Styles - Version 1.0.4

Version Description

Fix: Correctly set outer background color

Release Info

Developer	pdclark
Plugin	Styles
Version	1.0.4
Comparing to
See all releases

Code changes from version 0.5.3 to 1.0.4

Files changed (49) hide show

classes/edd-sl-plugin-updater.php +140 -0
classes/styles-admin.php +114 -0
classes/styles-child-theme.php +46 -0
classes/styles-child-updatable.php +195 -0
classes/styles-child.php +98 -0
classes/styles-control-background-color.php +66 -0
classes/styles-control-border-bottom-color.php +13 -0
classes/styles-control-border-color.php +29 -0
classes/styles-control-border-left-color.php +13 -0
classes/styles-control-border-right-color.php +13 -0
classes/styles-control-border-top-color.php +13 -0
classes/styles-control-color.php +64 -0
classes/styles-control-text.php +201 -0
classes/styles-control.php +170 -0
classes/styles-css.php +104 -0
classes/styles-customize.php +193 -0
classes/styles-helpers.php +108 -0
classes/styles-plugin.php +144 -0
css/styles-admin.css +1 -0
css/styles-customize.css +88 -0
js/PIE/PIE.htc +81 -81
js/PIE/PIE.js +73 -73
js/PIE/PIE.php +18 -18
js/PIE/PIE_uncompressed.htc +3713 -3713
js/PIE/PIE_uncompressed.js +3687 -3687
js/admin.js +432 -432
js/jq.gradientpicker.js +366 -366
js/jquery.ui.mouse.js +162 -162
js/jquery.ui.slider.js +666 -666
js/jquery.ui.slider.min.js +65 -65
js/jquery.ui.widget.js +268 -268
js/post-message-part-background-color.js +5 -0
js/post-message-part-border-color.js +5 -0
js/post-message-part-color.js +5 -0
js/post-message-part-text.js +5 -0
js/styles-customize-controls.js +44 -0
phpunit.php +40 -0
phpunit.xml +19 -0
readme.txt +135 -128
screenshot-1.png +0 -0
screenshot-2.png +0 -0
screenshot-3.png +0 -0
styles.php +49 -73
tests/bootstrap.php +13 -0
tests/styles/init.php +30 -0
tests/styles/tests-styles-customize.php +26 -0
tests/styles/tests-styles-plugin.php +16 -0
uninstall.php +35 -21
views/licenses.php +62 -0

classes/edd-sl-plugin-updater.php ADDED Viewed

	@@ -0,0 +1,140 @@


1	+ <?php
2	+
3	+ // uncomment this line for testing
4	+ //set_site_transient( 'update_plugins', null );
5	+
6	+ /**
7	+ * Allows plugins to use their own update API.
8	+ *
9	+ * @author Pippin Williamson
10	+ * @version 1.0
11	+ */
12	+ class EDD_SL_Plugin_Updater {
13	+ private $api_url = '';
14	+ private $api_data = array();
15	+ private $name = '';
16	+ private $slug = '';
17	+
18	+ /**
19	+ * Class constructor.
20	+ *
21	+ * @uses plugin_basename()
22	+ * @uses hook()
23	+ *
24	+ * @param string $_api_url The URL pointing to the custom API endpoint.
25	+ * @param string $_plugin_file Path to the plugin file.
26	+ * @param array $_api_data Optional data to send with API calls.
27	+ * @return void
28	+ */
29	+ function __construct( $_api_url, $_plugin_file, $_api_data = null ) {
30	+ $this->api_url = trailingslashit( $_api_url );
31	+ $this->api_data = urlencode_deep( $_api_data );
32	+ $this->name = plugin_basename( $_plugin_file );
33	+ $this->slug = basename( $_plugin_file, '.php');
34	+ $this->version = $_api_data['version'];
35	+
36	+ // Set up hooks.
37	+ $this->hook();
38	+ }
39	+
40	+ /**
41	+ * Set up Wordpress filters to hook into WP's update process.
42	+ *
43	+ * @uses add_filter()
44	+ *
45	+ * @return void
46	+ */
47	+ private function hook() {
48	+ add_filter( 'pre_set_site_transient_update_plugins', array( $this, 'pre_set_site_transient_update_plugins_filter' ) );
49	+ add_filter( 'plugins_api', array( $this, 'plugins_api_filter' ), 10, 3);
50	+ }
51	+
52	+ /**
53	+ * Check for Updates at the defined API endpoint and modify the update array.
54	+ *
55	+ * This function dives into the update api just when Wordpress creates its update array,
56	+ * then adds a custom API call and injects the custom plugin data retrieved from the API.
57	+ * It is reassembled from parts of the native Wordpress plugin update code.
58	+ * See wp-includes/update.php line 121 for the original wp_update_plugins() function.
59	+ *
60	+ * @uses api_request()
61	+ *
62	+ * @param array $_transient_data Update array build by Wordpress.
63	+ * @return array Modified update array with custom plugin data.
64	+ */
65	+ function pre_set_site_transient_update_plugins_filter( $_transient_data ) {
66	+
67	+
68	+ if( empty( $_transient_data ) ) return $_transient_data;
69	+
70	+ $to_send = array( 'slug' => $this->slug );
71	+
72	+ $api_response = $this->api_request( 'plugin_latest_version', $to_send );
73	+
74	+ if( false !== $api_response && is_object( $api_response ) ) {
75	+ if( version_compare( $this->version, $api_response->new_version, '<' ) )
76	+ $_transient_data->response[$this->name] = $api_response;
77	+ }
78	+ return $_transient_data;
79	+ }
80	+
81	+
82	+ /**
83	+ * Updates information on the "View version x.x details" page with custom data.
84	+ *
85	+ * @uses api_request()
86	+ *
87	+ * @param mixed $_data
88	+ * @param string $_action
89	+ * @param object $_args
90	+ * @return object $_data
91	+ */
92	+ function plugins_api_filter( $_data, $_action = '', $_args = null ) {
93	+ if ( ( $_action != 'plugin_information' ) \|\| !isset( $_args->slug ) \|\| ( $_args->slug != $this->slug ) ) return $_data;
94	+
95	+ $to_send = array( 'slug' => $this->slug );
96	+
97	+ $api_response = $this->api_request( 'plugin_information', $to_send );
98	+ if ( false !== $api_response ) $_data = $api_response;
99	+
100	+ return $_data;
101	+ }
102	+
103	+ /**
104	+ * Calls the API and, if successfull, returns the object delivered by the API.
105	+ *
106	+ * @uses get_bloginfo()
107	+ * @uses wp_remote_post()
108	+ * @uses is_wp_error()
109	+ *
110	+ * @param string $_action The requested action.
111	+ * @param array $_data Parameters for the API action.
112	+ * @return false\|\|object
113	+ */
114	+ private function api_request( $_action, $_data ) {
115	+
116	+ global $wp_version;
117	+
118	+ $data = array_merge( $this->api_data, $_data );
119	+ if( $data['slug'] != $this->slug )
120	+ return;
121	+
122	+ $api_params = array(
123	+ 'edd_action' => 'get_version',
124	+ 'license' => $data['license'],
125	+ 'name' => $data['item_name'],
126	+ 'slug' => $this->slug,
127	+ 'author' => $data['author']
128	+ );
129	+ $request = wp_remote_post( $this->api_url, array( 'timeout' => 15, 'sslverify' => false, 'body' => $api_params ) );
130	+
131	+ if ( !is_wp_error( $request ) ):
132	+ $request = json_decode( wp_remote_retrieve_body( $request ) );
133	+ if( $request )
134	+ $request->sections = maybe_unserialize( $request->sections );
135	+ return $request;
136	+ else:
137	+ return false;
138	+ endif;
139	+ }
140	+ }

classes/styles-admin.php ADDED Viewed

	@@ -0,0 +1,114 @@


1	+ <?php
2	+
3	+ class Styles_Admin {
4	+
5	+ /**
6	+ * @var Styles_Plugin
7	+ */
8	+ var $plugin;
9	+
10	+ /**
11	+ * Admin notices
12	+ */
13	+ var $notices = array();
14	+
15	+ var $default_themes = array(
16	+ 'twentyten',
17	+ 'twentyeleven',
18	+ 'twentytwelve',
19	+ 'twentythirteen',
20	+ );
21	+
22	+ /**
23	+ * @var Styles_License
24	+ */
25	+ var $license;
26	+
27	+ function __construct( $plugin ) {
28	+ $this->plugin = $plugin;
29	+
30	+ // Notices
31	+ add_action( 'admin_init', array( $this, 'install_default_themes_notice' ), 20 );
32	+ add_action( 'admin_init', array( $this, 'activate_notice' ), 30 );
33	+ add_action( 'admin_notices', array( $this, 'admin_notices' ) );
34	+
35	+ // Scripts
36	+ add_action( 'admin_enqueue_scripts', array( $this, 'admin_enqueue_scripts' ) );
37	+
38	+ // Plugin Meta
39	+ add_filter( 'plugin_row_meta', array( $this, 'plugin_row_meta' ), 10, 2 );
40	+
41	+ // License Menu
42	+ add_action( 'admin_menu', array( $this, 'license_menu' ) );
43	+ }
44	+
45	+ /**
46	+ * Enqueue admin stylesheet
47	+ */
48	+ public function admin_enqueue_scripts() {
49	+ wp_enqueue_style( 'storm-styles-admin', plugins_url('css/styles-admin.css', STYLES_BASENAME), array(), $this->plugin->version, 'all' );
50	+ }
51	+
52	+ public function plugin_row_meta( $meta, $basename ) {
53	+ if ( STYLES_BASENAME == $basename ) {
54	+ $meta[2] = str_replace( 'Visit plugin site', 'Get More Themes', $meta[2] );
55	+ $meta[] = '<a class="button button-primary" href="' . network_admin_url( 'customize.php' ) . '">Customize Theme</a>';
56	+ }
57	+ return $meta;
58	+ }
59	+
60	+ public function install_default_themes_notice() {
61	+ if ( !in_array( get_template(), $this->default_themes )
62	+ \|\| 'update.php' == basename( $_SERVER['PHP_SELF'] )
63	+ \|\| !current_user_can('install_plugins')
64	+ ) {
65	+ return false;
66	+ }
67	+
68	+ $slug = 'styles-' . get_template();
69	+
70	+ if ( !is_dir( WP_PLUGIN_DIR . '/' . $slug ) ) {
71	+ // Plugin not installed
72	+ $theme = wp_get_theme();
73	+ $url = wp_nonce_url( self_admin_url( 'update.php?action=install-plugin&plugin=' . $slug), 'install-plugin_' . $slug );
74	+ $this->notices[] = "<p>Styles is almost ready! To add theme options for <strong>{$theme->name}</strong>, please <a href='$url'>install Styles: {$theme->name}</a>.</p>";
75	+ return true;
76	+ }
77	+ }
78	+
79	+ /**
80	+ * If plugin for this theme is installed, but not activated, display notice.
81	+ */
82	+ public function activate_notice() {
83	+ $slug = 'styles-' . get_template();
84	+ $plugin_file = $slug . '/' . 'plugin.php';
85	+
86	+ if ( is_dir( WP_PLUGIN_DIR . '/' . $slug ) ) {
87	+ if ( is_plugin_inactive( $plugin_file ) ) {
88	+ $theme = wp_get_theme();
89	+ $url = wp_nonce_url(self_admin_url('plugins.php?action=activate&plugin=' . $plugin_file ), 'activate-plugin_' . $plugin_file );
90	+ $this->notices[] = "<p><strong>Styles: {$theme->name}</strong> is installed, but not active. Please <a href='$url'>activate Styles: {$theme->name}</a>.</p>";
91	+ }
92	+ }
93	+ }
94	+
95	+ public function admin_notices() {
96	+ foreach( $this->notices as $key => $message ) {
97	+ echo "<div class='updated fade' id='styles-$key'>$message</div>";
98	+ }
99	+ }
100	+
101	+ function license_menu() {
102	+ $plugins = apply_filters( 'styles_license_form_plugins', array() );
103	+
104	+ if ( !empty( $plugins ) ) {
105	+ add_plugins_page( 'Styles Licenses', 'Styles Licenses', 'manage_options', 'styles-license', array( $this, 'license_page' ) );
106	+ }
107	+ }
108	+
109	+ function license_page() {
110	+ require_once STYLES_DIR . '/views/licenses.php';
111	+ exit;
112	+ }
113	+
114	+ }

classes/styles-child-theme.php ADDED Viewed

	@@ -0,0 +1,46 @@


1	+ <?php
2	+
3	+ class Styles_Child_Theme extends Styles_Child_Updatable {
4	+
5	+ var $template;
6	+ var $styles_css;
7	+
8	+ public function __construct( $args ) {
9	+ parent::__construct( $args );
10	+
11	+ $this->template = str_replace( ' ', '-', strtolower( $this->item_name ) );
12	+ $this->styles_css = dirname( $this->plugin_file ) . '/style.css';
13	+
14	+ add_filter( 'styles_css_output', array( $this, 'styles_css_output' ) );
15	+ }
16	+
17	+ public function is_active() {
18	+ if ( Styles_Helpers::get_template() == $this->template ) {
19	+ return true;
20	+ }else {
21	+ return false;
22	+ }
23	+ }
24	+
25	+ public function get_json_path() {
26	+ if ( $this->is_active() ) {
27	+ $json_file = dirname( $this->plugin_file ) . '/customize.json';
28	+ return $json_file;
29	+ }else {
30	+ return false;
31	+ }
32	+
33	+ }
34	+
35	+ /**
36	+ * If styles.css exists in the plugin folder, prepend it to final CSS output
37	+ */
38	+ public function styles_css_output( $css ) {
39	+ if ( $this->is_active() && file_exists( $this->styles_css ) ) {
40	+ $css = file_get_contents( $this->styles_css ) . $css;
41	+ }
42	+
43	+ return $css;
44	+ }
45	+
46	+ }

classes/styles-child-updatable.php ADDED Viewed

	@@ -0,0 +1,195 @@


1	+ <?php
2	+
3	+ if ( !class_exists( 'EDD_SL_Plugin_Updater' ) ) {
4	+ require dirname( __FILE__ ) . '/edd-sl-plugin-updater.php';
5	+ }
6	+
7	+ /**
8	+ * Allow child plugins to update through WordPress updater
9	+ */
10	+ class Styles_Child_Updatable {
11	+
12	+ /**
13	+ * @var EDD_SL_Plugin_Updater
14	+ */
15	+ private $updater;
16	+ private $updates;
17	+ private $license_option_key;
18	+
19	+ var $plugin_file;
20	+ var $plugin_basename;
21	+ var $api_url;
22	+
23	+ var $default_args = array(
24	+ 'api_url' => 'http://store.stylesplugin.com',
25	+ );
26	+
27	+ public function __construct( $args ) {
28	+ $args = wp_parse_args( $args, $this->default_args );
29	+
30	+ $this->updates = !empty( $args['styles updates'] );
31	+ $this->license_option_key = dirname( $args['slug'] ) . '-' . 'license';
32	+ $this->plugin_file = WP_PLUGIN_DIR . '/' . $args['slug'];
33	+ $this->plugin_basename = $args[ 'slug' ];
34	+ $this->item_name = $this->maybe_guess_item_name( $args );
35	+ $this->api_url = $args['api_url'];
36	+ $this->name = $args['Name'];
37	+
38	+ $this->init_updater( $args );
39	+ }
40	+
41	+ public function maybe_guess_item_name( $args ) {
42	+ if ( !empty( $args['styles item'] ) ) {
43	+ return $args['styles item'];
44	+ }
45	+
46	+ return trim( str_replace( 'Styles:', '', $args['Title'] ) );
47	+ }
48	+
49	+ /**
50	+ * Initialize EDD Updater and licensing if updates are enabled
51	+ */
52	+ public function init_updater( $args ) {
53	+ if ( !$this->updates ) { return; }
54	+
55	+ // License activation hooks
56	+ add_action( 'plugin_action_links_' . $this->plugin_basename, array( $this, 'plugin_action_links' ), 10, 4 );
57	+ add_action( 'admin_init', array( $this, 'register_setting') );
58	+
59	+ add_action( 'admin_init', array( $this, 'activate_license') );
60	+ add_action( 'admin_init', array( $this, 'deactivate_license') );
61	+
62	+ add_filter( 'styles_license_form_plugins', array( $this, 'styles_license_form_plugins' ) );
63	+
64	+ // EDD Plugin Updater
65	+ $edd_api_data = array(
66	+ 'author' => $args['AuthorName'],
67	+ 'version' => $args['Version'],
68	+ 'license' => get_option( $this->license_option_key ),
69	+ 'item_name' => $this->item_name, // match EDD item post_title
70	+ );
71	+
72	+ $this->updater = new EDD_SL_Plugin_Updater( $args['api_url'], $this->plugin_file, $edd_api_data );
73	+
74	+ }
75	+
76	+ public function styles_license_form_plugins( $plugins ) {
77	+ $plugins[] = array(
78	+ 'name' => $this->name,
79	+ 'license_option_key' => $this->license_option_key,
80	+ );
81	+
82	+ return $plugins;
83	+ }
84	+
85	+ /**
86	+ * Add a license link to the plugin actions
87	+ * Skips free plugins
88	+ *
89	+ * @param $value
90	+ * @return array
91	+ */
92	+ function plugin_action_links( $actions, $plugin_file, $plugin_data, $context ) {
93	+ if ( !current_user_can( 'manage_options' ) ) { return $actions; }
94	+
95	+ $admin_url = admin_url( 'plugins.php?page=styles-license' );
96	+
97	+ $actions[ sizeof( $actions ) ] = '<a href="' . $admin_url . '" title="' . esc_html__( 'Styles Licenses', 'styles' ) . '">' . esc_html__( 'Licenses', 'styles' ) . '</a>';
98	+
99	+ return $actions;
100	+ }
101	+
102	+ /**
103	+ * Creates settings in options table
104	+ */
105	+ function register_setting() {
106	+ register_setting( 'styles_licenses', $this->license_option_key, array( $this, 'sanitize_license' ) );
107	+ }
108	+
109	+ function sanitize_license( $new ) {
110	+
111	+ $old = get_option( $this->license_option_key );
112	+
113	+ if( $old && $old != $new ) {
114	+ // new license has been entered, so must reactivate
115	+ delete_option( $option_key . '_status' );
116	+ }
117	+
118	+ return $new;
119	+ }
120	+
121	+ function activate_license() {
122	+
123	+ // listen for our activate button to be clicked
124	+ if( isset( $_POST['edd_license_activate'] ) ) {
125	+
126	+ // run a quick security check
127	+ if( ! check_admin_referer( 'edd_sample_nonce', 'edd_sample_nonce' ) )
128	+ return; // get out if we didn't click the Activate button
129	+
130	+ // retrieve the license from the database
131	+ $license = trim( get_option( $this->license_option_key ) );
132	+
133	+ // data to send in our API request
134	+ $api_params = array(
135	+ 'edd_action'=> 'activate_license',
136	+ 'license' => $license,
137	+ 'item_name' => urlencode( $this->item_name ) // the name of our product in EDD
138	+ );
139	+
140	+ // Call the custom API.
141	+ $response = wp_remote_get( add_query_arg( $api_params, $this->api_url ), array( 'timeout' => 15, 'sslverify' => false ) );
142	+
143	+ // make sure the response came back okay
144	+ if ( is_wp_error( $response ) )
145	+ return false;
146	+
147	+ // decode the license data
148	+ $license_data = json_decode( wp_remote_retrieve_body( $response ) );
149	+
150	+ // $license_data->license will be either "active" or "inactive"
151	+
152	+ update_option( $this->license_option_key . '_status', $license_data->license );
153	+
154	+ }
155	+ }
156	+
157	+ function deactivate_license() {
158	+
159	+ // listen for our activate button to be clicked
160	+ if( isset( $_POST['edd_license_deactivate'] ) ) {
161	+
162	+ // run a quick security check
163	+ if( ! check_admin_referer( 'edd_sample_nonce', 'edd_sample_nonce' ) )
164	+ return; // get out if we didn't click the Activate button
165	+
166	+ // retrieve the license from the database
167	+ $license = trim( get_option( $this->license_option_key ) );
168	+
169	+ // data to send in our API request
170	+ $api_params = array(
171	+ 'edd_action'=> 'deactivate_license',
172	+ 'license' => $license,
173	+ 'item_name' => urlencode( $this->item_name ) // the name of our product in EDD
174	+ );
175	+
176	+ // Call the custom API.
177	+ $response = wp_remote_get( add_query_arg( $api_params, $this->api_url ), array( 'timeout' => 15, 'sslverify' => false ) );
178	+
179	+ // make sure the response came back okay
180	+ if ( is_wp_error( $response ) ) {
181	+ return false;
182	+ }
183	+
184	+ // decode the license data
185	+ $license_data = json_decode( wp_remote_retrieve_body( $response ) );
186	+
187	+ // $license_data->license will be either "deactivated" or "failed"
188	+ if( $license_data->license == 'deactivated' ) {
189	+ delete_option( $this->license_option_key . '_status' );
190	+ }
191	+
192	+ }
193	+ }
194	+
195	+ }

classes/styles-child.php ADDED Viewed

	@@ -0,0 +1,98 @@


1	+ <?php
2	+
3	+ /**
4	+ * Detect and initialize plugins meant to extend Styles in common ways
5	+ * For example, add customize.json for a theme
6	+ */
7	+ class Styles_Child {
8	+
9	+ /**
10	+ * Styles_Plugin
11	+ */
12	+ var $plugin;
13	+
14	+ /**
15	+ * Array of plugin objects
16	+ * @var array
17	+ */
18	+ var $plugins = array();
19	+
20	+ public function __construct( $plugin ) {
21	+ $this->plugin = $plugin;
22	+
23	+ add_action( 'plugins_loaded', array( $this, 'plugins_loaded'), 20 );
24	+ add_filter( 'extra_plugin_headers', array( $this, 'extra_plugin_headers') );
25	+ add_action( 'update_option_active_plugins', array( $this, 'update_option_active_plugins' ) );
26	+
27	+ if ( defined( 'WP_DEBUG' ) && WP_DEBUG ) {
28	+ $this->update_option_active_plugins();
29	+ }
30	+ }
31	+
32	+ /**
33	+ * Additional headers
34	+ *
35	+ * @return array plugin header search terms
36	+ */
37	+ public function extra_plugin_headers() {
38	+ return array( 'styles class', 'styles item', 'styles updates' );
39	+ }
40	+
41	+ /**
42	+ * Build $this->plugins, a list of Styles child plugins based on plugin headers
43	+ *
44	+ * @return void
45	+ */
46	+ public function plugins_loaded( $plugins ) {
47	+ if ( !function_exists( 'is_plugin_active') ) {
48	+ include_once ABSPATH . 'wp-admin/includes/plugin.php';
49	+ }
50	+
51	+ foreach ( $this->get_plugins_meta() as $meta ) {
52	+
53	+ $class = $meta['styles class'];
54	+
55	+ if ( class_exists( $class ) && is_plugin_active( $meta['slug'] ) ) {
56	+ // For example,
57	+ // new Styles_Child_Theme( $meta )
58	+ $this->plugins[] = new $class( $meta );
59	+ }
60	+ }
61	+ }
62	+
63	+ public function get_plugins_meta() {
64	+ $child_plugins_meta = get_site_transient( 'styles_child_plugins' );
65	+
66	+ if ( false !== $child_plugins_meta ) {
67	+ return $child_plugins_meta;
68	+ }
69	+
70	+ if ( !function_exists( 'get_plugins') ) {
71	+ require_once ABSPATH . '/wp-admin/includes/plugin.php';
72	+ }
73	+
74	+ $child_plugins_meta = array();
75	+
76	+ foreach ( get_plugins() as $slug => $meta ) {
77	+ // Only include Styles child plugins with styles_class set in header
78	+ if ( empty( $meta['styles class'] ) ) { continue; }
79	+
80	+ $meta['slug'] = $slug;
81	+
82	+ $child_plugins_meta[] = $meta;
83	+ }
84	+
85	+ // Refresh plugin list and metadata every 6 hours (or on activate/deactivate)
86	+ set_site_transient( 'styles_child_plugins', $child_plugins_meta, 60606 );
87	+
88	+ return $child_plugins_meta;
89	+ }
90	+
91	+ /**
92	+ * Clear child plugins transient cache any time plugins are activated or deactivated.
93	+ */
94	+ public function update_option_active_plugins() {
95	+ delete_site_transient( 'styles_child_plugins' );
96	+ }
97	+
98	+ }

classes/styles-control-background-color.php ADDED Viewed

	@@ -0,0 +1,66 @@


1	+ <?php
2	+
3	+ class Styles_Control_Background_Color extends Styles_Control {
4	+ var $suffix = 'background color';
5	+ var $template = '$selector { background-color: $value; }';
6	+
7	+ public function __construct( $group, $element ) {
8	+ parent::__construct( $group, $element );
9	+ }
10	+
11	+ /**
12	+ * Register item with $wp_customize
13	+ */
14	+ public function add_item() {
15	+ global $wp_customize;
16	+
17	+ $args = array(
18	+ 'default' => $this->default,
19	+ 'type' => 'option',
20	+ 'capability' => 'edit_theme_options',
21	+ 'transport' => $this->get_transport(),
22	+ );
23	+
24	+ $wp_customize->add_setting( $this->setting, $args );
25	+
26	+ $wp_customize->add_control( new WP_Customize_Color_Control( $wp_customize, Styles_Helpers::get_control_id( $this->id ), array(
27	+ 'label' => __( $this->label, 'styles' ),
28	+ 'section' => $this->group,
29	+ 'settings' => $this->setting,
30	+ 'priority' => $this->priority . $this->group_priority,
31	+ ) ) );
32	+
33	+ }
34	+
35	+ /**
36	+ * Return CSS based on setting value
37	+ */
38	+ public function get_css(){
39	+ $value = $this->get_element_setting_value();
40	+
41	+ $css = '';
42	+ if ( $value ) {
43	+ $args = array(
44	+ 'template' => $this->template,
45	+ 'value' => $value,
46	+ );
47	+ $css = $this->apply_template( $args );
48	+ }
49	+
50	+ // Filter effects final CSS output, but not postMessage updates
51	+ return apply_filters( 'styles_css_background_color', $css );
52	+ }
53	+
54	+ public function post_message( $js ) {
55	+ $selector = str_replace( "'", "\'", $this->selector );
56	+
57	+ $js .= str_replace(
58	+ array( '@setting@', '@selector@' ),
59	+ array( $this->setting, $selector ),
60	+ file_get_contents( STYLES_DIR . '/js/post-message-part-background-color.js' )
61	+ );
62	+
63	+ return $js . PHP_EOL;
64	+ }
65	+
66	+ }

classes/styles-control-border-bottom-color.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ if ( !class_exists( 'Styles_Control_Border_Color' ) ) {
3	+ require_once dirname( __FILE__ ) . '/styles-control-border-color.php';
4	+ }
5	+
6	+ class Styles_Control_Border_Bottom_Color extends Styles_Control_Border_Color {
7	+ var $property = 'border-bottom-color';
8	+ var $suffix = 'bottom border color';
9	+
10	+ public function __construct( $group, $element ) {
11	+ parent::__construct( $group, $element );
12	+ }
13	+ }

classes/styles-control-border-color.php ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ <?php
2	+
3	+ if ( !class_exists( 'Styles_Control_Color' ) ) {
4	+ require_once dirname( __FILE__ ) . '/styles-control-color.php';
5	+ }
6	+
7	+ class Styles_Control_Border_Color extends Styles_Control_Color {
8	+ var $suffix = 'border color';
9	+ var $property = 'border-color';
10	+ var $template = '$selector { $property: $value; }';
11	+
12	+ public function __construct( $group, $element ) {
13	+ parent::__construct( $group, $element );
14	+
15	+ // Replace $property in $template for child classes
16	+ $this->template = str_replace( '$property', $this->property, $this->template );
17	+ }
18	+
19	+ public function post_message( $js ) {
20	+ $js .= str_replace(
21	+ array( '@setting@', '@selector@', '@property@' ),
22	+ array( $this->setting, $this->jquery_selector(), $this->property ),
23	+ file_get_contents( STYLES_DIR . '/js/post-message-part-border-color.js' )
24	+ );
25	+
26	+ return $js . PHP_EOL;
27	+ }
28	+
29	+ }

classes/styles-control-border-left-color.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ if ( !class_exists( 'Styles_Control_Border_Color' ) ) {
3	+ require_once dirname( __FILE__ ) . '/styles-control-border-color.php';
4	+ }
5	+
6	+ class Styles_Control_Border_Left_Color extends Styles_Control_Border_Color {
7	+ var $property = 'border-left-color';
8	+ var $suffix = 'left border color';
9	+
10	+ public function __construct( $group, $element ) {
11	+ parent::__construct( $group, $element );
12	+ }
13	+ }

classes/styles-control-border-right-color.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ if ( !class_exists( 'Styles_Control_Border_Color' ) ) {
3	+ require_once dirname( __FILE__ ) . '/styles-control-border-color.php';
4	+ }
5	+
6	+ class Styles_Control_Border_Right_Color extends Styles_Control_Border_Color {
7	+ var $property = 'border-right-color';
8	+ var $suffix = 'right border color';
9	+
10	+ public function __construct( $group, $element ) {
11	+ parent::__construct( $group, $element );
12	+ }
13	+ }

classes/styles-control-border-top-color.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ if ( !class_exists( 'Styles_Control_Border_Color' ) ) {
3	+ require_once dirname( __FILE__ ) . '/styles-control-border-color.php';
4	+ }
5	+
6	+ class Styles_Control_Border_Top_Color extends Styles_Control_Border_Color {
7	+ var $property = 'border-top-color';
8	+ var $suffix = 'top border color';
9	+
10	+ public function __construct( $group, $element ) {
11	+ parent::__construct( $group, $element );
12	+ }
13	+ }

classes/styles-control-color.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ class Styles_Control_Color extends Styles_Control {
4	+ var $suffix = 'color';
5	+ var $template = '$selector { color: $value; }';
6	+
7	+ public function __construct( $group, $element ) {
8	+ parent::__construct( $group, $element );
9	+ }
10	+
11	+ /**
12	+ * Register item with $wp_customize
13	+ */
14	+ public function add_item() {
15	+ global $wp_customize;
16	+
17	+ $args = array(
18	+ 'default' => $this->default,
19	+ 'type' => 'option',
20	+ 'capability' => 'edit_theme_options',
21	+ 'transport' => $this->get_transport(),
22	+ );
23	+
24	+ $wp_customize->add_setting( $this->setting, $args );
25	+
26	+ $wp_customize->add_control( new WP_Customize_Color_Control( $wp_customize, Styles_Helpers::get_control_id( $this->id ), array(
27	+ 'label' => __( $this->label, 'styles' ),
28	+ 'section' => $this->group,
29	+ 'settings' => $this->setting,
30	+ 'priority' => $this->priority . $this->group_priority,
31	+ ) ) );
32	+ }
33	+
34	+ /**
35	+ * Return CSS based on setting value
36	+ */
37	+ public function get_css(){
38	+ $selector = $this->selector;
39	+ $value = $this->get_element_setting_value();
40	+
41	+ $css = '';
42	+ if ( $value ) {
43	+ $args = array(
44	+ 'template' => $this->template,
45	+ 'value' => $value,
46	+ );
47	+ $css = $this->apply_template( $args );
48	+ }
49	+
50	+ // Filter effects final CSS output, but not postMessage updates
51	+ return apply_filters( 'styles_css_color', $css );
52	+ }
53	+
54	+ public function post_message( $js ) {
55	+ $js .= str_replace(
56	+ array( '@setting@', '@selector@' ),
57	+ array( $this->setting, $this->jquery_selector() ),
58	+ file_get_contents( STYLES_DIR . '/js/post-message-part-color.js' )
59	+ );
60	+
61	+ return $js . PHP_EOL;
62	+ }
63	+
64	+ }

classes/styles-control-text.php ADDED Viewed

	@@ -0,0 +1,201 @@


1	+ <?php
2	+
3	+ class Styles_Control_Text extends Styles_Control {
4	+ var $suffix = 'text';
5	+
6	+ // CSS Templates
7	+ var $template = '$selector { $value }';
8	+ var $template_font_size = 'font-size: $valuepx;';
9	+ var $template_font_family = 'font-family: $value;';
10	+
11	+ static $families = array( 'Arial' => 'Arial, Helvetica, sans-serif', 'Bookman' => 'Bookman, Palatino, Georgia, serif', 'Century Gothic' => '"Century Gothic", Helvetica, Arial, sans-serif', 'Comic Sans MS' => '"Comic Sans MS", Arial, sans-serif', 'Courier' => 'Courier, monospace', 'Garamond' => 'Garamond, Palatino, Georgia, serif', 'Georgia' => 'Georgia, Times, serif', 'Helvetica' => 'Helvetica, Arial, sans-serif', 'Lucida Grande' => '"Lucida Grande","Lucida Sans Unicode",Tahoma,Verdana,sans-serif', 'Palatino' => 'Palatino, Georgia, serif', 'Tahoma' => 'Tahoma, Verdana, Helvetica, sans-serif', 'Times' => 'Times, Georgia, serif', 'Trebuchet MS' => '"Trebuchet MS", Tahoma, Helvetica, sans-serif', 'Verdana' => 'Verdana, Tahoma, sans-serif', );
12	+ static $google_families = array( 'Abel' => 'Abel', 'Aclonica' => 'Aclonica', 'Actor' => 'Actor', 'Allan' => 'Allan:bold', 'Allerta' => 'Allerta', 'Allerta Stencil' => 'Allerta+Stencil', 'Amaranth' => 'Amaranth:700,400,italic700,italic400', 'Andika' => 'Andika', 'Angkor' => 'Angkor', 'Annie Use Your Telescope' => 'Annie+Use+Your+Telescope', 'Anonymous Pro' => 'Anonymous+Pro:bold,italicbold,normal,italic', 'Anton' => 'Anton', 'Architects Daughter' => 'Architects+Daughter', 'Arimo' => 'Arimo:italicbold,bold,normal,italic', 'Artifika' => 'Artifika', 'Arvo' => 'Arvo:italic,bold,italicbold,normal', 'Asset' => 'Asset', 'Astloch' => 'Astloch:normal,bold', 'Aubrey' => 'Aubrey', 'Bangers' => 'Bangers', 'Battambang' => 'Battambang:bold,normal', 'Bayon' => 'Bayon', 'Bentham' => 'Bentham', 'Bevan' => 'Bevan', 'Bigshot One' => 'Bigshot+One', 'Black Ops One' => 'Black+Ops+One', 'Bokor' => 'Bokor', 'Bowlby One' => 'Bowlby+One', 'Bowlby One SC' => 'Bowlby+One+SC', 'Brawler' => 'Brawler', 'Buda' => 'Buda:300', 'Cabin' => 'Cabin:italic600,500,italicbold,italic500,italic400,400,600,bold', 'Cabin Sketch' => 'Cabin+Sketch:bold', 'Calligraffitti' => 'Calligraffitti', 'Candal' => 'Candal', 'Cantarell' => 'Cantarell:italic,bold,italicbold,normal', 'Cardo' => 'Cardo', 'Carme' => 'Carme', 'Carter One' => 'Carter+One', 'Caudex' => 'Caudex:italic,italic700,400,700', 'Cedarville Cursive' => 'Cedarville+Cursive', 'Chenla' => 'Chenla', 'Cherry Cream Soda' => 'Cherry+Cream+Soda', 'Chewy' => 'Chewy', 'Coda' => 'Coda:800', 'Coda Caption' => 'Coda+Caption:800', 'Coming Soon' => 'Coming+Soon', 'Content' => 'Content:bold,normal', 'Copse' => 'Copse', 'Corben' => 'Corben:700', 'Comfortaa' => 'Comfortaa', 'Cousine' => 'Cousine:italic,normal,italicbold,bold', 'Covered By Your Grace' => 'Covered+By+Your+Grace', 'Crafty Girls' => 'Crafty+Girls', 'Crimson Text' => 'Crimson+Text:700,italic400,400,italic600,italic700,600', 'Crushed' => 'Crushed', 'Cuprum' => 'Cuprum', 'Damion' => 'Damion', 'Dancing Script' => 'Dancing+Script:bold,normal', 'Dangrek' => 'Dangrek', 'Dawning of a New Day' => 'Dawning+of+a+New+Day', 'Delius' => 'Delius:400', 'Delius Swash Caps' => 'Delius+Swash+Caps:400', 'Delius Unicase' => 'Delius+Unicase:400', 'Didact Gothic' => 'Didact+Gothic', 'Droid Arabic Kufi' => 'Droid+Arabic+Kufi:bold,normal', 'Droid Arabic Naskh' => 'Droid+Arabic+Naskh:normal,bold', 'Droid Sans' => 'Droid+Sans:bold,normal', 'Droid Sans Mono' => 'Droid+Sans+Mono', 'Droid Sans Thai' => 'Droid+Sans+Thai:bold,normal', 'Droid Serif' => 'Droid+Serif:bold,normal,italicbold,italic', 'Droid Serif Thai' => 'Droid+Serif+Thai:bold,normal', 'EB Garamond' => 'EB+Garamond', 'Expletus Sans' => 'Expletus+Sans:500,italic600,600,italic400,italic700,700,400,italic500', 'Federo' => 'Federo', 'Fontdiner Swanky' => 'Fontdiner+Swanky', 'Forum' => 'Forum', 'Francois One' => 'Francois+One', 'Freehand' => 'Freehand', 'GFS Didot' => 'GFS+Didot', 'GFS Neohellenic' => 'GFS+Neohellenic:italic,italicbold,normal,bold', 'Gentium Basic' => 'Gentium+Basic:italicbold,bold,normal,italic', 'Geo' => 'Geo:normal,oblique', 'Geostar' => 'Geostar', 'Geostar Fill' => 'Geostar+Fill', 'Give You Glory' => 'Give+You+Glory', 'Gloria Hallelujah' => 'Gloria+Hallelujah', 'Goblin One' => 'Goblin+One', 'Goudy Bookletter 1911' => 'Goudy+Bookletter+1911', 'Gravitas One' => 'Gravitas+One', 'Gruppo' => 'Gruppo', 'Hammersmith One' => 'Hammersmith+One', 'Hanuman' => 'Hanuman:normal,bold', 'Holtwood One SC' => 'Holtwood+One+SC', 'Homemade Apple' => 'Homemade+Apple', 'IM Fell DW Pica' => 'IM+Fell+DW+Pica:italic,normal', 'IM Fell DW Pica SC' => 'IM+Fell+DW+Pica+SC', 'IM Fell Double Pica' => 'IM+Fell+Double+Pica:normal,italic', 'IM Fell Double Pica SC' => 'IM+Fell+Double+Pica+SC', 'IM Fell English' => 'IM+Fell+English:italic,normal', 'IM Fell English SC' => 'IM+Fell+English+SC', 'IM Fell French Canon' => 'IM+Fell+French+Canon:italic,normal', 'IM Fell French Canon SC' => 'IM+Fell+French+Canon+SC', 'IM Fell Great Primer' => 'IM+Fell+Great+Primer:italic,normal', 'IM Fell Great Primer SC' => 'IM+Fell+Great+Primer+SC', 'Inconsolata' => 'Inconsolata', 'Indie Flower' => 'Indie+Flower', 'Irish Grover' => 'Irish+Grover', 'Irish Growler' => 'Irish+Growler', 'Istok Web' => 'Istok+Web:italic700,400,700,italic400', 'Josefin Sans' => 'Josefin+Sans:italic600,italic100,600,italic400,700,italic700,100,italic300,400,300', 'Josefin Sans Std Light' => 'Josefin+Sans+Std+Light', 'Josefin Slab' => 'Josefin+Slab:100,italic600,700,italic400,600,italic100,italic300,300,400,italic700', 'Judson' => 'Judson:700,italic400,400', 'Jura' => 'Jura:400,500,600,300', 'Just Another Hand' => 'Just+Another+Hand', 'Just Me Again Down Here' => 'Just+Me+Again+Down+Here', 'Kameron' => 'Kameron:400,700', 'Kelly Slab' => 'Kelly+Slab', 'Kenia' => 'Kenia', 'Khmer' => 'Khmer', 'Koulen' => 'Koulen', 'Kranky' => 'Kranky', 'Kreon' => 'Kreon:700,400,300', 'Kristi' => 'Kristi', 'La Belle Aurore' => 'La+Belle+Aurore', 'Lato' => 'Lato:italic300,300,900,700,italic100,100,italic700,400,italic900,italic400', 'League Script' => 'League+Script:400', 'Leckerli One' => 'Leckerli+One', 'Lekton' => 'Lekton:italic,400,700', 'Limelight' => 'Limelight', 'Lobster' => 'Lobster', 'Lobster Two' => 'Lobster+Two:italic400,700,400,italic700', 'Lora' => 'Lora:italic,normal,bold,italicbold', 'Love Ya Like A Sister' => 'Love+Ya+Like+A+Sister', 'Loved by the King' => 'Loved+by+the+King', 'Luckiest Guy' => 'Luckiest+Guy', 'Maiden Orange' => 'Maiden+Orange', 'Mako' => 'Mako', 'Marvel' => 'Marvel:400,700,italic700,italic400', 'Maven Pro' => 'Maven+Pro:700,900,500,400', 'Meddon' => 'Meddon', 'MedievalSharp' => 'MedievalSharp', 'Megrim' => 'Megrim', 'Merriweather' => 'Merriweather:700,900,400,300', 'Metal' => 'Metal', 'Metrophobic' => 'Metrophobic', 'Miama' => 'Miama', 'Michroma' => 'Michroma', 'Miltonian' => 'Miltonian', 'Miltonian Tattoo' => 'Miltonian+Tattoo', 'Modern Antiqua' => 'Modern+Antiqua', 'Molengo' => 'Molengo', 'Monofett' => 'Monofett', 'Moul' => 'Moul', 'Moulpali' => 'Moulpali', 'Mountains of Christmas' => 'Mountains+of+Christmas', 'Muli' => 'Muli:italic400,400,italic300,300', 'Nanum Brush Script' => 'Nanum+Brush+Script', 'Nanum Gothic' => 'Nanum+Gothic:800,700,normal', 'Nanum Gothic Coding' => 'Nanum+Gothic+Coding:normal,700', 'Nanum Myeongjo' => 'Nanum+Myeongjo:700,normal,800', 'Nanum Pen Script' => 'Nanum+Pen+Script', 'Neucha' => 'Neucha', 'Neuton' => 'Neuton:italic,normal', 'Neuton Cursive' => 'Neuton+Cursive', 'News Cycle' => 'News+Cycle', 'Nixie One' => 'Nixie+One', 'Nobile' => 'Nobile:700,italic500,400,italic700,500,italic400', 'Nothing You Could Do' => 'Nothing+You+Could+Do', 'Nova Cut' => 'Nova+Cut', 'Nova Flat' => 'Nova+Flat', 'Nova Mono' => 'Nova+Mono', 'Nova Oval' => 'Nova+Oval', 'Nova Round' => 'Nova+Round', 'Nova Script' => 'Nova+Script', 'Nova Slim' => 'Nova+Slim', 'Nova Square' => 'Nova+Square', 'Nunito' => 'Nunito:700,300,400', 'OFL Sorts Mill Goudy TT' => 'OFL+Sorts+Mill+Goudy+TT:italic,normal', 'OFL Sorts Mill Goudy TT' => 'OFL+Sorts+Mill+Goudy+TT:italic,normal', 'Odor Mean Chey' => 'Odor+Mean+Chey', 'Old Standard TT' => 'Old+Standard+TT:italic,bold,normal', 'Open Sans' => 'Open+Sans:italic300,italic800,600,300,italic400,italic600,italic700,700,800,400', 'Open Sans Condensed' => 'Open+Sans+Condensed:italic300,300', 'Orbitron' => 'Orbitron:500,900,400,700', 'Oswald' => 'Oswald', 'Over the Rainbow' => 'Over+the+Rainbow', 'Ovo' => 'Ovo', 'PT Sans' => 'PT+Sans:italic,bold,normal,italicbold', 'PT Sans Caption' => 'PT+Sans+Caption:normal,bold', 'PT Sans Narrow' => 'PT+Sans+Narrow:normal,bold', 'PT Serif' => 'PT+Serif:italic,normal,bold,italicbold', 'PT Serif Caption' => 'PT+Serif+Caption:normal,italic', 'Pacifico' => 'Pacifico', 'Patrick Hand' => 'Patrick+Hand', 'Paytone One' => 'Paytone+One', 'Pecita' => 'Pecita', 'Permanent Marker' => 'Permanent+Marker', 'Philosopher' => 'Philosopher:bold,normal,italic,italicbold', 'Play' => 'Play:bold,normal', 'Playfair Display' => 'Playfair+Display', 'Podkova' => 'Podkova', 'Pompiere' => 'Pompiere', 'Preahvihear' => 'Preahvihear', 'Puritan' => 'Puritan:bold,italic,italicbold,normal', 'Quattrocento' => 'Quattrocento', 'Quattrocento Sans' => 'Quattrocento+Sans', 'Radley' => 'Radley', 'Raleway' => 'Raleway:100', 'Rationale' => 'Rationale', 'Redressed' => 'Redressed', 'Reenie Beanie' => 'Reenie+Beanie', 'Rochester' => 'Rochester', 'Rock Salt' => 'Rock+Salt', 'Rokkitt' => 'Rokkitt:700,400', 'Rosario' => 'Rosario', 'Ruslan Display' => 'Ruslan+Display', 'Schoolbell' => 'Schoolbell', 'Shadows Into Light' => 'Shadows+Into+Light', 'Shanti' => 'Shanti', 'Siamreap' => 'Siamreap', 'Siemreap' => 'Siemreap', 'Sigmar One' => 'Sigmar+One', 'Six Caps' => 'Six+Caps', 'Slackey' => 'Slackey', 'Smokum' => 'Smokum', 'Smythe' => 'Smythe', 'Sniglet' => 'Sniglet:800', 'Snippet' => 'Snippet', 'Special Elite' => 'Special+Elite', 'Stardos Stencil' => 'Stardos+Stencil:normal,bold', 'Sue Ellen Francisco' => 'Sue+Ellen+Francisco', 'Sunshiney' => 'Sunshiney', 'Suwannaphum' => 'Suwannaphum', 'Swanky and Moo Moo' => 'Swanky+and+Moo+Moo', 'Syncopate' => 'Syncopate:normal,bold', 'Tangerine' => 'Tangerine:normal,bold', 'Taprom' => 'Taprom', 'Tenor Sans' => 'Tenor+Sans', 'Terminal Dosis Light' => 'Terminal+Dosis+Light', 'Thabit' => 'Thabit:italic,italicbold,normal,bold', 'The Girl Next Door' => 'The+Girl+Next+Door', 'Tienne' => 'Tienne:400,900,700', 'Tinos' => 'Tinos:italicbold,normal,italic,bold', 'Tulpen One' => 'Tulpen+One', 'Ubuntu' => 'Ubuntu:bold,300,normal,italicbold,italic,italic500,500,italic300', 'Ultra' => 'Ultra', 'UnifrakturCook' => 'UnifrakturCook:bold', 'UnifrakturMaguntia' => 'UnifrakturMaguntia', 'Unkempt' => 'Unkempt', 'Unna' => 'Unna', 'VT323' => 'VT323', 'Varela' => 'Varela', 'Varela Round' => 'Varela+Round', 'Vibur' => 'Vibur', 'Vollkorn' => 'Vollkorn:bold,italic,italicbold,normal', 'Waiting for the Sunrise' => 'Waiting+for+the+Sunrise', 'Wallpoet' => 'Wallpoet', 'Walter Turncoat' => 'Walter+Turncoat', 'Wire One' => 'Wire+One', 'Yanone Kaffeesatz' => 'Yanone+Kaffeesatz:700,200,400,300', 'Yellowtail' => 'Yellowtail', 'Yeseva One' => 'Yeseva+One', 'Zeyada' => 'Zeyada', /'jsMath cmbx10' => 'jsMath+cmbx10', 'jsMath cmex10' => 'jsMath+cmex10', 'jsMath cmmi10' => 'jsMath+cmmi10', 'jsMath cmr10' => 'jsMath+cmr10', 'jsMath cmsy10' => 'jsMath+cmsy10', 'jsMath cmti10' => 'jsMath+cmti10',/ );
13	+
14	+ public function __construct( $group, $element ) {
15	+ parent::__construct( $group, $element );
16	+
17	+ if ( !empty( $element['template_font_size'] ) ) {
18	+ $this->template_font_size = $element['template_font_size'];
19	+ }
20	+
21	+ if ( !empty( $element['template_font_family'] ) ) {
22	+ $this->template_font_family = $element['template_font_family'];
23	+ }
24	+
25	+ }
26	+
27	+ /**
28	+ * Register item with $wp_customize
29	+ */
30	+ public function add_item() {
31	+ global $wp_customize;
32	+
33	+ $args_size = array(
34	+ 'default' => $this->default,
35	+ 'type' => 'option',
36	+ 'capability' => 'edit_theme_options',
37	+ 'transport' => $this->get_transport(),
38	+ );
39	+
40	+ $args_family = array(
41	+ 'default' => $this->default,
42	+ 'type' => 'option',
43	+ 'capability' => 'edit_theme_options',
44	+ );
45	+
46	+ $wp_customize->add_setting( $this->setting.'[font_size]', $args_size );
47	+ $wp_customize->add_setting( $this->setting.'[font_family]', $args_family );
48	+
49	+ $wp_customize->add_control( new Styles_Customize_Text_Control( $wp_customize, Styles_Helpers::get_control_id( $this->id ), array(
50	+ 'label' => __( $this->label, 'styles' ),
51	+ 'section' => $this->group,
52	+ 'settings' => array(
53	+ 'font_size' => $this->setting.'[font_size]',
54	+ 'font_family' => $this->setting.'[font_family]',
55	+ ),
56	+ 'priority' => $this->priority . $this->group_priority,
57	+ ) ) );
58	+ }
59	+
60	+ /**
61	+ * Return CSS based on setting value
62	+ *
63	+ * @return string
64	+ */
65	+ public function get_css(){
66	+ $value = $this->get_element_setting_value();
67	+
68	+ $css = $this->get_css_font_size( $value );
69	+ $css .= $this->get_css_font_family( $value );
70	+
71	+ if ( !empty( $css ) ) {
72	+ $args = array(
73	+ 'template' => $this->template,
74	+ 'value' => $css,
75	+ );
76	+ $css = $this->apply_template( $args );
77	+ }
78	+
79	+ // Filter effects final CSS output, but not postMessage updates
80	+ return apply_filters( 'styles_css_text', $css );
81	+ }
82	+
83	+ public function get_css_font_size( $value ) {
84	+ if ( is_array( $value ) ) { $value = $value['font_size']; }
85	+
86	+ $css = '';
87	+ if ( $value ) {
88	+ $args = array(
89	+ 'template' => $this->template_font_size,
90	+ 'value' => $value,
91	+ );
92	+ $css = $this->apply_template( $args );
93	+ }
94	+
95	+ // Filter effects final CSS output, but not postMessage updates
96	+ return apply_filters( 'styles_css_font_size', $css );
97	+ }
98	+
99	+ public function get_css_font_family( $value = false ) {
100	+ if ( !$value ) { return ''; }
101	+ if ( is_array( $value ) ) { $value = $value['font_family']; }
102	+
103	+ if ( array_key_exists( $value, self::$families ) ) {
104	+
105	+ // Standard Font families. Convert values to stacks.
106	+ $value = self::$families[ $value ];
107	+
108	+ }else if ( array_key_exists( $value, self::$google_families ) ) {
109	+
110	+ // Google Font families
111	+ global $storm_styles;
112	+ $src = self::$google_families[ $value ];
113	+ // Add Google Font @import to beginning of CSS
114	+ $storm_styles->css->google_fonts[ $value ] = "@import url(//fonts.googleapis.com/css?family=$src);\r";
115	+
116	+ }
117	+
118	+ $css = '';
119	+ if ( $value ) {
120	+ $args = array(
121	+ 'template' => $this->template_font_family,
122	+ 'value' => $value,
123	+ );
124	+ $css = $this->apply_template( $args );
125	+ }
126	+
127	+ // Filter effects final CSS output, but not postMessage updates
128	+ return apply_filters( 'styles_css_font_family', $css );
129	+ }
130	+
131	+ public function post_message( $js ) {
132	+ $setting_font_size = $this->setting . '[font_size]';
133	+ $selector = str_replace( "'", "\'", $this->selector );
134	+
135	+ $js .= str_replace(
136	+ array( '@setting_font_size@', '@selector@' ),
137	+ array( $setting_font_size, $selector ),
138	+ file_get_contents( STYLES_DIR . '/js/post-message-part-text.js' )
139	+ );
140	+
141	+ return $js . PHP_EOL;
142	+ }
143	+
144	+ }
145	+
146	+ if (class_exists('WP_Customize_Control')) :
147	+
148	+ class Styles_Customize_Text_Control extends WP_Customize_Control {
149	+ public $type = 'text_formatting';
150	+
151	+ public function render_content() {
152	+ ?>
153	+ <span class="customize-control-title"><?php echo esc_html( $this->label ); ?></span>
154	+ <?php
155	+ $this->font_size();
156	+ $this->font_family();
157	+ }
158	+
159	+ public function font_size() {
160	+ $saved_value = $this->value( 'font_size' );
161	+
162	+ ?>
163	+ <label>
164	+ <input type="text" placeholder="Size" value="<?php echo esc_attr( $saved_value ); ?>" <?php $this->link( 'font_size' ); ?> class="styles-font-size"/> px
165	+ </label>
166	+ <?php
167	+ }
168	+
169	+ public function font_family() {
170	+ $saved_value = $this->value( 'font_family' );
171	+
172	+ foreach ( Styles_Control_Text::$families as $name => $value ) {
173	+ if ( empty( $value ) ) continue;
174	+ $fonts[esc_attr( $name )] = $name;
175	+ }
176	+
177	+ foreach ( Styles_Control_Text::$google_families as $name => $value ) {
178	+ if ( empty( $value ) ) continue;
179	+ $fonts[esc_attr( $name )] = $name;
180	+ }
181	+
182	+ ?>
183	+
184	+ <label>
185	+ <select <?php $this->link( 'font_family' ); ?> class="styles-font-family" data-selected="<?php echo $saved_value ?>">
186	+ <option class="label first" value="">Select Font</option>
187	+
188	+ <option class="label" value="">Standard Fonts</option>
189	+ <?php foreach ( Styles_Control_Text::$families as $name => $value ) : if ( empty( $value ) ) continue; ?>
190	+ <option value='<?php esc_attr_e( $name ) ?>' <?php selected( $name, $saved_value ) ?> ><?php echo $name ?></option>
191	+ <?php endforeach; ?>
192	+
193	+ <option class="label" value="">Google Fonts</option>
194	+ <?php // Google fonts populated by styles-customize.js to save bandwidth ?>
195	+ </select>
196	+ </label>
197	+ <?php
198	+ }
199	+ }
200	+
201	+ endif;

classes/styles-control.php ADDED Viewed

	@@ -0,0 +1,170 @@


1	+ <?php
2	+
3	+ abstract class Styles_Control {
4	+
5	+ var $group_priority = 1;
6	+
7	+ /**
8	+ * Default setting value
9	+ */
10	+ var $default = '';
11	+
12	+ // From $element
13	+ var $selector;
14	+ var $type;
15	+ var $label;
16	+ var $priority;
17	+ var $id;
18	+ var $setting;
19	+
20	+ /**
21	+ * Template CSS for $selector and $value to be filled into
22	+ *
23	+ * @var string
24	+ **/
25	+ public $template;
26	+
27	+ public function __construct( $group, $element ) {
28	+ $this->group = $group;
29	+ $this->element = $element;
30	+
31	+ if ( !empty( $element['template'] ) ) {
32	+ $this->template = $element['template'];
33	+ }
34	+
35	+ if ( empty( $this->label) ) {
36	+ $this->label = $this->selector;
37	+ }
38	+
39	+ $this->selector = $element['selector'];
40	+ $this->type = $element['type'];
41	+ $this->label = @ $element['label'];
42	+ $this->priority = @ $element['priority'];
43	+
44	+ $this->append_suffix_to_label();
45	+
46	+ $this->id = $this->get_element_id(); // must call append_suffix_to_label first
47	+ $this->setting = $this->get_setting_id(); // must call append_suffix_to_label first
48	+
49	+ if ( empty( $this->selector ) ) { return false; }
50	+
51	+ // postMessage javascript callback
52	+ if ( 'postMessage' == $this->get_transport() ) {
53	+ add_filter( 'styles_customize_preview', array( $this, 'post_message' ) );
54	+ }
55	+
56	+ }
57	+
58	+ /**
59	+ * Register control and setting with $wp_customize
60	+ * @return null
61	+ */
62	+ abstract public function add_item();
63	+
64	+ public function append_suffix_to_label() {
65	+ if ( !empty( $this->element['suffix'] ) ) {
66	+
67	+ // A custom suffix has been set in the JSON
68	+ $this->suffix = $element['suffix'];
69	+
70	+ }else if ( !empty( $this->suffix ) ){
71	+
72	+ // No custom suffix set
73	+
74	+ // Add indications for pseudo-selectors
75	+ if ( false !== strpos( $this->selector, ':hover' ) ) {
76	+
77	+ // Prepend "hover" if in selector
78	+ $this->suffix = 'hover ' . $this->suffix;
79	+
80	+ }else if ( false !== strpos( $this->selector, ':focus' ) ) {
81	+
82	+ // Prepend "focus" if in selector
83	+ $this->suffix = 'focused ' . $this->suffix;
84	+
85	+ }
86	+
87	+ }
88	+
89	+ // We have some suffix; append it to the label
90	+ if ( !empty( $this->suffix ) ) {
91	+ $this->label .= '::' . $this->suffix;
92	+ }
93	+
94	+ }
95	+
96	+ /**
97	+ * @param array $element Values related to this control, like CSS selector and control type
98	+ * @return string Unique, sanatized ID for this element based on label and type
99	+ */
100	+ public function get_element_id() {
101	+ $key = trim( sanitize_key( $this->label . '_' . $this->type ), '_' );
102	+ return str_replace( '-', '_', $key );
103	+ }
104	+
105	+ /**
106	+ * @param string $group Name of Customizer group this element is in
107	+ * @param string $id unique element ID
108	+ * @return string $setting_id unique setting ID for use in form input names
109	+ */
110	+ public function get_setting_id() {
111	+ $group = $this->group;
112	+ $id = str_replace( '-', '_', trim( $this->id, '_' ) );
113	+
114	+ $setting_id = Styles_Helpers::get_option_key() . "[$group][$id]";
115	+
116	+ return $setting_id;
117	+ }
118	+
119	+ public function get_element_setting_value() {
120	+ $settings = get_option( Styles_Helpers::get_option_key() );
121	+
122	+ $group_id = Styles_Helpers::get_group_id( $this->group );
123	+
124	+ $value = @$settings[ $group_id ][ $this->id ];
125	+
126	+ if ( !empty( $value ) ) {
127	+ return $value;
128	+ }else {
129	+ return false;
130	+ }
131	+ }
132	+
133	+ public function get_transport() {
134	+ $transport = 'refresh';
135	+
136	+ if (
137	+ method_exists( $this, 'post_message' )
138	+ && empty( $this->element['template'] ) // No custom CSS template set
139	+ && false == strpos( $this->selector, ':' ) // jQuery doesn't understand pseudo-selectors like :hover and :focus
140	+ ) {
141	+ // postMessage supported
142	+ $transport = 'postMessage';
143	+ }
144	+
145	+ return $transport;
146	+ }
147	+
148	+ public function apply_template( $args ) {
149	+ $template = $args['template'];
150	+ unset( $args['template'] );
151	+
152	+ foreach ( $args as $key => $value ) {
153	+ $template = str_replace( '$'.$key, $value, $template );
154	+ }
155	+
156	+ $template = str_replace( '$selector', $this->selector, $template );
157	+
158	+ return $template;
159	+ }
160	+
161	+ /**
162	+ * Convert CSS selector into jQuery-compatible selector
163	+ */
164	+ public function jquery_selector() {
165	+ $selector = str_replace( "'", "\'", $this->selector );
166	+
167	+ return $selector;
168	+ }
169	+
170	+ }

classes/styles-css.php ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ <?php
2	+
3	+ class Styles_CSS {
4	+
5	+ /**
6	+ * @var Styles_Plugin
7	+ */
8	+ var $plugin;
9	+
10	+ /**
11	+ * Class added to body and all selectors
12	+ *
13	+ * @var string
14	+ */
15	+ var $body_class = 'styles';
16	+
17	+ /**
18	+ * @import declarations to be added to top of CSS
19	+ *
20	+ * @var string
21	+ */
22	+ public $google_fonts = array();
23	+
24	+ function __construct( $plugin ) {
25	+ $this->plugin = $plugin;
26	+
27	+ add_filter( 'styles_pre_get_css', array( $this, 'selector_prefix' ) );
28	+ add_filter( 'body_class', array( $this, 'body_class' ) );
29	+ }
30	+
31	+ public function selector_prefix( $element ) {
32	+ if ( !empty( $element['selector'] ) ) {
33	+ $selector_array = explode( ',', $element['selector'] );
34	+
35	+ foreach( $selector_array as &$sub_selector ) {
36	+
37	+ if ( 'body' == $sub_selector ) {
38	+ // body selector without class; add it
39	+ $sub_selector = $sub_selector . '.' . $this->body_class;
40	+ }else if ( 'body ' == substr( $sub_selector, 0 ) ){
41	+ // body selector with sub-item without class
42	+ $sub_selector = str_replace( 'body ', 'body'. $this->body_class . ' ', $sub_selector );
43	+ }else if ( 'html' == substr( $sub_selector, 0 ) \|\| 'body' == substr( $sub_selector, 0 ) ) {
44	+ // html or body selector
45	+ continue;
46	+ }else {
47	+ // All others, prepend body class
48	+ $sub_selector = '.' . $this->body_class . ' ' . $sub_selector;
49	+ }
50	+
51	+ }
52	+
53	+ $element['selector'] = implode( ',', $selector_array );
54	+ }
55	+
56	+ return $element;
57	+ }
58	+
59	+ public function body_class( $classes ) {
60	+ $classes[] = $this->body_class;
61	+ return $classes;
62	+ }
63	+
64	+ public function output_css() {
65	+ global $wp_customize;
66	+
67	+ $css = false;
68	+
69	+ if ( empty( $wp_customize ) ) {
70	+ $css = get_option( Styles_Helpers::get_option_key( 'css' ) );
71	+ }
72	+
73	+ if ( !empty( $wp_customize ) \|\| empty( $css ) ) {
74	+ // Refresh
75	+
76	+ $css = '';
77	+
78	+ $this->plugin->customize_register( $wp_customize );
79	+
80	+ foreach ( $this->plugin->customize->get_settings() as $group => $elements ) {
81	+ foreach ( $elements as $element ) {
82	+ if ( $class = Styles_Helpers::get_element_class( $element ) ) {
83	+
84	+ $element = apply_filters( 'styles_pre_get_css', $element );
85	+ $control = new $class( $group, $element );
86	+
87	+ $css .= $control->get_css();
88	+ // $css .= call_user_func_array( $class . '::get_css', array( $group, $element ) );
89	+
90	+ }
91	+ }
92	+ }
93	+ $css = apply_filters( 'styles_css_output', $css );
94	+
95	+ $css = implode( '', $this->google_fonts ) . $css;
96	+
97	+ update_option( Styles_Helpers::get_option_key( 'css' ), $css );
98	+ }
99	+
100	+ echo '<style id="storm-styles">' . $css . '</style>';
101	+
102	+ }
103	+
104	+ }

classes/styles-customize.php ADDED Viewed

	@@ -0,0 +1,193 @@


1	+ <?php
2	+
3	+ class Styles_Customize {
4	+
5	+ /**
6	+ * @var Styles_Plugin
7	+ */
8	+ var $plugin;
9	+
10	+ /**
11	+ * Customize settings loaded from customize.json in plugin or theme
12	+ * @var array
13	+ */
14	+ var $settings = array();
15	+
16	+ /**
17	+ * Styles_Control objects that register with wp_customize
18	+ *
19	+ * @var array contains Styles_Control objects
20	+ */
21	+ var $controls;
22	+
23	+ function __construct( $plugin ) {
24	+ $this->plugin = &$plugin;
25	+
26	+ add_action( 'customize_register', array( $this, 'add_sections' ), 10 );
27	+ add_action( 'customize_controls_enqueue_scripts', array( $this, 'customize_controls_enqueue' ) );
28	+ add_action( 'customize_preview_init', array( $this, 'customize_preview_init_enqueue' ) );
29	+
30	+ // Load settings from various sources with filters
31	+ add_filter( 'styles_theme_settings', array( $this, 'load_theme_settings_from_plugin' ), 1 );
32	+ add_filter( 'styles_theme_settings', array( $this, 'load_settings_from_theme' ), 5 );
33	+
34	+ // Set storm-styles option to not autoload; does nothing if setting already exists
35	+ add_option( Styles_Helpers::get_option_key(), '', '', 'no' );
36	+
37	+ }
38	+
39	+ public function customize_preview_init_enqueue() {
40	+ // Version set to md5 of settings because JS generated from settings
41	+ $custom_preview_version = md5( serialize( $this->settings ) );
42	+
43	+ $custom_preview_url = add_query_arg( 'styles-action', 'customize-preview-js', site_url() );
44	+
45	+ // Account for theme previews
46	+ $custom_preview_url = add_query_arg( 'theme', Styles_Helpers::get_template(), $custom_preview_url );
47	+
48	+ wp_enqueue_script( 'styles-customize-preview', $custom_preview_url, array( 'jquery', 'customize-preview' ), $custom_preview_version, true );
49	+ }
50	+
51	+ public function customize_controls_enqueue() {
52	+
53	+ // Stylesheets
54	+ wp_enqueue_style( 'styles-customize', plugins_url( '/css/styles-customize.css', STYLES_BASENAME ), array(), $this->plugin->version );
55	+
56	+ // Javascript
57	+ wp_enqueue_script( 'styles-customize-controls', plugins_url( '/js/styles-customize-controls.js', STYLES_BASENAME ), array(), $this->plugin->version );
58	+
59	+ }
60	+
61	+ /**
62	+ * Output javascript for WP Customizer preview postMessage transport
63	+ */
64	+ public function preview_js() {
65	+ // This fires on a very early hook (parse_request)
66	+ // So we neet to init settings
67	+ foreach ( $this->get_settings() as $group => $elements ) {
68	+ $group_id = Styles_Helpers::get_group_id( $group );
69	+ $this->add_items( $group_id, $elements, false );
70	+ }
71	+
72	+ header( 'content-type: text/javascript' ); ?>
73	+
74	+ ( function( $ ){
75	+
76	+ <?php echo apply_filters( 'styles_customize_preview', '' ) ?>
77	+
78	+ } )( jQuery );
79	+
80	+ <?php
81	+
82	+ exit;
83	+ }
84	+
85	+ /**
86	+ * Register sections with WordPress theme customizer in WordPress 3.4+
87	+ * e.g., General, Header, Footer, Content, Sidebar
88	+ */
89	+ function add_sections( $wp_customize ) {
90	+ global $wp_customize;
91	+
92	+ $i = 950;
93	+ foreach ( $this->get_settings() as $group => $elements ) {
94	+ $i++;
95	+
96	+ // Groups
97	+ $group_id = Styles_Helpers::get_group_id( $group );
98	+ $wp_customize->add_section( $group_id, array(
99	+ 'title' => __( $group, 'storm' ),
100	+ 'priority' => $i,
101	+ ) );
102	+
103	+ $this->add_items( $group_id, $elements );
104	+ }
105	+ }
106	+
107	+
108	+ /**
109	+ * Register individual customize fields in WordPress 3.4+
110	+ * Settings & Controls are within each class (type calls different classes)
111	+ */
112	+ public function add_items( $group_id, $elements, $add_item = true ) {
113	+ static $i;
114	+ foreach ( $elements as $element ) {
115	+ $i++;
116	+ $element['priority'] = $i;
117	+ if ( $class = Styles_Helpers::get_element_class( $element ) ) {
118	+
119	+ // PHP <= 5.2 support
120	+ // Otherwise, would be: $class::add_item( $group_id, $element );
121	+ $control = new $class( $group_id, $element );
122	+
123	+ if ( $add_item ) {
124	+ $control->add_item();
125	+ }
126	+
127	+ $this->controls[] = $control;
128	+ }
129	+ }
130	+
131	+ }
132	+
133	+ /**
134	+ * Load settings as JSON either from transient / API or theme file
135	+ *
136	+ * @return array
137	+ */
138	+ public function get_settings() {
139	+
140	+ // Return cached settings if they've already been processed
141	+ if ( !empty( $this->settings ) ) {
142	+ return $this->settings;
143	+ }
144	+
145	+ // Plugin Authors: Filter to override settings sources
146	+ $this->settings = apply_filters( 'styles_theme_settings', $this->settings );
147	+
148	+ return $this->settings;
149	+ }
150	+
151	+ /**
152	+ * Load settings from path provided by plugin
153	+ */
154	+ public function load_theme_settings_from_plugin( $defaults = array() ) {
155	+ foreach( $this->plugin->child->plugins as $plugin ) {
156	+
157	+ if(
158	+ is_a( $plugin, 'Styles_Child_Theme')
159	+ && method_exists( $plugin, 'get_json_path' )
160	+ ) {
161	+
162	+ $json_file = $plugin->get_json_path();
163	+ $defaults = $this->load_settings_from_json_file( $json_file, $defaults );
164	+
165	+ }
166	+
167	+ }
168	+
169	+ return $defaults;
170	+ }
171	+
172	+ /**
173	+ * Load settings from theme file formatted as JSON
174	+ */
175	+ public function load_settings_from_theme( $defaults = array() ) {
176	+ $json_file = get_stylesheet_directory() . '/customize.json';
177	+ return $this->load_settings_from_json_file( $json_file, $defaults );
178	+ }
179	+
180	+ public function load_settings_from_json_file( $json_file, $default_settings = array() ) {
181	+ $settings = array();
182	+ if ( file_exists( $json_file ) ) {
183	+ $json = preg_replace('!/\.?\*/!s', '', file_get_contents( $json_file ) ); // strip comments before decoding
184	+ $settings = json_decode( $json, true );
185	+
186	+ if ( $json_error = Styles_Helpers::get_json_error( $json_file, $settings ) ) {
187	+ wp_die( $json_error );
188	+ }
189	+ }
190	+ return wp_parse_args( $settings, $default_settings );
191	+ }
192	+
193	+ }

classes/styles-helpers.php ADDED Viewed

	@@ -0,0 +1,108 @@


1	+ <?php
2	+
3	+ class Styles_Helpers {
4	+
5	+ static public $prefix = 'st_';
6	+ static public $control_id_counter = 0;
7	+ static private $template;
8	+
9	+ static public function sanitize_type( $type ) {
10	+ $type = str_replace( array('-', '_'), ' ', $type );
11	+ $type = ucwords( $type );
12	+ $type = str_replace( ' ', '_', $type );
13	+ return $type;
14	+ }
15	+
16	+ static public function get_group_id( $group ) {
17	+ return self::$prefix . sanitize_key( $group );
18	+ }
19	+
20	+ static public function get_control_id( $id ) {
21	+ self::$control_id_counter++;
22	+ return self::$prefix . $id . '_' . self::$control_id_counter;
23	+ }
24	+
25	+ /**
26	+ * Return name of static class for Customizer Control based on "type"
27	+ */
28	+ public static function get_element_class( $element ) {
29	+ if ( empty( $element['type'] ) ) { return false; }
30	+ $type = self::sanitize_type( $element['type'] );
31	+
32	+ // e.g., Styles_Control_Background_Color
33	+ $class = "Styles_Control_$type";
34	+
35	+ if ( class_exists( $class ) ) {
36	+ return $class;
37	+ }else {
38	+
39	+ $file = dirname( __FILE__ ) . '/' . strtolower( str_replace('_', '-', $class ) ) . '.php';
40	+
41	+ if ( file_exists( $file ) ) {
42	+ include $file;
43	+ return $class;
44	+ }else {
45	+ // trigger_error( 'Could not find class ' . $class, E_USER_ERROR );
46	+ return false;
47	+ }
48	+
49	+ }
50	+
51	+ }
52	+
53	+ public static function get_json_error( $json_file, $json_result ) {
54	+ $path = str_replace( ABSPATH, '', $json_file );
55	+ $url = site_url( $path );
56	+
57	+ $syntax_error = 'Malformed JSON. Check for errors. PHP <a href="http://php.net/manual/en/function.json-decode.php" target="_blank">json_decode</a> does not support comments or trailing commas.';
58	+ $template = '<h3>JSON error</h3>%s<p>Please check <code><a href="%s" target="_blank">%s</a></code></p>';
59	+
60	+ // PHP 5.2
61	+ if ( !function_exists( 'json_last_error' ) ) {
62	+ if ( null == $json_result ) {
63	+ return sprintf( $template, $syntax_error, $url, $path );
64	+ }
65	+ return false;
66	+ }
67	+
68	+ // PHP 5.3+
69	+ switch ( json_last_error() ) {
70	+ case JSON_ERROR_NONE: return false; break;
71	+ case JSON_ERROR_DEPTH: $error = 'Maximum stack depth exceeded.'; break;
72	+ case JSON_ERROR_STATE_MISMATCH: $error = 'Underflow or the modes mismatch.'; break;
73	+ case JSON_ERROR_CTRL_CHAR: $error = 'Unexpected control character.'; break;
74	+ case JSON_ERROR_SYNTAX: $error = $syntax_error; break;
75	+ case JSON_ERROR_UTF8: $error = 'Malformed UTF-8 characters, possibly incorrectly encoded.'; break;
76	+ default: $error = 'Unknown JSON error.'; break;
77	+ }
78	+
79	+ return sprintf( $template, $error, $url, $path );
80	+ }
81	+
82	+ public static function get_template() {
83	+ if ( isset( self::$template ) ) {
84	+ return self::$template;
85	+ }
86	+
87	+ global $wp_customize;
88	+
89	+ if ( isset( $_GET['theme'] ) ) {
90	+ self::$template = $_GET['theme'];
91	+ }else if ( is_a( $wp_customize, 'WP_Customize_Manager' ) ) {
92	+ self::$template = $wp_customize->theme()->template;
93	+ }else {
94	+ self::$template = get_template();
95	+ }
96	+
97	+ return self::$template;
98	+
99	+ }
100	+
101	+ public static function get_option_key( $suffix = false ) {
102	+ if ( $suffix ) {
103	+ return 'storm-styles-' . self::get_template() . '-' . $suffix;
104	+ }else {
105	+ return 'storm-styles-' . self::get_template();
106	+ }
107	+ }
108	+ }

classes/styles-plugin.php ADDED Viewed

	@@ -0,0 +1,144 @@


1	+ <?php
2	+
3	+ /**
4	+ * Plugin wrapper
5	+ **/
6	+ class Styles_Plugin {
7	+
8	+ /**
9	+ * Plugin Version
10	+ *
11	+ * Holds the current plugin version.
12	+ *
13	+ * @var string
14	+ **/
15	+ var $version = '1.0.4';
16	+
17	+ /**
18	+ * Plugin DB version
19	+ *
20	+ * Holds the current plugin database version.
21	+ * Not the same as the current plugin version.
22	+ *
23	+ * @var string
24	+ **/
25	+ var $db_version = '1.0';
26	+
27	+ /**
28	+ * @var Styles_CSS
29	+ */
30	+ var $css;
31	+
32	+ /**
33	+ * @var Styles_Customize
34	+ */
35	+ var $customize;
36	+
37	+ /**
38	+ * @var Styles_Admin
39	+ */
40	+ var $admin;
41	+
42	+ /**
43	+ * @var Styles_Child
44	+ */
45	+ var $child;
46	+
47	+ var $query_var = 'styles-action';
48	+
49	+ public function __construct() {
50	+
51	+ require_once dirname( __FILE__ ) . '/styles-helpers.php';
52	+
53	+ add_action( 'wp_head', array( $this, 'wp_head' ), 1000 );
54	+
55	+ add_action( 'plugins_loaded', array( $this, 'plugins_loaded' ), 15 );
56	+ add_action( 'admin_menu', array( $this, 'admin_menu' ), 1 );
57	+ add_action( 'customize_register', array( $this, 'customize_register' ), 1 );
58	+
59	+ // Generated javascript from settings for Customize postMessage transport
60	+ add_filter( 'query_vars', array( $this, 'query_vars' ) );
61	+ add_action( 'parse_request', array( $this, 'parse_request' ) );
62	+
63	+ }
64	+
65	+ /**
66	+ * Set up detection for child plugins that follow common patterns
67	+ */
68	+ public function plugins_loaded() {
69	+ if ( !is_a( $this->child, 'Styles_Child') ) {
70	+
71	+ require_once dirname( __FILE__ ) . '/styles-child.php';
72	+ require_once dirname( __FILE__ ) . '/styles-child-updatable.php';
73	+ require_once dirname( __FILE__ ) . '/styles-child-theme.php';
74	+
75	+ $this->child = new Styles_Child( $this );
76	+ }
77	+ }
78	+
79	+ /**
80	+ * Setup WP Admin user interface
81	+ */
82	+ public function admin_menu() {
83	+ if ( !is_a( $this->admin, 'Styles_Admin') ) {
84	+
85	+ require_once dirname( __FILE__ ) . '/styles-admin.php';
86	+
87	+ $this->admin = new Styles_Admin( $this );
88	+ }
89	+ }
90	+
91	+ /**
92	+ * Add settings to WP Customize
93	+ */
94	+ public function customize_register( $wp_customize = null ) {
95	+ if ( !is_a( $this->customize, 'Styles_Customize') ) {
96	+
97	+ require_once dirname( __FILE__ ) . '/styles-control.php';
98	+ require_once dirname( __FILE__ ) . '/styles-customize.php';
99	+
100	+ $this->customize = new Styles_Customize( $this );
101	+ }
102	+ }
103	+
104	+ /**
105	+ * Output CSS
106	+ */
107	+ public function wp_head() {
108	+ if ( !is_a( $this->css, 'Styles_CSS') ) {
109	+
110	+ require_once dirname( __FILE__ ) . '/styles-control.php';
111	+ require_once dirname( __FILE__ ) . '/styles-css.php';
112	+
113	+ $this->css = new Styles_CSS( $this );
114	+ }
115	+ $this->css->output_css();
116	+ }
117	+
118	+ /**
119	+ * Whitelist query var to trigger custom requests
120	+ */
121	+ public function query_vars( $vars ) {
122	+ $vars[] = $this->query_var;
123	+ return $vars;
124	+ }
125	+
126	+ /**
127	+ * Handle custom requests for our custom query_var
128	+ */
129	+ public function parse_request( $wp ) {
130	+ if ( !array_key_exists( $this->query_var, $wp->query_vars ) ) {
131	+ return;
132	+ }
133	+ switch ( $wp->query_vars[ $this->query_var ] ) {
134	+ case 'customize-preview-js':
135	+
136	+ $this->customize_register();
137	+
138	+ $this->customize->preview_js();
139	+
140	+ break;
141	+ }
142	+ }
143	+
144	+ }

css/styles-admin.css ADDED Viewed

	@@ -0,0 +1 @@


1	+ #styles a.button-primary { height:20px; line-height: 19px; font-size: 12px; padding-left: 6px; padding-right: 6px; }

css/styles-customize.css ADDED Viewed

	@@ -0,0 +1,88 @@


1	+ /* Control Type Labels (override or remove with "suffix" in JSON)*/
2	+ span.styles-type {
3	+ font-weight:normal;
4	+ text-transform: uppercase;
5	+ font-size: 10px;
6	+ color: #797979;
7	+ padding-left: 6px;
8	+ }
9	+
10	+ /* Styles_Customize_Text_Control */
11	+
12	+ #customize-controls input.styles-font-size {
13	+ width: 32px;
14	+ }
15	+
16	+ .styles-font-family option {
17	+ text-indent: 10px;
18	+ }
19	+
20	+ .styles-font-family option.label {
21	+ font-family: Helvetica, Arial, sans-serif;
22	+ font-size: 11px;
23	+ color: #666;
24	+ font-style: normal;
25	+ font-weight: normal;
26	+ text-indent: 0;
27	+ margin-top: 10px;
28	+ }
29	+
30	+ .styles-font-family option.first {
31	+ margin-top: 0;
32	+ }
33	+
34	+
35	+ /* Subsection */
36	+
37	+ /*
38	+ .styles-subsection-title:after {
39	+ border-color: #CCCCCC transparent;
40	+ border-style: solid;
41	+ border-width: 6px 6px 0;
42	+ content: "";
43	+ height: 0;
44	+ position: absolute;
45	+ right: 20px;
46	+ top: 15px;
47	+ width: 0;
48	+ z-index: 1;
49	+ }
50	+
51	+ .styles-subsection-title {
52	+ background-color: #F5F5F5;
53	+ background-image: -moz-linear-gradient(center top, #e8e8e8, #e0e0e0);
54	+ font-family: Georgia, "Times New Roman", "Bitstream Charter", Times, serif;
55	+ font-size: 15px;
56	+ font-weight: normal;
57	+ padding: 11px 20px;
58	+ text-shadow: 0 1px 0 #FFFFFF;
59	+ -moz-user-select: none;
60	+ cursor: pointer;
61	+ position: relative;
62	+ margin: 0 -20px -8px;
63	+ border-bottom: 1px solid #efefef;
64	+ }
65	+
66	+ .customize-section-content li:first-child .styles-subsection-title {
67	+ margin-top: -10px;
68	+ }
69	+
70	+ .open-subsection .styles-subsection-title {
71	+ border-bottom: 1px solid #6D6D6D;
72	+ }
73	+
74	+ .control-section .styles-subsection-title:hover, .open-subsection .styles-subsection-title {
75	+ background-color: #808080;
76	+ background-image: -moz-linear-gradient(center top, #9B9B9B, #848484);
77	+ color: #FFFFFF;
78	+ text-shadow: 0 -1px 0 #333333;
79	+ }
80	+
81	+ .customize-section-content {
82	+ padding-bottom: 0;
83	+ }
84	+
85	+ .styles-subsection {
86	+ padding: 20px 0;
87	+ }
88	+ */

js/PIE/PIE.htc CHANGED Viewed

@@ -1,81 +1,81 @@
-            -
            <!--
-            -
            PIE: CSS3 rendering for IE
-            -
            Version 1.0beta4
-            -
            http://css3pie.com
-            -
            Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
-            -
            -->
-            -
            <PUBLIC:COMPONENT lightWeight="true">
-            -
            <PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
-            -
            <PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
-            -
            <PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
-            -
-            -
            <script type="text/javascript">
-            -
            var doc = element.document;var g=window.PIE;
-            -
            if(!g){g=window.PIE={F:"-pie-",Sa:"Pie",Pa:"pie_",Jb:{TD:1,TH:1}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(L){}g.J=function(){for(var a=4,b=doc.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return a}();if(g.J===6)g.F=g.F.replace(/^-/,"");g.Ab=doc.documentMode||g.J;(function(){var a,b=0,c={};g.p={Ga:function(e){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+e)},
-            -
            ta:function(e){return e&&e._pieId||(e._pieId=++b)},fb:function(e){var f,h,j,d,i=arguments;f=1;for(h=i.length;f<h;f++){d=i[f];for(j in d)if(d.hasOwnProperty(j))e[j]=d[j]}return e},Pb:function(e,f,h){var j=c[e],d,i;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([f,h]):f.call(h,j);else{i=c[e]=[[f,h]];d=new Image;d.onload=function(){j=c[e]={i:d.width,f:d.height};for(var k=0,m=i.length;k<m;k++)i[k][0].call(i[k][1],j);d.onload=null};d.src=e}}}})();g.ia=function(){this.hb=[];this.Db={}};
-            -
            g.ia.prototype={aa:function(a){var b=g.p.ta(a),c=this.Db,e=this.hb;if(!(b in c)){c[b]=e.length;e.push(a)}},Ma:function(a){a=g.p.ta(a);var b=this.Db;if(a&&a in b){delete this.hb[b[a]];delete b[a]}},Ia:function(){for(var a=this.hb,b=a.length;b--;)a[b]&&a[b]()}};g.ya=new g.ia;g.ya.Tc=function(){var a=this;if(!a.Uc){setInterval(function(){a.Ia()},250);a.Uc=1}};g.G=new g.ia;window.attachEvent("onbeforeunload",function(){g.G.Ia()});g.G.Ea=function(a,b,c){a.attachEvent(b,c);this.aa(function(){a.detachEvent(b,
-            -
            c)})};(function(){function a(){g.za.Ia()}g.za=new g.ia;g.G.Ea(window,"onresize",a)})();(function(){function a(){g.Ra.Ia()}g.Ra=new g.ia;g.G.Ea(window,"onscroll",a);g.za.aa(a)})();(function(){function a(){c=g.Qa.wc()}function b(){if(c){for(var e=0,f=c.length;e<f;e++)g.attach(c[e]);c=0}}var c;g.G.Ea(window,"onbeforeprint",a);g.G.Ea(window,"onafterprint",b)})();g.hd=function(){function a(i){this.V=i}var b=doc.createElement("length-calc"),c=doc.documentElement,e=b.style,f={},h=["mm","cm","in","pt","pc"],
-            -
            j=h.length,d={};e.position="absolute";e.top=e.left="-9999px";for(c.appendChild(b);j--;){b.style.width="100"+h[j];f[h[j]]=b.offsetWidth/100}c.removeChild(b);a.prototype={ib:/(px|em|ex|mm|cm|in|pt|pc|%)$/,vb:function(){var i=this.Lc;if(i===void 0)i=this.Lc=parseFloat(this.V);return i},ab:function(){var i=this.ad;if(!i)i=this.ad=(i=this.V.match(this.ib))&&i[0]||"px";return i},a:function(i,k){var m=this.vb(),l=this.ab();switch(l){case "px":return m;case "%":return m*(typeof k==="function"?k():k)/100;
-            -
            case "em":return m*this.tb(i);case "ex":return m*this.tb(i)/2;default:return m*f[l]}},tb:function(i){var k=i.currentStyle.fontSize;if(k.indexOf("px")>0)return parseFloat(k);else{b.style.width="1em";i.appendChild(b);k=b.offsetWidth;b.parentNode===i&&i.removeChild(b);return k}}};g.k=function(i){return d[i]||(d[i]=new a(i))};return a}();g.Na=function(){function a(f){this.U=f}var b=g.k("50%"),c={top:1,center:1,bottom:1},e={left:1,center:1,right:1};a.prototype={Dc:function(){if(!this.sb){var f=this.U,
-            -
            h=f.length,j=g.u,d=j.ja,i=g.k("0");d=d.fa;i=["left",i,"top",i];if(h===1){f.push(new j.Ta(d,"center"));h++}if(h===2){d&(f[0].h|f[1].h)&&f[0].d in c&&f[1].d in e&&f.push(f.shift());if(f[0].h&d)if(f[0].d==="center")i[1]=b;else i[0]=f[0].d;else if(f[0].Y())i[1]=g.k(f[0].d);if(f[1].h&d)if(f[1].d==="center")i[3]=b;else i[2]=f[1].d;else if(f[1].Y())i[3]=g.k(f[1].d)}this.sb=i}return this.sb},coords:function(f,h,j){var d=this.Dc(),i=d[1].a(f,h);f=d[3].a(f,j);return{x:d[0]==="right"?h-i:i,y:d[2]==="bottom"?
-            -
            j-f:f}}};return a}();g.Rb=function(){function a(b){this.V=b}a.prototype={ib:/[a-z]+$/i,ab:function(){return this.lc||(this.lc=this.V.match(this.ib)[0].toLowerCase())},vc:function(){var b=this.fc,c;if(b===undefined){b=this.ab();c=parseFloat(this.V,10);b=this.fc=b==="deg"?c:b==="rad"?c/Math.PI*180:b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();g.$b=function(){function a(c){this.V=c}var b={};a.Sc=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.gb=
-            -
            {aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",
-            -
            darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",
-            -
            indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",
-            -
            mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",
-            -
            peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",
-            -
            whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ca){var c=this.V,e;if(e=c.match(a.Sc)){this.Ca="rgb("+e[1]+","+e[2]+","+e[3]+")";this.qb=parseFloat(e[4])}else{if((e=c.toLowerCase())in a.gb)c="#"+a.gb[e];this.Ca=c;this.qb=c==="transparent"?0:1}}},O:function(c){this.parse();return this.Ca==="currentColor"?c.currentStyle.color:this.Ca},la:function(){this.parse();return this.qb}};g.pa=function(c){return b[c]||(b[c]=new a(c))};return a}();g.u=function(){function a(c){this.Ha=
-            -
            c;this.ch=0;this.U=[];this.wa=0}var b=a.ja={xa:1,ob:2,ea:4,ac:8,pb:16,fa:32,A:64,ga:128,ha:256,Aa:512,dc:1024,URL:2048};a.Ta=function(c,e){this.h=c;this.d=e};a.Ta.prototype={db:function(){return this.h&b.A||this.h&b.ga&&this.d==="0"},Y:function(){return this.db()||this.h&b.Aa}};a.prototype={dd:/\s/,Mc:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,zb:/^\-?[_a-z][\w-]*/i,Yc:/^("([^"]*)"|'([^']*)')/,Fc:/^#([\da-f]{6}|[\da-f]{3})/i,bd:{px:b.A,em:b.A,ex:b.A,mm:b.A,cm:b.A,
-            -
            "in":b.A,pt:b.A,pc:b.A,deg:b.xa,rad:b.xa,grad:b.xa},sc:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function e(t,n){t=new a.Ta(t,n);if(!c){k.U.push(t);k.wa++}return t}function f(){k.wa++;return null}var h,j,d,i,k=this;if(this.wa<this.U.length)return this.U[this.wa++];for(;this.dd.test(this.Ha.charAt(this.ch));)this.ch++;if(this.ch>=this.Ha.length)return f();j=this.ch;h=this.Ha.substring(this.ch);d=h.charAt(0);switch(d){case "#":if(i=h.match(this.Fc)){this.ch+=i[0].length;return e(b.ea,i[0])}break;
-            -
            case '"':case "'":if(i=h.match(this.Yc)){this.ch+=i[0].length;return e(b.dc,i[2]||i[3]||"")}break;case "/":case ",":this.ch++;return e(b.ha,d);case "u":if(i=h.match(this.url)){this.ch+=i[0].length;return e(b.URL,i[2]||i[3]||i[4]||"")}}if(i=h.match(this.Mc)){d=i[0];this.ch+=d.length;if(h.charAt(d.length)==="%"){this.ch++;return e(b.Aa,d+"%")}if(i=h.substring(d.length).match(this.zb)){d+=i[0];this.ch+=i[0].length;return e(this.bd[i[0].toLowerCase()]||b.ac,d)}return e(b.ga,d)}if(i=h.match(this.zb)){d=
-            -
            i[0];this.ch+=d.length;if(d.toLowerCase()in g.$b.gb||d==="currentColor")return e(b.ea,d);if(h.charAt(d.length)==="("){this.ch++;if(d.toLowerCase()in this.sc){h=function(t){return t&&t.h&b.ga};i=function(t){return t&&t.h&(b.ga|b.Aa)};var m=function(t,n){return t&&t.d===n},l=function(){return k.next(1)};if((d.charAt(0)==="r"?i(l()):h(l()))&&m(l(),",")&&i(l())&&m(l(),",")&&i(l())&&(d==="rgb"||d==="hsa"||m(l(),",")&&h(l()))&&m(l(),")"))return e(b.ea,this.Ha.substring(j,this.ch));return f()}return e(b.pb,
-            -
            d)}return e(b.fa,d)}this.ch++;return e(b.ob,d)},z:function(){return this.U[this.wa-- -2]},all:function(){for(;this.next(););return this.U},da:function(c,e){for(var f=[],h,j;h=this.next();){if(c(h)){j=true;this.z();break}f.push(h)}return e&&!j?null:f}};return a}();var M=function(a){this.e=a};M.prototype={K:0,Qc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Vc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.i!==b.i||a.f!==b.f)},ub:function(){var a=this.e.getBoundingClientRect();
-            -
            return{x:a.left,y:a.top,i:a.right-a.left,f:a.bottom-a.top}},o:function(){return this.K?this.Da||(this.Da=this.ub()):this.ub()},Ec:function(){return!!this.Ua},Ja:function(){++this.K},La:function(){if(!--this.K){if(this.Da)this.Ua=this.Da;this.Da=null}}};(function(){function a(b){var c=g.p.ta(b);return function(){if(this.K){var e=this.rb||(this.rb={});return c in e?e[c]:(e[c]=b.call(this))}else return b.call(this)}}g.s={K:0,$:function(b){function c(e){this.e=e}g.p.fb(c.prototype,g.s,b);c.kc={};return c},
-            -
            m:function(){var b=this.qa(),c=this.constructor.kc;return b?b in c?c[b]:(c[b]=this.ba(b)):null},qa:a(function(){var b=this.e,c=this.constructor,e=b.style;b=b.currentStyle;var f=this.na,h=this.va,j=c.ic||(c.ic=g.F+f);c=c.jc||(c.jc=g.Sa+h.charAt(0).toUpperCase()+h.substring(1));return e[c]||b.getAttribute(j)||e[h]||b.getAttribute(f)}),g:a(function(){return!!this.m()}),D:a(function(){var b=this.qa(),c=b!==this.gc;this.gc=b;return c}),ma:a,Ja:function(){++this.K},La:function(){--this.K||delete this.rb}}})();
-            -
            g.Tb=g.s.$({na:g.F+"background",va:g.Sa+"Background",nc:{scroll:1,fixed:1,local:1},Ka:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},Nc:{"padding-box":1,"border-box":1,"content-box":1},rc:{"padding-box":1,"border-box":1},Rc:{top:1,right:1,bottom:1,left:1,center:1},Wc:{contain:1,cover:1},ba:function(a){function b(u){return u.Y()||u.h&i&&u.d in t}function c(u){return u.Y()&&g.k(u.d)||u.d==="auto"&&"auto"}var e=this.e.currentStyle,f,h,j=g.u.ja,d=j.ha,i=j.fa,k=j.ea,m,l,t=this.Rc,n,p,s=null;if(this.$a()){a=
-            -
            new g.u(a);s={M:[]};for(h={};f=a.next();){m=f.h;l=f.d;if(!h.P&&m&j.pb&&l==="linear-gradient"){n={ca:[],P:l};for(p={};f=a.next();){m=f.h;l=f.d;if(m&j.ob&&l===")"){p.color&&n.ca.push(p);n.ca.length>1&&g.p.fb(h,n);break}if(m&k){if(n.Xa||n.bb){f=a.z();if(f.h!==d)break;a.next()}p={color:g.pa(l)};f=a.next();if(f.Y())p.Fb=g.k(f.d);else a.z()}else if(m&j.xa&&!n.Xa&&!p.color&&!n.ca.length)n.Xa=new g.Rb(f.d);else if(b(f)&&!n.bb&&!p.color&&!n.ca.length){a.z();n.bb=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&
-            -
            d&&l===","){if(p.color){n.ca.push(p);p={}}}else break}}else if(!h.P&&m&j.URL){h.Cb=l;h.P="image"}else if(b(f)&&!h.size){a.z();h.Ya=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&i)if(l in this.Ka)h.Bb=l;else if(l in this.Nc){h.kd=l;if(l in this.rc)h.clip=l}else{if(l in this.nc)h.jd=l}else if(m&k&&!s.color)s.color=g.pa(l);else if(m&d)if(l==="/"){f=a.next();m=f.h;l=f.d;if(m&i&&l in this.Wc)h.size=l;else if(l=c(f))h.size={i:l,f:c(a.next())||a.z()&&l}}else{if(l===","&&h.P){s.M.push(h);h={}}}else return null}h.P&&
-            -
            s.M.push(h)}else this.Nb(function(){var u=e.backgroundPositionX,w=e.backgroundPositionY,r=e.backgroundImage,o=e.backgroundColor;s={};if(o!=="transparent")s.color=g.pa(o);if(r!=="none")s.M=[{P:"image",Cb:(new g.u(r)).next().d,Bb:e.backgroundRepeat,Ya:new g.Na((new g.u(u+" "+w)).all())}]});return s&&(s.color||s.M&&s.M[0])?s:null},Nb:function(a){var b=this.e.runtimeStyle,c=b.backgroundImage,e=b.backgroundColor;if(c)b.backgroundImage="";if(e)b.backgroundColor="";a=a.call(this);if(c)b.backgroundImage=
-            -
            c;if(e)b.backgroundColor=e;return a},qa:g.s.ma(function(){return this.$a()||this.Nb(function(){var a=this.e.currentStyle;return a.backgroundColor+" "+a.backgroundImage+" "+a.backgroundRepeat+" "+a.backgroundPositionX+" "+a.backgroundPositionY})}),$a:g.s.ma(function(){var a=this.e;return a.style[this.va]||a.currentStyle.getAttribute(this.na)}),Eb:function(){var a=0;if(g.J<7){a=this.e;a=""+(a.style[g.Sa+"PngFix"]||a.currentStyle.getAttribute(g.F+"png-fix"))==="true"}return a},g:g.s.ma(function(){return(this.$a()||
-            -
            this.Eb())&&!!this.m()})});g.Xb=g.s.$({Ib:["Top","Right","Bottom","Left"],Kc:{thin:"1px",medium:"3px",thick:"5px"},ba:function(){var a={},b={},c={},e=false,f=true,h=true,j=true;this.Ob(function(){for(var d=this.e.currentStyle,i=0,k,m,l,t,n,p,s;i<4;i++){l=this.Ib[i];s=l.charAt(0).toLowerCase();k=b[s]=d["border"+l+"Style"];m=d["border"+l+"Color"];l=d["border"+l+"Width"];if(i>0){if(k!==t)h=false;if(m!==n)f=false;if(l!==p)j=false}t=k;n=m;p=l;c[s]=g.pa(m);l=a[s]=g.k(b[s]==="none"?"0":this.Kc[l]||l);if(l.a(this.e)>
-            -
            0)e=true}});return e?{nb:a,Zc:b,tc:c,ed:j,uc:f,$c:h}:null},qa:g.s.ma(function(){var a=this.e,b=a.currentStyle,c;a.tagName in g.Jb&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Ob(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Ob:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,e=b.borderColor;if(c)b.borderWidth="";if(e)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(e)b.borderColor=e;return a}});(function(){g.Oa=g.s.$({na:"border-radius",
-            -
            va:"borderRadius",ba:function(b){var c=null,e,f,h,j,d=false;if(b){f=new g.u(b);var i=function(){for(var k=[],m;(h=f.next())&&h.Y();){j=g.k(h.d);m=j.vb();if(m<0)return null;if(m>0)d=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=i()){if(h){if(h.h&g.u.ja.ha&&h.d==="/")e=i()}else e=b;if(d&&b&&e)c={x:b,y:e}}}return c}});var a=g.k("0");a={tl:a,tr:a,br:a,bl:a};g.Oa.Qb={x:a,y:a}})();g.Vb=g.s.$({na:"border-image",va:"borderImage",Ka:{stretch:1,
-            -
            round:1,repeat:1,space:1},ba:function(a){var b=null,c,e,f,h,j,d,i=0,k,m=g.u.ja,l=m.fa,t=m.ga,n=m.A,p=m.Aa;if(a){c=new g.u(a);b={};for(var s=function(r){return r&&r.h&m.ha&&r.d==="/"},u=function(r){return r&&r.h&l&&r.d==="fill"},w=function(){h=c.da(function(r){return!(r.h&(t|p))});if(u(c.next())&&!b.fill)b.fill=true;else c.z();if(s(c.next())){i++;j=c.da(function(){return!(e.h&(t|p|n))&&!(e.h&l&&e.d==="auto")});if(s(c.next())){i++;d=c.da(function(){return!(e.h&(t|n))})}}else c.z()};e=c.next();){a=e.h;
-            -
            f=e.d;if(a&(t|p)&&!h){c.z();w()}else if(u(e)&&!b.fill){b.fill=true;w()}else if(a&l&&this.Ka[f]&&!b.repeat){b.repeat={f:f};if(e=c.next())if(e.h&l&&this.Ka[e.d])b.repeat.kb=e.d;else c.z()}else if(a&m.URL&&!b.src)b.src=f;else return null}if(!b.src||!h||h.length<1||h.length>4||j&&j.length>4||i===1&&j.length<1||d&&d.length>4||i===2&&d.length<1)return null;if(!b.repeat)b.repeat={f:"stretch"};if(!b.repeat.kb)b.repeat.kb=b.repeat.f;a=function(r,o){return{T:o(r[0]),S:o(r[1]||r[0]),L:o(r[2]||r[0]),Q:o(r[3]||
-            -
            r[1]||r[0])}};b.slice=a(h,function(r){return g.k(r.h&t?r.d+"px":r.d)});b.width=j&&j.length>0?a(j,function(r){return r.h&(n|p)?g.k(r.d):r.d}):(k=this.e.currentStyle)&&{T:g.k(k.borderTopWidth),S:g.k(k.borderRightWidth),L:g.k(k.borderBottomWidth),Q:g.k(k.borderLeftWidth)};b.ua=a(d||[0],function(r){return r.h&n?g.k(r.d):r.d})}return b}});g.Zb=g.s.$({na:"box-shadow",va:"boxShadow",ba:function(a){var b,c=g.k,e=g.u.ja,f;if(a){f=new g.u(a);b={ua:[],cb:[]};for(a=function(){for(var h,j,d,i,k,m;h=f.next();){d=
-            -
            h.d;j=h.h;if(j&e.ha&&d===",")break;else if(h.db()&&!k){f.z();k=f.da(function(l){return!l.db()})}else if(j&e.ea&&!i)i=d;else if(j&e.fa&&d==="inset"&&!m)m=true;else return false}h=k&&k.length;if(h>1&&h<5){(m?b.cb:b.ua).push({fd:c(k[0].d),gd:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Xc:c(k[3]?k[3].d:"0"),color:g.pa(i||"currentColor")});return true}return false};a(););}return b&&(b.cb.length||b.ua.length)?b:null}});g.ec=g.s.$({qa:g.s.ma(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),
-            -
            ba:function(){var a=this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,e;b.visibility="";e=a.visibility;b.visibility=c;return{cd:e!=="hidden",xc:a.display!=="none"}},g:function(){return false}});g.B={Z:function(a){function b(c,e,f,h){this.e=c;this.q=e;this.j=f;this.parent=h}g.p.fb(b.prototype,g.B,a);return b},eb:false,R:function(){return false},Kb:function(){this.n();this.g()&&this.X()},jb:function(){this.eb=true},Lb:function(){this.g()?this.X():this.n()},Wa:function(a,b){this.Hb(a);for(var c=
-            -
            this.ka||(this.ka=[]),e=a+1,f=c.length,h;e<f;e++)if(h=c[e])break;c[a]=b;this.w().insertBefore(b,h||null)},ra:function(a){var b=this.ka;return b&&b[a]||null},Hb:function(a){var b=this.ra(a),c=this.Ba;if(b&&c){c.removeChild(b);this.ka[a]=null}},sa:function(a,b,c,e){var f=this.Va||(this.Va={}),h=f[a];if(!h){h=f[a]=g.p.Ga("shape");if(b)h.appendChild(h[b]=g.p.Ga(b));if(e){c=this.ra(e);if(!c){this.Wa(e,doc.createElement("group"+e));c=this.ra(e)}}c.appendChild(h);a=h.style;a.position="absolute";a.left=a.top=
-            -
            0;a.behavior="url(#default#VML)"}return h},Za:function(a){var b=this.Va,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},xb:function(a){var b=this.e,c=this.q.o(),e=c.i,f=c.f,h,j,d,i,k,m;c=a.x.tl.a(b,e);h=a.y.tl.a(b,f);j=a.x.tr.a(b,e);d=a.y.tr.a(b,f);i=a.x.br.a(b,e);k=a.y.br.a(b,f);m=a.x.bl.a(b,e);a=a.y.bl.a(b,f);e=Math.min(e/(c+j),f/(d+k),e/(m+i),f/(h+a));if(e<1){c*=e;h*=e;j*=e;d*=e;i*=e;k*=e;m*=e;a*=e}return{x:{tl:c,tr:j,br:i,bl:m},y:{tl:h,tr:d,br:k,bl:a}}},oa:function(a,b,c){b=
-            -
            b||1;var e,f,h=this.q.o();f=h.i*b;h=h.f*b;var j=this.j.v,d=Math.floor,i=Math.ceil,k=a?a.T*b:0,m=a?a.S*b:0,l=a?a.L*b:0;a=a?a.Q*b:0;var t,n,p,s,u;if(c||j.g()){e=this.xb(c||j.m());c=e.x.tl*b;j=e.y.tl*b;t=e.x.tr*b;n=e.y.tr*b;p=e.x.br*b;s=e.y.br*b;u=e.x.bl*b;b=e.y.bl*b;f="m"+d(a)+","+d(j)+"qy"+d(c)+","+d(k)+"l"+i(f-t)+","+d(k)+"qx"+i(f-m)+","+d(n)+"l"+i(f-m)+","+i(h-s)+"qy"+i(f-p)+","+i(h-l)+"l"+d(u)+","+i(h-l)+"qx"+d(a)+","+i(h-b)+" x e"}else f="m"+d(a)+","+d(k)+"l"+i(f-m)+","+d(k)+"l"+i(f-m)+","+i(h-
-            -
            l)+"l"+d(a)+","+i(h-l)+"xe";return f},w:function(){var a=this.parent.ra(this.C),b;if(!a){a=doc.createElement(this.Fa);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.Wa(this.C,a)}return a},n:function(){this.parent.Hb(this.C);delete this.Va;delete this.ka}};g.cc=g.B.Z({g:function(){var a=this.oc;for(var b in a)if(a.hasOwnProperty(b)&&a[b].g())return true;return false},R:function(){return this.j.lb.D()},jb:function(){if(this.g()){var a=this.wb(),b=a,c;a=a.currentStyle;var e=a.position,f=
-            -
            this.w().style,h=0,j=0;j=this.q.o();if(e==="fixed"&&g.J>6){h=j.x;j=j.y;b=e}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;h=j.x-c.left-(parseFloat(b.borderLeftWidth)||0);j=j.y-c.top-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;h=j.x+b.scrollLeft-b.clientLeft;j=j.y+b.scrollTop-b.clientTop}b="absolute"}f.position=b;f.left=h;f.top=j;f.zIndex=e==="static"?-1:a.zIndex;this.eb=true}},Lb:function(){},Mb:function(){var a=
-            -
            this.j.lb.m();this.w().style.display=a.cd&&a.xc?"":"none"},Kb:function(){this.g()?this.Mb():this.n()},wb:function(){var a=this.e;return a.tagName in g.Jb?a.offsetParent:a},w:function(){var a=this.Ba,b;if(!a){b=this.wb();a=this.Ba=doc.createElement("css3-container");a.style.direction="ltr";this.Mb();b.parentNode.insertBefore(a,b)}return a},n:function(){var a=this.Ba,b;if(a&&(b=a.parentNode))b.removeChild(a);delete this.Ba;delete this.ka}});g.Sb=g.B.Z({C:2,Fa:"background",R:function(){var a=this.j;
-            -
            return a.H.D()||a.v.D()},g:function(){var a=this.j;return a.N.g()||a.v.g()||a.H.g()||a.W.g()&&a.W.m().cb},X:function(){var a=this.q.o();if(a.i&&a.f){this.yc();this.zc()}},yc:function(){var a=this.j.H.m(),b=this.q.o(),c=this.e,e=a&&a.color,f,h;if(e&&e.la()>0){this.yb();a=this.sa("bgColor","fill",this.w(),1);f=b.i;b=b.f;a.stroked=false;a.coordsize=f*2+","+b*2;a.coordorigin="1,1";a.path=this.oa(null,2);h=a.style;h.width=f;h.height=b;a.fill.color=e.O(c);c=e.la();if(c<1)a.fill.opacity=c}else this.Za("bgColor")},
-            -
            zc:function(){var a=this.j.H.m(),b=this.q.o();a=a&&a.M;var c,e,f,h,j;if(a){this.yb();e=b.i;f=b.f;for(j=a.length;j--;){b=a[j];c=this.sa("bgImage"+j,"fill",this.w(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=e*2+","+f*2;c.coordorigin="1,1";c.path=this.oa(0,2);h=c.style;h.width=e;h.height=f;if(b.P==="linear-gradient")this.mc(c,b);else{c.fill.src=b.Cb;this.Pc(c,j)}}}for(j=a?a.length:0;this.Za("bgImage"+j++););},Pc:function(a,b){g.p.Pb(a.fill.src,function(c){var e=a.fill,f=this.e,
-            -
            h=this.q.o(),j=h.i;h=h.f;var d=this.j,i=d.I.m(),k=i&&i.nb;i=k?k.t.a(f):0;var m=k?k.r.a(f):0,l=k?k.b.a(f):0;k=k?k.l.a(f):0;d=d.H.m().M[b];f=d.Ya?d.Ya.coords(f,j-c.i-k-m,h-c.f-i-l):{x:0,y:0};d=d.Bb;l=m=0;var t=j+1,n=h+1,p=g.J===8?0:1;k=Math.round(f.x)+k+0.5;i=Math.round(f.y)+i+0.5;e.position=k/j+","+i/h;if(d&&d!=="repeat"){if(d==="repeat-x"||d==="no-repeat"){m=i+1;n=i+c.f+p}if(d==="repeat-y"||d==="no-repeat"){l=k+1;t=k+c.i+p}a.style.clip="rect("+m+"px,"+t+"px,"+n+"px,"+l+"px)"}},this)},mc:function(a,
-            -
            b){function c(B,C,z,F,H){if(z===0||z===180)return[F,C];else if(z===90||z===270)return[B,H];else{z=Math.tan(-z*t/180);B=z*B-C;C=-1/z;F=C*F-H;H=C-z;return[(F-B)/H,(z*F-C*B)/H]}}function e(){w=m>=90&&m<270?i:0;r=m<180?k:0;o=i-w;x=k-r}function f(){for(;m<0;)m+=360;m%=360}function h(B,C){var z=C[0]-B[0];B=C[1]-B[1];return Math.abs(z===0?B:B===0?z:Math.sqrt(z*z+B*B))}var j=this.e,d=this.q.o(),i=d.i,k=d.f;a=a.fill;var m=b.Xa,l=b.bb;b=b.ca;d=b.length;var t=Math.PI,n,p,s,u,w,r,o,x,q,y,A,D;if(l){l=l.coords(j,
-            -
            i,k);n=l.x;p=l.y}if(m){m=m.vc();f();e();if(!l){n=w;p=r}l=c(n,p,m,o,x);s=l[0];u=l[1]}else if(l){s=i-n;u=k-p}else{n=p=s=0;u=k}l=s-n;q=u-p;if(m===void 0){m=!l?q<0?90:270:!q?l<0?180:0:-Math.atan2(q,l)/t*180;f();e()}l=m%90?Math.atan2(l*i/k,q)/t*180:m+90;l+=180;l%=360;y=h([n,p],[s,u]);s=h([w,r],c(w,r,m,o,x));u=[];p=h([n,p],c(n,p,m,w,r))/s*100;n=[];for(q=0;q<d;q++)n.push(b[q].Fb?b[q].Fb.a(j,y):q===0?0:q===d-1?y:null);for(q=1;q<d;q++){if(n[q]===null){A=n[q-1];y=q;do D=n[++y];while(D===null);n[q]=A+(D-A)/
-            -
            (y-q+1)}n[q]=Math.max(n[q],n[q-1])}for(q=0;q<d;q++)u.push(p+n[q]/s*100+"% "+b[q].color.O(j));a.angle=l;a.type="gradient";a.method="sigma";a.color=b[0].color.O(j);a.color2=b[d-1].color.O(j);a.colors.value=u.join(",")},yb:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},n:function(){g.B.n.call(this);var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});g.Wb=g.B.Z({C:4,Fa:"border",qc:{TABLE:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,
-            -
            IMG:1,HR:1,FIELDSET:1},Jc:{submit:1,button:1,reset:1},R:function(){var a=this.j;return a.I.D()||a.v.D()},g:function(){var a=this.j;return(a.N.g()||a.v.g()||a.H.g())&&a.I.g()},X:function(){var a=this.e,b=this.j.I.m(),c=this.q.o(),e=c.i;c=c.f;var f,h,j,d,i;if(b){this.Hc();b=this.Bc(2);d=0;for(i=b.length;d<i;d++){j=b[d];f=this.sa("borderPiece"+d,j.stroke?"stroke":"fill",this.w());f.coordsize=e*2+","+c*2;f.coordorigin="1,1";f.path=j.path;h=f.style;h.width=e;h.height=c;f.filled=!!j.fill;f.stroked=!!j.stroke;
-            -
            if(j.stroke){f=f.stroke;f.weight=j.mb+"px";f.color=j.color.O(a);f.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";f.linestyle=j.stroke==="double"&&j.mb>2?"ThinThin":"Single"}else f.fill.color=j.fill.O(a)}for(;this.Za("borderPiece"+d++););}},Hc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,e=a.tagName,f=g.J===6,h;if(f&&e in this.qc||e==="BUTTON"||e==="INPUT"&&a.type in this.Jc){c.borderWidth="";e=this.j.I.Ib;for(h=e.length;h--;){f=e[h];c["padding"+f]="";c["padding"+
-            -
            f]=g.k(b["padding"+f]).a(a)+g.k(b["border"+f+"Width"]).a(a)+(!g.J===8&&h%2?1:0)}c.borderWidth=0}else if(f){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");e=b.style;e.visibility="visible";for(e.zoom=1;e=a.firstChild;)b.appendChild(e);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},Bc:function(a){var b=this.e,c,e,f,h=this.j.I,j=[],d,i,k,m,l=Math.round,t,n,p;if(h.g()){c=h.m();h=c.nb;n=c.Zc;p=c.tc;if(c.ed&&c.$c&&c.uc){if(p.t.la()>
-            -
            0){c=h.t.a(b);k=c/2;j.push({path:this.oa({T:k,S:k,L:k,Q:k},a),stroke:n.t,color:p.t,mb:c})}}else{a=a||1;c=this.q.o();e=c.i;f=c.f;c=l(h.t.a(b));k=l(h.r.a(b));m=l(h.b.a(b));b=l(h.l.a(b));var s={t:c,r:k,b:m,l:b};b=this.j.v;if(b.g())t=this.xb(b.m());d=Math.floor;i=Math.ceil;var u=function(o,x){return t?t[o][x]:0},w=function(o,x,q,y,A,D){var B=u("x",o),C=u("y",o),z=o.charAt(1)==="r";o=o.charAt(0)==="b";return B>0&&C>0?(D?"al":"ae")+(z?i(e-B):d(B))*a+","+(o?i(f-C):d(C))*a+","+(d(B)-x)*a+","+(d(C)-q)*a+","+
-            -
            y*65535+","+2949075*(A?1:-1):(D?"m":"l")+(z?e-x:x)*a+","+(o?f-q:q)*a},r=function(o,x,q,y){var A=o==="t"?d(u("x","tl"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+d(u("y","tr"))*a:o==="b"?i(e-u("x","br"))*a+","+d(f-x)*a:d(x)*a+","+i(f-u("y","bl"))*a;o=o==="t"?i(e-u("x","tr"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+i(f-u("y","br"))*a:o==="b"?d(u("x","bl"))*a+","+d(f-x)*a:d(x)*a+","+d(u("y","tl"))*a;return q?(y?"m"+o:"")+"l"+A:(y?"m"+A:"")+"l"+o};b=function(o,x,q,y,A,D){var B=o==="l"||o==="r",C=s[o],z,F;if(C>0&&n[o]!==
-            -
            "none"&&p[o].la()>0){z=s[B?o:x];x=s[B?x:o];F=s[B?o:q];q=s[B?q:o];if(n[o]==="dashed"||n[o]==="dotted"){j.push({path:w(y,z,x,D+45,0,1)+w(y,0,0,D,1,0),fill:p[o]});j.push({path:r(o,C/2,0,1),stroke:n[o],mb:C,color:p[o]});j.push({path:w(A,F,q,D,0,1)+w(A,0,0,D-45,1,0),fill:p[o]})}else j.push({path:w(y,z,x,D+45,0,1)+r(o,C,0,0)+w(A,F,q,D,0,0)+(n[o]==="double"&&C>2?w(A,F-d(F/3),q-d(q/3),D-45,1,0)+r(o,i(C/3*2),1,0)+w(y,z-d(z/3),x-d(x/3),D,1,0)+"x "+w(y,d(z/3),d(x/3),D+45,0,1)+r(o,d(C/3),1,0)+w(A,d(F/3),d(q/
-            -
            3),D,0,0):"")+w(A,0,0,D-45,1,0)+r(o,0,1,0)+w(y,0,0,D,1,0),fill:p[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},n:function(){g.B.n.call(this);this.e.runtimeStyle.borderColor=""}});g.Ub=g.B.Z({C:5,Oc:["t","tr","r","br","b","bl","l","tl","c"],R:function(){return this.j.N.D()},g:function(){return this.j.N.g()},X:function(){this.w();var a=this.j.N.m(),b=this.q.o(),c=this.e,e=this.Gb;g.p.Pb(a.src,function(f){function h(w,
-            -
            r,o,x,q){w=e[w].style;var y=Math.max;w.width=y(r,0);w.height=y(o,0);w.left=x;w.top=q}function j(w,r,o){for(var x=0,q=w.length;x<q;x++)e[w[x]].imagedata[r]=o}var d=b.i,i=b.f,k=a.width,m=k.T.a(c),l=k.S.a(c),t=k.L.a(c);k=k.Q.a(c);var n=a.slice,p=n.T.a(c),s=n.S.a(c),u=n.L.a(c);n=n.Q.a(c);h("tl",k,m,0,0);h("t",d-k-l,m,k,0);h("tr",l,m,d-l,0);h("r",l,i-m-t,d-l,m);h("br",l,t,d-l,i-t);h("b",d-k-l,t,k,i-t);h("bl",k,t,0,i-t);h("l",k,i-m-t,0,m);h("c",d-k-l,i-m-t,k,m);j(["tl","t","tr"],"cropBottom",(f.f-p)/f.f);
-            -
            j(["tl","l","bl"],"cropRight",(f.i-n)/f.i);j(["bl","b","br"],"cropTop",(f.f-u)/f.f);j(["tr","r","br"],"cropLeft",(f.i-s)/f.i);if(a.repeat.kb==="stretch"){j(["l","r","c"],"cropTop",p/f.f);j(["l","r","c"],"cropBottom",u/f.f)}if(a.repeat.f==="stretch"){j(["t","b","c"],"cropLeft",n/f.i);j(["t","b","c"],"cropRight",s/f.i)}e.c.style.display=a.fill?"":"none"},this)},w:function(){var a=this.parent.ra(this.C),b,c,e,f=this.Oc,h=f.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";
-            -
            this.Gb={};for(e=0;e<h;e++){c=this.Gb[f[e]]=g.p.Ga("rect");c.appendChild(g.p.Ga("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.j.N.m().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.Wa(this.C,a)}return a}});g.Yb=g.B.Z({C:1,Fa:"outset-box-shadow",R:function(){var a=this.j;return a.W.D()||a.v.D()},g:function(){var a=this.j.W;return a.g()&&a.m().ua[0]},X:function(){function a(z,F,H,K,J,v,E){z=b.sa("shadow"+z+F,"fill",
-            -
            e,j-z);F=z.fill;z.coordsize=m*2+","+l*2;z.coordorigin="1,1";z.stroked=false;z.filled=true;F.color=J.O(c);if(v){F.type="gradienttitle";F.color2=F.color;F.opacity=0}z.path=E;u=z.style;u.left=H;u.top=K;u.width=m;u.height=l;return z}var b=this,c=this.e,e=this.w(),f=this.j,h=f.W.m().ua;f=f.v.m();var j=h.length,d=j,i,k=this.q.o(),m=k.i,l=k.f;k=g.J===8?1:0;for(var t=["tl","tr","br","bl"],n,p,s,u,w,r,o,x,q,y,A,D,B,C;d--;){p=h[d];w=p.fd.a(c);r=p.gd.a(c);i=p.Xc.a(c);o=p.blur.a(c);p=p.color;x=-i-o;if(!f&&o)f=
-            -
            g.Oa.Qb;x=this.oa({T:x,S:x,L:x,Q:x},2,f);if(o){q=(i+o)*2+m;y=(i+o)*2+l;A=o*2/q;D=o*2/y;if(o-i>m/2||o-i>l/2)for(i=4;i--;){n=t[i];B=n.charAt(0)==="b";C=n.charAt(1)==="r";n=a(d,n,w,r,p,o,x);s=n.fill;s.focusposition=(C?1-A:A)+","+(B?1-D:D);s.focussize="0,0";n.style.clip="rect("+((B?y/2:0)+k)+"px,"+(C?q:q/2)+"px,"+(B?y:y/2)+"px,"+((C?q/2:0)+k)+"px)"}else{n=a(d,"",w,r,p,o,x);s=n.fill;s.focusposition=A+","+D;s.focussize=1-A*2+","+(1-D*2)}}else{n=a(d,"",w,r,p,o,x);w=p.la();if(w<1)n.fill.opacity=w}}}});g.bc=
-            -
            g.B.Z({C:6,Fa:"imgEl",R:function(){var a=this.j;return this.e.src!==this.hc||a.v.D()},g:function(){var a=this.j;return a.v.g()||a.H.Eb()},X:function(){this.hc=j;this.Gc();var a=this.sa("img","fill",this.w()),b=a.fill,c=this.q.o(),e=c.i;c=c.f;var f=this.j.I.m();f=f&&f.nb;var h=this.e,j=h.src,d=Math.round;a.stroked=false;b.type="frame";b.src=j;b.position=(e?0.5/e:0)+","+(c?0.5/c:0);a.coordsize=e*2+","+c*2;a.coordorigin="1,1";a.path=this.oa(f?{T:d(f.t.a(h)),S:d(f.r.a(h)),L:d(f.b.a(h)),Q:d(f.l.a(h))}:
-            -
            0,2);a=a.style;a.width=e;a.height=c},Gc:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},n:function(){g.B.n.call(this);this.e.runtimeStyle.filter=""}});g.Qa=function(){function a(d){function i(){if(!z){var v,E,G=d.currentStyle,I=G.getAttribute(c)==="true";J=G.getAttribute(e);J=g.Ab===8?J!=="false":J==="true";if(!C){C=1;d.runtimeStyle.zoom=1;G=d;for(var O=1;G=G.previousSibling;)if(G.nodeType===1){O=0;break}if(O)d.className+=" "+g.Pa+"first-child"}y.Ja();if(I&&(E=y.o())&&(v=doc.documentElement||
-            -
            doc.body)&&(E.y>v.clientHeight||E.x>v.clientWidth||E.y+E.f<0||E.x+E.i<0)){if(!H){H=1;g.Ra.aa(i)}}else{z=1;H=C=0;g.Ra.Ma(i);A={H:new g.Tb(d),I:new g.Xb(d),N:new g.Vb(d),v:new g.Oa(d),W:new g.Zb(d),lb:new g.ec(d)};D=[A.H,A.I,A.N,A.v,A.W,A.lb];v=new g.cc(d,y,A);E=[new g.Yb(d,y,A,v),new g.Sb(d,y,A,v),new g.Wb(d,y,A,v),new g.Ub(d,y,A,v)];d.tagName==="IMG"&&E.push(new g.bc(d,y,A,v));v.oc=E;q=[v].concat(E);if(v=d.currentStyle.getAttribute(g.F+"watch-ancestors")){B=[];v=parseInt(v,10);E=0;for(I=d.parentNode;I&&
-            -
            (v==="NaN"||E++<v);){B.push(I);I.attachEvent("onpropertychange",u);I.attachEvent("onmouseenter",p);I.attachEvent("onmouseleave",s);I=I.parentNode}}if(J){g.ya.aa(m);g.ya.Tc()}m(1)}if(!F){F=1;d.attachEvent("onmove",k);d.attachEvent("onresize",k);d.attachEvent("onpropertychange",l);d.attachEvent("onmouseenter",p);d.attachEvent("onmouseleave",s);g.za.aa(k);g.G.aa(o)}y.La()}}function k(){y&&y.Ec()&&m()}function m(v){if(!K)if(z){var E,G;w();if(v||y.Qc()){E=0;for(G=q.length;E<G;E++)q[E].jb()}if(v||y.Vc()){E=
-            -
            0;for(G=q.length;E<G;E++)q[E].Lb()}r()}else C||i()}function l(){var v,E,G;v=event;if(!K&&!(v&&v.propertyName in j))if(z){w();v=0;for(E=q.length;v<E;v++){G=q[v];G.eb||G.jb();G.R()&&G.Kb()}r()}else C||i()}function t(){if(d)d.className+=f}function n(){if(d)d.className=d.className.replace(h,"")}function p(){setTimeout(t,0)}function s(){setTimeout(n,0)}function u(){var v=event.propertyName;if(v==="className"||v==="id")l()}function w(){y.Ja();for(var v=D.length;v--;)D[v].Ja()}function r(){for(var v=D.length;v--;)D[v].La();
-            -
            y.La()}function o(){if(F){if(B)for(var v=0,E=B.length,G;v<E;v++){G=B[v];G.detachEvent("onpropertychange",u);G.detachEvent("onmouseenter",p);G.detachEvent("onmouseleave",s)}d.detachEvent("onmove",m);d.detachEvent("onresize",m);d.detachEvent("onpropertychange",l);d.detachEvent("onmouseenter",p);d.detachEvent("onmouseleave",s);g.G.Ma(o);F=0}}function x(){if(!K){var v,E;o();K=1;if(q){v=0;for(E=q.length;v<E;v++)q[v].n()}J&&g.ya.Ma(m);g.za.Ma(m);q=y=A=D=B=d=null}}var q,y=new M(d),A,D,B,C,z,F,H,K,J;this.Ic=
-            -
            i;this.update=m;this.n=x;this.Ac=d}var b={},c=g.F+"lazy-init",e=g.F+"poll",f=" "+g.Pa+"hover",h=new RegExp("\\b"+g.Pa+"hover\\b","g"),j={background:1,bgColor:1,display:1};a.Cc=function(d){var i=g.p.ta(d);return b[i]||(b[i]=new a(d))};a.n=function(d){d=g.p.ta(d);var i=b[d];if(i){i.n();delete b[d]}};a.wc=function(){var d=[],i;if(b){for(var k in b)if(b.hasOwnProperty(k)){i=b[k];d.push(i.Ac);i.n()}b={}}return d};return a}();g.attach=function(a){g.Ab<9&&g.Qa.Cc(a).Ic()};g.detach=function(a){g.Qa.n(a)}};
-            -
            var N=window.PIE,P=element;function init(){N&&doc.media!=="print"&&N.attach(P)}function cleanup(){if(N){N.detach(P);N=P=0}}P.readyState==="complete"&&init();
-            -
            </script>
-            -
            </PUBLIC:COMPONENT>


1	+ <!--
2	+ PIE: CSS3 rendering for IE
3	+ Version 1.0beta4
4	+ http://css3pie.com
5	+ Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
6	+ -->
7	+ <PUBLIC:COMPONENT lightWeight="true">
8	+ <PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
9	+ <PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
10	+ <PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
11	+
12	+ <script type="text/javascript">
13	+ var doc = element.document;var g=window.PIE;
14	+ if(!g){g=window.PIE={F:"-pie-",Sa:"Pie",Pa:"pie_",Jb:{TD:1,TH:1}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(L){}g.J=function(){for(var a=4,b=doc.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return a}();if(g.J===6)g.F=g.F.replace(/^-/,"");g.Ab=doc.documentMode\|\|g.J;(function(){var a,b=0,c={};g.p={Ga:function(e){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+e)},
15	+ ta:function(e){return e&&e._pieId\|\|(e._pieId=++b)},fb:function(e){var f,h,j,d,i=arguments;f=1;for(h=i.length;f<h;f++){d=i[f];for(j in d)if(d.hasOwnProperty(j))e[j]=d[j]}return e},Pb:function(e,f,h){var j=c[e],d,i;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([f,h]):f.call(h,j);else{i=c[e]=[[f,h]];d=new Image;d.onload=function(){j=c[e]={i:d.width,f:d.height};for(var k=0,m=i.length;k<m;k++)i[k][0].call(i[k][1],j);d.onload=null};d.src=e}}}})();g.ia=function(){this.hb=[];this.Db={}};
16	+ g.ia.prototype={aa:function(a){var b=g.p.ta(a),c=this.Db,e=this.hb;if(!(b in c)){c[b]=e.length;e.push(a)}},Ma:function(a){a=g.p.ta(a);var b=this.Db;if(a&&a in b){delete this.hb[b[a]];delete b[a]}},Ia:function(){for(var a=this.hb,b=a.length;b--;)a[b]&&a[b]()}};g.ya=new g.ia;g.ya.Tc=function(){var a=this;if(!a.Uc){setInterval(function(){a.Ia()},250);a.Uc=1}};g.G=new g.ia;window.attachEvent("onbeforeunload",function(){g.G.Ia()});g.G.Ea=function(a,b,c){a.attachEvent(b,c);this.aa(function(){a.detachEvent(b,
17	+ c)})};(function(){function a(){g.za.Ia()}g.za=new g.ia;g.G.Ea(window,"onresize",a)})();(function(){function a(){g.Ra.Ia()}g.Ra=new g.ia;g.G.Ea(window,"onscroll",a);g.za.aa(a)})();(function(){function a(){c=g.Qa.wc()}function b(){if(c){for(var e=0,f=c.length;e<f;e++)g.attach(c[e]);c=0}}var c;g.G.Ea(window,"onbeforeprint",a);g.G.Ea(window,"onafterprint",b)})();g.hd=function(){function a(i){this.V=i}var b=doc.createElement("length-calc"),c=doc.documentElement,e=b.style,f={},h=["mm","cm","in","pt","pc"],
18	+ j=h.length,d={};e.position="absolute";e.top=e.left="-9999px";for(c.appendChild(b);j--;){b.style.width="100"+h[j];f[h[j]]=b.offsetWidth/100}c.removeChild(b);a.prototype={ib:/(px\|em\|ex\|mm\|cm\|in\|pt\|pc\|%)$/,vb:function(){var i=this.Lc;if(i===void 0)i=this.Lc=parseFloat(this.V);return i},ab:function(){var i=this.ad;if(!i)i=this.ad=(i=this.V.match(this.ib))&&i[0]\|\|"px";return i},a:function(i,k){var m=this.vb(),l=this.ab();switch(l){case "px":return m;case "%":return m*(typeof k==="function"?k():k)/100;
19	+ case "em":return mthis.tb(i);case "ex":return mthis.tb(i)/2;default:return m*f[l]}},tb:function(i){var k=i.currentStyle.fontSize;if(k.indexOf("px")>0)return parseFloat(k);else{b.style.width="1em";i.appendChild(b);k=b.offsetWidth;b.parentNode===i&&i.removeChild(b);return k}}};g.k=function(i){return d[i]\|\|(d[i]=new a(i))};return a}();g.Na=function(){function a(f){this.U=f}var b=g.k("50%"),c={top:1,center:1,bottom:1},e={left:1,center:1,right:1};a.prototype={Dc:function(){if(!this.sb){var f=this.U,
20	+ h=f.length,j=g.u,d=j.ja,i=g.k("0");d=d.fa;i=["left",i,"top",i];if(h===1){f.push(new j.Ta(d,"center"));h++}if(h===2){d&(f[0].h\|f[1].h)&&f[0].d in c&&f[1].d in e&&f.push(f.shift());if(f[0].h&d)if(f[0].d==="center")i[1]=b;else i[0]=f[0].d;else if(f[0].Y())i[1]=g.k(f[0].d);if(f[1].h&d)if(f[1].d==="center")i[3]=b;else i[2]=f[1].d;else if(f[1].Y())i[3]=g.k(f[1].d)}this.sb=i}return this.sb},coords:function(f,h,j){var d=this.Dc(),i=d[1].a(f,h);f=d[3].a(f,j);return{x:d[0]==="right"?h-i:i,y:d[2]==="bottom"?
21	+ j-f:f}}};return a}();g.Rb=function(){function a(b){this.V=b}a.prototype={ib:/[a-z]+$/i,ab:function(){return this.lc\|\|(this.lc=this.V.match(this.ib)[0].toLowerCase())},vc:function(){var b=this.fc,c;if(b===undefined){b=this.ab();c=parseFloat(this.V,10);b=this.fc=b==="deg"?c:b==="rad"?c/Math.PI180:b==="grad"?c/400360:b==="turn"?c360:0}return b}};return a}();g.$b=function(){function a(c){this.V=c}var b={};a.Sc=/\srgba$\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d+\|\d\.\d+)\s$\s/;a.gb=
22	+ {aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",
23	+ darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",
24	+ indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",
25	+ mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",
26	+ peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",
27	+ whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ca){var c=this.V,e;if(e=c.match(a.Sc)){this.Ca="rgb("+e[1]+","+e[2]+","+e[3]+")";this.qb=parseFloat(e[4])}else{if((e=c.toLowerCase())in a.gb)c="#"+a.gb[e];this.Ca=c;this.qb=c==="transparent"?0:1}}},O:function(c){this.parse();return this.Ca==="currentColor"?c.currentStyle.color:this.Ca},la:function(){this.parse();return this.qb}};g.pa=function(c){return b[c]\|\|(b[c]=new a(c))};return a}();g.u=function(){function a(c){this.Ha=
28	+ c;this.ch=0;this.U=[];this.wa=0}var b=a.ja={xa:1,ob:2,ea:4,ac:8,pb:16,fa:32,A:64,ga:128,ha:256,Aa:512,dc:1024,URL:2048};a.Ta=function(c,e){this.h=c;this.d=e};a.Ta.prototype={db:function(){return this.h&b.A\|\|this.h&b.ga&&this.d==="0"},Y:function(){return this.db()\|\|this.h&b.Aa}};a.prototype={dd:/\s/,Mc:/^[\+\-]?(\d\.)?\d+/,url:/^url$\s("([^"])"\|'([^'])'\|([!#$%&-~]))\s$/i,zb:/^\-?[_a-z][\w-]/i,Yc:/^("([^"])"\|'([^'])')/,Fc:/^#([\da-f]{6}\|[\da-f]{3})/i,bd:{px:b.A,em:b.A,ex:b.A,mm:b.A,cm:b.A,
29	+ "in":b.A,pt:b.A,pc:b.A,deg:b.xa,rad:b.xa,grad:b.xa},sc:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function e(t,n){t=new a.Ta(t,n);if(!c){k.U.push(t);k.wa++}return t}function f(){k.wa++;return null}var h,j,d,i,k=this;if(this.wa<this.U.length)return this.U[this.wa++];for(;this.dd.test(this.Ha.charAt(this.ch));)this.ch++;if(this.ch>=this.Ha.length)return f();j=this.ch;h=this.Ha.substring(this.ch);d=h.charAt(0);switch(d){case "#":if(i=h.match(this.Fc)){this.ch+=i[0].length;return e(b.ea,i[0])}break;
30	+ case '"':case "'":if(i=h.match(this.Yc)){this.ch+=i[0].length;return e(b.dc,i[2]\|\|i[3]\|\|"")}break;case "/":case ",":this.ch++;return e(b.ha,d);case "u":if(i=h.match(this.url)){this.ch+=i[0].length;return e(b.URL,i[2]\|\|i[3]\|\|i[4]\|\|"")}}if(i=h.match(this.Mc)){d=i[0];this.ch+=d.length;if(h.charAt(d.length)==="%"){this.ch++;return e(b.Aa,d+"%")}if(i=h.substring(d.length).match(this.zb)){d+=i[0];this.ch+=i[0].length;return e(this.bd[i[0].toLowerCase()]\|\|b.ac,d)}return e(b.ga,d)}if(i=h.match(this.zb)){d=
31	+ i[0];this.ch+=d.length;if(d.toLowerCase()in g.$b.gb\|\|d==="currentColor")return e(b.ea,d);if(h.charAt(d.length)==="("){this.ch++;if(d.toLowerCase()in this.sc){h=function(t){return t&&t.h&b.ga};i=function(t){return t&&t.h&(b.ga\|b.Aa)};var m=function(t,n){return t&&t.d===n},l=function(){return k.next(1)};if((d.charAt(0)==="r"?i(l()):h(l()))&&m(l(),",")&&i(l())&&m(l(),",")&&i(l())&&(d==="rgb"\|\|d==="hsa"\|\|m(l(),",")&&h(l()))&&m(l(),")"))return e(b.ea,this.Ha.substring(j,this.ch));return f()}return e(b.pb,
32	+ d)}return e(b.fa,d)}this.ch++;return e(b.ob,d)},z:function(){return this.U[this.wa-- -2]},all:function(){for(;this.next(););return this.U},da:function(c,e){for(var f=[],h,j;h=this.next();){if(c(h)){j=true;this.z();break}f.push(h)}return e&&!j?null:f}};return a}();var M=function(a){this.e=a};M.prototype={K:0,Qc:function(){var a=this.Ua,b;return!a\|\|(b=this.o())&&(a.x!==b.x\|\|a.y!==b.y)},Vc:function(){var a=this.Ua,b;return!a\|\|(b=this.o())&&(a.i!==b.i\|\|a.f!==b.f)},ub:function(){var a=this.e.getBoundingClientRect();
33	+ return{x:a.left,y:a.top,i:a.right-a.left,f:a.bottom-a.top}},o:function(){return this.K?this.Da\|\|(this.Da=this.ub()):this.ub()},Ec:function(){return!!this.Ua},Ja:function(){++this.K},La:function(){if(!--this.K){if(this.Da)this.Ua=this.Da;this.Da=null}}};(function(){function a(b){var c=g.p.ta(b);return function(){if(this.K){var e=this.rb\|\|(this.rb={});return c in e?e[c]:(e[c]=b.call(this))}else return b.call(this)}}g.s={K:0,$:function(b){function c(e){this.e=e}g.p.fb(c.prototype,g.s,b);c.kc={};return c},
34	+ m:function(){var b=this.qa(),c=this.constructor.kc;return b?b in c?c[b]:(c[b]=this.ba(b)):null},qa:a(function(){var b=this.e,c=this.constructor,e=b.style;b=b.currentStyle;var f=this.na,h=this.va,j=c.ic\|\|(c.ic=g.F+f);c=c.jc\|\|(c.jc=g.Sa+h.charAt(0).toUpperCase()+h.substring(1));return e[c]\|\|b.getAttribute(j)\|\|e[h]\|\|b.getAttribute(f)}),g:a(function(){return!!this.m()}),D:a(function(){var b=this.qa(),c=b!==this.gc;this.gc=b;return c}),ma:a,Ja:function(){++this.K},La:function(){--this.K\|\|delete this.rb}}})();
35	+ g.Tb=g.s.$({na:g.F+"background",va:g.Sa+"Background",nc:{scroll:1,fixed:1,local:1},Ka:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},Nc:{"padding-box":1,"border-box":1,"content-box":1},rc:{"padding-box":1,"border-box":1},Rc:{top:1,right:1,bottom:1,left:1,center:1},Wc:{contain:1,cover:1},ba:function(a){function b(u){return u.Y()\|\|u.h&i&&u.d in t}function c(u){return u.Y()&&g.k(u.d)\|\|u.d==="auto"&&"auto"}var e=this.e.currentStyle,f,h,j=g.u.ja,d=j.ha,i=j.fa,k=j.ea,m,l,t=this.Rc,n,p,s=null;if(this.$a()){a=
36	+ new g.u(a);s={M:[]};for(h={};f=a.next();){m=f.h;l=f.d;if(!h.P&&m&j.pb&&l==="linear-gradient"){n={ca:[],P:l};for(p={};f=a.next();){m=f.h;l=f.d;if(m&j.ob&&l===")"){p.color&&n.ca.push(p);n.ca.length>1&&g.p.fb(h,n);break}if(m&k){if(n.Xa\|\|n.bb){f=a.z();if(f.h!==d)break;a.next()}p={color:g.pa(l)};f=a.next();if(f.Y())p.Fb=g.k(f.d);else a.z()}else if(m&j.xa&&!n.Xa&&!p.color&&!n.ca.length)n.Xa=new g.Rb(f.d);else if(b(f)&&!n.bb&&!p.color&&!n.ca.length){a.z();n.bb=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&
37	+ d&&l===","){if(p.color){n.ca.push(p);p={}}}else break}}else if(!h.P&&m&j.URL){h.Cb=l;h.P="image"}else if(b(f)&&!h.size){a.z();h.Ya=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&i)if(l in this.Ka)h.Bb=l;else if(l in this.Nc){h.kd=l;if(l in this.rc)h.clip=l}else{if(l in this.nc)h.jd=l}else if(m&k&&!s.color)s.color=g.pa(l);else if(m&d)if(l==="/"){f=a.next();m=f.h;l=f.d;if(m&i&&l in this.Wc)h.size=l;else if(l=c(f))h.size={i:l,f:c(a.next())\|\|a.z()&&l}}else{if(l===","&&h.P){s.M.push(h);h={}}}else return null}h.P&&
38	+ s.M.push(h)}else this.Nb(function(){var u=e.backgroundPositionX,w=e.backgroundPositionY,r=e.backgroundImage,o=e.backgroundColor;s={};if(o!=="transparent")s.color=g.pa(o);if(r!=="none")s.M=[{P:"image",Cb:(new g.u(r)).next().d,Bb:e.backgroundRepeat,Ya:new g.Na((new g.u(u+" "+w)).all())}]});return s&&(s.color\|\|s.M&&s.M[0])?s:null},Nb:function(a){var b=this.e.runtimeStyle,c=b.backgroundImage,e=b.backgroundColor;if(c)b.backgroundImage="";if(e)b.backgroundColor="";a=a.call(this);if(c)b.backgroundImage=
39	+ c;if(e)b.backgroundColor=e;return a},qa:g.s.ma(function(){return this.$a()\|\|this.Nb(function(){var a=this.e.currentStyle;return a.backgroundColor+" "+a.backgroundImage+" "+a.backgroundRepeat+" "+a.backgroundPositionX+" "+a.backgroundPositionY})}),$a:g.s.ma(function(){var a=this.e;return a.style[this.va]\|\|a.currentStyle.getAttribute(this.na)}),Eb:function(){var a=0;if(g.J<7){a=this.e;a=""+(a.style[g.Sa+"PngFix"]\|\|a.currentStyle.getAttribute(g.F+"png-fix"))==="true"}return a},g:g.s.ma(function(){return(this.$a()\|\|
40	+ this.Eb())&&!!this.m()})});g.Xb=g.s.$({Ib:["Top","Right","Bottom","Left"],Kc:{thin:"1px",medium:"3px",thick:"5px"},ba:function(){var a={},b={},c={},e=false,f=true,h=true,j=true;this.Ob(function(){for(var d=this.e.currentStyle,i=0,k,m,l,t,n,p,s;i<4;i++){l=this.Ib[i];s=l.charAt(0).toLowerCase();k=b[s]=d["border"+l+"Style"];m=d["border"+l+"Color"];l=d["border"+l+"Width"];if(i>0){if(k!==t)h=false;if(m!==n)f=false;if(l!==p)j=false}t=k;n=m;p=l;c[s]=g.pa(m);l=a[s]=g.k(b[s]==="none"?"0":this.Kc[l]\|\|l);if(l.a(this.e)>
41	+ 0)e=true}});return e?{nb:a,Zc:b,tc:c,ed:j,uc:f,$c:h}:null},qa:g.s.ma(function(){var a=this.e,b=a.currentStyle,c;a.tagName in g.Jb&&a.offsetParent.currentStyle.borderCollapse==="collapse"\|\|this.Ob(function(){c=b.borderWidth+"\|"+b.borderStyle+"\|"+b.borderColor});return c}),Ob:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,e=b.borderColor;if(c)b.borderWidth="";if(e)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(e)b.borderColor=e;return a}});(function(){g.Oa=g.s.$({na:"border-radius",
42	+ va:"borderRadius",ba:function(b){var c=null,e,f,h,j,d=false;if(b){f=new g.u(b);var i=function(){for(var k=[],m;(h=f.next())&&h.Y();){j=g.k(h.d);m=j.vb();if(m<0)return null;if(m>0)d=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]\|\|k[0],br:k[2]\|\|k[0],bl:k[3]\|\|k[1]\|\|k[0]}:null};if(b=i()){if(h){if(h.h&g.u.ja.ha&&h.d==="/")e=i()}else e=b;if(d&&b&&e)c={x:b,y:e}}}return c}});var a=g.k("0");a={tl:a,tr:a,br:a,bl:a};g.Oa.Qb={x:a,y:a}})();g.Vb=g.s.$({na:"border-image",va:"borderImage",Ka:{stretch:1,
43	+ round:1,repeat:1,space:1},ba:function(a){var b=null,c,e,f,h,j,d,i=0,k,m=g.u.ja,l=m.fa,t=m.ga,n=m.A,p=m.Aa;if(a){c=new g.u(a);b={};for(var s=function(r){return r&&r.h&m.ha&&r.d==="/"},u=function(r){return r&&r.h&l&&r.d==="fill"},w=function(){h=c.da(function(r){return!(r.h&(t\|p))});if(u(c.next())&&!b.fill)b.fill=true;else c.z();if(s(c.next())){i++;j=c.da(function(){return!(e.h&(t\|p\|n))&&!(e.h&l&&e.d==="auto")});if(s(c.next())){i++;d=c.da(function(){return!(e.h&(t\|n))})}}else c.z()};e=c.next();){a=e.h;
44	+ f=e.d;if(a&(t\|p)&&!h){c.z();w()}else if(u(e)&&!b.fill){b.fill=true;w()}else if(a&l&&this.Ka[f]&&!b.repeat){b.repeat={f:f};if(e=c.next())if(e.h&l&&this.Ka[e.d])b.repeat.kb=e.d;else c.z()}else if(a&m.URL&&!b.src)b.src=f;else return null}if(!b.src\|\|!h\|\|h.length<1\|\|h.length>4\|\|j&&j.length>4\|\|i===1&&j.length<1\|\|d&&d.length>4\|\|i===2&&d.length<1)return null;if(!b.repeat)b.repeat={f:"stretch"};if(!b.repeat.kb)b.repeat.kb=b.repeat.f;a=function(r,o){return{T:o(r[0]),S:o(r[1]\|\|r[0]),L:o(r[2]\|\|r[0]),Q:o(r[3]\|\|
45	+ r[1]\|\|r[0])}};b.slice=a(h,function(r){return g.k(r.h&t?r.d+"px":r.d)});b.width=j&&j.length>0?a(j,function(r){return r.h&(n\|p)?g.k(r.d):r.d}):(k=this.e.currentStyle)&&{T:g.k(k.borderTopWidth),S:g.k(k.borderRightWidth),L:g.k(k.borderBottomWidth),Q:g.k(k.borderLeftWidth)};b.ua=a(d\|\|[0],function(r){return r.h&n?g.k(r.d):r.d})}return b}});g.Zb=g.s.$({na:"box-shadow",va:"boxShadow",ba:function(a){var b,c=g.k,e=g.u.ja,f;if(a){f=new g.u(a);b={ua:[],cb:[]};for(a=function(){for(var h,j,d,i,k,m;h=f.next();){d=
46	+ h.d;j=h.h;if(j&e.ha&&d===",")break;else if(h.db()&&!k){f.z();k=f.da(function(l){return!l.db()})}else if(j&e.ea&&!i)i=d;else if(j&e.fa&&d==="inset"&&!m)m=true;else return false}h=k&&k.length;if(h>1&&h<5){(m?b.cb:b.ua).push({fd:c(k[0].d),gd:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Xc:c(k[3]?k[3].d:"0"),color:g.pa(i\|\|"currentColor")});return true}return false};a(););}return b&&(b.cb.length\|\|b.ua.length)?b:null}});g.ec=g.s.$({qa:g.s.ma(function(){var a=this.e.currentStyle;return a.visibility+"\|"+a.display}),
47	+ ba:function(){var a=this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,e;b.visibility="";e=a.visibility;b.visibility=c;return{cd:e!=="hidden",xc:a.display!=="none"}},g:function(){return false}});g.B={Z:function(a){function b(c,e,f,h){this.e=c;this.q=e;this.j=f;this.parent=h}g.p.fb(b.prototype,g.B,a);return b},eb:false,R:function(){return false},Kb:function(){this.n();this.g()&&this.X()},jb:function(){this.eb=true},Lb:function(){this.g()?this.X():this.n()},Wa:function(a,b){this.Hb(a);for(var c=
48	+ this.ka\|\|(this.ka=[]),e=a+1,f=c.length,h;e<f;e++)if(h=c[e])break;c[a]=b;this.w().insertBefore(b,h\|\|null)},ra:function(a){var b=this.ka;return b&&b[a]\|\|null},Hb:function(a){var b=this.ra(a),c=this.Ba;if(b&&c){c.removeChild(b);this.ka[a]=null}},sa:function(a,b,c,e){var f=this.Va\|\|(this.Va={}),h=f[a];if(!h){h=f[a]=g.p.Ga("shape");if(b)h.appendChild(h[b]=g.p.Ga(b));if(e){c=this.ra(e);if(!c){this.Wa(e,doc.createElement("group"+e));c=this.ra(e)}}c.appendChild(h);a=h.style;a.position="absolute";a.left=a.top=
49	+ 0;a.behavior="url(#default#VML)"}return h},Za:function(a){var b=this.Va,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},xb:function(a){var b=this.e,c=this.q.o(),e=c.i,f=c.f,h,j,d,i,k,m;c=a.x.tl.a(b,e);h=a.y.tl.a(b,f);j=a.x.tr.a(b,e);d=a.y.tr.a(b,f);i=a.x.br.a(b,e);k=a.y.br.a(b,f);m=a.x.bl.a(b,e);a=a.y.bl.a(b,f);e=Math.min(e/(c+j),f/(d+k),e/(m+i),f/(h+a));if(e<1){c=e;h=e;j=e;d=e;i=e;k=e;m=e;a=e}return{x:{tl:c,tr:j,br:i,bl:m},y:{tl:h,tr:d,br:k,bl:a}}},oa:function(a,b,c){b=
50	+ b\|\|1;var e,f,h=this.q.o();f=h.ib;h=h.fb;var j=this.j.v,d=Math.floor,i=Math.ceil,k=a?a.Tb:0,m=a?a.Sb:0,l=a?a.Lb:0;a=a?a.Qb:0;var t,n,p,s,u;if(c\|\|j.g()){e=this.xb(c\|\|j.m());c=e.x.tlb;j=e.y.tlb;t=e.x.trb;n=e.y.trb;p=e.x.brb;s=e.y.brb;u=e.x.blb;b=e.y.blb;f="m"+d(a)+","+d(j)+"qy"+d(c)+","+d(k)+"l"+i(f-t)+","+d(k)+"qx"+i(f-m)+","+d(n)+"l"+i(f-m)+","+i(h-s)+"qy"+i(f-p)+","+i(h-l)+"l"+d(u)+","+i(h-l)+"qx"+d(a)+","+i(h-b)+" x e"}else f="m"+d(a)+","+d(k)+"l"+i(f-m)+","+d(k)+"l"+i(f-m)+","+i(h-
51	+ l)+"l"+d(a)+","+i(h-l)+"xe";return f},w:function(){var a=this.parent.ra(this.C),b;if(!a){a=doc.createElement(this.Fa);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.Wa(this.C,a)}return a},n:function(){this.parent.Hb(this.C);delete this.Va;delete this.ka}};g.cc=g.B.Z({g:function(){var a=this.oc;for(var b in a)if(a.hasOwnProperty(b)&&a[b].g())return true;return false},R:function(){return this.j.lb.D()},jb:function(){if(this.g()){var a=this.wb(),b=a,c;a=a.currentStyle;var e=a.position,f=
52	+ this.w().style,h=0,j=0;j=this.q.o();if(e==="fixed"&&g.J>6){h=j.x;j=j.y;b=e}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;h=j.x-c.left-(parseFloat(b.borderLeftWidth)\|\|0);j=j.y-c.top-(parseFloat(b.borderTopWidth)\|\|0)}else{b=doc.documentElement;h=j.x+b.scrollLeft-b.clientLeft;j=j.y+b.scrollTop-b.clientTop}b="absolute"}f.position=b;f.left=h;f.top=j;f.zIndex=e==="static"?-1:a.zIndex;this.eb=true}},Lb:function(){},Mb:function(){var a=
53	+ this.j.lb.m();this.w().style.display=a.cd&&a.xc?"":"none"},Kb:function(){this.g()?this.Mb():this.n()},wb:function(){var a=this.e;return a.tagName in g.Jb?a.offsetParent:a},w:function(){var a=this.Ba,b;if(!a){b=this.wb();a=this.Ba=doc.createElement("css3-container");a.style.direction="ltr";this.Mb();b.parentNode.insertBefore(a,b)}return a},n:function(){var a=this.Ba,b;if(a&&(b=a.parentNode))b.removeChild(a);delete this.Ba;delete this.ka}});g.Sb=g.B.Z({C:2,Fa:"background",R:function(){var a=this.j;
54	+ return a.H.D()\|\|a.v.D()},g:function(){var a=this.j;return a.N.g()\|\|a.v.g()\|\|a.H.g()\|\|a.W.g()&&a.W.m().cb},X:function(){var a=this.q.o();if(a.i&&a.f){this.yc();this.zc()}},yc:function(){var a=this.j.H.m(),b=this.q.o(),c=this.e,e=a&&a.color,f,h;if(e&&e.la()>0){this.yb();a=this.sa("bgColor","fill",this.w(),1);f=b.i;b=b.f;a.stroked=false;a.coordsize=f2+","+b2;a.coordorigin="1,1";a.path=this.oa(null,2);h=a.style;h.width=f;h.height=b;a.fill.color=e.O(c);c=e.la();if(c<1)a.fill.opacity=c}else this.Za("bgColor")},
55	+ zc:function(){var a=this.j.H.m(),b=this.q.o();a=a&&a.M;var c,e,f,h,j;if(a){this.yb();e=b.i;f=b.f;for(j=a.length;j--;){b=a[j];c=this.sa("bgImage"+j,"fill",this.w(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=e2+","+f2;c.coordorigin="1,1";c.path=this.oa(0,2);h=c.style;h.width=e;h.height=f;if(b.P==="linear-gradient")this.mc(c,b);else{c.fill.src=b.Cb;this.Pc(c,j)}}}for(j=a?a.length:0;this.Za("bgImage"+j++););},Pc:function(a,b){g.p.Pb(a.fill.src,function(c){var e=a.fill,f=this.e,
56	+ h=this.q.o(),j=h.i;h=h.f;var d=this.j,i=d.I.m(),k=i&&i.nb;i=k?k.t.a(f):0;var m=k?k.r.a(f):0,l=k?k.b.a(f):0;k=k?k.l.a(f):0;d=d.H.m().M[b];f=d.Ya?d.Ya.coords(f,j-c.i-k-m,h-c.f-i-l):{x:0,y:0};d=d.Bb;l=m=0;var t=j+1,n=h+1,p=g.J===8?0:1;k=Math.round(f.x)+k+0.5;i=Math.round(f.y)+i+0.5;e.position=k/j+","+i/h;if(d&&d!=="repeat"){if(d==="repeat-x"\|\|d==="no-repeat"){m=i+1;n=i+c.f+p}if(d==="repeat-y"\|\|d==="no-repeat"){l=k+1;t=k+c.i+p}a.style.clip="rect("+m+"px,"+t+"px,"+n+"px,"+l+"px)"}},this)},mc:function(a,
57	+ b){function c(B,C,z,F,H){if(z===0\|\|z===180)return[F,C];else if(z===90\|\|z===270)return[B,H];else{z=Math.tan(-zt/180);B=zB-C;C=-1/z;F=CF-H;H=C-z;return[(F-B)/H,(zF-CB)/H]}}function e(){w=m>=90&&m<270?i:0;r=m<180?k:0;o=i-w;x=k-r}function f(){for(;m<0;)m+=360;m%=360}function h(B,C){var z=C[0]-B[0];B=C[1]-B[1];return Math.abs(z===0?B:B===0?z:Math.sqrt(zz+B*B))}var j=this.e,d=this.q.o(),i=d.i,k=d.f;a=a.fill;var m=b.Xa,l=b.bb;b=b.ca;d=b.length;var t=Math.PI,n,p,s,u,w,r,o,x,q,y,A,D;if(l){l=l.coords(j,
58	+ i,k);n=l.x;p=l.y}if(m){m=m.vc();f();e();if(!l){n=w;p=r}l=c(n,p,m,o,x);s=l[0];u=l[1]}else if(l){s=i-n;u=k-p}else{n=p=s=0;u=k}l=s-n;q=u-p;if(m===void 0){m=!l?q<0?90:270:!q?l<0?180:0:-Math.atan2(q,l)/t180;f();e()}l=m%90?Math.atan2(li/k,q)/t180:m+90;l+=180;l%=360;y=h([n,p],[s,u]);s=h([w,r],c(w,r,m,o,x));u=[];p=h([n,p],c(n,p,m,w,r))/s100;n=[];for(q=0;q<d;q++)n.push(b[q].Fb?b[q].Fb.a(j,y):q===0?0:q===d-1?y:null);for(q=1;q<d;q++){if(n[q]===null){A=n[q-1];y=q;do D=n[++y];while(D===null);n[q]=A+(D-A)/
59	+ (y-q+1)}n[q]=Math.max(n[q],n[q-1])}for(q=0;q<d;q++)u.push(p+n[q]/s*100+"% "+b[q].color.O(j));a.angle=l;a.type="gradient";a.method="sigma";a.color=b[0].color.O(j);a.color2=b[d-1].color.O(j);a.colors.value=u.join(",")},yb:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},n:function(){g.B.n.call(this);var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});g.Wb=g.B.Z({C:4,Fa:"border",qc:{TABLE:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,
60	+ IMG:1,HR:1,FIELDSET:1},Jc:{submit:1,button:1,reset:1},R:function(){var a=this.j;return a.I.D()\|\|a.v.D()},g:function(){var a=this.j;return(a.N.g()\|\|a.v.g()\|\|a.H.g())&&a.I.g()},X:function(){var a=this.e,b=this.j.I.m(),c=this.q.o(),e=c.i;c=c.f;var f,h,j,d,i;if(b){this.Hc();b=this.Bc(2);d=0;for(i=b.length;d<i;d++){j=b[d];f=this.sa("borderPiece"+d,j.stroke?"stroke":"fill",this.w());f.coordsize=e2+","+c2;f.coordorigin="1,1";f.path=j.path;h=f.style;h.width=e;h.height=c;f.filled=!!j.fill;f.stroked=!!j.stroke;
61	+ if(j.stroke){f=f.stroke;f.weight=j.mb+"px";f.color=j.color.O(a);f.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";f.linestyle=j.stroke==="double"&&j.mb>2?"ThinThin":"Single"}else f.fill.color=j.fill.O(a)}for(;this.Za("borderPiece"+d++););}},Hc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,e=a.tagName,f=g.J===6,h;if(f&&e in this.qc\|\|e==="BUTTON"\|\|e==="INPUT"&&a.type in this.Jc){c.borderWidth="";e=this.j.I.Ib;for(h=e.length;h--;){f=e[h];c["padding"+f]="";c["padding"+
62	+ f]=g.k(b["padding"+f]).a(a)+g.k(b["border"+f+"Width"]).a(a)+(!g.J===8&&h%2?1:0)}c.borderWidth=0}else if(f){if(a.childNodes.length!==1\|\|a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");e=b.style;e.visibility="visible";for(e.zoom=1;e=a.firstChild;)b.appendChild(e);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},Bc:function(a){var b=this.e,c,e,f,h=this.j.I,j=[],d,i,k,m,l=Math.round,t,n,p;if(h.g()){c=h.m();h=c.nb;n=c.Zc;p=c.tc;if(c.ed&&c.$c&&c.uc){if(p.t.la()>
63	+ 0){c=h.t.a(b);k=c/2;j.push({path:this.oa({T:k,S:k,L:k,Q:k},a),stroke:n.t,color:p.t,mb:c})}}else{a=a\|\|1;c=this.q.o();e=c.i;f=c.f;c=l(h.t.a(b));k=l(h.r.a(b));m=l(h.b.a(b));b=l(h.l.a(b));var s={t:c,r:k,b:m,l:b};b=this.j.v;if(b.g())t=this.xb(b.m());d=Math.floor;i=Math.ceil;var u=function(o,x){return t?t[o][x]:0},w=function(o,x,q,y,A,D){var B=u("x",o),C=u("y",o),z=o.charAt(1)==="r";o=o.charAt(0)==="b";return B>0&&C>0?(D?"al":"ae")+(z?i(e-B):d(B))a+","+(o?i(f-C):d(C))a+","+(d(B)-x)a+","+(d(C)-q)a+","+
64	+ y65535+","+2949075(A?1:-1):(D?"m":"l")+(z?e-x:x)a+","+(o?f-q:q)a},r=function(o,x,q,y){var A=o==="t"?d(u("x","tl"))a+","+i(x)a:o==="r"?i(e-x)a+","+d(u("y","tr"))a:o==="b"?i(e-u("x","br"))a+","+d(f-x)a:d(x)a+","+i(f-u("y","bl"))a;o=o==="t"?i(e-u("x","tr"))a+","+i(x)a:o==="r"?i(e-x)a+","+i(f-u("y","br"))a:o==="b"?d(u("x","bl"))a+","+d(f-x)a:d(x)a+","+d(u("y","tl"))a;return q?(y?"m"+o:"")+"l"+A:(y?"m"+A:"")+"l"+o};b=function(o,x,q,y,A,D){var B=o==="l"\|\|o==="r",C=s[o],z,F;if(C>0&&n[o]!==
65	+ "none"&&p[o].la()>0){z=s[B?o:x];x=s[B?x:o];F=s[B?o:q];q=s[B?q:o];if(n[o]==="dashed"\|\|n[o]==="dotted"){j.push({path:w(y,z,x,D+45,0,1)+w(y,0,0,D,1,0),fill:p[o]});j.push({path:r(o,C/2,0,1),stroke:n[o],mb:C,color:p[o]});j.push({path:w(A,F,q,D,0,1)+w(A,0,0,D-45,1,0),fill:p[o]})}else j.push({path:w(y,z,x,D+45,0,1)+r(o,C,0,0)+w(A,F,q,D,0,0)+(n[o]==="double"&&C>2?w(A,F-d(F/3),q-d(q/3),D-45,1,0)+r(o,i(C/3*2),1,0)+w(y,z-d(z/3),x-d(x/3),D,1,0)+"x "+w(y,d(z/3),d(x/3),D+45,0,1)+r(o,d(C/3),1,0)+w(A,d(F/3),d(q/
66	+ 3),D,0,0):"")+w(A,0,0,D-45,1,0)+r(o,0,1,0)+w(y,0,0,D,1,0),fill:p[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},n:function(){g.B.n.call(this);this.e.runtimeStyle.borderColor=""}});g.Ub=g.B.Z({C:5,Oc:["t","tr","r","br","b","bl","l","tl","c"],R:function(){return this.j.N.D()},g:function(){return this.j.N.g()},X:function(){this.w();var a=this.j.N.m(),b=this.q.o(),c=this.e,e=this.Gb;g.p.Pb(a.src,function(f){function h(w,
67	+ r,o,x,q){w=e[w].style;var y=Math.max;w.width=y(r,0);w.height=y(o,0);w.left=x;w.top=q}function j(w,r,o){for(var x=0,q=w.length;x<q;x++)e[w[x]].imagedata[r]=o}var d=b.i,i=b.f,k=a.width,m=k.T.a(c),l=k.S.a(c),t=k.L.a(c);k=k.Q.a(c);var n=a.slice,p=n.T.a(c),s=n.S.a(c),u=n.L.a(c);n=n.Q.a(c);h("tl",k,m,0,0);h("t",d-k-l,m,k,0);h("tr",l,m,d-l,0);h("r",l,i-m-t,d-l,m);h("br",l,t,d-l,i-t);h("b",d-k-l,t,k,i-t);h("bl",k,t,0,i-t);h("l",k,i-m-t,0,m);h("c",d-k-l,i-m-t,k,m);j(["tl","t","tr"],"cropBottom",(f.f-p)/f.f);
68	+ j(["tl","l","bl"],"cropRight",(f.i-n)/f.i);j(["bl","b","br"],"cropTop",(f.f-u)/f.f);j(["tr","r","br"],"cropLeft",(f.i-s)/f.i);if(a.repeat.kb==="stretch"){j(["l","r","c"],"cropTop",p/f.f);j(["l","r","c"],"cropBottom",u/f.f)}if(a.repeat.f==="stretch"){j(["t","b","c"],"cropLeft",n/f.i);j(["t","b","c"],"cropRight",s/f.i)}e.c.style.display=a.fill?"":"none"},this)},w:function(){var a=this.parent.ra(this.C),b,c,e,f=this.Oc,h=f.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";
69	+ this.Gb={};for(e=0;e<h;e++){c=this.Gb[f[e]]=g.p.Ga("rect");c.appendChild(g.p.Ga("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.j.N.m().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.Wa(this.C,a)}return a}});g.Yb=g.B.Z({C:1,Fa:"outset-box-shadow",R:function(){var a=this.j;return a.W.D()\|\|a.v.D()},g:function(){var a=this.j.W;return a.g()&&a.m().ua[0]},X:function(){function a(z,F,H,K,J,v,E){z=b.sa("shadow"+z+F,"fill",
70	+ e,j-z);F=z.fill;z.coordsize=m2+","+l2;z.coordorigin="1,1";z.stroked=false;z.filled=true;F.color=J.O(c);if(v){F.type="gradienttitle";F.color2=F.color;F.opacity=0}z.path=E;u=z.style;u.left=H;u.top=K;u.width=m;u.height=l;return z}var b=this,c=this.e,e=this.w(),f=this.j,h=f.W.m().ua;f=f.v.m();var j=h.length,d=j,i,k=this.q.o(),m=k.i,l=k.f;k=g.J===8?1:0;for(var t=["tl","tr","br","bl"],n,p,s,u,w,r,o,x,q,y,A,D,B,C;d--;){p=h[d];w=p.fd.a(c);r=p.gd.a(c);i=p.Xc.a(c);o=p.blur.a(c);p=p.color;x=-i-o;if(!f&&o)f=
71	+ g.Oa.Qb;x=this.oa({T:x,S:x,L:x,Q:x},2,f);if(o){q=(i+o)2+m;y=(i+o)2+l;A=o2/q;D=o2/y;if(o-i>m/2\|\|o-i>l/2)for(i=4;i--;){n=t[i];B=n.charAt(0)==="b";C=n.charAt(1)==="r";n=a(d,n,w,r,p,o,x);s=n.fill;s.focusposition=(C?1-A:A)+","+(B?1-D:D);s.focussize="0,0";n.style.clip="rect("+((B?y/2:0)+k)+"px,"+(C?q:q/2)+"px,"+(B?y:y/2)+"px,"+((C?q/2:0)+k)+"px)"}else{n=a(d,"",w,r,p,o,x);s=n.fill;s.focusposition=A+","+D;s.focussize=1-A2+","+(1-D2)}}else{n=a(d,"",w,r,p,o,x);w=p.la();if(w<1)n.fill.opacity=w}}}});g.bc=
72	+ g.B.Z({C:6,Fa:"imgEl",R:function(){var a=this.j;return this.e.src!==this.hc\|\|a.v.D()},g:function(){var a=this.j;return a.v.g()\|\|a.H.Eb()},X:function(){this.hc=j;this.Gc();var a=this.sa("img","fill",this.w()),b=a.fill,c=this.q.o(),e=c.i;c=c.f;var f=this.j.I.m();f=f&&f.nb;var h=this.e,j=h.src,d=Math.round;a.stroked=false;b.type="frame";b.src=j;b.position=(e?0.5/e:0)+","+(c?0.5/c:0);a.coordsize=e2+","+c2;a.coordorigin="1,1";a.path=this.oa(f?{T:d(f.t.a(h)),S:d(f.r.a(h)),L:d(f.b.a(h)),Q:d(f.l.a(h))}:
73	+ 0,2);a=a.style;a.width=e;a.height=c},Gc:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},n:function(){g.B.n.call(this);this.e.runtimeStyle.filter=""}});g.Qa=function(){function a(d){function i(){if(!z){var v,E,G=d.currentStyle,I=G.getAttribute(c)==="true";J=G.getAttribute(e);J=g.Ab===8?J!=="false":J==="true";if(!C){C=1;d.runtimeStyle.zoom=1;G=d;for(var O=1;G=G.previousSibling;)if(G.nodeType===1){O=0;break}if(O)d.className+=" "+g.Pa+"first-child"}y.Ja();if(I&&(E=y.o())&&(v=doc.documentElement\|\|
74	+ doc.body)&&(E.y>v.clientHeight\|\|E.x>v.clientWidth\|\|E.y+E.f<0\|\|E.x+E.i<0)){if(!H){H=1;g.Ra.aa(i)}}else{z=1;H=C=0;g.Ra.Ma(i);A={H:new g.Tb(d),I:new g.Xb(d),N:new g.Vb(d),v:new g.Oa(d),W:new g.Zb(d),lb:new g.ec(d)};D=[A.H,A.I,A.N,A.v,A.W,A.lb];v=new g.cc(d,y,A);E=[new g.Yb(d,y,A,v),new g.Sb(d,y,A,v),new g.Wb(d,y,A,v),new g.Ub(d,y,A,v)];d.tagName==="IMG"&&E.push(new g.bc(d,y,A,v));v.oc=E;q=[v].concat(E);if(v=d.currentStyle.getAttribute(g.F+"watch-ancestors")){B=[];v=parseInt(v,10);E=0;for(I=d.parentNode;I&&
75	+ (v==="NaN"\|\|E++<v);){B.push(I);I.attachEvent("onpropertychange",u);I.attachEvent("onmouseenter",p);I.attachEvent("onmouseleave",s);I=I.parentNode}}if(J){g.ya.aa(m);g.ya.Tc()}m(1)}if(!F){F=1;d.attachEvent("onmove",k);d.attachEvent("onresize",k);d.attachEvent("onpropertychange",l);d.attachEvent("onmouseenter",p);d.attachEvent("onmouseleave",s);g.za.aa(k);g.G.aa(o)}y.La()}}function k(){y&&y.Ec()&&m()}function m(v){if(!K)if(z){var E,G;w();if(v\|\|y.Qc()){E=0;for(G=q.length;E<G;E++)q[E].jb()}if(v\|\|y.Vc()){E=
76	+ 0;for(G=q.length;E<G;E++)q[E].Lb()}r()}else C\|\|i()}function l(){var v,E,G;v=event;if(!K&&!(v&&v.propertyName in j))if(z){w();v=0;for(E=q.length;v<E;v++){G=q[v];G.eb\|\|G.jb();G.R()&&G.Kb()}r()}else C\|\|i()}function t(){if(d)d.className+=f}function n(){if(d)d.className=d.className.replace(h,"")}function p(){setTimeout(t,0)}function s(){setTimeout(n,0)}function u(){var v=event.propertyName;if(v==="className"\|\|v==="id")l()}function w(){y.Ja();for(var v=D.length;v--;)D[v].Ja()}function r(){for(var v=D.length;v--;)D[v].La();
77	+ y.La()}function o(){if(F){if(B)for(var v=0,E=B.length,G;v<E;v++){G=B[v];G.detachEvent("onpropertychange",u);G.detachEvent("onmouseenter",p);G.detachEvent("onmouseleave",s)}d.detachEvent("onmove",m);d.detachEvent("onresize",m);d.detachEvent("onpropertychange",l);d.detachEvent("onmouseenter",p);d.detachEvent("onmouseleave",s);g.G.Ma(o);F=0}}function x(){if(!K){var v,E;o();K=1;if(q){v=0;for(E=q.length;v<E;v++)q[v].n()}J&&g.ya.Ma(m);g.za.Ma(m);q=y=A=D=B=d=null}}var q,y=new M(d),A,D,B,C,z,F,H,K,J;this.Ic=
78	+ i;this.update=m;this.n=x;this.Ac=d}var b={},c=g.F+"lazy-init",e=g.F+"poll",f=" "+g.Pa+"hover",h=new RegExp("\\b"+g.Pa+"hover\\b","g"),j={background:1,bgColor:1,display:1};a.Cc=function(d){var i=g.p.ta(d);return b[i]\|\|(b[i]=new a(d))};a.n=function(d){d=g.p.ta(d);var i=b[d];if(i){i.n();delete b[d]}};a.wc=function(){var d=[],i;if(b){for(var k in b)if(b.hasOwnProperty(k)){i=b[k];d.push(i.Ac);i.n()}b={}}return d};return a}();g.attach=function(a){g.Ab<9&&g.Qa.Cc(a).Ic()};g.detach=function(a){g.Qa.n(a)}};
79	+ var N=window.PIE,P=element;function init(){N&&doc.media!=="print"&&N.attach(P)}function cleanup(){if(N){N.detach(P);N=P=0}}P.readyState==="complete"&&init();
80	+ </script>
81	+ </PUBLIC:COMPONENT>

js/PIE/PIE.js CHANGED Viewed

@@ -1,74 +1,74 @@
-            -
            /*
-            -
            PIE: CSS3 rendering for IE
-            -
            Version 1.0beta4
-            -
            http://css3pie.com
-            -
            Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
-            -
            */
-            -
            (function(){
-            -
            var doc = document;var g=window.PIE;
-            -
            if(!g){g=window.PIE={F:"-pie-",Sa:"Pie",Pa:"pie_",Jb:{TD:1,TH:1}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(L){}g.J=function(){for(var a=4,b=doc.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return a}();if(g.J===6)g.F=g.F.replace(/^-/,"");g.Ab=doc.documentMode||g.J;(function(){var a,b=0,c={};g.p={Ga:function(e){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+e)},
-            -
            ta:function(e){return e&&e._pieId||(e._pieId=++b)},fb:function(e){var f,h,j,d,i=arguments;f=1;for(h=i.length;f<h;f++){d=i[f];for(j in d)if(d.hasOwnProperty(j))e[j]=d[j]}return e},Pb:function(e,f,h){var j=c[e],d,i;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([f,h]):f.call(h,j);else{i=c[e]=[[f,h]];d=new Image;d.onload=function(){j=c[e]={i:d.width,f:d.height};for(var k=0,m=i.length;k<m;k++)i[k][0].call(i[k][1],j);d.onload=null};d.src=e}}}})();g.ia=function(){this.hb=[];this.Db={}};
-            -
            g.ia.prototype={aa:function(a){var b=g.p.ta(a),c=this.Db,e=this.hb;if(!(b in c)){c[b]=e.length;e.push(a)}},Ma:function(a){a=g.p.ta(a);var b=this.Db;if(a&&a in b){delete this.hb[b[a]];delete b[a]}},Ia:function(){for(var a=this.hb,b=a.length;b--;)a[b]&&a[b]()}};g.ya=new g.ia;g.ya.Tc=function(){var a=this;if(!a.Uc){setInterval(function(){a.Ia()},250);a.Uc=1}};g.G=new g.ia;window.attachEvent("onbeforeunload",function(){g.G.Ia()});g.G.Ea=function(a,b,c){a.attachEvent(b,c);this.aa(function(){a.detachEvent(b,
-            -
            c)})};(function(){function a(){g.za.Ia()}g.za=new g.ia;g.G.Ea(window,"onresize",a)})();(function(){function a(){g.Ra.Ia()}g.Ra=new g.ia;g.G.Ea(window,"onscroll",a);g.za.aa(a)})();(function(){function a(){c=g.Qa.wc()}function b(){if(c){for(var e=0,f=c.length;e<f;e++)g.attach(c[e]);c=0}}var c;g.G.Ea(window,"onbeforeprint",a);g.G.Ea(window,"onafterprint",b)})();g.hd=function(){function a(i){this.V=i}var b=doc.createElement("length-calc"),c=doc.documentElement,e=b.style,f={},h=["mm","cm","in","pt","pc"],
-            -
            j=h.length,d={};e.position="absolute";e.top=e.left="-9999px";for(c.appendChild(b);j--;){b.style.width="100"+h[j];f[h[j]]=b.offsetWidth/100}c.removeChild(b);a.prototype={ib:/(px|em|ex|mm|cm|in|pt|pc|%)$/,vb:function(){var i=this.Lc;if(i===void 0)i=this.Lc=parseFloat(this.V);return i},ab:function(){var i=this.ad;if(!i)i=this.ad=(i=this.V.match(this.ib))&&i[0]||"px";return i},a:function(i,k){var m=this.vb(),l=this.ab();switch(l){case "px":return m;case "%":return m*(typeof k==="function"?k():k)/100;
-            -
            case "em":return m*this.tb(i);case "ex":return m*this.tb(i)/2;default:return m*f[l]}},tb:function(i){var k=i.currentStyle.fontSize;if(k.indexOf("px")>0)return parseFloat(k);else{b.style.width="1em";i.appendChild(b);k=b.offsetWidth;b.parentNode===i&&i.removeChild(b);return k}}};g.k=function(i){return d[i]||(d[i]=new a(i))};return a}();g.Na=function(){function a(f){this.U=f}var b=g.k("50%"),c={top:1,center:1,bottom:1},e={left:1,center:1,right:1};a.prototype={Dc:function(){if(!this.sb){var f=this.U,
-            -
            h=f.length,j=g.u,d=j.ja,i=g.k("0");d=d.fa;i=["left",i,"top",i];if(h===1){f.push(new j.Ta(d,"center"));h++}if(h===2){d&(f[0].h|f[1].h)&&f[0].d in c&&f[1].d in e&&f.push(f.shift());if(f[0].h&d)if(f[0].d==="center")i[1]=b;else i[0]=f[0].d;else if(f[0].Y())i[1]=g.k(f[0].d);if(f[1].h&d)if(f[1].d==="center")i[3]=b;else i[2]=f[1].d;else if(f[1].Y())i[3]=g.k(f[1].d)}this.sb=i}return this.sb},coords:function(f,h,j){var d=this.Dc(),i=d[1].a(f,h);f=d[3].a(f,j);return{x:d[0]==="right"?h-i:i,y:d[2]==="bottom"?
-            -
            j-f:f}}};return a}();g.Rb=function(){function a(b){this.V=b}a.prototype={ib:/[a-z]+$/i,ab:function(){return this.lc||(this.lc=this.V.match(this.ib)[0].toLowerCase())},vc:function(){var b=this.fc,c;if(b===undefined){b=this.ab();c=parseFloat(this.V,10);b=this.fc=b==="deg"?c:b==="rad"?c/Math.PI*180:b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();g.$b=function(){function a(c){this.V=c}var b={};a.Sc=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.gb=
-            -
            {aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",
-            -
            darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",
-            -
            indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",
-            -
            mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",
-            -
            peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",
-            -
            whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ca){var c=this.V,e;if(e=c.match(a.Sc)){this.Ca="rgb("+e[1]+","+e[2]+","+e[3]+")";this.qb=parseFloat(e[4])}else{if((e=c.toLowerCase())in a.gb)c="#"+a.gb[e];this.Ca=c;this.qb=c==="transparent"?0:1}}},O:function(c){this.parse();return this.Ca==="currentColor"?c.currentStyle.color:this.Ca},la:function(){this.parse();return this.qb}};g.pa=function(c){return b[c]||(b[c]=new a(c))};return a}();g.u=function(){function a(c){this.Ha=
-            -
            c;this.ch=0;this.U=[];this.wa=0}var b=a.ja={xa:1,ob:2,ea:4,ac:8,pb:16,fa:32,A:64,ga:128,ha:256,Aa:512,dc:1024,URL:2048};a.Ta=function(c,e){this.h=c;this.d=e};a.Ta.prototype={db:function(){return this.h&b.A||this.h&b.ga&&this.d==="0"},Y:function(){return this.db()||this.h&b.Aa}};a.prototype={dd:/\s/,Mc:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,zb:/^\-?[_a-z][\w-]*/i,Yc:/^("([^"]*)"|'([^']*)')/,Fc:/^#([\da-f]{6}|[\da-f]{3})/i,bd:{px:b.A,em:b.A,ex:b.A,mm:b.A,cm:b.A,
-            -
            "in":b.A,pt:b.A,pc:b.A,deg:b.xa,rad:b.xa,grad:b.xa},sc:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function e(t,n){t=new a.Ta(t,n);if(!c){k.U.push(t);k.wa++}return t}function f(){k.wa++;return null}var h,j,d,i,k=this;if(this.wa<this.U.length)return this.U[this.wa++];for(;this.dd.test(this.Ha.charAt(this.ch));)this.ch++;if(this.ch>=this.Ha.length)return f();j=this.ch;h=this.Ha.substring(this.ch);d=h.charAt(0);switch(d){case "#":if(i=h.match(this.Fc)){this.ch+=i[0].length;return e(b.ea,i[0])}break;
-            -
            case '"':case "'":if(i=h.match(this.Yc)){this.ch+=i[0].length;return e(b.dc,i[2]||i[3]||"")}break;case "/":case ",":this.ch++;return e(b.ha,d);case "u":if(i=h.match(this.url)){this.ch+=i[0].length;return e(b.URL,i[2]||i[3]||i[4]||"")}}if(i=h.match(this.Mc)){d=i[0];this.ch+=d.length;if(h.charAt(d.length)==="%"){this.ch++;return e(b.Aa,d+"%")}if(i=h.substring(d.length).match(this.zb)){d+=i[0];this.ch+=i[0].length;return e(this.bd[i[0].toLowerCase()]||b.ac,d)}return e(b.ga,d)}if(i=h.match(this.zb)){d=
-            -
            i[0];this.ch+=d.length;if(d.toLowerCase()in g.$b.gb||d==="currentColor")return e(b.ea,d);if(h.charAt(d.length)==="("){this.ch++;if(d.toLowerCase()in this.sc){h=function(t){return t&&t.h&b.ga};i=function(t){return t&&t.h&(b.ga|b.Aa)};var m=function(t,n){return t&&t.d===n},l=function(){return k.next(1)};if((d.charAt(0)==="r"?i(l()):h(l()))&&m(l(),",")&&i(l())&&m(l(),",")&&i(l())&&(d==="rgb"||d==="hsa"||m(l(),",")&&h(l()))&&m(l(),")"))return e(b.ea,this.Ha.substring(j,this.ch));return f()}return e(b.pb,
-            -
            d)}return e(b.fa,d)}this.ch++;return e(b.ob,d)},z:function(){return this.U[this.wa-- -2]},all:function(){for(;this.next(););return this.U},da:function(c,e){for(var f=[],h,j;h=this.next();){if(c(h)){j=true;this.z();break}f.push(h)}return e&&!j?null:f}};return a}();var M=function(a){this.e=a};M.prototype={K:0,Qc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Vc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.i!==b.i||a.f!==b.f)},ub:function(){var a=this.e.getBoundingClientRect();
-            -
            return{x:a.left,y:a.top,i:a.right-a.left,f:a.bottom-a.top}},o:function(){return this.K?this.Da||(this.Da=this.ub()):this.ub()},Ec:function(){return!!this.Ua},Ja:function(){++this.K},La:function(){if(!--this.K){if(this.Da)this.Ua=this.Da;this.Da=null}}};(function(){function a(b){var c=g.p.ta(b);return function(){if(this.K){var e=this.rb||(this.rb={});return c in e?e[c]:(e[c]=b.call(this))}else return b.call(this)}}g.s={K:0,$:function(b){function c(e){this.e=e}g.p.fb(c.prototype,g.s,b);c.kc={};return c},
-            -
            m:function(){var b=this.qa(),c=this.constructor.kc;return b?b in c?c[b]:(c[b]=this.ba(b)):null},qa:a(function(){var b=this.e,c=this.constructor,e=b.style;b=b.currentStyle;var f=this.na,h=this.va,j=c.ic||(c.ic=g.F+f);c=c.jc||(c.jc=g.Sa+h.charAt(0).toUpperCase()+h.substring(1));return e[c]||b.getAttribute(j)||e[h]||b.getAttribute(f)}),g:a(function(){return!!this.m()}),D:a(function(){var b=this.qa(),c=b!==this.gc;this.gc=b;return c}),ma:a,Ja:function(){++this.K},La:function(){--this.K||delete this.rb}}})();
-            -
            g.Tb=g.s.$({na:g.F+"background",va:g.Sa+"Background",nc:{scroll:1,fixed:1,local:1},Ka:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},Nc:{"padding-box":1,"border-box":1,"content-box":1},rc:{"padding-box":1,"border-box":1},Rc:{top:1,right:1,bottom:1,left:1,center:1},Wc:{contain:1,cover:1},ba:function(a){function b(u){return u.Y()||u.h&i&&u.d in t}function c(u){return u.Y()&&g.k(u.d)||u.d==="auto"&&"auto"}var e=this.e.currentStyle,f,h,j=g.u.ja,d=j.ha,i=j.fa,k=j.ea,m,l,t=this.Rc,n,p,s=null;if(this.$a()){a=
-            -
            new g.u(a);s={M:[]};for(h={};f=a.next();){m=f.h;l=f.d;if(!h.P&&m&j.pb&&l==="linear-gradient"){n={ca:[],P:l};for(p={};f=a.next();){m=f.h;l=f.d;if(m&j.ob&&l===")"){p.color&&n.ca.push(p);n.ca.length>1&&g.p.fb(h,n);break}if(m&k){if(n.Xa||n.bb){f=a.z();if(f.h!==d)break;a.next()}p={color:g.pa(l)};f=a.next();if(f.Y())p.Fb=g.k(f.d);else a.z()}else if(m&j.xa&&!n.Xa&&!p.color&&!n.ca.length)n.Xa=new g.Rb(f.d);else if(b(f)&&!n.bb&&!p.color&&!n.ca.length){a.z();n.bb=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&
-            -
            d&&l===","){if(p.color){n.ca.push(p);p={}}}else break}}else if(!h.P&&m&j.URL){h.Cb=l;h.P="image"}else if(b(f)&&!h.size){a.z();h.Ya=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&i)if(l in this.Ka)h.Bb=l;else if(l in this.Nc){h.kd=l;if(l in this.rc)h.clip=l}else{if(l in this.nc)h.jd=l}else if(m&k&&!s.color)s.color=g.pa(l);else if(m&d)if(l==="/"){f=a.next();m=f.h;l=f.d;if(m&i&&l in this.Wc)h.size=l;else if(l=c(f))h.size={i:l,f:c(a.next())||a.z()&&l}}else{if(l===","&&h.P){s.M.push(h);h={}}}else return null}h.P&&
-            -
            s.M.push(h)}else this.Nb(function(){var u=e.backgroundPositionX,w=e.backgroundPositionY,r=e.backgroundImage,o=e.backgroundColor;s={};if(o!=="transparent")s.color=g.pa(o);if(r!=="none")s.M=[{P:"image",Cb:(new g.u(r)).next().d,Bb:e.backgroundRepeat,Ya:new g.Na((new g.u(u+" "+w)).all())}]});return s&&(s.color||s.M&&s.M[0])?s:null},Nb:function(a){var b=this.e.runtimeStyle,c=b.backgroundImage,e=b.backgroundColor;if(c)b.backgroundImage="";if(e)b.backgroundColor="";a=a.call(this);if(c)b.backgroundImage=
-            -
            c;if(e)b.backgroundColor=e;return a},qa:g.s.ma(function(){return this.$a()||this.Nb(function(){var a=this.e.currentStyle;return a.backgroundColor+" "+a.backgroundImage+" "+a.backgroundRepeat+" "+a.backgroundPositionX+" "+a.backgroundPositionY})}),$a:g.s.ma(function(){var a=this.e;return a.style[this.va]||a.currentStyle.getAttribute(this.na)}),Eb:function(){var a=0;if(g.J<7){a=this.e;a=""+(a.style[g.Sa+"PngFix"]||a.currentStyle.getAttribute(g.F+"png-fix"))==="true"}return a},g:g.s.ma(function(){return(this.$a()||
-            -
            this.Eb())&&!!this.m()})});g.Xb=g.s.$({Ib:["Top","Right","Bottom","Left"],Kc:{thin:"1px",medium:"3px",thick:"5px"},ba:function(){var a={},b={},c={},e=false,f=true,h=true,j=true;this.Ob(function(){for(var d=this.e.currentStyle,i=0,k,m,l,t,n,p,s;i<4;i++){l=this.Ib[i];s=l.charAt(0).toLowerCase();k=b[s]=d["border"+l+"Style"];m=d["border"+l+"Color"];l=d["border"+l+"Width"];if(i>0){if(k!==t)h=false;if(m!==n)f=false;if(l!==p)j=false}t=k;n=m;p=l;c[s]=g.pa(m);l=a[s]=g.k(b[s]==="none"?"0":this.Kc[l]||l);if(l.a(this.e)>
-            -
            0)e=true}});return e?{nb:a,Zc:b,tc:c,ed:j,uc:f,$c:h}:null},qa:g.s.ma(function(){var a=this.e,b=a.currentStyle,c;a.tagName in g.Jb&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Ob(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Ob:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,e=b.borderColor;if(c)b.borderWidth="";if(e)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(e)b.borderColor=e;return a}});(function(){g.Oa=g.s.$({na:"border-radius",
-            -
            va:"borderRadius",ba:function(b){var c=null,e,f,h,j,d=false;if(b){f=new g.u(b);var i=function(){for(var k=[],m;(h=f.next())&&h.Y();){j=g.k(h.d);m=j.vb();if(m<0)return null;if(m>0)d=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=i()){if(h){if(h.h&g.u.ja.ha&&h.d==="/")e=i()}else e=b;if(d&&b&&e)c={x:b,y:e}}}return c}});var a=g.k("0");a={tl:a,tr:a,br:a,bl:a};g.Oa.Qb={x:a,y:a}})();g.Vb=g.s.$({na:"border-image",va:"borderImage",Ka:{stretch:1,
-            -
            round:1,repeat:1,space:1},ba:function(a){var b=null,c,e,f,h,j,d,i=0,k,m=g.u.ja,l=m.fa,t=m.ga,n=m.A,p=m.Aa;if(a){c=new g.u(a);b={};for(var s=function(r){return r&&r.h&m.ha&&r.d==="/"},u=function(r){return r&&r.h&l&&r.d==="fill"},w=function(){h=c.da(function(r){return!(r.h&(t|p))});if(u(c.next())&&!b.fill)b.fill=true;else c.z();if(s(c.next())){i++;j=c.da(function(){return!(e.h&(t|p|n))&&!(e.h&l&&e.d==="auto")});if(s(c.next())){i++;d=c.da(function(){return!(e.h&(t|n))})}}else c.z()};e=c.next();){a=e.h;
-            -
            f=e.d;if(a&(t|p)&&!h){c.z();w()}else if(u(e)&&!b.fill){b.fill=true;w()}else if(a&l&&this.Ka[f]&&!b.repeat){b.repeat={f:f};if(e=c.next())if(e.h&l&&this.Ka[e.d])b.repeat.kb=e.d;else c.z()}else if(a&m.URL&&!b.src)b.src=f;else return null}if(!b.src||!h||h.length<1||h.length>4||j&&j.length>4||i===1&&j.length<1||d&&d.length>4||i===2&&d.length<1)return null;if(!b.repeat)b.repeat={f:"stretch"};if(!b.repeat.kb)b.repeat.kb=b.repeat.f;a=function(r,o){return{T:o(r[0]),S:o(r[1]||r[0]),L:o(r[2]||r[0]),Q:o(r[3]||
-            -
            r[1]||r[0])}};b.slice=a(h,function(r){return g.k(r.h&t?r.d+"px":r.d)});b.width=j&&j.length>0?a(j,function(r){return r.h&(n|p)?g.k(r.d):r.d}):(k=this.e.currentStyle)&&{T:g.k(k.borderTopWidth),S:g.k(k.borderRightWidth),L:g.k(k.borderBottomWidth),Q:g.k(k.borderLeftWidth)};b.ua=a(d||[0],function(r){return r.h&n?g.k(r.d):r.d})}return b}});g.Zb=g.s.$({na:"box-shadow",va:"boxShadow",ba:function(a){var b,c=g.k,e=g.u.ja,f;if(a){f=new g.u(a);b={ua:[],cb:[]};for(a=function(){for(var h,j,d,i,k,m;h=f.next();){d=
-            -
            h.d;j=h.h;if(j&e.ha&&d===",")break;else if(h.db()&&!k){f.z();k=f.da(function(l){return!l.db()})}else if(j&e.ea&&!i)i=d;else if(j&e.fa&&d==="inset"&&!m)m=true;else return false}h=k&&k.length;if(h>1&&h<5){(m?b.cb:b.ua).push({fd:c(k[0].d),gd:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Xc:c(k[3]?k[3].d:"0"),color:g.pa(i||"currentColor")});return true}return false};a(););}return b&&(b.cb.length||b.ua.length)?b:null}});g.ec=g.s.$({qa:g.s.ma(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),
-            -
            ba:function(){var a=this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,e;b.visibility="";e=a.visibility;b.visibility=c;return{cd:e!=="hidden",xc:a.display!=="none"}},g:function(){return false}});g.B={Z:function(a){function b(c,e,f,h){this.e=c;this.q=e;this.j=f;this.parent=h}g.p.fb(b.prototype,g.B,a);return b},eb:false,R:function(){return false},Kb:function(){this.n();this.g()&&this.X()},jb:function(){this.eb=true},Lb:function(){this.g()?this.X():this.n()},Wa:function(a,b){this.Hb(a);for(var c=
-            -
            this.ka||(this.ka=[]),e=a+1,f=c.length,h;e<f;e++)if(h=c[e])break;c[a]=b;this.w().insertBefore(b,h||null)},ra:function(a){var b=this.ka;return b&&b[a]||null},Hb:function(a){var b=this.ra(a),c=this.Ba;if(b&&c){c.removeChild(b);this.ka[a]=null}},sa:function(a,b,c,e){var f=this.Va||(this.Va={}),h=f[a];if(!h){h=f[a]=g.p.Ga("shape");if(b)h.appendChild(h[b]=g.p.Ga(b));if(e){c=this.ra(e);if(!c){this.Wa(e,doc.createElement("group"+e));c=this.ra(e)}}c.appendChild(h);a=h.style;a.position="absolute";a.left=a.top=
-            -
            0;a.behavior="url(#default#VML)"}return h},Za:function(a){var b=this.Va,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},xb:function(a){var b=this.e,c=this.q.o(),e=c.i,f=c.f,h,j,d,i,k,m;c=a.x.tl.a(b,e);h=a.y.tl.a(b,f);j=a.x.tr.a(b,e);d=a.y.tr.a(b,f);i=a.x.br.a(b,e);k=a.y.br.a(b,f);m=a.x.bl.a(b,e);a=a.y.bl.a(b,f);e=Math.min(e/(c+j),f/(d+k),e/(m+i),f/(h+a));if(e<1){c*=e;h*=e;j*=e;d*=e;i*=e;k*=e;m*=e;a*=e}return{x:{tl:c,tr:j,br:i,bl:m},y:{tl:h,tr:d,br:k,bl:a}}},oa:function(a,b,c){b=
-            -
            b||1;var e,f,h=this.q.o();f=h.i*b;h=h.f*b;var j=this.j.v,d=Math.floor,i=Math.ceil,k=a?a.T*b:0,m=a?a.S*b:0,l=a?a.L*b:0;a=a?a.Q*b:0;var t,n,p,s,u;if(c||j.g()){e=this.xb(c||j.m());c=e.x.tl*b;j=e.y.tl*b;t=e.x.tr*b;n=e.y.tr*b;p=e.x.br*b;s=e.y.br*b;u=e.x.bl*b;b=e.y.bl*b;f="m"+d(a)+","+d(j)+"qy"+d(c)+","+d(k)+"l"+i(f-t)+","+d(k)+"qx"+i(f-m)+","+d(n)+"l"+i(f-m)+","+i(h-s)+"qy"+i(f-p)+","+i(h-l)+"l"+d(u)+","+i(h-l)+"qx"+d(a)+","+i(h-b)+" x e"}else f="m"+d(a)+","+d(k)+"l"+i(f-m)+","+d(k)+"l"+i(f-m)+","+i(h-
-            -
            l)+"l"+d(a)+","+i(h-l)+"xe";return f},w:function(){var a=this.parent.ra(this.C),b;if(!a){a=doc.createElement(this.Fa);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.Wa(this.C,a)}return a},n:function(){this.parent.Hb(this.C);delete this.Va;delete this.ka}};g.cc=g.B.Z({g:function(){var a=this.oc;for(var b in a)if(a.hasOwnProperty(b)&&a[b].g())return true;return false},R:function(){return this.j.lb.D()},jb:function(){if(this.g()){var a=this.wb(),b=a,c;a=a.currentStyle;var e=a.position,f=
-            -
            this.w().style,h=0,j=0;j=this.q.o();if(e==="fixed"&&g.J>6){h=j.x;j=j.y;b=e}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;h=j.x-c.left-(parseFloat(b.borderLeftWidth)||0);j=j.y-c.top-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;h=j.x+b.scrollLeft-b.clientLeft;j=j.y+b.scrollTop-b.clientTop}b="absolute"}f.position=b;f.left=h;f.top=j;f.zIndex=e==="static"?-1:a.zIndex;this.eb=true}},Lb:function(){},Mb:function(){var a=
-            -
            this.j.lb.m();this.w().style.display=a.cd&&a.xc?"":"none"},Kb:function(){this.g()?this.Mb():this.n()},wb:function(){var a=this.e;return a.tagName in g.Jb?a.offsetParent:a},w:function(){var a=this.Ba,b;if(!a){b=this.wb();a=this.Ba=doc.createElement("css3-container");a.style.direction="ltr";this.Mb();b.parentNode.insertBefore(a,b)}return a},n:function(){var a=this.Ba,b;if(a&&(b=a.parentNode))b.removeChild(a);delete this.Ba;delete this.ka}});g.Sb=g.B.Z({C:2,Fa:"background",R:function(){var a=this.j;
-            -
            return a.H.D()||a.v.D()},g:function(){var a=this.j;return a.N.g()||a.v.g()||a.H.g()||a.W.g()&&a.W.m().cb},X:function(){var a=this.q.o();if(a.i&&a.f){this.yc();this.zc()}},yc:function(){var a=this.j.H.m(),b=this.q.o(),c=this.e,e=a&&a.color,f,h;if(e&&e.la()>0){this.yb();a=this.sa("bgColor","fill",this.w(),1);f=b.i;b=b.f;a.stroked=false;a.coordsize=f*2+","+b*2;a.coordorigin="1,1";a.path=this.oa(null,2);h=a.style;h.width=f;h.height=b;a.fill.color=e.O(c);c=e.la();if(c<1)a.fill.opacity=c}else this.Za("bgColor")},
-            -
            zc:function(){var a=this.j.H.m(),b=this.q.o();a=a&&a.M;var c,e,f,h,j;if(a){this.yb();e=b.i;f=b.f;for(j=a.length;j--;){b=a[j];c=this.sa("bgImage"+j,"fill",this.w(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=e*2+","+f*2;c.coordorigin="1,1";c.path=this.oa(0,2);h=c.style;h.width=e;h.height=f;if(b.P==="linear-gradient")this.mc(c,b);else{c.fill.src=b.Cb;this.Pc(c,j)}}}for(j=a?a.length:0;this.Za("bgImage"+j++););},Pc:function(a,b){g.p.Pb(a.fill.src,function(c){var e=a.fill,f=this.e,
-            -
            h=this.q.o(),j=h.i;h=h.f;var d=this.j,i=d.I.m(),k=i&&i.nb;i=k?k.t.a(f):0;var m=k?k.r.a(f):0,l=k?k.b.a(f):0;k=k?k.l.a(f):0;d=d.H.m().M[b];f=d.Ya?d.Ya.coords(f,j-c.i-k-m,h-c.f-i-l):{x:0,y:0};d=d.Bb;l=m=0;var t=j+1,n=h+1,p=g.J===8?0:1;k=Math.round(f.x)+k+0.5;i=Math.round(f.y)+i+0.5;e.position=k/j+","+i/h;if(d&&d!=="repeat"){if(d==="repeat-x"||d==="no-repeat"){m=i+1;n=i+c.f+p}if(d==="repeat-y"||d==="no-repeat"){l=k+1;t=k+c.i+p}a.style.clip="rect("+m+"px,"+t+"px,"+n+"px,"+l+"px)"}},this)},mc:function(a,
-            -
            b){function c(B,C,z,F,H){if(z===0||z===180)return[F,C];else if(z===90||z===270)return[B,H];else{z=Math.tan(-z*t/180);B=z*B-C;C=-1/z;F=C*F-H;H=C-z;return[(F-B)/H,(z*F-C*B)/H]}}function e(){w=m>=90&&m<270?i:0;r=m<180?k:0;o=i-w;x=k-r}function f(){for(;m<0;)m+=360;m%=360}function h(B,C){var z=C[0]-B[0];B=C[1]-B[1];return Math.abs(z===0?B:B===0?z:Math.sqrt(z*z+B*B))}var j=this.e,d=this.q.o(),i=d.i,k=d.f;a=a.fill;var m=b.Xa,l=b.bb;b=b.ca;d=b.length;var t=Math.PI,n,p,s,u,w,r,o,x,q,y,A,D;if(l){l=l.coords(j,
-            -
            i,k);n=l.x;p=l.y}if(m){m=m.vc();f();e();if(!l){n=w;p=r}l=c(n,p,m,o,x);s=l[0];u=l[1]}else if(l){s=i-n;u=k-p}else{n=p=s=0;u=k}l=s-n;q=u-p;if(m===void 0){m=!l?q<0?90:270:!q?l<0?180:0:-Math.atan2(q,l)/t*180;f();e()}l=m%90?Math.atan2(l*i/k,q)/t*180:m+90;l+=180;l%=360;y=h([n,p],[s,u]);s=h([w,r],c(w,r,m,o,x));u=[];p=h([n,p],c(n,p,m,w,r))/s*100;n=[];for(q=0;q<d;q++)n.push(b[q].Fb?b[q].Fb.a(j,y):q===0?0:q===d-1?y:null);for(q=1;q<d;q++){if(n[q]===null){A=n[q-1];y=q;do D=n[++y];while(D===null);n[q]=A+(D-A)/
-            -
            (y-q+1)}n[q]=Math.max(n[q],n[q-1])}for(q=0;q<d;q++)u.push(p+n[q]/s*100+"% "+b[q].color.O(j));a.angle=l;a.type="gradient";a.method="sigma";a.color=b[0].color.O(j);a.color2=b[d-1].color.O(j);a.colors.value=u.join(",")},yb:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},n:function(){g.B.n.call(this);var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});g.Wb=g.B.Z({C:4,Fa:"border",qc:{TABLE:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,
-            -
            IMG:1,HR:1,FIELDSET:1},Jc:{submit:1,button:1,reset:1},R:function(){var a=this.j;return a.I.D()||a.v.D()},g:function(){var a=this.j;return(a.N.g()||a.v.g()||a.H.g())&&a.I.g()},X:function(){var a=this.e,b=this.j.I.m(),c=this.q.o(),e=c.i;c=c.f;var f,h,j,d,i;if(b){this.Hc();b=this.Bc(2);d=0;for(i=b.length;d<i;d++){j=b[d];f=this.sa("borderPiece"+d,j.stroke?"stroke":"fill",this.w());f.coordsize=e*2+","+c*2;f.coordorigin="1,1";f.path=j.path;h=f.style;h.width=e;h.height=c;f.filled=!!j.fill;f.stroked=!!j.stroke;
-            -
            if(j.stroke){f=f.stroke;f.weight=j.mb+"px";f.color=j.color.O(a);f.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";f.linestyle=j.stroke==="double"&&j.mb>2?"ThinThin":"Single"}else f.fill.color=j.fill.O(a)}for(;this.Za("borderPiece"+d++););}},Hc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,e=a.tagName,f=g.J===6,h;if(f&&e in this.qc||e==="BUTTON"||e==="INPUT"&&a.type in this.Jc){c.borderWidth="";e=this.j.I.Ib;for(h=e.length;h--;){f=e[h];c["padding"+f]="";c["padding"+
-            -
            f]=g.k(b["padding"+f]).a(a)+g.k(b["border"+f+"Width"]).a(a)+(!g.J===8&&h%2?1:0)}c.borderWidth=0}else if(f){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");e=b.style;e.visibility="visible";for(e.zoom=1;e=a.firstChild;)b.appendChild(e);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},Bc:function(a){var b=this.e,c,e,f,h=this.j.I,j=[],d,i,k,m,l=Math.round,t,n,p;if(h.g()){c=h.m();h=c.nb;n=c.Zc;p=c.tc;if(c.ed&&c.$c&&c.uc){if(p.t.la()>
-            -
            0){c=h.t.a(b);k=c/2;j.push({path:this.oa({T:k,S:k,L:k,Q:k},a),stroke:n.t,color:p.t,mb:c})}}else{a=a||1;c=this.q.o();e=c.i;f=c.f;c=l(h.t.a(b));k=l(h.r.a(b));m=l(h.b.a(b));b=l(h.l.a(b));var s={t:c,r:k,b:m,l:b};b=this.j.v;if(b.g())t=this.xb(b.m());d=Math.floor;i=Math.ceil;var u=function(o,x){return t?t[o][x]:0},w=function(o,x,q,y,A,D){var B=u("x",o),C=u("y",o),z=o.charAt(1)==="r";o=o.charAt(0)==="b";return B>0&&C>0?(D?"al":"ae")+(z?i(e-B):d(B))*a+","+(o?i(f-C):d(C))*a+","+(d(B)-x)*a+","+(d(C)-q)*a+","+
-            -
            y*65535+","+2949075*(A?1:-1):(D?"m":"l")+(z?e-x:x)*a+","+(o?f-q:q)*a},r=function(o,x,q,y){var A=o==="t"?d(u("x","tl"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+d(u("y","tr"))*a:o==="b"?i(e-u("x","br"))*a+","+d(f-x)*a:d(x)*a+","+i(f-u("y","bl"))*a;o=o==="t"?i(e-u("x","tr"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+i(f-u("y","br"))*a:o==="b"?d(u("x","bl"))*a+","+d(f-x)*a:d(x)*a+","+d(u("y","tl"))*a;return q?(y?"m"+o:"")+"l"+A:(y?"m"+A:"")+"l"+o};b=function(o,x,q,y,A,D){var B=o==="l"||o==="r",C=s[o],z,F;if(C>0&&n[o]!==
-            -
            "none"&&p[o].la()>0){z=s[B?o:x];x=s[B?x:o];F=s[B?o:q];q=s[B?q:o];if(n[o]==="dashed"||n[o]==="dotted"){j.push({path:w(y,z,x,D+45,0,1)+w(y,0,0,D,1,0),fill:p[o]});j.push({path:r(o,C/2,0,1),stroke:n[o],mb:C,color:p[o]});j.push({path:w(A,F,q,D,0,1)+w(A,0,0,D-45,1,0),fill:p[o]})}else j.push({path:w(y,z,x,D+45,0,1)+r(o,C,0,0)+w(A,F,q,D,0,0)+(n[o]==="double"&&C>2?w(A,F-d(F/3),q-d(q/3),D-45,1,0)+r(o,i(C/3*2),1,0)+w(y,z-d(z/3),x-d(x/3),D,1,0)+"x "+w(y,d(z/3),d(x/3),D+45,0,1)+r(o,d(C/3),1,0)+w(A,d(F/3),d(q/
-            -
            3),D,0,0):"")+w(A,0,0,D-45,1,0)+r(o,0,1,0)+w(y,0,0,D,1,0),fill:p[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},n:function(){g.B.n.call(this);this.e.runtimeStyle.borderColor=""}});g.Ub=g.B.Z({C:5,Oc:["t","tr","r","br","b","bl","l","tl","c"],R:function(){return this.j.N.D()},g:function(){return this.j.N.g()},X:function(){this.w();var a=this.j.N.m(),b=this.q.o(),c=this.e,e=this.Gb;g.p.Pb(a.src,function(f){function h(w,
-            -
            r,o,x,q){w=e[w].style;var y=Math.max;w.width=y(r,0);w.height=y(o,0);w.left=x;w.top=q}function j(w,r,o){for(var x=0,q=w.length;x<q;x++)e[w[x]].imagedata[r]=o}var d=b.i,i=b.f,k=a.width,m=k.T.a(c),l=k.S.a(c),t=k.L.a(c);k=k.Q.a(c);var n=a.slice,p=n.T.a(c),s=n.S.a(c),u=n.L.a(c);n=n.Q.a(c);h("tl",k,m,0,0);h("t",d-k-l,m,k,0);h("tr",l,m,d-l,0);h("r",l,i-m-t,d-l,m);h("br",l,t,d-l,i-t);h("b",d-k-l,t,k,i-t);h("bl",k,t,0,i-t);h("l",k,i-m-t,0,m);h("c",d-k-l,i-m-t,k,m);j(["tl","t","tr"],"cropBottom",(f.f-p)/f.f);
-            -
            j(["tl","l","bl"],"cropRight",(f.i-n)/f.i);j(["bl","b","br"],"cropTop",(f.f-u)/f.f);j(["tr","r","br"],"cropLeft",(f.i-s)/f.i);if(a.repeat.kb==="stretch"){j(["l","r","c"],"cropTop",p/f.f);j(["l","r","c"],"cropBottom",u/f.f)}if(a.repeat.f==="stretch"){j(["t","b","c"],"cropLeft",n/f.i);j(["t","b","c"],"cropRight",s/f.i)}e.c.style.display=a.fill?"":"none"},this)},w:function(){var a=this.parent.ra(this.C),b,c,e,f=this.Oc,h=f.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";
-            -
            this.Gb={};for(e=0;e<h;e++){c=this.Gb[f[e]]=g.p.Ga("rect");c.appendChild(g.p.Ga("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.j.N.m().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.Wa(this.C,a)}return a}});g.Yb=g.B.Z({C:1,Fa:"outset-box-shadow",R:function(){var a=this.j;return a.W.D()||a.v.D()},g:function(){var a=this.j.W;return a.g()&&a.m().ua[0]},X:function(){function a(z,F,H,K,J,v,E){z=b.sa("shadow"+z+F,"fill",
-            -
            e,j-z);F=z.fill;z.coordsize=m*2+","+l*2;z.coordorigin="1,1";z.stroked=false;z.filled=true;F.color=J.O(c);if(v){F.type="gradienttitle";F.color2=F.color;F.opacity=0}z.path=E;u=z.style;u.left=H;u.top=K;u.width=m;u.height=l;return z}var b=this,c=this.e,e=this.w(),f=this.j,h=f.W.m().ua;f=f.v.m();var j=h.length,d=j,i,k=this.q.o(),m=k.i,l=k.f;k=g.J===8?1:0;for(var t=["tl","tr","br","bl"],n,p,s,u,w,r,o,x,q,y,A,D,B,C;d--;){p=h[d];w=p.fd.a(c);r=p.gd.a(c);i=p.Xc.a(c);o=p.blur.a(c);p=p.color;x=-i-o;if(!f&&o)f=
-            -
            g.Oa.Qb;x=this.oa({T:x,S:x,L:x,Q:x},2,f);if(o){q=(i+o)*2+m;y=(i+o)*2+l;A=o*2/q;D=o*2/y;if(o-i>m/2||o-i>l/2)for(i=4;i--;){n=t[i];B=n.charAt(0)==="b";C=n.charAt(1)==="r";n=a(d,n,w,r,p,o,x);s=n.fill;s.focusposition=(C?1-A:A)+","+(B?1-D:D);s.focussize="0,0";n.style.clip="rect("+((B?y/2:0)+k)+"px,"+(C?q:q/2)+"px,"+(B?y:y/2)+"px,"+((C?q/2:0)+k)+"px)"}else{n=a(d,"",w,r,p,o,x);s=n.fill;s.focusposition=A+","+D;s.focussize=1-A*2+","+(1-D*2)}}else{n=a(d,"",w,r,p,o,x);w=p.la();if(w<1)n.fill.opacity=w}}}});g.bc=
-            -
            g.B.Z({C:6,Fa:"imgEl",R:function(){var a=this.j;return this.e.src!==this.hc||a.v.D()},g:function(){var a=this.j;return a.v.g()||a.H.Eb()},X:function(){this.hc=j;this.Gc();var a=this.sa("img","fill",this.w()),b=a.fill,c=this.q.o(),e=c.i;c=c.f;var f=this.j.I.m();f=f&&f.nb;var h=this.e,j=h.src,d=Math.round;a.stroked=false;b.type="frame";b.src=j;b.position=(e?0.5/e:0)+","+(c?0.5/c:0);a.coordsize=e*2+","+c*2;a.coordorigin="1,1";a.path=this.oa(f?{T:d(f.t.a(h)),S:d(f.r.a(h)),L:d(f.b.a(h)),Q:d(f.l.a(h))}:
-            -
            0,2);a=a.style;a.width=e;a.height=c},Gc:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},n:function(){g.B.n.call(this);this.e.runtimeStyle.filter=""}});g.Qa=function(){function a(d){function i(){if(!z){var v,E,G=d.currentStyle,I=G.getAttribute(c)==="true";J=G.getAttribute(e);J=g.Ab===8?J!=="false":J==="true";if(!C){C=1;d.runtimeStyle.zoom=1;G=d;for(var O=1;G=G.previousSibling;)if(G.nodeType===1){O=0;break}if(O)d.className+=" "+g.Pa+"first-child"}y.Ja();if(I&&(E=y.o())&&(v=doc.documentElement||
-            -
            doc.body)&&(E.y>v.clientHeight||E.x>v.clientWidth||E.y+E.f<0||E.x+E.i<0)){if(!H){H=1;g.Ra.aa(i)}}else{z=1;H=C=0;g.Ra.Ma(i);A={H:new g.Tb(d),I:new g.Xb(d),N:new g.Vb(d),v:new g.Oa(d),W:new g.Zb(d),lb:new g.ec(d)};D=[A.H,A.I,A.N,A.v,A.W,A.lb];v=new g.cc(d,y,A);E=[new g.Yb(d,y,A,v),new g.Sb(d,y,A,v),new g.Wb(d,y,A,v),new g.Ub(d,y,A,v)];d.tagName==="IMG"&&E.push(new g.bc(d,y,A,v));v.oc=E;q=[v].concat(E);if(v=d.currentStyle.getAttribute(g.F+"watch-ancestors")){B=[];v=parseInt(v,10);E=0;for(I=d.parentNode;I&&
-            -
            (v==="NaN"||E++<v);){B.push(I);I.attachEvent("onpropertychange",u);I.attachEvent("onmouseenter",p);I.attachEvent("onmouseleave",s);I=I.parentNode}}if(J){g.ya.aa(m);g.ya.Tc()}m(1)}if(!F){F=1;d.attachEvent("onmove",k);d.attachEvent("onresize",k);d.attachEvent("onpropertychange",l);d.attachEvent("onmouseenter",p);d.attachEvent("onmouseleave",s);g.za.aa(k);g.G.aa(o)}y.La()}}function k(){y&&y.Ec()&&m()}function m(v){if(!K)if(z){var E,G;w();if(v||y.Qc()){E=0;for(G=q.length;E<G;E++)q[E].jb()}if(v||y.Vc()){E=
-            -
            0;for(G=q.length;E<G;E++)q[E].Lb()}r()}else C||i()}function l(){var v,E,G;v=event;if(!K&&!(v&&v.propertyName in j))if(z){w();v=0;for(E=q.length;v<E;v++){G=q[v];G.eb||G.jb();G.R()&&G.Kb()}r()}else C||i()}function t(){if(d)d.className+=f}function n(){if(d)d.className=d.className.replace(h,"")}function p(){setTimeout(t,0)}function s(){setTimeout(n,0)}function u(){var v=event.propertyName;if(v==="className"||v==="id")l()}function w(){y.Ja();for(var v=D.length;v--;)D[v].Ja()}function r(){for(var v=D.length;v--;)D[v].La();
-            -
            y.La()}function o(){if(F){if(B)for(var v=0,E=B.length,G;v<E;v++){G=B[v];G.detachEvent("onpropertychange",u);G.detachEvent("onmouseenter",p);G.detachEvent("onmouseleave",s)}d.detachEvent("onmove",m);d.detachEvent("onresize",m);d.detachEvent("onpropertychange",l);d.detachEvent("onmouseenter",p);d.detachEvent("onmouseleave",s);g.G.Ma(o);F=0}}function x(){if(!K){var v,E;o();K=1;if(q){v=0;for(E=q.length;v<E;v++)q[v].n()}J&&g.ya.Ma(m);g.za.Ma(m);q=y=A=D=B=d=null}}var q,y=new M(d),A,D,B,C,z,F,H,K,J;this.Ic=
-            -
            i;this.update=m;this.n=x;this.Ac=d}var b={},c=g.F+"lazy-init",e=g.F+"poll",f=" "+g.Pa+"hover",h=new RegExp("\\b"+g.Pa+"hover\\b","g"),j={background:1,bgColor:1,display:1};a.Cc=function(d){var i=g.p.ta(d);return b[i]||(b[i]=new a(d))};a.n=function(d){d=g.p.ta(d);var i=b[d];if(i){i.n();delete b[d]}};a.wc=function(){var d=[],i;if(b){for(var k in b)if(b.hasOwnProperty(k)){i=b[k];d.push(i.Ac);i.n()}b={}}return d};return a}();g.attach=function(a){g.Ab<9&&g.Qa.Cc(a).Ic()};g.detach=function(a){g.Qa.n(a)}};
             })();


1	+ /*
2	+ PIE: CSS3 rendering for IE
3	+ Version 1.0beta4
4	+ http://css3pie.com
5	+ Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
6	+ */
7	+ (function(){
8	+ var doc = document;var g=window.PIE;
9	+ if(!g){g=window.PIE={F:"-pie-",Sa:"Pie",Pa:"pie_",Jb:{TD:1,TH:1}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(L){}g.J=function(){for(var a=4,b=doc.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return a}();if(g.J===6)g.F=g.F.replace(/^-/,"");g.Ab=doc.documentMode\|\|g.J;(function(){var a,b=0,c={};g.p={Ga:function(e){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+e)},
10	+ ta:function(e){return e&&e._pieId\|\|(e._pieId=++b)},fb:function(e){var f,h,j,d,i=arguments;f=1;for(h=i.length;f<h;f++){d=i[f];for(j in d)if(d.hasOwnProperty(j))e[j]=d[j]}return e},Pb:function(e,f,h){var j=c[e],d,i;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([f,h]):f.call(h,j);else{i=c[e]=[[f,h]];d=new Image;d.onload=function(){j=c[e]={i:d.width,f:d.height};for(var k=0,m=i.length;k<m;k++)i[k][0].call(i[k][1],j);d.onload=null};d.src=e}}}})();g.ia=function(){this.hb=[];this.Db={}};
11	+ g.ia.prototype={aa:function(a){var b=g.p.ta(a),c=this.Db,e=this.hb;if(!(b in c)){c[b]=e.length;e.push(a)}},Ma:function(a){a=g.p.ta(a);var b=this.Db;if(a&&a in b){delete this.hb[b[a]];delete b[a]}},Ia:function(){for(var a=this.hb,b=a.length;b--;)a[b]&&a[b]()}};g.ya=new g.ia;g.ya.Tc=function(){var a=this;if(!a.Uc){setInterval(function(){a.Ia()},250);a.Uc=1}};g.G=new g.ia;window.attachEvent("onbeforeunload",function(){g.G.Ia()});g.G.Ea=function(a,b,c){a.attachEvent(b,c);this.aa(function(){a.detachEvent(b,
12	+ c)})};(function(){function a(){g.za.Ia()}g.za=new g.ia;g.G.Ea(window,"onresize",a)})();(function(){function a(){g.Ra.Ia()}g.Ra=new g.ia;g.G.Ea(window,"onscroll",a);g.za.aa(a)})();(function(){function a(){c=g.Qa.wc()}function b(){if(c){for(var e=0,f=c.length;e<f;e++)g.attach(c[e]);c=0}}var c;g.G.Ea(window,"onbeforeprint",a);g.G.Ea(window,"onafterprint",b)})();g.hd=function(){function a(i){this.V=i}var b=doc.createElement("length-calc"),c=doc.documentElement,e=b.style,f={},h=["mm","cm","in","pt","pc"],
13	+ j=h.length,d={};e.position="absolute";e.top=e.left="-9999px";for(c.appendChild(b);j--;){b.style.width="100"+h[j];f[h[j]]=b.offsetWidth/100}c.removeChild(b);a.prototype={ib:/(px\|em\|ex\|mm\|cm\|in\|pt\|pc\|%)$/,vb:function(){var i=this.Lc;if(i===void 0)i=this.Lc=parseFloat(this.V);return i},ab:function(){var i=this.ad;if(!i)i=this.ad=(i=this.V.match(this.ib))&&i[0]\|\|"px";return i},a:function(i,k){var m=this.vb(),l=this.ab();switch(l){case "px":return m;case "%":return m*(typeof k==="function"?k():k)/100;
14	+ case "em":return mthis.tb(i);case "ex":return mthis.tb(i)/2;default:return m*f[l]}},tb:function(i){var k=i.currentStyle.fontSize;if(k.indexOf("px")>0)return parseFloat(k);else{b.style.width="1em";i.appendChild(b);k=b.offsetWidth;b.parentNode===i&&i.removeChild(b);return k}}};g.k=function(i){return d[i]\|\|(d[i]=new a(i))};return a}();g.Na=function(){function a(f){this.U=f}var b=g.k("50%"),c={top:1,center:1,bottom:1},e={left:1,center:1,right:1};a.prototype={Dc:function(){if(!this.sb){var f=this.U,
15	+ h=f.length,j=g.u,d=j.ja,i=g.k("0");d=d.fa;i=["left",i,"top",i];if(h===1){f.push(new j.Ta(d,"center"));h++}if(h===2){d&(f[0].h\|f[1].h)&&f[0].d in c&&f[1].d in e&&f.push(f.shift());if(f[0].h&d)if(f[0].d==="center")i[1]=b;else i[0]=f[0].d;else if(f[0].Y())i[1]=g.k(f[0].d);if(f[1].h&d)if(f[1].d==="center")i[3]=b;else i[2]=f[1].d;else if(f[1].Y())i[3]=g.k(f[1].d)}this.sb=i}return this.sb},coords:function(f,h,j){var d=this.Dc(),i=d[1].a(f,h);f=d[3].a(f,j);return{x:d[0]==="right"?h-i:i,y:d[2]==="bottom"?
16	+ j-f:f}}};return a}();g.Rb=function(){function a(b){this.V=b}a.prototype={ib:/[a-z]+$/i,ab:function(){return this.lc\|\|(this.lc=this.V.match(this.ib)[0].toLowerCase())},vc:function(){var b=this.fc,c;if(b===undefined){b=this.ab();c=parseFloat(this.V,10);b=this.fc=b==="deg"?c:b==="rad"?c/Math.PI180:b==="grad"?c/400360:b==="turn"?c360:0}return b}};return a}();g.$b=function(){function a(c){this.V=c}var b={};a.Sc=/\srgba$\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d+\|\d\.\d+)\s$\s/;a.gb=
17	+ {aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",
18	+ darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",
19	+ indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",
20	+ mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",
21	+ peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",
22	+ whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ca){var c=this.V,e;if(e=c.match(a.Sc)){this.Ca="rgb("+e[1]+","+e[2]+","+e[3]+")";this.qb=parseFloat(e[4])}else{if((e=c.toLowerCase())in a.gb)c="#"+a.gb[e];this.Ca=c;this.qb=c==="transparent"?0:1}}},O:function(c){this.parse();return this.Ca==="currentColor"?c.currentStyle.color:this.Ca},la:function(){this.parse();return this.qb}};g.pa=function(c){return b[c]\|\|(b[c]=new a(c))};return a}();g.u=function(){function a(c){this.Ha=
23	+ c;this.ch=0;this.U=[];this.wa=0}var b=a.ja={xa:1,ob:2,ea:4,ac:8,pb:16,fa:32,A:64,ga:128,ha:256,Aa:512,dc:1024,URL:2048};a.Ta=function(c,e){this.h=c;this.d=e};a.Ta.prototype={db:function(){return this.h&b.A\|\|this.h&b.ga&&this.d==="0"},Y:function(){return this.db()\|\|this.h&b.Aa}};a.prototype={dd:/\s/,Mc:/^[\+\-]?(\d\.)?\d+/,url:/^url$\s("([^"])"\|'([^'])'\|([!#$%&-~]))\s$/i,zb:/^\-?[_a-z][\w-]/i,Yc:/^("([^"])"\|'([^'])')/,Fc:/^#([\da-f]{6}\|[\da-f]{3})/i,bd:{px:b.A,em:b.A,ex:b.A,mm:b.A,cm:b.A,
24	+ "in":b.A,pt:b.A,pc:b.A,deg:b.xa,rad:b.xa,grad:b.xa},sc:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function e(t,n){t=new a.Ta(t,n);if(!c){k.U.push(t);k.wa++}return t}function f(){k.wa++;return null}var h,j,d,i,k=this;if(this.wa<this.U.length)return this.U[this.wa++];for(;this.dd.test(this.Ha.charAt(this.ch));)this.ch++;if(this.ch>=this.Ha.length)return f();j=this.ch;h=this.Ha.substring(this.ch);d=h.charAt(0);switch(d){case "#":if(i=h.match(this.Fc)){this.ch+=i[0].length;return e(b.ea,i[0])}break;
25	+ case '"':case "'":if(i=h.match(this.Yc)){this.ch+=i[0].length;return e(b.dc,i[2]\|\|i[3]\|\|"")}break;case "/":case ",":this.ch++;return e(b.ha,d);case "u":if(i=h.match(this.url)){this.ch+=i[0].length;return e(b.URL,i[2]\|\|i[3]\|\|i[4]\|\|"")}}if(i=h.match(this.Mc)){d=i[0];this.ch+=d.length;if(h.charAt(d.length)==="%"){this.ch++;return e(b.Aa,d+"%")}if(i=h.substring(d.length).match(this.zb)){d+=i[0];this.ch+=i[0].length;return e(this.bd[i[0].toLowerCase()]\|\|b.ac,d)}return e(b.ga,d)}if(i=h.match(this.zb)){d=
26	+ i[0];this.ch+=d.length;if(d.toLowerCase()in g.$b.gb\|\|d==="currentColor")return e(b.ea,d);if(h.charAt(d.length)==="("){this.ch++;if(d.toLowerCase()in this.sc){h=function(t){return t&&t.h&b.ga};i=function(t){return t&&t.h&(b.ga\|b.Aa)};var m=function(t,n){return t&&t.d===n},l=function(){return k.next(1)};if((d.charAt(0)==="r"?i(l()):h(l()))&&m(l(),",")&&i(l())&&m(l(),",")&&i(l())&&(d==="rgb"\|\|d==="hsa"\|\|m(l(),",")&&h(l()))&&m(l(),")"))return e(b.ea,this.Ha.substring(j,this.ch));return f()}return e(b.pb,
27	+ d)}return e(b.fa,d)}this.ch++;return e(b.ob,d)},z:function(){return this.U[this.wa-- -2]},all:function(){for(;this.next(););return this.U},da:function(c,e){for(var f=[],h,j;h=this.next();){if(c(h)){j=true;this.z();break}f.push(h)}return e&&!j?null:f}};return a}();var M=function(a){this.e=a};M.prototype={K:0,Qc:function(){var a=this.Ua,b;return!a\|\|(b=this.o())&&(a.x!==b.x\|\|a.y!==b.y)},Vc:function(){var a=this.Ua,b;return!a\|\|(b=this.o())&&(a.i!==b.i\|\|a.f!==b.f)},ub:function(){var a=this.e.getBoundingClientRect();
28	+ return{x:a.left,y:a.top,i:a.right-a.left,f:a.bottom-a.top}},o:function(){return this.K?this.Da\|\|(this.Da=this.ub()):this.ub()},Ec:function(){return!!this.Ua},Ja:function(){++this.K},La:function(){if(!--this.K){if(this.Da)this.Ua=this.Da;this.Da=null}}};(function(){function a(b){var c=g.p.ta(b);return function(){if(this.K){var e=this.rb\|\|(this.rb={});return c in e?e[c]:(e[c]=b.call(this))}else return b.call(this)}}g.s={K:0,$:function(b){function c(e){this.e=e}g.p.fb(c.prototype,g.s,b);c.kc={};return c},
29	+ m:function(){var b=this.qa(),c=this.constructor.kc;return b?b in c?c[b]:(c[b]=this.ba(b)):null},qa:a(function(){var b=this.e,c=this.constructor,e=b.style;b=b.currentStyle;var f=this.na,h=this.va,j=c.ic\|\|(c.ic=g.F+f);c=c.jc\|\|(c.jc=g.Sa+h.charAt(0).toUpperCase()+h.substring(1));return e[c]\|\|b.getAttribute(j)\|\|e[h]\|\|b.getAttribute(f)}),g:a(function(){return!!this.m()}),D:a(function(){var b=this.qa(),c=b!==this.gc;this.gc=b;return c}),ma:a,Ja:function(){++this.K},La:function(){--this.K\|\|delete this.rb}}})();
30	+ g.Tb=g.s.$({na:g.F+"background",va:g.Sa+"Background",nc:{scroll:1,fixed:1,local:1},Ka:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},Nc:{"padding-box":1,"border-box":1,"content-box":1},rc:{"padding-box":1,"border-box":1},Rc:{top:1,right:1,bottom:1,left:1,center:1},Wc:{contain:1,cover:1},ba:function(a){function b(u){return u.Y()\|\|u.h&i&&u.d in t}function c(u){return u.Y()&&g.k(u.d)\|\|u.d==="auto"&&"auto"}var e=this.e.currentStyle,f,h,j=g.u.ja,d=j.ha,i=j.fa,k=j.ea,m,l,t=this.Rc,n,p,s=null;if(this.$a()){a=
31	+ new g.u(a);s={M:[]};for(h={};f=a.next();){m=f.h;l=f.d;if(!h.P&&m&j.pb&&l==="linear-gradient"){n={ca:[],P:l};for(p={};f=a.next();){m=f.h;l=f.d;if(m&j.ob&&l===")"){p.color&&n.ca.push(p);n.ca.length>1&&g.p.fb(h,n);break}if(m&k){if(n.Xa\|\|n.bb){f=a.z();if(f.h!==d)break;a.next()}p={color:g.pa(l)};f=a.next();if(f.Y())p.Fb=g.k(f.d);else a.z()}else if(m&j.xa&&!n.Xa&&!p.color&&!n.ca.length)n.Xa=new g.Rb(f.d);else if(b(f)&&!n.bb&&!p.color&&!n.ca.length){a.z();n.bb=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&
32	+ d&&l===","){if(p.color){n.ca.push(p);p={}}}else break}}else if(!h.P&&m&j.URL){h.Cb=l;h.P="image"}else if(b(f)&&!h.size){a.z();h.Ya=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&i)if(l in this.Ka)h.Bb=l;else if(l in this.Nc){h.kd=l;if(l in this.rc)h.clip=l}else{if(l in this.nc)h.jd=l}else if(m&k&&!s.color)s.color=g.pa(l);else if(m&d)if(l==="/"){f=a.next();m=f.h;l=f.d;if(m&i&&l in this.Wc)h.size=l;else if(l=c(f))h.size={i:l,f:c(a.next())\|\|a.z()&&l}}else{if(l===","&&h.P){s.M.push(h);h={}}}else return null}h.P&&
33	+ s.M.push(h)}else this.Nb(function(){var u=e.backgroundPositionX,w=e.backgroundPositionY,r=e.backgroundImage,o=e.backgroundColor;s={};if(o!=="transparent")s.color=g.pa(o);if(r!=="none")s.M=[{P:"image",Cb:(new g.u(r)).next().d,Bb:e.backgroundRepeat,Ya:new g.Na((new g.u(u+" "+w)).all())}]});return s&&(s.color\|\|s.M&&s.M[0])?s:null},Nb:function(a){var b=this.e.runtimeStyle,c=b.backgroundImage,e=b.backgroundColor;if(c)b.backgroundImage="";if(e)b.backgroundColor="";a=a.call(this);if(c)b.backgroundImage=
34	+ c;if(e)b.backgroundColor=e;return a},qa:g.s.ma(function(){return this.$a()\|\|this.Nb(function(){var a=this.e.currentStyle;return a.backgroundColor+" "+a.backgroundImage+" "+a.backgroundRepeat+" "+a.backgroundPositionX+" "+a.backgroundPositionY})}),$a:g.s.ma(function(){var a=this.e;return a.style[this.va]\|\|a.currentStyle.getAttribute(this.na)}),Eb:function(){var a=0;if(g.J<7){a=this.e;a=""+(a.style[g.Sa+"PngFix"]\|\|a.currentStyle.getAttribute(g.F+"png-fix"))==="true"}return a},g:g.s.ma(function(){return(this.$a()\|\|
35	+ this.Eb())&&!!this.m()})});g.Xb=g.s.$({Ib:["Top","Right","Bottom","Left"],Kc:{thin:"1px",medium:"3px",thick:"5px"},ba:function(){var a={},b={},c={},e=false,f=true,h=true,j=true;this.Ob(function(){for(var d=this.e.currentStyle,i=0,k,m,l,t,n,p,s;i<4;i++){l=this.Ib[i];s=l.charAt(0).toLowerCase();k=b[s]=d["border"+l+"Style"];m=d["border"+l+"Color"];l=d["border"+l+"Width"];if(i>0){if(k!==t)h=false;if(m!==n)f=false;if(l!==p)j=false}t=k;n=m;p=l;c[s]=g.pa(m);l=a[s]=g.k(b[s]==="none"?"0":this.Kc[l]\|\|l);if(l.a(this.e)>
36	+ 0)e=true}});return e?{nb:a,Zc:b,tc:c,ed:j,uc:f,$c:h}:null},qa:g.s.ma(function(){var a=this.e,b=a.currentStyle,c;a.tagName in g.Jb&&a.offsetParent.currentStyle.borderCollapse==="collapse"\|\|this.Ob(function(){c=b.borderWidth+"\|"+b.borderStyle+"\|"+b.borderColor});return c}),Ob:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,e=b.borderColor;if(c)b.borderWidth="";if(e)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(e)b.borderColor=e;return a}});(function(){g.Oa=g.s.$({na:"border-radius",
37	+ va:"borderRadius",ba:function(b){var c=null,e,f,h,j,d=false;if(b){f=new g.u(b);var i=function(){for(var k=[],m;(h=f.next())&&h.Y();){j=g.k(h.d);m=j.vb();if(m<0)return null;if(m>0)d=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]\|\|k[0],br:k[2]\|\|k[0],bl:k[3]\|\|k[1]\|\|k[0]}:null};if(b=i()){if(h){if(h.h&g.u.ja.ha&&h.d==="/")e=i()}else e=b;if(d&&b&&e)c={x:b,y:e}}}return c}});var a=g.k("0");a={tl:a,tr:a,br:a,bl:a};g.Oa.Qb={x:a,y:a}})();g.Vb=g.s.$({na:"border-image",va:"borderImage",Ka:{stretch:1,
38	+ round:1,repeat:1,space:1},ba:function(a){var b=null,c,e,f,h,j,d,i=0,k,m=g.u.ja,l=m.fa,t=m.ga,n=m.A,p=m.Aa;if(a){c=new g.u(a);b={};for(var s=function(r){return r&&r.h&m.ha&&r.d==="/"},u=function(r){return r&&r.h&l&&r.d==="fill"},w=function(){h=c.da(function(r){return!(r.h&(t\|p))});if(u(c.next())&&!b.fill)b.fill=true;else c.z();if(s(c.next())){i++;j=c.da(function(){return!(e.h&(t\|p\|n))&&!(e.h&l&&e.d==="auto")});if(s(c.next())){i++;d=c.da(function(){return!(e.h&(t\|n))})}}else c.z()};e=c.next();){a=e.h;
39	+ f=e.d;if(a&(t\|p)&&!h){c.z();w()}else if(u(e)&&!b.fill){b.fill=true;w()}else if(a&l&&this.Ka[f]&&!b.repeat){b.repeat={f:f};if(e=c.next())if(e.h&l&&this.Ka[e.d])b.repeat.kb=e.d;else c.z()}else if(a&m.URL&&!b.src)b.src=f;else return null}if(!b.src\|\|!h\|\|h.length<1\|\|h.length>4\|\|j&&j.length>4\|\|i===1&&j.length<1\|\|d&&d.length>4\|\|i===2&&d.length<1)return null;if(!b.repeat)b.repeat={f:"stretch"};if(!b.repeat.kb)b.repeat.kb=b.repeat.f;a=function(r,o){return{T:o(r[0]),S:o(r[1]\|\|r[0]),L:o(r[2]\|\|r[0]),Q:o(r[3]\|\|
40	+ r[1]\|\|r[0])}};b.slice=a(h,function(r){return g.k(r.h&t?r.d+"px":r.d)});b.width=j&&j.length>0?a(j,function(r){return r.h&(n\|p)?g.k(r.d):r.d}):(k=this.e.currentStyle)&&{T:g.k(k.borderTopWidth),S:g.k(k.borderRightWidth),L:g.k(k.borderBottomWidth),Q:g.k(k.borderLeftWidth)};b.ua=a(d\|\|[0],function(r){return r.h&n?g.k(r.d):r.d})}return b}});g.Zb=g.s.$({na:"box-shadow",va:"boxShadow",ba:function(a){var b,c=g.k,e=g.u.ja,f;if(a){f=new g.u(a);b={ua:[],cb:[]};for(a=function(){for(var h,j,d,i,k,m;h=f.next();){d=
41	+ h.d;j=h.h;if(j&e.ha&&d===",")break;else if(h.db()&&!k){f.z();k=f.da(function(l){return!l.db()})}else if(j&e.ea&&!i)i=d;else if(j&e.fa&&d==="inset"&&!m)m=true;else return false}h=k&&k.length;if(h>1&&h<5){(m?b.cb:b.ua).push({fd:c(k[0].d),gd:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Xc:c(k[3]?k[3].d:"0"),color:g.pa(i\|\|"currentColor")});return true}return false};a(););}return b&&(b.cb.length\|\|b.ua.length)?b:null}});g.ec=g.s.$({qa:g.s.ma(function(){var a=this.e.currentStyle;return a.visibility+"\|"+a.display}),
42	+ ba:function(){var a=this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,e;b.visibility="";e=a.visibility;b.visibility=c;return{cd:e!=="hidden",xc:a.display!=="none"}},g:function(){return false}});g.B={Z:function(a){function b(c,e,f,h){this.e=c;this.q=e;this.j=f;this.parent=h}g.p.fb(b.prototype,g.B,a);return b},eb:false,R:function(){return false},Kb:function(){this.n();this.g()&&this.X()},jb:function(){this.eb=true},Lb:function(){this.g()?this.X():this.n()},Wa:function(a,b){this.Hb(a);for(var c=
43	+ this.ka\|\|(this.ka=[]),e=a+1,f=c.length,h;e<f;e++)if(h=c[e])break;c[a]=b;this.w().insertBefore(b,h\|\|null)},ra:function(a){var b=this.ka;return b&&b[a]\|\|null},Hb:function(a){var b=this.ra(a),c=this.Ba;if(b&&c){c.removeChild(b);this.ka[a]=null}},sa:function(a,b,c,e){var f=this.Va\|\|(this.Va={}),h=f[a];if(!h){h=f[a]=g.p.Ga("shape");if(b)h.appendChild(h[b]=g.p.Ga(b));if(e){c=this.ra(e);if(!c){this.Wa(e,doc.createElement("group"+e));c=this.ra(e)}}c.appendChild(h);a=h.style;a.position="absolute";a.left=a.top=
44	+ 0;a.behavior="url(#default#VML)"}return h},Za:function(a){var b=this.Va,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},xb:function(a){var b=this.e,c=this.q.o(),e=c.i,f=c.f,h,j,d,i,k,m;c=a.x.tl.a(b,e);h=a.y.tl.a(b,f);j=a.x.tr.a(b,e);d=a.y.tr.a(b,f);i=a.x.br.a(b,e);k=a.y.br.a(b,f);m=a.x.bl.a(b,e);a=a.y.bl.a(b,f);e=Math.min(e/(c+j),f/(d+k),e/(m+i),f/(h+a));if(e<1){c=e;h=e;j=e;d=e;i=e;k=e;m=e;a=e}return{x:{tl:c,tr:j,br:i,bl:m},y:{tl:h,tr:d,br:k,bl:a}}},oa:function(a,b,c){b=
45	+ b\|\|1;var e,f,h=this.q.o();f=h.ib;h=h.fb;var j=this.j.v,d=Math.floor,i=Math.ceil,k=a?a.Tb:0,m=a?a.Sb:0,l=a?a.Lb:0;a=a?a.Qb:0;var t,n,p,s,u;if(c\|\|j.g()){e=this.xb(c\|\|j.m());c=e.x.tlb;j=e.y.tlb;t=e.x.trb;n=e.y.trb;p=e.x.brb;s=e.y.brb;u=e.x.blb;b=e.y.blb;f="m"+d(a)+","+d(j)+"qy"+d(c)+","+d(k)+"l"+i(f-t)+","+d(k)+"qx"+i(f-m)+","+d(n)+"l"+i(f-m)+","+i(h-s)+"qy"+i(f-p)+","+i(h-l)+"l"+d(u)+","+i(h-l)+"qx"+d(a)+","+i(h-b)+" x e"}else f="m"+d(a)+","+d(k)+"l"+i(f-m)+","+d(k)+"l"+i(f-m)+","+i(h-
46	+ l)+"l"+d(a)+","+i(h-l)+"xe";return f},w:function(){var a=this.parent.ra(this.C),b;if(!a){a=doc.createElement(this.Fa);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.Wa(this.C,a)}return a},n:function(){this.parent.Hb(this.C);delete this.Va;delete this.ka}};g.cc=g.B.Z({g:function(){var a=this.oc;for(var b in a)if(a.hasOwnProperty(b)&&a[b].g())return true;return false},R:function(){return this.j.lb.D()},jb:function(){if(this.g()){var a=this.wb(),b=a,c;a=a.currentStyle;var e=a.position,f=
47	+ this.w().style,h=0,j=0;j=this.q.o();if(e==="fixed"&&g.J>6){h=j.x;j=j.y;b=e}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;h=j.x-c.left-(parseFloat(b.borderLeftWidth)\|\|0);j=j.y-c.top-(parseFloat(b.borderTopWidth)\|\|0)}else{b=doc.documentElement;h=j.x+b.scrollLeft-b.clientLeft;j=j.y+b.scrollTop-b.clientTop}b="absolute"}f.position=b;f.left=h;f.top=j;f.zIndex=e==="static"?-1:a.zIndex;this.eb=true}},Lb:function(){},Mb:function(){var a=
48	+ this.j.lb.m();this.w().style.display=a.cd&&a.xc?"":"none"},Kb:function(){this.g()?this.Mb():this.n()},wb:function(){var a=this.e;return a.tagName in g.Jb?a.offsetParent:a},w:function(){var a=this.Ba,b;if(!a){b=this.wb();a=this.Ba=doc.createElement("css3-container");a.style.direction="ltr";this.Mb();b.parentNode.insertBefore(a,b)}return a},n:function(){var a=this.Ba,b;if(a&&(b=a.parentNode))b.removeChild(a);delete this.Ba;delete this.ka}});g.Sb=g.B.Z({C:2,Fa:"background",R:function(){var a=this.j;
49	+ return a.H.D()\|\|a.v.D()},g:function(){var a=this.j;return a.N.g()\|\|a.v.g()\|\|a.H.g()\|\|a.W.g()&&a.W.m().cb},X:function(){var a=this.q.o();if(a.i&&a.f){this.yc();this.zc()}},yc:function(){var a=this.j.H.m(),b=this.q.o(),c=this.e,e=a&&a.color,f,h;if(e&&e.la()>0){this.yb();a=this.sa("bgColor","fill",this.w(),1);f=b.i;b=b.f;a.stroked=false;a.coordsize=f2+","+b2;a.coordorigin="1,1";a.path=this.oa(null,2);h=a.style;h.width=f;h.height=b;a.fill.color=e.O(c);c=e.la();if(c<1)a.fill.opacity=c}else this.Za("bgColor")},
50	+ zc:function(){var a=this.j.H.m(),b=this.q.o();a=a&&a.M;var c,e,f,h,j;if(a){this.yb();e=b.i;f=b.f;for(j=a.length;j--;){b=a[j];c=this.sa("bgImage"+j,"fill",this.w(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=e2+","+f2;c.coordorigin="1,1";c.path=this.oa(0,2);h=c.style;h.width=e;h.height=f;if(b.P==="linear-gradient")this.mc(c,b);else{c.fill.src=b.Cb;this.Pc(c,j)}}}for(j=a?a.length:0;this.Za("bgImage"+j++););},Pc:function(a,b){g.p.Pb(a.fill.src,function(c){var e=a.fill,f=this.e,
51	+ h=this.q.o(),j=h.i;h=h.f;var d=this.j,i=d.I.m(),k=i&&i.nb;i=k?k.t.a(f):0;var m=k?k.r.a(f):0,l=k?k.b.a(f):0;k=k?k.l.a(f):0;d=d.H.m().M[b];f=d.Ya?d.Ya.coords(f,j-c.i-k-m,h-c.f-i-l):{x:0,y:0};d=d.Bb;l=m=0;var t=j+1,n=h+1,p=g.J===8?0:1;k=Math.round(f.x)+k+0.5;i=Math.round(f.y)+i+0.5;e.position=k/j+","+i/h;if(d&&d!=="repeat"){if(d==="repeat-x"\|\|d==="no-repeat"){m=i+1;n=i+c.f+p}if(d==="repeat-y"\|\|d==="no-repeat"){l=k+1;t=k+c.i+p}a.style.clip="rect("+m+"px,"+t+"px,"+n+"px,"+l+"px)"}},this)},mc:function(a,
52	+ b){function c(B,C,z,F,H){if(z===0\|\|z===180)return[F,C];else if(z===90\|\|z===270)return[B,H];else{z=Math.tan(-zt/180);B=zB-C;C=-1/z;F=CF-H;H=C-z;return[(F-B)/H,(zF-CB)/H]}}function e(){w=m>=90&&m<270?i:0;r=m<180?k:0;o=i-w;x=k-r}function f(){for(;m<0;)m+=360;m%=360}function h(B,C){var z=C[0]-B[0];B=C[1]-B[1];return Math.abs(z===0?B:B===0?z:Math.sqrt(zz+B*B))}var j=this.e,d=this.q.o(),i=d.i,k=d.f;a=a.fill;var m=b.Xa,l=b.bb;b=b.ca;d=b.length;var t=Math.PI,n,p,s,u,w,r,o,x,q,y,A,D;if(l){l=l.coords(j,
53	+ i,k);n=l.x;p=l.y}if(m){m=m.vc();f();e();if(!l){n=w;p=r}l=c(n,p,m,o,x);s=l[0];u=l[1]}else if(l){s=i-n;u=k-p}else{n=p=s=0;u=k}l=s-n;q=u-p;if(m===void 0){m=!l?q<0?90:270:!q?l<0?180:0:-Math.atan2(q,l)/t180;f();e()}l=m%90?Math.atan2(li/k,q)/t180:m+90;l+=180;l%=360;y=h([n,p],[s,u]);s=h([w,r],c(w,r,m,o,x));u=[];p=h([n,p],c(n,p,m,w,r))/s100;n=[];for(q=0;q<d;q++)n.push(b[q].Fb?b[q].Fb.a(j,y):q===0?0:q===d-1?y:null);for(q=1;q<d;q++){if(n[q]===null){A=n[q-1];y=q;do D=n[++y];while(D===null);n[q]=A+(D-A)/
54	+ (y-q+1)}n[q]=Math.max(n[q],n[q-1])}for(q=0;q<d;q++)u.push(p+n[q]/s*100+"% "+b[q].color.O(j));a.angle=l;a.type="gradient";a.method="sigma";a.color=b[0].color.O(j);a.color2=b[d-1].color.O(j);a.colors.value=u.join(",")},yb:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},n:function(){g.B.n.call(this);var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});g.Wb=g.B.Z({C:4,Fa:"border",qc:{TABLE:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,
55	+ IMG:1,HR:1,FIELDSET:1},Jc:{submit:1,button:1,reset:1},R:function(){var a=this.j;return a.I.D()\|\|a.v.D()},g:function(){var a=this.j;return(a.N.g()\|\|a.v.g()\|\|a.H.g())&&a.I.g()},X:function(){var a=this.e,b=this.j.I.m(),c=this.q.o(),e=c.i;c=c.f;var f,h,j,d,i;if(b){this.Hc();b=this.Bc(2);d=0;for(i=b.length;d<i;d++){j=b[d];f=this.sa("borderPiece"+d,j.stroke?"stroke":"fill",this.w());f.coordsize=e2+","+c2;f.coordorigin="1,1";f.path=j.path;h=f.style;h.width=e;h.height=c;f.filled=!!j.fill;f.stroked=!!j.stroke;
56	+ if(j.stroke){f=f.stroke;f.weight=j.mb+"px";f.color=j.color.O(a);f.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";f.linestyle=j.stroke==="double"&&j.mb>2?"ThinThin":"Single"}else f.fill.color=j.fill.O(a)}for(;this.Za("borderPiece"+d++););}},Hc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,e=a.tagName,f=g.J===6,h;if(f&&e in this.qc\|\|e==="BUTTON"\|\|e==="INPUT"&&a.type in this.Jc){c.borderWidth="";e=this.j.I.Ib;for(h=e.length;h--;){f=e[h];c["padding"+f]="";c["padding"+
57	+ f]=g.k(b["padding"+f]).a(a)+g.k(b["border"+f+"Width"]).a(a)+(!g.J===8&&h%2?1:0)}c.borderWidth=0}else if(f){if(a.childNodes.length!==1\|\|a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");e=b.style;e.visibility="visible";for(e.zoom=1;e=a.firstChild;)b.appendChild(e);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},Bc:function(a){var b=this.e,c,e,f,h=this.j.I,j=[],d,i,k,m,l=Math.round,t,n,p;if(h.g()){c=h.m();h=c.nb;n=c.Zc;p=c.tc;if(c.ed&&c.$c&&c.uc){if(p.t.la()>
58	+ 0){c=h.t.a(b);k=c/2;j.push({path:this.oa({T:k,S:k,L:k,Q:k},a),stroke:n.t,color:p.t,mb:c})}}else{a=a\|\|1;c=this.q.o();e=c.i;f=c.f;c=l(h.t.a(b));k=l(h.r.a(b));m=l(h.b.a(b));b=l(h.l.a(b));var s={t:c,r:k,b:m,l:b};b=this.j.v;if(b.g())t=this.xb(b.m());d=Math.floor;i=Math.ceil;var u=function(o,x){return t?t[o][x]:0},w=function(o,x,q,y,A,D){var B=u("x",o),C=u("y",o),z=o.charAt(1)==="r";o=o.charAt(0)==="b";return B>0&&C>0?(D?"al":"ae")+(z?i(e-B):d(B))a+","+(o?i(f-C):d(C))a+","+(d(B)-x)a+","+(d(C)-q)a+","+
59	+ y65535+","+2949075(A?1:-1):(D?"m":"l")+(z?e-x:x)a+","+(o?f-q:q)a},r=function(o,x,q,y){var A=o==="t"?d(u("x","tl"))a+","+i(x)a:o==="r"?i(e-x)a+","+d(u("y","tr"))a:o==="b"?i(e-u("x","br"))a+","+d(f-x)a:d(x)a+","+i(f-u("y","bl"))a;o=o==="t"?i(e-u("x","tr"))a+","+i(x)a:o==="r"?i(e-x)a+","+i(f-u("y","br"))a:o==="b"?d(u("x","bl"))a+","+d(f-x)a:d(x)a+","+d(u("y","tl"))a;return q?(y?"m"+o:"")+"l"+A:(y?"m"+A:"")+"l"+o};b=function(o,x,q,y,A,D){var B=o==="l"\|\|o==="r",C=s[o],z,F;if(C>0&&n[o]!==
60	+ "none"&&p[o].la()>0){z=s[B?o:x];x=s[B?x:o];F=s[B?o:q];q=s[B?q:o];if(n[o]==="dashed"\|\|n[o]==="dotted"){j.push({path:w(y,z,x,D+45,0,1)+w(y,0,0,D,1,0),fill:p[o]});j.push({path:r(o,C/2,0,1),stroke:n[o],mb:C,color:p[o]});j.push({path:w(A,F,q,D,0,1)+w(A,0,0,D-45,1,0),fill:p[o]})}else j.push({path:w(y,z,x,D+45,0,1)+r(o,C,0,0)+w(A,F,q,D,0,0)+(n[o]==="double"&&C>2?w(A,F-d(F/3),q-d(q/3),D-45,1,0)+r(o,i(C/3*2),1,0)+w(y,z-d(z/3),x-d(x/3),D,1,0)+"x "+w(y,d(z/3),d(x/3),D+45,0,1)+r(o,d(C/3),1,0)+w(A,d(F/3),d(q/
61	+ 3),D,0,0):"")+w(A,0,0,D-45,1,0)+r(o,0,1,0)+w(y,0,0,D,1,0),fill:p[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},n:function(){g.B.n.call(this);this.e.runtimeStyle.borderColor=""}});g.Ub=g.B.Z({C:5,Oc:["t","tr","r","br","b","bl","l","tl","c"],R:function(){return this.j.N.D()},g:function(){return this.j.N.g()},X:function(){this.w();var a=this.j.N.m(),b=this.q.o(),c=this.e,e=this.Gb;g.p.Pb(a.src,function(f){function h(w,
62	+ r,o,x,q){w=e[w].style;var y=Math.max;w.width=y(r,0);w.height=y(o,0);w.left=x;w.top=q}function j(w,r,o){for(var x=0,q=w.length;x<q;x++)e[w[x]].imagedata[r]=o}var d=b.i,i=b.f,k=a.width,m=k.T.a(c),l=k.S.a(c),t=k.L.a(c);k=k.Q.a(c);var n=a.slice,p=n.T.a(c),s=n.S.a(c),u=n.L.a(c);n=n.Q.a(c);h("tl",k,m,0,0);h("t",d-k-l,m,k,0);h("tr",l,m,d-l,0);h("r",l,i-m-t,d-l,m);h("br",l,t,d-l,i-t);h("b",d-k-l,t,k,i-t);h("bl",k,t,0,i-t);h("l",k,i-m-t,0,m);h("c",d-k-l,i-m-t,k,m);j(["tl","t","tr"],"cropBottom",(f.f-p)/f.f);
63	+ j(["tl","l","bl"],"cropRight",(f.i-n)/f.i);j(["bl","b","br"],"cropTop",(f.f-u)/f.f);j(["tr","r","br"],"cropLeft",(f.i-s)/f.i);if(a.repeat.kb==="stretch"){j(["l","r","c"],"cropTop",p/f.f);j(["l","r","c"],"cropBottom",u/f.f)}if(a.repeat.f==="stretch"){j(["t","b","c"],"cropLeft",n/f.i);j(["t","b","c"],"cropRight",s/f.i)}e.c.style.display=a.fill?"":"none"},this)},w:function(){var a=this.parent.ra(this.C),b,c,e,f=this.Oc,h=f.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";
64	+ this.Gb={};for(e=0;e<h;e++){c=this.Gb[f[e]]=g.p.Ga("rect");c.appendChild(g.p.Ga("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.j.N.m().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.Wa(this.C,a)}return a}});g.Yb=g.B.Z({C:1,Fa:"outset-box-shadow",R:function(){var a=this.j;return a.W.D()\|\|a.v.D()},g:function(){var a=this.j.W;return a.g()&&a.m().ua[0]},X:function(){function a(z,F,H,K,J,v,E){z=b.sa("shadow"+z+F,"fill",
65	+ e,j-z);F=z.fill;z.coordsize=m2+","+l2;z.coordorigin="1,1";z.stroked=false;z.filled=true;F.color=J.O(c);if(v){F.type="gradienttitle";F.color2=F.color;F.opacity=0}z.path=E;u=z.style;u.left=H;u.top=K;u.width=m;u.height=l;return z}var b=this,c=this.e,e=this.w(),f=this.j,h=f.W.m().ua;f=f.v.m();var j=h.length,d=j,i,k=this.q.o(),m=k.i,l=k.f;k=g.J===8?1:0;for(var t=["tl","tr","br","bl"],n,p,s,u,w,r,o,x,q,y,A,D,B,C;d--;){p=h[d];w=p.fd.a(c);r=p.gd.a(c);i=p.Xc.a(c);o=p.blur.a(c);p=p.color;x=-i-o;if(!f&&o)f=
66	+ g.Oa.Qb;x=this.oa({T:x,S:x,L:x,Q:x},2,f);if(o){q=(i+o)2+m;y=(i+o)2+l;A=o2/q;D=o2/y;if(o-i>m/2\|\|o-i>l/2)for(i=4;i--;){n=t[i];B=n.charAt(0)==="b";C=n.charAt(1)==="r";n=a(d,n,w,r,p,o,x);s=n.fill;s.focusposition=(C?1-A:A)+","+(B?1-D:D);s.focussize="0,0";n.style.clip="rect("+((B?y/2:0)+k)+"px,"+(C?q:q/2)+"px,"+(B?y:y/2)+"px,"+((C?q/2:0)+k)+"px)"}else{n=a(d,"",w,r,p,o,x);s=n.fill;s.focusposition=A+","+D;s.focussize=1-A2+","+(1-D2)}}else{n=a(d,"",w,r,p,o,x);w=p.la();if(w<1)n.fill.opacity=w}}}});g.bc=
67	+ g.B.Z({C:6,Fa:"imgEl",R:function(){var a=this.j;return this.e.src!==this.hc\|\|a.v.D()},g:function(){var a=this.j;return a.v.g()\|\|a.H.Eb()},X:function(){this.hc=j;this.Gc();var a=this.sa("img","fill",this.w()),b=a.fill,c=this.q.o(),e=c.i;c=c.f;var f=this.j.I.m();f=f&&f.nb;var h=this.e,j=h.src,d=Math.round;a.stroked=false;b.type="frame";b.src=j;b.position=(e?0.5/e:0)+","+(c?0.5/c:0);a.coordsize=e2+","+c2;a.coordorigin="1,1";a.path=this.oa(f?{T:d(f.t.a(h)),S:d(f.r.a(h)),L:d(f.b.a(h)),Q:d(f.l.a(h))}:
68	+ 0,2);a=a.style;a.width=e;a.height=c},Gc:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},n:function(){g.B.n.call(this);this.e.runtimeStyle.filter=""}});g.Qa=function(){function a(d){function i(){if(!z){var v,E,G=d.currentStyle,I=G.getAttribute(c)==="true";J=G.getAttribute(e);J=g.Ab===8?J!=="false":J==="true";if(!C){C=1;d.runtimeStyle.zoom=1;G=d;for(var O=1;G=G.previousSibling;)if(G.nodeType===1){O=0;break}if(O)d.className+=" "+g.Pa+"first-child"}y.Ja();if(I&&(E=y.o())&&(v=doc.documentElement\|\|
69	+ doc.body)&&(E.y>v.clientHeight\|\|E.x>v.clientWidth\|\|E.y+E.f<0\|\|E.x+E.i<0)){if(!H){H=1;g.Ra.aa(i)}}else{z=1;H=C=0;g.Ra.Ma(i);A={H:new g.Tb(d),I:new g.Xb(d),N:new g.Vb(d),v:new g.Oa(d),W:new g.Zb(d),lb:new g.ec(d)};D=[A.H,A.I,A.N,A.v,A.W,A.lb];v=new g.cc(d,y,A);E=[new g.Yb(d,y,A,v),new g.Sb(d,y,A,v),new g.Wb(d,y,A,v),new g.Ub(d,y,A,v)];d.tagName==="IMG"&&E.push(new g.bc(d,y,A,v));v.oc=E;q=[v].concat(E);if(v=d.currentStyle.getAttribute(g.F+"watch-ancestors")){B=[];v=parseInt(v,10);E=0;for(I=d.parentNode;I&&
70	+ (v==="NaN"\|\|E++<v);){B.push(I);I.attachEvent("onpropertychange",u);I.attachEvent("onmouseenter",p);I.attachEvent("onmouseleave",s);I=I.parentNode}}if(J){g.ya.aa(m);g.ya.Tc()}m(1)}if(!F){F=1;d.attachEvent("onmove",k);d.attachEvent("onresize",k);d.attachEvent("onpropertychange",l);d.attachEvent("onmouseenter",p);d.attachEvent("onmouseleave",s);g.za.aa(k);g.G.aa(o)}y.La()}}function k(){y&&y.Ec()&&m()}function m(v){if(!K)if(z){var E,G;w();if(v\|\|y.Qc()){E=0;for(G=q.length;E<G;E++)q[E].jb()}if(v\|\|y.Vc()){E=
71	+ 0;for(G=q.length;E<G;E++)q[E].Lb()}r()}else C\|\|i()}function l(){var v,E,G;v=event;if(!K&&!(v&&v.propertyName in j))if(z){w();v=0;for(E=q.length;v<E;v++){G=q[v];G.eb\|\|G.jb();G.R()&&G.Kb()}r()}else C\|\|i()}function t(){if(d)d.className+=f}function n(){if(d)d.className=d.className.replace(h,"")}function p(){setTimeout(t,0)}function s(){setTimeout(n,0)}function u(){var v=event.propertyName;if(v==="className"\|\|v==="id")l()}function w(){y.Ja();for(var v=D.length;v--;)D[v].Ja()}function r(){for(var v=D.length;v--;)D[v].La();
72	+ y.La()}function o(){if(F){if(B)for(var v=0,E=B.length,G;v<E;v++){G=B[v];G.detachEvent("onpropertychange",u);G.detachEvent("onmouseenter",p);G.detachEvent("onmouseleave",s)}d.detachEvent("onmove",m);d.detachEvent("onresize",m);d.detachEvent("onpropertychange",l);d.detachEvent("onmouseenter",p);d.detachEvent("onmouseleave",s);g.G.Ma(o);F=0}}function x(){if(!K){var v,E;o();K=1;if(q){v=0;for(E=q.length;v<E;v++)q[v].n()}J&&g.ya.Ma(m);g.za.Ma(m);q=y=A=D=B=d=null}}var q,y=new M(d),A,D,B,C,z,F,H,K,J;this.Ic=
73	+ i;this.update=m;this.n=x;this.Ac=d}var b={},c=g.F+"lazy-init",e=g.F+"poll",f=" "+g.Pa+"hover",h=new RegExp("\\b"+g.Pa+"hover\\b","g"),j={background:1,bgColor:1,display:1};a.Cc=function(d){var i=g.p.ta(d);return b[i]\|\|(b[i]=new a(d))};a.n=function(d){d=g.p.ta(d);var i=b[d];if(i){i.n();delete b[d]}};a.wc=function(){var d=[],i;if(b){for(var k in b)if(b.hasOwnProperty(k)){i=b[k];d.push(i.Ac);i.n()}b={}}return d};return a}();g.attach=function(a){g.Ab<9&&g.Qa.Cc(a).Ic()};g.detach=function(a){g.Qa.n(a)}};
74	})();

js/PIE/PIE.php CHANGED Viewed

@@ -1,19 +1,19 @@
-            -
            <?php
-            -
            /*
-            -
            This file is a wrapper, for use in PHP environments, which serves PIE.htc using the
-            -
            correct content-type, so that IE will recognize it as a behavior.  Simply specify the
-            -
            behavior property to fetch this .php file instead of the .htc directly:
-            -
-            -
            .myElement {
-            -
                [ ...css3 properties... ]
-            -
                behavior: url(PIE.php);
-            -
            }
-            -
-            -
            This is only necessary when the web server is not configured to serve .htc files with
-            -
            the text/x-component content-type, and cannot easily be configured to do so (as is the
-            -
            case with some shared hosting providers).
-            -
            */
-            -
-            -
            header( 'Content-type: text/x-component' );
-            -
            include( 'PIE.htc' );
             ?>


1	+ <?php
2	+ /*
3	+ This file is a wrapper, for use in PHP environments, which serves PIE.htc using the
4	+ correct content-type, so that IE will recognize it as a behavior. Simply specify the
5	+ behavior property to fetch this .php file instead of the .htc directly:
6	+
7	+ .myElement {
8	+ [ ...css3 properties... ]
9	+ behavior: url(PIE.php);
10	+ }
11	+
12	+ This is only necessary when the web server is not configured to serve .htc files with
13	+ the text/x-component content-type, and cannot easily be configured to do so (as is the
14	+ case with some shared hosting providers).
15	+ */
16	+
17	+ header( 'Content-type: text/x-component' );
18	+ include( 'PIE.htc' );
19	?>

js/PIE/PIE_uncompressed.htc CHANGED Viewed

@@ -1,3713 +1,3713 @@
-            -
            <!--
-            -
            PIE: CSS3 rendering for IE
-            -
            Version 1.0beta4
-            -
            http://css3pie.com
-            -
            Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
-            -
            -->
-            -
            <PUBLIC:COMPONENT lightWeight="true">
-            -
            <PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
-            -
            <PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
-            -
            <PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
-            -
-            -
            <script type="text/javascript">
-            -
            var doc = element.document;var PIE = window['PIE'];
-            -
-            -
            if( !PIE ) {
-            -
                PIE = window['PIE'] = {
-            -
                    CSS_PREFIX: '-pie-',
-            -
                    STYLE_PREFIX: 'Pie',
-            -
                    CLASS_PREFIX: 'pie_',
-            -
                    tableCellTags: {
-            -
                        'TD': 1,
-            -
                        'TH': 1
-            -
                    }
-            -
                };
-            -
-            -
                // Force the background cache to be used. No reason it shouldn't be.
-            -
                try {
-            -
                    doc.execCommand( 'BackgroundImageCache', false, true );
-            -
                } catch(e) {}
-            -
-            -
                /*
-            -
                 * IE version detection approach by James Padolsey, with modifications -- from
-            -
                 * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
-            -
                 */
-            -
                PIE.ieVersion = function(){
-            -
                    var v = 4,
-            -
                        div = doc.createElement('div'),
-            -
                        all = div.getElementsByTagName('i');
-            -
-            -
                    while (
-            -
                        div.innerHTML = '<!--[if gt IE ' + (++v) + ']><i></i><![endif]-->',
-            -
                        all[0]
-            -
                    ) {}
-            -
-            -
                    return v;
-            -
                }();
-            -
-            -
                // Detect IE6
-            -
                if( PIE.ieVersion === 6 ) {
-            -
                    // IE6 can't access properties with leading dash, but can without it.
-            -
                    PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
-            -
                }
-            -
-            -
                // Detect IE8
-            -
                PIE.ieDocMode = doc.documentMode || PIE.ieVersion;
-            -
            /**
-            -
             * Utility functions
-            -
             */
-            -
            (function() {
-            -
                var vmlCreatorDoc,
-            -
                    idNum = 0,
-            -
                    imageSizes = {};
-            -
-            -
-            -
                PIE.Util = {
-            -
-            -
                    /**
-            -
                     * To create a VML element, it must be created by a Document which has the VML
-            -
                     * namespace set. Unfortunately, if you try to add the namespace programatically
-            -
                     * into the main document, you will get an "Unspecified error" when trying to
-            -
                     * access document.namespaces before the document is finished loading. To get
-            -
                     * around this, we create a DocumentFragment, which in IE land is apparently a
-            -
                     * full-fledged Document. It allows adding namespaces immediately, so we add the
-            -
                     * namespace there and then have it create the VML element.
-            -
                     * @param {string} tag The tag name for the VML element
-            -
                     * @return {Element} The new VML element
-            -
                     */
-            -
                    createVmlElement: function( tag ) {
-            -
                        var vmlPrefix = 'css3vml';
-            -
                        if( !vmlCreatorDoc ) {
-            -
                            vmlCreatorDoc = doc.createDocumentFragment();
-            -
                            vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
-            -
                        }
-            -
                        return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Generate and return a unique ID for a given object. The generated ID is stored
-            -
                     * as a property of the object for future reuse.
-            -
                     * @param {Object} obj
-            -
                     */
-            -
                    getUID: function( obj ) {
-            -
                        return obj && obj[ '_pieId' ] || ( obj[ '_pieId' ] = ++idNum );
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Simple utility for merging objects
-            -
                     * @param {Object} obj1 The main object into which all others will be merged
-            -
                     * @param {...Object} var_args Other objects which will be merged into the first, in order
-            -
                     */
-            -
                    merge: function( obj1 ) {
-            -
                        var i, len, p, objN, args = arguments;
-            -
                        for( i = 1, len = args.length; i < len; i++ ) {
-            -
                            objN = args[i];
-            -
                            for( p in objN ) {
-            -
                                if( objN.hasOwnProperty( p ) ) {
-            -
                                    obj1[ p ] = objN[ p ];
-            -
                                }
-            -
                            }
-            -
                        }
-            -
                        return obj1;
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Execute a callback function, passing it the dimensions of a given image once
-            -
                     * they are known.
-            -
                     * @param {string} src The source URL of the image
-            -
                     * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
-            -
                     * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
-            -
                     */
-            -
                    withImageSize: function( src, func, ctx ) {
-            -
                        var size = imageSizes[ src ], img, queue;
-            -
                        if( size ) {
-            -
                            // If we have a queue, add to it
-            -
                            if( Object.prototype.toString.call( size ) === '[object Array]' ) {
-            -
                                size.push( [ func, ctx ] );
-            -
                            }
-            -
                            // Already have the size cached, call func right away
-            -
                            else {
-            -
                                func.call( ctx, size );
-            -
                            }
-            -
                        } else {
-            -
                            queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
-            -
                            img = new Image();
-            -
                            img.onload = function() {
-            -
                                size = imageSizes[ src ] = { w: img.width, h: img.height };
-            -
                                for( var i = 0, len = queue.length; i < len; i++ ) {
-            -
                                    queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
-            -
                                }
-            -
                                img.onload = null;
-            -
                            };
-            -
                            img.src = src;
-            -
                        }
-            -
                    }
-            -
                };
-            -
            })();/**
-            -
             *
-            -
             */
-            -
            PIE.Observable = function() {
-            -
                /**
-            -
                 * List of registered observer functions
-            -
                 */
-            -
                this.observers = [];
-            -
-            -
                /**
-            -
                 * Hash of function ids to their position in the observers list, for fast lookup
-            -
                 */
-            -
                this.indexes = {};
-            -
            };
-            -
            PIE.Observable.prototype = {
-            -
-            -
                observe: function( fn ) {
-            -
                    var id = PIE.Util.getUID( fn ),
-            -
                        indexes = this.indexes,
-            -
                        observers = this.observers;
-            -
                    if( !( id in indexes ) ) {
-            -
                        indexes[ id ] = observers.length;
-            -
                        observers.push( fn );
-            -
                    }
-            -
                },
-            -
-            -
                unobserve: function( fn ) {
-            -
                    var id = PIE.Util.getUID( fn ),
-            -
                        indexes = this.indexes;
-            -
                    if( id && id in indexes ) {
-            -
                        delete this.observers[ indexes[ id ] ];
-            -
                        delete indexes[ id ];
-            -
                    }
-            -
                },
-            -
-            -
                fire: function() {
-            -
                    var o = this.observers,
-            -
                        i = o.length;
-            -
                    while( i-- ) {
-            -
                        o[ i ] && o[ i ]();
-            -
                    }
-            -
                }
-            -
-            -
            };/*
-            -
             * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
-            -
             * always firing the onmove and onresize events when elements are moved or resized. We check a few
-            -
             * times every second to make sure the elements have the correct position and size. See Element.js
-            -
             * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8
-            -
             * and false elsewhere.
-            -
             */
-            -
-            -
            PIE.Heartbeat = new PIE.Observable();
-            -
            PIE.Heartbeat.run = function() {
-            -
                var me = this;
-            -
                if( !me.running ) {
-            -
                    setInterval( function() { me.fire() }, 250 );
-            -
                    me.running = 1;
-            -
                }
-            -
            };
-            -
            /**
-            -
             * Create an observable listener for the onbeforeunload event
-            -
             */
-            -
            PIE.OnBeforeUnload = new PIE.Observable();
-            -
            window.attachEvent( 'onbeforeunload', function() { PIE.OnBeforeUnload.fire(); } );
-            -
-            -
            /**
-            -
             * Attach an event which automatically gets detached onbeforeunload
-            -
             */
-            -
            PIE.OnBeforeUnload.attachManagedEvent = function( target, name, handler ) {
-            -
                target.attachEvent( name, handler );
-            -
                this.observe( function() {
-            -
                    target.detachEvent( name, handler );
-            -
                } );
-            -
            };/**
-            -
             * Create a single observable listener for window resize events.
-            -
             */
-            -
            (function() {
-            -
                PIE.OnResize = new PIE.Observable();
-            -
-            -
                function resized() {
-            -
                    PIE.OnResize.fire();
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onresize', resized );
-            -
            })();
-            -
            /**
-            -
             * Create a single observable listener for scroll events. Used for lazy loading based
-            -
             * on the viewport, and for fixed position backgrounds.
-            -
             */
-            -
            (function() {
-            -
                PIE.OnScroll = new PIE.Observable();
-            -
-            -
                function scrolled() {
-            -
                    PIE.OnScroll.fire();
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onscroll', scrolled );
-            -
-            -
                PIE.OnResize.observe( scrolled );
-            -
            })();
-            -
            /**
-            -
             * Listen for printing events, destroy all active PIE instances when printing, and
-            -
             * restore them afterward.
-            -
             */
-            -
            (function() {
-            -
-            -
                var elements;
-            -
-            -
                function beforePrint() {
-            -
                    elements = PIE.Element.destroyAll();
-            -
                }
-            -
-            -
                function afterPrint() {
-            -
                    if( elements ) {
-            -
                        for( var i = 0, len = elements.length; i < len; i++ ) {
-            -
                            PIE[ 'attach' ]( elements[i] );
-            -
                        }
-            -
                        elements = 0;
-            -
                    }
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
-            -
-            -
            })();/**
-            -
             * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
-            -
             * value is returned from PIE.getLength() - always use that instead of instantiating directly.
-            -
             * @constructor
-            -
             * @param {string} val The CSS string representing the length. It is assumed that this will already have
-            -
             *                 been validated as a valid length or percentage syntax.
-            -
             */
-            -
            PIE.Length = (function() {
-            -
                var lengthCalcEl = doc.createElement( 'length-calc' ),
-            -
                    parent = doc.documentElement,
-            -
                    s = lengthCalcEl.style,
-            -
                    conversions = {},
-            -
                    units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
-            -
                    i = units.length,
-            -
                    instances = {};
-            -
-            -
                s.position = 'absolute';
-            -
                s.top = s.left = '-9999px';
-            -
-            -
                parent.appendChild( lengthCalcEl );
-            -
                while( i-- ) {
-            -
                    lengthCalcEl.style.width = '100' + units[i];
-            -
                    conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
-            -
                }
-            -
                parent.removeChild( lengthCalcEl );
-            -
-            -
-            -
                function Length( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
                Length.prototype = {
-            -
                    /**
-            -
                     * Regular expression for matching the length unit
-            -
                     * @private
-            -
                     */
-            -
                    unitRE: /(px|em|ex|mm|cm|in|pt|pc|%)$/,
-            -
-            -
                    /**
-            -
                     * Get the numeric value of the length
-            -
                     * @return {number} The value
-            -
                     */
-            -
                    getNumber: function() {
-            -
                        var num = this.num,
-            -
                            UNDEF;
-            -
                        if( num === UNDEF ) {
-            -
                            num = this.num = parseFloat( this.val );
-            -
                        }
-            -
                        return num;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Get the unit of the length
-            -
                     * @return {string} The unit
-            -
                     */
-            -
                    getUnit: function() {
-            -
                        var unit = this.unit,
-            -
                            m;
-            -
                        if( !unit ) {
-            -
                            m = this.val.match( this.unitRE );
-            -
                            unit = this.unit = ( m && m[0] ) || 'px';
-            -
                        }
-            -
                        return unit;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Determine whether this is a percentage length value
-            -
                     * @return {boolean}
-            -
                     */
-            -
                    isPercentage: function() {
-            -
                        return this.getUnit() === '%';
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Resolve this length into a number of pixels.
-            -
                     * @param {Element} el - the context element, used to resolve font-relative values
-            -
                     * @param {(function():number|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
-            -
                     *                  function which will be called to return the number.
-            -
                     */
-            -
                    pixels: function( el, pct100 ) {
-            -
                        var num = this.getNumber(),
-            -
                            unit = this.getUnit();
-            -
                        switch( unit ) {
-            -
                            case "px":
-            -
                                return num;
-            -
                            case "%":
-            -
                                return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
-            -
                            case "em":
-            -
                                return num * this.getEmPixels( el );
-            -
                            case "ex":
-            -
                                return num * this.getEmPixels( el ) / 2;
-            -
                            default:
-            -
                                return num * conversions[ unit ];
-            -
                        }
-            -
                    },
-            -
-            -
                    /**
-            -
                     * The em and ex units are relative to the font-size of the current element,
-            -
                     * however if the font-size is set using non-pixel units then we get that value
-            -
                     * rather than a pixel conversion. To get around this, we keep a floating element
-            -
                     * with width:1em which we insert into the target element and then read its offsetWidth.
-            -
                     * But if the font-size *is* specified in pixels, then we use that directly to avoid
-            -
                     * the expensive DOM manipulation.
-            -
                     * @param el
-            -
                     */
-            -
                    getEmPixels: function( el ) {
-            -
                        var fs = el.currentStyle.fontSize,
-            -
                            px;
-            -
-            -
                        if( fs.indexOf( 'px' ) > 0 ) {
-            -
                            return parseFloat( fs );
-            -
                        } else {
-            -
                            lengthCalcEl.style.width = '1em';
-            -
                            el.appendChild( lengthCalcEl );
-            -
                            px = lengthCalcEl.offsetWidth;
-            -
                            if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
-            -
                                el.removeChild( lengthCalcEl );
-            -
                            }
-            -
                            return px;
-            -
                        }
-            -
                    }
-            -
                };
-            -
-            -
-            -
                /**
-            -
                 * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
-            -
                 * @param {string} val The CSS string representing the length. It is assumed that this will already have
-            -
                 *                 been validated as a valid length or percentage syntax.
-            -
                 */
-            -
                PIE.getLength = function( val ) {
-            -
                    return instances[ val ] || ( instances[ val ] = new Length( val ) );
-            -
                };
-            -
-            -
                return Length;
-            -
            })();
-            -
            /**
-            -
             * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
-            -
             * @constructor
-            -
             * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
-            -
             */
-            -
            PIE.BgPosition = (function() {
-            -
-            -
                var length_fifty = PIE.getLength( '50%' ),
-            -
                    vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
-            -
                    horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
-            -
-            -
-            -
                function BgPosition( tokens ) {
-            -
                    this.tokens = tokens;
-            -
                }
-            -
                BgPosition.prototype = {
-            -
                    /**
-            -
                     * Normalize the values into the form:
-            -
                     * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
-            -
                     * where: xOffsetSide is either 'left' or 'right',
-            -
                     *        yOffsetSide is either 'top' or 'bottom',
-            -
                     *        and x/yOffsetLength are both PIE.Length objects.
-            -
                     * @return {Array}
-            -
                     */
-            -
                    getValues: function() {
-            -
                        if( !this._values ) {
-            -
                            var tokens = this.tokens,
-            -
                                len = tokens.length,
-            -
                                Tokenizer = PIE.Tokenizer,
-            -
                                identType = Tokenizer.Type,
-            -
                                length_zero = PIE.getLength( '0' ),
-            -
                                type_ident = identType.IDENT,
-            -
                                type_length = identType.LENGTH,
-            -
                                type_percent = identType.PERCENT,
-            -
                                type, value,
-            -
                                vals = [ 'left', length_zero, 'top', length_zero ];
-            -
-            -
                            // If only one value, the second is assumed to be 'center'
-            -
                            if( len === 1 ) {
-            -
                                tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
-            -
                                len++;
-            -
                            }
-            -
-            -
                            // Two values - CSS2
-            -
                            if( len === 2 ) {
-            -
                                // If both idents, they can appear in either order, so switch them if needed
-            -
                                if( type_ident & ( tokens[0].tokenType | tokens[1].tokenType ) &&
-            -
                                    tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
-            -
                                    tokens.push( tokens.shift() );
-            -
                                }
-            -
                                if( tokens[0].tokenType & type_ident ) {
-            -
                                    if( tokens[0].tokenValue === 'center' ) {
-            -
                                        vals[1] = length_fifty;
-            -
                                    } else {
-            -
                                        vals[0] = tokens[0].tokenValue;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokens[0].isLengthOrPercent() ) {
-            -
                                    vals[1] = PIE.getLength( tokens[0].tokenValue );
-            -
                                }
-            -
                                if( tokens[1].tokenType & type_ident ) {
-            -
                                    if( tokens[1].tokenValue === 'center' ) {
-            -
                                        vals[3] = length_fifty;
-            -
                                    } else {
-            -
                                        vals[2] = tokens[1].tokenValue;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokens[1].isLengthOrPercent() ) {
-            -
                                    vals[3] = PIE.getLength( tokens[1].tokenValue );
-            -
                                }
-            -
                            }
-            -
-            -
                            // Three or four values - CSS3
-            -
                            else {
-            -
                                // TODO
-            -
                            }
-            -
-            -
                            this._values = vals;
-            -
                        }
-            -
                        return this._values;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Find the coordinates of the background image from the upper-left corner of the background area.
-            -
                     * Note that these coordinate values are not rounded.
-            -
                     * @param {Element} el
-            -
                     * @param {number} width - the width for percentages (background area width minus image width)
-            -
                     * @param {number} height - the height for percentages (background area height minus image height)
-            -
                     * @return {Object} { x: Number, y: Number }
-            -
                     */
-            -
                    coords: function( el, width, height ) {
-            -
                        var vals = this.getValues(),
-            -
                            pxX = vals[1].pixels( el, width ),
-            -
                            pxY = vals[3].pixels( el, height );
-            -
-            -
                        return {
-            -
                            x: vals[0] === 'right' ? width - pxX : pxX,
-            -
                            y: vals[2] === 'bottom' ? height - pxY : pxY
-            -
                        };
-            -
                    }
-            -
                };
-            -
-            -
                return BgPosition;
-            -
            })();
-            -
            /**
-            -
             * Wrapper for angle values; handles conversion to degrees from all allowed angle units
-            -
             * @constructor
-            -
             * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
-            -
             */
-            -
            PIE.Angle = (function() {
-            -
                function Angle( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
                Angle.prototype = {
-            -
                    unitRE: /[a-z]+$/i,
-            -
-            -
                    /**
-            -
                     * @return {string} The unit of the angle value
-            -
                     */
-            -
                    getUnit: function() {
-            -
                        return this._unit || ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Get the numeric value of the angle in degrees.
-            -
                     * @return {number} The degrees value
-            -
                     */
-            -
                    degrees: function() {
-            -
                        var deg = this._deg, u, n;
-            -
                        if( deg === undefined ) {
-            -
                            u = this.getUnit();
-            -
                            n = parseFloat( this.val, 10 );
-            -
                            deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
-            -
                        }
-            -
                        return deg;
-            -
                    }
-            -
                };
-            -
-            -
                return Angle;
-            -
            })();/**
-            -
             * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
-            -
             * value is returned from PIE.getColor() - always use that instead of instantiating directly.
-            -
             * @constructor
-            -
             * @param {string} val The raw CSS string value for the color
-            -
             */
-            -
            PIE.Color = (function() {
-            -
                var instances = {};
-            -
-            -
                function Color( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
-            -
                /**
-            -
                 * Regular expression for matching rgba colors and extracting their components
-            -
                 * @type {RegExp}
-            -
                 */
-            -
                Color.rgbaRE = /\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;
-            -
-            -
                Color.names = {
-            -
                    "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
-            -
                    "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
-            -
                    "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
-            -
                    "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
-            -
                    "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
-            -
                    "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
-            -
                    "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
-            -
                    "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
-            -
                    "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
-            -
                    "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
-            -
                    "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
-            -
                    "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
-            -
                    "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
-            -
                    "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
-            -
                    "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
-            -
                    "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
-            -
                    "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
-            -
                    "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
-            -
                    "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
-            -
                    "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
-            -
                    "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
-            -
                    "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
-            -
                    "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
-            -
                    "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
-            -
                    "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
-            -
                    "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
-            -
                    "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
-            -
                    "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
-            -
                    "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
-            -
                    "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
-            -
                    "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
-            -
                    "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
-            -
                    "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
-            -
                    "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
-            -
                    "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
-            -
                    "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
-            -
                    "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
-            -
                    "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
-            -
                    "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
-            -
                    "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
-            -
                    "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
-            -
                    "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
-            -
                    "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
-            -
                    "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
-            -
                    "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
-            -
                    "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
-            -
                    "yellow":"FF0", "yellowgreen":"9ACD32"
-            -
                };
-            -
-            -
                Color.prototype = {
-            -
                    /**
-            -
                     * @private
-            -
                     */
-            -
                    parse: function() {
-            -
                        if( !this._color ) {
-            -
                            var me = this,
-            -
                                v = me.val,
-            -
                                vLower,
-            -
                                m = v.match( Color.rgbaRE );
-            -
                            if( m ) {
-            -
                                me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
-            -
                                me._alpha = parseFloat( m[4] );
-            -
                            }
-            -
                            else {
-            -
                                if( ( vLower = v.toLowerCase() ) in Color.names ) {
-            -
                                    v = '#' + Color.names[vLower];
-            -
                                }
-            -
                                me._color = v;
-            -
                                me._alpha = ( v === 'transparent' ? 0 : 1 );
-            -
                            }
-            -
                        }
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve the value of the color in a format usable by IE natively. This will be the same as
-            -
                     * the raw input value, except for rgba values which will be converted to an rgb value.
-            -
                     * @param {Element} el The context element, used to get 'currentColor' keyword value.
-            -
                     * @return {string} Color value
-            -
                     */
-            -
                    colorValue: function( el ) {
-            -
                        this.parse();
-            -
                        return this._color === 'currentColor' ? el.currentStyle.color : this._color;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
-            -
                     * with an alpha component.
-            -
                     * @return {number} The alpha value, from 0 to 1.
-            -
                     */
-            -
                    alpha: function() {
-            -
                        this.parse();
-            -
                        return this._alpha;
-            -
                    }
-            -
                };
-            -
-            -
-            -
                /**
-            -
                 * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
-            -
                 * @param {string} val The CSS string representing the color. It is assumed that this will already have
-            -
                 *                 been validated as a valid color syntax.
-            -
                 */
-            -
                PIE.getColor = function(val) {
-            -
                    return instances[ val ] || ( instances[ val ] = new Color( val ) );
-            -
                };
-            -
-            -
                return Color;
-            -
            })();/**
-            -
             * A tokenizer for CSS value strings.
-            -
             * @constructor
-            -
             * @param {string} css The CSS value string
-            -
             */
-            -
            PIE.Tokenizer = (function() {
-            -
                function Tokenizer( css ) {
-            -
                    this.css = css;
-            -
                    this.ch = 0;
-            -
                    this.tokens = [];
-            -
                    this.tokenIndex = 0;
-            -
                }
-            -
-            -
                /**
-            -
                 * Enumeration of token type constants.
-            -
                 * @enum {number}
-            -
                 */
-            -
                var Type = Tokenizer.Type = {
-            -
                    ANGLE: 1,
-            -
                    CHARACTER: 2,
-            -
                    COLOR: 4,
-            -
                    DIMEN: 8,
-            -
                    FUNCTION: 16,
-            -
                    IDENT: 32,
-            -
                    LENGTH: 64,
-            -
                    NUMBER: 128,
-            -
                    OPERATOR: 256,
-            -
                    PERCENT: 512,
-            -
                    STRING: 1024,
-            -
                    URL: 2048
-            -
                };
-            -
-            -
                /**
-            -
                 * A single token
-            -
                 * @constructor
-            -
                 * @param {number} type The type of the token - see PIE.Tokenizer.Type
-            -
                 * @param {string} value The value of the token
-            -
                 */
-            -
                Tokenizer.Token = function( type, value ) {
-            -
                    this.tokenType = type;
-            -
                    this.tokenValue = value;
-            -
                };
-            -
                Tokenizer.Token.prototype = {
-            -
                    isLength: function() {
-            -
                        return this.tokenType & Type.LENGTH || ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
-            -
                    },
-            -
                    isLengthOrPercent: function() {
-            -
                        return this.isLength() || this.tokenType & Type.PERCENT;
-            -
                    }
-            -
                };
-            -
-            -
                Tokenizer.prototype = {
-            -
                    whitespace: /\s/,
-            -
                    number: /^[\+\-]?(\d*\.)?\d+/,
-            -
                    url: /^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,
-            -
                    ident: /^\-?[_a-z][\w-]*/i,
-            -
                    string: /^("([^"]*)"|'([^']*)')/,
-            -
                    operator: /^[\/,]/,
-            -
                    hash: /^#[\w]+/,
-            -
                    hashColor: /^#([\da-f]{6}|[\da-f]{3})/i,
-            -
-            -
                    unitTypes: {
-            -
                        'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
-            -
                        'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
-            -
                        'pt': Type.LENGTH, 'pc': Type.LENGTH,
-            -
                        'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
-            -
                    },
-            -
-            -
                    colorNames: {
-            -
                        'aqua':1, 'black':1, 'blue':1, 'fuchsia':1, 'gray':1, 'green':1, 'lime':1, 'maroon':1,
-            -
                        'navy':1, 'olive':1, 'purple':1, 'red':1, 'silver':1, 'teal':1, 'white':1, 'yellow': 1,
-            -
                        'currentColor': 1
-            -
                    },
-            -
-            -
                    colorFunctions: {
-            -
                        'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Advance to and return the next token in the CSS string. If the end of the CSS string has
-            -
                     * been reached, null will be returned.
-            -
                     * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
-            -
                     * @return {PIE.Tokenizer.Token}
-            -
                     */
-            -
                    next: function( forget ) {
-            -
                        var css, ch, firstChar, match, val,
-            -
                            me = this;
-            -
-            -
                        function newToken( type, value ) {
-            -
                            var tok = new Tokenizer.Token( type, value );
-            -
                            if( !forget ) {
-            -
                                me.tokens.push( tok );
-            -
                                me.tokenIndex++;
-            -
                            }
-            -
                            return tok;
-            -
                        }
-            -
                        function failure() {
-            -
                            me.tokenIndex++;
-            -
                            return null;
-            -
                        }
-            -
-            -
                        // In case we previously backed up, return the stored token in the next slot
-            -
                        if( this.tokenIndex < this.tokens.length ) {
-            -
                            return this.tokens[ this.tokenIndex++ ];
-            -
                        }
-            -
-            -
                        // Move past leading whitespace characters
-            -
                        while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
-            -
                            this.ch++;
-            -
                        }
-            -
                        if( this.ch >= this.css.length ) {
-            -
                            return failure();
-            -
                        }
-            -
-            -
                        ch = this.ch;
-            -
                        css = this.css.substring( this.ch );
-            -
                        firstChar = css.charAt( 0 );
-            -
                        switch( firstChar ) {
-            -
                            case '#':
-            -
                                if( match = css.match( this.hashColor ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.COLOR, match[0] );
-            -
                                }
-            -
                                break;
-            -
-            -
                            case '"':
-            -
                            case "'":
-            -
                                if( match = css.match( this.string ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.STRING, match[2] || match[3] || '' );
-            -
                                }
-            -
                                break;
-            -
-            -
                            case "/":
-            -
                            case ",":
-            -
                                this.ch++;
-            -
                                return newToken( Type.OPERATOR, firstChar );
-            -
-            -
                            case 'u':
-            -
                                if( match = css.match( this.url ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.URL, match[2] || match[3] || match[4] || '' );
-            -
                                }
-            -
                        }
-            -
-            -
                        // Numbers and values starting with numbers
-            -
                        if( match = css.match( this.number ) ) {
-            -
                            val = match[0];
-            -
                            this.ch += val.length;
-            -
-            -
                            // Check if it is followed by a unit
-            -
                            if( css.charAt( val.length ) === '%' ) {
-            -
                                this.ch++;
-            -
                                return newToken( Type.PERCENT, val + '%' );
-            -
                            }
-            -
                            if( match = css.substring( val.length ).match( this.ident ) ) {
-            -
                                val += match[0];
-            -
                                this.ch += match[0].length;
-            -
                                return newToken( this.unitTypes[ match[0].toLowerCase() ] || Type.DIMEN, val );
-            -
                            }
-            -
-            -
                            // Plain ol' number
-            -
                            return newToken( Type.NUMBER, val );
-            -
                        }
-            -
-            -
                        // Identifiers
-            -
                        if( match = css.match( this.ident ) ) {
-            -
                            val = match[0];
-            -
                            this.ch += val.length;
-            -
-            -
                            // Named colors
-            -
                            if( val.toLowerCase() in PIE.Color.names || val === 'currentColor' ) {
-            -
                                return newToken( Type.COLOR, val );
-            -
                            }
-            -
-            -
                            // Functions
-            -
                            if( css.charAt( val.length ) === '(' ) {
-            -
                                this.ch++;
-            -
-            -
                                // Color values in function format: rgb, rgba, hsl, hsla
-            -
                                if( val.toLowerCase() in this.colorFunctions ) {
-            -
                                    function isNum( tok ) {
-            -
                                        return tok && tok.tokenType & Type.NUMBER;
-            -
                                    }
-            -
                                    function isNumOrPct( tok ) {
-            -
                                        return tok && ( tok.tokenType & ( Type.NUMBER | Type.PERCENT ) );
-            -
                                    }
-            -
                                    function isValue( tok, val ) {
-            -
                                        return tok && tok.tokenValue === val;
-            -
                                    }
-            -
                                    function next() {
-            -
                                        return me.next( 1 );
-            -
                                    }
-            -
-            -
                                    if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
-            -
                                        isValue( next(), ',' ) &&
-            -
                                        isNumOrPct( next() ) &&
-            -
                                        isValue( next(), ',' ) &&
-            -
                                        isNumOrPct( next() ) &&
-            -
                                        ( val === 'rgb' || val === 'hsa' || (
-            -
                                            isValue( next(), ',' ) &&
-            -
                                            isNum( next() )
-            -
                                        ) ) &&
-            -
                                        isValue( next(), ')' ) ) {
-            -
                                        return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
-            -
                                    }
-            -
                                    return failure();
-            -
                                }
-            -
-            -
                                return newToken( Type.FUNCTION, val );
-            -
                            }
-            -
-            -
                            // Other identifier
-            -
                            return newToken( Type.IDENT, val );
-            -
                        }
-            -
-            -
                        // Standalone character
-            -
                        this.ch++;
-            -
                        return newToken( Type.CHARACTER, firstChar );
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Determine whether there is another token
-            -
                     * @return {boolean}
-            -
                     */
-            -
                    hasNext: function() {
-            -
                        var next = this.next();
-            -
                        this.prev();
-            -
                        return !!next;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Back up and return the previous token
-            -
                     * @return {PIE.Tokenizer.Token}
-            -
                     */
-            -
                    prev: function() {
-            -
                        return this.tokens[ this.tokenIndex-- - 2 ];
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve all the tokens in the CSS string
-            -
                     * @return {Array.<PIE.Tokenizer.Token>}
-            -
                     */
-            -
                    all: function() {
-            -
                        while( this.next() ) {}
-            -
                        return this.tokens;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Return a list of tokens from the current position until the given function returns
-            -
                     * true. The final token will not be included in the list.
-            -
                     * @param {function():boolean} func - test function
-            -
                     * @param {boolean} require - if true, then if the end of the CSS string is reached
-            -
                     *        before the test function returns true, null will be returned instead of the
-            -
                     *        tokens that have been found so far.
-            -
                     * @return {Array.<PIE.Tokenizer.Token>}
-            -
                     */
-            -
                    until: function( func, require ) {
-            -
                        var list = [], t, hit;
-            -
                        while( t = this.next() ) {
-            -
                            if( func( t ) ) {
-            -
                                hit = true;
-            -
                                this.prev();
-            -
                                break;
-            -
                            }
-            -
                            list.push( t );
-            -
                        }
-            -
                        return require && !hit ? null : list;
-            -
                    }
-            -
                };
-            -
-            -
                return Tokenizer;
-            -
            })();/**
-            -
             * Handles calculating, caching, and detecting changes to size and position of the element.
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BoundsInfo = function( el ) {
-            -
                this.targetElement = el;
-            -
            };
-            -
            PIE.BoundsInfo.prototype = {
-            -
-            -
                _locked: 0,
-            -
-            -
                positionChanged: function() {
-            -
                    var last = this._lastBounds,
-            -
                        bounds;
-            -
                    return !last || ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x || last.y !== bounds.y ) );
-            -
                },
-            -
-            -
                sizeChanged: function() {
-            -
                    var last = this._lastBounds,
-            -
                        bounds;
-            -
                    return !last || ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w || last.h !== bounds.h ) );
-            -
                },
-            -
-            -
                getLiveBounds: function() {
-            -
                    var rect = this.targetElement.getBoundingClientRect();
-            -
                    return {
-            -
                        x: rect.left,
-            -
                        y: rect.top,
-            -
                        w: rect.right - rect.left,
-            -
                        h: rect.bottom - rect.top
-            -
                    };
-            -
                },
-            -
-            -
                getBounds: function() {
-            -
                    return this._locked ?
-            -
                            ( this._lockedBounds || ( this._lockedBounds = this.getLiveBounds() ) ) :
-            -
                            this.getLiveBounds();
-            -
                },
-            -
-            -
                hasBeenQueried: function() {
-            -
                    return !!this._lastBounds;
-            -
                },
-            -
-            -
                lock: function() {
-            -
                    ++this._locked;
-            -
                },
-            -
-            -
                unlock: function() {
-            -
                    if( !--this._locked ) {
-            -
                        if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
-            -
                        this._lockedBounds = null;
-            -
                    }
-            -
                }
-            -
-            -
            };
-            -
            (function() {
-            -
-            -
            function cacheWhenLocked( fn ) {
-            -
                var uid = PIE.Util.getUID( fn );
-            -
                return function() {
-            -
                    if( this._locked ) {
-            -
                        var cache = this._lockedValues || ( this._lockedValues = {} );
-            -
                        return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
-            -
                    } else {
-            -
                        return fn.call( this );
-            -
                    }
-            -
                }
-            -
            }
-            -
-            -
-            -
            PIE.StyleInfoBase = {
-            -
-            -
                _locked: 0,
-            -
-            -
                /**
-            -
                 * Create a new StyleInfo class, with the standard constructor, and augmented by
-            -
                 * the StyleInfoBase's members.
-            -
                 * @param proto
-            -
                 */
-            -
                newStyleInfo: function( proto ) {
-            -
                    function StyleInfo( el ) {
-            -
                        this.targetElement = el;
-            -
                    }
-            -
                    PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
-            -
                    StyleInfo._propsCache = {};
-            -
                    return StyleInfo;
-            -
                },
-            -
-            -
                /**
-            -
                 * Get an object representation of the target CSS style, caching it for each unique
-            -
                 * CSS value string.
-            -
                 * @return {Object}
-            -
                 */
-            -
                getProps: function() {
-            -
                    var css = this.getCss(),
-            -
                        cache = this.constructor._propsCache;
-            -
                    return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Get the raw CSS value for the target style
-            -
                 * @return {string}
-            -
                 */
-            -
                getCss: cacheWhenLocked( function() {
-            -
                    var el = this.targetElement,
-            -
                        ctor = this.constructor,
-            -
                        s = el.style,
-            -
                        cs = el.currentStyle,
-            -
                        cssProp = this.cssProperty,
-            -
                        styleProp = this.styleProperty,
-            -
                        prefixedCssProp = ctor._prefixedCssProp || ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
-            -
                        prefixedStyleProp = ctor._prefixedStyleProp || ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
-            -
                    return s[ prefixedStyleProp ] || cs.getAttribute( prefixedCssProp ) || s[ styleProp ] || cs.getAttribute( cssProp );
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Determine whether the target CSS style is active.
-            -
                 * @return {boolean}
-            -
                 */
-            -
                isActive: cacheWhenLocked( function() {
-            -
                    return !!this.getProps();
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Determine whether the target CSS style has changed since the last time it was used.
-            -
                 * @return {boolean}
-            -
                 */
-            -
                changed: cacheWhenLocked( function() {
-            -
                    var currentCss = this.getCss(),
-            -
                        changed = currentCss !== this._lastCss;
-            -
                    this._lastCss = currentCss;
-            -
                    return changed;
-            -
                } ),
-            -
-            -
                cacheWhenLocked: cacheWhenLocked,
-            -
-            -
                lock: function() {
-            -
                    ++this._locked;
-            -
                },
-            -
-            -
                unlock: function() {
-            -
                    if( !--this._locked ) {
-            -
                        delete this._lockedValues;
-            -
                    }
-            -
                }
-            -
            };
-            -
-            -
            })();/**
-            -
             * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: PIE.CSS_PREFIX + 'background',
-            -
                styleProperty: PIE.STYLE_PREFIX + 'Background',
-            -
-            -
                attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
-            -
                repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
-            -
                originIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
-            -
                clipIdents: { 'padding-box':1, 'border-box':1 },
-            -
                positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
-            -
                sizeIdents: { 'contain':1, 'cover':1 },
-            -
-            -
                /**
-            -
                 * For background styles, we support the -pie-background property but fall back to the standard
-            -
                 * backround* properties.  The reason we have to use the prefixed version is that IE natively
-            -
                 * parses the standard properties and if it sees something it doesn't know how to parse, for example
-            -
                 * multiple values or gradient definitions, it will throw that away and not make it available through
-            -
                 * currentStyle.
-            -
                 *
-            -
                 * Format of return object:
-            -
                 * {
-            -
                 *     color: <PIE.Color>,
-            -
                 *     bgImages: [
-            -
                 *         {
-            -
                 *             imgType: 'image',
-            -
                 *             imgUrl: 'image.png',
-            -
                 *             imgRepeat: <'no-repeat' | 'repeat-x' | 'repeat-y' | 'repeat'>,
-            -
                 *             bgPosition: <PIE.BgPosition>,
-            -
                 *             attachment: <'scroll' | 'fixed' | 'local'>,
-            -
                 *             bgOrigin: <'border-box' | 'padding-box' | 'content-box'>,
-            -
                 *             clip: <'border-box' | 'padding-box'>,
-            -
                 *             size: <'contain' | 'cover' | { w: <'auto' | PIE.Length>, h: <'auto' | PIE.Length> }>
-            -
                 *         },
-            -
                 *         {
-            -
                 *             imgType: 'linear-gradient',
-            -
                 *             gradientStart: <PIE.BgPosition>,
-            -
                 *             angle: <PIE.Angle>,
-            -
                 *             stops: [
-            -
                 *                 { color: <PIE.Color>, offset: <PIE.Length> },
-            -
                 *                 { color: <PIE.Color>, offset: <PIE.Length> }, ...
-            -
                 *             ]
-            -
                 *         }
-            -
                 *     ]
-            -
                 * }
-            -
                 * @param {String} css
-            -
                 * @override
-            -
                 */
-            -
                parseCss: function( css ) {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        tokenizer, token, image,
-            -
                        tok_type = PIE.Tokenizer.Type,
-            -
                        type_operator = tok_type.OPERATOR,
-            -
                        type_ident = tok_type.IDENT,
-            -
                        type_color = tok_type.COLOR,
-            -
                        tokType, tokVal,
-            -
                        positionIdents = this.positionIdents,
-            -
                        gradient, stop,
-            -
                        props = null;
-            -
-            -
                    function isBgPosToken( token ) {
-            -
                        return token.isLengthOrPercent() || ( token.tokenType & type_ident && token.tokenValue in positionIdents );
-            -
                    }
-            -
-            -
                    function sizeToken( token ) {
-            -
                        return ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) || ( token.tokenValue === 'auto' && 'auto' );
-            -
                    }
-            -
-            -
                    // If the CSS3-specific -pie-background property is present, parse it
-            -
                    if( this.getCss3() ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        props = { bgImages: [] };
-            -
                        image = {};
-            -
-            -
                        while( token = tokenizer.next() ) {
-            -
                            tokType = token.tokenType;
-            -
                            tokVal = token.tokenValue;
-            -
-            -
                            if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
-            -
                                gradient = { stops: [], imgType: tokVal };
-            -
                                stop = {};
-            -
                                while( token = tokenizer.next() ) {
-            -
                                    tokType = token.tokenType;
-            -
                                    tokVal = token.tokenValue;
-            -
-            -
                                    // If we reached the end of the function and had at least 2 stops, flush the info
-            -
                                    if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
-            -
                                        if( stop.color ) {
-            -
                                            gradient.stops.push( stop );
-            -
                                        }
-            -
                                        if( gradient.stops.length > 1 ) {
-            -
                                            PIE.Util.merge( image, gradient );
-            -
                                        }
-            -
                                        break;
-            -
                                    }
-            -
-            -
                                    // Color stop - must start with color
-            -
                                    if( tokType & type_color ) {
-            -
                                        // if we already have an angle/position, make sure that the previous token was a comma
-            -
                                        if( gradient.angle || gradient.gradientStart ) {
-            -
                                            token = tokenizer.prev();
-            -
                                            if( token.tokenType !== type_operator ) {
-            -
                                                break; //fail
-            -
                                            }
-            -
                                            tokenizer.next();
-            -
                                        }
-            -
-            -
                                        stop = {
-            -
                                            color: PIE.getColor( tokVal )
-            -
                                        };
-            -
                                        // check for offset following color
-            -
                                        token = tokenizer.next();
-            -
                                        if( token.isLengthOrPercent() ) {
-            -
                                            stop.offset = PIE.getLength( token.tokenValue );
-            -
                                        } else {
-            -
                                            tokenizer.prev();
-            -
                                        }
-            -
                                    }
-            -
                                    // Angle - can only appear in first spot
-            -
                                    else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
-            -
                                        gradient.angle = new PIE.Angle( token.tokenValue );
-            -
                                    }
-            -
                                    else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
-            -
                                        tokenizer.prev();
-            -
                                        gradient.gradientStart = new PIE.BgPosition(
-            -
                                            tokenizer.until( function( t ) {
-            -
                                                return !isBgPosToken( t );
-            -
                                            }, false )
-            -
                                        );
-            -
                                    }
-            -
                                    else if( tokType & type_operator && tokVal === ',' ) {
-            -
                                        if( stop.color ) {
-            -
                                            gradient.stops.push( stop );
-            -
                                            stop = {};
-            -
                                        }
-            -
                                    }
-            -
                                    else {
-            -
                                        // Found something we didn't recognize; fail without adding image
-            -
                                        break;
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
                            else if( !image.imgType && tokType & tok_type.URL ) {
-            -
                                image.imgUrl = tokVal;
-            -
                                image.imgType = 'image';
-            -
                            }
-            -
                            else if( isBgPosToken( token ) && !image.size ) {
-            -
                                tokenizer.prev();
-            -
                                image.bgPosition = new PIE.BgPosition(
-            -
                                    tokenizer.until( function( t ) {
-            -
                                        return !isBgPosToken( t );
-            -
                                    }, false )
-            -
                                );
-            -
                            }
-            -
                            else if( tokType & type_ident ) {
-            -
                                if( tokVal in this.repeatIdents ) {
-            -
                                    image.imgRepeat = tokVal;
-            -
                                }
-            -
                                else if( tokVal in this.originIdents ) {
-            -
                                    image.bgOrigin = tokVal;
-            -
                                    if( tokVal in this.clipIdents ) {
-            -
                                        image.clip = tokVal;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokVal in this.attachIdents ) {
-            -
                                    image.attachment = tokVal;
-            -
                                }
-            -
                            }
-            -
                            else if( tokType & type_color && !props.color ) {
-            -
                                props.color = PIE.getColor( tokVal );
-            -
                            }
-            -
                            else if( tokType & type_operator ) {
-            -
                                // background size
-            -
                                if( tokVal === '/' ) {
-            -
                                    token = tokenizer.next();
-            -
                                    tokType = token.tokenType;
-            -
                                    tokVal = token.tokenValue;
-            -
                                    if( tokType & type_ident && tokVal in this.sizeIdents ) {
-            -
                                        image.size = tokVal;
-            -
                                    }
-            -
                                    else if( tokVal = sizeToken( token ) ) {
-            -
                                        image.size = {
-            -
                                            w: tokVal,
-            -
                                            h: sizeToken( tokenizer.next() ) || ( tokenizer.prev() && tokVal )
-            -
                                        };
-            -
                                    }
-            -
                                }
-            -
                                // new layer
-            -
                                else if( tokVal === ',' && image.imgType ) {
-            -
                                    props.bgImages.push( image );
-            -
                                    image = {};
-            -
                                }
-            -
                            }
-            -
                            else {
-            -
                                // Found something unrecognized; chuck everything
-            -
                                return null;
-            -
                            }
-            -
                        }
-            -
-            -
                        // leftovers
-            -
                        if( image.imgType ) {
-            -
                            props.bgImages.push( image );
-            -
                        }
-            -
                    }
-            -
-            -
                    // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
-            -
                    else {
-            -
                        this.withActualBg( function() {
-            -
                            var posX = cs.backgroundPositionX,
-            -
                                posY = cs.backgroundPositionY,
-            -
                                img = cs.backgroundImage,
-            -
                                color = cs.backgroundColor;
-            -
-            -
                            props = {};
-            -
                            if( color !== 'transparent' ) {
-            -
                                props.color = PIE.getColor( color )
-            -
                            }
-            -
                            if( img !== 'none' ) {
-            -
                                props.bgImages = [ {
-            -
                                    imgType: 'image',
-            -
                                    imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
-            -
                                    imgRepeat: cs.backgroundRepeat,
-            -
                                    bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
-            -
                                } ];
-            -
                            }
-            -
                        } );
-            -
                    }
-            -
-            -
                    return ( props && ( props.color || ( props.bgImages && props.bgImages[0] ) ) ) ? props : null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Execute a function with the actual background styles (not overridden with runtimeStyle
-            -
                 * properties set by the renderers) available via currentStyle.
-            -
                 * @param fn
-            -
                 */
-            -
                withActualBg: function( fn ) {
-            -
                    var rs = this.targetElement.runtimeStyle,
-            -
                        rsImage = rs.backgroundImage,
-            -
                        rsColor = rs.backgroundColor,
-            -
                        ret;
-            -
-            -
                    if( rsImage ) rs.backgroundImage = '';
-            -
                    if( rsColor ) rs.backgroundColor = '';
-            -
-            -
                    ret = fn.call( this );
-            -
-            -
                    if( rsImage ) rs.backgroundImage = rsImage;
-            -
                    if( rsColor ) rs.backgroundColor = rsColor;
-            -
-            -
                    return ret;
-            -
                },
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    return this.getCss3() ||
-            -
                           this.withActualBg( function() {
-            -
                               var cs = this.targetElement.currentStyle;
-            -
                               return cs.backgroundColor + ' ' + cs.backgroundImage + ' ' + cs.backgroundRepeat + ' ' +
-            -
                               cs.backgroundPositionX + ' ' + cs.backgroundPositionY;
-            -
                           } );
-            -
                } ),
-            -
-            -
                getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var el = this.targetElement;
-            -
                    return el.style[ this.styleProperty ] || el.currentStyle.getAttribute( this.cssProperty );
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
-            -
                 */
-            -
                isPngFix: function() {
-            -
                    var val = 0, el;
-            -
                    if( PIE.ieVersion < 7 ) {
-            -
                        el = this.targetElement;
-            -
                        val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] || el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
-            -
                    }
-            -
                    return val;
-            -
                },
-            -
-            -
                /**
-            -
                 * The isActive logic is slightly different, because getProps() always returns an object
-            -
                 * even if it is just falling back to the native background properties.  But we only want
-            -
                 * to report is as being "active" if either the -pie-background override property is present
-            -
                 * and parses successfully or '-pie-png-fix' is set to true in IE6.
-            -
                 */
-            -
                isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    return (this.getCss3() || this.isPngFix()) && !!this.getProps();
-            -
                } )
-            -
-            -
            } );/**
-            -
             * Handles parsing, caching, and detecting changes to border CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
-            -
                namedWidths: {
-            -
                    'thin': '1px',
-            -
                    'medium': '3px',
-            -
                    'thick': '5px'
-            -
                },
-            -
-            -
                parseCss: function( css ) {
-            -
                    var w = {},
-            -
                        s = {},
-            -
                        c = {},
-            -
                        active = false,
-            -
                        colorsSame = true,
-            -
                        stylesSame = true,
-            -
                        widthsSame = true;
-            -
-            -
                    this.withActualBorder( function() {
-            -
                        var el = this.targetElement,
-            -
                            cs = el.currentStyle,
-            -
                            i = 0,
-            -
                            style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
-            -
                        for( ; i < 4; i++ ) {
-            -
                            side = this.sides[ i ];
-            -
-            -
                            ltr = side.charAt(0).toLowerCase();
-            -
                            style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
-            -
                            color = cs[ 'border' + side + 'Color' ];
-            -
                            width = cs[ 'border' + side + 'Width' ];
-            -
-            -
                            if( i > 0 ) {
-            -
                                if( style !== lastStyle ) { stylesSame = false; }
-            -
                                if( color !== lastColor ) { colorsSame = false; }
-            -
                                if( width !== lastWidth ) { widthsSame = false; }
-            -
                            }
-            -
                            lastStyle = style;
-            -
                            lastColor = color;
-            -
                            lastWidth = width;
-            -
-            -
                            c[ ltr ] = PIE.getColor( color );
-            -
-            -
                            width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] || width ) );
-            -
                            if( width.pixels( this.targetElement ) > 0 ) {
-            -
                                active = true;
-            -
                            }
-            -
                        }
-            -
                    } );
-            -
-            -
                    return active ? {
-            -
                        widths: w,
-            -
                        styles: s,
-            -
                        colors: c,
-            -
                        widthsSame: widthsSame,
-            -
                        colorsSame: colorsSame,
-            -
                        stylesSame: stylesSame
-            -
                    } : null;
-            -
                },
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        css;
-            -
-            -
                    // Don't redraw or hide borders for cells in border-collapse:collapse tables
-            -
                    if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
-            -
                        this.withActualBorder( function() {
-            -
                            css = cs.borderWidth + '|' + cs.borderStyle + '|' + cs.borderColor;
-            -
                        } );
-            -
                    }
-            -
                    return css;
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Execute a function with the actual border styles (not overridden with runtimeStyle
-            -
                 * properties set by the renderers) available via currentStyle.
-            -
                 * @param fn
-            -
                 */
-            -
                withActualBorder: function( fn ) {
-            -
                    var rs = this.targetElement.runtimeStyle,
-            -
                        rsWidth = rs.borderWidth,
-            -
                        rsColor = rs.borderColor,
-            -
                        ret;
-            -
-            -
                    if( rsWidth ) rs.borderWidth = '';
-            -
                    if( rsColor ) rs.borderColor = '';
-            -
-            -
                    ret = fn.call( this );
-            -
-            -
                    if( rsWidth ) rs.borderWidth = rsWidth;
-            -
                    if( rsColor ) rs.borderColor = rsColor;
-            -
-            -
                    return ret;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Handles parsing, caching, and detecting changes to border-radius CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            (function() {
-            -
-            -
            PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'border-radius',
-            -
                styleProperty: 'borderRadius',
-            -
-            -
                parseCss: function( css ) {
-            -
                    var p = null, x, y,
-            -
                        tokenizer, token, length,
-            -
                        hasNonZero = false;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
-            -
                        function collectLengths() {
-            -
                            var arr = [], num;
-            -
                            while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
-            -
                                length = PIE.getLength( token.tokenValue );
-            -
                                num = length.getNumber();
-            -
                                if( num < 0 ) {
-            -
                                    return null;
-            -
                                }
-            -
                                if( num > 0 ) {
-            -
                                    hasNonZero = true;
-            -
                                }
-            -
                                arr.push( length );
-            -
                            }
-            -
                            return arr.length > 0 && arr.length < 5 ? {
-            -
                                    'tl': arr[0],
-            -
                                    'tr': arr[1] || arr[0],
-            -
                                    'br': arr[2] || arr[0],
-            -
                                    'bl': arr[3] || arr[1] || arr[0]
-            -
                                } : null;
-            -
                        }
-            -
-            -
                        // Grab the initial sequence of lengths
-            -
                        if( x = collectLengths() ) {
-            -
                            // See if there is a slash followed by more lengths, for the y-axis radii
-            -
                            if( token ) {
-            -
                                if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
-            -
                                    y = collectLengths();
-            -
                                }
-            -
                            } else {
-            -
                                y = x;
-            -
                            }
-            -
-            -
                            // Treat all-zero values the same as no value
-            -
                            if( hasNonZero && x && y ) {
-            -
                                p = { x: x, y : y };
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    return p;
-            -
                }
-            -
            } );
-            -
-            -
            var zero = PIE.getLength( '0' ),
-            -
                zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
-            -
            PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
-            -
-            -
            })();/**
-            -
             * Handles parsing, caching, and detecting changes to border-image CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'border-image',
-            -
                styleProperty: 'borderImage',
-            -
-            -
                repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
-            -
-            -
                parseCss: function( css ) {
-            -
                    var p = null, tokenizer, token, type, value,
-            -
                        slices, widths, outsets,
-            -
                        slashCount = 0, cs,
-            -
                        Type = PIE.Tokenizer.Type,
-            -
                        IDENT = Type.IDENT,
-            -
                        NUMBER = Type.NUMBER,
-            -
                        LENGTH = Type.LENGTH,
-            -
                        PERCENT = Type.PERCENT;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        p = {};
-            -
-            -
                        function isSlash( token ) {
-            -
                            return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
-            -
                        }
-            -
-            -
                        function isFillIdent( token ) {
-            -
                            return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
-            -
                        }
-            -
-            -
                        function collectSlicesEtc() {
-            -
                            slices = tokenizer.until( function( tok ) {
-            -
                                return !( tok.tokenType & ( NUMBER | PERCENT ) );
-            -
                            } );
-            -
-            -
                            if( isFillIdent( tokenizer.next() ) && !p.fill ) {
-            -
                                p.fill = true;
-            -
                            } else {
-            -
                                tokenizer.prev();
-            -
                            }
-            -
-            -
                            if( isSlash( tokenizer.next() ) ) {
-            -
                                slashCount++;
-            -
                                widths = tokenizer.until( function( tok ) {
-            -
                                    return !( token.tokenType & ( NUMBER | PERCENT | LENGTH ) ) && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
-            -
                                } );
-            -
-            -
                                if( isSlash( tokenizer.next() ) ) {
-            -
                                    slashCount++;
-            -
                                    outsets = tokenizer.until( function( tok ) {
-            -
                                        return !( token.tokenType & ( NUMBER | LENGTH ) );
-            -
                                    } );
-            -
                                }
-            -
                            } else {
-            -
                                tokenizer.prev();
-            -
                            }
-            -
                        }
-            -
-            -
                        while( token = tokenizer.next() ) {
-            -
                            type = token.tokenType;
-            -
                            value = token.tokenValue;
-            -
-            -
                            // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
-            -
                            if( type & ( NUMBER | PERCENT ) && !slices ) {
-            -
                                tokenizer.prev();
-            -
                                collectSlicesEtc();
-            -
                            }
-            -
                            else if( isFillIdent( token ) && !p.fill ) {
-            -
                                p.fill = true;
-            -
                                collectSlicesEtc();
-            -
                            }
-            -
-            -
                            // Idents: one or values for 'repeat'
-            -
                            else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
-            -
                                p.repeat = { h: value };
-            -
                                if( token = tokenizer.next() ) {
-            -
                                    if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
-            -
                                        p.repeat.v = token.tokenValue;
-            -
                                    } else {
-            -
                                        tokenizer.prev();
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
-            -
                            // URL of the image
-            -
                            else if( ( type & Type.URL ) && !p.src ) {
-            -
                                p.src =  value;
-            -
                            }
-            -
-            -
                            // Found something unrecognized; exit.
-            -
                            else {
-            -
                                return null;
-            -
                            }
-            -
                        }
-            -
-            -
                        // Validate what we collected
-            -
                        if( !p.src || !slices || slices.length < 1 || slices.length > 4 ||
-            -
                            ( widths && widths.length > 4 ) || ( slashCount === 1 && widths.length < 1 ) ||
-            -
                            ( outsets && outsets.length > 4 ) || ( slashCount === 2 && outsets.length < 1 ) ) {
-            -
                            return null;
-            -
                        }
-            -
-            -
                        // Fill in missing values
-            -
                        if( !p.repeat ) {
-            -
                            p.repeat = { h: 'stretch' };
-            -
                        }
-            -
                        if( !p.repeat.v ) {
-            -
                            p.repeat.v = p.repeat.h;
-            -
                        }
-            -
-            -
                        function distributeSides( tokens, convertFn ) {
-            -
                            return {
-            -
                                t: convertFn( tokens[0] ),
-            -
                                r: convertFn( tokens[1] || tokens[0] ),
-            -
                                b: convertFn( tokens[2] || tokens[0] ),
-            -
                                l: convertFn( tokens[3] || tokens[1] || tokens[0] )
-            -
                            };
-            -
                        }
-            -
-            -
                        p.slice = distributeSides( slices, function( tok ) {
-            -
                            return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
-            -
                        } );
-            -
-            -
                        p.width = widths && widths.length > 0 ?
-            -
                                distributeSides( widths, function( tok ) {
-            -
                                    return tok.tokenType & ( LENGTH | PERCENT ) ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
-            -
                                } ) :
-            -
                                ( cs = this.targetElement.currentStyle ) && {
-            -
                                    t: PIE.getLength( cs.borderTopWidth ),
-            -
                                    r: PIE.getLength( cs.borderRightWidth ),
-            -
                                    b: PIE.getLength( cs.borderBottomWidth ),
-            -
                                    l: PIE.getLength( cs.borderLeftWidth )
-            -
                                };
-            -
-            -
                        p.outset = distributeSides( outsets || [ 0 ], function( tok ) {
-            -
                            return tok.tokenType & LENGTH ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
-            -
                        } );
-            -
                    }
-            -
-            -
                    return p;
-            -
                }
-            -
            } );/**
-            -
             * Handles parsing, caching, and detecting changes to box-shadow CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'box-shadow',
-            -
                styleProperty: 'boxShadow',
-            -
-            -
                parseCss: function( css ) {
-            -
                    var props,
-            -
                        getLength = PIE.getLength,
-            -
                        Type = PIE.Tokenizer.Type,
-            -
                        tokenizer;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        props = { outset: [], inset: [] };
-            -
-            -
                        function parseItem() {
-            -
                            var token, type, value, color, lengths, inset, len;
-            -
-            -
                            while( token = tokenizer.next() ) {
-            -
                                value = token.tokenValue;
-            -
                                type = token.tokenType;
-            -
-            -
                                if( type & Type.OPERATOR && value === ',' ) {
-            -
                                    break;
-            -
                                }
-            -
                                else if( token.isLength() && !lengths ) {
-            -
                                    tokenizer.prev();
-            -
                                    lengths = tokenizer.until( function( token ) {
-            -
                                        return !token.isLength();
-            -
                                    } );
-            -
                                }
-            -
                                else if( type & Type.COLOR && !color ) {
-            -
                                    color = value;
-            -
                                }
-            -
                                else if( type & Type.IDENT && value === 'inset' && !inset ) {
-            -
                                    inset = true;
-            -
                                }
-            -
                                else { //encountered an unrecognized token; fail.
-            -
                                    return false;
-            -
                                }
-            -
                            }
-            -
-            -
                            len = lengths && lengths.length;
-            -
                            if( len > 1 && len < 5 ) {
-            -
                                ( inset ? props.inset : props.outset ).push( {
-            -
                                    xOffset: getLength( lengths[0].tokenValue ),
-            -
                                    yOffset: getLength( lengths[1].tokenValue ),
-            -
                                    blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
-            -
                                    spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
-            -
                                    color: PIE.getColor( color || 'currentColor' )
-            -
                                } );
-            -
                                return true;
-            -
                            }
-            -
                            return false;
-            -
                        }
-            -
-            -
                        while( parseItem() ) {}
-            -
                    }
-            -
-            -
                    return props && ( props.inset.length || props.outset.length ) ? props : null;
-            -
                }
-            -
            } );
-            -
            /**
-            -
             * Retrieves the state of the element's visibility and display
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var cs = this.targetElement.currentStyle;
-            -
                    return cs.visibility + '|' + cs.display;
-            -
                } ),
-            -
-            -
                parseCss: function() {
-            -
                    var el = this.targetElement,
-            -
                        rs = el.runtimeStyle,
-            -
                        cs = el.currentStyle,
-            -
                        rsVis = rs.visibility,
-            -
                        csVis;
-            -
-            -
                    rs.visibility = '';
-            -
                    csVis = cs.visibility;
-            -
                    rs.visibility = rsVis;
-            -
-            -
                    return {
-            -
                        visible: csVis !== 'hidden',
-            -
                        displayed: cs.display !== 'none'
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Always return false for isActive, since this property alone will not trigger
-            -
                 * a renderer to do anything.
-            -
                 */
-            -
                isActive: function() {
-            -
                    return false;
-            -
                }
-            -
-            -
            } );
-            -
            PIE.RendererBase = {
-            -
-            -
                /**
-            -
                 * Create a new Renderer class, with the standard constructor, and augmented by
-            -
                 * the RendererBase's members.
-            -
                 * @param proto
-            -
                 */
-            -
                newRenderer: function( proto ) {
-            -
                    function Renderer( el, boundsInfo, styleInfos, parent ) {
-            -
                        this.targetElement = el;
-            -
                        this.boundsInfo = boundsInfo;
-            -
                        this.styleInfos = styleInfos;
-            -
                        this.parent = parent;
-            -
                    }
-            -
                    PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
-            -
                    return Renderer;
-            -
                },
-            -
-            -
                /**
-            -
                 * Flag indicating the element has already been positioned at least once.
-            -
                 * @type {boolean}
-            -
                 */
-            -
                isPositioned: false,
-            -
-            -
                /**
-            -
                 * Determine if the renderer needs to be updated
-            -
                 * @return {boolean}
-            -
                 */
-            -
                needsUpdate: function() {
-            -
                    return false;
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified properties
-            -
                 */
-            -
                updateProps: function() {
-            -
                    this.destroy();
-            -
                    if( this.isActive() ) {
-            -
                        this.draw();
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified element position
-            -
                 */
-            -
                updatePos: function() {
-            -
                    this.isPositioned = true;
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified element dimensions
-            -
                 */
-            -
                updateSize: function() {
-            -
                    if( this.isActive() ) {
-            -
                        this.draw();
-            -
                    } else {
-            -
                        this.destroy();
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
-            -
                 * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
-            -
                 * So instead we make sure they are inserted into the DOM in the correct order.
-            -
                 * @param {number} index
-            -
                 * @param {Element} el
-            -
                 */
-            -
                addLayer: function( index, el ) {
-            -
                    this.removeLayer( index );
-            -
                    for( var layers = this._layers || ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
-            -
                        layer = layers[i];
-            -
                        if( layer ) {
-            -
                            break;
-            -
                        }
-            -
                    }
-            -
                    layers[index] = el;
-            -
                    this.getBox().insertBefore( el, layer || null );
-            -
                },
-            -
-            -
                /**
-            -
                 * Retrieve a layer element by its index, or null if not present
-            -
                 * @param {number} index
-            -
                 * @return {Element}
-            -
                 */
-            -
                getLayer: function( index ) {
-            -
                    var layers = this._layers;
-            -
                    return layers && layers[index] || null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Remove a layer element by its index
-            -
                 * @param {number} index
-            -
                 */
-            -
                removeLayer: function( index ) {
-            -
                    var layer = this.getLayer( index ),
-            -
                        box = this._box;
-            -
                    if( layer && box ) {
-            -
                        box.removeChild( layer );
-            -
                        this._layers[index] = null;
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get a VML shape by name, creating it if necessary.
-            -
                 * @param {string} name A name identifying the element
-            -
                 * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
-            -
                 * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
-            -
                 * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
-            -
                 *                  using container elements in the correct order, to get correct z stacking without z-index.
-            -
                 */
-            -
                getShape: function( name, subElName, parent, group ) {
-            -
                    var shapes = this._shapes || ( this._shapes = {} ),
-            -
                        shape = shapes[ name ],
-            -
                        s;
-            -
-            -
                    if( !shape ) {
-            -
                        shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
-            -
                        if( subElName ) {
-            -
                            shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
-            -
                        }
-            -
-            -
                        if( group ) {
-            -
                            parent = this.getLayer( group );
-            -
                            if( !parent ) {
-            -
                                this.addLayer( group, doc.createElement( 'group' + group ) );
-            -
                                parent = this.getLayer( group );
-            -
                            }
-            -
                        }
-            -
-            -
                        parent.appendChild( shape );
-            -
-            -
                        s = shape.style;
-            -
                        s.position = 'absolute';
-            -
                        s.left = s.top = 0;
-            -
                        s['behavior'] = 'url(#default#VML)';
-            -
                    }
-            -
                    return shape;
-            -
                },
-            -
-            -
                /**
-            -
                 * Delete a named shape which was created by getShape(). Returns true if a shape with the
-            -
                 * given name was found and deleted, or false if there was no shape of that name.
-            -
                 * @param {string} name
-            -
                 * @return {boolean}
-            -
                 */
-            -
                deleteShape: function( name ) {
-            -
                    var shapes = this._shapes,
-            -
                        shape = shapes && shapes[ name ];
-            -
                    if( shape ) {
-            -
                        shape.parentNode.removeChild( shape );
-            -
                        delete shapes[ name ];
-            -
                    }
-            -
                    return !!shape;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * For a given set of border radius length/percentage values, convert them to concrete pixel
-            -
                 * values based on the current size of the target element.
-            -
                 * @param {Object} radii
-            -
                 * @return {Object}
-            -
                 */
-            -
                getRadiiPixels: function( radii ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        tlX, tlY, trX, trY, brX, brY, blX, blY, f;
-            -
-            -
                    tlX = radii.x['tl'].pixels( el, w );
-            -
                    tlY = radii.y['tl'].pixels( el, h );
-            -
                    trX = radii.x['tr'].pixels( el, w );
-            -
                    trY = radii.y['tr'].pixels( el, h );
-            -
                    brX = radii.x['br'].pixels( el, w );
-            -
                    brY = radii.y['br'].pixels( el, h );
-            -
                    blX = radii.x['bl'].pixels( el, w );
-            -
                    blY = radii.y['bl'].pixels( el, h );
-            -
-            -
                    // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
-            -
                    // is taken straight from the CSS3 Backgrounds and Borders spec.
-            -
                    f = Math.min(
-            -
                        w / ( tlX + trX ),
-            -
                        h / ( trY + brY ),
-            -
                        w / ( blX + brX ),
-            -
                        h / ( tlY + blY )
-            -
                    );
-            -
                    if( f < 1 ) {
-            -
                        tlX *= f;
-            -
                        tlY *= f;
-            -
                        trX *= f;
-            -
                        trY *= f;
-            -
                        brX *= f;
-            -
                        brY *= f;
-            -
                        blX *= f;
-            -
                        blY *= f;
-            -
                    }
-            -
-            -
                    return {
-            -
                        x: {
-            -
                            'tl': tlX,
-            -
                            'tr': trX,
-            -
                            'br': brX,
-            -
                            'bl': blX
-            -
                        },
-            -
                        y: {
-            -
                            'tl': tlY,
-            -
                            'tr': trY,
-            -
                            'br': brY,
-            -
                            'bl': blY
-            -
                        }
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Return the VML path string for the element's background box, with corners rounded.
-            -
                 * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
-            -
                 *        pixels to shrink the box path inward from the element's four sides.
-            -
                 * @param {number=} mult If specified, all coordinates will be multiplied by this number
-            -
                 * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
-            -
                 *        from this renderer's borderRadiusInfo object.
-            -
                 * @return {string} the VML path
-            -
                 */
-            -
                getBoxPath: function( shrink, mult, radii ) {
-            -
                    mult = mult || 1;
-            -
-            -
                    var r, str,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w * mult,
-            -
                        h = bounds.h * mult,
-            -
                        radInfo = this.styleInfos.borderRadiusInfo,
-            -
                        floor = Math.floor, ceil = Math.ceil,
-            -
                        shrinkT = shrink ? shrink.t * mult : 0,
-            -
                        shrinkR = shrink ? shrink.r * mult : 0,
-            -
                        shrinkB = shrink ? shrink.b * mult : 0,
-            -
                        shrinkL = shrink ? shrink.l * mult : 0,
-            -
                        tlX, tlY, trX, trY, brX, brY, blX, blY;
-            -
-            -
                    if( radii || radInfo.isActive() ) {
-            -
                        r = this.getRadiiPixels( radii || radInfo.getProps() );
-            -
-            -
                        tlX = r.x['tl'] * mult;
-            -
                        tlY = r.y['tl'] * mult;
-            -
                        trX = r.x['tr'] * mult;
-            -
                        trY = r.y['tr'] * mult;
-            -
                        brX = r.x['br'] * mult;
-            -
                        brY = r.y['br'] * mult;
-            -
                        blX = r.x['bl'] * mult;
-            -
                        blY = r.y['bl'] * mult;
-            -
-            -
                        str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
-            -
                            'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
-            -
                            'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
-            -
                            'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
-            -
                            'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
-            -
                            'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
-            -
                            'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
-            -
                            'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
-            -
                    } else {
-            -
                        // simplified path for non-rounded box
-            -
                        str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
-            -
                              'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
-            -
                              'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
-            -
                              'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
-            -
                              'xe';
-            -
                    }
-            -
                    return str;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get the container element for the shapes, creating it if necessary.
-            -
                 */
-            -
                getBox: function() {
-            -
                    var box = this.parent.getLayer( this.boxZIndex ), s;
-            -
-            -
                    if( !box ) {
-            -
                        box = doc.createElement( this.boxName );
-            -
                        s = box.style;
-            -
                        s.position = 'absolute';
-            -
                        s.top = s.left = 0;
-            -
                        this.parent.addLayer( this.boxZIndex, box );
-            -
                    }
-            -
-            -
                    return box;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Destroy the rendered objects. This is a base implementation which handles common renderer
-            -
                 * structures, but individual renderers may override as necessary.
-            -
                 */
-            -
                destroy: function() {
-            -
                    this.parent.removeLayer( this.boxZIndex );
-            -
                    delete this._shapes;
-            -
                    delete this._layers;
-            -
                }
-            -
            };
-            -
            /**
-            -
             * Root renderer; creates the outermost container element and handles keeping it aligned
-            -
             * with the target element's size and position.
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             */
-            -
            PIE.RootRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                isActive: function() {
-            -
                    var children = this.childRenderers;
-            -
                    for( var i in children ) {
-            -
                        if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
-            -
                            return true;
-            -
                        }
-            -
                    }
-            -
                    return false;
-            -
                },
-            -
-            -
                needsUpdate: function() {
-            -
                    return this.styleInfos.visibilityInfo.changed();
-            -
                },
-            -
-            -
                updatePos: function() {
-            -
                    if( this.isActive() ) {
-            -
                        var el = this.getPositioningElement(),
-            -
                            par = el,
-            -
                            docEl,
-            -
                            parRect,
-            -
                            tgtCS = el.currentStyle,
-            -
                            tgtPos = tgtCS.position,
-            -
                            boxPos,
-            -
                            s = this.getBox().style, cs,
-            -
                            x = 0, y = 0,
-            -
                            elBounds = this.boundsInfo.getBounds();
-            -
-            -
                        if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
-            -
                            x = elBounds.x;
-            -
                            y = elBounds.y;
-            -
                            boxPos = tgtPos;
-            -
                        } else {
-            -
                            // Get the element's offsets from its nearest positioned ancestor. Uses
-            -
                            // getBoundingClientRect for accuracy and speed.
-            -
                            do {
-            -
                                par = par.offsetParent;
-            -
                            } while( par && ( par.currentStyle.position === 'static' ) );
-            -
                            if( par ) {
-            -
                                parRect = par.getBoundingClientRect();
-            -
                                cs = par.currentStyle;
-            -
                                x = elBounds.x - parRect.left - ( parseFloat(cs.borderLeftWidth) || 0 );
-            -
                                y = elBounds.y - parRect.top - ( parseFloat(cs.borderTopWidth) || 0 );
-            -
                            } else {
-            -
                                docEl = doc.documentElement;
-            -
                                x = elBounds.x + docEl.scrollLeft - docEl.clientLeft;
-            -
                                y = elBounds.y + docEl.scrollTop - docEl.clientTop;
-            -
                            }
-            -
                            boxPos = 'absolute';
-            -
                        }
-            -
-            -
                        s.position = boxPos;
-            -
                        s.left = x;
-            -
                        s.top = y;
-            -
                        s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
-            -
                        this.isPositioned = true;
-            -
                    }
-            -
                },
-            -
-            -
                updateSize: function() {
-            -
                    // NO-OP
-            -
                },
-            -
-            -
                updateVisibility: function() {
-            -
                    var vis = this.styleInfos.visibilityInfo.getProps();
-            -
                    this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
-            -
                },
-            -
-            -
                updateProps: function() {
-            -
                    if( this.isActive() ) {
-            -
                        this.updateVisibility();
-            -
                    } else {
-            -
                        this.destroy();
-            -
                    }
-            -
                },
-            -
-            -
                getPositioningElement: function() {
-            -
                    var el = this.targetElement;
-            -
                    return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
-            -
                },
-            -
-            -
                getBox: function() {
-            -
                    var box = this._box, el;
-            -
                    if( !box ) {
-            -
                        el = this.getPositioningElement();
-            -
                        box = this._box = doc.createElement( 'css3-container' );
-            -
                        box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
-            -
-            -
                        this.updateVisibility();
-            -
-            -
                        el.parentNode.insertBefore( box, el );
-            -
                    }
-            -
                    return box;
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    var box = this._box, par;
-            -
                    if( box && ( par = box.parentNode ) ) {
-            -
                        par.removeChild( box );
-            -
                    }
-            -
                    delete this._box;
-            -
                    delete this._layers;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for element backgrounds.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 2,
-            -
                boxName: 'background',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.backgroundInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderImageInfo.isActive() ||
-            -
                           si.borderRadiusInfo.isActive() ||
-            -
                           si.backgroundInfo.isActive() ||
-            -
                           ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the shapes
-            -
                 */
-            -
                draw: function() {
-            -
                    var bounds = this.boundsInfo.getBounds();
-            -
                    if( bounds.w && bounds.h ) {
-            -
                        this.drawBgColor();
-            -
                        this.drawBgImages();
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the background color shape
-            -
                 */
-            -
                drawBgColor: function() {
-            -
                    var props = this.styleInfos.backgroundInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        el = this.targetElement,
-            -
                        color = props && props.color,
-            -
                        shape, w, h, s, alpha;
-            -
-            -
                    if( color && color.alpha() > 0 ) {
-            -
                        this.hideBackground();
-            -
-            -
                        shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
-            -
                        w = bounds.w;
-            -
                        h = bounds.h;
-            -
                        shape.stroked = false;
-            -
                        shape.coordsize = w * 2 + ',' + h * 2;
-            -
                        shape.coordorigin = '1,1';
-            -
                        shape.path = this.getBoxPath( null, 2 );
-            -
                        s = shape.style;
-            -
                        s.width = w;
-            -
                        s.height = h;
-            -
                        shape.fill.color = color.colorValue( el );
-            -
-            -
                        alpha = color.alpha();
-            -
                        if( alpha < 1 ) {
-            -
                            shape.fill.opacity = alpha;
-            -
                        }
-            -
                    } else {
-            -
                        this.deleteShape( 'bgColor' );
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw all the background image layers
-            -
                 */
-            -
                drawBgImages: function() {
-            -
                    var props = this.styleInfos.backgroundInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        images = props && props.bgImages,
-            -
                        img, shape, w, h, s, i;
-            -
-            -
                    if( images ) {
-            -
                        this.hideBackground();
-            -
-            -
                        w = bounds.w;
-            -
                        h = bounds.h;
-            -
-            -
                        i = images.length;
-            -
                        while( i-- ) {
-            -
                            img = images[i];
-            -
                            shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
-            -
-            -
                            shape.stroked = false;
-            -
                            shape.fill.type = 'tile';
-            -
                            shape.fillcolor = 'none';
-            -
                            shape.coordsize = w * 2 + ',' + h * 2;
-            -
                            shape.coordorigin = '1,1';
-            -
                            shape.path = this.getBoxPath( 0, 2 );
-            -
                            s = shape.style;
-            -
                            s.width = w;
-            -
                            s.height = h;
-            -
-            -
                            if( img.imgType === 'linear-gradient' ) {
-            -
                                this.addLinearGradient( shape, img );
-            -
                            }
-            -
                            else {
-            -
                                shape.fill.src = img.imgUrl;
-            -
                                this.positionBgImage( shape, i );
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    // Delete any bgImage shapes previously created which weren't used above
-            -
                    i = images ? images.length : 0;
-            -
                    while( this.deleteShape( 'bgImage' + i++ ) ) {}
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Set the position and clipping of the background image for a layer
-            -
                 * @param {Element} shape
-            -
                 * @param {number} index
-            -
                 */
-            -
                positionBgImage: function( shape, index ) {
-            -
                    PIE.Util.withImageSize( shape.fill.src, function( size ) {
-            -
                        var fill = shape.fill,
-            -
                            el = this.targetElement,
-            -
                            bounds = this.boundsInfo.getBounds(),
-            -
                            elW = bounds.w,
-            -
                            elH = bounds.h,
-            -
                            si = this.styleInfos,
-            -
                            border = si.borderInfo.getProps(),
-            -
                            bw = border && border.widths,
-            -
                            bwT = bw ? bw['t'].pixels( el ) : 0,
-            -
                            bwR = bw ? bw['r'].pixels( el ) : 0,
-            -
                            bwB = bw ? bw['b'].pixels( el ) : 0,
-            -
                            bwL = bw ? bw['l'].pixels( el ) : 0,
-            -
                            bg = si.backgroundInfo.getProps().bgImages[ index ],
-            -
                            bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
-            -
                            repeat = bg.imgRepeat,
-            -
                            pxX, pxY,
-            -
                            clipT = 0, clipL = 0,
-            -
                            clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
-            -
                            clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
-            -
-            -
                        // Positioning - find the pixel offset from the top/left and convert to a ratio
-            -
                        // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
-            -
                        // needed to fix antialiasing but makes the bg image fuzzy.
-            -
                        pxX = Math.round( bgPos.x ) + bwL + 0.5;
-            -
                        pxY = Math.round( bgPos.y ) + bwT + 0.5;
-            -
                        fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
-            -
-            -
                        // Repeating - clip the image shape
-            -
                        if( repeat && repeat !== 'repeat' ) {
-            -
                            if( repeat === 'repeat-x' || repeat === 'no-repeat' ) {
-            -
                                clipT = pxY + 1;
-            -
                                clipB = pxY + size.h + clipAdjust;
-            -
                            }
-            -
                            if( repeat === 'repeat-y' || repeat === 'no-repeat' ) {
-            -
                                clipL = pxX + 1;
-            -
                                clipR = pxX + size.w + clipAdjust;
-            -
                            }
-            -
                            shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
-            -
                        }
-            -
                    }, this );
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Draw the linear gradient for a gradient layer
-            -
                 * @param {Element} shape
-            -
                 * @param {Object} info The object holding the information about the gradient
-            -
                 */
-            -
                addLinearGradient: function( shape, info ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        fill = shape.fill,
-            -
                        angle = info.angle,
-            -
                        startPos = info.gradientStart,
-            -
                        stops = info.stops,
-            -
                        stopCount = stops.length,
-            -
                        PI = Math.PI,
-            -
                        UNDEF,
-            -
                        startX, startY,
-            -
                        endX, endY,
-            -
                        startCornerX, startCornerY,
-            -
                        endCornerX, endCornerY,
-            -
                        vmlAngle, vmlGradientLength, vmlColors,
-            -
                        deltaX, deltaY, lineLength,
-            -
                        stopPx, vmlOffsetPct,
-            -
                        p, i, j, before, after;
-            -
-            -
                    /**
-            -
                     * Find the point along a given line (defined by a starting point and an angle), at which
-            -
                     * that line is intersected by a perpendicular line extending through another point.
-            -
                     * @param x1 - x coord of the starting point
-            -
                     * @param y1 - y coord of the starting point
-            -
                     * @param angle - angle of the line extending from the starting point (in degrees)
-            -
                     * @param x2 - x coord of point along the perpendicular line
-            -
                     * @param y2 - y coord of point along the perpendicular line
-            -
                     * @return [ x, y ]
-            -
                     */
-            -
                    function perpendicularIntersect( x1, y1, angle, x2, y2 ) {
-            -
                        // Handle straight vertical and horizontal angles, for performance and to avoid
-            -
                        // divide-by-zero errors.
-            -
                        if( angle === 0 || angle === 180 ) {
-            -
                            return [ x2, y1 ];
-            -
                        }
-            -
                        else if( angle === 90 || angle === 270 ) {
-            -
                            return [ x1, y2 ];
-            -
                        }
-            -
                        else {
-            -
                            // General approach: determine the Ax+By=C formula for each line (the slope of the second
-            -
                            // line is the negative inverse of the first) and then solve for where both formulas have
-            -
                            // the same x/y values.
-            -
                            var a1 = Math.tan( -angle * PI / 180 ),
-            -
                                c1 = a1 * x1 - y1,
-            -
                                a2 = -1 / a1,
-            -
                                c2 = a2 * x2 - y2,
-            -
                                d = a2 - a1,
-            -
                                endX = ( c2 - c1 ) / d,
-            -
                                endY = ( a1 * c2 - a2 * c1 ) / d;
-            -
                            return [ endX, endY ];
-            -
                        }
-            -
                    }
-            -
-            -
                    // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
-            -
                    // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
-            -
                    // the total length of the VML rendered gradient-line corner to corner.
-            -
                    function findCorners() {
-            -
                        startCornerX = ( angle >= 90 && angle < 270 ) ? w : 0;
-            -
                        startCornerY = angle < 180 ? h : 0;
-            -
                        endCornerX = w - startCornerX;
-            -
                        endCornerY = h - startCornerY;
-            -
                    }
-            -
-            -
                    // Normalize the angle to a value between [0, 360)
-            -
                    function normalizeAngle() {
-            -
                        while( angle < 0 ) {
-            -
                            angle += 360;
-            -
                        }
-            -
                        angle = angle % 360;
-            -
                    }
-            -
-            -
                    // Find the distance between two points
-            -
                    function distance( p1, p2 ) {
-            -
                        var dx = p2[0] - p1[0],
-            -
                            dy = p2[1] - p1[1];
-            -
                        return Math.abs(
-            -
                            dx === 0 ? dy :
-            -
                            dy === 0 ? dx :
-            -
                            Math.sqrt( dx * dx + dy * dy )
-            -
                        );
-            -
                    }
-            -
-            -
                    // Find the start and end points of the gradient
-            -
                    if( startPos ) {
-            -
                        startPos = startPos.coords( el, w, h );
-            -
                        startX = startPos.x;
-            -
                        startY = startPos.y;
-            -
                    }
-            -
                    if( angle ) {
-            -
                        angle = angle.degrees();
-            -
-            -
                        normalizeAngle();
-            -
                        findCorners();
-            -
-            -
                        // If no start position was specified, then choose a corner as the starting point.
-            -
                        if( !startPos ) {
-            -
                            startX = startCornerX;
-            -
                            startY = startCornerY;
-            -
                        }
-            -
-            -
                        // Find the end position by extending a perpendicular line from the gradient-line which
-            -
                        // intersects the corner opposite from the starting corner.
-            -
                        p = perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
-            -
                        endX = p[0];
-            -
                        endY = p[1];
-            -
                    }
-            -
                    else if( startPos ) {
-            -
                        // Start position but no angle specified: find the end point by rotating 180deg around the center
-            -
                        endX = w - startX;
-            -
                        endY = h - startY;
-            -
                    }
-            -
                    else {
-            -
                        // Neither position nor angle specified; create vertical gradient from top to bottom
-            -
                        startX = startY = endX = 0;
-            -
                        endY = h;
-            -
                    }
-            -
                    deltaX = endX - startX;
-            -
                    deltaY = endY - startY;
-            -
-            -
                    if( angle === UNDEF ) {
-            -
                        // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
-            -
                        // or vertical angles so they get exact whole numbers rather than what atan2 gives.
-            -
                        angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
-            -
                                    ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
-            -
                                        -Math.atan2( deltaY, deltaX ) / PI * 180
-            -
                                    )
-            -
                                );
-            -
                        normalizeAngle();
-            -
                        findCorners();
-            -
                    }
-            -
-            -
-            -
                    // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
-            -
                    // bounding box; for example specifying a 45 deg angle actually results in a gradient
-            -
                    // drawn diagonally from one corner to its opposite corner, which will only appear to the
-            -
                    // viewer as 45 degrees if the shape is equilateral.  We adjust for this by taking the x/y deltas
-            -
                    // between the start and end points, multiply one of them by the shape's aspect ratio,
-            -
                    // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
-            -
                    // horizontal or vertical then we don't need to do this conversion.
-            -
                    vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
-            -
-            -
                    // VML angles are 180 degrees offset from CSS angles
-            -
                    vmlAngle += 180;
-            -
                    vmlAngle = vmlAngle % 360;
-            -
-            -
                    // Add all the stops to the VML 'colors' list, including the first and last stops.
-            -
                    // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
-            -
                    // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
-            -
                    // percentage along the VML gradient-line, which runs from shape corner to corner.
-            -
                    lineLength = distance( [ startX, startY ], [ endX, endY ] );
-            -
                    vmlGradientLength = distance( [ startCornerX, startCornerY ], perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY ) );
-            -
                    vmlColors = [];
-            -
                    vmlOffsetPct = distance( [ startX, startY ], perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY ) ) / vmlGradientLength * 100;
-            -
-            -
                    // Find the pixel offsets along the CSS3 gradient-line for each stop.
-            -
                    stopPx = [];
-            -
                    for( i = 0; i < stopCount; i++ ) {
-            -
                        stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
-            -
                                     i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
-            -
                    }
-            -
                    // Fill in gaps with evenly-spaced offsets
-            -
                    for( i = 1; i < stopCount; i++ ) {
-            -
                        if( stopPx[ i ] === null ) {
-            -
                            before = stopPx[ i - 1 ];
-            -
                            j = i;
-            -
                            do {
-            -
                                after = stopPx[ ++j ];
-            -
                            } while( after === null );
-            -
                            stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
-            -
                        }
-            -
                        // Make sure each stop's offset is no less than the one before it
-            -
                        stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
-            -
                    }
-            -
-            -
                    // Convert to percentage along the VML gradient line and add to the VML 'colors' value
-            -
                    for( i = 0; i < stopCount; i++ ) {
-            -
                        vmlColors.push(
-            -
                            ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
-            -
                        );
-            -
                    }
-            -
-            -
                    // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
-            -
                    // the first and last stop colors; this just sets outer bounds for the gradient.
-            -
                    fill['angle'] = vmlAngle;
-            -
                    fill['type'] = 'gradient';
-            -
                    fill['method'] = 'sigma';
-            -
                    fill['color'] = stops[0].color.colorValue( el );
-            -
                    fill['color2'] = stops[stopCount - 1].color.colorValue( el );
-            -
                    fill['colors'].value = vmlColors.join( ',' );
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Hide the actual background image and color of the element.
-            -
                 */
-            -
                hideBackground: function() {
-            -
                    var rs = this.targetElement.runtimeStyle;
-            -
                    rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
-            -
                    rs.backgroundColor = 'transparent';
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    var rs = this.targetElement.runtimeStyle;
-            -
                    rs.backgroundImage = rs.backgroundColor = '';
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for element borders.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 4,
-            -
                boxName: 'border',
-            -
-            -
                /**
-            -
                 * Lookup table of elements which cannot take custom children.
-            -
                 */
-            -
                childlessElements: {
-            -
                    'TABLE':1, //can obviously have children but not custom ones
-            -
                    'INPUT':1,
-            -
                    'TEXTAREA':1,
-            -
                    'SELECT':1,
-            -
                    'OPTION':1,
-            -
                    'IMG':1,
-            -
                    'HR':1,
-            -
                    'FIELDSET':1 //can take children but wrapping its children messes up its <legend>
-            -
                },
-            -
-            -
                /**
-            -
                 * Values of the type attribute for input elements displayed as buttons
-            -
                 */
-            -
                inputButtonTypes: {
-            -
                    'submit':1,
-            -
                    'button':1,
-            -
                    'reset':1
-            -
                },
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return ( si.borderImageInfo.isActive() ||
-            -
                             si.borderRadiusInfo.isActive() ||
-            -
                             si.backgroundInfo.isActive() ) &&
-            -
                           si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the border shape(s)
-            -
                 */
-            -
                draw: function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        props = this.styleInfos.borderInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        side, shape, stroke, s,
-            -
                        segments, seg, i, len;
-            -
-            -
                    if( props ) {
-            -
                        this.hideBorder();
-            -
-            -
                        segments = this.getBorderSegments( 2 );
-            -
                        for( i = 0, len = segments.length; i < len; i++) {
-            -
                            seg = segments[i];
-            -
                            shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
-            -
                            shape.coordsize = w * 2 + ',' + h * 2;
-            -
                            shape.coordorigin = '1,1';
-            -
                            shape.path = seg.path;
-            -
                            s = shape.style;
-            -
                            s.width = w;
-            -
                            s.height = h;
-            -
-            -
                            shape.filled = !!seg.fill;
-            -
                            shape.stroked = !!seg.stroke;
-            -
                            if( seg.stroke ) {
-            -
                                stroke = shape.stroke;
-            -
                                stroke['weight'] = seg.weight + 'px';
-            -
                                stroke.color = seg.color.colorValue( el );
-            -
                                stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
-            -
                                stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
-            -
                            } else {
-            -
                                shape.fill.color = seg.fill.colorValue( el );
-            -
                            }
-            -
                        }
-            -
-            -
                        // remove any previously-created border shapes which didn't get used above
-            -
                        while( this.deleteShape( 'borderPiece' + i++ ) ) {}
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
-            -
                 * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
-            -
                 * like form buttons require removing the border width altogether, so for those we increase the padding
-            -
                 * by the border size.
-            -
                 */
-            -
                hideBorder: function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        rs = el.runtimeStyle,
-            -
                        tag = el.tagName,
-            -
                        isIE6 = PIE.ieVersion === 6,
-            -
                        sides, side, i;
-            -
-            -
                    if( ( isIE6 && tag in this.childlessElements ) || tag === 'BUTTON' ||
-            -
                            ( tag === 'INPUT' && el.type in this.inputButtonTypes ) ) {
-            -
                        rs.borderWidth = '';
-            -
                        sides = this.styleInfos.borderInfo.sides;
-            -
                        for( i = sides.length; i--; ) {
-            -
                            side = sides[ i ];
-            -
                            rs[ 'padding' + side ] = '';
-            -
                            rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
-            -
                                                     ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
-            -
                                                     ( !PIE.ieVersion === 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
-            -
                        }
-            -
                        rs.borderWidth = 0;
-            -
                    }
-            -
                    else if( isIE6 ) {
-            -
                        // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
-            -
                        // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
-            -
                        // (background and border) but displays all the contents.
-            -
                        // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
-            -
                        // as this can interfere with other author scripts which add/modify/delete children. Also, this
-            -
                        // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
-            -
                        // using a compositor filter or some other filter which masks the border.
-            -
                        if( el.childNodes.length !== 1 || el.firstChild.tagName !== 'ie6-mask' ) {
-            -
                            var cont = doc.createElement( 'ie6-mask' ),
-            -
                                s = cont.style, child;
-            -
                            s.visibility = 'visible';
-            -
                            s.zoom = 1;
-            -
                            while( child = el.firstChild ) {
-            -
                                cont.appendChild( child );
-            -
                            }
-            -
                            el.appendChild( cont );
-            -
                            rs.visibility = 'hidden';
-            -
                        }
-            -
                    }
-            -
                    else {
-            -
                        rs.borderColor = 'transparent';
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get the VML path definitions for the border segment(s).
-            -
                 * @param {number=} mult If specified, all coordinates will be multiplied by this number
-            -
                 * @return {Array.<string>}
-            -
                 */
-            -
                getBorderSegments: function( mult ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds, elW, elH,
-            -
                        borderInfo = this.styleInfos.borderInfo,
-            -
                        segments = [],
-            -
                        floor, ceil, wT, wR, wB, wL,
-            -
                        round = Math.round,
-            -
                        borderProps, radiusInfo, radii, widths, styles, colors;
-            -
-            -
                    if( borderInfo.isActive() ) {
-            -
                        borderProps = borderInfo.getProps();
-            -
-            -
                        widths = borderProps.widths;
-            -
                        styles = borderProps.styles;
-            -
                        colors = borderProps.colors;
-            -
-            -
                        if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
-            -
                            if( colors['t'].alpha() > 0 ) {
-            -
                                // shortcut for identical border on all sides - only need 1 stroked shape
-            -
                                wT = widths['t'].pixels( el ); //thickness
-            -
                                wR = wT / 2; //shrink
-            -
                                segments.push( {
-            -
                                    path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
-            -
                                    stroke: styles['t'],
-            -
                                    color: colors['t'],
-            -
                                    weight: wT
-            -
                                } );
-            -
                            }
-            -
                        }
-            -
                        else {
-            -
                            mult = mult || 1;
-            -
                            bounds = this.boundsInfo.getBounds();
-            -
                            elW = bounds.w;
-            -
                            elH = bounds.h;
-            -
-            -
                            wT = round( widths['t'].pixels( el ) );
-            -
                            wR = round( widths['r'].pixels( el ) );
-            -
                            wB = round( widths['b'].pixels( el ) );
-            -
                            wL = round( widths['l'].pixels( el ) );
-            -
                            var pxWidths = {
-            -
                                't': wT,
-            -
                                'r': wR,
-            -
                                'b': wB,
-            -
                                'l': wL
-            -
                            };
-            -
-            -
                            radiusInfo = this.styleInfos.borderRadiusInfo;
-            -
                            if( radiusInfo.isActive() ) {
-            -
                                radii = this.getRadiiPixels( radiusInfo.getProps() );
-            -
                            }
-            -
-            -
                            floor = Math.floor;
-            -
                            ceil = Math.ceil;
-            -
-            -
                            function radius( xy, corner ) {
-            -
                                return radii ? radii[ xy ][ corner ] : 0;
-            -
                            }
-            -
-            -
                            function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
-            -
                                var rx = radius( 'x', corner),
-            -
                                    ry = radius( 'y', corner),
-            -
                                    deg = 65535,
-            -
                                    isRight = corner.charAt( 1 ) === 'r',
-            -
                                    isBottom = corner.charAt( 0 ) === 'b';
-            -
                                return ( rx > 0 && ry > 0 ) ?
-            -
                                            ( doMove ? 'al' : 'ae' ) +
-            -
                                            ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
-            -
                                            ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
-            -
                                            ( floor( rx ) - shrinkX ) * mult + ',' + // width
-            -
                                            ( floor( ry ) - shrinkY ) * mult + ',' + // height
-            -
                                            ( startAngle * deg ) + ',' + // start angle
-            -
                                            ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
-            -
                                        ) : (
-            -
                                            ( doMove ? 'm' : 'l' ) +
-            -
                                            ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
-            -
                                            ( isBottom ? elH - shrinkY : shrinkY ) * mult
-            -
                                        );
-            -
                            }
-            -
-            -
                            function line( side, shrink, ccw, doMove ) {
-            -
                                var
-            -
                                    start = (
-            -
                                        side === 't' ?
-            -
                                            floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
-            -
                                        side === 'r' ?
-            -
                                            ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
-            -
                                        side === 'b' ?
-            -
                                            ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
-            -
                                        // side === 'l' ?
-            -
                                            floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
-            -
                                    ),
-            -
                                    end = (
-            -
                                        side === 't' ?
-            -
                                            ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
-            -
                                        side === 'r' ?
-            -
                                            ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
-            -
                                        side === 'b' ?
-            -
                                            floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
-            -
                                        // side === 'l' ?
-            -
                                            floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
-            -
                                    );
-            -
                                return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
-            -
                                             ( doMove ? 'm' + start : '' ) + 'l' + end;
-            -
                            }
-            -
-            -
-            -
                            function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
-            -
                                var vert = side === 'l' || side === 'r',
-            -
                                    sideW = pxWidths[ side ],
-            -
                                    beforeX, beforeY, afterX, afterY;
-            -
-            -
                                if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
-            -
                                    beforeX = pxWidths[ vert ? side : sideBefore ];
-            -
                                    beforeY = pxWidths[ vert ? sideBefore : side ];
-            -
                                    afterX = pxWidths[ vert ? side : sideAfter ];
-            -
                                    afterY = pxWidths[ vert ? sideAfter : side ];
-            -
-            -
                                    if( styles[ side ] === 'dashed' || styles[ side ] === 'dotted' ) {
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
-            -
                                                  curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                        segments.push( {
-            -
                                            path: line( side, sideW / 2, 0, 1 ),
-            -
                                            stroke: styles[ side ],
-            -
                                            weight: sideW,
-            -
                                            color: colors[ side ]
-            -
                                        } );
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
-            -
                                                  curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                    }
-            -
                                    else {
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
-            -
                                                  line( side, sideW, 0, 0 ) +
-            -
                                                  curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
-            -
-            -
                                                  ( styles[ side ] === 'double' && sideW > 2 ?
-            -
                                                          curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
-            -
                                                          line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
-            -
                                                          curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
-            -
                                                          'x ' +
-            -
                                                          curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
-            -
                                                          line( side, floor( sideW / 3 ), 1, 0 ) +
-            -
                                                          curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
-            -
                                                      : '' ) +
-            -
-            -
                                                  curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
-            -
                                                  line( side, 0, 1, 0 ) +
-            -
                                                  curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
-            -
                            addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
-            -
                            addSide( 'r', 't', 'b', 'tr', 'br', 0 );
-            -
                            addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
-            -
                            addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
-            -
                        }
-            -
                    }
-            -
-            -
                    return segments;
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    this.targetElement.runtimeStyle.borderColor = '';
-            -
                }
-            -
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for border-image
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 5,
-            -
                pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
-            -
-            -
                needsUpdate: function() {
-            -
                    return this.styleInfos.borderImageInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    return this.styleInfos.borderImageInfo.isActive();
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    this.getBox(); //make sure pieces are created
-            -
-            -
                    var props = this.styleInfos.borderImageInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        el = this.targetElement,
-            -
                        pieces = this.pieces;
-            -
-            -
                    PIE.Util.withImageSize( props.src, function( imgSize ) {
-            -
                        var elW = bounds.w,
-            -
                            elH = bounds.h,
-            -
-            -
                            widths = props.width,
-            -
                            widthT = widths.t.pixels( el ),
-            -
                            widthR = widths.r.pixels( el ),
-            -
                            widthB = widths.b.pixels( el ),
-            -
                            widthL = widths.l.pixels( el ),
-            -
                            slices = props.slice,
-            -
                            sliceT = slices.t.pixels( el ),
-            -
                            sliceR = slices.r.pixels( el ),
-            -
                            sliceB = slices.b.pixels( el ),
-            -
                            sliceL = slices.l.pixels( el );
-            -
-            -
                        // Piece positions and sizes
-            -
                        function setSizeAndPos( piece, w, h, x, y ) {
-            -
                            var s = pieces[piece].style,
-            -
                                max = Math.max;
-            -
                            s.width = max(w, 0);
-            -
                            s.height = max(h, 0);
-            -
                            s.left = x;
-            -
                            s.top = y;
-            -
                        }
-            -
                        setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
-            -
                        setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
-            -
                        setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
-            -
                        setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
-            -
                        setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
-            -
                        setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
-            -
                        setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
-            -
                        setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
-            -
                        setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
-            -
-            -
-            -
                        // image croppings
-            -
                        function setCrops( sides, crop, val ) {
-            -
                            for( var i=0, len=sides.length; i < len; i++ ) {
-            -
                                pieces[ sides[i] ]['imagedata'][ crop ] = val;
-            -
                            }
-            -
                        }
-            -
-            -
                        // corners
-            -
                        setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
-            -
                        setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
-            -
                        setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
-            -
                        setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
-            -
-            -
                        // edges and center
-            -
                        if( props.repeat.v === 'stretch' ) {
-            -
                            setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
-            -
                            setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
-            -
                        }
-            -
                        if( props.repeat.h === 'stretch' ) {
-            -
                            setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
-            -
                            setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
-            -
                        }
-            -
-            -
                        // center fill
-            -
                        pieces['c'].style.display = props.fill ? '' : 'none';
-            -
                    }, this );
-            -
                },
-            -
-            -
                getBox: function() {
-            -
                    var box = this.parent.getLayer( this.boxZIndex ),
-            -
                        s, piece, i,
-            -
                        pieceNames = this.pieceNames,
-            -
                        len = pieceNames.length;
-            -
-            -
                    if( !box ) {
-            -
                        box = doc.createElement( 'border-image' );
-            -
                        s = box.style;
-            -
                        s.position = 'absolute';
-            -
-            -
                        this.pieces = {};
-            -
-            -
                        for( i = 0; i < len; i++ ) {
-            -
                            piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
-            -
                            piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
-            -
                            s = piece.style;
-            -
                            s['behavior'] = 'url(#default#VML)';
-            -
                            s.position = "absolute";
-            -
                            s.top = s.left = 0;
-            -
                            piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
-            -
                            piece.stroked = false;
-            -
                            piece.filled = false;
-            -
                            box.appendChild( piece );
-            -
                        }
-            -
-            -
                        this.parent.addLayer( this.boxZIndex, box );
-            -
                    }
-            -
-            -
                    return box;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for outset box-shadows
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 1,
-            -
                boxName: 'outset-box-shadow',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.boxShadowInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var boxShadowInfo = this.styleInfos.boxShadowInfo;
-            -
                    return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    var me = this,
-            -
                        el = this.targetElement,
-            -
                        box = this.getBox(),
-            -
                        styleInfos = this.styleInfos,
-            -
                        shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
-            -
                        radii = styleInfos.borderRadiusInfo.getProps(),
-            -
                        len = shadowInfos.length,
-            -
                        i = len, j,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
-            -
                        corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
-            -
                        shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
-            -
                        totalW, totalH, focusX, focusY, isBottom, isRight;
-            -
-            -
-            -
                    function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
-            -
                        var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
-            -
                            fill = shape.fill;
-            -
-            -
                        // Position and size
-            -
                        shape['coordsize'] = w * 2 + ',' + h * 2;
-            -
                        shape['coordorigin'] = '1,1';
-            -
-            -
                        // Color and opacity
-            -
                        shape['stroked'] = false;
-            -
                        shape['filled'] = true;
-            -
                        fill.color = color.colorValue( el );
-            -
                        if( blur ) {
-            -
                            fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
-            -
                            fill['color2'] = fill.color;
-            -
                            fill['opacity'] = 0;
-            -
                        }
-            -
-            -
                        // Path
-            -
                        shape.path = path;
-            -
-            -
                        // This needs to go last for some reason, to prevent rendering at incorrect size
-            -
                        ss = shape.style;
-            -
                        ss.left = xOff;
-            -
                        ss.top = yOff;
-            -
                        ss.width = w;
-            -
                        ss.height = h;
-            -
-            -
                        return shape;
-            -
                    }
-            -
-            -
-            -
                    while( i-- ) {
-            -
                        shadowInfo = shadowInfos[ i ];
-            -
                        xOff = shadowInfo.xOffset.pixels( el );
-            -
                        yOff = shadowInfo.yOffset.pixels( el );
-            -
                        spread = shadowInfo.spread.pixels( el ),
-            -
                        blur = shadowInfo.blur.pixels( el );
-            -
                        color = shadowInfo.color;
-            -
                        // Shape path
-            -
                        shrink = -spread - blur;
-            -
                        if( !radii && blur ) {
-            -
                            // If blurring, use a non-null border radius info object so that getBoxPath will
-            -
                            // round the corners of the expanded shadow shape rather than squaring them off.
-            -
                            radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
-            -
                        }
-            -
                        path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
-            -
-            -
                        if( blur ) {
-            -
                            totalW = ( spread + blur ) * 2 + w;
-            -
                            totalH = ( spread + blur ) * 2 + h;
-            -
                            focusX = blur * 2 / totalW;
-            -
                            focusY = blur * 2 / totalH;
-            -
                            if( blur - spread > w / 2 || blur - spread > h / 2 ) {
-            -
                                // If the blur is larger than half the element's narrowest dimension, we cannot do
-            -
                                // this with a single shape gradient, because its focussize would have to be less than
-            -
                                // zero which results in ugly artifacts. Instead we create four shapes, each with its
-            -
                                // gradient focus past center, and then clip them so each only shows the quadrant
-            -
                                // opposite the focus.
-            -
                                for( j = 4; j--; ) {
-            -
                                    corner = corners[j];
-            -
                                    isBottom = corner.charAt( 0 ) === 'b';
-            -
                                    isRight = corner.charAt( 1 ) === 'r';
-            -
                                    shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
-            -
                                    fill = shape.fill;
-            -
                                    fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
-            -
                                                            ( isBottom ? 1 - focusY : focusY );
-            -
                                    fill['focussize'] = '0,0';
-            -
-            -
                                    // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
-            -
                                    // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
-            -
                                    shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
-            -
                                                                 ( isRight ? totalW : totalW / 2 ) + 'px,' +
-            -
                                                                 ( isBottom ? totalH : totalH / 2 ) + 'px,' +
-            -
                                                                 ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
-            -
                                }
-            -
                            } else {
-            -
                                // TODO delete old quadrant shapes if resizing expands past the barrier
-            -
                                shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
-            -
                                fill = shape.fill;
-            -
                                fill['focusposition'] = focusX + ',' + focusY;
-            -
                                fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
-            -
                            }
-            -
                        } else {
-            -
                            shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
-            -
                            alpha = color.alpha();
-            -
                            if( alpha < 1 ) {
-            -
                                // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
-            -
                                // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha  ) + ')';
-            -
                                shape.fill.opacity = alpha;
-            -
                            }
-            -
                        }
-            -
                    }
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for re-rendering img elements using VML. Kicks in if the img has
-            -
             * a border-radius applied, or if the -pie-png-fix flag is set.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 6,
-            -
                boxName: 'imgEl',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return this.targetElement.src !== this._lastSrc || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderRadiusInfo.isActive() || si.backgroundInfo.isPngFix();
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    this._lastSrc = src;
-            -
                    this.hideActualImg();
-            -
-            -
                    var shape = this.getShape( 'img', 'fill', this.getBox() ),
-            -
                        fill = shape.fill,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        borderProps = this.styleInfos.borderInfo.getProps(),
-            -
                        borderWidths = borderProps && borderProps.widths,
-            -
                        el = this.targetElement,
-            -
                        src = el.src,
-            -
                        round = Math.round,
-            -
                        s;
-            -
-            -
                    shape.stroked = false;
-            -
                    fill.type = 'frame';
-            -
                    fill.src = src;
-            -
                    fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
-            -
                    shape.coordsize = w * 2 + ',' + h * 2;
-            -
                    shape.coordorigin = '1,1';
-            -
                    shape.path = this.getBoxPath( borderWidths ? {
-            -
                        t: round( borderWidths['t'].pixels( el ) ),
-            -
                        r: round( borderWidths['r'].pixels( el ) ),
-            -
                        b: round( borderWidths['b'].pixels( el ) ),
-            -
                        l: round( borderWidths['l'].pixels( el ) )
-            -
                    } : 0, 2 );
-            -
                    s = shape.style;
-            -
                    s.width = w;
-            -
                    s.height = h;
-            -
                },
-            -
-            -
                hideActualImg: function() {
-            -
                    this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    this.targetElement.runtimeStyle.filter = '';
-            -
                }
-            -
-            -
            } );
-            -
-            -
            PIE.Element = (function() {
-            -
-            -
                var wrappers = {},
-            -
                    lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
-            -
                    pollCssProp = PIE.CSS_PREFIX + 'poll',
-            -
                    hoverClass = ' ' + PIE.CLASS_PREFIX + 'hover',
-            -
                    hoverClassRE = new RegExp( '\\b' + PIE.CLASS_PREFIX + 'hover\\b', 'g' ),
-            -
                    ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 };
-            -
-            -
-            -
                function addListener( el, type, handler ) {
-            -
                    el.attachEvent( type, handler );
-            -
                }
-            -
-            -
                function removeListener( el, type, handler ) {
-            -
                    el.detachEvent( type, handler );
-            -
                }
-            -
-            -
-            -
                function Element( el ) {
-            -
                    var renderers,
-            -
                        boundsInfo = new PIE.BoundsInfo( el ),
-            -
                        styleInfos,
-            -
                        styleInfosArr,
-            -
                        ancestors,
-            -
                        initializing,
-            -
                        initialized,
-            -
                        eventsAttached,
-            -
                        delayed,
-            -
                        destroyed,
-            -
                        poll;
-            -
-            -
                    /**
-            -
                     * Initialize PIE for this element.
-            -
                     */
-            -
                    function init() {
-            -
                        if( !initialized ) {
-            -
                            var docEl,
-            -
                                bounds,
-            -
                                cs = el.currentStyle,
-            -
                                lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
-            -
                                rootRenderer;
-            -
-            -
                            // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
-            -
                            poll = cs.getAttribute( pollCssProp );
-            -
                            poll = PIE.ieDocMode === 8 ? poll !== 'false' : poll === 'true';
-            -
-            -
                            // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
-            -
                            // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
-            -
                            if( !initializing ) {
-            -
                                initializing = 1;
-            -
                                el.runtimeStyle.zoom = 1;
-            -
                                initFirstChildPseudoClass();
-            -
                            }
-            -
-            -
                            boundsInfo.lock();
-            -
-            -
                            // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
-            -
                            if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement || doc.body ) &&
-            -
                                    ( bounds.y > docEl.clientHeight || bounds.x > docEl.clientWidth || bounds.y + bounds.h < 0 || bounds.x + bounds.w < 0 ) ) {
-            -
                                if( !delayed ) {
-            -
                                    delayed = 1;
-            -
                                    PIE.OnScroll.observe( init );
-            -
                                }
-            -
                            } else {
-            -
                                initialized = 1;
-            -
                                delayed = initializing = 0;
-            -
                                PIE.OnScroll.unobserve( init );
-            -
-            -
                                // Create the style infos and renderers
-            -
                                styleInfos = {
-            -
                                    backgroundInfo: new PIE.BackgroundStyleInfo( el ),
-            -
                                    borderInfo: new PIE.BorderStyleInfo( el ),
-            -
                                    borderImageInfo: new PIE.BorderImageStyleInfo( el ),
-            -
                                    borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
-            -
                                    boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
-            -
                                    visibilityInfo: new PIE.VisibilityStyleInfo( el )
-            -
                                };
-            -
                                styleInfosArr = [
-            -
                                    styleInfos.backgroundInfo,
-            -
                                    styleInfos.borderInfo,
-            -
                                    styleInfos.borderImageInfo,
-            -
                                    styleInfos.borderRadiusInfo,
-            -
                                    styleInfos.boxShadowInfo,
-            -
                                    styleInfos.visibilityInfo
-            -
                                ];
-            -
-            -
                                rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
-            -
                                var childRenderers = [
-            -
                                    new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
-            -
                                ];
-            -
                                if( el.tagName === 'IMG' ) {
-            -
                                    childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
-            -
                                }
-            -
                                rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
-            -
                                renderers = [ rootRenderer ].concat( childRenderers );
-            -
-            -
                                // Add property change listeners to ancestors if requested
-            -
                                initAncestorPropChangeListeners();
-            -
-            -
                                // Add to list of polled elements in IE8
-            -
                                if( poll ) {
-            -
                                    PIE.Heartbeat.observe( update );
-            -
                                    PIE.Heartbeat.run();
-            -
                                }
-            -
-            -
                                // Trigger rendering
-            -
                                update( 1 );
-            -
                            }
-            -
-            -
                            if( !eventsAttached ) {
-            -
                                eventsAttached = 1;
-            -
                                addListener( el, 'onmove', handleMoveOrResize );
-            -
                                addListener( el, 'onresize', handleMoveOrResize );
-            -
                                addListener( el, 'onpropertychange', propChanged );
-            -
                                addListener( el, 'onmouseenter', mouseEntered );
-            -
                                addListener( el, 'onmouseleave', mouseLeft );
-            -
                                PIE.OnResize.observe( handleMoveOrResize );
-            -
-            -
                                PIE.OnBeforeUnload.observe( removeEventListeners );
-            -
                            }
-            -
-            -
                            boundsInfo.unlock();
-            -
                        }
-            -
                    }
-            -
-            -
-            -
-            -
-            -
                    /**
-            -
                     * Event handler for onmove and onresize events. Invokes update() only if the element's
-            -
                     * bounds have previously been calculated, to prevent multiple runs during page load when
-            -
                     * the element has no initial CSS3 properties.
-            -
                     */
-            -
                    function handleMoveOrResize() {
-            -
                        if( boundsInfo && boundsInfo.hasBeenQueried() ) {
-            -
                            update();
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Update position and/or size as necessary. Both move and resize events call
-            -
                     * this rather than the updatePos/Size functions because sometimes, particularly
-            -
                     * during page load, one will fire but the other won't.
-            -
                     */
-            -
                    function update( force ) {
-            -
                        if( !destroyed ) {
-            -
                            if( initialized ) {
-            -
                                var i, len;
-            -
-            -
                                lockAll();
-            -
                                if( force || boundsInfo.positionChanged() ) {
-            -
                                    /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
-            -
                                       position changes may not always be accurate; it's possible that
-            -
                                       an element will actually move relative to its positioning parent, but its position
-            -
                                       relative to the viewport will stay the same. Need to come up with a better way to
-            -
                                       track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
-            -
                                       but that is a more expensive operation since it does some DOM walking, and we want this
-            -
                                       check to be as fast as possible. */
-            -
                                    for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                        renderers[i].updatePos();
-            -
                                    }
-            -
                                }
-            -
                                if( force || boundsInfo.sizeChanged() ) {
-            -
                                    for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                        renderers[i].updateSize();
-            -
                                    }
-            -
                                }
-            -
                                unlockAll();
-            -
                            }
-            -
                            else if( !initializing ) {
-            -
                                init();
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle property changes to trigger update when appropriate.
-            -
                     */
-            -
                    function propChanged() {
-            -
                        var i, len, renderer,
-            -
                            e = event;
-            -
-            -
                        // Some elements like <table> fire onpropertychange events for old-school background properties
-            -
                        // ('background', 'bgColor') when runtimeStyle background properties are changed, which
-            -
                        // results in an infinite loop; therefore we filter out those property names. Also, 'display'
-            -
                        // is ignored because size calculations don't work correctly immediately when its onpropertychange
-            -
                        // event fires, and because it will trigger an onresize event anyway.
-            -
                        if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
-            -
                            if( initialized ) {
-            -
                                lockAll();
-            -
                                for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                    renderer = renderers[i];
-            -
                                    // Make sure position is synced if the element hasn't already been rendered.
-            -
                                    // TODO this feels sloppy - look into merging propChanged and update functions
-            -
                                    if( !renderer.isPositioned ) {
-            -
                                        renderer.updatePos();
-            -
                                    }
-            -
                                    if( renderer.needsUpdate() ) {
-            -
                                        renderer.updateProps();
-            -
                                    }
-            -
                                }
-            -
                                unlockAll();
-            -
                            }
-            -
                            else if( !initializing ) {
-            -
                                init();
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    function addHoverClass() {
-            -
                        if( el ) {
-            -
                            el.className += hoverClass;
-            -
                        }
-            -
                    }
-            -
-            -
                    function removeHoverClass() {
-            -
                        if( el ) {
-            -
                            el.className = el.className.replace( hoverClassRE, '' );
-            -
                        }
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
-            -
                     * hover styles to non-link elements, and to trigger a propertychange update.
-            -
                     */
-            -
                    function mouseEntered() {
-            -
                        //must delay this because the mouseenter event fires before the :hover styles are added.
-            -
                        setTimeout( addHoverClass, 0 );
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle mouseleave events
-            -
                     */
-            -
                    function mouseLeft() {
-            -
                        //must delay this because the mouseleave event fires before the :hover styles are removed.
-            -
                        setTimeout( removeHoverClass, 0 );
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Handle property changes on ancestors of the element; see initAncestorPropChangeListeners()
-            -
                     * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
-            -
                     */
-            -
                    function ancestorPropChanged() {
-            -
                        var name = event.propertyName;
-            -
                        if( name === 'className' || name === 'id' ) {
-            -
                            propChanged();
-            -
                        }
-            -
                    }
-            -
-            -
                    function lockAll() {
-            -
                        boundsInfo.lock();
-            -
                        for( var i = styleInfosArr.length; i--; ) {
-            -
                            styleInfosArr[i].lock();
-            -
                        }
-            -
                    }
-            -
-            -
                    function unlockAll() {
-            -
                        for( var i = styleInfosArr.length; i--; ) {
-            -
                            styleInfosArr[i].unlock();
-            -
                        }
-            -
                        boundsInfo.unlock();
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Remove all event listeners from the element and any monitoried ancestors.
-            -
                     */
-            -
                    function removeEventListeners() {
-            -
                        if (eventsAttached) {
-            -
                            if( ancestors ) {
-            -
                                for( var i = 0, len = ancestors.length, a; i < len; i++ ) {
-            -
                                    a = ancestors[i];
-            -
                                    removeListener( a, 'onpropertychange', ancestorPropChanged );
-            -
                                    removeListener( a, 'onmouseenter', mouseEntered );
-            -
                                    removeListener( a, 'onmouseleave', mouseLeft );
-            -
                                }
-            -
                            }
-            -
-            -
                            // Remove event listeners
-            -
                            removeListener( el, 'onmove', update );
-            -
                            removeListener( el, 'onresize', update );
-            -
                            removeListener( el, 'onpropertychange', propChanged );
-            -
                            removeListener( el, 'onmouseenter', mouseEntered );
-            -
                            removeListener( el, 'onmouseleave', mouseLeft );
-            -
-            -
                            PIE.OnBeforeUnload.unobserve( removeEventListeners );
-            -
                            eventsAttached = 0;
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Clean everything up when the behavior is removed from the element, or the element
-            -
                     * is manually destroyed.
-            -
                     */
-            -
                    function destroy() {
-            -
                        if( !destroyed ) {
-            -
                            var i, len;
-            -
-            -
                            removeEventListeners();
-            -
-            -
                            destroyed = 1;
-            -
-            -
                            // destroy any active renderers
-            -
                            if( renderers ) {
-            -
                                for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                    renderers[i].destroy();
-            -
                                }
-            -
                            }
-            -
-            -
                            // Remove from list of polled elements in IE8
-            -
                            if( poll ) {
-            -
                                PIE.Heartbeat.unobserve( update );
-            -
                            }
-            -
                            // Stop onresize listening
-            -
                            PIE.OnResize.unobserve( update );
-            -
-            -
                            // Kill references
-            -
                            renderers = boundsInfo = styleInfos = styleInfosArr = ancestors = el = null;
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange listeners
-            -
                     * to ancestor(s) of the element so we can pick up style changes based on CSS rules using
-            -
                     * descendant selectors.
-            -
                     */
-            -
                    function initAncestorPropChangeListeners() {
-            -
                        var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
-            -
                            i, a;
-            -
                        if( watch ) {
-            -
                            ancestors = [];
-            -
                            watch = parseInt( watch, 10 );
-            -
                            i = 0;
-            -
                            a = el.parentNode;
-            -
                            while( a && ( watch === 'NaN' || i++ < watch ) ) {
-            -
                                ancestors.push( a );
-            -
                                addListener( a, 'onpropertychange', ancestorPropChanged );
-            -
                                addListener( a, 'onmouseenter', mouseEntered );
-            -
                                addListener( a, 'onmouseleave', mouseLeft );
-            -
                                a = a.parentNode;
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * If the target element is a first child, add a pie_first-child class to it. This allows using
-            -
                     * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
-            -
                     * pseudo-class selector.
-            -
                     */
-            -
                    function initFirstChildPseudoClass() {
-            -
                        var tmpEl = el,
-            -
                            isFirst = 1;
-            -
                        while( tmpEl = tmpEl.previousSibling ) {
-            -
                            if( tmpEl.nodeType === 1 ) {
-            -
                                isFirst = 0;
-            -
                                break;
-            -
                            }
-            -
                        }
-            -
                        if( isFirst ) {
-            -
                            el.className += ' ' + PIE.CLASS_PREFIX + 'first-child';
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    // These methods are all already bound to this instance so there's no need to wrap them
-            -
                    // in a closure to maintain the 'this' scope object when calling them.
-            -
                    this.init = init;
-            -
                    this.update = update;
-            -
                    this.destroy = destroy;
-            -
                    this.el = el;
-            -
                }
-            -
-            -
                Element.getInstance = function( el ) {
-            -
                    var id = PIE.Util.getUID( el );
-            -
                    return wrappers[ id ] || ( wrappers[ id ] = new Element( el ) );
-            -
                };
-            -
-            -
                Element.destroy = function( el ) {
-            -
                    var id = PIE.Util.getUID( el ),
-            -
                        wrapper = wrappers[ id ];
-            -
                    if( wrapper ) {
-            -
                        wrapper.destroy();
-            -
                        delete wrappers[ id ];
-            -
                    }
-            -
                };
-            -
-            -
                Element.destroyAll = function() {
-            -
                    var els = [], wrapper;
-            -
                    if( wrappers ) {
-            -
                        for( var w in wrappers ) {
-            -
                            if( wrappers.hasOwnProperty( w ) ) {
-            -
                                wrapper = wrappers[ w ];
-            -
                                els.push( wrapper.el );
-            -
                                wrapper.destroy();
-            -
                            }
-            -
                        }
-            -
                        wrappers = {};
-            -
                    }
-            -
                    return els;
-            -
                };
-            -
-            -
                return Element;
-            -
            })();
-            -
-            -
            /*
-            -
             * This file exposes the public API for invoking PIE.
-            -
             */
-            -
-            -
-            -
            /**
-            -
             * Programatically attach PIE to a single element.
-            -
             * @param {Element} el
-            -
             */
-            -
            PIE[ 'attach' ] = function( el ) {
-            -
                if (PIE.ieDocMode < 9) {
-            -
                    PIE.Element.getInstance( el ).init();
-            -
                }
-            -
            };
-            -
-            -
-            -
            /**
-            -
             * Programatically detach PIE from a single element.
-            -
             * @param {Element} el
-            -
             */
-            -
            PIE[ 'detach' ] = function( el ) {
-            -
                PIE.Element.destroy( el );
-            -
            };
-            -
-            -
-            -
            } // if( !PIE )
-            -
            var p = window['PIE'],
-            -
                el = element;
-            -
-            -
            function init() {
-            -
                if( p && doc.media !== 'print' ) { // IE strangely attaches a second copy of the behavior to elements when printing
-            -
                    p['attach']( el );
-            -
                }
-            -
            }
-            -
-            -
            function cleanup() {
-            -
                if (p) {
-            -
                    p['detach']( el );
-            -
                    p = el = 0;
-            -
                }
-            -
            }
-            -
-            -
            if( el.readyState === 'complete' ) {
-            -
                init();
-            -
            }
-            -
            </script>
-            -
            </PUBLIC:COMPONENT>


1	+ <!--
2	+ PIE: CSS3 rendering for IE
3	+ Version 1.0beta4
4	+ http://css3pie.com
5	+ Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
6	+ -->
7	+ <PUBLIC:COMPONENT lightWeight="true">
8	+ <PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
9	+ <PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
10	+ <PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
11	+
12	+ <script type="text/javascript">
13	+ var doc = element.document;var PIE = window['PIE'];
14	+
15	+ if( !PIE ) {
16	+ PIE = window['PIE'] = {
17	+ CSS_PREFIX: '-pie-',
18	+ STYLE_PREFIX: 'Pie',
19	+ CLASS_PREFIX: 'pie_',
20	+ tableCellTags: {
21	+ 'TD': 1,
22	+ 'TH': 1
23	+ }
24	+ };
25	+
26	+ // Force the background cache to be used. No reason it shouldn't be.
27	+ try {
28	+ doc.execCommand( 'BackgroundImageCache', false, true );
29	+ } catch(e) {}
30	+
31	+ /*
32	+ * IE version detection approach by James Padolsey, with modifications -- from
33	+ * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
34	+ */
35	+ PIE.ieVersion = function(){
36	+ var v = 4,
37	+ div = doc.createElement('div'),
38	+ all = div.getElementsByTagName('i');
39	+
40	+ while (
41	+ div.innerHTML = '<!--[if gt IE ' + (++v) + ']><i></i><![endif]-->',
42	+ all[0]
43	+ ) {}
44	+
45	+ return v;
46	+ }();
47	+
48	+ // Detect IE6
49	+ if( PIE.ieVersion === 6 ) {
50	+ // IE6 can't access properties with leading dash, but can without it.
51	+ PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
52	+ }
53	+
54	+ // Detect IE8
55	+ PIE.ieDocMode = doc.documentMode \|\| PIE.ieVersion;
56	+ /**
57	+ * Utility functions
58	+ */
59	+ (function() {
60	+ var vmlCreatorDoc,
61	+ idNum = 0,
62	+ imageSizes = {};
63	+
64	+
65	+ PIE.Util = {
66	+
67	+ /**
68	+ * To create a VML element, it must be created by a Document which has the VML
69	+ * namespace set. Unfortunately, if you try to add the namespace programatically
70	+ * into the main document, you will get an "Unspecified error" when trying to
71	+ * access document.namespaces before the document is finished loading. To get
72	+ * around this, we create a DocumentFragment, which in IE land is apparently a
73	+ * full-fledged Document. It allows adding namespaces immediately, so we add the
74	+ * namespace there and then have it create the VML element.
75	+ * @param {string} tag The tag name for the VML element
76	+ * @return {Element} The new VML element
77	+ */
78	+ createVmlElement: function( tag ) {
79	+ var vmlPrefix = 'css3vml';
80	+ if( !vmlCreatorDoc ) {
81	+ vmlCreatorDoc = doc.createDocumentFragment();
82	+ vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
83	+ }
84	+ return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
85	+ },
86	+
87	+
88	+ /**
89	+ * Generate and return a unique ID for a given object. The generated ID is stored
90	+ * as a property of the object for future reuse.
91	+ * @param {Object} obj
92	+ */
93	+ getUID: function( obj ) {
94	+ return obj && obj[ '_pieId' ] \|\| ( obj[ '_pieId' ] = ++idNum );
95	+ },
96	+
97	+
98	+ /**
99	+ * Simple utility for merging objects
100	+ * @param {Object} obj1 The main object into which all others will be merged
101	+ * @param {...Object} var_args Other objects which will be merged into the first, in order
102	+ */
103	+ merge: function( obj1 ) {
104	+ var i, len, p, objN, args = arguments;
105	+ for( i = 1, len = args.length; i < len; i++ ) {
106	+ objN = args[i];
107	+ for( p in objN ) {
108	+ if( objN.hasOwnProperty( p ) ) {
109	+ obj1[ p ] = objN[ p ];
110	+ }
111	+ }
112	+ }
113	+ return obj1;
114	+ },
115	+
116	+
117	+ /**
118	+ * Execute a callback function, passing it the dimensions of a given image once
119	+ * they are known.
120	+ * @param {string} src The source URL of the image
121	+ * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
122	+ * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
123	+ */
124	+ withImageSize: function( src, func, ctx ) {
125	+ var size = imageSizes[ src ], img, queue;
126	+ if( size ) {
127	+ // If we have a queue, add to it
128	+ if( Object.prototype.toString.call( size ) === '[object Array]' ) {
129	+ size.push( [ func, ctx ] );
130	+ }
131	+ // Already have the size cached, call func right away
132	+ else {
133	+ func.call( ctx, size );
134	+ }
135	+ } else {
136	+ queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
137	+ img = new Image();
138	+ img.onload = function() {
139	+ size = imageSizes[ src ] = { w: img.width, h: img.height };
140	+ for( var i = 0, len = queue.length; i < len; i++ ) {
141	+ queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
142	+ }
143	+ img.onload = null;
144	+ };
145	+ img.src = src;
146	+ }
147	+ }
148	+ };
149	+ })();/**
150	+ *
151	+ */
152	+ PIE.Observable = function() {
153	+ /**
154	+ * List of registered observer functions
155	+ */
156	+ this.observers = [];
157	+
158	+ /**
159	+ * Hash of function ids to their position in the observers list, for fast lookup
160	+ */
161	+ this.indexes = {};
162	+ };
163	+ PIE.Observable.prototype = {
164	+
165	+ observe: function( fn ) {
166	+ var id = PIE.Util.getUID( fn ),
167	+ indexes = this.indexes,
168	+ observers = this.observers;
169	+ if( !( id in indexes ) ) {
170	+ indexes[ id ] = observers.length;
171	+ observers.push( fn );
172	+ }
173	+ },
174	+
175	+ unobserve: function( fn ) {
176	+ var id = PIE.Util.getUID( fn ),
177	+ indexes = this.indexes;
178	+ if( id && id in indexes ) {
179	+ delete this.observers[ indexes[ id ] ];
180	+ delete indexes[ id ];
181	+ }
182	+ },
183	+
184	+ fire: function() {
185	+ var o = this.observers,
186	+ i = o.length;
187	+ while( i-- ) {
188	+ o[ i ] && o[ i ]();
189	+ }
190	+ }
191	+
192	+ };/*
193	+ * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
194	+ * always firing the onmove and onresize events when elements are moved or resized. We check a few
195	+ * times every second to make sure the elements have the correct position and size. See Element.js
196	+ * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8
197	+ * and false elsewhere.
198	+ */
199	+
200	+ PIE.Heartbeat = new PIE.Observable();
201	+ PIE.Heartbeat.run = function() {
202	+ var me = this;
203	+ if( !me.running ) {
204	+ setInterval( function() { me.fire() }, 250 );
205	+ me.running = 1;
206	+ }
207	+ };
208	+ /**
209	+ * Create an observable listener for the onbeforeunload event
210	+ */
211	+ PIE.OnBeforeUnload = new PIE.Observable();
212	+ window.attachEvent( 'onbeforeunload', function() { PIE.OnBeforeUnload.fire(); } );
213	+
214	+ /**
215	+ * Attach an event which automatically gets detached onbeforeunload
216	+ */
217	+ PIE.OnBeforeUnload.attachManagedEvent = function( target, name, handler ) {
218	+ target.attachEvent( name, handler );
219	+ this.observe( function() {
220	+ target.detachEvent( name, handler );
221	+ } );
222	+ };/**
223	+ * Create a single observable listener for window resize events.
224	+ */
225	+ (function() {
226	+ PIE.OnResize = new PIE.Observable();
227	+
228	+ function resized() {
229	+ PIE.OnResize.fire();
230	+ }
231	+
232	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onresize', resized );
233	+ })();
234	+ /**
235	+ * Create a single observable listener for scroll events. Used for lazy loading based
236	+ * on the viewport, and for fixed position backgrounds.
237	+ */
238	+ (function() {
239	+ PIE.OnScroll = new PIE.Observable();
240	+
241	+ function scrolled() {
242	+ PIE.OnScroll.fire();
243	+ }
244	+
245	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onscroll', scrolled );
246	+
247	+ PIE.OnResize.observe( scrolled );
248	+ })();
249	+ /**
250	+ * Listen for printing events, destroy all active PIE instances when printing, and
251	+ * restore them afterward.
252	+ */
253	+ (function() {
254	+
255	+ var elements;
256	+
257	+ function beforePrint() {
258	+ elements = PIE.Element.destroyAll();
259	+ }
260	+
261	+ function afterPrint() {
262	+ if( elements ) {
263	+ for( var i = 0, len = elements.length; i < len; i++ ) {
264	+ PIE[ 'attach' ]( elements[i] );
265	+ }
266	+ elements = 0;
267	+ }
268	+ }
269	+
270	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
271	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
272	+
273	+ })();/**
274	+ * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
275	+ * value is returned from PIE.getLength() - always use that instead of instantiating directly.
276	+ * @constructor
277	+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
278	+ * been validated as a valid length or percentage syntax.
279	+ */
280	+ PIE.Length = (function() {
281	+ var lengthCalcEl = doc.createElement( 'length-calc' ),
282	+ parent = doc.documentElement,
283	+ s = lengthCalcEl.style,
284	+ conversions = {},
285	+ units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
286	+ i = units.length,
287	+ instances = {};
288	+
289	+ s.position = 'absolute';
290	+ s.top = s.left = '-9999px';
291	+
292	+ parent.appendChild( lengthCalcEl );
293	+ while( i-- ) {
294	+ lengthCalcEl.style.width = '100' + units[i];
295	+ conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
296	+ }
297	+ parent.removeChild( lengthCalcEl );
298	+
299	+
300	+ function Length( val ) {
301	+ this.val = val;
302	+ }
303	+ Length.prototype = {
304	+ /**
305	+ * Regular expression for matching the length unit
306	+ * @private
307	+ */
308	+ unitRE: /(px\|em\|ex\|mm\|cm\|in\|pt\|pc\|%)$/,
309	+
310	+ /**
311	+ * Get the numeric value of the length
312	+ * @return {number} The value
313	+ */
314	+ getNumber: function() {
315	+ var num = this.num,
316	+ UNDEF;
317	+ if( num === UNDEF ) {
318	+ num = this.num = parseFloat( this.val );
319	+ }
320	+ return num;
321	+ },
322	+
323	+ /**
324	+ * Get the unit of the length
325	+ * @return {string} The unit
326	+ */
327	+ getUnit: function() {
328	+ var unit = this.unit,
329	+ m;
330	+ if( !unit ) {
331	+ m = this.val.match( this.unitRE );
332	+ unit = this.unit = ( m && m[0] ) \|\| 'px';
333	+ }
334	+ return unit;
335	+ },
336	+
337	+ /**
338	+ * Determine whether this is a percentage length value
339	+ * @return {boolean}
340	+ */
341	+ isPercentage: function() {
342	+ return this.getUnit() === '%';
343	+ },
344	+
345	+ /**
346	+ * Resolve this length into a number of pixels.
347	+ * @param {Element} el - the context element, used to resolve font-relative values
348	+ * @param {(function():number\|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
349	+ * function which will be called to return the number.
350	+ */
351	+ pixels: function( el, pct100 ) {
352	+ var num = this.getNumber(),
353	+ unit = this.getUnit();
354	+ switch( unit ) {
355	+ case "px":
356	+ return num;
357	+ case "%":
358	+ return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
359	+ case "em":
360	+ return num * this.getEmPixels( el );
361	+ case "ex":
362	+ return num * this.getEmPixels( el ) / 2;
363	+ default:
364	+ return num * conversions[ unit ];
365	+ }
366	+ },
367	+
368	+ /**
369	+ * The em and ex units are relative to the font-size of the current element,
370	+ * however if the font-size is set using non-pixel units then we get that value
371	+ * rather than a pixel conversion. To get around this, we keep a floating element
372	+ * with width:1em which we insert into the target element and then read its offsetWidth.
373	+ * But if the font-size is specified in pixels, then we use that directly to avoid
374	+ * the expensive DOM manipulation.
375	+ * @param el
376	+ */
377	+ getEmPixels: function( el ) {
378	+ var fs = el.currentStyle.fontSize,
379	+ px;
380	+
381	+ if( fs.indexOf( 'px' ) > 0 ) {
382	+ return parseFloat( fs );
383	+ } else {
384	+ lengthCalcEl.style.width = '1em';
385	+ el.appendChild( lengthCalcEl );
386	+ px = lengthCalcEl.offsetWidth;
387	+ if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
388	+ el.removeChild( lengthCalcEl );
389	+ }
390	+ return px;
391	+ }
392	+ }
393	+ };
394	+
395	+
396	+ /**
397	+ * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
398	+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
399	+ * been validated as a valid length or percentage syntax.
400	+ */
401	+ PIE.getLength = function( val ) {
402	+ return instances[ val ] \|\| ( instances[ val ] = new Length( val ) );
403	+ };
404	+
405	+ return Length;
406	+ })();
407	+ /**
408	+ * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
409	+ * @constructor
410	+ * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
411	+ */
412	+ PIE.BgPosition = (function() {
413	+
414	+ var length_fifty = PIE.getLength( '50%' ),
415	+ vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
416	+ horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
417	+
418	+
419	+ function BgPosition( tokens ) {
420	+ this.tokens = tokens;
421	+ }
422	+ BgPosition.prototype = {
423	+ /**
424	+ * Normalize the values into the form:
425	+ * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
426	+ * where: xOffsetSide is either 'left' or 'right',
427	+ * yOffsetSide is either 'top' or 'bottom',
428	+ * and x/yOffsetLength are both PIE.Length objects.
429	+ * @return {Array}
430	+ */
431	+ getValues: function() {
432	+ if( !this._values ) {
433	+ var tokens = this.tokens,
434	+ len = tokens.length,
435	+ Tokenizer = PIE.Tokenizer,
436	+ identType = Tokenizer.Type,
437	+ length_zero = PIE.getLength( '0' ),
438	+ type_ident = identType.IDENT,
439	+ type_length = identType.LENGTH,
440	+ type_percent = identType.PERCENT,
441	+ type, value,
442	+ vals = [ 'left', length_zero, 'top', length_zero ];
443	+
444	+ // If only one value, the second is assumed to be 'center'
445	+ if( len === 1 ) {
446	+ tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
447	+ len++;
448	+ }
449	+
450	+ // Two values - CSS2
451	+ if( len === 2 ) {
452	+ // If both idents, they can appear in either order, so switch them if needed
453	+ if( type_ident & ( tokens[0].tokenType \| tokens[1].tokenType ) &&
454	+ tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
455	+ tokens.push( tokens.shift() );
456	+ }
457	+ if( tokens[0].tokenType & type_ident ) {
458	+ if( tokens[0].tokenValue === 'center' ) {
459	+ vals[1] = length_fifty;
460	+ } else {
461	+ vals[0] = tokens[0].tokenValue;
462	+ }
463	+ }
464	+ else if( tokens[0].isLengthOrPercent() ) {
465	+ vals[1] = PIE.getLength( tokens[0].tokenValue );
466	+ }
467	+ if( tokens[1].tokenType & type_ident ) {
468	+ if( tokens[1].tokenValue === 'center' ) {
469	+ vals[3] = length_fifty;
470	+ } else {
471	+ vals[2] = tokens[1].tokenValue;
472	+ }
473	+ }
474	+ else if( tokens[1].isLengthOrPercent() ) {
475	+ vals[3] = PIE.getLength( tokens[1].tokenValue );
476	+ }
477	+ }
478	+
479	+ // Three or four values - CSS3
480	+ else {
481	+ // TODO
482	+ }
483	+
484	+ this._values = vals;
485	+ }
486	+ return this._values;
487	+ },
488	+
489	+ /**
490	+ * Find the coordinates of the background image from the upper-left corner of the background area.
491	+ * Note that these coordinate values are not rounded.
492	+ * @param {Element} el
493	+ * @param {number} width - the width for percentages (background area width minus image width)
494	+ * @param {number} height - the height for percentages (background area height minus image height)
495	+ * @return {Object} { x: Number, y: Number }
496	+ */
497	+ coords: function( el, width, height ) {
498	+ var vals = this.getValues(),
499	+ pxX = vals[1].pixels( el, width ),
500	+ pxY = vals[3].pixels( el, height );
501	+
502	+ return {
503	+ x: vals[0] === 'right' ? width - pxX : pxX,
504	+ y: vals[2] === 'bottom' ? height - pxY : pxY
505	+ };
506	+ }
507	+ };
508	+
509	+ return BgPosition;
510	+ })();
511	+ /**
512	+ * Wrapper for angle values; handles conversion to degrees from all allowed angle units
513	+ * @constructor
514	+ * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
515	+ */
516	+ PIE.Angle = (function() {
517	+ function Angle( val ) {
518	+ this.val = val;
519	+ }
520	+ Angle.prototype = {
521	+ unitRE: /[a-z]+$/i,
522	+
523	+ /**
524	+ * @return {string} The unit of the angle value
525	+ */
526	+ getUnit: function() {
527	+ return this._unit \|\| ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
528	+ },
529	+
530	+ /**
531	+ * Get the numeric value of the angle in degrees.
532	+ * @return {number} The degrees value
533	+ */
534	+ degrees: function() {
535	+ var deg = this._deg, u, n;
536	+ if( deg === undefined ) {
537	+ u = this.getUnit();
538	+ n = parseFloat( this.val, 10 );
539	+ deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
540	+ }
541	+ return deg;
542	+ }
543	+ };
544	+
545	+ return Angle;
546	+ })();/**
547	+ * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
548	+ * value is returned from PIE.getColor() - always use that instead of instantiating directly.
549	+ * @constructor
550	+ * @param {string} val The raw CSS string value for the color
551	+ */
552	+ PIE.Color = (function() {
553	+ var instances = {};
554	+
555	+ function Color( val ) {
556	+ this.val = val;
557	+ }
558	+
559	+ /**
560	+ * Regular expression for matching rgba colors and extracting their components
561	+ * @type {RegExp}
562	+ */
563	+ Color.rgbaRE = /\srgba$\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d+\|\d\.\d+)\s$\s*/;
564	+
565	+ Color.names = {
566	+ "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
567	+ "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
568	+ "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
569	+ "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
570	+ "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
571	+ "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
572	+ "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
573	+ "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
574	+ "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
575	+ "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
576	+ "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
577	+ "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
578	+ "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
579	+ "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
580	+ "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
581	+ "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
582	+ "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
583	+ "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
584	+ "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
585	+ "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
586	+ "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
587	+ "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
588	+ "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
589	+ "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
590	+ "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
591	+ "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
592	+ "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
593	+ "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
594	+ "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
595	+ "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
596	+ "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
597	+ "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
598	+ "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
599	+ "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
600	+ "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
601	+ "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
602	+ "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
603	+ "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
604	+ "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
605	+ "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
606	+ "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
607	+ "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
608	+ "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
609	+ "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
610	+ "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
611	+ "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
612	+ "yellow":"FF0", "yellowgreen":"9ACD32"
613	+ };
614	+
615	+ Color.prototype = {
616	+ /**
617	+ * @private
618	+ */
619	+ parse: function() {
620	+ if( !this._color ) {
621	+ var me = this,
622	+ v = me.val,
623	+ vLower,
624	+ m = v.match( Color.rgbaRE );
625	+ if( m ) {
626	+ me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
627	+ me._alpha = parseFloat( m[4] );
628	+ }
629	+ else {
630	+ if( ( vLower = v.toLowerCase() ) in Color.names ) {
631	+ v = '#' + Color.names[vLower];
632	+ }
633	+ me._color = v;
634	+ me._alpha = ( v === 'transparent' ? 0 : 1 );
635	+ }
636	+ }
637	+ },
638	+
639	+ /**
640	+ * Retrieve the value of the color in a format usable by IE natively. This will be the same as
641	+ * the raw input value, except for rgba values which will be converted to an rgb value.
642	+ * @param {Element} el The context element, used to get 'currentColor' keyword value.
643	+ * @return {string} Color value
644	+ */
645	+ colorValue: function( el ) {
646	+ this.parse();
647	+ return this._color === 'currentColor' ? el.currentStyle.color : this._color;
648	+ },
649	+
650	+ /**
651	+ * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
652	+ * with an alpha component.
653	+ * @return {number} The alpha value, from 0 to 1.
654	+ */
655	+ alpha: function() {
656	+ this.parse();
657	+ return this._alpha;
658	+ }
659	+ };
660	+
661	+
662	+ /**
663	+ * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
664	+ * @param {string} val The CSS string representing the color. It is assumed that this will already have
665	+ * been validated as a valid color syntax.
666	+ */
667	+ PIE.getColor = function(val) {
668	+ return instances[ val ] \|\| ( instances[ val ] = new Color( val ) );
669	+ };
670	+
671	+ return Color;
672	+ })();/**
673	+ * A tokenizer for CSS value strings.
674	+ * @constructor
675	+ * @param {string} css The CSS value string
676	+ */
677	+ PIE.Tokenizer = (function() {
678	+ function Tokenizer( css ) {
679	+ this.css = css;
680	+ this.ch = 0;
681	+ this.tokens = [];
682	+ this.tokenIndex = 0;
683	+ }
684	+
685	+ /**
686	+ * Enumeration of token type constants.
687	+ * @enum {number}
688	+ */
689	+ var Type = Tokenizer.Type = {
690	+ ANGLE: 1,
691	+ CHARACTER: 2,
692	+ COLOR: 4,
693	+ DIMEN: 8,
694	+ FUNCTION: 16,
695	+ IDENT: 32,
696	+ LENGTH: 64,
697	+ NUMBER: 128,
698	+ OPERATOR: 256,
699	+ PERCENT: 512,
700	+ STRING: 1024,
701	+ URL: 2048
702	+ };
703	+
704	+ /**
705	+ * A single token
706	+ * @constructor
707	+ * @param {number} type The type of the token - see PIE.Tokenizer.Type
708	+ * @param {string} value The value of the token
709	+ */
710	+ Tokenizer.Token = function( type, value ) {
711	+ this.tokenType = type;
712	+ this.tokenValue = value;
713	+ };
714	+ Tokenizer.Token.prototype = {
715	+ isLength: function() {
716	+ return this.tokenType & Type.LENGTH \|\| ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
717	+ },
718	+ isLengthOrPercent: function() {
719	+ return this.isLength() \|\| this.tokenType & Type.PERCENT;
720	+ }
721	+ };
722	+
723	+ Tokenizer.prototype = {
724	+ whitespace: /\s/,
725	+ number: /^[\+\-]?(\d*\.)?\d+/,
726	+ url: /^url$\s("([^"])"\|'([^'])'\|([!#$%&-~]))\s$/i,
727	+ ident: /^\-?[_a-z][\w-]*/i,
728	+ string: /^("([^"])"\|'([^'])')/,
729	+ operator: /^[\/,]/,
730	+ hash: /^#[\w]+/,
731	+ hashColor: /^#([\da-f]{6}\|[\da-f]{3})/i,
732	+
733	+ unitTypes: {
734	+ 'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
735	+ 'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
736	+ 'pt': Type.LENGTH, 'pc': Type.LENGTH,
737	+ 'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
738	+ },
739	+
740	+ colorNames: {
741	+ 'aqua':1, 'black':1, 'blue':1, 'fuchsia':1, 'gray':1, 'green':1, 'lime':1, 'maroon':1,
742	+ 'navy':1, 'olive':1, 'purple':1, 'red':1, 'silver':1, 'teal':1, 'white':1, 'yellow': 1,
743	+ 'currentColor': 1
744	+ },
745	+
746	+ colorFunctions: {
747	+ 'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
748	+ },
749	+
750	+
751	+ /**
752	+ * Advance to and return the next token in the CSS string. If the end of the CSS string has
753	+ * been reached, null will be returned.
754	+ * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
755	+ * @return {PIE.Tokenizer.Token}
756	+ */
757	+ next: function( forget ) {
758	+ var css, ch, firstChar, match, val,
759	+ me = this;
760	+
761	+ function newToken( type, value ) {
762	+ var tok = new Tokenizer.Token( type, value );
763	+ if( !forget ) {
764	+ me.tokens.push( tok );
765	+ me.tokenIndex++;
766	+ }
767	+ return tok;
768	+ }
769	+ function failure() {
770	+ me.tokenIndex++;
771	+ return null;
772	+ }
773	+
774	+ // In case we previously backed up, return the stored token in the next slot
775	+ if( this.tokenIndex < this.tokens.length ) {
776	+ return this.tokens[ this.tokenIndex++ ];
777	+ }
778	+
779	+ // Move past leading whitespace characters
780	+ while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
781	+ this.ch++;
782	+ }
783	+ if( this.ch >= this.css.length ) {
784	+ return failure();
785	+ }
786	+
787	+ ch = this.ch;
788	+ css = this.css.substring( this.ch );
789	+ firstChar = css.charAt( 0 );
790	+ switch( firstChar ) {
791	+ case '#':
792	+ if( match = css.match( this.hashColor ) ) {
793	+ this.ch += match[0].length;
794	+ return newToken( Type.COLOR, match[0] );
795	+ }
796	+ break;
797	+
798	+ case '"':
799	+ case "'":
800	+ if( match = css.match( this.string ) ) {
801	+ this.ch += match[0].length;
802	+ return newToken( Type.STRING, match[2] \|\| match[3] \|\| '' );
803	+ }
804	+ break;
805	+
806	+ case "/":
807	+ case ",":
808	+ this.ch++;
809	+ return newToken( Type.OPERATOR, firstChar );
810	+
811	+ case 'u':
812	+ if( match = css.match( this.url ) ) {
813	+ this.ch += match[0].length;
814	+ return newToken( Type.URL, match[2] \|\| match[3] \|\| match[4] \|\| '' );
815	+ }
816	+ }
817	+
818	+ // Numbers and values starting with numbers
819	+ if( match = css.match( this.number ) ) {
820	+ val = match[0];
821	+ this.ch += val.length;
822	+
823	+ // Check if it is followed by a unit
824	+ if( css.charAt( val.length ) === '%' ) {
825	+ this.ch++;
826	+ return newToken( Type.PERCENT, val + '%' );
827	+ }
828	+ if( match = css.substring( val.length ).match( this.ident ) ) {
829	+ val += match[0];
830	+ this.ch += match[0].length;
831	+ return newToken( this.unitTypes[ match[0].toLowerCase() ] \|\| Type.DIMEN, val );
832	+ }
833	+
834	+ // Plain ol' number
835	+ return newToken( Type.NUMBER, val );
836	+ }
837	+
838	+ // Identifiers
839	+ if( match = css.match( this.ident ) ) {
840	+ val = match[0];
841	+ this.ch += val.length;
842	+
843	+ // Named colors
844	+ if( val.toLowerCase() in PIE.Color.names \|\| val === 'currentColor' ) {
845	+ return newToken( Type.COLOR, val );
846	+ }
847	+
848	+ // Functions
849	+ if( css.charAt( val.length ) === '(' ) {
850	+ this.ch++;
851	+
852	+ // Color values in function format: rgb, rgba, hsl, hsla
853	+ if( val.toLowerCase() in this.colorFunctions ) {
854	+ function isNum( tok ) {
855	+ return tok && tok.tokenType & Type.NUMBER;
856	+ }
857	+ function isNumOrPct( tok ) {
858	+ return tok && ( tok.tokenType & ( Type.NUMBER \| Type.PERCENT ) );
859	+ }
860	+ function isValue( tok, val ) {
861	+ return tok && tok.tokenValue === val;
862	+ }
863	+ function next() {
864	+ return me.next( 1 );
865	+ }
866	+
867	+ if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
868	+ isValue( next(), ',' ) &&
869	+ isNumOrPct( next() ) &&
870	+ isValue( next(), ',' ) &&
871	+ isNumOrPct( next() ) &&
872	+ ( val === 'rgb' \|\| val === 'hsa' \|\| (
873	+ isValue( next(), ',' ) &&
874	+ isNum( next() )
875	+ ) ) &&
876	+ isValue( next(), ')' ) ) {
877	+ return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
878	+ }
879	+ return failure();
880	+ }
881	+
882	+ return newToken( Type.FUNCTION, val );
883	+ }
884	+
885	+ // Other identifier
886	+ return newToken( Type.IDENT, val );
887	+ }
888	+
889	+ // Standalone character
890	+ this.ch++;
891	+ return newToken( Type.CHARACTER, firstChar );
892	+ },
893	+
894	+ /**
895	+ * Determine whether there is another token
896	+ * @return {boolean}
897	+ */
898	+ hasNext: function() {
899	+ var next = this.next();
900	+ this.prev();
901	+ return !!next;
902	+ },
903	+
904	+ /**
905	+ * Back up and return the previous token
906	+ * @return {PIE.Tokenizer.Token}
907	+ */
908	+ prev: function() {
909	+ return this.tokens[ this.tokenIndex-- - 2 ];
910	+ },
911	+
912	+ /**
913	+ * Retrieve all the tokens in the CSS string
914	+ * @return {Array.<PIE.Tokenizer.Token>}
915	+ */
916	+ all: function() {
917	+ while( this.next() ) {}
918	+ return this.tokens;
919	+ },
920	+
921	+ /**
922	+ * Return a list of tokens from the current position until the given function returns
923	+ * true. The final token will not be included in the list.
924	+ * @param {function():boolean} func - test function
925	+ * @param {boolean} require - if true, then if the end of the CSS string is reached
926	+ * before the test function returns true, null will be returned instead of the
927	+ * tokens that have been found so far.
928	+ * @return {Array.<PIE.Tokenizer.Token>}
929	+ */
930	+ until: function( func, require ) {
931	+ var list = [], t, hit;
932	+ while( t = this.next() ) {
933	+ if( func( t ) ) {
934	+ hit = true;
935	+ this.prev();
936	+ break;
937	+ }
938	+ list.push( t );
939	+ }
940	+ return require && !hit ? null : list;
941	+ }
942	+ };
943	+
944	+ return Tokenizer;
945	+ })();/**
946	+ * Handles calculating, caching, and detecting changes to size and position of the element.
947	+ * @constructor
948	+ * @param {Element} el the target element
949	+ */
950	+ PIE.BoundsInfo = function( el ) {
951	+ this.targetElement = el;
952	+ };
953	+ PIE.BoundsInfo.prototype = {
954	+
955	+ _locked: 0,
956	+
957	+ positionChanged: function() {
958	+ var last = this._lastBounds,
959	+ bounds;
960	+ return !last \|\| ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x \|\| last.y !== bounds.y ) );
961	+ },
962	+
963	+ sizeChanged: function() {
964	+ var last = this._lastBounds,
965	+ bounds;
966	+ return !last \|\| ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w \|\| last.h !== bounds.h ) );
967	+ },
968	+
969	+ getLiveBounds: function() {
970	+ var rect = this.targetElement.getBoundingClientRect();
971	+ return {
972	+ x: rect.left,
973	+ y: rect.top,
974	+ w: rect.right - rect.left,
975	+ h: rect.bottom - rect.top
976	+ };
977	+ },
978	+
979	+ getBounds: function() {
980	+ return this._locked ?
981	+ ( this._lockedBounds \|\| ( this._lockedBounds = this.getLiveBounds() ) ) :
982	+ this.getLiveBounds();
983	+ },
984	+
985	+ hasBeenQueried: function() {
986	+ return !!this._lastBounds;
987	+ },
988	+
989	+ lock: function() {
990	+ ++this._locked;
991	+ },
992	+
993	+ unlock: function() {
994	+ if( !--this._locked ) {
995	+ if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
996	+ this._lockedBounds = null;
997	+ }
998	+ }
999	+
1000	+ };
1001	+ (function() {
1002	+
1003	+ function cacheWhenLocked( fn ) {
1004	+ var uid = PIE.Util.getUID( fn );
1005	+ return function() {
1006	+ if( this._locked ) {
1007	+ var cache = this._lockedValues \|\| ( this._lockedValues = {} );
1008	+ return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
1009	+ } else {
1010	+ return fn.call( this );
1011	+ }
1012	+ }
1013	+ }
1014	+
1015	+
1016	+ PIE.StyleInfoBase = {
1017	+
1018	+ _locked: 0,
1019	+
1020	+ /**
1021	+ * Create a new StyleInfo class, with the standard constructor, and augmented by
1022	+ * the StyleInfoBase's members.
1023	+ * @param proto
1024	+ */
1025	+ newStyleInfo: function( proto ) {
1026	+ function StyleInfo( el ) {
1027	+ this.targetElement = el;
1028	+ }
1029	+ PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
1030	+ StyleInfo._propsCache = {};
1031	+ return StyleInfo;
1032	+ },
1033	+
1034	+ /**
1035	+ * Get an object representation of the target CSS style, caching it for each unique
1036	+ * CSS value string.
1037	+ * @return {Object}
1038	+ */
1039	+ getProps: function() {
1040	+ var css = this.getCss(),
1041	+ cache = this.constructor._propsCache;
1042	+ return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
1043	+ },
1044	+
1045	+ /**
1046	+ * Get the raw CSS value for the target style
1047	+ * @return {string}
1048	+ */
1049	+ getCss: cacheWhenLocked( function() {
1050	+ var el = this.targetElement,
1051	+ ctor = this.constructor,
1052	+ s = el.style,
1053	+ cs = el.currentStyle,
1054	+ cssProp = this.cssProperty,
1055	+ styleProp = this.styleProperty,
1056	+ prefixedCssProp = ctor._prefixedCssProp \|\| ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
1057	+ prefixedStyleProp = ctor._prefixedStyleProp \|\| ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
1058	+ return s[ prefixedStyleProp ] \|\| cs.getAttribute( prefixedCssProp ) \|\| s[ styleProp ] \|\| cs.getAttribute( cssProp );
1059	+ } ),
1060	+
1061	+ /**
1062	+ * Determine whether the target CSS style is active.
1063	+ * @return {boolean}
1064	+ */
1065	+ isActive: cacheWhenLocked( function() {
1066	+ return !!this.getProps();
1067	+ } ),
1068	+
1069	+ /**
1070	+ * Determine whether the target CSS style has changed since the last time it was used.
1071	+ * @return {boolean}
1072	+ */
1073	+ changed: cacheWhenLocked( function() {
1074	+ var currentCss = this.getCss(),
1075	+ changed = currentCss !== this._lastCss;
1076	+ this._lastCss = currentCss;
1077	+ return changed;
1078	+ } ),
1079	+
1080	+ cacheWhenLocked: cacheWhenLocked,
1081	+
1082	+ lock: function() {
1083	+ ++this._locked;
1084	+ },
1085	+
1086	+ unlock: function() {
1087	+ if( !--this._locked ) {
1088	+ delete this._lockedValues;
1089	+ }
1090	+ }
1091	+ };
1092	+
1093	+ })();/**
1094	+ * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
1095	+ * @constructor
1096	+ * @param {Element} el the target element
1097	+ */
1098	+ PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1099	+
1100	+ cssProperty: PIE.CSS_PREFIX + 'background',
1101	+ styleProperty: PIE.STYLE_PREFIX + 'Background',
1102	+
1103	+ attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
1104	+ repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
1105	+ originIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
1106	+ clipIdents: { 'padding-box':1, 'border-box':1 },
1107	+ positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
1108	+ sizeIdents: { 'contain':1, 'cover':1 },
1109	+
1110	+ /**
1111	+ * For background styles, we support the -pie-background property but fall back to the standard
1112	+ * backround* properties. The reason we have to use the prefixed version is that IE natively
1113	+ * parses the standard properties and if it sees something it doesn't know how to parse, for example
1114	+ * multiple values or gradient definitions, it will throw that away and not make it available through
1115	+ * currentStyle.
1116	+ *
1117	+ * Format of return object:
1118	+ * {
1119	+ * color: <PIE.Color>,
1120	+ * bgImages: [
1121	+ * {
1122	+ * imgType: 'image',
1123	+ * imgUrl: 'image.png',
1124	+ * imgRepeat: <'no-repeat' \| 'repeat-x' \| 'repeat-y' \| 'repeat'>,
1125	+ * bgPosition: <PIE.BgPosition>,
1126	+ * attachment: <'scroll' \| 'fixed' \| 'local'>,
1127	+ * bgOrigin: <'border-box' \| 'padding-box' \| 'content-box'>,
1128	+ * clip: <'border-box' \| 'padding-box'>,
1129	+ * size: <'contain' \| 'cover' \| { w: <'auto' \| PIE.Length>, h: <'auto' \| PIE.Length> }>
1130	+ * },
1131	+ * {
1132	+ * imgType: 'linear-gradient',
1133	+ * gradientStart: <PIE.BgPosition>,
1134	+ * angle: <PIE.Angle>,
1135	+ * stops: [
1136	+ * { color: <PIE.Color>, offset: <PIE.Length> },
1137	+ * { color: <PIE.Color>, offset: <PIE.Length> }, ...
1138	+ * ]
1139	+ * }
1140	+ * ]
1141	+ * }
1142	+ * @param {String} css
1143	+ * @override
1144	+ */
1145	+ parseCss: function( css ) {
1146	+ var el = this.targetElement,
1147	+ cs = el.currentStyle,
1148	+ tokenizer, token, image,
1149	+ tok_type = PIE.Tokenizer.Type,
1150	+ type_operator = tok_type.OPERATOR,
1151	+ type_ident = tok_type.IDENT,
1152	+ type_color = tok_type.COLOR,
1153	+ tokType, tokVal,
1154	+ positionIdents = this.positionIdents,
1155	+ gradient, stop,
1156	+ props = null;
1157	+
1158	+ function isBgPosToken( token ) {
1159	+ return token.isLengthOrPercent() \|\| ( token.tokenType & type_ident && token.tokenValue in positionIdents );
1160	+ }
1161	+
1162	+ function sizeToken( token ) {
1163	+ return ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) \|\| ( token.tokenValue === 'auto' && 'auto' );
1164	+ }
1165	+
1166	+ // If the CSS3-specific -pie-background property is present, parse it
1167	+ if( this.getCss3() ) {
1168	+ tokenizer = new PIE.Tokenizer( css );
1169	+ props = { bgImages: [] };
1170	+ image = {};
1171	+
1172	+ while( token = tokenizer.next() ) {
1173	+ tokType = token.tokenType;
1174	+ tokVal = token.tokenValue;
1175	+
1176	+ if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
1177	+ gradient = { stops: [], imgType: tokVal };
1178	+ stop = {};
1179	+ while( token = tokenizer.next() ) {
1180	+ tokType = token.tokenType;
1181	+ tokVal = token.tokenValue;
1182	+
1183	+ // If we reached the end of the function and had at least 2 stops, flush the info
1184	+ if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
1185	+ if( stop.color ) {
1186	+ gradient.stops.push( stop );
1187	+ }
1188	+ if( gradient.stops.length > 1 ) {
1189	+ PIE.Util.merge( image, gradient );
1190	+ }
1191	+ break;
1192	+ }
1193	+
1194	+ // Color stop - must start with color
1195	+ if( tokType & type_color ) {
1196	+ // if we already have an angle/position, make sure that the previous token was a comma
1197	+ if( gradient.angle \|\| gradient.gradientStart ) {
1198	+ token = tokenizer.prev();
1199	+ if( token.tokenType !== type_operator ) {
1200	+ break; //fail
1201	+ }
1202	+ tokenizer.next();
1203	+ }
1204	+
1205	+ stop = {
1206	+ color: PIE.getColor( tokVal )
1207	+ };
1208	+ // check for offset following color
1209	+ token = tokenizer.next();
1210	+ if( token.isLengthOrPercent() ) {
1211	+ stop.offset = PIE.getLength( token.tokenValue );
1212	+ } else {
1213	+ tokenizer.prev();
1214	+ }
1215	+ }
1216	+ // Angle - can only appear in first spot
1217	+ else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
1218	+ gradient.angle = new PIE.Angle( token.tokenValue );
1219	+ }
1220	+ else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
1221	+ tokenizer.prev();
1222	+ gradient.gradientStart = new PIE.BgPosition(
1223	+ tokenizer.until( function( t ) {
1224	+ return !isBgPosToken( t );
1225	+ }, false )
1226	+ );
1227	+ }
1228	+ else if( tokType & type_operator && tokVal === ',' ) {
1229	+ if( stop.color ) {
1230	+ gradient.stops.push( stop );
1231	+ stop = {};
1232	+ }
1233	+ }
1234	+ else {
1235	+ // Found something we didn't recognize; fail without adding image
1236	+ break;
1237	+ }
1238	+ }
1239	+ }
1240	+ else if( !image.imgType && tokType & tok_type.URL ) {
1241	+ image.imgUrl = tokVal;
1242	+ image.imgType = 'image';
1243	+ }
1244	+ else if( isBgPosToken( token ) && !image.size ) {
1245	+ tokenizer.prev();
1246	+ image.bgPosition = new PIE.BgPosition(
1247	+ tokenizer.until( function( t ) {
1248	+ return !isBgPosToken( t );
1249	+ }, false )
1250	+ );
1251	+ }
1252	+ else if( tokType & type_ident ) {
1253	+ if( tokVal in this.repeatIdents ) {
1254	+ image.imgRepeat = tokVal;
1255	+ }
1256	+ else if( tokVal in this.originIdents ) {
1257	+ image.bgOrigin = tokVal;
1258	+ if( tokVal in this.clipIdents ) {
1259	+ image.clip = tokVal;
1260	+ }
1261	+ }
1262	+ else if( tokVal in this.attachIdents ) {
1263	+ image.attachment = tokVal;
1264	+ }
1265	+ }
1266	+ else if( tokType & type_color && !props.color ) {
1267	+ props.color = PIE.getColor( tokVal );
1268	+ }
1269	+ else if( tokType & type_operator ) {
1270	+ // background size
1271	+ if( tokVal === '/' ) {
1272	+ token = tokenizer.next();
1273	+ tokType = token.tokenType;
1274	+ tokVal = token.tokenValue;
1275	+ if( tokType & type_ident && tokVal in this.sizeIdents ) {
1276	+ image.size = tokVal;
1277	+ }
1278	+ else if( tokVal = sizeToken( token ) ) {
1279	+ image.size = {
1280	+ w: tokVal,
1281	+ h: sizeToken( tokenizer.next() ) \|\| ( tokenizer.prev() && tokVal )
1282	+ };
1283	+ }
1284	+ }
1285	+ // new layer
1286	+ else if( tokVal === ',' && image.imgType ) {
1287	+ props.bgImages.push( image );
1288	+ image = {};
1289	+ }
1290	+ }
1291	+ else {
1292	+ // Found something unrecognized; chuck everything
1293	+ return null;
1294	+ }
1295	+ }
1296	+
1297	+ // leftovers
1298	+ if( image.imgType ) {
1299	+ props.bgImages.push( image );
1300	+ }
1301	+ }
1302	+
1303	+ // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
1304	+ else {
1305	+ this.withActualBg( function() {
1306	+ var posX = cs.backgroundPositionX,
1307	+ posY = cs.backgroundPositionY,
1308	+ img = cs.backgroundImage,
1309	+ color = cs.backgroundColor;
1310	+
1311	+ props = {};
1312	+ if( color !== 'transparent' ) {
1313	+ props.color = PIE.getColor( color )
1314	+ }
1315	+ if( img !== 'none' ) {
1316	+ props.bgImages = [ {
1317	+ imgType: 'image',
1318	+ imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
1319	+ imgRepeat: cs.backgroundRepeat,
1320	+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
1321	+ } ];
1322	+ }
1323	+ } );
1324	+ }
1325	+
1326	+ return ( props && ( props.color \|\| ( props.bgImages && props.bgImages[0] ) ) ) ? props : null;
1327	+ },
1328	+
1329	+ /**
1330	+ * Execute a function with the actual background styles (not overridden with runtimeStyle
1331	+ * properties set by the renderers) available via currentStyle.
1332	+ * @param fn
1333	+ */
1334	+ withActualBg: function( fn ) {
1335	+ var rs = this.targetElement.runtimeStyle,
1336	+ rsImage = rs.backgroundImage,
1337	+ rsColor = rs.backgroundColor,
1338	+ ret;
1339	+
1340	+ if( rsImage ) rs.backgroundImage = '';
1341	+ if( rsColor ) rs.backgroundColor = '';
1342	+
1343	+ ret = fn.call( this );
1344	+
1345	+ if( rsImage ) rs.backgroundImage = rsImage;
1346	+ if( rsColor ) rs.backgroundColor = rsColor;
1347	+
1348	+ return ret;
1349	+ },
1350	+
1351	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1352	+ return this.getCss3() \|\|
1353	+ this.withActualBg( function() {
1354	+ var cs = this.targetElement.currentStyle;
1355	+ return cs.backgroundColor + ' ' + cs.backgroundImage + ' ' + cs.backgroundRepeat + ' ' +
1356	+ cs.backgroundPositionX + ' ' + cs.backgroundPositionY;
1357	+ } );
1358	+ } ),
1359	+
1360	+ getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
1361	+ var el = this.targetElement;
1362	+ return el.style[ this.styleProperty ] \|\| el.currentStyle.getAttribute( this.cssProperty );
1363	+ } ),
1364	+
1365	+ /**
1366	+ * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
1367	+ */
1368	+ isPngFix: function() {
1369	+ var val = 0, el;
1370	+ if( PIE.ieVersion < 7 ) {
1371	+ el = this.targetElement;
1372	+ val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] \|\| el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
1373	+ }
1374	+ return val;
1375	+ },
1376	+
1377	+ /**
1378	+ * The isActive logic is slightly different, because getProps() always returns an object
1379	+ * even if it is just falling back to the native background properties. But we only want
1380	+ * to report is as being "active" if either the -pie-background override property is present
1381	+ * and parses successfully or '-pie-png-fix' is set to true in IE6.
1382	+ */
1383	+ isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
1384	+ return (this.getCss3() \|\| this.isPngFix()) && !!this.getProps();
1385	+ } )
1386	+
1387	+ } );/**
1388	+ * Handles parsing, caching, and detecting changes to border CSS
1389	+ * @constructor
1390	+ * @param {Element} el the target element
1391	+ */
1392	+ PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1393	+
1394	+ sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
1395	+ namedWidths: {
1396	+ 'thin': '1px',
1397	+ 'medium': '3px',
1398	+ 'thick': '5px'
1399	+ },
1400	+
1401	+ parseCss: function( css ) {
1402	+ var w = {},
1403	+ s = {},
1404	+ c = {},
1405	+ active = false,
1406	+ colorsSame = true,
1407	+ stylesSame = true,
1408	+ widthsSame = true;
1409	+
1410	+ this.withActualBorder( function() {
1411	+ var el = this.targetElement,
1412	+ cs = el.currentStyle,
1413	+ i = 0,
1414	+ style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
1415	+ for( ; i < 4; i++ ) {
1416	+ side = this.sides[ i ];
1417	+
1418	+ ltr = side.charAt(0).toLowerCase();
1419	+ style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
1420	+ color = cs[ 'border' + side + 'Color' ];
1421	+ width = cs[ 'border' + side + 'Width' ];
1422	+
1423	+ if( i > 0 ) {
1424	+ if( style !== lastStyle ) { stylesSame = false; }
1425	+ if( color !== lastColor ) { colorsSame = false; }
1426	+ if( width !== lastWidth ) { widthsSame = false; }
1427	+ }
1428	+ lastStyle = style;
1429	+ lastColor = color;
1430	+ lastWidth = width;
1431	+
1432	+ c[ ltr ] = PIE.getColor( color );
1433	+
1434	+ width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] \|\| width ) );
1435	+ if( width.pixels( this.targetElement ) > 0 ) {
1436	+ active = true;
1437	+ }
1438	+ }
1439	+ } );
1440	+
1441	+ return active ? {
1442	+ widths: w,
1443	+ styles: s,
1444	+ colors: c,
1445	+ widthsSame: widthsSame,
1446	+ colorsSame: colorsSame,
1447	+ stylesSame: stylesSame
1448	+ } : null;
1449	+ },
1450	+
1451	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1452	+ var el = this.targetElement,
1453	+ cs = el.currentStyle,
1454	+ css;
1455	+
1456	+ // Don't redraw or hide borders for cells in border-collapse:collapse tables
1457	+ if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
1458	+ this.withActualBorder( function() {
1459	+ css = cs.borderWidth + '\|' + cs.borderStyle + '\|' + cs.borderColor;
1460	+ } );
1461	+ }
1462	+ return css;
1463	+ } ),
1464	+
1465	+ /**
1466	+ * Execute a function with the actual border styles (not overridden with runtimeStyle
1467	+ * properties set by the renderers) available via currentStyle.
1468	+ * @param fn
1469	+ */
1470	+ withActualBorder: function( fn ) {
1471	+ var rs = this.targetElement.runtimeStyle,
1472	+ rsWidth = rs.borderWidth,
1473	+ rsColor = rs.borderColor,
1474	+ ret;
1475	+
1476	+ if( rsWidth ) rs.borderWidth = '';
1477	+ if( rsColor ) rs.borderColor = '';
1478	+
1479	+ ret = fn.call( this );
1480	+
1481	+ if( rsWidth ) rs.borderWidth = rsWidth;
1482	+ if( rsColor ) rs.borderColor = rsColor;
1483	+
1484	+ return ret;
1485	+ }
1486	+
1487	+ } );
1488	+ /**
1489	+ * Handles parsing, caching, and detecting changes to border-radius CSS
1490	+ * @constructor
1491	+ * @param {Element} el the target element
1492	+ */
1493	+ (function() {
1494	+
1495	+ PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1496	+
1497	+ cssProperty: 'border-radius',
1498	+ styleProperty: 'borderRadius',
1499	+
1500	+ parseCss: function( css ) {
1501	+ var p = null, x, y,
1502	+ tokenizer, token, length,
1503	+ hasNonZero = false;
1504	+
1505	+ if( css ) {
1506	+ tokenizer = new PIE.Tokenizer( css );
1507	+
1508	+ function collectLengths() {
1509	+ var arr = [], num;
1510	+ while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
1511	+ length = PIE.getLength( token.tokenValue );
1512	+ num = length.getNumber();
1513	+ if( num < 0 ) {
1514	+ return null;
1515	+ }
1516	+ if( num > 0 ) {
1517	+ hasNonZero = true;
1518	+ }
1519	+ arr.push( length );
1520	+ }
1521	+ return arr.length > 0 && arr.length < 5 ? {
1522	+ 'tl': arr[0],
1523	+ 'tr': arr[1] \|\| arr[0],
1524	+ 'br': arr[2] \|\| arr[0],
1525	+ 'bl': arr[3] \|\| arr[1] \|\| arr[0]
1526	+ } : null;
1527	+ }
1528	+
1529	+ // Grab the initial sequence of lengths
1530	+ if( x = collectLengths() ) {
1531	+ // See if there is a slash followed by more lengths, for the y-axis radii
1532	+ if( token ) {
1533	+ if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
1534	+ y = collectLengths();
1535	+ }
1536	+ } else {
1537	+ y = x;
1538	+ }
1539	+
1540	+ // Treat all-zero values the same as no value
1541	+ if( hasNonZero && x && y ) {
1542	+ p = { x: x, y : y };
1543	+ }
1544	+ }
1545	+ }
1546	+
1547	+ return p;
1548	+ }
1549	+ } );
1550	+
1551	+ var zero = PIE.getLength( '0' ),
1552	+ zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
1553	+ PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
1554	+
1555	+ })();/**
1556	+ * Handles parsing, caching, and detecting changes to border-image CSS
1557	+ * @constructor
1558	+ * @param {Element} el the target element
1559	+ */
1560	+ PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1561	+
1562	+ cssProperty: 'border-image',
1563	+ styleProperty: 'borderImage',
1564	+
1565	+ repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
1566	+
1567	+ parseCss: function( css ) {
1568	+ var p = null, tokenizer, token, type, value,
1569	+ slices, widths, outsets,
1570	+ slashCount = 0, cs,
1571	+ Type = PIE.Tokenizer.Type,
1572	+ IDENT = Type.IDENT,
1573	+ NUMBER = Type.NUMBER,
1574	+ LENGTH = Type.LENGTH,
1575	+ PERCENT = Type.PERCENT;
1576	+
1577	+ if( css ) {
1578	+ tokenizer = new PIE.Tokenizer( css );
1579	+ p = {};
1580	+
1581	+ function isSlash( token ) {
1582	+ return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
1583	+ }
1584	+
1585	+ function isFillIdent( token ) {
1586	+ return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
1587	+ }
1588	+
1589	+ function collectSlicesEtc() {
1590	+ slices = tokenizer.until( function( tok ) {
1591	+ return !( tok.tokenType & ( NUMBER \| PERCENT ) );
1592	+ } );
1593	+
1594	+ if( isFillIdent( tokenizer.next() ) && !p.fill ) {
1595	+ p.fill = true;
1596	+ } else {
1597	+ tokenizer.prev();
1598	+ }
1599	+
1600	+ if( isSlash( tokenizer.next() ) ) {
1601	+ slashCount++;
1602	+ widths = tokenizer.until( function( tok ) {
1603	+ return !( token.tokenType & ( NUMBER \| PERCENT \| LENGTH ) ) && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
1604	+ } );
1605	+
1606	+ if( isSlash( tokenizer.next() ) ) {
1607	+ slashCount++;
1608	+ outsets = tokenizer.until( function( tok ) {
1609	+ return !( token.tokenType & ( NUMBER \| LENGTH ) );
1610	+ } );
1611	+ }
1612	+ } else {
1613	+ tokenizer.prev();
1614	+ }
1615	+ }
1616	+
1617	+ while( token = tokenizer.next() ) {
1618	+ type = token.tokenType;
1619	+ value = token.tokenValue;
1620	+
1621	+ // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
1622	+ if( type & ( NUMBER \| PERCENT ) && !slices ) {
1623	+ tokenizer.prev();
1624	+ collectSlicesEtc();
1625	+ }
1626	+ else if( isFillIdent( token ) && !p.fill ) {
1627	+ p.fill = true;
1628	+ collectSlicesEtc();
1629	+ }
1630	+
1631	+ // Idents: one or values for 'repeat'
1632	+ else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
1633	+ p.repeat = { h: value };
1634	+ if( token = tokenizer.next() ) {
1635	+ if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
1636	+ p.repeat.v = token.tokenValue;
1637	+ } else {
1638	+ tokenizer.prev();
1639	+ }
1640	+ }
1641	+ }
1642	+
1643	+ // URL of the image
1644	+ else if( ( type & Type.URL ) && !p.src ) {
1645	+ p.src = value;
1646	+ }
1647	+
1648	+ // Found something unrecognized; exit.
1649	+ else {
1650	+ return null;
1651	+ }
1652	+ }
1653	+
1654	+ // Validate what we collected
1655	+ if( !p.src \|\| !slices \|\| slices.length < 1 \|\| slices.length > 4 \|\|
1656	+ ( widths && widths.length > 4 ) \|\| ( slashCount === 1 && widths.length < 1 ) \|\|
1657	+ ( outsets && outsets.length > 4 ) \|\| ( slashCount === 2 && outsets.length < 1 ) ) {
1658	+ return null;
1659	+ }
1660	+
1661	+ // Fill in missing values
1662	+ if( !p.repeat ) {
1663	+ p.repeat = { h: 'stretch' };
1664	+ }
1665	+ if( !p.repeat.v ) {
1666	+ p.repeat.v = p.repeat.h;
1667	+ }
1668	+
1669	+ function distributeSides( tokens, convertFn ) {
1670	+ return {
1671	+ t: convertFn( tokens[0] ),
1672	+ r: convertFn( tokens[1] \|\| tokens[0] ),
1673	+ b: convertFn( tokens[2] \|\| tokens[0] ),
1674	+ l: convertFn( tokens[3] \|\| tokens[1] \|\| tokens[0] )
1675	+ };
1676	+ }
1677	+
1678	+ p.slice = distributeSides( slices, function( tok ) {
1679	+ return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
1680	+ } );
1681	+
1682	+ p.width = widths && widths.length > 0 ?
1683	+ distributeSides( widths, function( tok ) {
1684	+ return tok.tokenType & ( LENGTH \| PERCENT ) ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
1685	+ } ) :
1686	+ ( cs = this.targetElement.currentStyle ) && {
1687	+ t: PIE.getLength( cs.borderTopWidth ),
1688	+ r: PIE.getLength( cs.borderRightWidth ),
1689	+ b: PIE.getLength( cs.borderBottomWidth ),
1690	+ l: PIE.getLength( cs.borderLeftWidth )
1691	+ };
1692	+
1693	+ p.outset = distributeSides( outsets \|\| [ 0 ], function( tok ) {
1694	+ return tok.tokenType & LENGTH ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
1695	+ } );
1696	+ }
1697	+
1698	+ return p;
1699	+ }
1700	+ } );/**
1701	+ * Handles parsing, caching, and detecting changes to box-shadow CSS
1702	+ * @constructor
1703	+ * @param {Element} el the target element
1704	+ */
1705	+ PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1706	+
1707	+ cssProperty: 'box-shadow',
1708	+ styleProperty: 'boxShadow',
1709	+
1710	+ parseCss: function( css ) {
1711	+ var props,
1712	+ getLength = PIE.getLength,
1713	+ Type = PIE.Tokenizer.Type,
1714	+ tokenizer;
1715	+
1716	+ if( css ) {
1717	+ tokenizer = new PIE.Tokenizer( css );
1718	+ props = { outset: [], inset: [] };
1719	+
1720	+ function parseItem() {
1721	+ var token, type, value, color, lengths, inset, len;
1722	+
1723	+ while( token = tokenizer.next() ) {
1724	+ value = token.tokenValue;
1725	+ type = token.tokenType;
1726	+
1727	+ if( type & Type.OPERATOR && value === ',' ) {
1728	+ break;
1729	+ }
1730	+ else if( token.isLength() && !lengths ) {
1731	+ tokenizer.prev();
1732	+ lengths = tokenizer.until( function( token ) {
1733	+ return !token.isLength();
1734	+ } );
1735	+ }
1736	+ else if( type & Type.COLOR && !color ) {
1737	+ color = value;
1738	+ }
1739	+ else if( type & Type.IDENT && value === 'inset' && !inset ) {
1740	+ inset = true;
1741	+ }
1742	+ else { //encountered an unrecognized token; fail.
1743	+ return false;
1744	+ }
1745	+ }
1746	+
1747	+ len = lengths && lengths.length;
1748	+ if( len > 1 && len < 5 ) {
1749	+ ( inset ? props.inset : props.outset ).push( {
1750	+ xOffset: getLength( lengths[0].tokenValue ),
1751	+ yOffset: getLength( lengths[1].tokenValue ),
1752	+ blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
1753	+ spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
1754	+ color: PIE.getColor( color \|\| 'currentColor' )
1755	+ } );
1756	+ return true;
1757	+ }
1758	+ return false;
1759	+ }
1760	+
1761	+ while( parseItem() ) {}
1762	+ }
1763	+
1764	+ return props && ( props.inset.length \|\| props.outset.length ) ? props : null;
1765	+ }
1766	+ } );
1767	+ /**
1768	+ * Retrieves the state of the element's visibility and display
1769	+ * @constructor
1770	+ * @param {Element} el the target element
1771	+ */
1772	+ PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1773	+
1774	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1775	+ var cs = this.targetElement.currentStyle;
1776	+ return cs.visibility + '\|' + cs.display;
1777	+ } ),
1778	+
1779	+ parseCss: function() {
1780	+ var el = this.targetElement,
1781	+ rs = el.runtimeStyle,
1782	+ cs = el.currentStyle,
1783	+ rsVis = rs.visibility,
1784	+ csVis;
1785	+
1786	+ rs.visibility = '';
1787	+ csVis = cs.visibility;
1788	+ rs.visibility = rsVis;
1789	+
1790	+ return {
1791	+ visible: csVis !== 'hidden',
1792	+ displayed: cs.display !== 'none'
1793	+ }
1794	+ },
1795	+
1796	+ /**
1797	+ * Always return false for isActive, since this property alone will not trigger
1798	+ * a renderer to do anything.
1799	+ */
1800	+ isActive: function() {
1801	+ return false;
1802	+ }
1803	+
1804	+ } );
1805	+ PIE.RendererBase = {
1806	+
1807	+ /**
1808	+ * Create a new Renderer class, with the standard constructor, and augmented by
1809	+ * the RendererBase's members.
1810	+ * @param proto
1811	+ */
1812	+ newRenderer: function( proto ) {
1813	+ function Renderer( el, boundsInfo, styleInfos, parent ) {
1814	+ this.targetElement = el;
1815	+ this.boundsInfo = boundsInfo;
1816	+ this.styleInfos = styleInfos;
1817	+ this.parent = parent;
1818	+ }
1819	+ PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
1820	+ return Renderer;
1821	+ },
1822	+
1823	+ /**
1824	+ * Flag indicating the element has already been positioned at least once.
1825	+ * @type {boolean}
1826	+ */
1827	+ isPositioned: false,
1828	+
1829	+ /**
1830	+ * Determine if the renderer needs to be updated
1831	+ * @return {boolean}
1832	+ */
1833	+ needsUpdate: function() {
1834	+ return false;
1835	+ },
1836	+
1837	+ /**
1838	+ * Tell the renderer to update based on modified properties
1839	+ */
1840	+ updateProps: function() {
1841	+ this.destroy();
1842	+ if( this.isActive() ) {
1843	+ this.draw();
1844	+ }
1845	+ },
1846	+
1847	+ /**
1848	+ * Tell the renderer to update based on modified element position
1849	+ */
1850	+ updatePos: function() {
1851	+ this.isPositioned = true;
1852	+ },
1853	+
1854	+ /**
1855	+ * Tell the renderer to update based on modified element dimensions
1856	+ */
1857	+ updateSize: function() {
1858	+ if( this.isActive() ) {
1859	+ this.draw();
1860	+ } else {
1861	+ this.destroy();
1862	+ }
1863	+ },
1864	+
1865	+
1866	+ /**
1867	+ * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
1868	+ * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
1869	+ * So instead we make sure they are inserted into the DOM in the correct order.
1870	+ * @param {number} index
1871	+ * @param {Element} el
1872	+ */
1873	+ addLayer: function( index, el ) {
1874	+ this.removeLayer( index );
1875	+ for( var layers = this._layers \|\| ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
1876	+ layer = layers[i];
1877	+ if( layer ) {
1878	+ break;
1879	+ }
1880	+ }
1881	+ layers[index] = el;
1882	+ this.getBox().insertBefore( el, layer \|\| null );
1883	+ },
1884	+
1885	+ /**
1886	+ * Retrieve a layer element by its index, or null if not present
1887	+ * @param {number} index
1888	+ * @return {Element}
1889	+ */
1890	+ getLayer: function( index ) {
1891	+ var layers = this._layers;
1892	+ return layers && layers[index] \|\| null;
1893	+ },
1894	+
1895	+ /**
1896	+ * Remove a layer element by its index
1897	+ * @param {number} index
1898	+ */
1899	+ removeLayer: function( index ) {
1900	+ var layer = this.getLayer( index ),
1901	+ box = this._box;
1902	+ if( layer && box ) {
1903	+ box.removeChild( layer );
1904	+ this._layers[index] = null;
1905	+ }
1906	+ },
1907	+
1908	+
1909	+ /**
1910	+ * Get a VML shape by name, creating it if necessary.
1911	+ * @param {string} name A name identifying the element
1912	+ * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
1913	+ * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
1914	+ * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
1915	+ * using container elements in the correct order, to get correct z stacking without z-index.
1916	+ */
1917	+ getShape: function( name, subElName, parent, group ) {
1918	+ var shapes = this._shapes \|\| ( this._shapes = {} ),
1919	+ shape = shapes[ name ],
1920	+ s;
1921	+
1922	+ if( !shape ) {
1923	+ shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
1924	+ if( subElName ) {
1925	+ shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
1926	+ }
1927	+
1928	+ if( group ) {
1929	+ parent = this.getLayer( group );
1930	+ if( !parent ) {
1931	+ this.addLayer( group, doc.createElement( 'group' + group ) );
1932	+ parent = this.getLayer( group );
1933	+ }
1934	+ }
1935	+
1936	+ parent.appendChild( shape );
1937	+
1938	+ s = shape.style;
1939	+ s.position = 'absolute';
1940	+ s.left = s.top = 0;
1941	+ s['behavior'] = 'url(#default#VML)';
1942	+ }
1943	+ return shape;
1944	+ },
1945	+
1946	+ /**
1947	+ * Delete a named shape which was created by getShape(). Returns true if a shape with the
1948	+ * given name was found and deleted, or false if there was no shape of that name.
1949	+ * @param {string} name
1950	+ * @return {boolean}
1951	+ */
1952	+ deleteShape: function( name ) {
1953	+ var shapes = this._shapes,
1954	+ shape = shapes && shapes[ name ];
1955	+ if( shape ) {
1956	+ shape.parentNode.removeChild( shape );
1957	+ delete shapes[ name ];
1958	+ }
1959	+ return !!shape;
1960	+ },
1961	+
1962	+
1963	+ /**
1964	+ * For a given set of border radius length/percentage values, convert them to concrete pixel
1965	+ * values based on the current size of the target element.
1966	+ * @param {Object} radii
1967	+ * @return {Object}
1968	+ */
1969	+ getRadiiPixels: function( radii ) {
1970	+ var el = this.targetElement,
1971	+ bounds = this.boundsInfo.getBounds(),
1972	+ w = bounds.w,
1973	+ h = bounds.h,
1974	+ tlX, tlY, trX, trY, brX, brY, blX, blY, f;
1975	+
1976	+ tlX = radii.x['tl'].pixels( el, w );
1977	+ tlY = radii.y['tl'].pixels( el, h );
1978	+ trX = radii.x['tr'].pixels( el, w );
1979	+ trY = radii.y['tr'].pixels( el, h );
1980	+ brX = radii.x['br'].pixels( el, w );
1981	+ brY = radii.y['br'].pixels( el, h );
1982	+ blX = radii.x['bl'].pixels( el, w );
1983	+ blY = radii.y['bl'].pixels( el, h );
1984	+
1985	+ // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
1986	+ // is taken straight from the CSS3 Backgrounds and Borders spec.
1987	+ f = Math.min(
1988	+ w / ( tlX + trX ),
1989	+ h / ( trY + brY ),
1990	+ w / ( blX + brX ),
1991	+ h / ( tlY + blY )
1992	+ );
1993	+ if( f < 1 ) {
1994	+ tlX *= f;
1995	+ tlY *= f;
1996	+ trX *= f;
1997	+ trY *= f;
1998	+ brX *= f;
1999	+ brY *= f;
2000	+ blX *= f;
2001	+ blY *= f;
2002	+ }
2003	+
2004	+ return {
2005	+ x: {
2006	+ 'tl': tlX,
2007	+ 'tr': trX,
2008	+ 'br': brX,
2009	+ 'bl': blX
2010	+ },
2011	+ y: {
2012	+ 'tl': tlY,
2013	+ 'tr': trY,
2014	+ 'br': brY,
2015	+ 'bl': blY
2016	+ }
2017	+ }
2018	+ },
2019	+
2020	+ /**
2021	+ * Return the VML path string for the element's background box, with corners rounded.
2022	+ * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
2023	+ * pixels to shrink the box path inward from the element's four sides.
2024	+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
2025	+ * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
2026	+ * from this renderer's borderRadiusInfo object.
2027	+ * @return {string} the VML path
2028	+ */
2029	+ getBoxPath: function( shrink, mult, radii ) {
2030	+ mult = mult \|\| 1;
2031	+
2032	+ var r, str,
2033	+ bounds = this.boundsInfo.getBounds(),
2034	+ w = bounds.w * mult,
2035	+ h = bounds.h * mult,
2036	+ radInfo = this.styleInfos.borderRadiusInfo,
2037	+ floor = Math.floor, ceil = Math.ceil,
2038	+ shrinkT = shrink ? shrink.t * mult : 0,
2039	+ shrinkR = shrink ? shrink.r * mult : 0,
2040	+ shrinkB = shrink ? shrink.b * mult : 0,
2041	+ shrinkL = shrink ? shrink.l * mult : 0,
2042	+ tlX, tlY, trX, trY, brX, brY, blX, blY;
2043	+
2044	+ if( radii \|\| radInfo.isActive() ) {
2045	+ r = this.getRadiiPixels( radii \|\| radInfo.getProps() );
2046	+
2047	+ tlX = r.x['tl'] * mult;
2048	+ tlY = r.y['tl'] * mult;
2049	+ trX = r.x['tr'] * mult;
2050	+ trY = r.y['tr'] * mult;
2051	+ brX = r.x['br'] * mult;
2052	+ brY = r.y['br'] * mult;
2053	+ blX = r.x['bl'] * mult;
2054	+ blY = r.y['bl'] * mult;
2055	+
2056	+ str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
2057	+ 'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
2058	+ 'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
2059	+ 'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
2060	+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
2061	+ 'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
2062	+ 'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
2063	+ 'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
2064	+ } else {
2065	+ // simplified path for non-rounded box
2066	+ str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
2067	+ 'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
2068	+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
2069	+ 'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
2070	+ 'xe';
2071	+ }
2072	+ return str;
2073	+ },
2074	+
2075	+
2076	+ /**
2077	+ * Get the container element for the shapes, creating it if necessary.
2078	+ */
2079	+ getBox: function() {
2080	+ var box = this.parent.getLayer( this.boxZIndex ), s;
2081	+
2082	+ if( !box ) {
2083	+ box = doc.createElement( this.boxName );
2084	+ s = box.style;
2085	+ s.position = 'absolute';
2086	+ s.top = s.left = 0;
2087	+ this.parent.addLayer( this.boxZIndex, box );
2088	+ }
2089	+
2090	+ return box;
2091	+ },
2092	+
2093	+
2094	+ /**
2095	+ * Destroy the rendered objects. This is a base implementation which handles common renderer
2096	+ * structures, but individual renderers may override as necessary.
2097	+ */
2098	+ destroy: function() {
2099	+ this.parent.removeLayer( this.boxZIndex );
2100	+ delete this._shapes;
2101	+ delete this._layers;
2102	+ }
2103	+ };
2104	+ /**
2105	+ * Root renderer; creates the outermost container element and handles keeping it aligned
2106	+ * with the target element's size and position.
2107	+ * @param {Element} el The target element
2108	+ * @param {Object} styleInfos The StyleInfo objects
2109	+ */
2110	+ PIE.RootRenderer = PIE.RendererBase.newRenderer( {
2111	+
2112	+ isActive: function() {
2113	+ var children = this.childRenderers;
2114	+ for( var i in children ) {
2115	+ if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
2116	+ return true;
2117	+ }
2118	+ }
2119	+ return false;
2120	+ },
2121	+
2122	+ needsUpdate: function() {
2123	+ return this.styleInfos.visibilityInfo.changed();
2124	+ },
2125	+
2126	+ updatePos: function() {
2127	+ if( this.isActive() ) {
2128	+ var el = this.getPositioningElement(),
2129	+ par = el,
2130	+ docEl,
2131	+ parRect,
2132	+ tgtCS = el.currentStyle,
2133	+ tgtPos = tgtCS.position,
2134	+ boxPos,
2135	+ s = this.getBox().style, cs,
2136	+ x = 0, y = 0,
2137	+ elBounds = this.boundsInfo.getBounds();
2138	+
2139	+ if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
2140	+ x = elBounds.x;
2141	+ y = elBounds.y;
2142	+ boxPos = tgtPos;
2143	+ } else {
2144	+ // Get the element's offsets from its nearest positioned ancestor. Uses
2145	+ // getBoundingClientRect for accuracy and speed.
2146	+ do {
2147	+ par = par.offsetParent;
2148	+ } while( par && ( par.currentStyle.position === 'static' ) );
2149	+ if( par ) {
2150	+ parRect = par.getBoundingClientRect();
2151	+ cs = par.currentStyle;
2152	+ x = elBounds.x - parRect.left - ( parseFloat(cs.borderLeftWidth) \|\| 0 );
2153	+ y = elBounds.y - parRect.top - ( parseFloat(cs.borderTopWidth) \|\| 0 );
2154	+ } else {
2155	+ docEl = doc.documentElement;
2156	+ x = elBounds.x + docEl.scrollLeft - docEl.clientLeft;
2157	+ y = elBounds.y + docEl.scrollTop - docEl.clientTop;
2158	+ }
2159	+ boxPos = 'absolute';
2160	+ }
2161	+
2162	+ s.position = boxPos;
2163	+ s.left = x;
2164	+ s.top = y;
2165	+ s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
2166	+ this.isPositioned = true;
2167	+ }
2168	+ },
2169	+
2170	+ updateSize: function() {
2171	+ // NO-OP
2172	+ },
2173	+
2174	+ updateVisibility: function() {
2175	+ var vis = this.styleInfos.visibilityInfo.getProps();
2176	+ this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
2177	+ },
2178	+
2179	+ updateProps: function() {
2180	+ if( this.isActive() ) {
2181	+ this.updateVisibility();
2182	+ } else {
2183	+ this.destroy();
2184	+ }
2185	+ },
2186	+
2187	+ getPositioningElement: function() {
2188	+ var el = this.targetElement;
2189	+ return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
2190	+ },
2191	+
2192	+ getBox: function() {
2193	+ var box = this._box, el;
2194	+ if( !box ) {
2195	+ el = this.getPositioningElement();
2196	+ box = this._box = doc.createElement( 'css3-container' );
2197	+ box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
2198	+
2199	+ this.updateVisibility();
2200	+
2201	+ el.parentNode.insertBefore( box, el );
2202	+ }
2203	+ return box;
2204	+ },
2205	+
2206	+ destroy: function() {
2207	+ var box = this._box, par;
2208	+ if( box && ( par = box.parentNode ) ) {
2209	+ par.removeChild( box );
2210	+ }
2211	+ delete this._box;
2212	+ delete this._layers;
2213	+ }
2214	+
2215	+ } );
2216	+ /**
2217	+ * Renderer for element backgrounds.
2218	+ * @constructor
2219	+ * @param {Element} el The target element
2220	+ * @param {Object} styleInfos The StyleInfo objects
2221	+ * @param {PIE.RootRenderer} parent
2222	+ */
2223	+ PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
2224	+
2225	+ boxZIndex: 2,
2226	+ boxName: 'background',
2227	+
2228	+ needsUpdate: function() {
2229	+ var si = this.styleInfos;
2230	+ return si.backgroundInfo.changed() \|\| si.borderRadiusInfo.changed();
2231	+ },
2232	+
2233	+ isActive: function() {
2234	+ var si = this.styleInfos;
2235	+ return si.borderImageInfo.isActive() \|\|
2236	+ si.borderRadiusInfo.isActive() \|\|
2237	+ si.backgroundInfo.isActive() \|\|
2238	+ ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
2239	+ },
2240	+
2241	+ /**
2242	+ * Draw the shapes
2243	+ */
2244	+ draw: function() {
2245	+ var bounds = this.boundsInfo.getBounds();
2246	+ if( bounds.w && bounds.h ) {
2247	+ this.drawBgColor();
2248	+ this.drawBgImages();
2249	+ }
2250	+ },
2251	+
2252	+ /**
2253	+ * Draw the background color shape
2254	+ */
2255	+ drawBgColor: function() {
2256	+ var props = this.styleInfos.backgroundInfo.getProps(),
2257	+ bounds = this.boundsInfo.getBounds(),
2258	+ el = this.targetElement,
2259	+ color = props && props.color,
2260	+ shape, w, h, s, alpha;
2261	+
2262	+ if( color && color.alpha() > 0 ) {
2263	+ this.hideBackground();
2264	+
2265	+ shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
2266	+ w = bounds.w;
2267	+ h = bounds.h;
2268	+ shape.stroked = false;
2269	+ shape.coordsize = w * 2 + ',' + h * 2;
2270	+ shape.coordorigin = '1,1';
2271	+ shape.path = this.getBoxPath( null, 2 );
2272	+ s = shape.style;
2273	+ s.width = w;
2274	+ s.height = h;
2275	+ shape.fill.color = color.colorValue( el );
2276	+
2277	+ alpha = color.alpha();
2278	+ if( alpha < 1 ) {
2279	+ shape.fill.opacity = alpha;
2280	+ }
2281	+ } else {
2282	+ this.deleteShape( 'bgColor' );
2283	+ }
2284	+ },
2285	+
2286	+ /**
2287	+ * Draw all the background image layers
2288	+ */
2289	+ drawBgImages: function() {
2290	+ var props = this.styleInfos.backgroundInfo.getProps(),
2291	+ bounds = this.boundsInfo.getBounds(),
2292	+ images = props && props.bgImages,
2293	+ img, shape, w, h, s, i;
2294	+
2295	+ if( images ) {
2296	+ this.hideBackground();
2297	+
2298	+ w = bounds.w;
2299	+ h = bounds.h;
2300	+
2301	+ i = images.length;
2302	+ while( i-- ) {
2303	+ img = images[i];
2304	+ shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
2305	+
2306	+ shape.stroked = false;
2307	+ shape.fill.type = 'tile';
2308	+ shape.fillcolor = 'none';
2309	+ shape.coordsize = w * 2 + ',' + h * 2;
2310	+ shape.coordorigin = '1,1';
2311	+ shape.path = this.getBoxPath( 0, 2 );
2312	+ s = shape.style;
2313	+ s.width = w;
2314	+ s.height = h;
2315	+
2316	+ if( img.imgType === 'linear-gradient' ) {
2317	+ this.addLinearGradient( shape, img );
2318	+ }
2319	+ else {
2320	+ shape.fill.src = img.imgUrl;
2321	+ this.positionBgImage( shape, i );
2322	+ }
2323	+ }
2324	+ }
2325	+
2326	+ // Delete any bgImage shapes previously created which weren't used above
2327	+ i = images ? images.length : 0;
2328	+ while( this.deleteShape( 'bgImage' + i++ ) ) {}
2329	+ },
2330	+
2331	+
2332	+ /**
2333	+ * Set the position and clipping of the background image for a layer
2334	+ * @param {Element} shape
2335	+ * @param {number} index
2336	+ */
2337	+ positionBgImage: function( shape, index ) {
2338	+ PIE.Util.withImageSize( shape.fill.src, function( size ) {
2339	+ var fill = shape.fill,
2340	+ el = this.targetElement,
2341	+ bounds = this.boundsInfo.getBounds(),
2342	+ elW = bounds.w,
2343	+ elH = bounds.h,
2344	+ si = this.styleInfos,
2345	+ border = si.borderInfo.getProps(),
2346	+ bw = border && border.widths,
2347	+ bwT = bw ? bw['t'].pixels( el ) : 0,
2348	+ bwR = bw ? bw['r'].pixels( el ) : 0,
2349	+ bwB = bw ? bw['b'].pixels( el ) : 0,
2350	+ bwL = bw ? bw['l'].pixels( el ) : 0,
2351	+ bg = si.backgroundInfo.getProps().bgImages[ index ],
2352	+ bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
2353	+ repeat = bg.imgRepeat,
2354	+ pxX, pxY,
2355	+ clipT = 0, clipL = 0,
2356	+ clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
2357	+ clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
2358	+
2359	+ // Positioning - find the pixel offset from the top/left and convert to a ratio
2360	+ // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
2361	+ // needed to fix antialiasing but makes the bg image fuzzy.
2362	+ pxX = Math.round( bgPos.x ) + bwL + 0.5;
2363	+ pxY = Math.round( bgPos.y ) + bwT + 0.5;
2364	+ fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
2365	+
2366	+ // Repeating - clip the image shape
2367	+ if( repeat && repeat !== 'repeat' ) {
2368	+ if( repeat === 'repeat-x' \|\| repeat === 'no-repeat' ) {
2369	+ clipT = pxY + 1;
2370	+ clipB = pxY + size.h + clipAdjust;
2371	+ }
2372	+ if( repeat === 'repeat-y' \|\| repeat === 'no-repeat' ) {
2373	+ clipL = pxX + 1;
2374	+ clipR = pxX + size.w + clipAdjust;
2375	+ }
2376	+ shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
2377	+ }
2378	+ }, this );
2379	+ },
2380	+
2381	+
2382	+ /**
2383	+ * Draw the linear gradient for a gradient layer
2384	+ * @param {Element} shape
2385	+ * @param {Object} info The object holding the information about the gradient
2386	+ */
2387	+ addLinearGradient: function( shape, info ) {
2388	+ var el = this.targetElement,
2389	+ bounds = this.boundsInfo.getBounds(),
2390	+ w = bounds.w,
2391	+ h = bounds.h,
2392	+ fill = shape.fill,
2393	+ angle = info.angle,
2394	+ startPos = info.gradientStart,
2395	+ stops = info.stops,
2396	+ stopCount = stops.length,
2397	+ PI = Math.PI,
2398	+ UNDEF,
2399	+ startX, startY,
2400	+ endX, endY,
2401	+ startCornerX, startCornerY,
2402	+ endCornerX, endCornerY,
2403	+ vmlAngle, vmlGradientLength, vmlColors,
2404	+ deltaX, deltaY, lineLength,
2405	+ stopPx, vmlOffsetPct,
2406	+ p, i, j, before, after;
2407	+
2408	+ /**
2409	+ * Find the point along a given line (defined by a starting point and an angle), at which
2410	+ * that line is intersected by a perpendicular line extending through another point.
2411	+ * @param x1 - x coord of the starting point
2412	+ * @param y1 - y coord of the starting point
2413	+ * @param angle - angle of the line extending from the starting point (in degrees)
2414	+ * @param x2 - x coord of point along the perpendicular line
2415	+ * @param y2 - y coord of point along the perpendicular line
2416	+ * @return [ x, y ]
2417	+ */
2418	+ function perpendicularIntersect( x1, y1, angle, x2, y2 ) {
2419	+ // Handle straight vertical and horizontal angles, for performance and to avoid
2420	+ // divide-by-zero errors.
2421	+ if( angle === 0 \|\| angle === 180 ) {
2422	+ return [ x2, y1 ];
2423	+ }
2424	+ else if( angle === 90 \|\| angle === 270 ) {
2425	+ return [ x1, y2 ];
2426	+ }
2427	+ else {
2428	+ // General approach: determine the Ax+By=C formula for each line (the slope of the second
2429	+ // line is the negative inverse of the first) and then solve for where both formulas have
2430	+ // the same x/y values.
2431	+ var a1 = Math.tan( -angle * PI / 180 ),
2432	+ c1 = a1 * x1 - y1,
2433	+ a2 = -1 / a1,
2434	+ c2 = a2 * x2 - y2,
2435	+ d = a2 - a1,
2436	+ endX = ( c2 - c1 ) / d,
2437	+ endY = ( a1 * c2 - a2 * c1 ) / d;
2438	+ return [ endX, endY ];
2439	+ }
2440	+ }
2441	+
2442	+ // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
2443	+ // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
2444	+ // the total length of the VML rendered gradient-line corner to corner.
2445	+ function findCorners() {
2446	+ startCornerX = ( angle >= 90 && angle < 270 ) ? w : 0;
2447	+ startCornerY = angle < 180 ? h : 0;
2448	+ endCornerX = w - startCornerX;
2449	+ endCornerY = h - startCornerY;
2450	+ }
2451	+
2452	+ // Normalize the angle to a value between [0, 360)
2453	+ function normalizeAngle() {
2454	+ while( angle < 0 ) {
2455	+ angle += 360;
2456	+ }
2457	+ angle = angle % 360;
2458	+ }
2459	+
2460	+ // Find the distance between two points
2461	+ function distance( p1, p2 ) {
2462	+ var dx = p2[0] - p1[0],
2463	+ dy = p2[1] - p1[1];
2464	+ return Math.abs(
2465	+ dx === 0 ? dy :
2466	+ dy === 0 ? dx :
2467	+ Math.sqrt( dx * dx + dy * dy )
2468	+ );
2469	+ }
2470	+
2471	+ // Find the start and end points of the gradient
2472	+ if( startPos ) {
2473	+ startPos = startPos.coords( el, w, h );
2474	+ startX = startPos.x;
2475	+ startY = startPos.y;
2476	+ }
2477	+ if( angle ) {
2478	+ angle = angle.degrees();
2479	+
2480	+ normalizeAngle();
2481	+ findCorners();
2482	+
2483	+ // If no start position was specified, then choose a corner as the starting point.
2484	+ if( !startPos ) {
2485	+ startX = startCornerX;
2486	+ startY = startCornerY;
2487	+ }
2488	+
2489	+ // Find the end position by extending a perpendicular line from the gradient-line which
2490	+ // intersects the corner opposite from the starting corner.
2491	+ p = perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
2492	+ endX = p[0];
2493	+ endY = p[1];
2494	+ }
2495	+ else if( startPos ) {
2496	+ // Start position but no angle specified: find the end point by rotating 180deg around the center
2497	+ endX = w - startX;
2498	+ endY = h - startY;
2499	+ }
2500	+ else {
2501	+ // Neither position nor angle specified; create vertical gradient from top to bottom
2502	+ startX = startY = endX = 0;
2503	+ endY = h;
2504	+ }
2505	+ deltaX = endX - startX;
2506	+ deltaY = endY - startY;
2507	+
2508	+ if( angle === UNDEF ) {
2509	+ // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
2510	+ // or vertical angles so they get exact whole numbers rather than what atan2 gives.
2511	+ angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
2512	+ ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
2513	+ -Math.atan2( deltaY, deltaX ) / PI * 180
2514	+ )
2515	+ );
2516	+ normalizeAngle();
2517	+ findCorners();
2518	+ }
2519	+
2520	+
2521	+ // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
2522	+ // bounding box; for example specifying a 45 deg angle actually results in a gradient
2523	+ // drawn diagonally from one corner to its opposite corner, which will only appear to the
2524	+ // viewer as 45 degrees if the shape is equilateral. We adjust for this by taking the x/y deltas
2525	+ // between the start and end points, multiply one of them by the shape's aspect ratio,
2526	+ // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
2527	+ // horizontal or vertical then we don't need to do this conversion.
2528	+ vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
2529	+
2530	+ // VML angles are 180 degrees offset from CSS angles
2531	+ vmlAngle += 180;
2532	+ vmlAngle = vmlAngle % 360;
2533	+
2534	+ // Add all the stops to the VML 'colors' list, including the first and last stops.
2535	+ // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
2536	+ // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
2537	+ // percentage along the VML gradient-line, which runs from shape corner to corner.
2538	+ lineLength = distance( [ startX, startY ], [ endX, endY ] );
2539	+ vmlGradientLength = distance( [ startCornerX, startCornerY ], perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY ) );
2540	+ vmlColors = [];
2541	+ vmlOffsetPct = distance( [ startX, startY ], perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY ) ) / vmlGradientLength * 100;
2542	+
2543	+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
2544	+ stopPx = [];
2545	+ for( i = 0; i < stopCount; i++ ) {
2546	+ stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
2547	+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
2548	+ }
2549	+ // Fill in gaps with evenly-spaced offsets
2550	+ for( i = 1; i < stopCount; i++ ) {
2551	+ if( stopPx[ i ] === null ) {
2552	+ before = stopPx[ i - 1 ];
2553	+ j = i;
2554	+ do {
2555	+ after = stopPx[ ++j ];
2556	+ } while( after === null );
2557	+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
2558	+ }
2559	+ // Make sure each stop's offset is no less than the one before it
2560	+ stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
2561	+ }
2562	+
2563	+ // Convert to percentage along the VML gradient line and add to the VML 'colors' value
2564	+ for( i = 0; i < stopCount; i++ ) {
2565	+ vmlColors.push(
2566	+ ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
2567	+ );
2568	+ }
2569	+
2570	+ // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
2571	+ // the first and last stop colors; this just sets outer bounds for the gradient.
2572	+ fill['angle'] = vmlAngle;
2573	+ fill['type'] = 'gradient';
2574	+ fill['method'] = 'sigma';
2575	+ fill['color'] = stops[0].color.colorValue( el );
2576	+ fill['color2'] = stops[stopCount - 1].color.colorValue( el );
2577	+ fill['colors'].value = vmlColors.join( ',' );
2578	+ },
2579	+
2580	+
2581	+ /**
2582	+ * Hide the actual background image and color of the element.
2583	+ */
2584	+ hideBackground: function() {
2585	+ var rs = this.targetElement.runtimeStyle;
2586	+ rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
2587	+ rs.backgroundColor = 'transparent';
2588	+ },
2589	+
2590	+ destroy: function() {
2591	+ PIE.RendererBase.destroy.call( this );
2592	+ var rs = this.targetElement.runtimeStyle;
2593	+ rs.backgroundImage = rs.backgroundColor = '';
2594	+ }
2595	+
2596	+ } );
2597	+ /**
2598	+ * Renderer for element borders.
2599	+ * @constructor
2600	+ * @param {Element} el The target element
2601	+ * @param {Object} styleInfos The StyleInfo objects
2602	+ * @param {PIE.RootRenderer} parent
2603	+ */
2604	+ PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
2605	+
2606	+ boxZIndex: 4,
2607	+ boxName: 'border',
2608	+
2609	+ /**
2610	+ * Lookup table of elements which cannot take custom children.
2611	+ */
2612	+ childlessElements: {
2613	+ 'TABLE':1, //can obviously have children but not custom ones
2614	+ 'INPUT':1,
2615	+ 'TEXTAREA':1,
2616	+ 'SELECT':1,
2617	+ 'OPTION':1,
2618	+ 'IMG':1,
2619	+ 'HR':1,
2620	+ 'FIELDSET':1 //can take children but wrapping its children messes up its <legend>
2621	+ },
2622	+
2623	+ /**
2624	+ * Values of the type attribute for input elements displayed as buttons
2625	+ */
2626	+ inputButtonTypes: {
2627	+ 'submit':1,
2628	+ 'button':1,
2629	+ 'reset':1
2630	+ },
2631	+
2632	+ needsUpdate: function() {
2633	+ var si = this.styleInfos;
2634	+ return si.borderInfo.changed() \|\| si.borderRadiusInfo.changed();
2635	+ },
2636	+
2637	+ isActive: function() {
2638	+ var si = this.styleInfos;
2639	+ return ( si.borderImageInfo.isActive() \|\|
2640	+ si.borderRadiusInfo.isActive() \|\|
2641	+ si.backgroundInfo.isActive() ) &&
2642	+ si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
2643	+ },
2644	+
2645	+ /**
2646	+ * Draw the border shape(s)
2647	+ */
2648	+ draw: function() {
2649	+ var el = this.targetElement,
2650	+ cs = el.currentStyle,
2651	+ props = this.styleInfos.borderInfo.getProps(),
2652	+ bounds = this.boundsInfo.getBounds(),
2653	+ w = bounds.w,
2654	+ h = bounds.h,
2655	+ side, shape, stroke, s,
2656	+ segments, seg, i, len;
2657	+
2658	+ if( props ) {
2659	+ this.hideBorder();
2660	+
2661	+ segments = this.getBorderSegments( 2 );
2662	+ for( i = 0, len = segments.length; i < len; i++) {
2663	+ seg = segments[i];
2664	+ shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
2665	+ shape.coordsize = w * 2 + ',' + h * 2;
2666	+ shape.coordorigin = '1,1';
2667	+ shape.path = seg.path;
2668	+ s = shape.style;
2669	+ s.width = w;
2670	+ s.height = h;
2671	+
2672	+ shape.filled = !!seg.fill;
2673	+ shape.stroked = !!seg.stroke;
2674	+ if( seg.stroke ) {
2675	+ stroke = shape.stroke;
2676	+ stroke['weight'] = seg.weight + 'px';
2677	+ stroke.color = seg.color.colorValue( el );
2678	+ stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
2679	+ stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
2680	+ } else {
2681	+ shape.fill.color = seg.fill.colorValue( el );
2682	+ }
2683	+ }
2684	+
2685	+ // remove any previously-created border shapes which didn't get used above
2686	+ while( this.deleteShape( 'borderPiece' + i++ ) ) {}
2687	+ }
2688	+ },
2689	+
2690	+ /**
2691	+ * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
2692	+ * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
2693	+ * like form buttons require removing the border width altogether, so for those we increase the padding
2694	+ * by the border size.
2695	+ */
2696	+ hideBorder: function() {
2697	+ var el = this.targetElement,
2698	+ cs = el.currentStyle,
2699	+ rs = el.runtimeStyle,
2700	+ tag = el.tagName,
2701	+ isIE6 = PIE.ieVersion === 6,
2702	+ sides, side, i;
2703	+
2704	+ if( ( isIE6 && tag in this.childlessElements ) \|\| tag === 'BUTTON' \|\|
2705	+ ( tag === 'INPUT' && el.type in this.inputButtonTypes ) ) {
2706	+ rs.borderWidth = '';
2707	+ sides = this.styleInfos.borderInfo.sides;
2708	+ for( i = sides.length; i--; ) {
2709	+ side = sides[ i ];
2710	+ rs[ 'padding' + side ] = '';
2711	+ rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
2712	+ ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
2713	+ ( !PIE.ieVersion === 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
2714	+ }
2715	+ rs.borderWidth = 0;
2716	+ }
2717	+ else if( isIE6 ) {
2718	+ // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
2719	+ // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
2720	+ // (background and border) but displays all the contents.
2721	+ // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
2722	+ // as this can interfere with other author scripts which add/modify/delete children. Also, this
2723	+ // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
2724	+ // using a compositor filter or some other filter which masks the border.
2725	+ if( el.childNodes.length !== 1 \|\| el.firstChild.tagName !== 'ie6-mask' ) {
2726	+ var cont = doc.createElement( 'ie6-mask' ),
2727	+ s = cont.style, child;
2728	+ s.visibility = 'visible';
2729	+ s.zoom = 1;
2730	+ while( child = el.firstChild ) {
2731	+ cont.appendChild( child );
2732	+ }
2733	+ el.appendChild( cont );
2734	+ rs.visibility = 'hidden';
2735	+ }
2736	+ }
2737	+ else {
2738	+ rs.borderColor = 'transparent';
2739	+ }
2740	+ },
2741	+
2742	+
2743	+ /**
2744	+ * Get the VML path definitions for the border segment(s).
2745	+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
2746	+ * @return {Array.<string>}
2747	+ */
2748	+ getBorderSegments: function( mult ) {
2749	+ var el = this.targetElement,
2750	+ bounds, elW, elH,
2751	+ borderInfo = this.styleInfos.borderInfo,
2752	+ segments = [],
2753	+ floor, ceil, wT, wR, wB, wL,
2754	+ round = Math.round,
2755	+ borderProps, radiusInfo, radii, widths, styles, colors;
2756	+
2757	+ if( borderInfo.isActive() ) {
2758	+ borderProps = borderInfo.getProps();
2759	+
2760	+ widths = borderProps.widths;
2761	+ styles = borderProps.styles;
2762	+ colors = borderProps.colors;
2763	+
2764	+ if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
2765	+ if( colors['t'].alpha() > 0 ) {
2766	+ // shortcut for identical border on all sides - only need 1 stroked shape
2767	+ wT = widths['t'].pixels( el ); //thickness
2768	+ wR = wT / 2; //shrink
2769	+ segments.push( {
2770	+ path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
2771	+ stroke: styles['t'],
2772	+ color: colors['t'],
2773	+ weight: wT
2774	+ } );
2775	+ }
2776	+ }
2777	+ else {
2778	+ mult = mult \|\| 1;
2779	+ bounds = this.boundsInfo.getBounds();
2780	+ elW = bounds.w;
2781	+ elH = bounds.h;
2782	+
2783	+ wT = round( widths['t'].pixels( el ) );
2784	+ wR = round( widths['r'].pixels( el ) );
2785	+ wB = round( widths['b'].pixels( el ) );
2786	+ wL = round( widths['l'].pixels( el ) );
2787	+ var pxWidths = {
2788	+ 't': wT,
2789	+ 'r': wR,
2790	+ 'b': wB,
2791	+ 'l': wL
2792	+ };
2793	+
2794	+ radiusInfo = this.styleInfos.borderRadiusInfo;
2795	+ if( radiusInfo.isActive() ) {
2796	+ radii = this.getRadiiPixels( radiusInfo.getProps() );
2797	+ }
2798	+
2799	+ floor = Math.floor;
2800	+ ceil = Math.ceil;
2801	+
2802	+ function radius( xy, corner ) {
2803	+ return radii ? radii[ xy ][ corner ] : 0;
2804	+ }
2805	+
2806	+ function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
2807	+ var rx = radius( 'x', corner),
2808	+ ry = radius( 'y', corner),
2809	+ deg = 65535,
2810	+ isRight = corner.charAt( 1 ) === 'r',
2811	+ isBottom = corner.charAt( 0 ) === 'b';
2812	+ return ( rx > 0 && ry > 0 ) ?
2813	+ ( doMove ? 'al' : 'ae' ) +
2814	+ ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
2815	+ ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
2816	+ ( floor( rx ) - shrinkX ) * mult + ',' + // width
2817	+ ( floor( ry ) - shrinkY ) * mult + ',' + // height
2818	+ ( startAngle * deg ) + ',' + // start angle
2819	+ ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
2820	+ ) : (
2821	+ ( doMove ? 'm' : 'l' ) +
2822	+ ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
2823	+ ( isBottom ? elH - shrinkY : shrinkY ) * mult
2824	+ );
2825	+ }
2826	+
2827	+ function line( side, shrink, ccw, doMove ) {
2828	+ var
2829	+ start = (
2830	+ side === 't' ?
2831	+ floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
2832	+ side === 'r' ?
2833	+ ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
2834	+ side === 'b' ?
2835	+ ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
2836	+ // side === 'l' ?
2837	+ floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
2838	+ ),
2839	+ end = (
2840	+ side === 't' ?
2841	+ ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
2842	+ side === 'r' ?
2843	+ ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
2844	+ side === 'b' ?
2845	+ floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
2846	+ // side === 'l' ?
2847	+ floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
2848	+ );
2849	+ return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
2850	+ ( doMove ? 'm' + start : '' ) + 'l' + end;
2851	+ }
2852	+
2853	+
2854	+ function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
2855	+ var vert = side === 'l' \|\| side === 'r',
2856	+ sideW = pxWidths[ side ],
2857	+ beforeX, beforeY, afterX, afterY;
2858	+
2859	+ if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
2860	+ beforeX = pxWidths[ vert ? side : sideBefore ];
2861	+ beforeY = pxWidths[ vert ? sideBefore : side ];
2862	+ afterX = pxWidths[ vert ? side : sideAfter ];
2863	+ afterY = pxWidths[ vert ? sideAfter : side ];
2864	+
2865	+ if( styles[ side ] === 'dashed' \|\| styles[ side ] === 'dotted' ) {
2866	+ segments.push( {
2867	+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
2868	+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
2869	+ fill: colors[ side ]
2870	+ } );
2871	+ segments.push( {
2872	+ path: line( side, sideW / 2, 0, 1 ),
2873	+ stroke: styles[ side ],
2874	+ weight: sideW,
2875	+ color: colors[ side ]
2876	+ } );
2877	+ segments.push( {
2878	+ path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
2879	+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
2880	+ fill: colors[ side ]
2881	+ } );
2882	+ }
2883	+ else {
2884	+ segments.push( {
2885	+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
2886	+ line( side, sideW, 0, 0 ) +
2887	+ curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
2888	+
2889	+ ( styles[ side ] === 'double' && sideW > 2 ?
2890	+ curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
2891	+ line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
2892	+ curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
2893	+ 'x ' +
2894	+ curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
2895	+ line( side, floor( sideW / 3 ), 1, 0 ) +
2896	+ curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
2897	+ : '' ) +
2898	+
2899	+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
2900	+ line( side, 0, 1, 0 ) +
2901	+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
2902	+ fill: colors[ side ]
2903	+ } );
2904	+ }
2905	+ }
2906	+ }
2907	+
2908	+ addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
2909	+ addSide( 'r', 't', 'b', 'tr', 'br', 0 );
2910	+ addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
2911	+ addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
2912	+ }
2913	+ }
2914	+
2915	+ return segments;
2916	+ },
2917	+
2918	+ destroy: function() {
2919	+ PIE.RendererBase.destroy.call( this );
2920	+ this.targetElement.runtimeStyle.borderColor = '';
2921	+ }
2922	+
2923	+
2924	+ } );
2925	+ /**
2926	+ * Renderer for border-image
2927	+ * @constructor
2928	+ * @param {Element} el The target element
2929	+ * @param {Object} styleInfos The StyleInfo objects
2930	+ * @param {PIE.RootRenderer} parent
2931	+ */
2932	+ PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
2933	+
2934	+ boxZIndex: 5,
2935	+ pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
2936	+
2937	+ needsUpdate: function() {
2938	+ return this.styleInfos.borderImageInfo.changed();
2939	+ },
2940	+
2941	+ isActive: function() {
2942	+ return this.styleInfos.borderImageInfo.isActive();
2943	+ },
2944	+
2945	+ draw: function() {
2946	+ this.getBox(); //make sure pieces are created
2947	+
2948	+ var props = this.styleInfos.borderImageInfo.getProps(),
2949	+ bounds = this.boundsInfo.getBounds(),
2950	+ el = this.targetElement,
2951	+ pieces = this.pieces;
2952	+
2953	+ PIE.Util.withImageSize( props.src, function( imgSize ) {
2954	+ var elW = bounds.w,
2955	+ elH = bounds.h,
2956	+
2957	+ widths = props.width,
2958	+ widthT = widths.t.pixels( el ),
2959	+ widthR = widths.r.pixels( el ),
2960	+ widthB = widths.b.pixels( el ),
2961	+ widthL = widths.l.pixels( el ),
2962	+ slices = props.slice,
2963	+ sliceT = slices.t.pixels( el ),
2964	+ sliceR = slices.r.pixels( el ),
2965	+ sliceB = slices.b.pixels( el ),
2966	+ sliceL = slices.l.pixels( el );
2967	+
2968	+ // Piece positions and sizes
2969	+ function setSizeAndPos( piece, w, h, x, y ) {
2970	+ var s = pieces[piece].style,
2971	+ max = Math.max;
2972	+ s.width = max(w, 0);
2973	+ s.height = max(h, 0);
2974	+ s.left = x;
2975	+ s.top = y;
2976	+ }
2977	+ setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
2978	+ setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
2979	+ setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
2980	+ setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
2981	+ setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
2982	+ setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
2983	+ setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
2984	+ setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
2985	+ setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
2986	+
2987	+
2988	+ // image croppings
2989	+ function setCrops( sides, crop, val ) {
2990	+ for( var i=0, len=sides.length; i < len; i++ ) {
2991	+ pieces[ sides[i] ]['imagedata'][ crop ] = val;
2992	+ }
2993	+ }
2994	+
2995	+ // corners
2996	+ setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
2997	+ setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
2998	+ setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
2999	+ setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
3000	+
3001	+ // edges and center
3002	+ if( props.repeat.v === 'stretch' ) {
3003	+ setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
3004	+ setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
3005	+ }
3006	+ if( props.repeat.h === 'stretch' ) {
3007	+ setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
3008	+ setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
3009	+ }
3010	+
3011	+ // center fill
3012	+ pieces['c'].style.display = props.fill ? '' : 'none';
3013	+ }, this );
3014	+ },
3015	+
3016	+ getBox: function() {
3017	+ var box = this.parent.getLayer( this.boxZIndex ),
3018	+ s, piece, i,
3019	+ pieceNames = this.pieceNames,
3020	+ len = pieceNames.length;
3021	+
3022	+ if( !box ) {
3023	+ box = doc.createElement( 'border-image' );
3024	+ s = box.style;
3025	+ s.position = 'absolute';
3026	+
3027	+ this.pieces = {};
3028	+
3029	+ for( i = 0; i < len; i++ ) {
3030	+ piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
3031	+ piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
3032	+ s = piece.style;
3033	+ s['behavior'] = 'url(#default#VML)';
3034	+ s.position = "absolute";
3035	+ s.top = s.left = 0;
3036	+ piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
3037	+ piece.stroked = false;
3038	+ piece.filled = false;
3039	+ box.appendChild( piece );
3040	+ }
3041	+
3042	+ this.parent.addLayer( this.boxZIndex, box );
3043	+ }
3044	+
3045	+ return box;
3046	+ }
3047	+
3048	+ } );
3049	+ /**
3050	+ * Renderer for outset box-shadows
3051	+ * @constructor
3052	+ * @param {Element} el The target element
3053	+ * @param {Object} styleInfos The StyleInfo objects
3054	+ * @param {PIE.RootRenderer} parent
3055	+ */
3056	+ PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
3057	+
3058	+ boxZIndex: 1,
3059	+ boxName: 'outset-box-shadow',
3060	+
3061	+ needsUpdate: function() {
3062	+ var si = this.styleInfos;
3063	+ return si.boxShadowInfo.changed() \|\| si.borderRadiusInfo.changed();
3064	+ },
3065	+
3066	+ isActive: function() {
3067	+ var boxShadowInfo = this.styleInfos.boxShadowInfo;
3068	+ return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
3069	+ },
3070	+
3071	+ draw: function() {
3072	+ var me = this,
3073	+ el = this.targetElement,
3074	+ box = this.getBox(),
3075	+ styleInfos = this.styleInfos,
3076	+ shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
3077	+ radii = styleInfos.borderRadiusInfo.getProps(),
3078	+ len = shadowInfos.length,
3079	+ i = len, j,
3080	+ bounds = this.boundsInfo.getBounds(),
3081	+ w = bounds.w,
3082	+ h = bounds.h,
3083	+ clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
3084	+ corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
3085	+ shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
3086	+ totalW, totalH, focusX, focusY, isBottom, isRight;
3087	+
3088	+
3089	+ function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
3090	+ var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
3091	+ fill = shape.fill;
3092	+
3093	+ // Position and size
3094	+ shape['coordsize'] = w * 2 + ',' + h * 2;
3095	+ shape['coordorigin'] = '1,1';
3096	+
3097	+ // Color and opacity
3098	+ shape['stroked'] = false;
3099	+ shape['filled'] = true;
3100	+ fill.color = color.colorValue( el );
3101	+ if( blur ) {
3102	+ fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
3103	+ fill['color2'] = fill.color;
3104	+ fill['opacity'] = 0;
3105	+ }
3106	+
3107	+ // Path
3108	+ shape.path = path;
3109	+
3110	+ // This needs to go last for some reason, to prevent rendering at incorrect size
3111	+ ss = shape.style;
3112	+ ss.left = xOff;
3113	+ ss.top = yOff;
3114	+ ss.width = w;
3115	+ ss.height = h;
3116	+
3117	+ return shape;
3118	+ }
3119	+
3120	+
3121	+ while( i-- ) {
3122	+ shadowInfo = shadowInfos[ i ];
3123	+ xOff = shadowInfo.xOffset.pixels( el );
3124	+ yOff = shadowInfo.yOffset.pixels( el );
3125	+ spread = shadowInfo.spread.pixels( el ),
3126	+ blur = shadowInfo.blur.pixels( el );
3127	+ color = shadowInfo.color;
3128	+ // Shape path
3129	+ shrink = -spread - blur;
3130	+ if( !radii && blur ) {
3131	+ // If blurring, use a non-null border radius info object so that getBoxPath will
3132	+ // round the corners of the expanded shadow shape rather than squaring them off.
3133	+ radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
3134	+ }
3135	+ path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
3136	+
3137	+ if( blur ) {
3138	+ totalW = ( spread + blur ) * 2 + w;
3139	+ totalH = ( spread + blur ) * 2 + h;
3140	+ focusX = blur * 2 / totalW;
3141	+ focusY = blur * 2 / totalH;
3142	+ if( blur - spread > w / 2 \|\| blur - spread > h / 2 ) {
3143	+ // If the blur is larger than half the element's narrowest dimension, we cannot do
3144	+ // this with a single shape gradient, because its focussize would have to be less than
3145	+ // zero which results in ugly artifacts. Instead we create four shapes, each with its
3146	+ // gradient focus past center, and then clip them so each only shows the quadrant
3147	+ // opposite the focus.
3148	+ for( j = 4; j--; ) {
3149	+ corner = corners[j];
3150	+ isBottom = corner.charAt( 0 ) === 'b';
3151	+ isRight = corner.charAt( 1 ) === 'r';
3152	+ shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
3153	+ fill = shape.fill;
3154	+ fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
3155	+ ( isBottom ? 1 - focusY : focusY );
3156	+ fill['focussize'] = '0,0';
3157	+
3158	+ // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
3159	+ // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
3160	+ shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
3161	+ ( isRight ? totalW : totalW / 2 ) + 'px,' +
3162	+ ( isBottom ? totalH : totalH / 2 ) + 'px,' +
3163	+ ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
3164	+ }
3165	+ } else {
3166	+ // TODO delete old quadrant shapes if resizing expands past the barrier
3167	+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
3168	+ fill = shape.fill;
3169	+ fill['focusposition'] = focusX + ',' + focusY;
3170	+ fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
3171	+ }
3172	+ } else {
3173	+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
3174	+ alpha = color.alpha();
3175	+ if( alpha < 1 ) {
3176	+ // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
3177	+ // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha ) + ')';
3178	+ shape.fill.opacity = alpha;
3179	+ }
3180	+ }
3181	+ }
3182	+ }
3183	+
3184	+ } );
3185	+ /**
3186	+ * Renderer for re-rendering img elements using VML. Kicks in if the img has
3187	+ * a border-radius applied, or if the -pie-png-fix flag is set.
3188	+ * @constructor
3189	+ * @param {Element} el The target element
3190	+ * @param {Object} styleInfos The StyleInfo objects
3191	+ * @param {PIE.RootRenderer} parent
3192	+ */
3193	+ PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
3194	+
3195	+ boxZIndex: 6,
3196	+ boxName: 'imgEl',
3197	+
3198	+ needsUpdate: function() {
3199	+ var si = this.styleInfos;
3200	+ return this.targetElement.src !== this._lastSrc \|\| si.borderRadiusInfo.changed();
3201	+ },
3202	+
3203	+ isActive: function() {
3204	+ var si = this.styleInfos;
3205	+ return si.borderRadiusInfo.isActive() \|\| si.backgroundInfo.isPngFix();
3206	+ },
3207	+
3208	+ draw: function() {
3209	+ this._lastSrc = src;
3210	+ this.hideActualImg();
3211	+
3212	+ var shape = this.getShape( 'img', 'fill', this.getBox() ),
3213	+ fill = shape.fill,
3214	+ bounds = this.boundsInfo.getBounds(),
3215	+ w = bounds.w,
3216	+ h = bounds.h,
3217	+ borderProps = this.styleInfos.borderInfo.getProps(),
3218	+ borderWidths = borderProps && borderProps.widths,
3219	+ el = this.targetElement,
3220	+ src = el.src,
3221	+ round = Math.round,
3222	+ s;
3223	+
3224	+ shape.stroked = false;
3225	+ fill.type = 'frame';
3226	+ fill.src = src;
3227	+ fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
3228	+ shape.coordsize = w * 2 + ',' + h * 2;
3229	+ shape.coordorigin = '1,1';
3230	+ shape.path = this.getBoxPath( borderWidths ? {
3231	+ t: round( borderWidths['t'].pixels( el ) ),
3232	+ r: round( borderWidths['r'].pixels( el ) ),
3233	+ b: round( borderWidths['b'].pixels( el ) ),
3234	+ l: round( borderWidths['l'].pixels( el ) )
3235	+ } : 0, 2 );
3236	+ s = shape.style;
3237	+ s.width = w;
3238	+ s.height = h;
3239	+ },
3240	+
3241	+ hideActualImg: function() {
3242	+ this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
3243	+ },
3244	+
3245	+ destroy: function() {
3246	+ PIE.RendererBase.destroy.call( this );
3247	+ this.targetElement.runtimeStyle.filter = '';
3248	+ }
3249	+
3250	+ } );
3251	+
3252	+ PIE.Element = (function() {
3253	+
3254	+ var wrappers = {},
3255	+ lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
3256	+ pollCssProp = PIE.CSS_PREFIX + 'poll',
3257	+ hoverClass = ' ' + PIE.CLASS_PREFIX + 'hover',
3258	+ hoverClassRE = new RegExp( '\\b' + PIE.CLASS_PREFIX + 'hover\\b', 'g' ),
3259	+ ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 };
3260	+
3261	+
3262	+ function addListener( el, type, handler ) {
3263	+ el.attachEvent( type, handler );
3264	+ }
3265	+
3266	+ function removeListener( el, type, handler ) {
3267	+ el.detachEvent( type, handler );
3268	+ }
3269	+
3270	+
3271	+ function Element( el ) {
3272	+ var renderers,
3273	+ boundsInfo = new PIE.BoundsInfo( el ),
3274	+ styleInfos,
3275	+ styleInfosArr,
3276	+ ancestors,
3277	+ initializing,
3278	+ initialized,
3279	+ eventsAttached,
3280	+ delayed,
3281	+ destroyed,
3282	+ poll;
3283	+
3284	+ /**
3285	+ * Initialize PIE for this element.
3286	+ */
3287	+ function init() {
3288	+ if( !initialized ) {
3289	+ var docEl,
3290	+ bounds,
3291	+ cs = el.currentStyle,
3292	+ lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
3293	+ rootRenderer;
3294	+
3295	+ // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
3296	+ poll = cs.getAttribute( pollCssProp );
3297	+ poll = PIE.ieDocMode === 8 ? poll !== 'false' : poll === 'true';
3298	+
3299	+ // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
3300	+ // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
3301	+ if( !initializing ) {
3302	+ initializing = 1;
3303	+ el.runtimeStyle.zoom = 1;
3304	+ initFirstChildPseudoClass();
3305	+ }
3306	+
3307	+ boundsInfo.lock();
3308	+
3309	+ // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
3310	+ if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement \|\| doc.body ) &&
3311	+ ( bounds.y > docEl.clientHeight \|\| bounds.x > docEl.clientWidth \|\| bounds.y + bounds.h < 0 \|\| bounds.x + bounds.w < 0 ) ) {
3312	+ if( !delayed ) {
3313	+ delayed = 1;
3314	+ PIE.OnScroll.observe( init );
3315	+ }
3316	+ } else {
3317	+ initialized = 1;
3318	+ delayed = initializing = 0;
3319	+ PIE.OnScroll.unobserve( init );
3320	+
3321	+ // Create the style infos and renderers
3322	+ styleInfos = {
3323	+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
3324	+ borderInfo: new PIE.BorderStyleInfo( el ),
3325	+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
3326	+ borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
3327	+ boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
3328	+ visibilityInfo: new PIE.VisibilityStyleInfo( el )
3329	+ };
3330	+ styleInfosArr = [
3331	+ styleInfos.backgroundInfo,
3332	+ styleInfos.borderInfo,
3333	+ styleInfos.borderImageInfo,
3334	+ styleInfos.borderRadiusInfo,
3335	+ styleInfos.boxShadowInfo,
3336	+ styleInfos.visibilityInfo
3337	+ ];
3338	+
3339	+ rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
3340	+ var childRenderers = [
3341	+ new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3342	+ new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3343	+ //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3344	+ new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3345	+ new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
3346	+ ];
3347	+ if( el.tagName === 'IMG' ) {
3348	+ childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
3349	+ }
3350	+ rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
3351	+ renderers = [ rootRenderer ].concat( childRenderers );
3352	+
3353	+ // Add property change listeners to ancestors if requested
3354	+ initAncestorPropChangeListeners();
3355	+
3356	+ // Add to list of polled elements in IE8
3357	+ if( poll ) {
3358	+ PIE.Heartbeat.observe( update );
3359	+ PIE.Heartbeat.run();
3360	+ }
3361	+
3362	+ // Trigger rendering
3363	+ update( 1 );
3364	+ }
3365	+
3366	+ if( !eventsAttached ) {
3367	+ eventsAttached = 1;
3368	+ addListener( el, 'onmove', handleMoveOrResize );
3369	+ addListener( el, 'onresize', handleMoveOrResize );
3370	+ addListener( el, 'onpropertychange', propChanged );
3371	+ addListener( el, 'onmouseenter', mouseEntered );
3372	+ addListener( el, 'onmouseleave', mouseLeft );
3373	+ PIE.OnResize.observe( handleMoveOrResize );
3374	+
3375	+ PIE.OnBeforeUnload.observe( removeEventListeners );
3376	+ }
3377	+
3378	+ boundsInfo.unlock();
3379	+ }
3380	+ }
3381	+
3382	+
3383	+
3384	+
3385	+ /**
3386	+ * Event handler for onmove and onresize events. Invokes update() only if the element's
3387	+ * bounds have previously been calculated, to prevent multiple runs during page load when
3388	+ * the element has no initial CSS3 properties.
3389	+ */
3390	+ function handleMoveOrResize() {
3391	+ if( boundsInfo && boundsInfo.hasBeenQueried() ) {
3392	+ update();
3393	+ }
3394	+ }
3395	+
3396	+
3397	+ /**
3398	+ * Update position and/or size as necessary. Both move and resize events call
3399	+ * this rather than the updatePos/Size functions because sometimes, particularly
3400	+ * during page load, one will fire but the other won't.
3401	+ */
3402	+ function update( force ) {
3403	+ if( !destroyed ) {
3404	+ if( initialized ) {
3405	+ var i, len;
3406	+
3407	+ lockAll();
3408	+ if( force \|\| boundsInfo.positionChanged() ) {
3409	+ /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
3410	+ position changes may not always be accurate; it's possible that
3411	+ an element will actually move relative to its positioning parent, but its position
3412	+ relative to the viewport will stay the same. Need to come up with a better way to
3413	+ track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
3414	+ but that is a more expensive operation since it does some DOM walking, and we want this
3415	+ check to be as fast as possible. */
3416	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3417	+ renderers[i].updatePos();
3418	+ }
3419	+ }
3420	+ if( force \|\| boundsInfo.sizeChanged() ) {
3421	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3422	+ renderers[i].updateSize();
3423	+ }
3424	+ }
3425	+ unlockAll();
3426	+ }
3427	+ else if( !initializing ) {
3428	+ init();
3429	+ }
3430	+ }
3431	+ }
3432	+
3433	+ /**
3434	+ * Handle property changes to trigger update when appropriate.
3435	+ */
3436	+ function propChanged() {
3437	+ var i, len, renderer,
3438	+ e = event;
3439	+
3440	+ // Some elements like <table> fire onpropertychange events for old-school background properties
3441	+ // ('background', 'bgColor') when runtimeStyle background properties are changed, which
3442	+ // results in an infinite loop; therefore we filter out those property names. Also, 'display'
3443	+ // is ignored because size calculations don't work correctly immediately when its onpropertychange
3444	+ // event fires, and because it will trigger an onresize event anyway.
3445	+ if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
3446	+ if( initialized ) {
3447	+ lockAll();
3448	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3449	+ renderer = renderers[i];
3450	+ // Make sure position is synced if the element hasn't already been rendered.
3451	+ // TODO this feels sloppy - look into merging propChanged and update functions
3452	+ if( !renderer.isPositioned ) {
3453	+ renderer.updatePos();
3454	+ }
3455	+ if( renderer.needsUpdate() ) {
3456	+ renderer.updateProps();
3457	+ }
3458	+ }
3459	+ unlockAll();
3460	+ }
3461	+ else if( !initializing ) {
3462	+ init();
3463	+ }
3464	+ }
3465	+ }
3466	+
3467	+
3468	+ function addHoverClass() {
3469	+ if( el ) {
3470	+ el.className += hoverClass;
3471	+ }
3472	+ }
3473	+
3474	+ function removeHoverClass() {
3475	+ if( el ) {
3476	+ el.className = el.className.replace( hoverClassRE, '' );
3477	+ }
3478	+ }
3479	+
3480	+ /**
3481	+ * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
3482	+ * hover styles to non-link elements, and to trigger a propertychange update.
3483	+ */
3484	+ function mouseEntered() {
3485	+ //must delay this because the mouseenter event fires before the :hover styles are added.
3486	+ setTimeout( addHoverClass, 0 );
3487	+ }
3488	+
3489	+ /**
3490	+ * Handle mouseleave events
3491	+ */
3492	+ function mouseLeft() {
3493	+ //must delay this because the mouseleave event fires before the :hover styles are removed.
3494	+ setTimeout( removeHoverClass, 0 );
3495	+ }
3496	+
3497	+
3498	+ /**
3499	+ * Handle property changes on ancestors of the element; see initAncestorPropChangeListeners()
3500	+ * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
3501	+ */
3502	+ function ancestorPropChanged() {
3503	+ var name = event.propertyName;
3504	+ if( name === 'className' \|\| name === 'id' ) {
3505	+ propChanged();
3506	+ }
3507	+ }
3508	+
3509	+ function lockAll() {
3510	+ boundsInfo.lock();
3511	+ for( var i = styleInfosArr.length; i--; ) {
3512	+ styleInfosArr[i].lock();
3513	+ }
3514	+ }
3515	+
3516	+ function unlockAll() {
3517	+ for( var i = styleInfosArr.length; i--; ) {
3518	+ styleInfosArr[i].unlock();
3519	+ }
3520	+ boundsInfo.unlock();
3521	+ }
3522	+
3523	+
3524	+ /**
3525	+ * Remove all event listeners from the element and any monitoried ancestors.
3526	+ */
3527	+ function removeEventListeners() {
3528	+ if (eventsAttached) {
3529	+ if( ancestors ) {
3530	+ for( var i = 0, len = ancestors.length, a; i < len; i++ ) {
3531	+ a = ancestors[i];
3532	+ removeListener( a, 'onpropertychange', ancestorPropChanged );
3533	+ removeListener( a, 'onmouseenter', mouseEntered );
3534	+ removeListener( a, 'onmouseleave', mouseLeft );
3535	+ }
3536	+ }
3537	+
3538	+ // Remove event listeners
3539	+ removeListener( el, 'onmove', update );
3540	+ removeListener( el, 'onresize', update );
3541	+ removeListener( el, 'onpropertychange', propChanged );
3542	+ removeListener( el, 'onmouseenter', mouseEntered );
3543	+ removeListener( el, 'onmouseleave', mouseLeft );
3544	+
3545	+ PIE.OnBeforeUnload.unobserve( removeEventListeners );
3546	+ eventsAttached = 0;
3547	+ }
3548	+ }
3549	+
3550	+
3551	+ /**
3552	+ * Clean everything up when the behavior is removed from the element, or the element
3553	+ * is manually destroyed.
3554	+ */
3555	+ function destroy() {
3556	+ if( !destroyed ) {
3557	+ var i, len;
3558	+
3559	+ removeEventListeners();
3560	+
3561	+ destroyed = 1;
3562	+
3563	+ // destroy any active renderers
3564	+ if( renderers ) {
3565	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3566	+ renderers[i].destroy();
3567	+ }
3568	+ }
3569	+
3570	+ // Remove from list of polled elements in IE8
3571	+ if( poll ) {
3572	+ PIE.Heartbeat.unobserve( update );
3573	+ }
3574	+ // Stop onresize listening
3575	+ PIE.OnResize.unobserve( update );
3576	+
3577	+ // Kill references
3578	+ renderers = boundsInfo = styleInfos = styleInfosArr = ancestors = el = null;
3579	+ }
3580	+ }
3581	+
3582	+
3583	+ /**
3584	+ * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange listeners
3585	+ * to ancestor(s) of the element so we can pick up style changes based on CSS rules using
3586	+ * descendant selectors.
3587	+ */
3588	+ function initAncestorPropChangeListeners() {
3589	+ var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
3590	+ i, a;
3591	+ if( watch ) {
3592	+ ancestors = [];
3593	+ watch = parseInt( watch, 10 );
3594	+ i = 0;
3595	+ a = el.parentNode;
3596	+ while( a && ( watch === 'NaN' \|\| i++ < watch ) ) {
3597	+ ancestors.push( a );
3598	+ addListener( a, 'onpropertychange', ancestorPropChanged );
3599	+ addListener( a, 'onmouseenter', mouseEntered );
3600	+ addListener( a, 'onmouseleave', mouseLeft );
3601	+ a = a.parentNode;
3602	+ }
3603	+ }
3604	+ }
3605	+
3606	+
3607	+ /**
3608	+ * If the target element is a first child, add a pie_first-child class to it. This allows using
3609	+ * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
3610	+ * pseudo-class selector.
3611	+ */
3612	+ function initFirstChildPseudoClass() {
3613	+ var tmpEl = el,
3614	+ isFirst = 1;
3615	+ while( tmpEl = tmpEl.previousSibling ) {
3616	+ if( tmpEl.nodeType === 1 ) {
3617	+ isFirst = 0;
3618	+ break;
3619	+ }
3620	+ }
3621	+ if( isFirst ) {
3622	+ el.className += ' ' + PIE.CLASS_PREFIX + 'first-child';
3623	+ }
3624	+ }
3625	+
3626	+
3627	+ // These methods are all already bound to this instance so there's no need to wrap them
3628	+ // in a closure to maintain the 'this' scope object when calling them.
3629	+ this.init = init;
3630	+ this.update = update;
3631	+ this.destroy = destroy;
3632	+ this.el = el;
3633	+ }
3634	+
3635	+ Element.getInstance = function( el ) {
3636	+ var id = PIE.Util.getUID( el );
3637	+ return wrappers[ id ] \|\| ( wrappers[ id ] = new Element( el ) );
3638	+ };
3639	+
3640	+ Element.destroy = function( el ) {
3641	+ var id = PIE.Util.getUID( el ),
3642	+ wrapper = wrappers[ id ];
3643	+ if( wrapper ) {
3644	+ wrapper.destroy();
3645	+ delete wrappers[ id ];
3646	+ }
3647	+ };
3648	+
3649	+ Element.destroyAll = function() {
3650	+ var els = [], wrapper;
3651	+ if( wrappers ) {
3652	+ for( var w in wrappers ) {
3653	+ if( wrappers.hasOwnProperty( w ) ) {
3654	+ wrapper = wrappers[ w ];
3655	+ els.push( wrapper.el );
3656	+ wrapper.destroy();
3657	+ }
3658	+ }
3659	+ wrappers = {};
3660	+ }
3661	+ return els;
3662	+ };
3663	+
3664	+ return Element;
3665	+ })();
3666	+
3667	+ /*
3668	+ * This file exposes the public API for invoking PIE.
3669	+ */
3670	+
3671	+
3672	+ /**
3673	+ * Programatically attach PIE to a single element.
3674	+ * @param {Element} el
3675	+ */
3676	+ PIE[ 'attach' ] = function( el ) {
3677	+ if (PIE.ieDocMode < 9) {
3678	+ PIE.Element.getInstance( el ).init();
3679	+ }
3680	+ };
3681	+
3682	+
3683	+ /**
3684	+ * Programatically detach PIE from a single element.
3685	+ * @param {Element} el
3686	+ */
3687	+ PIE[ 'detach' ] = function( el ) {
3688	+ PIE.Element.destroy( el );
3689	+ };
3690	+
3691	+
3692	+ } // if( !PIE )
3693	+ var p = window['PIE'],
3694	+ el = element;
3695	+
3696	+ function init() {
3697	+ if( p && doc.media !== 'print' ) { // IE strangely attaches a second copy of the behavior to elements when printing
3698	+ p['attach']( el );
3699	+ }
3700	+ }
3701	+
3702	+ function cleanup() {
3703	+ if (p) {
3704	+ p['detach']( el );
3705	+ p = el = 0;
3706	+ }
3707	+ }
3708	+
3709	+ if( el.readyState === 'complete' ) {
3710	+ init();
3711	+ }
3712	+ </script>
3713	+ </PUBLIC:COMPONENT>

js/PIE/PIE_uncompressed.js CHANGED Viewed

@@ -1,3688 +1,3688 @@
-            -
            /*
-            -
            PIE: CSS3 rendering for IE
-            -
            Version 1.0beta4
-            -
            http://css3pie.com
-            -
            Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
-            -
            */
-            -
            (function(){
-            -
            var doc = document;var PIE = window['PIE'];
-            -
-            -
            if( !PIE ) {
-            -
                PIE = window['PIE'] = {
-            -
                    CSS_PREFIX: '-pie-',
-            -
                    STYLE_PREFIX: 'Pie',
-            -
                    CLASS_PREFIX: 'pie_',
-            -
                    tableCellTags: {
-            -
                        'TD': 1,
-            -
                        'TH': 1
-            -
                    }
-            -
                };
-            -
-            -
                // Force the background cache to be used. No reason it shouldn't be.
-            -
                try {
-            -
                    doc.execCommand( 'BackgroundImageCache', false, true );
-            -
                } catch(e) {}
-            -
-            -
                /*
-            -
                 * IE version detection approach by James Padolsey, with modifications -- from
-            -
                 * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
-            -
                 */
-            -
                PIE.ieVersion = function(){
-            -
                    var v = 4,
-            -
                        div = doc.createElement('div'),
-            -
                        all = div.getElementsByTagName('i');
-            -
-            -
                    while (
-            -
                        div.innerHTML = '<!--[if gt IE ' + (++v) + ']><i></i><![endif]-->',
-            -
                        all[0]
-            -
                    ) {}
-            -
-            -
                    return v;
-            -
                }();
-            -
-            -
                // Detect IE6
-            -
                if( PIE.ieVersion === 6 ) {
-            -
                    // IE6 can't access properties with leading dash, but can without it.
-            -
                    PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
-            -
                }
-            -
-            -
                // Detect IE8
-            -
                PIE.ieDocMode = doc.documentMode || PIE.ieVersion;
-            -
            /**
-            -
             * Utility functions
-            -
             */
-            -
            (function() {
-            -
                var vmlCreatorDoc,
-            -
                    idNum = 0,
-            -
                    imageSizes = {};
-            -
-            -
-            -
                PIE.Util = {
-            -
-            -
                    /**
-            -
                     * To create a VML element, it must be created by a Document which has the VML
-            -
                     * namespace set. Unfortunately, if you try to add the namespace programatically
-            -
                     * into the main document, you will get an "Unspecified error" when trying to
-            -
                     * access document.namespaces before the document is finished loading. To get
-            -
                     * around this, we create a DocumentFragment, which in IE land is apparently a
-            -
                     * full-fledged Document. It allows adding namespaces immediately, so we add the
-            -
                     * namespace there and then have it create the VML element.
-            -
                     * @param {string} tag The tag name for the VML element
-            -
                     * @return {Element} The new VML element
-            -
                     */
-            -
                    createVmlElement: function( tag ) {
-            -
                        var vmlPrefix = 'css3vml';
-            -
                        if( !vmlCreatorDoc ) {
-            -
                            vmlCreatorDoc = doc.createDocumentFragment();
-            -
                            vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
-            -
                        }
-            -
                        return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Generate and return a unique ID for a given object. The generated ID is stored
-            -
                     * as a property of the object for future reuse.
-            -
                     * @param {Object} obj
-            -
                     */
-            -
                    getUID: function( obj ) {
-            -
                        return obj && obj[ '_pieId' ] || ( obj[ '_pieId' ] = ++idNum );
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Simple utility for merging objects
-            -
                     * @param {Object} obj1 The main object into which all others will be merged
-            -
                     * @param {...Object} var_args Other objects which will be merged into the first, in order
-            -
                     */
-            -
                    merge: function( obj1 ) {
-            -
                        var i, len, p, objN, args = arguments;
-            -
                        for( i = 1, len = args.length; i < len; i++ ) {
-            -
                            objN = args[i];
-            -
                            for( p in objN ) {
-            -
                                if( objN.hasOwnProperty( p ) ) {
-            -
                                    obj1[ p ] = objN[ p ];
-            -
                                }
-            -
                            }
-            -
                        }
-            -
                        return obj1;
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Execute a callback function, passing it the dimensions of a given image once
-            -
                     * they are known.
-            -
                     * @param {string} src The source URL of the image
-            -
                     * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
-            -
                     * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
-            -
                     */
-            -
                    withImageSize: function( src, func, ctx ) {
-            -
                        var size = imageSizes[ src ], img, queue;
-            -
                        if( size ) {
-            -
                            // If we have a queue, add to it
-            -
                            if( Object.prototype.toString.call( size ) === '[object Array]' ) {
-            -
                                size.push( [ func, ctx ] );
-            -
                            }
-            -
                            // Already have the size cached, call func right away
-            -
                            else {
-            -
                                func.call( ctx, size );
-            -
                            }
-            -
                        } else {
-            -
                            queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
-            -
                            img = new Image();
-            -
                            img.onload = function() {
-            -
                                size = imageSizes[ src ] = { w: img.width, h: img.height };
-            -
                                for( var i = 0, len = queue.length; i < len; i++ ) {
-            -
                                    queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
-            -
                                }
-            -
                                img.onload = null;
-            -
                            };
-            -
                            img.src = src;
-            -
                        }
-            -
                    }
-            -
                };
-            -
            })();/**
-            -
             *
-            -
             */
-            -
            PIE.Observable = function() {
-            -
                /**
-            -
                 * List of registered observer functions
-            -
                 */
-            -
                this.observers = [];
-            -
-            -
                /**
-            -
                 * Hash of function ids to their position in the observers list, for fast lookup
-            -
                 */
-            -
                this.indexes = {};
-            -
            };
-            -
            PIE.Observable.prototype = {
-            -
-            -
                observe: function( fn ) {
-            -
                    var id = PIE.Util.getUID( fn ),
-            -
                        indexes = this.indexes,
-            -
                        observers = this.observers;
-            -
                    if( !( id in indexes ) ) {
-            -
                        indexes[ id ] = observers.length;
-            -
                        observers.push( fn );
-            -
                    }
-            -
                },
-            -
-            -
                unobserve: function( fn ) {
-            -
                    var id = PIE.Util.getUID( fn ),
-            -
                        indexes = this.indexes;
-            -
                    if( id && id in indexes ) {
-            -
                        delete this.observers[ indexes[ id ] ];
-            -
                        delete indexes[ id ];
-            -
                    }
-            -
                },
-            -
-            -
                fire: function() {
-            -
                    var o = this.observers,
-            -
                        i = o.length;
-            -
                    while( i-- ) {
-            -
                        o[ i ] && o[ i ]();
-            -
                    }
-            -
                }
-            -
-            -
            };/*
-            -
             * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
-            -
             * always firing the onmove and onresize events when elements are moved or resized. We check a few
-            -
             * times every second to make sure the elements have the correct position and size. See Element.js
-            -
             * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8
-            -
             * and false elsewhere.
-            -
             */
-            -
-            -
            PIE.Heartbeat = new PIE.Observable();
-            -
            PIE.Heartbeat.run = function() {
-            -
                var me = this;
-            -
                if( !me.running ) {
-            -
                    setInterval( function() { me.fire() }, 250 );
-            -
                    me.running = 1;
-            -
                }
-            -
            };
-            -
            /**
-            -
             * Create an observable listener for the onbeforeunload event
-            -
             */
-            -
            PIE.OnBeforeUnload = new PIE.Observable();
-            -
            window.attachEvent( 'onbeforeunload', function() { PIE.OnBeforeUnload.fire(); } );
-            -
-            -
            /**
-            -
             * Attach an event which automatically gets detached onbeforeunload
-            -
             */
-            -
            PIE.OnBeforeUnload.attachManagedEvent = function( target, name, handler ) {
-            -
                target.attachEvent( name, handler );
-            -
                this.observe( function() {
-            -
                    target.detachEvent( name, handler );
-            -
                } );
-            -
            };/**
-            -
             * Create a single observable listener for window resize events.
-            -
             */
-            -
            (function() {
-            -
                PIE.OnResize = new PIE.Observable();
-            -
-            -
                function resized() {
-            -
                    PIE.OnResize.fire();
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onresize', resized );
-            -
            })();
-            -
            /**
-            -
             * Create a single observable listener for scroll events. Used for lazy loading based
-            -
             * on the viewport, and for fixed position backgrounds.
-            -
             */
-            -
            (function() {
-            -
                PIE.OnScroll = new PIE.Observable();
-            -
-            -
                function scrolled() {
-            -
                    PIE.OnScroll.fire();
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onscroll', scrolled );
-            -
-            -
                PIE.OnResize.observe( scrolled );
-            -
            })();
-            -
            /**
-            -
             * Listen for printing events, destroy all active PIE instances when printing, and
-            -
             * restore them afterward.
-            -
             */
-            -
            (function() {
-            -
-            -
                var elements;
-            -
-            -
                function beforePrint() {
-            -
                    elements = PIE.Element.destroyAll();
-            -
                }
-            -
-            -
                function afterPrint() {
-            -
                    if( elements ) {
-            -
                        for( var i = 0, len = elements.length; i < len; i++ ) {
-            -
                            PIE[ 'attach' ]( elements[i] );
-            -
                        }
-            -
                        elements = 0;
-            -
                    }
-            -
                }
-            -
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
-            -
                PIE.OnBeforeUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
-            -
-            -
            })();/**
-            -
             * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
-            -
             * value is returned from PIE.getLength() - always use that instead of instantiating directly.
-            -
             * @constructor
-            -
             * @param {string} val The CSS string representing the length. It is assumed that this will already have
-            -
             *                 been validated as a valid length or percentage syntax.
-            -
             */
-            -
            PIE.Length = (function() {
-            -
                var lengthCalcEl = doc.createElement( 'length-calc' ),
-            -
                    parent = doc.documentElement,
-            -
                    s = lengthCalcEl.style,
-            -
                    conversions = {},
-            -
                    units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
-            -
                    i = units.length,
-            -
                    instances = {};
-            -
-            -
                s.position = 'absolute';
-            -
                s.top = s.left = '-9999px';
-            -
-            -
                parent.appendChild( lengthCalcEl );
-            -
                while( i-- ) {
-            -
                    lengthCalcEl.style.width = '100' + units[i];
-            -
                    conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
-            -
                }
-            -
                parent.removeChild( lengthCalcEl );
-            -
-            -
-            -
                function Length( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
                Length.prototype = {
-            -
                    /**
-            -
                     * Regular expression for matching the length unit
-            -
                     * @private
-            -
                     */
-            -
                    unitRE: /(px|em|ex|mm|cm|in|pt|pc|%)$/,
-            -
-            -
                    /**
-            -
                     * Get the numeric value of the length
-            -
                     * @return {number} The value
-            -
                     */
-            -
                    getNumber: function() {
-            -
                        var num = this.num,
-            -
                            UNDEF;
-            -
                        if( num === UNDEF ) {
-            -
                            num = this.num = parseFloat( this.val );
-            -
                        }
-            -
                        return num;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Get the unit of the length
-            -
                     * @return {string} The unit
-            -
                     */
-            -
                    getUnit: function() {
-            -
                        var unit = this.unit,
-            -
                            m;
-            -
                        if( !unit ) {
-            -
                            m = this.val.match( this.unitRE );
-            -
                            unit = this.unit = ( m && m[0] ) || 'px';
-            -
                        }
-            -
                        return unit;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Determine whether this is a percentage length value
-            -
                     * @return {boolean}
-            -
                     */
-            -
                    isPercentage: function() {
-            -
                        return this.getUnit() === '%';
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Resolve this length into a number of pixels.
-            -
                     * @param {Element} el - the context element, used to resolve font-relative values
-            -
                     * @param {(function():number|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
-            -
                     *                  function which will be called to return the number.
-            -
                     */
-            -
                    pixels: function( el, pct100 ) {
-            -
                        var num = this.getNumber(),
-            -
                            unit = this.getUnit();
-            -
                        switch( unit ) {
-            -
                            case "px":
-            -
                                return num;
-            -
                            case "%":
-            -
                                return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
-            -
                            case "em":
-            -
                                return num * this.getEmPixels( el );
-            -
                            case "ex":
-            -
                                return num * this.getEmPixels( el ) / 2;
-            -
                            default:
-            -
                                return num * conversions[ unit ];
-            -
                        }
-            -
                    },
-            -
-            -
                    /**
-            -
                     * The em and ex units are relative to the font-size of the current element,
-            -
                     * however if the font-size is set using non-pixel units then we get that value
-            -
                     * rather than a pixel conversion. To get around this, we keep a floating element
-            -
                     * with width:1em which we insert into the target element and then read its offsetWidth.
-            -
                     * But if the font-size *is* specified in pixels, then we use that directly to avoid
-            -
                     * the expensive DOM manipulation.
-            -
                     * @param el
-            -
                     */
-            -
                    getEmPixels: function( el ) {
-            -
                        var fs = el.currentStyle.fontSize,
-            -
                            px;
-            -
-            -
                        if( fs.indexOf( 'px' ) > 0 ) {
-            -
                            return parseFloat( fs );
-            -
                        } else {
-            -
                            lengthCalcEl.style.width = '1em';
-            -
                            el.appendChild( lengthCalcEl );
-            -
                            px = lengthCalcEl.offsetWidth;
-            -
                            if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
-            -
                                el.removeChild( lengthCalcEl );
-            -
                            }
-            -
                            return px;
-            -
                        }
-            -
                    }
-            -
                };
-            -
-            -
-            -
                /**
-            -
                 * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
-            -
                 * @param {string} val The CSS string representing the length. It is assumed that this will already have
-            -
                 *                 been validated as a valid length or percentage syntax.
-            -
                 */
-            -
                PIE.getLength = function( val ) {
-            -
                    return instances[ val ] || ( instances[ val ] = new Length( val ) );
-            -
                };
-            -
-            -
                return Length;
-            -
            })();
-            -
            /**
-            -
             * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
-            -
             * @constructor
-            -
             * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
-            -
             */
-            -
            PIE.BgPosition = (function() {
-            -
-            -
                var length_fifty = PIE.getLength( '50%' ),
-            -
                    vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
-            -
                    horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
-            -
-            -
-            -
                function BgPosition( tokens ) {
-            -
                    this.tokens = tokens;
-            -
                }
-            -
                BgPosition.prototype = {
-            -
                    /**
-            -
                     * Normalize the values into the form:
-            -
                     * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
-            -
                     * where: xOffsetSide is either 'left' or 'right',
-            -
                     *        yOffsetSide is either 'top' or 'bottom',
-            -
                     *        and x/yOffsetLength are both PIE.Length objects.
-            -
                     * @return {Array}
-            -
                     */
-            -
                    getValues: function() {
-            -
                        if( !this._values ) {
-            -
                            var tokens = this.tokens,
-            -
                                len = tokens.length,
-            -
                                Tokenizer = PIE.Tokenizer,
-            -
                                identType = Tokenizer.Type,
-            -
                                length_zero = PIE.getLength( '0' ),
-            -
                                type_ident = identType.IDENT,
-            -
                                type_length = identType.LENGTH,
-            -
                                type_percent = identType.PERCENT,
-            -
                                type, value,
-            -
                                vals = [ 'left', length_zero, 'top', length_zero ];
-            -
-            -
                            // If only one value, the second is assumed to be 'center'
-            -
                            if( len === 1 ) {
-            -
                                tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
-            -
                                len++;
-            -
                            }
-            -
-            -
                            // Two values - CSS2
-            -
                            if( len === 2 ) {
-            -
                                // If both idents, they can appear in either order, so switch them if needed
-            -
                                if( type_ident & ( tokens[0].tokenType | tokens[1].tokenType ) &&
-            -
                                    tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
-            -
                                    tokens.push( tokens.shift() );
-            -
                                }
-            -
                                if( tokens[0].tokenType & type_ident ) {
-            -
                                    if( tokens[0].tokenValue === 'center' ) {
-            -
                                        vals[1] = length_fifty;
-            -
                                    } else {
-            -
                                        vals[0] = tokens[0].tokenValue;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokens[0].isLengthOrPercent() ) {
-            -
                                    vals[1] = PIE.getLength( tokens[0].tokenValue );
-            -
                                }
-            -
                                if( tokens[1].tokenType & type_ident ) {
-            -
                                    if( tokens[1].tokenValue === 'center' ) {
-            -
                                        vals[3] = length_fifty;
-            -
                                    } else {
-            -
                                        vals[2] = tokens[1].tokenValue;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokens[1].isLengthOrPercent() ) {
-            -
                                    vals[3] = PIE.getLength( tokens[1].tokenValue );
-            -
                                }
-            -
                            }
-            -
-            -
                            // Three or four values - CSS3
-            -
                            else {
-            -
                                // TODO
-            -
                            }
-            -
-            -
                            this._values = vals;
-            -
                        }
-            -
                        return this._values;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Find the coordinates of the background image from the upper-left corner of the background area.
-            -
                     * Note that these coordinate values are not rounded.
-            -
                     * @param {Element} el
-            -
                     * @param {number} width - the width for percentages (background area width minus image width)
-            -
                     * @param {number} height - the height for percentages (background area height minus image height)
-            -
                     * @return {Object} { x: Number, y: Number }
-            -
                     */
-            -
                    coords: function( el, width, height ) {
-            -
                        var vals = this.getValues(),
-            -
                            pxX = vals[1].pixels( el, width ),
-            -
                            pxY = vals[3].pixels( el, height );
-            -
-            -
                        return {
-            -
                            x: vals[0] === 'right' ? width - pxX : pxX,
-            -
                            y: vals[2] === 'bottom' ? height - pxY : pxY
-            -
                        };
-            -
                    }
-            -
                };
-            -
-            -
                return BgPosition;
-            -
            })();
-            -
            /**
-            -
             * Wrapper for angle values; handles conversion to degrees from all allowed angle units
-            -
             * @constructor
-            -
             * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
-            -
             */
-            -
            PIE.Angle = (function() {
-            -
                function Angle( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
                Angle.prototype = {
-            -
                    unitRE: /[a-z]+$/i,
-            -
-            -
                    /**
-            -
                     * @return {string} The unit of the angle value
-            -
                     */
-            -
                    getUnit: function() {
-            -
                        return this._unit || ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Get the numeric value of the angle in degrees.
-            -
                     * @return {number} The degrees value
-            -
                     */
-            -
                    degrees: function() {
-            -
                        var deg = this._deg, u, n;
-            -
                        if( deg === undefined ) {
-            -
                            u = this.getUnit();
-            -
                            n = parseFloat( this.val, 10 );
-            -
                            deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
-            -
                        }
-            -
                        return deg;
-            -
                    }
-            -
                };
-            -
-            -
                return Angle;
-            -
            })();/**
-            -
             * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
-            -
             * value is returned from PIE.getColor() - always use that instead of instantiating directly.
-            -
             * @constructor
-            -
             * @param {string} val The raw CSS string value for the color
-            -
             */
-            -
            PIE.Color = (function() {
-            -
                var instances = {};
-            -
-            -
                function Color( val ) {
-            -
                    this.val = val;
-            -
                }
-            -
-            -
                /**
-            -
                 * Regular expression for matching rgba colors and extracting their components
-            -
                 * @type {RegExp}
-            -
                 */
-            -
                Color.rgbaRE = /\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;
-            -
-            -
                Color.names = {
-            -
                    "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
-            -
                    "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
-            -
                    "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
-            -
                    "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
-            -
                    "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
-            -
                    "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
-            -
                    "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
-            -
                    "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
-            -
                    "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
-            -
                    "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
-            -
                    "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
-            -
                    "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
-            -
                    "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
-            -
                    "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
-            -
                    "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
-            -
                    "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
-            -
                    "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
-            -
                    "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
-            -
                    "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
-            -
                    "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
-            -
                    "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
-            -
                    "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
-            -
                    "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
-            -
                    "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
-            -
                    "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
-            -
                    "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
-            -
                    "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
-            -
                    "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
-            -
                    "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
-            -
                    "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
-            -
                    "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
-            -
                    "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
-            -
                    "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
-            -
                    "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
-            -
                    "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
-            -
                    "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
-            -
                    "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
-            -
                    "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
-            -
                    "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
-            -
                    "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
-            -
                    "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
-            -
                    "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
-            -
                    "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
-            -
                    "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
-            -
                    "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
-            -
                    "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
-            -
                    "yellow":"FF0", "yellowgreen":"9ACD32"
-            -
                };
-            -
-            -
                Color.prototype = {
-            -
                    /**
-            -
                     * @private
-            -
                     */
-            -
                    parse: function() {
-            -
                        if( !this._color ) {
-            -
                            var me = this,
-            -
                                v = me.val,
-            -
                                vLower,
-            -
                                m = v.match( Color.rgbaRE );
-            -
                            if( m ) {
-            -
                                me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
-            -
                                me._alpha = parseFloat( m[4] );
-            -
                            }
-            -
                            else {
-            -
                                if( ( vLower = v.toLowerCase() ) in Color.names ) {
-            -
                                    v = '#' + Color.names[vLower];
-            -
                                }
-            -
                                me._color = v;
-            -
                                me._alpha = ( v === 'transparent' ? 0 : 1 );
-            -
                            }
-            -
                        }
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve the value of the color in a format usable by IE natively. This will be the same as
-            -
                     * the raw input value, except for rgba values which will be converted to an rgb value.
-            -
                     * @param {Element} el The context element, used to get 'currentColor' keyword value.
-            -
                     * @return {string} Color value
-            -
                     */
-            -
                    colorValue: function( el ) {
-            -
                        this.parse();
-            -
                        return this._color === 'currentColor' ? el.currentStyle.color : this._color;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
-            -
                     * with an alpha component.
-            -
                     * @return {number} The alpha value, from 0 to 1.
-            -
                     */
-            -
                    alpha: function() {
-            -
                        this.parse();
-            -
                        return this._alpha;
-            -
                    }
-            -
                };
-            -
-            -
-            -
                /**
-            -
                 * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
-            -
                 * @param {string} val The CSS string representing the color. It is assumed that this will already have
-            -
                 *                 been validated as a valid color syntax.
-            -
                 */
-            -
                PIE.getColor = function(val) {
-            -
                    return instances[ val ] || ( instances[ val ] = new Color( val ) );
-            -
                };
-            -
-            -
                return Color;
-            -
            })();/**
-            -
             * A tokenizer for CSS value strings.
-            -
             * @constructor
-            -
             * @param {string} css The CSS value string
-            -
             */
-            -
            PIE.Tokenizer = (function() {
-            -
                function Tokenizer( css ) {
-            -
                    this.css = css;
-            -
                    this.ch = 0;
-            -
                    this.tokens = [];
-            -
                    this.tokenIndex = 0;
-            -
                }
-            -
-            -
                /**
-            -
                 * Enumeration of token type constants.
-            -
                 * @enum {number}
-            -
                 */
-            -
                var Type = Tokenizer.Type = {
-            -
                    ANGLE: 1,
-            -
                    CHARACTER: 2,
-            -
                    COLOR: 4,
-            -
                    DIMEN: 8,
-            -
                    FUNCTION: 16,
-            -
                    IDENT: 32,
-            -
                    LENGTH: 64,
-            -
                    NUMBER: 128,
-            -
                    OPERATOR: 256,
-            -
                    PERCENT: 512,
-            -
                    STRING: 1024,
-            -
                    URL: 2048
-            -
                };
-            -
-            -
                /**
-            -
                 * A single token
-            -
                 * @constructor
-            -
                 * @param {number} type The type of the token - see PIE.Tokenizer.Type
-            -
                 * @param {string} value The value of the token
-            -
                 */
-            -
                Tokenizer.Token = function( type, value ) {
-            -
                    this.tokenType = type;
-            -
                    this.tokenValue = value;
-            -
                };
-            -
                Tokenizer.Token.prototype = {
-            -
                    isLength: function() {
-            -
                        return this.tokenType & Type.LENGTH || ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
-            -
                    },
-            -
                    isLengthOrPercent: function() {
-            -
                        return this.isLength() || this.tokenType & Type.PERCENT;
-            -
                    }
-            -
                };
-            -
-            -
                Tokenizer.prototype = {
-            -
                    whitespace: /\s/,
-            -
                    number: /^[\+\-]?(\d*\.)?\d+/,
-            -
                    url: /^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,
-            -
                    ident: /^\-?[_a-z][\w-]*/i,
-            -
                    string: /^("([^"]*)"|'([^']*)')/,
-            -
                    operator: /^[\/,]/,
-            -
                    hash: /^#[\w]+/,
-            -
                    hashColor: /^#([\da-f]{6}|[\da-f]{3})/i,
-            -
-            -
                    unitTypes: {
-            -
                        'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
-            -
                        'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
-            -
                        'pt': Type.LENGTH, 'pc': Type.LENGTH,
-            -
                        'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
-            -
                    },
-            -
-            -
                    colorNames: {
-            -
                        'aqua':1, 'black':1, 'blue':1, 'fuchsia':1, 'gray':1, 'green':1, 'lime':1, 'maroon':1,
-            -
                        'navy':1, 'olive':1, 'purple':1, 'red':1, 'silver':1, 'teal':1, 'white':1, 'yellow': 1,
-            -
                        'currentColor': 1
-            -
                    },
-            -
-            -
                    colorFunctions: {
-            -
                        'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
-            -
                    },
-            -
-            -
-            -
                    /**
-            -
                     * Advance to and return the next token in the CSS string. If the end of the CSS string has
-            -
                     * been reached, null will be returned.
-            -
                     * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
-            -
                     * @return {PIE.Tokenizer.Token}
-            -
                     */
-            -
                    next: function( forget ) {
-            -
                        var css, ch, firstChar, match, val,
-            -
                            me = this;
-            -
-            -
                        function newToken( type, value ) {
-            -
                            var tok = new Tokenizer.Token( type, value );
-            -
                            if( !forget ) {
-            -
                                me.tokens.push( tok );
-            -
                                me.tokenIndex++;
-            -
                            }
-            -
                            return tok;
-            -
                        }
-            -
                        function failure() {
-            -
                            me.tokenIndex++;
-            -
                            return null;
-            -
                        }
-            -
-            -
                        // In case we previously backed up, return the stored token in the next slot
-            -
                        if( this.tokenIndex < this.tokens.length ) {
-            -
                            return this.tokens[ this.tokenIndex++ ];
-            -
                        }
-            -
-            -
                        // Move past leading whitespace characters
-            -
                        while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
-            -
                            this.ch++;
-            -
                        }
-            -
                        if( this.ch >= this.css.length ) {
-            -
                            return failure();
-            -
                        }
-            -
-            -
                        ch = this.ch;
-            -
                        css = this.css.substring( this.ch );
-            -
                        firstChar = css.charAt( 0 );
-            -
                        switch( firstChar ) {
-            -
                            case '#':
-            -
                                if( match = css.match( this.hashColor ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.COLOR, match[0] );
-            -
                                }
-            -
                                break;
-            -
-            -
                            case '"':
-            -
                            case "'":
-            -
                                if( match = css.match( this.string ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.STRING, match[2] || match[3] || '' );
-            -
                                }
-            -
                                break;
-            -
-            -
                            case "/":
-            -
                            case ",":
-            -
                                this.ch++;
-            -
                                return newToken( Type.OPERATOR, firstChar );
-            -
-            -
                            case 'u':
-            -
                                if( match = css.match( this.url ) ) {
-            -
                                    this.ch += match[0].length;
-            -
                                    return newToken( Type.URL, match[2] || match[3] || match[4] || '' );
-            -
                                }
-            -
                        }
-            -
-            -
                        // Numbers and values starting with numbers
-            -
                        if( match = css.match( this.number ) ) {
-            -
                            val = match[0];
-            -
                            this.ch += val.length;
-            -
-            -
                            // Check if it is followed by a unit
-            -
                            if( css.charAt( val.length ) === '%' ) {
-            -
                                this.ch++;
-            -
                                return newToken( Type.PERCENT, val + '%' );
-            -
                            }
-            -
                            if( match = css.substring( val.length ).match( this.ident ) ) {
-            -
                                val += match[0];
-            -
                                this.ch += match[0].length;
-            -
                                return newToken( this.unitTypes[ match[0].toLowerCase() ] || Type.DIMEN, val );
-            -
                            }
-            -
-            -
                            // Plain ol' number
-            -
                            return newToken( Type.NUMBER, val );
-            -
                        }
-            -
-            -
                        // Identifiers
-            -
                        if( match = css.match( this.ident ) ) {
-            -
                            val = match[0];
-            -
                            this.ch += val.length;
-            -
-            -
                            // Named colors
-            -
                            if( val.toLowerCase() in PIE.Color.names || val === 'currentColor' ) {
-            -
                                return newToken( Type.COLOR, val );
-            -
                            }
-            -
-            -
                            // Functions
-            -
                            if( css.charAt( val.length ) === '(' ) {
-            -
                                this.ch++;
-            -
-            -
                                // Color values in function format: rgb, rgba, hsl, hsla
-            -
                                if( val.toLowerCase() in this.colorFunctions ) {
-            -
                                    function isNum( tok ) {
-            -
                                        return tok && tok.tokenType & Type.NUMBER;
-            -
                                    }
-            -
                                    function isNumOrPct( tok ) {
-            -
                                        return tok && ( tok.tokenType & ( Type.NUMBER | Type.PERCENT ) );
-            -
                                    }
-            -
                                    function isValue( tok, val ) {
-            -
                                        return tok && tok.tokenValue === val;
-            -
                                    }
-            -
                                    function next() {
-            -
                                        return me.next( 1 );
-            -
                                    }
-            -
-            -
                                    if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
-            -
                                        isValue( next(), ',' ) &&
-            -
                                        isNumOrPct( next() ) &&
-            -
                                        isValue( next(), ',' ) &&
-            -
                                        isNumOrPct( next() ) &&
-            -
                                        ( val === 'rgb' || val === 'hsa' || (
-            -
                                            isValue( next(), ',' ) &&
-            -
                                            isNum( next() )
-            -
                                        ) ) &&
-            -
                                        isValue( next(), ')' ) ) {
-            -
                                        return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
-            -
                                    }
-            -
                                    return failure();
-            -
                                }
-            -
-            -
                                return newToken( Type.FUNCTION, val );
-            -
                            }
-            -
-            -
                            // Other identifier
-            -
                            return newToken( Type.IDENT, val );
-            -
                        }
-            -
-            -
                        // Standalone character
-            -
                        this.ch++;
-            -
                        return newToken( Type.CHARACTER, firstChar );
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Determine whether there is another token
-            -
                     * @return {boolean}
-            -
                     */
-            -
                    hasNext: function() {
-            -
                        var next = this.next();
-            -
                        this.prev();
-            -
                        return !!next;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Back up and return the previous token
-            -
                     * @return {PIE.Tokenizer.Token}
-            -
                     */
-            -
                    prev: function() {
-            -
                        return this.tokens[ this.tokenIndex-- - 2 ];
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Retrieve all the tokens in the CSS string
-            -
                     * @return {Array.<PIE.Tokenizer.Token>}
-            -
                     */
-            -
                    all: function() {
-            -
                        while( this.next() ) {}
-            -
                        return this.tokens;
-            -
                    },
-            -
-            -
                    /**
-            -
                     * Return a list of tokens from the current position until the given function returns
-            -
                     * true. The final token will not be included in the list.
-            -
                     * @param {function():boolean} func - test function
-            -
                     * @param {boolean} require - if true, then if the end of the CSS string is reached
-            -
                     *        before the test function returns true, null will be returned instead of the
-            -
                     *        tokens that have been found so far.
-            -
                     * @return {Array.<PIE.Tokenizer.Token>}
-            -
                     */
-            -
                    until: function( func, require ) {
-            -
                        var list = [], t, hit;
-            -
                        while( t = this.next() ) {
-            -
                            if( func( t ) ) {
-            -
                                hit = true;
-            -
                                this.prev();
-            -
                                break;
-            -
                            }
-            -
                            list.push( t );
-            -
                        }
-            -
                        return require && !hit ? null : list;
-            -
                    }
-            -
                };
-            -
-            -
                return Tokenizer;
-            -
            })();/**
-            -
             * Handles calculating, caching, and detecting changes to size and position of the element.
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BoundsInfo = function( el ) {
-            -
                this.targetElement = el;
-            -
            };
-            -
            PIE.BoundsInfo.prototype = {
-            -
-            -
                _locked: 0,
-            -
-            -
                positionChanged: function() {
-            -
                    var last = this._lastBounds,
-            -
                        bounds;
-            -
                    return !last || ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x || last.y !== bounds.y ) );
-            -
                },
-            -
-            -
                sizeChanged: function() {
-            -
                    var last = this._lastBounds,
-            -
                        bounds;
-            -
                    return !last || ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w || last.h !== bounds.h ) );
-            -
                },
-            -
-            -
                getLiveBounds: function() {
-            -
                    var rect = this.targetElement.getBoundingClientRect();
-            -
                    return {
-            -
                        x: rect.left,
-            -
                        y: rect.top,
-            -
                        w: rect.right - rect.left,
-            -
                        h: rect.bottom - rect.top
-            -
                    };
-            -
                },
-            -
-            -
                getBounds: function() {
-            -
                    return this._locked ?
-            -
                            ( this._lockedBounds || ( this._lockedBounds = this.getLiveBounds() ) ) :
-            -
                            this.getLiveBounds();
-            -
                },
-            -
-            -
                hasBeenQueried: function() {
-            -
                    return !!this._lastBounds;
-            -
                },
-            -
-            -
                lock: function() {
-            -
                    ++this._locked;
-            -
                },
-            -
-            -
                unlock: function() {
-            -
                    if( !--this._locked ) {
-            -
                        if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
-            -
                        this._lockedBounds = null;
-            -
                    }
-            -
                }
-            -
-            -
            };
-            -
            (function() {
-            -
-            -
            function cacheWhenLocked( fn ) {
-            -
                var uid = PIE.Util.getUID( fn );
-            -
                return function() {
-            -
                    if( this._locked ) {
-            -
                        var cache = this._lockedValues || ( this._lockedValues = {} );
-            -
                        return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
-            -
                    } else {
-            -
                        return fn.call( this );
-            -
                    }
-            -
                }
-            -
            }
-            -
-            -
-            -
            PIE.StyleInfoBase = {
-            -
-            -
                _locked: 0,
-            -
-            -
                /**
-            -
                 * Create a new StyleInfo class, with the standard constructor, and augmented by
-            -
                 * the StyleInfoBase's members.
-            -
                 * @param proto
-            -
                 */
-            -
                newStyleInfo: function( proto ) {
-            -
                    function StyleInfo( el ) {
-            -
                        this.targetElement = el;
-            -
                    }
-            -
                    PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
-            -
                    StyleInfo._propsCache = {};
-            -
                    return StyleInfo;
-            -
                },
-            -
-            -
                /**
-            -
                 * Get an object representation of the target CSS style, caching it for each unique
-            -
                 * CSS value string.
-            -
                 * @return {Object}
-            -
                 */
-            -
                getProps: function() {
-            -
                    var css = this.getCss(),
-            -
                        cache = this.constructor._propsCache;
-            -
                    return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Get the raw CSS value for the target style
-            -
                 * @return {string}
-            -
                 */
-            -
                getCss: cacheWhenLocked( function() {
-            -
                    var el = this.targetElement,
-            -
                        ctor = this.constructor,
-            -
                        s = el.style,
-            -
                        cs = el.currentStyle,
-            -
                        cssProp = this.cssProperty,
-            -
                        styleProp = this.styleProperty,
-            -
                        prefixedCssProp = ctor._prefixedCssProp || ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
-            -
                        prefixedStyleProp = ctor._prefixedStyleProp || ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
-            -
                    return s[ prefixedStyleProp ] || cs.getAttribute( prefixedCssProp ) || s[ styleProp ] || cs.getAttribute( cssProp );
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Determine whether the target CSS style is active.
-            -
                 * @return {boolean}
-            -
                 */
-            -
                isActive: cacheWhenLocked( function() {
-            -
                    return !!this.getProps();
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Determine whether the target CSS style has changed since the last time it was used.
-            -
                 * @return {boolean}
-            -
                 */
-            -
                changed: cacheWhenLocked( function() {
-            -
                    var currentCss = this.getCss(),
-            -
                        changed = currentCss !== this._lastCss;
-            -
                    this._lastCss = currentCss;
-            -
                    return changed;
-            -
                } ),
-            -
-            -
                cacheWhenLocked: cacheWhenLocked,
-            -
-            -
                lock: function() {
-            -
                    ++this._locked;
-            -
                },
-            -
-            -
                unlock: function() {
-            -
                    if( !--this._locked ) {
-            -
                        delete this._lockedValues;
-            -
                    }
-            -
                }
-            -
            };
-            -
-            -
            })();/**
-            -
             * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: PIE.CSS_PREFIX + 'background',
-            -
                styleProperty: PIE.STYLE_PREFIX + 'Background',
-            -
-            -
                attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
-            -
                repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
-            -
                originIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
-            -
                clipIdents: { 'padding-box':1, 'border-box':1 },
-            -
                positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
-            -
                sizeIdents: { 'contain':1, 'cover':1 },
-            -
-            -
                /**
-            -
                 * For background styles, we support the -pie-background property but fall back to the standard
-            -
                 * backround* properties.  The reason we have to use the prefixed version is that IE natively
-            -
                 * parses the standard properties and if it sees something it doesn't know how to parse, for example
-            -
                 * multiple values or gradient definitions, it will throw that away and not make it available through
-            -
                 * currentStyle.
-            -
                 *
-            -
                 * Format of return object:
-            -
                 * {
-            -
                 *     color: <PIE.Color>,
-            -
                 *     bgImages: [
-            -
                 *         {
-            -
                 *             imgType: 'image',
-            -
                 *             imgUrl: 'image.png',
-            -
                 *             imgRepeat: <'no-repeat' | 'repeat-x' | 'repeat-y' | 'repeat'>,
-            -
                 *             bgPosition: <PIE.BgPosition>,
-            -
                 *             attachment: <'scroll' | 'fixed' | 'local'>,
-            -
                 *             bgOrigin: <'border-box' | 'padding-box' | 'content-box'>,
-            -
                 *             clip: <'border-box' | 'padding-box'>,
-            -
                 *             size: <'contain' | 'cover' | { w: <'auto' | PIE.Length>, h: <'auto' | PIE.Length> }>
-            -
                 *         },
-            -
                 *         {
-            -
                 *             imgType: 'linear-gradient',
-            -
                 *             gradientStart: <PIE.BgPosition>,
-            -
                 *             angle: <PIE.Angle>,
-            -
                 *             stops: [
-            -
                 *                 { color: <PIE.Color>, offset: <PIE.Length> },
-            -
                 *                 { color: <PIE.Color>, offset: <PIE.Length> }, ...
-            -
                 *             ]
-            -
                 *         }
-            -
                 *     ]
-            -
                 * }
-            -
                 * @param {String} css
-            -
                 * @override
-            -
                 */
-            -
                parseCss: function( css ) {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        tokenizer, token, image,
-            -
                        tok_type = PIE.Tokenizer.Type,
-            -
                        type_operator = tok_type.OPERATOR,
-            -
                        type_ident = tok_type.IDENT,
-            -
                        type_color = tok_type.COLOR,
-            -
                        tokType, tokVal,
-            -
                        positionIdents = this.positionIdents,
-            -
                        gradient, stop,
-            -
                        props = null;
-            -
-            -
                    function isBgPosToken( token ) {
-            -
                        return token.isLengthOrPercent() || ( token.tokenType & type_ident && token.tokenValue in positionIdents );
-            -
                    }
-            -
-            -
                    function sizeToken( token ) {
-            -
                        return ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) || ( token.tokenValue === 'auto' && 'auto' );
-            -
                    }
-            -
-            -
                    // If the CSS3-specific -pie-background property is present, parse it
-            -
                    if( this.getCss3() ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        props = { bgImages: [] };
-            -
                        image = {};
-            -
-            -
                        while( token = tokenizer.next() ) {
-            -
                            tokType = token.tokenType;
-            -
                            tokVal = token.tokenValue;
-            -
-            -
                            if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
-            -
                                gradient = { stops: [], imgType: tokVal };
-            -
                                stop = {};
-            -
                                while( token = tokenizer.next() ) {
-            -
                                    tokType = token.tokenType;
-            -
                                    tokVal = token.tokenValue;
-            -
-            -
                                    // If we reached the end of the function and had at least 2 stops, flush the info
-            -
                                    if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
-            -
                                        if( stop.color ) {
-            -
                                            gradient.stops.push( stop );
-            -
                                        }
-            -
                                        if( gradient.stops.length > 1 ) {
-            -
                                            PIE.Util.merge( image, gradient );
-            -
                                        }
-            -
                                        break;
-            -
                                    }
-            -
-            -
                                    // Color stop - must start with color
-            -
                                    if( tokType & type_color ) {
-            -
                                        // if we already have an angle/position, make sure that the previous token was a comma
-            -
                                        if( gradient.angle || gradient.gradientStart ) {
-            -
                                            token = tokenizer.prev();
-            -
                                            if( token.tokenType !== type_operator ) {
-            -
                                                break; //fail
-            -
                                            }
-            -
                                            tokenizer.next();
-            -
                                        }
-            -
-            -
                                        stop = {
-            -
                                            color: PIE.getColor( tokVal )
-            -
                                        };
-            -
                                        // check for offset following color
-            -
                                        token = tokenizer.next();
-            -
                                        if( token.isLengthOrPercent() ) {
-            -
                                            stop.offset = PIE.getLength( token.tokenValue );
-            -
                                        } else {
-            -
                                            tokenizer.prev();
-            -
                                        }
-            -
                                    }
-            -
                                    // Angle - can only appear in first spot
-            -
                                    else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
-            -
                                        gradient.angle = new PIE.Angle( token.tokenValue );
-            -
                                    }
-            -
                                    else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
-            -
                                        tokenizer.prev();
-            -
                                        gradient.gradientStart = new PIE.BgPosition(
-            -
                                            tokenizer.until( function( t ) {
-            -
                                                return !isBgPosToken( t );
-            -
                                            }, false )
-            -
                                        );
-            -
                                    }
-            -
                                    else if( tokType & type_operator && tokVal === ',' ) {
-            -
                                        if( stop.color ) {
-            -
                                            gradient.stops.push( stop );
-            -
                                            stop = {};
-            -
                                        }
-            -
                                    }
-            -
                                    else {
-            -
                                        // Found something we didn't recognize; fail without adding image
-            -
                                        break;
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
                            else if( !image.imgType && tokType & tok_type.URL ) {
-            -
                                image.imgUrl = tokVal;
-            -
                                image.imgType = 'image';
-            -
                            }
-            -
                            else if( isBgPosToken( token ) && !image.size ) {
-            -
                                tokenizer.prev();
-            -
                                image.bgPosition = new PIE.BgPosition(
-            -
                                    tokenizer.until( function( t ) {
-            -
                                        return !isBgPosToken( t );
-            -
                                    }, false )
-            -
                                );
-            -
                            }
-            -
                            else if( tokType & type_ident ) {
-            -
                                if( tokVal in this.repeatIdents ) {
-            -
                                    image.imgRepeat = tokVal;
-            -
                                }
-            -
                                else if( tokVal in this.originIdents ) {
-            -
                                    image.bgOrigin = tokVal;
-            -
                                    if( tokVal in this.clipIdents ) {
-            -
                                        image.clip = tokVal;
-            -
                                    }
-            -
                                }
-            -
                                else if( tokVal in this.attachIdents ) {
-            -
                                    image.attachment = tokVal;
-            -
                                }
-            -
                            }
-            -
                            else if( tokType & type_color && !props.color ) {
-            -
                                props.color = PIE.getColor( tokVal );
-            -
                            }
-            -
                            else if( tokType & type_operator ) {
-            -
                                // background size
-            -
                                if( tokVal === '/' ) {
-            -
                                    token = tokenizer.next();
-            -
                                    tokType = token.tokenType;
-            -
                                    tokVal = token.tokenValue;
-            -
                                    if( tokType & type_ident && tokVal in this.sizeIdents ) {
-            -
                                        image.size = tokVal;
-            -
                                    }
-            -
                                    else if( tokVal = sizeToken( token ) ) {
-            -
                                        image.size = {
-            -
                                            w: tokVal,
-            -
                                            h: sizeToken( tokenizer.next() ) || ( tokenizer.prev() && tokVal )
-            -
                                        };
-            -
                                    }
-            -
                                }
-            -
                                // new layer
-            -
                                else if( tokVal === ',' && image.imgType ) {
-            -
                                    props.bgImages.push( image );
-            -
                                    image = {};
-            -
                                }
-            -
                            }
-            -
                            else {
-            -
                                // Found something unrecognized; chuck everything
-            -
                                return null;
-            -
                            }
-            -
                        }
-            -
-            -
                        // leftovers
-            -
                        if( image.imgType ) {
-            -
                            props.bgImages.push( image );
-            -
                        }
-            -
                    }
-            -
-            -
                    // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
-            -
                    else {
-            -
                        this.withActualBg( function() {
-            -
                            var posX = cs.backgroundPositionX,
-            -
                                posY = cs.backgroundPositionY,
-            -
                                img = cs.backgroundImage,
-            -
                                color = cs.backgroundColor;
-            -
-            -
                            props = {};
-            -
                            if( color !== 'transparent' ) {
-            -
                                props.color = PIE.getColor( color )
-            -
                            }
-            -
                            if( img !== 'none' ) {
-            -
                                props.bgImages = [ {
-            -
                                    imgType: 'image',
-            -
                                    imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
-            -
                                    imgRepeat: cs.backgroundRepeat,
-            -
                                    bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
-            -
                                } ];
-            -
                            }
-            -
                        } );
-            -
                    }
-            -
-            -
                    return ( props && ( props.color || ( props.bgImages && props.bgImages[0] ) ) ) ? props : null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Execute a function with the actual background styles (not overridden with runtimeStyle
-            -
                 * properties set by the renderers) available via currentStyle.
-            -
                 * @param fn
-            -
                 */
-            -
                withActualBg: function( fn ) {
-            -
                    var rs = this.targetElement.runtimeStyle,
-            -
                        rsImage = rs.backgroundImage,
-            -
                        rsColor = rs.backgroundColor,
-            -
                        ret;
-            -
-            -
                    if( rsImage ) rs.backgroundImage = '';
-            -
                    if( rsColor ) rs.backgroundColor = '';
-            -
-            -
                    ret = fn.call( this );
-            -
-            -
                    if( rsImage ) rs.backgroundImage = rsImage;
-            -
                    if( rsColor ) rs.backgroundColor = rsColor;
-            -
-            -
                    return ret;
-            -
                },
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    return this.getCss3() ||
-            -
                           this.withActualBg( function() {
-            -
                               var cs = this.targetElement.currentStyle;
-            -
                               return cs.backgroundColor + ' ' + cs.backgroundImage + ' ' + cs.backgroundRepeat + ' ' +
-            -
                               cs.backgroundPositionX + ' ' + cs.backgroundPositionY;
-            -
                           } );
-            -
                } ),
-            -
-            -
                getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var el = this.targetElement;
-            -
                    return el.style[ this.styleProperty ] || el.currentStyle.getAttribute( this.cssProperty );
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
-            -
                 */
-            -
                isPngFix: function() {
-            -
                    var val = 0, el;
-            -
                    if( PIE.ieVersion < 7 ) {
-            -
                        el = this.targetElement;
-            -
                        val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] || el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
-            -
                    }
-            -
                    return val;
-            -
                },
-            -
-            -
                /**
-            -
                 * The isActive logic is slightly different, because getProps() always returns an object
-            -
                 * even if it is just falling back to the native background properties.  But we only want
-            -
                 * to report is as being "active" if either the -pie-background override property is present
-            -
                 * and parses successfully or '-pie-png-fix' is set to true in IE6.
-            -
                 */
-            -
                isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    return (this.getCss3() || this.isPngFix()) && !!this.getProps();
-            -
                } )
-            -
-            -
            } );/**
-            -
             * Handles parsing, caching, and detecting changes to border CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
-            -
                namedWidths: {
-            -
                    'thin': '1px',
-            -
                    'medium': '3px',
-            -
                    'thick': '5px'
-            -
                },
-            -
-            -
                parseCss: function( css ) {
-            -
                    var w = {},
-            -
                        s = {},
-            -
                        c = {},
-            -
                        active = false,
-            -
                        colorsSame = true,
-            -
                        stylesSame = true,
-            -
                        widthsSame = true;
-            -
-            -
                    this.withActualBorder( function() {
-            -
                        var el = this.targetElement,
-            -
                            cs = el.currentStyle,
-            -
                            i = 0,
-            -
                            style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
-            -
                        for( ; i < 4; i++ ) {
-            -
                            side = this.sides[ i ];
-            -
-            -
                            ltr = side.charAt(0).toLowerCase();
-            -
                            style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
-            -
                            color = cs[ 'border' + side + 'Color' ];
-            -
                            width = cs[ 'border' + side + 'Width' ];
-            -
-            -
                            if( i > 0 ) {
-            -
                                if( style !== lastStyle ) { stylesSame = false; }
-            -
                                if( color !== lastColor ) { colorsSame = false; }
-            -
                                if( width !== lastWidth ) { widthsSame = false; }
-            -
                            }
-            -
                            lastStyle = style;
-            -
                            lastColor = color;
-            -
                            lastWidth = width;
-            -
-            -
                            c[ ltr ] = PIE.getColor( color );
-            -
-            -
                            width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] || width ) );
-            -
                            if( width.pixels( this.targetElement ) > 0 ) {
-            -
                                active = true;
-            -
                            }
-            -
                        }
-            -
                    } );
-            -
-            -
                    return active ? {
-            -
                        widths: w,
-            -
                        styles: s,
-            -
                        colors: c,
-            -
                        widthsSame: widthsSame,
-            -
                        colorsSame: colorsSame,
-            -
                        stylesSame: stylesSame
-            -
                    } : null;
-            -
                },
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        css;
-            -
-            -
                    // Don't redraw or hide borders for cells in border-collapse:collapse tables
-            -
                    if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
-            -
                        this.withActualBorder( function() {
-            -
                            css = cs.borderWidth + '|' + cs.borderStyle + '|' + cs.borderColor;
-            -
                        } );
-            -
                    }
-            -
                    return css;
-            -
                } ),
-            -
-            -
                /**
-            -
                 * Execute a function with the actual border styles (not overridden with runtimeStyle
-            -
                 * properties set by the renderers) available via currentStyle.
-            -
                 * @param fn
-            -
                 */
-            -
                withActualBorder: function( fn ) {
-            -
                    var rs = this.targetElement.runtimeStyle,
-            -
                        rsWidth = rs.borderWidth,
-            -
                        rsColor = rs.borderColor,
-            -
                        ret;
-            -
-            -
                    if( rsWidth ) rs.borderWidth = '';
-            -
                    if( rsColor ) rs.borderColor = '';
-            -
-            -
                    ret = fn.call( this );
-            -
-            -
                    if( rsWidth ) rs.borderWidth = rsWidth;
-            -
                    if( rsColor ) rs.borderColor = rsColor;
-            -
-            -
                    return ret;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Handles parsing, caching, and detecting changes to border-radius CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            (function() {
-            -
-            -
            PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'border-radius',
-            -
                styleProperty: 'borderRadius',
-            -
-            -
                parseCss: function( css ) {
-            -
                    var p = null, x, y,
-            -
                        tokenizer, token, length,
-            -
                        hasNonZero = false;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
-            -
                        function collectLengths() {
-            -
                            var arr = [], num;
-            -
                            while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
-            -
                                length = PIE.getLength( token.tokenValue );
-            -
                                num = length.getNumber();
-            -
                                if( num < 0 ) {
-            -
                                    return null;
-            -
                                }
-            -
                                if( num > 0 ) {
-            -
                                    hasNonZero = true;
-            -
                                }
-            -
                                arr.push( length );
-            -
                            }
-            -
                            return arr.length > 0 && arr.length < 5 ? {
-            -
                                    'tl': arr[0],
-            -
                                    'tr': arr[1] || arr[0],
-            -
                                    'br': arr[2] || arr[0],
-            -
                                    'bl': arr[3] || arr[1] || arr[0]
-            -
                                } : null;
-            -
                        }
-            -
-            -
                        // Grab the initial sequence of lengths
-            -
                        if( x = collectLengths() ) {
-            -
                            // See if there is a slash followed by more lengths, for the y-axis radii
-            -
                            if( token ) {
-            -
                                if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
-            -
                                    y = collectLengths();
-            -
                                }
-            -
                            } else {
-            -
                                y = x;
-            -
                            }
-            -
-            -
                            // Treat all-zero values the same as no value
-            -
                            if( hasNonZero && x && y ) {
-            -
                                p = { x: x, y : y };
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    return p;
-            -
                }
-            -
            } );
-            -
-            -
            var zero = PIE.getLength( '0' ),
-            -
                zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
-            -
            PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
-            -
-            -
            })();/**
-            -
             * Handles parsing, caching, and detecting changes to border-image CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'border-image',
-            -
                styleProperty: 'borderImage',
-            -
-            -
                repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
-            -
-            -
                parseCss: function( css ) {
-            -
                    var p = null, tokenizer, token, type, value,
-            -
                        slices, widths, outsets,
-            -
                        slashCount = 0, cs,
-            -
                        Type = PIE.Tokenizer.Type,
-            -
                        IDENT = Type.IDENT,
-            -
                        NUMBER = Type.NUMBER,
-            -
                        LENGTH = Type.LENGTH,
-            -
                        PERCENT = Type.PERCENT;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        p = {};
-            -
-            -
                        function isSlash( token ) {
-            -
                            return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
-            -
                        }
-            -
-            -
                        function isFillIdent( token ) {
-            -
                            return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
-            -
                        }
-            -
-            -
                        function collectSlicesEtc() {
-            -
                            slices = tokenizer.until( function( tok ) {
-            -
                                return !( tok.tokenType & ( NUMBER | PERCENT ) );
-            -
                            } );
-            -
-            -
                            if( isFillIdent( tokenizer.next() ) && !p.fill ) {
-            -
                                p.fill = true;
-            -
                            } else {
-            -
                                tokenizer.prev();
-            -
                            }
-            -
-            -
                            if( isSlash( tokenizer.next() ) ) {
-            -
                                slashCount++;
-            -
                                widths = tokenizer.until( function( tok ) {
-            -
                                    return !( token.tokenType & ( NUMBER | PERCENT | LENGTH ) ) && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
-            -
                                } );
-            -
-            -
                                if( isSlash( tokenizer.next() ) ) {
-            -
                                    slashCount++;
-            -
                                    outsets = tokenizer.until( function( tok ) {
-            -
                                        return !( token.tokenType & ( NUMBER | LENGTH ) );
-            -
                                    } );
-            -
                                }
-            -
                            } else {
-            -
                                tokenizer.prev();
-            -
                            }
-            -
                        }
-            -
-            -
                        while( token = tokenizer.next() ) {
-            -
                            type = token.tokenType;
-            -
                            value = token.tokenValue;
-            -
-            -
                            // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
-            -
                            if( type & ( NUMBER | PERCENT ) && !slices ) {
-            -
                                tokenizer.prev();
-            -
                                collectSlicesEtc();
-            -
                            }
-            -
                            else if( isFillIdent( token ) && !p.fill ) {
-            -
                                p.fill = true;
-            -
                                collectSlicesEtc();
-            -
                            }
-            -
-            -
                            // Idents: one or values for 'repeat'
-            -
                            else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
-            -
                                p.repeat = { h: value };
-            -
                                if( token = tokenizer.next() ) {
-            -
                                    if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
-            -
                                        p.repeat.v = token.tokenValue;
-            -
                                    } else {
-            -
                                        tokenizer.prev();
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
-            -
                            // URL of the image
-            -
                            else if( ( type & Type.URL ) && !p.src ) {
-            -
                                p.src =  value;
-            -
                            }
-            -
-            -
                            // Found something unrecognized; exit.
-            -
                            else {
-            -
                                return null;
-            -
                            }
-            -
                        }
-            -
-            -
                        // Validate what we collected
-            -
                        if( !p.src || !slices || slices.length < 1 || slices.length > 4 ||
-            -
                            ( widths && widths.length > 4 ) || ( slashCount === 1 && widths.length < 1 ) ||
-            -
                            ( outsets && outsets.length > 4 ) || ( slashCount === 2 && outsets.length < 1 ) ) {
-            -
                            return null;
-            -
                        }
-            -
-            -
                        // Fill in missing values
-            -
                        if( !p.repeat ) {
-            -
                            p.repeat = { h: 'stretch' };
-            -
                        }
-            -
                        if( !p.repeat.v ) {
-            -
                            p.repeat.v = p.repeat.h;
-            -
                        }
-            -
-            -
                        function distributeSides( tokens, convertFn ) {
-            -
                            return {
-            -
                                t: convertFn( tokens[0] ),
-            -
                                r: convertFn( tokens[1] || tokens[0] ),
-            -
                                b: convertFn( tokens[2] || tokens[0] ),
-            -
                                l: convertFn( tokens[3] || tokens[1] || tokens[0] )
-            -
                            };
-            -
                        }
-            -
-            -
                        p.slice = distributeSides( slices, function( tok ) {
-            -
                            return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
-            -
                        } );
-            -
-            -
                        p.width = widths && widths.length > 0 ?
-            -
                                distributeSides( widths, function( tok ) {
-            -
                                    return tok.tokenType & ( LENGTH | PERCENT ) ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
-            -
                                } ) :
-            -
                                ( cs = this.targetElement.currentStyle ) && {
-            -
                                    t: PIE.getLength( cs.borderTopWidth ),
-            -
                                    r: PIE.getLength( cs.borderRightWidth ),
-            -
                                    b: PIE.getLength( cs.borderBottomWidth ),
-            -
                                    l: PIE.getLength( cs.borderLeftWidth )
-            -
                                };
-            -
-            -
                        p.outset = distributeSides( outsets || [ 0 ], function( tok ) {
-            -
                            return tok.tokenType & LENGTH ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
-            -
                        } );
-            -
                    }
-            -
-            -
                    return p;
-            -
                }
-            -
            } );/**
-            -
             * Handles parsing, caching, and detecting changes to box-shadow CSS
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                cssProperty: 'box-shadow',
-            -
                styleProperty: 'boxShadow',
-            -
-            -
                parseCss: function( css ) {
-            -
                    var props,
-            -
                        getLength = PIE.getLength,
-            -
                        Type = PIE.Tokenizer.Type,
-            -
                        tokenizer;
-            -
-            -
                    if( css ) {
-            -
                        tokenizer = new PIE.Tokenizer( css );
-            -
                        props = { outset: [], inset: [] };
-            -
-            -
                        function parseItem() {
-            -
                            var token, type, value, color, lengths, inset, len;
-            -
-            -
                            while( token = tokenizer.next() ) {
-            -
                                value = token.tokenValue;
-            -
                                type = token.tokenType;
-            -
-            -
                                if( type & Type.OPERATOR && value === ',' ) {
-            -
                                    break;
-            -
                                }
-            -
                                else if( token.isLength() && !lengths ) {
-            -
                                    tokenizer.prev();
-            -
                                    lengths = tokenizer.until( function( token ) {
-            -
                                        return !token.isLength();
-            -
                                    } );
-            -
                                }
-            -
                                else if( type & Type.COLOR && !color ) {
-            -
                                    color = value;
-            -
                                }
-            -
                                else if( type & Type.IDENT && value === 'inset' && !inset ) {
-            -
                                    inset = true;
-            -
                                }
-            -
                                else { //encountered an unrecognized token; fail.
-            -
                                    return false;
-            -
                                }
-            -
                            }
-            -
-            -
                            len = lengths && lengths.length;
-            -
                            if( len > 1 && len < 5 ) {
-            -
                                ( inset ? props.inset : props.outset ).push( {
-            -
                                    xOffset: getLength( lengths[0].tokenValue ),
-            -
                                    yOffset: getLength( lengths[1].tokenValue ),
-            -
                                    blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
-            -
                                    spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
-            -
                                    color: PIE.getColor( color || 'currentColor' )
-            -
                                } );
-            -
                                return true;
-            -
                            }
-            -
                            return false;
-            -
                        }
-            -
-            -
                        while( parseItem() ) {}
-            -
                    }
-            -
-            -
                    return props && ( props.inset.length || props.outset.length ) ? props : null;
-            -
                }
-            -
            } );
-            -
            /**
-            -
             * Retrieves the state of the element's visibility and display
-            -
             * @constructor
-            -
             * @param {Element} el the target element
-            -
             */
-            -
            PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
-            -
-            -
                getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
-            -
                    var cs = this.targetElement.currentStyle;
-            -
                    return cs.visibility + '|' + cs.display;
-            -
                } ),
-            -
-            -
                parseCss: function() {
-            -
                    var el = this.targetElement,
-            -
                        rs = el.runtimeStyle,
-            -
                        cs = el.currentStyle,
-            -
                        rsVis = rs.visibility,
-            -
                        csVis;
-            -
-            -
                    rs.visibility = '';
-            -
                    csVis = cs.visibility;
-            -
                    rs.visibility = rsVis;
-            -
-            -
                    return {
-            -
                        visible: csVis !== 'hidden',
-            -
                        displayed: cs.display !== 'none'
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Always return false for isActive, since this property alone will not trigger
-            -
                 * a renderer to do anything.
-            -
                 */
-            -
                isActive: function() {
-            -
                    return false;
-            -
                }
-            -
-            -
            } );
-            -
            PIE.RendererBase = {
-            -
-            -
                /**
-            -
                 * Create a new Renderer class, with the standard constructor, and augmented by
-            -
                 * the RendererBase's members.
-            -
                 * @param proto
-            -
                 */
-            -
                newRenderer: function( proto ) {
-            -
                    function Renderer( el, boundsInfo, styleInfos, parent ) {
-            -
                        this.targetElement = el;
-            -
                        this.boundsInfo = boundsInfo;
-            -
                        this.styleInfos = styleInfos;
-            -
                        this.parent = parent;
-            -
                    }
-            -
                    PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
-            -
                    return Renderer;
-            -
                },
-            -
-            -
                /**
-            -
                 * Flag indicating the element has already been positioned at least once.
-            -
                 * @type {boolean}
-            -
                 */
-            -
                isPositioned: false,
-            -
-            -
                /**
-            -
                 * Determine if the renderer needs to be updated
-            -
                 * @return {boolean}
-            -
                 */
-            -
                needsUpdate: function() {
-            -
                    return false;
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified properties
-            -
                 */
-            -
                updateProps: function() {
-            -
                    this.destroy();
-            -
                    if( this.isActive() ) {
-            -
                        this.draw();
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified element position
-            -
                 */
-            -
                updatePos: function() {
-            -
                    this.isPositioned = true;
-            -
                },
-            -
-            -
                /**
-            -
                 * Tell the renderer to update based on modified element dimensions
-            -
                 */
-            -
                updateSize: function() {
-            -
                    if( this.isActive() ) {
-            -
                        this.draw();
-            -
                    } else {
-            -
                        this.destroy();
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
-            -
                 * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
-            -
                 * So instead we make sure they are inserted into the DOM in the correct order.
-            -
                 * @param {number} index
-            -
                 * @param {Element} el
-            -
                 */
-            -
                addLayer: function( index, el ) {
-            -
                    this.removeLayer( index );
-            -
                    for( var layers = this._layers || ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
-            -
                        layer = layers[i];
-            -
                        if( layer ) {
-            -
                            break;
-            -
                        }
-            -
                    }
-            -
                    layers[index] = el;
-            -
                    this.getBox().insertBefore( el, layer || null );
-            -
                },
-            -
-            -
                /**
-            -
                 * Retrieve a layer element by its index, or null if not present
-            -
                 * @param {number} index
-            -
                 * @return {Element}
-            -
                 */
-            -
                getLayer: function( index ) {
-            -
                    var layers = this._layers;
-            -
                    return layers && layers[index] || null;
-            -
                },
-            -
-            -
                /**
-            -
                 * Remove a layer element by its index
-            -
                 * @param {number} index
-            -
                 */
-            -
                removeLayer: function( index ) {
-            -
                    var layer = this.getLayer( index ),
-            -
                        box = this._box;
-            -
                    if( layer && box ) {
-            -
                        box.removeChild( layer );
-            -
                        this._layers[index] = null;
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get a VML shape by name, creating it if necessary.
-            -
                 * @param {string} name A name identifying the element
-            -
                 * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
-            -
                 * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
-            -
                 * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
-            -
                 *                  using container elements in the correct order, to get correct z stacking without z-index.
-            -
                 */
-            -
                getShape: function( name, subElName, parent, group ) {
-            -
                    var shapes = this._shapes || ( this._shapes = {} ),
-            -
                        shape = shapes[ name ],
-            -
                        s;
-            -
-            -
                    if( !shape ) {
-            -
                        shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
-            -
                        if( subElName ) {
-            -
                            shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
-            -
                        }
-            -
-            -
                        if( group ) {
-            -
                            parent = this.getLayer( group );
-            -
                            if( !parent ) {
-            -
                                this.addLayer( group, doc.createElement( 'group' + group ) );
-            -
                                parent = this.getLayer( group );
-            -
                            }
-            -
                        }
-            -
-            -
                        parent.appendChild( shape );
-            -
-            -
                        s = shape.style;
-            -
                        s.position = 'absolute';
-            -
                        s.left = s.top = 0;
-            -
                        s['behavior'] = 'url(#default#VML)';
-            -
                    }
-            -
                    return shape;
-            -
                },
-            -
-            -
                /**
-            -
                 * Delete a named shape which was created by getShape(). Returns true if a shape with the
-            -
                 * given name was found and deleted, or false if there was no shape of that name.
-            -
                 * @param {string} name
-            -
                 * @return {boolean}
-            -
                 */
-            -
                deleteShape: function( name ) {
-            -
                    var shapes = this._shapes,
-            -
                        shape = shapes && shapes[ name ];
-            -
                    if( shape ) {
-            -
                        shape.parentNode.removeChild( shape );
-            -
                        delete shapes[ name ];
-            -
                    }
-            -
                    return !!shape;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * For a given set of border radius length/percentage values, convert them to concrete pixel
-            -
                 * values based on the current size of the target element.
-            -
                 * @param {Object} radii
-            -
                 * @return {Object}
-            -
                 */
-            -
                getRadiiPixels: function( radii ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        tlX, tlY, trX, trY, brX, brY, blX, blY, f;
-            -
-            -
                    tlX = radii.x['tl'].pixels( el, w );
-            -
                    tlY = radii.y['tl'].pixels( el, h );
-            -
                    trX = radii.x['tr'].pixels( el, w );
-            -
                    trY = radii.y['tr'].pixels( el, h );
-            -
                    brX = radii.x['br'].pixels( el, w );
-            -
                    brY = radii.y['br'].pixels( el, h );
-            -
                    blX = radii.x['bl'].pixels( el, w );
-            -
                    blY = radii.y['bl'].pixels( el, h );
-            -
-            -
                    // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
-            -
                    // is taken straight from the CSS3 Backgrounds and Borders spec.
-            -
                    f = Math.min(
-            -
                        w / ( tlX + trX ),
-            -
                        h / ( trY + brY ),
-            -
                        w / ( blX + brX ),
-            -
                        h / ( tlY + blY )
-            -
                    );
-            -
                    if( f < 1 ) {
-            -
                        tlX *= f;
-            -
                        tlY *= f;
-            -
                        trX *= f;
-            -
                        trY *= f;
-            -
                        brX *= f;
-            -
                        brY *= f;
-            -
                        blX *= f;
-            -
                        blY *= f;
-            -
                    }
-            -
-            -
                    return {
-            -
                        x: {
-            -
                            'tl': tlX,
-            -
                            'tr': trX,
-            -
                            'br': brX,
-            -
                            'bl': blX
-            -
                        },
-            -
                        y: {
-            -
                            'tl': tlY,
-            -
                            'tr': trY,
-            -
                            'br': brY,
-            -
                            'bl': blY
-            -
                        }
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Return the VML path string for the element's background box, with corners rounded.
-            -
                 * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
-            -
                 *        pixels to shrink the box path inward from the element's four sides.
-            -
                 * @param {number=} mult If specified, all coordinates will be multiplied by this number
-            -
                 * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
-            -
                 *        from this renderer's borderRadiusInfo object.
-            -
                 * @return {string} the VML path
-            -
                 */
-            -
                getBoxPath: function( shrink, mult, radii ) {
-            -
                    mult = mult || 1;
-            -
-            -
                    var r, str,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w * mult,
-            -
                        h = bounds.h * mult,
-            -
                        radInfo = this.styleInfos.borderRadiusInfo,
-            -
                        floor = Math.floor, ceil = Math.ceil,
-            -
                        shrinkT = shrink ? shrink.t * mult : 0,
-            -
                        shrinkR = shrink ? shrink.r * mult : 0,
-            -
                        shrinkB = shrink ? shrink.b * mult : 0,
-            -
                        shrinkL = shrink ? shrink.l * mult : 0,
-            -
                        tlX, tlY, trX, trY, brX, brY, blX, blY;
-            -
-            -
                    if( radii || radInfo.isActive() ) {
-            -
                        r = this.getRadiiPixels( radii || radInfo.getProps() );
-            -
-            -
                        tlX = r.x['tl'] * mult;
-            -
                        tlY = r.y['tl'] * mult;
-            -
                        trX = r.x['tr'] * mult;
-            -
                        trY = r.y['tr'] * mult;
-            -
                        brX = r.x['br'] * mult;
-            -
                        brY = r.y['br'] * mult;
-            -
                        blX = r.x['bl'] * mult;
-            -
                        blY = r.y['bl'] * mult;
-            -
-            -
                        str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
-            -
                            'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
-            -
                            'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
-            -
                            'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
-            -
                            'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
-            -
                            'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
-            -
                            'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
-            -
                            'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
-            -
                    } else {
-            -
                        // simplified path for non-rounded box
-            -
                        str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
-            -
                              'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
-            -
                              'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
-            -
                              'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
-            -
                              'xe';
-            -
                    }
-            -
                    return str;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get the container element for the shapes, creating it if necessary.
-            -
                 */
-            -
                getBox: function() {
-            -
                    var box = this.parent.getLayer( this.boxZIndex ), s;
-            -
-            -
                    if( !box ) {
-            -
                        box = doc.createElement( this.boxName );
-            -
                        s = box.style;
-            -
                        s.position = 'absolute';
-            -
                        s.top = s.left = 0;
-            -
                        this.parent.addLayer( this.boxZIndex, box );
-            -
                    }
-            -
-            -
                    return box;
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Destroy the rendered objects. This is a base implementation which handles common renderer
-            -
                 * structures, but individual renderers may override as necessary.
-            -
                 */
-            -
                destroy: function() {
-            -
                    this.parent.removeLayer( this.boxZIndex );
-            -
                    delete this._shapes;
-            -
                    delete this._layers;
-            -
                }
-            -
            };
-            -
            /**
-            -
             * Root renderer; creates the outermost container element and handles keeping it aligned
-            -
             * with the target element's size and position.
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             */
-            -
            PIE.RootRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                isActive: function() {
-            -
                    var children = this.childRenderers;
-            -
                    for( var i in children ) {
-            -
                        if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
-            -
                            return true;
-            -
                        }
-            -
                    }
-            -
                    return false;
-            -
                },
-            -
-            -
                needsUpdate: function() {
-            -
                    return this.styleInfos.visibilityInfo.changed();
-            -
                },
-            -
-            -
                updatePos: function() {
-            -
                    if( this.isActive() ) {
-            -
                        var el = this.getPositioningElement(),
-            -
                            par = el,
-            -
                            docEl,
-            -
                            parRect,
-            -
                            tgtCS = el.currentStyle,
-            -
                            tgtPos = tgtCS.position,
-            -
                            boxPos,
-            -
                            s = this.getBox().style, cs,
-            -
                            x = 0, y = 0,
-            -
                            elBounds = this.boundsInfo.getBounds();
-            -
-            -
                        if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
-            -
                            x = elBounds.x;
-            -
                            y = elBounds.y;
-            -
                            boxPos = tgtPos;
-            -
                        } else {
-            -
                            // Get the element's offsets from its nearest positioned ancestor. Uses
-            -
                            // getBoundingClientRect for accuracy and speed.
-            -
                            do {
-            -
                                par = par.offsetParent;
-            -
                            } while( par && ( par.currentStyle.position === 'static' ) );
-            -
                            if( par ) {
-            -
                                parRect = par.getBoundingClientRect();
-            -
                                cs = par.currentStyle;
-            -
                                x = elBounds.x - parRect.left - ( parseFloat(cs.borderLeftWidth) || 0 );
-            -
                                y = elBounds.y - parRect.top - ( parseFloat(cs.borderTopWidth) || 0 );
-            -
                            } else {
-            -
                                docEl = doc.documentElement;
-            -
                                x = elBounds.x + docEl.scrollLeft - docEl.clientLeft;
-            -
                                y = elBounds.y + docEl.scrollTop - docEl.clientTop;
-            -
                            }
-            -
                            boxPos = 'absolute';
-            -
                        }
-            -
-            -
                        s.position = boxPos;
-            -
                        s.left = x;
-            -
                        s.top = y;
-            -
                        s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
-            -
                        this.isPositioned = true;
-            -
                    }
-            -
                },
-            -
-            -
                updateSize: function() {
-            -
                    // NO-OP
-            -
                },
-            -
-            -
                updateVisibility: function() {
-            -
                    var vis = this.styleInfos.visibilityInfo.getProps();
-            -
                    this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
-            -
                },
-            -
-            -
                updateProps: function() {
-            -
                    if( this.isActive() ) {
-            -
                        this.updateVisibility();
-            -
                    } else {
-            -
                        this.destroy();
-            -
                    }
-            -
                },
-            -
-            -
                getPositioningElement: function() {
-            -
                    var el = this.targetElement;
-            -
                    return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
-            -
                },
-            -
-            -
                getBox: function() {
-            -
                    var box = this._box, el;
-            -
                    if( !box ) {
-            -
                        el = this.getPositioningElement();
-            -
                        box = this._box = doc.createElement( 'css3-container' );
-            -
                        box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
-            -
-            -
                        this.updateVisibility();
-            -
-            -
                        el.parentNode.insertBefore( box, el );
-            -
                    }
-            -
                    return box;
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    var box = this._box, par;
-            -
                    if( box && ( par = box.parentNode ) ) {
-            -
                        par.removeChild( box );
-            -
                    }
-            -
                    delete this._box;
-            -
                    delete this._layers;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for element backgrounds.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 2,
-            -
                boxName: 'background',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.backgroundInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderImageInfo.isActive() ||
-            -
                           si.borderRadiusInfo.isActive() ||
-            -
                           si.backgroundInfo.isActive() ||
-            -
                           ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the shapes
-            -
                 */
-            -
                draw: function() {
-            -
                    var bounds = this.boundsInfo.getBounds();
-            -
                    if( bounds.w && bounds.h ) {
-            -
                        this.drawBgColor();
-            -
                        this.drawBgImages();
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the background color shape
-            -
                 */
-            -
                drawBgColor: function() {
-            -
                    var props = this.styleInfos.backgroundInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        el = this.targetElement,
-            -
                        color = props && props.color,
-            -
                        shape, w, h, s, alpha;
-            -
-            -
                    if( color && color.alpha() > 0 ) {
-            -
                        this.hideBackground();
-            -
-            -
                        shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
-            -
                        w = bounds.w;
-            -
                        h = bounds.h;
-            -
                        shape.stroked = false;
-            -
                        shape.coordsize = w * 2 + ',' + h * 2;
-            -
                        shape.coordorigin = '1,1';
-            -
                        shape.path = this.getBoxPath( null, 2 );
-            -
                        s = shape.style;
-            -
                        s.width = w;
-            -
                        s.height = h;
-            -
                        shape.fill.color = color.colorValue( el );
-            -
-            -
                        alpha = color.alpha();
-            -
                        if( alpha < 1 ) {
-            -
                            shape.fill.opacity = alpha;
-            -
                        }
-            -
                    } else {
-            -
                        this.deleteShape( 'bgColor' );
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw all the background image layers
-            -
                 */
-            -
                drawBgImages: function() {
-            -
                    var props = this.styleInfos.backgroundInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        images = props && props.bgImages,
-            -
                        img, shape, w, h, s, i;
-            -
-            -
                    if( images ) {
-            -
                        this.hideBackground();
-            -
-            -
                        w = bounds.w;
-            -
                        h = bounds.h;
-            -
-            -
                        i = images.length;
-            -
                        while( i-- ) {
-            -
                            img = images[i];
-            -
                            shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
-            -
-            -
                            shape.stroked = false;
-            -
                            shape.fill.type = 'tile';
-            -
                            shape.fillcolor = 'none';
-            -
                            shape.coordsize = w * 2 + ',' + h * 2;
-            -
                            shape.coordorigin = '1,1';
-            -
                            shape.path = this.getBoxPath( 0, 2 );
-            -
                            s = shape.style;
-            -
                            s.width = w;
-            -
                            s.height = h;
-            -
-            -
                            if( img.imgType === 'linear-gradient' ) {
-            -
                                this.addLinearGradient( shape, img );
-            -
                            }
-            -
                            else {
-            -
                                shape.fill.src = img.imgUrl;
-            -
                                this.positionBgImage( shape, i );
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    // Delete any bgImage shapes previously created which weren't used above
-            -
                    i = images ? images.length : 0;
-            -
                    while( this.deleteShape( 'bgImage' + i++ ) ) {}
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Set the position and clipping of the background image for a layer
-            -
                 * @param {Element} shape
-            -
                 * @param {number} index
-            -
                 */
-            -
                positionBgImage: function( shape, index ) {
-            -
                    PIE.Util.withImageSize( shape.fill.src, function( size ) {
-            -
                        var fill = shape.fill,
-            -
                            el = this.targetElement,
-            -
                            bounds = this.boundsInfo.getBounds(),
-            -
                            elW = bounds.w,
-            -
                            elH = bounds.h,
-            -
                            si = this.styleInfos,
-            -
                            border = si.borderInfo.getProps(),
-            -
                            bw = border && border.widths,
-            -
                            bwT = bw ? bw['t'].pixels( el ) : 0,
-            -
                            bwR = bw ? bw['r'].pixels( el ) : 0,
-            -
                            bwB = bw ? bw['b'].pixels( el ) : 0,
-            -
                            bwL = bw ? bw['l'].pixels( el ) : 0,
-            -
                            bg = si.backgroundInfo.getProps().bgImages[ index ],
-            -
                            bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
-            -
                            repeat = bg.imgRepeat,
-            -
                            pxX, pxY,
-            -
                            clipT = 0, clipL = 0,
-            -
                            clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
-            -
                            clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
-            -
-            -
                        // Positioning - find the pixel offset from the top/left and convert to a ratio
-            -
                        // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
-            -
                        // needed to fix antialiasing but makes the bg image fuzzy.
-            -
                        pxX = Math.round( bgPos.x ) + bwL + 0.5;
-            -
                        pxY = Math.round( bgPos.y ) + bwT + 0.5;
-            -
                        fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
-            -
-            -
                        // Repeating - clip the image shape
-            -
                        if( repeat && repeat !== 'repeat' ) {
-            -
                            if( repeat === 'repeat-x' || repeat === 'no-repeat' ) {
-            -
                                clipT = pxY + 1;
-            -
                                clipB = pxY + size.h + clipAdjust;
-            -
                            }
-            -
                            if( repeat === 'repeat-y' || repeat === 'no-repeat' ) {
-            -
                                clipL = pxX + 1;
-            -
                                clipR = pxX + size.w + clipAdjust;
-            -
                            }
-            -
                            shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
-            -
                        }
-            -
                    }, this );
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Draw the linear gradient for a gradient layer
-            -
                 * @param {Element} shape
-            -
                 * @param {Object} info The object holding the information about the gradient
-            -
                 */
-            -
                addLinearGradient: function( shape, info ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        fill = shape.fill,
-            -
                        angle = info.angle,
-            -
                        startPos = info.gradientStart,
-            -
                        stops = info.stops,
-            -
                        stopCount = stops.length,
-            -
                        PI = Math.PI,
-            -
                        UNDEF,
-            -
                        startX, startY,
-            -
                        endX, endY,
-            -
                        startCornerX, startCornerY,
-            -
                        endCornerX, endCornerY,
-            -
                        vmlAngle, vmlGradientLength, vmlColors,
-            -
                        deltaX, deltaY, lineLength,
-            -
                        stopPx, vmlOffsetPct,
-            -
                        p, i, j, before, after;
-            -
-            -
                    /**
-            -
                     * Find the point along a given line (defined by a starting point and an angle), at which
-            -
                     * that line is intersected by a perpendicular line extending through another point.
-            -
                     * @param x1 - x coord of the starting point
-            -
                     * @param y1 - y coord of the starting point
-            -
                     * @param angle - angle of the line extending from the starting point (in degrees)
-            -
                     * @param x2 - x coord of point along the perpendicular line
-            -
                     * @param y2 - y coord of point along the perpendicular line
-            -
                     * @return [ x, y ]
-            -
                     */
-            -
                    function perpendicularIntersect( x1, y1, angle, x2, y2 ) {
-            -
                        // Handle straight vertical and horizontal angles, for performance and to avoid
-            -
                        // divide-by-zero errors.
-            -
                        if( angle === 0 || angle === 180 ) {
-            -
                            return [ x2, y1 ];
-            -
                        }
-            -
                        else if( angle === 90 || angle === 270 ) {
-            -
                            return [ x1, y2 ];
-            -
                        }
-            -
                        else {
-            -
                            // General approach: determine the Ax+By=C formula for each line (the slope of the second
-            -
                            // line is the negative inverse of the first) and then solve for where both formulas have
-            -
                            // the same x/y values.
-            -
                            var a1 = Math.tan( -angle * PI / 180 ),
-            -
                                c1 = a1 * x1 - y1,
-            -
                                a2 = -1 / a1,
-            -
                                c2 = a2 * x2 - y2,
-            -
                                d = a2 - a1,
-            -
                                endX = ( c2 - c1 ) / d,
-            -
                                endY = ( a1 * c2 - a2 * c1 ) / d;
-            -
                            return [ endX, endY ];
-            -
                        }
-            -
                    }
-            -
-            -
                    // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
-            -
                    // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
-            -
                    // the total length of the VML rendered gradient-line corner to corner.
-            -
                    function findCorners() {
-            -
                        startCornerX = ( angle >= 90 && angle < 270 ) ? w : 0;
-            -
                        startCornerY = angle < 180 ? h : 0;
-            -
                        endCornerX = w - startCornerX;
-            -
                        endCornerY = h - startCornerY;
-            -
                    }
-            -
-            -
                    // Normalize the angle to a value between [0, 360)
-            -
                    function normalizeAngle() {
-            -
                        while( angle < 0 ) {
-            -
                            angle += 360;
-            -
                        }
-            -
                        angle = angle % 360;
-            -
                    }
-            -
-            -
                    // Find the distance between two points
-            -
                    function distance( p1, p2 ) {
-            -
                        var dx = p2[0] - p1[0],
-            -
                            dy = p2[1] - p1[1];
-            -
                        return Math.abs(
-            -
                            dx === 0 ? dy :
-            -
                            dy === 0 ? dx :
-            -
                            Math.sqrt( dx * dx + dy * dy )
-            -
                        );
-            -
                    }
-            -
-            -
                    // Find the start and end points of the gradient
-            -
                    if( startPos ) {
-            -
                        startPos = startPos.coords( el, w, h );
-            -
                        startX = startPos.x;
-            -
                        startY = startPos.y;
-            -
                    }
-            -
                    if( angle ) {
-            -
                        angle = angle.degrees();
-            -
-            -
                        normalizeAngle();
-            -
                        findCorners();
-            -
-            -
                        // If no start position was specified, then choose a corner as the starting point.
-            -
                        if( !startPos ) {
-            -
                            startX = startCornerX;
-            -
                            startY = startCornerY;
-            -
                        }
-            -
-            -
                        // Find the end position by extending a perpendicular line from the gradient-line which
-            -
                        // intersects the corner opposite from the starting corner.
-            -
                        p = perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
-            -
                        endX = p[0];
-            -
                        endY = p[1];
-            -
                    }
-            -
                    else if( startPos ) {
-            -
                        // Start position but no angle specified: find the end point by rotating 180deg around the center
-            -
                        endX = w - startX;
-            -
                        endY = h - startY;
-            -
                    }
-            -
                    else {
-            -
                        // Neither position nor angle specified; create vertical gradient from top to bottom
-            -
                        startX = startY = endX = 0;
-            -
                        endY = h;
-            -
                    }
-            -
                    deltaX = endX - startX;
-            -
                    deltaY = endY - startY;
-            -
-            -
                    if( angle === UNDEF ) {
-            -
                        // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
-            -
                        // or vertical angles so they get exact whole numbers rather than what atan2 gives.
-            -
                        angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
-            -
                                    ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
-            -
                                        -Math.atan2( deltaY, deltaX ) / PI * 180
-            -
                                    )
-            -
                                );
-            -
                        normalizeAngle();
-            -
                        findCorners();
-            -
                    }
-            -
-            -
-            -
                    // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
-            -
                    // bounding box; for example specifying a 45 deg angle actually results in a gradient
-            -
                    // drawn diagonally from one corner to its opposite corner, which will only appear to the
-            -
                    // viewer as 45 degrees if the shape is equilateral.  We adjust for this by taking the x/y deltas
-            -
                    // between the start and end points, multiply one of them by the shape's aspect ratio,
-            -
                    // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
-            -
                    // horizontal or vertical then we don't need to do this conversion.
-            -
                    vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
-            -
-            -
                    // VML angles are 180 degrees offset from CSS angles
-            -
                    vmlAngle += 180;
-            -
                    vmlAngle = vmlAngle % 360;
-            -
-            -
                    // Add all the stops to the VML 'colors' list, including the first and last stops.
-            -
                    // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
-            -
                    // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
-            -
                    // percentage along the VML gradient-line, which runs from shape corner to corner.
-            -
                    lineLength = distance( [ startX, startY ], [ endX, endY ] );
-            -
                    vmlGradientLength = distance( [ startCornerX, startCornerY ], perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY ) );
-            -
                    vmlColors = [];
-            -
                    vmlOffsetPct = distance( [ startX, startY ], perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY ) ) / vmlGradientLength * 100;
-            -
-            -
                    // Find the pixel offsets along the CSS3 gradient-line for each stop.
-            -
                    stopPx = [];
-            -
                    for( i = 0; i < stopCount; i++ ) {
-            -
                        stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
-            -
                                     i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
-            -
                    }
-            -
                    // Fill in gaps with evenly-spaced offsets
-            -
                    for( i = 1; i < stopCount; i++ ) {
-            -
                        if( stopPx[ i ] === null ) {
-            -
                            before = stopPx[ i - 1 ];
-            -
                            j = i;
-            -
                            do {
-            -
                                after = stopPx[ ++j ];
-            -
                            } while( after === null );
-            -
                            stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
-            -
                        }
-            -
                        // Make sure each stop's offset is no less than the one before it
-            -
                        stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
-            -
                    }
-            -
-            -
                    // Convert to percentage along the VML gradient line and add to the VML 'colors' value
-            -
                    for( i = 0; i < stopCount; i++ ) {
-            -
                        vmlColors.push(
-            -
                            ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
-            -
                        );
-            -
                    }
-            -
-            -
                    // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
-            -
                    // the first and last stop colors; this just sets outer bounds for the gradient.
-            -
                    fill['angle'] = vmlAngle;
-            -
                    fill['type'] = 'gradient';
-            -
                    fill['method'] = 'sigma';
-            -
                    fill['color'] = stops[0].color.colorValue( el );
-            -
                    fill['color2'] = stops[stopCount - 1].color.colorValue( el );
-            -
                    fill['colors'].value = vmlColors.join( ',' );
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Hide the actual background image and color of the element.
-            -
                 */
-            -
                hideBackground: function() {
-            -
                    var rs = this.targetElement.runtimeStyle;
-            -
                    rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
-            -
                    rs.backgroundColor = 'transparent';
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    var rs = this.targetElement.runtimeStyle;
-            -
                    rs.backgroundImage = rs.backgroundColor = '';
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for element borders.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 4,
-            -
                boxName: 'border',
-            -
-            -
                /**
-            -
                 * Lookup table of elements which cannot take custom children.
-            -
                 */
-            -
                childlessElements: {
-            -
                    'TABLE':1, //can obviously have children but not custom ones
-            -
                    'INPUT':1,
-            -
                    'TEXTAREA':1,
-            -
                    'SELECT':1,
-            -
                    'OPTION':1,
-            -
                    'IMG':1,
-            -
                    'HR':1,
-            -
                    'FIELDSET':1 //can take children but wrapping its children messes up its <legend>
-            -
                },
-            -
-            -
                /**
-            -
                 * Values of the type attribute for input elements displayed as buttons
-            -
                 */
-            -
                inputButtonTypes: {
-            -
                    'submit':1,
-            -
                    'button':1,
-            -
                    'reset':1
-            -
                },
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return ( si.borderImageInfo.isActive() ||
-            -
                             si.borderRadiusInfo.isActive() ||
-            -
                             si.backgroundInfo.isActive() ) &&
-            -
                           si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
-            -
                },
-            -
-            -
                /**
-            -
                 * Draw the border shape(s)
-            -
                 */
-            -
                draw: function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        props = this.styleInfos.borderInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        side, shape, stroke, s,
-            -
                        segments, seg, i, len;
-            -
-            -
                    if( props ) {
-            -
                        this.hideBorder();
-            -
-            -
                        segments = this.getBorderSegments( 2 );
-            -
                        for( i = 0, len = segments.length; i < len; i++) {
-            -
                            seg = segments[i];
-            -
                            shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
-            -
                            shape.coordsize = w * 2 + ',' + h * 2;
-            -
                            shape.coordorigin = '1,1';
-            -
                            shape.path = seg.path;
-            -
                            s = shape.style;
-            -
                            s.width = w;
-            -
                            s.height = h;
-            -
-            -
                            shape.filled = !!seg.fill;
-            -
                            shape.stroked = !!seg.stroke;
-            -
                            if( seg.stroke ) {
-            -
                                stroke = shape.stroke;
-            -
                                stroke['weight'] = seg.weight + 'px';
-            -
                                stroke.color = seg.color.colorValue( el );
-            -
                                stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
-            -
                                stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
-            -
                            } else {
-            -
                                shape.fill.color = seg.fill.colorValue( el );
-            -
                            }
-            -
                        }
-            -
-            -
                        // remove any previously-created border shapes which didn't get used above
-            -
                        while( this.deleteShape( 'borderPiece' + i++ ) ) {}
-            -
                    }
-            -
                },
-            -
-            -
                /**
-            -
                 * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
-            -
                 * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
-            -
                 * like form buttons require removing the border width altogether, so for those we increase the padding
-            -
                 * by the border size.
-            -
                 */
-            -
                hideBorder: function() {
-            -
                    var el = this.targetElement,
-            -
                        cs = el.currentStyle,
-            -
                        rs = el.runtimeStyle,
-            -
                        tag = el.tagName,
-            -
                        isIE6 = PIE.ieVersion === 6,
-            -
                        sides, side, i;
-            -
-            -
                    if( ( isIE6 && tag in this.childlessElements ) || tag === 'BUTTON' ||
-            -
                            ( tag === 'INPUT' && el.type in this.inputButtonTypes ) ) {
-            -
                        rs.borderWidth = '';
-            -
                        sides = this.styleInfos.borderInfo.sides;
-            -
                        for( i = sides.length; i--; ) {
-            -
                            side = sides[ i ];
-            -
                            rs[ 'padding' + side ] = '';
-            -
                            rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
-            -
                                                     ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
-            -
                                                     ( !PIE.ieVersion === 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
-            -
                        }
-            -
                        rs.borderWidth = 0;
-            -
                    }
-            -
                    else if( isIE6 ) {
-            -
                        // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
-            -
                        // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
-            -
                        // (background and border) but displays all the contents.
-            -
                        // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
-            -
                        // as this can interfere with other author scripts which add/modify/delete children. Also, this
-            -
                        // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
-            -
                        // using a compositor filter or some other filter which masks the border.
-            -
                        if( el.childNodes.length !== 1 || el.firstChild.tagName !== 'ie6-mask' ) {
-            -
                            var cont = doc.createElement( 'ie6-mask' ),
-            -
                                s = cont.style, child;
-            -
                            s.visibility = 'visible';
-            -
                            s.zoom = 1;
-            -
                            while( child = el.firstChild ) {
-            -
                                cont.appendChild( child );
-            -
                            }
-            -
                            el.appendChild( cont );
-            -
                            rs.visibility = 'hidden';
-            -
                        }
-            -
                    }
-            -
                    else {
-            -
                        rs.borderColor = 'transparent';
-            -
                    }
-            -
                },
-            -
-            -
-            -
                /**
-            -
                 * Get the VML path definitions for the border segment(s).
-            -
                 * @param {number=} mult If specified, all coordinates will be multiplied by this number
-            -
                 * @return {Array.<string>}
-            -
                 */
-            -
                getBorderSegments: function( mult ) {
-            -
                    var el = this.targetElement,
-            -
                        bounds, elW, elH,
-            -
                        borderInfo = this.styleInfos.borderInfo,
-            -
                        segments = [],
-            -
                        floor, ceil, wT, wR, wB, wL,
-            -
                        round = Math.round,
-            -
                        borderProps, radiusInfo, radii, widths, styles, colors;
-            -
-            -
                    if( borderInfo.isActive() ) {
-            -
                        borderProps = borderInfo.getProps();
-            -
-            -
                        widths = borderProps.widths;
-            -
                        styles = borderProps.styles;
-            -
                        colors = borderProps.colors;
-            -
-            -
                        if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
-            -
                            if( colors['t'].alpha() > 0 ) {
-            -
                                // shortcut for identical border on all sides - only need 1 stroked shape
-            -
                                wT = widths['t'].pixels( el ); //thickness
-            -
                                wR = wT / 2; //shrink
-            -
                                segments.push( {
-            -
                                    path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
-            -
                                    stroke: styles['t'],
-            -
                                    color: colors['t'],
-            -
                                    weight: wT
-            -
                                } );
-            -
                            }
-            -
                        }
-            -
                        else {
-            -
                            mult = mult || 1;
-            -
                            bounds = this.boundsInfo.getBounds();
-            -
                            elW = bounds.w;
-            -
                            elH = bounds.h;
-            -
-            -
                            wT = round( widths['t'].pixels( el ) );
-            -
                            wR = round( widths['r'].pixels( el ) );
-            -
                            wB = round( widths['b'].pixels( el ) );
-            -
                            wL = round( widths['l'].pixels( el ) );
-            -
                            var pxWidths = {
-            -
                                't': wT,
-            -
                                'r': wR,
-            -
                                'b': wB,
-            -
                                'l': wL
-            -
                            };
-            -
-            -
                            radiusInfo = this.styleInfos.borderRadiusInfo;
-            -
                            if( radiusInfo.isActive() ) {
-            -
                                radii = this.getRadiiPixels( radiusInfo.getProps() );
-            -
                            }
-            -
-            -
                            floor = Math.floor;
-            -
                            ceil = Math.ceil;
-            -
-            -
                            function radius( xy, corner ) {
-            -
                                return radii ? radii[ xy ][ corner ] : 0;
-            -
                            }
-            -
-            -
                            function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
-            -
                                var rx = radius( 'x', corner),
-            -
                                    ry = radius( 'y', corner),
-            -
                                    deg = 65535,
-            -
                                    isRight = corner.charAt( 1 ) === 'r',
-            -
                                    isBottom = corner.charAt( 0 ) === 'b';
-            -
                                return ( rx > 0 && ry > 0 ) ?
-            -
                                            ( doMove ? 'al' : 'ae' ) +
-            -
                                            ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
-            -
                                            ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
-            -
                                            ( floor( rx ) - shrinkX ) * mult + ',' + // width
-            -
                                            ( floor( ry ) - shrinkY ) * mult + ',' + // height
-            -
                                            ( startAngle * deg ) + ',' + // start angle
-            -
                                            ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
-            -
                                        ) : (
-            -
                                            ( doMove ? 'm' : 'l' ) +
-            -
                                            ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
-            -
                                            ( isBottom ? elH - shrinkY : shrinkY ) * mult
-            -
                                        );
-            -
                            }
-            -
-            -
                            function line( side, shrink, ccw, doMove ) {
-            -
                                var
-            -
                                    start = (
-            -
                                        side === 't' ?
-            -
                                            floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
-            -
                                        side === 'r' ?
-            -
                                            ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
-            -
                                        side === 'b' ?
-            -
                                            ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
-            -
                                        // side === 'l' ?
-            -
                                            floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
-            -
                                    ),
-            -
                                    end = (
-            -
                                        side === 't' ?
-            -
                                            ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
-            -
                                        side === 'r' ?
-            -
                                            ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
-            -
                                        side === 'b' ?
-            -
                                            floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
-            -
                                        // side === 'l' ?
-            -
                                            floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
-            -
                                    );
-            -
                                return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
-            -
                                             ( doMove ? 'm' + start : '' ) + 'l' + end;
-            -
                            }
-            -
-            -
-            -
                            function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
-            -
                                var vert = side === 'l' || side === 'r',
-            -
                                    sideW = pxWidths[ side ],
-            -
                                    beforeX, beforeY, afterX, afterY;
-            -
-            -
                                if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
-            -
                                    beforeX = pxWidths[ vert ? side : sideBefore ];
-            -
                                    beforeY = pxWidths[ vert ? sideBefore : side ];
-            -
                                    afterX = pxWidths[ vert ? side : sideAfter ];
-            -
                                    afterY = pxWidths[ vert ? sideAfter : side ];
-            -
-            -
                                    if( styles[ side ] === 'dashed' || styles[ side ] === 'dotted' ) {
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
-            -
                                                  curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                        segments.push( {
-            -
                                            path: line( side, sideW / 2, 0, 1 ),
-            -
                                            stroke: styles[ side ],
-            -
                                            weight: sideW,
-            -
                                            color: colors[ side ]
-            -
                                        } );
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
-            -
                                                  curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                    }
-            -
                                    else {
-            -
                                        segments.push( {
-            -
                                            path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
-            -
                                                  line( side, sideW, 0, 0 ) +
-            -
                                                  curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
-            -
-            -
                                                  ( styles[ side ] === 'double' && sideW > 2 ?
-            -
                                                          curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
-            -
                                                          line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
-            -
                                                          curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
-            -
                                                          'x ' +
-            -
                                                          curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
-            -
                                                          line( side, floor( sideW / 3 ), 1, 0 ) +
-            -
                                                          curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
-            -
                                                      : '' ) +
-            -
-            -
                                                  curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
-            -
                                                  line( side, 0, 1, 0 ) +
-            -
                                                  curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
-            -
                                            fill: colors[ side ]
-            -
                                        } );
-            -
                                    }
-            -
                                }
-            -
                            }
-            -
-            -
                            addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
-            -
                            addSide( 'r', 't', 'b', 'tr', 'br', 0 );
-            -
                            addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
-            -
                            addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
-            -
                        }
-            -
                    }
-            -
-            -
                    return segments;
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    this.targetElement.runtimeStyle.borderColor = '';
-            -
                }
-            -
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for border-image
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 5,
-            -
                pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
-            -
-            -
                needsUpdate: function() {
-            -
                    return this.styleInfos.borderImageInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    return this.styleInfos.borderImageInfo.isActive();
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    this.getBox(); //make sure pieces are created
-            -
-            -
                    var props = this.styleInfos.borderImageInfo.getProps(),
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        el = this.targetElement,
-            -
                        pieces = this.pieces;
-            -
-            -
                    PIE.Util.withImageSize( props.src, function( imgSize ) {
-            -
                        var elW = bounds.w,
-            -
                            elH = bounds.h,
-            -
-            -
                            widths = props.width,
-            -
                            widthT = widths.t.pixels( el ),
-            -
                            widthR = widths.r.pixels( el ),
-            -
                            widthB = widths.b.pixels( el ),
-            -
                            widthL = widths.l.pixels( el ),
-            -
                            slices = props.slice,
-            -
                            sliceT = slices.t.pixels( el ),
-            -
                            sliceR = slices.r.pixels( el ),
-            -
                            sliceB = slices.b.pixels( el ),
-            -
                            sliceL = slices.l.pixels( el );
-            -
-            -
                        // Piece positions and sizes
-            -
                        function setSizeAndPos( piece, w, h, x, y ) {
-            -
                            var s = pieces[piece].style,
-            -
                                max = Math.max;
-            -
                            s.width = max(w, 0);
-            -
                            s.height = max(h, 0);
-            -
                            s.left = x;
-            -
                            s.top = y;
-            -
                        }
-            -
                        setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
-            -
                        setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
-            -
                        setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
-            -
                        setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
-            -
                        setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
-            -
                        setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
-            -
                        setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
-            -
                        setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
-            -
                        setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
-            -
-            -
-            -
                        // image croppings
-            -
                        function setCrops( sides, crop, val ) {
-            -
                            for( var i=0, len=sides.length; i < len; i++ ) {
-            -
                                pieces[ sides[i] ]['imagedata'][ crop ] = val;
-            -
                            }
-            -
                        }
-            -
-            -
                        // corners
-            -
                        setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
-            -
                        setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
-            -
                        setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
-            -
                        setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
-            -
-            -
                        // edges and center
-            -
                        if( props.repeat.v === 'stretch' ) {
-            -
                            setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
-            -
                            setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
-            -
                        }
-            -
                        if( props.repeat.h === 'stretch' ) {
-            -
                            setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
-            -
                            setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
-            -
                        }
-            -
-            -
                        // center fill
-            -
                        pieces['c'].style.display = props.fill ? '' : 'none';
-            -
                    }, this );
-            -
                },
-            -
-            -
                getBox: function() {
-            -
                    var box = this.parent.getLayer( this.boxZIndex ),
-            -
                        s, piece, i,
-            -
                        pieceNames = this.pieceNames,
-            -
                        len = pieceNames.length;
-            -
-            -
                    if( !box ) {
-            -
                        box = doc.createElement( 'border-image' );
-            -
                        s = box.style;
-            -
                        s.position = 'absolute';
-            -
-            -
                        this.pieces = {};
-            -
-            -
                        for( i = 0; i < len; i++ ) {
-            -
                            piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
-            -
                            piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
-            -
                            s = piece.style;
-            -
                            s['behavior'] = 'url(#default#VML)';
-            -
                            s.position = "absolute";
-            -
                            s.top = s.left = 0;
-            -
                            piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
-            -
                            piece.stroked = false;
-            -
                            piece.filled = false;
-            -
                            box.appendChild( piece );
-            -
                        }
-            -
-            -
                        this.parent.addLayer( this.boxZIndex, box );
-            -
                    }
-            -
-            -
                    return box;
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for outset box-shadows
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 1,
-            -
                boxName: 'outset-box-shadow',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.boxShadowInfo.changed() || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var boxShadowInfo = this.styleInfos.boxShadowInfo;
-            -
                    return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    var me = this,
-            -
                        el = this.targetElement,
-            -
                        box = this.getBox(),
-            -
                        styleInfos = this.styleInfos,
-            -
                        shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
-            -
                        radii = styleInfos.borderRadiusInfo.getProps(),
-            -
                        len = shadowInfos.length,
-            -
                        i = len, j,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
-            -
                        corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
-            -
                        shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
-            -
                        totalW, totalH, focusX, focusY, isBottom, isRight;
-            -
-            -
-            -
                    function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
-            -
                        var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
-            -
                            fill = shape.fill;
-            -
-            -
                        // Position and size
-            -
                        shape['coordsize'] = w * 2 + ',' + h * 2;
-            -
                        shape['coordorigin'] = '1,1';
-            -
-            -
                        // Color and opacity
-            -
                        shape['stroked'] = false;
-            -
                        shape['filled'] = true;
-            -
                        fill.color = color.colorValue( el );
-            -
                        if( blur ) {
-            -
                            fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
-            -
                            fill['color2'] = fill.color;
-            -
                            fill['opacity'] = 0;
-            -
                        }
-            -
-            -
                        // Path
-            -
                        shape.path = path;
-            -
-            -
                        // This needs to go last for some reason, to prevent rendering at incorrect size
-            -
                        ss = shape.style;
-            -
                        ss.left = xOff;
-            -
                        ss.top = yOff;
-            -
                        ss.width = w;
-            -
                        ss.height = h;
-            -
-            -
                        return shape;
-            -
                    }
-            -
-            -
-            -
                    while( i-- ) {
-            -
                        shadowInfo = shadowInfos[ i ];
-            -
                        xOff = shadowInfo.xOffset.pixels( el );
-            -
                        yOff = shadowInfo.yOffset.pixels( el );
-            -
                        spread = shadowInfo.spread.pixels( el ),
-            -
                        blur = shadowInfo.blur.pixels( el );
-            -
                        color = shadowInfo.color;
-            -
                        // Shape path
-            -
                        shrink = -spread - blur;
-            -
                        if( !radii && blur ) {
-            -
                            // If blurring, use a non-null border radius info object so that getBoxPath will
-            -
                            // round the corners of the expanded shadow shape rather than squaring them off.
-            -
                            radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
-            -
                        }
-            -
                        path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
-            -
-            -
                        if( blur ) {
-            -
                            totalW = ( spread + blur ) * 2 + w;
-            -
                            totalH = ( spread + blur ) * 2 + h;
-            -
                            focusX = blur * 2 / totalW;
-            -
                            focusY = blur * 2 / totalH;
-            -
                            if( blur - spread > w / 2 || blur - spread > h / 2 ) {
-            -
                                // If the blur is larger than half the element's narrowest dimension, we cannot do
-            -
                                // this with a single shape gradient, because its focussize would have to be less than
-            -
                                // zero which results in ugly artifacts. Instead we create four shapes, each with its
-            -
                                // gradient focus past center, and then clip them so each only shows the quadrant
-            -
                                // opposite the focus.
-            -
                                for( j = 4; j--; ) {
-            -
                                    corner = corners[j];
-            -
                                    isBottom = corner.charAt( 0 ) === 'b';
-            -
                                    isRight = corner.charAt( 1 ) === 'r';
-            -
                                    shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
-            -
                                    fill = shape.fill;
-            -
                                    fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
-            -
                                                            ( isBottom ? 1 - focusY : focusY );
-            -
                                    fill['focussize'] = '0,0';
-            -
-            -
                                    // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
-            -
                                    // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
-            -
                                    shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
-            -
                                                                 ( isRight ? totalW : totalW / 2 ) + 'px,' +
-            -
                                                                 ( isBottom ? totalH : totalH / 2 ) + 'px,' +
-            -
                                                                 ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
-            -
                                }
-            -
                            } else {
-            -
                                // TODO delete old quadrant shapes if resizing expands past the barrier
-            -
                                shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
-            -
                                fill = shape.fill;
-            -
                                fill['focusposition'] = focusX + ',' + focusY;
-            -
                                fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
-            -
                            }
-            -
                        } else {
-            -
                            shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
-            -
                            alpha = color.alpha();
-            -
                            if( alpha < 1 ) {
-            -
                                // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
-            -
                                // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha  ) + ')';
-            -
                                shape.fill.opacity = alpha;
-            -
                            }
-            -
                        }
-            -
                    }
-            -
                }
-            -
-            -
            } );
-            -
            /**
-            -
             * Renderer for re-rendering img elements using VML. Kicks in if the img has
-            -
             * a border-radius applied, or if the -pie-png-fix flag is set.
-            -
             * @constructor
-            -
             * @param {Element} el The target element
-            -
             * @param {Object} styleInfos The StyleInfo objects
-            -
             * @param {PIE.RootRenderer} parent
-            -
             */
-            -
            PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
-            -
-            -
                boxZIndex: 6,
-            -
                boxName: 'imgEl',
-            -
-            -
                needsUpdate: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return this.targetElement.src !== this._lastSrc || si.borderRadiusInfo.changed();
-            -
                },
-            -
-            -
                isActive: function() {
-            -
                    var si = this.styleInfos;
-            -
                    return si.borderRadiusInfo.isActive() || si.backgroundInfo.isPngFix();
-            -
                },
-            -
-            -
                draw: function() {
-            -
                    this._lastSrc = src;
-            -
                    this.hideActualImg();
-            -
-            -
                    var shape = this.getShape( 'img', 'fill', this.getBox() ),
-            -
                        fill = shape.fill,
-            -
                        bounds = this.boundsInfo.getBounds(),
-            -
                        w = bounds.w,
-            -
                        h = bounds.h,
-            -
                        borderProps = this.styleInfos.borderInfo.getProps(),
-            -
                        borderWidths = borderProps && borderProps.widths,
-            -
                        el = this.targetElement,
-            -
                        src = el.src,
-            -
                        round = Math.round,
-            -
                        s;
-            -
-            -
                    shape.stroked = false;
-            -
                    fill.type = 'frame';
-            -
                    fill.src = src;
-            -
                    fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
-            -
                    shape.coordsize = w * 2 + ',' + h * 2;
-            -
                    shape.coordorigin = '1,1';
-            -
                    shape.path = this.getBoxPath( borderWidths ? {
-            -
                        t: round( borderWidths['t'].pixels( el ) ),
-            -
                        r: round( borderWidths['r'].pixels( el ) ),
-            -
                        b: round( borderWidths['b'].pixels( el ) ),
-            -
                        l: round( borderWidths['l'].pixels( el ) )
-            -
                    } : 0, 2 );
-            -
                    s = shape.style;
-            -
                    s.width = w;
-            -
                    s.height = h;
-            -
                },
-            -
-            -
                hideActualImg: function() {
-            -
                    this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
-            -
                },
-            -
-            -
                destroy: function() {
-            -
                    PIE.RendererBase.destroy.call( this );
-            -
                    this.targetElement.runtimeStyle.filter = '';
-            -
                }
-            -
-            -
            } );
-            -
-            -
            PIE.Element = (function() {
-            -
-            -
                var wrappers = {},
-            -
                    lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
-            -
                    pollCssProp = PIE.CSS_PREFIX + 'poll',
-            -
                    hoverClass = ' ' + PIE.CLASS_PREFIX + 'hover',
-            -
                    hoverClassRE = new RegExp( '\\b' + PIE.CLASS_PREFIX + 'hover\\b', 'g' ),
-            -
                    ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 };
-            -
-            -
-            -
                function addListener( el, type, handler ) {
-            -
                    el.attachEvent( type, handler );
-            -
                }
-            -
-            -
                function removeListener( el, type, handler ) {
-            -
                    el.detachEvent( type, handler );
-            -
                }
-            -
-            -
-            -
                function Element( el ) {
-            -
                    var renderers,
-            -
                        boundsInfo = new PIE.BoundsInfo( el ),
-            -
                        styleInfos,
-            -
                        styleInfosArr,
-            -
                        ancestors,
-            -
                        initializing,
-            -
                        initialized,
-            -
                        eventsAttached,
-            -
                        delayed,
-            -
                        destroyed,
-            -
                        poll;
-            -
-            -
                    /**
-            -
                     * Initialize PIE for this element.
-            -
                     */
-            -
                    function init() {
-            -
                        if( !initialized ) {
-            -
                            var docEl,
-            -
                                bounds,
-            -
                                cs = el.currentStyle,
-            -
                                lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
-            -
                                rootRenderer;
-            -
-            -
                            // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
-            -
                            poll = cs.getAttribute( pollCssProp );
-            -
                            poll = PIE.ieDocMode === 8 ? poll !== 'false' : poll === 'true';
-            -
-            -
                            // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
-            -
                            // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
-            -
                            if( !initializing ) {
-            -
                                initializing = 1;
-            -
                                el.runtimeStyle.zoom = 1;
-            -
                                initFirstChildPseudoClass();
-            -
                            }
-            -
-            -
                            boundsInfo.lock();
-            -
-            -
                            // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
-            -
                            if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement || doc.body ) &&
-            -
                                    ( bounds.y > docEl.clientHeight || bounds.x > docEl.clientWidth || bounds.y + bounds.h < 0 || bounds.x + bounds.w < 0 ) ) {
-            -
                                if( !delayed ) {
-            -
                                    delayed = 1;
-            -
                                    PIE.OnScroll.observe( init );
-            -
                                }
-            -
                            } else {
-            -
                                initialized = 1;
-            -
                                delayed = initializing = 0;
-            -
                                PIE.OnScroll.unobserve( init );
-            -
-            -
                                // Create the style infos and renderers
-            -
                                styleInfos = {
-            -
                                    backgroundInfo: new PIE.BackgroundStyleInfo( el ),
-            -
                                    borderInfo: new PIE.BorderStyleInfo( el ),
-            -
                                    borderImageInfo: new PIE.BorderImageStyleInfo( el ),
-            -
                                    borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
-            -
                                    boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
-            -
                                    visibilityInfo: new PIE.VisibilityStyleInfo( el )
-            -
                                };
-            -
                                styleInfosArr = [
-            -
                                    styleInfos.backgroundInfo,
-            -
                                    styleInfos.borderInfo,
-            -
                                    styleInfos.borderImageInfo,
-            -
                                    styleInfos.borderRadiusInfo,
-            -
                                    styleInfos.boxShadowInfo,
-            -
                                    styleInfos.visibilityInfo
-            -
                                ];
-            -
-            -
                                rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
-            -
                                var childRenderers = [
-            -
                                    new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
-            -
                                    new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
-            -
                                ];
-            -
                                if( el.tagName === 'IMG' ) {
-            -
                                    childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
-            -
                                }
-            -
                                rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
-            -
                                renderers = [ rootRenderer ].concat( childRenderers );
-            -
-            -
                                // Add property change listeners to ancestors if requested
-            -
                                initAncestorPropChangeListeners();
-            -
-            -
                                // Add to list of polled elements in IE8
-            -
                                if( poll ) {
-            -
                                    PIE.Heartbeat.observe( update );
-            -
                                    PIE.Heartbeat.run();
-            -
                                }
-            -
-            -
                                // Trigger rendering
-            -
                                update( 1 );
-            -
                            }
-            -
-            -
                            if( !eventsAttached ) {
-            -
                                eventsAttached = 1;
-            -
                                addListener( el, 'onmove', handleMoveOrResize );
-            -
                                addListener( el, 'onresize', handleMoveOrResize );
-            -
                                addListener( el, 'onpropertychange', propChanged );
-            -
                                addListener( el, 'onmouseenter', mouseEntered );
-            -
                                addListener( el, 'onmouseleave', mouseLeft );
-            -
                                PIE.OnResize.observe( handleMoveOrResize );
-            -
-            -
                                PIE.OnBeforeUnload.observe( removeEventListeners );
-            -
                            }
-            -
-            -
                            boundsInfo.unlock();
-            -
                        }
-            -
                    }
-            -
-            -
-            -
-            -
-            -
                    /**
-            -
                     * Event handler for onmove and onresize events. Invokes update() only if the element's
-            -
                     * bounds have previously been calculated, to prevent multiple runs during page load when
-            -
                     * the element has no initial CSS3 properties.
-            -
                     */
-            -
                    function handleMoveOrResize() {
-            -
                        if( boundsInfo && boundsInfo.hasBeenQueried() ) {
-            -
                            update();
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Update position and/or size as necessary. Both move and resize events call
-            -
                     * this rather than the updatePos/Size functions because sometimes, particularly
-            -
                     * during page load, one will fire but the other won't.
-            -
                     */
-            -
                    function update( force ) {
-            -
                        if( !destroyed ) {
-            -
                            if( initialized ) {
-            -
                                var i, len;
-            -
-            -
                                lockAll();
-            -
                                if( force || boundsInfo.positionChanged() ) {
-            -
                                    /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
-            -
                                       position changes may not always be accurate; it's possible that
-            -
                                       an element will actually move relative to its positioning parent, but its position
-            -
                                       relative to the viewport will stay the same. Need to come up with a better way to
-            -
                                       track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
-            -
                                       but that is a more expensive operation since it does some DOM walking, and we want this
-            -
                                       check to be as fast as possible. */
-            -
                                    for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                        renderers[i].updatePos();
-            -
                                    }
-            -
                                }
-            -
                                if( force || boundsInfo.sizeChanged() ) {
-            -
                                    for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                        renderers[i].updateSize();
-            -
                                    }
-            -
                                }
-            -
                                unlockAll();
-            -
                            }
-            -
                            else if( !initializing ) {
-            -
                                init();
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle property changes to trigger update when appropriate.
-            -
                     */
-            -
                    function propChanged() {
-            -
                        var i, len, renderer,
-            -
                            e = event;
-            -
-            -
                        // Some elements like <table> fire onpropertychange events for old-school background properties
-            -
                        // ('background', 'bgColor') when runtimeStyle background properties are changed, which
-            -
                        // results in an infinite loop; therefore we filter out those property names. Also, 'display'
-            -
                        // is ignored because size calculations don't work correctly immediately when its onpropertychange
-            -
                        // event fires, and because it will trigger an onresize event anyway.
-            -
                        if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
-            -
                            if( initialized ) {
-            -
                                lockAll();
-            -
                                for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                    renderer = renderers[i];
-            -
                                    // Make sure position is synced if the element hasn't already been rendered.
-            -
                                    // TODO this feels sloppy - look into merging propChanged and update functions
-            -
                                    if( !renderer.isPositioned ) {
-            -
                                        renderer.updatePos();
-            -
                                    }
-            -
                                    if( renderer.needsUpdate() ) {
-            -
                                        renderer.updateProps();
-            -
                                    }
-            -
                                }
-            -
                                unlockAll();
-            -
                            }
-            -
                            else if( !initializing ) {
-            -
                                init();
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    function addHoverClass() {
-            -
                        if( el ) {
-            -
                            el.className += hoverClass;
-            -
                        }
-            -
                    }
-            -
-            -
                    function removeHoverClass() {
-            -
                        if( el ) {
-            -
                            el.className = el.className.replace( hoverClassRE, '' );
-            -
                        }
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
-            -
                     * hover styles to non-link elements, and to trigger a propertychange update.
-            -
                     */
-            -
                    function mouseEntered() {
-            -
                        //must delay this because the mouseenter event fires before the :hover styles are added.
-            -
                        setTimeout( addHoverClass, 0 );
-            -
                    }
-            -
-            -
                    /**
-            -
                     * Handle mouseleave events
-            -
                     */
-            -
                    function mouseLeft() {
-            -
                        //must delay this because the mouseleave event fires before the :hover styles are removed.
-            -
                        setTimeout( removeHoverClass, 0 );
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Handle property changes on ancestors of the element; see initAncestorPropChangeListeners()
-            -
                     * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
-            -
                     */
-            -
                    function ancestorPropChanged() {
-            -
                        var name = event.propertyName;
-            -
                        if( name === 'className' || name === 'id' ) {
-            -
                            propChanged();
-            -
                        }
-            -
                    }
-            -
-            -
                    function lockAll() {
-            -
                        boundsInfo.lock();
-            -
                        for( var i = styleInfosArr.length; i--; ) {
-            -
                            styleInfosArr[i].lock();
-            -
                        }
-            -
                    }
-            -
-            -
                    function unlockAll() {
-            -
                        for( var i = styleInfosArr.length; i--; ) {
-            -
                            styleInfosArr[i].unlock();
-            -
                        }
-            -
                        boundsInfo.unlock();
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Remove all event listeners from the element and any monitoried ancestors.
-            -
                     */
-            -
                    function removeEventListeners() {
-            -
                        if (eventsAttached) {
-            -
                            if( ancestors ) {
-            -
                                for( var i = 0, len = ancestors.length, a; i < len; i++ ) {
-            -
                                    a = ancestors[i];
-            -
                                    removeListener( a, 'onpropertychange', ancestorPropChanged );
-            -
                                    removeListener( a, 'onmouseenter', mouseEntered );
-            -
                                    removeListener( a, 'onmouseleave', mouseLeft );
-            -
                                }
-            -
                            }
-            -
-            -
                            // Remove event listeners
-            -
                            removeListener( el, 'onmove', update );
-            -
                            removeListener( el, 'onresize', update );
-            -
                            removeListener( el, 'onpropertychange', propChanged );
-            -
                            removeListener( el, 'onmouseenter', mouseEntered );
-            -
                            removeListener( el, 'onmouseleave', mouseLeft );
-            -
-            -
                            PIE.OnBeforeUnload.unobserve( removeEventListeners );
-            -
                            eventsAttached = 0;
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * Clean everything up when the behavior is removed from the element, or the element
-            -
                     * is manually destroyed.
-            -
                     */
-            -
                    function destroy() {
-            -
                        if( !destroyed ) {
-            -
                            var i, len;
-            -
-            -
                            removeEventListeners();
-            -
-            -
                            destroyed = 1;
-            -
-            -
                            // destroy any active renderers
-            -
                            if( renderers ) {
-            -
                                for( i = 0, len = renderers.length; i < len; i++ ) {
-            -
                                    renderers[i].destroy();
-            -
                                }
-            -
                            }
-            -
-            -
                            // Remove from list of polled elements in IE8
-            -
                            if( poll ) {
-            -
                                PIE.Heartbeat.unobserve( update );
-            -
                            }
-            -
                            // Stop onresize listening
-            -
                            PIE.OnResize.unobserve( update );
-            -
-            -
                            // Kill references
-            -
                            renderers = boundsInfo = styleInfos = styleInfosArr = ancestors = el = null;
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange listeners
-            -
                     * to ancestor(s) of the element so we can pick up style changes based on CSS rules using
-            -
                     * descendant selectors.
-            -
                     */
-            -
                    function initAncestorPropChangeListeners() {
-            -
                        var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
-            -
                            i, a;
-            -
                        if( watch ) {
-            -
                            ancestors = [];
-            -
                            watch = parseInt( watch, 10 );
-            -
                            i = 0;
-            -
                            a = el.parentNode;
-            -
                            while( a && ( watch === 'NaN' || i++ < watch ) ) {
-            -
                                ancestors.push( a );
-            -
                                addListener( a, 'onpropertychange', ancestorPropChanged );
-            -
                                addListener( a, 'onmouseenter', mouseEntered );
-            -
                                addListener( a, 'onmouseleave', mouseLeft );
-            -
                                a = a.parentNode;
-            -
                            }
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    /**
-            -
                     * If the target element is a first child, add a pie_first-child class to it. This allows using
-            -
                     * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
-            -
                     * pseudo-class selector.
-            -
                     */
-            -
                    function initFirstChildPseudoClass() {
-            -
                        var tmpEl = el,
-            -
                            isFirst = 1;
-            -
                        while( tmpEl = tmpEl.previousSibling ) {
-            -
                            if( tmpEl.nodeType === 1 ) {
-            -
                                isFirst = 0;
-            -
                                break;
-            -
                            }
-            -
                        }
-            -
                        if( isFirst ) {
-            -
                            el.className += ' ' + PIE.CLASS_PREFIX + 'first-child';
-            -
                        }
-            -
                    }
-            -
-            -
-            -
                    // These methods are all already bound to this instance so there's no need to wrap them
-            -
                    // in a closure to maintain the 'this' scope object when calling them.
-            -
                    this.init = init;
-            -
                    this.update = update;
-            -
                    this.destroy = destroy;
-            -
                    this.el = el;
-            -
                }
-            -
-            -
                Element.getInstance = function( el ) {
-            -
                    var id = PIE.Util.getUID( el );
-            -
                    return wrappers[ id ] || ( wrappers[ id ] = new Element( el ) );
-            -
                };
-            -
-            -
                Element.destroy = function( el ) {
-            -
                    var id = PIE.Util.getUID( el ),
-            -
                        wrapper = wrappers[ id ];
-            -
                    if( wrapper ) {
-            -
                        wrapper.destroy();
-            -
                        delete wrappers[ id ];
-            -
                    }
-            -
                };
-            -
-            -
                Element.destroyAll = function() {
-            -
                    var els = [], wrapper;
-            -
                    if( wrappers ) {
-            -
                        for( var w in wrappers ) {
-            -
                            if( wrappers.hasOwnProperty( w ) ) {
-            -
                                wrapper = wrappers[ w ];
-            -
                                els.push( wrapper.el );
-            -
                                wrapper.destroy();
-            -
                            }
-            -
                        }
-            -
                        wrappers = {};
-            -
                    }
-            -
                    return els;
-            -
                };
-            -
-            -
                return Element;
-            -
            })();
-            -
-            -
            /*
-            -
             * This file exposes the public API for invoking PIE.
-            -
             */
-            -
-            -
-            -
            /**
-            -
             * Programatically attach PIE to a single element.
-            -
             * @param {Element} el
-            -
             */
-            -
            PIE[ 'attach' ] = function( el ) {
-            -
                if (PIE.ieDocMode < 9) {
-            -
                    PIE.Element.getInstance( el ).init();
-            -
                }
-            -
            };
-            -
-            -
-            -
            /**
-            -
             * Programatically detach PIE from a single element.
-            -
             * @param {Element} el
-            -
             */
-            -
            PIE[ 'detach' ] = function( el ) {
-            -
                PIE.Element.destroy( el );
-            -
            };
-            -
-            -
-            -
            } // if( !PIE )
             })();


1	+ /*
2	+ PIE: CSS3 rendering for IE
3	+ Version 1.0beta4
4	+ http://css3pie.com
5	+ Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
6	+ */
7	+ (function(){
8	+ var doc = document;var PIE = window['PIE'];
9	+
10	+ if( !PIE ) {
11	+ PIE = window['PIE'] = {
12	+ CSS_PREFIX: '-pie-',
13	+ STYLE_PREFIX: 'Pie',
14	+ CLASS_PREFIX: 'pie_',
15	+ tableCellTags: {
16	+ 'TD': 1,
17	+ 'TH': 1
18	+ }
19	+ };
20	+
21	+ // Force the background cache to be used. No reason it shouldn't be.
22	+ try {
23	+ doc.execCommand( 'BackgroundImageCache', false, true );
24	+ } catch(e) {}
25	+
26	+ /*
27	+ * IE version detection approach by James Padolsey, with modifications -- from
28	+ * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
29	+ */
30	+ PIE.ieVersion = function(){
31	+ var v = 4,
32	+ div = doc.createElement('div'),
33	+ all = div.getElementsByTagName('i');
34	+
35	+ while (
36	+ div.innerHTML = '<!--[if gt IE ' + (++v) + ']><i></i><![endif]-->',
37	+ all[0]
38	+ ) {}
39	+
40	+ return v;
41	+ }();
42	+
43	+ // Detect IE6
44	+ if( PIE.ieVersion === 6 ) {
45	+ // IE6 can't access properties with leading dash, but can without it.
46	+ PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
47	+ }
48	+
49	+ // Detect IE8
50	+ PIE.ieDocMode = doc.documentMode \|\| PIE.ieVersion;
51	+ /**
52	+ * Utility functions
53	+ */
54	+ (function() {
55	+ var vmlCreatorDoc,
56	+ idNum = 0,
57	+ imageSizes = {};
58	+
59	+
60	+ PIE.Util = {
61	+
62	+ /**
63	+ * To create a VML element, it must be created by a Document which has the VML
64	+ * namespace set. Unfortunately, if you try to add the namespace programatically
65	+ * into the main document, you will get an "Unspecified error" when trying to
66	+ * access document.namespaces before the document is finished loading. To get
67	+ * around this, we create a DocumentFragment, which in IE land is apparently a
68	+ * full-fledged Document. It allows adding namespaces immediately, so we add the
69	+ * namespace there and then have it create the VML element.
70	+ * @param {string} tag The tag name for the VML element
71	+ * @return {Element} The new VML element
72	+ */
73	+ createVmlElement: function( tag ) {
74	+ var vmlPrefix = 'css3vml';
75	+ if( !vmlCreatorDoc ) {
76	+ vmlCreatorDoc = doc.createDocumentFragment();
77	+ vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
78	+ }
79	+ return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
80	+ },
81	+
82	+
83	+ /**
84	+ * Generate and return a unique ID for a given object. The generated ID is stored
85	+ * as a property of the object for future reuse.
86	+ * @param {Object} obj
87	+ */
88	+ getUID: function( obj ) {
89	+ return obj && obj[ '_pieId' ] \|\| ( obj[ '_pieId' ] = ++idNum );
90	+ },
91	+
92	+
93	+ /**
94	+ * Simple utility for merging objects
95	+ * @param {Object} obj1 The main object into which all others will be merged
96	+ * @param {...Object} var_args Other objects which will be merged into the first, in order
97	+ */
98	+ merge: function( obj1 ) {
99	+ var i, len, p, objN, args = arguments;
100	+ for( i = 1, len = args.length; i < len; i++ ) {
101	+ objN = args[i];
102	+ for( p in objN ) {
103	+ if( objN.hasOwnProperty( p ) ) {
104	+ obj1[ p ] = objN[ p ];
105	+ }
106	+ }
107	+ }
108	+ return obj1;
109	+ },
110	+
111	+
112	+ /**
113	+ * Execute a callback function, passing it the dimensions of a given image once
114	+ * they are known.
115	+ * @param {string} src The source URL of the image
116	+ * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
117	+ * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
118	+ */
119	+ withImageSize: function( src, func, ctx ) {
120	+ var size = imageSizes[ src ], img, queue;
121	+ if( size ) {
122	+ // If we have a queue, add to it
123	+ if( Object.prototype.toString.call( size ) === '[object Array]' ) {
124	+ size.push( [ func, ctx ] );
125	+ }
126	+ // Already have the size cached, call func right away
127	+ else {
128	+ func.call( ctx, size );
129	+ }
130	+ } else {
131	+ queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
132	+ img = new Image();
133	+ img.onload = function() {
134	+ size = imageSizes[ src ] = { w: img.width, h: img.height };
135	+ for( var i = 0, len = queue.length; i < len; i++ ) {
136	+ queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
137	+ }
138	+ img.onload = null;
139	+ };
140	+ img.src = src;
141	+ }
142	+ }
143	+ };
144	+ })();/**
145	+ *
146	+ */
147	+ PIE.Observable = function() {
148	+ /**
149	+ * List of registered observer functions
150	+ */
151	+ this.observers = [];
152	+
153	+ /**
154	+ * Hash of function ids to their position in the observers list, for fast lookup
155	+ */
156	+ this.indexes = {};
157	+ };
158	+ PIE.Observable.prototype = {
159	+
160	+ observe: function( fn ) {
161	+ var id = PIE.Util.getUID( fn ),
162	+ indexes = this.indexes,
163	+ observers = this.observers;
164	+ if( !( id in indexes ) ) {
165	+ indexes[ id ] = observers.length;
166	+ observers.push( fn );
167	+ }
168	+ },
169	+
170	+ unobserve: function( fn ) {
171	+ var id = PIE.Util.getUID( fn ),
172	+ indexes = this.indexes;
173	+ if( id && id in indexes ) {
174	+ delete this.observers[ indexes[ id ] ];
175	+ delete indexes[ id ];
176	+ }
177	+ },
178	+
179	+ fire: function() {
180	+ var o = this.observers,
181	+ i = o.length;
182	+ while( i-- ) {
183	+ o[ i ] && o[ i ]();
184	+ }
185	+ }
186	+
187	+ };/*
188	+ * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
189	+ * always firing the onmove and onresize events when elements are moved or resized. We check a few
190	+ * times every second to make sure the elements have the correct position and size. See Element.js
191	+ * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8
192	+ * and false elsewhere.
193	+ */
194	+
195	+ PIE.Heartbeat = new PIE.Observable();
196	+ PIE.Heartbeat.run = function() {
197	+ var me = this;
198	+ if( !me.running ) {
199	+ setInterval( function() { me.fire() }, 250 );
200	+ me.running = 1;
201	+ }
202	+ };
203	+ /**
204	+ * Create an observable listener for the onbeforeunload event
205	+ */
206	+ PIE.OnBeforeUnload = new PIE.Observable();
207	+ window.attachEvent( 'onbeforeunload', function() { PIE.OnBeforeUnload.fire(); } );
208	+
209	+ /**
210	+ * Attach an event which automatically gets detached onbeforeunload
211	+ */
212	+ PIE.OnBeforeUnload.attachManagedEvent = function( target, name, handler ) {
213	+ target.attachEvent( name, handler );
214	+ this.observe( function() {
215	+ target.detachEvent( name, handler );
216	+ } );
217	+ };/**
218	+ * Create a single observable listener for window resize events.
219	+ */
220	+ (function() {
221	+ PIE.OnResize = new PIE.Observable();
222	+
223	+ function resized() {
224	+ PIE.OnResize.fire();
225	+ }
226	+
227	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onresize', resized );
228	+ })();
229	+ /**
230	+ * Create a single observable listener for scroll events. Used for lazy loading based
231	+ * on the viewport, and for fixed position backgrounds.
232	+ */
233	+ (function() {
234	+ PIE.OnScroll = new PIE.Observable();
235	+
236	+ function scrolled() {
237	+ PIE.OnScroll.fire();
238	+ }
239	+
240	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onscroll', scrolled );
241	+
242	+ PIE.OnResize.observe( scrolled );
243	+ })();
244	+ /**
245	+ * Listen for printing events, destroy all active PIE instances when printing, and
246	+ * restore them afterward.
247	+ */
248	+ (function() {
249	+
250	+ var elements;
251	+
252	+ function beforePrint() {
253	+ elements = PIE.Element.destroyAll();
254	+ }
255	+
256	+ function afterPrint() {
257	+ if( elements ) {
258	+ for( var i = 0, len = elements.length; i < len; i++ ) {
259	+ PIE[ 'attach' ]( elements[i] );
260	+ }
261	+ elements = 0;
262	+ }
263	+ }
264	+
265	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
266	+ PIE.OnBeforeUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
267	+
268	+ })();/**
269	+ * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
270	+ * value is returned from PIE.getLength() - always use that instead of instantiating directly.
271	+ * @constructor
272	+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
273	+ * been validated as a valid length or percentage syntax.
274	+ */
275	+ PIE.Length = (function() {
276	+ var lengthCalcEl = doc.createElement( 'length-calc' ),
277	+ parent = doc.documentElement,
278	+ s = lengthCalcEl.style,
279	+ conversions = {},
280	+ units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
281	+ i = units.length,
282	+ instances = {};
283	+
284	+ s.position = 'absolute';
285	+ s.top = s.left = '-9999px';
286	+
287	+ parent.appendChild( lengthCalcEl );
288	+ while( i-- ) {
289	+ lengthCalcEl.style.width = '100' + units[i];
290	+ conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
291	+ }
292	+ parent.removeChild( lengthCalcEl );
293	+
294	+
295	+ function Length( val ) {
296	+ this.val = val;
297	+ }
298	+ Length.prototype = {
299	+ /**
300	+ * Regular expression for matching the length unit
301	+ * @private
302	+ */
303	+ unitRE: /(px\|em\|ex\|mm\|cm\|in\|pt\|pc\|%)$/,
304	+
305	+ /**
306	+ * Get the numeric value of the length
307	+ * @return {number} The value
308	+ */
309	+ getNumber: function() {
310	+ var num = this.num,
311	+ UNDEF;
312	+ if( num === UNDEF ) {
313	+ num = this.num = parseFloat( this.val );
314	+ }
315	+ return num;
316	+ },
317	+
318	+ /**
319	+ * Get the unit of the length
320	+ * @return {string} The unit
321	+ */
322	+ getUnit: function() {
323	+ var unit = this.unit,
324	+ m;
325	+ if( !unit ) {
326	+ m = this.val.match( this.unitRE );
327	+ unit = this.unit = ( m && m[0] ) \|\| 'px';
328	+ }
329	+ return unit;
330	+ },
331	+
332	+ /**
333	+ * Determine whether this is a percentage length value
334	+ * @return {boolean}
335	+ */
336	+ isPercentage: function() {
337	+ return this.getUnit() === '%';
338	+ },
339	+
340	+ /**
341	+ * Resolve this length into a number of pixels.
342	+ * @param {Element} el - the context element, used to resolve font-relative values
343	+ * @param {(function():number\|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
344	+ * function which will be called to return the number.
345	+ */
346	+ pixels: function( el, pct100 ) {
347	+ var num = this.getNumber(),
348	+ unit = this.getUnit();
349	+ switch( unit ) {
350	+ case "px":
351	+ return num;
352	+ case "%":
353	+ return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
354	+ case "em":
355	+ return num * this.getEmPixels( el );
356	+ case "ex":
357	+ return num * this.getEmPixels( el ) / 2;
358	+ default:
359	+ return num * conversions[ unit ];
360	+ }
361	+ },
362	+
363	+ /**
364	+ * The em and ex units are relative to the font-size of the current element,
365	+ * however if the font-size is set using non-pixel units then we get that value
366	+ * rather than a pixel conversion. To get around this, we keep a floating element
367	+ * with width:1em which we insert into the target element and then read its offsetWidth.
368	+ * But if the font-size is specified in pixels, then we use that directly to avoid
369	+ * the expensive DOM manipulation.
370	+ * @param el
371	+ */
372	+ getEmPixels: function( el ) {
373	+ var fs = el.currentStyle.fontSize,
374	+ px;
375	+
376	+ if( fs.indexOf( 'px' ) > 0 ) {
377	+ return parseFloat( fs );
378	+ } else {
379	+ lengthCalcEl.style.width = '1em';
380	+ el.appendChild( lengthCalcEl );
381	+ px = lengthCalcEl.offsetWidth;
382	+ if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
383	+ el.removeChild( lengthCalcEl );
384	+ }
385	+ return px;
386	+ }
387	+ }
388	+ };
389	+
390	+
391	+ /**
392	+ * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
393	+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
394	+ * been validated as a valid length or percentage syntax.
395	+ */
396	+ PIE.getLength = function( val ) {
397	+ return instances[ val ] \|\| ( instances[ val ] = new Length( val ) );
398	+ };
399	+
400	+ return Length;
401	+ })();
402	+ /**
403	+ * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
404	+ * @constructor
405	+ * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
406	+ */
407	+ PIE.BgPosition = (function() {
408	+
409	+ var length_fifty = PIE.getLength( '50%' ),
410	+ vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
411	+ horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
412	+
413	+
414	+ function BgPosition( tokens ) {
415	+ this.tokens = tokens;
416	+ }
417	+ BgPosition.prototype = {
418	+ /**
419	+ * Normalize the values into the form:
420	+ * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
421	+ * where: xOffsetSide is either 'left' or 'right',
422	+ * yOffsetSide is either 'top' or 'bottom',
423	+ * and x/yOffsetLength are both PIE.Length objects.
424	+ * @return {Array}
425	+ */
426	+ getValues: function() {
427	+ if( !this._values ) {
428	+ var tokens = this.tokens,
429	+ len = tokens.length,
430	+ Tokenizer = PIE.Tokenizer,
431	+ identType = Tokenizer.Type,
432	+ length_zero = PIE.getLength( '0' ),
433	+ type_ident = identType.IDENT,
434	+ type_length = identType.LENGTH,
435	+ type_percent = identType.PERCENT,
436	+ type, value,
437	+ vals = [ 'left', length_zero, 'top', length_zero ];
438	+
439	+ // If only one value, the second is assumed to be 'center'
440	+ if( len === 1 ) {
441	+ tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
442	+ len++;
443	+ }
444	+
445	+ // Two values - CSS2
446	+ if( len === 2 ) {
447	+ // If both idents, they can appear in either order, so switch them if needed
448	+ if( type_ident & ( tokens[0].tokenType \| tokens[1].tokenType ) &&
449	+ tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
450	+ tokens.push( tokens.shift() );
451	+ }
452	+ if( tokens[0].tokenType & type_ident ) {
453	+ if( tokens[0].tokenValue === 'center' ) {
454	+ vals[1] = length_fifty;
455	+ } else {
456	+ vals[0] = tokens[0].tokenValue;
457	+ }
458	+ }
459	+ else if( tokens[0].isLengthOrPercent() ) {
460	+ vals[1] = PIE.getLength( tokens[0].tokenValue );
461	+ }
462	+ if( tokens[1].tokenType & type_ident ) {
463	+ if( tokens[1].tokenValue === 'center' ) {
464	+ vals[3] = length_fifty;
465	+ } else {
466	+ vals[2] = tokens[1].tokenValue;
467	+ }
468	+ }
469	+ else if( tokens[1].isLengthOrPercent() ) {
470	+ vals[3] = PIE.getLength( tokens[1].tokenValue );
471	+ }
472	+ }
473	+
474	+ // Three or four values - CSS3
475	+ else {
476	+ // TODO
477	+ }
478	+
479	+ this._values = vals;
480	+ }
481	+ return this._values;
482	+ },
483	+
484	+ /**
485	+ * Find the coordinates of the background image from the upper-left corner of the background area.
486	+ * Note that these coordinate values are not rounded.
487	+ * @param {Element} el
488	+ * @param {number} width - the width for percentages (background area width minus image width)
489	+ * @param {number} height - the height for percentages (background area height minus image height)
490	+ * @return {Object} { x: Number, y: Number }
491	+ */
492	+ coords: function( el, width, height ) {
493	+ var vals = this.getValues(),
494	+ pxX = vals[1].pixels( el, width ),
495	+ pxY = vals[3].pixels( el, height );
496	+
497	+ return {
498	+ x: vals[0] === 'right' ? width - pxX : pxX,
499	+ y: vals[2] === 'bottom' ? height - pxY : pxY
500	+ };
501	+ }
502	+ };
503	+
504	+ return BgPosition;
505	+ })();
506	+ /**
507	+ * Wrapper for angle values; handles conversion to degrees from all allowed angle units
508	+ * @constructor
509	+ * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
510	+ */
511	+ PIE.Angle = (function() {
512	+ function Angle( val ) {
513	+ this.val = val;
514	+ }
515	+ Angle.prototype = {
516	+ unitRE: /[a-z]+$/i,
517	+
518	+ /**
519	+ * @return {string} The unit of the angle value
520	+ */
521	+ getUnit: function() {
522	+ return this._unit \|\| ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
523	+ },
524	+
525	+ /**
526	+ * Get the numeric value of the angle in degrees.
527	+ * @return {number} The degrees value
528	+ */
529	+ degrees: function() {
530	+ var deg = this._deg, u, n;
531	+ if( deg === undefined ) {
532	+ u = this.getUnit();
533	+ n = parseFloat( this.val, 10 );
534	+ deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
535	+ }
536	+ return deg;
537	+ }
538	+ };
539	+
540	+ return Angle;
541	+ })();/**
542	+ * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
543	+ * value is returned from PIE.getColor() - always use that instead of instantiating directly.
544	+ * @constructor
545	+ * @param {string} val The raw CSS string value for the color
546	+ */
547	+ PIE.Color = (function() {
548	+ var instances = {};
549	+
550	+ function Color( val ) {
551	+ this.val = val;
552	+ }
553	+
554	+ /**
555	+ * Regular expression for matching rgba colors and extracting their components
556	+ * @type {RegExp}
557	+ */
558	+ Color.rgbaRE = /\srgba$\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d+\|\d\.\d+)\s$\s*/;
559	+
560	+ Color.names = {
561	+ "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
562	+ "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
563	+ "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
564	+ "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
565	+ "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
566	+ "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
567	+ "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
568	+ "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
569	+ "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
570	+ "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
571	+ "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
572	+ "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
573	+ "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
574	+ "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
575	+ "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
576	+ "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
577	+ "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
578	+ "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
579	+ "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
580	+ "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
581	+ "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
582	+ "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
583	+ "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
584	+ "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
585	+ "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
586	+ "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
587	+ "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
588	+ "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
589	+ "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
590	+ "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
591	+ "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
592	+ "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
593	+ "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
594	+ "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
595	+ "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
596	+ "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
597	+ "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
598	+ "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
599	+ "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
600	+ "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
601	+ "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
602	+ "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
603	+ "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
604	+ "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
605	+ "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
606	+ "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
607	+ "yellow":"FF0", "yellowgreen":"9ACD32"
608	+ };
609	+
610	+ Color.prototype = {
611	+ /**
612	+ * @private
613	+ */
614	+ parse: function() {
615	+ if( !this._color ) {
616	+ var me = this,
617	+ v = me.val,
618	+ vLower,
619	+ m = v.match( Color.rgbaRE );
620	+ if( m ) {
621	+ me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
622	+ me._alpha = parseFloat( m[4] );
623	+ }
624	+ else {
625	+ if( ( vLower = v.toLowerCase() ) in Color.names ) {
626	+ v = '#' + Color.names[vLower];
627	+ }
628	+ me._color = v;
629	+ me._alpha = ( v === 'transparent' ? 0 : 1 );
630	+ }
631	+ }
632	+ },
633	+
634	+ /**
635	+ * Retrieve the value of the color in a format usable by IE natively. This will be the same as
636	+ * the raw input value, except for rgba values which will be converted to an rgb value.
637	+ * @param {Element} el The context element, used to get 'currentColor' keyword value.
638	+ * @return {string} Color value
639	+ */
640	+ colorValue: function( el ) {
641	+ this.parse();
642	+ return this._color === 'currentColor' ? el.currentStyle.color : this._color;
643	+ },
644	+
645	+ /**
646	+ * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
647	+ * with an alpha component.
648	+ * @return {number} The alpha value, from 0 to 1.
649	+ */
650	+ alpha: function() {
651	+ this.parse();
652	+ return this._alpha;
653	+ }
654	+ };
655	+
656	+
657	+ /**
658	+ * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
659	+ * @param {string} val The CSS string representing the color. It is assumed that this will already have
660	+ * been validated as a valid color syntax.
661	+ */
662	+ PIE.getColor = function(val) {
663	+ return instances[ val ] \|\| ( instances[ val ] = new Color( val ) );
664	+ };
665	+
666	+ return Color;
667	+ })();/**
668	+ * A tokenizer for CSS value strings.
669	+ * @constructor
670	+ * @param {string} css The CSS value string
671	+ */
672	+ PIE.Tokenizer = (function() {
673	+ function Tokenizer( css ) {
674	+ this.css = css;
675	+ this.ch = 0;
676	+ this.tokens = [];
677	+ this.tokenIndex = 0;
678	+ }
679	+
680	+ /**
681	+ * Enumeration of token type constants.
682	+ * @enum {number}
683	+ */
684	+ var Type = Tokenizer.Type = {
685	+ ANGLE: 1,
686	+ CHARACTER: 2,
687	+ COLOR: 4,
688	+ DIMEN: 8,
689	+ FUNCTION: 16,
690	+ IDENT: 32,
691	+ LENGTH: 64,
692	+ NUMBER: 128,
693	+ OPERATOR: 256,
694	+ PERCENT: 512,
695	+ STRING: 1024,
696	+ URL: 2048
697	+ };
698	+
699	+ /**
700	+ * A single token
701	+ * @constructor
702	+ * @param {number} type The type of the token - see PIE.Tokenizer.Type
703	+ * @param {string} value The value of the token
704	+ */
705	+ Tokenizer.Token = function( type, value ) {
706	+ this.tokenType = type;
707	+ this.tokenValue = value;
708	+ };
709	+ Tokenizer.Token.prototype = {
710	+ isLength: function() {
711	+ return this.tokenType & Type.LENGTH \|\| ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
712	+ },
713	+ isLengthOrPercent: function() {
714	+ return this.isLength() \|\| this.tokenType & Type.PERCENT;
715	+ }
716	+ };
717	+
718	+ Tokenizer.prototype = {
719	+ whitespace: /\s/,
720	+ number: /^[\+\-]?(\d*\.)?\d+/,
721	+ url: /^url$\s("([^"])"\|'([^'])'\|([!#$%&-~]))\s$/i,
722	+ ident: /^\-?[_a-z][\w-]*/i,
723	+ string: /^("([^"])"\|'([^'])')/,
724	+ operator: /^[\/,]/,
725	+ hash: /^#[\w]+/,
726	+ hashColor: /^#([\da-f]{6}\|[\da-f]{3})/i,
727	+
728	+ unitTypes: {
729	+ 'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
730	+ 'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
731	+ 'pt': Type.LENGTH, 'pc': Type.LENGTH,
732	+ 'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
733	+ },
734	+
735	+ colorNames: {
736	+ 'aqua':1, 'black':1, 'blue':1, 'fuchsia':1, 'gray':1, 'green':1, 'lime':1, 'maroon':1,
737	+ 'navy':1, 'olive':1, 'purple':1, 'red':1, 'silver':1, 'teal':1, 'white':1, 'yellow': 1,
738	+ 'currentColor': 1
739	+ },
740	+
741	+ colorFunctions: {
742	+ 'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
743	+ },
744	+
745	+
746	+ /**
747	+ * Advance to and return the next token in the CSS string. If the end of the CSS string has
748	+ * been reached, null will be returned.
749	+ * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
750	+ * @return {PIE.Tokenizer.Token}
751	+ */
752	+ next: function( forget ) {
753	+ var css, ch, firstChar, match, val,
754	+ me = this;
755	+
756	+ function newToken( type, value ) {
757	+ var tok = new Tokenizer.Token( type, value );
758	+ if( !forget ) {
759	+ me.tokens.push( tok );
760	+ me.tokenIndex++;
761	+ }
762	+ return tok;
763	+ }
764	+ function failure() {
765	+ me.tokenIndex++;
766	+ return null;
767	+ }
768	+
769	+ // In case we previously backed up, return the stored token in the next slot
770	+ if( this.tokenIndex < this.tokens.length ) {
771	+ return this.tokens[ this.tokenIndex++ ];
772	+ }
773	+
774	+ // Move past leading whitespace characters
775	+ while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
776	+ this.ch++;
777	+ }
778	+ if( this.ch >= this.css.length ) {
779	+ return failure();
780	+ }
781	+
782	+ ch = this.ch;
783	+ css = this.css.substring( this.ch );
784	+ firstChar = css.charAt( 0 );
785	+ switch( firstChar ) {
786	+ case '#':
787	+ if( match = css.match( this.hashColor ) ) {
788	+ this.ch += match[0].length;
789	+ return newToken( Type.COLOR, match[0] );
790	+ }
791	+ break;
792	+
793	+ case '"':
794	+ case "'":
795	+ if( match = css.match( this.string ) ) {
796	+ this.ch += match[0].length;
797	+ return newToken( Type.STRING, match[2] \|\| match[3] \|\| '' );
798	+ }
799	+ break;
800	+
801	+ case "/":
802	+ case ",":
803	+ this.ch++;
804	+ return newToken( Type.OPERATOR, firstChar );
805	+
806	+ case 'u':
807	+ if( match = css.match( this.url ) ) {
808	+ this.ch += match[0].length;
809	+ return newToken( Type.URL, match[2] \|\| match[3] \|\| match[4] \|\| '' );
810	+ }
811	+ }
812	+
813	+ // Numbers and values starting with numbers
814	+ if( match = css.match( this.number ) ) {
815	+ val = match[0];
816	+ this.ch += val.length;
817	+
818	+ // Check if it is followed by a unit
819	+ if( css.charAt( val.length ) === '%' ) {
820	+ this.ch++;
821	+ return newToken( Type.PERCENT, val + '%' );
822	+ }
823	+ if( match = css.substring( val.length ).match( this.ident ) ) {
824	+ val += match[0];
825	+ this.ch += match[0].length;
826	+ return newToken( this.unitTypes[ match[0].toLowerCase() ] \|\| Type.DIMEN, val );
827	+ }
828	+
829	+ // Plain ol' number
830	+ return newToken( Type.NUMBER, val );
831	+ }
832	+
833	+ // Identifiers
834	+ if( match = css.match( this.ident ) ) {
835	+ val = match[0];
836	+ this.ch += val.length;
837	+
838	+ // Named colors
839	+ if( val.toLowerCase() in PIE.Color.names \|\| val === 'currentColor' ) {
840	+ return newToken( Type.COLOR, val );
841	+ }
842	+
843	+ // Functions
844	+ if( css.charAt( val.length ) === '(' ) {
845	+ this.ch++;
846	+
847	+ // Color values in function format: rgb, rgba, hsl, hsla
848	+ if( val.toLowerCase() in this.colorFunctions ) {
849	+ function isNum( tok ) {
850	+ return tok && tok.tokenType & Type.NUMBER;
851	+ }
852	+ function isNumOrPct( tok ) {
853	+ return tok && ( tok.tokenType & ( Type.NUMBER \| Type.PERCENT ) );
854	+ }
855	+ function isValue( tok, val ) {
856	+ return tok && tok.tokenValue === val;
857	+ }
858	+ function next() {
859	+ return me.next( 1 );
860	+ }
861	+
862	+ if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
863	+ isValue( next(), ',' ) &&
864	+ isNumOrPct( next() ) &&
865	+ isValue( next(), ',' ) &&
866	+ isNumOrPct( next() ) &&
867	+ ( val === 'rgb' \|\| val === 'hsa' \|\| (
868	+ isValue( next(), ',' ) &&
869	+ isNum( next() )
870	+ ) ) &&
871	+ isValue( next(), ')' ) ) {
872	+ return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
873	+ }
874	+ return failure();
875	+ }
876	+
877	+ return newToken( Type.FUNCTION, val );
878	+ }
879	+
880	+ // Other identifier
881	+ return newToken( Type.IDENT, val );
882	+ }
883	+
884	+ // Standalone character
885	+ this.ch++;
886	+ return newToken( Type.CHARACTER, firstChar );
887	+ },
888	+
889	+ /**
890	+ * Determine whether there is another token
891	+ * @return {boolean}
892	+ */
893	+ hasNext: function() {
894	+ var next = this.next();
895	+ this.prev();
896	+ return !!next;
897	+ },
898	+
899	+ /**
900	+ * Back up and return the previous token
901	+ * @return {PIE.Tokenizer.Token}
902	+ */
903	+ prev: function() {
904	+ return this.tokens[ this.tokenIndex-- - 2 ];
905	+ },
906	+
907	+ /**
908	+ * Retrieve all the tokens in the CSS string
909	+ * @return {Array.<PIE.Tokenizer.Token>}
910	+ */
911	+ all: function() {
912	+ while( this.next() ) {}
913	+ return this.tokens;
914	+ },
915	+
916	+ /**
917	+ * Return a list of tokens from the current position until the given function returns
918	+ * true. The final token will not be included in the list.
919	+ * @param {function():boolean} func - test function
920	+ * @param {boolean} require - if true, then if the end of the CSS string is reached
921	+ * before the test function returns true, null will be returned instead of the
922	+ * tokens that have been found so far.
923	+ * @return {Array.<PIE.Tokenizer.Token>}
924	+ */
925	+ until: function( func, require ) {
926	+ var list = [], t, hit;
927	+ while( t = this.next() ) {
928	+ if( func( t ) ) {
929	+ hit = true;
930	+ this.prev();
931	+ break;
932	+ }
933	+ list.push( t );
934	+ }
935	+ return require && !hit ? null : list;
936	+ }
937	+ };
938	+
939	+ return Tokenizer;
940	+ })();/**
941	+ * Handles calculating, caching, and detecting changes to size and position of the element.
942	+ * @constructor
943	+ * @param {Element} el the target element
944	+ */
945	+ PIE.BoundsInfo = function( el ) {
946	+ this.targetElement = el;
947	+ };
948	+ PIE.BoundsInfo.prototype = {
949	+
950	+ _locked: 0,
951	+
952	+ positionChanged: function() {
953	+ var last = this._lastBounds,
954	+ bounds;
955	+ return !last \|\| ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x \|\| last.y !== bounds.y ) );
956	+ },
957	+
958	+ sizeChanged: function() {
959	+ var last = this._lastBounds,
960	+ bounds;
961	+ return !last \|\| ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w \|\| last.h !== bounds.h ) );
962	+ },
963	+
964	+ getLiveBounds: function() {
965	+ var rect = this.targetElement.getBoundingClientRect();
966	+ return {
967	+ x: rect.left,
968	+ y: rect.top,
969	+ w: rect.right - rect.left,
970	+ h: rect.bottom - rect.top
971	+ };
972	+ },
973	+
974	+ getBounds: function() {
975	+ return this._locked ?
976	+ ( this._lockedBounds \|\| ( this._lockedBounds = this.getLiveBounds() ) ) :
977	+ this.getLiveBounds();
978	+ },
979	+
980	+ hasBeenQueried: function() {
981	+ return !!this._lastBounds;
982	+ },
983	+
984	+ lock: function() {
985	+ ++this._locked;
986	+ },
987	+
988	+ unlock: function() {
989	+ if( !--this._locked ) {
990	+ if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
991	+ this._lockedBounds = null;
992	+ }
993	+ }
994	+
995	+ };
996	+ (function() {
997	+
998	+ function cacheWhenLocked( fn ) {
999	+ var uid = PIE.Util.getUID( fn );
1000	+ return function() {
1001	+ if( this._locked ) {
1002	+ var cache = this._lockedValues \|\| ( this._lockedValues = {} );
1003	+ return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
1004	+ } else {
1005	+ return fn.call( this );
1006	+ }
1007	+ }
1008	+ }
1009	+
1010	+
1011	+ PIE.StyleInfoBase = {
1012	+
1013	+ _locked: 0,
1014	+
1015	+ /**
1016	+ * Create a new StyleInfo class, with the standard constructor, and augmented by
1017	+ * the StyleInfoBase's members.
1018	+ * @param proto
1019	+ */
1020	+ newStyleInfo: function( proto ) {
1021	+ function StyleInfo( el ) {
1022	+ this.targetElement = el;
1023	+ }
1024	+ PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
1025	+ StyleInfo._propsCache = {};
1026	+ return StyleInfo;
1027	+ },
1028	+
1029	+ /**
1030	+ * Get an object representation of the target CSS style, caching it for each unique
1031	+ * CSS value string.
1032	+ * @return {Object}
1033	+ */
1034	+ getProps: function() {
1035	+ var css = this.getCss(),
1036	+ cache = this.constructor._propsCache;
1037	+ return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
1038	+ },
1039	+
1040	+ /**
1041	+ * Get the raw CSS value for the target style
1042	+ * @return {string}
1043	+ */
1044	+ getCss: cacheWhenLocked( function() {
1045	+ var el = this.targetElement,
1046	+ ctor = this.constructor,
1047	+ s = el.style,
1048	+ cs = el.currentStyle,
1049	+ cssProp = this.cssProperty,
1050	+ styleProp = this.styleProperty,
1051	+ prefixedCssProp = ctor._prefixedCssProp \|\| ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
1052	+ prefixedStyleProp = ctor._prefixedStyleProp \|\| ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
1053	+ return s[ prefixedStyleProp ] \|\| cs.getAttribute( prefixedCssProp ) \|\| s[ styleProp ] \|\| cs.getAttribute( cssProp );
1054	+ } ),
1055	+
1056	+ /**
1057	+ * Determine whether the target CSS style is active.
1058	+ * @return {boolean}
1059	+ */
1060	+ isActive: cacheWhenLocked( function() {
1061	+ return !!this.getProps();
1062	+ } ),
1063	+
1064	+ /**
1065	+ * Determine whether the target CSS style has changed since the last time it was used.
1066	+ * @return {boolean}
1067	+ */
1068	+ changed: cacheWhenLocked( function() {
1069	+ var currentCss = this.getCss(),
1070	+ changed = currentCss !== this._lastCss;
1071	+ this._lastCss = currentCss;
1072	+ return changed;
1073	+ } ),
1074	+
1075	+ cacheWhenLocked: cacheWhenLocked,
1076	+
1077	+ lock: function() {
1078	+ ++this._locked;
1079	+ },
1080	+
1081	+ unlock: function() {
1082	+ if( !--this._locked ) {
1083	+ delete this._lockedValues;
1084	+ }
1085	+ }
1086	+ };
1087	+
1088	+ })();/**
1089	+ * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
1090	+ * @constructor
1091	+ * @param {Element} el the target element
1092	+ */
1093	+ PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1094	+
1095	+ cssProperty: PIE.CSS_PREFIX + 'background',
1096	+ styleProperty: PIE.STYLE_PREFIX + 'Background',
1097	+
1098	+ attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
1099	+ repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
1100	+ originIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
1101	+ clipIdents: { 'padding-box':1, 'border-box':1 },
1102	+ positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
1103	+ sizeIdents: { 'contain':1, 'cover':1 },
1104	+
1105	+ /**
1106	+ * For background styles, we support the -pie-background property but fall back to the standard
1107	+ * backround* properties. The reason we have to use the prefixed version is that IE natively
1108	+ * parses the standard properties and if it sees something it doesn't know how to parse, for example
1109	+ * multiple values or gradient definitions, it will throw that away and not make it available through
1110	+ * currentStyle.
1111	+ *
1112	+ * Format of return object:
1113	+ * {
1114	+ * color: <PIE.Color>,
1115	+ * bgImages: [
1116	+ * {
1117	+ * imgType: 'image',
1118	+ * imgUrl: 'image.png',
1119	+ * imgRepeat: <'no-repeat' \| 'repeat-x' \| 'repeat-y' \| 'repeat'>,
1120	+ * bgPosition: <PIE.BgPosition>,
1121	+ * attachment: <'scroll' \| 'fixed' \| 'local'>,
1122	+ * bgOrigin: <'border-box' \| 'padding-box' \| 'content-box'>,
1123	+ * clip: <'border-box' \| 'padding-box'>,
1124	+ * size: <'contain' \| 'cover' \| { w: <'auto' \| PIE.Length>, h: <'auto' \| PIE.Length> }>
1125	+ * },
1126	+ * {
1127	+ * imgType: 'linear-gradient',
1128	+ * gradientStart: <PIE.BgPosition>,
1129	+ * angle: <PIE.Angle>,
1130	+ * stops: [
1131	+ * { color: <PIE.Color>, offset: <PIE.Length> },
1132	+ * { color: <PIE.Color>, offset: <PIE.Length> }, ...
1133	+ * ]
1134	+ * }
1135	+ * ]
1136	+ * }
1137	+ * @param {String} css
1138	+ * @override
1139	+ */
1140	+ parseCss: function( css ) {
1141	+ var el = this.targetElement,
1142	+ cs = el.currentStyle,
1143	+ tokenizer, token, image,
1144	+ tok_type = PIE.Tokenizer.Type,
1145	+ type_operator = tok_type.OPERATOR,
1146	+ type_ident = tok_type.IDENT,
1147	+ type_color = tok_type.COLOR,
1148	+ tokType, tokVal,
1149	+ positionIdents = this.positionIdents,
1150	+ gradient, stop,
1151	+ props = null;
1152	+
1153	+ function isBgPosToken( token ) {
1154	+ return token.isLengthOrPercent() \|\| ( token.tokenType & type_ident && token.tokenValue in positionIdents );
1155	+ }
1156	+
1157	+ function sizeToken( token ) {
1158	+ return ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) \|\| ( token.tokenValue === 'auto' && 'auto' );
1159	+ }
1160	+
1161	+ // If the CSS3-specific -pie-background property is present, parse it
1162	+ if( this.getCss3() ) {
1163	+ tokenizer = new PIE.Tokenizer( css );
1164	+ props = { bgImages: [] };
1165	+ image = {};
1166	+
1167	+ while( token = tokenizer.next() ) {
1168	+ tokType = token.tokenType;
1169	+ tokVal = token.tokenValue;
1170	+
1171	+ if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
1172	+ gradient = { stops: [], imgType: tokVal };
1173	+ stop = {};
1174	+ while( token = tokenizer.next() ) {
1175	+ tokType = token.tokenType;
1176	+ tokVal = token.tokenValue;
1177	+
1178	+ // If we reached the end of the function and had at least 2 stops, flush the info
1179	+ if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
1180	+ if( stop.color ) {
1181	+ gradient.stops.push( stop );
1182	+ }
1183	+ if( gradient.stops.length > 1 ) {
1184	+ PIE.Util.merge( image, gradient );
1185	+ }
1186	+ break;
1187	+ }
1188	+
1189	+ // Color stop - must start with color
1190	+ if( tokType & type_color ) {
1191	+ // if we already have an angle/position, make sure that the previous token was a comma
1192	+ if( gradient.angle \|\| gradient.gradientStart ) {
1193	+ token = tokenizer.prev();
1194	+ if( token.tokenType !== type_operator ) {
1195	+ break; //fail
1196	+ }
1197	+ tokenizer.next();
1198	+ }
1199	+
1200	+ stop = {
1201	+ color: PIE.getColor( tokVal )
1202	+ };
1203	+ // check for offset following color
1204	+ token = tokenizer.next();
1205	+ if( token.isLengthOrPercent() ) {
1206	+ stop.offset = PIE.getLength( token.tokenValue );
1207	+ } else {
1208	+ tokenizer.prev();
1209	+ }
1210	+ }
1211	+ // Angle - can only appear in first spot
1212	+ else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
1213	+ gradient.angle = new PIE.Angle( token.tokenValue );
1214	+ }
1215	+ else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
1216	+ tokenizer.prev();
1217	+ gradient.gradientStart = new PIE.BgPosition(
1218	+ tokenizer.until( function( t ) {
1219	+ return !isBgPosToken( t );
1220	+ }, false )
1221	+ );
1222	+ }
1223	+ else if( tokType & type_operator && tokVal === ',' ) {
1224	+ if( stop.color ) {
1225	+ gradient.stops.push( stop );
1226	+ stop = {};
1227	+ }
1228	+ }
1229	+ else {
1230	+ // Found something we didn't recognize; fail without adding image
1231	+ break;
1232	+ }
1233	+ }
1234	+ }
1235	+ else if( !image.imgType && tokType & tok_type.URL ) {
1236	+ image.imgUrl = tokVal;
1237	+ image.imgType = 'image';
1238	+ }
1239	+ else if( isBgPosToken( token ) && !image.size ) {
1240	+ tokenizer.prev();
1241	+ image.bgPosition = new PIE.BgPosition(
1242	+ tokenizer.until( function( t ) {
1243	+ return !isBgPosToken( t );
1244	+ }, false )
1245	+ );
1246	+ }
1247	+ else if( tokType & type_ident ) {
1248	+ if( tokVal in this.repeatIdents ) {
1249	+ image.imgRepeat = tokVal;
1250	+ }
1251	+ else if( tokVal in this.originIdents ) {
1252	+ image.bgOrigin = tokVal;
1253	+ if( tokVal in this.clipIdents ) {
1254	+ image.clip = tokVal;
1255	+ }
1256	+ }
1257	+ else if( tokVal in this.attachIdents ) {
1258	+ image.attachment = tokVal;
1259	+ }
1260	+ }
1261	+ else if( tokType & type_color && !props.color ) {
1262	+ props.color = PIE.getColor( tokVal );
1263	+ }
1264	+ else if( tokType & type_operator ) {
1265	+ // background size
1266	+ if( tokVal === '/' ) {
1267	+ token = tokenizer.next();
1268	+ tokType = token.tokenType;
1269	+ tokVal = token.tokenValue;
1270	+ if( tokType & type_ident && tokVal in this.sizeIdents ) {
1271	+ image.size = tokVal;
1272	+ }
1273	+ else if( tokVal = sizeToken( token ) ) {
1274	+ image.size = {
1275	+ w: tokVal,
1276	+ h: sizeToken( tokenizer.next() ) \|\| ( tokenizer.prev() && tokVal )
1277	+ };
1278	+ }
1279	+ }
1280	+ // new layer
1281	+ else if( tokVal === ',' && image.imgType ) {
1282	+ props.bgImages.push( image );
1283	+ image = {};
1284	+ }
1285	+ }
1286	+ else {
1287	+ // Found something unrecognized; chuck everything
1288	+ return null;
1289	+ }
1290	+ }
1291	+
1292	+ // leftovers
1293	+ if( image.imgType ) {
1294	+ props.bgImages.push( image );
1295	+ }
1296	+ }
1297	+
1298	+ // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
1299	+ else {
1300	+ this.withActualBg( function() {
1301	+ var posX = cs.backgroundPositionX,
1302	+ posY = cs.backgroundPositionY,
1303	+ img = cs.backgroundImage,
1304	+ color = cs.backgroundColor;
1305	+
1306	+ props = {};
1307	+ if( color !== 'transparent' ) {
1308	+ props.color = PIE.getColor( color )
1309	+ }
1310	+ if( img !== 'none' ) {
1311	+ props.bgImages = [ {
1312	+ imgType: 'image',
1313	+ imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
1314	+ imgRepeat: cs.backgroundRepeat,
1315	+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
1316	+ } ];
1317	+ }
1318	+ } );
1319	+ }
1320	+
1321	+ return ( props && ( props.color \|\| ( props.bgImages && props.bgImages[0] ) ) ) ? props : null;
1322	+ },
1323	+
1324	+ /**
1325	+ * Execute a function with the actual background styles (not overridden with runtimeStyle
1326	+ * properties set by the renderers) available via currentStyle.
1327	+ * @param fn
1328	+ */
1329	+ withActualBg: function( fn ) {
1330	+ var rs = this.targetElement.runtimeStyle,
1331	+ rsImage = rs.backgroundImage,
1332	+ rsColor = rs.backgroundColor,
1333	+ ret;
1334	+
1335	+ if( rsImage ) rs.backgroundImage = '';
1336	+ if( rsColor ) rs.backgroundColor = '';
1337	+
1338	+ ret = fn.call( this );
1339	+
1340	+ if( rsImage ) rs.backgroundImage = rsImage;
1341	+ if( rsColor ) rs.backgroundColor = rsColor;
1342	+
1343	+ return ret;
1344	+ },
1345	+
1346	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1347	+ return this.getCss3() \|\|
1348	+ this.withActualBg( function() {
1349	+ var cs = this.targetElement.currentStyle;
1350	+ return cs.backgroundColor + ' ' + cs.backgroundImage + ' ' + cs.backgroundRepeat + ' ' +
1351	+ cs.backgroundPositionX + ' ' + cs.backgroundPositionY;
1352	+ } );
1353	+ } ),
1354	+
1355	+ getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
1356	+ var el = this.targetElement;
1357	+ return el.style[ this.styleProperty ] \|\| el.currentStyle.getAttribute( this.cssProperty );
1358	+ } ),
1359	+
1360	+ /**
1361	+ * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
1362	+ */
1363	+ isPngFix: function() {
1364	+ var val = 0, el;
1365	+ if( PIE.ieVersion < 7 ) {
1366	+ el = this.targetElement;
1367	+ val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] \|\| el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
1368	+ }
1369	+ return val;
1370	+ },
1371	+
1372	+ /**
1373	+ * The isActive logic is slightly different, because getProps() always returns an object
1374	+ * even if it is just falling back to the native background properties. But we only want
1375	+ * to report is as being "active" if either the -pie-background override property is present
1376	+ * and parses successfully or '-pie-png-fix' is set to true in IE6.
1377	+ */
1378	+ isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
1379	+ return (this.getCss3() \|\| this.isPngFix()) && !!this.getProps();
1380	+ } )
1381	+
1382	+ } );/**
1383	+ * Handles parsing, caching, and detecting changes to border CSS
1384	+ * @constructor
1385	+ * @param {Element} el the target element
1386	+ */
1387	+ PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1388	+
1389	+ sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
1390	+ namedWidths: {
1391	+ 'thin': '1px',
1392	+ 'medium': '3px',
1393	+ 'thick': '5px'
1394	+ },
1395	+
1396	+ parseCss: function( css ) {
1397	+ var w = {},
1398	+ s = {},
1399	+ c = {},
1400	+ active = false,
1401	+ colorsSame = true,
1402	+ stylesSame = true,
1403	+ widthsSame = true;
1404	+
1405	+ this.withActualBorder( function() {
1406	+ var el = this.targetElement,
1407	+ cs = el.currentStyle,
1408	+ i = 0,
1409	+ style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
1410	+ for( ; i < 4; i++ ) {
1411	+ side = this.sides[ i ];
1412	+
1413	+ ltr = side.charAt(0).toLowerCase();
1414	+ style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
1415	+ color = cs[ 'border' + side + 'Color' ];
1416	+ width = cs[ 'border' + side + 'Width' ];
1417	+
1418	+ if( i > 0 ) {
1419	+ if( style !== lastStyle ) { stylesSame = false; }
1420	+ if( color !== lastColor ) { colorsSame = false; }
1421	+ if( width !== lastWidth ) { widthsSame = false; }
1422	+ }
1423	+ lastStyle = style;
1424	+ lastColor = color;
1425	+ lastWidth = width;
1426	+
1427	+ c[ ltr ] = PIE.getColor( color );
1428	+
1429	+ width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] \|\| width ) );
1430	+ if( width.pixels( this.targetElement ) > 0 ) {
1431	+ active = true;
1432	+ }
1433	+ }
1434	+ } );
1435	+
1436	+ return active ? {
1437	+ widths: w,
1438	+ styles: s,
1439	+ colors: c,
1440	+ widthsSame: widthsSame,
1441	+ colorsSame: colorsSame,
1442	+ stylesSame: stylesSame
1443	+ } : null;
1444	+ },
1445	+
1446	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1447	+ var el = this.targetElement,
1448	+ cs = el.currentStyle,
1449	+ css;
1450	+
1451	+ // Don't redraw or hide borders for cells in border-collapse:collapse tables
1452	+ if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
1453	+ this.withActualBorder( function() {
1454	+ css = cs.borderWidth + '\|' + cs.borderStyle + '\|' + cs.borderColor;
1455	+ } );
1456	+ }
1457	+ return css;
1458	+ } ),
1459	+
1460	+ /**
1461	+ * Execute a function with the actual border styles (not overridden with runtimeStyle
1462	+ * properties set by the renderers) available via currentStyle.
1463	+ * @param fn
1464	+ */
1465	+ withActualBorder: function( fn ) {
1466	+ var rs = this.targetElement.runtimeStyle,
1467	+ rsWidth = rs.borderWidth,
1468	+ rsColor = rs.borderColor,
1469	+ ret;
1470	+
1471	+ if( rsWidth ) rs.borderWidth = '';
1472	+ if( rsColor ) rs.borderColor = '';
1473	+
1474	+ ret = fn.call( this );
1475	+
1476	+ if( rsWidth ) rs.borderWidth = rsWidth;
1477	+ if( rsColor ) rs.borderColor = rsColor;
1478	+
1479	+ return ret;
1480	+ }
1481	+
1482	+ } );
1483	+ /**
1484	+ * Handles parsing, caching, and detecting changes to border-radius CSS
1485	+ * @constructor
1486	+ * @param {Element} el the target element
1487	+ */
1488	+ (function() {
1489	+
1490	+ PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1491	+
1492	+ cssProperty: 'border-radius',
1493	+ styleProperty: 'borderRadius',
1494	+
1495	+ parseCss: function( css ) {
1496	+ var p = null, x, y,
1497	+ tokenizer, token, length,
1498	+ hasNonZero = false;
1499	+
1500	+ if( css ) {
1501	+ tokenizer = new PIE.Tokenizer( css );
1502	+
1503	+ function collectLengths() {
1504	+ var arr = [], num;
1505	+ while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
1506	+ length = PIE.getLength( token.tokenValue );
1507	+ num = length.getNumber();
1508	+ if( num < 0 ) {
1509	+ return null;
1510	+ }
1511	+ if( num > 0 ) {
1512	+ hasNonZero = true;
1513	+ }
1514	+ arr.push( length );
1515	+ }
1516	+ return arr.length > 0 && arr.length < 5 ? {
1517	+ 'tl': arr[0],
1518	+ 'tr': arr[1] \|\| arr[0],
1519	+ 'br': arr[2] \|\| arr[0],
1520	+ 'bl': arr[3] \|\| arr[1] \|\| arr[0]
1521	+ } : null;
1522	+ }
1523	+
1524	+ // Grab the initial sequence of lengths
1525	+ if( x = collectLengths() ) {
1526	+ // See if there is a slash followed by more lengths, for the y-axis radii
1527	+ if( token ) {
1528	+ if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
1529	+ y = collectLengths();
1530	+ }
1531	+ } else {
1532	+ y = x;
1533	+ }
1534	+
1535	+ // Treat all-zero values the same as no value
1536	+ if( hasNonZero && x && y ) {
1537	+ p = { x: x, y : y };
1538	+ }
1539	+ }
1540	+ }
1541	+
1542	+ return p;
1543	+ }
1544	+ } );
1545	+
1546	+ var zero = PIE.getLength( '0' ),
1547	+ zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
1548	+ PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
1549	+
1550	+ })();/**
1551	+ * Handles parsing, caching, and detecting changes to border-image CSS
1552	+ * @constructor
1553	+ * @param {Element} el the target element
1554	+ */
1555	+ PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1556	+
1557	+ cssProperty: 'border-image',
1558	+ styleProperty: 'borderImage',
1559	+
1560	+ repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
1561	+
1562	+ parseCss: function( css ) {
1563	+ var p = null, tokenizer, token, type, value,
1564	+ slices, widths, outsets,
1565	+ slashCount = 0, cs,
1566	+ Type = PIE.Tokenizer.Type,
1567	+ IDENT = Type.IDENT,
1568	+ NUMBER = Type.NUMBER,
1569	+ LENGTH = Type.LENGTH,
1570	+ PERCENT = Type.PERCENT;
1571	+
1572	+ if( css ) {
1573	+ tokenizer = new PIE.Tokenizer( css );
1574	+ p = {};
1575	+
1576	+ function isSlash( token ) {
1577	+ return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
1578	+ }
1579	+
1580	+ function isFillIdent( token ) {
1581	+ return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
1582	+ }
1583	+
1584	+ function collectSlicesEtc() {
1585	+ slices = tokenizer.until( function( tok ) {
1586	+ return !( tok.tokenType & ( NUMBER \| PERCENT ) );
1587	+ } );
1588	+
1589	+ if( isFillIdent( tokenizer.next() ) && !p.fill ) {
1590	+ p.fill = true;
1591	+ } else {
1592	+ tokenizer.prev();
1593	+ }
1594	+
1595	+ if( isSlash( tokenizer.next() ) ) {
1596	+ slashCount++;
1597	+ widths = tokenizer.until( function( tok ) {
1598	+ return !( token.tokenType & ( NUMBER \| PERCENT \| LENGTH ) ) && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
1599	+ } );
1600	+
1601	+ if( isSlash( tokenizer.next() ) ) {
1602	+ slashCount++;
1603	+ outsets = tokenizer.until( function( tok ) {
1604	+ return !( token.tokenType & ( NUMBER \| LENGTH ) );
1605	+ } );
1606	+ }
1607	+ } else {
1608	+ tokenizer.prev();
1609	+ }
1610	+ }
1611	+
1612	+ while( token = tokenizer.next() ) {
1613	+ type = token.tokenType;
1614	+ value = token.tokenValue;
1615	+
1616	+ // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
1617	+ if( type & ( NUMBER \| PERCENT ) && !slices ) {
1618	+ tokenizer.prev();
1619	+ collectSlicesEtc();
1620	+ }
1621	+ else if( isFillIdent( token ) && !p.fill ) {
1622	+ p.fill = true;
1623	+ collectSlicesEtc();
1624	+ }
1625	+
1626	+ // Idents: one or values for 'repeat'
1627	+ else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
1628	+ p.repeat = { h: value };
1629	+ if( token = tokenizer.next() ) {
1630	+ if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
1631	+ p.repeat.v = token.tokenValue;
1632	+ } else {
1633	+ tokenizer.prev();
1634	+ }
1635	+ }
1636	+ }
1637	+
1638	+ // URL of the image
1639	+ else if( ( type & Type.URL ) && !p.src ) {
1640	+ p.src = value;
1641	+ }
1642	+
1643	+ // Found something unrecognized; exit.
1644	+ else {
1645	+ return null;
1646	+ }
1647	+ }
1648	+
1649	+ // Validate what we collected
1650	+ if( !p.src \|\| !slices \|\| slices.length < 1 \|\| slices.length > 4 \|\|
1651	+ ( widths && widths.length > 4 ) \|\| ( slashCount === 1 && widths.length < 1 ) \|\|
1652	+ ( outsets && outsets.length > 4 ) \|\| ( slashCount === 2 && outsets.length < 1 ) ) {
1653	+ return null;
1654	+ }
1655	+
1656	+ // Fill in missing values
1657	+ if( !p.repeat ) {
1658	+ p.repeat = { h: 'stretch' };
1659	+ }
1660	+ if( !p.repeat.v ) {
1661	+ p.repeat.v = p.repeat.h;
1662	+ }
1663	+
1664	+ function distributeSides( tokens, convertFn ) {
1665	+ return {
1666	+ t: convertFn( tokens[0] ),
1667	+ r: convertFn( tokens[1] \|\| tokens[0] ),
1668	+ b: convertFn( tokens[2] \|\| tokens[0] ),
1669	+ l: convertFn( tokens[3] \|\| tokens[1] \|\| tokens[0] )
1670	+ };
1671	+ }
1672	+
1673	+ p.slice = distributeSides( slices, function( tok ) {
1674	+ return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
1675	+ } );
1676	+
1677	+ p.width = widths && widths.length > 0 ?
1678	+ distributeSides( widths, function( tok ) {
1679	+ return tok.tokenType & ( LENGTH \| PERCENT ) ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
1680	+ } ) :
1681	+ ( cs = this.targetElement.currentStyle ) && {
1682	+ t: PIE.getLength( cs.borderTopWidth ),
1683	+ r: PIE.getLength( cs.borderRightWidth ),
1684	+ b: PIE.getLength( cs.borderBottomWidth ),
1685	+ l: PIE.getLength( cs.borderLeftWidth )
1686	+ };
1687	+
1688	+ p.outset = distributeSides( outsets \|\| [ 0 ], function( tok ) {
1689	+ return tok.tokenType & LENGTH ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
1690	+ } );
1691	+ }
1692	+
1693	+ return p;
1694	+ }
1695	+ } );/**
1696	+ * Handles parsing, caching, and detecting changes to box-shadow CSS
1697	+ * @constructor
1698	+ * @param {Element} el the target element
1699	+ */
1700	+ PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1701	+
1702	+ cssProperty: 'box-shadow',
1703	+ styleProperty: 'boxShadow',
1704	+
1705	+ parseCss: function( css ) {
1706	+ var props,
1707	+ getLength = PIE.getLength,
1708	+ Type = PIE.Tokenizer.Type,
1709	+ tokenizer;
1710	+
1711	+ if( css ) {
1712	+ tokenizer = new PIE.Tokenizer( css );
1713	+ props = { outset: [], inset: [] };
1714	+
1715	+ function parseItem() {
1716	+ var token, type, value, color, lengths, inset, len;
1717	+
1718	+ while( token = tokenizer.next() ) {
1719	+ value = token.tokenValue;
1720	+ type = token.tokenType;
1721	+
1722	+ if( type & Type.OPERATOR && value === ',' ) {
1723	+ break;
1724	+ }
1725	+ else if( token.isLength() && !lengths ) {
1726	+ tokenizer.prev();
1727	+ lengths = tokenizer.until( function( token ) {
1728	+ return !token.isLength();
1729	+ } );
1730	+ }
1731	+ else if( type & Type.COLOR && !color ) {
1732	+ color = value;
1733	+ }
1734	+ else if( type & Type.IDENT && value === 'inset' && !inset ) {
1735	+ inset = true;
1736	+ }
1737	+ else { //encountered an unrecognized token; fail.
1738	+ return false;
1739	+ }
1740	+ }
1741	+
1742	+ len = lengths && lengths.length;
1743	+ if( len > 1 && len < 5 ) {
1744	+ ( inset ? props.inset : props.outset ).push( {
1745	+ xOffset: getLength( lengths[0].tokenValue ),
1746	+ yOffset: getLength( lengths[1].tokenValue ),
1747	+ blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
1748	+ spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
1749	+ color: PIE.getColor( color \|\| 'currentColor' )
1750	+ } );
1751	+ return true;
1752	+ }
1753	+ return false;
1754	+ }
1755	+
1756	+ while( parseItem() ) {}
1757	+ }
1758	+
1759	+ return props && ( props.inset.length \|\| props.outset.length ) ? props : null;
1760	+ }
1761	+ } );
1762	+ /**
1763	+ * Retrieves the state of the element's visibility and display
1764	+ * @constructor
1765	+ * @param {Element} el the target element
1766	+ */
1767	+ PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
1768	+
1769	+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
1770	+ var cs = this.targetElement.currentStyle;
1771	+ return cs.visibility + '\|' + cs.display;
1772	+ } ),
1773	+
1774	+ parseCss: function() {
1775	+ var el = this.targetElement,
1776	+ rs = el.runtimeStyle,
1777	+ cs = el.currentStyle,
1778	+ rsVis = rs.visibility,
1779	+ csVis;
1780	+
1781	+ rs.visibility = '';
1782	+ csVis = cs.visibility;
1783	+ rs.visibility = rsVis;
1784	+
1785	+ return {
1786	+ visible: csVis !== 'hidden',
1787	+ displayed: cs.display !== 'none'
1788	+ }
1789	+ },
1790	+
1791	+ /**
1792	+ * Always return false for isActive, since this property alone will not trigger
1793	+ * a renderer to do anything.
1794	+ */
1795	+ isActive: function() {
1796	+ return false;
1797	+ }
1798	+
1799	+ } );
1800	+ PIE.RendererBase = {
1801	+
1802	+ /**
1803	+ * Create a new Renderer class, with the standard constructor, and augmented by
1804	+ * the RendererBase's members.
1805	+ * @param proto
1806	+ */
1807	+ newRenderer: function( proto ) {
1808	+ function Renderer( el, boundsInfo, styleInfos, parent ) {
1809	+ this.targetElement = el;
1810	+ this.boundsInfo = boundsInfo;
1811	+ this.styleInfos = styleInfos;
1812	+ this.parent = parent;
1813	+ }
1814	+ PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
1815	+ return Renderer;
1816	+ },
1817	+
1818	+ /**
1819	+ * Flag indicating the element has already been positioned at least once.
1820	+ * @type {boolean}
1821	+ */
1822	+ isPositioned: false,
1823	+
1824	+ /**
1825	+ * Determine if the renderer needs to be updated
1826	+ * @return {boolean}
1827	+ */
1828	+ needsUpdate: function() {
1829	+ return false;
1830	+ },
1831	+
1832	+ /**
1833	+ * Tell the renderer to update based on modified properties
1834	+ */
1835	+ updateProps: function() {
1836	+ this.destroy();
1837	+ if( this.isActive() ) {
1838	+ this.draw();
1839	+ }
1840	+ },
1841	+
1842	+ /**
1843	+ * Tell the renderer to update based on modified element position
1844	+ */
1845	+ updatePos: function() {
1846	+ this.isPositioned = true;
1847	+ },
1848	+
1849	+ /**
1850	+ * Tell the renderer to update based on modified element dimensions
1851	+ */
1852	+ updateSize: function() {
1853	+ if( this.isActive() ) {
1854	+ this.draw();
1855	+ } else {
1856	+ this.destroy();
1857	+ }
1858	+ },
1859	+
1860	+
1861	+ /**
1862	+ * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
1863	+ * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
1864	+ * So instead we make sure they are inserted into the DOM in the correct order.
1865	+ * @param {number} index
1866	+ * @param {Element} el
1867	+ */
1868	+ addLayer: function( index, el ) {
1869	+ this.removeLayer( index );
1870	+ for( var layers = this._layers \|\| ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
1871	+ layer = layers[i];
1872	+ if( layer ) {
1873	+ break;
1874	+ }
1875	+ }
1876	+ layers[index] = el;
1877	+ this.getBox().insertBefore( el, layer \|\| null );
1878	+ },
1879	+
1880	+ /**
1881	+ * Retrieve a layer element by its index, or null if not present
1882	+ * @param {number} index
1883	+ * @return {Element}
1884	+ */
1885	+ getLayer: function( index ) {
1886	+ var layers = this._layers;
1887	+ return layers && layers[index] \|\| null;
1888	+ },
1889	+
1890	+ /**
1891	+ * Remove a layer element by its index
1892	+ * @param {number} index
1893	+ */
1894	+ removeLayer: function( index ) {
1895	+ var layer = this.getLayer( index ),
1896	+ box = this._box;
1897	+ if( layer && box ) {
1898	+ box.removeChild( layer );
1899	+ this._layers[index] = null;
1900	+ }
1901	+ },
1902	+
1903	+
1904	+ /**
1905	+ * Get a VML shape by name, creating it if necessary.
1906	+ * @param {string} name A name identifying the element
1907	+ * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
1908	+ * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
1909	+ * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
1910	+ * using container elements in the correct order, to get correct z stacking without z-index.
1911	+ */
1912	+ getShape: function( name, subElName, parent, group ) {
1913	+ var shapes = this._shapes \|\| ( this._shapes = {} ),
1914	+ shape = shapes[ name ],
1915	+ s;
1916	+
1917	+ if( !shape ) {
1918	+ shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
1919	+ if( subElName ) {
1920	+ shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
1921	+ }
1922	+
1923	+ if( group ) {
1924	+ parent = this.getLayer( group );
1925	+ if( !parent ) {
1926	+ this.addLayer( group, doc.createElement( 'group' + group ) );
1927	+ parent = this.getLayer( group );
1928	+ }
1929	+ }
1930	+
1931	+ parent.appendChild( shape );
1932	+
1933	+ s = shape.style;
1934	+ s.position = 'absolute';
1935	+ s.left = s.top = 0;
1936	+ s['behavior'] = 'url(#default#VML)';
1937	+ }
1938	+ return shape;
1939	+ },
1940	+
1941	+ /**
1942	+ * Delete a named shape which was created by getShape(). Returns true if a shape with the
1943	+ * given name was found and deleted, or false if there was no shape of that name.
1944	+ * @param {string} name
1945	+ * @return {boolean}
1946	+ */
1947	+ deleteShape: function( name ) {
1948	+ var shapes = this._shapes,
1949	+ shape = shapes && shapes[ name ];
1950	+ if( shape ) {
1951	+ shape.parentNode.removeChild( shape );
1952	+ delete shapes[ name ];
1953	+ }
1954	+ return !!shape;
1955	+ },
1956	+
1957	+
1958	+ /**
1959	+ * For a given set of border radius length/percentage values, convert them to concrete pixel
1960	+ * values based on the current size of the target element.
1961	+ * @param {Object} radii
1962	+ * @return {Object}
1963	+ */
1964	+ getRadiiPixels: function( radii ) {
1965	+ var el = this.targetElement,
1966	+ bounds = this.boundsInfo.getBounds(),
1967	+ w = bounds.w,
1968	+ h = bounds.h,
1969	+ tlX, tlY, trX, trY, brX, brY, blX, blY, f;
1970	+
1971	+ tlX = radii.x['tl'].pixels( el, w );
1972	+ tlY = radii.y['tl'].pixels( el, h );
1973	+ trX = radii.x['tr'].pixels( el, w );
1974	+ trY = radii.y['tr'].pixels( el, h );
1975	+ brX = radii.x['br'].pixels( el, w );
1976	+ brY = radii.y['br'].pixels( el, h );
1977	+ blX = radii.x['bl'].pixels( el, w );
1978	+ blY = radii.y['bl'].pixels( el, h );
1979	+
1980	+ // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
1981	+ // is taken straight from the CSS3 Backgrounds and Borders spec.
1982	+ f = Math.min(
1983	+ w / ( tlX + trX ),
1984	+ h / ( trY + brY ),
1985	+ w / ( blX + brX ),
1986	+ h / ( tlY + blY )
1987	+ );
1988	+ if( f < 1 ) {
1989	+ tlX *= f;
1990	+ tlY *= f;
1991	+ trX *= f;
1992	+ trY *= f;
1993	+ brX *= f;
1994	+ brY *= f;
1995	+ blX *= f;
1996	+ blY *= f;
1997	+ }
1998	+
1999	+ return {
2000	+ x: {
2001	+ 'tl': tlX,
2002	+ 'tr': trX,
2003	+ 'br': brX,
2004	+ 'bl': blX
2005	+ },
2006	+ y: {
2007	+ 'tl': tlY,
2008	+ 'tr': trY,
2009	+ 'br': brY,
2010	+ 'bl': blY
2011	+ }
2012	+ }
2013	+ },
2014	+
2015	+ /**
2016	+ * Return the VML path string for the element's background box, with corners rounded.
2017	+ * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
2018	+ * pixels to shrink the box path inward from the element's four sides.
2019	+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
2020	+ * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
2021	+ * from this renderer's borderRadiusInfo object.
2022	+ * @return {string} the VML path
2023	+ */
2024	+ getBoxPath: function( shrink, mult, radii ) {
2025	+ mult = mult \|\| 1;
2026	+
2027	+ var r, str,
2028	+ bounds = this.boundsInfo.getBounds(),
2029	+ w = bounds.w * mult,
2030	+ h = bounds.h * mult,
2031	+ radInfo = this.styleInfos.borderRadiusInfo,
2032	+ floor = Math.floor, ceil = Math.ceil,
2033	+ shrinkT = shrink ? shrink.t * mult : 0,
2034	+ shrinkR = shrink ? shrink.r * mult : 0,
2035	+ shrinkB = shrink ? shrink.b * mult : 0,
2036	+ shrinkL = shrink ? shrink.l * mult : 0,
2037	+ tlX, tlY, trX, trY, brX, brY, blX, blY;
2038	+
2039	+ if( radii \|\| radInfo.isActive() ) {
2040	+ r = this.getRadiiPixels( radii \|\| radInfo.getProps() );
2041	+
2042	+ tlX = r.x['tl'] * mult;
2043	+ tlY = r.y['tl'] * mult;
2044	+ trX = r.x['tr'] * mult;
2045	+ trY = r.y['tr'] * mult;
2046	+ brX = r.x['br'] * mult;
2047	+ brY = r.y['br'] * mult;
2048	+ blX = r.x['bl'] * mult;
2049	+ blY = r.y['bl'] * mult;
2050	+
2051	+ str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
2052	+ 'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
2053	+ 'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
2054	+ 'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
2055	+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
2056	+ 'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
2057	+ 'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
2058	+ 'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
2059	+ } else {
2060	+ // simplified path for non-rounded box
2061	+ str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
2062	+ 'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
2063	+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
2064	+ 'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
2065	+ 'xe';
2066	+ }
2067	+ return str;
2068	+ },
2069	+
2070	+
2071	+ /**
2072	+ * Get the container element for the shapes, creating it if necessary.
2073	+ */
2074	+ getBox: function() {
2075	+ var box = this.parent.getLayer( this.boxZIndex ), s;
2076	+
2077	+ if( !box ) {
2078	+ box = doc.createElement( this.boxName );
2079	+ s = box.style;
2080	+ s.position = 'absolute';
2081	+ s.top = s.left = 0;
2082	+ this.parent.addLayer( this.boxZIndex, box );
2083	+ }
2084	+
2085	+ return box;
2086	+ },
2087	+
2088	+
2089	+ /**
2090	+ * Destroy the rendered objects. This is a base implementation which handles common renderer
2091	+ * structures, but individual renderers may override as necessary.
2092	+ */
2093	+ destroy: function() {
2094	+ this.parent.removeLayer( this.boxZIndex );
2095	+ delete this._shapes;
2096	+ delete this._layers;
2097	+ }
2098	+ };
2099	+ /**
2100	+ * Root renderer; creates the outermost container element and handles keeping it aligned
2101	+ * with the target element's size and position.
2102	+ * @param {Element} el The target element
2103	+ * @param {Object} styleInfos The StyleInfo objects
2104	+ */
2105	+ PIE.RootRenderer = PIE.RendererBase.newRenderer( {
2106	+
2107	+ isActive: function() {
2108	+ var children = this.childRenderers;
2109	+ for( var i in children ) {
2110	+ if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
2111	+ return true;
2112	+ }
2113	+ }
2114	+ return false;
2115	+ },
2116	+
2117	+ needsUpdate: function() {
2118	+ return this.styleInfos.visibilityInfo.changed();
2119	+ },
2120	+
2121	+ updatePos: function() {
2122	+ if( this.isActive() ) {
2123	+ var el = this.getPositioningElement(),
2124	+ par = el,
2125	+ docEl,
2126	+ parRect,
2127	+ tgtCS = el.currentStyle,
2128	+ tgtPos = tgtCS.position,
2129	+ boxPos,
2130	+ s = this.getBox().style, cs,
2131	+ x = 0, y = 0,
2132	+ elBounds = this.boundsInfo.getBounds();
2133	+
2134	+ if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
2135	+ x = elBounds.x;
2136	+ y = elBounds.y;
2137	+ boxPos = tgtPos;
2138	+ } else {
2139	+ // Get the element's offsets from its nearest positioned ancestor. Uses
2140	+ // getBoundingClientRect for accuracy and speed.
2141	+ do {
2142	+ par = par.offsetParent;
2143	+ } while( par && ( par.currentStyle.position === 'static' ) );
2144	+ if( par ) {
2145	+ parRect = par.getBoundingClientRect();
2146	+ cs = par.currentStyle;
2147	+ x = elBounds.x - parRect.left - ( parseFloat(cs.borderLeftWidth) \|\| 0 );
2148	+ y = elBounds.y - parRect.top - ( parseFloat(cs.borderTopWidth) \|\| 0 );
2149	+ } else {
2150	+ docEl = doc.documentElement;
2151	+ x = elBounds.x + docEl.scrollLeft - docEl.clientLeft;
2152	+ y = elBounds.y + docEl.scrollTop - docEl.clientTop;
2153	+ }
2154	+ boxPos = 'absolute';
2155	+ }
2156	+
2157	+ s.position = boxPos;
2158	+ s.left = x;
2159	+ s.top = y;
2160	+ s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
2161	+ this.isPositioned = true;
2162	+ }
2163	+ },
2164	+
2165	+ updateSize: function() {
2166	+ // NO-OP
2167	+ },
2168	+
2169	+ updateVisibility: function() {
2170	+ var vis = this.styleInfos.visibilityInfo.getProps();
2171	+ this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
2172	+ },
2173	+
2174	+ updateProps: function() {
2175	+ if( this.isActive() ) {
2176	+ this.updateVisibility();
2177	+ } else {
2178	+ this.destroy();
2179	+ }
2180	+ },
2181	+
2182	+ getPositioningElement: function() {
2183	+ var el = this.targetElement;
2184	+ return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
2185	+ },
2186	+
2187	+ getBox: function() {
2188	+ var box = this._box, el;
2189	+ if( !box ) {
2190	+ el = this.getPositioningElement();
2191	+ box = this._box = doc.createElement( 'css3-container' );
2192	+ box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
2193	+
2194	+ this.updateVisibility();
2195	+
2196	+ el.parentNode.insertBefore( box, el );
2197	+ }
2198	+ return box;
2199	+ },
2200	+
2201	+ destroy: function() {
2202	+ var box = this._box, par;
2203	+ if( box && ( par = box.parentNode ) ) {
2204	+ par.removeChild( box );
2205	+ }
2206	+ delete this._box;
2207	+ delete this._layers;
2208	+ }
2209	+
2210	+ } );
2211	+ /**
2212	+ * Renderer for element backgrounds.
2213	+ * @constructor
2214	+ * @param {Element} el The target element
2215	+ * @param {Object} styleInfos The StyleInfo objects
2216	+ * @param {PIE.RootRenderer} parent
2217	+ */
2218	+ PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
2219	+
2220	+ boxZIndex: 2,
2221	+ boxName: 'background',
2222	+
2223	+ needsUpdate: function() {
2224	+ var si = this.styleInfos;
2225	+ return si.backgroundInfo.changed() \|\| si.borderRadiusInfo.changed();
2226	+ },
2227	+
2228	+ isActive: function() {
2229	+ var si = this.styleInfos;
2230	+ return si.borderImageInfo.isActive() \|\|
2231	+ si.borderRadiusInfo.isActive() \|\|
2232	+ si.backgroundInfo.isActive() \|\|
2233	+ ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
2234	+ },
2235	+
2236	+ /**
2237	+ * Draw the shapes
2238	+ */
2239	+ draw: function() {
2240	+ var bounds = this.boundsInfo.getBounds();
2241	+ if( bounds.w && bounds.h ) {
2242	+ this.drawBgColor();
2243	+ this.drawBgImages();
2244	+ }
2245	+ },
2246	+
2247	+ /**
2248	+ * Draw the background color shape
2249	+ */
2250	+ drawBgColor: function() {
2251	+ var props = this.styleInfos.backgroundInfo.getProps(),
2252	+ bounds = this.boundsInfo.getBounds(),
2253	+ el = this.targetElement,
2254	+ color = props && props.color,
2255	+ shape, w, h, s, alpha;
2256	+
2257	+ if( color && color.alpha() > 0 ) {
2258	+ this.hideBackground();
2259	+
2260	+ shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
2261	+ w = bounds.w;
2262	+ h = bounds.h;
2263	+ shape.stroked = false;
2264	+ shape.coordsize = w * 2 + ',' + h * 2;
2265	+ shape.coordorigin = '1,1';
2266	+ shape.path = this.getBoxPath( null, 2 );
2267	+ s = shape.style;
2268	+ s.width = w;
2269	+ s.height = h;
2270	+ shape.fill.color = color.colorValue( el );
2271	+
2272	+ alpha = color.alpha();
2273	+ if( alpha < 1 ) {
2274	+ shape.fill.opacity = alpha;
2275	+ }
2276	+ } else {
2277	+ this.deleteShape( 'bgColor' );
2278	+ }
2279	+ },
2280	+
2281	+ /**
2282	+ * Draw all the background image layers
2283	+ */
2284	+ drawBgImages: function() {
2285	+ var props = this.styleInfos.backgroundInfo.getProps(),
2286	+ bounds = this.boundsInfo.getBounds(),
2287	+ images = props && props.bgImages,
2288	+ img, shape, w, h, s, i;
2289	+
2290	+ if( images ) {
2291	+ this.hideBackground();
2292	+
2293	+ w = bounds.w;
2294	+ h = bounds.h;
2295	+
2296	+ i = images.length;
2297	+ while( i-- ) {
2298	+ img = images[i];
2299	+ shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
2300	+
2301	+ shape.stroked = false;
2302	+ shape.fill.type = 'tile';
2303	+ shape.fillcolor = 'none';
2304	+ shape.coordsize = w * 2 + ',' + h * 2;
2305	+ shape.coordorigin = '1,1';
2306	+ shape.path = this.getBoxPath( 0, 2 );
2307	+ s = shape.style;
2308	+ s.width = w;
2309	+ s.height = h;
2310	+
2311	+ if( img.imgType === 'linear-gradient' ) {
2312	+ this.addLinearGradient( shape, img );
2313	+ }
2314	+ else {
2315	+ shape.fill.src = img.imgUrl;
2316	+ this.positionBgImage( shape, i );
2317	+ }
2318	+ }
2319	+ }
2320	+
2321	+ // Delete any bgImage shapes previously created which weren't used above
2322	+ i = images ? images.length : 0;
2323	+ while( this.deleteShape( 'bgImage' + i++ ) ) {}
2324	+ },
2325	+
2326	+
2327	+ /**
2328	+ * Set the position and clipping of the background image for a layer
2329	+ * @param {Element} shape
2330	+ * @param {number} index
2331	+ */
2332	+ positionBgImage: function( shape, index ) {
2333	+ PIE.Util.withImageSize( shape.fill.src, function( size ) {
2334	+ var fill = shape.fill,
2335	+ el = this.targetElement,
2336	+ bounds = this.boundsInfo.getBounds(),
2337	+ elW = bounds.w,
2338	+ elH = bounds.h,
2339	+ si = this.styleInfos,
2340	+ border = si.borderInfo.getProps(),
2341	+ bw = border && border.widths,
2342	+ bwT = bw ? bw['t'].pixels( el ) : 0,
2343	+ bwR = bw ? bw['r'].pixels( el ) : 0,
2344	+ bwB = bw ? bw['b'].pixels( el ) : 0,
2345	+ bwL = bw ? bw['l'].pixels( el ) : 0,
2346	+ bg = si.backgroundInfo.getProps().bgImages[ index ],
2347	+ bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
2348	+ repeat = bg.imgRepeat,
2349	+ pxX, pxY,
2350	+ clipT = 0, clipL = 0,
2351	+ clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
2352	+ clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
2353	+
2354	+ // Positioning - find the pixel offset from the top/left and convert to a ratio
2355	+ // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
2356	+ // needed to fix antialiasing but makes the bg image fuzzy.
2357	+ pxX = Math.round( bgPos.x ) + bwL + 0.5;
2358	+ pxY = Math.round( bgPos.y ) + bwT + 0.5;
2359	+ fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
2360	+
2361	+ // Repeating - clip the image shape
2362	+ if( repeat && repeat !== 'repeat' ) {
2363	+ if( repeat === 'repeat-x' \|\| repeat === 'no-repeat' ) {
2364	+ clipT = pxY + 1;
2365	+ clipB = pxY + size.h + clipAdjust;
2366	+ }
2367	+ if( repeat === 'repeat-y' \|\| repeat === 'no-repeat' ) {
2368	+ clipL = pxX + 1;
2369	+ clipR = pxX + size.w + clipAdjust;
2370	+ }
2371	+ shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
2372	+ }
2373	+ }, this );
2374	+ },
2375	+
2376	+
2377	+ /**
2378	+ * Draw the linear gradient for a gradient layer
2379	+ * @param {Element} shape
2380	+ * @param {Object} info The object holding the information about the gradient
2381	+ */
2382	+ addLinearGradient: function( shape, info ) {
2383	+ var el = this.targetElement,
2384	+ bounds = this.boundsInfo.getBounds(),
2385	+ w = bounds.w,
2386	+ h = bounds.h,
2387	+ fill = shape.fill,
2388	+ angle = info.angle,
2389	+ startPos = info.gradientStart,
2390	+ stops = info.stops,
2391	+ stopCount = stops.length,
2392	+ PI = Math.PI,
2393	+ UNDEF,
2394	+ startX, startY,
2395	+ endX, endY,
2396	+ startCornerX, startCornerY,
2397	+ endCornerX, endCornerY,
2398	+ vmlAngle, vmlGradientLength, vmlColors,
2399	+ deltaX, deltaY, lineLength,
2400	+ stopPx, vmlOffsetPct,
2401	+ p, i, j, before, after;
2402	+
2403	+ /**
2404	+ * Find the point along a given line (defined by a starting point and an angle), at which
2405	+ * that line is intersected by a perpendicular line extending through another point.
2406	+ * @param x1 - x coord of the starting point
2407	+ * @param y1 - y coord of the starting point
2408	+ * @param angle - angle of the line extending from the starting point (in degrees)
2409	+ * @param x2 - x coord of point along the perpendicular line
2410	+ * @param y2 - y coord of point along the perpendicular line
2411	+ * @return [ x, y ]
2412	+ */
2413	+ function perpendicularIntersect( x1, y1, angle, x2, y2 ) {
2414	+ // Handle straight vertical and horizontal angles, for performance and to avoid
2415	+ // divide-by-zero errors.
2416	+ if( angle === 0 \|\| angle === 180 ) {
2417	+ return [ x2, y1 ];
2418	+ }
2419	+ else if( angle === 90 \|\| angle === 270 ) {
2420	+ return [ x1, y2 ];
2421	+ }
2422	+ else {
2423	+ // General approach: determine the Ax+By=C formula for each line (the slope of the second
2424	+ // line is the negative inverse of the first) and then solve for where both formulas have
2425	+ // the same x/y values.
2426	+ var a1 = Math.tan( -angle * PI / 180 ),
2427	+ c1 = a1 * x1 - y1,
2428	+ a2 = -1 / a1,
2429	+ c2 = a2 * x2 - y2,
2430	+ d = a2 - a1,
2431	+ endX = ( c2 - c1 ) / d,
2432	+ endY = ( a1 * c2 - a2 * c1 ) / d;
2433	+ return [ endX, endY ];
2434	+ }
2435	+ }
2436	+
2437	+ // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
2438	+ // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
2439	+ // the total length of the VML rendered gradient-line corner to corner.
2440	+ function findCorners() {
2441	+ startCornerX = ( angle >= 90 && angle < 270 ) ? w : 0;
2442	+ startCornerY = angle < 180 ? h : 0;
2443	+ endCornerX = w - startCornerX;
2444	+ endCornerY = h - startCornerY;
2445	+ }
2446	+
2447	+ // Normalize the angle to a value between [0, 360)
2448	+ function normalizeAngle() {
2449	+ while( angle < 0 ) {
2450	+ angle += 360;
2451	+ }
2452	+ angle = angle % 360;
2453	+ }
2454	+
2455	+ // Find the distance between two points
2456	+ function distance( p1, p2 ) {
2457	+ var dx = p2[0] - p1[0],
2458	+ dy = p2[1] - p1[1];
2459	+ return Math.abs(
2460	+ dx === 0 ? dy :
2461	+ dy === 0 ? dx :
2462	+ Math.sqrt( dx * dx + dy * dy )
2463	+ );
2464	+ }
2465	+
2466	+ // Find the start and end points of the gradient
2467	+ if( startPos ) {
2468	+ startPos = startPos.coords( el, w, h );
2469	+ startX = startPos.x;
2470	+ startY = startPos.y;
2471	+ }
2472	+ if( angle ) {
2473	+ angle = angle.degrees();
2474	+
2475	+ normalizeAngle();
2476	+ findCorners();
2477	+
2478	+ // If no start position was specified, then choose a corner as the starting point.
2479	+ if( !startPos ) {
2480	+ startX = startCornerX;
2481	+ startY = startCornerY;
2482	+ }
2483	+
2484	+ // Find the end position by extending a perpendicular line from the gradient-line which
2485	+ // intersects the corner opposite from the starting corner.
2486	+ p = perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
2487	+ endX = p[0];
2488	+ endY = p[1];
2489	+ }
2490	+ else if( startPos ) {
2491	+ // Start position but no angle specified: find the end point by rotating 180deg around the center
2492	+ endX = w - startX;
2493	+ endY = h - startY;
2494	+ }
2495	+ else {
2496	+ // Neither position nor angle specified; create vertical gradient from top to bottom
2497	+ startX = startY = endX = 0;
2498	+ endY = h;
2499	+ }
2500	+ deltaX = endX - startX;
2501	+ deltaY = endY - startY;
2502	+
2503	+ if( angle === UNDEF ) {
2504	+ // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
2505	+ // or vertical angles so they get exact whole numbers rather than what atan2 gives.
2506	+ angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
2507	+ ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
2508	+ -Math.atan2( deltaY, deltaX ) / PI * 180
2509	+ )
2510	+ );
2511	+ normalizeAngle();
2512	+ findCorners();
2513	+ }
2514	+
2515	+
2516	+ // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
2517	+ // bounding box; for example specifying a 45 deg angle actually results in a gradient
2518	+ // drawn diagonally from one corner to its opposite corner, which will only appear to the
2519	+ // viewer as 45 degrees if the shape is equilateral. We adjust for this by taking the x/y deltas
2520	+ // between the start and end points, multiply one of them by the shape's aspect ratio,
2521	+ // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
2522	+ // horizontal or vertical then we don't need to do this conversion.
2523	+ vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
2524	+
2525	+ // VML angles are 180 degrees offset from CSS angles
2526	+ vmlAngle += 180;
2527	+ vmlAngle = vmlAngle % 360;
2528	+
2529	+ // Add all the stops to the VML 'colors' list, including the first and last stops.
2530	+ // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
2531	+ // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
2532	+ // percentage along the VML gradient-line, which runs from shape corner to corner.
2533	+ lineLength = distance( [ startX, startY ], [ endX, endY ] );
2534	+ vmlGradientLength = distance( [ startCornerX, startCornerY ], perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY ) );
2535	+ vmlColors = [];
2536	+ vmlOffsetPct = distance( [ startX, startY ], perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY ) ) / vmlGradientLength * 100;
2537	+
2538	+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
2539	+ stopPx = [];
2540	+ for( i = 0; i < stopCount; i++ ) {
2541	+ stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
2542	+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
2543	+ }
2544	+ // Fill in gaps with evenly-spaced offsets
2545	+ for( i = 1; i < stopCount; i++ ) {
2546	+ if( stopPx[ i ] === null ) {
2547	+ before = stopPx[ i - 1 ];
2548	+ j = i;
2549	+ do {
2550	+ after = stopPx[ ++j ];
2551	+ } while( after === null );
2552	+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
2553	+ }
2554	+ // Make sure each stop's offset is no less than the one before it
2555	+ stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
2556	+ }
2557	+
2558	+ // Convert to percentage along the VML gradient line and add to the VML 'colors' value
2559	+ for( i = 0; i < stopCount; i++ ) {
2560	+ vmlColors.push(
2561	+ ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
2562	+ );
2563	+ }
2564	+
2565	+ // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
2566	+ // the first and last stop colors; this just sets outer bounds for the gradient.
2567	+ fill['angle'] = vmlAngle;
2568	+ fill['type'] = 'gradient';
2569	+ fill['method'] = 'sigma';
2570	+ fill['color'] = stops[0].color.colorValue( el );
2571	+ fill['color2'] = stops[stopCount - 1].color.colorValue( el );
2572	+ fill['colors'].value = vmlColors.join( ',' );
2573	+ },
2574	+
2575	+
2576	+ /**
2577	+ * Hide the actual background image and color of the element.
2578	+ */
2579	+ hideBackground: function() {
2580	+ var rs = this.targetElement.runtimeStyle;
2581	+ rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
2582	+ rs.backgroundColor = 'transparent';
2583	+ },
2584	+
2585	+ destroy: function() {
2586	+ PIE.RendererBase.destroy.call( this );
2587	+ var rs = this.targetElement.runtimeStyle;
2588	+ rs.backgroundImage = rs.backgroundColor = '';
2589	+ }
2590	+
2591	+ } );
2592	+ /**
2593	+ * Renderer for element borders.
2594	+ * @constructor
2595	+ * @param {Element} el The target element
2596	+ * @param {Object} styleInfos The StyleInfo objects
2597	+ * @param {PIE.RootRenderer} parent
2598	+ */
2599	+ PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
2600	+
2601	+ boxZIndex: 4,
2602	+ boxName: 'border',
2603	+
2604	+ /**
2605	+ * Lookup table of elements which cannot take custom children.
2606	+ */
2607	+ childlessElements: {
2608	+ 'TABLE':1, //can obviously have children but not custom ones
2609	+ 'INPUT':1,
2610	+ 'TEXTAREA':1,
2611	+ 'SELECT':1,
2612	+ 'OPTION':1,
2613	+ 'IMG':1,
2614	+ 'HR':1,
2615	+ 'FIELDSET':1 //can take children but wrapping its children messes up its <legend>
2616	+ },
2617	+
2618	+ /**
2619	+ * Values of the type attribute for input elements displayed as buttons
2620	+ */
2621	+ inputButtonTypes: {
2622	+ 'submit':1,
2623	+ 'button':1,
2624	+ 'reset':1
2625	+ },
2626	+
2627	+ needsUpdate: function() {
2628	+ var si = this.styleInfos;
2629	+ return si.borderInfo.changed() \|\| si.borderRadiusInfo.changed();
2630	+ },
2631	+
2632	+ isActive: function() {
2633	+ var si = this.styleInfos;
2634	+ return ( si.borderImageInfo.isActive() \|\|
2635	+ si.borderRadiusInfo.isActive() \|\|
2636	+ si.backgroundInfo.isActive() ) &&
2637	+ si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
2638	+ },
2639	+
2640	+ /**
2641	+ * Draw the border shape(s)
2642	+ */
2643	+ draw: function() {
2644	+ var el = this.targetElement,
2645	+ cs = el.currentStyle,
2646	+ props = this.styleInfos.borderInfo.getProps(),
2647	+ bounds = this.boundsInfo.getBounds(),
2648	+ w = bounds.w,
2649	+ h = bounds.h,
2650	+ side, shape, stroke, s,
2651	+ segments, seg, i, len;
2652	+
2653	+ if( props ) {
2654	+ this.hideBorder();
2655	+
2656	+ segments = this.getBorderSegments( 2 );
2657	+ for( i = 0, len = segments.length; i < len; i++) {
2658	+ seg = segments[i];
2659	+ shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
2660	+ shape.coordsize = w * 2 + ',' + h * 2;
2661	+ shape.coordorigin = '1,1';
2662	+ shape.path = seg.path;
2663	+ s = shape.style;
2664	+ s.width = w;
2665	+ s.height = h;
2666	+
2667	+ shape.filled = !!seg.fill;
2668	+ shape.stroked = !!seg.stroke;
2669	+ if( seg.stroke ) {
2670	+ stroke = shape.stroke;
2671	+ stroke['weight'] = seg.weight + 'px';
2672	+ stroke.color = seg.color.colorValue( el );
2673	+ stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
2674	+ stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
2675	+ } else {
2676	+ shape.fill.color = seg.fill.colorValue( el );
2677	+ }
2678	+ }
2679	+
2680	+ // remove any previously-created border shapes which didn't get used above
2681	+ while( this.deleteShape( 'borderPiece' + i++ ) ) {}
2682	+ }
2683	+ },
2684	+
2685	+ /**
2686	+ * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
2687	+ * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
2688	+ * like form buttons require removing the border width altogether, so for those we increase the padding
2689	+ * by the border size.
2690	+ */
2691	+ hideBorder: function() {
2692	+ var el = this.targetElement,
2693	+ cs = el.currentStyle,
2694	+ rs = el.runtimeStyle,
2695	+ tag = el.tagName,
2696	+ isIE6 = PIE.ieVersion === 6,
2697	+ sides, side, i;
2698	+
2699	+ if( ( isIE6 && tag in this.childlessElements ) \|\| tag === 'BUTTON' \|\|
2700	+ ( tag === 'INPUT' && el.type in this.inputButtonTypes ) ) {
2701	+ rs.borderWidth = '';
2702	+ sides = this.styleInfos.borderInfo.sides;
2703	+ for( i = sides.length; i--; ) {
2704	+ side = sides[ i ];
2705	+ rs[ 'padding' + side ] = '';
2706	+ rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
2707	+ ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
2708	+ ( !PIE.ieVersion === 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
2709	+ }
2710	+ rs.borderWidth = 0;
2711	+ }
2712	+ else if( isIE6 ) {
2713	+ // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
2714	+ // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
2715	+ // (background and border) but displays all the contents.
2716	+ // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
2717	+ // as this can interfere with other author scripts which add/modify/delete children. Also, this
2718	+ // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
2719	+ // using a compositor filter or some other filter which masks the border.
2720	+ if( el.childNodes.length !== 1 \|\| el.firstChild.tagName !== 'ie6-mask' ) {
2721	+ var cont = doc.createElement( 'ie6-mask' ),
2722	+ s = cont.style, child;
2723	+ s.visibility = 'visible';
2724	+ s.zoom = 1;
2725	+ while( child = el.firstChild ) {
2726	+ cont.appendChild( child );
2727	+ }
2728	+ el.appendChild( cont );
2729	+ rs.visibility = 'hidden';
2730	+ }
2731	+ }
2732	+ else {
2733	+ rs.borderColor = 'transparent';
2734	+ }
2735	+ },
2736	+
2737	+
2738	+ /**
2739	+ * Get the VML path definitions for the border segment(s).
2740	+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
2741	+ * @return {Array.<string>}
2742	+ */
2743	+ getBorderSegments: function( mult ) {
2744	+ var el = this.targetElement,
2745	+ bounds, elW, elH,
2746	+ borderInfo = this.styleInfos.borderInfo,
2747	+ segments = [],
2748	+ floor, ceil, wT, wR, wB, wL,
2749	+ round = Math.round,
2750	+ borderProps, radiusInfo, radii, widths, styles, colors;
2751	+
2752	+ if( borderInfo.isActive() ) {
2753	+ borderProps = borderInfo.getProps();
2754	+
2755	+ widths = borderProps.widths;
2756	+ styles = borderProps.styles;
2757	+ colors = borderProps.colors;
2758	+
2759	+ if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
2760	+ if( colors['t'].alpha() > 0 ) {
2761	+ // shortcut for identical border on all sides - only need 1 stroked shape
2762	+ wT = widths['t'].pixels( el ); //thickness
2763	+ wR = wT / 2; //shrink
2764	+ segments.push( {
2765	+ path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
2766	+ stroke: styles['t'],
2767	+ color: colors['t'],
2768	+ weight: wT
2769	+ } );
2770	+ }
2771	+ }
2772	+ else {
2773	+ mult = mult \|\| 1;
2774	+ bounds = this.boundsInfo.getBounds();
2775	+ elW = bounds.w;
2776	+ elH = bounds.h;
2777	+
2778	+ wT = round( widths['t'].pixels( el ) );
2779	+ wR = round( widths['r'].pixels( el ) );
2780	+ wB = round( widths['b'].pixels( el ) );
2781	+ wL = round( widths['l'].pixels( el ) );
2782	+ var pxWidths = {
2783	+ 't': wT,
2784	+ 'r': wR,
2785	+ 'b': wB,
2786	+ 'l': wL
2787	+ };
2788	+
2789	+ radiusInfo = this.styleInfos.borderRadiusInfo;
2790	+ if( radiusInfo.isActive() ) {
2791	+ radii = this.getRadiiPixels( radiusInfo.getProps() );
2792	+ }
2793	+
2794	+ floor = Math.floor;
2795	+ ceil = Math.ceil;
2796	+
2797	+ function radius( xy, corner ) {
2798	+ return radii ? radii[ xy ][ corner ] : 0;
2799	+ }
2800	+
2801	+ function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
2802	+ var rx = radius( 'x', corner),
2803	+ ry = radius( 'y', corner),
2804	+ deg = 65535,
2805	+ isRight = corner.charAt( 1 ) === 'r',
2806	+ isBottom = corner.charAt( 0 ) === 'b';
2807	+ return ( rx > 0 && ry > 0 ) ?
2808	+ ( doMove ? 'al' : 'ae' ) +
2809	+ ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
2810	+ ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
2811	+ ( floor( rx ) - shrinkX ) * mult + ',' + // width
2812	+ ( floor( ry ) - shrinkY ) * mult + ',' + // height
2813	+ ( startAngle * deg ) + ',' + // start angle
2814	+ ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
2815	+ ) : (
2816	+ ( doMove ? 'm' : 'l' ) +
2817	+ ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
2818	+ ( isBottom ? elH - shrinkY : shrinkY ) * mult
2819	+ );
2820	+ }
2821	+
2822	+ function line( side, shrink, ccw, doMove ) {
2823	+ var
2824	+ start = (
2825	+ side === 't' ?
2826	+ floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
2827	+ side === 'r' ?
2828	+ ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
2829	+ side === 'b' ?
2830	+ ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
2831	+ // side === 'l' ?
2832	+ floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
2833	+ ),
2834	+ end = (
2835	+ side === 't' ?
2836	+ ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
2837	+ side === 'r' ?
2838	+ ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
2839	+ side === 'b' ?
2840	+ floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
2841	+ // side === 'l' ?
2842	+ floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
2843	+ );
2844	+ return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
2845	+ ( doMove ? 'm' + start : '' ) + 'l' + end;
2846	+ }
2847	+
2848	+
2849	+ function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
2850	+ var vert = side === 'l' \|\| side === 'r',
2851	+ sideW = pxWidths[ side ],
2852	+ beforeX, beforeY, afterX, afterY;
2853	+
2854	+ if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
2855	+ beforeX = pxWidths[ vert ? side : sideBefore ];
2856	+ beforeY = pxWidths[ vert ? sideBefore : side ];
2857	+ afterX = pxWidths[ vert ? side : sideAfter ];
2858	+ afterY = pxWidths[ vert ? sideAfter : side ];
2859	+
2860	+ if( styles[ side ] === 'dashed' \|\| styles[ side ] === 'dotted' ) {
2861	+ segments.push( {
2862	+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
2863	+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
2864	+ fill: colors[ side ]
2865	+ } );
2866	+ segments.push( {
2867	+ path: line( side, sideW / 2, 0, 1 ),
2868	+ stroke: styles[ side ],
2869	+ weight: sideW,
2870	+ color: colors[ side ]
2871	+ } );
2872	+ segments.push( {
2873	+ path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
2874	+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
2875	+ fill: colors[ side ]
2876	+ } );
2877	+ }
2878	+ else {
2879	+ segments.push( {
2880	+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
2881	+ line( side, sideW, 0, 0 ) +
2882	+ curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
2883	+
2884	+ ( styles[ side ] === 'double' && sideW > 2 ?
2885	+ curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
2886	+ line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
2887	+ curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
2888	+ 'x ' +
2889	+ curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
2890	+ line( side, floor( sideW / 3 ), 1, 0 ) +
2891	+ curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
2892	+ : '' ) +
2893	+
2894	+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
2895	+ line( side, 0, 1, 0 ) +
2896	+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
2897	+ fill: colors[ side ]
2898	+ } );
2899	+ }
2900	+ }
2901	+ }
2902	+
2903	+ addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
2904	+ addSide( 'r', 't', 'b', 'tr', 'br', 0 );
2905	+ addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
2906	+ addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
2907	+ }
2908	+ }
2909	+
2910	+ return segments;
2911	+ },
2912	+
2913	+ destroy: function() {
2914	+ PIE.RendererBase.destroy.call( this );
2915	+ this.targetElement.runtimeStyle.borderColor = '';
2916	+ }
2917	+
2918	+
2919	+ } );
2920	+ /**
2921	+ * Renderer for border-image
2922	+ * @constructor
2923	+ * @param {Element} el The target element
2924	+ * @param {Object} styleInfos The StyleInfo objects
2925	+ * @param {PIE.RootRenderer} parent
2926	+ */
2927	+ PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
2928	+
2929	+ boxZIndex: 5,
2930	+ pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
2931	+
2932	+ needsUpdate: function() {
2933	+ return this.styleInfos.borderImageInfo.changed();
2934	+ },
2935	+
2936	+ isActive: function() {
2937	+ return this.styleInfos.borderImageInfo.isActive();
2938	+ },
2939	+
2940	+ draw: function() {
2941	+ this.getBox(); //make sure pieces are created
2942	+
2943	+ var props = this.styleInfos.borderImageInfo.getProps(),
2944	+ bounds = this.boundsInfo.getBounds(),
2945	+ el = this.targetElement,
2946	+ pieces = this.pieces;
2947	+
2948	+ PIE.Util.withImageSize( props.src, function( imgSize ) {
2949	+ var elW = bounds.w,
2950	+ elH = bounds.h,
2951	+
2952	+ widths = props.width,
2953	+ widthT = widths.t.pixels( el ),
2954	+ widthR = widths.r.pixels( el ),
2955	+ widthB = widths.b.pixels( el ),
2956	+ widthL = widths.l.pixels( el ),
2957	+ slices = props.slice,
2958	+ sliceT = slices.t.pixels( el ),
2959	+ sliceR = slices.r.pixels( el ),
2960	+ sliceB = slices.b.pixels( el ),
2961	+ sliceL = slices.l.pixels( el );
2962	+
2963	+ // Piece positions and sizes
2964	+ function setSizeAndPos( piece, w, h, x, y ) {
2965	+ var s = pieces[piece].style,
2966	+ max = Math.max;
2967	+ s.width = max(w, 0);
2968	+ s.height = max(h, 0);
2969	+ s.left = x;
2970	+ s.top = y;
2971	+ }
2972	+ setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
2973	+ setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
2974	+ setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
2975	+ setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
2976	+ setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
2977	+ setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
2978	+ setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
2979	+ setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
2980	+ setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
2981	+
2982	+
2983	+ // image croppings
2984	+ function setCrops( sides, crop, val ) {
2985	+ for( var i=0, len=sides.length; i < len; i++ ) {
2986	+ pieces[ sides[i] ]['imagedata'][ crop ] = val;
2987	+ }
2988	+ }
2989	+
2990	+ // corners
2991	+ setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
2992	+ setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
2993	+ setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
2994	+ setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
2995	+
2996	+ // edges and center
2997	+ if( props.repeat.v === 'stretch' ) {
2998	+ setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
2999	+ setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
3000	+ }
3001	+ if( props.repeat.h === 'stretch' ) {
3002	+ setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
3003	+ setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
3004	+ }
3005	+
3006	+ // center fill
3007	+ pieces['c'].style.display = props.fill ? '' : 'none';
3008	+ }, this );
3009	+ },
3010	+
3011	+ getBox: function() {
3012	+ var box = this.parent.getLayer( this.boxZIndex ),
3013	+ s, piece, i,
3014	+ pieceNames = this.pieceNames,
3015	+ len = pieceNames.length;
3016	+
3017	+ if( !box ) {
3018	+ box = doc.createElement( 'border-image' );
3019	+ s = box.style;
3020	+ s.position = 'absolute';
3021	+
3022	+ this.pieces = {};
3023	+
3024	+ for( i = 0; i < len; i++ ) {
3025	+ piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
3026	+ piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
3027	+ s = piece.style;
3028	+ s['behavior'] = 'url(#default#VML)';
3029	+ s.position = "absolute";
3030	+ s.top = s.left = 0;
3031	+ piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
3032	+ piece.stroked = false;
3033	+ piece.filled = false;
3034	+ box.appendChild( piece );
3035	+ }
3036	+
3037	+ this.parent.addLayer( this.boxZIndex, box );
3038	+ }
3039	+
3040	+ return box;
3041	+ }
3042	+
3043	+ } );
3044	+ /**
3045	+ * Renderer for outset box-shadows
3046	+ * @constructor
3047	+ * @param {Element} el The target element
3048	+ * @param {Object} styleInfos The StyleInfo objects
3049	+ * @param {PIE.RootRenderer} parent
3050	+ */
3051	+ PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
3052	+
3053	+ boxZIndex: 1,
3054	+ boxName: 'outset-box-shadow',
3055	+
3056	+ needsUpdate: function() {
3057	+ var si = this.styleInfos;
3058	+ return si.boxShadowInfo.changed() \|\| si.borderRadiusInfo.changed();
3059	+ },
3060	+
3061	+ isActive: function() {
3062	+ var boxShadowInfo = this.styleInfos.boxShadowInfo;
3063	+ return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
3064	+ },
3065	+
3066	+ draw: function() {
3067	+ var me = this,
3068	+ el = this.targetElement,
3069	+ box = this.getBox(),
3070	+ styleInfos = this.styleInfos,
3071	+ shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
3072	+ radii = styleInfos.borderRadiusInfo.getProps(),
3073	+ len = shadowInfos.length,
3074	+ i = len, j,
3075	+ bounds = this.boundsInfo.getBounds(),
3076	+ w = bounds.w,
3077	+ h = bounds.h,
3078	+ clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
3079	+ corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
3080	+ shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
3081	+ totalW, totalH, focusX, focusY, isBottom, isRight;
3082	+
3083	+
3084	+ function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
3085	+ var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
3086	+ fill = shape.fill;
3087	+
3088	+ // Position and size
3089	+ shape['coordsize'] = w * 2 + ',' + h * 2;
3090	+ shape['coordorigin'] = '1,1';
3091	+
3092	+ // Color and opacity
3093	+ shape['stroked'] = false;
3094	+ shape['filled'] = true;
3095	+ fill.color = color.colorValue( el );
3096	+ if( blur ) {
3097	+ fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
3098	+ fill['color2'] = fill.color;
3099	+ fill['opacity'] = 0;
3100	+ }
3101	+
3102	+ // Path
3103	+ shape.path = path;
3104	+
3105	+ // This needs to go last for some reason, to prevent rendering at incorrect size
3106	+ ss = shape.style;
3107	+ ss.left = xOff;
3108	+ ss.top = yOff;
3109	+ ss.width = w;
3110	+ ss.height = h;
3111	+
3112	+ return shape;
3113	+ }
3114	+
3115	+
3116	+ while( i-- ) {
3117	+ shadowInfo = shadowInfos[ i ];
3118	+ xOff = shadowInfo.xOffset.pixels( el );
3119	+ yOff = shadowInfo.yOffset.pixels( el );
3120	+ spread = shadowInfo.spread.pixels( el ),
3121	+ blur = shadowInfo.blur.pixels( el );
3122	+ color = shadowInfo.color;
3123	+ // Shape path
3124	+ shrink = -spread - blur;
3125	+ if( !radii && blur ) {
3126	+ // If blurring, use a non-null border radius info object so that getBoxPath will
3127	+ // round the corners of the expanded shadow shape rather than squaring them off.
3128	+ radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
3129	+ }
3130	+ path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
3131	+
3132	+ if( blur ) {
3133	+ totalW = ( spread + blur ) * 2 + w;
3134	+ totalH = ( spread + blur ) * 2 + h;
3135	+ focusX = blur * 2 / totalW;
3136	+ focusY = blur * 2 / totalH;
3137	+ if( blur - spread > w / 2 \|\| blur - spread > h / 2 ) {
3138	+ // If the blur is larger than half the element's narrowest dimension, we cannot do
3139	+ // this with a single shape gradient, because its focussize would have to be less than
3140	+ // zero which results in ugly artifacts. Instead we create four shapes, each with its
3141	+ // gradient focus past center, and then clip them so each only shows the quadrant
3142	+ // opposite the focus.
3143	+ for( j = 4; j--; ) {
3144	+ corner = corners[j];
3145	+ isBottom = corner.charAt( 0 ) === 'b';
3146	+ isRight = corner.charAt( 1 ) === 'r';
3147	+ shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
3148	+ fill = shape.fill;
3149	+ fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
3150	+ ( isBottom ? 1 - focusY : focusY );
3151	+ fill['focussize'] = '0,0';
3152	+
3153	+ // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
3154	+ // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
3155	+ shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
3156	+ ( isRight ? totalW : totalW / 2 ) + 'px,' +
3157	+ ( isBottom ? totalH : totalH / 2 ) + 'px,' +
3158	+ ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
3159	+ }
3160	+ } else {
3161	+ // TODO delete old quadrant shapes if resizing expands past the barrier
3162	+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
3163	+ fill = shape.fill;
3164	+ fill['focusposition'] = focusX + ',' + focusY;
3165	+ fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
3166	+ }
3167	+ } else {
3168	+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
3169	+ alpha = color.alpha();
3170	+ if( alpha < 1 ) {
3171	+ // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
3172	+ // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha ) + ')';
3173	+ shape.fill.opacity = alpha;
3174	+ }
3175	+ }
3176	+ }
3177	+ }
3178	+
3179	+ } );
3180	+ /**
3181	+ * Renderer for re-rendering img elements using VML. Kicks in if the img has
3182	+ * a border-radius applied, or if the -pie-png-fix flag is set.
3183	+ * @constructor
3184	+ * @param {Element} el The target element
3185	+ * @param {Object} styleInfos The StyleInfo objects
3186	+ * @param {PIE.RootRenderer} parent
3187	+ */
3188	+ PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
3189	+
3190	+ boxZIndex: 6,
3191	+ boxName: 'imgEl',
3192	+
3193	+ needsUpdate: function() {
3194	+ var si = this.styleInfos;
3195	+ return this.targetElement.src !== this._lastSrc \|\| si.borderRadiusInfo.changed();
3196	+ },
3197	+
3198	+ isActive: function() {
3199	+ var si = this.styleInfos;
3200	+ return si.borderRadiusInfo.isActive() \|\| si.backgroundInfo.isPngFix();
3201	+ },
3202	+
3203	+ draw: function() {
3204	+ this._lastSrc = src;
3205	+ this.hideActualImg();
3206	+
3207	+ var shape = this.getShape( 'img', 'fill', this.getBox() ),
3208	+ fill = shape.fill,
3209	+ bounds = this.boundsInfo.getBounds(),
3210	+ w = bounds.w,
3211	+ h = bounds.h,
3212	+ borderProps = this.styleInfos.borderInfo.getProps(),
3213	+ borderWidths = borderProps && borderProps.widths,
3214	+ el = this.targetElement,
3215	+ src = el.src,
3216	+ round = Math.round,
3217	+ s;
3218	+
3219	+ shape.stroked = false;
3220	+ fill.type = 'frame';
3221	+ fill.src = src;
3222	+ fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
3223	+ shape.coordsize = w * 2 + ',' + h * 2;
3224	+ shape.coordorigin = '1,1';
3225	+ shape.path = this.getBoxPath( borderWidths ? {
3226	+ t: round( borderWidths['t'].pixels( el ) ),
3227	+ r: round( borderWidths['r'].pixels( el ) ),
3228	+ b: round( borderWidths['b'].pixels( el ) ),
3229	+ l: round( borderWidths['l'].pixels( el ) )
3230	+ } : 0, 2 );
3231	+ s = shape.style;
3232	+ s.width = w;
3233	+ s.height = h;
3234	+ },
3235	+
3236	+ hideActualImg: function() {
3237	+ this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
3238	+ },
3239	+
3240	+ destroy: function() {
3241	+ PIE.RendererBase.destroy.call( this );
3242	+ this.targetElement.runtimeStyle.filter = '';
3243	+ }
3244	+
3245	+ } );
3246	+
3247	+ PIE.Element = (function() {
3248	+
3249	+ var wrappers = {},
3250	+ lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
3251	+ pollCssProp = PIE.CSS_PREFIX + 'poll',
3252	+ hoverClass = ' ' + PIE.CLASS_PREFIX + 'hover',
3253	+ hoverClassRE = new RegExp( '\\b' + PIE.CLASS_PREFIX + 'hover\\b', 'g' ),
3254	+ ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 };
3255	+
3256	+
3257	+ function addListener( el, type, handler ) {
3258	+ el.attachEvent( type, handler );
3259	+ }
3260	+
3261	+ function removeListener( el, type, handler ) {
3262	+ el.detachEvent( type, handler );
3263	+ }
3264	+
3265	+
3266	+ function Element( el ) {
3267	+ var renderers,
3268	+ boundsInfo = new PIE.BoundsInfo( el ),
3269	+ styleInfos,
3270	+ styleInfosArr,
3271	+ ancestors,
3272	+ initializing,
3273	+ initialized,
3274	+ eventsAttached,
3275	+ delayed,
3276	+ destroyed,
3277	+ poll;
3278	+
3279	+ /**
3280	+ * Initialize PIE for this element.
3281	+ */
3282	+ function init() {
3283	+ if( !initialized ) {
3284	+ var docEl,
3285	+ bounds,
3286	+ cs = el.currentStyle,
3287	+ lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
3288	+ rootRenderer;
3289	+
3290	+ // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
3291	+ poll = cs.getAttribute( pollCssProp );
3292	+ poll = PIE.ieDocMode === 8 ? poll !== 'false' : poll === 'true';
3293	+
3294	+ // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
3295	+ // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
3296	+ if( !initializing ) {
3297	+ initializing = 1;
3298	+ el.runtimeStyle.zoom = 1;
3299	+ initFirstChildPseudoClass();
3300	+ }
3301	+
3302	+ boundsInfo.lock();
3303	+
3304	+ // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
3305	+ if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement \|\| doc.body ) &&
3306	+ ( bounds.y > docEl.clientHeight \|\| bounds.x > docEl.clientWidth \|\| bounds.y + bounds.h < 0 \|\| bounds.x + bounds.w < 0 ) ) {
3307	+ if( !delayed ) {
3308	+ delayed = 1;
3309	+ PIE.OnScroll.observe( init );
3310	+ }
3311	+ } else {
3312	+ initialized = 1;
3313	+ delayed = initializing = 0;
3314	+ PIE.OnScroll.unobserve( init );
3315	+
3316	+ // Create the style infos and renderers
3317	+ styleInfos = {
3318	+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
3319	+ borderInfo: new PIE.BorderStyleInfo( el ),
3320	+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
3321	+ borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
3322	+ boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
3323	+ visibilityInfo: new PIE.VisibilityStyleInfo( el )
3324	+ };
3325	+ styleInfosArr = [
3326	+ styleInfos.backgroundInfo,
3327	+ styleInfos.borderInfo,
3328	+ styleInfos.borderImageInfo,
3329	+ styleInfos.borderRadiusInfo,
3330	+ styleInfos.boxShadowInfo,
3331	+ styleInfos.visibilityInfo
3332	+ ];
3333	+
3334	+ rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
3335	+ var childRenderers = [
3336	+ new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3337	+ new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3338	+ //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3339	+ new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
3340	+ new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
3341	+ ];
3342	+ if( el.tagName === 'IMG' ) {
3343	+ childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
3344	+ }
3345	+ rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
3346	+ renderers = [ rootRenderer ].concat( childRenderers );
3347	+
3348	+ // Add property change listeners to ancestors if requested
3349	+ initAncestorPropChangeListeners();
3350	+
3351	+ // Add to list of polled elements in IE8
3352	+ if( poll ) {
3353	+ PIE.Heartbeat.observe( update );
3354	+ PIE.Heartbeat.run();
3355	+ }
3356	+
3357	+ // Trigger rendering
3358	+ update( 1 );
3359	+ }
3360	+
3361	+ if( !eventsAttached ) {
3362	+ eventsAttached = 1;
3363	+ addListener( el, 'onmove', handleMoveOrResize );
3364	+ addListener( el, 'onresize', handleMoveOrResize );
3365	+ addListener( el, 'onpropertychange', propChanged );
3366	+ addListener( el, 'onmouseenter', mouseEntered );
3367	+ addListener( el, 'onmouseleave', mouseLeft );
3368	+ PIE.OnResize.observe( handleMoveOrResize );
3369	+
3370	+ PIE.OnBeforeUnload.observe( removeEventListeners );
3371	+ }
3372	+
3373	+ boundsInfo.unlock();
3374	+ }
3375	+ }
3376	+
3377	+
3378	+
3379	+
3380	+ /**
3381	+ * Event handler for onmove and onresize events. Invokes update() only if the element's
3382	+ * bounds have previously been calculated, to prevent multiple runs during page load when
3383	+ * the element has no initial CSS3 properties.
3384	+ */
3385	+ function handleMoveOrResize() {
3386	+ if( boundsInfo && boundsInfo.hasBeenQueried() ) {
3387	+ update();
3388	+ }
3389	+ }
3390	+
3391	+
3392	+ /**
3393	+ * Update position and/or size as necessary. Both move and resize events call
3394	+ * this rather than the updatePos/Size functions because sometimes, particularly
3395	+ * during page load, one will fire but the other won't.
3396	+ */
3397	+ function update( force ) {
3398	+ if( !destroyed ) {
3399	+ if( initialized ) {
3400	+ var i, len;
3401	+
3402	+ lockAll();
3403	+ if( force \|\| boundsInfo.positionChanged() ) {
3404	+ /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
3405	+ position changes may not always be accurate; it's possible that
3406	+ an element will actually move relative to its positioning parent, but its position
3407	+ relative to the viewport will stay the same. Need to come up with a better way to
3408	+ track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
3409	+ but that is a more expensive operation since it does some DOM walking, and we want this
3410	+ check to be as fast as possible. */
3411	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3412	+ renderers[i].updatePos();
3413	+ }
3414	+ }
3415	+ if( force \|\| boundsInfo.sizeChanged() ) {
3416	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3417	+ renderers[i].updateSize();
3418	+ }
3419	+ }
3420	+ unlockAll();
3421	+ }
3422	+ else if( !initializing ) {
3423	+ init();
3424	+ }
3425	+ }
3426	+ }
3427	+
3428	+ /**
3429	+ * Handle property changes to trigger update when appropriate.
3430	+ */
3431	+ function propChanged() {
3432	+ var i, len, renderer,
3433	+ e = event;
3434	+
3435	+ // Some elements like <table> fire onpropertychange events for old-school background properties
3436	+ // ('background', 'bgColor') when runtimeStyle background properties are changed, which
3437	+ // results in an infinite loop; therefore we filter out those property names. Also, 'display'
3438	+ // is ignored because size calculations don't work correctly immediately when its onpropertychange
3439	+ // event fires, and because it will trigger an onresize event anyway.
3440	+ if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
3441	+ if( initialized ) {
3442	+ lockAll();
3443	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3444	+ renderer = renderers[i];
3445	+ // Make sure position is synced if the element hasn't already been rendered.
3446	+ // TODO this feels sloppy - look into merging propChanged and update functions
3447	+ if( !renderer.isPositioned ) {
3448	+ renderer.updatePos();
3449	+ }
3450	+ if( renderer.needsUpdate() ) {
3451	+ renderer.updateProps();
3452	+ }
3453	+ }
3454	+ unlockAll();
3455	+ }
3456	+ else if( !initializing ) {
3457	+ init();
3458	+ }
3459	+ }
3460	+ }
3461	+
3462	+
3463	+ function addHoverClass() {
3464	+ if( el ) {
3465	+ el.className += hoverClass;
3466	+ }
3467	+ }
3468	+
3469	+ function removeHoverClass() {
3470	+ if( el ) {
3471	+ el.className = el.className.replace( hoverClassRE, '' );
3472	+ }
3473	+ }
3474	+
3475	+ /**
3476	+ * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
3477	+ * hover styles to non-link elements, and to trigger a propertychange update.
3478	+ */
3479	+ function mouseEntered() {
3480	+ //must delay this because the mouseenter event fires before the :hover styles are added.
3481	+ setTimeout( addHoverClass, 0 );
3482	+ }
3483	+
3484	+ /**
3485	+ * Handle mouseleave events
3486	+ */
3487	+ function mouseLeft() {
3488	+ //must delay this because the mouseleave event fires before the :hover styles are removed.
3489	+ setTimeout( removeHoverClass, 0 );
3490	+ }
3491	+
3492	+
3493	+ /**
3494	+ * Handle property changes on ancestors of the element; see initAncestorPropChangeListeners()
3495	+ * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
3496	+ */
3497	+ function ancestorPropChanged() {
3498	+ var name = event.propertyName;
3499	+ if( name === 'className' \|\| name === 'id' ) {
3500	+ propChanged();
3501	+ }
3502	+ }
3503	+
3504	+ function lockAll() {
3505	+ boundsInfo.lock();
3506	+ for( var i = styleInfosArr.length; i--; ) {
3507	+ styleInfosArr[i].lock();
3508	+ }
3509	+ }
3510	+
3511	+ function unlockAll() {
3512	+ for( var i = styleInfosArr.length; i--; ) {
3513	+ styleInfosArr[i].unlock();
3514	+ }
3515	+ boundsInfo.unlock();
3516	+ }
3517	+
3518	+
3519	+ /**
3520	+ * Remove all event listeners from the element and any monitoried ancestors.
3521	+ */
3522	+ function removeEventListeners() {
3523	+ if (eventsAttached) {
3524	+ if( ancestors ) {
3525	+ for( var i = 0, len = ancestors.length, a; i < len; i++ ) {
3526	+ a = ancestors[i];
3527	+ removeListener( a, 'onpropertychange', ancestorPropChanged );
3528	+ removeListener( a, 'onmouseenter', mouseEntered );
3529	+ removeListener( a, 'onmouseleave', mouseLeft );
3530	+ }
3531	+ }
3532	+
3533	+ // Remove event listeners
3534	+ removeListener( el, 'onmove', update );
3535	+ removeListener( el, 'onresize', update );
3536	+ removeListener( el, 'onpropertychange', propChanged );
3537	+ removeListener( el, 'onmouseenter', mouseEntered );
3538	+ removeListener( el, 'onmouseleave', mouseLeft );
3539	+
3540	+ PIE.OnBeforeUnload.unobserve( removeEventListeners );
3541	+ eventsAttached = 0;
3542	+ }
3543	+ }
3544	+
3545	+
3546	+ /**
3547	+ * Clean everything up when the behavior is removed from the element, or the element
3548	+ * is manually destroyed.
3549	+ */
3550	+ function destroy() {
3551	+ if( !destroyed ) {
3552	+ var i, len;
3553	+
3554	+ removeEventListeners();
3555	+
3556	+ destroyed = 1;
3557	+
3558	+ // destroy any active renderers
3559	+ if( renderers ) {
3560	+ for( i = 0, len = renderers.length; i < len; i++ ) {
3561	+ renderers[i].destroy();
3562	+ }
3563	+ }
3564	+
3565	+ // Remove from list of polled elements in IE8
3566	+ if( poll ) {
3567	+ PIE.Heartbeat.unobserve( update );
3568	+ }
3569	+ // Stop onresize listening
3570	+ PIE.OnResize.unobserve( update );
3571	+
3572	+ // Kill references
3573	+ renderers = boundsInfo = styleInfos = styleInfosArr = ancestors = el = null;
3574	+ }
3575	+ }
3576	+
3577	+
3578	+ /**
3579	+ * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange listeners
3580	+ * to ancestor(s) of the element so we can pick up style changes based on CSS rules using
3581	+ * descendant selectors.
3582	+ */
3583	+ function initAncestorPropChangeListeners() {
3584	+ var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
3585	+ i, a;
3586	+ if( watch ) {
3587	+ ancestors = [];
3588	+ watch = parseInt( watch, 10 );
3589	+ i = 0;
3590	+ a = el.parentNode;
3591	+ while( a && ( watch === 'NaN' \|\| i++ < watch ) ) {
3592	+ ancestors.push( a );
3593	+ addListener( a, 'onpropertychange', ancestorPropChanged );
3594	+ addListener( a, 'onmouseenter', mouseEntered );
3595	+ addListener( a, 'onmouseleave', mouseLeft );
3596	+ a = a.parentNode;
3597	+ }
3598	+ }
3599	+ }
3600	+
3601	+
3602	+ /**
3603	+ * If the target element is a first child, add a pie_first-child class to it. This allows using
3604	+ * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
3605	+ * pseudo-class selector.
3606	+ */
3607	+ function initFirstChildPseudoClass() {
3608	+ var tmpEl = el,
3609	+ isFirst = 1;
3610	+ while( tmpEl = tmpEl.previousSibling ) {
3611	+ if( tmpEl.nodeType === 1 ) {
3612	+ isFirst = 0;
3613	+ break;
3614	+ }
3615	+ }
3616	+ if( isFirst ) {
3617	+ el.className += ' ' + PIE.CLASS_PREFIX + 'first-child';
3618	+ }
3619	+ }
3620	+
3621	+
3622	+ // These methods are all already bound to this instance so there's no need to wrap them
3623	+ // in a closure to maintain the 'this' scope object when calling them.
3624	+ this.init = init;
3625	+ this.update = update;
3626	+ this.destroy = destroy;
3627	+ this.el = el;
3628	+ }
3629	+
3630	+ Element.getInstance = function( el ) {
3631	+ var id = PIE.Util.getUID( el );
3632	+ return wrappers[ id ] \|\| ( wrappers[ id ] = new Element( el ) );
3633	+ };
3634	+
3635	+ Element.destroy = function( el ) {
3636	+ var id = PIE.Util.getUID( el ),
3637	+ wrapper = wrappers[ id ];
3638	+ if( wrapper ) {
3639	+ wrapper.destroy();
3640	+ delete wrappers[ id ];
3641	+ }
3642	+ };
3643	+
3644	+ Element.destroyAll = function() {
3645	+ var els = [], wrapper;
3646	+ if( wrappers ) {
3647	+ for( var w in wrappers ) {
3648	+ if( wrappers.hasOwnProperty( w ) ) {
3649	+ wrapper = wrappers[ w ];
3650	+ els.push( wrapper.el );
3651	+ wrapper.destroy();
3652	+ }
3653	+ }
3654	+ wrappers = {};
3655	+ }
3656	+ return els;
3657	+ };
3658	+
3659	+ return Element;
3660	+ })();
3661	+
3662	+ /*
3663	+ * This file exposes the public API for invoking PIE.
3664	+ */
3665	+
3666	+
3667	+ /**
3668	+ * Programatically attach PIE to a single element.
3669	+ * @param {Element} el
3670	+ */
3671	+ PIE[ 'attach' ] = function( el ) {
3672	+ if (PIE.ieDocMode < 9) {
3673	+ PIE.Element.getInstance( el ).init();
3674	+ }
3675	+ };
3676	+
3677	+
3678	+ /**
3679	+ * Programatically detach PIE from a single element.
3680	+ * @param {Element} el
3681	+ */
3682	+ PIE[ 'detach' ] = function( el ) {
3683	+ PIE.Element.destroy( el );
3684	+ };
3685	+
3686	+
3687	+ } // if( !PIE )
3688	})();

js/admin.js CHANGED Viewed

@@ -1,433 +1,433 @@
-            -
            jQuery(function($) {
-            -
            	$('div.gradPicker', '#styles-form').gradientPicker();
-            -
            	$('div.bgPicker', '#styles-form').bgPicker();
-            -
-            -
            	// Color Picker
-            -
            	$('input.pds_color_input', '#styles-form').change(function(){
-            -
            		if ( $(this).val().length < 3 ) {return;}
-            -
            		$(this).css( 'color', '#'+$(this).val() );
-            -
            		$(this).css( 'background-color', '#'+$(this).val() );
-            -
            	}).change().ColorPicker({
-            -
            		onChange: function(){
-            -
            			var el = $(this).data('colorpicker').el;
-            -
            			var hex = $(this).find('div.colorpicker_hex input').val();
-            -
-            -
            			$(el).val(hex).change();
-            -
            			saveStyles();
-            -
            		},
-            -
            		onSubmit: function(hsb, hex, rgb, el) {
-            -
            			$(el).val(hex).change();
-            -
            			$(el).ColorPickerHide();
-            -
            		},
-            -
            		onBeforeShow: function () {
-            -
            			$(this).ColorPickerSetColor( this.value );
-            -
            		},
-            -
            		onHide: function (colpkr) {
-            -
            			var el = $(colpkr).data('colorpicker').el;
-            -
            			var hex = $(colpkr).find('div.colorpicker_hex input').val();
-            -
-            -
            			$(el).val(hex).change();
-            -
-            -
            			return true;
-            -
            		}
-            -
            	});
-            -
-            -
            	// Sliders for integer inputs
-            -
            	$('input.slider', '#styles-form').each(function() {
-            -
            		// Show/hide slider on input click
-            -
            		$(this).click(function( e ) {
-            -
-            -
            			// Only init sliders on click for faster page load
-            -
            			if ( ! $(this).parent().next().hasClass('pds_slider_ui') ) {
-            -
-            -
            				var input_id = $(this).attr('id');
-            -
            				var input_val = parseInt( $(this).val() );
-            -
            				var opts = {
-            -
            					min: $(this).data('min'),
-            -
            					max: $(this).data('max'),
-            -
            					range: "min",
-            -
            					value: input_val + 1,
-            -
            					slide: function(event, ui) {
-            -
            						$(this).prev().find('input').val(ui.value - 1);
-            -
            					},
-            -
            					change: function(event, ui) {
-            -
            						$(this).prev().find('input').change();
-            -
            					}
-            -
            				};
-            -
-            -
            				$(this).parent().after('<div class="pds_slider_ui"></div>')
-            -
            				$(this).parent().next().slider(opts);
-            -
-            -
            			}
-            -
-            -
            			$(this).parent().next().toggle();
-            -
-            -
            		});
-            -
            	});
-            -
-            -
            	// Font buttons
-            -
            	$('a.value-toggle', '#styles-form').click( fontToggles );
-            -
-            -
            	$('select.pds_font_select', '#styles-form').change(function(){
-            -
            		var src = $(this).val();
-            -
            		if ( src.indexOf("http://") != -1) {
-            -
            			window.open( src, 'Google Web Fonts' );
-            -
            		}
-            -
-            -
            	})
-            -
-            -
            	// AJAX Submit & Preview
-            -
            	$('input.storm-submit', '#styles-form').click( saveStyles );
-            -
            	$('input, select', '#styles-form').change( saveStyles );
-            -
-            -
            	function saveStyles() {
-            -
            		if ( $(this).hasClass('storm-submit') ) {
-            -
            			var preview = false;
-            -
            		}else {
-            -
            			var preview = true;
-            -
            		}
-            -
-            -
            		clearTimeout( window.stormSaveTimeout );
-            -
            		window.stormSaveTimeout = setTimeout( function(){
-            -
-            -
            			// Display waiting graphic
-            -
            			var waiting = $('#styles-form img.waiting').show();
-            -
            			window.response_wrapper = $('#styles-form span.response').html('');
-            -
-            -
            			// Get form info
-            -
            			var data = $('#styles-form').serialize();
-            -
            			if ( preview ) { data = data + '&preview=1'; }
-            -
-            -
            			$.post(ajaxurl, data, function( response ) {
-            -
            				if ( response.message.indexOf('updated') != -1 ) {
-            -
            					$.cookie('pdstyles_preview_update', '1', {path: '/'});
-            -
            					$.cookie('pdstyles_preview_id', response.id, {path: '/'});
-            -
            					$.cookie('pdstyles_preview_href', response.href, {path: '/'});
-            -
            				}
-            -
-            -
            				$(response_wrapper).html( response.message );
-            -
            				waiting.hide();
-            -
-            -
            			}, 'json');
-            -
-            -
            			return false;
-            -
-            -
            		}, 500);
-            -
-            -
            		return false;
-            -
            	}
-            -
-            -
            	function fontToggles(){
-            -
            		var old_val = $(this).next().val();
-            -
            		var options =  $(this).data('options');
-            -
            		var index = $.inArray( old_val, options );
-            -
-            -
            		if ( -1 != index && (index+1) != options.length ) {
-            -
            			$(this).next().val( options[ index + 1 ] );
-            -
            		}else {
-            -
            			$(this).next().val( options[0] );
-            -
            		}
-            -
-            -
            		var new_val = $(this).next().val();
-            -
            		var old_class = $(this).data('type') +'-'+ old_val.replace('.', '');
-            -
            		var new_class = $(this).data('type') +'-'+ new_val.replace('.', '');
-            -
-            -
            		$(this).removeClass( old_class ).addClass( new_class );
-            -
-            -
            		$(this).next().change();
-            -
-            -
            		return false;
-            -
            	}
-            -
-            -
            }); // End DOM Ready
-            -
-            -
            /**
-            -
             * Background Picker plugin
-            -
             *
-            -
             * Creates UI for creating background CSS: Image, Gradient, RGBA Color, Transparent, Hidden
-            -
             *
-            -
             * @author pdclark
-            -
            **/
-            -
            (function($) {
-            -
            	$.bgPicker = function(element, options) {
-            -
-            -
            		// plugin's default options
-            -
            		// this is private property and is	accessible only from inside the plugin
-            -
            		var defaults = {
-            -
-            -
            			// foo: 'bar',
-            -
-            -
            			// if your plugin is event-driven, you may provide callback capabilities for its events.
-            -
            			// execute these functions before or after events of your plugin, so that users may customize
-            -
            			// those particular events without changing the plugin's code
-            -
            			// onFoo: function() {}
-            -
-            -
            		}
-            -
-            -
            		// to avoid confusions, use "plugin" to reference the current instance of the object
-            -
            		var plugin = this;
-            -
-            -
            		// this will hold the merged default, and user-provided options
-            -
            		// plugin's properties will be available through this object like:
-            -
            		// plugin.settings.propertyName from inside the plugin or
-            -
            		// element.data('bgPicker').settings.propertyName from outside the plugin, where "element" is the
-            -
            		// element the plugin is attached to;
-            -
            		plugin.settings = {}
-            -
-            -
            		var $element = $(element),	// reference to the jQuery version of DOM element the plugin is attached to
-            -
            			 element = element;		// reference to the actual DOM element
-            -
-            -
            		var $ui = $element.find('div.ui'),
-            -
            			$type_links = $element.find('div.types a'),
-            -
            			$active  = $element.find('div.data input[name$="[active]"]'),
-            -
            			$css   = $element.find('div.data input[name$="[css]"]'),
-            -
            			$image = $element.find('div.data input[name$="[image]"]'),
-            -
            			$stops = $element.find('div.data input[name$="[stops]"]'),
-            -
            			$color = $element.find('div.data input[name$="[bg_color]"]');
-            -
-            -
            		var colorPickerOpts = {
-            -
            			onSubmit: function(hsb, hex, rgb, el) {
-            -
            				setColor(el, hex);
-            -
            				// $(el).ColorPickerHide();
-            -
            			},
-            -
            			onBeforeShow: function () {
-            -
            				if ( $(this).data('color') ) {
-            -
            					$(this).ColorPickerSetColor( $(this).data('color') );
-            -
            				}
-            -
            			},
-            -
            			onHide: function (colpkr) {
-            -
            				var el = $(colpkr).data('colorpicker').el;
-            -
            				var hex = $(colpkr).find('div.colorpicker_hex input').val();
-            -
-            -
            				setColor(el, hex);
-            -
-            -
            				return true;
-            -
            			},
-            -
            			onChange: function(hsb, hex, rgb) {
-            -
            				setColor($color, hex);
-            -
            			},
-            -
            			flat: true,
-            -
            			color: 'ff0000'
-            -
            		};
-            -
-            -
            		// the "constructor" method that gets called when the object is created
-            -
            		plugin.init = function() {
-            -
            			// the plugin's final properties are the merged default and user-provided options (if any)
-            -
            			plugin.settings = $.extend({}, defaults, options);
-            -
-            -
            			$type_links.click( type_click );
-            -
            			type_switch( $active.val() );
-            -
-            -
            			$color.add( $stops ).add( $image ).change( update_css );
-            -
            			$image.change( update_image_preview );
-            -
-            -
            		}
-            -
-            -
            		// Global method -- Override WordPress default behavior
-            -
            		// send image url to the options field
-            -
            		window.send_to_editor = function (h) {
-            -
            			// get the image src from the html code in h
-            -
            			var re = new RegExp('<img src="([^"]+)"');
-            -
            			var m = re.exec(h);
-            -
            			jQuery('#'+blogicons.uploadid).val(m[1]).change();
-            -
            			tb_remove();
-            -
            		}
-            -
-            -
            		// Thickbox window position
-            -
            		if ( ! window.tb_resize_attached ) {
-            -
            			$(window).resize( function() { plugin.tb_position() } );
-            -
            			window.tb_resize_attached = true;
-            -
            		}
-            -
            		plugin.tb_position = function() {
-            -
            			var tbWindow = $('#TB_window');
-            -
            			var width = $(window).width();
-            -
            			var H = $(window).height();
-            -
            			var W = ( 720 < width ) ? 720 : width;
-            -
-            -
            			if ( tbWindow.size() ) {
-            -
            				tbWindow.width( W - 50 ).height( H - 45 );
-            -
            				$('#TB_iframeContent').width( W - 50 ).height( H - 75 );
-            -
            				tbWindow.css({'margin-left': '-' + parseInt((( W - 50 ) / 2),10) + 'px'});
-            -
            				if ( typeof document.body.style.maxWidth != 'undefined' )
-            -
            					tbWindow.css({'top':'20px','margin-top':'0'});
-            -
            				$('#TB_title').css({'background-color':'#222','color':'#cfcfcf'});
-            -
            			};
-            -
-            -
            			return $('a.thickbox').each( function() {
-            -
            				var href = $(this).attr('href');
-            -
            				if ( ! href ) return;
-            -
            				href = href.replace(/&width=[0-9]+/g, '');
-            -
            				href = href.replace(/&height=[0-9]+/g, '');
-            -
            				$(this).attr( 'href', href + '&width=' + ( W - 80 ) + '&height=' + ( H - 85 ) );
-            -
            			});
-            -
            		};
-            -
-            -
            		//
-            -
            		// public methods
-            -
            		//
-            -
            		// plugin.foo_public_method = function() {}
-            -
-            -
-            -
            		//
-            -
            		// private methods
-            -
            		//
-            -
            		var update_css = function () {
-            -
            			$css.val( $(this).val() ).change();
-            -
            		}
-            -
-            -
            		var type_click = function() {
-            -
            			var new_type = $(this).data('type');
-            -
-            -
            			if ( new_type == $active.val() ) {
-            -
            				return false;
-            -
            			}else {
-            -
            				type_switch( new_type );
-            -
            			}
-            -
-            -
            			return false;
-            -
            		}
-            -
-            -
            		var type_switch = function( type ) {
-            -
            			$ui.empty();
-            -
-            -
            			$type_links.removeClass('active').each( function(){
-            -
            				if (type == $(this).data('type')) { $(this).addClass('active'); }
-            -
            			});
-            -
-            -
            			switch ( type ) {
-            -
            				case 'bg_color':       load_color();       break;
-            -
            				case 'transparent': load_transparent(); break;
-            -
            				case 'gradient':    load_gradient();    break;
-            -
            				case 'image':       load_image();       break;
-            -
            				case 'hide':        load_hide();       break;
-            -
            				case 'font':        load_font();       break;
-            -
            			}
-            -
-            -
            			if ( type !== 'font' ) {
-            -
            				$active.val( type );
-            -
            			}
-            -
            		}
-            -
-            -
            		var load_font = function() {
-            -
            			$ui.siblings('div.font').toggle();
-            -
            			$ui.siblings('div.background-image').hide();
-            -
            		}
-            -
-            -
            		var load_hide = function() {
-            -
            			$css.val('hide').change();
-            -
            			$ui.siblings('div.background-image').hide();
-            -
            		}
-            -
-            -
            		var load_transparent = function() {
-            -
            			$css.val('transparent').change();
-            -
            			$ui.siblings('div.background-image').hide();
-            -
            		}
-            -
-            -
            		var load_gradient = function() {
-            -
            			var gradientPicker = $('<div class="gradPicker" />').gradientPicker({
-            -
            				$stops: $stops
-            -
            			});
-            -
-            -
            			$css.val( $stops.val() ).change();
-            -
            			$ui.siblings('div.background-image').hide();
-            -
            			$ui.append( gradientPicker );
-            -
            		}
-            -
-            -
            		var load_image = function() {
-            -
            			var imagePicker = $('<input type="button" class="button" value="Select Image" />').click( show_image_uploader );
-            -
            			var imagePreview = $('<img class="imagePreview" />').attr('src', $image.val() );
-            -
-            -
            			$css.val( $image.val() ).change();
-            -
-            -
            			$ui.siblings('div.background-image').show();
-            -
            			$ui.append( imagePicker ).append( imagePreview );
-            -
            		}
-            -
-            -
            		var update_image_preview = function() {
-            -
            			$ui.find('img.imagePreview').attr('src', $image.val() );
-            -
            		}
-            -
-            -
            		var load_color = function() {
-            -
            			$ui.siblings('div.background-image').hide();
-            -
-            -
            			var colorVal = $color.val().replace('#', '');
-            -
-            -
            			// Update color field value
-            -
            			if ( colorVal.length > 1 ) {
-            -
            				$color.data('color',  colorVal );
-            -
            				$color.data('ahex',  colorVal );
-            -
            			}else {
-            -
            				$color.data('ahex',  'ffffffff' );
-            -
            			}
-            -
            			$css.val( $color.val() ).change(); // Keeps #
-            -
-            -
            			var tmpColorPickerOpts = $.extend( colorPickerOpts, { color: colorVal });
-            -
-            -
            			var colorPicker = $('<div/>').ColorPicker( tmpColorPickerOpts );
-            -
-            -
            			$ui.append( colorPicker );
-            -
-            -
            			// function(color, context) { /* Live color slide */
-            -
            			// 	if ( color.val() == null ) {
-            -
            			// 		var rgba = 'transparent';
-            -
            			// 	}else {
-            -
            			// 		var alpha = Math.round( color.val('a') / 255 * 100 ) / 100;
-            -
            			// 		var rgba = 'rgba('+color.val('r')+','+color.val('g')+','+color.val('b')+','+alpha+')';
-            -
            			// 	}
-            -
            			//
-            -
            			// 	$color.val( rgba );
-            -
            			// 	$color.data('ahex', color.val('ahex') );
-            -
            			// 	$css.val( rgba ).change();
-            -
            			// }
-            -
-            -
            		}
-            -
-            -
            		var setColor = function(el, hex) {
-            -
            			$(el).each(function() {
-            -
            				$color.val( '#'+hex ).data('color', hex);
-            -
            				// $(this).css('backgroundColor', $color.val() );
-            -
            			});
-            -
-            -
            			$css.val( $color.val() );
-            -
-            -
            			$css.change();
-            -
            		}
-            -
-            -
            		var show_image_uploader = function() {
-            -
            			blogicons = {
-            -
            				uploadid: $image.attr('id')
-            -
            			}
-            -
            			tb_show('', storm_admin.mediaUploadURL+'?type=image&amp;tab=library&amp;TB_iframe=true');
-            -
            		}
-            -
-            -
            		plugin.init();
-            -
-            -
            	}
-            -
-            -
            	// add the plugin to the jQuery.fn object
-            -
            	$.fn.bgPicker = function(options) {
-            -
-            -
            		// iterate through the DOM elements we are attaching the plugin to
-            -
            		return this.each(function() {
-            -
-            -
            			// if plugin has not already been attached to the element
-            -
            			if (undefined == $(this).data('bgPicker')) {
-            -
-            -
            				// create a new instance of the plugin
-            -
            				// pass the DOM element and the user-provided options as arguments
-            -
            				var plugin = new $.bgPicker(this, options);
-            -
-            -
            				// in the jQuery version of the element
-            -
            				// store a reference to the plugin object
-            -
            				// you can later access the plugin and its methods and properties like
-            -
            				// element.data('bgPicker').publicMethod(arg1, arg2, ... argn) or
-            -
            				// element.data('bgPicker').settings.propertyName
-            -
            				$(this).data('bgPicker', plugin);
-            -
-            -
            			}
-            -
-            -
            		});
-            -
-            -
            	}
-            -
             })(jQuery);


1	+ jQuery(function($) {
2	+ $('div.gradPicker', '#styles-form').gradientPicker();
3	+ $('div.bgPicker', '#styles-form').bgPicker();
4	+
5	+ // Color Picker
6	+ $('input.pds_color_input', '#styles-form').change(function(){
7	+ if ( $(this).val().length < 3 ) {return;}
8	+ $(this).css( 'color', '#'+$(this).val() );
9	+ $(this).css( 'background-color', '#'+$(this).val() );
10	+ }).change().ColorPicker({
11	+ onChange: function(){
12	+ var el = $(this).data('colorpicker').el;
13	+ var hex = $(this).find('div.colorpicker_hex input').val();
14	+
15	+ $(el).val(hex).change();
16	+ saveStyles();
17	+ },
18	+ onSubmit: function(hsb, hex, rgb, el) {
19	+ $(el).val(hex).change();
20	+ $(el).ColorPickerHide();
21	+ },
22	+ onBeforeShow: function () {
23	+ $(this).ColorPickerSetColor( this.value );
24	+ },
25	+ onHide: function (colpkr) {
26	+ var el = $(colpkr).data('colorpicker').el;
27	+ var hex = $(colpkr).find('div.colorpicker_hex input').val();
28	+
29	+ $(el).val(hex).change();
30	+
31	+ return true;
32	+ }
33	+ });
34	+
35	+ // Sliders for integer inputs
36	+ $('input.slider', '#styles-form').each(function() {
37	+ // Show/hide slider on input click
38	+ $(this).click(function( e ) {
39	+
40	+ // Only init sliders on click for faster page load
41	+ if ( ! $(this).parent().next().hasClass('pds_slider_ui') ) {
42	+
43	+ var input_id = $(this).attr('id');
44	+ var input_val = parseInt( $(this).val() );
45	+ var opts = {
46	+ min: $(this).data('min'),
47	+ max: $(this).data('max'),
48	+ range: "min",
49	+ value: input_val + 1,
50	+ slide: function(event, ui) {
51	+ $(this).prev().find('input').val(ui.value - 1);
52	+ },
53	+ change: function(event, ui) {
54	+ $(this).prev().find('input').change();
55	+ }
56	+ };
57	+
58	+ $(this).parent().after('<div class="pds_slider_ui"></div>')
59	+ $(this).parent().next().slider(opts);
60	+
61	+ }
62	+
63	+ $(this).parent().next().toggle();
64	+
65	+ });
66	+ });
67	+
68	+ // Font buttons
69	+ $('a.value-toggle', '#styles-form').click( fontToggles );
70	+
71	+ $('select.pds_font_select', '#styles-form').change(function(){
72	+ var src = $(this).val();
73	+ if ( src.indexOf("http://") != -1) {
74	+ window.open( src, 'Google Web Fonts' );
75	+ }
76	+
77	+ })
78	+
79	+ // AJAX Submit & Preview
80	+ $('input.storm-submit', '#styles-form').click( saveStyles );
81	+ $('input, select', '#styles-form').change( saveStyles );
82	+
83	+ function saveStyles() {
84	+ if ( $(this).hasClass('storm-submit') ) {
85	+ var preview = false;
86	+ }else {
87	+ var preview = true;
88	+ }
89	+
90	+ clearTimeout( window.stormSaveTimeout );
91	+ window.stormSaveTimeout = setTimeout( function(){
92	+
93	+ // Display waiting graphic
94	+ var waiting = $('#styles-form img.waiting').show();
95	+ window.response_wrapper = $('#styles-form span.response').html('');
96	+
97	+ // Get form info
98	+ var data = $('#styles-form').serialize();
99	+ if ( preview ) { data = data + '&preview=1'; }
100	+
101	+ $.post(ajaxurl, data, function( response ) {
102	+ if ( response.message.indexOf('updated') != -1 ) {
103	+ $.cookie('pdstyles_preview_update', '1', {path: '/'});
104	+ $.cookie('pdstyles_preview_id', response.id, {path: '/'});
105	+ $.cookie('pdstyles_preview_href', response.href, {path: '/'});
106	+ }
107	+
108	+ $(response_wrapper).html( response.message );
109	+ waiting.hide();
110	+
111	+ }, 'json');
112	+
113	+ return false;
114	+
115	+ }, 500);
116	+
117	+ return false;
118	+ }
119	+
120	+ function fontToggles(){
121	+ var old_val = $(this).next().val();
122	+ var options = $(this).data('options');
123	+ var index = $.inArray( old_val, options );
124	+
125	+ if ( -1 != index && (index+1) != options.length ) {
126	+ $(this).next().val( options[ index + 1 ] );
127	+ }else {
128	+ $(this).next().val( options[0] );
129	+ }
130	+
131	+ var new_val = $(this).next().val();
132	+ var old_class = $(this).data('type') +'-'+ old_val.replace('.', '');
133	+ var new_class = $(this).data('type') +'-'+ new_val.replace('.', '');
134	+
135	+ $(this).removeClass( old_class ).addClass( new_class );
136	+
137	+ $(this).next().change();
138	+
139	+ return false;
140	+ }
141	+
142	+ }); // End DOM Ready
143	+
144	+ /**
145	+ * Background Picker plugin
146	+ *
147	+ * Creates UI for creating background CSS: Image, Gradient, RGBA Color, Transparent, Hidden
148	+ *
149	+ * @author pdclark
150	+ **/
151	+ (function($) {
152	+ $.bgPicker = function(element, options) {
153	+
154	+ // plugin's default options
155	+ // this is private property and is accessible only from inside the plugin
156	+ var defaults = {
157	+
158	+ // foo: 'bar',
159	+
160	+ // if your plugin is event-driven, you may provide callback capabilities for its events.
161	+ // execute these functions before or after events of your plugin, so that users may customize
162	+ // those particular events without changing the plugin's code
163	+ // onFoo: function() {}
164	+
165	+ }
166	+
167	+ // to avoid confusions, use "plugin" to reference the current instance of the object
168	+ var plugin = this;
169	+
170	+ // this will hold the merged default, and user-provided options
171	+ // plugin's properties will be available through this object like:
172	+ // plugin.settings.propertyName from inside the plugin or
173	+ // element.data('bgPicker').settings.propertyName from outside the plugin, where "element" is the
174	+ // element the plugin is attached to;
175	+ plugin.settings = {}
176	+
177	+ var $element = $(element), // reference to the jQuery version of DOM element the plugin is attached to
178	+ element = element; // reference to the actual DOM element
179	+
180	+ var $ui = $element.find('div.ui'),
181	+ $type_links = $element.find('div.types a'),
182	+ $active = $element.find('div.data input[name$="[active]"]'),
183	+ $css = $element.find('div.data input[name$="[css]"]'),
184	+ $image = $element.find('div.data input[name$="[image]"]'),
185	+ $stops = $element.find('div.data input[name$="[stops]"]'),
186	+ $color = $element.find('div.data input[name$="[bg_color]"]');
187	+
188	+ var colorPickerOpts = {
189	+ onSubmit: function(hsb, hex, rgb, el) {
190	+ setColor(el, hex);
191	+ // $(el).ColorPickerHide();
192	+ },
193	+ onBeforeShow: function () {
194	+ if ( $(this).data('color') ) {
195	+ $(this).ColorPickerSetColor( $(this).data('color') );
196	+ }
197	+ },
198	+ onHide: function (colpkr) {
199	+ var el = $(colpkr).data('colorpicker').el;
200	+ var hex = $(colpkr).find('div.colorpicker_hex input').val();
201	+
202	+ setColor(el, hex);
203	+
204	+ return true;
205	+ },
206	+ onChange: function(hsb, hex, rgb) {
207	+ setColor($color, hex);
208	+ },
209	+ flat: true,
210	+ color: 'ff0000'
211	+ };
212	+
213	+ // the "constructor" method that gets called when the object is created
214	+ plugin.init = function() {
215	+ // the plugin's final properties are the merged default and user-provided options (if any)
216	+ plugin.settings = $.extend({}, defaults, options);
217	+
218	+ $type_links.click( type_click );
219	+ type_switch( $active.val() );
220	+
221	+ $color.add( $stops ).add( $image ).change( update_css );
222	+ $image.change( update_image_preview );
223	+
224	+ }
225	+
226	+ // Global method -- Override WordPress default behavior
227	+ // send image url to the options field
228	+ window.send_to_editor = function (h) {
229	+ // get the image src from the html code in h
230	+ var re = new RegExp('<img src="([^"]+)"');
231	+ var m = re.exec(h);
232	+ jQuery('#'+blogicons.uploadid).val(m[1]).change();
233	+ tb_remove();
234	+ }
235	+
236	+ // Thickbox window position
237	+ if ( ! window.tb_resize_attached ) {
238	+ $(window).resize( function() { plugin.tb_position() } );
239	+ window.tb_resize_attached = true;
240	+ }
241	+ plugin.tb_position = function() {
242	+ var tbWindow = $('#TB_window');
243	+ var width = $(window).width();
244	+ var H = $(window).height();
245	+ var W = ( 720 < width ) ? 720 : width;
246	+
247	+ if ( tbWindow.size() ) {
248	+ tbWindow.width( W - 50 ).height( H - 45 );
249	+ $('#TB_iframeContent').width( W - 50 ).height( H - 75 );
250	+ tbWindow.css({'margin-left': '-' + parseInt((( W - 50 ) / 2),10) + 'px'});
251	+ if ( typeof document.body.style.maxWidth != 'undefined' )
252	+ tbWindow.css({'top':'20px','margin-top':'0'});
253	+ $('#TB_title').css({'background-color':'#222','color':'#cfcfcf'});
254	+ };
255	+
256	+ return $('a.thickbox').each( function() {
257	+ var href = $(this).attr('href');
258	+ if ( ! href ) return;
259	+ href = href.replace(/&width=[0-9]+/g, '');
260	+ href = href.replace(/&height=[0-9]+/g, '');
261	+ $(this).attr( 'href', href + '&width=' + ( W - 80 ) + '&height=' + ( H - 85 ) );
262	+ });
263	+ };
264	+
265	+ //
266	+ // public methods
267	+ //
268	+ // plugin.foo_public_method = function() {}
269	+
270	+
271	+ //
272	+ // private methods
273	+ //
274	+ var update_css = function () {
275	+ $css.val( $(this).val() ).change();
276	+ }
277	+
278	+ var type_click = function() {
279	+ var new_type = $(this).data('type');
280	+
281	+ if ( new_type == $active.val() ) {
282	+ return false;
283	+ }else {
284	+ type_switch( new_type );
285	+ }
286	+
287	+ return false;
288	+ }
289	+
290	+ var type_switch = function( type ) {
291	+ $ui.empty();
292	+
293	+ $type_links.removeClass('active').each( function(){
294	+ if (type == $(this).data('type')) { $(this).addClass('active'); }
295	+ });
296	+
297	+ switch ( type ) {
298	+ case 'bg_color': load_color(); break;
299	+ case 'transparent': load_transparent(); break;
300	+ case 'gradient': load_gradient(); break;
301	+ case 'image': load_image(); break;
302	+ case 'hide': load_hide(); break;
303	+ case 'font': load_font(); break;
304	+ }
305	+
306	+ if ( type !== 'font' ) {
307	+ $active.val( type );
308	+ }
309	+ }
310	+
311	+ var load_font = function() {
312	+ $ui.siblings('div.font').toggle();
313	+ $ui.siblings('div.background-image').hide();
314	+ }
315	+
316	+ var load_hide = function() {
317	+ $css.val('hide').change();
318	+ $ui.siblings('div.background-image').hide();
319	+ }
320	+
321	+ var load_transparent = function() {
322	+ $css.val('transparent').change();
323	+ $ui.siblings('div.background-image').hide();
324	+ }
325	+
326	+ var load_gradient = function() {
327	+ var gradientPicker = $('<div class="gradPicker" />').gradientPicker({
328	+ $stops: $stops
329	+ });
330	+
331	+ $css.val( $stops.val() ).change();
332	+ $ui.siblings('div.background-image').hide();
333	+ $ui.append( gradientPicker );
334	+ }
335	+
336	+ var load_image = function() {
337	+ var imagePicker = $('<input type="button" class="button" value="Select Image" />').click( show_image_uploader );
338	+ var imagePreview = $('<img class="imagePreview" />').attr('src', $image.val() );
339	+
340	+ $css.val( $image.val() ).change();
341	+
342	+ $ui.siblings('div.background-image').show();
343	+ $ui.append( imagePicker ).append( imagePreview );
344	+ }
345	+
346	+ var update_image_preview = function() {
347	+ $ui.find('img.imagePreview').attr('src', $image.val() );
348	+ }
349	+
350	+ var load_color = function() {
351	+ $ui.siblings('div.background-image').hide();
352	+
353	+ var colorVal = $color.val().replace('#', '');
354	+
355	+ // Update color field value
356	+ if ( colorVal.length > 1 ) {
357	+ $color.data('color', colorVal );
358	+ $color.data('ahex', colorVal );
359	+ }else {
360	+ $color.data('ahex', 'ffffffff' );
361	+ }
362	+ $css.val( $color.val() ).change(); // Keeps #
363	+
364	+ var tmpColorPickerOpts = $.extend( colorPickerOpts, { color: colorVal });
365	+
366	+ var colorPicker = $('<div/>').ColorPicker( tmpColorPickerOpts );
367	+
368	+ $ui.append( colorPicker );
369	+
370	+ // function(color, context) { /* Live color slide */
371	+ // if ( color.val() == null ) {
372	+ // var rgba = 'transparent';
373	+ // }else {
374	+ // var alpha = Math.round( color.val('a') / 255 * 100 ) / 100;
375	+ // var rgba = 'rgba('+color.val('r')+','+color.val('g')+','+color.val('b')+','+alpha+')';
376	+ // }
377	+ //
378	+ // $color.val( rgba );
379	+ // $color.data('ahex', color.val('ahex') );
380	+ // $css.val( rgba ).change();
381	+ // }
382	+
383	+ }
384	+
385	+ var setColor = function(el, hex) {
386	+ $(el).each(function() {
387	+ $color.val( '#'+hex ).data('color', hex);
388	+ // $(this).css('backgroundColor', $color.val() );
389	+ });
390	+
391	+ $css.val( $color.val() );
392	+
393	+ $css.change();
394	+ }
395	+
396	+ var show_image_uploader = function() {
397	+ blogicons = {
398	+ uploadid: $image.attr('id')
399	+ }
400	+ tb_show('', storm_admin.mediaUploadURL+'?type=image&tab=library&TB_iframe=true');
401	+ }
402	+
403	+ plugin.init();
404	+
405	+ }
406	+
407	+ // add the plugin to the jQuery.fn object
408	+ $.fn.bgPicker = function(options) {
409	+
410	+ // iterate through the DOM elements we are attaching the plugin to
411	+ return this.each(function() {
412	+
413	+ // if plugin has not already been attached to the element
414	+ if (undefined == $(this).data('bgPicker')) {
415	+
416	+ // create a new instance of the plugin
417	+ // pass the DOM element and the user-provided options as arguments
418	+ var plugin = new $.bgPicker(this, options);
419	+
420	+ // in the jQuery version of the element
421	+ // store a reference to the plugin object
422	+ // you can later access the plugin and its methods and properties like
423	+ // element.data('bgPicker').publicMethod(arg1, arg2, ... argn) or
424	+ // element.data('bgPicker').settings.propertyName
425	+ $(this).data('bgPicker', plugin);
426	+
427	+ }
428	+
429	+ });
430	+
431	+ }
432	+
433	})(jQuery);

js/jq.gradientpicker.js CHANGED Viewed

@@ -1,366 +1,366 @@
-            -
            // Gradient Picker plugin
-            -
            // @author pdclark
-            -
            (function($) {
-            -
-            -
            	// here we go!
-            -
            	$.gradientPicker = function(element, options) {
-            -
-            -
            		// to avoid confusion, use "plugin" to reference the current instance of the object
-            -
            		var plugin = this;
-            -
-            -
            		// this will hold the merged default, and user-provided options
-            -
            		// plugin's properties will be available through this object like:
-            -
            		// plugin.settings.propertyName from inside the plugin or
-            -
            		// element.data('gradientPicker').settings.propertyName from outside the plugin, where "element" is the
-            -
            		// element the plugin is attached to;
-            -
            		plugin.settings = {}
-            -
-            -
            		var $element = $(element),  // reference to the jQuery version of DOM element the plugin is attached to
-            -
            			element = element;		// reference to the actual DOM element
-            -
-            -
            		var $markerWrap, $preview, $stops, $presets;
-            -
-            -
            		var initComplete = false;
-            -
-            -
            		var timeoutID;
-            -
-            -
            		var stops = new Array();
-            -
-            -
            		var colorPickerOpts = {
-            -
            			eventName: 'dblclick',
-            -
            			onSubmit: function(hsb, hex, rgb, el) {
-            -
            				setHandleColor(el, hex);
-            -
            				$(el).ColorPickerHide();
-            -
            			},
-            -
            			onBeforeShow: function () {
-            -
            				if ( $(this).data('color') ) {
-            -
            					$(this).ColorPickerSetColor( $(this).data('color') );
-            -
            				}
-            -
            			},
-            -
            			onHide: function (colpkr) {
-            -
            				var el = $(colpkr).data('colorpicker').el;
-            -
            				var hex = $(colpkr).find('div.colorpicker_hex input').val();
-            -
-            -
            				setHandleColor(el, hex);
-            -
-            -
            				return true;
-            -
            			},
-            -
            			onChange: function(hsb, hex, rgb) {
-            -
            				var el = $(this).data('colorpicker').el;
-            -
-            -
            				setHandleColor(el, hex);
-            -
            			}
-            -
            		};
-            -
-            -
            		// plugin's default options
-            -
            		// this is private property and is  accessible only from inside the plugin
-            -
            		var defaults = {
-            -
-            -
            			// foo: 'bar',
-            -
            			$stops: $element.find('input.stops'),
-            -
-            -
            			// if your plugin is event-driven, you may provide callback capabilities for its events.
-            -
            			// execute these functions before or after events of your plugin, so that users may customize
-            -
            			// those particular events without changing the plugin's code
-            -
            			// onFoo: function() {}
-            -
-            -
            		}
-            -
-            -
            		// Constructor
-            -
            		plugin.init = function() {
-            -
            			// the plugin's final properties are the merged default and user-provided options (if any)
-            -
            			plugin.settings = $.extend({}, defaults, options);
-            -
-            -
            			$presets = $('<div class="presets" />');
-            -
            			$preview = $('<div class="grad-preview" />');
-            -
            			$markerWrap = $('<div class="stop-markers" />').click( addMarker );
-            -
-            -
            			$stops = plugin.settings.$stops;
-            -
-            -
            			$element.append( $presets, $preview, $markerWrap );
-            -
-            -
            			stopsInputToArray();
-            -
            			stopsArrayToMarkers();
-            -
            			stopsMarkersToArray();
-            -
-            -
            			setupPresets();
-            -
-            -
            			initComplete = true;
-            -
            		}
-            -
-            -
            		//
-            -
            		// public methods
-            -
            		//
-            -
            		// these methods can be called like:
-            -
            		// plugin.methodName(arg1, arg2, ... argn) from inside the plugin or
-            -
            		// element.data('gradientPicker').publicMethod(arg1, arg2, ... argn) from outside the plugin, where "element"
-            -
            		// is the element the plugin is attached to;
-            -
-            -
            		plugin.updatePreview = function() {
-            -
            			var css = 'background:-webkit-linear-gradient(0deg, '+stops+');background:-moz-linear-gradient(0deg, '+stops+');background:-ms-linear-gradient(0deg, '+stops+');background:-o-linear-gradient(0deg, '+stops+');background:linear-gradient(0deg, '+stops+');';
-            -
-            -
            			$preview.attr('style', css);
-            -
-            -
            			stopsArrayToInput();
-            -
            		}
-            -
-            -
            		//
-            -
            		// Private Methods
-            -
            		//
-            -
-            -
            		// --- Data passing
-            -
-            -
            		var stopsInputToArray = function () {
-            -
            			stops.length = 0;
-            -
-            -
            			var tmp = $stops.val();
-            -
            			tmp = tmp.split(',');
-            -
-            -
            			$.each(tmp, function(i, val){
-            -
            				val = $.trim(val);
-            -
            				val = val.split(' ');
-            -
-            -
            				if ( val[0] != undefined ){ var hex = val[0].replace('#', ''); }
-            -
            				else { var hex = '#000000'; }
-            -
-            -
            				if ( val[1] != undefined ){ var value = val[1].replace('%', ''); }
-            -
            				else { var value = ''; }
-            -
-            -
            				stops.push( {
-            -
            					hex: hex,
-            -
            					value: value,
-            -
            					toString: function() { return '#'+this.hex+' '+this.value+'%'; }
-            -
            				});
-            -
-            -
            			});
-            -
            			plugin.updatePreview();
-            -
            		}
-            -
-            -
            		var stopsArrayToMarkers = function () {
-            -
            			$markerWrap.find('div.marker').slider('destroy').remove();
-            -
            			$.each( stops, function(i, stop){
-            -
            				addMarker( {}, stop.value, stop.hex );
-            -
            			} );
-            -
-            -
            		}
-            -
-            -
            		var stopsArrayToInput = function() {
-            -
            			if ( stops.toString() != $stops.val() ) {
-            -
-            -
            				clearTimeout(timeoutID);
-            -
-            -
            				timeoutID = setTimeout( function(){
-            -
            					$stops.val(stops).change();
-            -
            				}, 500);
-            -
-            -
            			}
-            -
            		}
-            -
-            -
            		var stopsMarkersToArray = function() {
-            -
            			if ( !initComplete ) { return; }
-            -
-            -
            			stops.length = 0;
-            -
-            -
            			$markerWrap.find('div.marker').each(function(){
-            -
            				var hex   = $(this).data('color'),
-            -
            					value = $(this).slider('value');
-            -
-            -
            				stops.push({
-            -
            					hex: hex,
-            -
            					value: value,
-            -
            					toString: function() { return '#'+this.hex+' '+this.value+'%'; }
-            -
            				});
-            -
            			});
-            -
-            -
            			stops.sort( function( a, b ){
-            -
            				if ( a.value < b.value ) { return -1; }	// Less than 0: Sort "a" to be a lower index than "b"
-            -
            				if ( a.value > b.value ) { return  1; }	// Greater than 0: Sort "b" to be a lower index than "a".
-            -
            				return 0; 								// Zero: "a" and "b" should be considered equal, and no sorting performed.
-            -
            			});
-            -
-            -
            			plugin.updatePreview();
-            -
            		}
-            -
-            -
            		// --- Presets
-            -
-            -
            		var setupPresets = function() {
-            -
            			var li, css,
-            -
            				cssTemplate = 'background: -moz-linear-gradient(VAL);background: -webkit-linear-gradient(VAL);background: -o-linear-gradient(VAL);background: -ms-linear-gradient(VAL);background: linear-gradient(VAL);',
-            -
            				presets = [
-            -
            					'#000000 0%, #ffffff 100%'
-            -
            					,'#e2e2e2 0%, #dbdbdb 50%, #d1d1d1 51%, #fefefe 100%'
-            -
            					,'#d8e0de 0%, #aebfbc 22%, #99afab 33%, #8ea6a2 50%, #829d98 67%, #4e5c5a 82%, #0e0e0e 100%'
-            -
            					,'#b8e1fc 0%,#a9d2f3 10%,#90bae4 25%,#90bcea 37%,#90bff0 50%,#6ba8e5 51%,#a2daf5 83%,#bdf3fd 100%'
-            -
            					,'#3b679e 0%,#2b88d9 50%,#207cca 51%,#7db9e8 100%'
-            -
            					,'#b3dced 0%,#29b8e5 50%,#bce0ee 100%'
-            -
            					,'#cedbe9 0%,#aac5de 17%,#6199c7 50%,#3a84c3 51%,#419ad6 59%,#4bb8f0 71%,#3a8bc2 84%,#26558b 100%'
-            -
            					,'#e1ffff 0%,#e1ffff 7%,#e1ffff 12%,#fdffff 12%,#e6f8fd 30%,#c8eefb 54%,#bee4f8 75%,#b1d8f5 100%'
-            -
            					,'#e4f5fc 0%, #bfe8f9 50%, #9fd8ef 51%, #2ab0ed 100%'
-            -
            					// ,'#00b7ea 0%, #009ec3 100%'
-            -
            					,'#ff0000 0%,#ff9d00 20%,#fbff00 40%,#1fcf00 60%,#0011ff 80%,#c910c9 100%'
-            -
            				],
-            -
            				$list = $('<ul/>');
-            -
-            -
            			$.each( presets, function( index, value ){
-            -
-            -
            				css = cssTemplate.replace(/VAL/g, '-45deg, '+value);
-            -
-            -
            				li = $('<li/>')
-            -
            					.attr( 'style', css )
-            -
            					.data('value', value)
-            -
            					.click( loadPreset );
-            -
-            -
            				$list.append( li );
-            -
-            -
            			});
-            -
-            -
            			$presets.append( $list );
-            -
-            -
            			// If we don't have a gradient loaded by now,
-            -
            			// load the first preset
-            -
            			if ( stops.length == 1 ) {
-            -
            				$presets.find('li:first').click();
-            -
            			}
-            -
-            -
            		}
-            -
-            -
            		var loadPreset = function() {
-            -
            			$stops.val( $(this).data('value') );
-            -
-            -
            			stopsInputToArray();
-            -
            			stopsArrayToMarkers();
-            -
            			$stops.change();
-            -
            			// stopsMarkersToArray();
-            -
-            -
            		}
-            -
-            -
            		// --- Sliders
-            -
-            -
            		var markerSlide = function(event, ui) {
-            -
            			var thisY = $(this).offset().top;
-            -
            			var mouseY = event.originalEvent.pageY;
-            -
-            -
            			if ( (mouseY - thisY) > 25 ) { // Mouse has moved more than X pixels below slider
-            -
            				if ( ! $(this).data('remove') ) { // Slider not yet flagged 'remove'
-            -
            					$(this).data('remove', true); // Flag as 'remove'
-            -
            					$(this).css('opacity', '.2');
-            -
            				}
-            -
            			}else { // Mouse within X pixels of slider
-            -
            				if ( $(this).data('remove') ) { // Slider still flagged
-            -
            					$(this).data('remove', false); // Unflag it
-            -
            					$(this).css('opacity', '1');
-            -
            				}
-            -
            			}
-            -
-            -
            			stopsMarkersToArray();
-            -
            		}
-            -
-            -
            		var markerStop = function( event, ui ) {
-            -
            			if ( $(this).data('remove') ) {
-            -
            				$(this).slider('destroy').remove();
-            -
            				stopsMarkersToArray();
-            -
            			}
-            -
            			stopsArrayToInput();
-            -
            		}
-            -
-            -
            		var setHandleColor = function(el, hex, newMarker) {
-            -
            			$(el).each(function() {
-            -
            				$(this).data('color', hex).find('a').css('backgroundColor', '#'+hex);
-            -
            			});
-            -
-            -
            			if ( newMarker !== true ){
-            -
            				stopsMarkersToArray();
-            -
            			}
-            -
            		}
-            -
-            -
            		var addMarker = function( e, value, hex ) {
-            -
            			if ( 'object' == typeof(e.target) && $(e.target).is('a') ) {
-            -
            				return;
-            -
            			}
-            -
-            -
            			if ( e.layerX === undefined ) {
-            -
            				var offset = $(this).offset();
-            -
            				if ( offset != null ) { e.layerX = e.pageX - offset.left; }
-            -
            			}
-            -
-            -
            			if ( value === undefined ) { value  = Math.round( e.layerX / $(this).width() * 100 ); }
-            -
            			if (   hex === undefined ) { hex = '000000'; }
-            -
-            -
            			if ( isNaN(value) ) return;
-            -
-            -
            			var marker = $('<div class="marker"/>');
-            -
-            -
            			var sliderOpts = {
-            -
            				min: 0,
-            -
            				max: 100,
-            -
            				value: value,
-            -
            				stop: markerStop,
-            -
            				slide: markerSlide
-            -
            			};
-            -
-            -
            			marker.slider( sliderOpts ).unbind( 'click' ).ColorPicker( colorPickerOpts ).click( removeMarker );
-            -
-            -
            			$markerWrap.append( marker );
-            -
-            -
            			setHandleColor( marker, hex, true );
-            -
-            -
            		}
-            -
-            -
            		var removeMarker = function(e) {
-            -
            			if ( e.altKey || e === true ) {
-            -
            				$(this).slider('destroy').remove();
-            -
            				stopsMarkersToArray();
-            -
            				stopsArrayToInput();
-            -
            				return false;
-            -
            			}
-            -
            		}
-            -
-            -
            		// --- Utility
-            -
-            -
            		var rgbtohex = function(rgbString) {
-            -
            			var parts = rgbString
-            -
            					.match(/^rgb\((\d+),\s*(\d+),\s*(\d+)\)$/)
-            -
            			;
-            -
            			// parts now should be ["rgb(0, 70, 255", "0", "70", "255"]
-            -
-            -
            			delete (parts[0]);
-            -
            			for (var i = 1; i <= 3; ++i) {
-            -
            				parts[i] = parseInt(parts[i]).toString(16);
-            -
            				if (parts[i].length == 1) parts[i] = '0' + parts[i];
-            -
            			}
-            -
            			return '#'+parts.join(''); // "0070ff"
-            -
            		}
-            -
-            -
            		// fire up the plugin!
-            -
            		// call the "constructor" method
-            -
            		plugin.init();
-            -
-            -
            	}
-            -
-            -
            	// add the plugin to the jQuery.fn object
-            -
            	$.fn.gradientPicker = function(options) {
-            -
-            -
            		// iterate through the DOM elements we are attaching the plugin to
-            -
            		return this.each(function() {
-            -
-            -
            			// if plugin has not already been attached to the element
-            -
            			if (undefined == $(this).data('gradientPicker')) {
-            -
-            -
            				// create a new instance of the plugin
-            -
            				// pass the DOM element and the user-provided options as arguments
-            -
            				var plugin = new $.gradientPicker(this, options);
-            -
-            -
            				// in the jQuery version of the element
-            -
            				// store a reference to the plugin object
-            -
            				// you can later access the plugin and its methods and properties like
-            -
            				// element.data('gradientPicker').publicMethod(arg1, arg2, ... argn) or
-            -
            				// element.data('gradientPicker').settings.propertyName
-            -
            				$(this).data('gradientPicker', plugin);
-            -
-            -
            			}
-            -
-            -
            		});
-            -
-            -
            	}
-            -
-            -
            })(jQuery);


1	+ // Gradient Picker plugin
2	+ // @author pdclark
3	+ (function($) {
4	+
5	+ // here we go!
6	+ $.gradientPicker = function(element, options) {
7	+
8	+ // to avoid confusion, use "plugin" to reference the current instance of the object
9	+ var plugin = this;
10	+
11	+ // this will hold the merged default, and user-provided options
12	+ // plugin's properties will be available through this object like:
13	+ // plugin.settings.propertyName from inside the plugin or
14	+ // element.data('gradientPicker').settings.propertyName from outside the plugin, where "element" is the
15	+ // element the plugin is attached to;
16	+ plugin.settings = {}
17	+
18	+ var $element = $(element), // reference to the jQuery version of DOM element the plugin is attached to
19	+ element = element; // reference to the actual DOM element
20	+
21	+ var $markerWrap, $preview, $stops, $presets;
22	+
23	+ var initComplete = false;
24	+
25	+ var timeoutID;
26	+
27	+ var stops = new Array();
28	+
29	+ var colorPickerOpts = {
30	+ eventName: 'dblclick',
31	+ onSubmit: function(hsb, hex, rgb, el) {
32	+ setHandleColor(el, hex);
33	+ $(el).ColorPickerHide();
34	+ },
35	+ onBeforeShow: function () {
36	+ if ( $(this).data('color') ) {
37	+ $(this).ColorPickerSetColor( $(this).data('color') );
38	+ }
39	+ },
40	+ onHide: function (colpkr) {
41	+ var el = $(colpkr).data('colorpicker').el;
42	+ var hex = $(colpkr).find('div.colorpicker_hex input').val();
43	+
44	+ setHandleColor(el, hex);
45	+
46	+ return true;
47	+ },
48	+ onChange: function(hsb, hex, rgb) {
49	+ var el = $(this).data('colorpicker').el;
50	+
51	+ setHandleColor(el, hex);
52	+ }
53	+ };
54	+
55	+ // plugin's default options
56	+ // this is private property and is accessible only from inside the plugin
57	+ var defaults = {
58	+
59	+ // foo: 'bar',
60	+ $stops: $element.find('input.stops'),
61	+
62	+ // if your plugin is event-driven, you may provide callback capabilities for its events.
63	+ // execute these functions before or after events of your plugin, so that users may customize
64	+ // those particular events without changing the plugin's code
65	+ // onFoo: function() {}
66	+
67	+ }
68	+
69	+ // Constructor
70	+ plugin.init = function() {
71	+ // the plugin's final properties are the merged default and user-provided options (if any)
72	+ plugin.settings = $.extend({}, defaults, options);
73	+
74	+ $presets = $('<div class="presets" />');
75	+ $preview = $('<div class="grad-preview" />');
76	+ $markerWrap = $('<div class="stop-markers" />').click( addMarker );
77	+
78	+ $stops = plugin.settings.$stops;
79	+
80	+ $element.append( $presets, $preview, $markerWrap );
81	+
82	+ stopsInputToArray();
83	+ stopsArrayToMarkers();
84	+ stopsMarkersToArray();
85	+
86	+ setupPresets();
87	+
88	+ initComplete = true;
89	+ }
90	+
91	+ //
92	+ // public methods
93	+ //
94	+ // these methods can be called like:
95	+ // plugin.methodName(arg1, arg2, ... argn) from inside the plugin or
96	+ // element.data('gradientPicker').publicMethod(arg1, arg2, ... argn) from outside the plugin, where "element"
97	+ // is the element the plugin is attached to;
98	+
99	+ plugin.updatePreview = function() {
100	+ var css = 'background:-webkit-linear-gradient(0deg, '+stops+');background:-moz-linear-gradient(0deg, '+stops+');background:-ms-linear-gradient(0deg, '+stops+');background:-o-linear-gradient(0deg, '+stops+');background:linear-gradient(0deg, '+stops+');';
101	+
102	+ $preview.attr('style', css);
103	+
104	+ stopsArrayToInput();
105	+ }
106	+
107	+ //
108	+ // Private Methods
109	+ //
110	+
111	+ // --- Data passing
112	+
113	+ var stopsInputToArray = function () {
114	+ stops.length = 0;
115	+
116	+ var tmp = $stops.val();
117	+ tmp = tmp.split(',');
118	+
119	+ $.each(tmp, function(i, val){
120	+ val = $.trim(val);
121	+ val = val.split(' ');
122	+
123	+ if ( val[0] != undefined ){ var hex = val[0].replace('#', ''); }
124	+ else { var hex = '#000000'; }
125	+
126	+ if ( val[1] != undefined ){ var value = val[1].replace('%', ''); }
127	+ else { var value = ''; }
128	+
129	+ stops.push( {
130	+ hex: hex,
131	+ value: value,
132	+ toString: function() { return '#'+this.hex+' '+this.value+'%'; }
133	+ });
134	+
135	+ });
136	+ plugin.updatePreview();
137	+ }
138	+
139	+ var stopsArrayToMarkers = function () {
140	+ $markerWrap.find('div.marker').slider('destroy').remove();
141	+ $.each( stops, function(i, stop){
142	+ addMarker( {}, stop.value, stop.hex );
143	+ } );
144	+
145	+ }
146	+
147	+ var stopsArrayToInput = function() {
148	+ if ( stops.toString() != $stops.val() ) {
149	+
150	+ clearTimeout(timeoutID);
151	+
152	+ timeoutID = setTimeout( function(){
153	+ $stops.val(stops).change();
154	+ }, 500);
155	+
156	+ }
157	+ }
158	+
159	+ var stopsMarkersToArray = function() {
160	+ if ( !initComplete ) { return; }
161	+
162	+ stops.length = 0;
163	+
164	+ $markerWrap.find('div.marker').each(function(){
165	+ var hex = $(this).data('color'),
166	+ value = $(this).slider('value');
167	+
168	+ stops.push({
169	+ hex: hex,
170	+ value: value,
171	+ toString: function() { return '#'+this.hex+' '+this.value+'%'; }
172	+ });
173	+ });
174	+
175	+ stops.sort( function( a, b ){
176	+ if ( a.value < b.value ) { return -1; } // Less than 0: Sort "a" to be a lower index than "b"
177	+ if ( a.value > b.value ) { return 1; } // Greater than 0: Sort "b" to be a lower index than "a".
178	+ return 0; // Zero: "a" and "b" should be considered equal, and no sorting performed.
179	+ });
180	+
181	+ plugin.updatePreview();
182	+ }
183	+
184	+ // --- Presets
185	+
186	+ var setupPresets = function() {
187	+ var li, css,
188	+ cssTemplate = 'background: -moz-linear-gradient(VAL);background: -webkit-linear-gradient(VAL);background: -o-linear-gradient(VAL);background: -ms-linear-gradient(VAL);background: linear-gradient(VAL);',
189	+ presets = [
190	+ '#000000 0%, #ffffff 100%'
191	+ ,'#e2e2e2 0%, #dbdbdb 50%, #d1d1d1 51%, #fefefe 100%'
192	+ ,'#d8e0de 0%, #aebfbc 22%, #99afab 33%, #8ea6a2 50%, #829d98 67%, #4e5c5a 82%, #0e0e0e 100%'
193	+ ,'#b8e1fc 0%,#a9d2f3 10%,#90bae4 25%,#90bcea 37%,#90bff0 50%,#6ba8e5 51%,#a2daf5 83%,#bdf3fd 100%'
194	+ ,'#3b679e 0%,#2b88d9 50%,#207cca 51%,#7db9e8 100%'
195	+ ,'#b3dced 0%,#29b8e5 50%,#bce0ee 100%'
196	+ ,'#cedbe9 0%,#aac5de 17%,#6199c7 50%,#3a84c3 51%,#419ad6 59%,#4bb8f0 71%,#3a8bc2 84%,#26558b 100%'
197	+ ,'#e1ffff 0%,#e1ffff 7%,#e1ffff 12%,#fdffff 12%,#e6f8fd 30%,#c8eefb 54%,#bee4f8 75%,#b1d8f5 100%'
198	+ ,'#e4f5fc 0%, #bfe8f9 50%, #9fd8ef 51%, #2ab0ed 100%'
199	+ // ,'#00b7ea 0%, #009ec3 100%'
200	+ ,'#ff0000 0%,#ff9d00 20%,#fbff00 40%,#1fcf00 60%,#0011ff 80%,#c910c9 100%'
201	+ ],
202	+ $list = $('<ul/>');
203	+
204	+ $.each( presets, function( index, value ){
205	+
206	+ css = cssTemplate.replace(/VAL/g, '-45deg, '+value);
207	+
208	+ li = $('<li/>')
209	+ .attr( 'style', css )
210	+ .data('value', value)
211	+ .click( loadPreset );
212	+
213	+ $list.append( li );
214	+
215	+ });
216	+
217	+ $presets.append( $list );
218	+
219	+ // If we don't have a gradient loaded by now,
220	+ // load the first preset
221	+ if ( stops.length == 1 ) {
222	+ $presets.find('li:first').click();
223	+ }
224	+
225	+ }
226	+
227	+ var loadPreset = function() {
228	+ $stops.val( $(this).data('value') );
229	+
230	+ stopsInputToArray();
231	+ stopsArrayToMarkers();
232	+ $stops.change();
233	+ // stopsMarkersToArray();
234	+
235	+ }
236	+
237	+ // --- Sliders
238	+
239	+ var markerSlide = function(event, ui) {
240	+ var thisY = $(this).offset().top;
241	+ var mouseY = event.originalEvent.pageY;
242	+
243	+ if ( (mouseY - thisY) > 25 ) { // Mouse has moved more than X pixels below slider
244	+ if ( ! $(this).data('remove') ) { // Slider not yet flagged 'remove'
245	+ $(this).data('remove', true); // Flag as 'remove'
246	+ $(this).css('opacity', '.2');
247	+ }
248	+ }else { // Mouse within X pixels of slider
249	+ if ( $(this).data('remove') ) { // Slider still flagged
250	+ $(this).data('remove', false); // Unflag it
251	+ $(this).css('opacity', '1');
252	+ }
253	+ }
254	+
255	+ stopsMarkersToArray();
256	+ }
257	+
258	+ var markerStop = function( event, ui ) {
259	+ if ( $(this).data('remove') ) {
260	+ $(this).slider('destroy').remove();
261	+ stopsMarkersToArray();
262	+ }
263	+ stopsArrayToInput();
264	+ }
265	+
266	+ var setHandleColor = function(el, hex, newMarker) {
267	+ $(el).each(function() {
268	+ $(this).data('color', hex).find('a').css('backgroundColor', '#'+hex);
269	+ });
270	+
271	+ if ( newMarker !== true ){
272	+ stopsMarkersToArray();
273	+ }
274	+ }
275	+
276	+ var addMarker = function( e, value, hex ) {
277	+ if ( 'object' == typeof(e.target) && $(e.target).is('a') ) {
278	+ return;
279	+ }
280	+
281	+ if ( e.layerX === undefined ) {
282	+ var offset = $(this).offset();
283	+ if ( offset != null ) { e.layerX = e.pageX - offset.left; }
284	+ }
285	+
286	+ if ( value === undefined ) { value = Math.round( e.layerX / $(this).width() * 100 ); }
287	+ if ( hex === undefined ) { hex = '000000'; }
288	+
289	+ if ( isNaN(value) ) return;
290	+
291	+ var marker = $('<div class="marker"/>');
292	+
293	+ var sliderOpts = {
294	+ min: 0,
295	+ max: 100,
296	+ value: value,
297	+ stop: markerStop,
298	+ slide: markerSlide
299	+ };
300	+
301	+ marker.slider( sliderOpts ).unbind( 'click' ).ColorPicker( colorPickerOpts ).click( removeMarker );
302	+
303	+ $markerWrap.append( marker );
304	+
305	+ setHandleColor( marker, hex, true );
306	+
307	+ }
308	+
309	+ var removeMarker = function(e) {
310	+ if ( e.altKey \|\| e === true ) {
311	+ $(this).slider('destroy').remove();
312	+ stopsMarkersToArray();
313	+ stopsArrayToInput();
314	+ return false;
315	+ }
316	+ }
317	+
318	+ // --- Utility
319	+
320	+ var rgbtohex = function(rgbString) {
321	+ var parts = rgbString
322	+ .match(/^rgb$(\d+),\s(\d+),\s(\d+)$$/)
323	+ ;
324	+ // parts now should be ["rgb(0, 70, 255", "0", "70", "255"]
325	+
326	+ delete (parts[0]);
327	+ for (var i = 1; i <= 3; ++i) {
328	+ parts[i] = parseInt(parts[i]).toString(16);
329	+ if (parts[i].length == 1) parts[i] = '0' + parts[i];
330	+ }
331	+ return '#'+parts.join(''); // "0070ff"
332	+ }
333	+
334	+ // fire up the plugin!
335	+ // call the "constructor" method
336	+ plugin.init();
337	+
338	+ }
339	+
340	+ // add the plugin to the jQuery.fn object
341	+ $.fn.gradientPicker = function(options) {
342	+
343	+ // iterate through the DOM elements we are attaching the plugin to
344	+ return this.each(function() {
345	+
346	+ // if plugin has not already been attached to the element
347	+ if (undefined == $(this).data('gradientPicker')) {
348	+
349	+ // create a new instance of the plugin
350	+ // pass the DOM element and the user-provided options as arguments
351	+ var plugin = new $.gradientPicker(this, options);
352	+
353	+ // in the jQuery version of the element
354	+ // store a reference to the plugin object
355	+ // you can later access the plugin and its methods and properties like
356	+ // element.data('gradientPicker').publicMethod(arg1, arg2, ... argn) or
357	+ // element.data('gradientPicker').settings.propertyName
358	+ $(this).data('gradientPicker', plugin);
359	+
360	+ }
361	+
362	+ });
363	+
364	+ }
365	+
366	+ })(jQuery);

js/jquery.ui.mouse.js CHANGED Viewed

@@ -1,162 +1,162 @@
-            -
            /*!
-            -
             * jQuery UI Mouse 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Mouse
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            var mouseHandled = false;
-            -
            $( document ).mouseup( function( e ) {
-            -
            	mouseHandled = false;
-            -
            });
-            -
-            -
            $.widget("ui.mouse", {
-            -
            	options: {
-            -
            		cancel: ':input,option',
-            -
            		distance: 1,
-            -
            		delay: 0
-            -
            	},
-            -
            	_mouseInit: function() {
-            -
            		var self = this;
-            -
-            -
            		this.element
-            -
            			.bind('mousedown.'+this.widgetName, function(event) {
-            -
            				return self._mouseDown(event);
-            -
            			})
-            -
            			.bind('click.'+this.widgetName, function(event) {
-            -
            				if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
-            -
            				    $.removeData(event.target, self.widgetName + '.preventClickEvent');
-            -
            					event.stopImmediatePropagation();
-            -
            					return false;
-            -
            				}
-            -
            			});
-            -
-            -
            		this.started = false;
-            -
            	},
-            -
-            -
            	// TODO: make sure destroying one instance of mouse doesn't mess with
-            -
            	// other instances of mouse
-            -
            	_mouseDestroy: function() {
-            -
            		this.element.unbind('.'+this.widgetName);
-            -
            	},
-            -
-            -
            	_mouseDown: function(event) {
-            -
            		// don't let more than one widget handle mouseStart
-            -
            		if( mouseHandled ) { return };
-            -
-            -
            		// we may have missed mouseup (out of window)
-            -
            		(this._mouseStarted && this._mouseUp(event));
-            -
-            -
            		this._mouseDownEvent = event;
-            -
-            -
            		var self = this,
-            -
            			btnIsLeft = (event.which == 1),
-            -
            			// event.target.nodeName works around a bug in IE 8 with
-            -
            			// disabled inputs (#7620)
-            -
            			elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
-            -
            		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
-            -
            			return true;
-            -
            		}
-            -
-            -
            		this.mouseDelayMet = !this.options.delay;
-            -
            		if (!this.mouseDelayMet) {
-            -
            			this._mouseDelayTimer = setTimeout(function() {
-            -
            				self.mouseDelayMet = true;
-            -
            			}, this.options.delay);
-            -
            		}
-            -
-            -
            		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
-            -
            			this._mouseStarted = (this._mouseStart(event) !== false);
-            -
            			if (!this._mouseStarted) {
-            -
            				event.preventDefault();
-            -
            				return true;
-            -
            			}
-            -
            		}
-            -
-            -
            		// Click event may never have fired (Gecko & Opera)
-            -
            		if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
-            -
            			$.removeData(event.target, this.widgetName + '.preventClickEvent');
-            -
            		}
-            -
-            -
            		// these delegates are required to keep context
-            -
            		this._mouseMoveDelegate = function(event) {
-            -
            			return self._mouseMove(event);
-            -
            		};
-            -
            		this._mouseUpDelegate = function(event) {
-            -
            			return self._mouseUp(event);
-            -
            		};
-            -
            		$(document)
-            -
            			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-            -
            			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-            -
-            -
            		event.preventDefault();
-            -
-            -
            		mouseHandled = true;
-            -
            		return true;
-            -
            	},
-            -
-            -
            	_mouseMove: function(event) {
-            -
            		// IE mouseup check - mouseup happened when mouse was out of window
-            -
            		if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
-            -
            			return this._mouseUp(event);
-            -
            		}
-            -
-            -
            		if (this._mouseStarted) {
-            -
            			this._mouseDrag(event);
-            -
            			return event.preventDefault();
-            -
            		}
-            -
-            -
            		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
-            -
            			this._mouseStarted =
-            -
            				(this._mouseStart(this._mouseDownEvent, event) !== false);
-            -
            			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
-            -
            		}
-            -
-            -
            		return !this._mouseStarted;
-            -
            	},
-            -
-            -
            	_mouseUp: function(event) {
-            -
            		$(document)
-            -
            			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-            -
            			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-            -
-            -
            		if (this._mouseStarted) {
-            -
            			this._mouseStarted = false;
-            -
-            -
            			if (event.target == this._mouseDownEvent.target) {
-            -
            			    $.data(event.target, this.widgetName + '.preventClickEvent', true);
-            -
            			}
-            -
-            -
            			this._mouseStop(event);
-            -
            		}
-            -
-            -
            		return false;
-            -
            	},
-            -
-            -
            	_mouseDistanceMet: function(event) {
-            -
            		return (Math.max(
-            -
            				Math.abs(this._mouseDownEvent.pageX - event.pageX),
-            -
            				Math.abs(this._mouseDownEvent.pageY - event.pageY)
-            -
            			) >= this.options.distance
-            -
            		);
-            -
            	},
-            -
-            -
            	_mouseDelayMet: function(event) {
-            -
            		return this.mouseDelayMet;
-            -
            	},
-            -
-            -
            	// These are placeholder methods, to be overriden by extending plugin
-            -
            	_mouseStart: function(event) {},
-            -
            	_mouseDrag: function(event) {},
-            -
            	_mouseStop: function(event) {},
-            -
            	_mouseCapture: function(event) { return true; }
-            -
            });
-            -
-            -
            })(jQuery);


1	+ /*!
2	+ * jQuery UI Mouse 1.8.16
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI/Mouse
9	+ *
10	+ * Depends:
11	+ * jquery.ui.widget.js
12	+ */
13	+ (function( $, undefined ) {
14	+
15	+ var mouseHandled = false;
16	+ $( document ).mouseup( function( e ) {
17	+ mouseHandled = false;
18	+ });
19	+
20	+ $.widget("ui.mouse", {
21	+ options: {
22	+ cancel: ':input,option',
23	+ distance: 1,
24	+ delay: 0
25	+ },
26	+ _mouseInit: function() {
27	+ var self = this;
28	+
29	+ this.element
30	+ .bind('mousedown.'+this.widgetName, function(event) {
31	+ return self._mouseDown(event);
32	+ })
33	+ .bind('click.'+this.widgetName, function(event) {
34	+ if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
35	+ $.removeData(event.target, self.widgetName + '.preventClickEvent');
36	+ event.stopImmediatePropagation();
37	+ return false;
38	+ }
39	+ });
40	+
41	+ this.started = false;
42	+ },
43	+
44	+ // TODO: make sure destroying one instance of mouse doesn't mess with
45	+ // other instances of mouse
46	+ _mouseDestroy: function() {
47	+ this.element.unbind('.'+this.widgetName);
48	+ },
49	+
50	+ _mouseDown: function(event) {
51	+ // don't let more than one widget handle mouseStart
52	+ if( mouseHandled ) { return };
53	+
54	+ // we may have missed mouseup (out of window)
55	+ (this._mouseStarted && this._mouseUp(event));
56	+
57	+ this._mouseDownEvent = event;
58	+
59	+ var self = this,
60	+ btnIsLeft = (event.which == 1),
61	+ // event.target.nodeName works around a bug in IE 8 with
62	+ // disabled inputs (#7620)
63	+ elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
64	+ if (!btnIsLeft \|\| elIsCancel \|\| !this._mouseCapture(event)) {
65	+ return true;
66	+ }
67	+
68	+ this.mouseDelayMet = !this.options.delay;
69	+ if (!this.mouseDelayMet) {
70	+ this._mouseDelayTimer = setTimeout(function() {
71	+ self.mouseDelayMet = true;
72	+ }, this.options.delay);
73	+ }
74	+
75	+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
76	+ this._mouseStarted = (this._mouseStart(event) !== false);
77	+ if (!this._mouseStarted) {
78	+ event.preventDefault();
79	+ return true;
80	+ }
81	+ }
82	+
83	+ // Click event may never have fired (Gecko & Opera)
84	+ if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
85	+ $.removeData(event.target, this.widgetName + '.preventClickEvent');
86	+ }
87	+
88	+ // these delegates are required to keep context
89	+ this._mouseMoveDelegate = function(event) {
90	+ return self._mouseMove(event);
91	+ };
92	+ this._mouseUpDelegate = function(event) {
93	+ return self._mouseUp(event);
94	+ };
95	+ $(document)
96	+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
97	+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
98	+
99	+ event.preventDefault();
100	+
101	+ mouseHandled = true;
102	+ return true;
103	+ },
104	+
105	+ _mouseMove: function(event) {
106	+ // IE mouseup check - mouseup happened when mouse was out of window
107	+ if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
108	+ return this._mouseUp(event);
109	+ }
110	+
111	+ if (this._mouseStarted) {
112	+ this._mouseDrag(event);
113	+ return event.preventDefault();
114	+ }
115	+
116	+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
117	+ this._mouseStarted =
118	+ (this._mouseStart(this._mouseDownEvent, event) !== false);
119	+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
120	+ }
121	+
122	+ return !this._mouseStarted;
123	+ },
124	+
125	+ _mouseUp: function(event) {
126	+ $(document)
127	+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
128	+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
129	+
130	+ if (this._mouseStarted) {
131	+ this._mouseStarted = false;
132	+
133	+ if (event.target == this._mouseDownEvent.target) {
134	+ $.data(event.target, this.widgetName + '.preventClickEvent', true);
135	+ }
136	+
137	+ this._mouseStop(event);
138	+ }
139	+
140	+ return false;
141	+ },
142	+
143	+ _mouseDistanceMet: function(event) {
144	+ return (Math.max(
145	+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
146	+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
147	+ ) >= this.options.distance
148	+ );
149	+ },
150	+
151	+ _mouseDelayMet: function(event) {
152	+ return this.mouseDelayMet;
153	+ },
154	+
155	+ // These are placeholder methods, to be overriden by extending plugin
156	+ _mouseStart: function(event) {},
157	+ _mouseDrag: function(event) {},
158	+ _mouseStop: function(event) {},
159	+ _mouseCapture: function(event) { return true; }
160	+ });
161	+
162	+ })(jQuery);

js/jquery.ui.slider.js CHANGED Viewed

@@ -1,666 +1,666 @@
-            -
            /*
-            -
             * jQuery UI Slider 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Slider
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            // number of pages in a slider
-            -
            // (how many times can you page up/down to go through the whole range)
-            -
            var numPages = 5;
-            -
-            -
            $.widget( "ui.slider", $.ui.mouse, {
-            -
-            -
            	widgetEventPrefix: "slide",
-            -
-            -
            	options: {
-            -
            		animate: false,
-            -
            		distance: 0,
-            -
            		max: 100,
-            -
            		min: 0,
-            -
            		orientation: "horizontal",
-            -
            		range: false,
-            -
            		step: 1,
-            -
            		value: 0,
-            -
            		values: null
-            -
            	},
-            -
-            -
            	_create: function() {
-            -
            		var self = this,
-            -
            			o = this.options,
-            -
            			existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
-            -
            			handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
-            -
            			handleCount = ( o.values && o.values.length ) || 1,
-            -
            			handles = [];
-            -
-            -
            		this._keySliding = false;
-            -
            		this._mouseSliding = false;
-            -
            		this._animateOff = true;
-            -
            		this._handleIndex = null;
-            -
            		this._detectOrientation();
-            -
            		this._mouseInit();
-            -
-            -
            		this.element
-            -
            			.addClass( "ui-slider" +
-            -
            				" ui-slider-" + this.orientation +
-            -
            				" ui-widget" +
-            -
            				" ui-widget-content" +
-            -
            				" ui-corner-all" +
-            -
            				( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
-            -
-            -
            		this.range = $([]);
-            -
-            -
            		if ( o.range ) {
-            -
            			if ( o.range === true ) {
-            -
            				if ( !o.values ) {
-            -
            					o.values = [ this._valueMin(), this._valueMin() ];
-            -
            				}
-            -
            				if ( o.values.length && o.values.length !== 2 ) {
-            -
            					o.values = [ o.values[0], o.values[0] ];
-            -
            				}
-            -
            			}
-            -
-            -
            			this.range = $( "<div></div>" )
-            -
            				.appendTo( this.element )
-            -
            				.addClass( "ui-slider-range" +
-            -
            				// note: this isn't the most fittingly semantic framework class for this element,
-            -
            				// but worked best visually with a variety of themes
-            -
            				" ui-widget-header" +
-            -
            				( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
-            -
            		}
-            -
-            -
            		for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
-            -
            			handles.push( handle );
-            -
            		}
-            -
-            -
            		this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
-            -
-            -
            		this.handle = this.handles.eq( 0 );
-            -
-            -
            		this.handles.add( this.range ).filter( "a" )
-            -
            			.click(function( event ) {
-            -
            				event.preventDefault();
-            -
            			})
-            -
            			.hover(function() {
-            -
            				if ( !o.disabled ) {
-            -
            					$( this ).addClass( "ui-state-hover" );
-            -
            				}
-            -
            			}, function() {
-            -
            				$( this ).removeClass( "ui-state-hover" );
-            -
            			})
-            -
            			.focus(function() {
-            -
            				if ( !o.disabled ) {
-            -
            					$( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
-            -
            					$( this ).addClass( "ui-state-focus" );
-            -
            				} else {
-            -
            					$( this ).blur();
-            -
            				}
-            -
            			})
-            -
            			.blur(function() {
-            -
            				$( this ).removeClass( "ui-state-focus" );
-            -
            			});
-            -
-            -
            		this.handles.each(function( i ) {
-            -
            			$( this ).data( "index.ui-slider-handle", i );
-            -
            		});
-            -
-            -
            		this.handles
-            -
            			.keydown(function( event ) {
-            -
            				var ret = true,
-            -
            					index = $( this ).data( "index.ui-slider-handle" ),
-            -
            					allowed,
-            -
            					curVal,
-            -
            					newVal,
-            -
            					step;
-            -
-            -
            				if ( self.options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
-            -
            				switch ( event.keyCode ) {
-            -
            					case $.ui.keyCode.HOME:
-            -
            					case $.ui.keyCode.END:
-            -
            					case $.ui.keyCode.PAGE_UP:
-            -
            					case $.ui.keyCode.PAGE_DOWN:
-            -
            					case $.ui.keyCode.UP:
-            -
            					case $.ui.keyCode.RIGHT:
-            -
            					case $.ui.keyCode.DOWN:
-            -
            					case $.ui.keyCode.LEFT:
-            -
            						ret = false;
-            -
            						if ( !self._keySliding ) {
-            -
            							self._keySliding = true;
-            -
            							$( this ).addClass( "ui-state-active" );
-            -
            							allowed = self._start( event, index );
-            -
            							if ( allowed === false ) {
-            -
            								return;
-            -
            							}
-            -
            						}
-            -
            						break;
-            -
            				}
-            -
-            -
            				step = self.options.step;
-            -
            				if ( self.options.values && self.options.values.length ) {
-            -
            					curVal = newVal = self.values( index );
-            -
            				} else {
-            -
            					curVal = newVal = self.value();
-            -
            				}
-            -
-            -
            				switch ( event.keyCode ) {
-            -
            					case $.ui.keyCode.HOME:
-            -
            						newVal = self._valueMin();
-            -
            						break;
-            -
            					case $.ui.keyCode.END:
-            -
            						newVal = self._valueMax();
-            -
            						break;
-            -
            					case $.ui.keyCode.PAGE_UP:
-            -
            						newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
-            -
            						break;
-            -
            					case $.ui.keyCode.PAGE_DOWN:
-            -
            						newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
-            -
            						break;
-            -
            					case $.ui.keyCode.UP:
-            -
            					case $.ui.keyCode.RIGHT:
-            -
            						if ( curVal === self._valueMax() ) {
-            -
            							return;
-            -
            						}
-            -
            						newVal = self._trimAlignValue( curVal + step );
-            -
            						break;
-            -
            					case $.ui.keyCode.DOWN:
-            -
            					case $.ui.keyCode.LEFT:
-            -
            						if ( curVal === self._valueMin() ) {
-            -
            							return;
-            -
            						}
-            -
            						newVal = self._trimAlignValue( curVal - step );
-            -
            						break;
-            -
            				}
-            -
-            -
            				self._slide( event, index, newVal );
-            -
-            -
            				return ret;
-            -
-            -
            			})
-            -
            			.keyup(function( event ) {
-            -
            				var index = $( this ).data( "index.ui-slider-handle" );
-            -
-            -
            				if ( self._keySliding ) {
-            -
            					self._keySliding = false;
-            -
            					self._stop( event, index );
-            -
            					self._change( event, index );
-            -
            					$( this ).removeClass( "ui-state-active" );
-            -
            				}
-            -
-            -
            			});
-            -
-            -
            		this._refreshValue();
-            -
-            -
            		this._animateOff = false;
-            -
            	},
-            -
-            -
            	destroy: function() {
-            -
            		this.handles.remove();
-            -
            		this.range.remove();
-            -
-            -
            		this.element
-            -
            			.removeClass( "ui-slider" +
-            -
            				" ui-slider-horizontal" +
-            -
            				" ui-slider-vertical" +
-            -
            				" ui-slider-disabled" +
-            -
            				" ui-widget" +
-            -
            				" ui-widget-content" +
-            -
            				" ui-corner-all" )
-            -
            			.removeData( "slider" )
-            -
            			.unbind( ".slider" );
-            -
-            -
            		this._mouseDestroy();
-            -
-            -
            		return this;
-            -
            	},
-            -
-            -
            	_mouseCapture: function( event ) {
-            -
            		var o = this.options,
-            -
            			position,
-            -
            			normValue,
-            -
            			distance,
-            -
            			closestHandle,
-            -
            			self,
-            -
            			index,
-            -
            			allowed,
-            -
            			offset,
-            -
            			mouseOverHandle;
-            -
-            -
            		if ( o.disabled ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		this.elementSize = {
-            -
            			width: this.element.outerWidth(),
-            -
            			height: this.element.outerHeight()
-            -
            		};
-            -
            		this.elementOffset = this.element.offset();
-            -
-            -
            		position = { x: event.pageX, y: event.pageY };
-            -
            		normValue = this._normValueFromMouse( position );
-            -
            		distance = this._valueMax() - this._valueMin() + 1;
-            -
            		self = this;
-            -
            		this.handles.each(function( i ) {
-            -
            			var thisDistance = Math.abs( normValue - self.values(i) );
-            -
            			if ( distance > thisDistance ) {
-            -
            				distance = thisDistance;
-            -
            				closestHandle = $( this );
-            -
            				index = i;
-            -
            			}
-            -
            		});
-            -
-            -
            		// workaround for bug #3736 (if both handles of a range are at 0,
-            -
            		// the first is always used as the one with least distance,
-            -
            		// and moving it is obviously prevented by preventing negative ranges)
-            -
            		if( o.range === true && this.values(1) === o.min ) {
-            -
            			index += 1;
-            -
            			closestHandle = $( this.handles[index] );
-            -
            		}
-            -
-            -
            		allowed = this._start( event, index );
-            -
            		if ( allowed === false ) {
-            -
            			return false;
-            -
            		}
-            -
            		this._mouseSliding = true;
-            -
-            -
            		self._handleIndex = index;
-            -
-            -
            		closestHandle
-            -
            			.addClass( "ui-state-active" )
-            -
            			.focus();
-            -
-            -
            		offset = closestHandle.offset();
-            -
            		mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
-            -
            		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
-            -
            			left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
-            -
            			top: event.pageY - offset.top -
-            -
            				( closestHandle.height() / 2 ) -
-            -
            				( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
-            -
            				( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
-            -
            				( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
-            -
            		};
-            -
-            -
            		if ( !this.handles.hasClass( "ui-state-hover" ) ) {
-            -
            			this._slide( event, index, normValue );
-            -
            		}
-            -
            		this._animateOff = true;
-            -
            		return true;
-            -
            	},
-            -
-            -
            	_mouseStart: function( event ) {
-            -
            		return true;
-            -
            	},
-            -
-            -
            	_mouseDrag: function( event ) {
-            -
            		var position = { x: event.pageX, y: event.pageY },
-            -
            			normValue = this._normValueFromMouse( position );
-            -
-            -
            		this._slide( event, this._handleIndex, normValue );
-            -
-            -
            		return false;
-            -
            	},
-            -
-            -
            	_mouseStop: function( event ) {
-            -
            		this.handles.removeClass( "ui-state-active" );
-            -
            		this._mouseSliding = false;
-            -
-            -
            		this._stop( event, this._handleIndex );
-            -
            		this._change( event, this._handleIndex );
-            -
-            -
            		this._handleIndex = null;
-            -
            		this._clickOffset = null;
-            -
            		this._animateOff = false;
-            -
-            -
            		return false;
-            -
            	},
-            -
-            -
            	_detectOrientation: function() {
-            -
            		this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
-            -
            	},
-            -
-            -
            	_normValueFromMouse: function( position ) {
-            -
            		var pixelTotal,
-            -
            			pixelMouse,
-            -
            			percentMouse,
-            -
            			valueTotal,
-            -
            			valueMouse;
-            -
-            -
            		if ( this.orientation === "horizontal" ) {
-            -
            			pixelTotal = this.elementSize.width;
-            -
            			pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
-            -
            		} else {
-            -
            			pixelTotal = this.elementSize.height;
-            -
            			pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
-            -
            		}
-            -
-            -
            		percentMouse = ( pixelMouse / pixelTotal );
-            -
            		if ( percentMouse > 1 ) {
-            -
            			percentMouse = 1;
-            -
            		}
-            -
            		if ( percentMouse < 0 ) {
-            -
            			percentMouse = 0;
-            -
            		}
-            -
            		if ( this.orientation === "vertical" ) {
-            -
            			percentMouse = 1 - percentMouse;
-            -
            		}
-            -
-            -
            		valueTotal = this._valueMax() - this._valueMin();
-            -
            		valueMouse = this._valueMin() + percentMouse * valueTotal;
-            -
-            -
            		return this._trimAlignValue( valueMouse );
-            -
            	},
-            -
-            -
            	_start: function( event, index ) {
-            -
            		var uiHash = {
-            -
            			handle: this.handles[ index ],
-            -
            			value: this.value()
-            -
            		};
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			uiHash.value = this.values( index );
-            -
            			uiHash.values = this.values();
-            -
            		}
-            -
            		return this._trigger( "start", event, uiHash );
-            -
            	},
-            -
-            -
            	_slide: function( event, index, newVal ) {
-            -
            		var otherVal,
-            -
            			newValues,
-            -
            			allowed;
-            -
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			otherVal = this.values( index ? 0 : 1 );
-            -
-            -
            			if ( ( this.options.values.length === 2 && this.options.range === true ) &&
-            -
            					( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
-            -
            				) {
-            -
            				newVal = otherVal;
-            -
            			}
-            -
-            -
            			if ( newVal !== this.values( index ) ) {
-            -
            				newValues = this.values();
-            -
            				newValues[ index ] = newVal;
-            -
            				// A slide can be canceled by returning false from the slide callback
-            -
            				allowed = this._trigger( "slide", event, {
-            -
            					handle: this.handles[ index ],
-            -
            					value: newVal,
-            -
            					values: newValues
-            -
            				} );
-            -
            				otherVal = this.values( index ? 0 : 1 );
-            -
            				if ( allowed !== false ) {
-            -
            					this.values( index, newVal, true );
-            -
            				}
-            -
            			}
-            -
            		} else {
-            -
            			if ( newVal !== this.value() ) {
-            -
            				// A slide can be canceled by returning false from the slide callback
-            -
            				allowed = this._trigger( "slide", event, {
-            -
            					handle: this.handles[ index ],
-            -
            					value: newVal
-            -
            				} );
-            -
            				if ( allowed !== false ) {
-            -
            					this.value( newVal );
-            -
            				}
-            -
            			}
-            -
            		}
-            -
            	},
-            -
-            -
            	_stop: function( event, index ) {
-            -
            		var uiHash = {
-            -
            			handle: this.handles[ index ],
-            -
            			value: this.value()
-            -
            		};
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			uiHash.value = this.values( index );
-            -
            			uiHash.values = this.values();
-            -
            		}
-            -
-            -
            		this._trigger( "stop", event, uiHash );
-            -
            	},
-            -
-            -
            	_change: function( event, index ) {
-            -
            		if ( !this._keySliding && !this._mouseSliding ) {
-            -
            			var uiHash = {
-            -
            				handle: this.handles[ index ],
-            -
            				value: this.value()
-            -
            			};
-            -
            			if ( this.options.values && this.options.values.length ) {
-            -
            				uiHash.value = this.values( index );
-            -
            				uiHash.values = this.values();
-            -
            			}
-            -
-            -
            			this._trigger( "change", event, uiHash );
-            -
            		}
-            -
            	},
-            -
-            -
            	value: function( newValue ) {
-            -
            		if ( arguments.length ) {
-            -
            			this.options.value = this._trimAlignValue( newValue );
-            -
            			this._refreshValue();
-            -
            			this._change( null, 0 );
-            -
            			return;
-            -
            		}
-            -
-            -
            		return this._value();
-            -
            	},
-            -
-            -
            	values: function( index, newValue ) {
-            -
            		var vals,
-            -
            			newValues,
-            -
            			i;
-            -
-            -
            		if ( arguments.length > 1 ) {
-            -
            			this.options.values[ index ] = this._trimAlignValue( newValue );
-            -
            			this._refreshValue();
-            -
            			this._change( null, index );
-            -
            			return;
-            -
            		}
-            -
-            -
            		if ( arguments.length ) {
-            -
            			if ( $.isArray( arguments[ 0 ] ) ) {
-            -
            				vals = this.options.values;
-            -
            				newValues = arguments[ 0 ];
-            -
            				for ( i = 0; i < vals.length; i += 1 ) {
-            -
            					vals[ i ] = this._trimAlignValue( newValues[ i ] );
-            -
            					this._change( null, i );
-            -
            				}
-            -
            				this._refreshValue();
-            -
            			} else {
-            -
            				if ( this.options.values && this.options.values.length ) {
-            -
            					return this._values( index );
-            -
            				} else {
-            -
            					return this.value();
-            -
            				}
-            -
            			}
-            -
            		} else {
-            -
            			return this._values();
-            -
            		}
-            -
            	},
-            -
-            -
            	_setOption: function( key, value ) {
-            -
            		var i,
-            -
            			valsLength = 0;
-            -
-            -
            		if ( $.isArray( this.options.values ) ) {
-            -
            			valsLength = this.options.values.length;
-            -
            		}
-            -
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
-            -
-            -
            		switch ( key ) {
-            -
            			case "disabled":
-            -
            				if ( value ) {
-            -
            					this.handles.filter( ".ui-state-focus" ).blur();
-            -
            					this.handles.removeClass( "ui-state-hover" );
-            -
            					this.handles.propAttr( "disabled", true );
-            -
            					this.element.addClass( "ui-disabled" );
-            -
            				} else {
-            -
            					this.handles.propAttr( "disabled", false );
-            -
            					this.element.removeClass( "ui-disabled" );
-            -
            				}
-            -
            				break;
-            -
            			case "orientation":
-            -
            				this._detectOrientation();
-            -
            				this.element
-            -
            					.removeClass( "ui-slider-horizontal ui-slider-vertical" )
-            -
            					.addClass( "ui-slider-" + this.orientation );
-            -
            				this._refreshValue();
-            -
            				break;
-            -
            			case "value":
-            -
            				this._animateOff = true;
-            -
            				this._refreshValue();
-            -
            				this._change( null, 0 );
-            -
            				this._animateOff = false;
-            -
            				break;
-            -
            			case "values":
-            -
            				this._animateOff = true;
-            -
            				this._refreshValue();
-            -
            				for ( i = 0; i < valsLength; i += 1 ) {
-            -
            					this._change( null, i );
-            -
            				}
-            -
            				this._animateOff = false;
-            -
            				break;
-            -
            		}
-            -
            	},
-            -
-            -
            	//internal value getter
-            -
            	// _value() returns value trimmed by min and max, aligned by step
-            -
            	_value: function() {
-            -
            		var val = this.options.value;
-            -
            		val = this._trimAlignValue( val );
-            -
-            -
            		return val;
-            -
            	},
-            -
-            -
            	//internal values getter
-            -
            	// _values() returns array of values trimmed by min and max, aligned by step
-            -
            	// _values( index ) returns single value trimmed by min and max, aligned by step
-            -
            	_values: function( index ) {
-            -
            		var val,
-            -
            			vals,
-            -
            			i;
-            -
-            -
            		if ( arguments.length ) {
-            -
            			val = this.options.values[ index ];
-            -
            			val = this._trimAlignValue( val );
-            -
-            -
            			return val;
-            -
            		} else {
-            -
            			// .slice() creates a copy of the array
-            -
            			// this copy gets trimmed by min and max and then returned
-            -
            			vals = this.options.values.slice();
-            -
            			for ( i = 0; i < vals.length; i+= 1) {
-            -
            				vals[ i ] = this._trimAlignValue( vals[ i ] );
-            -
            			}
-            -
-            -
            			return vals;
-            -
            		}
-            -
            	},
-            -
-            -
            	// returns the step-aligned value that val is closest to, between (inclusive) min and max
-            -
            	_trimAlignValue: function( val ) {
-            -
            		if ( val <= this._valueMin() ) {
-            -
            			return this._valueMin();
-            -
            		}
-            -
            		if ( val >= this._valueMax() ) {
-            -
            			return this._valueMax();
-            -
            		}
-            -
            		var step = ( this.options.step > 0 ) ? this.options.step : 1,
-            -
            			valModStep = (val - this._valueMin()) % step,
-            -
            			alignValue = val - valModStep;
-            -
-            -
            		if ( Math.abs(valModStep) * 2 >= step ) {
-            -
            			alignValue += ( valModStep > 0 ) ? step : ( -step );
-            -
            		}
-            -
-            -
            		// Since JavaScript has problems with large floats, round
-            -
            		// the final value to 5 digits after the decimal point (see #4124)
-            -
            		return parseFloat( alignValue.toFixed(5) );
-            -
            	},
-            -
-            -
            	_valueMin: function() {
-            -
            		return this.options.min;
-            -
            	},
-            -
-            -
            	_valueMax: function() {
-            -
            		return this.options.max;
-            -
            	},
-            -
-            -
            	_refreshValue: function() {
-            -
            		var oRange = this.options.range,
-            -
            			o = this.options,
-            -
            			self = this,
-            -
            			animate = ( !this._animateOff ) ? o.animate : false,
-            -
            			valPercent,
-            -
            			_set = {},
-            -
            			lastValPercent,
-            -
            			value,
-            -
            			valueMin,
-            -
            			valueMax;
-            -
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			this.handles.each(function( i, j ) {
-            -
            				valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
-            -
            				_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
-            -
            				$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
-            -
            				if ( self.options.range === true ) {
-            -
            					if ( self.orientation === "horizontal" ) {
-            -
            						if ( i === 0 ) {
-            -
            							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
-            -
            						}
-            -
            						if ( i === 1 ) {
-            -
            							self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            						}
-            -
            					} else {
-            -
            						if ( i === 0 ) {
-            -
            							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
-            -
            						}
-            -
            						if ( i === 1 ) {
-            -
            							self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            						}
-            -
            					}
-            -
            				}
-            -
            				lastValPercent = valPercent;
-            -
            			});
-            -
            		} else {
-            -
            			value = this.value();
-            -
            			valueMin = this._valueMin();
-            -
            			valueMax = this._valueMax();
-            -
            			valPercent = ( valueMax !== valueMin ) ?
-            -
            					( value - valueMin ) / ( valueMax - valueMin ) * 100 :
-            -
            					0;
-            -
            			_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
-            -
            			this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
-            -
-            -
            			if ( oRange === "min" && this.orientation === "horizontal" ) {
-            -
            				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
-            -
            			}
-            -
            			if ( oRange === "max" && this.orientation === "horizontal" ) {
-            -
            				this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            			}
-            -
            			if ( oRange === "min" && this.orientation === "vertical" ) {
-            -
            				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
-            -
            			}
-            -
            			if ( oRange === "max" && this.orientation === "vertical" ) {
-            -
            				this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            			}
-            -
            		}
-            -
            	}
-            -
-            -
            });
-            -
-            -
            $.extend( $.ui.slider, {
-            -
            	version: "1.8.16"
-            -
            });
-            -
-            -
            }(jQuery));


1	+ /*
2	+ * jQuery UI Slider 1.8.16
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI/Slider
9	+ *
10	+ * Depends:
11	+ * jquery.ui.core.js
12	+ * jquery.ui.mouse.js
13	+ * jquery.ui.widget.js
14	+ */
15	+ (function( $, undefined ) {
16	+
17	+ // number of pages in a slider
18	+ // (how many times can you page up/down to go through the whole range)
19	+ var numPages = 5;
20	+
21	+ $.widget( "ui.slider", $.ui.mouse, {
22	+
23	+ widgetEventPrefix: "slide",
24	+
25	+ options: {
26	+ animate: false,
27	+ distance: 0,
28	+ max: 100,
29	+ min: 0,
30	+ orientation: "horizontal",
31	+ range: false,
32	+ step: 1,
33	+ value: 0,
34	+ values: null
35	+ },
36	+
37	+ _create: function() {
38	+ var self = this,
39	+ o = this.options,
40	+ existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
41	+ handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
42	+ handleCount = ( o.values && o.values.length ) \|\| 1,
43	+ handles = [];
44	+
45	+ this._keySliding = false;
46	+ this._mouseSliding = false;
47	+ this._animateOff = true;
48	+ this._handleIndex = null;
49	+ this._detectOrientation();
50	+ this._mouseInit();
51	+
52	+ this.element
53	+ .addClass( "ui-slider" +
54	+ " ui-slider-" + this.orientation +
55	+ " ui-widget" +
56	+ " ui-widget-content" +
57	+ " ui-corner-all" +
58	+ ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
59	+
60	+ this.range = $([]);
61	+
62	+ if ( o.range ) {
63	+ if ( o.range === true ) {
64	+ if ( !o.values ) {
65	+ o.values = [ this._valueMin(), this._valueMin() ];
66	+ }
67	+ if ( o.values.length && o.values.length !== 2 ) {
68	+ o.values = [ o.values[0], o.values[0] ];
69	+ }
70	+ }
71	+
72	+ this.range = $( "<div></div>" )
73	+ .appendTo( this.element )
74	+ .addClass( "ui-slider-range" +
75	+ // note: this isn't the most fittingly semantic framework class for this element,
76	+ // but worked best visually with a variety of themes
77	+ " ui-widget-header" +
78	+ ( ( o.range === "min" \|\| o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
79	+ }
80	+
81	+ for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
82	+ handles.push( handle );
83	+ }
84	+
85	+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
86	+
87	+ this.handle = this.handles.eq( 0 );
88	+
89	+ this.handles.add( this.range ).filter( "a" )
90	+ .click(function( event ) {
91	+ event.preventDefault();
92	+ })
93	+ .hover(function() {
94	+ if ( !o.disabled ) {
95	+ $( this ).addClass( "ui-state-hover" );
96	+ }
97	+ }, function() {
98	+ $( this ).removeClass( "ui-state-hover" );
99	+ })
100	+ .focus(function() {
101	+ if ( !o.disabled ) {
102	+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
103	+ $( this ).addClass( "ui-state-focus" );
104	+ } else {
105	+ $( this ).blur();
106	+ }
107	+ })
108	+ .blur(function() {
109	+ $( this ).removeClass( "ui-state-focus" );
110	+ });
111	+
112	+ this.handles.each(function( i ) {
113	+ $( this ).data( "index.ui-slider-handle", i );
114	+ });
115	+
116	+ this.handles
117	+ .keydown(function( event ) {
118	+ var ret = true,
119	+ index = $( this ).data( "index.ui-slider-handle" ),
120	+ allowed,
121	+ curVal,
122	+ newVal,
123	+ step;
124	+
125	+ if ( self.options.disabled ) {
126	+ return;
127	+ }
128	+
129	+ switch ( event.keyCode ) {
130	+ case $.ui.keyCode.HOME:
131	+ case $.ui.keyCode.END:
132	+ case $.ui.keyCode.PAGE_UP:
133	+ case $.ui.keyCode.PAGE_DOWN:
134	+ case $.ui.keyCode.UP:
135	+ case $.ui.keyCode.RIGHT:
136	+ case $.ui.keyCode.DOWN:
137	+ case $.ui.keyCode.LEFT:
138	+ ret = false;
139	+ if ( !self._keySliding ) {
140	+ self._keySliding = true;
141	+ $( this ).addClass( "ui-state-active" );
142	+ allowed = self._start( event, index );
143	+ if ( allowed === false ) {
144	+ return;
145	+ }
146	+ }
147	+ break;
148	+ }
149	+
150	+ step = self.options.step;
151	+ if ( self.options.values && self.options.values.length ) {
152	+ curVal = newVal = self.values( index );
153	+ } else {
154	+ curVal = newVal = self.value();
155	+ }
156	+
157	+ switch ( event.keyCode ) {
158	+ case $.ui.keyCode.HOME:
159	+ newVal = self._valueMin();
160	+ break;
161	+ case $.ui.keyCode.END:
162	+ newVal = self._valueMax();
163	+ break;
164	+ case $.ui.keyCode.PAGE_UP:
165	+ newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
166	+ break;
167	+ case $.ui.keyCode.PAGE_DOWN:
168	+ newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
169	+ break;
170	+ case $.ui.keyCode.UP:
171	+ case $.ui.keyCode.RIGHT:
172	+ if ( curVal === self._valueMax() ) {
173	+ return;
174	+ }
175	+ newVal = self._trimAlignValue( curVal + step );
176	+ break;
177	+ case $.ui.keyCode.DOWN:
178	+ case $.ui.keyCode.LEFT:
179	+ if ( curVal === self._valueMin() ) {
180	+ return;
181	+ }
182	+ newVal = self._trimAlignValue( curVal - step );
183	+ break;
184	+ }
185	+
186	+ self._slide( event, index, newVal );
187	+
188	+ return ret;
189	+
190	+ })
191	+ .keyup(function( event ) {
192	+ var index = $( this ).data( "index.ui-slider-handle" );
193	+
194	+ if ( self._keySliding ) {
195	+ self._keySliding = false;
196	+ self._stop( event, index );
197	+ self._change( event, index );
198	+ $( this ).removeClass( "ui-state-active" );
199	+ }
200	+
201	+ });
202	+
203	+ this._refreshValue();
204	+
205	+ this._animateOff = false;
206	+ },
207	+
208	+ destroy: function() {
209	+ this.handles.remove();
210	+ this.range.remove();
211	+
212	+ this.element
213	+ .removeClass( "ui-slider" +
214	+ " ui-slider-horizontal" +
215	+ " ui-slider-vertical" +
216	+ " ui-slider-disabled" +
217	+ " ui-widget" +
218	+ " ui-widget-content" +
219	+ " ui-corner-all" )
220	+ .removeData( "slider" )
221	+ .unbind( ".slider" );
222	+
223	+ this._mouseDestroy();
224	+
225	+ return this;
226	+ },
227	+
228	+ _mouseCapture: function( event ) {
229	+ var o = this.options,
230	+ position,
231	+ normValue,
232	+ distance,
233	+ closestHandle,
234	+ self,
235	+ index,
236	+ allowed,
237	+ offset,
238	+ mouseOverHandle;
239	+
240	+ if ( o.disabled ) {
241	+ return false;
242	+ }
243	+
244	+ this.elementSize = {
245	+ width: this.element.outerWidth(),
246	+ height: this.element.outerHeight()
247	+ };
248	+ this.elementOffset = this.element.offset();
249	+
250	+ position = { x: event.pageX, y: event.pageY };
251	+ normValue = this._normValueFromMouse( position );
252	+ distance = this._valueMax() - this._valueMin() + 1;
253	+ self = this;
254	+ this.handles.each(function( i ) {
255	+ var thisDistance = Math.abs( normValue - self.values(i) );
256	+ if ( distance > thisDistance ) {
257	+ distance = thisDistance;
258	+ closestHandle = $( this );
259	+ index = i;
260	+ }
261	+ });
262	+
263	+ // workaround for bug #3736 (if both handles of a range are at 0,
264	+ // the first is always used as the one with least distance,
265	+ // and moving it is obviously prevented by preventing negative ranges)
266	+ if( o.range === true && this.values(1) === o.min ) {
267	+ index += 1;
268	+ closestHandle = $( this.handles[index] );
269	+ }
270	+
271	+ allowed = this._start( event, index );
272	+ if ( allowed === false ) {
273	+ return false;
274	+ }
275	+ this._mouseSliding = true;
276	+
277	+ self._handleIndex = index;
278	+
279	+ closestHandle
280	+ .addClass( "ui-state-active" )
281	+ .focus();
282	+
283	+ offset = closestHandle.offset();
284	+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
285	+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
286	+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
287	+ top: event.pageY - offset.top -
288	+ ( closestHandle.height() / 2 ) -
289	+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) \|\| 0 ) -
290	+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) \|\| 0) +
291	+ ( parseInt( closestHandle.css("marginTop"), 10 ) \|\| 0)
292	+ };
293	+
294	+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
295	+ this._slide( event, index, normValue );
296	+ }
297	+ this._animateOff = true;
298	+ return true;
299	+ },
300	+
301	+ _mouseStart: function( event ) {
302	+ return true;
303	+ },
304	+
305	+ _mouseDrag: function( event ) {
306	+ var position = { x: event.pageX, y: event.pageY },
307	+ normValue = this._normValueFromMouse( position );
308	+
309	+ this._slide( event, this._handleIndex, normValue );
310	+
311	+ return false;
312	+ },
313	+
314	+ _mouseStop: function( event ) {
315	+ this.handles.removeClass( "ui-state-active" );
316	+ this._mouseSliding = false;
317	+
318	+ this._stop( event, this._handleIndex );
319	+ this._change( event, this._handleIndex );
320	+
321	+ this._handleIndex = null;
322	+ this._clickOffset = null;
323	+ this._animateOff = false;
324	+
325	+ return false;
326	+ },
327	+
328	+ _detectOrientation: function() {
329	+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
330	+ },
331	+
332	+ _normValueFromMouse: function( position ) {
333	+ var pixelTotal,
334	+ pixelMouse,
335	+ percentMouse,
336	+ valueTotal,
337	+ valueMouse;
338	+
339	+ if ( this.orientation === "horizontal" ) {
340	+ pixelTotal = this.elementSize.width;
341	+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
342	+ } else {
343	+ pixelTotal = this.elementSize.height;
344	+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
345	+ }
346	+
347	+ percentMouse = ( pixelMouse / pixelTotal );
348	+ if ( percentMouse > 1 ) {
349	+ percentMouse = 1;
350	+ }
351	+ if ( percentMouse < 0 ) {
352	+ percentMouse = 0;
353	+ }
354	+ if ( this.orientation === "vertical" ) {
355	+ percentMouse = 1 - percentMouse;
356	+ }
357	+
358	+ valueTotal = this._valueMax() - this._valueMin();
359	+ valueMouse = this._valueMin() + percentMouse * valueTotal;
360	+
361	+ return this._trimAlignValue( valueMouse );
362	+ },
363	+
364	+ _start: function( event, index ) {
365	+ var uiHash = {
366	+ handle: this.handles[ index ],
367	+ value: this.value()
368	+ };
369	+ if ( this.options.values && this.options.values.length ) {
370	+ uiHash.value = this.values( index );
371	+ uiHash.values = this.values();
372	+ }
373	+ return this._trigger( "start", event, uiHash );
374	+ },
375	+
376	+ _slide: function( event, index, newVal ) {
377	+ var otherVal,
378	+ newValues,
379	+ allowed;
380	+
381	+ if ( this.options.values && this.options.values.length ) {
382	+ otherVal = this.values( index ? 0 : 1 );
383	+
384	+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
385	+ ( ( index === 0 && newVal > otherVal) \|\| ( index === 1 && newVal < otherVal ) )
386	+ ) {
387	+ newVal = otherVal;
388	+ }
389	+
390	+ if ( newVal !== this.values( index ) ) {
391	+ newValues = this.values();
392	+ newValues[ index ] = newVal;
393	+ // A slide can be canceled by returning false from the slide callback
394	+ allowed = this._trigger( "slide", event, {
395	+ handle: this.handles[ index ],
396	+ value: newVal,
397	+ values: newValues
398	+ } );
399	+ otherVal = this.values( index ? 0 : 1 );
400	+ if ( allowed !== false ) {
401	+ this.values( index, newVal, true );
402	+ }
403	+ }
404	+ } else {
405	+ if ( newVal !== this.value() ) {
406	+ // A slide can be canceled by returning false from the slide callback
407	+ allowed = this._trigger( "slide", event, {
408	+ handle: this.handles[ index ],
409	+ value: newVal
410	+ } );
411	+ if ( allowed !== false ) {
412	+ this.value( newVal );
413	+ }
414	+ }
415	+ }
416	+ },
417	+
418	+ _stop: function( event, index ) {
419	+ var uiHash = {
420	+ handle: this.handles[ index ],
421	+ value: this.value()
422	+ };
423	+ if ( this.options.values && this.options.values.length ) {
424	+ uiHash.value = this.values( index );
425	+ uiHash.values = this.values();
426	+ }
427	+
428	+ this._trigger( "stop", event, uiHash );
429	+ },
430	+
431	+ _change: function( event, index ) {
432	+ if ( !this._keySliding && !this._mouseSliding ) {
433	+ var uiHash = {
434	+ handle: this.handles[ index ],
435	+ value: this.value()
436	+ };
437	+ if ( this.options.values && this.options.values.length ) {
438	+ uiHash.value = this.values( index );
439	+ uiHash.values = this.values();
440	+ }
441	+
442	+ this._trigger( "change", event, uiHash );
443	+ }
444	+ },
445	+
446	+ value: function( newValue ) {
447	+ if ( arguments.length ) {
448	+ this.options.value = this._trimAlignValue( newValue );
449	+ this._refreshValue();
450	+ this._change( null, 0 );
451	+ return;
452	+ }
453	+
454	+ return this._value();
455	+ },
456	+
457	+ values: function( index, newValue ) {
458	+ var vals,
459	+ newValues,
460	+ i;
461	+
462	+ if ( arguments.length > 1 ) {
463	+ this.options.values[ index ] = this._trimAlignValue( newValue );
464	+ this._refreshValue();
465	+ this._change( null, index );
466	+ return;
467	+ }
468	+
469	+ if ( arguments.length ) {
470	+ if ( $.isArray( arguments[ 0 ] ) ) {
471	+ vals = this.options.values;
472	+ newValues = arguments[ 0 ];
473	+ for ( i = 0; i < vals.length; i += 1 ) {
474	+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
475	+ this._change( null, i );
476	+ }
477	+ this._refreshValue();
478	+ } else {
479	+ if ( this.options.values && this.options.values.length ) {
480	+ return this._values( index );
481	+ } else {
482	+ return this.value();
483	+ }
484	+ }
485	+ } else {
486	+ return this._values();
487	+ }
488	+ },
489	+
490	+ _setOption: function( key, value ) {
491	+ var i,
492	+ valsLength = 0;
493	+
494	+ if ( $.isArray( this.options.values ) ) {
495	+ valsLength = this.options.values.length;
496	+ }
497	+
498	+ $.Widget.prototype._setOption.apply( this, arguments );
499	+
500	+ switch ( key ) {
501	+ case "disabled":
502	+ if ( value ) {
503	+ this.handles.filter( ".ui-state-focus" ).blur();
504	+ this.handles.removeClass( "ui-state-hover" );
505	+ this.handles.propAttr( "disabled", true );
506	+ this.element.addClass( "ui-disabled" );
507	+ } else {
508	+ this.handles.propAttr( "disabled", false );
509	+ this.element.removeClass( "ui-disabled" );
510	+ }
511	+ break;
512	+ case "orientation":
513	+ this._detectOrientation();
514	+ this.element
515	+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
516	+ .addClass( "ui-slider-" + this.orientation );
517	+ this._refreshValue();
518	+ break;
519	+ case "value":
520	+ this._animateOff = true;
521	+ this._refreshValue();
522	+ this._change( null, 0 );
523	+ this._animateOff = false;
524	+ break;
525	+ case "values":
526	+ this._animateOff = true;
527	+ this._refreshValue();
528	+ for ( i = 0; i < valsLength; i += 1 ) {
529	+ this._change( null, i );
530	+ }
531	+ this._animateOff = false;
532	+ break;
533	+ }
534	+ },
535	+
536	+ //internal value getter
537	+ // _value() returns value trimmed by min and max, aligned by step
538	+ _value: function() {
539	+ var val = this.options.value;
540	+ val = this._trimAlignValue( val );
541	+
542	+ return val;
543	+ },
544	+
545	+ //internal values getter
546	+ // _values() returns array of values trimmed by min and max, aligned by step
547	+ // _values( index ) returns single value trimmed by min and max, aligned by step
548	+ _values: function( index ) {
549	+ var val,
550	+ vals,
551	+ i;
552	+
553	+ if ( arguments.length ) {
554	+ val = this.options.values[ index ];
555	+ val = this._trimAlignValue( val );
556	+
557	+ return val;
558	+ } else {
559	+ // .slice() creates a copy of the array
560	+ // this copy gets trimmed by min and max and then returned
561	+ vals = this.options.values.slice();
562	+ for ( i = 0; i < vals.length; i+= 1) {
563	+ vals[ i ] = this._trimAlignValue( vals[ i ] );
564	+ }
565	+
566	+ return vals;
567	+ }
568	+ },
569	+
570	+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
571	+ _trimAlignValue: function( val ) {
572	+ if ( val <= this._valueMin() ) {
573	+ return this._valueMin();
574	+ }
575	+ if ( val >= this._valueMax() ) {
576	+ return this._valueMax();
577	+ }
578	+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
579	+ valModStep = (val - this._valueMin()) % step,
580	+ alignValue = val - valModStep;
581	+
582	+ if ( Math.abs(valModStep) * 2 >= step ) {
583	+ alignValue += ( valModStep > 0 ) ? step : ( -step );
584	+ }
585	+
586	+ // Since JavaScript has problems with large floats, round
587	+ // the final value to 5 digits after the decimal point (see #4124)
588	+ return parseFloat( alignValue.toFixed(5) );
589	+ },
590	+
591	+ _valueMin: function() {
592	+ return this.options.min;
593	+ },
594	+
595	+ _valueMax: function() {
596	+ return this.options.max;
597	+ },
598	+
599	+ _refreshValue: function() {
600	+ var oRange = this.options.range,
601	+ o = this.options,
602	+ self = this,
603	+ animate = ( !this._animateOff ) ? o.animate : false,
604	+ valPercent,
605	+ _set = {},
606	+ lastValPercent,
607	+ value,
608	+ valueMin,
609	+ valueMax;
610	+
611	+ if ( this.options.values && this.options.values.length ) {
612	+ this.handles.each(function( i, j ) {
613	+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
614	+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
615	+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
616	+ if ( self.options.range === true ) {
617	+ if ( self.orientation === "horizontal" ) {
618	+ if ( i === 0 ) {
619	+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
620	+ }
621	+ if ( i === 1 ) {
622	+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
623	+ }
624	+ } else {
625	+ if ( i === 0 ) {
626	+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
627	+ }
628	+ if ( i === 1 ) {
629	+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
630	+ }
631	+ }
632	+ }
633	+ lastValPercent = valPercent;
634	+ });
635	+ } else {
636	+ value = this.value();
637	+ valueMin = this._valueMin();
638	+ valueMax = this._valueMax();
639	+ valPercent = ( valueMax !== valueMin ) ?
640	+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
641	+ 0;
642	+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
643	+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
644	+
645	+ if ( oRange === "min" && this.orientation === "horizontal" ) {
646	+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
647	+ }
648	+ if ( oRange === "max" && this.orientation === "horizontal" ) {
649	+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
650	+ }
651	+ if ( oRange === "min" && this.orientation === "vertical" ) {
652	+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
653	+ }
654	+ if ( oRange === "max" && this.orientation === "vertical" ) {
655	+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
656	+ }
657	+ }
658	+ }
659	+
660	+ });
661	+
662	+ $.extend( $.ui.slider, {
663	+ version: "1.8.16"
664	+ });
665	+
666	+ }(jQuery));

js/jquery.ui.slider.min.js CHANGED Viewed

@@ -1,66 +1,66 @@
-            -
            /*!
-            -
             * jQuery UI Widget 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Widget
-            -
             */
-            -
            (function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=
-            -
            function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):
-            -
            d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=
-            -
            b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+
-            -
            "-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",
-            -
            c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
-            -
            ;/*!
-            -
             * jQuery UI Mouse 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Mouse
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
-            -
            this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
-            -
            this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
-            -
            !(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
-            -
            false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
-            -
            ;/*
-            -
             * jQuery UI Slider 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Slider
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=b.values&&b.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
-            -
            this.orientation+" ui-widget ui-widget-content ui-corner-all"+(b.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(b.range){if(b.range===true){if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
-            -
            this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
-            -
            g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length?
-            -
            (h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i-
-            -
            m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
-            -
            return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false;
-            -
            this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b=
-            -
            this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b=
-            -
            this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);
-            -
            c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c<f))c=f;if(c!==this.values(b)){f=this.values();f[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:f});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c});
-            -
            a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=
-            -
            this._trimAlignValue(a);this._refreshValue();this._change(null,0)}else return this._value()},values:function(a,b){var c,f,e;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a):
-            -
            this.value();else return this._values()},_setOption:function(a,b){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.propAttr("disabled",true);this.element.addClass("ui-disabled")}else{this.handles.propAttr("disabled",false);this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
-            -
            this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a];
-            -
            return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a=
-            -
            this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e-
-            -
            g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"},
-            -
            b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery);
+            ;


1	+ /*!
2	+ * jQuery UI Widget 1.8.16
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI/Widget
9	+ */
10	+ (function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a\|\|b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=
11	+ function(h){return!!b.data(h,a)};b[e]=b[e]\|\|{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix\|\|a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):
12	+ d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d\|\|{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=
13	+ b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+
14	+ "-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",
15	+ c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d\|\|{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false\|\|c.isDefaultPrevented())}}})(jQuery);
16	+ ;/*!
17	+ * jQuery UI Mouse 1.8.16
18	+ *
19	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
20	+ * Dual licensed under the MIT or GPL Version 2 licenses.
21	+ * http://jquery.org/license
22	+ *
23	+ * http://docs.jquery.com/UI/Mouse
24	+ *
25	+ * Depends:
26	+ * jquery.ui.widget.js
27	+ */
28	+ (function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
29	+ this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f\|\|g\|\|!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
30	+ this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
31	+ !(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
32	+ false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
33	+ ;/*
34	+ * jQuery UI Slider 1.8.16
35	+ *
36	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
37	+ * Dual licensed under the MIT or GPL Version 2 licenses.
38	+ * http://jquery.org/license
39	+ *
40	+ * http://docs.jquery.com/UI/Slider
41	+ *
42	+ * Depends:
43	+ * jquery.ui.core.js
44	+ * jquery.ui.mouse.js
45	+ * jquery.ui.widget.js
46	+ */
47	+ (function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=b.values&&b.values.length\|\|1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
48	+ this.orientation+" ui-widget ui-widget-content ui-corner-all"+(b.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(b.range){if(b.range===true){if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"\|\|b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
49	+ this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled\|\|d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
50	+ g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length?
51	+ (h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i-
52	+ m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
53	+ return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false;
54	+ this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)\|\|0)-(parseInt(e.css("borderBottomWidth"),10)\|\|0)+(parseInt(e.css("marginTop"),10)\|\|0)};this.handles.hasClass("ui-state-hover")\|\|this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b=
55	+ this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b=
56	+ this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);
57	+ c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f\|\|b===1&&c<f))c=f;if(c!==this.values(b)){f=this.values();f[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:f});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c});
58	+ a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=
59	+ this._trimAlignValue(a);this._refreshValue();this._change(null,0)}else return this._value()},values:function(a,b){var c,f,e;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a):
60	+ this.value();else return this._values()},_setOption:function(a,b){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.propAttr("disabled",true);this.element.addClass("ui-disabled")}else{this.handles.propAttr("disabled",false);this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
61	+ this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a];
62	+ return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a=
63	+ this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e-
64	+ g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"},
65	+ b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery);
66	;

js/jquery.ui.widget.js CHANGED Viewed

@@ -1,268 +1,268 @@
-            -
            /*!
-            -
             * jQuery UI Widget 1.8.16
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Widget
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            // jQuery 1.4+
-            -
            if ( $.cleanData ) {
-            -
            	var _cleanData = $.cleanData;
-            -
            	$.cleanData = function( elems ) {
-            -
            		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-            -
            			try {
-            -
            				$( elem ).triggerHandler( "remove" );
-            -
            			// http://bugs.jquery.com/ticket/8235
-            -
            			} catch( e ) {}
-            -
            		}
-            -
            		_cleanData( elems );
-            -
            	};
-            -
            } else {
-            -
            	var _remove = $.fn.remove;
-            -
            	$.fn.remove = function( selector, keepData ) {
-            -
            		return this.each(function() {
-            -
            			if ( !keepData ) {
-            -
            				if ( !selector || $.filter( selector, [ this ] ).length ) {
-            -
            					$( "*", this ).add( [ this ] ).each(function() {
-            -
            						try {
-            -
            							$( this ).triggerHandler( "remove" );
-            -
            						// http://bugs.jquery.com/ticket/8235
-            -
            						} catch( e ) {}
-            -
            					});
-            -
            				}
-            -
            			}
-            -
            			return _remove.call( $(this), selector, keepData );
-            -
            		});
-            -
            	};
-            -
            }
-            -
-            -
            $.widget = function( name, base, prototype ) {
-            -
            	var namespace = name.split( "." )[ 0 ],
-            -
            		fullName;
-            -
            	name = name.split( "." )[ 1 ];
-            -
            	fullName = namespace + "-" + name;
-            -
-            -
            	if ( !prototype ) {
-            -
            		prototype = base;
-            -
            		base = $.Widget;
-            -
            	}
-            -
-            -
            	// create selector for plugin
-            -
            	$.expr[ ":" ][ fullName ] = function( elem ) {
-            -
            		return !!$.data( elem, name );
-            -
            	};
-            -
-            -
            	$[ namespace ] = $[ namespace ] || {};
-            -
            	$[ namespace ][ name ] = function( options, element ) {
-            -
            		// allow instantiation without initializing for simple inheritance
-            -
            		if ( arguments.length ) {
-            -
            			this._createWidget( options, element );
-            -
            		}
-            -
            	};
-            -
-            -
            	var basePrototype = new base();
-            -
            	// we need to make the options hash a property directly on the new instance
-            -
            	// otherwise we'll modify the options hash on the prototype that we're
-            -
            	// inheriting from
-            -
            //	$.each( basePrototype, function( key, val ) {
-            -
            //		if ( $.isPlainObject(val) ) {
-            -
            //			basePrototype[ key ] = $.extend( {}, val );
-            -
            //		}
-            -
            //	});
-            -
            	basePrototype.options = $.extend( true, {}, basePrototype.options );
-            -
            	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
-            -
            		namespace: namespace,
-            -
            		widgetName: name,
-            -
            		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
-            -
            		widgetBaseClass: fullName
-            -
            	}, prototype );
-            -
-            -
            	$.widget.bridge( name, $[ namespace ][ name ] );
-            -
            };
-            -
-            -
            $.widget.bridge = function( name, object ) {
-            -
            	$.fn[ name ] = function( options ) {
-            -
            		var isMethodCall = typeof options === "string",
-            -
            			args = Array.prototype.slice.call( arguments, 1 ),
-            -
            			returnValue = this;
-            -
-            -
            		// allow multiple hashes to be passed on init
-            -
            		options = !isMethodCall && args.length ?
-            -
            			$.extend.apply( null, [ true, options ].concat(args) ) :
-            -
            			options;
-            -
-            -
            		// prevent calls to internal methods
-            -
            		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
-            -
            			return returnValue;
-            -
            		}
-            -
-            -
            		if ( isMethodCall ) {
-            -
            			this.each(function() {
-            -
            				var instance = $.data( this, name ),
-            -
            					methodValue = instance && $.isFunction( instance[options] ) ?
-            -
            						instance[ options ].apply( instance, args ) :
-            -
            						instance;
-            -
            				// TODO: add this back in 1.9 and use $.error() (see #5972)
-            -
            //				if ( !instance ) {
-            -
            //					throw "cannot call methods on " + name + " prior to initialization; " +
-            -
            //						"attempted to call method '" + options + "'";
-            -
            //				}
-            -
            //				if ( !$.isFunction( instance[options] ) ) {
-            -
            //					throw "no such method '" + options + "' for " + name + " widget instance";
-            -
            //				}
-            -
            //				var methodValue = instance[ options ].apply( instance, args );
-            -
            				if ( methodValue !== instance && methodValue !== undefined ) {
-            -
            					returnValue = methodValue;
-            -
            					return false;
-            -
            				}
-            -
            			});
-            -
            		} else {
-            -
            			this.each(function() {
-            -
            				var instance = $.data( this, name );
-            -
            				if ( instance ) {
-            -
            					instance.option( options || {} )._init();
-            -
            				} else {
-            -
            					$.data( this, name, new object( options, this ) );
-            -
            				}
-            -
            			});
-            -
            		}
-            -
-            -
            		return returnValue;
-            -
            	};
-            -
            };
-            -
-            -
            $.Widget = function( options, element ) {
-            -
            	// allow instantiation without initializing for simple inheritance
-            -
            	if ( arguments.length ) {
-            -
            		this._createWidget( options, element );
-            -
            	}
-            -
            };
-            -
-            -
            $.Widget.prototype = {
-            -
            	widgetName: "widget",
-            -
            	widgetEventPrefix: "",
-            -
            	options: {
-            -
            		disabled: false
-            -
            	},
-            -
            	_createWidget: function( options, element ) {
-            -
            		// $.widget.bridge stores the plugin instance, but we do it anyway
-            -
            		// so that it's stored even before the _create function runs
-            -
            		$.data( element, this.widgetName, this );
-            -
            		this.element = $( element );
-            -
            		this.options = $.extend( true, {},
-            -
            			this.options,
-            -
            			this._getCreateOptions(),
-            -
            			options );
-            -
-            -
            		var self = this;
-            -
            		this.element.bind( "remove." + this.widgetName, function() {
-            -
            			self.destroy();
-            -
            		});
-            -
-            -
            		this._create();
-            -
            		this._trigger( "create" );
-            -
            		this._init();
-            -
            	},
-            -
            	_getCreateOptions: function() {
-            -
            		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
-            -
            	},
-            -
            	_create: function() {},
-            -
            	_init: function() {},
-            -
-            -
            	destroy: function() {
-            -
            		this.element
-            -
            			.unbind( "." + this.widgetName )
-            -
            			.removeData( this.widgetName );
-            -
            		this.widget()
-            -
            			.unbind( "." + this.widgetName )
-            -
            			.removeAttr( "aria-disabled" )
-            -
            			.removeClass(
-            -
            				this.widgetBaseClass + "-disabled " +
-            -
            				"ui-state-disabled" );
-            -
            	},
-            -
-            -
            	widget: function() {
-            -
            		return this.element;
-            -
            	},
-            -
-            -
            	option: function( key, value ) {
-            -
            		var options = key;
-            -
-            -
            		if ( arguments.length === 0 ) {
-            -
            			// don't return a reference to the internal hash
-            -
            			return $.extend( {}, this.options );
-            -
            		}
-            -
-            -
            		if  (typeof key === "string" ) {
-            -
            			if ( value === undefined ) {
-            -
            				return this.options[ key ];
-            -
            			}
-            -
            			options = {};
-            -
            			options[ key ] = value;
-            -
            		}
-            -
-            -
            		this._setOptions( options );
-            -
-            -
            		return this;
-            -
            	},
-            -
            	_setOptions: function( options ) {
-            -
            		var self = this;
-            -
            		$.each( options, function( key, value ) {
-            -
            			self._setOption( key, value );
-            -
            		});
-            -
-            -
            		return this;
-            -
            	},
-            -
            	_setOption: function( key, value ) {
-            -
            		this.options[ key ] = value;
-            -
-            -
            		if ( key === "disabled" ) {
-            -
            			this.widget()
-            -
            				[ value ? "addClass" : "removeClass"](
-            -
            					this.widgetBaseClass + "-disabled" + " " +
-            -
            					"ui-state-disabled" )
-            -
            				.attr( "aria-disabled", value );
-            -
            		}
-            -
-            -
            		return this;
-            -
            	},
-            -
-            -
            	enable: function() {
-            -
            		return this._setOption( "disabled", false );
-            -
            	},
-            -
            	disable: function() {
-            -
            		return this._setOption( "disabled", true );
-            -
            	},
-            -
-            -
            	_trigger: function( type, event, data ) {
-            -
            		var callback = this.options[ type ];
-            -
-            -
            		event = $.Event( event );
-            -
            		event.type = ( type === this.widgetEventPrefix ?
-            -
            			type :
-            -
            			this.widgetEventPrefix + type ).toLowerCase();
-            -
            		data = data || {};
-            -
-            -
            		// copy original event properties over to the new event
-            -
            		// this would happen if we could call $.event.fix instead of $.Event
-            -
            		// but we don't have a way to force an event to be fixed multiple times
-            -
            		if ( event.originalEvent ) {
-            -
            			for ( var i = $.event.props.length, prop; i; ) {
-            -
            				prop = $.event.props[ --i ];
-            -
            				event[ prop ] = event.originalEvent[ prop ];
-            -
            			}
-            -
            		}
-            -
-            -
            		this.element.trigger( event, data );
-            -
-            -
            		return !( $.isFunction(callback) &&
-            -
            			callback.call( this.element[0], event, data ) === false ||
-            -
            			event.isDefaultPrevented() );
-            -
            	}
-            -
            };
-            -
-            -
            })( jQuery );


1	+ /*!
2	+ * jQuery UI Widget 1.8.16
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI/Widget
9	+ */
10	+ (function( $, undefined ) {
11	+
12	+ // jQuery 1.4+
13	+ if ( $.cleanData ) {
14	+ var _cleanData = $.cleanData;
15	+ $.cleanData = function( elems ) {
16	+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
17	+ try {
18	+ $( elem ).triggerHandler( "remove" );
19	+ // http://bugs.jquery.com/ticket/8235
20	+ } catch( e ) {}
21	+ }
22	+ _cleanData( elems );
23	+ };
24	+ } else {
25	+ var _remove = $.fn.remove;
26	+ $.fn.remove = function( selector, keepData ) {
27	+ return this.each(function() {
28	+ if ( !keepData ) {
29	+ if ( !selector \|\| $.filter( selector, [ this ] ).length ) {
30	+ $( "*", this ).add( [ this ] ).each(function() {
31	+ try {
32	+ $( this ).triggerHandler( "remove" );
33	+ // http://bugs.jquery.com/ticket/8235
34	+ } catch( e ) {}
35	+ });
36	+ }
37	+ }
38	+ return _remove.call( $(this), selector, keepData );
39	+ });
40	+ };
41	+ }
42	+
43	+ $.widget = function( name, base, prototype ) {
44	+ var namespace = name.split( "." )[ 0 ],
45	+ fullName;
46	+ name = name.split( "." )[ 1 ];
47	+ fullName = namespace + "-" + name;
48	+
49	+ if ( !prototype ) {
50	+ prototype = base;
51	+ base = $.Widget;
52	+ }
53	+
54	+ // create selector for plugin
55	+ $.expr[ ":" ][ fullName ] = function( elem ) {
56	+ return !!$.data( elem, name );
57	+ };
58	+
59	+ $[ namespace ] = $[ namespace ] \|\| {};
60	+ $[ namespace ][ name ] = function( options, element ) {
61	+ // allow instantiation without initializing for simple inheritance
62	+ if ( arguments.length ) {
63	+ this._createWidget( options, element );
64	+ }
65	+ };
66	+
67	+ var basePrototype = new base();
68	+ // we need to make the options hash a property directly on the new instance
69	+ // otherwise we'll modify the options hash on the prototype that we're
70	+ // inheriting from
71	+ // $.each( basePrototype, function( key, val ) {
72	+ // if ( $.isPlainObject(val) ) {
73	+ // basePrototype[ key ] = $.extend( {}, val );
74	+ // }
75	+ // });
76	+ basePrototype.options = $.extend( true, {}, basePrototype.options );
77	+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
78	+ namespace: namespace,
79	+ widgetName: name,
80	+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix \|\| name,
81	+ widgetBaseClass: fullName
82	+ }, prototype );
83	+
84	+ $.widget.bridge( name, $[ namespace ][ name ] );
85	+ };
86	+
87	+ $.widget.bridge = function( name, object ) {
88	+ $.fn[ name ] = function( options ) {
89	+ var isMethodCall = typeof options === "string",
90	+ args = Array.prototype.slice.call( arguments, 1 ),
91	+ returnValue = this;
92	+
93	+ // allow multiple hashes to be passed on init
94	+ options = !isMethodCall && args.length ?
95	+ $.extend.apply( null, [ true, options ].concat(args) ) :
96	+ options;
97	+
98	+ // prevent calls to internal methods
99	+ if ( isMethodCall && options.charAt( 0 ) === "_" ) {
100	+ return returnValue;
101	+ }
102	+
103	+ if ( isMethodCall ) {
104	+ this.each(function() {
105	+ var instance = $.data( this, name ),
106	+ methodValue = instance && $.isFunction( instance[options] ) ?
107	+ instance[ options ].apply( instance, args ) :
108	+ instance;
109	+ // TODO: add this back in 1.9 and use $.error() (see #5972)
110	+ // if ( !instance ) {
111	+ // throw "cannot call methods on " + name + " prior to initialization; " +
112	+ // "attempted to call method '" + options + "'";
113	+ // }
114	+ // if ( !$.isFunction( instance[options] ) ) {
115	+ // throw "no such method '" + options + "' for " + name + " widget instance";
116	+ // }
117	+ // var methodValue = instance[ options ].apply( instance, args );
118	+ if ( methodValue !== instance && methodValue !== undefined ) {
119	+ returnValue = methodValue;
120	+ return false;
121	+ }
122	+ });
123	+ } else {
124	+ this.each(function() {
125	+ var instance = $.data( this, name );
126	+ if ( instance ) {
127	+ instance.option( options \|\| {} )._init();
128	+ } else {
129	+ $.data( this, name, new object( options, this ) );
130	+ }
131	+ });
132	+ }
133	+
134	+ return returnValue;
135	+ };
136	+ };
137	+
138	+ $.Widget = function( options, element ) {
139	+ // allow instantiation without initializing for simple inheritance
140	+ if ( arguments.length ) {
141	+ this._createWidget( options, element );
142	+ }
143	+ };
144	+
145	+ $.Widget.prototype = {
146	+ widgetName: "widget",
147	+ widgetEventPrefix: "",
148	+ options: {
149	+ disabled: false
150	+ },
151	+ _createWidget: function( options, element ) {
152	+ // $.widget.bridge stores the plugin instance, but we do it anyway
153	+ // so that it's stored even before the _create function runs
154	+ $.data( element, this.widgetName, this );
155	+ this.element = $( element );
156	+ this.options = $.extend( true, {},
157	+ this.options,
158	+ this._getCreateOptions(),
159	+ options );
160	+
161	+ var self = this;
162	+ this.element.bind( "remove." + this.widgetName, function() {
163	+ self.destroy();
164	+ });
165	+
166	+ this._create();
167	+ this._trigger( "create" );
168	+ this._init();
169	+ },
170	+ _getCreateOptions: function() {
171	+ return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
172	+ },
173	+ _create: function() {},
174	+ _init: function() {},
175	+
176	+ destroy: function() {
177	+ this.element
178	+ .unbind( "." + this.widgetName )
179	+ .removeData( this.widgetName );
180	+ this.widget()
181	+ .unbind( "." + this.widgetName )
182	+ .removeAttr( "aria-disabled" )
183	+ .removeClass(
184	+ this.widgetBaseClass + "-disabled " +
185	+ "ui-state-disabled" );
186	+ },
187	+
188	+ widget: function() {
189	+ return this.element;
190	+ },
191	+
192	+ option: function( key, value ) {
193	+ var options = key;
194	+
195	+ if ( arguments.length === 0 ) {
196	+ // don't return a reference to the internal hash
197	+ return $.extend( {}, this.options );
198	+ }
199	+
200	+ if (typeof key === "string" ) {
201	+ if ( value === undefined ) {
202	+ return this.options[ key ];
203	+ }
204	+ options = {};
205	+ options[ key ] = value;
206	+ }
207	+
208	+ this._setOptions( options );
209	+
210	+ return this;
211	+ },
212	+ _setOptions: function( options ) {
213	+ var self = this;
214	+ $.each( options, function( key, value ) {
215	+ self._setOption( key, value );
216	+ });
217	+
218	+ return this;
219	+ },
220	+ _setOption: function( key, value ) {
221	+ this.options[ key ] = value;
222	+
223	+ if ( key === "disabled" ) {
224	+ this.widget()
225	+ [ value ? "addClass" : "removeClass"](
226	+ this.widgetBaseClass + "-disabled" + " " +
227	+ "ui-state-disabled" )
228	+ .attr( "aria-disabled", value );
229	+ }
230	+
231	+ return this;
232	+ },
233	+
234	+ enable: function() {
235	+ return this._setOption( "disabled", false );
236	+ },
237	+ disable: function() {
238	+ return this._setOption( "disabled", true );
239	+ },
240	+
241	+ _trigger: function( type, event, data ) {
242	+ var callback = this.options[ type ];
243	+
244	+ event = $.Event( event );
245	+ event.type = ( type === this.widgetEventPrefix ?
246	+ type :
247	+ this.widgetEventPrefix + type ).toLowerCase();
248	+ data = data \|\| {};
249	+
250	+ // copy original event properties over to the new event
251	+ // this would happen if we could call $.event.fix instead of $.Event
252	+ // but we don't have a way to force an event to be fixed multiple times
253	+ if ( event.originalEvent ) {
254	+ for ( var i = $.event.props.length, prop; i; ) {
255	+ prop = $.event.props[ --i ];
256	+ event[ prop ] = event.originalEvent[ prop ];
257	+ }
258	+ }
259	+
260	+ this.element.trigger( event, data );
261	+
262	+ return !( $.isFunction(callback) &&
263	+ callback.call( this.element[0], event, data ) === false \|\|
264	+ event.isDefaultPrevented() );
265	+ }
266	+ };
267	+
268	+ })( jQuery );

js/post-message-part-background-color.js ADDED Viewed

	@@ -0,0 +1,5 @@


1	+ wp.customize( '@setting@', function( value ) {
2	+ value.bind( function( newval ) {
3	+ $('@selector@').css('background-color', newval );
4	+ } );
5	+ } );

js/post-message-part-border-color.js ADDED Viewed

	@@ -0,0 +1,5 @@


1	+ wp.customize( '@setting@', function( value ) {
2	+ value.bind( function( newval ) {
3	+ $('@selector@').css('@property@', newval );
4	+ } );
5	+ } );

js/post-message-part-color.js ADDED Viewed

	@@ -0,0 +1,5 @@


1	+ wp.customize( '@setting@', function( value ) {
2	+ value.bind( function( newval ) {
3	+ $('@selector@').css('color', newval );
4	+ } );
5	+ } );

js/post-message-part-text.js ADDED Viewed

	@@ -0,0 +1,5 @@


1	+ wp.customize( '@setting_font_size@', function( value ) {
2	+ value.bind( function( newval ) {
3	+ $('@selector@').css('font-size', newval + 'px' );
4	+ } );
5	+ } );

js/styles-customize-controls.js ADDED Viewed

	@@ -0,0 +1,44 @@


1	+ jQuery( document ).ready( function ( $ ) {
2	+
3	+ add_control_label_spans();
4	+ /**
5	+ * Wrap content after long-dash in span
6	+ */
7	+ function add_control_label_spans() {
8	+ // Long dash, not hyphen
9	+ var delimeter = '::';
10	+
11	+ $( 'span.customize-control-title:contains(' + delimeter + ')' ).each( function(){
12	+ var html, parts;
13	+
14	+ html = $(this).html();
15	+ parts = html.split( delimeter );
16	+
17	+ if ( 2 == parts.length ) {
18	+ html = parts[0] + '<span class="styles-type">' + parts[1] + '</span>';
19	+ $(this).html( html );
20	+ }
21	+
22	+ });
23	+ }
24	+
25	+ populate_google_fonts();
26	+ /**
27	+ * Copy array of google fonts into font select element
28	+ * Doing it this cuts about 200kb off of page load size
29	+ */
30	+ function populate_google_fonts() {
31	+ var google_families = { 'Abel': 'Abel', 'Aclonica': 'Aclonica', 'Actor': 'Actor', 'Allan': 'Allan:bold', 'Allerta': 'Allerta', 'Allerta Stencil': 'Allerta+Stencil', 'Amaranth': 'Amaranth:700,400,italic700,italic400', 'Andika': 'Andika', 'Angkor': 'Angkor', 'Annie Use Your Telescope': 'Annie+Use+Your+Telescope', 'Anonymous Pro': 'Anonymous+Pro:bold,italicbold,normal,italic', 'Anton': 'Anton', 'Architects Daughter': 'Architects+Daughter', 'Arimo': 'Arimo:italicbold,bold,normal,italic', 'Artifika': 'Artifika', 'Arvo': 'Arvo:italic,bold,italicbold,normal', 'Asset': 'Asset', 'Astloch': 'Astloch:normal,bold', 'Aubrey': 'Aubrey', 'Bangers': 'Bangers', 'Battambang': 'Battambang:bold,normal', 'Bayon': 'Bayon', 'Bentham': 'Bentham', 'Bevan': 'Bevan', 'Bigshot One': 'Bigshot+One', 'Black Ops One': 'Black+Ops+One', 'Bokor': 'Bokor', 'Bowlby One': 'Bowlby+One', 'Bowlby One SC': 'Bowlby+One+SC', 'Brawler': 'Brawler', 'Buda': 'Buda:300', 'Cabin': 'Cabin:italic600,500,italicbold,italic500,italic400,400,600,bold', 'Cabin Sketch': 'Cabin+Sketch:bold', 'Calligraffitti': 'Calligraffitti', 'Candal': 'Candal', 'Cantarell': 'Cantarell:italic,bold,italicbold,normal', 'Cardo': 'Cardo', 'Carme': 'Carme', 'Carter One': 'Carter+One', 'Caudex': 'Caudex:italic,italic700,400,700', 'Cedarville Cursive': 'Cedarville+Cursive', 'Chenla': 'Chenla', 'Cherry Cream Soda': 'Cherry+Cream+Soda', 'Chewy': 'Chewy', 'Coda': 'Coda:800', 'Coda Caption': 'Coda+Caption:800', 'Coming Soon': 'Coming+Soon', 'Content': 'Content:bold,normal', 'Copse': 'Copse', 'Corben': 'Corben:700', 'Comfortaa': 'Comfortaa', 'Cousine': 'Cousine:italic,normal,italicbold,bold', 'Covered By Your Grace': 'Covered+By+Your+Grace', 'Crafty Girls': 'Crafty+Girls', 'Crimson Text': 'Crimson+Text:700,italic400,400,italic600,italic700,600', 'Crushed': 'Crushed', 'Cuprum': 'Cuprum', 'Damion': 'Damion', 'Dancing Script': 'Dancing+Script:bold,normal', 'Dangrek': 'Dangrek', 'Dawning of a New Day': 'Dawning+of+a+New+Day', 'Delius': 'Delius:400', 'Delius Swash Caps': 'Delius+Swash+Caps:400', 'Delius Unicase': 'Delius+Unicase:400', 'Didact Gothic': 'Didact+Gothic', 'Droid Arabic Kufi': 'Droid+Arabic+Kufi:bold,normal', 'Droid Arabic Naskh': 'Droid+Arabic+Naskh:normal,bold', 'Droid Sans': 'Droid+Sans:bold,normal', 'Droid Sans Mono': 'Droid+Sans+Mono', 'Droid Sans Thai': 'Droid+Sans+Thai:bold,normal', 'Droid Serif': 'Droid+Serif:bold,normal,italicbold,italic', 'Droid Serif Thai': 'Droid+Serif+Thai:bold,normal', 'EB Garamond': 'EB+Garamond', 'Expletus Sans': 'Expletus+Sans:500,italic600,600,italic400,italic700,700,400,italic500', 'Federo': 'Federo', 'Fontdiner Swanky': 'Fontdiner+Swanky', 'Forum': 'Forum', 'Francois One': 'Francois+One', 'Freehand': 'Freehand', 'GFS Didot': 'GFS+Didot', 'GFS Neohellenic': 'GFS+Neohellenic:italic,italicbold,normal,bold', 'Gentium Basic': 'Gentium+Basic:italicbold,bold,normal,italic', 'Geo': 'Geo:normal,oblique', 'Geostar': 'Geostar', 'Geostar Fill': 'Geostar+Fill', 'Give You Glory': 'Give+You+Glory', 'Gloria Hallelujah': 'Gloria+Hallelujah', 'Goblin One': 'Goblin+One', 'Goudy Bookletter 1911': 'Goudy+Bookletter+1911', 'Gravitas One': 'Gravitas+One', 'Gruppo': 'Gruppo', 'Hammersmith One': 'Hammersmith+One', 'Hanuman': 'Hanuman:normal,bold', 'Holtwood One SC': 'Holtwood+One+SC', 'Homemade Apple': 'Homemade+Apple', 'IM Fell DW Pica': 'IM+Fell+DW+Pica:italic,normal', 'IM Fell DW Pica SC': 'IM+Fell+DW+Pica+SC', 'IM Fell Double Pica': 'IM+Fell+Double+Pica:normal,italic', 'IM Fell Double Pica SC': 'IM+Fell+Double+Pica+SC', 'IM Fell English': 'IM+Fell+English:italic,normal', 'IM Fell English SC': 'IM+Fell+English+SC', 'IM Fell French Canon': 'IM+Fell+French+Canon:italic,normal', 'IM Fell French Canon SC': 'IM+Fell+French+Canon+SC', 'IM Fell Great Primer': 'IM+Fell+Great+Primer:italic,normal', 'IM Fell Great Primer SC': 'IM+Fell+Great+Primer+SC', 'Inconsolata': 'Inconsolata', 'Indie Flower': 'Indie+Flower', 'Irish Grover': 'Irish+Grover', 'Irish Growler': 'Irish+Growler', 'Istok Web': 'Istok+Web:italic700,400,700,italic400', 'Josefin Sans': 'Josefin+Sans:italic600,italic100,600,italic400,700,italic700,100,italic300,400,300', 'Josefin Sans Std Light': 'Josefin+Sans+Std+Light', 'Josefin Slab': 'Josefin+Slab:100,italic600,700,italic400,600,italic100,italic300,300,400,italic700', 'Judson': 'Judson:700,italic400,400', 'Jura': 'Jura:400,500,600,300', 'Just Another Hand': 'Just+Another+Hand', 'Just Me Again Down Here': 'Just+Me+Again+Down+Here', 'Kameron': 'Kameron:400,700', 'Kelly Slab': 'Kelly+Slab', 'Kenia': 'Kenia', 'Khmer': 'Khmer', 'Koulen': 'Koulen', 'Kranky': 'Kranky', 'Kreon': 'Kreon:700,400,300', 'Kristi': 'Kristi', 'La Belle Aurore': 'La+Belle+Aurore', 'Lato': 'Lato:italic300,300,900,700,italic100,100,italic700,400,italic900,italic400', 'League Script': 'League+Script:400', 'Leckerli One': 'Leckerli+One', 'Lekton': 'Lekton:italic,400,700', 'Limelight': 'Limelight', 'Lobster': 'Lobster', 'Lobster Two': 'Lobster+Two:italic400,700,400,italic700', 'Lora': 'Lora:italic,normal,bold,italicbold', 'Love Ya Like A Sister': 'Love+Ya+Like+A+Sister', 'Loved by the King': 'Loved+by+the+King', 'Luckiest Guy': 'Luckiest+Guy', 'Maiden Orange': 'Maiden+Orange', 'Mako': 'Mako', 'Marvel': 'Marvel:400,700,italic700,italic400', 'Maven Pro': 'Maven+Pro:700,900,500,400', 'Meddon': 'Meddon', 'MedievalSharp': 'MedievalSharp', 'Megrim': 'Megrim', 'Merriweather': 'Merriweather:700,900,400,300', 'Metal': 'Metal', 'Metrophobic': 'Metrophobic', 'Miama': 'Miama', 'Michroma': 'Michroma', 'Miltonian': 'Miltonian', 'Miltonian Tattoo': 'Miltonian+Tattoo', 'Modern Antiqua': 'Modern+Antiqua', 'Molengo': 'Molengo', 'Monofett': 'Monofett', 'Moul': 'Moul', 'Moulpali': 'Moulpali', 'Mountains of Christmas': 'Mountains+of+Christmas', 'Muli': 'Muli:italic400,400,italic300,300', 'Nanum Brush Script': 'Nanum+Brush+Script', 'Nanum Gothic': 'Nanum+Gothic:800,700,normal', 'Nanum Gothic Coding': 'Nanum+Gothic+Coding:normal,700', 'Nanum Myeongjo': 'Nanum+Myeongjo:700,normal,800', 'Nanum Pen Script': 'Nanum+Pen+Script', 'Neucha': 'Neucha', 'Neuton': 'Neuton:italic,normal', 'Neuton Cursive': 'Neuton+Cursive', 'News Cycle': 'News+Cycle', 'Nixie One': 'Nixie+One', 'Nobile': 'Nobile:700,italic500,400,italic700,500,italic400', 'Nothing You Could Do': 'Nothing+You+Could+Do', 'Nova Cut': 'Nova+Cut', 'Nova Flat': 'Nova+Flat', 'Nova Mono': 'Nova+Mono', 'Nova Oval': 'Nova+Oval', 'Nova Round': 'Nova+Round', 'Nova Script': 'Nova+Script', 'Nova Slim': 'Nova+Slim', 'Nova Square': 'Nova+Square', 'Nunito': 'Nunito:700,300,400', 'OFL Sorts Mill Goudy TT': 'OFL+Sorts+Mill+Goudy+TT:italic,normal', 'OFL Sorts Mill Goudy TT': 'OFL+Sorts+Mill+Goudy+TT:italic,normal', 'Odor Mean Chey': 'Odor+Mean+Chey', 'Old Standard TT': 'Old+Standard+TT:italic,bold,normal', 'Open Sans': 'Open+Sans:italic300,italic800,600,300,italic400,italic600,italic700,700,800,400', 'Open Sans Condensed': 'Open+Sans+Condensed:italic300,300', 'Orbitron': 'Orbitron:500,900,400,700', 'Oswald': 'Oswald', 'Over the Rainbow': 'Over+the+Rainbow', 'Ovo': 'Ovo', 'PT Sans': 'PT+Sans:italic,bold,normal,italicbold', 'PT Sans Caption': 'PT+Sans+Caption:normal,bold', 'PT Sans Narrow': 'PT+Sans+Narrow:normal,bold', 'PT Serif': 'PT+Serif:italic,normal,bold,italicbold', 'PT Serif Caption': 'PT+Serif+Caption:normal,italic', 'Pacifico': 'Pacifico', 'Patrick Hand': 'Patrick+Hand', 'Paytone One': 'Paytone+One', 'Pecita': 'Pecita', 'Permanent Marker': 'Permanent+Marker', 'Philosopher': 'Philosopher:bold,normal,italic,italicbold', 'Play': 'Play:bold,normal', 'Playfair Display': 'Playfair+Display', 'Podkova': 'Podkova', 'Pompiere': 'Pompiere', 'Preahvihear': 'Preahvihear', 'Puritan': 'Puritan:bold,italic,italicbold,normal', 'Quattrocento': 'Quattrocento', 'Quattrocento Sans': 'Quattrocento+Sans', 'Radley': 'Radley', 'Raleway': 'Raleway:100', 'Rationale': 'Rationale', 'Redressed': 'Redressed', 'Reenie Beanie': 'Reenie+Beanie', 'Rochester': 'Rochester', 'Rock Salt': 'Rock+Salt', 'Rokkitt': 'Rokkitt:700,400', 'Rosario': 'Rosario', 'Ruslan Display': 'Ruslan+Display', 'Schoolbell': 'Schoolbell', 'Shadows Into Light': 'Shadows+Into+Light', 'Shanti': 'Shanti', 'Siamreap': 'Siamreap', 'Siemreap': 'Siemreap', 'Sigmar One': 'Sigmar+One', 'Six Caps': 'Six+Caps', 'Slackey': 'Slackey', 'Smokum': 'Smokum', 'Smythe': 'Smythe', 'Sniglet': 'Sniglet:800', 'Snippet': 'Snippet', 'Special Elite': 'Special+Elite', 'Stardos Stencil': 'Stardos+Stencil:normal,bold', 'Sue Ellen Francisco': 'Sue+Ellen+Francisco', 'Sunshiney': 'Sunshiney', 'Suwannaphum': 'Suwannaphum', 'Swanky and Moo Moo': 'Swanky+and+Moo+Moo', 'Syncopate': 'Syncopate:normal,bold', 'Tangerine': 'Tangerine:normal,bold', 'Taprom': 'Taprom', 'Tenor Sans': 'Tenor+Sans', 'Terminal Dosis Light': 'Terminal+Dosis+Light', 'Thabit': 'Thabit:italic,italicbold,normal,bold', 'The Girl Next Door': 'The+Girl+Next+Door', 'Tienne': 'Tienne:400,900,700', 'Tinos': 'Tinos:italicbold,normal,italic,bold', 'Tulpen One': 'Tulpen+One', 'Ubuntu': 'Ubuntu:bold,300,normal,italicbold,italic,italic500,500,italic300', 'Ultra': 'Ultra', 'UnifrakturCook': 'UnifrakturCook:bold', 'UnifrakturMaguntia': 'UnifrakturMaguntia', 'Unkempt': 'Unkempt', 'Unna': 'Unna', 'VT323': 'VT323', 'Varela': 'Varela', 'Varela Round': 'Varela+Round', 'Vibur': 'Vibur', 'Vollkorn': 'Vollkorn:bold,italic,italicbold,normal', 'Waiting for the Sunrise': 'Waiting+for+the+Sunrise', 'Wallpoet': 'Wallpoet', 'Walter Turncoat': 'Walter+Turncoat', 'Wire One': 'Wire+One', 'Yanone Kaffeesatz': 'Yanone+Kaffeesatz:700,200,400,300', 'Yellowtail': 'Yellowtail', 'Yeseva One': 'Yeseva+One', 'Zeyada': 'Zeyada', /'jsMath cmbx10': 'jsMath+cmbx10', 'jsMath cmex10': 'jsMath+cmex10', 'jsMath cmmi10': 'jsMath+cmmi10', 'jsMath cmr10': 'jsMath+cmr10', 'jsMath cmsy10': 'jsMath+cmsy10', 'jsMath cmti10': 'jsMath+cmti10',/ };
32	+ var google_options;
33	+
34	+ $.each( google_families, function( name, value ){
35	+ google_options += "<option value='" + name + "'>" + name + "</option>";
36	+ });
37	+
38	+ $( 'select.styles-font-family' ).append( google_options ).each( function(){
39	+ var selected = $(this).data('selected');
40	+ $(this).find( 'option[value="' + selected + '"]' ).attr('selected', 'selected');
41	+ } );
42	+ }
43	+
44	+ } );

phpunit.php ADDED Viewed

	@@ -0,0 +1,40 @@


1	+ <html>
2	+ <head>
3	+ <link href="//netdna.bootstrapcdn.com/twitter-bootstrap/2.2.2/css/bootstrap-combined.min.css" rel="stylesheet">
4	+ <style>
5	+ body { margin: 20px; }
6	+ </style>
7	+ </head>
8	+ <body>
9	+
10	+ <pre><?php
11	+
12	+ $remove = array(
13	+ '[37;41m[2K',
14	+ '[0m[2K',
15	+ '[0m',
16	+ '[31;1m',
17	+ '[30;42m[2K',
18	+ '[41;37m',
19	+ );
20	+
21	+ $phpunit = '/Applications/MAMP/bin/php/php5.3.14/bin/phpunit';
22	+ $config = dirname( __FILE__ ) . '/phpunit.xml';
23	+
24	+ exec( "$phpunit -c '$config'", $output );
25	+
26	+ $start = false;
27	+ foreach ( $output as $line ) {
28	+ if ( false !== strpos($line, 'phpunit.xml') ) {
29	+ $start = true;
30	+ $line = trim($line);
31	+ }
32	+ if ( true \|\| $start ) {
33	+ echo str_replace( $remove, '', $line) . '<br/>';
34	+ }
35	+ }
36	+ ?>
37	+ </pre>
38	+
39	+ </body>
40	+ </html>

phpunit.xml ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+
3	+ <phpunit backupGlobals="false"
4	+ backupStaticAttributes="false"
5	+ colors="true"
6	+ convertErrorsToExceptions="true"
7	+ convertNoticesToExceptions="true"
8	+ convertWarningsToExceptions="true"
9	+ processIsolation="false"
10	+ stopOnFailure="false"
11	+ syntaxCheck="false"
12	+ bootstrap="tests/bootstrap.php"
13	+ >
14	+ <testsuites>
15	+ <testsuite name="Styles Test Suite">
16	+ <directory suffix=".php">tests</directory>
17	+ </testsuite>
18	+ </testsuites>
19	+ </phpunit>

readme.txt CHANGED Viewed

@@ -1,128 +1,135 @@
-            -
            === Styles ===
-            -
            Contributors: brainstormmedia, pdclark
-            -
            Plugin URI: http://stylesplugin.com
-            -
            Author URI: http://brainstormmedia.com
-            -
            Donate link: https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=FD4GKBGQFUZC8
-            -
            Tags: css, stylesheet, scss, sass, scaffold, less, admin, gui, color picker, gradient, image upload, google fonts, user interface, twentyten, twentyeleven
-            -
            Requires at least: 3.1
-            -
            Tested up to: 3.4
-            -
            Stable tag: 0.5.3
-            -
-            -
            Change the appearance of supported themes using zero code. Creates appearance options for images, colors, gradients, and fonts.
-            -
-            -
            == Description ==
-            -
-            -
            **Note:** There are plans to modify this plugin to tie-in with the new WordPress 3.4 theme customizer, but it requires a considerable rewrite. The final version would setup the Theme Customizer based on CSS only. If you're interested in contributing, please get in contact.
-            -
-            -
            Styles allows you to edit the appearance of themes that don't provide an interface in the WordPress admin for doing so. Themes supported by the free version include:
-            -
-            -
            * TwentyTen
-            -
            * TwentyEleven
-            -
-            -
            Theme support is provided by a remote API, so support can be updated as more themes are added. We hope to release support for more themes as add-ons to Styles. Have a specific theme you'd like to see supported? [Vote on themes here](https://www.google.com/moderator/?authuser=2#16/e=1f6d0a).
-            -
-            -
            Styles provides:
-            -
-            -
            * Transfer of settings between themes
-            -
            * Background images using WordPress Media Library
-            -
            * Photoshop-like Gradient Picker
-            -
            * Color Picker
-            -
            * Google Fonts
-            -
            * Font size, color, styling, and capitalization
-            -
            * Replace HTML elements with an image
-            -
            * Live preview when site open in a second window
-            -
-            -
            Enable the plugin to start playing with your site's look under `Appearance > Styles`.
-            -
-            -
            Here's a quick demo of how it works in TwentyEleven:
-            -
-            -
            [youtube http://www.youtube.com/watch?v=2gbRFFxx1GY]
-            -
-            -
            This plugin requires [PHP 5.2](https://codex.wordpress.org/Switching_to_PHP5), the minimum supported version as of WordPress 3.2.
-            -
-            -
            == Installation ==
-            -
-            -
            1. Upload the `styles` folder to the `/wp-content/plugins/` directory
-            -
            1. Activate the plugin through the 'Plugins' menu in WordPress
-            -
            1. Start using the plugin under `Appearance > Styles`
-            -
            1. Preview your changes by opening your site an a second window.
-            -
-            -
            == Screenshots ==
-            -
-            -
            1. Select background images from the WordPress Media Library. Theme elements can also be replaced by images, e.g., Styles can hide the site title text and replace it with an image, and resize it to fit.
-            -
            2. Multi-stop gradient picker. Gradients are output in formats for all browsers, including Internet Explorer.
-            -
            3. Background color picker.
-            -
            4. Google Fonts and other typographic settings.
-            -
-            -
            == Frequently Asked Questions ==
-            -
-            -
            = What features do you plan to charge for? =
-            -
-            -
            Support for WordPress default themes, such as TwentyTen and TwentyEleven, will always be free. We plan to charge in the future for additional features such as:
-            -
-            -
            * Additional themes
-            -
            * Access to support forums
-            -
            * Documentation on how to setup custom themes or additional elements
-            -
-            -
            = Will this plugin slow down my site? =
-            -
-            -
            No! Styles is very careful about only loading what is absolutely required to get its job done. CSS settings are processed once when you click the "save" button. After that, all the work is done. A single compressed CSS file is all that's added to your site's front-end.
-            -
-            -
            = Styles says it can't write to a file when I try to save =
-            -
-            -
            That's not a question, but don't worry about it too much. If `wp-content/uploads` is not writable by the server, Styles will cache to the database instead. While caching to a file is ideal, there should not be a significant difference in performance.
-            -
-            -
            = How is WordPress able to interpret CSS this way? =
-            -
-            -
            Styles uses portions of Anthony Short's [Scaffold](https://github.com/anthonyshort/scaffold), which is a CSS pre-processor similar to Less, SASS, or Compass. Basically, Scaffold understands CSS and is written in PHP. WordPress is also written in PHP, so Scaffold is able to communicate to WordPress about the structure and content of CSS files.
-            -
-            -
            = Can I use Styles as a replacement for Less, Sass, or Compass? =
-            -
-            -
            For general purpose CSS processing, you'll be much better off using one of the many desktop-based libraries. We used Styles + Scaffold as our main CSS Processor for a very long time. However, the plugin as it exists today would not be appropriate for that purpose. We've pared the CSS processing libraries down to a bare minimum to keep things as simple and stable as possible. The plugin as it is today is meant only to create a theme user interface.
-            -
-            -
            == Changelog ==
-            -
-            -
            = 0.5.2 =
-            -
            * Fix display of icons in cases where WordPress is installed in a subdirectory or wp-content is moved. Fixes http://bit.ly/Jc7oyd
-            -
-            -
            = 0.5.1.1 =
-            -
            * Fix transparent background option
-            -
            * Fix display of unavailable theme options
-            -
-            -
            = 0.5.1 =
-            -
            * Fix issue that would prevent Font styles from outputting if another option wasn't set on the same element.
-            -
-            -
            = 0.5.0 =
-            -
            * Load themes from API: Allows for theme support to be added without plugin updates.
-            -
            * New data structure: Allow settings to migrate from theme to theme
-            -
            * Automatically rebuild CSS when theme is switched
-            -
            * Wrap font settings into other options. This sets the stage to simplify the user interface in a future version.
-            -
            * Add option to hide text and replace with image on any element
-            -
            * Expand TwentyTen options
-            -
            * Gradient Picker: Fix add marker, drag to remove marker
-            -
            * Massive code clean-up: Removed 1,198 lines of code; modified 2,488
-            -
            * Minor UI tweaks
-            -
-            -
            = 0.4.1 =
-            -
            * Fix saved CSS being one update behind
-            -
            * Fix initial values of fields & background color picker
-            -
            * Fix preview update stall
-            -
            * Fix background value when no image selected
-            -
            * Fix background replacement matching
-            -
-            -
            = 0.4.0 =
-            -
            * Initial public release.
-            -
-            -
            == Upgrade Notice ==
-            -
-            -
            = 0.5.3 =
-            -
            * Allow fonts to load over HTTP or HTTPS
-            -
-            -
            = 0.5.2 =
-            -
            * Fix transparent background option
-            -
            * Fix display of unavailable theme options
-            -
-            -
            == License ==
-            -
-            -
            Copyright 2011 Brainstorm Media - Released under the  GNU General Public License
-            -
             - [License details](http://www.gnu.org/licenses/gpl.html)


1	+ === Styles ===
2	+ Contributors: brainstormmedia, pdclark, elusivelight
3	+ Plugin URI: http://stylesplugin.com
4	+ Author URI: http://brainstormmedia.com
5	+ Tags: css, stylesheet, styles, appearance, customize, customizer, colors, color picker, images, image upload, background, fonts, google fonts, user interface, twentyten, twentyeleven, twentytwelve, twentythirteen
6	+ Requires at least: 3.4
7	+ Tested up to: 3.5.2
8	+ Stable tag: 1.0.4
9	+
10	+ Be creative with colors and fonts. Styles changes everything.
11	+
12	+
13	+ == Description ==
14	+
15	+ WordPress has lots of beautiful themes, but personalizing a design can be difficult and time-intensive. Styles changes that. Styles gives you creative control in one consistent interface – the WordPress theme customizer. Styles lets you make your site your own. :)
16	+
17	+ [Try a demo in TwentyTwelve](http://demo.stylesplugin.com/twentytwelve).
18	+
19	+ Features of the plugin include:
20	+
21	+ * Instant previews
22	+ * Text size
23	+ * Google Fonts
24	+ * Text colors
25	+ * Border colors
26	+ * Background colors
27	+ * Hundreds of options
28	+ * Consistent interface and names in every theme
29	+ * Built on WordPress customizer, so Styles grows as WordPress grows
30	+
31	+ Styles and options for all built-in WordPress themes are free. More themes are available at [StylesPlugin.com](http://stylesplugin.com).
32	+
33	+ Free Themes include:
34	+
35	+ * TwentyTen: [Plugin](http://wordpress.org/extend/plugins/styles-twentyten), [Demo](http://demo.stylesplugin.com/twentyten)
36	+ * TwentyEleven: [Plugin](http://wordpress.org/extend/plugins/styles-twentyeleven), [Demo](http://demo.stylesplugin.com/twentyeleven)
37	+ * TwentyTwelve: [Plugin](http://wordpress.org/extend/plugins/styles-twentytwelve), [Demo](http://demo.stylesplugin.com/twentytwelve)
38	+ * TwentyThirteen: [Plugin](http://wordpress.org/extend/plugins/styles-twentythirteen), [Demo](http://demo.stylesplugin.com/twentythirteen)
39	+
40	+ == Installation ==
41	+
42	+ 1. Upload the `styles` folder to the `/wp-content/plugins/` directory
43	+ 1. Activate the plugin through the 'Plugins' menu in WordPress
44	+ 1. Install an additional plugin for your current theme.
45	+ 1. Edit your site under `Appearance > Customize`
46	+
47	+ == Screenshots ==
48	+
49	+ 1. TwentyEleven header settings.
50	+ 2. All TwentyEleven sections.
51	+ 3. TwentyEleven menu settings.
52	+
53	+ == Frequently Asked Questions ==
54	+
55	+ = Why is this plugin free? =
56	+
57	+ We believe life is better when we work together. :) Support for WordPress default themes, like TwentyTwelve and TwentyThirteen, will always be free. Continued development in Styles will be supported by:
58	+
59	+ * Plugins for additional themes
60	+ * Plugins for add-on features
61	+ * Premium support and updates
62	+ * Documentation for using Styles in your own themes
63	+
64	+ = Does Styles support my theme? =
65	+
66	+ Maybe! We have additional themes available available at [StylesPlugin.com](http://stylesplugin.com). If you don't find your theme there, we also have documentation on how to create options using styles available for developers. Adding one option takes only one line of code.
67	+
68	+ = Will this plugin slow down my site? =
69	+
70	+ No! Styles is very careful about only loading what is needed to get its job done. Once you're done editing, stylesheets are cached and loaded for your sites users as quickly as possible.
71	+
72	+ == Changelog ==
73	+ = 1.0.4 =
74	+ * Fix: Correctly set outer background color
75	+
76	+ = 1.0.3 =
77	+ * Fix: Google fonts loading correctly once saved.
78	+
79	+ = 1.0.2 =
80	+ * Fix: Remove front-end PHP notice. (Minor; Only matters if WP_DEBUG is enabled.)
81	+
82	+ = 1.0.1 =
83	+ * Fix: Remove Customizer PHP notice. (Minor; Only matters if WP_DEBUG is enabled.)
84	+
85	+ = 1.0 =
86	+ * New: Completely rewrite Styles to use the WordPress Customizer API. Whew! That was a lot of work, but will allow us to grow closely with WordPress going forward.
87	+ * New: Styles 1.0 does not import 0.5.2 settings. However, you can always [reinstall Styles 0.5.3](http://downloads.wordpress.org/plugin/styles.0.5.3.zip) to get your old settings back.
88	+ * New: TwentyTwelve support.
89	+ * New: TwentyThirteen support.
90	+ * New: Remove gradients and background images. Sorry! We had to simpify and prioritize in the rewrite. If many users find Styles useful, we hope to bring these features back!
91	+ * New: Instant preview for many options using Customizer postMessage
92	+
93	+ = 0.5.2 =
94	+ * Fix: Display of icons in cases where WordPress is installed in a subdirectory or wp-content is moved. Fixes http://bit.ly/Jc7oyd
95	+
96	+ = 0.5.1.1 =
97	+ * Fix: Transparent background option
98	+ * Fix: Display of unavailable theme options
99	+
100	+ = 0.5.1 =
101	+ * Fix: Issue that would prevent Font styles from outputting if another option wasn't set on the same element.
102	+
103	+ = 0.5.0 =
104	+ * New: Load themes from API: Allows for theme support to be added without plugin updates.
105	+ * New: Data structure: Allow settings to migrate from theme to theme
106	+ * New: Automatically rebuild CSS when theme is switched
107	+ * New: Wrap font settings into other options. This sets the stage to simplify the user interface in a future version.
108	+ * New: Add option to hide text and replace with image on any element
109	+ * New: Expand TwentyTen options
110	+ * New: Gradient Picker: Fix add marker, drag to remove marker
111	+ * Fix: Massive code clean-up: Removed 1,198 lines of code; modified 2,488
112	+ * Fix: Minor UI tweaks
113	+
114	+ = 0.4.1 =
115	+ * Fix: Saved CSS being one update behind
116	+ * Fix: Initial values of fields & background color picker
117	+ * Fix: Preview update stall
118	+ * Fix: Background value when no image selected
119	+ * Fix: Background replacement matching
120	+
121	+ = 0.4.0 =
122	+ * Initial public release.
123	+
124	+ == Upgrade Notice ==
125	+
126	+ 1.0.4
127	+ * Fix: Correctly set outer background color.
128	+
129	+ 1.0.3
130	+ * Fix: Google fonts loading correctly once saved.
131	+
132	+ 1.0
133	+ Completely rewrote Styles to use the WordPress Customizer API. Whew! That was a lot of work, but will allow us to grow closely with WordPress going forward.
134	+
135	+ Styles 1.0 does not import 0.5.2 settings. However, you can always [reinstall Styles 0.5.3](http://downloads.wordpress.org/plugin/styles.0.5.3.zip) to get your old settings back.

screenshot-1.png CHANGED Viewed

Binary file

screenshot-2.png CHANGED Viewed

Binary file

screenshot-3.png CHANGED Viewed

Binary file

styles.php CHANGED Viewed

@@ -1,73 +1,49 @@
-            -
            <?php
-            -
            /*
-            -
            Plugin Name: Styles
-            -
            Plugin URI: http://stylesplugin.com
-            -
            Description: Change the appearance of your theme using the WordPress admin. Creates WordPress theme options for images, colors, gradients, and fonts.
-            -
            Version: 0.5.3
-            -
            Author: Brainstorm Media
-            -
            Author URI: http://brainstormmedia.com
-            -
            */
-            -
-            -
            /**
-            -
             * This plugin is made possible in part by code reuse from the following authors:
-            -
             *
-            -
             *   Anthony Short, Scaffold: https://github.com/anthonyshort/Scaffold
-            -
             *   Matt Martz (Sivel), Shadowbox: http://profiles.wordpress.org/sivel/
-            -
             *   Joost de Valk (Yoast), WordPress SEO: http://wordpress.org/extend/plugins/wordpress-seo/
-            -
             *
-            -
             * Thank you for being generous with your knowledge.
-            -
             *
-            -
             * - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
-            -
             *
-            -
             * Copyright 2010 Brainstorm Media
-            -
             *
-            -
             * This program is free software; you can redistribute it and/or modify
-            -
             * it under the terms of the GNU General Public License as published by
-            -
             * the Free Software Foundation; either version 2 of the License, or
-            -
             * (at your option) any later version.
-            -
             *
-            -
             * This program is distributed in the hope that it will be useful,
-            -
             * but WITHOUT ANY WARRANTY; without even the implied warranty of
-            -
             * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-            -
             * GNU General Public License for more details.
-            -
             *
-            -
             * You should have received a copy of the GNU General Public License
-            -
             * along with this program; if not, write to the Free Software
-            -
             * Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
-            -
             */
-            -
-            -
            /**
-            -
             * PHP version check based on WP SEO by Joost de Valk http://yoast.com/wordpress/seo/
-            -
             */
-            -
            if ( version_compare(PHP_VERSION, '5.2', '<') ) {
-            -
            	if ( is_admin() && (!defined('DOING_AJAX') || !DOING_AJAX) ) {
-            -
            		require_once ABSPATH.'/wp-admin/includes/plugin.php';
-            -
            		deactivate_plugins( __FILE__ );
-            -
            	   wp_die( sprintf( __('Styles requires PHP 5.2 or higher, as does WordPress 3.2 and higher. The plugin has now disabled itself. For more info, %s$1see this post%s$2.', 'Styles'), '<a href="http://codex.wordpress.org/Switching_to_PHP5">', '</a>') );
-            -
            	}
-            -
            }
-            -
-            -
            /**
-            -
             * Instantiate the $StormStyles object
-            -
             */
-            -
            function storm_styles_init() {
-            -
-            -
            	require dirname ( __FILE__ ) . '/classes/stormFirePHP/stormFirePHP.php';
-            -
            	require dirname ( __FILE__ ) . '/classes/storm-styles.php';
-            -
            	require dirname ( __FILE__ ) . '/classes/storm-wp-frontend.php';
-            -
-            -
            	if ( is_admin() || DOING_AJAX ) {
-            -
            		// Only load heavy files if we're in wp-admin or processing CSS over AJAX
-            -
            		require dirname ( __FILE__ ) . '/classes/storm-css-processor.php';
-            -
            		require dirname ( __FILE__ ) . '/classes/storm-wp-settings.php';
-            -
            		require dirname ( __FILE__ ) . '/classes/storm-wp-admin.php';
-            -
            	}
-            -
-            -
            	$storm_styles = new Storm_Styles();
-            -
-            -
            }
-            -
            add_action('init', 'storm_styles_init');
-            -
-            -
-            -
-            -


1	+ <?php
2	+ /*
3	+ Plugin Name: Styles
4	+ Plugin URI: http://stylesplugin.com
5	+ Description: Change the appearance of your theme using the WordPress admin. Creates WordPress theme options for images, colors, gradients, and fonts.
6	+ Version: 1.0.4
7	+ Author: Brainstorm Media
8	+ Author URI: http://brainstormmedia.com
9	+ Git URI: https://updates%40brainstormmedia.com:updates@bitbucket.org/brainstormmedia/styles.git
10	+ */
11	+
12	+ /**
13	+ * Copyright 2013 Brainstorm Media
14	+ *
15	+ * This program is free software; you can redistribute it and/or modify
16	+ * it under the terms of the GNU General Public License as published by
17	+ * the Free Software Foundation; either version 2 of the License, or
18	+ * (at your option) any later version.
19	+ *
20	+ * This program is distributed in the hope that it will be useful,
21	+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
22	+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
23	+ * GNU General Public License for more details.
24	+ *
25	+ * You should have received a copy of the GNU General Public License
26	+ * along with this program; if not, write to the Free Software
27	+ * Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
28	+ */
29	+
30	+ function styles_plugin_init() {
31	+ global $storm_styles;
32	+
33	+ if ( is_admin() ) {
34	+ global $wp_version;
35	+ $styles_exit_msg = esc_html__( 'Styles requires WordPress 3.4 or newer. <a href="http://codex.wordpress.org/Upgrading_WordPress">Please update.</a>', 'styles' );
36	+ if ( version_compare( $wp_version, "3.4", "<" ) ) {
37	+ exit( $styles_exit_msg );
38	+ }
39	+ }
40	+
41	+ if ( !defined( 'STYLES_BASENAME' ) ) define( 'STYLES_BASENAME', plugin_basename( __FILE__ ) );
42	+ if ( !defined( 'STYLES_DIR' ) ) define( 'STYLES_DIR', dirname( __FILE__ ) );
43	+
44	+ require dirname ( __FILE__ ) . '/classes/styles-plugin.php';
45	+
46	+ $storm_styles = new Styles_Plugin();
47	+
48	+ }
49	+ add_action( 'plugins_loaded', 'styles_plugin_init' );

tests/bootstrap.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ // Load WordPress test environment
3	+ // https://github.com/nb/wordpress-tests
4	+ //
5	+ // The path to wordpress-tests
6	+
7	+ $wordpress_tests = dirname( dirname( dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) ) ) . '/wordpress-tests/bootstrap.php';
8	+
9	+ if( file_exists( $wordpress_tests ) ) {
10	+ require_once $wordpress_tests;
11	+ } else {
12	+ exit( "Couldn't find path to wordpress-tests/bootstrap.php\n" );
13	+ }

tests/styles/init.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+
3	+ /**
4	+ * Test basic setup, like whether plugin is activated in test environment ;)
5	+ */
6	+ class Tests_Styles_Init extends WP_UnitTestCase {
7	+ /* Styles Object */
8	+ var $styles;
9	+
10	+ public function setUp() {
11	+ parent::setUp();
12	+ global $storm_styles;
13	+ $this->styles = $storm_styles;
14	+ }
15	+
16	+ public function test_is_plugin_active() {
17	+ include_once( ABSPATH . 'wp-admin/includes/plugin.php' );
18	+ $this->assertTrue( is_plugin_active( STYLES_BASENAME ) );
19	+ }
20	+
21	+ public function test_is_plugin_initialized() {
22	+ $this->assertFalse( null == $this->styles );
23	+ }
24	+
25	+ public function test_styles_version_matches_plugin_header() {
26	+ $data = get_plugin_data( WP_PLUGIN_DIR .'/'. STYLES_BASENAME, false, false);
27	+ $this->assertEquals( $data['Version'], $this->styles->version );
28	+ }
29	+
30	+ }

tests/styles/tests-styles-customize.php ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ <?php
2	+
3	+ class Tests_Styles_Customize extends WP_UnitTestCase {
4	+
5	+ public function setUp() {
6	+ parent::setUp();
7	+ if ( !class_exists( 'Styles_Customize' ) ) {
8	+ require_once WP_PLUGIN_DIR . '/' . dirname( STYLES_BASENAME ) . '/classes/styles-customize.php';
9	+ }
10	+ }
11	+
12	+ public function test_get_settings_not_empty() {
13	+ $settings = Styles_Customize::get_settings();
14	+ $this->assertFalse( empty( $settings ) );
15	+ }
16	+
17	+ /*
18	+ public function test_load_settings_from_theme_file() {
19	+ // Move customize.json if it exists
20	+ // Write a known customize.json
21	+ // Test that it reads
22	+ // Move original back
23	+ }
24	+ */
25	+
26	+ }

tests/styles/tests-styles-plugin.php ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ <?php
2	+
3	+ class Tests_Styles_Plugin extends WP_UnitTestCase {
4	+
5	+ /**
6	+ * Require that storm-styles appears in head
7	+ */
8	+ public function test_wp_head_outputs_css() {
9	+ ob_start();
10	+ @do_action( 'wp_head' );
11	+ $wp_head = ob_get_clean();
12	+
13	+ $this->assertFalse( false === strpos( $wp_head, 'storm-styles') );
14	+ }
15	+
16	+ }

uninstall.php CHANGED Viewed

@@ -1,21 +1,35 @@
-            -
            <?php
-            -
            /**
-            -
             * Uninstalls the Styles options when an uninstall has been requested
-            -
             * from the WordPress admin
-            -
             */
-            -
-            -
            // If uninstall/delete not called from WordPress then exit
-            -
            if( ! defined ( 'ABSPATH' ) && ! defined ( 'WP_UNINSTALL_PLUGIN' ) )
-            -
            	exit();
-            -
-            -
            // Delete shadowbox option from options table
-            -
            delete_option ( 'styles' );
-            -
            delete_option ( 'styles-preview' );
-            -
            delete_option ( 'styles-cache' );
-            -
            delete_option ( 'styles-settings' );
-            -
-            -
            // Remove files
-            -
            $upload_dir = wp_upload_dir();
-            -
            $styles_dir = "{$upload_dir['basedir']}/styles/";
-            -
            if ( is_dir ( $styles_dir ) )
-            -
            	@rmdir ( $styles_dir );


1	+ <?php
2	+ /**
3	+ * Uninstalls the Styles options when an uninstall has been requested
4	+ * from the WordPress admin
5	+ */
6	+
7	+ // If uninstall/delete not called from WordPress then exit
8	+ if( ! defined ( 'ABSPATH' ) && ! defined ( 'WP_UNINSTALL_PLUGIN' ) )
9	+ exit;
10	+
11	+
12	+ global $wpdb;
13	+
14	+ $sql = "DELETE from $wpdb->options WHERE option_name LIKE 'storm-styles-%'";
15	+
16	+ if( is_multisite() ){
17	+
18	+ // Site network: remove options from each blog
19	+ $blog_ids = $wpdb->get_col( "SELECT blog_id FROM $wpdb->blogs" );
20	+ if( $blog_ids ){
21	+
22	+ foreach( $blog_ids as $id ) {
23	+ switch_to_blog( $id );
24	+
25	+ $wpdb->query( $sql );
26	+
27	+ restore_current_blog();
28	+ }
29	+
30	+ }
31	+
32	+ }else {
33	+ // Single site
34	+ $wpdb->query( $sql );
35	+ }

views/licenses.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <div class="wrap">
2	+
3	+ <h2><?php _e('Styles Licenses'); ?></h2>
4	+
5	+ <?php foreach ( apply_filters( 'styles_license_form_plugins', array() ) as $plugin ) : ?>
6	+
7	+ <?php
8	+ $name = $license_option_key = null;
9	+ extract( $plugin, EXTR_IF_EXISTS );
10	+
11	+ $license = get_option( $license_option_key );
12	+ $status = get_option( $license_option_key . '_status' );
13	+ ?>
14	+
15	+ <h3><?php echo $name ?></h3>
16	+ <form method="post" action="options.php">
17	+
18	+ <?php settings_fields('styles_licenses'); ?>
19	+
20	+ <table class="form-table">
21	+ <tbody>
22	+ <tr valign="top">
23	+ <th scope="row" valign="top">
24	+ <?php _e('License Key'); ?>
25	+ </th>
26	+ <td>
27	+ <input id="<?php esc_attr_e( $license_option_key ); ?>" name="<?php esc_attr_e( $license_option_key ); ?>" type="text" class="regular-text" value="<?php esc_attr_e( $license ); ?>" />
28	+ <label class="description" for="<?php esc_attr_e( $license_option_key ); ?>"><?php _e('Enter your license key'); ?></label>
29	+ </td>
30	+ </tr>
31	+ <?php if( false !== $license ) : ?>
32	+
33	+ <tr valign="top">
34	+ <th scope="row" valign="top">
35	+ <?php _e('Activate License'); ?>
36	+ </th>
37	+ <td>
38	+ <?php if( $status !== false && $status == 'valid' ) : ?>
39	+
40	+ <?php wp_nonce_field( 'edd_sample_nonce', 'edd_sample_nonce' ); ?>
41	+
42	+ <span style="color:green;"><?php _e('active'); ?></span>
43	+ <input type="submit" class="button-secondary" name="edd_license_deactivate" value="<?php _e('Deactivate License'); ?>"/>
44	+
45	+ <?php else : ?>
46	+
47	+ <?php wp_nonce_field( 'edd_sample_nonce', 'edd_sample_nonce' ); ?>
48	+
49	+ <input type="submit" class="button-secondary" name="edd_license_activate" value="<?php _e('Activate License'); ?>"/>
50	+
51	+ <?php endif; ?>
52	+ </td>
53	+ </tr>
54	+
55	+ <?php endif; ?>
56	+
57	+ </tbody>
58	+ </table>
59	+ <?php submit_button(); ?>
60	+ </form>
61	+
62	+ <?php endforeach; ?>