Version Description
- SAFE UPDATE: No data loss for those upgrading from version 1.0 or higher
- Bug fix on update
Download this release
Release Info
| Developer | spwebguy |
| Plugin |  Team Members |
| Version | 2.0.1 |
| Comparing to | |
| See all releases | |
Code changes from version 1.3.1 to 2.0.1
- cmb2/bootstrap.php +61 -0
- cmb2/css/cmb2.css +2928 -0
- cmb2/css/cmb2.css.map +7 -0
- cmb2/css/cmb2.min.css +1 -0
- cmb2/css/index.php +0 -0
- cmb2/css/sass/cmb2.scss +14 -0
- cmb2/css/sass/index.php +0 -0
- cmb2/css/sass/partials/_collapsible_ui.scss +52 -0
- cmb2/css/sass/partials/_jquery_ui.scss +289 -0
- cmb2/css/sass/partials/_main_wrap.scss +438 -0
- cmb2/css/sass/partials/_misc.scss +20 -0
- cmb2/css/sass/partials/_mixins.scss +40 -0
- cmb2/css/sass/partials/_post_metaboxes.scss +114 -0
- cmb2/css/sass/partials/_sidebar_placements.scss +153 -0
- cmb2/css/sass/partials/_timepicker.scss +40 -0
- cmb2/css/sass/partials/_variables.scss +22 -0
- cmb2/css/sass/partials/index.php +0 -0
- cmb2/images/ico-delete.png +0 -0
- cmb2/images/index.php +0 -0
- cmb2/images/ui-bg_flat_0_aaaaaa_40x100.png +0 -0
- cmb2/images/ui-bg_flat_75_ffffff_40x100.png +0 -0
- cmb2/images/ui-bg_glass_55_fbf9ee_1x400.png +0 -0
- cmb2/images/ui-bg_glass_65_ffffff_1x400.png +0 -0
- cmb2/images/ui-bg_glass_75_dadada_1x400.png +0 -0
- cmb2/images/ui-bg_glass_75_e6e6e6_1x400.png +0 -0
- cmb2/images/ui-bg_glass_95_fef1ec_1x400.png +0 -0
- cmb2/images/ui-bg_highlight-soft_75_cccccc_1x100.png +0 -0
- cmb2/images/ui-icons_222222_256x240.png +0 -0
- cmb2/images/ui-icons_2e83ff_256x240.png +0 -0
- cmb2/images/ui-icons_454545_256x240.png +0 -0
- cmb2/images/ui-icons_888888_256x240.png +0 -0
- cmb2/images/ui-icons_cd0a0a_256x240.png +0 -0
- cmb2/includes/CMB2.php +859 -0
- cmb2/includes/CMB2_Ajax.php +209 -0
- cmb2/includes/CMB2_Boxes.php +36 -0
- cmb2/includes/CMB2_Field.php +892 -0
- cmb2/includes/CMB2_Options.php +178 -0
- cmb2/includes/CMB2_Sanitize.php +376 -0
- cmb2/includes/CMB2_Show_Filters.php +168 -0
- cmb2/includes/CMB2_Types.php +962 -0
- cmb2/includes/CMB2_Utils.php +181 -0
- cmb2/includes/CMB2_hookup.php +395 -0
- cmb2/includes/helper-functions.php +283 -0
- cmb2/includes/index.php +0 -0
- cmb2/index.php +0 -0
- cmb2/init.php +78 -0
- cmb2/js/cmb2.js +891 -0
- cmb2/js/cmb2.min.js +1 -0
- cmb2/js/index.php +0 -0
- cmb2/js/jquery.timePicker.min.js +13 -0
- css/admin_de_style.css +88 -0
- css/admin_de_style.min.css +1 -0
- css/tmm_custom_style.css +4 -1
- css/tmm_custom_style.min.css +1 -1
- drkfr/Gruntfile.js +0 -39
- drkfr/class.drkfr-meta-box.php +0 -379
- drkfr/classes.fields.php +0 -1675
- drkfr/css/dist/drkfr.css +0 -63
- drkfr/css/dist/drkfr.min.css +0 -63
- drkfr/css/legacy.css +0 -319
- drkfr/css/src/file.css +0 -166
- drkfr/css/src/generic.css +0 -55
- drkfr/css/src/group.css +0 -82
- drkfr/css/src/layout.css +0 -57
- drkfr/css/src/misc-fields.css +0 -71
- drkfr/css/src/repeatable.css +0 -88
- drkfr/css/src/sortable.css +0 -40
- drkfr/css/vendor/jquery-ui/images/animated-overlay.gif +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_flat_0_aaaaaa_40x100.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_flat_75_ffffff_40x100.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_glass_55_fbf9ee_1x400.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_glass_65_ffffff_1x400.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_glass_75_dadada_1x400.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_glass_75_e6e6e6_1x400.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_glass_95_fef1ec_1x400.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-icons_222222_256x240.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-icons_2e83ff_256x240.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-icons_454545_256x240.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-icons_888888_256x240.png +0 -0
- drkfr/css/vendor/jquery-ui/images/ui-icons_cd0a0a_256x240.png +0 -0
- drkfr/css/vendor/jquery-ui/jquery-ui.css +0 -1175
- drkfr/css/vendor/jquery-ui/jquery-ui.min.css +0 -5
- drkfr/css/vendor/jquery-ui/jquery.ui.theme.css +0 -406
- drkfr/custom-meta-boxes.php +0 -136
- drkfr/fields-anywhere.php +0 -92
- drkfr/images/drkfr-icon-remove.png +0 -0
- drkfr/images/drkfr-icon-remove@2x.png +0 -0
- drkfr/images/wpspin-2x.gif +0 -0
- drkfr/images/wpspin.gif +0 -0
- drkfr/js/drkfr.js +0 -315
- drkfr/js/field-gmap.js +0 -93
- drkfr/js/field-wysiwyg.js +0 -106
- drkfr/js/field.colorpicker.js +0 -18
- drkfr/js/field.datetime.js +0 -47
- drkfr/js/field.select.js +0 -29
- drkfr/js/file-upload.js +0 -129
- drkfr/js/jquery.timePicker.min.js +0 -20
- drkfr/js/vendor/select2/.bower.json +0 -25
- drkfr/js/vendor/select2/.gitignore +0 -2
- drkfr/js/vendor/select2/LICENSE +0 -18
- drkfr/js/vendor/select2/README.md +0 -99
- drkfr/js/vendor/select2/bower.json +0 -8
- drkfr/js/vendor/select2/component.json +0 -66
- drkfr/js/vendor/select2/composer.json +0 -29
- drkfr/js/vendor/select2/package.json +0 -20
- drkfr/js/vendor/select2/release.sh +0 -79
- drkfr/js/vendor/select2/select2-bootstrap.css +0 -87
- drkfr/js/vendor/select2/select2-spinner.gif +0 -0
- drkfr/js/vendor/select2/select2.css +0 -704
- drkfr/js/vendor/select2/select2.jquery.json +0 -36
- drkfr/js/vendor/select2/select2.js +0 -3508
- drkfr/js/vendor/select2/select2.min.js +0 -23
- drkfr/js/vendor/select2/select2.png +0 -0
- drkfr/js/vendor/select2/select2_locale_ar.js +0 -19
- drkfr/js/vendor/select2/select2_locale_az.js +0 -20
- drkfr/js/vendor/select2/select2_locale_bg.js +0 -20
- drkfr/js/vendor/select2/select2_locale_ca.js +0 -19
- drkfr/js/vendor/select2/select2_locale_cs.js +0 -51
- drkfr/js/vendor/select2/select2_locale_da.js +0 -19
- drkfr/js/vendor/select2/select2_locale_de.js +0 -18
- drkfr/js/vendor/select2/select2_locale_el.js +0 -19
- drkfr/js/vendor/select2/select2_locale_en.js.template +0 -20
- drkfr/js/vendor/select2/select2_locale_es.js +0 -17
- drkfr/js/vendor/select2/select2_locale_et.js +0 -19
- drkfr/js/vendor/select2/select2_locale_eu.js +0 -45
- drkfr/js/vendor/select2/select2_locale_fa.js +0 -21
- drkfr/js/vendor/select2/select2_locale_fi.js +0 -30
- drkfr/js/vendor/select2/select2_locale_fr.js +0 -18
- drkfr/js/vendor/select2/select2_locale_gl.js +0 -45
- drkfr/js/vendor/select2/select2_locale_he.js +0 -19
- drkfr/js/vendor/select2/select2_locale_hr.js +0 -24
- drkfr/js/vendor/select2/select2_locale_hu.js +0 -17
- drkfr/js/vendor/select2/select2_locale_id.js +0 -19
- drkfr/js/vendor/select2/select2_locale_is.js +0 -17
- drkfr/js/vendor/select2/select2_locale_it.js +0 -17
- drkfr/js/vendor/select2/select2_locale_ja.js +0 -17
- drkfr/js/vendor/select2/select2_locale_ka.js +0 -19
- drkfr/js/vendor/select2/select2_locale_ko.js +0 -19
- drkfr/js/vendor/select2/select2_locale_lt.js +0 -26
- drkfr/js/vendor/select2/select2_locale_lv.js +0 -19
- drkfr/js/vendor/select2/select2_locale_mk.js +0 -19
- drkfr/js/vendor/select2/select2_locale_ms.js +0 -19
- drkfr/js/vendor/select2/select2_locale_nl.js +0 -17
- drkfr/js/vendor/select2/select2_locale_no.js +0 -20
- drkfr/js/vendor/select2/select2_locale_pl.js +0 -25
- drkfr/js/vendor/select2/select2_locale_pt-BR.js +0 -17
- drkfr/js/vendor/select2/select2_locale_pt-PT.js +0 -17
- drkfr/js/vendor/select2/select2_locale_ro.js +0 -17
- drkfr/js/vendor/select2/select2_locale_rs.js +0 -19
- drkfr/js/vendor/select2/select2_locale_ru.js +0 -23
- drkfr/js/vendor/select2/select2_locale_sk.js +0 -50
- drkfr/js/vendor/select2/select2_locale_sv.js +0 -19
- drkfr/js/vendor/select2/select2_locale_th.js +0 -19
- drkfr/js/vendor/select2/select2_locale_tr.js +0 -19
- drkfr/js/vendor/select2/select2_locale_ug-CN.js +0 -16
- drkfr/js/vendor/select2/select2_locale_uk.js +0 -25
- drkfr/js/vendor/select2/select2_locale_vi.js +0 -20
- drkfr/js/vendor/select2/select2_locale_zh-CN.js +0 -16
- drkfr/js/vendor/select2/select2_locale_zh-TW.js +0 -16
- drkfr/js/vendor/select2/select2x2.png +0 -0
- drkfr/phpunit.xml +0 -14
- readme.txt +14 -1
- tmm.php +498 -177
cmb2/bootstrap.php
ADDED
|
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Helper function to provide directory path to CMB
|
| 5 |
+
* @since 2.0.0
|
| 6 |
+
* @param string $path Path to append
|
| 7 |
+
* @return string Directory with optional path appended
|
| 8 |
+
*/
|
| 9 |
+
function cmb2_dir( $path = '' ) {
|
| 10 |
+
static $cmb2_dir = null;
|
| 11 |
+
if ( is_null( $cmb2_dir ) ) {
|
| 12 |
+
$cmb2_dir = trailingslashit( dirname( __FILE__ ) );
|
| 13 |
+
}
|
| 14 |
+
return $cmb2_dir . $path;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* Include helper functions,
|
| 19 |
+
* and more importantly, the class/file autoloader
|
| 20 |
+
*/
|
| 21 |
+
require_once cmb2_dir( 'includes/helper-functions.php' );
|
| 22 |
+
|
| 23 |
+
/**
|
| 24 |
+
* Fires when CMB2 is included/loaded
|
| 25 |
+
*
|
| 26 |
+
* Should be used to to add metaboxes. See example-functions.php
|
| 27 |
+
*/
|
| 28 |
+
do_action( 'cmb2_init' );
|
| 29 |
+
|
| 30 |
+
/**
|
| 31 |
+
* For back-compat. Does the dirtywork of instantiatiating all the
|
| 32 |
+
* CMB2 instances for the cmb2_meta_boxes filter
|
| 33 |
+
* @since 2.0.2
|
| 34 |
+
*/
|
| 35 |
+
$all_meta_boxes_config = apply_filters( 'cmb2_meta_boxes', array() );
|
| 36 |
+
foreach ( (array) $all_meta_boxes_config as $meta_box_config ) {
|
| 37 |
+
new CMB2( $meta_box_config );
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
/**
|
| 41 |
+
* Fires after all CMB2 instances are created
|
| 42 |
+
*/
|
| 43 |
+
do_action( 'cmb2_init_before_hookup' );
|
| 44 |
+
|
| 45 |
+
/**
|
| 46 |
+
* Get all created metaboxes, and instantiate CMB2_hookup
|
| 47 |
+
* on metaboxes which require it.
|
| 48 |
+
* @since 2.0.2
|
| 49 |
+
*/
|
| 50 |
+
foreach ( CMB2_Boxes::get_all() as $cmb ) {
|
| 51 |
+
if ( $cmb->prop( 'hookup' ) ) {
|
| 52 |
+
$hookup = new CMB2_hookup( $cmb );
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
/**
|
| 57 |
+
* Fires after CMB2 initiation process has been completed
|
| 58 |
+
*/
|
| 59 |
+
do_action( 'cmb2_after_init' );
|
| 60 |
+
|
| 61 |
+
// End. That's it, folks! //
|
cmb2/css/cmb2.css
ADDED
|
@@ -0,0 +1,2928 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* CMB Styling
|
| 3 |
+
*/
|
| 4 |
+
|
| 5 |
+
/*--------------------------------------------------------------
|
| 6 |
+
Main Wrap
|
| 7 |
+
--------------------------------------------------------------*/
|
| 8 |
+
|
| 9 |
+
/* line 5, sass/partials/_main_wrap.scss */
|
| 10 |
+
|
| 11 |
+
.cmb2-wrap {
|
| 12 |
+
margin: 0;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
/* line 8, sass/partials/_main_wrap.scss */
|
| 16 |
+
|
| 17 |
+
.cmb2-wrap input,
|
| 18 |
+
.cmb2-wrap textarea {
|
| 19 |
+
font-size: 14px;
|
| 20 |
+
max-width: 100%;
|
| 21 |
+
padding: 5px;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
/* line 18, sass/partials/_main_wrap.scss */
|
| 25 |
+
|
| 26 |
+
.cmb2-wrap input[type=text].cmb2-oembed {
|
| 27 |
+
width: 100%;
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
/* line 23, sass/partials/_main_wrap.scss */
|
| 31 |
+
|
| 32 |
+
.cmb2-wrap textarea {
|
| 33 |
+
width: 500px;
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
/* line 26, sass/partials/_main_wrap.scss */
|
| 37 |
+
|
| 38 |
+
.cmb2-wrap textarea.cmb2-textarea-code {
|
| 39 |
+
font-family: "Courier 10 Pitch", Courier, monospace;
|
| 40 |
+
line-height: 16px;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
/* line 34, sass/partials/_main_wrap.scss */
|
| 44 |
+
|
| 45 |
+
.cmb2-wrap input.cmb2-text-small,
|
| 46 |
+
.cmb2-wrap input.cmb2-timepicker {
|
| 47 |
+
width: 100px;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
/* line 40, sass/partials/_main_wrap.scss */
|
| 51 |
+
|
| 52 |
+
.cmb2-wrap input.cmb2-text-money {
|
| 53 |
+
width: 90px;
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
/* line 45, sass/partials/_main_wrap.scss */
|
| 57 |
+
|
| 58 |
+
.cmb2-wrap input.cmb2-text-medium {
|
| 59 |
+
width: 230px;
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
/* line 50, sass/partials/_main_wrap.scss */
|
| 63 |
+
|
| 64 |
+
.cmb2-wrap input.cmb2-upload-file {
|
| 65 |
+
width: 65%;
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
/* line 54, sass/partials/_main_wrap.scss */
|
| 69 |
+
|
| 70 |
+
.cmb2-wrap input.ed_button {
|
| 71 |
+
padding: 2px 4px;
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
/* line 59, sass/partials/_main_wrap.scss */
|
| 75 |
+
|
| 76 |
+
.cmb2-wrap input:not([type="hidden"]) + input,
|
| 77 |
+
.cmb2-wrap input:not([type="hidden"]) + .button,
|
| 78 |
+
.cmb2-wrap input:not([type="hidden"]) + select {
|
| 79 |
+
margin-left: 20px;
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
/* line 67, sass/partials/_main_wrap.scss */
|
| 83 |
+
|
| 84 |
+
.cmb2-wrap ul {
|
| 85 |
+
margin: 0;
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
/* line 71, sass/partials/_main_wrap.scss */
|
| 89 |
+
|
| 90 |
+
.cmb2-wrap li {
|
| 91 |
+
font-size: 14px;
|
| 92 |
+
line-height: 16px;
|
| 93 |
+
margin: 1px 0 5px 0;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
/* line 82, sass/partials/_main_wrap.scss */
|
| 97 |
+
|
| 98 |
+
.cmb2-wrap select {
|
| 99 |
+
font-size: 14px;
|
| 100 |
+
margin-top: 3px;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
/* line 87, sass/partials/_main_wrap.scss */
|
| 104 |
+
|
| 105 |
+
.cmb2-wrap input:focus,
|
| 106 |
+
.cmb2-wrap textarea:focus {
|
| 107 |
+
background: #fffff8;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
/* line 92, sass/partials/_main_wrap.scss */
|
| 111 |
+
|
| 112 |
+
.cmb2-wrap input[type="radio"] {
|
| 113 |
+
margin: 0 5px 0 0;
|
| 114 |
+
padding: 0;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
/* line 97, sass/partials/_main_wrap.scss */
|
| 118 |
+
|
| 119 |
+
.cmb2-wrap input[type="checkbox"] {
|
| 120 |
+
margin: 0 5px 0 0;
|
| 121 |
+
padding: 0;
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
/* line 102, sass/partials/_main_wrap.scss */
|
| 125 |
+
|
| 126 |
+
.cmb2-wrap button,
|
| 127 |
+
.cmb2-wrap .button {
|
| 128 |
+
white-space: nowrap;
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
/* line 107, sass/partials/_main_wrap.scss */
|
| 132 |
+
|
| 133 |
+
.cmb2-wrap .mceLayout {
|
| 134 |
+
border: 1px solid #e9e9e9 !important;
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
/* line 111, sass/partials/_main_wrap.scss */
|
| 138 |
+
|
| 139 |
+
.cmb2-wrap .mceIframeContainer {
|
| 140 |
+
background: #fff;
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
/* line 115, sass/partials/_main_wrap.scss */
|
| 144 |
+
|
| 145 |
+
.cmb2-wrap .meta_mce {
|
| 146 |
+
width: 97%;
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
/* line 118, sass/partials/_main_wrap.scss */
|
| 150 |
+
|
| 151 |
+
.cmb2-wrap .meta_mce textarea {
|
| 152 |
+
width: 100%;
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
/* line 126, sass/partials/_main_wrap.scss */
|
| 156 |
+
|
| 157 |
+
.cmb2-wrap .wp-color-result,
|
| 158 |
+
.cmb2-wrap .wp-picker-input-wrap {
|
| 159 |
+
vertical-align: middle;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
/* line 131, sass/partials/_main_wrap.scss */
|
| 163 |
+
|
| 164 |
+
.cmb2-wrap .wp-color-result,
|
| 165 |
+
.cmb2-wrap .wp-picker-container {
|
| 166 |
+
margin: 0 10px 0 0;
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
/* line 136, sass/partials/_main_wrap.scss */
|
| 170 |
+
|
| 171 |
+
.cmb2-wrap .cmb-row {
|
| 172 |
+
margin: 0;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
/* line 139, sass/partials/_main_wrap.scss */
|
| 176 |
+
|
| 177 |
+
.cmb2-wrap .cmb-row:after {
|
| 178 |
+
content: '';
|
| 179 |
+
clear: both;
|
| 180 |
+
display: block;
|
| 181 |
+
width: 100%;
|
| 182 |
+
}
|
| 183 |
+
|
| 184 |
+
/* line 146, sass/partials/_main_wrap.scss */
|
| 185 |
+
|
| 186 |
+
.cmb2-wrap .cmb-row.cmb-repeat-row {
|
| 187 |
+
padding: 1.8em 0 0;
|
| 188 |
+
}
|
| 189 |
+
|
| 190 |
+
/* line 149, sass/partials/_main_wrap.scss */
|
| 191 |
+
|
| 192 |
+
.cmb2-wrap .cmb-row.cmb-repeat-row:first-of-type {
|
| 193 |
+
padding: 0;
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
/* line 154, sass/partials/_main_wrap.scss */
|
| 197 |
+
|
| 198 |
+
.cmb2-wrap .cmb-row.cmb-repeat .cmb2-metabox-description {
|
| 199 |
+
padding-top: 0;
|
| 200 |
+
padding-bottom: 1.8em;
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
/* line 161, sass/partials/_main_wrap.scss */
|
| 204 |
+
|
| 205 |
+
.cmb2-metabox {
|
| 206 |
+
clear: both;
|
| 207 |
+
margin: 0;
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
/* line 167, sass/partials/_main_wrap.scss */
|
| 211 |
+
|
| 212 |
+
.cmb2-metabox > .cmb-row:first-of-type > .cmb-td,
|
| 213 |
+
.cmb2-metabox > .cmb-row:first-of-type > .cmb-th,
|
| 214 |
+
.cmb2-metabox .cmb-field-list > .cmb-row:first-of-type > .cmb-td,
|
| 215 |
+
.cmb2-metabox .cmb-field-list > .cmb-row:first-of-type > .cmb-th {
|
| 216 |
+
border: 0;
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
/* line 174, sass/partials/_main_wrap.scss */
|
| 220 |
+
|
| 221 |
+
.cmb2-metabox > .cmb-row .cmb-repeat-table .cmb-row > .cmb-td {
|
| 222 |
+
padding-right: 20px;
|
| 223 |
+
box-sizing: border-box;
|
| 224 |
+
float: left;
|
| 225 |
+
}
|
| 226 |
+
|
| 227 |
+
/* line 182, sass/partials/_main_wrap.scss */
|
| 228 |
+
|
| 229 |
+
.cmb-add-row {
|
| 230 |
+
margin: 1.8em 0 0;
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
/* line 186, sass/partials/_main_wrap.scss */
|
| 234 |
+
|
| 235 |
+
.cmb-nested .cmb-td,
|
| 236 |
+
.cmb-repeatable-group .cmb-th,
|
| 237 |
+
.cmb-repeatable-group:first-of-type {
|
| 238 |
+
border: 0;
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
/* line 192, sass/partials/_main_wrap.scss */
|
| 242 |
+
|
| 243 |
+
.cmb-row:last-of-type,
|
| 244 |
+
.cmb2-wrap .cmb-row:last-of-type,
|
| 245 |
+
.cmb-repeatable-group:last-of-type {
|
| 246 |
+
border-bottom: 0;
|
| 247 |
+
}
|
| 248 |
+
|
| 249 |
+
/* line 198, sass/partials/_main_wrap.scss */
|
| 250 |
+
|
| 251 |
+
.cmb-repeatable-grouping {
|
| 252 |
+
border: 1px solid #e9e9e9;
|
| 253 |
+
padding: 0 1em;
|
| 254 |
+
max-width: 1000px;
|
| 255 |
+
}
|
| 256 |
+
|
| 257 |
+
/* line 202, sass/partials/_main_wrap.scss */
|
| 258 |
+
|
| 259 |
+
.cmb-repeatable-grouping.cmb-row {
|
| 260 |
+
margin: 0 0 0.8em;
|
| 261 |
+
}
|
| 262 |
+
|
| 263 |
+
/* line 209, sass/partials/_main_wrap.scss */
|
| 264 |
+
|
| 265 |
+
.cmb-th {
|
| 266 |
+
color: #222222;
|
| 267 |
+
float: left;
|
| 268 |
+
font-weight: 600;
|
| 269 |
+
line-height: 1.3;
|
| 270 |
+
padding: 20px 10px 20px 0;
|
| 271 |
+
vertical-align: top;
|
| 272 |
+
width: 200px;
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
+
/* line 223, sass/partials/_main_wrap.scss */
|
| 276 |
+
|
| 277 |
+
.cmb-td {
|
| 278 |
+
line-height: 1.3;
|
| 279 |
+
max-width: 100%;
|
| 280 |
+
padding: 15px 10px;
|
| 281 |
+
vertical-align: middle;
|
| 282 |
+
}
|
| 283 |
+
|
| 284 |
+
/* line 232, sass/partials/_main_wrap.scss */
|
| 285 |
+
|
| 286 |
+
.cmb-type-title .cmb-td {
|
| 287 |
+
padding: 0;
|
| 288 |
+
}
|
| 289 |
+
|
| 290 |
+
/* line 237, sass/partials/_main_wrap.scss */
|
| 291 |
+
|
| 292 |
+
.cmb-th label {
|
| 293 |
+
display: block;
|
| 294 |
+
padding: 5px 0;
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
/* line 242, sass/partials/_main_wrap.scss */
|
| 298 |
+
|
| 299 |
+
.cmb-th + .cmb-td {
|
| 300 |
+
float: left;
|
| 301 |
+
}
|
| 302 |
+
|
| 303 |
+
/* line 246, sass/partials/_main_wrap.scss */
|
| 304 |
+
|
| 305 |
+
.cmb-td .cmb-td {
|
| 306 |
+
padding-bottom: 1em;
|
| 307 |
+
}
|
| 308 |
+
|
| 309 |
+
/* line 250, sass/partials/_main_wrap.scss */
|
| 310 |
+
|
| 311 |
+
.cmb-remove-row {
|
| 312 |
+
text-align: right;
|
| 313 |
+
}
|
| 314 |
+
|
| 315 |
+
/* line 254, sass/partials/_main_wrap.scss */
|
| 316 |
+
|
| 317 |
+
.empty-row.hidden {
|
| 318 |
+
display: none;
|
| 319 |
+
}
|
| 320 |
+
|
| 321 |
+
/* line 260, sass/partials/_main_wrap.scss */
|
| 322 |
+
|
| 323 |
+
.cmb-repeatable-group .cmb-th {
|
| 324 |
+
padding: 5px;
|
| 325 |
+
}
|
| 326 |
+
|
| 327 |
+
/* line 264, sass/partials/_main_wrap.scss */
|
| 328 |
+
|
| 329 |
+
.cmb-repeatable-group .cmb-group-title {
|
| 330 |
+
background-color: #e9e9e9;
|
| 331 |
+
padding: 8px 12px 8px 2.2em;
|
| 332 |
+
margin: 0 -1em;
|
| 333 |
+
min-height: 1.5em;
|
| 334 |
+
font-size: 14px;
|
| 335 |
+
line-height: 1.4;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
/* line 272, sass/partials/_main_wrap.scss */
|
| 339 |
+
|
| 340 |
+
.cmb-repeatable-group .cmb-group-title h4 {
|
| 341 |
+
border: 0;
|
| 342 |
+
margin: 0;
|
| 343 |
+
font-size: 1.2em;
|
| 344 |
+
font-weight: 500;
|
| 345 |
+
padding: 0.5em 0.75em;
|
| 346 |
+
}
|
| 347 |
+
|
| 348 |
+
/* line 280, sass/partials/_main_wrap.scss */
|
| 349 |
+
|
| 350 |
+
.cmb-repeatable-group .cmb-group-title .cmb-th {
|
| 351 |
+
display: block;
|
| 352 |
+
width: 100%;
|
| 353 |
+
}
|
| 354 |
+
|
| 355 |
+
/* line 286, sass/partials/_main_wrap.scss */
|
| 356 |
+
|
| 357 |
+
.cmb-repeatable-group .cmb-group-description .cmb-th {
|
| 358 |
+
font-size: 1.2em;
|
| 359 |
+
display: block;
|
| 360 |
+
float: none;
|
| 361 |
+
padding-bottom: 1em;
|
| 362 |
+
text-align: left;
|
| 363 |
+
width: 100%;
|
| 364 |
+
}
|
| 365 |
+
|
| 366 |
+
/* line 27, sass/partials/_mixins.scss */
|
| 367 |
+
|
| 368 |
+
.cmb-repeatable-group .cmb-group-description .cmb-th label {
|
| 369 |
+
display: block;
|
| 370 |
+
margin-top: 0em;
|
| 371 |
+
padding-bottom: 5px;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
/* line 32, sass/partials/_mixins.scss */
|
| 375 |
+
|
| 376 |
+
.cmb-repeatable-group .cmb-group-description .cmb-th label:after {
|
| 377 |
+
border-bottom: 1px solid #e9e9e9;
|
| 378 |
+
content: '';
|
| 379 |
+
clear: both;
|
| 380 |
+
display: block;
|
| 381 |
+
padding-top: .4em;
|
| 382 |
+
}
|
| 383 |
+
|
| 384 |
+
/* line 290, sass/partials/_main_wrap.scss */
|
| 385 |
+
|
| 386 |
+
.cmb-repeatable-group .cmb-shift-rows {
|
| 387 |
+
font-size: 1em;
|
| 388 |
+
margin-right: 1em;
|
| 389 |
+
text-decoration: none;
|
| 390 |
+
}
|
| 391 |
+
|
| 392 |
+
/* line 295, sass/partials/_main_wrap.scss */
|
| 393 |
+
|
| 394 |
+
.cmb-repeatable-group .cmb-shift-rows .dashicons {
|
| 395 |
+
font-size: 1.5em;
|
| 396 |
+
height: 1.5em;
|
| 397 |
+
line-height: 1.2em;
|
| 398 |
+
width: 1em;
|
| 399 |
+
}
|
| 400 |
+
|
| 401 |
+
/* line 301, sass/partials/_main_wrap.scss */
|
| 402 |
+
|
| 403 |
+
.cmb-repeatable-group .cmb-shift-rows .dashicons.dashicons-arrow-down-alt2 {
|
| 404 |
+
line-height: 1.3em;
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
/* line 308, sass/partials/_main_wrap.scss */
|
| 408 |
+
|
| 409 |
+
.cmb-repeatable-group .cmb2-upload-button {
|
| 410 |
+
float: right;
|
| 411 |
+
}
|
| 412 |
+
|
| 413 |
+
/* line 314, sass/partials/_main_wrap.scss */
|
| 414 |
+
|
| 415 |
+
p.cmb2-metabox-description {
|
| 416 |
+
color: #aaaaaa;
|
| 417 |
+
font-style: italic;
|
| 418 |
+
margin: 0;
|
| 419 |
+
padding-top: .5em;
|
| 420 |
+
}
|
| 421 |
+
|
| 422 |
+
/* line 321, sass/partials/_main_wrap.scss */
|
| 423 |
+
|
| 424 |
+
span.cmb2-metabox-description {
|
| 425 |
+
color: #aaaaaa;
|
| 426 |
+
font-style: italic;
|
| 427 |
+
}
|
| 428 |
+
|
| 429 |
+
/* line 326, sass/partials/_main_wrap.scss */
|
| 430 |
+
|
| 431 |
+
.cmb2-metabox-title {
|
| 432 |
+
margin: 0 0 5px 0;
|
| 433 |
+
padding: 5px 0 0 0;
|
| 434 |
+
font-size: 14px;
|
| 435 |
+
}
|
| 436 |
+
|
| 437 |
+
/* line 332, sass/partials/_main_wrap.scss */
|
| 438 |
+
|
| 439 |
+
.cmb-inline ul {
|
| 440 |
+
padding: 4px 0 0 0;
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
/* line 336, sass/partials/_main_wrap.scss */
|
| 444 |
+
|
| 445 |
+
.cmb-inline li {
|
| 446 |
+
display: inline-block;
|
| 447 |
+
padding-right: 18px;
|
| 448 |
+
}
|
| 449 |
+
|
| 450 |
+
/* line 341, sass/partials/_main_wrap.scss */
|
| 451 |
+
|
| 452 |
+
.cmb-type-textarea-code pre {
|
| 453 |
+
margin: 0;
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
/* line 347, sass/partials/_main_wrap.scss */
|
| 457 |
+
|
| 458 |
+
.cmb2-media-status .img-status {
|
| 459 |
+
clear: none;
|
| 460 |
+
display: inline-block;
|
| 461 |
+
float: left;
|
| 462 |
+
margin-right: 10px;
|
| 463 |
+
width: auto;
|
| 464 |
+
}
|
| 465 |
+
|
| 466 |
+
/* line 354, sass/partials/_main_wrap.scss */
|
| 467 |
+
|
| 468 |
+
.cmb2-media-status .img-status img {
|
| 469 |
+
max-width: 350px;
|
| 470 |
+
}
|
| 471 |
+
|
| 472 |
+
/* line 359, sass/partials/_main_wrap.scss */
|
| 473 |
+
|
| 474 |
+
.cmb2-media-status .img-status img,
|
| 475 |
+
.cmb2-media-status .embed-status {
|
| 476 |
+
background: #ffffff;
|
| 477 |
+
border: 1px solid #e9e9e9;
|
| 478 |
+
border-radius: 2px;
|
| 479 |
+
-moz-border-radius: 2px;
|
| 480 |
+
margin: 15px 0 0 0;
|
| 481 |
+
padding: 5px;
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
/* line 369, sass/partials/_main_wrap.scss */
|
| 485 |
+
|
| 486 |
+
.cmb2-media-status .embed-status {
|
| 487 |
+
float: left;
|
| 488 |
+
max-width: 800px;
|
| 489 |
+
}
|
| 490 |
+
|
| 491 |
+
/* line 374, sass/partials/_main_wrap.scss */
|
| 492 |
+
|
| 493 |
+
.cmb2-media-status .img-status,
|
| 494 |
+
.cmb2-media-status .embed-status {
|
| 495 |
+
position: relative;
|
| 496 |
+
}
|
| 497 |
+
|
| 498 |
+
/* line 377, sass/partials/_main_wrap.scss */
|
| 499 |
+
|
| 500 |
+
.cmb2-media-status .img-status .cmb2-remove-file-button,
|
| 501 |
+
.cmb2-media-status .embed-status .cmb2-remove-file-button {
|
| 502 |
+
background: url(../images/ico-delete.png);
|
| 503 |
+
height: 16px;
|
| 504 |
+
left: -5px;
|
| 505 |
+
position: absolute;
|
| 506 |
+
text-indent: -9999px;
|
| 507 |
+
top: -5px;
|
| 508 |
+
width: 16px;
|
| 509 |
+
}
|
| 510 |
+
|
| 511 |
+
/* line 391, sass/partials/_main_wrap.scss */
|
| 512 |
+
|
| 513 |
+
.cmb2-media-status .img-status .cmb2-remove-file-button {
|
| 514 |
+
top: 10px;
|
| 515 |
+
}
|
| 516 |
+
|
| 517 |
+
/* line 396, sass/partials/_main_wrap.scss */
|
| 518 |
+
|
| 519 |
+
.cmb2-media-status .img-status img,
|
| 520 |
+
.cmb2-media-status .file-status > span {
|
| 521 |
+
cursor: pointer;
|
| 522 |
+
}
|
| 523 |
+
|
| 524 |
+
/* line 402, sass/partials/_main_wrap.scss */
|
| 525 |
+
|
| 526 |
+
.cmb-type-file-list .cmb2-media-status .img-status {
|
| 527 |
+
clear: none;
|
| 528 |
+
float: left;
|
| 529 |
+
margin-right: 10px;
|
| 530 |
+
width: auto;
|
| 531 |
+
}
|
| 532 |
+
|
| 533 |
+
/* line 409, sass/partials/_main_wrap.scss */
|
| 534 |
+
|
| 535 |
+
.cmb-attach-list li {
|
| 536 |
+
clear: both;
|
| 537 |
+
display: inline-block;
|
| 538 |
+
margin-bottom: 25px;
|
| 539 |
+
width: 100%;
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
/* line 415, sass/partials/_main_wrap.scss */
|
| 543 |
+
|
| 544 |
+
.cmb-attach-list li img {
|
| 545 |
+
cursor: move;
|
| 546 |
+
float: left;
|
| 547 |
+
margin-right: 10px;
|
| 548 |
+
}
|
| 549 |
+
|
| 550 |
+
/* line 422, sass/partials/_main_wrap.scss */
|
| 551 |
+
|
| 552 |
+
.cmb2-remove-wrapper {
|
| 553 |
+
margin: 0;
|
| 554 |
+
}
|
| 555 |
+
|
| 556 |
+
/* line 426, sass/partials/_main_wrap.scss */
|
| 557 |
+
|
| 558 |
+
.child-cmb2 .cmb-th {
|
| 559 |
+
text-align: left;
|
| 560 |
+
}
|
| 561 |
+
|
| 562 |
+
/*--------------------------------------------------------------
|
| 563 |
+
Timepicker
|
| 564 |
+
--------------------------------------------------------------*/
|
| 565 |
+
|
| 566 |
+
/* line 7, sass/partials/_timepicker.scss */
|
| 567 |
+
|
| 568 |
+
div.time-picker {
|
| 569 |
+
background: #fff;
|
| 570 |
+
border: 1px solid #aaaaaa;
|
| 571 |
+
height: 191px;
|
| 572 |
+
margin: 0;
|
| 573 |
+
position: absolute;
|
| 574 |
+
overflow: auto;
|
| 575 |
+
width: 6em; /* needed for IE */
|
| 576 |
+
z-index: 99;
|
| 577 |
+
}
|
| 578 |
+
|
| 579 |
+
/* line 17, sass/partials/_timepicker.scss */
|
| 580 |
+
|
| 581 |
+
div.time-picker ul {
|
| 582 |
+
list-style-type: none;
|
| 583 |
+
margin: 0;
|
| 584 |
+
padding: 0;
|
| 585 |
+
}
|
| 586 |
+
|
| 587 |
+
/* line 23, sass/partials/_timepicker.scss */
|
| 588 |
+
|
| 589 |
+
div.time-picker li {
|
| 590 |
+
cursor: pointer;
|
| 591 |
+
margin-bottom: 0;
|
| 592 |
+
font-family: sans-serif;
|
| 593 |
+
font-size: 14px;
|
| 594 |
+
padding: 4px 3px;
|
| 595 |
+
}
|
| 596 |
+
|
| 597 |
+
/* line 30, sass/partials/_timepicker.scss */
|
| 598 |
+
|
| 599 |
+
div.time-picker li.selected {
|
| 600 |
+
background: #0063ce;
|
| 601 |
+
color: #fff;
|
| 602 |
+
}
|
| 603 |
+
|
| 604 |
+
/* line 37, sass/partials/_timepicker.scss */
|
| 605 |
+
|
| 606 |
+
div.time-picker-12hours {
|
| 607 |
+
width: 8em; /* needed for IE */
|
| 608 |
+
}
|
| 609 |
+
|
| 610 |
+
/*--------------------------------------------------------------
|
| 611 |
+
Post Metaboxes
|
| 612 |
+
--------------------------------------------------------------*/
|
| 613 |
+
|
| 614 |
+
/* line 4, sass/partials/_post_metaboxes.scss */
|
| 615 |
+
|
| 616 |
+
#poststuff .cmb-group-title {
|
| 617 |
+
margin-left: -1em;
|
| 618 |
+
margin-right: -1em;
|
| 619 |
+
padding-left: 2.2em;
|
| 620 |
+
min-height: 1.5em;
|
| 621 |
+
}
|
| 622 |
+
|
| 623 |
+
/* line 14, sass/partials/_post_metaboxes.scss */
|
| 624 |
+
|
| 625 |
+
.postbox-container .cmb2-wrap,
|
| 626 |
+
.cmb-repeat-group-wrap .cmb2-wrap {
|
| 627 |
+
margin: 0;
|
| 628 |
+
}
|
| 629 |
+
|
| 630 |
+
/* line 17, sass/partials/_post_metaboxes.scss */
|
| 631 |
+
|
| 632 |
+
.postbox-container .cmb2-wrap > .cmb-field-list > .cmb-row,
|
| 633 |
+
.cmb-repeat-group-wrap .cmb2-wrap > .cmb-field-list > .cmb-row {
|
| 634 |
+
padding: 1.8em 0;
|
| 635 |
+
}
|
| 636 |
+
|
| 637 |
+
/* line 23, sass/partials/_post_metaboxes.scss */
|
| 638 |
+
|
| 639 |
+
.postbox-container .cmb2-wrap input[type=text].cmb2-oembed,
|
| 640 |
+
.cmb-repeat-group-wrap .cmb2-wrap input[type=text].cmb2-oembed {
|
| 641 |
+
width: 100%;
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
/* line 29, sass/partials/_post_metaboxes.scss */
|
| 645 |
+
|
| 646 |
+
.postbox-container .cmb-row,
|
| 647 |
+
.cmb-repeat-group-wrap .cmb-row {
|
| 648 |
+
padding: 0 0 1.8em;
|
| 649 |
+
margin: 0 0 0.8em;
|
| 650 |
+
}
|
| 651 |
+
|
| 652 |
+
/* line 33, sass/partials/_post_metaboxes.scss */
|
| 653 |
+
|
| 654 |
+
.postbox-container .cmb-row .cmbhandle,
|
| 655 |
+
.cmb-repeat-group-wrap .cmb-row .cmbhandle {
|
| 656 |
+
right: -1em;
|
| 657 |
+
position: relative;
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
/* line 39, sass/partials/_post_metaboxes.scss */
|
| 661 |
+
|
| 662 |
+
.postbox-container .cmb-repeatable-grouping,
|
| 663 |
+
.cmb-repeat-group-wrap .cmb-repeatable-grouping {
|
| 664 |
+
padding: 0 1em;
|
| 665 |
+
max-width: 100%;
|
| 666 |
+
min-width: 1px !important;
|
| 667 |
+
}
|
| 668 |
+
|
| 669 |
+
/* line 45, sass/partials/_post_metaboxes.scss */
|
| 670 |
+
|
| 671 |
+
.postbox-container .cmb-repeatable-group > .cmb-row,
|
| 672 |
+
.cmb-repeat-group-wrap .cmb-repeatable-group > .cmb-row {
|
| 673 |
+
padding-bottom: 0;
|
| 674 |
+
}
|
| 675 |
+
|
| 676 |
+
/* line 49, sass/partials/_post_metaboxes.scss */
|
| 677 |
+
|
| 678 |
+
.postbox-container .cmb-th,
|
| 679 |
+
.cmb-repeat-group-wrap .cmb-th {
|
| 680 |
+
width: 18%;
|
| 681 |
+
padding: 0 2% 0 0;
|
| 682 |
+
}
|
| 683 |
+
|
| 684 |
+
/* line 55, sass/partials/_post_metaboxes.scss */
|
| 685 |
+
|
| 686 |
+
.postbox-container .cmb-td,
|
| 687 |
+
.cmb-repeat-group-wrap .cmb-td {
|
| 688 |
+
margin-bottom: 0;
|
| 689 |
+
padding: 0;
|
| 690 |
+
line-height: 1.3;
|
| 691 |
+
}
|
| 692 |
+
|
| 693 |
+
/* line 61, sass/partials/_post_metaboxes.scss */
|
| 694 |
+
|
| 695 |
+
.postbox-container .cmb-repeat-row .cmb-td,
|
| 696 |
+
.cmb-repeat-group-wrap .cmb-repeat-row .cmb-td {
|
| 697 |
+
padding-bottom: 1.8em;
|
| 698 |
+
}
|
| 699 |
+
|
| 700 |
+
/* line 65, sass/partials/_post_metaboxes.scss */
|
| 701 |
+
|
| 702 |
+
.postbox-container .cmb-th + .cmb-td,
|
| 703 |
+
.cmb-repeat-group-wrap .cmb-th + .cmb-td {
|
| 704 |
+
width: 80%;
|
| 705 |
+
float: right;
|
| 706 |
+
}
|
| 707 |
+
|
| 708 |
+
/* line 70, sass/partials/_post_metaboxes.scss */
|
| 709 |
+
|
| 710 |
+
.postbox-container .cmb-row:not(:last-of-type),
|
| 711 |
+
.postbox-container .cmb-repeatable-group:not(:last-of-type),
|
| 712 |
+
.cmb-repeat-group-wrap .cmb-row:not(:last-of-type),
|
| 713 |
+
.cmb-repeat-group-wrap .cmb-repeatable-group:not(:last-of-type) {
|
| 714 |
+
border-bottom: 1px solid #e9e9e9;
|
| 715 |
+
}
|
| 716 |
+
|
| 717 |
+
/* line 79, sass/partials/_post_metaboxes.scss */
|
| 718 |
+
|
| 719 |
+
.postbox-container .cmb-repeat-group-field,
|
| 720 |
+
.postbox-container .cmb-remove-field-row,
|
| 721 |
+
.cmb-repeat-group-wrap .cmb-repeat-group-field,
|
| 722 |
+
.cmb-repeat-group-wrap .cmb-remove-field-row {
|
| 723 |
+
padding-top: 1.8em;
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
/* line 86, sass/partials/_post_metaboxes.scss */
|
| 727 |
+
|
| 728 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody,
|
| 729 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody,
|
| 730 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody,
|
| 731 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody {
|
| 732 |
+
display: table;
|
| 733 |
+
width: 100%;
|
| 734 |
+
}
|
| 735 |
+
|
| 736 |
+
/* line 90, sass/partials/_post_metaboxes.scss */
|
| 737 |
+
|
| 738 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,
|
| 739 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,
|
| 740 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,
|
| 741 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text {
|
| 742 |
+
width: 100%;
|
| 743 |
+
}
|
| 744 |
+
|
| 745 |
+
/* line 94, sass/partials/_post_metaboxes.scss */
|
| 746 |
+
|
| 747 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),
|
| 748 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),
|
| 749 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),
|
| 750 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row) {
|
| 751 |
+
display: table-row;
|
| 752 |
+
}
|
| 753 |
+
|
| 754 |
+
/* line 98, sass/partials/_post_metaboxes.scss */
|
| 755 |
+
|
| 756 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,
|
| 757 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,
|
| 758 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,
|
| 759 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td {
|
| 760 |
+
display: table-cell;
|
| 761 |
+
float: none;
|
| 762 |
+
width: 100%;
|
| 763 |
+
}
|
| 764 |
+
|
| 765 |
+
/* line 104, sass/partials/_post_metaboxes.scss */
|
| 766 |
+
|
| 767 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,
|
| 768 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,
|
| 769 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,
|
| 770 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td {
|
| 771 |
+
padding-top: 1.8em;
|
| 772 |
+
}
|
| 773 |
+
|
| 774 |
+
/* line 108, sass/partials/_post_metaboxes.scss */
|
| 775 |
+
|
| 776 |
+
.postbox-container .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,
|
| 777 |
+
.postbox-container .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,
|
| 778 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,
|
| 779 |
+
.cmb-repeat-group-wrap .cmb2-metabox > .cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row {
|
| 780 |
+
padding-right: 0;
|
| 781 |
+
}
|
| 782 |
+
|
| 783 |
+
/*--------------------------------------------------------------
|
| 784 |
+
Misc.
|
| 785 |
+
--------------------------------------------------------------*/
|
| 786 |
+
|
| 787 |
+
/* line 5, sass/partials/_misc.scss */
|
| 788 |
+
|
| 789 |
+
#poststuff .cmb-repeatable-group h2 {
|
| 790 |
+
margin: 0;
|
| 791 |
+
}
|
| 792 |
+
|
| 793 |
+
/* line 13, sass/partials/_misc.scss */
|
| 794 |
+
|
| 795 |
+
.edit-tags-php .cmb2-metabox-title,
|
| 796 |
+
.profile-php .cmb2-metabox-title,
|
| 797 |
+
.user-edit-php .cmb2-metabox-title {
|
| 798 |
+
font-size: 1.4em;
|
| 799 |
+
}
|
| 800 |
+
|
| 801 |
+
/* line 18, sass/partials/_misc.scss */
|
| 802 |
+
|
| 803 |
+
.postbox .cmb-spinner {
|
| 804 |
+
float: left;
|
| 805 |
+
}
|
| 806 |
+
|
| 807 |
+
/*--------------------------------------------------------------
|
| 808 |
+
Sidebar Placement Adjustments
|
| 809 |
+
--------------------------------------------------------------*/
|
| 810 |
+
|
| 811 |
+
/* line 10, sass/partials/_sidebar_placements.scss */
|
| 812 |
+
|
| 813 |
+
.inner-sidebar .cmb2-wrap > .cmb-field-list > .cmb-row,
|
| 814 |
+
#side-sortables .cmb2-wrap > .cmb-field-list > .cmb-row {
|
| 815 |
+
padding: 1.4em 0;
|
| 816 |
+
}
|
| 817 |
+
|
| 818 |
+
/* line 16, sass/partials/_sidebar_placements.scss */
|
| 819 |
+
|
| 820 |
+
.inner-sidebar .cmb2-wrap input[type=text]:not(.wp-color-picker),
|
| 821 |
+
#side-sortables .cmb2-wrap input[type=text]:not(.wp-color-picker) {
|
| 822 |
+
width: 100%;
|
| 823 |
+
}
|
| 824 |
+
|
| 825 |
+
/* line 20, sass/partials/_sidebar_placements.scss */
|
| 826 |
+
|
| 827 |
+
.inner-sidebar .cmb2-wrap input + input:not(.wp-picker-clear),
|
| 828 |
+
.inner-sidebar .cmb2-wrap input + select,
|
| 829 |
+
#side-sortables .cmb2-wrap input + input:not(.wp-picker-clear),
|
| 830 |
+
#side-sortables .cmb2-wrap input + select {
|
| 831 |
+
margin-left: 0;
|
| 832 |
+
margin-top: 1em;
|
| 833 |
+
display: block;
|
| 834 |
+
}
|
| 835 |
+
|
| 836 |
+
/* line 27, sass/partials/_sidebar_placements.scss */
|
| 837 |
+
|
| 838 |
+
.inner-sidebar .cmb2-wrap label,
|
| 839 |
+
#side-sortables .cmb2-wrap label {
|
| 840 |
+
display: block;
|
| 841 |
+
font-weight: 700;
|
| 842 |
+
padding: 0 0 5px;
|
| 843 |
+
}
|
| 844 |
+
|
| 845 |
+
/* line 35, sass/partials/_sidebar_placements.scss */
|
| 846 |
+
|
| 847 |
+
.inner-sidebar .cmb-repeatable-group,
|
| 848 |
+
#side-sortables .cmb-repeatable-group {
|
| 849 |
+
border-bottom: 1px solid #e9e9e9;
|
| 850 |
+
}
|
| 851 |
+
|
| 852 |
+
/* line 39, sass/partials/_sidebar_placements.scss */
|
| 853 |
+
|
| 854 |
+
.inner-sidebar .cmb-repeat-group-wrap > .cmb-td > .cmb-repeatable-group,
|
| 855 |
+
#side-sortables .cmb-repeat-group-wrap > .cmb-td > .cmb-repeatable-group {
|
| 856 |
+
border-bottom: 0;
|
| 857 |
+
margin-bottom: -1.4em;
|
| 858 |
+
}
|
| 859 |
+
|
| 860 |
+
/* line 44, sass/partials/_sidebar_placements.scss */
|
| 861 |
+
|
| 862 |
+
.inner-sidebar .cmb-th,
|
| 863 |
+
.inner-sidebar .cmb-td,
|
| 864 |
+
.inner-sidebar .cmb-th + .cmb-td,
|
| 865 |
+
#side-sortables .cmb-th,
|
| 866 |
+
#side-sortables .cmb-td,
|
| 867 |
+
#side-sortables .cmb-th + .cmb-td {
|
| 868 |
+
width: 100%;
|
| 869 |
+
display: block;
|
| 870 |
+
float: none;
|
| 871 |
+
}
|
| 872 |
+
|
| 873 |
+
/* line 52, sass/partials/_sidebar_placements.scss */
|
| 874 |
+
|
| 875 |
+
.inner-sidebar .closed .inside,
|
| 876 |
+
#side-sortables .closed .inside {
|
| 877 |
+
display: none;
|
| 878 |
+
}
|
| 879 |
+
|
| 880 |
+
/* line 56, sass/partials/_sidebar_placements.scss */
|
| 881 |
+
|
| 882 |
+
.inner-sidebar .cmb-td .cmb-td,
|
| 883 |
+
#side-sortables .cmb-td .cmb-td {
|
| 884 |
+
padding-bottom: 1em;
|
| 885 |
+
}
|
| 886 |
+
|
| 887 |
+
/* line 60, sass/partials/_sidebar_placements.scss */
|
| 888 |
+
|
| 889 |
+
.inner-sidebar .cmb-th,
|
| 890 |
+
#side-sortables .cmb-th {
|
| 891 |
+
display: block;
|
| 892 |
+
float: none;
|
| 893 |
+
padding-bottom: 1em;
|
| 894 |
+
text-align: left;
|
| 895 |
+
width: 100%;
|
| 896 |
+
padding-left: 0;
|
| 897 |
+
padding-right: 0;
|
| 898 |
+
}
|
| 899 |
+
|
| 900 |
+
/* line 27, sass/partials/_mixins.scss */
|
| 901 |
+
|
| 902 |
+
.inner-sidebar .cmb-th label,
|
| 903 |
+
#side-sortables .cmb-th label {
|
| 904 |
+
display: block;
|
| 905 |
+
margin-top: 0em;
|
| 906 |
+
padding-bottom: 5px;
|
| 907 |
+
}
|
| 908 |
+
|
| 909 |
+
/* line 32, sass/partials/_mixins.scss */
|
| 910 |
+
|
| 911 |
+
.inner-sidebar .cmb-th label:after,
|
| 912 |
+
#side-sortables .cmb-th label:after {
|
| 913 |
+
border-bottom: 1px solid #e9e9e9;
|
| 914 |
+
content: '';
|
| 915 |
+
clear: both;
|
| 916 |
+
display: block;
|
| 917 |
+
padding-top: .4em;
|
| 918 |
+
}
|
| 919 |
+
|
| 920 |
+
/* line 14, sass/partials/_mixins.scss */
|
| 921 |
+
|
| 922 |
+
.inner-sidebar .cmb-th label,
|
| 923 |
+
#side-sortables .cmb-th label {
|
| 924 |
+
font-size: 14px;
|
| 925 |
+
line-height: 1.4em;
|
| 926 |
+
}
|
| 927 |
+
|
| 928 |
+
/* line 67, sass/partials/_sidebar_placements.scss */
|
| 929 |
+
|
| 930 |
+
.inner-sidebar .cmb-group-description .cmb-th,
|
| 931 |
+
#side-sortables .cmb-group-description .cmb-th {
|
| 932 |
+
padding-top: 0;
|
| 933 |
+
}
|
| 934 |
+
|
| 935 |
+
/* line 70, sass/partials/_sidebar_placements.scss */
|
| 936 |
+
|
| 937 |
+
.inner-sidebar .cmb-group-description .cmb2-metabox-description,
|
| 938 |
+
#side-sortables .cmb-group-description .cmb2-metabox-description {
|
| 939 |
+
padding: 0;
|
| 940 |
+
}
|
| 941 |
+
|
| 942 |
+
/* line 77, sass/partials/_sidebar_placements.scss */
|
| 943 |
+
|
| 944 |
+
.inner-sidebar .cmb-group-title .cmb-th,
|
| 945 |
+
#side-sortables .cmb-group-title .cmb-th {
|
| 946 |
+
padding: 0;
|
| 947 |
+
}
|
| 948 |
+
|
| 949 |
+
/* line 83, sass/partials/_sidebar_placements.scss */
|
| 950 |
+
|
| 951 |
+
.inner-sidebar .cmb-repeatable-grouping + .cmb-repeatable-grouping,
|
| 952 |
+
#side-sortables .cmb-repeatable-grouping + .cmb-repeatable-grouping {
|
| 953 |
+
margin-top: 1em;
|
| 954 |
+
}
|
| 955 |
+
|
| 956 |
+
/* line 92, sass/partials/_sidebar_placements.scss */
|
| 957 |
+
|
| 958 |
+
.inner-sidebar .cmb2-media-status .img-status img,
|
| 959 |
+
.inner-sidebar .cmb2-media-status .embed-status img,
|
| 960 |
+
#side-sortables .cmb2-media-status .img-status img,
|
| 961 |
+
#side-sortables .cmb2-media-status .embed-status img {
|
| 962 |
+
max-width: 90%;
|
| 963 |
+
height: auto;
|
| 964 |
+
}
|
| 965 |
+
|
| 966 |
+
/* line 100, sass/partials/_sidebar_placements.scss */
|
| 967 |
+
|
| 968 |
+
.inner-sidebar .cmb2-list label,
|
| 969 |
+
#side-sortables .cmb2-list label {
|
| 970 |
+
display: inline;
|
| 971 |
+
font-weight: normal;
|
| 972 |
+
}
|
| 973 |
+
|
| 974 |
+
/* line 105, sass/partials/_sidebar_placements.scss */
|
| 975 |
+
|
| 976 |
+
.inner-sidebar .cmb2-metabox-description,
|
| 977 |
+
#side-sortables .cmb2-metabox-description {
|
| 978 |
+
display: block;
|
| 979 |
+
padding: 7px 0 0;
|
| 980 |
+
}
|
| 981 |
+
|
| 982 |
+
/* line 112, sass/partials/_sidebar_placements.scss */
|
| 983 |
+
|
| 984 |
+
.inner-sidebar .cmb-type-checkbox .cmb-td label,
|
| 985 |
+
.inner-sidebar .cmb-type-checkbox .cmb2-metabox-description,
|
| 986 |
+
#side-sortables .cmb-type-checkbox .cmb-td label,
|
| 987 |
+
#side-sortables .cmb-type-checkbox .cmb2-metabox-description {
|
| 988 |
+
font-weight: normal;
|
| 989 |
+
display: inline;
|
| 990 |
+
}
|
| 991 |
+
|
| 992 |
+
/* line 119, sass/partials/_sidebar_placements.scss */
|
| 993 |
+
|
| 994 |
+
.inner-sidebar .cmb-row .cmb2-metabox-description,
|
| 995 |
+
#side-sortables .cmb-row .cmb2-metabox-description {
|
| 996 |
+
padding-bottom: 1.8em;
|
| 997 |
+
}
|
| 998 |
+
|
| 999 |
+
/* line 123, sass/partials/_sidebar_placements.scss */
|
| 1000 |
+
|
| 1001 |
+
.inner-sidebar .cmb2-metabox-title,
|
| 1002 |
+
#side-sortables .cmb2-metabox-title {
|
| 1003 |
+
font-size: 1.2em;
|
| 1004 |
+
font-style: italic;
|
| 1005 |
+
}
|
| 1006 |
+
|
| 1007 |
+
/* line 128, sass/partials/_sidebar_placements.scss */
|
| 1008 |
+
|
| 1009 |
+
.inner-sidebar .cmb-remove-row,
|
| 1010 |
+
#side-sortables .cmb-remove-row {
|
| 1011 |
+
clear: both;
|
| 1012 |
+
padding-top: 12px;
|
| 1013 |
+
padding-bottom: 0;
|
| 1014 |
+
}
|
| 1015 |
+
|
| 1016 |
+
/* line 135, sass/partials/_sidebar_placements.scss */
|
| 1017 |
+
|
| 1018 |
+
.inner-sidebar .cmb-type-colorpicker .cmb-repeat-row .cmb-td,
|
| 1019 |
+
#side-sortables .cmb-type-colorpicker .cmb-repeat-row .cmb-td {
|
| 1020 |
+
width: auto;
|
| 1021 |
+
clear: none;
|
| 1022 |
+
float: left;
|
| 1023 |
+
padding-top: 0;
|
| 1024 |
+
}
|
| 1025 |
+
|
| 1026 |
+
/* line 140, sass/partials/_sidebar_placements.scss */
|
| 1027 |
+
|
| 1028 |
+
.inner-sidebar .cmb-type-colorpicker .cmb-repeat-row .cmb-td.cmb-remove-row,
|
| 1029 |
+
#side-sortables .cmb-type-colorpicker .cmb-repeat-row .cmb-td.cmb-remove-row {
|
| 1030 |
+
float: right;
|
| 1031 |
+
margin: 0;
|
| 1032 |
+
}
|
| 1033 |
+
|
| 1034 |
+
/* line 147, sass/partials/_sidebar_placements.scss */
|
| 1035 |
+
|
| 1036 |
+
.inner-sidebar .cmb2-upload-button,
|
| 1037 |
+
#side-sortables .cmb2-upload-button {
|
| 1038 |
+
clear: both;
|
| 1039 |
+
margin-top: 12px;
|
| 1040 |
+
}
|
| 1041 |
+
|
| 1042 |
+
/* line 2, sass/partials/_collapsible_ui.scss */
|
| 1043 |
+
|
| 1044 |
+
.cmb2-metabox .cmb-repeat-group-wrap {
|
| 1045 |
+
max-width: 1000px;
|
| 1046 |
+
}
|
| 1047 |
+
|
| 1048 |
+
/* line 5, sass/partials/_collapsible_ui.scss */
|
| 1049 |
+
|
| 1050 |
+
.cmb2-metabox .cmbhandle {
|
| 1051 |
+
color: #aaa;
|
| 1052 |
+
float: right;
|
| 1053 |
+
width: 27px;
|
| 1054 |
+
height: 30px;
|
| 1055 |
+
cursor: pointer;
|
| 1056 |
+
right: -1em;
|
| 1057 |
+
position: relative;
|
| 1058 |
+
}
|
| 1059 |
+
|
| 1060 |
+
/* line 13, sass/partials/_collapsible_ui.scss */
|
| 1061 |
+
|
| 1062 |
+
.cmb2-metabox .cmbhandle:before {
|
| 1063 |
+
content: '\f142';
|
| 1064 |
+
right: 12px;
|
| 1065 |
+
font: normal 20px/1 'dashicons';
|
| 1066 |
+
speak: none;
|
| 1067 |
+
display: inline-block;
|
| 1068 |
+
padding: 8px 10px;
|
| 1069 |
+
top: 0;
|
| 1070 |
+
position: relative;
|
| 1071 |
+
-webkit-font-smoothing: antialiased;
|
| 1072 |
+
-moz-osx-font-smoothing: grayscale;
|
| 1073 |
+
text-decoration: none !important;
|
| 1074 |
+
}
|
| 1075 |
+
|
| 1076 |
+
/* line 30, sass/partials/_collapsible_ui.scss */
|
| 1077 |
+
|
| 1078 |
+
.cmb2-metabox .postbox.closed .cmbhandle:before {
|
| 1079 |
+
content: '\f140';
|
| 1080 |
+
}
|
| 1081 |
+
|
| 1082 |
+
/* line 36, sass/partials/_collapsible_ui.scss */
|
| 1083 |
+
|
| 1084 |
+
.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 1085 |
+
-webkit-appearance: none !important;
|
| 1086 |
+
background: none !important;
|
| 1087 |
+
border: none !important;
|
| 1088 |
+
position: absolute;
|
| 1089 |
+
left: 0;
|
| 1090 |
+
top: .5em;
|
| 1091 |
+
line-height: 1em;
|
| 1092 |
+
cursor: pointer;
|
| 1093 |
+
}
|
| 1094 |
+
|
| 1095 |
+
/* line 45, sass/partials/_collapsible_ui.scss */
|
| 1096 |
+
|
| 1097 |
+
.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row:not([disabled]) {
|
| 1098 |
+
color: #a00;
|
| 1099 |
+
}
|
| 1100 |
+
|
| 1101 |
+
/* line 47, sass/partials/_collapsible_ui.scss */
|
| 1102 |
+
|
| 1103 |
+
.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row:not([disabled]):hover {
|
| 1104 |
+
color: #f00;
|
| 1105 |
+
}
|
| 1106 |
+
|
| 1107 |
+
/*
|
| 1108 |
+
* jQuery UI CSS Framework 1.8.16
|
| 1109 |
+
*
|
| 1110 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 1111 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 1112 |
+
* http://jquery.org/license
|
| 1113 |
+
*
|
| 1114 |
+
* http://docs.jquery.com/UI/Theming/API
|
| 1115 |
+
*/
|
| 1116 |
+
|
| 1117 |
+
/* line 11, sass/partials/_jquery_ui.scss */
|
| 1118 |
+
|
| 1119 |
+
.cmb2-element .ui-helper-hidden {
|
| 1120 |
+
display: none;
|
| 1121 |
+
}
|
| 1122 |
+
|
| 1123 |
+
/* line 12, sass/partials/_jquery_ui.scss */
|
| 1124 |
+
|
| 1125 |
+
.cmb2-element .ui-helper-hidden-accessible {
|
| 1126 |
+
position: absolute !important;
|
| 1127 |
+
clip: rect(1px 1px 1px 1px);
|
| 1128 |
+
clip: rect(1px, 1px, 1px, 1px);
|
| 1129 |
+
}
|
| 1130 |
+
|
| 1131 |
+
/* line 13, sass/partials/_jquery_ui.scss */
|
| 1132 |
+
|
| 1133 |
+
.cmb2-element .ui-helper-reset {
|
| 1134 |
+
margin: 0;
|
| 1135 |
+
padding: 0;
|
| 1136 |
+
border: 0;
|
| 1137 |
+
outline: 0;
|
| 1138 |
+
line-height: 1.3;
|
| 1139 |
+
text-decoration: none;
|
| 1140 |
+
font-size: 100%;
|
| 1141 |
+
list-style: none;
|
| 1142 |
+
}
|
| 1143 |
+
|
| 1144 |
+
/* line 14, sass/partials/_jquery_ui.scss */
|
| 1145 |
+
|
| 1146 |
+
.cmb2-element .ui-helper-clearfix:after {
|
| 1147 |
+
content: ".";
|
| 1148 |
+
display: block;
|
| 1149 |
+
height: 0;
|
| 1150 |
+
clear: both;
|
| 1151 |
+
visibility: hidden;
|
| 1152 |
+
}
|
| 1153 |
+
|
| 1154 |
+
/* line 15, sass/partials/_jquery_ui.scss */
|
| 1155 |
+
|
| 1156 |
+
.cmb2-element .ui-helper-clearfix {
|
| 1157 |
+
display: inline-block;
|
| 1158 |
+
}
|
| 1159 |
+
|
| 1160 |
+
/* line 16, sass/partials/_jquery_ui.scss */
|
| 1161 |
+
|
| 1162 |
+
.cmb2-element * html .ui-helper-clearfix {
|
| 1163 |
+
height: 1%;
|
| 1164 |
+
}
|
| 1165 |
+
|
| 1166 |
+
/* line 17, sass/partials/_jquery_ui.scss */
|
| 1167 |
+
|
| 1168 |
+
.cmb2-element .ui-helper-clearfix {
|
| 1169 |
+
display: block;
|
| 1170 |
+
}
|
| 1171 |
+
|
| 1172 |
+
/* line 18, sass/partials/_jquery_ui.scss */
|
| 1173 |
+
|
| 1174 |
+
.cmb2-element .ui-helper-zfix {
|
| 1175 |
+
width: 100%;
|
| 1176 |
+
height: 100%;
|
| 1177 |
+
top: 0;
|
| 1178 |
+
left: 0;
|
| 1179 |
+
position: absolute;
|
| 1180 |
+
opacity: 0;
|
| 1181 |
+
filter: Alpha(Opacity=0);
|
| 1182 |
+
}
|
| 1183 |
+
|
| 1184 |
+
/* line 19, sass/partials/_jquery_ui.scss */
|
| 1185 |
+
|
| 1186 |
+
.cmb2-element .ui-state-disabled {
|
| 1187 |
+
cursor: default !important;
|
| 1188 |
+
}
|
| 1189 |
+
|
| 1190 |
+
/* line 20, sass/partials/_jquery_ui.scss */
|
| 1191 |
+
|
| 1192 |
+
.cmb2-element .ui-icon {
|
| 1193 |
+
display: block;
|
| 1194 |
+
text-indent: -99999px;
|
| 1195 |
+
overflow: hidden;
|
| 1196 |
+
background-repeat: no-repeat;
|
| 1197 |
+
}
|
| 1198 |
+
|
| 1199 |
+
/* line 21, sass/partials/_jquery_ui.scss */
|
| 1200 |
+
|
| 1201 |
+
.cmb2-element .ui-widget-overlay {
|
| 1202 |
+
position: absolute;
|
| 1203 |
+
top: 0;
|
| 1204 |
+
left: 0;
|
| 1205 |
+
width: 100%;
|
| 1206 |
+
height: 100%;
|
| 1207 |
+
}
|
| 1208 |
+
|
| 1209 |
+
/* line 22, sass/partials/_jquery_ui.scss */
|
| 1210 |
+
|
| 1211 |
+
.cmb2-element .ui-widget {
|
| 1212 |
+
font-family: Verdana,Arial,sans-serif;
|
| 1213 |
+
font-size: 1.1em;
|
| 1214 |
+
}
|
| 1215 |
+
|
| 1216 |
+
/* line 24, sass/partials/_jquery_ui.scss */
|
| 1217 |
+
|
| 1218 |
+
.cmb2-element .ui-widget .ui-widget {
|
| 1219 |
+
font-size: 1em;
|
| 1220 |
+
}
|
| 1221 |
+
|
| 1222 |
+
/* line 25, sass/partials/_jquery_ui.scss */
|
| 1223 |
+
|
| 1224 |
+
.cmb2-element .ui-widget input,
|
| 1225 |
+
.cmb2-element .ui-widget select,
|
| 1226 |
+
.cmb2-element .ui-widget textarea,
|
| 1227 |
+
.cmb2-element .ui-widget button {
|
| 1228 |
+
font-family: Verdana,Arial,sans-serif;
|
| 1229 |
+
font-size: 1em;
|
| 1230 |
+
}
|
| 1231 |
+
|
| 1232 |
+
/* line 27, sass/partials/_jquery_ui.scss */
|
| 1233 |
+
|
| 1234 |
+
.cmb2-element .ui-widget-content {
|
| 1235 |
+
border: 1px solid #aaaaaa;
|
| 1236 |
+
background: #ffffff url(../images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;
|
| 1237 |
+
color: #222222;
|
| 1238 |
+
}
|
| 1239 |
+
|
| 1240 |
+
/* line 28, sass/partials/_jquery_ui.scss */
|
| 1241 |
+
|
| 1242 |
+
.cmb2-element .ui-widget-content a {
|
| 1243 |
+
color: #222222;
|
| 1244 |
+
}
|
| 1245 |
+
|
| 1246 |
+
/* line 29, sass/partials/_jquery_ui.scss */
|
| 1247 |
+
|
| 1248 |
+
.cmb2-element .ui-widget-header {
|
| 1249 |
+
border: 1px solid #aaaaaa;
|
| 1250 |
+
background: #cccccc url(../images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;
|
| 1251 |
+
color: #222222;
|
| 1252 |
+
font-weight: bold;
|
| 1253 |
+
}
|
| 1254 |
+
|
| 1255 |
+
/* line 30, sass/partials/_jquery_ui.scss */
|
| 1256 |
+
|
| 1257 |
+
.cmb2-element .ui-widget-header a {
|
| 1258 |
+
color: #222222;
|
| 1259 |
+
}
|
| 1260 |
+
|
| 1261 |
+
/* line 31, sass/partials/_jquery_ui.scss */
|
| 1262 |
+
|
| 1263 |
+
.cmb2-element .ui-state-default,
|
| 1264 |
+
.cmb2-element .ui-widget-content .ui-state-default,
|
| 1265 |
+
.cmb2-element .ui-widget-header .ui-state-default {
|
| 1266 |
+
border: 1px solid #d3d3d3;
|
| 1267 |
+
background: #e6e6e6 url(../images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;
|
| 1268 |
+
font-weight: normal;
|
| 1269 |
+
color: #555555;
|
| 1270 |
+
}
|
| 1271 |
+
|
| 1272 |
+
/* line 32, sass/partials/_jquery_ui.scss */
|
| 1273 |
+
|
| 1274 |
+
.cmb2-element .ui-state-default a,
|
| 1275 |
+
.cmb2-element .ui-state-default a:link,
|
| 1276 |
+
.cmb2-element .ui-state-default a:visited {
|
| 1277 |
+
color: #555555;
|
| 1278 |
+
text-decoration: none;
|
| 1279 |
+
}
|
| 1280 |
+
|
| 1281 |
+
/* line 33, sass/partials/_jquery_ui.scss */
|
| 1282 |
+
|
| 1283 |
+
.cmb2-element .ui-state-hover,
|
| 1284 |
+
.cmb2-element .ui-widget-content .ui-state-hover,
|
| 1285 |
+
.cmb2-element .ui-widget-header .ui-state-hover,
|
| 1286 |
+
.cmb2-element .ui-state-focus,
|
| 1287 |
+
.cmb2-element .ui-widget-content .ui-state-focus,
|
| 1288 |
+
.cmb2-element .ui-widget-header .ui-state-focus {
|
| 1289 |
+
border: 1px solid #999999;
|
| 1290 |
+
background: #dadada url(../images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;
|
| 1291 |
+
font-weight: normal;
|
| 1292 |
+
color: #212121;
|
| 1293 |
+
}
|
| 1294 |
+
|
| 1295 |
+
/* line 34, sass/partials/_jquery_ui.scss */
|
| 1296 |
+
|
| 1297 |
+
.cmb2-element .ui-state-hover a,
|
| 1298 |
+
.cmb2-element .ui-state-hover a:hover {
|
| 1299 |
+
color: #212121;
|
| 1300 |
+
text-decoration: none;
|
| 1301 |
+
}
|
| 1302 |
+
|
| 1303 |
+
/* line 35, sass/partials/_jquery_ui.scss */
|
| 1304 |
+
|
| 1305 |
+
.cmb2-element .ui-state-active,
|
| 1306 |
+
.cmb2-element .ui-widget-content .ui-state-active,
|
| 1307 |
+
.cmb2-element .ui-widget-header .ui-state-active {
|
| 1308 |
+
border: 1px solid #aaaaaa;
|
| 1309 |
+
background: #ffffff url(../images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;
|
| 1310 |
+
font-weight: normal;
|
| 1311 |
+
color: #212121;
|
| 1312 |
+
}
|
| 1313 |
+
|
| 1314 |
+
/* line 36, sass/partials/_jquery_ui.scss */
|
| 1315 |
+
|
| 1316 |
+
.cmb2-element .ui-state-active a,
|
| 1317 |
+
.cmb2-element .ui-state-active a:link,
|
| 1318 |
+
.cmb2-element .ui-state-active a:visited {
|
| 1319 |
+
color: #212121;
|
| 1320 |
+
text-decoration: none;
|
| 1321 |
+
}
|
| 1322 |
+
|
| 1323 |
+
/* line 37, sass/partials/_jquery_ui.scss */
|
| 1324 |
+
|
| 1325 |
+
.cmb2-element .ui-widget :active {
|
| 1326 |
+
outline: none;
|
| 1327 |
+
}
|
| 1328 |
+
|
| 1329 |
+
/* line 38, sass/partials/_jquery_ui.scss */
|
| 1330 |
+
|
| 1331 |
+
.cmb2-element .ui-state-highlight,
|
| 1332 |
+
.cmb2-element .ui-widget-content .ui-state-highlight,
|
| 1333 |
+
.cmb2-element .ui-widget-header .ui-state-highlight {
|
| 1334 |
+
border: 1px solid #fcefa1;
|
| 1335 |
+
background: #fbf9ee url(../images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;
|
| 1336 |
+
color: #363636;
|
| 1337 |
+
}
|
| 1338 |
+
|
| 1339 |
+
/* line 39, sass/partials/_jquery_ui.scss */
|
| 1340 |
+
|
| 1341 |
+
.cmb2-element .ui-state-highlight a,
|
| 1342 |
+
.cmb2-element .ui-widget-content .ui-state-highlight a,
|
| 1343 |
+
.cmb2-element .ui-widget-header .ui-state-highlight a {
|
| 1344 |
+
color: #363636;
|
| 1345 |
+
}
|
| 1346 |
+
|
| 1347 |
+
/* line 40, sass/partials/_jquery_ui.scss */
|
| 1348 |
+
|
| 1349 |
+
.cmb2-element .ui-state-error,
|
| 1350 |
+
.cmb2-element .ui-widget-content .ui-state-error,
|
| 1351 |
+
.cmb2-element .ui-widget-header .ui-state-error {
|
| 1352 |
+
border: 1px solid #cd0a0a;
|
| 1353 |
+
background: #fef1ec url(../images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;
|
| 1354 |
+
color: #cd0a0a;
|
| 1355 |
+
}
|
| 1356 |
+
|
| 1357 |
+
/* line 41, sass/partials/_jquery_ui.scss */
|
| 1358 |
+
|
| 1359 |
+
.cmb2-element .ui-state-error a,
|
| 1360 |
+
.cmb2-element .ui-widget-content .ui-state-error a,
|
| 1361 |
+
.cmb2-element .ui-widget-header .ui-state-error a {
|
| 1362 |
+
color: #cd0a0a;
|
| 1363 |
+
}
|
| 1364 |
+
|
| 1365 |
+
/* line 42, sass/partials/_jquery_ui.scss */
|
| 1366 |
+
|
| 1367 |
+
.cmb2-element .ui-state-error-text,
|
| 1368 |
+
.cmb2-element .ui-widget-content .ui-state-error-text,
|
| 1369 |
+
.cmb2-element .ui-widget-header .ui-state-error-text {
|
| 1370 |
+
color: #cd0a0a;
|
| 1371 |
+
}
|
| 1372 |
+
|
| 1373 |
+
/* line 43, sass/partials/_jquery_ui.scss */
|
| 1374 |
+
|
| 1375 |
+
.cmb2-element .ui-priority-primary,
|
| 1376 |
+
.cmb2-element .ui-widget-content .ui-priority-primary,
|
| 1377 |
+
.cmb2-element .ui-widget-header .ui-priority-primary {
|
| 1378 |
+
font-weight: bold;
|
| 1379 |
+
}
|
| 1380 |
+
|
| 1381 |
+
/* line 44, sass/partials/_jquery_ui.scss */
|
| 1382 |
+
|
| 1383 |
+
.cmb2-element .ui-priority-secondary,
|
| 1384 |
+
.cmb2-element .ui-widget-content .ui-priority-secondary,
|
| 1385 |
+
.cmb2-element .ui-widget-header .ui-priority-secondary {
|
| 1386 |
+
opacity: .7;
|
| 1387 |
+
filter: Alpha(Opacity=70);
|
| 1388 |
+
font-weight: normal;
|
| 1389 |
+
}
|
| 1390 |
+
|
| 1391 |
+
/* line 45, sass/partials/_jquery_ui.scss */
|
| 1392 |
+
|
| 1393 |
+
.cmb2-element .ui-state-disabled,
|
| 1394 |
+
.cmb2-element .ui-widget-content .ui-state-disabled,
|
| 1395 |
+
.cmb2-element .ui-widget-header .ui-state-disabled {
|
| 1396 |
+
opacity: .35;
|
| 1397 |
+
filter: Alpha(Opacity=35);
|
| 1398 |
+
background-image: none;
|
| 1399 |
+
}
|
| 1400 |
+
|
| 1401 |
+
/* line 46, sass/partials/_jquery_ui.scss */
|
| 1402 |
+
|
| 1403 |
+
.cmb2-element .ui-icon {
|
| 1404 |
+
width: 16px;
|
| 1405 |
+
height: 16px;
|
| 1406 |
+
background-image: url(../images/ui-icons_222222_256x240.png);
|
| 1407 |
+
}
|
| 1408 |
+
|
| 1409 |
+
/* line 47, sass/partials/_jquery_ui.scss */
|
| 1410 |
+
|
| 1411 |
+
.cmb2-element .ui-widget-content .ui-icon {
|
| 1412 |
+
background-image: url(../images/ui-icons_222222_256x240.png);
|
| 1413 |
+
}
|
| 1414 |
+
|
| 1415 |
+
/* line 48, sass/partials/_jquery_ui.scss */
|
| 1416 |
+
|
| 1417 |
+
.cmb2-element .ui-widget-header .ui-icon {
|
| 1418 |
+
background-image: url(../images/ui-icons_222222_256x240.png);
|
| 1419 |
+
}
|
| 1420 |
+
|
| 1421 |
+
/* line 49, sass/partials/_jquery_ui.scss */
|
| 1422 |
+
|
| 1423 |
+
.cmb2-element .ui-state-default .ui-icon {
|
| 1424 |
+
background-image: url(../images/ui-icons_888888_256x240.png);
|
| 1425 |
+
}
|
| 1426 |
+
|
| 1427 |
+
/* line 50, sass/partials/_jquery_ui.scss */
|
| 1428 |
+
|
| 1429 |
+
.cmb2-element .ui-state-hover .ui-icon,
|
| 1430 |
+
.cmb2-element .ui-state-focus .ui-icon {
|
| 1431 |
+
background-image: url(../images/ui-icons_454545_256x240.png);
|
| 1432 |
+
}
|
| 1433 |
+
|
| 1434 |
+
/* line 51, sass/partials/_jquery_ui.scss */
|
| 1435 |
+
|
| 1436 |
+
.cmb2-element .ui-state-active .ui-icon {
|
| 1437 |
+
background-image: url(../images/ui-icons_454545_256x240.png);
|
| 1438 |
+
}
|
| 1439 |
+
|
| 1440 |
+
/* line 52, sass/partials/_jquery_ui.scss */
|
| 1441 |
+
|
| 1442 |
+
.cmb2-element .ui-state-highlight .ui-icon {
|
| 1443 |
+
background-image: url(../images/ui-icons_2e83ff_256x240.png);
|
| 1444 |
+
}
|
| 1445 |
+
|
| 1446 |
+
/* line 53, sass/partials/_jquery_ui.scss */
|
| 1447 |
+
|
| 1448 |
+
.cmb2-element .ui-state-error .ui-icon,
|
| 1449 |
+
.cmb2-element .ui-state-error-text .ui-icon {
|
| 1450 |
+
background-image: url(../images/ui-icons_cd0a0a_256x240.png);
|
| 1451 |
+
}
|
| 1452 |
+
|
| 1453 |
+
/* line 54, sass/partials/_jquery_ui.scss */
|
| 1454 |
+
|
| 1455 |
+
.cmb2-element .ui-icon-carat-1-n {
|
| 1456 |
+
background-position: 0 0;
|
| 1457 |
+
}
|
| 1458 |
+
|
| 1459 |
+
/* line 55, sass/partials/_jquery_ui.scss */
|
| 1460 |
+
|
| 1461 |
+
.cmb2-element .ui-icon-carat-1-ne {
|
| 1462 |
+
background-position: -16px 0;
|
| 1463 |
+
}
|
| 1464 |
+
|
| 1465 |
+
/* line 56, sass/partials/_jquery_ui.scss */
|
| 1466 |
+
|
| 1467 |
+
.cmb2-element .ui-icon-carat-1-e {
|
| 1468 |
+
background-position: -32px 0;
|
| 1469 |
+
}
|
| 1470 |
+
|
| 1471 |
+
/* line 57, sass/partials/_jquery_ui.scss */
|
| 1472 |
+
|
| 1473 |
+
.cmb2-element .ui-icon-carat-1-se {
|
| 1474 |
+
background-position: -48px 0;
|
| 1475 |
+
}
|
| 1476 |
+
|
| 1477 |
+
/* line 58, sass/partials/_jquery_ui.scss */
|
| 1478 |
+
|
| 1479 |
+
.cmb2-element .ui-icon-carat-1-s {
|
| 1480 |
+
background-position: -64px 0;
|
| 1481 |
+
}
|
| 1482 |
+
|
| 1483 |
+
/* line 59, sass/partials/_jquery_ui.scss */
|
| 1484 |
+
|
| 1485 |
+
.cmb2-element .ui-icon-carat-1-sw {
|
| 1486 |
+
background-position: -80px 0;
|
| 1487 |
+
}
|
| 1488 |
+
|
| 1489 |
+
/* line 60, sass/partials/_jquery_ui.scss */
|
| 1490 |
+
|
| 1491 |
+
.cmb2-element .ui-icon-carat-1-w {
|
| 1492 |
+
background-position: -96px 0;
|
| 1493 |
+
}
|
| 1494 |
+
|
| 1495 |
+
/* line 61, sass/partials/_jquery_ui.scss */
|
| 1496 |
+
|
| 1497 |
+
.cmb2-element .ui-icon-carat-1-nw {
|
| 1498 |
+
background-position: -112px 0;
|
| 1499 |
+
}
|
| 1500 |
+
|
| 1501 |
+
/* line 62, sass/partials/_jquery_ui.scss */
|
| 1502 |
+
|
| 1503 |
+
.cmb2-element .ui-icon-carat-2-n-s {
|
| 1504 |
+
background-position: -128px 0;
|
| 1505 |
+
}
|
| 1506 |
+
|
| 1507 |
+
/* line 63, sass/partials/_jquery_ui.scss */
|
| 1508 |
+
|
| 1509 |
+
.cmb2-element .ui-icon-carat-2-e-w {
|
| 1510 |
+
background-position: -144px 0;
|
| 1511 |
+
}
|
| 1512 |
+
|
| 1513 |
+
/* line 64, sass/partials/_jquery_ui.scss */
|
| 1514 |
+
|
| 1515 |
+
.cmb2-element .ui-icon-triangle-1-n {
|
| 1516 |
+
background-position: 0 -16px;
|
| 1517 |
+
}
|
| 1518 |
+
|
| 1519 |
+
/* line 65, sass/partials/_jquery_ui.scss */
|
| 1520 |
+
|
| 1521 |
+
.cmb2-element .ui-icon-triangle-1-ne {
|
| 1522 |
+
background-position: -16px -16px;
|
| 1523 |
+
}
|
| 1524 |
+
|
| 1525 |
+
/* line 66, sass/partials/_jquery_ui.scss */
|
| 1526 |
+
|
| 1527 |
+
.cmb2-element .ui-icon-triangle-1-e {
|
| 1528 |
+
background-position: -32px -16px;
|
| 1529 |
+
}
|
| 1530 |
+
|
| 1531 |
+
/* line 67, sass/partials/_jquery_ui.scss */
|
| 1532 |
+
|
| 1533 |
+
.cmb2-element .ui-icon-triangle-1-se {
|
| 1534 |
+
background-position: -48px -16px;
|
| 1535 |
+
}
|
| 1536 |
+
|
| 1537 |
+
/* line 68, sass/partials/_jquery_ui.scss */
|
| 1538 |
+
|
| 1539 |
+
.cmb2-element .ui-icon-triangle-1-s {
|
| 1540 |
+
background-position: -64px -16px;
|
| 1541 |
+
}
|
| 1542 |
+
|
| 1543 |
+
/* line 69, sass/partials/_jquery_ui.scss */
|
| 1544 |
+
|
| 1545 |
+
.cmb2-element .ui-icon-triangle-1-sw {
|
| 1546 |
+
background-position: -80px -16px;
|
| 1547 |
+
}
|
| 1548 |
+
|
| 1549 |
+
/* line 70, sass/partials/_jquery_ui.scss */
|
| 1550 |
+
|
| 1551 |
+
.cmb2-element .ui-icon-triangle-1-w {
|
| 1552 |
+
background-position: -96px -16px;
|
| 1553 |
+
}
|
| 1554 |
+
|
| 1555 |
+
/* line 71, sass/partials/_jquery_ui.scss */
|
| 1556 |
+
|
| 1557 |
+
.cmb2-element .ui-icon-triangle-1-nw {
|
| 1558 |
+
background-position: -112px -16px;
|
| 1559 |
+
}
|
| 1560 |
+
|
| 1561 |
+
/* line 72, sass/partials/_jquery_ui.scss */
|
| 1562 |
+
|
| 1563 |
+
.cmb2-element .ui-icon-triangle-2-n-s {
|
| 1564 |
+
background-position: -128px -16px;
|
| 1565 |
+
}
|
| 1566 |
+
|
| 1567 |
+
/* line 73, sass/partials/_jquery_ui.scss */
|
| 1568 |
+
|
| 1569 |
+
.cmb2-element .ui-icon-triangle-2-e-w {
|
| 1570 |
+
background-position: -144px -16px;
|
| 1571 |
+
}
|
| 1572 |
+
|
| 1573 |
+
/* line 74, sass/partials/_jquery_ui.scss */
|
| 1574 |
+
|
| 1575 |
+
.cmb2-element .ui-icon-arrow-1-n {
|
| 1576 |
+
background-position: 0 -32px;
|
| 1577 |
+
}
|
| 1578 |
+
|
| 1579 |
+
/* line 75, sass/partials/_jquery_ui.scss */
|
| 1580 |
+
|
| 1581 |
+
.cmb2-element .ui-icon-arrow-1-ne {
|
| 1582 |
+
background-position: -16px -32px;
|
| 1583 |
+
}
|
| 1584 |
+
|
| 1585 |
+
/* line 76, sass/partials/_jquery_ui.scss */
|
| 1586 |
+
|
| 1587 |
+
.cmb2-element .ui-icon-arrow-1-e {
|
| 1588 |
+
background-position: -32px -32px;
|
| 1589 |
+
}
|
| 1590 |
+
|
| 1591 |
+
/* line 77, sass/partials/_jquery_ui.scss */
|
| 1592 |
+
|
| 1593 |
+
.cmb2-element .ui-icon-arrow-1-se {
|
| 1594 |
+
background-position: -48px -32px;
|
| 1595 |
+
}
|
| 1596 |
+
|
| 1597 |
+
/* line 78, sass/partials/_jquery_ui.scss */
|
| 1598 |
+
|
| 1599 |
+
.cmb2-element .ui-icon-arrow-1-s {
|
| 1600 |
+
background-position: -64px -32px;
|
| 1601 |
+
}
|
| 1602 |
+
|
| 1603 |
+
/* line 79, sass/partials/_jquery_ui.scss */
|
| 1604 |
+
|
| 1605 |
+
.cmb2-element .ui-icon-arrow-1-sw {
|
| 1606 |
+
background-position: -80px -32px;
|
| 1607 |
+
}
|
| 1608 |
+
|
| 1609 |
+
/* line 80, sass/partials/_jquery_ui.scss */
|
| 1610 |
+
|
| 1611 |
+
.cmb2-element .ui-icon-arrow-1-w {
|
| 1612 |
+
background-position: -96px -32px;
|
| 1613 |
+
}
|
| 1614 |
+
|
| 1615 |
+
/* line 81, sass/partials/_jquery_ui.scss */
|
| 1616 |
+
|
| 1617 |
+
.cmb2-element .ui-icon-arrow-1-nw {
|
| 1618 |
+
background-position: -112px -32px;
|
| 1619 |
+
}
|
| 1620 |
+
|
| 1621 |
+
/* line 82, sass/partials/_jquery_ui.scss */
|
| 1622 |
+
|
| 1623 |
+
.cmb2-element .ui-icon-arrow-2-n-s {
|
| 1624 |
+
background-position: -128px -32px;
|
| 1625 |
+
}
|
| 1626 |
+
|
| 1627 |
+
/* line 83, sass/partials/_jquery_ui.scss */
|
| 1628 |
+
|
| 1629 |
+
.cmb2-element .ui-icon-arrow-2-ne-sw {
|
| 1630 |
+
background-position: -144px -32px;
|
| 1631 |
+
}
|
| 1632 |
+
|
| 1633 |
+
/* line 84, sass/partials/_jquery_ui.scss */
|
| 1634 |
+
|
| 1635 |
+
.cmb2-element .ui-icon-arrow-2-e-w {
|
| 1636 |
+
background-position: -160px -32px;
|
| 1637 |
+
}
|
| 1638 |
+
|
| 1639 |
+
/* line 85, sass/partials/_jquery_ui.scss */
|
| 1640 |
+
|
| 1641 |
+
.cmb2-element .ui-icon-arrow-2-se-nw {
|
| 1642 |
+
background-position: -176px -32px;
|
| 1643 |
+
}
|
| 1644 |
+
|
| 1645 |
+
/* line 86, sass/partials/_jquery_ui.scss */
|
| 1646 |
+
|
| 1647 |
+
.cmb2-element .ui-icon-arrowstop-1-n {
|
| 1648 |
+
background-position: -192px -32px;
|
| 1649 |
+
}
|
| 1650 |
+
|
| 1651 |
+
/* line 87, sass/partials/_jquery_ui.scss */
|
| 1652 |
+
|
| 1653 |
+
.cmb2-element .ui-icon-arrowstop-1-e {
|
| 1654 |
+
background-position: -208px -32px;
|
| 1655 |
+
}
|
| 1656 |
+
|
| 1657 |
+
/* line 88, sass/partials/_jquery_ui.scss */
|
| 1658 |
+
|
| 1659 |
+
.cmb2-element .ui-icon-arrowstop-1-s {
|
| 1660 |
+
background-position: -224px -32px;
|
| 1661 |
+
}
|
| 1662 |
+
|
| 1663 |
+
/* line 89, sass/partials/_jquery_ui.scss */
|
| 1664 |
+
|
| 1665 |
+
.cmb2-element .ui-icon-arrowstop-1-w {
|
| 1666 |
+
background-position: -240px -32px;
|
| 1667 |
+
}
|
| 1668 |
+
|
| 1669 |
+
/* line 90, sass/partials/_jquery_ui.scss */
|
| 1670 |
+
|
| 1671 |
+
.cmb2-element .ui-icon-arrowthick-1-n {
|
| 1672 |
+
background-position: 0 -48px;
|
| 1673 |
+
}
|
| 1674 |
+
|
| 1675 |
+
/* line 91, sass/partials/_jquery_ui.scss */
|
| 1676 |
+
|
| 1677 |
+
.cmb2-element .ui-icon-arrowthick-1-ne {
|
| 1678 |
+
background-position: -16px -48px;
|
| 1679 |
+
}
|
| 1680 |
+
|
| 1681 |
+
/* line 92, sass/partials/_jquery_ui.scss */
|
| 1682 |
+
|
| 1683 |
+
.cmb2-element .ui-icon-arrowthick-1-e {
|
| 1684 |
+
background-position: -32px -48px;
|
| 1685 |
+
}
|
| 1686 |
+
|
| 1687 |
+
/* line 93, sass/partials/_jquery_ui.scss */
|
| 1688 |
+
|
| 1689 |
+
.cmb2-element .ui-icon-arrowthick-1-se {
|
| 1690 |
+
background-position: -48px -48px;
|
| 1691 |
+
}
|
| 1692 |
+
|
| 1693 |
+
/* line 94, sass/partials/_jquery_ui.scss */
|
| 1694 |
+
|
| 1695 |
+
.cmb2-element .ui-icon-arrowthick-1-s {
|
| 1696 |
+
background-position: -64px -48px;
|
| 1697 |
+
}
|
| 1698 |
+
|
| 1699 |
+
/* line 95, sass/partials/_jquery_ui.scss */
|
| 1700 |
+
|
| 1701 |
+
.cmb2-element .ui-icon-arrowthick-1-sw {
|
| 1702 |
+
background-position: -80px -48px;
|
| 1703 |
+
}
|
| 1704 |
+
|
| 1705 |
+
/* line 96, sass/partials/_jquery_ui.scss */
|
| 1706 |
+
|
| 1707 |
+
.cmb2-element .ui-icon-arrowthick-1-w {
|
| 1708 |
+
background-position: -96px -48px;
|
| 1709 |
+
}
|
| 1710 |
+
|
| 1711 |
+
/* line 97, sass/partials/_jquery_ui.scss */
|
| 1712 |
+
|
| 1713 |
+
.cmb2-element .ui-icon-arrowthick-1-nw {
|
| 1714 |
+
background-position: -112px -48px;
|
| 1715 |
+
}
|
| 1716 |
+
|
| 1717 |
+
/* line 98, sass/partials/_jquery_ui.scss */
|
| 1718 |
+
|
| 1719 |
+
.cmb2-element .ui-icon-arrowthick-2-n-s {
|
| 1720 |
+
background-position: -128px -48px;
|
| 1721 |
+
}
|
| 1722 |
+
|
| 1723 |
+
/* line 99, sass/partials/_jquery_ui.scss */
|
| 1724 |
+
|
| 1725 |
+
.cmb2-element .ui-icon-arrowthick-2-ne-sw {
|
| 1726 |
+
background-position: -144px -48px;
|
| 1727 |
+
}
|
| 1728 |
+
|
| 1729 |
+
/* line 100, sass/partials/_jquery_ui.scss */
|
| 1730 |
+
|
| 1731 |
+
.cmb2-element .ui-icon-arrowthick-2-e-w {
|
| 1732 |
+
background-position: -160px -48px;
|
| 1733 |
+
}
|
| 1734 |
+
|
| 1735 |
+
/* line 101, sass/partials/_jquery_ui.scss */
|
| 1736 |
+
|
| 1737 |
+
.cmb2-element .ui-icon-arrowthick-2-se-nw {
|
| 1738 |
+
background-position: -176px -48px;
|
| 1739 |
+
}
|
| 1740 |
+
|
| 1741 |
+
/* line 102, sass/partials/_jquery_ui.scss */
|
| 1742 |
+
|
| 1743 |
+
.cmb2-element .ui-icon-arrowthickstop-1-n {
|
| 1744 |
+
background-position: -192px -48px;
|
| 1745 |
+
}
|
| 1746 |
+
|
| 1747 |
+
/* line 103, sass/partials/_jquery_ui.scss */
|
| 1748 |
+
|
| 1749 |
+
.cmb2-element .ui-icon-arrowthickstop-1-e {
|
| 1750 |
+
background-position: -208px -48px;
|
| 1751 |
+
}
|
| 1752 |
+
|
| 1753 |
+
/* line 104, sass/partials/_jquery_ui.scss */
|
| 1754 |
+
|
| 1755 |
+
.cmb2-element .ui-icon-arrowthickstop-1-s {
|
| 1756 |
+
background-position: -224px -48px;
|
| 1757 |
+
}
|
| 1758 |
+
|
| 1759 |
+
/* line 105, sass/partials/_jquery_ui.scss */
|
| 1760 |
+
|
| 1761 |
+
.cmb2-element .ui-icon-arrowthickstop-1-w {
|
| 1762 |
+
background-position: -240px -48px;
|
| 1763 |
+
}
|
| 1764 |
+
|
| 1765 |
+
/* line 106, sass/partials/_jquery_ui.scss */
|
| 1766 |
+
|
| 1767 |
+
.cmb2-element .ui-icon-arrowreturnthick-1-w {
|
| 1768 |
+
background-position: 0 -64px;
|
| 1769 |
+
}
|
| 1770 |
+
|
| 1771 |
+
/* line 107, sass/partials/_jquery_ui.scss */
|
| 1772 |
+
|
| 1773 |
+
.cmb2-element .ui-icon-arrowreturnthick-1-n {
|
| 1774 |
+
background-position: -16px -64px;
|
| 1775 |
+
}
|
| 1776 |
+
|
| 1777 |
+
/* line 108, sass/partials/_jquery_ui.scss */
|
| 1778 |
+
|
| 1779 |
+
.cmb2-element .ui-icon-arrowreturnthick-1-e {
|
| 1780 |
+
background-position: -32px -64px;
|
| 1781 |
+
}
|
| 1782 |
+
|
| 1783 |
+
/* line 109, sass/partials/_jquery_ui.scss */
|
| 1784 |
+
|
| 1785 |
+
.cmb2-element .ui-icon-arrowreturnthick-1-s {
|
| 1786 |
+
background-position: -48px -64px;
|
| 1787 |
+
}
|
| 1788 |
+
|
| 1789 |
+
/* line 110, sass/partials/_jquery_ui.scss */
|
| 1790 |
+
|
| 1791 |
+
.cmb2-element .ui-icon-arrowreturn-1-w {
|
| 1792 |
+
background-position: -64px -64px;
|
| 1793 |
+
}
|
| 1794 |
+
|
| 1795 |
+
/* line 111, sass/partials/_jquery_ui.scss */
|
| 1796 |
+
|
| 1797 |
+
.cmb2-element .ui-icon-arrowreturn-1-n {
|
| 1798 |
+
background-position: -80px -64px;
|
| 1799 |
+
}
|
| 1800 |
+
|
| 1801 |
+
/* line 112, sass/partials/_jquery_ui.scss */
|
| 1802 |
+
|
| 1803 |
+
.cmb2-element .ui-icon-arrowreturn-1-e {
|
| 1804 |
+
background-position: -96px -64px;
|
| 1805 |
+
}
|
| 1806 |
+
|
| 1807 |
+
/* line 113, sass/partials/_jquery_ui.scss */
|
| 1808 |
+
|
| 1809 |
+
.cmb2-element .ui-icon-arrowreturn-1-s {
|
| 1810 |
+
background-position: -112px -64px;
|
| 1811 |
+
}
|
| 1812 |
+
|
| 1813 |
+
/* line 114, sass/partials/_jquery_ui.scss */
|
| 1814 |
+
|
| 1815 |
+
.cmb2-element .ui-icon-arrowrefresh-1-w {
|
| 1816 |
+
background-position: -128px -64px;
|
| 1817 |
+
}
|
| 1818 |
+
|
| 1819 |
+
/* line 115, sass/partials/_jquery_ui.scss */
|
| 1820 |
+
|
| 1821 |
+
.cmb2-element .ui-icon-arrowrefresh-1-n {
|
| 1822 |
+
background-position: -144px -64px;
|
| 1823 |
+
}
|
| 1824 |
+
|
| 1825 |
+
/* line 116, sass/partials/_jquery_ui.scss */
|
| 1826 |
+
|
| 1827 |
+
.cmb2-element .ui-icon-arrowrefresh-1-e {
|
| 1828 |
+
background-position: -160px -64px;
|
| 1829 |
+
}
|
| 1830 |
+
|
| 1831 |
+
/* line 117, sass/partials/_jquery_ui.scss */
|
| 1832 |
+
|
| 1833 |
+
.cmb2-element .ui-icon-arrowrefresh-1-s {
|
| 1834 |
+
background-position: -176px -64px;
|
| 1835 |
+
}
|
| 1836 |
+
|
| 1837 |
+
/* line 118, sass/partials/_jquery_ui.scss */
|
| 1838 |
+
|
| 1839 |
+
.cmb2-element .ui-icon-arrow-4 {
|
| 1840 |
+
background-position: 0 -80px;
|
| 1841 |
+
}
|
| 1842 |
+
|
| 1843 |
+
/* line 119, sass/partials/_jquery_ui.scss */
|
| 1844 |
+
|
| 1845 |
+
.cmb2-element .ui-icon-arrow-4-diag {
|
| 1846 |
+
background-position: -16px -80px;
|
| 1847 |
+
}
|
| 1848 |
+
|
| 1849 |
+
/* line 120, sass/partials/_jquery_ui.scss */
|
| 1850 |
+
|
| 1851 |
+
.cmb2-element .ui-icon-extlink {
|
| 1852 |
+
background-position: -32px -80px;
|
| 1853 |
+
}
|
| 1854 |
+
|
| 1855 |
+
/* line 121, sass/partials/_jquery_ui.scss */
|
| 1856 |
+
|
| 1857 |
+
.cmb2-element .ui-icon-newwin {
|
| 1858 |
+
background-position: -48px -80px;
|
| 1859 |
+
}
|
| 1860 |
+
|
| 1861 |
+
/* line 122, sass/partials/_jquery_ui.scss */
|
| 1862 |
+
|
| 1863 |
+
.cmb2-element .ui-icon-refresh {
|
| 1864 |
+
background-position: -64px -80px;
|
| 1865 |
+
}
|
| 1866 |
+
|
| 1867 |
+
/* line 123, sass/partials/_jquery_ui.scss */
|
| 1868 |
+
|
| 1869 |
+
.cmb2-element .ui-icon-shuffle {
|
| 1870 |
+
background-position: -80px -80px;
|
| 1871 |
+
}
|
| 1872 |
+
|
| 1873 |
+
/* line 124, sass/partials/_jquery_ui.scss */
|
| 1874 |
+
|
| 1875 |
+
.cmb2-element .ui-icon-transfer-e-w {
|
| 1876 |
+
background-position: -96px -80px;
|
| 1877 |
+
}
|
| 1878 |
+
|
| 1879 |
+
/* line 125, sass/partials/_jquery_ui.scss */
|
| 1880 |
+
|
| 1881 |
+
.cmb2-element .ui-icon-transferthick-e-w {
|
| 1882 |
+
background-position: -112px -80px;
|
| 1883 |
+
}
|
| 1884 |
+
|
| 1885 |
+
/* line 126, sass/partials/_jquery_ui.scss */
|
| 1886 |
+
|
| 1887 |
+
.cmb2-element .ui-icon-folder-collapsed {
|
| 1888 |
+
background-position: 0 -96px;
|
| 1889 |
+
}
|
| 1890 |
+
|
| 1891 |
+
/* line 127, sass/partials/_jquery_ui.scss */
|
| 1892 |
+
|
| 1893 |
+
.cmb2-element .ui-icon-folder-open {
|
| 1894 |
+
background-position: -16px -96px;
|
| 1895 |
+
}
|
| 1896 |
+
|
| 1897 |
+
/* line 128, sass/partials/_jquery_ui.scss */
|
| 1898 |
+
|
| 1899 |
+
.cmb2-element .ui-icon-document {
|
| 1900 |
+
background-position: -32px -96px;
|
| 1901 |
+
}
|
| 1902 |
+
|
| 1903 |
+
/* line 129, sass/partials/_jquery_ui.scss */
|
| 1904 |
+
|
| 1905 |
+
.cmb2-element .ui-icon-document-b {
|
| 1906 |
+
background-position: -48px -96px;
|
| 1907 |
+
}
|
| 1908 |
+
|
| 1909 |
+
/* line 130, sass/partials/_jquery_ui.scss */
|
| 1910 |
+
|
| 1911 |
+
.cmb2-element .ui-icon-note {
|
| 1912 |
+
background-position: -64px -96px;
|
| 1913 |
+
}
|
| 1914 |
+
|
| 1915 |
+
/* line 131, sass/partials/_jquery_ui.scss */
|
| 1916 |
+
|
| 1917 |
+
.cmb2-element .ui-icon-mail-closed {
|
| 1918 |
+
background-position: -80px -96px;
|
| 1919 |
+
}
|
| 1920 |
+
|
| 1921 |
+
/* line 132, sass/partials/_jquery_ui.scss */
|
| 1922 |
+
|
| 1923 |
+
.cmb2-element .ui-icon-mail-open {
|
| 1924 |
+
background-position: -96px -96px;
|
| 1925 |
+
}
|
| 1926 |
+
|
| 1927 |
+
/* line 133, sass/partials/_jquery_ui.scss */
|
| 1928 |
+
|
| 1929 |
+
.cmb2-element .ui-icon-suitcase {
|
| 1930 |
+
background-position: -112px -96px;
|
| 1931 |
+
}
|
| 1932 |
+
|
| 1933 |
+
/* line 134, sass/partials/_jquery_ui.scss */
|
| 1934 |
+
|
| 1935 |
+
.cmb2-element .ui-icon-comment {
|
| 1936 |
+
background-position: -128px -96px;
|
| 1937 |
+
}
|
| 1938 |
+
|
| 1939 |
+
/* line 135, sass/partials/_jquery_ui.scss */
|
| 1940 |
+
|
| 1941 |
+
.cmb2-element .ui-icon-person {
|
| 1942 |
+
background-position: -144px -96px;
|
| 1943 |
+
}
|
| 1944 |
+
|
| 1945 |
+
/* line 136, sass/partials/_jquery_ui.scss */
|
| 1946 |
+
|
| 1947 |
+
.cmb2-element .ui-icon-print {
|
| 1948 |
+
background-position: -160px -96px;
|
| 1949 |
+
}
|
| 1950 |
+
|
| 1951 |
+
/* line 137, sass/partials/_jquery_ui.scss */
|
| 1952 |
+
|
| 1953 |
+
.cmb2-element .ui-icon-trash {
|
| 1954 |
+
background-position: -176px -96px;
|
| 1955 |
+
}
|
| 1956 |
+
|
| 1957 |
+
/* line 138, sass/partials/_jquery_ui.scss */
|
| 1958 |
+
|
| 1959 |
+
.cmb2-element .ui-icon-locked {
|
| 1960 |
+
background-position: -192px -96px;
|
| 1961 |
+
}
|
| 1962 |
+
|
| 1963 |
+
/* line 139, sass/partials/_jquery_ui.scss */
|
| 1964 |
+
|
| 1965 |
+
.cmb2-element .ui-icon-unlocked {
|
| 1966 |
+
background-position: -208px -96px;
|
| 1967 |
+
}
|
| 1968 |
+
|
| 1969 |
+
/* line 140, sass/partials/_jquery_ui.scss */
|
| 1970 |
+
|
| 1971 |
+
.cmb2-element .ui-icon-bookmark {
|
| 1972 |
+
background-position: -224px -96px;
|
| 1973 |
+
}
|
| 1974 |
+
|
| 1975 |
+
/* line 141, sass/partials/_jquery_ui.scss */
|
| 1976 |
+
|
| 1977 |
+
.cmb2-element .ui-icon-tag {
|
| 1978 |
+
background-position: -240px -96px;
|
| 1979 |
+
}
|
| 1980 |
+
|
| 1981 |
+
/* line 142, sass/partials/_jquery_ui.scss */
|
| 1982 |
+
|
| 1983 |
+
.cmb2-element .ui-icon-home {
|
| 1984 |
+
background-position: 0 -112px;
|
| 1985 |
+
}
|
| 1986 |
+
|
| 1987 |
+
/* line 143, sass/partials/_jquery_ui.scss */
|
| 1988 |
+
|
| 1989 |
+
.cmb2-element .ui-icon-flag {
|
| 1990 |
+
background-position: -16px -112px;
|
| 1991 |
+
}
|
| 1992 |
+
|
| 1993 |
+
/* line 144, sass/partials/_jquery_ui.scss */
|
| 1994 |
+
|
| 1995 |
+
.cmb2-element .ui-icon-calendar {
|
| 1996 |
+
background-position: -32px -112px;
|
| 1997 |
+
}
|
| 1998 |
+
|
| 1999 |
+
/* line 145, sass/partials/_jquery_ui.scss */
|
| 2000 |
+
|
| 2001 |
+
.cmb2-element .ui-icon-cart {
|
| 2002 |
+
background-position: -48px -112px;
|
| 2003 |
+
}
|
| 2004 |
+
|
| 2005 |
+
/* line 146, sass/partials/_jquery_ui.scss */
|
| 2006 |
+
|
| 2007 |
+
.cmb2-element .ui-icon-pencil {
|
| 2008 |
+
background-position: -64px -112px;
|
| 2009 |
+
}
|
| 2010 |
+
|
| 2011 |
+
/* line 147, sass/partials/_jquery_ui.scss */
|
| 2012 |
+
|
| 2013 |
+
.cmb2-element .ui-icon-clock {
|
| 2014 |
+
background-position: -80px -112px;
|
| 2015 |
+
}
|
| 2016 |
+
|
| 2017 |
+
/* line 148, sass/partials/_jquery_ui.scss */
|
| 2018 |
+
|
| 2019 |
+
.cmb2-element .ui-icon-disk {
|
| 2020 |
+
background-position: -96px -112px;
|
| 2021 |
+
}
|
| 2022 |
+
|
| 2023 |
+
/* line 149, sass/partials/_jquery_ui.scss */
|
| 2024 |
+
|
| 2025 |
+
.cmb2-element .ui-icon-calculator {
|
| 2026 |
+
background-position: -112px -112px;
|
| 2027 |
+
}
|
| 2028 |
+
|
| 2029 |
+
/* line 150, sass/partials/_jquery_ui.scss */
|
| 2030 |
+
|
| 2031 |
+
.cmb2-element .ui-icon-zoomin {
|
| 2032 |
+
background-position: -128px -112px;
|
| 2033 |
+
}
|
| 2034 |
+
|
| 2035 |
+
/* line 151, sass/partials/_jquery_ui.scss */
|
| 2036 |
+
|
| 2037 |
+
.cmb2-element .ui-icon-zoomout {
|
| 2038 |
+
background-position: -144px -112px;
|
| 2039 |
+
}
|
| 2040 |
+
|
| 2041 |
+
/* line 152, sass/partials/_jquery_ui.scss */
|
| 2042 |
+
|
| 2043 |
+
.cmb2-element .ui-icon-search {
|
| 2044 |
+
background-position: -160px -112px;
|
| 2045 |
+
}
|
| 2046 |
+
|
| 2047 |
+
/* line 153, sass/partials/_jquery_ui.scss */
|
| 2048 |
+
|
| 2049 |
+
.cmb2-element .ui-icon-wrench {
|
| 2050 |
+
background-position: -176px -112px;
|
| 2051 |
+
}
|
| 2052 |
+
|
| 2053 |
+
/* line 154, sass/partials/_jquery_ui.scss */
|
| 2054 |
+
|
| 2055 |
+
.cmb2-element .ui-icon-gear {
|
| 2056 |
+
background-position: -192px -112px;
|
| 2057 |
+
}
|
| 2058 |
+
|
| 2059 |
+
/* line 155, sass/partials/_jquery_ui.scss */
|
| 2060 |
+
|
| 2061 |
+
.cmb2-element .ui-icon-heart {
|
| 2062 |
+
background-position: -208px -112px;
|
| 2063 |
+
}
|
| 2064 |
+
|
| 2065 |
+
/* line 156, sass/partials/_jquery_ui.scss */
|
| 2066 |
+
|
| 2067 |
+
.cmb2-element .ui-icon-star {
|
| 2068 |
+
background-position: -224px -112px;
|
| 2069 |
+
}
|
| 2070 |
+
|
| 2071 |
+
/* line 157, sass/partials/_jquery_ui.scss */
|
| 2072 |
+
|
| 2073 |
+
.cmb2-element .ui-icon-link {
|
| 2074 |
+
background-position: -240px -112px;
|
| 2075 |
+
}
|
| 2076 |
+
|
| 2077 |
+
/* line 158, sass/partials/_jquery_ui.scss */
|
| 2078 |
+
|
| 2079 |
+
.cmb2-element .ui-icon-cancel {
|
| 2080 |
+
background-position: 0 -128px;
|
| 2081 |
+
}
|
| 2082 |
+
|
| 2083 |
+
/* line 159, sass/partials/_jquery_ui.scss */
|
| 2084 |
+
|
| 2085 |
+
.cmb2-element .ui-icon-plus {
|
| 2086 |
+
background-position: -16px -128px;
|
| 2087 |
+
}
|
| 2088 |
+
|
| 2089 |
+
/* line 160, sass/partials/_jquery_ui.scss */
|
| 2090 |
+
|
| 2091 |
+
.cmb2-element .ui-icon-plusthick {
|
| 2092 |
+
background-position: -32px -128px;
|
| 2093 |
+
}
|
| 2094 |
+
|
| 2095 |
+
/* line 161, sass/partials/_jquery_ui.scss */
|
| 2096 |
+
|
| 2097 |
+
.cmb2-element .ui-icon-minus {
|
| 2098 |
+
background-position: -48px -128px;
|
| 2099 |
+
}
|
| 2100 |
+
|
| 2101 |
+
/* line 162, sass/partials/_jquery_ui.scss */
|
| 2102 |
+
|
| 2103 |
+
.cmb2-element .ui-icon-minusthick {
|
| 2104 |
+
background-position: -64px -128px;
|
| 2105 |
+
}
|
| 2106 |
+
|
| 2107 |
+
/* line 163, sass/partials/_jquery_ui.scss */
|
| 2108 |
+
|
| 2109 |
+
.cmb2-element .ui-icon-close {
|
| 2110 |
+
background-position: -80px -128px;
|
| 2111 |
+
}
|
| 2112 |
+
|
| 2113 |
+
/* line 164, sass/partials/_jquery_ui.scss */
|
| 2114 |
+
|
| 2115 |
+
.cmb2-element .ui-icon-closethick {
|
| 2116 |
+
background-position: -96px -128px;
|
| 2117 |
+
}
|
| 2118 |
+
|
| 2119 |
+
/* line 165, sass/partials/_jquery_ui.scss */
|
| 2120 |
+
|
| 2121 |
+
.cmb2-element .ui-icon-key {
|
| 2122 |
+
background-position: -112px -128px;
|
| 2123 |
+
}
|
| 2124 |
+
|
| 2125 |
+
/* line 166, sass/partials/_jquery_ui.scss */
|
| 2126 |
+
|
| 2127 |
+
.cmb2-element .ui-icon-lightbulb {
|
| 2128 |
+
background-position: -128px -128px;
|
| 2129 |
+
}
|
| 2130 |
+
|
| 2131 |
+
/* line 167, sass/partials/_jquery_ui.scss */
|
| 2132 |
+
|
| 2133 |
+
.cmb2-element .ui-icon-scissors {
|
| 2134 |
+
background-position: -144px -128px;
|
| 2135 |
+
}
|
| 2136 |
+
|
| 2137 |
+
/* line 168, sass/partials/_jquery_ui.scss */
|
| 2138 |
+
|
| 2139 |
+
.cmb2-element .ui-icon-clipboard {
|
| 2140 |
+
background-position: -160px -128px;
|
| 2141 |
+
}
|
| 2142 |
+
|
| 2143 |
+
/* line 169, sass/partials/_jquery_ui.scss */
|
| 2144 |
+
|
| 2145 |
+
.cmb2-element .ui-icon-copy {
|
| 2146 |
+
background-position: -176px -128px;
|
| 2147 |
+
}
|
| 2148 |
+
|
| 2149 |
+
/* line 170, sass/partials/_jquery_ui.scss */
|
| 2150 |
+
|
| 2151 |
+
.cmb2-element .ui-icon-contact {
|
| 2152 |
+
background-position: -192px -128px;
|
| 2153 |
+
}
|
| 2154 |
+
|
| 2155 |
+
/* line 171, sass/partials/_jquery_ui.scss */
|
| 2156 |
+
|
| 2157 |
+
.cmb2-element .ui-icon-image {
|
| 2158 |
+
background-position: -208px -128px;
|
| 2159 |
+
}
|
| 2160 |
+
|
| 2161 |
+
/* line 172, sass/partials/_jquery_ui.scss */
|
| 2162 |
+
|
| 2163 |
+
.cmb2-element .ui-icon-video {
|
| 2164 |
+
background-position: -224px -128px;
|
| 2165 |
+
}
|
| 2166 |
+
|
| 2167 |
+
/* line 173, sass/partials/_jquery_ui.scss */
|
| 2168 |
+
|
| 2169 |
+
.cmb2-element .ui-icon-script {
|
| 2170 |
+
background-position: -240px -128px;
|
| 2171 |
+
}
|
| 2172 |
+
|
| 2173 |
+
/* line 174, sass/partials/_jquery_ui.scss */
|
| 2174 |
+
|
| 2175 |
+
.cmb2-element .ui-icon-alert {
|
| 2176 |
+
background-position: 0 -144px;
|
| 2177 |
+
}
|
| 2178 |
+
|
| 2179 |
+
/* line 175, sass/partials/_jquery_ui.scss */
|
| 2180 |
+
|
| 2181 |
+
.cmb2-element .ui-icon-info {
|
| 2182 |
+
background-position: -16px -144px;
|
| 2183 |
+
}
|
| 2184 |
+
|
| 2185 |
+
/* line 176, sass/partials/_jquery_ui.scss */
|
| 2186 |
+
|
| 2187 |
+
.cmb2-element .ui-icon-notice {
|
| 2188 |
+
background-position: -32px -144px;
|
| 2189 |
+
}
|
| 2190 |
+
|
| 2191 |
+
/* line 177, sass/partials/_jquery_ui.scss */
|
| 2192 |
+
|
| 2193 |
+
.cmb2-element .ui-icon-help {
|
| 2194 |
+
background-position: -48px -144px;
|
| 2195 |
+
}
|
| 2196 |
+
|
| 2197 |
+
/* line 178, sass/partials/_jquery_ui.scss */
|
| 2198 |
+
|
| 2199 |
+
.cmb2-element .ui-icon-check {
|
| 2200 |
+
background-position: -64px -144px;
|
| 2201 |
+
}
|
| 2202 |
+
|
| 2203 |
+
/* line 179, sass/partials/_jquery_ui.scss */
|
| 2204 |
+
|
| 2205 |
+
.cmb2-element .ui-icon-bullet {
|
| 2206 |
+
background-position: -80px -144px;
|
| 2207 |
+
}
|
| 2208 |
+
|
| 2209 |
+
/* line 180, sass/partials/_jquery_ui.scss */
|
| 2210 |
+
|
| 2211 |
+
.cmb2-element .ui-icon-radio-off {
|
| 2212 |
+
background-position: -96px -144px;
|
| 2213 |
+
}
|
| 2214 |
+
|
| 2215 |
+
/* line 181, sass/partials/_jquery_ui.scss */
|
| 2216 |
+
|
| 2217 |
+
.cmb2-element .ui-icon-radio-on {
|
| 2218 |
+
background-position: -112px -144px;
|
| 2219 |
+
}
|
| 2220 |
+
|
| 2221 |
+
/* line 182, sass/partials/_jquery_ui.scss */
|
| 2222 |
+
|
| 2223 |
+
.cmb2-element .ui-icon-pin-w {
|
| 2224 |
+
background-position: -128px -144px;
|
| 2225 |
+
}
|
| 2226 |
+
|
| 2227 |
+
/* line 183, sass/partials/_jquery_ui.scss */
|
| 2228 |
+
|
| 2229 |
+
.cmb2-element .ui-icon-pin-s {
|
| 2230 |
+
background-position: -144px -144px;
|
| 2231 |
+
}
|
| 2232 |
+
|
| 2233 |
+
/* line 184, sass/partials/_jquery_ui.scss */
|
| 2234 |
+
|
| 2235 |
+
.cmb2-element .ui-icon-play {
|
| 2236 |
+
background-position: 0 -160px;
|
| 2237 |
+
}
|
| 2238 |
+
|
| 2239 |
+
/* line 185, sass/partials/_jquery_ui.scss */
|
| 2240 |
+
|
| 2241 |
+
.cmb2-element .ui-icon-pause {
|
| 2242 |
+
background-position: -16px -160px;
|
| 2243 |
+
}
|
| 2244 |
+
|
| 2245 |
+
/* line 186, sass/partials/_jquery_ui.scss */
|
| 2246 |
+
|
| 2247 |
+
.cmb2-element .ui-icon-seek-next {
|
| 2248 |
+
background-position: -32px -160px;
|
| 2249 |
+
}
|
| 2250 |
+
|
| 2251 |
+
/* line 187, sass/partials/_jquery_ui.scss */
|
| 2252 |
+
|
| 2253 |
+
.cmb2-element .ui-icon-seek-prev {
|
| 2254 |
+
background-position: -48px -160px;
|
| 2255 |
+
}
|
| 2256 |
+
|
| 2257 |
+
/* line 188, sass/partials/_jquery_ui.scss */
|
| 2258 |
+
|
| 2259 |
+
.cmb2-element .ui-icon-seek-end {
|
| 2260 |
+
background-position: -64px -160px;
|
| 2261 |
+
}
|
| 2262 |
+
|
| 2263 |
+
/* line 189, sass/partials/_jquery_ui.scss */
|
| 2264 |
+
|
| 2265 |
+
.cmb2-element .ui-icon-seek-start {
|
| 2266 |
+
background-position: -80px -160px;
|
| 2267 |
+
}
|
| 2268 |
+
|
| 2269 |
+
/* line 190, sass/partials/_jquery_ui.scss */
|
| 2270 |
+
|
| 2271 |
+
.cmb2-element .ui-icon-seek-first {
|
| 2272 |
+
background-position: -80px -160px;
|
| 2273 |
+
}
|
| 2274 |
+
|
| 2275 |
+
/* line 191, sass/partials/_jquery_ui.scss */
|
| 2276 |
+
|
| 2277 |
+
.cmb2-element .ui-icon-stop {
|
| 2278 |
+
background-position: -96px -160px;
|
| 2279 |
+
}
|
| 2280 |
+
|
| 2281 |
+
/* line 192, sass/partials/_jquery_ui.scss */
|
| 2282 |
+
|
| 2283 |
+
.cmb2-element .ui-icon-eject {
|
| 2284 |
+
background-position: -112px -160px;
|
| 2285 |
+
}
|
| 2286 |
+
|
| 2287 |
+
/* line 193, sass/partials/_jquery_ui.scss */
|
| 2288 |
+
|
| 2289 |
+
.cmb2-element .ui-icon-volume-off {
|
| 2290 |
+
background-position: -128px -160px;
|
| 2291 |
+
}
|
| 2292 |
+
|
| 2293 |
+
/* line 194, sass/partials/_jquery_ui.scss */
|
| 2294 |
+
|
| 2295 |
+
.cmb2-element .ui-icon-volume-on {
|
| 2296 |
+
background-position: -144px -160px;
|
| 2297 |
+
}
|
| 2298 |
+
|
| 2299 |
+
/* line 195, sass/partials/_jquery_ui.scss */
|
| 2300 |
+
|
| 2301 |
+
.cmb2-element .ui-icon-power {
|
| 2302 |
+
background-position: 0 -176px;
|
| 2303 |
+
}
|
| 2304 |
+
|
| 2305 |
+
/* line 196, sass/partials/_jquery_ui.scss */
|
| 2306 |
+
|
| 2307 |
+
.cmb2-element .ui-icon-signal-diag {
|
| 2308 |
+
background-position: -16px -176px;
|
| 2309 |
+
}
|
| 2310 |
+
|
| 2311 |
+
/* line 197, sass/partials/_jquery_ui.scss */
|
| 2312 |
+
|
| 2313 |
+
.cmb2-element .ui-icon-signal {
|
| 2314 |
+
background-position: -32px -176px;
|
| 2315 |
+
}
|
| 2316 |
+
|
| 2317 |
+
/* line 198, sass/partials/_jquery_ui.scss */
|
| 2318 |
+
|
| 2319 |
+
.cmb2-element .ui-icon-battery-0 {
|
| 2320 |
+
background-position: -48px -176px;
|
| 2321 |
+
}
|
| 2322 |
+
|
| 2323 |
+
/* line 199, sass/partials/_jquery_ui.scss */
|
| 2324 |
+
|
| 2325 |
+
.cmb2-element .ui-icon-battery-1 {
|
| 2326 |
+
background-position: -64px -176px;
|
| 2327 |
+
}
|
| 2328 |
+
|
| 2329 |
+
/* line 200, sass/partials/_jquery_ui.scss */
|
| 2330 |
+
|
| 2331 |
+
.cmb2-element .ui-icon-battery-2 {
|
| 2332 |
+
background-position: -80px -176px;
|
| 2333 |
+
}
|
| 2334 |
+
|
| 2335 |
+
/* line 201, sass/partials/_jquery_ui.scss */
|
| 2336 |
+
|
| 2337 |
+
.cmb2-element .ui-icon-battery-3 {
|
| 2338 |
+
background-position: -96px -176px;
|
| 2339 |
+
}
|
| 2340 |
+
|
| 2341 |
+
/* line 202, sass/partials/_jquery_ui.scss */
|
| 2342 |
+
|
| 2343 |
+
.cmb2-element .ui-icon-circle-plus {
|
| 2344 |
+
background-position: 0 -192px;
|
| 2345 |
+
}
|
| 2346 |
+
|
| 2347 |
+
/* line 203, sass/partials/_jquery_ui.scss */
|
| 2348 |
+
|
| 2349 |
+
.cmb2-element .ui-icon-circle-minus {
|
| 2350 |
+
background-position: -16px -192px;
|
| 2351 |
+
}
|
| 2352 |
+
|
| 2353 |
+
/* line 204, sass/partials/_jquery_ui.scss */
|
| 2354 |
+
|
| 2355 |
+
.cmb2-element .ui-icon-circle-close {
|
| 2356 |
+
background-position: -32px -192px;
|
| 2357 |
+
}
|
| 2358 |
+
|
| 2359 |
+
/* line 205, sass/partials/_jquery_ui.scss */
|
| 2360 |
+
|
| 2361 |
+
.cmb2-element .ui-icon-circle-triangle-e {
|
| 2362 |
+
background-position: -48px -192px;
|
| 2363 |
+
}
|
| 2364 |
+
|
| 2365 |
+
/* line 206, sass/partials/_jquery_ui.scss */
|
| 2366 |
+
|
| 2367 |
+
.cmb2-element .ui-icon-circle-triangle-s {
|
| 2368 |
+
background-position: -64px -192px;
|
| 2369 |
+
}
|
| 2370 |
+
|
| 2371 |
+
/* line 207, sass/partials/_jquery_ui.scss */
|
| 2372 |
+
|
| 2373 |
+
.cmb2-element .ui-icon-circle-triangle-w {
|
| 2374 |
+
background-position: -80px -192px;
|
| 2375 |
+
}
|
| 2376 |
+
|
| 2377 |
+
/* line 208, sass/partials/_jquery_ui.scss */
|
| 2378 |
+
|
| 2379 |
+
.cmb2-element .ui-icon-circle-triangle-n {
|
| 2380 |
+
background-position: -96px -192px;
|
| 2381 |
+
}
|
| 2382 |
+
|
| 2383 |
+
/* line 209, sass/partials/_jquery_ui.scss */
|
| 2384 |
+
|
| 2385 |
+
.cmb2-element .ui-icon-circle-arrow-e {
|
| 2386 |
+
background-position: -112px -192px;
|
| 2387 |
+
}
|
| 2388 |
+
|
| 2389 |
+
/* line 210, sass/partials/_jquery_ui.scss */
|
| 2390 |
+
|
| 2391 |
+
.cmb2-element .ui-icon-circle-arrow-s {
|
| 2392 |
+
background-position: -128px -192px;
|
| 2393 |
+
}
|
| 2394 |
+
|
| 2395 |
+
/* line 211, sass/partials/_jquery_ui.scss */
|
| 2396 |
+
|
| 2397 |
+
.cmb2-element .ui-icon-circle-arrow-w {
|
| 2398 |
+
background-position: -144px -192px;
|
| 2399 |
+
}
|
| 2400 |
+
|
| 2401 |
+
/* line 212, sass/partials/_jquery_ui.scss */
|
| 2402 |
+
|
| 2403 |
+
.cmb2-element .ui-icon-circle-arrow-n {
|
| 2404 |
+
background-position: -160px -192px;
|
| 2405 |
+
}
|
| 2406 |
+
|
| 2407 |
+
/* line 213, sass/partials/_jquery_ui.scss */
|
| 2408 |
+
|
| 2409 |
+
.cmb2-element .ui-icon-circle-zoomin {
|
| 2410 |
+
background-position: -176px -192px;
|
| 2411 |
+
}
|
| 2412 |
+
|
| 2413 |
+
/* line 214, sass/partials/_jquery_ui.scss */
|
| 2414 |
+
|
| 2415 |
+
.cmb2-element .ui-icon-circle-zoomout {
|
| 2416 |
+
background-position: -192px -192px;
|
| 2417 |
+
}
|
| 2418 |
+
|
| 2419 |
+
/* line 215, sass/partials/_jquery_ui.scss */
|
| 2420 |
+
|
| 2421 |
+
.cmb2-element .ui-icon-circle-check {
|
| 2422 |
+
background-position: -208px -192px;
|
| 2423 |
+
}
|
| 2424 |
+
|
| 2425 |
+
/* line 216, sass/partials/_jquery_ui.scss */
|
| 2426 |
+
|
| 2427 |
+
.cmb2-element .ui-icon-circlesmall-plus {
|
| 2428 |
+
background-position: 0 -208px;
|
| 2429 |
+
}
|
| 2430 |
+
|
| 2431 |
+
/* line 217, sass/partials/_jquery_ui.scss */
|
| 2432 |
+
|
| 2433 |
+
.cmb2-element .ui-icon-circlesmall-minus {
|
| 2434 |
+
background-position: -16px -208px;
|
| 2435 |
+
}
|
| 2436 |
+
|
| 2437 |
+
/* line 218, sass/partials/_jquery_ui.scss */
|
| 2438 |
+
|
| 2439 |
+
.cmb2-element .ui-icon-circlesmall-close {
|
| 2440 |
+
background-position: -32px -208px;
|
| 2441 |
+
}
|
| 2442 |
+
|
| 2443 |
+
/* line 219, sass/partials/_jquery_ui.scss */
|
| 2444 |
+
|
| 2445 |
+
.cmb2-element .ui-icon-squaresmall-plus {
|
| 2446 |
+
background-position: -48px -208px;
|
| 2447 |
+
}
|
| 2448 |
+
|
| 2449 |
+
/* line 220, sass/partials/_jquery_ui.scss */
|
| 2450 |
+
|
| 2451 |
+
.cmb2-element .ui-icon-squaresmall-minus {
|
| 2452 |
+
background-position: -64px -208px;
|
| 2453 |
+
}
|
| 2454 |
+
|
| 2455 |
+
/* line 221, sass/partials/_jquery_ui.scss */
|
| 2456 |
+
|
| 2457 |
+
.cmb2-element .ui-icon-squaresmall-close {
|
| 2458 |
+
background-position: -80px -208px;
|
| 2459 |
+
}
|
| 2460 |
+
|
| 2461 |
+
/* line 222, sass/partials/_jquery_ui.scss */
|
| 2462 |
+
|
| 2463 |
+
.cmb2-element .ui-icon-grip-dotted-vertical {
|
| 2464 |
+
background-position: 0 -224px;
|
| 2465 |
+
}
|
| 2466 |
+
|
| 2467 |
+
/* line 223, sass/partials/_jquery_ui.scss */
|
| 2468 |
+
|
| 2469 |
+
.cmb2-element .ui-icon-grip-dotted-horizontal {
|
| 2470 |
+
background-position: -16px -224px;
|
| 2471 |
+
}
|
| 2472 |
+
|
| 2473 |
+
/* line 224, sass/partials/_jquery_ui.scss */
|
| 2474 |
+
|
| 2475 |
+
.cmb2-element .ui-icon-grip-solid-vertical {
|
| 2476 |
+
background-position: -32px -224px;
|
| 2477 |
+
}
|
| 2478 |
+
|
| 2479 |
+
/* line 225, sass/partials/_jquery_ui.scss */
|
| 2480 |
+
|
| 2481 |
+
.cmb2-element .ui-icon-grip-solid-horizontal {
|
| 2482 |
+
background-position: -48px -224px;
|
| 2483 |
+
}
|
| 2484 |
+
|
| 2485 |
+
/* line 226, sass/partials/_jquery_ui.scss */
|
| 2486 |
+
|
| 2487 |
+
.cmb2-element .ui-icon-gripsmall-diagonal-se {
|
| 2488 |
+
background-position: -64px -224px;
|
| 2489 |
+
}
|
| 2490 |
+
|
| 2491 |
+
/* line 227, sass/partials/_jquery_ui.scss */
|
| 2492 |
+
|
| 2493 |
+
.cmb2-element .ui-icon-grip-diagonal-se {
|
| 2494 |
+
background-position: -80px -224px;
|
| 2495 |
+
}
|
| 2496 |
+
|
| 2497 |
+
/* line 228, sass/partials/_jquery_ui.scss */
|
| 2498 |
+
|
| 2499 |
+
.cmb2-element .ui-corner-all,
|
| 2500 |
+
.cmb2-element .ui-corner-top,
|
| 2501 |
+
.cmb2-element .ui-corner-left,
|
| 2502 |
+
.cmb2-element .ui-corner-tl {
|
| 2503 |
+
-moz-border-radius-topleft: 4px;
|
| 2504 |
+
-webkit-border-top-left-radius: 4px;
|
| 2505 |
+
-khtml-border-top-left-radius: 4px;
|
| 2506 |
+
border-top-left-radius: 4px;
|
| 2507 |
+
}
|
| 2508 |
+
|
| 2509 |
+
/* line 229, sass/partials/_jquery_ui.scss */
|
| 2510 |
+
|
| 2511 |
+
.cmb2-element .ui-corner-all,
|
| 2512 |
+
.cmb2-element .ui-corner-top,
|
| 2513 |
+
.cmb2-element .ui-corner-right,
|
| 2514 |
+
.cmb2-element .ui-corner-tr {
|
| 2515 |
+
-moz-border-radius-topright: 4px;
|
| 2516 |
+
-webkit-border-top-right-radius: 4px;
|
| 2517 |
+
-khtml-border-top-right-radius: 4px;
|
| 2518 |
+
border-top-right-radius: 4px;
|
| 2519 |
+
}
|
| 2520 |
+
|
| 2521 |
+
/* line 230, sass/partials/_jquery_ui.scss */
|
| 2522 |
+
|
| 2523 |
+
.cmb2-element .ui-corner-all,
|
| 2524 |
+
.cmb2-element .ui-corner-bottom,
|
| 2525 |
+
.cmb2-element .ui-corner-left,
|
| 2526 |
+
.cmb2-element .ui-corner-bl {
|
| 2527 |
+
-moz-border-radius-bottomleft: 4px;
|
| 2528 |
+
-webkit-border-bottom-left-radius: 4px;
|
| 2529 |
+
-khtml-border-bottom-left-radius: 4px;
|
| 2530 |
+
border-bottom-left-radius: 4px;
|
| 2531 |
+
}
|
| 2532 |
+
|
| 2533 |
+
/* line 231, sass/partials/_jquery_ui.scss */
|
| 2534 |
+
|
| 2535 |
+
.cmb2-element .ui-corner-all,
|
| 2536 |
+
.cmb2-element .ui-corner-bottom,
|
| 2537 |
+
.cmb2-element .ui-corner-right,
|
| 2538 |
+
.cmb2-element .ui-corner-br {
|
| 2539 |
+
-moz-border-radius-bottomright: 4px;
|
| 2540 |
+
-webkit-border-bottom-right-radius: 4px;
|
| 2541 |
+
-khtml-border-bottom-right-radius: 4px;
|
| 2542 |
+
border-bottom-right-radius: 4px;
|
| 2543 |
+
}
|
| 2544 |
+
|
| 2545 |
+
/* line 232, sass/partials/_jquery_ui.scss */
|
| 2546 |
+
|
| 2547 |
+
.cmb2-element .ui-widget-overlay {
|
| 2548 |
+
background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 2549 |
+
opacity: .30;
|
| 2550 |
+
filter: Alpha(Opacity=30);
|
| 2551 |
+
}
|
| 2552 |
+
|
| 2553 |
+
/* line 233, sass/partials/_jquery_ui.scss */
|
| 2554 |
+
|
| 2555 |
+
.cmb2-element .ui-widget-shadow {
|
| 2556 |
+
margin: -8px 0 0 -8px;
|
| 2557 |
+
padding: 8px;
|
| 2558 |
+
background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 2559 |
+
opacity: .30;
|
| 2560 |
+
filter: Alpha(Opacity=30);
|
| 2561 |
+
-moz-border-radius: 8px;
|
| 2562 |
+
-khtml-border-radius: 8px;
|
| 2563 |
+
-webkit-border-radius: 8px;
|
| 2564 |
+
border-radius: 8px;
|
| 2565 |
+
}
|
| 2566 |
+
|
| 2567 |
+
/* line 234, sass/partials/_jquery_ui.scss */
|
| 2568 |
+
|
| 2569 |
+
.cmb2-element .ui-datepicker {
|
| 2570 |
+
width: 17em;
|
| 2571 |
+
padding: .2em .2em 0;
|
| 2572 |
+
display: none;
|
| 2573 |
+
}
|
| 2574 |
+
|
| 2575 |
+
/* line 235, sass/partials/_jquery_ui.scss */
|
| 2576 |
+
|
| 2577 |
+
.cmb2-element .ui-datepicker .ui-datepicker-header {
|
| 2578 |
+
position: relative;
|
| 2579 |
+
padding: .2em 0;
|
| 2580 |
+
}
|
| 2581 |
+
|
| 2582 |
+
/* line 236, sass/partials/_jquery_ui.scss */
|
| 2583 |
+
|
| 2584 |
+
.cmb2-element .ui-datepicker .ui-datepicker-prev,
|
| 2585 |
+
.cmb2-element .ui-datepicker .ui-datepicker-next {
|
| 2586 |
+
position: absolute;
|
| 2587 |
+
top: 2px;
|
| 2588 |
+
width: 1.8em;
|
| 2589 |
+
height: 1.8em;
|
| 2590 |
+
}
|
| 2591 |
+
|
| 2592 |
+
/* line 237, sass/partials/_jquery_ui.scss */
|
| 2593 |
+
|
| 2594 |
+
.cmb2-element .ui-datepicker .ui-datepicker-prev-hover,
|
| 2595 |
+
.cmb2-element .ui-datepicker .ui-datepicker-next-hover {
|
| 2596 |
+
top: 1px;
|
| 2597 |
+
}
|
| 2598 |
+
|
| 2599 |
+
/* line 238, sass/partials/_jquery_ui.scss */
|
| 2600 |
+
|
| 2601 |
+
.cmb2-element .ui-datepicker .ui-datepicker-prev {
|
| 2602 |
+
left: 2px;
|
| 2603 |
+
}
|
| 2604 |
+
|
| 2605 |
+
/* line 239, sass/partials/_jquery_ui.scss */
|
| 2606 |
+
|
| 2607 |
+
.cmb2-element .ui-datepicker .ui-datepicker-next {
|
| 2608 |
+
right: 2px;
|
| 2609 |
+
}
|
| 2610 |
+
|
| 2611 |
+
/* line 240, sass/partials/_jquery_ui.scss */
|
| 2612 |
+
|
| 2613 |
+
.cmb2-element .ui-datepicker .ui-datepicker-prev-hover {
|
| 2614 |
+
left: 1px;
|
| 2615 |
+
}
|
| 2616 |
+
|
| 2617 |
+
/* line 241, sass/partials/_jquery_ui.scss */
|
| 2618 |
+
|
| 2619 |
+
.cmb2-element .ui-datepicker .ui-datepicker-next-hover {
|
| 2620 |
+
right: 1px;
|
| 2621 |
+
}
|
| 2622 |
+
|
| 2623 |
+
/* line 242, sass/partials/_jquery_ui.scss */
|
| 2624 |
+
|
| 2625 |
+
.cmb2-element .ui-datepicker .ui-datepicker-prev span,
|
| 2626 |
+
.cmb2-element .ui-datepicker .ui-datepicker-next span {
|
| 2627 |
+
display: block;
|
| 2628 |
+
position: absolute;
|
| 2629 |
+
left: 50%;
|
| 2630 |
+
margin-left: -8px;
|
| 2631 |
+
top: 50%;
|
| 2632 |
+
margin-top: -8px;
|
| 2633 |
+
}
|
| 2634 |
+
|
| 2635 |
+
/* line 243, sass/partials/_jquery_ui.scss */
|
| 2636 |
+
|
| 2637 |
+
.cmb2-element .ui-datepicker .ui-datepicker-title {
|
| 2638 |
+
margin: 0 2.3em;
|
| 2639 |
+
line-height: 1.8em;
|
| 2640 |
+
text-align: center;
|
| 2641 |
+
}
|
| 2642 |
+
|
| 2643 |
+
/* line 244, sass/partials/_jquery_ui.scss */
|
| 2644 |
+
|
| 2645 |
+
.cmb2-element .ui-datepicker .ui-datepicker-title select {
|
| 2646 |
+
font-size: 1em;
|
| 2647 |
+
margin: 1px 0;
|
| 2648 |
+
}
|
| 2649 |
+
|
| 2650 |
+
/* line 245, sass/partials/_jquery_ui.scss */
|
| 2651 |
+
|
| 2652 |
+
.cmb2-element .ui-datepicker select.ui-datepicker-month-year {
|
| 2653 |
+
width: 100%;
|
| 2654 |
+
}
|
| 2655 |
+
|
| 2656 |
+
/* line 246, sass/partials/_jquery_ui.scss */
|
| 2657 |
+
|
| 2658 |
+
.cmb2-element .ui-datepicker select.ui-datepicker-month,
|
| 2659 |
+
.cmb2-element .ui-datepicker select.ui-datepicker-year {
|
| 2660 |
+
width: 49%;
|
| 2661 |
+
}
|
| 2662 |
+
|
| 2663 |
+
/* line 248, sass/partials/_jquery_ui.scss */
|
| 2664 |
+
|
| 2665 |
+
.cmb2-element .ui-datepicker table {
|
| 2666 |
+
width: 100%;
|
| 2667 |
+
font-size: .9em;
|
| 2668 |
+
border-collapse: collapse;
|
| 2669 |
+
margin: 0 0 .4em;
|
| 2670 |
+
}
|
| 2671 |
+
|
| 2672 |
+
/* line 249, sass/partials/_jquery_ui.scss */
|
| 2673 |
+
|
| 2674 |
+
.cmb2-element .ui-datepicker th {
|
| 2675 |
+
padding: .7em .3em;
|
| 2676 |
+
text-align: center;
|
| 2677 |
+
font-weight: bold;
|
| 2678 |
+
border: 0;
|
| 2679 |
+
}
|
| 2680 |
+
|
| 2681 |
+
/* line 250, sass/partials/_jquery_ui.scss */
|
| 2682 |
+
|
| 2683 |
+
.cmb2-element .ui-datepicker td {
|
| 2684 |
+
border: 0;
|
| 2685 |
+
padding: 1px;
|
| 2686 |
+
}
|
| 2687 |
+
|
| 2688 |
+
/* line 251, sass/partials/_jquery_ui.scss */
|
| 2689 |
+
|
| 2690 |
+
.cmb2-element .ui-datepicker td span,
|
| 2691 |
+
.cmb2-element .ui-datepicker td a {
|
| 2692 |
+
display: block;
|
| 2693 |
+
padding: .2em;
|
| 2694 |
+
text-align: right;
|
| 2695 |
+
text-decoration: none;
|
| 2696 |
+
}
|
| 2697 |
+
|
| 2698 |
+
/* line 252, sass/partials/_jquery_ui.scss */
|
| 2699 |
+
|
| 2700 |
+
.cmb2-element .ui-datepicker .ui-datepicker-buttonpane {
|
| 2701 |
+
background-image: none;
|
| 2702 |
+
margin: .7em 0 0 0;
|
| 2703 |
+
padding: 0 .2em;
|
| 2704 |
+
border-left: 0;
|
| 2705 |
+
border-right: 0;
|
| 2706 |
+
border-bottom: 0;
|
| 2707 |
+
}
|
| 2708 |
+
|
| 2709 |
+
/* line 253, sass/partials/_jquery_ui.scss */
|
| 2710 |
+
|
| 2711 |
+
.cmb2-element .ui-datepicker .ui-datepicker-buttonpane button {
|
| 2712 |
+
float: right;
|
| 2713 |
+
margin: .5em .2em .4em;
|
| 2714 |
+
cursor: pointer;
|
| 2715 |
+
padding: .2em .6em .3em .6em;
|
| 2716 |
+
width: auto;
|
| 2717 |
+
overflow: visible;
|
| 2718 |
+
}
|
| 2719 |
+
|
| 2720 |
+
/* line 254, sass/partials/_jquery_ui.scss */
|
| 2721 |
+
|
| 2722 |
+
.cmb2-element .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
|
| 2723 |
+
float: left;
|
| 2724 |
+
}
|
| 2725 |
+
|
| 2726 |
+
/* line 255, sass/partials/_jquery_ui.scss */
|
| 2727 |
+
|
| 2728 |
+
.cmb2-element .ui-datepicker.ui-datepicker-multi {
|
| 2729 |
+
width: auto;
|
| 2730 |
+
}
|
| 2731 |
+
|
| 2732 |
+
/* line 256, sass/partials/_jquery_ui.scss */
|
| 2733 |
+
|
| 2734 |
+
.cmb2-element .ui-datepicker-multi .ui-datepicker-group {
|
| 2735 |
+
float: left;
|
| 2736 |
+
}
|
| 2737 |
+
|
| 2738 |
+
/* line 257, sass/partials/_jquery_ui.scss */
|
| 2739 |
+
|
| 2740 |
+
.cmb2-element .ui-datepicker-multi .ui-datepicker-group table {
|
| 2741 |
+
width: 95%;
|
| 2742 |
+
margin: 0 auto .4em;
|
| 2743 |
+
}
|
| 2744 |
+
|
| 2745 |
+
/* line 258, sass/partials/_jquery_ui.scss */
|
| 2746 |
+
|
| 2747 |
+
.cmb2-element .ui-datepicker-multi-2 .ui-datepicker-group {
|
| 2748 |
+
width: 50%;
|
| 2749 |
+
}
|
| 2750 |
+
|
| 2751 |
+
/* line 259, sass/partials/_jquery_ui.scss */
|
| 2752 |
+
|
| 2753 |
+
.cmb2-element .ui-datepicker-multi-3 .ui-datepicker-group {
|
| 2754 |
+
width: 33.3%;
|
| 2755 |
+
}
|
| 2756 |
+
|
| 2757 |
+
/* line 260, sass/partials/_jquery_ui.scss */
|
| 2758 |
+
|
| 2759 |
+
.cmb2-element .ui-datepicker-multi-4 .ui-datepicker-group {
|
| 2760 |
+
width: 25%;
|
| 2761 |
+
}
|
| 2762 |
+
|
| 2763 |
+
/* line 261, sass/partials/_jquery_ui.scss */
|
| 2764 |
+
|
| 2765 |
+
.cmb2-element .ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header {
|
| 2766 |
+
border-left-width: 0;
|
| 2767 |
+
}
|
| 2768 |
+
|
| 2769 |
+
/* line 262, sass/partials/_jquery_ui.scss */
|
| 2770 |
+
|
| 2771 |
+
.cmb2-element .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
|
| 2772 |
+
border-left-width: 0;
|
| 2773 |
+
}
|
| 2774 |
+
|
| 2775 |
+
/* line 263, sass/partials/_jquery_ui.scss */
|
| 2776 |
+
|
| 2777 |
+
.cmb2-element .ui-datepicker-multi .ui-datepicker-buttonpane {
|
| 2778 |
+
clear: left;
|
| 2779 |
+
}
|
| 2780 |
+
|
| 2781 |
+
/* line 264, sass/partials/_jquery_ui.scss */
|
| 2782 |
+
|
| 2783 |
+
.cmb2-element .ui-datepicker-row-break {
|
| 2784 |
+
clear: both;
|
| 2785 |
+
width: 100%;
|
| 2786 |
+
font-size: 0em;
|
| 2787 |
+
}
|
| 2788 |
+
|
| 2789 |
+
/* line 265, sass/partials/_jquery_ui.scss */
|
| 2790 |
+
|
| 2791 |
+
.cmb2-element .ui-datepicker-rtl {
|
| 2792 |
+
direction: rtl;
|
| 2793 |
+
}
|
| 2794 |
+
|
| 2795 |
+
/* line 267, sass/partials/_jquery_ui.scss */
|
| 2796 |
+
|
| 2797 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-prev {
|
| 2798 |
+
right: 2px;
|
| 2799 |
+
left: auto;
|
| 2800 |
+
}
|
| 2801 |
+
|
| 2802 |
+
/* line 268, sass/partials/_jquery_ui.scss */
|
| 2803 |
+
|
| 2804 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-next {
|
| 2805 |
+
left: 2px;
|
| 2806 |
+
right: auto;
|
| 2807 |
+
}
|
| 2808 |
+
|
| 2809 |
+
/* line 269, sass/partials/_jquery_ui.scss */
|
| 2810 |
+
|
| 2811 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-prev:hover {
|
| 2812 |
+
right: 1px;
|
| 2813 |
+
left: auto;
|
| 2814 |
+
}
|
| 2815 |
+
|
| 2816 |
+
/* line 270, sass/partials/_jquery_ui.scss */
|
| 2817 |
+
|
| 2818 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-next:hover {
|
| 2819 |
+
left: 1px;
|
| 2820 |
+
right: auto;
|
| 2821 |
+
}
|
| 2822 |
+
|
| 2823 |
+
/* line 271, sass/partials/_jquery_ui.scss */
|
| 2824 |
+
|
| 2825 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane {
|
| 2826 |
+
clear: right;
|
| 2827 |
+
}
|
| 2828 |
+
|
| 2829 |
+
/* line 272, sass/partials/_jquery_ui.scss */
|
| 2830 |
+
|
| 2831 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane button {
|
| 2832 |
+
float: left;
|
| 2833 |
+
}
|
| 2834 |
+
|
| 2835 |
+
/* line 273, sass/partials/_jquery_ui.scss */
|
| 2836 |
+
|
| 2837 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current {
|
| 2838 |
+
float: right;
|
| 2839 |
+
}
|
| 2840 |
+
|
| 2841 |
+
/* line 274, sass/partials/_jquery_ui.scss */
|
| 2842 |
+
|
| 2843 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-group {
|
| 2844 |
+
float: right;
|
| 2845 |
+
}
|
| 2846 |
+
|
| 2847 |
+
/* line 275, sass/partials/_jquery_ui.scss */
|
| 2848 |
+
|
| 2849 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header {
|
| 2850 |
+
border-right-width: 0;
|
| 2851 |
+
border-left-width: 1px;
|
| 2852 |
+
}
|
| 2853 |
+
|
| 2854 |
+
/* line 276, sass/partials/_jquery_ui.scss */
|
| 2855 |
+
|
| 2856 |
+
.cmb2-element .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
|
| 2857 |
+
border-right-width: 0;
|
| 2858 |
+
border-left-width: 1px;
|
| 2859 |
+
}
|
| 2860 |
+
|
| 2861 |
+
/* line 278, sass/partials/_jquery_ui.scss */
|
| 2862 |
+
|
| 2863 |
+
.cmb2-element .ui-datepicker-cover {
|
| 2864 |
+
display: none; /*sorry for IE5*/
|
| 2865 |
+
display/**/: block; /*sorry for IE5*/
|
| 2866 |
+
position: absolute; /*must have*/
|
| 2867 |
+
z-index: -1; /*must have*/
|
| 2868 |
+
filter: mask(); /*must have*/
|
| 2869 |
+
top: -4px; /*must have*/
|
| 2870 |
+
left: -4px; /*must have*/
|
| 2871 |
+
width: 200px; /*must have*/
|
| 2872 |
+
height: 200px; /*must have*/
|
| 2873 |
+
}
|
| 2874 |
+
|
| 2875 |
+
/*# sourceMappingURL=cmb2.css.map */
|
| 2876 |
+
|
| 2877 |
+
@media (max-width: 450px) {
|
| 2878 |
+
|
| 2879 |
+
/* line 209, sass/partials/_main_wrap.scss */
|
| 2880 |
+
|
| 2881 |
+
.cmb-th {
|
| 2882 |
+
font-size: 1.2em;
|
| 2883 |
+
display: block;
|
| 2884 |
+
float: none;
|
| 2885 |
+
padding-bottom: 1em;
|
| 2886 |
+
text-align: left;
|
| 2887 |
+
width: 100%;
|
| 2888 |
+
}
|
| 2889 |
+
|
| 2890 |
+
/* line 27, sass/partials/_mixins.scss */
|
| 2891 |
+
|
| 2892 |
+
.cmb-th label {
|
| 2893 |
+
display: block;
|
| 2894 |
+
margin-top: 0em;
|
| 2895 |
+
padding-bottom: 5px;
|
| 2896 |
+
}
|
| 2897 |
+
|
| 2898 |
+
/* line 32, sass/partials/_mixins.scss */
|
| 2899 |
+
|
| 2900 |
+
.cmb-th label:after {
|
| 2901 |
+
border-bottom: 1px solid #e9e9e9;
|
| 2902 |
+
content: '';
|
| 2903 |
+
clear: both;
|
| 2904 |
+
display: block;
|
| 2905 |
+
padding-top: .4em;
|
| 2906 |
+
}
|
| 2907 |
+
|
| 2908 |
+
/* line 431, sass/partials/_main_wrap.scss */
|
| 2909 |
+
|
| 2910 |
+
.cmb-th,
|
| 2911 |
+
.cmb-td,
|
| 2912 |
+
.cmb-th + .cmb-td {
|
| 2913 |
+
display: block;
|
| 2914 |
+
float: none;
|
| 2915 |
+
width: 100%;
|
| 2916 |
+
}
|
| 2917 |
+
|
| 2918 |
+
/* line 70, sass/partials/_post_metaboxes.scss */
|
| 2919 |
+
|
| 2920 |
+
.postbox-container .cmb-row:not(:last-of-type),
|
| 2921 |
+
.postbox-container .cmb-repeatable-group:not(:last-of-type),
|
| 2922 |
+
.cmb-repeat-group-wrap .cmb-row:not(:last-of-type),
|
| 2923 |
+
.cmb-repeat-group-wrap .cmb-repeatable-group:not(:last-of-type) {
|
| 2924 |
+
border-bottom: 0;
|
| 2925 |
+
}
|
| 2926 |
+
|
| 2927 |
+
}
|
| 2928 |
+
|
cmb2/css/cmb2.css.map
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"version": 3,
|
| 3 |
+
"mappings": ";;;;;;;AAIA,UAAW;EACV,MAAM,EAAE,CAAC;;;AAET;mBACS;EACR,SAAS,ECEK,IAAI;EDDlB,SAAS,EAAE,IAAI;EACf,OAAO,EAAE,GAAG;;;AAMZ,uCAAc;EACb,KAAK,EAAE,IAAI;;;AAIb,mBAAS;EACR,KAAK,EAAE,KAAK;;;AAEZ,sCAAqB;EACpB,WAAW,EChBE,sCAAkB;EDiB/B,WAAW,EAAE,IAAI;;;AAMlB,kEACkB;EACjB,KAAK,EAAE,KAAK;;;AAIb,gCAAkB;EACjB,KAAK,EAAE,IAAI;;;AAIZ,iCAAmB;EAClB,KAAK,EAAE,KAAK;;;AAIb,iCAAmB;EAClB,KAAK,EAAE,GAAG;;;AAGX,0BAAY;EACX,OAAO,EAAE,OAAO;;;AAIhB;;8CAES;EACR,WAAW,EAAE,IAAI;;;AAKpB,aAAG;EACF,MAAM,EAAE,CAAC;;;AAGV,aAAG;EACF,SAAS,EC5DK,IAAI;ED6DlB,WAAW,EAAE,IAAI;EACjB,MAAM,EAAE,WAAW;;;AAQpB,iBAAO;EACN,SAAS,ECvEK,IAAI;EDwElB,UAAU,EAAE,GAAG;;;AAGhB;yBACe;EACd,UAAU,ECtEI,OAAO;;;ADyEtB,8BAAoB;EACnB,MAAM,EAAE,SAAS;EACjB,OAAO,EAAE,CAAC;;;AAGX,iCAAuB;EACtB,MAAM,EAAE,SAAS;EACjB,OAAO,EAAE,CAAC;;;AAGX;kBACQ;EACP,WAAW,EAAE,MAAM;;;AAGpB,qBAAW;EACV,MAAM,EAAE,4BAAgC;;;AAGzC,8BAAoB;EACnB,UAAU,EAAE,IAAI;;;AAGjB,oBAAU;EACT,KAAK,EAAE,GAAG;;;AAEV,6BAAS;EACR,KAAK,EAAE,IAAI;;;AAOb;gCACsB;EACrB,cAAc,EAAE,MAAM;;;AAGvB;+BACqB;EACpB,MAAM,EAAE,UAAU;;;AAGnB,mBAAS;EACR,MAAM,EAAE,CAAC;;;AAET,yBAAQ;EACP,OAAO,EAAE,EAAE;EACX,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;;;AAGZ,kCAAiB;EAChB,OAAO,EAAE,SAAS;;;AAElB,gDAAgB;EACf,OAAO,EAAE,CAAC;;;AAIZ,wDAAuC;EACtC,WAAW,EAAE,CAAC;EACd,cAAc,EAAE,KAAK;;;;AAKxB,aAAc;EACb,KAAK,EAAE,IAAI;EACX,MAAM,EAAE,CAAC;;;AAIR;;;gEACQ;EACP,MAAM,EAAE,CAAC;;;AAKV,6DAAqC;EACpC,aAAa,EAAE,IAAI;EACnB,UAAU,EAAE,UAAU;EACtB,KAAK,EAAE,IAAI;;;;AAKd,YAAa;EACZ,MAAM,EAAE,SAAS;;;;AAGlB;;mCAEoC;EACnC,MAAM,EAAE,CAAC;;;;AAGV;;kCAEmC;EAClC,aAAa,EAAE,CAAC;;;;AAGjB,wBAAyB;EACxB,MAAM,EAAE,iBAAqB;EAC7B,OAAO,EAAE,KAAK;EACd,SAAS,EAAE,MAAM;;;AACjB,gCAAU;EACT,MAAM,EAAE,SAAS;;;;AAMnB,OAAQ;EACP,KAAK,ECnMU,OAAO;EDoMtB,KAAK,EAAE,IAAI;EACX,WAAW,EAAE,GAAG;EAChB,WAAW,EAAE,GAAG;EAChB,OAAO,EAAE,gBAAgB;EACzB,cAAc,EAAE,GAAG;EACnB,KAAK,EAAE,KAAK;;AAEZ,yBAAkC;;EATnC,OAAQ;IE3MP,SAAS,EAAE,KAAK;IAehB,OAAO,EAAE,KAAK;IACd,KAAK,EAAE,IAAI;IACX,cAAc,EAAE,GAAG;IACnB,UAAU,EAAE,IAAI;IAChB,KAAK,EAAE,IAAI;;;EAEX,aAAM;IACL,OAAO,EAAE,KAAK;IACd,UAAU,EAAE,GAAG;IACf,cAAc,EAAE,GAAG;;;EAEnB,mBAAQ;IACP,aAAa,EAAE,iBAAqB;IACpC,OAAO,EAAE,EAAE;IACX,KAAK,EAAE,IAAI;IACX,OAAO,EAAE,KAAK;IACd,WAAW,EAAE,IAAI;;;;;AF0LpB,OAAQ;EACP,WAAW,EAAE,GAAG;EAChB,SAAS,EAAE,IAAI;EACf,OAAO,EAAE,SAAS;EAClB,cAAc,EAAE,MAAM;;;;AAKtB,uBAAQ;EACP,OAAO,EAAE,CAAC;;;;AAIZ,aAAc;EACb,OAAO,EAAE,KAAK;EACd,OAAO,EAAE,KAAK;;;;AAGf,iBAAkB;EACjB,KAAK,EAAE,IAAI;;;;AAGZ,eAAgB;EACf,cAAc,EAAE,GAAG;;;;AAGpB,eAAgB;EACf,UAAU,EAAE,KAAK;;;;AAGlB,iBAAkB;EACjB,OAAO,EAAE,IAAI;;;;AAKb,6BAAQ;EACP,OAAO,EAAE,GAAG;;;AAGb,sCAAiB;EAChB,gBAAgB,ECxPF,OAAO;EDyPrB,OAAO,EAAE,kBAAkB;EAC3B,MAAM,EAAE,MAAM;EACd,UAAU,EAAE,KAAK;EACjB,SAAS,EAAE,IAAI;EACf,WAAW,EAAE,GAAG;;;AAEhB,yCAAG;EACF,MAAM,EAAE,CAAC;EACT,MAAM,EAAE,CAAC;EACT,SAAS,EAAE,KAAK;EAChB,WAAW,EAAE,GAAG;EAChB,OAAO,EAAE,YAAY;;;AAGtB,8CAAQ;EACP,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;;;AAIb,oDAA+B;EExR/B,SAAS,EAAE,KAAK;EAehB,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;EACX,cAAc,EAAE,GAAG;EACnB,UAAU,EAAE,IAAI;EAChB,KAAK,EAAE,IAAI;;;AAEX,0DAAM;EACL,OAAO,EAAE,KAAK;EACd,UAAU,EAAE,GAAG;EACf,cAAc,EAAE,GAAG;;;AAEnB,gEAAQ;EACP,aAAa,EAAE,iBAAqB;EACpC,OAAO,EAAE,EAAE;EACX,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,KAAK;EACd,WAAW,EAAE,IAAI;;;AF6PnB,qCAAgB;EACf,SAAS,EAAE,GAAG;EACd,YAAY,EAAE,GAAG;EACjB,eAAe,EAAE,IAAI;;;AAErB,gDAAW;EACV,SAAS,EAAE,KAAK;EAChB,MAAM,EAAE,KAAK;EACb,WAAW,EAAE,KAAK;EAClB,KAAK,EAAE,GAAG;;;AAEV,0EAA4B;EAC3B,WAAW,EAAE,KAAK;;;AAMrB,yCAAoB;EACnB,KAAK,EAAE,KAAK;;;;AAKd,0BAA2B;EAC1B,KAAK,EC3SU,OAAO;ED4StB,UAAU,EAAE,MAAM;EAClB,MAAM,EAAE,CAAC;EACT,WAAW,EAAE,IAAI;;;;AAGlB,6BAA8B;EAC7B,KAAK,EClTU,OAAO;EDmTtB,UAAU,EAAE,MAAM;;;;AAGnB,mBAAoB;EACnB,MAAM,EAAE,SAAS;EACjB,OAAO,EAAE,SAAS;EAClB,SAAS,EAAE,IAAI;;;;AAGhB,cAAe;EACd,OAAO,EAAE,SAAS;;;;AAGnB,cAAe;EACd,OAAO,EAAE,YAAY;EACrB,aAAa,EAAE,IAAI;;;;AAGpB,2BAA4B;EAC3B,MAAM,EAAE,CAAC;;;;AAKT,8BAAY;EACX,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,YAAY;EACrB,KAAK,EAAE,IAAI;EACX,YAAY,EAAE,IAAI;EAClB,KAAK,EAAE,IAAI;;;AAEX,kCAAI;EACH,SAAS,EAAE,KAAK;;;AAIlB;gCACc;EACb,UAAU,ECrVI,OAAO;EDsVrB,MAAM,EAAE,iBAAqB;EAC7B,aAAa,EAAE,GAAG;EAClB,kBAAkB,EAAE,GAAG;EACtB,MAAM,EAAE,UAAU;EACnB,OAAO,EAAE,GAAG;;;AAGb,gCAAc;EACb,KAAK,EAAE,IAAI;EACX,SAAS,EAAE,KAAK;;;AAGjB,gEAA2B;EAC1B,QAAQ,EAAE,QAAQ;;;AAElB,kHAAyB;EACxB,UAAU,EAAE,6BAA6B;EACzC,MAAM,EAAE,IAAI;EACZ,IAAI,EAAE,IAAI;EACV,QAAQ,EAAE,QAAQ;EAClB,WAAW,EAAE,OAAO;EACpB,GAAG,EAAE,IAAI;EACT,KAAK,EAAE,IAAI;;;AAOZ,uDAAyB;EACxB,GAAG,EAAE,IAAI;;;AAIX,0EAAqC;EACpC,MAAM,EAAE,OAAO;;;;AAKjB,kDAAmD;EAClD,KAAK,EAAE,IAAI;EACX,KAAK,EAAE,IAAI;EACX,YAAY,EAAE,IAAI;EAClB,KAAK,EAAE,IAAI;;;;AAGZ,mBAAoB;EACnB,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,YAAY;EACrB,aAAa,EAAE,IAAI;EACnB,KAAK,EAAE,IAAI;;;AAEX,uBAAI;EACH,MAAM,EAAE,IAAI;EACZ,KAAK,EAAE,IAAI;EACX,YAAY,EAAE,IAAI;;;;AAIpB,oBAAqB;EACpB,MAAM,EAAE,CAAC;;;;AAGV,mBAAoB;EACnB,UAAU,EAAE,IAAI;;;AAGjB,yBAAkC;;EACjC;;mBAEkB;IACjB,OAAO,EAAE,KAAK;IACd,KAAK,EAAE,IAAI;IACX,KAAK,EAAE,IAAI;;;;;;;AG7aZ,eAAc;EACb,UAAU,EAAE,IAAI;EAChB,MAAM,EAAE,iBAAe;EACvB,MAAM,EAAE,KAAK;EACb,MAAM,EAAE,CAAC;EACT,QAAQ,EAAE,QAAQ;EAClB,QAAQ,EAAE,IAAI;EACd,KAAK,EAAE,GAAG;;EACV,OAAO,EAAE,EAAE;;;AAEX,kBAAG;EACF,eAAe,EAAE,IAAI;EACrB,MAAM,EAAE,CAAC;EACT,OAAO,EAAE,CAAC;;;AAGX,kBAAG;EACF,MAAM,EAAE,OAAO;EACf,aAAa,EAAE,CAAC;EAChB,WAAW,EFjBE,UAAU;EEkBvB,SAAS,EAAE,IAAI;EACf,OAAO,EAAE,OAAO;;;AAEhB,2BAAW;EACV,UAAU,EFbE,OAAO;EEcnB,KAAK,EAAE,IAAI;;;AAKd,uBAAsB;EACrB,KAAK,EAAE,GAAG;;;;;;;;AClCZ,2BAA4B;EAC3B,WAAW,EAAE,IAAI;EACjB,YAAY,EAAE,IAAI;EAClB,YAAY,EAAE,KAAK;EAEnB,UAAU,EAAE,KAAK;;;;AAKjB,gEAAW;EACV,MAAM,EAAE,CAAC;;;AAET,0HAA6B;EAC5B,OAAO,EAAE,OAAO;;;AAKhB,0HAAc;EACb,KAAK,EAAE,IAAI;;;AAKd,4DAAS;EACR,OAAO,EAAE,SAAS;EAClB,MAAM,EAAE,SAAS;;;AAEjB,kFAAW;EACV,KAAK,EAAE,IAAI;EACX,QAAQ,EAAE,QAAQ;;;AAIpB,4FAAyB;EACxB,OAAO,EAAE,KAAK;EACd,SAAS,EAAE,IAAI;EACf,SAAS,EAAE,cAAc;;;AAG1B,4GAAiC;EAChC,cAAc,EAAE,CAAC;;;AAGlB,0DAAQ;EACP,KAAK,EAAE,GAAG;EACV,OAAO,EAAE,QAAQ;;;AAIlB,0DAAQ;EACP,aAAa,EAAE,CAAC;EAChB,OAAO,EAAE,CAAC;EACV,WAAW,EAAE,GAAG;;;AAGjB,0FAAwB;EACvB,cAAc,EAAE,KAAK;;;AAGtB,8EAAkB;EACjB,KAAK,EAAE,GAAG;EACV,KAAK,EAAE,KAAK;;;AAGb;;+DACyC;EACxC,aAAa,EAAE,iBAAqB;;AAEpC,yBAAkC;;EAJnC;;iEACyC;IAIvC,aAAa,EAAE,CAAC;;;;AAIlB;;4CACsB;EACrB,WAAW,EAAE,KAAK;;;AAKjB,oXAA6B;EAC5B,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;;;AAEX,gcAAmB;EAClB,KAAK,EAAE,IAAI;;;AAGZ,4gBAAsC;EACrC,OAAO,EAAE,SAAS;;;AAGnB,oZAAQ;EACP,OAAO,EAAE,UAAU;EACnB,KAAK,EAAE,IAAI;EACX,KAAK,EAAE,IAAI;;;AAGZ,wgBAAqC;EACpC,WAAW,EAAE,KAAK;;;AAGnB,gdAAuB;EACtB,aAAa,EAAE,CAAC;;;;;;;ACxGrB,mCAAoC;EACnC,MAAM,EAAE,CAAC;;;;AAOT;;kCAAoB;EACnB,SAAS,EAAE,KAAK;;;;AAIlB,qBAAsB;EACrB,KAAK,EAAE,IAAI;;;;;;;ACTV;uDAA6B;EAC5B,OAAO,EAAE,OAAO;;;AAKhB;iEAAqC;EACpC,KAAK,EAAE,IAAI;;;AAGZ;;yCAA0C;EACzC,WAAW,EAAE,CAAC;EACd,UAAU,EAAE,GAAG;EACf,OAAO,EAAE,KAAK;;;AAIhB;gCAAM;EACL,OAAO,EAAE,KAAK;EACd,WAAW,EAAE,GAAG;EAChB,OAAO,EAAE,OAAO;;;AAKlB;qCAAsB;EACrB,aAAa,EAAE,iBAAqB;;;AAGrC;wEAAyD;EACxD,aAAa,EAAE,CAAC;EAChB,aAAa,EAAE,MAAM;;;AAGtB;;;;;iCAEkB;EACjB,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;;;AAGZ;+BAAgB;EACf,OAAO,EAAE,IAAI;;;AAGd;+BAAgB;EACf,cAAc,EAAE,GAAG;;;AAGpB;uBAAQ;EJvCR,OAAO,EAAE,KAAK;EACd,KAAK,EAAE,IAAI;EACX,cAAc,EAAE,GAAG;EACnB,UAAU,EAAE,IAAI;EAChB,KAAK,EAAE,IAAI;EIqCV,YAAY,EAAE,CAAC;EACf,aAAa,EAAE,CAAC;;;AJpCjB;6BAAM;EACL,OAAO,EAAE,KAAK;EACd,UAAU,EAAE,GAAG;EACf,cAAc,EAAE,GAAG;;;AAEnB;mCAAQ;EACP,aAAa,EAAE,iBAAqB;EACpC,OAAO,EAAE,EAAE;EACX,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,KAAK;EACd,WAAW,EAAE,IAAI;;;AAvBnB;6BAAM;EACL,SAAS,EDHK,IAAI;ECIlB,WAAW,EAAE,KAAK;;;AImDlB;8CAAQ;EACP,WAAW,EAAE,CAAC;;;AAEf;gEAA0B;EACzB,OAAO,EAAE,CAAC;;;AAMX;wCAAQ;EACP,OAAO,EAAE,CAAC;;;AAKX;mEAA2B;EAC1B,UAAU,EAAE,GAAG;;;AAQf;;;oDAAI;EACH,SAAS,EAAE,GAAG;EAEd,MAAM,EAAE,IAAI;;;AAKf;gCAAiB;EAChB,OAAO,EAAE,MAAM;EACf,WAAW,EAAE,MAAM;;;AAGpB;yCAA0B;EACzB,OAAO,EAAE,KAAK;EACd,OAAO,EAAE,OAAO;;;AAKhB;;;4DAC0B;EACzB,WAAW,EAAE,MAAM;EACnB,OAAO,EAAE,MAAM;;;AAIjB;kDAAmC;EAClC,cAAc,EAAE,KAAK;;;AAGtB;mCAAoB;EACnB,SAAS,EAAE,KAAK;EAChB,UAAU,EAAE,MAAM;;;AAGnB;+BAAgB;EACf,KAAK,EAAE,IAAI;EACX,WAAW,EAAE,IAAI;EACjB,cAAc,EAAE,CAAC;;;AAIjB;6DAAQ;EACP,KAAK,EAAE,IAAI;EACX,KAAK,EAAE,IAAI;EACX,KAAK,EAAE,IAAI;EACX,WAAW,EAAE,CAAC;;;AACd;4EAAiB;EAChB,KAAK,EAAE,KAAK;EACZ,MAAM,EAAE,CAAC;;;AAKZ;mCAAoB;EACnB,KAAK,EAAE,IAAI;EACX,UAAU,EAAE,IAAI;;;;ACnJjB,oCAAuB;EACtB,SAAS,EAAE,MAAM;;;AAElB,wBAAW;EACV,KAAK,EAAE,IAAI;EACX,KAAK,EAAE,KAAK;EACZ,KAAK,EAAE,IAAI;EACX,MAAM,EAAE,IAAI;EACZ,MAAM,EAAE,OAAO;EACf,KAAK,EAAE,IAAI;EACX,QAAQ,EAAE,QAAQ;;;AAClB,+BAAS;EACR,OAAO,EAAE,OAAO;EAChB,KAAK,EAAE,IAAI;EACX,IAAI,EAAE,yBAAyB;EAC/B,KAAK,EAAE,IAAI;EACX,OAAO,EAAE,YAAY;EACrB,OAAO,EAAE,QAAQ;EACjB,GAAG,EAAE,CAAC;EACN,QAAQ,EAAE,QAAQ;EAClB,sBAAsB,EAAE,WAAW;EACnC,uBAAuB,EAAE,SAAS;EAClC,eAAe,EAAE,eAAe;;;AAMhC,+CAAS;EACR,OAAO,EAAE,OAAO;;;AAKnB,2EAA8D;EAC7D,kBAAkB,EAAE,eAAe;EACnC,UAAU,EAAE,eAAe;EAC3B,MAAM,EAAE,eAAe;EACvB,QAAQ,EAAE,QAAQ;EAClB,IAAI,EAAE,CAAC;EACP,GAAG,EAAE,IAAI;EACT,WAAW,EAAE,GAAG;EAChB,MAAM,EAAE,OAAO;;;AACf,2FAAkB;EACjB,KAAK,ENxBQ,IAAI;;;AMyBjB,iGAAQ;EACP,KAAK,EN3BO,IAAI;;;;;;;;;;;;;AOVnB,+BAAkB;EAAE,OAAO,EAAE,IAAI;;;AACjC,0CAA6B;EAAE,QAAQ,EAAE,mBAAmB;EAAE,IAAI,EAAE,qBAAqB;EAAE,IAAI,EAAE,wBAAqB;;;AACtH,8BAAiB;EAAE,MAAM,EAAE,CAAC;EAAE,OAAO,EAAE,CAAC;EAAE,MAAM,EAAE,CAAC;EAAE,OAAO,EAAE,CAAC;EAAE,WAAW,EAAE,GAAG;EAAE,eAAe,EAAE,IAAI;EAAE,SAAS,EAAE,IAAI;EAAE,UAAU,EAAE,IAAI;;;AAC3I,uCAA0B;EAAE,OAAO,EAAE,GAAG;EAAE,OAAO,EAAE,KAAK;EAAE,MAAM,EAAE,CAAC;EAAE,KAAK,EAAE,IAAI;EAAE,UAAU,EAAE,MAAM;;;AACpG,iCAAoB;EAAE,OAAO,EAAE,YAAY;;;AAC3C,wCAA2B;EAAE,MAAM,EAAC,EAAE;;;AACtC,iCAAoB;EAAE,OAAO,EAAC,KAAK;;;AACnC,6BAAgB;EAAE,KAAK,EAAE,IAAI;EAAE,MAAM,EAAE,IAAI;EAAE,GAAG,EAAE,CAAC;EAAE,IAAI,EAAE,CAAC;EAAE,QAAQ,EAAE,QAAQ;EAAE,OAAO,EAAE,CAAC;EAAE,MAAM,EAAC,gBAAgB;;;AACrH,gCAAmB;EAAE,MAAM,EAAE,kBAAkB;;;AAC/C,sBAAS;EAAE,OAAO,EAAE,KAAK;EAAE,WAAW,EAAE,QAAQ;EAAE,QAAQ,EAAE,MAAM;EAAE,iBAAiB,EAAE,SAAS;;;AAChG,gCAAmB;EAAE,QAAQ,EAAE,QAAQ;EAAE,GAAG,EAAE,CAAC;EAAE,IAAI,EAAE,CAAC;EAAE,KAAK,EAAE,IAAI;EAAE,MAAM,EAAE,IAAI;;;AACnF,wBAAW;EACV,WAAW,EAAE,wBAAwB;EAAE,SAAS,EAAE,KAAK;;;AACvD,mCAAW;EAAE,SAAS,EAAE,GAAG;;;AAC3B,mIAAgC;EAAE,WAAW,EAAE,wBAAwB;EAAE,SAAS,EAAE,GAAG;;;AAExF,gCAAmB;EAAE,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,KAAK,EAAE,OAAO;;;AACnJ,kCAAqB;EAAE,KAAK,EAAE,OAAO;;;AACrC,+BAAkB;EAAE,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,gFAAgF;EAAE,KAAK,EAAE,OAAO;EAAE,WAAW,EAAE,IAAI;;;AAC9K,iCAAoB;EAAE,KAAK,EAAE,OAAO;;;AACpC,sIAA6F;EAAE,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,WAAW,EAAE,MAAM;EAAE,KAAK,EAAE,OAAO;;;AAClP,oHAA2E;EAAE,KAAK,EAAE,OAAO;EAAE,eAAe,EAAE,IAAI;;;AAClH,kQAA+K;EAAE,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,WAAW,EAAE,MAAM;EAAE,KAAK,EAAE,OAAO;;;AACpU,sEAA2C;EAAE,KAAK,EAAE,OAAO;EAAE,eAAe,EAAE,IAAI;;;AAClF,mIAA0F;EAAE,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,WAAW,EAAE,MAAM;EAAE,KAAK,EAAE,OAAO;;;AAC/O,iHAAwE;EAAE,KAAK,EAAE,OAAO;EAAE,eAAe,EAAE,IAAI;;;AAC/G,gCAAmB;EAAE,OAAO,EAAE,IAAI;;;AAClC,4IAAoG;EAAC,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,KAAK,EAAE,OAAO;;;AACnO,kJAAwG;EAAE,KAAK,EAAE,OAAO;;;AACxH,gIAAuF;EAAC,MAAM,EAAE,iBAAiB;EAAE,UAAU,EAAE,uEAAuE;EAAE,KAAK,EAAE,OAAO;;;AACtN,sIAA6F;EAAE,KAAK,EAAE,OAAO;;;AAC7G,+IAAsG;EAAE,KAAK,EAAE,OAAO;;;AACtH,+IAAsG;EAAE,WAAW,EAAE,IAAI;;;AACzH,qJAA6G;EAAE,OAAO,EAAE,EAAE;EAAE,MAAM,EAAC,iBAAiB;EAAE,WAAW,EAAE,MAAM;;;AACzK,yIAAgG;EAAE,OAAO,EAAE,GAAG;EAAE,MAAM,EAAC,iBAAiB;EAAE,gBAAgB,EAAE,IAAI;;;AAChK,sBAAS;EAAE,KAAK,EAAE,IAAI;EAAE,MAAM,EAAE,IAAI;EAAE,gBAAgB,EAAE,0CAA0C;;;AAClG,yCAA4B;EAAC,gBAAgB,EAAE,0CAA0C;;;AACzF,wCAA2B;EAAC,gBAAgB,EAAE,0CAA0C;;;AACxF,wCAA2B;EAAE,gBAAgB,EAAE,0CAA0C;;;AACzF,8EAAmD;EAAC,gBAAgB,EAAE,0CAA0C;;;AAChH,uCAA0B;EAAC,gBAAgB,EAAE,0CAA0C;;;AACvF,0CAA6B;EAAC,gBAAgB,EAAE,0CAA0C;;;AAC1F,mFAAwD;EAAC,gBAAgB,EAAE,0CAA0C;;;AACrH,gCAAmB;EAAE,mBAAmB,EAAE,GAAG;;;AAC7C,iCAAoB;EAAE,mBAAmB,EAAE,OAAO;;;AAClD,gCAAmB;EAAE,mBAAmB,EAAE,OAAO;;;AACjD,iCAAoB;EAAE,mBAAmB,EAAE,OAAO;;;AAClD,gCAAmB;EAAE,mBAAmB,EAAE,OAAO;;;AACjD,iCAAoB;EAAE,mBAAmB,EAAE,OAAO;;;AAClD,gCAAmB;EAAE,mBAAmB,EAAE,OAAO;;;AACjD,iCAAoB;EAAE,mBAAmB,EAAE,QAAQ;;;AACnD,kCAAqB;EAAE,mBAAmB,EAAE,QAAQ;;;AACpD,kCAAqB;EAAE,mBAAmB,EAAE,QAAQ;;;AACpD,mCAAsB;EAAE,mBAAmB,EAAE,OAAO;;;AACpD,oCAAuB;EAAE,mBAAmB,EAAE,WAAW;;;AACzD,mCAAsB;EAAE,mBAAmB,EAAE,WAAW;;;AACxD,oCAAuB;EAAE,mBAAmB,EAAE,WAAW;;;AACzD,mCAAsB;EAAE,mBAAmB,EAAE,WAAW;;;AACxD,oCAAuB;EAAE,mBAAmB,EAAE,WAAW;;;AACzD,mCAAsB;EAAE,mBAAmB,EAAE,WAAW;;;AACxD,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,qCAAwB;EAAE,mBAAmB,EAAE,YAAY;;;AAC3D,qCAAwB;EAAE,mBAAmB,EAAE,YAAY;;;AAC3D,gCAAmB;EAAE,mBAAmB,EAAE,OAAO;;;AACjD,iCAAoB;EAAE,mBAAmB,EAAE,WAAW;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,WAAW;;;AACrD,iCAAoB;EAAE,mBAAmB,EAAE,WAAW;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,WAAW;;;AACrD,iCAAoB;EAAE,mBAAmB,EAAE,WAAW;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,WAAW;;;AACrD,iCAAoB;EAAE,mBAAmB,EAAE,YAAY;;;AACvD,kCAAqB;EAAE,mBAAmB,EAAE,YAAY;;;AACxD,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,kCAAqB;EAAE,mBAAmB,EAAE,YAAY;;;AACxD,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,oCAAuB;EAAE,mBAAmB,EAAE,YAAY;;;AAC1D,qCAAwB;EAAE,mBAAmB,EAAE,OAAO;;;AACtD,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,qCAAwB;EAAE,mBAAmB,EAAE,WAAW;;;AAC1D,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,qCAAwB;EAAE,mBAAmB,EAAE,WAAW;;;AAC1D,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,qCAAwB;EAAE,mBAAmB,EAAE,WAAW;;;AAC1D,sCAAyB;EAAE,mBAAmB,EAAE,YAAY;;;AAC5D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,yCAA4B;EAAE,mBAAmB,EAAE,YAAY;;;AAC/D,2CAA8B;EAAE,mBAAmB,EAAE,OAAO;;;AAC5D,2CAA8B;EAAE,mBAAmB,EAAE,WAAW;;;AAChE,2CAA8B;EAAE,mBAAmB,EAAE,WAAW;;;AAChE,2CAA8B;EAAE,mBAAmB,EAAE,WAAW;;;AAChE,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,sCAAyB;EAAE,mBAAmB,EAAE,WAAW;;;AAC3D,sCAAyB;EAAE,mBAAmB,EAAE,YAAY;;;AAC5D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,8BAAiB;EAAE,mBAAmB,EAAE,OAAO;;;AAC/C,mCAAsB;EAAE,mBAAmB,EAAE,WAAW;;;AACxD,8BAAiB;EAAE,mBAAmB,EAAE,WAAW;;;AACnD,6BAAgB;EAAE,mBAAmB,EAAE,WAAW;;;AAClD,8BAAiB;EAAE,mBAAmB,EAAE,WAAW;;;AACnD,8BAAiB;EAAE,mBAAmB,EAAE,WAAW;;;AACnD,mCAAsB;EAAE,mBAAmB,EAAE,WAAW;;;AACxD,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,uCAA0B;EAAE,mBAAmB,EAAE,OAAO;;;AACxD,kCAAqB;EAAE,mBAAmB,EAAE,WAAW;;;AACvD,+BAAkB;EAAE,mBAAmB,EAAE,WAAW;;;AACpD,iCAAoB;EAAE,mBAAmB,EAAE,WAAW;;;AACtD,2BAAc;EAAE,mBAAmB,EAAE,WAAW;;;AAChD,kCAAqB;EAAE,mBAAmB,EAAE,WAAW;;;AACvD,gCAAmB;EAAE,mBAAmB,EAAE,WAAW;;;AACrD,+BAAkB;EAAE,mBAAmB,EAAE,YAAY;;;AACrD,8BAAiB;EAAE,mBAAmB,EAAE,YAAY;;;AACpD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,+BAAkB;EAAE,mBAAmB,EAAE,YAAY;;;AACrD,+BAAkB;EAAE,mBAAmB,EAAE,YAAY;;;AACrD,0BAAa;EAAE,mBAAmB,EAAE,YAAY;;;AAChD,2BAAc;EAAE,mBAAmB,EAAE,QAAQ;;;AAC7C,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,+BAAkB;EAAE,mBAAmB,EAAE,YAAY;;;AACrD,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,iCAAoB;EAAE,mBAAmB,EAAE,aAAa;;;AACxD,6BAAgB;EAAE,mBAAmB,EAAE,aAAa;;;AACpD,8BAAiB;EAAE,mBAAmB,EAAE,aAAa;;;AACrD,6BAAgB;EAAE,mBAAmB,EAAE,aAAa;;;AACpD,6BAAgB;EAAE,mBAAmB,EAAE,aAAa;;;AACpD,2BAAc;EAAE,mBAAmB,EAAE,aAAa;;;AAClD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,2BAAc;EAAE,mBAAmB,EAAE,aAAa;;;AAClD,2BAAc;EAAE,mBAAmB,EAAE,aAAa;;;AAClD,6BAAgB;EAAE,mBAAmB,EAAE,QAAQ;;;AAC/C,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,iCAAoB;EAAE,mBAAmB,EAAE,YAAY;;;AACvD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,iCAAoB;EAAE,mBAAmB,EAAE,YAAY;;;AACvD,0BAAa;EAAE,mBAAmB,EAAE,aAAa;;;AACjD,gCAAmB;EAAE,mBAAmB,EAAE,aAAa;;;AACvD,+BAAkB;EAAE,mBAAmB,EAAE,aAAa;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,aAAa;;;AACvD,2BAAc;EAAE,mBAAmB,EAAE,aAAa;;;AAClD,8BAAiB;EAAE,mBAAmB,EAAE,aAAa;;;AACrD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,6BAAgB;EAAE,mBAAmB,EAAE,aAAa;;;AACpD,4BAAe;EAAE,mBAAmB,EAAE,QAAQ;;;AAC9C,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,+BAAkB;EAAE,mBAAmB,EAAE,aAAa;;;AACtD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,2BAAc;EAAE,mBAAmB,EAAE,QAAQ;;;AAC7C,4BAAe;EAAE,mBAAmB,EAAE,YAAY;;;AAClD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,+BAAkB;EAAE,mBAAmB,EAAE,YAAY;;;AACrD,iCAAoB;EAAE,mBAAmB,EAAE,YAAY;;;AACvD,iCAAoB;EAAE,mBAAmB,EAAE,YAAY;;;AACvD,2BAAc;EAAE,mBAAmB,EAAE,YAAY;;;AACjD,4BAAe;EAAE,mBAAmB,EAAE,aAAa;;;AACnD,iCAAoB;EAAE,mBAAmB,EAAE,aAAa;;;AACxD,gCAAmB;EAAE,mBAAmB,EAAE,aAAa;;;AACvD,4BAAe;EAAE,mBAAmB,EAAE,QAAQ;;;AAC9C,kCAAqB;EAAE,mBAAmB,EAAE,YAAY;;;AACxD,6BAAgB;EAAE,mBAAmB,EAAE,YAAY;;;AACnD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,gCAAmB;EAAE,mBAAmB,EAAE,YAAY;;;AACtD,kCAAqB;EAAE,mBAAmB,EAAE,QAAQ;;;AACpD,mCAAsB;EAAE,mBAAmB,EAAE,YAAY;;;AACzD,mCAAsB;EAAE,mBAAmB,EAAE,YAAY;;;AACzD,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,qCAAwB;EAAE,mBAAmB,EAAE,aAAa;;;AAC5D,qCAAwB;EAAE,mBAAmB,EAAE,aAAa;;;AAC5D,qCAAwB;EAAE,mBAAmB,EAAE,aAAa;;;AAC5D,qCAAwB;EAAE,mBAAmB,EAAE,aAAa;;;AAC5D,oCAAuB;EAAE,mBAAmB,EAAE,aAAa;;;AAC3D,qCAAwB;EAAE,mBAAmB,EAAE,aAAa;;;AAC5D,mCAAsB;EAAE,mBAAmB,EAAE,aAAa;;;AAC1D,uCAA0B;EAAE,mBAAmB,EAAE,QAAQ;;;AACzD,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,wCAA2B;EAAE,mBAAmB,EAAE,YAAY;;;AAC9D,2CAA8B;EAAE,mBAAmB,EAAE,QAAQ;;;AAC7D,6CAAgC;EAAE,mBAAmB,EAAE,YAAY;;;AACnE,0CAA6B;EAAE,mBAAmB,EAAE,YAAY;;;AAChE,4CAA+B;EAAE,mBAAmB,EAAE,YAAY;;;AAClE,4CAA+B;EAAE,mBAAmB,EAAE,YAAY;;;AAClE,uCAA0B;EAAE,mBAAmB,EAAE,YAAY;;;AAC7D,sHAA+D;EAAE,0BAA0B,EAAE,GAAG;EAAE,8BAA8B,EAAE,GAAG;EAAE,6BAA6B,EAAE,GAAG;EAAE,sBAAsB,EAAE,GAAG;;;AACtM,uHAAgE;EAAE,2BAA2B,EAAE,GAAG;EAAE,+BAA+B,EAAE,GAAG;EAAE,8BAA8B,EAAE,GAAG;EAAE,uBAAuB,EAAE,GAAG;;;AAC3M,yHAAkE;EAAE,6BAA6B,EAAE,GAAG;EAAE,iCAAiC,EAAE,GAAG;EAAE,gCAAgC,EAAE,GAAG;EAAE,yBAAyB,EAAE,GAAG;;;AACrN,0HAAmE;EAAE,8BAA8B,EAAE,GAAG;EAAE,kCAAkC,EAAE,GAAG;EAAE,iCAAiC,EAAE,GAAG;EAAE,0BAA0B,EAAE,GAAG;;;AAC1N,gCAAmB;EAAE,UAAU,EAAE,sEAAsE;EAAE,OAAO,EAAE,GAAG;EAAC,MAAM,EAAC,iBAAiB;;;AAC9I,+BAAkB;EAAE,MAAM,EAAE,aAAa;EAAE,OAAO,EAAE,GAAG;EAAE,UAAU,EAAE,sEAAsE;EAAE,OAAO,EAAE,GAAG;EAAC,MAAM,EAAC,iBAAiB;EAAE,kBAAkB,EAAE,GAAG;EAAE,oBAAoB,EAAE,GAAG;EAAE,qBAAqB,EAAE,GAAG;EAAE,aAAa,EAAE,GAAG;;;AACtR,4BAAe;EAAE,KAAK,EAAE,IAAI;EAAE,OAAO,EAAE,WAAW;EAAE,OAAO,EAAE,IAAI;;;AACjE,kDAAqC;EAAE,QAAQ,EAAC,QAAQ;EAAE,OAAO,EAAC,MAAM;;;AACxE,kGAAuE;EAAE,QAAQ,EAAC,QAAQ;EAAE,GAAG,EAAE,GAAG;EAAE,KAAK,EAAE,KAAK;EAAE,MAAM,EAAE,KAAK;;;AACjI,8GAAmF;EAAE,GAAG,EAAE,GAAG;;;AAC7F,gDAAmC;EAAE,IAAI,EAAC,GAAG;;;AAC7C,gDAAmC;EAAE,KAAK,EAAC,GAAG;;;AAC9C,sDAAyC;EAAE,IAAI,EAAC,GAAG;;;AACnD,sDAAyC;EAAE,KAAK,EAAC,GAAG;;;AACpD,4GAAiF;EAAE,OAAO,EAAE,KAAK;EAAE,QAAQ,EAAE,QAAQ;EAAE,IAAI,EAAE,GAAG;EAAE,WAAW,EAAE,IAAI;EAAE,GAAG,EAAE,GAAG;EAAE,UAAU,EAAE,IAAI;;;AAC/K,iDAAoC;EAAE,MAAM,EAAE,OAAO;EAAE,WAAW,EAAE,KAAK;EAAE,UAAU,EAAE,MAAM;;;AAC7F,wDAA2C;EAAE,SAAS,EAAC,GAAG;EAAE,MAAM,EAAC,KAAK;;;AACxE,4DAA+C;EAAC,KAAK,EAAE,IAAI;;;AAC3D;sDACyC;EAAE,KAAK,EAAE,GAAG;;;AACrD,kCAAqB;EAAC,KAAK,EAAE,IAAI;EAAE,SAAS,EAAE,IAAI;EAAE,eAAe,EAAE,QAAQ;EAAE,MAAM,EAAC,QAAQ;;;AAC9F,+BAAkB;EAAE,OAAO,EAAE,SAAS;EAAE,UAAU,EAAE,MAAM;EAAE,WAAW,EAAE,IAAI;EAAE,MAAM,EAAE,CAAC;;;AACxF,+BAAkB;EAAE,MAAM,EAAE,CAAC;EAAE,OAAO,EAAE,GAAG;;;AAC3C,uEAA4C;EAAE,OAAO,EAAE,KAAK;EAAE,OAAO,EAAE,IAAI;EAAE,UAAU,EAAE,KAAK;EAAE,eAAe,EAAE,IAAI;;;AACrH,sDAAyC;EAAE,gBAAgB,EAAE,IAAI;EAAE,MAAM,EAAE,UAAU;EAAE,OAAO,EAAC,MAAM;EAAE,WAAW,EAAE,CAAC;EAAE,YAAY,EAAE,CAAC;EAAE,aAAa,EAAE,CAAC;;;AACxJ,6DAAgD;EAAE,KAAK,EAAE,KAAK;EAAE,MAAM,EAAE,cAAc;EAAE,MAAM,EAAE,OAAO;EAAE,OAAO,EAAE,mBAAmB;EAAE,KAAK,EAAC,IAAI;EAAE,QAAQ,EAAC,OAAO;;;AACnK,mFAAsE;EAAE,KAAK,EAAC,IAAI;;;AAClF,gDAAmC;EAAE,KAAK,EAAC,IAAI;;;AAC/C,uDAA0C;EAAE,KAAK,EAAC,IAAI;;;AACtD,6DAAgD;EAAE,KAAK,EAAC,GAAG;EAAE,MAAM,EAAC,WAAW;;;AAC/E,yDAA4C;EAAE,KAAK,EAAC,GAAG;;;AACvD,yDAA4C;EAAE,KAAK,EAAC,KAAK;;;AACzD,yDAA4C;EAAE,KAAK,EAAC,GAAG;;;AACvD,kFAAqE;EAAE,iBAAiB,EAAC,CAAC;;;AAC1F,oFAAuE;EAAE,iBAAiB,EAAC,CAAC;;;AAC5F,4DAA+C;EAAE,KAAK,EAAC,IAAI;;;AAC3D,sCAAyB;EAAE,KAAK,EAAC,IAAI;EAAE,KAAK,EAAC,IAAI;EAAE,SAAS,EAAC,GAAG;;;AAChE,gCAAmB;EAClB,SAAS,EAAE,GAAG;;;AACd,oDAAoB;EAAE,KAAK,EAAE,GAAG;EAAE,IAAI,EAAE,IAAI;;;AAC5C,oDAAoB;EAAE,IAAI,EAAE,GAAG;EAAE,KAAK,EAAE,IAAI;;;AAC5C,0DAA0B;EAAE,KAAK,EAAE,GAAG;EAAE,IAAI,EAAE,IAAI;;;AAClD,0DAA0B;EAAE,IAAI,EAAE,GAAG;EAAE,KAAK,EAAE,IAAI;;;AAClD,0DAA0B;EAAE,KAAK,EAAC,KAAK;;;AACvC,iEAAiC;EAAE,KAAK,EAAE,IAAI;;;AAC9C,uFAAuD;EAAE,KAAK,EAAC,KAAK;;;AACpE,qDAAqB;EAAE,KAAK,EAAC,KAAK;;;AAClC,gFAAgD;EAAE,kBAAkB,EAAC,CAAC;EAAE,iBAAiB,EAAC,GAAG;;;AAC7F,kFAAkD;EAAE,kBAAkB,EAAC,CAAC;EAAE,iBAAiB,EAAC,GAAG;;;AAEhG,kCAAqB;EACpB,OAAO,EAAE,IAAI;;EACb,WAAW,EAAE,KAAK;;EAClB,QAAQ,EAAE,QAAQ;;EAClB,OAAO,EAAE,EAAE;;EACX,MAAM,EAAE,MAAM;;EACd,GAAG,EAAE,IAAI;;EACT,IAAI,EAAE,IAAI;;EACV,KAAK,EAAE,KAAK;;EACZ,MAAM,EAAE,KAAK",
|
| 4 |
+
"sources": ["sass/partials/_main_wrap.scss","sass/partials/_variables.scss","sass/partials/_mixins.scss","sass/partials/_timepicker.scss","sass/partials/_post_metaboxes.scss","sass/partials/_misc.scss","sass/partials/_sidebar_placements.scss","sass/partials/_collapsible_ui.scss","sass/partials/_jquery_ui.scss"],
|
| 5 |
+
"names": [],
|
| 6 |
+
"file": "cmb2.css"
|
| 7 |
+
}
|
cmb2/css/cmb2.min.css
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
.cmb2-wrap{margin:0}.cmb2-wrap input,.cmb2-wrap textarea{font-size:14px;max-width:100%;padding:5px}.cmb2-wrap input[type=text].cmb2-oembed{width:100%}.cmb2-wrap textarea{width:500px}.cmb2-wrap textarea.cmb2-textarea-code{font-family:"Courier 10 Pitch",Courier,monospace;line-height:16px}.cmb2-wrap input.cmb2-text-small,.cmb2-wrap input.cmb2-timepicker{width:100px}.cmb2-wrap input.cmb2-text-money{width:90px}.cmb2-wrap input.cmb2-text-medium{width:230px}.cmb2-wrap input.cmb2-upload-file{width:65%}.cmb2-wrap input.ed_button{padding:2px 4px}.cmb2-wrap input:not([type=hidden])+.button,.cmb2-wrap input:not([type=hidden])+input,.cmb2-wrap input:not([type=hidden])+select{margin-left:20px}.cmb2-wrap ul{margin:0}.cmb2-wrap li{font-size:14px;line-height:16px;margin:1px 0 5px}.cmb2-wrap select{font-size:14px;margin-top:3px}.cmb2-wrap input:focus,.cmb2-wrap textarea:focus{background:#fffff8}.cmb2-wrap input[type=checkbox],.cmb2-wrap input[type=radio]{margin:0 5px 0 0;padding:0}.cmb2-wrap .button,.cmb2-wrap button{white-space:nowrap}.cmb2-wrap .mceLayout{border:1px solid #e9e9e9!important}.cmb2-wrap .mceIframeContainer{background:#fff}.cmb2-wrap .meta_mce{width:97%}.cmb2-wrap .meta_mce textarea{width:100%}.cmb2-wrap .wp-color-result,.cmb2-wrap .wp-picker-input-wrap{vertical-align:middle}.cmb2-wrap .wp-color-result,.cmb2-wrap .wp-picker-container{margin:0 10px 0 0}.cmb2-wrap .cmb-row{margin:0}.cmb2-wrap .cmb-row:after{content:'';clear:both;display:block;width:100%}.cmb2-wrap .cmb-row.cmb-repeat-row{padding:1.8em 0 0}.cmb2-wrap .cmb-row.cmb-repeat-row:first-of-type{padding:0}.cmb2-wrap .cmb-row.cmb-repeat .cmb2-metabox-description{padding-top:0;padding-bottom:1.8em}.cmb2-metabox{clear:both;margin:0}.cmb2-metabox .cmb-field-list>.cmb-row:first-of-type>.cmb-td,.cmb2-metabox .cmb-field-list>.cmb-row:first-of-type>.cmb-th,.cmb2-metabox>.cmb-row:first-of-type>.cmb-td,.cmb2-metabox>.cmb-row:first-of-type>.cmb-th{border:0}.cmb2-metabox>.cmb-row .cmb-repeat-table .cmb-row>.cmb-td{padding-right:20px;box-sizing:border-box;float:left}.cmb-add-row{margin:1.8em 0 0}.cmb-nested .cmb-td,.cmb-repeatable-group .cmb-th,.cmb-repeatable-group:first-of-type{border:0}.cmb-repeatable-group:last-of-type,.cmb-row:last-of-type,.cmb2-wrap .cmb-row:last-of-type{border-bottom:0}.cmb-repeatable-grouping{border:1px solid #e9e9e9;padding:0 1em;max-width:1000px}.cmb-repeatable-grouping.cmb-row{margin:0 0 .8em}.cmb-th{color:#222;float:left;font-weight:600;line-height:1.3;padding:20px 10px 20px 0;vertical-align:top;width:200px}.cmb-td{line-height:1.3;max-width:100%;padding:15px 10px;vertical-align:middle}.cmb-type-title .cmb-td{padding:0}.cmb-th label{display:block;padding:5px 0}.cmb-th+.cmb-td{float:left}.cmb-td .cmb-td{padding-bottom:1em}.cmb-remove-row{text-align:right}.empty-row.hidden{display:none}.cmb-repeatable-group .cmb-th{padding:5px}.cmb-repeatable-group .cmb-group-title{background-color:#e9e9e9;padding:8px 12px 8px 2.2em;margin:0 -1em;min-height:1.5em;font-size:14px;line-height:1.4}.cmb-repeatable-group .cmb-group-title h4{border:0;margin:0;font-size:1.2em;font-weight:500;padding:.5em .75em}.cmb-repeatable-group .cmb-group-title .cmb-th{display:block;width:100%}.cmb-repeatable-group .cmb-group-description .cmb-th{font-size:1.2em;display:block;float:none;padding-bottom:1em;text-align:left;width:100%}.cmb-repeatable-group .cmb-group-description .cmb-th label{display:block;margin-top:0;padding-bottom:5px}.cmb-repeatable-group .cmb-group-description .cmb-th label:after{border-bottom:1px solid #e9e9e9;content:'';clear:both;display:block;padding-top:.4em}.cmb-repeatable-group .cmb-shift-rows{font-size:1em;margin-right:1em;text-decoration:none}.cmb-repeatable-group .cmb-shift-rows .dashicons{font-size:1.5em;height:1.5em;line-height:1.2em;width:1em}.cmb-repeatable-group .cmb-shift-rows .dashicons.dashicons-arrow-down-alt2{line-height:1.3em}.cmb-repeatable-group .cmb2-upload-button{float:right}p.cmb2-metabox-description{color:#aaa;font-style:italic;margin:0;padding-top:.5em}span.cmb2-metabox-description{color:#aaa;font-style:italic}.cmb2-metabox-title{margin:0 0 5px;padding:5px 0 0;font-size:14px}.cmb-inline ul{padding:4px 0 0}.cmb-inline li{display:inline-block;padding-right:18px}.cmb-type-textarea-code pre{margin:0}.cmb2-media-status .img-status{clear:none;display:inline-block;float:left;margin-right:10px;width:auto}.cmb2-media-status .img-status img{max-width:350px}.cmb2-media-status .embed-status,.cmb2-media-status .img-status img{background:#fff;border:1px solid #e9e9e9;border-radius:2px;-moz-border-radius:2px;margin:15px 0 0;padding:5px}.cmb2-media-status .embed-status{float:left;max-width:800px}.cmb2-media-status .embed-status,.cmb2-media-status .img-status{position:relative}.cmb2-media-status .embed-status .cmb2-remove-file-button,.cmb2-media-status .img-status .cmb2-remove-file-button{background:url(../images/ico-delete.png);height:16px;left:-5px;position:absolute;text-indent:-9999px;top:-5px;width:16px}.cmb2-media-status .img-status .cmb2-remove-file-button{top:10px}.cmb2-media-status .file-status>span,.cmb2-media-status .img-status img{cursor:pointer}.cmb-type-file-list .cmb2-media-status .img-status{clear:none;float:left;margin-right:10px;width:auto}.cmb-attach-list li{clear:both;display:inline-block;margin-bottom:25px;width:100%}.cmb-attach-list li img{cursor:move;float:left;margin-right:10px}.cmb2-remove-wrapper{margin:0}.child-cmb2 .cmb-th{text-align:left}div.time-picker{background:#fff;border:1px solid #aaa;height:191px;margin:0;position:absolute;overflow:auto;width:6em;z-index:99}div.time-picker ul{list-style-type:none;margin:0;padding:0}div.time-picker li{cursor:pointer;margin-bottom:0;font-family:sans-serif;font-size:14px;padding:4px 3px}div.time-picker li.selected{background:#0063ce;color:#fff}div.time-picker-12hours{width:8em}#poststuff .cmb-group-title{margin-left:-1em;margin-right:-1em;padding-left:2.2em;min-height:1.5em}.cmb-repeat-group-wrap .cmb2-wrap,.postbox-container .cmb2-wrap{margin:0}.cmb-repeat-group-wrap .cmb2-wrap>.cmb-field-list>.cmb-row,.postbox-container .cmb2-wrap>.cmb-field-list>.cmb-row{padding:1.8em 0}.cmb-repeat-group-wrap .cmb2-wrap input[type=text].cmb2-oembed,.postbox-container .cmb2-wrap input[type=text].cmb2-oembed{width:100%}.cmb-repeat-group-wrap .cmb-row,.postbox-container .cmb-row{padding:0 0 1.8em;margin:0 0 .8em}.cmb-repeat-group-wrap .cmb-row .cmbhandle,.postbox-container .cmb-row .cmbhandle{right:-1em;position:relative}.cmb-repeat-group-wrap .cmb-repeatable-grouping,.postbox-container .cmb-repeatable-grouping{padding:0 1em;max-width:100%;min-width:1px!important}.cmb-repeat-group-wrap .cmb-repeatable-group>.cmb-row,.postbox-container .cmb-repeatable-group>.cmb-row{padding-bottom:0}.cmb-repeat-group-wrap .cmb-th,.postbox-container .cmb-th{width:18%;padding:0 2% 0 0}.cmb-repeat-group-wrap .cmb-td,.postbox-container .cmb-td{margin-bottom:0;padding:0;line-height:1.3}.cmb-repeat-group-wrap .cmb-repeat-row .cmb-td,.postbox-container .cmb-repeat-row .cmb-td{padding-bottom:1.8em}.cmb-repeat-group-wrap .cmb-th+.cmb-td,.postbox-container .cmb-th+.cmb-td{width:80%;float:right}.cmb-repeat-group-wrap .cmb-repeatable-group:not(:last-of-type),.cmb-repeat-group-wrap .cmb-row:not(:last-of-type),.postbox-container .cmb-repeatable-group:not(:last-of-type),.postbox-container .cmb-row:not(:last-of-type){border-bottom:1px solid #e9e9e9}.cmb-repeat-group-wrap .cmb-remove-field-row,.cmb-repeat-group-wrap .cmb-repeat-group-field,.postbox-container .cmb-remove-field-row,.postbox-container .cmb-repeat-group-field{padding-top:1.8em}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody,.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody,.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody,.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody{display:table;width:100%}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text,.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody input.regular-text{width:100%}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row),.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(.hidden):not(.empty-row){display:table-row}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td,.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td{display:table-cell;float:none;width:100%}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td,.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-row:not(:first-of-type) .cmb-td{padding-top:1.8em}.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,.cmb-repeat-group-wrap .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,.postbox-container .cmb2-metabox>.cmb-row .cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row,.postbox-container .cmb2-metabox>.cmb-row.table-layout .cmb-repeat-table .cmb-tbody .cmb-td.cmb-remove-row{padding-right:0}#poststuff .cmb-repeatable-group h2{margin:0}.edit-tags-php .cmb2-metabox-title,.profile-php .cmb2-metabox-title,.user-edit-php .cmb2-metabox-title{font-size:1.4em}.postbox .cmb-spinner{float:left}#side-sortables .cmb2-wrap>.cmb-field-list>.cmb-row,.inner-sidebar .cmb2-wrap>.cmb-field-list>.cmb-row{padding:1.4em 0}#side-sortables .cmb2-wrap input[type=text]:not(.wp-color-picker),.inner-sidebar .cmb2-wrap input[type=text]:not(.wp-color-picker){width:100%}#side-sortables .cmb2-wrap input+input:not(.wp-picker-clear),#side-sortables .cmb2-wrap input+select,.inner-sidebar .cmb2-wrap input+input:not(.wp-picker-clear),.inner-sidebar .cmb2-wrap input+select{margin-left:0;margin-top:1em;display:block}#side-sortables .cmb2-wrap label,.inner-sidebar .cmb2-wrap label{display:block;font-weight:700;padding:0 0 5px}#side-sortables .cmb-repeatable-group,.inner-sidebar .cmb-repeatable-group{border-bottom:1px solid #e9e9e9}#side-sortables .cmb-repeat-group-wrap>.cmb-td>.cmb-repeatable-group,.inner-sidebar .cmb-repeat-group-wrap>.cmb-td>.cmb-repeatable-group{border-bottom:0;margin-bottom:-1.4em}#side-sortables .cmb-td,#side-sortables .cmb-th,#side-sortables .cmb-th+.cmb-td,.inner-sidebar .cmb-td,.inner-sidebar .cmb-th,.inner-sidebar .cmb-th+.cmb-td{width:100%;display:block;float:none}#side-sortables .closed .inside,.inner-sidebar .closed .inside{display:none}#side-sortables .cmb-td .cmb-td,.inner-sidebar .cmb-td .cmb-td{padding-bottom:1em}#side-sortables .cmb-th,.inner-sidebar .cmb-th{display:block;float:none;padding-bottom:1em;text-align:left;width:100%;padding-left:0;padding-right:0}#side-sortables .cmb-th label,.inner-sidebar .cmb-th label{display:block;margin-top:0;padding-bottom:5px}#side-sortables .cmb-th label:after,.inner-sidebar .cmb-th label:after{border-bottom:1px solid #e9e9e9;content:'';clear:both;display:block;padding-top:.4em}#side-sortables .cmb-th label,.inner-sidebar .cmb-th label{font-size:14px;line-height:1.4em}#side-sortables .cmb-group-description .cmb-th,.inner-sidebar .cmb-group-description .cmb-th{padding-top:0}#side-sortables .cmb-group-description .cmb2-metabox-description,#side-sortables .cmb-group-title .cmb-th,.inner-sidebar .cmb-group-description .cmb2-metabox-description,.inner-sidebar .cmb-group-title .cmb-th{padding:0}#side-sortables .cmb-repeatable-grouping+.cmb-repeatable-grouping,.inner-sidebar .cmb-repeatable-grouping+.cmb-repeatable-grouping{margin-top:1em}#side-sortables .cmb2-media-status .embed-status img,#side-sortables .cmb2-media-status .img-status img,.inner-sidebar .cmb2-media-status .embed-status img,.inner-sidebar .cmb2-media-status .img-status img{max-width:90%;height:auto}#side-sortables .cmb2-list label,.inner-sidebar .cmb2-list label{display:inline;font-weight:400}#side-sortables .cmb2-metabox-description,.inner-sidebar .cmb2-metabox-description{display:block;padding:7px 0 0}#side-sortables .cmb-type-checkbox .cmb-td label,#side-sortables .cmb-type-checkbox .cmb2-metabox-description,.inner-sidebar .cmb-type-checkbox .cmb-td label,.inner-sidebar .cmb-type-checkbox .cmb2-metabox-description{font-weight:400;display:inline}#side-sortables .cmb-row .cmb2-metabox-description,.inner-sidebar .cmb-row .cmb2-metabox-description{padding-bottom:1.8em}#side-sortables .cmb2-metabox-title,.inner-sidebar .cmb2-metabox-title{font-size:1.2em;font-style:italic}#side-sortables .cmb-remove-row,.inner-sidebar .cmb-remove-row{clear:both;padding-top:12px;padding-bottom:0}#side-sortables .cmb-type-colorpicker .cmb-repeat-row .cmb-td,.inner-sidebar .cmb-type-colorpicker .cmb-repeat-row .cmb-td{width:auto;clear:none;float:left;padding-top:0}#side-sortables .cmb-type-colorpicker .cmb-repeat-row .cmb-td.cmb-remove-row,.inner-sidebar .cmb-type-colorpicker .cmb-repeat-row .cmb-td.cmb-remove-row{float:right;margin:0}#side-sortables .cmb2-upload-button,.inner-sidebar .cmb2-upload-button{clear:both;margin-top:12px}.cmb2-metabox .cmb-repeat-group-wrap{max-width:1000px}.cmb2-metabox .cmbhandle{color:#aaa;float:right;width:27px;height:30px;cursor:pointer;right:-1em;position:relative}.cmb2-metabox .cmbhandle:before{content:'\f142';right:12px;font:400 20px/1 dashicons;speak:none;display:inline-block;padding:8px 10px;top:0;position:relative;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;text-decoration:none!important}.cmb2-metabox .postbox.closed .cmbhandle:before{content:'\f140'}.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row{-webkit-appearance:none!important;background:none!important;border:none!important;position:absolute;left:0;top:.5em;line-height:1em;cursor:pointer}.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row:not([disabled]){color:#a00}.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row:not([disabled]):hover{color:red}.cmb2-element .ui-helper-hidden{display:none}.cmb2-element .ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px)}.cmb2-element .ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.cmb2-element .ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden}.cmb2-element * html .ui-helper-clearfix{height:1%}.cmb2-element .ui-helper-clearfix{display:block}.cmb2-element .ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.cmb2-element .ui-state-disabled{cursor:default!important}.cmb2-element .ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.cmb2-element .ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.cmb2-element .ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.cmb2-element .ui-widget .ui-widget{font-size:1em}.cmb2-element .ui-widget button,.cmb2-element .ui-widget input,.cmb2-element .ui-widget select,.cmb2-element .ui-widget textarea{font-family:Verdana,Arial,sans-serif;font-size:1em}.cmb2-element .ui-widget-content{border:1px solid #aaa;background:#fff url(../images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.cmb2-element .ui-widget-content a{color:#222}.cmb2-element .ui-widget-header{border:1px solid #aaa;background:#ccc url(../images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:700}.cmb2-element .ui-widget-header a{color:#222}.cmb2-element .ui-state-default,.cmb2-element .ui-widget-content .ui-state-default,.cmb2-element .ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(../images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:400;color:#555}.cmb2-element .ui-state-default a,.cmb2-element .ui-state-default a:link,.cmb2-element .ui-state-default a:visited{color:#555;text-decoration:none}.cmb2-element .ui-state-focus,.cmb2-element .ui-state-hover,.cmb2-element .ui-widget-content .ui-state-focus,.cmb2-element .ui-widget-content .ui-state-hover,.cmb2-element .ui-widget-header .ui-state-focus,.cmb2-element .ui-widget-header .ui-state-hover{border:1px solid #999;background:#dadada url(../images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:400;color:#212121}.cmb2-element .ui-state-hover a,.cmb2-element .ui-state-hover a:hover{color:#212121;text-decoration:none}.cmb2-element .ui-state-active,.cmb2-element .ui-widget-content .ui-state-active,.cmb2-element .ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(../images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:400;color:#212121}.cmb2-element .ui-state-active a,.cmb2-element .ui-state-active a:link,.cmb2-element .ui-state-active a:visited{color:#212121;text-decoration:none}.cmb2-element .ui-widget :active{outline:0}.cmb2-element .ui-state-highlight,.cmb2-element .ui-widget-content .ui-state-highlight,.cmb2-element .ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(../images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.cmb2-element .ui-state-highlight a,.cmb2-element .ui-widget-content .ui-state-highlight a,.cmb2-element .ui-widget-header .ui-state-highlight a{color:#363636}.cmb2-element .ui-state-error,.cmb2-element .ui-widget-content .ui-state-error,.cmb2-element .ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(../images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.cmb2-element .ui-state-error a,.cmb2-element .ui-state-error-text,.cmb2-element .ui-widget-content .ui-state-error a,.cmb2-element .ui-widget-content .ui-state-error-text,.cmb2-element .ui-widget-header .ui-state-error a,.cmb2-element .ui-widget-header .ui-state-error-text{color:#cd0a0a}.cmb2-element .ui-priority-primary,.cmb2-element .ui-widget-content .ui-priority-primary,.cmb2-element .ui-widget-header .ui-priority-primary{font-weight:700}.cmb2-element .ui-priority-secondary,.cmb2-element .ui-widget-content .ui-priority-secondary,.cmb2-element .ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:400}.cmb2-element .ui-state-disabled,.cmb2-element .ui-widget-content .ui-state-disabled,.cmb2-element .ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.cmb2-element .ui-icon{width:16px;height:16px;background-image:url(../images/ui-icons_222222_256x240.png)}.cmb2-element .ui-widget-content .ui-icon,.cmb2-element .ui-widget-header .ui-icon{background-image:url(../images/ui-icons_222222_256x240.png)}.cmb2-element .ui-state-default .ui-icon{background-image:url(../images/ui-icons_888888_256x240.png)}.cmb2-element .ui-state-active .ui-icon,.cmb2-element .ui-state-focus .ui-icon,.cmb2-element .ui-state-hover .ui-icon{background-image:url(../images/ui-icons_454545_256x240.png)}.cmb2-element .ui-state-highlight .ui-icon{background-image:url(../images/ui-icons_2e83ff_256x240.png)}.cmb2-element .ui-state-error .ui-icon,.cmb2-element .ui-state-error-text .ui-icon{background-image:url(../images/ui-icons_cd0a0a_256x240.png)}.cmb2-element .ui-icon-carat-1-n{background-position:0 0}.cmb2-element .ui-icon-carat-1-ne{background-position:-16px 0}.cmb2-element .ui-icon-carat-1-e{background-position:-32px 0}.cmb2-element .ui-icon-carat-1-se{background-position:-48px 0}.cmb2-element .ui-icon-carat-1-s{background-position:-64px 0}.cmb2-element .ui-icon-carat-1-sw{background-position:-80px 0}.cmb2-element .ui-icon-carat-1-w{background-position:-96px 0}.cmb2-element .ui-icon-carat-1-nw{background-position:-112px 0}.cmb2-element .ui-icon-carat-2-n-s{background-position:-128px 0}.cmb2-element .ui-icon-carat-2-e-w{background-position:-144px 0}.cmb2-element .ui-icon-triangle-1-n{background-position:0 -16px}.cmb2-element .ui-icon-triangle-1-ne{background-position:-16px -16px}.cmb2-element .ui-icon-triangle-1-e{background-position:-32px -16px}.cmb2-element .ui-icon-triangle-1-se{background-position:-48px -16px}.cmb2-element .ui-icon-triangle-1-s{background-position:-64px -16px}.cmb2-element .ui-icon-triangle-1-sw{background-position:-80px -16px}.cmb2-element .ui-icon-triangle-1-w{background-position:-96px -16px}.cmb2-element .ui-icon-triangle-1-nw{background-position:-112px -16px}.cmb2-element .ui-icon-triangle-2-n-s{background-position:-128px -16px}.cmb2-element .ui-icon-triangle-2-e-w{background-position:-144px -16px}.cmb2-element .ui-icon-arrow-1-n{background-position:0 -32px}.cmb2-element .ui-icon-arrow-1-ne{background-position:-16px -32px}.cmb2-element .ui-icon-arrow-1-e{background-position:-32px -32px}.cmb2-element .ui-icon-arrow-1-se{background-position:-48px -32px}.cmb2-element .ui-icon-arrow-1-s{background-position:-64px -32px}.cmb2-element .ui-icon-arrow-1-sw{background-position:-80px -32px}.cmb2-element .ui-icon-arrow-1-w{background-position:-96px -32px}.cmb2-element .ui-icon-arrow-1-nw{background-position:-112px -32px}.cmb2-element .ui-icon-arrow-2-n-s{background-position:-128px -32px}.cmb2-element .ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.cmb2-element .ui-icon-arrow-2-e-w{background-position:-160px -32px}.cmb2-element .ui-icon-arrow-2-se-nw{background-position:-176px -32px}.cmb2-element .ui-icon-arrowstop-1-n{background-position:-192px -32px}.cmb2-element .ui-icon-arrowstop-1-e{background-position:-208px -32px}.cmb2-element .ui-icon-arrowstop-1-s{background-position:-224px -32px}.cmb2-element .ui-icon-arrowstop-1-w{background-position:-240px -32px}.cmb2-element .ui-icon-arrowthick-1-n{background-position:0 -48px}.cmb2-element .ui-icon-arrowthick-1-ne{background-position:-16px -48px}.cmb2-element .ui-icon-arrowthick-1-e{background-position:-32px -48px}.cmb2-element .ui-icon-arrowthick-1-se{background-position:-48px -48px}.cmb2-element .ui-icon-arrowthick-1-s{background-position:-64px -48px}.cmb2-element .ui-icon-arrowthick-1-sw{background-position:-80px -48px}.cmb2-element .ui-icon-arrowthick-1-w{background-position:-96px -48px}.cmb2-element .ui-icon-arrowthick-1-nw{background-position:-112px -48px}.cmb2-element .ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.cmb2-element .ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.cmb2-element .ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.cmb2-element .ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.cmb2-element .ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.cmb2-element .ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.cmb2-element .ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.cmb2-element .ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.cmb2-element .ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.cmb2-element .ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.cmb2-element .ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.cmb2-element .ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.cmb2-element .ui-icon-arrowreturn-1-w{background-position:-64px -64px}.cmb2-element .ui-icon-arrowreturn-1-n{background-position:-80px -64px}.cmb2-element .ui-icon-arrowreturn-1-e{background-position:-96px -64px}.cmb2-element .ui-icon-arrowreturn-1-s{background-position:-112px -64px}.cmb2-element .ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.cmb2-element .ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.cmb2-element .ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.cmb2-element .ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.cmb2-element .ui-icon-arrow-4{background-position:0 -80px}.cmb2-element .ui-icon-arrow-4-diag{background-position:-16px -80px}.cmb2-element .ui-icon-extlink{background-position:-32px -80px}.cmb2-element .ui-icon-newwin{background-position:-48px -80px}.cmb2-element .ui-icon-refresh{background-position:-64px -80px}.cmb2-element .ui-icon-shuffle{background-position:-80px -80px}.cmb2-element .ui-icon-transfer-e-w{background-position:-96px -80px}.cmb2-element .ui-icon-transferthick-e-w{background-position:-112px -80px}.cmb2-element .ui-icon-folder-collapsed{background-position:0 -96px}.cmb2-element .ui-icon-folder-open{background-position:-16px -96px}.cmb2-element .ui-icon-document{background-position:-32px -96px}.cmb2-element .ui-icon-document-b{background-position:-48px -96px}.cmb2-element .ui-icon-note{background-position:-64px -96px}.cmb2-element .ui-icon-mail-closed{background-position:-80px -96px}.cmb2-element .ui-icon-mail-open{background-position:-96px -96px}.cmb2-element .ui-icon-suitcase{background-position:-112px -96px}.cmb2-element .ui-icon-comment{background-position:-128px -96px}.cmb2-element .ui-icon-person{background-position:-144px -96px}.cmb2-element .ui-icon-print{background-position:-160px -96px}.cmb2-element .ui-icon-trash{background-position:-176px -96px}.cmb2-element .ui-icon-locked{background-position:-192px -96px}.cmb2-element .ui-icon-unlocked{background-position:-208px -96px}.cmb2-element .ui-icon-bookmark{background-position:-224px -96px}.cmb2-element .ui-icon-tag{background-position:-240px -96px}.cmb2-element .ui-icon-home{background-position:0 -112px}.cmb2-element .ui-icon-flag{background-position:-16px -112px}.cmb2-element .ui-icon-calendar{background-position:-32px -112px}.cmb2-element .ui-icon-cart{background-position:-48px -112px}.cmb2-element .ui-icon-pencil{background-position:-64px -112px}.cmb2-element .ui-icon-clock{background-position:-80px -112px}.cmb2-element .ui-icon-disk{background-position:-96px -112px}.cmb2-element .ui-icon-calculator{background-position:-112px -112px}.cmb2-element .ui-icon-zoomin{background-position:-128px -112px}.cmb2-element .ui-icon-zoomout{background-position:-144px -112px}.cmb2-element .ui-icon-search{background-position:-160px -112px}.cmb2-element .ui-icon-wrench{background-position:-176px -112px}.cmb2-element .ui-icon-gear{background-position:-192px -112px}.cmb2-element .ui-icon-heart{background-position:-208px -112px}.cmb2-element .ui-icon-star{background-position:-224px -112px}.cmb2-element .ui-icon-link{background-position:-240px -112px}.cmb2-element .ui-icon-cancel{background-position:0 -128px}.cmb2-element .ui-icon-plus{background-position:-16px -128px}.cmb2-element .ui-icon-plusthick{background-position:-32px -128px}.cmb2-element .ui-icon-minus{background-position:-48px -128px}.cmb2-element .ui-icon-minusthick{background-position:-64px -128px}.cmb2-element .ui-icon-close{background-position:-80px -128px}.cmb2-element .ui-icon-closethick{background-position:-96px -128px}.cmb2-element .ui-icon-key{background-position:-112px -128px}.cmb2-element .ui-icon-lightbulb{background-position:-128px -128px}.cmb2-element .ui-icon-scissors{background-position:-144px -128px}.cmb2-element .ui-icon-clipboard{background-position:-160px -128px}.cmb2-element .ui-icon-copy{background-position:-176px -128px}.cmb2-element .ui-icon-contact{background-position:-192px -128px}.cmb2-element .ui-icon-image{background-position:-208px -128px}.cmb2-element .ui-icon-video{background-position:-224px -128px}.cmb2-element .ui-icon-script{background-position:-240px -128px}.cmb2-element .ui-icon-alert{background-position:0 -144px}.cmb2-element .ui-icon-info{background-position:-16px -144px}.cmb2-element .ui-icon-notice{background-position:-32px -144px}.cmb2-element .ui-icon-help{background-position:-48px -144px}.cmb2-element .ui-icon-check{background-position:-64px -144px}.cmb2-element .ui-icon-bullet{background-position:-80px -144px}.cmb2-element .ui-icon-radio-off{background-position:-96px -144px}.cmb2-element .ui-icon-radio-on{background-position:-112px -144px}.cmb2-element .ui-icon-pin-w{background-position:-128px -144px}.cmb2-element .ui-icon-pin-s{background-position:-144px -144px}.cmb2-element .ui-icon-play{background-position:0 -160px}.cmb2-element .ui-icon-pause{background-position:-16px -160px}.cmb2-element .ui-icon-seek-next{background-position:-32px -160px}.cmb2-element .ui-icon-seek-prev{background-position:-48px -160px}.cmb2-element .ui-icon-seek-end{background-position:-64px -160px}.cmb2-element .ui-icon-seek-first,.cmb2-element .ui-icon-seek-start{background-position:-80px -160px}.cmb2-element .ui-icon-stop{background-position:-96px -160px}.cmb2-element .ui-icon-eject{background-position:-112px -160px}.cmb2-element .ui-icon-volume-off{background-position:-128px -160px}.cmb2-element .ui-icon-volume-on{background-position:-144px -160px}.cmb2-element .ui-icon-power{background-position:0 -176px}.cmb2-element .ui-icon-signal-diag{background-position:-16px -176px}.cmb2-element .ui-icon-signal{background-position:-32px -176px}.cmb2-element .ui-icon-battery-0{background-position:-48px -176px}.cmb2-element .ui-icon-battery-1{background-position:-64px -176px}.cmb2-element .ui-icon-battery-2{background-position:-80px -176px}.cmb2-element .ui-icon-battery-3{background-position:-96px -176px}.cmb2-element .ui-icon-circle-plus{background-position:0 -192px}.cmb2-element .ui-icon-circle-minus{background-position:-16px -192px}.cmb2-element .ui-icon-circle-close{background-position:-32px -192px}.cmb2-element .ui-icon-circle-triangle-e{background-position:-48px -192px}.cmb2-element .ui-icon-circle-triangle-s{background-position:-64px -192px}.cmb2-element .ui-icon-circle-triangle-w{background-position:-80px -192px}.cmb2-element .ui-icon-circle-triangle-n{background-position:-96px -192px}.cmb2-element .ui-icon-circle-arrow-e{background-position:-112px -192px}.cmb2-element .ui-icon-circle-arrow-s{background-position:-128px -192px}.cmb2-element .ui-icon-circle-arrow-w{background-position:-144px -192px}.cmb2-element .ui-icon-circle-arrow-n{background-position:-160px -192px}.cmb2-element .ui-icon-circle-zoomin{background-position:-176px -192px}.cmb2-element .ui-icon-circle-zoomout{background-position:-192px -192px}.cmb2-element .ui-icon-circle-check{background-position:-208px -192px}.cmb2-element .ui-icon-circlesmall-plus{background-position:0 -208px}.cmb2-element .ui-icon-circlesmall-minus{background-position:-16px -208px}.cmb2-element .ui-icon-circlesmall-close{background-position:-32px -208px}.cmb2-element .ui-icon-squaresmall-plus{background-position:-48px -208px}.cmb2-element .ui-icon-squaresmall-minus{background-position:-64px -208px}.cmb2-element .ui-icon-squaresmall-close{background-position:-80px -208px}.cmb2-element .ui-icon-grip-dotted-vertical{background-position:0 -224px}.cmb2-element .ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.cmb2-element .ui-icon-grip-solid-vertical{background-position:-32px -224px}.cmb2-element .ui-icon-grip-solid-horizontal{background-position:-48px -224px}.cmb2-element .ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.cmb2-element .ui-icon-grip-diagonal-se{background-position:-80px -224px}.cmb2-element .ui-corner-all,.cmb2-element .ui-corner-left,.cmb2-element .ui-corner-tl,.cmb2-element .ui-corner-top{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.cmb2-element .ui-corner-all,.cmb2-element .ui-corner-right,.cmb2-element .ui-corner-top,.cmb2-element .ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.cmb2-element .ui-corner-all,.cmb2-element .ui-corner-bl,.cmb2-element .ui-corner-bottom,.cmb2-element .ui-corner-left{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.cmb2-element .ui-corner-all,.cmb2-element .ui-corner-bottom,.cmb2-element .ui-corner-br,.cmb2-element .ui-corner-right{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.cmb2-element .ui-widget-overlay{background:#aaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.cmb2-element .ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px}.cmb2-element .ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.cmb2-element .ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.cmb2-element .ui-datepicker .ui-datepicker-next,.cmb2-element .ui-datepicker .ui-datepicker-prev{position:absolute;top:2px;width:1.8em;height:1.8em}.cmb2-element .ui-datepicker .ui-datepicker-next-hover,.cmb2-element .ui-datepicker .ui-datepicker-prev-hover{top:1px}.cmb2-element .ui-datepicker .ui-datepicker-prev{left:2px}.cmb2-element .ui-datepicker .ui-datepicker-next{right:2px}.cmb2-element .ui-datepicker .ui-datepicker-prev-hover{left:1px}.cmb2-element .ui-datepicker .ui-datepicker-next-hover{right:1px}.cmb2-element .ui-datepicker .ui-datepicker-next span,.cmb2-element .ui-datepicker .ui-datepicker-prev span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.cmb2-element .ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.cmb2-element .ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.cmb2-element .ui-datepicker select.ui-datepicker-month-year{width:100%}.cmb2-element .ui-datepicker select.ui-datepicker-month,.cmb2-element .ui-datepicker select.ui-datepicker-year{width:49%}.cmb2-element .ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.cmb2-element .ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:700;border:0}.cmb2-element .ui-datepicker td{border:0;padding:1px}.cmb2-element .ui-datepicker td a,.cmb2-element .ui-datepicker td span{display:block;padding:.2em;text-align:right;text-decoration:none}.cmb2-element .ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.cmb2-element .ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em;width:auto;overflow:visible}.cmb2-element .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.cmb2-element .ui-datepicker.ui-datepicker-multi{width:auto}.cmb2-element .ui-datepicker-multi .ui-datepicker-group{float:left}.cmb2-element .ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.cmb2-element .ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.cmb2-element .ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.cmb2-element .ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.cmb2-element .ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,.cmb2-element .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.cmb2-element .ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.cmb2-element .ui-datepicker-row-break{clear:both;width:100%;font-size:0}.cmb2-element .ui-datepicker-rtl{direction:rtl}.cmb2-element .ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.cmb2-element .ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.cmb2-element .ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.cmb2-element .ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.cmb2-element .ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,.cmb2-element .ui-datepicker-rtl .ui-datepicker-group{float:right}.cmb2-element .ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,.cmb2-element .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.cmb2-element .ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}@media (max-width:450px){.cmb-th{font-size:1.2em;padding-bottom:1em;text-align:left}.cmb-th label{display:block;margin-top:0;padding-bottom:5px}.cmb-th label:after{border-bottom:1px solid #e9e9e9;content:'';clear:both;display:block;padding-top:.4em}.cmb-td,.cmb-th,.cmb-th+.cmb-td{display:block;float:none;width:100%}.cmb-repeat-group-wrap .cmb-repeatable-group:not(:last-of-type),.cmb-repeat-group-wrap .cmb-row:not(:last-of-type),.postbox-container .cmb-repeatable-group:not(:last-of-type),.postbox-container .cmb-row:not(:last-of-type){border-bottom:0}}
|
cmb2/css/index.php
ADDED
|
File without changes
|
cmb2/css/sass/cmb2.scss
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* CMB Styling
|
| 3 |
+
*/
|
| 4 |
+
|
| 5 |
+
@import "partials/variables";
|
| 6 |
+
@import "partials/mixins";
|
| 7 |
+
|
| 8 |
+
@import "partials/main_wrap";
|
| 9 |
+
@import "partials/timepicker";
|
| 10 |
+
@import "partials/post_metaboxes";
|
| 11 |
+
@import "partials/misc";
|
| 12 |
+
@import "partials/sidebar_placements";
|
| 13 |
+
@import "partials/collapsible_ui";
|
| 14 |
+
@import "partials/jquery_ui";
|
cmb2/css/sass/index.php
ADDED
|
File without changes
|
cmb2/css/sass/partials/_collapsible_ui.scss
ADDED
|
@@ -0,0 +1,52 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.cmb2-metabox {
|
| 2 |
+
.cmb-repeat-group-wrap {
|
| 3 |
+
max-width: 1000px
|
| 4 |
+
}
|
| 5 |
+
.cmbhandle {
|
| 6 |
+
color: #aaa;
|
| 7 |
+
float: right;
|
| 8 |
+
width: 27px;
|
| 9 |
+
height: 30px;
|
| 10 |
+
cursor: pointer;
|
| 11 |
+
right: -1em;
|
| 12 |
+
position: relative;
|
| 13 |
+
&:before {
|
| 14 |
+
content: '\f142';
|
| 15 |
+
right: 12px;
|
| 16 |
+
font: normal 20px/1 'dashicons';
|
| 17 |
+
speak: none;
|
| 18 |
+
display: inline-block;
|
| 19 |
+
padding: 8px 10px;
|
| 20 |
+
top: 0;
|
| 21 |
+
position: relative;
|
| 22 |
+
-webkit-font-smoothing: antialiased;
|
| 23 |
+
-moz-osx-font-smoothing: grayscale;
|
| 24 |
+
text-decoration: none !important;
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.postbox.closed {
|
| 29 |
+
.cmbhandle {
|
| 30 |
+
&:before {
|
| 31 |
+
content: '\f140';
|
| 32 |
+
}
|
| 33 |
+
}
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 37 |
+
-webkit-appearance: none !important;
|
| 38 |
+
background: none !important;
|
| 39 |
+
border: none !important;
|
| 40 |
+
position: absolute;
|
| 41 |
+
left: 0;
|
| 42 |
+
top: .5em;
|
| 43 |
+
line-height: 1em;
|
| 44 |
+
cursor: pointer;
|
| 45 |
+
&:not([disabled]) {
|
| 46 |
+
color: $dark-red;
|
| 47 |
+
&:hover {
|
| 48 |
+
color: $red;
|
| 49 |
+
}
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
}
|
cmb2/css/sass/partials/_jquery_ui.scss
ADDED
|
@@ -0,0 +1,289 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* jQuery UI CSS Framework 1.8.16
|
| 3 |
+
*
|
| 4 |
+
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
| 5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
| 6 |
+
* http://jquery.org/license
|
| 7 |
+
*
|
| 8 |
+
* http://docs.jquery.com/UI/Theming/API
|
| 9 |
+
*/
|
| 10 |
+
.cmb2-element {
|
| 11 |
+
.ui-helper-hidden { display: none; }
|
| 12 |
+
.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
|
| 13 |
+
.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
|
| 14 |
+
.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
|
| 15 |
+
.ui-helper-clearfix { display: inline-block; }
|
| 16 |
+
* html .ui-helper-clearfix { height:1%; }
|
| 17 |
+
.ui-helper-clearfix { display:block; }
|
| 18 |
+
.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
|
| 19 |
+
.ui-state-disabled { cursor: default !important; }
|
| 20 |
+
.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
|
| 21 |
+
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
|
| 22 |
+
.ui-widget {
|
| 23 |
+
font-family: Verdana,Arial,sans-serif; font-size: 1.1em;
|
| 24 |
+
.ui-widget { font-size: 1em; }
|
| 25 |
+
input, select, textarea, button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
|
| 26 |
+
}
|
| 27 |
+
.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(../images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
|
| 28 |
+
.ui-widget-content a { color: #222222; }
|
| 29 |
+
.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(../images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
|
| 30 |
+
.ui-widget-header a { color: #222222; }
|
| 31 |
+
.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(../images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
|
| 32 |
+
.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
|
| 33 |
+
.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(../images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
|
| 34 |
+
.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
|
| 35 |
+
.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(../images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
|
| 36 |
+
.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
|
| 37 |
+
.ui-widget :active { outline: none; }
|
| 38 |
+
.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(../images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
|
| 39 |
+
.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
|
| 40 |
+
.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(../images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
|
| 41 |
+
.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
|
| 42 |
+
.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
|
| 43 |
+
.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
|
| 44 |
+
.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
|
| 45 |
+
.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
|
| 46 |
+
.ui-icon { width: 16px; height: 16px; background-image: url(../images/ui-icons_222222_256x240.png); }
|
| 47 |
+
.ui-widget-content .ui-icon {background-image: url(../images/ui-icons_222222_256x240.png); }
|
| 48 |
+
.ui-widget-header .ui-icon {background-image: url(../images/ui-icons_222222_256x240.png); }
|
| 49 |
+
.ui-state-default .ui-icon { background-image: url(../images/ui-icons_888888_256x240.png); }
|
| 50 |
+
.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(../images/ui-icons_454545_256x240.png); }
|
| 51 |
+
.ui-state-active .ui-icon {background-image: url(../images/ui-icons_454545_256x240.png); }
|
| 52 |
+
.ui-state-highlight .ui-icon {background-image: url(../images/ui-icons_2e83ff_256x240.png); }
|
| 53 |
+
.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(../images/ui-icons_cd0a0a_256x240.png); }
|
| 54 |
+
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 55 |
+
.ui-icon-carat-1-ne { background-position: -16px 0; }
|
| 56 |
+
.ui-icon-carat-1-e { background-position: -32px 0; }
|
| 57 |
+
.ui-icon-carat-1-se { background-position: -48px 0; }
|
| 58 |
+
.ui-icon-carat-1-s { background-position: -64px 0; }
|
| 59 |
+
.ui-icon-carat-1-sw { background-position: -80px 0; }
|
| 60 |
+
.ui-icon-carat-1-w { background-position: -96px 0; }
|
| 61 |
+
.ui-icon-carat-1-nw { background-position: -112px 0; }
|
| 62 |
+
.ui-icon-carat-2-n-s { background-position: -128px 0; }
|
| 63 |
+
.ui-icon-carat-2-e-w { background-position: -144px 0; }
|
| 64 |
+
.ui-icon-triangle-1-n { background-position: 0 -16px; }
|
| 65 |
+
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
|
| 66 |
+
.ui-icon-triangle-1-e { background-position: -32px -16px; }
|
| 67 |
+
.ui-icon-triangle-1-se { background-position: -48px -16px; }
|
| 68 |
+
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
| 69 |
+
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
|
| 70 |
+
.ui-icon-triangle-1-w { background-position: -96px -16px; }
|
| 71 |
+
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
|
| 72 |
+
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
|
| 73 |
+
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
|
| 74 |
+
.ui-icon-arrow-1-n { background-position: 0 -32px; }
|
| 75 |
+
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
|
| 76 |
+
.ui-icon-arrow-1-e { background-position: -32px -32px; }
|
| 77 |
+
.ui-icon-arrow-1-se { background-position: -48px -32px; }
|
| 78 |
+
.ui-icon-arrow-1-s { background-position: -64px -32px; }
|
| 79 |
+
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
|
| 80 |
+
.ui-icon-arrow-1-w { background-position: -96px -32px; }
|
| 81 |
+
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
|
| 82 |
+
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
|
| 83 |
+
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
|
| 84 |
+
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
|
| 85 |
+
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
|
| 86 |
+
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
|
| 87 |
+
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
|
| 88 |
+
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
|
| 89 |
+
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
|
| 90 |
+
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
|
| 91 |
+
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
|
| 92 |
+
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
|
| 93 |
+
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
|
| 94 |
+
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
|
| 95 |
+
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
|
| 96 |
+
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
|
| 97 |
+
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
|
| 98 |
+
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
|
| 99 |
+
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
|
| 100 |
+
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
|
| 101 |
+
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
|
| 102 |
+
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
|
| 103 |
+
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
|
| 104 |
+
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
|
| 105 |
+
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
|
| 106 |
+
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
|
| 107 |
+
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
|
| 108 |
+
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
|
| 109 |
+
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
|
| 110 |
+
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
|
| 111 |
+
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
|
| 112 |
+
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
|
| 113 |
+
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
|
| 114 |
+
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
|
| 115 |
+
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
|
| 116 |
+
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
|
| 117 |
+
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
|
| 118 |
+
.ui-icon-arrow-4 { background-position: 0 -80px; }
|
| 119 |
+
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
|
| 120 |
+
.ui-icon-extlink { background-position: -32px -80px; }
|
| 121 |
+
.ui-icon-newwin { background-position: -48px -80px; }
|
| 122 |
+
.ui-icon-refresh { background-position: -64px -80px; }
|
| 123 |
+
.ui-icon-shuffle { background-position: -80px -80px; }
|
| 124 |
+
.ui-icon-transfer-e-w { background-position: -96px -80px; }
|
| 125 |
+
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
|
| 126 |
+
.ui-icon-folder-collapsed { background-position: 0 -96px; }
|
| 127 |
+
.ui-icon-folder-open { background-position: -16px -96px; }
|
| 128 |
+
.ui-icon-document { background-position: -32px -96px; }
|
| 129 |
+
.ui-icon-document-b { background-position: -48px -96px; }
|
| 130 |
+
.ui-icon-note { background-position: -64px -96px; }
|
| 131 |
+
.ui-icon-mail-closed { background-position: -80px -96px; }
|
| 132 |
+
.ui-icon-mail-open { background-position: -96px -96px; }
|
| 133 |
+
.ui-icon-suitcase { background-position: -112px -96px; }
|
| 134 |
+
.ui-icon-comment { background-position: -128px -96px; }
|
| 135 |
+
.ui-icon-person { background-position: -144px -96px; }
|
| 136 |
+
.ui-icon-print { background-position: -160px -96px; }
|
| 137 |
+
.ui-icon-trash { background-position: -176px -96px; }
|
| 138 |
+
.ui-icon-locked { background-position: -192px -96px; }
|
| 139 |
+
.ui-icon-unlocked { background-position: -208px -96px; }
|
| 140 |
+
.ui-icon-bookmark { background-position: -224px -96px; }
|
| 141 |
+
.ui-icon-tag { background-position: -240px -96px; }
|
| 142 |
+
.ui-icon-home { background-position: 0 -112px; }
|
| 143 |
+
.ui-icon-flag { background-position: -16px -112px; }
|
| 144 |
+
.ui-icon-calendar { background-position: -32px -112px; }
|
| 145 |
+
.ui-icon-cart { background-position: -48px -112px; }
|
| 146 |
+
.ui-icon-pencil { background-position: -64px -112px; }
|
| 147 |
+
.ui-icon-clock { background-position: -80px -112px; }
|
| 148 |
+
.ui-icon-disk { background-position: -96px -112px; }
|
| 149 |
+
.ui-icon-calculator { background-position: -112px -112px; }
|
| 150 |
+
.ui-icon-zoomin { background-position: -128px -112px; }
|
| 151 |
+
.ui-icon-zoomout { background-position: -144px -112px; }
|
| 152 |
+
.ui-icon-search { background-position: -160px -112px; }
|
| 153 |
+
.ui-icon-wrench { background-position: -176px -112px; }
|
| 154 |
+
.ui-icon-gear { background-position: -192px -112px; }
|
| 155 |
+
.ui-icon-heart { background-position: -208px -112px; }
|
| 156 |
+
.ui-icon-star { background-position: -224px -112px; }
|
| 157 |
+
.ui-icon-link { background-position: -240px -112px; }
|
| 158 |
+
.ui-icon-cancel { background-position: 0 -128px; }
|
| 159 |
+
.ui-icon-plus { background-position: -16px -128px; }
|
| 160 |
+
.ui-icon-plusthick { background-position: -32px -128px; }
|
| 161 |
+
.ui-icon-minus { background-position: -48px -128px; }
|
| 162 |
+
.ui-icon-minusthick { background-position: -64px -128px; }
|
| 163 |
+
.ui-icon-close { background-position: -80px -128px; }
|
| 164 |
+
.ui-icon-closethick { background-position: -96px -128px; }
|
| 165 |
+
.ui-icon-key { background-position: -112px -128px; }
|
| 166 |
+
.ui-icon-lightbulb { background-position: -128px -128px; }
|
| 167 |
+
.ui-icon-scissors { background-position: -144px -128px; }
|
| 168 |
+
.ui-icon-clipboard { background-position: -160px -128px; }
|
| 169 |
+
.ui-icon-copy { background-position: -176px -128px; }
|
| 170 |
+
.ui-icon-contact { background-position: -192px -128px; }
|
| 171 |
+
.ui-icon-image { background-position: -208px -128px; }
|
| 172 |
+
.ui-icon-video { background-position: -224px -128px; }
|
| 173 |
+
.ui-icon-script { background-position: -240px -128px; }
|
| 174 |
+
.ui-icon-alert { background-position: 0 -144px; }
|
| 175 |
+
.ui-icon-info { background-position: -16px -144px; }
|
| 176 |
+
.ui-icon-notice { background-position: -32px -144px; }
|
| 177 |
+
.ui-icon-help { background-position: -48px -144px; }
|
| 178 |
+
.ui-icon-check { background-position: -64px -144px; }
|
| 179 |
+
.ui-icon-bullet { background-position: -80px -144px; }
|
| 180 |
+
.ui-icon-radio-off { background-position: -96px -144px; }
|
| 181 |
+
.ui-icon-radio-on { background-position: -112px -144px; }
|
| 182 |
+
.ui-icon-pin-w { background-position: -128px -144px; }
|
| 183 |
+
.ui-icon-pin-s { background-position: -144px -144px; }
|
| 184 |
+
.ui-icon-play { background-position: 0 -160px; }
|
| 185 |
+
.ui-icon-pause { background-position: -16px -160px; }
|
| 186 |
+
.ui-icon-seek-next { background-position: -32px -160px; }
|
| 187 |
+
.ui-icon-seek-prev { background-position: -48px -160px; }
|
| 188 |
+
.ui-icon-seek-end { background-position: -64px -160px; }
|
| 189 |
+
.ui-icon-seek-start { background-position: -80px -160px; }
|
| 190 |
+
.ui-icon-seek-first { background-position: -80px -160px; }
|
| 191 |
+
.ui-icon-stop { background-position: -96px -160px; }
|
| 192 |
+
.ui-icon-eject { background-position: -112px -160px; }
|
| 193 |
+
.ui-icon-volume-off { background-position: -128px -160px; }
|
| 194 |
+
.ui-icon-volume-on { background-position: -144px -160px; }
|
| 195 |
+
.ui-icon-power { background-position: 0 -176px; }
|
| 196 |
+
.ui-icon-signal-diag { background-position: -16px -176px; }
|
| 197 |
+
.ui-icon-signal { background-position: -32px -176px; }
|
| 198 |
+
.ui-icon-battery-0 { background-position: -48px -176px; }
|
| 199 |
+
.ui-icon-battery-1 { background-position: -64px -176px; }
|
| 200 |
+
.ui-icon-battery-2 { background-position: -80px -176px; }
|
| 201 |
+
.ui-icon-battery-3 { background-position: -96px -176px; }
|
| 202 |
+
.ui-icon-circle-plus { background-position: 0 -192px; }
|
| 203 |
+
.ui-icon-circle-minus { background-position: -16px -192px; }
|
| 204 |
+
.ui-icon-circle-close { background-position: -32px -192px; }
|
| 205 |
+
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
|
| 206 |
+
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
|
| 207 |
+
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
|
| 208 |
+
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
|
| 209 |
+
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
|
| 210 |
+
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
|
| 211 |
+
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
|
| 212 |
+
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
|
| 213 |
+
.ui-icon-circle-zoomin { background-position: -176px -192px; }
|
| 214 |
+
.ui-icon-circle-zoomout { background-position: -192px -192px; }
|
| 215 |
+
.ui-icon-circle-check { background-position: -208px -192px; }
|
| 216 |
+
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
|
| 217 |
+
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
|
| 218 |
+
.ui-icon-circlesmall-close { background-position: -32px -208px; }
|
| 219 |
+
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
|
| 220 |
+
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
|
| 221 |
+
.ui-icon-squaresmall-close { background-position: -80px -208px; }
|
| 222 |
+
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
|
| 223 |
+
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
|
| 224 |
+
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
|
| 225 |
+
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
|
| 226 |
+
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
| 227 |
+
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
| 228 |
+
.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; }
|
| 229 |
+
.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; }
|
| 230 |
+
.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
|
| 231 |
+
.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
|
| 232 |
+
.ui-widget-overlay { background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
|
| 233 |
+
.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }
|
| 234 |
+
.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
|
| 235 |
+
.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
|
| 236 |
+
.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
|
| 237 |
+
.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
|
| 238 |
+
.ui-datepicker .ui-datepicker-prev { left:2px; }
|
| 239 |
+
.ui-datepicker .ui-datepicker-next { right:2px; }
|
| 240 |
+
.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
|
| 241 |
+
.ui-datepicker .ui-datepicker-next-hover { right:1px; }
|
| 242 |
+
.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
|
| 243 |
+
.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
|
| 244 |
+
.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
|
| 245 |
+
.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
|
| 246 |
+
.ui-datepicker select.ui-datepicker-month,
|
| 247 |
+
.ui-datepicker select.ui-datepicker-year { width: 49%;}
|
| 248 |
+
.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
|
| 249 |
+
.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
|
| 250 |
+
.ui-datepicker td { border: 0; padding: 1px; }
|
| 251 |
+
.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
|
| 252 |
+
.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
|
| 253 |
+
.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
|
| 254 |
+
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
|
| 255 |
+
.ui-datepicker.ui-datepicker-multi { width:auto; }
|
| 256 |
+
.ui-datepicker-multi .ui-datepicker-group { float:left; }
|
| 257 |
+
.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
|
| 258 |
+
.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
|
| 259 |
+
.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
|
| 260 |
+
.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
|
| 261 |
+
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
|
| 262 |
+
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
|
| 263 |
+
.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
|
| 264 |
+
.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
|
| 265 |
+
.ui-datepicker-rtl {
|
| 266 |
+
direction: rtl;
|
| 267 |
+
.ui-datepicker-prev { right: 2px; left: auto; }
|
| 268 |
+
.ui-datepicker-next { left: 2px; right: auto; }
|
| 269 |
+
.ui-datepicker-prev:hover { right: 1px; left: auto; }
|
| 270 |
+
.ui-datepicker-next:hover { left: 1px; right: auto; }
|
| 271 |
+
.ui-datepicker-buttonpane { clear:right; }
|
| 272 |
+
.ui-datepicker-buttonpane button { float: left; }
|
| 273 |
+
.ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
|
| 274 |
+
.ui-datepicker-group { float:right; }
|
| 275 |
+
.ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 276 |
+
.ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
|
| 277 |
+
}
|
| 278 |
+
.ui-datepicker-cover {
|
| 279 |
+
display: none; /*sorry for IE5*/
|
| 280 |
+
display/**/: block; /*sorry for IE5*/
|
| 281 |
+
position: absolute; /*must have*/
|
| 282 |
+
z-index: -1; /*must have*/
|
| 283 |
+
filter: mask(); /*must have*/
|
| 284 |
+
top: -4px; /*must have*/
|
| 285 |
+
left: -4px; /*must have*/
|
| 286 |
+
width: 200px; /*must have*/
|
| 287 |
+
height: 200px; /*must have*/
|
| 288 |
+
}
|
| 289 |
+
}
|
cmb2/css/sass/partials/_main_wrap.scss
ADDED
|
@@ -0,0 +1,438 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*--------------------------------------------------------------
|
| 2 |
+
Main Wrap
|
| 3 |
+
--------------------------------------------------------------*/
|
| 4 |
+
|
| 5 |
+
.cmb2-wrap {
|
| 6 |
+
margin: 0;
|
| 7 |
+
|
| 8 |
+
input,
|
| 9 |
+
textarea {
|
| 10 |
+
font-size: $font-size;
|
| 11 |
+
max-width: 100%;
|
| 12 |
+
padding: 5px;
|
| 13 |
+
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
input[type=text] {
|
| 17 |
+
|
| 18 |
+
&.cmb2-oembed {
|
| 19 |
+
width: 100%;
|
| 20 |
+
}
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
textarea {
|
| 24 |
+
width: 500px;
|
| 25 |
+
|
| 26 |
+
&.cmb2-textarea-code {
|
| 27 |
+
font-family: $font-mono;
|
| 28 |
+
line-height: 16px;
|
| 29 |
+
}
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
input {
|
| 33 |
+
|
| 34 |
+
&.cmb2-text-small,
|
| 35 |
+
&.cmb2-timepicker {
|
| 36 |
+
width: 100px;
|
| 37 |
+
// margin-right: 15px
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
&.cmb2-text-money {
|
| 41 |
+
width: 90px;
|
| 42 |
+
// margin-right: 15px
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
&.cmb2-text-medium {
|
| 46 |
+
width: 230px;
|
| 47 |
+
// margin-right: 15px
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
&.cmb2-upload-file {
|
| 51 |
+
width: 65%;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
&.ed_button {
|
| 55 |
+
padding: 2px 4px;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
&:not([type="hidden"]) {
|
| 59 |
+
+ input,
|
| 60 |
+
+ .button,
|
| 61 |
+
+ select {
|
| 62 |
+
margin-left: 20px;
|
| 63 |
+
}
|
| 64 |
+
}
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
ul {
|
| 68 |
+
margin: 0;
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
li {
|
| 72 |
+
font-size: $font-size;
|
| 73 |
+
line-height: 16px;
|
| 74 |
+
margin: 1px 0 5px 0;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
// .cmb-field-list .cmb-field-list {
|
| 78 |
+
// padding-top:5px;
|
| 79 |
+
// margin: 0;
|
| 80 |
+
// }
|
| 81 |
+
|
| 82 |
+
select {
|
| 83 |
+
font-size: $font-size;
|
| 84 |
+
margin-top: 3px;
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
input:focus,
|
| 88 |
+
textarea:focus {
|
| 89 |
+
background: $light-yellow;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
input[type="radio"] {
|
| 93 |
+
margin: 0 5px 0 0;
|
| 94 |
+
padding: 0
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
input[type="checkbox"] {
|
| 98 |
+
margin: 0 5px 0 0;
|
| 99 |
+
padding: 0;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
button,
|
| 103 |
+
.button {
|
| 104 |
+
white-space: nowrap;
|
| 105 |
+
}
|
| 106 |
+
|
| 107 |
+
.mceLayout {
|
| 108 |
+
border: 1px solid $light-gray !important;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
.mceIframeContainer {
|
| 112 |
+
background: #fff;
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
.meta_mce {
|
| 116 |
+
width: 97%;
|
| 117 |
+
|
| 118 |
+
textarea {
|
| 119 |
+
width: 100%;
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
// /**
|
| 124 |
+
// * Color picker
|
| 125 |
+
// */
|
| 126 |
+
.wp-color-result,
|
| 127 |
+
.wp-picker-input-wrap {
|
| 128 |
+
vertical-align: middle;
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
.wp-color-result,
|
| 132 |
+
.wp-picker-container {
|
| 133 |
+
margin: 0 10px 0 0;
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
.cmb-row {
|
| 137 |
+
margin: 0;
|
| 138 |
+
|
| 139 |
+
&:after {
|
| 140 |
+
content: '';
|
| 141 |
+
clear: both;
|
| 142 |
+
display: block;
|
| 143 |
+
width: 100%;
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
&.cmb-repeat-row {
|
| 147 |
+
padding: 1.8em 0 0;
|
| 148 |
+
|
| 149 |
+
&:first-of-type {
|
| 150 |
+
padding: 0;
|
| 151 |
+
}
|
| 152 |
+
}
|
| 153 |
+
|
| 154 |
+
&.cmb-repeat .cmb2-metabox-description {
|
| 155 |
+
padding-top: 0;
|
| 156 |
+
padding-bottom: 1.8em;
|
| 157 |
+
}
|
| 158 |
+
}
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
.cmb2-metabox {
|
| 162 |
+
clear: both;
|
| 163 |
+
margin: 0;
|
| 164 |
+
|
| 165 |
+
> .cmb-row:first-of-type >,
|
| 166 |
+
.cmb-field-list > .cmb-row:first-of-type > {
|
| 167 |
+
.cmb-td,
|
| 168 |
+
.cmb-th {
|
| 169 |
+
border: 0;
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
> .cmb-row {
|
| 174 |
+
.cmb-repeat-table .cmb-row > .cmb-td {
|
| 175 |
+
padding-right: 20px;
|
| 176 |
+
box-sizing: border-box;
|
| 177 |
+
float: left;
|
| 178 |
+
}
|
| 179 |
+
}
|
| 180 |
+
}
|
| 181 |
+
|
| 182 |
+
.cmb-add-row {
|
| 183 |
+
margin: 1.8em 0 0;
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
.cmb-nested .cmb-td,
|
| 187 |
+
.cmb-repeatable-group .cmb-th,
|
| 188 |
+
.cmb-repeatable-group:first-of-type {
|
| 189 |
+
border: 0;
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
.cmb-row:last-of-type,
|
| 193 |
+
.cmb2-wrap .cmb-row:last-of-type,
|
| 194 |
+
.cmb-repeatable-group:last-of-type {
|
| 195 |
+
border-bottom: 0;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
.cmb-repeatable-grouping {
|
| 199 |
+
border: 1px solid $light-gray;
|
| 200 |
+
padding: 0 1em;
|
| 201 |
+
max-width: 1000px;
|
| 202 |
+
&.cmb-row {
|
| 203 |
+
margin: 0 0 0.8em;
|
| 204 |
+
}
|
| 205 |
+
+ .cmb-repeatable-grouping {
|
| 206 |
+
}
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
.cmb-th {
|
| 210 |
+
color: $dark-gray;
|
| 211 |
+
float: left;
|
| 212 |
+
font-weight: 600;
|
| 213 |
+
line-height: 1.3;
|
| 214 |
+
padding: 20px 10px 20px 0;
|
| 215 |
+
vertical-align: top;
|
| 216 |
+
width: 200px;
|
| 217 |
+
|
| 218 |
+
@media (max-width: $mobile-break) {
|
| 219 |
+
@include fullth;
|
| 220 |
+
}
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
.cmb-td {
|
| 224 |
+
line-height: 1.3;
|
| 225 |
+
max-width: 100%;
|
| 226 |
+
padding: 15px 10px;
|
| 227 |
+
vertical-align: middle;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
.cmb-type-title {
|
| 231 |
+
|
| 232 |
+
.cmb-td {
|
| 233 |
+
padding: 0;
|
| 234 |
+
}
|
| 235 |
+
}
|
| 236 |
+
|
| 237 |
+
.cmb-th label {
|
| 238 |
+
display: block;
|
| 239 |
+
padding: 5px 0;
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
.cmb-th + .cmb-td {
|
| 243 |
+
float: left;
|
| 244 |
+
}
|
| 245 |
+
|
| 246 |
+
.cmb-td .cmb-td {
|
| 247 |
+
padding-bottom: 1em;
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
.cmb-remove-row {
|
| 251 |
+
text-align: right;
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
.empty-row.hidden {
|
| 255 |
+
display: none;
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
.cmb-repeatable-group {
|
| 259 |
+
|
| 260 |
+
.cmb-th {
|
| 261 |
+
padding: 5px;
|
| 262 |
+
}
|
| 263 |
+
|
| 264 |
+
.cmb-group-title {
|
| 265 |
+
background-color: $light-gray;
|
| 266 |
+
padding: 8px 12px 8px 2.2em;
|
| 267 |
+
margin: 0 -1em;
|
| 268 |
+
min-height: 1.5em;
|
| 269 |
+
font-size: 14px;
|
| 270 |
+
line-height: 1.4;
|
| 271 |
+
|
| 272 |
+
h4 {
|
| 273 |
+
border: 0;
|
| 274 |
+
margin: 0;
|
| 275 |
+
font-size: 1.2em;
|
| 276 |
+
font-weight: 500;
|
| 277 |
+
padding: 0.5em 0.75em;
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
.cmb-th {
|
| 281 |
+
display: block;
|
| 282 |
+
width: 100%;
|
| 283 |
+
}
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
.cmb-group-description .cmb-th {
|
| 287 |
+
@include fullth;
|
| 288 |
+
}
|
| 289 |
+
|
| 290 |
+
.cmb-shift-rows {
|
| 291 |
+
font-size: 1em;
|
| 292 |
+
margin-right: 1em;
|
| 293 |
+
text-decoration: none;
|
| 294 |
+
|
| 295 |
+
.dashicons {
|
| 296 |
+
font-size: 1.5em;
|
| 297 |
+
height: 1.5em;
|
| 298 |
+
line-height: 1.2em;
|
| 299 |
+
width: 1em;
|
| 300 |
+
|
| 301 |
+
&.dashicons-arrow-down-alt2 {
|
| 302 |
+
line-height: 1.3em;
|
| 303 |
+
|
| 304 |
+
}
|
| 305 |
+
}
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
.cmb2-upload-button {
|
| 309 |
+
float: right;
|
| 310 |
+
}
|
| 311 |
+
|
| 312 |
+
}
|
| 313 |
+
|
| 314 |
+
p.cmb2-metabox-description {
|
| 315 |
+
color: $gray;
|
| 316 |
+
font-style: italic;
|
| 317 |
+
margin: 0;
|
| 318 |
+
padding-top: .5em;
|
| 319 |
+
}
|
| 320 |
+
|
| 321 |
+
span.cmb2-metabox-description {
|
| 322 |
+
color: $gray;
|
| 323 |
+
font-style: italic;
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
.cmb2-metabox-title {
|
| 327 |
+
margin: 0 0 5px 0;
|
| 328 |
+
padding: 5px 0 0 0;
|
| 329 |
+
font-size: 14px;
|
| 330 |
+
}
|
| 331 |
+
|
| 332 |
+
.cmb-inline ul {
|
| 333 |
+
padding: 4px 0 0 0;
|
| 334 |
+
}
|
| 335 |
+
|
| 336 |
+
.cmb-inline li {
|
| 337 |
+
display: inline-block;
|
| 338 |
+
padding-right: 18px;
|
| 339 |
+
}
|
| 340 |
+
|
| 341 |
+
.cmb-type-textarea-code pre {
|
| 342 |
+
margin: 0;
|
| 343 |
+
}
|
| 344 |
+
|
| 345 |
+
.cmb2-media-status {
|
| 346 |
+
|
| 347 |
+
.img-status {
|
| 348 |
+
clear: none;
|
| 349 |
+
display: inline-block;
|
| 350 |
+
float: left;
|
| 351 |
+
margin-right: 10px;
|
| 352 |
+
width: auto;
|
| 353 |
+
|
| 354 |
+
img {
|
| 355 |
+
max-width: 350px;
|
| 356 |
+
}
|
| 357 |
+
}
|
| 358 |
+
|
| 359 |
+
.img-status img,
|
| 360 |
+
.embed-status {
|
| 361 |
+
background: $white;
|
| 362 |
+
border: 1px solid $light-gray;
|
| 363 |
+
border-radius: 2px;
|
| 364 |
+
-moz-border-radius: 2px;
|
| 365 |
+
margin: 15px 0 0 0;
|
| 366 |
+
padding: 5px;
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
.embed-status {
|
| 370 |
+
float: left;
|
| 371 |
+
max-width: 800px;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
.img-status, .embed-status {
|
| 375 |
+
position: relative;
|
| 376 |
+
|
| 377 |
+
.cmb2-remove-file-button {
|
| 378 |
+
background: url(../images/ico-delete.png);
|
| 379 |
+
height: 16px;
|
| 380 |
+
left: -5px;
|
| 381 |
+
position: absolute;
|
| 382 |
+
text-indent: -9999px;
|
| 383 |
+
top: -5px;
|
| 384 |
+
width: 16px;
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
}
|
| 388 |
+
|
| 389 |
+
.img-status {
|
| 390 |
+
|
| 391 |
+
.cmb2-remove-file-button {
|
| 392 |
+
top: 10px;
|
| 393 |
+
}
|
| 394 |
+
}
|
| 395 |
+
|
| 396 |
+
.img-status img, .file-status > span {
|
| 397 |
+
cursor: pointer;
|
| 398 |
+
}
|
| 399 |
+
|
| 400 |
+
}
|
| 401 |
+
|
| 402 |
+
.cmb-type-file-list .cmb2-media-status .img-status {
|
| 403 |
+
clear: none;
|
| 404 |
+
float: left;
|
| 405 |
+
margin-right: 10px;
|
| 406 |
+
width: auto;
|
| 407 |
+
}
|
| 408 |
+
|
| 409 |
+
.cmb-attach-list li {
|
| 410 |
+
clear: both;
|
| 411 |
+
display: inline-block;
|
| 412 |
+
margin-bottom: 25px;
|
| 413 |
+
width: 100%;
|
| 414 |
+
|
| 415 |
+
img {
|
| 416 |
+
cursor: move;
|
| 417 |
+
float: left;
|
| 418 |
+
margin-right: 10px;
|
| 419 |
+
}
|
| 420 |
+
}
|
| 421 |
+
|
| 422 |
+
.cmb2-remove-wrapper {
|
| 423 |
+
margin: 0;
|
| 424 |
+
}
|
| 425 |
+
|
| 426 |
+
.child-cmb2 .cmb-th {
|
| 427 |
+
text-align: left;
|
| 428 |
+
}
|
| 429 |
+
|
| 430 |
+
@media (max-width: $mobile-break) {
|
| 431 |
+
.cmb-th,
|
| 432 |
+
.cmb-td,
|
| 433 |
+
.cmb-th + .cmb-td {
|
| 434 |
+
display: block;
|
| 435 |
+
float: none;
|
| 436 |
+
width: 100%;
|
| 437 |
+
}
|
| 438 |
+
}
|
cmb2/css/sass/partials/_misc.scss
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*--------------------------------------------------------------
|
| 2 |
+
Misc.
|
| 3 |
+
--------------------------------------------------------------*/
|
| 4 |
+
|
| 5 |
+
#poststuff .cmb-repeatable-group h2 {
|
| 6 |
+
margin: 0;
|
| 7 |
+
}
|
| 8 |
+
|
| 9 |
+
.edit-tags-php,
|
| 10 |
+
.profile-php,
|
| 11 |
+
.user-edit-php {
|
| 12 |
+
|
| 13 |
+
.cmb2-metabox-title {
|
| 14 |
+
font-size: 1.4em;
|
| 15 |
+
}
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
.postbox .cmb-spinner {
|
| 19 |
+
float: left;
|
| 20 |
+
}
|
cmb2/css/sass/partials/_mixins.scss
ADDED
|
@@ -0,0 +1,40 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
//--------------------------------------------------------------
|
| 2 |
+
// Mixins
|
| 3 |
+
//--------------------------------------------------------------
|
| 4 |
+
|
| 5 |
+
@mixin fullth() {
|
| 6 |
+
font-size: 1.2em;
|
| 7 |
+
@include _fullth;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
@mixin fullth_side() {
|
| 11 |
+
|
| 12 |
+
@include _fullth;
|
| 13 |
+
|
| 14 |
+
label {
|
| 15 |
+
font-size: $font-size;
|
| 16 |
+
line-height: 1.4em;
|
| 17 |
+
}
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
@mixin _fullth() {
|
| 21 |
+
display: block;
|
| 22 |
+
float: none;
|
| 23 |
+
padding-bottom: 1em;
|
| 24 |
+
text-align: left;
|
| 25 |
+
width: 100%;
|
| 26 |
+
|
| 27 |
+
label {
|
| 28 |
+
display: block;
|
| 29 |
+
margin-top: 0em;
|
| 30 |
+
padding-bottom: 5px;
|
| 31 |
+
|
| 32 |
+
&:after {
|
| 33 |
+
border-bottom: 1px solid $light-gray;
|
| 34 |
+
content: '';
|
| 35 |
+
clear: both;
|
| 36 |
+
display: block;
|
| 37 |
+
padding-top: .4em;
|
| 38 |
+
}
|
| 39 |
+
}
|
| 40 |
+
}
|
cmb2/css/sass/partials/_post_metaboxes.scss
ADDED
|
@@ -0,0 +1,114 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*--------------------------------------------------------------
|
| 2 |
+
Post Metaboxes
|
| 3 |
+
--------------------------------------------------------------*/
|
| 4 |
+
#poststuff .cmb-group-title {
|
| 5 |
+
margin-left: -1em;
|
| 6 |
+
margin-right: -1em;
|
| 7 |
+
padding-left: 2.2em;
|
| 8 |
+
// cursor: move;
|
| 9 |
+
min-height: 1.5em;
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
.postbox-container, .cmb-repeat-group-wrap {
|
| 13 |
+
|
| 14 |
+
.cmb2-wrap {
|
| 15 |
+
margin: 0;
|
| 16 |
+
|
| 17 |
+
> .cmb-field-list > .cmb-row {
|
| 18 |
+
padding: 1.8em 0;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
input[type=text] {
|
| 22 |
+
|
| 23 |
+
&.cmb2-oembed {
|
| 24 |
+
width: 100%;
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.cmb-row {
|
| 30 |
+
padding: 0 0 1.8em;
|
| 31 |
+
margin: 0 0 0.8em;
|
| 32 |
+
|
| 33 |
+
.cmbhandle {
|
| 34 |
+
right: -1em;
|
| 35 |
+
position: relative;
|
| 36 |
+
}
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
.cmb-repeatable-grouping {
|
| 40 |
+
padding: 0 1em;
|
| 41 |
+
max-width: 100%;
|
| 42 |
+
min-width: 1px !important;
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
.cmb-repeatable-group > .cmb-row {
|
| 46 |
+
padding-bottom: 0;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
.cmb-th {
|
| 50 |
+
width: 18%;
|
| 51 |
+
padding: 0 2% 0 0;
|
| 52 |
+
// text-align: right;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
.cmb-td {
|
| 56 |
+
margin-bottom: 0;
|
| 57 |
+
padding: 0;
|
| 58 |
+
line-height: 1.3;
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
.cmb-repeat-row .cmb-td {
|
| 62 |
+
padding-bottom: 1.8em;
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
.cmb-th + .cmb-td {
|
| 66 |
+
width: 80%;
|
| 67 |
+
float: right;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
.cmb-row:not(:last-of-type),
|
| 71 |
+
.cmb-repeatable-group:not(:last-of-type) {
|
| 72 |
+
border-bottom: 1px solid $light-gray;
|
| 73 |
+
|
| 74 |
+
@media (max-width: $mobile-break) {
|
| 75 |
+
border-bottom: 0;
|
| 76 |
+
}
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
.cmb-repeat-group-field,
|
| 80 |
+
.cmb-remove-field-row {
|
| 81 |
+
padding-top: 1.8em;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
.cmb2-metabox > .cmb-row {
|
| 85 |
+
&.table-layout, .cmb-row.table-layout {
|
| 86 |
+
.cmb-repeat-table .cmb-tbody {
|
| 87 |
+
display: table;
|
| 88 |
+
width: 100%;
|
| 89 |
+
|
| 90 |
+
input.regular-text {
|
| 91 |
+
width: 100%;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
.cmb-row:not(.hidden):not(.empty-row) {
|
| 95 |
+
display: table-row;
|
| 96 |
+
}
|
| 97 |
+
|
| 98 |
+
.cmb-td {
|
| 99 |
+
display: table-cell;
|
| 100 |
+
float: none;
|
| 101 |
+
width: 100%;
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
.cmb-row:not(:first-of-type) .cmb-td {
|
| 105 |
+
padding-top: 1.8em;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
.cmb-td.cmb-remove-row {
|
| 109 |
+
padding-right: 0;
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
}
|
| 113 |
+
}
|
| 114 |
+
}
|
cmb2/css/sass/partials/_sidebar_placements.scss
ADDED
|
@@ -0,0 +1,153 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*--------------------------------------------------------------
|
| 2 |
+
Sidebar Placement Adjustments
|
| 3 |
+
--------------------------------------------------------------*/
|
| 4 |
+
|
| 5 |
+
.inner-sidebar,
|
| 6 |
+
#side-sortables {
|
| 7 |
+
|
| 8 |
+
.cmb2-wrap {
|
| 9 |
+
|
| 10 |
+
> .cmb-field-list > .cmb-row {
|
| 11 |
+
padding: 1.4em 0;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
input {
|
| 15 |
+
|
| 16 |
+
&[type=text]:not( .wp-color-picker ) {
|
| 17 |
+
width: 100%;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
+ input:not( .wp-picker-clear ), + select {
|
| 21 |
+
margin-left: 0;
|
| 22 |
+
margin-top: 1em;
|
| 23 |
+
display: block;
|
| 24 |
+
}
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
label {
|
| 28 |
+
display: block;
|
| 29 |
+
font-weight: 700;
|
| 30 |
+
padding: 0 0 5px;
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
.cmb-repeatable-group {
|
| 36 |
+
border-bottom: 1px solid $light-gray;
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
.cmb-repeat-group-wrap > .cmb-td > .cmb-repeatable-group {
|
| 40 |
+
border-bottom: 0;
|
| 41 |
+
margin-bottom: -1.4em;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
.cmb-th,
|
| 45 |
+
.cmb-td,
|
| 46 |
+
.cmb-th + .cmb-td {
|
| 47 |
+
width: 100%;
|
| 48 |
+
display: block;
|
| 49 |
+
float: none;
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
.closed .inside {
|
| 53 |
+
display: none;
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
.cmb-td .cmb-td {
|
| 57 |
+
padding-bottom: 1em;
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
.cmb-th {
|
| 61 |
+
@include fullth_side;
|
| 62 |
+
padding-left: 0;
|
| 63 |
+
padding-right: 0;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
.cmb-group-description {
|
| 67 |
+
.cmb-th {
|
| 68 |
+
padding-top: 0;
|
| 69 |
+
}
|
| 70 |
+
.cmb2-metabox-description {
|
| 71 |
+
padding: 0;
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
.cmb-group-title {
|
| 76 |
+
// padding-bottom: 0;
|
| 77 |
+
.cmb-th {
|
| 78 |
+
padding: 0;
|
| 79 |
+
}
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
.cmb-repeatable-grouping {
|
| 83 |
+
+ .cmb-repeatable-grouping {
|
| 84 |
+
margin-top: 1em;
|
| 85 |
+
}
|
| 86 |
+
}
|
| 87 |
+
.cmb2-media-status {
|
| 88 |
+
|
| 89 |
+
.img-status,
|
| 90 |
+
.embed-status {
|
| 91 |
+
|
| 92 |
+
img {
|
| 93 |
+
max-width: 90%;
|
| 94 |
+
// width: auto;
|
| 95 |
+
height: auto;
|
| 96 |
+
}
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
.cmb2-list label {
|
| 101 |
+
display: inline;
|
| 102 |
+
font-weight: normal;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
.cmb2-metabox-description {
|
| 106 |
+
display: block;
|
| 107 |
+
padding: 7px 0 0;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
.cmb-type-checkbox {
|
| 111 |
+
|
| 112 |
+
.cmb-td label,
|
| 113 |
+
.cmb2-metabox-description {
|
| 114 |
+
font-weight: normal;
|
| 115 |
+
display: inline;
|
| 116 |
+
}
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
.cmb-row .cmb2-metabox-description {
|
| 120 |
+
padding-bottom: 1.8em;
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
.cmb2-metabox-title {
|
| 124 |
+
font-size: 1.2em;
|
| 125 |
+
font-style: italic;
|
| 126 |
+
}
|
| 127 |
+
|
| 128 |
+
.cmb-remove-row {
|
| 129 |
+
clear: both;
|
| 130 |
+
padding-top: 12px;
|
| 131 |
+
padding-bottom: 0;
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
.cmb-type-colorpicker .cmb-repeat-row {
|
| 135 |
+
.cmb-td {
|
| 136 |
+
width: auto;
|
| 137 |
+
clear: none;
|
| 138 |
+
float: left;
|
| 139 |
+
padding-top: 0;
|
| 140 |
+
&.cmb-remove-row {
|
| 141 |
+
float: right;
|
| 142 |
+
margin: 0;
|
| 143 |
+
}
|
| 144 |
+
}
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
.cmb2-upload-button {
|
| 148 |
+
clear: both;
|
| 149 |
+
margin-top: 12px;
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
}
|
| 153 |
+
|
cmb2/css/sass/partials/_timepicker.scss
ADDED
|
@@ -0,0 +1,40 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*--------------------------------------------------------------
|
| 2 |
+
Timepicker
|
| 3 |
+
--------------------------------------------------------------*/
|
| 4 |
+
|
| 5 |
+
div {
|
| 6 |
+
|
| 7 |
+
&.time-picker {
|
| 8 |
+
background: #fff;
|
| 9 |
+
border: 1px solid $gray;
|
| 10 |
+
height: 191px;
|
| 11 |
+
margin: 0;
|
| 12 |
+
position: absolute;
|
| 13 |
+
overflow: auto;
|
| 14 |
+
width: 6em; /* needed for IE */
|
| 15 |
+
z-index: 99;
|
| 16 |
+
|
| 17 |
+
ul {
|
| 18 |
+
list-style-type: none;
|
| 19 |
+
margin: 0;
|
| 20 |
+
padding: 0;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
li {
|
| 24 |
+
cursor: pointer;
|
| 25 |
+
margin-bottom: 0;
|
| 26 |
+
font-family: $font-sans;
|
| 27 |
+
font-size: 14px;
|
| 28 |
+
padding: 4px 3px;
|
| 29 |
+
|
| 30 |
+
&.selected {
|
| 31 |
+
background: $blue;
|
| 32 |
+
color: #fff;
|
| 33 |
+
}
|
| 34 |
+
}
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
&.time-picker-12hours {
|
| 38 |
+
width: 8em; /* needed for IE */
|
| 39 |
+
}
|
| 40 |
+
}
|
cmb2/css/sass/partials/_variables.scss
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
//--------------------------------------------------------------
|
| 2 |
+
// Variables
|
| 3 |
+
//--------------------------------------------------------------
|
| 4 |
+
|
| 5 |
+
// Mobile break-point
|
| 6 |
+
$mobile-break : 450px;
|
| 7 |
+
|
| 8 |
+
// Fonts
|
| 9 |
+
$font-sans : sans-serif;
|
| 10 |
+
$font-serif : Georgia, Times, "Times New Roman", serif;
|
| 11 |
+
$font-mono : "Courier 10 Pitch", Courier, monospace;
|
| 12 |
+
$font-size : 14px;
|
| 13 |
+
|
| 14 |
+
// Colors
|
| 15 |
+
$dark-gray : #222222;
|
| 16 |
+
$gray : #aaaaaa;
|
| 17 |
+
$light-gray : #e9e9e9;
|
| 18 |
+
$blue : #0063ce;
|
| 19 |
+
$light-yellow : #fffff8;
|
| 20 |
+
$white : #ffffff;
|
| 21 |
+
$red : #f00;
|
| 22 |
+
$dark-red : #a00;
|
cmb2/css/sass/partials/index.php
ADDED
|
File without changes
|
cmb2/images/ico-delete.png
ADDED
|
Binary file
|
cmb2/images/index.php
ADDED
|
File without changes
|
cmb2/images/ui-bg_flat_0_aaaaaa_40x100.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_flat_75_ffffff_40x100.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_glass_55_fbf9ee_1x400.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_glass_65_ffffff_1x400.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_glass_75_dadada_1x400.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_glass_75_e6e6e6_1x400.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_glass_95_fef1ec_1x400.png
ADDED
|
Binary file
|
cmb2/images/ui-bg_highlight-soft_75_cccccc_1x100.png
ADDED
|
Binary file
|
cmb2/images/ui-icons_222222_256x240.png
ADDED
|
Binary file
|
cmb2/images/ui-icons_2e83ff_256x240.png
ADDED
|
Binary file
|
cmb2/images/ui-icons_454545_256x240.png
ADDED
|
Binary file
|
cmb2/images/ui-icons_888888_256x240.png
ADDED
|
Binary file
|
cmb2/images/ui-icons_cd0a0a_256x240.png
ADDED
|
Binary file
|
cmb2/includes/CMB2.php
ADDED
|
@@ -0,0 +1,859 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Create meta boxes
|
| 4 |
+
*
|
| 5 |
+
* @property-read string $cmb_id
|
| 6 |
+
* @property-read array $meta_box
|
| 7 |
+
* @property-read array $updated
|
| 8 |
+
*/
|
| 9 |
+
class CMB2 {
|
| 10 |
+
|
| 11 |
+
/**
|
| 12 |
+
* Current field's ID
|
| 13 |
+
* @var string
|
| 14 |
+
* @since 2.0.0
|
| 15 |
+
*/
|
| 16 |
+
protected $cmb_id = '';
|
| 17 |
+
|
| 18 |
+
/**
|
| 19 |
+
* Metabox Config array
|
| 20 |
+
* @var array
|
| 21 |
+
* @since 0.9.0
|
| 22 |
+
*/
|
| 23 |
+
protected $meta_box;
|
| 24 |
+
|
| 25 |
+
/**
|
| 26 |
+
* Object ID for metabox meta retrieving/saving
|
| 27 |
+
* @var int
|
| 28 |
+
* @since 1.0.0
|
| 29 |
+
*/
|
| 30 |
+
protected $object_id = 0;
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* Type of object being saved. (e.g., post, user, or comment)
|
| 34 |
+
* @var string
|
| 35 |
+
* @since 1.0.0
|
| 36 |
+
*/
|
| 37 |
+
protected $object_type = 'post';
|
| 38 |
+
|
| 39 |
+
/**
|
| 40 |
+
* Type of object registered for metabox. (e.g., post, user, or comment)
|
| 41 |
+
* @var string
|
| 42 |
+
* @since 1.0.0
|
| 43 |
+
*/
|
| 44 |
+
protected $mb_object_type = null;
|
| 45 |
+
|
| 46 |
+
/**
|
| 47 |
+
* List of fields that are changed/updated on save
|
| 48 |
+
* @var array
|
| 49 |
+
* @since 1.1.0
|
| 50 |
+
*/
|
| 51 |
+
protected $updated = array();
|
| 52 |
+
|
| 53 |
+
/**
|
| 54 |
+
* Metabox Defaults
|
| 55 |
+
* @var array
|
| 56 |
+
* @since 1.0.1
|
| 57 |
+
*/
|
| 58 |
+
protected $mb_defaults = array(
|
| 59 |
+
'id' => '',
|
| 60 |
+
'title' => '',
|
| 61 |
+
'type' => '',
|
| 62 |
+
'object_types' => array(), // Post type
|
| 63 |
+
'context' => 'normal',
|
| 64 |
+
'priority' => 'high',
|
| 65 |
+
'show_names' => true, // Show field names on the left
|
| 66 |
+
'show_on' => array(), // Specific post IDs or page templates to display this metabox
|
| 67 |
+
'cmb_styles' => true, // Include cmb bundled stylesheet
|
| 68 |
+
'fields' => array(),
|
| 69 |
+
'hookup' => true,
|
| 70 |
+
'closed' => false, // Default to metabox being closed?
|
| 71 |
+
'new_user_section' => 'add-new-user', // or 'add-existing-user'
|
| 72 |
+
);
|
| 73 |
+
|
| 74 |
+
/**
|
| 75 |
+
* An array of hidden fields to output at the end of the form
|
| 76 |
+
* @var array
|
| 77 |
+
* @since 2.0.0
|
| 78 |
+
*/
|
| 79 |
+
protected $hidden_fields = array();
|
| 80 |
+
|
| 81 |
+
/**
|
| 82 |
+
* Array of key => value data for saving. Likely $_POST data.
|
| 83 |
+
* @var array
|
| 84 |
+
* @since 2.0.0
|
| 85 |
+
*/
|
| 86 |
+
public $data_to_save = array();
|
| 87 |
+
|
| 88 |
+
/**
|
| 89 |
+
* Array of key => value data for saving. Likely $_POST data.
|
| 90 |
+
* @var string
|
| 91 |
+
* @since 2.0.0
|
| 92 |
+
*/
|
| 93 |
+
protected $generated_nonce = '';
|
| 94 |
+
|
| 95 |
+
/**
|
| 96 |
+
* Get started
|
| 97 |
+
*/
|
| 98 |
+
function __construct( $meta_box, $object_id = 0 ) {
|
| 99 |
+
|
| 100 |
+
if ( empty( $meta_box['id'] ) ) {
|
| 101 |
+
wp_die( __( 'Metabox configuration is required to have an ID parameter', 'cmb2' ) );
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
$this->meta_box = wp_parse_args( $meta_box, $this->mb_defaults );
|
| 105 |
+
$this->object_id( $object_id );
|
| 106 |
+
$this->mb_object_type();
|
| 107 |
+
$this->cmb_id = $meta_box['id'];
|
| 108 |
+
|
| 109 |
+
CMB2_Boxes::add( $this );
|
| 110 |
+
|
| 111 |
+
/**
|
| 112 |
+
* Hook during initiation of CMB2 object
|
| 113 |
+
*
|
| 114 |
+
* The dynamic portion of the hook name, $this->cmb_id, is this meta_box id.
|
| 115 |
+
*
|
| 116 |
+
* @param array $cmb This CMB2 object
|
| 117 |
+
*/
|
| 118 |
+
do_action( "cmb2_init_{$this->cmb_id}", $this );
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
/**
|
| 122 |
+
* Loops through and displays fields
|
| 123 |
+
* @since 1.0.0
|
| 124 |
+
* @param int $object_id Object ID
|
| 125 |
+
* @param string $object_type Type of object being saved. (e.g., post, user, or comment)
|
| 126 |
+
*/
|
| 127 |
+
public function show_form( $object_id = 0, $object_type = '' ) {
|
| 128 |
+
$object_type = $this->object_type( $object_type );
|
| 129 |
+
$object_id = $this->object_id( $object_id );
|
| 130 |
+
|
| 131 |
+
$this->nonce_field();
|
| 132 |
+
|
| 133 |
+
echo "\n<!-- Begin CMB Fields -->\n";
|
| 134 |
+
|
| 135 |
+
/**
|
| 136 |
+
* Hook before form table begins
|
| 137 |
+
*
|
| 138 |
+
* @param array $cmb_id The current box ID
|
| 139 |
+
* @param int $object_id The ID of the current object
|
| 140 |
+
* @param string $object_type The type of object you are working with.
|
| 141 |
+
* Usually `post` (this applies to all post-types).
|
| 142 |
+
* Could also be `comment`, `user` or `options-page`.
|
| 143 |
+
* @param array $cmb This CMB2 object
|
| 144 |
+
*/
|
| 145 |
+
do_action( 'cmb2_before_form', $this->cmb_id, $object_id, $object_type, $this );
|
| 146 |
+
|
| 147 |
+
/**
|
| 148 |
+
* Hook before form table begins
|
| 149 |
+
*
|
| 150 |
+
* The first dynamic portion of the hook name, $object_type, is the type of object
|
| 151 |
+
* you are working with. Usually `post` (this applies to all post-types).
|
| 152 |
+
* Could also be `comment`, `user` or `options-page`.
|
| 153 |
+
*
|
| 154 |
+
* The second dynamic portion of the hook name, $this->cmb_id, is the meta_box id.
|
| 155 |
+
*
|
| 156 |
+
* @param array $cmb_id The current box ID
|
| 157 |
+
* @param int $object_id The ID of the current object
|
| 158 |
+
* @param array $cmb This CMB2 object
|
| 159 |
+
*/
|
| 160 |
+
do_action( "cmb2_before_{$object_type}_form_{$this->cmb_id}", $object_id, $this );
|
| 161 |
+
|
| 162 |
+
echo '<div class="cmb2-wrap form-table"><div id="cmb2-metabox-', sanitize_html_class( $this->cmb_id ), '" class="cmb2-metabox cmb-field-list">';
|
| 163 |
+
|
| 164 |
+
foreach ( $this->prop( 'fields' ) as $field_args ) {
|
| 165 |
+
|
| 166 |
+
$field_args['context'] = $this->prop( 'context' );
|
| 167 |
+
|
| 168 |
+
if ( 'group' == $field_args['type'] ) {
|
| 169 |
+
|
| 170 |
+
if ( ! isset( $field_args['show_names'] ) ) {
|
| 171 |
+
$field_args['show_names'] = $this->prop( 'show_names' );
|
| 172 |
+
}
|
| 173 |
+
$this->render_group( $field_args );
|
| 174 |
+
|
| 175 |
+
} elseif ( 'hidden' == $field_args['type'] ) {
|
| 176 |
+
|
| 177 |
+
// Save rendering for after the metabox
|
| 178 |
+
$this->add_hidden_field( array(
|
| 179 |
+
'field_args' => $field_args,
|
| 180 |
+
'object_type' => $this->object_type(),
|
| 181 |
+
'object_id' => $this->object_id(),
|
| 182 |
+
) );
|
| 183 |
+
|
| 184 |
+
} else {
|
| 185 |
+
|
| 186 |
+
$field_args['show_names'] = $this->prop( 'show_names' );
|
| 187 |
+
|
| 188 |
+
// Render default fields
|
| 189 |
+
$field = new CMB2_Field( array(
|
| 190 |
+
'field_args' => $field_args,
|
| 191 |
+
'object_type' => $this->object_type(),
|
| 192 |
+
'object_id' => $this->object_id(),
|
| 193 |
+
) );
|
| 194 |
+
$field->render_field();
|
| 195 |
+
}
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
echo '</div></div>';
|
| 199 |
+
|
| 200 |
+
$this->render_hidden_fields();
|
| 201 |
+
|
| 202 |
+
/**
|
| 203 |
+
* Hook after form form has been rendered
|
| 204 |
+
*
|
| 205 |
+
* @param array $cmb_id The current box ID
|
| 206 |
+
* @param int $object_id The ID of the current object
|
| 207 |
+
* @param string $object_type The type of object you are working with.
|
| 208 |
+
* Usually `post` (this applies to all post-types).
|
| 209 |
+
* Could also be `comment`, `user` or `options-page`.
|
| 210 |
+
* @param array $cmb This CMB2 object
|
| 211 |
+
*/
|
| 212 |
+
do_action( 'cmb2_after_form', $this->cmb_id, $object_id, $object_type, $this );
|
| 213 |
+
|
| 214 |
+
/**
|
| 215 |
+
* Hook after form form has been rendered
|
| 216 |
+
*
|
| 217 |
+
* The dynamic portion of the hook name, $this->cmb_id, is the meta_box id.
|
| 218 |
+
*
|
| 219 |
+
* The first dynamic portion of the hook name, $object_type, is the type of object
|
| 220 |
+
* you are working with. Usually `post` (this applies to all post-types).
|
| 221 |
+
* Could also be `comment`, `user` or `options-page`.
|
| 222 |
+
*
|
| 223 |
+
* @param int $object_id The ID of the current object
|
| 224 |
+
* @param array $cmb This CMB2 object
|
| 225 |
+
*/
|
| 226 |
+
do_action( "cmb2_after_{$object_type}_form_{$this->cmb_id}", $object_id, $this );
|
| 227 |
+
|
| 228 |
+
echo "\n<!-- End CMB Fields -->\n";
|
| 229 |
+
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
/**
|
| 233 |
+
* Render a repeatable group
|
| 234 |
+
*/
|
| 235 |
+
public function render_group( $args ) {
|
| 236 |
+
|
| 237 |
+
// If field is requesting to be conditionally shown
|
| 238 |
+
if ( isset( $args['show_on_cb'] ) && is_callable( $args['show_on_cb'] ) && ! call_user_func( $args['show_on_cb'], $this ) ) {
|
| 239 |
+
return;
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
if ( ! isset( $args['id'], $args['fields'] ) || ! is_array( $args['fields'] ) ) {
|
| 243 |
+
return;
|
| 244 |
+
}
|
| 245 |
+
|
| 246 |
+
$args['count'] = 0;
|
| 247 |
+
$field_group = new CMB2_Field( array(
|
| 248 |
+
'field_args' => $args,
|
| 249 |
+
'object_type' => $this->object_type(),
|
| 250 |
+
'object_id' => $this->object_id(),
|
| 251 |
+
) );
|
| 252 |
+
$desc = $field_group->args( 'description' );
|
| 253 |
+
$label = $field_group->args( 'name' );
|
| 254 |
+
$sortable = $field_group->options( 'sortable' ) ? ' sortable' : '';
|
| 255 |
+
$group_val = (array) $field_group->value();
|
| 256 |
+
$nrows = count( $group_val );
|
| 257 |
+
$remove_disabled = $nrows <= 1 ? 'disabled="disabled" ' : '';
|
| 258 |
+
|
| 259 |
+
echo '<div class="cmb-row cmb-repeat-group-wrap"><div class="cmb-td"><div id="', $field_group->id(), '_repeat" class="cmb-nested cmb-field-list cmb-repeatable-group', $sortable, '" style="width:100%;">';
|
| 260 |
+
if ( $desc || $label ) {
|
| 261 |
+
$class = $desc ? ' cmb-group-description' : '';
|
| 262 |
+
echo '<div class="cmb-row', $class, '"><div class="cmb-th">';
|
| 263 |
+
if ( $label ) {
|
| 264 |
+
echo '<h2 class="cmb-group-name">', $label, '</h2>';
|
| 265 |
+
}
|
| 266 |
+
if ( $desc ) {
|
| 267 |
+
echo '<p class="cmb2-metabox-description">', $desc, '</p>';
|
| 268 |
+
}
|
| 269 |
+
echo '</div></div>';
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
if ( ! empty( $group_val ) ) {
|
| 273 |
+
|
| 274 |
+
foreach ( $group_val as $iterator => $field_id ) {
|
| 275 |
+
$this->render_group_row( $field_group, $remove_disabled );
|
| 276 |
+
}
|
| 277 |
+
} else {
|
| 278 |
+
$this->render_group_row( $field_group, $remove_disabled );
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
echo '<div class="cmb-row"><div class="cmb-td"><p class="cmb-add-row"><button data-selector="', $field_group->id(), '_repeat" data-grouptitle="', $field_group->options( 'group_title' ), '" class="cmb-add-group-row button">', $field_group->options( 'add_button' ), '</button></p></div></div>';
|
| 282 |
+
|
| 283 |
+
echo '</div></div></div>';
|
| 284 |
+
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
+
public function render_group_row( $field_group, $remove_disabled ) {
|
| 288 |
+
|
| 289 |
+
echo '
|
| 290 |
+
<div class="postbox cmb-row cmb-repeatable-grouping" data-iterator="', $field_group->count(), '">
|
| 291 |
+
|
| 292 |
+
<button ', $remove_disabled, 'data-selector="', $field_group->id(), '_repeat" class="dashicons-before dashicons-no-alt cmb-remove-group-row"></button>
|
| 293 |
+
<div class="cmbhandle" title="' , __( 'Click to toggle', 'cmb2' ), '"><br></div>
|
| 294 |
+
<h3 class="cmb-group-title cmbhandle-title"><span>', $field_group->replace_hash( $field_group->options( 'group_title' ) ), '</span></h3>
|
| 295 |
+
|
| 296 |
+
<div class="inside cmb-td cmb-nested cmb-field-list">';
|
| 297 |
+
// Loop and render repeatable group fields
|
| 298 |
+
foreach ( array_values( $field_group->args( 'fields' ) ) as $field_args ) {
|
| 299 |
+
if ( 'hidden' == $field_args['type'] ) {
|
| 300 |
+
|
| 301 |
+
// Save rendering for after the metabox
|
| 302 |
+
$this->add_hidden_field( array(
|
| 303 |
+
'field_args' => $field_args,
|
| 304 |
+
'group_field' => $field_group,
|
| 305 |
+
) );
|
| 306 |
+
|
| 307 |
+
} else {
|
| 308 |
+
|
| 309 |
+
$field_args['show_names'] = $field_group->args( 'show_names' );
|
| 310 |
+
$field_args['context'] = $field_group->args( 'context' );
|
| 311 |
+
$field = new CMB2_Field( array(
|
| 312 |
+
'field_args' => $field_args,
|
| 313 |
+
'group_field' => $field_group,
|
| 314 |
+
) );
|
| 315 |
+
$field->render_field();
|
| 316 |
+
}
|
| 317 |
+
}
|
| 318 |
+
echo '
|
| 319 |
+
<div class="cmb-row cmb-remove-field-row">
|
| 320 |
+
<div class="cmb-remove-row">
|
| 321 |
+
<button ', $remove_disabled, 'data-selector="', $field_group->id(), '_repeat" class="button cmb-remove-group-row alignright">', $field_group->options( 'remove_button' ), '</button>
|
| 322 |
+
</div>
|
| 323 |
+
</div>
|
| 324 |
+
|
| 325 |
+
</div>
|
| 326 |
+
</div>
|
| 327 |
+
';
|
| 328 |
+
|
| 329 |
+
$field_group->args['count']++;
|
| 330 |
+
}
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* Add a hidden field to the list of hidden fields to be rendered later
|
| 334 |
+
* @since 2.0.0
|
| 335 |
+
* @param array $args Array of arguments to be passed to CMB2_Field
|
| 336 |
+
*/
|
| 337 |
+
public function add_hidden_field( $args ) {
|
| 338 |
+
$this->hidden_fields[] = new CMB2_Types( new CMB2_Field( $args ) );
|
| 339 |
+
}
|
| 340 |
+
|
| 341 |
+
/**
|
| 342 |
+
* Loop through and output hidden fields
|
| 343 |
+
* @since 2.0.0
|
| 344 |
+
*/
|
| 345 |
+
public function render_hidden_fields() {
|
| 346 |
+
if ( ! empty( $this->hidden_fields ) ) {
|
| 347 |
+
foreach ( $this->hidden_fields as $hidden ) {
|
| 348 |
+
$hidden->render();
|
| 349 |
+
}
|
| 350 |
+
}
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
+
/**
|
| 354 |
+
* Loops through and saves field data
|
| 355 |
+
* @since 1.0.0
|
| 356 |
+
* @param int $object_id Object ID
|
| 357 |
+
* @param string $object_type Type of object being saved. (e.g., post, user, or comment)
|
| 358 |
+
* @param array $data_to_save Array of key => value data for saving. Likely $_POST data.
|
| 359 |
+
*/
|
| 360 |
+
public function save_fields( $object_id = 0, $object_type = '', $data_to_save ) {
|
| 361 |
+
|
| 362 |
+
$this->data_to_save = $data_to_save;
|
| 363 |
+
$object_id = $this->object_id( $object_id );
|
| 364 |
+
$object_type = $this->object_type( $object_type );
|
| 365 |
+
|
| 366 |
+
$this->process_fields();
|
| 367 |
+
|
| 368 |
+
// If options page, save the updated options
|
| 369 |
+
if ( 'options-page' == $object_type ) {
|
| 370 |
+
cmb2_options( $object_id )->set();
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
+
/**
|
| 374 |
+
* Fires after all fields have been saved.
|
| 375 |
+
*
|
| 376 |
+
* The dynamic portion of the hook name, $object_type, refers to the metabox/form's object type
|
| 377 |
+
* Usually `post` (this applies to all post-types).
|
| 378 |
+
* Could also be `comment`, `user` or `options-page`.
|
| 379 |
+
*
|
| 380 |
+
* @param int $object_id The ID of the current object
|
| 381 |
+
* @param array $cmb_id The current box ID
|
| 382 |
+
* @param string $updated All fields that were updated.
|
| 383 |
+
* Will only include fields that had values change.
|
| 384 |
+
* @param array $cmb This CMB2 object
|
| 385 |
+
*/
|
| 386 |
+
do_action( "cmb2_save_{$object_type}_fields", $object_id, $this->cmb_id, $this->updated, $this );
|
| 387 |
+
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
/**
|
| 391 |
+
* Process and save form fields
|
| 392 |
+
* @since 2.0.0
|
| 393 |
+
*/
|
| 394 |
+
public function process_fields() {
|
| 395 |
+
$this->prop( 'show_on', array() );
|
| 396 |
+
|
| 397 |
+
// save field ids of those that are updated
|
| 398 |
+
$this->updated = array();
|
| 399 |
+
|
| 400 |
+
foreach ( $this->prop( 'fields' ) as $field_args ) {
|
| 401 |
+
$this->process_field( $field_args );
|
| 402 |
+
}
|
| 403 |
+
}
|
| 404 |
+
|
| 405 |
+
/**
|
| 406 |
+
* Process and save a field
|
| 407 |
+
* @since 2.0.0
|
| 408 |
+
* @param array $field_args Array of field arguments
|
| 409 |
+
*/
|
| 410 |
+
public function process_field( $field_args ) {
|
| 411 |
+
|
| 412 |
+
switch ( $field_args['type'] ) {
|
| 413 |
+
|
| 414 |
+
case 'group':
|
| 415 |
+
$this->save_group( $field_args );
|
| 416 |
+
break;
|
| 417 |
+
|
| 418 |
+
case 'title':
|
| 419 |
+
// Don't process title fields
|
| 420 |
+
break;
|
| 421 |
+
|
| 422 |
+
default:
|
| 423 |
+
|
| 424 |
+
// Save default fields
|
| 425 |
+
$field = new CMB2_Field( array(
|
| 426 |
+
'field_args' => $field_args,
|
| 427 |
+
'object_type' => $this->object_type(),
|
| 428 |
+
'object_id' => $this->object_id(),
|
| 429 |
+
) );
|
| 430 |
+
|
| 431 |
+
if ( $field->save_field( $this->data_to_save ) ) {
|
| 432 |
+
$this->updated[] = $field->id();
|
| 433 |
+
}
|
| 434 |
+
|
| 435 |
+
break;
|
| 436 |
+
}
|
| 437 |
+
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
/**
|
| 441 |
+
* Save a repeatable group
|
| 442 |
+
*/
|
| 443 |
+
public function save_group( $args ) {
|
| 444 |
+
|
| 445 |
+
if ( ! isset( $args['id'], $args['fields'], $this->data_to_save[ $args['id'] ] ) || ! is_array( $args['fields'] ) ) {
|
| 446 |
+
return;
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
$field_group = new CMB2_Field( array(
|
| 450 |
+
'field_args' => $args,
|
| 451 |
+
'object_type' => $this->object_type(),
|
| 452 |
+
'object_id' => $this->object_id(),
|
| 453 |
+
) );
|
| 454 |
+
$base_id = $field_group->id();
|
| 455 |
+
$old = $field_group->get_data();
|
| 456 |
+
$group_vals = $this->data_to_save[ $base_id ];
|
| 457 |
+
$saved = array();
|
| 458 |
+
$field_group->index = 0;
|
| 459 |
+
|
| 460 |
+
foreach ( array_values( $field_group->fields() ) as $field_args ) {
|
| 461 |
+
$field = new CMB2_Field( array(
|
| 462 |
+
'field_args' => $field_args,
|
| 463 |
+
'group_field' => $field_group,
|
| 464 |
+
) );
|
| 465 |
+
$sub_id = $field->id( true );
|
| 466 |
+
|
| 467 |
+
foreach ( (array) $group_vals as $field_group->index => $post_vals ) {
|
| 468 |
+
|
| 469 |
+
// Get value
|
| 470 |
+
$new_val = isset( $group_vals[ $field_group->index ][ $sub_id ] )
|
| 471 |
+
? $group_vals[ $field_group->index ][ $sub_id ]
|
| 472 |
+
: false;
|
| 473 |
+
|
| 474 |
+
// Sanitize
|
| 475 |
+
$new_val = $field->sanitization_cb( $new_val );
|
| 476 |
+
|
| 477 |
+
if ( 'file' == $field->type() && is_array( $new_val ) ) {
|
| 478 |
+
// Add image ID to the array stack
|
| 479 |
+
$saved[ $field_group->index ][ $new_val['field_id'] ] = $new_val['attach_id'];
|
| 480 |
+
// Reset var to url string
|
| 481 |
+
$new_val = $new_val['url'];
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
// Get old value
|
| 485 |
+
$old_val = is_array( $old ) && isset( $old[ $field_group->index ][ $sub_id ] )
|
| 486 |
+
? $old[ $field_group->index ][ $sub_id ]
|
| 487 |
+
: false;
|
| 488 |
+
|
| 489 |
+
$is_updated = ( ! empty( $new_val ) && $new_val != $old_val );
|
| 490 |
+
$is_removed = ( empty( $new_val ) && ! empty( $old_val ) );
|
| 491 |
+
// Compare values and add to `$updated` array
|
| 492 |
+
if ( $is_updated || $is_removed ) {
|
| 493 |
+
$this->updated[] = $base_id . '::' . $field_group->index . '::' . $sub_id;
|
| 494 |
+
}
|
| 495 |
+
|
| 496 |
+
// Add to `$saved` array
|
| 497 |
+
$saved[ $field_group->index ][ $sub_id ] = $new_val;
|
| 498 |
+
|
| 499 |
+
}
|
| 500 |
+
$saved[ $field_group->index ] = array_filter( $saved[ $field_group->index ] );
|
| 501 |
+
}
|
| 502 |
+
$saved = array_filter( $saved );
|
| 503 |
+
|
| 504 |
+
$field_group->update_data( $saved, true );
|
| 505 |
+
}
|
| 506 |
+
|
| 507 |
+
/**
|
| 508 |
+
* Get object id from global space if no id is provided
|
| 509 |
+
* @since 1.0.0
|
| 510 |
+
* @param integer $object_id Object ID
|
| 511 |
+
* @return integer $object_id Object ID
|
| 512 |
+
*/
|
| 513 |
+
public function object_id( $object_id = 0 ) {
|
| 514 |
+
|
| 515 |
+
if ( $object_id ) {
|
| 516 |
+
$this->object_id = $object_id;
|
| 517 |
+
return $this->object_id;
|
| 518 |
+
}
|
| 519 |
+
|
| 520 |
+
if ( $this->object_id ) {
|
| 521 |
+
return $this->object_id;
|
| 522 |
+
}
|
| 523 |
+
|
| 524 |
+
// Try to get our object ID from the global space
|
| 525 |
+
switch ( $this->object_type() ) {
|
| 526 |
+
case 'user':
|
| 527 |
+
$object_id = isset( $_REQUEST['user_id'] ) ? $_REQUEST['user_id'] : $object_id;
|
| 528 |
+
$object_id = ! $object_id && isset( $GLOBALS['user_ID'] ) ? $GLOBALS['user_ID'] : $object_id;
|
| 529 |
+
break;
|
| 530 |
+
|
| 531 |
+
default:
|
| 532 |
+
$object_id = isset( $GLOBALS['post']->ID ) ? $GLOBALS['post']->ID : $object_id;
|
| 533 |
+
$object_id = isset( $_REQUEST['post'] ) ? $_REQUEST['post'] : $object_id;
|
| 534 |
+
break;
|
| 535 |
+
}
|
| 536 |
+
|
| 537 |
+
// reset to id or 0
|
| 538 |
+
$this->object_id = $object_id ? $object_id : 0;
|
| 539 |
+
|
| 540 |
+
return $this->object_id;
|
| 541 |
+
}
|
| 542 |
+
|
| 543 |
+
/**
|
| 544 |
+
* Sets the $object_type based on metabox settings
|
| 545 |
+
* @since 1.0.0
|
| 546 |
+
* @return string Object type
|
| 547 |
+
*/
|
| 548 |
+
public function mb_object_type() {
|
| 549 |
+
|
| 550 |
+
if ( null !== $this->mb_object_type ) {
|
| 551 |
+
return $this->mb_object_type;
|
| 552 |
+
}
|
| 553 |
+
|
| 554 |
+
if ( $this->is_options_page_mb() ) {
|
| 555 |
+
$this->mb_object_type = 'options-page';
|
| 556 |
+
return $this->mb_object_type;
|
| 557 |
+
}
|
| 558 |
+
|
| 559 |
+
if ( ! $this->prop( 'object_types' ) ) {
|
| 560 |
+
$this->mb_object_type = 'post';
|
| 561 |
+
return $this->mb_object_type;
|
| 562 |
+
}
|
| 563 |
+
|
| 564 |
+
$type = false;
|
| 565 |
+
// check if 'object_types' is a string
|
| 566 |
+
if ( is_string( $this->prop( 'object_types' ) ) ) {
|
| 567 |
+
$type = $this->prop( 'object_types' );
|
| 568 |
+
}
|
| 569 |
+
// if it's an array of one, extract it
|
| 570 |
+
elseif ( is_array( $this->prop( 'object_types' ) ) && 1 === count( $this->prop( 'object_types' ) ) ) {
|
| 571 |
+
$cpts = $this->prop( 'object_types' );
|
| 572 |
+
$type = is_string( end( $cpts ) )
|
| 573 |
+
? end( $cpts )
|
| 574 |
+
: false;
|
| 575 |
+
}
|
| 576 |
+
|
| 577 |
+
if ( ! $type ) {
|
| 578 |
+
$this->mb_object_type = 'post';
|
| 579 |
+
return $this->mb_object_type;
|
| 580 |
+
}
|
| 581 |
+
|
| 582 |
+
// Get our object type
|
| 583 |
+
switch ( $type ) {
|
| 584 |
+
|
| 585 |
+
case 'user':
|
| 586 |
+
case 'comment':
|
| 587 |
+
$this->mb_object_type = $type;
|
| 588 |
+
break;
|
| 589 |
+
|
| 590 |
+
default:
|
| 591 |
+
$this->mb_object_type = 'post';
|
| 592 |
+
break;
|
| 593 |
+
}
|
| 594 |
+
|
| 595 |
+
return $this->mb_object_type;
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
/**
|
| 599 |
+
* Determines if metabox is for an options page
|
| 600 |
+
* @since 1.0.1
|
| 601 |
+
* @return boolean True/False
|
| 602 |
+
*/
|
| 603 |
+
public function is_options_page_mb() {
|
| 604 |
+
return ( isset( $this->meta_box['show_on']['key'] ) && 'options-page' === $this->meta_box['show_on']['key'] || array_key_exists( 'options-page', $this->meta_box['show_on'] ) );
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
/**
|
| 608 |
+
* Returns the object type
|
| 609 |
+
* @since 1.0.0
|
| 610 |
+
* @return string Object type
|
| 611 |
+
*/
|
| 612 |
+
public function object_type( $object_type = '' ) {
|
| 613 |
+
if ( $object_type ) {
|
| 614 |
+
$this->object_type = $object_type;
|
| 615 |
+
return $this->object_type;
|
| 616 |
+
}
|
| 617 |
+
|
| 618 |
+
if ( $this->object_type ) {
|
| 619 |
+
return $this->object_type;
|
| 620 |
+
}
|
| 621 |
+
|
| 622 |
+
global $pagenow;
|
| 623 |
+
|
| 624 |
+
if ( in_array( $pagenow, array( 'user-edit.php', 'profile.php', 'user-new.php' ), true ) ) {
|
| 625 |
+
$this->object_type = 'user';
|
| 626 |
+
|
| 627 |
+
} elseif ( in_array( $pagenow, array( 'edit-comments.php', 'comment.php' ), true ) ) {
|
| 628 |
+
$this->object_type = 'comment';
|
| 629 |
+
|
| 630 |
+
} else {
|
| 631 |
+
$this->object_type = 'post';
|
| 632 |
+
}
|
| 633 |
+
|
| 634 |
+
return $this->object_type;
|
| 635 |
+
}
|
| 636 |
+
|
| 637 |
+
/**
|
| 638 |
+
* Get metabox property and optionally set a fallback
|
| 639 |
+
* @since 2.0.0
|
| 640 |
+
* @param string $property Metabox config property to retrieve
|
| 641 |
+
* @param mixed $fallback Fallback value to set if no value found
|
| 642 |
+
* @return mixed Metabox config property value or false
|
| 643 |
+
*/
|
| 644 |
+
public function prop( $property, $fallback = null ) {
|
| 645 |
+
if ( array_key_exists( $property, $this->meta_box ) ) {
|
| 646 |
+
return $this->meta_box[ $property ];
|
| 647 |
+
} elseif ( $fallback ) {
|
| 648 |
+
return $this->meta_box[ $property ] = $fallback;
|
| 649 |
+
}
|
| 650 |
+
}
|
| 651 |
+
|
| 652 |
+
/**
|
| 653 |
+
* Add a field to the metabox
|
| 654 |
+
* @since 2.0.0
|
| 655 |
+
* @param array $field Metabox field config array
|
| 656 |
+
* @param int $position (optional) Position of metabox. 1 for first, etc
|
| 657 |
+
* @return mixed Field id or false
|
| 658 |
+
*/
|
| 659 |
+
public function add_field( array $field, $position = 0 ) {
|
| 660 |
+
if ( ! is_array( $field ) || ! array_key_exists( 'id', $field ) ) {
|
| 661 |
+
return false;
|
| 662 |
+
}
|
| 663 |
+
|
| 664 |
+
$this->_add_field_to_array(
|
| 665 |
+
$field,
|
| 666 |
+
$this->meta_box['fields'],
|
| 667 |
+
$position
|
| 668 |
+
);
|
| 669 |
+
|
| 670 |
+
return $field['id'];
|
| 671 |
+
}
|
| 672 |
+
|
| 673 |
+
/**
|
| 674 |
+
* Add a field to the metabox
|
| 675 |
+
* @since 2.0.0
|
| 676 |
+
* @param string $parent_field_id The field id of the group field to add the field
|
| 677 |
+
* @param array $field Metabox field config array
|
| 678 |
+
* @param int $position (optional) Position of metabox. 1 for first, etc
|
| 679 |
+
* @return mixed Array of parent/field ids or false
|
| 680 |
+
*/
|
| 681 |
+
public function add_group_field( $parent_field_id, array $field, $position = 0 ) {
|
| 682 |
+
if ( ! array_key_exists( $parent_field_id, $this->meta_box['fields'] ) ) {
|
| 683 |
+
return false;
|
| 684 |
+
}
|
| 685 |
+
|
| 686 |
+
$parent_field = $this->meta_box['fields'][ $parent_field_id ];
|
| 687 |
+
|
| 688 |
+
if ( 'group' !== $parent_field['type'] ) {
|
| 689 |
+
return false;
|
| 690 |
+
}
|
| 691 |
+
|
| 692 |
+
if ( ! isset( $parent_field['fields'] ) ) {
|
| 693 |
+
$this->meta_box['fields'][ $parent_field_id ]['fields'] = array();
|
| 694 |
+
}
|
| 695 |
+
|
| 696 |
+
$this->_add_field_to_array(
|
| 697 |
+
$field,
|
| 698 |
+
$this->meta_box['fields'][ $parent_field_id ]['fields'],
|
| 699 |
+
$position
|
| 700 |
+
);
|
| 701 |
+
|
| 702 |
+
return array( $parent_field_id, $field['id'] );
|
| 703 |
+
}
|
| 704 |
+
|
| 705 |
+
/**
|
| 706 |
+
* Add a field array to a fields array in desired position
|
| 707 |
+
* @since 2.0.2
|
| 708 |
+
* @param array $field Metabox field config array
|
| 709 |
+
* @param array &$fields Array (passed by reference) to append the field (array) to
|
| 710 |
+
* @param integer $position Optionally specify a position in the array to be inserted
|
| 711 |
+
*/
|
| 712 |
+
protected function _add_field_to_array( $field, &$fields, $position = 0 ) {
|
| 713 |
+
if ( $position ) {
|
| 714 |
+
cmb2_utils()->array_insert( $fields, array( $field['id'] => $field ), $position );
|
| 715 |
+
} else {
|
| 716 |
+
$fields[ $field['id'] ] = $field;
|
| 717 |
+
}
|
| 718 |
+
}
|
| 719 |
+
|
| 720 |
+
/**
|
| 721 |
+
* Remove a field from the metabox
|
| 722 |
+
* @since 2.0.0
|
| 723 |
+
* @param string $field_id The field id of the field to remove
|
| 724 |
+
* @param string $parent_field_id (optional) The field id of the group field to remove field from
|
| 725 |
+
* @return bool True if field was removed
|
| 726 |
+
*/
|
| 727 |
+
public function remove_field( $field_id, $parent_field_id = '' ) {
|
| 728 |
+
$ids = $this->get_field_ids( $field_id, $parent_field_id );
|
| 729 |
+
|
| 730 |
+
if ( ! $ids ) {
|
| 731 |
+
return false;
|
| 732 |
+
}
|
| 733 |
+
|
| 734 |
+
list( $field_id, $sub_field_id ) = $ids;
|
| 735 |
+
|
| 736 |
+
if ( ! $sub_field_id ) {
|
| 737 |
+
unset( $this->meta_box['fields'][ $field_id ] );
|
| 738 |
+
return true;
|
| 739 |
+
}
|
| 740 |
+
|
| 741 |
+
unset( $this->meta_box['fields'][ $field_id ]['fields'][ $sub_field_id ] );
|
| 742 |
+
return true;
|
| 743 |
+
}
|
| 744 |
+
|
| 745 |
+
/**
|
| 746 |
+
* Update or add a property to a field
|
| 747 |
+
* @since 2.0.0
|
| 748 |
+
* @param string $field_id Field id
|
| 749 |
+
* @param string $property Field property to set/update
|
| 750 |
+
* @param mixed $value Value to set the field property
|
| 751 |
+
* @param string $parent_field_id (optional) The field id of the group field to remove field from
|
| 752 |
+
* @return mixed Field id. Strict compare to false, as success can return a falsey value (like 0)
|
| 753 |
+
*/
|
| 754 |
+
public function update_field_property( $field_id, $property, $value, $parent_field_id = '' ) {
|
| 755 |
+
$ids = $this->get_field_ids( $field_id, $parent_field_id );
|
| 756 |
+
|
| 757 |
+
if ( ! $ids ) {
|
| 758 |
+
return false;
|
| 759 |
+
}
|
| 760 |
+
|
| 761 |
+
list( $field_id, $sub_field_id ) = $ids;
|
| 762 |
+
|
| 763 |
+
if ( ! $sub_field_id ) {
|
| 764 |
+
$this->meta_box['fields'][ $field_id ][ $property ] = $value;
|
| 765 |
+
return $field_id;
|
| 766 |
+
}
|
| 767 |
+
|
| 768 |
+
$this->meta_box['fields'][ $field_id ]['fields'][ $sub_field_id ][ $property ] = $value;
|
| 769 |
+
return $field_id;
|
| 770 |
+
}
|
| 771 |
+
|
| 772 |
+
/**
|
| 773 |
+
* Check if field ids match a field and return the index/field id
|
| 774 |
+
* @since 2.0.2
|
| 775 |
+
* @param string $field_id Field id
|
| 776 |
+
* @param string $parent_field_id (optional) Parent field id
|
| 777 |
+
* @return mixed Array of field/parent ids, or false
|
| 778 |
+
*/
|
| 779 |
+
public function get_field_ids( $field_id, $parent_field_id = '' ) {
|
| 780 |
+
$sub_field_id = $parent_field_id ? $field_id : '';
|
| 781 |
+
$field_id = $parent_field_id ? $parent_field_id : $field_id;
|
| 782 |
+
$fields =& $this->meta_box['fields'];
|
| 783 |
+
|
| 784 |
+
if ( ! array_key_exists( $field_id, $fields ) ) {
|
| 785 |
+
$field_id = $this->search_old_school_array( $field_id, $fields );
|
| 786 |
+
}
|
| 787 |
+
|
| 788 |
+
if ( false === $field_id ) {
|
| 789 |
+
return false;
|
| 790 |
+
}
|
| 791 |
+
|
| 792 |
+
if ( ! $sub_field_id ) {
|
| 793 |
+
return array( $field_id, $sub_field_id );
|
| 794 |
+
}
|
| 795 |
+
|
| 796 |
+
if ( 'group' !== $fields[ $field_id ]['type'] ) {
|
| 797 |
+
return false;
|
| 798 |
+
}
|
| 799 |
+
|
| 800 |
+
if ( ! array_key_exists( $sub_field_id, $fields[ $field_id ]['fields'] ) ) {
|
| 801 |
+
$sub_field_id = $this->search_old_school_array( $sub_field_id, $fields[ $field_id ]['fields'] );
|
| 802 |
+
}
|
| 803 |
+
|
| 804 |
+
return false === $sub_field_id ? false : array( $field_id, $sub_field_id );
|
| 805 |
+
}
|
| 806 |
+
|
| 807 |
+
/**
|
| 808 |
+
* When using the old array filter, it is unlikely field array indexes will be the field id
|
| 809 |
+
* @since 2.0.2
|
| 810 |
+
* @param string $field_id The field id
|
| 811 |
+
* @param array $fields Array of fields to search
|
| 812 |
+
* @return mixed Field index or false
|
| 813 |
+
*/
|
| 814 |
+
public function search_old_school_array( $field_id, $fields ) {
|
| 815 |
+
$ids = wp_list_pluck( $fields, 'id' );
|
| 816 |
+
$index = array_search( $field_id, $ids );
|
| 817 |
+
return false !== $index ? $index : false;
|
| 818 |
+
}
|
| 819 |
+
|
| 820 |
+
/**
|
| 821 |
+
* Generate a unique nonce field for each registered meta_box
|
| 822 |
+
* @since 2.0.0
|
| 823 |
+
* @return string unique nonce hidden input
|
| 824 |
+
*/
|
| 825 |
+
public function nonce_field() {
|
| 826 |
+
wp_nonce_field( $this->nonce(), $this->nonce(), false, true );
|
| 827 |
+
}
|
| 828 |
+
|
| 829 |
+
/**
|
| 830 |
+
* Generate a unique nonce for each registered meta_box
|
| 831 |
+
* @since 2.0.0
|
| 832 |
+
* @return string unique nonce string
|
| 833 |
+
*/
|
| 834 |
+
public function nonce() {
|
| 835 |
+
if ( $this->generated_nonce ) {
|
| 836 |
+
return $this->generated_nonce;
|
| 837 |
+
}
|
| 838 |
+
$this->generated_nonce = sanitize_html_class( 'nonce_' . basename( __FILE__ ) . $this->cmb_id );
|
| 839 |
+
return $this->generated_nonce;
|
| 840 |
+
}
|
| 841 |
+
|
| 842 |
+
/**
|
| 843 |
+
* Magic getter for our object.
|
| 844 |
+
* @param string $field
|
| 845 |
+
* @throws Exception Throws an exception if the field is invalid.
|
| 846 |
+
* @return mixed
|
| 847 |
+
*/
|
| 848 |
+
public function __get( $field ) {
|
| 849 |
+
switch ( $field ) {
|
| 850 |
+
case 'cmb_id':
|
| 851 |
+
case 'meta_box':
|
| 852 |
+
case 'updated':
|
| 853 |
+
return $this->{$field};
|
| 854 |
+
default:
|
| 855 |
+
throw new Exception( 'Invalid ' . __CLASS__ . ' property: ' . $field );
|
| 856 |
+
}
|
| 857 |
+
}
|
| 858 |
+
|
| 859 |
+
}
|
cmb2/includes/CMB2_Ajax.php
ADDED
|
@@ -0,0 +1,209 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* CMB ajax methods
|
| 5 |
+
* (i.e. a lot of work to get oEmbeds to work with non-post objects)
|
| 6 |
+
*
|
| 7 |
+
* @since 0.9.5
|
| 8 |
+
*/
|
| 9 |
+
class CMB2_Ajax {
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
// Whether to hijack the oembed cache system
|
| 13 |
+
protected $hijack = false;
|
| 14 |
+
protected $object_id = 0;
|
| 15 |
+
protected $embed_args = array();
|
| 16 |
+
protected $object_type = 'post';
|
| 17 |
+
protected $ajax_update = false;
|
| 18 |
+
|
| 19 |
+
|
| 20 |
+
/**
|
| 21 |
+
* Handles our oEmbed ajax request
|
| 22 |
+
* @since 0.9.5
|
| 23 |
+
* @return object oEmbed embed code | fallback | error message
|
| 24 |
+
*/
|
| 25 |
+
public function oembed_handler() {
|
| 26 |
+
|
| 27 |
+
// Verify our nonce
|
| 28 |
+
if ( ! ( isset( $_REQUEST['cmb2_ajax_nonce'], $_REQUEST['oembed_url'] ) && wp_verify_nonce( $_REQUEST['cmb2_ajax_nonce'], 'ajax_nonce' ) ) ) {
|
| 29 |
+
die();
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
// Sanitize our search string
|
| 33 |
+
$oembed_string = sanitize_text_field( $_REQUEST['oembed_url'] );
|
| 34 |
+
|
| 35 |
+
// Send back error if empty
|
| 36 |
+
if ( empty( $oembed_string ) ) {
|
| 37 |
+
wp_send_json_error( '<p class="ui-state-error-text">' . __( 'Please Try Again', 'cmb2' ) . '</p>' );
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
// Set width of embed
|
| 41 |
+
$embed_width = isset( $_REQUEST['oembed_width'] ) && intval( $_REQUEST['oembed_width'] ) < 640 ? intval( $_REQUEST['oembed_width'] ) : '640';
|
| 42 |
+
|
| 43 |
+
// Set url
|
| 44 |
+
$oembed_url = esc_url( $oembed_string );
|
| 45 |
+
|
| 46 |
+
// Set args
|
| 47 |
+
$embed_args = array( 'width' => $embed_width );
|
| 48 |
+
|
| 49 |
+
$this->ajax_update = true;
|
| 50 |
+
|
| 51 |
+
// Get embed code (or fallback link)
|
| 52 |
+
$html = $this->get_oembed( array(
|
| 53 |
+
'url' => $oembed_url,
|
| 54 |
+
'object_id' => $_REQUEST['object_id'],
|
| 55 |
+
'object_type' => isset( $_REQUEST['object_type'] ) ? $_REQUEST['object_type'] : 'post',
|
| 56 |
+
'oembed_args' => $embed_args,
|
| 57 |
+
'field_id' => $_REQUEST['field_id'],
|
| 58 |
+
) );
|
| 59 |
+
|
| 60 |
+
wp_send_json_success( $html );
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Retrieves oEmbed from url/object ID
|
| 66 |
+
* @since 0.9.5
|
| 67 |
+
* @param array $args Arguments for method
|
| 68 |
+
* @return string html markup with embed or fallback
|
| 69 |
+
*/
|
| 70 |
+
public function get_oembed( $args ) {
|
| 71 |
+
|
| 72 |
+
global $wp_embed;
|
| 73 |
+
|
| 74 |
+
$oembed_url = esc_url( $args['url'] );
|
| 75 |
+
|
| 76 |
+
// Sanitize object_id
|
| 77 |
+
$this->object_id = is_numeric( $args['object_id'] ) ? absint( $args['object_id'] ) : sanitize_text_field( $args['object_id'] );
|
| 78 |
+
|
| 79 |
+
$args = wp_parse_args( $args, array(
|
| 80 |
+
'object_type' => 'post',
|
| 81 |
+
'oembed_args' => $this->embed_args,
|
| 82 |
+
'field_id' => false,
|
| 83 |
+
'cache_key' => false,
|
| 84 |
+
) );
|
| 85 |
+
|
| 86 |
+
$this->embed_args =& $args;
|
| 87 |
+
|
| 88 |
+
|
| 89 |
+
/**
|
| 90 |
+
* Set the post_ID so oEmbed won't fail
|
| 91 |
+
* wp-includes/class-wp-embed.php, WP_Embed::shortcode()
|
| 92 |
+
*/
|
| 93 |
+
$wp_embed->post_ID = $this->object_id;
|
| 94 |
+
|
| 95 |
+
// Special scenario if NOT a post object
|
| 96 |
+
if ( isset( $args['object_type'] ) && 'post' != $args['object_type'] ) {
|
| 97 |
+
|
| 98 |
+
if ( 'options-page' == $args['object_type'] ) {
|
| 99 |
+
|
| 100 |
+
// Bogus id to pass some numeric checks. Issue with a VERY large WP install?
|
| 101 |
+
$wp_embed->post_ID = 1987645321;
|
| 102 |
+
|
| 103 |
+
// Use our own cache key to correspond to this field (vs one cache key per url)
|
| 104 |
+
$args['cache_key'] = $args['field_id'] . '_cache';
|
| 105 |
+
}
|
| 106 |
+
|
| 107 |
+
// Ok, we need to hijack the oembed cache system
|
| 108 |
+
$this->hijack = true;
|
| 109 |
+
$this->object_type = $args['object_type'];
|
| 110 |
+
|
| 111 |
+
// Gets ombed cache from our object's meta (vs postmeta)
|
| 112 |
+
add_filter( 'get_post_metadata', array( $this, 'hijack_oembed_cache_get' ), 10, 3 );
|
| 113 |
+
|
| 114 |
+
// Sets ombed cache in our object's meta (vs postmeta)
|
| 115 |
+
add_filter( 'update_post_metadata', array( $this, 'hijack_oembed_cache_set' ), 10, 4 );
|
| 116 |
+
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
$embed_args = '';
|
| 120 |
+
|
| 121 |
+
foreach ( $args['oembed_args'] as $key => $val ) {
|
| 122 |
+
$embed_args .= " $key=\"$val\"";
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
// Ping WordPress for an embed
|
| 126 |
+
$check_embed = $wp_embed->run_shortcode( '[embed' . $embed_args . ']' . $oembed_url . '[/embed]' );
|
| 127 |
+
|
| 128 |
+
// Fallback that WordPress creates when no oEmbed was found
|
| 129 |
+
$fallback = $wp_embed->maybe_make_link( $oembed_url );
|
| 130 |
+
|
| 131 |
+
// Send back our embed
|
| 132 |
+
if ( $check_embed && $check_embed != $fallback ) {
|
| 133 |
+
return '<div class="embed-status">' . $check_embed . '<p class="cmb2-remove-wrapper"><a href="#" class="cmb2-remove-file-button" rel="' . $args['field_id'] . '">' . __( 'Remove Embed', 'cmb2' ) . '</a></p></div>';
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
// Otherwise, send back error info that no oEmbeds were found
|
| 137 |
+
return '<p class="ui-state-error-text">' . sprintf( __( 'No oEmbed Results Found for %s. View more info at', 'cmb2' ), $fallback ) . ' <a href="http://codex.wordpress.org/Embeds" target="_blank">codex.wordpress.org/Embeds</a>.</p>';
|
| 138 |
+
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
|
| 142 |
+
/**
|
| 143 |
+
* Hijacks retrieving of cached oEmbed.
|
| 144 |
+
* Returns cached data from relevant object metadata (vs postmeta)
|
| 145 |
+
*
|
| 146 |
+
* @since 0.9.5
|
| 147 |
+
* @param boolean $check Whether to retrieve postmeta or override
|
| 148 |
+
* @param int $object_id Object ID
|
| 149 |
+
* @param string $meta_key Object metakey
|
| 150 |
+
* @return mixed Object's oEmbed cached data
|
| 151 |
+
*/
|
| 152 |
+
public function hijack_oembed_cache_get( $check, $object_id, $meta_key ) {
|
| 153 |
+
|
| 154 |
+
if ( ! $this->hijack || ( $this->object_id != $object_id && 1987645321 !== $object_id ) ) {
|
| 155 |
+
return $check;
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
if ( $this->ajax_update ) {
|
| 159 |
+
return false;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
// Get cached data
|
| 163 |
+
return ( 'options-page' === $this->object_type )
|
| 164 |
+
? cmb2_options( $this->object_id )->get( $this->embed_args['cache_key'] )
|
| 165 |
+
: get_metadata( $this->object_type, $this->object_id, $meta_key, true );
|
| 166 |
+
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
|
| 170 |
+
/**
|
| 171 |
+
* Hijacks saving of cached oEmbed.
|
| 172 |
+
* Saves cached data to relevant object metadata (vs postmeta)
|
| 173 |
+
*
|
| 174 |
+
* @since 0.9.5
|
| 175 |
+
* @param boolean $check Whether to continue setting postmeta
|
| 176 |
+
* @param int $object_id Object ID to get postmeta from
|
| 177 |
+
* @param string $meta_key Postmeta's key
|
| 178 |
+
* @param mixed $meta_value Value of the postmeta to be saved
|
| 179 |
+
* @return boolean Whether to continue setting
|
| 180 |
+
*/
|
| 181 |
+
public function hijack_oembed_cache_set( $check, $object_id, $meta_key, $meta_value ) {
|
| 182 |
+
|
| 183 |
+
if ( ! $this->hijack || ( $this->object_id != $object_id && 1987645321 !== $object_id ) ) {
|
| 184 |
+
return $check;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
$this->oembed_cache_set( $meta_key, $meta_value );
|
| 188 |
+
|
| 189 |
+
// Anything other than `null` to cancel saving to postmeta
|
| 190 |
+
return true;
|
| 191 |
+
}
|
| 192 |
+
|
| 193 |
+
|
| 194 |
+
/**
|
| 195 |
+
* Saves the cached oEmbed value to relevant object metadata (vs postmeta)
|
| 196 |
+
*
|
| 197 |
+
* @since 1.3.0
|
| 198 |
+
* @param string $meta_key Postmeta's key
|
| 199 |
+
* @param mixed $meta_value Value of the postmeta to be saved
|
| 200 |
+
*/
|
| 201 |
+
public function oembed_cache_set( $meta_key, $meta_value ) {
|
| 202 |
+
|
| 203 |
+
// Cache the result to our metadata
|
| 204 |
+
return ( 'options-page' !== $this->object_type )
|
| 205 |
+
? update_metadata( $this->object_type, $this->object_id, $meta_key, $meta_value )
|
| 206 |
+
: cmb2_options( $this->object_id )->update( $this->embed_args['cache_key'], $meta_value, true );
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
}
|
cmb2/includes/CMB2_Boxes.php
ADDED
|
@@ -0,0 +1,36 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Stores each CMB2 instance
|
| 4 |
+
*/
|
| 5 |
+
class CMB2_Boxes {
|
| 6 |
+
|
| 7 |
+
/**
|
| 8 |
+
* Array of all metabox objects
|
| 9 |
+
* @var array
|
| 10 |
+
* @since 2.0.0
|
| 11 |
+
*/
|
| 12 |
+
protected static $meta_boxes = array();
|
| 13 |
+
|
| 14 |
+
public static function add( $meta_box ) {
|
| 15 |
+
self::$meta_boxes[ $meta_box->cmb_id ] = $meta_box;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
public static function remove( $meta_box_id ) {
|
| 19 |
+
if ( array_key_exists( $meta_box_id, self::$meta_boxes ) ) {
|
| 20 |
+
unset( self::$meta_boxes[ $meta_box_id ] );
|
| 21 |
+
}
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
public static function get( $cmb_id ) {
|
| 25 |
+
if ( empty( self::$meta_boxes ) || empty( self::$meta_boxes[ $cmb_id ] ) ) {
|
| 26 |
+
return false;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
return self::$meta_boxes[ $cmb_id ];
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
public static function get_all() {
|
| 33 |
+
return self::$meta_boxes;
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
}
|
cmb2/includes/CMB2_Field.php
ADDED
|
@@ -0,0 +1,892 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* CMB field class
|
| 5 |
+
*
|
| 6 |
+
* @since 1.1.0
|
| 7 |
+
*
|
| 8 |
+
* @method string _id()
|
| 9 |
+
* @method string type()
|
| 10 |
+
* @method mixed fields()
|
| 11 |
+
* @method mixed count()
|
| 12 |
+
*/
|
| 13 |
+
class CMB2_Field {
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Metabox object id
|
| 17 |
+
* @var mixed
|
| 18 |
+
* @since 1.1.0
|
| 19 |
+
*/
|
| 20 |
+
public $object_id = null;
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Metabox object type
|
| 24 |
+
* @var string
|
| 25 |
+
* @since 1.1.0
|
| 26 |
+
*/
|
| 27 |
+
public $object_type = '';
|
| 28 |
+
|
| 29 |
+
/**
|
| 30 |
+
* Field arguments
|
| 31 |
+
* @var mixed
|
| 32 |
+
* @since 1.1.0
|
| 33 |
+
*/
|
| 34 |
+
public $args = array();
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* Field group object or false (if no group)
|
| 38 |
+
* @var mixed
|
| 39 |
+
* @since 1.1.0
|
| 40 |
+
*/
|
| 41 |
+
public $group = false;
|
| 42 |
+
|
| 43 |
+
/**
|
| 44 |
+
* Field meta value
|
| 45 |
+
* @var mixed
|
| 46 |
+
* @since 1.1.0
|
| 47 |
+
*/
|
| 48 |
+
public $value = null;
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Field meta value
|
| 52 |
+
* @var mixed
|
| 53 |
+
* @since 1.1.0
|
| 54 |
+
*/
|
| 55 |
+
public $escaped_value = null;
|
| 56 |
+
|
| 57 |
+
/**
|
| 58 |
+
* Grouped Field's current numeric index during the save process
|
| 59 |
+
* @var mixed
|
| 60 |
+
* @since 2.0.0
|
| 61 |
+
*/
|
| 62 |
+
public $index = 0;
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Array of field options
|
| 66 |
+
* @var array
|
| 67 |
+
* @since 2.0.0
|
| 68 |
+
*/
|
| 69 |
+
protected $field_options = array();
|
| 70 |
+
|
| 71 |
+
/**
|
| 72 |
+
* Array of field param callback results
|
| 73 |
+
* @var array
|
| 74 |
+
* @since 2.0.0
|
| 75 |
+
*/
|
| 76 |
+
protected $callback_results = array();
|
| 77 |
+
|
| 78 |
+
/**
|
| 79 |
+
* Constructs our field object
|
| 80 |
+
* @since 1.1.0
|
| 81 |
+
* @param array $args Field arguments
|
| 82 |
+
*/
|
| 83 |
+
public function __construct( $args ) {
|
| 84 |
+
|
| 85 |
+
if ( ! empty( $args['group_field'] ) ) {
|
| 86 |
+
$this->group = $args['group_field'];
|
| 87 |
+
$this->object_id = $this->group->object_id;
|
| 88 |
+
$this->object_type = $this->group->object_type;
|
| 89 |
+
} else {
|
| 90 |
+
$this->object_id = $args['object_id'];
|
| 91 |
+
$this->object_type = isset( $args['object_type'] ) ? $args['object_type'] : 'post';
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
$this->args = $this->_set_field_defaults( $args['field_args'] );
|
| 95 |
+
|
| 96 |
+
/**
|
| 97 |
+
* Filter whether to override getting of meta value.
|
| 98 |
+
* Returning a non 'cmb2_field_no_override_val' value
|
| 99 |
+
* will effectively short-circuit the value retrieval.
|
| 100 |
+
*
|
| 101 |
+
* @since 2.0.0
|
| 102 |
+
*
|
| 103 |
+
* @param null|array|string $value The value get_metadata() should
|
| 104 |
+
* return - a single metadata value,
|
| 105 |
+
* or an array of values.
|
| 106 |
+
* @param int $object_id Object ID.
|
| 107 |
+
* @param array $field_args All field arguments
|
| 108 |
+
* @param string $object_type Object Type
|
| 109 |
+
* @param CMB2_Field object $field_obj This field object
|
| 110 |
+
*/
|
| 111 |
+
$this->value = apply_filters( 'cmb2_override_meta_value', 'cmb2_field_no_override_val', $this->object_id, $this->args(), $this->object_type, $this );
|
| 112 |
+
|
| 113 |
+
/**
|
| 114 |
+
* Filter whether to override getting of meta value.
|
| 115 |
+
*
|
| 116 |
+
* The dynamic portion of the hook, $field_id, refers to the current
|
| 117 |
+
* field id paramater. Returning a non 'cmb2_field_no_override_val' value
|
| 118 |
+
* will effectively short-circuit the value retrieval.
|
| 119 |
+
*
|
| 120 |
+
* @since 2.0.0
|
| 121 |
+
*
|
| 122 |
+
* @param null|array|string $value The value get_metadata() should
|
| 123 |
+
* return - a single metadata value,
|
| 124 |
+
* or an array of values.
|
| 125 |
+
* @param int $object_id Object ID.
|
| 126 |
+
* @param array $field_args All field arguments
|
| 127 |
+
* @param string $object_type Object Type
|
| 128 |
+
* @param CMB2_Field object $field_obj This field object
|
| 129 |
+
*/
|
| 130 |
+
$this->value = apply_filters( "cmb2_override_{$this->id( true )}_meta_value", $this->value, $this->object_id, $this->args(), $this->object_type, $this );
|
| 131 |
+
|
| 132 |
+
// If no override, get our meta
|
| 133 |
+
$this->value = 'cmb2_field_no_override_val' === $this->value
|
| 134 |
+
? $this->get_data()
|
| 135 |
+
: $this->value;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
/**
|
| 139 |
+
* Non-existent methods fallback to checking for field arguments of the same name
|
| 140 |
+
* @since 1.1.0
|
| 141 |
+
* @param string $name Method name
|
| 142 |
+
* @param array $arguments Array of passed-in arguments
|
| 143 |
+
* @return mixed Value of field argument
|
| 144 |
+
*/
|
| 145 |
+
public function __call( $name, $arguments ) {
|
| 146 |
+
$key = isset( $arguments[0] ) ? $arguments[0] : false;
|
| 147 |
+
return $this->args( $name, $key );
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
/**
|
| 151 |
+
* Retrieves the field id
|
| 152 |
+
* @since 1.1.0
|
| 153 |
+
* @param boolean $raw Whether to retrieve pre-modidifed id
|
| 154 |
+
* @return string Field id
|
| 155 |
+
*/
|
| 156 |
+
public function id( $raw = false ) {
|
| 157 |
+
$id = $raw ? '_id' : 'id';
|
| 158 |
+
return $this->args( $id );
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
/**
|
| 162 |
+
* Get a field argument
|
| 163 |
+
* @since 1.1.0
|
| 164 |
+
* @param string $key Argument to check
|
| 165 |
+
* @param string $key Sub argument to check
|
| 166 |
+
* @return mixed Argument value or false if non-existent
|
| 167 |
+
*/
|
| 168 |
+
public function args( $key = '', $_key = '' ) {
|
| 169 |
+
$vars = $this->_data( 'args', $key );
|
| 170 |
+
if ( $_key ) {
|
| 171 |
+
return isset( $vars[ $_key ] ) ? $vars[ $_key ] : false;
|
| 172 |
+
}
|
| 173 |
+
return $vars;
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
/**
|
| 177 |
+
* Get Field's value
|
| 178 |
+
* @since 1.1.0
|
| 179 |
+
* @param string $key If value is an array, is used to get array key->value
|
| 180 |
+
* @return mixed Field value or false if non-existent
|
| 181 |
+
*/
|
| 182 |
+
public function value( $key = '' ) {
|
| 183 |
+
return $this->_data( 'value', $key );
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
/**
|
| 187 |
+
* Retrieve a portion of a field property
|
| 188 |
+
* @since 1.1.0
|
| 189 |
+
* @param string $var Field property to check
|
| 190 |
+
* @param string $key Field property array key to check
|
| 191 |
+
* @return mixed Queried property value or false
|
| 192 |
+
*/
|
| 193 |
+
public function _data( $var, $key = '' ) {
|
| 194 |
+
$vars = $this->$var;
|
| 195 |
+
if ( $key ) {
|
| 196 |
+
return isset( $vars[ $key ] ) ? $vars[ $key ] : false;
|
| 197 |
+
}
|
| 198 |
+
return $vars;
|
| 199 |
+
}
|
| 200 |
+
|
| 201 |
+
/**
|
| 202 |
+
* Retrieves metadata/option data
|
| 203 |
+
* @since 1.0.1
|
| 204 |
+
* @param string $field_id Meta key/Option array key
|
| 205 |
+
* @return mixed Meta/Option value
|
| 206 |
+
*/
|
| 207 |
+
public function get_data( $field_id = '', $args = array() ) {
|
| 208 |
+
if ( $field_id ) {
|
| 209 |
+
$args['field_id'] = $field_id;
|
| 210 |
+
} else if ( $this->group ) {
|
| 211 |
+
$args['field_id'] = $this->group->id();
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
$a = $this->data_args( $args );
|
| 215 |
+
|
| 216 |
+
$data = 'options-page' === $a['type']
|
| 217 |
+
? cmb2_options( $a['id'] )->get( $a['field_id'] )
|
| 218 |
+
: get_metadata( $a['type'], $a['id'], $a['field_id'], ( $a['single'] || $a['repeat'] ) );
|
| 219 |
+
|
| 220 |
+
if ( $this->group && $data ) {
|
| 221 |
+
$data = isset( $data[ $this->group->args( 'count' ) ][ $this->args( '_id' ) ] )
|
| 222 |
+
? $data[ $this->group->args( 'count' ) ][ $this->args( '_id' ) ]
|
| 223 |
+
: false;
|
| 224 |
+
}
|
| 225 |
+
return $data;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
/**
|
| 229 |
+
* Updates metadata/option data
|
| 230 |
+
* @since 1.0.1
|
| 231 |
+
* @param mixed $new_value Value to update data with
|
| 232 |
+
* @param bool $single Whether data is an array (add_metadata)
|
| 233 |
+
*/
|
| 234 |
+
public function update_data( $new_value, $single = true ) {
|
| 235 |
+
$a = $this->data_args( array( 'single' => $single ) );
|
| 236 |
+
|
| 237 |
+
$a[ 'value' ] = $a['repeat'] ? array_values( $new_value ) : $new_value;
|
| 238 |
+
|
| 239 |
+
/**
|
| 240 |
+
* Filter whether to override saving of meta value.
|
| 241 |
+
* Returning a non-null value will effectively short-circuit the function.
|
| 242 |
+
*
|
| 243 |
+
* @since 2.0.0
|
| 244 |
+
*
|
| 245 |
+
* @param null|bool $check Whether to allow updating metadata for the given type.
|
| 246 |
+
* @param array $args Array of data about current field including:
|
| 247 |
+
* 'type' : Current object type
|
| 248 |
+
* 'id' : Current object ID
|
| 249 |
+
* 'field_id' : Current Field ID
|
| 250 |
+
* 'repeat' : Whether current field is repeatable
|
| 251 |
+
* 'single' : Whether to save as a
|
| 252 |
+
* single meta value
|
| 253 |
+
* @param array $field_args All field arguments
|
| 254 |
+
* @param CMB2_Field object $field_obj This field object
|
| 255 |
+
*/
|
| 256 |
+
$override = apply_filters( 'cmb2_override_meta_save', null, $a, $this->args(), $this );
|
| 257 |
+
|
| 258 |
+
/**
|
| 259 |
+
* Filter whether to override saving of meta value.
|
| 260 |
+
*
|
| 261 |
+
* The dynamic portion of the hook, $a['field_id'], refers to the current
|
| 262 |
+
* field id paramater. Returning a non-null value
|
| 263 |
+
* will effectively short-circuit the function.
|
| 264 |
+
*
|
| 265 |
+
* @since 2.0.0
|
| 266 |
+
*
|
| 267 |
+
* @param null|bool $check Whether to allow updating metadata for the given type.
|
| 268 |
+
* @param array $args Array of data about current field including:
|
| 269 |
+
* 'type' : Current object type
|
| 270 |
+
* 'id' : Current object ID
|
| 271 |
+
* 'field_id' : Current Field ID
|
| 272 |
+
* 'repeat' : Whether current field is repeatable
|
| 273 |
+
* 'single' : Whether to save as a
|
| 274 |
+
* single meta value
|
| 275 |
+
* @param array $field_args All field arguments
|
| 276 |
+
* @param CMB2_Field object $field_obj This field object
|
| 277 |
+
*/
|
| 278 |
+
$override = apply_filters( "cmb2_override_{$a['field_id']}_meta_save", $override, $a, $this->args(), $this );
|
| 279 |
+
|
| 280 |
+
// If override, return that
|
| 281 |
+
if ( null !== $override ) {
|
| 282 |
+
return $override;
|
| 283 |
+
}
|
| 284 |
+
// Options page handling
|
| 285 |
+
if ( 'options-page' === $a['type'] ) {
|
| 286 |
+
return cmb2_options( $a['id'] )->update( $a['field_id'], $a[ 'value' ], false, $a['single'] );
|
| 287 |
+
}
|
| 288 |
+
// Add metadata if not single
|
| 289 |
+
if ( ! $a['single'] ) {
|
| 290 |
+
return add_metadata( $a['type'], $a['id'], $a['field_id'], $a[ 'value' ], false );
|
| 291 |
+
}
|
| 292 |
+
// Delete meta if we have an empty array
|
| 293 |
+
if ( is_array( $a[ 'value' ] ) && empty( $a[ 'value' ] ) ) {
|
| 294 |
+
return delete_metadata( $a['type'], $a['id'], $a['field_id'], $this->value );
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
// Update metadata
|
| 298 |
+
return update_metadata( $a['type'], $a['id'], $a['field_id'], $a[ 'value' ] );
|
| 299 |
+
}
|
| 300 |
+
|
| 301 |
+
/**
|
| 302 |
+
* Removes/updates metadata/option data
|
| 303 |
+
* @since 1.0.1
|
| 304 |
+
* @param string $old Old value
|
| 305 |
+
*/
|
| 306 |
+
public function remove_data( $old = '' ) {
|
| 307 |
+
$a = $this->data_args( array( 'old' => $old ) );
|
| 308 |
+
|
| 309 |
+
/**
|
| 310 |
+
* Filter whether to override removing of meta value.
|
| 311 |
+
* Returning a non-null value will effectively short-circuit the function.
|
| 312 |
+
*
|
| 313 |
+
* @since 2.0.0
|
| 314 |
+
*
|
| 315 |
+
* @param null|bool $delete Whether to allow metadata deletion of the given type.
|
| 316 |
+
* @param array $args Array of data about current field including:
|
| 317 |
+
* 'type' : Current object type
|
| 318 |
+
* 'id' : Current object ID
|
| 319 |
+
* 'field_id' : Current Field ID
|
| 320 |
+
* 'repeat' : Whether current field is repeatable
|
| 321 |
+
* 'single' : Whether to save as a
|
| 322 |
+
* single meta value
|
| 323 |
+
* @param array $field_args All field arguments
|
| 324 |
+
* @param CMB2_Field object $field_obj This field object
|
| 325 |
+
*/
|
| 326 |
+
$override = apply_filters( 'cmb2_override_meta_remove', null, $a, $this->args(), $this );
|
| 327 |
+
|
| 328 |
+
/**
|
| 329 |
+
* Filter whether to override removing of meta value.
|
| 330 |
+
*
|
| 331 |
+
* The dynamic portion of the hook, $a['field_id'], refers to the current
|
| 332 |
+
* field id paramater. Returning a non-null value
|
| 333 |
+
* will effectively short-circuit the function.
|
| 334 |
+
*
|
| 335 |
+
* @since 2.0.0
|
| 336 |
+
*
|
| 337 |
+
* @param null|bool $delete Whether to allow metadata deletion of the given type.
|
| 338 |
+
* @param array $args Array of data about current field including:
|
| 339 |
+
* 'type' : Current object type
|
| 340 |
+
* 'id' : Current object ID
|
| 341 |
+
* 'field_id' : Current Field ID
|
| 342 |
+
* 'repeat' : Whether current field is repeatable
|
| 343 |
+
* 'single' : Whether to save as a
|
| 344 |
+
* single meta value
|
| 345 |
+
* @param array $field_args All field arguments
|
| 346 |
+
* @param CMB2_Field object $field_obj This field object
|
| 347 |
+
*/
|
| 348 |
+
$override = apply_filters( "cmb2_override_{$a['field_id']}_meta_remove", $override, $a, $this->args(), $this );
|
| 349 |
+
|
| 350 |
+
// If no override, remove as usual
|
| 351 |
+
if ( null !== $override ) {
|
| 352 |
+
return $override;
|
| 353 |
+
}
|
| 354 |
+
// Option page handling
|
| 355 |
+
elseif ( 'options-page' === $a['type'] ) {
|
| 356 |
+
return cmb2_options( $a['id'] )->remove( $a['field_id'] );
|
| 357 |
+
}
|
| 358 |
+
|
| 359 |
+
// Remove metadata
|
| 360 |
+
return delete_metadata( $a['type'], $a['id'], $a['field_id'], $old );
|
| 361 |
+
}
|
| 362 |
+
|
| 363 |
+
/**
|
| 364 |
+
* data variables for get/set data methods
|
| 365 |
+
* @since 1.1.0
|
| 366 |
+
* @param array $args Override arguments
|
| 367 |
+
* @return array Updated arguments
|
| 368 |
+
*/
|
| 369 |
+
public function data_args( $args = array() ) {
|
| 370 |
+
$args = wp_parse_args( $args, array(
|
| 371 |
+
'type' => $this->object_type,
|
| 372 |
+
'id' => $this->object_id,
|
| 373 |
+
'field_id' => $this->id( true ),
|
| 374 |
+
'repeat' => $this->args( 'repeatable' ),
|
| 375 |
+
'single' => ! $this->args( 'multiple' ),
|
| 376 |
+
) );
|
| 377 |
+
return $args;
|
| 378 |
+
}
|
| 379 |
+
|
| 380 |
+
/**
|
| 381 |
+
* Checks if field has a registered sanitization callback
|
| 382 |
+
* @since 1.0.1
|
| 383 |
+
* @param mixed $meta_value Meta value
|
| 384 |
+
* @return mixed Possibly sanitized meta value
|
| 385 |
+
*/
|
| 386 |
+
public function sanitization_cb( $meta_value ) {
|
| 387 |
+
|
| 388 |
+
if ( $this->args( 'repeatable' ) && is_array( $meta_value ) ) {
|
| 389 |
+
// Remove empties
|
| 390 |
+
$meta_value = array_filter( $meta_value );
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
// Check if the field has a registered validation callback
|
| 394 |
+
$cb = $this->maybe_callback( 'sanitization_cb' );
|
| 395 |
+
if ( false === $cb ) {
|
| 396 |
+
// If requesting NO validation, return meta value
|
| 397 |
+
return $meta_value;
|
| 398 |
+
} elseif ( $cb ) {
|
| 399 |
+
// Ok, callback is good, let's run it.
|
| 400 |
+
return call_user_func( $cb, $meta_value, $this->args(), $this );
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
$clean = new CMB2_Sanitize( $this, $meta_value );
|
| 404 |
+
// Validation via 'CMB2_Sanitize' (with fallback filter)
|
| 405 |
+
return $clean->{$this->type()}( $meta_value );
|
| 406 |
+
}
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
* Process $_POST data to save this field's value
|
| 410 |
+
* @since 2.0.0
|
| 411 |
+
* @param array $data_to_save $_POST data to check
|
| 412 |
+
* @return bool Result of save
|
| 413 |
+
*/
|
| 414 |
+
public function save_field( $data_to_save ) {
|
| 415 |
+
|
| 416 |
+
$meta_value = isset( $data_to_save[ $this->id( true ) ] )
|
| 417 |
+
? $data_to_save[ $this->id( true ) ]
|
| 418 |
+
: null;
|
| 419 |
+
|
| 420 |
+
$new_value = $this->sanitization_cb( $meta_value );
|
| 421 |
+
$old = $this->get_data();
|
| 422 |
+
// $name = $this->id();
|
| 423 |
+
// if ( $this->args( 'multiple' ) && ! $this->args( 'repeatable' ) && ! $this->group ) {
|
| 424 |
+
// $this->remove_data();
|
| 425 |
+
// if ( ! empty( $new_value ) ) {
|
| 426 |
+
// foreach ( $new_value as $add_new ) {
|
| 427 |
+
// $this->updated[] = $name;
|
| 428 |
+
// $this->update_data( $add_new, $name, false );
|
| 429 |
+
// }
|
| 430 |
+
// }
|
| 431 |
+
// } else
|
| 432 |
+
if ( ! cmb2_utils()->isempty( $new_value ) && $new_value !== $old ) {
|
| 433 |
+
return $this->update_data( $new_value );
|
| 434 |
+
} elseif ( cmb2_utils()->isempty( $new_value ) ) {
|
| 435 |
+
return $this->remove_data();
|
| 436 |
+
}
|
| 437 |
+
}
|
| 438 |
+
|
| 439 |
+
/**
|
| 440 |
+
* Checks if field has a callback value
|
| 441 |
+
* @since 1.0.1
|
| 442 |
+
* @param string $cb Callback string
|
| 443 |
+
* @return mixed NULL, false for NO validation, or $cb string if it exists.
|
| 444 |
+
*/
|
| 445 |
+
public function maybe_callback( $cb ) {
|
| 446 |
+
$field_args = $this->args();
|
| 447 |
+
if ( ! isset( $field_args[ $cb ] ) ) {
|
| 448 |
+
return;
|
| 449 |
+
}
|
| 450 |
+
|
| 451 |
+
// Check if metabox is requesting NO validation
|
| 452 |
+
$cb = false !== $field_args[ $cb ] && 'false' !== $field_args[ $cb ] ? $field_args[ $cb ] : false;
|
| 453 |
+
|
| 454 |
+
// If requestion NO validation, return false
|
| 455 |
+
if ( ! $cb ) {
|
| 456 |
+
return false;
|
| 457 |
+
}
|
| 458 |
+
|
| 459 |
+
if ( is_callable( $cb ) ) {
|
| 460 |
+
return $cb;
|
| 461 |
+
}
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
/**
|
| 465 |
+
* Determine if current type is excempt from escaping
|
| 466 |
+
* @since 1.1.0
|
| 467 |
+
* @return bool True if exempt
|
| 468 |
+
*/
|
| 469 |
+
public function escaping_exception() {
|
| 470 |
+
// These types cannot be escaped
|
| 471 |
+
return in_array( $this->type(), array(
|
| 472 |
+
'file_list',
|
| 473 |
+
'multicheck',
|
| 474 |
+
'text_datetime_timestamp_timezone',
|
| 475 |
+
) );
|
| 476 |
+
}
|
| 477 |
+
|
| 478 |
+
/**
|
| 479 |
+
* Determine if current type cannot be repeatable
|
| 480 |
+
* @since 1.1.0
|
| 481 |
+
* @param string $type Field type to check
|
| 482 |
+
* @return bool True if type cannot be repeatable
|
| 483 |
+
*/
|
| 484 |
+
public function repeatable_exception( $type ) {
|
| 485 |
+
// These types cannot be escaped
|
| 486 |
+
return in_array( $type, array(
|
| 487 |
+
'file', // Use file_list
|
| 488 |
+
'radio',
|
| 489 |
+
'title',
|
| 490 |
+
'group',
|
| 491 |
+
// @todo Ajax load wp_editor: http://wordpress.stackexchange.com/questions/51776/how-to-load-wp-editor-through-ajax-jquery
|
| 492 |
+
'wysiwyg',
|
| 493 |
+
'checkbox',
|
| 494 |
+
'radio_inline',
|
| 495 |
+
'taxonomy_radio',
|
| 496 |
+
'taxonomy_select',
|
| 497 |
+
'taxonomy_multicheck',
|
| 498 |
+
) );
|
| 499 |
+
}
|
| 500 |
+
|
| 501 |
+
/**
|
| 502 |
+
* Escape the value before output. Defaults to 'esc_attr()'
|
| 503 |
+
* @since 1.0.1
|
| 504 |
+
* @param mixed $meta_value Meta value
|
| 505 |
+
* @param callable $func Escaping function (if not esc_attr())
|
| 506 |
+
* @return mixed Final value
|
| 507 |
+
*/
|
| 508 |
+
public function escaped_value( $func = 'esc_attr', $meta_value = '' ) {
|
| 509 |
+
|
| 510 |
+
if ( ! is_null( $this->escaped_value ) ) {
|
| 511 |
+
return $this->escaped_value;
|
| 512 |
+
}
|
| 513 |
+
|
| 514 |
+
$meta_value = $meta_value ? $meta_value : $this->value();
|
| 515 |
+
|
| 516 |
+
// Check if the field has a registered escaping callback
|
| 517 |
+
if ( $cb = $this->maybe_callback( 'escape_cb' ) ) {
|
| 518 |
+
// Ok, callback is good, let's run it.
|
| 519 |
+
return call_user_func( $cb, $meta_value, $this->args(), $this );
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
// Or custom escaping filter can be used
|
| 523 |
+
$esc = apply_filters( "cmb2_types_esc_{$this->type()}", null, $meta_value, $this->args(), $this );
|
| 524 |
+
if ( null !== $esc ) {
|
| 525 |
+
return $esc;
|
| 526 |
+
}
|
| 527 |
+
|
| 528 |
+
if ( false === $cb || $this->escaping_exception() ) {
|
| 529 |
+
// If requesting NO escaping, return meta value
|
| 530 |
+
return $this->val_or_default( $meta_value );
|
| 531 |
+
}
|
| 532 |
+
|
| 533 |
+
// escaping function passed in?
|
| 534 |
+
$func = $func ? $func : 'esc_attr';
|
| 535 |
+
$meta_value = $this->val_or_default( $meta_value );
|
| 536 |
+
|
| 537 |
+
if ( is_array( $meta_value ) ) {
|
| 538 |
+
foreach ( $meta_value as $key => $value ) {
|
| 539 |
+
$meta_value[ $key ] = call_user_func( $func, $value );
|
| 540 |
+
}
|
| 541 |
+
} else {
|
| 542 |
+
$meta_value = call_user_func( $func, $meta_value );
|
| 543 |
+
}
|
| 544 |
+
|
| 545 |
+
$this->escaped_value = $meta_value;
|
| 546 |
+
return $this->escaped_value;
|
| 547 |
+
}
|
| 548 |
+
|
| 549 |
+
/**
|
| 550 |
+
* Return non-empty value or field default if value IS empty
|
| 551 |
+
* @since 2.0.0
|
| 552 |
+
* @param mixed $meta_value Field value
|
| 553 |
+
* @return mixed Field value, or default value
|
| 554 |
+
*/
|
| 555 |
+
public function val_or_default( $meta_value ) {
|
| 556 |
+
return ! cmb2_utils()->isempty( $meta_value ) ? $meta_value : $this->args( 'default' );
|
| 557 |
+
}
|
| 558 |
+
|
| 559 |
+
/**
|
| 560 |
+
* Offset a time value based on timezone
|
| 561 |
+
* @since 1.0.0
|
| 562 |
+
* @return string Offset time string
|
| 563 |
+
*/
|
| 564 |
+
public function field_timezone_offset() {
|
| 565 |
+
return cmb2_utils()->timezone_offset( $this->field_timezone() );
|
| 566 |
+
}
|
| 567 |
+
|
| 568 |
+
/**
|
| 569 |
+
* Return timezone string
|
| 570 |
+
* @since 1.0.0
|
| 571 |
+
* @return string Timezone string
|
| 572 |
+
*/
|
| 573 |
+
public function field_timezone() {
|
| 574 |
+
|
| 575 |
+
// Is timezone arg set?
|
| 576 |
+
if ( $this->args( 'timezone' ) ) {
|
| 577 |
+
return $this->args( 'timezone' );
|
| 578 |
+
}
|
| 579 |
+
// Is there another meta key with a timezone stored as its value we should use?
|
| 580 |
+
else if ( $this->args( 'timezone_meta_key' ) ) {
|
| 581 |
+
return $this->get_data( $this->args( 'timezone_meta_key' ) );
|
| 582 |
+
}
|
| 583 |
+
|
| 584 |
+
return '';
|
| 585 |
+
}
|
| 586 |
+
|
| 587 |
+
/**
|
| 588 |
+
* Format the timestamp field value based on the field date/time format arg
|
| 589 |
+
* @since 2.0.0
|
| 590 |
+
* @param int $meta_value Timestamp
|
| 591 |
+
* @param string $format Either date_format or time_format
|
| 592 |
+
* @return string Formatted date
|
| 593 |
+
*/
|
| 594 |
+
public function format_timestamp( $meta_value, $format = 'date_format' ) {
|
| 595 |
+
return date( stripslashes( $this->args( $format ) ), $meta_value );
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
/**
|
| 599 |
+
* Return a formatted timestamp for a field
|
| 600 |
+
* @since 2.0.0
|
| 601 |
+
* @param string $format Either date_format or time_format
|
| 602 |
+
* @return string Formatted date
|
| 603 |
+
*/
|
| 604 |
+
public function get_timestamp_format( $format = 'date_format', $meta_value = 0 ) {
|
| 605 |
+
$meta_value = $meta_value ? $meta_value : $this->escaped_value();
|
| 606 |
+
$meta_value = cmb2_utils()->make_valid_time_stamp( $meta_value );
|
| 607 |
+
|
| 608 |
+
if ( empty( $meta_value ) ) {
|
| 609 |
+
return '';
|
| 610 |
+
}
|
| 611 |
+
|
| 612 |
+
return is_array( $meta_value )
|
| 613 |
+
? array_map( array( $this, 'format_timestamp' ), $meta_value, $format )
|
| 614 |
+
: $this->format_timestamp( $meta_value, $format );
|
| 615 |
+
}
|
| 616 |
+
|
| 617 |
+
/**
|
| 618 |
+
* Render a field row
|
| 619 |
+
* @since 1.0.0
|
| 620 |
+
*/
|
| 621 |
+
public function render_field() {
|
| 622 |
+
|
| 623 |
+
// If field is requesting to not be shown on the front-end
|
| 624 |
+
if ( ! is_admin() && ! $this->args( 'on_front' ) ) {
|
| 625 |
+
return;
|
| 626 |
+
}
|
| 627 |
+
|
| 628 |
+
// If field is requesting to be conditionally shown
|
| 629 |
+
if ( is_callable( $this->args( 'show_on_cb' ) ) && ! call_user_func( $this->args( 'show_on_cb' ), $this ) ) {
|
| 630 |
+
return;
|
| 631 |
+
}
|
| 632 |
+
|
| 633 |
+
$this->peform_param_callback( 'before_row' );
|
| 634 |
+
|
| 635 |
+
printf( "<div class=\"cmb-row %s\">\n", $this->row_classes() );
|
| 636 |
+
|
| 637 |
+
if ( 'title' == $this->type() || ! $this->args( 'show_names' ) ) {
|
| 638 |
+
echo "\t<div class=\"cmb-td\">\n";
|
| 639 |
+
|
| 640 |
+
if ( ! $this->args( 'show_names' ) ) {
|
| 641 |
+
$style = 'title' == $this->type() ? '' : ' style="display:none;"';
|
| 642 |
+
printf( "\n<label%s for=\"%s\">%s</label>\n", $style, $this->id(), $this->args( 'name' ) );
|
| 643 |
+
}
|
| 644 |
+
} else {
|
| 645 |
+
|
| 646 |
+
if ( $this->args( 'name' ) ) {
|
| 647 |
+
printf( '<div class="cmb-th"><label for="%1$s">%2$s</label></div>', $this->id(), $this->args( 'name' ) );
|
| 648 |
+
}
|
| 649 |
+
|
| 650 |
+
echo "\n\t<div class=\"cmb-td\">\n";
|
| 651 |
+
}
|
| 652 |
+
|
| 653 |
+
$this->peform_param_callback( 'before' );
|
| 654 |
+
|
| 655 |
+
$this_type = new CMB2_Types( $this );
|
| 656 |
+
$this_type->render();
|
| 657 |
+
|
| 658 |
+
$this->peform_param_callback( 'after' );
|
| 659 |
+
|
| 660 |
+
echo "\n\t</div>\n</div>";
|
| 661 |
+
|
| 662 |
+
$this->peform_param_callback( 'after_row' );
|
| 663 |
+
}
|
| 664 |
+
|
| 665 |
+
/**
|
| 666 |
+
* Defines the classes for the current CMB field row
|
| 667 |
+
*
|
| 668 |
+
* @since 2.0.0
|
| 669 |
+
* @return string Space concatenated list of classes
|
| 670 |
+
*/
|
| 671 |
+
public function row_classes() {
|
| 672 |
+
|
| 673 |
+
$classes = array();
|
| 674 |
+
|
| 675 |
+
/**
|
| 676 |
+
* By default, 'text_url' and 'text' fields get table-like styling
|
| 677 |
+
*
|
| 678 |
+
* @since 2.0.0
|
| 679 |
+
*
|
| 680 |
+
* @param array $field_types The types of fields which should get the 'table-layout' class
|
| 681 |
+
*/
|
| 682 |
+
$repeat_table_rows_types = apply_filters( 'cmb2_repeat_table_row_types', array(
|
| 683 |
+
'text_url', 'text',
|
| 684 |
+
) );
|
| 685 |
+
|
| 686 |
+
$conditional_classes = array(
|
| 687 |
+
'cmb-type-' . str_replace( '_', '-', sanitize_html_class( $this->type() ) ) => true,
|
| 688 |
+
'cmb2-id-' . str_replace( '_', '-', sanitize_html_class( $this->id() ) ) => true,
|
| 689 |
+
'cmb-repeat' => $this->args( 'repeatable' ),
|
| 690 |
+
'cmb-repeat-group-field' => $this->group,
|
| 691 |
+
'cmb-inline' => $this->args( 'inline' ),
|
| 692 |
+
'table-layout' => in_array( $this->type(), $repeat_table_rows_types ),
|
| 693 |
+
);
|
| 694 |
+
|
| 695 |
+
foreach ( $conditional_classes as $class => $condition ) {
|
| 696 |
+
if ( $condition ) {
|
| 697 |
+
$classes[] = $class;
|
| 698 |
+
}
|
| 699 |
+
}
|
| 700 |
+
|
| 701 |
+
if ( $added_classes = $this->get_param_callback_result( 'row_classes', false ) ) {
|
| 702 |
+
$added_classes = is_array( $added_classes ) ? implode( ' ', $added_classes ) : (string) $added_classes;
|
| 703 |
+
}
|
| 704 |
+
|
| 705 |
+
if ( $added_classes ) {
|
| 706 |
+
$classes[] = esc_attr( $added_classes );
|
| 707 |
+
}
|
| 708 |
+
|
| 709 |
+
/**
|
| 710 |
+
* Globally filter row classes
|
| 711 |
+
*
|
| 712 |
+
* @since 2.0.0
|
| 713 |
+
*
|
| 714 |
+
* @param string $classes Space-separated list of row classes
|
| 715 |
+
* @param CMB2_Field object $field This field object
|
| 716 |
+
*/
|
| 717 |
+
return apply_filters( 'cmb2_row_classes', implode( ' ', $classes ), $this );
|
| 718 |
+
}
|
| 719 |
+
|
| 720 |
+
/**
|
| 721 |
+
* Displays the results of the param callbacks.
|
| 722 |
+
*
|
| 723 |
+
* @since 2.0.0
|
| 724 |
+
* @param string $param Field parameter
|
| 725 |
+
*/
|
| 726 |
+
public function peform_param_callback( $param ) {
|
| 727 |
+
echo $this->get_param_callback_result( $param );
|
| 728 |
+
}
|
| 729 |
+
|
| 730 |
+
/**
|
| 731 |
+
* Store results of the param callbacks for continual access
|
| 732 |
+
* @since 2.0.0
|
| 733 |
+
* @param string $param Field parameter
|
| 734 |
+
* @param bool $echo Whether field should be 'echoed'
|
| 735 |
+
* @return mixed Results of param/param callback
|
| 736 |
+
*/
|
| 737 |
+
public function get_param_callback_result( $param, $echo = true ) {
|
| 738 |
+
|
| 739 |
+
// If we've already retrieved this param's value,
|
| 740 |
+
if ( array_key_exists( $param, $this->callback_results ) ) {
|
| 741 |
+
// send it back
|
| 742 |
+
return $this->callback_results[ $param ];
|
| 743 |
+
}
|
| 744 |
+
|
| 745 |
+
if ( $cb = $this->maybe_callback( $param ) ) {
|
| 746 |
+
if ( $echo ) {
|
| 747 |
+
// Ok, callback is good, let's run it and store the result
|
| 748 |
+
ob_start();
|
| 749 |
+
echo call_user_func( $cb, $this->args(), $this );
|
| 750 |
+
// grab the result from the output buffer and store it
|
| 751 |
+
$this->callback_results[ $param ] = ob_get_contents();
|
| 752 |
+
ob_end_clean();
|
| 753 |
+
} else {
|
| 754 |
+
$this->callback_results[ $param ] = call_user_func( $cb, $this->args(), $this );
|
| 755 |
+
}
|
| 756 |
+
|
| 757 |
+
return $this->callback_results[ $param ];
|
| 758 |
+
}
|
| 759 |
+
|
| 760 |
+
// Otherwise just get whatever is there
|
| 761 |
+
$this->callback_results[ $param ] = $this->args( $param );
|
| 762 |
+
|
| 763 |
+
return $this->callback_results[ $param ];
|
| 764 |
+
}
|
| 765 |
+
|
| 766 |
+
/**
|
| 767 |
+
* Replaces a hash key - {#} - with the repeatable count
|
| 768 |
+
* @since 1.2.0
|
| 769 |
+
* @param string $value Value to update
|
| 770 |
+
* @return string Updated value
|
| 771 |
+
*/
|
| 772 |
+
public function replace_hash( $value ) {
|
| 773 |
+
// Replace hash with 1 based count
|
| 774 |
+
return str_ireplace( '{#}', ( $this->count() + 1 ), $value );
|
| 775 |
+
}
|
| 776 |
+
|
| 777 |
+
/**
|
| 778 |
+
* Retrieve options args. Calls options_cb if it exists.
|
| 779 |
+
* @since 2.0.0
|
| 780 |
+
* @param string $key Specific option to retrieve
|
| 781 |
+
* @return array Array of options
|
| 782 |
+
*/
|
| 783 |
+
public function options( $key = '' ) {
|
| 784 |
+
if ( ! empty( $this->field_options ) ) {
|
| 785 |
+
if ( $key ) {
|
| 786 |
+
return array_key_exists( $key, $this->field_options ) ? $this->field_options[ $key ] : false;
|
| 787 |
+
}
|
| 788 |
+
|
| 789 |
+
return $this->field_options;
|
| 790 |
+
}
|
| 791 |
+
|
| 792 |
+
$this->field_options = (array) $this->args['options'];
|
| 793 |
+
|
| 794 |
+
if ( is_callable( $this->args['options_cb'] ) ) {
|
| 795 |
+
$options = call_user_func( $this->args['options_cb'], $this );
|
| 796 |
+
|
| 797 |
+
if ( $options && is_array( $options ) ) {
|
| 798 |
+
$this->field_options += $options;
|
| 799 |
+
}
|
| 800 |
+
}
|
| 801 |
+
|
| 802 |
+
if ( $key ) {
|
| 803 |
+
return array_key_exists( $key, $this->field_options ) ? $this->field_options[ $key ] : false;
|
| 804 |
+
}
|
| 805 |
+
|
| 806 |
+
return $this->field_options;
|
| 807 |
+
}
|
| 808 |
+
|
| 809 |
+
/**
|
| 810 |
+
* Fills in empty field parameters with defaults
|
| 811 |
+
* @since 1.1.0
|
| 812 |
+
* @param array $args Metabox field config array
|
| 813 |
+
*/
|
| 814 |
+
public function _set_field_defaults( $args ) {
|
| 815 |
+
|
| 816 |
+
// Set up blank or default values for empty ones
|
| 817 |
+
$args = wp_parse_args( $args, array(
|
| 818 |
+
'type' => '',
|
| 819 |
+
'name' => '',
|
| 820 |
+
'desc' => '',
|
| 821 |
+
'before' => '',
|
| 822 |
+
'after' => '',
|
| 823 |
+
'options_cb' => '',
|
| 824 |
+
'options' => array(),
|
| 825 |
+
'attributes' => array(),
|
| 826 |
+
'protocols' => null,
|
| 827 |
+
'default' => null,
|
| 828 |
+
'select_all_button' => true,
|
| 829 |
+
'multiple' => false,
|
| 830 |
+
'repeatable' => false,
|
| 831 |
+
'inline' => false,
|
| 832 |
+
'on_front' => true,
|
| 833 |
+
'show_names' => true,
|
| 834 |
+
'date_format' => 'm\/d\/Y',
|
| 835 |
+
'time_format' => 'h:i A',
|
| 836 |
+
'description' => isset( $args['desc'] ) ? $args['desc'] : '',
|
| 837 |
+
'preview_size' => 'file' == $args['type'] ? array( 350, 350 ) : array( 50, 50 ),
|
| 838 |
+
) );
|
| 839 |
+
|
| 840 |
+
// Allow a filter override of the default value
|
| 841 |
+
$args['default'] = apply_filters( 'cmb2_default_filter', $args['default'], $this );
|
| 842 |
+
// $args['multiple'] = isset( $args['multiple'] ) ? $args['multiple'] : ( 'multicheck' == $args['type'] ? true : false );
|
| 843 |
+
$args['repeatable'] = $args['repeatable'] && ! $this->repeatable_exception( $args['type'] );
|
| 844 |
+
$args['inline'] = $args['inline'] || false !== stripos( $args['type'], '_inline' );
|
| 845 |
+
|
| 846 |
+
// options param can be passed a callback as well
|
| 847 |
+
if ( is_callable( $args['options'] ) ) {
|
| 848 |
+
$args['options_cb'] = $args['options'];
|
| 849 |
+
$args['options'] = array();
|
| 850 |
+
}
|
| 851 |
+
|
| 852 |
+
$args['options'] = 'group' == $args['type'] ? wp_parse_args( $args['options'], array(
|
| 853 |
+
'add_button' => __( 'Add Group', 'cmb2' ),
|
| 854 |
+
'remove_button' => __( 'Remove Group', 'cmb2' ),
|
| 855 |
+
) ) : $args['options'];
|
| 856 |
+
|
| 857 |
+
$args['_id'] = $args['id'];
|
| 858 |
+
$args['_name'] = $args['id'];
|
| 859 |
+
|
| 860 |
+
if ( $this->group ) {
|
| 861 |
+
|
| 862 |
+
$args['id'] = $this->group->args( 'id' ) . '_' . $this->group->args( 'count' ) . '_' . $args['id'];
|
| 863 |
+
$args['_name'] = $this->group->args( 'id' ) . '[' . $this->group->args( 'count' ) . '][' . $args['_name'] . ']';
|
| 864 |
+
}
|
| 865 |
+
|
| 866 |
+
if ( 'wysiwyg' == $args['type'] ) {
|
| 867 |
+
$args['id'] = strtolower( str_ireplace( '-', '_', $args['id'] ) );
|
| 868 |
+
$args['options']['textarea_name'] = $args['_name'];
|
| 869 |
+
}
|
| 870 |
+
|
| 871 |
+
$option_types = apply_filters( 'cmb2_all_or_nothing_types', array( 'taxonomy_select', 'taxonomy_radio', 'taxonomy_radio_inline' ), $this );
|
| 872 |
+
|
| 873 |
+
if ( in_array( $args['type'], $option_types, true ) ) {
|
| 874 |
+
|
| 875 |
+
$args['show_option_none'] = isset( $args['show_option_none'] ) ? $args['show_option_none'] : __( 'None', 'cmb2' );
|
| 876 |
+
$args['show_option_all'] = isset( $args['show_option_all'] ) ? $args['show_option_all'] : __( 'All', 'cmb2' ); // @todo: implementation
|
| 877 |
+
|
| 878 |
+
}
|
| 879 |
+
|
| 880 |
+
return $args;
|
| 881 |
+
}
|
| 882 |
+
|
| 883 |
+
/**
|
| 884 |
+
* Updates attributes array values unless they exist from the field config array
|
| 885 |
+
* @since 1.1.0
|
| 886 |
+
* @param array $attrs Array of attributes to update
|
| 887 |
+
*/
|
| 888 |
+
public function maybe_set_attributes( $attrs = array() ) {
|
| 889 |
+
return wp_parse_args( $this->args['attributes'], $attrs );
|
| 890 |
+
}
|
| 891 |
+
|
| 892 |
+
}
|
cmb2/includes/CMB2_Options.php
ADDED
|
@@ -0,0 +1,178 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Retrieves an instance of CMB2_Option based on the option key
|
| 5 |
+
*/
|
| 6 |
+
class CMB2_Options {
|
| 7 |
+
/**
|
| 8 |
+
* Array of all CMB2_Option instances
|
| 9 |
+
* @var array
|
| 10 |
+
* @since 1.0.0
|
| 11 |
+
*/
|
| 12 |
+
protected static $option_sets = array();
|
| 13 |
+
|
| 14 |
+
public static function get( $option_key ) {
|
| 15 |
+
|
| 16 |
+
if ( empty( self::$option_sets ) || empty( self::$option_sets[ $option_key ] ) ) {
|
| 17 |
+
self::$option_sets[ $option_key ] = new CMB2_Option( $option_key );
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
return self::$option_sets[ $option_key ];
|
| 21 |
+
}
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Handles getting/setting of values to an option array
|
| 26 |
+
* for a specific option key
|
| 27 |
+
*/
|
| 28 |
+
class CMB2_Option {
|
| 29 |
+
|
| 30 |
+
/**
|
| 31 |
+
* Options array
|
| 32 |
+
* @var array
|
| 33 |
+
*/
|
| 34 |
+
protected $options = array();
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* Current option key
|
| 38 |
+
* @var string
|
| 39 |
+
*/
|
| 40 |
+
protected $key = '';
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* Initiate option object
|
| 44 |
+
* @since 2.0.0
|
| 45 |
+
*/
|
| 46 |
+
public function __construct( $option_key ) {
|
| 47 |
+
$this->key = $option_key;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Delete the option from the db
|
| 52 |
+
* @since 2.0.0
|
| 53 |
+
* @return bool Delete success or failure
|
| 54 |
+
*/
|
| 55 |
+
public function delete_option() {
|
| 56 |
+
$this->options = delete_option( $this->key );
|
| 57 |
+
return $this->options;
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
/**
|
| 61 |
+
* Removes an option from an option array
|
| 62 |
+
* @since 1.0.1
|
| 63 |
+
* @param string $field_id Option array field key
|
| 64 |
+
* @return array Modified options
|
| 65 |
+
*/
|
| 66 |
+
public function remove( $field_id, $resave = false ) {
|
| 67 |
+
|
| 68 |
+
$this->get_options();
|
| 69 |
+
|
| 70 |
+
if ( isset( $this->options[ $field_id ] ) ) {
|
| 71 |
+
unset( $this->options[ $field_id ] );
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
if ( $resave ) {
|
| 75 |
+
$this->set();
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
return $this->options;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
/**
|
| 82 |
+
* Retrieves an option from an option array
|
| 83 |
+
* @since 1.0.1
|
| 84 |
+
* @param string $field_id Option array field key
|
| 85 |
+
* @param mixed $default Fallback value for the option
|
| 86 |
+
* @return array Requested field or default
|
| 87 |
+
*/
|
| 88 |
+
function get( $field_id, $default = false ) {
|
| 89 |
+
$opts = $this->get_options();
|
| 90 |
+
|
| 91 |
+
if ( 'all' == $field_id ) {
|
| 92 |
+
return $opts;
|
| 93 |
+
} elseif ( array_key_exists( $field_id, $opts ) ) {
|
| 94 |
+
return false !== $opts[ $field_id ] ? $opts[ $field_id ] : $default;
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
return $default;
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
/**
|
| 101 |
+
* Updates Option data
|
| 102 |
+
* @since 1.0.1
|
| 103 |
+
* @param string $field_id Option array field key
|
| 104 |
+
* @param mixed $value Value to update data with
|
| 105 |
+
* @param bool $resave Whether to re-save the data
|
| 106 |
+
* @param bool $single Whether data should not be an array
|
| 107 |
+
* @return boolean Return status of update
|
| 108 |
+
*/
|
| 109 |
+
function update( $field_id, $value = '', $resave = false, $single = true ) {
|
| 110 |
+
$this->get_options();
|
| 111 |
+
|
| 112 |
+
if ( true !== $field_id ) {
|
| 113 |
+
|
| 114 |
+
if ( ! $single ) {
|
| 115 |
+
// If multiple, add to array
|
| 116 |
+
$this->options[ $field_id ][] = $value;
|
| 117 |
+
} else {
|
| 118 |
+
$this->options[ $field_id ] = $value;
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
if ( $resave || true === $field_id ) {
|
| 124 |
+
return $this->set();
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
return true;
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
/**
|
| 131 |
+
* Saves the option array
|
| 132 |
+
* Needs to be run after finished using remove/update_option
|
| 133 |
+
* @uses apply_filters() Calls 'cmb2_override_option_save_{$this->key}' hook
|
| 134 |
+
* to allow overwriting the option value to be stored.
|
| 135 |
+
*
|
| 136 |
+
* @since 1.0.1
|
| 137 |
+
* @param array $options Optional options to override
|
| 138 |
+
* @return bool Success/Failure
|
| 139 |
+
*/
|
| 140 |
+
function set( $options = array() ) {
|
| 141 |
+
$this->options = ! empty( $options ) ? $options : $this->options;
|
| 142 |
+
|
| 143 |
+
$test_save = apply_filters( "cmb2_override_option_save_{$this->key}", 'cmb2_no_override_option_save', $this->options, $this );
|
| 144 |
+
|
| 145 |
+
if ( 'cmb2_no_override_option_save' !== $test_save ) {
|
| 146 |
+
return $test_save;
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
// If no override, update the option
|
| 150 |
+
return update_option( $this->key, $this->options );
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
/**
|
| 154 |
+
* Retrieve option value based on name of option.
|
| 155 |
+
* @uses apply_filters() Calls 'cmb2_override_option_get_{$this->key}' hook to allow
|
| 156 |
+
* overwriting the option value to be retrieved.
|
| 157 |
+
*
|
| 158 |
+
* @since 1.0.1
|
| 159 |
+
* @param mixed $default Optional. Default value to return if the option does not exist.
|
| 160 |
+
* @return mixed Value set for the option.
|
| 161 |
+
*/
|
| 162 |
+
function get_options( $default = null ) {
|
| 163 |
+
if ( empty( $this->options ) ) {
|
| 164 |
+
|
| 165 |
+
$test_get = apply_filters( "cmb2_override_option_get_{$this->key}", 'cmb2_no_override_option_get', $default, $this );
|
| 166 |
+
|
| 167 |
+
if ( 'cmb2_no_override_option_get' !== $test_get ) {
|
| 168 |
+
$this->options = $test_get;
|
| 169 |
+
} else {
|
| 170 |
+
// If no override, get the option
|
| 171 |
+
$this->options = get_option( $this->key, $default );
|
| 172 |
+
}
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
return (array) $this->options;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
}
|
cmb2/includes/CMB2_Sanitize.php
ADDED
|
@@ -0,0 +1,376 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* CMB field validation
|
| 5 |
+
* @since 0.0.4
|
| 6 |
+
* @method string _id()
|
| 7 |
+
*/
|
| 8 |
+
class CMB2_Sanitize {
|
| 9 |
+
|
| 10 |
+
/**
|
| 11 |
+
* A CMB field object
|
| 12 |
+
* @var CMB2_Field object
|
| 13 |
+
*/
|
| 14 |
+
public $field;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* Field's $_POST value
|
| 18 |
+
* @var mixed
|
| 19 |
+
*/
|
| 20 |
+
public $value;
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Setup our class vars
|
| 24 |
+
* @since 1.1.0
|
| 25 |
+
* @param CMB2_Field $field A CMB field object
|
| 26 |
+
* @param mixed $value Field value
|
| 27 |
+
*/
|
| 28 |
+
public function __construct( CMB2_Field $field, $value ) {
|
| 29 |
+
$this->field = $field;
|
| 30 |
+
$this->value = stripslashes_deep( $value ); // get rid of those evil magic quotes
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
/**
|
| 34 |
+
* Catchall method if field's 'sanitization_cb' is NOT defined, or field type does not have a corresponding validation method
|
| 35 |
+
* @since 1.0.0
|
| 36 |
+
* @param string $name Non-existent method name
|
| 37 |
+
* @param array $arguments All arguments passed to the method
|
| 38 |
+
*/
|
| 39 |
+
public function __call( $name, $arguments ) {
|
| 40 |
+
list( $value ) = $arguments;
|
| 41 |
+
return $this->default_sanitization( $value );
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
/**
|
| 45 |
+
* Default fallback sanitization method. Applies filters.
|
| 46 |
+
* @since 1.0.2
|
| 47 |
+
* @param mixed $value Meta value
|
| 48 |
+
*/
|
| 49 |
+
public function default_sanitization( $value ) {
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Filter the value before it is saved.
|
| 53 |
+
*
|
| 54 |
+
* The dynamic portion of the hook name, $this->field->type(), refers to the field type.
|
| 55 |
+
*
|
| 56 |
+
* Passing a non-null value to the filter will short-circuit saving
|
| 57 |
+
* the field value, saving the passed value instead.
|
| 58 |
+
*
|
| 59 |
+
* @param bool|mixed $override_value Sanitization/Validation override value to return.
|
| 60 |
+
* Default false to skip it.
|
| 61 |
+
* @param mixed $value The value to be saved to this field.
|
| 62 |
+
* @param int $object_id The ID of the object where the value will be saved
|
| 63 |
+
* @param array $field_args The current field's arguments
|
| 64 |
+
* @param object $sanitizer This `CMB2_Sanitize` object
|
| 65 |
+
*/
|
| 66 |
+
$override_value = apply_filters( "cmb2_sanitize_{$this->field->type()}", null, $value, $this->field->object_id, $this->field->args(), $this );
|
| 67 |
+
/**
|
| 68 |
+
* DEPRECATED. See documentation above.
|
| 69 |
+
*/
|
| 70 |
+
$override_value = apply_filters( "cmb2_validate_{$this->field->type()}", $override_value, $value, $this->field->object_id, $this->field->args(), $this );
|
| 71 |
+
|
| 72 |
+
if ( null !== $override_value ) {
|
| 73 |
+
return $override_value;
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
switch ( $this->field->type() ) {
|
| 77 |
+
case 'wysiwyg':
|
| 78 |
+
// $value = wp_kses( $value );
|
| 79 |
+
// break;
|
| 80 |
+
case 'textarea_small':
|
| 81 |
+
return $this->textarea( $value );
|
| 82 |
+
case 'taxonomy_select':
|
| 83 |
+
case 'taxonomy_radio':
|
| 84 |
+
case 'taxonomy_multicheck':
|
| 85 |
+
if ( $this->field->args( 'taxonomy' ) ) {
|
| 86 |
+
return wp_set_object_terms( $this->field->object_id, $value, $this->field->args( 'taxonomy' ) );
|
| 87 |
+
}
|
| 88 |
+
case 'multicheck':
|
| 89 |
+
case 'file_list':
|
| 90 |
+
case 'oembed':
|
| 91 |
+
// no filtering
|
| 92 |
+
return $value;
|
| 93 |
+
default:
|
| 94 |
+
// Handle repeatable fields array
|
| 95 |
+
// We'll fallback to 'sanitize_text_field'
|
| 96 |
+
return is_array( $value ) ? array_map( 'sanitize_text_field', $value ) : call_user_func( 'sanitize_text_field', $value );
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
/**
|
| 101 |
+
* Simple checkbox validation
|
| 102 |
+
* @since 1.0.1
|
| 103 |
+
* @param mixed $value 'on' or false
|
| 104 |
+
* @return string|false 'on' or false
|
| 105 |
+
*/
|
| 106 |
+
public function checkbox( $value ) {
|
| 107 |
+
return $value === 'on' ? 'on' : false;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Validate url in a meta value
|
| 112 |
+
* @since 1.0.1
|
| 113 |
+
* @param string $value Meta value
|
| 114 |
+
* @return string Empty string or escaped url
|
| 115 |
+
*/
|
| 116 |
+
public function text_url( $value ) {
|
| 117 |
+
$protocols = $this->field->args( 'protocols' );
|
| 118 |
+
// for repeatable
|
| 119 |
+
if ( is_array( $value ) ) {
|
| 120 |
+
foreach ( $value as $key => $val ) {
|
| 121 |
+
$value[ $key ] = $val ? esc_url_raw( $val, $protocols ) : $this->field->args( 'default' );
|
| 122 |
+
}
|
| 123 |
+
} else {
|
| 124 |
+
$value = $value ? esc_url_raw( $value, $protocols ) : $this->field->args( 'default' );
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
return $value;
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
public function colorpicker( $value ) {
|
| 131 |
+
// for repeatable
|
| 132 |
+
if ( is_array( $value ) ) {
|
| 133 |
+
$check = $value;
|
| 134 |
+
$value = array();
|
| 135 |
+
foreach ( $check as $key => $val ) {
|
| 136 |
+
if ( $val && '#' != $val ) {
|
| 137 |
+
$value[ $key ] = esc_attr( $val );
|
| 138 |
+
}
|
| 139 |
+
}
|
| 140 |
+
} else {
|
| 141 |
+
$value = ! $value || '#' == $value ? '' : esc_attr( $value );
|
| 142 |
+
}
|
| 143 |
+
return $value;
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
/**
|
| 147 |
+
* Validate email in a meta value
|
| 148 |
+
* @since 1.0.1
|
| 149 |
+
* @param string $value Meta value
|
| 150 |
+
* @return string Empty string or sanitized email
|
| 151 |
+
*/
|
| 152 |
+
public function text_email( $value ) {
|
| 153 |
+
// for repeatable
|
| 154 |
+
if ( is_array( $value ) ) {
|
| 155 |
+
foreach ( $value as $key => $val ) {
|
| 156 |
+
$val = trim( $val );
|
| 157 |
+
$value[ $key ] = is_email( $val ) ? $val : '';
|
| 158 |
+
}
|
| 159 |
+
} else {
|
| 160 |
+
$value = trim( $value );
|
| 161 |
+
$value = is_email( $value ) ? $value : '';
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
return $value;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
/**
|
| 168 |
+
* Validate money in a meta value
|
| 169 |
+
* @since 1.0.1
|
| 170 |
+
* @param string $value Meta value
|
| 171 |
+
* @return string Empty string or sanitized money value
|
| 172 |
+
*/
|
| 173 |
+
public function text_money( $value ) {
|
| 174 |
+
|
| 175 |
+
global $wp_locale;
|
| 176 |
+
|
| 177 |
+
$search = array( $wp_locale->number_format['thousands_sep'], $wp_locale->number_format['decimal_point'] );
|
| 178 |
+
$replace = array( '', '.' );
|
| 179 |
+
|
| 180 |
+
// for repeatable
|
| 181 |
+
if ( is_array( $value ) ) {
|
| 182 |
+
foreach ( $value as $key => $val ) {
|
| 183 |
+
$value[ $key ] = number_format_i18n( (float) str_ireplace( $search, $replace, $val ), 2 );
|
| 184 |
+
}
|
| 185 |
+
} else {
|
| 186 |
+
$value = number_format_i18n( (float) str_ireplace( $search, $replace, $value ), 2 );
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
return $value;
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
/**
|
| 193 |
+
* Converts text date to timestamp
|
| 194 |
+
* @since 1.0.2
|
| 195 |
+
* @param string $value Meta value
|
| 196 |
+
* @return string Timestring
|
| 197 |
+
*/
|
| 198 |
+
public function text_date_timestamp( $value ) {
|
| 199 |
+
return is_array( $value ) ? array_map( 'strtotime', $value ) : strtotime( $value );
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
+
/**
|
| 203 |
+
* Datetime to timestamp
|
| 204 |
+
* @since 1.0.1
|
| 205 |
+
* @param string $value Meta value
|
| 206 |
+
* @return string Timestring
|
| 207 |
+
*/
|
| 208 |
+
public function text_datetime_timestamp( $value, $repeat = false ) {
|
| 209 |
+
|
| 210 |
+
$test = is_array( $value ) ? array_filter( $value ) : '';
|
| 211 |
+
if ( empty( $test ) ) {
|
| 212 |
+
return '';
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
if ( $repeat_value = $this->_check_repeat( $value, __FUNCTION__, $repeat ) ) {
|
| 216 |
+
return $repeat_value;
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
$value = strtotime( $value['date'] . ' ' . $value['time'] );
|
| 220 |
+
|
| 221 |
+
if ( $tz_offset = $this->field->field_timezone_offset() ) {
|
| 222 |
+
$value += $tz_offset;
|
| 223 |
+
}
|
| 224 |
+
|
| 225 |
+
return $value;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
/**
|
| 229 |
+
* Datetime to imestamp with timezone
|
| 230 |
+
* @since 1.0.1
|
| 231 |
+
* @param string $value Meta value
|
| 232 |
+
* @return string Timestring
|
| 233 |
+
*/
|
| 234 |
+
public function text_datetime_timestamp_timezone( $value, $repeat = false ) {
|
| 235 |
+
|
| 236 |
+
$test = is_array( $value ) ? array_filter( $value ) : '';
|
| 237 |
+
if ( empty( $test ) ) {
|
| 238 |
+
return '';
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
if ( $repeat_value = $this->_check_repeat( $value, __FUNCTION__, $repeat ) ) {
|
| 242 |
+
return $repeat_value;
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
$tzstring = null;
|
| 246 |
+
|
| 247 |
+
if ( is_array( $value ) && array_key_exists( 'timezone', $value ) ) {
|
| 248 |
+
$tzstring = $value['timezone'];
|
| 249 |
+
}
|
| 250 |
+
|
| 251 |
+
if ( empty( $tzstring ) ) {
|
| 252 |
+
$tzstring = cmb2_utils()->timezone_string();
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
$offset = cmb2_utils()->timezone_offset( $tzstring );
|
| 256 |
+
|
| 257 |
+
if ( 'UTC' === substr( $tzstring, 0, 3 ) ) {
|
| 258 |
+
$tzstring = timezone_name_from_abbr( '', $offset, 0 );
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
$value = new DateTime( $value['date'] . ' ' . $value['time'], new DateTimeZone( $tzstring ) );
|
| 262 |
+
$value = serialize( $value );
|
| 263 |
+
|
| 264 |
+
return $value;
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
/**
|
| 268 |
+
* Sanitize textareas and wysiwyg fields
|
| 269 |
+
* @since 1.0.1
|
| 270 |
+
* @param string $value Meta value
|
| 271 |
+
* @return string Sanitized data
|
| 272 |
+
*/
|
| 273 |
+
public function textarea( $value ) {
|
| 274 |
+
return is_array( $value ) ? array_map( 'wp_kses_post', $value ) : wp_kses_post( $value );
|
| 275 |
+
}
|
| 276 |
+
|
| 277 |
+
/**
|
| 278 |
+
* Sanitize code textareas
|
| 279 |
+
* @since 1.0.2
|
| 280 |
+
* @param string $value Meta value
|
| 281 |
+
* @return string Sanitized data
|
| 282 |
+
*/
|
| 283 |
+
public function textarea_code( $value, $repeat = false ) {
|
| 284 |
+
if ( $repeat_value = $this->_check_repeat( $value, __FUNCTION__, $repeat ) ) {
|
| 285 |
+
return $repeat_value;
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
return htmlspecialchars_decode( stripslashes( $value ) );
|
| 289 |
+
}
|
| 290 |
+
|
| 291 |
+
/**
|
| 292 |
+
* Peforms saving of `file` attachement's ID
|
| 293 |
+
* @since 1.1.0
|
| 294 |
+
* @param string $value File url
|
| 295 |
+
*/
|
| 296 |
+
public function _save_file_id( $value ) {
|
| 297 |
+
$group = $this->field->group;
|
| 298 |
+
$args = $this->field->args();
|
| 299 |
+
$args['id'] = $args['_id'] . '_id';
|
| 300 |
+
|
| 301 |
+
unset( $args['_id'], $args['_name'] );
|
| 302 |
+
// And get new field object
|
| 303 |
+
$field = new CMB2_Field( array(
|
| 304 |
+
'field_args' => $args,
|
| 305 |
+
'group_field' => $group,
|
| 306 |
+
'object_id' => $this->field->object_id,
|
| 307 |
+
'object_type' => $this->field->object_type,
|
| 308 |
+
) );
|
| 309 |
+
$id_key = $field->_id();
|
| 310 |
+
$id_val_old = $field->escaped_value( 'absint' );
|
| 311 |
+
|
| 312 |
+
if ( $group ) {
|
| 313 |
+
// Check group $_POST data
|
| 314 |
+
$i = $group->index;
|
| 315 |
+
$base_id = $group->_id();
|
| 316 |
+
$id_val = isset( $_POST[ $base_id ][ $i ][ $id_key ] ) ? absint( $_POST[ $base_id ][ $i ][ $id_key ] ) : 0;
|
| 317 |
+
|
| 318 |
+
} else {
|
| 319 |
+
// Check standard $_POST data
|
| 320 |
+
$id_val = isset( $_POST[ $field->id() ] ) ? $_POST[ $field->id() ] : null;
|
| 321 |
+
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
// If there is no ID saved yet, try to get it from the url
|
| 325 |
+
if ( $value && ! $id_val ) {
|
| 326 |
+
$id_val = cmb2_utils()->image_id_from_url( $value );
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
if ( $group ) {
|
| 330 |
+
return array(
|
| 331 |
+
'attach_id' => $id_val,
|
| 332 |
+
'field_id' => $id_key,
|
| 333 |
+
);
|
| 334 |
+
}
|
| 335 |
+
|
| 336 |
+
if ( $id_val && $id_val != $id_val_old ) {
|
| 337 |
+
return $field->update_data( $id_val );
|
| 338 |
+
} elseif ( empty( $id_val ) && $id_val_old ) {
|
| 339 |
+
return $field->remove_data( $id_val_old );
|
| 340 |
+
}
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
/**
|
| 344 |
+
* Handles saving of attachment post ID and sanitizing file url
|
| 345 |
+
* @since 1.1.0
|
| 346 |
+
* @param string $value File url
|
| 347 |
+
* @return string Sanitized url
|
| 348 |
+
*/
|
| 349 |
+
public function file( $value ) {
|
| 350 |
+
$id_value = $this->_save_file_id( $value );
|
| 351 |
+
$clean = $this->text_url( $value );
|
| 352 |
+
|
| 353 |
+
// Return an array with url/id if saving a group field
|
| 354 |
+
return $this->field->group ? array_merge( array( 'url' => $clean), $id_value ) : $clean;
|
| 355 |
+
}
|
| 356 |
+
|
| 357 |
+
/**
|
| 358 |
+
* If repeating, loop through and re-apply sanitization method
|
| 359 |
+
* @since 1.1.0
|
| 360 |
+
* @param mixed $value Meta value
|
| 361 |
+
* @param string $method Class method
|
| 362 |
+
* @param bool $repeat Whether repeating or not
|
| 363 |
+
* @return mixed Sanitized value
|
| 364 |
+
*/
|
| 365 |
+
public function _check_repeat( $value, $method, $repeat ) {
|
| 366 |
+
if ( $repeat || ! $this->field->args( 'repeatable' ) ) {
|
| 367 |
+
return;
|
| 368 |
+
}
|
| 369 |
+
$new_value = array();
|
| 370 |
+
foreach ( $value as $iterator => $val ) {
|
| 371 |
+
$new_value[] = $this->$method( $val, true );
|
| 372 |
+
}
|
| 373 |
+
return $new_value;
|
| 374 |
+
}
|
| 375 |
+
|
| 376 |
+
}
|
cmb2/includes/CMB2_Show_Filters.php
ADDED
|
@@ -0,0 +1,168 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Show On Filters
|
| 5 |
+
* Use the 'cmb2_show_on' filter to further refine the conditions under which a metabox is displayed.
|
| 6 |
+
* Below you can limit it by ID and page template
|
| 7 |
+
*
|
| 8 |
+
* All methods in this class are automatically filtered
|
| 9 |
+
*
|
| 10 |
+
* @since 1.0.0
|
| 11 |
+
*/
|
| 12 |
+
class CMB2_Show_Filters {
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* Get Show_on key. backwards compatible w/ 'key' indexes
|
| 16 |
+
*
|
| 17 |
+
* @since 2.0.0
|
| 18 |
+
*
|
| 19 |
+
* @param array $meta_box_args Metabox config array
|
| 20 |
+
*
|
| 21 |
+
* @return mixed show_on key or false
|
| 22 |
+
*/
|
| 23 |
+
private static function get_show_on_key( $meta_box_args ) {
|
| 24 |
+
$show_on = isset( $meta_box_args['show_on'] ) ? (array) $meta_box_args['show_on'] : false;
|
| 25 |
+
if ( $show_on && is_array( $show_on ) ) {
|
| 26 |
+
|
| 27 |
+
if ( array_key_exists( 'key', $show_on ) ) {
|
| 28 |
+
return $show_on['key'];
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
$keys = array_keys( $show_on );
|
| 32 |
+
return $keys[0];
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
return false;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
/**
|
| 39 |
+
* Get Show_on value. backwards compatible w/ 'value' indexes
|
| 40 |
+
*
|
| 41 |
+
* @since 2.0.0
|
| 42 |
+
*
|
| 43 |
+
* @param array $meta_box_args Metabox config array
|
| 44 |
+
*
|
| 45 |
+
* @return mixed show_on value or false
|
| 46 |
+
*/
|
| 47 |
+
private static function get_show_on_value( $meta_box_args ) {
|
| 48 |
+
$show_on = isset( $meta_box_args['show_on'] ) ? (array) $meta_box_args['show_on'] : false;
|
| 49 |
+
|
| 50 |
+
if ( $show_on && is_array( $show_on ) ) {
|
| 51 |
+
|
| 52 |
+
if ( array_key_exists( 'value', $show_on ) ) {
|
| 53 |
+
return $show_on['value'];
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
$keys = array_keys( $show_on );
|
| 57 |
+
|
| 58 |
+
return $show_on[ $keys[0] ];
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
return array();
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Add metaboxes for an specific ID
|
| 66 |
+
* @since 1.0.0
|
| 67 |
+
* @param bool $display To display or not
|
| 68 |
+
* @param array $meta_box_args Metabox config array
|
| 69 |
+
* @return bool Whether to display this metabox on the current page.
|
| 70 |
+
*/
|
| 71 |
+
public static function check_id( $display, $meta_box_args, $cmb ) {
|
| 72 |
+
|
| 73 |
+
$key = self::get_show_on_key( $meta_box_args );
|
| 74 |
+
if ( ! $key || 'id' !== $key ) {
|
| 75 |
+
return $display;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
$object_id = is_admin() ? $cmb->object_id() : @get_the_id();
|
| 79 |
+
|
| 80 |
+
if ( ! $object_id ) {
|
| 81 |
+
return false;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
// If current page id is in the included array, display the metabox
|
| 85 |
+
return in_array( $object_id, (array) self::get_show_on_value( $meta_box_args ) );
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
/**
|
| 89 |
+
* Add metaboxes for an specific Page Template
|
| 90 |
+
* @since 1.0.0
|
| 91 |
+
* @param bool $display To display or not
|
| 92 |
+
* @param array $meta_box_args Metabox config array
|
| 93 |
+
* @return bool Whether to display this metabox on the current page.
|
| 94 |
+
*/
|
| 95 |
+
public static function check_page_template( $display, $meta_box_args, $cmb ) {
|
| 96 |
+
|
| 97 |
+
$key = self::get_show_on_key( $meta_box_args );
|
| 98 |
+
if ( ! $key || 'page-template' !== $key ) {
|
| 99 |
+
return $display;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
$object_id = $cmb->object_id();
|
| 103 |
+
|
| 104 |
+
if ( ! $object_id || 'post' !== $cmb->object_type() ) {
|
| 105 |
+
return false;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
// Get current template
|
| 109 |
+
$current_template = get_post_meta( $object_id, '_wp_page_template', true );
|
| 110 |
+
|
| 111 |
+
// See if there's a match
|
| 112 |
+
if ( $current_template && in_array( $current_template, (array) self::get_show_on_value( $meta_box_args ) ) ) {
|
| 113 |
+
return true;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
return false;
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
/**
|
| 120 |
+
* Only show options-page metaboxes on their options page (but only enforce on the admin side)
|
| 121 |
+
* @since 1.0.0
|
| 122 |
+
* @param bool $display To display or not
|
| 123 |
+
* @param array $meta_box_args Metabox config array
|
| 124 |
+
* @return bool Whether to display this metabox on the current page.
|
| 125 |
+
*/
|
| 126 |
+
public static function check_admin_page( $display, $meta_box_args ) {
|
| 127 |
+
|
| 128 |
+
$key = self::get_show_on_key( $meta_box_args );
|
| 129 |
+
// check if this is a 'options-page' metabox
|
| 130 |
+
if ( ! $key || 'options-page' !== $key ) {
|
| 131 |
+
return $display;
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
// Enforce 'show_on' filter in the admin
|
| 135 |
+
if ( is_admin() ) {
|
| 136 |
+
|
| 137 |
+
// If there is no 'page' query var, our filter isn't applicable
|
| 138 |
+
if ( ! isset( $_GET['page'] ) ) {
|
| 139 |
+
return $display;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
$show_on = self::get_show_on_value( $meta_box_args );
|
| 143 |
+
|
| 144 |
+
if ( empty( $show_on ) ) {
|
| 145 |
+
return false;
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
if ( is_array( $show_on ) ) {
|
| 149 |
+
foreach ( $show_on as $page ) {
|
| 150 |
+
if ( $_GET['page'] == $page ) {
|
| 151 |
+
return true;
|
| 152 |
+
}
|
| 153 |
+
}
|
| 154 |
+
} else {
|
| 155 |
+
if ( $_GET['page'] == $show_on ) {
|
| 156 |
+
return true;
|
| 157 |
+
}
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
return false;
|
| 161 |
+
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
// Allow options-page metaboxes to be displayed anywhere on the front-end
|
| 165 |
+
return true;
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
}
|
cmb2/includes/CMB2_Types.php
ADDED
|
@@ -0,0 +1,962 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* CMB field types
|
| 5 |
+
*
|
| 6 |
+
* @todo test taxonomy methods with non-post objects
|
| 7 |
+
* @todo test all methods with non-post objects
|
| 8 |
+
* @todo Date/Time fields should store date format as data attribute for JS
|
| 9 |
+
*
|
| 10 |
+
* @since 1.0.0
|
| 11 |
+
*/
|
| 12 |
+
class CMB2_Types {
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* An iterator value for repeatable fields
|
| 16 |
+
* @var integer
|
| 17 |
+
* @since 1.0.0
|
| 18 |
+
*/
|
| 19 |
+
public $iterator = 0;
|
| 20 |
+
|
| 21 |
+
/**
|
| 22 |
+
* Current CMB2_Field field object
|
| 23 |
+
* @var CMB2_Field object
|
| 24 |
+
* @since 1.0.0
|
| 25 |
+
*/
|
| 26 |
+
public $field;
|
| 27 |
+
|
| 28 |
+
public function __construct( CMB2_Field $field ) {
|
| 29 |
+
$this->field = $field;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* Default fallback. Allows rendering fields via "cmb2_render_$name" hook
|
| 34 |
+
* @since 1.0.0
|
| 35 |
+
* @param string $name Non-existent method name
|
| 36 |
+
* @param array $arguments All arguments passed to the method
|
| 37 |
+
*/
|
| 38 |
+
public function __call( $name, $arguments ) {
|
| 39 |
+
/**
|
| 40 |
+
* Pass non-existent field types through an action
|
| 41 |
+
*
|
| 42 |
+
* The dynamic portion of the hook name, $name, refers to the field type.
|
| 43 |
+
*
|
| 44 |
+
* @param array $field The passed in `CMB2_Field` object
|
| 45 |
+
* @param mixed $escaped_value The value of this field escaped.
|
| 46 |
+
* It defaults to `sanitize_text_field`.
|
| 47 |
+
* If you need the unescaped value, you can access it
|
| 48 |
+
* via `$field->value()`
|
| 49 |
+
* @param int $object_id The ID of the current object
|
| 50 |
+
* @param string $object_type The type of object you are working with.
|
| 51 |
+
* Most commonly, `post` (this applies to all post-types),
|
| 52 |
+
* but could also be `comment`, `user` or `options-page`.
|
| 53 |
+
* @param object $field_type_object This `CMB2_Types` object
|
| 54 |
+
*/
|
| 55 |
+
do_action( "cmb2_render_$name", $this->field, $this->field->escaped_value(), $this->field->object_id, $this->field->object_type, $this );
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* Render a field (and handle repeatable)
|
| 60 |
+
* @since 1.1.0
|
| 61 |
+
*/
|
| 62 |
+
public function render() {
|
| 63 |
+
if ( $this->field->args( 'repeatable' ) ) {
|
| 64 |
+
$this->render_repeatable_field();
|
| 65 |
+
} else {
|
| 66 |
+
$this->_render();
|
| 67 |
+
}
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
/**
|
| 71 |
+
* Render a field type
|
| 72 |
+
* @since 1.1.0
|
| 73 |
+
*/
|
| 74 |
+
protected function _render() {
|
| 75 |
+
$this->field->peform_param_callback( 'before_field' );
|
| 76 |
+
echo $this->{$this->field->type()}();
|
| 77 |
+
$this->field->peform_param_callback( 'after_field' );
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* Checks if we can get a post object, and if so, uses `get_the_terms` which utilizes caching
|
| 82 |
+
* @since 1.0.2
|
| 83 |
+
* @return mixed Array of terms on success
|
| 84 |
+
*/
|
| 85 |
+
public function get_object_terms() {
|
| 86 |
+
$object_id = $this->field->object_id;
|
| 87 |
+
$taxonomy = $this->field->args( 'taxonomy' );
|
| 88 |
+
|
| 89 |
+
if ( ! $post = get_post( $object_id ) ) {
|
| 90 |
+
|
| 91 |
+
$cache_key = "cmb-cache-{$taxonomy}-{$object_id}";
|
| 92 |
+
|
| 93 |
+
// Check cache
|
| 94 |
+
$cached = get_transient( $cache_key );
|
| 95 |
+
if ( $cached ) {
|
| 96 |
+
return $cached;
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
$cached = wp_get_object_terms( $object_id, $taxonomy );
|
| 100 |
+
// Do our own (minimal) caching. Long enough for a page-load.
|
| 101 |
+
set_transient( $cache_key, $cached, 60 );
|
| 102 |
+
return $cached;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
// WP caches internally so it's better to use
|
| 106 |
+
return get_the_terms( $post, $taxonomy );
|
| 107 |
+
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Retrieve text parameter from field's options array (if it has one), or use fallback text
|
| 112 |
+
* @since 2.0.0
|
| 113 |
+
* @param string $option_key Key in field's options array
|
| 114 |
+
* @param string $fallback Fallback text
|
| 115 |
+
* @return string Text
|
| 116 |
+
*/
|
| 117 |
+
public function _text( $option_key, $fallback ) {
|
| 118 |
+
$has_string_param = $this->field->options( $option_key );
|
| 119 |
+
return $has_string_param ? $has_string_param : $fallback;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
/**
|
| 123 |
+
* Determine a file's extension
|
| 124 |
+
* @since 1.0.0
|
| 125 |
+
* @param string $file File url
|
| 126 |
+
* @return string|false File extension or false
|
| 127 |
+
*/
|
| 128 |
+
public function get_file_ext( $file ) {
|
| 129 |
+
$parsed = @parse_url( $file, PHP_URL_PATH );
|
| 130 |
+
return $parsed ? strtolower( pathinfo( $parsed, PATHINFO_EXTENSION ) ) : false;
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
/**
|
| 134 |
+
* Get the file name from a url
|
| 135 |
+
* @since 2.0.0
|
| 136 |
+
* @param string $value File url or path
|
| 137 |
+
* @return string File name
|
| 138 |
+
*/
|
| 139 |
+
public function get_file_name_from_path( $value ) {
|
| 140 |
+
$parts = explode( '/', $value );
|
| 141 |
+
return is_array( $parts ) ? end( $parts ) : $value;
|
| 142 |
+
}
|
| 143 |
+
|
| 144 |
+
/**
|
| 145 |
+
* Determines if a file has a valid image extension
|
| 146 |
+
* @since 1.0.0
|
| 147 |
+
* @param string $file File url
|
| 148 |
+
* @return bool Whether file has a valid image extension
|
| 149 |
+
*/
|
| 150 |
+
public function is_valid_img_ext( $file ) {
|
| 151 |
+
$file_ext = $this->get_file_ext( $file );
|
| 152 |
+
|
| 153 |
+
$is_valid_types = (array) apply_filters( 'cmb2_valid_img_types', array( 'jpg', 'jpeg', 'png', 'gif', 'ico', 'icon' ) );
|
| 154 |
+
|
| 155 |
+
return ( $file_ext && in_array( $file_ext, $is_valid_types ) );
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
/**
|
| 159 |
+
* Handles parsing and filtering attributes while preserving any passed in via field config.
|
| 160 |
+
* @since 1.1.0
|
| 161 |
+
* @param array $args Override arguments
|
| 162 |
+
* @param string $element Element for filter
|
| 163 |
+
* @param array $defaults Default arguments
|
| 164 |
+
* @return array Parsed and filtered arguments
|
| 165 |
+
*/
|
| 166 |
+
public function parse_args( $args, $element, $defaults ) {
|
| 167 |
+
return wp_parse_args( apply_filters( "cmb2_{$element}_attributes", $this->field->maybe_set_attributes( $args ), $defaults, $this->field, $this ), $defaults );
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
/**
|
| 171 |
+
* Combines attributes into a string for a form element
|
| 172 |
+
* @since 1.1.0
|
| 173 |
+
* @param array $attrs Attributes to concatenate
|
| 174 |
+
* @param array $attr_exclude Attributes that should NOT be concatenated
|
| 175 |
+
* @return string String of attributes for form element
|
| 176 |
+
*/
|
| 177 |
+
public function concat_attrs( $attrs, $attr_exclude = array() ) {
|
| 178 |
+
$attributes = '';
|
| 179 |
+
foreach ( $attrs as $attr => $val ) {
|
| 180 |
+
$excluded = in_array( $attr, (array) $attr_exclude, true );
|
| 181 |
+
$empty = false === $val && 'value' !== $attr;
|
| 182 |
+
if ( ! $excluded && ! $empty ) {
|
| 183 |
+
// if data attribute, use single quote wraps, else double
|
| 184 |
+
$quotes = false !== stripos( $attr, 'data-' ) ? "'" : '"';
|
| 185 |
+
$attributes .= sprintf( ' %1$s=%3$s%2$s%3$s', $attr, $val, $quotes );
|
| 186 |
+
}
|
| 187 |
+
}
|
| 188 |
+
return $attributes;
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
/**
|
| 192 |
+
* Generates html for concatenated items
|
| 193 |
+
* @since 1.1.0
|
| 194 |
+
* @param array $args Optional arguments
|
| 195 |
+
* @return string Concatenated html items
|
| 196 |
+
*/
|
| 197 |
+
public function concat_items( $args = array() ) {
|
| 198 |
+
|
| 199 |
+
$method = isset( $args['method'] ) ? $args['method'] : 'select_option';
|
| 200 |
+
unset( $args['method'] );
|
| 201 |
+
|
| 202 |
+
$value = $this->field->escaped_value()
|
| 203 |
+
? $this->field->escaped_value()
|
| 204 |
+
: $this->field->args( 'default' );
|
| 205 |
+
|
| 206 |
+
$concatenated_items = ''; $i = 1;
|
| 207 |
+
foreach ( (array) $this->field->options() as $opt_value => $opt_label ) {
|
| 208 |
+
|
| 209 |
+
// Clone args & modify for just this item
|
| 210 |
+
$a = $args;
|
| 211 |
+
|
| 212 |
+
$a['value'] = $opt_value;
|
| 213 |
+
$a['label'] = $opt_label;
|
| 214 |
+
|
| 215 |
+
// Check if this option is the value of the input
|
| 216 |
+
if ( $value == $opt_value ) {
|
| 217 |
+
$a['checked'] = 'checked';
|
| 218 |
+
}
|
| 219 |
+
|
| 220 |
+
$concatenated_items .= $this->$method( $a, $i++ );
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
return $concatenated_items;
|
| 224 |
+
}
|
| 225 |
+
|
| 226 |
+
/**
|
| 227 |
+
* Generates html for an option element
|
| 228 |
+
* @since 1.1.0
|
| 229 |
+
* @param array $args Arguments array containing value, label, and checked boolean
|
| 230 |
+
* @return string Generated option element html
|
| 231 |
+
*/
|
| 232 |
+
public function select_option( $args = array() ) {
|
| 233 |
+
return sprintf( "\t" . '<option value="%s" %s>%s</option>', $args['value'], selected( isset( $args['checked'] ) && $args['checked'], true, false ), $args['label'] ) . "\n";
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
/**
|
| 237 |
+
* Generates html for list item with input
|
| 238 |
+
* @since 1.1.0
|
| 239 |
+
* @param array $args Override arguments
|
| 240 |
+
* @param int $i Iterator value
|
| 241 |
+
* @return string Gnerated list item html
|
| 242 |
+
*/
|
| 243 |
+
public function list_input( $args = array(), $i ) {
|
| 244 |
+
$a = $this->parse_args( $args, 'list_input', array(
|
| 245 |
+
'type' => 'radio',
|
| 246 |
+
'class' => 'cmb2-option',
|
| 247 |
+
'name' => $this->_name(),
|
| 248 |
+
'id' => $this->_id( $i ),
|
| 249 |
+
'value' => $this->field->escaped_value(),
|
| 250 |
+
'label' => '',
|
| 251 |
+
) );
|
| 252 |
+
|
| 253 |
+
return sprintf( "\t" . '<li><input%s/> <label for="%s">%s</label></li>' . "\n", $this->concat_attrs( $a, array( 'label' ) ), $a['id'], $a['label'] );
|
| 254 |
+
}
|
| 255 |
+
|
| 256 |
+
/**
|
| 257 |
+
* Generates html for list item with checkbox input
|
| 258 |
+
* @since 1.1.0
|
| 259 |
+
* @param array $args Override arguments
|
| 260 |
+
* @param int $i Iterator value
|
| 261 |
+
* @return string Gnerated list item html
|
| 262 |
+
*/
|
| 263 |
+
public function list_input_checkbox( $args, $i ) {
|
| 264 |
+
$saved_value = $this->field->escaped_value();
|
| 265 |
+
if ( is_array( $saved_value ) && in_array( $args['value'], $saved_value ) ) {
|
| 266 |
+
$args['checked'] = 'checked';
|
| 267 |
+
}
|
| 268 |
+
$args['type'] = 'checkbox';
|
| 269 |
+
return $this->list_input( $args, $i );
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
/**
|
| 273 |
+
* Generates repeatable field table markup
|
| 274 |
+
* @since 1.0.0
|
| 275 |
+
*/
|
| 276 |
+
public function render_repeatable_field() {
|
| 277 |
+
$table_id = $this->field->id() . '_repeat';
|
| 278 |
+
|
| 279 |
+
$this->_desc( true, true, true );
|
| 280 |
+
?>
|
| 281 |
+
|
| 282 |
+
<div id="<?php echo $table_id; ?>" class="cmb-repeat-table cmb-nested">
|
| 283 |
+
<div class="cmb-tbody cmb-field-list">
|
| 284 |
+
<?php $this->repeatable_rows(); ?>
|
| 285 |
+
</div>
|
| 286 |
+
</div>
|
| 287 |
+
<p class="cmb-add-row">
|
| 288 |
+
<button data-selector="<?php echo $table_id; ?>" class="cmb-add-row-button button"><?php echo esc_html( $this->_text( 'add_row_text', __( 'Add Row', 'cmb2' ) ) ); ?></button>
|
| 289 |
+
</p>
|
| 290 |
+
|
| 291 |
+
<?php
|
| 292 |
+
// reset iterator
|
| 293 |
+
$this->iterator = 0;
|
| 294 |
+
}
|
| 295 |
+
|
| 296 |
+
/**
|
| 297 |
+
* Generates repeatable field rows
|
| 298 |
+
* @since 1.1.0
|
| 299 |
+
*/
|
| 300 |
+
public function repeatable_rows() {
|
| 301 |
+
$meta_value = array_filter( (array) $this->field->escaped_value() );
|
| 302 |
+
// check for default content
|
| 303 |
+
$default = $this->field->args( 'default' );
|
| 304 |
+
|
| 305 |
+
// check for saved data
|
| 306 |
+
if ( ! empty( $meta_value ) ) {
|
| 307 |
+
$meta_value = is_array( $meta_value ) ? array_filter( $meta_value ) : $meta_value;
|
| 308 |
+
$meta_value = ! empty( $meta_value ) ? $meta_value : $default;
|
| 309 |
+
} else {
|
| 310 |
+
$meta_value = $default;
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
// Loop value array and add a row
|
| 314 |
+
if ( ! empty( $meta_value ) ) {
|
| 315 |
+
$count = count( $meta_value );
|
| 316 |
+
foreach ( (array) $meta_value as $val ) {
|
| 317 |
+
$this->field->escaped_value = $val;
|
| 318 |
+
$this->repeat_row( $count < 2 );
|
| 319 |
+
$this->iterator++;
|
| 320 |
+
}
|
| 321 |
+
} else {
|
| 322 |
+
// Otherwise add one row
|
| 323 |
+
$this->repeat_row( true );
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
// Then add an empty row
|
| 327 |
+
$this->field->escaped_value = '';
|
| 328 |
+
$this->iterator = $this->iterator ? $this->iterator : 1;
|
| 329 |
+
$this->repeat_row( false, 'empty-row hidden' );
|
| 330 |
+
}
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* Generates a repeatable row's markup
|
| 334 |
+
* @since 1.1.0
|
| 335 |
+
* @param bool $disable_remover Whether remove button should be disabled
|
| 336 |
+
* @param string $class Repeatable table row's class
|
| 337 |
+
*/
|
| 338 |
+
protected function repeat_row( $disable_remover = false, $class = 'cmb-repeat-row' ) {
|
| 339 |
+
$disabled = $disable_remover ? ' button-disabled' : '';
|
| 340 |
+
?>
|
| 341 |
+
|
| 342 |
+
<div class="cmb-row <?php echo $class; ?>">
|
| 343 |
+
<div class="cmb-td">
|
| 344 |
+
<?php $this->_render(); ?>
|
| 345 |
+
</div>
|
| 346 |
+
<div class="cmb-td cmb-remove-row">
|
| 347 |
+
<button class="button cmb-remove-row-button<?php echo $disabled; ?>"><?php echo esc_html( $this->_text( 'remove_row_text', __( 'Remove', 'cmb2' ) ) ); ?></button>
|
| 348 |
+
</div>
|
| 349 |
+
</div>
|
| 350 |
+
|
| 351 |
+
<?php
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
/**
|
| 355 |
+
* Generates description markup
|
| 356 |
+
* @since 1.0.0
|
| 357 |
+
* @param boolean $paragraph Paragraph tag or span
|
| 358 |
+
* @param boolean $echo Whether to echo description or only return it
|
| 359 |
+
* @return string Field's description markup
|
| 360 |
+
*/
|
| 361 |
+
public function _desc( $paragraph = false, $echo = false, $repeat_group = false ) {
|
| 362 |
+
// Prevent description from printing multiple times for repeatable fields
|
| 363 |
+
if ( ! $repeat_group && ( $this->field->args( 'repeatable' ) || $this->iterator > 0 ) ) {
|
| 364 |
+
return '';
|
| 365 |
+
}
|
| 366 |
+
|
| 367 |
+
$desc = $this->field->args( 'description' );
|
| 368 |
+
|
| 369 |
+
if ( ! $desc ) {
|
| 370 |
+
return;
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
+
$tag = $paragraph ? 'p' : 'span';
|
| 374 |
+
$desc = sprintf( "\n" . '<%1$s class="cmb2-metabox-description">%2$s</%1$s>' . "\n", $tag, $desc );
|
| 375 |
+
|
| 376 |
+
if ( $echo ) {
|
| 377 |
+
echo $desc;
|
| 378 |
+
}
|
| 379 |
+
return $desc;
|
| 380 |
+
}
|
| 381 |
+
|
| 382 |
+
/**
|
| 383 |
+
* Generate field name attribute
|
| 384 |
+
* @since 1.1.0
|
| 385 |
+
* @param string $suffix For multi-part fields
|
| 386 |
+
* @return string Name attribute
|
| 387 |
+
*/
|
| 388 |
+
public function _name( $suffix = '' ) {
|
| 389 |
+
return $this->field->args( '_name' ) . ( $this->field->args( 'repeatable' ) ? '[' . $this->iterator . ']' : '' ) . $suffix;
|
| 390 |
+
}
|
| 391 |
+
|
| 392 |
+
/**
|
| 393 |
+
* Generate field id attribute
|
| 394 |
+
* @since 1.1.0
|
| 395 |
+
* @param string $suffix For multi-part fields
|
| 396 |
+
* @return string Id attribute
|
| 397 |
+
*/
|
| 398 |
+
public function _id( $suffix = '' ) {
|
| 399 |
+
return $this->field->id() . $suffix . ( $this->field->args( 'repeatable' ) ? '_' . $this->iterator . '" data-iterator="' . $this->iterator : '' );
|
| 400 |
+
}
|
| 401 |
+
|
| 402 |
+
/**
|
| 403 |
+
* Handles outputting an 'input' element
|
| 404 |
+
* @since 1.1.0
|
| 405 |
+
* @param array $args Override arguments
|
| 406 |
+
* @return string Form input element
|
| 407 |
+
*/
|
| 408 |
+
public function input( $args = array() ) {
|
| 409 |
+
$a = $this->parse_args( $args, 'input', array(
|
| 410 |
+
'type' => 'text',
|
| 411 |
+
'class' => 'regular-text',
|
| 412 |
+
'name' => $this->_name(),
|
| 413 |
+
'id' => $this->_id(),
|
| 414 |
+
'value' => $this->field->escaped_value(),
|
| 415 |
+
'desc' => $this->_desc( true ),
|
| 416 |
+
) );
|
| 417 |
+
|
| 418 |
+
return sprintf( '<input%s/>%s', $this->concat_attrs( $a, array( 'desc' ) ), $a['desc'] );
|
| 419 |
+
}
|
| 420 |
+
|
| 421 |
+
/**
|
| 422 |
+
* Handles outputting an 'textarea' element
|
| 423 |
+
* @since 1.1.0
|
| 424 |
+
* @param array $args Override arguments
|
| 425 |
+
* @return string Form textarea element
|
| 426 |
+
*/
|
| 427 |
+
public function textarea( $args = array() ) {
|
| 428 |
+
$a = $this->parse_args( $args, 'textarea', array(
|
| 429 |
+
'class' => 'cmb2_textarea',
|
| 430 |
+
'name' => $this->_name(),
|
| 431 |
+
'id' => $this->_id(),
|
| 432 |
+
'cols' => 60,
|
| 433 |
+
'rows' => 10,
|
| 434 |
+
'value' => $this->field->escaped_value( 'esc_textarea' ),
|
| 435 |
+
'desc' => $this->_desc( true ),
|
| 436 |
+
) );
|
| 437 |
+
return sprintf( '<textarea%s>%s</textarea>%s', $this->concat_attrs( $a, array( 'desc', 'value' ) ), $a['value'], $a['desc'] );
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
/**
|
| 441 |
+
* Begin Field Types
|
| 442 |
+
*/
|
| 443 |
+
|
| 444 |
+
public function text() {
|
| 445 |
+
return $this->input();
|
| 446 |
+
}
|
| 447 |
+
|
| 448 |
+
public function hidden() {
|
| 449 |
+
return $this->input( array( 'type' => 'hidden', 'desc' => '', 'class' => false ) );
|
| 450 |
+
}
|
| 451 |
+
|
| 452 |
+
public function text_small() {
|
| 453 |
+
return $this->input( array( 'class' => 'cmb2-text-small', 'desc' => $this->_desc() ) );
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
public function text_medium() {
|
| 457 |
+
return $this->input( array( 'class' => 'cmb2-text-medium', 'desc' => $this->_desc() ) );
|
| 458 |
+
}
|
| 459 |
+
|
| 460 |
+
public function text_email() {
|
| 461 |
+
return $this->input( array( 'class' => 'cmb2-text-email cmb2-text-medium', 'type' => 'email' ) );
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
public function text_url() {
|
| 465 |
+
return $this->input( array( 'class' => 'cmb2-text-url cmb2-text-medium regular-text', 'value' => $this->field->escaped_value( 'esc_url' ) ) );
|
| 466 |
+
}
|
| 467 |
+
|
| 468 |
+
public function text_date() {
|
| 469 |
+
$formatted_value = $this->field->get_timestamp_format();
|
| 470 |
+
|
| 471 |
+
return $this->input( array( 'class' => 'cmb2-text-small cmb2-datepicker', 'desc' => $this->_desc(), 'value' => $formatted_value ) );
|
| 472 |
+
}
|
| 473 |
+
|
| 474 |
+
public function text_time() {
|
| 475 |
+
$formatted_value = $this->field->get_timestamp_format( 'time_format' );
|
| 476 |
+
|
| 477 |
+
return $this->input( array( 'class' => 'cmb2-timepicker text-time', 'desc' => $this->_desc(), 'value' => $formatted_value ) );
|
| 478 |
+
}
|
| 479 |
+
|
| 480 |
+
public function text_money() {
|
| 481 |
+
return ( ! $this->field->get_param_callback_result( 'before_field' ) ? '$ ' : ' ' ) . $this->input( array( 'class' => 'cmb2-text-money', 'desc' => $this->_desc() ) );
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
public function textarea_small() {
|
| 485 |
+
return $this->textarea( array( 'class' => 'cmb2-textarea-small', 'rows' => 4 ) );
|
| 486 |
+
}
|
| 487 |
+
|
| 488 |
+
public function textarea_code() {
|
| 489 |
+
return sprintf( '<pre>%s', $this->textarea( array( 'class' => 'cmb2-textarea-code', 'desc' => '</pre>' . $this->_desc( true ) ) ) );
|
| 490 |
+
}
|
| 491 |
+
|
| 492 |
+
public function wysiwyg( $args = array() ) {
|
| 493 |
+
$a = $this->parse_args( $args, 'input', array(
|
| 494 |
+
'id' => $this->_id(),
|
| 495 |
+
'value' => $this->field->escaped_value( 'stripslashes' ),
|
| 496 |
+
'desc' => $this->_desc( true ),
|
| 497 |
+
'options' => $this->field->options(),
|
| 498 |
+
) );
|
| 499 |
+
|
| 500 |
+
wp_editor( $a['value'], $a['id'], $a['options'] );
|
| 501 |
+
echo $a['desc'];
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
public function text_date_timestamp() {
|
| 505 |
+
$formatted_value = $this->field->get_timestamp_format();
|
| 506 |
+
|
| 507 |
+
return $this->input( array( 'class' => 'cmb2-text-small cmb2-datepicker', 'value' => $formatted_value ) );
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
public function text_datetime_timestamp( $meta_value = null ) {
|
| 511 |
+
$desc = '';
|
| 512 |
+
if ( ! $meta_value ) {
|
| 513 |
+
$meta_value = $this->field->escaped_value();
|
| 514 |
+
// This will be used if there is a select_timezone set for this field
|
| 515 |
+
$tz_offset = $this->field->field_timezone_offset();
|
| 516 |
+
if ( ! empty( $tz_offset ) ) {
|
| 517 |
+
$meta_value -= $tz_offset;
|
| 518 |
+
}
|
| 519 |
+
$desc = $this->_desc();
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
$inputs = array(
|
| 523 |
+
$this->input( array(
|
| 524 |
+
'class' => 'cmb2-text-small cmb2-datepicker',
|
| 525 |
+
'name' => $this->_name( '[date]' ),
|
| 526 |
+
'id' => $this->_id( '_date' ),
|
| 527 |
+
'value' => ! empty( $meta_value ) && ! is_array( $meta_value ) ? $this->field->get_timestamp_format( 'date_format', $meta_value ) : '',
|
| 528 |
+
'desc' => '',
|
| 529 |
+
) ),
|
| 530 |
+
$this->input( array(
|
| 531 |
+
'class' => 'cmb2-timepicker text-time',
|
| 532 |
+
'name' => $this->_name( '[time]' ),
|
| 533 |
+
'id' => $this->_id( '_time' ),
|
| 534 |
+
'value' => ! empty( $meta_value ) && ! is_array( $meta_value ) ? $this->field->get_timestamp_format( 'time_format', $meta_value ) : '',
|
| 535 |
+
'desc' => $desc,
|
| 536 |
+
) ),
|
| 537 |
+
);
|
| 538 |
+
|
| 539 |
+
return implode( "\n", $inputs );
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
public function text_datetime_timestamp_timezone() {
|
| 543 |
+
$meta_value = $this->field->escaped_value();
|
| 544 |
+
if ( is_array( $meta_value ) ) {
|
| 545 |
+
$meta_value = '';
|
| 546 |
+
}
|
| 547 |
+
$datetime = unserialize( $meta_value );
|
| 548 |
+
$meta_value = $tzstring = '';
|
| 549 |
+
|
| 550 |
+
if ( $datetime && $datetime instanceof DateTime ) {
|
| 551 |
+
$tz = $datetime->getTimezone();
|
| 552 |
+
$tzstring = $tz->getName();
|
| 553 |
+
$meta_value = $datetime->getTimestamp() + $tz->getOffset( new DateTime( 'NOW' ) );
|
| 554 |
+
}
|
| 555 |
+
|
| 556 |
+
$inputs = array(
|
| 557 |
+
$this->text_datetime_timestamp( $meta_value ),
|
| 558 |
+
$this->select( array(
|
| 559 |
+
'class' => 'cmb2_select cmb2-select-timezone',
|
| 560 |
+
'name' => $this->_name( '[timezone]' ),
|
| 561 |
+
'id' => $this->_id( '_timezone' ),
|
| 562 |
+
'options' => wp_timezone_choice( $tzstring ),
|
| 563 |
+
'desc' => $this->_desc(),
|
| 564 |
+
) ),
|
| 565 |
+
);
|
| 566 |
+
|
| 567 |
+
return implode( "\n", $inputs );
|
| 568 |
+
}
|
| 569 |
+
|
| 570 |
+
public function select_timezone() {
|
| 571 |
+
$this->field->args['default'] = $this->field->args( 'default' )
|
| 572 |
+
? $this->field->args( 'default' )
|
| 573 |
+
: cmb2_utils()->timezone_string();
|
| 574 |
+
|
| 575 |
+
return $this->select( array(
|
| 576 |
+
'class' => 'cmb2_select cmb2-select-timezone',
|
| 577 |
+
'options' => wp_timezone_choice( $this->field->escaped_value() ),
|
| 578 |
+
'desc' => $this->_desc(),
|
| 579 |
+
) );
|
| 580 |
+
}
|
| 581 |
+
|
| 582 |
+
public function colorpicker() {
|
| 583 |
+
$meta_value = $this->field->escaped_value();
|
| 584 |
+
$hex_color = '(([a-fA-F0-9]){3}){1,2}$';
|
| 585 |
+
if ( preg_match( '/^' . $hex_color . '/i', $meta_value ) ) {
|
| 586 |
+
// Value is just 123abc, so prepend #
|
| 587 |
+
$meta_value = '#' . $meta_value;
|
| 588 |
+
} elseif ( ! preg_match( '/^#' . $hex_color . '/i', $meta_value ) ) {
|
| 589 |
+
// Value doesn't match #123abc, so sanitize to just #
|
| 590 |
+
$meta_value = '#';
|
| 591 |
+
}
|
| 592 |
+
|
| 593 |
+
return $this->input( array( 'class' => 'cmb2-colorpicker cmb2-text-small', 'value' => $meta_value ) );
|
| 594 |
+
}
|
| 595 |
+
|
| 596 |
+
public function title( $args = array() ) {
|
| 597 |
+
$a = $this->parse_args( $args, 'title', array(
|
| 598 |
+
'tag' => $this->field->object_type == 'post' ? 'h5' : 'h3',
|
| 599 |
+
'class' => 'cmb2-metabox-title',
|
| 600 |
+
'name' => $this->field->args( 'name' ),
|
| 601 |
+
'desc' => $this->_desc( true ),
|
| 602 |
+
) );
|
| 603 |
+
|
| 604 |
+
return sprintf( '<%1$s class="%2$s">%3$s</%1$s>%4$s', $a['tag'], $a['class'], $a['name'], $a['desc'] );
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
public function select( $args = array() ) {
|
| 608 |
+
$a = $this->parse_args( $args, 'select', array(
|
| 609 |
+
'class' => 'cmb2_select',
|
| 610 |
+
'name' => $this->_name(),
|
| 611 |
+
'id' => $this->_id(),
|
| 612 |
+
'desc' => $this->_desc( true ),
|
| 613 |
+
'options' => $this->concat_items(),
|
| 614 |
+
) );
|
| 615 |
+
|
| 616 |
+
$attrs = $this->concat_attrs( $a, array( 'desc', 'options' ) );
|
| 617 |
+
return sprintf( '<select%s>%s</select>%s', $attrs, $a['options'], $a['desc'] );
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
public function taxonomy_select() {
|
| 621 |
+
|
| 622 |
+
$names = $this->get_object_terms();
|
| 623 |
+
$saved_term = is_wp_error( $names ) || empty( $names ) ? $this->field->args( 'default' ) : $names[key( $names )]->slug;
|
| 624 |
+
$terms = get_terms( $this->field->args( 'taxonomy' ), 'hide_empty=0' );
|
| 625 |
+
$options = '';
|
| 626 |
+
|
| 627 |
+
$option_none = $this->field->args( 'show_option_none' );
|
| 628 |
+
if ( ! empty( $option_none ) ) {
|
| 629 |
+
$option_none_value = apply_filters( 'cmb2_taxonomy_select_default_value', '' );
|
| 630 |
+
$option_none_value = apply_filters( "cmb2_taxonomy_select_{$this->_id()}_default_value", $option_none_value );
|
| 631 |
+
|
| 632 |
+
$options .= $this->select_option( array(
|
| 633 |
+
'label' => $option_none,
|
| 634 |
+
'value' => $option_none_value,
|
| 635 |
+
'checked' => $saved_term == $option_none_value,
|
| 636 |
+
) );
|
| 637 |
+
}
|
| 638 |
+
|
| 639 |
+
foreach ( $terms as $term ) {
|
| 640 |
+
$options .= $this->select_option( array(
|
| 641 |
+
'label' => $term->name,
|
| 642 |
+
'value' => $term->slug,
|
| 643 |
+
'checked' => $saved_term == $term->slug,
|
| 644 |
+
) );
|
| 645 |
+
}
|
| 646 |
+
|
| 647 |
+
return $this->select( array( 'options' => $options ) );
|
| 648 |
+
}
|
| 649 |
+
|
| 650 |
+
public function radio( $args = array(), $type = 'radio' ) {
|
| 651 |
+
$a = $this->parse_args( $args, $type, array(
|
| 652 |
+
'class' => 'cmb2-radio-list cmb2-list',
|
| 653 |
+
'options' => $this->concat_items( array( 'label' => 'test', 'method' => 'list_input' ) ),
|
| 654 |
+
'desc' => $this->_desc( true ),
|
| 655 |
+
) );
|
| 656 |
+
|
| 657 |
+
return sprintf( '<ul class="%s">%s</ul>%s', $a['class'], $a['options'], $a['desc'] );
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
public function radio_inline() {
|
| 661 |
+
return $this->radio( array(), 'radio_inline' );
|
| 662 |
+
}
|
| 663 |
+
|
| 664 |
+
public function multicheck( $type = 'checkbox' ) {
|
| 665 |
+
|
| 666 |
+
$classes = false === $this->field->args( 'select_all_button' )
|
| 667 |
+
? 'cmb2-checkbox-list no-select-all cmb2-list'
|
| 668 |
+
: 'cmb2-checkbox-list cmb2-list';
|
| 669 |
+
|
| 670 |
+
return $this->radio( array( 'class' => $classes, 'options' => $this->concat_items( array( 'name' => $this->_name() . '[]', 'method' => 'list_input_checkbox' ) ) ), $type );
|
| 671 |
+
}
|
| 672 |
+
|
| 673 |
+
public function multicheck_inline() {
|
| 674 |
+
$this->multicheck( 'multicheck_inline' );
|
| 675 |
+
}
|
| 676 |
+
|
| 677 |
+
public function checkbox() {
|
| 678 |
+
$meta_value = $this->field->escaped_value();
|
| 679 |
+
$args = array( 'type' => 'checkbox', 'class' => 'cmb2-option cmb2-list', 'value' => 'on', 'desc' => '' );
|
| 680 |
+
if ( ! empty( $meta_value ) ) {
|
| 681 |
+
$args['checked'] = 'checked';
|
| 682 |
+
}
|
| 683 |
+
return sprintf( '%s <label for="%s">%s</label>', $this->input( $args ), $this->_id(), $this->_desc() );
|
| 684 |
+
}
|
| 685 |
+
|
| 686 |
+
public function taxonomy_radio() {
|
| 687 |
+
$names = $this->get_object_terms();
|
| 688 |
+
$saved_term = is_wp_error( $names ) || empty( $names ) ? $this->field->args( 'default' ) : $names[key( $names )]->slug;
|
| 689 |
+
$terms = get_terms( $this->field->args( 'taxonomy' ), 'hide_empty=0' );
|
| 690 |
+
$options = ''; $i = 1;
|
| 691 |
+
|
| 692 |
+
if ( ! $terms ) {
|
| 693 |
+
$options .= sprintf( '<li><label>%s</label></li>', esc_html( $this->_text( 'no_terms_text', __( 'No terms', 'cmb2' ) ) ) );
|
| 694 |
+
} else {
|
| 695 |
+
$option_none = $this->field->args( 'show_option_none' );
|
| 696 |
+
if ( ! empty( $option_none ) ) {
|
| 697 |
+
$option_none_value = apply_filters( "cmb2_taxonomy_radio_{$this->_id()}_default_value", apply_filters( 'cmb2_taxonomy_radio_default_value', '' ) );
|
| 698 |
+
$args = array(
|
| 699 |
+
'value' => $option_none_value,
|
| 700 |
+
'label' => $option_none,
|
| 701 |
+
);
|
| 702 |
+
if ( $saved_term == $option_none_value ) {
|
| 703 |
+
$args['checked'] = 'checked';
|
| 704 |
+
}
|
| 705 |
+
$options .= $this->list_input( $args, $i );
|
| 706 |
+
$i++;
|
| 707 |
+
}
|
| 708 |
+
|
| 709 |
+
foreach ( $terms as $term ) {
|
| 710 |
+
$args = array(
|
| 711 |
+
'value' => $term->slug,
|
| 712 |
+
'label' => $term->name,
|
| 713 |
+
);
|
| 714 |
+
|
| 715 |
+
if ( $saved_term == $term->slug ) {
|
| 716 |
+
$args['checked'] = 'checked';
|
| 717 |
+
}
|
| 718 |
+
$options .= $this->list_input( $args, $i );
|
| 719 |
+
$i++;
|
| 720 |
+
}
|
| 721 |
+
}
|
| 722 |
+
|
| 723 |
+
return $this->radio( array( 'options' => $options ), 'taxonomy_radio' );
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
public function taxonomy_radio_inline() {
|
| 727 |
+
$this->taxonomy_radio();
|
| 728 |
+
}
|
| 729 |
+
|
| 730 |
+
public function taxonomy_multicheck() {
|
| 731 |
+
|
| 732 |
+
$names = $this->get_object_terms();
|
| 733 |
+
$saved_terms = is_wp_error( $names ) || empty( $names )
|
| 734 |
+
? $this->field->args( 'default' )
|
| 735 |
+
: wp_list_pluck( $names, 'slug' );
|
| 736 |
+
$terms = get_terms( $this->field->args( 'taxonomy' ), 'hide_empty=0' );
|
| 737 |
+
$name = $this->_name() . '[]';
|
| 738 |
+
$options = ''; $i = 1;
|
| 739 |
+
|
| 740 |
+
if ( ! $terms ) {
|
| 741 |
+
$options .= sprintf( '<li><label>%s</label></li>', esc_html( $this->_text( 'no_terms_text', __( 'No terms', 'cmb2' ) ) ) );
|
| 742 |
+
} else {
|
| 743 |
+
|
| 744 |
+
foreach ( $terms as $term ) {
|
| 745 |
+
$args = array(
|
| 746 |
+
'value' => $term->slug,
|
| 747 |
+
'label' => $term->name,
|
| 748 |
+
'type' => 'checkbox',
|
| 749 |
+
'name' => $name,
|
| 750 |
+
);
|
| 751 |
+
|
| 752 |
+
if ( is_array( $saved_terms ) && in_array( $term->slug, $saved_terms ) ) {
|
| 753 |
+
$args['checked'] = 'checked';
|
| 754 |
+
}
|
| 755 |
+
$options .= $this->list_input( $args, $i );
|
| 756 |
+
$i++;
|
| 757 |
+
}
|
| 758 |
+
}
|
| 759 |
+
|
| 760 |
+
$classes = false === $this->field->args( 'select_all_button' )
|
| 761 |
+
? 'cmb2-checkbox-list no-select-all cmb2-list'
|
| 762 |
+
: 'cmb2-checkbox-list cmb2-list';
|
| 763 |
+
|
| 764 |
+
return $this->radio( array( 'class' => $classes, 'options' => $options ), 'taxonomy_multicheck' );
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
public function taxonomy_multicheck_inline() {
|
| 768 |
+
$this->taxonomy_multicheck();
|
| 769 |
+
}
|
| 770 |
+
|
| 771 |
+
public function oembed() {
|
| 772 |
+
$meta_value = trim( $this->field->escaped_value() );
|
| 773 |
+
$oembed = ! empty( $meta_value )
|
| 774 |
+
? cmb2_get_oembed( array(
|
| 775 |
+
'url' => $this->field->escaped_value(),
|
| 776 |
+
'object_id' => $this->field->object_id,
|
| 777 |
+
'object_type' => $this->field->object_type,
|
| 778 |
+
'oembed_args' => array( 'width' => '640' ),
|
| 779 |
+
'field_id' => $this->_id(),
|
| 780 |
+
) )
|
| 781 |
+
: '';
|
| 782 |
+
|
| 783 |
+
echo $this->input( array(
|
| 784 |
+
'class' => 'cmb2-oembed regular-text',
|
| 785 |
+
'data-objectid' => $this->field->object_id,
|
| 786 |
+
'data-objecttype' => $this->field->object_type,
|
| 787 |
+
) ),
|
| 788 |
+
'<p class="cmb-spinner spinner" style="display:none;"></p>',
|
| 789 |
+
'<div id="', $this->_id( '-status' ), '" class="cmb2-media-status ui-helper-clearfix embed_wrap">', $oembed, '</div>';
|
| 790 |
+
}
|
| 791 |
+
|
| 792 |
+
public function file_list() {
|
| 793 |
+
$meta_value = $this->field->escaped_value();
|
| 794 |
+
$name = $this->_name();
|
| 795 |
+
$img_size = $this->field->args( 'preview_size' );
|
| 796 |
+
|
| 797 |
+
echo $this->input( array(
|
| 798 |
+
'type' => 'hidden',
|
| 799 |
+
'class' => 'cmb2-upload-file cmb2-upload-list',
|
| 800 |
+
'size' => 45, 'desc' => '', 'value' => '',
|
| 801 |
+
'data-previewsize' => is_array( $img_size ) ? sprintf( '[%s]', implode( ',', $img_size ) ) : 50,
|
| 802 |
+
) ),
|
| 803 |
+
$this->input( array(
|
| 804 |
+
'type' => 'button',
|
| 805 |
+
'class' => 'cmb2-upload-button button cmb2-upload-list',
|
| 806 |
+
'value' => esc_html( $this->_text( 'add_upload_files_text', __( 'Add or Upload Files', 'cmb2' ) ) ),
|
| 807 |
+
'name' => '', 'id' => '',
|
| 808 |
+
) );
|
| 809 |
+
|
| 810 |
+
echo '<ul id="', $this->_id( '-status' ), '" class="cmb2-media-status cmb-attach-list">';
|
| 811 |
+
|
| 812 |
+
if ( $meta_value && is_array( $meta_value ) ) {
|
| 813 |
+
|
| 814 |
+
foreach ( $meta_value as $id => $fullurl ) {
|
| 815 |
+
$id_input = $this->input( array(
|
| 816 |
+
'type' => 'hidden',
|
| 817 |
+
'value' => $fullurl,
|
| 818 |
+
'name' => $name . '[' . $id . ']',
|
| 819 |
+
'id' => 'filelist-' . $id,
|
| 820 |
+
'data-id' => $id,
|
| 821 |
+
'desc' => '',
|
| 822 |
+
'class' => false,
|
| 823 |
+
) );
|
| 824 |
+
|
| 825 |
+
if ( $this->is_valid_img_ext( $fullurl ) ) {
|
| 826 |
+
|
| 827 |
+
$this->img_status_output( array(
|
| 828 |
+
'image' => wp_get_attachment_image( $id, $img_size ),
|
| 829 |
+
'tag' => 'li',
|
| 830 |
+
'id_input' => $id_input,
|
| 831 |
+
) );
|
| 832 |
+
|
| 833 |
+
} else {
|
| 834 |
+
|
| 835 |
+
$this->file_status_output( array(
|
| 836 |
+
'value' => $fullurl,
|
| 837 |
+
'tag' => 'li',
|
| 838 |
+
'id_input' => $id_input,
|
| 839 |
+
) );
|
| 840 |
+
|
| 841 |
+
}
|
| 842 |
+
}
|
| 843 |
+
}
|
| 844 |
+
|
| 845 |
+
echo '</ul>';
|
| 846 |
+
}
|
| 847 |
+
|
| 848 |
+
public function file() {
|
| 849 |
+
$meta_value = $this->field->escaped_value();
|
| 850 |
+
$options = (array) $this->field->options();
|
| 851 |
+
$img_size = $this->field->args( 'preview_size' );
|
| 852 |
+
|
| 853 |
+
// if options array and 'url' => false, then hide the url field
|
| 854 |
+
$input_type = array_key_exists( 'url', $options ) && false === $options['url'] ? 'hidden' : 'text';
|
| 855 |
+
|
| 856 |
+
echo $this->input( array(
|
| 857 |
+
'type' => $input_type,
|
| 858 |
+
'class' => 'cmb2-upload-file regular-text',
|
| 859 |
+
'size' => 45,
|
| 860 |
+
'desc' => '',
|
| 861 |
+
'data-previewsize' => is_array( $img_size ) ? '[' . implode( ',', $img_size ) . ']' : 350,
|
| 862 |
+
) );
|
| 863 |
+
|
| 864 |
+
printf( '<input class="cmb2-upload-button button" type="button" value="%s" />', esc_attr( $this->_text( 'add_upload_file_text', __( 'Add or Upload File', 'cmb2' ) ) ) );
|
| 865 |
+
|
| 866 |
+
$this->_desc( true, true );
|
| 867 |
+
|
| 868 |
+
$cached_id = $this->_id();
|
| 869 |
+
// Reset field args for attachment ID
|
| 870 |
+
$args = $this->field->args();
|
| 871 |
+
$args['id'] = $cached_id . '_id';
|
| 872 |
+
unset( $args['_id'], $args['_name'] );
|
| 873 |
+
|
| 874 |
+
// And get new field object
|
| 875 |
+
$this->field = new CMB2_Field( array(
|
| 876 |
+
'field_args' => $args,
|
| 877 |
+
'group_field' => $this->field->group,
|
| 878 |
+
'object_type' => $this->field->object_type,
|
| 879 |
+
'object_id' => $this->field->object_id,
|
| 880 |
+
) );
|
| 881 |
+
|
| 882 |
+
// Get ID value
|
| 883 |
+
$_id_value = $this->field->escaped_value( 'absint' );
|
| 884 |
+
|
| 885 |
+
// If there is no ID saved yet, try to get it from the url
|
| 886 |
+
if ( $meta_value && ! $_id_value ) {
|
| 887 |
+
$_id_value = cmb2_utils()->image_id_from_url( esc_url_raw( $meta_value ) );
|
| 888 |
+
}
|
| 889 |
+
|
| 890 |
+
echo $this->input( array(
|
| 891 |
+
'type' => 'hidden',
|
| 892 |
+
'class' => 'cmb2-upload-file-id',
|
| 893 |
+
'value' => $_id_value,
|
| 894 |
+
'desc' => '',
|
| 895 |
+
) ),
|
| 896 |
+
'<div id="', $this->_id( '-status' ), '" class="cmb2-media-status">';
|
| 897 |
+
if ( ! empty( $meta_value ) ) {
|
| 898 |
+
|
| 899 |
+
if ( $this->is_valid_img_ext( $meta_value ) ) {
|
| 900 |
+
|
| 901 |
+
if ( $_id_value ) {
|
| 902 |
+
$image = wp_get_attachment_image( $_id_value, $img_size, null, array( 'class' => 'cmb-file-field-image' ) );
|
| 903 |
+
} else {
|
| 904 |
+
$size = is_array( $img_size ) ? $img_size[0] : 350;
|
| 905 |
+
$image = '<img style="max-width: ' . absint( $size ) . 'px; width: 100%; height: auto;" src="' . $meta_value . '" alt="" />';
|
| 906 |
+
}
|
| 907 |
+
|
| 908 |
+
$this->img_status_output( array(
|
| 909 |
+
'image' => $image,
|
| 910 |
+
'tag' => 'div',
|
| 911 |
+
'cached_id' => $cached_id,
|
| 912 |
+
) );
|
| 913 |
+
|
| 914 |
+
} else {
|
| 915 |
+
|
| 916 |
+
$this->file_status_output( array(
|
| 917 |
+
'value' => $meta_value,
|
| 918 |
+
'tag' => 'div',
|
| 919 |
+
'cached_id' => $cached_id,
|
| 920 |
+
) );
|
| 921 |
+
|
| 922 |
+
}
|
| 923 |
+
}
|
| 924 |
+
echo '</div>';
|
| 925 |
+
}
|
| 926 |
+
|
| 927 |
+
/**
|
| 928 |
+
* file/file_list image wrap
|
| 929 |
+
* @since 2.0.2
|
| 930 |
+
* @param array $args Array of arguments for output
|
| 931 |
+
* @return string Image wrap output
|
| 932 |
+
*/
|
| 933 |
+
public function img_status_output( $args ) {
|
| 934 |
+
printf( '<%1$s class="img-status">%2$s<p class="cmb2-remove-wrapper"><a href="#" class="cmb2-remove-file-button"%3$s>%4$s</a></p>%5$s</%1$s>',
|
| 935 |
+
$args['tag'],
|
| 936 |
+
$args['image'],
|
| 937 |
+
isset( $args['cached_id'] ) ? ' rel="' . $args['cached_id'] . '"' : '',
|
| 938 |
+
esc_html( $this->_text( 'remove_image_text', __( 'Remove Image', 'cmb2' ) ) ),
|
| 939 |
+
isset( $args['id_input'] ) ? $args['id_input'] : ''
|
| 940 |
+
);
|
| 941 |
+
}
|
| 942 |
+
|
| 943 |
+
/**
|
| 944 |
+
* file/file_list file wrap
|
| 945 |
+
* @since 2.0.2
|
| 946 |
+
* @param array $args Array of arguments for output
|
| 947 |
+
* @return string File wrap output
|
| 948 |
+
*/
|
| 949 |
+
public function file_status_output( $args ) {
|
| 950 |
+
printf( '<%1$s class="file-status"><span>%2$s <strong>%3$s</strong></span> (<a href="%4$s" target="_blank" rel="external">%5$s</a> / <a href="#" class="cmb2-remove-file-button"%6$s>%7$s</a>)%8$s</%1$s>',
|
| 951 |
+
$args['tag'],
|
| 952 |
+
esc_html( $this->_text( 'file_text', __( 'File:', 'cmb2' ) ) ),
|
| 953 |
+
$this->get_file_name_from_path( $args['value'] ),
|
| 954 |
+
$args['value'],
|
| 955 |
+
esc_html( $this->_text( 'file-download-text', __( 'Download', 'cmb2' ) ) ),
|
| 956 |
+
isset( $args['cached_id'] ) ? ' rel="' . $args['cached_id'] . '"' : '',
|
| 957 |
+
esc_html( $this->_text( 'remove_text', __( 'Remove', 'cmb2' ) ) ),
|
| 958 |
+
isset( $args['id_input'] ) ? $args['id_input'] : ''
|
| 959 |
+
);
|
| 960 |
+
}
|
| 961 |
+
|
| 962 |
+
}
|
cmb2/includes/CMB2_Utils.php
ADDED
|
@@ -0,0 +1,181 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* CMB field class
|
| 5 |
+
* @since 1.1.0
|
| 6 |
+
*/
|
| 7 |
+
class CMB2_Utils {
|
| 8 |
+
|
| 9 |
+
/**
|
| 10 |
+
* The url which is used to load local resources.
|
| 11 |
+
* @var string
|
| 12 |
+
* @since 2.0.0
|
| 13 |
+
*/
|
| 14 |
+
protected $url = '';
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* Utility method that attempts to get an attachment's ID by it's url
|
| 18 |
+
* @since 1.0.0
|
| 19 |
+
* @param string $img_url Attachment url
|
| 20 |
+
* @return mixed Attachment ID or false
|
| 21 |
+
*/
|
| 22 |
+
public function image_id_from_url( $img_url ) {
|
| 23 |
+
global $wpdb;
|
| 24 |
+
|
| 25 |
+
$img_url = esc_url_raw( $img_url );
|
| 26 |
+
// Get just the file name
|
| 27 |
+
if ( false !== strpos( $img_url, '/' ) ) {
|
| 28 |
+
$explode = explode( '/', $img_url );
|
| 29 |
+
$img_url = end( $explode );
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
// And search for a fuzzy match of the file name
|
| 33 |
+
$attachment = $wpdb->get_col( $wpdb->prepare( "SELECT ID FROM $wpdb->posts WHERE guid LIKE '%%%s%%' LIMIT 1;", $img_url ) );
|
| 34 |
+
|
| 35 |
+
// If we found an attachement ID, return it
|
| 36 |
+
if ( ! empty( $attachment ) && is_array( $attachment ) ) {
|
| 37 |
+
return $attachment[0];
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
// No luck
|
| 41 |
+
return false;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
/**
|
| 45 |
+
* Utility method that returns time string offset by timezone
|
| 46 |
+
* @since 1.0.0
|
| 47 |
+
* @param string $tzstring Time string
|
| 48 |
+
* @return string Offset time string
|
| 49 |
+
*/
|
| 50 |
+
public function timezone_offset( $tzstring ) {
|
| 51 |
+
if ( ! empty( $tzstring ) && is_string( $tzstring ) ) {
|
| 52 |
+
if ( 'UTC' === substr( $tzstring, 0, 3 ) ) {
|
| 53 |
+
$tzstring = str_replace( array( ':15', ':30', ':45' ), array( '.25', '.5', '.75' ), $tzstring );
|
| 54 |
+
return intval( floatval( substr( $tzstring, 3 ) ) * HOUR_IN_SECONDS );
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
$date_time_zone_selected = new DateTimeZone( $tzstring );
|
| 58 |
+
$tz_offset = timezone_offset_get( $date_time_zone_selected, date_create() );
|
| 59 |
+
|
| 60 |
+
return $tz_offset;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
return 0;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
/**
|
| 67 |
+
* Utility method that returns a timezone string representing the default timezone for the site.
|
| 68 |
+
*
|
| 69 |
+
* Roughly copied from WordPress, as get_option('timezone_string') will return
|
| 70 |
+
* an empty string if no value has been set on the options page.
|
| 71 |
+
* A timezone string is required by the wp_timezone_choice() used by the
|
| 72 |
+
* select_timezone field.
|
| 73 |
+
*
|
| 74 |
+
* @since 1.0.0
|
| 75 |
+
* @return string Timezone string
|
| 76 |
+
*/
|
| 77 |
+
public function timezone_string() {
|
| 78 |
+
$current_offset = get_option( 'gmt_offset' );
|
| 79 |
+
$tzstring = get_option( 'timezone_string' );
|
| 80 |
+
|
| 81 |
+
if ( empty( $tzstring ) ) { // Create a UTC+- zone if no timezone string exists
|
| 82 |
+
if ( 0 == $current_offset ) {
|
| 83 |
+
$tzstring = 'UTC+0';
|
| 84 |
+
} elseif ( $current_offset < 0 ) {
|
| 85 |
+
$tzstring = 'UTC' . $current_offset;
|
| 86 |
+
} else {
|
| 87 |
+
$tzstring = 'UTC+' . $current_offset;
|
| 88 |
+
}
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
return $tzstring;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
/**
|
| 95 |
+
* Returns a timestamp, first checking if value already is a timestamp.
|
| 96 |
+
* @since 2.0.0
|
| 97 |
+
* @param string|int $string Possible timestamp string
|
| 98 |
+
* @return int Time stamp
|
| 99 |
+
*/
|
| 100 |
+
public function make_valid_time_stamp( $string ) {
|
| 101 |
+
if ( ! $string ) {
|
| 102 |
+
return 0;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
return $this->is_valid_time_stamp( $string )
|
| 106 |
+
? (int) $string :
|
| 107 |
+
strtotime( $string );
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Determine if a value is a valid timestamp
|
| 112 |
+
* @since 2.0.0
|
| 113 |
+
* @param mixed $timestamp Value to check
|
| 114 |
+
* @return boolean Whether value is a valid timestamp
|
| 115 |
+
*/
|
| 116 |
+
public function is_valid_time_stamp( $timestamp ) {
|
| 117 |
+
return (string) (int) $timestamp === (string) $timestamp
|
| 118 |
+
&& $timestamp <= PHP_INT_MAX
|
| 119 |
+
&& $timestamp >= ~PHP_INT_MAX;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
/**
|
| 123 |
+
* Checks if a value is 'empty'. Still accepts 0.
|
| 124 |
+
* @since 2.0.0
|
| 125 |
+
* @param mixed $value Value to check
|
| 126 |
+
* @return bool True or false
|
| 127 |
+
*/
|
| 128 |
+
public function isempty( $value ) {
|
| 129 |
+
return is_null( $value ) || '' === $value || false === $value;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
/**
|
| 133 |
+
* Insert a single array item inside another array at a set position
|
| 134 |
+
* @since 2.0.2
|
| 135 |
+
* @param array &$array Array to modify. Is passed by reference, and no return is needed.
|
| 136 |
+
* @param array $new New array to insert
|
| 137 |
+
* @param int $position Position in the main array to insert the new array
|
| 138 |
+
*/
|
| 139 |
+
public function array_insert( &$array, $new, $position ) {
|
| 140 |
+
$before = array_slice( $array, 0, $position - 1 );
|
| 141 |
+
$after = array_diff_key( $array, $before );
|
| 142 |
+
$array = array_merge( $before, $new, $after );
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
/**
|
| 146 |
+
* Defines the url which is used to load local resources.
|
| 147 |
+
* This may need to be filtered for local Window installations.
|
| 148 |
+
* If resources do not load, please check the wiki for details.
|
| 149 |
+
* @since 1.0.1
|
| 150 |
+
* @return string URL to CMB resources
|
| 151 |
+
*/
|
| 152 |
+
public function url( $path = '' ) {
|
| 153 |
+
if ( $this->url ) {
|
| 154 |
+
return $this->url . $path;
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
if ( 'WIN' === strtoupper( substr( PHP_OS, 0, 3 ) ) ) {
|
| 158 |
+
// Windows
|
| 159 |
+
$content_dir = str_replace( '/', DIRECTORY_SEPARATOR, WP_CONTENT_DIR );
|
| 160 |
+
$content_url = str_replace( $content_dir, WP_CONTENT_URL, cmb2_dir() );
|
| 161 |
+
$cmb2_url = str_replace( DIRECTORY_SEPARATOR, '/', $content_url );
|
| 162 |
+
|
| 163 |
+
} else {
|
| 164 |
+
$cmb2_url = str_replace(
|
| 165 |
+
array( WP_CONTENT_DIR, WP_PLUGIN_DIR ),
|
| 166 |
+
array( WP_CONTENT_URL, WP_PLUGIN_URL ),
|
| 167 |
+
cmb2_dir()
|
| 168 |
+
);
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
/**
|
| 172 |
+
* Filter the CMB location url
|
| 173 |
+
*
|
| 174 |
+
* @param string $cmb2_url Currently registered url
|
| 175 |
+
*/
|
| 176 |
+
$this->url = trailingslashit( apply_filters( 'cmb2_meta_box_url', set_url_scheme( $cmb2_url ), CMB2_VERSION ) );
|
| 177 |
+
|
| 178 |
+
return $this->url . $path;
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
}
|
cmb2/includes/CMB2_hookup.php
ADDED
|
@@ -0,0 +1,395 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class CMB2_hookup {
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* Metabox Form ID
|
| 7 |
+
* @var string
|
| 8 |
+
* @since 0.9.4
|
| 9 |
+
*/
|
| 10 |
+
protected $form_id = 'post';
|
| 11 |
+
|
| 12 |
+
/**
|
| 13 |
+
* Array of all hooks done (to be run once)
|
| 14 |
+
* @var array
|
| 15 |
+
* @since 2.0.0
|
| 16 |
+
*/
|
| 17 |
+
protected static $hooks_completed = array();
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* Only allow JS registration once
|
| 21 |
+
* @var bool
|
| 22 |
+
* @since 2.0.0
|
| 23 |
+
*/
|
| 24 |
+
protected static $registration_done = false;
|
| 25 |
+
|
| 26 |
+
/**
|
| 27 |
+
* Metabox Form ID
|
| 28 |
+
* @var CMB2 object
|
| 29 |
+
* @since 2.0.2
|
| 30 |
+
*/
|
| 31 |
+
protected $cmb;
|
| 32 |
+
|
| 33 |
+
public function __construct( CMB2 $cmb ) {
|
| 34 |
+
$this->cmb = $cmb;
|
| 35 |
+
|
| 36 |
+
$this->hooks();
|
| 37 |
+
if ( is_admin() ) {
|
| 38 |
+
$this->admin_hooks();
|
| 39 |
+
}
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
public function hooks() {
|
| 43 |
+
// Handle oembed Ajax
|
| 44 |
+
$this->once( 'wp_ajax_cmb2_oembed_handler', array( cmb2_ajax(), 'oembed_handler' ) );
|
| 45 |
+
$this->once( 'wp_ajax_nopriv_cmb2_oembed_handler', array( cmb2_ajax(), 'oembed_handler' ) );
|
| 46 |
+
|
| 47 |
+
foreach ( get_class_methods( 'CMB2_Show_Filters' ) as $filter ) {
|
| 48 |
+
add_filter( 'cmb2_show_on', array( 'CMB2_Show_Filters', $filter ), 10, 3 );
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
public function admin_hooks() {
|
| 54 |
+
|
| 55 |
+
$field_types = (array) wp_list_pluck( $this->cmb->prop( 'fields', array() ), 'type' );
|
| 56 |
+
$has_upload = in_array( 'file', $field_types ) || in_array( 'file_list', $field_types );
|
| 57 |
+
|
| 58 |
+
global $pagenow;
|
| 59 |
+
|
| 60 |
+
// register our scripts and styles for cmb
|
| 61 |
+
$this->once( 'admin_enqueue_scripts', array( __CLASS__, 'register_scripts' ), 8 );
|
| 62 |
+
|
| 63 |
+
$type = $this->cmb->mb_object_type();
|
| 64 |
+
if ( 'post' == $type ) {
|
| 65 |
+
add_action( 'add_meta_boxes', array( $this, 'add_metaboxes' ) );
|
| 66 |
+
add_action( 'add_attachment', array( $this, 'save_post' ) );
|
| 67 |
+
add_action( 'edit_attachment', array( $this, 'save_post' ) );
|
| 68 |
+
add_action( 'save_post', array( $this, 'save_post' ), 10, 2 );
|
| 69 |
+
|
| 70 |
+
$this->once( 'admin_enqueue_scripts', array( $this, 'do_scripts' ) );
|
| 71 |
+
|
| 72 |
+
if ( $has_upload && in_array( $pagenow, array( 'page.php', 'page-new.php', 'post.php', 'post-new.php' ) ) ) {
|
| 73 |
+
$this->once( 'admin_head', array( $this, 'add_post_enctype' ) );
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
} elseif ( 'user' == $type ) {
|
| 77 |
+
|
| 78 |
+
$priority = $this->cmb->prop( 'priority' );
|
| 79 |
+
|
| 80 |
+
if ( ! is_numeric( $priority ) ) {
|
| 81 |
+
switch ( $priority ) {
|
| 82 |
+
|
| 83 |
+
case 'high':
|
| 84 |
+
$priority = 5;
|
| 85 |
+
break;
|
| 86 |
+
|
| 87 |
+
case 'low':
|
| 88 |
+
$priority = 20;
|
| 89 |
+
break;
|
| 90 |
+
|
| 91 |
+
default:
|
| 92 |
+
$priority = 10;
|
| 93 |
+
break;
|
| 94 |
+
}
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
add_action( 'show_user_profile', array( $this, 'user_metabox' ), $priority );
|
| 98 |
+
add_action( 'edit_user_profile', array( $this, 'user_metabox' ), $priority );
|
| 99 |
+
add_action( 'user_new_form', array( $this, 'user_new_metabox' ), $priority );
|
| 100 |
+
|
| 101 |
+
add_action( 'personal_options_update', array( $this, 'save_user' ) );
|
| 102 |
+
add_action( 'edit_user_profile_update', array( $this, 'save_user' ) );
|
| 103 |
+
add_action( 'user_register', array( $this, 'save_user' ) );
|
| 104 |
+
if ( $has_upload && in_array( $pagenow, array( 'profile.php', 'user-edit.php', 'user-add.php' ) ) ) {
|
| 105 |
+
$this->form_id = 'your-profile';
|
| 106 |
+
$this->once( 'admin_head', array( $this, 'add_post_enctype' ) );
|
| 107 |
+
}
|
| 108 |
+
}
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
/**
|
| 112 |
+
* Registers scripts and styles for CMB
|
| 113 |
+
* @since 1.0.0
|
| 114 |
+
*/
|
| 115 |
+
public static function register_scripts() {
|
| 116 |
+
if ( self::$registration_done ) {
|
| 117 |
+
return;
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
// Only use minified files if SCRIPT_DEBUG is off
|
| 121 |
+
$min = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ? '' : '.min';
|
| 122 |
+
|
| 123 |
+
if ( ! is_admin() ) {
|
| 124 |
+
// we need to register colorpicker on the front-end
|
| 125 |
+
wp_register_script( 'iris', admin_url( 'js/iris.min.js' ), array( 'jquery-ui-draggable', 'jquery-ui-slider', 'jquery-touch-punch' ), CMB2_VERSION );
|
| 126 |
+
wp_register_script( 'wp-color-picker', admin_url( 'js/color-picker.min.js' ), array( 'iris' ), CMB2_VERSION );
|
| 127 |
+
wp_localize_script( 'wp-color-picker', 'wpColorPickerL10n', array(
|
| 128 |
+
'clear' => __( 'Clear', 'cmb2' ),
|
| 129 |
+
'defaultString' => __( 'Default', 'cmb2' ),
|
| 130 |
+
'pick' => __( 'Select Color', 'cmb2' ),
|
| 131 |
+
'current' => __( 'Current Color', 'cmb2' ),
|
| 132 |
+
) );
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
wp_register_script( 'cmb-timepicker', cmb2_utils()->url( 'js/jquery.timePicker.min.js' ) );
|
| 136 |
+
|
| 137 |
+
// scripts required for cmb
|
| 138 |
+
$scripts = array( 'jquery', 'jquery-ui-core', 'jquery-ui-datepicker', 'cmb-timepicker', 'wp-color-picker' );
|
| 139 |
+
// styles required for cmb
|
| 140 |
+
$styles = array( 'wp-color-picker' );
|
| 141 |
+
|
| 142 |
+
wp_register_script( 'cmb2-scripts', cmb2_utils()->url( "js/cmb2{$min}.js" ), $scripts, CMB2_VERSION );
|
| 143 |
+
|
| 144 |
+
wp_localize_script( 'cmb2-scripts', 'cmb2_l10', apply_filters( 'cmb2_localized_data', array(
|
| 145 |
+
'ajax_nonce' => wp_create_nonce( 'ajax_nonce' ),
|
| 146 |
+
'ajaxurl' => admin_url( '/admin-ajax.php' ),
|
| 147 |
+
'script_debug' => defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG,
|
| 148 |
+
'up_arrow_class' => 'dashicons dashicons-arrow-up-alt2',
|
| 149 |
+
'down_arrow_class' => 'dashicons dashicons-arrow-down-alt2',
|
| 150 |
+
'defaults' => array(
|
| 151 |
+
'color_picker' => false,
|
| 152 |
+
'date_picker' => array(
|
| 153 |
+
'changeMonth' => true,
|
| 154 |
+
'changeYear' => true,
|
| 155 |
+
'dateFormat' => __( 'mm/dd/yy', 'cmb2' ),
|
| 156 |
+
'dayNames' => explode( ',', __( 'Sunday, Monday, Tuesday, Wednesday, Thursday, Friday, Saturday', 'cmb2' ) ),
|
| 157 |
+
'dayNamesMin' => explode( ',', __( 'Su, Mo, Tu, We, Th, Fr, Sa', 'cmb2' ) ),
|
| 158 |
+
'dayNamesShort' => explode( ',', __( 'Sun, Mon, Tue, Wed, Thu, Fri, Sat', 'cmb2' ) ),
|
| 159 |
+
'monthNames' => explode( ',', __( 'January, February, March, April, May, June, July, August, September, October, November, December', 'cmb2' ) ),
|
| 160 |
+
'monthNamesShort' => explode( ',', __( 'Jan, Feb, Mar, Apr, May, Jun, Jul, Aug, Sep, Oct, Nov, Dec', 'cmb2' ) ),
|
| 161 |
+
'nextText' => __( 'Next', 'cmb2' ),
|
| 162 |
+
'prevText' => __( 'Prev', 'cmb2' ),
|
| 163 |
+
'currentText' => __( 'Today', 'cmb2' ),
|
| 164 |
+
'closeText' => __( 'Done', 'cmb2' ),
|
| 165 |
+
'clearText' => __( 'Clear', 'cmb2' ),
|
| 166 |
+
),
|
| 167 |
+
'time_picker' => array(
|
| 168 |
+
'startTime' => '00:00',
|
| 169 |
+
'endTime' => '23:59',
|
| 170 |
+
'show24Hours' => false,
|
| 171 |
+
'separator' => ':',
|
| 172 |
+
'step' => 30,
|
| 173 |
+
),
|
| 174 |
+
),
|
| 175 |
+
'strings' => array(
|
| 176 |
+
'upload_file' => __( 'Use this file', 'cmb2' ),
|
| 177 |
+
'remove_image' => __( 'Remove Image', 'cmb2' ),
|
| 178 |
+
'remove_file' => __( 'Remove', 'cmb2' ),
|
| 179 |
+
'file' => __( 'File:', 'cmb2' ),
|
| 180 |
+
'download' => __( 'Download', 'cmb2' ),
|
| 181 |
+
'check_toggle' => __( 'Select / Deselect All', 'cmb2' ),
|
| 182 |
+
),
|
| 183 |
+
) ) );
|
| 184 |
+
|
| 185 |
+
wp_register_style( 'cmb2-styles', cmb2_utils()->url( "css/cmb2{$min}.css" ), $styles );
|
| 186 |
+
|
| 187 |
+
self::$registration_done = true;
|
| 188 |
+
}
|
| 189 |
+
|
| 190 |
+
/**
|
| 191 |
+
* Enqueues scripts and styles for CMB
|
| 192 |
+
* @since 1.0.0
|
| 193 |
+
*/
|
| 194 |
+
public function do_scripts( $hook ) {
|
| 195 |
+
// only enqueue our scripts/styles on the proper pages
|
| 196 |
+
if ( in_array( $hook, array( 'post.php', 'post-new.php', 'page-new.php', 'page.php' ), true ) ) {
|
| 197 |
+
if ( $this->cmb->prop( 'cmb_styles' ) ) {
|
| 198 |
+
self::enqueue_cmb_css();
|
| 199 |
+
}
|
| 200 |
+
self::enqueue_cmb_js();
|
| 201 |
+
}
|
| 202 |
+
}
|
| 203 |
+
|
| 204 |
+
/**
|
| 205 |
+
* Add encoding attribute
|
| 206 |
+
*/
|
| 207 |
+
public function add_post_enctype() {
|
| 208 |
+
echo '
|
| 209 |
+
<script type="text/javascript">
|
| 210 |
+
jQuery(document).ready(function(){
|
| 211 |
+
$form = jQuery("#' . $this->form_id . '");
|
| 212 |
+
if ( $form.length ) {
|
| 213 |
+
$form.attr( {
|
| 214 |
+
"enctype" : "multipart/form-data",
|
| 215 |
+
"encoding" : "multipart/form-data"
|
| 216 |
+
} );
|
| 217 |
+
}
|
| 218 |
+
});
|
| 219 |
+
</script>';
|
| 220 |
+
}
|
| 221 |
+
|
| 222 |
+
/**
|
| 223 |
+
* Add metaboxes (to 'post' object type)
|
| 224 |
+
*/
|
| 225 |
+
public function add_metaboxes() {
|
| 226 |
+
|
| 227 |
+
if ( ! $this->show_on() ) {
|
| 228 |
+
return;
|
| 229 |
+
}
|
| 230 |
+
|
| 231 |
+
foreach ( $this->cmb->prop( 'object_types' ) as $page ) {
|
| 232 |
+
|
| 233 |
+
if ( $this->cmb->prop( 'closed' ) ) {
|
| 234 |
+
add_filter( "postbox_classes_{$page}_{$this->cmb->cmb_id}", array( $this, 'close_metabox_class' ) );
|
| 235 |
+
}
|
| 236 |
+
|
| 237 |
+
add_meta_box( $this->cmb->cmb_id, $this->cmb->prop( 'title' ), array( $this, 'post_metabox' ), $page, $this->cmb->prop( 'context' ), $this->cmb->prop( 'priority' ) );
|
| 238 |
+
}
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
/**
|
| 242 |
+
* Add 'closed' class to metabox
|
| 243 |
+
* @since 2.0.0
|
| 244 |
+
* @param array $classes Array of classes
|
| 245 |
+
* @return array Modified array of classes
|
| 246 |
+
*/
|
| 247 |
+
public function close_metabox_class( $classes ) {
|
| 248 |
+
$classes[] = 'closed';
|
| 249 |
+
return $classes;
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
/**
|
| 253 |
+
* Display metaboxes for a post object
|
| 254 |
+
* @since 1.0.0
|
| 255 |
+
*/
|
| 256 |
+
public function post_metabox() {
|
| 257 |
+
$this->cmb->show_form( get_the_ID(), 'post' );
|
| 258 |
+
}
|
| 259 |
+
|
| 260 |
+
/**
|
| 261 |
+
* Display metaboxes for new user page
|
| 262 |
+
* @since 1.0.0
|
| 263 |
+
*/
|
| 264 |
+
public function user_new_metabox( $section ) {
|
| 265 |
+
if ( $section == $this->cmb->prop( 'new_user_section' ) ) {
|
| 266 |
+
$object_id = $this->cmb->object_id();
|
| 267 |
+
$this->cmb->object_id( isset( $_REQUEST['user_id'] ) ? $_REQUEST['user_id'] : $object_id );
|
| 268 |
+
$this->user_metabox();
|
| 269 |
+
}
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
/**
|
| 273 |
+
* Display metaboxes for a user object
|
| 274 |
+
* @since 1.0.0
|
| 275 |
+
*/
|
| 276 |
+
public function user_metabox() {
|
| 277 |
+
|
| 278 |
+
if ( 'user' != $this->cmb->mb_object_type() ) {
|
| 279 |
+
return;
|
| 280 |
+
}
|
| 281 |
+
|
| 282 |
+
if ( ! $this->show_on() ) {
|
| 283 |
+
return;
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
if ( $this->cmb->prop( 'cmb_styles' ) ) {
|
| 287 |
+
self::enqueue_cmb_css();
|
| 288 |
+
}
|
| 289 |
+
self::enqueue_cmb_js();
|
| 290 |
+
|
| 291 |
+
$this->cmb->show_form( 0, 'user' );
|
| 292 |
+
}
|
| 293 |
+
|
| 294 |
+
/**
|
| 295 |
+
* Save data from metabox
|
| 296 |
+
*/
|
| 297 |
+
public function save_post( $post_id, $post = false ) {
|
| 298 |
+
|
| 299 |
+
$post_type = $post ? $post->post_type : get_post_type( $post_id );
|
| 300 |
+
|
| 301 |
+
$do_not_pass_go = (
|
| 302 |
+
// check nonce
|
| 303 |
+
! isset( $_POST[ $this->cmb->nonce() ] )
|
| 304 |
+
|| ! wp_verify_nonce( $_POST[ $this->cmb->nonce() ], $this->cmb->nonce() )
|
| 305 |
+
// check if autosave
|
| 306 |
+
|| defined( 'DOING_AUTOSAVE' ) && DOING_AUTOSAVE
|
| 307 |
+
// check user editing permissions
|
| 308 |
+
|| ( 'page' == $post_type && ! current_user_can( 'edit_page', $post_id ) )
|
| 309 |
+
|| ! current_user_can( 'edit_post', $post_id )
|
| 310 |
+
// get the metabox post_types & compare it to this post_type
|
| 311 |
+
|| ! in_array( $post_type, $this->cmb->prop( 'object_types' ) )
|
| 312 |
+
);
|
| 313 |
+
|
| 314 |
+
if ( $do_not_pass_go ) {
|
| 315 |
+
// do not collect $200
|
| 316 |
+
return;
|
| 317 |
+
}
|
| 318 |
+
|
| 319 |
+
// take a trip to reading railroad – if you pass go collect $200
|
| 320 |
+
$this->cmb->save_fields( $post_id, 'post', $_POST );
|
| 321 |
+
}
|
| 322 |
+
|
| 323 |
+
/**
|
| 324 |
+
* Save data from metabox
|
| 325 |
+
*/
|
| 326 |
+
public function save_user( $user_id ) {
|
| 327 |
+
// check permissions
|
| 328 |
+
if (
|
| 329 |
+
// check nonce
|
| 330 |
+
! isset( $_POST[ $this->cmb->nonce() ] )
|
| 331 |
+
|| ! wp_verify_nonce( $_POST[ $this->cmb->nonce() ], $this->cmb->nonce() )
|
| 332 |
+
) {
|
| 333 |
+
// @todo more hardening?
|
| 334 |
+
return;
|
| 335 |
+
}
|
| 336 |
+
|
| 337 |
+
$this->cmb->save_fields( $user_id, 'user', $_POST );
|
| 338 |
+
}
|
| 339 |
+
|
| 340 |
+
/**
|
| 341 |
+
* Determines if metabox should be shown in current context
|
| 342 |
+
* @since 2.0.0
|
| 343 |
+
* @return bool
|
| 344 |
+
*/
|
| 345 |
+
public function show_on() {
|
| 346 |
+
return (bool) apply_filters( 'cmb2_show_on', true, $this->cmb->meta_box, $this->cmb );
|
| 347 |
+
}
|
| 348 |
+
|
| 349 |
+
/**
|
| 350 |
+
* Ensures WordPress hook only gets fired once
|
| 351 |
+
* @since 2.0.0
|
| 352 |
+
* @param string $action The name of the filter to hook the $hook callback to.
|
| 353 |
+
* @param callback $hook The callback to be run when the filter is applied.
|
| 354 |
+
* @param integer $priority Order the functions are executed
|
| 355 |
+
* @param int $accepted_args The number of arguments the function accepts.
|
| 356 |
+
*/
|
| 357 |
+
public function once( $action, $hook, $priority = 10, $accepted_args = 1 ) {
|
| 358 |
+
$key = md5( serialize( func_get_args() ) );
|
| 359 |
+
|
| 360 |
+
if ( in_array( $key, self::$hooks_completed ) ) {
|
| 361 |
+
return;
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
self::$hooks_completed[] = $key;
|
| 365 |
+
add_filter( $action, $hook, $priority, $accepted_args );
|
| 366 |
+
}
|
| 367 |
+
|
| 368 |
+
/**
|
| 369 |
+
* Includes CMB styles
|
| 370 |
+
* @since 2.0.0
|
| 371 |
+
*/
|
| 372 |
+
public static function enqueue_cmb_css() {
|
| 373 |
+
if ( ! apply_filters( 'cmb2_enqueue_css', true ) ) {
|
| 374 |
+
return false;
|
| 375 |
+
}
|
| 376 |
+
|
| 377 |
+
self::register_scripts();
|
| 378 |
+
return wp_enqueue_style( 'cmb2-styles' );
|
| 379 |
+
}
|
| 380 |
+
|
| 381 |
+
/**
|
| 382 |
+
* Includes CMB JS
|
| 383 |
+
* @since 2.0.0
|
| 384 |
+
*/
|
| 385 |
+
public static function enqueue_cmb_js() {
|
| 386 |
+
if ( ! apply_filters( 'cmb2_enqueue_js', true ) ) {
|
| 387 |
+
return false;
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
self::register_scripts();
|
| 391 |
+
wp_enqueue_media();
|
| 392 |
+
return wp_enqueue_script( 'cmb2-scripts' );
|
| 393 |
+
}
|
| 394 |
+
|
| 395 |
+
}
|
cmb2/includes/helper-functions.php
ADDED
|
@@ -0,0 +1,283 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Autoloads files with CMB2 classes when needed
|
| 5 |
+
* @since 1.0.0
|
| 6 |
+
* @param string $class_name Name of the class being requested
|
| 7 |
+
*/
|
| 8 |
+
function cmb2_autoload_classes( $class_name ) {
|
| 9 |
+
if ( class_exists( $class_name, false ) || false === strpos( $class_name, 'CMB2' ) ) {
|
| 10 |
+
return;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
$file = cmb2_dir( "includes/{$class_name}.php" );
|
| 14 |
+
if ( file_exists( $file ) ) {
|
| 15 |
+
include_once( $file );
|
| 16 |
+
}
|
| 17 |
+
}
|
| 18 |
+
spl_autoload_register( 'cmb2_autoload_classes' );
|
| 19 |
+
|
| 20 |
+
/**
|
| 21 |
+
* Get instance of the CMB2_Utils class
|
| 22 |
+
* @since 2.0.0
|
| 23 |
+
* @return CMB2_Utils object CMB utilities class
|
| 24 |
+
*/
|
| 25 |
+
function cmb2_utils() {
|
| 26 |
+
static $cmb2_utils;
|
| 27 |
+
$cmb2_utils = $cmb2_utils ? $cmb2_utils : new CMB2_Utils();
|
| 28 |
+
return $cmb2_utils;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
* Get instance of the CMB2_Ajax class
|
| 33 |
+
* @since 2.0.0
|
| 34 |
+
* @return CMB2_Ajax object CMB utilities class
|
| 35 |
+
*/
|
| 36 |
+
function cmb2_ajax() {
|
| 37 |
+
static $cmb2_ajax;
|
| 38 |
+
$cmb2_ajax = $cmb2_ajax ? $cmb2_ajax : new CMB2_Ajax();
|
| 39 |
+
return $cmb2_ajax;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* Get instance of the CMB2_Option class for the passed metabox ID
|
| 44 |
+
* @since 2.0.0
|
| 45 |
+
* @return CMB2_Option object Options class for setting/getting options for metabox
|
| 46 |
+
*/
|
| 47 |
+
function cmb2_options( $key ) {
|
| 48 |
+
return CMB2_Options::get( $key );
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Get a cmb oEmbed. Handles oEmbed getting for non-post objects
|
| 53 |
+
* @since 2.0.0
|
| 54 |
+
* @param array $args Arguments. Accepts:
|
| 55 |
+
*
|
| 56 |
+
* 'url' - URL to retrieve the oEmbed from,
|
| 57 |
+
* 'object_id' - $post_id,
|
| 58 |
+
* 'object_type' - 'post',
|
| 59 |
+
* 'oembed_args' - $embed_args, // array containing 'width', etc
|
| 60 |
+
* 'field_id' - false,
|
| 61 |
+
* 'cache_key' - false,
|
| 62 |
+
*
|
| 63 |
+
* @return string oEmbed string
|
| 64 |
+
*/
|
| 65 |
+
function cmb2_get_oembed( $args = array() ) {
|
| 66 |
+
return cmb2_ajax()->get_oembed( $args );
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
* A helper function to get an option from a CMB options array
|
| 71 |
+
* @since 1.0.1
|
| 72 |
+
* @param string $option_key Option key
|
| 73 |
+
* @param string $field_id Option array field key
|
| 74 |
+
* @return array Options array or specific field
|
| 75 |
+
*/
|
| 76 |
+
function cmb2_get_option( $option_key, $field_id = '' ) {
|
| 77 |
+
return cmb2_options( $option_key )->get( $field_id );
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* A helper function to update an option in a CMB options array
|
| 82 |
+
* @since 2.0.0
|
| 83 |
+
* @param string $option_key Option key
|
| 84 |
+
* @param string $field_id Option array field key
|
| 85 |
+
* @param mixed $value Value to update data with
|
| 86 |
+
* @param boolean $single Whether data should not be an array
|
| 87 |
+
* @return boolean Success/Failure
|
| 88 |
+
*/
|
| 89 |
+
function cmb2_update_option( $option_key, $field_id, $value, $single = true ) {
|
| 90 |
+
if ( cmb2_options( $option_key )->update( $field_id, $value, false, $single ) ) {
|
| 91 |
+
return cmb2_options( $option_key )->set();
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
return false;
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
* Get a CMB field object.
|
| 99 |
+
* @since 1.1.0
|
| 100 |
+
* @param array $meta_box Metabox ID or Metabox config array
|
| 101 |
+
* @param array $field_id Field ID or all field arguments
|
| 102 |
+
* @param int $object_id Object ID
|
| 103 |
+
* @param string $object_type Type of object being saved. (e.g., post, user, comment, or options-page)
|
| 104 |
+
* @return CMB2_Field|null CMB2_Field object unless metabox config cannot be found
|
| 105 |
+
*/
|
| 106 |
+
function cmb2_get_field( $meta_box, $field_id, $object_id = 0, $object_type = 'post' ) {
|
| 107 |
+
|
| 108 |
+
$object_id = $object_id ? $object_id : get_the_ID();
|
| 109 |
+
$cmb = ( $meta_box instanceof CMB2 ) ? $meta_box : cmb2_get_metabox( $meta_box, $object_id );
|
| 110 |
+
|
| 111 |
+
if ( ! $cmb ) {
|
| 112 |
+
return;
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
$object_type = $object_type ? $object_type : $cmb->mb_object_type();
|
| 116 |
+
$cmb->object_type( $object_type );
|
| 117 |
+
|
| 118 |
+
if ( is_array( $field_id ) && isset( $field_id['id'] ) ) {
|
| 119 |
+
return new CMB2_Field( array(
|
| 120 |
+
'field_args' => $field_id,
|
| 121 |
+
'object_id' => $object_id,
|
| 122 |
+
'object_type' => $object_type,
|
| 123 |
+
) );
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
$fields = (array) $cmb->prop( 'fields' );
|
| 127 |
+
foreach ( $fields as $field ) {
|
| 128 |
+
if ( $field['id'] == $field_id || $field['name'] == $field_id ) {
|
| 129 |
+
// Send back field object
|
| 130 |
+
return new CMB2_Field( array(
|
| 131 |
+
'field_args' => $field,
|
| 132 |
+
'object_id' => $object_id,
|
| 133 |
+
'object_type' => $object_type,
|
| 134 |
+
) );
|
| 135 |
+
|
| 136 |
+
}
|
| 137 |
+
}
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
/**
|
| 141 |
+
* Get a field's value.
|
| 142 |
+
* @since 1.1.0
|
| 143 |
+
* @param array $meta_box Metabox ID or Metabox config array
|
| 144 |
+
* @param array $field_id Field ID or all field arguments
|
| 145 |
+
* @param int $object_id Object ID
|
| 146 |
+
* @param string $object_type Type of object being saved. (e.g., post, user, comment, or options-page)
|
| 147 |
+
* @return mixed Maybe escaped value
|
| 148 |
+
*/
|
| 149 |
+
function cmb2_get_field_value( $meta_box, $field_id, $object_id = 0, $object_type = 'post' ) {
|
| 150 |
+
$field = cmb2_get_field( $meta_box, $field_id, $object_id, $object_type );
|
| 151 |
+
return $field->escaped_value();
|
| 152 |
+
}
|
| 153 |
+
|
| 154 |
+
/**
|
| 155 |
+
* Because OOP can be scary
|
| 156 |
+
* @since 2.0.2
|
| 157 |
+
* @param array $meta_box_config Metabox Config array
|
| 158 |
+
* @return CMB2 object Instantiated CMB2 object
|
| 159 |
+
*/
|
| 160 |
+
function new_cmb2_box( array $meta_box_config ) {
|
| 161 |
+
return cmb2_get_metabox( $meta_box_config );
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
/**
|
| 165 |
+
* Retrieve a CMB instance by the metabox ID
|
| 166 |
+
* @since 2.0.0
|
| 167 |
+
* @param mixed $meta_box Metabox ID or Metabox config array
|
| 168 |
+
* @return CMB2 object
|
| 169 |
+
*/
|
| 170 |
+
function cmb2_get_metabox( $meta_box, $object_id = 0 ) {
|
| 171 |
+
|
| 172 |
+
if ( $meta_box instanceof CMB2 ) {
|
| 173 |
+
return $meta_box;
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
if ( is_string( $meta_box ) ) {
|
| 177 |
+
$cmb = CMB2_Boxes::get( $meta_box );
|
| 178 |
+
} else {
|
| 179 |
+
// See if we already have an instance of this metabox
|
| 180 |
+
$cmb = CMB2_Boxes::get( $meta_box['id'] );
|
| 181 |
+
// If not, we'll initate a new metabox
|
| 182 |
+
$cmb = $cmb ? $cmb : new CMB2( $meta_box, $object_id );
|
| 183 |
+
}
|
| 184 |
+
|
| 185 |
+
if ( $cmb && $object_id ) {
|
| 186 |
+
$cmb->object_id( $object_id );
|
| 187 |
+
}
|
| 188 |
+
return $cmb;
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
/**
|
| 192 |
+
* Retrieve a metabox form
|
| 193 |
+
* @since 2.0.0
|
| 194 |
+
* @param mixed $meta_box Metabox config array or Metabox ID
|
| 195 |
+
* @param int $object_id Object ID
|
| 196 |
+
* @param array $args Optional arguments array
|
| 197 |
+
* @return string CMB html form markup
|
| 198 |
+
*/
|
| 199 |
+
function cmb2_get_metabox_form( $meta_box, $object_id = 0, $args = array() ) {
|
| 200 |
+
|
| 201 |
+
$object_id = $object_id ? $object_id : get_the_ID();
|
| 202 |
+
$cmb = cmb2_get_metabox( $meta_box, $object_id );
|
| 203 |
+
|
| 204 |
+
ob_start();
|
| 205 |
+
// Get cmb form
|
| 206 |
+
cmb2_print_metabox_form( $cmb, $object_id, $args );
|
| 207 |
+
$form = ob_get_contents();
|
| 208 |
+
ob_end_clean();
|
| 209 |
+
|
| 210 |
+
return apply_filters( 'cmb2_get_metabox_form', $form, $object_id, $cmb );
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
/**
|
| 214 |
+
* Display a metabox form & save it on submission
|
| 215 |
+
* @since 1.0.0
|
| 216 |
+
* @param mixed $meta_box Metabox config array or Metabox ID
|
| 217 |
+
* @param int $object_id Object ID
|
| 218 |
+
* @param array $args Optional arguments array
|
| 219 |
+
*/
|
| 220 |
+
function cmb2_print_metabox_form( $meta_box, $object_id = 0, $args = array() ) {
|
| 221 |
+
|
| 222 |
+
$object_id = $object_id ? $object_id : get_the_ID();
|
| 223 |
+
$cmb = cmb2_get_metabox( $meta_box, $object_id );
|
| 224 |
+
|
| 225 |
+
// if passing a metabox ID, and that ID was not found
|
| 226 |
+
if ( ! $cmb ) {
|
| 227 |
+
return;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
// Set object type to what is declared in the metabox (rather than trying to guess from context)
|
| 231 |
+
$cmb->object_type( $cmb->mb_object_type() );
|
| 232 |
+
|
| 233 |
+
// Save the metabox if it's been submitted
|
| 234 |
+
// check permissions
|
| 235 |
+
// @todo more hardening?
|
| 236 |
+
if (
|
| 237 |
+
// check nonce
|
| 238 |
+
isset( $_POST['submit-cmb'], $_POST['object_id'], $_POST[ $cmb->nonce() ] )
|
| 239 |
+
&& wp_verify_nonce( $_POST[ $cmb->nonce() ], $cmb->nonce() )
|
| 240 |
+
&& $object_id && $_POST['object_id'] == $object_id
|
| 241 |
+
) {
|
| 242 |
+
$cmb->save_fields( $object_id, $cmb->object_type(), $_POST );
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
// Enqueue JS/CSS
|
| 246 |
+
if ( $cmb->prop( 'cmb_styles' ) ) {
|
| 247 |
+
CMB2_hookup::enqueue_cmb_css();
|
| 248 |
+
}
|
| 249 |
+
CMB2_hookup::enqueue_cmb_js();
|
| 250 |
+
|
| 251 |
+
$args = wp_parse_args( $args, array(
|
| 252 |
+
'form_format' => '<form class="cmb-form" method="post" id="%1$s" enctype="multipart/form-data" encoding="multipart/form-data"><input type="hidden" name="object_id" value="%2$s">%3$s<input type="submit" name="submit-cmb" value="%4$s" class="button-primary"></form>',
|
| 253 |
+
'save_button' => __( 'Save', 'cmb2' ),
|
| 254 |
+
) );
|
| 255 |
+
|
| 256 |
+
$form_format = apply_filters( 'cmb2_get_metabox_form_format', $args['form_format'], $object_id, $cmb );
|
| 257 |
+
|
| 258 |
+
$format_parts = explode( '%3$s', $form_format );
|
| 259 |
+
|
| 260 |
+
// Show cmb form
|
| 261 |
+
printf( $format_parts[0], $cmb->cmb_id, $object_id );
|
| 262 |
+
$cmb->show_form();
|
| 263 |
+
|
| 264 |
+
if ( isset( $format_parts[1] ) && $format_parts[1] ) {
|
| 265 |
+
printf( str_ireplace( '%4$s', '%1$s', $format_parts[1] ), $args['save_button'] );
|
| 266 |
+
}
|
| 267 |
+
|
| 268 |
+
}
|
| 269 |
+
|
| 270 |
+
/**
|
| 271 |
+
* Display a metabox form (or optionally return it) & save it on submission
|
| 272 |
+
* @since 1.0.0
|
| 273 |
+
* @param mixed $meta_box Metabox config array or Metabox ID
|
| 274 |
+
* @param int $object_id Object ID
|
| 275 |
+
* @param array $args Optional arguments array
|
| 276 |
+
*/
|
| 277 |
+
function cmb2_metabox_form( $meta_box, $object_id = 0, $args = array() ) {
|
| 278 |
+
if ( ! isset( $args['echo'] ) || $args['echo'] ) {
|
| 279 |
+
cmb2_print_metabox_form( $meta_box, $object_id, $args );
|
| 280 |
+
} else {
|
| 281 |
+
return cmb2_get_metabox_form( $meta_box, $object_id, $args );
|
| 282 |
+
}
|
| 283 |
+
}
|
cmb2/includes/index.php
ADDED
|
File without changes
|
cmb2/index.php
ADDED
|
File without changes
|
cmb2/init.php
ADDED
|
@@ -0,0 +1,78 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'cmb2_bootstrap_202', false ) ) {
|
| 3 |
+
|
| 4 |
+
/**
|
| 5 |
+
* Check for newest version of CMB
|
| 6 |
+
*/
|
| 7 |
+
class cmb2_bootstrap_202 {
|
| 8 |
+
|
| 9 |
+
/**
|
| 10 |
+
* Current version number
|
| 11 |
+
* @var string
|
| 12 |
+
* @since 1.0.0
|
| 13 |
+
*/
|
| 14 |
+
const VERSION = '2.0.2';
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* Current version hook priority
|
| 18 |
+
* Will decrement with each release
|
| 19 |
+
*
|
| 20 |
+
* @var int
|
| 21 |
+
* @since 2.0.0
|
| 22 |
+
*/
|
| 23 |
+
const PRIORITY = 9997;
|
| 24 |
+
|
| 25 |
+
public static $single = null;
|
| 26 |
+
|
| 27 |
+
public static function go() {
|
| 28 |
+
if ( null === self::$single ) {
|
| 29 |
+
self::$single = new self();
|
| 30 |
+
}
|
| 31 |
+
return self::$single;
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
private function __construct() {
|
| 35 |
+
/**
|
| 36 |
+
* A constant you can use to check if CMB2 is loaded
|
| 37 |
+
* for your plugins/themes with CMB2 dependency
|
| 38 |
+
*/
|
| 39 |
+
if ( ! defined( 'CMB2_LOADED' ) ) {
|
| 40 |
+
define( 'CMB2_LOADED', true );
|
| 41 |
+
}
|
| 42 |
+
add_action( 'init', array( $this, 'include_cmb' ), self::PRIORITY );
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
public function include_cmb() {
|
| 46 |
+
if ( ! class_exists( 'CMB2', false ) ) {
|
| 47 |
+
if ( ! defined( 'CMB2_VERSION' ) ) {
|
| 48 |
+
define( 'CMB2_VERSION', self::VERSION );
|
| 49 |
+
}
|
| 50 |
+
$this->l10ni18n();
|
| 51 |
+
require_once 'bootstrap.php';
|
| 52 |
+
}
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
/**
|
| 56 |
+
* Load CMB text domain
|
| 57 |
+
* @since 2.0.0
|
| 58 |
+
*/
|
| 59 |
+
public function l10ni18n() {
|
| 60 |
+
$loaded = load_plugin_textdomain( 'cmb2', false, '/languages/' );
|
| 61 |
+
if ( ! $loaded ) {
|
| 62 |
+
$loaded = load_muplugin_textdomain( 'cmb2', '/languages/' );
|
| 63 |
+
}
|
| 64 |
+
if ( ! $loaded ) {
|
| 65 |
+
$loaded = load_theme_textdomain( 'cmb2', '/languages/' );
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
if ( ! $loaded ) {
|
| 69 |
+
$locale = apply_filters( 'plugin_locale', get_locale(), 'cmb2' );
|
| 70 |
+
$mofile = dirname( __FILE__ ) . '/languages/cmb2-' . $locale . '.mo';
|
| 71 |
+
load_textdomain( 'cmb2', $mofile );
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
}
|
| 76 |
+
cmb2_bootstrap_202::go();
|
| 77 |
+
|
| 78 |
+
} // class exists check
|
cmb2/js/cmb2.js
ADDED
|
@@ -0,0 +1,891 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Controls the behaviours of custom metabox fields.
|
| 3 |
+
*
|
| 4 |
+
* @author WebDevStudios
|
| 5 |
+
* @see https://github.com/WebDevStudios/CMB2
|
| 6 |
+
*/
|
| 7 |
+
|
| 8 |
+
/**
|
| 9 |
+
* Custom jQuery for Custom Metaboxes and Fields
|
| 10 |
+
*/
|
| 11 |
+
window.CMB2 = (function(window, document, $, undefined){
|
| 12 |
+
'use strict';
|
| 13 |
+
|
| 14 |
+
// localization strings
|
| 15 |
+
var l10n = window.cmb2_l10;
|
| 16 |
+
var setTimeout = window.setTimeout;
|
| 17 |
+
|
| 18 |
+
// CMB functionality object
|
| 19 |
+
var cmb = {
|
| 20 |
+
formfield : '',
|
| 21 |
+
idNumber : false,
|
| 22 |
+
file_frames : {},
|
| 23 |
+
repeatEls : 'input:not([type="button"]),select,textarea,.cmb2-media-status',
|
| 24 |
+
styleBreakPoint : 450,
|
| 25 |
+
mediaHandlers : {},
|
| 26 |
+
defaults : {
|
| 27 |
+
time_picker : l10n.defaults.time_picker,
|
| 28 |
+
date_picker : l10n.defaults.date_picker,
|
| 29 |
+
color_picker : l10n.defaults.color_picker || {},
|
| 30 |
+
},
|
| 31 |
+
};
|
| 32 |
+
|
| 33 |
+
// Because it's a more efficient way of getting an element by id.
|
| 34 |
+
var $id = function( selector ) {
|
| 35 |
+
return $( document.getElementById( selector ) );
|
| 36 |
+
};
|
| 37 |
+
|
| 38 |
+
cmb.metabox = function() {
|
| 39 |
+
if ( cmb.$metabox ) {
|
| 40 |
+
return cmb.$metabox;
|
| 41 |
+
}
|
| 42 |
+
cmb.$metabox = $('.cmb2-wrap > .cmb2-metabox');
|
| 43 |
+
return cmb.$metabox;
|
| 44 |
+
};
|
| 45 |
+
|
| 46 |
+
cmb.init = function() {
|
| 47 |
+
|
| 48 |
+
cmb.log( 'CMB2 localized data', l10n );
|
| 49 |
+
var $metabox = cmb.metabox();
|
| 50 |
+
var $repeatGroup = $metabox.find('.cmb-repeatable-group');
|
| 51 |
+
|
| 52 |
+
/**
|
| 53 |
+
* Initialize time/date/color pickers
|
| 54 |
+
*/
|
| 55 |
+
cmb.initPickers( $metabox.find('input[type="text"].cmb2-timepicker'), $metabox.find('input[type="text"].cmb2-datepicker'), $metabox.find('input[type="text"].cmb2-colorpicker') );
|
| 56 |
+
|
| 57 |
+
// Wrap date picker in class to narrow the scope of jQuery UI CSS and prevent conflicts
|
| 58 |
+
$id( 'ui-datepicker-div' ).wrap('<div class="cmb2-element" />');
|
| 59 |
+
|
| 60 |
+
// Insert toggle button into DOM wherever there is multicheck. credit: Genesis Framework
|
| 61 |
+
$( '<p><span class="button cmb-multicheck-toggle">' + l10n.strings.check_toggle + '</span></p>' ).insertBefore( '.cmb2-checkbox-list:not(.no-select-all)' );
|
| 62 |
+
|
| 63 |
+
// Make File List drag/drop sortable:
|
| 64 |
+
cmb.makeListSortable();
|
| 65 |
+
|
| 66 |
+
$metabox
|
| 67 |
+
.on( 'change', '.cmb2_upload_file', function() {
|
| 68 |
+
cmb.formfield = $(this).attr('id');
|
| 69 |
+
$id( cmb.formfield + '_id' ).val('');
|
| 70 |
+
})
|
| 71 |
+
// Media/file management
|
| 72 |
+
.on( 'click', '.cmb-multicheck-toggle', cmb.toggleCheckBoxes )
|
| 73 |
+
.on( 'click', '.cmb2-upload-button', cmb.handleMedia )
|
| 74 |
+
.on( 'click', '.cmb-attach-list li, .cmb2-media-status .img-status img, .cmb2-media-status .file-status > span', cmb.handleFileClick )
|
| 75 |
+
.on( 'click', '.cmb2-remove-file-button', cmb.handleRemoveMedia )
|
| 76 |
+
// Repeatable content
|
| 77 |
+
.on( 'click', '.cmb-add-group-row', cmb.addGroupRow )
|
| 78 |
+
.on( 'click', '.cmb-add-row-button', cmb.addAjaxRow )
|
| 79 |
+
.on( 'click', '.cmb-remove-group-row', cmb.removeGroupRow )
|
| 80 |
+
.on( 'click', '.cmb-remove-row-button', cmb.removeAjaxRow )
|
| 81 |
+
// Ajax oEmbed display
|
| 82 |
+
.on( 'keyup paste focusout', '.cmb2-oembed', cmb.maybeOembed )
|
| 83 |
+
// Reset titles when removing a row
|
| 84 |
+
.on( 'cmb2_remove_row', '.cmb-repeatable-group', cmb.resetTitlesAndIterator )
|
| 85 |
+
.on( 'click', '.cmbhandle, .cmbhandle + .cmbhandle-title', cmb.toggleHandle );
|
| 86 |
+
|
| 87 |
+
if ( $repeatGroup.length ) {
|
| 88 |
+
$repeatGroup
|
| 89 |
+
.filter('.sortable').each( function() {
|
| 90 |
+
// Add sorting arrows
|
| 91 |
+
$(this).find( '.button.cmb-remove-group-row' ).before( '<a class="button cmb-shift-rows move-up alignleft" href="#"><span class="'+ l10n.up_arrow_class +'"></span></a> <a class="button cmb-shift-rows move-down alignleft" href="#"><span class="'+ l10n.down_arrow_class +'"></span></a>' );
|
| 92 |
+
})
|
| 93 |
+
.on( 'click', '.cmb-shift-rows', cmb.shiftRows )
|
| 94 |
+
.on( 'cmb2_add_row', cmb.emptyValue );
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
// on pageload
|
| 98 |
+
setTimeout( cmb.resizeoEmbeds, 500);
|
| 99 |
+
// and on window resize
|
| 100 |
+
$(window).on( 'resize', cmb.resizeoEmbeds );
|
| 101 |
+
|
| 102 |
+
};
|
| 103 |
+
|
| 104 |
+
cmb.resetTitlesAndIterator = function() {
|
| 105 |
+
// Loop repeatable group tables
|
| 106 |
+
$( '.cmb-repeatable-group' ).each( function() {
|
| 107 |
+
var $table = $(this);
|
| 108 |
+
// Loop repeatable group table rows
|
| 109 |
+
$table.find( '.cmb-repeatable-grouping' ).each( function( rowindex ) {
|
| 110 |
+
var $row = $(this);
|
| 111 |
+
// Reset rows iterator
|
| 112 |
+
$row.data( 'iterator', rowindex );
|
| 113 |
+
// Reset rows title
|
| 114 |
+
$row.find( '.cmb-group-title h4' ).text( $table.find( '.cmb-add-group-row' ).data( 'grouptitle' ).replace( '{#}', ( rowindex + 1 ) ) );
|
| 115 |
+
});
|
| 116 |
+
});
|
| 117 |
+
};
|
| 118 |
+
|
| 119 |
+
cmb.toggleHandle = function( evt ) {
|
| 120 |
+
evt.preventDefault();
|
| 121 |
+
$(document).trigger( 'postbox-toggled', $(this).parent('.postbox').toggleClass('closed') );
|
| 122 |
+
};
|
| 123 |
+
|
| 124 |
+
cmb.toggleCheckBoxes = function( evt ) {
|
| 125 |
+
evt.preventDefault();
|
| 126 |
+
var $self = $(this);
|
| 127 |
+
var $multicheck = $self.closest( '.cmb-td' ).find( 'input[type=checkbox]' );
|
| 128 |
+
|
| 129 |
+
// If the button has already been clicked once...
|
| 130 |
+
if ( $self.data( 'checked' ) ) {
|
| 131 |
+
// clear the checkboxes and remove the flag
|
| 132 |
+
$multicheck.prop( 'checked', false );
|
| 133 |
+
$self.data( 'checked', false );
|
| 134 |
+
}
|
| 135 |
+
// Otherwise mark the checkboxes and add a flag
|
| 136 |
+
else {
|
| 137 |
+
$multicheck.prop( 'checked', true );
|
| 138 |
+
$self.data( 'checked', true );
|
| 139 |
+
}
|
| 140 |
+
};
|
| 141 |
+
|
| 142 |
+
cmb.handleMedia = function( evt ) {
|
| 143 |
+
evt.preventDefault();
|
| 144 |
+
|
| 145 |
+
var $el = $( this );
|
| 146 |
+
cmb.attach_id = ! $el.hasClass( 'cmb2-upload-list' ) ? $el.closest( '.cmb-td' ).find( '.cmb2-upload-file-id' ).val() : false;
|
| 147 |
+
// Clean up default 0 value
|
| 148 |
+
cmb.attach_id = '0' !== cmb.attach_id ? cmb.attach_id : false;
|
| 149 |
+
|
| 150 |
+
cmb._handleMedia( $el.prev('input.cmb2-upload-file').attr('id'), $el.hasClass( 'cmb2-upload-list' ) );
|
| 151 |
+
};
|
| 152 |
+
|
| 153 |
+
cmb.handleFileClick = function( evt ) {
|
| 154 |
+
evt.preventDefault();
|
| 155 |
+
|
| 156 |
+
var $el = $( this );
|
| 157 |
+
var $td = $el.closest( '.cmb-td' );
|
| 158 |
+
var isList = $td.find( '.cmb2-upload-button' ).hasClass( 'cmb2-upload-list' );
|
| 159 |
+
cmb.attach_id = isList ? $el.find( 'input[type="hidden"]' ).data( 'id' ) : $td.find( '.cmb2-upload-file-id' ).val();
|
| 160 |
+
|
| 161 |
+
if ( cmb.attach_id ) {
|
| 162 |
+
cmb._handleMedia( $td.find( 'input.cmb2-upload-file' ).attr('id'), isList, cmb.attach_id );
|
| 163 |
+
}
|
| 164 |
+
};
|
| 165 |
+
|
| 166 |
+
cmb._handleMedia = function( formfield, isList ) {
|
| 167 |
+
if ( ! wp ) {
|
| 168 |
+
return;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
var $metabox = cmb.metabox();
|
| 172 |
+
cmb.formfield = formfield;
|
| 173 |
+
var $formfield = $id( cmb.formfield );
|
| 174 |
+
var previewSize = $formfield.data( 'previewsize' );
|
| 175 |
+
var formName = $formfield.attr('name');
|
| 176 |
+
var uploadStatus = true;
|
| 177 |
+
var attachment = true;
|
| 178 |
+
|
| 179 |
+
// If this field's media frame already exists, reopen it.
|
| 180 |
+
if ( cmb.formfield in cmb.file_frames ) {
|
| 181 |
+
cmb.file_frames[ cmb.formfield ].open();
|
| 182 |
+
return;
|
| 183 |
+
}
|
| 184 |
+
|
| 185 |
+
// Create the media frame.
|
| 186 |
+
cmb.file_frames[ cmb.formfield ] = wp.media({
|
| 187 |
+
title: $metabox.find('label[for=' + cmb.formfield + ']').text(),
|
| 188 |
+
button: {
|
| 189 |
+
text: l10n.strings.upload_file
|
| 190 |
+
},
|
| 191 |
+
multiple: isList ? true : false
|
| 192 |
+
});
|
| 193 |
+
|
| 194 |
+
cmb.mediaHandlers.list = function( selection, returnIt ) {
|
| 195 |
+
// Get all of our selected files
|
| 196 |
+
attachment = selection.toJSON();
|
| 197 |
+
|
| 198 |
+
$formfield.val(attachment.url);
|
| 199 |
+
$id( cmb.formfield +'_id' ).val(attachment.id);
|
| 200 |
+
|
| 201 |
+
// Setup our fileGroup array
|
| 202 |
+
var fileGroup = [];
|
| 203 |
+
|
| 204 |
+
// Loop through each attachment
|
| 205 |
+
$( attachment ).each( function() {
|
| 206 |
+
if ( this.type && this.type === 'image' ) {
|
| 207 |
+
var width = previewSize[0] ? previewSize[0] : 50;
|
| 208 |
+
var height = previewSize[1] ? previewSize[1] : 50;
|
| 209 |
+
|
| 210 |
+
// image preview
|
| 211 |
+
uploadStatus = '<li class="img-status">'+
|
| 212 |
+
'<img width="'+ width +'" height="'+ height +'" src="' + this.url + '" class="attachment-'+ width +'px'+ height +'px" alt="'+ this.filename +'">'+
|
| 213 |
+
'<p><a href="#" class="cmb2-remove-file-button" rel="'+ cmb.formfield +'['+ this.id +']">'+ l10n.strings.remove_image +'</a></p>'+
|
| 214 |
+
'<input type="hidden" id="filelist-'+ this.id +'" data-id="'+ this.id +'" name="'+ formName +'['+ this.id +']" value="' + this.url + '">'+
|
| 215 |
+
'</li>';
|
| 216 |
+
|
| 217 |
+
} else {
|
| 218 |
+
// Standard generic output if it's not an image.
|
| 219 |
+
uploadStatus = '<li class="file-status"><span>'+ l10n.strings.file +' <strong>'+ this.filename +'</strong></span> (<a href="' + this.url + '" target="_blank" rel="external">'+ l10n.strings.download +'</a> / <a href="#" class="cmb2-remove-file-button" rel="'+ cmb.formfield +'['+ this.id +']">'+ l10n.strings.remove_file +'</a>)'+
|
| 220 |
+
'<input type="hidden" id="filelist-'+ this.id +'" data-id="'+ this.id +'" name="'+ formName +'['+ this.id +']" value="' + this.url + '">'+
|
| 221 |
+
'</li>';
|
| 222 |
+
|
| 223 |
+
}
|
| 224 |
+
|
| 225 |
+
// Add our file to our fileGroup array
|
| 226 |
+
fileGroup.push( uploadStatus );
|
| 227 |
+
});
|
| 228 |
+
|
| 229 |
+
if ( ! returnIt ) {
|
| 230 |
+
// Append each item from our fileGroup array to .cmb2-media-status
|
| 231 |
+
$( fileGroup ).each( function() {
|
| 232 |
+
$formfield.siblings('.cmb2-media-status').slideDown().append(this);
|
| 233 |
+
});
|
| 234 |
+
} else {
|
| 235 |
+
return fileGroup;
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
};
|
| 239 |
+
cmb.mediaHandlers.single = function( selection ) {
|
| 240 |
+
// Only get one file from the uploader
|
| 241 |
+
attachment = selection.first().toJSON();
|
| 242 |
+
|
| 243 |
+
$formfield.val(attachment.url);
|
| 244 |
+
$id( cmb.formfield +'_id' ).val(attachment.id);
|
| 245 |
+
|
| 246 |
+
if ( attachment.type && attachment.type === 'image' ) {
|
| 247 |
+
// image preview
|
| 248 |
+
var width = previewSize[0] ? previewSize[0] : 350;
|
| 249 |
+
uploadStatus = '<div class="img-status"><img width="'+ width +'px" style="max-width: '+ width +'px; width: 100%; height: auto;" src="' + attachment.url + '" alt="'+ attachment.filename +'" title="'+ attachment.filename +'" /><p><a href="#" class="cmb2-remove-file-button" rel="' + cmb.formfield + '">'+ l10n.strings.remove_image +'</a></p></div>';
|
| 250 |
+
} else {
|
| 251 |
+
// Standard generic output if it's not an image.
|
| 252 |
+
uploadStatus = '<div class="file-status"><span>'+ l10n.strings.file +' <strong>'+ attachment.filename +'</strong></span> (<a href="'+ attachment.url +'" target="_blank" rel="external">'+ l10n.strings.download +'</a> / <a href="#" class="cmb2-remove-file-button" rel="'+ cmb.formfield +'">'+ l10n.strings.remove_file +'</a>)</div>';
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
// add/display our output
|
| 256 |
+
$formfield.siblings('.cmb2-media-status').slideDown().html(uploadStatus);
|
| 257 |
+
};
|
| 258 |
+
|
| 259 |
+
cmb.mediaHandlers.selectFile = function() {
|
| 260 |
+
var selection = cmb.file_frames[ cmb.formfield ].state().get('selection');
|
| 261 |
+
var type = isList ? 'list' : 'single';
|
| 262 |
+
|
| 263 |
+
if ( cmb.attach_id && isList ) {
|
| 264 |
+
$( '[data-id="'+ cmb.attach_id +'"]' ).parents( 'li' ).replaceWith( cmb.mediaHandlers.list( selection, true ) );
|
| 265 |
+
return;
|
| 266 |
+
}
|
| 267 |
+
|
| 268 |
+
cmb.mediaHandlers[type]( selection );
|
| 269 |
+
};
|
| 270 |
+
|
| 271 |
+
cmb.mediaHandlers.openModal = function() {
|
| 272 |
+
var selection = cmb.file_frames[ cmb.formfield ].state().get('selection');
|
| 273 |
+
|
| 274 |
+
if ( ! cmb.attach_id ) {
|
| 275 |
+
return selection.reset();
|
| 276 |
+
}
|
| 277 |
+
|
| 278 |
+
var attach = wp.media.attachment( cmb.attach_id );
|
| 279 |
+
attach.fetch();
|
| 280 |
+
selection.set( attach ? [ attach ] : [] );
|
| 281 |
+
};
|
| 282 |
+
|
| 283 |
+
// When a file is selected, run a callback.
|
| 284 |
+
cmb.file_frames[ cmb.formfield ]
|
| 285 |
+
.on( 'select', cmb.mediaHandlers.selectFile )
|
| 286 |
+
.on( 'open', cmb.mediaHandlers.openModal );
|
| 287 |
+
|
| 288 |
+
// Finally, open the modal
|
| 289 |
+
cmb.file_frames[ cmb.formfield ].open();
|
| 290 |
+
};
|
| 291 |
+
|
| 292 |
+
cmb.handleRemoveMedia = function( evt ) {
|
| 293 |
+
evt.preventDefault();
|
| 294 |
+
var $self = $(this);
|
| 295 |
+
if ( $self.is( '.cmb-attach-list .cmb2-remove-file-button' ) ){
|
| 296 |
+
$self.parents('li').remove();
|
| 297 |
+
return false;
|
| 298 |
+
}
|
| 299 |
+
|
| 300 |
+
cmb.formfield = $self.attr('rel');
|
| 301 |
+
|
| 302 |
+
cmb.metabox().find( 'input#' + cmb.formfield ).val('');
|
| 303 |
+
cmb.metabox().find( 'input#' + cmb.formfield + '_id' ).val('');
|
| 304 |
+
$self.parents('.cmb2-media-status').html('');
|
| 305 |
+
|
| 306 |
+
return false;
|
| 307 |
+
};
|
| 308 |
+
|
| 309 |
+
$.fn.cleanRow = function( prevNum, group ) {
|
| 310 |
+
var $self = $(this);
|
| 311 |
+
var $inputs = $self.find( 'input:not([type="button"]), select, textarea, label' );
|
| 312 |
+
var $other = $self.find('[id]').not( 'input:not([type="button"]), select, textarea, label' );
|
| 313 |
+
if ( group ) {
|
| 314 |
+
// Remove extra ajaxed rows
|
| 315 |
+
$self.find('.cmb-repeat-table .cmb-repeat-row:not(:first-child)').remove();
|
| 316 |
+
|
| 317 |
+
// Update all elements w/ an ID
|
| 318 |
+
if ( $other.length ) {
|
| 319 |
+
$other.each( function() {
|
| 320 |
+
var $_this = $( this );
|
| 321 |
+
var oldID = $_this.attr( 'id' );
|
| 322 |
+
var newID = oldID.replace( '_'+ prevNum, '_'+ cmb.idNumber );
|
| 323 |
+
var $buttons = $self.find('[data-selector="'+ oldID +'"]');
|
| 324 |
+
$_this.attr( 'id', newID );
|
| 325 |
+
|
| 326 |
+
// Replace data-selector vars
|
| 327 |
+
if ( $buttons.length ) {
|
| 328 |
+
$buttons.attr( 'data-selector', newID ).data( 'selector', newID );
|
| 329 |
+
}
|
| 330 |
+
});
|
| 331 |
+
}
|
| 332 |
+
}
|
| 333 |
+
cmb.neweditor_id = [];
|
| 334 |
+
|
| 335 |
+
$inputs.filter(':checked').prop( 'checked', false );
|
| 336 |
+
$inputs.filter(':selected').prop( 'selected', false );
|
| 337 |
+
|
| 338 |
+
if ( $self.find('h3.cmb-group-title').length ) {
|
| 339 |
+
$self.find( 'h3.cmb-group-title' ).text( $self.data( 'title' ).replace( '{#}', ( cmb.idNumber + 1 ) ) );
|
| 340 |
+
}
|
| 341 |
+
|
| 342 |
+
$inputs.each( function(){
|
| 343 |
+
var $newInput = $(this);
|
| 344 |
+
var isEditor = $newInput.hasClass( 'wp-editor-area' );
|
| 345 |
+
var oldFor = $newInput.attr( 'for' );
|
| 346 |
+
// var $next = $newInput.next();
|
| 347 |
+
var attrs = {};
|
| 348 |
+
var newID, oldID;
|
| 349 |
+
if ( oldFor ) {
|
| 350 |
+
attrs = { 'for' : oldFor.replace( '_'+ prevNum, '_'+ cmb.idNumber ) };
|
| 351 |
+
} else {
|
| 352 |
+
var oldName = $newInput.attr( 'name' );
|
| 353 |
+
// Replace 'name' attribute key
|
| 354 |
+
var newName = oldName ? oldName.replace( '['+ prevNum +']', '['+ cmb.idNumber +']' ) : '';
|
| 355 |
+
oldID = $newInput.attr( 'id' );
|
| 356 |
+
newID = oldID ? oldID.replace( '_'+ prevNum, '_'+ cmb.idNumber ) : '';
|
| 357 |
+
attrs = {
|
| 358 |
+
id: newID,
|
| 359 |
+
name: newName,
|
| 360 |
+
// value: '',
|
| 361 |
+
'data-iterator': cmb.idNumber,
|
| 362 |
+
};
|
| 363 |
+
}
|
| 364 |
+
|
| 365 |
+
$newInput
|
| 366 |
+
.removeClass( 'hasDatepicker' )
|
| 367 |
+
.attr( attrs ).val('');
|
| 368 |
+
|
| 369 |
+
// wysiwyg field
|
| 370 |
+
if ( isEditor ) {
|
| 371 |
+
// Get new wysiwyg ID
|
| 372 |
+
newID = newID ? oldID.replace( 'zx'+ prevNum, 'zx'+ cmb.idNumber ) : '';
|
| 373 |
+
// Empty the contents
|
| 374 |
+
$newInput.html('');
|
| 375 |
+
// Get wysiwyg field
|
| 376 |
+
var $wysiwyg = $newInput.parents( '.cmb-type-wysiwyg' );
|
| 377 |
+
// Remove extra mce divs
|
| 378 |
+
$wysiwyg.find('.mce-tinymce:not(:first-child)').remove();
|
| 379 |
+
// Replace id instances
|
| 380 |
+
var html = $wysiwyg.html().replace( new RegExp( oldID, 'g' ), newID );
|
| 381 |
+
// Update field html
|
| 382 |
+
$wysiwyg.html( html );
|
| 383 |
+
// Save ids for later to re-init tinymce
|
| 384 |
+
cmb.neweditor_id.push( { 'id': newID, 'old': oldID } );
|
| 385 |
+
}
|
| 386 |
+
});
|
| 387 |
+
|
| 388 |
+
return this;
|
| 389 |
+
};
|
| 390 |
+
|
| 391 |
+
$.fn.newRowHousekeeping = function() {
|
| 392 |
+
var $row = $(this);
|
| 393 |
+
var $colorPicker = $row.find( '.wp-picker-container' );
|
| 394 |
+
var $list = $row.find( '.cmb2-media-status' );
|
| 395 |
+
|
| 396 |
+
if ( $colorPicker.length ) {
|
| 397 |
+
// Need to clean-up colorpicker before appending
|
| 398 |
+
$colorPicker.each( function() {
|
| 399 |
+
var $td = $(this).parent();
|
| 400 |
+
$td.html( $td.find( 'input[type="text"].cmb2-colorpicker' ).attr('style', '') );
|
| 401 |
+
});
|
| 402 |
+
}
|
| 403 |
+
|
| 404 |
+
// Need to clean-up colorpicker before appending
|
| 405 |
+
if ( $list.length ) {
|
| 406 |
+
$list.empty();
|
| 407 |
+
}
|
| 408 |
+
|
| 409 |
+
return this;
|
| 410 |
+
};
|
| 411 |
+
|
| 412 |
+
cmb.afterRowInsert = function( $row, group ) {
|
| 413 |
+
|
| 414 |
+
var $focus = $row.find('input:not([type="button"]), textarea, select').first();
|
| 415 |
+
if ( $focus.length ) {
|
| 416 |
+
if ( group ) {
|
| 417 |
+
$('html, body').animate({
|
| 418 |
+
scrollTop: Math.round( $focus.offset().top - 150 )
|
| 419 |
+
}, 1000);
|
| 420 |
+
}
|
| 421 |
+
$focus.focus();
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
var _prop;
|
| 425 |
+
|
| 426 |
+
// Need to re-init wp_editor instances
|
| 427 |
+
if ( cmb.neweditor_id.length ) {
|
| 428 |
+
var i;
|
| 429 |
+
for ( i = cmb.neweditor_id.length - 1; i >= 0; i-- ) {
|
| 430 |
+
var id = cmb.neweditor_id[i].id;
|
| 431 |
+
var old = cmb.neweditor_id[i].old;
|
| 432 |
+
|
| 433 |
+
if ( typeof( tinyMCEPreInit.mceInit[ id ] ) === 'undefined' ) {
|
| 434 |
+
var newSettings = jQuery.extend( {}, tinyMCEPreInit.mceInit[ old ] );
|
| 435 |
+
|
| 436 |
+
for ( _prop in newSettings ) {
|
| 437 |
+
if ( 'string' === typeof( newSettings[_prop] ) ) {
|
| 438 |
+
newSettings[_prop] = newSettings[_prop].replace( new RegExp( old, 'g' ), id );
|
| 439 |
+
}
|
| 440 |
+
}
|
| 441 |
+
tinyMCEPreInit.mceInit[ id ] = newSettings;
|
| 442 |
+
}
|
| 443 |
+
if ( typeof( tinyMCEPreInit.qtInit[ id ] ) === 'undefined' ) {
|
| 444 |
+
var newQTS = jQuery.extend( {}, tinyMCEPreInit.qtInit[ old ] );
|
| 445 |
+
for ( _prop in newQTS ) {
|
| 446 |
+
if ( 'string' === typeof( newQTS[_prop] ) ) {
|
| 447 |
+
newQTS[_prop] = newQTS[_prop].replace( new RegExp( old, 'g' ), id );
|
| 448 |
+
}
|
| 449 |
+
}
|
| 450 |
+
tinyMCEPreInit.qtInit[ id ] = newQTS;
|
| 451 |
+
}
|
| 452 |
+
tinyMCE.init({
|
| 453 |
+
id : tinyMCEPreInit.mceInit[ id ],
|
| 454 |
+
});
|
| 455 |
+
|
| 456 |
+
}
|
| 457 |
+
}
|
| 458 |
+
|
| 459 |
+
// Init pickers from new row
|
| 460 |
+
cmb.initPickers( $row.find('input[type="text"].cmb2-timepicker'), $row.find('input[type="text"].cmb2-datepicker'), $row.find('input[type="text"].cmb2-colorpicker') );
|
| 461 |
+
};
|
| 462 |
+
|
| 463 |
+
cmb.updateNameAttr = function () {
|
| 464 |
+
|
| 465 |
+
var $this = $(this);
|
| 466 |
+
var name = $this.attr( 'name' ); // get current name
|
| 467 |
+
|
| 468 |
+
// No name? bail
|
| 469 |
+
if ( typeof name === 'undefined' ) {
|
| 470 |
+
return false;
|
| 471 |
+
}
|
| 472 |
+
|
| 473 |
+
var prevNum = parseInt( $this.parents( '.cmb-repeatable-grouping' ).data( 'iterator' ) );
|
| 474 |
+
var newNum = prevNum - 1; // Subtract 1 to get new iterator number
|
| 475 |
+
|
| 476 |
+
// Update field name attributes so data is not orphaned when a row is removed and post is saved
|
| 477 |
+
var $newName = name.replace( '[' + prevNum + ']', '[' + newNum + ']' );
|
| 478 |
+
|
| 479 |
+
// New name with replaced iterator
|
| 480 |
+
$this.attr( 'name', $newName );
|
| 481 |
+
|
| 482 |
+
};
|
| 483 |
+
|
| 484 |
+
cmb.emptyValue = function( evt, row ) {
|
| 485 |
+
$('input:not([type="button"]), textarea', row).val('');
|
| 486 |
+
};
|
| 487 |
+
|
| 488 |
+
cmb.addGroupRow = function( evt ) {
|
| 489 |
+
evt.preventDefault();
|
| 490 |
+
|
| 491 |
+
var $self = $(this);
|
| 492 |
+
|
| 493 |
+
// before anything significant happens
|
| 494 |
+
$self.trigger( 'cmb2_add_group_row_start', $self );
|
| 495 |
+
|
| 496 |
+
var $table = $id( $self.data('selector') );
|
| 497 |
+
var $oldRow = $table.find('.cmb-repeatable-grouping').last();
|
| 498 |
+
var prevNum = parseInt( $oldRow.data('iterator') );
|
| 499 |
+
cmb.idNumber = prevNum + 1;
|
| 500 |
+
var $row = $oldRow.clone();
|
| 501 |
+
|
| 502 |
+
$row.data( 'title', $self.data( 'grouptitle' ) ).newRowHousekeeping().cleanRow( prevNum, true ).find( '.cmb-add-row-button' ).prop( 'disabled', false );
|
| 503 |
+
|
| 504 |
+
var $newRow = $( '<div class="postbox cmb-row cmb-repeatable-grouping" data-iterator="'+ cmb.idNumber +'">'+ $row.html() +'</div>' );
|
| 505 |
+
$oldRow.after( $newRow );
|
| 506 |
+
|
| 507 |
+
cmb.afterRowInsert( $newRow, true );
|
| 508 |
+
|
| 509 |
+
if ( $table.find('.cmb-repeatable-grouping').length <= 1 ) {
|
| 510 |
+
$table.find('.cmb-remove-group-row').prop( 'disabled', true );
|
| 511 |
+
} else {
|
| 512 |
+
$table.find('.cmb-remove-group-row').prop( 'disabled', false );
|
| 513 |
+
}
|
| 514 |
+
|
| 515 |
+
$table.trigger( 'cmb2_add_row', $newRow );
|
| 516 |
+
};
|
| 517 |
+
|
| 518 |
+
cmb.addAjaxRow = function( evt ) {
|
| 519 |
+
evt.preventDefault();
|
| 520 |
+
|
| 521 |
+
var $self = $(this);
|
| 522 |
+
var $table = $id( $self.data('selector') );
|
| 523 |
+
var $emptyrow = $table.find('.empty-row');
|
| 524 |
+
var prevNum = parseInt( $emptyrow.find('[data-iterator]').data('iterator') );
|
| 525 |
+
cmb.idNumber = prevNum + 1;
|
| 526 |
+
var $row = $emptyrow.clone();
|
| 527 |
+
|
| 528 |
+
$row.newRowHousekeeping().cleanRow( prevNum );
|
| 529 |
+
|
| 530 |
+
$emptyrow.removeClass('empty-row hidden').addClass('cmb-repeat-row');
|
| 531 |
+
$emptyrow.after( $row );
|
| 532 |
+
|
| 533 |
+
cmb.afterRowInsert( $row );
|
| 534 |
+
|
| 535 |
+
$table.trigger( 'cmb2_add_row', $row );
|
| 536 |
+
|
| 537 |
+
$table.find( '.cmb-remove-row-button' ).removeClass( 'button-disabled' );
|
| 538 |
+
|
| 539 |
+
};
|
| 540 |
+
|
| 541 |
+
cmb.removeGroupRow = function( evt ) {
|
| 542 |
+
evt.preventDefault();
|
| 543 |
+
|
| 544 |
+
var $self = $(this);
|
| 545 |
+
var $table = $id( $self.data('selector') );
|
| 546 |
+
var $parent = $self.parents('.cmb-repeatable-grouping');
|
| 547 |
+
var number = $table.find('.cmb-repeatable-grouping').length;
|
| 548 |
+
|
| 549 |
+
if ( number > 1 ) {
|
| 550 |
+
|
| 551 |
+
$table.trigger( 'cmb2_remove_group_row_start', $self );
|
| 552 |
+
|
| 553 |
+
// when a group is removed loop through all next groups and update fields names
|
| 554 |
+
$parent.nextAll( '.cmb-repeatable-grouping' ).find( cmb.repeatEls ).each( cmb.updateNameAttr );
|
| 555 |
+
|
| 556 |
+
$parent.remove();
|
| 557 |
+
|
| 558 |
+
if ( number <= 2 ) {
|
| 559 |
+
$table.find('.cmb-remove-group-row').prop( 'disabled', true );
|
| 560 |
+
} else {
|
| 561 |
+
$table.find('.cmb-remove-group-row').prop( 'disabled', false );
|
| 562 |
+
}
|
| 563 |
+
|
| 564 |
+
$table.trigger( 'cmb2_remove_row' );
|
| 565 |
+
}
|
| 566 |
+
|
| 567 |
+
};
|
| 568 |
+
|
| 569 |
+
cmb.removeAjaxRow = function( evt ) {
|
| 570 |
+
evt.preventDefault();
|
| 571 |
+
|
| 572 |
+
var $self = $(this);
|
| 573 |
+
|
| 574 |
+
// Check if disabled
|
| 575 |
+
if ( $self.hasClass( 'button-disabled' ) ) {
|
| 576 |
+
return;
|
| 577 |
+
}
|
| 578 |
+
|
| 579 |
+
var $parent = $self.parents('.cmb-row');
|
| 580 |
+
var $table = $self.parents('.cmb-repeat-table');
|
| 581 |
+
var number = $table.find('.cmb-row').length;
|
| 582 |
+
|
| 583 |
+
if ( number > 2 ) {
|
| 584 |
+
if ( $parent.hasClass('empty-row') ) {
|
| 585 |
+
$parent.prev().addClass( 'empty-row' ).removeClass('cmb-repeat-row');
|
| 586 |
+
}
|
| 587 |
+
$self.parents('.cmb-repeat-table .cmb-row').remove();
|
| 588 |
+
if ( number === 3 ) {
|
| 589 |
+
$table.find( '.cmb-remove-row-button' ).addClass( 'button-disabled' );
|
| 590 |
+
}
|
| 591 |
+
$table.trigger( 'cmb2_remove_row' );
|
| 592 |
+
} else {
|
| 593 |
+
$self.addClass( 'button-disabled' );
|
| 594 |
+
}
|
| 595 |
+
};
|
| 596 |
+
|
| 597 |
+
cmb.shiftRows = function( evt ) {
|
| 598 |
+
|
| 599 |
+
evt.preventDefault();
|
| 600 |
+
|
| 601 |
+
var $self = $(this);
|
| 602 |
+
// before anything signif happens
|
| 603 |
+
$self.trigger( 'cmb2_shift_rows_enter', $self );
|
| 604 |
+
|
| 605 |
+
var $parent = $self.parents( '.cmb-repeatable-grouping' );
|
| 606 |
+
var $goto = $self.hasClass( 'move-up' ) ? $parent.prev( '.cmb-repeatable-grouping' ) : $parent.next( '.cmb-repeatable-grouping' );
|
| 607 |
+
|
| 608 |
+
if ( ! $goto.length ) {
|
| 609 |
+
return;
|
| 610 |
+
}
|
| 611 |
+
|
| 612 |
+
// we're gonna shift
|
| 613 |
+
$self.trigger( 'cmb2_shift_rows_start', $self );
|
| 614 |
+
|
| 615 |
+
var inputVals = [];
|
| 616 |
+
// Loop this items fields
|
| 617 |
+
$parent.find( cmb.repeatEls ).each( function() {
|
| 618 |
+
var $element = $(this);
|
| 619 |
+
var val;
|
| 620 |
+
if ( $element.hasClass('cmb2-media-status') ) {
|
| 621 |
+
// special case for image previews
|
| 622 |
+
val = $element.html();
|
| 623 |
+
} else if ( 'checkbox' === $element.attr('type') || 'radio' === $element.attr('type') ) {
|
| 624 |
+
val = $element.is(':checked');
|
| 625 |
+
} else if ( 'select' === $element.prop('tagName') ) {
|
| 626 |
+
val = $element.is(':selected');
|
| 627 |
+
} else {
|
| 628 |
+
val = $element.val();
|
| 629 |
+
}
|
| 630 |
+
// Get all the current values per element
|
| 631 |
+
inputVals.push( { val: val, $: $element } );
|
| 632 |
+
});
|
| 633 |
+
// And swap them all
|
| 634 |
+
$goto.find( cmb.repeatEls ).each( function( index ) {
|
| 635 |
+
var $element = $(this);
|
| 636 |
+
var val;
|
| 637 |
+
|
| 638 |
+
if ( $element.hasClass('cmb2-media-status') ) {
|
| 639 |
+
// special case for image previews
|
| 640 |
+
val = $element.html();
|
| 641 |
+
$element.html( inputVals[ index ].val );
|
| 642 |
+
inputVals[ index ].$.html( val );
|
| 643 |
+
|
| 644 |
+
}
|
| 645 |
+
// handle checkbox swapping
|
| 646 |
+
else if ( 'checkbox' === $element.attr('type') || 'radio' === $element.attr( 'type' ) ) {
|
| 647 |
+
inputVals[ index ].$.prop( 'checked', $element.is(':checked') );
|
| 648 |
+
$element.prop( 'checked', inputVals[ index ].val );
|
| 649 |
+
}
|
| 650 |
+
// handle select swapping
|
| 651 |
+
else if ( 'select' === $element.prop('tagName') ) {
|
| 652 |
+
inputVals[ index ].$.prop( 'selected', $element.is(':selected') );
|
| 653 |
+
$element.prop( 'selected', inputVals[ index ].val );
|
| 654 |
+
}
|
| 655 |
+
// handle normal input swapping
|
| 656 |
+
else {
|
| 657 |
+
inputVals[ index ].$.val( $element.val() );
|
| 658 |
+
$element.val( inputVals[ index ].val );
|
| 659 |
+
}
|
| 660 |
+
});
|
| 661 |
+
|
| 662 |
+
// shift done
|
| 663 |
+
$self.trigger( 'cmb2_shift_rows_complete', $self );
|
| 664 |
+
};
|
| 665 |
+
|
| 666 |
+
cmb.initPickers = function( $timePickers, $datePickers, $colorPickers ) {
|
| 667 |
+
// Initialize timepicker
|
| 668 |
+
cmb.initTimePickers( $timePickers );
|
| 669 |
+
|
| 670 |
+
// Initialize jQuery UI datepicker
|
| 671 |
+
cmb.initDatePickers( $datePickers );
|
| 672 |
+
|
| 673 |
+
// Initialize color picker
|
| 674 |
+
cmb.initColorPickers( $colorPickers );
|
| 675 |
+
};
|
| 676 |
+
|
| 677 |
+
cmb.initTimePickers = function( $selector ) {
|
| 678 |
+
if ( ! $selector.length ) {
|
| 679 |
+
return;
|
| 680 |
+
}
|
| 681 |
+
|
| 682 |
+
$selector.timePicker( cmb.defaults.time_picker );
|
| 683 |
+
};
|
| 684 |
+
|
| 685 |
+
cmb.initDatePickers = function( $selector ) {
|
| 686 |
+
if ( ! $selector.length ) {
|
| 687 |
+
return;
|
| 688 |
+
}
|
| 689 |
+
|
| 690 |
+
$selector.datepicker( "destroy" );
|
| 691 |
+
$selector.datepicker( cmb.defaults.date_picker );
|
| 692 |
+
};
|
| 693 |
+
|
| 694 |
+
cmb.initColorPickers = function( $selector ) {
|
| 695 |
+
if ( ! $selector.length ) {
|
| 696 |
+
return;
|
| 697 |
+
}
|
| 698 |
+
if (typeof jQuery.wp === 'object' && typeof jQuery.wp.wpColorPicker === 'function') {
|
| 699 |
+
|
| 700 |
+
$selector.wpColorPicker( cmb.defaults.color_picker );
|
| 701 |
+
|
| 702 |
+
} else {
|
| 703 |
+
$selector.each( function(i) {
|
| 704 |
+
$(this).after('<div id="picker-' + i + '" style="z-index: 1000; background: #EEE; border: 1px solid #CCC; position: absolute; display: block;"></div>');
|
| 705 |
+
$id( 'picker-' + i ).hide().farbtastic($(this));
|
| 706 |
+
})
|
| 707 |
+
.focus( function() {
|
| 708 |
+
$(this).next().show();
|
| 709 |
+
})
|
| 710 |
+
.blur( function() {
|
| 711 |
+
$(this).next().hide();
|
| 712 |
+
});
|
| 713 |
+
}
|
| 714 |
+
};
|
| 715 |
+
|
| 716 |
+
cmb.makeListSortable = function() {
|
| 717 |
+
var $filelist = cmb.metabox().find( '.cmb2-media-status.cmb-attach-list' );
|
| 718 |
+
if ( $filelist.length ) {
|
| 719 |
+
$filelist.sortable({ cursor: "move" }).disableSelection();
|
| 720 |
+
}
|
| 721 |
+
};
|
| 722 |
+
|
| 723 |
+
cmb.maybeOembed = function( evt ) {
|
| 724 |
+
var $self = $(this);
|
| 725 |
+
var type = evt.type;
|
| 726 |
+
|
| 727 |
+
var m = {
|
| 728 |
+
focusout : function() {
|
| 729 |
+
setTimeout( function() {
|
| 730 |
+
// if it's been 2 seconds, hide our spinner
|
| 731 |
+
cmb.spinner( '.postbox .cmb2-metabox', true );
|
| 732 |
+
}, 2000);
|
| 733 |
+
},
|
| 734 |
+
keyup : function() {
|
| 735 |
+
var betw = function( min, max ) {
|
| 736 |
+
return ( evt.which <= max && evt.which >= min );
|
| 737 |
+
};
|
| 738 |
+
// Only Ajax on normal keystrokes
|
| 739 |
+
if ( betw( 48, 90 ) || betw( 96, 111 ) || betw( 8, 9 ) || evt.which === 187 || evt.which === 190 ) {
|
| 740 |
+
// fire our ajax function
|
| 741 |
+
cmb.doAjax( $self, evt);
|
| 742 |
+
}
|
| 743 |
+
},
|
| 744 |
+
paste : function() {
|
| 745 |
+
// paste event is fired before the value is filled, so wait a bit
|
| 746 |
+
setTimeout( function() { cmb.doAjax( $self ); }, 100);
|
| 747 |
+
}
|
| 748 |
+
};
|
| 749 |
+
m[type]();
|
| 750 |
+
|
| 751 |
+
};
|
| 752 |
+
|
| 753 |
+
/**
|
| 754 |
+
* Resize oEmbed videos to fit in their respective metaboxes
|
| 755 |
+
*/
|
| 756 |
+
cmb.resizeoEmbeds = function() {
|
| 757 |
+
cmb.metabox().each( function() {
|
| 758 |
+
var $self = $(this);
|
| 759 |
+
var $tableWrap = $self.parents('.inside');
|
| 760 |
+
var isSide = $self.parents('.inner-sidebar').length || $self.parents( '#side-sortables' ).length;
|
| 761 |
+
var isSmall = isSide;
|
| 762 |
+
var isSmallest = false;
|
| 763 |
+
if ( ! $tableWrap.length ) {
|
| 764 |
+
return true; // continue
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
// Calculate new width
|
| 768 |
+
var tableW = $tableWrap.width();
|
| 769 |
+
|
| 770 |
+
if ( cmb.styleBreakPoint > tableW ) {
|
| 771 |
+
isSmall = true;
|
| 772 |
+
isSmallest = ( cmb.styleBreakPoint - 62 ) > tableW;
|
| 773 |
+
}
|
| 774 |
+
|
| 775 |
+
tableW = isSmall ? tableW : Math.round(($tableWrap.width() * 0.82)*0.97);
|
| 776 |
+
var newWidth = tableW - 30;
|
| 777 |
+
if ( isSmall && ! isSide && ! isSmallest ) {
|
| 778 |
+
newWidth = newWidth - 75;
|
| 779 |
+
}
|
| 780 |
+
if ( newWidth > 639 ) {
|
| 781 |
+
return true; // continue
|
| 782 |
+
}
|
| 783 |
+
|
| 784 |
+
var $embeds = $self.find('.cmb-type-oembed .embed-status');
|
| 785 |
+
var $children = $embeds.children().not('.cmb2-remove-wrapper');
|
| 786 |
+
if ( ! $children.length ) {
|
| 787 |
+
return true; // continue
|
| 788 |
+
}
|
| 789 |
+
|
| 790 |
+
$children.each( function() {
|
| 791 |
+
var $self = $(this);
|
| 792 |
+
var iwidth = $self.width();
|
| 793 |
+
var iheight = $self.height();
|
| 794 |
+
var _newWidth = newWidth;
|
| 795 |
+
if ( $self.parents( '.cmb-repeat-row' ).length && ! isSmall ) {
|
| 796 |
+
// Make room for our repeatable "remove" button column
|
| 797 |
+
_newWidth = newWidth - 91;
|
| 798 |
+
_newWidth = 785 > tableW ? _newWidth - 15 : _newWidth;
|
| 799 |
+
}
|
| 800 |
+
// Calc new height
|
| 801 |
+
var newHeight = Math.round((_newWidth * iheight)/iwidth);
|
| 802 |
+
$self.width(_newWidth).height(newHeight);
|
| 803 |
+
});
|
| 804 |
+
|
| 805 |
+
});
|
| 806 |
+
};
|
| 807 |
+
|
| 808 |
+
/**
|
| 809 |
+
* Safely log things if query var is set
|
| 810 |
+
* @since 1.0.0
|
| 811 |
+
*/
|
| 812 |
+
cmb.log = function() {
|
| 813 |
+
if ( l10n.script_debug && console && typeof console.log === 'function' ) {
|
| 814 |
+
console.log.apply(console, arguments);
|
| 815 |
+
}
|
| 816 |
+
};
|
| 817 |
+
|
| 818 |
+
cmb.spinner = function( $context, hide ) {
|
| 819 |
+
if ( hide ) {
|
| 820 |
+
$('.cmb-spinner', $context ).hide();
|
| 821 |
+
}
|
| 822 |
+
else {
|
| 823 |
+
$('.cmb-spinner', $context ).show();
|
| 824 |
+
}
|
| 825 |
+
};
|
| 826 |
+
|
| 827 |
+
// function for running our ajax
|
| 828 |
+
cmb.doAjax = function($obj) {
|
| 829 |
+
// get typed value
|
| 830 |
+
var oembed_url = $obj.val();
|
| 831 |
+
// only proceed if the field contains more than 6 characters
|
| 832 |
+
if ( oembed_url.length < 6 ) {
|
| 833 |
+
return;
|
| 834 |
+
}
|
| 835 |
+
|
| 836 |
+
// only proceed if the user has pasted, pressed a number, letter, or whitelisted characters
|
| 837 |
+
|
| 838 |
+
// get field id
|
| 839 |
+
var field_id = $obj.attr('id');
|
| 840 |
+
// get our inputs $context for pinpointing
|
| 841 |
+
var $context = $obj.parents('.cmb-repeat-table .cmb-row .cmb-td');
|
| 842 |
+
$context = $context.length ? $context : $obj.parents('.cmb2-metabox .cmb-row .cmb-td');
|
| 843 |
+
|
| 844 |
+
var embed_container = $('.embed-status', $context);
|
| 845 |
+
var oembed_width = $obj.width();
|
| 846 |
+
var child_el = $(':first-child', embed_container);
|
| 847 |
+
|
| 848 |
+
// http://www.youtube.com/watch?v=dGG7aru2S6U
|
| 849 |
+
cmb.log( 'oembed_url', oembed_url, field_id );
|
| 850 |
+
oembed_width = ( embed_container.length && child_el.length ) ? child_el.width() : $obj.width();
|
| 851 |
+
|
| 852 |
+
// show our spinner
|
| 853 |
+
cmb.spinner( $context );
|
| 854 |
+
// clear out previous results
|
| 855 |
+
$('.embed_wrap', $context).html('');
|
| 856 |
+
// and run our ajax function
|
| 857 |
+
setTimeout( function() {
|
| 858 |
+
// if they haven't typed in 500 ms
|
| 859 |
+
if ( $('.cmb2-oembed:focus').val() !== oembed_url ) {
|
| 860 |
+
return;
|
| 861 |
+
}
|
| 862 |
+
$.ajax({
|
| 863 |
+
type : 'post',
|
| 864 |
+
dataType : 'json',
|
| 865 |
+
url : l10n.ajaxurl,
|
| 866 |
+
data : {
|
| 867 |
+
'action': 'cmb2_oembed_handler',
|
| 868 |
+
'oembed_url': oembed_url,
|
| 869 |
+
'oembed_width': oembed_width > 300 ? oembed_width : 300,
|
| 870 |
+
'field_id': field_id,
|
| 871 |
+
'object_id': $obj.data('objectid'),
|
| 872 |
+
'object_type': $obj.data('objecttype'),
|
| 873 |
+
'cmb2_ajax_nonce': l10n.ajax_nonce
|
| 874 |
+
},
|
| 875 |
+
success: function(response) {
|
| 876 |
+
cmb.log( response );
|
| 877 |
+
// hide our spinner
|
| 878 |
+
cmb.spinner( $context, true );
|
| 879 |
+
// and populate our results from ajax response
|
| 880 |
+
$('.embed_wrap', $context).html(response.data);
|
| 881 |
+
}
|
| 882 |
+
});
|
| 883 |
+
|
| 884 |
+
}, 500);
|
| 885 |
+
};
|
| 886 |
+
|
| 887 |
+
$(document).ready(cmb.init);
|
| 888 |
+
|
| 889 |
+
return cmb;
|
| 890 |
+
|
| 891 |
+
})(window, document, jQuery);
|
cmb2/js/cmb2.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
window.CMB2=function(window,document,$){"use strict";var l10n=window.cmb2_l10,setTimeout=window.setTimeout,cmb={formfield:"",idNumber:!1,file_frames:{},repeatEls:'input:not([type="button"]),select,textarea,.cmb2-media-status',styleBreakPoint:450,mediaHandlers:{},defaults:{time_picker:l10n.defaults.time_picker,date_picker:l10n.defaults.date_picker,color_picker:l10n.defaults.color_picker||{}}},$id=function(selector){return $(document.getElementById(selector))};return cmb.metabox=function(){return cmb.$metabox?cmb.$metabox:(cmb.$metabox=$(".cmb2-wrap > .cmb2-metabox"),cmb.$metabox)},cmb.init=function(){cmb.log("CMB2 localized data",l10n);var $metabox=cmb.metabox(),$repeatGroup=$metabox.find(".cmb-repeatable-group");cmb.initPickers($metabox.find('input[type="text"].cmb2-timepicker'),$metabox.find('input[type="text"].cmb2-datepicker'),$metabox.find('input[type="text"].cmb2-colorpicker')),$id("ui-datepicker-div").wrap('<div class="cmb2-element" />'),$('<p><span class="button cmb-multicheck-toggle">'+l10n.strings.check_toggle+"</span></p>").insertBefore(".cmb2-checkbox-list:not(.no-select-all)"),cmb.makeListSortable(),$metabox.on("change",".cmb2_upload_file",function(){cmb.formfield=$(this).attr("id"),$id(cmb.formfield+"_id").val("")}).on("click",".cmb-multicheck-toggle",cmb.toggleCheckBoxes).on("click",".cmb2-upload-button",cmb.handleMedia).on("click",".cmb-attach-list li, .cmb2-media-status .img-status img, .cmb2-media-status .file-status > span",cmb.handleFileClick).on("click",".cmb2-remove-file-button",cmb.handleRemoveMedia).on("click",".cmb-add-group-row",cmb.addGroupRow).on("click",".cmb-add-row-button",cmb.addAjaxRow).on("click",".cmb-remove-group-row",cmb.removeGroupRow).on("click",".cmb-remove-row-button",cmb.removeAjaxRow).on("keyup paste focusout",".cmb2-oembed",cmb.maybeOembed).on("cmb2_remove_row",".cmb-repeatable-group",cmb.resetTitlesAndIterator).on("click",".cmbhandle, .cmbhandle + .cmbhandle-title",cmb.toggleHandle),$repeatGroup.length&&$repeatGroup.filter(".sortable").each(function(){$(this).find(".button.cmb-remove-group-row").before('<a class="button cmb-shift-rows move-up alignleft" href="#"><span class="'+l10n.up_arrow_class+'"></span></a> <a class="button cmb-shift-rows move-down alignleft" href="#"><span class="'+l10n.down_arrow_class+'"></span></a>')}).on("click",".cmb-shift-rows",cmb.shiftRows).on("cmb2_add_row",cmb.emptyValue),setTimeout(cmb.resizeoEmbeds,500),$(window).on("resize",cmb.resizeoEmbeds)},cmb.resetTitlesAndIterator=function(){$(".cmb-repeatable-group").each(function(){var $table=$(this);$table.find(".cmb-repeatable-grouping").each(function(rowindex){var $row=$(this);$row.data("iterator",rowindex),$row.find(".cmb-group-title h4").text($table.find(".cmb-add-group-row").data("grouptitle").replace("{#}",rowindex+1))})})},cmb.toggleHandle=function(evt){evt.preventDefault(),$(document).trigger("postbox-toggled",$(this).parent(".postbox").toggleClass("closed"))},cmb.toggleCheckBoxes=function(evt){evt.preventDefault();var $self=$(this),$multicheck=$self.closest(".cmb-td").find("input[type=checkbox]");$self.data("checked")?($multicheck.prop("checked",!1),$self.data("checked",!1)):($multicheck.prop("checked",!0),$self.data("checked",!0))},cmb.handleMedia=function(evt){evt.preventDefault();var $el=$(this);cmb.attach_id=$el.hasClass("cmb2-upload-list")?!1:$el.closest(".cmb-td").find(".cmb2-upload-file-id").val(),cmb.attach_id="0"!==cmb.attach_id?cmb.attach_id:!1,cmb._handleMedia($el.prev("input.cmb2-upload-file").attr("id"),$el.hasClass("cmb2-upload-list"))},cmb.handleFileClick=function(evt){evt.preventDefault();var $el=$(this),$td=$el.closest(".cmb-td"),isList=$td.find(".cmb2-upload-button").hasClass("cmb2-upload-list");cmb.attach_id=isList?$el.find('input[type="hidden"]').data("id"):$td.find(".cmb2-upload-file-id").val(),cmb.attach_id&&cmb._handleMedia($td.find("input.cmb2-upload-file").attr("id"),isList,cmb.attach_id)},cmb._handleMedia=function(formfield,isList){if(wp){var $metabox=cmb.metabox();cmb.formfield=formfield;var $formfield=$id(cmb.formfield),previewSize=$formfield.data("previewsize"),formName=$formfield.attr("name"),uploadStatus=!0,attachment=!0;if(cmb.formfield in cmb.file_frames)return void cmb.file_frames[cmb.formfield].open();cmb.file_frames[cmb.formfield]=wp.media({title:$metabox.find("label[for="+cmb.formfield+"]").text(),button:{text:l10n.strings.upload_file},multiple:isList?!0:!1}),cmb.mediaHandlers.list=function(selection,returnIt){attachment=selection.toJSON(),$formfield.val(attachment.url),$id(cmb.formfield+"_id").val(attachment.id);var fileGroup=[];return $(attachment).each(function(){if(this.type&&"image"===this.type){var width=previewSize[0]?previewSize[0]:50,height=previewSize[1]?previewSize[1]:50;uploadStatus='<li class="img-status"><img width="'+width+'" height="'+height+'" src="'+this.url+'" class="attachment-'+width+"px"+height+'px" alt="'+this.filename+'"><p><a href="#" class="cmb2-remove-file-button" rel="'+cmb.formfield+"["+this.id+']">'+l10n.strings.remove_image+'</a></p><input type="hidden" id="filelist-'+this.id+'" data-id="'+this.id+'" name="'+formName+"["+this.id+']" value="'+this.url+'"></li>'}else uploadStatus='<li class="file-status"><span>'+l10n.strings.file+" <strong>"+this.filename+'</strong></span> (<a href="'+this.url+'" target="_blank" rel="external">'+l10n.strings.download+'</a> / <a href="#" class="cmb2-remove-file-button" rel="'+cmb.formfield+"["+this.id+']">'+l10n.strings.remove_file+'</a>)<input type="hidden" id="filelist-'+this.id+'" data-id="'+this.id+'" name="'+formName+"["+this.id+']" value="'+this.url+'"></li>';fileGroup.push(uploadStatus)}),returnIt?fileGroup:void $(fileGroup).each(function(){$formfield.siblings(".cmb2-media-status").slideDown().append(this)})},cmb.mediaHandlers.single=function(selection){if(attachment=selection.first().toJSON(),$formfield.val(attachment.url),$id(cmb.formfield+"_id").val(attachment.id),attachment.type&&"image"===attachment.type){var width=previewSize[0]?previewSize[0]:350;uploadStatus='<div class="img-status"><img width="'+width+'px" style="max-width: '+width+'px; width: 100%; height: auto;" src="'+attachment.url+'" alt="'+attachment.filename+'" title="'+attachment.filename+'" /><p><a href="#" class="cmb2-remove-file-button" rel="'+cmb.formfield+'">'+l10n.strings.remove_image+"</a></p></div>"}else uploadStatus='<div class="file-status"><span>'+l10n.strings.file+" <strong>"+attachment.filename+'</strong></span> (<a href="'+attachment.url+'" target="_blank" rel="external">'+l10n.strings.download+'</a> / <a href="#" class="cmb2-remove-file-button" rel="'+cmb.formfield+'">'+l10n.strings.remove_file+"</a>)</div>";$formfield.siblings(".cmb2-media-status").slideDown().html(uploadStatus)},cmb.mediaHandlers.selectFile=function(){var selection=cmb.file_frames[cmb.formfield].state().get("selection"),type=isList?"list":"single";return cmb.attach_id&&isList?void $('[data-id="'+cmb.attach_id+'"]').parents("li").replaceWith(cmb.mediaHandlers.list(selection,!0)):void cmb.mediaHandlers[type](selection)},cmb.mediaHandlers.openModal=function(){var selection=cmb.file_frames[cmb.formfield].state().get("selection");if(!cmb.attach_id)return selection.reset();var attach=wp.media.attachment(cmb.attach_id);attach.fetch(),selection.set(attach?[attach]:[])},cmb.file_frames[cmb.formfield].on("select",cmb.mediaHandlers.selectFile).on("open",cmb.mediaHandlers.openModal),cmb.file_frames[cmb.formfield].open()}},cmb.handleRemoveMedia=function(evt){evt.preventDefault();var $self=$(this);return $self.is(".cmb-attach-list .cmb2-remove-file-button")?($self.parents("li").remove(),!1):(cmb.formfield=$self.attr("rel"),cmb.metabox().find("input#"+cmb.formfield).val(""),cmb.metabox().find("input#"+cmb.formfield+"_id").val(""),$self.parents(".cmb2-media-status").html(""),!1)},$.fn.cleanRow=function(prevNum,group){var $self=$(this),$inputs=$self.find('input:not([type="button"]), select, textarea, label'),$other=$self.find("[id]").not('input:not([type="button"]), select, textarea, label');return group&&($self.find(".cmb-repeat-table .cmb-repeat-row:not(:first-child)").remove(),$other.length&&$other.each(function(){var $_this=$(this),oldID=$_this.attr("id"),newID=oldID.replace("_"+prevNum,"_"+cmb.idNumber),$buttons=$self.find('[data-selector="'+oldID+'"]');$_this.attr("id",newID),$buttons.length&&$buttons.attr("data-selector",newID).data("selector",newID)})),cmb.neweditor_id=[],$inputs.filter(":checked").prop("checked",!1),$inputs.filter(":selected").prop("selected",!1),$self.find("h3.cmb-group-title").length&&$self.find("h3.cmb-group-title").text($self.data("title").replace("{#}",cmb.idNumber+1)),$inputs.each(function(){var newID,oldID,$newInput=$(this),isEditor=$newInput.hasClass("wp-editor-area"),oldFor=$newInput.attr("for"),attrs={};if(oldFor)attrs={"for":oldFor.replace("_"+prevNum,"_"+cmb.idNumber)};else{var oldName=$newInput.attr("name"),newName=oldName?oldName.replace("["+prevNum+"]","["+cmb.idNumber+"]"):"";oldID=$newInput.attr("id"),newID=oldID?oldID.replace("_"+prevNum,"_"+cmb.idNumber):"",attrs={id:newID,name:newName,"data-iterator":cmb.idNumber}}if($newInput.removeClass("hasDatepicker").attr(attrs).val(""),isEditor){newID=newID?oldID.replace("zx"+prevNum,"zx"+cmb.idNumber):"",$newInput.html("");var $wysiwyg=$newInput.parents(".cmb-type-wysiwyg");$wysiwyg.find(".mce-tinymce:not(:first-child)").remove();var html=$wysiwyg.html().replace(new RegExp(oldID,"g"),newID);$wysiwyg.html(html),cmb.neweditor_id.push({id:newID,old:oldID})}}),this},$.fn.newRowHousekeeping=function(){var $row=$(this),$colorPicker=$row.find(".wp-picker-container"),$list=$row.find(".cmb2-media-status");return $colorPicker.length&&$colorPicker.each(function(){var $td=$(this).parent();$td.html($td.find('input[type="text"].cmb2-colorpicker').attr("style",""))}),$list.length&&$list.empty(),this},cmb.afterRowInsert=function($row,group){var $focus=$row.find('input:not([type="button"]), textarea, select').first();$focus.length&&(group&&$("html, body").animate({scrollTop:Math.round($focus.offset().top-150)},1e3),$focus.focus());var _prop;if(cmb.neweditor_id.length){var i;for(i=cmb.neweditor_id.length-1;i>=0;i--){var id=cmb.neweditor_id[i].id,old=cmb.neweditor_id[i].old;if("undefined"==typeof tinyMCEPreInit.mceInit[id]){var newSettings=jQuery.extend({},tinyMCEPreInit.mceInit[old]);for(_prop in newSettings)"string"==typeof newSettings[_prop]&&(newSettings[_prop]=newSettings[_prop].replace(new RegExp(old,"g"),id));tinyMCEPreInit.mceInit[id]=newSettings}if("undefined"==typeof tinyMCEPreInit.qtInit[id]){var newQTS=jQuery.extend({},tinyMCEPreInit.qtInit[old]);for(_prop in newQTS)"string"==typeof newQTS[_prop]&&(newQTS[_prop]=newQTS[_prop].replace(new RegExp(old,"g"),id));tinyMCEPreInit.qtInit[id]=newQTS}tinyMCE.init({id:tinyMCEPreInit.mceInit[id]})}}cmb.initPickers($row.find('input[type="text"].cmb2-timepicker'),$row.find('input[type="text"].cmb2-datepicker'),$row.find('input[type="text"].cmb2-colorpicker'))},cmb.updateNameAttr=function(){var $this=$(this),name=$this.attr("name");if("undefined"==typeof name)return!1;var prevNum=parseInt($this.parents(".cmb-repeatable-grouping").data("iterator")),newNum=prevNum-1,$newName=name.replace("["+prevNum+"]","["+newNum+"]");$this.attr("name",$newName)},cmb.emptyValue=function(evt,row){$('input:not([type="button"]), textarea',row).val("")},cmb.addGroupRow=function(evt){evt.preventDefault();var $self=$(this);$self.trigger("cmb2_add_group_row_start",$self);var $table=$id($self.data("selector")),$oldRow=$table.find(".cmb-repeatable-grouping").last(),prevNum=parseInt($oldRow.data("iterator"));cmb.idNumber=prevNum+1;var $row=$oldRow.clone();$row.data("title",$self.data("grouptitle")).newRowHousekeeping().cleanRow(prevNum,!0).find(".cmb-add-row-button").prop("disabled",!1);var $newRow=$('<div class="postbox cmb-row cmb-repeatable-grouping" data-iterator="'+cmb.idNumber+'">'+$row.html()+"</div>");$oldRow.after($newRow),cmb.afterRowInsert($newRow,!0),$table.find(".cmb-repeatable-grouping").length<=1?$table.find(".cmb-remove-group-row").prop("disabled",!0):$table.find(".cmb-remove-group-row").prop("disabled",!1),$table.trigger("cmb2_add_row",$newRow)},cmb.addAjaxRow=function(evt){evt.preventDefault();var $self=$(this),$table=$id($self.data("selector")),$emptyrow=$table.find(".empty-row"),prevNum=parseInt($emptyrow.find("[data-iterator]").data("iterator"));cmb.idNumber=prevNum+1;var $row=$emptyrow.clone();$row.newRowHousekeeping().cleanRow(prevNum),$emptyrow.removeClass("empty-row hidden").addClass("cmb-repeat-row"),$emptyrow.after($row),cmb.afterRowInsert($row),$table.trigger("cmb2_add_row",$row),$table.find(".cmb-remove-row-button").removeClass("button-disabled")},cmb.removeGroupRow=function(evt){evt.preventDefault();var $self=$(this),$table=$id($self.data("selector")),$parent=$self.parents(".cmb-repeatable-grouping"),number=$table.find(".cmb-repeatable-grouping").length;number>1&&($table.trigger("cmb2_remove_group_row_start",$self),$parent.nextAll(".cmb-repeatable-grouping").find(cmb.repeatEls).each(cmb.updateNameAttr),$parent.remove(),2>=number?$table.find(".cmb-remove-group-row").prop("disabled",!0):$table.find(".cmb-remove-group-row").prop("disabled",!1),$table.trigger("cmb2_remove_row"))},cmb.removeAjaxRow=function(evt){evt.preventDefault();var $self=$(this);if(!$self.hasClass("button-disabled")){var $parent=$self.parents(".cmb-row"),$table=$self.parents(".cmb-repeat-table"),number=$table.find(".cmb-row").length;number>2?($parent.hasClass("empty-row")&&$parent.prev().addClass("empty-row").removeClass("cmb-repeat-row"),$self.parents(".cmb-repeat-table .cmb-row").remove(),3===number&&$table.find(".cmb-remove-row-button").addClass("button-disabled"),$table.trigger("cmb2_remove_row")):$self.addClass("button-disabled")}},cmb.shiftRows=function(evt){evt.preventDefault();var $self=$(this);$self.trigger("cmb2_shift_rows_enter",$self);var $parent=$self.parents(".cmb-repeatable-grouping"),$goto=$self.hasClass("move-up")?$parent.prev(".cmb-repeatable-grouping"):$parent.next(".cmb-repeatable-grouping");if($goto.length){$self.trigger("cmb2_shift_rows_start",$self);var inputVals=[];$parent.find(cmb.repeatEls).each(function(){var val,$element=$(this);val=$element.hasClass("cmb2-media-status")?$element.html():"checkbox"===$element.attr("type")||"radio"===$element.attr("type")?$element.is(":checked"):"select"===$element.prop("tagName")?$element.is(":selected"):$element.val(),inputVals.push({val:val,$:$element})}),$goto.find(cmb.repeatEls).each(function(index){var val,$element=$(this);$element.hasClass("cmb2-media-status")?(val=$element.html(),$element.html(inputVals[index].val),inputVals[index].$.html(val)):"checkbox"===$element.attr("type")||"radio"===$element.attr("type")?(inputVals[index].$.prop("checked",$element.is(":checked")),$element.prop("checked",inputVals[index].val)):"select"===$element.prop("tagName")?(inputVals[index].$.prop("selected",$element.is(":selected")),$element.prop("selected",inputVals[index].val)):(inputVals[index].$.val($element.val()),$element.val(inputVals[index].val))}),$self.trigger("cmb2_shift_rows_complete",$self)}},cmb.initPickers=function($timePickers,$datePickers,$colorPickers){cmb.initTimePickers($timePickers),cmb.initDatePickers($datePickers),cmb.initColorPickers($colorPickers)},cmb.initTimePickers=function($selector){$selector.length&&$selector.timePicker(cmb.defaults.time_picker)},cmb.initDatePickers=function($selector){$selector.length&&($selector.datepicker("destroy"),$selector.datepicker(cmb.defaults.date_picker))},cmb.initColorPickers=function($selector){$selector.length&&("object"==typeof jQuery.wp&&"function"==typeof jQuery.wp.wpColorPicker?$selector.wpColorPicker(cmb.defaults.color_picker):$selector.each(function(i){$(this).after('<div id="picker-'+i+'" style="z-index: 1000; background: #EEE; border: 1px solid #CCC; position: absolute; display: block;"></div>'),$id("picker-"+i).hide().farbtastic($(this))}).focus(function(){$(this).next().show()}).blur(function(){$(this).next().hide()}))},cmb.makeListSortable=function(){var $filelist=cmb.metabox().find(".cmb2-media-status.cmb-attach-list");$filelist.length&&$filelist.sortable({cursor:"move"}).disableSelection()},cmb.maybeOembed=function(evt){var $self=$(this),type=evt.type,m={focusout:function(){setTimeout(function(){cmb.spinner(".postbox .cmb2-metabox",!0)},2e3)},keyup:function(){var betw=function(min,max){return evt.which<=max&&evt.which>=min};(betw(48,90)||betw(96,111)||betw(8,9)||187===evt.which||190===evt.which)&&cmb.doAjax($self,evt)},paste:function(){setTimeout(function(){cmb.doAjax($self)},100)}};m[type]()},cmb.resizeoEmbeds=function(){cmb.metabox().each(function(){var $self=$(this),$tableWrap=$self.parents(".inside"),isSide=$self.parents(".inner-sidebar").length||$self.parents("#side-sortables").length,isSmall=isSide,isSmallest=!1;if(!$tableWrap.length)return!0;var tableW=$tableWrap.width();cmb.styleBreakPoint>tableW&&(isSmall=!0,isSmallest=cmb.styleBreakPoint-62>tableW),tableW=isSmall?tableW:Math.round(.82*$tableWrap.width()*.97);var newWidth=tableW-30;if(!isSmall||isSide||isSmallest||(newWidth-=75),newWidth>639)return!0;var $embeds=$self.find(".cmb-type-oembed .embed-status"),$children=$embeds.children().not(".cmb2-remove-wrapper");return $children.length?void $children.each(function(){var $self=$(this),iwidth=$self.width(),iheight=$self.height(),_newWidth=newWidth;$self.parents(".cmb-repeat-row").length&&!isSmall&&(_newWidth=newWidth-91,_newWidth=785>tableW?_newWidth-15:_newWidth);var newHeight=Math.round(_newWidth*iheight/iwidth);$self.width(_newWidth).height(newHeight)}):!0})},cmb.log=function(){l10n.script_debug&&console&&"function"==typeof console.log&&console.log.apply(console,arguments)},cmb.spinner=function($context,hide){hide?$(".cmb-spinner",$context).hide():$(".cmb-spinner",$context).show()},cmb.doAjax=function($obj){var oembed_url=$obj.val();if(!(oembed_url.length<6)){var field_id=$obj.attr("id"),$context=$obj.parents(".cmb-repeat-table .cmb-row .cmb-td");$context=$context.length?$context:$obj.parents(".cmb2-metabox .cmb-row .cmb-td");var embed_container=$(".embed-status",$context),oembed_width=$obj.width(),child_el=$(":first-child",embed_container);cmb.log("oembed_url",oembed_url,field_id),oembed_width=embed_container.length&&child_el.length?child_el.width():$obj.width(),cmb.spinner($context),$(".embed_wrap",$context).html(""),setTimeout(function(){$(".cmb2-oembed:focus").val()===oembed_url&&$.ajax({type:"post",dataType:"json",url:l10n.ajaxurl,data:{action:"cmb2_oembed_handler",oembed_url:oembed_url,oembed_width:oembed_width>300?oembed_width:300,field_id:field_id,object_id:$obj.data("objectid"),object_type:$obj.data("objecttype"),cmb2_ajax_nonce:l10n.ajax_nonce},success:function(response){cmb.log(response),cmb.spinner($context,!0),$(".embed_wrap",$context).html(response.data)}})},500)}},$(document).ready(cmb.init),cmb}(window,document,jQuery);
|
cmb2/js/index.php
ADDED
|
File without changes
|
cmb2/js/jquery.timePicker.min.js
ADDED
|
@@ -0,0 +1,13 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* A time picker for jQuery.
|
| 3 |
+
*
|
| 4 |
+
* Dual licensed under the MIT and GPL licenses.
|
| 5 |
+
* Copyright (c) 2009 Anders Fajerson
|
| 6 |
+
*
|
| 7 |
+
* @name timePicker
|
| 8 |
+
* @author Anders Fajerson (http://perifer.se)
|
| 9 |
+
* @see http://github.com/perifer/timePicker
|
| 10 |
+
* @example $("#mytime").timePicker();
|
| 11 |
+
* @example $("#mytime").timePicker({step:30, startTime:"15:00", endTime:"18:00"});
|
| 12 |
+
*/
|
| 13 |
+
(function(a){function g(a){a.setFullYear(2001),a.setMonth(0),a.setDate(0);return a}function f(a,b){if(a){var c=a.split(b.separator),d=parseFloat(c[0]),e=parseFloat(c[1]);b.show24Hours||(d===12&&a.indexOf("AM")!==-1?d=0:d!==12&&a.indexOf("PM")!==-1&&(d+=12));var f=new Date(0,0,0,d,e,0);return g(f)}return null}function e(a,b){return typeof a=="object"?g(a):f(a,b)}function d(a){return(a<10?"0":"")+a}function c(a,b){var c=a.getHours(),e=b.show24Hours?c:(c+11)%12+1,f=a.getMinutes();return d(e)+b.separator+d(f)+(b.show24Hours?"":c<12?" AM":" PM")}function b(b,c,d,e){b.value=a(c).text(),a(b).change(),a.browser.msie||b.focus(),d.hide()}a.fn.timePicker=function(b){var c=a.extend({},a.fn.timePicker.defaults,b);return this.each(function(){a.timePicker(this,c)})},a.timePicker=function(b,c){var d=a(b)[0];return d.timePicker||(d.timePicker=new jQuery._timePicker(d,c))},a.timePicker.version="0.3",a._timePicker=function(d,h){var i=!1,j=!1,k=e(h.startTime,h),l=e(h.endTime,h),m="selected",n="li."+m;a(d).attr("autocomplete","OFF");var o=[],p=new Date(k);while(p<=l)o[o.length]=c(p,h),p=new Date(p.setMinutes(p.getMinutes()+h.step));var q=a('<div class="time-picker'+(h.show24Hours?"":" time-picker-12hours")+'"></div>'),r=a("<ul></ul>");for(var s=0;s<o.length;s++)r.append("<li>"+o[s]+"</li>");q.append(r),q.appendTo("body").hide(),q.mouseover(function(){i=!0}).mouseout(function(){i=!1}),a("li",r).mouseover(function(){j||(a(n,q).removeClass(m),a(this).addClass(m))}).mousedown(function(){i=!0}).click(function(){b(d,this,q,h),i=!1});var t=function(){if(q.is(":visible"))return!1;a("li",q).removeClass(m);var b=a(d).offset();q.css({top:b.top+d.offsetHeight,left:b.left}),q.show();var e=d.value?f(d.value,h):k,i=k.getHours()*60+k.getMinutes(),j=e.getHours()*60+e.getMinutes()-i,n=Math.round(j/h.step),o=g(new Date(0,0,0,0,n*h.step+i,0));o=k<o&&o<=l?o:k;var p=a("li:contains("+c(o,h)+")",q);p.length&&(p.addClass(m),q[0].scrollTop=p[0].offsetTop);return!0};a(d).focus(t).click(t),a(d).blur(function(){i||q.hide()});var u=a.browser.opera||a.browser.mozilla?"keypress":"keydown";a(d)[u](function(c){var e;j=!0;var f=q[0].scrollTop;switch(c.keyCode){case 38:if(t())return!1;e=a(n,r);var g=e.prev().addClass(m)[0];g?(e.removeClass(m),g.offsetTop<f&&(q[0].scrollTop=f-g.offsetHeight)):(e.removeClass(m),g=a("li:last",r).addClass(m)[0],q[0].scrollTop=g.offsetTop-g.offsetHeight);return!1;case 40:if(t())return!1;e=a(n,r);var i=e.next().addClass(m)[0];i?(e.removeClass(m),i.offsetTop+i.offsetHeight>f+q[0].offsetHeight&&(q[0].scrollTop=f+i.offsetHeight)):(e.removeClass(m),i=a("li:first",r).addClass(m)[0],q[0].scrollTop=0);return!1;case 13:if(q.is(":visible")){var k=a(n,r)[0];b(d,k,q,h)}return!1;case 27:q.hide();return!1}return!0}),a(d).keyup(function(a){j=!1}),this.getTime=function(){return f(d.value,h)},this.setTime=function(b){d.value=c(e(b,h),h),a(d).change()}},a.fn.timePicker.defaults={step:30,startTime:new Date(0,0,0,0,0,0),endTime:new Date(0,0,0,23,30,0),separator:":",show24Hours:!0}})(jQuery)
|
css/admin_de_style.css
ADDED
|
@@ -0,0 +1,88 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.de_first {clear:left;}
|
| 2 |
+
.de_input input[type=text] {border:2px #dddddd solid !important; box-shadow: 0 0 0 !important;}
|
| 3 |
+
.de_input textarea {border:2px #dddddd solid !important; box-shadow: 0 0 0 !important;}
|
| 4 |
+
.de_input select {width:100% !important;}
|
| 5 |
+
|
| 6 |
+
.de_text {padding:0 !important; margin:0 !important; border:none !important;}
|
| 7 |
+
.de_text .cmb-th {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 8 |
+
.de_text .cmb-td {width:100% !important;}
|
| 9 |
+
.de_text .cmb-td input {width:100% !important;}
|
| 10 |
+
|
| 11 |
+
.de_text_side {padding:0 !important; margin:0 !important;border:none !important;}
|
| 12 |
+
.de_text_side .cmb-th {font-size:14px; width:100% !important; color:#333 !important; padding-bottom:5px !important;}
|
| 13 |
+
.de_text_side .cmb-th label {padding-bottom:0 !important}
|
| 14 |
+
.de_text_side .cmb-th label::after {display:none !important;}
|
| 15 |
+
.de_text_side .cmb-td {width:100% !important;}
|
| 16 |
+
.de_text_side .cmb-td input, .de_text_side .cmb-td select {width:100% !important;}
|
| 17 |
+
.de_text_side p {padding-bottom:0 !important; font-style:normal !important; font-size:12px !important; color:#808080 !important;}
|
| 18 |
+
|
| 19 |
+
.de_color {padding:0 !important; margin:0 !important; border:none !important;}
|
| 20 |
+
.de_color .cmb-th {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 21 |
+
.de_color .cmb-td {width:100% !important;}
|
| 22 |
+
|
| 23 |
+
.de_color_side {padding:0 !important; margin:0 !important; border:none !important;}
|
| 24 |
+
.de_color_side .cmb-th {font-size:14px; width:100% !important; color:#333 !important; padding-bottom:5px !important;}
|
| 25 |
+
.de_color_side .cmb-td {width:100% !important;}
|
| 26 |
+
.de_color_side .cmb-th label {padding-bottom:0 !important}
|
| 27 |
+
.de_color_side .cmb-th label::after {display:none !important;}
|
| 28 |
+
.de_color_side .cmb-td {width:100% !important;}
|
| 29 |
+
|
| 30 |
+
.de_textarea {padding:0 !important; margin:0 !important; border:none !important;}
|
| 31 |
+
.de_textarea .cmb-th {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 32 |
+
.de_textarea .cmb-td {width:100% !important;}
|
| 33 |
+
.de_textarea .cmb-td textarea {width:100% !important;}
|
| 34 |
+
|
| 35 |
+
.de_info {padding:0 !important; margin:0 !important; border:none !important;}
|
| 36 |
+
.de_info .cmb-td h5 {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 37 |
+
.de_info .cmb-td {width:100% !important;}
|
| 38 |
+
.de_info .cmb-td input {width:100% !important;}
|
| 39 |
+
.de_info .cmb-td p {font-size:12px; color:grey !important; font-style:normal !important;}
|
| 40 |
+
|
| 41 |
+
.de_info_side .cmb-td a {font-size:15px !important; text-decoration:none !important;}
|
| 42 |
+
.de_info_side .cmb-td a span {position:relative; top:3px;}
|
| 43 |
+
.de_info_side .cmb-td p {padding:0 !important; color: #bbb; font-size:14px !important;}
|
| 44 |
+
|
| 45 |
+
.de_upload {padding:0 !important; margin:0 !important; border:none !important; padding-top:14px !important;}
|
| 46 |
+
.de_upload .cmb-th {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 47 |
+
.de_upload .cmb-td {width:100% !important;}
|
| 48 |
+
.de_upload .cmb-td input[type=text] {width:80% !important; color:#ccc !important; border:2px whitesmoke solid !important; box-shadow: 0 0 0 !important;}
|
| 49 |
+
.de_upload .cmb-td .button {margin-left:0 !important; width:19% !important; position:relative; top:4px;}
|
| 50 |
+
|
| 51 |
+
.de_heading {padding:0 !important; margin:0 !important; padding-top:14px !important; border:none !important;}
|
| 52 |
+
.de_heading_side {padding:0 !important; margin:0 !important; padding-top:0px !important; border:none !important;}
|
| 53 |
+
.de_heading .cmb-td h5 {font-style:normal !important; color:#0074A2; padding-left:4px; font-size:18px !important; font-weight:400 !important; border-bottom:6px whitesmoke double !important; padding-bottom:5px !important;}
|
| 54 |
+
.de_heading_side .cmb-td h5 {font-style:normal !important; color:#0074A2; padding-left:4px; font-size:18px !important; font-weight:400 !important; border-bottom:6px whitesmoke double !important; padding-bottom:5px !important;}
|
| 55 |
+
|
| 56 |
+
.de_checkbox {padding:0 !important; margin:0 !important; border:none !important;}
|
| 57 |
+
.de_checkbox .cmb-th {font-size:14px; text-transform:uppercase; width:100% !important; color:#333 !important;}
|
| 58 |
+
.de_checkbox .cmb-td {width:100% !important;}
|
| 59 |
+
.de_checkbox .cmb-td label span {font-size:12px; color:grey; font-style:normal !important;}
|
| 60 |
+
|
| 61 |
+
.de_checkbox_side {padding:0 !important; margin:0 !important; border:none !important;}
|
| 62 |
+
.de_checkbox_side .cmb-th {font-size:14px; width:100% !important; color:#333 !important;}
|
| 63 |
+
.de_checkbox_side .cmb-td {width:100% !important;}
|
| 64 |
+
.de_checkbox_side .cmb-th {padding-bottom:0 !important}
|
| 65 |
+
.de_checkbox_side .cmb-th label::after {display:none !important;}
|
| 66 |
+
.de_checkbox_side .cmb-td label span {font-size:12px; color:grey; font-style:normal !important;}
|
| 67 |
+
|
| 68 |
+
.de_thirty {margin-left:1.5% !important; margin-right:1.5% !important; width:27% !important; float:left !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 69 |
+
|
| 70 |
+
.de_fifty {margin-left:1.5% !important; margin-right:1.5% !important; width:47% !important; float:left !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 71 |
+
|
| 72 |
+
.de_twentyfive {margin-left:1.5% !important; margin-right:1.5% !important; width:22% !important; float:left !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 73 |
+
|
| 74 |
+
.de_seventyfive {margin-left:1.5% !important; margin-right:1.5% !important; width:72% !important; float:left !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 75 |
+
|
| 76 |
+
.de_seventy {margin-left:1.5% !important; margin-right:1.5% !important; width:67% !important; float:left !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 77 |
+
|
| 78 |
+
.de_hundred {clear:both; margin-left:1.5% !important; margin-right:1.5% !important; width:97% !important; margin-bottom:14px !important; margin-top:14px !important;}
|
| 79 |
+
|
| 80 |
+
.de_hundred_side {clear:both; margin-left:1.5% !important; margin-right:1.5% !important; width:97% !important; margin-bottom:20px !important; margin-top:24px !important;}
|
| 81 |
+
|
| 82 |
+
@media only screen and (max-width: 1100px) {
|
| 83 |
+
.de_thirty, .de_fifty, .de_twentyfive, .de_seventy, .de_seventyfive, .de_hundred {
|
| 84 |
+
clear:both; margin-left:1.5% !important; margin-right:1.5% !important; width:97% !important; margin-bottom:14px !important; margin-top:14px !important;
|
| 85 |
+
}
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
.de_nomtop {margin-top:0 !important;}
|
css/admin_de_style.min.css
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
.de_first{clear:left}.de_input input[type=text],.de_input textarea{border:2px solid #ddd!important;box-shadow:0 0 0!important}.de_input select{width:100%!important}.de_text{padding:0!important;margin:0!important;border:none!important}.de_text .cmb-th{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_text .cmb-td,.de_text .cmb-td input{width:100%!important}.de_text_side{padding:0!important;margin:0!important;border:none!important}.de_text_side .cmb-th{font-size:14px;width:100%!important;color:#333!important;padding-bottom:5px!important}.de_text_side .cmb-th label{padding-bottom:0!important}.de_text_side .cmb-th label::after{display:none!important}.de_text_side .cmb-td,.de_text_side .cmb-td input,.de_text_side .cmb-td select{width:100%!important}.de_text_side p{padding-bottom:0!important;font-style:normal!important;font-size:12px!important;color:grey!important}.de_color{padding:0!important;margin:0!important;border:none!important}.de_color .cmb-th{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_color .cmb-td{width:100%!important}.de_color_side{padding:0!important;margin:0!important;border:none!important}.de_color_side .cmb-th{font-size:14px;width:100%!important;color:#333!important;padding-bottom:5px!important}.de_color_side .cmb-th label{padding-bottom:0!important}.de_color_side .cmb-th label::after{display:none!important}.de_color_side .cmb-td{width:100%!important}.de_textarea{padding:0!important;margin:0!important;border:none!important}.de_textarea .cmb-th{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_textarea .cmb-td,.de_textarea .cmb-td textarea{width:100%!important}.de_info{padding:0!important;margin:0!important;border:none!important}.de_info .cmb-td h5{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_info .cmb-td,.de_info .cmb-td input{width:100%!important}.de_info .cmb-td p{font-size:12px;color:grey!important;font-style:normal!important}.de_info_side .cmb-td a{font-size:15px!important;text-decoration:none!important}.de_info_side .cmb-td a span{position:relative;top:3px}.de_info_side .cmb-td p{padding:0!important;color:#bbb;font-size:14px!important}.de_upload{padding:14px 0 0!important;margin:0!important;border:none!important}.de_upload .cmb-th{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_upload .cmb-td{width:100%!important}.de_upload .cmb-td input[type=text]{width:80%!important;color:#ccc!important;border:2px solid #f5f5f5!important;box-shadow:0 0 0!important}.de_upload .cmb-td .button{margin-left:0!important;width:19%!important;position:relative;top:4px}.de_heading{padding:14px 0 0!important;margin:0!important;border:none!important}.de_heading_side{padding:0!important;margin:0!important;border:none!important}.de_heading .cmb-td h5,.de_heading_side .cmb-td h5{font-style:normal!important;color:#0074A2;padding-left:4px;font-size:18px!important;font-weight:400!important;border-bottom:6px #f5f5f5 double!important;padding-bottom:5px!important}.de_checkbox{padding:0!important;margin:0!important;border:none!important}.de_checkbox .cmb-th{font-size:14px;text-transform:uppercase;width:100%!important;color:#333!important}.de_checkbox .cmb-td{width:100%!important}.de_checkbox .cmb-td label span{font-size:12px;color:grey;font-style:normal!important}.de_checkbox_side{padding:0!important;margin:0!important;border:none!important}.de_checkbox_side .cmb-th{font-size:14px;width:100%!important;color:#333!important}.de_checkbox_side .cmb-td{width:100%!important}.de_checkbox_side .cmb-th{padding-bottom:0!important}.de_checkbox_side .cmb-th label::after{display:none!important}.de_checkbox_side .cmb-td label span{font-size:12px;color:grey;font-style:normal!important}.de_thirty{margin:14px 1.5%!important;width:27%!important;float:left!important}.de_fifty{margin:14px 1.5%!important;width:47%!important;float:left!important}.de_twentyfive{margin:14px 1.5%!important;width:22%!important;float:left!important}.de_seventyfive{margin:14px 1.5%!important;width:72%!important;float:left!important}.de_seventy{margin:14px 1.5%!important;width:67%!important;float:left!important}.de_hundred{clear:both;margin:14px 1.5%!important;width:97%!important}.de_hundred_side{clear:both;margin:24px 1.5% 20px!important;width:97%!important}@media only screen and (max-width:1100px){.de_fifty,.de_hundred,.de_seventy,.de_seventyfive,.de_thirty,.de_twentyfive{clear:both;margin:14px 1.5%!important;width:97%!important}}.de_nomtop{margin-top:0!important}
|
css/tmm_custom_style.css
CHANGED
|
@@ -91,4 +91,7 @@
|
|
| 91 |
}
|
| 92 |
.tmm_4_columns .tmm_names {font-size:22px;}
|
| 93 |
.tmm_4_columns .tmm_member .tmm_textblock .tmm_sociallink img {width:24px; height:24px; margin:10px 5px;}
|
| 94 |
-
}
|
|
|
|
|
|
|
|
|
| 91 |
}
|
| 92 |
.tmm_4_columns .tmm_names {font-size:22px;}
|
| 93 |
.tmm_4_columns .tmm_member .tmm_textblock .tmm_sociallink img {width:24px; height:24px; margin:10px 5px;}
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
/* Force original fonts */
|
| 97 |
+
.tmm_container .tmm_ori_f .tmm_fname, .tmm_container .tmm_ori_f .tmm_job, .tmm_container .tmm_ori_f .tmm_desc, .tmm_container .tmm_ori_f .tmm_lname {font-family: 'Helvetica Neue', Helvetica, Arial, sans-serif !important; font-weight:300 !important;}
|
css/tmm_custom_style.min.css
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
@charset "UTF-8";.tmm_wrap{width:100%;margin-bottom:30px;text-align:center}.clearer{clear:both}.tmm_member{margin-top:100px;height:auto;float:left;text-align:center
|
| 1 |
+
@charset "UTF-8";.tmm_wrap{width:100%;margin-bottom:30px;text-align:center}.clearer{clear:both}.tmm_member{margin-top:100px;height:auto;float:left;text-align:center;-webkit-box-shadow:1px 0 5px 0 rgba(0,0,0,.05);-moz-box-shadow:1px 0 5px 0 rgba(0,0,0,.05);box-shadow:1px 0 5px 0 rgba(0,0,0,.05);border-top:5px solid #d3d3d3;border-bottom:8px solid #f5f5f5}.tmm_three_entries{clear:both}.tmm_2_columns .tmm_member{width:48%;margin-right:1%;margin-left:1%}.tmm_3_columns .tmm_member{width:31%;margin-right:1%;margin-left:1%}.tmm_4_columns .tmm_member{width:23%;margin-right:1%;margin-left:1%}.tmm_member>img{width:150px;height:150px;-webkit-box-shadow:2px 0 15px 0 rgba(0,0,0,.15);-moz-box-shadow:2px 0 15px 0 rgba(0,0,0,.15);box-shadow:2px 0 15px 0 rgba(0,0,0,.15);border-radius:60px!important;margin-top:-80px;border:10px solid #f5f5f5}.tmm_4_columns .tmm_member>img{width:100px;height:100px;margin-top:-70px;border-radius:40px!important;border:6px solid #f5f5f5}.tmm_member .tmm_textblock .tmm_scblock{padding-top:10px}.tmm_member .tmm_textblock{padding:10px 20px}.tmm_member .tmm_textblock .tmm_sociallink{clear:both;margin-bottom:20px;border:none}.tmm_member .tmm_textblock .tmm_sociallink img{display:inline-block;border:none;width:24px;height:24px;box-shadow:0 0;margin:10px 5px}.tmm_4_columns .tmm_member .tmm_textblock .tmm_sociallink img{width:21px;height:21px;margin:6px 3px}.tmm_member .tmm_textblock .tmm_sociallink img:hover{opacity:.8}.tmm_names{font-size:22px;margin-bottom:8px;margin-top:10px;font-weight:300;line-height:24px}.tmm_4_columns .tmm_names{font-size:19px}.tmm_fname,.tmm_lname{display:inline}.tmm_job{font-size:14px;color:#a2a5a4;text-transform:uppercase}.tmm_desc{padding:10px;margin-top:19px;margin-bottom:10px;font-size:14px}.tmm_4_columns .tmm_desc{padding:8px;margin-top:14px;margin-bottom:8px;font-size:13px;line-height:23px}@media only screen and (min-width:40em) and (max-width:64.063em){.tmm_4_columns .tmm_member{width:40%;margin-left:5%;margin-right:5%}.tmm_names{font-size:17px;margin-bottom:8px;margin-top:10px;font-weight:300;line-height:24px}.tmm_job{font-size:13px;color:#a2a5a4;text-transform:uppercase}.tmm_desc{padding:10px;margin-top:19px;margin-bottom:10px;font-size:14px;line-height:23px}.tmm_4_columns .tmm_desc{font-size:15px;line-height:23px}.tmm_3_columns .tmm_member>img{width:100px;height:100px;border-radius:40px!important;border:9px solid #f5f5f5}.tmm_4_columns .tmm_member>img{width:150px;height:150px;border-radius:60px!important;border:9px solid #f5f5f5}.tmm_4_columns .tmm_member .tmm_textblock .tmm_sociallink img{width:24px;height:24px;margin:10px 5px}}@media only screen and (max-width:40em){.tmm_2_columns .tmm_member,.tmm_3_columns .tmm_member,.tmm_4_columns .tmm_member,.tmm_member{width:96%;margin:120px 2% 0}.tmm_4_columns .tmm_desc{font-size:15px}.tmm_4_columns .tmm_member>img{width:150px;height:150px;border-radius:60px!important;border:9px solid #f5f5f5}.tmm_4_columns .tmm_names{font-size:22px}.tmm_4_columns .tmm_member .tmm_textblock .tmm_sociallink img{width:24px;height:24px;margin:10px 5px}}.tmm_container .tmm_ori_f .tmm_desc,.tmm_container .tmm_ori_f .tmm_fname,.tmm_container .tmm_ori_f .tmm_job,.tmm_container .tmm_ori_f .tmm_lname{font-family:'Helvetica Neue',Helvetica,Arial,sans-serif!important;font-weight:300!important}
|
drkfr/Gruntfile.js
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
/*global module:false*/
|
| 2 |
-
module.exports = function(grunt) {
|
| 3 |
-
|
| 4 |
-
// Project configuration.
|
| 5 |
-
grunt.initConfig({
|
| 6 |
-
// Metadata.
|
| 7 |
-
pkg: grunt.file.readJSON('package.json'),
|
| 8 |
-
banner: '/**\n' +
|
| 9 |
-
' * <%= pkg.title || pkg.name %> - v<%= pkg.version %> - <%= grunt.template.today("yyyy-mm-dd") %>\n' +
|
| 10 |
-
'<%= pkg.homepage ? " * " + pkg.homepage + "\\n" : "" %>' +
|
| 11 |
-
' * Copyright (c) <%= grunt.template.today("yyyy") %> <%= pkg.author %>;' + ' License: <%= pkg.license %>\n' +
|
| 12 |
-
' */',
|
| 13 |
-
cssmin: {
|
| 14 |
-
combine: {
|
| 15 |
-
options: {
|
| 16 |
-
banner: '<%= banner %>'
|
| 17 |
-
},
|
| 18 |
-
files: {
|
| 19 |
-
'css/dist/DKTBS.min.css': [
|
| 20 |
-
'css/src/layout.css',
|
| 21 |
-
'css/src/generic.css',
|
| 22 |
-
'css/src/repeatable.css',
|
| 23 |
-
'css/src/sortable.css',
|
| 24 |
-
'css/src/group.css',
|
| 25 |
-
'css/src/file.css',
|
| 26 |
-
'css/src/misc-fields.css'
|
| 27 |
-
]
|
| 28 |
-
}
|
| 29 |
-
}
|
| 30 |
-
}
|
| 31 |
-
});
|
| 32 |
-
|
| 33 |
-
// These plugins provide necessary tasks.
|
| 34 |
-
grunt.loadNpmTasks('grunt-contrib-cssmin');
|
| 35 |
-
|
| 36 |
-
// Default task.
|
| 37 |
-
grunt.registerTask('default', [ 'cssmin' ] );
|
| 38 |
-
|
| 39 |
-
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/class.drkfr-meta-box.php
DELETED
|
@@ -1,379 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Create meta boxes
|
| 5 |
-
*/
|
| 6 |
-
class drkfr_Meta_Box {
|
| 7 |
-
|
| 8 |
-
protected $_meta_box;
|
| 9 |
-
private $fields = array();
|
| 10 |
-
|
| 11 |
-
function __construct( $meta_box ) {
|
| 12 |
-
|
| 13 |
-
$this->_meta_box = $meta_box;
|
| 14 |
-
|
| 15 |
-
if ( empty( $this->_meta_box['id'] ) )
|
| 16 |
-
$this->_meta_box['id'] = sanitize_title( $this->_meta_box['title'] );
|
| 17 |
-
|
| 18 |
-
add_action( 'dbx_post_advanced', array( &$this, 'init_fields_for_post' ) );
|
| 19 |
-
add_action( 'drkfr_init_fields', array( &$this, 'init_fields' ) );
|
| 20 |
-
|
| 21 |
-
global $pagenow;
|
| 22 |
-
|
| 23 |
-
add_action( 'admin_menu', array( &$this, 'add' ) );
|
| 24 |
-
add_action( 'save_post', array( &$this, 'save_for_post' ) );
|
| 25 |
-
add_action( 'edit_attachment', array( &$this, 'save_for_post' ) );
|
| 26 |
-
add_action( 'drkfr_save_fields', array( &$this, 'save' ) );
|
| 27 |
-
|
| 28 |
-
add_action( 'admin_enqueue_scripts', array( &$this, 'enqueue_scripts' ) );
|
| 29 |
-
add_action( 'admin_enqueue_scripts', array( &$this, 'enqueue_styles' ) );
|
| 30 |
-
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function init_fields( $post_id = 0 ) {
|
| 34 |
-
|
| 35 |
-
foreach ( $this->_meta_box['fields'] as $key => $field ) {
|
| 36 |
-
|
| 37 |
-
$values = array();
|
| 38 |
-
|
| 39 |
-
$args = $field;
|
| 40 |
-
unset( $args['id'] );
|
| 41 |
-
unset( $args['type'] );
|
| 42 |
-
unset( $args['name'] );
|
| 43 |
-
|
| 44 |
-
$class = _drkfr_field_class_for_type( $field['type'] );
|
| 45 |
-
|
| 46 |
-
// If we are on a post edit screen - get metadata value of the field for this post
|
| 47 |
-
if ( $post_id ) {
|
| 48 |
-
$values = (array) get_post_meta( $post_id, $field['id'], false );
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
if ( class_exists( $class ) ) {
|
| 52 |
-
$this->fields[] = new $class( $field['id'], $field['name'], (array) $values, $args );
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
public function init_fields_for_post() {
|
| 60 |
-
|
| 61 |
-
global $post, $temp_ID;
|
| 62 |
-
|
| 63 |
-
// Get the current ID
|
| 64 |
-
if( isset( $_GET['post'] ) )
|
| 65 |
-
$post_id = $_GET['post'];
|
| 66 |
-
|
| 67 |
-
elseif( isset( $_POST['post_ID'] ) )
|
| 68 |
-
$post_id = $_POST['post_ID'];
|
| 69 |
-
|
| 70 |
-
elseif ( ! empty( $post->ID ) )
|
| 71 |
-
$post_id = $post->ID;
|
| 72 |
-
|
| 73 |
-
if ( is_page() || ! isset( $post_id ) )
|
| 74 |
-
return false;
|
| 75 |
-
|
| 76 |
-
$this->init_fields( (int) $post_id );
|
| 77 |
-
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
function enqueue_scripts() {
|
| 81 |
-
|
| 82 |
-
wp_enqueue_script( 'drkfr-scripts', trailingslashit( drkfr_URL ) . 'js/drkfr.js', array( 'jquery' ) );
|
| 83 |
-
|
| 84 |
-
wp_localize_script( 'drkfr-scripts', 'drkfrData', array(
|
| 85 |
-
'strings' => array(
|
| 86 |
-
'confirmDeleteField' => __( 'Are you sure you want to delete this field?', 'drkfr' )
|
| 87 |
-
)
|
| 88 |
-
) );
|
| 89 |
-
|
| 90 |
-
foreach ( $this->fields as $field )
|
| 91 |
-
$field->enqueue_scripts();
|
| 92 |
-
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
function enqueue_styles() {
|
| 96 |
-
|
| 97 |
-
$suffix = drkfr_DEV ? '' : '.min';
|
| 98 |
-
|
| 99 |
-
if ( version_compare( get_bloginfo( 'version' ), '3.8', '>=' ) )
|
| 100 |
-
wp_enqueue_style( 'drkfr-styles', trailingslashit( drkfr_URL ) . "css/dist/drkfr$suffix.css" );
|
| 101 |
-
else
|
| 102 |
-
wp_enqueue_style( 'drkfr-styles', trailingslashit( drkfr_URL ) . 'css/legacy.css' );
|
| 103 |
-
|
| 104 |
-
foreach ( $this->fields as $field )
|
| 105 |
-
$field->enqueue_styles();
|
| 106 |
-
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
// Add metabox
|
| 110 |
-
function add() {
|
| 111 |
-
|
| 112 |
-
$this->_meta_box['context'] = empty($this->_meta_box['context']) ? 'normal' : $this->_meta_box['context'];
|
| 113 |
-
$this->_meta_box['priority'] = empty($this->_meta_box['priority']) ? 'low' : $this->_meta_box['priority'];
|
| 114 |
-
|
| 115 |
-
// Backwards compatablilty.
|
| 116 |
-
if ( isset( $this->_meta_box['show_on']['key'] ) ) {
|
| 117 |
-
$this->_meta_box['show_on'][ $this->_meta_box['show_on']['key'] ] = $this->_meta_box['show_on']['value'];
|
| 118 |
-
unset( $this->_meta_box['show_on']['key'] );
|
| 119 |
-
unset( $this->_meta_box['show_on']['value'] );
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
foreach ( (array) $this->_meta_box['pages'] as $page ) {
|
| 123 |
-
if ( $this->is_metabox_displayed() ) {
|
| 124 |
-
add_meta_box( $this->_meta_box['id'], $this->_meta_box['title'], array(&$this, 'show'), $page, $this->_meta_box['context'], $this->_meta_box['priority'] ) ;
|
| 125 |
-
}
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* Handle 'Show On' and 'Hide On' Filters
|
| 132 |
-
*/
|
| 133 |
-
function is_metabox_displayed() {
|
| 134 |
-
$display = true;
|
| 135 |
-
$display = $this->add_for_id( $display );
|
| 136 |
-
$display = $this->hide_for_id( $display );
|
| 137 |
-
$display = $this->add_for_page_template( $display );
|
| 138 |
-
$display = $this->hide_for_page_template( $display );
|
| 139 |
-
return $display;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
// Add drkfr for ID
|
| 143 |
-
function add_for_id( $display ) {
|
| 144 |
-
|
| 145 |
-
if ( ! isset( $this->_meta_box['show_on']['id'] ) ) {
|
| 146 |
-
return $display;
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
// Don't show drkfr if we can't identify ID of a post
|
| 150 |
-
$post_id = $this->get_post_id();
|
| 151 |
-
|
| 152 |
-
if ( ! isset( $post_id ) ) {
|
| 153 |
-
return false;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
// If value isn't an array, turn it into one
|
| 157 |
-
$this->_meta_box['show_on']['id'] = ! is_array( $this->_meta_box['show_on']['id'] ) ? array( $this->_meta_box['show_on']['id'] ) : $this->_meta_box['show_on']['id'];
|
| 158 |
-
|
| 159 |
-
return in_array( $post_id, $this->_meta_box['show_on']['id'] );
|
| 160 |
-
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
// Hide drkfr for ID
|
| 164 |
-
function hide_for_id( $display ) {
|
| 165 |
-
|
| 166 |
-
if ( ! isset( $this->_meta_box['hide_on']['id'] ) ) {
|
| 167 |
-
return $display;
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
// Return if we can't identify ID of a post
|
| 171 |
-
$post_id = $this->get_post_id();
|
| 172 |
-
if ( ! isset( $post_id ) ) {
|
| 173 |
-
return $display;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
// If value isn't an array, turn it into one
|
| 177 |
-
$this->_meta_box['hide_on']['id'] = ! is_array( $this->_meta_box['hide_on']['id'] ) ? array( $this->_meta_box['hide_on']['id'] ) : $this->_meta_box['hide_on']['id'];
|
| 178 |
-
|
| 179 |
-
return ! in_array( $post_id, $this->_meta_box['hide_on']['id'] );
|
| 180 |
-
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
// Add drkfr for Page Template
|
| 184 |
-
function add_for_page_template( $display ) {
|
| 185 |
-
|
| 186 |
-
if ( ! isset( $this->_meta_box['show_on']['page-template'] ) ) {
|
| 187 |
-
return $display;
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
// Return false if we can't identify ID of a post
|
| 191 |
-
$post_id = $this->get_post_id();
|
| 192 |
-
if ( ! isset( $post_id ) ) {
|
| 193 |
-
return false;
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
// Get current template
|
| 197 |
-
$current_template = get_post_meta( $post_id, '_wp_page_template', true );
|
| 198 |
-
|
| 199 |
-
// If value isn't an array, turn it into one
|
| 200 |
-
$this->_meta_box['show_on']['page-template'] = ! is_array( $this->_meta_box['show_on']['page-template'] ) ? array( $this->_meta_box['show_on']['page-template'] ) : $this->_meta_box['show_on']['page-template'];
|
| 201 |
-
|
| 202 |
-
return in_array( $current_template, $this->_meta_box['show_on']['page-template'] );
|
| 203 |
-
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
// Hide drkfr for Page Template
|
| 207 |
-
function hide_for_page_template( $display ) {
|
| 208 |
-
|
| 209 |
-
if ( ! isset( $this->_meta_box['hide_on']['page-template'] ) ) {
|
| 210 |
-
return $display;
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
// Return $display if we can't identify ID of a post and hence its current template
|
| 214 |
-
$post_id = $this->get_post_id();
|
| 215 |
-
|
| 216 |
-
if ( ! isset( $post_id ) ) {
|
| 217 |
-
return $display;
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
// Get current template
|
| 221 |
-
$current_template = get_post_meta( $post_id, '_wp_page_template', true );
|
| 222 |
-
|
| 223 |
-
// If value isn't an array, turn it into one
|
| 224 |
-
$this->_meta_box['hide_on']['page-template'] = ! is_array( $this->_meta_box['hide_on']['page-template'] ) ? array( $this->_meta_box['hide_on']['page-template'] ) : $this->_meta_box['hide_on']['page-template'];
|
| 225 |
-
|
| 226 |
-
return ! in_array( $current_template, $this->_meta_box['hide_on']['page-template'] );
|
| 227 |
-
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
// display fields
|
| 231 |
-
function show() { ?>
|
| 232 |
-
|
| 233 |
-
<input type="hidden" name="wp_meta_box_nonce" value="<?php esc_attr_e( wp_create_nonce( basename(__FILE__) ) ); ?>" />
|
| 234 |
-
|
| 235 |
-
<?php self::layout_fields( $this->fields );
|
| 236 |
-
|
| 237 |
-
}
|
| 238 |
-
|
| 239 |
-
/**
|
| 240 |
-
* Layout an array of fields, depending on their 'cols' property.
|
| 241 |
-
*
|
| 242 |
-
* This is a static method so other fields can use it that rely on sub fields
|
| 243 |
-
*
|
| 244 |
-
* @param drkfr_Field[] $fields
|
| 245 |
-
*/
|
| 246 |
-
static function layout_fields( array $fields ) { ?>
|
| 247 |
-
|
| 248 |
-
<div class="drkfr_metabox">
|
| 249 |
-
|
| 250 |
-
<?php $current_colspan = 0;
|
| 251 |
-
|
| 252 |
-
foreach ( $fields as $field ) :
|
| 253 |
-
|
| 254 |
-
if ( $current_colspan == 0 ) : ?>
|
| 255 |
-
|
| 256 |
-
<div class="drkfr-row">
|
| 257 |
-
|
| 258 |
-
<?php endif;
|
| 259 |
-
|
| 260 |
-
$current_colspan += $field->args['cols'];
|
| 261 |
-
|
| 262 |
-
$classes = array( 'field', get_class($field) );
|
| 263 |
-
|
| 264 |
-
if ( ! empty( $field->args['repeatable'] ) )
|
| 265 |
-
$classes[] = 'repeatable';
|
| 266 |
-
|
| 267 |
-
if ( ! empty( $field->args['sortable'] ) )
|
| 268 |
-
$classes[] = 'drkfr-sortable';
|
| 269 |
-
|
| 270 |
-
$attrs = array(
|
| 271 |
-
sprintf( 'id="%s"', sanitize_html_class( $field->id ) ),
|
| 272 |
-
sprintf( 'class="%s"', esc_attr( implode(' ', array_map( 'sanitize_html_class', $classes ) ) ) )
|
| 273 |
-
);
|
| 274 |
-
|
| 275 |
-
// Field Repeatable Max.
|
| 276 |
-
if ( isset( $field->args['repeatable_max'] ) )
|
| 277 |
-
$attrs[] = sprintf( 'data-rep-max="%s"', intval( $field->args['repeatable_max'] ) );
|
| 278 |
-
|
| 279 |
-
?>
|
| 280 |
-
|
| 281 |
-
<div class="drkfr-cell-<?php echo intval( $field->args['cols'] ); ?>">
|
| 282 |
-
|
| 283 |
-
<div <?php echo implode( ' ', $attrs ); ?>>
|
| 284 |
-
<?php $field->display(); ?>
|
| 285 |
-
</div>
|
| 286 |
-
|
| 287 |
-
<input type="hidden" name="_drkfr_present_<?php esc_attr_e( $field->id ); ?>" value="1" />
|
| 288 |
-
|
| 289 |
-
</div>
|
| 290 |
-
|
| 291 |
-
<?php if ( $current_colspan == 12 || $field === end( $fields ) ) :
|
| 292 |
-
|
| 293 |
-
$current_colspan = 0; ?>
|
| 294 |
-
|
| 295 |
-
</div><!-- .drkfr-row -->
|
| 296 |
-
|
| 297 |
-
<?php endif; ?>
|
| 298 |
-
|
| 299 |
-
<?php endforeach; ?>
|
| 300 |
-
|
| 301 |
-
</div>
|
| 302 |
-
|
| 303 |
-
<?php }
|
| 304 |
-
|
| 305 |
-
function strip_repeatable( $values ) {
|
| 306 |
-
|
| 307 |
-
foreach ( $values as $key => $value ) {
|
| 308 |
-
|
| 309 |
-
if ( false !== strpos( $key, 'drkfr-group-x' ) || false !== strpos( $key, 'drkfr-field-x' ) )
|
| 310 |
-
unset( $values[$key] );
|
| 311 |
-
|
| 312 |
-
elseif ( is_array( $value ) )
|
| 313 |
-
$values[$key] = $this->strip_repeatable( $value );
|
| 314 |
-
|
| 315 |
-
}
|
| 316 |
-
|
| 317 |
-
return $values;
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
// Save data from metabox
|
| 321 |
-
function save( $post_id = 0 ) {
|
| 322 |
-
|
| 323 |
-
// Verify nonce
|
| 324 |
-
if ( ! isset( $_POST['wp_meta_box_nonce'] ) || ! wp_verify_nonce( $_POST['wp_meta_box_nonce'], basename( __FILE__ ) ) )
|
| 325 |
-
return $post_id;
|
| 326 |
-
|
| 327 |
-
foreach ( $this->_meta_box['fields'] as $field ) {
|
| 328 |
-
|
| 329 |
-
// Verify this meta box was shown on the page
|
| 330 |
-
if ( ! isset( $_POST['_drkfr_present_' . $field['id'] ] ) )
|
| 331 |
-
continue;
|
| 332 |
-
|
| 333 |
-
if ( isset( $_POST[ $field['id'] ] ) )
|
| 334 |
-
$value = (array) $_POST[ $field['id'] ];
|
| 335 |
-
else
|
| 336 |
-
$value = array();
|
| 337 |
-
|
| 338 |
-
$value = $this->strip_repeatable( $value );
|
| 339 |
-
|
| 340 |
-
if ( ! $class = _drkfr_field_class_for_type( $field['type'] ) ) {
|
| 341 |
-
do_action( 'drkfr_save_' . $field['type'], $field, $value );
|
| 342 |
-
}
|
| 343 |
-
|
| 344 |
-
$field_obj = new $class( $field['id'], $field['name'], $value, $field );
|
| 345 |
-
|
| 346 |
-
$field_obj->save( $post_id, $value );
|
| 347 |
-
|
| 348 |
-
}
|
| 349 |
-
|
| 350 |
-
// If we are not on a post, need to refresh the field objects to reflect new values, as we do not get a redirect
|
| 351 |
-
if ( ! $post_id ) {
|
| 352 |
-
$this->fields = array();
|
| 353 |
-
$this->init_fields();
|
| 354 |
-
}
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
// Save the on save_post hook
|
| 358 |
-
function save_for_post( $post_id ) {
|
| 359 |
-
|
| 360 |
-
// check autosave
|
| 361 |
-
if ( defined( 'DOING_AUTOSAVE' ) && DOING_AUTOSAVE )
|
| 362 |
-
return $post_id;
|
| 363 |
-
|
| 364 |
-
$this->save( $post_id );
|
| 365 |
-
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
function get_post_id() {
|
| 369 |
-
|
| 370 |
-
$post_id = isset( $_GET['post'] ) ? $_GET['post'] : null;
|
| 371 |
-
|
| 372 |
-
if ( ! $post_id && isset( $_POST['post_id'] ) ) {
|
| 373 |
-
$post_id = $_POST['post_id'];
|
| 374 |
-
}
|
| 375 |
-
|
| 376 |
-
return $post_id;
|
| 377 |
-
|
| 378 |
-
}
|
| 379 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/classes.fields.php
DELETED
|
@@ -1,1675 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Abstract class for all fields.
|
| 5 |
-
* Subclasses need only override html()
|
| 6 |
-
*
|
| 7 |
-
* @abstract
|
| 8 |
-
*/
|
| 9 |
-
abstract class drkfr_Field {
|
| 10 |
-
|
| 11 |
-
public $value;
|
| 12 |
-
public $field_index = 0;
|
| 13 |
-
|
| 14 |
-
public function __construct( $name, $title, array $values, $args = array() ) {
|
| 15 |
-
|
| 16 |
-
$this->id = $name;
|
| 17 |
-
$this->name = $name . '[]';
|
| 18 |
-
$this->title = $title;
|
| 19 |
-
$this->args = wp_parse_args( $args, $this->get_default_args() );
|
| 20 |
-
|
| 21 |
-
// Deprecated argument: 'std'
|
| 22 |
-
if ( ! empty( $this->args['std'] ) && empty( $this->args['default'] ) ) {
|
| 23 |
-
$this->args['default'] = $this->args['std'];
|
| 24 |
-
_deprecated_argument( 'drkfr_Field', '0.9', "field argument 'std' is deprecated, use 'default' instead" );
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
if ( ! empty( $this->args['options'] ) && is_array( reset( $this->args['options'] ) ) ) {
|
| 28 |
-
$re_format = array();
|
| 29 |
-
foreach ( $this->args['options'] as $option ) {
|
| 30 |
-
$re_format[$option['value']] = $option['name'];
|
| 31 |
-
}
|
| 32 |
-
$this->args['options'] = $re_format;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
// If the field has a custom value populator callback
|
| 36 |
-
if ( ! empty( $args['values_callback'] ) )
|
| 37 |
-
$this->values = call_user_func( $args['values_callback'], get_the_id() );
|
| 38 |
-
else
|
| 39 |
-
$this->values = $values;
|
| 40 |
-
|
| 41 |
-
$this->value = reset( $this->values );
|
| 42 |
-
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* Get the default args for the abstract field.
|
| 47 |
-
* These args are available to all fields.
|
| 48 |
-
*
|
| 49 |
-
* @return array $args
|
| 50 |
-
*/
|
| 51 |
-
public function get_default_args() {
|
| 52 |
-
return apply_filters(
|
| 53 |
-
'drkfr_field_default_args',
|
| 54 |
-
array(
|
| 55 |
-
'desc' => '',
|
| 56 |
-
'repeatable' => false,
|
| 57 |
-
'sortable' => false,
|
| 58 |
-
'repeatable_max' => null,
|
| 59 |
-
'show_label' => false,
|
| 60 |
-
'readonly' => false,
|
| 61 |
-
'disabled' => false,
|
| 62 |
-
'default' => '',
|
| 63 |
-
'cols' => '12',
|
| 64 |
-
'style' => '',
|
| 65 |
-
'class' => '',
|
| 66 |
-
'data_delegate' => null,
|
| 67 |
-
'save_callback' => null,
|
| 68 |
-
'string-repeat-field' => __( 'Add New', 'drkfr' ),
|
| 69 |
-
'string-delete-field' => __( 'Remove Field', 'drkfr' ),
|
| 70 |
-
),
|
| 71 |
-
get_class( $this )
|
| 72 |
-
);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* Enqueue all scripts required by the field.
|
| 77 |
-
*
|
| 78 |
-
* @uses wp_enqueue_script()
|
| 79 |
-
*/
|
| 80 |
-
public function enqueue_scripts() {
|
| 81 |
-
|
| 82 |
-
if ( isset( $this->args['sortable'] ) && $this->args['sortable'] )
|
| 83 |
-
wp_enqueue_script( 'jquery-ui-sortable' );
|
| 84 |
-
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Enqueue all styles required by the field.
|
| 89 |
-
*
|
| 90 |
-
* @uses wp_enqueue_style()
|
| 91 |
-
*/
|
| 92 |
-
public function enqueue_styles() {}
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* Output the field input ID attribute.
|
| 96 |
-
*
|
| 97 |
-
* If multiple inputs are required for a single field,
|
| 98 |
-
* use the append parameter to add unique identifier.
|
| 99 |
-
*
|
| 100 |
-
* @param string $append
|
| 101 |
-
* @return null
|
| 102 |
-
*/
|
| 103 |
-
public function id_attr( $append = null ) {
|
| 104 |
-
|
| 105 |
-
printf( 'id="%s"', esc_attr( $this->get_the_id_attr( $append ) ) );
|
| 106 |
-
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* Output the for attribute for the field.
|
| 111 |
-
*
|
| 112 |
-
*
|
| 113 |
-
*
|
| 114 |
-
* If multiple inputs are required for a single field,
|
| 115 |
-
* use the append parameter to add unique identifier.
|
| 116 |
-
*
|
| 117 |
-
* @param string $append
|
| 118 |
-
* @return null
|
| 119 |
-
*/
|
| 120 |
-
public function get_the_id_attr( $append = null ) {
|
| 121 |
-
|
| 122 |
-
$id = $this->id;
|
| 123 |
-
|
| 124 |
-
if ( isset( $this->parent ) ) {
|
| 125 |
-
$parent_id = preg_replace( '/drkfr\-field\-(\d+|x)/', 'drkfr-group-$1', $this->parent->get_the_id_attr() );
|
| 126 |
-
$id = $parent_id . '[' . $id . ']';
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
$id .= '-drkfr-field-' . $this->field_index;
|
| 130 |
-
|
| 131 |
-
if ( ! is_null( $append ) )
|
| 132 |
-
$id .= '-' . $append;
|
| 133 |
-
|
| 134 |
-
$id = str_replace( array( '[', ']', '--' ), '-', $id );
|
| 135 |
-
|
| 136 |
-
return $id;
|
| 137 |
-
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* Return the field input ID attribute value.
|
| 142 |
-
*
|
| 143 |
-
* If multiple inputs are required for a single field,
|
| 144 |
-
* use the append parameter to add unique identifier.
|
| 145 |
-
*
|
| 146 |
-
* @param string $append
|
| 147 |
-
* @return string id attribute value.
|
| 148 |
-
*/
|
| 149 |
-
public function for_attr( $append = null ) {
|
| 150 |
-
|
| 151 |
-
printf( 'for="%s"', esc_attr( $this->get_the_id_attr( $append ) ) );
|
| 152 |
-
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
public function name_attr( $append = null ) {
|
| 156 |
-
|
| 157 |
-
printf( 'name="%s"', esc_attr( $this->get_the_name_attr( $append ) ) );
|
| 158 |
-
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
public function get_the_name_attr( $append = null ) {
|
| 162 |
-
|
| 163 |
-
$name = str_replace( '[]', '', $this->name );
|
| 164 |
-
|
| 165 |
-
if ( isset( $this->parent ) ) {
|
| 166 |
-
$parent_name = preg_replace( '/drkfr\-field\-(\d+|x)/', 'drkfr-group-$1', $this->parent->get_the_name_attr() );
|
| 167 |
-
$name = $parent_name . '[' . $name . ']';
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
$name .= "[drkfr-field-$this->field_index]";
|
| 171 |
-
|
| 172 |
-
if ( ! is_null( $append ) )
|
| 173 |
-
$name .= $append;
|
| 174 |
-
|
| 175 |
-
return $name;
|
| 176 |
-
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
public function class_attr( $classes = '' ) {
|
| 180 |
-
|
| 181 |
-
if ( $classes = implode( ' ', array_map( 'sanitize_html_class', array_filter( array_unique( explode( ' ', $classes . ' ' . $this->args['class'] ) ) ) ) ) ) { ?>
|
| 182 |
-
|
| 183 |
-
class="<?php echo esc_attr( $classes ); ?>"
|
| 184 |
-
|
| 185 |
-
<?php }
|
| 186 |
-
|
| 187 |
-
}
|
| 188 |
-
|
| 189 |
-
/**
|
| 190 |
-
* Get JS Safe ID.
|
| 191 |
-
*
|
| 192 |
-
* For use as a unique field identifier in javascript.
|
| 193 |
-
*/
|
| 194 |
-
public function get_js_id() {
|
| 195 |
-
|
| 196 |
-
return str_replace( array( '-', '[', ']', '--' ),'_', $this->get_the_id_attr() ); // JS friendly ID
|
| 197 |
-
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
public function boolean_attr( $attrs = array() ) {
|
| 201 |
-
|
| 202 |
-
if ( $this->args['readonly'] )
|
| 203 |
-
$attrs[] = 'readonly';
|
| 204 |
-
|
| 205 |
-
if ( $this->args['disabled'] )
|
| 206 |
-
$attrs[] = 'disabled';
|
| 207 |
-
|
| 208 |
-
$attrs = array_filter( array_unique( $attrs ) );
|
| 209 |
-
|
| 210 |
-
foreach ( $attrs as $attr )
|
| 211 |
-
echo esc_html( $attr ) . '="' . esc_attr( $attr ) . '"';
|
| 212 |
-
|
| 213 |
-
}
|
| 214 |
-
|
| 215 |
-
/**
|
| 216 |
-
* Check if this field has a data delegate set
|
| 217 |
-
*
|
| 218 |
-
* @return boolean
|
| 219 |
-
*/
|
| 220 |
-
public function has_data_delegate() {
|
| 221 |
-
return (bool) $this->args['data_delegate'];
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
/**
|
| 225 |
-
* Get the array of data from the data delegate
|
| 226 |
-
*
|
| 227 |
-
* @return array mixed
|
| 228 |
-
*/
|
| 229 |
-
protected function get_delegate_data() {
|
| 230 |
-
|
| 231 |
-
if ( $this->args['data_delegate'] )
|
| 232 |
-
return call_user_func_array( $this->args['data_delegate'], array( $this ) );
|
| 233 |
-
|
| 234 |
-
return array();
|
| 235 |
-
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
public function get_value() {
|
| 239 |
-
return ( $this->value || $this->value === '0' ) ? $this->value : $this->args['default'];
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
public function &get_values() {
|
| 243 |
-
return $this->values;
|
| 244 |
-
}
|
| 245 |
-
|
| 246 |
-
public function set_values( array $values ) {
|
| 247 |
-
|
| 248 |
-
$this->values = $values;
|
| 249 |
-
|
| 250 |
-
unset( $this->value );
|
| 251 |
-
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
public function parse_save_values() {}
|
| 255 |
-
|
| 256 |
-
public function parse_save_value() {}
|
| 257 |
-
|
| 258 |
-
/**
|
| 259 |
-
* @todo this surely only works for posts
|
| 260 |
-
* @todo why do values need to be passed in, they can already be passed in on construct
|
| 261 |
-
*/
|
| 262 |
-
public function save( $post_id, $values ) {
|
| 263 |
-
|
| 264 |
-
// Don't save readonly values.
|
| 265 |
-
if ( $this->args['readonly'] )
|
| 266 |
-
return;
|
| 267 |
-
|
| 268 |
-
$this->values = $values;
|
| 269 |
-
$this->parse_save_values();
|
| 270 |
-
|
| 271 |
-
// Allow override from args
|
| 272 |
-
if ( ! empty( $this->args['save_callback'] ) ) {
|
| 273 |
-
|
| 274 |
-
call_user_func( $this->args['save_callback'], $this->values, $post_id );
|
| 275 |
-
|
| 276 |
-
return;
|
| 277 |
-
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
// If we are not on a post edit screen
|
| 281 |
-
if ( ! $post_id )
|
| 282 |
-
return;
|
| 283 |
-
|
| 284 |
-
delete_post_meta( $post_id, $this->id );
|
| 285 |
-
|
| 286 |
-
foreach( $this->values as $v ) {
|
| 287 |
-
|
| 288 |
-
$this->value = $v;
|
| 289 |
-
$this->parse_save_value();
|
| 290 |
-
|
| 291 |
-
if ( $this->value || $this->value === '0' )
|
| 292 |
-
add_post_meta( $post_id, $this->id, $this->value );
|
| 293 |
-
|
| 294 |
-
}
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
public function title() {
|
| 298 |
-
|
| 299 |
-
if ( $this->title ) { ?>
|
| 300 |
-
|
| 301 |
-
<div class="field-title">
|
| 302 |
-
<label <?php $this->for_attr(); ?>>
|
| 303 |
-
<?php echo esc_html( $this->title ); ?>
|
| 304 |
-
</label>
|
| 305 |
-
</div>
|
| 306 |
-
|
| 307 |
-
<?php }
|
| 308 |
-
|
| 309 |
-
}
|
| 310 |
-
|
| 311 |
-
public function description() {
|
| 312 |
-
|
| 313 |
-
if ( ! empty( $this->args['desc'] ) ) { ?>
|
| 314 |
-
|
| 315 |
-
<div class="drkfr_metabox_description">
|
| 316 |
-
<?php echo wp_kses_post( $this->args['desc'] ); ?>
|
| 317 |
-
</div>
|
| 318 |
-
|
| 319 |
-
<?php }
|
| 320 |
-
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
public function display() {
|
| 324 |
-
|
| 325 |
-
// If there are no values and it's not repeateble, we want to do one with empty string
|
| 326 |
-
if ( ! $this->get_values() && ! $this->args['repeatable'] )
|
| 327 |
-
$values = array( '' );
|
| 328 |
-
else
|
| 329 |
-
$values = $this->get_values();
|
| 330 |
-
|
| 331 |
-
$this->title();
|
| 332 |
-
|
| 333 |
-
$this->description();
|
| 334 |
-
|
| 335 |
-
$i = 0;
|
| 336 |
-
foreach ( $values as $key => $value ) {
|
| 337 |
-
|
| 338 |
-
$this->field_index = $i;
|
| 339 |
-
$this->value = $value; ?>
|
| 340 |
-
|
| 341 |
-
<div class="field-item" data-class="<?php echo esc_attr( get_class( $this ) ); ?>" style="position: relative; <?php echo esc_attr( $this->args['style'] ); ?>">
|
| 342 |
-
|
| 343 |
-
<?php if ( $this->args['repeatable'] ) : ?>
|
| 344 |
-
<button class="drkfr-delete-field" title="<?php echo esc_attr( $this->args['string-delete-field'] ); ?>">
|
| 345 |
-
<span class="drkfr-delete-field-icon">×</span>
|
| 346 |
-
</button>
|
| 347 |
-
<?php endif; ?>
|
| 348 |
-
|
| 349 |
-
<?php $this->html(); ?>
|
| 350 |
-
|
| 351 |
-
</div>
|
| 352 |
-
|
| 353 |
-
<?php
|
| 354 |
-
|
| 355 |
-
$i++;
|
| 356 |
-
|
| 357 |
-
}
|
| 358 |
-
|
| 359 |
-
// Insert a hidden one if it's repeatable
|
| 360 |
-
if ( $this->args['repeatable'] ) {
|
| 361 |
-
|
| 362 |
-
$this->field_index = 'x'; // x used to distinguish hidden fields.
|
| 363 |
-
$this->value = ''; ?>
|
| 364 |
-
|
| 365 |
-
<div class="field-item hidden" data-class="<?php echo esc_attr( get_class( $this ) ); ?>" style="position: relative; <?php echo esc_attr( $this->args['style'] ); ?>">
|
| 366 |
-
|
| 367 |
-
<?php if ( $this->args['repeatable'] ) : ?>
|
| 368 |
-
<button class="drkfr-delete-field" title="<?php echo esc_attr( $this->args['string-delete-field'] ); ?>">
|
| 369 |
-
<span class="drkfr-delete-field-icon">×</span>
|
| 370 |
-
<?php echo esc_html( $this->args['string-delete-field'] ); ?>
|
| 371 |
-
</button>
|
| 372 |
-
<?php endif; ?>
|
| 373 |
-
|
| 374 |
-
<?php $this->html(); ?>
|
| 375 |
-
|
| 376 |
-
</div>
|
| 377 |
-
|
| 378 |
-
<button class="button repeat-field"><?php echo esc_html( $this->args['string-repeat-field'] ); ?></button>
|
| 379 |
-
|
| 380 |
-
<?php }
|
| 381 |
-
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
}
|
| 385 |
-
|
| 386 |
-
/**
|
| 387 |
-
* Standard text field.
|
| 388 |
-
*
|
| 389 |
-
* @extends drkfr_Field
|
| 390 |
-
*/
|
| 391 |
-
class drkfr_Text_Field extends drkfr_Field {
|
| 392 |
-
|
| 393 |
-
public function html() { ?>
|
| 394 |
-
|
| 395 |
-
<input type="text" <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr(); ?> <?php $this->name_attr(); ?> value="<?php echo esc_attr( $this->get_value() ); ?>" />
|
| 396 |
-
|
| 397 |
-
<?php }
|
| 398 |
-
}
|
| 399 |
-
|
| 400 |
-
class drkfr_Text_Small_Field extends drkfr_Text_Field {
|
| 401 |
-
|
| 402 |
-
public function html() {
|
| 403 |
-
|
| 404 |
-
$this->args['class'] .= ' drkfr_text_small';
|
| 405 |
-
|
| 406 |
-
parent::html();
|
| 407 |
-
|
| 408 |
-
}
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
/**
|
| 412 |
-
* Field for image upload / file updoad.
|
| 413 |
-
*
|
| 414 |
-
* @todo ability to set image size (preview image) from caller
|
| 415 |
-
*/
|
| 416 |
-
class drkfr_File_Field extends drkfr_Field {
|
| 417 |
-
|
| 418 |
-
/**
|
| 419 |
-
* Return the default args for the File field.
|
| 420 |
-
*
|
| 421 |
-
* @return array $args
|
| 422 |
-
*/
|
| 423 |
-
public function get_default_args() {
|
| 424 |
-
return array_merge(
|
| 425 |
-
parent::get_default_args(),
|
| 426 |
-
array(
|
| 427 |
-
'library-type' => array( 'video', 'audio', 'text', 'application' )
|
| 428 |
-
)
|
| 429 |
-
);
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
function enqueue_scripts() {
|
| 433 |
-
|
| 434 |
-
global $post_ID;
|
| 435 |
-
$post_ID = isset($post_ID) ? (int) $post_ID : 0;
|
| 436 |
-
|
| 437 |
-
parent::enqueue_scripts();
|
| 438 |
-
|
| 439 |
-
wp_enqueue_media( array( 'post' => $post_ID ));
|
| 440 |
-
wp_enqueue_script( 'drkfr-file-upload', trailingslashit( drkfr_URL ) . 'js/file-upload.js', array( 'jquery', 'drkfr-scripts' ) );
|
| 441 |
-
|
| 442 |
-
}
|
| 443 |
-
|
| 444 |
-
public function html() {
|
| 445 |
-
|
| 446 |
-
if ( $this->get_value() ) {
|
| 447 |
-
$src = wp_mime_type_icon( $this->get_value() );
|
| 448 |
-
$size = getimagesize( str_replace( site_url(), ABSPATH, $src ) );
|
| 449 |
-
$icon_img = '<img src="' . $src . '" ' . $size[3] . ' />';
|
| 450 |
-
}
|
| 451 |
-
|
| 452 |
-
$data_type = ( ! empty( $this->args['library-type'] ) ? implode( ',', $this->args['library-type'] ) : null );
|
| 453 |
-
|
| 454 |
-
?>
|
| 455 |
-
|
| 456 |
-
<div class="drkfr-file-wrap" <?php echo 'data-type="' . esc_attr( $data_type ) . '"'; ?>>
|
| 457 |
-
|
| 458 |
-
<div class="drkfr-file-wrap-placeholder"></div>
|
| 459 |
-
|
| 460 |
-
<button class="button drkfr-file-upload <?php echo esc_attr( $this->get_value() ) ? 'hidden' : '' ?>">
|
| 461 |
-
<?php esc_html_e( 'Add File', 'drkfr' ); ?>
|
| 462 |
-
</button>
|
| 463 |
-
|
| 464 |
-
<div class="drkfr-file-holder type-file <?php echo $this->get_value() ? '' : 'hidden'; ?>">
|
| 465 |
-
|
| 466 |
-
<?php if ( $this->get_value() ) : ?>
|
| 467 |
-
|
| 468 |
-
<?php if ( isset( $icon_img ) ) echo $icon_img; ?>
|
| 469 |
-
|
| 470 |
-
<div class="drkfr-file-name">
|
| 471 |
-
<strong><?php echo esc_html( basename( get_attached_file( $this->get_value() ) ) ); ?></strong>
|
| 472 |
-
</div>
|
| 473 |
-
|
| 474 |
-
<?php endif; ?>
|
| 475 |
-
|
| 476 |
-
</div>
|
| 477 |
-
|
| 478 |
-
<button class="drkfr-remove-file button <?php echo $this->get_value() ? '' : 'hidden'; ?>">
|
| 479 |
-
<?php esc_html_e( 'Remove', 'drkfr' ); ?>
|
| 480 |
-
</button>
|
| 481 |
-
|
| 482 |
-
<input type="hidden"
|
| 483 |
-
<?php $this->class_attr( 'drkfr-file-upload-input' ); ?>
|
| 484 |
-
<?php $this->name_attr(); ?>
|
| 485 |
-
value="<?php echo esc_attr( $this->value ); ?>"
|
| 486 |
-
/>
|
| 487 |
-
|
| 488 |
-
</div>
|
| 489 |
-
|
| 490 |
-
<?php }
|
| 491 |
-
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
class drkfr_Image_Field extends drkfr_File_Field {
|
| 495 |
-
|
| 496 |
-
/**
|
| 497 |
-
* Return the default args for the Image field.
|
| 498 |
-
*
|
| 499 |
-
* @return array $args
|
| 500 |
-
*/
|
| 501 |
-
public function get_default_args() {
|
| 502 |
-
return array_merge(
|
| 503 |
-
parent::get_default_args(),
|
| 504 |
-
array(
|
| 505 |
-
'size' => 'thumbnail',
|
| 506 |
-
'library-type' => array( 'image' ),
|
| 507 |
-
'show_size' => false
|
| 508 |
-
)
|
| 509 |
-
);
|
| 510 |
-
}
|
| 511 |
-
|
| 512 |
-
public function html() {
|
| 513 |
-
|
| 514 |
-
if ( $this->get_value() )
|
| 515 |
-
$image = wp_get_attachment_image_src( $this->get_value(), $this->args['size'], true );
|
| 516 |
-
|
| 517 |
-
// Convert size arg to array of width, height, crop
|
| 518 |
-
$size = $this->parse_image_size( $this->args['size'] );
|
| 519 |
-
|
| 520 |
-
// Inline styles
|
| 521 |
-
$styles = sprintf( 'width: %1$dpx; height: %2$dpx; line-height: %2$dpx', intval( $size['width'] ), intval( $size['height'] ) );
|
| 522 |
-
$placeholder_styles = sprintf( 'width: %dpx; height: %dpx;', intval( $size['width'] ) - 8, intval( $size['height'] ) - 8 );
|
| 523 |
-
|
| 524 |
-
$data_type = ( ! empty( $this->args['library-type'] ) ? implode( ',', $this->args['library-type'] ) : null );
|
| 525 |
-
|
| 526 |
-
?>
|
| 527 |
-
|
| 528 |
-
<div class="drkfr-file-wrap" style="<?php echo esc_attr( $styles ); ?>" data-type="<?php echo esc_attr( $data_type ); ?>">
|
| 529 |
-
|
| 530 |
-
<div class="drkfr-file-wrap-placeholder" style="<?php echo esc_attr( $placeholder_styles ); ?>">
|
| 531 |
-
|
| 532 |
-
<?php if ( $this->args['show_size'] ) : ?>
|
| 533 |
-
<span class="dimensions">
|
| 534 |
-
<?php printf( '%dpx × %dpx', intval( $size['width'] ), intval( $size['height'] ) ); ?>
|
| 535 |
-
</span>
|
| 536 |
-
<?php endif; ?>
|
| 537 |
-
|
| 538 |
-
</div>
|
| 539 |
-
|
| 540 |
-
<button class="button drkfr-file-upload <?php echo esc_attr( $this->get_value() ) ? 'hidden' : '' ?>" data-nonce="<?php echo wp_create_nonce( 'drkfr-file-upload-nonce' ); ?>">
|
| 541 |
-
<?php esc_html_e( 'Add Image', 'drkfr' ); ?>
|
| 542 |
-
</button>
|
| 543 |
-
|
| 544 |
-
<div class="drkfr-file-holder type-img <?php echo $this->get_value() ? '' : 'hidden'; ?>" data-crop="<?php echo (bool) $size['crop']; ?>">
|
| 545 |
-
|
| 546 |
-
<?php if ( ! empty( $image ) ) : ?>
|
| 547 |
-
<img src="<?php echo esc_url( $image[0] ); ?>" width="<?php echo intval( $image[1] ); ?>" height="<?php echo intval( $image[2] ); ?>" />
|
| 548 |
-
<?php endif; ?>
|
| 549 |
-
|
| 550 |
-
</div>
|
| 551 |
-
|
| 552 |
-
<button class="drkfr-remove-file button <?php echo $this->get_value() ? '' : 'hidden'; ?>">
|
| 553 |
-
<?php esc_html_e( 'Remove', 'drkfr' ); ?>
|
| 554 |
-
</button>
|
| 555 |
-
|
| 556 |
-
<input type="hidden"
|
| 557 |
-
<?php $this->class_attr( 'drkfr-file-upload-input' ); ?>
|
| 558 |
-
<?php $this->name_attr(); ?>
|
| 559 |
-
value="<?php echo esc_attr( $this->value ); ?>"
|
| 560 |
-
/>
|
| 561 |
-
|
| 562 |
-
</div>
|
| 563 |
-
|
| 564 |
-
<?php }
|
| 565 |
-
|
| 566 |
-
/**
|
| 567 |
-
* Parse the size argument to get pixel width, pixel height and crop information.
|
| 568 |
-
*
|
| 569 |
-
* @param string $size
|
| 570 |
-
* @return array width, height, crop
|
| 571 |
-
*/
|
| 572 |
-
private function parse_image_size( $size ) {
|
| 573 |
-
|
| 574 |
-
// Handle string for built-in image sizes
|
| 575 |
-
if ( is_string( $size ) && in_array( $size, array( 'thumbnail', 'medium', 'large' ) ) ) {
|
| 576 |
-
return array(
|
| 577 |
-
'width' => get_option( $size . '_size_w' ),
|
| 578 |
-
'height' => get_option( $size . '_size_h' ),
|
| 579 |
-
'crop' => get_option( $size . '_crop' )
|
| 580 |
-
);
|
| 581 |
-
}
|
| 582 |
-
|
| 583 |
-
// Handle string for additional image sizes
|
| 584 |
-
global $_wp_additional_image_sizes;
|
| 585 |
-
if ( is_string( $size ) && isset( $_wp_additional_image_sizes[$size] ) ) {
|
| 586 |
-
return array(
|
| 587 |
-
'width' => $_wp_additional_image_sizes[$size]['width'],
|
| 588 |
-
'height' => $_wp_additional_image_sizes[$size]['height'],
|
| 589 |
-
'crop' => $_wp_additional_image_sizes[$size]['crop']
|
| 590 |
-
);
|
| 591 |
-
}
|
| 592 |
-
|
| 593 |
-
// Handle default WP size format.
|
| 594 |
-
if ( is_array( $size ) && isset( $size[0] ) && isset( $size[1] ) )
|
| 595 |
-
$size = array( 'width' => $size[0], 'height' => $size[1] );
|
| 596 |
-
|
| 597 |
-
return wp_parse_args( $size, array(
|
| 598 |
-
'width' => get_option( 'thumbnail_size_w' ),
|
| 599 |
-
'height' => get_option( 'thumbnail_size_h' ),
|
| 600 |
-
'crop' => get_option( 'thumbnail_crop' )
|
| 601 |
-
) );
|
| 602 |
-
|
| 603 |
-
}
|
| 604 |
-
|
| 605 |
-
/**
|
| 606 |
-
* Ajax callback for outputing an image src based on post data.
|
| 607 |
-
*
|
| 608 |
-
* @return null
|
| 609 |
-
*/
|
| 610 |
-
static function request_image_ajax_callback() {
|
| 611 |
-
|
| 612 |
-
if ( ! ( isset( $_POST['nonce'] ) && wp_verify_nonce( $_POST['nonce'], 'drkfr-file-upload-nonce' ) ) )
|
| 613 |
-
return;
|
| 614 |
-
|
| 615 |
-
$id = intval( $_POST['id'] );
|
| 616 |
-
|
| 617 |
-
$size = array(
|
| 618 |
-
intval( $_POST['width'] ),
|
| 619 |
-
intval( $_POST['height'] ),
|
| 620 |
-
'crop' => (bool) $_POST['crop']
|
| 621 |
-
);
|
| 622 |
-
|
| 623 |
-
$image = wp_get_attachment_image_src( $id, $size );
|
| 624 |
-
echo reset( $image );
|
| 625 |
-
|
| 626 |
-
die(); // this is required to return a proper result
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
}
|
| 630 |
-
add_action( 'wp_ajax_drkfr_request_image', array( 'drkfr_Image_Field', 'request_image_ajax_callback' ) );
|
| 631 |
-
|
| 632 |
-
/**
|
| 633 |
-
* Standard text meta box for a URL.
|
| 634 |
-
*
|
| 635 |
-
*/
|
| 636 |
-
class drkfr_URL_Field extends drkfr_Field {
|
| 637 |
-
|
| 638 |
-
public function html() { ?>
|
| 639 |
-
|
| 640 |
-
<input type="text" <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_url code' ); ?> <?php $this->name_attr(); ?> value="<?php echo esc_attr( esc_url( $this->value ) ); ?>" />
|
| 641 |
-
|
| 642 |
-
<?php }
|
| 643 |
-
}
|
| 644 |
-
|
| 645 |
-
/**
|
| 646 |
-
* Date picker box.
|
| 647 |
-
*
|
| 648 |
-
*/
|
| 649 |
-
class drkfr_Date_Field extends drkfr_Field {
|
| 650 |
-
|
| 651 |
-
public function enqueue_scripts() {
|
| 652 |
-
|
| 653 |
-
parent::enqueue_scripts();
|
| 654 |
-
|
| 655 |
-
wp_enqueue_style( 'drkfr-jquery-ui', trailingslashit( drkfr_URL ) . 'css/vendor/jquery-ui/jquery-ui.css', '1.10.3' );
|
| 656 |
-
|
| 657 |
-
wp_enqueue_script( 'drkfr-datetime', trailingslashit( drkfr_URL ) . 'js/field.datetime.js', array( 'jquery', 'jquery-ui-core', 'jquery-ui-datepicker', 'drkfr-scripts' ) );
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
public function html() { ?>
|
| 661 |
-
|
| 662 |
-
<input <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_small drkfr_datepicker' ); ?> type="text" <?php $this->name_attr(); ?> value="<?php echo esc_attr( $this->value ); ?>" />
|
| 663 |
-
|
| 664 |
-
<?php }
|
| 665 |
-
}
|
| 666 |
-
|
| 667 |
-
class drkfr_Time_Field extends drkfr_Field {
|
| 668 |
-
|
| 669 |
-
public function enqueue_scripts() {
|
| 670 |
-
|
| 671 |
-
parent::enqueue_scripts();
|
| 672 |
-
|
| 673 |
-
wp_enqueue_style( 'drkfr-jquery-ui', trailingslashit( drkfr_URL ) . 'css/vendor/jquery-ui/jquery-ui.css', '1.10.3' );
|
| 674 |
-
|
| 675 |
-
wp_enqueue_script( 'drkfr-timepicker', trailingslashit( drkfr_URL ) . 'js/jquery.timePicker.min.js', array( 'jquery', 'drkfr-scripts' ) );
|
| 676 |
-
wp_enqueue_script( 'drkfr-datetime', trailingslashit( drkfr_URL ) . 'js/field.datetime.js', array( 'jquery', 'jquery-ui-core', 'jquery-ui-datepicker', 'drkfr-scripts' ) );
|
| 677 |
-
}
|
| 678 |
-
|
| 679 |
-
public function html() { ?>
|
| 680 |
-
|
| 681 |
-
<input <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_small drkfr_timepicker' ); ?> type="text" <?php $this->name_attr(); ?> value="<?php echo esc_attr( $this->value ); ?>"/>
|
| 682 |
-
|
| 683 |
-
<?php }
|
| 684 |
-
|
| 685 |
-
}
|
| 686 |
-
|
| 687 |
-
/**
|
| 688 |
-
* Date picker for date only (not time) box.
|
| 689 |
-
*
|
| 690 |
-
*/
|
| 691 |
-
class drkfr_Date_Timestamp_Field extends drkfr_Field {
|
| 692 |
-
|
| 693 |
-
public function enqueue_scripts() {
|
| 694 |
-
|
| 695 |
-
parent::enqueue_scripts();
|
| 696 |
-
|
| 697 |
-
wp_enqueue_style( 'drkfr-jquery-ui', trailingslashit( drkfr_URL ) . 'css/vendor/jquery-ui/jquery-ui.css', '1.10.3' );
|
| 698 |
-
|
| 699 |
-
wp_enqueue_script( 'drkfr-timepicker', trailingslashit( drkfr_URL ) . 'js/jquery.timePicker.min.js', array( 'jquery', 'drkfr-scripts' ) );
|
| 700 |
-
wp_enqueue_script( 'drkfr-datetime', trailingslashit( drkfr_URL ) . 'js/field.datetime.js', array( 'jquery', 'jquery-ui-core', 'jquery-ui-datepicker', 'drkfr-scripts' ) );
|
| 701 |
-
|
| 702 |
-
}
|
| 703 |
-
|
| 704 |
-
public function html() { ?>
|
| 705 |
-
|
| 706 |
-
<input <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_small drkfr_datepicker' ); ?> type="text" <?php $this->name_attr(); ?> value="<?php echo $this->value ? esc_attr( date( 'm\/d\/Y', $this->value ) ) : '' ?>" />
|
| 707 |
-
|
| 708 |
-
<?php }
|
| 709 |
-
|
| 710 |
-
public function parse_save_values() {
|
| 711 |
-
|
| 712 |
-
foreach( $this->values as &$value )
|
| 713 |
-
$value = strtotime( $value );
|
| 714 |
-
|
| 715 |
-
sort( $this->values );
|
| 716 |
-
|
| 717 |
-
}
|
| 718 |
-
|
| 719 |
-
}
|
| 720 |
-
|
| 721 |
-
/**
|
| 722 |
-
* Date picker for date and time (seperate fields) box.
|
| 723 |
-
*
|
| 724 |
-
*/
|
| 725 |
-
class drkfr_Datetime_Timestamp_Field extends drkfr_Field {
|
| 726 |
-
|
| 727 |
-
public function enqueue_scripts() {
|
| 728 |
-
|
| 729 |
-
parent::enqueue_scripts();
|
| 730 |
-
|
| 731 |
-
wp_enqueue_style( 'drkfr-jquery-ui', trailingslashit( drkfr_URL ) . 'css/vendor/jquery-ui/jquery-ui.css', '1.10.3' );
|
| 732 |
-
|
| 733 |
-
wp_enqueue_script( 'drkfr-timepicker', trailingslashit( drkfr_URL ) . 'js/jquery.timePicker.min.js', array( 'jquery', 'drkfr-scripts' ) );
|
| 734 |
-
wp_enqueue_script( 'drkfr-datetime', trailingslashit( drkfr_URL ) . 'js/field.datetime.js', array( 'jquery', 'jquery-ui-core', 'jquery-ui-datepicker', 'drkfr-scripts' ) );
|
| 735 |
-
}
|
| 736 |
-
|
| 737 |
-
public function html() { ?>
|
| 738 |
-
|
| 739 |
-
<input <?php $this->id_attr('date'); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_small drkfr_datepicker' ); ?> type="text" <?php $this->name_attr( '[date]' ); ?> value="<?php echo $this->value ? esc_attr( date( 'm\/d\/Y', $this->value ) ) : '' ?>" />
|
| 740 |
-
<input <?php $this->id_attr('time'); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_text_small drkfr_timepicker' ); ?> type="text" <?php $this->name_attr( '[time]' ); ?> value="<?php echo $this->value ? esc_attr( date( 'h:i A', $this->value ) ) : '' ?>" />
|
| 741 |
-
|
| 742 |
-
<?php }
|
| 743 |
-
|
| 744 |
-
public function parse_save_values() {
|
| 745 |
-
|
| 746 |
-
// Convert all [date] and [time] values to a unix timestamp.
|
| 747 |
-
// If date is empty, assume delete. If time is empty, assume 00:00.
|
| 748 |
-
foreach( $this->values as $key => &$value ) {
|
| 749 |
-
if ( empty( $value['date'] ) )
|
| 750 |
-
unset( $this->values[$key] );
|
| 751 |
-
else
|
| 752 |
-
$value = strtotime( $value['date'] . ' ' . $value['time'] );
|
| 753 |
-
}
|
| 754 |
-
|
| 755 |
-
$this->values = array_filter( $this->values );
|
| 756 |
-
sort( $this->values );
|
| 757 |
-
|
| 758 |
-
parent::parse_save_values();
|
| 759 |
-
|
| 760 |
-
}
|
| 761 |
-
|
| 762 |
-
}
|
| 763 |
-
|
| 764 |
-
/**
|
| 765 |
-
* Standard text field.
|
| 766 |
-
*
|
| 767 |
-
* Args:
|
| 768 |
-
* - int "rows" - number of rows in the <textarea>
|
| 769 |
-
*/
|
| 770 |
-
class drkfr_Textarea_Field extends drkfr_Field {
|
| 771 |
-
|
| 772 |
-
public function html() { ?>
|
| 773 |
-
|
| 774 |
-
<textarea <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr(); ?> rows="<?php echo ! empty( $this->args['rows'] ) ? esc_attr( $this->args['rows'] ) : 4; ?>" <?php $this->name_attr(); ?>><?php echo esc_html( $this->value ); ?></textarea>
|
| 775 |
-
|
| 776 |
-
<?php }
|
| 777 |
-
|
| 778 |
-
}
|
| 779 |
-
|
| 780 |
-
/**
|
| 781 |
-
* Code style text field.
|
| 782 |
-
*
|
| 783 |
-
* Args:
|
| 784 |
-
* - int "rows" - number of rows in the <textarea>
|
| 785 |
-
*/
|
| 786 |
-
class drkfr_Textarea_Field_Code extends drkfr_Textarea_Field {
|
| 787 |
-
|
| 788 |
-
public function html() {
|
| 789 |
-
|
| 790 |
-
$this->args['class'] .= ' code';
|
| 791 |
-
|
| 792 |
-
parent::html();
|
| 793 |
-
|
| 794 |
-
}
|
| 795 |
-
|
| 796 |
-
}
|
| 797 |
-
|
| 798 |
-
/**
|
| 799 |
-
* Colour picker
|
| 800 |
-
*
|
| 801 |
-
*/
|
| 802 |
-
class drkfr_Color_Picker extends drkfr_Field {
|
| 803 |
-
|
| 804 |
-
public function enqueue_scripts() {
|
| 805 |
-
|
| 806 |
-
parent::enqueue_scripts();
|
| 807 |
-
|
| 808 |
-
wp_enqueue_script( 'drkfr-colorpicker', trailingslashit( drkfr_URL ) . 'js/field.colorpicker.js', array( 'jquery', 'wp-color-picker', 'drkfr-scripts' ) );
|
| 809 |
-
wp_enqueue_style( 'wp-color-picker' );
|
| 810 |
-
}
|
| 811 |
-
|
| 812 |
-
public function html() { ?>
|
| 813 |
-
|
| 814 |
-
<input <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr( 'drkfr_colorpicker drkfr_text_small' ); ?> type="text" <?php $this->name_attr(); ?> value="<?php echo esc_attr( $this->get_value() ); ?>" />
|
| 815 |
-
|
| 816 |
-
<?php }
|
| 817 |
-
|
| 818 |
-
}
|
| 819 |
-
|
| 820 |
-
/**
|
| 821 |
-
* Standard radio field.
|
| 822 |
-
*
|
| 823 |
-
* Args:
|
| 824 |
-
* - bool "inline" - display the radio buttons inline
|
| 825 |
-
*/
|
| 826 |
-
class drkfr_Radio_Field extends drkfr_Field {
|
| 827 |
-
|
| 828 |
-
/**
|
| 829 |
-
* Return the default args for the Radio input field.
|
| 830 |
-
*
|
| 831 |
-
* @return array $args
|
| 832 |
-
*/
|
| 833 |
-
public function get_default_args() {
|
| 834 |
-
return array_merge(
|
| 835 |
-
parent::get_default_args(),
|
| 836 |
-
array(
|
| 837 |
-
'options' => array(),
|
| 838 |
-
)
|
| 839 |
-
);
|
| 840 |
-
}
|
| 841 |
-
|
| 842 |
-
public function html() {
|
| 843 |
-
|
| 844 |
-
if ( $this->has_data_delegate() )
|
| 845 |
-
$this->args['options'] = $this->get_delegate_data(); ?>
|
| 846 |
-
|
| 847 |
-
<?php foreach ( $this->args['options'] as $key => $value ): ?>
|
| 848 |
-
|
| 849 |
-
<input <?php $this->id_attr( 'item-' . $key ); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr(); ?> type="radio" <?php $this->name_attr(); ?> value="<?php echo esc_attr( $key ); ?>" <?php checked( $key, $this->get_value() ); ?> />
|
| 850 |
-
<label <?php $this->for_attr( 'item-' . $key ); ?> style="margin-right: 20px;">
|
| 851 |
-
<?php echo esc_html( $value ); ?>
|
| 852 |
-
</label>
|
| 853 |
-
|
| 854 |
-
<?php endforeach; ?>
|
| 855 |
-
|
| 856 |
-
<?php }
|
| 857 |
-
|
| 858 |
-
}
|
| 859 |
-
|
| 860 |
-
/**
|
| 861 |
-
* Standard checkbox field.
|
| 862 |
-
*
|
| 863 |
-
*/
|
| 864 |
-
class drkfr_Checkbox extends drkfr_Field {
|
| 865 |
-
|
| 866 |
-
public function title() {}
|
| 867 |
-
|
| 868 |
-
public function html() { ?>
|
| 869 |
-
|
| 870 |
-
<input <?php $this->id_attr(); ?> <?php $this->boolean_attr(); ?> <?php $this->class_attr(); ?> type="checkbox" <?php $this->name_attr(); ?> value="1" <?php checked( $this->get_value() ); ?> />
|
| 871 |
-
<label <?php $this->for_attr(); ?>><?php echo esc_html( $this->title ); ?></label>
|
| 872 |
-
|
| 873 |
-
<?php }
|
| 874 |
-
|
| 875 |
-
}
|
| 876 |
-
|
| 877 |
-
|
| 878 |
-
/**
|
| 879 |
-
* Standard title used as a splitter.
|
| 880 |
-
*
|
| 881 |
-
*/
|
| 882 |
-
class drkfr_Title extends drkfr_Field {
|
| 883 |
-
|
| 884 |
-
public function title() {
|
| 885 |
-
?>
|
| 886 |
-
|
| 887 |
-
<div class="field-title">
|
| 888 |
-
<h2 <?php $this->class_attr(); ?>>
|
| 889 |
-
<?php echo esc_html( $this->title ); ?>
|
| 890 |
-
</h2>
|
| 891 |
-
</div>
|
| 892 |
-
|
| 893 |
-
<?php
|
| 894 |
-
|
| 895 |
-
}
|
| 896 |
-
|
| 897 |
-
public function html() {}
|
| 898 |
-
|
| 899 |
-
}
|
| 900 |
-
|
| 901 |
-
/**
|
| 902 |
-
* wysiwyg field.
|
| 903 |
-
*
|
| 904 |
-
*/
|
| 905 |
-
class drkfr_wysiwyg extends drkfr_Field {
|
| 906 |
-
|
| 907 |
-
/**
|
| 908 |
-
* Return the default args for the WYSIWYG field.
|
| 909 |
-
*
|
| 910 |
-
* @return array $args
|
| 911 |
-
*/
|
| 912 |
-
public function get_default_args() {
|
| 913 |
-
return array_merge(
|
| 914 |
-
parent::get_default_args(),
|
| 915 |
-
array(
|
| 916 |
-
'options' => array(),
|
| 917 |
-
)
|
| 918 |
-
);
|
| 919 |
-
}
|
| 920 |
-
|
| 921 |
-
function enqueue_scripts() {
|
| 922 |
-
|
| 923 |
-
parent::enqueue_scripts();
|
| 924 |
-
|
| 925 |
-
wp_enqueue_script( 'drkfr-wysiwyg', trailingslashit( drkfr_URL ) . 'js/field-wysiwyg.js', array( 'jquery', 'drkfr-scripts' ) );
|
| 926 |
-
}
|
| 927 |
-
|
| 928 |
-
public function html() {
|
| 929 |
-
|
| 930 |
-
$id = $this->get_the_id_attr();
|
| 931 |
-
$name = $this->get_the_name_attr();
|
| 932 |
-
|
| 933 |
-
$field_id = $this->get_js_id();
|
| 934 |
-
|
| 935 |
-
printf( '<div class="drkfr-wysiwyg" data-id="%s" data-name="%s" data-field-id="%s">', $id, $name, $field_id );
|
| 936 |
-
|
| 937 |
-
if ( $this->is_placeholder() ) {
|
| 938 |
-
|
| 939 |
-
// For placeholder, output the markup for the editor in a JS var.
|
| 940 |
-
ob_start();
|
| 941 |
-
$this->args['options']['textarea_name'] = 'drkfr-placeholder-name-' . $field_id;
|
| 942 |
-
wp_editor( '', 'drkfr-placeholder-id-' . $field_id, $this->args['options'] );
|
| 943 |
-
$editor = ob_get_clean();
|
| 944 |
-
$editor = str_replace( array( "\n", "\r" ), "", $editor );
|
| 945 |
-
$editor = str_replace( array( "'" ), '"', $editor );
|
| 946 |
-
|
| 947 |
-
?>
|
| 948 |
-
|
| 949 |
-
<script>
|
| 950 |
-
if ( 'undefined' === typeof( drkfr_wysiwyg_editors ) )
|
| 951 |
-
var drkfr_wysiwyg_editors = {};
|
| 952 |
-
drkfr_wysiwyg_editors.<?php echo $field_id; ?> = '<?php echo $editor; ?>';
|
| 953 |
-
</script>
|
| 954 |
-
|
| 955 |
-
<?php
|
| 956 |
-
|
| 957 |
-
} else {
|
| 958 |
-
|
| 959 |
-
$this->args['options']['textarea_name'] = $name;
|
| 960 |
-
echo wp_editor( $this->get_value(), $id, $this->args['options'] );
|
| 961 |
-
|
| 962 |
-
}
|
| 963 |
-
|
| 964 |
-
echo '</div>';
|
| 965 |
-
|
| 966 |
-
}
|
| 967 |
-
|
| 968 |
-
/**
|
| 969 |
-
* Check if this is a placeholder field.
|
| 970 |
-
* Either the field itself, or because it is part of a repeatable group.
|
| 971 |
-
*
|
| 972 |
-
* @return bool
|
| 973 |
-
*/
|
| 974 |
-
public function is_placeholder() {
|
| 975 |
-
|
| 976 |
-
if ( isset( $this->parent ) && ! is_int( $this->parent->field_index ) )
|
| 977 |
-
return true;
|
| 978 |
-
|
| 979 |
-
else return ! is_int( $this->field_index );
|
| 980 |
-
|
| 981 |
-
}
|
| 982 |
-
|
| 983 |
-
}
|
| 984 |
-
|
| 985 |
-
/**
|
| 986 |
-
* Standard select field.
|
| 987 |
-
*
|
| 988 |
-
* @supports "data_delegate"
|
| 989 |
-
* @args
|
| 990 |
-
* 'options' => array Array of options to show in the select, optionally use data_delegate instead
|
| 991 |
-
* 'allow_none' => bool Allow no option to be selected (will palce a "None" at the top of the select)
|
| 992 |
-
* 'multiple' => bool whether multiple can be selected
|
| 993 |
-
*/
|
| 994 |
-
class drkfr_Select extends drkfr_Field {
|
| 995 |
-
|
| 996 |
-
public function __construct() {
|
| 997 |
-
|
| 998 |
-
$args = func_get_args();
|
| 999 |
-
|
| 1000 |
-
call_user_func_array( array( 'parent', '__construct' ), $args );
|
| 1001 |
-
|
| 1002 |
-
}
|
| 1003 |
-
|
| 1004 |
-
/**
|
| 1005 |
-
* Return the default args for the Select field.
|
| 1006 |
-
*
|
| 1007 |
-
* @return array $args
|
| 1008 |
-
*/
|
| 1009 |
-
public function get_default_args() {
|
| 1010 |
-
return array_merge(
|
| 1011 |
-
parent::get_default_args(),
|
| 1012 |
-
array(
|
| 1013 |
-
'options' => array(),
|
| 1014 |
-
'multiple' => false,
|
| 1015 |
-
'select2_options' => array(),
|
| 1016 |
-
)
|
| 1017 |
-
);
|
| 1018 |
-
}
|
| 1019 |
-
|
| 1020 |
-
public function parse_save_values(){
|
| 1021 |
-
|
| 1022 |
-
if ( isset( $this->parent ) && isset( $this->args['multiple'] ) && $this->args['multiple'] )
|
| 1023 |
-
$this->values = array( $this->values );
|
| 1024 |
-
|
| 1025 |
-
}
|
| 1026 |
-
|
| 1027 |
-
public function get_options() {
|
| 1028 |
-
|
| 1029 |
-
if ( $this->has_data_delegate() )
|
| 1030 |
-
$this->args['options'] = $this->get_delegate_data();
|
| 1031 |
-
|
| 1032 |
-
return $this->args['options'];
|
| 1033 |
-
}
|
| 1034 |
-
|
| 1035 |
-
public function enqueue_scripts() {
|
| 1036 |
-
|
| 1037 |
-
parent::enqueue_scripts();
|
| 1038 |
-
|
| 1039 |
-
wp_enqueue_script( 'select2', trailingslashit( drkfr_URL ) . 'js/vendor/select2/select2.js', array( 'jquery' ) );
|
| 1040 |
-
wp_enqueue_script( 'field-select', trailingslashit( drkfr_URL ) . 'js/field.select.js', array( 'jquery', 'select2', 'drkfr-scripts' ) );
|
| 1041 |
-
}
|
| 1042 |
-
|
| 1043 |
-
public function enqueue_styles() {
|
| 1044 |
-
|
| 1045 |
-
parent::enqueue_styles();
|
| 1046 |
-
|
| 1047 |
-
wp_enqueue_style( 'select2', trailingslashit( drkfr_URL ) . 'js/vendor/select2/select2.css' );
|
| 1048 |
-
}
|
| 1049 |
-
|
| 1050 |
-
public function html() {
|
| 1051 |
-
|
| 1052 |
-
if ( $this->has_data_delegate() )
|
| 1053 |
-
$this->args['options'] = $this->get_delegate_data();
|
| 1054 |
-
|
| 1055 |
-
$this->output_field();
|
| 1056 |
-
|
| 1057 |
-
$this->output_script();
|
| 1058 |
-
|
| 1059 |
-
}
|
| 1060 |
-
|
| 1061 |
-
public function output_field() {
|
| 1062 |
-
|
| 1063 |
-
$val = (array) $this->get_value();
|
| 1064 |
-
|
| 1065 |
-
$name = $this->get_the_name_attr();
|
| 1066 |
-
$name .= ! empty( $this->args['multiple'] ) ? '[]' : null;
|
| 1067 |
-
|
| 1068 |
-
?>
|
| 1069 |
-
|
| 1070 |
-
<select
|
| 1071 |
-
<?php $this->id_attr(); ?>
|
| 1072 |
-
<?php $this->boolean_attr(); ?>
|
| 1073 |
-
<?php printf( 'name="%s"', esc_attr( $name ) ); ?>
|
| 1074 |
-
<?php printf( 'data-field-id="%s" ', esc_attr( $this->get_js_id() ) ); ?>
|
| 1075 |
-
<?php echo ! empty( $this->args['multiple'] ) ? 'multiple' : '' ?>
|
| 1076 |
-
<?php $this->class_attr( 'drkfr_select' ); ?>
|
| 1077 |
-
style="width: 100%"
|
| 1078 |
-
>
|
| 1079 |
-
|
| 1080 |
-
<?php if ( ! empty( $this->args['allow_none'] ) ) : ?>
|
| 1081 |
-
<option value=""></option>
|
| 1082 |
-
<?php endif; ?>
|
| 1083 |
-
|
| 1084 |
-
<?php foreach ( $this->args['options'] as $value => $name ): ?>
|
| 1085 |
-
<option <?php selected( in_array( $value, $val ) ) ?> value="<?php echo esc_attr( $value ); ?>"><?php echo esc_html( $name ); ?></option>
|
| 1086 |
-
<?php endforeach; ?>
|
| 1087 |
-
|
| 1088 |
-
</select>
|
| 1089 |
-
|
| 1090 |
-
<?php
|
| 1091 |
-
}
|
| 1092 |
-
|
| 1093 |
-
public function output_script() {
|
| 1094 |
-
|
| 1095 |
-
$options = wp_parse_args( $this->args['select2_options'], array(
|
| 1096 |
-
'placeholder' => __( 'Type to search', 'drkfr' ),
|
| 1097 |
-
'allowClear' => true,
|
| 1098 |
-
) );
|
| 1099 |
-
|
| 1100 |
-
?>
|
| 1101 |
-
|
| 1102 |
-
<script type="text/javascript">
|
| 1103 |
-
|
| 1104 |
-
(function($) {
|
| 1105 |
-
|
| 1106 |
-
var options = <?php echo json_encode( $options ); ?>
|
| 1107 |
-
|
| 1108 |
-
if ( 'undefined' === typeof( window.drkfr_select_fields ) )
|
| 1109 |
-
window.drkfr_select_fields = {};
|
| 1110 |
-
|
| 1111 |
-
var id = <?php echo json_encode( $this->get_js_id() ); ?>;
|
| 1112 |
-
window.drkfr_select_fields[id] = options;
|
| 1113 |
-
|
| 1114 |
-
})( jQuery );
|
| 1115 |
-
|
| 1116 |
-
</script>
|
| 1117 |
-
|
| 1118 |
-
<?php
|
| 1119 |
-
}
|
| 1120 |
-
|
| 1121 |
-
}
|
| 1122 |
-
|
| 1123 |
-
class drkfr_Taxonomy extends drkfr_Select {
|
| 1124 |
-
|
| 1125 |
-
/**
|
| 1126 |
-
* Return the default args for the Taxonomy select field.
|
| 1127 |
-
*
|
| 1128 |
-
* @return array $args
|
| 1129 |
-
*/
|
| 1130 |
-
public function get_default_args() {
|
| 1131 |
-
return array_merge(
|
| 1132 |
-
parent::get_default_args(),
|
| 1133 |
-
array(
|
| 1134 |
-
'taxonomy' => '',
|
| 1135 |
-
'hide_empty' => false,
|
| 1136 |
-
)
|
| 1137 |
-
);
|
| 1138 |
-
}
|
| 1139 |
-
|
| 1140 |
-
|
| 1141 |
-
public function __construct() {
|
| 1142 |
-
|
| 1143 |
-
$args = func_get_args();
|
| 1144 |
-
|
| 1145 |
-
call_user_func_array( array( 'parent', '__construct' ), $args );
|
| 1146 |
-
|
| 1147 |
-
$this->args['data_delegate'] = array( $this, 'get_delegate_data' );
|
| 1148 |
-
|
| 1149 |
-
}
|
| 1150 |
-
|
| 1151 |
-
public function get_delegate_data() {
|
| 1152 |
-
|
| 1153 |
-
$terms = $this->get_terms();
|
| 1154 |
-
|
| 1155 |
-
if ( is_wp_error( $terms ) ) {
|
| 1156 |
-
return array();
|
| 1157 |
-
}
|
| 1158 |
-
|
| 1159 |
-
$term_options = array();
|
| 1160 |
-
|
| 1161 |
-
foreach ( $terms as $term )
|
| 1162 |
-
$term_options[$term->term_id] = $term->name;
|
| 1163 |
-
|
| 1164 |
-
return $term_options;
|
| 1165 |
-
|
| 1166 |
-
}
|
| 1167 |
-
|
| 1168 |
-
private function get_terms() {
|
| 1169 |
-
|
| 1170 |
-
return get_terms( $this->args['taxonomy'], array( 'hide_empty' => $this->args['hide_empty'] ) );
|
| 1171 |
-
|
| 1172 |
-
}
|
| 1173 |
-
|
| 1174 |
-
}
|
| 1175 |
-
|
| 1176 |
-
/**
|
| 1177 |
-
* Post Select field.
|
| 1178 |
-
*
|
| 1179 |
-
* @supports "data_delegate"
|
| 1180 |
-
* @args
|
| 1181 |
-
* 'options' => array Array of options to show in the select, optionally use data_delegate instead
|
| 1182 |
-
* 'allow_none' => bool Allow no option to be selected (will palce a "None" at the top of the select)
|
| 1183 |
-
* 'multiple' => bool whether multiple can be selected
|
| 1184 |
-
*/
|
| 1185 |
-
class drkfr_Post_Select extends drkfr_Select {
|
| 1186 |
-
|
| 1187 |
-
public function __construct() {
|
| 1188 |
-
|
| 1189 |
-
$args = func_get_args();
|
| 1190 |
-
|
| 1191 |
-
call_user_func_array( array( 'parent', '__construct' ), $args );
|
| 1192 |
-
|
| 1193 |
-
if ( ! $this->args['use_ajax'] ) {
|
| 1194 |
-
|
| 1195 |
-
$this->args['data_delegate'] = array( $this, 'get_delegate_data' );
|
| 1196 |
-
|
| 1197 |
-
}
|
| 1198 |
-
|
| 1199 |
-
}
|
| 1200 |
-
|
| 1201 |
-
/**
|
| 1202 |
-
* Return the default args for the Post select field.
|
| 1203 |
-
*
|
| 1204 |
-
* @return array $args
|
| 1205 |
-
*/
|
| 1206 |
-
public function get_default_args() {
|
| 1207 |
-
return array_merge(
|
| 1208 |
-
parent::get_default_args(),
|
| 1209 |
-
array(
|
| 1210 |
-
'query' => array(),
|
| 1211 |
-
'use_ajax' => false,
|
| 1212 |
-
'multiple' => false,
|
| 1213 |
-
)
|
| 1214 |
-
);
|
| 1215 |
-
}
|
| 1216 |
-
|
| 1217 |
-
public function get_delegate_data() {
|
| 1218 |
-
|
| 1219 |
-
$data = array();
|
| 1220 |
-
|
| 1221 |
-
foreach ( $this->get_posts() as $post_id )
|
| 1222 |
-
$data[$post_id] = get_the_title( $post_id );
|
| 1223 |
-
|
| 1224 |
-
return $data;
|
| 1225 |
-
|
| 1226 |
-
}
|
| 1227 |
-
|
| 1228 |
-
private function get_posts() {
|
| 1229 |
-
|
| 1230 |
-
$this->args['query']['fields'] = 'ids';
|
| 1231 |
-
$query = new WP_Query( $this->args['query'] );
|
| 1232 |
-
|
| 1233 |
-
return isset( $query->posts ) ? $query->posts : array();
|
| 1234 |
-
|
| 1235 |
-
}
|
| 1236 |
-
|
| 1237 |
-
public function parse_save_value() {
|
| 1238 |
-
|
| 1239 |
-
// AJAX multi select2 data is submitted as a string of comma separated post IDs.
|
| 1240 |
-
// If empty, set to false instead of empty array to ensure the meta entry is deleted.
|
| 1241 |
-
if ( $this->args['use_ajax'] && $this->args['multiple'] ) {
|
| 1242 |
-
$this->value = ( ! empty( $this->value ) ) ? explode( ',', $this->value ) : false;
|
| 1243 |
-
}
|
| 1244 |
-
|
| 1245 |
-
}
|
| 1246 |
-
|
| 1247 |
-
public function output_field() {
|
| 1248 |
-
|
| 1249 |
-
// If AJAX, must use input type not standard select.
|
| 1250 |
-
if ( $this->args['use_ajax'] ) :
|
| 1251 |
-
|
| 1252 |
-
?>
|
| 1253 |
-
|
| 1254 |
-
<input
|
| 1255 |
-
<?php $this->id_attr(); ?>
|
| 1256 |
-
<?php printf( 'value="%s" ', esc_attr( implode( ',' , (array) $this->value ) ) ); ?>
|
| 1257 |
-
<?php printf( 'name="%s"', esc_attr( $this->get_the_name_attr() ) ); ?>
|
| 1258 |
-
<?php printf( 'data-field-id="%s" ', esc_attr( $this->get_js_id() ) ); ?>
|
| 1259 |
-
<?php $this->boolean_attr(); ?>
|
| 1260 |
-
class="drkfr_select"
|
| 1261 |
-
style="width: 100%"
|
| 1262 |
-
/>
|
| 1263 |
-
|
| 1264 |
-
<?php
|
| 1265 |
-
|
| 1266 |
-
else :
|
| 1267 |
-
|
| 1268 |
-
parent::output_field();
|
| 1269 |
-
|
| 1270 |
-
endif;
|
| 1271 |
-
|
| 1272 |
-
}
|
| 1273 |
-
|
| 1274 |
-
public function output_script() {
|
| 1275 |
-
|
| 1276 |
-
parent::output_script();
|
| 1277 |
-
|
| 1278 |
-
?>
|
| 1279 |
-
|
| 1280 |
-
<script type="text/javascript">
|
| 1281 |
-
|
| 1282 |
-
(function($) {
|
| 1283 |
-
|
| 1284 |
-
if ( 'undefined' === typeof( window.drkfr_select_fields ) )
|
| 1285 |
-
return false;
|
| 1286 |
-
|
| 1287 |
-
// Get options for this field so we can modify it.
|
| 1288 |
-
var id = <?php echo json_encode( $this->get_js_id() ); ?>;
|
| 1289 |
-
var options = window.drkfr_select_fields[id];
|
| 1290 |
-
|
| 1291 |
-
<?php if ( $this->args['use_ajax'] && $this->args['multiple'] ) : ?>
|
| 1292 |
-
// The multiple setting is required when using ajax (because an input field is used instead of select)
|
| 1293 |
-
options.multiple = true;
|
| 1294 |
-
<?php endif; ?>
|
| 1295 |
-
|
| 1296 |
-
<?php if ( $this->args['use_ajax'] && ! empty( $this->value ) ) : ?>
|
| 1297 |
-
|
| 1298 |
-
options.initSelection = function( element, callback ) {
|
| 1299 |
-
|
| 1300 |
-
var data = [];
|
| 1301 |
-
|
| 1302 |
-
<?php if ( $this->args['multiple'] ) : ?>
|
| 1303 |
-
|
| 1304 |
-
<?php foreach ( (array) $this->value as $post_id ) : ?>
|
| 1305 |
-
data.push( <?php echo json_encode( array( 'id' => $post_id, 'text' => html_entity_decode( get_the_title( $post_id ) ) ) ); ?> );
|
| 1306 |
-
<?php endforeach; ?>
|
| 1307 |
-
|
| 1308 |
-
<?php else : ?>
|
| 1309 |
-
|
| 1310 |
-
data = <?php echo json_encode( array( 'id' => $this->value, 'text' => html_entity_decode( get_the_title( $this->get_value() ) ) ) ); ?>;
|
| 1311 |
-
|
| 1312 |
-
<?php endif; ?>
|
| 1313 |
-
|
| 1314 |
-
callback( data );
|
| 1315 |
-
|
| 1316 |
-
};
|
| 1317 |
-
|
| 1318 |
-
<?php endif; ?>
|
| 1319 |
-
|
| 1320 |
-
<?php if ( $this->args['use_ajax'] ) : ?>
|
| 1321 |
-
|
| 1322 |
-
var ajaxData = {
|
| 1323 |
-
action : 'drkfr_post_select',
|
| 1324 |
-
post_id : '<?php echo intval( get_the_id() ); ?>', // Used for user capabilty check.
|
| 1325 |
-
nonce : <?php echo json_encode( wp_create_nonce( 'drkfr_select_field' ) ); ?>,
|
| 1326 |
-
query : <?php echo json_encode( $this->args['query'] ); ?>
|
| 1327 |
-
};
|
| 1328 |
-
|
| 1329 |
-
options.ajax = {
|
| 1330 |
-
url: <?php echo json_encode( esc_url( admin_url( 'admin-ajax.php' ) ) ); ?>,
|
| 1331 |
-
type: 'POST',
|
| 1332 |
-
dataType: 'json',
|
| 1333 |
-
data: function( term, page ) {
|
| 1334 |
-
ajaxData.query.s = term;
|
| 1335 |
-
ajaxData.query.paged = page;
|
| 1336 |
-
return ajaxData;
|
| 1337 |
-
},
|
| 1338 |
-
results : function( results, page ) {
|
| 1339 |
-
var postsPerPage = ajaxData.query.posts_per_page = ( 'posts_per_page' in ajaxData.query ) ? ajaxData.query.posts_per_page : ( 'showposts' in ajaxData.query ) ? ajaxData.query.showposts : 10;
|
| 1340 |
-
var isMore = ( page * postsPerPage ) < results.total;
|
| 1341 |
-
return { results: results.posts, more: isMore };
|
| 1342 |
-
}
|
| 1343 |
-
}
|
| 1344 |
-
|
| 1345 |
-
<?php endif; ?>
|
| 1346 |
-
|
| 1347 |
-
})( jQuery );
|
| 1348 |
-
|
| 1349 |
-
</script>
|
| 1350 |
-
|
| 1351 |
-
<?php
|
| 1352 |
-
}
|
| 1353 |
-
|
| 1354 |
-
}
|
| 1355 |
-
|
| 1356 |
-
// TODO this should be in inside the class
|
| 1357 |
-
function drkfr_ajax_post_select() {
|
| 1358 |
-
|
| 1359 |
-
$post_id = ! empty( $_POST['post_id'] ) ? intval( $_POST['post_id'] ) : false;
|
| 1360 |
-
$nonce = ! empty( $_POST['nonce'] ) ? $_POST['nonce'] : false;
|
| 1361 |
-
$args = ! empty( $_POST['query'] ) ? $_POST['query'] : array();
|
| 1362 |
-
|
| 1363 |
-
if ( ! $nonce || ! wp_verify_nonce( $nonce, 'drkfr_select_field' ) || ! current_user_can( 'edit_post', $post_id ) ) {
|
| 1364 |
-
echo json_encode( array( 'total' => 0, 'posts' => array() ) );
|
| 1365 |
-
exit;
|
| 1366 |
-
}
|
| 1367 |
-
|
| 1368 |
-
$args['fields'] = 'ids'; // Only need to retrieve post IDs.
|
| 1369 |
-
|
| 1370 |
-
$query = new WP_Query( $args );
|
| 1371 |
-
|
| 1372 |
-
$json = array( 'total' => $query->found_posts, 'posts' => array() );
|
| 1373 |
-
|
| 1374 |
-
foreach ( $query->posts as $post_id ) {
|
| 1375 |
-
array_push( $json['posts'], array( 'id' => $post_id, 'text' => html_entity_decode( get_the_title( $post_id ) ) ) );
|
| 1376 |
-
}
|
| 1377 |
-
|
| 1378 |
-
echo json_encode( $json );
|
| 1379 |
-
|
| 1380 |
-
exit;
|
| 1381 |
-
|
| 1382 |
-
}
|
| 1383 |
-
add_action( 'wp_ajax_drkfr_post_select', 'drkfr_ajax_post_select' );
|
| 1384 |
-
|
| 1385 |
-
/**
|
| 1386 |
-
* Field to group child fieids
|
| 1387 |
-
* pass $args[fields] array for child fields
|
| 1388 |
-
* pass $args['repeatable'] for cloing all child fields (set)
|
| 1389 |
-
*
|
| 1390 |
-
* @todo remove global $post reference, somehow
|
| 1391 |
-
*/
|
| 1392 |
-
class drkfr_Group_Field extends drkfr_Field {
|
| 1393 |
-
|
| 1394 |
-
static $added_js;
|
| 1395 |
-
private $fields = array();
|
| 1396 |
-
|
| 1397 |
-
function __construct() {
|
| 1398 |
-
|
| 1399 |
-
$args = func_get_args(); // you can't just put func_get_args() into a function as a parameter
|
| 1400 |
-
call_user_func_array( array( 'parent', '__construct' ), $args );
|
| 1401 |
-
|
| 1402 |
-
if ( ! empty( $this->args['fields'] ) ) {
|
| 1403 |
-
foreach ( $this->args['fields'] as $f ) {
|
| 1404 |
-
|
| 1405 |
-
$class = _drkfr_field_class_for_type( $f['type'] );
|
| 1406 |
-
$this->add_field( new $class( $f['id'], $f['name'], array(), $f ) );
|
| 1407 |
-
|
| 1408 |
-
}
|
| 1409 |
-
}
|
| 1410 |
-
|
| 1411 |
-
}
|
| 1412 |
-
|
| 1413 |
-
/**
|
| 1414 |
-
* Return the default args for the Group field.
|
| 1415 |
-
*
|
| 1416 |
-
* @return array $args
|
| 1417 |
-
*/
|
| 1418 |
-
public function get_default_args() {
|
| 1419 |
-
return array_merge(
|
| 1420 |
-
parent::get_default_args(),
|
| 1421 |
-
array(
|
| 1422 |
-
'fields' => array(),
|
| 1423 |
-
'string-repeat-field' => __( 'Add Item', 'drkfr' ),
|
| 1424 |
-
'string-delete-field' => __( 'Remove Item', 'drkfr' ),
|
| 1425 |
-
)
|
| 1426 |
-
);
|
| 1427 |
-
}
|
| 1428 |
-
|
| 1429 |
-
public function enqueue_scripts() {
|
| 1430 |
-
|
| 1431 |
-
parent::enqueue_scripts();
|
| 1432 |
-
|
| 1433 |
-
foreach ( $this->args['fields'] as $f ) {
|
| 1434 |
-
$class = _drkfr_field_class_for_type( $f['type'] );
|
| 1435 |
-
$field = new $class( '', '', array(), $f );
|
| 1436 |
-
$field->enqueue_scripts();
|
| 1437 |
-
}
|
| 1438 |
-
|
| 1439 |
-
}
|
| 1440 |
-
|
| 1441 |
-
public function enqueue_styles() {
|
| 1442 |
-
|
| 1443 |
-
parent::enqueue_styles();
|
| 1444 |
-
|
| 1445 |
-
foreach ( $this->args['fields'] as $f ) {
|
| 1446 |
-
$class = _drkfr_field_class_for_type( $f['type'] );
|
| 1447 |
-
$field = new $class( '', '', array(), $f );
|
| 1448 |
-
$field->enqueue_styles();
|
| 1449 |
-
}
|
| 1450 |
-
|
| 1451 |
-
}
|
| 1452 |
-
|
| 1453 |
-
public function display() {
|
| 1454 |
-
|
| 1455 |
-
global $post;
|
| 1456 |
-
|
| 1457 |
-
$field = $this->args;
|
| 1458 |
-
$values = $this->get_values();
|
| 1459 |
-
|
| 1460 |
-
$this->title();
|
| 1461 |
-
$this->description();
|
| 1462 |
-
|
| 1463 |
-
if ( ! $this->args['repeatable'] && empty( $values ) ) {
|
| 1464 |
-
$values = array( null );
|
| 1465 |
-
}
|
| 1466 |
-
|
| 1467 |
-
if ( $values ) {
|
| 1468 |
-
|
| 1469 |
-
$i = 0;
|
| 1470 |
-
foreach ( $values as $value ) {
|
| 1471 |
-
|
| 1472 |
-
$this->field_index = $i;
|
| 1473 |
-
$this->value = $value;
|
| 1474 |
-
|
| 1475 |
-
?>
|
| 1476 |
-
|
| 1477 |
-
<div class="field-item" data-class="<?php echo esc_attr( get_class($this) ) ?>" style="<?php echo esc_attr( $this->args['style'] ); ?>">
|
| 1478 |
-
<?php $this->html(); ?>
|
| 1479 |
-
</div>
|
| 1480 |
-
|
| 1481 |
-
<?php
|
| 1482 |
-
|
| 1483 |
-
$i++;
|
| 1484 |
-
|
| 1485 |
-
}
|
| 1486 |
-
|
| 1487 |
-
}
|
| 1488 |
-
|
| 1489 |
-
if ( $this->args['repeatable'] ) {
|
| 1490 |
-
|
| 1491 |
-
$this->field_index = 'x'; // x used to distinguish hidden fields.
|
| 1492 |
-
$this->value = '';
|
| 1493 |
-
|
| 1494 |
-
?>
|
| 1495 |
-
|
| 1496 |
-
<div class="field-item hidden" data-class="<?php echo esc_attr( get_class( $this ) ); ?>" style="<?php echo esc_attr( $this->args['style'] ); ?>">
|
| 1497 |
-
<?php $this->html(); ?>
|
| 1498 |
-
</div>
|
| 1499 |
-
|
| 1500 |
-
<button class="button repeat-field">
|
| 1501 |
-
<?php echo esc_html( $this->args['string-repeat-field'] ); ?>
|
| 1502 |
-
</button>
|
| 1503 |
-
|
| 1504 |
-
<?php }
|
| 1505 |
-
|
| 1506 |
-
}
|
| 1507 |
-
|
| 1508 |
-
public function html() {
|
| 1509 |
-
|
| 1510 |
-
$fields = &$this->get_fields();
|
| 1511 |
-
$value = $this->get_value();
|
| 1512 |
-
|
| 1513 |
-
// Reset all field values.
|
| 1514 |
-
foreach ( $fields as $field ) {
|
| 1515 |
-
$field->set_values( array() );
|
| 1516 |
-
}
|
| 1517 |
-
|
| 1518 |
-
// Set values for this field.
|
| 1519 |
-
if ( ! empty( $value ) ) {
|
| 1520 |
-
foreach ( $value as $field_id => $field_value ) {
|
| 1521 |
-
$field_value = ( ! empty( $field_value ) ) ? $field_value : array();
|
| 1522 |
-
if ( ! empty( $fields[$field_id] ) ) {
|
| 1523 |
-
$fields[$field_id]->set_values( (array) $field_value );
|
| 1524 |
-
}
|
| 1525 |
-
}
|
| 1526 |
-
}
|
| 1527 |
-
|
| 1528 |
-
?>
|
| 1529 |
-
|
| 1530 |
-
<?php if ( $this->args['repeatable'] ) : ?>
|
| 1531 |
-
<button class="drkfr-delete-field">
|
| 1532 |
-
<span class="drkfr-delete-field-icon">×</span>
|
| 1533 |
-
<?php echo esc_html( $this->args['string-delete-field'] ); ?>
|
| 1534 |
-
</button>
|
| 1535 |
-
<?php endif; ?>
|
| 1536 |
-
|
| 1537 |
-
<?php drkfr_Meta_Box::layout_fields( $fields ); ?>
|
| 1538 |
-
|
| 1539 |
-
<?php }
|
| 1540 |
-
|
| 1541 |
-
public function parse_save_values() {
|
| 1542 |
-
|
| 1543 |
-
$fields = &$this->get_fields();
|
| 1544 |
-
$values = &$this->get_values();
|
| 1545 |
-
|
| 1546 |
-
foreach ( $values as &$group_value ) {
|
| 1547 |
-
foreach ( $group_value as $field_id => &$field_value ) {
|
| 1548 |
-
|
| 1549 |
-
if ( ! isset( $fields[$field_id] ) ) {
|
| 1550 |
-
$field_value = array();
|
| 1551 |
-
continue;
|
| 1552 |
-
}
|
| 1553 |
-
|
| 1554 |
-
$field = $fields[$field_id];
|
| 1555 |
-
$field->set_values( $field_value );
|
| 1556 |
-
$field->parse_save_values();
|
| 1557 |
-
|
| 1558 |
-
$field_value = $field->get_values();
|
| 1559 |
-
|
| 1560 |
-
// if the field is a repeatable field, store the whole array of them, if it's not repeatble,
|
| 1561 |
-
// just store the first (and only) one directly
|
| 1562 |
-
if ( ! $field->args['repeatable'] )
|
| 1563 |
-
$field_value = reset( $field_value );
|
| 1564 |
-
}
|
| 1565 |
-
}
|
| 1566 |
-
|
| 1567 |
-
}
|
| 1568 |
-
|
| 1569 |
-
public function add_field( drkfr_Field $field ) {
|
| 1570 |
-
$field->parent = $this;
|
| 1571 |
-
$this->fields[$field->id] = $field;
|
| 1572 |
-
}
|
| 1573 |
-
|
| 1574 |
-
public function &get_fields() {
|
| 1575 |
-
return $this->fields;
|
| 1576 |
-
}
|
| 1577 |
-
|
| 1578 |
-
public function set_values( array $values ) {
|
| 1579 |
-
|
| 1580 |
-
$fields = &$this->get_fields();
|
| 1581 |
-
$this->values = $values;
|
| 1582 |
-
|
| 1583 |
-
// Reset all field values.
|
| 1584 |
-
foreach ( $fields as $field ) {
|
| 1585 |
-
$field->set_values( array() );
|
| 1586 |
-
}
|
| 1587 |
-
|
| 1588 |
-
foreach ( $values as $value ) {
|
| 1589 |
-
foreach ( $value as $field_id => $field_value ) {
|
| 1590 |
-
$fields[$field_id]->set_values( (array) $field_value );
|
| 1591 |
-
}
|
| 1592 |
-
}
|
| 1593 |
-
|
| 1594 |
-
}
|
| 1595 |
-
|
| 1596 |
-
}
|
| 1597 |
-
|
| 1598 |
-
|
| 1599 |
-
/**
|
| 1600 |
-
* Google map field class for drkfr
|
| 1601 |
-
*
|
| 1602 |
-
* It enables the google places API and doesn't store the place
|
| 1603 |
-
* name. It only stores latitude and longitude of the selected area.
|
| 1604 |
-
*
|
| 1605 |
-
* Note
|
| 1606 |
-
*/
|
| 1607 |
-
class drkfr_Gmap_Field extends drkfr_Field {
|
| 1608 |
-
|
| 1609 |
-
/**
|
| 1610 |
-
* Return the default args for the Map field.
|
| 1611 |
-
*
|
| 1612 |
-
* @return array $args
|
| 1613 |
-
*/
|
| 1614 |
-
public function get_default_args() {
|
| 1615 |
-
return array_merge(
|
| 1616 |
-
parent::get_default_args(),
|
| 1617 |
-
array(
|
| 1618 |
-
'field_width' => '100%',
|
| 1619 |
-
'field_height' => '250px',
|
| 1620 |
-
'default_lat' => '51.5073509',
|
| 1621 |
-
'default_long' => '-0.12775829999998223',
|
| 1622 |
-
'default_zoom' => '8',
|
| 1623 |
-
'string-marker-title' => __( 'Drag to set the exact location', 'drkfr' ),
|
| 1624 |
-
)
|
| 1625 |
-
);
|
| 1626 |
-
}
|
| 1627 |
-
|
| 1628 |
-
public function enqueue_scripts() {
|
| 1629 |
-
|
| 1630 |
-
parent::enqueue_scripts();
|
| 1631 |
-
|
| 1632 |
-
wp_enqueue_script( 'drkfr-google-maps', '//maps.google.com/maps/api/js?sensor=true&libraries=places' );
|
| 1633 |
-
wp_enqueue_script( 'drkfr-google-maps-script', trailingslashit( drkfr_URL ) . 'js/field-gmap.js', array( 'jquery', 'drkfr-google-maps' ) );
|
| 1634 |
-
|
| 1635 |
-
wp_localize_script( 'drkfr-google-maps-script', 'drkfrGmaps', array(
|
| 1636 |
-
'defaults' => array(
|
| 1637 |
-
'latitude' => $this->args['default_lat'],
|
| 1638 |
-
'longitude' => $this->args['default_long'],
|
| 1639 |
-
'zoom' => $this->args['default_zoom'],
|
| 1640 |
-
),
|
| 1641 |
-
'strings' => array(
|
| 1642 |
-
'markerTitle' => $this->args['string-marker-title']
|
| 1643 |
-
)
|
| 1644 |
-
) );
|
| 1645 |
-
|
| 1646 |
-
}
|
| 1647 |
-
|
| 1648 |
-
public function html() {
|
| 1649 |
-
|
| 1650 |
-
// Ensure all args used are set
|
| 1651 |
-
$value = wp_parse_args(
|
| 1652 |
-
$this->get_value(),
|
| 1653 |
-
array( 'lat' => null, 'long' => null, 'elevation' => null )
|
| 1654 |
-
);
|
| 1655 |
-
|
| 1656 |
-
$style = array(
|
| 1657 |
-
sprintf( 'width: %s;', $this->args['field_width'] ),
|
| 1658 |
-
sprintf( 'height: %s;', $this->args['field_height'] ),
|
| 1659 |
-
'border: 1px solid #eee;',
|
| 1660 |
-
'margin-top: 8px;'
|
| 1661 |
-
);
|
| 1662 |
-
|
| 1663 |
-
?>
|
| 1664 |
-
|
| 1665 |
-
<input type="text" <?php $this->class_attr( 'map-search' ); ?> <?php $this->id_attr(); ?> />
|
| 1666 |
-
|
| 1667 |
-
<div class="map" style="<?php echo esc_attr( implode( ' ', $style ) ); ?>"></div>
|
| 1668 |
-
|
| 1669 |
-
<input type="hidden" class="latitude" <?php $this->name_attr( '[lat]' ); ?> value="<?php echo esc_attr( $value['lat'] ); ?>" />
|
| 1670 |
-
<input type="hidden" class="longitude" <?php $this->name_attr( '[long]' ); ?> value="<?php echo esc_attr( $value['long'] ); ?>" />
|
| 1671 |
-
<input type="hidden" class="elevation" <?php $this->name_attr( '[elevation]' ); ?> value="<?php echo esc_attr( $value['elevation'] ); ?>" />
|
| 1672 |
-
|
| 1673 |
-
<?php
|
| 1674 |
-
}
|
| 1675 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/dist/drkfr.css
DELETED
|
@@ -1,63 +0,0 @@
|
|
| 1 |
-
|
| 2 |
-
/**
|
| 3 |
-
* drkfr Styles
|
| 4 |
-
*
|
| 5 |
-
* This file is used for development only and is loaded when drkfr_DEV is defined as true.
|
| 6 |
-
* drkfr.min.css is generated by the Grunt build process.
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
@import '../src/layout.css';
|
| 10 |
-
@import '../src/generic.css';
|
| 11 |
-
|
| 12 |
-
/** Features **/
|
| 13 |
-
@import '../src/repeatable.css';
|
| 14 |
-
@import '../src/sortable.css';
|
| 15 |
-
|
| 16 |
-
/** Fields **/
|
| 17 |
-
@import '../src/group.css';
|
| 18 |
-
@import '../src/file.css';
|
| 19 |
-
@import '../src/misc-fields.css';
|
| 20 |
-
|
| 21 |
-
.drkfr_metabox .field-item {
|
| 22 |
-
background:white !important;
|
| 23 |
-
border:none !important;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
.drkfr_metabox .drkfr-handle {
|
| 27 |
-
background:url('../../images/dragndrop.png') no-repeat whitesmoke !important;
|
| 28 |
-
border:lightgray 0px solid !important;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
.drkfr_metabox .drkfr-delete-field {
|
| 32 |
-
font-size:14px !important;
|
| 33 |
-
padding-top: 2px !important;
|
| 34 |
-
padding-bottom: 4px !important;
|
| 35 |
-
padding-left: 28px !important;
|
| 36 |
-
padding-right: 12px !important;
|
| 37 |
-
height:32px !important;
|
| 38 |
-
top:7px !important;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
.drkfr_metabox .drkfr-handle {
|
| 42 |
-
height:47px !important;
|
| 43 |
-
margin-bottom:10px !important;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
.drkfr_metabox .field-title{
|
| 47 |
-
margin-top:0px;
|
| 48 |
-
font-size:18px;
|
| 49 |
-
font-weight:400;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
.drkfr_Title h2 {
|
| 53 |
-
margin: 0px !important;
|
| 54 |
-
padding: 0px !important;
|
| 55 |
-
text-align: center;
|
| 56 |
-
font-size: 22px !important;
|
| 57 |
-
color: grey;
|
| 58 |
-
font-weight: 400 !important;
|
| 59 |
-
border-bottom: 5px solid whitesmoke;
|
| 60 |
-
padding-bottom: 9px !important;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.drkfr_metabox .field {border:none;}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/dist/drkfr.min.css
DELETED
|
@@ -1,63 +0,0 @@
|
|
| 1 |
-
|
| 2 |
-
/**
|
| 3 |
-
* drkfr Styles
|
| 4 |
-
*
|
| 5 |
-
* This file is used for development only and is loaded when drkfr_DEV is defined as true.
|
| 6 |
-
* drkfr.min.css is generated by the Grunt build process.
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
@import '../src/layout.css';
|
| 10 |
-
@import '../src/generic.css';
|
| 11 |
-
|
| 12 |
-
/** Features **/
|
| 13 |
-
@import '../src/repeatable.css';
|
| 14 |
-
@import '../src/sortable.css';
|
| 15 |
-
|
| 16 |
-
/** Fields **/
|
| 17 |
-
@import '../src/group.css';
|
| 18 |
-
@import '../src/file.css';
|
| 19 |
-
@import '../src/misc-fields.css';
|
| 20 |
-
|
| 21 |
-
.drkfr_metabox .field-item {
|
| 22 |
-
background:white !important;
|
| 23 |
-
border:none !important;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
.drkfr_metabox .drkfr-handle {
|
| 27 |
-
background:url('../../images/dragndrop.png') no-repeat whitesmoke !important;
|
| 28 |
-
border:lightgray 0px solid !important;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
.drkfr_metabox .drkfr-delete-field {
|
| 32 |
-
font-size:14px !important;
|
| 33 |
-
padding-top: 2px !important;
|
| 34 |
-
padding-bottom: 4px !important;
|
| 35 |
-
padding-left: 28px !important;
|
| 36 |
-
padding-right: 12px !important;
|
| 37 |
-
height:32px !important;
|
| 38 |
-
top:7px !important;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
.drkfr_metabox .drkfr-handle {
|
| 42 |
-
height:47px !important;
|
| 43 |
-
margin-bottom:10px !important;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
.drkfr_metabox .field-title{
|
| 47 |
-
margin-top:0px;
|
| 48 |
-
font-size:18px;
|
| 49 |
-
font-weight:400;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
.drkfr_Title h2 {
|
| 53 |
-
margin: 0px !important;
|
| 54 |
-
padding: 0px !important;
|
| 55 |
-
text-align: center;
|
| 56 |
-
font-size: 22px !important;
|
| 57 |
-
color: grey;
|
| 58 |
-
font-weight: 400 !important;
|
| 59 |
-
border-bottom: 5px solid whitesmoke;
|
| 60 |
-
padding-bottom: 9px !important;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.drkfr_metabox .field {border:none;}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/legacy.css
DELETED
|
@@ -1,319 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* drkfr Styling
|
| 3 |
-
*/
|
| 4 |
-
.drkfr_metabox tr td, table.drkfr_metabox tr th { vertical-align: top; padding: 5px; }
|
| 5 |
-
.drkfr_metabox th { text-align: right; font-weight:bold;}
|
| 6 |
-
.drkfr_metabox th label { margin-top:5px; display:block;}
|
| 7 |
-
div.drkfr_metabox_description { color: #AAA; font-style: italic; margin: 0 0 8px !important;}
|
| 8 |
-
span.drkfr_metabox_description { color: #AAA; font-style: italic;}
|
| 9 |
-
.drkfr_metabox input,
|
| 10 |
-
.drkfr_metabox textarea { font-size:12px; padding: 5px; margin: 0; }
|
| 11 |
-
.drkfr_metabox input[type=text], table.drkfr_metabox textarea, table.drkfr_metabox select { width: 100%; }
|
| 12 |
-
.drkfr_metabox textarea.drkfr_textarea_code,
|
| 13 |
-
.drkfr_metabox textarea.drkfr_textarea { vertical-align: top; margin: 0; }
|
| 14 |
-
.drkfr_metabox textarea.drkfr_textarea_code { font-family: Consolas,Monaco,monospace; line-height: 16px; }
|
| 15 |
-
.drkfr_metabox input.drkfr_text_small { width: 100px; }
|
| 16 |
-
.drkfr_metabox input.drkfr_timepicker { width: 100px; margin-right: 0;}
|
| 17 |
-
.drkfr_metabox input.drkfr_text_money { width: 90px; margin-right: 15px;}
|
| 18 |
-
.drkfr_metabox input.drkfr_text_medium { width: 230px; margin-right: 15px;}
|
| 19 |
-
.drkfr_metabox input.drkfr_upload_file { width: 65%; }
|
| 20 |
-
.drkfr_metabox li { font-size:12px; margin: 1px 0 5px 0; line-height: 16px; }
|
| 21 |
-
.drkfr_metabox ul { padding-top:5px; margin: 0; }
|
| 22 |
-
.drkfr_metabox select { font-size:12px; margin-top: 3px;}
|
| 23 |
-
.drkfr_metabox input:focus, table.drkfr_metabox textarea:focus { background: #fffff8;}
|
| 24 |
-
.drkfr_metabox_title { margin: 0 0 5px 0; padding: 5px 0 0 0; font: italic 24px/35px Georgia,"Times New Roman","Bitstream Charter",Times,serif;}
|
| 25 |
-
.drkfr_radio_inline { padding: 4px 0 0 0;}
|
| 26 |
-
.drkfr_radio_inline_option {display: inline; padding-right: 18px;}
|
| 27 |
-
.drkfr_metabox input[type="radio"] { margin: 0 5px 0 0; padding: 0;}
|
| 28 |
-
.drkfr_metabox input[type="checkbox"] { margin: 0 5px 0 0; padding: 0;}
|
| 29 |
-
.drkfr_metabox .mceIframeContainer {background:#FFF;}
|
| 30 |
-
.drkfr_metabox .meta_mce {width:97%;}
|
| 31 |
-
.drkfr_metabox .meta_mce textarea {width:100%;}
|
| 32 |
-
.drkfr_metabox .drkfr_upload_status { margin: 10px 0 0 0;}
|
| 33 |
-
.drkfr_metabox .drkfr_upload_status .img_status { position: relative; }
|
| 34 |
-
.drkfr_metabox .drkfr_upload_status .img_status img { border:1px solid #DFDFDF; background: #FAFAFA; max-width:350px; padding: 5px; -moz-border-radius: 2px; border-radius: 2px;}
|
| 35 |
-
.drkfr_remove_file_button { text-indent: -9999px; background: url(../images/ico-delete.png); width: 16px; height: 16px; position: absolute; top: -5px; left: -5px;}
|
| 36 |
-
/* Sidebar placement adjustments */
|
| 37 |
-
.inner-sidebar table.drkfr_metabox input[type=text], table.drkfr_metabox textarea { width: 100%; }
|
| 38 |
-
.inner-sidebar table.drkfr_metabox .drkfr_upload_status .img_status img { width: 90%; }
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* Timepicker
|
| 42 |
-
*/
|
| 43 |
-
div.time-picker { position: absolute; height: 191px; width:4em; /* needed for IE */ overflow: auto; background: #fff; border: 1px solid #aaa; z-index: 99; margin: 0; }
|
| 44 |
-
div.time-picker-12hours { width:6em; /* needed for IE */ }
|
| 45 |
-
div.time-picker ul { list-style-type: none; margin: 0; padding: 0; }
|
| 46 |
-
div.time-picker li { cursor: pointer; height: 10px; font: 12px/1 Helvetica, Arial, sans-serif; padding: 4px 3px; }
|
| 47 |
-
div.time-picker li.selected { background: #0063CE; color: #fff; }
|
| 48 |
-
|
| 49 |
-
.field { margin-bottom: 8px; }
|
| 50 |
-
.field-title { margin-bottom: 8px; margin-top: 0; font-weight: bold; }
|
| 51 |
-
.field-title label { vertical-align: baseline; }
|
| 52 |
-
#poststuff .field-title h2 { margin: 0 !important; }
|
| 53 |
-
|
| 54 |
-
.field.repeatable .field-item {
|
| 55 |
-
padding-right: 25px;
|
| 56 |
-
margin-bottom: 8px;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.drkfr-delete-field {
|
| 60 |
-
position: absolute;
|
| 61 |
-
top: 6px;
|
| 62 |
-
right: 0;
|
| 63 |
-
width: 16px;
|
| 64 |
-
height: 16px;
|
| 65 |
-
padding-left: 0;
|
| 66 |
-
padding-right: 0;
|
| 67 |
-
text-indent: 26px;
|
| 68 |
-
overflow: hidden;
|
| 69 |
-
white-space: nowrap;
|
| 70 |
-
padding: 0;
|
| 71 |
-
font-size: 20px;
|
| 72 |
-
line-height: 20px;
|
| 73 |
-
text-align: center;
|
| 74 |
-
text-decoration: none;
|
| 75 |
-
color: #464646;
|
| 76 |
-
cursor: pointer;
|
| 77 |
-
border-width: 0;
|
| 78 |
-
border-radius: 3px;
|
| 79 |
-
border: 1px solid #fff;
|
| 80 |
-
box-shadow: 0 0 0 1px rgba(0,0,0,0.3);
|
| 81 |
-
background: #f3f3f3;
|
| 82 |
-
background-image: -webkit-gradient(linear,left top,left bottom,from(#fefefe),to(#f4f4f4));
|
| 83 |
-
background-image: -webkit-linear-gradient(top,#fefefe,#f4f4f4);
|
| 84 |
-
background-image: -moz-linear-gradient(top,#fefefe,#f4f4f4);
|
| 85 |
-
background-image: -o-linear-gradient(top,#fefefe,#f4f4f4);
|
| 86 |
-
background-image: linear-gradient(to bottom,#fefefe,#f4f4f4);
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
.drkfr-delete-field:hover,
|
| 90 |
-
.drkfr-delete-field:focus,
|
| 91 |
-
.drkfr-delete-field:active {
|
| 92 |
-
box-shadow: 0 0 0 1px rgba(0,0,0,0.6);
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
.drkfr-delete-field .drkfr-delete-field-icon {
|
| 96 |
-
content: ' ';
|
| 97 |
-
display: block;
|
| 98 |
-
position: absolute;
|
| 99 |
-
height: 8px;
|
| 100 |
-
width: 8px;
|
| 101 |
-
top: 50%;
|
| 102 |
-
left: 50%;
|
| 103 |
-
margin-top: -4px;
|
| 104 |
-
margin-left: -4px;
|
| 105 |
-
background-image: url( '../images/drkfr-icon-remove.png');
|
| 106 |
-
background-repeat: no-repeat;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
@media only screen and (-webkit-min-device-pixel-ratio : 1.5), only screen and (min-device-pixel-ratio : 1.5) {
|
| 110 |
-
|
| 111 |
-
.drkfr-delete-field .drkfr-delete-field-icon {
|
| 112 |
-
background-image: url( '../images/drkfr-icon-remove@2x.png');
|
| 113 |
-
background-size: 8px 8px;
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
#poststuff .field-title h2 { margin: 0 !important; }
|
| 119 |
-
|
| 120 |
-
.field.repeatable .field-item { padding-right: 25px; margin-bottom: 8px; }
|
| 121 |
-
.ui-icon.delete-field { position: absolute; top: 6px; right: 0; cursor: pointer; opacity: 0.75; }
|
| 122 |
-
.ui-icon.delete-field:hover { opacity: 1; }
|
| 123 |
-
button.repeat-field { display: block !important; clear: both; }
|
| 124 |
-
|
| 125 |
-
.drkfr_Text_Small_Field.repeatable .field-item,
|
| 126 |
-
.drkfr_Date_Field.repeatable .field-item,
|
| 127 |
-
.drkfr_Time_Field.repeatable .field-item,
|
| 128 |
-
.drkfr_Date_Timestamp_Field.repeatable .field-item,
|
| 129 |
-
.drkfr_Date_Timestamp_Field.repeatable .field-item,
|
| 130 |
-
.drkfr_Datetime_Timestamp_Field.repeatable .field-item {
|
| 131 |
-
float: left; clear: both;
|
| 132 |
-
}
|
| 133 |
-
.drkfr_Datetime_Timestamp_Field input + input { margin-left: 4px; }
|
| 134 |
-
|
| 135 |
-
#poststuff .drkfr_Group_Field h2 { padding: 0; margin: 8px 5px; }
|
| 136 |
-
.drkfr_Group_Field.repeatable > .field-item { padding: 0 9px; margin-bottom: 16px ; border: 1px solid #DDD; background: #F9F9F9; border-radius: 3px; }
|
| 137 |
-
|
| 138 |
-
.drkfr_Group_Field.repeatable > .field-item.ui-sortable-placeholder { margin-bottom: 16px !important; }
|
| 139 |
-
|
| 140 |
-
.drkfr_Group_Field > .field-title {
|
| 141 |
-
margin-top: 20px;
|
| 142 |
-
font-size: 1.5em;
|
| 143 |
-
margin-top: 10px;
|
| 144 |
-
margin-bottom: 10px;
|
| 145 |
-
padding: 0 0 3px;
|
| 146 |
-
clear: left;
|
| 147 |
-
color: #464646;
|
| 148 |
-
font-family: "HelveticaNeue-Light","Helvetica Neue Light","Helvetica Neue",sans-serif;
|
| 149 |
-
font-weight: lighter;
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
.drkfr_Group_Field.repeatable > .field-item {
|
| 153 |
-
padding: 0 9px;
|
| 154 |
-
margin-bottom: 16px;
|
| 155 |
-
border: 1px solid #DDD;
|
| 156 |
-
border-radius: 3px;
|
| 157 |
-
}
|
| 158 |
-
|
| 159 |
-
.drkfr_Group_Field .group > .drkfr-delete-field {
|
| 160 |
-
top: 0;
|
| 161 |
-
right: -3px;
|
| 162 |
-
width: auto;
|
| 163 |
-
height: auto;
|
| 164 |
-
padding: 2px 5px 2px 20px;
|
| 165 |
-
text-indent: 0;
|
| 166 |
-
font-size: 12px;
|
| 167 |
-
line-height: 14px;
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
.drkfr_Group_Field .group > .drkfr-delete-field .drkfr-delete-field-icon {
|
| 171 |
-
left: 10px;
|
| 172 |
-
text-indent: 100%;
|
| 173 |
-
overflow: hidden;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
.drkfr_File_Field .field-item,
|
| 178 |
-
.drkfr_Image_Field .field-item { float: left; margin: 0 8px 8px 0 !important; text-align: center; padding: 0 !important; z-index: 1; }
|
| 179 |
-
.drkfr-file-wrap { position: relative; overflow: hidden; width: 150px; height: 150px; line-height: 150px; }
|
| 180 |
-
.drkfr-file-wrap-placeholder { content: ' '; position: absolute; top: 0; left: 0; display: block; height: 142px; width: 142px; border: 4px dashed #DDD; z-index: -1; }
|
| 181 |
-
.drkfr-file-wrap-placeholder .dimensions { line-height: normal; position: absolute; bottom: 10px; right: 10px; font-size: 18px; font-weight: bold; opacity: 0.2;}
|
| 182 |
-
.drkfr-file-holder { position: relative; overflow: hidden; box-shadow: inset 0 0 15px rgba(0,0,0,0.1),inset 0 0 0 1px rgba(0,0,0,0.05); background: #eee; width: 100%; height: 100%; }
|
| 183 |
-
.drkfr-file-holder.type-file img { position: absolute; top: 43%; margin-top: -30px; left: 50%; margin-left: -23px; }
|
| 184 |
-
.drkfr-file-holder.type-img img { width: 100%; height: auto; margin-top: 0; vertical-align: top; }
|
| 185 |
-
.drkfr-file-holder.type-img::after { content: ''; display: block; position: absolute; top: 0; left: 0; right: 0; bottom: 0; box-shadow: inset 0 0 0 1px rgba(0,0,0,0.1); overflow: hidden; z-index: 1; }
|
| 186 |
-
.drkfr-file-name { position: absolute; left: 0; right: 0; bottom: 0; line-height: 1.4; overflow: hidden; max-height: 100%; word-wrap: break-word; text-align: center; font-weight: bold; background: rgba(255,255,255,0.8); box-shadow: inset 0 0 0 1px rgba(0,0,0,0.15); }
|
| 187 |
-
.drkfr-file-name strong { padding: 5px 10px; display: block;}
|
| 188 |
-
.drkfr_File_Field .drkfr-delete-field,
|
| 189 |
-
.drkfr_Image_Field .drkfr-delete-field { z-index: 10; top: 10px; right: 10px; }
|
| 190 |
-
.drkfr_File_Field .drkfr-remove-file,
|
| 191 |
-
.drkfr_Image_Field .drkfr-remove-file { position: absolute; z-index: 1; top: 5px; right: 5px; }
|
| 192 |
-
.drkfr_File_Field.repeatable .drkfr-remove-file,
|
| 193 |
-
.drkfr_Image_Field.repeatable .drkfr-remove-file { display: none !important; }
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
.drkfr_Color_Picker .field-item { float: left; clear: both; }
|
| 197 |
-
.drkfr_Color_Picker .iris-picker .iris-slider-offset { width: auto; height: auto; border: none; background: transparent; margin: 0; /*top: 4px !important; bottom: 5px !important;*/ border-radius: 0; }
|
| 198 |
-
.drkfr_Color_Picker .iris-picker .iris-strip .ui-slider-handle { margin-bottom: 0; }
|
| 199 |
-
.drkfr_Color_Picker .iris-picker .iris-strip .ui-slider-handle:focus { outline: none; }
|
| 200 |
-
|
| 201 |
-
.drkfr-loading:before { content: ' '; display: block; background: url( '../images/wpspin.gif' ) no-repeat; width: 16px; height: 16px; position: absolute; top: 50%; left: 50%; margin-top: -8px; margin-left: -8px; }
|
| 202 |
-
@media only screen and (-webkit-min-device-pixel-ratio : 1.5), only screen and (min-device-pixel-ratio : 1.5) {
|
| 203 |
-
.drkfr-loading:before { background-image: url( 'images/wpspin-2x.gif'); background-size: 16px 16px; }
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
.drkfr-sortable > .field-item {
|
| 207 |
-
padding-left: 16px;
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
.drkfr-sortable .drkfr-handle {
|
| 211 |
-
height: 100%;
|
| 212 |
-
width: 2px;
|
| 213 |
-
position: absolute;
|
| 214 |
-
top: 0;
|
| 215 |
-
left: 0;
|
| 216 |
-
background: transparent;
|
| 217 |
-
cursor: move;
|
| 218 |
-
border-left: 2px solid #DFDFDF;
|
| 219 |
-
border-right: 2px solid #DFDFDF;
|
| 220 |
-
}
|
| 221 |
-
|
| 222 |
-
.drkfr-sortable .drkfr-handle:after {
|
| 223 |
-
position: absolute;
|
| 224 |
-
content: ' ';
|
| 225 |
-
height: 100%;
|
| 226 |
-
width: 0;
|
| 227 |
-
position: absolute;
|
| 228 |
-
top: 0;
|
| 229 |
-
left: 100%;
|
| 230 |
-
margin-left: 4px;
|
| 231 |
-
background: transparent;
|
| 232 |
-
cursor: move;
|
| 233 |
-
border-left: 2px solid #DFDFDF;
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
.drkfr-sortable .ui-sortable-helper {
|
| 237 |
-
opacity: 0.75;
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
.drkfr-sortable .ui-sortable-helper:before {
|
| 242 |
-
content: ' ';
|
| 243 |
-
position: absolute;
|
| 244 |
-
width: 100%;
|
| 245 |
-
height: 100%;
|
| 246 |
-
top: -6px;
|
| 247 |
-
left: -6px;
|
| 248 |
-
background-color: #F8F8F8;
|
| 249 |
-
border: 1px solid #DEDEDE;
|
| 250 |
-
padding: 5px;
|
| 251 |
-
z-index: -1;
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
.drkfr-sortable .ui-sortable-placeholder {
|
| 255 |
-
border: 1px dashed #DDD !important;
|
| 256 |
-
background: transparent !important;
|
| 257 |
-
visibility: visible !important;
|
| 258 |
-
margin-bottom: 6px !important;
|
| 259 |
-
margin-right: 6px !important;
|
| 260 |
-
}
|
| 261 |
-
|
| 262 |
-
.drkfr_File_Field.drkfr-sortable .drkfr-handle,
|
| 263 |
-
.drkfr_Image_Field.drkfr-sortable .drkfr-handle {
|
| 264 |
-
background: transparent;
|
| 265 |
-
width: 100%;
|
| 266 |
-
z-index: 1;
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
.drkfr_File_Field.drkfr-sortable .drkfr-file-upload,
|
| 270 |
-
.drkfr_Image_Field.drkfr-sortable .drkfr-file-upload {
|
| 271 |
-
position: relative;
|
| 272 |
-
z-index: 5;
|
| 273 |
-
}
|
| 274 |
-
|
| 275 |
-
.drkfr_File_Field.drkfr-sortable .ui-sortable-helper:before,
|
| 276 |
-
.drkfr_Image_Field.drkfr-sortable .ui-sortable-helper:before {
|
| 277 |
-
top: 0;
|
| 278 |
-
left: 0;
|
| 279 |
-
padding: 0;
|
| 280 |
-
border: none;
|
| 281 |
-
background: #F9F9F9;
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
.drkfr_Group_Field.drkfr-sortable > .field-item {
|
| 285 |
-
position: relative;
|
| 286 |
-
padding-top: 30px;
|
| 287 |
-
}
|
| 288 |
-
|
| 289 |
-
.drkfr_Group_Field.drkfr-sortable > .field-item > .drkfr-handle {
|
| 290 |
-
top: -1px;
|
| 291 |
-
left: -1px;
|
| 292 |
-
right: -1px;
|
| 293 |
-
height: 30px;
|
| 294 |
-
width: auto;
|
| 295 |
-
border: 1px solid #dfdfdf;
|
| 296 |
-
border-radius: 3px 3px 0 0;
|
| 297 |
-
background: #f1f1f1;
|
| 298 |
-
background-image: -webkit-gradient(linear,left bottom,left top,from(#ececec),to(#f9f9f9));
|
| 299 |
-
background-image: -webkit-linear-gradient(bottom,#ececec,#f9f9f9);
|
| 300 |
-
background-image: -moz-linear-gradient(bottom,#ececec,#f9f9f9);
|
| 301 |
-
background-image: -o-linear-gradient(bottom,#ececec,#f9f9f9);
|
| 302 |
-
background-image: linear-gradient(to top,#ececec,#f9f9f9);
|
| 303 |
-
}
|
| 304 |
-
|
| 305 |
-
.drkfr_Group_Field.drkfr-sortable .drkfr-handle:after {
|
| 306 |
-
display: none;
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
.drkfr_Group_Field.drkfr-sortable .group > .drkfr-delete-field {
|
| 310 |
-
top: -33px;
|
| 311 |
-
right: -5px;
|
| 312 |
-
width: auto;
|
| 313 |
-
height: auto;
|
| 314 |
-
padding: 2px 5px 2px 20px;
|
| 315 |
-
text-indent: 0;
|
| 316 |
-
font-size: 12px;
|
| 317 |
-
line-height: 14px;
|
| 318 |
-
z-index: 1;
|
| 319 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/file.css
DELETED
|
@@ -1,166 +0,0 @@
|
|
| 1 |
-
|
| 2 |
-
.drkfr_File_Field .field-item,
|
| 3 |
-
.drkfr_Image_Field .field-item {
|
| 4 |
-
float: left;
|
| 5 |
-
margin: 0 16px 16px 0 !important;
|
| 6 |
-
text-align: center;
|
| 7 |
-
padding: 0 !important;
|
| 8 |
-
z-index: 1;
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
.drkfr-file-wrap {
|
| 12 |
-
position: relative;
|
| 13 |
-
overflow: hidden;
|
| 14 |
-
width: 150px;
|
| 15 |
-
height: 150px;
|
| 16 |
-
line-height: 150px;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
.drkfr-file-wrap-placeholder {
|
| 20 |
-
content: ' ';
|
| 21 |
-
position: absolute;
|
| 22 |
-
top: 0;
|
| 23 |
-
left: 0;
|
| 24 |
-
display: block;
|
| 25 |
-
height: 142px;
|
| 26 |
-
width: 142px;
|
| 27 |
-
border: 4px dashed #DDD;
|
| 28 |
-
z-index: -1;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
.drkfr-file-wrap-placeholder .dimensions {
|
| 32 |
-
line-height: normal;
|
| 33 |
-
position: absolute;
|
| 34 |
-
bottom: 10px;
|
| 35 |
-
right: 10px;
|
| 36 |
-
font-size: 18px;
|
| 37 |
-
font-weight: bold;
|
| 38 |
-
opacity: 0.2;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
.drkfr-file-holder {
|
| 42 |
-
position: relative;
|
| 43 |
-
overflow: hidden;
|
| 44 |
-
box-shadow: inset 0 0 15px rgba(0,0,0,0.1), inset 0 0 0 1px rgba(0,0,0,0.05);
|
| 45 |
-
background: #eee;
|
| 46 |
-
width: 100%;
|
| 47 |
-
height: 100%;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
.drkfr-file-holder.type-file img {
|
| 51 |
-
position: absolute;
|
| 52 |
-
top: 43%;
|
| 53 |
-
margin-top: -30px;
|
| 54 |
-
left: 50%;
|
| 55 |
-
margin-left: -23px;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
.drkfr-file-holder.type-img img {
|
| 59 |
-
width: 100%;
|
| 60 |
-
height: auto;
|
| 61 |
-
margin-top: 0;
|
| 62 |
-
vertical-align: top;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.drkfr-file-holder.type-img::after {
|
| 66 |
-
content: '';
|
| 67 |
-
display: block;
|
| 68 |
-
position: absolute;
|
| 69 |
-
top: 0;
|
| 70 |
-
left: 0;
|
| 71 |
-
right: 0;
|
| 72 |
-
bottom: 0;
|
| 73 |
-
box-shadow: inset 0 0 0 1px rgba(0,0,0,0.1);
|
| 74 |
-
overflow: hidden;
|
| 75 |
-
z-index: 1;
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
.drkfr-file-name {
|
| 79 |
-
position: absolute;
|
| 80 |
-
left: 0;
|
| 81 |
-
right: 0;
|
| 82 |
-
bottom: 0;
|
| 83 |
-
line-height: 1.4;
|
| 84 |
-
overflow: hidden;
|
| 85 |
-
max-height: 100%;
|
| 86 |
-
word-wrap: break-word;
|
| 87 |
-
text-align: center;
|
| 88 |
-
font-weight: bold;
|
| 89 |
-
background: rgba(255,255,255,0.8);
|
| 90 |
-
box-shadow: inset 0 0 0 1px rgba(0,0,0,0.15);
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
.drkfr-file-name strong {
|
| 94 |
-
padding: 5px 10px;
|
| 95 |
-
display: block;
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
.drkfr_File_Field .drkfr-delete-field,
|
| 99 |
-
.drkfr_Image_Field .drkfr-delete-field {
|
| 100 |
-
z-index: 10;
|
| 101 |
-
top: 10px;
|
| 102 |
-
right: 10px;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
.drkfr_File_Field .drkfr-remove-file,
|
| 106 |
-
.drkfr_Image_Field .drkfr-remove-file {
|
| 107 |
-
position: absolute;
|
| 108 |
-
z-index: 1;
|
| 109 |
-
top: 5px;
|
| 110 |
-
right: 5px;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
.drkfr_File_Field.repeatable .drkfr-remove-file,
|
| 114 |
-
.drkfr_Image_Field.repeatable .drkfr-remove-file {
|
| 115 |
-
display: none !important;
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
.drkfr-file-wrap .drkfr-file-upload {
|
| 119 |
-
vertical-align: middle;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.drkfr-loading::before {
|
| 123 |
-
content: ' ';
|
| 124 |
-
display: block;
|
| 125 |
-
background: url( '../../images/wpspin.gif' ) no-repeat;
|
| 126 |
-
width: 16px;
|
| 127 |
-
height: 16px;
|
| 128 |
-
position: absolute;
|
| 129 |
-
top: 50%;
|
| 130 |
-
left: 50%;
|
| 131 |
-
margin-top: -8px;
|
| 132 |
-
margin-left: -8px;
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
@media only screen and (-webkit-min-device-pixel-ratio : 1.5), only screen and (min-device-pixel-ratio : 1.5) {
|
| 136 |
-
|
| 137 |
-
.drkfr-loading::before {
|
| 138 |
-
background-image: url( '../../images/wpspin-2x.gif');
|
| 139 |
-
background-size: 16px 16px;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
.drkfr_File_Field.drkfr-sortable .drkfr-handle,
|
| 145 |
-
.drkfr_Image_Field.drkfr-sortable .drkfr-handle {
|
| 146 |
-
border: none;
|
| 147 |
-
background: transparent;
|
| 148 |
-
height: 100%;
|
| 149 |
-
width: 100%;
|
| 150 |
-
z-index: 1;
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
.drkfr_File_Field.drkfr-sortable .drkfr-file-upload,
|
| 154 |
-
.drkfr_Image_Field.drkfr-sortable .drkfr-file-upload {
|
| 155 |
-
position: relative;
|
| 156 |
-
z-index: 5;
|
| 157 |
-
}
|
| 158 |
-
|
| 159 |
-
.drkfr_File_Field.drkfr-sortable .ui-sortable-helper:before,
|
| 160 |
-
.drkfr_Image_Field.drkfr-sortable .ui-sortable-helper:before {
|
| 161 |
-
top: 0;
|
| 162 |
-
left: 0;
|
| 163 |
-
padding: 0;
|
| 164 |
-
border: none;
|
| 165 |
-
background: #F9F9F9;
|
| 166 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/generic.css
DELETED
|
@@ -1,55 +0,0 @@
|
|
| 1 |
-
.drkfr_metabox .field-item {
|
| 2 |
-
position: relative;
|
| 3 |
-
}
|
| 4 |
-
|
| 5 |
-
.drkfr_metabox_description {
|
| 6 |
-
color: #AAA;
|
| 7 |
-
font-style: italic;
|
| 8 |
-
margin: 0 0 16px !important;
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
.drkfr_metabox input[type=text],
|
| 12 |
-
.drkfr_metabox textarea,
|
| 13 |
-
.drkfr_metabox select {
|
| 14 |
-
width: 100%;
|
| 15 |
-
margin: 0;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
.drkfr_metabox input.drkfr_text_small {
|
| 19 |
-
width: 100px;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
.drkfr_metabox input.drkfr_text_medium {
|
| 23 |
-
width: 230px;
|
| 24 |
-
margin-right: 15px;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
.drkfr_metabox input[type="radio"] {
|
| 28 |
-
margin: 0 5px 0 0;
|
| 29 |
-
padding: 0;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
.drkfr_metabox input[type="checkbox"] {
|
| 33 |
-
margin: 0 5px 0 0;
|
| 34 |
-
padding: 0;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
.drkfr_metabox .field-title {
|
| 38 |
-
margin-top: -4px;
|
| 39 |
-
margin-bottom: 16px;
|
| 40 |
-
margin-top: 0;
|
| 41 |
-
font-weight: bold;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
.drkfr_metabox .field-title label {
|
| 45 |
-
vertical-align: baseline;
|
| 46 |
-
}
|
| 47 |
-
.drkfr_metabox .select2-search-choice-close {
|
| 48 |
-
-webkit-transition: none;
|
| 49 |
-
transition: none;
|
| 50 |
-
top: 3px;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
.drkfr_metabox [disabled] {
|
| 54 |
-
background: #F7F7F7;
|
| 55 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/group.css
DELETED
|
@@ -1,82 +0,0 @@
|
|
| 1 |
-
/** Group **/
|
| 2 |
-
|
| 3 |
-
.drkfr_metabox .drkfr_Group_Field > .field-title {
|
| 4 |
-
font-size: 20px;
|
| 5 |
-
clear: left;
|
| 6 |
-
color: #222;
|
| 7 |
-
font-family: 'Open Sans', sans-serif;
|
| 8 |
-
font-weight: normal;
|
| 9 |
-
margin: 8px 0;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable > .field-title {
|
| 13 |
-
margin-bottom: 16px;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable > .field-item {
|
| 17 |
-
padding: 30px 10px 0;
|
| 18 |
-
margin-bottom: 16px;
|
| 19 |
-
border: 1px solid #DDD;
|
| 20 |
-
background: #FAFAFA;
|
| 21 |
-
position: relative;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable > .field-item:before {
|
| 25 |
-
content: ' ';
|
| 26 |
-
display: block;
|
| 27 |
-
position: absolute;
|
| 28 |
-
top: 0;
|
| 29 |
-
left: 0;
|
| 30 |
-
right: 0;
|
| 31 |
-
height: 33px;
|
| 32 |
-
border-bottom: 1px solid #DDDDDD;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable > .field-item > .drkfr-delete-field {
|
| 36 |
-
top: 5px;
|
| 37 |
-
right: 5px;
|
| 38 |
-
width: auto;
|
| 39 |
-
text-indent: 0;
|
| 40 |
-
padding-left: 24px;
|
| 41 |
-
padding-right: 8px;
|
| 42 |
-
height: 22px;
|
| 43 |
-
line-height: 20px;
|
| 44 |
-
font-size: 11px;
|
| 45 |
-
z-index: 1;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable > .field-item > .drkfr-delete-field .drkfr-delete-field-icon {
|
| 49 |
-
left: 12px;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
.drkfr_Group_Field.drkfr-sortable > .field-item {
|
| 54 |
-
position: relative;
|
| 55 |
-
padding-top: 30px;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
.drkfr_Group_Field.drkfr-sortable > .field-item > .drkfr-handle {
|
| 59 |
-
top: -1px;
|
| 60 |
-
left: -1px;
|
| 61 |
-
right: -1px;
|
| 62 |
-
height: 34px;
|
| 63 |
-
width: auto;
|
| 64 |
-
border: none;
|
| 65 |
-
border-bottom: 1px solid #DDDDDD;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
.drkfr_Group_Field.drkfr-sortable > .field-item.ui-sortable-helper > .drkfr-handle {
|
| 69 |
-
padding: 0 5px;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
.drkfr_metabox .drkfr_Group_Field.repeatable.drkfr-sortable > .field-item:before {
|
| 73 |
-
display: none !important;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
.drkfr_Group_Field.drkfr-sortable > .ui-sortable-placeholder {
|
| 77 |
-
margin-bottom: 16px !important;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
.drkfr_Group_Field .drkfr_metabox > .drkfr-row:last-child {
|
| 81 |
-
margin-bottom: 0;
|
| 82 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/layout.css
DELETED
|
@@ -1,57 +0,0 @@
|
|
| 1 |
-
/** drkfr Layout **/
|
| 2 |
-
|
| 3 |
-
.drkfr_metabox .field {
|
| 4 |
-
overflow: hidden;
|
| 5 |
-
padding: 16px 0;
|
| 6 |
-
border-bottom: 1px solid #DFDFDF;
|
| 7 |
-
}
|
| 8 |
-
|
| 9 |
-
.drkfr-row:last-child > [class*="drkfr-cell-"] > .field {
|
| 10 |
-
border-bottom: 0;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
/* Neaten up the margins when metaboxes are within the standard postbox. */
|
| 14 |
-
.postbox > .inside > .drkfr_metabox {
|
| 15 |
-
margin: -10px 0;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
.drkfr_metabox .drkfr-row {
|
| 19 |
-
overflow: hidden;
|
| 20 |
-
margin: 0 -5px;
|
| 21 |
-
zoom: 1;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.drkfr_metabox .drkfr-row:before,
|
| 25 |
-
.drkfr_metabox .drkfr-row:after {
|
| 26 |
-
content: "";
|
| 27 |
-
display: table;
|
| 28 |
-
}
|
| 29 |
-
.drkfr_metabox .drkfr-row:after {
|
| 30 |
-
clear: both;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
.drkfr_metabox [class*="drkfr-cell-"] {
|
| 34 |
-
float: left;
|
| 35 |
-
padding: 0 5px;
|
| 36 |
-
-moz-box-sizing: border-box;
|
| 37 |
-
box-sizing: border-box;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
.drkfr_metabox .drkfr-cell-1 { width: 8.333333333%; }
|
| 41 |
-
.drkfr_metabox .drkfr-cell-2 { width: 16.666666667%; }
|
| 42 |
-
.drkfr_metabox .drkfr-cell-3 { width: 25%; }
|
| 43 |
-
.drkfr_metabox .drkfr-cell-4 { width: 33.333333333%; }
|
| 44 |
-
.drkfr_metabox .drkfr-cell-5 { width: 41.666666667%; }
|
| 45 |
-
.drkfr_metabox .drkfr-cell-6 { width: 50%; }
|
| 46 |
-
.drkfr_metabox .drkfr-cell-7 { width: 58.333333333%; }
|
| 47 |
-
.drkfr_metabox .drkfr-cell-8 { width: 66.666666667%; }
|
| 48 |
-
.drkfr_metabox .drkfr-cell-9 { width: 75%; }
|
| 49 |
-
.drkfr_metabox .drkfr-cell-10 { width: 83.333333333%; }
|
| 50 |
-
.drkfr_metabox .drkfr-cell-11 { width: 91.666666667%; }
|
| 51 |
-
.drkfr_metabox .drkfr-cell-12 { width: 100%; }
|
| 52 |
-
|
| 53 |
-
@media all and ( max-width: 850px ) {
|
| 54 |
-
|
| 55 |
-
.drkfr_metabox [class*="drkfr-cell-"] { width: 100%; }
|
| 56 |
-
|
| 57 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/misc-fields.css
DELETED
|
@@ -1,71 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Title Field
|
| 3 |
-
*/
|
| 4 |
-
.drkfr_Title .field-title {
|
| 5 |
-
margin: 8px 0 !important;
|
| 6 |
-
}
|
| 7 |
-
|
| 8 |
-
.drkfr_Title {
|
| 9 |
-
border-bottom: 0;
|
| 10 |
-
padding-bottom: 0;
|
| 11 |
-
margin-top: 16px;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.drkfr_Title h2 {
|
| 15 |
-
margin: 0 !important;
|
| 16 |
-
padding: 0 !important;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Color Picker
|
| 22 |
-
*/
|
| 23 |
-
.drkfr_Color_Picker .field-item {
|
| 24 |
-
float: left;
|
| 25 |
-
clear: both;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.drkfr_Color_Picker:before,
|
| 29 |
-
.drkfr_Color_Picker:after {
|
| 30 |
-
content: "";
|
| 31 |
-
display: table;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
.drkfr_Color_Picker:after {
|
| 35 |
-
clear: both;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
.drkfr_Color_Picker {
|
| 39 |
-
zoom: 1;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* Timepicker
|
| 45 |
-
*/
|
| 46 |
-
div.time-picker { position: absolute; height: 191px; width:4em; /* needed for IE */ overflow: auto; background: #fff; border: 1px solid #aaa; z-index: 99; margin: 0; }
|
| 47 |
-
div.time-picker-12hours { width:6em; /* needed for IE */ }
|
| 48 |
-
div.time-picker ul { list-style-type: none; margin: 0; padding: 0; }
|
| 49 |
-
div.time-picker li { cursor: pointer; height: 10px; font: 12px/1 Helvetica, Arial, sans-serif; padding: 4px 3px; }
|
| 50 |
-
div.time-picker li.selected { background: #0063CE; color: #fff; }
|
| 51 |
-
|
| 52 |
-
.drkfr_metabox input.drkfr_timepicker {
|
| 53 |
-
width: 100px;
|
| 54 |
-
margin-right: 0;
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
.drkfr_Datetime_Timestamp_Field input + input {
|
| 58 |
-
margin-left: 4px;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Select Fields
|
| 63 |
-
*/
|
| 64 |
-
|
| 65 |
-
.drkfr_select {
|
| 66 |
-
width: 100%;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.select2-offscreen {
|
| 70 |
-
display: none;
|
| 71 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/repeatable.css
DELETED
|
@@ -1,88 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Repeatable
|
| 3 |
-
*/
|
| 4 |
-
|
| 5 |
-
.drkfr_metabox .field.repeatable > .field-item {
|
| 6 |
-
padding-right: 30px;
|
| 7 |
-
margin-bottom: 10px;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.drkfr_metabox .repeat-field {
|
| 11 |
-
display: block !important;
|
| 12 |
-
clear: both;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.drkfr_Text_Small_Field.repeatable .field-item,
|
| 16 |
-
.drkfr_Date_Field.repeatable .field-item,
|
| 17 |
-
.drkfr_Time_Field.repeatable .field-item,
|
| 18 |
-
.drkfr_Date_Timestamp_Field.repeatable .field-item,
|
| 19 |
-
.drkfr_Date_Timestamp_Field.repeatable .field-item,
|
| 20 |
-
.drkfr_Datetime_Timestamp_Field.repeatable .field-item {
|
| 21 |
-
float: left; clear: both;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.drkfr-delete-field {
|
| 25 |
-
display: inline-block;
|
| 26 |
-
text-decoration: none;
|
| 27 |
-
font-size: 11px;
|
| 28 |
-
line-height: 20px;
|
| 29 |
-
height: 22px;
|
| 30 |
-
width: 22px;
|
| 31 |
-
margin: 0;
|
| 32 |
-
padding: 0;
|
| 33 |
-
cursor: pointer;
|
| 34 |
-
border-width: 1px;
|
| 35 |
-
border-style: solid;
|
| 36 |
-
-webkit-border-radius: 3px;
|
| 37 |
-
-webkit-appearance: none;
|
| 38 |
-
border-radius: 3px;
|
| 39 |
-
white-space: nowrap;
|
| 40 |
-
-webkit-box-sizing: border-box;
|
| 41 |
-
-moz-box-sizing: border-box;
|
| 42 |
-
box-sizing: border-box;
|
| 43 |
-
color: #555;
|
| 44 |
-
border-color: #ccc;
|
| 45 |
-
background: #f7f7f7;
|
| 46 |
-
-webkit-box-shadow: inset 0 1px 0 #fff,0 1px 0 rgba(0,0,0,.08);
|
| 47 |
-
box-shadow: inset 0 1px 0 #fff,0 1px 0 rgba(0,0,0,.08);
|
| 48 |
-
vertical-align: top;
|
| 49 |
-
position: absolute;
|
| 50 |
-
top: 3px;
|
| 51 |
-
right: 0;
|
| 52 |
-
text-indent: 100%;
|
| 53 |
-
overflow: hidden;
|
| 54 |
-
white-space: nowrap;
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
.drkfr-delete-field:hover,
|
| 58 |
-
.drkfr-delete-field:focus,
|
| 59 |
-
.drkfr-delete-field:active {
|
| 60 |
-
background: #fafafa;
|
| 61 |
-
border-color: #999;
|
| 62 |
-
color: #222;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.drkfr-delete-field .drkfr-delete-field-icon {
|
| 66 |
-
content: ' ';
|
| 67 |
-
display: block;
|
| 68 |
-
position: absolute;
|
| 69 |
-
height: 8px;
|
| 70 |
-
width: 8px;
|
| 71 |
-
top: 50%;
|
| 72 |
-
left: 50%;
|
| 73 |
-
margin-top: -4px;
|
| 74 |
-
margin-left: -4px;
|
| 75 |
-
background-image: url( '../../images/drkfr-icon-remove.png');
|
| 76 |
-
background-repeat: no-repeat;
|
| 77 |
-
text-indent: 8px;
|
| 78 |
-
overflow: hidden;
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
@media only screen and (-webkit-min-device-pixel-ratio : 1.5), only screen and (min-device-pixel-ratio : 1.5) {
|
| 82 |
-
|
| 83 |
-
.drkfr-delete-field .drkfr-delete-field-icon {
|
| 84 |
-
background-image: url( '../../images/drkfr-icon-remove@2x.png');
|
| 85 |
-
background-size: 8px 8px;
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/src/sortable.css
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
|
| 2 |
-
.drkfr-sortable > .field-item {
|
| 3 |
-
padding-left: 15px;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
.drkfr-sortable .drkfr-handle {
|
| 7 |
-
height: 100%;
|
| 8 |
-
width: 3px;
|
| 9 |
-
position: absolute;
|
| 10 |
-
top: 0;
|
| 11 |
-
left: 0;
|
| 12 |
-
background: transparent;
|
| 13 |
-
cursor: move;
|
| 14 |
-
border-left: 3px solid #DFDFDF;
|
| 15 |
-
border-right: 3px solid #DFDFDF;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
.drkfr-sortable .ui-sortable-helper {
|
| 19 |
-
opacity: 0.75;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
.drkfr-sortable .ui-sortable-helper:before {
|
| 23 |
-
content: ' ';
|
| 24 |
-
position: absolute;
|
| 25 |
-
width: 100%;
|
| 26 |
-
height: 100%;
|
| 27 |
-
top: -6px;
|
| 28 |
-
left: -6px;
|
| 29 |
-
background-color: #F8F8F8;
|
| 30 |
-
border: 1px solid #DEDEDE;
|
| 31 |
-
padding: 5px;
|
| 32 |
-
z-index: -1;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
.drkfr-sortable > .ui-sortable-placeholder {
|
| 36 |
-
border: 1px dashed #DDD !important;
|
| 37 |
-
background: transparent !important;
|
| 38 |
-
visibility: visible !important;
|
| 39 |
-
margin-bottom: 8px !important;
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/vendor/jquery-ui/images/animated-overlay.gif
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_flat_0_aaaaaa_40x100.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_flat_75_ffffff_40x100.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_glass_55_fbf9ee_1x400.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_glass_65_ffffff_1x400.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_glass_75_dadada_1x400.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_glass_75_e6e6e6_1x400.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_glass_95_fef1ec_1x400.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-icons_222222_256x240.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-icons_2e83ff_256x240.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-icons_454545_256x240.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-icons_888888_256x240.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/images/ui-icons_cd0a0a_256x240.png
DELETED
|
Binary file
|
drkfr/css/vendor/jquery-ui/jquery-ui.css
DELETED
|
@@ -1,1175 +0,0 @@
|
|
| 1 |
-
/*! jQuery UI - v1.10.2 - 2013-03-14
|
| 2 |
-
* http://jqueryui.com
|
| 3 |
-
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css
|
| 4 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 5 |
-
* Copyright 2013 jQuery Foundation and other contributors Licensed MIT */
|
| 6 |
-
|
| 7 |
-
/* Layout helpers
|
| 8 |
-
----------------------------------*/
|
| 9 |
-
.ui-helper-hidden {
|
| 10 |
-
display: none;
|
| 11 |
-
}
|
| 12 |
-
.ui-helper-hidden-accessible {
|
| 13 |
-
border: 0;
|
| 14 |
-
clip: rect(0 0 0 0);
|
| 15 |
-
height: 1px;
|
| 16 |
-
margin: -1px;
|
| 17 |
-
overflow: hidden;
|
| 18 |
-
padding: 0;
|
| 19 |
-
position: absolute;
|
| 20 |
-
width: 1px;
|
| 21 |
-
}
|
| 22 |
-
.ui-helper-reset {
|
| 23 |
-
margin: 0;
|
| 24 |
-
padding: 0;
|
| 25 |
-
border: 0;
|
| 26 |
-
outline: 0;
|
| 27 |
-
line-height: 1.3;
|
| 28 |
-
text-decoration: none;
|
| 29 |
-
font-size: 100%;
|
| 30 |
-
list-style: none;
|
| 31 |
-
}
|
| 32 |
-
.ui-helper-clearfix:before,
|
| 33 |
-
.ui-helper-clearfix:after {
|
| 34 |
-
content: "";
|
| 35 |
-
display: table;
|
| 36 |
-
border-collapse: collapse;
|
| 37 |
-
}
|
| 38 |
-
.ui-helper-clearfix:after {
|
| 39 |
-
clear: both;
|
| 40 |
-
}
|
| 41 |
-
.ui-helper-clearfix {
|
| 42 |
-
min-height: 0; /* support: IE7 */
|
| 43 |
-
}
|
| 44 |
-
.ui-helper-zfix {
|
| 45 |
-
width: 100%;
|
| 46 |
-
height: 100%;
|
| 47 |
-
top: 0;
|
| 48 |
-
left: 0;
|
| 49 |
-
position: absolute;
|
| 50 |
-
opacity: 0;
|
| 51 |
-
filter:Alpha(Opacity=0);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.ui-front {
|
| 55 |
-
z-index: 100;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
/* Interaction Cues
|
| 60 |
-
----------------------------------*/
|
| 61 |
-
.ui-state-disabled {
|
| 62 |
-
cursor: default !important;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
/* Icons
|
| 67 |
-
----------------------------------*/
|
| 68 |
-
|
| 69 |
-
/* states and images */
|
| 70 |
-
.ui-icon {
|
| 71 |
-
display: block;
|
| 72 |
-
text-indent: -99999px;
|
| 73 |
-
overflow: hidden;
|
| 74 |
-
background-repeat: no-repeat;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
/* Misc visuals
|
| 79 |
-
----------------------------------*/
|
| 80 |
-
|
| 81 |
-
/* Overlays */
|
| 82 |
-
.ui-widget-overlay {
|
| 83 |
-
position: fixed;
|
| 84 |
-
top: 0;
|
| 85 |
-
left: 0;
|
| 86 |
-
width: 100%;
|
| 87 |
-
height: 100%;
|
| 88 |
-
}
|
| 89 |
-
.ui-accordion .ui-accordion-header {
|
| 90 |
-
display: block;
|
| 91 |
-
cursor: pointer;
|
| 92 |
-
position: relative;
|
| 93 |
-
margin-top: 2px;
|
| 94 |
-
padding: .5em .5em .5em .7em;
|
| 95 |
-
min-height: 0; /* support: IE7 */
|
| 96 |
-
}
|
| 97 |
-
.ui-accordion .ui-accordion-icons {
|
| 98 |
-
padding-left: 2.2em;
|
| 99 |
-
}
|
| 100 |
-
.ui-accordion .ui-accordion-noicons {
|
| 101 |
-
padding-left: .7em;
|
| 102 |
-
}
|
| 103 |
-
.ui-accordion .ui-accordion-icons .ui-accordion-icons {
|
| 104 |
-
padding-left: 2.2em;
|
| 105 |
-
}
|
| 106 |
-
.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
|
| 107 |
-
position: absolute;
|
| 108 |
-
left: .5em;
|
| 109 |
-
top: 50%;
|
| 110 |
-
margin-top: -8px;
|
| 111 |
-
}
|
| 112 |
-
.ui-accordion .ui-accordion-content {
|
| 113 |
-
padding: 1em 2.2em;
|
| 114 |
-
border-top: 0;
|
| 115 |
-
overflow: auto;
|
| 116 |
-
}
|
| 117 |
-
.ui-autocomplete {
|
| 118 |
-
position: absolute;
|
| 119 |
-
top: 0;
|
| 120 |
-
left: 0;
|
| 121 |
-
cursor: default;
|
| 122 |
-
}
|
| 123 |
-
.ui-button {
|
| 124 |
-
display: inline-block;
|
| 125 |
-
position: relative;
|
| 126 |
-
padding: 0;
|
| 127 |
-
line-height: normal;
|
| 128 |
-
margin-right: .1em;
|
| 129 |
-
cursor: pointer;
|
| 130 |
-
vertical-align: middle;
|
| 131 |
-
text-align: center;
|
| 132 |
-
overflow: visible; /* removes extra width in IE */
|
| 133 |
-
}
|
| 134 |
-
.ui-button,
|
| 135 |
-
.ui-button:link,
|
| 136 |
-
.ui-button:visited,
|
| 137 |
-
.ui-button:hover,
|
| 138 |
-
.ui-button:active {
|
| 139 |
-
text-decoration: none;
|
| 140 |
-
}
|
| 141 |
-
/* to make room for the icon, a width needs to be set here */
|
| 142 |
-
.ui-button-icon-only {
|
| 143 |
-
width: 2.2em;
|
| 144 |
-
}
|
| 145 |
-
/* button elements seem to need a little more width */
|
| 146 |
-
button.ui-button-icon-only {
|
| 147 |
-
width: 2.4em;
|
| 148 |
-
}
|
| 149 |
-
.ui-button-icons-only {
|
| 150 |
-
width: 3.4em;
|
| 151 |
-
}
|
| 152 |
-
button.ui-button-icons-only {
|
| 153 |
-
width: 3.7em;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/* button text element */
|
| 157 |
-
.ui-button .ui-button-text {
|
| 158 |
-
display: block;
|
| 159 |
-
line-height: normal;
|
| 160 |
-
}
|
| 161 |
-
.ui-button-text-only .ui-button-text {
|
| 162 |
-
padding: .4em 1em;
|
| 163 |
-
}
|
| 164 |
-
.ui-button-icon-only .ui-button-text,
|
| 165 |
-
.ui-button-icons-only .ui-button-text {
|
| 166 |
-
padding: .4em;
|
| 167 |
-
text-indent: -9999999px;
|
| 168 |
-
}
|
| 169 |
-
.ui-button-text-icon-primary .ui-button-text,
|
| 170 |
-
.ui-button-text-icons .ui-button-text {
|
| 171 |
-
padding: .4em 1em .4em 2.1em;
|
| 172 |
-
}
|
| 173 |
-
.ui-button-text-icon-secondary .ui-button-text,
|
| 174 |
-
.ui-button-text-icons .ui-button-text {
|
| 175 |
-
padding: .4em 2.1em .4em 1em;
|
| 176 |
-
}
|
| 177 |
-
.ui-button-text-icons .ui-button-text {
|
| 178 |
-
padding-left: 2.1em;
|
| 179 |
-
padding-right: 2.1em;
|
| 180 |
-
}
|
| 181 |
-
/* no icon support for input elements, provide padding by default */
|
| 182 |
-
input.ui-button {
|
| 183 |
-
padding: .4em 1em;
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
/* button icon element(s) */
|
| 187 |
-
.ui-button-icon-only .ui-icon,
|
| 188 |
-
.ui-button-text-icon-primary .ui-icon,
|
| 189 |
-
.ui-button-text-icon-secondary .ui-icon,
|
| 190 |
-
.ui-button-text-icons .ui-icon,
|
| 191 |
-
.ui-button-icons-only .ui-icon {
|
| 192 |
-
position: absolute;
|
| 193 |
-
top: 50%;
|
| 194 |
-
margin-top: -8px;
|
| 195 |
-
}
|
| 196 |
-
.ui-button-icon-only .ui-icon {
|
| 197 |
-
left: 50%;
|
| 198 |
-
margin-left: -8px;
|
| 199 |
-
}
|
| 200 |
-
.ui-button-text-icon-primary .ui-button-icon-primary,
|
| 201 |
-
.ui-button-text-icons .ui-button-icon-primary,
|
| 202 |
-
.ui-button-icons-only .ui-button-icon-primary {
|
| 203 |
-
left: .5em;
|
| 204 |
-
}
|
| 205 |
-
.ui-button-text-icon-secondary .ui-button-icon-secondary,
|
| 206 |
-
.ui-button-text-icons .ui-button-icon-secondary,
|
| 207 |
-
.ui-button-icons-only .ui-button-icon-secondary {
|
| 208 |
-
right: .5em;
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
/* button sets */
|
| 212 |
-
.ui-buttonset {
|
| 213 |
-
margin-right: 7px;
|
| 214 |
-
}
|
| 215 |
-
.ui-buttonset .ui-button {
|
| 216 |
-
margin-left: 0;
|
| 217 |
-
margin-right: -.3em;
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
/* workarounds */
|
| 221 |
-
/* reset extra padding in Firefox, see h5bp.com/l */
|
| 222 |
-
input.ui-button::-moz-focus-inner,
|
| 223 |
-
button.ui-button::-moz-focus-inner {
|
| 224 |
-
border: 0;
|
| 225 |
-
padding: 0;
|
| 226 |
-
}
|
| 227 |
-
.ui-datepicker {
|
| 228 |
-
width: 17em;
|
| 229 |
-
padding: .2em .2em 0;
|
| 230 |
-
display: none;
|
| 231 |
-
}
|
| 232 |
-
.ui-datepicker .ui-datepicker-header {
|
| 233 |
-
position: relative;
|
| 234 |
-
padding: .2em 0;
|
| 235 |
-
}
|
| 236 |
-
.ui-datepicker .ui-datepicker-prev,
|
| 237 |
-
.ui-datepicker .ui-datepicker-next {
|
| 238 |
-
position: absolute;
|
| 239 |
-
top: 2px;
|
| 240 |
-
width: 1.8em;
|
| 241 |
-
height: 1.8em;
|
| 242 |
-
}
|
| 243 |
-
.ui-datepicker .ui-datepicker-prev-hover,
|
| 244 |
-
.ui-datepicker .ui-datepicker-next-hover {
|
| 245 |
-
top: 1px;
|
| 246 |
-
}
|
| 247 |
-
.ui-datepicker .ui-datepicker-prev {
|
| 248 |
-
left: 2px;
|
| 249 |
-
}
|
| 250 |
-
.ui-datepicker .ui-datepicker-next {
|
| 251 |
-
right: 2px;
|
| 252 |
-
}
|
| 253 |
-
.ui-datepicker .ui-datepicker-prev-hover {
|
| 254 |
-
left: 1px;
|
| 255 |
-
}
|
| 256 |
-
.ui-datepicker .ui-datepicker-next-hover {
|
| 257 |
-
right: 1px;
|
| 258 |
-
}
|
| 259 |
-
.ui-datepicker .ui-datepicker-prev span,
|
| 260 |
-
.ui-datepicker .ui-datepicker-next span {
|
| 261 |
-
display: block;
|
| 262 |
-
position: absolute;
|
| 263 |
-
left: 50%;
|
| 264 |
-
margin-left: -8px;
|
| 265 |
-
top: 50%;
|
| 266 |
-
margin-top: -8px;
|
| 267 |
-
}
|
| 268 |
-
.ui-datepicker .ui-datepicker-title {
|
| 269 |
-
margin: 0 2.3em;
|
| 270 |
-
line-height: 1.8em;
|
| 271 |
-
text-align: center;
|
| 272 |
-
}
|
| 273 |
-
.ui-datepicker .ui-datepicker-title select {
|
| 274 |
-
font-size: 1em;
|
| 275 |
-
margin: 1px 0;
|
| 276 |
-
}
|
| 277 |
-
.ui-datepicker select.ui-datepicker-month-year {
|
| 278 |
-
width: 100%;
|
| 279 |
-
}
|
| 280 |
-
.ui-datepicker select.ui-datepicker-month,
|
| 281 |
-
.ui-datepicker select.ui-datepicker-year {
|
| 282 |
-
width: 49%;
|
| 283 |
-
}
|
| 284 |
-
.ui-datepicker table {
|
| 285 |
-
width: 100%;
|
| 286 |
-
font-size: .9em;
|
| 287 |
-
border-collapse: collapse;
|
| 288 |
-
margin: 0 0 .4em;
|
| 289 |
-
}
|
| 290 |
-
.ui-datepicker th {
|
| 291 |
-
padding: .7em .3em;
|
| 292 |
-
text-align: center;
|
| 293 |
-
font-weight: bold;
|
| 294 |
-
border: 0;
|
| 295 |
-
}
|
| 296 |
-
.ui-datepicker td {
|
| 297 |
-
border: 0;
|
| 298 |
-
padding: 1px;
|
| 299 |
-
}
|
| 300 |
-
.ui-datepicker td span,
|
| 301 |
-
.ui-datepicker td a {
|
| 302 |
-
display: block;
|
| 303 |
-
padding: .2em;
|
| 304 |
-
text-align: right;
|
| 305 |
-
text-decoration: none;
|
| 306 |
-
}
|
| 307 |
-
.ui-datepicker .ui-datepicker-buttonpane {
|
| 308 |
-
background-image: none;
|
| 309 |
-
margin: .7em 0 0 0;
|
| 310 |
-
padding: 0 .2em;
|
| 311 |
-
border-left: 0;
|
| 312 |
-
border-right: 0;
|
| 313 |
-
border-bottom: 0;
|
| 314 |
-
}
|
| 315 |
-
.ui-datepicker .ui-datepicker-buttonpane button {
|
| 316 |
-
float: right;
|
| 317 |
-
margin: .5em .2em .4em;
|
| 318 |
-
cursor: pointer;
|
| 319 |
-
padding: .2em .6em .3em .6em;
|
| 320 |
-
width: auto;
|
| 321 |
-
overflow: visible;
|
| 322 |
-
}
|
| 323 |
-
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
|
| 324 |
-
float: left;
|
| 325 |
-
}
|
| 326 |
-
|
| 327 |
-
/* with multiple calendars */
|
| 328 |
-
.ui-datepicker.ui-datepicker-multi {
|
| 329 |
-
width: auto;
|
| 330 |
-
}
|
| 331 |
-
.ui-datepicker-multi .ui-datepicker-group {
|
| 332 |
-
float: left;
|
| 333 |
-
}
|
| 334 |
-
.ui-datepicker-multi .ui-datepicker-group table {
|
| 335 |
-
width: 95%;
|
| 336 |
-
margin: 0 auto .4em;
|
| 337 |
-
}
|
| 338 |
-
.ui-datepicker-multi-2 .ui-datepicker-group {
|
| 339 |
-
width: 50%;
|
| 340 |
-
}
|
| 341 |
-
.ui-datepicker-multi-3 .ui-datepicker-group {
|
| 342 |
-
width: 33.3%;
|
| 343 |
-
}
|
| 344 |
-
.ui-datepicker-multi-4 .ui-datepicker-group {
|
| 345 |
-
width: 25%;
|
| 346 |
-
}
|
| 347 |
-
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
|
| 348 |
-
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
|
| 349 |
-
border-left-width: 0;
|
| 350 |
-
}
|
| 351 |
-
.ui-datepicker-multi .ui-datepicker-buttonpane {
|
| 352 |
-
clear: left;
|
| 353 |
-
}
|
| 354 |
-
.ui-datepicker-row-break {
|
| 355 |
-
clear: both;
|
| 356 |
-
width: 100%;
|
| 357 |
-
font-size: 0;
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
/* RTL support */
|
| 361 |
-
.ui-datepicker-rtl {
|
| 362 |
-
direction: rtl;
|
| 363 |
-
}
|
| 364 |
-
.ui-datepicker-rtl .ui-datepicker-prev {
|
| 365 |
-
right: 2px;
|
| 366 |
-
left: auto;
|
| 367 |
-
}
|
| 368 |
-
.ui-datepicker-rtl .ui-datepicker-next {
|
| 369 |
-
left: 2px;
|
| 370 |
-
right: auto;
|
| 371 |
-
}
|
| 372 |
-
.ui-datepicker-rtl .ui-datepicker-prev:hover {
|
| 373 |
-
right: 1px;
|
| 374 |
-
left: auto;
|
| 375 |
-
}
|
| 376 |
-
.ui-datepicker-rtl .ui-datepicker-next:hover {
|
| 377 |
-
left: 1px;
|
| 378 |
-
right: auto;
|
| 379 |
-
}
|
| 380 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane {
|
| 381 |
-
clear: right;
|
| 382 |
-
}
|
| 383 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button {
|
| 384 |
-
float: left;
|
| 385 |
-
}
|
| 386 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
|
| 387 |
-
.ui-datepicker-rtl .ui-datepicker-group {
|
| 388 |
-
float: right;
|
| 389 |
-
}
|
| 390 |
-
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
|
| 391 |
-
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
|
| 392 |
-
border-right-width: 0;
|
| 393 |
-
border-left-width: 1px;
|
| 394 |
-
}
|
| 395 |
-
.ui-dialog {
|
| 396 |
-
position: absolute;
|
| 397 |
-
top: 0;
|
| 398 |
-
left: 0;
|
| 399 |
-
padding: .2em;
|
| 400 |
-
outline: 0;
|
| 401 |
-
}
|
| 402 |
-
.ui-dialog .ui-dialog-titlebar {
|
| 403 |
-
padding: .4em 1em;
|
| 404 |
-
position: relative;
|
| 405 |
-
}
|
| 406 |
-
.ui-dialog .ui-dialog-title {
|
| 407 |
-
float: left;
|
| 408 |
-
margin: .1em 0;
|
| 409 |
-
white-space: nowrap;
|
| 410 |
-
width: 90%;
|
| 411 |
-
overflow: hidden;
|
| 412 |
-
text-overflow: ellipsis;
|
| 413 |
-
}
|
| 414 |
-
.ui-dialog .ui-dialog-titlebar-close {
|
| 415 |
-
position: absolute;
|
| 416 |
-
right: .3em;
|
| 417 |
-
top: 50%;
|
| 418 |
-
width: 21px;
|
| 419 |
-
margin: -10px 0 0 0;
|
| 420 |
-
padding: 1px;
|
| 421 |
-
height: 20px;
|
| 422 |
-
}
|
| 423 |
-
.ui-dialog .ui-dialog-content {
|
| 424 |
-
position: relative;
|
| 425 |
-
border: 0;
|
| 426 |
-
padding: .5em 1em;
|
| 427 |
-
background: none;
|
| 428 |
-
overflow: auto;
|
| 429 |
-
}
|
| 430 |
-
.ui-dialog .ui-dialog-buttonpane {
|
| 431 |
-
text-align: left;
|
| 432 |
-
border-width: 1px 0 0 0;
|
| 433 |
-
background-image: none;
|
| 434 |
-
margin-top: .5em;
|
| 435 |
-
padding: .3em 1em .5em .4em;
|
| 436 |
-
}
|
| 437 |
-
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
|
| 438 |
-
float: right;
|
| 439 |
-
}
|
| 440 |
-
.ui-dialog .ui-dialog-buttonpane button {
|
| 441 |
-
margin: .5em .4em .5em 0;
|
| 442 |
-
cursor: pointer;
|
| 443 |
-
}
|
| 444 |
-
.ui-dialog .ui-resizable-se {
|
| 445 |
-
width: 12px;
|
| 446 |
-
height: 12px;
|
| 447 |
-
right: -5px;
|
| 448 |
-
bottom: -5px;
|
| 449 |
-
background-position: 16px 16px;
|
| 450 |
-
}
|
| 451 |
-
.ui-draggable .ui-dialog-titlebar {
|
| 452 |
-
cursor: move;
|
| 453 |
-
}
|
| 454 |
-
.ui-menu {
|
| 455 |
-
list-style: none;
|
| 456 |
-
padding: 2px;
|
| 457 |
-
margin: 0;
|
| 458 |
-
display: block;
|
| 459 |
-
outline: none;
|
| 460 |
-
}
|
| 461 |
-
.ui-menu .ui-menu {
|
| 462 |
-
margin-top: -3px;
|
| 463 |
-
position: absolute;
|
| 464 |
-
}
|
| 465 |
-
.ui-menu .ui-menu-item {
|
| 466 |
-
margin: 0;
|
| 467 |
-
padding: 0;
|
| 468 |
-
width: 100%;
|
| 469 |
-
}
|
| 470 |
-
.ui-menu .ui-menu-divider {
|
| 471 |
-
margin: 5px -2px 5px -2px;
|
| 472 |
-
height: 0;
|
| 473 |
-
font-size: 0;
|
| 474 |
-
line-height: 0;
|
| 475 |
-
border-width: 1px 0 0 0;
|
| 476 |
-
}
|
| 477 |
-
.ui-menu .ui-menu-item a {
|
| 478 |
-
text-decoration: none;
|
| 479 |
-
display: block;
|
| 480 |
-
padding: 2px .4em;
|
| 481 |
-
line-height: 1.5;
|
| 482 |
-
min-height: 0; /* support: IE7 */
|
| 483 |
-
font-weight: normal;
|
| 484 |
-
}
|
| 485 |
-
.ui-menu .ui-menu-item a.ui-state-focus,
|
| 486 |
-
.ui-menu .ui-menu-item a.ui-state-active {
|
| 487 |
-
font-weight: normal;
|
| 488 |
-
margin: -1px;
|
| 489 |
-
}
|
| 490 |
-
|
| 491 |
-
.ui-menu .ui-state-disabled {
|
| 492 |
-
font-weight: normal;
|
| 493 |
-
margin: .4em 0 .2em;
|
| 494 |
-
line-height: 1.5;
|
| 495 |
-
}
|
| 496 |
-
.ui-menu .ui-state-disabled a {
|
| 497 |
-
cursor: default;
|
| 498 |
-
}
|
| 499 |
-
|
| 500 |
-
/* icon support */
|
| 501 |
-
.ui-menu-icons {
|
| 502 |
-
position: relative;
|
| 503 |
-
}
|
| 504 |
-
.ui-menu-icons .ui-menu-item a {
|
| 505 |
-
position: relative;
|
| 506 |
-
padding-left: 2em;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
/* left-aligned */
|
| 510 |
-
.ui-menu .ui-icon {
|
| 511 |
-
position: absolute;
|
| 512 |
-
top: .2em;
|
| 513 |
-
left: .2em;
|
| 514 |
-
}
|
| 515 |
-
|
| 516 |
-
/* right-aligned */
|
| 517 |
-
.ui-menu .ui-menu-icon {
|
| 518 |
-
position: static;
|
| 519 |
-
float: right;
|
| 520 |
-
}
|
| 521 |
-
.ui-progressbar {
|
| 522 |
-
height: 2em;
|
| 523 |
-
text-align: left;
|
| 524 |
-
overflow: hidden;
|
| 525 |
-
}
|
| 526 |
-
.ui-progressbar .ui-progressbar-value {
|
| 527 |
-
margin: -1px;
|
| 528 |
-
height: 100%;
|
| 529 |
-
}
|
| 530 |
-
.ui-progressbar .ui-progressbar-overlay {
|
| 531 |
-
background: url("images/animated-overlay.gif");
|
| 532 |
-
height: 100%;
|
| 533 |
-
filter: alpha(opacity=25);
|
| 534 |
-
opacity: 0.25;
|
| 535 |
-
}
|
| 536 |
-
.ui-progressbar-indeterminate .ui-progressbar-value {
|
| 537 |
-
background-image: none;
|
| 538 |
-
}
|
| 539 |
-
.ui-resizable {
|
| 540 |
-
position: relative;
|
| 541 |
-
}
|
| 542 |
-
.ui-resizable-handle {
|
| 543 |
-
position: absolute;
|
| 544 |
-
font-size: 0.1px;
|
| 545 |
-
display: block;
|
| 546 |
-
}
|
| 547 |
-
.ui-resizable-disabled .ui-resizable-handle,
|
| 548 |
-
.ui-resizable-autohide .ui-resizable-handle {
|
| 549 |
-
display: none;
|
| 550 |
-
}
|
| 551 |
-
.ui-resizable-n {
|
| 552 |
-
cursor: n-resize;
|
| 553 |
-
height: 7px;
|
| 554 |
-
width: 100%;
|
| 555 |
-
top: -5px;
|
| 556 |
-
left: 0;
|
| 557 |
-
}
|
| 558 |
-
.ui-resizable-s {
|
| 559 |
-
cursor: s-resize;
|
| 560 |
-
height: 7px;
|
| 561 |
-
width: 100%;
|
| 562 |
-
bottom: -5px;
|
| 563 |
-
left: 0;
|
| 564 |
-
}
|
| 565 |
-
.ui-resizable-e {
|
| 566 |
-
cursor: e-resize;
|
| 567 |
-
width: 7px;
|
| 568 |
-
right: -5px;
|
| 569 |
-
top: 0;
|
| 570 |
-
height: 100%;
|
| 571 |
-
}
|
| 572 |
-
.ui-resizable-w {
|
| 573 |
-
cursor: w-resize;
|
| 574 |
-
width: 7px;
|
| 575 |
-
left: -5px;
|
| 576 |
-
top: 0;
|
| 577 |
-
height: 100%;
|
| 578 |
-
}
|
| 579 |
-
.ui-resizable-se {
|
| 580 |
-
cursor: se-resize;
|
| 581 |
-
width: 12px;
|
| 582 |
-
height: 12px;
|
| 583 |
-
right: 1px;
|
| 584 |
-
bottom: 1px;
|
| 585 |
-
}
|
| 586 |
-
.ui-resizable-sw {
|
| 587 |
-
cursor: sw-resize;
|
| 588 |
-
width: 9px;
|
| 589 |
-
height: 9px;
|
| 590 |
-
left: -5px;
|
| 591 |
-
bottom: -5px;
|
| 592 |
-
}
|
| 593 |
-
.ui-resizable-nw {
|
| 594 |
-
cursor: nw-resize;
|
| 595 |
-
width: 9px;
|
| 596 |
-
height: 9px;
|
| 597 |
-
left: -5px;
|
| 598 |
-
top: -5px;
|
| 599 |
-
}
|
| 600 |
-
.ui-resizable-ne {
|
| 601 |
-
cursor: ne-resize;
|
| 602 |
-
width: 9px;
|
| 603 |
-
height: 9px;
|
| 604 |
-
right: -5px;
|
| 605 |
-
top: -5px;
|
| 606 |
-
}
|
| 607 |
-
.ui-selectable-helper {
|
| 608 |
-
position: absolute;
|
| 609 |
-
z-index: 100;
|
| 610 |
-
border: 1px dotted black;
|
| 611 |
-
}
|
| 612 |
-
.ui-slider {
|
| 613 |
-
position: relative;
|
| 614 |
-
text-align: left;
|
| 615 |
-
}
|
| 616 |
-
.ui-slider .ui-slider-handle {
|
| 617 |
-
position: absolute;
|
| 618 |
-
z-index: 2;
|
| 619 |
-
width: 1.2em;
|
| 620 |
-
height: 1.2em;
|
| 621 |
-
cursor: default;
|
| 622 |
-
}
|
| 623 |
-
.ui-slider .ui-slider-range {
|
| 624 |
-
position: absolute;
|
| 625 |
-
z-index: 1;
|
| 626 |
-
font-size: .7em;
|
| 627 |
-
display: block;
|
| 628 |
-
border: 0;
|
| 629 |
-
background-position: 0 0;
|
| 630 |
-
}
|
| 631 |
-
|
| 632 |
-
/* For IE8 - See #6727 */
|
| 633 |
-
.ui-slider.ui-state-disabled .ui-slider-handle,
|
| 634 |
-
.ui-slider.ui-state-disabled .ui-slider-range {
|
| 635 |
-
filter: inherit;
|
| 636 |
-
}
|
| 637 |
-
|
| 638 |
-
.ui-slider-horizontal {
|
| 639 |
-
height: .8em;
|
| 640 |
-
}
|
| 641 |
-
.ui-slider-horizontal .ui-slider-handle {
|
| 642 |
-
top: -.3em;
|
| 643 |
-
margin-left: -.6em;
|
| 644 |
-
}
|
| 645 |
-
.ui-slider-horizontal .ui-slider-range {
|
| 646 |
-
top: 0;
|
| 647 |
-
height: 100%;
|
| 648 |
-
}
|
| 649 |
-
.ui-slider-horizontal .ui-slider-range-min {
|
| 650 |
-
left: 0;
|
| 651 |
-
}
|
| 652 |
-
.ui-slider-horizontal .ui-slider-range-max {
|
| 653 |
-
right: 0;
|
| 654 |
-
}
|
| 655 |
-
|
| 656 |
-
.ui-slider-vertical {
|
| 657 |
-
width: .8em;
|
| 658 |
-
height: 100px;
|
| 659 |
-
}
|
| 660 |
-
.ui-slider-vertical .ui-slider-handle {
|
| 661 |
-
left: -.3em;
|
| 662 |
-
margin-left: 0;
|
| 663 |
-
margin-bottom: -.6em;
|
| 664 |
-
}
|
| 665 |
-
.ui-slider-vertical .ui-slider-range {
|
| 666 |
-
left: 0;
|
| 667 |
-
width: 100%;
|
| 668 |
-
}
|
| 669 |
-
.ui-slider-vertical .ui-slider-range-min {
|
| 670 |
-
bottom: 0;
|
| 671 |
-
}
|
| 672 |
-
.ui-slider-vertical .ui-slider-range-max {
|
| 673 |
-
top: 0;
|
| 674 |
-
}
|
| 675 |
-
.ui-spinner {
|
| 676 |
-
position: relative;
|
| 677 |
-
display: inline-block;
|
| 678 |
-
overflow: hidden;
|
| 679 |
-
padding: 0;
|
| 680 |
-
vertical-align: middle;
|
| 681 |
-
}
|
| 682 |
-
.ui-spinner-input {
|
| 683 |
-
border: none;
|
| 684 |
-
background: none;
|
| 685 |
-
color: inherit;
|
| 686 |
-
padding: 0;
|
| 687 |
-
margin: .2em 0;
|
| 688 |
-
vertical-align: middle;
|
| 689 |
-
margin-left: .4em;
|
| 690 |
-
margin-right: 22px;
|
| 691 |
-
}
|
| 692 |
-
.ui-spinner-button {
|
| 693 |
-
width: 16px;
|
| 694 |
-
height: 50%;
|
| 695 |
-
font-size: .5em;
|
| 696 |
-
padding: 0;
|
| 697 |
-
margin: 0;
|
| 698 |
-
text-align: center;
|
| 699 |
-
position: absolute;
|
| 700 |
-
cursor: default;
|
| 701 |
-
display: block;
|
| 702 |
-
overflow: hidden;
|
| 703 |
-
right: 0;
|
| 704 |
-
}
|
| 705 |
-
/* more specificity required here to overide default borders */
|
| 706 |
-
.ui-spinner a.ui-spinner-button {
|
| 707 |
-
border-top: none;
|
| 708 |
-
border-bottom: none;
|
| 709 |
-
border-right: none;
|
| 710 |
-
}
|
| 711 |
-
/* vertical centre icon */
|
| 712 |
-
.ui-spinner .ui-icon {
|
| 713 |
-
position: absolute;
|
| 714 |
-
margin-top: -8px;
|
| 715 |
-
top: 50%;
|
| 716 |
-
left: 0;
|
| 717 |
-
}
|
| 718 |
-
.ui-spinner-up {
|
| 719 |
-
top: 0;
|
| 720 |
-
}
|
| 721 |
-
.ui-spinner-down {
|
| 722 |
-
bottom: 0;
|
| 723 |
-
}
|
| 724 |
-
|
| 725 |
-
/* TR overrides */
|
| 726 |
-
.ui-spinner .ui-icon-triangle-1-s {
|
| 727 |
-
/* need to fix icons sprite */
|
| 728 |
-
background-position: -65px -16px;
|
| 729 |
-
}
|
| 730 |
-
.ui-tabs {
|
| 731 |
-
position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
|
| 732 |
-
padding: .2em;
|
| 733 |
-
}
|
| 734 |
-
.ui-tabs .ui-tabs-nav {
|
| 735 |
-
margin: 0;
|
| 736 |
-
padding: .2em .2em 0;
|
| 737 |
-
}
|
| 738 |
-
.ui-tabs .ui-tabs-nav li {
|
| 739 |
-
list-style: none;
|
| 740 |
-
float: left;
|
| 741 |
-
position: relative;
|
| 742 |
-
top: 0;
|
| 743 |
-
margin: 1px .2em 0 0;
|
| 744 |
-
border-bottom-width: 0;
|
| 745 |
-
padding: 0;
|
| 746 |
-
white-space: nowrap;
|
| 747 |
-
}
|
| 748 |
-
.ui-tabs .ui-tabs-nav li a {
|
| 749 |
-
float: left;
|
| 750 |
-
padding: .5em 1em;
|
| 751 |
-
text-decoration: none;
|
| 752 |
-
}
|
| 753 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-active {
|
| 754 |
-
margin-bottom: -1px;
|
| 755 |
-
padding-bottom: 1px;
|
| 756 |
-
}
|
| 757 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-active a,
|
| 758 |
-
.ui-tabs .ui-tabs-nav li.ui-state-disabled a,
|
| 759 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-loading a {
|
| 760 |
-
cursor: text;
|
| 761 |
-
}
|
| 762 |
-
.ui-tabs .ui-tabs-nav li a, /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
|
| 763 |
-
.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a {
|
| 764 |
-
cursor: pointer;
|
| 765 |
-
}
|
| 766 |
-
.ui-tabs .ui-tabs-panel {
|
| 767 |
-
display: block;
|
| 768 |
-
border-width: 0;
|
| 769 |
-
padding: 1em 1.4em;
|
| 770 |
-
background: none;
|
| 771 |
-
}
|
| 772 |
-
.ui-tooltip {
|
| 773 |
-
padding: 8px;
|
| 774 |
-
position: absolute;
|
| 775 |
-
z-index: 9999;
|
| 776 |
-
max-width: 300px;
|
| 777 |
-
-webkit-box-shadow: 0 0 5px #aaa;
|
| 778 |
-
box-shadow: 0 0 5px #aaa;
|
| 779 |
-
}
|
| 780 |
-
body .ui-tooltip {
|
| 781 |
-
border-width: 2px;
|
| 782 |
-
}
|
| 783 |
-
|
| 784 |
-
/* Component containers
|
| 785 |
-
----------------------------------*/
|
| 786 |
-
.ui-widget {
|
| 787 |
-
font-family: Verdana,Arial,sans-serif;
|
| 788 |
-
font-size: 1.1em;
|
| 789 |
-
}
|
| 790 |
-
.ui-widget .ui-widget {
|
| 791 |
-
font-size: 1em;
|
| 792 |
-
}
|
| 793 |
-
.ui-widget input,
|
| 794 |
-
.ui-widget select,
|
| 795 |
-
.ui-widget textarea,
|
| 796 |
-
.ui-widget button {
|
| 797 |
-
font-family: Verdana,Arial,sans-serif;
|
| 798 |
-
font-size: 1em;
|
| 799 |
-
}
|
| 800 |
-
.ui-widget-content {
|
| 801 |
-
border: 1px solid #aaaaaa;
|
| 802 |
-
background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;
|
| 803 |
-
color: #222222;
|
| 804 |
-
}
|
| 805 |
-
.ui-widget-content a {
|
| 806 |
-
color: #222222;
|
| 807 |
-
}
|
| 808 |
-
.ui-widget-header {
|
| 809 |
-
border: 1px solid #aaaaaa;
|
| 810 |
-
background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;
|
| 811 |
-
color: #222222;
|
| 812 |
-
font-weight: bold;
|
| 813 |
-
}
|
| 814 |
-
.ui-widget-header a {
|
| 815 |
-
color: #222222;
|
| 816 |
-
}
|
| 817 |
-
|
| 818 |
-
/* Interaction states
|
| 819 |
-
----------------------------------*/
|
| 820 |
-
.ui-state-default,
|
| 821 |
-
.ui-widget-content .ui-state-default,
|
| 822 |
-
.ui-widget-header .ui-state-default {
|
| 823 |
-
border: 1px solid #d3d3d3;
|
| 824 |
-
background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;
|
| 825 |
-
font-weight: normal;
|
| 826 |
-
color: #555555;
|
| 827 |
-
}
|
| 828 |
-
.ui-state-default a,
|
| 829 |
-
.ui-state-default a:link,
|
| 830 |
-
.ui-state-default a:visited {
|
| 831 |
-
color: #555555;
|
| 832 |
-
text-decoration: none;
|
| 833 |
-
}
|
| 834 |
-
.ui-state-hover,
|
| 835 |
-
.ui-widget-content .ui-state-hover,
|
| 836 |
-
.ui-widget-header .ui-state-hover,
|
| 837 |
-
.ui-state-focus,
|
| 838 |
-
.ui-widget-content .ui-state-focus,
|
| 839 |
-
.ui-widget-header .ui-state-focus {
|
| 840 |
-
border: 1px solid #999999;
|
| 841 |
-
background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;
|
| 842 |
-
font-weight: normal;
|
| 843 |
-
color: #212121;
|
| 844 |
-
}
|
| 845 |
-
.ui-state-hover a,
|
| 846 |
-
.ui-state-hover a:hover,
|
| 847 |
-
.ui-state-hover a:link,
|
| 848 |
-
.ui-state-hover a:visited {
|
| 849 |
-
color: #212121;
|
| 850 |
-
text-decoration: none;
|
| 851 |
-
}
|
| 852 |
-
.ui-state-active,
|
| 853 |
-
.ui-widget-content .ui-state-active,
|
| 854 |
-
.ui-widget-header .ui-state-active {
|
| 855 |
-
border: 1px solid #aaaaaa;
|
| 856 |
-
background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;
|
| 857 |
-
font-weight: normal;
|
| 858 |
-
color: #212121;
|
| 859 |
-
}
|
| 860 |
-
.ui-state-active a,
|
| 861 |
-
.ui-state-active a:link,
|
| 862 |
-
.ui-state-active a:visited {
|
| 863 |
-
color: #212121;
|
| 864 |
-
text-decoration: none;
|
| 865 |
-
}
|
| 866 |
-
|
| 867 |
-
/* Interaction Cues
|
| 868 |
-
----------------------------------*/
|
| 869 |
-
.ui-state-highlight,
|
| 870 |
-
.ui-widget-content .ui-state-highlight,
|
| 871 |
-
.ui-widget-header .ui-state-highlight {
|
| 872 |
-
border: 1px solid #fcefa1;
|
| 873 |
-
background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;
|
| 874 |
-
color: #363636;
|
| 875 |
-
}
|
| 876 |
-
.ui-state-highlight a,
|
| 877 |
-
.ui-widget-content .ui-state-highlight a,
|
| 878 |
-
.ui-widget-header .ui-state-highlight a {
|
| 879 |
-
color: #363636;
|
| 880 |
-
}
|
| 881 |
-
.ui-state-error,
|
| 882 |
-
.ui-widget-content .ui-state-error,
|
| 883 |
-
.ui-widget-header .ui-state-error {
|
| 884 |
-
border: 1px solid #cd0a0a;
|
| 885 |
-
background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;
|
| 886 |
-
color: #cd0a0a;
|
| 887 |
-
}
|
| 888 |
-
.ui-state-error a,
|
| 889 |
-
.ui-widget-content .ui-state-error a,
|
| 890 |
-
.ui-widget-header .ui-state-error a {
|
| 891 |
-
color: #cd0a0a;
|
| 892 |
-
}
|
| 893 |
-
.ui-state-error-text,
|
| 894 |
-
.ui-widget-content .ui-state-error-text,
|
| 895 |
-
.ui-widget-header .ui-state-error-text {
|
| 896 |
-
color: #cd0a0a;
|
| 897 |
-
}
|
| 898 |
-
.ui-priority-primary,
|
| 899 |
-
.ui-widget-content .ui-priority-primary,
|
| 900 |
-
.ui-widget-header .ui-priority-primary {
|
| 901 |
-
font-weight: bold;
|
| 902 |
-
}
|
| 903 |
-
.ui-priority-secondary,
|
| 904 |
-
.ui-widget-content .ui-priority-secondary,
|
| 905 |
-
.ui-widget-header .ui-priority-secondary {
|
| 906 |
-
opacity: .7;
|
| 907 |
-
filter:Alpha(Opacity=70);
|
| 908 |
-
font-weight: normal;
|
| 909 |
-
}
|
| 910 |
-
.ui-state-disabled,
|
| 911 |
-
.ui-widget-content .ui-state-disabled,
|
| 912 |
-
.ui-widget-header .ui-state-disabled {
|
| 913 |
-
opacity: .35;
|
| 914 |
-
filter:Alpha(Opacity=35);
|
| 915 |
-
background-image: none;
|
| 916 |
-
}
|
| 917 |
-
.ui-state-disabled .ui-icon {
|
| 918 |
-
filter:Alpha(Opacity=35); /* For IE8 - See #6059 */
|
| 919 |
-
}
|
| 920 |
-
|
| 921 |
-
/* Icons
|
| 922 |
-
----------------------------------*/
|
| 923 |
-
|
| 924 |
-
/* states and images */
|
| 925 |
-
.ui-icon {
|
| 926 |
-
width: 16px;
|
| 927 |
-
height: 16px;
|
| 928 |
-
}
|
| 929 |
-
.ui-icon,
|
| 930 |
-
.ui-widget-content .ui-icon {
|
| 931 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 932 |
-
}
|
| 933 |
-
.ui-widget-header .ui-icon {
|
| 934 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 935 |
-
}
|
| 936 |
-
.ui-state-default .ui-icon {
|
| 937 |
-
background-image: url(images/ui-icons_888888_256x240.png);
|
| 938 |
-
}
|
| 939 |
-
.ui-state-hover .ui-icon,
|
| 940 |
-
.ui-state-focus .ui-icon {
|
| 941 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 942 |
-
}
|
| 943 |
-
.ui-state-active .ui-icon {
|
| 944 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 945 |
-
}
|
| 946 |
-
.ui-state-highlight .ui-icon {
|
| 947 |
-
background-image: url(images/ui-icons_2e83ff_256x240.png);
|
| 948 |
-
}
|
| 949 |
-
.ui-state-error .ui-icon,
|
| 950 |
-
.ui-state-error-text .ui-icon {
|
| 951 |
-
background-image: url(images/ui-icons_cd0a0a_256x240.png);
|
| 952 |
-
}
|
| 953 |
-
|
| 954 |
-
/* positioning */
|
| 955 |
-
.ui-icon-blank { background-position: 16px 16px; }
|
| 956 |
-
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 957 |
-
.ui-icon-carat-1-ne { background-position: -16px 0; }
|
| 958 |
-
.ui-icon-carat-1-e { background-position: -32px 0; }
|
| 959 |
-
.ui-icon-carat-1-se { background-position: -48px 0; }
|
| 960 |
-
.ui-icon-carat-1-s { background-position: -64px 0; }
|
| 961 |
-
.ui-icon-carat-1-sw { background-position: -80px 0; }
|
| 962 |
-
.ui-icon-carat-1-w { background-position: -96px 0; }
|
| 963 |
-
.ui-icon-carat-1-nw { background-position: -112px 0; }
|
| 964 |
-
.ui-icon-carat-2-n-s { background-position: -128px 0; }
|
| 965 |
-
.ui-icon-carat-2-e-w { background-position: -144px 0; }
|
| 966 |
-
.ui-icon-triangle-1-n { background-position: 0 -16px; }
|
| 967 |
-
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
|
| 968 |
-
.ui-icon-triangle-1-e { background-position: -32px -16px; }
|
| 969 |
-
.ui-icon-triangle-1-se { background-position: -48px -16px; }
|
| 970 |
-
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
| 971 |
-
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
|
| 972 |
-
.ui-icon-triangle-1-w { background-position: -96px -16px; }
|
| 973 |
-
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
|
| 974 |
-
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
|
| 975 |
-
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
|
| 976 |
-
.ui-icon-arrow-1-n { background-position: 0 -32px; }
|
| 977 |
-
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
|
| 978 |
-
.ui-icon-arrow-1-e { background-position: -32px -32px; }
|
| 979 |
-
.ui-icon-arrow-1-se { background-position: -48px -32px; }
|
| 980 |
-
.ui-icon-arrow-1-s { background-position: -64px -32px; }
|
| 981 |
-
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
|
| 982 |
-
.ui-icon-arrow-1-w { background-position: -96px -32px; }
|
| 983 |
-
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
|
| 984 |
-
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
|
| 985 |
-
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
|
| 986 |
-
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
|
| 987 |
-
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
|
| 988 |
-
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
|
| 989 |
-
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
|
| 990 |
-
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
|
| 991 |
-
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
|
| 992 |
-
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
|
| 993 |
-
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
|
| 994 |
-
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
|
| 995 |
-
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
|
| 996 |
-
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
|
| 997 |
-
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
|
| 998 |
-
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
|
| 999 |
-
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
|
| 1000 |
-
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
|
| 1001 |
-
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
|
| 1002 |
-
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
|
| 1003 |
-
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
|
| 1004 |
-
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
|
| 1005 |
-
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
|
| 1006 |
-
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
|
| 1007 |
-
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
|
| 1008 |
-
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
|
| 1009 |
-
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
|
| 1010 |
-
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
|
| 1011 |
-
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
|
| 1012 |
-
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
|
| 1013 |
-
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
|
| 1014 |
-
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
|
| 1015 |
-
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
|
| 1016 |
-
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
|
| 1017 |
-
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
|
| 1018 |
-
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
|
| 1019 |
-
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
|
| 1020 |
-
.ui-icon-arrow-4 { background-position: 0 -80px; }
|
| 1021 |
-
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
|
| 1022 |
-
.ui-icon-extlink { background-position: -32px -80px; }
|
| 1023 |
-
.ui-icon-newwin { background-position: -48px -80px; }
|
| 1024 |
-
.ui-icon-refresh { background-position: -64px -80px; }
|
| 1025 |
-
.ui-icon-shuffle { background-position: -80px -80px; }
|
| 1026 |
-
.ui-icon-transfer-e-w { background-position: -96px -80px; }
|
| 1027 |
-
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
|
| 1028 |
-
.ui-icon-folder-collapsed { background-position: 0 -96px; }
|
| 1029 |
-
.ui-icon-folder-open { background-position: -16px -96px; }
|
| 1030 |
-
.ui-icon-document { background-position: -32px -96px; }
|
| 1031 |
-
.ui-icon-document-b { background-position: -48px -96px; }
|
| 1032 |
-
.ui-icon-note { background-position: -64px -96px; }
|
| 1033 |
-
.ui-icon-mail-closed { background-position: -80px -96px; }
|
| 1034 |
-
.ui-icon-mail-open { background-position: -96px -96px; }
|
| 1035 |
-
.ui-icon-suitcase { background-position: -112px -96px; }
|
| 1036 |
-
.ui-icon-comment { background-position: -128px -96px; }
|
| 1037 |
-
.ui-icon-person { background-position: -144px -96px; }
|
| 1038 |
-
.ui-icon-print { background-position: -160px -96px; }
|
| 1039 |
-
.ui-icon-trash { background-position: -176px -96px; }
|
| 1040 |
-
.ui-icon-locked { background-position: -192px -96px; }
|
| 1041 |
-
.ui-icon-unlocked { background-position: -208px -96px; }
|
| 1042 |
-
.ui-icon-bookmark { background-position: -224px -96px; }
|
| 1043 |
-
.ui-icon-tag { background-position: -240px -96px; }
|
| 1044 |
-
.ui-icon-home { background-position: 0 -112px; }
|
| 1045 |
-
.ui-icon-flag { background-position: -16px -112px; }
|
| 1046 |
-
.ui-icon-calendar { background-position: -32px -112px; }
|
| 1047 |
-
.ui-icon-cart { background-position: -48px -112px; }
|
| 1048 |
-
.ui-icon-pencil { background-position: -64px -112px; }
|
| 1049 |
-
.ui-icon-clock { background-position: -80px -112px; }
|
| 1050 |
-
.ui-icon-disk { background-position: -96px -112px; }
|
| 1051 |
-
.ui-icon-calculator { background-position: -112px -112px; }
|
| 1052 |
-
.ui-icon-zoomin { background-position: -128px -112px; }
|
| 1053 |
-
.ui-icon-zoomout { background-position: -144px -112px; }
|
| 1054 |
-
.ui-icon-search { background-position: -160px -112px; }
|
| 1055 |
-
.ui-icon-wrench { background-position: -176px -112px; }
|
| 1056 |
-
.ui-icon-gear { background-position: -192px -112px; }
|
| 1057 |
-
.ui-icon-heart { background-position: -208px -112px; }
|
| 1058 |
-
.ui-icon-star { background-position: -224px -112px; }
|
| 1059 |
-
.ui-icon-link { background-position: -240px -112px; }
|
| 1060 |
-
.ui-icon-cancel { background-position: 0 -128px; }
|
| 1061 |
-
.ui-icon-plus { background-position: -16px -128px; }
|
| 1062 |
-
.ui-icon-plusthick { background-position: -32px -128px; }
|
| 1063 |
-
.ui-icon-minus { background-position: -48px -128px; }
|
| 1064 |
-
.ui-icon-minusthick { background-position: -64px -128px; }
|
| 1065 |
-
.ui-icon-close { background-position: -80px -128px; }
|
| 1066 |
-
.ui-icon-closethick { background-position: -96px -128px; }
|
| 1067 |
-
.ui-icon-key { background-position: -112px -128px; }
|
| 1068 |
-
.ui-icon-lightbulb { background-position: -128px -128px; }
|
| 1069 |
-
.ui-icon-scissors { background-position: -144px -128px; }
|
| 1070 |
-
.ui-icon-clipboard { background-position: -160px -128px; }
|
| 1071 |
-
.ui-icon-copy { background-position: -176px -128px; }
|
| 1072 |
-
.ui-icon-contact { background-position: -192px -128px; }
|
| 1073 |
-
.ui-icon-image { background-position: -208px -128px; }
|
| 1074 |
-
.ui-icon-video { background-position: -224px -128px; }
|
| 1075 |
-
.ui-icon-script { background-position: -240px -128px; }
|
| 1076 |
-
.ui-icon-alert { background-position: 0 -144px; }
|
| 1077 |
-
.ui-icon-info { background-position: -16px -144px; }
|
| 1078 |
-
.ui-icon-notice { background-position: -32px -144px; }
|
| 1079 |
-
.ui-icon-help { background-position: -48px -144px; }
|
| 1080 |
-
.ui-icon-check { background-position: -64px -144px; }
|
| 1081 |
-
.ui-icon-bullet { background-position: -80px -144px; }
|
| 1082 |
-
.ui-icon-radio-on { background-position: -96px -144px; }
|
| 1083 |
-
.ui-icon-radio-off { background-position: -112px -144px; }
|
| 1084 |
-
.ui-icon-pin-w { background-position: -128px -144px; }
|
| 1085 |
-
.ui-icon-pin-s { background-position: -144px -144px; }
|
| 1086 |
-
.ui-icon-play { background-position: 0 -160px; }
|
| 1087 |
-
.ui-icon-pause { background-position: -16px -160px; }
|
| 1088 |
-
.ui-icon-seek-next { background-position: -32px -160px; }
|
| 1089 |
-
.ui-icon-seek-prev { background-position: -48px -160px; }
|
| 1090 |
-
.ui-icon-seek-end { background-position: -64px -160px; }
|
| 1091 |
-
.ui-icon-seek-start { background-position: -80px -160px; }
|
| 1092 |
-
/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
|
| 1093 |
-
.ui-icon-seek-first { background-position: -80px -160px; }
|
| 1094 |
-
.ui-icon-stop { background-position: -96px -160px; }
|
| 1095 |
-
.ui-icon-eject { background-position: -112px -160px; }
|
| 1096 |
-
.ui-icon-volume-off { background-position: -128px -160px; }
|
| 1097 |
-
.ui-icon-volume-on { background-position: -144px -160px; }
|
| 1098 |
-
.ui-icon-power { background-position: 0 -176px; }
|
| 1099 |
-
.ui-icon-signal-diag { background-position: -16px -176px; }
|
| 1100 |
-
.ui-icon-signal { background-position: -32px -176px; }
|
| 1101 |
-
.ui-icon-battery-0 { background-position: -48px -176px; }
|
| 1102 |
-
.ui-icon-battery-1 { background-position: -64px -176px; }
|
| 1103 |
-
.ui-icon-battery-2 { background-position: -80px -176px; }
|
| 1104 |
-
.ui-icon-battery-3 { background-position: -96px -176px; }
|
| 1105 |
-
.ui-icon-circle-plus { background-position: 0 -192px; }
|
| 1106 |
-
.ui-icon-circle-minus { background-position: -16px -192px; }
|
| 1107 |
-
.ui-icon-circle-close { background-position: -32px -192px; }
|
| 1108 |
-
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
|
| 1109 |
-
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
|
| 1110 |
-
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
|
| 1111 |
-
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
|
| 1112 |
-
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
|
| 1113 |
-
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
|
| 1114 |
-
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
|
| 1115 |
-
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
|
| 1116 |
-
.ui-icon-circle-zoomin { background-position: -176px -192px; }
|
| 1117 |
-
.ui-icon-circle-zoomout { background-position: -192px -192px; }
|
| 1118 |
-
.ui-icon-circle-check { background-position: -208px -192px; }
|
| 1119 |
-
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
|
| 1120 |
-
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
|
| 1121 |
-
.ui-icon-circlesmall-close { background-position: -32px -208px; }
|
| 1122 |
-
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
|
| 1123 |
-
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
|
| 1124 |
-
.ui-icon-squaresmall-close { background-position: -80px -208px; }
|
| 1125 |
-
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
|
| 1126 |
-
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
|
| 1127 |
-
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
|
| 1128 |
-
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
|
| 1129 |
-
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
| 1130 |
-
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
| 1131 |
-
|
| 1132 |
-
|
| 1133 |
-
/* Misc visuals
|
| 1134 |
-
----------------------------------*/
|
| 1135 |
-
|
| 1136 |
-
/* Corner radius */
|
| 1137 |
-
.ui-corner-all,
|
| 1138 |
-
.ui-corner-top,
|
| 1139 |
-
.ui-corner-left,
|
| 1140 |
-
.ui-corner-tl {
|
| 1141 |
-
border-top-left-radius: 4px;
|
| 1142 |
-
}
|
| 1143 |
-
.ui-corner-all,
|
| 1144 |
-
.ui-corner-top,
|
| 1145 |
-
.ui-corner-right,
|
| 1146 |
-
.ui-corner-tr {
|
| 1147 |
-
border-top-right-radius: 4px;
|
| 1148 |
-
}
|
| 1149 |
-
.ui-corner-all,
|
| 1150 |
-
.ui-corner-bottom,
|
| 1151 |
-
.ui-corner-left,
|
| 1152 |
-
.ui-corner-bl {
|
| 1153 |
-
border-bottom-left-radius: 4px;
|
| 1154 |
-
}
|
| 1155 |
-
.ui-corner-all,
|
| 1156 |
-
.ui-corner-bottom,
|
| 1157 |
-
.ui-corner-right,
|
| 1158 |
-
.ui-corner-br {
|
| 1159 |
-
border-bottom-right-radius: 4px;
|
| 1160 |
-
}
|
| 1161 |
-
|
| 1162 |
-
/* Overlays */
|
| 1163 |
-
.ui-widget-overlay {
|
| 1164 |
-
background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 1165 |
-
opacity: .3;
|
| 1166 |
-
filter: Alpha(Opacity=30);
|
| 1167 |
-
}
|
| 1168 |
-
.ui-widget-shadow {
|
| 1169 |
-
margin: -8px 0 0 -8px;
|
| 1170 |
-
padding: 8px;
|
| 1171 |
-
background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 1172 |
-
opacity: .3;
|
| 1173 |
-
filter: Alpha(Opacity=30);
|
| 1174 |
-
border-radius: 8px;
|
| 1175 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/vendor/jquery-ui/jquery-ui.min.css
DELETED
|
@@ -1,5 +0,0 @@
|
|
| 1 |
-
/*! jQuery UI - v1.10.2 - 2013-03-14
|
| 2 |
-
* http://jqueryui.com
|
| 3 |
-
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css
|
| 4 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 5 |
-
* Copyright 2013 jQuery Foundation and other contributors Licensed MIT */.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table;border-collapse:collapse}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{min-height:0}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-front{z-index:100}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:fixed;top:0;left:0;width:100%;height:100%}.ui-accordion .ui-accordion-header{display:block;cursor:pointer;position:relative;margin-top:2px;padding:.5em .5em .5em .7em;min-height:0}.ui-accordion .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-noicons{padding-left:.7em}.ui-accordion .ui-accordion-icons .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-accordion-header-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;overflow:auto}.ui-autocomplete{position:absolute;top:0;left:0;cursor:default}.ui-button{display:inline-block;position:relative;padding:0;line-height:normal;margin-right:.1em;cursor:pointer;vertical-align:middle;text-align:center;overflow:visible}.ui-button,.ui-button:link,.ui-button:visited,.ui-button:hover,.ui-button:active{text-decoration:none}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:normal}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}input.ui-button::-moz-focus-inner,button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:700;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-dialog{position:absolute;top:0;left:0;padding:.2em;outline:0}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 0;white-space:nowrap;width:90%;overflow:hidden;text-overflow:ellipsis}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:21px;margin:-10px 0 0 0;padding:1px;height:20px}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:0;overflow:auto}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0;background-image:none;margin-top:.5em;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:12px;height:12px;right:-5px;bottom:-5px;background-position:16px 16px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-menu{list-style:none;padding:2px;margin:0;display:block;outline:0}.ui-menu .ui-menu{margin-top:-3px;position:absolute}.ui-menu .ui-menu-item{margin:0;padding:0;width:100%}.ui-menu .ui-menu-divider{margin:5px -2px 5px -2px;height:0;font-size:0;line-height:0;border-width:1px 0 0}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:2px .4em;line-height:1.5;min-height:0;font-weight:400}.ui-menu .ui-menu-item a.ui-state-focus,.ui-menu .ui-menu-item a.ui-state-active{font-weight:400;margin:-1px}.ui-menu .ui-state-disabled{font-weight:400;margin:.4em 0 .2em;line-height:1.5}.ui-menu .ui-state-disabled a{cursor:default}.ui-menu-icons{position:relative}.ui-menu-icons .ui-menu-item a{position:relative;padding-left:2em}.ui-menu .ui-icon{position:absolute;top:.2em;left:.2em}.ui-menu .ui-menu-icon{position:static;float:right}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-progressbar .ui-progressbar-overlay{background:url(images/animated-overlay.gif);height:100%;filter:alpha(opacity=25);opacity:.25}.ui-progressbar-indeterminate .ui-progressbar-value{background-image:none}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted #000}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider.ui-state-disabled .ui-slider-handle,.ui-slider.ui-state-disabled .ui-slider-range{filter:inherit}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle}.ui-spinner-input{border:0;background:0;color:inherit;padding:0;margin:.2em 0;vertical-align:middle;margin-left:.4em;margin-right:22px}.ui-spinner-button{width:16px;height:50%;font-size:.5em;padding:0;margin:0;text-align:center;position:absolute;cursor:default;display:block;overflow:hidden;right:0}.ui-spinner a.ui-spinner-button{border-top:0;border-bottom:0;border-right:0}.ui-spinner .ui-icon{position:absolute;margin-top:-8px;top:50%;left:0}.ui-spinner-up{top:0}.ui-spinner-down{bottom:0}.ui-spinner .ui-icon-triangle-1-s{background-position:-65px -16px}.ui-tabs{position:relative;padding:.2em}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom-width:0;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-active a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-tabs-loading a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:0}.ui-tooltip{padding:8px;position:absolute;z-index:9999;max-width:300px;-webkit-box-shadow:0 0 5px #aaa;box-shadow:0 0 5px #aaa}body .ui-tooltip{border-width:2px}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover,.ui-state-hover a:link,.ui-state-hover a:visited{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-state-disabled .ui-icon{filter:Alpha(Opacity=35)}.ui-icon{width:16px;height:16px}.ui-icon,.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-blank{background-position:16px 16px}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-on{background-position:-96px -144px}.ui-icon-radio-off{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);border-radius:8px}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/css/vendor/jquery-ui/jquery.ui.theme.css
DELETED
|
@@ -1,406 +0,0 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* jQuery UI CSS Framework 1.10.2
|
| 3 |
-
* http://jqueryui.com
|
| 4 |
-
*
|
| 5 |
-
* Copyright 2013 jQuery Foundation and other contributors
|
| 6 |
-
* Released under the MIT license.
|
| 7 |
-
* http://jquery.org/license
|
| 8 |
-
*
|
| 9 |
-
* http://docs.jquery.com/UI/Theming/API
|
| 10 |
-
*
|
| 11 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 12 |
-
*/
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
/* Component containers
|
| 16 |
-
----------------------------------*/
|
| 17 |
-
.ui-widget {
|
| 18 |
-
font-family: Verdana,Arial,sans-serif;
|
| 19 |
-
font-size: 1.1em;
|
| 20 |
-
}
|
| 21 |
-
.ui-widget .ui-widget {
|
| 22 |
-
font-size: 1em;
|
| 23 |
-
}
|
| 24 |
-
.ui-widget input,
|
| 25 |
-
.ui-widget select,
|
| 26 |
-
.ui-widget textarea,
|
| 27 |
-
.ui-widget button {
|
| 28 |
-
font-family: Verdana,Arial,sans-serif;
|
| 29 |
-
font-size: 1em;
|
| 30 |
-
}
|
| 31 |
-
.ui-widget-content {
|
| 32 |
-
border: 1px solid #aaaaaa;
|
| 33 |
-
background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;
|
| 34 |
-
color: #222222;
|
| 35 |
-
}
|
| 36 |
-
.ui-widget-content a {
|
| 37 |
-
color: #222222;
|
| 38 |
-
}
|
| 39 |
-
.ui-widget-header {
|
| 40 |
-
border: 1px solid #aaaaaa;
|
| 41 |
-
background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;
|
| 42 |
-
color: #222222;
|
| 43 |
-
font-weight: bold;
|
| 44 |
-
}
|
| 45 |
-
.ui-widget-header a {
|
| 46 |
-
color: #222222;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/* Interaction states
|
| 50 |
-
----------------------------------*/
|
| 51 |
-
.ui-state-default,
|
| 52 |
-
.ui-widget-content .ui-state-default,
|
| 53 |
-
.ui-widget-header .ui-state-default {
|
| 54 |
-
border: 1px solid #d3d3d3;
|
| 55 |
-
background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;
|
| 56 |
-
font-weight: normal;
|
| 57 |
-
color: #555555;
|
| 58 |
-
}
|
| 59 |
-
.ui-state-default a,
|
| 60 |
-
.ui-state-default a:link,
|
| 61 |
-
.ui-state-default a:visited {
|
| 62 |
-
color: #555555;
|
| 63 |
-
text-decoration: none;
|
| 64 |
-
}
|
| 65 |
-
.ui-state-hover,
|
| 66 |
-
.ui-widget-content .ui-state-hover,
|
| 67 |
-
.ui-widget-header .ui-state-hover,
|
| 68 |
-
.ui-state-focus,
|
| 69 |
-
.ui-widget-content .ui-state-focus,
|
| 70 |
-
.ui-widget-header .ui-state-focus {
|
| 71 |
-
border: 1px solid #999999;
|
| 72 |
-
background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;
|
| 73 |
-
font-weight: normal;
|
| 74 |
-
color: #212121;
|
| 75 |
-
}
|
| 76 |
-
.ui-state-hover a,
|
| 77 |
-
.ui-state-hover a:hover,
|
| 78 |
-
.ui-state-hover a:link,
|
| 79 |
-
.ui-state-hover a:visited {
|
| 80 |
-
color: #212121;
|
| 81 |
-
text-decoration: none;
|
| 82 |
-
}
|
| 83 |
-
.ui-state-active,
|
| 84 |
-
.ui-widget-content .ui-state-active,
|
| 85 |
-
.ui-widget-header .ui-state-active {
|
| 86 |
-
border: 1px solid #aaaaaa;
|
| 87 |
-
background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;
|
| 88 |
-
font-weight: normal;
|
| 89 |
-
color: #212121;
|
| 90 |
-
}
|
| 91 |
-
.ui-state-active a,
|
| 92 |
-
.ui-state-active a:link,
|
| 93 |
-
.ui-state-active a:visited {
|
| 94 |
-
color: #212121;
|
| 95 |
-
text-decoration: none;
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/* Interaction Cues
|
| 99 |
-
----------------------------------*/
|
| 100 |
-
.ui-state-highlight,
|
| 101 |
-
.ui-widget-content .ui-state-highlight,
|
| 102 |
-
.ui-widget-header .ui-state-highlight {
|
| 103 |
-
border: 1px solid #fcefa1;
|
| 104 |
-
background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;
|
| 105 |
-
color: #363636;
|
| 106 |
-
}
|
| 107 |
-
.ui-state-highlight a,
|
| 108 |
-
.ui-widget-content .ui-state-highlight a,
|
| 109 |
-
.ui-widget-header .ui-state-highlight a {
|
| 110 |
-
color: #363636;
|
| 111 |
-
}
|
| 112 |
-
.ui-state-error,
|
| 113 |
-
.ui-widget-content .ui-state-error,
|
| 114 |
-
.ui-widget-header .ui-state-error {
|
| 115 |
-
border: 1px solid #cd0a0a;
|
| 116 |
-
background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;
|
| 117 |
-
color: #cd0a0a;
|
| 118 |
-
}
|
| 119 |
-
.ui-state-error a,
|
| 120 |
-
.ui-widget-content .ui-state-error a,
|
| 121 |
-
.ui-widget-header .ui-state-error a {
|
| 122 |
-
color: #cd0a0a;
|
| 123 |
-
}
|
| 124 |
-
.ui-state-error-text,
|
| 125 |
-
.ui-widget-content .ui-state-error-text,
|
| 126 |
-
.ui-widget-header .ui-state-error-text {
|
| 127 |
-
color: #cd0a0a;
|
| 128 |
-
}
|
| 129 |
-
.ui-priority-primary,
|
| 130 |
-
.ui-widget-content .ui-priority-primary,
|
| 131 |
-
.ui-widget-header .ui-priority-primary {
|
| 132 |
-
font-weight: bold;
|
| 133 |
-
}
|
| 134 |
-
.ui-priority-secondary,
|
| 135 |
-
.ui-widget-content .ui-priority-secondary,
|
| 136 |
-
.ui-widget-header .ui-priority-secondary {
|
| 137 |
-
opacity: .7;
|
| 138 |
-
filter:Alpha(Opacity=70);
|
| 139 |
-
font-weight: normal;
|
| 140 |
-
}
|
| 141 |
-
.ui-state-disabled,
|
| 142 |
-
.ui-widget-content .ui-state-disabled,
|
| 143 |
-
.ui-widget-header .ui-state-disabled {
|
| 144 |
-
opacity: .35;
|
| 145 |
-
filter:Alpha(Opacity=35);
|
| 146 |
-
background-image: none;
|
| 147 |
-
}
|
| 148 |
-
.ui-state-disabled .ui-icon {
|
| 149 |
-
filter:Alpha(Opacity=35); /* For IE8 - See #6059 */
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
/* Icons
|
| 153 |
-
----------------------------------*/
|
| 154 |
-
|
| 155 |
-
/* states and images */
|
| 156 |
-
.ui-icon {
|
| 157 |
-
width: 16px;
|
| 158 |
-
height: 16px;
|
| 159 |
-
}
|
| 160 |
-
.ui-icon,
|
| 161 |
-
.ui-widget-content .ui-icon {
|
| 162 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 163 |
-
}
|
| 164 |
-
.ui-widget-header .ui-icon {
|
| 165 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 166 |
-
}
|
| 167 |
-
.ui-state-default .ui-icon {
|
| 168 |
-
background-image: url(images/ui-icons_888888_256x240.png);
|
| 169 |
-
}
|
| 170 |
-
.ui-state-hover .ui-icon,
|
| 171 |
-
.ui-state-focus .ui-icon {
|
| 172 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 173 |
-
}
|
| 174 |
-
.ui-state-active .ui-icon {
|
| 175 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 176 |
-
}
|
| 177 |
-
.ui-state-highlight .ui-icon {
|
| 178 |
-
background-image: url(images/ui-icons_2e83ff_256x240.png);
|
| 179 |
-
}
|
| 180 |
-
.ui-state-error .ui-icon,
|
| 181 |
-
.ui-state-error-text .ui-icon {
|
| 182 |
-
background-image: url(images/ui-icons_cd0a0a_256x240.png);
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
/* positioning */
|
| 186 |
-
.ui-icon-blank { background-position: 16px 16px; }
|
| 187 |
-
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 188 |
-
.ui-icon-carat-1-ne { background-position: -16px 0; }
|
| 189 |
-
.ui-icon-carat-1-e { background-position: -32px 0; }
|
| 190 |
-
.ui-icon-carat-1-se { background-position: -48px 0; }
|
| 191 |
-
.ui-icon-carat-1-s { background-position: -64px 0; }
|
| 192 |
-
.ui-icon-carat-1-sw { background-position: -80px 0; }
|
| 193 |
-
.ui-icon-carat-1-w { background-position: -96px 0; }
|
| 194 |
-
.ui-icon-carat-1-nw { background-position: -112px 0; }
|
| 195 |
-
.ui-icon-carat-2-n-s { background-position: -128px 0; }
|
| 196 |
-
.ui-icon-carat-2-e-w { background-position: -144px 0; }
|
| 197 |
-
.ui-icon-triangle-1-n { background-position: 0 -16px; }
|
| 198 |
-
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
|
| 199 |
-
.ui-icon-triangle-1-e { background-position: -32px -16px; }
|
| 200 |
-
.ui-icon-triangle-1-se { background-position: -48px -16px; }
|
| 201 |
-
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
| 202 |
-
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
|
| 203 |
-
.ui-icon-triangle-1-w { background-position: -96px -16px; }
|
| 204 |
-
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
|
| 205 |
-
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
|
| 206 |
-
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
|
| 207 |
-
.ui-icon-arrow-1-n { background-position: 0 -32px; }
|
| 208 |
-
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
|
| 209 |
-
.ui-icon-arrow-1-e { background-position: -32px -32px; }
|
| 210 |
-
.ui-icon-arrow-1-se { background-position: -48px -32px; }
|
| 211 |
-
.ui-icon-arrow-1-s { background-position: -64px -32px; }
|
| 212 |
-
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
|
| 213 |
-
.ui-icon-arrow-1-w { background-position: -96px -32px; }
|
| 214 |
-
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
|
| 215 |
-
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
|
| 216 |
-
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
|
| 217 |
-
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
|
| 218 |
-
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
|
| 219 |
-
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
|
| 220 |
-
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
|
| 221 |
-
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
|
| 222 |
-
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
|
| 223 |
-
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
|
| 224 |
-
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
|
| 225 |
-
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
|
| 226 |
-
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
|
| 227 |
-
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
|
| 228 |
-
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
|
| 229 |
-
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
|
| 230 |
-
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
|
| 231 |
-
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
|
| 232 |
-
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
|
| 233 |
-
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
|
| 234 |
-
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
|
| 235 |
-
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
|
| 236 |
-
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
|
| 237 |
-
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
|
| 238 |
-
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
|
| 239 |
-
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
|
| 240 |
-
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
|
| 241 |
-
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
|
| 242 |
-
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
|
| 243 |
-
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
|
| 244 |
-
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
|
| 245 |
-
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
|
| 246 |
-
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
|
| 247 |
-
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
|
| 248 |
-
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
|
| 249 |
-
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
|
| 250 |
-
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
|
| 251 |
-
.ui-icon-arrow-4 { background-position: 0 -80px; }
|
| 252 |
-
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
|
| 253 |
-
.ui-icon-extlink { background-position: -32px -80px; }
|
| 254 |
-
.ui-icon-newwin { background-position: -48px -80px; }
|
| 255 |
-
.ui-icon-refresh { background-position: -64px -80px; }
|
| 256 |
-
.ui-icon-shuffle { background-position: -80px -80px; }
|
| 257 |
-
.ui-icon-transfer-e-w { background-position: -96px -80px; }
|
| 258 |
-
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
|
| 259 |
-
.ui-icon-folder-collapsed { background-position: 0 -96px; }
|
| 260 |
-
.ui-icon-folder-open { background-position: -16px -96px; }
|
| 261 |
-
.ui-icon-document { background-position: -32px -96px; }
|
| 262 |
-
.ui-icon-document-b { background-position: -48px -96px; }
|
| 263 |
-
.ui-icon-note { background-position: -64px -96px; }
|
| 264 |
-
.ui-icon-mail-closed { background-position: -80px -96px; }
|
| 265 |
-
.ui-icon-mail-open { background-position: -96px -96px; }
|
| 266 |
-
.ui-icon-suitcase { background-position: -112px -96px; }
|
| 267 |
-
.ui-icon-comment { background-position: -128px -96px; }
|
| 268 |
-
.ui-icon-person { background-position: -144px -96px; }
|
| 269 |
-
.ui-icon-print { background-position: -160px -96px; }
|
| 270 |
-
.ui-icon-trash { background-position: -176px -96px; }
|
| 271 |
-
.ui-icon-locked { background-position: -192px -96px; }
|
| 272 |
-
.ui-icon-unlocked { background-position: -208px -96px; }
|
| 273 |
-
.ui-icon-bookmark { background-position: -224px -96px; }
|
| 274 |
-
.ui-icon-tag { background-position: -240px -96px; }
|
| 275 |
-
.ui-icon-home { background-position: 0 -112px; }
|
| 276 |
-
.ui-icon-flag { background-position: -16px -112px; }
|
| 277 |
-
.ui-icon-calendar { background-position: -32px -112px; }
|
| 278 |
-
.ui-icon-cart { background-position: -48px -112px; }
|
| 279 |
-
.ui-icon-pencil { background-position: -64px -112px; }
|
| 280 |
-
.ui-icon-clock { background-position: -80px -112px; }
|
| 281 |
-
.ui-icon-disk { background-position: -96px -112px; }
|
| 282 |
-
.ui-icon-calculator { background-position: -112px -112px; }
|
| 283 |
-
.ui-icon-zoomin { background-position: -128px -112px; }
|
| 284 |
-
.ui-icon-zoomout { background-position: -144px -112px; }
|
| 285 |
-
.ui-icon-search { background-position: -160px -112px; }
|
| 286 |
-
.ui-icon-wrench { background-position: -176px -112px; }
|
| 287 |
-
.ui-icon-gear { background-position: -192px -112px; }
|
| 288 |
-
.ui-icon-heart { background-position: -208px -112px; }
|
| 289 |
-
.ui-icon-star { background-position: -224px -112px; }
|
| 290 |
-
.ui-icon-link { background-position: -240px -112px; }
|
| 291 |
-
.ui-icon-cancel { background-position: 0 -128px; }
|
| 292 |
-
.ui-icon-plus { background-position: -16px -128px; }
|
| 293 |
-
.ui-icon-plusthick { background-position: -32px -128px; }
|
| 294 |
-
.ui-icon-minus { background-position: -48px -128px; }
|
| 295 |
-
.ui-icon-minusthick { background-position: -64px -128px; }
|
| 296 |
-
.ui-icon-close { background-position: -80px -128px; }
|
| 297 |
-
.ui-icon-closethick { background-position: -96px -128px; }
|
| 298 |
-
.ui-icon-key { background-position: -112px -128px; }
|
| 299 |
-
.ui-icon-lightbulb { background-position: -128px -128px; }
|
| 300 |
-
.ui-icon-scissors { background-position: -144px -128px; }
|
| 301 |
-
.ui-icon-clipboard { background-position: -160px -128px; }
|
| 302 |
-
.ui-icon-copy { background-position: -176px -128px; }
|
| 303 |
-
.ui-icon-contact { background-position: -192px -128px; }
|
| 304 |
-
.ui-icon-image { background-position: -208px -128px; }
|
| 305 |
-
.ui-icon-video { background-position: -224px -128px; }
|
| 306 |
-
.ui-icon-script { background-position: -240px -128px; }
|
| 307 |
-
.ui-icon-alert { background-position: 0 -144px; }
|
| 308 |
-
.ui-icon-info { background-position: -16px -144px; }
|
| 309 |
-
.ui-icon-notice { background-position: -32px -144px; }
|
| 310 |
-
.ui-icon-help { background-position: -48px -144px; }
|
| 311 |
-
.ui-icon-check { background-position: -64px -144px; }
|
| 312 |
-
.ui-icon-bullet { background-position: -80px -144px; }
|
| 313 |
-
.ui-icon-radio-on { background-position: -96px -144px; }
|
| 314 |
-
.ui-icon-radio-off { background-position: -112px -144px; }
|
| 315 |
-
.ui-icon-pin-w { background-position: -128px -144px; }
|
| 316 |
-
.ui-icon-pin-s { background-position: -144px -144px; }
|
| 317 |
-
.ui-icon-play { background-position: 0 -160px; }
|
| 318 |
-
.ui-icon-pause { background-position: -16px -160px; }
|
| 319 |
-
.ui-icon-seek-next { background-position: -32px -160px; }
|
| 320 |
-
.ui-icon-seek-prev { background-position: -48px -160px; }
|
| 321 |
-
.ui-icon-seek-end { background-position: -64px -160px; }
|
| 322 |
-
.ui-icon-seek-start { background-position: -80px -160px; }
|
| 323 |
-
/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
|
| 324 |
-
.ui-icon-seek-first { background-position: -80px -160px; }
|
| 325 |
-
.ui-icon-stop { background-position: -96px -160px; }
|
| 326 |
-
.ui-icon-eject { background-position: -112px -160px; }
|
| 327 |
-
.ui-icon-volume-off { background-position: -128px -160px; }
|
| 328 |
-
.ui-icon-volume-on { background-position: -144px -160px; }
|
| 329 |
-
.ui-icon-power { background-position: 0 -176px; }
|
| 330 |
-
.ui-icon-signal-diag { background-position: -16px -176px; }
|
| 331 |
-
.ui-icon-signal { background-position: -32px -176px; }
|
| 332 |
-
.ui-icon-battery-0 { background-position: -48px -176px; }
|
| 333 |
-
.ui-icon-battery-1 { background-position: -64px -176px; }
|
| 334 |
-
.ui-icon-battery-2 { background-position: -80px -176px; }
|
| 335 |
-
.ui-icon-battery-3 { background-position: -96px -176px; }
|
| 336 |
-
.ui-icon-circle-plus { background-position: 0 -192px; }
|
| 337 |
-
.ui-icon-circle-minus { background-position: -16px -192px; }
|
| 338 |
-
.ui-icon-circle-close { background-position: -32px -192px; }
|
| 339 |
-
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
|
| 340 |
-
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
|
| 341 |
-
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
|
| 342 |
-
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
|
| 343 |
-
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
|
| 344 |
-
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
|
| 345 |
-
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
|
| 346 |
-
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
|
| 347 |
-
.ui-icon-circle-zoomin { background-position: -176px -192px; }
|
| 348 |
-
.ui-icon-circle-zoomout { background-position: -192px -192px; }
|
| 349 |
-
.ui-icon-circle-check { background-position: -208px -192px; }
|
| 350 |
-
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
|
| 351 |
-
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
|
| 352 |
-
.ui-icon-circlesmall-close { background-position: -32px -208px; }
|
| 353 |
-
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
|
| 354 |
-
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
|
| 355 |
-
.ui-icon-squaresmall-close { background-position: -80px -208px; }
|
| 356 |
-
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
|
| 357 |
-
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
|
| 358 |
-
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
|
| 359 |
-
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
|
| 360 |
-
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
| 361 |
-
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
/* Misc visuals
|
| 365 |
-
----------------------------------*/
|
| 366 |
-
|
| 367 |
-
/* Corner radius */
|
| 368 |
-
.ui-corner-all,
|
| 369 |
-
.ui-corner-top,
|
| 370 |
-
.ui-corner-left,
|
| 371 |
-
.ui-corner-tl {
|
| 372 |
-
border-top-left-radius: 4px;
|
| 373 |
-
}
|
| 374 |
-
.ui-corner-all,
|
| 375 |
-
.ui-corner-top,
|
| 376 |
-
.ui-corner-right,
|
| 377 |
-
.ui-corner-tr {
|
| 378 |
-
border-top-right-radius: 4px;
|
| 379 |
-
}
|
| 380 |
-
.ui-corner-all,
|
| 381 |
-
.ui-corner-bottom,
|
| 382 |
-
.ui-corner-left,
|
| 383 |
-
.ui-corner-bl {
|
| 384 |
-
border-bottom-left-radius: 4px;
|
| 385 |
-
}
|
| 386 |
-
.ui-corner-all,
|
| 387 |
-
.ui-corner-bottom,
|
| 388 |
-
.ui-corner-right,
|
| 389 |
-
.ui-corner-br {
|
| 390 |
-
border-bottom-right-radius: 4px;
|
| 391 |
-
}
|
| 392 |
-
|
| 393 |
-
/* Overlays */
|
| 394 |
-
.ui-widget-overlay {
|
| 395 |
-
background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 396 |
-
opacity: .3;
|
| 397 |
-
filter: Alpha(Opacity=30);
|
| 398 |
-
}
|
| 399 |
-
.ui-widget-shadow {
|
| 400 |
-
margin: -8px 0 0 -8px;
|
| 401 |
-
padding: 8px;
|
| 402 |
-
background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;
|
| 403 |
-
opacity: .3;
|
| 404 |
-
filter: Alpha(Opacity=30);
|
| 405 |
-
border-radius: 8px;
|
| 406 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/custom-meta-boxes.php
DELETED
|
@@ -1,136 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! defined( 'drkfr_DEV') )
|
| 3 |
-
define( 'drkfr_DEV', false );
|
| 4 |
-
|
| 5 |
-
if ( ! defined( 'drkfr_PATH') )
|
| 6 |
-
define( 'drkfr_PATH', plugin_dir_path( __FILE__ ) );
|
| 7 |
-
|
| 8 |
-
if ( ! defined( 'drkfr_URL' ) )
|
| 9 |
-
define( 'drkfr_URL', plugins_url( '', __FILE__ ) );
|
| 10 |
-
|
| 11 |
-
include_once( drkfr_PATH . '/classes.fields.php' );
|
| 12 |
-
include_once( drkfr_PATH . '/class.drkfr-meta-box.php' );
|
| 13 |
-
|
| 14 |
-
// Make it possible to add fields in locations other than post edit screen.
|
| 15 |
-
include_once( drkfr_PATH . '/fields-anywhere.php' );
|
| 16 |
-
|
| 17 |
-
// include_once( drkfr_PATH . '/example-functions.php' );
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* Get all the meta boxes on init
|
| 21 |
-
*
|
| 22 |
-
* @return null
|
| 23 |
-
*/
|
| 24 |
-
function drkfr_init() {
|
| 25 |
-
|
| 26 |
-
if ( ! is_admin() )
|
| 27 |
-
return;
|
| 28 |
-
|
| 29 |
-
// Load translations
|
| 30 |
-
$textdomain = 'drkfr';
|
| 31 |
-
$locale = apply_filters( 'plugin_locale', get_locale(), $textdomain );
|
| 32 |
-
|
| 33 |
-
// By default, try to load language files from /wp-content/languages/custom-meta-boxes/
|
| 34 |
-
load_textdomain( $textdomain, WP_LANG_DIR . '/custom-meta-boxes/' . $textdomain . '-' . $locale . '.mo' );
|
| 35 |
-
load_textdomain( $textdomain, drkfr_PATH . '/languages/' . $textdomain . '-' . $locale . '.mo' );
|
| 36 |
-
|
| 37 |
-
$meta_boxes = apply_filters( 'drkfr_meta_boxes', array() );
|
| 38 |
-
|
| 39 |
-
if ( ! empty( $meta_boxes ) )
|
| 40 |
-
foreach ( $meta_boxes as $meta_box )
|
| 41 |
-
new drkfr_Meta_Box( $meta_box );
|
| 42 |
-
|
| 43 |
-
}
|
| 44 |
-
add_action( 'init', 'drkfr_init', 50 );
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Return an array of built in available fields
|
| 48 |
-
*
|
| 49 |
-
* Key is field name, Value is class used by field.
|
| 50 |
-
* Available fields can be modified using the 'drkfr_field_types' filter.
|
| 51 |
-
*
|
| 52 |
-
* @return array
|
| 53 |
-
*/
|
| 54 |
-
function _drkfr_available_fields() {
|
| 55 |
-
|
| 56 |
-
return apply_filters( 'drkfr_field_types', array(
|
| 57 |
-
'text' => 'drkfr_Text_Field',
|
| 58 |
-
'text_small' => 'drkfr_Text_Small_Field',
|
| 59 |
-
'text_url' => 'drkfr_URL_Field',
|
| 60 |
-
'url' => 'drkfr_URL_Field',
|
| 61 |
-
'radio' => 'drkfr_Radio_Field',
|
| 62 |
-
'checkbox' => 'drkfr_Checkbox',
|
| 63 |
-
'file' => 'drkfr_File_Field',
|
| 64 |
-
'image' => 'drkfr_Image_Field',
|
| 65 |
-
'wysiwyg' => 'drkfr_wysiwyg',
|
| 66 |
-
'textarea' => 'drkfr_Textarea_Field',
|
| 67 |
-
'textarea_code' => 'drkfr_Textarea_Field_Code',
|
| 68 |
-
'select' => 'drkfr_Select',
|
| 69 |
-
'taxonomy_select' => 'drkfr_Taxonomy',
|
| 70 |
-
'post_select' => 'drkfr_Post_Select',
|
| 71 |
-
'date' => 'drkfr_Date_Field',
|
| 72 |
-
'date_unix' => 'drkfr_Date_Timestamp_Field',
|
| 73 |
-
'datetime_unix' => 'drkfr_Datetime_Timestamp_Field',
|
| 74 |
-
'time' => 'drkfr_Time_Field',
|
| 75 |
-
'colorpicker' => 'drkfr_Color_Picker',
|
| 76 |
-
'title' => 'drkfr_Title',
|
| 77 |
-
'group' => 'drkfr_Group_Field',
|
| 78 |
-
'gmap' => 'drkfr_Gmap_Field',
|
| 79 |
-
) );
|
| 80 |
-
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* Get a field class by type
|
| 85 |
-
*
|
| 86 |
-
* @param string $type
|
| 87 |
-
* @return string $class, or false if not found.
|
| 88 |
-
*/
|
| 89 |
-
function _drkfr_field_class_for_type( $type ) {
|
| 90 |
-
|
| 91 |
-
$map = _drkfr_available_fields();
|
| 92 |
-
|
| 93 |
-
if ( isset( $map[$type] ) )
|
| 94 |
-
return $map[$type];
|
| 95 |
-
|
| 96 |
-
return false;
|
| 97 |
-
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* For the order of repeatable fields to be guaranteed, orderby meta_id needs to be set.
|
| 102 |
-
* Note usermeta has a different meta_id column name.
|
| 103 |
-
*
|
| 104 |
-
* Only do this for older versions as meta is now ordered by ID (since 3.8)
|
| 105 |
-
* See http://core.trac.wordpress.org/ticket/25511
|
| 106 |
-
*
|
| 107 |
-
* @param string $query
|
| 108 |
-
* @return string $query
|
| 109 |
-
*/
|
| 110 |
-
function drkfr_fix_meta_query_order($query) {
|
| 111 |
-
|
| 112 |
-
$pattern = '/^SELECT (post_id|user_id), meta_key, meta_value FROM \w* WHERE post_id IN \([\d|,]*\)$/';
|
| 113 |
-
|
| 114 |
-
if (
|
| 115 |
-
0 === strpos( $query, "SELECT post_id, meta_key, meta_value" ) &&
|
| 116 |
-
preg_match( $pattern, $query, $matches )
|
| 117 |
-
) {
|
| 118 |
-
|
| 119 |
-
if ( isset( $matches[1] ) && 'user_id' == $matches[1] )
|
| 120 |
-
$meta_id_column = 'umeta_id';
|
| 121 |
-
else
|
| 122 |
-
$meta_id_column = 'meta_id';
|
| 123 |
-
|
| 124 |
-
$meta_query_orderby = ' ORDER BY ' . $meta_id_column;
|
| 125 |
-
|
| 126 |
-
if ( false === strpos( $query, $meta_query_orderby ) )
|
| 127 |
-
$query .= $meta_query_orderby;
|
| 128 |
-
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
return $query;
|
| 132 |
-
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
if ( version_compare( get_bloginfo( 'version' ), '3.8', '<' ) )
|
| 136 |
-
add_filter( 'query', 'drkfr_fix_meta_query_order', 1 );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/fields-anywhere.php
DELETED
|
@@ -1,92 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/**
|
| 4 |
-
* Create drkfr Meta boxes anywhere you like (other than the post edit screen).
|
| 5 |
-
*
|
| 6 |
-
* This is functional, but a little hacky.
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Draw the meta boxes in places other than the post edit screen
|
| 11 |
-
*
|
| 12 |
-
* @return null
|
| 13 |
-
*/
|
| 14 |
-
function drkfr_draw_meta_boxes( $pages, $context = 'normal', $object = null ) {
|
| 15 |
-
|
| 16 |
-
drkfr_do_meta_boxes( $pages, $context, $object );
|
| 17 |
-
|
| 18 |
-
wp_enqueue_script('post');
|
| 19 |
-
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Meta-Box template function
|
| 24 |
-
*
|
| 25 |
-
* @since 2.5.0
|
| 26 |
-
*
|
| 27 |
-
* @param string|object $screen Screen identifier
|
| 28 |
-
* @param string $context box context
|
| 29 |
-
* @param mixed $object gets passed to the box callback function as first parameter
|
| 30 |
-
* @return int number of meta_boxes
|
| 31 |
-
*/
|
| 32 |
-
function drkfr_do_meta_boxes( $screen, $context, $object ) {
|
| 33 |
-
|
| 34 |
-
global $wp_meta_boxes;
|
| 35 |
-
|
| 36 |
-
static $already_sorted = false;
|
| 37 |
-
|
| 38 |
-
if ( empty( $screen ) )
|
| 39 |
-
$screen = get_current_screen();
|
| 40 |
-
|
| 41 |
-
elseif ( is_string( $screen ) )
|
| 42 |
-
$screen = convert_to_screen( $screen );
|
| 43 |
-
|
| 44 |
-
$page = $screen->id;
|
| 45 |
-
|
| 46 |
-
$hidden = get_hidden_meta_boxes( $screen );
|
| 47 |
-
|
| 48 |
-
$i = 0;
|
| 49 |
-
|
| 50 |
-
do {
|
| 51 |
-
// Grab the ones the user has manually sorted. Pull them out of their previous context/priority and into the one the user chose
|
| 52 |
-
|
| 53 |
-
if ( ! $already_sorted && $sorted = get_user_option( "meta-box-order_$page" ) )
|
| 54 |
-
foreach ( $sorted as $box_context => $ids )
|
| 55 |
-
foreach ( explode(',', $ids ) as $id )
|
| 56 |
-
if ( $id && 'dashboard_browser_nag' !== $id )
|
| 57 |
-
add_meta_box( $id, null, null, $screen, $box_context, 'sorted' );
|
| 58 |
-
|
| 59 |
-
$already_sorted = true;
|
| 60 |
-
|
| 61 |
-
if ( ! isset( $wp_meta_boxes ) || ! isset( $wp_meta_boxes[$page] ) || ! isset( $wp_meta_boxes[$page][$context] ) )
|
| 62 |
-
break;
|
| 63 |
-
|
| 64 |
-
foreach ( array( 'high', 'sorted', 'core', 'default', 'low' ) as $priority ) {
|
| 65 |
-
|
| 66 |
-
if ( isset( $wp_meta_boxes[$page][$context][$priority] ) ) {
|
| 67 |
-
|
| 68 |
-
foreach ( (array) $wp_meta_boxes[$page][$context][$priority] as $box ) {
|
| 69 |
-
|
| 70 |
-
if ( false == $box || ! $box['title'] )
|
| 71 |
-
continue;
|
| 72 |
-
|
| 73 |
-
$i++;
|
| 74 |
-
|
| 75 |
-
$hidden_class = in_array($box['id'], $hidden) ? ' hide-if-js' : ''; ?>
|
| 76 |
-
|
| 77 |
-
<div id="<?php esc_attr_e( $box['id'] ); ?>" class="<?php esc_attr_e( postbox_classes( $box['id'], $page ) . $hidden_class ); ?>">
|
| 78 |
-
|
| 79 |
-
<?php call_user_func( $box['callback'], $object, $box ); ?>
|
| 80 |
-
|
| 81 |
-
</div>
|
| 82 |
-
|
| 83 |
-
<?php }
|
| 84 |
-
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
}
|
| 88 |
-
} while( 0 );
|
| 89 |
-
|
| 90 |
-
return $i;
|
| 91 |
-
|
| 92 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/images/drkfr-icon-remove.png
DELETED
|
Binary file
|
drkfr/images/drkfr-icon-remove@2x.png
DELETED
|
Binary file
|
drkfr/images/wpspin-2x.gif
DELETED
|
Binary file
|
drkfr/images/wpspin.gif
DELETED
|
Binary file
|
drkfr/js/drkfr.js
DELETED
|
@@ -1,315 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Custom jQuery for Custom Metaboxes and Fields
|
| 3 |
-
*/
|
| 4 |
-
|
| 5 |
-
/*jslint browser: true, devel: true, indent: 4, maxerr: 50, sub: true */
|
| 6 |
-
/*global jQuery, tb_show, tb_remove */
|
| 7 |
-
|
| 8 |
-
'use strict';
|
| 9 |
-
|
| 10 |
-
var drkfr = {
|
| 11 |
-
|
| 12 |
-
_initCallbacks: [],
|
| 13 |
-
_clonedFieldCallbacks: [],
|
| 14 |
-
_deletedFieldCallbacks: [],
|
| 15 |
-
|
| 16 |
-
_sortStartCallbacks: [],
|
| 17 |
-
_sortEndCallbacks: [],
|
| 18 |
-
|
| 19 |
-
init : function() {
|
| 20 |
-
|
| 21 |
-
jQuery( '.field.repeatable' ).each( function() {
|
| 22 |
-
drkfr.isMaxFields( jQuery(this) );
|
| 23 |
-
} );
|
| 24 |
-
|
| 25 |
-
// Unbind & Re-bind all drkfr events to prevent duplicates.
|
| 26 |
-
jQuery(document).unbind( 'click.drkfr' );
|
| 27 |
-
jQuery(document).on( 'click.drkfr', '.drkfr-delete-field', drkfr.deleteField );
|
| 28 |
-
jQuery(document).on( 'click.drkfr', '.repeat-field', drkfr.repeatField );
|
| 29 |
-
|
| 30 |
-
// When toggling the display of the meta box container - reinitialize
|
| 31 |
-
jQuery(document).on( 'click.drkfr', '.postbox h3, .postbox .handlediv', drkfr.init );
|
| 32 |
-
|
| 33 |
-
drkfr.doneInit();
|
| 34 |
-
|
| 35 |
-
jQuery('.field.drkfr-sortable' ).each( function() {
|
| 36 |
-
drkfr.sortableInit( jQuery(this) );
|
| 37 |
-
} );
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
},
|
| 41 |
-
|
| 42 |
-
repeatField : function( e ) {
|
| 43 |
-
|
| 44 |
-
var templateField, newT, field, index, attr;
|
| 45 |
-
|
| 46 |
-
field = jQuery( this ).closest('.field' );
|
| 47 |
-
|
| 48 |
-
e.preventDefault();
|
| 49 |
-
jQuery(this).blur();
|
| 50 |
-
|
| 51 |
-
if ( drkfr.isMaxFields( field, 1 ) )
|
| 52 |
-
return;
|
| 53 |
-
|
| 54 |
-
templateField = field.children( '.field-item.hidden' );
|
| 55 |
-
|
| 56 |
-
newT = templateField.clone();
|
| 57 |
-
newT.removeClass( 'hidden' );
|
| 58 |
-
|
| 59 |
-
var excludeInputTypes = '[type=submit],[type=button],[type=checkbox],[type=radio],[readonly]';
|
| 60 |
-
newT.find( 'input' ).not( excludeInputTypes ).val( '' );
|
| 61 |
-
|
| 62 |
-
newT.find( '.drkfr_upload_status' ).html('');
|
| 63 |
-
|
| 64 |
-
newT.insertBefore( templateField );
|
| 65 |
-
|
| 66 |
-
// Recalculate group ids & update the name fields..
|
| 67 |
-
index = 0;
|
| 68 |
-
attr = ['id','name','for','data-id','data-name'];
|
| 69 |
-
|
| 70 |
-
field.children( '.field-item' ).not( templateField ).each( function() {
|
| 71 |
-
|
| 72 |
-
var search = field.hasClass( 'drkfr_Group_Field' ) ? /drkfr-group-(\d|x)*/g : /drkfr-field-(\d|x)*/g;
|
| 73 |
-
var replace = field.hasClass( 'drkfr_Group_Field' ) ? 'drkfr-group-' + index : 'drkfr-field-' + index;
|
| 74 |
-
|
| 75 |
-
jQuery(this).find( '[' + attr.join('],[') + ']' ).each( function() {
|
| 76 |
-
|
| 77 |
-
for ( var i = 0; i < attr.length; i++ )
|
| 78 |
-
if ( typeof( jQuery(this).attr( attr[i] ) ) !== 'undefined' )
|
| 79 |
-
jQuery(this).attr( attr[i], jQuery(this).attr( attr[i] ).replace( search, replace ) );
|
| 80 |
-
|
| 81 |
-
} );
|
| 82 |
-
|
| 83 |
-
index += 1;
|
| 84 |
-
|
| 85 |
-
} );
|
| 86 |
-
|
| 87 |
-
drkfr.clonedField( newT );
|
| 88 |
-
|
| 89 |
-
if ( field.hasClass( 'drkfr-sortable' ) )
|
| 90 |
-
drkfr.sortableInit( field );
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
},
|
| 94 |
-
|
| 95 |
-
deleteField : function( e ) {
|
| 96 |
-
|
| 97 |
-
var fieldItem, field;
|
| 98 |
-
|
| 99 |
-
e.preventDefault();
|
| 100 |
-
jQuery(this).blur();
|
| 101 |
-
|
| 102 |
-
if ( ! confirm( drkfrData.strings.confirmDeleteField ) ) {
|
| 103 |
-
return;
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
fieldItem = jQuery( this ).closest('.field-item' );
|
| 107 |
-
field = fieldItem.closest( '.field' );
|
| 108 |
-
|
| 109 |
-
drkfr.isMaxFields( field, -1 );
|
| 110 |
-
drkfr.deletedField( fieldItem );
|
| 111 |
-
|
| 112 |
-
fieldItem.remove();
|
| 113 |
-
|
| 114 |
-
},
|
| 115 |
-
|
| 116 |
-
/**
|
| 117 |
-
* Prevent having more than the maximum number of repeatable fields.
|
| 118 |
-
* When called, if there is the maximum, disable .repeat-field button.
|
| 119 |
-
* Note: Information Passed using data-max attribute on the .field element.
|
| 120 |
-
*
|
| 121 |
-
* @param jQuery .field
|
| 122 |
-
* @param int modifier - adjust count by this ammount. 1 If adding a field, 0 if checking, -1 if removing a field... etc
|
| 123 |
-
* @return null
|
| 124 |
-
*/
|
| 125 |
-
isMaxFields: function( field, modifier ) {
|
| 126 |
-
|
| 127 |
-
var count, addBtn, min, max, count;
|
| 128 |
-
|
| 129 |
-
modifier = (modifier) ? parseInt( modifier, 10 ) : 0;
|
| 130 |
-
|
| 131 |
-
addBtn = field.children( '.repeat-field' );
|
| 132 |
-
count = field.children('.field-item').not('.hidden').length + modifier; // Count after anticipated action (modifier)
|
| 133 |
-
max = field.attr( 'data-rep-max' );
|
| 134 |
-
|
| 135 |
-
// Show all the remove field buttons.
|
| 136 |
-
field.find( '> .field-item > .drkfr-delete-field, > .field-item > .group > .drkfr-delete-field' ).show();
|
| 137 |
-
|
| 138 |
-
if ( typeof( max ) === 'undefined' )
|
| 139 |
-
return false;
|
| 140 |
-
|
| 141 |
-
// Disable the add new field button?
|
| 142 |
-
if ( count >= parseInt( max, 10 ) )
|
| 143 |
-
addBtn.attr( 'disabled', 'disabled' );
|
| 144 |
-
else
|
| 145 |
-
addBtn.removeAttr( 'disabled' );
|
| 146 |
-
|
| 147 |
-
if ( count > parseInt( max, 10 ) )
|
| 148 |
-
return true;
|
| 149 |
-
|
| 150 |
-
},
|
| 151 |
-
|
| 152 |
-
addCallbackForInit: function( callback ) {
|
| 153 |
-
|
| 154 |
-
this._initCallbacks.push( callback )
|
| 155 |
-
|
| 156 |
-
},
|
| 157 |
-
|
| 158 |
-
/**
|
| 159 |
-
* Fire init callbacks.
|
| 160 |
-
* Called when drkfr has been set up.
|
| 161 |
-
*/
|
| 162 |
-
doneInit: function() {
|
| 163 |
-
|
| 164 |
-
var _this = this,
|
| 165 |
-
callbacks = drkfr._initCallbacks;
|
| 166 |
-
|
| 167 |
-
if ( callbacks ) {
|
| 168 |
-
for ( var a = 0; a < callbacks.length; a++) {
|
| 169 |
-
callbacks[a]();
|
| 170 |
-
}
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
},
|
| 174 |
-
|
| 175 |
-
addCallbackForClonedField: function( fieldName, callback ) {
|
| 176 |
-
|
| 177 |
-
if ( jQuery.isArray( fieldName ) )
|
| 178 |
-
for ( var i = 0; i < fieldName.length; i++ )
|
| 179 |
-
drkfr.addCallbackForClonedField( fieldName[i], callback );
|
| 180 |
-
|
| 181 |
-
this._clonedFieldCallbacks[fieldName] = this._clonedFieldCallbacks[fieldName] ? this._clonedFieldCallbacks[fieldName] : []
|
| 182 |
-
this._clonedFieldCallbacks[fieldName].push( callback )
|
| 183 |
-
|
| 184 |
-
},
|
| 185 |
-
|
| 186 |
-
/**
|
| 187 |
-
* Fire clonedField callbacks.
|
| 188 |
-
* Called when a field has been cloned.
|
| 189 |
-
*/
|
| 190 |
-
clonedField: function( el ) {
|
| 191 |
-
|
| 192 |
-
// also check child elements
|
| 193 |
-
el.add( el.find( 'div[data-class]' ) ).each( function( i, el ) {
|
| 194 |
-
|
| 195 |
-
el = jQuery( el )
|
| 196 |
-
var callbacks = drkfr._clonedFieldCallbacks[el.attr( 'data-class') ]
|
| 197 |
-
|
| 198 |
-
if ( callbacks )
|
| 199 |
-
for ( var a = 0; a < callbacks.length; a++ )
|
| 200 |
-
callbacks[a]( el );
|
| 201 |
-
|
| 202 |
-
})
|
| 203 |
-
},
|
| 204 |
-
|
| 205 |
-
addCallbackForDeletedField: function( fieldName, callback ) {
|
| 206 |
-
|
| 207 |
-
if ( jQuery.isArray( fieldName ) )
|
| 208 |
-
for ( var i = 0; i < fieldName.length; i++ )
|
| 209 |
-
drkfr._deletedFieldCallbacks( fieldName[i], callback );
|
| 210 |
-
|
| 211 |
-
this._deletedFieldCallbacks[fieldName] = this._deletedFieldCallbacks[fieldName] ? this._deletedFieldCallbacks[fieldName] : []
|
| 212 |
-
this._deletedFieldCallbacks[fieldName].push( callback )
|
| 213 |
-
|
| 214 |
-
},
|
| 215 |
-
|
| 216 |
-
/**
|
| 217 |
-
* Fire deletedField callbacks.
|
| 218 |
-
* Called when a field has been cloned.
|
| 219 |
-
*/
|
| 220 |
-
deletedField: function( el ) {
|
| 221 |
-
|
| 222 |
-
// also check child elements
|
| 223 |
-
el.add( el.find( 'div[data-class]' ) ).each( function(i, el) {
|
| 224 |
-
|
| 225 |
-
el = jQuery( el )
|
| 226 |
-
var callbacks = drkfr._deletedFieldCallbacks[el.attr( 'data-class') ]
|
| 227 |
-
|
| 228 |
-
if ( callbacks )
|
| 229 |
-
for ( var a = 0; a < callbacks.length; a++ )
|
| 230 |
-
callbacks[a]( el )
|
| 231 |
-
|
| 232 |
-
})
|
| 233 |
-
},
|
| 234 |
-
|
| 235 |
-
sortableInit : function( field ) {
|
| 236 |
-
|
| 237 |
-
var items = field.find(' > .field-item').not('.hidden');
|
| 238 |
-
|
| 239 |
-
field.find( '> .field-item > .drkfr-handle' ).remove();
|
| 240 |
-
|
| 241 |
-
items.each( function() {
|
| 242 |
-
jQuery(this).append( '<div class="drkfr-handle"></div>' );
|
| 243 |
-
} );
|
| 244 |
-
|
| 245 |
-
field.sortable( {
|
| 246 |
-
handle: "> .drkfr-handle" ,
|
| 247 |
-
cursor: "move",
|
| 248 |
-
items: " > .field-item",
|
| 249 |
-
beforeStop: function( event, ui ) { drkfr.sortStart( jQuery( ui.item[0] ) ); },
|
| 250 |
-
deactivate: function( event, ui ) { drkfr.sortEnd( jQuery( ui.item[0] ) ); },
|
| 251 |
-
} );
|
| 252 |
-
|
| 253 |
-
},
|
| 254 |
-
|
| 255 |
-
sortStart : function ( el ) {
|
| 256 |
-
|
| 257 |
-
// also check child elements
|
| 258 |
-
el.add( el.find( 'div[data-class]' ) ).each( function(i, el) {
|
| 259 |
-
|
| 260 |
-
el = jQuery( el )
|
| 261 |
-
var callbacks = drkfr._sortStartCallbacks[el.attr( 'data-class') ]
|
| 262 |
-
|
| 263 |
-
if ( callbacks )
|
| 264 |
-
for ( var a = 0; a < callbacks.length; a++ )
|
| 265 |
-
callbacks[a]( el )
|
| 266 |
-
|
| 267 |
-
})
|
| 268 |
-
|
| 269 |
-
},
|
| 270 |
-
|
| 271 |
-
addCallbackForSortStart: function( fieldName, callback ) {
|
| 272 |
-
|
| 273 |
-
if ( jQuery.isArray( fieldName ) )
|
| 274 |
-
for ( var i = 0; i < fieldName.length; i++ )
|
| 275 |
-
drkfr.addCallbackForSortStart( fieldName[i], callback );
|
| 276 |
-
|
| 277 |
-
this._sortStartCallbacks[fieldName] = this._sortStartCallbacks[fieldName] ? this._sortStartCallbacks[fieldName] : []
|
| 278 |
-
this._sortStartCallbacks[fieldName].push( callback )
|
| 279 |
-
|
| 280 |
-
},
|
| 281 |
-
|
| 282 |
-
sortEnd : function ( el ) {
|
| 283 |
-
|
| 284 |
-
// also check child elements
|
| 285 |
-
el.add( el.find( 'div[data-class]' ) ).each( function(i, el) {
|
| 286 |
-
|
| 287 |
-
el = jQuery( el )
|
| 288 |
-
var callbacks = drkfr._sortEndCallbacks[el.attr( 'data-class') ]
|
| 289 |
-
|
| 290 |
-
if ( callbacks )
|
| 291 |
-
for ( var a = 0; a < callbacks.length; a++ )
|
| 292 |
-
callbacks[a]( el )
|
| 293 |
-
|
| 294 |
-
})
|
| 295 |
-
|
| 296 |
-
},
|
| 297 |
-
|
| 298 |
-
addCallbackForSortEnd: function( fieldName, callback ) {
|
| 299 |
-
|
| 300 |
-
if ( jQuery.isArray( fieldName ) )
|
| 301 |
-
for ( var i = 0; i < fieldName.length; i++ )
|
| 302 |
-
drkfr.addCallbackForSortEnd( fieldName[i], callback );
|
| 303 |
-
|
| 304 |
-
this._sortEndCallbacks[fieldName] = this._sortEndCallbacks[fieldName] ? this._sortEndCallbacks[fieldName] : []
|
| 305 |
-
this._sortEndCallbacks[fieldName].push( callback )
|
| 306 |
-
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
}
|
| 310 |
-
|
| 311 |
-
jQuery(document).ready( function() {
|
| 312 |
-
|
| 313 |
-
drkfr.init();
|
| 314 |
-
|
| 315 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/field-gmap.js
DELETED
|
@@ -1,93 +0,0 @@
|
|
| 1 |
-
/*jshint devel:true */
|
| 2 |
-
/*global google */
|
| 3 |
-
|
| 4 |
-
(function($) {
|
| 5 |
-
|
| 6 |
-
var drkfrGmapsInit = function( fieldEl ) {
|
| 7 |
-
|
| 8 |
-
var searchInput = $('.map-search', fieldEl ).get(0);
|
| 9 |
-
var mapCanvas = $('.map', fieldEl ).get(0);
|
| 10 |
-
var latitude = $('.latitude', fieldEl );
|
| 11 |
-
var longitude = $('.longitude', fieldEl );
|
| 12 |
-
var elevation = $('.elevation', fieldEl );
|
| 13 |
-
var elevator = new google.maps.ElevationService();
|
| 14 |
-
|
| 15 |
-
var mapOptions = {
|
| 16 |
-
center: new google.maps.LatLng( drkfrGmaps.defaults.latitude, drkfrGmaps.defaults.longitude ),
|
| 17 |
-
zoom: parseInt( drkfrGmaps.defaults.zoom ),
|
| 18 |
-
mapTypeId: google.maps.MapTypeId.ROADMAP
|
| 19 |
-
};
|
| 20 |
-
|
| 21 |
-
var map = new google.maps.Map( mapCanvas, mapOptions );
|
| 22 |
-
|
| 23 |
-
// Marker
|
| 24 |
-
var markerOptions = {
|
| 25 |
-
map: map,
|
| 26 |
-
draggable: true,
|
| 27 |
-
title: drkfrGmaps.strings.markerTitle
|
| 28 |
-
};
|
| 29 |
-
|
| 30 |
-
var marker = new google.maps.Marker( markerOptions );
|
| 31 |
-
marker.setPosition( mapOptions.center );
|
| 32 |
-
|
| 33 |
-
function setPosition( latLng, zoom ) {
|
| 34 |
-
|
| 35 |
-
marker.setPosition( latLng );
|
| 36 |
-
map.setCenter( latLng );
|
| 37 |
-
|
| 38 |
-
if ( zoom ) {
|
| 39 |
-
map.setZoom( zoom );
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
latitude.val( latLng.lat() );
|
| 43 |
-
longitude.val( latLng.lng() );
|
| 44 |
-
|
| 45 |
-
elevator.getElevationForLocations( { locations: [ marker.getPosition() ] }, function (results, status) {
|
| 46 |
-
if (status == google.maps.ElevationStatus.OK && results[0] ) {
|
| 47 |
-
elevation.val( results[0].elevation );
|
| 48 |
-
}
|
| 49 |
-
});
|
| 50 |
-
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
// Set stored Coordinates
|
| 54 |
-
if ( latitude.val() && longitude.val() ) {
|
| 55 |
-
latLng = new google.maps.LatLng( latitude.val(), longitude.val() );
|
| 56 |
-
setPosition( latLng, 17 )
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
google.maps.event.addListener( marker, 'dragend', function() {
|
| 60 |
-
setPosition( marker.getPosition() );
|
| 61 |
-
});
|
| 62 |
-
|
| 63 |
-
// Search
|
| 64 |
-
var autocomplete = new google.maps.places.Autocomplete(searchInput);
|
| 65 |
-
autocomplete.bindTo('bounds', map);
|
| 66 |
-
|
| 67 |
-
google.maps.event.addListener(autocomplete, 'place_changed', function() {
|
| 68 |
-
var place = autocomplete.getPlace();
|
| 69 |
-
if (place.geometry.viewport) {
|
| 70 |
-
map.fitBounds(place.geometry.viewport);
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
setPosition( place.geometry.location, 17 );
|
| 74 |
-
|
| 75 |
-
});
|
| 76 |
-
|
| 77 |
-
$(searchInput).keypress(function(e) {
|
| 78 |
-
if (e.keyCode === 13) {
|
| 79 |
-
e.preventDefault();
|
| 80 |
-
}
|
| 81 |
-
});
|
| 82 |
-
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
drkfr.addCallbackForInit( function() {
|
| 86 |
-
$('.drkfr_Gmap_Field .field-item').each(function() {
|
| 87 |
-
drkfrGmapsInit( $(this) );
|
| 88 |
-
});
|
| 89 |
-
} );
|
| 90 |
-
|
| 91 |
-
drkfr.addCallbackForClonedField( ['drkfr_Gmap_Field'], drkfrGmapsInit );
|
| 92 |
-
|
| 93 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/field-wysiwyg.js
DELETED
|
@@ -1,106 +0,0 @@
|
|
| 1 |
-
drkfr.addCallbackForDeletedField( 'drkfr_wysiwyg', function( el ) {
|
| 2 |
-
|
| 3 |
-
// Destroy WYSIWYG editors instances.
|
| 4 |
-
el.find( '.drkfr-wysiwyg textarea' ).each( function() {
|
| 5 |
-
var instance = tinyMCE.get( jQuery(this).attr('id') );
|
| 6 |
-
if ( instance !== null && typeof( instance ) !== 'undefined' )
|
| 7 |
-
instance.remove();
|
| 8 |
-
} );
|
| 9 |
-
|
| 10 |
-
} );
|
| 11 |
-
|
| 12 |
-
drkfr.addCallbackForClonedField( 'drkfr_wysiwyg', function( newT ) {
|
| 13 |
-
|
| 14 |
-
newT.find( '.drkfr-wysiwyg' ).each( function (i) {
|
| 15 |
-
|
| 16 |
-
var el, id, name, ed, dom, i, fieldId, nameRegex, idRegex;
|
| 17 |
-
|
| 18 |
-
el = jQuery(this);
|
| 19 |
-
id = el.attr( 'data-id' );
|
| 20 |
-
name = el.attr( 'data-name' );
|
| 21 |
-
ed = tinyMCE.get(id);
|
| 22 |
-
fieldId = el.attr('data-field-id'); //Field identifier, not including field/group index.,
|
| 23 |
-
|
| 24 |
-
if ( ed )
|
| 25 |
-
return;
|
| 26 |
-
|
| 27 |
-
nameRegex = new RegExp( 'drkfr-placeholder-name-' + fieldId, 'g' );
|
| 28 |
-
idRegex = new RegExp( 'drkfr-placeholder-id-' + fieldId, 'g' );
|
| 29 |
-
|
| 30 |
-
// Placeholder markup for the new wysiwyg is stored as a prop on var drkfr_wysiwyg_editors
|
| 31 |
-
// Copy, update ids & names & insert.
|
| 32 |
-
el.html( drkfr_wysiwyg_editors[fieldId].replace( nameRegex, name ).replace( idRegex, id ) );
|
| 33 |
-
|
| 34 |
-
// If no settings for this field. Clone from placeholder.
|
| 35 |
-
if ( typeof( tinyMCEPreInit.mceInit[ id ] ) === 'undefined' ) {
|
| 36 |
-
var newSettings = jQuery.extend( {}, tinyMCEPreInit.mceInit[ 'drkfr-placeholder-id-' + fieldId ] );
|
| 37 |
-
for ( var prop in newSettings )
|
| 38 |
-
if ( 'string' === typeof( newSettings[prop] ) )
|
| 39 |
-
newSettings[prop] = newSettings[prop].replace( idRegex, id ).replace( nameRegex, name );
|
| 40 |
-
tinyMCEPreInit.mceInit[ id ] = newSettings;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
// If no Quicktag settings for this field. Clone from placeholder.
|
| 44 |
-
if ( typeof( tinyMCEPreInit.qtInit[ id ] ) === 'undefined' ) {
|
| 45 |
-
var newQTS = jQuery.extend( {}, tinyMCEPreInit.qtInit[ 'drkfr-placeholder-id-' + fieldId ] );
|
| 46 |
-
for ( var prop in newQTS )
|
| 47 |
-
if ( 'string' === typeof( newQTS[prop] ) )
|
| 48 |
-
newQTS[prop] = newQTS[prop].replace( idRegex, id ).replace( nameRegex, name );
|
| 49 |
-
tinyMCEPreInit.qtInit[ id ] = newQTS;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
var mode = el.find('.wp-editor-wrap').hasClass('tmce-active') ? 'tmce' : 'html';
|
| 53 |
-
|
| 54 |
-
// If current mode is visual, create the tinyMCE.
|
| 55 |
-
if ( 'tmce' === mode ) {
|
| 56 |
-
if ( tinyMCE.majorVersion === '4' ) {
|
| 57 |
-
var ed = tinymce.init( tinyMCEPreInit.mceInit[id] );
|
| 58 |
-
} else if ( tinyMCE.majorVersion === '3' ) {
|
| 59 |
-
var ed = new tinymce.Editor( id, tinyMCEPreInit.mceInit[id] );
|
| 60 |
-
ed.render();
|
| 61 |
-
}
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
// Init Quicktags.
|
| 65 |
-
QTags.instances[0] = undefined;
|
| 66 |
-
try { quicktags( tinyMCEPreInit.qtInit[id] ); } catch(e){}
|
| 67 |
-
|
| 68 |
-
} );
|
| 69 |
-
|
| 70 |
-
} );
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
drkfr.addCallbackForSortStart( 'drkfr_wysiwyg', function( el ) {
|
| 74 |
-
|
| 75 |
-
el.find( '.wp-editor-area' ).each(function(){
|
| 76 |
-
var id = jQuery(this).attr('id');
|
| 77 |
-
|
| 78 |
-
if ( tinyMCE.majorVersion === '4' ) {
|
| 79 |
-
tinyMCE.execCommand('mceRemoveEditor', false, id);
|
| 80 |
-
} else if ( tinyMCE.majorVersion === '3' ) {
|
| 81 |
-
tinyMCE.execCommand('mceRemoveControl', false, id);
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
});
|
| 86 |
-
|
| 87 |
-
} );
|
| 88 |
-
|
| 89 |
-
drkfr.addCallbackForSortEnd( 'drkfr_wysiwyg', function( el ) {
|
| 90 |
-
|
| 91 |
-
el.find( '.wp-editor-area' ).each(function(){
|
| 92 |
-
|
| 93 |
-
var id = jQuery(this).attr('id'),
|
| 94 |
-
mode = jQuery(this).closest('.wp-editor-wrap').hasClass('tmce-active') ? 'tmce' : 'html';
|
| 95 |
-
|
| 96 |
-
if ( 'tmce' === mode ) {
|
| 97 |
-
if ( tinyMCE.majorVersion === '4' ) {
|
| 98 |
-
tinyMCE.execCommand('mceAddEditor', false, id);
|
| 99 |
-
} else if ( tinyMCE.majorVersion === '3' ) {
|
| 100 |
-
tinyMCE.execCommand('mceAddControl', false, id);
|
| 101 |
-
}
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
});
|
| 105 |
-
|
| 106 |
-
} );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/field.colorpicker.js
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* ColorPickers
|
| 3 |
-
*/
|
| 4 |
-
|
| 5 |
-
drkfr.addCallbackForInit( function() {
|
| 6 |
-
|
| 7 |
-
// Colorpicker
|
| 8 |
-
jQuery('input:text.drkfr_colorpicker').wpColorPicker();
|
| 9 |
-
|
| 10 |
-
} );
|
| 11 |
-
|
| 12 |
-
drkfr.addCallbackForClonedField( 'drkfr_Color_Picker', function( newT ) {
|
| 13 |
-
|
| 14 |
-
// Reinitialize colorpickers
|
| 15 |
-
newT.find('.wp-color-result').remove();
|
| 16 |
-
newT.find('input:text.drkfr_colorpicker').wpColorPicker();
|
| 17 |
-
|
| 18 |
-
} );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/field.datetime.js
DELETED
|
@@ -1,47 +0,0 @@
|
|
| 1 |
-
|
| 2 |
-
/**
|
| 3 |
-
* Date & Time Fields
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
drkfr.addCallbackForClonedField( ['drkfr_Date_Field', 'drkfr_Time_Field', 'drkfr_Date_Timestamp_Field', 'drkfr_Datetime_Timestamp_Field' ], function( newT ) {
|
| 7 |
-
|
| 8 |
-
// Reinitialize all the datepickers
|
| 9 |
-
newT.find( '.drkfr_datepicker' ).each(function () {
|
| 10 |
-
jQuery(this).attr( 'id', '' ).removeClass( 'hasDatepicker' ).removeData( 'datepicker' ).unbind().datepicker();
|
| 11 |
-
});
|
| 12 |
-
|
| 13 |
-
// Reinitialize all the timepickers.
|
| 14 |
-
newT.find('.drkfr_timepicker' ).each(function () {
|
| 15 |
-
jQuery(this).timePicker({
|
| 16 |
-
startTime: "00:00",
|
| 17 |
-
endTime: "23:30",
|
| 18 |
-
show24Hours: false,
|
| 19 |
-
separator: ':',
|
| 20 |
-
step: 30
|
| 21 |
-
});
|
| 22 |
-
});
|
| 23 |
-
|
| 24 |
-
} );
|
| 25 |
-
|
| 26 |
-
drkfr.addCallbackForInit( function() {
|
| 27 |
-
|
| 28 |
-
// Datepicker
|
| 29 |
-
jQuery('.drkfr_datepicker').each(function () {
|
| 30 |
-
jQuery(this).datepicker();
|
| 31 |
-
});
|
| 32 |
-
|
| 33 |
-
// Wrap date picker in class to narrow the scope of jQuery UI CSS and prevent conflicts
|
| 34 |
-
jQuery("#ui-datepicker-div").wrap('<div class="drkfr_element" />');
|
| 35 |
-
|
| 36 |
-
// Timepicker
|
| 37 |
-
jQuery('.drkfr_timepicker').each(function () {
|
| 38 |
-
jQuery(this).timePicker({
|
| 39 |
-
startTime: "00:00",
|
| 40 |
-
endTime: "23:30",
|
| 41 |
-
show24Hours: false,
|
| 42 |
-
separator: ':',
|
| 43 |
-
step: 30
|
| 44 |
-
});
|
| 45 |
-
} );
|
| 46 |
-
|
| 47 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/field.select.js
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
var drkfrSelectInit = function() {
|
| 2 |
-
|
| 3 |
-
jQuery( '.drkfr_select' ).each( function() {
|
| 4 |
-
|
| 5 |
-
var el = jQuery(this);
|
| 6 |
-
var fieldID = el.attr( 'data-field-id'); // JS Friendly ID
|
| 7 |
-
|
| 8 |
-
// If fieldID is set
|
| 9 |
-
// If fieldID options exist
|
| 10 |
-
// If Element is not hidden template field.
|
| 11 |
-
// If elemnt has not already been initialized.
|
| 12 |
-
if ( fieldID && fieldID in window.drkfr_select_fields && el.is( ':visible' ) && ! el.hasClass( 'select2-added' ) ) {
|
| 13 |
-
|
| 14 |
-
// Get options for this field.
|
| 15 |
-
options = window.drkfr_select_fields[fieldID];
|
| 16 |
-
|
| 17 |
-
el.addClass( 'select2-added' ).select2( options );
|
| 18 |
-
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
})
|
| 22 |
-
|
| 23 |
-
};
|
| 24 |
-
|
| 25 |
-
// Hook this in for all the required fields.
|
| 26 |
-
drkfr.addCallbackForInit( drkfrSelectInit );
|
| 27 |
-
drkfr.addCallbackForClonedField( 'drkfr_Select', drkfrSelectInit );
|
| 28 |
-
drkfr.addCallbackForClonedField( 'drkfr_Post_Select', drkfrSelectInit );
|
| 29 |
-
drkfr.addCallbackForClonedField( 'drkfr_Taxonomy', drkfrSelectInit );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/file-upload.js
DELETED
|
@@ -1,129 +0,0 @@
|
|
| 1 |
-
jQuery( document ).ready( function() {
|
| 2 |
-
|
| 3 |
-
jQuery( document ).on( 'click', '.drkfr-file-upload', function(e) {
|
| 4 |
-
|
| 5 |
-
e.preventDefault();
|
| 6 |
-
|
| 7 |
-
var link = jQuery( this );
|
| 8 |
-
var container = jQuery( this ).parent();
|
| 9 |
-
|
| 10 |
-
var frameArgs = {
|
| 11 |
-
multiple: false,
|
| 12 |
-
title: 'Select File',
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
library = container.attr( 'data-type' ).split(',');
|
| 16 |
-
if ( library.length > 0 )
|
| 17 |
-
frameArgs.library = { type: library }
|
| 18 |
-
|
| 19 |
-
var drkfr_Frame = wp.media( frameArgs );
|
| 20 |
-
|
| 21 |
-
drkfr_Frame.on( 'select', function() {
|
| 22 |
-
|
| 23 |
-
var selection = drkfr_Frame.state().get('selection'),
|
| 24 |
-
model = selection.first(),
|
| 25 |
-
fileHolder = container.find( '.drkfr-file-holder' );
|
| 26 |
-
|
| 27 |
-
jQuery( container ).find( '.drkfr-file-upload-input' ).val( model.id );
|
| 28 |
-
|
| 29 |
-
link.hide(); // Hide 'add media' button
|
| 30 |
-
|
| 31 |
-
drkfr_Frame.close();
|
| 32 |
-
|
| 33 |
-
fileHolder.html( '' );
|
| 34 |
-
fileHolder.show();
|
| 35 |
-
fileHolder.siblings( '.drkfr-remove-file' ).show();
|
| 36 |
-
|
| 37 |
-
var fieldType = container.closest( '.field-item' ).attr( 'data-class' );
|
| 38 |
-
|
| 39 |
-
if ( 'drkfr_Image_Field' === fieldType ) {
|
| 40 |
-
|
| 41 |
-
var data = {
|
| 42 |
-
action: 'drkfr_request_image',
|
| 43 |
-
id: model.attributes.id,
|
| 44 |
-
width: container.width(),
|
| 45 |
-
height: container.height(),
|
| 46 |
-
crop: fileHolder.attr('data-crop'),
|
| 47 |
-
nonce: link.attr( 'data-nonce' )
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
fileHolder.addClass( 'drkfr-loading' );
|
| 51 |
-
|
| 52 |
-
jQuery.post( ajaxurl, data, function( src ) {
|
| 53 |
-
// Insert image
|
| 54 |
-
jQuery( '<img />', { src: src } ).prependTo( fileHolder );
|
| 55 |
-
fileHolder.removeClass( 'drkfr-loading' );
|
| 56 |
-
}).fail( function() {
|
| 57 |
-
// Fallback - insert full size image.
|
| 58 |
-
jQuery( '<img />', { src: model.attributes.url } ).prependTo( fileHolder );
|
| 59 |
-
fileHolder.removeClass( 'drkfr-loading' );
|
| 60 |
-
});
|
| 61 |
-
|
| 62 |
-
} else {
|
| 63 |
-
|
| 64 |
-
jQuery( '<img />', { src: model.attributes.icon } ).prependTo( fileHolder );
|
| 65 |
-
fileHolder.append( jQuery('<div class="drkfr-file-name" />').html( '<strong>' + model.attributes.filename + '</strong>' ) );
|
| 66 |
-
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
});
|
| 70 |
-
|
| 71 |
-
drkfr_Frame.open();
|
| 72 |
-
|
| 73 |
-
} );
|
| 74 |
-
|
| 75 |
-
jQuery( document ).on( 'click', '.drkfr-remove-file', function(e) {
|
| 76 |
-
|
| 77 |
-
e.preventDefault();
|
| 78 |
-
|
| 79 |
-
var container = jQuery( this ).parent().parent();
|
| 80 |
-
|
| 81 |
-
container.find( '.drkfr-file-holder' ).html( '' ).hide();
|
| 82 |
-
container.find( '.drkfr-file-upload-input' ).val( '' );
|
| 83 |
-
container.find( '.drkfr-file-upload' ).show().css( 'display', 'inline-block' );
|
| 84 |
-
container.find( '.drkfr-remove-file' ).hide();
|
| 85 |
-
|
| 86 |
-
} );
|
| 87 |
-
|
| 88 |
-
/**
|
| 89 |
-
* Recalculate the dimensions of the file upload field.
|
| 90 |
-
* It should never be larger than the available width.
|
| 91 |
-
* It should maintain the aspect ratio of the original field.
|
| 92 |
-
* It should recalculate when resized.
|
| 93 |
-
* @return {[type]} [description]
|
| 94 |
-
*/
|
| 95 |
-
var recalculateFileFieldSize = function() {
|
| 96 |
-
|
| 97 |
-
jQuery( '.drkfr-file-wrap' ).each( function() {
|
| 98 |
-
|
| 99 |
-
var el = jQuery(this),
|
| 100 |
-
container = el.closest( '.postbox' ),
|
| 101 |
-
width = container.width() - 12 - 10 - 10,
|
| 102 |
-
ratio = el.height() / el.width();
|
| 103 |
-
|
| 104 |
-
if ( el.attr( 'data-original-width' ) )
|
| 105 |
-
el.width( el.attr( 'data-original-width' ) );
|
| 106 |
-
else
|
| 107 |
-
el.attr( 'data-original-width', el.width() );
|
| 108 |
-
|
| 109 |
-
if ( el.attr( 'data-original-height' ) )
|
| 110 |
-
el.height( el.attr( 'data-original-height' ) );
|
| 111 |
-
else
|
| 112 |
-
el.attr( 'data-original-height', el.height() );
|
| 113 |
-
|
| 114 |
-
if ( el.width() > width ) {
|
| 115 |
-
el.width( width );
|
| 116 |
-
el.find( '.drkfr-file-wrap-placeholder' ).width( width - 8 );
|
| 117 |
-
el.height( width * ratio );
|
| 118 |
-
el.css( 'line-height', ( width * ratio ) + 'px' );
|
| 119 |
-
el.find( '.drkfr-file-wrap-placeholder' ).height( ( width * ratio ) - 8 );
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
} );
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
recalculateFileFieldSize();
|
| 127 |
-
jQuery(window).resize( recalculateFileFieldSize );
|
| 128 |
-
|
| 129 |
-
} );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/jquery.timePicker.min.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
* A time picker for jQuery
|
| 3 |
-
*
|
| 4 |
-
* Dual licensed under the MIT and GPL licenses.
|
| 5 |
-
* Copyright (c) 2009 Anders Fajerson and 2013 Dennis Burke
|
| 6 |
-
* @name timePicker
|
| 7 |
-
* @author Anders Fajerson (http://perifer.se)
|
| 8 |
-
* @example $("#mytime").timePicker();
|
| 9 |
-
* @example $("#mytime").timePicker({step:30, startTime:"15:00", endTime:"18:00"});
|
| 10 |
-
*
|
| 11 |
-
* Based on timePicker by Sam Collet (http://www.texotela.co.uk/code/jquery/timepicker/)
|
| 12 |
-
*
|
| 13 |
-
* Options:
|
| 14 |
-
* step: # of minutes to step the time by
|
| 15 |
-
* startTime: beginning of the range of acceptable times
|
| 16 |
-
* endTime: end of the range of acceptable times
|
| 17 |
-
* separator: separator string to use between hours and minutes (e.g. ':')
|
| 18 |
-
* show24Hours: use a 24-hour scheme
|
| 19 |
-
*/
|
| 20 |
-
(function(e){"use strict";function n(t,n,r){t.value=e(n).text();e(t).change();t.focus();r.hide()}function r(e,t){var n=e.getHours();var r=t.show24Hours?n:(n+11)%12+1;var s=e.getMinutes();return i(r)+t.separator+i(s)+(t.show24Hours?"":n<12?" am":" pm")}function i(e){return(e<10?"0":"")+e}function s(e,t){return typeof e==="object"?u(e):o(e,t)}function o(e,t){if(e){e=a(e,t);var n=e.split(t.separator);var r=parseFloat(n[0]);var i=parseFloat(n[1]);if(!t.show24Hours){if(r===12&&e.indexOf("am")!==-1){r=0}else if(r!==12&&e.indexOf("pm")!==-1){r+=12}}var s=new Date(0,0,0,r,i,0);return u(s)}return null}function u(e){e.setFullYear(2001);e.setMonth(0);e.setDate(0);return e}function a(e,t){var n,r,i,s,o,u;if(t.show24Hours){return e}if(e){r=e.toLowerCase().replace(/\s*/g,"");if(n=/^(\d{1,2})(a|p)m*$/.exec(r)){if(parseInt(n[1],10)<12){return""+n[1]+":00"+n[2]+"m"}}else if(i=/^(\d{1,2}):(\d{1,2})(a|p)m*$/.exec(r)){s=parseInt(i[1],10);o=parseInt(i[2],10);u=i[3]+"m";if(s<12||o<59){return""+s+":"+(o>=10?o:o+"0")+u}}else if(i=/^(\d{1,2}):(\d{1,2})$/.exec(r)){s=parseInt(i[1],10);o=parseInt(i[2],10);u="am";if(s<=24&&o<=59){if(s>=12){s=s-12;u="pm"}if(s===0){s=12}return s+":"+o+u}}}}var t={init:function(t){var n=e.extend({},e.fn.timePicker.defaults,t);return this.each(function(){e.timePicker(this,n)})},destroy:function(){return this.each(function(){if(this.timePicker){var t=e(this).data("timepickerdiv");e(this).data("timepickerdiv","");e("#"+t).remove();delete this.timePicker}})}};e.timePicker=function(t,n){try{var r=e(t)[0];return r.timePicker||(r.timePicker=new e._timePicker(r,n))}catch(i){throw"timepicker must be called on an element"}};e.timePicker.version="0.4.0";e._timePicker=function(t,i){var f=false;var l=false;var c=s(i.startTime,i);var h=s(i.endTime,i);var p=i.defaultSelected?s(i.defaultSelected,i):c;var d="selected";var v="li."+d;var m="tp"+(new Date).getTime();e(t).attr("autocomplete","off");e(t).data("timepickerdiv",m);var g=[];var y=new Date(c);while(y<=h){g[g.length]=r(y,i);y=new Date(y.setMinutes(y.getMinutes()+i.step))}var b=e('<div id="'+m+'" class="time-picker'+(i.show24Hours?"":" time-picker-12hours")+'"></div>');var w=e("<ul></ul>");for(var E=0;E<g.length;E+=1){w.append("<li>"+g[E]+"</li>")}b.append(w);b.appendTo("body").hide();b.mouseover(function(){f=true}).mouseout(function(){f=false});e("li",w).mouseover(function(){if(!l){e(v,b).removeClass(d);e(this).addClass(d)}}).mousedown(function(){f=true}).click(function(){n(t,this,b,i);f=false});var S=function(){if(b.is(":visible")){return false}e("li",b).removeClass(d);var n=e(t).offset();b.css({top:n.top+t.offsetHeight,left:n.left});b.show();var s=t.value?o(t.value,i):p;var a=c.getHours()*60+c.getMinutes();var f=s.getHours()*60+s.getMinutes()-a;var l=Math.round(f/i.step);var v=u(new Date(0,0,0,0,l*i.step+a,0));v=c<v&&v<=h?v:c;var m=e("li:contains("+r(v,i)+")",b);if(m.length){m.addClass(d);b[0].scrollTop=m[0].offsetTop}return true};e(t).focus(S).click(S);e(t).blur(function(){if(!f){b.hide()}e(this).val(a(e(this).val(),i))});e(t).keydown(function(r){var s;l=true;var o=b[0].scrollTop;switch(r.which){case 38:if(S()){break}s=e(v,w);var u=s.prev().addClass(d)[0];if(u){s.removeClass(d);if(u.offsetTop<o){b[0].scrollTop=o-u.offsetHeight}}else{s.removeClass(d);u=e("li:last",w).addClass(d)[0];b[0].scrollTop=u.offsetTop-u.offsetHeight}break;case 40:if(S()){break}s=e(v,w);var a=s.next().addClass(d)[0];if(a){s.removeClass(d);if(a.offsetTop+a.offsetHeight>o+b[0].offsetHeight){b[0].scrollTop=o+a.offsetHeight}}else{s.removeClass(d);a=e("li:first",w).addClass(d)[0];b[0].scrollTop=0}break;case 13:if(b.is(":visible")){var f=e(v,w)[0];n(t,f,b,i);r.preventDefault()}break;case 27:b.hide();break}});e(t).keyup(function(){l=false});this.getTime=function(){return o(t.value,i)};this.setTime=function(n){t.value=r(s(n,i),i);e(t).change()}};e.fn.timePicker=function(n){if(t[n]){return t[n].apply(this,Array.prototype.slice.call(arguments,1))}else if(typeof n==="object"||!n){return t.init.apply(this,arguments)}else{e.error("Method "+n+" does not exist on jQuery.tooltip")}};e.fn.timePicker.defaults={step:30,startTime:new Date(0,0,0,0,0,0),endTime:new Date(0,0,0,23,30,0),defaultSelected:null,separator:":",show24Hours:true}})(jQuery)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/.bower.json
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"version": "3.5.1",
|
| 4 |
-
"main": [
|
| 5 |
-
"select2.js",
|
| 6 |
-
"select2.css",
|
| 7 |
-
"select2.png",
|
| 8 |
-
"select2x2.png",
|
| 9 |
-
"select2-spinner.gif"
|
| 10 |
-
],
|
| 11 |
-
"dependencies": {
|
| 12 |
-
"jquery": ">= 1.7.1"
|
| 13 |
-
},
|
| 14 |
-
"homepage": "https://github.com/ivaynberg/select2",
|
| 15 |
-
"_release": "3.5.1",
|
| 16 |
-
"_resolution": {
|
| 17 |
-
"type": "version",
|
| 18 |
-
"tag": "3.5.1",
|
| 19 |
-
"commit": "621a3f9532357148b05efc0602f7e06b44ff9bb4"
|
| 20 |
-
},
|
| 21 |
-
"_source": "git://github.com/ivaynberg/select2.git",
|
| 22 |
-
"_target": "~3.5.1",
|
| 23 |
-
"_originalSource": "select2",
|
| 24 |
-
"_direct": true
|
| 25 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/.gitignore
DELETED
|
@@ -1,2 +0,0 @@
|
|
| 1 |
-
.idea
|
| 2 |
-
|
|
|
|
|
|
drkfr/js/vendor/select2/LICENSE
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
Copyright 2014 Igor Vaynberg
|
| 2 |
-
|
| 3 |
-
Version: @@ver@@ Timestamp: @@timestamp@@
|
| 4 |
-
|
| 5 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 6 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 7 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 8 |
-
License or the GPL License.
|
| 9 |
-
|
| 10 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 11 |
-
|
| 12 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 13 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 14 |
-
|
| 15 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 16 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 17 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 18 |
-
permissions and limitations under the Apache License and the GPL License.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/README.md
DELETED
|
@@ -1,99 +0,0 @@
|
|
| 1 |
-
Select2
|
| 2 |
-
=======
|
| 3 |
-
|
| 4 |
-
Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
|
| 5 |
-
|
| 6 |
-
To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
|
| 7 |
-
|
| 8 |
-
Use cases
|
| 9 |
-
---------
|
| 10 |
-
|
| 11 |
-
* Enhancing native selects with search.
|
| 12 |
-
* Enhancing native selects with a better multi-select interface.
|
| 13 |
-
* Loading data from JavaScript: easily load items via ajax and have them searchable.
|
| 14 |
-
* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
|
| 15 |
-
* Tagging: ability to add new items on the fly.
|
| 16 |
-
* Working with large, remote datasets: ability to partially load a dataset based on the search term.
|
| 17 |
-
* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
|
| 18 |
-
* Templating: support for custom rendering of results and selections.
|
| 19 |
-
|
| 20 |
-
Browser compatibility
|
| 21 |
-
---------------------
|
| 22 |
-
* IE 8+
|
| 23 |
-
* Chrome 8+
|
| 24 |
-
* Firefox 10+
|
| 25 |
-
* Safari 3+
|
| 26 |
-
* Opera 10.6+
|
| 27 |
-
|
| 28 |
-
Usage
|
| 29 |
-
-----
|
| 30 |
-
You can source Select2 directly from a [CDN like JSDliver](http://www.jsdelivr.com/#!select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
|
| 31 |
-
|
| 32 |
-
Integrations
|
| 33 |
-
------------
|
| 34 |
-
|
| 35 |
-
* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
|
| 36 |
-
* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
|
| 37 |
-
* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org))
|
| 38 |
-
* [Django](https://github.com/applegrew/django-select2)
|
| 39 |
-
* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
|
| 40 |
-
* [Symfony2](https://github.com/avocode/FormExtensions)
|
| 41 |
-
* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
|
| 42 |
-
* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
|
| 43 |
-
* [Meteor](https://jquery-select2.meteor.com)
|
| 44 |
-
* [Yii 2.x](http://demos.krajee.com/widgets#select2)
|
| 45 |
-
* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
|
| 46 |
-
* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
|
| 47 |
-
|
| 48 |
-
### Example Integrations
|
| 49 |
-
|
| 50 |
-
* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
|
| 51 |
-
* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
|
| 52 |
-
* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
|
| 53 |
-
* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
|
| 54 |
-
|
| 55 |
-
Internationalization (i18n)
|
| 56 |
-
---------------------------
|
| 57 |
-
|
| 58 |
-
Select2 supports multiple languages by simply including the right language JS
|
| 59 |
-
file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
|
| 60 |
-
|
| 61 |
-
Missing a language? Just copy `select2_locale_en.js.template`, translate
|
| 62 |
-
it, and make a pull request back to Select2 here on GitHub.
|
| 63 |
-
|
| 64 |
-
Bug tracker
|
| 65 |
-
-----------
|
| 66 |
-
|
| 67 |
-
Have a bug? Please create an issue here on GitHub!
|
| 68 |
-
|
| 69 |
-
https://github.com/ivaynberg/select2/issues
|
| 70 |
-
|
| 71 |
-
Mailing list
|
| 72 |
-
------------
|
| 73 |
-
|
| 74 |
-
Have a question? Ask on our mailing list!
|
| 75 |
-
|
| 76 |
-
select2@googlegroups.com
|
| 77 |
-
|
| 78 |
-
https://groups.google.com/d/forum/select2
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
Copyright and license
|
| 82 |
-
---------------------
|
| 83 |
-
|
| 84 |
-
Copyright 2012 Igor Vaynberg
|
| 85 |
-
|
| 86 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 87 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 88 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 89 |
-
License or the GPL License.
|
| 90 |
-
|
| 91 |
-
You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
|
| 92 |
-
|
| 93 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 94 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 95 |
-
|
| 96 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 97 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 98 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 99 |
-
permissions and limitations under the Apache License and the GPL License.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/bower.json
DELETED
|
@@ -1,8 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"version": "3.5.1",
|
| 4 |
-
"main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
|
| 5 |
-
"dependencies": {
|
| 6 |
-
"jquery": ">= 1.7.1"
|
| 7 |
-
}
|
| 8 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/component.json
DELETED
|
@@ -1,66 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"repo": "ivaynberg/select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 5 |
-
"version": "3.5.1",
|
| 6 |
-
"demo": "http://ivaynberg.github.io/select2/",
|
| 7 |
-
"keywords": [
|
| 8 |
-
"jquery"
|
| 9 |
-
],
|
| 10 |
-
"main": "select2.js",
|
| 11 |
-
"styles": [
|
| 12 |
-
"select2.css",
|
| 13 |
-
"select2-bootstrap.css"
|
| 14 |
-
],
|
| 15 |
-
"scripts": [
|
| 16 |
-
"select2.js",
|
| 17 |
-
"select2_locale_ar.js",
|
| 18 |
-
"select2_locale_bg.js",
|
| 19 |
-
"select2_locale_ca.js",
|
| 20 |
-
"select2_locale_cs.js",
|
| 21 |
-
"select2_locale_da.js",
|
| 22 |
-
"select2_locale_de.js",
|
| 23 |
-
"select2_locale_el.js",
|
| 24 |
-
"select2_locale_es.js",
|
| 25 |
-
"select2_locale_et.js",
|
| 26 |
-
"select2_locale_eu.js",
|
| 27 |
-
"select2_locale_fa.js",
|
| 28 |
-
"select2_locale_fi.js",
|
| 29 |
-
"select2_locale_fr.js",
|
| 30 |
-
"select2_locale_gl.js",
|
| 31 |
-
"select2_locale_he.js",
|
| 32 |
-
"select2_locale_hr.js",
|
| 33 |
-
"select2_locale_hu.js",
|
| 34 |
-
"select2_locale_id.js",
|
| 35 |
-
"select2_locale_is.js",
|
| 36 |
-
"select2_locale_it.js",
|
| 37 |
-
"select2_locale_ja.js",
|
| 38 |
-
"select2_locale_ka.js",
|
| 39 |
-
"select2_locale_ko.js",
|
| 40 |
-
"select2_locale_lt.js",
|
| 41 |
-
"select2_locale_lv.js",
|
| 42 |
-
"select2_locale_mk.js",
|
| 43 |
-
"select2_locale_ms.js",
|
| 44 |
-
"select2_locale_nl.js",
|
| 45 |
-
"select2_locale_no.js",
|
| 46 |
-
"select2_locale_pl.js",
|
| 47 |
-
"select2_locale_pt-BR.js",
|
| 48 |
-
"select2_locale_pt-PT.js",
|
| 49 |
-
"select2_locale_ro.js",
|
| 50 |
-
"select2_locale_ru.js",
|
| 51 |
-
"select2_locale_sk.js",
|
| 52 |
-
"select2_locale_sv.js",
|
| 53 |
-
"select2_locale_th.js",
|
| 54 |
-
"select2_locale_tr.js",
|
| 55 |
-
"select2_locale_uk.js",
|
| 56 |
-
"select2_locale_vi.js",
|
| 57 |
-
"select2_locale_zh-CN.js",
|
| 58 |
-
"select2_locale_zh-TW.js"
|
| 59 |
-
],
|
| 60 |
-
"images": [
|
| 61 |
-
"select2-spinner.gif",
|
| 62 |
-
"select2.png",
|
| 63 |
-
"select2x2.png"
|
| 64 |
-
],
|
| 65 |
-
"license": "MIT"
|
| 66 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/composer.json
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name":
|
| 3 |
-
"ivaynberg/select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes.",
|
| 5 |
-
"version": "3.5.1",
|
| 6 |
-
"type": "component",
|
| 7 |
-
"homepage": "http://ivaynberg.github.io/select2/",
|
| 8 |
-
"license": "Apache-2.0",
|
| 9 |
-
"require": {
|
| 10 |
-
"robloach/component-installer": "*",
|
| 11 |
-
"components/jquery": ">=1.7.1"
|
| 12 |
-
},
|
| 13 |
-
"extra": {
|
| 14 |
-
"component": {
|
| 15 |
-
"scripts": [
|
| 16 |
-
"select2.js"
|
| 17 |
-
],
|
| 18 |
-
"files": [
|
| 19 |
-
"select2.js",
|
| 20 |
-
"select2_locale_*.js",
|
| 21 |
-
"select2.css",
|
| 22 |
-
"select2-bootstrap.css",
|
| 23 |
-
"select2-spinner.gif",
|
| 24 |
-
"select2.png",
|
| 25 |
-
"select2x2.png"
|
| 26 |
-
]
|
| 27 |
-
}
|
| 28 |
-
}
|
| 29 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/package.json
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name" : "Select2",
|
| 3 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 4 |
-
"homepage": "http://ivaynberg.github.io/select2",
|
| 5 |
-
"author": "Igor Vaynberg",
|
| 6 |
-
"repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
|
| 7 |
-
"main": "select2.js",
|
| 8 |
-
"version": "3.5.1",
|
| 9 |
-
"jspm": {
|
| 10 |
-
"main": "select2",
|
| 11 |
-
"files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
|
| 12 |
-
"shim": {
|
| 13 |
-
"select2": {
|
| 14 |
-
"imports": ["jquery", "./select2.css!"],
|
| 15 |
-
"exports": "$"
|
| 16 |
-
}
|
| 17 |
-
},
|
| 18 |
-
"buildConfig": { "uglify": true }
|
| 19 |
-
}
|
| 20 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/release.sh
DELETED
|
@@ -1,79 +0,0 @@
|
|
| 1 |
-
#!/bin/bash
|
| 2 |
-
set -e
|
| 3 |
-
|
| 4 |
-
echo -n "Enter the version for this release: "
|
| 5 |
-
|
| 6 |
-
read ver
|
| 7 |
-
|
| 8 |
-
if [ ! $ver ]; then
|
| 9 |
-
echo "Invalid version."
|
| 10 |
-
exit
|
| 11 |
-
fi
|
| 12 |
-
|
| 13 |
-
name="select2"
|
| 14 |
-
js="$name.js"
|
| 15 |
-
mini="$name.min.js"
|
| 16 |
-
css="$name.css"
|
| 17 |
-
release="$name-$ver"
|
| 18 |
-
tag="$ver"
|
| 19 |
-
branch="build-$ver"
|
| 20 |
-
curbranch=`git branch | grep "*" | sed "s/* //"`
|
| 21 |
-
timestamp=$(date)
|
| 22 |
-
tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
|
| 23 |
-
remote="github"
|
| 24 |
-
|
| 25 |
-
echo "Pulling from origin"
|
| 26 |
-
|
| 27 |
-
git pull
|
| 28 |
-
|
| 29 |
-
echo "Updating Version Identifiers"
|
| 30 |
-
|
| 31 |
-
sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
|
| 32 |
-
|
| 33 |
-
git add bower.json
|
| 34 |
-
git add select2.jquery.json
|
| 35 |
-
git add component.json
|
| 36 |
-
git add composer.json
|
| 37 |
-
git add package.json
|
| 38 |
-
|
| 39 |
-
git commit -m "modified version identifiers in descriptors for release $ver"
|
| 40 |
-
git push
|
| 41 |
-
|
| 42 |
-
git branch "$branch"
|
| 43 |
-
git checkout "$branch"
|
| 44 |
-
|
| 45 |
-
echo "Tokenizing..."
|
| 46 |
-
|
| 47 |
-
find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
|
| 48 |
-
find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
|
| 49 |
-
|
| 50 |
-
sed -e "s/latest/$ver/g" -i -- bower.json
|
| 51 |
-
|
| 52 |
-
git add "$js"
|
| 53 |
-
git add "$css"
|
| 54 |
-
|
| 55 |
-
echo "Minifying..."
|
| 56 |
-
|
| 57 |
-
echo "/*" > "$mini"
|
| 58 |
-
cat LICENSE | sed "$tokens" >> "$mini"
|
| 59 |
-
echo "*/" >> "$mini"
|
| 60 |
-
|
| 61 |
-
curl -s \
|
| 62 |
-
--data-urlencode "js_code@$js" \
|
| 63 |
-
http://marijnhaverbeke.nl/uglifyjs \
|
| 64 |
-
>> "$mini"
|
| 65 |
-
|
| 66 |
-
git add "$mini"
|
| 67 |
-
|
| 68 |
-
git commit -m "release $ver"
|
| 69 |
-
|
| 70 |
-
echo "Tagging..."
|
| 71 |
-
git tag -a "$tag" -m "tagged version $ver"
|
| 72 |
-
git push "$remote" --tags
|
| 73 |
-
|
| 74 |
-
echo "Cleaning Up..."
|
| 75 |
-
|
| 76 |
-
git checkout "$curbranch"
|
| 77 |
-
git branch -D "$branch"
|
| 78 |
-
|
| 79 |
-
echo "Done"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2-bootstrap.css
DELETED
|
@@ -1,87 +0,0 @@
|
|
| 1 |
-
.form-control .select2-choice {
|
| 2 |
-
border: 0;
|
| 3 |
-
border-radius: 2px;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
.form-control .select2-choice .select2-arrow {
|
| 7 |
-
border-radius: 0 2px 2px 0;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.form-control.select2-container {
|
| 11 |
-
height: auto !important;
|
| 12 |
-
padding: 0;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
-
border-color: #5897FB;
|
| 17 |
-
border-radius: 3px 3px 0 0;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
-
border-radius: 3px 3px 0 0;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.form-control.select2-container .select2-choices {
|
| 25 |
-
border: 0 !important;
|
| 26 |
-
border-radius: 3px;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
.control-group.warning .select2-container .select2-choice,
|
| 30 |
-
.control-group.warning .select2-container .select2-choices,
|
| 31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
-
border: 1px solid #C09853 !important;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
-
border-left: 1px solid #C09853 !important;
|
| 41 |
-
background: #FCF8E3 !important;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
.control-group.error .select2-container .select2-choice,
|
| 45 |
-
.control-group.error .select2-container .select2-choices,
|
| 46 |
-
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
-
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
-
border: 1px solid #B94A48 !important;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.control-group.error .select2-container .select2-choice div {
|
| 55 |
-
border-left: 1px solid #B94A48 !important;
|
| 56 |
-
background: #F2DEDE !important;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.control-group.info .select2-container .select2-choice,
|
| 60 |
-
.control-group.info .select2-container .select2-choices,
|
| 61 |
-
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
-
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
-
border: 1px solid #3A87AD !important;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.control-group.info .select2-container .select2-choice div {
|
| 70 |
-
border-left: 1px solid #3A87AD !important;
|
| 71 |
-
background: #D9EDF7 !important;
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
.control-group.success .select2-container .select2-choice,
|
| 75 |
-
.control-group.success .select2-container .select2-choices,
|
| 76 |
-
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
-
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
-
border: 1px solid #468847 !important;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
.control-group.success .select2-container .select2-choice div {
|
| 85 |
-
border-left: 1px solid #468847 !important;
|
| 86 |
-
background: #DFF0D8 !important;
|
| 87 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2-spinner.gif
DELETED
|
Binary file
|
drkfr/js/vendor/select2/select2.css
DELETED
|
@@ -1,704 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 3 |
-
*/
|
| 4 |
-
.select2-container {
|
| 5 |
-
margin: 0;
|
| 6 |
-
position: relative;
|
| 7 |
-
display: inline-block;
|
| 8 |
-
/* inline-block for ie7 */
|
| 9 |
-
zoom: 1;
|
| 10 |
-
*display: inline;
|
| 11 |
-
vertical-align: middle;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.select2-container,
|
| 15 |
-
.select2-drop,
|
| 16 |
-
.select2-search,
|
| 17 |
-
.select2-search input {
|
| 18 |
-
/*
|
| 19 |
-
Force border-box so that % widths fit the parent
|
| 20 |
-
container without overlap because of margin/padding.
|
| 21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
-
*/
|
| 23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
-
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
-
box-sizing: border-box; /* css3 */
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.select2-container .select2-choice {
|
| 29 |
-
display: block;
|
| 30 |
-
height: 26px;
|
| 31 |
-
padding: 0 0 0 8px;
|
| 32 |
-
overflow: hidden;
|
| 33 |
-
position: relative;
|
| 34 |
-
|
| 35 |
-
border: 1px solid #aaa;
|
| 36 |
-
white-space: nowrap;
|
| 37 |
-
line-height: 26px;
|
| 38 |
-
color: #444;
|
| 39 |
-
text-decoration: none;
|
| 40 |
-
|
| 41 |
-
border-radius: 4px;
|
| 42 |
-
|
| 43 |
-
background-clip: padding-box;
|
| 44 |
-
|
| 45 |
-
-webkit-touch-callout: none;
|
| 46 |
-
-webkit-user-select: none;
|
| 47 |
-
-moz-user-select: none;
|
| 48 |
-
-ms-user-select: none;
|
| 49 |
-
user-select: none;
|
| 50 |
-
|
| 51 |
-
background-color: #fff;
|
| 52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
-
padding: 0 8px 0 0;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
-
border-bottom-color: #aaa;
|
| 65 |
-
|
| 66 |
-
border-radius: 0 0 4px 4px;
|
| 67 |
-
|
| 68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
-
margin-right: 42px;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
-
margin-right: 26px;
|
| 81 |
-
display: block;
|
| 82 |
-
overflow: hidden;
|
| 83 |
-
|
| 84 |
-
white-space: nowrap;
|
| 85 |
-
|
| 86 |
-
text-overflow: ellipsis;
|
| 87 |
-
float: none;
|
| 88 |
-
width: auto;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
-
margin-left: 26px;
|
| 93 |
-
margin-right: 0;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
.select2-container .select2-choice abbr {
|
| 97 |
-
display: none;
|
| 98 |
-
width: 12px;
|
| 99 |
-
height: 12px;
|
| 100 |
-
position: absolute;
|
| 101 |
-
right: 24px;
|
| 102 |
-
top: 8px;
|
| 103 |
-
|
| 104 |
-
font-size: 1px;
|
| 105 |
-
text-decoration: none;
|
| 106 |
-
|
| 107 |
-
border: 0;
|
| 108 |
-
background: url('select2.png') right top no-repeat;
|
| 109 |
-
cursor: pointer;
|
| 110 |
-
outline: 0;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
-
display: inline-block;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
.select2-container .select2-choice abbr:hover {
|
| 118 |
-
background-position: right -11px;
|
| 119 |
-
cursor: pointer;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.select2-drop-mask {
|
| 123 |
-
border: 0;
|
| 124 |
-
margin: 0;
|
| 125 |
-
padding: 0;
|
| 126 |
-
position: fixed;
|
| 127 |
-
left: 0;
|
| 128 |
-
top: 0;
|
| 129 |
-
min-height: 100%;
|
| 130 |
-
min-width: 100%;
|
| 131 |
-
height: auto;
|
| 132 |
-
width: auto;
|
| 133 |
-
opacity: 0;
|
| 134 |
-
z-index: 9998;
|
| 135 |
-
/* styles required for IE to work */
|
| 136 |
-
background-color: #fff;
|
| 137 |
-
filter: alpha(opacity=0);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
.select2-drop {
|
| 141 |
-
width: 100%;
|
| 142 |
-
margin-top: -1px;
|
| 143 |
-
position: absolute;
|
| 144 |
-
z-index: 9999;
|
| 145 |
-
top: 100%;
|
| 146 |
-
|
| 147 |
-
background: #fff;
|
| 148 |
-
color: #000;
|
| 149 |
-
border: 1px solid #aaa;
|
| 150 |
-
border-top: 0;
|
| 151 |
-
|
| 152 |
-
border-radius: 0 0 4px 4px;
|
| 153 |
-
|
| 154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
.select2-drop.select2-drop-above {
|
| 159 |
-
margin-top: 1px;
|
| 160 |
-
border-top: 1px solid #aaa;
|
| 161 |
-
border-bottom: 0;
|
| 162 |
-
|
| 163 |
-
border-radius: 4px 4px 0 0;
|
| 164 |
-
|
| 165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.select2-drop-active {
|
| 170 |
-
border: 1px solid #5897fb;
|
| 171 |
-
border-top: none;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
-
border-top: 1px solid #5897fb;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.select2-drop-auto-width {
|
| 179 |
-
border-top: 1px solid #aaa;
|
| 180 |
-
width: auto;
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.select2-drop-auto-width .select2-search {
|
| 184 |
-
padding-top: 4px;
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
.select2-container .select2-choice .select2-arrow {
|
| 188 |
-
display: inline-block;
|
| 189 |
-
width: 18px;
|
| 190 |
-
height: 100%;
|
| 191 |
-
position: absolute;
|
| 192 |
-
right: 0;
|
| 193 |
-
top: 0;
|
| 194 |
-
|
| 195 |
-
border-left: 1px solid #aaa;
|
| 196 |
-
border-radius: 0 4px 4px 0;
|
| 197 |
-
|
| 198 |
-
background-clip: padding-box;
|
| 199 |
-
|
| 200 |
-
background: #ccc;
|
| 201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
-
left: 0;
|
| 210 |
-
right: auto;
|
| 211 |
-
|
| 212 |
-
border-left: none;
|
| 213 |
-
border-right: 1px solid #aaa;
|
| 214 |
-
border-radius: 4px 0 0 4px;
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
-
display: block;
|
| 219 |
-
width: 100%;
|
| 220 |
-
height: 100%;
|
| 221 |
-
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
-
background-position: 2px 1px;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.select2-search {
|
| 229 |
-
display: inline-block;
|
| 230 |
-
width: 100%;
|
| 231 |
-
min-height: 26px;
|
| 232 |
-
margin: 0;
|
| 233 |
-
padding-left: 4px;
|
| 234 |
-
padding-right: 4px;
|
| 235 |
-
|
| 236 |
-
position: relative;
|
| 237 |
-
z-index: 10000;
|
| 238 |
-
|
| 239 |
-
white-space: nowrap;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
.select2-search input {
|
| 243 |
-
width: 100%;
|
| 244 |
-
height: auto !important;
|
| 245 |
-
min-height: 26px;
|
| 246 |
-
padding: 4px 20px 4px 5px;
|
| 247 |
-
margin: 0;
|
| 248 |
-
|
| 249 |
-
outline: 0;
|
| 250 |
-
font-family: sans-serif;
|
| 251 |
-
font-size: 1em;
|
| 252 |
-
|
| 253 |
-
border: 1px solid #aaa;
|
| 254 |
-
border-radius: 0;
|
| 255 |
-
|
| 256 |
-
-webkit-box-shadow: none;
|
| 257 |
-
box-shadow: none;
|
| 258 |
-
|
| 259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
html[dir="rtl"] .select2-search input {
|
| 267 |
-
padding: 4px 5px 4px 20px;
|
| 268 |
-
|
| 269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
-
margin-top: 4px;
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
.select2-search input.select2-active {
|
| 281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.select2-container-active .select2-choice,
|
| 289 |
-
.select2-container-active .select2-choices {
|
| 290 |
-
border: 1px solid #5897fb;
|
| 291 |
-
outline: none;
|
| 292 |
-
|
| 293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
.select2-dropdown-open .select2-choice {
|
| 298 |
-
border-bottom-color: transparent;
|
| 299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
-
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
-
|
| 302 |
-
border-bottom-left-radius: 0;
|
| 303 |
-
border-bottom-right-radius: 0;
|
| 304 |
-
|
| 305 |
-
background-color: #eee;
|
| 306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
-
border: 1px solid #5897fb;
|
| 316 |
-
border-top-color: transparent;
|
| 317 |
-
|
| 318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
-
background: transparent;
|
| 327 |
-
border-left: none;
|
| 328 |
-
filter: none;
|
| 329 |
-
}
|
| 330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
-
border-right: none;
|
| 332 |
-
}
|
| 333 |
-
|
| 334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
-
background-position: -18px 1px;
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
-
background-position: -16px 1px;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
.select2-hidden-accessible {
|
| 343 |
-
border: 0;
|
| 344 |
-
clip: rect(0 0 0 0);
|
| 345 |
-
height: 1px;
|
| 346 |
-
margin: -1px;
|
| 347 |
-
overflow: hidden;
|
| 348 |
-
padding: 0;
|
| 349 |
-
position: absolute;
|
| 350 |
-
width: 1px;
|
| 351 |
-
}
|
| 352 |
-
|
| 353 |
-
/* results */
|
| 354 |
-
.select2-results {
|
| 355 |
-
max-height: 200px;
|
| 356 |
-
padding: 0 0 0 4px;
|
| 357 |
-
margin: 4px 4px 4px 0;
|
| 358 |
-
position: relative;
|
| 359 |
-
overflow-x: hidden;
|
| 360 |
-
overflow-y: auto;
|
| 361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
html[dir="rtl"] .select2-results {
|
| 365 |
-
padding: 0 4px 0 0;
|
| 366 |
-
margin: 4px 0 4px 4px;
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
.select2-results ul.select2-result-sub {
|
| 370 |
-
margin: 0;
|
| 371 |
-
padding-left: 0;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
.select2-results li {
|
| 375 |
-
list-style: none;
|
| 376 |
-
display: list-item;
|
| 377 |
-
background-image: none;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
-
font-weight: bold;
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
.select2-results .select2-result-label {
|
| 385 |
-
padding: 3px 7px 4px;
|
| 386 |
-
margin: 0;
|
| 387 |
-
cursor: pointer;
|
| 388 |
-
|
| 389 |
-
min-height: 1em;
|
| 390 |
-
|
| 391 |
-
-webkit-touch-callout: none;
|
| 392 |
-
-webkit-user-select: none;
|
| 393 |
-
-moz-user-select: none;
|
| 394 |
-
-ms-user-select: none;
|
| 395 |
-
user-select: none;
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
-
|
| 406 |
-
.select2-results .select2-highlighted {
|
| 407 |
-
background: #3875d7;
|
| 408 |
-
color: #fff;
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
.select2-results li em {
|
| 412 |
-
background: #feffde;
|
| 413 |
-
font-style: normal;
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
.select2-results .select2-highlighted em {
|
| 417 |
-
background: transparent;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
.select2-results .select2-highlighted ul {
|
| 421 |
-
background: #fff;
|
| 422 |
-
color: #000;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
.select2-results .select2-no-results,
|
| 426 |
-
.select2-results .select2-searching,
|
| 427 |
-
.select2-results .select2-ajax-error,
|
| 428 |
-
.select2-results .select2-selection-limit {
|
| 429 |
-
background: #f4f4f4;
|
| 430 |
-
display: list-item;
|
| 431 |
-
padding-left: 5px;
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
/*
|
| 435 |
-
disabled look for disabled choices in the results dropdown
|
| 436 |
-
*/
|
| 437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
-
color: #666;
|
| 439 |
-
background: #f4f4f4;
|
| 440 |
-
display: list-item;
|
| 441 |
-
cursor: default;
|
| 442 |
-
}
|
| 443 |
-
.select2-results .select2-disabled {
|
| 444 |
-
background: #f4f4f4;
|
| 445 |
-
display: list-item;
|
| 446 |
-
cursor: default;
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
.select2-results .select2-selected {
|
| 450 |
-
display: none;
|
| 451 |
-
}
|
| 452 |
-
|
| 453 |
-
.select2-more-results.select2-active {
|
| 454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
.select2-results .select2-ajax-error {
|
| 458 |
-
background: rgba(255, 50, 50, .2);
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
.select2-more-results {
|
| 462 |
-
background: #f4f4f4;
|
| 463 |
-
display: list-item;
|
| 464 |
-
}
|
| 465 |
-
|
| 466 |
-
/* disabled styles */
|
| 467 |
-
|
| 468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
-
background-color: #f4f4f4;
|
| 470 |
-
background-image: none;
|
| 471 |
-
border: 1px solid #ddd;
|
| 472 |
-
cursor: default;
|
| 473 |
-
}
|
| 474 |
-
|
| 475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
-
background-color: #f4f4f4;
|
| 477 |
-
background-image: none;
|
| 478 |
-
border-left: 0;
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
-
display: none;
|
| 483 |
-
}
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
/* multiselect */
|
| 487 |
-
|
| 488 |
-
.select2-container-multi .select2-choices {
|
| 489 |
-
height: auto !important;
|
| 490 |
-
height: 1%;
|
| 491 |
-
margin: 0;
|
| 492 |
-
padding: 0 5px 0 0;
|
| 493 |
-
position: relative;
|
| 494 |
-
|
| 495 |
-
border: 1px solid #aaa;
|
| 496 |
-
cursor: text;
|
| 497 |
-
overflow: hidden;
|
| 498 |
-
|
| 499 |
-
background-color: #fff;
|
| 500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
-
}
|
| 505 |
-
|
| 506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
-
padding: 0 0 0 5px;
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
.select2-locked {
|
| 511 |
-
padding: 3px 5px 3px 5px !important;
|
| 512 |
-
}
|
| 513 |
-
|
| 514 |
-
.select2-container-multi .select2-choices {
|
| 515 |
-
min-height: 26px;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
-
border: 1px solid #5897fb;
|
| 520 |
-
outline: none;
|
| 521 |
-
|
| 522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
-
}
|
| 525 |
-
.select2-container-multi .select2-choices li {
|
| 526 |
-
float: left;
|
| 527 |
-
list-style: none;
|
| 528 |
-
}
|
| 529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
-
{
|
| 531 |
-
float: right;
|
| 532 |
-
}
|
| 533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
-
margin: 0;
|
| 535 |
-
padding: 0;
|
| 536 |
-
white-space: nowrap;
|
| 537 |
-
}
|
| 538 |
-
|
| 539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
-
padding: 5px;
|
| 541 |
-
margin: 1px 0;
|
| 542 |
-
|
| 543 |
-
font-family: sans-serif;
|
| 544 |
-
font-size: 100%;
|
| 545 |
-
color: #666;
|
| 546 |
-
outline: 0;
|
| 547 |
-
border: 0;
|
| 548 |
-
-webkit-box-shadow: none;
|
| 549 |
-
box-shadow: none;
|
| 550 |
-
background: transparent !important;
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
-
}
|
| 556 |
-
|
| 557 |
-
.select2-default {
|
| 558 |
-
color: #999 !important;
|
| 559 |
-
}
|
| 560 |
-
|
| 561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
-
padding: 3px 5px 3px 18px;
|
| 563 |
-
margin: 3px 0 3px 5px;
|
| 564 |
-
position: relative;
|
| 565 |
-
|
| 566 |
-
line-height: 13px;
|
| 567 |
-
color: #333;
|
| 568 |
-
cursor: default;
|
| 569 |
-
border: 1px solid #aaaaaa;
|
| 570 |
-
|
| 571 |
-
border-radius: 3px;
|
| 572 |
-
|
| 573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
-
|
| 576 |
-
background-clip: padding-box;
|
| 577 |
-
|
| 578 |
-
-webkit-touch-callout: none;
|
| 579 |
-
-webkit-user-select: none;
|
| 580 |
-
-moz-user-select: none;
|
| 581 |
-
-ms-user-select: none;
|
| 582 |
-
user-select: none;
|
| 583 |
-
|
| 584 |
-
background-color: #e4e4e4;
|
| 585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
-
background-image: linear-gradient(to top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
-
}
|
| 591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
-
{
|
| 593 |
-
margin: 3px 5px 3px 0;
|
| 594 |
-
padding: 3px 18px 3px 5px;
|
| 595 |
-
}
|
| 596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
-
cursor: default;
|
| 598 |
-
}
|
| 599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
-
background: #d4d4d4;
|
| 601 |
-
}
|
| 602 |
-
|
| 603 |
-
.select2-search-choice-close {
|
| 604 |
-
display: block;
|
| 605 |
-
width: 12px;
|
| 606 |
-
height: 13px;
|
| 607 |
-
position: absolute;
|
| 608 |
-
right: 3px;
|
| 609 |
-
top: 4px;
|
| 610 |
-
|
| 611 |
-
font-size: 1px;
|
| 612 |
-
outline: none;
|
| 613 |
-
background: url('select2.png') right top no-repeat;
|
| 614 |
-
}
|
| 615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
-
right: auto;
|
| 617 |
-
left: 3px;
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
.select2-container-multi .select2-search-choice-close {
|
| 621 |
-
left: 3px;
|
| 622 |
-
}
|
| 623 |
-
|
| 624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
-
left: auto;
|
| 626 |
-
right: 2px;
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
-
background-position: right -11px;
|
| 631 |
-
}
|
| 632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
-
background-position: right -11px;
|
| 634 |
-
}
|
| 635 |
-
|
| 636 |
-
/* disabled styles */
|
| 637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
-
background-color: #f4f4f4;
|
| 639 |
-
background-image: none;
|
| 640 |
-
border: 1px solid #ddd;
|
| 641 |
-
cursor: default;
|
| 642 |
-
}
|
| 643 |
-
|
| 644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
-
padding: 3px 5px 3px 5px;
|
| 646 |
-
border: 1px solid #ddd;
|
| 647 |
-
background-image: none;
|
| 648 |
-
background-color: #f4f4f4;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
-
background: none;
|
| 653 |
-
}
|
| 654 |
-
/* end multiselect */
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
.select2-result-selectable .select2-match,
|
| 658 |
-
.select2-result-unselectable .select2-match {
|
| 659 |
-
text-decoration: underline;
|
| 660 |
-
}
|
| 661 |
-
|
| 662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
-
clip: rect(0 0 0 0) !important;
|
| 664 |
-
width: 1px !important;
|
| 665 |
-
height: 1px !important;
|
| 666 |
-
border: 0 !important;
|
| 667 |
-
margin: 0 !important;
|
| 668 |
-
padding: 0 !important;
|
| 669 |
-
overflow: hidden !important;
|
| 670 |
-
position: absolute !important;
|
| 671 |
-
outline: 0 !important;
|
| 672 |
-
left: 0px !important;
|
| 673 |
-
top: 0px !important;
|
| 674 |
-
}
|
| 675 |
-
|
| 676 |
-
.select2-display-none {
|
| 677 |
-
display: none;
|
| 678 |
-
}
|
| 679 |
-
|
| 680 |
-
.select2-measure-scrollbar {
|
| 681 |
-
position: absolute;
|
| 682 |
-
top: -10000px;
|
| 683 |
-
left: -10000px;
|
| 684 |
-
width: 100px;
|
| 685 |
-
height: 100px;
|
| 686 |
-
overflow: scroll;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
/* Retina-ize icons */
|
| 690 |
-
|
| 691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
-
.select2-search input,
|
| 693 |
-
.select2-search-choice-close,
|
| 694 |
-
.select2-container .select2-choice abbr,
|
| 695 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
-
background-image: url('select2x2.png') !important;
|
| 697 |
-
background-repeat: no-repeat !important;
|
| 698 |
-
background-size: 60px 40px !important;
|
| 699 |
-
}
|
| 700 |
-
|
| 701 |
-
.select2-search input {
|
| 702 |
-
background-position: 100% -21px !important;
|
| 703 |
-
}
|
| 704 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2.jquery.json
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"title": "Select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 5 |
-
"keywords": [
|
| 6 |
-
"select",
|
| 7 |
-
"autocomplete",
|
| 8 |
-
"typeahead",
|
| 9 |
-
"dropdown",
|
| 10 |
-
"multiselect",
|
| 11 |
-
"tag",
|
| 12 |
-
"tagging"
|
| 13 |
-
],
|
| 14 |
-
"version": "3.5.1",
|
| 15 |
-
"author": {
|
| 16 |
-
"name": "Igor Vaynberg",
|
| 17 |
-
"url": "https://github.com/ivaynberg"
|
| 18 |
-
},
|
| 19 |
-
"licenses": [
|
| 20 |
-
{
|
| 21 |
-
"type": "Apache",
|
| 22 |
-
"url": "http://www.apache.org/licenses/LICENSE-2.0"
|
| 23 |
-
},
|
| 24 |
-
{
|
| 25 |
-
"type": "GPL v2",
|
| 26 |
-
"url": "http://www.gnu.org/licenses/gpl-2.0.html"
|
| 27 |
-
}
|
| 28 |
-
],
|
| 29 |
-
"bugs": "https://github.com/ivaynberg/select2/issues",
|
| 30 |
-
"homepage": "http://ivaynberg.github.com/select2",
|
| 31 |
-
"docs": "http://ivaynberg.github.com/select2/",
|
| 32 |
-
"download": "https://github.com/ivaynberg/select2/tags",
|
| 33 |
-
"dependencies": {
|
| 34 |
-
"jquery": ">=1.7.1"
|
| 35 |
-
}
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2.js
DELETED
|
@@ -1,3508 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2012 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
(function ($) {
|
| 22 |
-
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
-
$.extend($.fn, {
|
| 24 |
-
/*
|
| 25 |
-
* 4-10 times faster .each replacement
|
| 26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
-
*/
|
| 28 |
-
each2 : function (c) {
|
| 29 |
-
var j = $([0]), i = -1, l = this.length;
|
| 30 |
-
while (
|
| 31 |
-
++i < l
|
| 32 |
-
&& (j.context = j[0] = this[i])
|
| 33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
-
);
|
| 35 |
-
return this;
|
| 36 |
-
}
|
| 37 |
-
});
|
| 38 |
-
}
|
| 39 |
-
})(jQuery);
|
| 40 |
-
|
| 41 |
-
(function ($, undefined) {
|
| 42 |
-
"use strict";
|
| 43 |
-
/*global document, window, jQuery, console */
|
| 44 |
-
|
| 45 |
-
if (window.Select2 !== undefined) {
|
| 46 |
-
return;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
-
|
| 52 |
-
KEY = {
|
| 53 |
-
TAB: 9,
|
| 54 |
-
ENTER: 13,
|
| 55 |
-
ESC: 27,
|
| 56 |
-
SPACE: 32,
|
| 57 |
-
LEFT: 37,
|
| 58 |
-
UP: 38,
|
| 59 |
-
RIGHT: 39,
|
| 60 |
-
DOWN: 40,
|
| 61 |
-
SHIFT: 16,
|
| 62 |
-
CTRL: 17,
|
| 63 |
-
ALT: 18,
|
| 64 |
-
PAGE_UP: 33,
|
| 65 |
-
PAGE_DOWN: 34,
|
| 66 |
-
HOME: 36,
|
| 67 |
-
END: 35,
|
| 68 |
-
BACKSPACE: 8,
|
| 69 |
-
DELETE: 46,
|
| 70 |
-
isArrow: function (k) {
|
| 71 |
-
k = k.which ? k.which : k;
|
| 72 |
-
switch (k) {
|
| 73 |
-
case KEY.LEFT:
|
| 74 |
-
case KEY.RIGHT:
|
| 75 |
-
case KEY.UP:
|
| 76 |
-
case KEY.DOWN:
|
| 77 |
-
return true;
|
| 78 |
-
}
|
| 79 |
-
return false;
|
| 80 |
-
},
|
| 81 |
-
isControl: function (e) {
|
| 82 |
-
var k = e.which;
|
| 83 |
-
switch (k) {
|
| 84 |
-
case KEY.SHIFT:
|
| 85 |
-
case KEY.CTRL:
|
| 86 |
-
case KEY.ALT:
|
| 87 |
-
return true;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
if (e.metaKey) return true;
|
| 91 |
-
|
| 92 |
-
return false;
|
| 93 |
-
},
|
| 94 |
-
isFunctionKey: function (k) {
|
| 95 |
-
k = k.which ? k.which : k;
|
| 96 |
-
return k >= 112 && k <= 123;
|
| 97 |
-
}
|
| 98 |
-
},
|
| 99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
-
|
| 101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
-
|
| 103 |
-
$document = $(document);
|
| 104 |
-
|
| 105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
function reinsertElement(element) {
|
| 109 |
-
var placeholder = $(document.createTextNode(''));
|
| 110 |
-
|
| 111 |
-
element.before(placeholder);
|
| 112 |
-
placeholder.before(element);
|
| 113 |
-
placeholder.remove();
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
function stripDiacritics(str) {
|
| 117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
-
function match(a) {
|
| 119 |
-
return DIACRITICS[a] || a;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
function indexOf(value, array) {
|
| 126 |
-
var i = 0, l = array.length;
|
| 127 |
-
for (; i < l; i = i + 1) {
|
| 128 |
-
if (equal(value, array[i])) return i;
|
| 129 |
-
}
|
| 130 |
-
return -1;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
function measureScrollbar () {
|
| 134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
-
$template.appendTo('body');
|
| 136 |
-
|
| 137 |
-
var dim = {
|
| 138 |
-
width: $template.width() - $template[0].clientWidth,
|
| 139 |
-
height: $template.height() - $template[0].clientHeight
|
| 140 |
-
};
|
| 141 |
-
$template.remove();
|
| 142 |
-
|
| 143 |
-
return dim;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Compares equality of a and b
|
| 148 |
-
* @param a
|
| 149 |
-
* @param b
|
| 150 |
-
*/
|
| 151 |
-
function equal(a, b) {
|
| 152 |
-
if (a === b) return true;
|
| 153 |
-
if (a === undefined || b === undefined) return false;
|
| 154 |
-
if (a === null || b === null) return false;
|
| 155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
-
return false;
|
| 160 |
-
}
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
* Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty
|
| 164 |
-
* strings
|
| 165 |
-
* @param string
|
| 166 |
-
* @param separator
|
| 167 |
-
*/
|
| 168 |
-
function splitVal(string, separator) {
|
| 169 |
-
var val, i, l;
|
| 170 |
-
if (string === null || string.length < 1) return [];
|
| 171 |
-
val = string.split(separator);
|
| 172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]);
|
| 173 |
-
return val;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
function getSideBorderPadding(element) {
|
| 177 |
-
return element.outerWidth(false) - element.width();
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function installKeyUpChangeEvent(element) {
|
| 181 |
-
var key="keyup-change-value";
|
| 182 |
-
element.on("keydown", function () {
|
| 183 |
-
if ($.data(element, key) === undefined) {
|
| 184 |
-
$.data(element, key, element.val());
|
| 185 |
-
}
|
| 186 |
-
});
|
| 187 |
-
element.on("keyup", function () {
|
| 188 |
-
var val= $.data(element, key);
|
| 189 |
-
if (val !== undefined && element.val() !== val) {
|
| 190 |
-
$.removeData(element, key);
|
| 191 |
-
element.trigger("keyup-change");
|
| 192 |
-
}
|
| 193 |
-
});
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
/**
|
| 198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
-
*
|
| 200 |
-
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
-
* the elements under the pointer are scrolled.
|
| 202 |
-
*/
|
| 203 |
-
function installFilteredMouseMove(element) {
|
| 204 |
-
element.on("mousemove", function (e) {
|
| 205 |
-
var lastpos = lastMousePosition;
|
| 206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
-
}
|
| 209 |
-
});
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
/**
|
| 213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
-
* within the last quietMillis milliseconds.
|
| 215 |
-
*
|
| 216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
-
* @param fn function to be debounced
|
| 218 |
-
* @param ctx object to be used as this reference within fn
|
| 219 |
-
* @return debounced version of fn
|
| 220 |
-
*/
|
| 221 |
-
function debounce(quietMillis, fn, ctx) {
|
| 222 |
-
ctx = ctx || undefined;
|
| 223 |
-
var timeout;
|
| 224 |
-
return function () {
|
| 225 |
-
var args = arguments;
|
| 226 |
-
window.clearTimeout(timeout);
|
| 227 |
-
timeout = window.setTimeout(function() {
|
| 228 |
-
fn.apply(ctx, args);
|
| 229 |
-
}, quietMillis);
|
| 230 |
-
};
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
function installDebouncedScroll(threshold, element) {
|
| 234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
-
element.on("scroll", function (e) {
|
| 236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
-
});
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
function focus($el) {
|
| 241 |
-
if ($el[0] === document.activeElement) return;
|
| 242 |
-
|
| 243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
-
of the current event has finished - which seems like the only reliable way
|
| 245 |
-
to set focus */
|
| 246 |
-
window.setTimeout(function() {
|
| 247 |
-
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
-
|
| 249 |
-
$el.focus();
|
| 250 |
-
|
| 251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
-
sometimes modals or others listeners may steal it after its set */
|
| 253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
-
if (isVisible && el === document.activeElement) {
|
| 255 |
-
|
| 256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
-
just before setting focus */
|
| 258 |
-
if(el.setSelectionRange)
|
| 259 |
-
{
|
| 260 |
-
el.setSelectionRange(pos, pos);
|
| 261 |
-
}
|
| 262 |
-
else if (el.createTextRange) {
|
| 263 |
-
range = el.createTextRange();
|
| 264 |
-
range.collapse(false);
|
| 265 |
-
range.select();
|
| 266 |
-
}
|
| 267 |
-
}
|
| 268 |
-
}, 0);
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
function getCursorInfo(el) {
|
| 272 |
-
el = $(el)[0];
|
| 273 |
-
var offset = 0;
|
| 274 |
-
var length = 0;
|
| 275 |
-
if ('selectionStart' in el) {
|
| 276 |
-
offset = el.selectionStart;
|
| 277 |
-
length = el.selectionEnd - offset;
|
| 278 |
-
} else if ('selection' in document) {
|
| 279 |
-
el.focus();
|
| 280 |
-
var sel = document.selection.createRange();
|
| 281 |
-
length = document.selection.createRange().text.length;
|
| 282 |
-
sel.moveStart('character', -el.value.length);
|
| 283 |
-
offset = sel.text.length - length;
|
| 284 |
-
}
|
| 285 |
-
return { offset: offset, length: length };
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
function killEvent(event) {
|
| 289 |
-
event.preventDefault();
|
| 290 |
-
event.stopPropagation();
|
| 291 |
-
}
|
| 292 |
-
function killEventImmediately(event) {
|
| 293 |
-
event.preventDefault();
|
| 294 |
-
event.stopImmediatePropagation();
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
function measureTextWidth(e) {
|
| 298 |
-
if (!sizer){
|
| 299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
-
sizer = $(document.createElement("div")).css({
|
| 301 |
-
position: "absolute",
|
| 302 |
-
left: "-10000px",
|
| 303 |
-
top: "-10000px",
|
| 304 |
-
display: "none",
|
| 305 |
-
fontSize: style.fontSize,
|
| 306 |
-
fontFamily: style.fontFamily,
|
| 307 |
-
fontStyle: style.fontStyle,
|
| 308 |
-
fontWeight: style.fontWeight,
|
| 309 |
-
letterSpacing: style.letterSpacing,
|
| 310 |
-
textTransform: style.textTransform,
|
| 311 |
-
whiteSpace: "nowrap"
|
| 312 |
-
});
|
| 313 |
-
sizer.attr("class","select2-sizer");
|
| 314 |
-
$("body").append(sizer);
|
| 315 |
-
}
|
| 316 |
-
sizer.text(e.val());
|
| 317 |
-
return sizer.width();
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
function syncCssClasses(dest, src, adapter) {
|
| 321 |
-
var classes, replacements = [], adapted;
|
| 322 |
-
|
| 323 |
-
classes = $.trim(dest.attr("class"));
|
| 324 |
-
|
| 325 |
-
if (classes) {
|
| 326 |
-
classes = '' + classes; // for IE which returns object
|
| 327 |
-
|
| 328 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
-
if (this.indexOf("select2-") === 0) {
|
| 330 |
-
replacements.push(this);
|
| 331 |
-
}
|
| 332 |
-
});
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
classes = $.trim(src.attr("class"));
|
| 336 |
-
|
| 337 |
-
if (classes) {
|
| 338 |
-
classes = '' + classes; // for IE which returns object
|
| 339 |
-
|
| 340 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
-
if (this.indexOf("select2-") !== 0) {
|
| 342 |
-
adapted = adapter(this);
|
| 343 |
-
|
| 344 |
-
if (adapted) {
|
| 345 |
-
replacements.push(adapted);
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
});
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
dest.attr("class", replacements.join(" "));
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
-
tl=term.length;
|
| 358 |
-
|
| 359 |
-
if (match<0) {
|
| 360 |
-
markup.push(escapeMarkup(text));
|
| 361 |
-
return;
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
-
markup.push("<span class='select2-match'>");
|
| 366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
-
markup.push("</span>");
|
| 368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
-
}
|
| 370 |
-
|
| 371 |
-
function defaultEscapeMarkup(markup) {
|
| 372 |
-
var replace_map = {
|
| 373 |
-
'\\': '\',
|
| 374 |
-
'&': '&',
|
| 375 |
-
'<': '<',
|
| 376 |
-
'>': '>',
|
| 377 |
-
'"': '"',
|
| 378 |
-
"'": ''',
|
| 379 |
-
"/": '/'
|
| 380 |
-
};
|
| 381 |
-
|
| 382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
-
return replace_map[match];
|
| 384 |
-
});
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
/**
|
| 388 |
-
* Produces an ajax-based query function
|
| 389 |
-
*
|
| 390 |
-
* @param options object containing configuration parameters
|
| 391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
-
* @param options.url url for the data
|
| 394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
-
* The expected format is an object containing the following keys:
|
| 399 |
-
* results array of objects that will be used as choices
|
| 400 |
-
* more (optional) boolean indicating whether there are more results available
|
| 401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
-
*/
|
| 403 |
-
function ajax(options) {
|
| 404 |
-
var timeout, // current scheduled but not yet executed request
|
| 405 |
-
handler = null,
|
| 406 |
-
quietMillis = options.quietMillis || 100,
|
| 407 |
-
ajaxUrl = options.url,
|
| 408 |
-
self = this;
|
| 409 |
-
|
| 410 |
-
return function (query) {
|
| 411 |
-
window.clearTimeout(timeout);
|
| 412 |
-
timeout = window.setTimeout(function () {
|
| 413 |
-
var data = options.data, // ajax data function
|
| 414 |
-
url = ajaxUrl, // ajax url string or function
|
| 415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
-
deprecated = {
|
| 418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
-
cache: options.cache || false,
|
| 420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
-
dataType: options.dataType||"json"
|
| 422 |
-
},
|
| 423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
-
|
| 425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
-
|
| 428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
-
|
| 430 |
-
if (options.params) {
|
| 431 |
-
if ($.isFunction(options.params)) {
|
| 432 |
-
$.extend(params, options.params.call(self));
|
| 433 |
-
} else {
|
| 434 |
-
$.extend(params, options.params);
|
| 435 |
-
}
|
| 436 |
-
}
|
| 437 |
-
|
| 438 |
-
$.extend(params, {
|
| 439 |
-
url: url,
|
| 440 |
-
dataType: options.dataType,
|
| 441 |
-
data: data,
|
| 442 |
-
success: function (data) {
|
| 443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
-
// added query as third paramter to keep backwards compatibility
|
| 445 |
-
var results = options.results(data, query.page, query);
|
| 446 |
-
query.callback(results);
|
| 447 |
-
},
|
| 448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
-
var results = {
|
| 450 |
-
hasError: true,
|
| 451 |
-
jqXHR: jqXHR,
|
| 452 |
-
textStatus: textStatus,
|
| 453 |
-
errorThrown: errorThrown,
|
| 454 |
-
};
|
| 455 |
-
|
| 456 |
-
query.callback(results);
|
| 457 |
-
}
|
| 458 |
-
});
|
| 459 |
-
handler = transport.call(self, params);
|
| 460 |
-
}, quietMillis);
|
| 461 |
-
};
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
/**
|
| 465 |
-
* Produces a query function that works with a local array
|
| 466 |
-
*
|
| 467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
-
* object.
|
| 469 |
-
*
|
| 470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
-
*
|
| 472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
-
* the text.
|
| 477 |
-
*/
|
| 478 |
-
function local(options) {
|
| 479 |
-
var data = options, // data elements
|
| 480 |
-
dataText,
|
| 481 |
-
tmp,
|
| 482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
-
|
| 484 |
-
if ($.isArray(data)) {
|
| 485 |
-
tmp = data;
|
| 486 |
-
data = { results: tmp };
|
| 487 |
-
}
|
| 488 |
-
|
| 489 |
-
if ($.isFunction(data) === false) {
|
| 490 |
-
tmp = data;
|
| 491 |
-
data = function() { return tmp; };
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
var dataItem = data();
|
| 495 |
-
if (dataItem.text) {
|
| 496 |
-
text = dataItem.text;
|
| 497 |
-
// if text is not a function we assume it to be a key name
|
| 498 |
-
if (!$.isFunction(text)) {
|
| 499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
-
text = function (item) { return item[dataText]; };
|
| 501 |
-
}
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
return function (query) {
|
| 505 |
-
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
-
if (t === "") {
|
| 507 |
-
query.callback(data());
|
| 508 |
-
return;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
process = function(datum, collection) {
|
| 512 |
-
var group, attr;
|
| 513 |
-
datum = datum[0];
|
| 514 |
-
if (datum.children) {
|
| 515 |
-
group = {};
|
| 516 |
-
for (attr in datum) {
|
| 517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
-
}
|
| 519 |
-
group.children=[];
|
| 520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
-
collection.push(group);
|
| 523 |
-
}
|
| 524 |
-
} else {
|
| 525 |
-
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
-
collection.push(datum);
|
| 527 |
-
}
|
| 528 |
-
}
|
| 529 |
-
};
|
| 530 |
-
|
| 531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
-
query.callback(filtered);
|
| 533 |
-
};
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
// TODO javadoc
|
| 537 |
-
function tags(data) {
|
| 538 |
-
var isFunc = $.isFunction(data);
|
| 539 |
-
return function (query) {
|
| 540 |
-
var t = query.term, filtered = {results: []};
|
| 541 |
-
var result = isFunc ? data(query) : data;
|
| 542 |
-
if ($.isArray(result)) {
|
| 543 |
-
$(result).each(function () {
|
| 544 |
-
var isObject = this.text !== undefined,
|
| 545 |
-
text = isObject ? this.text : this;
|
| 546 |
-
if (t === "" || query.matcher(t, text)) {
|
| 547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
-
}
|
| 549 |
-
});
|
| 550 |
-
query.callback(filtered);
|
| 551 |
-
}
|
| 552 |
-
};
|
| 553 |
-
}
|
| 554 |
-
|
| 555 |
-
/**
|
| 556 |
-
* Checks if the formatter function should be used.
|
| 557 |
-
*
|
| 558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
-
* false if no formatting should be performed.
|
| 560 |
-
*
|
| 561 |
-
* @param formatter
|
| 562 |
-
*/
|
| 563 |
-
function checkFormatter(formatter, formatterName) {
|
| 564 |
-
if ($.isFunction(formatter)) return true;
|
| 565 |
-
if (!formatter) return false;
|
| 566 |
-
if (typeof(formatter) === 'string') return true;
|
| 567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
/**
|
| 571 |
-
* Returns a given value
|
| 572 |
-
* If given a function, returns its output
|
| 573 |
-
*
|
| 574 |
-
* @param val string|function
|
| 575 |
-
* @param context value of "this" to be passed to function
|
| 576 |
-
* @returns {*}
|
| 577 |
-
*/
|
| 578 |
-
function evaluate(val, context) {
|
| 579 |
-
if ($.isFunction(val)) {
|
| 580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
-
return val.apply(context, args);
|
| 582 |
-
}
|
| 583 |
-
return val;
|
| 584 |
-
}
|
| 585 |
-
|
| 586 |
-
function countResults(results) {
|
| 587 |
-
var count = 0;
|
| 588 |
-
$.each(results, function(i, item) {
|
| 589 |
-
if (item.children) {
|
| 590 |
-
count += countResults(item.children);
|
| 591 |
-
} else {
|
| 592 |
-
count++;
|
| 593 |
-
}
|
| 594 |
-
});
|
| 595 |
-
return count;
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
/**
|
| 599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
-
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
-
*
|
| 603 |
-
* @param input text user has typed so far or pasted into the search field
|
| 604 |
-
* @param selection currently selected choices
|
| 605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
-
* @param opts select2's opts
|
| 607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
-
*/
|
| 609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
-
token, // token
|
| 613 |
-
index, // position at which the separator was found
|
| 614 |
-
i, l, // looping variables
|
| 615 |
-
separator; // the matched separator
|
| 616 |
-
|
| 617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
-
|
| 619 |
-
while (true) {
|
| 620 |
-
index = -1;
|
| 621 |
-
|
| 622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
-
separator = opts.tokenSeparators[i];
|
| 624 |
-
index = input.indexOf(separator);
|
| 625 |
-
if (index >= 0) break;
|
| 626 |
-
}
|
| 627 |
-
|
| 628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
-
|
| 630 |
-
token = input.substring(0, index);
|
| 631 |
-
input = input.substring(index + separator.length);
|
| 632 |
-
|
| 633 |
-
if (token.length > 0) {
|
| 634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
-
dupe = false;
|
| 637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
-
dupe = true; break;
|
| 640 |
-
}
|
| 641 |
-
}
|
| 642 |
-
|
| 643 |
-
if (!dupe) selectCallback(token);
|
| 644 |
-
}
|
| 645 |
-
}
|
| 646 |
-
}
|
| 647 |
-
|
| 648 |
-
if (original!==input) return input;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
function cleanupJQueryElements() {
|
| 652 |
-
var self = this;
|
| 653 |
-
|
| 654 |
-
$.each(arguments, function (i, element) {
|
| 655 |
-
self[element].remove();
|
| 656 |
-
self[element] = null;
|
| 657 |
-
});
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
/**
|
| 661 |
-
* Creates a new class
|
| 662 |
-
*
|
| 663 |
-
* @param superClass
|
| 664 |
-
* @param methods
|
| 665 |
-
*/
|
| 666 |
-
function clazz(SuperClass, methods) {
|
| 667 |
-
var constructor = function () {};
|
| 668 |
-
constructor.prototype = new SuperClass;
|
| 669 |
-
constructor.prototype.constructor = constructor;
|
| 670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
-
return constructor;
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
AbstractSelect2 = clazz(Object, {
|
| 676 |
-
|
| 677 |
-
// abstract
|
| 678 |
-
bind: function (func) {
|
| 679 |
-
var self = this;
|
| 680 |
-
return function () {
|
| 681 |
-
func.apply(self, arguments);
|
| 682 |
-
};
|
| 683 |
-
},
|
| 684 |
-
|
| 685 |
-
// abstract
|
| 686 |
-
init: function (opts) {
|
| 687 |
-
var results, search, resultsSelector = ".select2-results";
|
| 688 |
-
|
| 689 |
-
// prepare options
|
| 690 |
-
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
-
|
| 692 |
-
this.id=opts.id;
|
| 693 |
-
|
| 694 |
-
// destroy if called on an existing component
|
| 695 |
-
if (opts.element.data("select2") !== undefined &&
|
| 696 |
-
opts.element.data("select2") !== null) {
|
| 697 |
-
opts.element.data("select2").destroy();
|
| 698 |
-
}
|
| 699 |
-
|
| 700 |
-
this.container = this.createContainer();
|
| 701 |
-
|
| 702 |
-
this.liveRegion = $("<span>", {
|
| 703 |
-
role: "status",
|
| 704 |
-
"aria-live": "polite"
|
| 705 |
-
})
|
| 706 |
-
.addClass("select2-hidden-accessible")
|
| 707 |
-
.appendTo(document.body);
|
| 708 |
-
|
| 709 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 710 |
-
this.containerEventName= this.containerId
|
| 711 |
-
.replace(/([.])/g, '_')
|
| 712 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 713 |
-
this.container.attr("id", this.containerId);
|
| 714 |
-
|
| 715 |
-
this.container.attr("title", opts.element.attr("title"));
|
| 716 |
-
|
| 717 |
-
this.body = $("body");
|
| 718 |
-
|
| 719 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 720 |
-
|
| 721 |
-
this.container.attr("style", opts.element.attr("style"));
|
| 722 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 723 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 724 |
-
|
| 725 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 726 |
-
|
| 727 |
-
// swap container for the element
|
| 728 |
-
this.opts.element
|
| 729 |
-
.data("select2", this)
|
| 730 |
-
.attr("tabindex", "-1")
|
| 731 |
-
.before(this.container)
|
| 732 |
-
.on("click.select2", killEvent); // do not leak click events
|
| 733 |
-
|
| 734 |
-
this.container.data("select2", this);
|
| 735 |
-
|
| 736 |
-
this.dropdown = this.container.find(".select2-drop");
|
| 737 |
-
|
| 738 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 739 |
-
|
| 740 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 741 |
-
this.dropdown.data("select2", this);
|
| 742 |
-
this.dropdown.on("click", killEvent);
|
| 743 |
-
|
| 744 |
-
this.results = results = this.container.find(resultsSelector);
|
| 745 |
-
this.search = search = this.container.find("input.select2-input");
|
| 746 |
-
|
| 747 |
-
this.queryCount = 0;
|
| 748 |
-
this.resultsPage = 0;
|
| 749 |
-
this.context = null;
|
| 750 |
-
|
| 751 |
-
// initialize the container
|
| 752 |
-
this.initContainer();
|
| 753 |
-
|
| 754 |
-
this.container.on("click", killEvent);
|
| 755 |
-
|
| 756 |
-
installFilteredMouseMove(this.results);
|
| 757 |
-
|
| 758 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 759 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 760 |
-
this._touchEvent = true;
|
| 761 |
-
this.highlightUnderEvent(event);
|
| 762 |
-
}));
|
| 763 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 764 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 765 |
-
|
| 766 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 767 |
-
// otherwise click will be triggered on an underlying element
|
| 768 |
-
this.dropdown.on('click', this.bind(function (event) {
|
| 769 |
-
if (this._touchEvent) {
|
| 770 |
-
this._touchEvent = false;
|
| 771 |
-
this.selectHighlighted();
|
| 772 |
-
}
|
| 773 |
-
}));
|
| 774 |
-
|
| 775 |
-
installDebouncedScroll(80, this.results);
|
| 776 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 777 |
-
|
| 778 |
-
// do not propagate change event from the search field out of the component
|
| 779 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 780 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 781 |
-
|
| 782 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 783 |
-
if ($.fn.mousewheel) {
|
| 784 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 785 |
-
var top = results.scrollTop();
|
| 786 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
| 787 |
-
results.scrollTop(0);
|
| 788 |
-
killEvent(e);
|
| 789 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 790 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 791 |
-
killEvent(e);
|
| 792 |
-
}
|
| 793 |
-
});
|
| 794 |
-
}
|
| 795 |
-
|
| 796 |
-
installKeyUpChangeEvent(search);
|
| 797 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 798 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 799 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 800 |
-
|
| 801 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 802 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 803 |
-
this.highlightUnderEvent(e);
|
| 804 |
-
this.selectHighlighted(e);
|
| 805 |
-
}
|
| 806 |
-
}));
|
| 807 |
-
|
| 808 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 809 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 810 |
-
// dom it will trigger the popup close, which is not what we want
|
| 811 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 812 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 813 |
-
|
| 814 |
-
this.nextSearchTerm = undefined;
|
| 815 |
-
|
| 816 |
-
if ($.isFunction(this.opts.initSelection)) {
|
| 817 |
-
// initialize selection based on the current value of the source element
|
| 818 |
-
this.initSelection();
|
| 819 |
-
|
| 820 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
| 821 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 822 |
-
this.monitorSource();
|
| 823 |
-
}
|
| 824 |
-
|
| 825 |
-
if (opts.maximumInputLength !== null) {
|
| 826 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
| 827 |
-
}
|
| 828 |
-
|
| 829 |
-
var disabled = opts.element.prop("disabled");
|
| 830 |
-
if (disabled === undefined) disabled = false;
|
| 831 |
-
this.enable(!disabled);
|
| 832 |
-
|
| 833 |
-
var readonly = opts.element.prop("readonly");
|
| 834 |
-
if (readonly === undefined) readonly = false;
|
| 835 |
-
this.readonly(readonly);
|
| 836 |
-
|
| 837 |
-
// Calculate size of scrollbar
|
| 838 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 839 |
-
|
| 840 |
-
this.autofocus = opts.element.prop("autofocus");
|
| 841 |
-
opts.element.prop("autofocus", false);
|
| 842 |
-
if (this.autofocus) this.focus();
|
| 843 |
-
|
| 844 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 845 |
-
},
|
| 846 |
-
|
| 847 |
-
// abstract
|
| 848 |
-
destroy: function () {
|
| 849 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 850 |
-
|
| 851 |
-
this.close();
|
| 852 |
-
|
| 853 |
-
if (element.length && element[0].detachEvent) {
|
| 854 |
-
element.each(function () {
|
| 855 |
-
this.detachEvent("onpropertychange", self._sync);
|
| 856 |
-
});
|
| 857 |
-
}
|
| 858 |
-
if (this.propertyObserver) {
|
| 859 |
-
this.propertyObserver.disconnect();
|
| 860 |
-
this.propertyObserver = null;
|
| 861 |
-
}
|
| 862 |
-
this._sync = null;
|
| 863 |
-
|
| 864 |
-
if (select2 !== undefined) {
|
| 865 |
-
select2.container.remove();
|
| 866 |
-
select2.liveRegion.remove();
|
| 867 |
-
select2.dropdown.remove();
|
| 868 |
-
element
|
| 869 |
-
.removeClass("select2-offscreen")
|
| 870 |
-
.removeData("select2")
|
| 871 |
-
.off(".select2")
|
| 872 |
-
.prop("autofocus", this.autofocus || false);
|
| 873 |
-
if (this.elementTabIndex) {
|
| 874 |
-
element.attr({tabindex: this.elementTabIndex});
|
| 875 |
-
} else {
|
| 876 |
-
element.removeAttr("tabindex");
|
| 877 |
-
}
|
| 878 |
-
element.show();
|
| 879 |
-
}
|
| 880 |
-
|
| 881 |
-
cleanupJQueryElements.call(this,
|
| 882 |
-
"container",
|
| 883 |
-
"liveRegion",
|
| 884 |
-
"dropdown",
|
| 885 |
-
"results",
|
| 886 |
-
"search"
|
| 887 |
-
);
|
| 888 |
-
},
|
| 889 |
-
|
| 890 |
-
// abstract
|
| 891 |
-
optionToData: function(element) {
|
| 892 |
-
if (element.is("option")) {
|
| 893 |
-
return {
|
| 894 |
-
id:element.prop("value"),
|
| 895 |
-
text:element.text(),
|
| 896 |
-
element: element.get(),
|
| 897 |
-
css: element.attr("class"),
|
| 898 |
-
disabled: element.prop("disabled"),
|
| 899 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 900 |
-
};
|
| 901 |
-
} else if (element.is("optgroup")) {
|
| 902 |
-
return {
|
| 903 |
-
text:element.attr("label"),
|
| 904 |
-
children:[],
|
| 905 |
-
element: element.get(),
|
| 906 |
-
css: element.attr("class")
|
| 907 |
-
};
|
| 908 |
-
}
|
| 909 |
-
},
|
| 910 |
-
|
| 911 |
-
// abstract
|
| 912 |
-
prepareOpts: function (opts) {
|
| 913 |
-
var element, select, idKey, ajaxUrl, self = this;
|
| 914 |
-
|
| 915 |
-
element = opts.element;
|
| 916 |
-
|
| 917 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 918 |
-
this.select = select = opts.element;
|
| 919 |
-
}
|
| 920 |
-
|
| 921 |
-
if (select) {
|
| 922 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 923 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 924 |
-
if (this in opts) {
|
| 925 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 926 |
-
}
|
| 927 |
-
});
|
| 928 |
-
}
|
| 929 |
-
|
| 930 |
-
opts = $.extend({}, {
|
| 931 |
-
populateResults: function(container, results, query) {
|
| 932 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 933 |
-
|
| 934 |
-
populate=function(results, container, depth) {
|
| 935 |
-
|
| 936 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 937 |
-
|
| 938 |
-
results = opts.sortResults(results, container, query);
|
| 939 |
-
|
| 940 |
-
// collect the created nodes for bulk append
|
| 941 |
-
var nodes = [];
|
| 942 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 943 |
-
|
| 944 |
-
result=results[i];
|
| 945 |
-
|
| 946 |
-
disabled = (result.disabled === true);
|
| 947 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
| 948 |
-
|
| 949 |
-
compound=result.children && result.children.length > 0;
|
| 950 |
-
|
| 951 |
-
node=$("<li></li>");
|
| 952 |
-
node.addClass("select2-results-dept-"+depth);
|
| 953 |
-
node.addClass("select2-result");
|
| 954 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 955 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
| 956 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
| 957 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
| 958 |
-
node.attr("role", "presentation");
|
| 959 |
-
|
| 960 |
-
label=$(document.createElement("div"));
|
| 961 |
-
label.addClass("select2-result-label");
|
| 962 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
| 963 |
-
label.attr("role", "option");
|
| 964 |
-
|
| 965 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 966 |
-
if (formatted!==undefined) {
|
| 967 |
-
label.html(formatted);
|
| 968 |
-
node.append(label);
|
| 969 |
-
}
|
| 970 |
-
|
| 971 |
-
|
| 972 |
-
if (compound) {
|
| 973 |
-
|
| 974 |
-
innerContainer=$("<ul></ul>");
|
| 975 |
-
innerContainer.addClass("select2-result-sub");
|
| 976 |
-
populate(result.children, innerContainer, depth+1);
|
| 977 |
-
node.append(innerContainer);
|
| 978 |
-
}
|
| 979 |
-
|
| 980 |
-
node.data("select2-data", result);
|
| 981 |
-
nodes.push(node[0]);
|
| 982 |
-
}
|
| 983 |
-
|
| 984 |
-
// bulk append the created nodes
|
| 985 |
-
container.append(nodes);
|
| 986 |
-
liveRegion.text(opts.formatMatches(results.length));
|
| 987 |
-
};
|
| 988 |
-
|
| 989 |
-
populate(results, container, 0);
|
| 990 |
-
}
|
| 991 |
-
}, $.fn.select2.defaults, opts);
|
| 992 |
-
|
| 993 |
-
if (typeof(opts.id) !== "function") {
|
| 994 |
-
idKey = opts.id;
|
| 995 |
-
opts.id = function (e) { return e[idKey]; };
|
| 996 |
-
}
|
| 997 |
-
|
| 998 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 999 |
-
if ("tags" in opts) {
|
| 1000 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1001 |
-
}
|
| 1002 |
-
opts.tags=opts.element.data("select2Tags");
|
| 1003 |
-
}
|
| 1004 |
-
|
| 1005 |
-
if (select) {
|
| 1006 |
-
opts.query = this.bind(function (query) {
|
| 1007 |
-
var data = { results: [], more: false },
|
| 1008 |
-
term = query.term,
|
| 1009 |
-
children, placeholderOption, process;
|
| 1010 |
-
|
| 1011 |
-
process=function(element, collection) {
|
| 1012 |
-
var group;
|
| 1013 |
-
if (element.is("option")) {
|
| 1014 |
-
if (query.matcher(term, element.text(), element)) {
|
| 1015 |
-
collection.push(self.optionToData(element));
|
| 1016 |
-
}
|
| 1017 |
-
} else if (element.is("optgroup")) {
|
| 1018 |
-
group=self.optionToData(element);
|
| 1019 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1020 |
-
if (group.children.length>0) {
|
| 1021 |
-
collection.push(group);
|
| 1022 |
-
}
|
| 1023 |
-
}
|
| 1024 |
-
};
|
| 1025 |
-
|
| 1026 |
-
children=element.children();
|
| 1027 |
-
|
| 1028 |
-
// ignore the placeholder option if there is one
|
| 1029 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1030 |
-
placeholderOption = this.getPlaceholderOption();
|
| 1031 |
-
if (placeholderOption) {
|
| 1032 |
-
children=children.not(placeholderOption);
|
| 1033 |
-
}
|
| 1034 |
-
}
|
| 1035 |
-
|
| 1036 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1037 |
-
|
| 1038 |
-
query.callback(data);
|
| 1039 |
-
});
|
| 1040 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1041 |
-
opts.id=function(e) { return e.id; };
|
| 1042 |
-
} else {
|
| 1043 |
-
if (!("query" in opts)) {
|
| 1044 |
-
|
| 1045 |
-
if ("ajax" in opts) {
|
| 1046 |
-
ajaxUrl = opts.element.data("ajax-url");
|
| 1047 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1048 |
-
opts.ajax.url = ajaxUrl;
|
| 1049 |
-
}
|
| 1050 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1051 |
-
} else if ("data" in opts) {
|
| 1052 |
-
opts.query = local(opts.data);
|
| 1053 |
-
} else if ("tags" in opts) {
|
| 1054 |
-
opts.query = tags(opts.tags);
|
| 1055 |
-
if (opts.createSearchChoice === undefined) {
|
| 1056 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1057 |
-
}
|
| 1058 |
-
if (opts.initSelection === undefined) {
|
| 1059 |
-
opts.initSelection = function (element, callback) {
|
| 1060 |
-
var data = [];
|
| 1061 |
-
$(splitVal(element.val(), opts.separator)).each(function () {
|
| 1062 |
-
var obj = { id: this, text: this },
|
| 1063 |
-
tags = opts.tags;
|
| 1064 |
-
if ($.isFunction(tags)) tags=tags();
|
| 1065 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1066 |
-
data.push(obj);
|
| 1067 |
-
});
|
| 1068 |
-
|
| 1069 |
-
callback(data);
|
| 1070 |
-
};
|
| 1071 |
-
}
|
| 1072 |
-
}
|
| 1073 |
-
}
|
| 1074 |
-
}
|
| 1075 |
-
if (typeof(opts.query) !== "function") {
|
| 1076 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1077 |
-
}
|
| 1078 |
-
|
| 1079 |
-
if (opts.createSearchChoicePosition === 'top') {
|
| 1080 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1081 |
-
}
|
| 1082 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1083 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1084 |
-
}
|
| 1085 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1086 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1087 |
-
}
|
| 1088 |
-
|
| 1089 |
-
return opts;
|
| 1090 |
-
},
|
| 1091 |
-
|
| 1092 |
-
/**
|
| 1093 |
-
* Monitor the original element for changes and update select2 accordingly
|
| 1094 |
-
*/
|
| 1095 |
-
// abstract
|
| 1096 |
-
monitorSource: function () {
|
| 1097 |
-
var el = this.opts.element, observer, self = this;
|
| 1098 |
-
|
| 1099 |
-
el.on("change.select2", this.bind(function (e) {
|
| 1100 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1101 |
-
this.initSelection();
|
| 1102 |
-
}
|
| 1103 |
-
}));
|
| 1104 |
-
|
| 1105 |
-
this._sync = this.bind(function () {
|
| 1106 |
-
|
| 1107 |
-
// sync enabled state
|
| 1108 |
-
var disabled = el.prop("disabled");
|
| 1109 |
-
if (disabled === undefined) disabled = false;
|
| 1110 |
-
this.enable(!disabled);
|
| 1111 |
-
|
| 1112 |
-
var readonly = el.prop("readonly");
|
| 1113 |
-
if (readonly === undefined) readonly = false;
|
| 1114 |
-
this.readonly(readonly);
|
| 1115 |
-
|
| 1116 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1117 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1118 |
-
|
| 1119 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1120 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1121 |
-
|
| 1122 |
-
});
|
| 1123 |
-
|
| 1124 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1125 |
-
if (el.length && el[0].attachEvent) {
|
| 1126 |
-
el.each(function() {
|
| 1127 |
-
this.attachEvent("onpropertychange", self._sync);
|
| 1128 |
-
});
|
| 1129 |
-
}
|
| 1130 |
-
|
| 1131 |
-
// safari, chrome, firefox, IE11
|
| 1132 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1133 |
-
if (observer !== undefined) {
|
| 1134 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1135 |
-
this.propertyObserver = new observer(function (mutations) {
|
| 1136 |
-
$.each(mutations, self._sync);
|
| 1137 |
-
});
|
| 1138 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1139 |
-
}
|
| 1140 |
-
},
|
| 1141 |
-
|
| 1142 |
-
// abstract
|
| 1143 |
-
triggerSelect: function(data) {
|
| 1144 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1145 |
-
this.opts.element.trigger(evt);
|
| 1146 |
-
return !evt.isDefaultPrevented();
|
| 1147 |
-
},
|
| 1148 |
-
|
| 1149 |
-
/**
|
| 1150 |
-
* Triggers the change event on the source element
|
| 1151 |
-
*/
|
| 1152 |
-
// abstract
|
| 1153 |
-
triggerChange: function (details) {
|
| 1154 |
-
|
| 1155 |
-
details = details || {};
|
| 1156 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1157 |
-
// prevents recursive triggering
|
| 1158 |
-
this.opts.element.data("select2-change-triggered", true);
|
| 1159 |
-
this.opts.element.trigger(details);
|
| 1160 |
-
this.opts.element.data("select2-change-triggered", false);
|
| 1161 |
-
|
| 1162 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1163 |
-
// so here we trigger the click event manually
|
| 1164 |
-
this.opts.element.click();
|
| 1165 |
-
|
| 1166 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
| 1167 |
-
// so here we trigger the blur event manually if so desired
|
| 1168 |
-
if (this.opts.blurOnChange)
|
| 1169 |
-
this.opts.element.blur();
|
| 1170 |
-
},
|
| 1171 |
-
|
| 1172 |
-
//abstract
|
| 1173 |
-
isInterfaceEnabled: function()
|
| 1174 |
-
{
|
| 1175 |
-
return this.enabledInterface === true;
|
| 1176 |
-
},
|
| 1177 |
-
|
| 1178 |
-
// abstract
|
| 1179 |
-
enableInterface: function() {
|
| 1180 |
-
var enabled = this._enabled && !this._readonly,
|
| 1181 |
-
disabled = !enabled;
|
| 1182 |
-
|
| 1183 |
-
if (enabled === this.enabledInterface) return false;
|
| 1184 |
-
|
| 1185 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1186 |
-
this.close();
|
| 1187 |
-
this.enabledInterface = enabled;
|
| 1188 |
-
|
| 1189 |
-
return true;
|
| 1190 |
-
},
|
| 1191 |
-
|
| 1192 |
-
// abstract
|
| 1193 |
-
enable: function(enabled) {
|
| 1194 |
-
if (enabled === undefined) enabled = true;
|
| 1195 |
-
if (this._enabled === enabled) return;
|
| 1196 |
-
this._enabled = enabled;
|
| 1197 |
-
|
| 1198 |
-
this.opts.element.prop("disabled", !enabled);
|
| 1199 |
-
this.enableInterface();
|
| 1200 |
-
},
|
| 1201 |
-
|
| 1202 |
-
// abstract
|
| 1203 |
-
disable: function() {
|
| 1204 |
-
this.enable(false);
|
| 1205 |
-
},
|
| 1206 |
-
|
| 1207 |
-
// abstract
|
| 1208 |
-
readonly: function(enabled) {
|
| 1209 |
-
if (enabled === undefined) enabled = false;
|
| 1210 |
-
if (this._readonly === enabled) return;
|
| 1211 |
-
this._readonly = enabled;
|
| 1212 |
-
|
| 1213 |
-
this.opts.element.prop("readonly", enabled);
|
| 1214 |
-
this.enableInterface();
|
| 1215 |
-
},
|
| 1216 |
-
|
| 1217 |
-
// abstract
|
| 1218 |
-
opened: function () {
|
| 1219 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1220 |
-
},
|
| 1221 |
-
|
| 1222 |
-
// abstract
|
| 1223 |
-
positionDropdown: function() {
|
| 1224 |
-
var $dropdown = this.dropdown,
|
| 1225 |
-
offset = this.container.offset(),
|
| 1226 |
-
height = this.container.outerHeight(false),
|
| 1227 |
-
width = this.container.outerWidth(false),
|
| 1228 |
-
dropHeight = $dropdown.outerHeight(false),
|
| 1229 |
-
$window = $(window),
|
| 1230 |
-
windowWidth = $window.width(),
|
| 1231 |
-
windowHeight = $window.height(),
|
| 1232 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1233 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1234 |
-
dropTop = offset.top + height,
|
| 1235 |
-
dropLeft = offset.left,
|
| 1236 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1237 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1238 |
-
dropWidth = $dropdown.outerWidth(false),
|
| 1239 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight,
|
| 1240 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1241 |
-
bodyOffset,
|
| 1242 |
-
above,
|
| 1243 |
-
changeDirection,
|
| 1244 |
-
css,
|
| 1245 |
-
resultsListNode;
|
| 1246 |
-
|
| 1247 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
| 1248 |
-
if (aboveNow) {
|
| 1249 |
-
above = true;
|
| 1250 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1251 |
-
changeDirection = true;
|
| 1252 |
-
above = false;
|
| 1253 |
-
}
|
| 1254 |
-
} else {
|
| 1255 |
-
above = false;
|
| 1256 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1257 |
-
changeDirection = true;
|
| 1258 |
-
above = true;
|
| 1259 |
-
}
|
| 1260 |
-
}
|
| 1261 |
-
|
| 1262 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1263 |
-
if (changeDirection) {
|
| 1264 |
-
$dropdown.hide();
|
| 1265 |
-
offset = this.container.offset();
|
| 1266 |
-
height = this.container.outerHeight(false);
|
| 1267 |
-
width = this.container.outerWidth(false);
|
| 1268 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1269 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1270 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1271 |
-
dropTop = offset.top + height;
|
| 1272 |
-
dropLeft = offset.left;
|
| 1273 |
-
dropWidth = $dropdown.outerWidth(false);
|
| 1274 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
|
| 1275 |
-
$dropdown.show();
|
| 1276 |
-
|
| 1277 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1278 |
-
this.focusSearch();
|
| 1279 |
-
}
|
| 1280 |
-
|
| 1281 |
-
if (this.opts.dropdownAutoWidth) {
|
| 1282 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1283 |
-
$dropdown.addClass('select2-drop-auto-width');
|
| 1284 |
-
$dropdown.css('width', '');
|
| 1285 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1286 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1287 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1288 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1289 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
|
| 1290 |
-
}
|
| 1291 |
-
else {
|
| 1292 |
-
this.container.removeClass('select2-drop-auto-width');
|
| 1293 |
-
}
|
| 1294 |
-
|
| 1295 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1296 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1297 |
-
|
| 1298 |
-
// fix positioning when body has an offset and is not position: static
|
| 1299 |
-
if (this.body.css('position') !== 'static') {
|
| 1300 |
-
bodyOffset = this.body.offset();
|
| 1301 |
-
dropTop -= bodyOffset.top;
|
| 1302 |
-
dropLeft -= bodyOffset.left;
|
| 1303 |
-
}
|
| 1304 |
-
|
| 1305 |
-
if (!enoughRoomOnRight) {
|
| 1306 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1307 |
-
}
|
| 1308 |
-
|
| 1309 |
-
css = {
|
| 1310 |
-
left: dropLeft,
|
| 1311 |
-
width: width
|
| 1312 |
-
};
|
| 1313 |
-
|
| 1314 |
-
if (above) {
|
| 1315 |
-
css.top = offset.top - dropHeight;
|
| 1316 |
-
css.bottom = 'auto';
|
| 1317 |
-
this.container.addClass("select2-drop-above");
|
| 1318 |
-
$dropdown.addClass("select2-drop-above");
|
| 1319 |
-
}
|
| 1320 |
-
else {
|
| 1321 |
-
css.top = dropTop;
|
| 1322 |
-
css.bottom = 'auto';
|
| 1323 |
-
this.container.removeClass("select2-drop-above");
|
| 1324 |
-
$dropdown.removeClass("select2-drop-above");
|
| 1325 |
-
}
|
| 1326 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1327 |
-
|
| 1328 |
-
$dropdown.css(css);
|
| 1329 |
-
},
|
| 1330 |
-
|
| 1331 |
-
// abstract
|
| 1332 |
-
shouldOpen: function() {
|
| 1333 |
-
var event;
|
| 1334 |
-
|
| 1335 |
-
if (this.opened()) return false;
|
| 1336 |
-
|
| 1337 |
-
if (this._enabled === false || this._readonly === true) return false;
|
| 1338 |
-
|
| 1339 |
-
event = $.Event("select2-opening");
|
| 1340 |
-
this.opts.element.trigger(event);
|
| 1341 |
-
return !event.isDefaultPrevented();
|
| 1342 |
-
},
|
| 1343 |
-
|
| 1344 |
-
// abstract
|
| 1345 |
-
clearDropdownAlignmentPreference: function() {
|
| 1346 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1347 |
-
this.container.removeClass("select2-drop-above");
|
| 1348 |
-
this.dropdown.removeClass("select2-drop-above");
|
| 1349 |
-
},
|
| 1350 |
-
|
| 1351 |
-
/**
|
| 1352 |
-
* Opens the dropdown
|
| 1353 |
-
*
|
| 1354 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1355 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1356 |
-
*/
|
| 1357 |
-
// abstract
|
| 1358 |
-
open: function () {
|
| 1359 |
-
|
| 1360 |
-
if (!this.shouldOpen()) return false;
|
| 1361 |
-
|
| 1362 |
-
this.opening();
|
| 1363 |
-
|
| 1364 |
-
// Only bind the document mousemove when the dropdown is visible
|
| 1365 |
-
$document.on("mousemove.select2Event", function (e) {
|
| 1366 |
-
lastMousePosition.x = e.pageX;
|
| 1367 |
-
lastMousePosition.y = e.pageY;
|
| 1368 |
-
});
|
| 1369 |
-
|
| 1370 |
-
return true;
|
| 1371 |
-
},
|
| 1372 |
-
|
| 1373 |
-
/**
|
| 1374 |
-
* Performs the opening of the dropdown
|
| 1375 |
-
*/
|
| 1376 |
-
// abstract
|
| 1377 |
-
opening: function() {
|
| 1378 |
-
var cid = this.containerEventName,
|
| 1379 |
-
scroll = "scroll." + cid,
|
| 1380 |
-
resize = "resize."+cid,
|
| 1381 |
-
orient = "orientationchange."+cid,
|
| 1382 |
-
mask;
|
| 1383 |
-
|
| 1384 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1385 |
-
|
| 1386 |
-
this.clearDropdownAlignmentPreference();
|
| 1387 |
-
|
| 1388 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1389 |
-
this.dropdown.detach().appendTo(this.body);
|
| 1390 |
-
}
|
| 1391 |
-
|
| 1392 |
-
// create the dropdown mask if doesn't already exist
|
| 1393 |
-
mask = $("#select2-drop-mask");
|
| 1394 |
-
if (mask.length == 0) {
|
| 1395 |
-
mask = $(document.createElement("div"));
|
| 1396 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1397 |
-
mask.hide();
|
| 1398 |
-
mask.appendTo(this.body);
|
| 1399 |
-
mask.on("mousedown touchstart click", function (e) {
|
| 1400 |
-
// Prevent IE from generating a click event on the body
|
| 1401 |
-
reinsertElement(mask);
|
| 1402 |
-
|
| 1403 |
-
var dropdown = $("#select2-drop"), self;
|
| 1404 |
-
if (dropdown.length > 0) {
|
| 1405 |
-
self=dropdown.data("select2");
|
| 1406 |
-
if (self.opts.selectOnBlur) {
|
| 1407 |
-
self.selectHighlighted({noFocus: true});
|
| 1408 |
-
}
|
| 1409 |
-
self.close();
|
| 1410 |
-
e.preventDefault();
|
| 1411 |
-
e.stopPropagation();
|
| 1412 |
-
}
|
| 1413 |
-
});
|
| 1414 |
-
}
|
| 1415 |
-
|
| 1416 |
-
// ensure the mask is always right before the dropdown
|
| 1417 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1418 |
-
this.dropdown.before(mask);
|
| 1419 |
-
}
|
| 1420 |
-
|
| 1421 |
-
// move the global id to the correct dropdown
|
| 1422 |
-
$("#select2-drop").removeAttr("id");
|
| 1423 |
-
this.dropdown.attr("id", "select2-drop");
|
| 1424 |
-
|
| 1425 |
-
// show the elements
|
| 1426 |
-
mask.show();
|
| 1427 |
-
|
| 1428 |
-
this.positionDropdown();
|
| 1429 |
-
this.dropdown.show();
|
| 1430 |
-
this.positionDropdown();
|
| 1431 |
-
|
| 1432 |
-
this.dropdown.addClass("select2-drop-active");
|
| 1433 |
-
|
| 1434 |
-
// attach listeners to events that can change the position of the container and thus require
|
| 1435 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1436 |
-
var that = this;
|
| 1437 |
-
this.container.parents().add(window).each(function () {
|
| 1438 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1439 |
-
if (that.opened()) that.positionDropdown();
|
| 1440 |
-
});
|
| 1441 |
-
});
|
| 1442 |
-
|
| 1443 |
-
|
| 1444 |
-
},
|
| 1445 |
-
|
| 1446 |
-
// abstract
|
| 1447 |
-
close: function () {
|
| 1448 |
-
if (!this.opened()) return;
|
| 1449 |
-
|
| 1450 |
-
var cid = this.containerEventName,
|
| 1451 |
-
scroll = "scroll." + cid,
|
| 1452 |
-
resize = "resize."+cid,
|
| 1453 |
-
orient = "orientationchange."+cid;
|
| 1454 |
-
|
| 1455 |
-
// unbind event listeners
|
| 1456 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1457 |
-
|
| 1458 |
-
this.clearDropdownAlignmentPreference();
|
| 1459 |
-
|
| 1460 |
-
$("#select2-drop-mask").hide();
|
| 1461 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1462 |
-
this.dropdown.hide();
|
| 1463 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1464 |
-
this.results.empty();
|
| 1465 |
-
|
| 1466 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1467 |
-
$document.off("mousemove.select2Event");
|
| 1468 |
-
|
| 1469 |
-
this.clearSearch();
|
| 1470 |
-
this.search.removeClass("select2-active");
|
| 1471 |
-
this.opts.element.trigger($.Event("select2-close"));
|
| 1472 |
-
},
|
| 1473 |
-
|
| 1474 |
-
/**
|
| 1475 |
-
* Opens control, sets input value, and updates results.
|
| 1476 |
-
*/
|
| 1477 |
-
// abstract
|
| 1478 |
-
externalSearch: function (term) {
|
| 1479 |
-
this.open();
|
| 1480 |
-
this.search.val(term);
|
| 1481 |
-
this.updateResults(false);
|
| 1482 |
-
},
|
| 1483 |
-
|
| 1484 |
-
// abstract
|
| 1485 |
-
clearSearch: function () {
|
| 1486 |
-
|
| 1487 |
-
},
|
| 1488 |
-
|
| 1489 |
-
//abstract
|
| 1490 |
-
getMaximumSelectionSize: function() {
|
| 1491 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1492 |
-
},
|
| 1493 |
-
|
| 1494 |
-
// abstract
|
| 1495 |
-
ensureHighlightVisible: function () {
|
| 1496 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1497 |
-
|
| 1498 |
-
index = this.highlight();
|
| 1499 |
-
|
| 1500 |
-
if (index < 0) return;
|
| 1501 |
-
|
| 1502 |
-
if (index == 0) {
|
| 1503 |
-
|
| 1504 |
-
// if the first element is highlighted scroll all the way to the top,
|
| 1505 |
-
// that way any unselectable headers above it will also be scrolled
|
| 1506 |
-
// into view
|
| 1507 |
-
|
| 1508 |
-
results.scrollTop(0);
|
| 1509 |
-
return;
|
| 1510 |
-
}
|
| 1511 |
-
|
| 1512 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1513 |
-
|
| 1514 |
-
child = $(children[index]);
|
| 1515 |
-
|
| 1516 |
-
topOffset = (child.offset() || {}).top || 0;
|
| 1517 |
-
|
| 1518 |
-
hb = topOffset + child.outerHeight(true);
|
| 1519 |
-
|
| 1520 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
| 1521 |
-
if (index === children.length - 1) {
|
| 1522 |
-
more = results.find("li.select2-more-results");
|
| 1523 |
-
if (more.length > 0) {
|
| 1524 |
-
hb = more.offset().top + more.outerHeight(true);
|
| 1525 |
-
}
|
| 1526 |
-
}
|
| 1527 |
-
|
| 1528 |
-
rb = results.offset().top + results.outerHeight(true);
|
| 1529 |
-
if (hb > rb) {
|
| 1530 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1531 |
-
}
|
| 1532 |
-
y = topOffset - results.offset().top;
|
| 1533 |
-
|
| 1534 |
-
// make sure the top of the element is visible
|
| 1535 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
| 1536 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1537 |
-
}
|
| 1538 |
-
},
|
| 1539 |
-
|
| 1540 |
-
// abstract
|
| 1541 |
-
findHighlightableChoices: function() {
|
| 1542 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1543 |
-
},
|
| 1544 |
-
|
| 1545 |
-
// abstract
|
| 1546 |
-
moveHighlight: function (delta) {
|
| 1547 |
-
var choices = this.findHighlightableChoices(),
|
| 1548 |
-
index = this.highlight();
|
| 1549 |
-
|
| 1550 |
-
while (index > -1 && index < choices.length) {
|
| 1551 |
-
index += delta;
|
| 1552 |
-
var choice = $(choices[index]);
|
| 1553 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1554 |
-
this.highlight(index);
|
| 1555 |
-
break;
|
| 1556 |
-
}
|
| 1557 |
-
}
|
| 1558 |
-
},
|
| 1559 |
-
|
| 1560 |
-
// abstract
|
| 1561 |
-
highlight: function (index) {
|
| 1562 |
-
var choices = this.findHighlightableChoices(),
|
| 1563 |
-
choice,
|
| 1564 |
-
data;
|
| 1565 |
-
|
| 1566 |
-
if (arguments.length === 0) {
|
| 1567 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1568 |
-
}
|
| 1569 |
-
|
| 1570 |
-
if (index >= choices.length) index = choices.length - 1;
|
| 1571 |
-
if (index < 0) index = 0;
|
| 1572 |
-
|
| 1573 |
-
this.removeHighlight();
|
| 1574 |
-
|
| 1575 |
-
choice = $(choices[index]);
|
| 1576 |
-
choice.addClass("select2-highlighted");
|
| 1577 |
-
|
| 1578 |
-
// ensure assistive technology can determine the active choice
|
| 1579 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1580 |
-
|
| 1581 |
-
this.ensureHighlightVisible();
|
| 1582 |
-
|
| 1583 |
-
this.liveRegion.text(choice.text());
|
| 1584 |
-
|
| 1585 |
-
data = choice.data("select2-data");
|
| 1586 |
-
if (data) {
|
| 1587 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1588 |
-
}
|
| 1589 |
-
},
|
| 1590 |
-
|
| 1591 |
-
removeHighlight: function() {
|
| 1592 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1593 |
-
},
|
| 1594 |
-
|
| 1595 |
-
touchMoved: function() {
|
| 1596 |
-
this._touchMoved = true;
|
| 1597 |
-
},
|
| 1598 |
-
|
| 1599 |
-
clearTouchMoved: function() {
|
| 1600 |
-
this._touchMoved = false;
|
| 1601 |
-
},
|
| 1602 |
-
|
| 1603 |
-
// abstract
|
| 1604 |
-
countSelectableResults: function() {
|
| 1605 |
-
return this.findHighlightableChoices().length;
|
| 1606 |
-
},
|
| 1607 |
-
|
| 1608 |
-
// abstract
|
| 1609 |
-
highlightUnderEvent: function (event) {
|
| 1610 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
| 1611 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1612 |
-
var choices = this.findHighlightableChoices();
|
| 1613 |
-
this.highlight(choices.index(el));
|
| 1614 |
-
} else if (el.length == 0) {
|
| 1615 |
-
// if we are over an unselectable item remove all highlights
|
| 1616 |
-
this.removeHighlight();
|
| 1617 |
-
}
|
| 1618 |
-
},
|
| 1619 |
-
|
| 1620 |
-
// abstract
|
| 1621 |
-
loadMoreIfNeeded: function () {
|
| 1622 |
-
var results = this.results,
|
| 1623 |
-
more = results.find("li.select2-more-results"),
|
| 1624 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1625 |
-
page = this.resultsPage + 1,
|
| 1626 |
-
self=this,
|
| 1627 |
-
term=this.search.val(),
|
| 1628 |
-
context=this.context;
|
| 1629 |
-
|
| 1630 |
-
if (more.length === 0) return;
|
| 1631 |
-
below = more.offset().top - results.offset().top - results.height();
|
| 1632 |
-
|
| 1633 |
-
if (below <= this.opts.loadMorePadding) {
|
| 1634 |
-
more.addClass("select2-active");
|
| 1635 |
-
this.opts.query({
|
| 1636 |
-
element: this.opts.element,
|
| 1637 |
-
term: term,
|
| 1638 |
-
page: page,
|
| 1639 |
-
context: context,
|
| 1640 |
-
matcher: this.opts.matcher,
|
| 1641 |
-
callback: this.bind(function (data) {
|
| 1642 |
-
|
| 1643 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1644 |
-
if (!self.opened()) return;
|
| 1645 |
-
|
| 1646 |
-
|
| 1647 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1648 |
-
self.postprocessResults(data, false, false);
|
| 1649 |
-
|
| 1650 |
-
if (data.more===true) {
|
| 1651 |
-
more.detach().appendTo(results).text(evaluate(self.opts.formatLoadMore, self.opts.element, page+1));
|
| 1652 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1653 |
-
} else {
|
| 1654 |
-
more.remove();
|
| 1655 |
-
}
|
| 1656 |
-
self.positionDropdown();
|
| 1657 |
-
self.resultsPage = page;
|
| 1658 |
-
self.context = data.context;
|
| 1659 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1660 |
-
})});
|
| 1661 |
-
}
|
| 1662 |
-
},
|
| 1663 |
-
|
| 1664 |
-
/**
|
| 1665 |
-
* Default tokenizer function which does nothing
|
| 1666 |
-
*/
|
| 1667 |
-
tokenize: function() {
|
| 1668 |
-
|
| 1669 |
-
},
|
| 1670 |
-
|
| 1671 |
-
/**
|
| 1672 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1673 |
-
*/
|
| 1674 |
-
// abstract
|
| 1675 |
-
updateResults: function (initial) {
|
| 1676 |
-
var search = this.search,
|
| 1677 |
-
results = this.results,
|
| 1678 |
-
opts = this.opts,
|
| 1679 |
-
data,
|
| 1680 |
-
self = this,
|
| 1681 |
-
input,
|
| 1682 |
-
term = search.val(),
|
| 1683 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1684 |
-
// sequence number used to drop out-of-order responses
|
| 1685 |
-
queryNumber;
|
| 1686 |
-
|
| 1687 |
-
// prevent duplicate queries against the same term
|
| 1688 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1689 |
-
|
| 1690 |
-
$.data(this.container, "select2-last-term", term);
|
| 1691 |
-
|
| 1692 |
-
// if the search is currently hidden we do not alter the results
|
| 1693 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1694 |
-
return;
|
| 1695 |
-
}
|
| 1696 |
-
|
| 1697 |
-
function postRender() {
|
| 1698 |
-
search.removeClass("select2-active");
|
| 1699 |
-
self.positionDropdown();
|
| 1700 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1701 |
-
self.liveRegion.text(results.text());
|
| 1702 |
-
}
|
| 1703 |
-
else {
|
| 1704 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable').length));
|
| 1705 |
-
}
|
| 1706 |
-
}
|
| 1707 |
-
|
| 1708 |
-
function render(html) {
|
| 1709 |
-
results.html(html);
|
| 1710 |
-
postRender();
|
| 1711 |
-
}
|
| 1712 |
-
|
| 1713 |
-
queryNumber = ++this.queryCount;
|
| 1714 |
-
|
| 1715 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
| 1716 |
-
if (maxSelSize >=1) {
|
| 1717 |
-
data = this.data();
|
| 1718 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1719 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1720 |
-
return;
|
| 1721 |
-
}
|
| 1722 |
-
}
|
| 1723 |
-
|
| 1724 |
-
if (search.val().length < opts.minimumInputLength) {
|
| 1725 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1726 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1727 |
-
} else {
|
| 1728 |
-
render("");
|
| 1729 |
-
}
|
| 1730 |
-
if (initial && this.showSearch) this.showSearch(true);
|
| 1731 |
-
return;
|
| 1732 |
-
}
|
| 1733 |
-
|
| 1734 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1735 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1736 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1737 |
-
} else {
|
| 1738 |
-
render("");
|
| 1739 |
-
}
|
| 1740 |
-
return;
|
| 1741 |
-
}
|
| 1742 |
-
|
| 1743 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1744 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1745 |
-
}
|
| 1746 |
-
|
| 1747 |
-
search.addClass("select2-active");
|
| 1748 |
-
|
| 1749 |
-
this.removeHighlight();
|
| 1750 |
-
|
| 1751 |
-
// give the tokenizer a chance to pre-process the input
|
| 1752 |
-
input = this.tokenize();
|
| 1753 |
-
if (input != undefined && input != null) {
|
| 1754 |
-
search.val(input);
|
| 1755 |
-
}
|
| 1756 |
-
|
| 1757 |
-
this.resultsPage = 1;
|
| 1758 |
-
|
| 1759 |
-
opts.query({
|
| 1760 |
-
element: opts.element,
|
| 1761 |
-
term: search.val(),
|
| 1762 |
-
page: this.resultsPage,
|
| 1763 |
-
context: null,
|
| 1764 |
-
matcher: opts.matcher,
|
| 1765 |
-
callback: this.bind(function (data) {
|
| 1766 |
-
var def; // default choice
|
| 1767 |
-
|
| 1768 |
-
// ignore old responses
|
| 1769 |
-
if (queryNumber != this.queryCount) {
|
| 1770 |
-
return;
|
| 1771 |
-
}
|
| 1772 |
-
|
| 1773 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1774 |
-
if (!this.opened()) {
|
| 1775 |
-
this.search.removeClass("select2-active");
|
| 1776 |
-
return;
|
| 1777 |
-
}
|
| 1778 |
-
|
| 1779 |
-
// handle ajax error
|
| 1780 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1781 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1782 |
-
return;
|
| 1783 |
-
}
|
| 1784 |
-
|
| 1785 |
-
// save context, if any
|
| 1786 |
-
this.context = (data.context===undefined) ? null : data.context;
|
| 1787 |
-
// create a default choice and prepend it to the list
|
| 1788 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1789 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1790 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1791 |
-
if ($(data.results).filter(
|
| 1792 |
-
function () {
|
| 1793 |
-
return equal(self.id(this), self.id(def));
|
| 1794 |
-
}).length === 0) {
|
| 1795 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
| 1796 |
-
}
|
| 1797 |
-
}
|
| 1798 |
-
}
|
| 1799 |
-
|
| 1800 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1801 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1802 |
-
return;
|
| 1803 |
-
}
|
| 1804 |
-
|
| 1805 |
-
results.empty();
|
| 1806 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1807 |
-
|
| 1808 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1809 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1810 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1811 |
-
}
|
| 1812 |
-
|
| 1813 |
-
this.postprocessResults(data, initial);
|
| 1814 |
-
|
| 1815 |
-
postRender();
|
| 1816 |
-
|
| 1817 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1818 |
-
})});
|
| 1819 |
-
},
|
| 1820 |
-
|
| 1821 |
-
// abstract
|
| 1822 |
-
cancel: function () {
|
| 1823 |
-
this.close();
|
| 1824 |
-
},
|
| 1825 |
-
|
| 1826 |
-
// abstract
|
| 1827 |
-
blur: function () {
|
| 1828 |
-
// if selectOnBlur == true, select the currently highlighted option
|
| 1829 |
-
if (this.opts.selectOnBlur)
|
| 1830 |
-
this.selectHighlighted({noFocus: true});
|
| 1831 |
-
|
| 1832 |
-
this.close();
|
| 1833 |
-
this.container.removeClass("select2-container-active");
|
| 1834 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1835 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1836 |
-
this.clearSearch();
|
| 1837 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1838 |
-
},
|
| 1839 |
-
|
| 1840 |
-
// abstract
|
| 1841 |
-
focusSearch: function () {
|
| 1842 |
-
focus(this.search);
|
| 1843 |
-
},
|
| 1844 |
-
|
| 1845 |
-
// abstract
|
| 1846 |
-
selectHighlighted: function (options) {
|
| 1847 |
-
if (this._touchMoved) {
|
| 1848 |
-
this.clearTouchMoved();
|
| 1849 |
-
return;
|
| 1850 |
-
}
|
| 1851 |
-
var index=this.highlight(),
|
| 1852 |
-
highlighted=this.results.find(".select2-highlighted"),
|
| 1853 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1854 |
-
|
| 1855 |
-
if (data) {
|
| 1856 |
-
this.highlight(index);
|
| 1857 |
-
this.onSelect(data, options);
|
| 1858 |
-
} else if (options && options.noFocus) {
|
| 1859 |
-
this.close();
|
| 1860 |
-
}
|
| 1861 |
-
},
|
| 1862 |
-
|
| 1863 |
-
// abstract
|
| 1864 |
-
getPlaceholder: function () {
|
| 1865 |
-
var placeholderOption;
|
| 1866 |
-
return this.opts.element.attr("placeholder") ||
|
| 1867 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1868 |
-
this.opts.element.data("placeholder") ||
|
| 1869 |
-
this.opts.placeholder ||
|
| 1870 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1871 |
-
},
|
| 1872 |
-
|
| 1873 |
-
// abstract
|
| 1874 |
-
getPlaceholderOption: function() {
|
| 1875 |
-
if (this.select) {
|
| 1876 |
-
var firstOption = this.select.children('option').first();
|
| 1877 |
-
if (this.opts.placeholderOption !== undefined ) {
|
| 1878 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1879 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1880 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1881 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1882 |
-
//No explicit placeholder option specified, use the first if it's blank
|
| 1883 |
-
return firstOption;
|
| 1884 |
-
}
|
| 1885 |
-
}
|
| 1886 |
-
},
|
| 1887 |
-
|
| 1888 |
-
/**
|
| 1889 |
-
* Get the desired width for the container element. This is
|
| 1890 |
-
* derived first from option `width` passed to select2, then
|
| 1891 |
-
* the inline 'style' on the original element, and finally
|
| 1892 |
-
* falls back to the jQuery calculated element width.
|
| 1893 |
-
*/
|
| 1894 |
-
// abstract
|
| 1895 |
-
initContainerWidth: function () {
|
| 1896 |
-
function resolveContainerWidth() {
|
| 1897 |
-
var style, attrs, matches, i, l, attr;
|
| 1898 |
-
|
| 1899 |
-
if (this.opts.width === "off") {
|
| 1900 |
-
return null;
|
| 1901 |
-
} else if (this.opts.width === "element"){
|
| 1902 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1903 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1904 |
-
// check if there is inline style on the element that contains width
|
| 1905 |
-
style = this.opts.element.attr('style');
|
| 1906 |
-
if (style !== undefined) {
|
| 1907 |
-
attrs = style.split(';');
|
| 1908 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1909 |
-
attr = attrs[i].replace(/\s/g, '');
|
| 1910 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1911 |
-
if (matches !== null && matches.length >= 1)
|
| 1912 |
-
return matches[1];
|
| 1913 |
-
}
|
| 1914 |
-
}
|
| 1915 |
-
|
| 1916 |
-
if (this.opts.width === "resolve") {
|
| 1917 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1918 |
-
// when attached to input type=hidden or elements hidden via css
|
| 1919 |
-
style = this.opts.element.css('width');
|
| 1920 |
-
if (style.indexOf("%") > 0) return style;
|
| 1921 |
-
|
| 1922 |
-
// finally, fallback on the calculated width of the element
|
| 1923 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1924 |
-
}
|
| 1925 |
-
|
| 1926 |
-
return null;
|
| 1927 |
-
} else if ($.isFunction(this.opts.width)) {
|
| 1928 |
-
return this.opts.width();
|
| 1929 |
-
} else {
|
| 1930 |
-
return this.opts.width;
|
| 1931 |
-
}
|
| 1932 |
-
};
|
| 1933 |
-
|
| 1934 |
-
var width = resolveContainerWidth.call(this);
|
| 1935 |
-
if (width !== null) {
|
| 1936 |
-
this.container.css("width", width);
|
| 1937 |
-
}
|
| 1938 |
-
}
|
| 1939 |
-
});
|
| 1940 |
-
|
| 1941 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1942 |
-
|
| 1943 |
-
// single
|
| 1944 |
-
|
| 1945 |
-
createContainer: function () {
|
| 1946 |
-
var container = $(document.createElement("div")).attr({
|
| 1947 |
-
"class": "select2-container"
|
| 1948 |
-
}).html([
|
| 1949 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1950 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1951 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1952 |
-
"</a>",
|
| 1953 |
-
"<label for='' class='select2-offscreen'></label>",
|
| 1954 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1955 |
-
"<div class='select2-drop select2-display-none'>",
|
| 1956 |
-
" <div class='select2-search'>",
|
| 1957 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 1958 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1959 |
-
" aria-autocomplete='list' />",
|
| 1960 |
-
" </div>",
|
| 1961 |
-
" <ul class='select2-results' role='listbox'>",
|
| 1962 |
-
" </ul>",
|
| 1963 |
-
"</div>"].join(""));
|
| 1964 |
-
return container;
|
| 1965 |
-
},
|
| 1966 |
-
|
| 1967 |
-
// single
|
| 1968 |
-
enableInterface: function() {
|
| 1969 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1970 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1971 |
-
}
|
| 1972 |
-
},
|
| 1973 |
-
|
| 1974 |
-
// single
|
| 1975 |
-
opening: function () {
|
| 1976 |
-
var el, range, len;
|
| 1977 |
-
|
| 1978 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1979 |
-
this.showSearch(true);
|
| 1980 |
-
}
|
| 1981 |
-
|
| 1982 |
-
this.parent.opening.apply(this, arguments);
|
| 1983 |
-
|
| 1984 |
-
if (this.showSearchInput !== false) {
|
| 1985 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1986 |
-
// all other browsers handle this just fine
|
| 1987 |
-
|
| 1988 |
-
this.search.val(this.focusser.val());
|
| 1989 |
-
}
|
| 1990 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 1991 |
-
this.search.focus();
|
| 1992 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 1993 |
-
// new text will appear *before* focusser.val()
|
| 1994 |
-
el = this.search.get(0);
|
| 1995 |
-
if (el.createTextRange) {
|
| 1996 |
-
range = el.createTextRange();
|
| 1997 |
-
range.collapse(false);
|
| 1998 |
-
range.select();
|
| 1999 |
-
} else if (el.setSelectionRange) {
|
| 2000 |
-
len = this.search.val().length;
|
| 2001 |
-
el.setSelectionRange(len, len);
|
| 2002 |
-
}
|
| 2003 |
-
}
|
| 2004 |
-
|
| 2005 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2006 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2007 |
-
if(this.search.val() === "") {
|
| 2008 |
-
if(this.nextSearchTerm != undefined){
|
| 2009 |
-
this.search.val(this.nextSearchTerm);
|
| 2010 |
-
this.search.select();
|
| 2011 |
-
}
|
| 2012 |
-
}
|
| 2013 |
-
|
| 2014 |
-
this.focusser.prop("disabled", true).val("");
|
| 2015 |
-
this.updateResults(true);
|
| 2016 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2017 |
-
},
|
| 2018 |
-
|
| 2019 |
-
// single
|
| 2020 |
-
close: function () {
|
| 2021 |
-
if (!this.opened()) return;
|
| 2022 |
-
this.parent.close.apply(this, arguments);
|
| 2023 |
-
|
| 2024 |
-
this.focusser.prop("disabled", false);
|
| 2025 |
-
|
| 2026 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2027 |
-
this.focusser.focus();
|
| 2028 |
-
}
|
| 2029 |
-
},
|
| 2030 |
-
|
| 2031 |
-
// single
|
| 2032 |
-
focus: function () {
|
| 2033 |
-
if (this.opened()) {
|
| 2034 |
-
this.close();
|
| 2035 |
-
} else {
|
| 2036 |
-
this.focusser.prop("disabled", false);
|
| 2037 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2038 |
-
this.focusser.focus();
|
| 2039 |
-
}
|
| 2040 |
-
}
|
| 2041 |
-
},
|
| 2042 |
-
|
| 2043 |
-
// single
|
| 2044 |
-
isFocused: function () {
|
| 2045 |
-
return this.container.hasClass("select2-container-active");
|
| 2046 |
-
},
|
| 2047 |
-
|
| 2048 |
-
// single
|
| 2049 |
-
cancel: function () {
|
| 2050 |
-
this.parent.cancel.apply(this, arguments);
|
| 2051 |
-
this.focusser.prop("disabled", false);
|
| 2052 |
-
|
| 2053 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2054 |
-
this.focusser.focus();
|
| 2055 |
-
}
|
| 2056 |
-
},
|
| 2057 |
-
|
| 2058 |
-
// single
|
| 2059 |
-
destroy: function() {
|
| 2060 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2061 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2062 |
-
this.parent.destroy.apply(this, arguments);
|
| 2063 |
-
|
| 2064 |
-
cleanupJQueryElements.call(this,
|
| 2065 |
-
"selection",
|
| 2066 |
-
"focusser"
|
| 2067 |
-
);
|
| 2068 |
-
},
|
| 2069 |
-
|
| 2070 |
-
// single
|
| 2071 |
-
initContainer: function () {
|
| 2072 |
-
|
| 2073 |
-
var selection,
|
| 2074 |
-
container = this.container,
|
| 2075 |
-
dropdown = this.dropdown,
|
| 2076 |
-
idSuffix = nextUid(),
|
| 2077 |
-
elementLabel;
|
| 2078 |
-
|
| 2079 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
| 2080 |
-
this.showSearch(false);
|
| 2081 |
-
} else {
|
| 2082 |
-
this.showSearch(true);
|
| 2083 |
-
}
|
| 2084 |
-
|
| 2085 |
-
this.selection = selection = container.find(".select2-choice");
|
| 2086 |
-
|
| 2087 |
-
this.focusser = container.find(".select2-focusser");
|
| 2088 |
-
|
| 2089 |
-
// add aria associations
|
| 2090 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2091 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2092 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2093 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2094 |
-
|
| 2095 |
-
// rewrite labels from original element to focusser
|
| 2096 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2097 |
-
|
| 2098 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2099 |
-
|
| 2100 |
-
this.focusser.prev()
|
| 2101 |
-
.text(elementLabel.text())
|
| 2102 |
-
.attr('for', this.focusser.attr('id'));
|
| 2103 |
-
|
| 2104 |
-
// Ensure the original element retains an accessible name
|
| 2105 |
-
var originalTitle = this.opts.element.attr("title");
|
| 2106 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2107 |
-
|
| 2108 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2109 |
-
|
| 2110 |
-
// write label for search field using the label from the focusser element
|
| 2111 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2112 |
-
|
| 2113 |
-
this.search.prev()
|
| 2114 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2115 |
-
.attr('for', this.search.attr('id'));
|
| 2116 |
-
|
| 2117 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2118 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2119 |
-
|
| 2120 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
| 2121 |
-
if (229 == e.keyCode) return;
|
| 2122 |
-
|
| 2123 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2124 |
-
// prevent the page from scrolling
|
| 2125 |
-
killEvent(e);
|
| 2126 |
-
return;
|
| 2127 |
-
}
|
| 2128 |
-
|
| 2129 |
-
switch (e.which) {
|
| 2130 |
-
case KEY.UP:
|
| 2131 |
-
case KEY.DOWN:
|
| 2132 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2133 |
-
killEvent(e);
|
| 2134 |
-
return;
|
| 2135 |
-
case KEY.ENTER:
|
| 2136 |
-
this.selectHighlighted();
|
| 2137 |
-
killEvent(e);
|
| 2138 |
-
return;
|
| 2139 |
-
case KEY.TAB:
|
| 2140 |
-
this.selectHighlighted({noFocus: true});
|
| 2141 |
-
return;
|
| 2142 |
-
case KEY.ESC:
|
| 2143 |
-
this.cancel(e);
|
| 2144 |
-
killEvent(e);
|
| 2145 |
-
return;
|
| 2146 |
-
}
|
| 2147 |
-
}));
|
| 2148 |
-
|
| 2149 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2150 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2151 |
-
// without this the search field loses focus which is annoying
|
| 2152 |
-
if (document.activeElement === this.body.get(0)) {
|
| 2153 |
-
window.setTimeout(this.bind(function() {
|
| 2154 |
-
if (this.opened()) {
|
| 2155 |
-
this.search.focus();
|
| 2156 |
-
}
|
| 2157 |
-
}), 0);
|
| 2158 |
-
}
|
| 2159 |
-
}));
|
| 2160 |
-
|
| 2161 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
| 2162 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2163 |
-
|
| 2164 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2165 |
-
return;
|
| 2166 |
-
}
|
| 2167 |
-
|
| 2168 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2169 |
-
killEvent(e);
|
| 2170 |
-
return;
|
| 2171 |
-
}
|
| 2172 |
-
|
| 2173 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2174 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2175 |
-
|
| 2176 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2177 |
-
|
| 2178 |
-
this.open();
|
| 2179 |
-
killEvent(e);
|
| 2180 |
-
return;
|
| 2181 |
-
}
|
| 2182 |
-
|
| 2183 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2184 |
-
if (this.opts.allowClear) {
|
| 2185 |
-
this.clear();
|
| 2186 |
-
}
|
| 2187 |
-
killEvent(e);
|
| 2188 |
-
return;
|
| 2189 |
-
}
|
| 2190 |
-
}));
|
| 2191 |
-
|
| 2192 |
-
|
| 2193 |
-
installKeyUpChangeEvent(this.focusser);
|
| 2194 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2195 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2196 |
-
e.stopPropagation();
|
| 2197 |
-
if (this.opened()) return;
|
| 2198 |
-
this.open();
|
| 2199 |
-
}
|
| 2200 |
-
}));
|
| 2201 |
-
|
| 2202 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2203 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2204 |
-
this.clear();
|
| 2205 |
-
killEventImmediately(e);
|
| 2206 |
-
this.close();
|
| 2207 |
-
this.selection.focus();
|
| 2208 |
-
}));
|
| 2209 |
-
|
| 2210 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2211 |
-
// Prevent IE from generating a click event on the body
|
| 2212 |
-
reinsertElement(selection);
|
| 2213 |
-
|
| 2214 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2215 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2216 |
-
}
|
| 2217 |
-
|
| 2218 |
-
if (this.opened()) {
|
| 2219 |
-
this.close();
|
| 2220 |
-
} else if (this.isInterfaceEnabled()) {
|
| 2221 |
-
this.open();
|
| 2222 |
-
}
|
| 2223 |
-
|
| 2224 |
-
killEvent(e);
|
| 2225 |
-
}));
|
| 2226 |
-
|
| 2227 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2228 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2229 |
-
this.search.focus();
|
| 2230 |
-
}
|
| 2231 |
-
}));
|
| 2232 |
-
|
| 2233 |
-
selection.on("focus", this.bind(function(e) {
|
| 2234 |
-
killEvent(e);
|
| 2235 |
-
}));
|
| 2236 |
-
|
| 2237 |
-
this.focusser.on("focus", this.bind(function(){
|
| 2238 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2239 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2240 |
-
}
|
| 2241 |
-
this.container.addClass("select2-container-active");
|
| 2242 |
-
})).on("blur", this.bind(function() {
|
| 2243 |
-
if (!this.opened()) {
|
| 2244 |
-
this.container.removeClass("select2-container-active");
|
| 2245 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2246 |
-
}
|
| 2247 |
-
}));
|
| 2248 |
-
this.search.on("focus", this.bind(function(){
|
| 2249 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2250 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2251 |
-
}
|
| 2252 |
-
this.container.addClass("select2-container-active");
|
| 2253 |
-
}));
|
| 2254 |
-
|
| 2255 |
-
this.initContainerWidth();
|
| 2256 |
-
this.opts.element.addClass("select2-offscreen");
|
| 2257 |
-
this.setPlaceholder();
|
| 2258 |
-
|
| 2259 |
-
},
|
| 2260 |
-
|
| 2261 |
-
// single
|
| 2262 |
-
clear: function(triggerChange) {
|
| 2263 |
-
var data=this.selection.data("select2-data");
|
| 2264 |
-
if (data) { // guard against queued quick consecutive clicks
|
| 2265 |
-
var evt = $.Event("select2-clearing");
|
| 2266 |
-
this.opts.element.trigger(evt);
|
| 2267 |
-
if (evt.isDefaultPrevented()) {
|
| 2268 |
-
return;
|
| 2269 |
-
}
|
| 2270 |
-
var placeholderOption = this.getPlaceholderOption();
|
| 2271 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2272 |
-
this.selection.find(".select2-chosen").empty();
|
| 2273 |
-
this.selection.removeData("select2-data");
|
| 2274 |
-
this.setPlaceholder();
|
| 2275 |
-
|
| 2276 |
-
if (triggerChange !== false){
|
| 2277 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2278 |
-
this.triggerChange({removed:data});
|
| 2279 |
-
}
|
| 2280 |
-
}
|
| 2281 |
-
},
|
| 2282 |
-
|
| 2283 |
-
/**
|
| 2284 |
-
* Sets selection based on source element's value
|
| 2285 |
-
*/
|
| 2286 |
-
// single
|
| 2287 |
-
initSelection: function () {
|
| 2288 |
-
var selected;
|
| 2289 |
-
if (this.isPlaceholderOptionSelected()) {
|
| 2290 |
-
this.updateSelection(null);
|
| 2291 |
-
this.close();
|
| 2292 |
-
this.setPlaceholder();
|
| 2293 |
-
} else {
|
| 2294 |
-
var self = this;
|
| 2295 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2296 |
-
if (selected !== undefined && selected !== null) {
|
| 2297 |
-
self.updateSelection(selected);
|
| 2298 |
-
self.close();
|
| 2299 |
-
self.setPlaceholder();
|
| 2300 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2301 |
-
}
|
| 2302 |
-
});
|
| 2303 |
-
}
|
| 2304 |
-
},
|
| 2305 |
-
|
| 2306 |
-
isPlaceholderOptionSelected: function() {
|
| 2307 |
-
var placeholderOption;
|
| 2308 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2309 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2310 |
-
|| (this.opts.element.val() === "")
|
| 2311 |
-
|| (this.opts.element.val() === undefined)
|
| 2312 |
-
|| (this.opts.element.val() === null);
|
| 2313 |
-
},
|
| 2314 |
-
|
| 2315 |
-
// single
|
| 2316 |
-
prepareOpts: function () {
|
| 2317 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2318 |
-
self=this;
|
| 2319 |
-
|
| 2320 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2321 |
-
// install the selection initializer
|
| 2322 |
-
opts.initSelection = function (element, callback) {
|
| 2323 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2324 |
-
// a single select box always has a value, no need to null check 'selected'
|
| 2325 |
-
callback(self.optionToData(selected));
|
| 2326 |
-
};
|
| 2327 |
-
} else if ("data" in opts) {
|
| 2328 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2329 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2330 |
-
var id = element.val();
|
| 2331 |
-
//search in data by id, storing the actual matching item
|
| 2332 |
-
var match = null;
|
| 2333 |
-
opts.query({
|
| 2334 |
-
matcher: function(term, text, el){
|
| 2335 |
-
var is_match = equal(id, opts.id(el));
|
| 2336 |
-
if (is_match) {
|
| 2337 |
-
match = el;
|
| 2338 |
-
}
|
| 2339 |
-
return is_match;
|
| 2340 |
-
},
|
| 2341 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2342 |
-
callback(match);
|
| 2343 |
-
}
|
| 2344 |
-
});
|
| 2345 |
-
};
|
| 2346 |
-
}
|
| 2347 |
-
|
| 2348 |
-
return opts;
|
| 2349 |
-
},
|
| 2350 |
-
|
| 2351 |
-
// single
|
| 2352 |
-
getPlaceholder: function() {
|
| 2353 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2354 |
-
if (this.select) {
|
| 2355 |
-
if (this.getPlaceholderOption() === undefined) {
|
| 2356 |
-
return undefined;
|
| 2357 |
-
}
|
| 2358 |
-
}
|
| 2359 |
-
|
| 2360 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2361 |
-
},
|
| 2362 |
-
|
| 2363 |
-
// single
|
| 2364 |
-
setPlaceholder: function () {
|
| 2365 |
-
var placeholder = this.getPlaceholder();
|
| 2366 |
-
|
| 2367 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2368 |
-
|
| 2369 |
-
// check for a placeholder option if attached to a select
|
| 2370 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2371 |
-
|
| 2372 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2373 |
-
|
| 2374 |
-
this.selection.addClass("select2-default");
|
| 2375 |
-
|
| 2376 |
-
this.container.removeClass("select2-allowclear");
|
| 2377 |
-
}
|
| 2378 |
-
},
|
| 2379 |
-
|
| 2380 |
-
// single
|
| 2381 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2382 |
-
var selected = 0, self = this, showSearchInput = true;
|
| 2383 |
-
|
| 2384 |
-
// find the selected element in the result list
|
| 2385 |
-
|
| 2386 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2387 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2388 |
-
selected = i;
|
| 2389 |
-
return false;
|
| 2390 |
-
}
|
| 2391 |
-
});
|
| 2392 |
-
|
| 2393 |
-
// and highlight it
|
| 2394 |
-
if (noHighlightUpdate !== false) {
|
| 2395 |
-
if (initial === true && selected >= 0) {
|
| 2396 |
-
this.highlight(selected);
|
| 2397 |
-
} else {
|
| 2398 |
-
this.highlight(0);
|
| 2399 |
-
}
|
| 2400 |
-
}
|
| 2401 |
-
|
| 2402 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2403 |
-
|
| 2404 |
-
if (initial === true) {
|
| 2405 |
-
var min = this.opts.minimumResultsForSearch;
|
| 2406 |
-
if (min >= 0) {
|
| 2407 |
-
this.showSearch(countResults(data.results) >= min);
|
| 2408 |
-
}
|
| 2409 |
-
}
|
| 2410 |
-
},
|
| 2411 |
-
|
| 2412 |
-
// single
|
| 2413 |
-
showSearch: function(showSearchInput) {
|
| 2414 |
-
if (this.showSearchInput === showSearchInput) return;
|
| 2415 |
-
|
| 2416 |
-
this.showSearchInput = showSearchInput;
|
| 2417 |
-
|
| 2418 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2419 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2420 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
| 2421 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2422 |
-
},
|
| 2423 |
-
|
| 2424 |
-
// single
|
| 2425 |
-
onSelect: function (data, options) {
|
| 2426 |
-
|
| 2427 |
-
if (!this.triggerSelect(data)) { return; }
|
| 2428 |
-
|
| 2429 |
-
var old = this.opts.element.val(),
|
| 2430 |
-
oldData = this.data();
|
| 2431 |
-
|
| 2432 |
-
this.opts.element.val(this.id(data));
|
| 2433 |
-
this.updateSelection(data);
|
| 2434 |
-
|
| 2435 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2436 |
-
|
| 2437 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2438 |
-
this.close();
|
| 2439 |
-
|
| 2440 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2441 |
-
this.focusser.focus();
|
| 2442 |
-
}
|
| 2443 |
-
|
| 2444 |
-
if (!equal(old, this.id(data))) {
|
| 2445 |
-
this.triggerChange({ added: data, removed: oldData });
|
| 2446 |
-
}
|
| 2447 |
-
},
|
| 2448 |
-
|
| 2449 |
-
// single
|
| 2450 |
-
updateSelection: function (data) {
|
| 2451 |
-
|
| 2452 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2453 |
-
|
| 2454 |
-
this.selection.data("select2-data", data);
|
| 2455 |
-
|
| 2456 |
-
container.empty();
|
| 2457 |
-
if (data !== null) {
|
| 2458 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2459 |
-
}
|
| 2460 |
-
if (formatted !== undefined) {
|
| 2461 |
-
container.append(formatted);
|
| 2462 |
-
}
|
| 2463 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2464 |
-
if (cssClass !== undefined) {
|
| 2465 |
-
container.addClass(cssClass);
|
| 2466 |
-
}
|
| 2467 |
-
|
| 2468 |
-
this.selection.removeClass("select2-default");
|
| 2469 |
-
|
| 2470 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2471 |
-
this.container.addClass("select2-allowclear");
|
| 2472 |
-
}
|
| 2473 |
-
},
|
| 2474 |
-
|
| 2475 |
-
// single
|
| 2476 |
-
val: function () {
|
| 2477 |
-
var val,
|
| 2478 |
-
triggerChange = false,
|
| 2479 |
-
data = null,
|
| 2480 |
-
self = this,
|
| 2481 |
-
oldData = this.data();
|
| 2482 |
-
|
| 2483 |
-
if (arguments.length === 0) {
|
| 2484 |
-
return this.opts.element.val();
|
| 2485 |
-
}
|
| 2486 |
-
|
| 2487 |
-
val = arguments[0];
|
| 2488 |
-
|
| 2489 |
-
if (arguments.length > 1) {
|
| 2490 |
-
triggerChange = arguments[1];
|
| 2491 |
-
}
|
| 2492 |
-
|
| 2493 |
-
if (this.select) {
|
| 2494 |
-
this.select
|
| 2495 |
-
.val(val)
|
| 2496 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2497 |
-
data = self.optionToData(elm);
|
| 2498 |
-
return false;
|
| 2499 |
-
});
|
| 2500 |
-
this.updateSelection(data);
|
| 2501 |
-
this.setPlaceholder();
|
| 2502 |
-
if (triggerChange) {
|
| 2503 |
-
this.triggerChange({added: data, removed:oldData});
|
| 2504 |
-
}
|
| 2505 |
-
} else {
|
| 2506 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2507 |
-
if (!val && val !== 0) {
|
| 2508 |
-
this.clear(triggerChange);
|
| 2509 |
-
return;
|
| 2510 |
-
}
|
| 2511 |
-
if (this.opts.initSelection === undefined) {
|
| 2512 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2513 |
-
}
|
| 2514 |
-
this.opts.element.val(val);
|
| 2515 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 2516 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
| 2517 |
-
self.updateSelection(data);
|
| 2518 |
-
self.setPlaceholder();
|
| 2519 |
-
if (triggerChange) {
|
| 2520 |
-
self.triggerChange({added: data, removed:oldData});
|
| 2521 |
-
}
|
| 2522 |
-
});
|
| 2523 |
-
}
|
| 2524 |
-
},
|
| 2525 |
-
|
| 2526 |
-
// single
|
| 2527 |
-
clearSearch: function () {
|
| 2528 |
-
this.search.val("");
|
| 2529 |
-
this.focusser.val("");
|
| 2530 |
-
},
|
| 2531 |
-
|
| 2532 |
-
// single
|
| 2533 |
-
data: function(value) {
|
| 2534 |
-
var data,
|
| 2535 |
-
triggerChange = false;
|
| 2536 |
-
|
| 2537 |
-
if (arguments.length === 0) {
|
| 2538 |
-
data = this.selection.data("select2-data");
|
| 2539 |
-
if (data == undefined) data = null;
|
| 2540 |
-
return data;
|
| 2541 |
-
} else {
|
| 2542 |
-
if (arguments.length > 1) {
|
| 2543 |
-
triggerChange = arguments[1];
|
| 2544 |
-
}
|
| 2545 |
-
if (!value) {
|
| 2546 |
-
this.clear(triggerChange);
|
| 2547 |
-
} else {
|
| 2548 |
-
data = this.data();
|
| 2549 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
| 2550 |
-
this.updateSelection(value);
|
| 2551 |
-
if (triggerChange) {
|
| 2552 |
-
this.triggerChange({added: value, removed:data});
|
| 2553 |
-
}
|
| 2554 |
-
}
|
| 2555 |
-
}
|
| 2556 |
-
}
|
| 2557 |
-
});
|
| 2558 |
-
|
| 2559 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2560 |
-
|
| 2561 |
-
// multi
|
| 2562 |
-
createContainer: function () {
|
| 2563 |
-
var container = $(document.createElement("div")).attr({
|
| 2564 |
-
"class": "select2-container select2-container-multi"
|
| 2565 |
-
}).html([
|
| 2566 |
-
"<ul class='select2-choices'>",
|
| 2567 |
-
" <li class='select2-search-field'>",
|
| 2568 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 2569 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2570 |
-
" </li>",
|
| 2571 |
-
"</ul>",
|
| 2572 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2573 |
-
" <ul class='select2-results'>",
|
| 2574 |
-
" </ul>",
|
| 2575 |
-
"</div>"].join(""));
|
| 2576 |
-
return container;
|
| 2577 |
-
},
|
| 2578 |
-
|
| 2579 |
-
// multi
|
| 2580 |
-
prepareOpts: function () {
|
| 2581 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2582 |
-
self=this;
|
| 2583 |
-
|
| 2584 |
-
// TODO validate placeholder is a string if specified
|
| 2585 |
-
|
| 2586 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2587 |
-
// install the selection initializer
|
| 2588 |
-
opts.initSelection = function (element, callback) {
|
| 2589 |
-
|
| 2590 |
-
var data = [];
|
| 2591 |
-
|
| 2592 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2593 |
-
data.push(self.optionToData(elm));
|
| 2594 |
-
});
|
| 2595 |
-
callback(data);
|
| 2596 |
-
};
|
| 2597 |
-
} else if ("data" in opts) {
|
| 2598 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2599 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2600 |
-
var ids = splitVal(element.val(), opts.separator);
|
| 2601 |
-
//search in data by array of ids, storing matching items in a list
|
| 2602 |
-
var matches = [];
|
| 2603 |
-
opts.query({
|
| 2604 |
-
matcher: function(term, text, el){
|
| 2605 |
-
var is_match = $.grep(ids, function(id) {
|
| 2606 |
-
return equal(id, opts.id(el));
|
| 2607 |
-
}).length;
|
| 2608 |
-
if (is_match) {
|
| 2609 |
-
matches.push(el);
|
| 2610 |
-
}
|
| 2611 |
-
return is_match;
|
| 2612 |
-
},
|
| 2613 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2614 |
-
// reorder matches based on the order they appear in the ids array because right now
|
| 2615 |
-
// they are in the order in which they appear in data array
|
| 2616 |
-
var ordered = [];
|
| 2617 |
-
for (var i = 0; i < ids.length; i++) {
|
| 2618 |
-
var id = ids[i];
|
| 2619 |
-
for (var j = 0; j < matches.length; j++) {
|
| 2620 |
-
var match = matches[j];
|
| 2621 |
-
if (equal(id, opts.id(match))) {
|
| 2622 |
-
ordered.push(match);
|
| 2623 |
-
matches.splice(j, 1);
|
| 2624 |
-
break;
|
| 2625 |
-
}
|
| 2626 |
-
}
|
| 2627 |
-
}
|
| 2628 |
-
callback(ordered);
|
| 2629 |
-
}
|
| 2630 |
-
});
|
| 2631 |
-
};
|
| 2632 |
-
}
|
| 2633 |
-
|
| 2634 |
-
return opts;
|
| 2635 |
-
},
|
| 2636 |
-
|
| 2637 |
-
// multi
|
| 2638 |
-
selectChoice: function (choice) {
|
| 2639 |
-
|
| 2640 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
| 2641 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2642 |
-
|
| 2643 |
-
} else {
|
| 2644 |
-
if (selected.length) {
|
| 2645 |
-
this.opts.element.trigger("choice-deselected", selected);
|
| 2646 |
-
}
|
| 2647 |
-
selected.removeClass("select2-search-choice-focus");
|
| 2648 |
-
if (choice && choice.length) {
|
| 2649 |
-
this.close();
|
| 2650 |
-
choice.addClass("select2-search-choice-focus");
|
| 2651 |
-
this.opts.element.trigger("choice-selected", choice);
|
| 2652 |
-
}
|
| 2653 |
-
}
|
| 2654 |
-
},
|
| 2655 |
-
|
| 2656 |
-
// multi
|
| 2657 |
-
destroy: function() {
|
| 2658 |
-
$("label[for='" + this.search.attr('id') + "']")
|
| 2659 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2660 |
-
this.parent.destroy.apply(this, arguments);
|
| 2661 |
-
|
| 2662 |
-
cleanupJQueryElements.call(this,
|
| 2663 |
-
"searchContainer",
|
| 2664 |
-
"selection"
|
| 2665 |
-
);
|
| 2666 |
-
},
|
| 2667 |
-
|
| 2668 |
-
// multi
|
| 2669 |
-
initContainer: function () {
|
| 2670 |
-
|
| 2671 |
-
var selector = ".select2-choices", selection;
|
| 2672 |
-
|
| 2673 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
| 2674 |
-
this.selection = selection = this.container.find(selector);
|
| 2675 |
-
|
| 2676 |
-
var _this = this;
|
| 2677 |
-
this.selection.on("click", ".select2-search-choice:not(.select2-locked)", function (e) {
|
| 2678 |
-
//killEvent(e);
|
| 2679 |
-
_this.search[0].focus();
|
| 2680 |
-
_this.selectChoice($(this));
|
| 2681 |
-
});
|
| 2682 |
-
|
| 2683 |
-
// rewrite labels from original element to focusser
|
| 2684 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2685 |
-
|
| 2686 |
-
this.search.prev()
|
| 2687 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2688 |
-
.attr('for', this.search.attr('id'));
|
| 2689 |
-
|
| 2690 |
-
this.search.on("input paste", this.bind(function() {
|
| 2691 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2692 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2693 |
-
if (!this.opened()) {
|
| 2694 |
-
this.open();
|
| 2695 |
-
}
|
| 2696 |
-
}));
|
| 2697 |
-
|
| 2698 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
| 2699 |
-
|
| 2700 |
-
this.keydowns = 0;
|
| 2701 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2702 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2703 |
-
|
| 2704 |
-
++this.keydowns;
|
| 2705 |
-
var selected = selection.find(".select2-search-choice-focus");
|
| 2706 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2707 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2708 |
-
var pos = getCursorInfo(this.search);
|
| 2709 |
-
|
| 2710 |
-
if (selected.length &&
|
| 2711 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2712 |
-
var selectedChoice = selected;
|
| 2713 |
-
if (e.which == KEY.LEFT && prev.length) {
|
| 2714 |
-
selectedChoice = prev;
|
| 2715 |
-
}
|
| 2716 |
-
else if (e.which == KEY.RIGHT) {
|
| 2717 |
-
selectedChoice = next.length ? next : null;
|
| 2718 |
-
}
|
| 2719 |
-
else if (e.which === KEY.BACKSPACE) {
|
| 2720 |
-
if (this.unselect(selected.first())) {
|
| 2721 |
-
this.search.width(10);
|
| 2722 |
-
selectedChoice = prev.length ? prev : next;
|
| 2723 |
-
}
|
| 2724 |
-
} else if (e.which == KEY.DELETE) {
|
| 2725 |
-
if (this.unselect(selected.first())) {
|
| 2726 |
-
this.search.width(10);
|
| 2727 |
-
selectedChoice = next.length ? next : null;
|
| 2728 |
-
}
|
| 2729 |
-
} else if (e.which == KEY.ENTER) {
|
| 2730 |
-
selectedChoice = null;
|
| 2731 |
-
}
|
| 2732 |
-
|
| 2733 |
-
this.selectChoice(selectedChoice);
|
| 2734 |
-
killEvent(e);
|
| 2735 |
-
if (!selectedChoice || !selectedChoice.length) {
|
| 2736 |
-
this.open();
|
| 2737 |
-
}
|
| 2738 |
-
return;
|
| 2739 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2740 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2741 |
-
|
| 2742 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2743 |
-
killEvent(e);
|
| 2744 |
-
return;
|
| 2745 |
-
} else {
|
| 2746 |
-
this.selectChoice(null);
|
| 2747 |
-
}
|
| 2748 |
-
|
| 2749 |
-
if (this.opened()) {
|
| 2750 |
-
switch (e.which) {
|
| 2751 |
-
case KEY.UP:
|
| 2752 |
-
case KEY.DOWN:
|
| 2753 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2754 |
-
killEvent(e);
|
| 2755 |
-
return;
|
| 2756 |
-
case KEY.ENTER:
|
| 2757 |
-
this.selectHighlighted();
|
| 2758 |
-
killEvent(e);
|
| 2759 |
-
return;
|
| 2760 |
-
case KEY.TAB:
|
| 2761 |
-
this.selectHighlighted({noFocus:true});
|
| 2762 |
-
this.close();
|
| 2763 |
-
return;
|
| 2764 |
-
case KEY.ESC:
|
| 2765 |
-
this.cancel(e);
|
| 2766 |
-
killEvent(e);
|
| 2767 |
-
return;
|
| 2768 |
-
}
|
| 2769 |
-
}
|
| 2770 |
-
|
| 2771 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2772 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2773 |
-
return;
|
| 2774 |
-
}
|
| 2775 |
-
|
| 2776 |
-
if (e.which === KEY.ENTER) {
|
| 2777 |
-
if (this.opts.openOnEnter === false) {
|
| 2778 |
-
return;
|
| 2779 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2780 |
-
return;
|
| 2781 |
-
}
|
| 2782 |
-
}
|
| 2783 |
-
|
| 2784 |
-
this.open();
|
| 2785 |
-
|
| 2786 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2787 |
-
// prevent the page from scrolling
|
| 2788 |
-
killEvent(e);
|
| 2789 |
-
}
|
| 2790 |
-
|
| 2791 |
-
if (e.which === KEY.ENTER) {
|
| 2792 |
-
// prevent form from being submitted
|
| 2793 |
-
killEvent(e);
|
| 2794 |
-
}
|
| 2795 |
-
|
| 2796 |
-
}));
|
| 2797 |
-
|
| 2798 |
-
this.search.on("keyup", this.bind(function (e) {
|
| 2799 |
-
this.keydowns = 0;
|
| 2800 |
-
this.resizeSearch();
|
| 2801 |
-
})
|
| 2802 |
-
);
|
| 2803 |
-
|
| 2804 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2805 |
-
this.container.removeClass("select2-container-active");
|
| 2806 |
-
this.search.removeClass("select2-focused");
|
| 2807 |
-
this.selectChoice(null);
|
| 2808 |
-
if (!this.opened()) this.clearSearch();
|
| 2809 |
-
e.stopImmediatePropagation();
|
| 2810 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2811 |
-
}));
|
| 2812 |
-
|
| 2813 |
-
this.container.on("click", selector, this.bind(function (e) {
|
| 2814 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2815 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2816 |
-
// clicked inside a select2 search choice, do not open
|
| 2817 |
-
return;
|
| 2818 |
-
}
|
| 2819 |
-
this.selectChoice(null);
|
| 2820 |
-
this.clearPlaceholder();
|
| 2821 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2822 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2823 |
-
}
|
| 2824 |
-
this.open();
|
| 2825 |
-
this.focusSearch();
|
| 2826 |
-
e.preventDefault();
|
| 2827 |
-
}));
|
| 2828 |
-
|
| 2829 |
-
this.container.on("focus", selector, this.bind(function () {
|
| 2830 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2831 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2832 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2833 |
-
}
|
| 2834 |
-
this.container.addClass("select2-container-active");
|
| 2835 |
-
this.dropdown.addClass("select2-drop-active");
|
| 2836 |
-
this.clearPlaceholder();
|
| 2837 |
-
}));
|
| 2838 |
-
|
| 2839 |
-
this.initContainerWidth();
|
| 2840 |
-
this.opts.element.addClass("select2-offscreen");
|
| 2841 |
-
|
| 2842 |
-
// set the placeholder if necessary
|
| 2843 |
-
this.clearSearch();
|
| 2844 |
-
},
|
| 2845 |
-
|
| 2846 |
-
// multi
|
| 2847 |
-
enableInterface: function() {
|
| 2848 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2849 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2850 |
-
}
|
| 2851 |
-
},
|
| 2852 |
-
|
| 2853 |
-
// multi
|
| 2854 |
-
initSelection: function () {
|
| 2855 |
-
var data;
|
| 2856 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2857 |
-
this.updateSelection([]);
|
| 2858 |
-
this.close();
|
| 2859 |
-
// set the placeholder if necessary
|
| 2860 |
-
this.clearSearch();
|
| 2861 |
-
}
|
| 2862 |
-
if (this.select || this.opts.element.val() !== "") {
|
| 2863 |
-
var self = this;
|
| 2864 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2865 |
-
if (data !== undefined && data !== null) {
|
| 2866 |
-
self.updateSelection(data);
|
| 2867 |
-
self.close();
|
| 2868 |
-
// set the placeholder if necessary
|
| 2869 |
-
self.clearSearch();
|
| 2870 |
-
}
|
| 2871 |
-
});
|
| 2872 |
-
}
|
| 2873 |
-
},
|
| 2874 |
-
|
| 2875 |
-
// multi
|
| 2876 |
-
clearSearch: function () {
|
| 2877 |
-
var placeholder = this.getPlaceholder(),
|
| 2878 |
-
maxWidth = this.getMaxSearchWidth();
|
| 2879 |
-
|
| 2880 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2881 |
-
this.search.val(placeholder).addClass("select2-default");
|
| 2882 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2883 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2884 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2885 |
-
} else {
|
| 2886 |
-
this.search.val("").width(10);
|
| 2887 |
-
}
|
| 2888 |
-
},
|
| 2889 |
-
|
| 2890 |
-
// multi
|
| 2891 |
-
clearPlaceholder: function () {
|
| 2892 |
-
if (this.search.hasClass("select2-default")) {
|
| 2893 |
-
this.search.val("").removeClass("select2-default");
|
| 2894 |
-
}
|
| 2895 |
-
},
|
| 2896 |
-
|
| 2897 |
-
// multi
|
| 2898 |
-
opening: function () {
|
| 2899 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2900 |
-
this.resizeSearch();
|
| 2901 |
-
|
| 2902 |
-
this.parent.opening.apply(this, arguments);
|
| 2903 |
-
|
| 2904 |
-
this.focusSearch();
|
| 2905 |
-
|
| 2906 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2907 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2908 |
-
if(this.search.val() === "") {
|
| 2909 |
-
if(this.nextSearchTerm != undefined){
|
| 2910 |
-
this.search.val(this.nextSearchTerm);
|
| 2911 |
-
this.search.select();
|
| 2912 |
-
}
|
| 2913 |
-
}
|
| 2914 |
-
|
| 2915 |
-
this.updateResults(true);
|
| 2916 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2917 |
-
this.search.focus();
|
| 2918 |
-
}
|
| 2919 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2920 |
-
},
|
| 2921 |
-
|
| 2922 |
-
// multi
|
| 2923 |
-
close: function () {
|
| 2924 |
-
if (!this.opened()) return;
|
| 2925 |
-
this.parent.close.apply(this, arguments);
|
| 2926 |
-
},
|
| 2927 |
-
|
| 2928 |
-
// multi
|
| 2929 |
-
focus: function () {
|
| 2930 |
-
this.close();
|
| 2931 |
-
this.search.focus();
|
| 2932 |
-
},
|
| 2933 |
-
|
| 2934 |
-
// multi
|
| 2935 |
-
isFocused: function () {
|
| 2936 |
-
return this.search.hasClass("select2-focused");
|
| 2937 |
-
},
|
| 2938 |
-
|
| 2939 |
-
// multi
|
| 2940 |
-
updateSelection: function (data) {
|
| 2941 |
-
var ids = [], filtered = [], self = this;
|
| 2942 |
-
|
| 2943 |
-
// filter out duplicates
|
| 2944 |
-
$(data).each(function () {
|
| 2945 |
-
if (indexOf(self.id(this), ids) < 0) {
|
| 2946 |
-
ids.push(self.id(this));
|
| 2947 |
-
filtered.push(this);
|
| 2948 |
-
}
|
| 2949 |
-
});
|
| 2950 |
-
data = filtered;
|
| 2951 |
-
|
| 2952 |
-
this.selection.find(".select2-search-choice").remove();
|
| 2953 |
-
$(data).each(function () {
|
| 2954 |
-
self.addSelectedChoice(this);
|
| 2955 |
-
});
|
| 2956 |
-
self.postprocessResults();
|
| 2957 |
-
},
|
| 2958 |
-
|
| 2959 |
-
// multi
|
| 2960 |
-
tokenize: function() {
|
| 2961 |
-
var input = this.search.val();
|
| 2962 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2963 |
-
if (input != null && input != undefined) {
|
| 2964 |
-
this.search.val(input);
|
| 2965 |
-
if (input.length > 0) {
|
| 2966 |
-
this.open();
|
| 2967 |
-
}
|
| 2968 |
-
}
|
| 2969 |
-
|
| 2970 |
-
},
|
| 2971 |
-
|
| 2972 |
-
// multi
|
| 2973 |
-
onSelect: function (data, options) {
|
| 2974 |
-
|
| 2975 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2976 |
-
|
| 2977 |
-
this.addSelectedChoice(data);
|
| 2978 |
-
|
| 2979 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2980 |
-
|
| 2981 |
-
// keep track of the search's value before it gets cleared
|
| 2982 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2983 |
-
|
| 2984 |
-
this.clearSearch();
|
| 2985 |
-
this.updateResults();
|
| 2986 |
-
|
| 2987 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 2988 |
-
|
| 2989 |
-
if (this.opts.closeOnSelect) {
|
| 2990 |
-
this.close();
|
| 2991 |
-
this.search.width(10);
|
| 2992 |
-
} else {
|
| 2993 |
-
if (this.countSelectableResults()>0) {
|
| 2994 |
-
this.search.width(10);
|
| 2995 |
-
this.resizeSearch();
|
| 2996 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 2997 |
-
// if we reached max selection size repaint the results so choices
|
| 2998 |
-
// are replaced with the max selection reached message
|
| 2999 |
-
this.updateResults(true);
|
| 3000 |
-
} else {
|
| 3001 |
-
// initializes search's value with nextSearchTerm and update search result
|
| 3002 |
-
if(this.nextSearchTerm != undefined){
|
| 3003 |
-
this.search.val(this.nextSearchTerm);
|
| 3004 |
-
this.updateResults();
|
| 3005 |
-
this.search.select();
|
| 3006 |
-
}
|
| 3007 |
-
}
|
| 3008 |
-
this.positionDropdown();
|
| 3009 |
-
} else {
|
| 3010 |
-
// if nothing left to select close
|
| 3011 |
-
this.close();
|
| 3012 |
-
this.search.width(10);
|
| 3013 |
-
}
|
| 3014 |
-
}
|
| 3015 |
-
|
| 3016 |
-
// since its not possible to select an element that has already been
|
| 3017 |
-
// added we do not need to check if this is a new element before firing change
|
| 3018 |
-
this.triggerChange({ added: data });
|
| 3019 |
-
|
| 3020 |
-
if (!options || !options.noFocus)
|
| 3021 |
-
this.focusSearch();
|
| 3022 |
-
},
|
| 3023 |
-
|
| 3024 |
-
// multi
|
| 3025 |
-
cancel: function () {
|
| 3026 |
-
this.close();
|
| 3027 |
-
this.focusSearch();
|
| 3028 |
-
},
|
| 3029 |
-
|
| 3030 |
-
addSelectedChoice: function (data) {
|
| 3031 |
-
var enableChoice = !data.locked,
|
| 3032 |
-
enabledItem = $(
|
| 3033 |
-
"<li class='select2-search-choice'>" +
|
| 3034 |
-
" <div></div>" +
|
| 3035 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3036 |
-
"</li>"),
|
| 3037 |
-
disabledItem = $(
|
| 3038 |
-
"<li class='select2-search-choice select2-locked'>" +
|
| 3039 |
-
"<div></div>" +
|
| 3040 |
-
"</li>");
|
| 3041 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3042 |
-
id = this.id(data),
|
| 3043 |
-
val = this.getVal(),
|
| 3044 |
-
formatted,
|
| 3045 |
-
cssClass;
|
| 3046 |
-
|
| 3047 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3048 |
-
if (formatted != undefined) {
|
| 3049 |
-
choice.find("div").replaceWith("<div>"+formatted+"</div>");
|
| 3050 |
-
}
|
| 3051 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3052 |
-
if (cssClass != undefined) {
|
| 3053 |
-
choice.addClass(cssClass);
|
| 3054 |
-
}
|
| 3055 |
-
|
| 3056 |
-
if(enableChoice){
|
| 3057 |
-
choice.find(".select2-search-choice-close")
|
| 3058 |
-
.on("mousedown", killEvent)
|
| 3059 |
-
.on("click dblclick", this.bind(function (e) {
|
| 3060 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3061 |
-
|
| 3062 |
-
this.unselect($(e.target));
|
| 3063 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3064 |
-
killEvent(e);
|
| 3065 |
-
this.close();
|
| 3066 |
-
this.focusSearch();
|
| 3067 |
-
})).on("focus", this.bind(function () {
|
| 3068 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3069 |
-
this.container.addClass("select2-container-active");
|
| 3070 |
-
this.dropdown.addClass("select2-drop-active");
|
| 3071 |
-
}));
|
| 3072 |
-
}
|
| 3073 |
-
|
| 3074 |
-
choice.data("select2-data", data);
|
| 3075 |
-
choice.insertBefore(this.searchContainer);
|
| 3076 |
-
|
| 3077 |
-
val.push(id);
|
| 3078 |
-
this.setVal(val);
|
| 3079 |
-
},
|
| 3080 |
-
|
| 3081 |
-
// multi
|
| 3082 |
-
unselect: function (selected) {
|
| 3083 |
-
var val = this.getVal(),
|
| 3084 |
-
data,
|
| 3085 |
-
index;
|
| 3086 |
-
selected = selected.closest(".select2-search-choice");
|
| 3087 |
-
|
| 3088 |
-
if (selected.length === 0) {
|
| 3089 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3090 |
-
}
|
| 3091 |
-
|
| 3092 |
-
data = selected.data("select2-data");
|
| 3093 |
-
|
| 3094 |
-
if (!data) {
|
| 3095 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3096 |
-
// and invoked on an element already removed
|
| 3097 |
-
return;
|
| 3098 |
-
}
|
| 3099 |
-
|
| 3100 |
-
var evt = $.Event("select2-removing");
|
| 3101 |
-
evt.val = this.id(data);
|
| 3102 |
-
evt.choice = data;
|
| 3103 |
-
this.opts.element.trigger(evt);
|
| 3104 |
-
|
| 3105 |
-
if (evt.isDefaultPrevented()) {
|
| 3106 |
-
return false;
|
| 3107 |
-
}
|
| 3108 |
-
|
| 3109 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3110 |
-
val.splice(index, 1);
|
| 3111 |
-
this.setVal(val);
|
| 3112 |
-
if (this.select) this.postprocessResults();
|
| 3113 |
-
}
|
| 3114 |
-
|
| 3115 |
-
selected.remove();
|
| 3116 |
-
|
| 3117 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3118 |
-
this.triggerChange({ removed: data });
|
| 3119 |
-
|
| 3120 |
-
return true;
|
| 3121 |
-
},
|
| 3122 |
-
|
| 3123 |
-
// multi
|
| 3124 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3125 |
-
var val = this.getVal(),
|
| 3126 |
-
choices = this.results.find(".select2-result"),
|
| 3127 |
-
compound = this.results.find(".select2-result-with-children"),
|
| 3128 |
-
self = this;
|
| 3129 |
-
|
| 3130 |
-
choices.each2(function (i, choice) {
|
| 3131 |
-
var id = self.id(choice.data("select2-data"));
|
| 3132 |
-
if (indexOf(id, val) >= 0) {
|
| 3133 |
-
choice.addClass("select2-selected");
|
| 3134 |
-
// mark all children of the selected parent as selected
|
| 3135 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3136 |
-
}
|
| 3137 |
-
});
|
| 3138 |
-
|
| 3139 |
-
compound.each2(function(i, choice) {
|
| 3140 |
-
// hide an optgroup if it doesn't have any selectable children
|
| 3141 |
-
if (!choice.is('.select2-result-selectable')
|
| 3142 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3143 |
-
choice.addClass("select2-selected");
|
| 3144 |
-
}
|
| 3145 |
-
});
|
| 3146 |
-
|
| 3147 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false){
|
| 3148 |
-
self.highlight(0);
|
| 3149 |
-
}
|
| 3150 |
-
|
| 3151 |
-
//If all results are chosen render formatNoMatches
|
| 3152 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3153 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3154 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3155 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3156 |
-
}
|
| 3157 |
-
}
|
| 3158 |
-
}
|
| 3159 |
-
|
| 3160 |
-
},
|
| 3161 |
-
|
| 3162 |
-
// multi
|
| 3163 |
-
getMaxSearchWidth: function() {
|
| 3164 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3165 |
-
},
|
| 3166 |
-
|
| 3167 |
-
// multi
|
| 3168 |
-
resizeSearch: function () {
|
| 3169 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3170 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3171 |
-
|
| 3172 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3173 |
-
|
| 3174 |
-
left = this.search.offset().left;
|
| 3175 |
-
|
| 3176 |
-
maxWidth = this.selection.width();
|
| 3177 |
-
containerLeft = this.selection.offset().left;
|
| 3178 |
-
|
| 3179 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3180 |
-
|
| 3181 |
-
if (searchWidth < minimumWidth) {
|
| 3182 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3183 |
-
}
|
| 3184 |
-
|
| 3185 |
-
if (searchWidth < 40) {
|
| 3186 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3187 |
-
}
|
| 3188 |
-
|
| 3189 |
-
if (searchWidth <= 0) {
|
| 3190 |
-
searchWidth = minimumWidth;
|
| 3191 |
-
}
|
| 3192 |
-
|
| 3193 |
-
this.search.width(Math.floor(searchWidth));
|
| 3194 |
-
},
|
| 3195 |
-
|
| 3196 |
-
// multi
|
| 3197 |
-
getVal: function () {
|
| 3198 |
-
var val;
|
| 3199 |
-
if (this.select) {
|
| 3200 |
-
val = this.select.val();
|
| 3201 |
-
return val === null ? [] : val;
|
| 3202 |
-
} else {
|
| 3203 |
-
val = this.opts.element.val();
|
| 3204 |
-
return splitVal(val, this.opts.separator);
|
| 3205 |
-
}
|
| 3206 |
-
},
|
| 3207 |
-
|
| 3208 |
-
// multi
|
| 3209 |
-
setVal: function (val) {
|
| 3210 |
-
var unique;
|
| 3211 |
-
if (this.select) {
|
| 3212 |
-
this.select.val(val);
|
| 3213 |
-
} else {
|
| 3214 |
-
unique = [];
|
| 3215 |
-
// filter out duplicates
|
| 3216 |
-
$(val).each(function () {
|
| 3217 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3218 |
-
});
|
| 3219 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3220 |
-
}
|
| 3221 |
-
},
|
| 3222 |
-
|
| 3223 |
-
// multi
|
| 3224 |
-
buildChangeDetails: function (old, current) {
|
| 3225 |
-
var current = current.slice(0),
|
| 3226 |
-
old = old.slice(0);
|
| 3227 |
-
|
| 3228 |
-
// remove intersection from each array
|
| 3229 |
-
for (var i = 0; i < current.length; i++) {
|
| 3230 |
-
for (var j = 0; j < old.length; j++) {
|
| 3231 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3232 |
-
current.splice(i, 1);
|
| 3233 |
-
if(i>0){
|
| 3234 |
-
i--;
|
| 3235 |
-
}
|
| 3236 |
-
old.splice(j, 1);
|
| 3237 |
-
j--;
|
| 3238 |
-
}
|
| 3239 |
-
}
|
| 3240 |
-
}
|
| 3241 |
-
|
| 3242 |
-
return {added: current, removed: old};
|
| 3243 |
-
},
|
| 3244 |
-
|
| 3245 |
-
|
| 3246 |
-
// multi
|
| 3247 |
-
val: function (val, triggerChange) {
|
| 3248 |
-
var oldData, self=this;
|
| 3249 |
-
|
| 3250 |
-
if (arguments.length === 0) {
|
| 3251 |
-
return this.getVal();
|
| 3252 |
-
}
|
| 3253 |
-
|
| 3254 |
-
oldData=this.data();
|
| 3255 |
-
if (!oldData.length) oldData=[];
|
| 3256 |
-
|
| 3257 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3258 |
-
if (!val && val !== 0) {
|
| 3259 |
-
this.opts.element.val("");
|
| 3260 |
-
this.updateSelection([]);
|
| 3261 |
-
this.clearSearch();
|
| 3262 |
-
if (triggerChange) {
|
| 3263 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
| 3264 |
-
}
|
| 3265 |
-
return;
|
| 3266 |
-
}
|
| 3267 |
-
|
| 3268 |
-
// val is a list of ids
|
| 3269 |
-
this.setVal(val);
|
| 3270 |
-
|
| 3271 |
-
if (this.select) {
|
| 3272 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3273 |
-
if (triggerChange) {
|
| 3274 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3275 |
-
}
|
| 3276 |
-
} else {
|
| 3277 |
-
if (this.opts.initSelection === undefined) {
|
| 3278 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3279 |
-
}
|
| 3280 |
-
|
| 3281 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 3282 |
-
var ids=$.map(data, self.id);
|
| 3283 |
-
self.setVal(ids);
|
| 3284 |
-
self.updateSelection(data);
|
| 3285 |
-
self.clearSearch();
|
| 3286 |
-
if (triggerChange) {
|
| 3287 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3288 |
-
}
|
| 3289 |
-
});
|
| 3290 |
-
}
|
| 3291 |
-
this.clearSearch();
|
| 3292 |
-
},
|
| 3293 |
-
|
| 3294 |
-
// multi
|
| 3295 |
-
onSortStart: function() {
|
| 3296 |
-
if (this.select) {
|
| 3297 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3298 |
-
}
|
| 3299 |
-
|
| 3300 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
| 3301 |
-
this.search.width(0);
|
| 3302 |
-
// hide the container
|
| 3303 |
-
this.searchContainer.hide();
|
| 3304 |
-
},
|
| 3305 |
-
|
| 3306 |
-
// multi
|
| 3307 |
-
onSortEnd:function() {
|
| 3308 |
-
|
| 3309 |
-
var val=[], self=this;
|
| 3310 |
-
|
| 3311 |
-
// show search and move it to the end of the list
|
| 3312 |
-
this.searchContainer.show();
|
| 3313 |
-
// make sure the search container is the last item in the list
|
| 3314 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3315 |
-
// since we collapsed the width in dragStarted, we resize it here
|
| 3316 |
-
this.resizeSearch();
|
| 3317 |
-
|
| 3318 |
-
// update selection
|
| 3319 |
-
this.selection.find(".select2-search-choice").each(function() {
|
| 3320 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
| 3321 |
-
});
|
| 3322 |
-
this.setVal(val);
|
| 3323 |
-
this.triggerChange();
|
| 3324 |
-
},
|
| 3325 |
-
|
| 3326 |
-
// multi
|
| 3327 |
-
data: function(values, triggerChange) {
|
| 3328 |
-
var self=this, ids, old;
|
| 3329 |
-
if (arguments.length === 0) {
|
| 3330 |
-
return this.selection
|
| 3331 |
-
.children(".select2-search-choice")
|
| 3332 |
-
.map(function() { return $(this).data("select2-data"); })
|
| 3333 |
-
.get();
|
| 3334 |
-
} else {
|
| 3335 |
-
old = this.data();
|
| 3336 |
-
if (!values) { values = []; }
|
| 3337 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3338 |
-
this.setVal(ids);
|
| 3339 |
-
this.updateSelection(values);
|
| 3340 |
-
this.clearSearch();
|
| 3341 |
-
if (triggerChange) {
|
| 3342 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3343 |
-
}
|
| 3344 |
-
}
|
| 3345 |
-
}
|
| 3346 |
-
});
|
| 3347 |
-
|
| 3348 |
-
$.fn.select2 = function () {
|
| 3349 |
-
|
| 3350 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
| 3351 |
-
opts,
|
| 3352 |
-
select2,
|
| 3353 |
-
method, value, multiple,
|
| 3354 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3355 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3356 |
-
propertyMethods = ["val", "data"],
|
| 3357 |
-
methodsMap = { search: "externalSearch" };
|
| 3358 |
-
|
| 3359 |
-
this.each(function () {
|
| 3360 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3361 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3362 |
-
opts.element = $(this);
|
| 3363 |
-
|
| 3364 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3365 |
-
multiple = opts.element.prop("multiple");
|
| 3366 |
-
} else {
|
| 3367 |
-
multiple = opts.multiple || false;
|
| 3368 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3369 |
-
}
|
| 3370 |
-
|
| 3371 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3372 |
-
select2.init(opts);
|
| 3373 |
-
} else if (typeof(args[0]) === "string") {
|
| 3374 |
-
|
| 3375 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3376 |
-
throw "Unknown method: " + args[0];
|
| 3377 |
-
}
|
| 3378 |
-
|
| 3379 |
-
value = undefined;
|
| 3380 |
-
select2 = $(this).data("select2");
|
| 3381 |
-
if (select2 === undefined) return;
|
| 3382 |
-
|
| 3383 |
-
method=args[0];
|
| 3384 |
-
|
| 3385 |
-
if (method === "container") {
|
| 3386 |
-
value = select2.container;
|
| 3387 |
-
} else if (method === "dropdown") {
|
| 3388 |
-
value = select2.dropdown;
|
| 3389 |
-
} else {
|
| 3390 |
-
if (methodsMap[method]) method = methodsMap[method];
|
| 3391 |
-
|
| 3392 |
-
value = select2[method].apply(select2, args.slice(1));
|
| 3393 |
-
}
|
| 3394 |
-
if (indexOf(args[0], valueMethods) >= 0
|
| 3395 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3396 |
-
return false; // abort the iteration, ready to return first matched value
|
| 3397 |
-
}
|
| 3398 |
-
} else {
|
| 3399 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
| 3400 |
-
}
|
| 3401 |
-
});
|
| 3402 |
-
return (value === undefined) ? this : value;
|
| 3403 |
-
};
|
| 3404 |
-
|
| 3405 |
-
// plugin defaults, accessible to users
|
| 3406 |
-
$.fn.select2.defaults = {
|
| 3407 |
-
width: "copy",
|
| 3408 |
-
loadMorePadding: 0,
|
| 3409 |
-
closeOnSelect: true,
|
| 3410 |
-
openOnEnter: true,
|
| 3411 |
-
containerCss: {},
|
| 3412 |
-
dropdownCss: {},
|
| 3413 |
-
containerCssClass: "",
|
| 3414 |
-
dropdownCssClass: "",
|
| 3415 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
| 3416 |
-
var markup=[];
|
| 3417 |
-
markMatch(result.text, query.term, markup, escapeMarkup);
|
| 3418 |
-
return markup.join("");
|
| 3419 |
-
},
|
| 3420 |
-
formatSelection: function (data, container, escapeMarkup) {
|
| 3421 |
-
return data ? escapeMarkup(data.text) : undefined;
|
| 3422 |
-
},
|
| 3423 |
-
sortResults: function (results, container, query) {
|
| 3424 |
-
return results;
|
| 3425 |
-
},
|
| 3426 |
-
formatResultCssClass: function(data) {return data.css;},
|
| 3427 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3428 |
-
minimumResultsForSearch: 0,
|
| 3429 |
-
minimumInputLength: 0,
|
| 3430 |
-
maximumInputLength: null,
|
| 3431 |
-
maximumSelectionSize: 0,
|
| 3432 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
| 3433 |
-
matcher: function(term, text) {
|
| 3434 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3435 |
-
},
|
| 3436 |
-
separator: ",",
|
| 3437 |
-
tokenSeparators: [],
|
| 3438 |
-
tokenizer: defaultTokenizer,
|
| 3439 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3440 |
-
blurOnChange: false,
|
| 3441 |
-
selectOnBlur: false,
|
| 3442 |
-
adaptContainerCssClass: function(c) { return c; },
|
| 3443 |
-
adaptDropdownCssClass: function(c) { return null; },
|
| 3444 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3445 |
-
searchInputPlaceholder: '',
|
| 3446 |
-
createSearchChoicePosition: 'top',
|
| 3447 |
-
shouldFocusInput: function (instance) {
|
| 3448 |
-
// Attempt to detect touch devices
|
| 3449 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3450 |
-
(navigator.msMaxTouchPoints > 0));
|
| 3451 |
-
|
| 3452 |
-
// Only devices which support touch events should be special cased
|
| 3453 |
-
if (!supportsTouchEvents) {
|
| 3454 |
-
return true;
|
| 3455 |
-
}
|
| 3456 |
-
|
| 3457 |
-
// Never focus the input if search is disabled
|
| 3458 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3459 |
-
return false;
|
| 3460 |
-
}
|
| 3461 |
-
|
| 3462 |
-
return true;
|
| 3463 |
-
}
|
| 3464 |
-
};
|
| 3465 |
-
|
| 3466 |
-
$.fn.select2.locales = [];
|
| 3467 |
-
|
| 3468 |
-
$.fn.select2.locales['en'] = {
|
| 3469 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3470 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 3471 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3472 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3473 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3474 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3475 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3476 |
-
formatSearching: function () { return "Searching…"; },
|
| 3477 |
-
};
|
| 3478 |
-
|
| 3479 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3480 |
-
|
| 3481 |
-
$.fn.select2.ajaxDefaults = {
|
| 3482 |
-
transport: $.ajax,
|
| 3483 |
-
params: {
|
| 3484 |
-
type: "GET",
|
| 3485 |
-
cache: false,
|
| 3486 |
-
dataType: "json"
|
| 3487 |
-
}
|
| 3488 |
-
};
|
| 3489 |
-
|
| 3490 |
-
// exports
|
| 3491 |
-
window.Select2 = {
|
| 3492 |
-
query: {
|
| 3493 |
-
ajax: ajax,
|
| 3494 |
-
local: local,
|
| 3495 |
-
tags: tags
|
| 3496 |
-
}, util: {
|
| 3497 |
-
debounce: debounce,
|
| 3498 |
-
markMatch: markMatch,
|
| 3499 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3500 |
-
stripDiacritics: stripDiacritics
|
| 3501 |
-
}, "class": {
|
| 3502 |
-
"abstract": AbstractSelect2,
|
| 3503 |
-
"single": SingleSelect2,
|
| 3504 |
-
"multi": MultiSelect2
|
| 3505 |
-
}
|
| 3506 |
-
};
|
| 3507 |
-
|
| 3508 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2.min.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2014 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
-
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};j=a(document),g=function(){var a=1;return function(){return a++}}(),d=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a("body"),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",f,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",f,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",f,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",f,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&a.each(function(){this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,f);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+g()),t.attr("role","option"),v=c.formatResult(o,t,f,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=g.scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,f=b.outerHeight(!1),r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(t=this.body.offset(),m-=t.top,n-=t.left),r||(n=c.left+this.container.outerWidth(!1)-q),w={left:n,width:e},u?(w.top=c.top-f,w.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss,this.opts.element)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),j.on("mousemove.select2Event",function(a){i.x=a.pageX,i.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),j.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);
|
| 22 |
-
break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(K(e.opts.formatLoadMore,e.opts.element,d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find(".select2-result-selectable").length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,h,d=this.container,e=this.dropdown,f=g();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+f),this.focusser.attr("aria-labelledby","select2-chosen-"+f),this.results.attr("id","select2-results-"+f),this.search.attr("aria-owns","select2-results-"+f),this.focusser.attr("id","s2id_autogen"+f),h=a("label[for='"+this.opts.element.attr("id")+"']"),this.focusser.prev().text(h.text()).attr("for",this.focusser.attr("id"));var i=this.opts.element.attr("title");this.opts.element.attr("title",i||h.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),e.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),h=e.length?e:f):a.which==c.DELETE?this.unselect(b.first())&&(this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length||this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."
|
| 23 |
-
},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2.png
DELETED
|
Binary file
|
drkfr/js/vendor/select2/select2_locale_ar.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Arabic translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Adel KEDJOUR <adel@kedjour.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ar'] = {
|
| 10 |
-
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { if (n == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return n == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + n + " إختيارات فقط"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
| 15 |
-
formatSearching: function () { return "البحث…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_az.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Azerbaijani translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['az'] = {
|
| 10 |
-
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
| 11 |
-
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
| 16 |
-
formatSearching: function () { return "Axtarılır…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_bg.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Bulgarian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['bg'] = {
|
| 11 |
-
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
| 16 |
-
formatSearching: function () { return "Търсене…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ca.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Catalan translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: David Planella <david.planella@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ca'] = {
|
| 10 |
-
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
| 15 |
-
formatSearching: function () { return "S'està cercant…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_cs.js
DELETED
|
@@ -1,51 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Czech translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Michal Marek <ahoj@michal-marek.cz>
|
| 5 |
-
* Author - sklonovani: David Vallner <david@vallner.net>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
// use text for the numbers 2 through 4
|
| 10 |
-
var smallNumbers = {
|
| 11 |
-
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
| 12 |
-
3: function() { return "tři"; },
|
| 13 |
-
4: function() { return "čtyři"; }
|
| 14 |
-
}
|
| 15 |
-
$.fn.select2.locales['cs'] = {
|
| 16 |
-
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
| 17 |
-
formatInputTooShort: function (input, min) {
|
| 18 |
-
var n = min - input.length;
|
| 19 |
-
if (n == 1) {
|
| 20 |
-
return "Prosím zadejte ještě jeden znak";
|
| 21 |
-
} else if (n <= 4) {
|
| 22 |
-
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
| 23 |
-
} else {
|
| 24 |
-
return "Prosím zadejte ještě dalších "+n+" znaků";
|
| 25 |
-
}
|
| 26 |
-
},
|
| 27 |
-
formatInputTooLong: function (input, max) {
|
| 28 |
-
var n = input.length - max;
|
| 29 |
-
if (n == 1) {
|
| 30 |
-
return "Prosím zadejte o jeden znak méně";
|
| 31 |
-
} else if (n <= 4) {
|
| 32 |
-
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
| 33 |
-
} else {
|
| 34 |
-
return "Prosím zadejte o "+n+" znaků méně";
|
| 35 |
-
}
|
| 36 |
-
},
|
| 37 |
-
formatSelectionTooBig: function (limit) {
|
| 38 |
-
if (limit == 1) {
|
| 39 |
-
return "Můžete zvolit jen jednu položku";
|
| 40 |
-
} else if (limit <= 4) {
|
| 41 |
-
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
| 42 |
-
} else {
|
| 43 |
-
return "Můžete zvolit maximálně "+limit+" položek";
|
| 44 |
-
}
|
| 45 |
-
},
|
| 46 |
-
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
| 47 |
-
formatSearching: function () { return "Vyhledávání…"; }
|
| 48 |
-
};
|
| 49 |
-
|
| 50 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
| 51 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_da.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Danish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Anders Jenbo <anders@jenbo.dk>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['da'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
| 15 |
-
formatSearching: function () { return "Søger…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_de.js
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 German translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['de'] = {
|
| 8 |
-
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
| 13 |
-
formatSearching: function () { return "Suche…"; },
|
| 14 |
-
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
| 15 |
-
};
|
| 16 |
-
|
| 17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
| 18 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_el.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Greek translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['el'] = {
|
| 10 |
-
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
| 15 |
-
formatSearching: function () { return "Αναζήτηση…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_en.js.template
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 <Language> translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Your Name <your@email>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['en'] = {
|
| 10 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 11 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 16 |
-
formatSearching: function () { return "Searching…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_es.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Spanish translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['es'] = {
|
| 8 |
-
formatNoMatches: function () { return "No se encontraron resultados"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
| 13 |
-
formatSearching: function () { return "Buscando…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_et.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Estonian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['et'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
| 15 |
-
formatSearching: function () { return "Otsin.."; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_eu.js
DELETED
|
@@ -1,45 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Basque translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['eu'] = {
|
| 10 |
-
formatNoMatches: function () {
|
| 11 |
-
return "Ez da bat datorrenik aurkitu";
|
| 12 |
-
},
|
| 13 |
-
formatInputTooShort: function (input, min) {
|
| 14 |
-
var n = min - input.length;
|
| 15 |
-
if (n === 1) {
|
| 16 |
-
return "Idatzi karaktere bat gehiago";
|
| 17 |
-
} else {
|
| 18 |
-
return "Idatzi " + n + " karaktere gehiago";
|
| 19 |
-
}
|
| 20 |
-
},
|
| 21 |
-
formatInputTooLong: function (input, max) {
|
| 22 |
-
var n = input.length - max;
|
| 23 |
-
if (n === 1) {
|
| 24 |
-
return "Idatzi karaktere bat gutxiago";
|
| 25 |
-
} else {
|
| 26 |
-
return "Idatzi " + n + " karaktere gutxiago";
|
| 27 |
-
}
|
| 28 |
-
},
|
| 29 |
-
formatSelectionTooBig: function (limit) {
|
| 30 |
-
if (limit === 1 ) {
|
| 31 |
-
return "Elementu bakarra hauta dezakezu";
|
| 32 |
-
} else {
|
| 33 |
-
return limit + " elementu hauta ditzakezu soilik";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatLoadMore: function (pageNumber) {
|
| 37 |
-
return "Emaitza gehiago kargatzen…";
|
| 38 |
-
},
|
| 39 |
-
formatSearching: function () {
|
| 40 |
-
return "Bilatzen…";
|
| 41 |
-
}
|
| 42 |
-
};
|
| 43 |
-
|
| 44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
| 45 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_fa.js
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Persian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Ali Choopan <choopan@arsh.co>
|
| 5 |
-
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['fa'] = {
|
| 11 |
-
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
| 12 |
-
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
| 13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
| 14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
| 17 |
-
formatSearching: function () { return "در حال جستجو…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
| 21 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_fi.js
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Finnish translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['fi'] = {
|
| 7 |
-
formatNoMatches: function () {
|
| 8 |
-
return "Ei tuloksia";
|
| 9 |
-
},
|
| 10 |
-
formatInputTooShort: function (input, min) {
|
| 11 |
-
var n = min - input.length;
|
| 12 |
-
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
| 13 |
-
},
|
| 14 |
-
formatInputTooLong: function (input, max) {
|
| 15 |
-
var n = input.length - max;
|
| 16 |
-
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
| 17 |
-
},
|
| 18 |
-
formatSelectionTooBig: function (limit) {
|
| 19 |
-
return "Voit valita ainoastaan " + limit + " kpl";
|
| 20 |
-
},
|
| 21 |
-
formatLoadMore: function (pageNumber) {
|
| 22 |
-
return "Ladataan lisää tuloksia…";
|
| 23 |
-
},
|
| 24 |
-
formatSearching: function () {
|
| 25 |
-
return "Etsitään…";
|
| 26 |
-
}
|
| 27 |
-
};
|
| 28 |
-
|
| 29 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
| 30 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_fr.js
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 French translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['fr'] = {
|
| 8 |
-
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
| 9 |
-
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
| 10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
| 11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
| 12 |
-
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
| 13 |
-
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
| 14 |
-
formatSearching: function () { return "Recherche en cours…"; }
|
| 15 |
-
};
|
| 16 |
-
|
| 17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
| 18 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_gl.js
DELETED
|
@@ -1,45 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Galician translation
|
| 3 |
-
*
|
| 4 |
-
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['gl'] = {
|
| 10 |
-
formatNoMatches: function () {
|
| 11 |
-
return "Non se atoparon resultados";
|
| 12 |
-
},
|
| 13 |
-
formatInputTooShort: function (input, min) {
|
| 14 |
-
var n = min - input.length;
|
| 15 |
-
if (n === 1) {
|
| 16 |
-
return "Engada un carácter";
|
| 17 |
-
} else {
|
| 18 |
-
return "Engada " + n + " caracteres";
|
| 19 |
-
}
|
| 20 |
-
},
|
| 21 |
-
formatInputTooLong: function (input, max) {
|
| 22 |
-
var n = input.length - max;
|
| 23 |
-
if (n === 1) {
|
| 24 |
-
return "Elimine un carácter";
|
| 25 |
-
} else {
|
| 26 |
-
return "Elimine " + n + " caracteres";
|
| 27 |
-
}
|
| 28 |
-
},
|
| 29 |
-
formatSelectionTooBig: function (limit) {
|
| 30 |
-
if (limit === 1 ) {
|
| 31 |
-
return "Só pode seleccionar un elemento";
|
| 32 |
-
} else {
|
| 33 |
-
return "Só pode seleccionar " + limit + " elementos";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatLoadMore: function (pageNumber) {
|
| 37 |
-
return "Cargando máis resultados…";
|
| 38 |
-
},
|
| 39 |
-
formatSearching: function () {
|
| 40 |
-
return "Buscando…";
|
| 41 |
-
}
|
| 42 |
-
};
|
| 43 |
-
|
| 44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
| 45 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_he.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Hebrew translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['he'] = {
|
| 10 |
-
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
| 15 |
-
formatSearching: function () { return "מחפש…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_hr.js
DELETED
|
@@ -1,24 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Croatian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Edi Modrić <edi.modric@gmail.com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['hr'] = {
|
| 11 |
-
formatNoMatches: function () { return "Nema rezultata"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
| 13 |
-
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
| 16 |
-
formatSearching: function () { return "Pretraga…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
| 20 |
-
|
| 21 |
-
function character (n) {
|
| 22 |
-
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
| 23 |
-
}
|
| 24 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_hu.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Hungarian translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['hu'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nincs találat."; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
| 13 |
-
formatSearching: function () { return "Keresés…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_id.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Indonesian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['id'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
| 15 |
-
formatSearching: function () { return "Mencari…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_is.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Icelandic translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['is'] = {
|
| 8 |
-
formatNoMatches: function () { return "Ekkert fannst"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
| 13 |
-
formatSearching: function () { return "Leita…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_it.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Italian translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['it'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
| 13 |
-
formatSearching: function () { return "Ricerca…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ja.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Japanese translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['ja'] = {
|
| 8 |
-
formatNoMatches: function () { return "該当なし"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "読込中･･･"; },
|
| 13 |
-
formatSearching: function () { return "検索中･･･"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ka.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Georgian (Kartuli) translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Dimitri Kurashvili dimakura@gmail.com
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ka'] = {
|
| 10 |
-
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
| 15 |
-
formatSearching: function () { return "ძებნა…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ko.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Korean translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Swen Mun <longfinfunnel@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ko'] = {
|
| 10 |
-
formatNoMatches: function () { return "결과 없음"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
| 15 |
-
formatSearching: function () { return "검색 중…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_lt.js
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Lithuanian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['lt'] = {
|
| 11 |
-
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
| 13 |
-
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
| 14 |
-
formatSelectionTooBig: function (limit) {
|
| 15 |
-
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
| 16 |
-
},
|
| 17 |
-
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
| 18 |
-
formatSearching: function () { return "Ieškoma…"; }
|
| 19 |
-
};
|
| 20 |
-
|
| 21 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
| 22 |
-
|
| 23 |
-
function character (n) {
|
| 24 |
-
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
| 25 |
-
}
|
| 26 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_lv.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Latvian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['lv'] = {
|
| 10 |
-
formatNoMatches: function () { return "Sakritību nav"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
| 15 |
-
formatSearching: function () { return "Meklēšana…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_mk.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Macedonian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Marko Aleksic <psybaron@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['mk'] = {
|
| 10 |
-
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
| 15 |
-
formatSearching: function () { return "Пребарување…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ms.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Malay translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Kepoweran <kepoweran@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ms'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
| 15 |
-
formatSearching: function () { return "Mencari…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_nl.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Dutch translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['nl'] = {
|
| 8 |
-
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
| 13 |
-
formatSearching: function () { return "Zoeken…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_no.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Norwegian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['no'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ingen treff"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laster flere resultater…"; },
|
| 15 |
-
formatSearching: function () { return "Søker…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
| 19 |
-
})(jQuery);
|
| 20 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_pl.js
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Polish translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
* @author Michał Połtyn <mike@poltyn.com>
|
| 7 |
-
*/
|
| 8 |
-
(function ($) {
|
| 9 |
-
"use strict";
|
| 10 |
-
|
| 11 |
-
$.fn.select2.locales['pl'] = {
|
| 12 |
-
formatNoMatches: function () { return "Brak wyników"; },
|
| 13 |
-
formatInputTooShort: function (input, min) { return "Wpisz co najmniej" + character(min - input.length, "znak", "i"); },
|
| 14 |
-
formatInputTooLong: function (input, max) { return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i"); },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y"); },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "Ładowanie wyników…"; },
|
| 17 |
-
formatSearching: function () { return "Szukanie…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
| 21 |
-
|
| 22 |
-
function character (n, word, pluralSuffix) {
|
| 23 |
-
return " " + n + " " + word + (n == 1 ? "" : n%10 < 5 && n%10 > 1 && (n%100 < 5 || n%100 > 20) ? pluralSuffix : "ów");
|
| 24 |
-
}
|
| 25 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_pt-BR.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Brazilian Portuguese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['pt-BR'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite mais " + n + " caracter" + (n == 1? "" : "es"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
| 13 |
-
formatSearching: function () { return "Buscando…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_pt-PT.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Portuguese (Portugal) translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['pt-PT'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
| 13 |
-
formatSearching: function () { return "A pesquisar…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ro.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Romanian translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['ro'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
| 13 |
-
formatSearching: function () { return "Căutare…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_rs.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Serbian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Limon Monte <limon.monte@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['rs'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
| 15 |
-
formatSearching: function () { return "Pretraga…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ru.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Russian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ru'] = {
|
| 10 |
-
formatNoMatches: function () { return "Совпадений не найдено"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
| 12 |
-
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
| 15 |
-
formatSearching: function () { return "Поиск…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
| 19 |
-
|
| 20 |
-
function character (n) {
|
| 21 |
-
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
| 22 |
-
}
|
| 23 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_sk.js
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Slovak translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: David Vallner <david@vallner.net>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
// use text for the numbers 2 through 4
|
| 9 |
-
var smallNumbers = {
|
| 10 |
-
2: function(masc) { return (masc ? "dva" : "dve"); },
|
| 11 |
-
3: function() { return "tri"; },
|
| 12 |
-
4: function() { return "štyri"; }
|
| 13 |
-
};
|
| 14 |
-
$.fn.select2.locales['sk'] = {
|
| 15 |
-
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
| 16 |
-
formatInputTooShort: function (input, min) {
|
| 17 |
-
var n = min - input.length;
|
| 18 |
-
if (n == 1) {
|
| 19 |
-
return "Prosím, zadajte ešte jeden znak";
|
| 20 |
-
} else if (n <= 4) {
|
| 21 |
-
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
| 22 |
-
} else {
|
| 23 |
-
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
| 24 |
-
}
|
| 25 |
-
},
|
| 26 |
-
formatInputTooLong: function (input, max) {
|
| 27 |
-
var n = input.length - max;
|
| 28 |
-
if (n == 1) {
|
| 29 |
-
return "Prosím, zadajte o jeden znak menej";
|
| 30 |
-
} else if (n <= 4) {
|
| 31 |
-
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
| 32 |
-
} else {
|
| 33 |
-
return "Prosím, zadajte o "+n+" znakov menej";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatSelectionTooBig: function (limit) {
|
| 37 |
-
if (limit == 1) {
|
| 38 |
-
return "Môžete zvoliť len jednu položku";
|
| 39 |
-
} else if (limit <= 4) {
|
| 40 |
-
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
| 41 |
-
} else {
|
| 42 |
-
return "Môžete zvoliť najviac "+limit+" položiek";
|
| 43 |
-
}
|
| 44 |
-
},
|
| 45 |
-
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
| 46 |
-
formatSearching: function () { return "Vyhľadávanie…"; }
|
| 47 |
-
};
|
| 48 |
-
|
| 49 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
| 50 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_sv.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Swedish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Jens Rantil <jens.rantil@telavox.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['sv'] = {
|
| 10 |
-
formatNoMatches: function () { return "Inga träffar"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
| 15 |
-
formatSearching: function () { return "Söker…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_th.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Thai translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['th'] = {
|
| 10 |
-
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
| 15 |
-
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_tr.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Turkish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['tr'] = {
|
| 10 |
-
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
| 15 |
-
formatSearching: function () { return "Aranıyor…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_ug-CN.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Uyghur translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['ug-CN'] = {
|
| 7 |
-
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
| 12 |
-
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_uk.js
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Ukrainian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author bigmihail <bigmihail@bigmir.net>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['uk'] = {
|
| 11 |
-
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
| 12 |
-
formatNoMatches: function () { return "Нічого не знайдено"; },
|
| 13 |
-
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
| 14 |
-
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
| 17 |
-
formatSearching: function () { return "Пошук…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
| 21 |
-
|
| 22 |
-
function character (n, word) {
|
| 23 |
-
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
| 24 |
-
}
|
| 25 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_vi.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Vietnamese translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Long Nguyen <olragon@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['vi'] = {
|
| 10 |
-
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
| 15 |
-
formatSearching: function () { return "Đang tìm…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
| 19 |
-
})(jQuery);
|
| 20 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_zh-CN.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Chinese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['zh-CN'] = {
|
| 7 |
-
formatNoMatches: function () { return "没有找到匹配项"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
| 12 |
-
formatSearching: function () { return "搜索中…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2_locale_zh-TW.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Traditional Chinese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['zh-TW'] = {
|
| 7 |
-
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
| 12 |
-
formatSearching: function () { return "搜尋中…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
drkfr/js/vendor/select2/select2x2.png
DELETED
|
Binary file
|
drkfr/phpunit.xml
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<phpunit
|
| 2 |
-
bootstrap="tests/bootstrap.php"
|
| 3 |
-
backupGlobals="false"
|
| 4 |
-
colors="true"
|
| 5 |
-
convertErrorsToExceptions="true"
|
| 6 |
-
convertNoticesToExceptions="true"
|
| 7 |
-
convertWarningsToExceptions="true"
|
| 8 |
-
>
|
| 9 |
-
<testsuites>
|
| 10 |
-
<testsuite>
|
| 11 |
-
<directory prefix="test" suffix=".php">./tests/</directory>
|
| 12 |
-
</testsuite>
|
| 13 |
-
</testsuites>
|
| 14 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
readme.txt
CHANGED
|
@@ -1,5 +1,6 @@
|
|
| 1 |
=== Team Members ===
|
| 2 |
-
|
|
|
|
| 3 |
Requires at least: 3.6
|
| 4 |
Tested up to: 4.1.1
|
| 5 |
Stable tag: trunk
|
|
@@ -67,6 +68,18 @@ The [PRO version](http://wpdarko.com/items/team-members-pro/) gives you access t
|
|
| 67 |
3. Creating members (admin view)
|
| 68 |
|
| 69 |
== Changelog ==
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 70 |
= 1.3.1 =
|
| 71 |
* SAFE UPDATE: No data loss for those upgrading from version 1.0 or higher
|
| 72 |
* Added an email icon for member links
|
| 1 |
=== Team Members ===
|
| 2 |
+
Contributors: spwebguy
|
| 3 |
+
Tags: team, teams, my team, our team, grid, shortcode, responsive, members, staff, people, showcase, employees, simple, founders
|
| 4 |
Requires at least: 3.6
|
| 5 |
Tested up to: 4.1.1
|
| 6 |
Stable tag: trunk
|
| 68 |
3. Creating members (admin view)
|
| 69 |
|
| 70 |
== Changelog ==
|
| 71 |
+
= 2.0.1 =
|
| 72 |
+
* SAFE UPDATE: No data loss for those upgrading from version 1.0 or higher
|
| 73 |
+
* Bug fix on update
|
| 74 |
+
|
| 75 |
+
= 2.0 =
|
| 76 |
+
* SAFE UPDATE: No data loss for those upgrading from version 1.0 or higher
|
| 77 |
+
* New admin interface (new framework)
|
| 78 |
+
* You can now force the plugin's original fonts (user request)
|
| 79 |
+
* Added docs and support forums links
|
| 80 |
+
* Added instructions
|
| 81 |
+
* Much cleaner code
|
| 82 |
+
|
| 83 |
= 1.3.1 =
|
| 84 |
* SAFE UPDATE: No data loss for those upgrading from version 1.0 or higher
|
| 85 |
* Added an email icon for member links
|
tmm.php
CHANGED
|
@@ -3,12 +3,75 @@
|
|
| 3 |
Plugin Name: Team Members
|
| 4 |
Plugin URI: http://wpdarko.com/support/documentation/get-started-team-members/
|
| 5 |
Description: A responsive, simple and clean way to display your team. Create new members, add their positions, bios, social links and copy-paste the shortcode into any post/page. Find support and information on the <a href="http://wpdarko.com/team-members/">plugin's page</a>. This free version is NOT limited and does not contain any ad. Check out the <a href='http://wpdarko.com/items/team-members-pro/'>PRO version</a> for more great features.
|
| 6 |
-
Version:
|
| 7 |
Author: WP Darko
|
| 8 |
Author URI: http://wpdarko.com
|
| 9 |
License: GPL2
|
| 10 |
*/
|
| 11 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 12 |
function tmm_free_pro_check() {
|
| 13 |
if (is_plugin_active('team-members-pro/tmm-pro.php')) {
|
| 14 |
|
|
@@ -25,12 +88,20 @@ function tmm_free_pro_check() {
|
|
| 25 |
|
| 26 |
add_action( 'admin_init', 'tmm_free_pro_check' );
|
| 27 |
|
| 28 |
-
/*
|
| 29 |
add_action( 'wp_enqueue_scripts', 'add_tmm_scripts' );
|
| 30 |
function add_tmm_scripts() {
|
| 31 |
wp_enqueue_style( 'tmm', plugins_url('css/tmm_custom_style.min.css', __FILE__));
|
| 32 |
}
|
| 33 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 34 |
add_action( 'init', 'create_tmm_type' );
|
| 35 |
|
| 36 |
function create_tmm_type() {
|
|
@@ -50,160 +121,410 @@ function create_tmm_type() {
|
|
| 50 |
);
|
| 51 |
}
|
| 52 |
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
array(
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
'
|
| 94 |
-
|
| 95 |
-
'twitter' => 'Twitter',
|
| 96 |
-
'linkedin' => 'LinkedIn',
|
| 97 |
-
'googleplus' => 'Google+',
|
| 98 |
-
'facebook' => 'Facebook',
|
| 99 |
-
'instagram' => 'Instagram',
|
| 100 |
-
'tumblr' => 'Tumblr',
|
| 101 |
-
'pinterest' => 'Pinterest',
|
| 102 |
-
'email' => 'Email',
|
| 103 |
-
'website' => 'Website',
|
| 104 |
-
'customlink' => 'Other links',
|
| 105 |
-
)
|
| 106 |
-
),
|
| 107 |
-
array( 'id' => 'tmm_sc_title2', 'type' => 'text', 'cols' => 4),
|
| 108 |
-
array( 'id' => 'tmm_sc_url2', 'default' => 'http://', 'type' => 'text', 'cols' => 5),
|
| 109 |
-
array(
|
| 110 |
-
'id' => 'tmm_sc_type3',
|
| 111 |
-
'type' => 'select',
|
| 112 |
-
'cols' => 3,
|
| 113 |
-
'options' => array(
|
| 114 |
-
'nada' => '-',
|
| 115 |
-
'twitter' => 'Twitter',
|
| 116 |
-
'linkedin' => 'LinkedIn',
|
| 117 |
-
'googleplus' => 'Google+',
|
| 118 |
-
'facebook' => 'Facebook',
|
| 119 |
-
'instagram' => 'Instagram',
|
| 120 |
-
'tumblr' => 'Tumblr',
|
| 121 |
-
'pinterest' => 'Pinterest',
|
| 122 |
-
'email' => 'Email',
|
| 123 |
-
'website' => 'Website',
|
| 124 |
-
'customlink' => 'Other links',
|
| 125 |
-
)
|
| 126 |
-
),
|
| 127 |
-
array( 'id' => 'tmm_sc_title3', 'type' => 'text', 'cols' => 4),
|
| 128 |
-
array( 'id' => 'tmm_sc_url3', 'default' => 'http://', 'type' => 'text', 'cols' => 5),
|
| 129 |
-
);
|
| 130 |
-
|
| 131 |
-
$group_settings = array(
|
| 132 |
-
array( 'id' => 'tmm_columns', 'name' => 'Number of columns', 'type' => 'text', 'desc' => 'Number of members to show per line.' ),
|
| 133 |
-
array( 'id' => 'tmm_color', 'name' => 'Main color', 'type' => 'colorpicker', 'default' => '#57c9e0' ),
|
| 134 |
-
array(
|
| 135 |
-
'id' => 'tmm_columns',
|
| 136 |
-
'type' => 'select',
|
| 137 |
-
'desc' => 'Number of members to show per line.',
|
| 138 |
'options' => array(
|
| 139 |
-
'
|
| 140 |
-
'
|
| 141 |
-
'
|
| 142 |
-
)
|
| 143 |
-
),
|
| 144 |
-
);
|
| 145 |
-
// Example of repeatable group. Using all fields.
|
| 146 |
-
// For this example, copy fields from $fields, update I
|
| 147 |
-
$group_fields = $fields;
|
| 148 |
-
foreach ( $group_fields as &$field ) {
|
| 149 |
-
$field['id'] = str_replace( 'field', 'gfield', $field['id'] );
|
| 150 |
-
}
|
| 151 |
-
$meta_boxes[] = array(
|
| 152 |
-
'title' => 'Create/remove/sort team members',
|
| 153 |
-
'pages' => 'tmm',
|
| 154 |
-
'fields' => array(
|
| 155 |
-
array(
|
| 156 |
-
'id' => 'tmm_head',
|
| 157 |
-
'type' => 'group',
|
| 158 |
-
'repeatable' => true,
|
| 159 |
'sortable' => true,
|
| 160 |
-
'
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 168 |
'context' => 'side',
|
| 169 |
'priority' => 'high',
|
| 170 |
-
'
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
|
|
|
|
|
|
|
|
|
| 183 |
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 187 |
'context' => 'side',
|
| 188 |
'priority' => 'low',
|
| 189 |
-
'
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
add_filter( 'drkfr_meta_boxes', 'tmm_metaboxes' );
|
| 201 |
|
| 202 |
-
if (!class_exists('drkfr_Meta_Box')) {
|
| 203 |
-
require_once( 'drkfr/custom-meta-boxes.php' );
|
| 204 |
}
|
| 205 |
|
| 206 |
-
|
|
|
|
|
|
|
| 207 |
add_action( 'manage_tmm_posts_custom_column' , 'dktmm_custom_columns', 10, 2 );
|
| 208 |
|
| 209 |
function dktmm_custom_columns( $column, $post_id ) {
|
|
@@ -227,7 +548,7 @@ function add_tmm_columns($columns) {
|
|
| 227 |
}
|
| 228 |
add_filter('manage_tmm_posts_columns' , 'add_tmm_columns');
|
| 229 |
|
| 230 |
-
//
|
| 231 |
function tmm_sc($atts) {
|
| 232 |
extract(shortcode_atts(array(
|
| 233 |
"name" => ''
|
|
@@ -238,13 +559,11 @@ function tmm_sc($atts) {
|
|
| 238 |
|
| 239 |
global $post;
|
| 240 |
|
| 241 |
-
$members = get_post_meta( get_the_id(), '
|
| 242 |
-
$options = get_post_meta( get_the_id(), '
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
$tmm_color = $option['tmm_color'];
|
| 247 |
-
}
|
| 248 |
|
| 249 |
$output .= '<div class="tmm tmm_'.$name.'">';
|
| 250 |
$output .= '<div class="tmm_'.$tmm_columns.'_columns">';
|
|
@@ -267,48 +586,50 @@ function tmm_sc($atts) {
|
|
| 267 |
}
|
| 268 |
|
| 269 |
$output .= '<div class="tmm_member" style="border-top:'.$tmm_color.' solid 5px;">';
|
| 270 |
-
|
|
|
|
|
|
|
| 271 |
$output .= '<div class="tmm_textblock">';
|
| 272 |
$output .= '<div class="tmm_names">';
|
| 273 |
-
$output .= '<span class="tmm_fname">'.$member['
|
| 274 |
$output .= ' ';
|
| 275 |
-
$output .= '<span class="tmm_lname">'.$member['
|
| 276 |
$output .= '</div>';
|
| 277 |
-
$output .= '<div class="tmm_job">'.$member['
|
| 278 |
-
$output .= '<div class="tmm_desc">'.$member['
|
| 279 |
$output .= '<div class="tmm_scblock">';
|
| 280 |
-
if ($member['
|
| 281 |
-
if ($member['
|
| 282 |
-
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['
|
| 283 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 284 |
$output .= '</a>';
|
| 285 |
} else {
|
| 286 |
-
$output .= '<a class="tmm_sociallink" href="'.$member['
|
| 287 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 288 |
$output .= '</a>';
|
| 289 |
}
|
| 290 |
}
|
| 291 |
|
| 292 |
-
if ($member['
|
| 293 |
-
if ($member['
|
| 294 |
-
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['
|
| 295 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 296 |
$output .= '</a>';
|
| 297 |
} else {
|
| 298 |
-
$output .= '<a class="tmm_sociallink" href="'.$member['
|
| 299 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 300 |
$output .= '</a>';
|
| 301 |
}
|
| 302 |
}
|
| 303 |
|
| 304 |
-
if ($member['
|
| 305 |
-
if ($member['
|
| 306 |
-
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['
|
| 307 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 308 |
$output .= '</a>';
|
| 309 |
} else {
|
| 310 |
-
$output .= '<a class="tmm_sociallink" href="'.$member['
|
| 311 |
-
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['
|
| 312 |
$output .= '</a>';
|
| 313 |
}
|
| 314 |
}
|
| 3 |
Plugin Name: Team Members
|
| 4 |
Plugin URI: http://wpdarko.com/support/documentation/get-started-team-members/
|
| 5 |
Description: A responsive, simple and clean way to display your team. Create new members, add their positions, bios, social links and copy-paste the shortcode into any post/page. Find support and information on the <a href="http://wpdarko.com/team-members/">plugin's page</a>. This free version is NOT limited and does not contain any ad. Check out the <a href='http://wpdarko.com/items/team-members-pro/'>PRO version</a> for more great features.
|
| 6 |
+
Version: 2.0.1
|
| 7 |
Author: WP Darko
|
| 8 |
Author URI: http://wpdarko.com
|
| 9 |
License: GPL2
|
| 10 |
*/
|
| 11 |
|
| 12 |
+
/* Recover old data if there is */
|
| 13 |
+
add_action( 'init', 'tmm_old_data' );
|
| 14 |
+
|
| 15 |
+
function tmm_old_data() {
|
| 16 |
+
|
| 17 |
+
if(!get_option('tmm_is_updated_yn9090')){
|
| 18 |
+
|
| 19 |
+
global $post;
|
| 20 |
+
$args = array(
|
| 21 |
+
'post_type' => 'tmm',
|
| 22 |
+
'posts_per_page' => 9999,
|
| 23 |
+
);
|
| 24 |
+
|
| 25 |
+
$get_old = get_posts( $args );
|
| 26 |
+
foreach ( $get_old as $post ) : setup_postdata( $post );
|
| 27 |
+
|
| 28 |
+
$current_id = get_the_id();
|
| 29 |
+
$old_data_teams = get_post_meta( $current_id, 'tmm_head', false );
|
| 30 |
+
|
| 31 |
+
foreach ($old_data_teams as $key => $odata) {
|
| 32 |
+
|
| 33 |
+
$test_man[$key]['_tmm_firstname'] = $odata['tmm_firstname'];
|
| 34 |
+
$test_man[$key]['_tmm_lastname'] = $odata['tmm_lastname'];
|
| 35 |
+
$test_man[$key]['_tmm_job'] = $odata['tmm_job'];
|
| 36 |
+
$test_man[$key]['_tmm_photo'] = wp_get_attachment_url($odata['tmm_photo']);
|
| 37 |
+
$test_man[$key]['_tmm_desc'] = $odata['tmm_desc'];
|
| 38 |
+
$test_man[$key]['_tmm_sc_type1'] = $odata['tmm_sc_type1'];
|
| 39 |
+
$test_man[$key]['_tmm_sc_title1'] = $odata['tmm_sc_title1'];
|
| 40 |
+
$test_man[$key]['_tmm_sc_url1'] = $odata['tmm_sc_url1'];
|
| 41 |
+
$test_man[$key]['_tmm_sc_type2'] = $odata['tmm_sc_type2'];
|
| 42 |
+
$test_man[$key]['_tmm_sc_title2'] = $odata['tmm_sc_title2'];
|
| 43 |
+
$test_man[$key]['_tmm_sc_url2'] = $odata['tmm_sc_url2'];
|
| 44 |
+
$test_man[$key]['_tmm_sc_type3'] = $odata['tmm_sc_type3'];
|
| 45 |
+
$test_man[$key]['_tmm_sc_title3'] = $odata['tmm_sc_title3'];
|
| 46 |
+
$test_man[$key]['_tmm_sc_url3'] = $odata['tmm_sc_url3'];
|
| 47 |
+
|
| 48 |
+
update_post_meta($current_id, '_tmm_head', $test_man);
|
| 49 |
+
wp_reset_postdata();
|
| 50 |
+
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
$test_man = '';
|
| 54 |
+
$old_data_settings = get_post_meta( $current_id, 'tmm_settings_head', false );
|
| 55 |
+
|
| 56 |
+
foreach ($old_data_settings as $key => $odata) {
|
| 57 |
+
|
| 58 |
+
$var1 = $odata['tmm_columns'];
|
| 59 |
+
$var2 = $odata['tmm_color'];
|
| 60 |
+
|
| 61 |
+
update_post_meta($current_id, '_tmm_columns', $var1);
|
| 62 |
+
update_post_meta($current_id, '_tmm_color', $var2);
|
| 63 |
+
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
endforeach;
|
| 67 |
+
|
| 68 |
+
update_option('tmm_is_updated_yn9090', 'old_data_recovered');
|
| 69 |
+
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
/* Check for the PRO version */
|
| 75 |
function tmm_free_pro_check() {
|
| 76 |
if (is_plugin_active('team-members-pro/tmm-pro.php')) {
|
| 77 |
|
| 88 |
|
| 89 |
add_action( 'admin_init', 'tmm_free_pro_check' );
|
| 90 |
|
| 91 |
+
/* Enqueue styles & scripts */
|
| 92 |
add_action( 'wp_enqueue_scripts', 'add_tmm_scripts' );
|
| 93 |
function add_tmm_scripts() {
|
| 94 |
wp_enqueue_style( 'tmm', plugins_url('css/tmm_custom_style.min.css', __FILE__));
|
| 95 |
}
|
| 96 |
|
| 97 |
+
/* Enqueue admin styles */
|
| 98 |
+
add_action( 'admin_enqueue_scripts', 'add_admin_tmm_style' );
|
| 99 |
+
|
| 100 |
+
function add_admin_tmm_style() {
|
| 101 |
+
wp_enqueue_style( 'tmm', plugins_url('css/admin_de_style.min.css', __FILE__));
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
/* Create the Team post type */
|
| 105 |
add_action( 'init', 'create_tmm_type' );
|
| 106 |
|
| 107 |
function create_tmm_type() {
|
| 121 |
);
|
| 122 |
}
|
| 123 |
|
| 124 |
+
/* Hide View/Preview since it's a shortcode */
|
| 125 |
+
function tmm_admin_css() {
|
| 126 |
+
global $post_type;
|
| 127 |
+
$post_types = array(
|
| 128 |
+
'tmm',
|
| 129 |
+
);
|
| 130 |
+
if(in_array($post_type, $post_types))
|
| 131 |
+
echo '<style type="text/css">#post-preview, #view-post-btn{display: none;}</style>';
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
function remove_view_link_tmm( $action ) {
|
| 135 |
+
|
| 136 |
+
unset ($action['view']);
|
| 137 |
+
return $action;
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
add_filter( 'post_row_actions', 'remove_view_link_tmm' );
|
| 141 |
+
add_action( 'admin_head-post-new.php', 'tmm_admin_css' );
|
| 142 |
+
add_action( 'admin_head-post.php', 'tmm_admin_css' );
|
| 143 |
+
|
| 144 |
+
// Adding the CMB2 Metabox class
|
| 145 |
+
if ( file_exists( dirname( __FILE__ ) . '/cmb2/init.php' ) ) {
|
| 146 |
+
require_once dirname( __FILE__ ) . '/cmb2/init.php';
|
| 147 |
+
} elseif ( file_exists( dirname( __FILE__ ) . '/CMB2/init.php' ) ) {
|
| 148 |
+
require_once dirname( __FILE__ ) . '/CMB2/init.php';
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
// Registering Teams metaboxes
|
| 152 |
+
function tmm_register_group_metabox() {
|
| 153 |
+
|
| 154 |
+
$prefix = '_tmm_';
|
| 155 |
+
|
| 156 |
+
// Tables group
|
| 157 |
+
$main_group = new_cmb2_box( array(
|
| 158 |
+
'id' => $prefix . 'team_metabox',
|
| 159 |
+
'title' => '<span class="dashicons dashicons-welcome-add-page"></span> Manage Members <span style="color:#8a7463; font-weight:400; float:right; padding-right:14px;"><span class="dashicons dashicons-lock"></span> Free version</span>',
|
| 160 |
+
'object_types' => array( 'tmm' ),
|
| 161 |
+
));
|
| 162 |
+
|
| 163 |
+
$tmm_group = $main_group->add_field( array(
|
| 164 |
+
'id' => $prefix . 'head',
|
| 165 |
+
'type' => 'group',
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 166 |
'options' => array(
|
| 167 |
+
'group_title' => 'Member {#}',
|
| 168 |
+
'add_button' => 'Add another member',
|
| 169 |
+
'remove_button' => 'Remove member',
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 170 |
'sortable' => true,
|
| 171 |
+
'single' => false,
|
| 172 |
+
),
|
| 173 |
+
));
|
| 174 |
+
|
| 175 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 176 |
+
'name' => 'Member details',
|
| 177 |
+
'id' => $prefix . 'member_header',
|
| 178 |
+
'type' => 'title',
|
| 179 |
+
'row_classes' => 'de_hundred de_heading',
|
| 180 |
+
));
|
| 181 |
+
|
| 182 |
+
|
| 183 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 184 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Firstname</span>',
|
| 185 |
+
'id' => $prefix . 'firstname',
|
| 186 |
+
'type' => 'text',
|
| 187 |
+
'row_classes' => 'de_first de_twentyfive de_text de_input',
|
| 188 |
+
));
|
| 189 |
+
|
| 190 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 191 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Lastname</span>',
|
| 192 |
+
'id' => $prefix . 'lastname',
|
| 193 |
+
'type' => 'text',
|
| 194 |
+
'row_classes' => 'de_twentyfive de_text de_input',
|
| 195 |
+
));
|
| 196 |
+
|
| 197 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 198 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Job/role</span>',
|
| 199 |
+
'id' => $prefix . 'job',
|
| 200 |
+
'type' => 'text',
|
| 201 |
+
'row_classes' => 'de_fifty de_text de_input',
|
| 202 |
+
));
|
| 203 |
+
|
| 204 |
+
|
| 205 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 206 |
+
'name' => '<span class="dashicons dashicons-format-image"></span> Photo',
|
| 207 |
+
'id' => $prefix . 'photo',
|
| 208 |
+
'type' => 'file',
|
| 209 |
+
'attributes' => array(
|
| 210 |
+
'placeholder' => 'recommended size: 500 x 500',
|
| 211 |
+
),
|
| 212 |
+
'row_classes' => 'de_first de_hundred de_upload de_input',
|
| 213 |
+
));
|
| 214 |
+
|
| 215 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 216 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Description/bio',
|
| 217 |
+
'id' => $prefix . 'desc',
|
| 218 |
+
'type' => 'textarea',
|
| 219 |
+
'attributes' => array(
|
| 220 |
+
'rows' => 6,
|
| 221 |
+
),
|
| 222 |
+
'row_classes' => 'de_first de_fifty de_textarea de_input',
|
| 223 |
+
));
|
| 224 |
+
|
| 225 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 226 |
+
'name' => 'Tips & Tricks',
|
| 227 |
+
'desc' => '<span class="dashicons dashicons-yes"></span> Add links<br/><span style="color:#bbb;"><a href="http://you.com/member-page">View member page</a></span>',
|
| 228 |
+
'id' => $prefix . 'desc_desc',
|
| 229 |
+
'type' => 'title',
|
| 230 |
+
'row_classes' => 'de_fifty de_info',
|
| 231 |
+
));
|
| 232 |
+
|
| 233 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 234 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Complementary info title</span>',
|
| 235 |
+
'desc' => 'This adds a little link below the description/bio, it will reveal the complementary info text when a visitor hovers over it.',
|
| 236 |
+
'id' => $prefix . 'comp_title',
|
| 237 |
+
'type' => 'text',
|
| 238 |
+
'row_classes' => 'de_first de_fifty de_text de_input',
|
| 239 |
+
));
|
| 240 |
+
|
| 241 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 242 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Complementary info text</span>',
|
| 243 |
+
'id' => $prefix . 'comp_text',
|
| 244 |
+
'type' => 'textarea',
|
| 245 |
+
'attributes' => array(
|
| 246 |
+
'rows' => 1,
|
| 247 |
+
),
|
| 248 |
+
'row_classes' => 'de_fifty de_text de_input',
|
| 249 |
+
));
|
| 250 |
+
|
| 251 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 252 |
+
'name' => 'Member links',
|
| 253 |
+
'id' => $prefix . 'member_links_header',
|
| 254 |
+
'type' => 'title',
|
| 255 |
+
'row_classes' => 'de_hundred de_heading',
|
| 256 |
+
));
|
| 257 |
+
|
| 258 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 259 |
+
'name' => '<span class="dashicons dashicons-admin-generic"></span> Link type (icon)',
|
| 260 |
+
'id' => $prefix . 'sc_type1',
|
| 261 |
+
'type' => 'select',
|
| 262 |
+
'options' => array(
|
| 263 |
+
'nada' => '-',
|
| 264 |
+
'twitter' => 'Twitter',
|
| 265 |
+
'linkedin' => 'LinkedIn',
|
| 266 |
+
'googleplus' => 'Google+',
|
| 267 |
+
'facebook' => 'Facebook',
|
| 268 |
+
'instagram' => 'Instagram',
|
| 269 |
+
'tumblr' => 'Tumblr',
|
| 270 |
+
'pinterest' => 'Pinterest',
|
| 271 |
+
'email' => 'Email',
|
| 272 |
+
'website' => 'Website',
|
| 273 |
+
'customlink' => 'Other links',
|
| 274 |
+
),
|
| 275 |
+
'default' => 'nada',
|
| 276 |
+
'row_classes' => 'de_first de_twentyfive de_select de_text de_input',
|
| 277 |
+
));
|
| 278 |
+
|
| 279 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 280 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Link title',
|
| 281 |
+
'id' => $prefix . 'sc_title1',
|
| 282 |
+
'type' => 'text',
|
| 283 |
+
'row_classes' => 'de_twentyfive de_text de_input',
|
| 284 |
+
));
|
| 285 |
+
|
| 286 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 287 |
+
'name' => '<span class="dashicons dashicons-edit"></span> Link URL',
|
| 288 |
+
'id' => $prefix . 'sc_url1',
|
| 289 |
+
'type' => 'text',
|
| 290 |
+
'row_classes' => 'de_fifty de_text de_input',
|
| 291 |
+
));
|
| 292 |
+
|
| 293 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 294 |
+
'name' => '',
|
| 295 |
+
'id' => $prefix . 'sc_type2',
|
| 296 |
+
'type' => 'select',
|
| 297 |
+
'options' => array(
|
| 298 |
+
'nada' => '-',
|
| 299 |
+
'twitter' => 'Twitter',
|
| 300 |
+
'linkedin' => 'LinkedIn',
|
| 301 |
+
'googleplus' => 'Google+',
|
| 302 |
+
'facebook' => 'Facebook',
|
| 303 |
+
'instagram' => 'Instagram',
|
| 304 |
+
'tumblr' => 'Tumblr',
|
| 305 |
+
'pinterest' => 'Pinterest',
|
| 306 |
+
'email' => 'Email',
|
| 307 |
+
'website' => 'Website',
|
| 308 |
+
'customlink' => 'Other links',
|
| 309 |
+
),
|
| 310 |
+
'default' => 'nada',
|
| 311 |
+
'row_classes' => 'de_first de_twentyfive de_select de_text de_input de_nomtop',
|
| 312 |
+
));
|
| 313 |
+
|
| 314 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 315 |
+
'name' => '',
|
| 316 |
+
'id' => $prefix . 'sc_title2',
|
| 317 |
+
'type' => 'text',
|
| 318 |
+
'row_classes' => 'de_twentyfive de_text de_input de_nomtop',
|
| 319 |
+
));
|
| 320 |
+
|
| 321 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 322 |
+
'name' => '',
|
| 323 |
+
'id' => $prefix . 'sc_url2',
|
| 324 |
+
'type' => 'text',
|
| 325 |
+
'row_classes' => 'de_fifty de_text de_input de_nomtop',
|
| 326 |
+
));
|
| 327 |
+
|
| 328 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 329 |
+
'name' => '',
|
| 330 |
+
'id' => $prefix . 'sc_type3',
|
| 331 |
+
'type' => 'select',
|
| 332 |
+
'options' => array(
|
| 333 |
+
'nada' => '-',
|
| 334 |
+
'twitter' => 'Twitter',
|
| 335 |
+
'linkedin' => 'LinkedIn',
|
| 336 |
+
'googleplus' => 'Google+',
|
| 337 |
+
'facebook' => 'Facebook',
|
| 338 |
+
'instagram' => 'Instagram',
|
| 339 |
+
'tumblr' => 'Tumblr',
|
| 340 |
+
'pinterest' => 'Pinterest',
|
| 341 |
+
'email' => 'Email',
|
| 342 |
+
'website' => 'Website',
|
| 343 |
+
'customlink' => 'Other links',
|
| 344 |
+
),
|
| 345 |
+
'default' => 'nada',
|
| 346 |
+
'row_classes' => 'de_first de_twentyfive de_select de_text de_input de_nomtop',
|
| 347 |
+
));
|
| 348 |
+
|
| 349 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 350 |
+
'name' => '',
|
| 351 |
+
'id' => $prefix . 'sc_title3',
|
| 352 |
+
'type' => 'text',
|
| 353 |
+
'row_classes' => 'de_twentyfive de_text de_input de_nomtop',
|
| 354 |
+
));
|
| 355 |
+
|
| 356 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 357 |
+
'name' => '',
|
| 358 |
+
'id' => $prefix . 'sc_url3',
|
| 359 |
+
'type' => 'text',
|
| 360 |
+
'row_classes' => 'de_fifty de_text de_input de_nomtop',
|
| 361 |
+
));
|
| 362 |
+
|
| 363 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 364 |
+
'name' => 'Member styling',
|
| 365 |
+
'id' => $prefix . 'member_styling_header',
|
| 366 |
+
'type' => 'title',
|
| 367 |
+
'row_classes' => 'de_hundred de_heading',
|
| 368 |
+
));
|
| 369 |
+
|
| 370 |
+
$main_group->add_group_field( $tmm_group, array(
|
| 371 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Color (per member)</span>',
|
| 372 |
+
'id' => $prefix . 'freecolor',
|
| 373 |
+
'type' => 'colorpicker',
|
| 374 |
+
'row_classes' => 'de_first de_hundred de_color de_input',
|
| 375 |
+
));
|
| 376 |
+
|
| 377 |
+
// Settings group
|
| 378 |
+
$side_group = new_cmb2_box( array(
|
| 379 |
+
'id' => $prefix . 'settings_head',
|
| 380 |
+
'title' => '<span class="dashicons dashicons-admin-tools"></span> Team Settings',
|
| 381 |
+
'object_types' => array( 'tmm' ),
|
| 382 |
'context' => 'side',
|
| 383 |
'priority' => 'high',
|
| 384 |
+
'closed' => true,
|
| 385 |
+
));
|
| 386 |
+
|
| 387 |
+
$side_group->add_field( array(
|
| 388 |
+
'name' => 'General settings',
|
| 389 |
+
'id' => $prefix . 'other_settings_desc',
|
| 390 |
+
'type' => 'title',
|
| 391 |
+
'row_classes' => 'de_hundred_side de_heading_side',
|
| 392 |
+
));
|
| 393 |
+
|
| 394 |
+
$side_group->add_field( array(
|
| 395 |
+
'name' => '<span class="dashicons dashicons-admin-appearance"></span> Main Color</span>',
|
| 396 |
+
'id' => $prefix . 'color',
|
| 397 |
+
'type' => 'colorpicker',
|
| 398 |
+
'row_classes' => 'de_first de_hundred de_color de_input',
|
| 399 |
+
));
|
| 400 |
|
| 401 |
+
$side_group->add_field( array(
|
| 402 |
+
'name' => '<span class="dashicons dashicons-arrow-down"></span> Members to show per line',
|
| 403 |
+
'id' => $prefix . 'columns',
|
| 404 |
+
'type' => 'select',
|
| 405 |
+
'options' => array(
|
| 406 |
+
'2' => 'Two members per line',
|
| 407 |
+
'3' => 'Three members per line',
|
| 408 |
+
'4' => 'Four members per line',
|
| 409 |
+
),
|
| 410 |
+
'default' => '3',
|
| 411 |
+
'row_classes' => 'de_hundred_side de_text_side',
|
| 412 |
+
));
|
| 413 |
+
|
| 414 |
+
$side_group->add_field( array(
|
| 415 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Pictures\' shape</span>',
|
| 416 |
+
'id' => $prefix . 'picture_shape',
|
| 417 |
+
'type' => 'select',
|
| 418 |
+
'options' => array(
|
| 419 |
+
'-' => 'Rounded or Squared',
|
| 420 |
+
),
|
| 421 |
+
'default' => '-',
|
| 422 |
+
'row_classes' => 'de_hundred_side de_text_side',
|
| 423 |
+
));
|
| 424 |
+
|
| 425 |
+
$side_group->add_field( array(
|
| 426 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Pictures\' borders</span>',
|
| 427 |
+
'id' => $prefix . 'picture_border',
|
| 428 |
+
'type' => 'select',
|
| 429 |
+
'options' => array(
|
| 430 |
+
'-' => 'Yes or No',
|
| 431 |
+
),
|
| 432 |
+
'default' => '-',
|
| 433 |
+
'row_classes' => 'de_hundred_side de_text_side',
|
| 434 |
+
));
|
| 435 |
+
|
| 436 |
+
$side_group->add_field( array(
|
| 437 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Pictures\' position</span>',
|
| 438 |
+
'id' => $prefix . 'picture_position',
|
| 439 |
+
'type' => 'select',
|
| 440 |
+
'options' => array(
|
| 441 |
+
'-' => 'Floating or Inside the box',
|
| 442 |
+
),
|
| 443 |
+
'default' => '-',
|
| 444 |
+
'row_classes' => 'de_hundred_side de_text_side',
|
| 445 |
+
));
|
| 446 |
+
|
| 447 |
+
$side_group->add_field( array(
|
| 448 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Pictures\' filter</span>',
|
| 449 |
+
'id' => $prefix . 'picture_filter',
|
| 450 |
+
'type' => 'select',
|
| 451 |
+
'options' => array(
|
| 452 |
+
'-' => 'Choose among 4 filters',
|
| 453 |
+
),
|
| 454 |
+
'default' => '-',
|
| 455 |
+
'row_classes' => 'de_hundred_side de_text_side',
|
| 456 |
+
));
|
| 457 |
+
|
| 458 |
+
$side_group->add_field( array(
|
| 459 |
+
'name' => '<span style="color:#8a7463;"><span class="dashicons dashicons-lock"></span> PRO Top border\'s size</span>',
|
| 460 |
+
'desc' => 'In pixels, without the "px".',
|
| 461 |
+
'id' => $prefix . 'tp_border_size',
|
| 462 |
+
'type' => 'text',
|
| 463 |
+
'row_classes' => 'de_hundred_side de_text_side de_input',
|
| 464 |
+
));
|
| 465 |
+
|
| 466 |
+
// Help group
|
| 467 |
+
$help_group = new_cmb2_box( array(
|
| 468 |
+
'id' => $prefix . 'help_metabox',
|
| 469 |
+
'title' => '<span class="dashicons dashicons-sos"></span> Help & Support',
|
| 470 |
+
'object_types' => array( 'tmm' ),
|
| 471 |
+
'context' => 'side',
|
| 472 |
+
'priority' => 'high',
|
| 473 |
+
'closed' => true,
|
| 474 |
+
'row_classes' => 'de_hundred de_heading',
|
| 475 |
+
));
|
| 476 |
+
|
| 477 |
+
$help_group->add_field( array(
|
| 478 |
+
'name' => '',
|
| 479 |
+
'desc' => 'Find help at WPdarko.com<br/><br/><a target="_blank" href="http://wpdarko.com/support/forum/plugins/team-members/"><span class="dashicons dashicons-arrow-right-alt2"></span> Support forum</a><br/><a target="_blank" href="http://wpdarko.com/support/documentation/get-started-team-members/"><span class="dashicons dashicons-arrow-right-alt2"></span> Documentation</a>',
|
| 480 |
+
'id' => $prefix . 'help_desc',
|
| 481 |
+
'type' => 'title',
|
| 482 |
+
'row_classes' => 'de_hundred de_info de_info_side',
|
| 483 |
+
));
|
| 484 |
+
|
| 485 |
+
// PRO group
|
| 486 |
+
$pro_group = new_cmb2_box( array(
|
| 487 |
+
'id' => $prefix . 'pro_metabox',
|
| 488 |
+
'title' => '<span class="dashicons dashicons-awards"></span> PRO version',
|
| 489 |
+
'object_types' => array( 'tmm' ),
|
| 490 |
+
'context' => 'side',
|
| 491 |
+
'priority' => 'high',
|
| 492 |
+
'closed' => true,
|
| 493 |
+
'row_classes' => 'de_hundred de_heading',
|
| 494 |
+
));
|
| 495 |
+
|
| 496 |
+
$pro_group->add_field( array(
|
| 497 |
+
'name' => '',
|
| 498 |
+
'desc' => 'This free version is <strong>not</strong> limited and does <strong>not</strong> contain any ad. Check out the PRO version for more great features.<br/><br/><a target="_blank" href="http://wpdarko.com/items/team-members-pro"><span class="dashicons dashicons-arrow-right-alt2"></span> See plugin\'s page</a><br/><br/><span style="font-size:13px; color:#88acbc;">Coupon code <strong>7884661</strong> (20% OFF).</span>',
|
| 499 |
+
'id' => $prefix . 'pro_desc',
|
| 500 |
+
'type' => 'title',
|
| 501 |
+
'row_classes' => 'de_hundred de_info de_info_side',
|
| 502 |
+
));
|
| 503 |
+
|
| 504 |
+
// Shortcode group
|
| 505 |
+
$show_group = new_cmb2_box( array(
|
| 506 |
+
'id' => $prefix . 'shortcode_metabox',
|
| 507 |
+
'title' => '<span class="dashicons dashicons-visibility"></span> Display my Team',
|
| 508 |
+
'object_types' => array( 'tmm' ),
|
| 509 |
'context' => 'side',
|
| 510 |
'priority' => 'low',
|
| 511 |
+
'closed' => false,
|
| 512 |
+
'row_classes' => 'de_hundred de_heading',
|
| 513 |
+
));
|
| 514 |
+
|
| 515 |
+
$show_group->add_field( array(
|
| 516 |
+
'name' => '',
|
| 517 |
+
'desc' => 'To display your Team on your site, copy-paste the Team\'s [Shortcode] in your post/page. <br/><br/>You can find this shortcode by clicking on the "Teams" tab in the menu on the left.',
|
| 518 |
+
'id' => $prefix . 'short_desc',
|
| 519 |
+
'type' => 'title',
|
| 520 |
+
'row_classes' => 'de_hundred de_info de_info_side',
|
| 521 |
+
));
|
|
|
|
| 522 |
|
|
|
|
|
|
|
| 523 |
}
|
| 524 |
|
| 525 |
+
add_action( 'cmb2_init', 'tmm_register_group_metabox' );
|
| 526 |
+
|
| 527 |
+
//Shortcode columns
|
| 528 |
add_action( 'manage_tmm_posts_custom_column' , 'dktmm_custom_columns', 10, 2 );
|
| 529 |
|
| 530 |
function dktmm_custom_columns( $column, $post_id ) {
|
| 548 |
}
|
| 549 |
add_filter('manage_tmm_posts_columns' , 'add_tmm_columns');
|
| 550 |
|
| 551 |
+
//Tmm shortcode
|
| 552 |
function tmm_sc($atts) {
|
| 553 |
extract(shortcode_atts(array(
|
| 554 |
"name" => ''
|
| 559 |
|
| 560 |
global $post;
|
| 561 |
|
| 562 |
+
$members = get_post_meta( get_the_id(), '_tmm_head', true );
|
| 563 |
+
$options = get_post_meta( get_the_id(), '_tmm_settings_head', true );
|
| 564 |
+
|
| 565 |
+
$tmm_columns = get_post_meta( $post->ID, '_tmm_columns', true );
|
| 566 |
+
$tmm_color = get_post_meta( $post->ID, '_tmm_color', true );
|
|
|
|
|
|
|
| 567 |
|
| 568 |
$output .= '<div class="tmm tmm_'.$name.'">';
|
| 569 |
$output .= '<div class="tmm_'.$tmm_columns.'_columns">';
|
| 586 |
}
|
| 587 |
|
| 588 |
$output .= '<div class="tmm_member" style="border-top:'.$tmm_color.' solid 5px;">';
|
| 589 |
+
|
| 590 |
+
$output .= '<img src="'.$member['_tmm_photo'].'"/>';
|
| 591 |
+
|
| 592 |
$output .= '<div class="tmm_textblock">';
|
| 593 |
$output .= '<div class="tmm_names">';
|
| 594 |
+
$output .= '<span class="tmm_fname">'.$member['_tmm_firstname'].'</span>';
|
| 595 |
$output .= ' ';
|
| 596 |
+
$output .= '<span class="tmm_lname">'.$member['_tmm_lastname'].'</span>';
|
| 597 |
$output .= '</div>';
|
| 598 |
+
$output .= '<div class="tmm_job">'.$member['_tmm_job'].'</div>';
|
| 599 |
+
$output .= '<div class="tmm_desc">'.$member['_tmm_desc'].'</div>';
|
| 600 |
$output .= '<div class="tmm_scblock">';
|
| 601 |
+
if ($member['_tmm_sc_type1'] != 'nada') {
|
| 602 |
+
if ($member['_tmm_sc_type1'] == 'email') {
|
| 603 |
+
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['_tmm_sc_url1'].'" title="'.$member['_tmm_sc_title1'].'">';
|
| 604 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type1'].'.png"/>';
|
| 605 |
$output .= '</a>';
|
| 606 |
} else {
|
| 607 |
+
$output .= '<a class="tmm_sociallink" href="'.$member['_tmm_sc_url1'].'" title="'.$member['_tmm_sc_title1'].'">';
|
| 608 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type1'].'.png"/>';
|
| 609 |
$output .= '</a>';
|
| 610 |
}
|
| 611 |
}
|
| 612 |
|
| 613 |
+
if ($member['_tmm_sc_type2'] != 'nada') {
|
| 614 |
+
if ($member['_tmm_sc_type2'] == 'email') {
|
| 615 |
+
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['_tmm_sc_url2'].'" title="'.$member['_tmm_sc_title2'].'">';
|
| 616 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type2'].'.png"/>';
|
| 617 |
$output .= '</a>';
|
| 618 |
} else {
|
| 619 |
+
$output .= '<a class="tmm_sociallink" href="'.$member['_tmm_sc_url2'].'" title="'.$member['_tmm_sc_title2'].'">';
|
| 620 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type2'].'.png"/>';
|
| 621 |
$output .= '</a>';
|
| 622 |
}
|
| 623 |
}
|
| 624 |
|
| 625 |
+
if ($member['_tmm_sc_type3'] != 'nada') {
|
| 626 |
+
if ($member['_tmm_sc_type3'] == 'email') {
|
| 627 |
+
$output .= '<a class="tmm_sociallink" href="mailto:'.$member['_tmm_sc_url3'].'" title="'.$member['_tmm_sc_title3'].'">';
|
| 628 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type3'].'.png"/>';
|
| 629 |
$output .= '</a>';
|
| 630 |
} else {
|
| 631 |
+
$output .= '<a class="tmm_sociallink" href="'.$member['_tmm_sc_url3'].'" title="'.$member['_tmm_sc_title3'].'">';
|
| 632 |
+
$output .= '<img src="'.plugins_url('img/links/', __FILE__).$member['_tmm_sc_type3'].'.png"/>';
|
| 633 |
$output .= '</a>';
|
| 634 |
}
|
| 635 |
}
|
