Version Description
Release Date - 2022-2-14
- IWP-319 Update plugin author
- IWP-320 Update twitter and facebook links
- IWP-321 Update welcome message
- IWP-375 Spelling and link corrections
- IWP-376 Fix incorrect title on classic editor widget
Download this release
Release Info
Developer | data443 |
Plugin | Tracking Code Manager |
Version | 2.0.5 |
Comparing to | |
See all releases |
Code changes from version 2.0.4 to 2.0.5
- assets/css/style.css +140 -140
- assets/deps/select2-3.5.2/.gitignore +2 -2
- assets/deps/select2-3.5.2/CONTRIBUTING.md +107 -107
- assets/deps/select2-3.5.2/LICENSE +18 -18
- assets/deps/select2-3.5.2/README.md +114 -114
- assets/deps/select2-3.5.2/bower.json +8 -8
- assets/deps/select2-3.5.2/component.json +66 -66
- assets/deps/select2-3.5.2/composer.json +29 -29
- assets/deps/select2-3.5.2/package.json +20 -20
- assets/deps/select2-3.5.2/release.sh +79 -79
- assets/deps/select2-3.5.2/select2-bootstrap.css +87 -87
- assets/deps/select2-3.5.2/select2.css +704 -704
- assets/deps/select2-3.5.2/select2.jquery.json +36 -36
- assets/deps/select2-3.5.2/select2.js +3541 -3541
- assets/deps/select2-3.5.2/select2.min.js +22 -22
- assets/deps/select2-3.5.2/select2_locale_ar.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_az.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_bg.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_ca.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_cs.js +51 -51
- assets/deps/select2-3.5.2/select2_locale_da.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_de.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_el.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_en.js.template +20 -20
- assets/deps/select2-3.5.2/select2_locale_es.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_et.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_eu.js +45 -45
- assets/deps/select2-3.5.2/select2_locale_fa.js +21 -21
- assets/deps/select2-3.5.2/select2_locale_fi.js +30 -30
- assets/deps/select2-3.5.2/select2_locale_fr.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_gl.js +45 -45
- assets/deps/select2-3.5.2/select2_locale_he.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_hr.js +24 -24
- assets/deps/select2-3.5.2/select2_locale_hu.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_id.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_is.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_it.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_ja.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_ka.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ko.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_lt.js +26 -26
- assets/deps/select2-3.5.2/select2_locale_lv.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_mk.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_ms.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_nb.js +22 -22
- assets/deps/select2-3.5.2/select2_locale_nl.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_pl.js +54 -54
- assets/deps/select2-3.5.2/select2_locale_pt-BR.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_pt-PT.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_ro.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_rs.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ru.js +23 -23
- assets/deps/select2-3.5.2/select2_locale_sk.js +50 -50
- assets/deps/select2-3.5.2/select2_locale_sv.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_th.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_tr.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ug-CN.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_uk.js +25 -25
- assets/deps/select2-3.5.2/select2_locale_vi.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_zh-CN.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_zh-TW.js +16 -16
- assets/deps/starrr/starrr.css +7 -7
- assets/deps/starrr/starrr.js +123 -123
- assets/js/library.js +445 -445
- assets/js/plugin.js +103 -103
- autoload.php +47 -47
- includes/actions.php +3 -3
- includes/admin/editor.php +414 -414
- includes/admin/manager.php +201 -201
- includes/admin/metabox.php +209 -209
- includes/admin/settings.php +56 -56
- includes/admin/whatsnew.php +88 -88
- includes/classes/core/Manager.php +657 -657
- includes/classes/core/Singleton.php +37 -37
- includes/classes/domain/EcommercePurchase.php +15 -15
- includes/classes/ui/Check.php +106 -106
- includes/classes/ui/Form.php +512 -512
- includes/classes/ui/Tabs.php +294 -294
- includes/classes/utils/Cron.php +36 -36
- includes/classes/utils/Ecommerce.php +178 -178
- includes/classes/utils/Language.php +112 -112
- includes/classes/utils/Logger.php +82 -82
- includes/classes/utils/MobileDetect.php +679 -1435
assets/css/style.css
CHANGED
@@ -1,141 +1,141 @@
|
|
1 |
-
._tcmp {
|
2 |
-
background-color: #efc439;
|
3 |
-
border-radius: 2px;
|
4 |
-
color: #fff;
|
5 |
-
display: inline-block;
|
6 |
-
font-size: 12px;
|
7 |
-
padding: 0 2px;
|
8 |
-
line-height: 14px;
|
9 |
-
vertical-align: baseline;
|
10 |
-
}
|
11 |
-
|
12 |
-
.tcmp-tag {
|
13 |
-
display: inline-block;
|
14 |
-
line-height: 13px;
|
15 |
-
padding: 0 3px;
|
16 |
-
color: white;
|
17 |
-
font-size: 10px;
|
18 |
-
font-weight: normal;
|
19 |
-
width:25px;
|
20 |
-
margin-top:3px;
|
21 |
-
margin-right:5px;
|
22 |
-
text-align:center;
|
23 |
-
-webkit-border-radius: 2px;
|
24 |
-
border-radius: 2px;
|
25 |
-
vertical-align: baseline;
|
26 |
-
}
|
27 |
-
.tcmp-tag-free {
|
28 |
-
/*background-color: #edb802;*/
|
29 |
-
background-color: #16a765;
|
30 |
-
}
|
31 |
-
.tcmp-tag-premium {
|
32 |
-
/*background-color: #edb802;*/
|
33 |
-
background-color: #4986e7;
|
34 |
-
opacity: 0.7;
|
35 |
-
filter: alpha(opacity=70);
|
36 |
-
}
|
37 |
-
.tcmp-tag-premium a {
|
38 |
-
color:white;
|
39 |
-
text-decoration:none;
|
40 |
-
}
|
41 |
-
.tcmp-button {
|
42 |
-
margin-right:5px!important;
|
43 |
-
}
|
44 |
-
|
45 |
-
.tcmp-textarea {
|
46 |
-
font-family:"Courier New", Courier, mono;
|
47 |
-
font-size:12px;
|
48 |
-
color:#555;
|
49 |
-
background-color:#f8f8f8;
|
50 |
-
width:550px;
|
51 |
-
height:350px;
|
52 |
-
}
|
53 |
-
|
54 |
-
.tcmp-form {
|
55 |
-
float:left;
|
56 |
-
padding:5px;
|
57 |
-
}
|
58 |
-
.tcmp-form input, .tcmp-form label {
|
59 |
-
float:left;
|
60 |
-
}
|
61 |
-
.tcmp-text {
|
62 |
-
width: 400px;
|
63 |
-
}
|
64 |
-
.tcmp-label {
|
65 |
-
width: 150px;
|
66 |
-
margin: 0px;
|
67 |
-
background-color: transparent;
|
68 |
-
}
|
69 |
-
.tcmp-label-disabled {
|
70 |
-
/*color:#A8A8A8;*/
|
71 |
-
opacity: 0.7;
|
72 |
-
filter: alpha(opacity=70);
|
73 |
-
}
|
74 |
-
.tcmp-checkbox {
|
75 |
-
margin:0px;
|
76 |
-
}
|
77 |
-
.tcmp-checkbox:disabled {
|
78 |
-
background-color: #f8f8f8;
|
79 |
-
}
|
80 |
-
.tcmp-select {
|
81 |
-
|
82 |
-
}
|
83 |
-
.tcmp-form-newline {
|
84 |
-
clear:both;
|
85 |
-
margin-bottom:5px;
|
86 |
-
}
|
87 |
-
|
88 |
-
.tcmp-box-error {
|
89 |
-
background: #fff;
|
90 |
-
border-left: 4px solid #dd3d36;
|
91 |
-
margin: 5px 0 15px;
|
92 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
93 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
94 |
-
padding: 1px 12px;
|
95 |
-
}
|
96 |
-
.tcmp-box-warning {
|
97 |
-
background: #fff;
|
98 |
-
border-left: 4px solid #ffba00;
|
99 |
-
margin: 5px 0 15px;
|
100 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
101 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
102 |
-
padding: 1px 12px;
|
103 |
-
}
|
104 |
-
.tcmp-box-success {
|
105 |
-
background: #fff;
|
106 |
-
border-left: 4px solid #7ad03a;
|
107 |
-
margin: 5px 0 15px;
|
108 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
109 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
110 |
-
padding: 1px 12px;
|
111 |
-
}
|
112 |
-
.tcmp-box-info {
|
113 |
-
background: #fff;
|
114 |
-
border-left: 4px solid #00a0d2;
|
115 |
-
margin: 5px 0 15px;
|
116 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
117 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
118 |
-
padding: 1px 12px;
|
119 |
-
}
|
120 |
-
|
121 |
-
table thead {
|
122 |
-
background-color: #fafafa;
|
123 |
-
}
|
124 |
-
table tr td {
|
125 |
-
vertical-align: middle;
|
126 |
-
border-top: 1px solid #eeeeee;
|
127 |
-
}
|
128 |
-
table .odd {
|
129 |
-
background-color: white;
|
130 |
-
}
|
131 |
-
table .even {
|
132 |
-
background-color: #fafafa;
|
133 |
-
}
|
134 |
-
#tcmp-sidebar li {
|
135 |
-
margin: 0px!important;
|
136 |
-
margin-left: 20px!important;;
|
137 |
-
}
|
138 |
-
.tcmp-plugin-widget {
|
139 |
-
padding: 10px;
|
140 |
-
border: 2px dashed red;
|
141 |
}
|
1 |
+
._tcmp {
|
2 |
+
background-color: #efc439;
|
3 |
+
border-radius: 2px;
|
4 |
+
color: #fff;
|
5 |
+
display: inline-block;
|
6 |
+
font-size: 12px;
|
7 |
+
padding: 0 2px;
|
8 |
+
line-height: 14px;
|
9 |
+
vertical-align: baseline;
|
10 |
+
}
|
11 |
+
|
12 |
+
.tcmp-tag {
|
13 |
+
display: inline-block;
|
14 |
+
line-height: 13px;
|
15 |
+
padding: 0 3px;
|
16 |
+
color: white;
|
17 |
+
font-size: 10px;
|
18 |
+
font-weight: normal;
|
19 |
+
width:25px;
|
20 |
+
margin-top:3px;
|
21 |
+
margin-right:5px;
|
22 |
+
text-align:center;
|
23 |
+
-webkit-border-radius: 2px;
|
24 |
+
border-radius: 2px;
|
25 |
+
vertical-align: baseline;
|
26 |
+
}
|
27 |
+
.tcmp-tag-free {
|
28 |
+
/*background-color: #edb802;*/
|
29 |
+
background-color: #16a765;
|
30 |
+
}
|
31 |
+
.tcmp-tag-premium {
|
32 |
+
/*background-color: #edb802;*/
|
33 |
+
background-color: #4986e7;
|
34 |
+
opacity: 0.7;
|
35 |
+
filter: alpha(opacity=70);
|
36 |
+
}
|
37 |
+
.tcmp-tag-premium a {
|
38 |
+
color:white;
|
39 |
+
text-decoration:none;
|
40 |
+
}
|
41 |
+
.tcmp-button {
|
42 |
+
margin-right:5px!important;
|
43 |
+
}
|
44 |
+
|
45 |
+
.tcmp-textarea {
|
46 |
+
font-family:"Courier New", Courier, mono;
|
47 |
+
font-size:12px;
|
48 |
+
color:#555;
|
49 |
+
background-color:#f8f8f8;
|
50 |
+
width:550px;
|
51 |
+
height:350px;
|
52 |
+
}
|
53 |
+
|
54 |
+
.tcmp-form {
|
55 |
+
float:left;
|
56 |
+
padding:5px;
|
57 |
+
}
|
58 |
+
.tcmp-form input, .tcmp-form label {
|
59 |
+
float:left;
|
60 |
+
}
|
61 |
+
.tcmp-text {
|
62 |
+
width: 400px;
|
63 |
+
}
|
64 |
+
.tcmp-label {
|
65 |
+
width: 150px;
|
66 |
+
margin: 0px;
|
67 |
+
background-color: transparent;
|
68 |
+
}
|
69 |
+
.tcmp-label-disabled {
|
70 |
+
/*color:#A8A8A8;*/
|
71 |
+
opacity: 0.7;
|
72 |
+
filter: alpha(opacity=70);
|
73 |
+
}
|
74 |
+
.tcmp-checkbox {
|
75 |
+
margin:0px;
|
76 |
+
}
|
77 |
+
.tcmp-checkbox:disabled {
|
78 |
+
background-color: #f8f8f8;
|
79 |
+
}
|
80 |
+
.tcmp-select {
|
81 |
+
|
82 |
+
}
|
83 |
+
.tcmp-form-newline {
|
84 |
+
clear:both;
|
85 |
+
margin-bottom:5px;
|
86 |
+
}
|
87 |
+
|
88 |
+
.tcmp-box-error {
|
89 |
+
background: #fff;
|
90 |
+
border-left: 4px solid #dd3d36;
|
91 |
+
margin: 5px 0 15px;
|
92 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
93 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
94 |
+
padding: 1px 12px;
|
95 |
+
}
|
96 |
+
.tcmp-box-warning {
|
97 |
+
background: #fff;
|
98 |
+
border-left: 4px solid #ffba00;
|
99 |
+
margin: 5px 0 15px;
|
100 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
101 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
102 |
+
padding: 1px 12px;
|
103 |
+
}
|
104 |
+
.tcmp-box-success {
|
105 |
+
background: #fff;
|
106 |
+
border-left: 4px solid #7ad03a;
|
107 |
+
margin: 5px 0 15px;
|
108 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
109 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
110 |
+
padding: 1px 12px;
|
111 |
+
}
|
112 |
+
.tcmp-box-info {
|
113 |
+
background: #fff;
|
114 |
+
border-left: 4px solid #00a0d2;
|
115 |
+
margin: 5px 0 15px;
|
116 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
117 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
118 |
+
padding: 1px 12px;
|
119 |
+
}
|
120 |
+
|
121 |
+
table thead {
|
122 |
+
background-color: #fafafa;
|
123 |
+
}
|
124 |
+
table tr td {
|
125 |
+
vertical-align: middle;
|
126 |
+
border-top: 1px solid #eeeeee;
|
127 |
+
}
|
128 |
+
table .odd {
|
129 |
+
background-color: white;
|
130 |
+
}
|
131 |
+
table .even {
|
132 |
+
background-color: #fafafa;
|
133 |
+
}
|
134 |
+
#tcmp-sidebar li {
|
135 |
+
margin: 0px!important;
|
136 |
+
margin-left: 20px!important;;
|
137 |
+
}
|
138 |
+
.tcmp-plugin-widget {
|
139 |
+
padding: 10px;
|
140 |
+
border: 2px dashed red;
|
141 |
}
|
assets/deps/select2-3.5.2/.gitignore
CHANGED
@@ -1,2 +1,2 @@
|
|
1 |
-
.idea
|
2 |
-
|
1 |
+
.idea
|
2 |
+
|
assets/deps/select2-3.5.2/CONTRIBUTING.md
CHANGED
@@ -1,107 +1,107 @@
|
|
1 |
-
Contributing to Select2
|
2 |
-
=======================
|
3 |
-
Looking to contribute something to Select2? **Here's how you can help.**
|
4 |
-
|
5 |
-
Please take a moment to review this document in order to make the contribution
|
6 |
-
process easy and effective for everyone involved.
|
7 |
-
|
8 |
-
Following these guidelines helps to communicate that you respect the time of
|
9 |
-
the developers managing and developing this open source project. In return,
|
10 |
-
they should reciprocate that respect in addressing your issue or assessing
|
11 |
-
patches and features.
|
12 |
-
|
13 |
-
Using the issue tracker
|
14 |
-
-----------------------
|
15 |
-
When [reporting bugs][reporting-bugs] or
|
16 |
-
[requesting features][requesting-features], the
|
17 |
-
[issue tracker on GitHub][issue-tracker] is the recommended channel to use.
|
18 |
-
|
19 |
-
The issue tracker **is not** a place for support requests. The
|
20 |
-
[mailing list][mailing-list] or [IRC channel][irc-channel] are better places to
|
21 |
-
get help.
|
22 |
-
|
23 |
-
Reporting bugs with Select2
|
24 |
-
---------------------------
|
25 |
-
We really appreciate clear bug reports that _consistently_ show an issue
|
26 |
-
_within Select2_.
|
27 |
-
|
28 |
-
The ideal bug report follows these guidelines:
|
29 |
-
|
30 |
-
1. **Use the [GitHub issue search][issue-search]** — Check if the issue
|
31 |
-
has already been reported.
|
32 |
-
2. **Check if the issue has been fixed** — Try to reproduce the problem
|
33 |
-
using the code in the `master` branch.
|
34 |
-
3. **Isolate the problem** — Try to create an
|
35 |
-
[isolated test case][isolated-case] that consistently reproduces the problem.
|
36 |
-
|
37 |
-
Please try to be as detailed as possible in your bug report, especially if an
|
38 |
-
isolated test case cannot be made. Some useful questions to include the answer
|
39 |
-
to are:
|
40 |
-
|
41 |
-
- What steps can be used to reproduce the issue?
|
42 |
-
- What is the bug and what is the expected outcome?
|
43 |
-
- What browser(s) and Operating System have you tested with?
|
44 |
-
- Does the bug happen consistently across all tested browsers?
|
45 |
-
- What version of jQuery are you using? And what version of Select2?
|
46 |
-
- Are you using Select2 with other plugins?
|
47 |
-
|
48 |
-
All of these questions will help people fix and identify any potential bugs.
|
49 |
-
|
50 |
-
Requesting features in Select2
|
51 |
-
------------------------------
|
52 |
-
Select2 is a large library that carries with it a lot of functionality. Because
|
53 |
-
of this, many feature requests will not be implemented in the core library.
|
54 |
-
|
55 |
-
Before starting work on a major feature for Select2, **contact the
|
56 |
-
[community][community] first** or you may risk spending a considerable amount of
|
57 |
-
time on something which the project developers are not interested in bringing
|
58 |
-
into the project.
|
59 |
-
|
60 |
-
### Select2 4.0
|
61 |
-
|
62 |
-
Many feature requests will be closed off until 4.0, where Select2 plans to adopt
|
63 |
-
a more flexible API. If you are interested in helping with the development of
|
64 |
-
the next major Select2 release, please send a message to the
|
65 |
-
[mailing list][mailing-list] or [irc channel][irc-channel] for more information.
|
66 |
-
|
67 |
-
Triaging issues and pull requests
|
68 |
-
---------------------------------
|
69 |
-
Anyone can help the project maintainers triage issues and review pull requests.
|
70 |
-
|
71 |
-
### Handling new issues
|
72 |
-
|
73 |
-
Select2 regularly receives new issues which need to be tested and organized.
|
74 |
-
|
75 |
-
When a new issue that comes in that is similar to another existing issue, it
|
76 |
-
should be checked to make sure it is not a duplicate. Duplicates issues should
|
77 |
-
be marked by replying to the issue with "Duplicate of #[issue number]" where
|
78 |
-
`[issue number]` is the url or issue number for the existing issue. This will
|
79 |
-
allow the project maintainers to quickly close off additional issues and keep
|
80 |
-
the discussion focused within a single issue.
|
81 |
-
|
82 |
-
If you can test issues that are reported to Select2 that contain test cases and
|
83 |
-
confirm under what conditions bugs happen, that will allow others to identify
|
84 |
-
what causes a bug quicker.
|
85 |
-
|
86 |
-
### Reviewing pull requests
|
87 |
-
|
88 |
-
It is very common for pull requests to be opened for issues that contain a clear
|
89 |
-
solution to the problem. These pull requests should be rigorously reviewed by
|
90 |
-
the community before being accepted. If you are not sure about a piece of
|
91 |
-
submitted code, or know of a better way to do something, do not hesitate to make
|
92 |
-
a comment on the pull request.
|
93 |
-
|
94 |
-
It should also be made clear that **all code contributed to Select** must be
|
95 |
-
licensable under the [Apache 2 or GPL 2 licenses][licensing]. Code that cannot
|
96 |
-
be released under either of these licenses **cannot be accepted** into the
|
97 |
-
project.
|
98 |
-
|
99 |
-
[community]: https://github.com/ivaynberg/select2#community
|
100 |
-
[reporting-bugs]: #reporting-bugs-with-select2
|
101 |
-
[requesting-features]: #requesting-features-in-select2
|
102 |
-
[issue-tracker]: https://github.com/ivaynberg/select2/issues
|
103 |
-
[mailing-list]: https://github.com/ivaynberg/select2#mailing-list
|
104 |
-
[irc-channel]: https://github.com/ivaynberg/select2#irc-channel
|
105 |
-
[issue-search]: https://github.com/ivaynberg/select2/search?q=&type=Issues
|
106 |
-
[isolated-case]: http://css-tricks.com/6263-reduced-test-cases/
|
107 |
-
[licensing]: https://github.com/ivaynberg/select2#copyright-and-license
|
1 |
+
Contributing to Select2
|
2 |
+
=======================
|
3 |
+
Looking to contribute something to Select2? **Here's how you can help.**
|
4 |
+
|
5 |
+
Please take a moment to review this document in order to make the contribution
|
6 |
+
process easy and effective for everyone involved.
|
7 |
+
|
8 |
+
Following these guidelines helps to communicate that you respect the time of
|
9 |
+
the developers managing and developing this open source project. In return,
|
10 |
+
they should reciprocate that respect in addressing your issue or assessing
|
11 |
+
patches and features.
|
12 |
+
|
13 |
+
Using the issue tracker
|
14 |
+
-----------------------
|
15 |
+
When [reporting bugs][reporting-bugs] or
|
16 |
+
[requesting features][requesting-features], the
|
17 |
+
[issue tracker on GitHub][issue-tracker] is the recommended channel to use.
|
18 |
+
|
19 |
+
The issue tracker **is not** a place for support requests. The
|
20 |
+
[mailing list][mailing-list] or [IRC channel][irc-channel] are better places to
|
21 |
+
get help.
|
22 |
+
|
23 |
+
Reporting bugs with Select2
|
24 |
+
---------------------------
|
25 |
+
We really appreciate clear bug reports that _consistently_ show an issue
|
26 |
+
_within Select2_.
|
27 |
+
|
28 |
+
The ideal bug report follows these guidelines:
|
29 |
+
|
30 |
+
1. **Use the [GitHub issue search][issue-search]** — Check if the issue
|
31 |
+
has already been reported.
|
32 |
+
2. **Check if the issue has been fixed** — Try to reproduce the problem
|
33 |
+
using the code in the `master` branch.
|
34 |
+
3. **Isolate the problem** — Try to create an
|
35 |
+
[isolated test case][isolated-case] that consistently reproduces the problem.
|
36 |
+
|
37 |
+
Please try to be as detailed as possible in your bug report, especially if an
|
38 |
+
isolated test case cannot be made. Some useful questions to include the answer
|
39 |
+
to are:
|
40 |
+
|
41 |
+
- What steps can be used to reproduce the issue?
|
42 |
+
- What is the bug and what is the expected outcome?
|
43 |
+
- What browser(s) and Operating System have you tested with?
|
44 |
+
- Does the bug happen consistently across all tested browsers?
|
45 |
+
- What version of jQuery are you using? And what version of Select2?
|
46 |
+
- Are you using Select2 with other plugins?
|
47 |
+
|
48 |
+
All of these questions will help people fix and identify any potential bugs.
|
49 |
+
|
50 |
+
Requesting features in Select2
|
51 |
+
------------------------------
|
52 |
+
Select2 is a large library that carries with it a lot of functionality. Because
|
53 |
+
of this, many feature requests will not be implemented in the core library.
|
54 |
+
|
55 |
+
Before starting work on a major feature for Select2, **contact the
|
56 |
+
[community][community] first** or you may risk spending a considerable amount of
|
57 |
+
time on something which the project developers are not interested in bringing
|
58 |
+
into the project.
|
59 |
+
|
60 |
+
### Select2 4.0
|
61 |
+
|
62 |
+
Many feature requests will be closed off until 4.0, where Select2 plans to adopt
|
63 |
+
a more flexible API. If you are interested in helping with the development of
|
64 |
+
the next major Select2 release, please send a message to the
|
65 |
+
[mailing list][mailing-list] or [irc channel][irc-channel] for more information.
|
66 |
+
|
67 |
+
Triaging issues and pull requests
|
68 |
+
---------------------------------
|
69 |
+
Anyone can help the project maintainers triage issues and review pull requests.
|
70 |
+
|
71 |
+
### Handling new issues
|
72 |
+
|
73 |
+
Select2 regularly receives new issues which need to be tested and organized.
|
74 |
+
|
75 |
+
When a new issue that comes in that is similar to another existing issue, it
|
76 |
+
should be checked to make sure it is not a duplicate. Duplicates issues should
|
77 |
+
be marked by replying to the issue with "Duplicate of #[issue number]" where
|
78 |
+
`[issue number]` is the url or issue number for the existing issue. This will
|
79 |
+
allow the project maintainers to quickly close off additional issues and keep
|
80 |
+
the discussion focused within a single issue.
|
81 |
+
|
82 |
+
If you can test issues that are reported to Select2 that contain test cases and
|
83 |
+
confirm under what conditions bugs happen, that will allow others to identify
|
84 |
+
what causes a bug quicker.
|
85 |
+
|
86 |
+
### Reviewing pull requests
|
87 |
+
|
88 |
+
It is very common for pull requests to be opened for issues that contain a clear
|
89 |
+
solution to the problem. These pull requests should be rigorously reviewed by
|
90 |
+
the community before being accepted. If you are not sure about a piece of
|
91 |
+
submitted code, or know of a better way to do something, do not hesitate to make
|
92 |
+
a comment on the pull request.
|
93 |
+
|
94 |
+
It should also be made clear that **all code contributed to Select** must be
|
95 |
+
licensable under the [Apache 2 or GPL 2 licenses][licensing]. Code that cannot
|
96 |
+
be released under either of these licenses **cannot be accepted** into the
|
97 |
+
project.
|
98 |
+
|
99 |
+
[community]: https://github.com/ivaynberg/select2#community
|
100 |
+
[reporting-bugs]: #reporting-bugs-with-select2
|
101 |
+
[requesting-features]: #requesting-features-in-select2
|
102 |
+
[issue-tracker]: https://github.com/ivaynberg/select2/issues
|
103 |
+
[mailing-list]: https://github.com/ivaynberg/select2#mailing-list
|
104 |
+
[irc-channel]: https://github.com/ivaynberg/select2#irc-channel
|
105 |
+
[issue-search]: https://github.com/ivaynberg/select2/search?q=&type=Issues
|
106 |
+
[isolated-case]: http://css-tricks.com/6263-reduced-test-cases/
|
107 |
+
[licensing]: https://github.com/ivaynberg/select2#copyright-and-license
|
assets/deps/select2-3.5.2/LICENSE
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
Copyright 2014 Igor Vaynberg
|
2 |
-
|
3 |
-
Version: @@ver@@ Timestamp: @@timestamp@@
|
4 |
-
|
5 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
6 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
7 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
8 |
-
License or the GPL License.
|
9 |
-
|
10 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
11 |
-
|
12 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
13 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
14 |
-
|
15 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
16 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
17 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
18 |
-
permissions and limitations under the Apache License and the GPL License.
|
1 |
+
Copyright 2014 Igor Vaynberg
|
2 |
+
|
3 |
+
Version: @@ver@@ Timestamp: @@timestamp@@
|
4 |
+
|
5 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
6 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
7 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
8 |
+
License or the GPL License.
|
9 |
+
|
10 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
11 |
+
|
12 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
13 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
14 |
+
|
15 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
16 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
17 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
18 |
+
permissions and limitations under the Apache License and the GPL License.
|
assets/deps/select2-3.5.2/README.md
CHANGED
@@ -1,114 +1,114 @@
|
|
1 |
-
Select2
|
2 |
-
=======
|
3 |
-
|
4 |
-
Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
|
5 |
-
|
6 |
-
To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
|
7 |
-
|
8 |
-
Use cases
|
9 |
-
---------
|
10 |
-
|
11 |
-
* Enhancing native selects with search.
|
12 |
-
* Enhancing native selects with a better multi-select interface.
|
13 |
-
* Loading data from JavaScript: easily load items via ajax and have them searchable.
|
14 |
-
* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
|
15 |
-
* Tagging: ability to add new items on the fly.
|
16 |
-
* Working with large, remote datasets: ability to partially load a dataset based on the search term.
|
17 |
-
* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
|
18 |
-
* Templating: support for custom rendering of results and selections.
|
19 |
-
|
20 |
-
Browser compatibility
|
21 |
-
---------------------
|
22 |
-
* IE 8+
|
23 |
-
* Chrome 8+
|
24 |
-
* Firefox 10+
|
25 |
-
* Safari 3+
|
26 |
-
* Opera 10.6+
|
27 |
-
|
28 |
-
Usage
|
29 |
-
-----
|
30 |
-
You can source Select2 directly from a CDN like [JSDliver](http://www.jsdelivr.com/#!select2) or [CDNJS](http://www.cdnjs.com/libraries/select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
|
31 |
-
|
32 |
-
Integrations
|
33 |
-
------------
|
34 |
-
|
35 |
-
* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
|
36 |
-
* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
|
37 |
-
* [AngularUI](http://angular-ui.github.io/#ui-select) ([AngularJS](https://angularjs.org/))
|
38 |
-
* [Django](https://github.com/applegrew/django-select2)
|
39 |
-
* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
|
40 |
-
* [Symfony2](https://github.com/avocode/FormExtensions)
|
41 |
-
* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
|
42 |
-
* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
|
43 |
-
* [Meteor](https://jquery-select2.meteor.com)
|
44 |
-
* [Yii 2.x](http://demos.krajee.com/widgets#select2)
|
45 |
-
* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
|
46 |
-
* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
|
47 |
-
|
48 |
-
### Example Integrations
|
49 |
-
|
50 |
-
* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
|
51 |
-
* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
|
52 |
-
* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
|
53 |
-
* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
|
54 |
-
|
55 |
-
Internationalization (i18n)
|
56 |
-
---------------------------
|
57 |
-
|
58 |
-
Select2 supports multiple languages by simply including the right language JS
|
59 |
-
file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
|
60 |
-
|
61 |
-
Missing a language? Just copy `select2_locale_en.js.template`, translate
|
62 |
-
it, and make a pull request back to Select2 here on GitHub.
|
63 |
-
|
64 |
-
Documentation
|
65 |
-
-------------
|
66 |
-
|
67 |
-
The documentation for Select2 is available [through GitHub Pages](https://ivaynberg.github.io/select2/) and is located within this repository in the [`gh-pages` branch](https://github.com/ivaynberg/select2/tree/gh-pages).
|
68 |
-
|
69 |
-
Community
|
70 |
-
---------
|
71 |
-
|
72 |
-
### Bug tracker
|
73 |
-
|
74 |
-
Have a bug? Please create an issue here on GitHub!
|
75 |
-
|
76 |
-
https://github.com/ivaynberg/select2/issues
|
77 |
-
|
78 |
-
### Mailing list
|
79 |
-
|
80 |
-
Have a question? Ask on our mailing list!
|
81 |
-
|
82 |
-
select2@googlegroups.com
|
83 |
-
|
84 |
-
https://groups.google.com/d/forum/select2
|
85 |
-
|
86 |
-
### IRC channel
|
87 |
-
|
88 |
-
Need help implementing Select2 in your project? Ask in our IRC channel!
|
89 |
-
|
90 |
-
**Network:** [Freenode](https://freenode.net/) (`chat.freenode.net`)
|
91 |
-
|
92 |
-
**Channel:** `#select2`
|
93 |
-
|
94 |
-
**Web access:** https://webchat.freenode.net/?channels=select2
|
95 |
-
|
96 |
-
Copyright and license
|
97 |
-
---------------------
|
98 |
-
|
99 |
-
Copyright 2012 Igor Vaynberg
|
100 |
-
|
101 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
102 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
103 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
104 |
-
License or the GPL License.
|
105 |
-
|
106 |
-
You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
|
107 |
-
|
108 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
109 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
110 |
-
|
111 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
112 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
113 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
114 |
-
permissions and limitations under the Apache License and the GPL License.
|
1 |
+
Select2
|
2 |
+
=======
|
3 |
+
|
4 |
+
Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
|
5 |
+
|
6 |
+
To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
|
7 |
+
|
8 |
+
Use cases
|
9 |
+
---------
|
10 |
+
|
11 |
+
* Enhancing native selects with search.
|
12 |
+
* Enhancing native selects with a better multi-select interface.
|
13 |
+
* Loading data from JavaScript: easily load items via ajax and have them searchable.
|
14 |
+
* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
|
15 |
+
* Tagging: ability to add new items on the fly.
|
16 |
+
* Working with large, remote datasets: ability to partially load a dataset based on the search term.
|
17 |
+
* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
|
18 |
+
* Templating: support for custom rendering of results and selections.
|
19 |
+
|
20 |
+
Browser compatibility
|
21 |
+
---------------------
|
22 |
+
* IE 8+
|
23 |
+
* Chrome 8+
|
24 |
+
* Firefox 10+
|
25 |
+
* Safari 3+
|
26 |
+
* Opera 10.6+
|
27 |
+
|
28 |
+
Usage
|
29 |
+
-----
|
30 |
+
You can source Select2 directly from a CDN like [JSDliver](http://www.jsdelivr.com/#!select2) or [CDNJS](http://www.cdnjs.com/libraries/select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
|
31 |
+
|
32 |
+
Integrations
|
33 |
+
------------
|
34 |
+
|
35 |
+
* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
|
36 |
+
* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
|
37 |
+
* [AngularUI](http://angular-ui.github.io/#ui-select) ([AngularJS](https://angularjs.org/))
|
38 |
+
* [Django](https://github.com/applegrew/django-select2)
|
39 |
+
* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
|
40 |
+
* [Symfony2](https://github.com/avocode/FormExtensions)
|
41 |
+
* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
|
42 |
+
* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
|
43 |
+
* [Meteor](https://jquery-select2.meteor.com)
|
44 |
+
* [Yii 2.x](http://demos.krajee.com/widgets#select2)
|
45 |
+
* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
|
46 |
+
* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
|
47 |
+
|
48 |
+
### Example Integrations
|
49 |
+
|
50 |
+
* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
|
51 |
+
* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
|
52 |
+
* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
|
53 |
+
* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
|
54 |
+
|
55 |
+
Internationalization (i18n)
|
56 |
+
---------------------------
|
57 |
+
|
58 |
+
Select2 supports multiple languages by simply including the right language JS
|
59 |
+
file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
|
60 |
+
|
61 |
+
Missing a language? Just copy `select2_locale_en.js.template`, translate
|
62 |
+
it, and make a pull request back to Select2 here on GitHub.
|
63 |
+
|
64 |
+
Documentation
|
65 |
+
-------------
|
66 |
+
|
67 |
+
The documentation for Select2 is available [through GitHub Pages](https://ivaynberg.github.io/select2/) and is located within this repository in the [`gh-pages` branch](https://github.com/ivaynberg/select2/tree/gh-pages).
|
68 |
+
|
69 |
+
Community
|
70 |
+
---------
|
71 |
+
|
72 |
+
### Bug tracker
|
73 |
+
|
74 |
+
Have a bug? Please create an issue here on GitHub!
|
75 |
+
|
76 |
+
https://github.com/ivaynberg/select2/issues
|
77 |
+
|
78 |
+
### Mailing list
|
79 |
+
|
80 |
+
Have a question? Ask on our mailing list!
|
81 |
+
|
82 |
+
select2@googlegroups.com
|
83 |
+
|
84 |
+
https://groups.google.com/d/forum/select2
|
85 |
+
|
86 |
+
### IRC channel
|
87 |
+
|
88 |
+
Need help implementing Select2 in your project? Ask in our IRC channel!
|
89 |
+
|
90 |
+
**Network:** [Freenode](https://freenode.net/) (`chat.freenode.net`)
|
91 |
+
|
92 |
+
**Channel:** `#select2`
|
93 |
+
|
94 |
+
**Web access:** https://webchat.freenode.net/?channels=select2
|
95 |
+
|
96 |
+
Copyright and license
|
97 |
+
---------------------
|
98 |
+
|
99 |
+
Copyright 2012 Igor Vaynberg
|
100 |
+
|
101 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
102 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
103 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
104 |
+
License or the GPL License.
|
105 |
+
|
106 |
+
You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
|
107 |
+
|
108 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
109 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
110 |
+
|
111 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
112 |
+
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
113 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
114 |
+
permissions and limitations under the Apache License and the GPL License.
|
assets/deps/select2-3.5.2/bower.json
CHANGED
@@ -1,8 +1,8 @@
|
|
1 |
-
{
|
2 |
-
"name": "select2",
|
3 |
-
"version": "3.5.2",
|
4 |
-
"main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
|
5 |
-
"dependencies": {
|
6 |
-
"jquery": ">= 1.7.1"
|
7 |
-
}
|
8 |
-
}
|
1 |
+
{
|
2 |
+
"name": "select2",
|
3 |
+
"version": "3.5.2",
|
4 |
+
"main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
|
5 |
+
"dependencies": {
|
6 |
+
"jquery": ">= 1.7.1"
|
7 |
+
}
|
8 |
+
}
|
assets/deps/select2-3.5.2/component.json
CHANGED
@@ -1,66 +1,66 @@
|
|
1 |
-
{
|
2 |
-
"name": "select2",
|
3 |
-
"repo": "ivaynberg/select2",
|
4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
5 |
-
"version": "3.5.2",
|
6 |
-
"demo": "http://ivaynberg.github.io/select2/",
|
7 |
-
"keywords": [
|
8 |
-
"jquery"
|
9 |
-
],
|
10 |
-
"main": "select2.js",
|
11 |
-
"styles": [
|
12 |
-
"select2.css",
|
13 |
-
"select2-bootstrap.css"
|
14 |
-
],
|
15 |
-
"scripts": [
|
16 |
-
"select2.js",
|
17 |
-
"select2_locale_ar.js",
|
18 |
-
"select2_locale_bg.js",
|
19 |
-
"select2_locale_ca.js",
|
20 |
-
"select2_locale_cs.js",
|
21 |
-
"select2_locale_da.js",
|
22 |
-
"select2_locale_de.js",
|
23 |
-
"select2_locale_el.js",
|
24 |
-
"select2_locale_es.js",
|
25 |
-
"select2_locale_et.js",
|
26 |
-
"select2_locale_eu.js",
|
27 |
-
"select2_locale_fa.js",
|
28 |
-
"select2_locale_fi.js",
|
29 |
-
"select2_locale_fr.js",
|
30 |
-
"select2_locale_gl.js",
|
31 |
-
"select2_locale_he.js",
|
32 |
-
"select2_locale_hr.js",
|
33 |
-
"select2_locale_hu.js",
|
34 |
-
"select2_locale_id.js",
|
35 |
-
"select2_locale_is.js",
|
36 |
-
"select2_locale_it.js",
|
37 |
-
"select2_locale_ja.js",
|
38 |
-
"select2_locale_ka.js",
|
39 |
-
"select2_locale_ko.js",
|
40 |
-
"select2_locale_lt.js",
|
41 |
-
"select2_locale_lv.js",
|
42 |
-
"select2_locale_mk.js",
|
43 |
-
"select2_locale_ms.js",
|
44 |
-
"select2_locale_nl.js",
|
45 |
-
"select2_locale_no.js",
|
46 |
-
"select2_locale_pl.js",
|
47 |
-
"select2_locale_pt-BR.js",
|
48 |
-
"select2_locale_pt-PT.js",
|
49 |
-
"select2_locale_ro.js",
|
50 |
-
"select2_locale_ru.js",
|
51 |
-
"select2_locale_sk.js",
|
52 |
-
"select2_locale_sv.js",
|
53 |
-
"select2_locale_th.js",
|
54 |
-
"select2_locale_tr.js",
|
55 |
-
"select2_locale_uk.js",
|
56 |
-
"select2_locale_vi.js",
|
57 |
-
"select2_locale_zh-CN.js",
|
58 |
-
"select2_locale_zh-TW.js"
|
59 |
-
],
|
60 |
-
"images": [
|
61 |
-
"select2-spinner.gif",
|
62 |
-
"select2.png",
|
63 |
-
"select2x2.png"
|
64 |
-
],
|
65 |
-
"license": "MIT"
|
66 |
-
}
|
1 |
+
{
|
2 |
+
"name": "select2",
|
3 |
+
"repo": "ivaynberg/select2",
|
4 |
+
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
5 |
+
"version": "3.5.2",
|
6 |
+
"demo": "http://ivaynberg.github.io/select2/",
|
7 |
+
"keywords": [
|
8 |
+
"jquery"
|
9 |
+
],
|
10 |
+
"main": "select2.js",
|
11 |
+
"styles": [
|
12 |
+
"select2.css",
|
13 |
+
"select2-bootstrap.css"
|
14 |
+
],
|
15 |
+
"scripts": [
|
16 |
+
"select2.js",
|
17 |
+
"select2_locale_ar.js",
|
18 |
+
"select2_locale_bg.js",
|
19 |
+
"select2_locale_ca.js",
|
20 |
+
"select2_locale_cs.js",
|
21 |
+
"select2_locale_da.js",
|
22 |
+
"select2_locale_de.js",
|
23 |
+
"select2_locale_el.js",
|
24 |
+
"select2_locale_es.js",
|
25 |
+
"select2_locale_et.js",
|
26 |
+
"select2_locale_eu.js",
|
27 |
+
"select2_locale_fa.js",
|
28 |
+
"select2_locale_fi.js",
|
29 |
+
"select2_locale_fr.js",
|
30 |
+
"select2_locale_gl.js",
|
31 |
+
"select2_locale_he.js",
|
32 |
+
"select2_locale_hr.js",
|
33 |
+
"select2_locale_hu.js",
|
34 |
+
"select2_locale_id.js",
|
35 |
+
"select2_locale_is.js",
|
36 |
+
"select2_locale_it.js",
|
37 |
+
"select2_locale_ja.js",
|
38 |
+
"select2_locale_ka.js",
|
39 |
+
"select2_locale_ko.js",
|
40 |
+
"select2_locale_lt.js",
|
41 |
+
"select2_locale_lv.js",
|
42 |
+
"select2_locale_mk.js",
|
43 |
+
"select2_locale_ms.js",
|
44 |
+
"select2_locale_nl.js",
|
45 |
+
"select2_locale_no.js",
|
46 |
+
"select2_locale_pl.js",
|
47 |
+
"select2_locale_pt-BR.js",
|
48 |
+
"select2_locale_pt-PT.js",
|
49 |
+
"select2_locale_ro.js",
|
50 |
+
"select2_locale_ru.js",
|
51 |
+
"select2_locale_sk.js",
|
52 |
+
"select2_locale_sv.js",
|
53 |
+
"select2_locale_th.js",
|
54 |
+
"select2_locale_tr.js",
|
55 |
+
"select2_locale_uk.js",
|
56 |
+
"select2_locale_vi.js",
|
57 |
+
"select2_locale_zh-CN.js",
|
58 |
+
"select2_locale_zh-TW.js"
|
59 |
+
],
|
60 |
+
"images": [
|
61 |
+
"select2-spinner.gif",
|
62 |
+
"select2.png",
|
63 |
+
"select2x2.png"
|
64 |
+
],
|
65 |
+
"license": "MIT"
|
66 |
+
}
|
assets/deps/select2-3.5.2/composer.json
CHANGED
@@ -1,29 +1,29 @@
|
|
1 |
-
{
|
2 |
-
"name":
|
3 |
-
"ivaynberg/select2",
|
4 |
-
"description": "Select2 is a jQuery based replacement for select boxes.",
|
5 |
-
"version": "3.5.2",
|
6 |
-
"type": "component",
|
7 |
-
"homepage": "http://ivaynberg.github.io/select2/",
|
8 |
-
"license": "Apache-2.0",
|
9 |
-
"require": {
|
10 |
-
"robloach/component-installer": "*",
|
11 |
-
"components/jquery": ">=1.7.1"
|
12 |
-
},
|
13 |
-
"extra": {
|
14 |
-
"component": {
|
15 |
-
"scripts": [
|
16 |
-
"select2.js"
|
17 |
-
],
|
18 |
-
"files": [
|
19 |
-
"select2.js",
|
20 |
-
"select2_locale_*.js",
|
21 |
-
"select2.css",
|
22 |
-
"select2-bootstrap.css",
|
23 |
-
"select2-spinner.gif",
|
24 |
-
"select2.png",
|
25 |
-
"select2x2.png"
|
26 |
-
]
|
27 |
-
}
|
28 |
-
}
|
29 |
-
}
|
1 |
+
{
|
2 |
+
"name":
|
3 |
+
"ivaynberg/select2",
|
4 |
+
"description": "Select2 is a jQuery based replacement for select boxes.",
|
5 |
+
"version": "3.5.2",
|
6 |
+
"type": "component",
|
7 |
+
"homepage": "http://ivaynberg.github.io/select2/",
|
8 |
+
"license": "Apache-2.0",
|
9 |
+
"require": {
|
10 |
+
"robloach/component-installer": "*",
|
11 |
+
"components/jquery": ">=1.7.1"
|
12 |
+
},
|
13 |
+
"extra": {
|
14 |
+
"component": {
|
15 |
+
"scripts": [
|
16 |
+
"select2.js"
|
17 |
+
],
|
18 |
+
"files": [
|
19 |
+
"select2.js",
|
20 |
+
"select2_locale_*.js",
|
21 |
+
"select2.css",
|
22 |
+
"select2-bootstrap.css",
|
23 |
+
"select2-spinner.gif",
|
24 |
+
"select2.png",
|
25 |
+
"select2x2.png"
|
26 |
+
]
|
27 |
+
}
|
28 |
+
}
|
29 |
+
}
|
assets/deps/select2-3.5.2/package.json
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
{
|
2 |
-
"name" : "Select2",
|
3 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
4 |
-
"homepage": "http://ivaynberg.github.io/select2",
|
5 |
-
"author": "Igor Vaynberg",
|
6 |
-
"repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
|
7 |
-
"main": "select2.js",
|
8 |
-
"version": "3.5.2",
|
9 |
-
"jspm": {
|
10 |
-
"main": "select2",
|
11 |
-
"files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
|
12 |
-
"shim": {
|
13 |
-
"select2": {
|
14 |
-
"imports": ["jquery", "./select2.css!"],
|
15 |
-
"exports": "$"
|
16 |
-
}
|
17 |
-
},
|
18 |
-
"buildConfig": { "uglify": true }
|
19 |
-
}
|
20 |
-
}
|
1 |
+
{
|
2 |
+
"name" : "Select2",
|
3 |
+
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
4 |
+
"homepage": "http://ivaynberg.github.io/select2",
|
5 |
+
"author": "Igor Vaynberg",
|
6 |
+
"repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
|
7 |
+
"main": "select2.js",
|
8 |
+
"version": "3.5.2",
|
9 |
+
"jspm": {
|
10 |
+
"main": "select2",
|
11 |
+
"files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
|
12 |
+
"shim": {
|
13 |
+
"select2": {
|
14 |
+
"imports": ["jquery", "./select2.css!"],
|
15 |
+
"exports": "$"
|
16 |
+
}
|
17 |
+
},
|
18 |
+
"buildConfig": { "uglify": true }
|
19 |
+
}
|
20 |
+
}
|
assets/deps/select2-3.5.2/release.sh
CHANGED
@@ -1,79 +1,79 @@
|
|
1 |
-
#!/bin/bash
|
2 |
-
set -e
|
3 |
-
|
4 |
-
echo -n "Enter the version for this release: "
|
5 |
-
|
6 |
-
read ver
|
7 |
-
|
8 |
-
if [ ! $ver ]; then
|
9 |
-
echo "Invalid version."
|
10 |
-
exit
|
11 |
-
fi
|
12 |
-
|
13 |
-
name="select2"
|
14 |
-
js="$name.js"
|
15 |
-
mini="$name.min.js"
|
16 |
-
css="$name.css"
|
17 |
-
release="$name-$ver"
|
18 |
-
tag="$ver"
|
19 |
-
branch="build-$ver"
|
20 |
-
curbranch=`git branch | grep "*" | sed "s/* //"`
|
21 |
-
timestamp=$(date)
|
22 |
-
tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
|
23 |
-
remote="origin"
|
24 |
-
|
25 |
-
echo "Pulling from origin"
|
26 |
-
|
27 |
-
git pull
|
28 |
-
|
29 |
-
echo "Updating Version Identifiers"
|
30 |
-
|
31 |
-
sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
|
32 |
-
|
33 |
-
git add bower.json
|
34 |
-
git add select2.jquery.json
|
35 |
-
git add component.json
|
36 |
-
git add composer.json
|
37 |
-
git add package.json
|
38 |
-
|
39 |
-
git commit -m "modified version identifiers in descriptors for release $ver"
|
40 |
-
git push
|
41 |
-
|
42 |
-
git branch "$branch"
|
43 |
-
git checkout "$branch"
|
44 |
-
|
45 |
-
echo "Tokenizing..."
|
46 |
-
|
47 |
-
find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
|
48 |
-
find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
|
49 |
-
|
50 |
-
sed -e "s/latest/$ver/g" -i -- bower.json
|
51 |
-
|
52 |
-
git add "$js"
|
53 |
-
git add "$css"
|
54 |
-
|
55 |
-
echo "Minifying..."
|
56 |
-
|
57 |
-
echo "/*" > "$mini"
|
58 |
-
cat LICENSE | sed "$tokens" >> "$mini"
|
59 |
-
echo "*/" >> "$mini"
|
60 |
-
|
61 |
-
curl -s \
|
62 |
-
--data-urlencode "js_code@$js" \
|
63 |
-
http://marijnhaverbeke.nl/uglifyjs \
|
64 |
-
>> "$mini"
|
65 |
-
|
66 |
-
git add "$mini"
|
67 |
-
|
68 |
-
git commit -m "release $ver"
|
69 |
-
|
70 |
-
echo "Tagging..."
|
71 |
-
git tag -a "$tag" -m "tagged version $ver"
|
72 |
-
git push "$remote" --tags
|
73 |
-
|
74 |
-
echo "Cleaning Up..."
|
75 |
-
|
76 |
-
git checkout "$curbranch"
|
77 |
-
git branch -D "$branch"
|
78 |
-
|
79 |
-
echo "Done"
|
1 |
+
#!/bin/bash
|
2 |
+
set -e
|
3 |
+
|
4 |
+
echo -n "Enter the version for this release: "
|
5 |
+
|
6 |
+
read ver
|
7 |
+
|
8 |
+
if [ ! $ver ]; then
|
9 |
+
echo "Invalid version."
|
10 |
+
exit
|
11 |
+
fi
|
12 |
+
|
13 |
+
name="select2"
|
14 |
+
js="$name.js"
|
15 |
+
mini="$name.min.js"
|
16 |
+
css="$name.css"
|
17 |
+
release="$name-$ver"
|
18 |
+
tag="$ver"
|
19 |
+
branch="build-$ver"
|
20 |
+
curbranch=`git branch | grep "*" | sed "s/* //"`
|
21 |
+
timestamp=$(date)
|
22 |
+
tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
|
23 |
+
remote="origin"
|
24 |
+
|
25 |
+
echo "Pulling from origin"
|
26 |
+
|
27 |
+
git pull
|
28 |
+
|
29 |
+
echo "Updating Version Identifiers"
|
30 |
+
|
31 |
+
sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
|
32 |
+
|
33 |
+
git add bower.json
|
34 |
+
git add select2.jquery.json
|
35 |
+
git add component.json
|
36 |
+
git add composer.json
|
37 |
+
git add package.json
|
38 |
+
|
39 |
+
git commit -m "modified version identifiers in descriptors for release $ver"
|
40 |
+
git push
|
41 |
+
|
42 |
+
git branch "$branch"
|
43 |
+
git checkout "$branch"
|
44 |
+
|
45 |
+
echo "Tokenizing..."
|
46 |
+
|
47 |
+
find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
|
48 |
+
find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
|
49 |
+
|
50 |
+
sed -e "s/latest/$ver/g" -i -- bower.json
|
51 |
+
|
52 |
+
git add "$js"
|
53 |
+
git add "$css"
|
54 |
+
|
55 |
+
echo "Minifying..."
|
56 |
+
|
57 |
+
echo "/*" > "$mini"
|
58 |
+
cat LICENSE | sed "$tokens" >> "$mini"
|
59 |
+
echo "*/" >> "$mini"
|
60 |
+
|
61 |
+
curl -s \
|
62 |
+
--data-urlencode "js_code@$js" \
|
63 |
+
http://marijnhaverbeke.nl/uglifyjs \
|
64 |
+
>> "$mini"
|
65 |
+
|
66 |
+
git add "$mini"
|
67 |
+
|
68 |
+
git commit -m "release $ver"
|
69 |
+
|
70 |
+
echo "Tagging..."
|
71 |
+
git tag -a "$tag" -m "tagged version $ver"
|
72 |
+
git push "$remote" --tags
|
73 |
+
|
74 |
+
echo "Cleaning Up..."
|
75 |
+
|
76 |
+
git checkout "$curbranch"
|
77 |
+
git branch -D "$branch"
|
78 |
+
|
79 |
+
echo "Done"
|
assets/deps/select2-3.5.2/select2-bootstrap.css
CHANGED
@@ -1,87 +1,87 @@
|
|
1 |
-
.form-control .select2-choice {
|
2 |
-
border: 0;
|
3 |
-
border-radius: 2px;
|
4 |
-
}
|
5 |
-
|
6 |
-
.form-control .select2-choice .select2-arrow {
|
7 |
-
border-radius: 0 2px 2px 0;
|
8 |
-
}
|
9 |
-
|
10 |
-
.form-control.select2-container {
|
11 |
-
height: auto !important;
|
12 |
-
padding: 0;
|
13 |
-
}
|
14 |
-
|
15 |
-
.form-control.select2-container.select2-dropdown-open {
|
16 |
-
border-color: #5897FB;
|
17 |
-
border-radius: 3px 3px 0 0;
|
18 |
-
}
|
19 |
-
|
20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
21 |
-
border-radius: 3px 3px 0 0;
|
22 |
-
}
|
23 |
-
|
24 |
-
.form-control.select2-container .select2-choices {
|
25 |
-
border: 0 !important;
|
26 |
-
border-radius: 3px;
|
27 |
-
}
|
28 |
-
|
29 |
-
.control-group.warning .select2-container .select2-choice,
|
30 |
-
.control-group.warning .select2-container .select2-choices,
|
31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
36 |
-
border: 1px solid #C09853 !important;
|
37 |
-
}
|
38 |
-
|
39 |
-
.control-group.warning .select2-container .select2-choice div {
|
40 |
-
border-left: 1px solid #C09853 !important;
|
41 |
-
background: #FCF8E3 !important;
|
42 |
-
}
|
43 |
-
|
44 |
-
.control-group.error .select2-container .select2-choice,
|
45 |
-
.control-group.error .select2-container .select2-choices,
|
46 |
-
.control-group.error .select2-container-active .select2-choice,
|
47 |
-
.control-group.error .select2-container-active .select2-choices,
|
48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
51 |
-
border: 1px solid #B94A48 !important;
|
52 |
-
}
|
53 |
-
|
54 |
-
.control-group.error .select2-container .select2-choice div {
|
55 |
-
border-left: 1px solid #B94A48 !important;
|
56 |
-
background: #F2DEDE !important;
|
57 |
-
}
|
58 |
-
|
59 |
-
.control-group.info .select2-container .select2-choice,
|
60 |
-
.control-group.info .select2-container .select2-choices,
|
61 |
-
.control-group.info .select2-container-active .select2-choice,
|
62 |
-
.control-group.info .select2-container-active .select2-choices,
|
63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
66 |
-
border: 1px solid #3A87AD !important;
|
67 |
-
}
|
68 |
-
|
69 |
-
.control-group.info .select2-container .select2-choice div {
|
70 |
-
border-left: 1px solid #3A87AD !important;
|
71 |
-
background: #D9EDF7 !important;
|
72 |
-
}
|
73 |
-
|
74 |
-
.control-group.success .select2-container .select2-choice,
|
75 |
-
.control-group.success .select2-container .select2-choices,
|
76 |
-
.control-group.success .select2-container-active .select2-choice,
|
77 |
-
.control-group.success .select2-container-active .select2-choices,
|
78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
81 |
-
border: 1px solid #468847 !important;
|
82 |
-
}
|
83 |
-
|
84 |
-
.control-group.success .select2-container .select2-choice div {
|
85 |
-
border-left: 1px solid #468847 !important;
|
86 |
-
background: #DFF0D8 !important;
|
87 |
-
}
|
1 |
+
.form-control .select2-choice {
|
2 |
+
border: 0;
|
3 |
+
border-radius: 2px;
|
4 |
+
}
|
5 |
+
|
6 |
+
.form-control .select2-choice .select2-arrow {
|
7 |
+
border-radius: 0 2px 2px 0;
|
8 |
+
}
|
9 |
+
|
10 |
+
.form-control.select2-container {
|
11 |
+
height: auto !important;
|
12 |
+
padding: 0;
|
13 |
+
}
|
14 |
+
|
15 |
+
.form-control.select2-container.select2-dropdown-open {
|
16 |
+
border-color: #5897FB;
|
17 |
+
border-radius: 3px 3px 0 0;
|
18 |
+
}
|
19 |
+
|
20 |
+
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
21 |
+
border-radius: 3px 3px 0 0;
|
22 |
+
}
|
23 |
+
|
24 |
+
.form-control.select2-container .select2-choices {
|
25 |
+
border: 0 !important;
|
26 |
+
border-radius: 3px;
|
27 |
+
}
|
28 |
+
|
29 |
+
.control-group.warning .select2-container .select2-choice,
|
30 |
+
.control-group.warning .select2-container .select2-choices,
|
31 |
+
.control-group.warning .select2-container-active .select2-choice,
|
32 |
+
.control-group.warning .select2-container-active .select2-choices,
|
33 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
34 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
35 |
+
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
36 |
+
border: 1px solid #C09853 !important;
|
37 |
+
}
|
38 |
+
|
39 |
+
.control-group.warning .select2-container .select2-choice div {
|
40 |
+
border-left: 1px solid #C09853 !important;
|
41 |
+
background: #FCF8E3 !important;
|
42 |
+
}
|
43 |
+
|
44 |
+
.control-group.error .select2-container .select2-choice,
|
45 |
+
.control-group.error .select2-container .select2-choices,
|
46 |
+
.control-group.error .select2-container-active .select2-choice,
|
47 |
+
.control-group.error .select2-container-active .select2-choices,
|
48 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
49 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
50 |
+
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
51 |
+
border: 1px solid #B94A48 !important;
|
52 |
+
}
|
53 |
+
|
54 |
+
.control-group.error .select2-container .select2-choice div {
|
55 |
+
border-left: 1px solid #B94A48 !important;
|
56 |
+
background: #F2DEDE !important;
|
57 |
+
}
|
58 |
+
|
59 |
+
.control-group.info .select2-container .select2-choice,
|
60 |
+
.control-group.info .select2-container .select2-choices,
|
61 |
+
.control-group.info .select2-container-active .select2-choice,
|
62 |
+
.control-group.info .select2-container-active .select2-choices,
|
63 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
64 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
65 |
+
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
66 |
+
border: 1px solid #3A87AD !important;
|
67 |
+
}
|
68 |
+
|
69 |
+
.control-group.info .select2-container .select2-choice div {
|
70 |
+
border-left: 1px solid #3A87AD !important;
|
71 |
+
background: #D9EDF7 !important;
|
72 |
+
}
|
73 |
+
|
74 |
+
.control-group.success .select2-container .select2-choice,
|
75 |
+
.control-group.success .select2-container .select2-choices,
|
76 |
+
.control-group.success .select2-container-active .select2-choice,
|
77 |
+
.control-group.success .select2-container-active .select2-choices,
|
78 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
79 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
80 |
+
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
81 |
+
border: 1px solid #468847 !important;
|
82 |
+
}
|
83 |
+
|
84 |
+
.control-group.success .select2-container .select2-choice div {
|
85 |
+
border-left: 1px solid #468847 !important;
|
86 |
+
background: #DFF0D8 !important;
|
87 |
+
}
|
assets/deps/select2-3.5.2/select2.css
CHANGED
@@ -1,704 +1,704 @@
|
|
1 |
-
/*
|
2 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
3 |
-
*/
|
4 |
-
.select2-container {
|
5 |
-
margin: 0;
|
6 |
-
position: relative;
|
7 |
-
display: inline-block;
|
8 |
-
/* inline-block for ie7 */
|
9 |
-
zoom: 1;
|
10 |
-
*display: inline;
|
11 |
-
vertical-align: middle;
|
12 |
-
}
|
13 |
-
|
14 |
-
.select2-container,
|
15 |
-
.select2-drop,
|
16 |
-
.select2-search,
|
17 |
-
.select2-search input {
|
18 |
-
/*
|
19 |
-
Force border-box so that % widths fit the parent
|
20 |
-
container without overlap because of margin/padding.
|
21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
22 |
-
*/
|
23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
24 |
-
-moz-box-sizing: border-box; /* firefox */
|
25 |
-
box-sizing: border-box; /* css3 */
|
26 |
-
}
|
27 |
-
|
28 |
-
.select2-container .select2-choice {
|
29 |
-
display: block;
|
30 |
-
height: 26px;
|
31 |
-
padding: 0 0 0 8px;
|
32 |
-
overflow: hidden;
|
33 |
-
position: relative;
|
34 |
-
|
35 |
-
border: 1px solid #aaa;
|
36 |
-
white-space: nowrap;
|
37 |
-
line-height: 26px;
|
38 |
-
color: #444;
|
39 |
-
text-decoration: none;
|
40 |
-
|
41 |
-
border-radius: 4px;
|
42 |
-
|
43 |
-
background-clip: padding-box;
|
44 |
-
|
45 |
-
-webkit-touch-callout: none;
|
46 |
-
-webkit-user-select: none;
|
47 |
-
-moz-user-select: none;
|
48 |
-
-ms-user-select: none;
|
49 |
-
user-select: none;
|
50 |
-
|
51 |
-
background-color: #fff;
|
52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
57 |
-
}
|
58 |
-
|
59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
60 |
-
padding: 0 8px 0 0;
|
61 |
-
}
|
62 |
-
|
63 |
-
.select2-container.select2-drop-above .select2-choice {
|
64 |
-
border-bottom-color: #aaa;
|
65 |
-
|
66 |
-
border-radius: 0 0 4px 4px;
|
67 |
-
|
68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
73 |
-
}
|
74 |
-
|
75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
76 |
-
margin-right: 42px;
|
77 |
-
}
|
78 |
-
|
79 |
-
.select2-container .select2-choice > .select2-chosen {
|
80 |
-
margin-right: 26px;
|
81 |
-
display: block;
|
82 |
-
overflow: hidden;
|
83 |
-
|
84 |
-
white-space: nowrap;
|
85 |
-
|
86 |
-
text-overflow: ellipsis;
|
87 |
-
float: none;
|
88 |
-
width: auto;
|
89 |
-
}
|
90 |
-
|
91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
92 |
-
margin-left: 26px;
|
93 |
-
margin-right: 0;
|
94 |
-
}
|
95 |
-
|
96 |
-
.select2-container .select2-choice abbr {
|
97 |
-
display: none;
|
98 |
-
width: 12px;
|
99 |
-
height: 12px;
|
100 |
-
position: absolute;
|
101 |
-
right: 24px;
|
102 |
-
top: 8px;
|
103 |
-
|
104 |
-
font-size: 1px;
|
105 |
-
text-decoration: none;
|
106 |
-
|
107 |
-
border: 0;
|
108 |
-
background: url('select2.png') right top no-repeat;
|
109 |
-
cursor: pointer;
|
110 |
-
outline: 0;
|
111 |
-
}
|
112 |
-
|
113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
114 |
-
display: inline-block;
|
115 |
-
}
|
116 |
-
|
117 |
-
.select2-container .select2-choice abbr:hover {
|
118 |
-
background-position: right -11px;
|
119 |
-
cursor: pointer;
|
120 |
-
}
|
121 |
-
|
122 |
-
.select2-drop-mask {
|
123 |
-
border: 0;
|
124 |
-
margin: 0;
|
125 |
-
padding: 0;
|
126 |
-
position: fixed;
|
127 |
-
left: 0;
|
128 |
-
top: 0;
|
129 |
-
min-height: 100%;
|
130 |
-
min-width: 100%;
|
131 |
-
height: auto;
|
132 |
-
width: auto;
|
133 |
-
opacity: 0;
|
134 |
-
z-index: 9998;
|
135 |
-
/* styles required for IE to work */
|
136 |
-
background-color: #fff;
|
137 |
-
filter: alpha(opacity=0);
|
138 |
-
}
|
139 |
-
|
140 |
-
.select2-drop {
|
141 |
-
width: 100%;
|
142 |
-
margin-top: -1px;
|
143 |
-
position: absolute;
|
144 |
-
z-index: 9999;
|
145 |
-
top: 100%;
|
146 |
-
|
147 |
-
background: #fff;
|
148 |
-
color: #000;
|
149 |
-
border: 1px solid #aaa;
|
150 |
-
border-top: 0;
|
151 |
-
|
152 |
-
border-radius: 0 0 4px 4px;
|
153 |
-
|
154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
156 |
-
}
|
157 |
-
|
158 |
-
.select2-drop.select2-drop-above {
|
159 |
-
margin-top: 1px;
|
160 |
-
border-top: 1px solid #aaa;
|
161 |
-
border-bottom: 0;
|
162 |
-
|
163 |
-
border-radius: 4px 4px 0 0;
|
164 |
-
|
165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
167 |
-
}
|
168 |
-
|
169 |
-
.select2-drop-active {
|
170 |
-
border: 1px solid #5897fb;
|
171 |
-
border-top: none;
|
172 |
-
}
|
173 |
-
|
174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
175 |
-
border-top: 1px solid #5897fb;
|
176 |
-
}
|
177 |
-
|
178 |
-
.select2-drop-auto-width {
|
179 |
-
border-top: 1px solid #aaa;
|
180 |
-
width: auto;
|
181 |
-
}
|
182 |
-
|
183 |
-
.select2-drop-auto-width .select2-search {
|
184 |
-
padding-top: 4px;
|
185 |
-
}
|
186 |
-
|
187 |
-
.select2-container .select2-choice .select2-arrow {
|
188 |
-
display: inline-block;
|
189 |
-
width: 18px;
|
190 |
-
height: 100%;
|
191 |
-
position: absolute;
|
192 |
-
right: 0;
|
193 |
-
top: 0;
|
194 |
-
|
195 |
-
border-left: 1px solid #aaa;
|
196 |
-
border-radius: 0 4px 4px 0;
|
197 |
-
|
198 |
-
background-clip: padding-box;
|
199 |
-
|
200 |
-
background: #ccc;
|
201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
206 |
-
}
|
207 |
-
|
208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
209 |
-
left: 0;
|
210 |
-
right: auto;
|
211 |
-
|
212 |
-
border-left: none;
|
213 |
-
border-right: 1px solid #aaa;
|
214 |
-
border-radius: 4px 0 0 4px;
|
215 |
-
}
|
216 |
-
|
217 |
-
.select2-container .select2-choice .select2-arrow b {
|
218 |
-
display: block;
|
219 |
-
width: 100%;
|
220 |
-
height: 100%;
|
221 |
-
background: url('select2.png') no-repeat 0 1px;
|
222 |
-
}
|
223 |
-
|
224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
225 |
-
background-position: 2px 1px;
|
226 |
-
}
|
227 |
-
|
228 |
-
.select2-search {
|
229 |
-
display: inline-block;
|
230 |
-
width: 100%;
|
231 |
-
min-height: 26px;
|
232 |
-
margin: 0;
|
233 |
-
padding-left: 4px;
|
234 |
-
padding-right: 4px;
|
235 |
-
|
236 |
-
position: relative;
|
237 |
-
z-index: 10000;
|
238 |
-
|
239 |
-
white-space: nowrap;
|
240 |
-
}
|
241 |
-
|
242 |
-
.select2-search input {
|
243 |
-
width: 100%;
|
244 |
-
height: auto !important;
|
245 |
-
min-height: 26px;
|
246 |
-
padding: 4px 20px 4px 5px;
|
247 |
-
margin: 0;
|
248 |
-
|
249 |
-
outline: 0;
|
250 |
-
font-family: sans-serif;
|
251 |
-
font-size: 1em;
|
252 |
-
|
253 |
-
border: 1px solid #aaa;
|
254 |
-
border-radius: 0;
|
255 |
-
|
256 |
-
-webkit-box-shadow: none;
|
257 |
-
box-shadow: none;
|
258 |
-
|
259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
264 |
-
}
|
265 |
-
|
266 |
-
html[dir="rtl"] .select2-search input {
|
267 |
-
padding: 4px 5px 4px 20px;
|
268 |
-
|
269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
-
}
|
275 |
-
|
276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
277 |
-
margin-top: 4px;
|
278 |
-
}
|
279 |
-
|
280 |
-
.select2-search input.select2-active {
|
281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
286 |
-
}
|
287 |
-
|
288 |
-
.select2-container-active .select2-choice,
|
289 |
-
.select2-container-active .select2-choices {
|
290 |
-
border: 1px solid #5897fb;
|
291 |
-
outline: none;
|
292 |
-
|
293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
295 |
-
}
|
296 |
-
|
297 |
-
.select2-dropdown-open .select2-choice {
|
298 |
-
border-bottom-color: transparent;
|
299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
300 |
-
box-shadow: 0 1px 0 #fff inset;
|
301 |
-
|
302 |
-
border-bottom-left-radius: 0;
|
303 |
-
border-bottom-right-radius: 0;
|
304 |
-
|
305 |
-
background-color: #eee;
|
306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
311 |
-
}
|
312 |
-
|
313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
315 |
-
border: 1px solid #5897fb;
|
316 |
-
border-top-color: transparent;
|
317 |
-
|
318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
323 |
-
}
|
324 |
-
|
325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
326 |
-
background: transparent;
|
327 |
-
border-left: none;
|
328 |
-
filter: none;
|
329 |
-
}
|
330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
331 |
-
border-right: none;
|
332 |
-
}
|
333 |
-
|
334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
335 |
-
background-position: -18px 1px;
|
336 |
-
}
|
337 |
-
|
338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
339 |
-
background-position: -16px 1px;
|
340 |
-
}
|
341 |
-
|
342 |
-
.select2-hidden-accessible {
|
343 |
-
border: 0;
|
344 |
-
clip: rect(0 0 0 0);
|
345 |
-
height: 1px;
|
346 |
-
margin: -1px;
|
347 |
-
overflow: hidden;
|
348 |
-
padding: 0;
|
349 |
-
position: absolute;
|
350 |
-
width: 1px;
|
351 |
-
}
|
352 |
-
|
353 |
-
/* results */
|
354 |
-
.select2-results {
|
355 |
-
max-height: 200px;
|
356 |
-
padding: 0 0 0 4px;
|
357 |
-
margin: 4px 4px 4px 0;
|
358 |
-
position: relative;
|
359 |
-
overflow-x: hidden;
|
360 |
-
overflow-y: auto;
|
361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
362 |
-
}
|
363 |
-
|
364 |
-
html[dir="rtl"] .select2-results {
|
365 |
-
padding: 0 4px 0 0;
|
366 |
-
margin: 4px 0 4px 4px;
|
367 |
-
}
|
368 |
-
|
369 |
-
.select2-results ul.select2-result-sub {
|
370 |
-
margin: 0;
|
371 |
-
padding-left: 0;
|
372 |
-
}
|
373 |
-
|
374 |
-
.select2-results li {
|
375 |
-
list-style: none;
|
376 |
-
display: list-item;
|
377 |
-
background-image: none;
|
378 |
-
}
|
379 |
-
|
380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
381 |
-
font-weight: bold;
|
382 |
-
}
|
383 |
-
|
384 |
-
.select2-results .select2-result-label {
|
385 |
-
padding: 3px 7px 4px;
|
386 |
-
margin: 0;
|
387 |
-
cursor: pointer;
|
388 |
-
|
389 |
-
min-height: 1em;
|
390 |
-
|
391 |
-
-webkit-touch-callout: none;
|
392 |
-
-webkit-user-select: none;
|
393 |
-
-moz-user-select: none;
|
394 |
-
-ms-user-select: none;
|
395 |
-
user-select: none;
|
396 |
-
}
|
397 |
-
|
398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
405 |
-
|
406 |
-
.select2-results .select2-highlighted {
|
407 |
-
background: #3875d7;
|
408 |
-
color: #fff;
|
409 |
-
}
|
410 |
-
|
411 |
-
.select2-results li em {
|
412 |
-
background: #feffde;
|
413 |
-
font-style: normal;
|
414 |
-
}
|
415 |
-
|
416 |
-
.select2-results .select2-highlighted em {
|
417 |
-
background: transparent;
|
418 |
-
}
|
419 |
-
|
420 |
-
.select2-results .select2-highlighted ul {
|
421 |
-
background: #fff;
|
422 |
-
color: #000;
|
423 |
-
}
|
424 |
-
|
425 |
-
.select2-results .select2-no-results,
|
426 |
-
.select2-results .select2-searching,
|
427 |
-
.select2-results .select2-ajax-error,
|
428 |
-
.select2-results .select2-selection-limit {
|
429 |
-
background: #f4f4f4;
|
430 |
-
display: list-item;
|
431 |
-
padding-left: 5px;
|
432 |
-
}
|
433 |
-
|
434 |
-
/*
|
435 |
-
disabled look for disabled choices in the results dropdown
|
436 |
-
*/
|
437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
438 |
-
color: #666;
|
439 |
-
background: #f4f4f4;
|
440 |
-
display: list-item;
|
441 |
-
cursor: default;
|
442 |
-
}
|
443 |
-
.select2-results .select2-disabled {
|
444 |
-
background: #f4f4f4;
|
445 |
-
display: list-item;
|
446 |
-
cursor: default;
|
447 |
-
}
|
448 |
-
|
449 |
-
.select2-results .select2-selected {
|
450 |
-
display: none;
|
451 |
-
}
|
452 |
-
|
453 |
-
.select2-more-results.select2-active {
|
454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
455 |
-
}
|
456 |
-
|
457 |
-
.select2-results .select2-ajax-error {
|
458 |
-
background: rgba(255, 50, 50, .2);
|
459 |
-
}
|
460 |
-
|
461 |
-
.select2-more-results {
|
462 |
-
background: #f4f4f4;
|
463 |
-
display: list-item;
|
464 |
-
}
|
465 |
-
|
466 |
-
/* disabled styles */
|
467 |
-
|
468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
469 |
-
background-color: #f4f4f4;
|
470 |
-
background-image: none;
|
471 |
-
border: 1px solid #ddd;
|
472 |
-
cursor: default;
|
473 |
-
}
|
474 |
-
|
475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
476 |
-
background-color: #f4f4f4;
|
477 |
-
background-image: none;
|
478 |
-
border-left: 0;
|
479 |
-
}
|
480 |
-
|
481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
482 |
-
display: none;
|
483 |
-
}
|
484 |
-
|
485 |
-
|
486 |
-
/* multiselect */
|
487 |
-
|
488 |
-
.select2-container-multi .select2-choices {
|
489 |
-
height: auto !important;
|
490 |
-
height: 1%;
|
491 |
-
margin: 0;
|
492 |
-
padding: 0 5px 0 0;
|
493 |
-
position: relative;
|
494 |
-
|
495 |
-
border: 1px solid #aaa;
|
496 |
-
cursor: text;
|
497 |
-
overflow: hidden;
|
498 |
-
|
499 |
-
background-color: #fff;
|
500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
504 |
-
}
|
505 |
-
|
506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
507 |
-
padding: 0 0 0 5px;
|
508 |
-
}
|
509 |
-
|
510 |
-
.select2-locked {
|
511 |
-
padding: 3px 5px 3px 5px !important;
|
512 |
-
}
|
513 |
-
|
514 |
-
.select2-container-multi .select2-choices {
|
515 |
-
min-height: 26px;
|
516 |
-
}
|
517 |
-
|
518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
519 |
-
border: 1px solid #5897fb;
|
520 |
-
outline: none;
|
521 |
-
|
522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
524 |
-
}
|
525 |
-
.select2-container-multi .select2-choices li {
|
526 |
-
float: left;
|
527 |
-
list-style: none;
|
528 |
-
}
|
529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
530 |
-
{
|
531 |
-
float: right;
|
532 |
-
}
|
533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
534 |
-
margin: 0;
|
535 |
-
padding: 0;
|
536 |
-
white-space: nowrap;
|
537 |
-
}
|
538 |
-
|
539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
540 |
-
padding: 5px;
|
541 |
-
margin: 1px 0;
|
542 |
-
|
543 |
-
font-family: sans-serif;
|
544 |
-
font-size: 100%;
|
545 |
-
color: #666;
|
546 |
-
outline: 0;
|
547 |
-
border: 0;
|
548 |
-
-webkit-box-shadow: none;
|
549 |
-
box-shadow: none;
|
550 |
-
background: transparent !important;
|
551 |
-
}
|
552 |
-
|
553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
555 |
-
}
|
556 |
-
|
557 |
-
.select2-default {
|
558 |
-
color: #999 !important;
|
559 |
-
}
|
560 |
-
|
561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
562 |
-
padding: 3px 5px 3px 18px;
|
563 |
-
margin: 3px 0 3px 5px;
|
564 |
-
position: relative;
|
565 |
-
|
566 |
-
line-height: 13px;
|
567 |
-
color: #333;
|
568 |
-
cursor: default;
|
569 |
-
border: 1px solid #aaaaaa;
|
570 |
-
|
571 |
-
border-radius: 3px;
|
572 |
-
|
573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
575 |
-
|
576 |
-
background-clip: padding-box;
|
577 |
-
|
578 |
-
-webkit-touch-callout: none;
|
579 |
-
-webkit-user-select: none;
|
580 |
-
-moz-user-select: none;
|
581 |
-
-ms-user-select: none;
|
582 |
-
user-select: none;
|
583 |
-
|
584 |
-
background-color: #e4e4e4;
|
585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
589 |
-
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
590 |
-
}
|
591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
592 |
-
{
|
593 |
-
margin: 3px 5px 3px 0;
|
594 |
-
padding: 3px 18px 3px 5px;
|
595 |
-
}
|
596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
597 |
-
cursor: default;
|
598 |
-
}
|
599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
600 |
-
background: #d4d4d4;
|
601 |
-
}
|
602 |
-
|
603 |
-
.select2-search-choice-close {
|
604 |
-
display: block;
|
605 |
-
width: 12px;
|
606 |
-
height: 13px;
|
607 |
-
position: absolute;
|
608 |
-
right: 3px;
|
609 |
-
top: 4px;
|
610 |
-
|
611 |
-
font-size: 1px;
|
612 |
-
outline: none;
|
613 |
-
background: url('select2.png') right top no-repeat;
|
614 |
-
}
|
615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
616 |
-
right: auto;
|
617 |
-
left: 3px;
|
618 |
-
}
|
619 |
-
|
620 |
-
.select2-container-multi .select2-search-choice-close {
|
621 |
-
left: 3px;
|
622 |
-
}
|
623 |
-
|
624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
625 |
-
left: auto;
|
626 |
-
right: 2px;
|
627 |
-
}
|
628 |
-
|
629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
630 |
-
background-position: right -11px;
|
631 |
-
}
|
632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
633 |
-
background-position: right -11px;
|
634 |
-
}
|
635 |
-
|
636 |
-
/* disabled styles */
|
637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
638 |
-
background-color: #f4f4f4;
|
639 |
-
background-image: none;
|
640 |
-
border: 1px solid #ddd;
|
641 |
-
cursor: default;
|
642 |
-
}
|
643 |
-
|
644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
645 |
-
padding: 3px 5px 3px 5px;
|
646 |
-
border: 1px solid #ddd;
|
647 |
-
background-image: none;
|
648 |
-
background-color: #f4f4f4;
|
649 |
-
}
|
650 |
-
|
651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
652 |
-
background: none;
|
653 |
-
}
|
654 |
-
/* end multiselect */
|
655 |
-
|
656 |
-
|
657 |
-
.select2-result-selectable .select2-match,
|
658 |
-
.select2-result-unselectable .select2-match {
|
659 |
-
text-decoration: underline;
|
660 |
-
}
|
661 |
-
|
662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
663 |
-
clip: rect(0 0 0 0) !important;
|
664 |
-
width: 1px !important;
|
665 |
-
height: 1px !important;
|
666 |
-
border: 0 !important;
|
667 |
-
margin: 0 !important;
|
668 |
-
padding: 0 !important;
|
669 |
-
overflow: hidden !important;
|
670 |
-
position: absolute !important;
|
671 |
-
outline: 0 !important;
|
672 |
-
left: 0px !important;
|
673 |
-
top: 0px !important;
|
674 |
-
}
|
675 |
-
|
676 |
-
.select2-display-none {
|
677 |
-
display: none;
|
678 |
-
}
|
679 |
-
|
680 |
-
.select2-measure-scrollbar {
|
681 |
-
position: absolute;
|
682 |
-
top: -10000px;
|
683 |
-
left: -10000px;
|
684 |
-
width: 100px;
|
685 |
-
height: 100px;
|
686 |
-
overflow: scroll;
|
687 |
-
}
|
688 |
-
|
689 |
-
/* Retina-ize icons */
|
690 |
-
|
691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
692 |
-
.select2-search input,
|
693 |
-
.select2-search-choice-close,
|
694 |
-
.select2-container .select2-choice abbr,
|
695 |
-
.select2-container .select2-choice .select2-arrow b {
|
696 |
-
background-image: url('select2x2.png') !important;
|
697 |
-
background-repeat: no-repeat !important;
|
698 |
-
background-size: 60px 40px !important;
|
699 |
-
}
|
700 |
-
|
701 |
-
.select2-search input {
|
702 |
-
background-position: 100% -21px !important;
|
703 |
-
}
|
704 |
-
}
|
1 |
+
/*
|
2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
3 |
+
*/
|
4 |
+
.select2-container {
|
5 |
+
margin: 0;
|
6 |
+
position: relative;
|
7 |
+
display: inline-block;
|
8 |
+
/* inline-block for ie7 */
|
9 |
+
zoom: 1;
|
10 |
+
*display: inline;
|
11 |
+
vertical-align: middle;
|
12 |
+
}
|
13 |
+
|
14 |
+
.select2-container,
|
15 |
+
.select2-drop,
|
16 |
+
.select2-search,
|
17 |
+
.select2-search input {
|
18 |
+
/*
|
19 |
+
Force border-box so that % widths fit the parent
|
20 |
+
container without overlap because of margin/padding.
|
21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
22 |
+
*/
|
23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
24 |
+
-moz-box-sizing: border-box; /* firefox */
|
25 |
+
box-sizing: border-box; /* css3 */
|
26 |
+
}
|
27 |
+
|
28 |
+
.select2-container .select2-choice {
|
29 |
+
display: block;
|
30 |
+
height: 26px;
|
31 |
+
padding: 0 0 0 8px;
|
32 |
+
overflow: hidden;
|
33 |
+
position: relative;
|
34 |
+
|
35 |
+
border: 1px solid #aaa;
|
36 |
+
white-space: nowrap;
|
37 |
+
line-height: 26px;
|
38 |
+
color: #444;
|
39 |
+
text-decoration: none;
|
40 |
+
|
41 |
+
border-radius: 4px;
|
42 |
+
|
43 |
+
background-clip: padding-box;
|
44 |
+
|
45 |
+
-webkit-touch-callout: none;
|
46 |
+
-webkit-user-select: none;
|
47 |
+
-moz-user-select: none;
|
48 |
+
-ms-user-select: none;
|
49 |
+
user-select: none;
|
50 |
+
|
51 |
+
background-color: #fff;
|
52 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
53 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
54 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
55 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
57 |
+
}
|
58 |
+
|
59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
60 |
+
padding: 0 8px 0 0;
|
61 |
+
}
|
62 |
+
|
63 |
+
.select2-container.select2-drop-above .select2-choice {
|
64 |
+
border-bottom-color: #aaa;
|
65 |
+
|
66 |
+
border-radius: 0 0 4px 4px;
|
67 |
+
|
68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
69 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
70 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
71 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
73 |
+
}
|
74 |
+
|
75 |
+
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
76 |
+
margin-right: 42px;
|
77 |
+
}
|
78 |
+
|
79 |
+
.select2-container .select2-choice > .select2-chosen {
|
80 |
+
margin-right: 26px;
|
81 |
+
display: block;
|
82 |
+
overflow: hidden;
|
83 |
+
|
84 |
+
white-space: nowrap;
|
85 |
+
|
86 |
+
text-overflow: ellipsis;
|
87 |
+
float: none;
|
88 |
+
width: auto;
|
89 |
+
}
|
90 |
+
|
91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
92 |
+
margin-left: 26px;
|
93 |
+
margin-right: 0;
|
94 |
+
}
|
95 |
+
|
96 |
+
.select2-container .select2-choice abbr {
|
97 |
+
display: none;
|
98 |
+
width: 12px;
|
99 |
+
height: 12px;
|
100 |
+
position: absolute;
|
101 |
+
right: 24px;
|
102 |
+
top: 8px;
|
103 |
+
|
104 |
+
font-size: 1px;
|
105 |
+
text-decoration: none;
|
106 |
+
|
107 |
+
border: 0;
|
108 |
+
background: url('select2.png') right top no-repeat;
|
109 |
+
cursor: pointer;
|
110 |
+
outline: 0;
|
111 |
+
}
|
112 |
+
|
113 |
+
.select2-container.select2-allowclear .select2-choice abbr {
|
114 |
+
display: inline-block;
|
115 |
+
}
|
116 |
+
|
117 |
+
.select2-container .select2-choice abbr:hover {
|
118 |
+
background-position: right -11px;
|
119 |
+
cursor: pointer;
|
120 |
+
}
|
121 |
+
|
122 |
+
.select2-drop-mask {
|
123 |
+
border: 0;
|
124 |
+
margin: 0;
|
125 |
+
padding: 0;
|
126 |
+
position: fixed;
|
127 |
+
left: 0;
|
128 |
+
top: 0;
|
129 |
+
min-height: 100%;
|
130 |
+
min-width: 100%;
|
131 |
+
height: auto;
|
132 |
+
width: auto;
|
133 |
+
opacity: 0;
|
134 |
+
z-index: 9998;
|
135 |
+
/* styles required for IE to work */
|
136 |
+
background-color: #fff;
|
137 |
+
filter: alpha(opacity=0);
|
138 |
+
}
|
139 |
+
|
140 |
+
.select2-drop {
|
141 |
+
width: 100%;
|
142 |
+
margin-top: -1px;
|
143 |
+
position: absolute;
|
144 |
+
z-index: 9999;
|
145 |
+
top: 100%;
|
146 |
+
|
147 |
+
background: #fff;
|
148 |
+
color: #000;
|
149 |
+
border: 1px solid #aaa;
|
150 |
+
border-top: 0;
|
151 |
+
|
152 |
+
border-radius: 0 0 4px 4px;
|
153 |
+
|
154 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
155 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
156 |
+
}
|
157 |
+
|
158 |
+
.select2-drop.select2-drop-above {
|
159 |
+
margin-top: 1px;
|
160 |
+
border-top: 1px solid #aaa;
|
161 |
+
border-bottom: 0;
|
162 |
+
|
163 |
+
border-radius: 4px 4px 0 0;
|
164 |
+
|
165 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
166 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
167 |
+
}
|
168 |
+
|
169 |
+
.select2-drop-active {
|
170 |
+
border: 1px solid #5897fb;
|
171 |
+
border-top: none;
|
172 |
+
}
|
173 |
+
|
174 |
+
.select2-drop.select2-drop-above.select2-drop-active {
|
175 |
+
border-top: 1px solid #5897fb;
|
176 |
+
}
|
177 |
+
|
178 |
+
.select2-drop-auto-width {
|
179 |
+
border-top: 1px solid #aaa;
|
180 |
+
width: auto;
|
181 |
+
}
|
182 |
+
|
183 |
+
.select2-drop-auto-width .select2-search {
|
184 |
+
padding-top: 4px;
|
185 |
+
}
|
186 |
+
|
187 |
+
.select2-container .select2-choice .select2-arrow {
|
188 |
+
display: inline-block;
|
189 |
+
width: 18px;
|
190 |
+
height: 100%;
|
191 |
+
position: absolute;
|
192 |
+
right: 0;
|
193 |
+
top: 0;
|
194 |
+
|
195 |
+
border-left: 1px solid #aaa;
|
196 |
+
border-radius: 0 4px 4px 0;
|
197 |
+
|
198 |
+
background-clip: padding-box;
|
199 |
+
|
200 |
+
background: #ccc;
|
201 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
202 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
203 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
204 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
206 |
+
}
|
207 |
+
|
208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
209 |
+
left: 0;
|
210 |
+
right: auto;
|
211 |
+
|
212 |
+
border-left: none;
|
213 |
+
border-right: 1px solid #aaa;
|
214 |
+
border-radius: 4px 0 0 4px;
|
215 |
+
}
|
216 |
+
|
217 |
+
.select2-container .select2-choice .select2-arrow b {
|
218 |
+
display: block;
|
219 |
+
width: 100%;
|
220 |
+
height: 100%;
|
221 |
+
background: url('select2.png') no-repeat 0 1px;
|
222 |
+
}
|
223 |
+
|
224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
225 |
+
background-position: 2px 1px;
|
226 |
+
}
|
227 |
+
|
228 |
+
.select2-search {
|
229 |
+
display: inline-block;
|
230 |
+
width: 100%;
|
231 |
+
min-height: 26px;
|
232 |
+
margin: 0;
|
233 |
+
padding-left: 4px;
|
234 |
+
padding-right: 4px;
|
235 |
+
|
236 |
+
position: relative;
|
237 |
+
z-index: 10000;
|
238 |
+
|
239 |
+
white-space: nowrap;
|
240 |
+
}
|
241 |
+
|
242 |
+
.select2-search input {
|
243 |
+
width: 100%;
|
244 |
+
height: auto !important;
|
245 |
+
min-height: 26px;
|
246 |
+
padding: 4px 20px 4px 5px;
|
247 |
+
margin: 0;
|
248 |
+
|
249 |
+
outline: 0;
|
250 |
+
font-family: sans-serif;
|
251 |
+
font-size: 1em;
|
252 |
+
|
253 |
+
border: 1px solid #aaa;
|
254 |
+
border-radius: 0;
|
255 |
+
|
256 |
+
-webkit-box-shadow: none;
|
257 |
+
box-shadow: none;
|
258 |
+
|
259 |
+
background: #fff url('select2.png') no-repeat 100% -22px;
|
260 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
261 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
262 |
+
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
264 |
+
}
|
265 |
+
|
266 |
+
html[dir="rtl"] .select2-search input {
|
267 |
+
padding: 4px 5px 4px 20px;
|
268 |
+
|
269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
+
}
|
275 |
+
|
276 |
+
.select2-drop.select2-drop-above .select2-search input {
|
277 |
+
margin-top: 4px;
|
278 |
+
}
|
279 |
+
|
280 |
+
.select2-search input.select2-active {
|
281 |
+
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
282 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
283 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
284 |
+
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
286 |
+
}
|
287 |
+
|
288 |
+
.select2-container-active .select2-choice,
|
289 |
+
.select2-container-active .select2-choices {
|
290 |
+
border: 1px solid #5897fb;
|
291 |
+
outline: none;
|
292 |
+
|
293 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
294 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
295 |
+
}
|
296 |
+
|
297 |
+
.select2-dropdown-open .select2-choice {
|
298 |
+
border-bottom-color: transparent;
|
299 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
300 |
+
box-shadow: 0 1px 0 #fff inset;
|
301 |
+
|
302 |
+
border-bottom-left-radius: 0;
|
303 |
+
border-bottom-right-radius: 0;
|
304 |
+
|
305 |
+
background-color: #eee;
|
306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
308 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
309 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
311 |
+
}
|
312 |
+
|
313 |
+
.select2-dropdown-open.select2-drop-above .select2-choice,
|
314 |
+
.select2-dropdown-open.select2-drop-above .select2-choices {
|
315 |
+
border: 1px solid #5897fb;
|
316 |
+
border-top-color: transparent;
|
317 |
+
|
318 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
319 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
320 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
321 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
323 |
+
}
|
324 |
+
|
325 |
+
.select2-dropdown-open .select2-choice .select2-arrow {
|
326 |
+
background: transparent;
|
327 |
+
border-left: none;
|
328 |
+
filter: none;
|
329 |
+
}
|
330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
331 |
+
border-right: none;
|
332 |
+
}
|
333 |
+
|
334 |
+
.select2-dropdown-open .select2-choice .select2-arrow b {
|
335 |
+
background-position: -18px 1px;
|
336 |
+
}
|
337 |
+
|
338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
339 |
+
background-position: -16px 1px;
|
340 |
+
}
|
341 |
+
|
342 |
+
.select2-hidden-accessible {
|
343 |
+
border: 0;
|
344 |
+
clip: rect(0 0 0 0);
|
345 |
+
height: 1px;
|
346 |
+
margin: -1px;
|
347 |
+
overflow: hidden;
|
348 |
+
padding: 0;
|
349 |
+
position: absolute;
|
350 |
+
width: 1px;
|
351 |
+
}
|
352 |
+
|
353 |
+
/* results */
|
354 |
+
.select2-results {
|
355 |
+
max-height: 200px;
|
356 |
+
padding: 0 0 0 4px;
|
357 |
+
margin: 4px 4px 4px 0;
|
358 |
+
position: relative;
|
359 |
+
overflow-x: hidden;
|
360 |
+
overflow-y: auto;
|
361 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
362 |
+
}
|
363 |
+
|
364 |
+
html[dir="rtl"] .select2-results {
|
365 |
+
padding: 0 4px 0 0;
|
366 |
+
margin: 4px 0 4px 4px;
|
367 |
+
}
|
368 |
+
|
369 |
+
.select2-results ul.select2-result-sub {
|
370 |
+
margin: 0;
|
371 |
+
padding-left: 0;
|
372 |
+
}
|
373 |
+
|
374 |
+
.select2-results li {
|
375 |
+
list-style: none;
|
376 |
+
display: list-item;
|
377 |
+
background-image: none;
|
378 |
+
}
|
379 |
+
|
380 |
+
.select2-results li.select2-result-with-children > .select2-result-label {
|
381 |
+
font-weight: bold;
|
382 |
+
}
|
383 |
+
|
384 |
+
.select2-results .select2-result-label {
|
385 |
+
padding: 3px 7px 4px;
|
386 |
+
margin: 0;
|
387 |
+
cursor: pointer;
|
388 |
+
|
389 |
+
min-height: 1em;
|
390 |
+
|
391 |
+
-webkit-touch-callout: none;
|
392 |
+
-webkit-user-select: none;
|
393 |
+
-moz-user-select: none;
|
394 |
+
-ms-user-select: none;
|
395 |
+
user-select: none;
|
396 |
+
}
|
397 |
+
|
398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
405 |
+
|
406 |
+
.select2-results .select2-highlighted {
|
407 |
+
background: #3875d7;
|
408 |
+
color: #fff;
|
409 |
+
}
|
410 |
+
|
411 |
+
.select2-results li em {
|
412 |
+
background: #feffde;
|
413 |
+
font-style: normal;
|
414 |
+
}
|
415 |
+
|
416 |
+
.select2-results .select2-highlighted em {
|
417 |
+
background: transparent;
|
418 |
+
}
|
419 |
+
|
420 |
+
.select2-results .select2-highlighted ul {
|
421 |
+
background: #fff;
|
422 |
+
color: #000;
|
423 |
+
}
|
424 |
+
|
425 |
+
.select2-results .select2-no-results,
|
426 |
+
.select2-results .select2-searching,
|
427 |
+
.select2-results .select2-ajax-error,
|
428 |
+
.select2-results .select2-selection-limit {
|
429 |
+
background: #f4f4f4;
|
430 |
+
display: list-item;
|
431 |
+
padding-left: 5px;
|
432 |
+
}
|
433 |
+
|
434 |
+
/*
|
435 |
+
disabled look for disabled choices in the results dropdown
|
436 |
+
*/
|
437 |
+
.select2-results .select2-disabled.select2-highlighted {
|
438 |
+
color: #666;
|
439 |
+
background: #f4f4f4;
|
440 |
+
display: list-item;
|
441 |
+
cursor: default;
|
442 |
+
}
|
443 |
+
.select2-results .select2-disabled {
|
444 |
+
background: #f4f4f4;
|
445 |
+
display: list-item;
|
446 |
+
cursor: default;
|
447 |
+
}
|
448 |
+
|
449 |
+
.select2-results .select2-selected {
|
450 |
+
display: none;
|
451 |
+
}
|
452 |
+
|
453 |
+
.select2-more-results.select2-active {
|
454 |
+
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
455 |
+
}
|
456 |
+
|
457 |
+
.select2-results .select2-ajax-error {
|
458 |
+
background: rgba(255, 50, 50, .2);
|
459 |
+
}
|
460 |
+
|
461 |
+
.select2-more-results {
|
462 |
+
background: #f4f4f4;
|
463 |
+
display: list-item;
|
464 |
+
}
|
465 |
+
|
466 |
+
/* disabled styles */
|
467 |
+
|
468 |
+
.select2-container.select2-container-disabled .select2-choice {
|
469 |
+
background-color: #f4f4f4;
|
470 |
+
background-image: none;
|
471 |
+
border: 1px solid #ddd;
|
472 |
+
cursor: default;
|
473 |
+
}
|
474 |
+
|
475 |
+
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
476 |
+
background-color: #f4f4f4;
|
477 |
+
background-image: none;
|
478 |
+
border-left: 0;
|
479 |
+
}
|
480 |
+
|
481 |
+
.select2-container.select2-container-disabled .select2-choice abbr {
|
482 |
+
display: none;
|
483 |
+
}
|
484 |
+
|
485 |
+
|
486 |
+
/* multiselect */
|
487 |
+
|
488 |
+
.select2-container-multi .select2-choices {
|
489 |
+
height: auto !important;
|
490 |
+
height: 1%;
|
491 |
+
margin: 0;
|
492 |
+
padding: 0 5px 0 0;
|
493 |
+
position: relative;
|
494 |
+
|
495 |
+
border: 1px solid #aaa;
|
496 |
+
cursor: text;
|
497 |
+
overflow: hidden;
|
498 |
+
|
499 |
+
background-color: #fff;
|
500 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
501 |
+
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
502 |
+
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
504 |
+
}
|
505 |
+
|
506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
507 |
+
padding: 0 0 0 5px;
|
508 |
+
}
|
509 |
+
|
510 |
+
.select2-locked {
|
511 |
+
padding: 3px 5px 3px 5px !important;
|
512 |
+
}
|
513 |
+
|
514 |
+
.select2-container-multi .select2-choices {
|
515 |
+
min-height: 26px;
|
516 |
+
}
|
517 |
+
|
518 |
+
.select2-container-multi.select2-container-active .select2-choices {
|
519 |
+
border: 1px solid #5897fb;
|
520 |
+
outline: none;
|
521 |
+
|
522 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
523 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
524 |
+
}
|
525 |
+
.select2-container-multi .select2-choices li {
|
526 |
+
float: left;
|
527 |
+
list-style: none;
|
528 |
+
}
|
529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
530 |
+
{
|
531 |
+
float: right;
|
532 |
+
}
|
533 |
+
.select2-container-multi .select2-choices .select2-search-field {
|
534 |
+
margin: 0;
|
535 |
+
padding: 0;
|
536 |
+
white-space: nowrap;
|
537 |
+
}
|
538 |
+
|
539 |
+
.select2-container-multi .select2-choices .select2-search-field input {
|
540 |
+
padding: 5px;
|
541 |
+
margin: 1px 0;
|
542 |
+
|
543 |
+
font-family: sans-serif;
|
544 |
+
font-size: 100%;
|
545 |
+
color: #666;
|
546 |
+
outline: 0;
|
547 |
+
border: 0;
|
548 |
+
-webkit-box-shadow: none;
|
549 |
+
box-shadow: none;
|
550 |
+
background: transparent !important;
|
551 |
+
}
|
552 |
+
|
553 |
+
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
554 |
+
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
555 |
+
}
|
556 |
+
|
557 |
+
.select2-default {
|
558 |
+
color: #999 !important;
|
559 |
+
}
|
560 |
+
|
561 |
+
.select2-container-multi .select2-choices .select2-search-choice {
|
562 |
+
padding: 3px 5px 3px 18px;
|
563 |
+
margin: 3px 0 3px 5px;
|
564 |
+
position: relative;
|
565 |
+
|
566 |
+
line-height: 13px;
|
567 |
+
color: #333;
|
568 |
+
cursor: default;
|
569 |
+
border: 1px solid #aaaaaa;
|
570 |
+
|
571 |
+
border-radius: 3px;
|
572 |
+
|
573 |
+
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
574 |
+
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
575 |
+
|
576 |
+
background-clip: padding-box;
|
577 |
+
|
578 |
+
-webkit-touch-callout: none;
|
579 |
+
-webkit-user-select: none;
|
580 |
+
-moz-user-select: none;
|
581 |
+
-ms-user-select: none;
|
582 |
+
user-select: none;
|
583 |
+
|
584 |
+
background-color: #e4e4e4;
|
585 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
586 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
587 |
+
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
588 |
+
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
590 |
+
}
|
591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
592 |
+
{
|
593 |
+
margin: 3px 5px 3px 0;
|
594 |
+
padding: 3px 18px 3px 5px;
|
595 |
+
}
|
596 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
597 |
+
cursor: default;
|
598 |
+
}
|
599 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
600 |
+
background: #d4d4d4;
|
601 |
+
}
|
602 |
+
|
603 |
+
.select2-search-choice-close {
|
604 |
+
display: block;
|
605 |
+
width: 12px;
|
606 |
+
height: 13px;
|
607 |
+
position: absolute;
|
608 |
+
right: 3px;
|
609 |
+
top: 4px;
|
610 |
+
|
611 |
+
font-size: 1px;
|
612 |
+
outline: none;
|
613 |
+
background: url('select2.png') right top no-repeat;
|
614 |
+
}
|
615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
616 |
+
right: auto;
|
617 |
+
left: 3px;
|
618 |
+
}
|
619 |
+
|
620 |
+
.select2-container-multi .select2-search-choice-close {
|
621 |
+
left: 3px;
|
622 |
+
}
|
623 |
+
|
624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
625 |
+
left: auto;
|
626 |
+
right: 2px;
|
627 |
+
}
|
628 |
+
|
629 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
630 |
+
background-position: right -11px;
|
631 |
+
}
|
632 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
633 |
+
background-position: right -11px;
|
634 |
+
}
|
635 |
+
|
636 |
+
/* disabled styles */
|
637 |
+
.select2-container-multi.select2-container-disabled .select2-choices {
|
638 |
+
background-color: #f4f4f4;
|
639 |
+
background-image: none;
|
640 |
+
border: 1px solid #ddd;
|
641 |
+
cursor: default;
|
642 |
+
}
|
643 |
+
|
644 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
645 |
+
padding: 3px 5px 3px 5px;
|
646 |
+
border: 1px solid #ddd;
|
647 |
+
background-image: none;
|
648 |
+
background-color: #f4f4f4;
|
649 |
+
}
|
650 |
+
|
651 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
652 |
+
background: none;
|
653 |
+
}
|
654 |
+
/* end multiselect */
|
655 |
+
|
656 |
+
|
657 |
+
.select2-result-selectable .select2-match,
|
658 |
+
.select2-result-unselectable .select2-match {
|
659 |
+
text-decoration: underline;
|
660 |
+
}
|
661 |
+
|
662 |
+
.select2-offscreen, .select2-offscreen:focus {
|
663 |
+
clip: rect(0 0 0 0) !important;
|
664 |
+
width: 1px !important;
|
665 |
+
height: 1px !important;
|
666 |
+
border: 0 !important;
|
667 |
+
margin: 0 !important;
|
668 |
+
padding: 0 !important;
|
669 |
+
overflow: hidden !important;
|
670 |
+
position: absolute !important;
|
671 |
+
outline: 0 !important;
|
672 |
+
left: 0px !important;
|
673 |
+
top: 0px !important;
|
674 |
+
}
|
675 |
+
|
676 |
+
.select2-display-none {
|
677 |
+
display: none;
|
678 |
+
}
|
679 |
+
|
680 |
+
.select2-measure-scrollbar {
|
681 |
+
position: absolute;
|
682 |
+
top: -10000px;
|
683 |
+
left: -10000px;
|
684 |
+
width: 100px;
|
685 |
+
height: 100px;
|
686 |
+
overflow: scroll;
|
687 |
+
}
|
688 |
+
|
689 |
+
/* Retina-ize icons */
|
690 |
+
|
691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
692 |
+
.select2-search input,
|
693 |
+
.select2-search-choice-close,
|
694 |
+
.select2-container .select2-choice abbr,
|
695 |
+
.select2-container .select2-choice .select2-arrow b {
|
696 |
+
background-image: url('select2x2.png') !important;
|
697 |
+
background-repeat: no-repeat !important;
|
698 |
+
background-size: 60px 40px !important;
|
699 |
+
}
|
700 |
+
|
701 |
+
.select2-search input {
|
702 |
+
background-position: 100% -21px !important;
|
703 |
+
}
|
704 |
+
}
|
assets/deps/select2-3.5.2/select2.jquery.json
CHANGED
@@ -1,36 +1,36 @@
|
|
1 |
-
{
|
2 |
-
"name": "select2",
|
3 |
-
"title": "Select2",
|
4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
5 |
-
"keywords": [
|
6 |
-
"select",
|
7 |
-
"autocomplete",
|
8 |
-
"typeahead",
|
9 |
-
"dropdown",
|
10 |
-
"multiselect",
|
11 |
-
"tag",
|
12 |
-
"tagging"
|
13 |
-
],
|
14 |
-
"version": "3.5.2",
|
15 |
-
"author": {
|
16 |
-
"name": "Igor Vaynberg",
|
17 |
-
"url": "https://github.com/ivaynberg"
|
18 |
-
},
|
19 |
-
"licenses": [
|
20 |
-
{
|
21 |
-
"type": "Apache",
|
22 |
-
"url": "http://www.apache.org/licenses/LICENSE-2.0"
|
23 |
-
},
|
24 |
-
{
|
25 |
-
"type": "GPL v2",
|
26 |
-
"url": "http://www.gnu.org/licenses/gpl-2.0.html"
|
27 |
-
}
|
28 |
-
],
|
29 |
-
"bugs": "https://github.com/ivaynberg/select2/issues",
|
30 |
-
"homepage": "http://ivaynberg.github.com/select2",
|
31 |
-
"docs": "http://ivaynberg.github.com/select2/",
|
32 |
-
"download": "https://github.com/ivaynberg/select2/tags",
|
33 |
-
"dependencies": {
|
34 |
-
"jquery": ">=1.7.1"
|
35 |
-
}
|
36 |
-
}
|
1 |
+
{
|
2 |
+
"name": "select2",
|
3 |
+
"title": "Select2",
|
4 |
+
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
5 |
+
"keywords": [
|
6 |
+
"select",
|
7 |
+
"autocomplete",
|
8 |
+
"typeahead",
|
9 |
+
"dropdown",
|
10 |
+
"multiselect",
|
11 |
+
"tag",
|
12 |
+
"tagging"
|
13 |
+
],
|
14 |
+
"version": "3.5.2",
|
15 |
+
"author": {
|
16 |
+
"name": "Igor Vaynberg",
|
17 |
+
"url": "https://github.com/ivaynberg"
|
18 |
+
},
|
19 |
+
"licenses": [
|
20 |
+
{
|
21 |
+
"type": "Apache",
|
22 |
+
"url": "http://www.apache.org/licenses/LICENSE-2.0"
|
23 |
+
},
|
24 |
+
{
|
25 |
+
"type": "GPL v2",
|
26 |
+
"url": "http://www.gnu.org/licenses/gpl-2.0.html"
|
27 |
+
}
|
28 |
+
],
|
29 |
+
"bugs": "https://github.com/ivaynberg/select2/issues",
|
30 |
+
"homepage": "http://ivaynberg.github.com/select2",
|
31 |
+
"docs": "http://ivaynberg.github.com/select2/",
|
32 |
+
"download": "https://github.com/ivaynberg/select2/tags",
|
33 |
+
"dependencies": {
|
34 |
+
"jquery": ">=1.7.1"
|
35 |
+
}
|
36 |
+
}
|
assets/deps/select2-3.5.2/select2.js
CHANGED
@@ -1,3541 +1,3541 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2012 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
(function ($) {
|
22 |
-
if(typeof $.fn.each2 == "undefined") {
|
23 |
-
$.extend($.fn, {
|
24 |
-
/*
|
25 |
-
* 4-10 times faster .each replacement
|
26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
-
*/
|
28 |
-
each2 : function (c) {
|
29 |
-
var j = $([0]), i = -1, l = this.length;
|
30 |
-
while (
|
31 |
-
++i < l
|
32 |
-
&& (j.context = j[0] = this[i])
|
33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
-
);
|
35 |
-
return this;
|
36 |
-
}
|
37 |
-
});
|
38 |
-
}
|
39 |
-
})(jQuery);
|
40 |
-
|
41 |
-
(function ($, undefined) {
|
42 |
-
"use strict";
|
43 |
-
/*global document, window, jQuery, console */
|
44 |
-
|
45 |
-
if (window.Select2 !== undefined) {
|
46 |
-
return;
|
47 |
-
}
|
48 |
-
|
49 |
-
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
-
|
52 |
-
KEY = {
|
53 |
-
TAB: 9,
|
54 |
-
ENTER: 13,
|
55 |
-
ESC: 27,
|
56 |
-
SPACE: 32,
|
57 |
-
LEFT: 37,
|
58 |
-
UP: 38,
|
59 |
-
RIGHT: 39,
|
60 |
-
DOWN: 40,
|
61 |
-
SHIFT: 16,
|
62 |
-
CTRL: 17,
|
63 |
-
ALT: 18,
|
64 |
-
PAGE_UP: 33,
|
65 |
-
PAGE_DOWN: 34,
|
66 |
-
HOME: 36,
|
67 |
-
END: 35,
|
68 |
-
BACKSPACE: 8,
|
69 |
-
DELETE: 46,
|
70 |
-
isArrow: function (k) {
|
71 |
-
k = k.which ? k.which : k;
|
72 |
-
switch (k) {
|
73 |
-
case KEY.LEFT:
|
74 |
-
case KEY.RIGHT:
|
75 |
-
case KEY.UP:
|
76 |
-
case KEY.DOWN:
|
77 |
-
return true;
|
78 |
-
}
|
79 |
-
return false;
|
80 |
-
},
|
81 |
-
isControl: function (e) {
|
82 |
-
var k = e.which;
|
83 |
-
switch (k) {
|
84 |
-
case KEY.SHIFT:
|
85 |
-
case KEY.CTRL:
|
86 |
-
case KEY.ALT:
|
87 |
-
return true;
|
88 |
-
}
|
89 |
-
|
90 |
-
if (e.metaKey) return true;
|
91 |
-
|
92 |
-
return false;
|
93 |
-
},
|
94 |
-
isFunctionKey: function (k) {
|
95 |
-
k = k.which ? k.which : k;
|
96 |
-
return k >= 112 && k <= 123;
|
97 |
-
}
|
98 |
-
},
|
99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
-
|
101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
-
|
103 |
-
$document = $(document);
|
104 |
-
|
105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
-
|
107 |
-
|
108 |
-
function reinsertElement(element) {
|
109 |
-
var placeholder = $(document.createTextNode(''));
|
110 |
-
|
111 |
-
element.before(placeholder);
|
112 |
-
placeholder.before(element);
|
113 |
-
placeholder.remove();
|
114 |
-
}
|
115 |
-
|
116 |
-
function stripDiacritics(str) {
|
117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
-
function match(a) {
|
119 |
-
return DIACRITICS[a] || a;
|
120 |
-
}
|
121 |
-
|
122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
-
}
|
124 |
-
|
125 |
-
function indexOf(value, array) {
|
126 |
-
var i = 0, l = array.length;
|
127 |
-
for (; i < l; i = i + 1) {
|
128 |
-
if (equal(value, array[i])) return i;
|
129 |
-
}
|
130 |
-
return -1;
|
131 |
-
}
|
132 |
-
|
133 |
-
function measureScrollbar () {
|
134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
-
$template.appendTo(document.body);
|
136 |
-
|
137 |
-
var dim = {
|
138 |
-
width: $template.width() - $template[0].clientWidth,
|
139 |
-
height: $template.height() - $template[0].clientHeight
|
140 |
-
};
|
141 |
-
$template.remove();
|
142 |
-
|
143 |
-
return dim;
|
144 |
-
}
|
145 |
-
|
146 |
-
/**
|
147 |
-
* Compares equality of a and b
|
148 |
-
* @param a
|
149 |
-
* @param b
|
150 |
-
*/
|
151 |
-
function equal(a, b) {
|
152 |
-
if (a === b) return true;
|
153 |
-
if (a === undefined || b === undefined) return false;
|
154 |
-
if (a === null || b === null) return false;
|
155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
-
return false;
|
160 |
-
}
|
161 |
-
|
162 |
-
/**
|
163 |
-
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
-
* strings
|
165 |
-
* @param string
|
166 |
-
* @param separator
|
167 |
-
*/
|
168 |
-
function splitVal(string, separator, transform) {
|
169 |
-
var val, i, l;
|
170 |
-
if (string === null || string.length < 1) return [];
|
171 |
-
val = string.split(separator);
|
172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
-
return val;
|
174 |
-
}
|
175 |
-
|
176 |
-
function getSideBorderPadding(element) {
|
177 |
-
return element.outerWidth(false) - element.width();
|
178 |
-
}
|
179 |
-
|
180 |
-
function installKeyUpChangeEvent(element) {
|
181 |
-
var key="keyup-change-value";
|
182 |
-
element.on("keydown", function () {
|
183 |
-
if ($.data(element, key) === undefined) {
|
184 |
-
$.data(element, key, element.val());
|
185 |
-
}
|
186 |
-
});
|
187 |
-
element.on("keyup", function () {
|
188 |
-
var val= $.data(element, key);
|
189 |
-
if (val !== undefined && element.val() !== val) {
|
190 |
-
$.removeData(element, key);
|
191 |
-
element.trigger("keyup-change");
|
192 |
-
}
|
193 |
-
});
|
194 |
-
}
|
195 |
-
|
196 |
-
|
197 |
-
/**
|
198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
-
*
|
200 |
-
* filters out mouse events that occur when mouse is stationary but
|
201 |
-
* the elements under the pointer are scrolled.
|
202 |
-
*/
|
203 |
-
function installFilteredMouseMove(element) {
|
204 |
-
element.on("mousemove", function (e) {
|
205 |
-
var lastpos = lastMousePosition;
|
206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
208 |
-
}
|
209 |
-
});
|
210 |
-
}
|
211 |
-
|
212 |
-
/**
|
213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
-
* within the last quietMillis milliseconds.
|
215 |
-
*
|
216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
-
* @param fn function to be debounced
|
218 |
-
* @param ctx object to be used as this reference within fn
|
219 |
-
* @return debounced version of fn
|
220 |
-
*/
|
221 |
-
function debounce(quietMillis, fn, ctx) {
|
222 |
-
ctx = ctx || undefined;
|
223 |
-
var timeout;
|
224 |
-
return function () {
|
225 |
-
var args = arguments;
|
226 |
-
window.clearTimeout(timeout);
|
227 |
-
timeout = window.setTimeout(function() {
|
228 |
-
fn.apply(ctx, args);
|
229 |
-
}, quietMillis);
|
230 |
-
};
|
231 |
-
}
|
232 |
-
|
233 |
-
function installDebouncedScroll(threshold, element) {
|
234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
-
element.on("scroll", function (e) {
|
236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
-
});
|
238 |
-
}
|
239 |
-
|
240 |
-
function focus($el) {
|
241 |
-
if ($el[0] === document.activeElement) return;
|
242 |
-
|
243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
-
of the current event has finished - which seems like the only reliable way
|
245 |
-
to set focus */
|
246 |
-
window.setTimeout(function() {
|
247 |
-
var el=$el[0], pos=$el.val().length, range;
|
248 |
-
|
249 |
-
$el.focus();
|
250 |
-
|
251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
-
sometimes modals or others listeners may steal it after its set */
|
253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
-
if (isVisible && el === document.activeElement) {
|
255 |
-
|
256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
-
just before setting focus */
|
258 |
-
if(el.setSelectionRange)
|
259 |
-
{
|
260 |
-
el.setSelectionRange(pos, pos);
|
261 |
-
}
|
262 |
-
else if (el.createTextRange) {
|
263 |
-
range = el.createTextRange();
|
264 |
-
range.collapse(false);
|
265 |
-
range.select();
|
266 |
-
}
|
267 |
-
}
|
268 |
-
}, 0);
|
269 |
-
}
|
270 |
-
|
271 |
-
function getCursorInfo(el) {
|
272 |
-
el = $(el)[0];
|
273 |
-
var offset = 0;
|
274 |
-
var length = 0;
|
275 |
-
if ('selectionStart' in el) {
|
276 |
-
offset = el.selectionStart;
|
277 |
-
length = el.selectionEnd - offset;
|
278 |
-
} else if ('selection' in document) {
|
279 |
-
el.focus();
|
280 |
-
var sel = document.selection.createRange();
|
281 |
-
length = document.selection.createRange().text.length;
|
282 |
-
sel.moveStart('character', -el.value.length);
|
283 |
-
offset = sel.text.length - length;
|
284 |
-
}
|
285 |
-
return { offset: offset, length: length };
|
286 |
-
}
|
287 |
-
|
288 |
-
function killEvent(event) {
|
289 |
-
event.preventDefault();
|
290 |
-
event.stopPropagation();
|
291 |
-
}
|
292 |
-
function killEventImmediately(event) {
|
293 |
-
event.preventDefault();
|
294 |
-
event.stopImmediatePropagation();
|
295 |
-
}
|
296 |
-
|
297 |
-
function measureTextWidth(e) {
|
298 |
-
if (!sizer){
|
299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
-
sizer = $(document.createElement("div")).css({
|
301 |
-
position: "absolute",
|
302 |
-
left: "-10000px",
|
303 |
-
top: "-10000px",
|
304 |
-
display: "none",
|
305 |
-
fontSize: style.fontSize,
|
306 |
-
fontFamily: style.fontFamily,
|
307 |
-
fontStyle: style.fontStyle,
|
308 |
-
fontWeight: style.fontWeight,
|
309 |
-
letterSpacing: style.letterSpacing,
|
310 |
-
textTransform: style.textTransform,
|
311 |
-
whiteSpace: "nowrap"
|
312 |
-
});
|
313 |
-
sizer.attr("class","select2-sizer");
|
314 |
-
$(document.body).append(sizer);
|
315 |
-
}
|
316 |
-
sizer.text(e.val());
|
317 |
-
return sizer.width();
|
318 |
-
}
|
319 |
-
|
320 |
-
function syncCssClasses(dest, src, adapter) {
|
321 |
-
var classes, replacements = [], adapted;
|
322 |
-
|
323 |
-
classes = $.trim(dest.attr("class"));
|
324 |
-
|
325 |
-
if (classes) {
|
326 |
-
classes = '' + classes; // for IE which returns object
|
327 |
-
|
328 |
-
$(classes.split(/\s+/)).each2(function() {
|
329 |
-
if (this.indexOf("select2-") === 0) {
|
330 |
-
replacements.push(this);
|
331 |
-
}
|
332 |
-
});
|
333 |
-
}
|
334 |
-
|
335 |
-
classes = $.trim(src.attr("class"));
|
336 |
-
|
337 |
-
if (classes) {
|
338 |
-
classes = '' + classes; // for IE which returns object
|
339 |
-
|
340 |
-
$(classes.split(/\s+/)).each2(function() {
|
341 |
-
if (this.indexOf("select2-") !== 0) {
|
342 |
-
adapted = adapter(this);
|
343 |
-
|
344 |
-
if (adapted) {
|
345 |
-
replacements.push(adapted);
|
346 |
-
}
|
347 |
-
}
|
348 |
-
});
|
349 |
-
}
|
350 |
-
|
351 |
-
dest.attr("class", replacements.join(" "));
|
352 |
-
}
|
353 |
-
|
354 |
-
|
355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
-
tl=term.length;
|
358 |
-
|
359 |
-
if (match<0) {
|
360 |
-
markup.push(escapeMarkup(text));
|
361 |
-
return;
|
362 |
-
}
|
363 |
-
|
364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
-
markup.push("<span class='select2-match'>");
|
366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
-
markup.push("</span>");
|
368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
-
}
|
370 |
-
|
371 |
-
function defaultEscapeMarkup(markup) {
|
372 |
-
var replace_map = {
|
373 |
-
'\\': '\',
|
374 |
-
'&': '&',
|
375 |
-
'<': '<',
|
376 |
-
'>': '>',
|
377 |
-
'"': '"',
|
378 |
-
"'": ''',
|
379 |
-
"/": '/'
|
380 |
-
};
|
381 |
-
|
382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
-
return replace_map[match];
|
384 |
-
});
|
385 |
-
}
|
386 |
-
|
387 |
-
/**
|
388 |
-
* Produces an ajax-based query function
|
389 |
-
*
|
390 |
-
* @param options object containing configuration parameters
|
391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
-
* @param options.url url for the data
|
394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
-
* The expected format is an object containing the following keys:
|
399 |
-
* results array of objects that will be used as choices
|
400 |
-
* more (optional) boolean indicating whether there are more results available
|
401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
-
*/
|
403 |
-
function ajax(options) {
|
404 |
-
var timeout, // current scheduled but not yet executed request
|
405 |
-
handler = null,
|
406 |
-
quietMillis = options.quietMillis || 100,
|
407 |
-
ajaxUrl = options.url,
|
408 |
-
self = this;
|
409 |
-
|
410 |
-
return function (query) {
|
411 |
-
window.clearTimeout(timeout);
|
412 |
-
timeout = window.setTimeout(function () {
|
413 |
-
var data = options.data, // ajax data function
|
414 |
-
url = ajaxUrl, // ajax url string or function
|
415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
417 |
-
deprecated = {
|
418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
-
cache: options.cache || false,
|
420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
-
dataType: options.dataType||"json"
|
422 |
-
},
|
423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
-
|
425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
-
|
428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
-
|
430 |
-
if (options.params) {
|
431 |
-
if ($.isFunction(options.params)) {
|
432 |
-
$.extend(params, options.params.call(self));
|
433 |
-
} else {
|
434 |
-
$.extend(params, options.params);
|
435 |
-
}
|
436 |
-
}
|
437 |
-
|
438 |
-
$.extend(params, {
|
439 |
-
url: url,
|
440 |
-
dataType: options.dataType,
|
441 |
-
data: data,
|
442 |
-
success: function (data) {
|
443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
-
// added query as third paramter to keep backwards compatibility
|
445 |
-
var results = options.results(data, query.page, query);
|
446 |
-
query.callback(results);
|
447 |
-
},
|
448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
449 |
-
var results = {
|
450 |
-
hasError: true,
|
451 |
-
jqXHR: jqXHR,
|
452 |
-
textStatus: textStatus,
|
453 |
-
errorThrown: errorThrown
|
454 |
-
};
|
455 |
-
|
456 |
-
query.callback(results);
|
457 |
-
}
|
458 |
-
});
|
459 |
-
handler = transport.call(self, params);
|
460 |
-
}, quietMillis);
|
461 |
-
};
|
462 |
-
}
|
463 |
-
|
464 |
-
/**
|
465 |
-
* Produces a query function that works with a local array
|
466 |
-
*
|
467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
-
* object.
|
469 |
-
*
|
470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
-
*
|
472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
-
* the text.
|
477 |
-
*/
|
478 |
-
function local(options) {
|
479 |
-
var data = options, // data elements
|
480 |
-
dataText,
|
481 |
-
tmp,
|
482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
-
|
484 |
-
if ($.isArray(data)) {
|
485 |
-
tmp = data;
|
486 |
-
data = { results: tmp };
|
487 |
-
}
|
488 |
-
|
489 |
-
if ($.isFunction(data) === false) {
|
490 |
-
tmp = data;
|
491 |
-
data = function() { return tmp; };
|
492 |
-
}
|
493 |
-
|
494 |
-
var dataItem = data();
|
495 |
-
if (dataItem.text) {
|
496 |
-
text = dataItem.text;
|
497 |
-
// if text is not a function we assume it to be a key name
|
498 |
-
if (!$.isFunction(text)) {
|
499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
-
text = function (item) { return item[dataText]; };
|
501 |
-
}
|
502 |
-
}
|
503 |
-
|
504 |
-
return function (query) {
|
505 |
-
var t = query.term, filtered = { results: [] }, process;
|
506 |
-
if (t === "") {
|
507 |
-
query.callback(data());
|
508 |
-
return;
|
509 |
-
}
|
510 |
-
|
511 |
-
process = function(datum, collection) {
|
512 |
-
var group, attr;
|
513 |
-
datum = datum[0];
|
514 |
-
if (datum.children) {
|
515 |
-
group = {};
|
516 |
-
for (attr in datum) {
|
517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
-
}
|
519 |
-
group.children=[];
|
520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
-
collection.push(group);
|
523 |
-
}
|
524 |
-
} else {
|
525 |
-
if (query.matcher(t, text(datum), datum)) {
|
526 |
-
collection.push(datum);
|
527 |
-
}
|
528 |
-
}
|
529 |
-
};
|
530 |
-
|
531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
-
query.callback(filtered);
|
533 |
-
};
|
534 |
-
}
|
535 |
-
|
536 |
-
// TODO javadoc
|
537 |
-
function tags(data) {
|
538 |
-
var isFunc = $.isFunction(data);
|
539 |
-
return function (query) {
|
540 |
-
var t = query.term, filtered = {results: []};
|
541 |
-
var result = isFunc ? data(query) : data;
|
542 |
-
if ($.isArray(result)) {
|
543 |
-
$(result).each(function () {
|
544 |
-
var isObject = this.text !== undefined,
|
545 |
-
text = isObject ? this.text : this;
|
546 |
-
if (t === "" || query.matcher(t, text)) {
|
547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
-
}
|
549 |
-
});
|
550 |
-
query.callback(filtered);
|
551 |
-
}
|
552 |
-
};
|
553 |
-
}
|
554 |
-
|
555 |
-
/**
|
556 |
-
* Checks if the formatter function should be used.
|
557 |
-
*
|
558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
-
* false if no formatting should be performed.
|
560 |
-
*
|
561 |
-
* @param formatter
|
562 |
-
*/
|
563 |
-
function checkFormatter(formatter, formatterName) {
|
564 |
-
if ($.isFunction(formatter)) return true;
|
565 |
-
if (!formatter) return false;
|
566 |
-
if (typeof(formatter) === 'string') return true;
|
567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
-
}
|
569 |
-
|
570 |
-
/**
|
571 |
-
* Returns a given value
|
572 |
-
* If given a function, returns its output
|
573 |
-
*
|
574 |
-
* @param val string|function
|
575 |
-
* @param context value of "this" to be passed to function
|
576 |
-
* @returns {*}
|
577 |
-
*/
|
578 |
-
function evaluate(val, context) {
|
579 |
-
if ($.isFunction(val)) {
|
580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
-
return val.apply(context, args);
|
582 |
-
}
|
583 |
-
return val;
|
584 |
-
}
|
585 |
-
|
586 |
-
function countResults(results) {
|
587 |
-
var count = 0;
|
588 |
-
$.each(results, function(i, item) {
|
589 |
-
if (item.children) {
|
590 |
-
count += countResults(item.children);
|
591 |
-
} else {
|
592 |
-
count++;
|
593 |
-
}
|
594 |
-
});
|
595 |
-
return count;
|
596 |
-
}
|
597 |
-
|
598 |
-
/**
|
599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
-
* two options have to be defined in order for the tokenizer to work.
|
602 |
-
*
|
603 |
-
* @param input text user has typed so far or pasted into the search field
|
604 |
-
* @param selection currently selected choices
|
605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
-
* @param opts select2's opts
|
607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
-
*/
|
609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
-
token, // token
|
613 |
-
index, // position at which the separator was found
|
614 |
-
i, l, // looping variables
|
615 |
-
separator; // the matched separator
|
616 |
-
|
617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
-
|
619 |
-
while (true) {
|
620 |
-
index = -1;
|
621 |
-
|
622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
-
separator = opts.tokenSeparators[i];
|
624 |
-
index = input.indexOf(separator);
|
625 |
-
if (index >= 0) break;
|
626 |
-
}
|
627 |
-
|
628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
-
|
630 |
-
token = input.substring(0, index);
|
631 |
-
input = input.substring(index + separator.length);
|
632 |
-
|
633 |
-
if (token.length > 0) {
|
634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
-
dupe = false;
|
637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
-
dupe = true; break;
|
640 |
-
}
|
641 |
-
}
|
642 |
-
|
643 |
-
if (!dupe) selectCallback(token);
|
644 |
-
}
|
645 |
-
}
|
646 |
-
}
|
647 |
-
|
648 |
-
if (original!==input) return input;
|
649 |
-
}
|
650 |
-
|
651 |
-
function cleanupJQueryElements() {
|
652 |
-
var self = this;
|
653 |
-
|
654 |
-
$.each(arguments, function (i, element) {
|
655 |
-
self[element].remove();
|
656 |
-
self[element] = null;
|
657 |
-
});
|
658 |
-
}
|
659 |
-
|
660 |
-
/**
|
661 |
-
* Creates a new class
|
662 |
-
*
|
663 |
-
* @param superClass
|
664 |
-
* @param methods
|
665 |
-
*/
|
666 |
-
function clazz(SuperClass, methods) {
|
667 |
-
var constructor = function () {};
|
668 |
-
constructor.prototype = new SuperClass;
|
669 |
-
constructor.prototype.constructor = constructor;
|
670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
-
return constructor;
|
673 |
-
}
|
674 |
-
|
675 |
-
AbstractSelect2 = clazz(Object, {
|
676 |
-
|
677 |
-
// abstract
|
678 |
-
bind: function (func) {
|
679 |
-
var self = this;
|
680 |
-
return function () {
|
681 |
-
func.apply(self, arguments);
|
682 |
-
};
|
683 |
-
},
|
684 |
-
|
685 |
-
// abstract
|
686 |
-
init: function (opts) {
|
687 |
-
var results, search, resultsSelector = ".select2-results";
|
688 |
-
|
689 |
-
// prepare options
|
690 |
-
this.opts = opts = this.prepareOpts(opts);
|
691 |
-
|
692 |
-
this.id=opts.id;
|
693 |
-
|
694 |
-
// destroy if called on an existing component
|
695 |
-
if (opts.element.data("select2") !== undefined &&
|
696 |
-
opts.element.data("select2") !== null) {
|
697 |
-
opts.element.data("select2").destroy();
|
698 |
-
}
|
699 |
-
|
700 |
-
this.container = this.createContainer();
|
701 |
-
|
702 |
-
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
-
if (this.liveRegion.length == 0) {
|
704 |
-
this.liveRegion = $("<span>", {
|
705 |
-
role: "status",
|
706 |
-
"aria-live": "polite"
|
707 |
-
})
|
708 |
-
.addClass("select2-hidden-accessible")
|
709 |
-
.appendTo(document.body);
|
710 |
-
}
|
711 |
-
|
712 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
-
this.containerEventName= this.containerId
|
714 |
-
.replace(/([.])/g, '_')
|
715 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
-
this.container.attr("id", this.containerId);
|
717 |
-
|
718 |
-
this.container.attr("title", opts.element.attr("title"));
|
719 |
-
|
720 |
-
this.body = $(document.body);
|
721 |
-
|
722 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
-
|
724 |
-
this.container.attr("style", opts.element.attr("style"));
|
725 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
-
|
728 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
-
|
730 |
-
// swap container for the element
|
731 |
-
this.opts.element
|
732 |
-
.data("select2", this)
|
733 |
-
.attr("tabindex", "-1")
|
734 |
-
.before(this.container)
|
735 |
-
.on("click.select2", killEvent); // do not leak click events
|
736 |
-
|
737 |
-
this.container.data("select2", this);
|
738 |
-
|
739 |
-
this.dropdown = this.container.find(".select2-drop");
|
740 |
-
|
741 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
-
|
743 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
-
this.dropdown.data("select2", this);
|
745 |
-
this.dropdown.on("click", killEvent);
|
746 |
-
|
747 |
-
this.results = results = this.container.find(resultsSelector);
|
748 |
-
this.search = search = this.container.find("input.select2-input");
|
749 |
-
|
750 |
-
this.queryCount = 0;
|
751 |
-
this.resultsPage = 0;
|
752 |
-
this.context = null;
|
753 |
-
|
754 |
-
// initialize the container
|
755 |
-
this.initContainer();
|
756 |
-
|
757 |
-
this.container.on("click", killEvent);
|
758 |
-
|
759 |
-
installFilteredMouseMove(this.results);
|
760 |
-
|
761 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
-
this._touchEvent = true;
|
764 |
-
this.highlightUnderEvent(event);
|
765 |
-
}));
|
766 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
-
|
769 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
-
// otherwise click will be triggered on an underlying element
|
771 |
-
this.dropdown.on('click', this.bind(function (event) {
|
772 |
-
if (this._touchEvent) {
|
773 |
-
this._touchEvent = false;
|
774 |
-
this.selectHighlighted();
|
775 |
-
}
|
776 |
-
}));
|
777 |
-
|
778 |
-
installDebouncedScroll(80, this.results);
|
779 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
-
|
781 |
-
// do not propagate change event from the search field out of the component
|
782 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
-
|
785 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
-
if ($.fn.mousewheel) {
|
787 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
-
var top = results.scrollTop();
|
789 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
-
results.scrollTop(0);
|
791 |
-
killEvent(e);
|
792 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
-
killEvent(e);
|
795 |
-
}
|
796 |
-
});
|
797 |
-
}
|
798 |
-
|
799 |
-
installKeyUpChangeEvent(search);
|
800 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
-
|
804 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
-
this.highlightUnderEvent(e);
|
807 |
-
this.selectHighlighted(e);
|
808 |
-
}
|
809 |
-
}));
|
810 |
-
|
811 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
-
// dom it will trigger the popup close, which is not what we want
|
814 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
-
|
817 |
-
this.nextSearchTerm = undefined;
|
818 |
-
|
819 |
-
if ($.isFunction(this.opts.initSelection)) {
|
820 |
-
// initialize selection based on the current value of the source element
|
821 |
-
this.initSelection();
|
822 |
-
|
823 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
-
this.monitorSource();
|
826 |
-
}
|
827 |
-
|
828 |
-
if (opts.maximumInputLength !== null) {
|
829 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
-
}
|
831 |
-
|
832 |
-
var disabled = opts.element.prop("disabled");
|
833 |
-
if (disabled === undefined) disabled = false;
|
834 |
-
this.enable(!disabled);
|
835 |
-
|
836 |
-
var readonly = opts.element.prop("readonly");
|
837 |
-
if (readonly === undefined) readonly = false;
|
838 |
-
this.readonly(readonly);
|
839 |
-
|
840 |
-
// Calculate size of scrollbar
|
841 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
-
|
843 |
-
this.autofocus = opts.element.prop("autofocus");
|
844 |
-
opts.element.prop("autofocus", false);
|
845 |
-
if (this.autofocus) this.focus();
|
846 |
-
|
847 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
-
},
|
849 |
-
|
850 |
-
// abstract
|
851 |
-
destroy: function () {
|
852 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
-
|
854 |
-
this.close();
|
855 |
-
|
856 |
-
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
-
element.each(function () {
|
858 |
-
if (self._sync) {
|
859 |
-
this.detachEvent("onpropertychange", self._sync);
|
860 |
-
}
|
861 |
-
});
|
862 |
-
}
|
863 |
-
if (this.propertyObserver) {
|
864 |
-
this.propertyObserver.disconnect();
|
865 |
-
this.propertyObserver = null;
|
866 |
-
}
|
867 |
-
this._sync = null;
|
868 |
-
|
869 |
-
if (select2 !== undefined) {
|
870 |
-
select2.container.remove();
|
871 |
-
select2.liveRegion.remove();
|
872 |
-
select2.dropdown.remove();
|
873 |
-
element
|
874 |
-
.show()
|
875 |
-
.removeData("select2")
|
876 |
-
.off(".select2")
|
877 |
-
.prop("autofocus", this.autofocus || false);
|
878 |
-
if (this.elementTabIndex) {
|
879 |
-
element.attr({tabindex: this.elementTabIndex});
|
880 |
-
} else {
|
881 |
-
element.removeAttr("tabindex");
|
882 |
-
}
|
883 |
-
element.show();
|
884 |
-
}
|
885 |
-
|
886 |
-
cleanupJQueryElements.call(this,
|
887 |
-
"container",
|
888 |
-
"liveRegion",
|
889 |
-
"dropdown",
|
890 |
-
"results",
|
891 |
-
"search"
|
892 |
-
);
|
893 |
-
},
|
894 |
-
|
895 |
-
// abstract
|
896 |
-
optionToData: function(element) {
|
897 |
-
if (element.is("option")) {
|
898 |
-
return {
|
899 |
-
id:element.prop("value"),
|
900 |
-
text:element.text(),
|
901 |
-
element: element.get(),
|
902 |
-
css: element.attr("class"),
|
903 |
-
disabled: element.prop("disabled"),
|
904 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
905 |
-
};
|
906 |
-
} else if (element.is("optgroup")) {
|
907 |
-
return {
|
908 |
-
text:element.attr("label"),
|
909 |
-
children:[],
|
910 |
-
element: element.get(),
|
911 |
-
css: element.attr("class")
|
912 |
-
};
|
913 |
-
}
|
914 |
-
},
|
915 |
-
|
916 |
-
// abstract
|
917 |
-
prepareOpts: function (opts) {
|
918 |
-
var element, select, idKey, ajaxUrl, self = this;
|
919 |
-
|
920 |
-
element = opts.element;
|
921 |
-
|
922 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
923 |
-
this.select = select = opts.element;
|
924 |
-
}
|
925 |
-
|
926 |
-
if (select) {
|
927 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
928 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
929 |
-
if (this in opts) {
|
930 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
931 |
-
}
|
932 |
-
});
|
933 |
-
}
|
934 |
-
|
935 |
-
opts = $.extend({}, {
|
936 |
-
populateResults: function(container, results, query) {
|
937 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
938 |
-
|
939 |
-
populate=function(results, container, depth) {
|
940 |
-
|
941 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
942 |
-
|
943 |
-
results = opts.sortResults(results, container, query);
|
944 |
-
|
945 |
-
// collect the created nodes for bulk append
|
946 |
-
var nodes = [];
|
947 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
948 |
-
|
949 |
-
result=results[i];
|
950 |
-
|
951 |
-
disabled = (result.disabled === true);
|
952 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
953 |
-
|
954 |
-
compound=result.children && result.children.length > 0;
|
955 |
-
|
956 |
-
node=$("<li></li>");
|
957 |
-
node.addClass("select2-results-dept-"+depth);
|
958 |
-
node.addClass("select2-result");
|
959 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
960 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
961 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
962 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
963 |
-
node.attr("role", "presentation");
|
964 |
-
|
965 |
-
label=$(document.createElement("div"));
|
966 |
-
label.addClass("select2-result-label");
|
967 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
968 |
-
label.attr("role", "option");
|
969 |
-
|
970 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
971 |
-
if (formatted!==undefined) {
|
972 |
-
label.html(formatted);
|
973 |
-
node.append(label);
|
974 |
-
}
|
975 |
-
|
976 |
-
|
977 |
-
if (compound) {
|
978 |
-
|
979 |
-
innerContainer=$("<ul></ul>");
|
980 |
-
innerContainer.addClass("select2-result-sub");
|
981 |
-
populate(result.children, innerContainer, depth+1);
|
982 |
-
node.append(innerContainer);
|
983 |
-
}
|
984 |
-
|
985 |
-
node.data("select2-data", result);
|
986 |
-
nodes.push(node[0]);
|
987 |
-
}
|
988 |
-
|
989 |
-
// bulk append the created nodes
|
990 |
-
container.append(nodes);
|
991 |
-
liveRegion.text(opts.formatMatches(results.length));
|
992 |
-
};
|
993 |
-
|
994 |
-
populate(results, container, 0);
|
995 |
-
}
|
996 |
-
}, $.fn.select2.defaults, opts);
|
997 |
-
|
998 |
-
if (typeof(opts.id) !== "function") {
|
999 |
-
idKey = opts.id;
|
1000 |
-
opts.id = function (e) { return e[idKey]; };
|
1001 |
-
}
|
1002 |
-
|
1003 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
1004 |
-
if ("tags" in opts) {
|
1005 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1006 |
-
}
|
1007 |
-
opts.tags=opts.element.data("select2Tags");
|
1008 |
-
}
|
1009 |
-
|
1010 |
-
if (select) {
|
1011 |
-
opts.query = this.bind(function (query) {
|
1012 |
-
var data = { results: [], more: false },
|
1013 |
-
term = query.term,
|
1014 |
-
children, placeholderOption, process;
|
1015 |
-
|
1016 |
-
process=function(element, collection) {
|
1017 |
-
var group;
|
1018 |
-
if (element.is("option")) {
|
1019 |
-
if (query.matcher(term, element.text(), element)) {
|
1020 |
-
collection.push(self.optionToData(element));
|
1021 |
-
}
|
1022 |
-
} else if (element.is("optgroup")) {
|
1023 |
-
group=self.optionToData(element);
|
1024 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1025 |
-
if (group.children.length>0) {
|
1026 |
-
collection.push(group);
|
1027 |
-
}
|
1028 |
-
}
|
1029 |
-
};
|
1030 |
-
|
1031 |
-
children=element.children();
|
1032 |
-
|
1033 |
-
// ignore the placeholder option if there is one
|
1034 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1035 |
-
placeholderOption = this.getPlaceholderOption();
|
1036 |
-
if (placeholderOption) {
|
1037 |
-
children=children.not(placeholderOption);
|
1038 |
-
}
|
1039 |
-
}
|
1040 |
-
|
1041 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
1042 |
-
|
1043 |
-
query.callback(data);
|
1044 |
-
});
|
1045 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1046 |
-
opts.id=function(e) { return e.id; };
|
1047 |
-
} else {
|
1048 |
-
if (!("query" in opts)) {
|
1049 |
-
|
1050 |
-
if ("ajax" in opts) {
|
1051 |
-
ajaxUrl = opts.element.data("ajax-url");
|
1052 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
1053 |
-
opts.ajax.url = ajaxUrl;
|
1054 |
-
}
|
1055 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
1056 |
-
} else if ("data" in opts) {
|
1057 |
-
opts.query = local(opts.data);
|
1058 |
-
} else if ("tags" in opts) {
|
1059 |
-
opts.query = tags(opts.tags);
|
1060 |
-
if (opts.createSearchChoice === undefined) {
|
1061 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1062 |
-
}
|
1063 |
-
if (opts.initSelection === undefined) {
|
1064 |
-
opts.initSelection = function (element, callback) {
|
1065 |
-
var data = [];
|
1066 |
-
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1067 |
-
var obj = { id: this, text: this },
|
1068 |
-
tags = opts.tags;
|
1069 |
-
if ($.isFunction(tags)) tags=tags();
|
1070 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1071 |
-
data.push(obj);
|
1072 |
-
});
|
1073 |
-
|
1074 |
-
callback(data);
|
1075 |
-
};
|
1076 |
-
}
|
1077 |
-
}
|
1078 |
-
}
|
1079 |
-
}
|
1080 |
-
if (typeof(opts.query) !== "function") {
|
1081 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1082 |
-
}
|
1083 |
-
|
1084 |
-
if (opts.createSearchChoicePosition === 'top') {
|
1085 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1086 |
-
}
|
1087 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
1088 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1089 |
-
}
|
1090 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1091 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1092 |
-
}
|
1093 |
-
|
1094 |
-
return opts;
|
1095 |
-
},
|
1096 |
-
|
1097 |
-
/**
|
1098 |
-
* Monitor the original element for changes and update select2 accordingly
|
1099 |
-
*/
|
1100 |
-
// abstract
|
1101 |
-
monitorSource: function () {
|
1102 |
-
var el = this.opts.element, observer, self = this;
|
1103 |
-
|
1104 |
-
el.on("change.select2", this.bind(function (e) {
|
1105 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1106 |
-
this.initSelection();
|
1107 |
-
}
|
1108 |
-
}));
|
1109 |
-
|
1110 |
-
this._sync = this.bind(function () {
|
1111 |
-
|
1112 |
-
// sync enabled state
|
1113 |
-
var disabled = el.prop("disabled");
|
1114 |
-
if (disabled === undefined) disabled = false;
|
1115 |
-
this.enable(!disabled);
|
1116 |
-
|
1117 |
-
var readonly = el.prop("readonly");
|
1118 |
-
if (readonly === undefined) readonly = false;
|
1119 |
-
this.readonly(readonly);
|
1120 |
-
|
1121 |
-
if (this.container) {
|
1122 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1123 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1124 |
-
}
|
1125 |
-
|
1126 |
-
if (this.dropdown) {
|
1127 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1128 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1129 |
-
}
|
1130 |
-
|
1131 |
-
});
|
1132 |
-
|
1133 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1134 |
-
if (el.length && el[0].attachEvent) {
|
1135 |
-
el.each(function() {
|
1136 |
-
this.attachEvent("onpropertychange", self._sync);
|
1137 |
-
});
|
1138 |
-
}
|
1139 |
-
|
1140 |
-
// safari, chrome, firefox, IE11
|
1141 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1142 |
-
if (observer !== undefined) {
|
1143 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1144 |
-
this.propertyObserver = new observer(function (mutations) {
|
1145 |
-
$.each(mutations, self._sync);
|
1146 |
-
});
|
1147 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1148 |
-
}
|
1149 |
-
},
|
1150 |
-
|
1151 |
-
// abstract
|
1152 |
-
triggerSelect: function(data) {
|
1153 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1154 |
-
this.opts.element.trigger(evt);
|
1155 |
-
return !evt.isDefaultPrevented();
|
1156 |
-
},
|
1157 |
-
|
1158 |
-
/**
|
1159 |
-
* Triggers the change event on the source element
|
1160 |
-
*/
|
1161 |
-
// abstract
|
1162 |
-
triggerChange: function (details) {
|
1163 |
-
|
1164 |
-
details = details || {};
|
1165 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
1166 |
-
// prevents recursive triggering
|
1167 |
-
this.opts.element.data("select2-change-triggered", true);
|
1168 |
-
this.opts.element.trigger(details);
|
1169 |
-
this.opts.element.data("select2-change-triggered", false);
|
1170 |
-
|
1171 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1172 |
-
// so here we trigger the click event manually
|
1173 |
-
this.opts.element.click();
|
1174 |
-
|
1175 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
1176 |
-
// so here we trigger the blur event manually if so desired
|
1177 |
-
if (this.opts.blurOnChange)
|
1178 |
-
this.opts.element.blur();
|
1179 |
-
},
|
1180 |
-
|
1181 |
-
//abstract
|
1182 |
-
isInterfaceEnabled: function()
|
1183 |
-
{
|
1184 |
-
return this.enabledInterface === true;
|
1185 |
-
},
|
1186 |
-
|
1187 |
-
// abstract
|
1188 |
-
enableInterface: function() {
|
1189 |
-
var enabled = this._enabled && !this._readonly,
|
1190 |
-
disabled = !enabled;
|
1191 |
-
|
1192 |
-
if (enabled === this.enabledInterface) return false;
|
1193 |
-
|
1194 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
1195 |
-
this.close();
|
1196 |
-
this.enabledInterface = enabled;
|
1197 |
-
|
1198 |
-
return true;
|
1199 |
-
},
|
1200 |
-
|
1201 |
-
// abstract
|
1202 |
-
enable: function(enabled) {
|
1203 |
-
if (enabled === undefined) enabled = true;
|
1204 |
-
if (this._enabled === enabled) return;
|
1205 |
-
this._enabled = enabled;
|
1206 |
-
|
1207 |
-
this.opts.element.prop("disabled", !enabled);
|
1208 |
-
this.enableInterface();
|
1209 |
-
},
|
1210 |
-
|
1211 |
-
// abstract
|
1212 |
-
disable: function() {
|
1213 |
-
this.enable(false);
|
1214 |
-
},
|
1215 |
-
|
1216 |
-
// abstract
|
1217 |
-
readonly: function(enabled) {
|
1218 |
-
if (enabled === undefined) enabled = false;
|
1219 |
-
if (this._readonly === enabled) return;
|
1220 |
-
this._readonly = enabled;
|
1221 |
-
|
1222 |
-
this.opts.element.prop("readonly", enabled);
|
1223 |
-
this.enableInterface();
|
1224 |
-
},
|
1225 |
-
|
1226 |
-
// abstract
|
1227 |
-
opened: function () {
|
1228 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1229 |
-
},
|
1230 |
-
|
1231 |
-
// abstract
|
1232 |
-
positionDropdown: function() {
|
1233 |
-
var $dropdown = this.dropdown,
|
1234 |
-
container = this.container,
|
1235 |
-
offset = container.offset(),
|
1236 |
-
height = container.outerHeight(false),
|
1237 |
-
width = container.outerWidth(false),
|
1238 |
-
dropHeight = $dropdown.outerHeight(false),
|
1239 |
-
$window = $(window),
|
1240 |
-
windowWidth = $window.width(),
|
1241 |
-
windowHeight = $window.height(),
|
1242 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
1243 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
1244 |
-
dropTop = offset.top + height,
|
1245 |
-
dropLeft = offset.left,
|
1246 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1247 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1248 |
-
dropWidth = $dropdown.outerWidth(false),
|
1249 |
-
enoughRoomOnRight = function() {
|
1250 |
-
return dropLeft + dropWidth <= viewPortRight;
|
1251 |
-
},
|
1252 |
-
enoughRoomOnLeft = function() {
|
1253 |
-
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1254 |
-
},
|
1255 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1256 |
-
bodyOffset,
|
1257 |
-
above,
|
1258 |
-
changeDirection,
|
1259 |
-
css,
|
1260 |
-
resultsListNode;
|
1261 |
-
|
1262 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
1263 |
-
if (aboveNow) {
|
1264 |
-
above = true;
|
1265 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
1266 |
-
changeDirection = true;
|
1267 |
-
above = false;
|
1268 |
-
}
|
1269 |
-
} else {
|
1270 |
-
above = false;
|
1271 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
1272 |
-
changeDirection = true;
|
1273 |
-
above = true;
|
1274 |
-
}
|
1275 |
-
}
|
1276 |
-
|
1277 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
1278 |
-
if (changeDirection) {
|
1279 |
-
$dropdown.hide();
|
1280 |
-
offset = this.container.offset();
|
1281 |
-
height = this.container.outerHeight(false);
|
1282 |
-
width = this.container.outerWidth(false);
|
1283 |
-
dropHeight = $dropdown.outerHeight(false);
|
1284 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
1285 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
1286 |
-
dropTop = offset.top + height;
|
1287 |
-
dropLeft = offset.left;
|
1288 |
-
dropWidth = $dropdown.outerWidth(false);
|
1289 |
-
$dropdown.show();
|
1290 |
-
|
1291 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
1292 |
-
this.focusSearch();
|
1293 |
-
}
|
1294 |
-
|
1295 |
-
if (this.opts.dropdownAutoWidth) {
|
1296 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
1297 |
-
$dropdown.addClass('select2-drop-auto-width');
|
1298 |
-
$dropdown.css('width', '');
|
1299 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1300 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1301 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1302 |
-
dropHeight = $dropdown.outerHeight(false);
|
1303 |
-
}
|
1304 |
-
else {
|
1305 |
-
this.container.removeClass('select2-drop-auto-width');
|
1306 |
-
}
|
1307 |
-
|
1308 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1309 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1310 |
-
|
1311 |
-
// fix positioning when body has an offset and is not position: static
|
1312 |
-
if (this.body.css('position') !== 'static') {
|
1313 |
-
bodyOffset = this.body.offset();
|
1314 |
-
dropTop -= bodyOffset.top;
|
1315 |
-
dropLeft -= bodyOffset.left;
|
1316 |
-
}
|
1317 |
-
|
1318 |
-
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1319 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1320 |
-
}
|
1321 |
-
|
1322 |
-
css = {
|
1323 |
-
left: dropLeft,
|
1324 |
-
width: width
|
1325 |
-
};
|
1326 |
-
|
1327 |
-
if (above) {
|
1328 |
-
css.top = offset.top - dropHeight;
|
1329 |
-
css.bottom = 'auto';
|
1330 |
-
this.container.addClass("select2-drop-above");
|
1331 |
-
$dropdown.addClass("select2-drop-above");
|
1332 |
-
}
|
1333 |
-
else {
|
1334 |
-
css.top = dropTop;
|
1335 |
-
css.bottom = 'auto';
|
1336 |
-
this.container.removeClass("select2-drop-above");
|
1337 |
-
$dropdown.removeClass("select2-drop-above");
|
1338 |
-
}
|
1339 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1340 |
-
|
1341 |
-
$dropdown.css(css);
|
1342 |
-
},
|
1343 |
-
|
1344 |
-
// abstract
|
1345 |
-
shouldOpen: function() {
|
1346 |
-
var event;
|
1347 |
-
|
1348 |
-
if (this.opened()) return false;
|
1349 |
-
|
1350 |
-
if (this._enabled === false || this._readonly === true) return false;
|
1351 |
-
|
1352 |
-
event = $.Event("select2-opening");
|
1353 |
-
this.opts.element.trigger(event);
|
1354 |
-
return !event.isDefaultPrevented();
|
1355 |
-
},
|
1356 |
-
|
1357 |
-
// abstract
|
1358 |
-
clearDropdownAlignmentPreference: function() {
|
1359 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1360 |
-
this.container.removeClass("select2-drop-above");
|
1361 |
-
this.dropdown.removeClass("select2-drop-above");
|
1362 |
-
},
|
1363 |
-
|
1364 |
-
/**
|
1365 |
-
* Opens the dropdown
|
1366 |
-
*
|
1367 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1368 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1369 |
-
*/
|
1370 |
-
// abstract
|
1371 |
-
open: function () {
|
1372 |
-
|
1373 |
-
if (!this.shouldOpen()) return false;
|
1374 |
-
|
1375 |
-
this.opening();
|
1376 |
-
|
1377 |
-
// Only bind the document mousemove when the dropdown is visible
|
1378 |
-
$document.on("mousemove.select2Event", function (e) {
|
1379 |
-
lastMousePosition.x = e.pageX;
|
1380 |
-
lastMousePosition.y = e.pageY;
|
1381 |
-
});
|
1382 |
-
|
1383 |
-
return true;
|
1384 |
-
},
|
1385 |
-
|
1386 |
-
/**
|
1387 |
-
* Performs the opening of the dropdown
|
1388 |
-
*/
|
1389 |
-
// abstract
|
1390 |
-
opening: function() {
|
1391 |
-
var cid = this.containerEventName,
|
1392 |
-
scroll = "scroll." + cid,
|
1393 |
-
resize = "resize."+cid,
|
1394 |
-
orient = "orientationchange."+cid,
|
1395 |
-
mask;
|
1396 |
-
|
1397 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1398 |
-
|
1399 |
-
this.clearDropdownAlignmentPreference();
|
1400 |
-
|
1401 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1402 |
-
this.dropdown.detach().appendTo(this.body);
|
1403 |
-
}
|
1404 |
-
|
1405 |
-
// create the dropdown mask if doesn't already exist
|
1406 |
-
mask = $("#select2-drop-mask");
|
1407 |
-
if (mask.length === 0) {
|
1408 |
-
mask = $(document.createElement("div"));
|
1409 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1410 |
-
mask.hide();
|
1411 |
-
mask.appendTo(this.body);
|
1412 |
-
mask.on("mousedown touchstart click", function (e) {
|
1413 |
-
// Prevent IE from generating a click event on the body
|
1414 |
-
reinsertElement(mask);
|
1415 |
-
|
1416 |
-
var dropdown = $("#select2-drop"), self;
|
1417 |
-
if (dropdown.length > 0) {
|
1418 |
-
self=dropdown.data("select2");
|
1419 |
-
if (self.opts.selectOnBlur) {
|
1420 |
-
self.selectHighlighted({noFocus: true});
|
1421 |
-
}
|
1422 |
-
self.close();
|
1423 |
-
e.preventDefault();
|
1424 |
-
e.stopPropagation();
|
1425 |
-
}
|
1426 |
-
});
|
1427 |
-
}
|
1428 |
-
|
1429 |
-
// ensure the mask is always right before the dropdown
|
1430 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
1431 |
-
this.dropdown.before(mask);
|
1432 |
-
}
|
1433 |
-
|
1434 |
-
// move the global id to the correct dropdown
|
1435 |
-
$("#select2-drop").removeAttr("id");
|
1436 |
-
this.dropdown.attr("id", "select2-drop");
|
1437 |
-
|
1438 |
-
// show the elements
|
1439 |
-
mask.show();
|
1440 |
-
|
1441 |
-
this.positionDropdown();
|
1442 |
-
this.dropdown.show();
|
1443 |
-
this.positionDropdown();
|
1444 |
-
|
1445 |
-
this.dropdown.addClass("select2-drop-active");
|
1446 |
-
|
1447 |
-
// attach listeners to events that can change the position of the container and thus require
|
1448 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1449 |
-
var that = this;
|
1450 |
-
this.container.parents().add(window).each(function () {
|
1451 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1452 |
-
if (that.opened()) that.positionDropdown();
|
1453 |
-
});
|
1454 |
-
});
|
1455 |
-
|
1456 |
-
|
1457 |
-
},
|
1458 |
-
|
1459 |
-
// abstract
|
1460 |
-
close: function () {
|
1461 |
-
if (!this.opened()) return;
|
1462 |
-
|
1463 |
-
var cid = this.containerEventName,
|
1464 |
-
scroll = "scroll." + cid,
|
1465 |
-
resize = "resize."+cid,
|
1466 |
-
orient = "orientationchange."+cid;
|
1467 |
-
|
1468 |
-
// unbind event listeners
|
1469 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1470 |
-
|
1471 |
-
this.clearDropdownAlignmentPreference();
|
1472 |
-
|
1473 |
-
$("#select2-drop-mask").hide();
|
1474 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1475 |
-
this.dropdown.hide();
|
1476 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1477 |
-
this.results.empty();
|
1478 |
-
|
1479 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
1480 |
-
$document.off("mousemove.select2Event");
|
1481 |
-
|
1482 |
-
this.clearSearch();
|
1483 |
-
this.search.removeClass("select2-active");
|
1484 |
-
this.opts.element.trigger($.Event("select2-close"));
|
1485 |
-
},
|
1486 |
-
|
1487 |
-
/**
|
1488 |
-
* Opens control, sets input value, and updates results.
|
1489 |
-
*/
|
1490 |
-
// abstract
|
1491 |
-
externalSearch: function (term) {
|
1492 |
-
this.open();
|
1493 |
-
this.search.val(term);
|
1494 |
-
this.updateResults(false);
|
1495 |
-
},
|
1496 |
-
|
1497 |
-
// abstract
|
1498 |
-
clearSearch: function () {
|
1499 |
-
|
1500 |
-
},
|
1501 |
-
|
1502 |
-
//abstract
|
1503 |
-
getMaximumSelectionSize: function() {
|
1504 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1505 |
-
},
|
1506 |
-
|
1507 |
-
// abstract
|
1508 |
-
ensureHighlightVisible: function () {
|
1509 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1510 |
-
|
1511 |
-
index = this.highlight();
|
1512 |
-
|
1513 |
-
if (index < 0) return;
|
1514 |
-
|
1515 |
-
if (index == 0) {
|
1516 |
-
|
1517 |
-
// if the first element is highlighted scroll all the way to the top,
|
1518 |
-
// that way any unselectable headers above it will also be scrolled
|
1519 |
-
// into view
|
1520 |
-
|
1521 |
-
results.scrollTop(0);
|
1522 |
-
return;
|
1523 |
-
}
|
1524 |
-
|
1525 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
1526 |
-
|
1527 |
-
child = $(children[index]);
|
1528 |
-
|
1529 |
-
topOffset = (child.offset() || {}).top || 0;
|
1530 |
-
|
1531 |
-
hb = topOffset + child.outerHeight(true);
|
1532 |
-
|
1533 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
1534 |
-
if (index === children.length - 1) {
|
1535 |
-
more = results.find("li.select2-more-results");
|
1536 |
-
if (more.length > 0) {
|
1537 |
-
hb = more.offset().top + more.outerHeight(true);
|
1538 |
-
}
|
1539 |
-
}
|
1540 |
-
|
1541 |
-
rb = results.offset().top + results.outerHeight(false);
|
1542 |
-
if (hb > rb) {
|
1543 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
1544 |
-
}
|
1545 |
-
y = topOffset - results.offset().top;
|
1546 |
-
|
1547 |
-
// make sure the top of the element is visible
|
1548 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
1549 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
1550 |
-
}
|
1551 |
-
},
|
1552 |
-
|
1553 |
-
// abstract
|
1554 |
-
findHighlightableChoices: function() {
|
1555 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1556 |
-
},
|
1557 |
-
|
1558 |
-
// abstract
|
1559 |
-
moveHighlight: function (delta) {
|
1560 |
-
var choices = this.findHighlightableChoices(),
|
1561 |
-
index = this.highlight();
|
1562 |
-
|
1563 |
-
while (index > -1 && index < choices.length) {
|
1564 |
-
index += delta;
|
1565 |
-
var choice = $(choices[index]);
|
1566 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1567 |
-
this.highlight(index);
|
1568 |
-
break;
|
1569 |
-
}
|
1570 |
-
}
|
1571 |
-
},
|
1572 |
-
|
1573 |
-
// abstract
|
1574 |
-
highlight: function (index) {
|
1575 |
-
var choices = this.findHighlightableChoices(),
|
1576 |
-
choice,
|
1577 |
-
data;
|
1578 |
-
|
1579 |
-
if (arguments.length === 0) {
|
1580 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1581 |
-
}
|
1582 |
-
|
1583 |
-
if (index >= choices.length) index = choices.length - 1;
|
1584 |
-
if (index < 0) index = 0;
|
1585 |
-
|
1586 |
-
this.removeHighlight();
|
1587 |
-
|
1588 |
-
choice = $(choices[index]);
|
1589 |
-
choice.addClass("select2-highlighted");
|
1590 |
-
|
1591 |
-
// ensure assistive technology can determine the active choice
|
1592 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1593 |
-
|
1594 |
-
this.ensureHighlightVisible();
|
1595 |
-
|
1596 |
-
this.liveRegion.text(choice.text());
|
1597 |
-
|
1598 |
-
data = choice.data("select2-data");
|
1599 |
-
if (data) {
|
1600 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1601 |
-
}
|
1602 |
-
},
|
1603 |
-
|
1604 |
-
removeHighlight: function() {
|
1605 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1606 |
-
},
|
1607 |
-
|
1608 |
-
touchMoved: function() {
|
1609 |
-
this._touchMoved = true;
|
1610 |
-
},
|
1611 |
-
|
1612 |
-
clearTouchMoved: function() {
|
1613 |
-
this._touchMoved = false;
|
1614 |
-
},
|
1615 |
-
|
1616 |
-
// abstract
|
1617 |
-
countSelectableResults: function() {
|
1618 |
-
return this.findHighlightableChoices().length;
|
1619 |
-
},
|
1620 |
-
|
1621 |
-
// abstract
|
1622 |
-
highlightUnderEvent: function (event) {
|
1623 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
1624 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1625 |
-
var choices = this.findHighlightableChoices();
|
1626 |
-
this.highlight(choices.index(el));
|
1627 |
-
} else if (el.length == 0) {
|
1628 |
-
// if we are over an unselectable item remove all highlights
|
1629 |
-
this.removeHighlight();
|
1630 |
-
}
|
1631 |
-
},
|
1632 |
-
|
1633 |
-
// abstract
|
1634 |
-
loadMoreIfNeeded: function () {
|
1635 |
-
var results = this.results,
|
1636 |
-
more = results.find("li.select2-more-results"),
|
1637 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1638 |
-
page = this.resultsPage + 1,
|
1639 |
-
self=this,
|
1640 |
-
term=this.search.val(),
|
1641 |
-
context=this.context;
|
1642 |
-
|
1643 |
-
if (more.length === 0) return;
|
1644 |
-
below = more.offset().top - results.offset().top - results.height();
|
1645 |
-
|
1646 |
-
if (below <= this.opts.loadMorePadding) {
|
1647 |
-
more.addClass("select2-active");
|
1648 |
-
this.opts.query({
|
1649 |
-
element: this.opts.element,
|
1650 |
-
term: term,
|
1651 |
-
page: page,
|
1652 |
-
context: context,
|
1653 |
-
matcher: this.opts.matcher,
|
1654 |
-
callback: this.bind(function (data) {
|
1655 |
-
|
1656 |
-
// ignore a response if the select2 has been closed before it was received
|
1657 |
-
if (!self.opened()) return;
|
1658 |
-
|
1659 |
-
|
1660 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1661 |
-
self.postprocessResults(data, false, false);
|
1662 |
-
|
1663 |
-
if (data.more===true) {
|
1664 |
-
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1665 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1666 |
-
} else {
|
1667 |
-
more.remove();
|
1668 |
-
}
|
1669 |
-
self.positionDropdown();
|
1670 |
-
self.resultsPage = page;
|
1671 |
-
self.context = data.context;
|
1672 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1673 |
-
})});
|
1674 |
-
}
|
1675 |
-
},
|
1676 |
-
|
1677 |
-
/**
|
1678 |
-
* Default tokenizer function which does nothing
|
1679 |
-
*/
|
1680 |
-
tokenize: function() {
|
1681 |
-
|
1682 |
-
},
|
1683 |
-
|
1684 |
-
/**
|
1685 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1686 |
-
*/
|
1687 |
-
// abstract
|
1688 |
-
updateResults: function (initial) {
|
1689 |
-
var search = this.search,
|
1690 |
-
results = this.results,
|
1691 |
-
opts = this.opts,
|
1692 |
-
data,
|
1693 |
-
self = this,
|
1694 |
-
input,
|
1695 |
-
term = search.val(),
|
1696 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
1697 |
-
// sequence number used to drop out-of-order responses
|
1698 |
-
queryNumber;
|
1699 |
-
|
1700 |
-
// prevent duplicate queries against the same term
|
1701 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1702 |
-
|
1703 |
-
$.data(this.container, "select2-last-term", term);
|
1704 |
-
|
1705 |
-
// if the search is currently hidden we do not alter the results
|
1706 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1707 |
-
return;
|
1708 |
-
}
|
1709 |
-
|
1710 |
-
function postRender() {
|
1711 |
-
search.removeClass("select2-active");
|
1712 |
-
self.positionDropdown();
|
1713 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1714 |
-
self.liveRegion.text(results.text());
|
1715 |
-
}
|
1716 |
-
else {
|
1717 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1718 |
-
}
|
1719 |
-
}
|
1720 |
-
|
1721 |
-
function render(html) {
|
1722 |
-
results.html(html);
|
1723 |
-
postRender();
|
1724 |
-
}
|
1725 |
-
|
1726 |
-
queryNumber = ++this.queryCount;
|
1727 |
-
|
1728 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
1729 |
-
if (maxSelSize >=1) {
|
1730 |
-
data = this.data();
|
1731 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1732 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1733 |
-
return;
|
1734 |
-
}
|
1735 |
-
}
|
1736 |
-
|
1737 |
-
if (search.val().length < opts.minimumInputLength) {
|
1738 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1739 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1740 |
-
} else {
|
1741 |
-
render("");
|
1742 |
-
}
|
1743 |
-
if (initial && this.showSearch) this.showSearch(true);
|
1744 |
-
return;
|
1745 |
-
}
|
1746 |
-
|
1747 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1748 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1749 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1750 |
-
} else {
|
1751 |
-
render("");
|
1752 |
-
}
|
1753 |
-
return;
|
1754 |
-
}
|
1755 |
-
|
1756 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1757 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1758 |
-
}
|
1759 |
-
|
1760 |
-
search.addClass("select2-active");
|
1761 |
-
|
1762 |
-
this.removeHighlight();
|
1763 |
-
|
1764 |
-
// give the tokenizer a chance to pre-process the input
|
1765 |
-
input = this.tokenize();
|
1766 |
-
if (input != undefined && input != null) {
|
1767 |
-
search.val(input);
|
1768 |
-
}
|
1769 |
-
|
1770 |
-
this.resultsPage = 1;
|
1771 |
-
|
1772 |
-
opts.query({
|
1773 |
-
element: opts.element,
|
1774 |
-
term: search.val(),
|
1775 |
-
page: this.resultsPage,
|
1776 |
-
context: null,
|
1777 |
-
matcher: opts.matcher,
|
1778 |
-
callback: this.bind(function (data) {
|
1779 |
-
var def; // default choice
|
1780 |
-
|
1781 |
-
// ignore old responses
|
1782 |
-
if (queryNumber != this.queryCount) {
|
1783 |
-
return;
|
1784 |
-
}
|
1785 |
-
|
1786 |
-
// ignore a response if the select2 has been closed before it was received
|
1787 |
-
if (!this.opened()) {
|
1788 |
-
this.search.removeClass("select2-active");
|
1789 |
-
return;
|
1790 |
-
}
|
1791 |
-
|
1792 |
-
// handle ajax error
|
1793 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1794 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1795 |
-
return;
|
1796 |
-
}
|
1797 |
-
|
1798 |
-
// save context, if any
|
1799 |
-
this.context = (data.context===undefined) ? null : data.context;
|
1800 |
-
// create a default choice and prepend it to the list
|
1801 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
1802 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1803 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1804 |
-
if ($(data.results).filter(
|
1805 |
-
function () {
|
1806 |
-
return equal(self.id(this), self.id(def));
|
1807 |
-
}).length === 0) {
|
1808 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
1809 |
-
}
|
1810 |
-
}
|
1811 |
-
}
|
1812 |
-
|
1813 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1814 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1815 |
-
return;
|
1816 |
-
}
|
1817 |
-
|
1818 |
-
results.empty();
|
1819 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1820 |
-
|
1821 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
1822 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
1823 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1824 |
-
}
|
1825 |
-
|
1826 |
-
this.postprocessResults(data, initial);
|
1827 |
-
|
1828 |
-
postRender();
|
1829 |
-
|
1830 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1831 |
-
})});
|
1832 |
-
},
|
1833 |
-
|
1834 |
-
// abstract
|
1835 |
-
cancel: function () {
|
1836 |
-
this.close();
|
1837 |
-
},
|
1838 |
-
|
1839 |
-
// abstract
|
1840 |
-
blur: function () {
|
1841 |
-
// if selectOnBlur == true, select the currently highlighted option
|
1842 |
-
if (this.opts.selectOnBlur)
|
1843 |
-
this.selectHighlighted({noFocus: true});
|
1844 |
-
|
1845 |
-
this.close();
|
1846 |
-
this.container.removeClass("select2-container-active");
|
1847 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
1848 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
1849 |
-
this.clearSearch();
|
1850 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
1851 |
-
},
|
1852 |
-
|
1853 |
-
// abstract
|
1854 |
-
focusSearch: function () {
|
1855 |
-
focus(this.search);
|
1856 |
-
},
|
1857 |
-
|
1858 |
-
// abstract
|
1859 |
-
selectHighlighted: function (options) {
|
1860 |
-
if (this._touchMoved) {
|
1861 |
-
this.clearTouchMoved();
|
1862 |
-
return;
|
1863 |
-
}
|
1864 |
-
var index=this.highlight(),
|
1865 |
-
highlighted=this.results.find(".select2-highlighted"),
|
1866 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
1867 |
-
|
1868 |
-
if (data) {
|
1869 |
-
this.highlight(index);
|
1870 |
-
this.onSelect(data, options);
|
1871 |
-
} else if (options && options.noFocus) {
|
1872 |
-
this.close();
|
1873 |
-
}
|
1874 |
-
},
|
1875 |
-
|
1876 |
-
// abstract
|
1877 |
-
getPlaceholder: function () {
|
1878 |
-
var placeholderOption;
|
1879 |
-
return this.opts.element.attr("placeholder") ||
|
1880 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
1881 |
-
this.opts.element.data("placeholder") ||
|
1882 |
-
this.opts.placeholder ||
|
1883 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
1884 |
-
},
|
1885 |
-
|
1886 |
-
// abstract
|
1887 |
-
getPlaceholderOption: function() {
|
1888 |
-
if (this.select) {
|
1889 |
-
var firstOption = this.select.children('option').first();
|
1890 |
-
if (this.opts.placeholderOption !== undefined ) {
|
1891 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
1892 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
1893 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
1894 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
1895 |
-
//No explicit placeholder option specified, use the first if it's blank
|
1896 |
-
return firstOption;
|
1897 |
-
}
|
1898 |
-
}
|
1899 |
-
},
|
1900 |
-
|
1901 |
-
/**
|
1902 |
-
* Get the desired width for the container element. This is
|
1903 |
-
* derived first from option `width` passed to select2, then
|
1904 |
-
* the inline 'style' on the original element, and finally
|
1905 |
-
* falls back to the jQuery calculated element width.
|
1906 |
-
*/
|
1907 |
-
// abstract
|
1908 |
-
initContainerWidth: function () {
|
1909 |
-
function resolveContainerWidth() {
|
1910 |
-
var style, attrs, matches, i, l, attr;
|
1911 |
-
|
1912 |
-
if (this.opts.width === "off") {
|
1913 |
-
return null;
|
1914 |
-
} else if (this.opts.width === "element"){
|
1915 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
1916 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
1917 |
-
// check if there is inline style on the element that contains width
|
1918 |
-
style = this.opts.element.attr('style');
|
1919 |
-
if (style !== undefined) {
|
1920 |
-
attrs = style.split(';');
|
1921 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
1922 |
-
attr = attrs[i].replace(/\s/g, '');
|
1923 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
1924 |
-
if (matches !== null && matches.length >= 1)
|
1925 |
-
return matches[1];
|
1926 |
-
}
|
1927 |
-
}
|
1928 |
-
|
1929 |
-
if (this.opts.width === "resolve") {
|
1930 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
1931 |
-
// when attached to input type=hidden or elements hidden via css
|
1932 |
-
style = this.opts.element.css('width');
|
1933 |
-
if (style.indexOf("%") > 0) return style;
|
1934 |
-
|
1935 |
-
// finally, fallback on the calculated width of the element
|
1936 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
1937 |
-
}
|
1938 |
-
|
1939 |
-
return null;
|
1940 |
-
} else if ($.isFunction(this.opts.width)) {
|
1941 |
-
return this.opts.width();
|
1942 |
-
} else {
|
1943 |
-
return this.opts.width;
|
1944 |
-
}
|
1945 |
-
};
|
1946 |
-
|
1947 |
-
var width = resolveContainerWidth.call(this);
|
1948 |
-
if (width !== null) {
|
1949 |
-
this.container.css("width", width);
|
1950 |
-
}
|
1951 |
-
}
|
1952 |
-
});
|
1953 |
-
|
1954 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
1955 |
-
|
1956 |
-
// single
|
1957 |
-
|
1958 |
-
createContainer: function () {
|
1959 |
-
var container = $(document.createElement("div")).attr({
|
1960 |
-
"class": "select2-container"
|
1961 |
-
}).html([
|
1962 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
1963 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
1964 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
1965 |
-
"</a>",
|
1966 |
-
"<label for='' class='select2-offscreen'></label>",
|
1967 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
1968 |
-
"<div class='select2-drop select2-display-none'>",
|
1969 |
-
" <div class='select2-search'>",
|
1970 |
-
" <label for='' class='select2-offscreen'></label>",
|
1971 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
1972 |
-
" aria-autocomplete='list' />",
|
1973 |
-
" </div>",
|
1974 |
-
" <ul class='select2-results' role='listbox'>",
|
1975 |
-
" </ul>",
|
1976 |
-
"</div>"].join(""));
|
1977 |
-
return container;
|
1978 |
-
},
|
1979 |
-
|
1980 |
-
// single
|
1981 |
-
enableInterface: function() {
|
1982 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
1983 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
1984 |
-
}
|
1985 |
-
},
|
1986 |
-
|
1987 |
-
// single
|
1988 |
-
opening: function () {
|
1989 |
-
var el, range, len;
|
1990 |
-
|
1991 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
1992 |
-
this.showSearch(true);
|
1993 |
-
}
|
1994 |
-
|
1995 |
-
this.parent.opening.apply(this, arguments);
|
1996 |
-
|
1997 |
-
if (this.showSearchInput !== false) {
|
1998 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
1999 |
-
// all other browsers handle this just fine
|
2000 |
-
|
2001 |
-
this.search.val(this.focusser.val());
|
2002 |
-
}
|
2003 |
-
if (this.opts.shouldFocusInput(this)) {
|
2004 |
-
this.search.focus();
|
2005 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2006 |
-
// new text will appear *before* focusser.val()
|
2007 |
-
el = this.search.get(0);
|
2008 |
-
if (el.createTextRange) {
|
2009 |
-
range = el.createTextRange();
|
2010 |
-
range.collapse(false);
|
2011 |
-
range.select();
|
2012 |
-
} else if (el.setSelectionRange) {
|
2013 |
-
len = this.search.val().length;
|
2014 |
-
el.setSelectionRange(len, len);
|
2015 |
-
}
|
2016 |
-
}
|
2017 |
-
|
2018 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
2019 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2020 |
-
if(this.search.val() === "") {
|
2021 |
-
if(this.nextSearchTerm != undefined){
|
2022 |
-
this.search.val(this.nextSearchTerm);
|
2023 |
-
this.search.select();
|
2024 |
-
}
|
2025 |
-
}
|
2026 |
-
|
2027 |
-
this.focusser.prop("disabled", true).val("");
|
2028 |
-
this.updateResults(true);
|
2029 |
-
this.opts.element.trigger($.Event("select2-open"));
|
2030 |
-
},
|
2031 |
-
|
2032 |
-
// single
|
2033 |
-
close: function () {
|
2034 |
-
if (!this.opened()) return;
|
2035 |
-
this.parent.close.apply(this, arguments);
|
2036 |
-
|
2037 |
-
this.focusser.prop("disabled", false);
|
2038 |
-
|
2039 |
-
if (this.opts.shouldFocusInput(this)) {
|
2040 |
-
this.focusser.focus();
|
2041 |
-
}
|
2042 |
-
},
|
2043 |
-
|
2044 |
-
// single
|
2045 |
-
focus: function () {
|
2046 |
-
if (this.opened()) {
|
2047 |
-
this.close();
|
2048 |
-
} else {
|
2049 |
-
this.focusser.prop("disabled", false);
|
2050 |
-
if (this.opts.shouldFocusInput(this)) {
|
2051 |
-
this.focusser.focus();
|
2052 |
-
}
|
2053 |
-
}
|
2054 |
-
},
|
2055 |
-
|
2056 |
-
// single
|
2057 |
-
isFocused: function () {
|
2058 |
-
return this.container.hasClass("select2-container-active");
|
2059 |
-
},
|
2060 |
-
|
2061 |
-
// single
|
2062 |
-
cancel: function () {
|
2063 |
-
this.parent.cancel.apply(this, arguments);
|
2064 |
-
this.focusser.prop("disabled", false);
|
2065 |
-
|
2066 |
-
if (this.opts.shouldFocusInput(this)) {
|
2067 |
-
this.focusser.focus();
|
2068 |
-
}
|
2069 |
-
},
|
2070 |
-
|
2071 |
-
// single
|
2072 |
-
destroy: function() {
|
2073 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
2074 |
-
.attr('for', this.opts.element.attr("id"));
|
2075 |
-
this.parent.destroy.apply(this, arguments);
|
2076 |
-
|
2077 |
-
cleanupJQueryElements.call(this,
|
2078 |
-
"selection",
|
2079 |
-
"focusser"
|
2080 |
-
);
|
2081 |
-
},
|
2082 |
-
|
2083 |
-
// single
|
2084 |
-
initContainer: function () {
|
2085 |
-
|
2086 |
-
var selection,
|
2087 |
-
container = this.container,
|
2088 |
-
dropdown = this.dropdown,
|
2089 |
-
idSuffix = nextUid(),
|
2090 |
-
elementLabel;
|
2091 |
-
|
2092 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
2093 |
-
this.showSearch(false);
|
2094 |
-
} else {
|
2095 |
-
this.showSearch(true);
|
2096 |
-
}
|
2097 |
-
|
2098 |
-
this.selection = selection = container.find(".select2-choice");
|
2099 |
-
|
2100 |
-
this.focusser = container.find(".select2-focusser");
|
2101 |
-
|
2102 |
-
// add aria associations
|
2103 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2104 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2105 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
2106 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2107 |
-
|
2108 |
-
// rewrite labels from original element to focusser
|
2109 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2110 |
-
|
2111 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2112 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2113 |
-
|
2114 |
-
this.focusser.prev()
|
2115 |
-
.text(elementLabel.text())
|
2116 |
-
.attr('for', this.focusser.attr('id'));
|
2117 |
-
|
2118 |
-
// Ensure the original element retains an accessible name
|
2119 |
-
var originalTitle = this.opts.element.attr("title");
|
2120 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2121 |
-
|
2122 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
2123 |
-
|
2124 |
-
// write label for search field using the label from the focusser element
|
2125 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2126 |
-
|
2127 |
-
this.search.prev()
|
2128 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2129 |
-
.attr('for', this.search.attr('id'));
|
2130 |
-
|
2131 |
-
this.search.on("keydown", this.bind(function (e) {
|
2132 |
-
if (!this.isInterfaceEnabled()) return;
|
2133 |
-
|
2134 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
2135 |
-
if (229 == e.keyCode) return;
|
2136 |
-
|
2137 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2138 |
-
// prevent the page from scrolling
|
2139 |
-
killEvent(e);
|
2140 |
-
return;
|
2141 |
-
}
|
2142 |
-
|
2143 |
-
switch (e.which) {
|
2144 |
-
case KEY.UP:
|
2145 |
-
case KEY.DOWN:
|
2146 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2147 |
-
killEvent(e);
|
2148 |
-
return;
|
2149 |
-
case KEY.ENTER:
|
2150 |
-
this.selectHighlighted();
|
2151 |
-
killEvent(e);
|
2152 |
-
return;
|
2153 |
-
case KEY.TAB:
|
2154 |
-
this.selectHighlighted({noFocus: true});
|
2155 |
-
return;
|
2156 |
-
case KEY.ESC:
|
2157 |
-
this.cancel(e);
|
2158 |
-
killEvent(e);
|
2159 |
-
return;
|
2160 |
-
}
|
2161 |
-
}));
|
2162 |
-
|
2163 |
-
this.search.on("blur", this.bind(function(e) {
|
2164 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2165 |
-
// without this the search field loses focus which is annoying
|
2166 |
-
if (document.activeElement === this.body.get(0)) {
|
2167 |
-
window.setTimeout(this.bind(function() {
|
2168 |
-
if (this.opened()) {
|
2169 |
-
this.search.focus();
|
2170 |
-
}
|
2171 |
-
}), 0);
|
2172 |
-
}
|
2173 |
-
}));
|
2174 |
-
|
2175 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
2176 |
-
if (!this.isInterfaceEnabled()) return;
|
2177 |
-
|
2178 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2179 |
-
return;
|
2180 |
-
}
|
2181 |
-
|
2182 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2183 |
-
killEvent(e);
|
2184 |
-
return;
|
2185 |
-
}
|
2186 |
-
|
2187 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2188 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2189 |
-
|
2190 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2191 |
-
|
2192 |
-
this.open();
|
2193 |
-
killEvent(e);
|
2194 |
-
return;
|
2195 |
-
}
|
2196 |
-
|
2197 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2198 |
-
if (this.opts.allowClear) {
|
2199 |
-
this.clear();
|
2200 |
-
}
|
2201 |
-
killEvent(e);
|
2202 |
-
return;
|
2203 |
-
}
|
2204 |
-
}));
|
2205 |
-
|
2206 |
-
|
2207 |
-
installKeyUpChangeEvent(this.focusser);
|
2208 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2209 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
2210 |
-
e.stopPropagation();
|
2211 |
-
if (this.opened()) return;
|
2212 |
-
this.open();
|
2213 |
-
}
|
2214 |
-
}));
|
2215 |
-
|
2216 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2217 |
-
if (!this.isInterfaceEnabled()) {
|
2218 |
-
return;
|
2219 |
-
}
|
2220 |
-
|
2221 |
-
this.clear();
|
2222 |
-
killEventImmediately(e);
|
2223 |
-
this.close();
|
2224 |
-
|
2225 |
-
if (this.selection) {
|
2226 |
-
this.selection.focus();
|
2227 |
-
}
|
2228 |
-
}));
|
2229 |
-
|
2230 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
2231 |
-
// Prevent IE from generating a click event on the body
|
2232 |
-
reinsertElement(selection);
|
2233 |
-
|
2234 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2235 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2236 |
-
}
|
2237 |
-
|
2238 |
-
if (this.opened()) {
|
2239 |
-
this.close();
|
2240 |
-
} else if (this.isInterfaceEnabled()) {
|
2241 |
-
this.open();
|
2242 |
-
}
|
2243 |
-
|
2244 |
-
killEvent(e);
|
2245 |
-
}));
|
2246 |
-
|
2247 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
2248 |
-
if (this.opts.shouldFocusInput(this)) {
|
2249 |
-
this.search.focus();
|
2250 |
-
}
|
2251 |
-
}));
|
2252 |
-
|
2253 |
-
selection.on("focus", this.bind(function(e) {
|
2254 |
-
killEvent(e);
|
2255 |
-
}));
|
2256 |
-
|
2257 |
-
this.focusser.on("focus", this.bind(function(){
|
2258 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2259 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2260 |
-
}
|
2261 |
-
this.container.addClass("select2-container-active");
|
2262 |
-
})).on("blur", this.bind(function() {
|
2263 |
-
if (!this.opened()) {
|
2264 |
-
this.container.removeClass("select2-container-active");
|
2265 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
2266 |
-
}
|
2267 |
-
}));
|
2268 |
-
this.search.on("focus", this.bind(function(){
|
2269 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2270 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2271 |
-
}
|
2272 |
-
this.container.addClass("select2-container-active");
|
2273 |
-
}));
|
2274 |
-
|
2275 |
-
this.initContainerWidth();
|
2276 |
-
this.opts.element.hide();
|
2277 |
-
this.setPlaceholder();
|
2278 |
-
|
2279 |
-
},
|
2280 |
-
|
2281 |
-
// single
|
2282 |
-
clear: function(triggerChange) {
|
2283 |
-
var data=this.selection.data("select2-data");
|
2284 |
-
if (data) { // guard against queued quick consecutive clicks
|
2285 |
-
var evt = $.Event("select2-clearing");
|
2286 |
-
this.opts.element.trigger(evt);
|
2287 |
-
if (evt.isDefaultPrevented()) {
|
2288 |
-
return;
|
2289 |
-
}
|
2290 |
-
var placeholderOption = this.getPlaceholderOption();
|
2291 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2292 |
-
this.selection.find(".select2-chosen").empty();
|
2293 |
-
this.selection.removeData("select2-data");
|
2294 |
-
this.setPlaceholder();
|
2295 |
-
|
2296 |
-
if (triggerChange !== false){
|
2297 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2298 |
-
this.triggerChange({removed:data});
|
2299 |
-
}
|
2300 |
-
}
|
2301 |
-
},
|
2302 |
-
|
2303 |
-
/**
|
2304 |
-
* Sets selection based on source element's value
|
2305 |
-
*/
|
2306 |
-
// single
|
2307 |
-
initSelection: function () {
|
2308 |
-
var selected;
|
2309 |
-
if (this.isPlaceholderOptionSelected()) {
|
2310 |
-
this.updateSelection(null);
|
2311 |
-
this.close();
|
2312 |
-
this.setPlaceholder();
|
2313 |
-
} else {
|
2314 |
-
var self = this;
|
2315 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2316 |
-
if (selected !== undefined && selected !== null) {
|
2317 |
-
self.updateSelection(selected);
|
2318 |
-
self.close();
|
2319 |
-
self.setPlaceholder();
|
2320 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
2321 |
-
}
|
2322 |
-
});
|
2323 |
-
}
|
2324 |
-
},
|
2325 |
-
|
2326 |
-
isPlaceholderOptionSelected: function() {
|
2327 |
-
var placeholderOption;
|
2328 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2329 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2330 |
-
|| (this.opts.element.val() === "")
|
2331 |
-
|| (this.opts.element.val() === undefined)
|
2332 |
-
|| (this.opts.element.val() === null);
|
2333 |
-
},
|
2334 |
-
|
2335 |
-
// single
|
2336 |
-
prepareOpts: function () {
|
2337 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2338 |
-
self=this;
|
2339 |
-
|
2340 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2341 |
-
// install the selection initializer
|
2342 |
-
opts.initSelection = function (element, callback) {
|
2343 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2344 |
-
// a single select box always has a value, no need to null check 'selected'
|
2345 |
-
callback(self.optionToData(selected));
|
2346 |
-
};
|
2347 |
-
} else if ("data" in opts) {
|
2348 |
-
// install default initSelection when applied to hidden input and data is local
|
2349 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2350 |
-
var id = element.val();
|
2351 |
-
//search in data by id, storing the actual matching item
|
2352 |
-
var match = null;
|
2353 |
-
opts.query({
|
2354 |
-
matcher: function(term, text, el){
|
2355 |
-
var is_match = equal(id, opts.id(el));
|
2356 |
-
if (is_match) {
|
2357 |
-
match = el;
|
2358 |
-
}
|
2359 |
-
return is_match;
|
2360 |
-
},
|
2361 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2362 |
-
callback(match);
|
2363 |
-
}
|
2364 |
-
});
|
2365 |
-
};
|
2366 |
-
}
|
2367 |
-
|
2368 |
-
return opts;
|
2369 |
-
},
|
2370 |
-
|
2371 |
-
// single
|
2372 |
-
getPlaceholder: function() {
|
2373 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2374 |
-
if (this.select) {
|
2375 |
-
if (this.getPlaceholderOption() === undefined) {
|
2376 |
-
return undefined;
|
2377 |
-
}
|
2378 |
-
}
|
2379 |
-
|
2380 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
2381 |
-
},
|
2382 |
-
|
2383 |
-
// single
|
2384 |
-
setPlaceholder: function () {
|
2385 |
-
var placeholder = this.getPlaceholder();
|
2386 |
-
|
2387 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2388 |
-
|
2389 |
-
// check for a placeholder option if attached to a select
|
2390 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2391 |
-
|
2392 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2393 |
-
|
2394 |
-
this.selection.addClass("select2-default");
|
2395 |
-
|
2396 |
-
this.container.removeClass("select2-allowclear");
|
2397 |
-
}
|
2398 |
-
},
|
2399 |
-
|
2400 |
-
// single
|
2401 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2402 |
-
var selected = 0, self = this, showSearchInput = true;
|
2403 |
-
|
2404 |
-
// find the selected element in the result list
|
2405 |
-
|
2406 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
2407 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2408 |
-
selected = i;
|
2409 |
-
return false;
|
2410 |
-
}
|
2411 |
-
});
|
2412 |
-
|
2413 |
-
// and highlight it
|
2414 |
-
if (noHighlightUpdate !== false) {
|
2415 |
-
if (initial === true && selected >= 0) {
|
2416 |
-
this.highlight(selected);
|
2417 |
-
} else {
|
2418 |
-
this.highlight(0);
|
2419 |
-
}
|
2420 |
-
}
|
2421 |
-
|
2422 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
2423 |
-
|
2424 |
-
if (initial === true) {
|
2425 |
-
var min = this.opts.minimumResultsForSearch;
|
2426 |
-
if (min >= 0) {
|
2427 |
-
this.showSearch(countResults(data.results) >= min);
|
2428 |
-
}
|
2429 |
-
}
|
2430 |
-
},
|
2431 |
-
|
2432 |
-
// single
|
2433 |
-
showSearch: function(showSearchInput) {
|
2434 |
-
if (this.showSearchInput === showSearchInput) return;
|
2435 |
-
|
2436 |
-
this.showSearchInput = showSearchInput;
|
2437 |
-
|
2438 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2439 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2440 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
2441 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2442 |
-
},
|
2443 |
-
|
2444 |
-
// single
|
2445 |
-
onSelect: function (data, options) {
|
2446 |
-
|
2447 |
-
if (!this.triggerSelect(data)) { return; }
|
2448 |
-
|
2449 |
-
var old = this.opts.element.val(),
|
2450 |
-
oldData = this.data();
|
2451 |
-
|
2452 |
-
this.opts.element.val(this.id(data));
|
2453 |
-
this.updateSelection(data);
|
2454 |
-
|
2455 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2456 |
-
|
2457 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
2458 |
-
this.close();
|
2459 |
-
|
2460 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2461 |
-
this.focusser.focus();
|
2462 |
-
}
|
2463 |
-
|
2464 |
-
if (!equal(old, this.id(data))) {
|
2465 |
-
this.triggerChange({ added: data, removed: oldData });
|
2466 |
-
}
|
2467 |
-
},
|
2468 |
-
|
2469 |
-
// single
|
2470 |
-
updateSelection: function (data) {
|
2471 |
-
|
2472 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2473 |
-
|
2474 |
-
this.selection.data("select2-data", data);
|
2475 |
-
|
2476 |
-
container.empty();
|
2477 |
-
if (data !== null) {
|
2478 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2479 |
-
}
|
2480 |
-
if (formatted !== undefined) {
|
2481 |
-
container.append(formatted);
|
2482 |
-
}
|
2483 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2484 |
-
if (cssClass !== undefined) {
|
2485 |
-
container.addClass(cssClass);
|
2486 |
-
}
|
2487 |
-
|
2488 |
-
this.selection.removeClass("select2-default");
|
2489 |
-
|
2490 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2491 |
-
this.container.addClass("select2-allowclear");
|
2492 |
-
}
|
2493 |
-
},
|
2494 |
-
|
2495 |
-
// single
|
2496 |
-
val: function () {
|
2497 |
-
var val,
|
2498 |
-
triggerChange = false,
|
2499 |
-
data = null,
|
2500 |
-
self = this,
|
2501 |
-
oldData = this.data();
|
2502 |
-
|
2503 |
-
if (arguments.length === 0) {
|
2504 |
-
return this.opts.element.val();
|
2505 |
-
}
|
2506 |
-
|
2507 |
-
val = arguments[0];
|
2508 |
-
|
2509 |
-
if (arguments.length > 1) {
|
2510 |
-
triggerChange = arguments[1];
|
2511 |
-
}
|
2512 |
-
|
2513 |
-
if (this.select) {
|
2514 |
-
this.select
|
2515 |
-
.val(val)
|
2516 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2517 |
-
data = self.optionToData(elm);
|
2518 |
-
return false;
|
2519 |
-
});
|
2520 |
-
this.updateSelection(data);
|
2521 |
-
this.setPlaceholder();
|
2522 |
-
if (triggerChange) {
|
2523 |
-
this.triggerChange({added: data, removed:oldData});
|
2524 |
-
}
|
2525 |
-
} else {
|
2526 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2527 |
-
if (!val && val !== 0) {
|
2528 |
-
this.clear(triggerChange);
|
2529 |
-
return;
|
2530 |
-
}
|
2531 |
-
if (this.opts.initSelection === undefined) {
|
2532 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
2533 |
-
}
|
2534 |
-
this.opts.element.val(val);
|
2535 |
-
this.opts.initSelection(this.opts.element, function(data){
|
2536 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
2537 |
-
self.updateSelection(data);
|
2538 |
-
self.setPlaceholder();
|
2539 |
-
if (triggerChange) {
|
2540 |
-
self.triggerChange({added: data, removed:oldData});
|
2541 |
-
}
|
2542 |
-
});
|
2543 |
-
}
|
2544 |
-
},
|
2545 |
-
|
2546 |
-
// single
|
2547 |
-
clearSearch: function () {
|
2548 |
-
this.search.val("");
|
2549 |
-
this.focusser.val("");
|
2550 |
-
},
|
2551 |
-
|
2552 |
-
// single
|
2553 |
-
data: function(value) {
|
2554 |
-
var data,
|
2555 |
-
triggerChange = false;
|
2556 |
-
|
2557 |
-
if (arguments.length === 0) {
|
2558 |
-
data = this.selection.data("select2-data");
|
2559 |
-
if (data == undefined) data = null;
|
2560 |
-
return data;
|
2561 |
-
} else {
|
2562 |
-
if (arguments.length > 1) {
|
2563 |
-
triggerChange = arguments[1];
|
2564 |
-
}
|
2565 |
-
if (!value) {
|
2566 |
-
this.clear(triggerChange);
|
2567 |
-
} else {
|
2568 |
-
data = this.data();
|
2569 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
2570 |
-
this.updateSelection(value);
|
2571 |
-
if (triggerChange) {
|
2572 |
-
this.triggerChange({added: value, removed:data});
|
2573 |
-
}
|
2574 |
-
}
|
2575 |
-
}
|
2576 |
-
}
|
2577 |
-
});
|
2578 |
-
|
2579 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
2580 |
-
|
2581 |
-
// multi
|
2582 |
-
createContainer: function () {
|
2583 |
-
var container = $(document.createElement("div")).attr({
|
2584 |
-
"class": "select2-container select2-container-multi"
|
2585 |
-
}).html([
|
2586 |
-
"<ul class='select2-choices'>",
|
2587 |
-
" <li class='select2-search-field'>",
|
2588 |
-
" <label for='' class='select2-offscreen'></label>",
|
2589 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2590 |
-
" </li>",
|
2591 |
-
"</ul>",
|
2592 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2593 |
-
" <ul class='select2-results'>",
|
2594 |
-
" </ul>",
|
2595 |
-
"</div>"].join(""));
|
2596 |
-
return container;
|
2597 |
-
},
|
2598 |
-
|
2599 |
-
// multi
|
2600 |
-
prepareOpts: function () {
|
2601 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2602 |
-
self=this;
|
2603 |
-
|
2604 |
-
// TODO validate placeholder is a string if specified
|
2605 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2606 |
-
// install the selection initializer
|
2607 |
-
opts.initSelection = function (element, callback) {
|
2608 |
-
|
2609 |
-
var data = [];
|
2610 |
-
|
2611 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2612 |
-
data.push(self.optionToData(elm));
|
2613 |
-
});
|
2614 |
-
callback(data);
|
2615 |
-
};
|
2616 |
-
} else if ("data" in opts) {
|
2617 |
-
// install default initSelection when applied to hidden input and data is local
|
2618 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2619 |
-
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2620 |
-
//search in data by array of ids, storing matching items in a list
|
2621 |
-
var matches = [];
|
2622 |
-
opts.query({
|
2623 |
-
matcher: function(term, text, el){
|
2624 |
-
var is_match = $.grep(ids, function(id) {
|
2625 |
-
return equal(id, opts.id(el));
|
2626 |
-
}).length;
|
2627 |
-
if (is_match) {
|
2628 |
-
matches.push(el);
|
2629 |
-
}
|
2630 |
-
return is_match;
|
2631 |
-
},
|
2632 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2633 |
-
// reorder matches based on the order they appear in the ids array because right now
|
2634 |
-
// they are in the order in which they appear in data array
|
2635 |
-
var ordered = [];
|
2636 |
-
for (var i = 0; i < ids.length; i++) {
|
2637 |
-
var id = ids[i];
|
2638 |
-
for (var j = 0; j < matches.length; j++) {
|
2639 |
-
var match = matches[j];
|
2640 |
-
if (equal(id, opts.id(match))) {
|
2641 |
-
ordered.push(match);
|
2642 |
-
matches.splice(j, 1);
|
2643 |
-
break;
|
2644 |
-
}
|
2645 |
-
}
|
2646 |
-
}
|
2647 |
-
callback(ordered);
|
2648 |
-
}
|
2649 |
-
});
|
2650 |
-
};
|
2651 |
-
}
|
2652 |
-
|
2653 |
-
return opts;
|
2654 |
-
},
|
2655 |
-
|
2656 |
-
// multi
|
2657 |
-
selectChoice: function (choice) {
|
2658 |
-
|
2659 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
2660 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
2661 |
-
|
2662 |
-
} else {
|
2663 |
-
if (selected.length) {
|
2664 |
-
this.opts.element.trigger("choice-deselected", selected);
|
2665 |
-
}
|
2666 |
-
selected.removeClass("select2-search-choice-focus");
|
2667 |
-
if (choice && choice.length) {
|
2668 |
-
this.close();
|
2669 |
-
choice.addClass("select2-search-choice-focus");
|
2670 |
-
this.opts.element.trigger("choice-selected", choice);
|
2671 |
-
}
|
2672 |
-
}
|
2673 |
-
},
|
2674 |
-
|
2675 |
-
// multi
|
2676 |
-
destroy: function() {
|
2677 |
-
$("label[for='" + this.search.attr('id') + "']")
|
2678 |
-
.attr('for', this.opts.element.attr("id"));
|
2679 |
-
this.parent.destroy.apply(this, arguments);
|
2680 |
-
|
2681 |
-
cleanupJQueryElements.call(this,
|
2682 |
-
"searchContainer",
|
2683 |
-
"selection"
|
2684 |
-
);
|
2685 |
-
},
|
2686 |
-
|
2687 |
-
// multi
|
2688 |
-
initContainer: function () {
|
2689 |
-
|
2690 |
-
var selector = ".select2-choices", selection;
|
2691 |
-
|
2692 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
2693 |
-
this.selection = selection = this.container.find(selector);
|
2694 |
-
|
2695 |
-
var _this = this;
|
2696 |
-
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2697 |
-
_this.search[0].focus();
|
2698 |
-
_this.selectChoice($(this));
|
2699 |
-
});
|
2700 |
-
|
2701 |
-
// rewrite labels from original element to focusser
|
2702 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
2703 |
-
|
2704 |
-
this.search.prev()
|
2705 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2706 |
-
.attr('for', this.search.attr('id'));
|
2707 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2708 |
-
|
2709 |
-
this.search.on("input paste", this.bind(function() {
|
2710 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2711 |
-
if (!this.isInterfaceEnabled()) return;
|
2712 |
-
if (!this.opened()) {
|
2713 |
-
this.open();
|
2714 |
-
}
|
2715 |
-
}));
|
2716 |
-
|
2717 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
2718 |
-
|
2719 |
-
this.keydowns = 0;
|
2720 |
-
this.search.on("keydown", this.bind(function (e) {
|
2721 |
-
if (!this.isInterfaceEnabled()) return;
|
2722 |
-
|
2723 |
-
++this.keydowns;
|
2724 |
-
var selected = selection.find(".select2-search-choice-focus");
|
2725 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2726 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2727 |
-
var pos = getCursorInfo(this.search);
|
2728 |
-
|
2729 |
-
if (selected.length &&
|
2730 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2731 |
-
var selectedChoice = selected;
|
2732 |
-
if (e.which == KEY.LEFT && prev.length) {
|
2733 |
-
selectedChoice = prev;
|
2734 |
-
}
|
2735 |
-
else if (e.which == KEY.RIGHT) {
|
2736 |
-
selectedChoice = next.length ? next : null;
|
2737 |
-
}
|
2738 |
-
else if (e.which === KEY.BACKSPACE) {
|
2739 |
-
if (this.unselect(selected.first())) {
|
2740 |
-
this.search.width(10);
|
2741 |
-
selectedChoice = prev.length ? prev : next;
|
2742 |
-
}
|
2743 |
-
} else if (e.which == KEY.DELETE) {
|
2744 |
-
if (this.unselect(selected.first())) {
|
2745 |
-
this.search.width(10);
|
2746 |
-
selectedChoice = next.length ? next : null;
|
2747 |
-
}
|
2748 |
-
} else if (e.which == KEY.ENTER) {
|
2749 |
-
selectedChoice = null;
|
2750 |
-
}
|
2751 |
-
|
2752 |
-
this.selectChoice(selectedChoice);
|
2753 |
-
killEvent(e);
|
2754 |
-
if (!selectedChoice || !selectedChoice.length) {
|
2755 |
-
this.open();
|
2756 |
-
}
|
2757 |
-
return;
|
2758 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2759 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2760 |
-
|
2761 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2762 |
-
killEvent(e);
|
2763 |
-
return;
|
2764 |
-
} else {
|
2765 |
-
this.selectChoice(null);
|
2766 |
-
}
|
2767 |
-
|
2768 |
-
if (this.opened()) {
|
2769 |
-
switch (e.which) {
|
2770 |
-
case KEY.UP:
|
2771 |
-
case KEY.DOWN:
|
2772 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2773 |
-
killEvent(e);
|
2774 |
-
return;
|
2775 |
-
case KEY.ENTER:
|
2776 |
-
this.selectHighlighted();
|
2777 |
-
killEvent(e);
|
2778 |
-
return;
|
2779 |
-
case KEY.TAB:
|
2780 |
-
this.selectHighlighted({noFocus:true});
|
2781 |
-
this.close();
|
2782 |
-
return;
|
2783 |
-
case KEY.ESC:
|
2784 |
-
this.cancel(e);
|
2785 |
-
killEvent(e);
|
2786 |
-
return;
|
2787 |
-
}
|
2788 |
-
}
|
2789 |
-
|
2790 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2791 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2792 |
-
return;
|
2793 |
-
}
|
2794 |
-
|
2795 |
-
if (e.which === KEY.ENTER) {
|
2796 |
-
if (this.opts.openOnEnter === false) {
|
2797 |
-
return;
|
2798 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2799 |
-
return;
|
2800 |
-
}
|
2801 |
-
}
|
2802 |
-
|
2803 |
-
this.open();
|
2804 |
-
|
2805 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2806 |
-
// prevent the page from scrolling
|
2807 |
-
killEvent(e);
|
2808 |
-
}
|
2809 |
-
|
2810 |
-
if (e.which === KEY.ENTER) {
|
2811 |
-
// prevent form from being submitted
|
2812 |
-
killEvent(e);
|
2813 |
-
}
|
2814 |
-
|
2815 |
-
}));
|
2816 |
-
|
2817 |
-
this.search.on("keyup", this.bind(function (e) {
|
2818 |
-
this.keydowns = 0;
|
2819 |
-
this.resizeSearch();
|
2820 |
-
})
|
2821 |
-
);
|
2822 |
-
|
2823 |
-
this.search.on("blur", this.bind(function(e) {
|
2824 |
-
this.container.removeClass("select2-container-active");
|
2825 |
-
this.search.removeClass("select2-focused");
|
2826 |
-
this.selectChoice(null);
|
2827 |
-
if (!this.opened()) this.clearSearch();
|
2828 |
-
e.stopImmediatePropagation();
|
2829 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
2830 |
-
}));
|
2831 |
-
|
2832 |
-
this.container.on("click", selector, this.bind(function (e) {
|
2833 |
-
if (!this.isInterfaceEnabled()) return;
|
2834 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
2835 |
-
// clicked inside a select2 search choice, do not open
|
2836 |
-
return;
|
2837 |
-
}
|
2838 |
-
this.selectChoice(null);
|
2839 |
-
this.clearPlaceholder();
|
2840 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2841 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2842 |
-
}
|
2843 |
-
this.open();
|
2844 |
-
this.focusSearch();
|
2845 |
-
e.preventDefault();
|
2846 |
-
}));
|
2847 |
-
|
2848 |
-
this.container.on("focus", selector, this.bind(function () {
|
2849 |
-
if (!this.isInterfaceEnabled()) return;
|
2850 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2851 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2852 |
-
}
|
2853 |
-
this.container.addClass("select2-container-active");
|
2854 |
-
this.dropdown.addClass("select2-drop-active");
|
2855 |
-
this.clearPlaceholder();
|
2856 |
-
}));
|
2857 |
-
|
2858 |
-
this.initContainerWidth();
|
2859 |
-
this.opts.element.hide();
|
2860 |
-
|
2861 |
-
// set the placeholder if necessary
|
2862 |
-
this.clearSearch();
|
2863 |
-
},
|
2864 |
-
|
2865 |
-
// multi
|
2866 |
-
enableInterface: function() {
|
2867 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
2868 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
2869 |
-
}
|
2870 |
-
},
|
2871 |
-
|
2872 |
-
// multi
|
2873 |
-
initSelection: function () {
|
2874 |
-
var data;
|
2875 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
2876 |
-
this.updateSelection([]);
|
2877 |
-
this.close();
|
2878 |
-
// set the placeholder if necessary
|
2879 |
-
this.clearSearch();
|
2880 |
-
}
|
2881 |
-
if (this.select || this.opts.element.val() !== "") {
|
2882 |
-
var self = this;
|
2883 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
2884 |
-
if (data !== undefined && data !== null) {
|
2885 |
-
self.updateSelection(data);
|
2886 |
-
self.close();
|
2887 |
-
// set the placeholder if necessary
|
2888 |
-
self.clearSearch();
|
2889 |
-
}
|
2890 |
-
});
|
2891 |
-
}
|
2892 |
-
},
|
2893 |
-
|
2894 |
-
// multi
|
2895 |
-
clearSearch: function () {
|
2896 |
-
var placeholder = this.getPlaceholder(),
|
2897 |
-
maxWidth = this.getMaxSearchWidth();
|
2898 |
-
|
2899 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
2900 |
-
this.search.val(placeholder).addClass("select2-default");
|
2901 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
2902 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
2903 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
2904 |
-
} else {
|
2905 |
-
this.search.val("").width(10);
|
2906 |
-
}
|
2907 |
-
},
|
2908 |
-
|
2909 |
-
// multi
|
2910 |
-
clearPlaceholder: function () {
|
2911 |
-
if (this.search.hasClass("select2-default")) {
|
2912 |
-
this.search.val("").removeClass("select2-default");
|
2913 |
-
}
|
2914 |
-
},
|
2915 |
-
|
2916 |
-
// multi
|
2917 |
-
opening: function () {
|
2918 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
2919 |
-
this.resizeSearch();
|
2920 |
-
|
2921 |
-
this.parent.opening.apply(this, arguments);
|
2922 |
-
|
2923 |
-
this.focusSearch();
|
2924 |
-
|
2925 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
2926 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2927 |
-
if(this.search.val() === "") {
|
2928 |
-
if(this.nextSearchTerm != undefined){
|
2929 |
-
this.search.val(this.nextSearchTerm);
|
2930 |
-
this.search.select();
|
2931 |
-
}
|
2932 |
-
}
|
2933 |
-
|
2934 |
-
this.updateResults(true);
|
2935 |
-
if (this.opts.shouldFocusInput(this)) {
|
2936 |
-
this.search.focus();
|
2937 |
-
}
|
2938 |
-
this.opts.element.trigger($.Event("select2-open"));
|
2939 |
-
},
|
2940 |
-
|
2941 |
-
// multi
|
2942 |
-
close: function () {
|
2943 |
-
if (!this.opened()) return;
|
2944 |
-
this.parent.close.apply(this, arguments);
|
2945 |
-
},
|
2946 |
-
|
2947 |
-
// multi
|
2948 |
-
focus: function () {
|
2949 |
-
this.close();
|
2950 |
-
this.search.focus();
|
2951 |
-
},
|
2952 |
-
|
2953 |
-
// multi
|
2954 |
-
isFocused: function () {
|
2955 |
-
return this.search.hasClass("select2-focused");
|
2956 |
-
},
|
2957 |
-
|
2958 |
-
// multi
|
2959 |
-
updateSelection: function (data) {
|
2960 |
-
var ids = [], filtered = [], self = this;
|
2961 |
-
|
2962 |
-
// filter out duplicates
|
2963 |
-
$(data).each(function () {
|
2964 |
-
if (indexOf(self.id(this), ids) < 0) {
|
2965 |
-
ids.push(self.id(this));
|
2966 |
-
filtered.push(this);
|
2967 |
-
}
|
2968 |
-
});
|
2969 |
-
data = filtered;
|
2970 |
-
|
2971 |
-
this.selection.find(".select2-search-choice").remove();
|
2972 |
-
$(data).each(function () {
|
2973 |
-
self.addSelectedChoice(this);
|
2974 |
-
});
|
2975 |
-
self.postprocessResults();
|
2976 |
-
},
|
2977 |
-
|
2978 |
-
// multi
|
2979 |
-
tokenize: function() {
|
2980 |
-
var input = this.search.val();
|
2981 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
2982 |
-
if (input != null && input != undefined) {
|
2983 |
-
this.search.val(input);
|
2984 |
-
if (input.length > 0) {
|
2985 |
-
this.open();
|
2986 |
-
}
|
2987 |
-
}
|
2988 |
-
|
2989 |
-
},
|
2990 |
-
|
2991 |
-
// multi
|
2992 |
-
onSelect: function (data, options) {
|
2993 |
-
|
2994 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
2995 |
-
|
2996 |
-
this.addSelectedChoice(data);
|
2997 |
-
|
2998 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
2999 |
-
|
3000 |
-
// keep track of the search's value before it gets cleared
|
3001 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
3002 |
-
|
3003 |
-
this.clearSearch();
|
3004 |
-
this.updateResults();
|
3005 |
-
|
3006 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3007 |
-
|
3008 |
-
if (this.opts.closeOnSelect) {
|
3009 |
-
this.close();
|
3010 |
-
this.search.width(10);
|
3011 |
-
} else {
|
3012 |
-
if (this.countSelectableResults()>0) {
|
3013 |
-
this.search.width(10);
|
3014 |
-
this.resizeSearch();
|
3015 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3016 |
-
// if we reached max selection size repaint the results so choices
|
3017 |
-
// are replaced with the max selection reached message
|
3018 |
-
this.updateResults(true);
|
3019 |
-
} else {
|
3020 |
-
// initializes search's value with nextSearchTerm and update search result
|
3021 |
-
if(this.nextSearchTerm != undefined){
|
3022 |
-
this.search.val(this.nextSearchTerm);
|
3023 |
-
this.updateResults();
|
3024 |
-
this.search.select();
|
3025 |
-
}
|
3026 |
-
}
|
3027 |
-
this.positionDropdown();
|
3028 |
-
} else {
|
3029 |
-
// if nothing left to select close
|
3030 |
-
this.close();
|
3031 |
-
this.search.width(10);
|
3032 |
-
}
|
3033 |
-
}
|
3034 |
-
|
3035 |
-
// since its not possible to select an element that has already been
|
3036 |
-
// added we do not need to check if this is a new element before firing change
|
3037 |
-
this.triggerChange({ added: data });
|
3038 |
-
|
3039 |
-
if (!options || !options.noFocus)
|
3040 |
-
this.focusSearch();
|
3041 |
-
},
|
3042 |
-
|
3043 |
-
// multi
|
3044 |
-
cancel: function () {
|
3045 |
-
this.close();
|
3046 |
-
this.focusSearch();
|
3047 |
-
},
|
3048 |
-
|
3049 |
-
addSelectedChoice: function (data) {
|
3050 |
-
var enableChoice = !data.locked,
|
3051 |
-
enabledItem = $(
|
3052 |
-
"<li class='select2-search-choice'>" +
|
3053 |
-
" <div></div>" +
|
3054 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3055 |
-
"</li>"),
|
3056 |
-
disabledItem = $(
|
3057 |
-
"<li class='select2-search-choice select2-locked'>" +
|
3058 |
-
"<div></div>" +
|
3059 |
-
"</li>");
|
3060 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
3061 |
-
id = this.id(data),
|
3062 |
-
val = this.getVal(),
|
3063 |
-
formatted,
|
3064 |
-
cssClass;
|
3065 |
-
|
3066 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3067 |
-
if (formatted != undefined) {
|
3068 |
-
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3069 |
-
}
|
3070 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3071 |
-
if (cssClass != undefined) {
|
3072 |
-
choice.addClass(cssClass);
|
3073 |
-
}
|
3074 |
-
|
3075 |
-
if(enableChoice){
|
3076 |
-
choice.find(".select2-search-choice-close")
|
3077 |
-
.on("mousedown", killEvent)
|
3078 |
-
.on("click dblclick", this.bind(function (e) {
|
3079 |
-
if (!this.isInterfaceEnabled()) return;
|
3080 |
-
|
3081 |
-
this.unselect($(e.target));
|
3082 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3083 |
-
killEvent(e);
|
3084 |
-
this.close();
|
3085 |
-
this.focusSearch();
|
3086 |
-
})).on("focus", this.bind(function () {
|
3087 |
-
if (!this.isInterfaceEnabled()) return;
|
3088 |
-
this.container.addClass("select2-container-active");
|
3089 |
-
this.dropdown.addClass("select2-drop-active");
|
3090 |
-
}));
|
3091 |
-
}
|
3092 |
-
|
3093 |
-
choice.data("select2-data", data);
|
3094 |
-
choice.insertBefore(this.searchContainer);
|
3095 |
-
|
3096 |
-
val.push(id);
|
3097 |
-
this.setVal(val);
|
3098 |
-
},
|
3099 |
-
|
3100 |
-
// multi
|
3101 |
-
unselect: function (selected) {
|
3102 |
-
var val = this.getVal(),
|
3103 |
-
data,
|
3104 |
-
index;
|
3105 |
-
selected = selected.closest(".select2-search-choice");
|
3106 |
-
|
3107 |
-
if (selected.length === 0) {
|
3108 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3109 |
-
}
|
3110 |
-
|
3111 |
-
data = selected.data("select2-data");
|
3112 |
-
|
3113 |
-
if (!data) {
|
3114 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3115 |
-
// and invoked on an element already removed
|
3116 |
-
return;
|
3117 |
-
}
|
3118 |
-
|
3119 |
-
var evt = $.Event("select2-removing");
|
3120 |
-
evt.val = this.id(data);
|
3121 |
-
evt.choice = data;
|
3122 |
-
this.opts.element.trigger(evt);
|
3123 |
-
|
3124 |
-
if (evt.isDefaultPrevented()) {
|
3125 |
-
return false;
|
3126 |
-
}
|
3127 |
-
|
3128 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
3129 |
-
val.splice(index, 1);
|
3130 |
-
this.setVal(val);
|
3131 |
-
if (this.select) this.postprocessResults();
|
3132 |
-
}
|
3133 |
-
|
3134 |
-
selected.remove();
|
3135 |
-
|
3136 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3137 |
-
this.triggerChange({ removed: data });
|
3138 |
-
|
3139 |
-
return true;
|
3140 |
-
},
|
3141 |
-
|
3142 |
-
// multi
|
3143 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3144 |
-
var val = this.getVal(),
|
3145 |
-
choices = this.results.find(".select2-result"),
|
3146 |
-
compound = this.results.find(".select2-result-with-children"),
|
3147 |
-
self = this;
|
3148 |
-
|
3149 |
-
choices.each2(function (i, choice) {
|
3150 |
-
var id = self.id(choice.data("select2-data"));
|
3151 |
-
if (indexOf(id, val) >= 0) {
|
3152 |
-
choice.addClass("select2-selected");
|
3153 |
-
// mark all children of the selected parent as selected
|
3154 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3155 |
-
}
|
3156 |
-
});
|
3157 |
-
|
3158 |
-
compound.each2(function(i, choice) {
|
3159 |
-
// hide an optgroup if it doesn't have any selectable children
|
3160 |
-
if (!choice.is('.select2-result-selectable')
|
3161 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3162 |
-
choice.addClass("select2-selected");
|
3163 |
-
}
|
3164 |
-
});
|
3165 |
-
|
3166 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3167 |
-
self.highlight(0);
|
3168 |
-
}
|
3169 |
-
|
3170 |
-
//If all results are chosen render formatNoMatches
|
3171 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3172 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3173 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3174 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3175 |
-
}
|
3176 |
-
}
|
3177 |
-
}
|
3178 |
-
|
3179 |
-
},
|
3180 |
-
|
3181 |
-
// multi
|
3182 |
-
getMaxSearchWidth: function() {
|
3183 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
3184 |
-
},
|
3185 |
-
|
3186 |
-
// multi
|
3187 |
-
resizeSearch: function () {
|
3188 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3189 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
3190 |
-
|
3191 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
3192 |
-
|
3193 |
-
left = this.search.offset().left;
|
3194 |
-
|
3195 |
-
maxWidth = this.selection.width();
|
3196 |
-
containerLeft = this.selection.offset().left;
|
3197 |
-
|
3198 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3199 |
-
|
3200 |
-
if (searchWidth < minimumWidth) {
|
3201 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3202 |
-
}
|
3203 |
-
|
3204 |
-
if (searchWidth < 40) {
|
3205 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3206 |
-
}
|
3207 |
-
|
3208 |
-
if (searchWidth <= 0) {
|
3209 |
-
searchWidth = minimumWidth;
|
3210 |
-
}
|
3211 |
-
|
3212 |
-
this.search.width(Math.floor(searchWidth));
|
3213 |
-
},
|
3214 |
-
|
3215 |
-
// multi
|
3216 |
-
getVal: function () {
|
3217 |
-
var val;
|
3218 |
-
if (this.select) {
|
3219 |
-
val = this.select.val();
|
3220 |
-
return val === null ? [] : val;
|
3221 |
-
} else {
|
3222 |
-
val = this.opts.element.val();
|
3223 |
-
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3224 |
-
}
|
3225 |
-
},
|
3226 |
-
|
3227 |
-
// multi
|
3228 |
-
setVal: function (val) {
|
3229 |
-
var unique;
|
3230 |
-
if (this.select) {
|
3231 |
-
this.select.val(val);
|
3232 |
-
} else {
|
3233 |
-
unique = [];
|
3234 |
-
// filter out duplicates
|
3235 |
-
$(val).each(function () {
|
3236 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
3237 |
-
});
|
3238 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3239 |
-
}
|
3240 |
-
},
|
3241 |
-
|
3242 |
-
// multi
|
3243 |
-
buildChangeDetails: function (old, current) {
|
3244 |
-
var current = current.slice(0),
|
3245 |
-
old = old.slice(0);
|
3246 |
-
|
3247 |
-
// remove intersection from each array
|
3248 |
-
for (var i = 0; i < current.length; i++) {
|
3249 |
-
for (var j = 0; j < old.length; j++) {
|
3250 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3251 |
-
current.splice(i, 1);
|
3252 |
-
if(i>0){
|
3253 |
-
i--;
|
3254 |
-
}
|
3255 |
-
old.splice(j, 1);
|
3256 |
-
j--;
|
3257 |
-
}
|
3258 |
-
}
|
3259 |
-
}
|
3260 |
-
|
3261 |
-
return {added: current, removed: old};
|
3262 |
-
},
|
3263 |
-
|
3264 |
-
|
3265 |
-
// multi
|
3266 |
-
val: function (val, triggerChange) {
|
3267 |
-
var oldData, self=this;
|
3268 |
-
|
3269 |
-
if (arguments.length === 0) {
|
3270 |
-
return this.getVal();
|
3271 |
-
}
|
3272 |
-
|
3273 |
-
oldData=this.data();
|
3274 |
-
if (!oldData.length) oldData=[];
|
3275 |
-
|
3276 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3277 |
-
if (!val && val !== 0) {
|
3278 |
-
this.opts.element.val("");
|
3279 |
-
this.updateSelection([]);
|
3280 |
-
this.clearSearch();
|
3281 |
-
if (triggerChange) {
|
3282 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
3283 |
-
}
|
3284 |
-
return;
|
3285 |
-
}
|
3286 |
-
|
3287 |
-
// val is a list of ids
|
3288 |
-
this.setVal(val);
|
3289 |
-
|
3290 |
-
if (this.select) {
|
3291 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3292 |
-
if (triggerChange) {
|
3293 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3294 |
-
}
|
3295 |
-
} else {
|
3296 |
-
if (this.opts.initSelection === undefined) {
|
3297 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
3298 |
-
}
|
3299 |
-
|
3300 |
-
this.opts.initSelection(this.opts.element, function(data){
|
3301 |
-
var ids=$.map(data, self.id);
|
3302 |
-
self.setVal(ids);
|
3303 |
-
self.updateSelection(data);
|
3304 |
-
self.clearSearch();
|
3305 |
-
if (triggerChange) {
|
3306 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3307 |
-
}
|
3308 |
-
});
|
3309 |
-
}
|
3310 |
-
this.clearSearch();
|
3311 |
-
},
|
3312 |
-
|
3313 |
-
// multi
|
3314 |
-
onSortStart: function() {
|
3315 |
-
if (this.select) {
|
3316 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3317 |
-
}
|
3318 |
-
|
3319 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
3320 |
-
this.search.width(0);
|
3321 |
-
// hide the container
|
3322 |
-
this.searchContainer.hide();
|
3323 |
-
},
|
3324 |
-
|
3325 |
-
// multi
|
3326 |
-
onSortEnd:function() {
|
3327 |
-
|
3328 |
-
var val=[], self=this;
|
3329 |
-
|
3330 |
-
// show search and move it to the end of the list
|
3331 |
-
this.searchContainer.show();
|
3332 |
-
// make sure the search container is the last item in the list
|
3333 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
3334 |
-
// since we collapsed the width in dragStarted, we resize it here
|
3335 |
-
this.resizeSearch();
|
3336 |
-
|
3337 |
-
// update selection
|
3338 |
-
this.selection.find(".select2-search-choice").each(function() {
|
3339 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
3340 |
-
});
|
3341 |
-
this.setVal(val);
|
3342 |
-
this.triggerChange();
|
3343 |
-
},
|
3344 |
-
|
3345 |
-
// multi
|
3346 |
-
data: function(values, triggerChange) {
|
3347 |
-
var self=this, ids, old;
|
3348 |
-
if (arguments.length === 0) {
|
3349 |
-
return this.selection
|
3350 |
-
.children(".select2-search-choice")
|
3351 |
-
.map(function() { return $(this).data("select2-data"); })
|
3352 |
-
.get();
|
3353 |
-
} else {
|
3354 |
-
old = this.data();
|
3355 |
-
if (!values) { values = []; }
|
3356 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3357 |
-
this.setVal(ids);
|
3358 |
-
this.updateSelection(values);
|
3359 |
-
this.clearSearch();
|
3360 |
-
if (triggerChange) {
|
3361 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3362 |
-
}
|
3363 |
-
}
|
3364 |
-
}
|
3365 |
-
});
|
3366 |
-
|
3367 |
-
$.fn.select2 = function () {
|
3368 |
-
|
3369 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
3370 |
-
opts,
|
3371 |
-
select2,
|
3372 |
-
method, value, multiple,
|
3373 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3374 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3375 |
-
propertyMethods = ["val", "data"],
|
3376 |
-
methodsMap = { search: "externalSearch" };
|
3377 |
-
|
3378 |
-
this.each(function () {
|
3379 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
3380 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3381 |
-
opts.element = $(this);
|
3382 |
-
|
3383 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3384 |
-
multiple = opts.element.prop("multiple");
|
3385 |
-
} else {
|
3386 |
-
multiple = opts.multiple || false;
|
3387 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3388 |
-
}
|
3389 |
-
|
3390 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3391 |
-
select2.init(opts);
|
3392 |
-
} else if (typeof(args[0]) === "string") {
|
3393 |
-
|
3394 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
3395 |
-
throw "Unknown method: " + args[0];
|
3396 |
-
}
|
3397 |
-
|
3398 |
-
value = undefined;
|
3399 |
-
select2 = $(this).data("select2");
|
3400 |
-
if (select2 === undefined) return;
|
3401 |
-
|
3402 |
-
method=args[0];
|
3403 |
-
|
3404 |
-
if (method === "container") {
|
3405 |
-
value = select2.container;
|
3406 |
-
} else if (method === "dropdown") {
|
3407 |
-
value = select2.dropdown;
|
3408 |
-
} else {
|
3409 |
-
if (methodsMap[method]) method = methodsMap[method];
|
3410 |
-
|
3411 |
-
value = select2[method].apply(select2, args.slice(1));
|
3412 |
-
}
|
3413 |
-
if (indexOf(args[0], valueMethods) >= 0
|
3414 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3415 |
-
return false; // abort the iteration, ready to return first matched value
|
3416 |
-
}
|
3417 |
-
} else {
|
3418 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
3419 |
-
}
|
3420 |
-
});
|
3421 |
-
return (value === undefined) ? this : value;
|
3422 |
-
};
|
3423 |
-
|
3424 |
-
// plugin defaults, accessible to users
|
3425 |
-
$.fn.select2.defaults = {
|
3426 |
-
width: "copy",
|
3427 |
-
loadMorePadding: 0,
|
3428 |
-
closeOnSelect: true,
|
3429 |
-
openOnEnter: true,
|
3430 |
-
containerCss: {},
|
3431 |
-
dropdownCss: {},
|
3432 |
-
containerCssClass: "",
|
3433 |
-
dropdownCssClass: "",
|
3434 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
3435 |
-
var markup=[];
|
3436 |
-
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3437 |
-
return markup.join("");
|
3438 |
-
},
|
3439 |
-
transformVal: function(val) {
|
3440 |
-
return $.trim(val);
|
3441 |
-
},
|
3442 |
-
formatSelection: function (data, container, escapeMarkup) {
|
3443 |
-
return data ? escapeMarkup(this.text(data)) : undefined;
|
3444 |
-
},
|
3445 |
-
sortResults: function (results, container, query) {
|
3446 |
-
return results;
|
3447 |
-
},
|
3448 |
-
formatResultCssClass: function(data) {return data.css;},
|
3449 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
3450 |
-
minimumResultsForSearch: 0,
|
3451 |
-
minimumInputLength: 0,
|
3452 |
-
maximumInputLength: null,
|
3453 |
-
maximumSelectionSize: 0,
|
3454 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
3455 |
-
text: function (e) {
|
3456 |
-
if (e && this.data && this.data.text) {
|
3457 |
-
if ($.isFunction(this.data.text)) {
|
3458 |
-
return this.data.text(e);
|
3459 |
-
} else {
|
3460 |
-
return e[this.data.text];
|
3461 |
-
}
|
3462 |
-
} else {
|
3463 |
-
return e.text;
|
3464 |
-
}
|
3465 |
-
},
|
3466 |
-
matcher: function(term, text) {
|
3467 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3468 |
-
},
|
3469 |
-
separator: ",",
|
3470 |
-
tokenSeparators: [],
|
3471 |
-
tokenizer: defaultTokenizer,
|
3472 |
-
escapeMarkup: defaultEscapeMarkup,
|
3473 |
-
blurOnChange: false,
|
3474 |
-
selectOnBlur: false,
|
3475 |
-
adaptContainerCssClass: function(c) { return c; },
|
3476 |
-
adaptDropdownCssClass: function(c) { return null; },
|
3477 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3478 |
-
searchInputPlaceholder: '',
|
3479 |
-
createSearchChoicePosition: 'top',
|
3480 |
-
shouldFocusInput: function (instance) {
|
3481 |
-
// Attempt to detect touch devices
|
3482 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3483 |
-
(navigator.msMaxTouchPoints > 0));
|
3484 |
-
|
3485 |
-
// Only devices which support touch events should be special cased
|
3486 |
-
if (!supportsTouchEvents) {
|
3487 |
-
return true;
|
3488 |
-
}
|
3489 |
-
|
3490 |
-
// Never focus the input if search is disabled
|
3491 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
3492 |
-
return false;
|
3493 |
-
}
|
3494 |
-
|
3495 |
-
return true;
|
3496 |
-
}
|
3497 |
-
};
|
3498 |
-
|
3499 |
-
$.fn.select2.locales = [];
|
3500 |
-
|
3501 |
-
$.fn.select2.locales['en'] = {
|
3502 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3503 |
-
formatNoMatches: function () { return "No matches found"; },
|
3504 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3505 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3506 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3507 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3508 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3509 |
-
formatSearching: function () { return "Searching…"; }
|
3510 |
-
};
|
3511 |
-
|
3512 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3513 |
-
|
3514 |
-
$.fn.select2.ajaxDefaults = {
|
3515 |
-
transport: $.ajax,
|
3516 |
-
params: {
|
3517 |
-
type: "GET",
|
3518 |
-
cache: false,
|
3519 |
-
dataType: "json"
|
3520 |
-
}
|
3521 |
-
};
|
3522 |
-
|
3523 |
-
// exports
|
3524 |
-
window.Select2 = {
|
3525 |
-
query: {
|
3526 |
-
ajax: ajax,
|
3527 |
-
local: local,
|
3528 |
-
tags: tags
|
3529 |
-
}, util: {
|
3530 |
-
debounce: debounce,
|
3531 |
-
markMatch: markMatch,
|
3532 |
-
escapeMarkup: defaultEscapeMarkup,
|
3533 |
-
stripDiacritics: stripDiacritics
|
3534 |
-
}, "class": {
|
3535 |
-
"abstract": AbstractSelect2,
|
3536 |
-
"single": SingleSelect2,
|
3537 |
-
"multi": MultiSelect2
|
3538 |
-
}
|
3539 |
-
};
|
3540 |
-
|
3541 |
-
}(jQuery));
|
1 |
+
/*
|
2 |
+
Copyright 2012 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
+
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
(function ($) {
|
22 |
+
if(typeof $.fn.each2 == "undefined") {
|
23 |
+
$.extend($.fn, {
|
24 |
+
/*
|
25 |
+
* 4-10 times faster .each replacement
|
26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
+
*/
|
28 |
+
each2 : function (c) {
|
29 |
+
var j = $([0]), i = -1, l = this.length;
|
30 |
+
while (
|
31 |
+
++i < l
|
32 |
+
&& (j.context = j[0] = this[i])
|
33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
+
);
|
35 |
+
return this;
|
36 |
+
}
|
37 |
+
});
|
38 |
+
}
|
39 |
+
})(jQuery);
|
40 |
+
|
41 |
+
(function ($, undefined) {
|
42 |
+
"use strict";
|
43 |
+
/*global document, window, jQuery, console */
|
44 |
+
|
45 |
+
if (window.Select2 !== undefined) {
|
46 |
+
return;
|
47 |
+
}
|
48 |
+
|
49 |
+
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
+
|
52 |
+
KEY = {
|
53 |
+
TAB: 9,
|
54 |
+
ENTER: 13,
|
55 |
+
ESC: 27,
|
56 |
+
SPACE: 32,
|
57 |
+
LEFT: 37,
|
58 |
+
UP: 38,
|
59 |
+
RIGHT: 39,
|
60 |
+
DOWN: 40,
|
61 |
+
SHIFT: 16,
|
62 |
+
CTRL: 17,
|
63 |
+
ALT: 18,
|
64 |
+
PAGE_UP: 33,
|
65 |
+
PAGE_DOWN: 34,
|
66 |
+
HOME: 36,
|
67 |
+
END: 35,
|
68 |
+
BACKSPACE: 8,
|
69 |
+
DELETE: 46,
|
70 |
+
isArrow: function (k) {
|
71 |
+
k = k.which ? k.which : k;
|
72 |
+
switch (k) {
|
73 |
+
case KEY.LEFT:
|
74 |
+
case KEY.RIGHT:
|
75 |
+
case KEY.UP:
|
76 |
+
case KEY.DOWN:
|
77 |
+
return true;
|
78 |
+
}
|
79 |
+
return false;
|
80 |
+
},
|
81 |
+
isControl: function (e) {
|
82 |
+
var k = e.which;
|
83 |
+
switch (k) {
|
84 |
+
case KEY.SHIFT:
|
85 |
+
case KEY.CTRL:
|
86 |
+
case KEY.ALT:
|
87 |
+
return true;
|
88 |
+
}
|
89 |
+
|
90 |
+
if (e.metaKey) return true;
|
91 |
+
|
92 |
+
return false;
|
93 |
+
},
|
94 |
+
isFunctionKey: function (k) {
|
95 |
+
k = k.which ? k.which : k;
|
96 |
+
return k >= 112 && k <= 123;
|
97 |
+
}
|
98 |
+
},
|
99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
+
|
101 |
+
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
+
|
103 |
+
$document = $(document);
|
104 |
+
|
105 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
+
|
107 |
+
|
108 |
+
function reinsertElement(element) {
|
109 |
+
var placeholder = $(document.createTextNode(''));
|
110 |
+
|
111 |
+
element.before(placeholder);
|
112 |
+
placeholder.before(element);
|
113 |
+
placeholder.remove();
|
114 |
+
}
|
115 |
+
|
116 |
+
function stripDiacritics(str) {
|
117 |
+
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
+
function match(a) {
|
119 |
+
return DIACRITICS[a] || a;
|
120 |
+
}
|
121 |
+
|
122 |
+
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
+
}
|
124 |
+
|
125 |
+
function indexOf(value, array) {
|
126 |
+
var i = 0, l = array.length;
|
127 |
+
for (; i < l; i = i + 1) {
|
128 |
+
if (equal(value, array[i])) return i;
|
129 |
+
}
|
130 |
+
return -1;
|
131 |
+
}
|
132 |
+
|
133 |
+
function measureScrollbar () {
|
134 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
+
$template.appendTo(document.body);
|
136 |
+
|
137 |
+
var dim = {
|
138 |
+
width: $template.width() - $template[0].clientWidth,
|
139 |
+
height: $template.height() - $template[0].clientHeight
|
140 |
+
};
|
141 |
+
$template.remove();
|
142 |
+
|
143 |
+
return dim;
|
144 |
+
}
|
145 |
+
|
146 |
+
/**
|
147 |
+
* Compares equality of a and b
|
148 |
+
* @param a
|
149 |
+
* @param b
|
150 |
+
*/
|
151 |
+
function equal(a, b) {
|
152 |
+
if (a === b) return true;
|
153 |
+
if (a === undefined || b === undefined) return false;
|
154 |
+
if (a === null || b === null) return false;
|
155 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
+
return false;
|
160 |
+
}
|
161 |
+
|
162 |
+
/**
|
163 |
+
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
+
* strings
|
165 |
+
* @param string
|
166 |
+
* @param separator
|
167 |
+
*/
|
168 |
+
function splitVal(string, separator, transform) {
|
169 |
+
var val, i, l;
|
170 |
+
if (string === null || string.length < 1) return [];
|
171 |
+
val = string.split(separator);
|
172 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
+
return val;
|
174 |
+
}
|
175 |
+
|
176 |
+
function getSideBorderPadding(element) {
|
177 |
+
return element.outerWidth(false) - element.width();
|
178 |
+
}
|
179 |
+
|
180 |
+
function installKeyUpChangeEvent(element) {
|
181 |
+
var key="keyup-change-value";
|
182 |
+
element.on("keydown", function () {
|
183 |
+
if ($.data(element, key) === undefined) {
|
184 |
+
$.data(element, key, element.val());
|
185 |
+
}
|
186 |
+
});
|
187 |
+
element.on("keyup", function () {
|
188 |
+
var val= $.data(element, key);
|
189 |
+
if (val !== undefined && element.val() !== val) {
|
190 |
+
$.removeData(element, key);
|
191 |
+
element.trigger("keyup-change");
|
192 |
+
}
|
193 |
+
});
|
194 |
+
}
|
195 |
+
|
196 |
+
|
197 |
+
/**
|
198 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
+
*
|
200 |
+
* filters out mouse events that occur when mouse is stationary but
|
201 |
+
* the elements under the pointer are scrolled.
|
202 |
+
*/
|
203 |
+
function installFilteredMouseMove(element) {
|
204 |
+
element.on("mousemove", function (e) {
|
205 |
+
var lastpos = lastMousePosition;
|
206 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
+
$(e.target).trigger("mousemove-filtered", e);
|
208 |
+
}
|
209 |
+
});
|
210 |
+
}
|
211 |
+
|
212 |
+
/**
|
213 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
+
* within the last quietMillis milliseconds.
|
215 |
+
*
|
216 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
+
* @param fn function to be debounced
|
218 |
+
* @param ctx object to be used as this reference within fn
|
219 |
+
* @return debounced version of fn
|
220 |
+
*/
|
221 |
+
function debounce(quietMillis, fn, ctx) {
|
222 |
+
ctx = ctx || undefined;
|
223 |
+
var timeout;
|
224 |
+
return function () {
|
225 |
+
var args = arguments;
|
226 |
+
window.clearTimeout(timeout);
|
227 |
+
timeout = window.setTimeout(function() {
|
228 |
+
fn.apply(ctx, args);
|
229 |
+
}, quietMillis);
|
230 |
+
};
|
231 |
+
}
|
232 |
+
|
233 |
+
function installDebouncedScroll(threshold, element) {
|
234 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
+
element.on("scroll", function (e) {
|
236 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
+
});
|
238 |
+
}
|
239 |
+
|
240 |
+
function focus($el) {
|
241 |
+
if ($el[0] === document.activeElement) return;
|
242 |
+
|
243 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
+
of the current event has finished - which seems like the only reliable way
|
245 |
+
to set focus */
|
246 |
+
window.setTimeout(function() {
|
247 |
+
var el=$el[0], pos=$el.val().length, range;
|
248 |
+
|
249 |
+
$el.focus();
|
250 |
+
|
251 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
+
sometimes modals or others listeners may steal it after its set */
|
253 |
+
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
+
if (isVisible && el === document.activeElement) {
|
255 |
+
|
256 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
+
just before setting focus */
|
258 |
+
if(el.setSelectionRange)
|
259 |
+
{
|
260 |
+
el.setSelectionRange(pos, pos);
|
261 |
+
}
|
262 |
+
else if (el.createTextRange) {
|
263 |
+
range = el.createTextRange();
|
264 |
+
range.collapse(false);
|
265 |
+
range.select();
|
266 |
+
}
|
267 |
+
}
|
268 |
+
}, 0);
|
269 |
+
}
|
270 |
+
|
271 |
+
function getCursorInfo(el) {
|
272 |
+
el = $(el)[0];
|
273 |
+
var offset = 0;
|
274 |
+
var length = 0;
|
275 |
+
if ('selectionStart' in el) {
|
276 |
+
offset = el.selectionStart;
|
277 |
+
length = el.selectionEnd - offset;
|
278 |
+
} else if ('selection' in document) {
|
279 |
+
el.focus();
|
280 |
+
var sel = document.selection.createRange();
|
281 |
+
length = document.selection.createRange().text.length;
|
282 |
+
sel.moveStart('character', -el.value.length);
|
283 |
+
offset = sel.text.length - length;
|
284 |
+
}
|
285 |
+
return { offset: offset, length: length };
|
286 |
+
}
|
287 |
+
|
288 |
+
function killEvent(event) {
|
289 |
+
event.preventDefault();
|
290 |
+
event.stopPropagation();
|
291 |
+
}
|
292 |
+
function killEventImmediately(event) {
|
293 |
+
event.preventDefault();
|
294 |
+
event.stopImmediatePropagation();
|
295 |
+
}
|
296 |
+
|
297 |
+
function measureTextWidth(e) {
|
298 |
+
if (!sizer){
|
299 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
+
sizer = $(document.createElement("div")).css({
|
301 |
+
position: "absolute",
|
302 |
+
left: "-10000px",
|
303 |
+
top: "-10000px",
|
304 |
+
display: "none",
|
305 |
+
fontSize: style.fontSize,
|
306 |
+
fontFamily: style.fontFamily,
|
307 |
+
fontStyle: style.fontStyle,
|
308 |
+
fontWeight: style.fontWeight,
|
309 |
+
letterSpacing: style.letterSpacing,
|
310 |
+
textTransform: style.textTransform,
|
311 |
+
whiteSpace: "nowrap"
|
312 |
+
});
|
313 |
+
sizer.attr("class","select2-sizer");
|
314 |
+
$(document.body).append(sizer);
|
315 |
+
}
|
316 |
+
sizer.text(e.val());
|
317 |
+
return sizer.width();
|
318 |
+
}
|
319 |
+
|
320 |
+
function syncCssClasses(dest, src, adapter) {
|
321 |
+
var classes, replacements = [], adapted;
|
322 |
+
|
323 |
+
classes = $.trim(dest.attr("class"));
|
324 |
+
|
325 |
+
if (classes) {
|
326 |
+
classes = '' + classes; // for IE which returns object
|
327 |
+
|
328 |
+
$(classes.split(/\s+/)).each2(function() {
|
329 |
+
if (this.indexOf("select2-") === 0) {
|
330 |
+
replacements.push(this);
|
331 |
+
}
|
332 |
+
});
|
333 |
+
}
|
334 |
+
|
335 |
+
classes = $.trim(src.attr("class"));
|
336 |
+
|
337 |
+
if (classes) {
|
338 |
+
classes = '' + classes; // for IE which returns object
|
339 |
+
|
340 |
+
$(classes.split(/\s+/)).each2(function() {
|
341 |
+
if (this.indexOf("select2-") !== 0) {
|
342 |
+
adapted = adapter(this);
|
343 |
+
|
344 |
+
if (adapted) {
|
345 |
+
replacements.push(adapted);
|
346 |
+
}
|
347 |
+
}
|
348 |
+
});
|
349 |
+
}
|
350 |
+
|
351 |
+
dest.attr("class", replacements.join(" "));
|
352 |
+
}
|
353 |
+
|
354 |
+
|
355 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
+
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
+
tl=term.length;
|
358 |
+
|
359 |
+
if (match<0) {
|
360 |
+
markup.push(escapeMarkup(text));
|
361 |
+
return;
|
362 |
+
}
|
363 |
+
|
364 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
+
markup.push("<span class='select2-match'>");
|
366 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
+
markup.push("</span>");
|
368 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
+
}
|
370 |
+
|
371 |
+
function defaultEscapeMarkup(markup) {
|
372 |
+
var replace_map = {
|
373 |
+
'\\': '\',
|
374 |
+
'&': '&',
|
375 |
+
'<': '<',
|
376 |
+
'>': '>',
|
377 |
+
'"': '"',
|
378 |
+
"'": ''',
|
379 |
+
"/": '/'
|
380 |
+
};
|
381 |
+
|
382 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
+
return replace_map[match];
|
384 |
+
});
|
385 |
+
}
|
386 |
+
|
387 |
+
/**
|
388 |
+
* Produces an ajax-based query function
|
389 |
+
*
|
390 |
+
* @param options object containing configuration parameters
|
391 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
+
* @param options.url url for the data
|
394 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
+
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
+
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
+
* The expected format is an object containing the following keys:
|
399 |
+
* results array of objects that will be used as choices
|
400 |
+
* more (optional) boolean indicating whether there are more results available
|
401 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
+
*/
|
403 |
+
function ajax(options) {
|
404 |
+
var timeout, // current scheduled but not yet executed request
|
405 |
+
handler = null,
|
406 |
+
quietMillis = options.quietMillis || 100,
|
407 |
+
ajaxUrl = options.url,
|
408 |
+
self = this;
|
409 |
+
|
410 |
+
return function (query) {
|
411 |
+
window.clearTimeout(timeout);
|
412 |
+
timeout = window.setTimeout(function () {
|
413 |
+
var data = options.data, // ajax data function
|
414 |
+
url = ajaxUrl, // ajax url string or function
|
415 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
+
// deprecated - to be removed in 4.0 - use params instead
|
417 |
+
deprecated = {
|
418 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
+
cache: options.cache || false,
|
420 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
+
dataType: options.dataType||"json"
|
422 |
+
},
|
423 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
+
|
425 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
+
|
428 |
+
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
+
|
430 |
+
if (options.params) {
|
431 |
+
if ($.isFunction(options.params)) {
|
432 |
+
$.extend(params, options.params.call(self));
|
433 |
+
} else {
|
434 |
+
$.extend(params, options.params);
|
435 |
+
}
|
436 |
+
}
|
437 |
+
|
438 |
+
$.extend(params, {
|
439 |
+
url: url,
|
440 |
+
dataType: options.dataType,
|
441 |
+
data: data,
|
442 |
+
success: function (data) {
|
443 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
+
// added query as third paramter to keep backwards compatibility
|
445 |
+
var results = options.results(data, query.page, query);
|
446 |
+
query.callback(results);
|
447 |
+
},
|
448 |
+
error: function(jqXHR, textStatus, errorThrown){
|
449 |
+
var results = {
|
450 |
+
hasError: true,
|
451 |
+
jqXHR: jqXHR,
|
452 |
+
textStatus: textStatus,
|
453 |
+
errorThrown: errorThrown
|
454 |
+
};
|
455 |
+
|
456 |
+
query.callback(results);
|
457 |
+
}
|
458 |
+
});
|
459 |
+
handler = transport.call(self, params);
|
460 |
+
}, quietMillis);
|
461 |
+
};
|
462 |
+
}
|
463 |
+
|
464 |
+
/**
|
465 |
+
* Produces a query function that works with a local array
|
466 |
+
*
|
467 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
+
* object.
|
469 |
+
*
|
470 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
+
*
|
472 |
+
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
+
* the text.
|
477 |
+
*/
|
478 |
+
function local(options) {
|
479 |
+
var data = options, // data elements
|
480 |
+
dataText,
|
481 |
+
tmp,
|
482 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
+
|
484 |
+
if ($.isArray(data)) {
|
485 |
+
tmp = data;
|
486 |
+
data = { results: tmp };
|
487 |
+
}
|
488 |
+
|
489 |
+
if ($.isFunction(data) === false) {
|
490 |
+
tmp = data;
|
491 |
+
data = function() { return tmp; };
|
492 |
+
}
|
493 |
+
|
494 |
+
var dataItem = data();
|
495 |
+
if (dataItem.text) {
|
496 |
+
text = dataItem.text;
|
497 |
+
// if text is not a function we assume it to be a key name
|
498 |
+
if (!$.isFunction(text)) {
|
499 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
+
text = function (item) { return item[dataText]; };
|
501 |
+
}
|
502 |
+
}
|
503 |
+
|
504 |
+
return function (query) {
|
505 |
+
var t = query.term, filtered = { results: [] }, process;
|
506 |
+
if (t === "") {
|
507 |
+
query.callback(data());
|
508 |
+
return;
|
509 |
+
}
|
510 |
+
|
511 |
+
process = function(datum, collection) {
|
512 |
+
var group, attr;
|
513 |
+
datum = datum[0];
|
514 |
+
if (datum.children) {
|
515 |
+
group = {};
|
516 |
+
for (attr in datum) {
|
517 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
+
}
|
519 |
+
group.children=[];
|
520 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
+
collection.push(group);
|
523 |
+
}
|
524 |
+
} else {
|
525 |
+
if (query.matcher(t, text(datum), datum)) {
|
526 |
+
collection.push(datum);
|
527 |
+
}
|
528 |
+
}
|
529 |
+
};
|
530 |
+
|
531 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
+
query.callback(filtered);
|
533 |
+
};
|
534 |
+
}
|
535 |
+
|
536 |
+
// TODO javadoc
|
537 |
+
function tags(data) {
|
538 |
+
var isFunc = $.isFunction(data);
|
539 |
+
return function (query) {
|
540 |
+
var t = query.term, filtered = {results: []};
|
541 |
+
var result = isFunc ? data(query) : data;
|
542 |
+
if ($.isArray(result)) {
|
543 |
+
$(result).each(function () {
|
544 |
+
var isObject = this.text !== undefined,
|
545 |
+
text = isObject ? this.text : this;
|
546 |
+
if (t === "" || query.matcher(t, text)) {
|
547 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
+
}
|
549 |
+
});
|
550 |
+
query.callback(filtered);
|
551 |
+
}
|
552 |
+
};
|
553 |
+
}
|
554 |
+
|
555 |
+
/**
|
556 |
+
* Checks if the formatter function should be used.
|
557 |
+
*
|
558 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
+
* false if no formatting should be performed.
|
560 |
+
*
|
561 |
+
* @param formatter
|
562 |
+
*/
|
563 |
+
function checkFormatter(formatter, formatterName) {
|
564 |
+
if ($.isFunction(formatter)) return true;
|
565 |
+
if (!formatter) return false;
|
566 |
+
if (typeof(formatter) === 'string') return true;
|
567 |
+
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
+
}
|
569 |
+
|
570 |
+
/**
|
571 |
+
* Returns a given value
|
572 |
+
* If given a function, returns its output
|
573 |
+
*
|
574 |
+
* @param val string|function
|
575 |
+
* @param context value of "this" to be passed to function
|
576 |
+
* @returns {*}
|
577 |
+
*/
|
578 |
+
function evaluate(val, context) {
|
579 |
+
if ($.isFunction(val)) {
|
580 |
+
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
+
return val.apply(context, args);
|
582 |
+
}
|
583 |
+
return val;
|
584 |
+
}
|
585 |
+
|
586 |
+
function countResults(results) {
|
587 |
+
var count = 0;
|
588 |
+
$.each(results, function(i, item) {
|
589 |
+
if (item.children) {
|
590 |
+
count += countResults(item.children);
|
591 |
+
} else {
|
592 |
+
count++;
|
593 |
+
}
|
594 |
+
});
|
595 |
+
return count;
|
596 |
+
}
|
597 |
+
|
598 |
+
/**
|
599 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
+
* two options have to be defined in order for the tokenizer to work.
|
602 |
+
*
|
603 |
+
* @param input text user has typed so far or pasted into the search field
|
604 |
+
* @param selection currently selected choices
|
605 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
+
* @param opts select2's opts
|
607 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
+
*/
|
609 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
+
token, // token
|
613 |
+
index, // position at which the separator was found
|
614 |
+
i, l, // looping variables
|
615 |
+
separator; // the matched separator
|
616 |
+
|
617 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
+
|
619 |
+
while (true) {
|
620 |
+
index = -1;
|
621 |
+
|
622 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
+
separator = opts.tokenSeparators[i];
|
624 |
+
index = input.indexOf(separator);
|
625 |
+
if (index >= 0) break;
|
626 |
+
}
|
627 |
+
|
628 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
+
|
630 |
+
token = input.substring(0, index);
|
631 |
+
input = input.substring(index + separator.length);
|
632 |
+
|
633 |
+
if (token.length > 0) {
|
634 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
+
dupe = false;
|
637 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
+
dupe = true; break;
|
640 |
+
}
|
641 |
+
}
|
642 |
+
|
643 |
+
if (!dupe) selectCallback(token);
|
644 |
+
}
|
645 |
+
}
|
646 |
+
}
|
647 |
+
|
648 |
+
if (original!==input) return input;
|
649 |
+
}
|
650 |
+
|
651 |
+
function cleanupJQueryElements() {
|
652 |
+
var self = this;
|
653 |
+
|
654 |
+
$.each(arguments, function (i, element) {
|
655 |
+
self[element].remove();
|
656 |
+
self[element] = null;
|
657 |
+
});
|
658 |
+
}
|
659 |
+
|
660 |
+
/**
|
661 |
+
* Creates a new class
|
662 |
+
*
|
663 |
+
* @param superClass
|
664 |
+
* @param methods
|
665 |
+
*/
|
666 |
+
function clazz(SuperClass, methods) {
|
667 |
+
var constructor = function () {};
|
668 |
+
constructor.prototype = new SuperClass;
|
669 |
+
constructor.prototype.constructor = constructor;
|
670 |
+
constructor.prototype.parent = SuperClass.prototype;
|
671 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
+
return constructor;
|
673 |
+
}
|
674 |
+
|
675 |
+
AbstractSelect2 = clazz(Object, {
|
676 |
+
|
677 |
+
// abstract
|
678 |
+
bind: function (func) {
|
679 |
+
var self = this;
|
680 |
+
return function () {
|
681 |
+
func.apply(self, arguments);
|
682 |
+
};
|
683 |
+
},
|
684 |
+
|
685 |
+
// abstract
|
686 |
+
init: function (opts) {
|
687 |
+
var results, search, resultsSelector = ".select2-results";
|
688 |
+
|
689 |
+
// prepare options
|
690 |
+
this.opts = opts = this.prepareOpts(opts);
|
691 |
+
|
692 |
+
this.id=opts.id;
|
693 |
+
|
694 |
+
// destroy if called on an existing component
|
695 |
+
if (opts.element.data("select2") !== undefined &&
|
696 |
+
opts.element.data("select2") !== null) {
|
697 |
+
opts.element.data("select2").destroy();
|
698 |
+
}
|
699 |
+
|
700 |
+
this.container = this.createContainer();
|
701 |
+
|
702 |
+
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
+
if (this.liveRegion.length == 0) {
|
704 |
+
this.liveRegion = $("<span>", {
|
705 |
+
role: "status",
|
706 |
+
"aria-live": "polite"
|
707 |
+
})
|
708 |
+
.addClass("select2-hidden-accessible")
|
709 |
+
.appendTo(document.body);
|
710 |
+
}
|
711 |
+
|
712 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
+
this.containerEventName= this.containerId
|
714 |
+
.replace(/([.])/g, '_')
|
715 |
+
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
+
this.container.attr("id", this.containerId);
|
717 |
+
|
718 |
+
this.container.attr("title", opts.element.attr("title"));
|
719 |
+
|
720 |
+
this.body = $(document.body);
|
721 |
+
|
722 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
+
|
724 |
+
this.container.attr("style", opts.element.attr("style"));
|
725 |
+
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
+
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
+
|
728 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
+
|
730 |
+
// swap container for the element
|
731 |
+
this.opts.element
|
732 |
+
.data("select2", this)
|
733 |
+
.attr("tabindex", "-1")
|
734 |
+
.before(this.container)
|
735 |
+
.on("click.select2", killEvent); // do not leak click events
|
736 |
+
|
737 |
+
this.container.data("select2", this);
|
738 |
+
|
739 |
+
this.dropdown = this.container.find(".select2-drop");
|
740 |
+
|
741 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
+
|
743 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
+
this.dropdown.data("select2", this);
|
745 |
+
this.dropdown.on("click", killEvent);
|
746 |
+
|
747 |
+
this.results = results = this.container.find(resultsSelector);
|
748 |
+
this.search = search = this.container.find("input.select2-input");
|
749 |
+
|
750 |
+
this.queryCount = 0;
|
751 |
+
this.resultsPage = 0;
|
752 |
+
this.context = null;
|
753 |
+
|
754 |
+
// initialize the container
|
755 |
+
this.initContainer();
|
756 |
+
|
757 |
+
this.container.on("click", killEvent);
|
758 |
+
|
759 |
+
installFilteredMouseMove(this.results);
|
760 |
+
|
761 |
+
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
+
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
+
this._touchEvent = true;
|
764 |
+
this.highlightUnderEvent(event);
|
765 |
+
}));
|
766 |
+
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
+
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
+
|
769 |
+
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
+
// otherwise click will be triggered on an underlying element
|
771 |
+
this.dropdown.on('click', this.bind(function (event) {
|
772 |
+
if (this._touchEvent) {
|
773 |
+
this._touchEvent = false;
|
774 |
+
this.selectHighlighted();
|
775 |
+
}
|
776 |
+
}));
|
777 |
+
|
778 |
+
installDebouncedScroll(80, this.results);
|
779 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
+
|
781 |
+
// do not propagate change event from the search field out of the component
|
782 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
+
|
785 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
+
if ($.fn.mousewheel) {
|
787 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
+
var top = results.scrollTop();
|
789 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
+
results.scrollTop(0);
|
791 |
+
killEvent(e);
|
792 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
+
killEvent(e);
|
795 |
+
}
|
796 |
+
});
|
797 |
+
}
|
798 |
+
|
799 |
+
installKeyUpChangeEvent(search);
|
800 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
+
|
804 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
+
this.highlightUnderEvent(e);
|
807 |
+
this.selectHighlighted(e);
|
808 |
+
}
|
809 |
+
}));
|
810 |
+
|
811 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
+
// dom it will trigger the popup close, which is not what we want
|
814 |
+
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
+
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
+
|
817 |
+
this.nextSearchTerm = undefined;
|
818 |
+
|
819 |
+
if ($.isFunction(this.opts.initSelection)) {
|
820 |
+
// initialize selection based on the current value of the source element
|
821 |
+
this.initSelection();
|
822 |
+
|
823 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
+
this.monitorSource();
|
826 |
+
}
|
827 |
+
|
828 |
+
if (opts.maximumInputLength !== null) {
|
829 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
+
}
|
831 |
+
|
832 |
+
var disabled = opts.element.prop("disabled");
|
833 |
+
if (disabled === undefined) disabled = false;
|
834 |
+
this.enable(!disabled);
|
835 |
+
|
836 |
+
var readonly = opts.element.prop("readonly");
|
837 |
+
if (readonly === undefined) readonly = false;
|
838 |
+
this.readonly(readonly);
|
839 |
+
|
840 |
+
// Calculate size of scrollbar
|
841 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
+
|
843 |
+
this.autofocus = opts.element.prop("autofocus");
|
844 |
+
opts.element.prop("autofocus", false);
|
845 |
+
if (this.autofocus) this.focus();
|
846 |
+
|
847 |
+
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
+
},
|
849 |
+
|
850 |
+
// abstract
|
851 |
+
destroy: function () {
|
852 |
+
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
+
|
854 |
+
this.close();
|
855 |
+
|
856 |
+
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
+
element.each(function () {
|
858 |
+
if (self._sync) {
|
859 |
+
this.detachEvent("onpropertychange", self._sync);
|
860 |
+
}
|
861 |
+
});
|
862 |
+
}
|
863 |
+
if (this.propertyObserver) {
|
864 |
+
this.propertyObserver.disconnect();
|
865 |
+
this.propertyObserver = null;
|
866 |
+
}
|
867 |
+
this._sync = null;
|
868 |
+
|
869 |
+
if (select2 !== undefined) {
|
870 |
+
select2.container.remove();
|
871 |
+
select2.liveRegion.remove();
|
872 |
+
select2.dropdown.remove();
|
873 |
+
element
|
874 |
+
.show()
|
875 |
+
.removeData("select2")
|
876 |
+
.off(".select2")
|
877 |
+
.prop("autofocus", this.autofocus || false);
|
878 |
+
if (this.elementTabIndex) {
|
879 |
+
element.attr({tabindex: this.elementTabIndex});
|
880 |
+
} else {
|
881 |
+
element.removeAttr("tabindex");
|
882 |
+
}
|
883 |
+
element.show();
|
884 |
+
}
|
885 |
+
|
886 |
+
cleanupJQueryElements.call(this,
|
887 |
+
"container",
|
888 |
+
"liveRegion",
|
889 |
+
"dropdown",
|
890 |
+
"results",
|
891 |
+
"search"
|
892 |
+
);
|
893 |
+
},
|
894 |
+
|
895 |
+
// abstract
|
896 |
+
optionToData: function(element) {
|
897 |
+
if (element.is("option")) {
|
898 |
+
return {
|
899 |
+
id:element.prop("value"),
|
900 |
+
text:element.text(),
|
901 |
+
element: element.get(),
|
902 |
+
css: element.attr("class"),
|
903 |
+
disabled: element.prop("disabled"),
|
904 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
905 |
+
};
|
906 |
+
} else if (element.is("optgroup")) {
|
907 |
+
return {
|
908 |
+
text:element.attr("label"),
|
909 |
+
children:[],
|
910 |
+
element: element.get(),
|
911 |
+
css: element.attr("class")
|
912 |
+
};
|
913 |
+
}
|
914 |
+
},
|
915 |
+
|
916 |
+
// abstract
|
917 |
+
prepareOpts: function (opts) {
|
918 |
+
var element, select, idKey, ajaxUrl, self = this;
|
919 |
+
|
920 |
+
element = opts.element;
|
921 |
+
|
922 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
923 |
+
this.select = select = opts.element;
|
924 |
+
}
|
925 |
+
|
926 |
+
if (select) {
|
927 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
928 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
929 |
+
if (this in opts) {
|
930 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
931 |
+
}
|
932 |
+
});
|
933 |
+
}
|
934 |
+
|
935 |
+
opts = $.extend({}, {
|
936 |
+
populateResults: function(container, results, query) {
|
937 |
+
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
938 |
+
|
939 |
+
populate=function(results, container, depth) {
|
940 |
+
|
941 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
942 |
+
|
943 |
+
results = opts.sortResults(results, container, query);
|
944 |
+
|
945 |
+
// collect the created nodes for bulk append
|
946 |
+
var nodes = [];
|
947 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
948 |
+
|
949 |
+
result=results[i];
|
950 |
+
|
951 |
+
disabled = (result.disabled === true);
|
952 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
953 |
+
|
954 |
+
compound=result.children && result.children.length > 0;
|
955 |
+
|
956 |
+
node=$("<li></li>");
|
957 |
+
node.addClass("select2-results-dept-"+depth);
|
958 |
+
node.addClass("select2-result");
|
959 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
960 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
961 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
962 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
963 |
+
node.attr("role", "presentation");
|
964 |
+
|
965 |
+
label=$(document.createElement("div"));
|
966 |
+
label.addClass("select2-result-label");
|
967 |
+
label.attr("id", "select2-result-label-" + nextUid());
|
968 |
+
label.attr("role", "option");
|
969 |
+
|
970 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
971 |
+
if (formatted!==undefined) {
|
972 |
+
label.html(formatted);
|
973 |
+
node.append(label);
|
974 |
+
}
|
975 |
+
|
976 |
+
|
977 |
+
if (compound) {
|
978 |
+
|
979 |
+
innerContainer=$("<ul></ul>");
|
980 |
+
innerContainer.addClass("select2-result-sub");
|
981 |
+
populate(result.children, innerContainer, depth+1);
|
982 |
+
node.append(innerContainer);
|
983 |
+
}
|
984 |
+
|
985 |
+
node.data("select2-data", result);
|
986 |
+
nodes.push(node[0]);
|
987 |
+
}
|
988 |
+
|
989 |
+
// bulk append the created nodes
|
990 |
+
container.append(nodes);
|
991 |
+
liveRegion.text(opts.formatMatches(results.length));
|
992 |
+
};
|
993 |
+
|
994 |
+
populate(results, container, 0);
|
995 |
+
}
|
996 |
+
}, $.fn.select2.defaults, opts);
|
997 |
+
|
998 |
+
if (typeof(opts.id) !== "function") {
|
999 |
+
idKey = opts.id;
|
1000 |
+
opts.id = function (e) { return e[idKey]; };
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
1004 |
+
if ("tags" in opts) {
|
1005 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1006 |
+
}
|
1007 |
+
opts.tags=opts.element.data("select2Tags");
|
1008 |
+
}
|
1009 |
+
|
1010 |
+
if (select) {
|
1011 |
+
opts.query = this.bind(function (query) {
|
1012 |
+
var data = { results: [], more: false },
|
1013 |
+
term = query.term,
|
1014 |
+
children, placeholderOption, process;
|
1015 |
+
|
1016 |
+
process=function(element, collection) {
|
1017 |
+
var group;
|
1018 |
+
if (element.is("option")) {
|
1019 |
+
if (query.matcher(term, element.text(), element)) {
|
1020 |
+
collection.push(self.optionToData(element));
|
1021 |
+
}
|
1022 |
+
} else if (element.is("optgroup")) {
|
1023 |
+
group=self.optionToData(element);
|
1024 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1025 |
+
if (group.children.length>0) {
|
1026 |
+
collection.push(group);
|
1027 |
+
}
|
1028 |
+
}
|
1029 |
+
};
|
1030 |
+
|
1031 |
+
children=element.children();
|
1032 |
+
|
1033 |
+
// ignore the placeholder option if there is one
|
1034 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1035 |
+
placeholderOption = this.getPlaceholderOption();
|
1036 |
+
if (placeholderOption) {
|
1037 |
+
children=children.not(placeholderOption);
|
1038 |
+
}
|
1039 |
+
}
|
1040 |
+
|
1041 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
1042 |
+
|
1043 |
+
query.callback(data);
|
1044 |
+
});
|
1045 |
+
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1046 |
+
opts.id=function(e) { return e.id; };
|
1047 |
+
} else {
|
1048 |
+
if (!("query" in opts)) {
|
1049 |
+
|
1050 |
+
if ("ajax" in opts) {
|
1051 |
+
ajaxUrl = opts.element.data("ajax-url");
|
1052 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
1053 |
+
opts.ajax.url = ajaxUrl;
|
1054 |
+
}
|
1055 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
1056 |
+
} else if ("data" in opts) {
|
1057 |
+
opts.query = local(opts.data);
|
1058 |
+
} else if ("tags" in opts) {
|
1059 |
+
opts.query = tags(opts.tags);
|
1060 |
+
if (opts.createSearchChoice === undefined) {
|
1061 |
+
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1062 |
+
}
|
1063 |
+
if (opts.initSelection === undefined) {
|
1064 |
+
opts.initSelection = function (element, callback) {
|
1065 |
+
var data = [];
|
1066 |
+
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1067 |
+
var obj = { id: this, text: this },
|
1068 |
+
tags = opts.tags;
|
1069 |
+
if ($.isFunction(tags)) tags=tags();
|
1070 |
+
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1071 |
+
data.push(obj);
|
1072 |
+
});
|
1073 |
+
|
1074 |
+
callback(data);
|
1075 |
+
};
|
1076 |
+
}
|
1077 |
+
}
|
1078 |
+
}
|
1079 |
+
}
|
1080 |
+
if (typeof(opts.query) !== "function") {
|
1081 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1082 |
+
}
|
1083 |
+
|
1084 |
+
if (opts.createSearchChoicePosition === 'top') {
|
1085 |
+
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1086 |
+
}
|
1087 |
+
else if (opts.createSearchChoicePosition === 'bottom') {
|
1088 |
+
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1089 |
+
}
|
1090 |
+
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1091 |
+
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1092 |
+
}
|
1093 |
+
|
1094 |
+
return opts;
|
1095 |
+
},
|
1096 |
+
|
1097 |
+
/**
|
1098 |
+
* Monitor the original element for changes and update select2 accordingly
|
1099 |
+
*/
|
1100 |
+
// abstract
|
1101 |
+
monitorSource: function () {
|
1102 |
+
var el = this.opts.element, observer, self = this;
|
1103 |
+
|
1104 |
+
el.on("change.select2", this.bind(function (e) {
|
1105 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1106 |
+
this.initSelection();
|
1107 |
+
}
|
1108 |
+
}));
|
1109 |
+
|
1110 |
+
this._sync = this.bind(function () {
|
1111 |
+
|
1112 |
+
// sync enabled state
|
1113 |
+
var disabled = el.prop("disabled");
|
1114 |
+
if (disabled === undefined) disabled = false;
|
1115 |
+
this.enable(!disabled);
|
1116 |
+
|
1117 |
+
var readonly = el.prop("readonly");
|
1118 |
+
if (readonly === undefined) readonly = false;
|
1119 |
+
this.readonly(readonly);
|
1120 |
+
|
1121 |
+
if (this.container) {
|
1122 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1123 |
+
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1124 |
+
}
|
1125 |
+
|
1126 |
+
if (this.dropdown) {
|
1127 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1128 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1129 |
+
}
|
1130 |
+
|
1131 |
+
});
|
1132 |
+
|
1133 |
+
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1134 |
+
if (el.length && el[0].attachEvent) {
|
1135 |
+
el.each(function() {
|
1136 |
+
this.attachEvent("onpropertychange", self._sync);
|
1137 |
+
});
|
1138 |
+
}
|
1139 |
+
|
1140 |
+
// safari, chrome, firefox, IE11
|
1141 |
+
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1142 |
+
if (observer !== undefined) {
|
1143 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1144 |
+
this.propertyObserver = new observer(function (mutations) {
|
1145 |
+
$.each(mutations, self._sync);
|
1146 |
+
});
|
1147 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1148 |
+
}
|
1149 |
+
},
|
1150 |
+
|
1151 |
+
// abstract
|
1152 |
+
triggerSelect: function(data) {
|
1153 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1154 |
+
this.opts.element.trigger(evt);
|
1155 |
+
return !evt.isDefaultPrevented();
|
1156 |
+
},
|
1157 |
+
|
1158 |
+
/**
|
1159 |
+
* Triggers the change event on the source element
|
1160 |
+
*/
|
1161 |
+
// abstract
|
1162 |
+
triggerChange: function (details) {
|
1163 |
+
|
1164 |
+
details = details || {};
|
1165 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
1166 |
+
// prevents recursive triggering
|
1167 |
+
this.opts.element.data("select2-change-triggered", true);
|
1168 |
+
this.opts.element.trigger(details);
|
1169 |
+
this.opts.element.data("select2-change-triggered", false);
|
1170 |
+
|
1171 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1172 |
+
// so here we trigger the click event manually
|
1173 |
+
this.opts.element.click();
|
1174 |
+
|
1175 |
+
// ValidationEngine ignores the change event and listens instead to blur
|
1176 |
+
// so here we trigger the blur event manually if so desired
|
1177 |
+
if (this.opts.blurOnChange)
|
1178 |
+
this.opts.element.blur();
|
1179 |
+
},
|
1180 |
+
|
1181 |
+
//abstract
|
1182 |
+
isInterfaceEnabled: function()
|
1183 |
+
{
|
1184 |
+
return this.enabledInterface === true;
|
1185 |
+
},
|
1186 |
+
|
1187 |
+
// abstract
|
1188 |
+
enableInterface: function() {
|
1189 |
+
var enabled = this._enabled && !this._readonly,
|
1190 |
+
disabled = !enabled;
|
1191 |
+
|
1192 |
+
if (enabled === this.enabledInterface) return false;
|
1193 |
+
|
1194 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
1195 |
+
this.close();
|
1196 |
+
this.enabledInterface = enabled;
|
1197 |
+
|
1198 |
+
return true;
|
1199 |
+
},
|
1200 |
+
|
1201 |
+
// abstract
|
1202 |
+
enable: function(enabled) {
|
1203 |
+
if (enabled === undefined) enabled = true;
|
1204 |
+
if (this._enabled === enabled) return;
|
1205 |
+
this._enabled = enabled;
|
1206 |
+
|
1207 |
+
this.opts.element.prop("disabled", !enabled);
|
1208 |
+
this.enableInterface();
|
1209 |
+
},
|
1210 |
+
|
1211 |
+
// abstract
|
1212 |
+
disable: function() {
|
1213 |
+
this.enable(false);
|
1214 |
+
},
|
1215 |
+
|
1216 |
+
// abstract
|
1217 |
+
readonly: function(enabled) {
|
1218 |
+
if (enabled === undefined) enabled = false;
|
1219 |
+
if (this._readonly === enabled) return;
|
1220 |
+
this._readonly = enabled;
|
1221 |
+
|
1222 |
+
this.opts.element.prop("readonly", enabled);
|
1223 |
+
this.enableInterface();
|
1224 |
+
},
|
1225 |
+
|
1226 |
+
// abstract
|
1227 |
+
opened: function () {
|
1228 |
+
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1229 |
+
},
|
1230 |
+
|
1231 |
+
// abstract
|
1232 |
+
positionDropdown: function() {
|
1233 |
+
var $dropdown = this.dropdown,
|
1234 |
+
container = this.container,
|
1235 |
+
offset = container.offset(),
|
1236 |
+
height = container.outerHeight(false),
|
1237 |
+
width = container.outerWidth(false),
|
1238 |
+
dropHeight = $dropdown.outerHeight(false),
|
1239 |
+
$window = $(window),
|
1240 |
+
windowWidth = $window.width(),
|
1241 |
+
windowHeight = $window.height(),
|
1242 |
+
viewPortRight = $window.scrollLeft() + windowWidth,
|
1243 |
+
viewportBottom = $window.scrollTop() + windowHeight,
|
1244 |
+
dropTop = offset.top + height,
|
1245 |
+
dropLeft = offset.left,
|
1246 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1247 |
+
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1248 |
+
dropWidth = $dropdown.outerWidth(false),
|
1249 |
+
enoughRoomOnRight = function() {
|
1250 |
+
return dropLeft + dropWidth <= viewPortRight;
|
1251 |
+
},
|
1252 |
+
enoughRoomOnLeft = function() {
|
1253 |
+
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1254 |
+
},
|
1255 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1256 |
+
bodyOffset,
|
1257 |
+
above,
|
1258 |
+
changeDirection,
|
1259 |
+
css,
|
1260 |
+
resultsListNode;
|
1261 |
+
|
1262 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
1263 |
+
if (aboveNow) {
|
1264 |
+
above = true;
|
1265 |
+
if (!enoughRoomAbove && enoughRoomBelow) {
|
1266 |
+
changeDirection = true;
|
1267 |
+
above = false;
|
1268 |
+
}
|
1269 |
+
} else {
|
1270 |
+
above = false;
|
1271 |
+
if (!enoughRoomBelow && enoughRoomAbove) {
|
1272 |
+
changeDirection = true;
|
1273 |
+
above = true;
|
1274 |
+
}
|
1275 |
+
}
|
1276 |
+
|
1277 |
+
//if we are changing direction we need to get positions when dropdown is hidden;
|
1278 |
+
if (changeDirection) {
|
1279 |
+
$dropdown.hide();
|
1280 |
+
offset = this.container.offset();
|
1281 |
+
height = this.container.outerHeight(false);
|
1282 |
+
width = this.container.outerWidth(false);
|
1283 |
+
dropHeight = $dropdown.outerHeight(false);
|
1284 |
+
viewPortRight = $window.scrollLeft() + windowWidth;
|
1285 |
+
viewportBottom = $window.scrollTop() + windowHeight;
|
1286 |
+
dropTop = offset.top + height;
|
1287 |
+
dropLeft = offset.left;
|
1288 |
+
dropWidth = $dropdown.outerWidth(false);
|
1289 |
+
$dropdown.show();
|
1290 |
+
|
1291 |
+
// fix so the cursor does not move to the left within the search-textbox in IE
|
1292 |
+
this.focusSearch();
|
1293 |
+
}
|
1294 |
+
|
1295 |
+
if (this.opts.dropdownAutoWidth) {
|
1296 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
1297 |
+
$dropdown.addClass('select2-drop-auto-width');
|
1298 |
+
$dropdown.css('width', '');
|
1299 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1300 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1301 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1302 |
+
dropHeight = $dropdown.outerHeight(false);
|
1303 |
+
}
|
1304 |
+
else {
|
1305 |
+
this.container.removeClass('select2-drop-auto-width');
|
1306 |
+
}
|
1307 |
+
|
1308 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1309 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1310 |
+
|
1311 |
+
// fix positioning when body has an offset and is not position: static
|
1312 |
+
if (this.body.css('position') !== 'static') {
|
1313 |
+
bodyOffset = this.body.offset();
|
1314 |
+
dropTop -= bodyOffset.top;
|
1315 |
+
dropLeft -= bodyOffset.left;
|
1316 |
+
}
|
1317 |
+
|
1318 |
+
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1319 |
+
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1320 |
+
}
|
1321 |
+
|
1322 |
+
css = {
|
1323 |
+
left: dropLeft,
|
1324 |
+
width: width
|
1325 |
+
};
|
1326 |
+
|
1327 |
+
if (above) {
|
1328 |
+
css.top = offset.top - dropHeight;
|
1329 |
+
css.bottom = 'auto';
|
1330 |
+
this.container.addClass("select2-drop-above");
|
1331 |
+
$dropdown.addClass("select2-drop-above");
|
1332 |
+
}
|
1333 |
+
else {
|
1334 |
+
css.top = dropTop;
|
1335 |
+
css.bottom = 'auto';
|
1336 |
+
this.container.removeClass("select2-drop-above");
|
1337 |
+
$dropdown.removeClass("select2-drop-above");
|
1338 |
+
}
|
1339 |
+
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1340 |
+
|
1341 |
+
$dropdown.css(css);
|
1342 |
+
},
|
1343 |
+
|
1344 |
+
// abstract
|
1345 |
+
shouldOpen: function() {
|
1346 |
+
var event;
|
1347 |
+
|
1348 |
+
if (this.opened()) return false;
|
1349 |
+
|
1350 |
+
if (this._enabled === false || this._readonly === true) return false;
|
1351 |
+
|
1352 |
+
event = $.Event("select2-opening");
|
1353 |
+
this.opts.element.trigger(event);
|
1354 |
+
return !event.isDefaultPrevented();
|
1355 |
+
},
|
1356 |
+
|
1357 |
+
// abstract
|
1358 |
+
clearDropdownAlignmentPreference: function() {
|
1359 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1360 |
+
this.container.removeClass("select2-drop-above");
|
1361 |
+
this.dropdown.removeClass("select2-drop-above");
|
1362 |
+
},
|
1363 |
+
|
1364 |
+
/**
|
1365 |
+
* Opens the dropdown
|
1366 |
+
*
|
1367 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1368 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1369 |
+
*/
|
1370 |
+
// abstract
|
1371 |
+
open: function () {
|
1372 |
+
|
1373 |
+
if (!this.shouldOpen()) return false;
|
1374 |
+
|
1375 |
+
this.opening();
|
1376 |
+
|
1377 |
+
// Only bind the document mousemove when the dropdown is visible
|
1378 |
+
$document.on("mousemove.select2Event", function (e) {
|
1379 |
+
lastMousePosition.x = e.pageX;
|
1380 |
+
lastMousePosition.y = e.pageY;
|
1381 |
+
});
|
1382 |
+
|
1383 |
+
return true;
|
1384 |
+
},
|
1385 |
+
|
1386 |
+
/**
|
1387 |
+
* Performs the opening of the dropdown
|
1388 |
+
*/
|
1389 |
+
// abstract
|
1390 |
+
opening: function() {
|
1391 |
+
var cid = this.containerEventName,
|
1392 |
+
scroll = "scroll." + cid,
|
1393 |
+
resize = "resize."+cid,
|
1394 |
+
orient = "orientationchange."+cid,
|
1395 |
+
mask;
|
1396 |
+
|
1397 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1398 |
+
|
1399 |
+
this.clearDropdownAlignmentPreference();
|
1400 |
+
|
1401 |
+
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1402 |
+
this.dropdown.detach().appendTo(this.body);
|
1403 |
+
}
|
1404 |
+
|
1405 |
+
// create the dropdown mask if doesn't already exist
|
1406 |
+
mask = $("#select2-drop-mask");
|
1407 |
+
if (mask.length === 0) {
|
1408 |
+
mask = $(document.createElement("div"));
|
1409 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1410 |
+
mask.hide();
|
1411 |
+
mask.appendTo(this.body);
|
1412 |
+
mask.on("mousedown touchstart click", function (e) {
|
1413 |
+
// Prevent IE from generating a click event on the body
|
1414 |
+
reinsertElement(mask);
|
1415 |
+
|
1416 |
+
var dropdown = $("#select2-drop"), self;
|
1417 |
+
if (dropdown.length > 0) {
|
1418 |
+
self=dropdown.data("select2");
|
1419 |
+
if (self.opts.selectOnBlur) {
|
1420 |
+
self.selectHighlighted({noFocus: true});
|
1421 |
+
}
|
1422 |
+
self.close();
|
1423 |
+
e.preventDefault();
|
1424 |
+
e.stopPropagation();
|
1425 |
+
}
|
1426 |
+
});
|
1427 |
+
}
|
1428 |
+
|
1429 |
+
// ensure the mask is always right before the dropdown
|
1430 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
1431 |
+
this.dropdown.before(mask);
|
1432 |
+
}
|
1433 |
+
|
1434 |
+
// move the global id to the correct dropdown
|
1435 |
+
$("#select2-drop").removeAttr("id");
|
1436 |
+
this.dropdown.attr("id", "select2-drop");
|
1437 |
+
|
1438 |
+
// show the elements
|
1439 |
+
mask.show();
|
1440 |
+
|
1441 |
+
this.positionDropdown();
|
1442 |
+
this.dropdown.show();
|
1443 |
+
this.positionDropdown();
|
1444 |
+
|
1445 |
+
this.dropdown.addClass("select2-drop-active");
|
1446 |
+
|
1447 |
+
// attach listeners to events that can change the position of the container and thus require
|
1448 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1449 |
+
var that = this;
|
1450 |
+
this.container.parents().add(window).each(function () {
|
1451 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1452 |
+
if (that.opened()) that.positionDropdown();
|
1453 |
+
});
|
1454 |
+
});
|
1455 |
+
|
1456 |
+
|
1457 |
+
},
|
1458 |
+
|
1459 |
+
// abstract
|
1460 |
+
close: function () {
|
1461 |
+
if (!this.opened()) return;
|
1462 |
+
|
1463 |
+
var cid = this.containerEventName,
|
1464 |
+
scroll = "scroll." + cid,
|
1465 |
+
resize = "resize."+cid,
|
1466 |
+
orient = "orientationchange."+cid;
|
1467 |
+
|
1468 |
+
// unbind event listeners
|
1469 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1470 |
+
|
1471 |
+
this.clearDropdownAlignmentPreference();
|
1472 |
+
|
1473 |
+
$("#select2-drop-mask").hide();
|
1474 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1475 |
+
this.dropdown.hide();
|
1476 |
+
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1477 |
+
this.results.empty();
|
1478 |
+
|
1479 |
+
// Now that the dropdown is closed, unbind the global document mousemove event
|
1480 |
+
$document.off("mousemove.select2Event");
|
1481 |
+
|
1482 |
+
this.clearSearch();
|
1483 |
+
this.search.removeClass("select2-active");
|
1484 |
+
this.opts.element.trigger($.Event("select2-close"));
|
1485 |
+
},
|
1486 |
+
|
1487 |
+
/**
|
1488 |
+
* Opens control, sets input value, and updates results.
|
1489 |
+
*/
|
1490 |
+
// abstract
|
1491 |
+
externalSearch: function (term) {
|
1492 |
+
this.open();
|
1493 |
+
this.search.val(term);
|
1494 |
+
this.updateResults(false);
|
1495 |
+
},
|
1496 |
+
|
1497 |
+
// abstract
|
1498 |
+
clearSearch: function () {
|
1499 |
+
|
1500 |
+
},
|
1501 |
+
|
1502 |
+
//abstract
|
1503 |
+
getMaximumSelectionSize: function() {
|
1504 |
+
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1505 |
+
},
|
1506 |
+
|
1507 |
+
// abstract
|
1508 |
+
ensureHighlightVisible: function () {
|
1509 |
+
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1510 |
+
|
1511 |
+
index = this.highlight();
|
1512 |
+
|
1513 |
+
if (index < 0) return;
|
1514 |
+
|
1515 |
+
if (index == 0) {
|
1516 |
+
|
1517 |
+
// if the first element is highlighted scroll all the way to the top,
|
1518 |
+
// that way any unselectable headers above it will also be scrolled
|
1519 |
+
// into view
|
1520 |
+
|
1521 |
+
results.scrollTop(0);
|
1522 |
+
return;
|
1523 |
+
}
|
1524 |
+
|
1525 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
1526 |
+
|
1527 |
+
child = $(children[index]);
|
1528 |
+
|
1529 |
+
topOffset = (child.offset() || {}).top || 0;
|
1530 |
+
|
1531 |
+
hb = topOffset + child.outerHeight(true);
|
1532 |
+
|
1533 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
1534 |
+
if (index === children.length - 1) {
|
1535 |
+
more = results.find("li.select2-more-results");
|
1536 |
+
if (more.length > 0) {
|
1537 |
+
hb = more.offset().top + more.outerHeight(true);
|
1538 |
+
}
|
1539 |
+
}
|
1540 |
+
|
1541 |
+
rb = results.offset().top + results.outerHeight(false);
|
1542 |
+
if (hb > rb) {
|
1543 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
1544 |
+
}
|
1545 |
+
y = topOffset - results.offset().top;
|
1546 |
+
|
1547 |
+
// make sure the top of the element is visible
|
1548 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
1549 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
1550 |
+
}
|
1551 |
+
},
|
1552 |
+
|
1553 |
+
// abstract
|
1554 |
+
findHighlightableChoices: function() {
|
1555 |
+
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1556 |
+
},
|
1557 |
+
|
1558 |
+
// abstract
|
1559 |
+
moveHighlight: function (delta) {
|
1560 |
+
var choices = this.findHighlightableChoices(),
|
1561 |
+
index = this.highlight();
|
1562 |
+
|
1563 |
+
while (index > -1 && index < choices.length) {
|
1564 |
+
index += delta;
|
1565 |
+
var choice = $(choices[index]);
|
1566 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1567 |
+
this.highlight(index);
|
1568 |
+
break;
|
1569 |
+
}
|
1570 |
+
}
|
1571 |
+
},
|
1572 |
+
|
1573 |
+
// abstract
|
1574 |
+
highlight: function (index) {
|
1575 |
+
var choices = this.findHighlightableChoices(),
|
1576 |
+
choice,
|
1577 |
+
data;
|
1578 |
+
|
1579 |
+
if (arguments.length === 0) {
|
1580 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1581 |
+
}
|
1582 |
+
|
1583 |
+
if (index >= choices.length) index = choices.length - 1;
|
1584 |
+
if (index < 0) index = 0;
|
1585 |
+
|
1586 |
+
this.removeHighlight();
|
1587 |
+
|
1588 |
+
choice = $(choices[index]);
|
1589 |
+
choice.addClass("select2-highlighted");
|
1590 |
+
|
1591 |
+
// ensure assistive technology can determine the active choice
|
1592 |
+
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1593 |
+
|
1594 |
+
this.ensureHighlightVisible();
|
1595 |
+
|
1596 |
+
this.liveRegion.text(choice.text());
|
1597 |
+
|
1598 |
+
data = choice.data("select2-data");
|
1599 |
+
if (data) {
|
1600 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1601 |
+
}
|
1602 |
+
},
|
1603 |
+
|
1604 |
+
removeHighlight: function() {
|
1605 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1606 |
+
},
|
1607 |
+
|
1608 |
+
touchMoved: function() {
|
1609 |
+
this._touchMoved = true;
|
1610 |
+
},
|
1611 |
+
|
1612 |
+
clearTouchMoved: function() {
|
1613 |
+
this._touchMoved = false;
|
1614 |
+
},
|
1615 |
+
|
1616 |
+
// abstract
|
1617 |
+
countSelectableResults: function() {
|
1618 |
+
return this.findHighlightableChoices().length;
|
1619 |
+
},
|
1620 |
+
|
1621 |
+
// abstract
|
1622 |
+
highlightUnderEvent: function (event) {
|
1623 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
1624 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1625 |
+
var choices = this.findHighlightableChoices();
|
1626 |
+
this.highlight(choices.index(el));
|
1627 |
+
} else if (el.length == 0) {
|
1628 |
+
// if we are over an unselectable item remove all highlights
|
1629 |
+
this.removeHighlight();
|
1630 |
+
}
|
1631 |
+
},
|
1632 |
+
|
1633 |
+
// abstract
|
1634 |
+
loadMoreIfNeeded: function () {
|
1635 |
+
var results = this.results,
|
1636 |
+
more = results.find("li.select2-more-results"),
|
1637 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1638 |
+
page = this.resultsPage + 1,
|
1639 |
+
self=this,
|
1640 |
+
term=this.search.val(),
|
1641 |
+
context=this.context;
|
1642 |
+
|
1643 |
+
if (more.length === 0) return;
|
1644 |
+
below = more.offset().top - results.offset().top - results.height();
|
1645 |
+
|
1646 |
+
if (below <= this.opts.loadMorePadding) {
|
1647 |
+
more.addClass("select2-active");
|
1648 |
+
this.opts.query({
|
1649 |
+
element: this.opts.element,
|
1650 |
+
term: term,
|
1651 |
+
page: page,
|
1652 |
+
context: context,
|
1653 |
+
matcher: this.opts.matcher,
|
1654 |
+
callback: this.bind(function (data) {
|
1655 |
+
|
1656 |
+
// ignore a response if the select2 has been closed before it was received
|
1657 |
+
if (!self.opened()) return;
|
1658 |
+
|
1659 |
+
|
1660 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1661 |
+
self.postprocessResults(data, false, false);
|
1662 |
+
|
1663 |
+
if (data.more===true) {
|
1664 |
+
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1665 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1666 |
+
} else {
|
1667 |
+
more.remove();
|
1668 |
+
}
|
1669 |
+
self.positionDropdown();
|
1670 |
+
self.resultsPage = page;
|
1671 |
+
self.context = data.context;
|
1672 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1673 |
+
})});
|
1674 |
+
}
|
1675 |
+
},
|
1676 |
+
|
1677 |
+
/**
|
1678 |
+
* Default tokenizer function which does nothing
|
1679 |
+
*/
|
1680 |
+
tokenize: function() {
|
1681 |
+
|
1682 |
+
},
|
1683 |
+
|
1684 |
+
/**
|
1685 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1686 |
+
*/
|
1687 |
+
// abstract
|
1688 |
+
updateResults: function (initial) {
|
1689 |
+
var search = this.search,
|
1690 |
+
results = this.results,
|
1691 |
+
opts = this.opts,
|
1692 |
+
data,
|
1693 |
+
self = this,
|
1694 |
+
input,
|
1695 |
+
term = search.val(),
|
1696 |
+
lastTerm = $.data(this.container, "select2-last-term"),
|
1697 |
+
// sequence number used to drop out-of-order responses
|
1698 |
+
queryNumber;
|
1699 |
+
|
1700 |
+
// prevent duplicate queries against the same term
|
1701 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1702 |
+
|
1703 |
+
$.data(this.container, "select2-last-term", term);
|
1704 |
+
|
1705 |
+
// if the search is currently hidden we do not alter the results
|
1706 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1707 |
+
return;
|
1708 |
+
}
|
1709 |
+
|
1710 |
+
function postRender() {
|
1711 |
+
search.removeClass("select2-active");
|
1712 |
+
self.positionDropdown();
|
1713 |
+
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1714 |
+
self.liveRegion.text(results.text());
|
1715 |
+
}
|
1716 |
+
else {
|
1717 |
+
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1718 |
+
}
|
1719 |
+
}
|
1720 |
+
|
1721 |
+
function render(html) {
|
1722 |
+
results.html(html);
|
1723 |
+
postRender();
|
1724 |
+
}
|
1725 |
+
|
1726 |
+
queryNumber = ++this.queryCount;
|
1727 |
+
|
1728 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
1729 |
+
if (maxSelSize >=1) {
|
1730 |
+
data = this.data();
|
1731 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1732 |
+
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1733 |
+
return;
|
1734 |
+
}
|
1735 |
+
}
|
1736 |
+
|
1737 |
+
if (search.val().length < opts.minimumInputLength) {
|
1738 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1739 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1740 |
+
} else {
|
1741 |
+
render("");
|
1742 |
+
}
|
1743 |
+
if (initial && this.showSearch) this.showSearch(true);
|
1744 |
+
return;
|
1745 |
+
}
|
1746 |
+
|
1747 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1748 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1749 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1750 |
+
} else {
|
1751 |
+
render("");
|
1752 |
+
}
|
1753 |
+
return;
|
1754 |
+
}
|
1755 |
+
|
1756 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1757 |
+
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1758 |
+
}
|
1759 |
+
|
1760 |
+
search.addClass("select2-active");
|
1761 |
+
|
1762 |
+
this.removeHighlight();
|
1763 |
+
|
1764 |
+
// give the tokenizer a chance to pre-process the input
|
1765 |
+
input = this.tokenize();
|
1766 |
+
if (input != undefined && input != null) {
|
1767 |
+
search.val(input);
|
1768 |
+
}
|
1769 |
+
|
1770 |
+
this.resultsPage = 1;
|
1771 |
+
|
1772 |
+
opts.query({
|
1773 |
+
element: opts.element,
|
1774 |
+
term: search.val(),
|
1775 |
+
page: this.resultsPage,
|
1776 |
+
context: null,
|
1777 |
+
matcher: opts.matcher,
|
1778 |
+
callback: this.bind(function (data) {
|
1779 |
+
var def; // default choice
|
1780 |
+
|
1781 |
+
// ignore old responses
|
1782 |
+
if (queryNumber != this.queryCount) {
|
1783 |
+
return;
|
1784 |
+
}
|
1785 |
+
|
1786 |
+
// ignore a response if the select2 has been closed before it was received
|
1787 |
+
if (!this.opened()) {
|
1788 |
+
this.search.removeClass("select2-active");
|
1789 |
+
return;
|
1790 |
+
}
|
1791 |
+
|
1792 |
+
// handle ajax error
|
1793 |
+
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1794 |
+
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1795 |
+
return;
|
1796 |
+
}
|
1797 |
+
|
1798 |
+
// save context, if any
|
1799 |
+
this.context = (data.context===undefined) ? null : data.context;
|
1800 |
+
// create a default choice and prepend it to the list
|
1801 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
1802 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1803 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1804 |
+
if ($(data.results).filter(
|
1805 |
+
function () {
|
1806 |
+
return equal(self.id(this), self.id(def));
|
1807 |
+
}).length === 0) {
|
1808 |
+
this.opts.createSearchChoicePosition(data.results, def);
|
1809 |
+
}
|
1810 |
+
}
|
1811 |
+
}
|
1812 |
+
|
1813 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1814 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1815 |
+
return;
|
1816 |
+
}
|
1817 |
+
|
1818 |
+
results.empty();
|
1819 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1820 |
+
|
1821 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
1822 |
+
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
1823 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1824 |
+
}
|
1825 |
+
|
1826 |
+
this.postprocessResults(data, initial);
|
1827 |
+
|
1828 |
+
postRender();
|
1829 |
+
|
1830 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1831 |
+
})});
|
1832 |
+
},
|
1833 |
+
|
1834 |
+
// abstract
|
1835 |
+
cancel: function () {
|
1836 |
+
this.close();
|
1837 |
+
},
|
1838 |
+
|
1839 |
+
// abstract
|
1840 |
+
blur: function () {
|
1841 |
+
// if selectOnBlur == true, select the currently highlighted option
|
1842 |
+
if (this.opts.selectOnBlur)
|
1843 |
+
this.selectHighlighted({noFocus: true});
|
1844 |
+
|
1845 |
+
this.close();
|
1846 |
+
this.container.removeClass("select2-container-active");
|
1847 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
1848 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
1849 |
+
this.clearSearch();
|
1850 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
1851 |
+
},
|
1852 |
+
|
1853 |
+
// abstract
|
1854 |
+
focusSearch: function () {
|
1855 |
+
focus(this.search);
|
1856 |
+
},
|
1857 |
+
|
1858 |
+
// abstract
|
1859 |
+
selectHighlighted: function (options) {
|
1860 |
+
if (this._touchMoved) {
|
1861 |
+
this.clearTouchMoved();
|
1862 |
+
return;
|
1863 |
+
}
|
1864 |
+
var index=this.highlight(),
|
1865 |
+
highlighted=this.results.find(".select2-highlighted"),
|
1866 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
1867 |
+
|
1868 |
+
if (data) {
|
1869 |
+
this.highlight(index);
|
1870 |
+
this.onSelect(data, options);
|
1871 |
+
} else if (options && options.noFocus) {
|
1872 |
+
this.close();
|
1873 |
+
}
|
1874 |
+
},
|
1875 |
+
|
1876 |
+
// abstract
|
1877 |
+
getPlaceholder: function () {
|
1878 |
+
var placeholderOption;
|
1879 |
+
return this.opts.element.attr("placeholder") ||
|
1880 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
1881 |
+
this.opts.element.data("placeholder") ||
|
1882 |
+
this.opts.placeholder ||
|
1883 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
1884 |
+
},
|
1885 |
+
|
1886 |
+
// abstract
|
1887 |
+
getPlaceholderOption: function() {
|
1888 |
+
if (this.select) {
|
1889 |
+
var firstOption = this.select.children('option').first();
|
1890 |
+
if (this.opts.placeholderOption !== undefined ) {
|
1891 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
1892 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
1893 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
1894 |
+
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
1895 |
+
//No explicit placeholder option specified, use the first if it's blank
|
1896 |
+
return firstOption;
|
1897 |
+
}
|
1898 |
+
}
|
1899 |
+
},
|
1900 |
+
|
1901 |
+
/**
|
1902 |
+
* Get the desired width for the container element. This is
|
1903 |
+
* derived first from option `width` passed to select2, then
|
1904 |
+
* the inline 'style' on the original element, and finally
|
1905 |
+
* falls back to the jQuery calculated element width.
|
1906 |
+
*/
|
1907 |
+
// abstract
|
1908 |
+
initContainerWidth: function () {
|
1909 |
+
function resolveContainerWidth() {
|
1910 |
+
var style, attrs, matches, i, l, attr;
|
1911 |
+
|
1912 |
+
if (this.opts.width === "off") {
|
1913 |
+
return null;
|
1914 |
+
} else if (this.opts.width === "element"){
|
1915 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
1916 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
1917 |
+
// check if there is inline style on the element that contains width
|
1918 |
+
style = this.opts.element.attr('style');
|
1919 |
+
if (style !== undefined) {
|
1920 |
+
attrs = style.split(';');
|
1921 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
1922 |
+
attr = attrs[i].replace(/\s/g, '');
|
1923 |
+
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
1924 |
+
if (matches !== null && matches.length >= 1)
|
1925 |
+
return matches[1];
|
1926 |
+
}
|
1927 |
+
}
|
1928 |
+
|
1929 |
+
if (this.opts.width === "resolve") {
|
1930 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
1931 |
+
// when attached to input type=hidden or elements hidden via css
|
1932 |
+
style = this.opts.element.css('width');
|
1933 |
+
if (style.indexOf("%") > 0) return style;
|
1934 |
+
|
1935 |
+
// finally, fallback on the calculated width of the element
|
1936 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
1937 |
+
}
|
1938 |
+
|
1939 |
+
return null;
|
1940 |
+
} else if ($.isFunction(this.opts.width)) {
|
1941 |
+
return this.opts.width();
|
1942 |
+
} else {
|
1943 |
+
return this.opts.width;
|
1944 |
+
}
|
1945 |
+
};
|
1946 |
+
|
1947 |
+
var width = resolveContainerWidth.call(this);
|
1948 |
+
if (width !== null) {
|
1949 |
+
this.container.css("width", width);
|
1950 |
+
}
|
1951 |
+
}
|
1952 |
+
});
|
1953 |
+
|
1954 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
1955 |
+
|
1956 |
+
// single
|
1957 |
+
|
1958 |
+
createContainer: function () {
|
1959 |
+
var container = $(document.createElement("div")).attr({
|
1960 |
+
"class": "select2-container"
|
1961 |
+
}).html([
|
1962 |
+
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
1963 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
1964 |
+
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
1965 |
+
"</a>",
|
1966 |
+
"<label for='' class='select2-offscreen'></label>",
|
1967 |
+
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
1968 |
+
"<div class='select2-drop select2-display-none'>",
|
1969 |
+
" <div class='select2-search'>",
|
1970 |
+
" <label for='' class='select2-offscreen'></label>",
|
1971 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
1972 |
+
" aria-autocomplete='list' />",
|
1973 |
+
" </div>",
|
1974 |
+
" <ul class='select2-results' role='listbox'>",
|
1975 |
+
" </ul>",
|
1976 |
+
"</div>"].join(""));
|
1977 |
+
return container;
|
1978 |
+
},
|
1979 |
+
|
1980 |
+
// single
|
1981 |
+
enableInterface: function() {
|
1982 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
1983 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
1984 |
+
}
|
1985 |
+
},
|
1986 |
+
|
1987 |
+
// single
|
1988 |
+
opening: function () {
|
1989 |
+
var el, range, len;
|
1990 |
+
|
1991 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
1992 |
+
this.showSearch(true);
|
1993 |
+
}
|
1994 |
+
|
1995 |
+
this.parent.opening.apply(this, arguments);
|
1996 |
+
|
1997 |
+
if (this.showSearchInput !== false) {
|
1998 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
1999 |
+
// all other browsers handle this just fine
|
2000 |
+
|
2001 |
+
this.search.val(this.focusser.val());
|
2002 |
+
}
|
2003 |
+
if (this.opts.shouldFocusInput(this)) {
|
2004 |
+
this.search.focus();
|
2005 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2006 |
+
// new text will appear *before* focusser.val()
|
2007 |
+
el = this.search.get(0);
|
2008 |
+
if (el.createTextRange) {
|
2009 |
+
range = el.createTextRange();
|
2010 |
+
range.collapse(false);
|
2011 |
+
range.select();
|
2012 |
+
} else if (el.setSelectionRange) {
|
2013 |
+
len = this.search.val().length;
|
2014 |
+
el.setSelectionRange(len, len);
|
2015 |
+
}
|
2016 |
+
}
|
2017 |
+
|
2018 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2019 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2020 |
+
if(this.search.val() === "") {
|
2021 |
+
if(this.nextSearchTerm != undefined){
|
2022 |
+
this.search.val(this.nextSearchTerm);
|
2023 |
+
this.search.select();
|
2024 |
+
}
|
2025 |
+
}
|
2026 |
+
|
2027 |
+
this.focusser.prop("disabled", true).val("");
|
2028 |
+
this.updateResults(true);
|
2029 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2030 |
+
},
|
2031 |
+
|
2032 |
+
// single
|
2033 |
+
close: function () {
|
2034 |
+
if (!this.opened()) return;
|
2035 |
+
this.parent.close.apply(this, arguments);
|
2036 |
+
|
2037 |
+
this.focusser.prop("disabled", false);
|
2038 |
+
|
2039 |
+
if (this.opts.shouldFocusInput(this)) {
|
2040 |
+
this.focusser.focus();
|
2041 |
+
}
|
2042 |
+
},
|
2043 |
+
|
2044 |
+
// single
|
2045 |
+
focus: function () {
|
2046 |
+
if (this.opened()) {
|
2047 |
+
this.close();
|
2048 |
+
} else {
|
2049 |
+
this.focusser.prop("disabled", false);
|
2050 |
+
if (this.opts.shouldFocusInput(this)) {
|
2051 |
+
this.focusser.focus();
|
2052 |
+
}
|
2053 |
+
}
|
2054 |
+
},
|
2055 |
+
|
2056 |
+
// single
|
2057 |
+
isFocused: function () {
|
2058 |
+
return this.container.hasClass("select2-container-active");
|
2059 |
+
},
|
2060 |
+
|
2061 |
+
// single
|
2062 |
+
cancel: function () {
|
2063 |
+
this.parent.cancel.apply(this, arguments);
|
2064 |
+
this.focusser.prop("disabled", false);
|
2065 |
+
|
2066 |
+
if (this.opts.shouldFocusInput(this)) {
|
2067 |
+
this.focusser.focus();
|
2068 |
+
}
|
2069 |
+
},
|
2070 |
+
|
2071 |
+
// single
|
2072 |
+
destroy: function() {
|
2073 |
+
$("label[for='" + this.focusser.attr('id') + "']")
|
2074 |
+
.attr('for', this.opts.element.attr("id"));
|
2075 |
+
this.parent.destroy.apply(this, arguments);
|
2076 |
+
|
2077 |
+
cleanupJQueryElements.call(this,
|
2078 |
+
"selection",
|
2079 |
+
"focusser"
|
2080 |
+
);
|
2081 |
+
},
|
2082 |
+
|
2083 |
+
// single
|
2084 |
+
initContainer: function () {
|
2085 |
+
|
2086 |
+
var selection,
|
2087 |
+
container = this.container,
|
2088 |
+
dropdown = this.dropdown,
|
2089 |
+
idSuffix = nextUid(),
|
2090 |
+
elementLabel;
|
2091 |
+
|
2092 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
2093 |
+
this.showSearch(false);
|
2094 |
+
} else {
|
2095 |
+
this.showSearch(true);
|
2096 |
+
}
|
2097 |
+
|
2098 |
+
this.selection = selection = container.find(".select2-choice");
|
2099 |
+
|
2100 |
+
this.focusser = container.find(".select2-focusser");
|
2101 |
+
|
2102 |
+
// add aria associations
|
2103 |
+
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2104 |
+
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2105 |
+
this.results.attr("id", "select2-results-"+idSuffix);
|
2106 |
+
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2107 |
+
|
2108 |
+
// rewrite labels from original element to focusser
|
2109 |
+
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2110 |
+
|
2111 |
+
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2112 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2113 |
+
|
2114 |
+
this.focusser.prev()
|
2115 |
+
.text(elementLabel.text())
|
2116 |
+
.attr('for', this.focusser.attr('id'));
|
2117 |
+
|
2118 |
+
// Ensure the original element retains an accessible name
|
2119 |
+
var originalTitle = this.opts.element.attr("title");
|
2120 |
+
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2121 |
+
|
2122 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
2123 |
+
|
2124 |
+
// write label for search field using the label from the focusser element
|
2125 |
+
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2126 |
+
|
2127 |
+
this.search.prev()
|
2128 |
+
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2129 |
+
.attr('for', this.search.attr('id'));
|
2130 |
+
|
2131 |
+
this.search.on("keydown", this.bind(function (e) {
|
2132 |
+
if (!this.isInterfaceEnabled()) return;
|
2133 |
+
|
2134 |
+
// filter 229 keyCodes (input method editor is processing key input)
|
2135 |
+
if (229 == e.keyCode) return;
|
2136 |
+
|
2137 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2138 |
+
// prevent the page from scrolling
|
2139 |
+
killEvent(e);
|
2140 |
+
return;
|
2141 |
+
}
|
2142 |
+
|
2143 |
+
switch (e.which) {
|
2144 |
+
case KEY.UP:
|
2145 |
+
case KEY.DOWN:
|
2146 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2147 |
+
killEvent(e);
|
2148 |
+
return;
|
2149 |
+
case KEY.ENTER:
|
2150 |
+
this.selectHighlighted();
|
2151 |
+
killEvent(e);
|
2152 |
+
return;
|
2153 |
+
case KEY.TAB:
|
2154 |
+
this.selectHighlighted({noFocus: true});
|
2155 |
+
return;
|
2156 |
+
case KEY.ESC:
|
2157 |
+
this.cancel(e);
|
2158 |
+
killEvent(e);
|
2159 |
+
return;
|
2160 |
+
}
|
2161 |
+
}));
|
2162 |
+
|
2163 |
+
this.search.on("blur", this.bind(function(e) {
|
2164 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2165 |
+
// without this the search field loses focus which is annoying
|
2166 |
+
if (document.activeElement === this.body.get(0)) {
|
2167 |
+
window.setTimeout(this.bind(function() {
|
2168 |
+
if (this.opened()) {
|
2169 |
+
this.search.focus();
|
2170 |
+
}
|
2171 |
+
}), 0);
|
2172 |
+
}
|
2173 |
+
}));
|
2174 |
+
|
2175 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
2176 |
+
if (!this.isInterfaceEnabled()) return;
|
2177 |
+
|
2178 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2179 |
+
return;
|
2180 |
+
}
|
2181 |
+
|
2182 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2183 |
+
killEvent(e);
|
2184 |
+
return;
|
2185 |
+
}
|
2186 |
+
|
2187 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2188 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2189 |
+
|
2190 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2191 |
+
|
2192 |
+
this.open();
|
2193 |
+
killEvent(e);
|
2194 |
+
return;
|
2195 |
+
}
|
2196 |
+
|
2197 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2198 |
+
if (this.opts.allowClear) {
|
2199 |
+
this.clear();
|
2200 |
+
}
|
2201 |
+
killEvent(e);
|
2202 |
+
return;
|
2203 |
+
}
|
2204 |
+
}));
|
2205 |
+
|
2206 |
+
|
2207 |
+
installKeyUpChangeEvent(this.focusser);
|
2208 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2209 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
2210 |
+
e.stopPropagation();
|
2211 |
+
if (this.opened()) return;
|
2212 |
+
this.open();
|
2213 |
+
}
|
2214 |
+
}));
|
2215 |
+
|
2216 |
+
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2217 |
+
if (!this.isInterfaceEnabled()) {
|
2218 |
+
return;
|
2219 |
+
}
|
2220 |
+
|
2221 |
+
this.clear();
|
2222 |
+
killEventImmediately(e);
|
2223 |
+
this.close();
|
2224 |
+
|
2225 |
+
if (this.selection) {
|
2226 |
+
this.selection.focus();
|
2227 |
+
}
|
2228 |
+
}));
|
2229 |
+
|
2230 |
+
selection.on("mousedown touchstart", this.bind(function (e) {
|
2231 |
+
// Prevent IE from generating a click event on the body
|
2232 |
+
reinsertElement(selection);
|
2233 |
+
|
2234 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2235 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2236 |
+
}
|
2237 |
+
|
2238 |
+
if (this.opened()) {
|
2239 |
+
this.close();
|
2240 |
+
} else if (this.isInterfaceEnabled()) {
|
2241 |
+
this.open();
|
2242 |
+
}
|
2243 |
+
|
2244 |
+
killEvent(e);
|
2245 |
+
}));
|
2246 |
+
|
2247 |
+
dropdown.on("mousedown touchstart", this.bind(function() {
|
2248 |
+
if (this.opts.shouldFocusInput(this)) {
|
2249 |
+
this.search.focus();
|
2250 |
+
}
|
2251 |
+
}));
|
2252 |
+
|
2253 |
+
selection.on("focus", this.bind(function(e) {
|
2254 |
+
killEvent(e);
|
2255 |
+
}));
|
2256 |
+
|
2257 |
+
this.focusser.on("focus", this.bind(function(){
|
2258 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2259 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2260 |
+
}
|
2261 |
+
this.container.addClass("select2-container-active");
|
2262 |
+
})).on("blur", this.bind(function() {
|
2263 |
+
if (!this.opened()) {
|
2264 |
+
this.container.removeClass("select2-container-active");
|
2265 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2266 |
+
}
|
2267 |
+
}));
|
2268 |
+
this.search.on("focus", this.bind(function(){
|
2269 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2270 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2271 |
+
}
|
2272 |
+
this.container.addClass("select2-container-active");
|
2273 |
+
}));
|
2274 |
+
|
2275 |
+
this.initContainerWidth();
|
2276 |
+
this.opts.element.hide();
|
2277 |
+
this.setPlaceholder();
|
2278 |
+
|
2279 |
+
},
|
2280 |
+
|
2281 |
+
// single
|
2282 |
+
clear: function(triggerChange) {
|
2283 |
+
var data=this.selection.data("select2-data");
|
2284 |
+
if (data) { // guard against queued quick consecutive clicks
|
2285 |
+
var evt = $.Event("select2-clearing");
|
2286 |
+
this.opts.element.trigger(evt);
|
2287 |
+
if (evt.isDefaultPrevented()) {
|
2288 |
+
return;
|
2289 |
+
}
|
2290 |
+
var placeholderOption = this.getPlaceholderOption();
|
2291 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2292 |
+
this.selection.find(".select2-chosen").empty();
|
2293 |
+
this.selection.removeData("select2-data");
|
2294 |
+
this.setPlaceholder();
|
2295 |
+
|
2296 |
+
if (triggerChange !== false){
|
2297 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2298 |
+
this.triggerChange({removed:data});
|
2299 |
+
}
|
2300 |
+
}
|
2301 |
+
},
|
2302 |
+
|
2303 |
+
/**
|
2304 |
+
* Sets selection based on source element's value
|
2305 |
+
*/
|
2306 |
+
// single
|
2307 |
+
initSelection: function () {
|
2308 |
+
var selected;
|
2309 |
+
if (this.isPlaceholderOptionSelected()) {
|
2310 |
+
this.updateSelection(null);
|
2311 |
+
this.close();
|
2312 |
+
this.setPlaceholder();
|
2313 |
+
} else {
|
2314 |
+
var self = this;
|
2315 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2316 |
+
if (selected !== undefined && selected !== null) {
|
2317 |
+
self.updateSelection(selected);
|
2318 |
+
self.close();
|
2319 |
+
self.setPlaceholder();
|
2320 |
+
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
2321 |
+
}
|
2322 |
+
});
|
2323 |
+
}
|
2324 |
+
},
|
2325 |
+
|
2326 |
+
isPlaceholderOptionSelected: function() {
|
2327 |
+
var placeholderOption;
|
2328 |
+
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2329 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2330 |
+
|| (this.opts.element.val() === "")
|
2331 |
+
|| (this.opts.element.val() === undefined)
|
2332 |
+
|| (this.opts.element.val() === null);
|
2333 |
+
},
|
2334 |
+
|
2335 |
+
// single
|
2336 |
+
prepareOpts: function () {
|
2337 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2338 |
+
self=this;
|
2339 |
+
|
2340 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2341 |
+
// install the selection initializer
|
2342 |
+
opts.initSelection = function (element, callback) {
|
2343 |
+
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2344 |
+
// a single select box always has a value, no need to null check 'selected'
|
2345 |
+
callback(self.optionToData(selected));
|
2346 |
+
};
|
2347 |
+
} else if ("data" in opts) {
|
2348 |
+
// install default initSelection when applied to hidden input and data is local
|
2349 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2350 |
+
var id = element.val();
|
2351 |
+
//search in data by id, storing the actual matching item
|
2352 |
+
var match = null;
|
2353 |
+
opts.query({
|
2354 |
+
matcher: function(term, text, el){
|
2355 |
+
var is_match = equal(id, opts.id(el));
|
2356 |
+
if (is_match) {
|
2357 |
+
match = el;
|
2358 |
+
}
|
2359 |
+
return is_match;
|
2360 |
+
},
|
2361 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2362 |
+
callback(match);
|
2363 |
+
}
|
2364 |
+
});
|
2365 |
+
};
|
2366 |
+
}
|
2367 |
+
|
2368 |
+
return opts;
|
2369 |
+
},
|
2370 |
+
|
2371 |
+
// single
|
2372 |
+
getPlaceholder: function() {
|
2373 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2374 |
+
if (this.select) {
|
2375 |
+
if (this.getPlaceholderOption() === undefined) {
|
2376 |
+
return undefined;
|
2377 |
+
}
|
2378 |
+
}
|
2379 |
+
|
2380 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
2381 |
+
},
|
2382 |
+
|
2383 |
+
// single
|
2384 |
+
setPlaceholder: function () {
|
2385 |
+
var placeholder = this.getPlaceholder();
|
2386 |
+
|
2387 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2388 |
+
|
2389 |
+
// check for a placeholder option if attached to a select
|
2390 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2391 |
+
|
2392 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2393 |
+
|
2394 |
+
this.selection.addClass("select2-default");
|
2395 |
+
|
2396 |
+
this.container.removeClass("select2-allowclear");
|
2397 |
+
}
|
2398 |
+
},
|
2399 |
+
|
2400 |
+
// single
|
2401 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2402 |
+
var selected = 0, self = this, showSearchInput = true;
|
2403 |
+
|
2404 |
+
// find the selected element in the result list
|
2405 |
+
|
2406 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
2407 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2408 |
+
selected = i;
|
2409 |
+
return false;
|
2410 |
+
}
|
2411 |
+
});
|
2412 |
+
|
2413 |
+
// and highlight it
|
2414 |
+
if (noHighlightUpdate !== false) {
|
2415 |
+
if (initial === true && selected >= 0) {
|
2416 |
+
this.highlight(selected);
|
2417 |
+
} else {
|
2418 |
+
this.highlight(0);
|
2419 |
+
}
|
2420 |
+
}
|
2421 |
+
|
2422 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
2423 |
+
|
2424 |
+
if (initial === true) {
|
2425 |
+
var min = this.opts.minimumResultsForSearch;
|
2426 |
+
if (min >= 0) {
|
2427 |
+
this.showSearch(countResults(data.results) >= min);
|
2428 |
+
}
|
2429 |
+
}
|
2430 |
+
},
|
2431 |
+
|
2432 |
+
// single
|
2433 |
+
showSearch: function(showSearchInput) {
|
2434 |
+
if (this.showSearchInput === showSearchInput) return;
|
2435 |
+
|
2436 |
+
this.showSearchInput = showSearchInput;
|
2437 |
+
|
2438 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2439 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2440 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
2441 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2442 |
+
},
|
2443 |
+
|
2444 |
+
// single
|
2445 |
+
onSelect: function (data, options) {
|
2446 |
+
|
2447 |
+
if (!this.triggerSelect(data)) { return; }
|
2448 |
+
|
2449 |
+
var old = this.opts.element.val(),
|
2450 |
+
oldData = this.data();
|
2451 |
+
|
2452 |
+
this.opts.element.val(this.id(data));
|
2453 |
+
this.updateSelection(data);
|
2454 |
+
|
2455 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2456 |
+
|
2457 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
2458 |
+
this.close();
|
2459 |
+
|
2460 |
+
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2461 |
+
this.focusser.focus();
|
2462 |
+
}
|
2463 |
+
|
2464 |
+
if (!equal(old, this.id(data))) {
|
2465 |
+
this.triggerChange({ added: data, removed: oldData });
|
2466 |
+
}
|
2467 |
+
},
|
2468 |
+
|
2469 |
+
// single
|
2470 |
+
updateSelection: function (data) {
|
2471 |
+
|
2472 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2473 |
+
|
2474 |
+
this.selection.data("select2-data", data);
|
2475 |
+
|
2476 |
+
container.empty();
|
2477 |
+
if (data !== null) {
|
2478 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2479 |
+
}
|
2480 |
+
if (formatted !== undefined) {
|
2481 |
+
container.append(formatted);
|
2482 |
+
}
|
2483 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2484 |
+
if (cssClass !== undefined) {
|
2485 |
+
container.addClass(cssClass);
|
2486 |
+
}
|
2487 |
+
|
2488 |
+
this.selection.removeClass("select2-default");
|
2489 |
+
|
2490 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2491 |
+
this.container.addClass("select2-allowclear");
|
2492 |
+
}
|
2493 |
+
},
|
2494 |
+
|
2495 |
+
// single
|
2496 |
+
val: function () {
|
2497 |
+
var val,
|
2498 |
+
triggerChange = false,
|
2499 |
+
data = null,
|
2500 |
+
self = this,
|
2501 |
+
oldData = this.data();
|
2502 |
+
|
2503 |
+
if (arguments.length === 0) {
|
2504 |
+
return this.opts.element.val();
|
2505 |
+
}
|
2506 |
+
|
2507 |
+
val = arguments[0];
|
2508 |
+
|
2509 |
+
if (arguments.length > 1) {
|
2510 |
+
triggerChange = arguments[1];
|
2511 |
+
}
|
2512 |
+
|
2513 |
+
if (this.select) {
|
2514 |
+
this.select
|
2515 |
+
.val(val)
|
2516 |
+
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2517 |
+
data = self.optionToData(elm);
|
2518 |
+
return false;
|
2519 |
+
});
|
2520 |
+
this.updateSelection(data);
|
2521 |
+
this.setPlaceholder();
|
2522 |
+
if (triggerChange) {
|
2523 |
+
this.triggerChange({added: data, removed:oldData});
|
2524 |
+
}
|
2525 |
+
} else {
|
2526 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2527 |
+
if (!val && val !== 0) {
|
2528 |
+
this.clear(triggerChange);
|
2529 |
+
return;
|
2530 |
+
}
|
2531 |
+
if (this.opts.initSelection === undefined) {
|
2532 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
2533 |
+
}
|
2534 |
+
this.opts.element.val(val);
|
2535 |
+
this.opts.initSelection(this.opts.element, function(data){
|
2536 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
2537 |
+
self.updateSelection(data);
|
2538 |
+
self.setPlaceholder();
|
2539 |
+
if (triggerChange) {
|
2540 |
+
self.triggerChange({added: data, removed:oldData});
|
2541 |
+
}
|
2542 |
+
});
|
2543 |
+
}
|
2544 |
+
},
|
2545 |
+
|
2546 |
+
// single
|
2547 |
+
clearSearch: function () {
|
2548 |
+
this.search.val("");
|
2549 |
+
this.focusser.val("");
|
2550 |
+
},
|
2551 |
+
|
2552 |
+
// single
|
2553 |
+
data: function(value) {
|
2554 |
+
var data,
|
2555 |
+
triggerChange = false;
|
2556 |
+
|
2557 |
+
if (arguments.length === 0) {
|
2558 |
+
data = this.selection.data("select2-data");
|
2559 |
+
if (data == undefined) data = null;
|
2560 |
+
return data;
|
2561 |
+
} else {
|
2562 |
+
if (arguments.length > 1) {
|
2563 |
+
triggerChange = arguments[1];
|
2564 |
+
}
|
2565 |
+
if (!value) {
|
2566 |
+
this.clear(triggerChange);
|
2567 |
+
} else {
|
2568 |
+
data = this.data();
|
2569 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
2570 |
+
this.updateSelection(value);
|
2571 |
+
if (triggerChange) {
|
2572 |
+
this.triggerChange({added: value, removed:data});
|
2573 |
+
}
|
2574 |
+
}
|
2575 |
+
}
|
2576 |
+
}
|
2577 |
+
});
|
2578 |
+
|
2579 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
2580 |
+
|
2581 |
+
// multi
|
2582 |
+
createContainer: function () {
|
2583 |
+
var container = $(document.createElement("div")).attr({
|
2584 |
+
"class": "select2-container select2-container-multi"
|
2585 |
+
}).html([
|
2586 |
+
"<ul class='select2-choices'>",
|
2587 |
+
" <li class='select2-search-field'>",
|
2588 |
+
" <label for='' class='select2-offscreen'></label>",
|
2589 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2590 |
+
" </li>",
|
2591 |
+
"</ul>",
|
2592 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2593 |
+
" <ul class='select2-results'>",
|
2594 |
+
" </ul>",
|
2595 |
+
"</div>"].join(""));
|
2596 |
+
return container;
|
2597 |
+
},
|
2598 |
+
|
2599 |
+
// multi
|
2600 |
+
prepareOpts: function () {
|
2601 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2602 |
+
self=this;
|
2603 |
+
|
2604 |
+
// TODO validate placeholder is a string if specified
|
2605 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2606 |
+
// install the selection initializer
|
2607 |
+
opts.initSelection = function (element, callback) {
|
2608 |
+
|
2609 |
+
var data = [];
|
2610 |
+
|
2611 |
+
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2612 |
+
data.push(self.optionToData(elm));
|
2613 |
+
});
|
2614 |
+
callback(data);
|
2615 |
+
};
|
2616 |
+
} else if ("data" in opts) {
|
2617 |
+
// install default initSelection when applied to hidden input and data is local
|
2618 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2619 |
+
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2620 |
+
//search in data by array of ids, storing matching items in a list
|
2621 |
+
var matches = [];
|
2622 |
+
opts.query({
|
2623 |
+
matcher: function(term, text, el){
|
2624 |
+
var is_match = $.grep(ids, function(id) {
|
2625 |
+
return equal(id, opts.id(el));
|
2626 |
+
}).length;
|
2627 |
+
if (is_match) {
|
2628 |
+
matches.push(el);
|
2629 |
+
}
|
2630 |
+
return is_match;
|
2631 |
+
},
|
2632 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2633 |
+
// reorder matches based on the order they appear in the ids array because right now
|
2634 |
+
// they are in the order in which they appear in data array
|
2635 |
+
var ordered = [];
|
2636 |
+
for (var i = 0; i < ids.length; i++) {
|
2637 |
+
var id = ids[i];
|
2638 |
+
for (var j = 0; j < matches.length; j++) {
|
2639 |
+
var match = matches[j];
|
2640 |
+
if (equal(id, opts.id(match))) {
|
2641 |
+
ordered.push(match);
|
2642 |
+
matches.splice(j, 1);
|
2643 |
+
break;
|
2644 |
+
}
|
2645 |
+
}
|
2646 |
+
}
|
2647 |
+
callback(ordered);
|
2648 |
+
}
|
2649 |
+
});
|
2650 |
+
};
|
2651 |
+
}
|
2652 |
+
|
2653 |
+
return opts;
|
2654 |
+
},
|
2655 |
+
|
2656 |
+
// multi
|
2657 |
+
selectChoice: function (choice) {
|
2658 |
+
|
2659 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
2660 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
2661 |
+
|
2662 |
+
} else {
|
2663 |
+
if (selected.length) {
|
2664 |
+
this.opts.element.trigger("choice-deselected", selected);
|
2665 |
+
}
|
2666 |
+
selected.removeClass("select2-search-choice-focus");
|
2667 |
+
if (choice && choice.length) {
|
2668 |
+
this.close();
|
2669 |
+
choice.addClass("select2-search-choice-focus");
|
2670 |
+
this.opts.element.trigger("choice-selected", choice);
|
2671 |
+
}
|
2672 |
+
}
|
2673 |
+
},
|
2674 |
+
|
2675 |
+
// multi
|
2676 |
+
destroy: function() {
|
2677 |
+
$("label[for='" + this.search.attr('id') + "']")
|
2678 |
+
.attr('for', this.opts.element.attr("id"));
|
2679 |
+
this.parent.destroy.apply(this, arguments);
|
2680 |
+
|
2681 |
+
cleanupJQueryElements.call(this,
|
2682 |
+
"searchContainer",
|
2683 |
+
"selection"
|
2684 |
+
);
|
2685 |
+
},
|
2686 |
+
|
2687 |
+
// multi
|
2688 |
+
initContainer: function () {
|
2689 |
+
|
2690 |
+
var selector = ".select2-choices", selection;
|
2691 |
+
|
2692 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
2693 |
+
this.selection = selection = this.container.find(selector);
|
2694 |
+
|
2695 |
+
var _this = this;
|
2696 |
+
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2697 |
+
_this.search[0].focus();
|
2698 |
+
_this.selectChoice($(this));
|
2699 |
+
});
|
2700 |
+
|
2701 |
+
// rewrite labels from original element to focusser
|
2702 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
2703 |
+
|
2704 |
+
this.search.prev()
|
2705 |
+
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2706 |
+
.attr('for', this.search.attr('id'));
|
2707 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2708 |
+
|
2709 |
+
this.search.on("input paste", this.bind(function() {
|
2710 |
+
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2711 |
+
if (!this.isInterfaceEnabled()) return;
|
2712 |
+
if (!this.opened()) {
|
2713 |
+
this.open();
|
2714 |
+
}
|
2715 |
+
}));
|
2716 |
+
|
2717 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
2718 |
+
|
2719 |
+
this.keydowns = 0;
|
2720 |
+
this.search.on("keydown", this.bind(function (e) {
|
2721 |
+
if (!this.isInterfaceEnabled()) return;
|
2722 |
+
|
2723 |
+
++this.keydowns;
|
2724 |
+
var selected = selection.find(".select2-search-choice-focus");
|
2725 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2726 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2727 |
+
var pos = getCursorInfo(this.search);
|
2728 |
+
|
2729 |
+
if (selected.length &&
|
2730 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2731 |
+
var selectedChoice = selected;
|
2732 |
+
if (e.which == KEY.LEFT && prev.length) {
|
2733 |
+
selectedChoice = prev;
|
2734 |
+
}
|
2735 |
+
else if (e.which == KEY.RIGHT) {
|
2736 |
+
selectedChoice = next.length ? next : null;
|
2737 |
+
}
|
2738 |
+
else if (e.which === KEY.BACKSPACE) {
|
2739 |
+
if (this.unselect(selected.first())) {
|
2740 |
+
this.search.width(10);
|
2741 |
+
selectedChoice = prev.length ? prev : next;
|
2742 |
+
}
|
2743 |
+
} else if (e.which == KEY.DELETE) {
|
2744 |
+
if (this.unselect(selected.first())) {
|
2745 |
+
this.search.width(10);
|
2746 |
+
selectedChoice = next.length ? next : null;
|
2747 |
+
}
|
2748 |
+
} else if (e.which == KEY.ENTER) {
|
2749 |
+
selectedChoice = null;
|
2750 |
+
}
|
2751 |
+
|
2752 |
+
this.selectChoice(selectedChoice);
|
2753 |
+
killEvent(e);
|
2754 |
+
if (!selectedChoice || !selectedChoice.length) {
|
2755 |
+
this.open();
|
2756 |
+
}
|
2757 |
+
return;
|
2758 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2759 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2760 |
+
|
2761 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2762 |
+
killEvent(e);
|
2763 |
+
return;
|
2764 |
+
} else {
|
2765 |
+
this.selectChoice(null);
|
2766 |
+
}
|
2767 |
+
|
2768 |
+
if (this.opened()) {
|
2769 |
+
switch (e.which) {
|
2770 |
+
case KEY.UP:
|
2771 |
+
case KEY.DOWN:
|
2772 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2773 |
+
killEvent(e);
|
2774 |
+
return;
|
2775 |
+
case KEY.ENTER:
|
2776 |
+
this.selectHighlighted();
|
2777 |
+
killEvent(e);
|
2778 |
+
return;
|
2779 |
+
case KEY.TAB:
|
2780 |
+
this.selectHighlighted({noFocus:true});
|
2781 |
+
this.close();
|
2782 |
+
return;
|
2783 |
+
case KEY.ESC:
|
2784 |
+
this.cancel(e);
|
2785 |
+
killEvent(e);
|
2786 |
+
return;
|
2787 |
+
}
|
2788 |
+
}
|
2789 |
+
|
2790 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2791 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2792 |
+
return;
|
2793 |
+
}
|
2794 |
+
|
2795 |
+
if (e.which === KEY.ENTER) {
|
2796 |
+
if (this.opts.openOnEnter === false) {
|
2797 |
+
return;
|
2798 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2799 |
+
return;
|
2800 |
+
}
|
2801 |
+
}
|
2802 |
+
|
2803 |
+
this.open();
|
2804 |
+
|
2805 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2806 |
+
// prevent the page from scrolling
|
2807 |
+
killEvent(e);
|
2808 |
+
}
|
2809 |
+
|
2810 |
+
if (e.which === KEY.ENTER) {
|
2811 |
+
// prevent form from being submitted
|
2812 |
+
killEvent(e);
|
2813 |
+
}
|
2814 |
+
|
2815 |
+
}));
|
2816 |
+
|
2817 |
+
this.search.on("keyup", this.bind(function (e) {
|
2818 |
+
this.keydowns = 0;
|
2819 |
+
this.resizeSearch();
|
2820 |
+
})
|
2821 |
+
);
|
2822 |
+
|
2823 |
+
this.search.on("blur", this.bind(function(e) {
|
2824 |
+
this.container.removeClass("select2-container-active");
|
2825 |
+
this.search.removeClass("select2-focused");
|
2826 |
+
this.selectChoice(null);
|
2827 |
+
if (!this.opened()) this.clearSearch();
|
2828 |
+
e.stopImmediatePropagation();
|
2829 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2830 |
+
}));
|
2831 |
+
|
2832 |
+
this.container.on("click", selector, this.bind(function (e) {
|
2833 |
+
if (!this.isInterfaceEnabled()) return;
|
2834 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
2835 |
+
// clicked inside a select2 search choice, do not open
|
2836 |
+
return;
|
2837 |
+
}
|
2838 |
+
this.selectChoice(null);
|
2839 |
+
this.clearPlaceholder();
|
2840 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2841 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2842 |
+
}
|
2843 |
+
this.open();
|
2844 |
+
this.focusSearch();
|
2845 |
+
e.preventDefault();
|
2846 |
+
}));
|
2847 |
+
|
2848 |
+
this.container.on("focus", selector, this.bind(function () {
|
2849 |
+
if (!this.isInterfaceEnabled()) return;
|
2850 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2851 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2852 |
+
}
|
2853 |
+
this.container.addClass("select2-container-active");
|
2854 |
+
this.dropdown.addClass("select2-drop-active");
|
2855 |
+
this.clearPlaceholder();
|
2856 |
+
}));
|
2857 |
+
|
2858 |
+
this.initContainerWidth();
|
2859 |
+
this.opts.element.hide();
|
2860 |
+
|
2861 |
+
// set the placeholder if necessary
|
2862 |
+
this.clearSearch();
|
2863 |
+
},
|
2864 |
+
|
2865 |
+
// multi
|
2866 |
+
enableInterface: function() {
|
2867 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
2868 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
2869 |
+
}
|
2870 |
+
},
|
2871 |
+
|
2872 |
+
// multi
|
2873 |
+
initSelection: function () {
|
2874 |
+
var data;
|
2875 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
2876 |
+
this.updateSelection([]);
|
2877 |
+
this.close();
|
2878 |
+
// set the placeholder if necessary
|
2879 |
+
this.clearSearch();
|
2880 |
+
}
|
2881 |
+
if (this.select || this.opts.element.val() !== "") {
|
2882 |
+
var self = this;
|
2883 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
2884 |
+
if (data !== undefined && data !== null) {
|
2885 |
+
self.updateSelection(data);
|
2886 |
+
self.close();
|
2887 |
+
// set the placeholder if necessary
|
2888 |
+
self.clearSearch();
|
2889 |
+
}
|
2890 |
+
});
|
2891 |
+
}
|
2892 |
+
},
|
2893 |
+
|
2894 |
+
// multi
|
2895 |
+
clearSearch: function () {
|
2896 |
+
var placeholder = this.getPlaceholder(),
|
2897 |
+
maxWidth = this.getMaxSearchWidth();
|
2898 |
+
|
2899 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
2900 |
+
this.search.val(placeholder).addClass("select2-default");
|
2901 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
2902 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
2903 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
2904 |
+
} else {
|
2905 |
+
this.search.val("").width(10);
|
2906 |
+
}
|
2907 |
+
},
|
2908 |
+
|
2909 |
+
// multi
|
2910 |
+
clearPlaceholder: function () {
|
2911 |
+
if (this.search.hasClass("select2-default")) {
|
2912 |
+
this.search.val("").removeClass("select2-default");
|
2913 |
+
}
|
2914 |
+
},
|
2915 |
+
|
2916 |
+
// multi
|
2917 |
+
opening: function () {
|
2918 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
2919 |
+
this.resizeSearch();
|
2920 |
+
|
2921 |
+
this.parent.opening.apply(this, arguments);
|
2922 |
+
|
2923 |
+
this.focusSearch();
|
2924 |
+
|
2925 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2926 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2927 |
+
if(this.search.val() === "") {
|
2928 |
+
if(this.nextSearchTerm != undefined){
|
2929 |
+
this.search.val(this.nextSearchTerm);
|
2930 |
+
this.search.select();
|
2931 |
+
}
|
2932 |
+
}
|
2933 |
+
|
2934 |
+
this.updateResults(true);
|
2935 |
+
if (this.opts.shouldFocusInput(this)) {
|
2936 |
+
this.search.focus();
|
2937 |
+
}
|
2938 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2939 |
+
},
|
2940 |
+
|
2941 |
+
// multi
|
2942 |
+
close: function () {
|
2943 |
+
if (!this.opened()) return;
|
2944 |
+
this.parent.close.apply(this, arguments);
|
2945 |
+
},
|
2946 |
+
|
2947 |
+
// multi
|
2948 |
+
focus: function () {
|
2949 |
+
this.close();
|
2950 |
+
this.search.focus();
|
2951 |
+
},
|
2952 |
+
|
2953 |
+
// multi
|
2954 |
+
isFocused: function () {
|
2955 |
+
return this.search.hasClass("select2-focused");
|
2956 |
+
},
|
2957 |
+
|
2958 |
+
// multi
|
2959 |
+
updateSelection: function (data) {
|
2960 |
+
var ids = [], filtered = [], self = this;
|
2961 |
+
|
2962 |
+
// filter out duplicates
|
2963 |
+
$(data).each(function () {
|
2964 |
+
if (indexOf(self.id(this), ids) < 0) {
|
2965 |
+
ids.push(self.id(this));
|
2966 |
+
filtered.push(this);
|
2967 |
+
}
|
2968 |
+
});
|
2969 |
+
data = filtered;
|
2970 |
+
|
2971 |
+
this.selection.find(".select2-search-choice").remove();
|
2972 |
+
$(data).each(function () {
|
2973 |
+
self.addSelectedChoice(this);
|
2974 |
+
});
|
2975 |
+
self.postprocessResults();
|
2976 |
+
},
|
2977 |
+
|
2978 |
+
// multi
|
2979 |
+
tokenize: function() {
|
2980 |
+
var input = this.search.val();
|
2981 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
2982 |
+
if (input != null && input != undefined) {
|
2983 |
+
this.search.val(input);
|
2984 |
+
if (input.length > 0) {
|
2985 |
+
this.open();
|
2986 |
+
}
|
2987 |
+
}
|
2988 |
+
|
2989 |
+
},
|
2990 |
+
|
2991 |
+
// multi
|
2992 |
+
onSelect: function (data, options) {
|
2993 |
+
|
2994 |
+
if (!this.triggerSelect(data) || data.text === "") { return; }
|
2995 |
+
|
2996 |
+
this.addSelectedChoice(data);
|
2997 |
+
|
2998 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
2999 |
+
|
3000 |
+
// keep track of the search's value before it gets cleared
|
3001 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
3002 |
+
|
3003 |
+
this.clearSearch();
|
3004 |
+
this.updateResults();
|
3005 |
+
|
3006 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3007 |
+
|
3008 |
+
if (this.opts.closeOnSelect) {
|
3009 |
+
this.close();
|
3010 |
+
this.search.width(10);
|
3011 |
+
} else {
|
3012 |
+
if (this.countSelectableResults()>0) {
|
3013 |
+
this.search.width(10);
|
3014 |
+
this.resizeSearch();
|
3015 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3016 |
+
// if we reached max selection size repaint the results so choices
|
3017 |
+
// are replaced with the max selection reached message
|
3018 |
+
this.updateResults(true);
|
3019 |
+
} else {
|
3020 |
+
// initializes search's value with nextSearchTerm and update search result
|
3021 |
+
if(this.nextSearchTerm != undefined){
|
3022 |
+
this.search.val(this.nextSearchTerm);
|
3023 |
+
this.updateResults();
|
3024 |
+
this.search.select();
|
3025 |
+
}
|
3026 |
+
}
|
3027 |
+
this.positionDropdown();
|
3028 |
+
} else {
|
3029 |
+
// if nothing left to select close
|
3030 |
+
this.close();
|
3031 |
+
this.search.width(10);
|
3032 |
+
}
|
3033 |
+
}
|
3034 |
+
|
3035 |
+
// since its not possible to select an element that has already been
|
3036 |
+
// added we do not need to check if this is a new element before firing change
|
3037 |
+
this.triggerChange({ added: data });
|
3038 |
+
|
3039 |
+
if (!options || !options.noFocus)
|
3040 |
+
this.focusSearch();
|
3041 |
+
},
|
3042 |
+
|
3043 |
+
// multi
|
3044 |
+
cancel: function () {
|
3045 |
+
this.close();
|
3046 |
+
this.focusSearch();
|
3047 |
+
},
|
3048 |
+
|
3049 |
+
addSelectedChoice: function (data) {
|
3050 |
+
var enableChoice = !data.locked,
|
3051 |
+
enabledItem = $(
|
3052 |
+
"<li class='select2-search-choice'>" +
|
3053 |
+
" <div></div>" +
|
3054 |
+
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3055 |
+
"</li>"),
|
3056 |
+
disabledItem = $(
|
3057 |
+
"<li class='select2-search-choice select2-locked'>" +
|
3058 |
+
"<div></div>" +
|
3059 |
+
"</li>");
|
3060 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
3061 |
+
id = this.id(data),
|
3062 |
+
val = this.getVal(),
|
3063 |
+
formatted,
|
3064 |
+
cssClass;
|
3065 |
+
|
3066 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3067 |
+
if (formatted != undefined) {
|
3068 |
+
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3069 |
+
}
|
3070 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3071 |
+
if (cssClass != undefined) {
|
3072 |
+
choice.addClass(cssClass);
|
3073 |
+
}
|
3074 |
+
|
3075 |
+
if(enableChoice){
|
3076 |
+
choice.find(".select2-search-choice-close")
|
3077 |
+
.on("mousedown", killEvent)
|
3078 |
+
.on("click dblclick", this.bind(function (e) {
|
3079 |
+
if (!this.isInterfaceEnabled()) return;
|
3080 |
+
|
3081 |
+
this.unselect($(e.target));
|
3082 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3083 |
+
killEvent(e);
|
3084 |
+
this.close();
|
3085 |
+
this.focusSearch();
|
3086 |
+
})).on("focus", this.bind(function () {
|
3087 |
+
if (!this.isInterfaceEnabled()) return;
|
3088 |
+
this.container.addClass("select2-container-active");
|
3089 |
+
this.dropdown.addClass("select2-drop-active");
|
3090 |
+
}));
|
3091 |
+
}
|
3092 |
+
|
3093 |
+
choice.data("select2-data", data);
|
3094 |
+
choice.insertBefore(this.searchContainer);
|
3095 |
+
|
3096 |
+
val.push(id);
|
3097 |
+
this.setVal(val);
|
3098 |
+
},
|
3099 |
+
|
3100 |
+
// multi
|
3101 |
+
unselect: function (selected) {
|
3102 |
+
var val = this.getVal(),
|
3103 |
+
data,
|
3104 |
+
index;
|
3105 |
+
selected = selected.closest(".select2-search-choice");
|
3106 |
+
|
3107 |
+
if (selected.length === 0) {
|
3108 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3109 |
+
}
|
3110 |
+
|
3111 |
+
data = selected.data("select2-data");
|
3112 |
+
|
3113 |
+
if (!data) {
|
3114 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3115 |
+
// and invoked on an element already removed
|
3116 |
+
return;
|
3117 |
+
}
|
3118 |
+
|
3119 |
+
var evt = $.Event("select2-removing");
|
3120 |
+
evt.val = this.id(data);
|
3121 |
+
evt.choice = data;
|
3122 |
+
this.opts.element.trigger(evt);
|
3123 |
+
|
3124 |
+
if (evt.isDefaultPrevented()) {
|
3125 |
+
return false;
|
3126 |
+
}
|
3127 |
+
|
3128 |
+
while((index = indexOf(this.id(data), val)) >= 0) {
|
3129 |
+
val.splice(index, 1);
|
3130 |
+
this.setVal(val);
|
3131 |
+
if (this.select) this.postprocessResults();
|
3132 |
+
}
|
3133 |
+
|
3134 |
+
selected.remove();
|
3135 |
+
|
3136 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3137 |
+
this.triggerChange({ removed: data });
|
3138 |
+
|
3139 |
+
return true;
|
3140 |
+
},
|
3141 |
+
|
3142 |
+
// multi
|
3143 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3144 |
+
var val = this.getVal(),
|
3145 |
+
choices = this.results.find(".select2-result"),
|
3146 |
+
compound = this.results.find(".select2-result-with-children"),
|
3147 |
+
self = this;
|
3148 |
+
|
3149 |
+
choices.each2(function (i, choice) {
|
3150 |
+
var id = self.id(choice.data("select2-data"));
|
3151 |
+
if (indexOf(id, val) >= 0) {
|
3152 |
+
choice.addClass("select2-selected");
|
3153 |
+
// mark all children of the selected parent as selected
|
3154 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3155 |
+
}
|
3156 |
+
});
|
3157 |
+
|
3158 |
+
compound.each2(function(i, choice) {
|
3159 |
+
// hide an optgroup if it doesn't have any selectable children
|
3160 |
+
if (!choice.is('.select2-result-selectable')
|
3161 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3162 |
+
choice.addClass("select2-selected");
|
3163 |
+
}
|
3164 |
+
});
|
3165 |
+
|
3166 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3167 |
+
self.highlight(0);
|
3168 |
+
}
|
3169 |
+
|
3170 |
+
//If all results are chosen render formatNoMatches
|
3171 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3172 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3173 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3174 |
+
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3175 |
+
}
|
3176 |
+
}
|
3177 |
+
}
|
3178 |
+
|
3179 |
+
},
|
3180 |
+
|
3181 |
+
// multi
|
3182 |
+
getMaxSearchWidth: function() {
|
3183 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
3184 |
+
},
|
3185 |
+
|
3186 |
+
// multi
|
3187 |
+
resizeSearch: function () {
|
3188 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3189 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
3190 |
+
|
3191 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
3192 |
+
|
3193 |
+
left = this.search.offset().left;
|
3194 |
+
|
3195 |
+
maxWidth = this.selection.width();
|
3196 |
+
containerLeft = this.selection.offset().left;
|
3197 |
+
|
3198 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3199 |
+
|
3200 |
+
if (searchWidth < minimumWidth) {
|
3201 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3202 |
+
}
|
3203 |
+
|
3204 |
+
if (searchWidth < 40) {
|
3205 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3206 |
+
}
|
3207 |
+
|
3208 |
+
if (searchWidth <= 0) {
|
3209 |
+
searchWidth = minimumWidth;
|
3210 |
+
}
|
3211 |
+
|
3212 |
+
this.search.width(Math.floor(searchWidth));
|
3213 |
+
},
|
3214 |
+
|
3215 |
+
// multi
|
3216 |
+
getVal: function () {
|
3217 |
+
var val;
|
3218 |
+
if (this.select) {
|
3219 |
+
val = this.select.val();
|
3220 |
+
return val === null ? [] : val;
|
3221 |
+
} else {
|
3222 |
+
val = this.opts.element.val();
|
3223 |
+
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3224 |
+
}
|
3225 |
+
},
|
3226 |
+
|
3227 |
+
// multi
|
3228 |
+
setVal: function (val) {
|
3229 |
+
var unique;
|
3230 |
+
if (this.select) {
|
3231 |
+
this.select.val(val);
|
3232 |
+
} else {
|
3233 |
+
unique = [];
|
3234 |
+
// filter out duplicates
|
3235 |
+
$(val).each(function () {
|
3236 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
3237 |
+
});
|
3238 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3239 |
+
}
|
3240 |
+
},
|
3241 |
+
|
3242 |
+
// multi
|
3243 |
+
buildChangeDetails: function (old, current) {
|
3244 |
+
var current = current.slice(0),
|
3245 |
+
old = old.slice(0);
|
3246 |
+
|
3247 |
+
// remove intersection from each array
|
3248 |
+
for (var i = 0; i < current.length; i++) {
|
3249 |
+
for (var j = 0; j < old.length; j++) {
|
3250 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3251 |
+
current.splice(i, 1);
|
3252 |
+
if(i>0){
|
3253 |
+
i--;
|
3254 |
+
}
|
3255 |
+
old.splice(j, 1);
|
3256 |
+
j--;
|
3257 |
+
}
|
3258 |
+
}
|
3259 |
+
}
|
3260 |
+
|
3261 |
+
return {added: current, removed: old};
|
3262 |
+
},
|
3263 |
+
|
3264 |
+
|
3265 |
+
// multi
|
3266 |
+
val: function (val, triggerChange) {
|
3267 |
+
var oldData, self=this;
|
3268 |
+
|
3269 |
+
if (arguments.length === 0) {
|
3270 |
+
return this.getVal();
|
3271 |
+
}
|
3272 |
+
|
3273 |
+
oldData=this.data();
|
3274 |
+
if (!oldData.length) oldData=[];
|
3275 |
+
|
3276 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3277 |
+
if (!val && val !== 0) {
|
3278 |
+
this.opts.element.val("");
|
3279 |
+
this.updateSelection([]);
|
3280 |
+
this.clearSearch();
|
3281 |
+
if (triggerChange) {
|
3282 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
3283 |
+
}
|
3284 |
+
return;
|
3285 |
+
}
|
3286 |
+
|
3287 |
+
// val is a list of ids
|
3288 |
+
this.setVal(val);
|
3289 |
+
|
3290 |
+
if (this.select) {
|
3291 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3292 |
+
if (triggerChange) {
|
3293 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3294 |
+
}
|
3295 |
+
} else {
|
3296 |
+
if (this.opts.initSelection === undefined) {
|
3297 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
3298 |
+
}
|
3299 |
+
|
3300 |
+
this.opts.initSelection(this.opts.element, function(data){
|
3301 |
+
var ids=$.map(data, self.id);
|
3302 |
+
self.setVal(ids);
|
3303 |
+
self.updateSelection(data);
|
3304 |
+
self.clearSearch();
|
3305 |
+
if (triggerChange) {
|
3306 |
+
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3307 |
+
}
|
3308 |
+
});
|
3309 |
+
}
|
3310 |
+
this.clearSearch();
|
3311 |
+
},
|
3312 |
+
|
3313 |
+
// multi
|
3314 |
+
onSortStart: function() {
|
3315 |
+
if (this.select) {
|
3316 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3317 |
+
}
|
3318 |
+
|
3319 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
3320 |
+
this.search.width(0);
|
3321 |
+
// hide the container
|
3322 |
+
this.searchContainer.hide();
|
3323 |
+
},
|
3324 |
+
|
3325 |
+
// multi
|
3326 |
+
onSortEnd:function() {
|
3327 |
+
|
3328 |
+
var val=[], self=this;
|
3329 |
+
|
3330 |
+
// show search and move it to the end of the list
|
3331 |
+
this.searchContainer.show();
|
3332 |
+
// make sure the search container is the last item in the list
|
3333 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
3334 |
+
// since we collapsed the width in dragStarted, we resize it here
|
3335 |
+
this.resizeSearch();
|
3336 |
+
|
3337 |
+
// update selection
|
3338 |
+
this.selection.find(".select2-search-choice").each(function() {
|
3339 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
3340 |
+
});
|
3341 |
+
this.setVal(val);
|
3342 |
+
this.triggerChange();
|
3343 |
+
},
|
3344 |
+
|
3345 |
+
// multi
|
3346 |
+
data: function(values, triggerChange) {
|
3347 |
+
var self=this, ids, old;
|
3348 |
+
if (arguments.length === 0) {
|
3349 |
+
return this.selection
|
3350 |
+
.children(".select2-search-choice")
|
3351 |
+
.map(function() { return $(this).data("select2-data"); })
|
3352 |
+
.get();
|
3353 |
+
} else {
|
3354 |
+
old = this.data();
|
3355 |
+
if (!values) { values = []; }
|
3356 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3357 |
+
this.setVal(ids);
|
3358 |
+
this.updateSelection(values);
|
3359 |
+
this.clearSearch();
|
3360 |
+
if (triggerChange) {
|
3361 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3362 |
+
}
|
3363 |
+
}
|
3364 |
+
}
|
3365 |
+
});
|
3366 |
+
|
3367 |
+
$.fn.select2 = function () {
|
3368 |
+
|
3369 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
3370 |
+
opts,
|
3371 |
+
select2,
|
3372 |
+
method, value, multiple,
|
3373 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3374 |
+
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3375 |
+
propertyMethods = ["val", "data"],
|
3376 |
+
methodsMap = { search: "externalSearch" };
|
3377 |
+
|
3378 |
+
this.each(function () {
|
3379 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
3380 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3381 |
+
opts.element = $(this);
|
3382 |
+
|
3383 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3384 |
+
multiple = opts.element.prop("multiple");
|
3385 |
+
} else {
|
3386 |
+
multiple = opts.multiple || false;
|
3387 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3388 |
+
}
|
3389 |
+
|
3390 |
+
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3391 |
+
select2.init(opts);
|
3392 |
+
} else if (typeof(args[0]) === "string") {
|
3393 |
+
|
3394 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
3395 |
+
throw "Unknown method: " + args[0];
|
3396 |
+
}
|
3397 |
+
|
3398 |
+
value = undefined;
|
3399 |
+
select2 = $(this).data("select2");
|
3400 |
+
if (select2 === undefined) return;
|
3401 |
+
|
3402 |
+
method=args[0];
|
3403 |
+
|
3404 |
+
if (method === "container") {
|
3405 |
+
value = select2.container;
|
3406 |
+
} else if (method === "dropdown") {
|
3407 |
+
value = select2.dropdown;
|
3408 |
+
} else {
|
3409 |
+
if (methodsMap[method]) method = methodsMap[method];
|
3410 |
+
|
3411 |
+
value = select2[method].apply(select2, args.slice(1));
|
3412 |
+
}
|
3413 |
+
if (indexOf(args[0], valueMethods) >= 0
|
3414 |
+
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3415 |
+
return false; // abort the iteration, ready to return first matched value
|
3416 |
+
}
|
3417 |
+
} else {
|
3418 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
3419 |
+
}
|
3420 |
+
});
|
3421 |
+
return (value === undefined) ? this : value;
|
3422 |
+
};
|
3423 |
+
|
3424 |
+
// plugin defaults, accessible to users
|
3425 |
+
$.fn.select2.defaults = {
|
3426 |
+
width: "copy",
|
3427 |
+
loadMorePadding: 0,
|
3428 |
+
closeOnSelect: true,
|
3429 |
+
openOnEnter: true,
|
3430 |
+
containerCss: {},
|
3431 |
+
dropdownCss: {},
|
3432 |
+
containerCssClass: "",
|
3433 |
+
dropdownCssClass: "",
|
3434 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
3435 |
+
var markup=[];
|
3436 |
+
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3437 |
+
return markup.join("");
|
3438 |
+
},
|
3439 |
+
transformVal: function(val) {
|
3440 |
+
return $.trim(val);
|
3441 |
+
},
|
3442 |
+
formatSelection: function (data, container, escapeMarkup) {
|
3443 |
+
return data ? escapeMarkup(this.text(data)) : undefined;
|
3444 |
+
},
|
3445 |
+
sortResults: function (results, container, query) {
|
3446 |
+
return results;
|
3447 |
+
},
|
3448 |
+
formatResultCssClass: function(data) {return data.css;},
|
3449 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
3450 |
+
minimumResultsForSearch: 0,
|
3451 |
+
minimumInputLength: 0,
|
3452 |
+
maximumInputLength: null,
|
3453 |
+
maximumSelectionSize: 0,
|
3454 |
+
id: function (e) { return e == undefined ? null : e.id; },
|
3455 |
+
text: function (e) {
|
3456 |
+
if (e && this.data && this.data.text) {
|
3457 |
+
if ($.isFunction(this.data.text)) {
|
3458 |
+
return this.data.text(e);
|
3459 |
+
} else {
|
3460 |
+
return e[this.data.text];
|
3461 |
+
}
|
3462 |
+
} else {
|
3463 |
+
return e.text;
|
3464 |
+
}
|
3465 |
+
},
|
3466 |
+
matcher: function(term, text) {
|
3467 |
+
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3468 |
+
},
|
3469 |
+
separator: ",",
|
3470 |
+
tokenSeparators: [],
|
3471 |
+
tokenizer: defaultTokenizer,
|
3472 |
+
escapeMarkup: defaultEscapeMarkup,
|
3473 |
+
blurOnChange: false,
|
3474 |
+
selectOnBlur: false,
|
3475 |
+
adaptContainerCssClass: function(c) { return c; },
|
3476 |
+
adaptDropdownCssClass: function(c) { return null; },
|
3477 |
+
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3478 |
+
searchInputPlaceholder: '',
|
3479 |
+
createSearchChoicePosition: 'top',
|
3480 |
+
shouldFocusInput: function (instance) {
|
3481 |
+
// Attempt to detect touch devices
|
3482 |
+
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3483 |
+
(navigator.msMaxTouchPoints > 0));
|
3484 |
+
|
3485 |
+
// Only devices which support touch events should be special cased
|
3486 |
+
if (!supportsTouchEvents) {
|
3487 |
+
return true;
|
3488 |
+
}
|
3489 |
+
|
3490 |
+
// Never focus the input if search is disabled
|
3491 |
+
if (instance.opts.minimumResultsForSearch < 0) {
|
3492 |
+
return false;
|
3493 |
+
}
|
3494 |
+
|
3495 |
+
return true;
|
3496 |
+
}
|
3497 |
+
};
|
3498 |
+
|
3499 |
+
$.fn.select2.locales = [];
|
3500 |
+
|
3501 |
+
$.fn.select2.locales['en'] = {
|
3502 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3503 |
+
formatNoMatches: function () { return "No matches found"; },
|
3504 |
+
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3505 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3506 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3507 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3508 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3509 |
+
formatSearching: function () { return "Searching…"; }
|
3510 |
+
};
|
3511 |
+
|
3512 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3513 |
+
|
3514 |
+
$.fn.select2.ajaxDefaults = {
|
3515 |
+
transport: $.ajax,
|
3516 |
+
params: {
|
3517 |
+
type: "GET",
|
3518 |
+
cache: false,
|
3519 |
+
dataType: "json"
|
3520 |
+
}
|
3521 |
+
};
|
3522 |
+
|
3523 |
+
// exports
|
3524 |
+
window.Select2 = {
|
3525 |
+
query: {
|
3526 |
+
ajax: ajax,
|
3527 |
+
local: local,
|
3528 |
+
tags: tags
|
3529 |
+
}, util: {
|
3530 |
+
debounce: debounce,
|
3531 |
+
markMatch: markMatch,
|
3532 |
+
escapeMarkup: defaultEscapeMarkup,
|
3533 |
+
stripDiacritics: stripDiacritics
|
3534 |
+
}, "class": {
|
3535 |
+
"abstract": AbstractSelect2,
|
3536 |
+
"single": SingleSelect2,
|
3537 |
+
"multi": MultiSelect2
|
3538 |
+
}
|
3539 |
+
};
|
3540 |
+
|
3541 |
+
}(jQuery));
|
assets/deps/select2-3.5.2/select2.min.js
CHANGED
@@ -1,23 +1,23 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2014 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
-
permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
22 |
-
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
23 |
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
1 |
+
/*
|
2 |
+
Copyright 2014 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
+
permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
23 |
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ar.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Arabic translation.
|
3 |
-
*
|
4 |
-
* Author: Adel KEDJOUR <adel@kedjour.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ar'] = {
|
10 |
-
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
13 |
-
formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
15 |
-
formatSearching: function () { return "البحث…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Arabic translation.
|
3 |
+
*
|
4 |
+
* Author: Adel KEDJOUR <adel@kedjour.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ar'] = {
|
10 |
+
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
13 |
+
formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
15 |
+
formatSearching: function () { return "البحث…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_az.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Azerbaijani translation.
|
3 |
-
*
|
4 |
-
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['az'] = {
|
10 |
-
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
11 |
-
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
16 |
-
formatSearching: function () { return "Axtarılır…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Azerbaijani translation.
|
3 |
+
*
|
4 |
+
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['az'] = {
|
10 |
+
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
11 |
+
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
16 |
+
formatSearching: function () { return "Axtarılır…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_bg.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Bulgarian translation.
|
3 |
-
*
|
4 |
-
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['bg'] = {
|
11 |
-
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
16 |
-
formatSearching: function () { return "Търсене…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Bulgarian translation.
|
3 |
+
*
|
4 |
+
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['bg'] = {
|
11 |
+
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
16 |
+
formatSearching: function () { return "Търсене…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ca.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Catalan translation.
|
3 |
-
*
|
4 |
-
* Author: David Planella <david.planella@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ca'] = {
|
10 |
-
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
15 |
-
formatSearching: function () { return "S'està cercant…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Catalan translation.
|
3 |
+
*
|
4 |
+
* Author: David Planella <david.planella@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ca'] = {
|
10 |
+
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
15 |
+
formatSearching: function () { return "S'està cercant…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_cs.js
CHANGED
@@ -1,51 +1,51 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Czech translation.
|
3 |
-
*
|
4 |
-
* Author: Michal Marek <ahoj@michal-marek.cz>
|
5 |
-
* Author - sklonovani: David Vallner <david@vallner.net>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
// use text for the numbers 2 through 4
|
10 |
-
var smallNumbers = {
|
11 |
-
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
12 |
-
3: function() { return "tři"; },
|
13 |
-
4: function() { return "čtyři"; }
|
14 |
-
}
|
15 |
-
$.fn.select2.locales['cs'] = {
|
16 |
-
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
17 |
-
formatInputTooShort: function (input, min) {
|
18 |
-
var n = min - input.length;
|
19 |
-
if (n == 1) {
|
20 |
-
return "Prosím zadejte ještě jeden znak";
|
21 |
-
} else if (n <= 4) {
|
22 |
-
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
23 |
-
} else {
|
24 |
-
return "Prosím zadejte ještě dalších "+n+" znaků";
|
25 |
-
}
|
26 |
-
},
|
27 |
-
formatInputTooLong: function (input, max) {
|
28 |
-
var n = input.length - max;
|
29 |
-
if (n == 1) {
|
30 |
-
return "Prosím zadejte o jeden znak méně";
|
31 |
-
} else if (n <= 4) {
|
32 |
-
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
33 |
-
} else {
|
34 |
-
return "Prosím zadejte o "+n+" znaků méně";
|
35 |
-
}
|
36 |
-
},
|
37 |
-
formatSelectionTooBig: function (limit) {
|
38 |
-
if (limit == 1) {
|
39 |
-
return "Můžete zvolit jen jednu položku";
|
40 |
-
} else if (limit <= 4) {
|
41 |
-
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
42 |
-
} else {
|
43 |
-
return "Můžete zvolit maximálně "+limit+" položek";
|
44 |
-
}
|
45 |
-
},
|
46 |
-
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
47 |
-
formatSearching: function () { return "Vyhledávání…"; }
|
48 |
-
};
|
49 |
-
|
50 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
51 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Czech translation.
|
3 |
+
*
|
4 |
+
* Author: Michal Marek <ahoj@michal-marek.cz>
|
5 |
+
* Author - sklonovani: David Vallner <david@vallner.net>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
// use text for the numbers 2 through 4
|
10 |
+
var smallNumbers = {
|
11 |
+
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
12 |
+
3: function() { return "tři"; },
|
13 |
+
4: function() { return "čtyři"; }
|
14 |
+
}
|
15 |
+
$.fn.select2.locales['cs'] = {
|
16 |
+
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
17 |
+
formatInputTooShort: function (input, min) {
|
18 |
+
var n = min - input.length;
|
19 |
+
if (n == 1) {
|
20 |
+
return "Prosím zadejte ještě jeden znak";
|
21 |
+
} else if (n <= 4) {
|
22 |
+
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
23 |
+
} else {
|
24 |
+
return "Prosím zadejte ještě dalších "+n+" znaků";
|
25 |
+
}
|
26 |
+
},
|
27 |
+
formatInputTooLong: function (input, max) {
|
28 |
+
var n = input.length - max;
|
29 |
+
if (n == 1) {
|
30 |
+
return "Prosím zadejte o jeden znak méně";
|
31 |
+
} else if (n <= 4) {
|
32 |
+
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
33 |
+
} else {
|
34 |
+
return "Prosím zadejte o "+n+" znaků méně";
|
35 |
+
}
|
36 |
+
},
|
37 |
+
formatSelectionTooBig: function (limit) {
|
38 |
+
if (limit == 1) {
|
39 |
+
return "Můžete zvolit jen jednu položku";
|
40 |
+
} else if (limit <= 4) {
|
41 |
+
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
42 |
+
} else {
|
43 |
+
return "Můžete zvolit maximálně "+limit+" položek";
|
44 |
+
}
|
45 |
+
},
|
46 |
+
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
47 |
+
formatSearching: function () { return "Vyhledávání…"; }
|
48 |
+
};
|
49 |
+
|
50 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
51 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_da.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Danish translation.
|
3 |
-
*
|
4 |
-
* Author: Anders Jenbo <anders@jenbo.dk>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['da'] = {
|
10 |
-
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
15 |
-
formatSearching: function () { return "Søger…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Danish translation.
|
3 |
+
*
|
4 |
+
* Author: Anders Jenbo <anders@jenbo.dk>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['da'] = {
|
10 |
+
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
15 |
+
formatSearching: function () { return "Søger…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_de.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 German translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['de'] = {
|
8 |
-
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
13 |
-
formatSearching: function () { return "Suche…"; },
|
14 |
-
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
18 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 German translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['de'] = {
|
8 |
+
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
13 |
+
formatSearching: function () { return "Suche…"; },
|
14 |
+
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
18 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_el.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Greek translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['el'] = {
|
10 |
-
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
15 |
-
formatSearching: function () { return "Αναζήτηση…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
19 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Greek translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['el'] = {
|
10 |
+
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
15 |
+
formatSearching: function () { return "Αναζήτηση…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
19 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_en.js.template
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 <Language> translation.
|
3 |
-
*
|
4 |
-
* Author: Your Name <your@email>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['en'] = {
|
10 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
11 |
-
formatNoMatches: function () { return "No matches found"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
14 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
16 |
-
formatSearching: function () { return "Searching…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 <Language> translation.
|
3 |
+
*
|
4 |
+
* Author: Your Name <your@email>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['en'] = {
|
10 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
11 |
+
formatNoMatches: function () { return "No matches found"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
14 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
16 |
+
formatSearching: function () { return "Searching…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_es.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Spanish translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['es'] = {
|
8 |
-
formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
|
9 |
-
formatNoMatches: function () { return "No se encontraron resultados"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
14 |
-
formatSearching: function () { return "Buscando…"; },
|
15 |
-
formatAjaxError: function() { return "La carga falló"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Spanish translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['es'] = {
|
8 |
+
formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
|
9 |
+
formatNoMatches: function () { return "No se encontraron resultados"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
14 |
+
formatSearching: function () { return "Buscando…"; },
|
15 |
+
formatAjaxError: function() { return "La carga falló"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_et.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Estonian translation.
|
3 |
-
*
|
4 |
-
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['et'] = {
|
10 |
-
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
15 |
-
formatSearching: function () { return "Otsin.."; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Estonian translation.
|
3 |
+
*
|
4 |
+
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['et'] = {
|
10 |
+
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
15 |
+
formatSearching: function () { return "Otsin.."; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_eu.js
CHANGED
@@ -1,45 +1,45 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Basque translation.
|
3 |
-
*
|
4 |
-
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['eu'] = {
|
10 |
-
formatNoMatches: function () {
|
11 |
-
return "Ez da bat datorrenik aurkitu";
|
12 |
-
},
|
13 |
-
formatInputTooShort: function (input, min) {
|
14 |
-
var n = min - input.length;
|
15 |
-
if (n === 1) {
|
16 |
-
return "Idatzi karaktere bat gehiago";
|
17 |
-
} else {
|
18 |
-
return "Idatzi " + n + " karaktere gehiago";
|
19 |
-
}
|
20 |
-
},
|
21 |
-
formatInputTooLong: function (input, max) {
|
22 |
-
var n = input.length - max;
|
23 |
-
if (n === 1) {
|
24 |
-
return "Idatzi karaktere bat gutxiago";
|
25 |
-
} else {
|
26 |
-
return "Idatzi " + n + " karaktere gutxiago";
|
27 |
-
}
|
28 |
-
},
|
29 |
-
formatSelectionTooBig: function (limit) {
|
30 |
-
if (limit === 1 ) {
|
31 |
-
return "Elementu bakarra hauta dezakezu";
|
32 |
-
} else {
|
33 |
-
return limit + " elementu hauta ditzakezu soilik";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatLoadMore: function (pageNumber) {
|
37 |
-
return "Emaitza gehiago kargatzen…";
|
38 |
-
},
|
39 |
-
formatSearching: function () {
|
40 |
-
return "Bilatzen…";
|
41 |
-
}
|
42 |
-
};
|
43 |
-
|
44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
45 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Basque translation.
|
3 |
+
*
|
4 |
+
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['eu'] = {
|
10 |
+
formatNoMatches: function () {
|
11 |
+
return "Ez da bat datorrenik aurkitu";
|
12 |
+
},
|
13 |
+
formatInputTooShort: function (input, min) {
|
14 |
+
var n = min - input.length;
|
15 |
+
if (n === 1) {
|
16 |
+
return "Idatzi karaktere bat gehiago";
|
17 |
+
} else {
|
18 |
+
return "Idatzi " + n + " karaktere gehiago";
|
19 |
+
}
|
20 |
+
},
|
21 |
+
formatInputTooLong: function (input, max) {
|
22 |
+
var n = input.length - max;
|
23 |
+
if (n === 1) {
|
24 |
+
return "Idatzi karaktere bat gutxiago";
|
25 |
+
} else {
|
26 |
+
return "Idatzi " + n + " karaktere gutxiago";
|
27 |
+
}
|
28 |
+
},
|
29 |
+
formatSelectionTooBig: function (limit) {
|
30 |
+
if (limit === 1 ) {
|
31 |
+
return "Elementu bakarra hauta dezakezu";
|
32 |
+
} else {
|
33 |
+
return limit + " elementu hauta ditzakezu soilik";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatLoadMore: function (pageNumber) {
|
37 |
+
return "Emaitza gehiago kargatzen…";
|
38 |
+
},
|
39 |
+
formatSearching: function () {
|
40 |
+
return "Bilatzen…";
|
41 |
+
}
|
42 |
+
};
|
43 |
+
|
44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fa.js
CHANGED
@@ -1,21 +1,21 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Persian translation.
|
3 |
-
*
|
4 |
-
* Author: Ali Choopan <choopan@arsh.co>
|
5 |
-
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['fa'] = {
|
11 |
-
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
12 |
-
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
16 |
-
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
17 |
-
formatSearching: function () { return "در حال جستجو…"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
21 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Persian translation.
|
3 |
+
*
|
4 |
+
* Author: Ali Choopan <choopan@arsh.co>
|
5 |
+
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['fa'] = {
|
11 |
+
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
12 |
+
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
16 |
+
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
17 |
+
formatSearching: function () { return "در حال جستجو…"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
21 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fi.js
CHANGED
@@ -1,30 +1,30 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Finnish translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['fi'] = {
|
7 |
-
formatNoMatches: function () {
|
8 |
-
return "Ei tuloksia";
|
9 |
-
},
|
10 |
-
formatInputTooShort: function (input, min) {
|
11 |
-
var n = min - input.length;
|
12 |
-
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
13 |
-
},
|
14 |
-
formatInputTooLong: function (input, max) {
|
15 |
-
var n = input.length - max;
|
16 |
-
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
17 |
-
},
|
18 |
-
formatSelectionTooBig: function (limit) {
|
19 |
-
return "Voit valita ainoastaan " + limit + " kpl";
|
20 |
-
},
|
21 |
-
formatLoadMore: function (pageNumber) {
|
22 |
-
return "Ladataan lisää tuloksia…";
|
23 |
-
},
|
24 |
-
formatSearching: function () {
|
25 |
-
return "Etsitään…";
|
26 |
-
}
|
27 |
-
};
|
28 |
-
|
29 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
30 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Finnish translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['fi'] = {
|
7 |
+
formatNoMatches: function () {
|
8 |
+
return "Ei tuloksia";
|
9 |
+
},
|
10 |
+
formatInputTooShort: function (input, min) {
|
11 |
+
var n = min - input.length;
|
12 |
+
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
13 |
+
},
|
14 |
+
formatInputTooLong: function (input, max) {
|
15 |
+
var n = input.length - max;
|
16 |
+
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
17 |
+
},
|
18 |
+
formatSelectionTooBig: function (limit) {
|
19 |
+
return "Voit valita ainoastaan " + limit + " kpl";
|
20 |
+
},
|
21 |
+
formatLoadMore: function (pageNumber) {
|
22 |
+
return "Ladataan lisää tuloksia…";
|
23 |
+
},
|
24 |
+
formatSearching: function () {
|
25 |
+
return "Etsitään…";
|
26 |
+
}
|
27 |
+
};
|
28 |
+
|
29 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
30 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fr.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 French translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['fr'] = {
|
8 |
-
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
9 |
-
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
14 |
-
formatSearching: function () { return "Recherche en cours…"; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
18 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 French translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['fr'] = {
|
8 |
+
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
9 |
+
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
14 |
+
formatSearching: function () { return "Recherche en cours…"; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_gl.js
CHANGED
@@ -1,45 +1,45 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Galician translation
|
3 |
-
*
|
4 |
-
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['gl'] = {
|
10 |
-
formatNoMatches: function () {
|
11 |
-
return "Non se atoparon resultados";
|
12 |
-
},
|
13 |
-
formatInputTooShort: function (input, min) {
|
14 |
-
var n = min - input.length;
|
15 |
-
if (n === 1) {
|
16 |
-
return "Engada un carácter";
|
17 |
-
} else {
|
18 |
-
return "Engada " + n + " caracteres";
|
19 |
-
}
|
20 |
-
},
|
21 |
-
formatInputTooLong: function (input, max) {
|
22 |
-
var n = input.length - max;
|
23 |
-
if (n === 1) {
|
24 |
-
return "Elimine un carácter";
|
25 |
-
} else {
|
26 |
-
return "Elimine " + n + " caracteres";
|
27 |
-
}
|
28 |
-
},
|
29 |
-
formatSelectionTooBig: function (limit) {
|
30 |
-
if (limit === 1 ) {
|
31 |
-
return "Só pode seleccionar un elemento";
|
32 |
-
} else {
|
33 |
-
return "Só pode seleccionar " + limit + " elementos";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatLoadMore: function (pageNumber) {
|
37 |
-
return "Cargando máis resultados…";
|
38 |
-
},
|
39 |
-
formatSearching: function () {
|
40 |
-
return "Buscando…";
|
41 |
-
}
|
42 |
-
};
|
43 |
-
|
44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
45 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Galician translation
|
3 |
+
*
|
4 |
+
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['gl'] = {
|
10 |
+
formatNoMatches: function () {
|
11 |
+
return "Non se atoparon resultados";
|
12 |
+
},
|
13 |
+
formatInputTooShort: function (input, min) {
|
14 |
+
var n = min - input.length;
|
15 |
+
if (n === 1) {
|
16 |
+
return "Engada un carácter";
|
17 |
+
} else {
|
18 |
+
return "Engada " + n + " caracteres";
|
19 |
+
}
|
20 |
+
},
|
21 |
+
formatInputTooLong: function (input, max) {
|
22 |
+
var n = input.length - max;
|
23 |
+
if (n === 1) {
|
24 |
+
return "Elimine un carácter";
|
25 |
+
} else {
|
26 |
+
return "Elimine " + n + " caracteres";
|
27 |
+
}
|
28 |
+
},
|
29 |
+
formatSelectionTooBig: function (limit) {
|
30 |
+
if (limit === 1 ) {
|
31 |
+
return "Só pode seleccionar un elemento";
|
32 |
+
} else {
|
33 |
+
return "Só pode seleccionar " + limit + " elementos";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatLoadMore: function (pageNumber) {
|
37 |
+
return "Cargando máis resultados…";
|
38 |
+
},
|
39 |
+
formatSearching: function () {
|
40 |
+
return "Buscando…";
|
41 |
+
}
|
42 |
+
};
|
43 |
+
|
44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_he.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Hebrew translation.
|
3 |
-
*
|
4 |
-
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['he'] = {
|
10 |
-
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
15 |
-
formatSearching: function () { return "מחפש…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Hebrew translation.
|
3 |
+
*
|
4 |
+
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['he'] = {
|
10 |
+
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
15 |
+
formatSearching: function () { return "מחפש…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hr.js
CHANGED
@@ -1,24 +1,24 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Croatian translation.
|
3 |
-
*
|
4 |
-
* @author Edi Modrić <edi.modric@gmail.com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['hr'] = {
|
11 |
-
formatNoMatches: function () { return "Nema rezultata"; },
|
12 |
-
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
13 |
-
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
16 |
-
formatSearching: function () { return "Pretraga…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
20 |
-
|
21 |
-
function character (n) {
|
22 |
-
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
23 |
-
}
|
24 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Croatian translation.
|
3 |
+
*
|
4 |
+
* @author Edi Modrić <edi.modric@gmail.com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['hr'] = {
|
11 |
+
formatNoMatches: function () { return "Nema rezultata"; },
|
12 |
+
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
13 |
+
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
16 |
+
formatSearching: function () { return "Pretraga…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
20 |
+
|
21 |
+
function character (n) {
|
22 |
+
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
23 |
+
}
|
24 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hu.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Hungarian translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['hu'] = {
|
8 |
-
formatNoMatches: function () { return "Nincs találat."; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
13 |
-
formatSearching: function () { return "Keresés…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Hungarian translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['hu'] = {
|
8 |
+
formatNoMatches: function () { return "Nincs találat."; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
13 |
+
formatSearching: function () { return "Keresés…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_id.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Indonesian translation.
|
3 |
-
*
|
4 |
-
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['id'] = {
|
10 |
-
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
15 |
-
formatSearching: function () { return "Mencari…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Indonesian translation.
|
3 |
+
*
|
4 |
+
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['id'] = {
|
10 |
+
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
15 |
+
formatSearching: function () { return "Mencari…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_is.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Icelandic translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['is'] = {
|
8 |
-
formatNoMatches: function () { return "Ekkert fannst"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
13 |
-
formatSearching: function () { return "Leita…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Icelandic translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['is'] = {
|
8 |
+
formatNoMatches: function () { return "Ekkert fannst"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
13 |
+
formatSearching: function () { return "Leita…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_it.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Italian translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['it'] = {
|
8 |
-
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
13 |
-
formatSearching: function () { return "Ricerca…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
17 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Italian translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['it'] = {
|
8 |
+
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
13 |
+
formatSearching: function () { return "Ricerca…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
17 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ja.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Japanese translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['ja'] = {
|
8 |
-
formatNoMatches: function () { return "該当なし"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "読込中・・・"; },
|
13 |
-
formatSearching: function () { return "検索中・・・"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Japanese translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['ja'] = {
|
8 |
+
formatNoMatches: function () { return "該当なし"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "読込中・・・"; },
|
13 |
+
formatSearching: function () { return "検索中・・・"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ka.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Georgian (Kartuli) translation.
|
3 |
-
*
|
4 |
-
* Author: Dimitri Kurashvili dimakura@gmail.com
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ka'] = {
|
10 |
-
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
15 |
-
formatSearching: function () { return "ძებნა…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Georgian (Kartuli) translation.
|
3 |
+
*
|
4 |
+
* Author: Dimitri Kurashvili dimakura@gmail.com
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ka'] = {
|
10 |
+
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
15 |
+
formatSearching: function () { return "ძებნა…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ko.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Korean translation.
|
3 |
-
*
|
4 |
-
* @author Swen Mun <longfinfunnel@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ko'] = {
|
10 |
-
formatNoMatches: function () { return "결과 없음"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
15 |
-
formatSearching: function () { return "검색 중…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Korean translation.
|
3 |
+
*
|
4 |
+
* @author Swen Mun <longfinfunnel@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ko'] = {
|
10 |
+
formatNoMatches: function () { return "결과 없음"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
15 |
+
formatSearching: function () { return "검색 중…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lt.js
CHANGED
@@ -1,26 +1,26 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Lithuanian translation.
|
3 |
-
*
|
4 |
-
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['lt'] = {
|
11 |
-
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
12 |
-
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
13 |
-
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
14 |
-
formatSelectionTooBig: function (limit) {
|
15 |
-
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
16 |
-
},
|
17 |
-
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
18 |
-
formatSearching: function () { return "Ieškoma…"; }
|
19 |
-
};
|
20 |
-
|
21 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
22 |
-
|
23 |
-
function character (n) {
|
24 |
-
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
25 |
-
}
|
26 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Lithuanian translation.
|
3 |
+
*
|
4 |
+
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['lt'] = {
|
11 |
+
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
12 |
+
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
13 |
+
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
14 |
+
formatSelectionTooBig: function (limit) {
|
15 |
+
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
16 |
+
},
|
17 |
+
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
18 |
+
formatSearching: function () { return "Ieškoma…"; }
|
19 |
+
};
|
20 |
+
|
21 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
22 |
+
|
23 |
+
function character (n) {
|
24 |
+
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
25 |
+
}
|
26 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lv.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Latvian translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['lv'] = {
|
10 |
-
formatNoMatches: function () { return "Sakritību nav"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
15 |
-
formatSearching: function () { return "Meklēšana…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Latvian translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['lv'] = {
|
10 |
+
formatNoMatches: function () { return "Sakritību nav"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
15 |
+
formatSearching: function () { return "Meklēšana…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_mk.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Macedonian translation.
|
3 |
-
*
|
4 |
-
* Author: Marko Aleksic <psybaron@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['mk'] = {
|
10 |
-
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
15 |
-
formatSearching: function () { return "Пребарување…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
19 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Macedonian translation.
|
3 |
+
*
|
4 |
+
* Author: Marko Aleksic <psybaron@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['mk'] = {
|
10 |
+
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
15 |
+
formatSearching: function () { return "Пребарување…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
19 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ms.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Malay translation.
|
3 |
-
*
|
4 |
-
* Author: Kepoweran <kepoweran@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ms'] = {
|
10 |
-
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
15 |
-
formatSearching: function () { return "Mencari…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Malay translation.
|
3 |
+
*
|
4 |
+
* Author: Kepoweran <kepoweran@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ms'] = {
|
10 |
+
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
15 |
+
formatSearching: function () { return "Mencari…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_nb.js
CHANGED
@@ -1,22 +1,22 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Norwegian Bokmål translation.
|
3 |
-
*
|
4 |
-
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
5 |
-
* Author: Bjørn Johansen <post@bjornjohansen.no>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['nb'] = {
|
11 |
-
formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
|
12 |
-
formatNoMatches: function () { return "Ingen treff"; },
|
13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
16 |
-
formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
|
17 |
-
formatSearching: function () { return "Søker …"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
21 |
-
})(jQuery);
|
22 |
-
|
1 |
+
/**
|
2 |
+
* Select2 Norwegian Bokmål translation.
|
3 |
+
*
|
4 |
+
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
5 |
+
* Author: Bjørn Johansen <post@bjornjohansen.no>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['nb'] = {
|
11 |
+
formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
|
12 |
+
formatNoMatches: function () { return "Ingen treff"; },
|
13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
16 |
+
formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
|
17 |
+
formatSearching: function () { return "Søker …"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
21 |
+
})(jQuery);
|
22 |
+
|
assets/deps/select2-3.5.2/select2_locale_nl.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Dutch translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['nl'] = {
|
8 |
-
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
13 |
-
formatSearching: function () { return "Zoeken…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Dutch translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['nl'] = {
|
8 |
+
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
13 |
+
formatSearching: function () { return "Zoeken…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pl.js
CHANGED
@@ -1,54 +1,54 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Polish translation.
|
3 |
-
*
|
4 |
-
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
* @author Michał Połtyn <mike@poltyn.com>
|
7 |
-
* @author Damian Zajkowski <damian.zajkowski@gmail.com>
|
8 |
-
*/
|
9 |
-
(function($) {
|
10 |
-
"use strict";
|
11 |
-
|
12 |
-
$.fn.select2.locales['pl'] = {
|
13 |
-
formatNoMatches: function() {
|
14 |
-
return "Brak wyników";
|
15 |
-
},
|
16 |
-
formatInputTooShort: function(input, min) {
|
17 |
-
return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
|
18 |
-
},
|
19 |
-
formatInputTooLong: function(input, max) {
|
20 |
-
return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
|
21 |
-
},
|
22 |
-
formatSelectionTooBig: function(limit) {
|
23 |
-
return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
|
24 |
-
},
|
25 |
-
formatLoadMore: function(pageNumber) {
|
26 |
-
return "Ładowanie wyników…";
|
27 |
-
},
|
28 |
-
formatSearching: function() {
|
29 |
-
return "Szukanie…";
|
30 |
-
}
|
31 |
-
};
|
32 |
-
|
33 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
34 |
-
|
35 |
-
function character(n, word, pluralSuffix) {
|
36 |
-
//Liczba pojedyncza - brak suffiksu
|
37 |
-
//jeden znak
|
38 |
-
//jeden element
|
39 |
-
var suffix = '';
|
40 |
-
if (n > 1 && n < 5) {
|
41 |
-
//Liczaba mnoga ilość od 2 do 4 - własny suffiks
|
42 |
-
//Dwa znaki, trzy znaki, cztery znaki.
|
43 |
-
//Dwa elementy, trzy elementy, cztery elementy
|
44 |
-
suffix = pluralSuffix;
|
45 |
-
} else if (n == 0 || n >= 5) {
|
46 |
-
//Ilość 0 suffiks ów
|
47 |
-
//Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
|
48 |
-
//Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
|
49 |
-
//Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
|
50 |
-
suffix = 'ów';
|
51 |
-
}
|
52 |
-
return " " + n + " " + word + suffix;
|
53 |
-
}
|
54 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Polish translation.
|
3 |
+
*
|
4 |
+
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
* @author Michał Połtyn <mike@poltyn.com>
|
7 |
+
* @author Damian Zajkowski <damian.zajkowski@gmail.com>
|
8 |
+
*/
|
9 |
+
(function($) {
|
10 |
+
"use strict";
|
11 |
+
|
12 |
+
$.fn.select2.locales['pl'] = {
|
13 |
+
formatNoMatches: function() {
|
14 |
+
return "Brak wyników";
|
15 |
+
},
|
16 |
+
formatInputTooShort: function(input, min) {
|
17 |
+
return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
|
18 |
+
},
|
19 |
+
formatInputTooLong: function(input, max) {
|
20 |
+
return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
|
21 |
+
},
|
22 |
+
formatSelectionTooBig: function(limit) {
|
23 |
+
return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
|
24 |
+
},
|
25 |
+
formatLoadMore: function(pageNumber) {
|
26 |
+
return "Ładowanie wyników…";
|
27 |
+
},
|
28 |
+
formatSearching: function() {
|
29 |
+
return "Szukanie…";
|
30 |
+
}
|
31 |
+
};
|
32 |
+
|
33 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
34 |
+
|
35 |
+
function character(n, word, pluralSuffix) {
|
36 |
+
//Liczba pojedyncza - brak suffiksu
|
37 |
+
//jeden znak
|
38 |
+
//jeden element
|
39 |
+
var suffix = '';
|
40 |
+
if (n > 1 && n < 5) {
|
41 |
+
//Liczaba mnoga ilość od 2 do 4 - własny suffiks
|
42 |
+
//Dwa znaki, trzy znaki, cztery znaki.
|
43 |
+
//Dwa elementy, trzy elementy, cztery elementy
|
44 |
+
suffix = pluralSuffix;
|
45 |
+
} else if (n == 0 || n >= 5) {
|
46 |
+
//Ilość 0 suffiks ów
|
47 |
+
//Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
|
48 |
+
//Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
|
49 |
+
//Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
|
50 |
+
suffix = 'ów';
|
51 |
+
}
|
52 |
+
return " " + n + " " + word + suffix;
|
53 |
+
}
|
54 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-BR.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Brazilian Portuguese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['pt-BR'] = {
|
8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
-
formatAjaxError: function () { return "Erro na busca"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
14 |
-
formatSearching: function () { return "Buscando…"; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
18 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Brazilian Portuguese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['pt-BR'] = {
|
8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
+
formatAjaxError: function () { return "Erro na busca"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
14 |
+
formatSearching: function () { return "Buscando…"; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-PT.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Portuguese (Portugal) translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['pt-PT'] = {
|
8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
13 |
-
formatSearching: function () { return "A pesquisar…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Portuguese (Portugal) translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['pt-PT'] = {
|
8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
13 |
+
formatSearching: function () { return "A pesquisar…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ro.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Romanian translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['ro'] = {
|
8 |
-
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
13 |
-
formatSearching: function () { return "Căutare…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Romanian translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['ro'] = {
|
8 |
+
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
13 |
+
formatSearching: function () { return "Căutare…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_rs.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Serbian translation.
|
3 |
-
*
|
4 |
-
* @author Limon Monte <limon.monte@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['rs'] = {
|
10 |
-
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
15 |
-
formatSearching: function () { return "Pretraga…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Serbian translation.
|
3 |
+
*
|
4 |
+
* @author Limon Monte <limon.monte@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['rs'] = {
|
10 |
+
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
15 |
+
formatSearching: function () { return "Pretraga…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ru.js
CHANGED
@@ -1,23 +1,23 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Russian translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ru'] = {
|
10 |
-
formatNoMatches: function () { return "Совпадений не найдено"; },
|
11 |
-
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
12 |
-
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
15 |
-
formatSearching: function () { return "Поиск…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
19 |
-
|
20 |
-
function character (n) {
|
21 |
-
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
22 |
-
}
|
23 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Russian translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ru'] = {
|
10 |
+
formatNoMatches: function () { return "Совпадений не найдено"; },
|
11 |
+
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
12 |
+
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
15 |
+
formatSearching: function () { return "Поиск…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
19 |
+
|
20 |
+
function character (n) {
|
21 |
+
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
22 |
+
}
|
23 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sk.js
CHANGED
@@ -1,50 +1,50 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Slovak translation.
|
3 |
-
*
|
4 |
-
* Author: David Vallner <david@vallner.net>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
// use text for the numbers 2 through 4
|
9 |
-
var smallNumbers = {
|
10 |
-
2: function(masc) { return (masc ? "dva" : "dve"); },
|
11 |
-
3: function() { return "tri"; },
|
12 |
-
4: function() { return "štyri"; }
|
13 |
-
};
|
14 |
-
$.fn.select2.locales['sk'] = {
|
15 |
-
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
16 |
-
formatInputTooShort: function (input, min) {
|
17 |
-
var n = min - input.length;
|
18 |
-
if (n == 1) {
|
19 |
-
return "Prosím, zadajte ešte jeden znak";
|
20 |
-
} else if (n <= 4) {
|
21 |
-
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
22 |
-
} else {
|
23 |
-
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
24 |
-
}
|
25 |
-
},
|
26 |
-
formatInputTooLong: function (input, max) {
|
27 |
-
var n = input.length - max;
|
28 |
-
if (n == 1) {
|
29 |
-
return "Prosím, zadajte o jeden znak menej";
|
30 |
-
} else if (n >= 2 && n <= 4) {
|
31 |
-
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
32 |
-
} else {
|
33 |
-
return "Prosím, zadajte o "+n+" znakov menej";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatSelectionTooBig: function (limit) {
|
37 |
-
if (limit == 1) {
|
38 |
-
return "Môžete zvoliť len jednu položku";
|
39 |
-
} else if (limit >= 2 && limit <= 4) {
|
40 |
-
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
41 |
-
} else {
|
42 |
-
return "Môžete zvoliť najviac "+limit+" položiek";
|
43 |
-
}
|
44 |
-
},
|
45 |
-
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
46 |
-
formatSearching: function () { return "Vyhľadávanie…"; }
|
47 |
-
};
|
48 |
-
|
49 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
50 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Slovak translation.
|
3 |
+
*
|
4 |
+
* Author: David Vallner <david@vallner.net>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
// use text for the numbers 2 through 4
|
9 |
+
var smallNumbers = {
|
10 |
+
2: function(masc) { return (masc ? "dva" : "dve"); },
|
11 |
+
3: function() { return "tri"; },
|
12 |
+
4: function() { return "štyri"; }
|
13 |
+
};
|
14 |
+
$.fn.select2.locales['sk'] = {
|
15 |
+
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
16 |
+
formatInputTooShort: function (input, min) {
|
17 |
+
var n = min - input.length;
|
18 |
+
if (n == 1) {
|
19 |
+
return "Prosím, zadajte ešte jeden znak";
|
20 |
+
} else if (n <= 4) {
|
21 |
+
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
22 |
+
} else {
|
23 |
+
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
24 |
+
}
|
25 |
+
},
|
26 |
+
formatInputTooLong: function (input, max) {
|
27 |
+
var n = input.length - max;
|
28 |
+
if (n == 1) {
|
29 |
+
return "Prosím, zadajte o jeden znak menej";
|
30 |
+
} else if (n >= 2 && n <= 4) {
|
31 |
+
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
32 |
+
} else {
|
33 |
+
return "Prosím, zadajte o "+n+" znakov menej";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatSelectionTooBig: function (limit) {
|
37 |
+
if (limit == 1) {
|
38 |
+
return "Môžete zvoliť len jednu položku";
|
39 |
+
} else if (limit >= 2 && limit <= 4) {
|
40 |
+
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
41 |
+
} else {
|
42 |
+
return "Môžete zvoliť najviac "+limit+" položiek";
|
43 |
+
}
|
44 |
+
},
|
45 |
+
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
46 |
+
formatSearching: function () { return "Vyhľadávanie…"; }
|
47 |
+
};
|
48 |
+
|
49 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
50 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sv.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Swedish translation.
|
3 |
-
*
|
4 |
-
* Author: Jens Rantil <jens.rantil@telavox.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['sv'] = {
|
10 |
-
formatNoMatches: function () { return "Inga träffar"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
15 |
-
formatSearching: function () { return "Söker…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Swedish translation.
|
3 |
+
*
|
4 |
+
* Author: Jens Rantil <jens.rantil@telavox.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['sv'] = {
|
10 |
+
formatNoMatches: function () { return "Inga träffar"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
15 |
+
formatSearching: function () { return "Söker…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_th.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Thai translation.
|
3 |
-
*
|
4 |
-
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['th'] = {
|
10 |
-
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
15 |
-
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Thai translation.
|
3 |
+
*
|
4 |
+
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['th'] = {
|
10 |
+
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
15 |
+
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_tr.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Turkish translation.
|
3 |
-
*
|
4 |
-
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['tr'] = {
|
10 |
-
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
15 |
-
formatSearching: function () { return "Aranıyor…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Turkish translation.
|
3 |
+
*
|
4 |
+
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['tr'] = {
|
10 |
+
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
15 |
+
formatSearching: function () { return "Aranıyor…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ug-CN.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Uyghur translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['ug-CN'] = {
|
7 |
-
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
12 |
-
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Uyghur translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['ug-CN'] = {
|
7 |
+
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
12 |
+
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_uk.js
CHANGED
@@ -1,25 +1,25 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Ukrainian translation.
|
3 |
-
*
|
4 |
-
* @author bigmihail <bigmihail@bigmir.net>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['uk'] = {
|
11 |
-
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
12 |
-
formatNoMatches: function () { return "Нічого не знайдено"; },
|
13 |
-
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
14 |
-
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
16 |
-
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
17 |
-
formatSearching: function () { return "Пошук…"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
21 |
-
|
22 |
-
function character (n, word) {
|
23 |
-
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
24 |
-
}
|
25 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Ukrainian translation.
|
3 |
+
*
|
4 |
+
* @author bigmihail <bigmihail@bigmir.net>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['uk'] = {
|
11 |
+
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
12 |
+
formatNoMatches: function () { return "Нічого не знайдено"; },
|
13 |
+
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
14 |
+
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
16 |
+
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
17 |
+
formatSearching: function () { return "Пошук…"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
21 |
+
|
22 |
+
function character (n, word) {
|
23 |
+
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
24 |
+
}
|
25 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_vi.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Vietnamese translation.
|
3 |
-
*
|
4 |
-
* Author: Long Nguyen <olragon@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['vi'] = {
|
10 |
-
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
15 |
-
formatSearching: function () { return "Đang tìm…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
19 |
-
})(jQuery);
|
20 |
-
|
1 |
+
/**
|
2 |
+
* Select2 Vietnamese translation.
|
3 |
+
*
|
4 |
+
* Author: Long Nguyen <olragon@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['vi'] = {
|
10 |
+
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
15 |
+
formatSearching: function () { return "Đang tìm…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
19 |
+
})(jQuery);
|
20 |
+
|
assets/deps/select2-3.5.2/select2_locale_zh-CN.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Chinese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['zh-CN'] = {
|
7 |
-
formatNoMatches: function () { return "没有找到匹配项"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
12 |
-
formatSearching: function () { return "搜索中…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Chinese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['zh-CN'] = {
|
7 |
+
formatNoMatches: function () { return "没有找到匹配项"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
12 |
+
formatSearching: function () { return "搜索中…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_zh-TW.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Traditional Chinese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['zh-TW'] = {
|
7 |
-
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
12 |
-
formatSearching: function () { return "搜尋中…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Traditional Chinese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['zh-TW'] = {
|
7 |
+
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
12 |
+
formatSearching: function () { return "搜尋中…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
16 |
+
})(jQuery);
|
assets/deps/starrr/starrr.css
CHANGED
@@ -1,7 +1,7 @@
|
|
1 |
-
.starrr {
|
2 |
-
display: inline-block; }
|
3 |
-
.starrr i {
|
4 |
-
font-size: 16px;
|
5 |
-
padding: 0 1px;
|
6 |
-
cursor: pointer;
|
7 |
-
color: #ffd119; }
|
1 |
+
.starrr {
|
2 |
+
display: inline-block; }
|
3 |
+
.starrr i {
|
4 |
+
font-size: 16px;
|
5 |
+
padding: 0 1px;
|
6 |
+
cursor: pointer;
|
7 |
+
color: #ffd119; }
|
assets/deps/starrr/starrr.js
CHANGED
@@ -1,123 +1,123 @@
|
|
1 |
-
var __slice = [].slice;
|
2 |
-
|
3 |
-
(function(jQuery, window) {
|
4 |
-
var Starrr;
|
5 |
-
window.Starrr = Starrr = (function() {
|
6 |
-
Starrr.prototype.defaults = {
|
7 |
-
rating: void 0,
|
8 |
-
numStars: 5,
|
9 |
-
emptyStarClass: 'fa fa-star-o',
|
10 |
-
fullStarClass: 'fa fa-star',
|
11 |
-
change: function(e, value) {}
|
12 |
-
};
|
13 |
-
|
14 |
-
function Starrr($el, options) {
|
15 |
-
var i, _, _ref;
|
16 |
-
this.options = jQuery.extend({}, this.defaults, options);
|
17 |
-
this.$el = $el;
|
18 |
-
_ref = this.defaults;
|
19 |
-
for (i in _ref) {
|
20 |
-
_ = _ref[i];
|
21 |
-
if (this.$el.data(i.toLowerCase()) != null) {
|
22 |
-
this.options[i] = this.$el.data(i.toLowerCase());
|
23 |
-
}
|
24 |
-
}
|
25 |
-
if (this.$el.data('connected-input')) {
|
26 |
-
this.$connectedInput = jQuery("[name=\"" + (this.$el.data('connected-input')) + "\"]");
|
27 |
-
this.options.rating = this.$connectedInput.val() ? parseInt(this.$connectedInput.val(), 10) : void 0;
|
28 |
-
}
|
29 |
-
this.createStars();
|
30 |
-
this.syncRating();
|
31 |
-
if (this.$connectedInput && this.$connectedInput.is(':disabled')) {
|
32 |
-
return;
|
33 |
-
}
|
34 |
-
this.$el.on('mouseover.starrr', 'i', (function(_this) {
|
35 |
-
return function(e) {
|
36 |
-
return _this.syncRating(_this.getStars().index(e.currentTarget) + 1);
|
37 |
-
};
|
38 |
-
})(this));
|
39 |
-
this.$el.on('mouseout.starrr', (function(_this) {
|
40 |
-
return function() {
|
41 |
-
return _this.syncRating();
|
42 |
-
};
|
43 |
-
})(this));
|
44 |
-
this.$el.on('click.starrr', 'i', (function(_this) {
|
45 |
-
return function(e) {
|
46 |
-
return _this.setRating(_this.getStars().index(e.currentTarget) + 1);
|
47 |
-
};
|
48 |
-
})(this));
|
49 |
-
this.$el.on('starrr:change', this.options.change);
|
50 |
-
if (this.$connectedInput != null) {
|
51 |
-
this.$el.on('starrr:change', (function(_this) {
|
52 |
-
return function(e, value) {
|
53 |
-
_this.$connectedInput.val(value);
|
54 |
-
return _this.$connectedInput.trigger('focusout');
|
55 |
-
};
|
56 |
-
})(this));
|
57 |
-
}
|
58 |
-
}
|
59 |
-
|
60 |
-
Starrr.prototype.getStars = function() {
|
61 |
-
return this.$el.find('i');
|
62 |
-
};
|
63 |
-
|
64 |
-
Starrr.prototype.createStars = function() {
|
65 |
-
var _i, _ref, _results;
|
66 |
-
_results = [];
|
67 |
-
for (_i = 1, _ref = this.options.numStars; 1 <= _ref ? _i <= _ref : _i >= _ref; 1 <= _ref ? _i++ : _i--) {
|
68 |
-
_results.push(this.$el.append("<i class='" + this.options.emptyStarClass + "'></i>"));
|
69 |
-
}
|
70 |
-
return _results;
|
71 |
-
};
|
72 |
-
|
73 |
-
Starrr.prototype.setRating = function(rating) {
|
74 |
-
if (this.options.rating === rating) {
|
75 |
-
rating = void 0;
|
76 |
-
}
|
77 |
-
this.options.rating = rating;
|
78 |
-
this.syncRating();
|
79 |
-
return this.$el.trigger('starrr:change', rating);
|
80 |
-
};
|
81 |
-
|
82 |
-
Starrr.prototype.getRating = function() {
|
83 |
-
return this.options.rating;
|
84 |
-
};
|
85 |
-
|
86 |
-
Starrr.prototype.syncRating = function(rating) {
|
87 |
-
var i, _i, _j, _ref, _ref1;
|
88 |
-
rating || (rating = this.options.rating);
|
89 |
-
if (rating) {
|
90 |
-
for (i = _i = 0, _ref = rating - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
|
91 |
-
this.getStars().eq(i).removeClass(this.options.emptyStarClass).addClass(this.options.fullStarClass);
|
92 |
-
}
|
93 |
-
}
|
94 |
-
if (rating && rating < this.options.numStars) {
|
95 |
-
for (i = _j = rating, _ref1 = this.options.numStars - 1; rating <= _ref1 ? _j <= _ref1 : _j >= _ref1; i = rating <= _ref1 ? ++_j : --_j) {
|
96 |
-
this.getStars().eq(i).removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
97 |
-
}
|
98 |
-
}
|
99 |
-
if (!rating) {
|
100 |
-
return this.getStars().removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
101 |
-
}
|
102 |
-
};
|
103 |
-
|
104 |
-
return Starrr;
|
105 |
-
|
106 |
-
})();
|
107 |
-
return jQuery.fn.extend({
|
108 |
-
starrr: function() {
|
109 |
-
var args, option;
|
110 |
-
option = arguments[0], args = 2 <= arguments.length ? __slice.call(arguments, 1) : [];
|
111 |
-
return this.each(function() {
|
112 |
-
var data;
|
113 |
-
data = jQuery(this).data('starrr');
|
114 |
-
if (!data) {
|
115 |
-
jQuery(this).data('starrr', (data = new Starrr(jQuery(this), option)));
|
116 |
-
}
|
117 |
-
if (typeof option === 'string') {
|
118 |
-
return data[option].apply(data, args);
|
119 |
-
}
|
120 |
-
});
|
121 |
-
}
|
122 |
-
});
|
123 |
-
})(window.jQuery, window);
|
1 |
+
var __slice = [].slice;
|
2 |
+
|
3 |
+
(function(jQuery, window) {
|
4 |
+
var Starrr;
|
5 |
+
window.Starrr = Starrr = (function() {
|
6 |
+
Starrr.prototype.defaults = {
|
7 |
+
rating: void 0,
|
8 |
+
numStars: 5,
|
9 |
+
emptyStarClass: 'fa fa-star-o',
|
10 |
+
fullStarClass: 'fa fa-star',
|
11 |
+
change: function(e, value) {}
|
12 |
+
};
|
13 |
+
|
14 |
+
function Starrr($el, options) {
|
15 |
+
var i, _, _ref;
|
16 |
+
this.options = jQuery.extend({}, this.defaults, options);
|
17 |
+
this.$el = $el;
|
18 |
+
_ref = this.defaults;
|
19 |
+
for (i in _ref) {
|
20 |
+
_ = _ref[i];
|
21 |
+
if (this.$el.data(i.toLowerCase()) != null) {
|
22 |
+
this.options[i] = this.$el.data(i.toLowerCase());
|
23 |
+
}
|
24 |
+
}
|
25 |
+
if (this.$el.data('connected-input')) {
|
26 |
+
this.$connectedInput = jQuery("[name=\"" + (this.$el.data('connected-input')) + "\"]");
|
27 |
+
this.options.rating = this.$connectedInput.val() ? parseInt(this.$connectedInput.val(), 10) : void 0;
|
28 |
+
}
|
29 |
+
this.createStars();
|
30 |
+
this.syncRating();
|
31 |
+
if (this.$connectedInput && this.$connectedInput.is(':disabled')) {
|
32 |
+
return;
|
33 |
+
}
|
34 |
+
this.$el.on('mouseover.starrr', 'i', (function(_this) {
|
35 |
+
return function(e) {
|
36 |
+
return _this.syncRating(_this.getStars().index(e.currentTarget) + 1);
|
37 |
+
};
|
38 |
+
})(this));
|
39 |
+
this.$el.on('mouseout.starrr', (function(_this) {
|
40 |
+
return function() {
|
41 |
+
return _this.syncRating();
|
42 |
+
};
|
43 |
+
})(this));
|
44 |
+
this.$el.on('click.starrr', 'i', (function(_this) {
|
45 |
+
return function(e) {
|
46 |
+
return _this.setRating(_this.getStars().index(e.currentTarget) + 1);
|
47 |
+
};
|
48 |
+
})(this));
|
49 |
+
this.$el.on('starrr:change', this.options.change);
|
50 |
+
if (this.$connectedInput != null) {
|
51 |
+
this.$el.on('starrr:change', (function(_this) {
|
52 |
+
return function(e, value) {
|
53 |
+
_this.$connectedInput.val(value);
|
54 |
+
return _this.$connectedInput.trigger('focusout');
|
55 |
+
};
|
56 |
+
})(this));
|
57 |
+
}
|
58 |
+
}
|
59 |
+
|
60 |
+
Starrr.prototype.getStars = function() {
|
61 |
+
return this.$el.find('i');
|
62 |
+
};
|
63 |
+
|
64 |
+
Starrr.prototype.createStars = function() {
|
65 |
+
var _i, _ref, _results;
|
66 |
+
_results = [];
|
67 |
+
for (_i = 1, _ref = this.options.numStars; 1 <= _ref ? _i <= _ref : _i >= _ref; 1 <= _ref ? _i++ : _i--) {
|
68 |
+
_results.push(this.$el.append("<i class='" + this.options.emptyStarClass + "'></i>"));
|
69 |
+
}
|
70 |
+
return _results;
|
71 |
+
};
|
72 |
+
|
73 |
+
Starrr.prototype.setRating = function(rating) {
|
74 |
+
if (this.options.rating === rating) {
|
75 |
+
rating = void 0;
|
76 |
+
}
|
77 |
+
this.options.rating = rating;
|
78 |
+
this.syncRating();
|
79 |
+
return this.$el.trigger('starrr:change', rating);
|
80 |
+
};
|
81 |
+
|
82 |
+
Starrr.prototype.getRating = function() {
|
83 |
+
return this.options.rating;
|
84 |
+
};
|
85 |
+
|
86 |
+
Starrr.prototype.syncRating = function(rating) {
|
87 |
+
var i, _i, _j, _ref, _ref1;
|
88 |
+
rating || (rating = this.options.rating);
|
89 |
+
if (rating) {
|
90 |
+
for (i = _i = 0, _ref = rating - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
|
91 |
+
this.getStars().eq(i).removeClass(this.options.emptyStarClass).addClass(this.options.fullStarClass);
|
92 |
+
}
|
93 |
+
}
|
94 |
+
if (rating && rating < this.options.numStars) {
|
95 |
+
for (i = _j = rating, _ref1 = this.options.numStars - 1; rating <= _ref1 ? _j <= _ref1 : _j >= _ref1; i = rating <= _ref1 ? ++_j : --_j) {
|
96 |
+
this.getStars().eq(i).removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
97 |
+
}
|
98 |
+
}
|
99 |
+
if (!rating) {
|
100 |
+
return this.getStars().removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
101 |
+
}
|
102 |
+
};
|
103 |
+
|
104 |
+
return Starrr;
|
105 |
+
|
106 |
+
})();
|
107 |
+
return jQuery.fn.extend({
|
108 |
+
starrr: function() {
|
109 |
+
var args, option;
|
110 |
+
option = arguments[0], args = 2 <= arguments.length ? __slice.call(arguments, 1) : [];
|
111 |
+
return this.each(function() {
|
112 |
+
var data;
|
113 |
+
data = jQuery(this).data('starrr');
|
114 |
+
if (!data) {
|
115 |
+
jQuery(this).data('starrr', (data = new Starrr(jQuery(this), option)));
|
116 |
+
}
|
117 |
+
if (typeof option === 'string') {
|
118 |
+
return data[option].apply(data, args);
|
119 |
+
}
|
120 |
+
});
|
121 |
+
}
|
122 |
+
});
|
123 |
+
})(window.jQuery, window);
|
assets/js/library.js
CHANGED
@@ -1,446 +1,446 @@
|
|
1 |
-
//IntellyWP
|
2 |
-
var TCMP={};
|
3 |
-
TCMP.startsWith=function(str, prefix) {
|
4 |
-
return str.indexOf(prefix) === 0;
|
5 |
-
}
|
6 |
-
TCMP.endsWith=function(str, suffix) {
|
7 |
-
var result=false;
|
8 |
-
var pos=str.lastIndexOf(suffix);
|
9 |
-
if(pos===(str.length-suffix.length+1)) {
|
10 |
-
result=true;
|
11 |
-
}
|
12 |
-
return result;
|
13 |
-
}
|
14 |
-
TCMP.stripos=function(haystack, needle, offset) {
|
15 |
-
var haystack=(haystack + '').toLowerCase();
|
16 |
-
var needle=(needle + '').toLowerCase();
|
17 |
-
var index=0;
|
18 |
-
|
19 |
-
if ((index=haystack.indexOf(needle, offset))!==-1) {
|
20 |
-
return index;
|
21 |
-
}
|
22 |
-
return false;
|
23 |
-
};
|
24 |
-
TCMP.strpos=function(haystack, needle, offset) {
|
25 |
-
var haystack=(haystack + '');
|
26 |
-
var needle=(needle + '');
|
27 |
-
var index=0;
|
28 |
-
|
29 |
-
if ((index=haystack.indexOf(needle, offset))!==-1) {
|
30 |
-
return index;
|
31 |
-
}
|
32 |
-
return false;
|
33 |
-
};
|
34 |
-
TCMP.val=function(name, defaults) {
|
35 |
-
defaults=(defaults || '');
|
36 |
-
|
37 |
-
var result=[];
|
38 |
-
var $self=TCMP.jQuery(name);
|
39 |
-
if($self!==false) {
|
40 |
-
$self.each(function(i,v) {
|
41 |
-
var $this=jQuery(this);
|
42 |
-
var type=TCMP.attr($this, 'type', '');
|
43 |
-
if(type=='checkbox') {
|
44 |
-
v=TCMP.check($this);
|
45 |
-
} else if(type=='radio') {
|
46 |
-
v=TCMP.radio($this);
|
47 |
-
} else {
|
48 |
-
v=$this.val();
|
49 |
-
}
|
50 |
-
result.push(v);
|
51 |
-
});
|
52 |
-
}
|
53 |
-
if(result.length==0 || (result.length==1 && result[0]===null)) {
|
54 |
-
result=defaults;
|
55 |
-
} else {
|
56 |
-
result=result.join('|');
|
57 |
-
}
|
58 |
-
return result;
|
59 |
-
};
|
60 |
-
TCMP.check=function(name) {
|
61 |
-
var $self=TCMP.jQuery(name);
|
62 |
-
return ($self.is(':checked') ? 1 : 0);
|
63 |
-
};
|
64 |
-
TCMP.radio=function(name) {
|
65 |
-
var $self=TCMP.jQuery(name);
|
66 |
-
return ($self.filter(':checked').val());
|
67 |
-
};
|
68 |
-
TCMP.visible=function(name, visible) {
|
69 |
-
if(visible) {
|
70 |
-
jQuery(name).hide();
|
71 |
-
} else {
|
72 |
-
jQuery(name).show();
|
73 |
-
}
|
74 |
-
};
|
75 |
-
TCMP.aval=function(name) {
|
76 |
-
var data={};
|
77 |
-
jQuery("[name^='"+name+"']").each(function(i,v) {
|
78 |
-
var $this=jQuery(this);
|
79 |
-
var k=$this.attr('name');
|
80 |
-
var v=$this.val();
|
81 |
-
if($this.attr('type')=='checkbox') {
|
82 |
-
v=TCMP.check(k);
|
83 |
-
} else if($this.attr('type')=='radio') {
|
84 |
-
v=TCMP.radio(k);
|
85 |
-
}
|
86 |
-
data[k]=v;
|
87 |
-
});
|
88 |
-
//console.log(data);
|
89 |
-
return data;
|
90 |
-
};
|
91 |
-
TCMP.formatColorOption=function(option) {
|
92 |
-
if (!option.id) {
|
93 |
-
return option.text;
|
94 |
-
}
|
95 |
-
|
96 |
-
var color=jQuery(option.element).css('background-color');
|
97 |
-
var font=jQuery(option.element).css('color');
|
98 |
-
var $option=jQuery('<div></div>')
|
99 |
-
.html(option.text)
|
100 |
-
.css('background-color', color)
|
101 |
-
.css('color', font)
|
102 |
-
.addClass('lbColorSelectItem');
|
103 |
-
return $option;
|
104 |
-
};
|
105 |
-
TCMP.hideShow=function(name) {
|
106 |
-
var $source=TCMP.jQuery(name);
|
107 |
-
if ($source.attr('ipfm-hideIfTrue') && $source.attr('ipfm-hideShow')) {
|
108 |
-
var $destination=jQuery('[name=' + $source.attr('ipfm-hideShow') + ']');
|
109 |
-
if ($destination.length == 0) {
|
110 |
-
$destination=jQuery('#' + $source.attr('ipfm-hideShow'));
|
111 |
-
}
|
112 |
-
if ($destination.length > 0) {
|
113 |
-
var isChecked=$source.is(":checked");
|
114 |
-
var hideIfTrue=($source.attr('ipfm-hideIfTrue').toLowerCase() == 'true');
|
115 |
-
|
116 |
-
if (isChecked) {
|
117 |
-
if (hideIfTrue) {
|
118 |
-
$destination.hide();
|
119 |
-
} else {
|
120 |
-
$destination.show();
|
121 |
-
}
|
122 |
-
} else {
|
123 |
-
if (hideIfTrue) {
|
124 |
-
$destination.show();
|
125 |
-
} else {
|
126 |
-
$destination.hide();
|
127 |
-
}
|
128 |
-
}
|
129 |
-
}
|
130 |
-
}
|
131 |
-
};
|
132 |
-
TCMP.jQuery=function(name) {
|
133 |
-
var $self=name;
|
134 |
-
if(jQuery.type(name)=='string' || jQuery.type(name)=='array') {
|
135 |
-
$self=false;
|
136 |
-
var array=[];
|
137 |
-
var names=[];
|
138 |
-
switch (jQuery.type(name)) {
|
139 |
-
case 'string':
|
140 |
-
names=name.split('|');
|
141 |
-
break;
|
142 |
-
case 'array':
|
143 |
-
names=name;
|
144 |
-
break;
|
145 |
-
}
|
146 |
-
jQuery.each(names, function(i,v) {
|
147 |
-
var selector='[name='+v+']';
|
148 |
-
if(jQuery(selector).length>0) {
|
149 |
-
array.push(selector);
|
150 |
-
} else {
|
151 |
-
selector='#'+v;
|
152 |
-
if(jQuery(selector).length>0) {
|
153 |
-
array.push(selector);
|
154 |
-
}
|
155 |
-
}
|
156 |
-
});
|
157 |
-
if(array.length>0) {
|
158 |
-
array=array.join(',');
|
159 |
-
$self=jQuery(array);
|
160 |
-
}
|
161 |
-
}
|
162 |
-
return $self;
|
163 |
-
}
|
164 |
-
TCMP.attr=function($self, name, v) {
|
165 |
-
$self=TCMP.jQuery($self);
|
166 |
-
var result=v;
|
167 |
-
if($self.length>0) {
|
168 |
-
result=$self.attr(name);
|
169 |
-
}
|
170 |
-
if ((typeof result === typeof undefined) || (result===false)) {
|
171 |
-
result=v;
|
172 |
-
}
|
173 |
-
return result;
|
174 |
-
};
|
175 |
-
TCMP.select2=function($self, options) {
|
176 |
-
TCMP.destroy($self);
|
177 |
-
|
178 |
-
var $self=TCMP.jQuery($self);
|
179 |
-
var name=$self.attr('name');
|
180 |
-
var multiple=TCMP.attr($self, 'multiple', false);
|
181 |
-
if (multiple!==false) {
|
182 |
-
multiple=true;
|
183 |
-
}
|
184 |
-
|
185 |
-
hasSelection=false;
|
186 |
-
if($self.html().indexOf('selected')>0) {
|
187 |
-
//jQuery fails if you dont have any selected item return the first
|
188 |
-
$self.find("option").each(function() {
|
189 |
-
var $option=jQuery(this);
|
190 |
-
if(TCMP.attr($option, 'selected', '')!='') {
|
191 |
-
hasSelection=true;
|
192 |
-
}
|
193 |
-
});
|
194 |
-
}
|
195 |
-
|
196 |
-
var help=TCMP.attr($self, 'ipfm-help', '');
|
197 |
-
var ajax=TCMP.attr($self, 'ipfm-ajax', false);
|
198 |
-
var parent=TCMP.attr($self, 'ipfm-master', '');
|
199 |
-
var settings={};
|
200 |
-
if(ajax===false || ajax==='') {
|
201 |
-
settings={
|
202 |
-
placeholder: help
|
203 |
-
, width: '100%'
|
204 |
-
, allowClear: true
|
205 |
-
}
|
206 |
-
} else {
|
207 |
-
settings={
|
208 |
-
placeholder: help
|
209 |
-
, width: '100%'
|
210 |
-
, allowClear: true
|
211 |
-
, ajax: {
|
212 |
-
type: 'POST'
|
213 |
-
, dataType: 'json'
|
214 |
-
, delay: 250
|
215 |
-
, data: function (params) {
|
216 |
-
var result={
|
217 |
-
q: params.term
|
218 |
-
, page: params.page
|
219 |
-
, action: 'lb_ajax_ll'
|
220 |
-
, lb_action: ajax
|
221 |
-
};
|
222 |
-
if(parent!='') {
|
223 |
-
result['parentId']=TCMP.val(parent);
|
224 |
-
}
|
225 |
-
return result;
|
226 |
-
}
|
227 |
-
, processResults: function (data, page) {
|
228 |
-
return {results: data};
|
229 |
-
}
|
230 |
-
, cache: true
|
231 |
-
}
|
232 |
-
, minimumInputLength: 2
|
233 |
-
}
|
234 |
-
}
|
235 |
-
settings=jQuery.extend(settings, options);
|
236 |
-
$self.select2(settings);
|
237 |
-
$self.hide();
|
238 |
-
if(!hasSelection) {
|
239 |
-
$self.val(null).trigger('change');
|
240 |
-
}
|
241 |
-
};
|
242 |
-
TCMP.destroy=function($self) {
|
243 |
-
var name=$self.attr('name');
|
244 |
-
try {
|
245 |
-
if($self.data('select2') != null) {
|
246 |
-
//TCMP.log('[%s] DESTROY SELECT2', name);
|
247 |
-
$self.select2("destroy");
|
248 |
-
$self.html("<option><option>");
|
249 |
-
$self.val('').trigger('change');
|
250 |
-
}
|
251 |
-
} catch(ex) {}
|
252 |
-
};
|
253 |
-
TCMP.inArray=function(v, array) {
|
254 |
-
var result=false;
|
255 |
-
if(!array || !jQuery.isArray(array) || array.length==0) {
|
256 |
-
if(jQuery.type(array)=='string' && v==array) {
|
257 |
-
result=true;
|
258 |
-
}
|
259 |
-
} else {
|
260 |
-
for(i=0; i<array.length; i++) {
|
261 |
-
c=array[i];
|
262 |
-
if(v==c) {
|
263 |
-
result=true;
|
264 |
-
break;
|
265 |
-
}
|
266 |
-
}
|
267 |
-
}
|
268 |
-
return result;
|
269 |
-
}
|
270 |
-
TCMP.changeShowOptions=function($self) {
|
271 |
-
var selection=$self.val();
|
272 |
-
var name=TCMP.attr($self, 'name', '');
|
273 |
-
var $options=$self.children('option');
|
274 |
-
//console.log('NAME=[%s] OPTIONS=N.%s', name, $options.length);
|
275 |
-
var toShow={};
|
276 |
-
var toHide={};
|
277 |
-
$options.each(function(i,v) {
|
278 |
-
$option=jQuery(v);
|
279 |
-
var text=TCMP.attr($option, 'show', '');
|
280 |
-
if(text!='') {
|
281 |
-
text=text.split('|');
|
282 |
-
var j=0;
|
283 |
-
for(j=0; j<text.length; j++) {
|
284 |
-
var show=text[j];
|
285 |
-
var $show=jQuery('#'+show);
|
286 |
-
if($show.length>0) {
|
287 |
-
var value=TCMP.attr($option, 'value', '');
|
288 |
-
if(TCMP.inArray(value, selection)) {
|
289 |
-
toShow[show]=show;
|
290 |
-
} else {
|
291 |
-
toHide[show]=show;
|
292 |
-
}
|
293 |
-
} else {
|
294 |
-
console.log('changeShowOptions ID=[%s] NOT FOUND', show);
|
295 |
-
}
|
296 |
-
}
|
297 |
-
}
|
298 |
-
});
|
299 |
-
|
300 |
-
jQuery.each(toShow, function(k,v) {
|
301 |
-
delete toHide[k];
|
302 |
-
var $w=jQuery('#'+k);
|
303 |
-
$w.show();
|
304 |
-
});
|
305 |
-
jQuery.each(toHide, function(k,v) {
|
306 |
-
var $w=jQuery('#'+k);
|
307 |
-
$w.hide();
|
308 |
-
});
|
309 |
-
}
|
310 |
-
TCMP.setCookie=function(name,value,days) {
|
311 |
-
name='TCMP_'+name;
|
312 |
-
if (days) {
|
313 |
-
var date = new Date();
|
314 |
-
date.setTime(date.getTime()+(days*24*60*60*1000));
|
315 |
-
var expires = "; expires="+date.toGMTString();
|
316 |
-
}
|
317 |
-
else var expires = "";
|
318 |
-
document.cookie = name+"="+value+expires+"; path=/";
|
319 |
-
}
|
320 |
-
TCMP.getCookie=function(name) {
|
321 |
-
name='TCMP_'+name;
|
322 |
-
var nameEQ = name + "=";
|
323 |
-
var ca = document.cookie.split(';');
|
324 |
-
for(var i=0;i < ca.length;i++) {
|
325 |
-
var c = ca[i];
|
326 |
-
while (c.charAt(0)==' ') c = c.substring(1,c.length);
|
327 |
-
if (c.indexOf(nameEQ) == 0) return c.substring(nameEQ.length,c.length);
|
328 |
-
}
|
329 |
-
return null;
|
330 |
-
}
|
331 |
-
TCMP.removeCookie=function(name) {
|
332 |
-
createCookie(name,"",-1);
|
333 |
-
}
|
334 |
-
TCMP.getDateCookie=function(name) {
|
335 |
-
var result=TCMP.getCookie(name);
|
336 |
-
if(result!==null) {
|
337 |
-
//console.log('getDateCookie RESULT=%s', result);
|
338 |
-
result=moment(result).toDate();
|
339 |
-
//console.log('getDateCookie MOMENT=%s', result);
|
340 |
-
}
|
341 |
-
return result;
|
342 |
-
}
|
343 |
-
TCMP.setDateCookie=function(name, value, days) {
|
344 |
-
if(value!==null && value!=='') {
|
345 |
-
//console.log('setDateCookie RESULT=%s', value);
|
346 |
-
value=moment(value).format();
|
347 |
-
//console.log('setDateCookie MOMENT=%s', value);
|
348 |
-
}
|
349 |
-
TCMP.setCookie(name, value, days);
|
350 |
-
}
|
351 |
-
TCMP.formatTimer=function(time) {
|
352 |
-
if(!(time+'').match(/^\d+$/)) {
|
353 |
-
if(jQuery.type(time)=='string') {
|
354 |
-
time=time.replace(' ', ':');
|
355 |
-
time=time.replace('.', ':');
|
356 |
-
time=time.replace('/', ':');
|
357 |
-
time=time.split(':');
|
358 |
-
|
359 |
-
days=0;
|
360 |
-
hours=0;
|
361 |
-
minutes=0;
|
362 |
-
var length=time.length;
|
363 |
-
secs=parseInt(time[length-1]);
|
364 |
-
if(length>1) {
|
365 |
-
minutes=parseInt(time[length-2]);
|
366 |
-
if(length>2) {
|
367 |
-
hours=parseInt(time[length-3]);
|
368 |
-
if(length>3) {
|
369 |
-
days=parseInt(time[length-4]);
|
370 |
-
}
|
371 |
-
}
|
372 |
-
}
|
373 |
-
days=(isNaN(days) ? 0 : days);
|
374 |
-
hours=(isNaN(hours) ? 0 : hours);
|
375 |
-
minutes=(isNaN(minutes) ? 0 : minutes);
|
376 |
-
secs=(isNaN(secs) ? 0 : secs);
|
377 |
-
time=days*86400+hours*3600+minutes*60+secs;
|
378 |
-
} else {
|
379 |
-
time=0;
|
380 |
-
}
|
381 |
-
} else {
|
382 |
-
time=parseInt(time);
|
383 |
-
}
|
384 |
-
|
385 |
-
secs=time%60;
|
386 |
-
time=(time-secs)/60;
|
387 |
-
minutes=time%60;
|
388 |
-
time=(time-minutes)/60;
|
389 |
-
hours=time%24;
|
390 |
-
days=(time-hours)/24;
|
391 |
-
|
392 |
-
result=[];
|
393 |
-
result.push(days);
|
394 |
-
result.push((hours<10 ? '0' : '')+hours);
|
395 |
-
result.push((minutes<10 ? '0' : '')+minutes);
|
396 |
-
result.push((secs<10 ? '0' : '')+secs);
|
397 |
-
result=result.join(':');
|
398 |
-
return result;
|
399 |
-
}
|
400 |
-
TCMP.parseTimer=function(time) {
|
401 |
-
time=TCMP.formatTimer(time);
|
402 |
-
time=time.split(':');
|
403 |
-
result=parseInt(time[0])*86400+parseInt(time[1])*3600+parseInt(time[2])*60+parseInt(time[3]);
|
404 |
-
return result;
|
405 |
-
}
|
406 |
-
TCMP.isTrue=function(value) {
|
407 |
-
var result=false;
|
408 |
-
if(value===true) {
|
409 |
-
result=true;
|
410 |
-
} else if(value===false) {
|
411 |
-
result=false;
|
412 |
-
} else {
|
413 |
-
value=(value+'').toLowerCase();
|
414 |
-
result=(value=='yes' || value=='true' || value=='1');
|
415 |
-
}
|
416 |
-
return result;
|
417 |
-
}
|
418 |
-
TCMP.getFixedHeaders=function(value) {
|
419 |
-
//if we can't find it with selectors, the loop through every element
|
420 |
-
//in <body> - stopping once we find a position:fixed element and return that.
|
421 |
-
var $headers=[];
|
422 |
-
var $this;
|
423 |
-
jQuery('html div').each(function() {
|
424 |
-
$this=jQuery(this);
|
425 |
-
if($this.css('position')=='fixed') {
|
426 |
-
$headers.push($this);
|
427 |
-
}
|
428 |
-
});
|
429 |
-
/*if(jQuery('#blackbox-web-debug').length>0) {
|
430 |
-
$this=jQuery('#blackbox-web-debug');
|
431 |
-
$headers.push($this);
|
432 |
-
}*/
|
433 |
-
return $headers;
|
434 |
-
}
|
435 |
-
TCMP.parseInt=function(value, defaultValue) {
|
436 |
-
defaultValue=(defaultValue || 0);
|
437 |
-
value=parseInt(value);
|
438 |
-
if(isNaN(value)) {
|
439 |
-
value=defaultValue;
|
440 |
-
}
|
441 |
-
return value;
|
442 |
-
}
|
443 |
-
TCMP.replace=function(target, search, replacement) {
|
444 |
-
//return target.replace(new RegExp(search, 'g'), replacement);
|
445 |
-
return target.split(search).join(replacement);
|
446 |
}
|
1 |
+
//IntellyWP
|
2 |
+
var TCMP={};
|
3 |
+
TCMP.startsWith=function(str, prefix) {
|
4 |
+
return str.indexOf(prefix) === 0;
|
5 |
+
}
|
6 |
+
TCMP.endsWith=function(str, suffix) {
|
7 |
+
var result=false;
|
8 |
+
var pos=str.lastIndexOf(suffix);
|
9 |
+
if(pos===(str.length-suffix.length+1)) {
|
10 |
+
result=true;
|
11 |
+
}
|
12 |
+
return result;
|
13 |
+
}
|
14 |
+
TCMP.stripos=function(haystack, needle, offset) {
|
15 |
+
var haystack=(haystack + '').toLowerCase();
|
16 |
+
var needle=(needle + '').toLowerCase();
|
17 |
+
var index=0;
|
18 |
+
|
19 |
+
if ((index=haystack.indexOf(needle, offset))!==-1) {
|
20 |
+
return index;
|
21 |
+
}
|
22 |
+
return false;
|
23 |
+
};
|
24 |
+
TCMP.strpos=function(haystack, needle, offset) {
|
25 |
+
var haystack=(haystack + '');
|
26 |
+
var needle=(needle + '');
|
27 |
+
var index=0;
|
28 |
+
|
29 |
+
if ((index=haystack.indexOf(needle, offset))!==-1) {
|
30 |
+
return index;
|
31 |
+
}
|
32 |
+
return false;
|
33 |
+
};
|
34 |
+
TCMP.val=function(name, defaults) {
|
35 |
+
defaults=(defaults || '');
|
36 |
+
|
37 |
+
var result=[];
|
38 |
+
var $self=TCMP.jQuery(name);
|
39 |
+
if($self!==false) {
|
40 |
+
$self.each(function(i,v) {
|
41 |
+
var $this=jQuery(this);
|
42 |
+
var type=TCMP.attr($this, 'type', '');
|
43 |
+
if(type=='checkbox') {
|
44 |
+
v=TCMP.check($this);
|
45 |
+
} else if(type=='radio') {
|
46 |
+
v=TCMP.radio($this);
|
47 |
+
} else {
|
48 |
+
v=$this.val();
|
49 |
+
}
|
50 |
+
result.push(v);
|
51 |
+
});
|
52 |
+
}
|
53 |
+
if(result.length==0 || (result.length==1 && result[0]===null)) {
|
54 |
+
result=defaults;
|
55 |
+
} else {
|
56 |
+
result=result.join('|');
|
57 |
+
}
|
58 |
+
return result;
|
59 |
+
};
|
60 |
+
TCMP.check=function(name) {
|
61 |
+
var $self=TCMP.jQuery(name);
|
62 |
+
return ($self.is(':checked') ? 1 : 0);
|
63 |
+
};
|
64 |
+
TCMP.radio=function(name) {
|
65 |
+
var $self=TCMP.jQuery(name);
|
66 |
+
return ($self.filter(':checked').val());
|
67 |
+
};
|
68 |
+
TCMP.visible=function(name, visible) {
|
69 |
+
if(visible) {
|
70 |
+
jQuery(name).hide();
|
71 |
+
} else {
|
72 |
+
jQuery(name).show();
|
73 |
+
}
|
74 |
+
};
|
75 |
+
TCMP.aval=function(name) {
|
76 |
+
var data={};
|
77 |
+
jQuery("[name^='"+name+"']").each(function(i,v) {
|
78 |
+
var $this=jQuery(this);
|
79 |
+
var k=$this.attr('name');
|
80 |
+
var v=$this.val();
|
81 |
+
if($this.attr('type')=='checkbox') {
|
82 |
+
v=TCMP.check(k);
|
83 |
+
} else if($this.attr('type')=='radio') {
|
84 |
+
v=TCMP.radio(k);
|
85 |
+
}
|
86 |
+
data[k]=v;
|
87 |
+
});
|
88 |
+
//console.log(data);
|
89 |
+
return data;
|
90 |
+
};
|
91 |
+
TCMP.formatColorOption=function(option) {
|
92 |
+
if (!option.id) {
|
93 |
+
return option.text;
|
94 |
+
}
|
95 |
+
|
96 |
+
var color=jQuery(option.element).css('background-color');
|
97 |
+
var font=jQuery(option.element).css('color');
|
98 |
+
var $option=jQuery('<div></div>')
|
99 |
+
.html(option.text)
|
100 |
+
.css('background-color', color)
|
101 |
+
.css('color', font)
|
102 |
+
.addClass('lbColorSelectItem');
|
103 |
+
return $option;
|
104 |
+
};
|
105 |
+
TCMP.hideShow=function(name) {
|
106 |
+
var $source=TCMP.jQuery(name);
|
107 |
+
if ($source.attr('ipfm-hideIfTrue') && $source.attr('ipfm-hideShow')) {
|
108 |
+
var $destination=jQuery('[name=' + $source.attr('ipfm-hideShow') + ']');
|
109 |
+
if ($destination.length == 0) {
|
110 |
+
$destination=jQuery('#' + $source.attr('ipfm-hideShow'));
|
111 |
+
}
|
112 |
+
if ($destination.length > 0) {
|
113 |
+
var isChecked=$source.is(":checked");
|
114 |
+
var hideIfTrue=($source.attr('ipfm-hideIfTrue').toLowerCase() == 'true');
|
115 |
+
|
116 |
+
if (isChecked) {
|
117 |
+
if (hideIfTrue) {
|
118 |
+
$destination.hide();
|
119 |
+
} else {
|
120 |
+
$destination.show();
|
121 |
+
}
|
122 |
+
} else {
|
123 |
+
if (hideIfTrue) {
|
124 |
+
$destination.show();
|
125 |
+
} else {
|
126 |
+
$destination.hide();
|
127 |
+
}
|
128 |
+
}
|
129 |
+
}
|
130 |
+
}
|
131 |
+
};
|
132 |
+
TCMP.jQuery=function(name) {
|
133 |
+
var $self=name;
|
134 |
+
if(jQuery.type(name)=='string' || jQuery.type(name)=='array') {
|
135 |
+
$self=false;
|
136 |
+
var array=[];
|
137 |
+
var names=[];
|
138 |
+
switch (jQuery.type(name)) {
|
139 |
+
case 'string':
|
140 |
+
names=name.split('|');
|
141 |
+
break;
|
142 |
+
case 'array':
|
143 |
+
names=name;
|
144 |
+
break;
|
145 |
+
}
|
146 |
+
jQuery.each(names, function(i,v) {
|
147 |
+
var selector='[name='+v+']';
|
148 |
+
if(jQuery(selector).length>0) {
|
149 |
+
array.push(selector);
|
150 |
+
} else {
|
151 |
+
selector='#'+v;
|
152 |
+
if(jQuery(selector).length>0) {
|
153 |
+
array.push(selector);
|
154 |
+
}
|
155 |
+
}
|
156 |
+
});
|
157 |
+
if(array.length>0) {
|
158 |
+
array=array.join(',');
|
159 |
+
$self=jQuery(array);
|
160 |
+
}
|
161 |
+
}
|
162 |
+
return $self;
|
163 |
+
}
|
164 |
+
TCMP.attr=function($self, name, v) {
|
165 |
+
$self=TCMP.jQuery($self);
|
166 |
+
var result=v;
|
167 |
+
if($self.length>0) {
|
168 |
+
result=$self.attr(name);
|
169 |
+
}
|
170 |
+
if ((typeof result === typeof undefined) || (result===false)) {
|
171 |
+
result=v;
|
172 |
+
}
|
173 |
+
return result;
|
174 |
+
};
|
175 |
+
TCMP.select2=function($self, options) {
|
176 |
+
TCMP.destroy($self);
|
177 |
+
|
178 |
+
var $self=TCMP.jQuery($self);
|
179 |
+
var name=$self.attr('name');
|
180 |
+
var multiple=TCMP.attr($self, 'multiple', false);
|
181 |
+
if (multiple!==false) {
|
182 |
+
multiple=true;
|
183 |
+
}
|
184 |
+
|
185 |
+
hasSelection=false;
|
186 |
+
if($self.html().indexOf('selected')>0) {
|
187 |
+
//jQuery fails if you dont have any selected item return the first
|
188 |
+
$self.find("option").each(function() {
|
189 |
+
var $option=jQuery(this);
|
190 |
+
if(TCMP.attr($option, 'selected', '')!='') {
|
191 |
+
hasSelection=true;
|
192 |
+
}
|
193 |
+
});
|
194 |
+
}
|
195 |
+
|
196 |
+
var help=TCMP.attr($self, 'ipfm-help', '');
|
197 |
+
var ajax=TCMP.attr($self, 'ipfm-ajax', false);
|
198 |
+
var parent=TCMP.attr($self, 'ipfm-master', '');
|
199 |
+
var settings={};
|
200 |
+
if(ajax===false || ajax==='') {
|
201 |
+
settings={
|
202 |
+
placeholder: help
|
203 |
+
, width: '100%'
|
204 |
+
, allowClear: true
|
205 |
+
}
|
206 |
+
} else {
|
207 |
+
settings={
|
208 |
+
placeholder: help
|
209 |
+
, width: '100%'
|
210 |
+
, allowClear: true
|
211 |
+
, ajax: {
|
212 |
+
type: 'POST'
|
213 |
+
, dataType: 'json'
|
214 |
+
, delay: 250
|
215 |
+
, data: function (params) {
|
216 |
+
var result={
|
217 |
+
q: params.term
|
218 |
+
, page: params.page
|
219 |
+
, action: 'lb_ajax_ll'
|
220 |
+
, lb_action: ajax
|
221 |
+
};
|
222 |
+
if(parent!='') {
|
223 |
+
result['parentId']=TCMP.val(parent);
|
224 |
+
}
|
225 |
+
return result;
|
226 |
+
}
|
227 |
+
, processResults: function (data, page) {
|
228 |
+
return {results: data};
|
229 |
+
}
|
230 |
+
, cache: true
|
231 |
+
}
|
232 |
+
, minimumInputLength: 2
|
233 |
+
}
|
234 |
+
}
|
235 |
+
settings=jQuery.extend(settings, options);
|
236 |
+
$self.select2(settings);
|
237 |
+
$self.hide();
|
238 |
+
if(!hasSelection) {
|
239 |
+
$self.val(null).trigger('change');
|
240 |
+
}
|
241 |
+
};
|
242 |
+
TCMP.destroy=function($self) {
|
243 |
+
var name=$self.attr('name');
|
244 |
+
try {
|
245 |
+
if($self.data('select2') != null) {
|
246 |
+
//TCMP.log('[%s] DESTROY SELECT2', name);
|
247 |
+
$self.select2("destroy");
|
248 |
+
$self.html("<option><option>");
|
249 |
+
$self.val('').trigger('change');
|
250 |
+
}
|
251 |
+
} catch(ex) {}
|
252 |
+
};
|
253 |
+
TCMP.inArray=function(v, array) {
|
254 |
+
var result=false;
|
255 |
+
if(!array || !jQuery.isArray(array) || array.length==0) {
|
256 |
+
if(jQuery.type(array)=='string' && v==array) {
|
257 |
+
result=true;
|
258 |
+
}
|
259 |
+
} else {
|
260 |
+
for(i=0; i<array.length; i++) {
|
261 |
+
c=array[i];
|
262 |
+
if(v==c) {
|
263 |
+
result=true;
|
264 |
+
break;
|
265 |
+
}
|
266 |
+
}
|
267 |
+
}
|
268 |
+
return result;
|
269 |
+
}
|
270 |
+
TCMP.changeShowOptions=function($self) {
|
271 |
+
var selection=$self.val();
|
272 |
+
var name=TCMP.attr($self, 'name', '');
|
273 |
+
var $options=$self.children('option');
|
274 |
+
//console.log('NAME=[%s] OPTIONS=N.%s', name, $options.length);
|
275 |
+
var toShow={};
|
276 |
+
var toHide={};
|
277 |
+
$options.each(function(i,v) {
|
278 |
+
$option=jQuery(v);
|
279 |
+
var text=TCMP.attr($option, 'show', '');
|
280 |
+
if(text!='') {
|
281 |
+
text=text.split('|');
|
282 |
+
var j=0;
|
283 |
+
for(j=0; j<text.length; j++) {
|
284 |
+
var show=text[j];
|
285 |
+
var $show=jQuery('#'+show);
|
286 |
+
if($show.length>0) {
|
287 |
+
var value=TCMP.attr($option, 'value', '');
|
288 |
+
if(TCMP.inArray(value, selection)) {
|
289 |
+
toShow[show]=show;
|
290 |
+
} else {
|
291 |
+
toHide[show]=show;
|
292 |
+
}
|
293 |
+
} else {
|
294 |
+
console.log('changeShowOptions ID=[%s] NOT FOUND', show);
|
295 |
+
}
|
296 |
+
}
|
297 |
+
}
|
298 |
+
});
|
299 |
+
|
300 |
+
jQuery.each(toShow, function(k,v) {
|
301 |
+
delete toHide[k];
|
302 |
+
var $w=jQuery('#'+k);
|
303 |
+
$w.show();
|
304 |
+
});
|
305 |
+
jQuery.each(toHide, function(k,v) {
|
306 |
+
var $w=jQuery('#'+k);
|
307 |
+
$w.hide();
|
308 |
+
});
|
309 |
+
}
|
310 |
+
TCMP.setCookie=function(name,value,days) {
|
311 |
+
name='TCMP_'+name;
|
312 |
+
if (days) {
|
313 |
+
var date = new Date();
|
314 |
+
date.setTime(date.getTime()+(days*24*60*60*1000));
|
315 |
+
var expires = "; expires="+date.toGMTString();
|
316 |
+
}
|
317 |
+
else var expires = "";
|
318 |
+
document.cookie = name+"="+value+expires+"; path=/";
|
319 |
+
}
|
320 |
+
TCMP.getCookie=function(name) {
|
321 |
+
name='TCMP_'+name;
|
322 |
+
var nameEQ = name + "=";
|
323 |
+
var ca = document.cookie.split(';');
|
324 |
+
for(var i=0;i < ca.length;i++) {
|
325 |
+
var c = ca[i];
|
326 |
+
while (c.charAt(0)==' ') c = c.substring(1,c.length);
|
327 |
+
if (c.indexOf(nameEQ) == 0) return c.substring(nameEQ.length,c.length);
|
328 |
+
}
|
329 |
+
return null;
|
330 |
+
}
|
331 |
+
TCMP.removeCookie=function(name) {
|
332 |
+
createCookie(name,"",-1);
|
333 |
+
}
|
334 |
+
TCMP.getDateCookie=function(name) {
|
335 |
+
var result=TCMP.getCookie(name);
|
336 |
+
if(result!==null) {
|
337 |
+
//console.log('getDateCookie RESULT=%s', result);
|
338 |
+
result=moment(result).toDate();
|
339 |
+
//console.log('getDateCookie MOMENT=%s', result);
|
340 |
+
}
|
341 |
+
return result;
|
342 |
+
}
|
343 |
+
TCMP.setDateCookie=function(name, value, days) {
|
344 |
+
if(value!==null && value!=='') {
|
345 |
+
//console.log('setDateCookie RESULT=%s', value);
|
346 |
+
value=moment(value).format();
|
347 |
+
//console.log('setDateCookie MOMENT=%s', value);
|
348 |
+
}
|
349 |
+
TCMP.setCookie(name, value, days);
|
350 |
+
}
|
351 |
+
TCMP.formatTimer=function(time) {
|
352 |
+
if(!(time+'').match(/^\d+$/)) {
|
353 |
+
if(jQuery.type(time)=='string') {
|
354 |
+
time=time.replace(' ', ':');
|
355 |
+
time=time.replace('.', ':');
|
356 |
+
time=time.replace('/', ':');
|
357 |
+
time=time.split(':');
|
358 |
+
|
359 |
+
days=0;
|
360 |
+
hours=0;
|
361 |
+
minutes=0;
|
362 |
+
var length=time.length;
|
363 |
+
secs=parseInt(time[length-1]);
|
364 |
+
if(length>1) {
|
365 |
+
minutes=parseInt(time[length-2]);
|
366 |
+
if(length>2) {
|
367 |
+
hours=parseInt(time[length-3]);
|
368 |
+
if(length>3) {
|
369 |
+
days=parseInt(time[length-4]);
|
370 |
+
}
|
371 |
+
}
|
372 |
+
}
|
373 |
+
days=(isNaN(days) ? 0 : days);
|
374 |
+
hours=(isNaN(hours) ? 0 : hours);
|
375 |
+
minutes=(isNaN(minutes) ? 0 : minutes);
|
376 |
+
secs=(isNaN(secs) ? 0 : secs);
|
377 |
+
time=days*86400+hours*3600+minutes*60+secs;
|
378 |
+
} else {
|
379 |
+
time=0;
|
380 |
+
}
|
381 |
+
} else {
|
382 |
+
time=parseInt(time);
|
383 |
+
}
|
384 |
+
|
385 |
+
secs=time%60;
|
386 |
+
time=(time-secs)/60;
|
387 |
+
minutes=time%60;
|
388 |
+
time=(time-minutes)/60;
|
389 |
+
hours=time%24;
|
390 |
+
days=(time-hours)/24;
|
391 |
+
|
392 |
+
result=[];
|
393 |
+
result.push(days);
|
394 |
+
result.push((hours<10 ? '0' : '')+hours);
|
395 |
+
result.push((minutes<10 ? '0' : '')+minutes);
|
396 |
+
result.push((secs<10 ? '0' : '')+secs);
|
397 |
+
result=result.join(':');
|
398 |
+
return result;
|
399 |
+
}
|
400 |
+
TCMP.parseTimer=function(time) {
|
401 |
+
time=TCMP.formatTimer(time);
|
402 |
+
time=time.split(':');
|
403 |
+
result=parseInt(time[0])*86400+parseInt(time[1])*3600+parseInt(time[2])*60+parseInt(time[3]);
|
404 |
+
return result;
|
405 |
+
}
|
406 |
+
TCMP.isTrue=function(value) {
|
407 |
+
var result=false;
|
408 |
+
if(value===true) {
|
409 |
+
result=true;
|
410 |
+
} else if(value===false) {
|
411 |
+
result=false;
|
412 |
+
} else {
|
413 |
+
value=(value+'').toLowerCase();
|
414 |
+
result=(value=='yes' || value=='true' || value=='1');
|
415 |
+
}
|
416 |
+
return result;
|
417 |
+
}
|
418 |
+
TCMP.getFixedHeaders=function(value) {
|
419 |
+
//if we can't find it with selectors, the loop through every element
|
420 |
+
//in <body> - stopping once we find a position:fixed element and return that.
|
421 |
+
var $headers=[];
|
422 |
+
var $this;
|
423 |
+
jQuery('html div').each(function() {
|
424 |
+
$this=jQuery(this);
|
425 |
+
if($this.css('position')=='fixed') {
|
426 |
+
$headers.push($this);
|
427 |
+
}
|
428 |
+
});
|
429 |
+
/*if(jQuery('#blackbox-web-debug').length>0) {
|
430 |
+
$this=jQuery('#blackbox-web-debug');
|
431 |
+
$headers.push($this);
|
432 |
+
}*/
|
433 |
+
return $headers;
|
434 |
+
}
|
435 |
+
TCMP.parseInt=function(value, defaultValue) {
|
436 |
+
defaultValue=(defaultValue || 0);
|
437 |
+
value=parseInt(value);
|
438 |
+
if(isNaN(value)) {
|
439 |
+
value=defaultValue;
|
440 |
+
}
|
441 |
+
return value;
|
442 |
+
}
|
443 |
+
TCMP.replace=function(target, search, replacement) {
|
444 |
+
//return target.replace(new RegExp(search, 'g'), replacement);
|
445 |
+
return target.split(search).join(replacement);
|
446 |
}
|
assets/js/plugin.js
CHANGED
@@ -1,104 +1,104 @@
|
|
1 |
-
//IntellyWP
|
2 |
-
jQuery('.wrap .updated.fade').remove();
|
3 |
-
jQuery('.woocommerce-message').remove();
|
4 |
-
jQuery('.error').remove();
|
5 |
-
jQuery('.info').remove();
|
6 |
-
jQuery('.update-nag').remove();
|
7 |
-
|
8 |
-
jQuery(function() {
|
9 |
-
"use strict";
|
10 |
-
//WooCommerce errors
|
11 |
-
var removeWooUpdateTheme = setInterval(function () {
|
12 |
-
if (jQuery('.wrap .updated.fade').length > 0) {
|
13 |
-
jQuery('.wrap .updated.fade').remove();
|
14 |
-
clearInterval(removeWooUpdateTheme);
|
15 |
-
}
|
16 |
-
}, 100);
|
17 |
-
var removeWooMessage = setInterval(function () {
|
18 |
-
if (jQuery('.woocommerce-message').length > 0) {
|
19 |
-
jQuery('.woocommerce-message').remove();
|
20 |
-
clearInterval(removeWooMessage);
|
21 |
-
}
|
22 |
-
}, 100);
|
23 |
-
|
24 |
-
jQuery('.wrap .updated.fade').remove();
|
25 |
-
jQuery('.woocommerce-message').remove();
|
26 |
-
jQuery('.error').remove();
|
27 |
-
jQuery('.info').remove();
|
28 |
-
jQuery('.update-nag').remove();
|
29 |
-
});
|
30 |
-
|
31 |
-
jQuery(function() {
|
32 |
-
if(jQuery('.wrap .updated.fade').length>0) {
|
33 |
-
jQuery('.wrap .updated.fade').remove();
|
34 |
-
}
|
35 |
-
if(jQuery('.woocommerce-message').length>0) {
|
36 |
-
jQuery('.woocommerce-message').remove();
|
37 |
-
}
|
38 |
-
jQuery('.update-nag,.updated,.error').each(function() {
|
39 |
-
var $self=jQuery(this);
|
40 |
-
if(!$self.hasClass('iwp')) {
|
41 |
-
$self.remove();
|
42 |
-
}
|
43 |
-
});
|
44 |
-
});
|
45 |
-
|
46 |
-
jQuery(function() {
|
47 |
-
"use strict";
|
48 |
-
|
49 |
-
//WooCommerce errors
|
50 |
-
var removeWooUpdateTheme=setInterval(function () {
|
51 |
-
if (jQuery('.wrap .updated.fade').length > 0) {
|
52 |
-
jQuery('.wrap .updated.fade').remove();
|
53 |
-
clearInterval(removeWooUpdateTheme);
|
54 |
-
}
|
55 |
-
}, 100);
|
56 |
-
var removeWooMessage=setInterval(function () {
|
57 |
-
if (jQuery('.woocommerce-message').length > 0) {
|
58 |
-
jQuery('.woocommerce-message').remove();
|
59 |
-
clearInterval(removeWooMessage);
|
60 |
-
}
|
61 |
-
}, 100);
|
62 |
-
});
|
63 |
-
|
64 |
-
jQuery(function() {
|
65 |
-
jQuery('.tcmp-select-onfocus').click(function() {
|
66 |
-
var $self=jQuery(this);
|
67 |
-
$self.select();
|
68 |
-
});
|
69 |
-
|
70 |
-
jQuery(".tcmp-hideShow").click(function() {
|
71 |
-
tcmp_hideShow(this);
|
72 |
-
});
|
73 |
-
jQuery(".tcmp-hideShow").each(function() {
|
74 |
-
tcmp_hideShow(this);
|
75 |
-
});
|
76 |
-
|
77 |
-
function tcmp_hideShow(v) {
|
78 |
-
var $source=jQuery(v);
|
79 |
-
if($source.attr('tcmp-hideIfTrue') && $source.attr('tcmp-hideShow')) {
|
80 |
-
var $destination=jQuery('[name='+$source.attr('tcmp-hideShow')+']');
|
81 |
-
if($destination.length==0) {
|
82 |
-
$destination=jQuery('#'+$source.attr('tcmp-hideShow'));
|
83 |
-
}
|
84 |
-
if($destination.length>0) {
|
85 |
-
var isChecked=$source.is(":checked");
|
86 |
-
var hideIfTrue=($source.attr('tcmp-hideIfTrue').toLowerCase()=='true');
|
87 |
-
|
88 |
-
if(isChecked) {
|
89 |
-
if(hideIfTrue) {
|
90 |
-
$destination.hide();
|
91 |
-
} else {
|
92 |
-
$destination.show();
|
93 |
-
}
|
94 |
-
} else {
|
95 |
-
if(hideIfTrue) {
|
96 |
-
$destination.show();
|
97 |
-
} else {
|
98 |
-
$destination.hide();
|
99 |
-
}
|
100 |
-
}
|
101 |
-
}
|
102 |
-
}
|
103 |
-
}
|
104 |
});
|
1 |
+
//IntellyWP
|
2 |
+
jQuery('.wrap .updated.fade').remove();
|
3 |
+
jQuery('.woocommerce-message').remove();
|
4 |
+
jQuery('.error').remove();
|
5 |
+
jQuery('.info').remove();
|
6 |
+
jQuery('.update-nag').remove();
|
7 |
+
|
8 |
+
jQuery(function() {
|
9 |
+
"use strict";
|
10 |
+
//WooCommerce errors
|
11 |
+
var removeWooUpdateTheme = setInterval(function () {
|
12 |
+
if (jQuery('.wrap .updated.fade').length > 0) {
|
13 |
+
jQuery('.wrap .updated.fade').remove();
|
14 |
+
clearInterval(removeWooUpdateTheme);
|
15 |
+
}
|
16 |
+
}, 100);
|
17 |
+
var removeWooMessage = setInterval(function () {
|
18 |
+
if (jQuery('.woocommerce-message').length > 0) {
|
19 |
+
jQuery('.woocommerce-message').remove();
|
20 |
+
clearInterval(removeWooMessage);
|
21 |
+
}
|
22 |
+
}, 100);
|
23 |
+
|
24 |
+
jQuery('.wrap .updated.fade').remove();
|
25 |
+
jQuery('.woocommerce-message').remove();
|
26 |
+
jQuery('.error').remove();
|
27 |
+
jQuery('.info').remove();
|
28 |
+
jQuery('.update-nag').remove();
|
29 |
+
});
|
30 |
+
|
31 |
+
jQuery(function() {
|
32 |
+
if(jQuery('.wrap .updated.fade').length>0) {
|
33 |
+
jQuery('.wrap .updated.fade').remove();
|
34 |
+
}
|
35 |
+
if(jQuery('.woocommerce-message').length>0) {
|
36 |
+
jQuery('.woocommerce-message').remove();
|
37 |
+
}
|
38 |
+
jQuery('.update-nag,.updated,.error').each(function() {
|
39 |
+
var $self=jQuery(this);
|
40 |
+
if(!$self.hasClass('iwp')) {
|
41 |
+
$self.remove();
|
42 |
+
}
|
43 |
+
});
|
44 |
+
});
|
45 |
+
|
46 |
+
jQuery(function() {
|
47 |
+
"use strict";
|
48 |
+
|
49 |
+
//WooCommerce errors
|
50 |
+
var removeWooUpdateTheme=setInterval(function () {
|
51 |
+
if (jQuery('.wrap .updated.fade').length > 0) {
|
52 |
+
jQuery('.wrap .updated.fade').remove();
|
53 |
+
clearInterval(removeWooUpdateTheme);
|
54 |
+
}
|
55 |
+
}, 100);
|
56 |
+
var removeWooMessage=setInterval(function () {
|
57 |
+
if (jQuery('.woocommerce-message').length > 0) {
|
58 |
+
jQuery('.woocommerce-message').remove();
|
59 |
+
clearInterval(removeWooMessage);
|
60 |
+
}
|
61 |
+
}, 100);
|
62 |
+
});
|
63 |
+
|
64 |
+
jQuery(function() {
|
65 |
+
jQuery('.tcmp-select-onfocus').click(function() {
|
66 |
+
var $self=jQuery(this);
|
67 |
+
$self.select();
|
68 |
+
});
|
69 |
+
|
70 |
+
jQuery(".tcmp-hideShow").click(function() {
|
71 |
+
tcmp_hideShow(this);
|
72 |
+
});
|
73 |
+
jQuery(".tcmp-hideShow").each(function() {
|
74 |
+
tcmp_hideShow(this);
|
75 |
+
});
|
76 |
+
|
77 |
+
function tcmp_hideShow(v) {
|
78 |
+
var $source=jQuery(v);
|
79 |
+
if($source.attr('tcmp-hideIfTrue') && $source.attr('tcmp-hideShow')) {
|
80 |
+
var $destination=jQuery('[name='+$source.attr('tcmp-hideShow')+']');
|
81 |
+
if($destination.length==0) {
|
82 |
+
$destination=jQuery('#'+$source.attr('tcmp-hideShow'));
|
83 |
+
}
|
84 |
+
if($destination.length>0) {
|
85 |
+
var isChecked=$source.is(":checked");
|
86 |
+
var hideIfTrue=($source.attr('tcmp-hideIfTrue').toLowerCase()=='true');
|
87 |
+
|
88 |
+
if(isChecked) {
|
89 |
+
if(hideIfTrue) {
|
90 |
+
$destination.hide();
|
91 |
+
} else {
|
92 |
+
$destination.show();
|
93 |
+
}
|
94 |
+
} else {
|
95 |
+
if(hideIfTrue) {
|
96 |
+
$destination.show();
|
97 |
+
} else {
|
98 |
+
$destination.hide();
|
99 |
+
}
|
100 |
+
}
|
101 |
+
}
|
102 |
+
}
|
103 |
+
}
|
104 |
});
|
autoload.php
CHANGED
@@ -1,48 +1,48 @@
|
|
1 |
-
<?php
|
2 |
-
spl_autoload_register('tcmp_autoload');
|
3 |
-
function tcmp_autoload($class) {
|
4 |
-
$root=dirname(__FILE__).'/includes/classes/';
|
5 |
-
tcmp_autoload_root($root, $class);
|
6 |
-
}
|
7 |
-
function tcmp_autoload_root($root, $class) {
|
8 |
-
$slash=substr($root, strlen($root)-1);
|
9 |
-
if($slash!='/' && $slash!='\\') {
|
10 |
-
$root.='/';
|
11 |
-
}
|
12 |
-
$name=str_replace(TCMP_PLUGIN_PREFIX, '', $class);
|
13 |
-
if(strpos($class, TCMP_PLUGIN_PREFIX)===FALSE) {
|
14 |
-
//autoload only plugin classes
|
15 |
-
return;
|
16 |
-
}
|
17 |
-
|
18 |
-
$h=opendir($root);
|
19 |
-
while($file=readdir($h)) {
|
20 |
-
if(is_dir($root.$file) && $file != '.' && $file != '..') {
|
21 |
-
tcmp_autoload_root($root.$file, $class);
|
22 |
-
} elseif(file_exists($root.$name.'.php')) {
|
23 |
-
include_once($root.$name.'.php');
|
24 |
-
} elseif(file_exists($root.$class.'.php')) {
|
25 |
-
include_once($root.$class.'.php');
|
26 |
-
}
|
27 |
-
}
|
28 |
-
}
|
29 |
-
function tcmp_include_php($root) {
|
30 |
-
$h=opendir($root);
|
31 |
-
$slash=substr($root, strlen($root)-1);
|
32 |
-
if($slash!='/' && $slash!='\\') {
|
33 |
-
$root.='/';
|
34 |
-
}
|
35 |
-
|
36 |
-
while($file=readdir($h)) {
|
37 |
-
if(is_dir($root.$file) && $file != '.' && $file != '..'){
|
38 |
-
tcmp_include_php($root.$file);
|
39 |
-
} elseif(strlen($file)>5) {
|
40 |
-
$ext='.php';
|
41 |
-
$length=strlen($ext);
|
42 |
-
$start=$length*-1; //negative
|
43 |
-
if(strcasecmp(substr($file, $start), $ext)==0) {
|
44 |
-
include_once($root.$file);
|
45 |
-
}
|
46 |
-
}
|
47 |
-
}
|
48 |
}
|
1 |
+
<?php
|
2 |
+
spl_autoload_register('tcmp_autoload');
|
3 |
+
function tcmp_autoload($class) {
|
4 |
+
$root=dirname(__FILE__).'/includes/classes/';
|
5 |
+
tcmp_autoload_root($root, $class);
|
6 |
+
}
|
7 |
+
function tcmp_autoload_root($root, $class) {
|
8 |
+
$slash=substr($root, strlen($root)-1);
|
9 |
+
if($slash!='/' && $slash!='\\') {
|
10 |
+
$root.='/';
|
11 |
+
}
|
12 |
+
$name=str_replace(TCMP_PLUGIN_PREFIX, '', $class);
|
13 |
+
if(strpos($class, TCMP_PLUGIN_PREFIX)===FALSE) {
|
14 |
+
//autoload only plugin classes
|
15 |
+
return;
|
16 |
+
}
|
17 |
+
|
18 |
+
$h=opendir($root);
|
19 |
+
while($file=readdir($h)) {
|
20 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..') {
|
21 |
+
tcmp_autoload_root($root.$file, $class);
|
22 |
+
} elseif(file_exists($root.$name.'.php')) {
|
23 |
+
include_once($root.$name.'.php');
|
24 |
+
} elseif(file_exists($root.$class.'.php')) {
|
25 |
+
include_once($root.$class.'.php');
|
26 |
+
}
|
27 |
+
}
|
28 |
+
}
|
29 |
+
function tcmp_include_php($root) {
|
30 |
+
$h=opendir($root);
|
31 |
+
$slash=substr($root, strlen($root)-1);
|
32 |
+
if($slash!='/' && $slash!='\\') {
|
33 |
+
$root.='/';
|
34 |
+
}
|
35 |
+
|
36 |
+
while($file=readdir($h)) {
|
37 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..'){
|
38 |
+
tcmp_include_php($root.$file);
|
39 |
+
} elseif(strlen($file)>5) {
|
40 |
+
$ext='.php';
|
41 |
+
$length=strlen($ext);
|
42 |
+
$start=$length*-1; //negative
|
43 |
+
if(strcasecmp(substr($file, $start), $ext)==0) {
|
44 |
+
include_once($root.$file);
|
45 |
+
}
|
46 |
+
}
|
47 |
+
}
|
48 |
}
|
includes/actions.php
CHANGED
@@ -1,3 +1,3 @@
|
|
1 |
-
<?php
|
2 |
-
// Exit if accessed directly
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
1 |
+
<?php
|
2 |
+
// Exit if accessed directly
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
includes/admin/editor.php
CHANGED
@@ -1,414 +1,414 @@
|
|
1 |
-
<?php
|
2 |
-
function tcmp_notice_pro_features() {
|
3 |
-
global $tcmp;
|
4 |
-
?>
|
5 |
-
<br/>
|
6 |
-
<div class="message updated below-h2 iwp">
|
7 |
-
<div style="height:10px;"></div>
|
8 |
-
<?php
|
9 |
-
$i=1;
|
10 |
-
while($tcmp->Lang->H('Notice.ProHeader'.$i)) {
|
11 |
-
$tcmp->Lang->P('Notice.ProHeader'.$i);
|
12 |
-
echo '<br/>';
|
13 |
-
++$i;
|
14 |
-
}
|
15 |
-
$i=1;
|
16 |
-
?>
|
17 |
-
<br/>
|
18 |
-
<?php
|
19 |
-
|
20 |
-
/*$options = array('public' => TRUE, '_builtin' => FALSE);
|
21 |
-
$q=get_post_types($options, 'names');
|
22 |
-
if(is_array($q) && count($q)>0) {
|
23 |
-
sort($q);
|
24 |
-
$q=implode(', ', $q);
|
25 |
-
$q='(<b>'.$q.'</b>)';
|
26 |
-
} else {
|
27 |
-
$q='';
|
28 |
-
}*/
|
29 |
-
$q='';
|
30 |
-
while($tcmp->Lang->H('Notice.ProFeature'.$i)) { ?>
|
31 |
-
<div style="clear:both; margin-top: 2px;"></div>
|
32 |
-
<div style="float:left; vertical-align:middle; height:24px; margin-right:5px; margin-top:-5px;">
|
33 |
-
<img src="<?php echo TCMP_PLUGIN_IMAGES_URI?>tick.png" />
|
34 |
-
</div>
|
35 |
-
<div style="float:left; vertical-align:middle; height:24px;">
|
36 |
-
<?php $tcmp->Lang->P('Notice.ProFeature'.$i, $q)?>
|
37 |
-
</div>
|
38 |
-
<?php ++$i;
|
39 |
-
}
|
40 |
-
?>
|
41 |
-
<div style="clear:both;"></div>
|
42 |
-
<div style="height:10px;"></div>
|
43 |
-
<div style="float:right;">
|
44 |
-
<?php
|
45 |
-
$url=TCMP_PAGE_PREMIUM.'?utm_source=free-users&utm_medium=wp-cta&utm_campaign=wp-plugin';
|
46 |
-
?>
|
47 |
-
<a href="<?php echo $url?>" target="_blank">
|
48 |
-
<b><?php $tcmp->Lang->P('Notice.ProCTA')?></b>
|
49 |
-
</a>
|
50 |
-
</div>
|
51 |
-
<div style="height:10px; clear:both;"></div>
|
52 |
-
</div>
|
53 |
-
<br/>
|
54 |
-
<?php }
|
55 |
-
function tcmp_ui_editor_check($snippet) {
|
56 |
-
global $tcmp;
|
57 |
-
|
58 |
-
$snippet['trackMode']=intval($snippet['trackMode']);
|
59 |
-
$snippet['trackPage']=intval($snippet['trackPage']);
|
60 |
-
|
61 |
-
$snippet['includeEverywhereActive']=0;
|
62 |
-
if($snippet['trackPage']==TCMP_TRACK_PAGE_ALL) {
|
63 |
-
$snippet['includeEverywhereActive']=1;
|
64 |
-
}
|
65 |
-
$snippet=$tcmp->Manager->sanitize($snippet['id'], $snippet);
|
66 |
-
|
67 |
-
if ($snippet['name'] == '') {
|
68 |
-
$tcmp->Options->pushErrorMessage('Please enter a unique name');
|
69 |
-
} else {
|
70 |
-
$exist=$tcmp->Manager->exists($snippet['name']);
|
71 |
-
if ($exist && $exist['id'] != $snippet['id']) {
|
72 |
-
//nonostante il tutto il nome deve essee univoco
|
73 |
-
$tcmp->Options->pushErrorMessage('You have entered a name that already exists. IDs are NOT case-sensitive');
|
74 |
-
}
|
75 |
-
}
|
76 |
-
if ($snippet['code'] == '') {
|
77 |
-
$tcmp->Options->pushErrorMessage('Paste your HTML Tracking Code into the textarea');
|
78 |
-
}
|
79 |
-
|
80 |
-
if($snippet['trackMode']==TCMP_TRACK_MODE_CODE) {
|
81 |
-
|
82 |
-
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
83 |
-
if($snippet['trackPage']==TCMP_TRACK_PAGE_SPECIFIC) {
|
84 |
-
foreach ($types as $v) {
|
85 |
-
$includeActiveKey='includePostsOfType_'.$v['id'].'_Active';
|
86 |
-
$includeArrayKey='includePostsOfType_'.$v['id'];
|
87 |
-
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
88 |
-
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
89 |
-
|
90 |
-
if ($snippet[$includeActiveKey] == 1 && $snippet[$exceptActiveKey] == 1) {
|
91 |
-
if (in_array(-1, $snippet[$includeArrayKey]) && in_array(-1, $snippet[$exceptArrayKey])) {
|
92 |
-
$tcmp->Options->pushErrorMessage('Error.IncludeExcludeAll', $v['name']);
|
93 |
-
}
|
94 |
-
}
|
95 |
-
if ($snippet[$includeActiveKey] == 1 && count($snippet[$includeArrayKey]) == 0) {
|
96 |
-
$tcmp->Options->pushErrorMessage('Error.IncludeSelectAtLeastOne', $v['name']);
|
97 |
-
}
|
98 |
-
}
|
99 |
-
|
100 |
-
//second loop to respect the display order
|
101 |
-
foreach ($types as $v) {
|
102 |
-
$includeActiveKey='includePostsOfType_'.$v['id'].'_Active';
|
103 |
-
$includeArrayKey='includePostsOfType_'.$v['id'];
|
104 |
-
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
105 |
-
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
106 |
-
|
107 |
-
if ($snippet[$includeActiveKey] == 1 && in_array(-1, $snippet[$includeArrayKey])) {
|
108 |
-
if ($snippet[$exceptActiveKey] == 1 && count($snippet[$exceptArrayKey]) == 0) {
|
109 |
-
$tcmp->Options->pushErrorMessage('Error.ExcludeSelectAtLeastOne', $v['name']);
|
110 |
-
}
|
111 |
-
}
|
112 |
-
}
|
113 |
-
} else {
|
114 |
-
foreach($types as $v) {
|
115 |
-
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
116 |
-
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
117 |
-
|
118 |
-
if(isset($snippet[$exceptActiveKey])
|
119 |
-
&& $snippet[$exceptActiveKey]==1
|
120 |
-
&& count($snippet[$exceptArrayKey])==0) {
|
121 |
-
$tcmp->Options->pushErrorMessage('Error.ExcludeSelectAtLeastOne', $v['name']);
|
122 |
-
}
|
123 |
-
}
|
124 |
-
}
|
125 |
-
}
|
126 |
-
}
|
127 |
-
function tcmp_ui_editor() {
|
128 |
-
global $tcmp;
|
129 |
-
|
130 |
-
$tcmp->Form->prefix='Editor';
|
131 |
-
$id=TCMP_ISQS('id', 0);
|
132 |
-
if($id==0 && $tcmp->Manager->isLimitReached(FALSE)) {
|
133 |
-
$tcmp->Utils->redirect(TCMP_TAB_MANAGER_URI);
|
134 |
-
}
|
135 |
-
|
136 |
-
$snippet=$tcmp->Manager->get($id, TRUE);
|
137 |
-
if (wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_nonce')) {
|
138 |
-
foreach ($snippet as $k=>$v) {
|
139 |
-
$snippet[$k]=TCMP_QS($k);
|
140 |
-
if (is_string($snippet[$k])) {
|
141 |
-
$snippet[$k]=stripslashes($snippet[$k]);
|
142 |
-
}
|
143 |
-
}
|
144 |
-
|
145 |
-
tcmp_ui_editor_check($snippet);
|
146 |
-
if (!$tcmp->Options->hasErrorMessages()) {
|
147 |
-
$snippet=$tcmp->Manager->put($snippet['id'], $snippet);
|
148 |
-
/*if ($id <= 0) {
|
149 |
-
$tcmp->Options->pushSuccessMessage('Editor.Add', $snippet['id'], $snippet['name']);
|
150 |
-
$snippet=$tcmp->Manager->get('', TRUE);
|
151 |
-
} else {
|
152 |
-
$tcmp->Utils->redirect(TCMP_PAGE_MANAGER.'&id='.$id);
|
153 |
-
exit();
|
154 |
-
}*/
|
155 |
-
$id=$snippet['id'];
|
156 |
-
$tcmp->Utils->redirect(TCMP_PAGE_MANAGER.'&id='.$id); }
|
157 |
-
}
|
158 |
-
$tcmp->Options->writeMessages()
|
159 |
-
?>
|
160 |
-
<script>
|
161 |
-
jQuery(function(){
|
162 |
-
//enable/disable some part of except creating coherence
|
163 |
-
function tcmCheckVisible() {
|
164 |
-
var $mode=jQuery('[name=trackMode]:checked');
|
165 |
-
var showTrackCode=false;
|
166 |
-
var showTrackConversion=false;
|
167 |
-
if($mode.length>0) {
|
168 |
-
if(parseInt($mode.val())!=<?php echo TCMP_TRACK_MODE_CODE ?>) {
|
169 |
-
showTrackConversion=true;
|
170 |
-
jQuery('#position-box').hide();
|
171 |
-
|
172 |
-
tcmShowHide('.box-track-conversion', false);
|
173 |
-
tcmShowHide('#box-track-conversion-'+$mode.val(), true);
|
174 |
-
} else {
|
175 |
-
showTrackCode=true;
|
176 |
-
jQuery('#position-box').show();
|
177 |
-
}
|
178 |
-
}
|
179 |
-
tcmShowHide('#box-track-conversion', showTrackConversion);
|
180 |
-
tcmShowHide('#box-track-code', showTrackCode);
|
181 |
-
|
182 |
-
var $all=jQuery('[name=trackPage]:checked');
|
183 |
-
if($all.length>0 && parseInt($all.val())==<?php echo TCMP_TRACK_PAGE_SPECIFIC ?>) {
|
184 |
-
showExcept=false;
|
185 |
-
jQuery('[type=checkbox]').each(function() {
|
186 |
-
var $check=jQuery(this);
|
187 |
-
var id=TCMP.attr($check, 'id', '');
|
188 |
-
if(TCMP.startsWith(id, 'include')) {
|
189 |
-
var $select=id.replace('_Active', '');
|
190 |
-
$select=TCMP.jQuery($select);
|
191 |
-
|
192 |
-
isCheck=$check.is(':checked');
|
193 |
-
selection=$select.select2('val');
|
194 |
-
found=false;
|
195 |
-
for(i=0; i<selection.length; i++) {
|
196 |
-
if(parseInt(selection[i])==-1){
|
197 |
-
found=true;
|
198 |
-
}
|
199 |
-
}
|
200 |
-
|
201 |
-
var $except=id.replace('_Active', '');
|
202 |
-
$except=$except.replace('Active', '')+'Box';
|
203 |
-
$except=$except.substr('include'.length);
|
204 |
-
$except='except'+$except;
|
205 |
-
$except=jQuery('[id='+$except+']');
|
206 |
-
|
207 |
-
if(found) {
|
208 |
-
showExcept=true;
|
209 |
-
if($except.length>0) {
|
210 |
-
$except.show();
|
211 |
-
}
|
212 |
-
} else {
|
213 |
-
if($except.length>0) {
|
214 |
-
$except.hide();
|
215 |
-
}
|
216 |
-
}
|
217 |
-
}
|
218 |
-
});
|
219 |
-
}
|
220 |
-
|
221 |
-
showInclude=false;
|
222 |
-
if($all.length==0) {
|
223 |
-
showExcept=false;
|
224 |
-
} else {
|
225 |
-
if(parseInt($all.val())==<?php echo TCMP_TRACK_PAGE_ALL ?>) {
|
226 |
-
showExcept=true;
|
227 |
-
} else {
|
228 |
-
showInclude=true;
|
229 |
-
}
|
230 |
-
}
|
231 |
-
tcmShowHide('#tcmp-except-div', showExcept);
|
232 |
-
tcmShowHide('#tcmp-include-div', showInclude);
|
233 |
-
}
|
234 |
-
function tcmShowHide(selector, show) {
|
235 |
-
$selector=jQuery(selector);
|
236 |
-
if(show) {
|
237 |
-
$selector.show();
|
238 |
-
} else {
|
239 |
-
$selector.hide();
|
240 |
-
}
|
241 |
-
}
|
242 |
-
|
243 |
-
/*jQuery(".tcmTags").select2({
|
244 |
-
placeholder: "Type here..."
|
245 |
-
, theme: "classic"
|
246 |
-
}).on('change', function() {
|
247 |
-
tcmCheckVisible();
|
248 |
-
});*/
|
249 |
-
jQuery('.tcmLineTags,.tcmp-dropdown').select2({
|
250 |
-
placeholder: "Type here..."
|
251 |
-
, theme: "classic"
|
252 |
-
, width: '550px'
|
253 |
-
});
|
254 |
-
|
255 |
-
jQuery('.tcmp-hideShow').click(function() {
|
256 |
-
tcmCheckVisible();
|
257 |
-
});
|
258 |
-
jQuery('.tcmp-hideShow, input[type=checkbox], input[type=radio]').change(function() {
|
259 |
-
tcmCheckVisible();
|
260 |
-
});
|
261 |
-
jQuery('.tcmLineTags').on('change', function() {
|
262 |
-
tcmCheckVisible();
|
263 |
-
});
|
264 |
-
tcmCheckVisible();
|
265 |
-
});
|
266 |
-
</script>
|
267 |
-
<?php
|
268 |
-
|
269 |
-
$tcmp->Form->formStarts();
|
270 |
-
$tcmp->Form->hidden('id', $snippet);
|
271 |
-
$tcmp->Form->hidden('order', $snippet);
|
272 |
-
|
273 |
-
$tcmp->Form->checkbox('active', $snippet);
|
274 |
-
$tcmp->Form->text('name', $snippet);
|
275 |
-
$tcmp->Form->editor('code', $snippet);
|
276 |
-
|
277 |
-
$values=array(TCMP_POSITION_HEAD, TCMP_POSITION_BODY, TCMP_POSITION_FOOTER);
|
278 |
-
$tcmp->Form->dropdown('position', $snippet, $values, FALSE);
|
279 |
-
$values=array(TCMP_DEVICE_TYPE_ALL, TCMP_DEVICE_TYPE_DESKTOP, TCMP_DEVICE_TYPE_MOBILE, TCMP_DEVICE_TYPE_TABLET);
|
280 |
-
$tcmp->Form->dropdown('deviceType', $snippet, $values, TRUE);
|
281 |
-
|
282 |
-
$args=array('id'=>'box-track-mode');
|
283 |
-
$tcmp->Form->divStarts($args);
|
284 |
-
{
|
285 |
-
$tcmp->Form->p('Where do you want to add this code?');
|
286 |
-
$tcmp->Form->radio('trackMode', $snippet['trackMode'], TCMP_TRACK_MODE_CODE);
|
287 |
-
$plugins=$tcmp->Ecommerce->getActivePlugins();
|
288 |
-
if(count($plugins)==0) {
|
289 |
-
$plugins=array('Ecommerce'=>array(
|
290 |
-
'name'=>'Ecommerce'
|
291 |
-
, 'id'=>TCMP_PLUGINS_NO_PLUGINS
|
292 |
-
, 'version'=>'')
|
293 |
-
);
|
294 |
-
}
|
295 |
-
$tcmp->Form->tagNew=TRUE;
|
296 |
-
foreach($plugins as $k=>$v) {
|
297 |
-
$ecommerce=$v['name'];
|
298 |
-
if(isset($v['version']) && $v['version']!='') {
|
299 |
-
$ecommerce.=' (v.'.$v['version'].')';
|
300 |
-
}
|
301 |
-
$args=array('label'=>$tcmp->Lang->L('Editor.trackMode_1', $ecommerce));
|
302 |
-
$tcmp->Form->radio('trackMode', $snippet['trackMode'], $v['id'], $args);
|
303 |
-
}
|
304 |
-
$tcmp->Form->tagNew=FALSE;
|
305 |
-
|
306 |
-
}
|
307 |
-
$tcmp->Form->divEnds();
|
308 |
-
|
309 |
-
$args=array('id'=>'box-track-conversion');
|
310 |
-
$tcmp->Form->divStarts($args);
|
311 |
-
{
|
312 |
-
$tcmp->Form->p('ConversionProductQuestion');
|
313 |
-
?>
|
314 |
-
<p style="font-style: italic;"><?php $tcmp->Lang->P('Editor.PositionBlocked') ?></p>
|
315 |
-
<?php
|
316 |
-
foreach($plugins as $k=>$v) {
|
317 |
-
$args=array('id'=>'box-track-conversion-'.$v['id'], 'class'=>'box-track-conversion');
|
318 |
-
$tcmp->Form->divStarts($args);
|
319 |
-
{
|
320 |
-
if($v['id']==TCMP_PLUGINS_NO_PLUGINS) {
|
321 |
-
$plugins=$tcmp->Ecommerce->getPlugins(FALSE);
|
322 |
-
$ecommerce='';
|
323 |
-
foreach($plugins as $k=>$v) {
|
324 |
-
if($ecommerce!='') {
|
325 |
-
$ecommerce.=', ';
|
326 |
-
}
|
327 |
-
$ecommerce.=$k;
|
328 |
-
}
|
329 |
-
$tcmp->Options->pushErrorMessage('Editor.NoEcommerceFound', $ecommerce);
|
330 |
-
$tcmp->Options->writeMessages();
|
331 |
-
} else {
|
332 |
-
$postType=$tcmp->Ecommerce->getCustomPostType($v['id']);
|
333 |
-
$keyActive='CTC_'.$v['id'].'_Active';
|
334 |
-
$label=$tcmp->Lang->L('Editor.EcommerceCheck', $v['name'], $v['version']);
|
335 |
-
|
336 |
-
if($postType!='') {
|
337 |
-
$args=array('post_type'=>$postType, 'all'=>TRUE);
|
338 |
-
$values=$tcmp->Utils->query(TCMP_QUERY_POSTS_OF_TYPE, $args);
|
339 |
-
$keyArray='CTC_'.$v['id'].'_ProductsIds';
|
340 |
-
if(count($snippet[$keyArray])==0) {
|
341 |
-
//when enabled default selected -1
|
342 |
-
$snippet[$keyArray]=array(-1);
|
343 |
-
}
|
344 |
-
|
345 |
-
$args=array('label'=>$label, 'class'=>'tcmp-select tcmLineTags');
|
346 |
-
$tcmp->Form->labels=FALSE;
|
347 |
-
$tcmp->Form->dropdown($keyArray, $snippet[$keyArray], $values, TRUE, $args);
|
348 |
-
$tcmp->Form->labels=TRUE;
|
349 |
-
} else {
|
350 |
-
$args=array('label'=>$label);
|
351 |
-
$tcmp->Form->checkbox($keyActive, $snippet[$keyActive], 1, $args);
|
352 |
-
}
|
353 |
-
}
|
354 |
-
}
|
355 |
-
$tcmp->Form->divEnds();
|
356 |
-
|
357 |
-
$tcmp->Form->br();
|
358 |
-
$tcmp->Form->i('ConversionDynamicFields');
|
359 |
-
$tcmp->Form->br();
|
360 |
-
$tcmp->Form->br();
|
361 |
-
}
|
362 |
-
}
|
363 |
-
$tcmp->Form->divEnds();
|
364 |
-
|
365 |
-
$args=array('id'=>'box-track-code');
|
366 |
-
$tcmp->Form->divStarts($args);
|
367 |
-
{
|
368 |
-
$tcmp->Form->p('In which page do you want to insert this code?');
|
369 |
-
$tcmp->Form->radio('trackPage', $snippet['trackPage'], TCMP_TRACK_PAGE_ALL);
|
370 |
-
$tcmp->Form->radio('trackPage', $snippet['trackPage'], TCMP_TRACK_PAGE_SPECIFIC);
|
371 |
-
|
372 |
-
//, 'style'=>'margin-top:10px;'
|
373 |
-
$args=array('id'=>'tcmp-include-div');
|
374 |
-
$tcmp->Form->divStarts($args);
|
375 |
-
{
|
376 |
-
$tcmp->Form->p('Include tracking code in which pages?');
|
377 |
-
tcmp_formOptions('include', $snippet);
|
378 |
-
}
|
379 |
-
$tcmp->Form->divEnds();
|
380 |
-
|
381 |
-
$args=array('id'=>'tcmp-except-div');
|
382 |
-
$tcmp->Form->divStarts($args);
|
383 |
-
{
|
384 |
-
$tcmp->Form->p('Do you want to exclude some specific pages?');
|
385 |
-
tcmp_formOptions('except', $snippet);
|
386 |
-
}
|
387 |
-
$tcmp->Form->divEnds();
|
388 |
-
}
|
389 |
-
$tcmp->Form->divEnds();
|
390 |
-
|
391 |
-
$tcmp->Form->nonce('tcmp_nonce', 'tcmp_nonce');
|
392 |
-
tcmp_notice_pro_features();
|
393 |
-
$tcmp->Form->submit('Save');
|
394 |
-
$tcmp->Form->formEnds();
|
395 |
-
}
|
396 |
-
|
397 |
-
function tcmp_formOptions($prefix, $snippet) {
|
398 |
-
global $tcmp;
|
399 |
-
|
400 |
-
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
401 |
-
foreach($types as $v) {
|
402 |
-
$args=array('post_type'=>$v['id'], 'all'=>TRUE);
|
403 |
-
$values=$tcmp->Utils->query(TCMP_QUERY_POSTS_OF_TYPE, $args);
|
404 |
-
//$tcmp->Form->premium=!in_array($v['name'], array('post', 'page'));
|
405 |
-
|
406 |
-
$keyActive=$prefix.'PostsOfType_'.$v['id'].'_Active';
|
407 |
-
$keyArray=$prefix.'PostsOfType_'.$v['id'];
|
408 |
-
if($snippet[$keyActive]==0 && count($snippet[$keyArray])==0 && $prefix!='except') {
|
409 |
-
//when enabled default selected -1
|
410 |
-
$snippet[$keyArray]=array(-1);
|
411 |
-
}
|
412 |
-
$tcmp->Form->checkSelect($keyActive, $keyArray, $snippet, $values);
|
413 |
-
}
|
414 |
-
}
|
1 |
+
<?php
|
2 |
+
function tcmp_notice_pro_features() {
|
3 |
+
global $tcmp;
|
4 |
+
?>
|
5 |
+
<br/>
|
6 |
+
<div class="message updated below-h2 iwp">
|
7 |
+
<div style="height:10px;"></div>
|
8 |
+
<?php
|
9 |
+
$i=1;
|
10 |
+
while($tcmp->Lang->H('Notice.ProHeader'.$i)) {
|
11 |
+
$tcmp->Lang->P('Notice.ProHeader'.$i);
|
12 |
+
echo '<br/>';
|
13 |
+
++$i;
|
14 |
+
}
|
15 |
+
$i=1;
|
16 |
+
?>
|
17 |
+
<br/>
|
18 |
+
<?php
|
19 |
+
|
20 |
+
/*$options = array('public' => TRUE, '_builtin' => FALSE);
|
21 |
+
$q=get_post_types($options, 'names');
|
22 |
+
if(is_array($q) && count($q)>0) {
|
23 |
+
sort($q);
|
24 |
+
$q=implode(', ', $q);
|
25 |
+
$q='(<b>'.$q.'</b>)';
|
26 |
+
} else {
|
27 |
+
$q='';
|
28 |
+
}*/
|
29 |
+
$q='';
|
30 |
+
while($tcmp->Lang->H('Notice.ProFeature'.$i)) { ?>
|
31 |
+
<div style="clear:both; margin-top: 2px;"></div>
|
32 |
+
<div style="float:left; vertical-align:middle; height:24px; margin-right:5px; margin-top:-5px;">
|
33 |
+
<img src="<?php echo TCMP_PLUGIN_IMAGES_URI?>tick.png" />
|
34 |
+
</div>
|
35 |
+
<div style="float:left; vertical-align:middle; height:24px;">
|
36 |
+
<?php $tcmp->Lang->P('Notice.ProFeature'.$i, $q)?>
|
37 |
+
</div>
|
38 |
+
<?php ++$i;
|
39 |
+
}
|
40 |
+
?>
|
41 |
+
<div style="clear:both;"></div>
|
42 |
+
<div style="height:10px;"></div>
|
43 |
+
<div style="float:right;">
|
44 |
+
<?php
|
45 |
+
$url=TCMP_PAGE_PREMIUM.'?utm_source=free-users&utm_medium=wp-cta&utm_campaign=wp-plugin';
|
46 |
+
?>
|
47 |
+
<a href="<?php echo $url?>" target="_blank">
|
48 |
+
<b><?php $tcmp->Lang->P('Notice.ProCTA')?></b>
|
49 |
+
</a>
|
50 |
+
</div>
|
51 |
+
<div style="height:10px; clear:both;"></div>
|
52 |
+
</div>
|
53 |
+
<br/>
|
54 |
+
<?php }
|
55 |
+
function tcmp_ui_editor_check($snippet) {
|
56 |
+
global $tcmp;
|
57 |
+
|
58 |
+
$snippet['trackMode']=intval($snippet['trackMode']);
|
59 |
+
$snippet['trackPage']=intval($snippet['trackPage']);
|
60 |
+
|
61 |
+
$snippet['includeEverywhereActive']=0;
|
62 |
+
if($snippet['trackPage']==TCMP_TRACK_PAGE_ALL) {
|
63 |
+
$snippet['includeEverywhereActive']=1;
|
64 |
+
}
|
65 |
+
$snippet=$tcmp->Manager->sanitize($snippet['id'], $snippet);
|
66 |
+
|
67 |
+
if ($snippet['name'] == '') {
|
68 |
+
$tcmp->Options->pushErrorMessage('Please enter a unique name');
|
69 |
+
} else {
|
70 |
+
$exist=$tcmp->Manager->exists($snippet['name']);
|
71 |
+
if ($exist && $exist['id'] != $snippet['id']) {
|
72 |
+
//nonostante il tutto il nome deve essee univoco
|
73 |
+
$tcmp->Options->pushErrorMessage('You have entered a name that already exists. IDs are NOT case-sensitive');
|
74 |
+
}
|
75 |
+
}
|
76 |
+
if ($snippet['code'] == '') {
|
77 |
+
$tcmp->Options->pushErrorMessage('Paste your HTML Tracking Code into the textarea');
|
78 |
+
}
|
79 |
+
|
80 |
+
if($snippet['trackMode']==TCMP_TRACK_MODE_CODE) {
|
81 |
+
|
82 |
+
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
83 |
+
if($snippet['trackPage']==TCMP_TRACK_PAGE_SPECIFIC) {
|
84 |
+
foreach ($types as $v) {
|
85 |
+
$includeActiveKey='includePostsOfType_'.$v['id'].'_Active';
|
86 |
+
$includeArrayKey='includePostsOfType_'.$v['id'];
|
87 |
+
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
88 |
+
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
89 |
+
|
90 |
+
if ($snippet[$includeActiveKey] == 1 && $snippet[$exceptActiveKey] == 1) {
|
91 |
+
if (in_array(-1, $snippet[$includeArrayKey]) && in_array(-1, $snippet[$exceptArrayKey])) {
|
92 |
+
$tcmp->Options->pushErrorMessage('Error.IncludeExcludeAll', $v['name']);
|
93 |
+
}
|
94 |
+
}
|
95 |
+
if ($snippet[$includeActiveKey] == 1 && count($snippet[$includeArrayKey]) == 0) {
|
96 |
+
$tcmp->Options->pushErrorMessage('Error.IncludeSelectAtLeastOne', $v['name']);
|
97 |
+
}
|
98 |
+
}
|
99 |
+
|
100 |
+
//second loop to respect the display order
|
101 |
+
foreach ($types as $v) {
|
102 |
+
$includeActiveKey='includePostsOfType_'.$v['id'].'_Active';
|
103 |
+
$includeArrayKey='includePostsOfType_'.$v['id'];
|
104 |
+
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
105 |
+
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
106 |
+
|
107 |
+
if ($snippet[$includeActiveKey] == 1 && in_array(-1, $snippet[$includeArrayKey])) {
|
108 |
+
if ($snippet[$exceptActiveKey] == 1 && count($snippet[$exceptArrayKey]) == 0) {
|
109 |
+
$tcmp->Options->pushErrorMessage('Error.ExcludeSelectAtLeastOne', $v['name']);
|
110 |
+
}
|
111 |
+
}
|
112 |
+
}
|
113 |
+
} else {
|
114 |
+
foreach($types as $v) {
|
115 |
+
$exceptActiveKey='exceptPostsOfType_'.$v['id'].'_Active';
|
116 |
+
$exceptArrayKey='exceptPostsOfType_'.$v['id'];
|
117 |
+
|
118 |
+
if(isset($snippet[$exceptActiveKey])
|
119 |
+
&& $snippet[$exceptActiveKey]==1
|
120 |
+
&& count($snippet[$exceptArrayKey])==0) {
|
121 |
+
$tcmp->Options->pushErrorMessage('Error.ExcludeSelectAtLeastOne', $v['name']);
|
122 |
+
}
|
123 |
+
}
|
124 |
+
}
|
125 |
+
}
|
126 |
+
}
|
127 |
+
function tcmp_ui_editor() {
|
128 |
+
global $tcmp;
|
129 |
+
|
130 |
+
$tcmp->Form->prefix='Editor';
|
131 |
+
$id=TCMP_ISQS('id', 0);
|
132 |
+
if($id==0 && $tcmp->Manager->isLimitReached(FALSE)) {
|
133 |
+
$tcmp->Utils->redirect(TCMP_TAB_MANAGER_URI);
|
134 |
+
}
|
135 |
+
|
136 |
+
$snippet=$tcmp->Manager->get($id, TRUE);
|
137 |
+
if (wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_nonce')) {
|
138 |
+
foreach ($snippet as $k=>$v) {
|
139 |
+
$snippet[$k]=TCMP_QS($k);
|
140 |
+
if (is_string($snippet[$k])) {
|
141 |
+
$snippet[$k]=stripslashes($snippet[$k]);
|
142 |
+
}
|
143 |
+
}
|
144 |
+
|
145 |
+
tcmp_ui_editor_check($snippet);
|
146 |
+
if (!$tcmp->Options->hasErrorMessages()) {
|
147 |
+
$snippet=$tcmp->Manager->put($snippet['id'], $snippet);
|
148 |
+
/*if ($id <= 0) {
|
149 |
+
$tcmp->Options->pushSuccessMessage('Editor.Add', $snippet['id'], $snippet['name']);
|
150 |
+
$snippet=$tcmp->Manager->get('', TRUE);
|
151 |
+
} else {
|
152 |
+
$tcmp->Utils->redirect(TCMP_PAGE_MANAGER.'&id='.$id);
|
153 |
+
exit();
|
154 |
+
}*/
|
155 |
+
$id=$snippet['id'];
|
156 |
+
$tcmp->Utils->redirect(TCMP_PAGE_MANAGER.'&id='.$id); }
|
157 |
+
}
|
158 |
+
$tcmp->Options->writeMessages()
|
159 |
+
?>
|
160 |
+
<script>
|
161 |
+
jQuery(function(){
|
162 |
+
//enable/disable some part of except creating coherence
|
163 |
+
function tcmCheckVisible() {
|
164 |
+
var $mode=jQuery('[name=trackMode]:checked');
|
165 |
+
var showTrackCode=false;
|
166 |
+
var showTrackConversion=false;
|
167 |
+
if($mode.length>0) {
|
168 |
+
if(parseInt($mode.val())!=<?php echo TCMP_TRACK_MODE_CODE ?>) {
|
169 |
+
showTrackConversion=true;
|
170 |
+
jQuery('#position-box').hide();
|
171 |
+
|
172 |
+
tcmShowHide('.box-track-conversion', false);
|
173 |
+
tcmShowHide('#box-track-conversion-'+$mode.val(), true);
|
174 |
+
} else {
|
175 |
+
showTrackCode=true;
|
176 |
+
jQuery('#position-box').show();
|
177 |
+
}
|
178 |
+
}
|
179 |
+
tcmShowHide('#box-track-conversion', showTrackConversion);
|
180 |
+
tcmShowHide('#box-track-code', showTrackCode);
|
181 |
+
|
182 |
+
var $all=jQuery('[name=trackPage]:checked');
|
183 |
+
if($all.length>0 && parseInt($all.val())==<?php echo TCMP_TRACK_PAGE_SPECIFIC ?>) {
|
184 |
+
showExcept=false;
|
185 |
+
jQuery('[type=checkbox]').each(function() {
|
186 |
+
var $check=jQuery(this);
|
187 |
+
var id=TCMP.attr($check, 'id', '');
|
188 |
+
if(TCMP.startsWith(id, 'include')) {
|
189 |
+
var $select=id.replace('_Active', '');
|
190 |
+
$select=TCMP.jQuery($select);
|
191 |
+
|
192 |
+
isCheck=$check.is(':checked');
|
193 |
+
selection=$select.select2('val');
|
194 |
+
found=false;
|
195 |
+
for(i=0; i<selection.length; i++) {
|
196 |
+
if(parseInt(selection[i])==-1){
|
197 |
+
found=true;
|
198 |
+
}
|
199 |
+
}
|
200 |
+
|
201 |
+
var $except=id.replace('_Active', '');
|
202 |
+
$except=$except.replace('Active', '')+'Box';
|
203 |
+
$except=$except.substr('include'.length);
|
204 |
+
$except='except'+$except;
|
205 |
+
$except=jQuery('[id='+$except+']');
|
206 |
+
|
207 |
+
if(found) {
|
208 |
+
showExcept=true;
|
209 |
+
if($except.length>0) {
|
210 |
+
$except.show();
|
211 |
+
}
|
212 |
+
} else {
|
213 |
+
if($except.length>0) {
|
214 |
+
$except.hide();
|
215 |
+
}
|
216 |
+
}
|
217 |
+
}
|
218 |
+
});
|
219 |
+
}
|
220 |
+
|
221 |
+
showInclude=false;
|
222 |
+
if($all.length==0) {
|
223 |
+
showExcept=false;
|
224 |
+
} else {
|
225 |
+
if(parseInt($all.val())==<?php echo TCMP_TRACK_PAGE_ALL ?>) {
|
226 |
+
showExcept=true;
|
227 |
+
} else {
|
228 |
+
showInclude=true;
|
229 |
+
}
|
230 |
+
}
|
231 |
+
tcmShowHide('#tcmp-except-div', showExcept);
|
232 |
+
tcmShowHide('#tcmp-include-div', showInclude);
|
233 |
+
}
|
234 |
+
function tcmShowHide(selector, show) {
|
235 |
+
$selector=jQuery(selector);
|
236 |
+
if(show) {
|
237 |
+
$selector.show();
|
238 |
+
} else {
|
239 |
+
$selector.hide();
|
240 |
+
}
|
241 |
+
}
|
242 |
+
|
243 |
+
/*jQuery(".tcmTags").select2({
|
244 |
+
placeholder: "Type here..."
|
245 |
+
, theme: "classic"
|
246 |
+
}).on('change', function() {
|
247 |
+
tcmCheckVisible();
|
248 |
+
});*/
|
249 |
+
jQuery('.tcmLineTags,.tcmp-dropdown').select2({
|
250 |
+
placeholder: "Type here..."
|
251 |
+
, theme: "classic"
|
252 |
+
, width: '550px'
|
253 |
+
});
|
254 |
+
|
255 |
+
jQuery('.tcmp-hideShow').click(function() {
|
256 |
+
tcmCheckVisible();
|
257 |
+
});
|
258 |
+
jQuery('.tcmp-hideShow, input[type=checkbox], input[type=radio]').change(function() {
|
259 |
+
tcmCheckVisible();
|
260 |
+
});
|
261 |
+
jQuery('.tcmLineTags').on('change', function() {
|
262 |
+
tcmCheckVisible();
|
263 |
+
});
|
264 |
+
tcmCheckVisible();
|
265 |
+
});
|
266 |
+
</script>
|
267 |
+
<?php
|
268 |
+
|
269 |
+
$tcmp->Form->formStarts();
|
270 |
+
$tcmp->Form->hidden('id', $snippet);
|
271 |
+
$tcmp->Form->hidden('order', $snippet);
|
272 |
+
|
273 |
+
$tcmp->Form->checkbox('active', $snippet);
|
274 |
+
$tcmp->Form->text('name', $snippet);
|
275 |
+
$tcmp->Form->editor('code', $snippet);
|
276 |
+
|
277 |
+
$values=array(TCMP_POSITION_HEAD, TCMP_POSITION_BODY, TCMP_POSITION_FOOTER);
|
278 |
+
$tcmp->Form->dropdown('position', $snippet, $values, FALSE);
|
279 |
+
$values=array(TCMP_DEVICE_TYPE_ALL, TCMP_DEVICE_TYPE_DESKTOP, TCMP_DEVICE_TYPE_MOBILE, TCMP_DEVICE_TYPE_TABLET);
|
280 |
+
$tcmp->Form->dropdown('deviceType', $snippet, $values, TRUE);
|
281 |
+
|
282 |
+
$args=array('id'=>'box-track-mode');
|
283 |
+
$tcmp->Form->divStarts($args);
|
284 |
+
{
|
285 |
+
$tcmp->Form->p('Where do you want to add this code?');
|
286 |
+
$tcmp->Form->radio('trackMode', $snippet['trackMode'], TCMP_TRACK_MODE_CODE);
|
287 |
+
$plugins=$tcmp->Ecommerce->getActivePlugins();
|
288 |
+
if(count($plugins)==0) {
|
289 |
+
$plugins=array('Ecommerce'=>array(
|
290 |
+
'name'=>'Ecommerce'
|
291 |
+
, 'id'=>TCMP_PLUGINS_NO_PLUGINS
|
292 |
+
, 'version'=>'')
|
293 |
+
);
|
294 |
+
}
|
295 |
+
$tcmp->Form->tagNew=TRUE;
|
296 |
+
foreach($plugins as $k=>$v) {
|
297 |
+
$ecommerce=$v['name'];
|
298 |
+
if(isset($v['version']) && $v['version']!='') {
|
299 |
+
$ecommerce.=' (v.'.$v['version'].')';
|
300 |
+
}
|
301 |
+
$args=array('label'=>$tcmp->Lang->L('Editor.trackMode_1', $ecommerce));
|
302 |
+
$tcmp->Form->radio('trackMode', $snippet['trackMode'], $v['id'], $args);
|
303 |
+
}
|
304 |
+
$tcmp->Form->tagNew=FALSE;
|
305 |
+
|
306 |
+
}
|
307 |
+
$tcmp->Form->divEnds();
|
308 |
+
|
309 |
+
$args=array('id'=>'box-track-conversion');
|
310 |
+
$tcmp->Form->divStarts($args);
|
311 |
+
{
|
312 |
+
$tcmp->Form->p('ConversionProductQuestion');
|
313 |
+
?>
|
314 |
+
<p style="font-style: italic;"><?php $tcmp->Lang->P('Editor.PositionBlocked') ?></p>
|
315 |
+
<?php
|
316 |
+
foreach($plugins as $k=>$v) {
|
317 |
+
$args=array('id'=>'box-track-conversion-'.$v['id'], 'class'=>'box-track-conversion');
|
318 |
+
$tcmp->Form->divStarts($args);
|
319 |
+
{
|
320 |
+
if($v['id']==TCMP_PLUGINS_NO_PLUGINS) {
|
321 |
+
$plugins=$tcmp->Ecommerce->getPlugins(FALSE);
|
322 |
+
$ecommerce='';
|
323 |
+
foreach($plugins as $k=>$v) {
|
324 |
+
if($ecommerce!='') {
|
325 |
+
$ecommerce.=', ';
|
326 |
+
}
|
327 |
+
$ecommerce.=$k;
|
328 |
+
}
|
329 |
+
$tcmp->Options->pushErrorMessage('Editor.NoEcommerceFound', $ecommerce);
|
330 |
+
$tcmp->Options->writeMessages();
|
331 |
+
} else {
|
332 |
+
$postType=$tcmp->Ecommerce->getCustomPostType($v['id']);
|
333 |
+
$keyActive='CTC_'.$v['id'].'_Active';
|
334 |
+
$label=$tcmp->Lang->L('Editor.EcommerceCheck', $v['name'], $v['version']);
|
335 |
+
|
336 |
+
if($postType!='') {
|
337 |
+
$args=array('post_type'=>$postType, 'all'=>TRUE);
|
338 |
+
$values=$tcmp->Utils->query(TCMP_QUERY_POSTS_OF_TYPE, $args);
|
339 |
+
$keyArray='CTC_'.$v['id'].'_ProductsIds';
|
340 |
+
if(count($snippet[$keyArray])==0) {
|
341 |
+
//when enabled default selected -1
|
342 |
+
$snippet[$keyArray]=array(-1);
|
343 |
+
}
|
344 |
+
|
345 |
+
$args=array('label'=>$label, 'class'=>'tcmp-select tcmLineTags');
|
346 |
+
$tcmp->Form->labels=FALSE;
|
347 |
+
$tcmp->Form->dropdown($keyArray, $snippet[$keyArray], $values, TRUE, $args);
|
348 |
+
$tcmp->Form->labels=TRUE;
|
349 |
+
} else {
|
350 |
+
$args=array('label'=>$label);
|
351 |
+
$tcmp->Form->checkbox($keyActive, $snippet[$keyActive], 1, $args);
|
352 |
+
}
|
353 |
+
}
|
354 |
+
}
|
355 |
+
$tcmp->Form->divEnds();
|
356 |
+
|
357 |
+
$tcmp->Form->br();
|
358 |
+
$tcmp->Form->i('ConversionDynamicFields');
|
359 |
+
$tcmp->Form->br();
|
360 |
+
$tcmp->Form->br();
|
361 |
+
}
|
362 |
+
}
|
363 |
+
$tcmp->Form->divEnds();
|
364 |
+
|
365 |
+
$args=array('id'=>'box-track-code');
|
366 |
+
$tcmp->Form->divStarts($args);
|
367 |
+
{
|
368 |
+
$tcmp->Form->p('In which page do you want to insert this code?');
|
369 |
+
$tcmp->Form->radio('trackPage', $snippet['trackPage'], TCMP_TRACK_PAGE_ALL);
|
370 |
+
$tcmp->Form->radio('trackPage', $snippet['trackPage'], TCMP_TRACK_PAGE_SPECIFIC);
|
371 |
+
|
372 |
+
//, 'style'=>'margin-top:10px;'
|
373 |
+
$args=array('id'=>'tcmp-include-div');
|
374 |
+
$tcmp->Form->divStarts($args);
|
375 |
+
{
|
376 |
+
$tcmp->Form->p('Include tracking code in which pages?');
|
377 |
+
tcmp_formOptions('include', $snippet);
|
378 |
+
}
|
379 |
+
$tcmp->Form->divEnds();
|
380 |
+
|
381 |
+
$args=array('id'=>'tcmp-except-div');
|
382 |
+
$tcmp->Form->divStarts($args);
|
383 |
+
{
|
384 |
+
$tcmp->Form->p('Do you want to exclude some specific pages?');
|
385 |
+
tcmp_formOptions('except', $snippet);
|
386 |
+
}
|
387 |
+
$tcmp->Form->divEnds();
|
388 |
+
}
|
389 |
+
$tcmp->Form->divEnds();
|
390 |
+
|
391 |
+
$tcmp->Form->nonce('tcmp_nonce', 'tcmp_nonce');
|
392 |
+
tcmp_notice_pro_features();
|
393 |
+
$tcmp->Form->submit('Save');
|
394 |
+
$tcmp->Form->formEnds();
|
395 |
+
}
|
396 |
+
|
397 |
+
function tcmp_formOptions($prefix, $snippet) {
|
398 |
+
global $tcmp;
|
399 |
+
|
400 |
+
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
401 |
+
foreach($types as $v) {
|
402 |
+
$args=array('post_type'=>$v['id'], 'all'=>TRUE);
|
403 |
+
$values=$tcmp->Utils->query(TCMP_QUERY_POSTS_OF_TYPE, $args);
|
404 |
+
//$tcmp->Form->premium=!in_array($v['name'], array('post', 'page'));
|
405 |
+
|
406 |
+
$keyActive=$prefix.'PostsOfType_'.$v['id'].'_Active';
|
407 |
+
$keyArray=$prefix.'PostsOfType_'.$v['id'];
|
408 |
+
if($snippet[$keyActive]==0 && count($snippet[$keyArray])==0 && $prefix!='except') {
|
409 |
+
//when enabled default selected -1
|
410 |
+
$snippet[$keyArray]=array(-1);
|
411 |
+
}
|
412 |
+
$tcmp->Form->checkSelect($keyActive, $keyArray, $snippet, $values);
|
413 |
+
}
|
414 |
+
}
|
includes/admin/manager.php
CHANGED
@@ -1,202 +1,202 @@
|
|
1 |
-
<?php
|
2 |
-
//column renderer
|
3 |
-
function tcmp_ui_manager_column($active, $values=NULL, $hide=FALSE) {
|
4 |
-
global $tcmp;
|
5 |
-
?>
|
6 |
-
<td style="text-align:center;">
|
7 |
-
<?php
|
8 |
-
if($hide) {
|
9 |
-
$text='-';
|
10 |
-
} else {
|
11 |
-
if($active) {
|
12 |
-
$text='<span style="font-weight:bold; color:green">'.$tcmp->Lang->L('Yes').'</span>';
|
13 |
-
} else {
|
14 |
-
$text='<span style="font-weight:bold; color:red">'.$tcmp->Lang->L('No').'</span>';
|
15 |
-
}
|
16 |
-
if($active && $values) {
|
17 |
-
if(!is_array($values)) {
|
18 |
-
$text.=' {'.$values.'}';
|
19 |
-
} elseif(count($values)>0) {
|
20 |
-
$what=implode(',', $values);
|
21 |
-
if($what!='') {
|
22 |
-
$text.=' ['.$what.']';
|
23 |
-
}
|
24 |
-
}
|
25 |
-
}
|
26 |
-
}
|
27 |
-
echo $text;
|
28 |
-
?>
|
29 |
-
</td>
|
30 |
-
<?php
|
31 |
-
}
|
32 |
-
|
33 |
-
function tcmp_ui_manager() {
|
34 |
-
global $tcmp;
|
35 |
-
|
36 |
-
$id=TCMP_ISQS('id', 0);
|
37 |
-
if (TCMP_SQS('action')=='delete' && $id>0 && wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_delete')) {
|
38 |
-
$snippet=$tcmp->Manager->get($id);
|
39 |
-
if ($tcmp->Manager->remove($id)) {
|
40 |
-
$tcmp->Options->pushSuccessMessage('CodeDeleteNotice', $id, $snippet['name']);
|
41 |
-
}
|
42 |
-
} else if ($id != '' && $id != 0) {
|
43 |
-
$snippet = $tcmp->Manager->get($id);
|
44 |
-
if ($tcmp->Utils->is('action', 'toggle') && $id>0 && wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_toggle')) {
|
45 |
-
$snippet['active']=($snippet['active']==0 ? 1 : 0);
|
46 |
-
$tcmp->Manager->put($snippet['id'], $snippet);
|
47 |
-
}
|
48 |
-
$tcmp->Options->pushSuccessMessage('CodeUpdateNotice', $id, $snippet['name']);
|
49 |
-
}
|
50 |
-
|
51 |
-
$tcmp->Manager->isLimitReached(TRUE);
|
52 |
-
$tcmp->Options->writeMessages();
|
53 |
-
|
54 |
-
//controllo che faccio per essere retrocompatibile con la prima versione
|
55 |
-
//dove non avevo un id e salvavo tutto con il con il nome quindi una stringa
|
56 |
-
$snippets=$tcmp->Manager->keys();
|
57 |
-
foreach($snippets as $v) {
|
58 |
-
$snippet=$tcmp->Manager->get($v, FALSE, TRUE);
|
59 |
-
if(!$snippet) {
|
60 |
-
$tcmp->Manager->remove($v);
|
61 |
-
} elseif(!is_numeric($v)) {
|
62 |
-
$tcmp->Manager->remove($v);
|
63 |
-
$tcmp->Manager->put('', $snippet);
|
64 |
-
}
|
65 |
-
}
|
66 |
-
$snippets=$tcmp->Manager->values();
|
67 |
-
if (count($snippets)>0) { ?>
|
68 |
-
<div style="float:left;">
|
69 |
-
<form method="get" action="" style="margin:5px; float:left;">
|
70 |
-
<input type="hidden" name="page" value="<?php echo TCMP_PLUGIN_SLUG?>" />
|
71 |
-
<input type="hidden" name="tab" value="<?php echo TCMP_TAB_EDITOR?>" />
|
72 |
-
<input type="submit" class="button-primary" value="<?php $tcmp->Lang->P('Button.Add')?>" />
|
73 |
-
</form>
|
74 |
-
</div>
|
75 |
-
<div style="clear:both;"></div>
|
76 |
-
|
77 |
-
<style>
|
78 |
-
.widefat th {
|
79 |
-
font-weight: bold!important;
|
80 |
-
}
|
81 |
-
table input {
|
82 |
-
font-size: 13px;
|
83 |
-
}
|
84 |
-
.widefat thead td, .widefat thead th {
|
85 |
-
border-bottom: 0px!important;
|
86 |
-
}
|
87 |
-
</style>
|
88 |
-
<table class="widefat fixed" style="width:100%" id="tblSortable">
|
89 |
-
<thead>
|
90 |
-
<tr>
|
91 |
-
<th style="width:30px;">#N</th>
|
92 |
-
<th style="width:50px; text-align:center;"><?php $tcmp->Lang->P('Active?')?></th>
|
93 |
-
<th><?php $tcmp->Lang->P('Name')?></th>
|
94 |
-
<th><?php $tcmp->Lang->P('Where?')?></th>
|
95 |
-
<th style="text-align:center;"><?php $tcmp->Lang->P('Shortcode')?></th>
|
96 |
-
<th style="text-align:center;"><?php $tcmp->Lang->P('Actions')?></th>
|
97 |
-
</tr>
|
98 |
-
</thead>
|
99 |
-
<tbody class="table-body">
|
100 |
-
<?php
|
101 |
-
$i=1;
|
102 |
-
foreach ($snippets as $snippet) {
|
103 |
-
$bClass=(($i%2)==1 ? 'odd' : 'even');
|
104 |
-
?>
|
105 |
-
<tr class="<?php echo $bClass?>" id="row_<?php echo $snippet['id']?>">
|
106 |
-
<td>#<?php echo $i++ ?></td>
|
107 |
-
<td style="text-align:center;">
|
108 |
-
<?php
|
109 |
-
$color='red';
|
110 |
-
$text='No';
|
111 |
-
$question='QuestionActiveOn';
|
112 |
-
if($snippet['active']==1) {
|
113 |
-
$color='green';
|
114 |
-
$text='Yes';
|
115 |
-
$question='QuestionActiveOff';
|
116 |
-
}
|
117 |
-
$text='<span style="font-weight:bold; color:'.$color.'">'.$tcmp->Lang->L($text).'</span>';
|
118 |
-
?>
|
119 |
-
<a onclick="return confirm('<?php echo $tcmp->Lang->L($question)?>');" href="<?php echo TCMP_TAB_MANAGER_URI?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_toggle')); ?>&action=toggle&id=<?php echo $snippet['id'] ?>">
|
120 |
-
<?php echo $text?>
|
121 |
-
</a>
|
122 |
-
</td>
|
123 |
-
<td><?php echo $snippet['name']?></td>
|
124 |
-
<td>
|
125 |
-
<?php
|
126 |
-
if($tcmp->Manager->isModeScript($snippet)) {
|
127 |
-
if($tcmp->Manager->isPageEverywhere($snippet)) {
|
128 |
-
$text='Everywhere';
|
129 |
-
} else {
|
130 |
-
$text='Specific Pages';
|
131 |
-
}
|
132 |
-
} else {
|
133 |
-
$text='Conversion';
|
134 |
-
}
|
135 |
-
$tcmp->Lang->P($text);
|
136 |
-
?>
|
137 |
-
</td>
|
138 |
-
<td style="text-align:center;">
|
139 |
-
<input type="text" style="width:110px; text-align:center;" value='[tcm id="<?php echo esc_html($snippet['id']); ?>"]' readonly="readonly" class="tcmp-select-onfocus" />
|
140 |
-
</td>
|
141 |
-
<td style="text-align:center;">
|
142 |
-
<input type="button" class="button button-secondary" value="<?php $tcmp->Lang->P('Edit')?>" onclick="location.href='<?php echo TCMP_TAB_EDITOR_URI?>&id=<?php echo $snippet['id'] ?>';"/>
|
143 |
-
<input type="button" class="button button-secondary" value="<?php $tcmp->Lang->P('Delete?')?>" onclick="TCMP_btnDeleteClick(<?php echo $snippet['id'] ?>)"/>
|
144 |
-
</td>
|
145 |
-
</tr>
|
146 |
-
<?php } ?>
|
147 |
-
</tbody>
|
148 |
-
</table>
|
149 |
-
<script>
|
150 |
-
function TCMP_btnDeleteClick(id) {
|
151 |
-
var success=confirm('<?php echo $tcmp->Lang->L('Question.DeleteQuestion')?>');
|
152 |
-
if(success) {
|
153 |
-
var href='<?php echo TCMP_TAB_MANAGER_URI?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_delete')); ?>&action=delete&id=';
|
154 |
-
location.href=href+id;
|
155 |
-
}
|
156 |
-
}
|
157 |
-
</script>
|
158 |
-
<?php
|
159 |
-
tcmp_notice_pro_features();
|
160 |
-
if(count($snippets)>1) {
|
161 |
-
tcmp_manager_sortable_scripts();
|
162 |
-
}
|
163 |
-
} else { ?>
|
164 |
-
<h2><?php $tcmp->Lang->P('EmptyTrackingList', TCMP_TAB_EDITOR_URI)?></h2>
|
165 |
-
<?php }
|
166 |
-
}
|
167 |
-
function tcmp_manager_sortable_scripts() {
|
168 |
-
?>
|
169 |
-
<style>
|
170 |
-
.ui-state-highlight {
|
171 |
-
border: 1px dotted red!important;
|
172 |
-
background-color: #F4E449!important;
|
173 |
-
}
|
174 |
-
#tblSortable tbody tr:hover {
|
175 |
-
cursor: move!important;
|
176 |
-
}
|
177 |
-
#tblSortable tbody tr a:hover {
|
178 |
-
cursor: hand!important;
|
179 |
-
}
|
180 |
-
</style>
|
181 |
-
<script>
|
182 |
-
jQuery(function() {
|
183 |
-
var $sortable=jQuery("#tblSortable .table-body");
|
184 |
-
$sortable.sortable({
|
185 |
-
tolerance:'intersect'
|
186 |
-
, cursor:'move'
|
187 |
-
, items:'tr'
|
188 |
-
, placeholder:'ui-state-highlight'
|
189 |
-
, nested: 'tbody'
|
190 |
-
, update: function(event, ui) {
|
191 |
-
var orders=$sortable.sortable('serialize');
|
192 |
-
var data={action: 'TCMP_changeOrder', order: orders};
|
193 |
-
jQuery.post(ajaxurl, data, function(result) {
|
194 |
-
console.log(result);
|
195 |
-
});
|
196 |
-
}
|
197 |
-
});
|
198 |
-
$sortable.disableSelection();
|
199 |
-
});
|
200 |
-
</script>
|
201 |
-
<?php
|
202 |
}
|
1 |
+
<?php
|
2 |
+
//column renderer
|
3 |
+
function tcmp_ui_manager_column($active, $values=NULL, $hide=FALSE) {
|
4 |
+
global $tcmp;
|
5 |
+
?>
|
6 |
+
<td style="text-align:center;">
|
7 |
+
<?php
|
8 |
+
if($hide) {
|
9 |
+
$text='-';
|
10 |
+
} else {
|
11 |
+
if($active) {
|
12 |
+
$text='<span style="font-weight:bold; color:green">'.$tcmp->Lang->L('Yes').'</span>';
|
13 |
+
} else {
|
14 |
+
$text='<span style="font-weight:bold; color:red">'.$tcmp->Lang->L('No').'</span>';
|
15 |
+
}
|
16 |
+
if($active && $values) {
|
17 |
+
if(!is_array($values)) {
|
18 |
+
$text.=' {'.$values.'}';
|
19 |
+
} elseif(count($values)>0) {
|
20 |
+
$what=implode(',', $values);
|
21 |
+
if($what!='') {
|
22 |
+
$text.=' ['.$what.']';
|
23 |
+
}
|
24 |
+
}
|
25 |
+
}
|
26 |
+
}
|
27 |
+
echo $text;
|
28 |
+
?>
|
29 |
+
</td>
|
30 |
+
<?php
|
31 |
+
}
|
32 |
+
|
33 |
+
function tcmp_ui_manager() {
|
34 |
+
global $tcmp;
|
35 |
+
|
36 |
+
$id=TCMP_ISQS('id', 0);
|
37 |
+
if (TCMP_SQS('action')=='delete' && $id>0 && wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_delete')) {
|
38 |
+
$snippet=$tcmp->Manager->get($id);
|
39 |
+
if ($tcmp->Manager->remove($id)) {
|
40 |
+
$tcmp->Options->pushSuccessMessage('CodeDeleteNotice', $id, $snippet['name']);
|
41 |
+
}
|
42 |
+
} else if ($id != '' && $id != 0) {
|
43 |
+
$snippet = $tcmp->Manager->get($id);
|
44 |
+
if ($tcmp->Utils->is('action', 'toggle') && $id>0 && wp_verify_nonce(TCMP_QS('tcmp_nonce'), 'tcmp_toggle')) {
|
45 |
+
$snippet['active']=($snippet['active']==0 ? 1 : 0);
|
46 |
+
$tcmp->Manager->put($snippet['id'], $snippet);
|
47 |
+
}
|
48 |
+
$tcmp->Options->pushSuccessMessage('CodeUpdateNotice', $id, $snippet['name']);
|
49 |
+
}
|
50 |
+
|
51 |
+
$tcmp->Manager->isLimitReached(TRUE);
|
52 |
+
$tcmp->Options->writeMessages();
|
53 |
+
|
54 |
+
//controllo che faccio per essere retrocompatibile con la prima versione
|
55 |
+
//dove non avevo un id e salvavo tutto con il con il nome quindi una stringa
|
56 |
+
$snippets=$tcmp->Manager->keys();
|
57 |
+
foreach($snippets as $v) {
|
58 |
+
$snippet=$tcmp->Manager->get($v, FALSE, TRUE);
|
59 |
+
if(!$snippet) {
|
60 |
+
$tcmp->Manager->remove($v);
|
61 |
+
} elseif(!is_numeric($v)) {
|
62 |
+
$tcmp->Manager->remove($v);
|
63 |
+
$tcmp->Manager->put('', $snippet);
|
64 |
+
}
|
65 |
+
}
|
66 |
+
$snippets=$tcmp->Manager->values();
|
67 |
+
if (count($snippets)>0) { ?>
|
68 |
+
<div style="float:left;">
|
69 |
+
<form method="get" action="" style="margin:5px; float:left;">
|
70 |
+
<input type="hidden" name="page" value="<?php echo TCMP_PLUGIN_SLUG?>" />
|
71 |
+
<input type="hidden" name="tab" value="<?php echo TCMP_TAB_EDITOR?>" />
|
72 |
+
<input type="submit" class="button-primary" value="<?php $tcmp->Lang->P('Button.Add')?>" />
|
73 |
+
</form>
|
74 |
+
</div>
|
75 |
+
<div style="clear:both;"></div>
|
76 |
+
|
77 |
+
<style>
|
78 |
+
.widefat th {
|
79 |
+
font-weight: bold!important;
|
80 |
+
}
|
81 |
+
table input {
|
82 |
+
font-size: 13px;
|
83 |
+
}
|
84 |
+
.widefat thead td, .widefat thead th {
|
85 |
+
border-bottom: 0px!important;
|
86 |
+
}
|
87 |
+
</style>
|
88 |
+
<table class="widefat fixed" style="width:100%" id="tblSortable">
|
89 |
+
<thead>
|
90 |
+
<tr>
|
91 |
+
<th style="width:30px;">#N</th>
|
92 |
+
<th style="width:50px; text-align:center;"><?php $tcmp->Lang->P('Active?')?></th>
|
93 |
+
<th><?php $tcmp->Lang->P('Name')?></th>
|
94 |
+
<th><?php $tcmp->Lang->P('Where?')?></th>
|
95 |
+
<th style="text-align:center;"><?php $tcmp->Lang->P('Shortcode')?></th>
|
96 |
+
<th style="text-align:center;"><?php $tcmp->Lang->P('Actions')?></th>
|
97 |
+
</tr>
|
98 |
+
</thead>
|
99 |
+
<tbody class="table-body">
|
100 |
+
<?php
|
101 |
+
$i=1;
|
102 |
+
foreach ($snippets as $snippet) {
|
103 |
+
$bClass=(($i%2)==1 ? 'odd' : 'even');
|
104 |
+
?>
|
105 |
+
<tr class="<?php echo $bClass?>" id="row_<?php echo $snippet['id']?>">
|
106 |
+
<td>#<?php echo $i++ ?></td>
|
107 |
+
<td style="text-align:center;">
|
108 |
+
<?php
|
109 |
+
$color='red';
|
110 |
+
$text='No';
|
111 |
+
$question='QuestionActiveOn';
|
112 |
+
if($snippet['active']==1) {
|
113 |
+
$color='green';
|
114 |
+
$text='Yes';
|
115 |
+
$question='QuestionActiveOff';
|
116 |
+
}
|
117 |
+
$text='<span style="font-weight:bold; color:'.$color.'">'.$tcmp->Lang->L($text).'</span>';
|
118 |
+
?>
|
119 |
+
<a onclick="return confirm('<?php echo $tcmp->Lang->L($question)?>');" href="<?php echo TCMP_TAB_MANAGER_URI?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_toggle')); ?>&action=toggle&id=<?php echo $snippet['id'] ?>">
|
120 |
+
<?php echo $text?>
|
121 |
+
</a>
|
122 |
+
</td>
|
123 |
+
<td><?php echo $snippet['name']?></td>
|
124 |
+
<td>
|
125 |
+
<?php
|
126 |
+
if($tcmp->Manager->isModeScript($snippet)) {
|
127 |
+
if($tcmp->Manager->isPageEverywhere($snippet)) {
|
128 |
+
$text='Everywhere';
|
129 |
+
} else {
|
130 |
+
$text='Specific Pages';
|
131 |
+
}
|
132 |
+
} else {
|
133 |
+
$text='Conversion';
|
134 |
+
}
|
135 |
+
$tcmp->Lang->P($text);
|
136 |
+
?>
|
137 |
+
</td>
|
138 |
+
<td style="text-align:center;">
|
139 |
+
<input type="text" style="width:110px; text-align:center;" value='[tcm id="<?php echo esc_html($snippet['id']); ?>"]' readonly="readonly" class="tcmp-select-onfocus" />
|
140 |
+
</td>
|
141 |
+
<td style="text-align:center;">
|
142 |
+
<input type="button" class="button button-secondary" value="<?php $tcmp->Lang->P('Edit')?>" onclick="location.href='<?php echo TCMP_TAB_EDITOR_URI?>&id=<?php echo $snippet['id'] ?>';"/>
|
143 |
+
<input type="button" class="button button-secondary" value="<?php $tcmp->Lang->P('Delete?')?>" onclick="TCMP_btnDeleteClick(<?php echo $snippet['id'] ?>)"/>
|
144 |
+
</td>
|
145 |
+
</tr>
|
146 |
+
<?php } ?>
|
147 |
+
</tbody>
|
148 |
+
</table>
|
149 |
+
<script>
|
150 |
+
function TCMP_btnDeleteClick(id) {
|
151 |
+
var success=confirm('<?php echo $tcmp->Lang->L('Question.DeleteQuestion')?>');
|
152 |
+
if(success) {
|
153 |
+
var href='<?php echo TCMP_TAB_MANAGER_URI?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_delete')); ?>&action=delete&id=';
|
154 |
+
location.href=href+id;
|
155 |
+
}
|
156 |
+
}
|
157 |
+
</script>
|
158 |
+
<?php
|
159 |
+
tcmp_notice_pro_features();
|
160 |
+
if(count($snippets)>1) {
|
161 |
+
tcmp_manager_sortable_scripts();
|
162 |
+
}
|
163 |
+
} else { ?>
|
164 |
+
<h2><?php $tcmp->Lang->P('EmptyTrackingList', TCMP_TAB_EDITOR_URI)?></h2>
|
165 |
+
<?php }
|
166 |
+
}
|
167 |
+
function tcmp_manager_sortable_scripts() {
|
168 |
+
?>
|
169 |
+
<style>
|
170 |
+
.ui-state-highlight {
|
171 |
+
border: 1px dotted red!important;
|
172 |
+
background-color: #F4E449!important;
|
173 |
+
}
|
174 |
+
#tblSortable tbody tr:hover {
|
175 |
+
cursor: move!important;
|
176 |
+
}
|
177 |
+
#tblSortable tbody tr a:hover {
|
178 |
+
cursor: hand!important;
|
179 |
+
}
|
180 |
+
</style>
|
181 |
+
<script>
|
182 |
+
jQuery(function() {
|
183 |
+
var $sortable=jQuery("#tblSortable .table-body");
|
184 |
+
$sortable.sortable({
|
185 |
+
tolerance:'intersect'
|
186 |
+
, cursor:'move'
|
187 |
+
, items:'tr'
|
188 |
+
, placeholder:'ui-state-highlight'
|
189 |
+
, nested: 'tbody'
|
190 |
+
, update: function(event, ui) {
|
191 |
+
var orders=$sortable.sortable('serialize');
|
192 |
+
var data={action: 'TCMP_changeOrder', order: orders};
|
193 |
+
jQuery.post(ajaxurl, data, function(result) {
|
194 |
+
console.log(result);
|
195 |
+
});
|
196 |
+
}
|
197 |
+
});
|
198 |
+
$sortable.disableSelection();
|
199 |
+
});
|
200 |
+
</script>
|
201 |
+
<?php
|
202 |
}
|
includes/admin/metabox.php
CHANGED
@@ -1,209 +1,209 @@
|
|
1 |
-
<?php
|
2 |
-
function tcmp_ui_metabox($post) {
|
3 |
-
global $tcmp;
|
4 |
-
// Add an nonce field so we can check for it later.
|
5 |
-
wp_nonce_field('tcmp_meta_box', 'tcmp_meta_box_nonce');
|
6 |
-
|
7 |
-
$args=array('metabox'=>TRUE, 'field'=>'id');
|
8 |
-
$ids=$tcmp->Manager->getCodes(-1, $post, $args);
|
9 |
-
|
10 |
-
$allIds=array();
|
11 |
-
$snippets=$tcmp->Manager->values();
|
12 |
-
$postType=$post->post_type;
|
13 |
-
foreach($snippets as $snippet) {
|
14 |
-
if($snippet['trackMode']==TCMP_TRACK_MODE_CODE) {
|
15 |
-
if($snippet['active']!=0) {
|
16 |
-
if($snippet['exceptPostsOfType_'.$postType.'_Active']==0
|
17 |
-
|| !in_array(-1, $snippet['exceptPostsOfType_'.$postType])) {
|
18 |
-
$allIds[]=$snippet['id'];
|
19 |
-
}
|
20 |
-
}
|
21 |
-
}
|
22 |
-
}
|
23 |
-
?>
|
24 |
-
<div>
|
25 |
-
<?php $tcmp->Lang->P('Select existing Tracking Code')?>..
|
26 |
-
</div>
|
27 |
-
<input type="hidden" name="tcmp_all_ids" value="<?php echo implode(',', $allIds)?>" />
|
28 |
-
|
29 |
-
<div>
|
30 |
-
<?php
|
31 |
-
foreach($snippets as $snippet) {
|
32 |
-
$id=$snippet['id'];
|
33 |
-
if($snippet['trackMode']!=TCMP_TRACK_MODE_CODE) {
|
34 |
-
continue;
|
35 |
-
}
|
36 |
-
|
37 |
-
$disabled='';
|
38 |
-
$checked='';
|
39 |
-
|
40 |
-
if(!in_array($id, $allIds)) {
|
41 |
-
$disabled=' DISABLED';
|
42 |
-
} elseif(in_array($id, $ids)) {
|
43 |
-
$checked=' CHECKED';
|
44 |
-
}
|
45 |
-
?>
|
46 |
-
<input type="checkbox" class="tcmp-checkbox" name="tcmp_ids[]" value="<?php echo $id?>" <?php echo $checked ?> <?php echo $disabled ?> />
|
47 |
-
<?php echo $snippet['name']?>
|
48 |
-
<a href="<?php echo TCMP_TAB_EDITOR_URI?>&id=<?php echo $id?>" target="_blank"> ››</a>
|
49 |
-
<br/>
|
50 |
-
<?php } ?>
|
51 |
-
</div>
|
52 |
-
|
53 |
-
<br/>
|
54 |
-
<div>
|
55 |
-
<label for="tcmp_name"><?php $tcmp->Lang->P('Or add a name')?></label>
|
56 |
-
<br/>
|
57 |
-
<input type="text" name="tcmp_name" value="" style="width:100%"/>
|
58 |
-
</div>
|
59 |
-
<div>
|
60 |
-
<label for="code"><?php $tcmp->Lang->P('and paste HTML code here')?></label>
|
61 |
-
<br/>
|
62 |
-
<textarea dir="ltr" dirname="ltr" name="tcmp_code" class="tcmp-textarea" style="width:100%; height:175px;"></textarea>
|
63 |
-
</div>
|
64 |
-
|
65 |
-
<div style="clear:both"></div>
|
66 |
-
<i>Saving the post you'll save the tracking code</i>
|
67 |
-
<?php }
|
68 |
-
|
69 |
-
//si aggancia per creare i metabox in post e page
|
70 |
-
add_action('add_meta_boxes', 'tcmp_add_meta_box');
|
71 |
-
function tcmp_add_meta_box() {
|
72 |
-
global $tcmp;
|
73 |
-
|
74 |
-
$free=array('post', 'page');
|
75 |
-
$options=$tcmp->Options->getMetaboxPostTypes();
|
76 |
-
$screens=array();
|
77 |
-
foreach($options as $k=>$v) {
|
78 |
-
if(intval($v)>0) {
|
79 |
-
$screens[]=$k;
|
80 |
-
}
|
81 |
-
}
|
82 |
-
if(count($screens)>0) {
|
83 |
-
foreach ($screens as $screen) {
|
84 |
-
add_meta_box(
|
85 |
-
'tcmp_sectionid'
|
86 |
-
, $tcmp->Lang->L('Tracking Code
|
87 |
-
, 'tcmp_ui_metabox'
|
88 |
-
, $screen
|
89 |
-
, 'side'
|
90 |
-
);
|
91 |
-
}
|
92 |
-
}
|
93 |
-
}
|
94 |
-
function tcmp_edit_snippet_array($post, &$snippet, $prefix, $diff) {
|
95 |
-
global $tcmp;
|
96 |
-
$postId=$tcmp->Utils->get($post, 'ID', FALSE);
|
97 |
-
if($postId===FALSE) {
|
98 |
-
$postId=$tcmp->Utils->get($post, 'post_ID');
|
99 |
-
}
|
100 |
-
$postType=$tcmp->Utils->get($post, 'post_type');
|
101 |
-
|
102 |
-
$keyArray='PostsOfType_'.$postType;
|
103 |
-
$keyActive=$keyArray.'_Active';
|
104 |
-
if($snippet[$prefix.$keyActive]==0) {
|
105 |
-
$snippet[$prefix.$keyArray]=array();
|
106 |
-
}
|
107 |
-
$k=$prefix.$keyArray;
|
108 |
-
if($diff) {
|
109 |
-
$snippet[$k]=array_diff($snippet[$k], array($postId));
|
110 |
-
} else {
|
111 |
-
$snippet[$k]=array_merge($snippet[$k], array($postId));
|
112 |
-
if(in_array(-1, $snippet[$k])) {
|
113 |
-
$snippet[$k]=array(-1);
|
114 |
-
}
|
115 |
-
}
|
116 |
-
$snippet[$k]=array_unique($snippet[$k]);
|
117 |
-
$snippet[$prefix.$keyActive]=(count($snippet[$k])>0 ? 1 : 0);
|
118 |
-
return $snippet;
|
119 |
-
}
|
120 |
-
//si aggancia a quando un post viene salvato per salvare anche gli altri dati del metabox
|
121 |
-
add_action('save_post', 'tcmp_save_meta_box_data');
|
122 |
-
function tcmp_save_meta_box_data($postId) {
|
123 |
-
global $tcmp;
|
124 |
-
|
125 |
-
//in case of custom post type edit_ does not exist
|
126 |
-
//if (!current_user_can('edit_'.$postType, $postId)) {
|
127 |
-
// return;
|
128 |
-
//}
|
129 |
-
|
130 |
-
// If this is an autosave, our form has not been submitted, so we don't want to do anything.
|
131 |
-
if (defined('DOING_AUTOSAVE') && DOING_AUTOSAVE) {
|
132 |
-
return;
|
133 |
-
}
|
134 |
-
if (!isset($_POST['tcmp_meta_box_nonce']) || !isset($_POST['post_type'])) {
|
135 |
-
return;
|
136 |
-
}
|
137 |
-
// Verify that the nonce is valid.
|
138 |
-
if (!wp_verify_nonce($_POST['tcmp_meta_box_nonce'], 'tcmp_meta_box')) {
|
139 |
-
return;
|
140 |
-
}
|
141 |
-
|
142 |
-
$args=array('metabox'=>TRUE, 'field'=>'id');
|
143 |
-
$ids=$tcmp->Manager->getCodes(-1, $_POST, $args);
|
144 |
-
if(!is_array($ids)) {
|
145 |
-
$ids=array();
|
146 |
-
}
|
147 |
-
|
148 |
-
$allIds=TCMP_QS('tcmp_all_ids');
|
149 |
-
if($allIds===FALSE || $allIds=='') {
|
150 |
-
$allIds=array();
|
151 |
-
} else {
|
152 |
-
$allIds=explode(',', $allIds);
|
153 |
-
}
|
154 |
-
$currentIds=TCMP_ASQS('tcmp_ids', array());
|
155 |
-
if(!is_array($currentIds)) {
|
156 |
-
$currentIds=array();
|
157 |
-
}
|
158 |
-
|
159 |
-
if($ids!=$currentIds) {
|
160 |
-
foreach($allIds as $id) {
|
161 |
-
$id=intval($id);
|
162 |
-
if($id<=0) {
|
163 |
-
continue;
|
164 |
-
}
|
165 |
-
if(in_array($id, $currentIds) && in_array($id, $ids)) {
|
166 |
-
//selected now and already selected
|
167 |
-
continue;
|
168 |
-
}
|
169 |
-
if(!in_array($id, $currentIds) && !in_array($id, $ids)) {
|
170 |
-
//not selected now and not already selected
|
171 |
-
continue;
|
172 |
-
}
|
173 |
-
|
174 |
-
$snippet=$tcmp->Manager->get($id);
|
175 |
-
if($snippet==NULL) {
|
176 |
-
continue;
|
177 |
-
}
|
178 |
-
|
179 |
-
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'include', TRUE);
|
180 |
-
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'except', TRUE);
|
181 |
-
if(in_array($id, $currentIds)) {
|
182 |
-
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'include', FALSE);
|
183 |
-
} else {
|
184 |
-
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'except', FALSE);
|
185 |
-
}
|
186 |
-
$tcmp->Manager->put($id, $snippet);
|
187 |
-
}
|
188 |
-
}
|
189 |
-
|
190 |
-
$name=TCMP_SQS('tcmp_name');
|
191 |
-
$code=stripslashes(TCMP_QS('tcmp_code'));
|
192 |
-
if($name!='' && $code!='') {
|
193 |
-
$postType=TCMP_SQS('post_type');
|
194 |
-
$keyArray='PostsOfType_'.$postType;
|
195 |
-
$keyActive=$keyArray.'_Active';
|
196 |
-
|
197 |
-
$snippet=array(
|
198 |
-
'active'=>1
|
199 |
-
, 'name'=>$name
|
200 |
-
, 'code'=>$code
|
201 |
-
, 'trackPage'=>TCMP_TRACK_PAGE_SPECIFIC
|
202 |
-
, 'trackMode'=>TCMP_TRACK_MODE_CODE
|
203 |
-
);
|
204 |
-
$snippet['include'.$keyActive]=1;
|
205 |
-
$snippet['include'.$keyArray]=array($postId);
|
206 |
-
$snippet=$tcmp->Manager->put('', $snippet);
|
207 |
-
$tcmp->Log->debug("NEW SNIPPET REGISTRED=%s", $snippet);
|
208 |
-
}
|
209 |
-
}
|
1 |
+
<?php
|
2 |
+
function tcmp_ui_metabox($post) {
|
3 |
+
global $tcmp;
|
4 |
+
// Add an nonce field so we can check for it later.
|
5 |
+
wp_nonce_field('tcmp_meta_box', 'tcmp_meta_box_nonce');
|
6 |
+
|
7 |
+
$args=array('metabox'=>TRUE, 'field'=>'id');
|
8 |
+
$ids=$tcmp->Manager->getCodes(-1, $post, $args);
|
9 |
+
|
10 |
+
$allIds=array();
|
11 |
+
$snippets=$tcmp->Manager->values();
|
12 |
+
$postType=$post->post_type;
|
13 |
+
foreach($snippets as $snippet) {
|
14 |
+
if($snippet['trackMode']==TCMP_TRACK_MODE_CODE) {
|
15 |
+
if($snippet['active']!=0) {
|
16 |
+
if($snippet['exceptPostsOfType_'.$postType.'_Active']==0
|
17 |
+
|| !in_array(-1, $snippet['exceptPostsOfType_'.$postType])) {
|
18 |
+
$allIds[]=$snippet['id'];
|
19 |
+
}
|
20 |
+
}
|
21 |
+
}
|
22 |
+
}
|
23 |
+
?>
|
24 |
+
<div>
|
25 |
+
<?php $tcmp->Lang->P('Select existing Tracking Code')?>..
|
26 |
+
</div>
|
27 |
+
<input type="hidden" name="tcmp_all_ids" value="<?php echo implode(',', $allIds)?>" />
|
28 |
+
|
29 |
+
<div>
|
30 |
+
<?php
|
31 |
+
foreach($snippets as $snippet) {
|
32 |
+
$id=$snippet['id'];
|
33 |
+
if($snippet['trackMode']!=TCMP_TRACK_MODE_CODE) {
|
34 |
+
continue;
|
35 |
+
}
|
36 |
+
|
37 |
+
$disabled='';
|
38 |
+
$checked='';
|
39 |
+
|
40 |
+
if(!in_array($id, $allIds)) {
|
41 |
+
$disabled=' DISABLED';
|
42 |
+
} elseif(in_array($id, $ids)) {
|
43 |
+
$checked=' CHECKED';
|
44 |
+
}
|
45 |
+
?>
|
46 |
+
<input type="checkbox" class="tcmp-checkbox" name="tcmp_ids[]" value="<?php echo $id?>" <?php echo $checked ?> <?php echo $disabled ?> />
|
47 |
+
<?php echo $snippet['name']?>
|
48 |
+
<a href="<?php echo TCMP_TAB_EDITOR_URI?>&id=<?php echo $id?>" target="_blank"> ››</a>
|
49 |
+
<br/>
|
50 |
+
<?php } ?>
|
51 |
+
</div>
|
52 |
+
|
53 |
+
<br/>
|
54 |
+
<div>
|
55 |
+
<label for="tcmp_name"><?php $tcmp->Lang->P('Or add a name')?></label>
|
56 |
+
<br/>
|
57 |
+
<input type="text" name="tcmp_name" value="" style="width:100%"/>
|
58 |
+
</div>
|
59 |
+
<div>
|
60 |
+
<label for="code"><?php $tcmp->Lang->P('and paste HTML code here')?></label>
|
61 |
+
<br/>
|
62 |
+
<textarea dir="ltr" dirname="ltr" name="tcmp_code" class="tcmp-textarea" style="width:100%; height:175px;"></textarea>
|
63 |
+
</div>
|
64 |
+
|
65 |
+
<div style="clear:both"></div>
|
66 |
+
<i>Saving the post you'll save the tracking code</i>
|
67 |
+
<?php }
|
68 |
+
|
69 |
+
//si aggancia per creare i metabox in post e page
|
70 |
+
add_action('add_meta_boxes', 'tcmp_add_meta_box');
|
71 |
+
function tcmp_add_meta_box() {
|
72 |
+
global $tcmp;
|
73 |
+
|
74 |
+
$free=array('post', 'page');
|
75 |
+
$options=$tcmp->Options->getMetaboxPostTypes();
|
76 |
+
$screens=array();
|
77 |
+
foreach($options as $k=>$v) {
|
78 |
+
if(intval($v)>0) {
|
79 |
+
$screens[]=$k;
|
80 |
+
}
|
81 |
+
}
|
82 |
+
if(count($screens)>0) {
|
83 |
+
foreach ($screens as $screen) {
|
84 |
+
add_meta_box(
|
85 |
+
'tcmp_sectionid'
|
86 |
+
, $tcmp->Lang->L('Tracking Code by Data443')
|
87 |
+
, 'tcmp_ui_metabox'
|
88 |
+
, $screen
|
89 |
+
, 'side'
|
90 |
+
);
|
91 |
+
}
|
92 |
+
}
|
93 |
+
}
|
94 |
+
function tcmp_edit_snippet_array($post, &$snippet, $prefix, $diff) {
|
95 |
+
global $tcmp;
|
96 |
+
$postId=$tcmp->Utils->get($post, 'ID', FALSE);
|
97 |
+
if($postId===FALSE) {
|
98 |
+
$postId=$tcmp->Utils->get($post, 'post_ID');
|
99 |
+
}
|
100 |
+
$postType=$tcmp->Utils->get($post, 'post_type');
|
101 |
+
|
102 |
+
$keyArray='PostsOfType_'.$postType;
|
103 |
+
$keyActive=$keyArray.'_Active';
|
104 |
+
if($snippet[$prefix.$keyActive]==0) {
|
105 |
+
$snippet[$prefix.$keyArray]=array();
|
106 |
+
}
|
107 |
+
$k=$prefix.$keyArray;
|
108 |
+
if($diff) {
|
109 |
+
$snippet[$k]=array_diff($snippet[$k], array($postId));
|
110 |
+
} else {
|
111 |
+
$snippet[$k]=array_merge($snippet[$k], array($postId));
|
112 |
+
if(in_array(-1, $snippet[$k])) {
|
113 |
+
$snippet[$k]=array(-1);
|
114 |
+
}
|
115 |
+
}
|
116 |
+
$snippet[$k]=array_unique($snippet[$k]);
|
117 |
+
$snippet[$prefix.$keyActive]=(count($snippet[$k])>0 ? 1 : 0);
|
118 |
+
return $snippet;
|
119 |
+
}
|
120 |
+
//si aggancia a quando un post viene salvato per salvare anche gli altri dati del metabox
|
121 |
+
add_action('save_post', 'tcmp_save_meta_box_data');
|
122 |
+
function tcmp_save_meta_box_data($postId) {
|
123 |
+
global $tcmp;
|
124 |
+
|
125 |
+
//in case of custom post type edit_ does not exist
|
126 |
+
//if (!current_user_can('edit_'.$postType, $postId)) {
|
127 |
+
// return;
|
128 |
+
//}
|
129 |
+
|
130 |
+
// If this is an autosave, our form has not been submitted, so we don't want to do anything.
|
131 |
+
if (defined('DOING_AUTOSAVE') && DOING_AUTOSAVE) {
|
132 |
+
return;
|
133 |
+
}
|
134 |
+
if (!isset($_POST['tcmp_meta_box_nonce']) || !isset($_POST['post_type'])) {
|
135 |
+
return;
|
136 |
+
}
|
137 |
+
// Verify that the nonce is valid.
|
138 |
+
if (!wp_verify_nonce($_POST['tcmp_meta_box_nonce'], 'tcmp_meta_box')) {
|
139 |
+
return;
|
140 |
+
}
|
141 |
+
|
142 |
+
$args=array('metabox'=>TRUE, 'field'=>'id');
|
143 |
+
$ids=$tcmp->Manager->getCodes(-1, $_POST, $args);
|
144 |
+
if(!is_array($ids)) {
|
145 |
+
$ids=array();
|
146 |
+
}
|
147 |
+
|
148 |
+
$allIds=TCMP_QS('tcmp_all_ids');
|
149 |
+
if($allIds===FALSE || $allIds=='') {
|
150 |
+
$allIds=array();
|
151 |
+
} else {
|
152 |
+
$allIds=explode(',', $allIds);
|
153 |
+
}
|
154 |
+
$currentIds=TCMP_ASQS('tcmp_ids', array());
|
155 |
+
if(!is_array($currentIds)) {
|
156 |
+
$currentIds=array();
|
157 |
+
}
|
158 |
+
|
159 |
+
if($ids!=$currentIds) {
|
160 |
+
foreach($allIds as $id) {
|
161 |
+
$id=intval($id);
|
162 |
+
if($id<=0) {
|
163 |
+
continue;
|
164 |
+
}
|
165 |
+
if(in_array($id, $currentIds) && in_array($id, $ids)) {
|
166 |
+
//selected now and already selected
|
167 |
+
continue;
|
168 |
+
}
|
169 |
+
if(!in_array($id, $currentIds) && !in_array($id, $ids)) {
|
170 |
+
//not selected now and not already selected
|
171 |
+
continue;
|
172 |
+
}
|
173 |
+
|
174 |
+
$snippet=$tcmp->Manager->get($id);
|
175 |
+
if($snippet==NULL) {
|
176 |
+
continue;
|
177 |
+
}
|
178 |
+
|
179 |
+
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'include', TRUE);
|
180 |
+
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'except', TRUE);
|
181 |
+
if(in_array($id, $currentIds)) {
|
182 |
+
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'include', FALSE);
|
183 |
+
} else {
|
184 |
+
$snippet=tcmp_edit_snippet_array($_POST, $snippet, 'except', FALSE);
|
185 |
+
}
|
186 |
+
$tcmp->Manager->put($id, $snippet);
|
187 |
+
}
|
188 |
+
}
|
189 |
+
|
190 |
+
$name=TCMP_SQS('tcmp_name');
|
191 |
+
$code=stripslashes(TCMP_QS('tcmp_code'));
|
192 |
+
if($name!='' && $code!='') {
|
193 |
+
$postType=TCMP_SQS('post_type');
|
194 |
+
$keyArray='PostsOfType_'.$postType;
|
195 |
+
$keyActive=$keyArray.'_Active';
|
196 |
+
|
197 |
+
$snippet=array(
|
198 |
+
'active'=>1
|
199 |
+
, 'name'=>$name
|
200 |
+
, 'code'=>$code
|
201 |
+
, 'trackPage'=>TCMP_TRACK_PAGE_SPECIFIC
|
202 |
+
, 'trackMode'=>TCMP_TRACK_MODE_CODE
|
203 |
+
);
|
204 |
+
$snippet['include'.$keyActive]=1;
|
205 |
+
$snippet['include'.$keyArray]=array($postId);
|
206 |
+
$snippet=$tcmp->Manager->put('', $snippet);
|
207 |
+
$tcmp->Log->debug("NEW SNIPPET REGISTRED=%s", $snippet);
|
208 |
+
}
|
209 |
+
}
|
includes/admin/settings.php
CHANGED
@@ -1,57 +1,57 @@
|
|
1 |
-
<?php
|
2 |
-
function tcmp_ui_track() {
|
3 |
-
global $tcmp;
|
4 |
-
|
5 |
-
$track=TCMP_SQS('track', '');
|
6 |
-
if($track!='') {
|
7 |
-
$track=intval($track);
|
8 |
-
$tcmp->Options->setTrackingEnable($track);
|
9 |
-
$tcmp->Tracking->sendTracking(TRUE);
|
10 |
-
}
|
11 |
-
|
12 |
-
$uri=TCMP_TAB_SETTINGS_URI.'&track=';
|
13 |
-
if($tcmp->Options->isTrackingEnable()) {
|
14 |
-
$uri.='0';
|
15 |
-
$tcmp->Options->pushSuccessMessage('EnableAllowTrackingNotice', $uri);
|
16 |
-
} else {
|
17 |
-
$uri.='1';
|
18 |
-
$tcmp->Options->pushErrorMessage('DisableAllowTrackingNotice', $uri);
|
19 |
-
}
|
20 |
-
$tcmp->Options->writeMessages();
|
21 |
-
}
|
22 |
-
function tcmp_ui_settings() {
|
23 |
-
global $tcmp;
|
24 |
-
|
25 |
-
$tcmp->Form->prefix='License';
|
26 |
-
if($tcmp->Check->nonce('tcmp_license')) {
|
27 |
-
$options=$tcmp->Options->getMetaboxPostTypes();
|
28 |
-
foreach ($options as $k => $v) {
|
29 |
-
$v=TCMP_ISQS('metabox_' . $k, 0);
|
30 |
-
$options[$k]=$v;
|
31 |
-
}
|
32 |
-
$tcmp->Options->setMetaboxPostTypes($options);
|
33 |
-
|
34 |
-
$tcmp->Options->setHookPriority($tcmp->Utils->iqs('tcmpHookPriority', TCMP_HOOK_PRIORITY_DEFAULT));
|
35 |
-
}
|
36 |
-
|
37 |
-
$tcmp->Form->formStarts();
|
38 |
-
$tcmp->Form->prefix = 'Priority';
|
39 |
-
$tcmp->Form->p('PrioritySection');
|
40 |
-
$tcmp->Form->number('tcmpHookPriority', $tcmp->Options->getHookPriority());
|
41 |
-
|
42 |
-
$tcmp->Form->prefix='License';
|
43 |
-
$tcmp->Form->p('MetaboxSection');
|
44 |
-
$metaboxes=$tcmp->Options->getMetaboxPostTypes();
|
45 |
-
|
46 |
-
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
47 |
-
foreach ($types as $v) {
|
48 |
-
$v=$v['id'];
|
49 |
-
//$tcmp->Form->tags=TRUE;
|
50 |
-
//$tcmp->Form->premium=!in_array($v, array('post', 'page'));
|
51 |
-
$tcmp->Form->checkbox('metabox_'.$v, $metaboxes[$v]);
|
52 |
-
}
|
53 |
-
$tcmp->Form->nonce('tcmp_license');
|
54 |
-
$tcmp->Form->br();
|
55 |
-
$tcmp->Form->submit('Save');
|
56 |
-
$tcmp->Form->formEnds();
|
57 |
}
|
1 |
+
<?php
|
2 |
+
function tcmp_ui_track() {
|
3 |
+
global $tcmp;
|
4 |
+
|
5 |
+
$track=TCMP_SQS('track', '');
|
6 |
+
if($track!='') {
|
7 |
+
$track=intval($track);
|
8 |
+
$tcmp->Options->setTrackingEnable($track);
|
9 |
+
$tcmp->Tracking->sendTracking(TRUE);
|
10 |
+
}
|
11 |
+
|
12 |
+
$uri=TCMP_TAB_SETTINGS_URI.'&track=';
|
13 |
+
if($tcmp->Options->isTrackingEnable()) {
|
14 |
+
$uri.='0';
|
15 |
+
$tcmp->Options->pushSuccessMessage('EnableAllowTrackingNotice', $uri);
|
16 |
+
} else {
|
17 |
+
$uri.='1';
|
18 |
+
$tcmp->Options->pushErrorMessage('DisableAllowTrackingNotice', $uri);
|
19 |
+
}
|
20 |
+
$tcmp->Options->writeMessages();
|
21 |
+
}
|
22 |
+
function tcmp_ui_settings() {
|
23 |
+
global $tcmp;
|
24 |
+
|
25 |
+
$tcmp->Form->prefix='License';
|
26 |
+
if($tcmp->Check->nonce('tcmp_license')) {
|
27 |
+
$options=$tcmp->Options->getMetaboxPostTypes();
|
28 |
+
foreach ($options as $k => $v) {
|
29 |
+
$v=TCMP_ISQS('metabox_' . $k, 0);
|
30 |
+
$options[$k]=$v;
|
31 |
+
}
|
32 |
+
$tcmp->Options->setMetaboxPostTypes($options);
|
33 |
+
|
34 |
+
$tcmp->Options->setHookPriority($tcmp->Utils->iqs('tcmpHookPriority', TCMP_HOOK_PRIORITY_DEFAULT));
|
35 |
+
}
|
36 |
+
|
37 |
+
$tcmp->Form->formStarts();
|
38 |
+
$tcmp->Form->prefix = 'Priority';
|
39 |
+
$tcmp->Form->p('PrioritySection');
|
40 |
+
$tcmp->Form->number('tcmpHookPriority', $tcmp->Options->getHookPriority());
|
41 |
+
|
42 |
+
$tcmp->Form->prefix='License';
|
43 |
+
$tcmp->Form->p('MetaboxSection');
|
44 |
+
$metaboxes=$tcmp->Options->getMetaboxPostTypes();
|
45 |
+
|
46 |
+
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
47 |
+
foreach ($types as $v) {
|
48 |
+
$v=$v['id'];
|
49 |
+
//$tcmp->Form->tags=TRUE;
|
50 |
+
//$tcmp->Form->premium=!in_array($v, array('post', 'page'));
|
51 |
+
$tcmp->Form->checkbox('metabox_'.$v, $metaboxes[$v]);
|
52 |
+
}
|
53 |
+
$tcmp->Form->nonce('tcmp_license');
|
54 |
+
$tcmp->Form->br();
|
55 |
+
$tcmp->Form->submit('Save');
|
56 |
+
$tcmp->Form->formEnds();
|
57 |
}
|
includes/admin/whatsnew.php
CHANGED
@@ -1,89 +1,89 @@
|
|
1 |
-
<?php
|
2 |
-
define('TCMP_WHATSNEW_VERSION', 8);
|
3 |
-
function tcmp_ui_whats_new() {
|
4 |
-
global $tcmp;
|
5 |
-
$tcmp->Options->setShowWhatsNew(FALSE);
|
6 |
-
$tcmp->Options->setShowWhatsNewSeenVersion(TCMP_WHATSNEW_VERSION);
|
7 |
-
?>
|
8 |
-
<style>
|
9 |
-
.tcmp-grid {
|
10 |
-
margin-left: auto;
|
11 |
-
margin-right: auto;
|
12 |
-
border-spacing: 10px;
|
13 |
-
max-width: 1120px;
|
14 |
-
}
|
15 |
-
.tcmp-grid td, .tcmp-grid td p {
|
16 |
-
font-size:16px;
|
17 |
-
vertical-align: top;
|
18 |
-
}
|
19 |
-
.tcmp-grid td ul {
|
20 |
-
list-style-type: disc;
|
21 |
-
margin-left: 30px!important;
|
22 |
-
}
|
23 |
-
.tcmp-grid td {
|
24 |
-
padding: 20px!important;
|
25 |
-
}
|
26 |
-
.tcmp-headline {
|
27 |
-
font-size:40px;
|
28 |
-
font-weight:bold;
|
29 |
-
text-align:center;
|
30 |
-
margin: 10px!important;
|
31 |
-
}
|
32 |
-
.tcmp-subheadline {
|
33 |
-
font-size:25px!important;
|
34 |
-
font-weight:bold;
|
35 |
-
text-align:left;
|
36 |
-
margin: 0px!important;
|
37 |
-
}
|
38 |
-
</style>
|
39 |
-
|
40 |
-
<p class="tcmp-headline">What's new in Tracking Code Manager?</p>
|
41 |
-
<table border="0" class="tcmp-grid">
|
42 |
-
<tr valign="top">
|
43 |
-
<td valign="top" width="50%">
|
44 |
-
Now the Tracking Code Manager let you:
|
45 |
-
<ul>
|
46 |
-
<li>Use tracking codes by device types</li>
|
47 |
-
<li>Sort tracking codes using drag & drop</li>
|
48 |
-
<li>Shortcode support</li>
|
49 |
-
<li>Fixed 6 small issues</li>
|
50 |
-
<li>Quick support links added</li>
|
51 |
-
</ul>
|
52 |
-
<br>
|
53 |
-
|
54 |
-
<p class="tcmp-subheadline">Dynamic Conversion Values</p>
|
55 |
-
<p>Finally, Dynamic Conversion Values are now available for WooCommerce and Easy Digital Download. Now you can track the values of your conversions on <b>Google Adwords</b> and <b>Facebook Ads</b> (with the <b>New Pixel</b> and relative events like "Purchase" and others), and many other channels.</p>
|
56 |
-
<img src="<?php echo TCMP_PLUGIN_ASSETS_URI ?>landing/tcmp-fb.png" />
|
57 |
-
<br>
|
58 |
-
<br>
|
59 |
-
<div style="float: right;">
|
60 |
-
<a class="button button-secondary" href="<?php echo TCMP_TAB_MANAGER_URI?>&hwb=1">CONTINUE USING FREE VERSION</a>
|
61 |
-
<a class="button button-primary" href="<?php echo TCMP_TAB_DOCS_DCV_URI?>?utm_campaign=whatsnew" target="_blank">SEE MORE ››</a>
|
62 |
-
</div>
|
63 |
-
</td>
|
64 |
-
<td valign="top" width="50%" style="border-left: 1px solid #44444E;">
|
65 |
-
<p class="tcmp-subheadline" style="margin-top: 0px!important;">Introducing the Tracking Code Manager brother!</p>
|
66 |
-
<p>We are proud to introduce Posts' Footer Manager, a free plugin that let you clean and organize the stuff you have in the footer of your blogpost.</p>
|
67 |
-
<p>If you are tired of the MESSY stuff that appears after the content of your pages and articles, you should give it a go.</p>
|
68 |
-
<div style="float: right;">
|
69 |
-
<a class="button button-secondary" href="http://wordpress.org/plugins/intelly-posts-footer-manager" target="_blank">
|
70 |
-
Download Posts' Footer Manager from Wordpress.org ››
|
71 |
-
</a>
|
72 |
-
</div>
|
73 |
-
<br>
|
74 |
-
<br>
|
75 |
-
<br>
|
76 |
-
|
77 |
-
<p class="tcmp-subheadline">Our new awesome Plugins:</p>
|
78 |
-
<p>Built by Marketers, for Marketers.</p>
|
79 |
-
<ul>
|
80 |
-
<li><a href="https://intellywp.com/custom-audiences-enhancer/?utm_campaign=whatsnew" target="_blank">Custom Audiences Enhancer</a></li>
|
81 |
-
<li><a href="https://wordpress.org/plugins/intelly-welcome-bar/" target="_blank">Welcome Bar</a></li>
|
82 |
-
<li><a href="https://wordpress.org/plugins/intelly-related-posts/" target="_blank">Inline Related Posts</a></li>
|
83 |
-
<li><a href="https://wordpress.org/plugins/intelly-countdown/" target="_blank">Evergreen Countdown Timer</a></li>
|
84 |
-
<li><a href="https://wordpress.org/plugins/intelly-posts-footer-manager/" target="_blank">Posts' Footer Manager</a></li>
|
85 |
-
</ul>
|
86 |
-
</td>
|
87 |
-
</tr>
|
88 |
-
</table>
|
89 |
<?php }
|
1 |
+
<?php
|
2 |
+
define('TCMP_WHATSNEW_VERSION', 8);
|
3 |
+
function tcmp_ui_whats_new() {
|
4 |
+
global $tcmp;
|
5 |
+
$tcmp->Options->setShowWhatsNew(FALSE);
|
6 |
+
$tcmp->Options->setShowWhatsNewSeenVersion(TCMP_WHATSNEW_VERSION);
|
7 |
+
?>
|
8 |
+
<style>
|
9 |
+
.tcmp-grid {
|
10 |
+
margin-left: auto;
|
11 |
+
margin-right: auto;
|
12 |
+
border-spacing: 10px;
|
13 |
+
max-width: 1120px;
|
14 |
+
}
|
15 |
+
.tcmp-grid td, .tcmp-grid td p {
|
16 |
+
font-size:16px;
|
17 |
+
vertical-align: top;
|
18 |
+
}
|
19 |
+
.tcmp-grid td ul {
|
20 |
+
list-style-type: disc;
|
21 |
+
margin-left: 30px!important;
|
22 |
+
}
|
23 |
+
.tcmp-grid td {
|
24 |
+
padding: 20px!important;
|
25 |
+
}
|
26 |
+
.tcmp-headline {
|
27 |
+
font-size:40px;
|
28 |
+
font-weight:bold;
|
29 |
+
text-align:center;
|
30 |
+
margin: 10px!important;
|
31 |
+
}
|
32 |
+
.tcmp-subheadline {
|
33 |
+
font-size:25px!important;
|
34 |
+
font-weight:bold;
|
35 |
+
text-align:left;
|
36 |
+
margin: 0px!important;
|
37 |
+
}
|
38 |
+
</style>
|
39 |
+
|
40 |
+
<p class="tcmp-headline">What's new in Tracking Code Manager?</p>
|
41 |
+
<table border="0" class="tcmp-grid">
|
42 |
+
<tr valign="top">
|
43 |
+
<td valign="top" width="50%">
|
44 |
+
Now the Tracking Code Manager let you:
|
45 |
+
<ul>
|
46 |
+
<li>Use tracking codes by device types</li>
|
47 |
+
<li>Sort tracking codes using drag & drop</li>
|
48 |
+
<li>Shortcode support</li>
|
49 |
+
<li>Fixed 6 small issues</li>
|
50 |
+
<li>Quick support links added</li>
|
51 |
+
</ul>
|
52 |
+
<br>
|
53 |
+
|
54 |
+
<p class="tcmp-subheadline">Dynamic Conversion Values</p>
|
55 |
+
<p>Finally, Dynamic Conversion Values are now available for WooCommerce and Easy Digital Download. Now you can track the values of your conversions on <b>Google Adwords</b> and <b>Facebook Ads</b> (with the <b>New Pixel</b> and relative events like "Purchase" and others), and many other channels.</p>
|
56 |
+
<img src="<?php echo TCMP_PLUGIN_ASSETS_URI ?>landing/tcmp-fb.png" />
|
57 |
+
<br>
|
58 |
+
<br>
|
59 |
+
<div style="float: right;">
|
60 |
+
<a class="button button-secondary" href="<?php echo TCMP_TAB_MANAGER_URI?>&hwb=1">CONTINUE USING FREE VERSION</a>
|
61 |
+
<a class="button button-primary" href="<?php echo TCMP_TAB_DOCS_DCV_URI?>?utm_campaign=whatsnew" target="_blank">SEE MORE ››</a>
|
62 |
+
</div>
|
63 |
+
</td>
|
64 |
+
<td valign="top" width="50%" style="border-left: 1px solid #44444E;">
|
65 |
+
<p class="tcmp-subheadline" style="margin-top: 0px!important;">Introducing the Tracking Code Manager brother!</p>
|
66 |
+
<p>We are proud to introduce Posts' Footer Manager, a free plugin that let you clean and organize the stuff you have in the footer of your blogpost.</p>
|
67 |
+
<p>If you are tired of the MESSY stuff that appears after the content of your pages and articles, you should give it a go.</p>
|
68 |
+
<div style="float: right;">
|
69 |
+
<a class="button button-secondary" href="http://wordpress.org/plugins/intelly-posts-footer-manager" target="_blank">
|
70 |
+
Download Posts' Footer Manager from Wordpress.org ››
|
71 |
+
</a>
|
72 |
+
</div>
|
73 |
+
<br>
|
74 |
+
<br>
|
75 |
+
<br>
|
76 |
+
|
77 |
+
<p class="tcmp-subheadline">Our new awesome Plugins:</p>
|
78 |
+
<p>Built by Marketers, for Marketers.</p>
|
79 |
+
<ul>
|
80 |
+
<li><a href="https://intellywp.com/custom-audiences-enhancer/?utm_campaign=whatsnew" target="_blank">Custom Audiences Enhancer</a></li>
|
81 |
+
<li><a href="https://wordpress.org/plugins/intelly-welcome-bar/" target="_blank">Welcome Bar</a></li>
|
82 |
+
<li><a href="https://wordpress.org/plugins/intelly-related-posts/" target="_blank">Inline Related Posts</a></li>
|
83 |
+
<li><a href="https://wordpress.org/plugins/intelly-countdown/" target="_blank">Evergreen Countdown Timer</a></li>
|
84 |
+
<li><a href="https://wordpress.org/plugins/intelly-posts-footer-manager/" target="_blank">Posts' Footer Manager</a></li>
|
85 |
+
</ul>
|
86 |
+
</td>
|
87 |
+
</tr>
|
88 |
+
</table>
|
89 |
<?php }
|
includes/classes/core/Manager.php
CHANGED
@@ -1,658 +1,658 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class TCMP_Manager {
|
5 |
-
public function __construct() {
|
6 |
-
}
|
7 |
-
public function init() {
|
8 |
-
add_action('wp_ajax_TCMP_changeOrder', array(&$this, 'changeOrder'));
|
9 |
-
}
|
10 |
-
public function isLimitReached($notice=TRUE) {
|
11 |
-
global $tcmp;
|
12 |
-
$cnt=$this->codesCount();
|
13 |
-
$result=($cnt>=TCMP_SNIPPETS_LIMIT);
|
14 |
-
if ($result && $notice) {
|
15 |
-
$tcmp->Options->pushWarningMessage('SnippetsLimitReached', TCMP_SNIPPETS_LIMIT, TCMP_PAGE_PREMIUM);
|
16 |
-
} elseif($notice && $cnt>0) {
|
17 |
-
$tcmp->Options->pushSuccessMessage('SnippetsLimitNotice', $cnt, TCMP_SNIPPETS_LIMIT, TCMP_PAGE_PREMIUM);
|
18 |
-
}
|
19 |
-
return $result;
|
20 |
-
}
|
21 |
-
public function changeOrder() {
|
22 |
-
global $tcmp;
|
23 |
-
if(!isset($_POST['order'])) {
|
24 |
-
return;
|
25 |
-
}
|
26 |
-
|
27 |
-
$data=array();
|
28 |
-
parse_str(TCMP_SQS('order'), $data);
|
29 |
-
|
30 |
-
if (isset($data['row'])) {
|
31 |
-
$snippets=$this->values();
|
32 |
-
foreach($snippets as $id=>$v) {
|
33 |
-
$v['order']=0;
|
34 |
-
$snippets[$id]=$v;
|
35 |
-
}
|
36 |
-
|
37 |
-
$index=1;
|
38 |
-
foreach($data['row'] as $order=>$id) {
|
39 |
-
$v=$snippets[$id];
|
40 |
-
$v['order']=$index;
|
41 |
-
$snippets[$id]=$v;
|
42 |
-
++$index;
|
43 |
-
}
|
44 |
-
|
45 |
-
foreach($snippets as $id=>$v) {
|
46 |
-
$this->put($id, $v);
|
47 |
-
}
|
48 |
-
}
|
49 |
-
echo 'OK';
|
50 |
-
wp_die();
|
51 |
-
}
|
52 |
-
|
53 |
-
public function matchDeviceType($snippet) {
|
54 |
-
global $tcmp;
|
55 |
-
$deviceType=$tcmp->Utils->get($snippet, 'deviceType', FALSE);
|
56 |
-
$deviceType=$tcmp->Utils->toArray($deviceType);
|
57 |
-
if($deviceType===FALSE || count($deviceType)==0) {
|
58 |
-
return TRUE;
|
59 |
-
}
|
60 |
-
|
61 |
-
$detect=new TCMP_Mobile_Detect();
|
62 |
-
if ($detect->isMobile()) {
|
63 |
-
$type=TCMP_DEVICE_TYPE_MOBILE;
|
64 |
-
} elseif($detect->isTablet()){
|
65 |
-
$type=TCMP_DEVICE_TYPE_TABLET;
|
66 |
-
} else { //if(!$detect->isMobile() && !$detect->isTablet()) {
|
67 |
-
$type=TCMP_DEVICE_TYPE_DESKTOP;
|
68 |
-
}
|
69 |
-
|
70 |
-
$result=FALSE;
|
71 |
-
if(in_array(TCMP_DEVICE_TYPE_ALL, $deviceType) || in_array($type, $deviceType)) {
|
72 |
-
$result=TRUE;
|
73 |
-
}
|
74 |
-
return $result;
|
75 |
-
}
|
76 |
-
public function isModeScript($snippet) {
|
77 |
-
global $tcmp;
|
78 |
-
$result=$tcmp->Utils->iget($snippet, 'trackMode', 0);
|
79 |
-
return ($result==0);
|
80 |
-
}
|
81 |
-
public function isModeConversion($snippet) {
|
82 |
-
global $tcmp;
|
83 |
-
$result=$tcmp->Utils->iget($snippet, 'trackMode', 0);
|
84 |
-
return ($result!=0);
|
85 |
-
}
|
86 |
-
public function isPageEverywhere($snippet) {
|
87 |
-
global $tcmp;
|
88 |
-
if(!$this->isModeScript($snippet)) {
|
89 |
-
return FALSE;
|
90 |
-
}
|
91 |
-
|
92 |
-
$result=$tcmp->Utils->iget($snippet, 'trackPage', 0);
|
93 |
-
return ($result==TCMP_TRACK_PAGE_ALL);
|
94 |
-
}
|
95 |
-
public function isPageSpecific($snippet) {
|
96 |
-
global $tcmp;
|
97 |
-
if(!$this->isModeScript($snippet)) {
|
98 |
-
return FALSE;
|
99 |
-
}
|
100 |
-
|
101 |
-
$result=$tcmp->Utils->iget($snippet, 'trackPage', 0);
|
102 |
-
return ($result==TCMP_TRACK_PAGE_SPECIFIC);
|
103 |
-
}
|
104 |
-
|
105 |
-
public function exists($name) {
|
106 |
-
$snippets=$this->values();
|
107 |
-
$result=NULL;
|
108 |
-
$name=strtoupper($name);
|
109 |
-
if (isset($snippets[$name])) {
|
110 |
-
$result=$snippets[$name];
|
111 |
-
}
|
112 |
-
return $result;
|
113 |
-
}
|
114 |
-
|
115 |
-
//get a code snippet
|
116 |
-
public function get($id, $new=FALSE) {
|
117 |
-
global $tcmp;
|
118 |
-
|
119 |
-
$snippet=$tcmp->Options->getSnippet($id);
|
120 |
-
if (!$snippet && $new) {
|
121 |
-
$snippet=array();
|
122 |
-
$snippet['active']=1;
|
123 |
-
$snippet['trackMode']=-1;
|
124 |
-
$snippet['trackPage']=-1;
|
125 |
-
}
|
126 |
-
|
127 |
-
$snippet=$this->sanitize($id, $snippet);
|
128 |
-
return $snippet;
|
129 |
-
}
|
130 |
-
|
131 |
-
public function sanitize($id, $snippet) {
|
132 |
-
global $tcmp;
|
133 |
-
if($snippet==NULL || !is_array($snippet)) return NULL;
|
134 |
-
|
135 |
-
$page=0;
|
136 |
-
if(isset($snippet['includeEverywhereActive'])) {
|
137 |
-
$page=(intval($snippet['includeEverywhereActive']==1) ? 0 : 1);
|
138 |
-
}
|
139 |
-
$defaults=array(
|
140 |
-
'id'=>$id
|
141 |
-
, 'active'=>0
|
142 |
-
, 'name'=>''
|
143 |
-
, 'code'=>''
|
144 |
-
, 'order'=>1000
|
145 |
-
, 'position'=>TCMP_POSITION_HEAD
|
146 |
-
, 'trackMode'=>TCMP_TRACK_MODE_CODE
|
147 |
-
, 'trackPage'=>$page
|
148 |
-
, 'includeEverywhereActive'=>0
|
149 |
-
, 'includeCategoriesActive'=>0
|
150 |
-
, 'includeCategories'=>array()
|
151 |
-
, 'includeTagsActive'=>0
|
152 |
-
, 'includeTags'=>array()
|
153 |
-
, 'exceptCategoriesActive'=>0
|
154 |
-
, 'exceptCategories'=>array()
|
155 |
-
, 'exceptTagsActive'=>0
|
156 |
-
, 'exceptTags'=>array()
|
157 |
-
, 'deviceType'=>TCMP_DEVICE_TYPE_ALL
|
158 |
-
);
|
159 |
-
|
160 |
-
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
161 |
-
foreach($types as $v) {
|
162 |
-
$defaults['includePostsOfType_'.$v['id'].'_Active']=0;
|
163 |
-
$defaults['includePostsOfType_'.$v['id']]=array();
|
164 |
-
$defaults['exceptPostsOfType_'.$v['id'].'_Active']=0;
|
165 |
-
$defaults['exceptPostsOfType_'.$v['id']]=array();
|
166 |
-
}
|
167 |
-
|
168 |
-
$types=$tcmp->Utils->query(TCMP_QUERY_CONVERSION_PLUGINS);
|
169 |
-
foreach($types as $v) {
|
170 |
-
//CP stands for ConversionTrackingCode
|
171 |
-
//$defaults['CTC_'.$v['id'].'_Active']=0;
|
172 |
-
$defaults['CTC_'.$v['id'].'_ProductsIds']=array();
|
173 |
-
$defaults['CTC_'.$v['id'].'_CategoriesIds']=array();
|
174 |
-
$defaults['CTC_'.$v['id'].'_TagsIds']=array();
|
175 |
-
}
|
176 |
-
$snippet=$tcmp->Utils->parseArgs($snippet, $defaults);
|
177 |
-
|
178 |
-
foreach ($snippet as $k => $v) {
|
179 |
-
if (stripos($k, 'active') !== FALSE) {
|
180 |
-
$snippet[$k]=intval($v);
|
181 |
-
} elseif (is_array($v)) {
|
182 |
-
switch ($k) {
|
183 |
-
/*
|
184 |
-
case 'includePostsTypes':
|
185 |
-
case 'excludePostsTypes':
|
186 |
-
//keys are string and not number
|
187 |
-
$result=$this->uarray($snippet, $k, FALSE);
|
188 |
-
break;
|
189 |
-
*/
|
190 |
-
default:
|
191 |
-
//keys are number
|
192 |
-
$result=$this->uarray($snippet, $k, TRUE);
|
193 |
-
break;
|
194 |
-
}
|
195 |
-
}
|
196 |
-
}
|
197 |
-
$snippet['code']=trim($snippet['code']);
|
198 |
-
$snippet['position']=intval($snippet['position']);
|
199 |
-
if($snippet['trackMode']==='') {
|
200 |
-
$snippet['trackMode']=TCMP_TRACK_MODE_CODE;
|
201 |
-
} else {
|
202 |
-
$snippet['trackMode']=intval($snippet['trackMode']);
|
203 |
-
}
|
204 |
-
if($snippet['trackPage']==='') {
|
205 |
-
$snippet['trackPage']=$page;
|
206 |
-
} else {
|
207 |
-
$snippet['trackPage']=intval($snippet['trackPage']);
|
208 |
-
}
|
209 |
-
|
210 |
-
$snippet['includeEverywhereActive']=0;
|
211 |
-
if($snippet['trackPage']==TCMP_TRACK_PAGE_ALL) {
|
212 |
-
$snippet['includeEverywhereActive']=1;
|
213 |
-
}
|
214 |
-
|
215 |
-
$code=strtolower($snippet['code']);
|
216 |
-
$cnt=substr_count($code, '<iframe')+substr_count($code, '<script');
|
217 |
-
if($cnt<=0) {
|
218 |
-
$cnt=1;
|
219 |
-
}
|
220 |
-
$snippet['codesCount']=$cnt;
|
221 |
-
return $snippet;
|
222 |
-
}
|
223 |
-
private function uarray($snippet, $key, $isInteger=TRUE) {
|
224 |
-
$array=$snippet[$key];
|
225 |
-
if (!is_array($array)) {
|
226 |
-
$array=explode(',', $array);
|
227 |
-
}
|
228 |
-
|
229 |
-
if ($isInteger) {
|
230 |
-
for ($i=0; $i < count($array); $i++) {
|
231 |
-
$array[$i]=intval($array[$i]);
|
232 |
-
}
|
233 |
-
}
|
234 |
-
|
235 |
-
$array=array_unique($array);
|
236 |
-
$snippet[$key]=$array;
|
237 |
-
return $snippet;
|
238 |
-
}
|
239 |
-
|
240 |
-
//add or update a snippet (html tracking code)
|
241 |
-
public function put($id, $snippet) {
|
242 |
-
global $tcmp;
|
243 |
-
|
244 |
-
if ($id == '' || intval($id) <= 0) {
|
245 |
-
//if is a new code create a new unique id
|
246 |
-
$id=$this->getLastId() + 1;
|
247 |
-
$snippet['id']=$id;
|
248 |
-
}
|
249 |
-
$snippet=$this->sanitize($id, $snippet);
|
250 |
-
$tcmp->Options->setSnippet($id, $snippet);
|
251 |
-
|
252 |
-
$keys=$this->keys();
|
253 |
-
if (is_array($keys) && !in_array($id, $keys)) {
|
254 |
-
$keys[]=$id;
|
255 |
-
$this->keys($keys);
|
256 |
-
}
|
257 |
-
return $snippet;
|
258 |
-
}
|
259 |
-
|
260 |
-
//remove the id snippet
|
261 |
-
public function remove($id) {
|
262 |
-
global $tcmp;
|
263 |
-
$tcmp->Options->removeSnippet($id);
|
264 |
-
$keys=$this->keys();
|
265 |
-
$result=FALSE;
|
266 |
-
if (is_array($keys) && in_array($id, $keys)) {
|
267 |
-
$keys=array_diff($keys, array($id));
|
268 |
-
$this->keys($keys);
|
269 |
-
$result=TRUE;
|
270 |
-
}
|
271 |
-
return $result;
|
272 |
-
}
|
273 |
-
|
274 |
-
//verify if match with this snippet
|
275 |
-
private function matchSnippet($postId, $postType, $categoriesIds, $tagsIds, $prefix, $snippet) {
|
276 |
-
global $tcmp;
|
277 |
-
if(!$this->matchDeviceType($snippet)) {
|
278 |
-
return FALSE;
|
279 |
-
}
|
280 |
-
|
281 |
-
$include=FALSE;
|
282 |
-
$postId=intval($postId);
|
283 |
-
if($postId>0) {
|
284 |
-
$what=$prefix.'PostsOfType_'.$postType;
|
285 |
-
if(!$include && isset($snippet[$what.'_Active']) && isset($snippet[$what])&& $snippet[$what.'_Active'] && $tcmp->Utils->inAllArray($postId, $snippet[$what])) {
|
286 |
-
$tcmp->Log->debug('MATCH=%s SNIPPET=%s[%s] DUE TO POST=%s OF TYPE=%s IN [%s]'
|
287 |
-
, $prefix, $snippet['id'], $snippet['name'], $postId, $postType, $snippet[$what]);
|
288 |
-
$include=TRUE;
|
289 |
-
}
|
290 |
-
}
|
291 |
-
|
292 |
-
return $include;
|
293 |
-
}
|
294 |
-
|
295 |
-
public function writeCodes($position) {
|
296 |
-
global $tcmp;
|
297 |
-
|
298 |
-
$text='';
|
299 |
-
switch ($position) {
|
300 |
-
case TCMP_POSITION_HEAD:
|
301 |
-
$text='HEAD';
|
302 |
-
break;
|
303 |
-
case TCMP_POSITION_BODY:
|
304 |
-
$text='BODY';
|
305 |
-
break;
|
306 |
-
case TCMP_POSITION_FOOTER:
|
307 |
-
$text='FOOTER';
|
308 |
-
break;
|
309 |
-
case TCMP_POSITION_CONVERSION:
|
310 |
-
$text='CONVERSION';
|
311 |
-
break;
|
312 |
-
}
|
313 |
-
|
314 |
-
$post=$tcmp->Options->getPostShown();
|
315 |
-
$args=array('field'=>'code');
|
316 |
-
$codes=$tcmp->Manager->getCodes($position, $post, $args);
|
317 |
-
if(is_array($codes) && count($codes)>0) {
|
318 |
-
ob_start();
|
319 |
-
echo "\n<!--BEGIN: TRACKING CODE MANAGER BY INTELLYWP.COM IN $text//-->";
|
320 |
-
foreach($codes as $v) {
|
321 |
-
echo "\n$v";
|
322 |
-
}
|
323 |
-
echo "\n<!--END: https://wordpress.org/plugins/tracking-code-manager IN $text//-->";
|
324 |
-
$text=ob_get_contents();
|
325 |
-
ob_end_clean();
|
326 |
-
|
327 |
-
$purchase=$tcmp->Options->getEcommercePurchase();
|
328 |
-
if($purchase!==FALSE && intval($tcmp->Options->getLicenseSiteCount())>0) {
|
329 |
-
//retrieve user data
|
330 |
-
$purchase->userId=intval($purchase->userId);
|
331 |
-
if($purchase->userId>0) {
|
332 |
-
$user=get_user_by('id', $purchase->userId);
|
333 |
-
if(!is_null($user) && $user!==FALSE && get_class($user)=='WP_User') {
|
334 |
-
/* @var $user WP_User */
|
335 |
-
$purchase->email=$user->user_email;
|
336 |
-
$purchase->fullname=$user->user_firstname;
|
337 |
-
if($user->user_lastname!='') {
|
338 |
-
$purchase->fullname.=' '.$user->user_lastname;
|
339 |
-
}
|
340 |
-
}
|
341 |
-
}
|
342 |
-
|
343 |
-
$purchase->total=floatval($purchase->total);
|
344 |
-
$purchase->amount=floatval($purchase->amount);
|
345 |
-
$purchase->tax=floatval($purchase->tax);
|
346 |
-
|
347 |
-
$fields=array(
|
348 |
-
'ORDERID'=>$purchase->orderId
|
349 |
-
, 'CURRENCY'=>$purchase->currency
|
350 |
-
, 'FULLNAME'=>$purchase->fullname
|
351 |
-
, 'EMAIL'=>$purchase->email
|
352 |
-
, 'PRODUCTS'=>$purchase->products
|
353 |
-
, 'AMOUNT'=>$purchase->amount
|
354 |
-
, 'TOTAL'=>$purchase->total
|
355 |
-
, 'TAX'=>$purchase->tax
|
356 |
-
);
|
357 |
-
|
358 |
-
$sep='@@';
|
359 |
-
$buffer='';
|
360 |
-
$previous=0;
|
361 |
-
$start=strpos($text, $sep);
|
362 |
-
if($start===FALSE) {
|
363 |
-
$buffer=$text;
|
364 |
-
} else {
|
365 |
-
while($start!==FALSE) {
|
366 |
-
$buffer.=$tcmp->Utils->substr($text, $previous, $start);
|
367 |
-
$end=strpos($text, $sep, $start+strlen($sep));
|
368 |
-
if($end!==FALSE) {
|
369 |
-
$code=$tcmp->Utils->substr($text, $start+strlen($sep), $end);
|
370 |
-
$code=$tcmp->Utils->toArray($code);
|
371 |
-
if(count($code)==1) {
|
372 |
-
$code[]='';
|
373 |
-
}
|
374 |
-
|
375 |
-
$v=FALSE;
|
376 |
-
if(isset($fields[$code[0]])) {
|
377 |
-
$v=$fields[$code[0]];
|
378 |
-
}
|
379 |
-
if(is_null($v) || $v===FALSE) {
|
380 |
-
$v=$code[1];
|
381 |
-
}
|
382 |
-
if(is_numeric($v)) {
|
383 |
-
$v=floatval($v);
|
384 |
-
$v=round($v, 2);
|
385 |
-
switch ($code[0]) {
|
386 |
-
case 'TOTAL':
|
387 |
-
case 'AMOUNT':
|
388 |
-
case 'TAX':
|
389 |
-
$v=number_format($v, 2, '.', '');
|
390 |
-
break;
|
391 |
-
default:
|
392 |
-
$v=intval($v);
|
393 |
-
break;
|
394 |
-
}
|
395 |
-
} elseif(is_array($v)) {
|
396 |
-
$a='';
|
397 |
-
foreach($v as $t) {
|
398 |
-
$t=str_replace(',', '', $t);
|
399 |
-
if($a!='') {
|
400 |
-
$a.=',';
|
401 |
-
}
|
402 |
-
$a.=$t;
|
403 |
-
}
|
404 |
-
$v=$a;
|
405 |
-
}
|
406 |
-
$v=str_replace("'", '', $v);
|
407 |
-
$v=str_replace('"', '', $v);
|
408 |
-
$buffer.=$v;
|
409 |
-
|
410 |
-
$previous=$end+strlen($sep);
|
411 |
-
$start=strpos($text, $sep, $previous);
|
412 |
-
} else {
|
413 |
-
$buffer.=$tcmp->Utils->substr($text, $start);
|
414 |
-
$previous=FALSE;
|
415 |
-
$start=FALSE;
|
416 |
-
}
|
417 |
-
}
|
418 |
-
|
419 |
-
if ($previous !== FALSE && $previous < strlen($text)) {
|
420 |
-
$code = $tcmp->Utils->substr($text, $previous);
|
421 |
-
$buffer .= $code;
|
422 |
-
}
|
423 |
-
}
|
424 |
-
$text=$buffer;
|
425 |
-
}
|
426 |
-
echo $text;
|
427 |
-
}
|
428 |
-
}
|
429 |
-
|
430 |
-
//return snippets that match with options
|
431 |
-
public function getConversionSnippets($options=NULL) {
|
432 |
-
global $tcmp;
|
433 |
-
|
434 |
-
$defaults=array(
|
435 |
-
'pluginId'=>0
|
436 |
-
, 'categoriesIds'=>array()
|
437 |
-
, 'productsIds'=>array()
|
438 |
-
, 'tagsIds'=>array()
|
439 |
-
);
|
440 |
-
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
441 |
-
|
442 |
-
$result=array();
|
443 |
-
$pluginId=intval($options['pluginId']);
|
444 |
-
$values=$this->values();
|
445 |
-
|
446 |
-
foreach($values as $snippet) {
|
447 |
-
$snippet['trackMode']=intval($snippet['trackMode']);
|
448 |
-
if($snippet && $snippet['trackMode']>0 && $snippet['trackMode']==$pluginId) {
|
449 |
-
$match=FALSE;
|
450 |
-
|
451 |
-
$match=($match || $this->matchConversion($snippet, $pluginId, 'ProductsIds', $options['productsIds']));
|
452 |
-
$match=($match && $this->matchDeviceType($snippet));
|
453 |
-
if(!$match) {
|
454 |
-
//no selected so..all match! :)
|
455 |
-
if(count($snippet['CTC_'.$pluginId.'_ProductsIds'])==0
|
456 |
-
&& count($snippet['CTC_'.$pluginId.'_CategoriesIds'])==0
|
457 |
-
&& count($snippet['CTC_'.$pluginId.'_TagsIds'])==0) {
|
458 |
-
$match=TRUE;
|
459 |
-
}
|
460 |
-
}
|
461 |
-
|
462 |
-
if($match) {
|
463 |
-
$result[]=$snippet;
|
464 |
-
}
|
465 |
-
}
|
466 |
-
}
|
467 |
-
return $result;
|
468 |
-
}
|
469 |
-
private function matchConversion($snippet, $pluginId, $suffix, $currentIds) {
|
470 |
-
global $tcmp;
|
471 |
-
|
472 |
-
$settingsIds='CTC_'.$pluginId.'_'.$suffix;
|
473 |
-
if(isset($snippet[$settingsIds])) {
|
474 |
-
$settingsIds=$snippet[$settingsIds];
|
475 |
-
} else {
|
476 |
-
$settingsIds=array();
|
477 |
-
}
|
478 |
-
|
479 |
-
$result=$tcmp->Utils->inAllArray($currentIds, $settingsIds);
|
480 |
-
return $result;
|
481 |
-
}
|
482 |
-
|
483 |
-
//from a post retrieve the html code that is needed to insert into the page code
|
484 |
-
public function getCodes($position, $post, $args=array()) {
|
485 |
-
global $tcmp;
|
486 |
-
|
487 |
-
$defaults=array('field'=>'code');
|
488 |
-
$args=$tcmp->Utils->parseArgs($args, $defaults);
|
489 |
-
|
490 |
-
$postId=0;
|
491 |
-
$postType='page';
|
492 |
-
$tagsIds=array();
|
493 |
-
$categoriesIds=array();
|
494 |
-
if($post) {
|
495 |
-
$postId=$tcmp->Utils->get($post, 'ID', FALSE);
|
496 |
-
if($postId===FALSE) {
|
497 |
-
$postId=$tcmp->Utils->get($post, 'post_ID');
|
498 |
-
}
|
499 |
-
$postType=$tcmp->Utils->get($post, 'post_type');
|
500 |
-
|
501 |
-
$options=array('orderby' => 'name', 'order' => 'ASC', 'fields' => 'ids');
|
502 |
-
if(isset($post->ID)) {
|
503 |
-
$tagsIds=wp_get_post_tags($post->ID, $options);
|
504 |
-
$categoriesIds=wp_get_post_categories($post->ID);
|
505 |
-
} else {
|
506 |
-
$tagsIds=array();
|
507 |
-
$categoriesIds=array();
|
508 |
-
}
|
509 |
-
}
|
510 |
-
|
511 |
-
$tcmp->Options->clearSnippetsWritten();
|
512 |
-
if($position==TCMP_POSITION_CONVERSION) {
|
513 |
-
//write snippets previously appended
|
514 |
-
$ids=$tcmp->Options->getConversionSnippetIds();
|
515 |
-
if($ids!==FALSE && count($ids)>0) {
|
516 |
-
foreach($ids as $id) {
|
517 |
-
$snippet=$tcmp->Manager->get($id);
|
518 |
-
if($snippet) {
|
519 |
-
$tcmp->Options->pushSnippetWritten($snippet);
|
520 |
-
}
|
521 |
-
}
|
522 |
-
}
|
523 |
-
} else {
|
524 |
-
$snippets=$this->values();
|
525 |
-
foreach ($snippets as $v) {
|
526 |
-
if(!$v || ($position>-1 && $v['position']!=$position) || $v['code']=='' || !$v['active']) {
|
527 |
-
continue;
|
528 |
-
}
|
529 |
-
if ($v['trackMode']!=TCMP_TRACK_MODE_CODE) {
|
530 |
-
continue;
|
531 |
-
}
|
532 |
-
if($tcmp->Options->hasSnippetWritten($v)) {
|
533 |
-
$tcmp->Log->debug('SKIPPED SNIPPET=%s[%s] DUE TO ALREADY WRITTEN', $v['id'], $v['name']);
|
534 |
-
continue;
|
535 |
-
}
|
536 |
-
|
537 |
-
$match=FALSE;
|
538 |
-
if (!$match && ($v['trackPage']==TCMP_TRACK_PAGE_ALL || $v['includeEverywhereActive'])) {
|
539 |
-
$tcmp->Log->debug('INCLUDED SNIPPET=%s[%s] DUE TO EVERYWHERE', $v['id'], $v['name']);
|
540 |
-
$match=TRUE;
|
541 |
-
}
|
542 |
-
if(!$match && $postId>0 && $this->matchSnippet($postId, $postType, $categoriesIds, $tagsIds, 'include', $v)) {
|
543 |
-
$match=TRUE;
|
544 |
-
}
|
545 |
-
|
546 |
-
if($match && $postId>0) {
|
547 |
-
if($this->matchSnippet($postId, $postType, $categoriesIds, $tagsIds, 'except', $v)) {
|
548 |
-
$tcmp->Log->debug('FOUND AT LEAST ON EXCEPT TO EXCLUDE SNIPPET=%s [%s]', $v['id'], $v['name']);
|
549 |
-
$match=FALSE;
|
550 |
-
}
|
551 |
-
}
|
552 |
-
|
553 |
-
if ($match) {
|
554 |
-
$tcmp->Options->pushSnippetWritten($v);
|
555 |
-
}
|
556 |
-
}
|
557 |
-
}
|
558 |
-
|
559 |
-
//obtain result as snippets or array of one field (tipically "id")
|
560 |
-
$result=$tcmp->Options->getSnippetsWritten();
|
561 |
-
if ($args['field']!='all') {
|
562 |
-
$array=array();
|
563 |
-
foreach($result as $k=>$v) {
|
564 |
-
$k=$args['field'];
|
565 |
-
if(isset($v[$k])) {
|
566 |
-
$array[]=$v[$k];
|
567 |
-
} else {
|
568 |
-
$tcmp->Log->error('SNIPPET=%s [%s] WITHOUT FIELD=%s', $v['id'], $v['name'], $k);
|
569 |
-
}
|
570 |
-
}
|
571 |
-
$result=$array;
|
572 |
-
}
|
573 |
-
return $result;
|
574 |
-
}
|
575 |
-
|
576 |
-
//ottiene o salva tutte le chiavi dei tracking code utilizzati ordinati per id
|
577 |
-
public function keys($keys=NULL) {
|
578 |
-
global $tcmp;
|
579 |
-
|
580 |
-
if (is_array($keys)) {
|
581 |
-
$tcmp->Options->setSnippetList($keys);
|
582 |
-
$result=$keys;
|
583 |
-
} else {
|
584 |
-
$result=$tcmp->Options->getSnippetList();
|
585 |
-
}
|
586 |
-
|
587 |
-
if (!is_array($result)) {
|
588 |
-
$result=array();
|
589 |
-
} else {
|
590 |
-
sort($result);
|
591 |
-
}
|
592 |
-
return $result;
|
593 |
-
}
|
594 |
-
|
595 |
-
//ottiene il conteggio attuale dei tracking code
|
596 |
-
public function count() {
|
597 |
-
$result=count($this->keys());
|
598 |
-
return $result;
|
599 |
-
}
|
600 |
-
public function codesCount() {
|
601 |
-
$result=0;
|
602 |
-
$ids=$this->keys();
|
603 |
-
foreach($ids as $id) {
|
604 |
-
$snippet=$this->get($id);
|
605 |
-
if($snippet) {
|
606 |
-
$result+=1;
|
607 |
-
/*
|
608 |
-
if($snippet['codesCount']>0) {
|
609 |
-
$result+=intval($snippet['codesCount']);
|
610 |
-
} else {
|
611 |
-
$result+=1;
|
612 |
-
}
|
613 |
-
*/
|
614 |
-
}
|
615 |
-
}
|
616 |
-
return $result;
|
617 |
-
}
|
618 |
-
public function getLastId() {
|
619 |
-
$result=0;
|
620 |
-
$list=$this->keys();
|
621 |
-
foreach ($list as $v) {
|
622 |
-
$v=intval($v);
|
623 |
-
if ($v>$result) {
|
624 |
-
$result=$v;
|
625 |
-
}
|
626 |
-
}
|
627 |
-
return $result;
|
628 |
-
}
|
629 |
-
|
630 |
-
public function values() {
|
631 |
-
$keys=$this->keys();
|
632 |
-
$array=array();
|
633 |
-
foreach ($keys as $k) {
|
634 |
-
$v=$this->get($k);
|
635 |
-
$array[]=$v;
|
636 |
-
}
|
637 |
-
usort($array, array($this, 'values_Compare'));
|
638 |
-
|
639 |
-
$result=array();
|
640 |
-
foreach($array as $v) {
|
641 |
-
$id=$v['id'];
|
642 |
-
$result[$id]=$v;
|
643 |
-
}
|
644 |
-
return $result;
|
645 |
-
}
|
646 |
-
public function values_Compare($o1, $o2) {
|
647 |
-
global $tcmp;
|
648 |
-
$v1=$tcmp->Utils->iget($o1, 'order', FALSE);
|
649 |
-
$v2=$tcmp->Utils->iget($o2, 'order', FALSE);
|
650 |
-
$result=($v1-$v2);
|
651 |
-
if($result==0) {
|
652 |
-
$v1=$tcmp->Utils->get($o1, 'name', FALSE);
|
653 |
-
$v2=$tcmp->Utils->get($o2, 'name', FALSE);
|
654 |
-
$result=strcasecmp($v1, $v2);
|
655 |
-
}
|
656 |
-
return $result;
|
657 |
-
}
|
658 |
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class TCMP_Manager {
|
5 |
+
public function __construct() {
|
6 |
+
}
|
7 |
+
public function init() {
|
8 |
+
add_action('wp_ajax_TCMP_changeOrder', array(&$this, 'changeOrder'));
|
9 |
+
}
|
10 |
+
public function isLimitReached($notice=TRUE) {
|
11 |
+
global $tcmp;
|
12 |
+
$cnt=$this->codesCount();
|
13 |
+
$result=($cnt>=TCMP_SNIPPETS_LIMIT);
|
14 |
+
if ($result && $notice) {
|
15 |
+
$tcmp->Options->pushWarningMessage('SnippetsLimitReached', TCMP_SNIPPETS_LIMIT, TCMP_PAGE_PREMIUM);
|
16 |
+
} elseif($notice && $cnt>0) {
|
17 |
+
$tcmp->Options->pushSuccessMessage('SnippetsLimitNotice', $cnt, TCMP_SNIPPETS_LIMIT, TCMP_PAGE_PREMIUM);
|
18 |
+
}
|
19 |
+
return $result;
|
20 |
+
}
|
21 |
+
public function changeOrder() {
|
22 |
+
global $tcmp;
|
23 |
+
if(!isset($_POST['order'])) {
|
24 |
+
return;
|
25 |
+
}
|
26 |
+
|
27 |
+
$data=array();
|
28 |
+
parse_str(TCMP_SQS('order'), $data);
|
29 |
+
|
30 |
+
if (isset($data['row'])) {
|
31 |
+
$snippets=$this->values();
|
32 |
+
foreach($snippets as $id=>$v) {
|
33 |
+
$v['order']=0;
|
34 |
+
$snippets[$id]=$v;
|
35 |
+
}
|
36 |
+
|
37 |
+
$index=1;
|
38 |
+
foreach($data['row'] as $order=>$id) {
|
39 |
+
$v=$snippets[$id];
|
40 |
+
$v['order']=$index;
|
41 |
+
$snippets[$id]=$v;
|
42 |
+
++$index;
|
43 |
+
}
|
44 |
+
|
45 |
+
foreach($snippets as $id=>$v) {
|
46 |
+
$this->put($id, $v);
|
47 |
+
}
|
48 |
+
}
|
49 |
+
echo 'OK';
|
50 |
+
wp_die();
|
51 |
+
}
|
52 |
+
|
53 |
+
public function matchDeviceType($snippet) {
|
54 |
+
global $tcmp;
|
55 |
+
$deviceType=$tcmp->Utils->get($snippet, 'deviceType', FALSE);
|
56 |
+
$deviceType=$tcmp->Utils->toArray($deviceType);
|
57 |
+
if($deviceType===FALSE || count($deviceType)==0) {
|
58 |
+
return TRUE;
|
59 |
+
}
|
60 |
+
|
61 |
+
$detect=new TCMP_Mobile_Detect();
|
62 |
+
if ($detect->isMobile()) {
|
63 |
+
$type=TCMP_DEVICE_TYPE_MOBILE;
|
64 |
+
} elseif($detect->isTablet()){
|
65 |
+
$type=TCMP_DEVICE_TYPE_TABLET;
|
66 |
+
} else { //if(!$detect->isMobile() && !$detect->isTablet()) {
|
67 |
+
$type=TCMP_DEVICE_TYPE_DESKTOP;
|
68 |
+
}
|
69 |
+
|
70 |
+
$result=FALSE;
|
71 |
+
if(in_array(TCMP_DEVICE_TYPE_ALL, $deviceType) || in_array($type, $deviceType)) {
|
72 |
+
$result=TRUE;
|
73 |
+
}
|
74 |
+
return $result;
|
75 |
+
}
|
76 |
+
public function isModeScript($snippet) {
|
77 |
+
global $tcmp;
|
78 |
+
$result=$tcmp->Utils->iget($snippet, 'trackMode', 0);
|
79 |
+
return ($result==0);
|
80 |
+
}
|
81 |
+
public function isModeConversion($snippet) {
|
82 |
+
global $tcmp;
|
83 |
+
$result=$tcmp->Utils->iget($snippet, 'trackMode', 0);
|
84 |
+
return ($result!=0);
|
85 |
+
}
|
86 |
+
public function isPageEverywhere($snippet) {
|
87 |
+
global $tcmp;
|
88 |
+
if(!$this->isModeScript($snippet)) {
|
89 |
+
return FALSE;
|
90 |
+
}
|
91 |
+
|
92 |
+
$result=$tcmp->Utils->iget($snippet, 'trackPage', 0);
|
93 |
+
return ($result==TCMP_TRACK_PAGE_ALL);
|
94 |
+
}
|
95 |
+
public function isPageSpecific($snippet) {
|
96 |
+
global $tcmp;
|
97 |
+
if(!$this->isModeScript($snippet)) {
|
98 |
+
return FALSE;
|
99 |
+
}
|
100 |
+
|
101 |
+
$result=$tcmp->Utils->iget($snippet, 'trackPage', 0);
|
102 |
+
return ($result==TCMP_TRACK_PAGE_SPECIFIC);
|
103 |
+
}
|
104 |
+
|
105 |
+
public function exists($name) {
|
106 |
+
$snippets=$this->values();
|
107 |
+
$result=NULL;
|
108 |
+
$name=strtoupper($name);
|
109 |
+
if (isset($snippets[$name])) {
|
110 |
+
$result=$snippets[$name];
|
111 |
+
}
|
112 |
+
return $result;
|
113 |
+
}
|
114 |
+
|
115 |
+
//get a code snippet
|
116 |
+
public function get($id, $new=FALSE) {
|
117 |
+
global $tcmp;
|
118 |
+
|
119 |
+
$snippet=$tcmp->Options->getSnippet($id);
|
120 |
+
if (!$snippet && $new) {
|
121 |
+
$snippet=array();
|
122 |
+
$snippet['active']=1;
|
123 |
+
$snippet['trackMode']=-1;
|
124 |
+
$snippet['trackPage']=-1;
|
125 |
+
}
|
126 |
+
|
127 |
+
$snippet=$this->sanitize($id, $snippet);
|
128 |
+
return $snippet;
|
129 |
+
}
|
130 |
+
|
131 |
+
public function sanitize($id, $snippet) {
|
132 |
+
global $tcmp;
|
133 |
+
if($snippet==NULL || !is_array($snippet)) return NULL;
|
134 |
+
|
135 |
+
$page=0;
|
136 |
+
if(isset($snippet['includeEverywhereActive'])) {
|
137 |
+
$page=(intval($snippet['includeEverywhereActive']==1) ? 0 : 1);
|
138 |
+
}
|
139 |
+
$defaults=array(
|
140 |
+
'id'=>$id
|
141 |
+
, 'active'=>0
|
142 |
+
, 'name'=>''
|
143 |
+
, 'code'=>''
|
144 |
+
, 'order'=>1000
|
145 |
+
, 'position'=>TCMP_POSITION_HEAD
|
146 |
+
, 'trackMode'=>TCMP_TRACK_MODE_CODE
|
147 |
+
, 'trackPage'=>$page
|
148 |
+
, 'includeEverywhereActive'=>0
|
149 |
+
, 'includeCategoriesActive'=>0
|
150 |
+
, 'includeCategories'=>array()
|
151 |
+
, 'includeTagsActive'=>0
|
152 |
+
, 'includeTags'=>array()
|
153 |
+
, 'exceptCategoriesActive'=>0
|
154 |
+
, 'exceptCategories'=>array()
|
155 |
+
, 'exceptTagsActive'=>0
|
156 |
+
, 'exceptTags'=>array()
|
157 |
+
, 'deviceType'=>TCMP_DEVICE_TYPE_ALL
|
158 |
+
);
|
159 |
+
|
160 |
+
$types=$tcmp->Utils->query(TCMP_QUERY_POST_TYPES);
|
161 |
+
foreach($types as $v) {
|
162 |
+
$defaults['includePostsOfType_'.$v['id'].'_Active']=0;
|
163 |
+
$defaults['includePostsOfType_'.$v['id']]=array();
|
164 |
+
$defaults['exceptPostsOfType_'.$v['id'].'_Active']=0;
|
165 |
+
$defaults['exceptPostsOfType_'.$v['id']]=array();
|
166 |
+
}
|
167 |
+
|
168 |
+
$types=$tcmp->Utils->query(TCMP_QUERY_CONVERSION_PLUGINS);
|
169 |
+
foreach($types as $v) {
|
170 |
+
//CP stands for ConversionTrackingCode
|
171 |
+
//$defaults['CTC_'.$v['id'].'_Active']=0;
|
172 |
+
$defaults['CTC_'.$v['id'].'_ProductsIds']=array();
|
173 |
+
$defaults['CTC_'.$v['id'].'_CategoriesIds']=array();
|
174 |
+
$defaults['CTC_'.$v['id'].'_TagsIds']=array();
|
175 |
+
}
|
176 |
+
$snippet=$tcmp->Utils->parseArgs($snippet, $defaults);
|
177 |
+
|
178 |
+
foreach ($snippet as $k => $v) {
|
179 |
+
if (stripos($k, 'active') !== FALSE) {
|
180 |
+
$snippet[$k]=intval($v);
|
181 |
+
} elseif (is_array($v)) {
|
182 |
+
switch ($k) {
|
183 |
+
/*
|
184 |
+
case 'includePostsTypes':
|
185 |
+
case 'excludePostsTypes':
|
186 |
+
//keys are string and not number
|
187 |
+
$result=$this->uarray($snippet, $k, FALSE);
|
188 |
+
break;
|
189 |
+
*/
|
190 |
+
default:
|
191 |
+
//keys are number
|
192 |
+
$result=$this->uarray($snippet, $k, TRUE);
|
193 |
+
break;
|
194 |
+
}
|
195 |
+
}
|
196 |
+
}
|
197 |
+
$snippet['code']=trim($snippet['code']);
|
198 |
+
$snippet['position']=intval($snippet['position']);
|
199 |
+
if($snippet['trackMode']==='') {
|
200 |
+
$snippet['trackMode']=TCMP_TRACK_MODE_CODE;
|
201 |
+
} else {
|
202 |
+
$snippet['trackMode']=intval($snippet['trackMode']);
|
203 |
+
}
|
204 |
+
if($snippet['trackPage']==='') {
|
205 |
+
$snippet['trackPage']=$page;
|
206 |
+
} else {
|
207 |
+
$snippet['trackPage']=intval($snippet['trackPage']);
|
208 |
+
}
|
209 |
+
|
210 |
+
$snippet['includeEverywhereActive']=0;
|
211 |
+
if($snippet['trackPage']==TCMP_TRACK_PAGE_ALL) {
|
212 |
+
$snippet['includeEverywhereActive']=1;
|
213 |
+
}
|
214 |
+
|
215 |
+
$code=strtolower($snippet['code']);
|
216 |
+
$cnt=substr_count($code, '<iframe')+substr_count($code, '<script');
|
217 |
+
if($cnt<=0) {
|
218 |
+
$cnt=1;
|
219 |
+
}
|
220 |
+
$snippet['codesCount']=$cnt;
|
221 |
+
return $snippet;
|
222 |
+
}
|
223 |
+
private function uarray($snippet, $key, $isInteger=TRUE) {
|
224 |
+
$array=$snippet[$key];
|
225 |
+
if (!is_array($array)) {
|
226 |
+
$array=explode(',', $array);
|
227 |
+
}
|
228 |
+
|
229 |
+
if ($isInteger) {
|
230 |
+
for ($i=0; $i < count($array); $i++) {
|
231 |
+
$array[$i]=intval($array[$i]);
|
232 |
+
}
|
233 |
+
}
|
234 |
+
|
235 |
+
$array=array_unique($array);
|
236 |
+
$snippet[$key]=$array;
|
237 |
+
return $snippet;
|
238 |
+
}
|
239 |
+
|
240 |
+
//add or update a snippet (html tracking code)
|
241 |
+
public function put($id, $snippet) {
|
242 |
+
global $tcmp;
|
243 |
+
|
244 |
+
if ($id == '' || intval($id) <= 0) {
|
245 |
+
//if is a new code create a new unique id
|
246 |
+
$id=$this->getLastId() + 1;
|
247 |
+
$snippet['id']=$id;
|
248 |
+
}
|
249 |
+
$snippet=$this->sanitize($id, $snippet);
|
250 |
+
$tcmp->Options->setSnippet($id, $snippet);
|
251 |
+
|
252 |
+
$keys=$this->keys();
|
253 |
+
if (is_array($keys) && !in_array($id, $keys)) {
|
254 |
+
$keys[]=$id;
|
255 |
+
$this->keys($keys);
|
256 |
+
}
|
257 |
+
return $snippet;
|
258 |
+
}
|
259 |
+
|
260 |
+
//remove the id snippet
|
261 |
+
public function remove($id) {
|
262 |
+
global $tcmp;
|
263 |
+
$tcmp->Options->removeSnippet($id);
|
264 |
+
$keys=$this->keys();
|
265 |
+
$result=FALSE;
|
266 |
+
if (is_array($keys) && in_array($id, $keys)) {
|
267 |
+
$keys=array_diff($keys, array($id));
|
268 |
+
$this->keys($keys);
|
269 |
+
$result=TRUE;
|
270 |
+
}
|
271 |
+
return $result;
|
272 |
+
}
|
273 |
+
|
274 |
+
//verify if match with this snippet
|
275 |
+
private function matchSnippet($postId, $postType, $categoriesIds, $tagsIds, $prefix, $snippet) {
|
276 |
+
global $tcmp;
|
277 |
+
if(!$this->matchDeviceType($snippet)) {
|
278 |
+
return FALSE;
|
279 |
+
}
|
280 |
+
|
281 |
+
$include=FALSE;
|
282 |
+
$postId=intval($postId);
|
283 |
+
if($postId>0) {
|
284 |
+
$what=$prefix.'PostsOfType_'.$postType;
|
285 |
+
if(!$include && isset($snippet[$what.'_Active']) && isset($snippet[$what])&& $snippet[$what.'_Active'] && $tcmp->Utils->inAllArray($postId, $snippet[$what])) {
|
286 |
+
$tcmp->Log->debug('MATCH=%s SNIPPET=%s[%s] DUE TO POST=%s OF TYPE=%s IN [%s]'
|
287 |
+
, $prefix, $snippet['id'], $snippet['name'], $postId, $postType, $snippet[$what]);
|
288 |
+
$include=TRUE;
|
289 |
+
}
|
290 |
+
}
|
291 |
+
|
292 |
+
return $include;
|
293 |
+
}
|
294 |
+
|
295 |
+
public function writeCodes($position) {
|
296 |
+
global $tcmp;
|
297 |
+
|
298 |
+
$text='';
|
299 |
+
switch ($position) {
|
300 |
+
case TCMP_POSITION_HEAD:
|
301 |
+
$text='HEAD';
|
302 |
+
break;
|
303 |
+
case TCMP_POSITION_BODY:
|
304 |
+
$text='BODY';
|
305 |
+
break;
|
306 |
+
case TCMP_POSITION_FOOTER:
|
307 |
+
$text='FOOTER';
|
308 |
+
break;
|
309 |
+
case TCMP_POSITION_CONVERSION:
|
310 |
+
$text='CONVERSION';
|
311 |
+
break;
|
312 |
+
}
|
313 |
+
|
314 |
+
$post=$tcmp->Options->getPostShown();
|
315 |
+
$args=array('field'=>'code');
|
316 |
+
$codes=$tcmp->Manager->getCodes($position, $post, $args);
|
317 |
+
if(is_array($codes) && count($codes)>0) {
|
318 |
+
ob_start();
|
319 |
+
echo "\n<!--BEGIN: TRACKING CODE MANAGER BY INTELLYWP.COM IN $text//-->";
|
320 |
+
foreach($codes as $v) {
|
321 |
+
echo "\n$v";
|
322 |
+
}
|
323 |
+
echo "\n<!--END: https://wordpress.org/plugins/tracking-code-manager IN $text//-->";
|
324 |
+
$text=ob_get_contents();
|
325 |
+
ob_end_clean();
|
326 |
+
|
327 |
+
$purchase=$tcmp->Options->getEcommercePurchase();
|
328 |
+
if($purchase!==FALSE && intval($tcmp->Options->getLicenseSiteCount())>0) {
|
329 |
+
//retrieve user data
|
330 |
+
$purchase->userId=intval($purchase->userId);
|
331 |
+
if($purchase->userId>0) {
|
332 |
+
$user=get_user_by('id', $purchase->userId);
|
333 |
+
if(!is_null($user) && $user!==FALSE && get_class($user)=='WP_User') {
|
334 |
+
/* @var $user WP_User */
|
335 |
+
$purchase->email=$user->user_email;
|
336 |
+
$purchase->fullname=$user->user_firstname;
|
337 |
+
if($user->user_lastname!='') {
|
338 |
+
$purchase->fullname.=' '.$user->user_lastname;
|
339 |
+
}
|
340 |
+
}
|
341 |
+
}
|
342 |
+
|
343 |
+
$purchase->total=floatval($purchase->total);
|
344 |
+
$purchase->amount=floatval($purchase->amount);
|
345 |
+
$purchase->tax=floatval($purchase->tax);
|
346 |
+
|
347 |
+
$fields=array(
|
348 |
+
'ORDERID'=>$purchase->orderId
|
349 |
+
, 'CURRENCY'=>$purchase->currency
|
350 |
+
, 'FULLNAME'=>$purchase->fullname
|
351 |
+
, 'EMAIL'=>$purchase->email
|
352 |
+
, 'PRODUCTS'=>$purchase->products
|
353 |
+
, 'AMOUNT'=>$purchase->amount
|
354 |
+
, 'TOTAL'=>$purchase->total
|
355 |
+
, 'TAX'=>$purchase->tax
|
356 |
+
);
|
357 |
+
|
358 |
+
$sep='@@';
|
359 |
+
$buffer='';
|
360 |
+
$previous=0;
|
361 |
+
$start=strpos($text, $sep);
|
362 |
+
if($start===FALSE) {
|
363 |
+
$buffer=$text;
|
364 |
+
} else {
|
365 |
+
while($start!==FALSE) {
|
366 |
+
$buffer.=$tcmp->Utils->substr($text, $previous, $start);
|
367 |
+
$end=strpos($text, $sep, $start+strlen($sep));
|
368 |
+
if($end!==FALSE) {
|
369 |
+
$code=$tcmp->Utils->substr($text, $start+strlen($sep), $end);
|
370 |
+
$code=$tcmp->Utils->toArray($code);
|
371 |
+
if(count($code)==1) {
|
372 |
+
$code[]='';
|
373 |
+
}
|
374 |
+
|
375 |
+
$v=FALSE;
|
376 |
+
if(isset($fields[$code[0]])) {
|
377 |
+
$v=$fields[$code[0]];
|
378 |
+
}
|
379 |
+
if(is_null($v) || $v===FALSE) {
|
380 |
+
$v=$code[1];
|
381 |
+
}
|
382 |
+
if(is_numeric($v)) {
|
383 |
+
$v=floatval($v);
|
384 |
+
$v=round($v, 2);
|
385 |
+
switch ($code[0]) {
|
386 |
+
case 'TOTAL':
|
387 |
+
case 'AMOUNT':
|
388 |
+
case 'TAX':
|
389 |
+
$v=number_format($v, 2, '.', '');
|
390 |
+
break;
|
391 |
+
default:
|
392 |
+
$v=intval($v);
|
393 |
+
break;
|
394 |
+
}
|
395 |
+
} elseif(is_array($v)) {
|
396 |
+
$a='';
|
397 |
+
foreach($v as $t) {
|
398 |
+
$t=str_replace(',', '', $t);
|
399 |
+
if($a!='') {
|
400 |
+
$a.=',';
|
401 |
+
}
|
402 |
+
$a.=$t;
|
403 |
+
}
|
404 |
+
$v=$a;
|
405 |
+
}
|
406 |
+
$v=str_replace("'", '', $v);
|
407 |
+
$v=str_replace('"', '', $v);
|
408 |
+
$buffer.=$v;
|
409 |
+
|
410 |
+
$previous=$end+strlen($sep);
|
411 |
+
$start=strpos($text, $sep, $previous);
|
412 |
+
} else {
|
413 |
+
$buffer.=$tcmp->Utils->substr($text, $start);
|
414 |
+
$previous=FALSE;
|
415 |
+
$start=FALSE;
|
416 |
+
}
|
417 |
+
}
|
418 |
+
|
419 |
+
if ($previous !== FALSE && $previous < strlen($text)) {
|
420 |
+
$code = $tcmp->Utils->substr($text, $previous);
|
421 |
+
$buffer .= $code;
|
422 |
+
}
|
423 |
+
}
|
424 |
+
$text=$buffer;
|
425 |
+
}
|
426 |
+
echo $text;
|
427 |
+
}
|
428 |
+
}
|
429 |
+
|
430 |
+
//return snippets that match with options
|
431 |
+
public function getConversionSnippets($options=NULL) {
|
432 |
+
global $tcmp;
|
433 |
+
|
434 |
+
$defaults=array(
|
435 |
+
'pluginId'=>0
|
436 |
+
, 'categoriesIds'=>array()
|
437 |
+
, 'productsIds'=>array()
|
438 |
+
, 'tagsIds'=>array()
|
439 |
+
);
|
440 |
+
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
441 |
+
|
442 |
+
$result=array();
|
443 |
+
$pluginId=intval($options['pluginId']);
|
444 |
+
$values=$this->values();
|
445 |
+
|
446 |
+
foreach($values as $snippet) {
|
447 |
+
$snippet['trackMode']=intval($snippet['trackMode']);
|
448 |
+
if($snippet && $snippet['trackMode']>0 && $snippet['trackMode']==$pluginId) {
|
449 |
+
$match=FALSE;
|
450 |
+
|
451 |
+
$match=($match || $this->matchConversion($snippet, $pluginId, 'ProductsIds', $options['productsIds']));
|
452 |
+
$match=($match && $this->matchDeviceType($snippet));
|
453 |
+
if(!$match) {
|
454 |
+
//no selected so..all match! :)
|
455 |
+
if(count($snippet['CTC_'.$pluginId.'_ProductsIds'])==0
|
456 |
+
&& count($snippet['CTC_'.$pluginId.'_CategoriesIds'])==0
|
457 |
+
&& count($snippet['CTC_'.$pluginId.'_TagsIds'])==0) {
|
458 |
+
$match=TRUE;
|
459 |
+
}
|
460 |
+
}
|
461 |
+
|
462 |
+
if($match) {
|
463 |
+
$result[]=$snippet;
|
464 |
+
}
|
465 |
+
}
|
466 |
+
}
|
467 |
+
return $result;
|
468 |
+
}
|
469 |
+
private function matchConversion($snippet, $pluginId, $suffix, $currentIds) {
|
470 |
+
global $tcmp;
|
471 |
+
|
472 |
+
$settingsIds='CTC_'.$pluginId.'_'.$suffix;
|
473 |
+
if(isset($snippet[$settingsIds])) {
|
474 |
+
$settingsIds=$snippet[$settingsIds];
|
475 |
+
} else {
|
476 |
+
$settingsIds=array();
|
477 |
+
}
|
478 |
+
|
479 |
+
$result=$tcmp->Utils->inAllArray($currentIds, $settingsIds);
|
480 |
+
return $result;
|
481 |
+
}
|
482 |
+
|
483 |
+
//from a post retrieve the html code that is needed to insert into the page code
|
484 |
+
public function getCodes($position, $post, $args=array()) {
|
485 |
+
global $tcmp;
|
486 |
+
|
487 |
+
$defaults=array('field'=>'code');
|
488 |
+
$args=$tcmp->Utils->parseArgs($args, $defaults);
|
489 |
+
|
490 |
+
$postId=0;
|
491 |
+
$postType='page';
|
492 |
+
$tagsIds=array();
|
493 |
+
$categoriesIds=array();
|
494 |
+
if($post) {
|
495 |
+
$postId=$tcmp->Utils->get($post, 'ID', FALSE);
|
496 |
+
if($postId===FALSE) {
|
497 |
+
$postId=$tcmp->Utils->get($post, 'post_ID');
|
498 |
+
}
|
499 |
+
$postType=$tcmp->Utils->get($post, 'post_type');
|
500 |
+
|
501 |
+
$options=array('orderby' => 'name', 'order' => 'ASC', 'fields' => 'ids');
|
502 |
+
if(isset($post->ID)) {
|
503 |
+
$tagsIds=wp_get_post_tags($post->ID, $options);
|
504 |
+
$categoriesIds=wp_get_post_categories($post->ID);
|
505 |
+
} else {
|
506 |
+
$tagsIds=array();
|
507 |
+
$categoriesIds=array();
|
508 |
+
}
|
509 |
+
}
|
510 |
+
|
511 |
+
$tcmp->Options->clearSnippetsWritten();
|
512 |
+
if($position==TCMP_POSITION_CONVERSION) {
|
513 |
+
//write snippets previously appended
|
514 |
+
$ids=$tcmp->Options->getConversionSnippetIds();
|
515 |
+
if($ids!==FALSE && count($ids)>0) {
|
516 |
+
foreach($ids as $id) {
|
517 |
+
$snippet=$tcmp->Manager->get($id);
|
518 |
+
if($snippet) {
|
519 |
+
$tcmp->Options->pushSnippetWritten($snippet);
|
520 |
+
}
|
521 |
+
}
|
522 |
+
}
|
523 |
+
} else {
|
524 |
+
$snippets=$this->values();
|
525 |
+
foreach ($snippets as $v) {
|
526 |
+
if(!$v || ($position>-1 && $v['position']!=$position) || $v['code']=='' || !$v['active']) {
|
527 |
+
continue;
|
528 |
+
}
|
529 |
+
if ($v['trackMode']!=TCMP_TRACK_MODE_CODE) {
|
530 |
+
continue;
|
531 |
+
}
|
532 |
+
if($tcmp->Options->hasSnippetWritten($v)) {
|
533 |
+
$tcmp->Log->debug('SKIPPED SNIPPET=%s[%s] DUE TO ALREADY WRITTEN', $v['id'], $v['name']);
|
534 |
+
continue;
|
535 |
+
}
|
536 |
+
|
537 |
+
$match=FALSE;
|
538 |
+
if (!$match && ($v['trackPage']==TCMP_TRACK_PAGE_ALL || $v['includeEverywhereActive'])) {
|
539 |
+
$tcmp->Log->debug('INCLUDED SNIPPET=%s[%s] DUE TO EVERYWHERE', $v['id'], $v['name']);
|
540 |
+
$match=TRUE;
|
541 |
+
}
|
542 |
+
if(!$match && $postId>0 && $this->matchSnippet($postId, $postType, $categoriesIds, $tagsIds, 'include', $v)) {
|
543 |
+
$match=TRUE;
|
544 |
+
}
|
545 |
+
|
546 |
+
if($match && $postId>0) {
|
547 |
+
if($this->matchSnippet($postId, $postType, $categoriesIds, $tagsIds, 'except', $v)) {
|
548 |
+
$tcmp->Log->debug('FOUND AT LEAST ON EXCEPT TO EXCLUDE SNIPPET=%s [%s]', $v['id'], $v['name']);
|
549 |
+
$match=FALSE;
|
550 |
+
}
|
551 |
+
}
|
552 |
+
|
553 |
+
if ($match) {
|
554 |
+
$tcmp->Options->pushSnippetWritten($v);
|
555 |
+
}
|
556 |
+
}
|
557 |
+
}
|
558 |
+
|
559 |
+
//obtain result as snippets or array of one field (tipically "id")
|
560 |
+
$result=$tcmp->Options->getSnippetsWritten();
|
561 |
+
if ($args['field']!='all') {
|
562 |
+
$array=array();
|
563 |
+
foreach($result as $k=>$v) {
|
564 |
+
$k=$args['field'];
|
565 |
+
if(isset($v[$k])) {
|
566 |
+
$array[]=$v[$k];
|
567 |
+
} else {
|
568 |
+
$tcmp->Log->error('SNIPPET=%s [%s] WITHOUT FIELD=%s', $v['id'], $v['name'], $k);
|
569 |
+
}
|
570 |
+
}
|
571 |
+
$result=$array;
|
572 |
+
}
|
573 |
+
return $result;
|
574 |
+
}
|
575 |
+
|
576 |
+
//ottiene o salva tutte le chiavi dei tracking code utilizzati ordinati per id
|
577 |
+
public function keys($keys=NULL) {
|
578 |
+
global $tcmp;
|
579 |
+
|
580 |
+
if (is_array($keys)) {
|
581 |
+
$tcmp->Options->setSnippetList($keys);
|
582 |
+
$result=$keys;
|
583 |
+
} else {
|
584 |
+
$result=$tcmp->Options->getSnippetList();
|
585 |
+
}
|
586 |
+
|
587 |
+
if (!is_array($result)) {
|
588 |
+
$result=array();
|
589 |
+
} else {
|
590 |
+
sort($result);
|
591 |
+
}
|
592 |
+
return $result;
|
593 |
+
}
|
594 |
+
|
595 |
+
//ottiene il conteggio attuale dei tracking code
|
596 |
+
public function count() {
|
597 |
+
$result=count($this->keys());
|
598 |
+
return $result;
|
599 |
+
}
|
600 |
+
public function codesCount() {
|
601 |
+
$result=0;
|
602 |
+
$ids=$this->keys();
|
603 |
+
foreach($ids as $id) {
|
604 |
+
$snippet=$this->get($id);
|
605 |
+
if($snippet) {
|
606 |
+
$result+=1;
|
607 |
+
/*
|
608 |
+
if($snippet['codesCount']>0) {
|
609 |
+
$result+=intval($snippet['codesCount']);
|
610 |
+
} else {
|
611 |
+
$result+=1;
|
612 |
+
}
|
613 |
+
*/
|
614 |
+
}
|
615 |
+
}
|
616 |
+
return $result;
|
617 |
+
}
|
618 |
+
public function getLastId() {
|
619 |
+
$result=0;
|
620 |
+
$list=$this->keys();
|
621 |
+
foreach ($list as $v) {
|
622 |
+
$v=intval($v);
|
623 |
+
if ($v>$result) {
|
624 |
+
$result=$v;
|
625 |
+
}
|
626 |
+
}
|
627 |
+
return $result;
|
628 |
+
}
|
629 |
+
|
630 |
+
public function values() {
|
631 |
+
$keys=$this->keys();
|
632 |
+
$array=array();
|
633 |
+
foreach ($keys as $k) {
|
634 |
+
$v=$this->get($k);
|
635 |
+
$array[]=$v;
|
636 |
+
}
|
637 |
+
usort($array, array($this, 'values_Compare'));
|
638 |
+
|
639 |
+
$result=array();
|
640 |
+
foreach($array as $v) {
|
641 |
+
$id=$v['id'];
|
642 |
+
$result[$id]=$v;
|
643 |
+
}
|
644 |
+
return $result;
|
645 |
+
}
|
646 |
+
public function values_Compare($o1, $o2) {
|
647 |
+
global $tcmp;
|
648 |
+
$v1=$tcmp->Utils->iget($o1, 'order', FALSE);
|
649 |
+
$v2=$tcmp->Utils->iget($o2, 'order', FALSE);
|
650 |
+
$result=($v1-$v2);
|
651 |
+
if($result==0) {
|
652 |
+
$v1=$tcmp->Utils->get($o1, 'name', FALSE);
|
653 |
+
$v2=$tcmp->Utils->get($o2, 'name', FALSE);
|
654 |
+
$result=strcasecmp($v1, $v2);
|
655 |
+
}
|
656 |
+
return $result;
|
657 |
+
}
|
658 |
}
|
includes/classes/core/Singleton.php
CHANGED
@@ -1,38 +1,38 @@
|
|
1 |
-
<?php
|
2 |
-
class TCMP_Singleton {
|
3 |
-
var $Lang;
|
4 |
-
var $Utils;
|
5 |
-
var $Form;
|
6 |
-
var $Check;
|
7 |
-
var $Options;
|
8 |
-
var $Log;
|
9 |
-
var $Cron;
|
10 |
-
var $Tracking;
|
11 |
-
var $Manager;
|
12 |
-
var $Ecommerce;
|
13 |
-
var $Plugin;
|
14 |
-
var $Tabs;
|
15 |
-
var $BodyWritten;
|
16 |
-
|
17 |
-
function __construct() {
|
18 |
-
$this->Lang=new TCMP_Language();
|
19 |
-
$this->Tabs=new TCMP_Tabs();
|
20 |
-
$this->Utils=new TCMP_Utils();
|
21 |
-
$this->Form=new TCMP_Form();
|
22 |
-
$this->Check=new TCMP_Check();
|
23 |
-
$this->Options=new TCMP_Options();
|
24 |
-
$this->Log=new TCMP_Logger();
|
25 |
-
$this->Cron=new TCMP_Cron();
|
26 |
-
$this->Tracking=new TCMP_Tracking();
|
27 |
-
$this->Manager=new TCMP_Manager();
|
28 |
-
$this->Ecommerce=new TCMP_Ecommerce();
|
29 |
-
$this->Plugin=new TCMP_Plugin();
|
30 |
-
$this->BodyWritten = false;
|
31 |
-
}
|
32 |
-
public function init() {
|
33 |
-
$this->Lang->load('tcmp', TCMP_PLUGIN_DIR.'languages/Lang.txt');
|
34 |
-
$this->Tabs->init();
|
35 |
-
$this->Cron->init();
|
36 |
-
$this->Manager->init();
|
37 |
-
}
|
38 |
}
|
1 |
+
<?php
|
2 |
+
class TCMP_Singleton {
|
3 |
+
var $Lang;
|
4 |
+
var $Utils;
|
5 |
+
var $Form;
|
6 |
+
var $Check;
|
7 |
+
var $Options;
|
8 |
+
var $Log;
|
9 |
+
var $Cron;
|
10 |
+
var $Tracking;
|
11 |
+
var $Manager;
|
12 |
+
var $Ecommerce;
|
13 |
+
var $Plugin;
|
14 |
+
var $Tabs;
|
15 |
+
var $BodyWritten;
|
16 |
+
|
17 |
+
function __construct() {
|
18 |
+
$this->Lang=new TCMP_Language();
|
19 |
+
$this->Tabs=new TCMP_Tabs();
|
20 |
+
$this->Utils=new TCMP_Utils();
|
21 |
+
$this->Form=new TCMP_Form();
|
22 |
+
$this->Check=new TCMP_Check();
|
23 |
+
$this->Options=new TCMP_Options();
|
24 |
+
$this->Log=new TCMP_Logger();
|
25 |
+
$this->Cron=new TCMP_Cron();
|
26 |
+
$this->Tracking=new TCMP_Tracking();
|
27 |
+
$this->Manager=new TCMP_Manager();
|
28 |
+
$this->Ecommerce=new TCMP_Ecommerce();
|
29 |
+
$this->Plugin=new TCMP_Plugin();
|
30 |
+
$this->BodyWritten = false;
|
31 |
+
}
|
32 |
+
public function init() {
|
33 |
+
$this->Lang->load('tcmp', TCMP_PLUGIN_DIR.'languages/Lang.txt');
|
34 |
+
$this->Tabs->init();
|
35 |
+
$this->Cron->init();
|
36 |
+
$this->Manager->init();
|
37 |
+
}
|
38 |
}
|
includes/classes/domain/EcommercePurchase.php
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
class TCMP_EcommercePurchase {
|
4 |
-
var $orderId;
|
5 |
-
var $currency;
|
6 |
-
|
7 |
-
var $userId;
|
8 |
-
var $fullname;
|
9 |
-
var $email;
|
10 |
-
|
11 |
-
var $products=array();
|
12 |
-
|
13 |
-
var $amount;
|
14 |
-
var $total;
|
15 |
-
var $tax;
|
16 |
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
class TCMP_EcommercePurchase {
|
4 |
+
var $orderId;
|
5 |
+
var $currency;
|
6 |
+
|
7 |
+
var $userId;
|
8 |
+
var $fullname;
|
9 |
+
var $email;
|
10 |
+
|
11 |
+
var $products=array();
|
12 |
+
|
13 |
+
var $amount;
|
14 |
+
var $total;
|
15 |
+
var $tax;
|
16 |
}
|
includes/classes/ui/Check.php
CHANGED
@@ -1,107 +1,107 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
-
|
5 |
-
class TCMP_Check {
|
6 |
-
var $data;
|
7 |
-
|
8 |
-
public function __construct() {
|
9 |
-
$this->data=array_merge($_POST, $_GET);
|
10 |
-
}
|
11 |
-
|
12 |
-
public function is($name, $value, $ignoreCase=TRUE) {
|
13 |
-
$result=FALSE;
|
14 |
-
if(isset($this->data[$name])) {
|
15 |
-
if($ignoreCase) {
|
16 |
-
$result=(strtolower($this->data[$name])==strtolower($value));
|
17 |
-
} else {
|
18 |
-
$result=($this->data[$name]==$value);
|
19 |
-
}
|
20 |
-
}
|
21 |
-
return $result;
|
22 |
-
}
|
23 |
-
public function of($name, $default='') {
|
24 |
-
$result=$default;
|
25 |
-
if(isset($this->data[$name])) {
|
26 |
-
$result=$this->data[$name];
|
27 |
-
}
|
28 |
-
return $result;
|
29 |
-
}
|
30 |
-
public function nonce($action, $nonce='_wpnonce') {
|
31 |
-
if(isset($_REQUEST[$nonce])) {
|
32 |
-
$nonce=$_REQUEST[$nonce];
|
33 |
-
}
|
34 |
-
return wp_verify_nonce($nonce, $action);
|
35 |
-
}
|
36 |
-
|
37 |
-
//check if is a mandatory field by checking the .txt language file
|
38 |
-
private function error($name) {
|
39 |
-
global $tcmp;
|
40 |
-
|
41 |
-
$result=FALSE;
|
42 |
-
$k=$tcmp->Form->prefix.'.'.$name.'.check';
|
43 |
-
$v=$tcmp->Lang->L($k);
|
44 |
-
if($v!=$k) {
|
45 |
-
//this is a mandatory field so we give error
|
46 |
-
$tcmp->Options->pushErrorMessage($v);
|
47 |
-
$result=TRUE;
|
48 |
-
}
|
49 |
-
return $result;
|
50 |
-
}
|
51 |
-
|
52 |
-
public function value($name) {
|
53 |
-
$result='';
|
54 |
-
if(isset($this->data[$name])) {
|
55 |
-
$result=sanitize_text_field($this->data[$name]);
|
56 |
-
}
|
57 |
-
if($result=='') {
|
58 |
-
$this->error($name);
|
59 |
-
}
|
60 |
-
$this->data[$name]=$result;
|
61 |
-
return $result;
|
62 |
-
}
|
63 |
-
public function values($name) {
|
64 |
-
$result=array();
|
65 |
-
if(is_string($name)) {
|
66 |
-
$name=explode(',', $name);
|
67 |
-
}
|
68 |
-
foreach($name as $v) {
|
69 |
-
$result[]=$this->value(trim($v));
|
70 |
-
}
|
71 |
-
return $result;
|
72 |
-
}
|
73 |
-
public function email($name) {
|
74 |
-
$result=$this->value($name);
|
75 |
-
if($result!='') {
|
76 |
-
$result=sanitize_email($result);
|
77 |
-
if(!is_email($result)) {
|
78 |
-
$this->error($name);
|
79 |
-
}
|
80 |
-
}
|
81 |
-
$this->data[$name]=$result;
|
82 |
-
return $result;
|
83 |
-
}
|
84 |
-
public function float($name) {
|
85 |
-
$result=$this->value($name);
|
86 |
-
if($result!='' && !is_float($result)) {
|
87 |
-
$this->error($name);
|
88 |
-
}
|
89 |
-
$result=floatval($result);
|
90 |
-
$this->data[$name]=$result;
|
91 |
-
return $result;
|
92 |
-
}
|
93 |
-
public function integer($name) {
|
94 |
-
$result=$this->value($name);
|
95 |
-
if($result!='' && !is_int($result)) {
|
96 |
-
$this->error($name);
|
97 |
-
}
|
98 |
-
$result=intval($result);
|
99 |
-
$this->data[$name]=$result;
|
100 |
-
return $result;
|
101 |
-
}
|
102 |
-
|
103 |
-
public function hasErrors() {
|
104 |
-
global $tcmp;
|
105 |
-
return $tcmp->Options->hasErrorMessages();
|
106 |
-
}
|
107 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
+
|
5 |
+
class TCMP_Check {
|
6 |
+
var $data;
|
7 |
+
|
8 |
+
public function __construct() {
|
9 |
+
$this->data=array_merge($_POST, $_GET);
|
10 |
+
}
|
11 |
+
|
12 |
+
public function is($name, $value, $ignoreCase=TRUE) {
|
13 |
+
$result=FALSE;
|
14 |
+
if(isset($this->data[$name])) {
|
15 |
+
if($ignoreCase) {
|
16 |
+
$result=(strtolower($this->data[$name])==strtolower($value));
|
17 |
+
} else {
|
18 |
+
$result=($this->data[$name]==$value);
|
19 |
+
}
|
20 |
+
}
|
21 |
+
return $result;
|
22 |
+
}
|
23 |
+
public function of($name, $default='') {
|
24 |
+
$result=$default;
|
25 |
+
if(isset($this->data[$name])) {
|
26 |
+
$result=$this->data[$name];
|
27 |
+
}
|
28 |
+
return $result;
|
29 |
+
}
|
30 |
+
public function nonce($action, $nonce='_wpnonce') {
|
31 |
+
if(isset($_REQUEST[$nonce])) {
|
32 |
+
$nonce=$_REQUEST[$nonce];
|
33 |
+
}
|
34 |
+
return wp_verify_nonce($nonce, $action);
|
35 |
+
}
|
36 |
+
|
37 |
+
//check if is a mandatory field by checking the .txt language file
|
38 |
+
private function error($name) {
|
39 |
+
global $tcmp;
|
40 |
+
|
41 |
+
$result=FALSE;
|
42 |
+
$k=$tcmp->Form->prefix.'.'.$name.'.check';
|
43 |
+
$v=$tcmp->Lang->L($k);
|
44 |
+
if($v!=$k) {
|
45 |
+
//this is a mandatory field so we give error
|
46 |
+
$tcmp->Options->pushErrorMessage($v);
|
47 |
+
$result=TRUE;
|
48 |
+
}
|
49 |
+
return $result;
|
50 |
+
}
|
51 |
+
|
52 |
+
public function value($name) {
|
53 |
+
$result='';
|
54 |
+
if(isset($this->data[$name])) {
|
55 |
+
$result=sanitize_text_field($this->data[$name]);
|
56 |
+
}
|
57 |
+
if($result=='') {
|
58 |
+
$this->error($name);
|
59 |
+
}
|
60 |
+
$this->data[$name]=$result;
|
61 |
+
return $result;
|
62 |
+
}
|
63 |
+
public function values($name) {
|
64 |
+
$result=array();
|
65 |
+
if(is_string($name)) {
|
66 |
+
$name=explode(',', $name);
|
67 |
+
}
|
68 |
+
foreach($name as $v) {
|
69 |
+
$result[]=$this->value(trim($v));
|
70 |
+
}
|
71 |
+
return $result;
|
72 |
+
}
|
73 |
+
public function email($name) {
|
74 |
+
$result=$this->value($name);
|
75 |
+
if($result!='') {
|
76 |
+
$result=sanitize_email($result);
|
77 |
+
if(!is_email($result)) {
|
78 |
+
$this->error($name);
|
79 |
+
}
|
80 |
+
}
|
81 |
+
$this->data[$name]=$result;
|
82 |
+
return $result;
|
83 |
+
}
|
84 |
+
public function float($name) {
|
85 |
+
$result=$this->value($name);
|
86 |
+
if($result!='' && !is_float($result)) {
|
87 |
+
$this->error($name);
|
88 |
+
}
|
89 |
+
$result=floatval($result);
|
90 |
+
$this->data[$name]=$result;
|
91 |
+
return $result;
|
92 |
+
}
|
93 |
+
public function integer($name) {
|
94 |
+
$result=$this->value($name);
|
95 |
+
if($result!='' && !is_int($result)) {
|
96 |
+
$this->error($name);
|
97 |
+
}
|
98 |
+
$result=intval($result);
|
99 |
+
$this->data[$name]=$result;
|
100 |
+
return $result;
|
101 |
+
}
|
102 |
+
|
103 |
+
public function hasErrors() {
|
104 |
+
global $tcmp;
|
105 |
+
return $tcmp->Options->hasErrorMessages();
|
106 |
+
}
|
107 |
}
|
includes/classes/ui/Form.php
CHANGED
@@ -1,513 +1,513 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
-
|
5 |
-
class TCMP_Form {
|
6 |
-
var $prefix='Form';
|
7 |
-
var $labels=TRUE;
|
8 |
-
var $leftLabels=TRUE;
|
9 |
-
var $newline;
|
10 |
-
|
11 |
-
var $tags=TRUE;
|
12 |
-
var $onlyPremium=TRUE;
|
13 |
-
var $leftTags=FALSE;
|
14 |
-
var $premium=FALSE;
|
15 |
-
var $tagNew=FALSE;
|
16 |
-
|
17 |
-
public function __construct() {
|
18 |
-
}
|
19 |
-
|
20 |
-
//args can be a string or an associative array if you want
|
21 |
-
private function getTextArgs($args, $defaults, $excludes=array()) {
|
22 |
-
$result=$args;
|
23 |
-
|
24 |
-
if (is_string($excludes)) {
|
25 |
-
$excludes = explode(',', $excludes);
|
26 |
-
}
|
27 |
-
|
28 |
-
if(is_array($result) && count($result)>0) {
|
29 |
-
$result='';
|
30 |
-
foreach($args as $k=>$v) {
|
31 |
-
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
32 |
-
$result.=' '.$k.'="'.$v.'"';
|
33 |
-
}
|
34 |
-
}
|
35 |
-
} elseif(!$args) {
|
36 |
-
$result='';
|
37 |
-
}
|
38 |
-
if(is_array($defaults) && count($defaults)>0) {
|
39 |
-
foreach($defaults as $k=>$v) {
|
40 |
-
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
41 |
-
if(stripos($result, $k.'=')===FALSE) {
|
42 |
-
$result.=' '.$k.'="'.$v.'"';
|
43 |
-
}
|
44 |
-
}
|
45 |
-
}
|
46 |
-
}
|
47 |
-
return $result;
|
48 |
-
}
|
49 |
-
|
50 |
-
public function tag($overridePremium=FALSE) {
|
51 |
-
global $tcmp;
|
52 |
-
/*
|
53 |
-
$premium=($overridePremium || $this->premium);
|
54 |
-
if((!$overridePremium && !$this->tags) || $tcmp->License->hasPremium() || ($this->onlyPremium && !$premium)) return;
|
55 |
-
|
56 |
-
$tagClass='tcmp-tag-free';
|
57 |
-
$tagText='FREE';
|
58 |
-
if($premium) {
|
59 |
-
$tagClass='tcmp-tag-premium';
|
60 |
-
$tagText='<a href="'.TCMP_PAGE_PREMIUM.'" target="_new">PRO</a>';
|
61 |
-
}
|
62 |
-
*/
|
63 |
-
if(!$this->tags || !$this->tagNew) {
|
64 |
-
return;
|
65 |
-
}
|
66 |
-
|
67 |
-
$tagClass='tcmp-tag-free';
|
68 |
-
$tagText='NEW!';
|
69 |
-
?>
|
70 |
-
<div style="float:left;" class="tcmp-tag <?php echo $tagClass?>"><?php echo $tagText?></div>
|
71 |
-
<?php
|
72 |
-
}
|
73 |
-
|
74 |
-
public function label($name, $options='') {
|
75 |
-
global $tcmp;
|
76 |
-
$defaults=array('class'=>'');
|
77 |
-
$otherText=$this->getTextArgs($options, $defaults, array('label', 'id'));
|
78 |
-
|
79 |
-
$k=$this->prefix.'.'.$name;
|
80 |
-
if(!is_array($options)) {
|
81 |
-
$options=array();
|
82 |
-
}
|
83 |
-
if(isset($options['label']) && $options['label']) {
|
84 |
-
$k=$options['label'];
|
85 |
-
}
|
86 |
-
|
87 |
-
$label=$tcmp->Lang->L($k);
|
88 |
-
$for=(isset($options['id']) ? $options['id'] : $name);
|
89 |
-
|
90 |
-
//check if is a mandatory field by checking the .txt language file
|
91 |
-
$k=$this->prefix.'.'.$name.'.check';
|
92 |
-
if($tcmp->Lang->H($k)) {
|
93 |
-
$label.=' (*)';
|
94 |
-
}
|
95 |
-
|
96 |
-
$aClass='';
|
97 |
-
/*
|
98 |
-
if($this->premium && !$tcmp->License->hasPremium()) {
|
99 |
-
$aClass='tcmp-label-disabled';
|
100 |
-
}
|
101 |
-
*/
|
102 |
-
?>
|
103 |
-
<label for="<?php echo $for?>" <?php echo $otherText?> >
|
104 |
-
<?php if($this->leftTags) {
|
105 |
-
$this->tag();
|
106 |
-
}?>
|
107 |
-
<span style="float:left; margin-right:5px;" class="<?php echo $aClass?>"><?php echo $label?></span>
|
108 |
-
<?php if(!$this->leftTags) {
|
109 |
-
$this->tag();
|
110 |
-
}?>
|
111 |
-
</label>
|
112 |
-
<?php }
|
113 |
-
|
114 |
-
public function leftInput($name, $options='') {
|
115 |
-
if(!$this->labels) return;
|
116 |
-
if($this->leftLabels) {
|
117 |
-
$this->label($name, $options);
|
118 |
-
}
|
119 |
-
|
120 |
-
if($this->newline) {
|
121 |
-
$this->newline();
|
122 |
-
}
|
123 |
-
}
|
124 |
-
|
125 |
-
public function newline() {
|
126 |
-
?><div class="tcmp-form-newline"></div><?php
|
127 |
-
}
|
128 |
-
|
129 |
-
public function rightInput($name, $args='') {
|
130 |
-
if(!$this->labels) return;
|
131 |
-
if (!$this->leftLabels) {
|
132 |
-
$this->label($name, $args);
|
133 |
-
}
|
134 |
-
$this->newline();
|
135 |
-
}
|
136 |
-
|
137 |
-
public function formStarts($method='post', $action='', $args=NULL) {
|
138 |
-
//$this->tags=FALSE;
|
139 |
-
//$this->premium=FALSE;
|
140 |
-
|
141 |
-
//$defaults=array('style'=>'margin:1em 0; padding:1px 1em; background:#fff; border:1px solid #ccc;'
|
142 |
-
$defaults=array('class'=>'tcmp-form');
|
143 |
-
$other=$this->getTextArgs($args, $defaults);
|
144 |
-
?>
|
145 |
-
<form method="<?php echo $method?>" action="<?php echo $action?>" <?php echo $other?> >
|
146 |
-
<?php }
|
147 |
-
|
148 |
-
public function formEnds() { ?>
|
149 |
-
</form>
|
150 |
-
<?php }
|
151 |
-
|
152 |
-
public function divStarts($args=array()) {
|
153 |
-
$defaults=array();
|
154 |
-
$other=$this->getTextArgs($args, $defaults);
|
155 |
-
?>
|
156 |
-
<div <?php echo $other?>>
|
157 |
-
<?php }
|
158 |
-
public function divEnds() { ?>
|
159 |
-
</div>
|
160 |
-
<div style="clear:both;"></div>
|
161 |
-
<?php }
|
162 |
-
|
163 |
-
public function p($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
164 |
-
global $tcmp;
|
165 |
-
?>
|
166 |
-
<p style="font-weight:bold;">
|
167 |
-
<?php
|
168 |
-
$tcmp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);
|
169 |
-
if($tcmp->Lang->H($message.'Subtitle')) { ?>
|
170 |
-
<br/>
|
171 |
-
<span style="font-weight:normal;">
|
172 |
-
<?php $tcmp->Lang->P($message.'Subtitle', $v1, $v2, $v3, $v4, $v5)?>
|
173 |
-
</span>
|
174 |
-
<?php } ?>
|
175 |
-
</p>
|
176 |
-
<?php }
|
177 |
-
public function i($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
178 |
-
global $tcmp;
|
179 |
-
?>
|
180 |
-
<i><?php $tcmp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);?></i>
|
181 |
-
<?php }
|
182 |
-
|
183 |
-
var $_aceEditorUsed=FALSE;
|
184 |
-
public function editor($name, $value='', $options=NULL) {
|
185 |
-
global $tcmp;
|
186 |
-
|
187 |
-
$defaults=array(
|
188 |
-
'editor'=>'html'
|
189 |
-
, 'theme'=>'monokai'
|
190 |
-
, 'ui-visible'=>''
|
191 |
-
, 'height'=>350
|
192 |
-
, 'width'=>700
|
193 |
-
);
|
194 |
-
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
195 |
-
$value=$tcmp->Utils->get($value, $name , $value);
|
196 |
-
|
197 |
-
$args=array('class'=>'tcmp-label', 'style'=>'width:auto;');
|
198 |
-
$this->newline=TRUE;
|
199 |
-
$this->leftInput($name, $args);
|
200 |
-
|
201 |
-
$id=$name;
|
202 |
-
switch ($options['editor']) {
|
203 |
-
case 'wp':
|
204 |
-
case 'wordpress':
|
205 |
-
$settings=array(
|
206 |
-
'wpautop'=>TRUE
|
207 |
-
, 'media_buttons'=>TRUE
|
208 |
-
, 'drag_drop_upload'=>FALSE
|
209 |
-
, 'editor_height'=>$options['height']
|
210 |
-
);
|
211 |
-
wp_editor($value, $id, $settings);
|
212 |
-
?>
|
213 |
-
<script>
|
214 |
-
jQuery('#<?php echo $id?>').attr('ui-visible', '<?php echo $options['ui-visible']?>');
|
215 |
-
</script>
|
216 |
-
<?php
|
217 |
-
break;
|
218 |
-
case 'html':
|
219 |
-
case 'text':
|
220 |
-
case 'javascript':
|
221 |
-
case 'css':
|
222 |
-
if(!$this->_aceEditorUsed) { ?>
|
223 |
-
<script src="https://cdnjs.cloudflare.com/ajax/libs/ace/1.2.3/ace.js" type="text/javascript" charset="utf-8"></script>
|
224 |
-
<?php $this->_aceEditorUsed=TRUE;
|
225 |
-
}
|
226 |
-
|
227 |
-
$ace='ACE_'.$id;
|
228 |
-
$text=$value;
|
229 |
-
//$text=str_replace('&', '&', $text);
|
230 |
-
$text=str_replace('<', '<', $text);
|
231 |
-
$text=str_replace('>', '>', $text);
|
232 |
-
?>
|
233 |
-
<div id="<?php echo $id?>Ace" style="height:<?php echo $options['height']+50?>px; width: <?php echo $options['width']?>px;"><?php echo $text?></div>
|
234 |
-
<textarea id="<?php echo $id?>" name="<?php echo $id?>" ui-visible="<?php echo $options['ui-visible']?>" style="display: none;"></textarea>
|
235 |
-
<script>
|
236 |
-
jQuery.noConflict()(function($){
|
237 |
-
var text=$('#<?php echo $id?>Ace').html();
|
238 |
-
text=TCMP.replace(text, '<', '<');
|
239 |
-
text=TCMP.replace(text, '>', '>');
|
240 |
-
text=TCMP.replace(text, '&', '&');
|
241 |
-
|
242 |
-
var <?php echo $ace?>=ace.edit("<?php echo $id?>Ace");
|
243 |
-
<?php echo $ace?>.renderer.setShowGutter(false);
|
244 |
-
<?php echo $ace?>.setTheme("ace/theme/<?php echo $options['theme']?>");
|
245 |
-
<?php echo $ace?>.getSession().setMode("ace/mode/<?php echo $options['editor']?>");
|
246 |
-
<?php echo $ace?>.getSession().setUseSoftTabs(true);
|
247 |
-
<?php echo $ace?>.getSession().setUseWrapMode(true);
|
248 |
-
<?php echo $ace?>.session.setUseWorker(false)
|
249 |
-
<?php echo $ace?>.setValue(text);
|
250 |
-
|
251 |
-
$('#<?php echo $id?>Ace').focusout(function() {
|
252 |
-
var $hidden=$('#<?php echo $id?>');
|
253 |
-
var code=<?php echo $ace?>.getValue();
|
254 |
-
$hidden.val(code);
|
255 |
-
});
|
256 |
-
$('#<?php echo $id?>Ace').trigger('focusout');
|
257 |
-
});
|
258 |
-
</script>
|
259 |
-
<?php
|
260 |
-
break;
|
261 |
-
}
|
262 |
-
$this->newline=FALSE;
|
263 |
-
$this->rightInput($name, $args);
|
264 |
-
}
|
265 |
-
|
266 |
-
public function textarea($name, $value='', $args=NULL) {
|
267 |
-
if(is_array($value) && isset($value[$name])) {
|
268 |
-
$value=$value[$name];
|
269 |
-
}
|
270 |
-
$defaults=array('rows'=>10, 'class'=>'tcmp-textarea');
|
271 |
-
$other=$this->getTextArgs($args, $defaults);
|
272 |
-
|
273 |
-
$args=array('class'=>'tcmp-label', 'style'=>'width:auto;');
|
274 |
-
$this->newline=TRUE;
|
275 |
-
$this->leftInput($name, $args);
|
276 |
-
?>
|
277 |
-
<textarea dir="ltr" dirname="ltr" id="<?php echo $name ?>" name="<?php echo $name?>" <?php echo $other?> ><?php echo $value ?></textarea>
|
278 |
-
<?php
|
279 |
-
$this->newline=FALSE;
|
280 |
-
$this->rightInput($name, $args);
|
281 |
-
}
|
282 |
-
|
283 |
-
public function number($name, $value = '', $options = NULL)
|
284 |
-
{
|
285 |
-
if (!$options) {
|
286 |
-
$options = array();
|
287 |
-
}
|
288 |
-
$options['type'] = 'number';
|
289 |
-
$options['autocomplete'] = 'off';
|
290 |
-
$options['style'] = 'width:100px;';
|
291 |
-
if (!isset($options['min'])) {
|
292 |
-
$options['min'] = 0;
|
293 |
-
}
|
294 |
-
|
295 |
-
return $this->text($name, $value, $options);
|
296 |
-
}
|
297 |
-
|
298 |
-
public function text($name, $value = '', $options = NULL)
|
299 |
-
{
|
300 |
-
if (is_array($value) && isset($value[$name])) {
|
301 |
-
$value = $value[$name];
|
302 |
-
}
|
303 |
-
|
304 |
-
$type = 'text';
|
305 |
-
if (isset($options['type'])) {
|
306 |
-
$type = $options['type'];
|
307 |
-
}
|
308 |
-
|
309 |
-
$defaults = array('class' => 'tcmp-'.$type);
|
310 |
-
$other = $this->getTextArgs($options, $defaults, 'type');
|
311 |
-
|
312 |
-
$args = array('class' => 'tcmp-label');
|
313 |
-
$this->leftInput($name, $args);
|
314 |
-
?>
|
315 |
-
<input type="<?php echo $type?>" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
316 |
-
<?php
|
317 |
-
$this->rightInput($name, $args);
|
318 |
-
}
|
319 |
-
|
320 |
-
public function hidden($name, $value='', $args=NULL) {
|
321 |
-
if(is_array($value) && isset($value[$name])) {
|
322 |
-
$value=$value[$name];
|
323 |
-
}
|
324 |
-
$defaults=array();
|
325 |
-
$other=$this->getTextArgs($args, $defaults);
|
326 |
-
?>
|
327 |
-
<input type="hidden" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
328 |
-
<?php }
|
329 |
-
|
330 |
-
public function nonce($action=-1, $name='_wpnonce', $referer=true, $echo=true) {
|
331 |
-
wp_nonce_field($action, $name, $referer, $echo);
|
332 |
-
}
|
333 |
-
|
334 |
-
public function dropdown($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
335 |
-
global $tcmp;
|
336 |
-
if(is_array($value) && isset($value[$name])) {
|
337 |
-
$value=$value[$name];
|
338 |
-
}
|
339 |
-
$defaults=array('class'=>'tcmp-select tcmTags tcmp-dropdown');
|
340 |
-
$other=$this->getTextArgs($args, $defaults);
|
341 |
-
|
342 |
-
if(!is_array($value)) {
|
343 |
-
$value=array($value);
|
344 |
-
}
|
345 |
-
if(is_string($options)) {
|
346 |
-
$options=explode(',', $options);
|
347 |
-
}
|
348 |
-
if(is_array($options) && count($options)>0) {
|
349 |
-
if(!isset($options[0]['id'])) {
|
350 |
-
//this is a normal array so I use the values for "id" field and the "name" into the txt file
|
351 |
-
$temp=array();
|
352 |
-
foreach($options as $v) {
|
353 |
-
$temp[]=array('id'=>$v, 'name'=>$tcmp->Lang->L($this->prefix.'.'.$name.'.'.$v));
|
354 |
-
}
|
355 |
-
$options=$temp;
|
356 |
-
}
|
357 |
-
}
|
358 |
-
|
359 |
-
echo "<div id=\"$name-box\">";
|
360 |
-
$args=array('class'=>'tcmp-label');
|
361 |
-
$this->leftInput($name, $args);
|
362 |
-
?>
|
363 |
-
<select id="<?php echo $name ?>" name="<?php echo $name?><?php echo ($multiple ? '[]' : '')?>" <?php echo ($multiple ? 'multiple' : '')?> <?php echo $other?> >
|
364 |
-
<?php
|
365 |
-
foreach($options as $v) {
|
366 |
-
$selected='';
|
367 |
-
if(in_array($v['id'], $value)) {
|
368 |
-
$selected=' selected="selected"';
|
369 |
-
}
|
370 |
-
?>
|
371 |
-
<option value="<?php echo $v['id']?>" <?php echo $selected?>><?php echo $v['name']?></option>
|
372 |
-
<?php } ?>
|
373 |
-
</select>
|
374 |
-
<?php
|
375 |
-
$this->rightInput($name, $args);
|
376 |
-
echo '</div>';
|
377 |
-
}
|
378 |
-
|
379 |
-
public function br() { ?>
|
380 |
-
<br/>
|
381 |
-
<?php }
|
382 |
-
|
383 |
-
public function submit($value='', $args=NULL) {
|
384 |
-
global $tcmp;
|
385 |
-
$defaults=array();
|
386 |
-
$other=$this->getTextArgs($args, $defaults);
|
387 |
-
if($value=='') {
|
388 |
-
$value='Send';
|
389 |
-
}
|
390 |
-
$this->newline();
|
391 |
-
?>
|
392 |
-
<input type="submit" class="button-primary tcmp-button tcmp-submit" value="<?php $tcmp->Lang->P($value)?>" <?php echo $other?>/>
|
393 |
-
<?php }
|
394 |
-
|
395 |
-
public function delete($id, $action='delete', $args=NULL) {
|
396 |
-
global $tcmp;
|
397 |
-
$defaults=array();
|
398 |
-
$other=$this->getTextArgs($args, $defaults);
|
399 |
-
?>
|
400 |
-
<input type="button" class="button tcmp-button" value="<?php $tcmp->Lang->P('Delete?')?>" onclick="if (confirm('<?php $tcmp->Lang->P('Question.DeleteQuestion')?>') ) window.location='<?php echo TCMP_TAB_MANAGER_URI?>&action=<?php echo $action?>&id=<?php echo $id ?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_delete')); ?>';" <?php echo $other?> />
|
401 |
-
|
402 |
-
<?php
|
403 |
-
}
|
404 |
-
|
405 |
-
public function radio($name, $current=1, $value=1, $options=NULL) {
|
406 |
-
if(!is_array($options)) {
|
407 |
-
$options=array();
|
408 |
-
}
|
409 |
-
$options['radio']=TRUE;
|
410 |
-
$options['id']=$name.'_'.$value;
|
411 |
-
return $this->checkbox($name, $current, $value, $options);
|
412 |
-
}
|
413 |
-
public function checkbox($name, $current=1, $value=1, $options=NULL) {
|
414 |
-
global $tcmp;
|
415 |
-
if(is_array($current) && isset($current[$name])) {
|
416 |
-
$current=$current[$name];
|
417 |
-
}
|
418 |
-
|
419 |
-
/*
|
420 |
-
$defaults=array('class'=>'tcmp-checkbox', 'style'=>'margin:0px; margin-right:4px;');
|
421 |
-
if($this->premium && !$tcmp->License->hasPremium()) {
|
422 |
-
$defaults['disabled']='disabled';
|
423 |
-
$value='';
|
424 |
-
}
|
425 |
-
*/
|
426 |
-
if(!is_array($options)) {
|
427 |
-
$options=array();
|
428 |
-
}
|
429 |
-
|
430 |
-
$label=$name;
|
431 |
-
$type='checkbox';
|
432 |
-
if(isset($options['radio']) && $options['radio']) {
|
433 |
-
$type='radio';
|
434 |
-
$label.='_'.$value;
|
435 |
-
}
|
436 |
-
|
437 |
-
$defaults=array(
|
438 |
-
'class'=>'tcmp-checkbox'
|
439 |
-
, 'style'=>'margin:0px; margin-right:4px;'
|
440 |
-
, 'id'=>$name
|
441 |
-
);
|
442 |
-
$other=$this->getTextArgs($options, $defaults, array('radio', 'label'));
|
443 |
-
$prev=$this->leftLabels;
|
444 |
-
$this->leftLabels=FALSE;
|
445 |
-
|
446 |
-
$label=(isset($options['label']) ? $options['label'] : $this->prefix.'.'.$label);
|
447 |
-
$id=(isset($options['id']) ? $options['id'] : $name);
|
448 |
-
$options=array(
|
449 |
-
'class'=>''
|
450 |
-
, 'style'=>'margin-top:-1px;'
|
451 |
-
, 'label'=>$label
|
452 |
-
, 'id'=>$id
|
453 |
-
);
|
454 |
-
$this->leftInput($name, $options);
|
455 |
-
?>
|
456 |
-
<input type="<?php echo $type ?>" name="<?php echo $name?>" value="<?php echo $value?>" <?php echo($current==$value ? 'checked="checked"' : '') ?> <?php echo $other?> >
|
457 |
-
<?php
|
458 |
-
$this->rightInput($name, $options);
|
459 |
-
$this->leftLabels=$prev;
|
460 |
-
}
|
461 |
-
|
462 |
-
public function checkText($nameActive, $nameText, $value) {
|
463 |
-
global $tcmp;
|
464 |
-
|
465 |
-
$args=array('class'=>'tcmp-hideShow tcmp-checkbox'
|
466 |
-
, 'tcmp-hideIfTrue'=>'false'
|
467 |
-
, 'tcmp-hideShow'=>$nameText.'Text');
|
468 |
-
$this->checkbox($nameActive, $value, 1, $args);
|
469 |
-
if($this->premium) {
|
470 |
-
return;
|
471 |
-
}
|
472 |
-
?>
|
473 |
-
<div id="<?php echo $nameText?>Text" style="float:left;">
|
474 |
-
<?php
|
475 |
-
$prev=$this->labels;
|
476 |
-
$this->labels=FALSE;
|
477 |
-
$args=array();
|
478 |
-
$this->text($nameText, $value, $args);
|
479 |
-
$this->labels=$prev;
|
480 |
-
?>
|
481 |
-
</div>
|
482 |
-
<?php }
|
483 |
-
|
484 |
-
//create a checkbox with a left select visible only when the checkbox is selected
|
485 |
-
public function checkSelect($nameActive, $nameArray, $value, $values, $options=NULL) {
|
486 |
-
global $tcmp;
|
487 |
-
?>
|
488 |
-
<div id="<?php echo $nameArray?>Box" style="float:left;">
|
489 |
-
<?php
|
490 |
-
$defaults=array(
|
491 |
-
'class'=>'tcmp-hideShow tcmp-checkbox'
|
492 |
-
, 'tcmp-hideIfTrue'=>'false'
|
493 |
-
, 'tcmp-hideShow'=>$nameArray.'Tags'
|
494 |
-
);
|
495 |
-
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
496 |
-
$this->checkbox($nameActive, $value, 1, $options);
|
497 |
-
/*if(!$this->premium || $tcmp->License->hasPremium()) { ?>*/
|
498 |
-
if(TRUE) { ?>
|
499 |
-
<div id="<?php echo $nameArray?>Tags" style="float:left;">
|
500 |
-
<?php
|
501 |
-
$prev=$this->labels;
|
502 |
-
$this->labels=FALSE;
|
503 |
-
$options=array('class'=>'tcmp-select tcmLineTags');
|
504 |
-
$this->dropdown($nameArray, $value, $values, TRUE, $options);
|
505 |
-
$this->labels=$prev;
|
506 |
-
?>
|
507 |
-
</div>
|
508 |
-
<?php } ?>
|
509 |
-
</div>
|
510 |
-
<?php
|
511 |
-
$this->newline();
|
512 |
-
}
|
513 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
+
|
5 |
+
class TCMP_Form {
|
6 |
+
var $prefix='Form';
|
7 |
+
var $labels=TRUE;
|
8 |
+
var $leftLabels=TRUE;
|
9 |
+
var $newline;
|
10 |
+
|
11 |
+
var $tags=TRUE;
|
12 |
+
var $onlyPremium=TRUE;
|
13 |
+
var $leftTags=FALSE;
|
14 |
+
var $premium=FALSE;
|
15 |
+
var $tagNew=FALSE;
|
16 |
+
|
17 |
+
public function __construct() {
|
18 |
+
}
|
19 |
+
|
20 |
+
//args can be a string or an associative array if you want
|
21 |
+
private function getTextArgs($args, $defaults, $excludes=array()) {
|
22 |
+
$result=$args;
|
23 |
+
|
24 |
+
if (is_string($excludes)) {
|
25 |
+
$excludes = explode(',', $excludes);
|
26 |
+
}
|
27 |
+
|
28 |
+
if(is_array($result) && count($result)>0) {
|
29 |
+
$result='';
|
30 |
+
foreach($args as $k=>$v) {
|
31 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
32 |
+
$result.=' '.$k.'="'.$v.'"';
|
33 |
+
}
|
34 |
+
}
|
35 |
+
} elseif(!$args) {
|
36 |
+
$result='';
|
37 |
+
}
|
38 |
+
if(is_array($defaults) && count($defaults)>0) {
|
39 |
+
foreach($defaults as $k=>$v) {
|
40 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
41 |
+
if(stripos($result, $k.'=')===FALSE) {
|
42 |
+
$result.=' '.$k.'="'.$v.'"';
|
43 |
+
}
|
44 |
+
}
|
45 |
+
}
|
46 |
+
}
|
47 |
+
return $result;
|
48 |
+
}
|
49 |
+
|
50 |
+
public function tag($overridePremium=FALSE) {
|
51 |
+
global $tcmp;
|
52 |
+
/*
|
53 |
+
$premium=($overridePremium || $this->premium);
|
54 |
+
if((!$overridePremium && !$this->tags) || $tcmp->License->hasPremium() || ($this->onlyPremium && !$premium)) return;
|
55 |
+
|
56 |
+
$tagClass='tcmp-tag-free';
|
57 |
+
$tagText='FREE';
|
58 |
+
if($premium) {
|
59 |
+
$tagClass='tcmp-tag-premium';
|
60 |
+
$tagText='<a href="'.TCMP_PAGE_PREMIUM.'" target="_new">PRO</a>';
|
61 |
+
}
|
62 |
+
*/
|
63 |
+
if(!$this->tags || !$this->tagNew) {
|
64 |
+
return;
|
65 |
+
}
|
66 |
+
|
67 |
+
$tagClass='tcmp-tag-free';
|
68 |
+
$tagText='NEW!';
|
69 |
+
?>
|
70 |
+
<div style="float:left;" class="tcmp-tag <?php echo $tagClass?>"><?php echo $tagText?></div>
|
71 |
+
<?php
|
72 |
+
}
|
73 |
+
|
74 |
+
public function label($name, $options='') {
|
75 |
+
global $tcmp;
|
76 |
+
$defaults=array('class'=>'');
|
77 |
+
$otherText=$this->getTextArgs($options, $defaults, array('label', 'id'));
|
78 |
+
|
79 |
+
$k=$this->prefix.'.'.$name;
|
80 |
+
if(!is_array($options)) {
|
81 |
+
$options=array();
|
82 |
+
}
|
83 |
+
if(isset($options['label']) && $options['label']) {
|
84 |
+
$k=$options['label'];
|
85 |
+
}
|
86 |
+
|
87 |
+
$label=$tcmp->Lang->L($k);
|
88 |
+
$for=(isset($options['id']) ? $options['id'] : $name);
|
89 |
+
|
90 |
+
//check if is a mandatory field by checking the .txt language file
|
91 |
+
$k=$this->prefix.'.'.$name.'.check';
|
92 |
+
if($tcmp->Lang->H($k)) {
|
93 |
+
$label.=' (*)';
|
94 |
+
}
|
95 |
+
|
96 |
+
$aClass='';
|
97 |
+
/*
|
98 |
+
if($this->premium && !$tcmp->License->hasPremium()) {
|
99 |
+
$aClass='tcmp-label-disabled';
|
100 |
+
}
|
101 |
+
*/
|
102 |
+
?>
|
103 |
+
<label for="<?php echo $for?>" <?php echo $otherText?> >
|
104 |
+
<?php if($this->leftTags) {
|
105 |
+
$this->tag();
|
106 |
+
}?>
|
107 |
+
<span style="float:left; margin-right:5px;" class="<?php echo $aClass?>"><?php echo $label?></span>
|
108 |
+
<?php if(!$this->leftTags) {
|
109 |
+
$this->tag();
|
110 |
+
}?>
|
111 |
+
</label>
|
112 |
+
<?php }
|
113 |
+
|
114 |
+
public function leftInput($name, $options='') {
|
115 |
+
if(!$this->labels) return;
|
116 |
+
if($this->leftLabels) {
|
117 |
+
$this->label($name, $options);
|
118 |
+
}
|
119 |
+
|
120 |
+
if($this->newline) {
|
121 |
+
$this->newline();
|
122 |
+
}
|
123 |
+
}
|
124 |
+
|
125 |
+
public function newline() {
|
126 |
+
?><div class="tcmp-form-newline"></div><?php
|
127 |
+
}
|
128 |
+
|
129 |
+
public function rightInput($name, $args='') {
|
130 |
+
if(!$this->labels) return;
|
131 |
+
if (!$this->leftLabels) {
|
132 |
+
$this->label($name, $args);
|
133 |
+
}
|
134 |
+
$this->newline();
|
135 |
+
}
|
136 |
+
|
137 |
+
public function formStarts($method='post', $action='', $args=NULL) {
|
138 |
+
//$this->tags=FALSE;
|
139 |
+
//$this->premium=FALSE;
|
140 |
+
|
141 |
+
//$defaults=array('style'=>'margin:1em 0; padding:1px 1em; background:#fff; border:1px solid #ccc;'
|
142 |
+
$defaults=array('class'=>'tcmp-form');
|
143 |
+
$other=$this->getTextArgs($args, $defaults);
|
144 |
+
?>
|
145 |
+
<form method="<?php echo $method?>" action="<?php echo $action?>" <?php echo $other?> >
|
146 |
+
<?php }
|
147 |
+
|
148 |
+
public function formEnds() { ?>
|
149 |
+
</form>
|
150 |
+
<?php }
|
151 |
+
|
152 |
+
public function divStarts($args=array()) {
|
153 |
+
$defaults=array();
|
154 |
+
$other=$this->getTextArgs($args, $defaults);
|
155 |
+
?>
|
156 |
+
<div <?php echo $other?>>
|
157 |
+
<?php }
|
158 |
+
public function divEnds() { ?>
|
159 |
+
</div>
|
160 |
+
<div style="clear:both;"></div>
|
161 |
+
<?php }
|
162 |
+
|
163 |
+
public function p($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
164 |
+
global $tcmp;
|
165 |
+
?>
|
166 |
+
<p style="font-weight:bold;">
|
167 |
+
<?php
|
168 |
+
$tcmp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);
|
169 |
+
if($tcmp->Lang->H($message.'Subtitle')) { ?>
|
170 |
+
<br/>
|
171 |
+
<span style="font-weight:normal;">
|
172 |
+
<?php $tcmp->Lang->P($message.'Subtitle', $v1, $v2, $v3, $v4, $v5)?>
|
173 |
+
</span>
|
174 |
+
<?php } ?>
|
175 |
+
</p>
|
176 |
+
<?php }
|
177 |
+
public function i($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
178 |
+
global $tcmp;
|
179 |
+
?>
|
180 |
+
<i><?php $tcmp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);?></i>
|
181 |
+
<?php }
|
182 |
+
|
183 |
+
var $_aceEditorUsed=FALSE;
|
184 |
+
public function editor($name, $value='', $options=NULL) {
|
185 |
+
global $tcmp;
|
186 |
+
|
187 |
+
$defaults=array(
|
188 |
+
'editor'=>'html'
|
189 |
+
, 'theme'=>'monokai'
|
190 |
+
, 'ui-visible'=>''
|
191 |
+
, 'height'=>350
|
192 |
+
, 'width'=>700
|
193 |
+
);
|
194 |
+
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
195 |
+
$value=$tcmp->Utils->get($value, $name , $value);
|
196 |
+
|
197 |
+
$args=array('class'=>'tcmp-label', 'style'=>'width:auto;');
|
198 |
+
$this->newline=TRUE;
|
199 |
+
$this->leftInput($name, $args);
|
200 |
+
|
201 |
+
$id=$name;
|
202 |
+
switch ($options['editor']) {
|
203 |
+
case 'wp':
|
204 |
+
case 'wordpress':
|
205 |
+
$settings=array(
|
206 |
+
'wpautop'=>TRUE
|
207 |
+
, 'media_buttons'=>TRUE
|
208 |
+
, 'drag_drop_upload'=>FALSE
|
209 |
+
, 'editor_height'=>$options['height']
|
210 |
+
);
|
211 |
+
wp_editor($value, $id, $settings);
|
212 |
+
?>
|
213 |
+
<script>
|
214 |
+
jQuery('#<?php echo $id?>').attr('ui-visible', '<?php echo $options['ui-visible']?>');
|
215 |
+
</script>
|
216 |
+
<?php
|
217 |
+
break;
|
218 |
+
case 'html':
|
219 |
+
case 'text':
|
220 |
+
case 'javascript':
|
221 |
+
case 'css':
|
222 |
+
if(!$this->_aceEditorUsed) { ?>
|
223 |
+
<script src="https://cdnjs.cloudflare.com/ajax/libs/ace/1.2.3/ace.js" type="text/javascript" charset="utf-8"></script>
|
224 |
+
<?php $this->_aceEditorUsed=TRUE;
|
225 |
+
}
|
226 |
+
|
227 |
+
$ace='ACE_'.$id;
|
228 |
+
$text=$value;
|
229 |
+
//$text=str_replace('&', '&', $text);
|
230 |
+
$text=str_replace('<', '<', $text);
|
231 |
+
$text=str_replace('>', '>', $text);
|
232 |
+
?>
|
233 |
+
<div id="<?php echo $id?>Ace" style="height:<?php echo $options['height']+50?>px; width: <?php echo $options['width']?>px;"><?php echo $text?></div>
|
234 |
+
<textarea id="<?php echo $id?>" name="<?php echo $id?>" ui-visible="<?php echo $options['ui-visible']?>" style="display: none;"></textarea>
|
235 |
+
<script>
|
236 |
+
jQuery.noConflict()(function($){
|
237 |
+
var text=$('#<?php echo $id?>Ace').html();
|
238 |
+
text=TCMP.replace(text, '<', '<');
|
239 |
+
text=TCMP.replace(text, '>', '>');
|
240 |
+
text=TCMP.replace(text, '&', '&');
|
241 |
+
|
242 |
+
var <?php echo $ace?>=ace.edit("<?php echo $id?>Ace");
|
243 |
+
<?php echo $ace?>.renderer.setShowGutter(false);
|
244 |
+
<?php echo $ace?>.setTheme("ace/theme/<?php echo $options['theme']?>");
|
245 |
+
<?php echo $ace?>.getSession().setMode("ace/mode/<?php echo $options['editor']?>");
|
246 |
+
<?php echo $ace?>.getSession().setUseSoftTabs(true);
|
247 |
+
<?php echo $ace?>.getSession().setUseWrapMode(true);
|
248 |
+
<?php echo $ace?>.session.setUseWorker(false)
|
249 |
+
<?php echo $ace?>.setValue(text);
|
250 |
+
|
251 |
+
$('#<?php echo $id?>Ace').focusout(function() {
|
252 |
+
var $hidden=$('#<?php echo $id?>');
|
253 |
+
var code=<?php echo $ace?>.getValue();
|
254 |
+
$hidden.val(code);
|
255 |
+
});
|
256 |
+
$('#<?php echo $id?>Ace').trigger('focusout');
|
257 |
+
});
|
258 |
+
</script>
|
259 |
+
<?php
|
260 |
+
break;
|
261 |
+
}
|
262 |
+
$this->newline=FALSE;
|
263 |
+
$this->rightInput($name, $args);
|
264 |
+
}
|
265 |
+
|
266 |
+
public function textarea($name, $value='', $args=NULL) {
|
267 |
+
if(is_array($value) && isset($value[$name])) {
|
268 |
+
$value=$value[$name];
|
269 |
+
}
|
270 |
+
$defaults=array('rows'=>10, 'class'=>'tcmp-textarea');
|
271 |
+
$other=$this->getTextArgs($args, $defaults);
|
272 |
+
|
273 |
+
$args=array('class'=>'tcmp-label', 'style'=>'width:auto;');
|
274 |
+
$this->newline=TRUE;
|
275 |
+
$this->leftInput($name, $args);
|
276 |
+
?>
|
277 |
+
<textarea dir="ltr" dirname="ltr" id="<?php echo $name ?>" name="<?php echo $name?>" <?php echo $other?> ><?php echo $value ?></textarea>
|
278 |
+
<?php
|
279 |
+
$this->newline=FALSE;
|
280 |
+
$this->rightInput($name, $args);
|
281 |
+
}
|
282 |
+
|
283 |
+
public function number($name, $value = '', $options = NULL)
|
284 |
+
{
|
285 |
+
if (!$options) {
|
286 |
+
$options = array();
|
287 |
+
}
|
288 |
+
$options['type'] = 'number';
|
289 |
+
$options['autocomplete'] = 'off';
|
290 |
+
$options['style'] = 'width:100px;';
|
291 |
+
if (!isset($options['min'])) {
|
292 |
+
$options['min'] = 0;
|
293 |
+
}
|
294 |
+
|
295 |
+
return $this->text($name, $value, $options);
|
296 |
+
}
|
297 |
+
|
298 |
+
public function text($name, $value = '', $options = NULL)
|
299 |
+
{
|
300 |
+
if (is_array($value) && isset($value[$name])) {
|
301 |
+
$value = $value[$name];
|
302 |
+
}
|
303 |
+
|
304 |
+
$type = 'text';
|
305 |
+
if (isset($options['type'])) {
|
306 |
+
$type = $options['type'];
|
307 |
+
}
|
308 |
+
|
309 |
+
$defaults = array('class' => 'tcmp-'.$type);
|
310 |
+
$other = $this->getTextArgs($options, $defaults, 'type');
|
311 |
+
|
312 |
+
$args = array('class' => 'tcmp-label');
|
313 |
+
$this->leftInput($name, $args);
|
314 |
+
?>
|
315 |
+
<input type="<?php echo $type?>" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
316 |
+
<?php
|
317 |
+
$this->rightInput($name, $args);
|
318 |
+
}
|
319 |
+
|
320 |
+
public function hidden($name, $value='', $args=NULL) {
|
321 |
+
if(is_array($value) && isset($value[$name])) {
|
322 |
+
$value=$value[$name];
|
323 |
+
}
|
324 |
+
$defaults=array();
|
325 |
+
$other=$this->getTextArgs($args, $defaults);
|
326 |
+
?>
|
327 |
+
<input type="hidden" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
328 |
+
<?php }
|
329 |
+
|
330 |
+
public function nonce($action=-1, $name='_wpnonce', $referer=true, $echo=true) {
|
331 |
+
wp_nonce_field($action, $name, $referer, $echo);
|
332 |
+
}
|
333 |
+
|
334 |
+
public function dropdown($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
335 |
+
global $tcmp;
|
336 |
+
if(is_array($value) && isset($value[$name])) {
|
337 |
+
$value=$value[$name];
|
338 |
+
}
|
339 |
+
$defaults=array('class'=>'tcmp-select tcmTags tcmp-dropdown');
|
340 |
+
$other=$this->getTextArgs($args, $defaults);
|
341 |
+
|
342 |
+
if(!is_array($value)) {
|
343 |
+
$value=array($value);
|
344 |
+
}
|
345 |
+
if(is_string($options)) {
|
346 |
+
$options=explode(',', $options);
|
347 |
+
}
|
348 |
+
if(is_array($options) && count($options)>0) {
|
349 |
+
if(!isset($options[0]['id'])) {
|
350 |
+
//this is a normal array so I use the values for "id" field and the "name" into the txt file
|
351 |
+
$temp=array();
|
352 |
+
foreach($options as $v) {
|
353 |
+
$temp[]=array('id'=>$v, 'name'=>$tcmp->Lang->L($this->prefix.'.'.$name.'.'.$v));
|
354 |
+
}
|
355 |
+
$options=$temp;
|
356 |
+
}
|
357 |
+
}
|
358 |
+
|
359 |
+
echo "<div id=\"$name-box\">";
|
360 |
+
$args=array('class'=>'tcmp-label');
|
361 |
+
$this->leftInput($name, $args);
|
362 |
+
?>
|
363 |
+
<select id="<?php echo $name ?>" name="<?php echo $name?><?php echo ($multiple ? '[]' : '')?>" <?php echo ($multiple ? 'multiple' : '')?> <?php echo $other?> >
|
364 |
+
<?php
|
365 |
+
foreach($options as $v) {
|
366 |
+
$selected='';
|
367 |
+
if(in_array($v['id'], $value)) {
|
368 |
+
$selected=' selected="selected"';
|
369 |
+
}
|
370 |
+
?>
|
371 |
+
<option value="<?php echo $v['id']?>" <?php echo $selected?>><?php echo $v['name']?></option>
|
372 |
+
<?php } ?>
|
373 |
+
</select>
|
374 |
+
<?php
|
375 |
+
$this->rightInput($name, $args);
|
376 |
+
echo '</div>';
|
377 |
+
}
|
378 |
+
|
379 |
+
public function br() { ?>
|
380 |
+
<br/>
|
381 |
+
<?php }
|
382 |
+
|
383 |
+
public function submit($value='', $args=NULL) {
|
384 |
+
global $tcmp;
|
385 |
+
$defaults=array();
|
386 |
+
$other=$this->getTextArgs($args, $defaults);
|
387 |
+
if($value=='') {
|
388 |
+
$value='Send';
|
389 |
+
}
|
390 |
+
$this->newline();
|
391 |
+
?>
|
392 |
+
<input type="submit" class="button-primary tcmp-button tcmp-submit" value="<?php $tcmp->Lang->P($value)?>" <?php echo $other?>/>
|
393 |
+
<?php }
|
394 |
+
|
395 |
+
public function delete($id, $action='delete', $args=NULL) {
|
396 |
+
global $tcmp;
|
397 |
+
$defaults=array();
|
398 |
+
$other=$this->getTextArgs($args, $defaults);
|
399 |
+
?>
|
400 |
+
<input type="button" class="button tcmp-button" value="<?php $tcmp->Lang->P('Delete?')?>" onclick="if (confirm('<?php $tcmp->Lang->P('Question.DeleteQuestion')?>') ) window.location='<?php echo TCMP_TAB_MANAGER_URI?>&action=<?php echo $action?>&id=<?php echo $id ?>&tcmp_nonce=<?php echo esc_attr(wp_create_nonce('tcmp_delete')); ?>';" <?php echo $other?> />
|
401 |
+
|
402 |
+
<?php
|
403 |
+
}
|
404 |
+
|
405 |
+
public function radio($name, $current=1, $value=1, $options=NULL) {
|
406 |
+
if(!is_array($options)) {
|
407 |
+
$options=array();
|
408 |
+
}
|
409 |
+
$options['radio']=TRUE;
|
410 |
+
$options['id']=$name.'_'.$value;
|
411 |
+
return $this->checkbox($name, $current, $value, $options);
|
412 |
+
}
|
413 |
+
public function checkbox($name, $current=1, $value=1, $options=NULL) {
|
414 |
+
global $tcmp;
|
415 |
+
if(is_array($current) && isset($current[$name])) {
|
416 |
+
$current=$current[$name];
|
417 |
+
}
|
418 |
+
|
419 |
+
/*
|
420 |
+
$defaults=array('class'=>'tcmp-checkbox', 'style'=>'margin:0px; margin-right:4px;');
|
421 |
+
if($this->premium && !$tcmp->License->hasPremium()) {
|
422 |
+
$defaults['disabled']='disabled';
|
423 |
+
$value='';
|
424 |
+
}
|
425 |
+
*/
|
426 |
+
if(!is_array($options)) {
|
427 |
+
$options=array();
|
428 |
+
}
|
429 |
+
|
430 |
+
$label=$name;
|
431 |
+
$type='checkbox';
|
432 |
+
if(isset($options['radio']) && $options['radio']) {
|
433 |
+
$type='radio';
|
434 |
+
$label.='_'.$value;
|
435 |
+
}
|
436 |
+
|
437 |
+
$defaults=array(
|
438 |
+
'class'=>'tcmp-checkbox'
|
439 |
+
, 'style'=>'margin:0px; margin-right:4px;'
|
440 |
+
, 'id'=>$name
|
441 |
+
);
|
442 |
+
$other=$this->getTextArgs($options, $defaults, array('radio', 'label'));
|
443 |
+
$prev=$this->leftLabels;
|
444 |
+
$this->leftLabels=FALSE;
|
445 |
+
|
446 |
+
$label=(isset($options['label']) ? $options['label'] : $this->prefix.'.'.$label);
|
447 |
+
$id=(isset($options['id']) ? $options['id'] : $name);
|
448 |
+
$options=array(
|
449 |
+
'class'=>''
|
450 |
+
, 'style'=>'margin-top:-1px;'
|
451 |
+
, 'label'=>$label
|
452 |
+
, 'id'=>$id
|
453 |
+
);
|
454 |
+
$this->leftInput($name, $options);
|
455 |
+
?>
|
456 |
+
<input type="<?php echo $type ?>" name="<?php echo $name?>" value="<?php echo $value?>" <?php echo($current==$value ? 'checked="checked"' : '') ?> <?php echo $other?> >
|
457 |
+
<?php
|
458 |
+
$this->rightInput($name, $options);
|
459 |
+
$this->leftLabels=$prev;
|
460 |
+
}
|
461 |
+
|
462 |
+
public function checkText($nameActive, $nameText, $value) {
|
463 |
+
global $tcmp;
|
464 |
+
|
465 |
+
$args=array('class'=>'tcmp-hideShow tcmp-checkbox'
|
466 |
+
, 'tcmp-hideIfTrue'=>'false'
|
467 |
+
, 'tcmp-hideShow'=>$nameText.'Text');
|
468 |
+
$this->checkbox($nameActive, $value, 1, $args);
|
469 |
+
if($this->premium) {
|
470 |
+
return;
|
471 |
+
}
|
472 |
+
?>
|
473 |
+
<div id="<?php echo $nameText?>Text" style="float:left;">
|
474 |
+
<?php
|
475 |
+
$prev=$this->labels;
|
476 |
+
$this->labels=FALSE;
|
477 |
+
$args=array();
|
478 |
+
$this->text($nameText, $value, $args);
|
479 |
+
$this->labels=$prev;
|
480 |
+
?>
|
481 |
+
</div>
|
482 |
+
<?php }
|
483 |
+
|
484 |
+
//create a checkbox with a left select visible only when the checkbox is selected
|
485 |
+
public function checkSelect($nameActive, $nameArray, $value, $values, $options=NULL) {
|
486 |
+
global $tcmp;
|
487 |
+
?>
|
488 |
+
<div id="<?php echo $nameArray?>Box" style="float:left;">
|
489 |
+
<?php
|
490 |
+
$defaults=array(
|
491 |
+
'class'=>'tcmp-hideShow tcmp-checkbox'
|
492 |
+
, 'tcmp-hideIfTrue'=>'false'
|
493 |
+
, 'tcmp-hideShow'=>$nameArray.'Tags'
|
494 |
+
);
|
495 |
+
$options=$tcmp->Utils->parseArgs($options, $defaults);
|
496 |
+
$this->checkbox($nameActive, $value, 1, $options);
|
497 |
+
/*if(!$this->premium || $tcmp->License->hasPremium()) { ?>*/
|
498 |
+
if(TRUE) { ?>
|
499 |
+
<div id="<?php echo $nameArray?>Tags" style="float:left;">
|
500 |
+
<?php
|
501 |
+
$prev=$this->labels;
|
502 |
+
$this->labels=FALSE;
|
503 |
+
$options=array('class'=>'tcmp-select tcmLineTags');
|
504 |
+
$this->dropdown($nameArray, $value, $values, TRUE, $options);
|
505 |
+
$this->labels=$prev;
|
506 |
+
?>
|
507 |
+
</div>
|
508 |
+
<?php } ?>
|
509 |
+
</div>
|
510 |
+
<?php
|
511 |
+
$this->newline();
|
512 |
+
}
|
513 |
}
|
includes/classes/ui/Tabs.php
CHANGED
@@ -1,294 +1,294 @@
|
|
1 |
-
<?php
|
2 |
-
class TCMP_Tabs {
|
3 |
-
private $tabs = array();
|
4 |
-
|
5 |
-
function __construct() {
|
6 |
-
}
|
7 |
-
public function init() {
|
8 |
-
global $tcmp;
|
9 |
-
if($tcmp->Utils->isAdminUser()) {
|
10 |
-
add_action('admin_menu', array(&$this, 'attachMenu'));
|
11 |
-
add_filter('plugin_action_links', array(&$this, 'pluginActions'), 10, 2);
|
12 |
-
if($tcmp->Utils->isPluginPage()) {
|
13 |
-
add_action('admin_enqueue_scripts', array(&$this, 'enqueueScripts'));
|
14 |
-
}
|
15 |
-
}
|
16 |
-
}
|
17 |
-
|
18 |
-
function attachMenu() {
|
19 |
-
add_submenu_page('options-general.php'
|
20 |
-
, TCMP_PLUGIN_NAME, TCMP_PLUGIN_NAME
|
21 |
-
, 'manage_options', TCMP_PLUGIN_SLUG, array(&$this, 'showTabPage'));
|
22 |
-
}
|
23 |
-
function pluginActions($links, $file) {
|
24 |
-
global $tcmp;
|
25 |
-
if($file==TCMP_PLUGIN_SLUG.'/index.php'){
|
26 |
-
$settings=array();
|
27 |
-
$settings[]="<a href='".TCMP_TAB_MANAGER_URI."'>".$tcmp->Lang->L('Settings').'</a>';
|
28 |
-
$settings[]="<a href='".TCMP_PAGE_PREMIUM."'>".$tcmp->Lang->L('PREMIUM').'</a>';
|
29 |
-
$links=array_merge($settings, $links);
|
30 |
-
}
|
31 |
-
return $links;
|
32 |
-
}
|
33 |
-
function enqueueScripts() {
|
34 |
-
wp_enqueue_script('jquery');
|
35 |
-
wp_enqueue_script('jQuery');
|
36 |
-
wp_enqueue_script('jquery-ui-sortable');
|
37 |
-
|
38 |
-
$this->wpEnqueueStyle('assets/css/style.css');
|
39 |
-
$this->wpEnqueueStyle('assets/deps/select2-3.5.2/select2.css');
|
40 |
-
$this->wpEnqueueScript('assets/deps/select2-3.5.2/select2.min.js');
|
41 |
-
$this->wpEnqueueScript('assets/deps/starrr/starrr.js');
|
42 |
-
|
43 |
-
$this->wpEnqueueScript('assets/js/library.js');
|
44 |
-
$this->wpEnqueueScript('assets/js/plugin.js');
|
45 |
-
}
|
46 |
-
function wpEnqueueStyle($uri, $name='') {
|
47 |
-
if($name=='') {
|
48 |
-
$name=explode('/', $uri);
|
49 |
-
$name=$name[count($name)-1];
|
50 |
-
$dot=strrpos($name, '.');
|
51 |
-
if($dot!==FALSE) {
|
52 |
-
$name=substr($name, 0, $dot);
|
53 |
-
}
|
54 |
-
$name=TCMP_PLUGIN_PREFIX.'_'.$name;
|
55 |
-
}
|
56 |
-
|
57 |
-
$v='?v='.TCMP_PLUGIN_VERSION;
|
58 |
-
wp_enqueue_style($name, TCMP_PLUGIN_URI.$uri.$v);
|
59 |
-
}
|
60 |
-
function wpEnqueueScript($uri, $name='', $version=FALSE) {
|
61 |
-
if($name=='') {
|
62 |
-
$name=explode('/', $uri);
|
63 |
-
$name=$name[count($name)-1];
|
64 |
-
$dot=strrpos($name, '.');
|
65 |
-
if($dot!==FALSE) {
|
66 |
-
$name=substr($name, 0, $dot);
|
67 |
-
}
|
68 |
-
$name=TCMP_PLUGIN_PREFIX.'_'.$name;
|
69 |
-
}
|
70 |
-
|
71 |
-
$v='?v='.TCMP_PLUGIN_VERSION;
|
72 |
-
$deps=array();
|
73 |
-
wp_enqueue_script($name, TCMP_PLUGIN_URI.$uri.$v, $deps, $version, FALSE);
|
74 |
-
}
|
75 |
-
|
76 |
-
function showTabPage() {
|
77 |
-
global $tcmp;
|
78 |
-
|
79 |
-
$v=$tcmp->Options->getShowWhatsNewSeenVersion();
|
80 |
-
if($v!=TCMP_WHATSNEW_VERSION) {
|
81 |
-
$tcmp->Options->setShowWhatsNew(TRUE);
|
82 |
-
}
|
83 |
-
|
84 |
-
$hwb=TCMP_ISQS('hwb', '');
|
85 |
-
if($hwb!='') {
|
86 |
-
$tcmp->Options->setShowWhatsNew(FALSE);
|
87 |
-
}
|
88 |
-
|
89 |
-
$id=TCMP_ISQS('id', 0);
|
90 |
-
$defaultTab=TCMP_TAB_MANAGER;
|
91 |
-
$tab=TCMP_SQS('tab', $defaultTab);
|
92 |
-
|
93 |
-
if($tcmp->Options->isShowWhatsNew()) {
|
94 |
-
$tab=TCMP_TAB_WHATS_NEW;
|
95 |
-
$defaultTab=$tab;
|
96 |
-
$this->tabs[TCMP_TAB_WHATS_NEW]=$tcmp->Lang->L('What\'s New');
|
97 |
-
//$this->tabs[TCMP_TAB_MANAGER]=$tcmp->Lang->L('Start using the plugin!');
|
98 |
-
} else {
|
99 |
-
if($id>0 || !$tcmp->Manager->isLimitReached(FALSE)) {
|
100 |
-
$this->tabs[TCMP_TAB_EDITOR]=$tcmp->Lang->L($id>0 && $tab==TCMP_TAB_EDITOR ? 'Edit Script' : 'Add New Script');
|
101 |
-
} elseif($tab==TCMP_TAB_EDITOR) {
|
102 |
-
$tab = TCMP_TAB_MANAGER;
|
103 |
-
}
|
104 |
-
|
105 |
-
$this->tabs[TCMP_TAB_MANAGER]=$tcmp->Lang->L('Manager');
|
106 |
-
$this->tabs[TCMP_TAB_SETTINGS]=$tcmp->Lang->L('Settings');
|
107 |
-
$this->tabs[TCMP_TAB_DOCS]=$tcmp->Lang->L('Docs & FAQ');
|
108 |
-
}
|
109 |
-
|
110 |
-
?>
|
111 |
-
|
112 |
-
<div class="wrap" style="margin: 5px;">
|
113 |
-
<?php
|
114 |
-
$this->showTabs($defaultTab);
|
115 |
-
$header='';
|
116 |
-
switch ($tab) {
|
117 |
-
case TCMP_TAB_EDITOR:
|
118 |
-
$header=($id>0 ? 'Edit' : 'Add');
|
119 |
-
break;
|
120 |
-
case TCMP_TAB_WHATS_NEW:
|
121 |
-
$header='';
|
122 |
-
break;
|
123 |
-
case TCMP_TAB_MANAGER:
|
124 |
-
$header='Manager';
|
125 |
-
break;
|
126 |
-
case TCMP_TAB_SETTINGS:
|
127 |
-
$header='Settings';
|
128 |
-
break;
|
129 |
-
}
|
130 |
-
|
131 |
-
if($tcmp->Lang->H($header.'Title')) { ?>
|
132 |
-
<h2><?php $tcmp->Lang->P($header . 'Title', TCMP_PLUGIN_VERSION) ?></h2>
|
133 |
-
<?php if ($tcmp->Lang->H($header . 'Subtitle')) { ?>
|
134 |
-
<div><?php $tcmp->Lang->P($header . 'Subtitle') ?></div>
|
135 |
-
<?php } ?>
|
136 |
-
<br/>
|
137 |
-
<?php }
|
138 |
-
|
139 |
-
tcmp_ui_first_time();
|
140 |
-
?>
|
141 |
-
<div style="float:left; margin:5px;">
|
142 |
-
<?php
|
143 |
-
$styles=array();
|
144 |
-
$styles[]='float:left';
|
145 |
-
$styles[]='margin-right:20px';
|
146 |
-
if($tab!=TCMP_TAB_WHATS_NEW) {
|
147 |
-
$styles[]='max-width:750px';
|
148 |
-
}
|
149 |
-
$styles=implode('; ', $styles);
|
150 |
-
?>
|
151 |
-
<div id="tcmp-page" style="<?php echo $styles?>">
|
152 |
-
<?php switch ($tab) {
|
153 |
-
case TCMP_TAB_WHATS_NEW:
|
154 |
-
tcmp_ui_whats_new();
|
155 |
-
break;
|
156 |
-
case TCMP_TAB_EDITOR:
|
157 |
-
tcmp_ui_editor();
|
158 |
-
break;
|
159 |
-
case TCMP_TAB_MANAGER:
|
160 |
-
tcmp_ui_manager();
|
161 |
-
break;
|
162 |
-
case TCMP_TAB_SETTINGS:
|
163 |
-
tcmp_ui_track();
|
164 |
-
tcmp_ui_settings();
|
165 |
-
break;
|
166 |
-
} ?>
|
167 |
-
</div>
|
168 |
-
<?php if($tab!=TCMP_TAB_WHATS_NEW) { ?>
|
169 |
-
<div id="tcmp-sidebar" style="float:left; max-width: 250px;">
|
170 |
-
<?php
|
171 |
-
$count=$this->getPluginsCount();
|
172 |
-
$plugins=array();
|
173 |
-
while(count($plugins)<2) {
|
174 |
-
$id=rand(1, $count);
|
175 |
-
if(!isset($plugins[$id])) {
|
176 |
-
$plugins[$id]=$id;
|
177 |
-
}
|
178 |
-
}
|
179 |
-
|
180 |
-
$this->drawContactUsWidget();
|
181 |
-
foreach($plugins as $id) {
|
182 |
-
$this->drawPluginWidget($id);
|
183 |
-
}
|
184 |
-
?>
|
185 |
-
</div>
|
186 |
-
<?php } ?>
|
187 |
-
</div>
|
188 |
-
</div>
|
189 |
-
<div style="clear:both"></div>
|
190 |
-
<?php }
|
191 |
-
function getPluginsCount() {
|
192 |
-
global $tcmp;
|
193 |
-
$index=1;
|
194 |
-
while($tcmp->Lang->H('Plugin'.$index.'.Name')) {
|
195 |
-
$index++;
|
196 |
-
}
|
197 |
-
return $index-1;
|
198 |
-
}
|
199 |
-
function drawPluginWidget($id) {
|
200 |
-
global $tcmp;
|
201 |
-
?>
|
202 |
-
<div class="tcmp-plugin-widget">
|
203 |
-
<b><?php $tcmp->Lang->P('Plugin'.$id.'.Name') ?></b>
|
204 |
-
<br>
|
205 |
-
<i><?php $tcmp->Lang->P('Plugin'.$id.'.Subtitle') ?></i>
|
206 |
-
<br>
|
207 |
-
<ul style="list-style: circle;">
|
208 |
-
<?php
|
209 |
-
$index=1;
|
210 |
-
while($tcmp->Lang->H('Plugin'.$id.'.Feature'.$index)) { ?>
|
211 |
-
<li><?php $tcmp->Lang->P('Plugin'.$id.'.Feature'.$index) ?></li>
|
212 |
-
<?php $index++;
|
213 |
-
} ?>
|
214 |
-
</ul>
|
215 |
-
<a style="float:right;" class="button-primary" href="<?php $tcmp->Lang->P('Plugin'.$id.'.Permalink') ?>" target="_blank">
|
216 |
-
<?php $tcmp->Lang->P('PluginCTA')?>
|
217 |
-
</a>
|
218 |
-
<div style="clear:both"></div>
|
219 |
-
</div>
|
220 |
-
<br>
|
221 |
-
<?php }
|
222 |
-
function drawContactUsWidget() {
|
223 |
-
global $tcmp;
|
224 |
-
?>
|
225 |
-
<b><?php $tcmp->Lang->P('Sidebar.Title') ?></b>
|
226 |
-
<ul style="list-style: circle;">
|
227 |
-
<?php
|
228 |
-
$index=1;
|
229 |
-
while($tcmp->Lang->H('Sidebar'.$index.'.Name')) { ?>
|
230 |
-
<li>
|
231 |
-
<a href="<?php $tcmp->Lang->P('Sidebar'.$index.'.Url')?>" target="_blank">
|
232 |
-
<?php $tcmp->Lang->P('Sidebar'.$index.'.Name')?>
|
233 |
-
</a>
|
234 |
-
</li>
|
235 |
-
<?php $index++;
|
236 |
-
} ?>
|
237 |
-
</ul>
|
238 |
-
<?php }
|
239 |
-
function showTabs($defaultTab) {
|
240 |
-
global $tcmp;
|
241 |
-
$tab=$tcmp->Check->of('tab', $defaultTab);
|
242 |
-
if($tab==TCMP_TAB_DOCS) {
|
243 |
-
$tcmp->Utils->redirect(TCMP_TAB_DOCS_URI);
|
244 |
-
}
|
245 |
-
if($tcmp->Options->isShowWhatsNew()) {
|
246 |
-
$tab=TCMP_TAB_WHATS_NEW;
|
247 |
-
}
|
248 |
-
|
249 |
-
?>
|
250 |
-
<h2 class="nav-tab-wrapper" style="float:left; width:97%;">
|
251 |
-
<?php
|
252 |
-
foreach ($this->tabs as $k=>$v) {
|
253 |
-
$active = ($tab==$k ? 'nav-tab-active' : '');
|
254 |
-
$style='';
|
255 |
-
$target='_self';
|
256 |
-
if($tcmp->Options->isShowWhatsNew() && $k==TCMP_TAB_MANAGER) {
|
257 |
-
$active='';
|
258 |
-
$style='background-color:#F2E49B';
|
259 |
-
}
|
260 |
-
if($k==TCMP_TAB_DOCS) {
|
261 |
-
$target='_blank';
|
262 |
-
$style='background-color:#F2E49B';
|
263 |
-
}
|
264 |
-
?>
|
265 |
-
<a style="float:left; margin-left:10px; <?php echo $style?>" class="nav-tab <?php echo $active?>" target="<?php echo $target ?>" href="?page=<?php echo TCMP_PLUGIN_SLUG?>&tab=<?php echo $k?>"><?php echo $v?></a>
|
266 |
-
<?php
|
267 |
-
}
|
268 |
-
?>
|
269 |
-
<link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/font-awesome/4.2.0/css/font-awesome.min.css">
|
270 |
-
<style>
|
271 |
-
.starrr {display:inline-block}
|
272 |
-
.starrr i{font-size:16px;padding:0 1px;cursor:pointer;color:#2ea2cc;}
|
273 |
-
</style>
|
274 |
-
<div style="float:right; display:none;" id="rate-box">
|
275 |
-
<span style="font-weight:700; font-size:13px; color:#555;"><?php $tcmp->Lang->P('Rate us')?></span>
|
276 |
-
<div id="tcmp-rate" class="starrr" data-connected-input="tcmp-rate-rank"></div>
|
277 |
-
<input type="hidden" id="tcmp-rate-rank" name="tcmp-rate-rank" value="5" />
|
278 |
-
<?php $tcmp->Utils->twitter('
|
279 |
-
</div>
|
280 |
-
<script>
|
281 |
-
jQuery(function() {
|
282 |
-
jQuery(".starrr").starrr();
|
283 |
-
jQuery('#tcmp-rate').on('starrr:change', function(e, value){
|
284 |
-
var url='https://wordpress.org/support/view/plugin-reviews/tracking-code-manager?rate=5#postform';
|
285 |
-
window.open(url);
|
286 |
-
});
|
287 |
-
jQuery('#rate-box').show();
|
288 |
-
});
|
289 |
-
</script>
|
290 |
-
</h2>
|
291 |
-
<div style="clear:both;"></div>
|
292 |
-
<?php }
|
293 |
-
}
|
294 |
-
|
1 |
+
<?php
|
2 |
+
class TCMP_Tabs {
|
3 |
+
private $tabs = array();
|
4 |
+
|
5 |
+
function __construct() {
|
6 |
+
}
|
7 |
+
public function init() {
|
8 |
+
global $tcmp;
|
9 |
+
if($tcmp->Utils->isAdminUser()) {
|
10 |
+
add_action('admin_menu', array(&$this, 'attachMenu'));
|
11 |
+
add_filter('plugin_action_links', array(&$this, 'pluginActions'), 10, 2);
|
12 |
+
if($tcmp->Utils->isPluginPage()) {
|
13 |
+
add_action('admin_enqueue_scripts', array(&$this, 'enqueueScripts'));
|
14 |
+
}
|
15 |
+
}
|
16 |
+
}
|
17 |
+
|
18 |
+
function attachMenu() {
|
19 |
+
add_submenu_page('options-general.php'
|
20 |
+
, TCMP_PLUGIN_NAME, TCMP_PLUGIN_NAME
|
21 |
+
, 'manage_options', TCMP_PLUGIN_SLUG, array(&$this, 'showTabPage'));
|
22 |
+
}
|
23 |
+
function pluginActions($links, $file) {
|
24 |
+
global $tcmp;
|
25 |
+
if($file==TCMP_PLUGIN_SLUG.'/index.php'){
|
26 |
+
$settings=array();
|
27 |
+
$settings[]="<a href='".TCMP_TAB_MANAGER_URI."'>".$tcmp->Lang->L('Settings').'</a>';
|
28 |
+
$settings[]="<a href='".TCMP_PAGE_PREMIUM."'>".$tcmp->Lang->L('PREMIUM').'</a>';
|
29 |
+
$links=array_merge($settings, $links);
|
30 |
+
}
|
31 |
+
return $links;
|
32 |
+
}
|
33 |
+
function enqueueScripts() {
|
34 |
+
wp_enqueue_script('jquery');
|
35 |
+
wp_enqueue_script('jQuery');
|
36 |
+
wp_enqueue_script('jquery-ui-sortable');
|
37 |
+
|
38 |
+
$this->wpEnqueueStyle('assets/css/style.css');
|
39 |
+
$this->wpEnqueueStyle('assets/deps/select2-3.5.2/select2.css');
|
40 |
+
$this->wpEnqueueScript('assets/deps/select2-3.5.2/select2.min.js');
|
41 |
+
$this->wpEnqueueScript('assets/deps/starrr/starrr.js');
|
42 |
+
|
43 |
+
$this->wpEnqueueScript('assets/js/library.js');
|
44 |
+
$this->wpEnqueueScript('assets/js/plugin.js');
|
45 |
+
}
|
46 |
+
function wpEnqueueStyle($uri, $name='') {
|
47 |
+
if($name=='') {
|
48 |
+
$name=explode('/', $uri);
|
49 |
+
$name=$name[count($name)-1];
|
50 |
+
$dot=strrpos($name, '.');
|
51 |
+
if($dot!==FALSE) {
|
52 |
+
$name=substr($name, 0, $dot);
|
53 |
+
}
|
54 |
+
$name=TCMP_PLUGIN_PREFIX.'_'.$name;
|
55 |
+
}
|
56 |
+
|
57 |
+
$v='?v='.TCMP_PLUGIN_VERSION;
|
58 |
+
wp_enqueue_style($name, TCMP_PLUGIN_URI.$uri.$v);
|
59 |
+
}
|
60 |
+
function wpEnqueueScript($uri, $name='', $version=FALSE) {
|
61 |
+
if($name=='') {
|
62 |
+
$name=explode('/', $uri);
|
63 |
+
$name=$name[count($name)-1];
|
64 |
+
$dot=strrpos($name, '.');
|
65 |
+
if($dot!==FALSE) {
|
66 |
+
$name=substr($name, 0, $dot);
|
67 |
+
}
|
68 |
+
$name=TCMP_PLUGIN_PREFIX.'_'.$name;
|
69 |
+
}
|
70 |
+
|
71 |
+
$v='?v='.TCMP_PLUGIN_VERSION;
|
72 |
+
$deps=array();
|
73 |
+
wp_enqueue_script($name, TCMP_PLUGIN_URI.$uri.$v, $deps, $version, FALSE);
|
74 |
+
}
|
75 |
+
|
76 |
+
function showTabPage() {
|
77 |
+
global $tcmp;
|
78 |
+
|
79 |
+
$v=$tcmp->Options->getShowWhatsNewSeenVersion();
|
80 |
+
if($v!=TCMP_WHATSNEW_VERSION) {
|
81 |
+
$tcmp->Options->setShowWhatsNew(TRUE);
|
82 |
+
}
|
83 |
+
|
84 |
+
$hwb=TCMP_ISQS('hwb', '');
|
85 |
+
if($hwb!='') {
|
86 |
+
$tcmp->Options->setShowWhatsNew(FALSE);
|
87 |
+
}
|
88 |
+
|
89 |
+
$id=TCMP_ISQS('id', 0);
|
90 |
+
$defaultTab=TCMP_TAB_MANAGER;
|
91 |
+
$tab=TCMP_SQS('tab', $defaultTab);
|
92 |
+
|
93 |
+
if($tcmp->Options->isShowWhatsNew()) {
|
94 |
+
$tab=TCMP_TAB_WHATS_NEW;
|
95 |
+
$defaultTab=$tab;
|
96 |
+
$this->tabs[TCMP_TAB_WHATS_NEW]=$tcmp->Lang->L('What\'s New');
|
97 |
+
//$this->tabs[TCMP_TAB_MANAGER]=$tcmp->Lang->L('Start using the plugin!');
|
98 |
+
} else {
|
99 |
+
if($id>0 || !$tcmp->Manager->isLimitReached(FALSE)) {
|
100 |
+
$this->tabs[TCMP_TAB_EDITOR]=$tcmp->Lang->L($id>0 && $tab==TCMP_TAB_EDITOR ? 'Edit Script' : 'Add New Script');
|
101 |
+
} elseif($tab==TCMP_TAB_EDITOR) {
|
102 |
+
$tab = TCMP_TAB_MANAGER;
|
103 |
+
}
|
104 |
+
|
105 |
+
$this->tabs[TCMP_TAB_MANAGER]=$tcmp->Lang->L('Manager');
|
106 |
+
$this->tabs[TCMP_TAB_SETTINGS]=$tcmp->Lang->L('Settings');
|
107 |
+
$this->tabs[TCMP_TAB_DOCS]=$tcmp->Lang->L('Docs & FAQ');
|
108 |
+
}
|
109 |
+
|
110 |
+
?>
|
111 |
+
|
112 |
+
<div class="wrap" style="margin: 5px;">
|
113 |
+
<?php
|
114 |
+
$this->showTabs($defaultTab);
|
115 |
+
$header='';
|
116 |
+
switch ($tab) {
|
117 |
+
case TCMP_TAB_EDITOR:
|
118 |
+
$header=($id>0 ? 'Edit' : 'Add');
|
119 |
+
break;
|
120 |
+
case TCMP_TAB_WHATS_NEW:
|
121 |
+
$header='';
|
122 |
+
break;
|
123 |
+
case TCMP_TAB_MANAGER:
|
124 |
+
$header='Manager';
|
125 |
+
break;
|
126 |
+
case TCMP_TAB_SETTINGS:
|
127 |
+
$header='Settings';
|
128 |
+
break;
|
129 |
+
}
|
130 |
+
|
131 |
+
if($tcmp->Lang->H($header.'Title')) { ?>
|
132 |
+
<h2><?php $tcmp->Lang->P($header . 'Title', TCMP_PLUGIN_VERSION) ?></h2>
|
133 |
+
<?php if ($tcmp->Lang->H($header . 'Subtitle')) { ?>
|
134 |
+
<div><?php $tcmp->Lang->P($header . 'Subtitle') ?></div>
|
135 |
+
<?php } ?>
|
136 |
+
<br/>
|
137 |
+
<?php }
|
138 |
+
|
139 |
+
tcmp_ui_first_time();
|
140 |
+
?>
|
141 |
+
<div style="float:left; margin:5px;">
|
142 |
+
<?php
|
143 |
+
$styles=array();
|
144 |
+
$styles[]='float:left';
|
145 |
+
$styles[]='margin-right:20px';
|
146 |
+
if($tab!=TCMP_TAB_WHATS_NEW) {
|
147 |
+
$styles[]='max-width:750px';
|
148 |
+
}
|
149 |
+
$styles=implode('; ', $styles);
|
150 |
+
?>
|
151 |
+
<div id="tcmp-page" style="<?php echo $styles?>">
|
152 |
+
<?php switch ($tab) {
|
153 |
+
case TCMP_TAB_WHATS_NEW:
|
154 |
+
tcmp_ui_whats_new();
|
155 |
+
break;
|
156 |
+
case TCMP_TAB_EDITOR:
|
157 |
+
tcmp_ui_editor();
|
158 |
+
break;
|
159 |
+
case TCMP_TAB_MANAGER:
|
160 |
+
tcmp_ui_manager();
|
161 |
+
break;
|
162 |
+
case TCMP_TAB_SETTINGS:
|
163 |
+
tcmp_ui_track();
|
164 |
+
tcmp_ui_settings();
|
165 |
+
break;
|
166 |
+
} ?>
|
167 |
+
</div>
|
168 |
+
<?php if($tab!=TCMP_TAB_WHATS_NEW) { ?>
|
169 |
+
<div id="tcmp-sidebar" style="float:left; max-width: 250px;">
|
170 |
+
<?php
|
171 |
+
$count=$this->getPluginsCount();
|
172 |
+
$plugins=array();
|
173 |
+
while(count($plugins)<2) {
|
174 |
+
$id=rand(1, $count);
|
175 |
+
if(!isset($plugins[$id])) {
|
176 |
+
$plugins[$id]=$id;
|
177 |
+
}
|
178 |
+
}
|
179 |
+
|
180 |
+
$this->drawContactUsWidget();
|
181 |
+
foreach($plugins as $id) {
|
182 |
+
$this->drawPluginWidget($id);
|
183 |
+
}
|
184 |
+
?>
|
185 |
+
</div>
|
186 |
+
<?php } ?>
|
187 |
+
</div>
|
188 |
+
</div>
|
189 |
+
<div style="clear:both"></div>
|
190 |
+
<?php }
|
191 |
+
function getPluginsCount() {
|
192 |
+
global $tcmp;
|
193 |
+
$index=1;
|
194 |
+
while($tcmp->Lang->H('Plugin'.$index.'.Name')) {
|
195 |
+
$index++;
|
196 |
+
}
|
197 |
+
return $index-1;
|
198 |
+
}
|
199 |
+
function drawPluginWidget($id) {
|
200 |
+
global $tcmp;
|
201 |
+
?>
|
202 |
+
<div class="tcmp-plugin-widget">
|
203 |
+
<b><?php $tcmp->Lang->P('Plugin'.$id.'.Name') ?></b>
|
204 |
+
<br>
|
205 |
+
<i><?php $tcmp->Lang->P('Plugin'.$id.'.Subtitle') ?></i>
|
206 |
+
<br>
|
207 |
+
<ul style="list-style: circle;">
|
208 |
+
<?php
|
209 |
+
$index=1;
|
210 |
+
while($tcmp->Lang->H('Plugin'.$id.'.Feature'.$index)) { ?>
|
211 |
+
<li><?php $tcmp->Lang->P('Plugin'.$id.'.Feature'.$index) ?></li>
|
212 |
+
<?php $index++;
|
213 |
+
} ?>
|
214 |
+
</ul>
|
215 |
+
<a style="float:right;" class="button-primary" href="<?php $tcmp->Lang->P('Plugin'.$id.'.Permalink') ?>" target="_blank">
|
216 |
+
<?php $tcmp->Lang->P('PluginCTA')?>
|
217 |
+
</a>
|
218 |
+
<div style="clear:both"></div>
|
219 |
+
</div>
|
220 |
+
<br>
|
221 |
+
<?php }
|
222 |
+
function drawContactUsWidget() {
|
223 |
+
global $tcmp;
|
224 |
+
?>
|
225 |
+
<b><?php $tcmp->Lang->P('Sidebar.Title') ?></b>
|
226 |
+
<ul style="list-style: circle;">
|
227 |
+
<?php
|
228 |
+
$index=1;
|
229 |
+
while($tcmp->Lang->H('Sidebar'.$index.'.Name')) { ?>
|
230 |
+
<li>
|
231 |
+
<a href="<?php $tcmp->Lang->P('Sidebar'.$index.'.Url')?>" target="_blank">
|
232 |
+
<?php $tcmp->Lang->P('Sidebar'.$index.'.Name')?>
|
233 |
+
</a>
|
234 |
+
</li>
|
235 |
+
<?php $index++;
|
236 |
+
} ?>
|
237 |
+
</ul>
|
238 |
+
<?php }
|
239 |
+
function showTabs($defaultTab) {
|
240 |
+
global $tcmp;
|
241 |
+
$tab=$tcmp->Check->of('tab', $defaultTab);
|
242 |
+
if($tab==TCMP_TAB_DOCS) {
|
243 |
+
$tcmp->Utils->redirect(TCMP_TAB_DOCS_URI);
|
244 |
+
}
|
245 |
+
if($tcmp->Options->isShowWhatsNew()) {
|
246 |
+
$tab=TCMP_TAB_WHATS_NEW;
|
247 |
+
}
|
248 |
+
|
249 |
+
?>
|
250 |
+
<h2 class="nav-tab-wrapper" style="float:left; width:97%;">
|
251 |
+
<?php
|
252 |
+
foreach ($this->tabs as $k=>$v) {
|
253 |
+
$active = ($tab==$k ? 'nav-tab-active' : '');
|
254 |
+
$style='';
|
255 |
+
$target='_self';
|
256 |
+
if($tcmp->Options->isShowWhatsNew() && $k==TCMP_TAB_MANAGER) {
|
257 |
+
$active='';
|
258 |
+
$style='background-color:#F2E49B';
|
259 |
+
}
|
260 |
+
if($k==TCMP_TAB_DOCS) {
|
261 |
+
$target='_blank';
|
262 |
+
$style='background-color:#F2E49B';
|
263 |
+
}
|
264 |
+
?>
|
265 |
+
<a style="float:left; margin-left:10px; <?php echo $style?>" class="nav-tab <?php echo $active?>" target="<?php echo $target ?>" href="?page=<?php echo TCMP_PLUGIN_SLUG?>&tab=<?php echo $k?>"><?php echo $v?></a>
|
266 |
+
<?php
|
267 |
+
}
|
268 |
+
?>
|
269 |
+
<link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/font-awesome/4.2.0/css/font-awesome.min.css">
|
270 |
+
<style>
|
271 |
+
.starrr {display:inline-block}
|
272 |
+
.starrr i{font-size:16px;padding:0 1px;cursor:pointer;color:#2ea2cc;}
|
273 |
+
</style>
|
274 |
+
<div style="float:right; display:none;" id="rate-box">
|
275 |
+
<span style="font-weight:700; font-size:13px; color:#555;"><?php $tcmp->Lang->P('Rate us')?></span>
|
276 |
+
<div id="tcmp-rate" class="starrr" data-connected-input="tcmp-rate-rank"></div>
|
277 |
+
<input type="hidden" id="tcmp-rate-rank" name="tcmp-rate-rank" value="5" />
|
278 |
+
<?php $tcmp->Utils->twitter('data443risk') ?>
|
279 |
+
</div>
|
280 |
+
<script>
|
281 |
+
jQuery(function() {
|
282 |
+
jQuery(".starrr").starrr();
|
283 |
+
jQuery('#tcmp-rate').on('starrr:change', function(e, value){
|
284 |
+
var url='https://wordpress.org/support/view/plugin-reviews/tracking-code-manager?rate=5#postform';
|
285 |
+
window.open(url);
|
286 |
+
});
|
287 |
+
jQuery('#rate-box').show();
|
288 |
+
});
|
289 |
+
</script>
|
290 |
+
</h2>
|
291 |
+
<div style="clear:both;"></div>
|
292 |
+
<?php }
|
293 |
+
}
|
294 |
+
|
includes/classes/utils/Cron.php
CHANGED
@@ -1,36 +1,36 @@
|
|
1 |
-
<?php
|
2 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
3 |
-
|
4 |
-
class TCMP_Cron {
|
5 |
-
public function __construct() {
|
6 |
-
|
7 |
-
}
|
8 |
-
public function init() {
|
9 |
-
add_filter( 'cron_schedules', array( $this, 'add_schedules' ) );
|
10 |
-
add_action( 'wp', array( $this, 'schedule_Events' ) );
|
11 |
-
}
|
12 |
-
public function add_schedules( $schedules = array() ) {
|
13 |
-
global $tcmp;
|
14 |
-
// Adds once weekly to the existing schedules.
|
15 |
-
$schedules['weekly'] = array(
|
16 |
-
'interval' => 604800,
|
17 |
-
'display' => $tcmp->Lang->L('Once Weekly')
|
18 |
-
);
|
19 |
-
|
20 |
-
return $schedules;
|
21 |
-
}
|
22 |
-
public function schedule_Events() {
|
23 |
-
$this->weekly_events();
|
24 |
-
$this->daily_events();
|
25 |
-
}
|
26 |
-
private function weekly_events() {
|
27 |
-
if ( ! wp_next_scheduled( 'tcmp_weekly_scheduled_events' ) ) {
|
28 |
-
wp_schedule_event( current_time( 'timestamp' ), 'weekly', 'tcmp_weekly_scheduled_events' );
|
29 |
-
}
|
30 |
-
}
|
31 |
-
private function daily_events() {
|
32 |
-
if ( ! wp_next_scheduled( 'tcmp_daily_scheduled_events' ) ) {
|
33 |
-
wp_schedule_event( current_time( 'timestamp' ), 'daily', 'tcmp_daily_scheduled_events' );
|
34 |
-
}
|
35 |
-
}
|
36 |
-
}
|
1 |
+
<?php
|
2 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
3 |
+
|
4 |
+
class TCMP_Cron {
|
5 |
+
public function __construct() {
|
6 |
+
|
7 |
+
}
|
8 |
+
public function init() {
|
9 |
+
add_filter( 'cron_schedules', array( $this, 'add_schedules' ) );
|
10 |
+
add_action( 'wp', array( $this, 'schedule_Events' ) );
|
11 |
+
}
|
12 |
+
public function add_schedules( $schedules = array() ) {
|
13 |
+
global $tcmp;
|
14 |
+
// Adds once weekly to the existing schedules.
|
15 |
+
$schedules['weekly'] = array(
|
16 |
+
'interval' => 604800,
|
17 |
+
'display' => $tcmp->Lang->L('Once Weekly')
|
18 |
+
);
|
19 |
+
|
20 |
+
return $schedules;
|
21 |
+
}
|
22 |
+
public function schedule_Events() {
|
23 |
+
$this->weekly_events();
|
24 |
+
$this->daily_events();
|
25 |
+
}
|
26 |
+
private function weekly_events() {
|
27 |
+
if ( ! wp_next_scheduled( 'tcmp_weekly_scheduled_events' ) ) {
|
28 |
+
wp_schedule_event( current_time( 'timestamp' ), 'weekly', 'tcmp_weekly_scheduled_events' );
|
29 |
+
}
|
30 |
+
}
|
31 |
+
private function daily_events() {
|
32 |
+
if ( ! wp_next_scheduled( 'tcmp_daily_scheduled_events' ) ) {
|
33 |
+
wp_schedule_event( current_time( 'timestamp' ), 'daily', 'tcmp_daily_scheduled_events' );
|
34 |
+
}
|
35 |
+
}
|
36 |
+
}
|
includes/classes/utils/Ecommerce.php
CHANGED
@@ -1,178 +1,178 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class TCMP_Ecommerce {
|
5 |
-
var $_orderId;
|
6 |
-
|
7 |
-
function __construct() {
|
8 |
-
add_action('woocommerce_thankyou', array(&$this, 'wooCommerceThankYou'), -10);
|
9 |
-
//add_action('woocommerce_thankyou_order_id', array(&$this, 'wooCommerceThankYou'), -10);
|
10 |
-
|
11 |
-
add_action('edd_payment_receipt_after_table', array(&$this, 'eddThankYou'));
|
12 |
-
add_action('wpsc_transaction_result_cart_item', array(&$this, 'eCommerceThankYou'));
|
13 |
-
}
|
14 |
-
|
15 |
-
public function getCustomPostType($pluginId) {
|
16 |
-
$result='';
|
17 |
-
switch (intval($pluginId)) {
|
18 |
-
case TCMP_PLUGINS_WOOCOMMERCE:
|
19 |
-
$result='product';
|
20 |
-
break;
|
21 |
-
case TCMP_PLUGINS_EDD:
|
22 |
-
$result='download';
|
23 |
-
break;
|
24 |
-
case TCMP_PLUGINS_WP_ECOMMERCE:
|
25 |
-
$result='wpsc-product';
|
26 |
-
break;
|
27 |
-
}
|
28 |
-
return $result;
|
29 |
-
}
|
30 |
-
|
31 |
-
//WPSC_Purchase_Log_Customer_HTML_Notification
|
32 |
-
function eCommerceThankYou($order) {
|
33 |
-
global $tcmp;
|
34 |
-
$purchase=new TCMP_EcommercePurchase();
|
35 |
-
|
36 |
-
$orderId=intval($order['purchase_id']);
|
37 |
-
$purchase->orderId=$orderId;
|
38 |
-
$tcmp->Log->debug('Ecommerce: ECOMMERCE THANKYOU');
|
39 |
-
$tcmp->Log->debug('Ecommerce: NEW ECOMMERCE ORDERID=%s', $orderId);
|
40 |
-
|
41 |
-
$order=new WPSC_Purchase_Log($orderId);
|
42 |
-
$items=$order->get_cart_contents();
|
43 |
-
$productsIds=array();
|
44 |
-
foreach ($items as $v) {
|
45 |
-
if(isset($v->prodid)) {
|
46 |
-
$k=intval($v->prodid);
|
47 |
-
if($k) {
|
48 |
-
$v=$v->name;
|
49 |
-
$purchase->products[]=$v;
|
50 |
-
$productsIds[]=$k;
|
51 |
-
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
52 |
-
}
|
53 |
-
}
|
54 |
-
}
|
55 |
-
|
56 |
-
$args=array(
|
57 |
-
'pluginId'=>TCMP_PLUGINS_WP_ECOMMERCE
|
58 |
-
, 'productsIds'=>$productsIds
|
59 |
-
, 'categoriesIds'=>array()
|
60 |
-
, 'tagsIds'=>array()
|
61 |
-
);
|
62 |
-
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
63 |
-
return '';
|
64 |
-
}
|
65 |
-
|
66 |
-
function eddThankYou($payment, $edd_receipt_args=NULL) {
|
67 |
-
global $tcmp;
|
68 |
-
if(!class_exists('EDD_Customer')) {
|
69 |
-
return;
|
70 |
-
}
|
71 |
-
|
72 |
-
/* @var $payment WP_Post */
|
73 |
-
$purchase=new TCMP_EcommercePurchase();
|
74 |
-
$purchase->orderId=$tcmp->Utils->get($payment, 'ID');
|
75 |
-
$purchase->userId=$tcmp->Utils->get($payment, 'post_author', FALSE);
|
76 |
-
|
77 |
-
$settings=edd_get_settings();
|
78 |
-
if(isset($settings['currency'])) {
|
79 |
-
$purchase->currency=$settings['currency'];
|
80 |
-
}
|
81 |
-
|
82 |
-
$tcmp->Log->debug('Ecommerce: EDD THANKYOU');
|
83 |
-
$tcmp->Log->debug('Ecommerce: NEW EDD ORDERID=%s', $purchase->orderId);
|
84 |
-
$cart=edd_get_payment_meta_cart_details($purchase->orderId, TRUE);
|
85 |
-
$productsIds=array();
|
86 |
-
$purchase->amount=0;
|
87 |
-
$purchase->total=0;
|
88 |
-
foreach ($cart as $key=>$item) {
|
89 |
-
if(isset($item['id'])) {
|
90 |
-
$k=intval($item['id']);
|
91 |
-
if($k) {
|
92 |
-
$v=$item['name'];
|
93 |
-
$purchase->products[]=$v;
|
94 |
-
$productsIds[]=$k;
|
95 |
-
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
96 |
-
}
|
97 |
-
}
|
98 |
-
}
|
99 |
-
|
100 |
-
$args=array(
|
101 |
-
'pluginId'=>TCMP_PLUGINS_EDD
|
102 |
-
, 'productsIds'=>$productsIds
|
103 |
-
, 'categoriesIds'=>array()
|
104 |
-
, 'tagsIds'=>array()
|
105 |
-
);
|
106 |
-
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
107 |
-
}
|
108 |
-
function wooCommerceThankYou($orderId) {
|
109 |
-
global $tcmp;
|
110 |
-
if(!$orderId) {
|
111 |
-
return;
|
112 |
-
}
|
113 |
-
if($this->_orderId===$orderId) {
|
114 |
-
return;
|
115 |
-
}
|
116 |
-
|
117 |
-
$this->_orderId=$orderId;
|
118 |
-
$purchase=new TCMP_EcommercePurchase();
|
119 |
-
$purchase->orderId=$orderId;
|
120 |
-
$tcmp->Log->debug('Ecommerce: WOOCOMMERCE THANKYOU');
|
121 |
-
|
122 |
-
$order=new WC_Order($orderId);
|
123 |
-
$purchase->email=$order->get_billing_email();
|
124 |
-
$purchase->fullname=$order->get_billing_first_name();
|
125 |
-
if($order->get_billing_last_name()!='') {
|
126 |
-
$purchase->fullname.=' '.$order->get_billing_last_name();
|
127 |
-
}
|
128 |
-
|
129 |
-
$items=$order->get_items();
|
130 |
-
$tcmp->Log->debug('Ecommerce: NEW WOOCOMMERCE ORDERID=%s', $orderId);
|
131 |
-
$productsIds=array();
|
132 |
-
foreach($items as $k=>$v) {
|
133 |
-
$k=intval($v['product_id']);
|
134 |
-
if($k>0) {
|
135 |
-
$v=$v['name'];
|
136 |
-
$purchase->products[]=$v;
|
137 |
-
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
138 |
-
$productsIds[]=$k;
|
139 |
-
}
|
140 |
-
}
|
141 |
-
|
142 |
-
$args=array(
|
143 |
-
'pluginId'=>TCMP_PLUGINS_WOOCOMMERCE
|
144 |
-
, 'productsIds'=>$productsIds
|
145 |
-
, 'categoriesIds'=>array()
|
146 |
-
, 'tagsIds'=>array()
|
147 |
-
);
|
148 |
-
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
149 |
-
}
|
150 |
-
|
151 |
-
function getActivePlugins() {
|
152 |
-
return $this->getPlugins(TRUE);
|
153 |
-
}
|
154 |
-
function getPlugins($onlyActive=TRUE) {
|
155 |
-
global $tcmp;
|
156 |
-
|
157 |
-
$array=array();
|
158 |
-
$array[]=TCMP_PLUGINS_WOOCOMMERCE;
|
159 |
-
$array[]=TCMP_PLUGINS_EDD;
|
160 |
-
$array[]=TCMP_PLUGINS_WP_ECOMMERCE;
|
161 |
-
/*
|
162 |
-
$array[]=TCMP_PLUGINS_WP_SPSC;
|
163 |
-
$array[]=TCMP_PLUGINS_S2MEMBER;
|
164 |
-
$array[]=TCMP_PLUGINS_MEMBERS;
|
165 |
-
$array[]=TCMP_PLUGINS_CART66;
|
166 |
-
$array[]=TCMP_PLUGINS_ESHOP;
|
167 |
-
$array[]=TCMP_PLUGINS_JIGOSHOP;
|
168 |
-
$array[]=TCMP_PLUGINS_MARKETPRESS;
|
169 |
-
$array[]=TCMP_PLUGINS_SHOPP;
|
170 |
-
$array[]=TCMP_PLUGINS_SIMPLE_WP_ECOMMERCE;
|
171 |
-
$array[]=TCMP_PLUGINS_CF7;
|
172 |
-
$array[]=TCMP_PLUGINS_GRAVITY;
|
173 |
-
*/
|
174 |
-
|
175 |
-
$array=$tcmp->Plugin->getPlugins($array, $onlyActive);
|
176 |
-
return $array;
|
177 |
-
}
|
178 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class TCMP_Ecommerce {
|
5 |
+
var $_orderId;
|
6 |
+
|
7 |
+
function __construct() {
|
8 |
+
add_action('woocommerce_thankyou', array(&$this, 'wooCommerceThankYou'), -10);
|
9 |
+
//add_action('woocommerce_thankyou_order_id', array(&$this, 'wooCommerceThankYou'), -10);
|
10 |
+
|
11 |
+
add_action('edd_payment_receipt_after_table', array(&$this, 'eddThankYou'));
|
12 |
+
add_action('wpsc_transaction_result_cart_item', array(&$this, 'eCommerceThankYou'));
|
13 |
+
}
|
14 |
+
|
15 |
+
public function getCustomPostType($pluginId) {
|
16 |
+
$result='';
|
17 |
+
switch (intval($pluginId)) {
|
18 |
+
case TCMP_PLUGINS_WOOCOMMERCE:
|
19 |
+
$result='product';
|
20 |
+
break;
|
21 |
+
case TCMP_PLUGINS_EDD:
|
22 |
+
$result='download';
|
23 |
+
break;
|
24 |
+
case TCMP_PLUGINS_WP_ECOMMERCE:
|
25 |
+
$result='wpsc-product';
|
26 |
+
break;
|
27 |
+
}
|
28 |
+
return $result;
|
29 |
+
}
|
30 |
+
|
31 |
+
//WPSC_Purchase_Log_Customer_HTML_Notification
|
32 |
+
function eCommerceThankYou($order) {
|
33 |
+
global $tcmp;
|
34 |
+
$purchase=new TCMP_EcommercePurchase();
|
35 |
+
|
36 |
+
$orderId=intval($order['purchase_id']);
|
37 |
+
$purchase->orderId=$orderId;
|
38 |
+
$tcmp->Log->debug('Ecommerce: ECOMMERCE THANKYOU');
|
39 |
+
$tcmp->Log->debug('Ecommerce: NEW ECOMMERCE ORDERID=%s', $orderId);
|
40 |
+
|
41 |
+
$order=new WPSC_Purchase_Log($orderId);
|
42 |
+
$items=$order->get_cart_contents();
|
43 |
+
$productsIds=array();
|
44 |
+
foreach ($items as $v) {
|
45 |
+
if(isset($v->prodid)) {
|
46 |
+
$k=intval($v->prodid);
|
47 |
+
if($k) {
|
48 |
+
$v=$v->name;
|
49 |
+
$purchase->products[]=$v;
|
50 |
+
$productsIds[]=$k;
|
51 |
+
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
52 |
+
}
|
53 |
+
}
|
54 |
+
}
|
55 |
+
|
56 |
+
$args=array(
|
57 |
+
'pluginId'=>TCMP_PLUGINS_WP_ECOMMERCE
|
58 |
+
, 'productsIds'=>$productsIds
|
59 |
+
, 'categoriesIds'=>array()
|
60 |
+
, 'tagsIds'=>array()
|
61 |
+
);
|
62 |
+
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
63 |
+
return '';
|
64 |
+
}
|
65 |
+
|
66 |
+
function eddThankYou($payment, $edd_receipt_args=NULL) {
|
67 |
+
global $tcmp;
|
68 |
+
if(!class_exists('EDD_Customer')) {
|
69 |
+
return;
|
70 |
+
}
|
71 |
+
|
72 |
+
/* @var $payment WP_Post */
|
73 |
+
$purchase=new TCMP_EcommercePurchase();
|
74 |
+
$purchase->orderId=$tcmp->Utils->get($payment, 'ID');
|
75 |
+
$purchase->userId=$tcmp->Utils->get($payment, 'post_author', FALSE);
|
76 |
+
|
77 |
+
$settings=edd_get_settings();
|
78 |
+
if(isset($settings['currency'])) {
|
79 |
+
$purchase->currency=$settings['currency'];
|
80 |
+
}
|
81 |
+
|
82 |
+
$tcmp->Log->debug('Ecommerce: EDD THANKYOU');
|
83 |
+
$tcmp->Log->debug('Ecommerce: NEW EDD ORDERID=%s', $purchase->orderId);
|
84 |
+
$cart=edd_get_payment_meta_cart_details($purchase->orderId, TRUE);
|
85 |
+
$productsIds=array();
|
86 |
+
$purchase->amount=0;
|
87 |
+
$purchase->total=0;
|
88 |
+
foreach ($cart as $key=>$item) {
|
89 |
+
if(isset($item['id'])) {
|
90 |
+
$k=intval($item['id']);
|
91 |
+
if($k) {
|
92 |
+
$v=$item['name'];
|
93 |
+
$purchase->products[]=$v;
|
94 |
+
$productsIds[]=$k;
|
95 |
+
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
96 |
+
}
|
97 |
+
}
|
98 |
+
}
|
99 |
+
|
100 |
+
$args=array(
|
101 |
+
'pluginId'=>TCMP_PLUGINS_EDD
|
102 |
+
, 'productsIds'=>$productsIds
|
103 |
+
, 'categoriesIds'=>array()
|
104 |
+
, 'tagsIds'=>array()
|
105 |
+
);
|
106 |
+
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
107 |
+
}
|
108 |
+
function wooCommerceThankYou($orderId) {
|
109 |
+
global $tcmp;
|
110 |
+
if(!$orderId) {
|
111 |
+
return;
|
112 |
+
}
|
113 |
+
if($this->_orderId===$orderId) {
|
114 |
+
return;
|
115 |
+
}
|
116 |
+
|
117 |
+
$this->_orderId=$orderId;
|
118 |
+
$purchase=new TCMP_EcommercePurchase();
|
119 |
+
$purchase->orderId=$orderId;
|
120 |
+
$tcmp->Log->debug('Ecommerce: WOOCOMMERCE THANKYOU');
|
121 |
+
|
122 |
+
$order=new WC_Order($orderId);
|
123 |
+
$purchase->email=$order->get_billing_email();
|
124 |
+
$purchase->fullname=$order->get_billing_first_name();
|
125 |
+
if($order->get_billing_last_name()!='') {
|
126 |
+
$purchase->fullname.=' '.$order->get_billing_last_name();
|
127 |
+
}
|
128 |
+
|
129 |
+
$items=$order->get_items();
|
130 |
+
$tcmp->Log->debug('Ecommerce: NEW WOOCOMMERCE ORDERID=%s', $orderId);
|
131 |
+
$productsIds=array();
|
132 |
+
foreach($items as $k=>$v) {
|
133 |
+
$k=intval($v['product_id']);
|
134 |
+
if($k>0) {
|
135 |
+
$v=$v['name'];
|
136 |
+
$purchase->products[]=$v;
|
137 |
+
$tcmp->Log->debug('Ecommerce: ITEM %s=%s IN CART', $k, $v);
|
138 |
+
$productsIds[]=$k;
|
139 |
+
}
|
140 |
+
}
|
141 |
+
|
142 |
+
$args=array(
|
143 |
+
'pluginId'=>TCMP_PLUGINS_WOOCOMMERCE
|
144 |
+
, 'productsIds'=>$productsIds
|
145 |
+
, 'categoriesIds'=>array()
|
146 |
+
, 'tagsIds'=>array()
|
147 |
+
);
|
148 |
+
$tcmp->Options->pushConversionSnippets($args, $purchase);
|
149 |
+
}
|
150 |
+
|
151 |
+
function getActivePlugins() {
|
152 |
+
return $this->getPlugins(TRUE);
|
153 |
+
}
|
154 |
+
function getPlugins($onlyActive=TRUE) {
|
155 |
+
global $tcmp;
|
156 |
+
|
157 |
+
$array=array();
|
158 |
+
$array[]=TCMP_PLUGINS_WOOCOMMERCE;
|
159 |
+
$array[]=TCMP_PLUGINS_EDD;
|
160 |
+
$array[]=TCMP_PLUGINS_WP_ECOMMERCE;
|
161 |
+
/*
|
162 |
+
$array[]=TCMP_PLUGINS_WP_SPSC;
|
163 |
+
$array[]=TCMP_PLUGINS_S2MEMBER;
|
164 |
+
$array[]=TCMP_PLUGINS_MEMBERS;
|
165 |
+
$array[]=TCMP_PLUGINS_CART66;
|
166 |
+
$array[]=TCMP_PLUGINS_ESHOP;
|
167 |
+
$array[]=TCMP_PLUGINS_JIGOSHOP;
|
168 |
+
$array[]=TCMP_PLUGINS_MARKETPRESS;
|
169 |
+
$array[]=TCMP_PLUGINS_SHOPP;
|
170 |
+
$array[]=TCMP_PLUGINS_SIMPLE_WP_ECOMMERCE;
|
171 |
+
$array[]=TCMP_PLUGINS_CF7;
|
172 |
+
$array[]=TCMP_PLUGINS_GRAVITY;
|
173 |
+
*/
|
174 |
+
|
175 |
+
$array=$tcmp->Plugin->getPlugins($array, $onlyActive);
|
176 |
+
return $array;
|
177 |
+
}
|
178 |
+
}
|
includes/classes/utils/Language.php
CHANGED
@@ -1,112 +1,112 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class TCMP_Language {
|
5 |
-
var $domain;
|
6 |
-
var $bundle;
|
7 |
-
|
8 |
-
function __construct() {
|
9 |
-
$this->bundle=new TCMP_Properties();
|
10 |
-
}
|
11 |
-
function load($domain, $file) {
|
12 |
-
$this->domain=$domain;
|
13 |
-
$this->bundle->load($file);
|
14 |
-
}
|
15 |
-
//echo the $ec->Lang->L result
|
16 |
-
function P($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
17 |
-
$what=$this->L($key, $v1, $v2, $v3, $v4, $v5);
|
18 |
-
echo $what;
|
19 |
-
}
|
20 |
-
//verify if the key is defined or not
|
21 |
-
function H($key) {
|
22 |
-
if($this->bundle==NULL || !$this->bundle->hasKeys()) {
|
23 |
-
return FALSE;
|
24 |
-
}
|
25 |
-
|
26 |
-
$result=FALSE;
|
27 |
-
if($this->bundle->existsKey($key)) {
|
28 |
-
$result=TRUE;
|
29 |
-
} elseif($this->bundle->existsKey($key.'1')) {
|
30 |
-
$result=TRUE;
|
31 |
-
} else {
|
32 |
-
//special way to call this function passing arguments
|
33 |
-
//WTF_something means key=WTF and something as first argument
|
34 |
-
$s=strpos($result, '_');
|
35 |
-
if ($s!==FALSE) {
|
36 |
-
$text=substr($result, 0, $s);
|
37 |
-
$value=substr($result, $s + 1);
|
38 |
-
$e=strrpos($value, '_');
|
39 |
-
if ($e!==FALSE) {
|
40 |
-
$text.=substr($value, $e + 1);
|
41 |
-
$value=substr($value, 0, $e);
|
42 |
-
}
|
43 |
-
if ($this->bundle->existsKey($text)) {
|
44 |
-
$result=TRUE;
|
45 |
-
}
|
46 |
-
}
|
47 |
-
}
|
48 |
-
return $result;
|
49 |
-
}
|
50 |
-
//read the key from a text file with its translation. Try to translate using __(
|
51 |
-
function L($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
52 |
-
global $tcmp;
|
53 |
-
$result=$key;
|
54 |
-
$args=array($v1, $v2, $v3, $v4, $v5);
|
55 |
-
|
56 |
-
if($this->bundle==NULL || !$this->bundle->hasKeys()) {
|
57 |
-
$result=__($result, $this->domain);
|
58 |
-
} else {
|
59 |
-
//i use the file to store the translations without writing it inside the code
|
60 |
-
if ($this->bundle->existsKey($key)) {
|
61 |
-
$result=$this->bundle->getString($key);
|
62 |
-
$result=__($result, $this->domain);
|
63 |
-
} elseif ($this->bundle->existsKey($key.'1')) {
|
64 |
-
$result='';
|
65 |
-
$n=1;
|
66 |
-
while ($this->bundle->existsKey($key.$n)) {
|
67 |
-
if ($result != '') {
|
68 |
-
$result .= '<br/>';
|
69 |
-
}
|
70 |
-
$result .= __($this->bundle->getString($key . $n), $this->domain);
|
71 |
-
++$n;
|
72 |
-
}
|
73 |
-
} else {
|
74 |
-
//special way to call this function passing arguments
|
75 |
-
//WTF_something means key=WTF and something as first argument
|
76 |
-
$s=strpos($result, '_');
|
77 |
-
if ($s!==FALSE) {
|
78 |
-
$text=substr($result, 0, $s);
|
79 |
-
$value=substr($result, $s + 1);
|
80 |
-
$e=strrpos($value, '_');
|
81 |
-
if ($e!==FALSE) {
|
82 |
-
$text .= substr($value, $e + 1);
|
83 |
-
$value=substr($value, 0, $e);
|
84 |
-
}
|
85 |
-
if ($this->bundle->existsKey($text)) {
|
86 |
-
$result=$this->bundle->getString($text);
|
87 |
-
$args=array($value);
|
88 |
-
}
|
89 |
-
}
|
90 |
-
$result=__($result, $this->domain);
|
91 |
-
}
|
92 |
-
}
|
93 |
-
if($result==$key) {
|
94 |
-
$this->bundle->pushString($key, '');
|
95 |
-
}
|
96 |
-
//here i translate it using WP
|
97 |
-
foreach($args as $k=>$v) {
|
98 |
-
$k='{'.$k.'}';
|
99 |
-
while(strpos($result, $k)!==FALSE) {
|
100 |
-
$result=str_replace($k, $v, $result);
|
101 |
-
}
|
102 |
-
}
|
103 |
-
foreach($args as $k=>$v) {
|
104 |
-
$k='{dt:'.$k.'}';
|
105 |
-
$v=$tcmp->Utils->formatSmartDatetime($v);
|
106 |
-
while(strpos($result, $k)!==FALSE) {
|
107 |
-
$result=str_replace($k, $v, $result);
|
108 |
-
}
|
109 |
-
}
|
110 |
-
return $result;
|
111 |
-
}
|
112 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class TCMP_Language {
|
5 |
+
var $domain;
|
6 |
+
var $bundle;
|
7 |
+
|
8 |
+
function __construct() {
|
9 |
+
$this->bundle=new TCMP_Properties();
|
10 |
+
}
|
11 |
+
function load($domain, $file) {
|
12 |
+
$this->domain=$domain;
|
13 |
+
$this->bundle->load($file);
|
14 |
+
}
|
15 |
+
//echo the $ec->Lang->L result
|
16 |
+
function P($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
17 |
+
$what=$this->L($key, $v1, $v2, $v3, $v4, $v5);
|
18 |
+
echo $what;
|
19 |
+
}
|
20 |
+
//verify if the key is defined or not
|
21 |
+
function H($key) {
|
22 |
+
if($this->bundle==NULL || !$this->bundle->hasKeys()) {
|
23 |
+
return FALSE;
|
24 |
+
}
|
25 |
+
|
26 |
+
$result=FALSE;
|
27 |
+
if($this->bundle->existsKey($key)) {
|
28 |
+
$result=TRUE;
|
29 |
+
} elseif($this->bundle->existsKey($key.'1')) {
|
30 |
+
$result=TRUE;
|
31 |
+
} else {
|
32 |
+
//special way to call this function passing arguments
|
33 |
+
//WTF_something means key=WTF and something as first argument
|
34 |
+
$s=strpos($result, '_');
|
35 |
+
if ($s!==FALSE) {
|
36 |
+
$text=substr($result, 0, $s);
|
37 |
+
$value=substr($result, $s + 1);
|
38 |
+
$e=strrpos($value, '_');
|
39 |
+
if ($e!==FALSE) {
|
40 |
+
$text.=substr($value, $e + 1);
|
41 |
+
$value=substr($value, 0, $e);
|
42 |
+
}
|
43 |
+
if ($this->bundle->existsKey($text)) {
|
44 |
+
$result=TRUE;
|
45 |
+
}
|
46 |
+
}
|
47 |
+
}
|
48 |
+
return $result;
|
49 |
+
}
|
50 |
+
//read the key from a text file with its translation. Try to translate using __(
|
51 |
+
function L($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
52 |
+
global $tcmp;
|
53 |
+
$result=$key;
|
54 |
+
$args=array($v1, $v2, $v3, $v4, $v5);
|
55 |
+
|
56 |
+
if($this->bundle==NULL || !$this->bundle->hasKeys()) {
|
57 |
+
$result=__($result, $this->domain);
|
58 |
+
} else {
|
59 |
+
//i use the file to store the translations without writing it inside the code
|
60 |
+
if ($this->bundle->existsKey($key)) {
|
61 |
+
$result=$this->bundle->getString($key);
|
62 |
+
$result=__($result, $this->domain);
|
63 |
+
} elseif ($this->bundle->existsKey($key.'1')) {
|
64 |
+
$result='';
|
65 |
+
$n=1;
|
66 |
+
while ($this->bundle->existsKey($key.$n)) {
|
67 |
+
if ($result != '') {
|
68 |
+
$result .= '<br/>';
|
69 |
+
}
|
70 |
+
$result .= __($this->bundle->getString($key . $n), $this->domain);
|
71 |
+
++$n;
|
72 |
+
}
|
73 |
+
} else {
|
74 |
+
//special way to call this function passing arguments
|
75 |
+
//WTF_something means key=WTF and something as first argument
|
76 |
+
$s=strpos($result, '_');
|
77 |
+
if ($s!==FALSE) {
|
78 |
+
$text=substr($result, 0, $s);
|
79 |
+
$value=substr($result, $s + 1);
|
80 |
+
$e=strrpos($value, '_');
|
81 |
+
if ($e!==FALSE) {
|
82 |
+
$text .= substr($value, $e + 1);
|
83 |
+
$value=substr($value, 0, $e);
|
84 |
+
}
|
85 |
+
if ($this->bundle->existsKey($text)) {
|
86 |
+
$result=$this->bundle->getString($text);
|
87 |
+
$args=array($value);
|
88 |
+
}
|
89 |
+
}
|
90 |
+
$result=__($result, $this->domain);
|
91 |
+
}
|
92 |
+
}
|
93 |
+
if($result==$key) {
|
94 |
+
$this->bundle->pushString($key, '');
|
95 |
+
}
|
96 |
+
//here i translate it using WP
|
97 |
+
foreach($args as $k=>$v) {
|
98 |
+
$k='{'.$k.'}';
|
99 |
+
while(strpos($result, $k)!==FALSE) {
|
100 |
+
$result=str_replace($k, $v, $result);
|
101 |
+
}
|
102 |
+
}
|
103 |
+
foreach($args as $k=>$v) {
|
104 |
+
$k='{dt:'.$k.'}';
|
105 |
+
$v=$tcmp->Utils->formatSmartDatetime($v);
|
106 |
+
while(strpos($result, $k)!==FALSE) {
|
107 |
+
$result=str_replace($k, $v, $result);
|
108 |
+
}
|
109 |
+
}
|
110 |
+
return $result;
|
111 |
+
}
|
112 |
+
}
|
includes/classes/utils/Logger.php
CHANGED
@@ -1,83 +1,83 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
// Exit if accessed directly
|
4 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
-
|
6 |
-
class TCMP_Logger {
|
7 |
-
private $name;
|
8 |
-
private $context=array();
|
9 |
-
|
10 |
-
public function __construct($name='TCMP') {
|
11 |
-
if($name=='') $name='TCMP';
|
12 |
-
$this->name=$name;
|
13 |
-
}
|
14 |
-
|
15 |
-
public function pushContext($context) {
|
16 |
-
array_push($this->context, $context);
|
17 |
-
}
|
18 |
-
public function popContext() {
|
19 |
-
array_pop($this->context);
|
20 |
-
}
|
21 |
-
|
22 |
-
public function fatal($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
23 |
-
$what=$this->write('[FATAL]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
24 |
-
die($what);
|
25 |
-
}
|
26 |
-
public function debug($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
27 |
-
$this->write('[DEBUG]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
28 |
-
}
|
29 |
-
public function info($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
30 |
-
$this->write('[INFO] ', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
31 |
-
}
|
32 |
-
public function error($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
33 |
-
$this->write('[ERROR]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
34 |
-
}
|
35 |
-
private function dump($v) {
|
36 |
-
if(is_array($v) && count($v)==0) {
|
37 |
-
$v='[]';
|
38 |
-
}
|
39 |
-
if($v!=NULL) {
|
40 |
-
if(is_array($v) || is_object($v)) {
|
41 |
-
$v=print_r($v, TRUE);
|
42 |
-
}
|
43 |
-
}
|
44 |
-
if(is_bool($v)) {
|
45 |
-
$v=($v ? 'TRUE' : 'FALSE');
|
46 |
-
}
|
47 |
-
return $v;
|
48 |
-
}
|
49 |
-
private function write($verbosity, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
50 |
-
global $tcmp;
|
51 |
-
|
52 |
-
$text=sprintf($message
|
53 |
-
, $this->dump($v1)
|
54 |
-
, $this->dump($v2)
|
55 |
-
, $this->dump($v3)
|
56 |
-
, $this->dump($v4)
|
57 |
-
, $this->dump($v5)
|
58 |
-
, $this->dump($v6));
|
59 |
-
$message=date("d/m/Y H:i:s")." ".$verbosity." ";
|
60 |
-
if(count($this->context)>0) {
|
61 |
-
$message.='{'.$this->context[count($this->context)-1].'} ';
|
62 |
-
}
|
63 |
-
$message="\n".$message.$text;
|
64 |
-
if(!$tcmp->Options->isLoggerEnable()) {
|
65 |
-
return $message;
|
66 |
-
}
|
67 |
-
|
68 |
-
$hasErrors=false;
|
69 |
-
$filename=TCMP_PLUGIN_DIR."logs/".$this->name."_".date("Ym").".txt";
|
70 |
-
if (!$handle = fopen($filename, 'a')) {
|
71 |
-
$hasErrors=true;
|
72 |
-
}
|
73 |
-
|
74 |
-
if(!$hasErrors && fwrite($handle, $message)===FALSE) {
|
75 |
-
$hasErrors=true;
|
76 |
-
}
|
77 |
-
|
78 |
-
if(!$hasErrors) {
|
79 |
-
fclose($handle);
|
80 |
-
}
|
81 |
-
return $message;
|
82 |
-
}
|
83 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
// Exit if accessed directly
|
4 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
+
|
6 |
+
class TCMP_Logger {
|
7 |
+
private $name;
|
8 |
+
private $context=array();
|
9 |
+
|
10 |
+
public function __construct($name='TCMP') {
|
11 |
+
if($name=='') $name='TCMP';
|
12 |
+
$this->name=$name;
|
13 |
+
}
|
14 |
+
|
15 |
+
public function pushContext($context) {
|
16 |
+
array_push($this->context, $context);
|
17 |
+
}
|
18 |
+
public function popContext() {
|
19 |
+
array_pop($this->context);
|
20 |
+
}
|
21 |
+
|
22 |
+
public function fatal($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
23 |
+
$what=$this->write('[FATAL]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
24 |
+
die($what);
|
25 |
+
}
|
26 |
+
public function debug($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
27 |
+
$this->write('[DEBUG]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
28 |
+
}
|
29 |
+
public function info($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
30 |
+
$this->write('[INFO] ', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
31 |
+
}
|
32 |
+
public function error($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
33 |
+
$this->write('[ERROR]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
34 |
+
}
|
35 |
+
private function dump($v) {
|
36 |
+
if(is_array($v) && count($v)==0) {
|
37 |
+
$v='[]';
|
38 |
+
}
|
39 |
+
if($v!=NULL) {
|
40 |
+
if(is_array($v) || is_object($v)) {
|
41 |
+
$v=print_r($v, TRUE);
|
42 |
+
}
|
43 |
+
}
|
44 |
+
if(is_bool($v)) {
|
45 |
+
$v=($v ? 'TRUE' : 'FALSE');
|
46 |
+
}
|
47 |
+
return $v;
|
48 |
+
}
|
49 |
+
private function write($verbosity, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
50 |
+
global $tcmp;
|
51 |
+
|
52 |
+
$text=sprintf($message
|
53 |
+
, $this->dump($v1)
|
54 |
+
, $this->dump($v2)
|
55 |
+
, $this->dump($v3)
|
56 |
+
, $this->dump($v4)
|
57 |
+
, $this->dump($v5)
|
58 |
+
, $this->dump($v6));
|
59 |
+
$message=date("d/m/Y H:i:s")." ".$verbosity." ";
|
60 |
+
if(count($this->context)>0) {
|
61 |
+
$message.='{'.$this->context[count($this->context)-1].'} ';
|
62 |
+
}
|
63 |
+
$message="\n".$message.$text;
|
64 |
+
if(!$tcmp->Options->isLoggerEnable()) {
|
65 |
+
return $message;
|
66 |
+
}
|
67 |
+
|
68 |
+
$hasErrors=false;
|
69 |
+
$filename=TCMP_PLUGIN_DIR."logs/".$this->name."_".date("Ym").".txt";
|
70 |
+
if (!$handle = fopen($filename, 'a')) {
|
71 |
+
$hasErrors=true;
|
72 |
+
}
|
73 |
+
|
74 |
+
if(!$hasErrors && fwrite($handle, $message)===FALSE) {
|
75 |
+
$hasErrors=true;
|
76 |
+
}
|
77 |
+
|
78 |
+
if(!$hasErrors) {
|
79 |
+
fclose($handle);
|
80 |
+
}
|
81 |
+
return $message;
|
82 |
+
}
|
83 |
}
|
includes/classes/utils/MobileDetect.php
CHANGED
@@ -1,1435 +1,1435 @@
|
|
1 |
-
<?php
|
2 |
-
/**
|
3 |
-
* Mobile Detect Library
|
4 |
-
* =====================
|
5 |
-
*
|
6 |
-
* Motto: "Every business should have a mobile detection script to detect mobile readers"
|
7 |
-
*
|
8 |
-
* Mobile_Detect is a lightweight PHP class for detecting mobile devices (including tablets).
|
9 |
-
* It uses the User-Agent string combined with specific HTTP headers to detect the mobile environment.
|
10 |
-
*
|
11 |
-
* @author Current authors: Serban Ghita <serbanghita@gmail.com>
|
12 |
-
* Nick Ilyin <nick.ilyin@gmail.com>
|
13 |
-
*
|
14 |
-
* Original author: Victor Stanciu <vic.stanciu@gmail.com>
|
15 |
-
*
|
16 |
-
* @license Code and contributions have 'MIT License'
|
17 |
-
* More details: https://github.com/serbanghita/Mobile-Detect/blob/master/LICENSE.txt
|
18 |
-
*
|
19 |
-
* @link Homepage: http://mobiledetect.net
|
20 |
-
* GitHub Repo: https://github.com/serbanghita/Mobile-Detect
|
21 |
-
* Google Code: http://code.google.com/p/php-mobile-detect/
|
22 |
-
* README: https://github.com/serbanghita/Mobile-Detect/blob/master/README.md
|
23 |
-
* HOWTO: https://github.com/serbanghita/Mobile-Detect/wiki/Code-examples
|
24 |
-
*
|
25 |
-
* @version 2.8.19
|
26 |
-
*/
|
27 |
-
|
28 |
-
class TCMP_Mobile_Detect {
|
29 |
-
/**
|
30 |
-
* Mobile detection type.
|
31 |
-
*
|
32 |
-
* @deprecated since version 2.6.9
|
33 |
-
*/
|
34 |
-
const DETECTION_TYPE_MOBILE = 'mobile';
|
35 |
-
|
36 |
-
/**
|
37 |
-
* Extended detection type.
|
38 |
-
*
|
39 |
-
* @deprecated since version 2.6.9
|
40 |
-
*/
|
41 |
-
const DETECTION_TYPE_EXTENDED = 'extended';
|
42 |
-
|
43 |
-
/**
|
44 |
-
* A frequently used regular expression to extract version #s.
|
45 |
-
*
|
46 |
-
* @deprecated since version 2.6.9
|
47 |
-
*/
|
48 |
-
const VER = '([\w._\+]+)';
|
49 |
-
|
50 |
-
/**
|
51 |
-
* Top-level device.
|
52 |
-
*/
|
53 |
-
const MOBILE_GRADE_A = 'A';
|
54 |
-
|
55 |
-
/**
|
56 |
-
* Mid-level device.
|
57 |
-
*/
|
58 |
-
const MOBILE_GRADE_B = 'B';
|
59 |
-
|
60 |
-
/**
|
61 |
-
* Low-level device.
|
62 |
-
*/
|
63 |
-
const MOBILE_GRADE_C = 'C';
|
64 |
-
|
65 |
-
/**
|
66 |
-
* Stores the version number of the current release.
|
67 |
-
*/
|
68 |
-
const VERSION = '2.8.19';
|
69 |
-
|
70 |
-
/**
|
71 |
-
* A type for the version() method indicating a string return value.
|
72 |
-
*/
|
73 |
-
const VERSION_TYPE_STRING = 'text';
|
74 |
-
|
75 |
-
/**
|
76 |
-
* A type for the version() method indicating a float return value.
|
77 |
-
*/
|
78 |
-
const VERSION_TYPE_FLOAT = 'float';
|
79 |
-
|
80 |
-
/**
|
81 |
-
* A cache for resolved matches
|
82 |
-
* @var array
|
83 |
-
*/
|
84 |
-
protected $cache = array();
|
85 |
-
|
86 |
-
/**
|
87 |
-
* The User-Agent HTTP header is stored in here.
|
88 |
-
* @var string
|
89 |
-
*/
|
90 |
-
protected $userAgent = null;
|
91 |
-
|
92 |
-
/**
|
93 |
-
* HTTP headers in the PHP-flavor. So HTTP_USER_AGENT and SERVER_SOFTWARE.
|
94 |
-
* @var array
|
95 |
-
*/
|
96 |
-
protected $httpHeaders = array();
|
97 |
-
|
98 |
-
/**
|
99 |
-
* CloudFront headers. E.g. CloudFront-Is-Desktop-Viewer, CloudFront-Is-Mobile-Viewer & CloudFront-Is-Tablet-Viewer.
|
100 |
-
* @var array
|
101 |
-
*/
|
102 |
-
protected $cloudfrontHeaders = array();
|
103 |
-
|
104 |
-
/**
|
105 |
-
* The matching Regex.
|
106 |
-
* This is good for debug.
|
107 |
-
* @var string
|
108 |
-
*/
|
109 |
-
protected $matchingRegex = null;
|
110 |
-
|
111 |
-
/**
|
112 |
-
* The matches extracted from the regex expression.
|
113 |
-
* This is good for debug.
|
114 |
-
* @var string
|
115 |
-
*/
|
116 |
-
protected $matchesArray = null;
|
117 |
-
|
118 |
-
/**
|
119 |
-
* The detection type, using self::DETECTION_TYPE_MOBILE or self::DETECTION_TYPE_EXTENDED.
|
120 |
-
*
|
121 |
-
* @deprecated since version 2.6.9
|
122 |
-
*
|
123 |
-
* @var string
|
124 |
-
*/
|
125 |
-
protected $detectionType = self::DETECTION_TYPE_MOBILE;
|
126 |
-
|
127 |
-
/**
|
128 |
-
* HTTP headers that trigger the 'isMobile' detection
|
129 |
-
* to be true.
|
130 |
-
*
|
131 |
-
* @var array
|
132 |
-
*/
|
133 |
-
protected static $mobileHeaders = array(
|
134 |
-
|
135 |
-
'HTTP_ACCEPT' => array('matches' => array(
|
136 |
-
// Opera Mini; @reference: http://dev.opera.com/articles/view/opera-binary-markup-language/
|
137 |
-
'application/x-obml2d',
|
138 |
-
// BlackBerry devices.
|
139 |
-
'application/vnd.rim.html',
|
140 |
-
'text/vnd.wap.wml',
|
141 |
-
'application/vnd.wap.xhtml+xml'
|
142 |
-
)),
|
143 |
-
'HTTP_X_WAP_PROFILE' => null,
|
144 |
-
'HTTP_X_WAP_CLIENTID' => null,
|
145 |
-
'HTTP_WAP_CONNECTION' => null,
|
146 |
-
'HTTP_PROFILE' => null,
|
147 |
-
// Reported by Opera on Nokia devices (eg. C3).
|
148 |
-
'HTTP_X_OPERAMINI_PHONE_UA' => null,
|
149 |
-
'HTTP_X_NOKIA_GATEWAY_ID' => null,
|
150 |
-
'HTTP_X_ORANGE_ID' => null,
|
151 |
-
'HTTP_X_VODAFONE_3GPDPCONTEXT' => null,
|
152 |
-
'HTTP_X_HUAWEI_USERID' => null,
|
153 |
-
// Reported by Windows Smartphones.
|
154 |
-
'HTTP_UA_OS' => null,
|
155 |
-
// Reported by Verizon, Vodafone proxy system.
|
156 |
-
'HTTP_X_MOBILE_GATEWAY' => null,
|
157 |
-
// Seen this on HTC Sensation. SensationXE_Beats_Z715e.
|
158 |
-
'HTTP_X_ATT_DEVICEID' => null,
|
159 |
-
// Seen this on a HTC.
|
160 |
-
'HTTP_UA_CPU' => array('matches' => array('ARM')),
|
161 |
-
);
|
162 |
-
|
163 |
-
/**
|
164 |
-
* List of mobile devices (phones).
|
165 |
-
*
|
166 |
-
* @var array
|
167 |
-
*/
|
168 |
-
protected static $phoneDevices = array(
|
169 |
-
'iPhone' => '\biPhone\b|\biPod\b', // |\biTunes
|
170 |
-
'BlackBerry' => 'BlackBerry|\bBB10\b|rim[0-9]+',
|
171 |
-
'HTC' => 'HTC|HTC.*(Sensation|Evo|Vision|Explorer|6800|8100|8900|A7272|S510e|C110e|Legend|Desire|T8282)|APX515CKT|Qtek9090|APA9292KT|HD_mini|Sensation.*Z710e|PG86100|Z715e|Desire.*(A8181|HD)|ADR6200|ADR6400L|ADR6425|001HT|Inspire 4G|Android.*\bEVO\b|T-Mobile G1|Z520m',
|
172 |
-
'Nexus' => 'Nexus One|Nexus S|Galaxy.*Nexus|Android.*Nexus.*Mobile|Nexus 4|Nexus 5|Nexus 6',
|
173 |
-
// @todo: Is 'Dell Streak' a tablet or a phone? ;)
|
174 |
-
'Dell' => 'Dell.*Streak|Dell.*Aero|Dell.*Venue|DELL.*Venue Pro|Dell Flash|Dell Smoke|Dell Mini 3iX|XCD28|XCD35|\b001DL\b|\b101DL\b|\bGS01\b',
|
175 |
-
'Motorola' => 'Motorola|DROIDX|DROID BIONIC|\bDroid\b.*Build|Android.*Xoom|HRI39|MOT-|A1260|A1680|A555|A853|A855|A953|A955|A956|Motorola.*ELECTRIFY|Motorola.*i1|i867|i940|MB200|MB300|MB501|MB502|MB508|MB511|MB520|MB525|MB526|MB611|MB612|MB632|MB810|MB855|MB860|MB861|MB865|MB870|ME501|ME502|ME511|ME525|ME600|ME632|ME722|ME811|ME860|ME863|ME865|MT620|MT710|MT716|MT720|MT810|MT870|MT917|Motorola.*TITANIUM|WX435|WX445|XT300|XT301|XT311|XT316|XT317|XT319|XT320|XT390|XT502|XT530|XT531|XT532|XT535|XT603|XT610|XT611|XT615|XT681|XT701|XT702|XT711|XT720|XT800|XT806|XT860|XT862|XT875|XT882|XT883|XT894|XT901|XT907|XT909|XT910|XT912|XT928|XT926|XT915|XT919|XT925|XT1021|\bMoto E\b',
|
176 |
-
'Samsung' => 'Samsung|SM-G9250|GT-19300|SGH-I337|BGT-S5230|GT-B2100|GT-B2700|GT-B2710|GT-B3210|GT-B3310|GT-B3410|GT-B3730|GT-B3740|GT-B5510|GT-B5512|GT-B5722|GT-B6520|GT-B7300|GT-B7320|GT-B7330|GT-B7350|GT-B7510|GT-B7722|GT-B7800|GT-C3010|GT-C3011|GT-C3060|GT-C3200|GT-C3212|GT-C3212I|GT-C3262|GT-C3222|GT-C3300|GT-C3300K|GT-C3303|GT-C3303K|GT-C3310|GT-C3322|GT-C3330|GT-C3350|GT-C3500|GT-C3510|GT-C3530|GT-C3630|GT-C3780|GT-C5010|GT-C5212|GT-C6620|GT-C6625|GT-C6712|GT-E1050|GT-E1070|GT-E1075|GT-E1080|GT-E1081|GT-E1085|GT-E1087|GT-E1100|GT-E1107|GT-E1110|GT-E1120|GT-E1125|GT-E1130|GT-E1160|GT-E1170|GT-E1175|GT-E1180|GT-E1182|GT-E1200|GT-E1210|GT-E1225|GT-E1230|GT-E1390|GT-E2100|GT-E2120|GT-E2121|GT-E2152|GT-E2220|GT-E2222|GT-E2230|GT-E2232|GT-E2250|GT-E2370|GT-E2550|GT-E2652|GT-E3210|GT-E3213|GT-I5500|GT-I5503|GT-I5700|GT-I5800|GT-I5801|GT-I6410|GT-I6420|GT-I7110|GT-I7410|GT-I7500|GT-I8000|GT-I8150|GT-I8160|GT-I8190|GT-I8320|GT-I8330|GT-I8350|GT-I8530|GT-I8700|GT-I8703|GT-I8910|GT-I9000|GT-I9001|GT-I9003|GT-I9010|GT-I9020|GT-I9023|GT-I9070|GT-I9082|GT-I9100|GT-I9103|GT-I9220|GT-I9250|GT-I9300|GT-I9305|GT-I9500|GT-I9505|GT-M3510|GT-M5650|GT-M7500|GT-M7600|GT-M7603|GT-M8800|GT-M8910|GT-N7000|GT-S3110|GT-S3310|GT-S3350|GT-S3353|GT-S3370|GT-S3650|GT-S3653|GT-S3770|GT-S3850|GT-S5210|GT-S5220|GT-S5229|GT-S5230|GT-S5233|GT-S5250|GT-S5253|GT-S5260|GT-S5263|GT-S5270|GT-S5300|GT-S5330|GT-S5350|GT-S5360|GT-S5363|GT-S5369|GT-S5380|GT-S5380D|GT-S5560|GT-S5570|GT-S5600|GT-S5603|GT-S5610|GT-S5620|GT-S5660|GT-S5670|GT-S5690|GT-S5750|GT-S5780|GT-S5830|GT-S5839|GT-S6102|GT-S6500|GT-S7070|GT-S7200|GT-S7220|GT-S7230|GT-S7233|GT-S7250|GT-S7500|GT-S7530|GT-S7550|GT-S7562|GT-S7710|GT-S8000|GT-S8003|GT-S8500|GT-S8530|GT-S8600|SCH-A310|SCH-A530|SCH-A570|SCH-A610|SCH-A630|SCH-A650|SCH-A790|SCH-A795|SCH-A850|SCH-A870|SCH-A890|SCH-A930|SCH-A950|SCH-A970|SCH-A990|SCH-I100|SCH-I110|SCH-I400|SCH-I405|SCH-I500|SCH-I510|SCH-I515|SCH-I600|SCH-I730|SCH-I760|SCH-I770|SCH-I830|SCH-I910|SCH-I920|SCH-I959|SCH-LC11|SCH-N150|SCH-N300|SCH-R100|SCH-R300|SCH-R351|SCH-R400|SCH-R410|SCH-T300|SCH-U310|SCH-U320|SCH-U350|SCH-U360|SCH-U365|SCH-U370|SCH-U380|SCH-U410|SCH-U430|SCH-U450|SCH-U460|SCH-U470|SCH-U490|SCH-U540|SCH-U550|SCH-U620|SCH-U640|SCH-U650|SCH-U660|SCH-U700|SCH-U740|SCH-U750|SCH-U810|SCH-U820|SCH-U900|SCH-U940|SCH-U960|SCS-26UC|SGH-A107|SGH-A117|SGH-A127|SGH-A137|SGH-A157|SGH-A167|SGH-A177|SGH-A187|SGH-A197|SGH-A227|SGH-A237|SGH-A257|SGH-A437|SGH-A517|SGH-A597|SGH-A637|SGH-A657|SGH-A667|SGH-A687|SGH-A697|SGH-A707|SGH-A717|SGH-A727|SGH-A737|SGH-A747|SGH-A767|SGH-A777|SGH-A797|SGH-A817|SGH-A827|SGH-A837|SGH-A847|SGH-A867|SGH-A877|SGH-A887|SGH-A897|SGH-A927|SGH-B100|SGH-B130|SGH-B200|SGH-B220|SGH-C100|SGH-C110|SGH-C120|SGH-C130|SGH-C140|SGH-C160|SGH-C170|SGH-C180|SGH-C200|SGH-C207|SGH-C210|SGH-C225|SGH-C230|SGH-C417|SGH-C450|SGH-D307|SGH-D347|SGH-D357|SGH-D407|SGH-D415|SGH-D780|SGH-D807|SGH-D980|SGH-E105|SGH-E200|SGH-E315|SGH-E316|SGH-E317|SGH-E335|SGH-E590|SGH-E635|SGH-E715|SGH-E890|SGH-F300|SGH-F480|SGH-I200|SGH-I300|SGH-I320|SGH-I550|SGH-I577|SGH-I600|SGH-I607|SGH-I617|SGH-I627|SGH-I637|SGH-I677|SGH-I700|SGH-I717|SGH-I727|SGH-i747M|SGH-I777|SGH-I780|SGH-I827|SGH-I847|SGH-I857|SGH-I896|SGH-I897|SGH-I900|SGH-I907|SGH-I917|SGH-I927|SGH-I937|SGH-I997|SGH-J150|SGH-J200|SGH-L170|SGH-L700|SGH-M110|SGH-M150|SGH-M200|SGH-N105|SGH-N500|SGH-N600|SGH-N620|SGH-N625|SGH-N700|SGH-N710|SGH-P107|SGH-P207|SGH-P300|SGH-P310|SGH-P520|SGH-P735|SGH-P777|SGH-Q105|SGH-R210|SGH-R220|SGH-R225|SGH-S105|SGH-S307|SGH-T109|SGH-T119|SGH-T139|SGH-T209|SGH-T219|SGH-T229|SGH-T239|SGH-T249|SGH-T259|SGH-T309|SGH-T319|SGH-T329|SGH-T339|SGH-T349|SGH-T359|SGH-T369|SGH-T379|SGH-T409|SGH-T429|SGH-T439|SGH-T459|SGH-T469|SGH-T479|SGH-T499|SGH-T509|SGH-T519|SGH-T539|SGH-T559|SGH-T589|SGH-T609|SGH-T619|SGH-T629|SGH-T639|SGH-T659|SGH-T669|SGH-T679|SGH-T709|SGH-T719|SGH-T729|SGH-T739|SGH-T746|SGH-T749|SGH-T759|SGH-T769|SGH-T809|SGH-T819|SGH-T839|SGH-T919|SGH-T929|SGH-T939|SGH-T959|SGH-T989|SGH-U100|SGH-U200|SGH-U800|SGH-V205|SGH-V206|SGH-X100|SGH-X105|SGH-X120|SGH-X140|SGH-X426|SGH-X427|SGH-X475|SGH-X495|SGH-X497|SGH-X507|SGH-X600|SGH-X610|SGH-X620|SGH-X630|SGH-X700|SGH-X820|SGH-X890|SGH-Z130|SGH-Z150|SGH-Z170|SGH-ZX10|SGH-ZX20|SHW-M110|SPH-A120|SPH-A400|SPH-A420|SPH-A460|SPH-A500|SPH-A560|SPH-A600|SPH-A620|SPH-A660|SPH-A700|SPH-A740|SPH-A760|SPH-A790|SPH-A800|SPH-A820|SPH-A840|SPH-A880|SPH-A900|SPH-A940|SPH-A960|SPH-D600|SPH-D700|SPH-D710|SPH-D720|SPH-I300|SPH-I325|SPH-I330|SPH-I350|SPH-I500|SPH-I600|SPH-I700|SPH-L700|SPH-M100|SPH-M220|SPH-M240|SPH-M300|SPH-M305|SPH-M320|SPH-M330|SPH-M350|SPH-M360|SPH-M370|SPH-M380|SPH-M510|SPH-M540|SPH-M550|SPH-M560|SPH-M570|SPH-M580|SPH-M610|SPH-M620|SPH-M630|SPH-M800|SPH-M810|SPH-M850|SPH-M900|SPH-M910|SPH-M920|SPH-M930|SPH-N100|SPH-N200|SPH-N240|SPH-N300|SPH-N400|SPH-Z400|SWC-E100|SCH-i909|GT-N7100|GT-N7105|SCH-I535|SM-N900A|SGH-I317|SGH-T999L|GT-S5360B|GT-I8262|GT-S6802|GT-S6312|GT-S6310|GT-S5312|GT-S5310|GT-I9105|GT-I8510|GT-S6790N|SM-G7105|SM-N9005|GT-S5301|GT-I9295|GT-I9195|SM-C101|GT-S7392|GT-S7560|GT-B7610|GT-I5510|GT-S7582|GT-S7530E|GT-I8750|SM-G9006V|SM-G9008V|SM-G9009D|SM-G900A|SM-G900D|SM-G900F|SM-G900H|SM-G900I|SM-G900J|SM-G900K|SM-G900L|SM-G900M|SM-G900P|SM-G900R4|SM-G900S|SM-G900T|SM-G900V|SM-G900W8|SHV-E160K|SCH-P709|SCH-P729|SM-T2558|GT-I9205',
|
177 |
-
'LG' => '\bLG\b;|LG[- ]?(C800|C900|E400|E610|E900|E-900|F160|F180K|F180L|F180S|730|855|L160|LS740|LS840|LS970|LU6200|MS690|MS695|MS770|MS840|MS870|MS910|P500|P700|P705|VM696|AS680|AS695|AX840|C729|E970|GS505|272|C395|E739BK|E960|L55C|L75C|LS696|LS860|P769BK|P350|P500|P509|P870|UN272|US730|VS840|VS950|LN272|LN510|LS670|LS855|LW690|MN270|MN510|P509|P769|P930|UN200|UN270|UN510|UN610|US670|US740|US760|UX265|UX840|VN271|VN530|VS660|VS700|VS740|VS750|VS910|VS920|VS930|VX9200|VX11000|AX840A|LW770|P506|P925|P999|E612|D955|D802|MS323)',
|
178 |
-
'Sony' => 'SonyST|SonyLT|SonyEricsson|SonyEricssonLT15iv|LT18i|E10i|LT28h|LT26w|SonyEricssonMT27i|C5303|C6902|C6903|C6906|C6943|D2533',
|
179 |
-
'Asus' => 'Asus.*Galaxy|PadFone.*Mobile',
|
180 |
-
// http://www.micromaxinfo.com/mobiles/smartphones
|
181 |
-
// Added because the codes might conflict with Acer Tablets.
|
182 |
-
'Micromax' => 'Micromax.*\b(A210|A92|A88|A72|A111|A110Q|A115|A116|A110|A90S|A26|A51|A35|A54|A25|A27|A89|A68|A65|A57|A90)\b',
|
183 |
-
// @todo Complete the regex.
|
184 |
-
'Palm' => 'PalmSource|Palm', // avantgo|blazer|elaine|hiptop|plucker|xiino ;
|
185 |
-
'Vertu' => 'Vertu|Vertu.*Ltd|Vertu.*Ascent|Vertu.*Ayxta|Vertu.*Constellation(F|Quest)?|Vertu.*Monika|Vertu.*Signature', // Just for fun ;)
|
186 |
-
// http://www.pantech.co.kr/en/prod/prodList.do?gbrand=VEGA (PANTECH)
|
187 |
-
// Most of the VEGA devices are legacy. PANTECH seem to be newer devices based on Android.
|
188 |
-
'Pantech' => 'PANTECH|IM-A850S|IM-A840S|IM-A830L|IM-A830K|IM-A830S|IM-A820L|IM-A810K|IM-A810S|IM-A800S|IM-T100K|IM-A725L|IM-A780L|IM-A775C|IM-A770K|IM-A760S|IM-A750K|IM-A740S|IM-A730S|IM-A720L|IM-A710K|IM-A690L|IM-A690S|IM-A650S|IM-A630K|IM-A600S|VEGA PTL21|PT003|P8010|ADR910L|P6030|P6020|P9070|P4100|P9060|P5000|CDM8992|TXT8045|ADR8995|IS11PT|P2030|P6010|P8000|PT002|IS06|CDM8999|P9050|PT001|TXT8040|P2020|P9020|P2000|P7040|P7000|C790',
|
189 |
-
// http://www.fly-phone.com/devices/smartphones/ ; Included only smartphones.
|
190 |
-
'Fly' => 'IQ230|IQ444|IQ450|IQ440|IQ442|IQ441|IQ245|IQ256|IQ236|IQ255|IQ235|IQ245|IQ275|IQ240|IQ285|IQ280|IQ270|IQ260|IQ250',
|
191 |
-
// http://fr.wikomobile.com
|
192 |
-
'Wiko' => 'KITE 4G|HIGHWAY|GETAWAY|STAIRWAY|DARKSIDE|DARKFULL|DARKNIGHT|DARKMOON|SLIDE|WAX 4G|RAINBOW|BLOOM|SUNSET|GOA|LENNY|BARRY|IGGY|OZZY|CINK FIVE|CINK PEAX|CINK PEAX 2|CINK SLIM|CINK SLIM 2|CINK +|CINK KING|CINK PEAX|CINK SLIM|SUBLIM',
|
193 |
-
'iMobile' => 'i-mobile (IQ|i-STYLE|idea|ZAA|Hitz)',
|
194 |
-
// Added simvalley mobile just for fun. They have some interesting devices.
|
195 |
-
// http://www.simvalley.fr/telephonie---gps-_22_telephonie-mobile_telephones_.html
|
196 |
-
'SimValley' => '\b(SP-80|XT-930|SX-340|XT-930|SX-310|SP-360|SP60|SPT-800|SP-120|SPT-800|SP-140|SPX-5|SPX-8|SP-100|SPX-8|SPX-12)\b',
|
197 |
-
// Wolfgang - a brand that is sold by Aldi supermarkets.
|
198 |
-
// http://www.wolfgangmobile.com/
|
199 |
-
'Wolfgang' => 'AT-B24D|AT-AS50HD|AT-AS40W|AT-AS55HD|AT-AS45q2|AT-B26D|AT-AS50Q',
|
200 |
-
'Alcatel' => 'Alcatel',
|
201 |
-
'Nintendo' => 'Nintendo 3DS',
|
202 |
-
// http://en.wikipedia.org/wiki/Amoi
|
203 |
-
'Amoi' => 'Amoi',
|
204 |
-
// http://en.wikipedia.org/wiki/INQ
|
205 |
-
'INQ' => 'INQ',
|
206 |
-
// @Tapatalk is a mobile app; http://support.tapatalk.com/threads/smf-2-0-2-os-and-browser-detection-plugin-and-tapatalk.15565/#post-79039
|
207 |
-
'GenericPhone' => 'Tapatalk|PDA;|SAGEM|\bmmp\b|pocket|\bpsp\b|symbian|Smartphone|smartfon|treo|up.browser|up.link|vodafone|\bwap\b|nokia|Series40|Series60|S60|SonyEricsson|N900|MAUI.*WAP.*Browser',
|
208 |
-
);
|
209 |
-
|
210 |
-
/**
|
211 |
-
* List of tablet devices.
|
212 |
-
*
|
213 |
-
* @var array
|
214 |
-
*/
|
215 |
-
protected static $tabletDevices = array(
|
216 |
-
// @todo: check for mobile friendly emails topic.
|
217 |
-
'iPad' => 'iPad|iPad.*Mobile',
|
218 |
-
// Removed |^.*Android.*Nexus(?!(?:Mobile).)*$
|
219 |
-
// @see #442
|
220 |
-
'NexusTablet' => 'Android.*Nexus[\s]+(7|9|10)',
|
221 |
-
'SamsungTablet' => 'SAMSUNG.*Tablet|Galaxy.*Tab|SC-01C|GT-P1000|GT-P1003|GT-P1010|GT-P3105|GT-P6210|GT-P6800|GT-P6810|GT-P7100|GT-P7300|GT-P7310|GT-P7500|GT-P7510|SCH-I800|SCH-I815|SCH-I905|SGH-I957|SGH-I987|SGH-T849|SGH-T859|SGH-T869|SPH-P100|GT-P3100|GT-P3108|GT-P3110|GT-P5100|GT-P5110|GT-P6200|GT-P7320|GT-P7511|GT-N8000|GT-P8510|SGH-I497|SPH-P500|SGH-T779|SCH-I705|SCH-I915|GT-N8013|GT-P3113|GT-P5113|GT-P8110|GT-N8010|GT-N8005|GT-N8020|GT-P1013|GT-P6201|GT-P7501|GT-N5100|GT-N5105|GT-N5110|SHV-E140K|SHV-E140L|SHV-E140S|SHV-E150S|SHV-E230K|SHV-E230L|SHV-E230S|SHW-M180K|SHW-M180L|SHW-M180S|SHW-M180W|SHW-M300W|SHW-M305W|SHW-M380K|SHW-M380S|SHW-M380W|SHW-M430W|SHW-M480K|SHW-M480S|SHW-M480W|SHW-M485W|SHW-M486W|SHW-M500W|GT-I9228|SCH-P739|SCH-I925|GT-I9200|GT-P5200|GT-P5210|GT-P5210X|SM-T311|SM-T310|SM-T310X|SM-T210|SM-T210R|SM-T211|SM-P600|SM-P601|SM-P605|SM-P900|SM-P901|SM-T217|SM-T217A|SM-T217S|SM-P6000|SM-T3100|SGH-I467|XE500|SM-T110|GT-P5220|GT-I9200X|GT-N5110X|GT-N5120|SM-P905|SM-T111|SM-T2105|SM-T315|SM-T320|SM-T320X|SM-T321|SM-T520|SM-T525|SM-T530NU|SM-T230NU|SM-T330NU|SM-T900|XE500T1C|SM-P605V|SM-P905V|SM-T337V|SM-T537V|SM-T707V|SM-T807V|SM-P600X|SM-P900X|SM-T210X|SM-T230|SM-T230X|SM-T325|GT-P7503|SM-T531|SM-T330|SM-T530|SM-T705|SM-T705C|SM-T535|SM-T331|SM-T800|SM-T700|SM-T537|SM-T807|SM-P907A|SM-T337A|SM-T537A|SM-T707A|SM-T807A|SM-T237|SM-T807P|SM-P607T|SM-T217T|SM-T337T|SM-T807T|SM-T116NQ|SM-P550|SM-T350|SM-T550|SM-T9000|SM-P9000|SM-T705Y|SM-T805|GT-P3113|SM-T710|SM-T810|SM-T360|SM-T533|SM-T113|SM-T335|SM-T715', // SCH-P709|SCH-P729|SM-T2558|GT-I9205 - Samsung Mega - treat them like a regular phone.
|
222 |
-
// http://docs.aws.amazon.com/silk/latest/developerguide/user-agent.html
|
223 |
-
'Kindle' => 'Kindle|Silk.*Accelerated|Android.*\b(KFOT|KFTT|KFJWI|KFJWA|KFOTE|KFSOWI|KFTHWI|KFTHWA|KFAPWI|KFAPWA|WFJWAE|KFSAWA|KFSAWI|KFASWI)\b',
|
224 |
-
// Only the Surface tablets with Windows RT are considered mobile.
|
225 |
-
// http://msdn.microsoft.com/en-us/library/ie/hh920767(v=vs.85).aspx
|
226 |
-
'SurfaceTablet' => 'Windows NT [0-9.]+; ARM;.*(Tablet|ARMBJS)',
|
227 |
-
// http://shopping1.hp.com/is-bin/INTERSHOP.enfinity/WFS/WW-USSMBPublicStore-Site/en_US/-/USD/ViewStandardCatalog-Browse?CatalogCategoryID=JfIQ7EN5lqMAAAEyDcJUDwMT
|
228 |
-
'HPTablet' => 'HP Slate (7|8|10)|HP ElitePad 900|hp-tablet|EliteBook.*Touch|HP 8|Slate 21|HP SlateBook 10',
|
229 |
-
// Watch out for PadFone, see #132.
|
230 |
-
// http://www.asus.com/de/Tablets_Mobile/Memo_Pad_Products/
|
231 |
-
'AsusTablet' => '^.*PadFone((?!Mobile).)*$|Transformer|TF101|TF101G|TF300T|TF300TG|TF300TL|TF700T|TF700KL|TF701T|TF810C|ME171|ME301T|ME302C|ME371MG|ME370T|ME372MG|ME172V|ME173X|ME400C|Slider SL101|\bK00F\b|\bK00C\b|\bK00E\b|\bK00L\b|TX201LA|ME176C|ME102A|\bM80TA\b|ME372CL|ME560CG|ME372CG|ME302KL| K010 | K017 |ME572C|ME103K|ME170C|ME171C|\bME70C\b|ME581C|ME581CL|ME8510C|ME181C',
|
232 |
-
'BlackBerryTablet' => 'PlayBook|RIM Tablet',
|
233 |
-
'HTCtablet' => 'HTC_Flyer_P512|HTC Flyer|HTC Jetstream|HTC-P715a|HTC EVO View 4G|PG41200|PG09410',
|
234 |
-
'MotorolaTablet' => 'xoom|sholest|MZ615|MZ605|MZ505|MZ601|MZ602|MZ603|MZ604|MZ606|MZ607|MZ608|MZ609|MZ615|MZ616|MZ617',
|
235 |
-
'NookTablet' => 'Android.*Nook|NookColor|nook browser|BNRV200|BNRV200A|BNTV250|BNTV250A|BNTV400|BNTV600|LogicPD Zoom2',
|
236 |
-
// http://www.acer.ro/ac/ro/RO/content/drivers
|
237 |
-
// http://www.packardbell.co.uk/pb/en/GB/content/download (Packard Bell is part of Acer)
|
238 |
-
// http://us.acer.com/ac/en/US/content/group/tablets
|
239 |
-
// http://www.acer.de/ac/de/DE/content/models/tablets/
|
240 |
-
// Can conflict with Micromax and Motorola phones codes.
|
241 |
-
'AcerTablet' => 'Android.*; \b(A100|A101|A110|A200|A210|A211|A500|A501|A510|A511|A700|A701|W500|W500P|W501|W501P|W510|W511|W700|G100|G100W|B1-A71|B1-710|B1-711|A1-810|A1-811|A1-830)\b|W3-810|\bA3-A10\b|\bA3-A11\b',
|
242 |
-
// http://eu.computers.toshiba-europe.com/innovation/family/Tablets/1098744/banner_id/tablet_footerlink/
|
243 |
-
// http://us.toshiba.com/tablets/tablet-finder
|
244 |
-
// http://www.toshiba.co.jp/regza/tablet/
|
245 |
-
'ToshibaTablet' => 'Android.*(AT100|AT105|AT200|AT205|AT270|AT275|AT300|AT305|AT1S5|AT500|AT570|AT700|AT830)|TOSHIBA.*FOLIO',
|
246 |
-
// http://www.nttdocomo.co.jp/english/service/developer/smart_phone/technical_info/spec/index.html
|
247 |
-
// http://www.lg.com/us/tablets
|
248 |
-
'LGTablet' => '\bL-06C|LG-V909|LG-V900|LG-V700|LG-V510|LG-V500|LG-V410|LG-V400|LG-VK810\b',
|
249 |
-
'FujitsuTablet' => 'Android.*\b(F-01D|F-02F|F-05E|F-10D|M532|Q572)\b',
|
250 |
-
// Prestigio Tablets http://www.prestigio.com/support
|
251 |
-
'PrestigioTablet' => 'PMP3170B|PMP3270B|PMP3470B|PMP7170B|PMP3370B|PMP3570C|PMP5870C|PMP3670B|PMP5570C|PMP5770D|PMP3970B|PMP3870C|PMP5580C|PMP5880D|PMP5780D|PMP5588C|PMP7280C|PMP7280C3G|PMP7280|PMP7880D|PMP5597D|PMP5597|PMP7100D|PER3464|PER3274|PER3574|PER3884|PER5274|PER5474|PMP5097CPRO|PMP5097|PMP7380D|PMP5297C|PMP5297C_QUAD|PMP812E|PMP812E3G|PMP812F|PMP810E|PMP880TD|PMT3017|PMT3037|PMT3047|PMT3057|PMT7008|PMT5887|PMT5001|PMT5002',
|
252 |
-
// http://support.lenovo.com/en_GB/downloads/default.page?#
|
253 |
-
'LenovoTablet' => 'Idea(Tab|Pad)( A1|A10| K1|)|ThinkPad([ ]+)?Tablet|Lenovo.*(S2109|S2110|S5000|S6000|K3011|A3000|A3500|A1000|A2107|A2109|A1107|A5500|A7600|B6000|B8000|B8080)(-|)(FL|F|HV|H|)',
|
254 |
-
// http://www.dell.com/support/home/us/en/04/Products/tab_mob/tablets
|
255 |
-
'DellTablet' => 'Venue 11|Venue 8|Venue 7|Dell Streak 10|Dell Streak 7',
|
256 |
-
// http://www.yarvik.com/en/matrix/tablets/
|
257 |
-
'YarvikTablet' => 'Android.*\b(TAB210|TAB211|TAB224|TAB250|TAB260|TAB264|TAB310|TAB360|TAB364|TAB410|TAB411|TAB420|TAB424|TAB450|TAB460|TAB461|TAB464|TAB465|TAB467|TAB468|TAB07-100|TAB07-101|TAB07-150|TAB07-151|TAB07-152|TAB07-200|TAB07-201-3G|TAB07-210|TAB07-211|TAB07-212|TAB07-214|TAB07-220|TAB07-400|TAB07-485|TAB08-150|TAB08-200|TAB08-201-3G|TAB08-201-30|TAB09-100|TAB09-211|TAB09-410|TAB10-150|TAB10-201|TAB10-211|TAB10-400|TAB10-410|TAB13-201|TAB274EUK|TAB275EUK|TAB374EUK|TAB462EUK|TAB474EUK|TAB9-200)\b',
|
258 |
-
'MedionTablet' => 'Android.*\bOYO\b|LIFE.*(P9212|P9514|P9516|S9512)|LIFETAB',
|
259 |
-
'ArnovaTablet' => 'AN10G2|AN7bG3|AN7fG3|AN8G3|AN8cG3|AN7G3|AN9G3|AN7dG3|AN7dG3ST|AN7dG3ChildPad|AN10bG3|AN10bG3DT|AN9G2',
|
260 |
-
// http://www.intenso.de/kategorie_en.php?kategorie=33
|
261 |
-
// @todo: http://www.nbhkdz.com/read/b8e64202f92a2df129126bff.html - investigate
|
262 |
-
'IntensoTablet' => 'INM8002KP|INM1010FP|INM805ND|Intenso Tab|TAB1004',
|
263 |
-
// IRU.ru Tablets http://www.iru.ru/catalog/soho/planetable/
|
264 |
-
'IRUTablet' => 'M702pro',
|
265 |
-
'MegafonTablet' => 'MegaFon V9|\bZTE V9\b|Android.*\bMT7A\b',
|
266 |
-
// http://www.e-boda.ro/tablete-pc.html
|
267 |
-
'EbodaTablet' => 'E-Boda (Supreme|Impresspeed|Izzycomm|Essential)',
|
268 |
-
// http://www.allview.ro/produse/droseries/lista-tablete-pc/
|
269 |
-
'AllViewTablet' => 'Allview.*(Viva|Alldro|City|Speed|All TV|Frenzy|Quasar|Shine|TX1|AX1|AX2)',
|
270 |
-
// http://wiki.archosfans.com/index.php?title=Main_Page
|
271 |
-
'ArchosTablet' => '\b(101G9|80G9|A101IT)\b|Qilive 97R|Archos5|\bARCHOS (70|79|80|90|97|101|FAMILYPAD|)(b|)(G10| Cobalt| TITANIUM(HD|)| Xenon| Neon|XSK| 2| XS 2| PLATINUM| CARBON|GAMEPAD)\b',
|
272 |
-
// http://www.ainol.com/plugin.php?identifier=ainol&module=product
|
273 |
-
'AinolTablet' => 'NOVO7|NOVO8|NOVO10|Novo7Aurora|Novo7Basic|NOVO7PALADIN|novo9-Spark',
|
274 |
-
// @todo: inspect http://esupport.sony.com/US/p/select-system.pl?DIRECTOR=DRIVER
|
275 |
-
// Readers http://www.atsuhiro-me.net/ebook/sony-reader/sony-reader-web-browser
|
276 |
-
// http://www.sony.jp/support/tablet/
|
277 |
-
'SonyTablet' => 'Sony.*Tablet|Xperia Tablet|Sony Tablet S|SO-03E|SGPT12|SGPT13|SGPT114|SGPT121|SGPT122|SGPT123|SGPT111|SGPT112|SGPT113|SGPT131|SGPT132|SGPT133|SGPT211|SGPT212|SGPT213|SGP311|SGP312|SGP321|EBRD1101|EBRD1102|EBRD1201|SGP351|SGP341|SGP511|SGP512|SGP521|SGP541|SGP551|SGP621|SGP612|SOT31',
|
278 |
-
// http://www.support.philips.com/support/catalog/worldproducts.jsp?userLanguage=en&userCountry=cn&categoryid=3G_LTE_TABLET_SU_CN_CARE&title=3G%20tablets%20/%20LTE%20range&_dyncharset=UTF-8
|
279 |
-
'PhilipsTablet' => '\b(PI2010|PI3000|PI3100|PI3105|PI3110|PI3205|PI3210|PI3900|PI4010|PI7000|PI7100)\b',
|
280 |
-
// db + http://www.cube-tablet.com/buy-products.html
|
281 |
-
'CubeTablet' => 'Android.*(K8GT|U9GT|U10GT|U16GT|U17GT|U18GT|U19GT|U20GT|U23GT|U30GT)|CUBE U8GT',
|
282 |
-
// http://www.cobyusa.com/?p=pcat&pcat_id=3001
|
283 |
-
'CobyTablet' => 'MID1042|MID1045|MID1125|MID1126|MID7012|MID7014|MID7015|MID7034|MID7035|MID7036|MID7042|MID7048|MID7127|MID8042|MID8048|MID8127|MID9042|MID9740|MID9742|MID7022|MID7010',
|
284 |
-
// http://www.match.net.cn/products.asp
|
285 |
-
'MIDTablet' => 'M9701|M9000|M9100|M806|M1052|M806|T703|MID701|MID713|MID710|MID727|MID760|MID830|MID728|MID933|MID125|MID810|MID732|MID120|MID930|MID800|MID731|MID900|MID100|MID820|MID735|MID980|MID130|MID833|MID737|MID960|MID135|MID860|MID736|MID140|MID930|MID835|MID733',
|
286 |
-
// http://www.msi.com/support
|
287 |
-
// @todo Research the Windows Tablets.
|
288 |
-
'MSITablet' => 'MSI \b(Primo 73K|Primo 73L|Primo 81L|Primo 77|Primo 93|Primo 75|Primo 76|Primo 73|Primo 81|Primo 91|Primo 90|Enjoy 71|Enjoy 7|Enjoy 10)\b',
|
289 |
-
// @todo http://www.kyoceramobile.com/support/drivers/
|
290 |
-
// 'KyoceraTablet' => null,
|
291 |
-
// @todo http://intexuae.com/index.php/category/mobile-devices/tablets-products/
|
292 |
-
// 'IntextTablet' => null,
|
293 |
-
// http://pdadb.net/index.php?m=pdalist&list=SMiT (NoName Chinese Tablets)
|
294 |
-
// http://www.imp3.net/14/show.php?itemid=20454
|
295 |
-
'SMiTTablet' => 'Android.*(\bMID\b|MID-560|MTV-T1200|MTV-PND531|MTV-P1101|MTV-PND530)',
|
296 |
-
// http://www.rock-chips.com/index.php?do=prod&pid=2
|
297 |
-
'RockChipTablet' => 'Android.*(RK2818|RK2808A|RK2918|RK3066)|RK2738|RK2808A',
|
298 |
-
// http://www.fly-phone.com/devices/tablets/ ; http://www.fly-phone.com/service/
|
299 |
-
'FlyTablet' => 'IQ310|Fly Vision',
|
300 |
-
// http://www.bqreaders.com/gb/tablets-prices-sale.html
|
301 |
-
'bqTablet' => 'Android.*(bq)?.*(Elcano|Curie|Edison|Maxwell|Kepler|Pascal|Tesla|Hypatia|Platon|Newton|Livingstone|Cervantes|Avant|Aquaris E10)|Maxwell.*Lite|Maxwell.*Plus',
|
302 |
-
// http://www.huaweidevice.com/worldwide/productFamily.do?method=index&directoryId=5011&treeId=3290
|
303 |
-
// http://www.huaweidevice.com/worldwide/downloadCenter.do?method=index&directoryId=3372&treeId=0&tb=1&type=software (including legacy tablets)
|
304 |
-
'HuaweiTablet' => 'MediaPad|MediaPad 7 Youth|IDEOS S7|S7-201c|S7-202u|S7-101|S7-103|S7-104|S7-105|S7-106|S7-201|S7-Slim',
|
305 |
-
// Nec or Medias Tab
|
306 |
-
'NecTablet' => '\bN-06D|\bN-08D',
|
307 |
-
// Pantech Tablets: http://www.pantechusa.com/phones/
|
308 |
-
'PantechTablet' => 'Pantech.*P4100',
|
309 |
-
// Broncho Tablets: http://www.broncho.cn/ (hard to find)
|
310 |
-
'BronchoTablet' => 'Broncho.*(N701|N708|N802|a710)',
|
311 |
-
// http://versusuk.com/support.html
|
312 |
-
'VersusTablet' => 'TOUCHPAD.*[78910]|\bTOUCHTAB\b',
|
313 |
-
// http://www.zync.in/index.php/our-products/tablet-phablets
|
314 |
-
'ZyncTablet' => 'z1000|Z99 2G|z99|z930|z999|z990|z909|Z919|z900',
|
315 |
-
// http://www.positivoinformatica.com.br/www/pessoal/tablet-ypy/
|
316 |
-
'PositivoTablet' => 'TB07STA|TB10STA|TB07FTA|TB10FTA',
|
317 |
-
// https://www.nabitablet.com/
|
318 |
-
'NabiTablet' => 'Android.*\bNabi',
|
319 |
-
'KoboTablet' => 'Kobo Touch|\bK080\b|\bVox\b Build|\bArc\b Build',
|
320 |
-
// French Danew Tablets http://www.danew.com/produits-tablette.php
|
321 |
-
'DanewTablet' => 'DSlide.*\b(700|701R|702|703R|704|802|970|971|972|973|974|1010|1012)\b',
|
322 |
-
// Texet Tablets and Readers http://www.texet.ru/tablet/
|
323 |
-
'TexetTablet' => 'NaviPad|TB-772A|TM-7045|TM-7055|TM-9750|TM-7016|TM-7024|TM-7026|TM-7041|TM-7043|TM-7047|TM-8041|TM-9741|TM-9747|TM-9748|TM-9751|TM-7022|TM-7021|TM-7020|TM-7011|TM-7010|TM-7023|TM-7025|TM-7037W|TM-7038W|TM-7027W|TM-9720|TM-9725|TM-9737W|TM-1020|TM-9738W|TM-9740|TM-9743W|TB-807A|TB-771A|TB-727A|TB-725A|TB-719A|TB-823A|TB-805A|TB-723A|TB-715A|TB-707A|TB-705A|TB-709A|TB-711A|TB-890HD|TB-880HD|TB-790HD|TB-780HD|TB-770HD|TB-721HD|TB-710HD|TB-434HD|TB-860HD|TB-840HD|TB-760HD|TB-750HD|TB-740HD|TB-730HD|TB-722HD|TB-720HD|TB-700HD|TB-500HD|TB-470HD|TB-431HD|TB-430HD|TB-506|TB-504|TB-446|TB-436|TB-416|TB-146SE|TB-126SE',
|
324 |
-
// Avoid detecting 'PLAYSTATION 3' as mobile.
|
325 |
-
'PlaystationTablet' => 'Playstation.*(Portable|Vita)',
|
326 |
-
// http://www.trekstor.de/surftabs.html
|
327 |
-
'TrekstorTablet' => 'ST10416-1|VT10416-1|ST70408-1|ST702xx-1|ST702xx-2|ST80208|ST97216|ST70104-2|VT10416-2|ST10216-2A|SurfTab',
|
328 |
-
// http://www.pyleaudio.com/Products.aspx?%2fproducts%2fPersonal-Electronics%2fTablets
|
329 |
-
'PyleAudioTablet' => '\b(PTBL10CEU|PTBL10C|PTBL72BC|PTBL72BCEU|PTBL7CEU|PTBL7C|PTBL92BC|PTBL92BCEU|PTBL9CEU|PTBL9CUK|PTBL9C)\b',
|
330 |
-
// http://www.advandigital.com/index.php?link=content-product&jns=JP001
|
331 |
-
// because of the short codenames we have to include whitespaces to reduce the possible conflicts.
|
332 |
-
'AdvanTablet' => 'Android.* \b(E3A|T3X|T5C|T5B|T3E|T3C|T3B|T1J|T1F|T2A|T1H|T1i|E1C|T1-E|T5-A|T4|E1-B|T2Ci|T1-B|T1-D|O1-A|E1-A|T1-A|T3A|T4i)\b ',
|
333 |
-
// http://www.danytech.com/category/tablet-pc
|
334 |
-
'DanyTechTablet' => 'Genius Tab G3|Genius Tab S2|Genius Tab Q3|Genius Tab G4|Genius Tab Q4|Genius Tab G-II|Genius TAB GII|Genius TAB GIII|Genius Tab S1',
|
335 |
-
// http://www.galapad.net/product.html
|
336 |
-
'GalapadTablet' => 'Android.*\bG1\b',
|
337 |
-
// http://www.micromaxinfo.com/tablet/funbook
|
338 |
-
'MicromaxTablet' => 'Funbook|Micromax.*\b(P250|P560|P360|P362|P600|P300|P350|P500|P275)\b',
|
339 |
-
// http://www.karbonnmobiles.com/products_tablet.php
|
340 |
-
'KarbonnTablet' => 'Android.*\b(A39|A37|A34|ST8|ST10|ST7|Smart Tab3|Smart Tab2)\b',
|
341 |
-
// http://www.myallfine.com/Products.asp
|
342 |
-
'AllFineTablet' => 'Fine7 Genius|Fine7 Shine|Fine7 Air|Fine8 Style|Fine9 More|Fine10 Joy|Fine11 Wide',
|
343 |
-
// http://www.proscanvideo.com/products-search.asp?itemClass=TABLET&itemnmbr=
|
344 |
-
'PROSCANTablet' => '\b(PEM63|PLT1023G|PLT1041|PLT1044|PLT1044G|PLT1091|PLT4311|PLT4311PL|PLT4315|PLT7030|PLT7033|PLT7033D|PLT7035|PLT7035D|PLT7044K|PLT7045K|PLT7045KB|PLT7071KG|PLT7072|PLT7223G|PLT7225G|PLT7777G|PLT7810K|PLT7849G|PLT7851G|PLT7852G|PLT8015|PLT8031|PLT8034|PLT8036|PLT8080K|PLT8082|PLT8088|PLT8223G|PLT8234G|PLT8235G|PLT8816K|PLT9011|PLT9045K|PLT9233G|PLT9735|PLT9760G|PLT9770G)\b',
|
345 |
-
// http://www.yonesnav.com/products/products.php
|
346 |
-
'YONESTablet' => 'BQ1078|BC1003|BC1077|RK9702|BC9730|BC9001|IT9001|BC7008|BC7010|BC708|BC728|BC7012|BC7030|BC7027|BC7026',
|
347 |
-
// http://www.cjshowroom.com/eproducts.aspx?classcode=004001001
|
348 |
-
// China manufacturer makes tablets for different small brands (eg. http://www.zeepad.net/index.html)
|
349 |
-
'ChangJiaTablet' => 'TPC7102|TPC7103|TPC7105|TPC7106|TPC7107|TPC7201|TPC7203|TPC7205|TPC7210|TPC7708|TPC7709|TPC7712|TPC7110|TPC8101|TPC8103|TPC8105|TPC8106|TPC8203|TPC8205|TPC8503|TPC9106|TPC9701|TPC97101|TPC97103|TPC97105|TPC97106|TPC97111|TPC97113|TPC97203|TPC97603|TPC97809|TPC97205|TPC10101|TPC10103|TPC10106|TPC10111|TPC10203|TPC10205|TPC10503',
|
350 |
-
// http://www.gloryunion.cn/products.asp
|
351 |
-
// http://www.allwinnertech.com/en/apply/mobile.html
|
352 |
-
// http://www.ptcl.com.pk/pd_content.php?pd_id=284 (EVOTAB)
|
353 |
-
// @todo: Softwiner tablets?
|
354 |
-
// aka. Cute or Cool tablets. Not sure yet, must research to avoid collisions.
|
355 |
-
'GUTablet' => 'TX-A1301|TX-M9002|Q702|kf026', // A12R|D75A|D77|D79|R83|A95|A106C|R15|A75|A76|D71|D72|R71|R73|R77|D82|R85|D92|A97|D92|R91|A10F|A77F|W71F|A78F|W78F|W81F|A97F|W91F|W97F|R16G|C72|C73E|K72|K73|R96G
|
356 |
-
// http://www.pointofview-online.com/showroom.php?shop_mode=product_listing&category_id=118
|
357 |
-
'PointOfViewTablet' => 'TAB-P506|TAB-navi-7-3G-M|TAB-P517|TAB-P-527|TAB-P701|TAB-P703|TAB-P721|TAB-P731N|TAB-P741|TAB-P825|TAB-P905|TAB-P925|TAB-PR945|TAB-PL1015|TAB-P1025|TAB-PI1045|TAB-P1325|TAB-PROTAB[0-9]+|TAB-PROTAB25|TAB-PROTAB26|TAB-PROTAB27|TAB-PROTAB26XL|TAB-PROTAB2-IPS9|TAB-PROTAB30-IPS9|TAB-PROTAB25XXL|TAB-PROTAB26-IPS10|TAB-PROTAB30-IPS10',
|
358 |
-
// http://www.overmax.pl/pl/katalog-produktow,p8/tablety,c14/
|
359 |
-
// @todo: add more tests.
|
360 |
-
'OvermaxTablet' => 'OV-(SteelCore|NewBase|Basecore|Baseone|Exellen|Quattor|EduTab|Solution|ACTION|BasicTab|TeddyTab|MagicTab|Stream|TB-08|TB-09)',
|
361 |
-
// http://hclmetablet.com/India/index.php
|
362 |
-
'HCLTablet' => 'HCL.*Tablet|Connect-3G-2.0|Connect-2G-2.0|ME Tablet U1|ME Tablet U2|ME Tablet G1|ME Tablet X1|ME Tablet Y2|ME Tablet Sync',
|
363 |
-
// http://www.edigital.hu/Tablet_es_e-book_olvaso/Tablet-c18385.html
|
364 |
-
'DPSTablet' => 'DPS Dream 9|DPS Dual 7',
|
365 |
-
// http://www.visture.com/index.asp
|
366 |
-
'VistureTablet' => 'V97 HD|i75 3G|Visture V4( HD)?|Visture V5( HD)?|Visture V10',
|
367 |
-
// http://www.mijncresta.nl/tablet
|
368 |
-
'CrestaTablet' => 'CTP(-)?810|CTP(-)?818|CTP(-)?828|CTP(-)?838|CTP(-)?888|CTP(-)?978|CTP(-)?980|CTP(-)?987|CTP(-)?988|CTP(-)?989',
|
369 |
-
// MediaTek - http://www.mediatek.com/_en/01_products/02_proSys.php?cata_sn=1&cata1_sn=1&cata2_sn=309
|
370 |
-
'MediatekTablet' => '\bMT8125|MT8389|MT8135|MT8377\b',
|
371 |
-
// Concorde tab
|
372 |
-
'ConcordeTablet' => 'Concorde([ ]+)?Tab|ConCorde ReadMan',
|
373 |
-
// GoClever Tablets - http://www.goclever.com/uk/products,c1/tablet,c5/
|
374 |
-
'GoCleverTablet' => 'GOCLEVER TAB|A7GOCLEVER|M1042|M7841|M742|R1042BK|R1041|TAB A975|TAB A7842|TAB A741|TAB A741L|TAB M723G|TAB M721|TAB A1021|TAB I921|TAB R721|TAB I720|TAB T76|TAB R70|TAB R76.2|TAB R106|TAB R83.2|TAB M813G|TAB I721|GCTA722|TAB I70|TAB I71|TAB S73|TAB R73|TAB R74|TAB R93|TAB R75|TAB R76.1|TAB A73|TAB A93|TAB A93.2|TAB T72|TAB R83|TAB R974|TAB R973|TAB A101|TAB A103|TAB A104|TAB A104.2|R105BK|M713G|A972BK|TAB A971|TAB R974.2|TAB R104|TAB R83.3|TAB A1042',
|
375 |
-
// Modecom Tablets - http://www.modecom.eu/tablets/portal/
|
376 |
-
'ModecomTablet' => 'FreeTAB 9000|FreeTAB 7.4|FreeTAB 7004|FreeTAB 7800|FreeTAB 2096|FreeTAB 7.5|FreeTAB 1014|FreeTAB 1001 |FreeTAB 8001|FreeTAB 9706|FreeTAB 9702|FreeTAB 7003|FreeTAB 7002|FreeTAB 1002|FreeTAB 7801|FreeTAB 1331|FreeTAB 1004|FreeTAB 8002|FreeTAB 8014|FreeTAB 9704|FreeTAB 1003',
|
377 |
-
// Vonino Tablets - http://www.vonino.eu/tablets
|
378 |
-
'VoninoTablet' => '\b(Argus[ _]?S|Diamond[ _]?79HD|Emerald[ _]?78E|Luna[ _]?70C|Onyx[ _]?S|Onyx[ _]?Z|Orin[ _]?HD|Orin[ _]?S|Otis[ _]?S|SpeedStar[ _]?S|Magnet[ _]?M9|Primus[ _]?94[ _]?3G|Primus[ _]?94HD|Primus[ _]?QS|Android.*\bQ8\b|Sirius[ _]?EVO[ _]?QS|Sirius[ _]?QS|Spirit[ _]?S)\b',
|
379 |
-
// ECS Tablets - http://www.ecs.com.tw/ECSWebSite/Product/Product_Tablet_List.aspx?CategoryID=14&MenuID=107&childid=M_107&LanID=0
|
380 |
-
'ECSTablet' => 'V07OT2|TM105A|S10OT1|TR10CS1',
|
381 |
-
// Storex Tablets - http://storex.fr/espace_client/support.html
|
382 |
-
// @note: no need to add all the tablet codes since they are guided by the first regex.
|
383 |
-
'StorexTablet' => 'eZee[_\']?(Tab|Go)[0-9]+|TabLC7|Looney Tunes Tab',
|
384 |
-
// Generic Vodafone tablets.
|
385 |
-
'VodafoneTablet' => 'SmartTab([ ]+)?[0-9]+|SmartTabII10|SmartTabII7',
|
386 |
-
// French tablets - Essentiel B http://www.boulanger.fr/tablette_tactile_e-book/tablette_tactile_essentiel_b/cl_68908.htm?multiChoiceToDelete=brand&mc_brand=essentielb
|
387 |
-
// Aka: http://www.essentielb.fr/
|
388 |
-
'EssentielBTablet' => 'Smart[ \']?TAB[ ]+?[0-9]+|Family[ \']?TAB2',
|
389 |
-
// Ross & Moor - http://ross-moor.ru/
|
390 |
-
'RossMoorTablet' => 'RM-790|RM-997|RMD-878G|RMD-974R|RMT-705A|RMT-701|RME-601|RMT-501|RMT-711',
|
391 |
-
// i-mobile http://product.i-mobilephone.com/Mobile_Device
|
392 |
-
'iMobileTablet' => 'i-mobile i-note',
|
393 |
-
// http://www.tolino.de/de/vergleichen/
|
394 |
-
'TolinoTablet' => 'tolino tab [0-9.]+|tolino shine',
|
395 |
-
// AudioSonic - a Kmart brand
|
396 |
-
// http://www.kmart.com.au/webapp/wcs/stores/servlet/Search?langId=-1&storeId=10701&catalogId=10001&categoryId=193001&pageSize=72¤tPage=1&searchCategory=193001%2b4294965664&sortBy=p_MaxPrice%7c1
|
397 |
-
'AudioSonicTablet' => '\bC-22Q|T7-QC|T-17B|T-17P\b',
|
398 |
-
// AMPE Tablets - http://www.ampe.com.my/product-category/tablets/
|
399 |
-
// @todo: add them gradually to avoid conflicts.
|
400 |
-
'AMPETablet' => 'Android.* A78 ',
|
401 |
-
// Skk Mobile - http://skkmobile.com.ph/product_tablets.php
|
402 |
-
'SkkTablet' => 'Android.* (SKYPAD|PHOENIX|CYCLOPS)',
|
403 |
-
// Tecno Mobile (only tablet) - http://www.tecno-mobile.com/index.php/product?filterby=smart&list_order=all&page=1
|
404 |
-
'TecnoTablet' => 'TECNO P9',
|
405 |
-
// JXD (consoles & tablets) - http://jxd.hk/products.asp?selectclassid=009008&clsid=3
|
406 |
-
'JXDTablet' => 'Android.*\b(F3000|A3300|JXD5000|JXD3000|JXD2000|JXD300B|JXD300|S5800|S7800|S602b|S5110b|S7300|S5300|S602|S603|S5100|S5110|S601|S7100a|P3000F|P3000s|P101|P200s|P1000m|P200m|P9100|P1000s|S6600b|S908|P1000|P300|S18|S6600|S9100)\b',
|
407 |
-
// i-Joy tablets - http://www.i-joy.es/en/cat/products/tablets/
|
408 |
-
'iJoyTablet' => 'Tablet (Spirit 7|Essentia|Galatea|Fusion|Onix 7|Landa|Titan|Scooby|Deox|Stella|Themis|Argon|Unique 7|Sygnus|Hexen|Finity 7|Cream|Cream X2|Jade|Neon 7|Neron 7|Kandy|Scape|Saphyr 7|Rebel|Biox|Rebel|Rebel 8GB|Myst|Draco 7|Myst|Tab7-004|Myst|Tadeo Jones|Tablet Boing|Arrow|Draco Dual Cam|Aurix|Mint|Amity|Revolution|Finity 9|Neon 9|T9w|Amity 4GB Dual Cam|Stone 4GB|Stone 8GB|Andromeda|Silken|X2|Andromeda II|Halley|Flame|Saphyr 9,7|Touch 8|Planet|Triton|Unique 10|Hexen 10|Memphis 4GB|Memphis 8GB|Onix 10)',
|
409 |
-
// http://www.intracon.eu/tablet
|
410 |
-
'FX2Tablet' => 'FX2 PAD7|FX2 PAD10',
|
411 |
-
// http://www.xoro.de/produkte/
|
412 |
-
// @note: Might be the same brand with 'Simply tablets'
|
413 |
-
'XoroTablet' => 'KidsPAD 701|PAD[ ]?712|PAD[ ]?714|PAD[ ]?716|PAD[ ]?717|PAD[ ]?718|PAD[ ]?720|PAD[ ]?721|PAD[ ]?722|PAD[ ]?790|PAD[ ]?792|PAD[ ]?900|PAD[ ]?9715D|PAD[ ]?9716DR|PAD[ ]?9718DR|PAD[ ]?9719QR|PAD[ ]?9720QR|TelePAD1030|Telepad1032|TelePAD730|TelePAD731|TelePAD732|TelePAD735Q|TelePAD830|TelePAD9730|TelePAD795|MegaPAD 1331|MegaPAD 1851|MegaPAD 2151',
|
414 |
-
// http://www1.viewsonic.com/products/computing/tablets/
|
415 |
-
'ViewsonicTablet' => 'ViewPad 10pi|ViewPad 10e|ViewPad 10s|ViewPad E72|ViewPad7|ViewPad E100|ViewPad 7e|ViewSonic VB733|VB100a',
|
416 |
-
// http://www.odys.de/web/internet-tablet_en.html
|
417 |
-
'OdysTablet' => 'LOOX|XENO10|ODYS[ -](Space|EVO|Xpress|NOON)|\bXELIO\b|Xelio10Pro|XELIO7PHONETAB|XELIO10EXTREME|XELIOPT2|NEO_QUAD10',
|
418 |
-
// http://www.captiva-power.de/products.html#tablets-en
|
419 |
-
'CaptivaTablet' => 'CAPTIVA PAD',
|
420 |
-
// IconBIT - http://www.iconbit.com/products/tablets/
|
421 |
-
'IconbitTablet' => 'NetTAB|NT-3702|NT-3702S|NT-3702S|NT-3603P|NT-3603P|NT-0704S|NT-0704S|NT-3805C|NT-3805C|NT-0806C|NT-0806C|NT-0909T|NT-0909T|NT-0907S|NT-0907S|NT-0902S|NT-0902S',
|
422 |
-
// http://www.teclast.com/topic.php?channelID=70&topicID=140&pid=63
|
423 |
-
'TeclastTablet' => 'T98 4G|\bP80\b|\bX90HD\b|X98 Air|X98 Air 3G|\bX89\b|P80 3G|\bX80h\b|P98 Air|\bX89HD\b|P98 3G|\bP90HD\b|P89 3G|X98 3G|\bP70h\b|P79HD 3G|G18d 3G|\bP79HD\b|\bP89s\b|\bA88\b|\bP10HD\b|\bP19HD\b|G18 3G|\bP78HD\b|\bA78\b|\bP75\b|G17s 3G|G17h 3G|\bP85t\b|\bP90\b|\bP11\b|\bP98t\b|\bP98HD\b|\bG18d\b|\bP85s\b|\bP11HD\b|\bP88s\b|\bA80HD\b|\bA80se\b|\bA10h\b|\bP89\b|\bP78s\b|\bG18\b|\bP85\b|\bA70h\b|\bA70\b|\bG17\b|\bP18\b|\bA80s\b|\bA11s\b|\bP88HD\b|\bA80h\b|\bP76s\b|\bP76h\b|\bP98\b|\bA10HD\b|\bP78\b|\bP88\b|\bA11\b|\bA10t\b|\bP76a\b|\bP76t\b|\bP76e\b|\bP85HD\b|\bP85a\b|\bP86\b|\bP75HD\b|\bP76v\b|\bA12\b|\bP75a\b|\bA15\b|\bP76Ti\b|\bP81HD\b|\bA10\b|\bT760VE\b|\bT720HD\b|\bP76\b|\bP73\b|\bP71\b|\bP72\b|\bT720SE\b|\bC520Ti\b|\bT760\b|\bT720VE\b|T720-3GE|T720-WiFi',
|
424 |
-
// Onda - http://www.onda-tablet.com/buy-android-onda.html?dir=desc&limit=all&order=price
|
425 |
-
'OndaTablet' => '\b(V975i|Vi30|VX530|V701|Vi60|V701s|Vi50|V801s|V719|Vx610w|VX610W|V819i|Vi10|VX580W|Vi10|V711s|V813|V811|V820w|V820|Vi20|V711|VI30W|V712|V891w|V972|V819w|V820w|Vi60|V820w|V711|V813s|V801|V819|V975s|V801|V819|V819|V818|V811|V712|V975m|V101w|V961w|V812|V818|V971|V971s|V919|V989|V116w|V102w|V973|Vi40)\b[\s]+',
|
426 |
-
'JaytechTablet' => 'TPC-PA762',
|
427 |
-
'BlaupunktTablet' => 'Endeavour 800NG|Endeavour 1010',
|
428 |
-
// http://www.digma.ru/support/download/
|
429 |
-
// @todo: Ebooks also (if requested)
|
430 |
-
'DigmaTablet' => '\b(iDx10|iDx9|iDx8|iDx7|iDxD7|iDxD8|iDsQ8|iDsQ7|iDsQ8|iDsD10|iDnD7|3TS804H|iDsQ11|iDj7|iDs10)\b',
|
431 |
-
// http://www.evolioshop.com/ro/tablete-pc.html
|
432 |
-
// http://www.evolio.ro/support/downloads_static.html?cat=2
|
433 |
-
// @todo: Research some more
|
434 |
-
'EvolioTablet' => 'ARIA_Mini_wifi|Aria[ _]Mini|Evolio X10|Evolio X7|Evolio X8|\bEvotab\b|\bNeura\b',
|
435 |
-
// @todo http://www.lavamobiles.com/tablets-data-cards
|
436 |
-
'LavaTablet' => 'QPAD E704|\bIvoryS\b|E-TAB IVORY|\bE-TAB\b',
|
437 |
-
'AocTablet' => 'MW0811|MW0812|MW0922|MTK8382',
|
438 |
-
// https://www.celkonmobiles.com/?_a=categoryphones&sid=2
|
439 |
-
'CelkonTablet' => 'CT695|CT888|CT[\s]?910|CT7 Tab|CT9 Tab|CT3 Tab|CT2 Tab|CT1 Tab|C820|C720|\bCT-1\b',
|
440 |
-
// http://www.wolderelectronics.com/productos/manuales-y-guias-rapidas/categoria-2-miTab
|
441 |
-
'WolderTablet' => 'miTab \b(DIAMOND|SPACE|BROOKLYN|NEO|FLY|MANHATTAN|FUNK|EVOLUTION|SKY|GOCAR|IRON|GENIUS|POP|MINT|EPSILON|BROADWAY|JUMP|HOP|LEGEND|NEW AGE|LINE|ADVANCE|FEEL|FOLLOW|LIKE|LINK|LIVE|THINK|FREEDOM|CHICAGO|CLEVELAND|BALTIMORE-GH|IOWA|BOSTON|SEATTLE|PHOENIX|DALLAS|IN 101|MasterChef)\b',
|
442 |
-
// http://www.mi.com/en
|
443 |
-
'MiTablet' => '\bMI PAD\b|\bHM NOTE 1W\b',
|
444 |
-
// http://www.nbru.cn/index.html
|
445 |
-
'NibiruTablet' => 'Nibiru M1|Nibiru Jupiter One',
|
446 |
-
// http://navroad.com/products/produkty/tablety/
|
447 |
-
'NexoTablet' => 'NEXO NOVA|NEXO 10|NEXO AVIO|NEXO FREE|NEXO GO|NEXO EVO|NEXO 3G|NEXO SMART|NEXO KIDDO|NEXO MOBI',
|
448 |
-
// http://leader-online.com/new_site/product-category/tablets/
|
449 |
-
// http://www.leader-online.net.au/List/Tablet
|
450 |
-
'LeaderTablet' => 'TBLT10Q|TBLT10I|TBL-10WDKB|TBL-10WDKBO2013|TBL-W230V2|TBL-W450|TBL-W500|SV572|TBLT7I|TBA-AC7-8G|TBLT79|TBL-8W16|TBL-10W32|TBL-10WKB|TBL-W100',
|
451 |
-
// http://www.datawind.com/ubislate/
|
452 |
-
'UbislateTablet' => 'UbiSlate[\s]?7C',
|
453 |
-
// http://www.pocketbook-int.com/ru/support
|
454 |
-
'PocketBookTablet' => 'Pocketbook',
|
455 |
-
// http://www.tesco.com/direct/hudl/
|
456 |
-
'Hudl' => 'Hudl HT7S3|Hudl 2',
|
457 |
-
// http://www.telstra.com.au/home-phone/thub-2/
|
458 |
-
'TelstraTablet' => 'T-Hub2',
|
459 |
-
'GenericTablet' => 'Android.*\b97D\b|Tablet(?!.*PC)|BNTV250A|MID-WCDMA|LogicPD Zoom2|\bA7EB\b|CatNova8|A1_07|CT704|CT1002|\bM721\b|rk30sdk|\bEVOTAB\b|M758A|ET904|ALUMIUM10|Smartfren Tab|Endeavour 1010|Tablet-PC-4|Tagi Tab|\bM6pro\b|CT1020W|arc 10HD|\bJolla\b|\bTP750\b'
|
460 |
-
);
|
461 |
-
|
462 |
-
/**
|
463 |
-
* List of mobile Operating Systems.
|
464 |
-
*
|
465 |
-
* @var array
|
466 |
-
*/
|
467 |
-
protected static $operatingSystems = array(
|
468 |
-
'AndroidOS' => 'Android',
|
469 |
-
'BlackBerryOS' => 'blackberry|\bBB10\b|rim tablet os',
|
470 |
-
'PalmOS' => 'PalmOS|avantgo|blazer|elaine|hiptop|palm|plucker|xiino',
|
471 |
-
'SymbianOS' => 'Symbian|SymbOS|Series60|Series40|SYB-[0-9]+|\bS60\b',
|
472 |
-
// @reference: http://en.wikipedia.org/wiki/Windows_Mobile
|
473 |
-
'WindowsMobileOS' => 'Windows CE.*(PPC|Smartphone|Mobile|[0-9]{3}x[0-9]{3})|Window Mobile|Windows Phone [0-9.]+|WCE;',
|
474 |
-
// @reference: http://en.wikipedia.org/wiki/Windows_Phone
|
475 |
-
// http://wifeng.cn/?r=blog&a=view&id=106
|
476 |
-
// http://nicksnettravels.builttoroam.com/post/2011/01/10/Bogus-Windows-Phone-7-User-Agent-String.aspx
|
477 |
-
// http://msdn.microsoft.com/library/ms537503.aspx
|
478 |
-
// https://msdn.microsoft.com/en-us/library/hh869301(v=vs.85).aspx
|
479 |
-
'WindowsPhoneOS' => 'Windows Phone 10.0|Windows Phone 8.1|Windows Phone 8.0|Windows Phone OS|XBLWP7|ZuneWP7|Windows NT 6.[23]; ARM;',
|
480 |
-
'iOS' => '\biPhone.*Mobile|\biPod|\biPad',
|
481 |
-
// http://en.wikipedia.org/wiki/MeeGo
|
482 |
-
// @todo: research MeeGo in UAs
|
483 |
-
'MeeGoOS' => 'MeeGo',
|
484 |
-
// http://en.wikipedia.org/wiki/Maemo
|
485 |
-
// @todo: research Maemo in UAs
|
486 |
-
'MaemoOS' => 'Maemo',
|
487 |
-
'JavaOS' => 'J2ME/|\bMIDP\b|\bCLDC\b', // '|Java/' produces bug #135
|
488 |
-
'webOS' => 'webOS|hpwOS',
|
489 |
-
'badaOS' => '\bBada\b',
|
490 |
-
'BREWOS' => 'BREW',
|
491 |
-
);
|
492 |
-
|
493 |
-
/**
|
494 |
-
* List of mobile User Agents.
|
495 |
-
*
|
496 |
-
* @var array
|
497 |
-
*/
|
498 |
-
protected static $browsers = array(
|
499 |
-
// @reference: https://developers.google.com/chrome/mobile/docs/user-agent
|
500 |
-
'Chrome' => '\bCrMo\b|CriOS|Android.*Chrome/[.0-9]* (Mobile)?',
|
501 |
-
'Dolfin' => '\bDolfin\b',
|
502 |
-
'Opera' => 'Opera.*Mini|Opera.*Mobi|Android.*Opera|Mobile.*OPR/[0-9.]+|Coast/[0-9.]+',
|
503 |
-
'Skyfire' => 'Skyfire',
|
504 |
-
'IE' => 'IEMobile|MSIEMobile', // |Trident/[.0-9]+
|
505 |
-
'Firefox' => 'fennec|firefox.*maemo|(Mobile|Tablet).*Firefox|Firefox.*Mobile',
|
506 |
-
'Bolt' => 'bolt',
|
507 |
-
'TeaShark' => 'teashark',
|
508 |
-
'Blazer' => 'Blazer',
|
509 |
-
// @reference: http://developer.apple.com/library/safari/#documentation/AppleApplications/Reference/SafariWebContent/OptimizingforSafarioniPhone/OptimizingforSafarioniPhone.html#//apple_ref/doc/uid/TP40006517-SW3
|
510 |
-
'Safari' => 'Version.*Mobile.*Safari|Safari.*Mobile|MobileSafari',
|
511 |
-
// http://en.wikipedia.org/wiki/Midori_(web_browser)
|
512 |
-
//'Midori' => 'midori',
|
513 |
-
'Tizen' => 'Tizen',
|
514 |
-
'UCBrowser' => 'UC.*Browser|UCWEB',
|
515 |
-
'baiduboxapp' => 'baiduboxapp',
|
516 |
-
'baidubrowser' => 'baidubrowser',
|
517 |
-
// https://github.com/serbanghita/Mobile-Detect/issues/7
|
518 |
-
'DiigoBrowser' => 'DiigoBrowser',
|
519 |
-
// http://www.puffinbrowser.com/index.php
|
520 |
-
'Puffin' => 'Puffin',
|
521 |
-
// http://mercury-browser.com/index.html
|
522 |
-
'Mercury' => '\bMercury\b',
|
523 |
-
// http://en.wikipedia.org/wiki/Obigo_Browser
|
524 |
-
'ObigoBrowser' => 'Obigo',
|
525 |
-
// http://en.wikipedia.org/wiki/NetFront
|
526 |
-
'NetFront' => 'NF-Browser',
|
527 |
-
// @reference: http://en.wikipedia.org/wiki/Minimo
|
528 |
-
// http://en.wikipedia.org/wiki/Vision_Mobile_Browser
|
529 |
-
'GenericBrowser' => 'NokiaBrowser|OviBrowser|OneBrowser|TwonkyBeamBrowser|SEMC.*Browser|FlyFlow|Minimo|NetFront|Novarra-Vision|MQQBrowser|MicroMessenger',
|
530 |
-
);
|
531 |
-
|
532 |
-
/**
|
533 |
-
* Utilities.
|
534 |
-
*
|
535 |
-
* @var array
|
536 |
-
*/
|
537 |
-
protected static $utilities = array(
|
538 |
-
// Experimental. When a mobile device wants to switch to 'Desktop Mode'.
|
539 |
-
// http://scottcate.com/technology/windows-phone-8-ie10-desktop-or-mobile/
|
540 |
-
// https://github.com/serbanghita/Mobile-Detect/issues/57#issuecomment-15024011
|
541 |
-
// https://developers.facebook.com/docs/sharing/best-practices
|
542 |
-
'Bot' => 'Googlebot|facebookexternalhit|AdsBot-Google|Google Keyword Suggestion|Facebot|YandexBot|bingbot|ia_archiver|AhrefsBot|Ezooms|GSLFbot|WBSearchBot|Twitterbot|TweetmemeBot|Twikle|PaperLiBot|Wotbox|UnwindFetchor|Exabot|MJ12bot|YandexImages|TurnitinBot|Pingdom',
|
543 |
-
'MobileBot' => 'Googlebot-Mobile|AdsBot-Google-Mobile|YahooSeeker/M1A1-R2D2',
|
544 |
-
'DesktopMode' => 'WPDesktop',
|
545 |
-
'TV' => 'SonyDTV|HbbTV', // experimental
|
546 |
-
'WebKit' => '(webkit)[ /]([\w.]+)',
|
547 |
-
// @todo: Include JXD consoles.
|
548 |
-
'Console' => '\b(Nintendo|Nintendo WiiU|Nintendo 3DS|PLAYSTATION|Xbox)\b',
|
549 |
-
'Watch' => 'SM-V700',
|
550 |
-
);
|
551 |
-
|
552 |
-
/**
|
553 |
-
* All possible HTTP headers that represent the
|
554 |
-
* User-Agent string.
|
555 |
-
*
|
556 |
-
* @var array
|
557 |
-
*/
|
558 |
-
protected static $uaHttpHeaders = array(
|
559 |
-
// The default User-Agent string.
|
560 |
-
'HTTP_USER_AGENT',
|
561 |
-
// Header can occur on devices using Opera Mini.
|
562 |
-
'HTTP_X_OPERAMINI_PHONE_UA',
|
563 |
-
// Vodafone specific header: http://www.seoprinciple.com/mobile-web-community-still-angry-at-vodafone/24/
|
564 |
-
'HTTP_X_DEVICE_USER_AGENT',
|
565 |
-
'HTTP_X_ORIGINAL_USER_AGENT',
|
566 |
-
'HTTP_X_SKYFIRE_PHONE',
|
567 |
-
'HTTP_X_BOLT_PHONE_UA',
|
568 |
-
'HTTP_DEVICE_STOCK_UA',
|
569 |
-
'HTTP_X_UCBROWSER_DEVICE_UA'
|
570 |
-
);
|
571 |
-
|
572 |
-
/**
|
573 |
-
* The individual segments that could exist in a User-Agent string. VER refers to the regular
|
574 |
-
* expression defined in the constant self::VER.
|
575 |
-
*
|
576 |
-
* @var array
|
577 |
-
*/
|
578 |
-
protected static $properties = array(
|
579 |
-
|
580 |
-
// Build
|
581 |
-
'Mobile' => 'Mobile/[VER]',
|
582 |
-
'Build' => 'Build/[VER]',
|
583 |
-
'Version' => 'Version/[VER]',
|
584 |
-
'VendorID' => 'VendorID/[VER]',
|
585 |
-
|
586 |
-
// Devices
|
587 |
-
'iPad' => 'iPad.*CPU[a-z ]+[VER]',
|
588 |
-
'iPhone' => 'iPhone.*CPU[a-z ]+[VER]',
|
589 |
-
'iPod' => 'iPod.*CPU[a-z ]+[VER]',
|
590 |
-
//'BlackBerry' => array('BlackBerry[VER]', 'BlackBerry [VER];'),
|
591 |
-
'Kindle' => 'Kindle/[VER]',
|
592 |
-
|
593 |
-
// Browser
|
594 |
-
'Chrome' => array('Chrome/[VER]', 'CriOS/[VER]', 'CrMo/[VER]'),
|
595 |
-
'Coast' => array('Coast/[VER]'),
|
596 |
-
'Dolfin' => 'Dolfin/[VER]',
|
597 |
-
// @reference: https://developer.mozilla.org/en-US/docs/User_Agent_Strings_Reference
|
598 |
-
'Firefox' => 'Firefox/[VER]',
|
599 |
-
'Fennec' => 'Fennec/[VER]',
|
600 |
-
// http://msdn.microsoft.com/en-us/library/ms537503(v=vs.85).aspx
|
601 |
-
// https://msdn.microsoft.com/en-us/library/ie/hh869301(v=vs.85).aspx
|
602 |
-
'IE' => array('IEMobile/[VER];', 'IEMobile [VER]', 'MSIE [VER];', 'Trident/[0-9.]+;.*rv:[VER]'),
|
603 |
-
// http://en.wikipedia.org/wiki/NetFront
|
604 |
-
'NetFront' => 'NetFront/[VER]',
|
605 |
-
'NokiaBrowser' => 'NokiaBrowser/[VER]',
|
606 |
-
'Opera' => array( ' OPR/[VER]', 'Opera Mini/[VER]', 'Version/[VER]' ),
|
607 |
-
'Opera Mini' => 'Opera Mini/[VER]',
|
608 |
-
'Opera Mobi' => 'Version/[VER]',
|
609 |
-
'UC Browser' => 'UC Browser[VER]',
|
610 |
-
'MQQBrowser' => 'MQQBrowser/[VER]',
|
611 |
-
'MicroMessenger' => 'MicroMessenger/[VER]',
|
612 |
-
'baiduboxapp' => 'baiduboxapp/[VER]',
|
613 |
-
'baidubrowser' => 'baidubrowser/[VER]',
|
614 |
-
'Iron' => 'Iron/[VER]',
|
615 |
-
// @note: Safari 7534.48.3 is actually Version 5.1.
|
616 |
-
// @note: On BlackBerry the Version is overwriten by the OS.
|
617 |
-
'Safari' => array( 'Version/[VER]', 'Safari/[VER]' ),
|
618 |
-
'Skyfire' => 'Skyfire/[VER]',
|
619 |
-
'Tizen' => 'Tizen/[VER]',
|
620 |
-
'Webkit' => 'webkit[ /][VER]',
|
621 |
-
|
622 |
-
// Engine
|
623 |
-
'Gecko' => 'Gecko/[VER]',
|
624 |
-
'Trident' => 'Trident/[VER]',
|
625 |
-
'Presto' => 'Presto/[VER]',
|
626 |
-
|
627 |
-
// OS
|
628 |
-
'iOS' => ' \bi?OS\b [VER][ ;]{1}',
|
629 |
-
'Android' => 'Android [VER]',
|
630 |
-
'BlackBerry' => array('BlackBerry[\w]+/[VER]', 'BlackBerry.*Version/[VER]', 'Version/[VER]'),
|
631 |
-
'BREW' => 'BREW [VER]',
|
632 |
-
'Java' => 'Java/[VER]',
|
633 |
-
// @reference: http://windowsteamblog.com/windows_phone/b/wpdev/archive/2011/08/29/introducing-the-ie9-on-windows-phone-mango-user-agent-string.aspx
|
634 |
-
// @reference: http://en.wikipedia.org/wiki/Windows_NT#Releases
|
635 |
-
'Windows Phone OS' => array( 'Windows Phone OS [VER]', 'Windows Phone [VER]'),
|
636 |
-
'Windows Phone' => 'Windows Phone [VER]',
|
637 |
-
'Windows CE' => 'Windows CE/[VER]',
|
638 |
-
// http://social.msdn.microsoft.com/Forums/en-US/windowsdeveloperpreviewgeneral/thread/6be392da-4d2f-41b4-8354-8dcee20c85cd
|
639 |
-
'Windows NT' => 'Windows NT [VER]',
|
640 |
-
'Symbian' => array('SymbianOS/[VER]', 'Symbian/[VER]'),
|
641 |
-
'webOS' => array('webOS/[VER]', 'hpwOS/[VER];'),
|
642 |
-
);
|
643 |
-
|
644 |
-
/**
|
645 |
-
* Construct an instance of this class.
|
646 |
-
*
|
647 |
-
* @param array $headers Specify the headers as injection. Should be PHP _SERVER flavored.
|
648 |
-
* If left empty, will use the global _SERVER['HTTP_*'] vars instead.
|
649 |
-
* @param string $userAgent Inject the User-Agent header. If null, will use HTTP_USER_AGENT
|
650 |
-
* from the $headers array instead.
|
651 |
-
*/
|
652 |
-
public function __construct(
|
653 |
-
array $headers = null,
|
654 |
-
$userAgent = null
|
655 |
-
) {
|
656 |
-
$this->setHttpHeaders($headers);
|
657 |
-
$this->setUserAgent($userAgent);
|
658 |
-
}
|
659 |
-
|
660 |
-
/**
|
661 |
-
* Get the current script version.
|
662 |
-
* This is useful for the demo.php file,
|
663 |
-
* so people can check on what version they are testing
|
664 |
-
* for mobile devices.
|
665 |
-
*
|
666 |
-
* @return string The version number in semantic version format.
|
667 |
-
*/
|
668 |
-
public static function getScriptVersion()
|
669 |
-
{
|
670 |
-
return self::VERSION;
|
671 |
-
}
|
672 |
-
|
673 |
-
/**
|
674 |
-
* Set the HTTP Headers. Must be PHP-flavored. This method will reset existing headers.
|
675 |
-
*
|
676 |
-
* @param array $httpHeaders The headers to set. If null, then using PHP's _SERVER to extract
|
677 |
-
* the headers. The default null is left for backwards compatibilty.
|
678 |
-
*/
|
679 |
-
public function setHttpHeaders(
|
680 |
-
{
|
681 |
-
// use global _SERVER if $httpHeaders aren't defined
|
682 |
-
if (!is_array($httpHeaders) || !count($httpHeaders)) {
|
683 |
-
$httpHeaders = $_SERVER;
|
684 |
-
}
|
685 |
-
|
686 |
-
// clear existing headers
|
687 |
-
$this->httpHeaders = array();
|
688 |
-
|
689 |
-
// Only save HTTP headers. In PHP land, that means only _SERVER vars that
|
690 |
-
// start with HTTP_.
|
691 |
-
foreach ($httpHeaders as $key => $value) {
|
692 |
-
if (substr($key, 0, 5) === 'HTTP_') {
|
693 |
-
$this->httpHeaders[$key] = $value;
|
694 |
-
}
|
695 |
-
}
|
696 |
-
|
697 |
-
// In case we're dealing with CloudFront, we need to know.
|
698 |
-
$this->setCfHeaders($httpHeaders);
|
699 |
-
}
|
700 |
-
|
701 |
-
/**
|
702 |
-
* Retrieves the HTTP headers.
|
703 |
-
*
|
704 |
-
* @return array
|
705 |
-
*/
|
706 |
-
public function getHttpHeaders()
|
707 |
-
{
|
708 |
-
return $this->httpHeaders;
|
709 |
-
}
|
710 |
-
|
711 |
-
/**
|
712 |
-
* Retrieves a particular header. If it doesn't exist, no exception/error is caused.
|
713 |
-
* Simply null is returned.
|
714 |
-
*
|
715 |
-
* @param string $header The name of the header to retrieve. Can be HTTP compliant such as
|
716 |
-
* "User-Agent" or "X-Device-User-Agent" or can be php-esque with the
|
717 |
-
* all-caps, HTTP_ prefixed, underscore seperated awesomeness.
|
718 |
-
*
|
719 |
-
* @return string|null The value of the header.
|
720 |
-
*/
|
721 |
-
public function getHttpHeader($header)
|
722 |
-
{
|
723 |
-
// are we using PHP-flavored headers?
|
724 |
-
if (strpos($header, '_') === false) {
|
725 |
-
$header = str_replace('-', '_', $header);
|
726 |
-
$header = strtoupper($header);
|
727 |
-
}
|
728 |
-
|
729 |
-
// test the alternate, too
|
730 |
-
$altHeader = 'HTTP_' . $header;
|
731 |
-
|
732 |
-
//Test both the regular and the HTTP_ prefix
|
733 |
-
if (isset($this->httpHeaders[$header])) {
|
734 |
-
return $this->httpHeaders[$header];
|
735 |
-
} elseif (isset($this->httpHeaders[$altHeader])) {
|
736 |
-
return $this->httpHeaders[$altHeader];
|
737 |
-
}
|
738 |
-
|
739 |
-
return null;
|
740 |
-
}
|
741 |
-
|
742 |
-
public function getMobileHeaders()
|
743 |
-
{
|
744 |
-
return self::$mobileHeaders;
|
745 |
-
}
|
746 |
-
|
747 |
-
/**
|
748 |
-
* Get all possible HTTP headers that
|
749 |
-
* can contain the User-Agent string.
|
750 |
-
*
|
751 |
-
* @return array List of HTTP headers.
|
752 |
-
*/
|
753 |
-
public function getUaHttpHeaders()
|
754 |
-
{
|
755 |
-
return self::$uaHttpHeaders;
|
756 |
-
}
|
757 |
-
|
758 |
-
|
759 |
-
/**
|
760 |
-
* Set CloudFront headers
|
761 |
-
* http://docs.aws.amazon.com/AmazonCloudFront/latest/DeveloperGuide/header-caching.html#header-caching-web-device
|
762 |
-
*
|
763 |
-
* @param array $cfHeaders List of HTTP headers
|
764 |
-
*
|
765 |
-
* @return boolean If there were CloudFront headers to be set
|
766 |
-
*/
|
767 |
-
public function setCfHeaders($cfHeaders = null) {
|
768 |
-
// use global _SERVER if $cfHeaders aren't defined
|
769 |
-
if (!is_array($cfHeaders) || !count($cfHeaders)) {
|
770 |
-
$cfHeaders = $_SERVER;
|
771 |
-
}
|
772 |
-
|
773 |
-
// clear existing headers
|
774 |
-
$this->cloudfrontHeaders = array();
|
775 |
-
|
776 |
-
// Only save CLOUDFRONT headers. In PHP land, that means only _SERVER vars that
|
777 |
-
// start with cloudfront-.
|
778 |
-
$response = false;
|
779 |
-
foreach ($cfHeaders as $key => $value) {
|
780 |
-
if (substr(strtolower($key), 0, 16) === 'http_cloudfront_') {
|
781 |
-
$this->cloudfrontHeaders[strtoupper($key)] = $value;
|
782 |
-
$response = true;
|
783 |
-
}
|
784 |
-
}
|
785 |
-
|
786 |
-
return $response;
|
787 |
-
}
|
788 |
-
|
789 |
-
/**
|
790 |
-
* Retrieves the cloudfront headers.
|
791 |
-
*
|
792 |
-
* @return array
|
793 |
-
*/
|
794 |
-
public function getCfHeaders()
|
795 |
-
{
|
796 |
-
return $this->cloudfrontHeaders;
|
797 |
-
}
|
798 |
-
|
799 |
-
/**
|
800 |
-
* Set the User-Agent to be used.
|
801 |
-
*
|
802 |
-
* @param string $userAgent The user agent string to set.
|
803 |
-
*
|
804 |
-
* @return string|null
|
805 |
-
*/
|
806 |
-
public function setUserAgent($userAgent = null)
|
807 |
-
{
|
808 |
-
// Invalidate cache due to #375
|
809 |
-
$this->cache = array();
|
810 |
-
|
811 |
-
if (false === empty($userAgent)) {
|
812 |
-
return $this->userAgent = $userAgent;
|
813 |
-
} else {
|
814 |
-
$this->userAgent = null;
|
815 |
-
foreach ($this->getUaHttpHeaders() as $altHeader) {
|
816 |
-
if (false === empty($this->httpHeaders[$altHeader])) { // @todo: should use getHttpHeader(), but it would be slow. (Serban)
|
817 |
-
$this->userAgent .= $this->httpHeaders[$altHeader] . " ";
|
818 |
-
}
|
819 |
-
}
|
820 |
-
|
821 |
-
if (!empty($this->userAgent)) {
|
822 |
-
return $this->userAgent = trim($this->userAgent);
|
823 |
-
}
|
824 |
-
}
|
825 |
-
|
826 |
-
if (count($this->getCfHeaders()) > 0) {
|
827 |
-
return $this->userAgent = 'Amazon CloudFront';
|
828 |
-
}
|
829 |
-
return $this->userAgent = null;
|
830 |
-
}
|
831 |
-
|
832 |
-
/**
|
833 |
-
* Retrieve the User-Agent.
|
834 |
-
*
|
835 |
-
* @return string|null The user agent if it's set.
|
836 |
-
*/
|
837 |
-
public function getUserAgent()
|
838 |
-
{
|
839 |
-
return $this->userAgent;
|
840 |
-
}
|
841 |
-
|
842 |
-
/**
|
843 |
-
* Set the detection type. Must be one of self::DETECTION_TYPE_MOBILE or
|
844 |
-
* self::DETECTION_TYPE_EXTENDED. Otherwise, nothing is set.
|
845 |
-
*
|
846 |
-
* @deprecated since version 2.6.9
|
847 |
-
*
|
848 |
-
* @param string $type The type. Must be a self::DETECTION_TYPE_* constant. The default
|
849 |
-
* parameter is null which will default to self::DETECTION_TYPE_MOBILE.
|
850 |
-
*/
|
851 |
-
public function setDetectionType($type = null)
|
852 |
-
{
|
853 |
-
if ($type === null) {
|
854 |
-
$type = self::DETECTION_TYPE_MOBILE;
|
855 |
-
}
|
856 |
-
|
857 |
-
if ($type !== self::DETECTION_TYPE_MOBILE && $type !== self::DETECTION_TYPE_EXTENDED) {
|
858 |
-
return;
|
859 |
-
}
|
860 |
-
|
861 |
-
$this->detectionType = $type;
|
862 |
-
}
|
863 |
-
|
864 |
-
public function getMatchingRegex()
|
865 |
-
{
|
866 |
-
return $this->matchingRegex;
|
867 |
-
}
|
868 |
-
|
869 |
-
public function getMatchesArray()
|
870 |
-
{
|
871 |
-
return $this->matchesArray;
|
872 |
-
}
|
873 |
-
|
874 |
-
/**
|
875 |
-
* Retrieve the list of known phone devices.
|
876 |
-
*
|
877 |
-
* @return array List of phone devices.
|
878 |
-
*/
|
879 |
-
public static function getPhoneDevices()
|
880 |
-
{
|
881 |
-
return self::$phoneDevices;
|
882 |
-
}
|
883 |
-
|
884 |
-
/**
|
885 |
-
* Retrieve the list of known tablet devices.
|
886 |
-
*
|
887 |
-
* @return array List of tablet devices.
|
888 |
-
*/
|
889 |
-
public static function getTabletDevices()
|
890 |
-
{
|
891 |
-
return self::$tabletDevices;
|
892 |
-
}
|
893 |
-
|
894 |
-
/**
|
895 |
-
* Alias for getBrowsers() method.
|
896 |
-
*
|
897 |
-
* @return array List of user agents.
|
898 |
-
*/
|
899 |
-
public static function getUserAgents()
|
900 |
-
{
|
901 |
-
return self::getBrowsers();
|
902 |
-
}
|
903 |
-
|
904 |
-
/**
|
905 |
-
* Retrieve the list of known browsers. Specifically, the user agents.
|
906 |
-
*
|
907 |
-
* @return array List of browsers / user agents.
|
908 |
-
*/
|
909 |
-
public static function getBrowsers()
|
910 |
-
{
|
911 |
-
return self::$browsers;
|
912 |
-
}
|
913 |
-
|
914 |
-
/**
|
915 |
-
* Retrieve the list of known utilities.
|
916 |
-
*
|
917 |
-
* @return array List of utilities.
|
918 |
-
*/
|
919 |
-
public static function getUtilities()
|
920 |
-
{
|
921 |
-
return self::$utilities;
|
922 |
-
}
|
923 |
-
|
924 |
-
/**
|
925 |
-
* Method gets the mobile detection rules. This method is used for the magic methods $detect->is*().
|
926 |
-
*
|
927 |
-
* @deprecated since version 2.6.9
|
928 |
-
*
|
929 |
-
* @return array All the rules (but not extended).
|
930 |
-
*/
|
931 |
-
public static function getMobileDetectionRules()
|
932 |
-
{
|
933 |
-
static $rules;
|
934 |
-
|
935 |
-
if (!$rules) {
|
936 |
-
$rules = array_merge(
|
937 |
-
self::$phoneDevices,
|
938 |
-
self::$tabletDevices,
|
939 |
-
self::$operatingSystems,
|
940 |
-
self::$browsers
|
941 |
-
);
|
942 |
-
}
|
943 |
-
|
944 |
-
return $rules;
|
945 |
-
|
946 |
-
}
|
947 |
-
|
948 |
-
/**
|
949 |
-
* Method gets the mobile detection rules + utilities.
|
950 |
-
* The reason this is separate is because utilities rules
|
951 |
-
* don't necessary imply mobile. This method is used inside
|
952 |
-
* the new $detect->is('stuff') method.
|
953 |
-
*
|
954 |
-
* @deprecated since version 2.6.9
|
955 |
-
*
|
956 |
-
* @return array All the rules + extended.
|
957 |
-
*/
|
958 |
-
public function getMobileDetectionRulesExtended()
|
959 |
-
{
|
960 |
-
static $rules;
|
961 |
-
|
962 |
-
if (!$rules) {
|
963 |
-
// Merge all rules together.
|
964 |
-
$rules = array_merge(
|
965 |
-
self::$phoneDevices,
|
966 |
-
self::$tabletDevices,
|
967 |
-
self::$operatingSystems,
|
968 |
-
self::$browsers,
|
969 |
-
self::$utilities
|
970 |
-
);
|
971 |
-
}
|
972 |
-
|
973 |
-
return $rules;
|
974 |
-
}
|
975 |
-
|
976 |
-
/**
|
977 |
-
* Retrieve the current set of rules.
|
978 |
-
*
|
979 |
-
* @deprecated since version 2.6.9
|
980 |
-
*
|
981 |
-
* @return array
|
982 |
-
*/
|
983 |
-
public function getRules()
|
984 |
-
{
|
985 |
-
if ($this->detectionType == self::DETECTION_TYPE_EXTENDED) {
|
986 |
-
return self::getMobileDetectionRulesExtended();
|
987 |
-
} else {
|
988 |
-
return self::getMobileDetectionRules();
|
989 |
-
}
|
990 |
-
}
|
991 |
-
|
992 |
-
/**
|
993 |
-
* Retrieve the list of mobile operating systems.
|
994 |
-
*
|
995 |
-
* @return array The list of mobile operating systems.
|
996 |
-
*/
|
997 |
-
public static function getOperatingSystems()
|
998 |
-
{
|
999 |
-
return self::$operatingSystems;
|
1000 |
-
}
|
1001 |
-
|
1002 |
-
/**
|
1003 |
-
* Check the HTTP headers for signs of mobile.
|
1004 |
-
* This is the fastest mobile check possible; it's used
|
1005 |
-
* inside isMobile() method.
|
1006 |
-
*
|
1007 |
-
* @return bool
|
1008 |
-
*/
|
1009 |
-
public function checkHttpHeadersForMobile()
|
1010 |
-
{
|
1011 |
-
|
1012 |
-
foreach ($this->getMobileHeaders() as $mobileHeader => $matchType) {
|
1013 |
-
if (isset($this->httpHeaders[$mobileHeader])) {
|
1014 |
-
if (is_array($matchType['matches'])) {
|
1015 |
-
foreach ($matchType['matches'] as $_match) {
|
1016 |
-
if (strpos($this->httpHeaders[$mobileHeader], $_match) !== false) {
|
1017 |
-
return true;
|
1018 |
-
}
|
1019 |
-
}
|
1020 |
-
|
1021 |
-
return false;
|
1022 |
-
} else {
|
1023 |
-
return true;
|
1024 |
-
}
|
1025 |
-
}
|
1026 |
-
}
|
1027 |
-
|
1028 |
-
return false;
|
1029 |
-
|
1030 |
-
}
|
1031 |
-
|
1032 |
-
/**
|
1033 |
-
* Magic overloading method.
|
1034 |
-
*
|
1035 |
-
* @method boolean is[...]()
|
1036 |
-
* @param string $name
|
1037 |
-
* @param array $arguments
|
1038 |
-
* @return mixed
|
1039 |
-
* @throws BadMethodCallException when the method doesn't exist and doesn't start with 'is'
|
1040 |
-
*/
|
1041 |
-
public function __call($name, $arguments)
|
1042 |
-
{
|
1043 |
-
// make sure the name starts with 'is', otherwise
|
1044 |
-
if (substr($name, 0, 2) !== 'is') {
|
1045 |
-
throw new BadMethodCallException("No such method exists: $name");
|
1046 |
-
}
|
1047 |
-
|
1048 |
-
$this->setDetectionType(self::DETECTION_TYPE_MOBILE);
|
1049 |
-
|
1050 |
-
$key = substr($name, 2);
|
1051 |
-
|
1052 |
-
return $this->matchUAAgainstKey($key);
|
1053 |
-
}
|
1054 |
-
|
1055 |
-
/**
|
1056 |
-
* Find a detection rule that matches the current User-agent.
|
1057 |
-
*
|
1058 |
-
* @param null $userAgent deprecated
|
1059 |
-
* @return boolean
|
1060 |
-
*/
|
1061 |
-
protected function matchDetectionRulesAgainstUA($userAgent = null)
|
1062 |
-
{
|
1063 |
-
// Begin general search.
|
1064 |
-
foreach ($this->getRules() as $_regex) {
|
1065 |
-
if (empty($_regex)) {
|
1066 |
-
continue;
|
1067 |
-
}
|
1068 |
-
|
1069 |
-
if ($this->match($_regex, $userAgent)) {
|
1070 |
-
return true;
|
1071 |
-
}
|
1072 |
-
}
|
1073 |
-
|
1074 |
-
return false;
|
1075 |
-
}
|
1076 |
-
|
1077 |
-
/**
|
1078 |
-
* Search for a certain key in the rules array.
|
1079 |
-
* If the key is found then try to match the corresponding
|
1080 |
-
* regex against the User-Agent.
|
1081 |
-
*
|
1082 |
-
* @param string $key
|
1083 |
-
*
|
1084 |
-
* @return boolean
|
1085 |
-
*/
|
1086 |
-
protected function matchUAAgainstKey($key)
|
1087 |
-
{
|
1088 |
-
// Make the keys lowercase so we can match: isIphone(), isiPhone(), isiphone(), etc.
|
1089 |
-
$key = strtolower($key);
|
1090 |
-
if (false === isset($this->cache[$key])) {
|
1091 |
-
|
1092 |
-
// change the keys to lower case
|
1093 |
-
$_rules = array_change_key_case($this->getRules());
|
1094 |
-
|
1095 |
-
if (false === empty($_rules[$key])) {
|
1096 |
-
$this->cache[$key] = $this->match($_rules[$key]);
|
1097 |
-
}
|
1098 |
-
|
1099 |
-
if (false === isset($this->cache[$key])) {
|
1100 |
-
$this->cache[$key] = false;
|
1101 |
-
}
|
1102 |
-
}
|
1103 |
-
|
1104 |
-
return $this->cache[$key];
|
1105 |
-
}
|
1106 |
-
|
1107 |
-
/**
|
1108 |
-
* Check if the device is mobile.
|
1109 |
-
* Returns true if any type of mobile device detected, including special ones
|
1110 |
-
* @param null $userAgent deprecated
|
1111 |
-
* @param null $httpHeaders deprecated
|
1112 |
-
* @return bool
|
1113 |
-
*/
|
1114 |
-
public function isMobile($userAgent = null, $httpHeaders = null)
|
1115 |
-
{
|
1116 |
-
|
1117 |
-
if ($httpHeaders) {
|
1118 |
-
$this->setHttpHeaders($httpHeaders);
|
1119 |
-
}
|
1120 |
-
|
1121 |
-
if ($userAgent) {
|
1122 |
-
$this->setUserAgent($userAgent);
|
1123 |
-
}
|
1124 |
-
|
1125 |
-
// Check specifically for cloudfront headers if the useragent === 'Amazon CloudFront'
|
1126 |
-
if ($this->getUserAgent() === 'Amazon CloudFront') {
|
1127 |
-
$cfHeaders = $this->getCfHeaders();
|
1128 |
-
if(array_key_exists('HTTP_CLOUDFRONT_IS_MOBILE_VIEWER', $cfHeaders) && $cfHeaders['HTTP_CLOUDFRONT_IS_MOBILE_VIEWER'] === 'true') {
|
1129 |
-
return true;
|
1130 |
-
}
|
1131 |
-
}
|
1132 |
-
|
1133 |
-
$this->setDetectionType(self::DETECTION_TYPE_MOBILE);
|
1134 |
-
|
1135 |
-
if ($this->checkHttpHeadersForMobile()) {
|
1136 |
-
return true;
|
1137 |
-
} else {
|
1138 |
-
return $this->matchDetectionRulesAgainstUA();
|
1139 |
-
}
|
1140 |
-
|
1141 |
-
}
|
1142 |
-
|
1143 |
-
/**
|
1144 |
-
* Check if the device is a tablet.
|
1145 |
-
* Return true if any type of tablet device is detected.
|
1146 |
-
*
|
1147 |
-
* @param string $userAgent deprecated
|
1148 |
-
* @param array $httpHeaders deprecated
|
1149 |
-
* @return bool
|
1150 |
-
*/
|
1151 |
-
public function isTablet($userAgent = null, $httpHeaders = null)
|
1152 |
-
{
|
1153 |
-
// Check specifically for cloudfront headers if the useragent === 'Amazon CloudFront'
|
1154 |
-
if ($this->getUserAgent() === 'Amazon CloudFront') {
|
1155 |
-
$cfHeaders = $this->getCfHeaders();
|
1156 |
-
if(array_key_exists('HTTP_CLOUDFRONT_IS_TABLET_VIEWER', $cfHeaders) && $cfHeaders['HTTP_CLOUDFRONT_IS_TABLET_VIEWER'] === 'true') {
|
1157 |
-
return true;
|
1158 |
-
}
|
1159 |
-
}
|
1160 |
-
|
1161 |
-
$this->setDetectionType(self::DETECTION_TYPE_MOBILE);
|
1162 |
-
|
1163 |
-
foreach (self::$tabletDevices as $_regex) {
|
1164 |
-
if ($this->match($_regex, $userAgent)) {
|
1165 |
-
return true;
|
1166 |
-
}
|
1167 |
-
}
|
1168 |
-
|
1169 |
-
return false;
|
1170 |
-
}
|
1171 |
-
|
1172 |
-
/**
|
1173 |
-
* This method checks for a certain property in the
|
1174 |
-
* userAgent.
|
1175 |
-
* @todo: The httpHeaders part is not yet used.
|
1176 |
-
*
|
1177 |
-
* @param string $key
|
1178 |
-
* @param string $userAgent deprecated
|
1179 |
-
* @param string $httpHeaders deprecated
|
1180 |
-
* @return bool|int|null
|
1181 |
-
*/
|
1182 |
-
public function is($key, $userAgent = null, $httpHeaders = null)
|
1183 |
-
{
|
1184 |
-
// Set the UA and HTTP headers only if needed (eg. batch mode).
|
1185 |
-
if ($httpHeaders) {
|
1186 |
-
$this->setHttpHeaders($httpHeaders);
|
1187 |
-
}
|
1188 |
-
|
1189 |
-
if ($userAgent) {
|
1190 |
-
$this->setUserAgent($userAgent);
|
1191 |
-
}
|
1192 |
-
|
1193 |
-
$this->setDetectionType(self::DETECTION_TYPE_EXTENDED);
|
1194 |
-
|
1195 |
-
return $this->matchUAAgainstKey($key);
|
1196 |
-
}
|
1197 |
-
|
1198 |
-
/**
|
1199 |
-
* Some detection rules are relative (not standard),
|
1200 |
-
* because of the diversity of devices, vendors and
|
1201 |
-
* their conventions in representing the User-Agent or
|
1202 |
-
* the HTTP headers.
|
1203 |
-
*
|
1204 |
-
* This method will be used to check custom regexes against
|
1205 |
-
* the User-Agent string.
|
1206 |
-
*
|
1207 |
-
* @param $regex
|
1208 |
-
* @param string $userAgent
|
1209 |
-
* @return bool
|
1210 |
-
*
|
1211 |
-
* @todo: search in the HTTP headers too.
|
1212 |
-
*/
|
1213 |
-
public function match($regex, $userAgent = null)
|
1214 |
-
{
|
1215 |
-
$match = (bool) preg_match(sprintf('#%s#is', $regex), (false === empty($userAgent) ? $userAgent : $this->userAgent), $matches);
|
1216 |
-
// If positive match is found, store the results for debug.
|
1217 |
-
if ($match) {
|
1218 |
-
$this->matchingRegex = $regex;
|
1219 |
-
$this->matchesArray = $matches;
|
1220 |
-
}
|
1221 |
-
|
1222 |
-
return $match;
|
1223 |
-
}
|
1224 |
-
|
1225 |
-
/**
|
1226 |
-
* Get the properties array.
|
1227 |
-
*
|
1228 |
-
* @return array
|
1229 |
-
*/
|
1230 |
-
public static function getProperties()
|
1231 |
-
{
|
1232 |
-
return self::$properties;
|
1233 |
-
}
|
1234 |
-
|
1235 |
-
/**
|
1236 |
-
* Prepare the version number.
|
1237 |
-
*
|
1238 |
-
* @todo Remove the error supression from str_replace() call.
|
1239 |
-
*
|
1240 |
-
* @param string $ver The string version, like "2.6.21.2152";
|
1241 |
-
*
|
1242 |
-
* @return float
|
1243 |
-
*/
|
1244 |
-
public function prepareVersionNo($ver)
|
1245 |
-
{
|
1246 |
-
$ver = str_replace(array('_', ' ', '/'), '.', $ver);
|
1247 |
-
$arrVer = explode('.', $ver, 2);
|
1248 |
-
|
1249 |
-
if (isset($arrVer[1])) {
|
1250 |
-
$arrVer[1] = @str_replace('.', '', $arrVer[1]); // @todo: treat strings versions.
|
1251 |
-
}
|
1252 |
-
|
1253 |
-
return (float) implode('.', $arrVer);
|
1254 |
-
}
|
1255 |
-
|
1256 |
-
/**
|
1257 |
-
* Check the version of the given property in the User-Agent.
|
1258 |
-
* Will return a float number. (eg. 2_0 will return 2.0, 4.3.1 will return 4.31)
|
1259 |
-
*
|
1260 |
-
* @param string $propertyName The name of the property. See self::getProperties() array
|
1261 |
-
* keys for all possible properties.
|
1262 |
-
* @param string $type Either self::VERSION_TYPE_STRING to get a string value or
|
1263 |
-
* self::VERSION_TYPE_FLOAT indicating a float value. This parameter
|
1264 |
-
* is optional and defaults to self::VERSION_TYPE_STRING. Passing an
|
1265 |
-
* invalid parameter will default to the this type as well.
|
1266 |
-
*
|
1267 |
-
* @return string|float The version of the property we are trying to extract.
|
1268 |
-
*/
|
1269 |
-
public function version($propertyName, $type = self::VERSION_TYPE_STRING)
|
1270 |
-
{
|
1271 |
-
if (empty($propertyName)) {
|
1272 |
-
return false;
|
1273 |
-
}
|
1274 |
-
|
1275 |
-
// set the $type to the default if we don't recognize the type
|
1276 |
-
if ($type !== self::VERSION_TYPE_STRING && $type !== self::VERSION_TYPE_FLOAT) {
|
1277 |
-
$type = self::VERSION_TYPE_STRING;
|
1278 |
-
}
|
1279 |
-
|
1280 |
-
$properties = self::getProperties();
|
1281 |
-
|
1282 |
-
// Check if the property exists in the properties array.
|
1283 |
-
if (true === isset($properties[$propertyName])) {
|
1284 |
-
|
1285 |
-
// Prepare the pattern to be matched.
|
1286 |
-
// Make sure we always deal with an array (string is converted).
|
1287 |
-
$properties[$propertyName] = (array) $properties[$propertyName];
|
1288 |
-
|
1289 |
-
foreach ($properties[$propertyName] as $propertyMatchString) {
|
1290 |
-
|
1291 |
-
$propertyPattern = str_replace('[VER]', self::VER, $propertyMatchString);
|
1292 |
-
|
1293 |
-
// Identify and extract the version.
|
1294 |
-
preg_match(sprintf('#%s#is', $propertyPattern), $this->userAgent, $match);
|
1295 |
-
|
1296 |
-
if (false === empty($match[1])) {
|
1297 |
-
$version = ($type == self::VERSION_TYPE_FLOAT ? $this->prepareVersionNo($match[1]) : $match[1]);
|
1298 |
-
|
1299 |
-
return $version;
|
1300 |
-
}
|
1301 |
-
|
1302 |
-
}
|
1303 |
-
|
1304 |
-
}
|
1305 |
-
|
1306 |
-
return false;
|
1307 |
-
}
|
1308 |
-
|
1309 |
-
/**
|
1310 |
-
* Retrieve the mobile grading, using self::MOBILE_GRADE_* constants.
|
1311 |
-
*
|
1312 |
-
* @return string One of the self::MOBILE_GRADE_* constants.
|
1313 |
-
*/
|
1314 |
-
public function mobileGrade()
|
1315 |
-
{
|
1316 |
-
$isMobile = $this->isMobile();
|
1317 |
-
|
1318 |
-
if (
|
1319 |
-
// Apple iOS 4-7.0 – Tested on the original iPad (4.3 / 5.0), iPad 2 (4.3 / 5.1 / 6.1), iPad 3 (5.1 / 6.0), iPad Mini (6.1), iPad Retina (7.0), iPhone 3GS (4.3), iPhone 4 (4.3 / 5.1), iPhone 4S (5.1 / 6.0), iPhone 5 (6.0), and iPhone 5S (7.0)
|
1320 |
-
$this->is('iOS') && $this->version('iPad', self::VERSION_TYPE_FLOAT) >= 4.3 ||
|
1321 |
-
$this->is('iOS') && $this->version('iPhone', self::VERSION_TYPE_FLOAT) >= 4.3 ||
|
1322 |
-
$this->is('iOS') && $this->version('iPod', self::VERSION_TYPE_FLOAT) >= 4.3 ||
|
1323 |
-
|
1324 |
-
// Android 2.1-2.3 - Tested on the HTC Incredible (2.2), original Droid (2.2), HTC Aria (2.1), Google Nexus S (2.3). Functional on 1.5 & 1.6 but performance may be sluggish, tested on Google G1 (1.5)
|
1325 |
-
// Android 3.1 (Honeycomb) - Tested on the Samsung Galaxy Tab 10.1 and Motorola XOOM
|
1326 |
-
// Android 4.0 (ICS) - Tested on a Galaxy Nexus. Note: transition performance can be poor on upgraded devices
|
1327 |
-
// Android 4.1 (Jelly Bean) - Tested on a Galaxy Nexus and Galaxy 7
|
1328 |
-
( $this->version('Android', self::VERSION_TYPE_FLOAT)>2.1 && $this->is('Webkit') ) ||
|
1329 |
-
|
1330 |
-
// Windows Phone 7.5-8 - Tested on the HTC Surround (7.5), HTC Trophy (7.5), LG-E900 (7.5), Nokia 800 (7.8), HTC Mazaa (7.8), Nokia Lumia 520 (8), Nokia Lumia 920 (8), HTC 8x (8)
|
1331 |
-
$this->version('Windows Phone OS', self::VERSION_TYPE_FLOAT) >= 7.5 ||
|
1332 |
-
|
1333 |
-
// Tested on the Torch 9800 (6) and Style 9670 (6), BlackBerry® Torch 9810 (7), BlackBerry Z10 (10)
|
1334 |
-
$this->is('BlackBerry') && $this->version('BlackBerry', self::VERSION_TYPE_FLOAT) >= 6.0 ||
|
1335 |
-
// Blackberry Playbook (1.0-2.0) - Tested on PlayBook
|
1336 |
-
$this->match('Playbook.*Tablet') ||
|
1337 |
-
|
1338 |
-
// Palm WebOS (1.4-3.0) - Tested on the Palm Pixi (1.4), Pre (1.4), Pre 2 (2.0), HP TouchPad (3.0)
|
1339 |
-
( $this->version('webOS', self::VERSION_TYPE_FLOAT) >= 1.4 && $this->match('Palm|Pre|Pixi') ) ||
|
1340 |
-
// Palm WebOS 3.0 - Tested on HP TouchPad
|
1341 |
-
$this->match('hp.*TouchPad') ||
|
1342 |
-
|
1343 |
-
// Firefox Mobile 18 - Tested on Android 2.3 and 4.1 devices
|
1344 |
-
( $this->is('Firefox') && $this->version('Firefox', self::VERSION_TYPE_FLOAT) >= 18 ) ||
|
1345 |
-
|
1346 |
-
// Chrome for Android - Tested on Android 4.0, 4.1 device
|
1347 |
-
( $this->is('Chrome') && $this->is('AndroidOS') && $this->version('Android', self::VERSION_TYPE_FLOAT) >= 4.0 ) ||
|
1348 |
-
|
1349 |
-
// Skyfire 4.1 - Tested on Android 2.3 device
|
1350 |
-
( $this->is('Skyfire') && $this->version('Skyfire', self::VERSION_TYPE_FLOAT) >= 4.1 && $this->is('AndroidOS') && $this->version('Android', self::VERSION_TYPE_FLOAT) >= 2.3 ) ||
|
1351 |
-
|
1352 |
-
// Opera Mobile 11.5-12: Tested on Android 2.3
|
1353 |
-
( $this->is('Opera') && $this->version('Opera Mobi', self::VERSION_TYPE_FLOAT) >= 11.5 && $this->is('AndroidOS') ) ||
|
1354 |
-
|
1355 |
-
// Meego 1.2 - Tested on Nokia 950 and N9
|
1356 |
-
$this->is('MeeGoOS') ||
|
1357 |
-
|
1358 |
-
// Tizen (pre-release) - Tested on early hardware
|
1359 |
-
$this->is('Tizen') ||
|
1360 |
-
|
1361 |
-
// Samsung Bada 2.0 - Tested on a Samsung Wave 3, Dolphin browser
|
1362 |
-
// @todo: more tests here!
|
1363 |
-
$this->is('Dolfin') && $this->version('Bada', self::VERSION_TYPE_FLOAT) >= 2.0 ||
|
1364 |
-
|
1365 |
-
// UC Browser - Tested on Android 2.3 device
|
1366 |
-
( ($this->is('UC Browser') || $this->is('Dolfin')) && $this->version('Android', self::VERSION_TYPE_FLOAT) >= 2.3 ) ||
|
1367 |
-
|
1368 |
-
// Kindle 3 and Fire - Tested on the built-in WebKit browser for each
|
1369 |
-
( $this->match('Kindle Fire') ||
|
1370 |
-
$this->is('Kindle') && $this->version('Kindle', self::VERSION_TYPE_FLOAT) >= 3.0 ) ||
|
1371 |
-
|
1372 |
-
// Nook Color 1.4.1 - Tested on original Nook Color, not Nook Tablet
|
1373 |
-
$this->is('AndroidOS') && $this->is('NookTablet') ||
|
1374 |
-
|
1375 |
-
// Chrome Desktop 16-24 - Tested on OS X 10.7 and Windows 7
|
1376 |
-
$this->version('Chrome', self::VERSION_TYPE_FLOAT) >= 16 && !$isMobile ||
|
1377 |
-
|
1378 |
-
// Safari Desktop 5-6 - Tested on OS X 10.7 and Windows 7
|
1379 |
-
$this->version('Safari', self::VERSION_TYPE_FLOAT) >= 5.0 && !$isMobile ||
|
1380 |
-
|
1381 |
-
// Firefox Desktop 10-18 - Tested on OS X 10.7 and Windows 7
|
1382 |
-
$this->version('Firefox', self::VERSION_TYPE_FLOAT) >= 10.0 && !$isMobile ||
|
1383 |
-
|
1384 |
-
// Internet Explorer 7-9 - Tested on Windows XP, Vista and 7
|
1385 |
-
$this->version('IE', self::VERSION_TYPE_FLOAT) >= 7.0 && !$isMobile ||
|
1386 |
-
|
1387 |
-
// Opera Desktop 10-12 - Tested on OS X 10.7 and Windows 7
|
1388 |
-
$this->version('Opera', self::VERSION_TYPE_FLOAT) >= 10 && !$isMobile
|
1389 |
-
){
|
1390 |
-
return self::MOBILE_GRADE_A;
|
1391 |
-
}
|
1392 |
-
|
1393 |
-
if (
|
1394 |
-
$this->is('iOS') && $this->version('iPad', self::VERSION_TYPE_FLOAT)<4.3 ||
|
1395 |
-
$this->is('iOS') && $this->version('iPhone', self::VERSION_TYPE_FLOAT)<4.3 ||
|
1396 |
-
$this->is('iOS') && $this->version('iPod', self::VERSION_TYPE_FLOAT)<4.3 ||
|
1397 |
-
|
1398 |
-
// Blackberry 5.0: Tested on the Storm 2 9550, Bold 9770
|
1399 |
-
$this->is('Blackberry') && $this->version('BlackBerry', self::VERSION_TYPE_FLOAT) >= 5 && $this->version('BlackBerry', self::VERSION_TYPE_FLOAT)<6 ||
|
1400 |
-
|
1401 |
-
//Opera Mini (5.0-6.5) - Tested on iOS 3.2/4.3 and Android 2.3
|
1402 |
-
($this->version('Opera Mini', self::VERSION_TYPE_FLOAT) >= 5.0 && $this->version('Opera Mini', self::VERSION_TYPE_FLOAT) <= 7.0 &&
|
1403 |
-
($this->version('Android', self::VERSION_TYPE_FLOAT) >= 2.3 || $this->is('iOS')) ) ||
|
1404 |
-
|
1405 |
-
// Nokia Symbian^3 - Tested on Nokia N8 (Symbian^3), C7 (Symbian^3), also works on N97 (Symbian^1)
|
1406 |
-
$this->match('NokiaN8|NokiaC7|N97.*Series60|Symbian/3') ||
|
1407 |
-
|
1408 |
-
// @todo: report this (tested on Nokia N71)
|
1409 |
-
$this->version('Opera Mobi', self::VERSION_TYPE_FLOAT) >= 11 && $this->is('SymbianOS')
|
1410 |
-
){
|
1411 |
-
return self::MOBILE_GRADE_B;
|
1412 |
-
}
|
1413 |
-
|
1414 |
-
if (
|
1415 |
-
// Blackberry 4.x - Tested on the Curve 8330
|
1416 |
-
$this->version('BlackBerry', self::VERSION_TYPE_FLOAT) <= 5.0 ||
|
1417 |
-
// Windows Mobile - Tested on the HTC Leo (WinMo 5.2)
|
1418 |
-
$this->match('MSIEMobile|Windows CE.*Mobile') || $this->version('Windows Mobile', self::VERSION_TYPE_FLOAT) <= 5.2 ||
|
1419 |
-
|
1420 |
-
// Tested on original iPhone (3.1), iPhone 3 (3.2)
|
1421 |
-
$this->is('iOS') && $this->version('iPad', self::VERSION_TYPE_FLOAT) <= 3.2 ||
|
1422 |
-
$this->is('iOS') && $this->version('iPhone', self::VERSION_TYPE_FLOAT) <= 3.2 ||
|
1423 |
-
$this->is('iOS') && $this->version('iPod', self::VERSION_TYPE_FLOAT) <= 3.2 ||
|
1424 |
-
|
1425 |
-
// Internet Explorer 7 and older - Tested on Windows XP
|
1426 |
-
$this->version('IE', self::VERSION_TYPE_FLOAT) <= 7.0 && !$isMobile
|
1427 |
-
){
|
1428 |
-
return self::MOBILE_GRADE_C;
|
1429 |
-
}
|
1430 |
-
|
1431 |
-
// All older smartphone platforms and featurephones - Any device that doesn't support media queries
|
1432 |
-
// will receive the basic, C grade experience.
|
1433 |
-
return self::MOBILE_GRADE_C;
|
1434 |
-
}
|
1435 |
-
}
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* Mobile Detect Library
|
4 |
+
* =====================
|
5 |
+
*
|
6 |
+
* Motto: "Every business should have a mobile detection script to detect mobile readers"
|
7 |
+
*
|
8 |
+
* Mobile_Detect is a lightweight PHP class for detecting mobile devices (including tablets).
|
9 |
+
* It uses the User-Agent string combined with specific HTTP headers to detect the mobile environment.
|
10 |
+
*
|
11 |
+
* @author Current authors: Serban Ghita <serbanghita@gmail.com>
|
12 |
+
* Nick Ilyin <nick.ilyin@gmail.com>
|
13 |
+
*
|
14 |
+
* Original author: Victor Stanciu <vic.stanciu@gmail.com>
|
15 |
+
*
|
16 |
+
* @license Code and contributions have 'MIT License'
|
17 |
+
* More details: https://github.com/serbanghita/Mobile-Detect/blob/master/LICENSE.txt
|
18 |
+
*
|
19 |
+
* @link Homepage: http://mobiledetect.net
|
20 |
+
* GitHub Repo: https://github.com/serbanghita/Mobile-Detect
|
21 |
+
* Google Code: http://code.google.com/p/php-mobile-detect/
|
22 |
+
* README: https://github.com/serbanghita/Mobile-Detect/blob/master/README.md
|
23 |
+
* HOWTO: https://github.com/serbanghita/Mobile-Detect/wiki/Code-examples
|
24 |
+
*
|
25 |
+
* @version 2.8.19
|
26 |
+
*/
|
27 |
+
|
28 |
+
class TCMP_Mobile_Detect {
|
29 |
+
/**
|
30 |
+
* Mobile detection type.
|
31 |
+
*
|
32 |
+
* @deprecated since version 2.6.9
|
33 |
+
*/
|
34 |
+
const DETECTION_TYPE_MOBILE = 'mobile';
|
35 |
+
|
36 |
+
/**
|
37 |
+
* Extended detection type.
|
38 |
+
*
|
39 |
+
* @deprecated since version 2.6.9
|
40 |
+
*/
|
41 |
+
const DETECTION_TYPE_EXTENDED = 'extended';
|
42 |
+
|
43 |
+
/**
|
44 |
+
* A frequently used regular expression to extract version #s.
|
45 |
+
*
|
46 |
+
* @deprecated since version 2.6.9
|
47 |
+
*/
|
48 |
+
const VER = '([\w._\+]+)';
|
49 |
+
|
50 |
+
/**
|
51 |
+
* Top-level device.
|
52 |
+
*/
|
53 |
+
const MOBILE_GRADE_A = 'A';
|
54 |
+
|
55 |
+
/**
|
56 |
+
* Mid-level device.
|
57 |
+
*/
|
58 |
+
const MOBILE_GRADE_B = 'B';
|
59 |
+
|
60 |
+
/**
|
61 |
+
* Low-level device.
|
62 |
+
*/
|
63 |
+
const MOBILE_GRADE_C = 'C';
|
64 |
+
|
65 |
+
/**
|
66 |
+
* Stores the version number of the current release.
|
67 |
+
*/
|
68 |
+
const VERSION = '2.8.19';
|
69 |
+
|
70 |
+
/**
|
71 |
+
* A type for the version() method indicating a string return value.
|
72 |
+
*/
|
73 |
+
const VERSION_TYPE_STRING = 'text';
|
74 |
+
|
75 |
+
/**
|
76 |
+
* A type for the version() method indicating a float return value.
|
77 |
+
*/
|
78 |
+
const VERSION_TYPE_FLOAT = 'float';
|
79 |
+
|
80 |
+
/**
|
81 |
+
* A cache for resolved matches
|
82 |
+
* @var array
|
83 |
+
*/
|
84 |
+
protected $cache = array();
|
85 |
+
|
86 |
+
/**
|
87 |
+
* The User-Agent HTTP header is stored in here.
|
88 |
+
* @var string
|
89 |
+
*/
|
90 |
+
protected $userAgent = null;
|
91 |
+
|
92 |
+
/**
|
93 |
+
* HTTP headers in the PHP-flavor. So HTTP_USER_AGENT and SERVER_SOFTWARE.
|
94 |
+
* @var array
|
95 |
+
*/
|
96 |
+
protected $httpHeaders = array();
|
97 |
+
|
98 |
+
/**
|
99 |
+
* CloudFront headers. E.g. CloudFront-Is-Desktop-Viewer, CloudFront-Is-Mobile-Viewer & CloudFront-Is-Tablet-Viewer.
|
100 |
+
* @var array
|
101 |
+
*/
|
102 |
+
protected $cloudfrontHeaders = array();
|
103 |
+
|
104 |
+
/**
|
105 |
+
* The matching Regex.
|
106 |
+
* This is good for debug.
|
107 |
+
* @var string
|
108 |
+
*/
|
109 |
+
protected $matchingRegex = null;
|
110 |
+
|
111 |
+
/**
|
112 |
+
* The matches extracted from the regex expression.
|
113 |
+
* This is good for debug.
|
114 |
+
* @var string
|
115 |
+
*/
|
116 |
+
protected $matchesArray = null;
|
117 |
+
|
118 |
+
/**
|
119 |
+
* The detection type, using self::DETECTION_TYPE_MOBILE or self::DETECTION_TYPE_EXTENDED.
|
120 |
+
*
|
121 |
+
* @deprecated since version 2.6.9
|
122 |
+
*
|
123 |
+
* @var string
|
124 |
+
*/
|
125 |
+
protected $detectionType = self::DETECTION_TYPE_MOBILE;
|
126 |
+
|
127 |
+
/**
|
128 |
+
* HTTP headers that trigger the 'isMobile' detection
|
129 |
+
* to be true.
|
130 |
+
*
|
131 |
+
* @var array
|
132 |
+
*/
|
133 |
+
protected static $mobileHeaders = array(
|
134 |
+
|
135 |
+
'HTTP_ACCEPT' => array('matches' => array(
|
136 |
+
// Opera Mini; @reference: http://dev.opera.com/articles/view/opera-binary-markup-language/
|
137 |
+
'application/x-obml2d',
|
138 |
+
// BlackBerry devices.
|
139 |
+
'application/vnd.rim.html',
|
140 |
+
'text/vnd.wap.wml',
|
141 |
+
'application/vnd.wap.xhtml+xml'
|
142 |
+
)),
|
143 |
+
'HTTP_X_WAP_PROFILE' => null,
|
144 |
+
'HTTP_X_WAP_CLIENTID' => null,
|
145 |
+
'HTTP_WAP_CONNECTION' => null,
|
146 |
+
'HTTP_PROFILE' => null,
|
147 |
+
// Reported by Opera on Nokia devices (eg. C3).
|
148 |
+
'HTTP_X_OPERAMINI_PHONE_UA' => null,
|
149 |
+
'HTTP_X_NOKIA_GATEWAY_ID' => null,
|
150 |
+
'HTTP_X_ORANGE_ID' => null,
|
151 |
+
'HTTP_X_VODAFONE_3GPDPCONTEXT' => null,
|
152 |
+
'HTTP_X_HUAWEI_USERID' => null,
|
153 |
+
// Reported by Windows Smartphones.
|
154 |
+
'HTTP_UA_OS' => null,
|
155 |
+
// Reported by Verizon, Vodafone proxy system.
|
156 |
+
'HTTP_X_MOBILE_GATEWAY' => null,
|
157 |
+
// Seen this on HTC Sensation. SensationXE_Beats_Z715e.
|
158 |
+
'HTTP_X_ATT_DEVICEID' => null,
|
159 |
+
// Seen this on a HTC.
|
160 |
+
'HTTP_UA_CPU' => array('matches' => array('ARM')),
|
161 |
+
);
|
162 |
+
|
163 |
+
/**
|
164 |
+
* List of mobile devices (phones).
|
165 |
+
*
|
166 |
+
* @var array
|
167 |
+
*/
|
168 |
+
protected static $phoneDevices = array(
|
169 |
+
'iPhone' => '\biPhone\b|\biPod\b', // |\biTunes
|
170 |
+
'BlackBerry' => 'BlackBerry|\bBB10\b|rim[0-9]+',
|
171 |
+
'HTC' => 'HTC|HTC.*(Sensation|Evo|Vision|Explorer|6800|8100|8900|A7272|S510e|C110e|Legend|Desire|T8282)|APX515CKT|Qtek9090|APA9292KT|HD_mini|Sensation.*Z710e|PG86100|Z715e|Desire.*(A8181|HD)|ADR6200|ADR6400L|ADR6425|001HT|Inspire 4G|Android.*\bEVO\b|T-Mobile G1|Z520m',
|
172 |
+
'Nexus' => 'Nexus One|Nexus S|Galaxy.*Nexus|Android.*Nexus.*Mobile|Nexus 4|Nexus 5|Nexus 6',
|
173 |
+
// @todo: Is 'Dell Streak' a tablet or a phone? ;)
|
174 |
+
'Dell' => 'Dell.*Streak|Dell.*Aero|Dell.*Venue|DELL.*Venue Pro|Dell Flash|Dell Smoke|Dell Mini 3iX|XCD28|XCD35|\b001DL\b|\b101DL\b|\bGS01\b',
|
175 |
+
'Motorola' => 'Motorola|DROIDX|DROID BIONIC|\bDroid\b.*Build|Android.*Xoom|HRI39|MOT-|A1260|A1680|A555|A853|A855|A953|A955|A956|Motorola.*ELECTRIFY|Motorola.*i1|i867|i940|MB200|MB300|MB501|MB502|MB508|MB511|MB520|MB525|MB526|MB611|MB612|MB632|MB810|MB855|MB860|MB861|MB865|MB870|ME501|ME502|ME511|ME525|ME600|ME632|ME722|ME811|ME860|ME863|ME865|MT620|MT710|MT716|MT720|MT810|MT870|MT917|Motorola.*TITANIUM|WX435|WX445|XT300|XT301|XT311|XT316|XT317|XT319|XT320|XT390|XT502|XT530|XT531|XT532|XT535|XT603|XT610|XT611|XT615|XT681|XT701|XT702|XT711|XT720|XT800|XT806|XT860|XT862|XT875|XT882|XT883|XT894|XT901|XT907|XT909|XT910|XT912|XT928|XT926|XT915|XT919|XT925|XT1021|\bMoto E\b',
|
176 |
+
'Samsung' => 'Samsung|SM-G9250|GT-19300|SGH-I337|BGT-S5230|GT-B2100|GT-B2700|GT-B2710|GT-B3210|GT-B3310|GT-B3410|GT-B3730|GT-B3740|GT-B5510|GT-B5512|GT-B5722|GT-B6520|GT-B7300|GT-B7320|GT-B7330|GT-B7350|GT-B7510|GT-B7722|GT-B7800|GT-C3010|GT-C3011|GT-C3060|GT-C3200|GT-C3212|GT-C3212I|GT-C3262|GT-C3222|GT-C3300|GT-C3300K|GT-C3303|GT-C3303K|GT-C3310|GT-C3322|GT-C3330|GT-C3350|GT-C3500|GT-C3510|GT-C3530|GT-C3630|GT-C3780|GT-C5010|GT-C5212|GT-C6620|GT-C6625|GT-C6712|GT-E1050|GT-E1070|GT-E1075|GT-E1080|GT-E1081|GT-E1085|GT-E1087|GT-E1100|GT-E1107|GT-E1110|GT-E1120|GT-E1125|GT-E1130|GT-E1160|GT-E1170|GT-E1175|GT-E1180|GT-E1182|GT-E1200|GT-E1210|GT-E1225|GT-E1230|GT-E1390|GT-E2100|GT-E2120|GT-E2121|GT-E2152|GT-E2220|GT-E2222|GT-E2230|GT-E2232|GT-E2250|GT-E2370|GT-E2550|GT-E2652|GT-E3210|GT-E3213|GT-I5500|GT-I5503|GT-I5700|GT-I5800|GT-I5801|GT-I6410|GT-I6420|GT-I7110|GT-I7410|GT-I7500|GT-I8000|GT-I8150|GT-I8160|GT-I8190|GT-I8320|GT-I8330|GT-I8350|GT-I8530|GT-I8700|GT-I8703|GT-I8910|GT-I9000|GT-I9001|GT-I9003|GT-I9010|GT-I9020|GT-I9023|GT-I9070|GT-I9082|GT-I9100|GT-I9103|GT-I9220|GT-I9250|GT-I9300|GT-I9305|GT-I9500|GT-I9505|GT-M3510|GT-M5650|GT-M7500|GT-M7600|GT-M7603|GT-M8800|GT-M8910|GT-N7000|GT-S3110|GT-S3310|GT-S3350|GT-S3353|GT-S3370|GT-S3650|GT-S3653|GT-S3770|GT-S3850|GT-S5210|GT-S5220|GT-S5229|GT-S5230|GT-S5233|GT-S5250|GT-S5253|GT-S5260|GT-S5263|GT-S5270|GT-S5300|GT-S5330|GT-S5350|GT-S5360|GT-S5363|GT-S5369|GT-S5380|GT-S5380D|GT-S5560|GT-S5570|GT-S5600|GT-S5603|GT-S5610|GT-S5620|GT-S5660|GT-S5670|GT-S5690|GT-S5750|GT-S5780|GT-S5830|GT-S5839|GT-S6102|GT-S6500|GT-S7070|GT-S7200|GT-S7220|GT-S7230|GT-S7233|GT-S7250|GT-S7500|GT-S7530|GT-S7550|GT-S7562|GT-S7710|GT-S8000|GT-S8003|GT-S8500|GT-S8530|GT-S8600|SCH-A310|SCH-A530|SCH-A570|SCH-A610|SCH-A630|SCH-A650|SCH-A790|SCH-A795|SCH-A850|SCH-A870|SCH-A890|SCH-A930|SCH-A950|SCH-A970|SCH-A990|SCH-I100|SCH-I110|SCH-I400|SCH-I405|SCH-I500|SCH-I510|SCH-I515|SCH-I600|SCH-I730|SCH-I760|SCH-I770|SCH-I830|SCH-I910|SCH-I920|SCH-I959|SCH-LC11|SCH-N150|SCH-N300|SCH-R100|SCH-R300|SCH-R351|SCH-R400|SCH-R410|SCH-T300|SCH-U310|SCH-U320|SCH-U350|SCH-U360|SCH-U365|SCH-U370|SCH-U380|SCH-U410|SCH-U430|SCH-U450|SCH-U460|SCH-U470|SCH-U490|SCH-U540|SCH-U550|SCH-U620|SCH-U640|SCH-U650|SCH-U660|SCH-U700|SCH-U740|SCH-U750|SCH-U810|SCH-U820|SCH-U900|SCH-U940|SCH-U960|SCS-26UC|SGH-A107|SGH-A117|SGH-A127|SGH-A137|SGH-A157|SGH-A167|SGH-A177|SGH-A187|SGH-A197|SGH-A227|SGH-A237|SGH-A257|SGH-A437|SGH-A517|SGH-A597|SGH-A637|SGH-A657|SGH-A667|SGH-A687|SGH-A697|SGH-A707|SGH-A717|SGH-A727|SGH-A737|SGH-A747|SGH-A767|SGH-A777|SGH-A797|SGH-A817|SGH-A827|SGH-A837|SGH-A847|SGH-A867|SGH-A877|SGH-A887|SGH-A897|SGH-A927|SGH-B100|SGH-B130|SGH-B200|SGH-B220|SGH-C100|SGH-C110|SGH-C120|SGH-C130|SGH-C140|SGH-C160|SGH-C170|SGH-C180|SGH-C200|SGH-C207|SGH-C210|SGH-C225|SGH-C230|SGH-C417|SGH-C450|SGH-D307|SGH-D347|SGH-D357|SGH-D407|SGH-D415|SGH-D780|SGH-D807|SGH-D980|SGH-E105|SGH-E200|SGH-E315|SGH-E316|SGH-E317|SGH-E335|SGH-E590|SGH-E635|SGH-E715|SGH-E890|SGH-F300|SGH-F480|SGH-I200|SGH-I300|SGH-I320|SGH-I550|SGH-I577|SGH-I600|SGH-I607|SGH-I617|SGH-I627|SGH-I637|SGH-I677|SGH-I700|SGH-I717|SGH-I727|SGH-i747M|SGH-I777|SGH-I780|SGH-I827|SGH-I847|SGH-I857|SGH-I896|SGH-I897|SGH-I900|SGH-I907|SGH-I917|SGH-I927|SGH-I937|SGH-I997|SGH-J150|SGH-J200|SGH-L170|SGH-L700|SGH-M110|SGH-M150|SGH-M200|SGH-N105|SGH-N500|SGH-N600|SGH-N620|SGH-N625|SGH-N700|SGH-N710|SGH-P107|SGH-P207|SGH-P300|SGH-P310|SGH-P520|SGH-P735|SGH-P777|SGH-Q105|SGH-R210|SGH-R220|SGH-R225|SGH-S105|SGH-S307|SGH-T109|SGH-T119|SGH-T139|SGH-T209|SGH-T219|SGH-T229|SGH-T239|SGH-T249|SGH-T259|SGH-T309|SGH-T319|SGH-T329|SGH-T339|SGH-T349|SGH-T359|SGH-T369|SGH-T379|SGH-T409|SGH-T429|SGH-T439|SGH-T459|SGH-T469|SGH-T479|SGH-T499|SGH-T509|SGH-T519|SGH-T539|SGH-T559|SGH-T589|SGH-T609|SGH-T619|SGH-T629|SGH-T639|SGH-T659|SGH-T669|SGH-T679|SGH-T709|SGH-T719|SGH-T729|SGH-T739|SGH-T746|SGH-T749|SGH-T759|SGH-T769|SGH-T809|SGH-T819|SGH-T839|SGH-T919|SGH-T929|SGH-T939|SGH-T959|SGH-T989|SGH-U100|SGH-U200|SGH-U800|SGH-V205|SGH-V206|SGH-X100|SGH-X105|SGH-X120|SGH-X140|SGH-X426|SGH-X427|SGH-X475|SGH-X495|SGH-X497|SGH-X507|SGH-X600|SGH-X610|SGH-X620|SGH-X630|SGH-X700|SGH-X820|SGH-X890|SGH-Z130|SGH-Z150|SGH-Z170|SGH-ZX10|SGH-ZX20|SHW-M110|SPH-A120|SPH-A400|SPH-A420|SPH-A460|SPH-A500|SPH-A560|SPH-A600|SPH-A620|SPH-A660|SPH-A700|SPH-A740|SPH-A760|SPH-A790|SPH-A800|SPH-A820|SPH-A840|SPH-A880|SPH-A900|SPH-A940|SPH-A960|SPH-D600|SPH-D700|SPH-D710|SPH-D720|SPH-I300|SPH-I325|SPH-I330|SPH-I350|SPH-I500|SPH-I600|SPH-I700|SPH-L700|SPH-M100|SPH-M220|SPH-M240|SPH-M300|SPH-M305|SPH-M320|SPH-M330|SPH-M350|SPH-M360|SPH-M370|SPH-M380|SPH-M510|SPH-M540|SPH-M550|SPH-M560|SPH-M570|SPH-M580|SPH-M610|SPH-M620|SPH-M630|SPH-M800|SPH-M810|SPH-M850|SPH-M900|SPH-M910|SPH-M920|SPH-M930|SPH-N100|SPH-N200|SPH-N240|SPH-N300|SPH-N400|SPH-Z400|SWC-E100|SCH-i909|GT-N7100|GT-N7105|SCH-I535|SM-N900A|SGH-I317|SGH-T999L|GT-S5360B|GT-I8262|GT-S6802|GT-S6312|GT-S6310|GT-S5312|GT-S5310|GT-I9105|GT-I8510|GT-S6790N|SM-G7105|SM-N9005|GT-S5301|GT-I9295|GT-I9195|SM-C101|GT-S7392|GT-S7560|GT-B7610|GT-I5510|GT-S7582|GT-S7530E|GT-I8750|SM-G9006V|SM-G9008V|SM-G9009D|SM-G900A|SM-G900D|SM-G900F|SM-G900H|SM-G900I|SM-G900J|SM-G900K|SM-G900L|SM-G900M|SM-G900P|SM-G900R4|SM-G900S|SM-G900T|SM-G900V|SM-G900W8|SHV-E160K|SCH-P709|SCH-P729|SM-T2558|GT-I9205',
|
177 |
+
'LG' => '\bLG\b;|LG[- ]?(C800|C900|E400|E610|E900|E-900|F160|F180K|F180L|F180S|730|855|L160|LS740|LS840|LS970|LU6200|MS690|MS695|MS770|MS840|MS870|MS910|P500|P700|P705|VM696|AS680|AS695|AX840|C729|E970|GS505|272|C395|E739BK|E960|L55C|L75C|LS696|LS860|P769BK|P350|P500|P509|P870|UN272|US730|VS840|VS950|LN272|LN510|LS670|LS855|LW690|MN270|MN510|P509|P769|P930|UN200|UN270|UN510|UN610|US670|US740|US760|UX265|UX840|VN271|VN530|VS660|VS700|VS740|VS750|VS910|VS920|VS930|VX9200|VX11000|AX840A|LW770|P506|P925|P999|E612|D955|D802|MS323)',
|
178 |
+
'Sony' => 'SonyST|SonyLT|SonyEricsson|SonyEricssonLT15iv|LT18i|E10i|LT28h|LT26w|SonyEricssonMT27i|C5303|C6902|C6903|C6906|C6943|D2533',
|
179 |
+
'Asus' => 'Asus.*Galaxy|PadFone.*Mobile',
|
180 |
+
// http://www.micromaxinfo.com/mobiles/smartphones
|
181 |
+
// Added because the codes might conflict with Acer Tablets.
|
182 |
+
'Micromax' => 'Micromax.*\b(A210|A92|A88|A72|A111|A110Q|A115|A116|A110|A90S|A26|A51|A35|A54|A25|A27|A89|A68|A65|A57|A90)\b',
|
183 |
+
// @todo Complete the regex.
|
184 |
+
'Palm' => 'PalmSource|Palm', // avantgo|blazer|elaine|hiptop|plucker|xiino ;
|
185 |
+
'Vertu' => 'Vertu|Vertu.*Ltd|Vertu.*Ascent|Vertu.*Ayxta|Vertu.*Constellation(F|Quest)?|Vertu.*Monika|Vertu.*Signature', // Just for fun ;)
|
186 |
+
// http://www.pantech.co.kr/en/prod/prodList.do?gbrand=VEGA (PANTECH)
|
187 |
+
// Most of the VEGA devices are legacy. PANTECH seem to be newer devices based on Android.
|
188 |
+
'Pantech' => 'PANTECH|IM-A850S|IM-A840S|IM-A830L|IM-A830K|IM-A830S|IM-A820L|IM-A810K|IM-A810S|IM-A800S|IM-T100K|IM-A725L|IM-A780L|IM-A775C|IM-A770K|IM-A760S|IM-A750K|IM-A740S|IM-A730S|IM-A720L|IM-A710K|IM-A690L|IM-A690S|IM-A650S|IM-A630K|IM-A600S|VEGA PTL21|PT003|P8010|ADR910L|P6030|P6020|P9070|P4100|P9060|P5000|CDM8992|TXT8045|ADR8995|IS11PT|P2030|P6010|P8000|PT002|IS06|CDM8999|P9050|PT001|TXT8040|P2020|P9020|P2000|P7040|P7000|C790',
|
189 |
+
// http://www.fly-phone.com/devices/smartphones/ ; Included only smartphones.
|
190 |
+
'Fly' => 'IQ230|IQ444|IQ450|IQ440|IQ442|IQ441|IQ245|IQ256|IQ236|IQ255|IQ235|IQ245|IQ275|IQ240|IQ285|IQ280|IQ270|IQ260|IQ250',
|
191 |
+
// http://fr.wikomobile.com
|
192 |
+
'Wiko' => 'KITE 4G|HIGHWAY|GETAWAY|STAIRWAY|DARKSIDE|DARKFULL|DARKNIGHT|DARKMOON|SLIDE|WAX 4G|RAINBOW|BLOOM|SUNSET|GOA|LENNY|BARRY|IGGY|OZZY|CINK FIVE|CINK PEAX|CINK PEAX 2|CINK SLIM|CINK SLIM 2|CINK +|CINK KING|CINK PEAX|CINK SLIM|SUBLIM',
|
193 |
+
'iMobile' => 'i-mobile (IQ|i-STYLE|idea|ZAA|Hitz)',
|
194 |
+
// Added simvalley mobile just for fun. They have some interesting devices.
|
195 |
+
// http://www.simvalley.fr/telephonie---gps-_22_telephonie-mobile_telephones_.html
|
196 |
+
'SimValley' => '\b(SP-80|XT-930|SX-340|XT-930|SX-310|SP-360|SP60|SPT-800|SP-120|SPT-800|SP-140|SPX-5|SPX-8|SP-100|SPX-8|SPX-12)\b',
|
197 |
+
// Wolfgang - a brand that is sold by Aldi supermarkets.
|
198 |
+
// http://www.wolfgangmobile.com/
|
199 |
+
'Wolfgang' => 'AT-B24D|AT-AS50HD|AT-AS40W|AT-AS55HD|AT-AS45q2|AT-B26D|AT-AS50Q',
|
200 |
+
'Alcatel' => 'Alcatel',
|
201 |
+
'Nintendo' => 'Nintendo 3DS',
|
202 |
+
// http://en.wikipedia.org/wiki/Amoi
|
203 |
+
'Amoi' => 'Amoi',
|
204 |
+
// http://en.wikipedia.org/wiki/INQ
|
205 |
+
'INQ' => 'INQ',
|
206 |
+
// @Tapatalk is a mobile app; http://support.tapatalk.com/threads/smf-2-0-2-os-and-browser-detection-plugin-and-tapatalk.15565/#post-79039
|
207 |
+
'GenericPhone' => 'Tapatalk|PDA;|SAGEM|\bmmp\b|pocket|\bpsp\b|symbian|Smartphone|smartfon|treo|up.browser|up.link|vodafone|\bwap\b|nokia|Series40|Series60|S60|SonyEricsson|N900|MAUI.*WAP.*Browser',
|
208 |
+
);
|
209 |
+
|
210 |
+
/**
|
211 |
+
* List of tablet devices.
|
212 |
+
*
|
213 |
+
* @var array
|
214 |
+
*/
|
215 |
+
protected static $tabletDevices = array(
|
216 |
+
// @todo: check for mobile friendly emails topic.
|
217 |
+
'iPad' => 'iPad|iPad.*Mobile',
|
218 |
+
// Removed |^.*Android.*Nexus(?!(?:Mobile).)*$
|
219 |
+
// @see #442
|
220 |
+
'NexusTablet' => 'Android.*Nexus[\s]+(7|9|10)',
|
221 |
+
'SamsungTablet' => 'SAMSUNG.*Tablet|Galaxy.*Tab|SC-01C|GT-P1000|GT-P1003|GT-P1010|GT-P3105|GT-P6210|GT-P6800|GT-P6810|GT-P7100|GT-P7300|GT-P7310|GT-P7500|GT-P7510|SCH-I800|SCH-I815|SCH-I905|SGH-I957|SGH-I987|SGH-T849|SGH-T859|SGH-T869|SPH-P100|GT-P3100|GT-P3108|GT-P3110|GT-P5100|GT-P5110|GT-P6200|GT-P7320|GT-P7511|GT-N8000|GT-P8510|SGH-I497|SPH-P500|SGH-T779|SCH-I705|SCH-I915|GT-N8013|GT-P3113|GT-P5113|GT-P8110|GT-N8010|GT-N8005|GT-N8020|GT-P1013|GT-P6201|GT-P7501|GT-N5100|GT-N5105|GT-N5110|SHV-E140K|SHV-E140L|SHV-E140S|SHV-E150S|SHV-E230K|SHV-E230L|SHV-E230S|SHW-M180K|SHW-M180L|SHW-M180S|SHW-M180W|SHW-M300W|SHW-M305W|SHW-M380K|SHW-M380S|SHW-M380W|SHW-M430W|SHW-M480K|SHW-M480S|SHW-M480W|SHW-M485W|SHW-M486W|SHW-M500W|GT-I9228|SCH-P739|SCH-I925|GT-I9200|GT-P5200|GT-P5210|GT-P5210X|SM-T311|SM-T310|SM-T310X|SM-T210|SM-T210R|SM-T211|SM-P600|SM-P601|SM-P605|SM-P900|SM-P901|SM-T217|SM-T217A|SM-T217S|SM-P6000|SM-T3100|SGH-I467|XE500|SM-T110|GT-P5220|GT-I9200X|GT-N5110X|GT-N5120|SM-P905|SM-T111|SM-T2105|SM-T315|SM-T320|SM-T320X|SM-T321|SM-T520|SM-T525|SM-T530NU|SM-T230NU|SM-T330NU|SM-T900|XE500T1C|SM-P605V|SM-P905V|SM-T337V|SM-T537V|SM-T707V|SM-T807V|SM-P600X|SM-P900X|SM-T210X|SM-T230|SM-T230X|SM-T325|GT-P7503|SM-T531|SM-T330|SM-T530|SM-T705|SM-T705C|SM-T535|SM-T331|SM-T800|SM-T700|SM-T537|SM-T807|SM-P907A|SM-T337A|SM-T537A|SM-T707A|SM-T807A|SM-T237|SM-T807P|SM-P607T|SM-T217T|SM-T337T|SM-T807T|SM-T116NQ|SM-P550|SM-T350|SM-T550|SM-T9000|SM-P9000|SM-T705Y|SM-T805|GT-P3113|SM-T710|SM-T810|SM-T360|SM-T533|SM-T113|SM-T335|SM-T715', // SCH-P709|SCH-P729|SM-T2558|GT-I9205 - Samsung Mega - treat them like a regular phone.
|
222 |
+
// http://docs.aws.amazon.com/silk/latest/developerguide/user-agent.html
|
223 |
+
'Kindle' => 'Kindle|Silk.*Accelerated|Android.*\b(KFOT|KFTT|KFJWI|KFJWA|KFOTE|KFSOWI|KFTHWI|KFTHWA|KFAPWI|KFAPWA|WFJWAE|KFSAWA|KFSAWI|KFASWI)\b',
|
224 |
+
// Only the Surface tablets with Windows RT are considered mobile.
|
225 |
+
// http://msdn.microsoft.com/en-us/library/ie/hh920767(v=vs.85).aspx
|
226 |
+
'SurfaceTablet' => 'Windows NT [0-9.]+; ARM;.*(Tablet|ARMBJS)',
|
227 |
+
// http://shopping1.hp.com/is-bin/INTERSHOP.enfinity/WFS/WW-USSMBPublicStore-Site/en_US/-/USD/ViewStandardCatalog-Browse?CatalogCategoryID=JfIQ7EN5lqMAAAEyDcJUDwMT
|
228 |
+
'HPTablet' => 'HP Slate (7|8|10)|HP ElitePad 900|hp-tablet|EliteBook.*Touch|HP 8|Slate 21|HP SlateBook 10',
|
229 |
+
// Watch out for PadFone, see #132.
|
230 |
+
// http://www.asus.com/de/Tablets_Mobile/Memo_Pad_Products/
|
231 |
+
'AsusTablet' => '^.*PadFone((?!Mobile).)*$|Transformer|TF101|TF101G|TF300T|TF300TG|TF300TL|TF700T|TF700KL|TF701T|TF810C|ME171|ME301T|ME302C|ME371MG|ME370T|ME372MG|ME172V|ME173X|ME400C|Slider SL101|\bK00F\b|\bK00C\b|\bK00E\b|\bK00L\b|TX201LA|ME176C|ME102A|\bM80TA\b|ME372CL|ME560CG|ME372CG|ME302KL| K010 | K017 |ME572C|ME103K|ME170C|ME171C|\bME70C\b|ME581C|ME581CL|ME8510C|ME181C',
|
232 |
+
'BlackBerryTablet' => 'PlayBook|RIM Tablet',
|
233 |
+
'HTCtablet' => 'HTC_Flyer_P512|HTC Flyer|HTC Jetstream|HTC-P715a|HTC EVO View 4G|PG41200|PG09410',
|
234 |
+
'MotorolaTablet' => 'xoom|sholest|MZ615|MZ605|MZ505|MZ601|MZ602|MZ603|MZ604|MZ606|MZ607|MZ608|MZ609|MZ615|MZ616|MZ617',
|
235 |
+
'NookTablet' => 'Android.*Nook|NookColor|nook browser|BNRV200|BNRV200A|BNTV250|BNTV250A|BNTV400|BNTV600|LogicPD Zoom2',
|
236 |
+
// http://www.acer.ro/ac/ro/RO/content/drivers
|
237 |
+
// http://www.packardbell.co.uk/pb/en/GB/content/download (Packard Bell is part of Acer)
|
238 |
+
// http://us.acer.com/ac/en/US/content/group/tablets
|
239 |
+
// http://www.acer.de/ac/de/DE/content/models/tablets/
|
240 |
+
// Can conflict with Micromax and Motorola phones codes.
|
241 |
+
'AcerTablet' => 'Android.*; \b(A100|A101|A110|A200|A210|A211|A500|A501|A510|A511|A700|A701|W500|W500P|W501|W501P|W510|W511|W700|G100|G100W|B1-A71|B1-710|B1-711|A1-810|A1-811|A1-830)\b|W3-810|\bA3-A10\b|\bA3-A11\b',
|
242 |
+
// http://eu.computers.toshiba-europe.com/innovation/family/Tablets/1098744/banner_id/tablet_footerlink/
|
243 |
+
// http://us.toshiba.com/tablets/tablet-finder
|
244 |
+
// http://www.toshiba.co.jp/regza/tablet/
|
245 |
+
'ToshibaTablet' => 'Android.*(AT100|AT105|AT200|AT205|AT270|AT275|AT300|AT305|AT1S5|AT500|AT570|AT700|AT830)|TOSHIBA.*FOLIO',
|
246 |
+
// http://www.nttdocomo.co.jp/english/service/developer/smart_phone/technical_info/spec/index.html
|
247 |
+
// http://www.lg.com/us/tablets
|
248 |
+
'LGTablet' => '\bL-06C|LG-V909|LG-V900|LG-V700|LG-V510|LG-V500|LG-V410|LG-V400|LG-VK810\b',
|
249 |
+
'FujitsuTablet' => 'Android.*\b(F-01D|F-02F|F-05E|F-10D|M532|Q572)\b',
|
250 |
+
// Prestigio Tablets http://www.prestigio.com/support
|
251 |
+
'PrestigioTablet' => 'PMP3170B|PMP3270B|PMP3470B|PMP7170B|PMP3370B|PMP3570C|PMP5870C|PMP3670B|PMP5570C|PMP5770D|PMP3970B|PMP3870C|PMP5580C|PMP5880D|PMP5780D|PMP5588C|PMP7280C|PMP7280C3G|PMP7280|PMP7880D|PMP5597D|PMP5597|PMP7100D|PER3464|PER3274|PER3574|PER3884|PER5274|PER5474|PMP5097CPRO|PMP5097|PMP7380D|PMP5297C|PMP5297C_QUAD|PMP812E|PMP812E3G|PMP812F|PMP810E|PMP880TD|PMT3017|PMT3037|PMT3047|PMT3057|PMT7008|PMT5887|PMT5001|PMT5002',
|
252 |
+
// http://support.lenovo.com/en_GB/downloads/default.page?#
|
253 |
+
'LenovoTablet' => 'Idea(Tab|Pad)( A1|A10| K1|)|ThinkPad([ ]+)?Tablet|Lenovo.*(S2109|S2110|S5000|S6000|K3011|A3000|A3500|A1000|A2107|A2109|A1107|A5500|A7600|B6000|B8000|B8080)(-|)(FL|F|HV|H|)',
|
254 |
+
// http://www.dell.com/support/home/us/en/04/Products/tab_mob/tablets
|
255 |
+
'DellTablet' => 'Venue 11|Venue 8|Venue 7|Dell Streak 10|Dell Streak 7',
|
256 |
+
// http://www.yarvik.com/en/matrix/tablets/
|
257 |
+
'YarvikTablet' => 'Android.*\b(TAB210|TAB211|TAB224|TAB250|TAB260|TAB264|TAB310|TAB360|TAB364|TAB410|TAB411|TAB420|TAB424|TAB450|TAB460|TAB461|TAB464|TAB465|TAB467|TAB468|TAB07-100|TAB07-101|TAB07-150|TAB07-151|TAB07-152|TAB07-200|TAB07-201-3G|TAB07-210|TAB07-211|TAB07-212|TAB07-214|TAB07-220|TAB07-400|TAB07-485|TAB08-150|TAB08-200|TAB08-201-3G|TAB08-201-30|TAB09-100|TAB09-211|TAB09-410|TAB10-150|TAB10-201|TAB10-211|TAB10-400|TAB10-410|TAB13-201|TAB274EUK|TAB275EUK|TAB374EUK|TAB462EUK|TAB474EUK|TAB9-200)\b',
|
258 |
+
'MedionTablet' => 'Android.*\bOYO\b|LIFE.*(P9212|P9514|P9516|S9512)|LIFETAB',
|
259 |
+
'ArnovaTablet' => 'AN10G2|AN7bG3|AN7fG3|AN8G3|AN8cG3|AN7G3|AN9G3|AN7dG3|AN7dG3ST|AN7dG3ChildPad|AN10bG3|AN10bG3DT|AN9G2',
|
260 |
+
// http://www.intenso.de/kategorie_en.php?kategorie=33
|
261 |
+
// @todo: http://www.nbhkdz.com/read/b8e64202f92a2df129126bff.html - investigate
|
262 |
+
'IntensoTablet' => 'INM8002KP|INM1010FP|INM805ND|Intenso Tab|TAB1004',
|
263 |
+
// IRU.ru Tablets http://www.iru.ru/catalog/soho/planetable/
|
264 |
+
'IRUTablet' => 'M702pro',
|
265 |
+
'MegafonTablet' => 'MegaFon V9|\bZTE V9\b|Android.*\bMT7A\b',
|
266 |
+
// http://www.e-boda.ro/tablete-pc.html
|
267 |
+
'EbodaTablet' => 'E-Boda (Supreme|Impresspeed|Izzycomm|Essential)',
|
268 |
+
// http://www.allview.ro/produse/droseries/lista-tablete-pc/
|
269 |
+
'AllViewTablet' => 'Allview.*(Viva|Alldro|City|Speed|All TV|Frenzy|Quasar|Shine|TX1|AX1|AX2)',
|
270 |
+
// http://wiki.archosfans.com/index.php?title=Main_Page
|
271 |
+
'ArchosTablet' => '\b(101G9|80G9|A101IT)\b|Qilive 97R|Archos5|\bARCHOS (70|79|80|90|97|101|FAMILYPAD|)(b|)(G10| Cobalt| TITANIUM(HD|)| Xenon| Neon|XSK| 2| XS 2| PLATINUM| CARBON|GAMEPAD)\b',
|
272 |
+
// http://www.ainol.com/plugin.php?identifier=ainol&module=product
|
273 |
+
'AinolTablet' => 'NOVO7|NOVO8|NOVO10|Novo7Aurora|Novo7Basic|NOVO7PALADIN|novo9-Spark',
|
274 |
+
// @todo: inspect http://esupport.sony.com/US/p/select-system.pl?DIRECTOR=DRIVER
|
275 |
+
// Readers http://www.atsuhiro-me.net/ebook/sony-reader/sony-reader-web-browser
|
276 |
+
// http://www.sony.jp/support/tablet/
|
277 |
+
'SonyTablet' => 'Sony.*Tablet|Xperia Tablet|Sony Tablet S|SO-03E|SGPT12|SGPT13|SGPT114|SGPT121|SGPT122|SGPT123|SGPT111|SGPT112|SGPT113|SGPT131|SGPT132|SGPT133|SGPT211|SGPT212|SGPT213|SGP311|SGP312|SGP321|EBRD1101|EBRD1102|EBRD1201|SGP351|SGP341|SGP511|SGP512|SGP521|SGP541|SGP551|SGP621|SGP612|SOT31',
|
278 |
+
// http://www.support.philips.com/support/catalog/worldproducts.jsp?userLanguage=en&userCountry=cn&categoryid=3G_LTE_TABLET_SU_CN_CARE&title=3G%20tablets%20/%20LTE%20range&_dyncharset=UTF-8
|
279 |
+
'PhilipsTablet' => '\b(PI2010|PI3000|PI3100|PI3105|PI3110|PI3205|PI3210|PI3900|PI4010|PI7000|PI7100)\b',
|
280 |
+
// db + http://www.cube-tablet.com/buy-products.html
|
281 |
+
'CubeTablet' => 'Android.*(K8GT|U9GT|U10GT|U16GT|U17GT|U18GT|U19GT|U20GT|U23GT|U30GT)|CUBE U8GT',
|
282 |
+
// http://www.cobyusa.com/?p=pcat&pcat_id=3001
|
283 |
+
'CobyTablet' => 'MID1042|MID1045|MID1125|MID1126|MID7012|MID7014|MID7015|MID7034|MID7035|MID7036|MID7042|MID7048|MID7127|MID8042|MID8048|MID8127|MID9042|MID9740|MID9742|MID7022|MID7010',
|
284 |
+
// http://www.match.net.cn/products.asp
|
285 |
+
'MIDTablet' => 'M9701|M9000|M9100|M806|M1052|M806|T703|MID701|MID713|MID710|MID727|MID760|MID830|MID728|MID933|MID125|MID810|MID732|MID120|MID930|MID800|MID731|MID900|MID100|MID820|MID735|MID980|MID130|MID833|MID737|MID960|MID135|MID860|MID736|MID140|MID930|MID835|MID733',
|
286 |
+
// http://www.msi.com/support
|
287 |
+
// @todo Research the Windows Tablets.
|
288 |
+
'MSITablet' => 'MSI \b(Primo 73K|Primo 73L|Primo 81L|Primo 77|Primo 93|Primo 75|Primo 76|Primo 73|Primo 81|Primo 91|Primo 90|Enjoy 71|Enjoy 7|Enjoy 10)\b',
|
289 |
+
// @todo http://www.kyoceramobile.com/support/drivers/
|
290 |
+
// 'KyoceraTablet' => null,
|
291 |
+
// @todo http://intexuae.com/index.php/category/mobile-devices/tablets-products/
|
292 |
+
// 'IntextTablet' => null,
|
293 |
+
// http://pdadb.net/index.php?m=pdalist&list=SMiT (NoName Chinese Tablets)
|
294 |
+
// http://www.imp3.net/14/show.php?itemid=20454
|
295 |
+
'SMiTTablet' => 'Android.*(\bMID\b|MID-560|MTV-T1200|MTV-PND531|MTV-P1101|MTV-PND530)',
|
296 |
+
// http://www.rock-chips.com/index.php?do=prod&pid=2
|
297 |
+
'RockChipTablet' => 'Android.*(RK2818|RK2808A|RK2918|RK3066)|RK2738|RK2808A',
|
298 |
+
// http://www.fly-phone.com/devices/tablets/ ; http://www.fly-phone.com/service/
|
299 |
+
'FlyTablet' => 'IQ310|Fly Vision',
|
300 |
+
// http://www.bqreaders.com/gb/tablets-prices-sale.html
|
301 |
+
'bqTablet' => 'Android.*(bq)?.*(Elcano|Curie|Edison|Maxwell|Kepler|Pascal|Tesla|Hypatia|Platon|Newton|Livingstone|Cervantes|Avant|Aquaris E10)|Maxwell.*Lite|Maxwell.*Plus',
|
302 |
+
// http://www.huaweidevice.com/worldwide/productFamily.do?method=index&directoryId=5011&treeId=3290
|
303 |
+
// http://www.huaweidevice.com/worldwide/downloadCenter.do?method=index&directoryId=3372&treeId=0&tb=1&type=software (including legacy tablets)
|
304 |
+
'HuaweiTablet' => 'MediaPad|MediaPad 7 Youth|IDEOS S7|S7-201c|S7-202u|S7-101|S7-103|S7-104|S7-105|S7-106|S7-201|S7-Slim',
|
305 |
+
// Nec or Medias Tab
|
306 |
+
'NecTablet' => '\bN-06D|\bN-08D',
|
307 |
+
// Pantech Tablets: http://www.pantechusa.com/phones/
|
308 |
+
'PantechTablet' => 'Pantech.*P4100',
|
309 |
+
// Broncho Tablets: http://www.broncho.cn/ (hard to find)
|
310 |
+
'BronchoTablet' => 'Broncho.*(N701|N708|N802|a710)',
|
311 |
+
// http://versusuk.com/support.html
|
312 |
+
'VersusTablet' => 'TOUCHPAD.*[78910]|\bTOUCHTAB\b',
|
313 |
+
// http://www.zync.in/index.php/our-products/tablet-phablets
|
314 |
+
'ZyncTablet' => 'z1000|Z99 2G|z99|z930|z999|z990|z909|Z919|z900',
|
315 |
+
// http://www.positivoinformatica.com.br/www/pessoal/tablet-ypy/
|
316 |
+
'PositivoTablet' => 'TB07STA|TB10STA|TB07FTA|TB10FTA',
|
317 |
+
// https://www.nabitablet.com/
|
318 |
+
'NabiTablet' => 'Android.*\bNabi',
|
319 |
+
'KoboTablet' => 'Kobo Touch|\bK080\b|\bVox\b Build|\bArc\b Build',
|
320 |
+
// French Danew Tablets http://www.danew.com/produits-tablette.php
|
321 |
+
'DanewTablet' => 'DSlide.*\b(700|701R|702|703R|704|802|970|971|972|973|974|1010|1012)\b',
|
322 |
+
// Texet Tablets and Readers http://www.texet.ru/tablet/
|
323 |
+
'TexetTablet' => 'NaviPad|TB-772A|TM-7045|TM-7055|TM-9750|TM-7016|TM-7024|TM-7026|TM-7041|TM-7043|TM-7047|TM-8041|TM-9741|TM-9747|TM-9748|TM-9751|TM-7022|TM-7021|TM-7020|TM-7011|TM-7010|TM-7023|TM-7025|TM-7037W|TM-7038W|TM-7027W|TM-9720|TM-9725|TM-9737W|TM-1020|TM-9738W|TM-9740|TM-9743W|TB-807A|TB-771A|TB-727A|TB-725A|TB-719A|TB-823A|TB-805A|TB-723A|TB-715A|TB-707A|TB-705A|TB-709A|TB-711A|TB-890HD|TB-880HD|TB-790HD|TB-780HD|TB-770HD|TB-721HD|TB-710HD|TB-434HD|TB-860HD|TB-840HD|TB-760HD|TB-750HD|TB-740HD|TB-730HD|TB-722HD|TB-720HD|TB-700HD|TB-500HD|TB-470HD|TB-431HD|TB-430HD|TB-506|TB-504|TB-446|TB-436|TB-416|TB-146SE|TB-126SE',
|
324 |
+
// Avoid detecting 'PLAYSTATION 3' as mobile.
|
325 |
+
'PlaystationTablet' => 'Playstation.*(Portable|Vita)',
|
326 |
+
// http://www.trekstor.de/surftabs.html
|
327 |
+
'TrekstorTablet' => 'ST10416-1|VT10416-1|ST70408-1|ST702xx-1|ST702xx-2|ST80208|ST97216|ST70104-2|VT10416-2|ST10216-2A|SurfTab',
|
328 |
+
// http://www.pyleaudio.com/Products.aspx?%2fproducts%2fPersonal-Electronics%2fTablets
|
329 |
+
'PyleAudioTablet' => '\b(PTBL10CEU|PTBL10C|PTBL72BC|PTBL72BCEU|PTBL7CEU|PTBL7C|PTBL92BC|PTBL92BCEU|PTBL9CEU|PTBL9CUK|PTBL9C)\b',
|
330 |
+
// http://www.advandigital.com/index.php?link=content-product&jns=JP001
|
331 |
+
// because of the short codenames we have to include whitespaces to reduce the possible conflicts.
|
332 |
+
'AdvanTablet' => 'Android.* \b(E3A|T3X|T5C|T5B|T3E|T3C|T3B|T1J|T1F|T2A|T1H|T1i|E1C|T1-E|T5-A|T4|E1-B|T2Ci|T1-B|T1-D|O1-A|E1-A|T1-A|T3A|T4i)\b ',
|
333 |
+
// http://www.danytech.com/category/tablet-pc
|
334 |
+
'DanyTechTablet' => 'Genius Tab G3|Genius Tab S2|Genius Tab Q3|Genius Tab G4|Genius Tab Q4|Genius Tab G-II|Genius TAB GII|Genius TAB GIII|Genius Tab S1',
|
335 |
+
// http://www.galapad.net/product.html
|
336 |
+
'GalapadTablet' => 'Android.*\bG1\b',
|
337 |
+
// http://www.micromaxinfo.com/tablet/funbook
|
338 |
+
'MicromaxTablet' => 'Funbook|Micromax.*\b(P250|P560|P360|P362|P600|P300|P350|P500|P275)\b',
|
339 |
+
// http://www.karbonnmobiles.com/products_tablet.php
|
340 |
+
'KarbonnTablet' => 'Android.*\b(A39|A37|A34|ST8|ST10|ST7|Smart Tab3|Smart Tab2)\b',
|
341 |
+
// http://www.myallfine.com/Products.asp
|
342 |
+
'AllFineTablet' => 'Fine7 Genius|Fine7 Shine|Fine7 Air|Fine8 Style|Fine9 More|Fine10 Joy|Fine11 Wide',
|
343 |
+
// http://www.proscanvideo.com/products-search.asp?itemClass=TABLET&itemnmbr=
|
344 |
+
'PROSCANTablet' => '\b(PEM63|PLT1023G|PLT1041|PLT1044|PLT1044G|PLT1091|PLT4311|PLT4311PL|PLT4315|PLT7030|PLT7033|PLT7033D|PLT7035|PLT7035D|PLT7044K|PLT7045K|PLT7045KB|PLT7071KG|PLT7072|PLT7223G|PLT7225G|PLT7777G|PLT7810K|PLT7849G|PLT7851G|PLT7852G|PLT8015|PLT8031|PLT8034|PLT8036|PLT8080K|PLT8082|PLT8088|PLT8223G|PLT8234G|PLT8235G|PLT8816K|PLT9011|PLT9045K|PLT9233G|PLT9735|PLT9760G|PLT9770G)\b',
|
345 |
+
// http://www.yonesnav.com/products/products.php
|
346 |
+
'YONESTablet' => 'BQ1078|BC1003|BC1077|RK9702|BC9730|BC9001|IT9001|BC7008|BC7010|BC708|BC728|BC7012|BC7030|BC7027|BC7026',
|
347 |
+
// http://www.cjshowroom.com/eproducts.aspx?classcode=004001001
|
348 |
+
// China manufacturer makes tablets for different small brands (eg. http://www.zeepad.net/index.html)
|
349 |
+
'ChangJiaTablet' => 'TPC7102|TPC7103|TPC7105|TPC7106|TPC7107|TPC7201|TPC7203|TPC7205|TPC7210|TPC7708|TPC7709|TPC7712|TPC7110|TPC8101|TPC8103|TPC8105|TPC8106|TPC8203|TPC8205|TPC8503|TPC9106|TPC9701|TPC97101|TPC97103|TPC97105|TPC97106|TPC97111|TPC97113|TPC97203|TPC97603|TPC97809|TPC97205|TPC10101|TPC10103|TPC10106|TPC10111|TPC10203|TPC10205|TPC10503',
|
350 |
+
// http://www.gloryunion.cn/products.asp
|
351 |
+
// http://www.allwinnertech.com/en/apply/mobile.html
|
352 |
+
// http://www.ptcl.com.pk/pd_content.php?pd_id=284 (EVOTAB)
|
353 |
+
// @todo: Softwiner tablets?
|
354 |
+
// aka. Cute or Cool tablets. Not sure yet, must research to avoid collisions.
|
355 |
+
'GUTablet' => 'TX-A1301|TX-M9002|Q702|kf026', // A12R|D75A|D77|D79|R83|A95|A106C|R15|A75|A76|D71|D72|R71|R73|R77|D82|R85|D92|A97|D92|R91|A10F|A77F|W71F|A78F|W78F|W81F|A97F|W91F|W97F|R16G|C72|C73E|K72|K73|R96G
|
356 |
+
// http://www.pointofview-online.com/showroom.php?shop_mode=product_listing&category_id=118
|
357 |
+
'PointOfViewTablet' => 'TAB-P506|TAB-navi-7-3G-M|TAB-P517|TAB-P-527|TAB-P701|TAB-P703|TAB-P721|TAB-P731N|TAB-P741|TAB-P825|TAB-P905|TAB-P925|TAB-PR945|TAB-PL1015|TAB-P1025|TAB-PI1045|TAB-P1325|TAB-PROTAB[0-9]+|TAB-PROTAB25|TAB-PROTAB26|TAB-PROTAB27|TAB-PROTAB26XL|TAB-PROTAB2-IPS9|TAB-PROTAB30-IPS9|TAB-PROTAB25XXL|TAB-PROTAB26-IPS10|TAB-PROTAB30-IPS10',
|
358 |
+
// http://www.overmax.pl/pl/katalog-produktow,p8/tablety,c14/
|
359 |
+
// @todo: add more tests.
|
360 |
+
'OvermaxTablet' => 'OV-(SteelCore|NewBase|Basecore|Baseone|Exellen|Quattor|EduTab|Solution|ACTION|BasicTab|TeddyTab|MagicTab|Stream|TB-08|TB-09)',
|
361 |
+
// http://hclmetablet.com/India/index.php
|
362 |
+
'HCLTablet' => 'HCL.*Tablet|Connect-3G-2.0|Connect-2G-2.0|ME Tablet U1|ME Tablet U2|ME Tablet G1|ME Tablet X1|ME Tablet Y2|ME Tablet Sync',
|
363 |
+
// http://www.edigital.hu/Tablet_es_e-book_olvaso/Tablet-c18385.html
|
364 |
+
'DPSTablet' => 'DPS Dream 9|DPS Dual 7',
|
365 |
+
// http://www.visture.com/index.asp
|
366 |
+
'VistureTablet' => 'V97 HD|i75 3G|Visture V4( HD)?|Visture V5( HD)?|Visture V10',
|
367 |
+
// http://www.mijncresta.nl/tablet
|
368 |
+
'CrestaTablet' => 'CTP(-)?810|CTP(-)?818|CTP(-)?828|CTP(-)?838|CTP(-)?888|CTP(-)?978|CTP(-)?980|CTP(-)?987|CTP(-)?988|CTP(-)?989',
|
369 |
+
// MediaTek - http://www.mediatek.com/_en/01_products/02_proSys.php?cata_sn=1&cata1_sn=1&cata2_sn=309
|
370 |
+
'MediatekTablet' => '\bMT8125|MT8389|MT8135|MT8377\b',
|
371 |
+
// Concorde tab
|
372 |
+
'ConcordeTablet' => 'Concorde([ ]+)?Tab|ConCorde ReadMan',
|
373 |
+
// GoClever Tablets - http://www.goclever.com/uk/products,c1/tablet,c5/
|
374 |
+
'GoCleverTablet' => 'GOCLEVER TAB|A7GOCLEVER|M1042|M7841|M742|R1042BK|R1041|TAB A975|TAB A7842|TAB A741|TAB A741L|TAB M723G|TAB M721|TAB A1021|TAB I921|TAB R721|TAB I720|TAB T76|TAB R70|TAB R76.2|TAB R106|TAB R83.2|TAB M813G|TAB I721|GCTA722|TAB I70|TAB I71|TAB S73|TAB R73|TAB R74|TAB R93|TAB R75|TAB R76.1|TAB A73|TAB A93|TAB A93.2|TAB T72|TAB R83|TAB R974|TAB R973|TAB A101|TAB A103|TAB A104|TAB A104.2|R105BK|M713G|A972BK|TAB A971|TAB R974.2|TAB R104|TAB R83.3|TAB A1042',
|
375 |
+
// Modecom Tablets - http://www.modecom.eu/tablets/portal/
|
376 |
+
'ModecomTablet' => 'FreeTAB 9000|FreeTAB 7.4|FreeTAB 7004|FreeTAB 7800|FreeTAB 2096|FreeTAB 7.5|FreeTAB 1014|FreeTAB 1001 |FreeTAB 8001|FreeTAB 9706|FreeTAB 9702|FreeTAB 7003|FreeTAB 7002|FreeTAB 1002|FreeTAB 7801|FreeTAB 1331|FreeTAB 1004|FreeTAB 8002|FreeTAB 8014|FreeTAB 9704|FreeTAB 1003',
|
377 |
+
// Vonino Tablets - http://www.vonino.eu/tablets
|
378 |
+
'VoninoTablet' => '\b(Argus[ _]?S|Diamond[ _]?79HD|Emerald[ _]?78E|Luna[ _]?70C|Onyx[ _]?S|Onyx[ _]?Z|Orin[ _]?HD|Orin[ _]?S|Otis[ _]?S|SpeedStar[ _]?S|Magnet[ _]?M9|Primus[ _]?94[ _]?3G|Primus[ _]?94HD|Primus[ _]?QS|Android.*\bQ8\b|Sirius[ _]?EVO[ _]?QS|Sirius[ _]?QS|Spirit[ _]?S)\b',
|
379 |
+
// ECS Tablets - http://www.ecs.com.tw/ECSWebSite/Product/Product_Tablet_List.aspx?CategoryID=14&MenuID=107&childid=M_107&LanID=0
|
380 |
+
'ECSTablet' => 'V07OT2|TM105A|S10OT1|TR10CS1',
|
381 |
+
// Storex Tablets - http://storex.fr/espace_client/support.html
|
382 |
+
// @note: no need to add all the tablet codes since they are guided by the first regex.
|
383 |
+
'StorexTablet' => 'eZee[_\']?(Tab|Go)[0-9]+|TabLC7|Looney Tunes Tab',
|
384 |
+
// Generic Vodafone tablets.
|
385 |
+
'VodafoneTablet' => 'SmartTab([ ]+)?[0-9]+|SmartTabII10|SmartTabII7',
|
386 |
+
// French tablets - Essentiel B http://www.boulanger.fr/tablette_tactile_e-book/tablette_tactile_essentiel_b/cl_68908.htm?multiChoiceToDelete=brand&mc_brand=essentielb
|
387 |
+
// Aka: http://www.essentielb.fr/
|
388 |
+
'EssentielBTablet' => 'Smart[ \']?TAB[ ]+?[0-9]+|Family[ \']?TAB2',
|
389 |
+
// Ross & Moor - http://ross-moor.ru/
|
390 |
+
'RossMoorTablet' => 'RM-790|RM-997|RMD-878G|RMD-974R|RMT-705A|RMT-701|RME-601|RMT-501|RMT-711',
|
391 |
+
// i-mobile http://product.i-mobilephone.com/Mobile_Device
|
392 |
+
'iMobileTablet' => 'i-mobile i-note',
|
393 |
+
// http://www.tolino.de/de/vergleichen/
|
394 |
+
'TolinoTablet' => 'tolino tab [0-9.]+|tolino shine',
|
395 |
+
// AudioSonic - a Kmart brand
|
396 |
+
// http://www.kmart.com.au/webapp/wcs/stores/servlet/Search?langId=-1&storeId=10701&catalogId=10001&categoryId=193001&pageSize=72¤tPage=1&searchCategory=193001%2b4294965664&sortBy=p_MaxPrice%7c1
|
397 |
+
'AudioSonicTablet' => '\bC-22Q|T7-QC|T-17B|T-17P\b',
|
398 |
+
// AMPE Tablets - http://www.ampe.com.my/product-category/tablets/
|
399 |
+
// @todo: add them gradually to avoid conflicts.
|
400 |
+
'AMPETablet' => 'Android.* A78 ',
|
401 |
+
// Skk Mobile - http://skkmobile.com.ph/product_tablets.php
|
402 |
+
'SkkTablet' => 'Android.* (SKYPAD|PHOENIX|CYCLOPS)',
|
403 |
+
// Tecno Mobile (only tablet) - http://www.tecno-mobile.com/index.php/product?filterby=smart&list_order=all&page=1
|
404 |
+
'TecnoTablet' => 'TECNO P9',
|
405 |
+
// JXD (consoles & tablets) - http://jxd.hk/products.asp?selectclassid=009008&clsid=3
|
406 |
+
'JXDTablet' => 'Android.*\b(F3000|A3300|JXD5000|JXD3000|JXD2000|JXD300B|JXD300|S5800|S7800|S602b|S5110b|S7300|S5300|S602|S603|S5100|S5110|S601|S7100a|P3000F|P3000s|P101|P200s|P1000m|P200m|P9100|P1000s|S6600b|S908|P1000|P300|S18|S6600|S9100)\b',
|
407 |
+
// i-Joy tablets - http://www.i-joy.es/en/cat/products/tablets/
|
408 |
+
'iJoyTablet' => 'Tablet (Spirit 7|Essentia|Galatea|Fusion|Onix 7|Landa|Titan|Scooby|Deox|Stella|Themis|Argon|Unique 7|Sygnus|Hexen|Finity 7|Cream|Cream X2|Jade|Neon 7|Neron 7|Kandy|Scape|Saphyr 7|Rebel|Biox|Rebel|Rebel 8GB|Myst|Draco 7|Myst|Tab7-004|Myst|Tadeo Jones|Tablet Boing|Arrow|Draco Dual Cam|Aurix|Mint|Amity|Revolution|Finity 9|Neon 9|T9w|Amity 4GB Dual Cam|Stone 4GB|Stone 8GB|Andromeda|Silken|X2|Andromeda II|Halley|Flame|Saphyr 9,7|Touch 8|Planet|Triton|Unique 10|Hexen 10|Memphis 4GB|Memphis 8GB|Onix 10)',
|
409 |
+
// http://www.intracon.eu/tablet
|
410 |
+
'FX2Tablet' => 'FX2 PAD7|FX2 PAD10',
|
411 |
+
// http://www.xoro.de/produkte/
|
412 |
+
// @note: Might be the same brand with 'Simply tablets'
|
413 |
+
'XoroTablet' => 'KidsPAD 701|PAD[ ]?712|PAD[ ]?714|PAD[ ]?716|PAD[ ]?717|PAD[ ]?718|PAD[ ]?720|PAD[ ]?721|PAD[ ]?722|PAD[ ]?790|PAD[ ]?792|PAD[ ]?900|PAD[ ]?9715D|PAD[ ]?9716DR|PAD[ ]?9718DR|PAD[ ]?9719QR|PAD[ ]?9720QR|TelePAD1030|Telepad1032|TelePAD730|TelePAD731|TelePAD732|TelePAD735Q|TelePAD830|TelePAD9730|TelePAD795|MegaPAD 1331|MegaPAD 1851|MegaPAD 2151',
|
414 |
+
// http://www1.viewsonic.com/products/computing/tablets/
|
415 |
+
'ViewsonicTablet' => 'ViewPad 10pi|ViewPad 10e|ViewPad 10s|ViewPad E72|ViewPad7|ViewPad E100|ViewPad 7e|ViewSonic VB733|VB100a',
|
416 |
+
// http://www.odys.de/web/internet-tablet_en.html
|
417 |
+
'OdysTablet' => 'LOOX|XENO10|ODYS[ -](Space|EVO|Xpress|NOON)|\bXELIO\b|Xelio10Pro|XELIO7PHONETAB|XELIO10EXTREME|XELIOPT2|NEO_QUAD10',
|
418 |
+
// http://www.captiva-power.de/products.html#tablets-en
|
419 |
+
'CaptivaTablet' => 'CAPTIVA PAD',
|
420 |
+
// IconBIT - http://www.iconbit.com/products/tablets/
|
421 |
+
'IconbitTablet' => 'NetTAB|NT-3702|NT-3702S|NT-3702S|NT-3603P|NT-3603P|NT-0704S|NT-0704S|NT-3805C|NT-3805C|NT-0806C|NT-0806C|NT-0909T|NT-0909T|NT-0907S|NT-0907S|NT-0902S|NT-0902S',
|
422 |
+
// http://www.teclast.com/topic.php?channelID=70&topicID=140&pid=63
|
423 |
+
'TeclastTablet' => 'T98 4G|\bP80\b|\bX90HD\b|X98 Air|X98 Air 3G|\bX89\b|P80 3G|\bX80h\b|P98 Air|\bX89HD\b|P98 3G|\bP90HD\b|P89 3G|X98 3G|\bP70h\b|P79HD 3G|G18d 3G|\bP79HD\b|\bP89s\b|\bA88\b|\bP10HD\b|\bP19HD\b|G18 3G|\bP78HD\b|\bA78\b|\bP75\b|G17s 3G|G17h 3G|\bP85t\b|\bP90\b|\bP11\b|\bP98t\b|\bP98HD\b|\bG18d\b|\bP85s\b|\bP11HD\b|\bP88s\b|\bA80HD\b|\bA80se\b|\bA10h\b|\bP89\b|\bP78s\b|\bG18\b|\bP85\b|\bA70h\b|\bA70\b|\bG17\b|\bP18\b|\bA80s\b|\bA11s\b|\bP88HD\b|\bA80h\b|\bP76s\b|\bP76h\b|\bP98\b|\bA10HD\b|\bP78\b|\bP88\b|\bA11\b|\bA10t\b|\bP76a\b|\bP76t\b|\bP76e\b|\bP85HD\b|\bP85a\b|\bP86\b|\bP75HD\b|\bP76v\b|\bA12\b|\bP75a\b|\bA15\b|\bP76Ti\b|\bP81HD\b|\bA10\b|\bT760VE\b|\bT720HD\b|\bP76\b|\bP73\b|\bP71\b|\bP72\b|\bT720SE\b|\bC520Ti\b|\bT760\b|\bT720VE\b|T720-3GE|T720-WiFi',
|
424 |
+
// Onda - http://www.onda-tablet.com/buy-android-onda.html?dir=desc&limit=all&order=price
|
425 |
+
'OndaTablet' => '\b(V975i|Vi30|VX530|V701|Vi60|V701s|Vi50|V801s|V719|Vx610w|VX610W|V819i|Vi10|VX580W|Vi10|V711s|V813|V811|V820w|V820|Vi20|V711|VI30W|V712|V891w|V972|V819w|V820w|Vi60|V820w|V711|V813s|V801|V819|V975s|V801|V819|V819|V818|V811|V712|V975m|V101w|V961w|V812|V818|V971|V971s|V919|V989|V116w|V102w|V973|Vi40)\b[\s]+',
|
426 |
+
'JaytechTablet' => 'TPC-PA762',
|
427 |
+
'BlaupunktTablet' => 'Endeavour 800NG|Endeavour 1010',
|
428 |
+
// http://www.digma.ru/support/download/
|
429 |
+
// @todo: Ebooks also (if requested)
|
430 |
+
'DigmaTablet' => '\b(iDx10|iDx9|iDx8|iDx7|iDxD7|iDxD8|iDsQ8|iDsQ7|iDsQ8|iDsD10|iDnD7|3TS804H|iDsQ11|iDj7|iDs10)\b',
|
431 |
+
// http://www.evolioshop.com/ro/tablete-pc.html
|
432 |
+
// http://www.evolio.ro/support/downloads_static.html?cat=2
|
433 |
+
// @todo: Research some more
|
434 |
+
'EvolioTablet' => 'ARIA_Mini_wifi|Aria[ _]Mini|Evolio X10|Evolio X7|Evolio X8|\bEvotab\b|\bNeura\b',
|
435 |
+
// @todo http://www.lavamobiles.com/tablets-data-cards
|
436 |
+
'LavaTablet' => 'QPAD E704|\bIvoryS\b|E-TAB IVORY|\bE-TAB\b',
|
437 |
+
'AocTablet' => 'MW0811|MW0812|MW0922|MTK8382',
|
438 |
+
// https://www.celkonmobiles.com/?_a=categoryphones&sid=2
|
439 |
+
'CelkonTablet' => 'CT695|CT888|CT[\s]?910|CT7 Tab|CT9 Tab|CT3 Tab|CT2 Tab|CT1 Tab|C820|C720|\bCT-1\b',
|
440 |
+
// http://www.wolderelectronics.com/productos/manuales-y-guias-rapidas/categoria-2-miTab
|
441 |
+
'WolderTablet' => 'miTab \b(DIAMOND|SPACE|BROOKLYN|NEO|FLY|MANHATTAN|FUNK|EVOLUTION|SKY|GOCAR|IRON|GENIUS|POP|MINT|EPSILON|BROADWAY|JUMP|HOP|LEGEND|NEW AGE|LINE|ADVANCE|FEEL|FOLLOW|LIKE|LINK|LIVE|THINK|FREEDOM|CHICAGO|CLEVELAND|BALTIMORE-GH|IOWA|BOSTON|SEATTLE|PHOENIX|DALLAS|IN 101|MasterChef)\b',
|
442 |
+
// http://www.mi.com/en
|
443 |
+
'MiTablet' => '\bMI PAD\b|\bHM NOTE 1W\b',
|
444 |
+
// http://www.nbru.cn/index.html
|
445 |
+
'NibiruTablet' => 'Nibiru M1|Nibiru Jupiter One',
|
446 |
+
// http://navroad.com/products/produkty/tablety/
|
447 |
+
'NexoTablet' => 'NEXO NOVA|NEXO 10|NEXO AVIO|NEXO FREE|NEXO GO|NEXO EVO|NEXO 3G|NEXO SMART|NEXO KIDDO|NEXO MOBI',
|
448 |
+
// http://leader-online.com/new_site/product-category/tablets/
|
449 |
+
// http://www.leader-online.net.au/List/Tablet
|
450 |
+
'LeaderTablet' => 'TBLT10Q|TBLT10I|TBL-10WDKB|TBL-10WDKBO2013|TBL-W230V2|TBL-W450|TBL-W500|SV572|TBLT7I|TBA-AC7-8G|TBLT79|TBL-8W16|TBL-10W32|TBL-10WKB|TBL-W100',
|
451 |
+
// http://www.datawind.com/ubislate/
|
452 |
+
'UbislateTablet' => 'UbiSlate[\s]?7C',
|
453 |
+
// http://www.pocketbook-int.com/ru/support
|
454 |
+
'PocketBookTablet' => 'Pocketbook',
|
455 |
+
// http://www.tesco.com/direct/hudl/
|
456 |
+
'Hudl' => 'Hudl HT7S3|Hudl 2',
|
457 |
+
// http://www.telstra.com.au/home-phone/thub-2/
|
458 |
+
'TelstraTablet' => 'T-Hub2',
|
459 |
+
'GenericTablet' => 'Android.*\b97D\b|Tablet(?!.*PC)|BNTV250A|MID-WCDMA|LogicPD Zoom2|\bA7EB\b|CatNova8|A1_07|CT704|CT1002|\bM721\b|rk30sdk|\bEVOTAB\b|M758A|ET904|ALUMIUM10|Smartfren Tab|Endeavour 1010|Tablet-PC-4|Tagi Tab|\bM6pro\b|CT1020W|arc 10HD|\bJolla\b|\bTP750\b'
|
460 |
+
);
|
461 |
+
|
462 |
+
/**
|
463 |
+
* List of mobile Operating Systems.
|
464 |
+
*
|
465 |
+
* @var array
|
466 |
+
*/
|
467 |
+
protected static $operatingSystems = array(
|
468 |
+
'AndroidOS' => 'Android',
|
469 |
+
'BlackBerryOS' => 'blackberry|\bBB10\b|rim tablet os',
|
470 |
+
'PalmOS' => 'PalmOS|avantgo|blazer|elaine|hiptop|palm|plucker|xiino',
|
471 |
+
'SymbianOS' => 'Symbian|SymbOS|Series60|Series40|SYB-[0-9]+|\bS60\b',
|
472 |
+
// @reference: http://en.wikipedia.org/wiki/Windows_Mobile
|
473 |
+
'WindowsMobileOS' => 'Windows CE.*(PPC|Smartphone|Mobile|[0-9]{3}x[0-9]{3})|Window Mobile|Windows Phone [0-9.]+|WCE;',
|
474 |
+
// @reference: http://en.wikipedia.org/wiki/Windows_Phone
|
475 |
+
// http://wifeng.cn/?r=blog&a=view&id=106
|
476 |
+
// http://nicksnettravels.builttoroam.com/post/2011/01/10/Bogus-Windows-Phone-7-User-Agent-String.aspx
|
477 |
+
// http://msdn.microsoft.com/library/ms537503.aspx
|
478 |
+
// https://msdn.microsoft.com/en-us/library/hh869301(v=vs.85).aspx
|
479 |
+
'WindowsPhoneOS' => 'Windows Phone 10.0|Windows Phone 8.1|Windows Phone 8.0|Windows Phone OS|XBLWP7|ZuneWP7|Windows NT 6.[23]; ARM;',
|
480 |
+
'iOS' => '\biPhone.*Mobile|\biPod|\biPad',
|
481 |
+
// http://en.wikipedia.org/wiki/MeeGo
|
482 |
+
// @todo: research MeeGo in UAs
|
483 |
+
'MeeGoOS' => 'MeeGo',
|
484 |
+
// http://en.wikipedia.org/wiki/Maemo
|
485 |
+
// @todo: research Maemo in UAs
|
486 |
+
'MaemoOS' => 'Maemo',
|
487 |
+
'JavaOS' => 'J2ME/|\bMIDP\b|\bCLDC\b', // '|Java/' produces bug #135
|
488 |
+
'webOS' => 'webOS|hpwOS',
|
489 |
+
'badaOS' => '\bBada\b',
|
490 |
+
'BREWOS' => 'BREW',
|
491 |
+
);
|
492 |
+
|
493 |
+
/**
|
494 |
+
* List of mobile User Agents.
|
495 |
+
*
|
496 |
+
* @var array
|
497 |
+
*/
|
498 |
+
protected static $browsers = array(
|
499 |
+
// @reference: https://developers.google.com/chrome/mobile/docs/user-agent
|
500 |
+
'Chrome' => '\bCrMo\b|CriOS|Android.*Chrome/[.0-9]* (Mobile)?',
|
501 |
+
'Dolfin' => '\bDolfin\b',
|
502 |
+
'Opera' => 'Opera.*Mini|Opera.*Mobi|Android.*Opera|Mobile.*OPR/[0-9.]+|Coast/[0-9.]+',
|
503 |
+
'Skyfire' => 'Skyfire',
|
504 |
+
'IE' => 'IEMobile|MSIEMobile', // |Trident/[.0-9]+
|
505 |
+
'Firefox' => 'fennec|firefox.*maemo|(Mobile|Tablet).*Firefox|Firefox.*Mobile',
|
506 |
+
'Bolt' => 'bolt',
|
507 |
+
'TeaShark' => 'teashark',
|
508 |
+
'Blazer' => 'Blazer',
|
509 |
+
// @reference: http://developer.apple.com/library/safari/#documentation/AppleApplications/Reference/SafariWebContent/OptimizingforSafarioniPhone/OptimizingforSafarioniPhone.html#//apple_ref/doc/uid/TP40006517-SW3
|
510 |
+
'Safari' => 'Version.*Mobile.*Safari|Safari.*Mobile|MobileSafari',
|
511 |
+
// http://en.wikipedia.org/wiki/Midori_(web_browser)
|
512 |
+
//'Midori' => 'midori',
|
513 |
+
'Tizen' => 'Tizen',
|
514 |
+
'UCBrowser' => 'UC.*Browser|UCWEB',
|
515 |
+
'baiduboxapp' => 'baiduboxapp',
|
516 |
+
'baidubrowser' => 'baidubrowser',
|
517 |
+
// https://github.com/serbanghita/Mobile-Detect/issues/7
|
518 |
+
'DiigoBrowser' => 'DiigoBrowser',
|
519 |
+
// http://www.puffinbrowser.com/index.php
|
520 |
+
'Puffin' => 'Puffin',
|
521 |
+
// http://mercury-browser.com/index.html
|
522 |
+
'Mercury' => '\bMercury\b',
|
523 |
+
// http://en.wikipedia.org/wiki/Obigo_Browser
|
524 |
+
'ObigoBrowser' => 'Obigo',
|
525 |
+
// http://en.wikipedia.org/wiki/NetFront
|
526 |
+
'NetFront' => 'NF-Browser',
|
527 |
+
// @reference: http://en.wikipedia.org/wiki/Minimo
|
528 |
+
// http://en.wikipedia.org/wiki/Vision_Mobile_Browser
|
529 |
+
'GenericBrowser' => 'NokiaBrowser|OviBrowser|OneBrowser|TwonkyBeamBrowser|SEMC.*Browser|FlyFlow|Minimo|NetFront|Novarra-Vision|MQQBrowser|MicroMessenger',
|
530 |
+
);
|
531 |
+
|
532 |
+
/**
|
533 |
+
* Utilities.
|
534 |
+
*
|
535 |
+
* @var array
|
536 |
+
*/
|
537 |
+
protected static $utilities = array(
|
538 |
+
// Experimental. When a mobile device wants to switch to 'Desktop Mode'.
|
539 |
+
// http://scottcate.com/technology/windows-phone-8-ie10-desktop-or-mobile/
|
540 |
+
// https://github.com/serbanghita/Mobile-Detect/issues/57#issuecomment-15024011
|
541 |
+
// https://developers.facebook.com/docs/sharing/best-practices
|
542 |
+
'Bot' => 'Googlebot|facebookexternalhit|AdsBot-Google|Google Keyword Suggestion|Facebot|YandexBot|bingbot|ia_archiver|AhrefsBot|Ezooms|GSLFbot|WBSearchBot|Twitterbot|TweetmemeBot|Twikle|PaperLiBot|Wotbox|UnwindFetchor|Exabot|MJ12bot|YandexImages|TurnitinBot|Pingdom',
|
543 |
+
'MobileBot' => 'Googlebot-Mobile|AdsBot-Google-Mobile|YahooSeeker/M1A1-R2D2',
|
544 |
+
'DesktopMode' => 'WPDesktop',
|
545 |
+
'TV' => 'SonyDTV|HbbTV', // experimental
|
546 |
+
'WebKit' => '(webkit)[ /]([\w.]+)',
|
547 |
+
// @todo: Include JXD consoles.
|
548 |
+
'Console' => '\b(Nintendo|Nintendo WiiU|Nintendo 3DS|PLAYSTATION|Xbox)\b',
|
549 |
+
'Watch' => 'SM-V700',
|
550 |
+
);
|
551 |
+
|
552 |
+
/**
|
553 |
+
* All possible HTTP headers that represent the
|
554 |
+
* User-Agent string.
|
555 |
+
*
|
556 |
+
* @var array
|
557 |
+
*/
|
558 |
+
protected static $uaHttpHeaders = array(
|
559 |
+
// The default User-Agent string.
|
560 |
+
'HTTP_USER_AGENT',
|
561 |
+
// Header can occur on devices using Opera Mini.
|
562 |
+
'HTTP_X_OPERAMINI_PHONE_UA',
|
563 |
+
// Vodafone specific header: http://www.seoprinciple.com/mobile-web-community-still-angry-at-vodafone/24/
|
564 |
+
'HTTP_X_DEVICE_USER_AGENT',
|
565 |
+
'HTTP_X_ORIGINAL_USER_AGENT',
|
566 |
+
'HTTP_X_SKYFIRE_PHONE',
|
567 |
+
'HTTP_X_BOLT_PHONE_UA',
|
568 |
+
'HTTP_DEVICE_STOCK_UA',
|
569 |
+
'HTTP_X_UCBROWSER_DEVICE_UA'
|
570 |
+
);
|
571 |
+
|
572 |
+
/**
|
573 |
+
* The individual segments that could exist in a User-Agent string. VER refers to the regular
|
574 |
+
* expression defined in the constant self::VER.
|
575 |
+
*
|
576 |
+
* @var array
|
577 |
+
*/
|
578 |
+
protected static $properties = array(
|
579 |
+
|
580 |
+
// Build
|
581 |
+
'Mobile' => 'Mobile/[VER]',
|
582 |
+
'Build' => 'Build/[VER]',
|
583 |
+
'Version' => 'Version/[VER]',
|
584 |
+
'VendorID' => 'VendorID/[VER]',
|
585 |
+
|
586 |
+
// Devices
|
587 |
+
'iPad' => 'iPad.*CPU[a-z ]+[VER]',
|
588 |
+
'iPhone' => 'iPhone.*CPU[a-z ]+[VER]',
|
589 |
+
'iPod' => 'iPod.*CPU[a-z ]+[VER]',
|
590 |
+
//'BlackBerry' => array('BlackBerry[VER]', 'BlackBerry [VER];'),
|
591 |
+
'Kindle' => 'Kindle/[VER]',
|
592 |
+
|
593 |
+
// Browser
|
594 |
+
'Chrome' => array('Chrome/[VER]', 'CriOS/[VER]', 'CrMo/[VER]'),
|
595 |
+
'Coast' => array('Coast/[VER]'),
|
596 |
+
'Dolfin' => 'Dolfin/[VER]',
|
597 |
+
// @reference: https://developer.mozilla.org/en-US/docs/User_Agent_Strings_Reference
|
598 |
+
'Firefox' => 'Firefox/[VER]',
|
599 |
+
'Fennec' => 'Fennec/[VER]',
|
600 |
+
// http://msdn.microsoft.com/en-us/library/ms537503(v=vs.85).aspx
|
601 |
+
// https://msdn.microsoft.com/en-us/library/ie/hh869301(v=vs.85).aspx
|
602 |
+
'IE' => array('IEMobile/[VER];', 'IEMobile [VER]', 'MSIE [VER];', 'Trident/[0-9.]+;.*rv:[VER]'),
|
603 |
+
// http://en.wikipedia.org/wiki/NetFront
|
604 |
+
'NetFront' => 'NetFront/[VER]',
|
605 |
+
'NokiaBrowser' => 'NokiaBrowser/[VER]',
|
606 |
+
'Opera' => array( ' OPR/[VER]', 'Opera Mini/[VER]', 'Version/[VER]' ),
|
607 |
+
'Opera Mini' => 'Opera Mini/[VER]',
|
608 |
+
'Opera Mobi' => 'Version/[VER]',
|
609 |
+
'UC Browser' => 'UC Browser[VER]',
|
610 |
+
'MQQBrowser' => 'MQQBrowser/[VER]',
|
611 |
+
'MicroMessenger' => 'MicroMessenger/[VER]',
|
612 |
+
'baiduboxapp' => 'baiduboxapp/[VER]',
|
613 |
+
'baidubrowser' => 'baidubrowser/[VER]',
|
614 |
+
'Iron' => 'Iron/[VER]',
|
615 |
+
// @note: Safari 7534.48.3 is actually Version 5.1.
|
616 |
+
// @note: On BlackBerry the Version is overwriten by the OS.
|
617 |
+
'Safari' => array( 'Version/[VER]', 'Safari/[VER]' ),
|
618 |
+
'Skyfire' => 'Skyfire/[VER]',
|
619 |
+
'Tizen' => 'Tizen/[VER]',
|
620 |
+
'Webkit' => 'webkit[ /][VER]',
|
621 |
+
|
622 |
+
// Engine
|
623 |
+
'Gecko' => 'Gecko/[VER]',
|
624 |
+
'Trident' => 'Trident/[VER]',
|
625 |
+
'Presto' => 'Presto/[VER]',
|
626 |
+
|
627 |
+
// OS
|
628 |
+
'iOS' => ' \bi?OS\b [VER][ ;]{1}',
|
629 |
+
'Android' => 'Android [VER]',
|
630 |
+
'BlackBerry' => array('BlackBerry[\w]+/[VER]', 'BlackBerry.*Version/[VER]', 'Version/[VER]'),
|
631 |
+
'BREW' => 'BREW [VER]',
|
632 |
+
'Java' => 'Java/[VER]',
|
633 |
+
// @reference: http://windowsteamblog.com/windows_phone/b/wpdev/archive/2011/08/29/introducing-the-ie9-on-windows-phone-mango-user-agent-string.aspx
|
634 |
+
// @reference: http://en.wikipedia.org/wiki/Windows_NT#Releases
|
635 |
+
'Windows Phone OS' => array( 'Windows Phone OS [VER]', 'Windows Phone [VER]'),
|
636 |
+
'Windows Phone' => 'Windows Phone [VER]',
|
637 |
+
'Windows CE' => 'Windows CE/[VER]',
|
638 |
+
// http://social.msdn.microsoft.com/Forums/en-US/windowsdeveloperpreviewgeneral/thread/6be392da-4d2f-41b4-8354-8dcee20c85cd
|
639 |
+
'Windows NT' => 'Windows NT [VER]',
|
640 |
+
'Symbian' => array('SymbianOS/[VER]', 'Symbian/[VER]'),
|
641 |
+
'webOS' => array('webOS/[VER]', 'hpwOS/[VER];'),
|
642 |
+
);
|
643 |
+
|
644 |
+
/**
|
645 |
+
* Construct an instance of this class.
|
646 |
+
*
|
647 |
+
* @param array $headers Specify the headers as injection. Should be PHP _SERVER flavored.
|
648 |
+
* If left empty, will use the global _SERVER['HTTP_*'] vars instead.
|
649 |
+
* @param string $userAgent Inject the User-Agent header. If null, will use HTTP_USER_AGENT
|
650 |
+
* from the $headers array instead.
|
651 |
+
*/
|
652 |
+
public function __construct(
|
653 |
+
array $headers = null,
|
654 |
+
$userAgent = null
|
655 |
+
) {
|
656 |
+
$this->setHttpHeaders($headers);
|
657 |
+
$this->setUserAgent($userAgent);
|
658 |
+
}
|
659 |
+
|
660 |
+
/**
|
661 |
+
* Get the current script version.
|
662 |
+
* This is useful for the demo.php file,
|
663 |
+
* so people can check on what version they are testing
|
664 |
+
* for mobile devices.
|
665 |
+
*
|
666 |
+
* @return string The version number in semantic version format.
|
667 |
+
*/
|
668 |
+
public static function getScriptVersion()
|
669 |
+
{
|
670 |
+
return self::VERSION;
|
671 |
+
}
|
672 |
+
|
673 |
+
/**
|
674 |
+
* Set the HTTP Headers. Must be PHP-flavored. This method will reset existing headers.
|
675 |
+
*
|
676 |
+
* @param array $httpHeaders The headers to set. If null, then using PHP's _SERVER to extract
|
677 |
+
* the headers. The default null is left for backwards compatibilty.
|
678 |
+
*/
|
679 |
+
public function setHttpHeaders(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|