Version Description
- Fixed problem with shortcode "playlist" used in WYSIWYG field. http://wp-types.com/forums/topic/media-play-list-not-outputting-from-custom-wysiwyg-field-js-error/
- Fixed empty title problem for filter "wpt_field_options" on user edit/add screen https://wp-types.com/forums/topic/populate-select-field-in-wpcf-um-group/
- Added ability to create CPT without title and editor. https://wp-types.com/forums/topic/inaccurate-warning-message-when-creatingediting-a-cpt/
- Added Skype field validation.
- Fixed problem with loading custom CSS when user meta group is inactive or not assign to certain user role.
- Added ability to add to menu link to archive of post type.
- Added ability to setup meta box callback function. https://wp-types.com/forums/topic/add-support-for-meta_box_cb-in-custom-taxonomy/
- Added ability to add HTML5 placeholder attribute for custom post fields.
- Fixed problem with CPT labels. https://wp-types.com/forums/topic/after-save-cpts-cutom-labels-always-revert-to-default-label/
- Added a filters to the post title as option text in the select dropdown for post parents. wpcf_pr_belongs_items for array of options and wpcf_pr_belongs_item for one option. https://wp-types.com/forums/topic/help-to-distinguish-duplicate-titles-in-post-relationship/
- Added ability to choose custom fields to display it on custom posts admin list.
- Fixed problem with saving parent data into child data. On parent edit screen.
- Added check group name for Custom Fields and User Fields.
- Fixed missing "Edit" button on group edit screen when we close custom logic form.
Download this release
Release Info
| Developer | iworks |
| Plugin |  Toolset Types – Custom Post Types, Custom Fields and Taxonomies |
| Version | 1.6.6 |
| Comparing to | |
| See all releases | |
Code changes from version 1.6.5.1 to 1.6.6
- admin.php +150 -80
- classes/class.wpcf-marketing-messages.php +21 -15
- classes/class.wpcf-marketing-tutorial.php +3 -3
- classes/class.wpcf-marketing.php +3 -3
- embedded/admin.php +32 -21
- embedded/bootstrap.php +10 -8
- embedded/classes/class.wpcf-post-types.php +234 -3
- embedded/classes/editor.php +2 -4
- embedded/classes/field.php +67 -61
- embedded/classes/fields.php +1 -1
- embedded/classes/forms.php +16 -8
- embedded/classes/loader.php +20 -17
- embedded/classes/path.php +1 -1
- embedded/classes/post-types/messages.php +1 -1
- embedded/classes/relationship.php +23 -12
- embedded/classes/relationship/form-child.php +16 -4
- embedded/classes/repeater.php +58 -55
- embedded/classes/usermeta_field.php +13 -15
- embedded/classes/usermeta_repeater.php +46 -43
- embedded/classes/validate.php +24 -1
- embedded/classes/validation-cakephp.php +23 -0
- embedded/common/changelog.txt +14 -1
- embedded/common/classes/class.toolset.promo.php +197 -0
- embedded/common/classes/forms.php +9 -7
- embedded/common/debug/debug-information.php +1 -1
- embedded/common/debug/functions_debug_information.php +20 -15
- embedded/common/expression-parser/js/parser.js +14 -14
- embedded/common/expression-parser/parser.php +15 -15
- embedded/common/functions.php +14 -80
- embedded/common/res/css/colorbox.css +88 -0
- embedded/common/res/css/toolset-promotion.css +155 -0
- embedded/common/res/images/toolset.promotion/full.jpg +0 -0
- embedded/common/res/images/toolset.promotion/icons.png +0 -0
- embedded/common/res/js/jquery.colorbox-min.js +7 -0
- embedded/common/res/js/toolset-promotion.js +47 -0
- embedded/common/toolset-forms/api.php +19 -17
- embedded/common/toolset-forms/bootstrap.php +164 -125
- embedded/common/toolset-forms/classes/class.audio.php +1 -1
- embedded/common/toolset-forms/classes/class.checkbox.php +1 -1
- embedded/common/toolset-forms/classes/class.checkboxes.php +1 -1
- embedded/common/toolset-forms/classes/class.colorpicker.php +22 -18
- embedded/common/toolset-forms/classes/class.conditional.php +5 -1
- embedded/common/toolset-forms/classes/class.credaudio.php +1 -1
- embedded/common/toolset-forms/classes/class.credfile.php +1 -1
- embedded/common/toolset-forms/classes/class.credimage.php +1 -1
- embedded/common/toolset-forms/classes/class.credvideo.php +1 -1
- embedded/common/toolset-forms/classes/class.date.php +17 -7
- embedded/common/toolset-forms/classes/class.date.scripts.php +9 -0
- embedded/common/toolset-forms/classes/class.eforms.php +7 -5
- embedded/common/toolset-forms/classes/class.field_factory.php +18 -4
- embedded/common/toolset-forms/classes/class.fieldconfig.php +1 -1
- embedded/common/toolset-forms/classes/class.file.php +36 -18
- embedded/common/toolset-forms/classes/class.form_factory.php +11 -5
- embedded/common/toolset-forms/classes/class.image.php +1 -1
- embedded/common/toolset-forms/classes/class.radios.php +12 -4
- embedded/common/toolset-forms/classes/class.recaptcha.php +1 -1
- embedded/common/toolset-forms/classes/class.repetitive.php +1 -1
- embedded/common/toolset-forms/classes/class.select.php +14 -5
- embedded/common/toolset-forms/classes/class.skype.php +31 -22
- embedded/common/toolset-forms/classes/class.submit.php +4 -4
- embedded/common/toolset-forms/classes/class.taxonomy.php +4 -29
- embedded/common/toolset-forms/classes/class.taxonomyhierarchical.php +91 -104
- embedded/common/toolset-forms/classes/class.textarea.php +1 -1
- embedded/common/toolset-forms/classes/class.textfield.php +4 -6
- embedded/common/toolset-forms/classes/class.types.php +6 -3
- embedded/common/toolset-forms/classes/class.validation.php +8 -4
- embedded/common/toolset-forms/classes/class.video.php +1 -1
- embedded/common/toolset-forms/classes/class.wysiwyg.php +1 -1
- embedded/common/toolset-forms/css/wpt-toolset-frontend.css +7 -30
- embedded/common/toolset-forms/external/autocompleter.php +0 -53
- embedded/common/toolset-forms/js/conditional.js +122 -16
- embedded/common/toolset-forms/js/date.js +1 -1
- embedded/common/toolset-forms/js/file-wp35.js +98 -0
- embedded/common/toolset-forms/js/file.js +0 -68
- embedded/common/toolset-forms/js/jquery.autocomplete.js +0 -507
- embedded/common/toolset-forms/js/main.js +167 -150
- embedded/common/toolset-forms/js/repetitive.js +1 -1
- embedded/common/toolset-forms/js/skype.js +2 -2
- embedded/common/toolset-forms/js/validation.js +24 -17
- embedded/common/toolset-forms/lib/CakePHP-Validation.php +7 -8
- embedded/common/toolset-forms/readme.txt +11 -0
- embedded/common/toolset-forms/templates/metaform-item.php +26 -25
- embedded/common/toolset-forms/templates/metaform.php +1 -1
- embedded/common/toolset-forms/test.php +0 -36
- embedded/common/utility/css/notifications.css +41 -43
- embedded/common/utility/css/select2/select2.css +147 -54
- embedded/common/utility/img/icon-help-message.png +0 -0
- embedded/common/utility/js/keyboard.js +961 -0
- embedded/common/utility/js/keyboard.min.js +1 -0
- embedded/common/utility/js/select2.min.js +5 -4
- embedded/common/views/promote.php +0 -93
- embedded/common/views/res/img/views-32.png +0 -0
- embedded/common/visual-editor/editor-addon.class.php +62 -60
- embedded/common/visual-editor/res/js/icl_editor_addon_plugin.js +68 -33
- embedded/common/wplogger.php +6 -6
- embedded/frontend.php +64 -17
- embedded/functions.php +10 -47
- embedded/includes/ajax.php +166 -97
- embedded/includes/api.php +3 -2
- embedded/includes/classes/class.types.data.installer.php +268 -0
- embedded/includes/custom-taxonomies.php +19 -5
- embedded/includes/custom-types.php +65 -32
- embedded/includes/editor-support/post-relationship-editor-support.php +0 -4
- embedded/includes/examples/google_map.php +12 -0
- embedded/includes/fields-post.php +10 -14
- embedded/includes/fields.php +41 -30
- embedded/includes/fields/audio.php +1 -1
- embedded/includes/fields/checkbox.php +1 -1
- embedded/includes/fields/date.php +11 -11
- embedded/includes/fields/date/calendar.php +12 -6
- embedded/includes/fields/date/functions.php +13 -30
- embedded/includes/fields/embed.php +14 -11
- embedded/includes/fields/file.php +21 -84
- embedded/includes/fields/image.php +46 -72
- embedded/includes/fields/skype.php +9 -4
- embedded/includes/fields/textarea.php +1 -1
- embedded/includes/fields/video.php +11 -6
- embedded/includes/fields/wysiwyg.php +15 -5
- embedded/includes/import-export.php +55 -21
- embedded/includes/module-manager.php +11 -8
- embedded/includes/post-relationship.php +72 -20
- embedded/includes/relationship/child-table.php +6 -2
- embedded/includes/usermeta-add-user.php +1 -2
- embedded/includes/usermeta-post.php +1 -0
- embedded/includes/usermeta.php +6 -8
- embedded/includes/wpml.php +76 -68
- embedded/models/relationship.php +31 -29
- embedded/onthego-resources/loader.php +1 -2
- embedded/onthego-resources/onthego-styles/onthego-admin-styles.css +9 -0
- embedded/onthego-resources/onthego-styles/onthego-colors.css +1 -1
- embedded/onthego-resources/onthegosystems-icons/.fontcustom-manifest.json +32 -24
- embedded/onthego-resources/onthegosystems-icons/css/_onthegosystems-icons.scss +10 -6
- embedded/onthego-resources/onthegosystems-icons/css/onthegosystems-icons.css +10 -6
- embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons-preview.html +37 -7
- embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.woff +0 -0
- embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.eot → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot} +0 -0
- embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.svg → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg} +13 -7
- embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.ttf → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf} +0 -0
- embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff +0 -0
- embedded/onthego-resources/onthegosystems-icons/vectors/packager-logo.svg +14 -0
- embedded/onthego-resources/onthegosystems-icons/vectors/packager.svg +9 -0
- embedded/onthego-resources/onthegosystems-icons/vectors/{wpml logo.svg → wpml-logo.svg} +0 -0
- embedded/plugin.php +6 -6
- embedded/readme.txt +9 -0
- embedded/resources/css/basic.css +13 -2
- embedded/resources/css/colorbox.css +2 -2
- embedded/resources/css/dashicons.css +1 -1
- embedded/resources/css/usermeta.css +3 -3
- embedded/resources/js/basic.js +26 -17
- embedded/resources/js/fields-form.js +27 -13
- embedded/resources/js/fields-post.js +3 -1
- embedded/resources/js/post-relationship.js +9 -7
- embedded/usermeta-init.php +87 -79
- embedded/views/image.php +4 -2
- embedded/views/templates/editor-modal-checkbox.tpl.php +3 -3
- embedded/views/templates/editor-modal-checkboxes.tpl.php +3 -3
- embedded/views/templates/editor-modal-date.tpl.php +0 -4
- help.php +1 -1
- includes/ajax.php +62 -34
- includes/classes/class.wpcf.custom.fields.list.table.php +486 -0
- includes/classes/class.wpcf.custom.post.types.list.table.php +468 -0
- includes/classes/class.wpcf.custom.taxonomies.list.table.php +466 -0
- includes/classes/class.wpcf.user.fields.list.table.php +475 -0
- includes/common-functions.php +1 -1
- includes/conditional-display.php +16 -5
- includes/custom-taxonomies-form.php +77 -28
- includes/custom-types-form.php +72 -49
- includes/custom-types-taxonomies-list.php +40 -109
- includes/fields-control.php +58 -22
- includes/fields-form.php +185 -256
- includes/fields-list.php +20 -98
- includes/fields.php +157 -54
- includes/fields/checkbox.php +6 -0
- includes/fields/checkboxes.php +11 -5
- includes/fields/radio.php +10 -6
- includes/fields/select.php +8 -5
- includes/import-export.php +21 -15
- includes/migration.php +28 -33
- includes/post-relationship.php +191 -178
- includes/settings.php +2 -17
- includes/usermeta-control.php +61 -26
- includes/usermeta-form.php +163 -156
- includes/usermeta-list.php +18 -70
- includes/usermeta.php +49 -15
- marketing/helpful-links.php +9 -2
- plus/installer/changelog.txt +10 -3
- plus/installer/includes/deps-loader.class.php +0 -558
- plus/installer/includes/installer.class.php +300 -80
- plus/installer/installer.php +1 -2
- plus/installer/loader.php +10 -2
- plus/installer/res/css/admin.css +10 -0
- plus/installer/res/js/admin.js +22 -0
- plus/installer/res/js/iframeResizer.min.js +10 -10
- plus/types-access.php +5 -5
- plus/types-access/includes/admin-edit-access.php +27 -27
- readme.txt +30 -11
- resources/css/basic.css +0 -6
- resources/js/basic.js +1 -1
admin.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Admin functions
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -29,13 +29,19 @@ if ( defined( 'DOING_AJAX' ) ) {
|
|
| 29 |
include_once WPCF_ABSPATH.'/classes/class.wpcf-marketing-messages.php';
|
| 30 |
new WPCF_Types_Marketing_Messages();
|
| 31 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
/**
|
| 33 |
* admin_init hook.
|
| 34 |
*/
|
| 35 |
function wpcf_admin_init_hook()
|
| 36 |
{
|
| 37 |
wp_register_style('wpcf-css-embedded', WPCF_EMBEDDED_RES_RELPATH . '/css/basic.css', array(), WPCF_VERSION );
|
| 38 |
-
wp_register_style('wpcf-css', WPCF_RES_RELPATH . '/css/basic.css', array(), WPCF_VERSION);
|
| 39 |
|
| 40 |
wp_enqueue_style( 'wpcf-promo-tabs', WPCF_EMBEDDED_RES_RELPATH . '/css/tabs.css', array(), WPCF_VERSION );
|
| 41 |
wp_enqueue_style('toolset-dashicons');
|
|
@@ -59,38 +65,38 @@ function wpcf_admin_menu_hook()
|
|
| 59 |
|
| 60 |
$subpages = array();
|
| 61 |
|
| 62 |
-
// Custom
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 63 |
$subpages['wpcf-ctt'] = array(
|
| 64 |
-
'
|
| 65 |
-
'menu_title' => __( 'Types & Taxonomies', 'wpcf' ),
|
| 66 |
'function' => 'wpcf_admin_menu_summary_ctt',
|
| 67 |
);
|
| 68 |
|
| 69 |
// Custom fields
|
| 70 |
$subpages['wpcf-cf'] = array(
|
| 71 |
-
'page_title' => __( 'Custom Fields', 'wpcf' ),
|
| 72 |
'menu_title' => __( 'Custom Fields', 'wpcf' ),
|
| 73 |
'function' => 'wpcf_admin_menu_summary',
|
| 74 |
);
|
| 75 |
|
| 76 |
// Custom Fields Control
|
| 77 |
$subpages['wpcf-custom-fields-control'] = array(
|
| 78 |
-
'page_title' => __( 'Custom Fields Control', 'wpcf' ),
|
| 79 |
'menu_title' => __( 'Custom Fields Control', 'wpcf' ),
|
| 80 |
'function' => 'wpcf_admin_menu_custom_fields_control',
|
| 81 |
);
|
| 82 |
|
| 83 |
// User Meta
|
| 84 |
$subpages['wpcf-um'] = array(
|
| 85 |
-
'page_title' => __( 'User Fields', 'wpcf' ),
|
| 86 |
'menu_title' => __( 'User Fields', 'wpcf' ),
|
| 87 |
'function' => 'wpcf_usermeta_summary',
|
| 88 |
-
'load_hook' => 'wpcf_admin_menu_summary_hook',
|
| 89 |
);
|
| 90 |
|
| 91 |
// User Fields Control
|
| 92 |
$subpages['wpcf-user-fields-control'] = array(
|
| 93 |
-
'page_title' => __( 'User Fields Control', 'wpcf' ),
|
| 94 |
'menu_title' => __( 'User Fields Control', 'wpcf' ),
|
| 95 |
'function' => 'wpcf_admin_menu_user_fields_control',
|
| 96 |
);
|
|
@@ -100,19 +106,16 @@ function wpcf_admin_menu_hook()
|
|
| 100 |
|
| 101 |
// Import/Export
|
| 102 |
$subpages['wpcf-import-export'] = array(
|
| 103 |
-
'page_title' => __( 'Import/Export', 'wpcf' ),
|
| 104 |
'menu_title' => __( 'Import/Export', 'wpcf' ),
|
| 105 |
'function' => 'wpcf_admin_menu_import_export',
|
| 106 |
);
|
| 107 |
|
| 108 |
// Settings
|
| 109 |
$subpages['wpcf-custom-settings'] = array(
|
| 110 |
-
'page_title' => __( 'Settings', 'wpcf' ),
|
| 111 |
'menu_title' => __( 'Settings', 'wpcf' ),
|
| 112 |
'function' => 'wpcf_admin_menu_settings',
|
| 113 |
'submenu' => array(
|
| 114 |
'wpcf-debug-information' => array(
|
| 115 |
-
'page_title' => __( 'Debug Information', 'wpcf' ),
|
| 116 |
'menu_title' => __( 'Debug Information', 'wpcf' ),
|
| 117 |
'function' => 'wpcf_admin_menu_debug_information',
|
| 118 |
),
|
|
@@ -190,6 +193,16 @@ function wpcf_admin_menu_debug_information()
|
|
| 190 |
require_once WPCF_EMBEDDED_ABSPATH.'/common/debug/debug-information.php';
|
| 191 |
}
|
| 192 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 193 |
/**
|
| 194 |
* Menu page hook.
|
| 195 |
*/
|
|
@@ -197,6 +210,7 @@ function wpcf_admin_menu_summary_hook()
|
|
| 197 |
{
|
| 198 |
do_action( 'wpcf_admin_page_init' );
|
| 199 |
wpcf_admin_load_collapsible();
|
|
|
|
| 200 |
}
|
| 201 |
|
| 202 |
/**
|
|
@@ -204,16 +218,19 @@ function wpcf_admin_menu_summary_hook()
|
|
| 204 |
*/
|
| 205 |
function wpcf_admin_menu_summary()
|
| 206 |
{
|
| 207 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 208 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 209 |
require_once WPCF_INC_ABSPATH . '/fields-list.php';
|
| 210 |
$to_display = wpcf_admin_fields_get_fields();
|
| 211 |
if ( !empty( $to_display ) ) {
|
| 212 |
-
add_action( 'wpcf_groups_list_table_after',
|
| 213 |
-
'wpcf_admin_promotional_text' );
|
| 214 |
}
|
| 215 |
wpcf_admin_fields_list();
|
| 216 |
-
|
| 217 |
}
|
| 218 |
|
| 219 |
/**
|
|
@@ -293,69 +310,84 @@ function wpcf_admin_menu_edit_fields()
|
|
| 293 |
} else {
|
| 294 |
$title = __( 'Add New Group', 'wpcf' );
|
| 295 |
}
|
| 296 |
-
|
| 297 |
wpcf_wpml_warning();
|
| 298 |
$form = wpcf_form( 'wpcf_form_fields' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 299 |
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
}
|
| 310 |
-
jQuery('.wpcf-forms-set-legend').each(function () {
|
| 311 |
-
if (jQuery(this).val() == "<?php echo addslashes(__('Enter field name', 'wpcf')); ?>") {
|
| 312 |
-
jQuery(this).val('');
|
| 313 |
-
}
|
| 314 |
-
if (jQuery(this).next().val() == "<?php echo addslashes(__('Enter field slug', 'wpcf')); ?>") {
|
| 315 |
-
jQuery(this).next().val('');
|
| 316 |
-
}
|
| 317 |
-
if (jQuery(this).next().next().val() == "<?php echo addslashes(__('Describe this field', 'wpcf')); ?>") {
|
| 318 |
-
jQuery(this).next().next().val('');
|
| 319 |
-
}
|
| 320 |
-
});
|
| 321 |
-
}
|
| 322 |
-
</script>
|
| 323 |
-
|
| 324 |
-
<br /><form method="post" action="" class="wpcf-fields-form wpcf-form-validate" onsubmit="wpcf_group_submit()">
|
| 325 |
-
<?php echo $form->renderForm(); ?>
|
| 326 |
-
</form>
|
| 327 |
-
<?php
|
| 328 |
-
echo wpcf_add_admin_footer();
|
| 329 |
}
|
| 330 |
|
| 331 |
-
|
| 332 |
-
* Menu page hook.
|
| 333 |
-
*/
|
| 334 |
-
function wpcf_admin_menu_summary_ctt_hook()
|
| 335 |
{
|
| 336 |
do_action( 'wpcf_admin_page_init' );
|
| 337 |
-
wp_enqueue_style( 'wpcf-promo-tabs', WPCF_RES_RELPATH . '/css/tabs.css',
|
| 338 |
-
array(), WPCF_VERSION );
|
| 339 |
wpcf_admin_load_collapsible();
|
| 340 |
require_once WPCF_INC_ABSPATH . '/custom-types.php';
|
| 341 |
require_once WPCF_INC_ABSPATH . '/custom-taxonomies.php';
|
| 342 |
require_once WPCF_INC_ABSPATH . '/custom-types-taxonomies-list.php';
|
| 343 |
}
|
| 344 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 345 |
/**
|
| 346 |
* Menu page display.
|
| 347 |
*/
|
| 348 |
-
function
|
| 349 |
{
|
| 350 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 351 |
$to_display_posts = get_option( 'wpcf-custom-types', array() );
|
| 352 |
$to_display_tax = get_option( 'wpcf-custom-taxonomies', array() );
|
| 353 |
if ( !empty( $to_display_posts ) || !empty( $to_display_tax ) ) {
|
| 354 |
-
add_action( 'wpcf_types_tax_list_table_after',
|
| 355 |
-
'wpcf_admin_promotional_text' );
|
| 356 |
}
|
| 357 |
-
|
| 358 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 359 |
}
|
| 360 |
|
| 361 |
/**
|
|
@@ -402,14 +434,14 @@ function wpcf_admin_menu_edit_type()
|
|
| 402 |
} else {
|
| 403 |
$title = __( 'Add New Custom Post Type', 'wpcf' );
|
| 404 |
}
|
| 405 |
-
|
| 406 |
wpcf_wpml_warning();
|
| 407 |
$form = wpcf_form( 'wpcf_form_types' );
|
| 408 |
echo '<br /><form method="post" action="" class="wpcf-types-form '
|
| 409 |
. 'wpcf-form-validate">';
|
| 410 |
echo $form->renderForm();
|
| 411 |
echo '</form>';
|
| 412 |
-
|
| 413 |
}
|
| 414 |
|
| 415 |
/**
|
|
@@ -451,14 +483,14 @@ function wpcf_admin_menu_edit_tax()
|
|
| 451 |
} else {
|
| 452 |
$title = __( 'Add New Taxonomy', 'wpcf' );
|
| 453 |
}
|
| 454 |
-
|
| 455 |
wpcf_wpml_warning();
|
| 456 |
$form = wpcf_form( 'wpcf_form_tax' );
|
| 457 |
echo '<br /><form method="post" action="" class="wpcf-tax-form '
|
| 458 |
. 'wpcf-form-validate">';
|
| 459 |
echo $form->renderForm();
|
| 460 |
echo '</form>';
|
| 461 |
-
|
| 462 |
}
|
| 463 |
|
| 464 |
/**
|
|
@@ -481,12 +513,12 @@ function wpcf_admin_menu_import_export_hook()
|
|
| 481 |
*/
|
| 482 |
function wpcf_admin_menu_import_export()
|
| 483 |
{
|
| 484 |
-
|
| 485 |
echo '<br /><form method="post" action="" class="wpcf-import-export-form '
|
| 486 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 487 |
echo wpcf_form_simple( wpcf_admin_import_export_form() );
|
| 488 |
echo '</form>';
|
| 489 |
-
|
| 490 |
}
|
| 491 |
|
| 492 |
/**
|
|
@@ -505,7 +537,7 @@ function wpcf_admin_menu_custom_fields_control_hook()
|
|
| 505 |
&& wp_verify_nonce( $_REQUEST['_wpnonce'],
|
| 506 |
'custom_fields_control_bulk' )
|
| 507 |
&& (isset( $_POST['action'] ) || isset( $_POST['action2'] )) && !empty( $_POST['fields'] ) ) {
|
| 508 |
-
$action = $_POST['action'] == '-1' ? $_POST['action2'] : $_POST['action'];
|
| 509 |
wpcf_admin_custom_fields_control_bulk_actions( $action );
|
| 510 |
}
|
| 511 |
|
|
@@ -524,13 +556,13 @@ function wpcf_admin_menu_custom_fields_control_hook()
|
|
| 524 |
function wpcf_admin_menu_custom_fields_control()
|
| 525 |
{
|
| 526 |
global $wpcf_control_table;
|
| 527 |
-
|
| 528 |
echo '<form method="post" action="" id="wpcf-custom-fields-control-form" class="wpcf-custom-fields-control-form '
|
| 529 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 530 |
echo wpcf_admin_custom_fields_control_form( $wpcf_control_table );
|
| 531 |
wp_nonce_field( 'custom_fields_control_bulk' );
|
| 532 |
echo '</form>';
|
| 533 |
-
|
| 534 |
}
|
| 535 |
|
| 536 |
/**
|
|
@@ -552,13 +584,13 @@ function wpcf_admin_menu_migration_hook()
|
|
| 552 |
*/
|
| 553 |
function wpcf_admin_menu_migration()
|
| 554 |
{
|
| 555 |
-
|
| 556 |
echo '<br /><form method="post" action="" id="wpcf-migration-form" class="wpcf-migration-form '
|
| 557 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 558 |
$form = wpcf_form( 'wpcf_form_migration' );
|
| 559 |
echo $form->renderForm();
|
| 560 |
echo '</form>';
|
| 561 |
-
|
| 562 |
}
|
| 563 |
|
| 564 |
/**
|
|
@@ -583,7 +615,7 @@ function wpcf_admin_menu_settings()
|
|
| 583 |
{
|
| 584 |
$show_toolset_messages = !WPCF_Types_Marketing_Messages::check_register();
|
| 585 |
ob_start();
|
| 586 |
-
|
| 587 |
|
| 588 |
?>
|
| 589 |
<p style="font-weight: bold;"><?php
|
|
@@ -703,7 +735,7 @@ printf(
|
|
| 703 |
</tbody>
|
| 704 |
</table>
|
| 705 |
<?php
|
| 706 |
-
|
| 707 |
|
| 708 |
echo ob_get_clean();
|
| 709 |
}
|
|
@@ -715,12 +747,24 @@ printf(
|
|
| 715 |
* @param string $icon_id Custom icon
|
| 716 |
* @return string
|
| 717 |
*/
|
| 718 |
-
function wpcf_add_admin_header($title)
|
| 719 |
{
|
| 720 |
echo '<div class="wrap">';
|
| 721 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 722 |
do_action( 'wpcf_admin_header' );
|
| 723 |
-
do_action( 'wpcf_admin_header_' . $
|
| 724 |
}
|
| 725 |
|
| 726 |
/**
|
|
@@ -731,7 +775,8 @@ function wpcf_add_admin_header($title)
|
|
| 731 |
*/
|
| 732 |
function wpcf_add_admin_footer()
|
| 733 |
{
|
| 734 |
-
|
|
|
|
| 735 |
do_action( 'wpcf_admin_footer' );
|
| 736 |
echo '</div>';
|
| 737 |
}
|
|
@@ -811,7 +856,7 @@ function wpcf_admin_widefat_table( $ID, $header, $rows = array(), $empty_message
|
|
| 811 |
function wpcf_admin_tabs($tabs, $page, $default = '', $current = '')
|
| 812 |
{
|
| 813 |
if ( empty( $current ) && isset( $_GET['tab'] ) ) {
|
| 814 |
-
$current = $_GET['tab'];
|
| 815 |
} else {
|
| 816 |
$current = $default;
|
| 817 |
}
|
|
@@ -877,6 +922,7 @@ function wpcf_admin_plugin_help($hook, $page)
|
|
| 877 |
$call = 'custom_fields';
|
| 878 |
break;
|
| 879 |
|
|
|
|
| 880 |
case 'wpcf-ctt':
|
| 881 |
$call = 'custom_types_and_taxonomies';
|
| 882 |
break;
|
|
@@ -1006,6 +1052,7 @@ function wpcf_admin_deactivate_content($type, $arg, $action = 'delete')
|
|
| 1006 |
}
|
| 1007 |
if ( array_key_exists( $arg, $data['supports'] ) ) {
|
| 1008 |
unset( $custom[$post_type]['supports'][$arg] );
|
|
|
|
| 1009 |
}
|
| 1010 |
}
|
| 1011 |
update_option( 'wpcf-custom-taxonomies', $custom );
|
|
@@ -1022,6 +1069,7 @@ function wpcf_admin_deactivate_content($type, $arg, $action = 'delete')
|
|
| 1022 |
}
|
| 1023 |
if ( array_key_exists( $arg, $data['taxonomies'] ) ) {
|
| 1024 |
unset( $custom[$post_type]['taxonomies'][$arg] );
|
|
|
|
| 1025 |
}
|
| 1026 |
}
|
| 1027 |
update_option( 'wpcf-custom-types', $custom );
|
|
@@ -1142,7 +1190,7 @@ function wpcf_admin_add_submenu_page($menu, $menu_slug = null, $menu_parent = 'w
|
|
| 1142 |
*/
|
| 1143 |
$hook = add_submenu_page(
|
| 1144 |
$menu_parent,
|
| 1145 |
-
$menu['page_title'],
|
| 1146 |
$menu['menu_title'],
|
| 1147 |
$wpcf_capability,
|
| 1148 |
$menu_slug,
|
|
@@ -1175,3 +1223,25 @@ function wpcf_admin_add_submenu_page($menu, $menu_slug = null, $menu_parent = 'w
|
|
| 1175 |
return $hook;
|
| 1176 |
}
|
| 1177 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
*
|
| 4 |
* Admin functions
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/admin.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1120400 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 29 |
include_once WPCF_ABSPATH.'/classes/class.wpcf-marketing-messages.php';
|
| 30 |
new WPCF_Types_Marketing_Messages();
|
| 31 |
|
| 32 |
+
/**
|
| 33 |
+
* last edit flag
|
| 34 |
+
*/
|
| 35 |
+
if ( !defined('TOOLSET_EDIT_LAST' )){
|
| 36 |
+
define( 'TOOLSET_EDIT_LAST', '_toolset_edit_last');
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
/**
|
| 40 |
* admin_init hook.
|
| 41 |
*/
|
| 42 |
function wpcf_admin_init_hook()
|
| 43 |
{
|
| 44 |
wp_register_style('wpcf-css-embedded', WPCF_EMBEDDED_RES_RELPATH . '/css/basic.css', array(), WPCF_VERSION );
|
|
|
|
| 45 |
|
| 46 |
wp_enqueue_style( 'wpcf-promo-tabs', WPCF_EMBEDDED_RES_RELPATH . '/css/tabs.css', array(), WPCF_VERSION );
|
| 47 |
wp_enqueue_style('toolset-dashicons');
|
| 65 |
|
| 66 |
$subpages = array();
|
| 67 |
|
| 68 |
+
// Custom Post Types
|
| 69 |
+
$subpages['wpcf-cpt'] = array(
|
| 70 |
+
'menu_title' => __( 'Custom Post Types', 'wpcf' ),
|
| 71 |
+
'function' => 'wpcf_admin_menu_summary_cpt',
|
| 72 |
+
);
|
| 73 |
+
|
| 74 |
+
// Custom Taxonomies
|
| 75 |
$subpages['wpcf-ctt'] = array(
|
| 76 |
+
'menu_title' => __( 'Custom Taxonomies', 'wpcf' ),
|
|
|
|
| 77 |
'function' => 'wpcf_admin_menu_summary_ctt',
|
| 78 |
);
|
| 79 |
|
| 80 |
// Custom fields
|
| 81 |
$subpages['wpcf-cf'] = array(
|
|
|
|
| 82 |
'menu_title' => __( 'Custom Fields', 'wpcf' ),
|
| 83 |
'function' => 'wpcf_admin_menu_summary',
|
| 84 |
);
|
| 85 |
|
| 86 |
// Custom Fields Control
|
| 87 |
$subpages['wpcf-custom-fields-control'] = array(
|
|
|
|
| 88 |
'menu_title' => __( 'Custom Fields Control', 'wpcf' ),
|
| 89 |
'function' => 'wpcf_admin_menu_custom_fields_control',
|
| 90 |
);
|
| 91 |
|
| 92 |
// User Meta
|
| 93 |
$subpages['wpcf-um'] = array(
|
|
|
|
| 94 |
'menu_title' => __( 'User Fields', 'wpcf' ),
|
| 95 |
'function' => 'wpcf_usermeta_summary',
|
|
|
|
| 96 |
);
|
| 97 |
|
| 98 |
// User Fields Control
|
| 99 |
$subpages['wpcf-user-fields-control'] = array(
|
|
|
|
| 100 |
'menu_title' => __( 'User Fields Control', 'wpcf' ),
|
| 101 |
'function' => 'wpcf_admin_menu_user_fields_control',
|
| 102 |
);
|
| 106 |
|
| 107 |
// Import/Export
|
| 108 |
$subpages['wpcf-import-export'] = array(
|
|
|
|
| 109 |
'menu_title' => __( 'Import/Export', 'wpcf' ),
|
| 110 |
'function' => 'wpcf_admin_menu_import_export',
|
| 111 |
);
|
| 112 |
|
| 113 |
// Settings
|
| 114 |
$subpages['wpcf-custom-settings'] = array(
|
|
|
|
| 115 |
'menu_title' => __( 'Settings', 'wpcf' ),
|
| 116 |
'function' => 'wpcf_admin_menu_settings',
|
| 117 |
'submenu' => array(
|
| 118 |
'wpcf-debug-information' => array(
|
|
|
|
| 119 |
'menu_title' => __( 'Debug Information', 'wpcf' ),
|
| 120 |
'function' => 'wpcf_admin_menu_debug_information',
|
| 121 |
),
|
| 193 |
require_once WPCF_EMBEDDED_ABSPATH.'/common/debug/debug-information.php';
|
| 194 |
}
|
| 195 |
|
| 196 |
+
/**
|
| 197 |
+
* Menu page hook.
|
| 198 |
+
*/
|
| 199 |
+
function wpcf_usermeta_summary_hook()
|
| 200 |
+
{
|
| 201 |
+
do_action( 'wpcf_admin_page_init' );
|
| 202 |
+
wpcf_admin_load_collapsible();
|
| 203 |
+
wpcf_admin_page_add_options('uf', __( 'User Fields', 'wpcf' ));
|
| 204 |
+
}
|
| 205 |
+
|
| 206 |
/**
|
| 207 |
* Menu page hook.
|
| 208 |
*/
|
| 210 |
{
|
| 211 |
do_action( 'wpcf_admin_page_init' );
|
| 212 |
wpcf_admin_load_collapsible();
|
| 213 |
+
wpcf_admin_page_add_options('cf', __( 'Custom Fields', 'wpcf' ));
|
| 214 |
}
|
| 215 |
|
| 216 |
/**
|
| 218 |
*/
|
| 219 |
function wpcf_admin_menu_summary()
|
| 220 |
{
|
| 221 |
+
wpcf_add_admin_header(
|
| 222 |
+
__( 'Custom Fields', 'wpcf' ),
|
| 223 |
+
array('page'=>'wpcf-edit'),
|
| 224 |
+
__('Add New Group', 'wpcf')
|
| 225 |
+
);
|
| 226 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 227 |
require_once WPCF_INC_ABSPATH . '/fields-list.php';
|
| 228 |
$to_display = wpcf_admin_fields_get_fields();
|
| 229 |
if ( !empty( $to_display ) ) {
|
| 230 |
+
add_action( 'wpcf_groups_list_table_after', 'wpcf_admin_promotional_text' );
|
|
|
|
| 231 |
}
|
| 232 |
wpcf_admin_fields_list();
|
| 233 |
+
wpcf_add_admin_footer();
|
| 234 |
}
|
| 235 |
|
| 236 |
/**
|
| 310 |
} else {
|
| 311 |
$title = __( 'Add New Group', 'wpcf' );
|
| 312 |
}
|
| 313 |
+
wpcf_add_admin_header( $title );
|
| 314 |
wpcf_wpml_warning();
|
| 315 |
$form = wpcf_form( 'wpcf_form_fields' );
|
| 316 |
+
echo '<form method="post" action="" class="wpcf-fields-form wpcf-form-validate">';
|
| 317 |
+
echo '<div id="poststuff">';
|
| 318 |
+
echo $form->renderForm();
|
| 319 |
+
echo '</div>';
|
| 320 |
+
echo '</form>';
|
| 321 |
+
wpcf_add_admin_footer();
|
| 322 |
+
}
|
| 323 |
|
| 324 |
+
function wpcf_admin_page_add_options( $name, $label)
|
| 325 |
+
{
|
| 326 |
+
$option = 'per_page';
|
| 327 |
+
$args = array(
|
| 328 |
+
'label' => $label,
|
| 329 |
+
'default' => 10,
|
| 330 |
+
'option' => sprintf('wpcf_%s_%s', $name, $option),
|
| 331 |
+
);
|
| 332 |
+
add_screen_option( $option, $args );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 333 |
}
|
| 334 |
|
| 335 |
+
function wpcf_admin_menu_summary_cpt_ctt_hook()
|
|
|
|
|
|
|
|
|
|
| 336 |
{
|
| 337 |
do_action( 'wpcf_admin_page_init' );
|
| 338 |
+
wp_enqueue_style( 'wpcf-promo-tabs', WPCF_RES_RELPATH . '/css/tabs.css', array(), WPCF_VERSION );
|
|
|
|
| 339 |
wpcf_admin_load_collapsible();
|
| 340 |
require_once WPCF_INC_ABSPATH . '/custom-types.php';
|
| 341 |
require_once WPCF_INC_ABSPATH . '/custom-taxonomies.php';
|
| 342 |
require_once WPCF_INC_ABSPATH . '/custom-types-taxonomies-list.php';
|
| 343 |
}
|
| 344 |
|
| 345 |
+
/**
|
| 346 |
+
* Menu page hook.
|
| 347 |
+
*/
|
| 348 |
+
function wpcf_admin_menu_summary_cpt_hook()
|
| 349 |
+
{
|
| 350 |
+
wpcf_admin_menu_summary_cpt_ctt_hook();
|
| 351 |
+
wpcf_admin_page_add_options('cpt', __( 'Custom Post Types', 'wpcf' ));
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
/**
|
| 355 |
* Menu page display.
|
| 356 |
*/
|
| 357 |
+
function wpcf_admin_menu_summary_cpt()
|
| 358 |
{
|
| 359 |
+
wpcf_add_admin_header(
|
| 360 |
+
__( 'Custom Post Types', 'wpcf' ),
|
| 361 |
+
array('page'=>'wpcf-edit-type'),
|
| 362 |
+
__('Add New Custom Post Type', 'wpcf')
|
| 363 |
+
);
|
| 364 |
$to_display_posts = get_option( 'wpcf-custom-types', array() );
|
| 365 |
$to_display_tax = get_option( 'wpcf-custom-taxonomies', array() );
|
| 366 |
if ( !empty( $to_display_posts ) || !empty( $to_display_tax ) ) {
|
| 367 |
+
add_action( 'wpcf_types_tax_list_table_after', 'wpcf_admin_promotional_text' );
|
|
|
|
| 368 |
}
|
| 369 |
+
wpcf_admin_custom_post_types_list();
|
| 370 |
+
wpcf_add_admin_footer();
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
+
/**
|
| 374 |
+
* Menu page hook.
|
| 375 |
+
*/
|
| 376 |
+
function wpcf_admin_menu_summary_ctt_hook()
|
| 377 |
+
{
|
| 378 |
+
wpcf_admin_menu_summary_cpt_ctt_hook();
|
| 379 |
+
wpcf_admin_page_add_options('ctt', __( 'Custom Taxonomies', 'wpcf' ));
|
| 380 |
+
}
|
| 381 |
+
|
| 382 |
+
/**
|
| 383 |
+
* Menu page display.
|
| 384 |
+
*/
|
| 385 |
+
function wpcf_admin_menu_summary_ctt()
|
| 386 |
+
{
|
| 387 |
+
wpcf_add_admin_header( __( 'Custom Taxonomies', 'wpcf' ), array('page' => 'wpcf-edit-tax') );
|
| 388 |
+
wpcf_admin_custom_taxonomies_list();
|
| 389 |
+
do_action('wpcf_types_tax_list_table_after');
|
| 390 |
+
wpcf_add_admin_footer();
|
| 391 |
}
|
| 392 |
|
| 393 |
/**
|
| 434 |
} else {
|
| 435 |
$title = __( 'Add New Custom Post Type', 'wpcf' );
|
| 436 |
}
|
| 437 |
+
wpcf_add_admin_header( $title );
|
| 438 |
wpcf_wpml_warning();
|
| 439 |
$form = wpcf_form( 'wpcf_form_types' );
|
| 440 |
echo '<br /><form method="post" action="" class="wpcf-types-form '
|
| 441 |
. 'wpcf-form-validate">';
|
| 442 |
echo $form->renderForm();
|
| 443 |
echo '</form>';
|
| 444 |
+
wpcf_add_admin_footer();
|
| 445 |
}
|
| 446 |
|
| 447 |
/**
|
| 483 |
} else {
|
| 484 |
$title = __( 'Add New Taxonomy', 'wpcf' );
|
| 485 |
}
|
| 486 |
+
wpcf_add_admin_header( $title );
|
| 487 |
wpcf_wpml_warning();
|
| 488 |
$form = wpcf_form( 'wpcf_form_tax' );
|
| 489 |
echo '<br /><form method="post" action="" class="wpcf-tax-form '
|
| 490 |
. 'wpcf-form-validate">';
|
| 491 |
echo $form->renderForm();
|
| 492 |
echo '</form>';
|
| 493 |
+
wpcf_add_admin_footer();
|
| 494 |
}
|
| 495 |
|
| 496 |
/**
|
| 513 |
*/
|
| 514 |
function wpcf_admin_menu_import_export()
|
| 515 |
{
|
| 516 |
+
wpcf_add_admin_header( __( 'Import/Export', 'wpcf' ) );
|
| 517 |
echo '<br /><form method="post" action="" class="wpcf-import-export-form '
|
| 518 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 519 |
echo wpcf_form_simple( wpcf_admin_import_export_form() );
|
| 520 |
echo '</form>';
|
| 521 |
+
wpcf_add_admin_footer();
|
| 522 |
}
|
| 523 |
|
| 524 |
/**
|
| 537 |
&& wp_verify_nonce( $_REQUEST['_wpnonce'],
|
| 538 |
'custom_fields_control_bulk' )
|
| 539 |
&& (isset( $_POST['action'] ) || isset( $_POST['action2'] )) && !empty( $_POST['fields'] ) ) {
|
| 540 |
+
$action = ( $_POST['action'] == '-1' ) ? sanitize_text_field( $_POST['action2'] ) : sanitize_text_field( $_POST['action'] );
|
| 541 |
wpcf_admin_custom_fields_control_bulk_actions( $action );
|
| 542 |
}
|
| 543 |
|
| 556 |
function wpcf_admin_menu_custom_fields_control()
|
| 557 |
{
|
| 558 |
global $wpcf_control_table;
|
| 559 |
+
wpcf_add_admin_header( __( 'Custom Fields Control', 'wpcf' ) );
|
| 560 |
echo '<form method="post" action="" id="wpcf-custom-fields-control-form" class="wpcf-custom-fields-control-form '
|
| 561 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 562 |
echo wpcf_admin_custom_fields_control_form( $wpcf_control_table );
|
| 563 |
wp_nonce_field( 'custom_fields_control_bulk' );
|
| 564 |
echo '</form>';
|
| 565 |
+
wpcf_add_admin_footer();
|
| 566 |
}
|
| 567 |
|
| 568 |
/**
|
| 584 |
*/
|
| 585 |
function wpcf_admin_menu_migration()
|
| 586 |
{
|
| 587 |
+
wpcf_add_admin_header( __( 'Migration', 'wpcf' ) );
|
| 588 |
echo '<br /><form method="post" action="" id="wpcf-migration-form" class="wpcf-migration-form '
|
| 589 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 590 |
$form = wpcf_form( 'wpcf_form_migration' );
|
| 591 |
echo $form->renderForm();
|
| 592 |
echo '</form>';
|
| 593 |
+
wpcf_add_admin_footer();
|
| 594 |
}
|
| 595 |
|
| 596 |
/**
|
| 615 |
{
|
| 616 |
$show_toolset_messages = !WPCF_Types_Marketing_Messages::check_register();
|
| 617 |
ob_start();
|
| 618 |
+
wpcf_add_admin_header( __( 'Settings', 'wpcf' ) );
|
| 619 |
|
| 620 |
?>
|
| 621 |
<p style="font-weight: bold;"><?php
|
| 735 |
</tbody>
|
| 736 |
</table>
|
| 737 |
<?php
|
| 738 |
+
wpcf_add_admin_footer();
|
| 739 |
|
| 740 |
echo ob_get_clean();
|
| 741 |
}
|
| 747 |
* @param string $icon_id Custom icon
|
| 748 |
* @return string
|
| 749 |
*/
|
| 750 |
+
function wpcf_add_admin_header($title, $add_new = false, $add_new_title = false)
|
| 751 |
{
|
| 752 |
echo '<div class="wrap">';
|
| 753 |
+
echo '<h2>', $title;
|
| 754 |
+
if ( !$add_new_title ) {
|
| 755 |
+
$add_new_title = __('Add New', 'wpcf');
|
| 756 |
+
}
|
| 757 |
+
if ( $add_new ) {
|
| 758 |
+
printf(
|
| 759 |
+
' <a href="%s" class="add-new-h2">%s</a>',
|
| 760 |
+
add_query_arg( $add_new, admin_url('admin.php')),
|
| 761 |
+
$add_new_title
|
| 762 |
+
);
|
| 763 |
+
}
|
| 764 |
+
echo '</h2>';
|
| 765 |
+
$current_page = sanitize_text_field( $_GET['page'] );
|
| 766 |
do_action( 'wpcf_admin_header' );
|
| 767 |
+
do_action( 'wpcf_admin_header_' . $current_page );
|
| 768 |
}
|
| 769 |
|
| 770 |
/**
|
| 775 |
*/
|
| 776 |
function wpcf_add_admin_footer()
|
| 777 |
{
|
| 778 |
+
$current_page = sanitize_text_field( $_GET['page'] );
|
| 779 |
+
do_action( 'wpcf_admin_footer_' . $current_page );
|
| 780 |
do_action( 'wpcf_admin_footer' );
|
| 781 |
echo '</div>';
|
| 782 |
}
|
| 856 |
function wpcf_admin_tabs($tabs, $page, $default = '', $current = '')
|
| 857 |
{
|
| 858 |
if ( empty( $current ) && isset( $_GET['tab'] ) ) {
|
| 859 |
+
$current = sanitize_text_field( $_GET['tab'] );
|
| 860 |
} else {
|
| 861 |
$current = $default;
|
| 862 |
}
|
| 922 |
$call = 'custom_fields';
|
| 923 |
break;
|
| 924 |
|
| 925 |
+
case 'wpcf-cpt':
|
| 926 |
case 'wpcf-ctt':
|
| 927 |
$call = 'custom_types_and_taxonomies';
|
| 928 |
break;
|
| 1052 |
}
|
| 1053 |
if ( array_key_exists( $arg, $data['supports'] ) ) {
|
| 1054 |
unset( $custom[$post_type]['supports'][$arg] );
|
| 1055 |
+
$custom[$post_type][TOOLSET_EDIT_LAST] = time();
|
| 1056 |
}
|
| 1057 |
}
|
| 1058 |
update_option( 'wpcf-custom-taxonomies', $custom );
|
| 1069 |
}
|
| 1070 |
if ( array_key_exists( $arg, $data['taxonomies'] ) ) {
|
| 1071 |
unset( $custom[$post_type]['taxonomies'][$arg] );
|
| 1072 |
+
$custom[$post_type][TOOLSET_EDIT_LAST] = time();
|
| 1073 |
}
|
| 1074 |
}
|
| 1075 |
update_option( 'wpcf-custom-types', $custom );
|
| 1190 |
*/
|
| 1191 |
$hook = add_submenu_page(
|
| 1192 |
$menu_parent,
|
| 1193 |
+
isset($menu['page_title'])? $menu['page_title']:$menu['menu_title'],
|
| 1194 |
$menu['menu_title'],
|
| 1195 |
$wpcf_capability,
|
| 1196 |
$menu_slug,
|
| 1223 |
return $hook;
|
| 1224 |
}
|
| 1225 |
|
| 1226 |
+
/**
|
| 1227 |
+
* sort helper for tables
|
| 1228 |
+
*/
|
| 1229 |
+
function wpcf_usort_reorder($a,$b)
|
| 1230 |
+
{
|
| 1231 |
+
$orderby = (!empty($_REQUEST['orderby'])) ? sanitize_text_field( $_REQUEST['orderby'] ) : 'title'; //If no sort, default to title
|
| 1232 |
+
$order = (!empty($_REQUEST['order'])) ? sanitize_text_field( $_REQUEST['order'] ) : 'asc'; //If no order, default to asc
|
| 1233 |
+
if ( ! in_array( $order, array( 'asc', 'desc' ) ) ) {
|
| 1234 |
+
$order = 'asc';
|
| 1235 |
+
}
|
| 1236 |
+
if ('title' == $orderby || !isset($a[$orderby])) {
|
| 1237 |
+
$orderby = 'slug';
|
| 1238 |
+
}
|
| 1239 |
+
$result = strcmp($a[$orderby], $b[$orderby]); //Determine sort order
|
| 1240 |
+
return ($order==='asc') ? $result : -$result; //Send final sort direction to usort
|
| 1241 |
+
}
|
| 1242 |
+
|
| 1243 |
+
add_filter('set-screen-option', 'wpcf_table_set_option', 10, 3);
|
| 1244 |
+
function wpcf_table_set_option($status, $option, $value)
|
| 1245 |
+
{
|
| 1246 |
+
return $value;
|
| 1247 |
+
}
|
classes/class.wpcf-marketing-messages.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Types Marketing Class
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -43,8 +43,7 @@ class WPCF_Types_Marketing_Messages extends WPCF_Types_Marketing
|
|
| 43 |
return;
|
| 44 |
}
|
| 45 |
if ( self::check_register() ) {
|
| 46 |
-
|
| 47 |
-
$this->state = 'disabled';
|
| 48 |
}
|
| 49 |
}
|
| 50 |
|
|
@@ -122,8 +121,9 @@ class WPCF_Types_Marketing_Messages extends WPCF_Types_Marketing
|
|
| 122 |
&& array_key_exists('wpcf-post-type', $_GET)
|
| 123 |
) {
|
| 124 |
$types = get_option('wpcf-custom-types', array());
|
| 125 |
-
|
| 126 |
-
|
|
|
|
| 127 |
}
|
| 128 |
}
|
| 129 |
break;
|
|
@@ -134,15 +134,18 @@ class WPCF_Types_Marketing_Messages extends WPCF_Types_Marketing
|
|
| 134 |
&& array_key_exists('wpcf-tax', $_GET)
|
| 135 |
) {
|
| 136 |
$taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
|
|
|
| 140 |
$types = get_option('wpcf-custom-types', array());
|
| 141 |
-
$post_type = array_keys($taxonomies[$
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
|
|
|
|
|
|
| 146 |
}
|
| 147 |
}
|
| 148 |
}
|
|
@@ -218,6 +221,7 @@ class WPCF_Types_Marketing_Messages extends WPCF_Types_Marketing
|
|
| 218 |
array_key_exists($this->option_name, $_POST)
|
| 219 |
&& array_key_exists($_POST[$this->option_name], $this->options)
|
| 220 |
) {
|
|
|
|
| 221 |
if ( !add_option($this->option_name, $_POST[$this->option_name], '', 'no') ) {
|
| 222 |
update_option($this->option_name, $_POST[$this->option_name]);
|
| 223 |
}
|
|
@@ -306,6 +310,8 @@ class WPCF_Types_Marketing_Messages extends WPCF_Types_Marketing
|
|
| 306 |
return;
|
| 307 |
}
|
| 308 |
|
|
|
|
|
|
|
| 309 |
public function update_toolset_messages()
|
| 310 |
{
|
| 311 |
$settings = wpcf_get_settings();
|
| 3 |
*
|
| 4 |
* Types Marketing Class
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/classes/class.wpcf-marketing-messages.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1120400 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 43 |
return;
|
| 44 |
}
|
| 45 |
if ( self::check_register() ) {
|
| 46 |
+
$this->state = 'disabled';
|
|
|
|
| 47 |
}
|
| 48 |
}
|
| 49 |
|
| 121 |
&& array_key_exists('wpcf-post-type', $_GET)
|
| 122 |
) {
|
| 123 |
$types = get_option('wpcf-custom-types', array());
|
| 124 |
+
$candidate_key = sanitize_text_field( $_GET['wpcf-post-type'] );
|
| 125 |
+
if ( array_key_exists($candidate_key, $types ) ) {
|
| 126 |
+
$text = preg_replace( '/PPP/', $types[$candidate_key]['labels']['name'], $text);
|
| 127 |
}
|
| 128 |
}
|
| 129 |
break;
|
| 134 |
&& array_key_exists('wpcf-tax', $_GET)
|
| 135 |
) {
|
| 136 |
$taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 137 |
+
$candidate_key = sanitize_text_field( $_GET['wpcf-tax'] );
|
| 138 |
+
if ( array_key_exists($candidate_key, $taxonomies) ) {
|
| 139 |
+
$text = preg_replace( '/TTT/', $taxonomies[$candidate_key]['labels']['name'], $text);
|
| 140 |
+
if ( array_key_exists('supports', $taxonomies[$candidate_key]) ) {
|
| 141 |
$types = get_option('wpcf-custom-types', array());
|
| 142 |
+
$post_type = array_keys($taxonomies[$candidate_key]['supports']);
|
| 143 |
+
if ( !empty($post_type) ) {
|
| 144 |
+
$post_type = $post_type[array_rand($post_type)];
|
| 145 |
+
$post_type = get_post_type_object($post_type);
|
| 146 |
+
if ( $post_type ) {
|
| 147 |
+
$text = preg_replace( '/PPP/', $post_type->labels->name, $text);
|
| 148 |
+
}
|
| 149 |
}
|
| 150 |
}
|
| 151 |
}
|
| 221 |
array_key_exists($this->option_name, $_POST)
|
| 222 |
&& array_key_exists($_POST[$this->option_name], $this->options)
|
| 223 |
) {
|
| 224 |
+
// @todo we need to sanitize $_POST[$this->option_name]: is it a string, an array or what?
|
| 225 |
if ( !add_option($this->option_name, $_POST[$this->option_name], '', 'no') ) {
|
| 226 |
update_option($this->option_name, $_POST[$this->option_name]);
|
| 227 |
}
|
| 310 |
return;
|
| 311 |
}
|
| 312 |
|
| 313 |
+
// @todo nonce ?
|
| 314 |
+
// @todo auth ?
|
| 315 |
public function update_toolset_messages()
|
| 316 |
{
|
| 317 |
$settings = wpcf_get_settings();
|
classes/class.wpcf-marketing-tutorial.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Types Tutorial Class
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-02-
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 3 |
*
|
| 4 |
* Types Tutorial Class
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/classes/class.wpcf-marketing-tutorial.php $
|
| 7 |
+
* $LastChangedDate: 2015-02-18 14:28:53 +0000 (Wed, 18 Feb 2015) $
|
| 8 |
+
* $LastChangedRevision: 1093394 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
classes/class.wpcf-marketing.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Types Marketing Class
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-02-
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 3 |
*
|
| 4 |
* Types Marketing Class
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/classes/class.wpcf-marketing.php $
|
| 7 |
+
* $LastChangedDate: 2015-02-18 14:28:53 +0000 (Wed, 18 Feb 2015) $
|
| 8 |
+
* $LastChangedRevision: 1093394 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
embedded/admin.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate: 2015-01
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -52,11 +52,8 @@ function wpcf_embedded_admin_init_hook() {
|
|
| 52 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields/file.php';
|
| 53 |
// Add types button
|
| 54 |
add_filter( 'attachment_fields_to_edit', 'wpcf_fields_file_attachment_fields_to_edit_filter', PHP_INT_MAX, 2 );
|
| 55 |
-
// Add JS
|
| 56 |
-
add_action( 'admin_head', 'wpcf_fields_file_media_admin_head' );
|
| 57 |
// Filter media TABs
|
| 58 |
-
add_filter( 'media_upload_tabs',
|
| 59 |
-
'wpcf_fields_file_media_upload_tabs_filter' );
|
| 60 |
}
|
| 61 |
|
| 62 |
register_post_type( 'wp-types-group',
|
|
@@ -157,14 +154,15 @@ function wpcf_admin_fields_postfields_styles(){
|
|
| 157 |
|
| 158 |
// $groups = wpcf_admin_fields_get_groups();
|
| 159 |
$groups = wpcf_admin_post_get_post_groups_fields( wpcf_admin_get_edited_post() );
|
| 160 |
-
|
| 161 |
if ( !empty( $groups ) ) {
|
|
|
|
| 162 |
foreach ( $groups as $group ) {
|
| 163 |
echo str_replace( "}", "}\n",
|
| 164 |
wpcf_admin_get_groups_admin_styles_by_group( $group['id'] ) );
|
| 165 |
}
|
|
|
|
| 166 |
}
|
| 167 |
-
echo '</style>';
|
| 168 |
}
|
| 169 |
|
| 170 |
/**
|
|
@@ -293,16 +291,17 @@ function wpcf_admin_validation_messages( $method = false, $sprintf = '' ) {
|
|
| 293 |
'date' => __( 'Please enter a valid date', 'wpcf' ),
|
| 294 |
'digits' => __( 'Please enter numeric data', 'wpcf' ),
|
| 295 |
'number' => __( 'Please enter numeric data', 'wpcf' ),
|
| 296 |
-
'alphanumeric' => __( 'Letters, numbers, spaces or underscores only please',
|
| 297 |
-
|
| 298 |
-
'
|
| 299 |
-
|
| 300 |
-
'
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
|
|
|
| 306 |
);
|
| 307 |
if ( $method ) {
|
| 308 |
return isset( $messages[$method] ) ? $messages[$method] : '';
|
|
@@ -351,8 +350,20 @@ function wpcf_show_admin_messages() {
|
|
| 351 |
* @param type $class
|
| 352 |
* @return type
|
| 353 |
*/
|
| 354 |
-
function wpcf_admin_message_store( $message, $class = 'updated',
|
| 355 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 356 |
$messages = get_option( 'wpcf-messages', array() );
|
| 357 |
$messages[get_current_user_id()][md5( $message )] = array(
|
| 358 |
'message' => $message,
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/admin.php $
|
| 5 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 6 |
+
* $LastChangedRevision: 1125405 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 52 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields/file.php';
|
| 53 |
// Add types button
|
| 54 |
add_filter( 'attachment_fields_to_edit', 'wpcf_fields_file_attachment_fields_to_edit_filter', PHP_INT_MAX, 2 );
|
|
|
|
|
|
|
| 55 |
// Filter media TABs
|
| 56 |
+
add_filter( 'media_upload_tabs', 'wpcf_fields_file_media_upload_tabs_filter' );
|
|
|
|
| 57 |
}
|
| 58 |
|
| 59 |
register_post_type( 'wp-types-group',
|
| 154 |
|
| 155 |
// $groups = wpcf_admin_fields_get_groups();
|
| 156 |
$groups = wpcf_admin_post_get_post_groups_fields( wpcf_admin_get_edited_post() );
|
| 157 |
+
|
| 158 |
if ( !empty( $groups ) ) {
|
| 159 |
+
echo '<style type="text/css">';
|
| 160 |
foreach ( $groups as $group ) {
|
| 161 |
echo str_replace( "}", "}\n",
|
| 162 |
wpcf_admin_get_groups_admin_styles_by_group( $group['id'] ) );
|
| 163 |
}
|
| 164 |
+
echo '</style>';
|
| 165 |
}
|
|
|
|
| 166 |
}
|
| 167 |
|
| 168 |
/**
|
| 291 |
'date' => __( 'Please enter a valid date', 'wpcf' ),
|
| 292 |
'digits' => __( 'Please enter numeric data', 'wpcf' ),
|
| 293 |
'number' => __( 'Please enter numeric data', 'wpcf' ),
|
| 294 |
+
'alphanumeric' => __( 'Letters, numbers, spaces or underscores only please', 'wpcf' ),
|
| 295 |
+
'nospecialchars' => __( 'Letters, numbers, spaces, underscores and dashes only please', 'wpcf' ),
|
| 296 |
+
'rewriteslug' => __( 'Letters, numbers, slashes, underscores and dashes only please', 'wpcf' ),
|
| 297 |
+
'negativeTimestamp' => __( 'Please enter a date after 1 January 1970.', 'wpcf' ),
|
| 298 |
+
'maxlength' => sprintf( __( 'Maximum of %s characters exceeded.', 'wpcf' ), strval( $sprintf ) ),
|
| 299 |
+
'minlength' => sprintf( __( 'Minimum of %s characters exceeded.', 'wpcf' ), strval( $sprintf ) ),
|
| 300 |
+
/**
|
| 301 |
+
* see
|
| 302 |
+
* https://support.skype.com/en/faq/FA10858/what-is-a-skype-name-and-how-do-i-find-mine
|
| 303 |
+
*/
|
| 304 |
+
'skype' => __( 'Letters, numbers, dashes, underscores, commas and periods only please.', 'wpcf' ),
|
| 305 |
);
|
| 306 |
if ( $method ) {
|
| 307 |
return isset( $messages[$method] ) ? $messages[$method] : '';
|
| 350 |
* @param type $class
|
| 351 |
* @return type
|
| 352 |
*/
|
| 353 |
+
function wpcf_admin_message_store( $message, $class = 'updated', $keep_id = false )
|
| 354 |
+
{
|
| 355 |
+
/**
|
| 356 |
+
* Allow to store or note
|
| 357 |
+
*
|
| 358 |
+
* Filter allow to turn off storing messages in Types
|
| 359 |
+
*
|
| 360 |
+
* @since 1.6.6
|
| 361 |
+
*
|
| 362 |
+
* @param boolean $var default value is true to show messages
|
| 363 |
+
*/
|
| 364 |
+
if (!apply_filters('wpcf_admin_message_store', true) ) {
|
| 365 |
+
return;
|
| 366 |
+
}
|
| 367 |
$messages = get_option( 'wpcf-messages', array() );
|
| 368 |
$messages[get_current_user_id()][md5( $message )] = array(
|
| 369 |
'message' => $message,
|
embedded/bootstrap.php
CHANGED
|
@@ -7,9 +7,9 @@
|
|
| 7 |
*
|
| 8 |
* @since Types 1.2
|
| 9 |
*
|
| 10 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 11 |
-
* $LastChangedDate: 2015-
|
| 12 |
-
* $LastChangedRevision:
|
| 13 |
* $LastChangedBy: iworks $
|
| 14 |
*
|
| 15 |
*/
|
|
@@ -43,6 +43,12 @@ if ( !defined( 'TYPES_INIT_PRIORITY' ) ) {
|
|
| 43 |
*/
|
| 44 |
add_action( 'init', 'wpcf_embedded_init', TYPES_INIT_PRIORITY );
|
| 45 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 46 |
/*
|
| 47 |
*
|
| 48 |
*
|
|
@@ -131,7 +137,7 @@ function wpcf_embedded_init() {
|
|
| 131 |
// Define necessary constants if plugin is not present
|
| 132 |
// This ones are skipped if used as embedded code!
|
| 133 |
if ( !defined( 'WPCF_VERSION' ) ) {
|
| 134 |
-
define( 'WPCF_VERSION', '1.6.
|
| 135 |
define( 'WPCF_META_PREFIX', 'wpcf-' );
|
| 136 |
}
|
| 137 |
|
|
@@ -314,10 +320,6 @@ function wpcf_embedded_init() {
|
|
| 314 |
// Init loader
|
| 315 |
WPCF_Loader::init();
|
| 316 |
|
| 317 |
-
// Init custom types and taxonomies
|
| 318 |
-
wpcf_init_custom_types_taxonomies();
|
| 319 |
-
|
| 320 |
-
|
| 321 |
/*
|
| 322 |
* TODO Check why we enabled this
|
| 323 |
*
|
| 7 |
*
|
| 8 |
* @since Types 1.2
|
| 9 |
*
|
| 10 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/bootstrap.php $
|
| 11 |
+
* $LastChangedDate: 2015-04-01 14:17:52 +0000 (Wed, 01 Apr 2015) $
|
| 12 |
+
* $LastChangedRevision: 1125409 $
|
| 13 |
* $LastChangedBy: iworks $
|
| 14 |
*
|
| 15 |
*/
|
| 43 |
*/
|
| 44 |
add_action( 'init', 'wpcf_embedded_init', TYPES_INIT_PRIORITY );
|
| 45 |
|
| 46 |
+
/**
|
| 47 |
+
* register_post_type & register_taxonomy - must be with default pririty to
|
| 48 |
+
* handle defult taxonomies
|
| 49 |
+
*/
|
| 50 |
+
add_action( 'init', 'wpcf_init_custom_types_taxonomies');
|
| 51 |
+
|
| 52 |
/*
|
| 53 |
*
|
| 54 |
*
|
| 137 |
// Define necessary constants if plugin is not present
|
| 138 |
// This ones are skipped if used as embedded code!
|
| 139 |
if ( !defined( 'WPCF_VERSION' ) ) {
|
| 140 |
+
define( 'WPCF_VERSION', '1.6.6' );
|
| 141 |
define( 'WPCF_META_PREFIX', 'wpcf-' );
|
| 142 |
}
|
| 143 |
|
| 320 |
// Init loader
|
| 321 |
WPCF_Loader::init();
|
| 322 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 323 |
/*
|
| 324 |
* TODO Check why we enabled this
|
| 325 |
*
|
embedded/classes/class.wpcf-post-types.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Post Types Class
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate:
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -29,6 +29,237 @@ class WPCF_Post_Types
|
|
| 29 |
var $settings;
|
| 30 |
var $messages = null;
|
| 31 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
function set($post_type, $settings = null)
|
| 33 |
{
|
| 34 |
$data = get_post_type_object( $post_type );
|
| 3 |
*
|
| 4 |
* Post Types Class
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/class.wpcf-post-types.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1113864 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 29 |
var $settings;
|
| 30 |
var $messages = null;
|
| 31 |
|
| 32 |
+
function __construct()
|
| 33 |
+
{
|
| 34 |
+
add_action('admin_init', array($this, 'admin_init'));
|
| 35 |
+
add_action('admin_head-nav-menus.php', array($this, 'add_filters'));
|
| 36 |
+
add_filter('wp_setup_nav_menu_item', array( $this, 'setup_archive_item'));
|
| 37 |
+
add_filter('wp_nav_menu_objects', array( $this, 'maybe_make_current'));
|
| 38 |
+
}
|
| 39 |
+
/**
|
| 40 |
+
* Check has some custom fields to display.
|
| 41 |
+
*
|
| 42 |
+
* Check custom post type for custom fields to display on custom post edit
|
| 43 |
+
* screen.
|
| 44 |
+
*
|
| 45 |
+
* @since 1.6.6
|
| 46 |
+
* @access (for functions: only use if private)
|
| 47 |
+
*
|
| 48 |
+
* @return bool It has some fields?
|
| 49 |
+
*/
|
| 50 |
+
private function check_has_custom_fields($data)
|
| 51 |
+
{
|
| 52 |
+
return
|
| 53 |
+
isset($data['custom_fields'])
|
| 54 |
+
&& is_array($data['custom_fields'])
|
| 55 |
+
&& !empty($data['custom_fields']);
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* Admin init.
|
| 60 |
+
*
|
| 61 |
+
* Admin init function used to add columns..
|
| 62 |
+
*
|
| 63 |
+
* @since 1.6.6
|
| 64 |
+
*/
|
| 65 |
+
public function admin_init()
|
| 66 |
+
{
|
| 67 |
+
$custom_post_types = wpcf_get_active_custom_types();
|
| 68 |
+
foreach( $custom_post_types as $post_type => $data ) {
|
| 69 |
+
if ( $this->check_has_custom_fields($data)) {
|
| 70 |
+
$hook = sprintf('manage_edit-%s_columns', $post_type);
|
| 71 |
+
add_filter($hook, array($this, 'manage_posts_columns'));
|
| 72 |
+
$hook = sprintf('manage_%s_posts_custom_column', $post_type);
|
| 73 |
+
add_action($hook, array($this, 'manage_custom_columns'), 10, 2);
|
| 74 |
+
}
|
| 75 |
+
}
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
/**
|
| 79 |
+
* Add custom fields as a columns.
|
| 80 |
+
*
|
| 81 |
+
* Add custom fields as a columns on custom post admin list
|
| 82 |
+
*
|
| 83 |
+
* @since 1.6.6
|
| 84 |
+
*
|
| 85 |
+
* @param array $columns Hashtable of columns;
|
| 86 |
+
* @return array Hashtable of columns;
|
| 87 |
+
*/
|
| 88 |
+
public function manage_posts_columns($columns)
|
| 89 |
+
{
|
| 90 |
+
$screen = get_current_screen();
|
| 91 |
+
if ( !isset( $screen->post_type) ) {
|
| 92 |
+
return $columns;
|
| 93 |
+
}
|
| 94 |
+
$custom_post_types = wpcf_get_active_custom_types();
|
| 95 |
+
if(
|
| 96 |
+
!isset($custom_post_types[$screen->post_type])
|
| 97 |
+
|| !$this->check_has_custom_fields($custom_post_types[$screen->post_type])
|
| 98 |
+
) {
|
| 99 |
+
return $columns;
|
| 100 |
+
}
|
| 101 |
+
$fields = wpcf_admin_fields_get_fields();
|
| 102 |
+
ksort($fields);
|
| 103 |
+
foreach( $fields as $key => $data ) {
|
| 104 |
+
if ( !isset($data['meta_key']) ) {
|
| 105 |
+
continue;
|
| 106 |
+
}
|
| 107 |
+
if ( in_array($data['meta_key'], $custom_post_types[$screen->post_type]['custom_fields']) ) {
|
| 108 |
+
$columns[$data['meta_key']] = $data['name'];
|
| 109 |
+
}
|
| 110 |
+
}
|
| 111 |
+
return $columns;
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
/**
|
| 115 |
+
* Show value of custom field.
|
| 116 |
+
*
|
| 117 |
+
* Show value of custom field.
|
| 118 |
+
*
|
| 119 |
+
* @since 1.6.6
|
| 120 |
+
*
|
| 121 |
+
* @param string $column Column name,
|
| 122 |
+
* @param int $var Current post ID.
|
| 123 |
+
*/
|
| 124 |
+
public function manage_custom_columns($column, $post_id)
|
| 125 |
+
{
|
| 126 |
+
$value = get_post_meta($post_id, $column, true);
|
| 127 |
+
if ( empty($value) ) {
|
| 128 |
+
return;
|
| 129 |
+
}
|
| 130 |
+
$field = wpcf_admin_fields_get_field_by_meta_key($column);
|
| 131 |
+
if ( isset( $field['type'] ) ) {
|
| 132 |
+
switch( $field['type'] ) {
|
| 133 |
+
case 'image':
|
| 134 |
+
$value = sprintf(
|
| 135 |
+
'<img src="%s" width="120" />',
|
| 136 |
+
$value
|
| 137 |
+
);
|
| 138 |
+
break;
|
| 139 |
+
case 'skype':
|
| 140 |
+
$value = isset($value['skypename'])? $value['skypename']:'';
|
| 141 |
+
break;
|
| 142 |
+
case 'date':
|
| 143 |
+
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.php';
|
| 144 |
+
$value = WPToolset_Field_Date::timetodate($value);
|
| 145 |
+
break;
|
| 146 |
+
}
|
| 147 |
+
}
|
| 148 |
+
if ( is_string($value ) ) {
|
| 149 |
+
echo $value;
|
| 150 |
+
}
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
/**
|
| 154 |
+
* Assign menu item the appropriate url
|
| 155 |
+
* @param object $menu_item
|
| 156 |
+
* @return object $menu_item
|
| 157 |
+
*/
|
| 158 |
+
public function setup_archive_item( $menu_item ) {
|
| 159 |
+
if ( $menu_item->type !== 'post_type_archive' ) {
|
| 160 |
+
return $menu_item;
|
| 161 |
+
}
|
| 162 |
+
$post_type = $menu_item->object;
|
| 163 |
+
if (post_type_exists( $post_type )) {
|
| 164 |
+
$data = get_post_type_object( $post_type );
|
| 165 |
+
$menu_item->type_label = sprintf( __( 'Archive for %s', 'wpcf' ), $data->labels->name);
|
| 166 |
+
$menu_item->url = get_post_type_archive_link( $post_type );
|
| 167 |
+
}
|
| 168 |
+
return $menu_item;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
public function add_filters()
|
| 172 |
+
{
|
| 173 |
+
$custom_post_types = wpcf_get_active_custom_types();
|
| 174 |
+
if ( empty($custom_post_types) ) {
|
| 175 |
+
return;
|
| 176 |
+
}
|
| 177 |
+
foreach ( $custom_post_types as $slug => $data ) {
|
| 178 |
+
add_filter( 'nav_menu_items_' . $slug, array( $this, 'add_archive_checkbox' ), null, 3 );
|
| 179 |
+
}
|
| 180 |
+
}
|
| 181 |
+
|
| 182 |
+
public function add_archive_checkbox( $posts, $args, $post_type )
|
| 183 |
+
{
|
| 184 |
+
global $_nav_menu_placeholder, $wp_rewrite;
|
| 185 |
+
$_nav_menu_placeholder = ( 0 > $_nav_menu_placeholder ) ? intval($_nav_menu_placeholder) - 1 : -1;
|
| 186 |
+
|
| 187 |
+
array_unshift( $posts, (object) array(
|
| 188 |
+
'ID' => 0,
|
| 189 |
+
'object_id' => $_nav_menu_placeholder,
|
| 190 |
+
'post_title' => $post_type['args']->labels->all_items,
|
| 191 |
+
'post_type' => 'nav_menu_item',
|
| 192 |
+
'type' => 'post_type_archive',
|
| 193 |
+
'object' => $post_type['args']->slug,
|
| 194 |
+
) );
|
| 195 |
+
|
| 196 |
+
return $posts;
|
| 197 |
+
}
|
| 198 |
+
|
| 199 |
+
/**
|
| 200 |
+
* Make post type archive link 'current'
|
| 201 |
+
* @uses Post_Type_Archive_Links :: get_item_ancestors()
|
| 202 |
+
* @param array $items
|
| 203 |
+
* @return array $items
|
| 204 |
+
*/
|
| 205 |
+
public function maybe_make_current( $items ) {
|
| 206 |
+
foreach ( $items as $item ) {
|
| 207 |
+
if ( 'post_type_archive' !== $item->type ) {
|
| 208 |
+
continue;
|
| 209 |
+
}
|
| 210 |
+
$post_type = $item->object;
|
| 211 |
+
if (
|
| 212 |
+
! is_post_type_archive( $post_type )
|
| 213 |
+
AND ! is_singular( $post_type )
|
| 214 |
+
)
|
| 215 |
+
continue;
|
| 216 |
+
|
| 217 |
+
// Make item current
|
| 218 |
+
$item->current = true;
|
| 219 |
+
$item->classes[] = 'current-menu-item';
|
| 220 |
+
|
| 221 |
+
// Loop through ancestors and give them 'parent' or 'ancestor' class
|
| 222 |
+
$active_anc_item_ids = $this->get_item_ancestors( $item );
|
| 223 |
+
foreach ( $items as $key => $parent_item ) {
|
| 224 |
+
$classes = (array) $parent_item->classes;
|
| 225 |
+
|
| 226 |
+
// If menu item is the parent
|
| 227 |
+
if ( $parent_item->db_id == $item->menu_item_parent ) {
|
| 228 |
+
$classes[] = 'current-menu-parent';
|
| 229 |
+
$items[ $key ]->current_item_parent = true;
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
// If menu item is an ancestor
|
| 233 |
+
if ( in_array( intval( $parent_item->db_id ), $active_anc_item_ids ) ) {
|
| 234 |
+
$classes[] = 'current-menu-ancestor';
|
| 235 |
+
$items[ $key ]->current_item_ancestor = true;
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
$items[ $key ]->classes = array_unique( $classes );
|
| 239 |
+
}
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
return $items;
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
/**
|
| 246 |
+
* Get menu item's ancestors
|
| 247 |
+
* @param object $item
|
| 248 |
+
* @return array $active_anc_item_ids
|
| 249 |
+
*/
|
| 250 |
+
public function get_item_ancestors( $item ) {
|
| 251 |
+
$anc_id = absint( $item->db_id );
|
| 252 |
+
|
| 253 |
+
$active_anc_item_ids = array();
|
| 254 |
+
while (
|
| 255 |
+
$anc_id = get_post_meta( $anc_id, '_menu_item_menu_item_parent', true )
|
| 256 |
+
AND ! in_array( $anc_id, $active_anc_item_ids )
|
| 257 |
+
)
|
| 258 |
+
$active_anc_item_ids[] = $anc_id;
|
| 259 |
+
|
| 260 |
+
return $active_anc_item_ids;
|
| 261 |
+
}
|
| 262 |
+
|
| 263 |
function set($post_type, $settings = null)
|
| 264 |
{
|
| 265 |
$data = get_post_type_object( $post_type );
|
embedded/classes/editor.php
CHANGED
|
@@ -284,8 +284,7 @@ class WPCF_Editor
|
|
| 284 |
/*
|
| 285 |
* Callback
|
| 286 |
*/
|
| 287 |
-
$shortcode = call_user_func( $function, $_POST, $this->field,
|
| 288 |
-
$this->_meta_type );
|
| 289 |
} else {
|
| 290 |
/*
|
| 291 |
* Generic
|
|
@@ -305,8 +304,7 @@ class WPCF_Editor
|
|
| 305 |
*/
|
| 306 |
$shortcode = preg_replace( '@</?script[^>]*>@im', '', wp_kses_post($shortcode) );
|
| 307 |
// Add additional parameters if required
|
| 308 |
-
$shortcode = $this->_add_parameters_to_shortcode( $shortcode,
|
| 309 |
-
$_POST );
|
| 310 |
// Insert shortcode
|
| 311 |
echo '<script type="text/javascript">jQuery(function(){tedFrame.close(\''
|
| 312 |
. $shortcode . '\', \'' . esc_js( $shortcode ) . '\');});</script>';
|
| 284 |
/*
|
| 285 |
* Callback
|
| 286 |
*/
|
| 287 |
+
$shortcode = call_user_func( $function, $_POST, $this->field, $this->_meta_type );
|
|
|
|
| 288 |
} else {
|
| 289 |
/*
|
| 290 |
* Generic
|
| 304 |
*/
|
| 305 |
$shortcode = preg_replace( '@</?script[^>]*>@im', '', wp_kses_post($shortcode) );
|
| 306 |
// Add additional parameters if required
|
| 307 |
+
$shortcode = $this->_add_parameters_to_shortcode( $shortcode, $_POST );
|
|
|
|
| 308 |
// Insert shortcode
|
| 309 |
echo '<script type="text/javascript">jQuery(function(){tedFrame.close(\''
|
| 310 |
. $shortcode . '\', \'' . esc_js( $shortcode ) . '\');});</script>';
|
embedded/classes/field.php
CHANGED
|
@@ -2,37 +2,37 @@
|
|
| 2 |
/*
|
| 3 |
* Field class.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
|
| 12 |
/**
|
| 13 |
* Base class.
|
| 14 |
-
*
|
| 15 |
* Fields are our core items and we'll use this class to sort them out a little.
|
| 16 |
* Very useful, should be used to finish small tasks for field.
|
| 17 |
-
*
|
| 18 |
* Example:
|
| 19 |
-
*
|
| 20 |
* // Setup field
|
| 21 |
* global $wpcf;
|
| 22 |
* $my_field = new WPCF_Field();
|
| 23 |
* $my_field->set($wpcf->post, wpcf_admin_fields_get_field('image'));
|
| 24 |
-
*
|
| 25 |
* // Use it
|
| 26 |
* $my_field->save();
|
| 27 |
-
*
|
| 28 |
* // Generic instance can be found in global $wpcf.
|
| 29 |
* global $wpcf;
|
| 30 |
* $wpcf->field->set(...);
|
| 31 |
-
*
|
| 32 |
* !! BE CAREFUL !! not to disturb global instance if you suspect processing
|
| 33 |
* current item is not finished. Core code sometimes use same instance over
|
| 34 |
* few functions and places.
|
| 35 |
-
*
|
| 36 |
* @since Types 1.2
|
| 37 |
* @package Types
|
| 38 |
* @subpackage Classes
|
|
@@ -45,18 +45,18 @@ class WPCF_Field
|
|
| 45 |
|
| 46 |
/**
|
| 47 |
* Field structure
|
| 48 |
-
*
|
| 49 |
* This is actually a form array collected from files per specific field:
|
| 50 |
* /embedded/includes/fields/$field_type.php
|
| 51 |
* /includes/fields/$field_type.php
|
| 52 |
-
*
|
| 53 |
* @var type array
|
| 54 |
*/
|
| 55 |
var $cf = array();
|
| 56 |
|
| 57 |
/**
|
| 58 |
* All Types created fields
|
| 59 |
-
* @var type
|
| 60 |
*/
|
| 61 |
var $fields = null;
|
| 62 |
|
|
@@ -68,9 +68,9 @@ class WPCF_Field
|
|
| 68 |
|
| 69 |
/**
|
| 70 |
* Field config.
|
| 71 |
-
*
|
| 72 |
* Use it to set default configuration.
|
| 73 |
-
*
|
| 74 |
* @var type array
|
| 75 |
*/
|
| 76 |
var $config = array(
|
|
@@ -102,8 +102,8 @@ class WPCF_Field
|
|
| 102 |
|
| 103 |
/**
|
| 104 |
* Cache.DEPRECATED
|
| 105 |
-
*
|
| 106 |
-
* @var type
|
| 107 |
*/
|
| 108 |
var $cache = array();
|
| 109 |
|
|
@@ -115,25 +115,25 @@ class WPCF_Field
|
|
| 115 |
|
| 116 |
/**
|
| 117 |
* Context in which class is called
|
| 118 |
-
* @var type
|
| 119 |
*/
|
| 120 |
var $context = 'group';
|
| 121 |
|
| 122 |
/**
|
| 123 |
* Invalid fields
|
| 124 |
-
*
|
| 125 |
* @todo Revise
|
| 126 |
-
* @var type
|
| 127 |
*/
|
| 128 |
var $invalid_fields = array();
|
| 129 |
|
| 130 |
/**
|
| 131 |
-
* ID
|
| 132 |
*/
|
| 133 |
var $ID = '';
|
| 134 |
|
| 135 |
/**
|
| 136 |
-
* Unique ID
|
| 137 |
*/
|
| 138 |
var $unique_id = '';
|
| 139 |
|
|
@@ -144,16 +144,16 @@ class WPCF_Field
|
|
| 144 |
|
| 145 |
/**
|
| 146 |
* Set current post and field.
|
| 147 |
-
*
|
| 148 |
* @param type $post
|
| 149 |
-
* @param type $cf
|
| 150 |
*/
|
| 151 |
function set( $post, $cf ) {
|
| 152 |
|
| 153 |
global $wpcf;
|
| 154 |
|
| 155 |
/*
|
| 156 |
-
*
|
| 157 |
* Check if $cf is string
|
| 158 |
*/
|
| 159 |
if ( is_string( $cf ) ) {
|
|
@@ -218,8 +218,8 @@ class WPCF_Field
|
|
| 218 |
|
| 219 |
/**
|
| 220 |
* Set needed but not required form elements.
|
| 221 |
-
*
|
| 222 |
-
* @param string $cf
|
| 223 |
*/
|
| 224 |
function _parse_cf_form_element( $cf ) {
|
| 225 |
$p = array('#before' => '', '#after' => '', '#description' => '');
|
|
@@ -233,8 +233,9 @@ class WPCF_Field
|
|
| 233 |
|
| 234 |
/**
|
| 235 |
* Fetch and sort fields.
|
| 236 |
-
*
|
| 237 |
-
* @global
|
|
|
|
| 238 |
*/
|
| 239 |
function _get_meta() {
|
| 240 |
global $wpdb;
|
|
@@ -309,8 +310,8 @@ class WPCF_Field
|
|
| 309 |
|
| 310 |
/**
|
| 311 |
* Gets $_POST data.
|
| 312 |
-
*
|
| 313 |
-
* @return type
|
| 314 |
*/
|
| 315 |
function get_submitted_data() {
|
| 316 |
$posted = isset( $_POST['wpcf'][$this->cf['slug']] ) ? $_POST['wpcf'][$this->cf['slug']] : null;
|
|
@@ -320,12 +321,12 @@ class WPCF_Field
|
|
| 320 |
|
| 321 |
/**
|
| 322 |
* Save field.
|
| 323 |
-
*
|
| 324 |
* If $value is empty, $_POST will be checked.
|
| 325 |
* 1.3.2 Reverted saving empty fields
|
| 326 |
* removed - if ( !empty( $value ) || is_numeric( $value ) ) {
|
| 327 |
-
*
|
| 328 |
-
* @param type $value
|
| 329 |
*/
|
| 330 |
function save( $value = null )
|
| 331 |
{
|
|
@@ -394,9 +395,9 @@ class WPCF_Field
|
|
| 394 |
|
| 395 |
/**
|
| 396 |
* Apply filters to saved value.
|
| 397 |
-
*
|
| 398 |
* @param type $value
|
| 399 |
-
* @return type
|
| 400 |
*/
|
| 401 |
function _filter_save_value( $value )
|
| 402 |
{
|
|
@@ -411,7 +412,7 @@ class WPCF_Field
|
|
| 411 |
/**
|
| 412 |
* Use these hooks to add future functionality.
|
| 413 |
* Do not add any more code to core.
|
| 414 |
-
*
|
| 415 |
* @param type $field
|
| 416 |
* @param type $value
|
| 417 |
* @param type $meta_id
|
|
@@ -442,8 +443,8 @@ class WPCF_Field
|
|
| 442 |
|
| 443 |
/**
|
| 444 |
* Sets field config.
|
| 445 |
-
*
|
| 446 |
-
* @return type
|
| 447 |
*/
|
| 448 |
function _get_config() {
|
| 449 |
$this->_include_file_by_field_type($this->cf['type']);
|
|
@@ -456,7 +457,7 @@ class WPCF_Field
|
|
| 456 |
|
| 457 |
/**
|
| 458 |
* Discouraged usage.
|
| 459 |
-
*
|
| 460 |
* @return type
|
| 461 |
*/
|
| 462 |
function _deprecated_inherited_allowed() {
|
|
@@ -471,8 +472,8 @@ class WPCF_Field
|
|
| 471 |
|
| 472 |
/**
|
| 473 |
* Sets field meta box form.
|
| 474 |
-
*
|
| 475 |
-
* @return type
|
| 476 |
*/
|
| 477 |
function _get_meta_form( $meta_value = null, $meta_id = null, $wrap = true ) {
|
| 478 |
|
|
@@ -484,7 +485,7 @@ class WPCF_Field
|
|
| 484 |
|
| 485 |
/*
|
| 486 |
* Set value
|
| 487 |
-
*
|
| 488 |
* IMPORTANT
|
| 489 |
* Here we set values for form elements
|
| 490 |
*/
|
|
@@ -506,10 +507,10 @@ class WPCF_Field
|
|
| 506 |
}
|
| 507 |
|
| 508 |
/*
|
| 509 |
-
*
|
| 510 |
-
*
|
| 511 |
-
*
|
| 512 |
-
*
|
| 513 |
* Since Types 1.2
|
| 514 |
* Avoid using parent (inherited) type
|
| 515 |
* $this->config->inherited_field_type
|
|
@@ -549,7 +550,7 @@ class WPCF_Field
|
|
| 549 |
$func = 'wpcf_fields_' . $this->cf['type'] . '_meta_box_form';
|
| 550 |
if ( is_callable( $func ) ) {
|
| 551 |
/*
|
| 552 |
-
*
|
| 553 |
* From Types 1.2 use complete form setup
|
| 554 |
*/
|
| 555 |
$form_meta_box = call_user_func_array( 'wpcf_fields_'
|
|
@@ -576,7 +577,7 @@ class WPCF_Field
|
|
| 576 |
foreach ( $form as $element_key => $element ) {
|
| 577 |
|
| 578 |
/*
|
| 579 |
-
*
|
| 580 |
* Start using __ in keys to skip element
|
| 581 |
*/
|
| 582 |
// Skip protected
|
|
@@ -696,10 +697,17 @@ class WPCF_Field
|
|
| 696 |
|
| 697 |
/**
|
| 698 |
* Use this function to add final filters to HTML output.
|
| 699 |
-
*
|
| 700 |
-
* @param type $output
|
| 701 |
*/
|
| 702 |
-
function html( $html, $params )
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 703 |
/**
|
| 704 |
*
|
| 705 |
* Exception when RAW = TRUE.
|
|
@@ -712,20 +720,18 @@ class WPCF_Field
|
|
| 712 |
$html = htmlspecialchars( $html );
|
| 713 |
}
|
| 714 |
// Process shortcodes too
|
| 715 |
-
// $shortcode = do_shortcode( $html );
|
| 716 |
$html = do_shortcode( htmlspecialchars_decode( stripslashes( $html ) ) );
|
| 717 |
-
|
| 718 |
return $html;
|
| 719 |
}
|
| 720 |
|
| 721 |
/**
|
| 722 |
* Determines if field is created with Types.
|
| 723 |
-
*
|
| 724 |
* @param type $field_key
|
| 725 |
*/
|
| 726 |
function is_under_control( $field_key ) {
|
| 727 |
/*
|
| 728 |
-
*
|
| 729 |
* We force checking our meta prefix
|
| 730 |
*/
|
| 731 |
$key = $this->__get_slug_no_prefix( $field_key );
|
|
@@ -734,7 +740,7 @@ class WPCF_Field
|
|
| 734 |
|
| 735 |
/**
|
| 736 |
* Return slug.
|
| 737 |
-
*
|
| 738 |
* @param type $meta_key
|
| 739 |
* @return type
|
| 740 |
*/
|
|
@@ -745,14 +751,14 @@ class WPCF_Field
|
|
| 745 |
|
| 746 |
/**
|
| 747 |
* Returns altered element form name.
|
| 748 |
-
*
|
| 749 |
* Use $prefix to set name like:
|
| 750 |
* wpcf_post_relationship[214][wpcf-my-checkbox]
|
| 751 |
-
*
|
| 752 |
* Or if multi array
|
| 753 |
* wpcf_post_relationship[214][wpcf-my-date][datepicker]
|
| 754 |
* wpcf_post_relationship[214][wpcf-my-date][hour]
|
| 755 |
-
*
|
| 756 |
* @param type $prefix
|
| 757 |
* @param type $name
|
| 758 |
* @return type
|
|
@@ -769,7 +775,7 @@ class WPCF_Field
|
|
| 769 |
. $this->post->ID
|
| 770 |
. '][' . $this->slug . ']';
|
| 771 |
/*
|
| 772 |
-
*
|
| 773 |
* Multi array case
|
| 774 |
*/
|
| 775 |
} else {
|
| 2 |
/*
|
| 3 |
* Field class.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/field.php $
|
| 6 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 7 |
+
* $LastChangedRevision: 1125405 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
|
| 12 |
/**
|
| 13 |
* Base class.
|
| 14 |
+
*
|
| 15 |
* Fields are our core items and we'll use this class to sort them out a little.
|
| 16 |
* Very useful, should be used to finish small tasks for field.
|
| 17 |
+
*
|
| 18 |
* Example:
|
| 19 |
+
*
|
| 20 |
* // Setup field
|
| 21 |
* global $wpcf;
|
| 22 |
* $my_field = new WPCF_Field();
|
| 23 |
* $my_field->set($wpcf->post, wpcf_admin_fields_get_field('image'));
|
| 24 |
+
*
|
| 25 |
* // Use it
|
| 26 |
* $my_field->save();
|
| 27 |
+
*
|
| 28 |
* // Generic instance can be found in global $wpcf.
|
| 29 |
* global $wpcf;
|
| 30 |
* $wpcf->field->set(...);
|
| 31 |
+
*
|
| 32 |
* !! BE CAREFUL !! not to disturb global instance if you suspect processing
|
| 33 |
* current item is not finished. Core code sometimes use same instance over
|
| 34 |
* few functions and places.
|
| 35 |
+
*
|
| 36 |
* @since Types 1.2
|
| 37 |
* @package Types
|
| 38 |
* @subpackage Classes
|
| 45 |
|
| 46 |
/**
|
| 47 |
* Field structure
|
| 48 |
+
*
|
| 49 |
* This is actually a form array collected from files per specific field:
|
| 50 |
* /embedded/includes/fields/$field_type.php
|
| 51 |
* /includes/fields/$field_type.php
|
| 52 |
+
*
|
| 53 |
* @var type array
|
| 54 |
*/
|
| 55 |
var $cf = array();
|
| 56 |
|
| 57 |
/**
|
| 58 |
* All Types created fields
|
| 59 |
+
* @var type
|
| 60 |
*/
|
| 61 |
var $fields = null;
|
| 62 |
|
| 68 |
|
| 69 |
/**
|
| 70 |
* Field config.
|
| 71 |
+
*
|
| 72 |
* Use it to set default configuration.
|
| 73 |
+
*
|
| 74 |
* @var type array
|
| 75 |
*/
|
| 76 |
var $config = array(
|
| 102 |
|
| 103 |
/**
|
| 104 |
* Cache.DEPRECATED
|
| 105 |
+
*
|
| 106 |
+
* @var type
|
| 107 |
*/
|
| 108 |
var $cache = array();
|
| 109 |
|
| 115 |
|
| 116 |
/**
|
| 117 |
* Context in which class is called
|
| 118 |
+
* @var type
|
| 119 |
*/
|
| 120 |
var $context = 'group';
|
| 121 |
|
| 122 |
/**
|
| 123 |
* Invalid fields
|
| 124 |
+
*
|
| 125 |
* @todo Revise
|
| 126 |
+
* @var type
|
| 127 |
*/
|
| 128 |
var $invalid_fields = array();
|
| 129 |
|
| 130 |
/**
|
| 131 |
+
* ID
|
| 132 |
*/
|
| 133 |
var $ID = '';
|
| 134 |
|
| 135 |
/**
|
| 136 |
+
* Unique ID
|
| 137 |
*/
|
| 138 |
var $unique_id = '';
|
| 139 |
|
| 144 |
|
| 145 |
/**
|
| 146 |
* Set current post and field.
|
| 147 |
+
*
|
| 148 |
* @param type $post
|
| 149 |
+
* @param type $cf
|
| 150 |
*/
|
| 151 |
function set( $post, $cf ) {
|
| 152 |
|
| 153 |
global $wpcf;
|
| 154 |
|
| 155 |
/*
|
| 156 |
+
*
|
| 157 |
* Check if $cf is string
|
| 158 |
*/
|
| 159 |
if ( is_string( $cf ) ) {
|
| 218 |
|
| 219 |
/**
|
| 220 |
* Set needed but not required form elements.
|
| 221 |
+
*
|
| 222 |
+
* @param string $cf
|
| 223 |
*/
|
| 224 |
function _parse_cf_form_element( $cf ) {
|
| 225 |
$p = array('#before' => '', '#after' => '', '#description' => '');
|
| 233 |
|
| 234 |
/**
|
| 235 |
* Fetch and sort fields.
|
| 236 |
+
*
|
| 237 |
+
* @global object $wpdb
|
| 238 |
+
*
|
| 239 |
*/
|
| 240 |
function _get_meta() {
|
| 241 |
global $wpdb;
|
| 310 |
|
| 311 |
/**
|
| 312 |
* Gets $_POST data.
|
| 313 |
+
*
|
| 314 |
+
* @return type
|
| 315 |
*/
|
| 316 |
function get_submitted_data() {
|
| 317 |
$posted = isset( $_POST['wpcf'][$this->cf['slug']] ) ? $_POST['wpcf'][$this->cf['slug']] : null;
|
| 321 |
|
| 322 |
/**
|
| 323 |
* Save field.
|
| 324 |
+
*
|
| 325 |
* If $value is empty, $_POST will be checked.
|
| 326 |
* 1.3.2 Reverted saving empty fields
|
| 327 |
* removed - if ( !empty( $value ) || is_numeric( $value ) ) {
|
| 328 |
+
*
|
| 329 |
+
* @param type $value
|
| 330 |
*/
|
| 331 |
function save( $value = null )
|
| 332 |
{
|
| 395 |
|
| 396 |
/**
|
| 397 |
* Apply filters to saved value.
|
| 398 |
+
*
|
| 399 |
* @param type $value
|
| 400 |
+
* @return type
|
| 401 |
*/
|
| 402 |
function _filter_save_value( $value )
|
| 403 |
{
|
| 412 |
/**
|
| 413 |
* Use these hooks to add future functionality.
|
| 414 |
* Do not add any more code to core.
|
| 415 |
+
*
|
| 416 |
* @param type $field
|
| 417 |
* @param type $value
|
| 418 |
* @param type $meta_id
|
| 443 |
|
| 444 |
/**
|
| 445 |
* Sets field config.
|
| 446 |
+
*
|
| 447 |
+
* @return type
|
| 448 |
*/
|
| 449 |
function _get_config() {
|
| 450 |
$this->_include_file_by_field_type($this->cf['type']);
|
| 457 |
|
| 458 |
/**
|
| 459 |
* Discouraged usage.
|
| 460 |
+
*
|
| 461 |
* @return type
|
| 462 |
*/
|
| 463 |
function _deprecated_inherited_allowed() {
|
| 472 |
|
| 473 |
/**
|
| 474 |
* Sets field meta box form.
|
| 475 |
+
*
|
| 476 |
+
* @return type
|
| 477 |
*/
|
| 478 |
function _get_meta_form( $meta_value = null, $meta_id = null, $wrap = true ) {
|
| 479 |
|
| 485 |
|
| 486 |
/*
|
| 487 |
* Set value
|
| 488 |
+
*
|
| 489 |
* IMPORTANT
|
| 490 |
* Here we set values for form elements
|
| 491 |
*/
|
| 507 |
}
|
| 508 |
|
| 509 |
/*
|
| 510 |
+
*
|
| 511 |
+
*
|
| 512 |
+
*
|
| 513 |
+
*
|
| 514 |
* Since Types 1.2
|
| 515 |
* Avoid using parent (inherited) type
|
| 516 |
* $this->config->inherited_field_type
|
| 550 |
$func = 'wpcf_fields_' . $this->cf['type'] . '_meta_box_form';
|
| 551 |
if ( is_callable( $func ) ) {
|
| 552 |
/*
|
| 553 |
+
*
|
| 554 |
* From Types 1.2 use complete form setup
|
| 555 |
*/
|
| 556 |
$form_meta_box = call_user_func_array( 'wpcf_fields_'
|
| 577 |
foreach ( $form as $element_key => $element ) {
|
| 578 |
|
| 579 |
/*
|
| 580 |
+
*
|
| 581 |
* Start using __ in keys to skip element
|
| 582 |
*/
|
| 583 |
// Skip protected
|
| 697 |
|
| 698 |
/**
|
| 699 |
* Use this function to add final filters to HTML output.
|
| 700 |
+
*
|
| 701 |
+
* @param type $output
|
| 702 |
*/
|
| 703 |
+
function html( $html, $params )
|
| 704 |
+
{
|
| 705 |
+
/**
|
| 706 |
+
* check input
|
| 707 |
+
*/
|
| 708 |
+
if ( is_array($html) || is_object($html) ) {
|
| 709 |
+
return '';
|
| 710 |
+
}
|
| 711 |
/**
|
| 712 |
*
|
| 713 |
* Exception when RAW = TRUE.
|
| 720 |
$html = htmlspecialchars( $html );
|
| 721 |
}
|
| 722 |
// Process shortcodes too
|
|
|
|
| 723 |
$html = do_shortcode( htmlspecialchars_decode( stripslashes( $html ) ) );
|
|
|
|
| 724 |
return $html;
|
| 725 |
}
|
| 726 |
|
| 727 |
/**
|
| 728 |
* Determines if field is created with Types.
|
| 729 |
+
*
|
| 730 |
* @param type $field_key
|
| 731 |
*/
|
| 732 |
function is_under_control( $field_key ) {
|
| 733 |
/*
|
| 734 |
+
*
|
| 735 |
* We force checking our meta prefix
|
| 736 |
*/
|
| 737 |
$key = $this->__get_slug_no_prefix( $field_key );
|
| 740 |
|
| 741 |
/**
|
| 742 |
* Return slug.
|
| 743 |
+
*
|
| 744 |
* @param type $meta_key
|
| 745 |
* @return type
|
| 746 |
*/
|
| 751 |
|
| 752 |
/**
|
| 753 |
* Returns altered element form name.
|
| 754 |
+
*
|
| 755 |
* Use $prefix to set name like:
|
| 756 |
* wpcf_post_relationship[214][wpcf-my-checkbox]
|
| 757 |
+
*
|
| 758 |
* Or if multi array
|
| 759 |
* wpcf_post_relationship[214][wpcf-my-date][datepicker]
|
| 760 |
* wpcf_post_relationship[214][wpcf-my-date][hour]
|
| 761 |
+
*
|
| 762 |
* @param type $prefix
|
| 763 |
* @param type $name
|
| 764 |
* @return type
|
| 775 |
. $this->post->ID
|
| 776 |
. '][' . $this->slug . ']';
|
| 777 |
/*
|
| 778 |
+
*
|
| 779 |
* Multi array case
|
| 780 |
*/
|
| 781 |
} else {
|
embedded/classes/fields.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
/**
|
| 3 |
* Fields class.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2014-05-07 06:56:23 +0000 (Wed, 07 May 2014) $
|
| 7 |
* $LastChangedRevision: 909470 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
/**
|
| 3 |
* Fields class.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/fields.php $
|
| 6 |
* $LastChangedDate: 2014-05-07 06:56:23 +0000 (Wed, 07 May 2014) $
|
| 7 |
* $LastChangedRevision: 909470 $
|
| 8 |
* $LastChangedBy: iworks $
|
embedded/classes/forms.php
CHANGED
|
@@ -4,10 +4,10 @@
|
|
| 4 |
*
|
| 5 |
* Returns HTML formatted output for elements and handles form submission.
|
| 6 |
*
|
| 7 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 8 |
-
* $LastChangedDate:
|
| 9 |
-
* $LastChangedRevision:
|
| 10 |
-
* $LastChangedBy:
|
| 11 |
*
|
| 12 |
*
|
| 13 |
* @version 1.0
|
|
@@ -125,8 +125,10 @@ class Enlimbo_Forms_Wpcf
|
|
| 125 |
if ( empty( $id ) ) {
|
| 126 |
$id = $this->_id;
|
| 127 |
}
|
| 128 |
-
return (
|
| 129 |
-
|
|
|
|
|
|
|
| 130 |
}
|
| 131 |
|
| 132 |
/**
|
|
@@ -920,9 +922,15 @@ class Enlimbo_Forms_Wpcf
|
|
| 920 |
array('textfield', 'textarea') ) ? '' : 0;
|
| 921 |
}
|
| 922 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 923 |
$parts = explode( '[', $name );
|
| 924 |
-
$parts = array_map(
|
| 925 |
-
$parts );
|
| 926 |
if ( !isset( $_REQUEST[$parts[0]] ) ) {
|
| 927 |
return in_array( $element['#type'], array('textfield', 'textarea') ) ? '' : 0;
|
| 928 |
}
|
| 4 |
*
|
| 5 |
* Returns HTML formatted output for elements and handles form submission.
|
| 6 |
*
|
| 7 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/forms.php $
|
| 8 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 9 |
+
* $LastChangedRevision: 1113864 $
|
| 10 |
+
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
*
|
| 13 |
* @version 1.0
|
| 125 |
if ( empty( $id ) ) {
|
| 126 |
$id = $this->_id;
|
| 127 |
}
|
| 128 |
+
return (
|
| 129 |
+
isset( $_REQUEST['_wpnonce_wpcf'] )
|
| 130 |
+
&& wp_verify_nonce( $_REQUEST['_wpnonce_wpcf'], $id )
|
| 131 |
+
);
|
| 132 |
}
|
| 133 |
|
| 134 |
/**
|
| 922 |
array('textfield', 'textarea') ) ? '' : 0;
|
| 923 |
}
|
| 924 |
|
| 925 |
+
if ( !function_exists('getSubmittedDataTrim')) {
|
| 926 |
+
function getSubmittedDataTrim($a)
|
| 927 |
+
{
|
| 928 |
+
return trim($a, ']');
|
| 929 |
+
}
|
| 930 |
+
}
|
| 931 |
+
|
| 932 |
$parts = explode( '[', $name );
|
| 933 |
+
$parts = array_map( 'getSubmittedDataTrim', $parts );
|
|
|
|
| 934 |
if ( !isset( $_REQUEST[$parts[0]] ) ) {
|
| 935 |
return in_array( $element['#type'], array('textfield', 'textarea') ) ? '' : 0;
|
| 936 |
}
|
embedded/classes/loader.php
CHANGED
|
@@ -3,16 +3,16 @@
|
|
| 3 |
*
|
| 4 |
* Loader class
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate:
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 12 |
|
| 13 |
/**
|
| 14 |
* Loader Class
|
| 15 |
-
*
|
| 16 |
* @since Types 1.2
|
| 17 |
* @package Types
|
| 18 |
* @subpackage Classes
|
|
@@ -25,7 +25,7 @@ class WPCF_Loader
|
|
| 25 |
|
| 26 |
/**
|
| 27 |
* Settings
|
| 28 |
-
* @var array
|
| 29 |
*/
|
| 30 |
private static $__settings = array();
|
| 31 |
|
|
@@ -38,11 +38,14 @@ class WPCF_Loader
|
|
| 38 |
array('WPCF_Loader', 'renderJsSettings'), 5 );
|
| 39 |
add_filter( 'the_posts', array('WPCF_Loader', 'wpcf_cache_complete_postmeta') );
|
| 40 |
}
|
| 41 |
-
|
| 42 |
/**
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
|
|
|
|
|
|
|
|
|
| 46 |
public static function wpcf_cache_complete_postmeta( $posts ) {
|
| 47 |
global $wpdb;
|
| 48 |
if ( !$posts )
|
|
@@ -54,7 +57,7 @@ class WPCF_Loader
|
|
| 54 |
$cache_key_looped_post = md5( 'post::_is_cached' . $post->ID );
|
| 55 |
$cached_object = wp_cache_get( $cache_key_looped_post, $cache_group_ids );
|
| 56 |
if ( false === $cached_object ) {
|
| 57 |
-
$post_ids[] = $post->ID;
|
| 58 |
wp_cache_add( $cache_key_looped_post, $post->ID, $cache_group_ids );
|
| 59 |
}
|
| 60 |
}
|
|
@@ -150,7 +153,7 @@ class WPCF_Loader
|
|
| 150 |
|
| 151 |
/**
|
| 152 |
* Returns HTML formatted output.
|
| 153 |
-
*
|
| 154 |
* @param string $view
|
| 155 |
* @param mixed $data
|
| 156 |
* @return string
|
|
@@ -171,7 +174,7 @@ class WPCF_Loader
|
|
| 171 |
|
| 172 |
/**
|
| 173 |
* Returns HTML formatted output.
|
| 174 |
-
*
|
| 175 |
* @param string $view
|
| 176 |
* @param mixed $data
|
| 177 |
* @return string
|
|
@@ -187,7 +190,7 @@ class WPCF_Loader
|
|
| 187 |
|
| 188 |
/**
|
| 189 |
* Returns HTML formatted output.
|
| 190 |
-
*
|
| 191 |
* @param string $template
|
| 192 |
* @param mixed $data
|
| 193 |
* @return string
|
|
@@ -208,7 +211,7 @@ class WPCF_Loader
|
|
| 208 |
|
| 209 |
/**
|
| 210 |
* Loads model.
|
| 211 |
-
*
|
| 212 |
* @param string $template
|
| 213 |
* @param mixed $data
|
| 214 |
* @return string
|
|
@@ -224,7 +227,7 @@ class WPCF_Loader
|
|
| 224 |
|
| 225 |
/**
|
| 226 |
* Loads class.
|
| 227 |
-
*
|
| 228 |
* @param string $template
|
| 229 |
* @param mixed $data
|
| 230 |
* @return string
|
|
@@ -240,7 +243,7 @@ class WPCF_Loader
|
|
| 240 |
|
| 241 |
/**
|
| 242 |
* Loads include.
|
| 243 |
-
*
|
| 244 |
* @param string $template
|
| 245 |
* @param mixed $data
|
| 246 |
* @return string
|
|
@@ -256,7 +259,7 @@ class WPCF_Loader
|
|
| 256 |
|
| 257 |
/**
|
| 258 |
* Adds JS settings.
|
| 259 |
-
*
|
| 260 |
* @staticvar array $settings
|
| 261 |
* @param type $id
|
| 262 |
* @param type $setting
|
| 3 |
*
|
| 4 |
* Loader class
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/loader.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1120400 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 12 |
|
| 13 |
/**
|
| 14 |
* Loader Class
|
| 15 |
+
*
|
| 16 |
* @since Types 1.2
|
| 17 |
* @package Types
|
| 18 |
* @subpackage Classes
|
| 25 |
|
| 26 |
/**
|
| 27 |
* Settings
|
| 28 |
+
* @var array
|
| 29 |
*/
|
| 30 |
private static $__settings = array();
|
| 31 |
|
| 38 |
array('WPCF_Loader', 'renderJsSettings'), 5 );
|
| 39 |
add_filter( 'the_posts', array('WPCF_Loader', 'wpcf_cache_complete_postmeta') );
|
| 40 |
}
|
| 41 |
+
|
| 42 |
/**
|
| 43 |
+
* Cache the postmeta for posts returned by a WP_Query
|
| 44 |
+
*
|
| 45 |
+
* @global object $wpdb
|
| 46 |
+
*
|
| 47 |
+
*/
|
| 48 |
+
|
| 49 |
public static function wpcf_cache_complete_postmeta( $posts ) {
|
| 50 |
global $wpdb;
|
| 51 |
if ( !$posts )
|
| 57 |
$cache_key_looped_post = md5( 'post::_is_cached' . $post->ID );
|
| 58 |
$cached_object = wp_cache_get( $cache_key_looped_post, $cache_group_ids );
|
| 59 |
if ( false === $cached_object ) {
|
| 60 |
+
$post_ids[] = intval( $post->ID );
|
| 61 |
wp_cache_add( $cache_key_looped_post, $post->ID, $cache_group_ids );
|
| 62 |
}
|
| 63 |
}
|
| 153 |
|
| 154 |
/**
|
| 155 |
* Returns HTML formatted output.
|
| 156 |
+
*
|
| 157 |
* @param string $view
|
| 158 |
* @param mixed $data
|
| 159 |
* @return string
|
| 174 |
|
| 175 |
/**
|
| 176 |
* Returns HTML formatted output.
|
| 177 |
+
*
|
| 178 |
* @param string $view
|
| 179 |
* @param mixed $data
|
| 180 |
* @return string
|
| 190 |
|
| 191 |
/**
|
| 192 |
* Returns HTML formatted output.
|
| 193 |
+
*
|
| 194 |
* @param string $template
|
| 195 |
* @param mixed $data
|
| 196 |
* @return string
|
| 211 |
|
| 212 |
/**
|
| 213 |
* Loads model.
|
| 214 |
+
*
|
| 215 |
* @param string $template
|
| 216 |
* @param mixed $data
|
| 217 |
* @return string
|
| 227 |
|
| 228 |
/**
|
| 229 |
* Loads class.
|
| 230 |
+
*
|
| 231 |
* @param string $template
|
| 232 |
* @param mixed $data
|
| 233 |
* @return string
|
| 243 |
|
| 244 |
/**
|
| 245 |
* Loads include.
|
| 246 |
+
*
|
| 247 |
* @param string $template
|
| 248 |
* @param mixed $data
|
| 249 |
* @return string
|
| 259 |
|
| 260 |
/**
|
| 261 |
* Adds JS settings.
|
| 262 |
+
*
|
| 263 |
* @staticvar array $settings
|
| 264 |
* @param type $id
|
| 265 |
* @param type $setting
|
embedded/classes/path.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
/**
|
| 3 |
* WPCF_Path
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
/**
|
| 3 |
* WPCF_Path
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/path.php $
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
embedded/classes/post-types/messages.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
/*
|
| 3 |
* Messages.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
/*
|
| 3 |
* Messages.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/post-types/messages.php $
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
embedded/classes/relationship.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Post relationship class.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -201,8 +201,8 @@ class WPCF_Relationship
|
|
| 201 |
/**
|
| 202 |
* Bulk saving children.
|
| 203 |
*
|
| 204 |
-
* @param
|
| 205 |
-
* @param
|
| 206 |
*/
|
| 207 |
function save_children($parent_id, $children)
|
| 208 |
{
|
|
@@ -214,13 +214,13 @@ class WPCF_Relationship
|
|
| 214 |
/**
|
| 215 |
* Unified save child function.
|
| 216 |
*
|
| 217 |
-
* @param
|
| 218 |
-
* @param
|
|
|
|
|
|
|
| 219 |
*/
|
| 220 |
function save_child( $parent_id, $child_id, $save_fields = array() )
|
| 221 |
{
|
| 222 |
-
global $wpdb;
|
| 223 |
-
|
| 224 |
$parent = get_post( intval( $parent_id ) );
|
| 225 |
$child = get_post( intval( $child_id ) );
|
| 226 |
$post_data = array();
|
|
@@ -289,7 +289,18 @@ class WPCF_Relationship
|
|
| 289 |
}
|
| 290 |
unset($cf);
|
| 291 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 292 |
$updated_id = wp_update_post( $post_data );
|
|
|
|
|
|
|
|
|
|
|
|
|
| 293 |
if ( empty( $updated_id ) ) {
|
| 294 |
return new WP_Error( 'relationship-update-post-failed', 'Updating post failed' );
|
| 295 |
}
|
|
@@ -380,9 +391,9 @@ class WPCF_Relationship
|
|
| 380 |
/**
|
| 381 |
* Saves new child.
|
| 382 |
*
|
| 383 |
-
* @param
|
| 384 |
-
* @param
|
| 385 |
-
* @return
|
| 386 |
*/
|
| 387 |
function add_new_child($parent_id, $post_type)
|
| 388 |
{
|
| 2 |
/*
|
| 3 |
* Post relationship class.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/classes/relationship.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 201 |
/**
|
| 202 |
* Bulk saving children.
|
| 203 |
*
|
| 204 |
+
* @param int $parent_id
|
| 205 |
+
* @param array $children Array $child_id => $fields. For details about $fields see save_child().
|
| 206 |
*/
|
| 207 |
function save_children($parent_id, $children)
|
| 208 |
{
|
| 214 |
/**
|
| 215 |
* Unified save child function.
|
| 216 |
*
|
| 217 |
+
* @param int $parent_id
|
| 218 |
+
* @param int $child_id
|
| 219 |
+
* @param array $save_fields
|
| 220 |
+
* @return bool|WP_Error
|
| 221 |
*/
|
| 222 |
function save_child( $parent_id, $child_id, $save_fields = array() )
|
| 223 |
{
|
|
|
|
|
|
|
| 224 |
$parent = get_post( intval( $parent_id ) );
|
| 225 |
$child = get_post( intval( $child_id ) );
|
| 226 |
$post_data = array();
|
| 289 |
}
|
| 290 |
unset($cf);
|
| 291 |
|
| 292 |
+
/**
|
| 293 |
+
* avoid filters for children
|
| 294 |
+
* /
|
| 295 |
+
global $wp_filter;
|
| 296 |
+
$save_post = $wp_filter['save_post'];
|
| 297 |
+
$wp_filter['save_post'] = array();
|
| 298 |
+
*/
|
| 299 |
$updated_id = wp_update_post( $post_data );
|
| 300 |
+
/*
|
| 301 |
+
$wp_filter['save_post'] = $save_post;
|
| 302 |
+
*/
|
| 303 |
+
unset($save_post);
|
| 304 |
if ( empty( $updated_id ) ) {
|
| 305 |
return new WP_Error( 'relationship-update-post-failed', 'Updating post failed' );
|
| 306 |
}
|
| 391 |
/**
|
| 392 |
* Saves new child.
|
| 393 |
*
|
| 394 |
+
* @param int $parent_id
|
| 395 |
+
* @param string $post_type
|
| 396 |
+
* @return int|WP_Error
|
| 397 |
*/
|
| 398 |
function add_new_child($parent_id, $post_type)
|
| 399 |
{
|
embedded/classes/relationship/form-child.php
CHANGED
|
@@ -106,6 +106,18 @@ class WPCF_Relationship_Child_Form
|
|
| 106 |
$this->__urlParams[$__param] = $_GET[$__param];
|
| 107 |
}
|
| 108 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 109 |
$post_types = get_option( 'wpcf-custom-types', array() );
|
| 110 |
if (
|
| 111 |
array_key_exists($child_post_type, $post_types )
|
|
@@ -194,10 +206,10 @@ class WPCF_Relationship_Child_Form
|
|
| 194 |
*/
|
| 195 |
$options = array(__( 'All', 'wpcf' ) => 'all', 5 => 5, 10 => 10, 15 => 15);
|
| 196 |
// Add sorting
|
| 197 |
-
$add_data = isset( $_GET['sort'] ) && isset( $_GET['field'] ) ? '&sort=' .
|
| 198 |
-
.
|
| 199 |
if ( isset( $_GET['post_type_sort_parent'] ) ) {
|
| 200 |
-
$add_data .= '&post_type_sort_parent=' . $_GET['post_type_sort_parent'];
|
| 201 |
}
|
| 202 |
$this->pagination_bottom = wpcf_form_simple( array(
|
| 203 |
'pagination' => array(
|
|
@@ -690,7 +702,7 @@ class WPCF_Relationship_Child_Form
|
|
| 690 |
// Sorting
|
| 691 |
$dir = isset( $_GET['sort'] ) && $_GET['sort'] == 'ASC' ? 'DESC' : 'ASC';
|
| 692 |
$dir_default = 'ASC';
|
| 693 |
-
$sort_field = isset( $_GET['field'] ) ? $_GET['field'] : '';
|
| 694 |
|
| 695 |
// Set values
|
| 696 |
$post = $this->parent;
|
| 106 |
$this->__urlParams[$__param] = $_GET[$__param];
|
| 107 |
}
|
| 108 |
}
|
| 109 |
+
/**
|
| 110 |
+
* build-in types
|
| 111 |
+
*/
|
| 112 |
+
if ( in_array($child_post_type, array('page', 'post', 'attachment', 'revision', 'nav_menu_item') ) ) {
|
| 113 |
+
foreach( array_keys($this->child_supports) as $key ) {
|
| 114 |
+
$this->child_supports[$key] = post_type_supports($child_post_type, $key);
|
| 115 |
+
}
|
| 116 |
+
return;
|
| 117 |
+
}
|
| 118 |
+
/**
|
| 119 |
+
* custom post types
|
| 120 |
+
*/
|
| 121 |
$post_types = get_option( 'wpcf-custom-types', array() );
|
| 122 |
if (
|
| 123 |
array_key_exists($child_post_type, $post_types )
|
| 206 |
*/
|
| 207 |
$options = array(__( 'All', 'wpcf' ) => 'all', 5 => 5, 10 => 10, 15 => 15);
|
| 208 |
// Add sorting
|
| 209 |
+
$add_data = isset( $_GET['sort'] ) && isset( $_GET['field'] ) ? '&sort=' . sanitize_text_field( $_GET['sort'] ) . '&field='
|
| 210 |
+
. sanitize_text_field( $_GET['field'] ) : '';
|
| 211 |
if ( isset( $_GET['post_type_sort_parent'] ) ) {
|
| 212 |
+
$add_data .= '&post_type_sort_parent=' . sanitize_text_field( $_GET['post_type_sort_parent'] );
|
| 213 |
}
|
| 214 |
$this->pagination_bottom = wpcf_form_simple( array(
|
| 215 |
'pagination' => array(
|
| 702 |
// Sorting
|
| 703 |
$dir = isset( $_GET['sort'] ) && $_GET['sort'] == 'ASC' ? 'DESC' : 'ASC';
|
| 704 |
$dir_default = 'ASC';
|
| 705 |
+
$sort_field = isset( $_GET['field'] ) ? sanitize_text_field( $_GET['field'] ) : '';
|
| 706 |
|
| 707 |
// Set values
|
| 708 |
$post = $this->parent;
|
embedded/classes/repeater.php
CHANGED
|
@@ -1,29 +1,29 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
-
*
|
| 4 |
-
*
|
| 5 |
* Repeater fields class.
|
| 6 |
*/
|
| 7 |
|
| 8 |
/**
|
| 9 |
* Repater class
|
| 10 |
-
*
|
| 11 |
* Very useful, should be used to finish small tasks for repeater field.
|
| 12 |
-
*
|
| 13 |
* Example:
|
| 14 |
-
*
|
| 15 |
* // Setup field
|
| 16 |
* global $wpcf;
|
| 17 |
* $my_field = new WPCF_Repeater();
|
| 18 |
* $my_field->set($wpcf->post, wpcf_admin_fields_get_field('image'));
|
| 19 |
-
*
|
| 20 |
* // Use it
|
| 21 |
* $my_field->save();
|
| 22 |
-
*
|
| 23 |
* Generic instance can be found in global $wpcf.
|
| 24 |
* global $wpcf;
|
| 25 |
* $wpcf->repeater->set(...);
|
| 26 |
-
*
|
| 27 |
* @since Types 1.2
|
| 28 |
* @package Types
|
| 29 |
* @subpackage Classes
|
|
@@ -36,30 +36,30 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 36 |
|
| 37 |
/**
|
| 38 |
* Field order
|
| 39 |
-
*
|
| 40 |
-
* @var type
|
| 41 |
*/
|
| 42 |
var $order;
|
| 43 |
|
| 44 |
/**
|
| 45 |
* Indexing
|
| 46 |
-
*
|
| 47 |
* Set counts when processing fields.
|
| 48 |
-
*
|
| 49 |
-
* @var type
|
| 50 |
*/
|
| 51 |
var $index = 0;
|
| 52 |
|
| 53 |
/**
|
| 54 |
* Field title
|
| 55 |
-
* @var type
|
| 56 |
*/
|
| 57 |
var $title = '';
|
| 58 |
|
| 59 |
/**
|
| 60 |
* Field description.
|
| 61 |
-
*
|
| 62 |
-
* @var type
|
| 63 |
*/
|
| 64 |
var $description = '';
|
| 65 |
|
|
@@ -73,9 +73,9 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 73 |
|
| 74 |
/**
|
| 75 |
* Calls parent set func.
|
| 76 |
-
*
|
| 77 |
* @param type $post
|
| 78 |
-
* @param type $field
|
| 79 |
*/
|
| 80 |
function set( $post, $field ) {
|
| 81 |
parent::set( $post, $field );
|
|
@@ -84,12 +84,12 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 84 |
|
| 85 |
/**
|
| 86 |
* Save fields
|
| 87 |
-
*
|
| 88 |
* If $data empty, $_POST will be checked
|
| 89 |
-
*
|
| 90 |
* @global type $wpcf
|
| 91 |
* @param type $data
|
| 92 |
-
* @return boolean
|
| 93 |
*/
|
| 94 |
function save( $data = null ) {
|
| 95 |
|
|
@@ -107,7 +107,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 107 |
|
| 108 |
// Set data
|
| 109 |
if ( !empty( $data ) ) {
|
| 110 |
-
|
| 111 |
do_action('wpcf_postmeta_before_add_repetitive', $this->post, $this->cf);
|
| 112 |
|
| 113 |
// Insert new meta and collect all new mids
|
|
@@ -116,7 +116,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 116 |
foreach ( $data as $meta_value ) {
|
| 117 |
|
| 118 |
/*
|
| 119 |
-
*
|
| 120 |
* Deprecated!
|
| 121 |
*/
|
| 122 |
if ( is_array( $meta_value ) && isset( $meta_value['new_value'] ) ) {
|
|
@@ -142,7 +142,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 142 |
// Call insert post actions on each field
|
| 143 |
$this->_action_save( $this->cf, $_meta_value, $mid, $meta_value );
|
| 144 |
}
|
| 145 |
-
|
| 146 |
do_action('wpcf_postmeta_after_add_repetitive', $this->post, $this->cf);
|
| 147 |
|
| 148 |
// Save order
|
|
@@ -160,8 +160,8 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 160 |
|
| 161 |
/**
|
| 162 |
* Fetch and sort fields.
|
| 163 |
-
*
|
| 164 |
-
* @global
|
| 165 |
*/
|
| 166 |
function _get_meta() {
|
| 167 |
global $wpdb;
|
|
@@ -169,7 +169,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 169 |
$cache_key = md5( 'repeater::_get_meta' . $this->post->ID . $this->slug );
|
| 170 |
$cache_group = 'types_cache';
|
| 171 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 172 |
-
|
| 173 |
if ( $this->use_cache ) {
|
| 174 |
if ( false != $cached_object && is_array( $cached_object ) ) {
|
| 175 |
return $cached_object;
|
|
@@ -181,10 +181,10 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 181 |
$ordered = array();
|
| 182 |
$this->order = get_post_meta( $this->post->ID, $this->order_meta_name,
|
| 183 |
true );
|
| 184 |
-
|
| 185 |
$cache_key_field = md5( 'field::_get_meta' . $this->post->ID . $this->slug );
|
| 186 |
$cached_object_field = wp_cache_get( $cache_key_field, $cache_group );
|
| 187 |
-
|
| 188 |
if ( $this->use_cache ) {
|
| 189 |
if ( false != $cached_object_field && is_array( $cached_object_field ) ) {// WordPress cache
|
| 190 |
$r = $cached_object_field;
|
|
@@ -265,8 +265,8 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 265 |
}
|
| 266 |
|
| 267 |
/**
|
| 268 |
-
* Sets repetitive field form.
|
| 269 |
-
*
|
| 270 |
* @todo Make more distinction between $field_form and $form_field
|
| 271 |
*/
|
| 272 |
function get_fields_form() {
|
|
@@ -315,8 +315,8 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 315 |
|
| 316 |
// Set style
|
| 317 |
/*
|
| 318 |
-
*
|
| 319 |
-
*
|
| 320 |
* Hide if field not passed check
|
| 321 |
* TODO Move this to WPCF_Conditional
|
| 322 |
*/
|
|
@@ -328,17 +328,17 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 328 |
$css_cd = !$show ? 'display:none;' : '';
|
| 329 |
|
| 330 |
/**
|
| 331 |
-
*
|
| 332 |
-
*
|
| 333 |
-
*
|
| 334 |
-
*
|
| 335 |
* Set title and description
|
| 336 |
* TODO See if can be improved getting main element
|
| 337 |
-
*
|
| 338 |
* Get first element and extract details
|
| 339 |
* Pass emty string as value to avoid using meta as array
|
| 340 |
*/
|
| 341 |
-
//
|
| 342 |
$_c = array_values( parent::_get_meta_form( '' ) );
|
| 343 |
array_shift( $_c );
|
| 344 |
$_main_element = array_shift( $_c );
|
|
@@ -351,8 +351,8 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 351 |
}
|
| 352 |
|
| 353 |
/*
|
| 354 |
-
*
|
| 355 |
-
*
|
| 356 |
* Start wrapper
|
| 357 |
*/
|
| 358 |
$form[$unique_id . '_repetitive_wrapper_open'] = array(
|
|
@@ -372,12 +372,12 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 372 |
|
| 373 |
// Set hidden mark field
|
| 374 |
/*
|
| 375 |
-
*
|
| 376 |
-
*
|
| 377 |
-
*
|
| 378 |
* This actually marks field as repetitive
|
| 379 |
* IMPORTANT!!! IF NOT marked field won't be saved at all!
|
| 380 |
-
*
|
| 381 |
* @see wpcf_admin_post_save_post_hook()
|
| 382 |
*/
|
| 383 |
$form[$form_id . '_hidden_mark'] = array(
|
|
@@ -443,9 +443,9 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 443 |
|
| 444 |
/**
|
| 445 |
* Sete repetitive form for single field.
|
| 446 |
-
*
|
| 447 |
* @param type $meta
|
| 448 |
-
* @return string
|
| 449 |
*/
|
| 450 |
function get_field_form( $meta_value = null, $meta_id = null ) {
|
| 451 |
|
|
@@ -456,8 +456,8 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 456 |
$key = 'wpcf_field_' . md5( maybe_serialize( $meta_value ) . $meta_id );
|
| 457 |
}
|
| 458 |
/*
|
| 459 |
-
*
|
| 460 |
-
*
|
| 461 |
* TODO We prevented array because of some fails we had before.
|
| 462 |
* Now it should work fine
|
| 463 |
* Add debug log if meta_value['custom_order'] passed.
|
|
@@ -480,7 +480,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 480 |
$field_form = parent::_get_meta_form( $meta_value, $meta_id, false );
|
| 481 |
|
| 482 |
/*
|
| 483 |
-
*
|
| 484 |
* Apply filters to each form element.
|
| 485 |
* Here we add specific properties
|
| 486 |
* e.g. Skype alters fields.
|
|
@@ -489,7 +489,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 489 |
foreach ( $field_form as $k => $field ) {
|
| 490 |
|
| 491 |
/*
|
| 492 |
-
*
|
| 493 |
* IMPORTANT
|
| 494 |
* We change name to hold array
|
| 495 |
*/
|
|
@@ -579,7 +579,7 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 579 |
}
|
| 580 |
|
| 581 |
/**
|
| 582 |
-
* Set counting elements.
|
| 583 |
*/
|
| 584 |
function _set_form_count() {
|
| 585 |
if ( $this->index === 0 ) {
|
|
@@ -592,8 +592,11 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 592 |
|
| 593 |
/**
|
| 594 |
* Deletes meta.
|
| 595 |
-
*
|
| 596 |
-
* @
|
|
|
|
|
|
|
|
|
|
| 597 |
*/
|
| 598 |
function delete( $meta_id ) {
|
| 599 |
global $wpdb;
|
|
@@ -613,4 +616,4 @@ class WPCF_Repeater extends WPCF_Field
|
|
| 613 |
return $r;
|
| 614 |
}
|
| 615 |
|
| 616 |
-
}
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
+
*
|
| 4 |
+
*
|
| 5 |
* Repeater fields class.
|
| 6 |
*/
|
| 7 |
|
| 8 |
/**
|
| 9 |
* Repater class
|
| 10 |
+
*
|
| 11 |
* Very useful, should be used to finish small tasks for repeater field.
|
| 12 |
+
*
|
| 13 |
* Example:
|
| 14 |
+
*
|
| 15 |
* // Setup field
|
| 16 |
* global $wpcf;
|
| 17 |
* $my_field = new WPCF_Repeater();
|
| 18 |
* $my_field->set($wpcf->post, wpcf_admin_fields_get_field('image'));
|
| 19 |
+
*
|
| 20 |
* // Use it
|
| 21 |
* $my_field->save();
|
| 22 |
+
*
|
| 23 |
* Generic instance can be found in global $wpcf.
|
| 24 |
* global $wpcf;
|
| 25 |
* $wpcf->repeater->set(...);
|
| 26 |
+
*
|
| 27 |
* @since Types 1.2
|
| 28 |
* @package Types
|
| 29 |
* @subpackage Classes
|
| 36 |
|
| 37 |
/**
|
| 38 |
* Field order
|
| 39 |
+
*
|
| 40 |
+
* @var type
|
| 41 |
*/
|
| 42 |
var $order;
|
| 43 |
|
| 44 |
/**
|
| 45 |
* Indexing
|
| 46 |
+
*
|
| 47 |
* Set counts when processing fields.
|
| 48 |
+
*
|
| 49 |
+
* @var type
|
| 50 |
*/
|
| 51 |
var $index = 0;
|
| 52 |
|
| 53 |
/**
|
| 54 |
* Field title
|
| 55 |
+
* @var type
|
| 56 |
*/
|
| 57 |
var $title = '';
|
| 58 |
|
| 59 |
/**
|
| 60 |
* Field description.
|
| 61 |
+
*
|
| 62 |
+
* @var type
|
| 63 |
*/
|
| 64 |
var $description = '';
|
| 65 |
|
| 73 |
|
| 74 |
/**
|
| 75 |
* Calls parent set func.
|
| 76 |
+
*
|
| 77 |
* @param type $post
|
| 78 |
+
* @param type $field
|
| 79 |
*/
|
| 80 |
function set( $post, $field ) {
|
| 81 |
parent::set( $post, $field );
|
| 84 |
|
| 85 |
/**
|
| 86 |
* Save fields
|
| 87 |
+
*
|
| 88 |
* If $data empty, $_POST will be checked
|
| 89 |
+
*
|
| 90 |
* @global type $wpcf
|
| 91 |
* @param type $data
|
| 92 |
+
* @return boolean
|
| 93 |
*/
|
| 94 |
function save( $data = null ) {
|
| 95 |
|
| 107 |
|
| 108 |
// Set data
|
| 109 |
if ( !empty( $data ) ) {
|
| 110 |
+
|
| 111 |
do_action('wpcf_postmeta_before_add_repetitive', $this->post, $this->cf);
|
| 112 |
|
| 113 |
// Insert new meta and collect all new mids
|
| 116 |
foreach ( $data as $meta_value ) {
|
| 117 |
|
| 118 |
/*
|
| 119 |
+
*
|
| 120 |
* Deprecated!
|
| 121 |
*/
|
| 122 |
if ( is_array( $meta_value ) && isset( $meta_value['new_value'] ) ) {
|
| 142 |
// Call insert post actions on each field
|
| 143 |
$this->_action_save( $this->cf, $_meta_value, $mid, $meta_value );
|
| 144 |
}
|
| 145 |
+
|
| 146 |
do_action('wpcf_postmeta_after_add_repetitive', $this->post, $this->cf);
|
| 147 |
|
| 148 |
// Save order
|
| 160 |
|
| 161 |
/**
|
| 162 |
* Fetch and sort fields.
|
| 163 |
+
*
|
| 164 |
+
* @global object $wpdb
|
| 165 |
*/
|
| 166 |
function _get_meta() {
|
| 167 |
global $wpdb;
|
| 169 |
$cache_key = md5( 'repeater::_get_meta' . $this->post->ID . $this->slug );
|
| 170 |
$cache_group = 'types_cache';
|
| 171 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 172 |
+
|
| 173 |
if ( $this->use_cache ) {
|
| 174 |
if ( false != $cached_object && is_array( $cached_object ) ) {
|
| 175 |
return $cached_object;
|
| 181 |
$ordered = array();
|
| 182 |
$this->order = get_post_meta( $this->post->ID, $this->order_meta_name,
|
| 183 |
true );
|
| 184 |
+
|
| 185 |
$cache_key_field = md5( 'field::_get_meta' . $this->post->ID . $this->slug );
|
| 186 |
$cached_object_field = wp_cache_get( $cache_key_field, $cache_group );
|
| 187 |
+
|
| 188 |
if ( $this->use_cache ) {
|
| 189 |
if ( false != $cached_object_field && is_array( $cached_object_field ) ) {// WordPress cache
|
| 190 |
$r = $cached_object_field;
|
| 265 |
}
|
| 266 |
|
| 267 |
/**
|
| 268 |
+
* Sets repetitive field form.
|
| 269 |
+
*
|
| 270 |
* @todo Make more distinction between $field_form and $form_field
|
| 271 |
*/
|
| 272 |
function get_fields_form() {
|
| 315 |
|
| 316 |
// Set style
|
| 317 |
/*
|
| 318 |
+
*
|
| 319 |
+
*
|
| 320 |
* Hide if field not passed check
|
| 321 |
* TODO Move this to WPCF_Conditional
|
| 322 |
*/
|
| 328 |
$css_cd = !$show ? 'display:none;' : '';
|
| 329 |
|
| 330 |
/**
|
| 331 |
+
*
|
| 332 |
+
*
|
| 333 |
+
*
|
| 334 |
+
*
|
| 335 |
* Set title and description
|
| 336 |
* TODO See if can be improved getting main element
|
| 337 |
+
*
|
| 338 |
* Get first element and extract details
|
| 339 |
* Pass emty string as value to avoid using meta as array
|
| 340 |
*/
|
| 341 |
+
//
|
| 342 |
$_c = array_values( parent::_get_meta_form( '' ) );
|
| 343 |
array_shift( $_c );
|
| 344 |
$_main_element = array_shift( $_c );
|
| 351 |
}
|
| 352 |
|
| 353 |
/*
|
| 354 |
+
*
|
| 355 |
+
*
|
| 356 |
* Start wrapper
|
| 357 |
*/
|
| 358 |
$form[$unique_id . '_repetitive_wrapper_open'] = array(
|
| 372 |
|
| 373 |
// Set hidden mark field
|
| 374 |
/*
|
| 375 |
+
*
|
| 376 |
+
*
|
| 377 |
+
*
|
| 378 |
* This actually marks field as repetitive
|
| 379 |
* IMPORTANT!!! IF NOT marked field won't be saved at all!
|
| 380 |
+
*
|
| 381 |
* @see wpcf_admin_post_save_post_hook()
|
| 382 |
*/
|
| 383 |
$form[$form_id . '_hidden_mark'] = array(
|
| 443 |
|
| 444 |
/**
|
| 445 |
* Sete repetitive form for single field.
|
| 446 |
+
*
|
| 447 |
* @param type $meta
|
| 448 |
+
* @return string
|
| 449 |
*/
|
| 450 |
function get_field_form( $meta_value = null, $meta_id = null ) {
|
| 451 |
|
| 456 |
$key = 'wpcf_field_' . md5( maybe_serialize( $meta_value ) . $meta_id );
|
| 457 |
}
|
| 458 |
/*
|
| 459 |
+
*
|
| 460 |
+
*
|
| 461 |
* TODO We prevented array because of some fails we had before.
|
| 462 |
* Now it should work fine
|
| 463 |
* Add debug log if meta_value['custom_order'] passed.
|
| 480 |
$field_form = parent::_get_meta_form( $meta_value, $meta_id, false );
|
| 481 |
|
| 482 |
/*
|
| 483 |
+
*
|
| 484 |
* Apply filters to each form element.
|
| 485 |
* Here we add specific properties
|
| 486 |
* e.g. Skype alters fields.
|
| 489 |
foreach ( $field_form as $k => $field ) {
|
| 490 |
|
| 491 |
/*
|
| 492 |
+
*
|
| 493 |
* IMPORTANT
|
| 494 |
* We change name to hold array
|
| 495 |
*/
|
| 579 |
}
|
| 580 |
|
| 581 |
/**
|
| 582 |
+
* Set counting elements.
|
| 583 |
*/
|
| 584 |
function _set_form_count() {
|
| 585 |
if ( $this->index === 0 ) {
|
| 592 |
|
| 593 |
/**
|
| 594 |
* Deletes meta.
|
| 595 |
+
*
|
| 596 |
+
* @global object $wpdb
|
| 597 |
+
*
|
| 598 |
+
* @param type $meta_key
|
| 599 |
+
*
|
| 600 |
*/
|
| 601 |
function delete( $meta_id ) {
|
| 602 |
global $wpdb;
|
| 616 |
return $r;
|
| 617 |
}
|
| 618 |
|
| 619 |
+
}
|
embedded/classes/usermeta_field.php
CHANGED
|
@@ -1,7 +1,5 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
-
*
|
| 4 |
-
*
|
| 5 |
* Usermeta Field class extends Field.
|
| 6 |
*/
|
| 7 |
|
|
@@ -13,16 +11,16 @@ class WPCF_Usermeta_Field extends WPCF_Field
|
|
| 13 |
|
| 14 |
/**
|
| 15 |
* Set current post and field.
|
| 16 |
-
*
|
| 17 |
* @param type $post
|
| 18 |
-
* @param type $cf
|
| 19 |
*/
|
| 20 |
function set( $user_id, $cf ) {
|
| 21 |
|
| 22 |
global $wpcf;
|
| 23 |
|
| 24 |
/*
|
| 25 |
-
*
|
| 26 |
* Check if $cf is string
|
| 27 |
*/
|
| 28 |
if ( is_string( $cf ) ) {
|
|
@@ -63,9 +61,9 @@ class WPCF_Usermeta_Field extends WPCF_Field
|
|
| 63 |
|
| 64 |
/**
|
| 65 |
* Save usermeta field.
|
| 66 |
-
*
|
| 67 |
-
*
|
| 68 |
-
* @param type $value
|
| 69 |
*/
|
| 70 |
function usermeta_save( $value = null ) {
|
| 71 |
|
|
@@ -74,8 +72,8 @@ class WPCF_Usermeta_Field extends WPCF_Field
|
|
| 74 |
$value = $this->get_submitted_data();
|
| 75 |
}
|
| 76 |
/*
|
| 77 |
-
*
|
| 78 |
-
*
|
| 79 |
* Since Types 1.2
|
| 80 |
* We completely rewrite meta.
|
| 81 |
* It has no impact on frontend and covers a lot of cases
|
|
@@ -105,17 +103,17 @@ class WPCF_Usermeta_Field extends WPCF_Field
|
|
| 105 |
|
| 106 |
/**
|
| 107 |
* Fetch and sort fields.
|
| 108 |
-
*
|
| 109 |
-
*
|
|
|
|
| 110 |
*/
|
| 111 |
function _get_meta() {
|
| 112 |
global $wpdb;
|
| 113 |
|
| 114 |
-
|
| 115 |
$cache_key = md5( 'usermeta::_get_meta' . $this->currentUID . $this->slug );
|
| 116 |
$cache_group = 'types_cache';
|
| 117 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 118 |
-
|
| 119 |
if ( $this->use_cache ) {
|
| 120 |
if ( false != $cached_object && is_array( $cached_object ) && isset( $cached_object[0] ) ) {// WordPress cache
|
| 121 |
$r = $cached_object[0];
|
|
@@ -173,7 +171,7 @@ class WPCF_Usermeta_Field extends WPCF_Field
|
|
| 173 |
$this->__meta = $meta;
|
| 174 |
|
| 175 |
/*
|
| 176 |
-
*
|
| 177 |
* Apply filters
|
| 178 |
* !!! IMPORTANT !!!
|
| 179 |
* TODO Make this only place where field meta value is filtered
|
| 1 |
<?php
|
| 2 |
/*
|
|
|
|
|
|
|
| 3 |
* Usermeta Field class extends Field.
|
| 4 |
*/
|
| 5 |
|
| 11 |
|
| 12 |
/**
|
| 13 |
* Set current post and field.
|
| 14 |
+
*
|
| 15 |
* @param type $post
|
| 16 |
+
* @param type $cf
|
| 17 |
*/
|
| 18 |
function set( $user_id, $cf ) {
|
| 19 |
|
| 20 |
global $wpcf;
|
| 21 |
|
| 22 |
/*
|
| 23 |
+
*
|
| 24 |
* Check if $cf is string
|
| 25 |
*/
|
| 26 |
if ( is_string( $cf ) ) {
|
| 61 |
|
| 62 |
/**
|
| 63 |
* Save usermeta field.
|
| 64 |
+
*
|
| 65 |
+
*
|
| 66 |
+
* @param type $value
|
| 67 |
*/
|
| 68 |
function usermeta_save( $value = null ) {
|
| 69 |
|
| 72 |
$value = $this->get_submitted_data();
|
| 73 |
}
|
| 74 |
/*
|
| 75 |
+
*
|
| 76 |
+
*
|
| 77 |
* Since Types 1.2
|
| 78 |
* We completely rewrite meta.
|
| 79 |
* It has no impact on frontend and covers a lot of cases
|
| 103 |
|
| 104 |
/**
|
| 105 |
* Fetch and sort fields.
|
| 106 |
+
*
|
| 107 |
+
* @global object $wpdb
|
| 108 |
+
*
|
| 109 |
*/
|
| 110 |
function _get_meta() {
|
| 111 |
global $wpdb;
|
| 112 |
|
|
|
|
| 113 |
$cache_key = md5( 'usermeta::_get_meta' . $this->currentUID . $this->slug );
|
| 114 |
$cache_group = 'types_cache';
|
| 115 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 116 |
+
|
| 117 |
if ( $this->use_cache ) {
|
| 118 |
if ( false != $cached_object && is_array( $cached_object ) && isset( $cached_object[0] ) ) {// WordPress cache
|
| 119 |
$r = $cached_object[0];
|
| 171 |
$this->__meta = $meta;
|
| 172 |
|
| 173 |
/*
|
| 174 |
+
*
|
| 175 |
* Apply filters
|
| 176 |
* !!! IMPORTANT !!!
|
| 177 |
* TODO Make this only place where field meta value is filtered
|
embedded/classes/usermeta_repeater.php
CHANGED
|
@@ -8,30 +8,30 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 8 |
|
| 9 |
/**
|
| 10 |
* Field order
|
| 11 |
-
*
|
| 12 |
-
* @var type
|
| 13 |
*/
|
| 14 |
var $order;
|
| 15 |
|
| 16 |
/**
|
| 17 |
* Indexing
|
| 18 |
-
*
|
| 19 |
* Set counts when processing fields.
|
| 20 |
-
*
|
| 21 |
-
* @var type
|
| 22 |
*/
|
| 23 |
var $index = 0;
|
| 24 |
|
| 25 |
/**
|
| 26 |
* Field title
|
| 27 |
-
* @var type
|
| 28 |
*/
|
| 29 |
var $title = '';
|
| 30 |
|
| 31 |
/**
|
| 32 |
* Field description.
|
| 33 |
-
*
|
| 34 |
-
* @var type
|
| 35 |
*/
|
| 36 |
var $description = '';
|
| 37 |
|
|
@@ -45,9 +45,9 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 45 |
|
| 46 |
/**
|
| 47 |
* Calls parent set func.
|
| 48 |
-
*
|
| 49 |
* @param type $post
|
| 50 |
-
* @param type $field
|
| 51 |
*/
|
| 52 |
function set( $user_id, $field ) {
|
| 53 |
parent::set( $user_id, $field );
|
|
@@ -56,12 +56,12 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 56 |
|
| 57 |
/**
|
| 58 |
* Save fields
|
| 59 |
-
*
|
| 60 |
* If $data empty, $_POST will be checked
|
| 61 |
-
*
|
| 62 |
* @global type $wpcf
|
| 63 |
* @param type $data
|
| 64 |
-
* @return boolean
|
| 65 |
*/
|
| 66 |
function save( $data = null ) {
|
| 67 |
|
|
@@ -83,7 +83,7 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 83 |
foreach ( $data as $meta_value ) {
|
| 84 |
|
| 85 |
/*
|
| 86 |
-
*
|
| 87 |
* Deprecated!
|
| 88 |
*/
|
| 89 |
if ( is_array( $meta_value ) && isset( $meta_value['new_value'] ) ) {
|
|
@@ -123,8 +123,8 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 123 |
|
| 124 |
/**
|
| 125 |
* Fetch and sort fields.
|
| 126 |
-
*
|
| 127 |
-
* @global
|
| 128 |
*/
|
| 129 |
function _get_meta() {
|
| 130 |
global $wpdb;
|
|
@@ -132,7 +132,7 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 132 |
$cache_key = md5( 'usermetarepeater::_get_meta' . $this->currentUID . $this->slug );
|
| 133 |
$cache_group = 'types_cache';
|
| 134 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 135 |
-
|
| 136 |
if ( $this->use_cache ) {
|
| 137 |
if ( false != $cached_object && is_array( $cached_object ) ) {
|
| 138 |
return $cached_object;
|
|
@@ -146,10 +146,10 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 146 |
$ordered = array();
|
| 147 |
$this->order = get_user_meta( $this->currentUID, $this->order_meta_name,
|
| 148 |
true );
|
| 149 |
-
|
| 150 |
$cache_key_userfield = md5( 'usermeta::_get_meta' . $this->currentUID . $this->slug );
|
| 151 |
$cached_object_userfield = wp_cache_get( $cache_key_userfield, $cache_group );
|
| 152 |
-
|
| 153 |
if ( $this->use_cache ) {
|
| 154 |
if ( false != $cached_object_userfield && is_array( $cached_object_userfield ) ) {// WordPress cache
|
| 155 |
$r = $cached_object_userfield;
|
|
@@ -221,8 +221,8 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 221 |
}
|
| 222 |
|
| 223 |
/**
|
| 224 |
-
* Sets repetitive field form.
|
| 225 |
-
*
|
| 226 |
* @todo Make more distinction between $field_form and $form_field
|
| 227 |
*/
|
| 228 |
function get_fields_form( $is_profile = '' ) {
|
|
@@ -273,8 +273,8 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 273 |
|
| 274 |
// Set style
|
| 275 |
/*
|
| 276 |
-
*
|
| 277 |
-
*
|
| 278 |
* Hide if field not passed check
|
| 279 |
* TODO Move this to WPCF_Conditional
|
| 280 |
*/
|
|
@@ -286,17 +286,17 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 286 |
$css_cd = !$show ? 'display:none;' : '';
|
| 287 |
|
| 288 |
/**
|
| 289 |
-
*
|
| 290 |
-
*
|
| 291 |
-
*
|
| 292 |
-
*
|
| 293 |
* Set title and description
|
| 294 |
* TODO See if can be improved getting main element
|
| 295 |
-
*
|
| 296 |
* Get first element and extract details
|
| 297 |
* Pass emty string as value to avoid using meta as array
|
| 298 |
*/
|
| 299 |
-
//
|
| 300 |
$_c = array_values( parent::_get_meta_form( '' ) );
|
| 301 |
array_shift( $_c );
|
| 302 |
$_main_element = array_shift( $_c );
|
|
@@ -319,8 +319,8 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 319 |
);
|
| 320 |
|
| 321 |
/*
|
| 322 |
-
*
|
| 323 |
-
*
|
| 324 |
* Start wrapper
|
| 325 |
*/
|
| 326 |
$form[$unique_id . '_repetitive_wrapper_open'] = array(
|
|
@@ -334,12 +334,12 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 334 |
|
| 335 |
// Set hidden mark field
|
| 336 |
/*
|
| 337 |
-
*
|
| 338 |
-
*
|
| 339 |
-
*
|
| 340 |
* This actually marks field as repetitive
|
| 341 |
* IMPORTANT!!! IF NOT marked field won't be saved at all!
|
| 342 |
-
*
|
| 343 |
* @see wpcf_admin_post_save_post_hook()
|
| 344 |
*/
|
| 345 |
$form[$form_id . '_hidden_mark'] = array(
|
|
@@ -406,9 +406,9 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 406 |
|
| 407 |
/**
|
| 408 |
* Sete repetitive form for single field.
|
| 409 |
-
*
|
| 410 |
* @param type $meta
|
| 411 |
-
* @return string
|
| 412 |
*/
|
| 413 |
function get_field_form( $meta_value = null, $meta_id = null ) {
|
| 414 |
|
|
@@ -435,7 +435,7 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 435 |
$field_form = parent::_get_meta_form( $meta_value, $meta_id, false );
|
| 436 |
|
| 437 |
/*
|
| 438 |
-
*
|
| 439 |
* Apply filters to each form element.
|
| 440 |
* Here we add specific properties
|
| 441 |
* e.g. Skype alters fields.
|
|
@@ -444,7 +444,7 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 444 |
foreach ( $field_form as $k => $field ) {
|
| 445 |
|
| 446 |
/*
|
| 447 |
-
*
|
| 448 |
* IMPORTANT
|
| 449 |
* We change name to hold array
|
| 450 |
*/
|
|
@@ -534,7 +534,7 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 534 |
}
|
| 535 |
|
| 536 |
/**
|
| 537 |
-
* Set counting elements.
|
| 538 |
*/
|
| 539 |
function _set_form_count() {
|
| 540 |
if ( $this->index === 0 ) {
|
|
@@ -547,8 +547,11 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 547 |
|
| 548 |
/**
|
| 549 |
* Deletes meta.
|
| 550 |
-
*
|
| 551 |
-
* @
|
|
|
|
|
|
|
|
|
|
| 552 |
*/
|
| 553 |
function delete( $meta_id ) {
|
| 554 |
global $wpdb;
|
|
@@ -568,4 +571,4 @@ class WPCF_Usermeta_Repeater extends WPCF_Usermeta_Field
|
|
| 568 |
return $r;
|
| 569 |
}
|
| 570 |
|
| 571 |
-
}
|
| 8 |
|
| 9 |
/**
|
| 10 |
* Field order
|
| 11 |
+
*
|
| 12 |
+
* @var type
|
| 13 |
*/
|
| 14 |
var $order;
|
| 15 |
|
| 16 |
/**
|
| 17 |
* Indexing
|
| 18 |
+
*
|
| 19 |
* Set counts when processing fields.
|
| 20 |
+
*
|
| 21 |
+
* @var type
|
| 22 |
*/
|
| 23 |
var $index = 0;
|
| 24 |
|
| 25 |
/**
|
| 26 |
* Field title
|
| 27 |
+
* @var type
|
| 28 |
*/
|
| 29 |
var $title = '';
|
| 30 |
|
| 31 |
/**
|
| 32 |
* Field description.
|
| 33 |
+
*
|
| 34 |
+
* @var type
|
| 35 |
*/
|
| 36 |
var $description = '';
|
| 37 |
|
| 45 |
|
| 46 |
/**
|
| 47 |
* Calls parent set func.
|
| 48 |
+
*
|
| 49 |
* @param type $post
|
| 50 |
+
* @param type $field
|
| 51 |
*/
|
| 52 |
function set( $user_id, $field ) {
|
| 53 |
parent::set( $user_id, $field );
|
| 56 |
|
| 57 |
/**
|
| 58 |
* Save fields
|
| 59 |
+
*
|
| 60 |
* If $data empty, $_POST will be checked
|
| 61 |
+
*
|
| 62 |
* @global type $wpcf
|
| 63 |
* @param type $data
|
| 64 |
+
* @return boolean
|
| 65 |
*/
|
| 66 |
function save( $data = null ) {
|
| 67 |
|
| 83 |
foreach ( $data as $meta_value ) {
|
| 84 |
|
| 85 |
/*
|
| 86 |
+
*
|
| 87 |
* Deprecated!
|
| 88 |
*/
|
| 89 |
if ( is_array( $meta_value ) && isset( $meta_value['new_value'] ) ) {
|
| 123 |
|
| 124 |
/**
|
| 125 |
* Fetch and sort fields.
|
| 126 |
+
*
|
| 127 |
+
* @global object $wpdb
|
| 128 |
*/
|
| 129 |
function _get_meta() {
|
| 130 |
global $wpdb;
|
| 132 |
$cache_key = md5( 'usermetarepeater::_get_meta' . $this->currentUID . $this->slug );
|
| 133 |
$cache_group = 'types_cache';
|
| 134 |
$cached_object = wp_cache_get( $cache_key, $cache_group );
|
| 135 |
+
|
| 136 |
if ( $this->use_cache ) {
|
| 137 |
if ( false != $cached_object && is_array( $cached_object ) ) {
|
| 138 |
return $cached_object;
|
| 146 |
$ordered = array();
|
| 147 |
$this->order = get_user_meta( $this->currentUID, $this->order_meta_name,
|
| 148 |
true );
|
| 149 |
+
|
| 150 |
$cache_key_userfield = md5( 'usermeta::_get_meta' . $this->currentUID . $this->slug );
|
| 151 |
$cached_object_userfield = wp_cache_get( $cache_key_userfield, $cache_group );
|
| 152 |
+
|
| 153 |
if ( $this->use_cache ) {
|
| 154 |
if ( false != $cached_object_userfield && is_array( $cached_object_userfield ) ) {// WordPress cache
|
| 155 |
$r = $cached_object_userfield;
|
| 221 |
}
|
| 222 |
|
| 223 |
/**
|
| 224 |
+
* Sets repetitive field form.
|
| 225 |
+
*
|
| 226 |
* @todo Make more distinction between $field_form and $form_field
|
| 227 |
*/
|
| 228 |
function get_fields_form( $is_profile = '' ) {
|
| 273 |
|
| 274 |
// Set style
|
| 275 |
/*
|
| 276 |
+
*
|
| 277 |
+
*
|
| 278 |
* Hide if field not passed check
|
| 279 |
* TODO Move this to WPCF_Conditional
|
| 280 |
*/
|
| 286 |
$css_cd = !$show ? 'display:none;' : '';
|
| 287 |
|
| 288 |
/**
|
| 289 |
+
*
|
| 290 |
+
*
|
| 291 |
+
*
|
| 292 |
+
*
|
| 293 |
* Set title and description
|
| 294 |
* TODO See if can be improved getting main element
|
| 295 |
+
*
|
| 296 |
* Get first element and extract details
|
| 297 |
* Pass emty string as value to avoid using meta as array
|
| 298 |
*/
|
| 299 |
+
//
|
| 300 |
$_c = array_values( parent::_get_meta_form( '' ) );
|
| 301 |
array_shift( $_c );
|
| 302 |
$_main_element = array_shift( $_c );
|
| 319 |
);
|
| 320 |
|
| 321 |
/*
|
| 322 |
+
*
|
| 323 |
+
*
|
| 324 |
* Start wrapper
|
| 325 |
*/
|
| 326 |
$form[$unique_id . '_repetitive_wrapper_open'] = array(
|
| 334 |
|
| 335 |
// Set hidden mark field
|
| 336 |
/*
|
| 337 |
+
*
|
| 338 |
+
*
|
| 339 |
+
*
|
| 340 |
* This actually marks field as repetitive
|
| 341 |
* IMPORTANT!!! IF NOT marked field won't be saved at all!
|
| 342 |
+
*
|
| 343 |
* @see wpcf_admin_post_save_post_hook()
|
| 344 |
*/
|
| 345 |
$form[$form_id . '_hidden_mark'] = array(
|
| 406 |
|
| 407 |
/**
|
| 408 |
* Sete repetitive form for single field.
|
| 409 |
+
*
|
| 410 |
* @param type $meta
|
| 411 |
+
* @return string
|
| 412 |
*/
|
| 413 |
function get_field_form( $meta_value = null, $meta_id = null ) {
|
| 414 |
|
| 435 |
$field_form = parent::_get_meta_form( $meta_value, $meta_id, false );
|
| 436 |
|
| 437 |
/*
|
| 438 |
+
*
|
| 439 |
* Apply filters to each form element.
|
| 440 |
* Here we add specific properties
|
| 441 |
* e.g. Skype alters fields.
|
| 444 |
foreach ( $field_form as $k => $field ) {
|
| 445 |
|
| 446 |
/*
|
| 447 |
+
*
|
| 448 |
* IMPORTANT
|
| 449 |
* We change name to hold array
|
| 450 |
*/
|
| 534 |
}
|
| 535 |
|
| 536 |
/**
|
| 537 |
+
* Set counting elements.
|
| 538 |
*/
|
| 539 |
function _set_form_count() {
|
| 540 |
if ( $this->index === 0 ) {
|
| 547 |
|
| 548 |
/**
|
| 549 |
* Deletes meta.
|
| 550 |
+
*
|
| 551 |
+
* @global object $wpdb
|
| 552 |
+
*
|
| 553 |
+
* @param type $meta_key
|
| 554 |
+
*
|
| 555 |
*/
|
| 556 |
function delete( $meta_id ) {
|
| 557 |
global $wpdb;
|
| 571 |
return $r;
|
| 572 |
}
|
| 573 |
|
| 574 |
+
}
|
embedded/classes/validate.php
CHANGED
|
@@ -388,6 +388,29 @@ class Wpcf_Validate
|
|
| 388 |
return $form;
|
| 389 |
}
|
| 390 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 391 |
public static function setForced( $element, $field, $data = array() )
|
| 392 |
{
|
| 393 |
$attributes = array();
|
|
@@ -432,4 +455,4 @@ class Wpcf_Validate
|
|
| 432 |
return true;
|
| 433 |
}
|
| 434 |
|
| 435 |
-
}
|
| 388 |
return $form;
|
| 389 |
}
|
| 390 |
|
| 391 |
+
/**
|
| 392 |
+
* Returns form data.
|
| 393 |
+
*
|
| 394 |
+
* @param type $field
|
| 395 |
+
* @param type $data
|
| 396 |
+
* @return array
|
| 397 |
+
*/
|
| 398 |
+
public static function skype_form( $field, $data = array() )
|
| 399 |
+
{
|
| 400 |
+
$form = array();
|
| 401 |
+
$form['skype-checkbox'] = array(
|
| 402 |
+
'#type' => 'checkbox',
|
| 403 |
+
'#title' => 'Skype',
|
| 404 |
+
'#name' => $field['#name'] . '[active]',
|
| 405 |
+
'#default_value' => isset( $data['active'] ) ? 1 : 0,
|
| 406 |
+
'#inline' => true,
|
| 407 |
+
'#suffix' => '<br />',
|
| 408 |
+
);
|
| 409 |
+
$form['skype-checkbox'] = self::setForced( $form['skype-checkbox'], $field, $data );
|
| 410 |
+
$form['skype-message'] = self::get_custom_message( $field, self::get_message( 'skype' ), $data );
|
| 411 |
+
return $form;
|
| 412 |
+
}
|
| 413 |
+
|
| 414 |
public static function setForced( $element, $field, $data = array() )
|
| 415 |
{
|
| 416 |
$attributes = array();
|
| 455 |
return true;
|
| 456 |
}
|
| 457 |
|
| 458 |
+
}
|
embedded/classes/validation-cakephp.php
CHANGED
|
@@ -195,6 +195,29 @@ class Wpcf_Cake_Validation
|
|
| 195 |
return $return;
|
| 196 |
}
|
| 197 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 198 |
/**
|
| 199 |
* Checks that a string length is within s specified range.
|
| 200 |
* Spaces are included in the character count.
|
| 195 |
return $return;
|
| 196 |
}
|
| 197 |
|
| 198 |
+
function skype( $check ) {
|
| 199 |
+
$_this = &Wpcf_Cake_Validation::getInstance();
|
| 200 |
+
$_this->__reset();
|
| 201 |
+
$_this->check = $check;
|
| 202 |
+
|
| 203 |
+
if ( is_array( $check ) ) {
|
| 204 |
+
$_this->_extract( $check );
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
if ( empty( $_this->check ) && $_this->check != '0' ) {
|
| 208 |
+
return false;
|
| 209 |
+
}
|
| 210 |
+
$_this->regex = '/^[a-zA-Z0-9\s\-\_]*$/mu';
|
| 211 |
+
$return = $_this->_check();
|
| 212 |
+
|
| 213 |
+
if ( !$return ) {
|
| 214 |
+
$_this->regex = '/^[\p{Ll}\p{Lm}\p{Lo}\p{Lt}\p{Lu}\p{Nd}\s\-\_]+$/mu';
|
| 215 |
+
$return = $_this->_check();
|
| 216 |
+
}
|
| 217 |
+
|
| 218 |
+
return $return;
|
| 219 |
+
}
|
| 220 |
+
|
| 221 |
/**
|
| 222 |
* Checks that a string length is within s specified range.
|
| 223 |
* Spaces are included in the character count.
|
embedded/common/changelog.txt
CHANGED
|
@@ -1,3 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
-------------------------------------------------------------------------------------------------------------------
|
| 2 |
Common 1.4 (Feb 2 2015)
|
| 3 |
- Tagged for Views 1.7, Types 1.6.5, CRED 1.3.5 and Layouts 1.0 beta1
|
|
@@ -11,4 +24,4 @@ Common 1.3.1 (Dec 16 2014)
|
|
| 11 |
|
| 12 |
-------------------------------------------------------------------------------------------------------------------
|
| 13 |
Common 1.3 (Dec 15 2014)
|
| 14 |
-
- Tagged for Views 1.7 beta1 and Layouts 1.0 beta1
|
| 1 |
+
|
| 2 |
+
|
| 3 |
+
-------------------------------------------------------------------------------------------------------------------
|
| 4 |
+
Common 1.5 (Apr 1, 2015)
|
| 5 |
+
- Tagged for Types 1.6.6, Views 1.8, CRED 1.3.6 and Layouts 1.1.
|
| 6 |
+
- Fixed issue when there is more than one CRED form on a page with the same taxonomy.
|
| 7 |
+
- Fixed a little problem with edit skype button modal window - was too narrow.
|
| 8 |
+
- Fixed empty title problem for filter "wpt_field_options" on user edit/add screen.
|
| 9 |
+
https://wp-types.com/forums/topic/populate-select-field-in-wpcf-um-group/
|
| 10 |
+
- Added filter "toolset_editor_add_form_buttons" to disable Toolset buttons on the post editor.
|
| 11 |
+
- Added placeholder attributes to fields.
|
| 12 |
+
- Updated CakePHP validation URL method to allow new TLD's.
|
| 13 |
+
|
| 14 |
-------------------------------------------------------------------------------------------------------------------
|
| 15 |
Common 1.4 (Feb 2 2015)
|
| 16 |
- Tagged for Views 1.7, Types 1.6.5, CRED 1.3.5 and Layouts 1.0 beta1
|
| 24 |
|
| 25 |
-------------------------------------------------------------------------------------------------------------------
|
| 26 |
Common 1.3 (Dec 15 2014)
|
| 27 |
+
- Tagged for Views 1.7 beta1 and Layouts 1.0 beta1
|
embedded/common/classes/class.toolset.promo.php
ADDED
|
@@ -0,0 +1,197 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/classes/class.toolset.promo.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
+
* $LastChangedBy: iworks $
|
| 9 |
+
*
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
if (!class_exists('Toolset_Promotion')) {
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* Class to show promotion message.
|
| 16 |
+
*
|
| 17 |
+
* @since 1.5
|
| 18 |
+
* @access public
|
| 19 |
+
*/
|
| 20 |
+
class Toolset_Promotion
|
| 21 |
+
{
|
| 22 |
+
private $version = '1.0';
|
| 23 |
+
|
| 24 |
+
public function __construct()
|
| 25 |
+
{
|
| 26 |
+
add_action('admin_init', array($this, 'admin_init'));
|
| 27 |
+
add_action('admin_footer', array($this, 'admin_footer'));
|
| 28 |
+
add_action('admin_enqueue_scripts', array($this, 'admin_enqueue_scripts'));
|
| 29 |
+
add_action('plugins_loaded', 'on_the_go_systems_branding_plugins_loaded');
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* Register script and styles
|
| 34 |
+
*
|
| 35 |
+
* Register script and styles for future usage.
|
| 36 |
+
*
|
| 37 |
+
* @since 1.5
|
| 38 |
+
*
|
| 39 |
+
*/
|
| 40 |
+
public function admin_init()
|
| 41 |
+
{
|
| 42 |
+
wp_register_script(
|
| 43 |
+
'toolset-colorbox',
|
| 44 |
+
plugins_url('/res/js/jquery.colorbox-min.js', dirname(__FILE__)),
|
| 45 |
+
array('jquery'),
|
| 46 |
+
'1.4.31'
|
| 47 |
+
);
|
| 48 |
+
wp_register_script(
|
| 49 |
+
__CLASS__,
|
| 50 |
+
plugins_url('/res/js/toolset-promotion.js', dirname(__FILE__)),
|
| 51 |
+
array('underscore', 'toolset-colorbox'),
|
| 52 |
+
$this->version,
|
| 53 |
+
true
|
| 54 |
+
);
|
| 55 |
+
wp_register_style(
|
| 56 |
+
'toolset-colorbox',
|
| 57 |
+
plugins_url('/res/css/colorbox.css', dirname(__FILE__)),
|
| 58 |
+
false,
|
| 59 |
+
'1.4.31'
|
| 60 |
+
);
|
| 61 |
+
wp_register_style(
|
| 62 |
+
__CLASS__,
|
| 63 |
+
plugins_url('/res/css/toolset-promotion.css', dirname(__FILE__)),
|
| 64 |
+
array('toolset-colorbox', 'onthego-admin-styles'),
|
| 65 |
+
$this->version
|
| 66 |
+
);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
* Enqueue scripts & styles
|
| 71 |
+
*
|
| 72 |
+
* After check is a correct place, this function enqueue scripts & styles
|
| 73 |
+
* for toolset promotion box.
|
| 74 |
+
*
|
| 75 |
+
* @since 1.5
|
| 76 |
+
*
|
| 77 |
+
*/
|
| 78 |
+
public function admin_enqueue_scripts()
|
| 79 |
+
{
|
| 80 |
+
if (!is_admin() || !function_exists('get_current_screen')) {
|
| 81 |
+
return;
|
| 82 |
+
}
|
| 83 |
+
/**
|
| 84 |
+
* List of admin page id
|
| 85 |
+
*
|
| 86 |
+
* Filter allow to add or change list of admin screen id for checking
|
| 87 |
+
* where we need enqueue toolset promotion assets.
|
| 88 |
+
*
|
| 89 |
+
* @since 1.5
|
| 90 |
+
*
|
| 91 |
+
* @param array $screen_ids List of admin page screen ids.
|
| 92 |
+
*
|
| 93 |
+
*/
|
| 94 |
+
$screen_ids = apply_filters('toolset_promotion_screen_ids', array());
|
| 95 |
+
if (empty($screen_ids)) {
|
| 96 |
+
return;
|
| 97 |
+
}
|
| 98 |
+
$screen = get_current_screen();
|
| 99 |
+
if (!in_array($screen->id, $screen_ids)) {
|
| 100 |
+
return;
|
| 101 |
+
}
|
| 102 |
+
wp_enqueue_style(__CLASS__);
|
| 103 |
+
wp_enqueue_script(__CLASS__);
|
| 104 |
+
}
|
| 105 |
+
|
| 106 |
+
/**
|
| 107 |
+
* Print in footer
|
| 108 |
+
*
|
| 109 |
+
* Print nessary elemnt in admin footer
|
| 110 |
+
*
|
| 111 |
+
* @since 1.5
|
| 112 |
+
*
|
| 113 |
+
*/
|
| 114 |
+
public function admin_footer()
|
| 115 |
+
{
|
| 116 |
+
$link_learn = $this->get_affiliate_link_string('http://wp-types.com/');
|
| 117 |
+
$link_button = $this->get_affiliate_link_string('http://wp-types.com/#buy-toolset');
|
| 118 |
+
|
| 119 |
+
ob_start();
|
| 120 |
+
?>
|
| 121 |
+
|
| 122 |
+
<div class="ddl-dialogs-container">
|
| 123 |
+
<div id="js-buy-toolset-embedded-message-wrap"></div>
|
| 124 |
+
</div>
|
| 125 |
+
<script type="text/html" id="js-buy-toolset-embedded-message">
|
| 126 |
+
<div class="toolset-modal">
|
| 127 |
+
<h2><?php _e('Want to edit Views, CRED forms and Layouts? Get the full <em>Toolset</em> package!', 'wpcf'); ?></h2>
|
| 128 |
+
|
| 129 |
+
<div class="content">
|
| 130 |
+
<p class="full"><?php _e('The full <em>Toolset</em> package allows you to develop and customize themes without touching PHP. You will be able to:', 'wpcf'); ?></p>
|
| 131 |
+
|
| 132 |
+
<div class="icons">
|
| 133 |
+
<ul>
|
| 134 |
+
<li class="template"><?php _e('Create templates', 'wpcf'); ?></li>
|
| 135 |
+
<li class="layout"><?php _e('Design page layouts using drag-and-drop', 'wpcf'); ?></li>
|
| 136 |
+
<li class="toolset-search"><?php _e('Build parametric searches', 'wpcf'); ?></li>
|
| 137 |
+
</ul>
|
| 138 |
+
<ul>
|
| 139 |
+
<li class="list"><?php _e('Display lists of content', 'wpcf'); ?></li>
|
| 140 |
+
<li class="form"><?php _e('Create front-end content editing forms', 'wpcf'); ?></li>
|
| 141 |
+
<li class="more"><?php _e('and more…', 'wpcf'); ?></li>
|
| 142 |
+
</ul>
|
| 143 |
+
</div>
|
| 144 |
+
|
| 145 |
+
<p class="description"><?php _e('Once you buy the full Toolset, you will be able to edit Views, CRED forms and Layouts in your site, as well as build new ones.', 'wpcf'); ?></p>
|
| 146 |
+
|
| 147 |
+
<a href="<?php echo $link_button; ?>"
|
| 148 |
+
class="button"><?php _e('<em>Toolset</em> Package Options', 'wpcf'); ?></a>
|
| 149 |
+
<a href="<?php echo $link_learn; ?>"
|
| 150 |
+
class="learn"><?php _e('Learn more about <em>Toolset</em>', 'wpcf'); ?></a>
|
| 151 |
+
|
| 152 |
+
</div>
|
| 153 |
+
<span class="icon-toolset-logo"></span>
|
| 154 |
+
<span class="js-close-promotional-message"></span>
|
| 155 |
+
</div>
|
| 156 |
+
</script>
|
| 157 |
+
<?php
|
| 158 |
+
echo ob_get_clean();
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
private function get_affiliate_link_string($link)
|
| 162 |
+
{
|
| 163 |
+
if (function_exists('installer_ep_get_configuration') === false) {
|
| 164 |
+
return $link;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
$info = installer_ep_get_configuration(wp_get_theme()->Name);
|
| 168 |
+
|
| 169 |
+
if (!isset($info['repositories']) &&
|
| 170 |
+
!isset($info['repositories']['toolset'])
|
| 171 |
+
) {
|
| 172 |
+
return $link;
|
| 173 |
+
|
| 174 |
+
} else if (
|
| 175 |
+
isset($info['repositories']['toolset']['affiliate_id']) &&
|
| 176 |
+
isset($info['repositories']['toolset']['affiliate_key'])
|
| 177 |
+
) {
|
| 178 |
+
$id = $info['repositories']['toolset']['affiliate_id'];
|
| 179 |
+
$key = $info['repositories']['toolset']['affiliate_key'];
|
| 180 |
+
|
| 181 |
+
$hash = explode( '#', $link );
|
| 182 |
+
if( count($hash) > 1 ){
|
| 183 |
+
$link = $hash[0];
|
| 184 |
+
$hash = "#" . $hash[1];
|
| 185 |
+
} else {
|
| 186 |
+
$hash = '';
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
return sprintf("%s?aid=%s&affiliate_key=%s%s", $link, $id, $key, $hash);
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
return $link;
|
| 193 |
+
}
|
| 194 |
+
|
| 195 |
+
}
|
| 196 |
+
|
| 197 |
+
}
|
embedded/common/classes/forms.php
CHANGED
|
@@ -2,15 +2,15 @@
|
|
| 2 |
/**
|
| 3 |
* Returns HTML formatted output for elements and handles form submission.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
* @version 1.0
|
| 11 |
*/
|
| 12 |
-
if (!class_exists('Enlimbo_Forms_Wpcf')) {
|
| 13 |
-
|
| 14 |
class Enlimbo_Forms_Wpcf
|
| 15 |
{
|
| 16 |
|
|
@@ -932,8 +932,10 @@ if (!class_exists('Enlimbo_Forms_Wpcf')) {
|
|
| 932 |
}
|
| 933 |
|
| 934 |
$parts = explode('[', $name);
|
| 935 |
-
|
| 936 |
-
|
|
|
|
|
|
|
| 937 |
if (!isset($_REQUEST[$parts[0]])) {
|
| 938 |
return in_array($element['#type'],
|
| 939 |
array('textfield', 'textarea')) ? '' : 0;
|
| 2 |
/**
|
| 3 |
* Returns HTML formatted output for elements and handles form submission.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/classes/forms.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1113864 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
* @version 1.0
|
| 11 |
*/
|
| 12 |
+
if (!class_exists('Enlimbo_Forms_Wpcf')) {
|
| 13 |
+
|
| 14 |
class Enlimbo_Forms_Wpcf
|
| 15 |
{
|
| 16 |
|
| 932 |
}
|
| 933 |
|
| 934 |
$parts = explode('[', $name);
|
| 935 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196173458/comments
|
| 936 |
+
//Security Fixing
|
| 937 |
+
//$parts = array_map(create function('&$a', 'return trim($a, \']\');'), $parts);
|
| 938 |
+
$parts = array_map("cred_mytrimfunction", $parts);
|
| 939 |
if (!isset($_REQUEST[$parts[0]])) {
|
| 940 |
return in_array($element['#type'],
|
| 941 |
array('textfield', 'textarea')) ? '' : 0;
|
embedded/common/debug/debug-information.php
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
/**
|
| 4 |
* produce debug information
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 8 |
* $LastChangedRevision: 1027712 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 3 |
/**
|
| 4 |
* produce debug information
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/debug/debug-information.php $
|
| 7 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 8 |
* $LastChangedRevision: 1027712 $
|
| 9 |
* $LastChangedBy: iworks $
|
embedded/common/debug/functions_debug_information.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/**
|
| 3 |
* produce debug information
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -23,7 +23,7 @@ class ICL_Debug_Information
|
|
| 23 |
if (empty($info)) {
|
| 24 |
$info = array('core', 'plugins', 'theme', 'extra-debug');
|
| 25 |
}
|
| 26 |
-
|
| 27 |
$output = array();
|
| 28 |
foreach ($info as $type) {
|
| 29 |
switch ($type) {
|
|
@@ -42,12 +42,17 @@ class ICL_Debug_Information
|
|
| 42 |
}
|
| 43 |
}
|
| 44 |
return $output;
|
| 45 |
-
|
| 46 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 47 |
function get_core_info() {
|
| 48 |
-
|
| 49 |
global $wpdb;
|
| 50 |
-
|
| 51 |
$core = array(
|
| 52 |
'Wordpress' => array(
|
| 53 |
'Multisite' => is_multisite() ? 'Yes' : 'No',
|
|
@@ -77,12 +82,12 @@ class ICL_Debug_Information
|
|
| 77 |
}
|
| 78 |
|
| 79 |
function get_plugins_info() {
|
| 80 |
-
|
| 81 |
if ( ! function_exists( 'get_plugins' ) ) {
|
| 82 |
$admin_includes_path = str_replace( site_url('/', 'admin'), ABSPATH, admin_url('includes/', 'admin') );
|
| 83 |
require_once $admin_includes_path . 'plugin.php';
|
| 84 |
}
|
| 85 |
-
|
| 86 |
$plugins = get_plugins();
|
| 87 |
$active_plugins = get_option('active_plugins');
|
| 88 |
$active_plugins_info = array();
|
|
@@ -92,7 +97,7 @@ class ICL_Debug_Information
|
|
| 92 |
$active_plugins_info[$plugin] = $plugins[$plugin];
|
| 93 |
}
|
| 94 |
}
|
| 95 |
-
|
| 96 |
$mu_plugins = get_mu_plugins();
|
| 97 |
|
| 98 |
$dropins = get_dropins();
|
|
@@ -102,12 +107,12 @@ class ICL_Debug_Information
|
|
| 102 |
'mu_plugins' => $mu_plugins,
|
| 103 |
'dropins' => $dropins,
|
| 104 |
);
|
| 105 |
-
|
| 106 |
return $output;
|
| 107 |
}
|
| 108 |
-
|
| 109 |
function get_theme_info() {
|
| 110 |
-
|
| 111 |
if ( get_bloginfo( 'version' ) < '3.4' ) {
|
| 112 |
$current_theme = get_theme_data( get_stylesheet_directory() . '/style.css' );
|
| 113 |
$theme = $current_theme;
|
|
@@ -127,7 +132,7 @@ class ICL_Debug_Information
|
|
| 127 |
'DomainPath' => $current_theme->DomainPath,
|
| 128 |
);
|
| 129 |
}
|
| 130 |
-
|
| 131 |
return $theme;
|
| 132 |
}
|
| 133 |
|
| 2 |
/**
|
| 3 |
* produce debug information
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/debug/functions_debug_information.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1113864 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 23 |
if (empty($info)) {
|
| 24 |
$info = array('core', 'plugins', 'theme', 'extra-debug');
|
| 25 |
}
|
| 26 |
+
|
| 27 |
$output = array();
|
| 28 |
foreach ($info as $type) {
|
| 29 |
switch ($type) {
|
| 42 |
}
|
| 43 |
}
|
| 44 |
return $output;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
/**
|
| 48 |
+
*
|
| 49 |
+
* @global object $wpdb
|
| 50 |
+
*
|
| 51 |
+
*/
|
| 52 |
function get_core_info() {
|
| 53 |
+
|
| 54 |
global $wpdb;
|
| 55 |
+
|
| 56 |
$core = array(
|
| 57 |
'Wordpress' => array(
|
| 58 |
'Multisite' => is_multisite() ? 'Yes' : 'No',
|
| 82 |
}
|
| 83 |
|
| 84 |
function get_plugins_info() {
|
| 85 |
+
|
| 86 |
if ( ! function_exists( 'get_plugins' ) ) {
|
| 87 |
$admin_includes_path = str_replace( site_url('/', 'admin'), ABSPATH, admin_url('includes/', 'admin') );
|
| 88 |
require_once $admin_includes_path . 'plugin.php';
|
| 89 |
}
|
| 90 |
+
|
| 91 |
$plugins = get_plugins();
|
| 92 |
$active_plugins = get_option('active_plugins');
|
| 93 |
$active_plugins_info = array();
|
| 97 |
$active_plugins_info[$plugin] = $plugins[$plugin];
|
| 98 |
}
|
| 99 |
}
|
| 100 |
+
|
| 101 |
$mu_plugins = get_mu_plugins();
|
| 102 |
|
| 103 |
$dropins = get_dropins();
|
| 107 |
'mu_plugins' => $mu_plugins,
|
| 108 |
'dropins' => $dropins,
|
| 109 |
);
|
| 110 |
+
|
| 111 |
return $output;
|
| 112 |
}
|
| 113 |
+
|
| 114 |
function get_theme_info() {
|
| 115 |
+
|
| 116 |
if ( get_bloginfo( 'version' ) < '3.4' ) {
|
| 117 |
$current_theme = get_theme_data( get_stylesheet_directory() . '/style.css' );
|
| 118 |
$theme = $current_theme;
|
| 132 |
'DomainPath' => $current_theme->DomainPath,
|
| 133 |
);
|
| 134 |
}
|
| 135 |
+
|
| 136 |
return $theme;
|
| 137 |
}
|
| 138 |
|
embedded/common/expression-parser/js/parser.js
CHANGED
|
@@ -1602,14 +1602,14 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1602 |
if (varTmp != "RAND")
|
| 1603 |
{
|
| 1604 |
if (arrArgs.length < 1)
|
| 1605 |
-
throw varTmp + " requires
|
| 1606 |
else if (arrArgs.length > 1)
|
| 1607 |
throw varTmp + " requires only one argument!";
|
| 1608 |
}
|
| 1609 |
else
|
| 1610 |
{
|
| 1611 |
if (arrArgs.length < 1)
|
| 1612 |
-
throw varTmp + " requires
|
| 1613 |
else if (arrArgs.length > 2)
|
| 1614 |
throw varTmp + " requires at most two arguments!";
|
| 1615 |
}
|
|
@@ -1687,7 +1687,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1687 |
break;
|
| 1688 |
case "STR" :
|
| 1689 |
if (arrArgs.length < 1)
|
| 1690 |
-
throw varTmp + " requires
|
| 1691 |
else if (arrArgs.length > 2)
|
| 1692 |
throw varTmp + " requires at most two arguments!";
|
| 1693 |
varTerm = arrArgs[arrArgs.length-1];
|
|
@@ -1729,7 +1729,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1729 |
if (arrArgs.length > 1)
|
| 1730 |
throw varTmp + " requires only one argument!";
|
| 1731 |
else if (arrArgs.length < 1)
|
| 1732 |
-
throw varTmp + " requires
|
| 1733 |
varTerm = arrArgs[0];
|
| 1734 |
if (varTerm.isVariable)
|
| 1735 |
{
|
|
@@ -1758,7 +1758,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1758 |
break;
|
| 1759 |
case "REGEX" :
|
| 1760 |
if (arrArgs.length < 1)
|
| 1761 |
-
throw varTmp + " requires
|
| 1762 |
else if (arrArgs.length > 2)
|
| 1763 |
throw varTmp + " requires at most two arguments!";
|
| 1764 |
|
|
@@ -1798,7 +1798,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1798 |
case "NUM" :
|
| 1799 |
|
| 1800 |
if (arrArgs.length < 1)
|
| 1801 |
-
throw varTmp + " requires
|
| 1802 |
else if (arrArgs.length > 1)
|
| 1803 |
throw varTmp + " requires only one argument!";
|
| 1804 |
|
|
@@ -1841,7 +1841,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1841 |
break;
|
| 1842 |
case "LEN" :
|
| 1843 |
if (arrArgs.length < 1)
|
| 1844 |
-
throw varTmp + " requires
|
| 1845 |
else if (arrArgs.length > 1)
|
| 1846 |
throw varTmp + " requires only one argument!";
|
| 1847 |
|
|
@@ -1864,7 +1864,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1864 |
break;
|
| 1865 |
case "USER" :
|
| 1866 |
if (arrArgs.length < 1)
|
| 1867 |
-
throw varTmp + " requires
|
| 1868 |
else if (arrArgs.length > 1)
|
| 1869 |
throw varTmp + " requires only one argument!";
|
| 1870 |
|
|
@@ -1887,7 +1887,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1887 |
break;
|
| 1888 |
case "COOKIE" :
|
| 1889 |
if (arrArgs.length < 1)
|
| 1890 |
-
throw varTmp + " requires
|
| 1891 |
else if (arrArgs.length > 1)
|
| 1892 |
throw varTmp + " requires only one argument!";
|
| 1893 |
|
|
@@ -1912,7 +1912,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1912 |
case "CONTAINS" :
|
| 1913 |
// console.log( 'testing functions ', varTmp, arrArgs );
|
| 1914 |
if (arrArgs.length < 2)
|
| 1915 |
-
throw varTmp + " requires
|
| 1916 |
else if (arrArgs.length > 2)
|
| 1917 |
throw varTmp + " requires only two arguments!";
|
| 1918 |
|
|
@@ -1955,7 +1955,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 1955 |
break;
|
| 1956 |
case "DATE" :
|
| 1957 |
if (arrArgs.length < 2)
|
| 1958 |
-
throw varTmp + " requires
|
| 1959 |
else if (arrArgs.length > 2)
|
| 1960 |
throw varTmp + " requires only two arguments!";
|
| 1961 |
|
|
@@ -2030,7 +2030,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 2030 |
case "LEFT" :
|
| 2031 |
case "RIGHT" :
|
| 2032 |
if (arrArgs.length < 2)
|
| 2033 |
-
throw varTmp + " requires
|
| 2034 |
else if (arrArgs.length > 2)
|
| 2035 |
throw varTmp + " requires only two arguments!";
|
| 2036 |
|
|
@@ -2073,7 +2073,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 2073 |
case "IIF" :
|
| 2074 |
|
| 2075 |
if (arrArgs.length < 3)
|
| 2076 |
-
throw varTmp + " requires
|
| 2077 |
else if (arrArgs.length > 3)
|
| 2078 |
throw varTmp + " requires only three arguments!";
|
| 2079 |
|
|
@@ -2134,7 +2134,7 @@ window.ToolsetParser=window.ToolsetParser ||
|
|
| 2134 |
case "MAX" :
|
| 2135 |
case "MIN" :
|
| 2136 |
if (arrArgs.length < 1)
|
| 2137 |
-
throw varTmp + " requires
|
| 2138 |
|
| 2139 |
var _arr=[];
|
| 2140 |
intCntr = arrArgs.length;
|
| 1602 |
if (varTmp != "RAND")
|
| 1603 |
{
|
| 1604 |
if (arrArgs.length < 1)
|
| 1605 |
+
throw varTmp + " requires at least one argument!";
|
| 1606 |
else if (arrArgs.length > 1)
|
| 1607 |
throw varTmp + " requires only one argument!";
|
| 1608 |
}
|
| 1609 |
else
|
| 1610 |
{
|
| 1611 |
if (arrArgs.length < 1)
|
| 1612 |
+
throw varTmp + " requires at least one argument!";
|
| 1613 |
else if (arrArgs.length > 2)
|
| 1614 |
throw varTmp + " requires at most two arguments!";
|
| 1615 |
}
|
| 1687 |
break;
|
| 1688 |
case "STR" :
|
| 1689 |
if (arrArgs.length < 1)
|
| 1690 |
+
throw varTmp + " requires at least one argument!";
|
| 1691 |
else if (arrArgs.length > 2)
|
| 1692 |
throw varTmp + " requires at most two arguments!";
|
| 1693 |
varTerm = arrArgs[arrArgs.length-1];
|
| 1729 |
if (arrArgs.length > 1)
|
| 1730 |
throw varTmp + " requires only one argument!";
|
| 1731 |
else if (arrArgs.length < 1)
|
| 1732 |
+
throw varTmp + " requires at least one argument!";
|
| 1733 |
varTerm = arrArgs[0];
|
| 1734 |
if (varTerm.isVariable)
|
| 1735 |
{
|
| 1758 |
break;
|
| 1759 |
case "REGEX" :
|
| 1760 |
if (arrArgs.length < 1)
|
| 1761 |
+
throw varTmp + " requires at least one argument!";
|
| 1762 |
else if (arrArgs.length > 2)
|
| 1763 |
throw varTmp + " requires at most two arguments!";
|
| 1764 |
|
| 1798 |
case "NUM" :
|
| 1799 |
|
| 1800 |
if (arrArgs.length < 1)
|
| 1801 |
+
throw varTmp + " requires at least one argument!";
|
| 1802 |
else if (arrArgs.length > 1)
|
| 1803 |
throw varTmp + " requires only one argument!";
|
| 1804 |
|
| 1841 |
break;
|
| 1842 |
case "LEN" :
|
| 1843 |
if (arrArgs.length < 1)
|
| 1844 |
+
throw varTmp + " requires at least one argument!";
|
| 1845 |
else if (arrArgs.length > 1)
|
| 1846 |
throw varTmp + " requires only one argument!";
|
| 1847 |
|
| 1864 |
break;
|
| 1865 |
case "USER" :
|
| 1866 |
if (arrArgs.length < 1)
|
| 1867 |
+
throw varTmp + " requires at least one argument!";
|
| 1868 |
else if (arrArgs.length > 1)
|
| 1869 |
throw varTmp + " requires only one argument!";
|
| 1870 |
|
| 1887 |
break;
|
| 1888 |
case "COOKIE" :
|
| 1889 |
if (arrArgs.length < 1)
|
| 1890 |
+
throw varTmp + " requires at least one argument!";
|
| 1891 |
else if (arrArgs.length > 1)
|
| 1892 |
throw varTmp + " requires only one argument!";
|
| 1893 |
|
| 1912 |
case "CONTAINS" :
|
| 1913 |
// console.log( 'testing functions ', varTmp, arrArgs );
|
| 1914 |
if (arrArgs.length < 2)
|
| 1915 |
+
throw varTmp + " requires at least two arguments!";
|
| 1916 |
else if (arrArgs.length > 2)
|
| 1917 |
throw varTmp + " requires only two arguments!";
|
| 1918 |
|
| 1955 |
break;
|
| 1956 |
case "DATE" :
|
| 1957 |
if (arrArgs.length < 2)
|
| 1958 |
+
throw varTmp + " requires at least two arguments!";
|
| 1959 |
else if (arrArgs.length > 2)
|
| 1960 |
throw varTmp + " requires only two arguments!";
|
| 1961 |
|
| 2030 |
case "LEFT" :
|
| 2031 |
case "RIGHT" :
|
| 2032 |
if (arrArgs.length < 2)
|
| 2033 |
+
throw varTmp + " requires at least two arguments!";
|
| 2034 |
else if (arrArgs.length > 2)
|
| 2035 |
throw varTmp + " requires only two arguments!";
|
| 2036 |
|
| 2073 |
case "IIF" :
|
| 2074 |
|
| 2075 |
if (arrArgs.length < 3)
|
| 2076 |
+
throw varTmp + " requires at least three arguments!";
|
| 2077 |
else if (arrArgs.length > 3)
|
| 2078 |
throw varTmp + " requires only three arguments!";
|
| 2079 |
|
| 2134 |
case "MAX" :
|
| 2135 |
case "MIN" :
|
| 2136 |
if (arrArgs.length < 1)
|
| 2137 |
+
throw varTmp + " requires at least one operand!";
|
| 2138 |
|
| 2139 |
var _arr=[];
|
| 2140 |
intCntr = arrArgs.length;
|
embedded/common/expression-parser/parser.php
CHANGED
|
@@ -1639,14 +1639,14 @@ class Toolset_Parser
|
|
| 1639 |
if ($varTmp != "RAND")
|
| 1640 |
{
|
| 1641 |
if (count($arrArgs) < 1)
|
| 1642 |
-
throw new Exception($varTmp . " requires
|
| 1643 |
else if (count($arrArgs) > 1)
|
| 1644 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1645 |
}
|
| 1646 |
else
|
| 1647 |
{
|
| 1648 |
if (count($arrArgs) < 1)
|
| 1649 |
-
throw new Exception($varTmp . " requires
|
| 1650 |
else if (count($arrArgs) > 2)
|
| 1651 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1652 |
}
|
|
@@ -1717,7 +1717,7 @@ class Toolset_Parser
|
|
| 1717 |
break;
|
| 1718 |
case "STR" :
|
| 1719 |
if (count($arrArgs) < 1)
|
| 1720 |
-
throw new Exception($varTmp . " requires
|
| 1721 |
else if (count($arrArgs) > 2)
|
| 1722 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1723 |
$varTerm = $arrArgs[count($arrArgs)-1];
|
|
@@ -1756,7 +1756,7 @@ class Toolset_Parser
|
|
| 1756 |
if (count($arrArgs) > 1)
|
| 1757 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1758 |
else if (count($arrArgs) < 1)
|
| 1759 |
-
throw new Exception($varTmp . " requires
|
| 1760 |
$varTerm = $arrArgs[0];
|
| 1761 |
if ($varTerm->isVariable)
|
| 1762 |
{
|
|
@@ -1791,7 +1791,7 @@ class Toolset_Parser
|
|
| 1791 |
break;
|
| 1792 |
case "REGEX" :
|
| 1793 |
if (count($arrArgs) < 1)
|
| 1794 |
-
throw new Exception($varTmp . " requires
|
| 1795 |
else if (count($arrArgs) > 2)
|
| 1796 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1797 |
|
|
@@ -1828,7 +1828,7 @@ class Toolset_Parser
|
|
| 1828 |
case "UCASE" :
|
| 1829 |
case "NUM" :
|
| 1830 |
if (count($arrArgs) < 1)
|
| 1831 |
-
throw new Exception($varTmp . " requires
|
| 1832 |
else if (count($arrArgs) > 1)
|
| 1833 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1834 |
|
|
@@ -1870,7 +1870,7 @@ class Toolset_Parser
|
|
| 1870 |
break;
|
| 1871 |
case "LEN" :
|
| 1872 |
if (count($arrArgs) < 1)
|
| 1873 |
-
throw new Exception($varTmp . " requires
|
| 1874 |
else if (count($arrArgs) > 1)
|
| 1875 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1876 |
|
|
@@ -1895,7 +1895,7 @@ class Toolset_Parser
|
|
| 1895 |
break;
|
| 1896 |
case "USER" :
|
| 1897 |
if (count($arrArgs) < 1)
|
| 1898 |
-
throw new Exception($varTmp . " requires
|
| 1899 |
else if (count($arrArgs) > 1)
|
| 1900 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1901 |
|
|
@@ -1917,7 +1917,7 @@ class Toolset_Parser
|
|
| 1917 |
break;
|
| 1918 |
case "COOKIE" :
|
| 1919 |
if (count($arrArgs) < 1)
|
| 1920 |
-
throw new Exception($varTmp . " requires
|
| 1921 |
else if (count($arrArgs) > 1)
|
| 1922 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1923 |
|
|
@@ -1939,7 +1939,7 @@ class Toolset_Parser
|
|
| 1939 |
break;
|
| 1940 |
case "CONTAINS" :
|
| 1941 |
if (count($arrArgs) < 2)
|
| 1942 |
-
throw new Exception($varTmp . " requires
|
| 1943 |
else if (count($arrArgs) > 2)
|
| 1944 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 1945 |
|
|
@@ -1970,7 +1970,7 @@ class Toolset_Parser
|
|
| 1970 |
break;
|
| 1971 |
case "DATE" :
|
| 1972 |
if (count($arrArgs) < 2)
|
| 1973 |
-
throw new Exception($varTmp . " requires
|
| 1974 |
else if (count($arrArgs) > 2)
|
| 1975 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 1976 |
|
|
@@ -2010,7 +2010,7 @@ class Toolset_Parser
|
|
| 2010 |
case "empty" :
|
| 2011 |
case "EMPTY" :
|
| 2012 |
if (count($arrArgs) < 1)
|
| 2013 |
-
throw new Exception($varTmp . " requires
|
| 2014 |
else if (count($arrArgs) > 1)
|
| 2015 |
throw new Exception($varTmp . " requires only one arguments!");
|
| 2016 |
|
|
@@ -2041,7 +2041,7 @@ class Toolset_Parser
|
|
| 2041 |
case "LEFT" :
|
| 2042 |
case "RIGHT" :
|
| 2043 |
if (count($arrArgs) < 2)
|
| 2044 |
-
throw new Exception($varTmp . " requires
|
| 2045 |
else if (count($arrArgs) > 2)
|
| 2046 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 2047 |
|
|
@@ -2082,7 +2082,7 @@ class Toolset_Parser
|
|
| 2082 |
case "MID" :
|
| 2083 |
case "IIF" :
|
| 2084 |
if (count($arrArgs) < 3)
|
| 2085 |
-
throw new Exception($varTmp . " requires
|
| 2086 |
else if (count($arrArgs) > 3)
|
| 2087 |
throw new Exception($varTmp . " requires only three arguments!");
|
| 2088 |
|
|
@@ -2132,7 +2132,7 @@ class Toolset_Parser
|
|
| 2132 |
case "MAX" :
|
| 2133 |
case "MIN" :
|
| 2134 |
if (count($arrArgs) < 1)
|
| 2135 |
-
throw new Exception($varTmp . " requires
|
| 2136 |
|
| 2137 |
$_arr=array();
|
| 2138 |
$intCntr = count($arrArgs);
|
| 1639 |
if ($varTmp != "RAND")
|
| 1640 |
{
|
| 1641 |
if (count($arrArgs) < 1)
|
| 1642 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1643 |
else if (count($arrArgs) > 1)
|
| 1644 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1645 |
}
|
| 1646 |
else
|
| 1647 |
{
|
| 1648 |
if (count($arrArgs) < 1)
|
| 1649 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1650 |
else if (count($arrArgs) > 2)
|
| 1651 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1652 |
}
|
| 1717 |
break;
|
| 1718 |
case "STR" :
|
| 1719 |
if (count($arrArgs) < 1)
|
| 1720 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1721 |
else if (count($arrArgs) > 2)
|
| 1722 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1723 |
$varTerm = $arrArgs[count($arrArgs)-1];
|
| 1756 |
if (count($arrArgs) > 1)
|
| 1757 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1758 |
else if (count($arrArgs) < 1)
|
| 1759 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1760 |
$varTerm = $arrArgs[0];
|
| 1761 |
if ($varTerm->isVariable)
|
| 1762 |
{
|
| 1791 |
break;
|
| 1792 |
case "REGEX" :
|
| 1793 |
if (count($arrArgs) < 1)
|
| 1794 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1795 |
else if (count($arrArgs) > 2)
|
| 1796 |
throw new Exception($varTmp . " requires at most two arguments!");
|
| 1797 |
|
| 1828 |
case "UCASE" :
|
| 1829 |
case "NUM" :
|
| 1830 |
if (count($arrArgs) < 1)
|
| 1831 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1832 |
else if (count($arrArgs) > 1)
|
| 1833 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1834 |
|
| 1870 |
break;
|
| 1871 |
case "LEN" :
|
| 1872 |
if (count($arrArgs) < 1)
|
| 1873 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1874 |
else if (count($arrArgs) > 1)
|
| 1875 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1876 |
|
| 1895 |
break;
|
| 1896 |
case "USER" :
|
| 1897 |
if (count($arrArgs) < 1)
|
| 1898 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1899 |
else if (count($arrArgs) > 1)
|
| 1900 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1901 |
|
| 1917 |
break;
|
| 1918 |
case "COOKIE" :
|
| 1919 |
if (count($arrArgs) < 1)
|
| 1920 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 1921 |
else if (count($arrArgs) > 1)
|
| 1922 |
throw new Exception($varTmp . " requires only one argument!");
|
| 1923 |
|
| 1939 |
break;
|
| 1940 |
case "CONTAINS" :
|
| 1941 |
if (count($arrArgs) < 2)
|
| 1942 |
+
throw new Exception($varTmp . " requires at least two arguments!");
|
| 1943 |
else if (count($arrArgs) > 2)
|
| 1944 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 1945 |
|
| 1970 |
break;
|
| 1971 |
case "DATE" :
|
| 1972 |
if (count($arrArgs) < 2)
|
| 1973 |
+
throw new Exception($varTmp . " requires at least two arguments!");
|
| 1974 |
else if (count($arrArgs) > 2)
|
| 1975 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 1976 |
|
| 2010 |
case "empty" :
|
| 2011 |
case "EMPTY" :
|
| 2012 |
if (count($arrArgs) < 1)
|
| 2013 |
+
throw new Exception($varTmp . " requires at least one argument!");
|
| 2014 |
else if (count($arrArgs) > 1)
|
| 2015 |
throw new Exception($varTmp . " requires only one arguments!");
|
| 2016 |
|
| 2041 |
case "LEFT" :
|
| 2042 |
case "RIGHT" :
|
| 2043 |
if (count($arrArgs) < 2)
|
| 2044 |
+
throw new Exception($varTmp . " requires at least two arguments!");
|
| 2045 |
else if (count($arrArgs) > 2)
|
| 2046 |
throw new Exception($varTmp . " requires only two arguments!");
|
| 2047 |
|
| 2082 |
case "MID" :
|
| 2083 |
case "IIF" :
|
| 2084 |
if (count($arrArgs) < 3)
|
| 2085 |
+
throw new Exception($varTmp . " requires at least three arguments!");
|
| 2086 |
else if (count($arrArgs) > 3)
|
| 2087 |
throw new Exception($varTmp . " requires only three arguments!");
|
| 2088 |
|
| 2132 |
case "MAX" :
|
| 2133 |
case "MIN" :
|
| 2134 |
if (count($arrArgs) < 1)
|
| 2135 |
+
throw new Exception($varTmp . " requires at least one operand!");
|
| 2136 |
|
| 2137 |
$_arr=array();
|
| 2138 |
$intCntr = count($arrArgs);
|
embedded/common/functions.php
CHANGED
|
@@ -149,6 +149,8 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 149 |
|
| 150 |
add_filter( 'wpv-extra-condition-filters', 'wpv_add_time_functions' );
|
| 151 |
$evaluate = apply_filters( 'wpv-extra-condition-filters', $evaluate );
|
|
|
|
|
|
|
| 152 |
|
| 153 |
// evaluate empty() statements for variables
|
| 154 |
if ( $has_post ) {
|
|
@@ -165,8 +167,8 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 165 |
|| ( is_array( $match_var ) && empty( $match_var ) ) ) {
|
| 166 |
$is_empty = '1=1';
|
| 167 |
}
|
| 168 |
-
|
| 169 |
$evaluate = str_replace( $matches[0][$i], $is_empty, $evaluate );
|
|
|
|
| 170 |
}
|
| 171 |
}
|
| 172 |
}
|
|
@@ -185,10 +187,9 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 185 |
if ( strpos( $string, '$' ) === 0 ) {
|
| 186 |
$variable_name = substr( $string, 1 ); // omit dollar sign
|
| 187 |
if ( isset( $atts[$variable_name] ) ) {
|
| 188 |
-
$string = get_post_meta( $post->ID, $atts[$variable_name],
|
| 189 |
-
|
| 190 |
-
$
|
| 191 |
-
"'" . $string . "'", $evaluate );
|
| 192 |
}
|
| 193 |
}
|
| 194 |
}
|
|
@@ -246,11 +247,10 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 246 |
$evaluate = str_replace( $matches[0][$i], '1=0', $evaluate );
|
| 247 |
}
|
| 248 |
} else {
|
| 249 |
-
$evaluate = str_replace( $matches[1][$i], $first_string,
|
| 250 |
-
|
| 251 |
-
$evaluate = str_replace( $matches[5][$i], $second_string,
|
| 252 |
-
$evaluate );
|
| 253 |
}
|
|
|
|
| 254 |
}
|
| 255 |
}
|
| 256 |
|
|
@@ -261,10 +261,10 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 261 |
for ( $i = 0; $i < $strings_count; $i++ ) {
|
| 262 |
$string = $matches[1][$i];
|
| 263 |
// remove single quotes from string literals to get value only
|
| 264 |
-
$string = (strpos( $string, '\'' ) === 0) ? substr( $string, 1,
|
| 265 |
-
strlen( $string ) - 2 ) : $string;
|
| 266 |
if ( is_numeric( $string ) ) {
|
| 267 |
$evaluate = str_replace( $matches[1][$i], $string, $evaluate );
|
|
|
|
| 268 |
}
|
| 269 |
}
|
| 270 |
}
|
|
@@ -292,6 +292,7 @@ function wpv_condition( $atts, $post_to_check = null ) {
|
|
| 292 |
$meta = "0";
|
| 293 |
}
|
| 294 |
$evaluate = str_replace( '$' . $match, $meta, $evaluate );
|
|
|
|
| 295 |
}
|
| 296 |
}
|
| 297 |
}
|
|
@@ -487,7 +488,7 @@ class WPV_wpcf_switch_post_from_attr_id
|
|
| 487 |
$this->found = true;
|
| 488 |
|
| 489 |
// save original post
|
| 490 |
-
$this->post = isset( $post ) ? clone $post : null;
|
| 491 |
if ( $authordata ) {
|
| 492 |
$this->authordata = clone $authordata;
|
| 493 |
} else {
|
|
@@ -509,7 +510,7 @@ class WPV_wpcf_switch_post_from_attr_id
|
|
| 509 |
global $post, $authordata, $id;
|
| 510 |
|
| 511 |
// restore the global post values.
|
| 512 |
-
$post = isset( $this->post ) ? clone $this->post : null;
|
| 513 |
if ( $this->authordata ) {
|
| 514 |
$authordata = clone $this->authordata;
|
| 515 |
} else {
|
|
@@ -615,70 +616,3 @@ function wpv_dismiss_message_ajax() {
|
|
| 615 |
die( 'ajax' );
|
| 616 |
}
|
| 617 |
|
| 618 |
-
// disable the admin messages for now. They are causing problems.
|
| 619 |
-
//add_action('admin_head', 'wpv_show_admin_messages');
|
| 620 |
-
|
| 621 |
-
/**
|
| 622 |
-
* Shows stored admin messages.
|
| 623 |
-
*/
|
| 624 |
-
function wpv_show_admin_messages() {
|
| 625 |
-
$messages = get_option( 'wpv-messages', array() );
|
| 626 |
-
$dismissed_messages = get_option( 'wpv-dismissed-messages', array() );
|
| 627 |
-
foreach ( $messages as $message_id => $message ) {
|
| 628 |
-
if ( array_key_exists( $message_id, $dismissed_messages ) ) {
|
| 629 |
-
unset( $messages[$message_id] );
|
| 630 |
-
continue;
|
| 631 |
-
}
|
| 632 |
-
// update the nonce
|
| 633 |
-
$text = $message['message'];
|
| 634 |
-
$nonce = preg_match_all( "/_wpnonce=[^']+/", $text, $matches );
|
| 635 |
-
|
| 636 |
-
if ( $nonce ) {
|
| 637 |
-
$text = str_replace( $matches[0][0],
|
| 638 |
-
'_wpnonce=' . wp_create_nonce( 'dismiss_message' ), $text );
|
| 639 |
-
}
|
| 640 |
-
|
| 641 |
-
wpv_admin_message( $message_id, $text, $message['class'] );
|
| 642 |
-
if ( $show_once ) {
|
| 643 |
-
unset( $messages[$message_id] );
|
| 644 |
-
}
|
| 645 |
-
}
|
| 646 |
-
update_option( 'wpv-messages', $messages );
|
| 647 |
-
}
|
| 648 |
-
|
| 649 |
-
/**
|
| 650 |
-
* Stores admin messages.
|
| 651 |
-
*
|
| 652 |
-
* @param type $message_id
|
| 653 |
-
* @param type $message
|
| 654 |
-
* @param type $show_once
|
| 655 |
-
* @param type $class
|
| 656 |
-
*/
|
| 657 |
-
function wpv_admin_message_store( $message_id, $message, $show_once = true,
|
| 658 |
-
$class = 'updated' ) {
|
| 659 |
-
$messages = get_option( 'wpv-messages', array() );
|
| 660 |
-
$messages[strval( $message_id )] = array(
|
| 661 |
-
'message' => strval( $message ),
|
| 662 |
-
'class' => strval( $class ),
|
| 663 |
-
'show_once' => $show_once,
|
| 664 |
-
);
|
| 665 |
-
update_option( 'wpv-messages', $messages );
|
| 666 |
-
}
|
| 667 |
-
|
| 668 |
-
/**
|
| 669 |
-
* Shows admin message.
|
| 670 |
-
*
|
| 671 |
-
* @param type $message_id
|
| 672 |
-
* @param type $message
|
| 673 |
-
* @param type $class
|
| 674 |
-
*/
|
| 675 |
-
function wpv_admin_message( $message_id, $message, $class = 'updated' ) {
|
| 676 |
-
if ( apply_filters( 'wpv-show-message', true, $message_id ) ) {
|
| 677 |
-
add_action( 'admin_notices',
|
| 678 |
-
create_function( '$a=1, $message_id=\'' . strval( $message_id )
|
| 679 |
-
. '\', $class=\'' . strval( $class )
|
| 680 |
-
. '\', $message=\''
|
| 681 |
-
. htmlentities( strval( $message ), ENT_QUOTES ) . '\'',
|
| 682 |
-
'$screen = get_current_screen(); if (!$screen->is_network) echo "<div class=\"message $class\" id=\"wpv-message-$message_id\"><p>" . html_entity_decode($message, ENT_QUOTES) . "</p></div>";' ) );
|
| 683 |
-
}
|
| 684 |
-
}
|
| 149 |
|
| 150 |
add_filter( 'wpv-extra-condition-filters', 'wpv_add_time_functions' );
|
| 151 |
$evaluate = apply_filters( 'wpv-extra-condition-filters', $evaluate );
|
| 152 |
+
|
| 153 |
+
$logging_string .= "; After extra conditions: " . $evaluate;
|
| 154 |
|
| 155 |
// evaluate empty() statements for variables
|
| 156 |
if ( $has_post ) {
|
| 167 |
|| ( is_array( $match_var ) && empty( $match_var ) ) ) {
|
| 168 |
$is_empty = '1=1';
|
| 169 |
}
|
|
|
|
| 170 |
$evaluate = str_replace( $matches[0][$i], $is_empty, $evaluate );
|
| 171 |
+
$logging_string .= "; After empty: " . $evaluate;
|
| 172 |
}
|
| 173 |
}
|
| 174 |
}
|
| 187 |
if ( strpos( $string, '$' ) === 0 ) {
|
| 188 |
$variable_name = substr( $string, 1 ); // omit dollar sign
|
| 189 |
if ( isset( $atts[$variable_name] ) ) {
|
| 190 |
+
$string = get_post_meta( $post->ID, $atts[$variable_name], true );
|
| 191 |
+
$evaluate = str_replace( $matches[1][$i], "'" . $string . "'", $evaluate );
|
| 192 |
+
$logging_string .= "; After variables I: " . $evaluate;
|
|
|
|
| 193 |
}
|
| 194 |
}
|
| 195 |
}
|
| 247 |
$evaluate = str_replace( $matches[0][$i], '1=0', $evaluate );
|
| 248 |
}
|
| 249 |
} else {
|
| 250 |
+
$evaluate = str_replace( $matches[1][$i], $first_string, $evaluate );
|
| 251 |
+
$evaluate = str_replace( $matches[5][$i], $second_string, $evaluate );
|
|
|
|
|
|
|
| 252 |
}
|
| 253 |
+
$logging_string .= "; After variables II: " . $evaluate;
|
| 254 |
}
|
| 255 |
}
|
| 256 |
|
| 261 |
for ( $i = 0; $i < $strings_count; $i++ ) {
|
| 262 |
$string = $matches[1][$i];
|
| 263 |
// remove single quotes from string literals to get value only
|
| 264 |
+
$string = (strpos( $string, '\'' ) === 0) ? substr( $string, 1, strlen( $string ) - 2 ) : $string;
|
|
|
|
| 265 |
if ( is_numeric( $string ) ) {
|
| 266 |
$evaluate = str_replace( $matches[1][$i], $string, $evaluate );
|
| 267 |
+
$logging_string .= "; After variables III: " . $evaluate;
|
| 268 |
}
|
| 269 |
}
|
| 270 |
}
|
| 292 |
$meta = "0";
|
| 293 |
}
|
| 294 |
$evaluate = str_replace( '$' . $match, $meta, $evaluate );
|
| 295 |
+
$logging_string .= "; After variables IV: " . $evaluate;
|
| 296 |
}
|
| 297 |
}
|
| 298 |
}
|
| 488 |
$this->found = true;
|
| 489 |
|
| 490 |
// save original post
|
| 491 |
+
$this->post = ( isset( $post ) && ( $post instanceof WP_Post ) ) ? clone $post : null;
|
| 492 |
if ( $authordata ) {
|
| 493 |
$this->authordata = clone $authordata;
|
| 494 |
} else {
|
| 510 |
global $post, $authordata, $id;
|
| 511 |
|
| 512 |
// restore the global post values.
|
| 513 |
+
$post = ( isset( $this->post ) && ( $this->post instanceof WP_Post ) ) ? clone $this->post : null;
|
| 514 |
if ( $this->authordata ) {
|
| 515 |
$authordata = clone $this->authordata;
|
| 516 |
} else {
|
| 616 |
die( 'ajax' );
|
| 617 |
}
|
| 618 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/res/css/colorbox.css
ADDED
|
@@ -0,0 +1,88 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* -------- */
|
| 2 |
+
/* Colorbox */
|
| 3 |
+
/* -------- */
|
| 4 |
+
|
| 5 |
+
/* This file contains styles for default Colorbox elements only */
|
| 6 |
+
/* TODO: This file can be removed, we can load it from common */
|
| 7 |
+
|
| 8 |
+
body.disable-scrollbar {
|
| 9 |
+
overflow: hidden;
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
#colorbox,
|
| 13 |
+
#cboxOverlay,
|
| 14 |
+
#cboxWrapper {
|
| 15 |
+
position:absolute;
|
| 16 |
+
top:0;
|
| 17 |
+
left:0;
|
| 18 |
+
z-index:10000;
|
| 19 |
+
/* overflow:hidden;*/
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
#cboxOverlay {
|
| 23 |
+
position:fixed;
|
| 24 |
+
width:100%;
|
| 25 |
+
max-width: 100%;
|
| 26 |
+
height:100%;
|
| 27 |
+
background: #000;
|
| 28 |
+
}
|
| 29 |
+
#cboxMiddleLeft,
|
| 30 |
+
#cboxBottomLeft {
|
| 31 |
+
clear:left;
|
| 32 |
+
}
|
| 33 |
+
#cboxContent {
|
| 34 |
+
position:relative;
|
| 35 |
+
}
|
| 36 |
+
#cboxLoadedContent {
|
| 37 |
+
overflow:visible!important;
|
| 38 |
+
-webkit-overflow-scrolling: touch;
|
| 39 |
+
}
|
| 40 |
+
#cboxTitle {
|
| 41 |
+
margin:0;
|
| 42 |
+
}
|
| 43 |
+
#cboxLoadingOverlay,
|
| 44 |
+
#cboxLoadingGraphic {
|
| 45 |
+
position:absolute;
|
| 46 |
+
top:0;
|
| 47 |
+
left:0;
|
| 48 |
+
width:100%;
|
| 49 |
+
height:100%;
|
| 50 |
+
}
|
| 51 |
+
#cboxPrevious,
|
| 52 |
+
#cboxNext,
|
| 53 |
+
#cboxClose,
|
| 54 |
+
#cboxSlideshow {
|
| 55 |
+
cursor:pointer;
|
| 56 |
+
}
|
| 57 |
+
.cboxPhoto {
|
| 58 |
+
display:block;
|
| 59 |
+
float:left;
|
| 60 |
+
margin:auto;
|
| 61 |
+
max-width:none;
|
| 62 |
+
border:0;
|
| 63 |
+
-ms-interpolation-mode:bicubic;
|
| 64 |
+
}
|
| 65 |
+
.cboxIframe {
|
| 66 |
+
display:block;
|
| 67 |
+
width:100%;
|
| 68 |
+
height:100%;
|
| 69 |
+
border:0;
|
| 70 |
+
}
|
| 71 |
+
#colorbox,
|
| 72 |
+
#cboxContent,
|
| 73 |
+
#cboxLoadedContent {
|
| 74 |
+
-webkit-box-sizing:content-box;
|
| 75 |
+
-moz-box-sizing:content-box;
|
| 76 |
+
box-sizing:content-box;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
.cboxIE #cboxTopLeft,
|
| 80 |
+
.cboxIE #cboxTopCenter,
|
| 81 |
+
.cboxIE #cboxTopRight,
|
| 82 |
+
.cboxIE #cboxBottomLeft,
|
| 83 |
+
.cboxIE #cboxBottomCenter,
|
| 84 |
+
.cboxIE #cboxBottomRight,
|
| 85 |
+
.cboxIE #cboxMiddleLeft,
|
| 86 |
+
.cboxIE #cboxMiddleRight {
|
| 87 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF);
|
| 88 |
+
}
|
embedded/common/res/css/toolset-promotion.css
ADDED
|
@@ -0,0 +1,155 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
.toolset-modal
|
| 3 |
+
{
|
| 4 |
+
font-family: "Open Sans";
|
| 5 |
+
font-size: 15px;
|
| 6 |
+
width: 550px;
|
| 7 |
+
background-color: #fff;
|
| 8 |
+
padding: 45px 0 42px 0;
|
| 9 |
+
position: relative;
|
| 10 |
+
|
| 11 |
+
-webkit-box-shadow: 5px 5px 15px 0px rgba(50, 50, 50, 0.38);
|
| 12 |
+
-moz-box-shadow: 5px 5px 15px 0px rgba(50, 50, 50, 0.38);
|
| 13 |
+
box-shadow: 5px 5px 15px 0px rgba(50, 50, 50, 0.38);
|
| 14 |
+
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
.toolset-modal h2
|
| 18 |
+
{
|
| 19 |
+
color: #fff;
|
| 20 |
+
position: relative;
|
| 21 |
+
background-color: #333;
|
| 22 |
+
padding: 15px 30px;
|
| 23 |
+
font-size: 24px;
|
| 24 |
+
line-height: 30px;
|
| 25 |
+
font-weight: 300;
|
| 26 |
+
margin: 0;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.toolset-modal .icon-toolset-logo
|
| 30 |
+
{
|
| 31 |
+
color: #f05a28;
|
| 32 |
+
position: absolute;
|
| 33 |
+
top: 6px;
|
| 34 |
+
left: 23px;
|
| 35 |
+
font-size: 53px;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
.toolset-modal ul:before
|
| 39 |
+
{
|
| 40 |
+
content: "";
|
| 41 |
+
display: table;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
.toolset-modal .content
|
| 45 |
+
{
|
| 46 |
+
padding: 0 28px;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
.toolset-modal ul
|
| 50 |
+
{
|
| 51 |
+
display: table-row;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
.toolset-modal li:first-child
|
| 55 |
+
{
|
| 56 |
+
min-width: 75px;
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
.toolset-modal li:last-child
|
| 60 |
+
{
|
| 61 |
+
padding-right: 0;
|
| 62 |
+
min-width: 115px;
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
.toolset-modal li
|
| 66 |
+
,.js-close-promotional-message
|
| 67 |
+
{
|
| 68 |
+
background: transparent url(../images/toolset.promotion/icons.png) no-repeat;
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
.toolset-modal li
|
| 72 |
+
{
|
| 73 |
+
display: table-cell;
|
| 74 |
+
font-size: 13px;
|
| 75 |
+
font-weight: 700;
|
| 76 |
+
height: 52px;
|
| 77 |
+
padding: 0 20px 0 38px;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
|
| 81 |
+
.toolset-modal li.layout{background-position: 0 -65px}
|
| 82 |
+
.toolset-modal li.toolset-search{background-position: 0 -130px}
|
| 83 |
+
.toolset-modal li.list {background-position: 0 -195px}
|
| 84 |
+
.toolset-modal li.form {background-position: 0 -260px}
|
| 85 |
+
.toolset-modal li.more {background-position: 0 -325px}
|
| 86 |
+
|
| 87 |
+
.toolset-modal .full img
|
| 88 |
+
{
|
| 89 |
+
padding-bottom: 19px;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
.toolset-modal .full
|
| 93 |
+
{
|
| 94 |
+
background: transparent url(../images/toolset.promotion/full.jpg) no-repeat;
|
| 95 |
+
padding-left: 298px;
|
| 96 |
+
min-height: 165px;
|
| 97 |
+
font-size: 15px;
|
| 98 |
+
margin-bottom: 0;
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
.toolset-modal .icons
|
| 102 |
+
{
|
| 103 |
+
border: 1px solid #777;
|
| 104 |
+
border-width: 1px 0;
|
| 105 |
+
padding-top: 18px;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
.toolset-modal .description
|
| 109 |
+
{
|
| 110 |
+
font-size: 13px;
|
| 111 |
+
color: #4d4d4d;
|
| 112 |
+
margin: 30px 0;
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
.toolset-modal em
|
| 116 |
+
{
|
| 117 |
+
font-weight: 600;
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
.toolset-modal .button
|
| 121 |
+
{
|
| 122 |
+
padding: 10px 15px;
|
| 123 |
+
background-color: #f05a28;
|
| 124 |
+
color: #fff;
|
| 125 |
+
text-decoration: none;
|
| 126 |
+
margin-top: -10px;
|
| 127 |
+
height: auto;
|
| 128 |
+
font-size: 18px;
|
| 129 |
+
line-height: 1em;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
.toolset-modal .learn
|
| 133 |
+
{
|
| 134 |
+
font-size: 15px;
|
| 135 |
+
color: #f05a28;
|
| 136 |
+
display: inline-block;
|
| 137 |
+
margin-left: 20px;
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
.ddl-dialogs-container
|
| 141 |
+
{
|
| 142 |
+
display: none;
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
.js-close-promotional-message
|
| 146 |
+
{
|
| 147 |
+
background-position: 0 -480px;
|
| 148 |
+
cursor: pointer;
|
| 149 |
+
display: block;
|
| 150 |
+
height: 20px;
|
| 151 |
+
position: absolute;
|
| 152 |
+
right: -10px;
|
| 153 |
+
top: -10px;
|
| 154 |
+
width: 20px;
|
| 155 |
+
}
|
embedded/common/res/images/toolset.promotion/full.jpg
ADDED
|
Binary file
|
embedded/common/res/images/toolset.promotion/icons.png
ADDED
|
Binary file
|
embedded/common/res/js/jquery.colorbox-min.js
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
Colorbox v1.4.31 - 2013-09-25
|
| 3 |
+
jQuery lightbox and modal window plugin
|
| 4 |
+
(c) 2013 Jack Moore - http://www.jacklmoore.com/colorbox
|
| 5 |
+
license: http://www.opensource.org/licenses/mit-license.php
|
| 6 |
+
*/
|
| 7 |
+
(function(e,t,i){function o(i,o,n){var r=t.createElement(i);return o&&(r.id=Z+o),n&&(r.style.cssText=n),e(r)}function n(){return i.innerHeight?i.innerHeight:e(i).height()}function r(e){var t=k.length,i=(z+e)%t;return 0>i?t+i:i}function h(e,t){return Math.round((/%/.test(e)?("x"===t?E.width():n())/100:1)*parseInt(e,10))}function s(e,t){return e.photo||e.photoRegex.test(t)}function l(e,t){return e.retinaUrl&&i.devicePixelRatio>1?t.replace(e.photoRegex,e.retinaSuffix):t}function a(e){"contains"in g[0]&&!g[0].contains(e.target)&&(e.stopPropagation(),g.focus())}function d(){var t,i=e.data(N,Y);null==i?(B=e.extend({},X),console&&console.log&&console.log("Error: cboxElement missing settings object")):B=e.extend({},i);for(t in B)e.isFunction(B[t])&&"on"!==t.slice(0,2)&&(B[t]=B[t].call(N));B.rel=B.rel||N.rel||e(N).data("rel")||"nofollow",B.href=B.href||e(N).attr("href"),B.title=B.title||N.title,"string"==typeof B.href&&(B.href=e.trim(B.href))}function c(i,o){e(t).trigger(i),st.trigger(i),e.isFunction(o)&&o.call(N)}function u(i){q||(N=i,d(),k=e(N),z=0,"nofollow"!==B.rel&&(k=e("."+et).filter(function(){var t,i=e.data(this,Y);return i&&(t=e(this).data("rel")||i.rel||this.rel),t===B.rel}),z=k.index(N),-1===z&&(k=k.add(N),z=k.length-1)),w.css({opacity:parseFloat(B.opacity),cursor:B.overlayClose?"pointer":"auto",visibility:"visible"}).show(),J&&g.add(w).removeClass(J),B.className&&g.add(w).addClass(B.className),J=B.className,B.closeButton?K.html(B.close).appendTo(y):K.appendTo("<div/>"),U||(U=$=!0,g.css({visibility:"hidden",display:"block"}),H=o(lt,"LoadedContent","width:0; height:0; overflow:hidden"),y.css({width:"",height:""}).append(H),O=x.height()+C.height()+y.outerHeight(!0)-y.height(),_=b.width()+T.width()+y.outerWidth(!0)-y.width(),D=H.outerHeight(!0),A=H.outerWidth(!0),B.w=h(B.initialWidth,"x"),B.h=h(B.initialHeight,"y"),H.css({width:"",height:B.h}),Q.position(),c(tt,B.onOpen),P.add(L).hide(),g.focus(),B.trapFocus&&t.addEventListener&&(t.addEventListener("focus",a,!0),st.one(rt,function(){t.removeEventListener("focus",a,!0)})),B.returnFocus&&st.one(rt,function(){e(N).focus()})),m())}function f(){!g&&t.body&&(V=!1,E=e(i),g=o(lt).attr({id:Y,"class":e.support.opacity===!1?Z+"IE":"",role:"dialog",tabindex:"-1"}).hide(),w=o(lt,"Overlay").hide(),F=e([o(lt,"LoadingOverlay")[0],o(lt,"LoadingGraphic")[0]]),v=o(lt,"Wrapper"),y=o(lt,"Content").append(L=o(lt,"Title"),S=o(lt,"Current"),I=e('<button type="button"/>').attr({id:Z+"Previous"}),R=e('<button type="button"/>').attr({id:Z+"Next"}),M=o("button","Slideshow"),F),K=e('<button type="button"/>').attr({id:Z+"Close"}),v.append(o(lt).append(o(lt,"TopLeft"),x=o(lt,"TopCenter"),o(lt,"TopRight")),o(lt,!1,"clear:left").append(b=o(lt,"MiddleLeft"),y,T=o(lt,"MiddleRight")),o(lt,!1,"clear:left").append(o(lt,"BottomLeft"),C=o(lt,"BottomCenter"),o(lt,"BottomRight"))).find("div div").css({"float":"left"}),W=o(lt,!1,"position:absolute; width:9999px; visibility:hidden; display:none"),P=R.add(I).add(S).add(M),e(t.body).append(w,g.append(v,W)))}function p(){function i(e){e.which>1||e.shiftKey||e.altKey||e.metaKey||e.ctrlKey||(e.preventDefault(),u(this))}return g?(V||(V=!0,R.click(function(){Q.next()}),I.click(function(){Q.prev()}),K.click(function(){Q.close()}),w.click(function(){B.overlayClose&&Q.close()}),e(t).bind("keydown."+Z,function(e){var t=e.keyCode;U&&B.escKey&&27===t&&(e.preventDefault(),Q.close()),U&&B.arrowKey&&k[1]&&!e.altKey&&(37===t?(e.preventDefault(),I.click()):39===t&&(e.preventDefault(),R.click()))}),e.isFunction(e.fn.on)?e(t).on("click."+Z,"."+et,i):e("."+et).live("click."+Z,i)),!0):!1}function m(){var n,r,a,u=Q.prep,f=++at;$=!0,j=!1,N=k[z],d(),c(ht),c(it,B.onLoad),B.h=B.height?h(B.height,"y")-D-O:B.innerHeight&&h(B.innerHeight,"y"),B.w=B.width?h(B.width,"x")-A-_:B.innerWidth&&h(B.innerWidth,"x"),B.mw=B.w,B.mh=B.h,B.maxWidth&&(B.mw=h(B.maxWidth,"x")-A-_,B.mw=B.w&&B.w<B.mw?B.w:B.mw),B.maxHeight&&(B.mh=h(B.maxHeight,"y")-D-O,B.mh=B.h&&B.h<B.mh?B.h:B.mh),n=B.href,G=setTimeout(function(){F.show()},100),B.inline?(a=o(lt).hide().insertBefore(e(n)[0]),st.one(ht,function(){a.replaceWith(H.children())}),u(e(n))):B.iframe?u(" "):B.html?u(B.html):s(B,n)?(n=l(B,n),j=t.createElement("img"),e(j).addClass(Z+"Photo").bind("error",function(){B.title=!1,u(o(lt,"Error").html(B.imgError))}).one("load",function(){var t;f===at&&(e.each(["alt","longdesc","aria-describedby"],function(t,i){var o=e(N).attr(i)||e(N).attr("data-"+i);o&&j.setAttribute(i,o)}),B.retinaImage&&i.devicePixelRatio>1&&(j.height=j.height/i.devicePixelRatio,j.width=j.width/i.devicePixelRatio),B.scalePhotos&&(r=function(){j.height-=j.height*t,j.width-=j.width*t},B.mw&&j.width>B.mw&&(t=(j.width-B.mw)/j.width,r()),B.mh&&j.height>B.mh&&(t=(j.height-B.mh)/j.height,r())),B.h&&(j.style.marginTop=Math.max(B.mh-j.height,0)/2+"px"),k[1]&&(B.loop||k[z+1])&&(j.style.cursor="pointer",j.onclick=function(){Q.next()}),j.style.width=j.width+"px",j.style.height=j.height+"px",setTimeout(function(){u(j)},1))}),setTimeout(function(){j.src=n},1)):n&&W.load(n,B.data,function(t,i){f===at&&u("error"===i?o(lt,"Error").html(B.xhrError):e(this).contents())})}var w,g,v,y,x,b,T,C,k,E,H,W,F,L,S,M,R,I,K,P,B,O,_,D,A,N,z,j,U,$,q,G,Q,J,V,X={html:!1,photo:!1,iframe:!1,inline:!1,transition:"elastic",speed:300,fadeOut:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,href:!1,title:!1,rel:!1,opacity:.9,preloading:!0,className:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:void 0,closeButton:!0,fastIframe:!0,open:!1,reposition:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",photoRegex:/\.(gif|png|jp(e|g|eg)|bmp|ico|webp)((#|\?).*)?$/i,retinaImage:!1,retinaUrl:!1,retinaSuffix:"@2x.$1",current:"image {current} of {total}",previous:"previous",next:"next",close:"close",xhrError:"This content failed to load.",imgError:"This image failed to load.",returnFocus:!0,trapFocus:!0,onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1},Y="colorbox",Z="cbox",et=Z+"Element",tt=Z+"_open",it=Z+"_load",ot=Z+"_complete",nt=Z+"_cleanup",rt=Z+"_closed",ht=Z+"_purge",st=e("<a/>"),lt="div",at=0,dt={},ct=function(){function e(){clearTimeout(h)}function t(){(B.loop||k[z+1])&&(e(),h=setTimeout(Q.next,B.slideshowSpeed))}function i(){M.html(B.slideshowStop).unbind(l).one(l,o),st.bind(ot,t).bind(it,e),g.removeClass(s+"off").addClass(s+"on")}function o(){e(),st.unbind(ot,t).unbind(it,e),M.html(B.slideshowStart).unbind(l).one(l,function(){Q.next(),i()}),g.removeClass(s+"on").addClass(s+"off")}function n(){r=!1,M.hide(),e(),st.unbind(ot,t).unbind(it,e),g.removeClass(s+"off "+s+"on")}var r,h,s=Z+"Slideshow_",l="click."+Z;return function(){r?B.slideshow||(st.unbind(nt,n),n()):B.slideshow&&k[1]&&(r=!0,st.one(nt,n),B.slideshowAuto?i():o(),M.show())}}();e.colorbox||(e(f),Q=e.fn[Y]=e[Y]=function(t,i){var o=this;if(t=t||{},f(),p()){if(e.isFunction(o))o=e("<a/>"),t.open=!0;else if(!o[0])return o;i&&(t.onComplete=i),o.each(function(){e.data(this,Y,e.extend({},e.data(this,Y)||X,t))}).addClass(et),(e.isFunction(t.open)&&t.open.call(o)||t.open)&&u(o[0])}return o},Q.position=function(t,i){function o(){x[0].style.width=C[0].style.width=y[0].style.width=parseInt(g[0].style.width,10)-_+"px",y[0].style.height=b[0].style.height=T[0].style.height=parseInt(g[0].style.height,10)-O+"px"}var r,s,l,a=0,d=0,c=g.offset();if(E.unbind("resize."+Z),g.css({top:-9e4,left:-9e4}),s=E.scrollTop(),l=E.scrollLeft(),B.fixed?(c.top-=s,c.left-=l,g.css({position:"fixed"})):(a=s,d=l,g.css({position:"absolute"})),d+=B.right!==!1?Math.max(E.width()-B.w-A-_-h(B.right,"x"),0):B.left!==!1?h(B.left,"x"):Math.round(Math.max(E.width()-B.w-A-_,0)/2),a+=B.bottom!==!1?Math.max(n()-B.h-D-O-h(B.bottom,"y"),0):B.top!==!1?h(B.top,"y"):Math.round(Math.max(n()-B.h-D-O,0)/2),g.css({top:c.top,left:c.left,visibility:"visible"}),v[0].style.width=v[0].style.height="9999px",r={width:B.w+A+_,height:B.h+D+O,top:a,left:d},t){var u=0;e.each(r,function(e){return r[e]!==dt[e]?(u=t,void 0):void 0}),t=u}dt=r,t||g.css(r),g.dequeue().animate(r,{duration:t||0,complete:function(){o(),$=!1,v[0].style.width=B.w+A+_+"px",v[0].style.height=B.h+D+O+"px",B.reposition&&setTimeout(function(){E.bind("resize."+Z,Q.position)},1),i&&i()},step:o})},Q.resize=function(e){var t;U&&(e=e||{},e.width&&(B.w=h(e.width,"x")-A-_),e.innerWidth&&(B.w=h(e.innerWidth,"x")),H.css({width:B.w}),e.height&&(B.h=h(e.height,"y")-D-O),e.innerHeight&&(B.h=h(e.innerHeight,"y")),e.innerHeight||e.height||(t=H.scrollTop(),H.css({height:"auto"}),B.h=H.height()),H.css({height:B.h}),t&&H.scrollTop(t),Q.position("none"===B.transition?0:B.speed))},Q.prep=function(i){function n(){return B.w=B.w||H.width(),B.w=B.mw&&B.mw<B.w?B.mw:B.w,B.w}function h(){return B.h=B.h||H.height(),B.h=B.mh&&B.mh<B.h?B.mh:B.h,B.h}if(U){var a,d="none"===B.transition?0:B.speed;H.empty().remove(),H=o(lt,"LoadedContent").append(i),H.hide().appendTo(W.show()).css({width:n(),overflow:B.scrolling?"auto":"hidden"}).css({height:h()}).prependTo(y),W.hide(),e(j).css({"float":"none"}),a=function(){function i(){e.support.opacity===!1&&g[0].style.removeAttribute("filter")}var n,h,a=k.length,u="frameBorder",f="allowTransparency";U&&(h=function(){clearTimeout(G),F.hide(),c(ot,B.onComplete)},L.html(B.title).add(H).show(),a>1?("string"==typeof B.current&&S.html(B.current.replace("{current}",z+1).replace("{total}",a)).show(),R[B.loop||a-1>z?"show":"hide"]().html(B.next),I[B.loop||z?"show":"hide"]().html(B.previous),ct(),B.preloading&&e.each([r(-1),r(1)],function(){var i,o,n=k[this],r=e.data(n,Y);r&&r.href?(i=r.href,e.isFunction(i)&&(i=i.call(n))):i=e(n).attr("href"),i&&s(r,i)&&(i=l(r,i),o=t.createElement("img"),o.src=i)})):P.hide(),B.iframe?(n=o("iframe")[0],u in n&&(n[u]=0),f in n&&(n[f]="true"),B.scrolling||(n.scrolling="no"),e(n).attr({src:B.href,name:(new Date).getTime(),"class":Z+"Iframe",allowFullScreen:!0,webkitAllowFullScreen:!0,mozallowfullscreen:!0}).one("load",h).appendTo(H),st.one(ht,function(){n.src="//about:blank"}),B.fastIframe&&e(n).trigger("load")):h(),"fade"===B.transition?g.fadeTo(d,1,i):i())},"fade"===B.transition?g.fadeTo(d,0,function(){Q.position(0,a)}):Q.position(d,a)}},Q.next=function(){!$&&k[1]&&(B.loop||k[z+1])&&(z=r(1),u(k[z]))},Q.prev=function(){!$&&k[1]&&(B.loop||z)&&(z=r(-1),u(k[z]))},Q.close=function(){U&&!q&&(q=!0,U=!1,c(nt,B.onCleanup),E.unbind("."+Z),w.fadeTo(B.fadeOut||0,0),g.stop().fadeTo(B.fadeOut||0,0,function(){g.add(w).css({opacity:1,cursor:"auto"}).hide(),c(ht),H.empty().remove(),setTimeout(function(){q=!1,c(rt,B.onClosed)},1)}))},Q.remove=function(){g&&(g.stop(),e.colorbox.close(),g.stop().remove(),w.remove(),q=!1,g=null,e("."+et).removeData(Y).removeClass(et),e(t).unbind("click."+Z))},Q.element=function(){return e(N)},Q.settings=X)})(jQuery,document,window);
|
embedded/common/res/js/toolset-promotion.js
ADDED
|
@@ -0,0 +1,47 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
var Toolset_Promotion = Toolset_Promotion || {};
|
| 2 |
+
|
| 3 |
+
Toolset_Promotion = function($){
|
| 4 |
+
var self = this;
|
| 5 |
+
|
| 6 |
+
self.init = function(){
|
| 7 |
+
self.toolset_open_promotional_message();
|
| 8 |
+
};
|
| 9 |
+
|
| 10 |
+
self.toolset_open_promotional_message = function(){
|
| 11 |
+
var $el = $('.js-open-promotional-message')
|
| 12 |
+
, template = $('#js-buy-toolset-embedded-message').html()
|
| 13 |
+
, $container = $('#js-buy-toolset-embedded-message-wrap');
|
| 14 |
+
|
| 15 |
+
$container.html( _.template( template ) );
|
| 16 |
+
|
| 17 |
+
$(document).on('click', $el.selector, function(event){
|
| 18 |
+
event.preventDefault();
|
| 19 |
+
$.colorbox({
|
| 20 |
+
href: $container.selector,
|
| 21 |
+
inline: true,
|
| 22 |
+
open: true,
|
| 23 |
+
closeButton: false,
|
| 24 |
+
fixed: true,
|
| 25 |
+
top: false,
|
| 26 |
+
width:'554px',
|
| 27 |
+
onComplete: function() {
|
| 28 |
+
|
| 29 |
+
},
|
| 30 |
+
onCleanup: function() {
|
| 31 |
+
|
| 32 |
+
},
|
| 33 |
+
opacity: .2
|
| 34 |
+
});
|
| 35 |
+
})
|
| 36 |
+
$('.js-close-promotional-message').on('click', function(){
|
| 37 |
+
$.colorbox.close();
|
| 38 |
+
});
|
| 39 |
+
};
|
| 40 |
+
|
| 41 |
+
self.init();
|
| 42 |
+
|
| 43 |
+
};
|
| 44 |
+
|
| 45 |
+
;(function($){
|
| 46 |
+
var toolset_promotion_message = new Toolset_Promotion($);
|
| 47 |
+
}(jQuery));
|
embedded/common/toolset-forms/api.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -66,21 +66,23 @@ function wptoolset_timetodate( $timestamp, $format = null ){
|
|
| 66 |
global $wptoolset_forms;
|
| 67 |
return $wptoolset_forms->timetodate( $timestamp, $format );
|
| 68 |
}
|
| 69 |
-
/**
|
| 70 |
-
* wptoolset_esc_like
|
| 71 |
-
*
|
| 72 |
-
* In WordPress 4.0, like_escape() was deprecated, due to incorrect
|
| 73 |
-
* documentation and improper sanitization leading to a history of misuse
|
| 74 |
-
* To maintain compatibility with versions of WP before 4.0, we duplicate the
|
| 75 |
-
* logic of the replacement, wpdb::esc_like()
|
| 76 |
-
*
|
| 77 |
-
* @see wpdb::esc_like() for more details on proper use.
|
| 78 |
-
*
|
| 79 |
-
* @param string $text The raw text to be escaped.
|
| 80 |
-
* @return string Text in the form of a LIKE phrase. Not SQL safe. Run through
|
| 81 |
-
* wpdb::prepare() before use.
|
| 82 |
-
*/
|
| 83 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 84 |
function wptoolset_esc_like( $like )
|
| 85 |
{
|
| 86 |
global $wpdb;
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/api.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1113864 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 66 |
global $wptoolset_forms;
|
| 67 |
return $wptoolset_forms->timetodate( $timestamp, $format );
|
| 68 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 69 |
|
| 70 |
+
/**
|
| 71 |
+
* wptoolset_esc_like
|
| 72 |
+
*
|
| 73 |
+
* In WordPress 4.0, like_escape() was deprecated, due to incorrect
|
| 74 |
+
* documentation and improper sanitization leading to a history of misuse
|
| 75 |
+
* To maintain compatibility with versions of WP before 4.0, we duplicate the
|
| 76 |
+
* logic of the replacement, wpdb::esc_like()
|
| 77 |
+
*
|
| 78 |
+
* @see wpdb::esc_like() for more details on proper use.
|
| 79 |
+
*
|
| 80 |
+
* @global object $wpdb
|
| 81 |
+
*
|
| 82 |
+
* @param string $text The raw text to be escaped.
|
| 83 |
+
* @return string Text in the form of a LIKE phrase. Not SQL safe. Run through
|
| 84 |
+
* wpdb::prepare() before use.
|
| 85 |
+
*/
|
| 86 |
function wptoolset_esc_like( $like )
|
| 87 |
{
|
| 88 |
global $wpdb;
|
embedded/common/toolset-forms/bootstrap.php
CHANGED
|
@@ -2,77 +2,74 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-01
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
-
|
| 12 |
require_once 'api.php';
|
| 13 |
|
| 14 |
-
define(
|
| 15 |
-
define(
|
| 16 |
|
| 17 |
/**
|
| 18 |
* check we are as a embedded?
|
| 19 |
*/
|
| 20 |
-
if (
|
| 21 |
-
define(
|
| 22 |
}
|
| 23 |
/**
|
| 24 |
* setup WPTOOLSET_FORMS_RELPATH for plugin
|
| 25 |
*/
|
| 26 |
-
if (
|
| 27 |
-
define(
|
| 28 |
}
|
| 29 |
-
if (
|
| 30 |
-
define(
|
| 31 |
}
|
| 32 |
|
| 33 |
-
class WPToolset_Forms_Bootstrap
|
| 34 |
-
{
|
| 35 |
|
| 36 |
private $__forms;
|
| 37 |
|
| 38 |
-
public final function __construct()
|
| 39 |
-
{
|
| 40 |
// Custom conditinal AJAX check
|
| 41 |
-
add_action(
|
| 42 |
-
array($this, 'ajaxCustomConditional') );
|
| 43 |
|
| 44 |
// Date conditinal AJAX check
|
| 45 |
-
add_action(
|
| 46 |
-
array($this, 'ajaxConditional') );
|
| 47 |
|
| 48 |
// Date extended localization AJAX callback
|
| 49 |
-
add_action(
|
| 50 |
-
add_action(
|
|
|
|
|
|
|
|
|
|
|
|
|
| 51 |
|
| 52 |
// File media popup
|
| 53 |
-
if (
|
| 54 |
-
'context=wpt-fields-media-insert' ) !== false)
|
| 55 |
) {
|
| 56 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.file.php';
|
| 57 |
-
add_action(
|
| 58 |
}
|
| 59 |
-
add_filter('sanitize_file_name', array(
|
| 60 |
|
| 61 |
-
add_filter(
|
| 62 |
/**
|
| 63 |
* common class for calendar
|
| 64 |
*/
|
| 65 |
-
require_once WPTOOLSET_FORMS_ABSPATH.'/classes/class.date.scripts.php';
|
| 66 |
new WPToolset_Field_Date_Scripts();
|
| 67 |
|
| 68 |
-
add_action('pre_get_posts', array($this,'pre_get_posts'));
|
| 69 |
}
|
| 70 |
|
| 71 |
// returns HTML
|
| 72 |
-
public function field($form_id, $config, $value)
|
| 73 |
-
|
| 74 |
-
$form
|
| 75 |
-
return $form->metaform( $config, $config['name'], $value );
|
| 76 |
}
|
| 77 |
|
| 78 |
// returns HTML
|
|
@@ -81,129 +78,172 @@ class WPToolset_Forms_Bootstrap
|
|
| 81 |
// return $form->editform( $config );
|
| 82 |
// }
|
| 83 |
|
| 84 |
-
public function form(
|
| 85 |
-
|
| 86 |
-
if ( isset( $this->__forms[$form_id] ) ) {
|
| 87 |
return $this->__forms[$form_id];
|
| 88 |
}
|
| 89 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.form_factory.php';
|
| 90 |
-
return $this->__forms[$form_id] = new FormFactory(
|
| 91 |
}
|
| 92 |
|
| 93 |
-
public function validate_field($form_id, $config, $value)
|
| 94 |
-
|
| 95 |
-
if ( empty( $config['validation'] ) ) {
|
| 96 |
return true;
|
| 97 |
}
|
| 98 |
-
$form = $this->form(
|
| 99 |
-
return $form->validateField(
|
| 100 |
}
|
| 101 |
|
| 102 |
-
public function ajaxCustomConditional()
|
| 103 |
-
{
|
| 104 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.conditional.php';
|
| 105 |
WPToolset_Forms_Conditional::ajaxCustomConditional();
|
| 106 |
}
|
| 107 |
|
| 108 |
-
public function checkConditional($config)
|
| 109 |
-
|
| 110 |
-
if ( empty( $config['conditional'] ) ) {
|
| 111 |
return true;
|
| 112 |
}
|
| 113 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.conditional.php';
|
| 114 |
-
return WPToolset_Forms_Conditional::evaluate(
|
| 115 |
}
|
| 116 |
|
| 117 |
-
public function addConditional($form_id, $config)
|
| 118 |
-
|
| 119 |
-
$this->form( $form_id )->addConditional( $config );
|
| 120 |
}
|
| 121 |
|
| 122 |
-
public function ajaxConditional()
|
| 123 |
-
{
|
| 124 |
$data = $_POST['conditions'];
|
| 125 |
$data['values'] = $_POST['values'];
|
| 126 |
-
echo $this->checkConditional(
|
| 127 |
die();
|
| 128 |
}
|
| 129 |
|
| 130 |
-
public function wpt_localize_extended_date()
|
| 131 |
-
|
| 132 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 133 |
if ($date_format == '') {
|
| 134 |
$date_format = get_option('date_format');
|
| 135 |
}
|
| 136 |
-
$date = $_POST['date'];
|
| 137 |
$date = adodb_mktime(0, 0, 0, substr($date, 2, 2), substr($date, 0, 2), substr($date, 4, 4));
|
| 138 |
$date_format = str_replace('\\\\', '\\', $date_format);
|
| 139 |
-
echo json_encode(array('display' => adodb_date($date_format, $date),'timestamp' => $date));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 140 |
die();
|
| 141 |
}
|
| 142 |
|
| 143 |
-
public function filterTypesField($field, $post_id = null, $_post_wpcf = array())
|
| 144 |
-
{
|
| 145 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.types.php';
|
| 146 |
-
return WPToolset_Types::filterField(
|
| 147 |
}
|
| 148 |
|
| 149 |
-
public function addFieldFilters($type)
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
call_user_func(
|
| 153 |
-
call_user_func( array($class, 'addActions') );
|
| 154 |
}
|
| 155 |
}
|
| 156 |
|
| 157 |
-
public function getConditionalData($form_id)
|
| 158 |
-
|
| 159 |
-
return $this->form( $form_id )->getConditionalClass()->getData();
|
| 160 |
}
|
| 161 |
|
| 162 |
-
public function strtotime($date, $format = null)
|
| 163 |
-
{
|
| 164 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.php';
|
| 165 |
-
return WPToolset_Field_Date::strtotime(
|
| 166 |
}
|
| 167 |
|
| 168 |
-
public function timetodate($timestamp, $format = null)
|
| 169 |
-
{
|
| 170 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.php';
|
| 171 |
-
return WPToolset_Field_Date::timetodate(
|
| 172 |
}
|
| 173 |
|
| 174 |
-
public function sanitize_file_name($filename)
|
| 175 |
-
{
|
| 176 |
/**
|
| 177 |
* replace german special characters
|
| 178 |
*/
|
| 179 |
-
$de_from
|
| 180 |
-
$de_to
|
| 181 |
$filename = str_replace($de_from, $de_to, $filename);
|
| 182 |
/**
|
| 183 |
* replace polish special characters
|
| 184 |
*/
|
| 185 |
-
$pl_from
|
| 186 |
-
$pl_to
|
| 187 |
$filename = str_replace($pl_from, $pl_to, $filename);
|
| 188 |
/**
|
| 189 |
* remove special characters
|
| 190 |
*/
|
| 191 |
-
$filename = preg_replace(
|
| 192 |
-
$filename = preg_replace(
|
| 193 |
return $filename;
|
| 194 |
}
|
| 195 |
|
| 196 |
-
public function set_default_repdrag_image($image)
|
| 197 |
-
{
|
| 198 |
return WPTOOLSET_FORMS_RELPATH . '/images/move.png';
|
| 199 |
}
|
| 200 |
|
| 201 |
/**
|
| 202 |
* add custom post type to query when they use category or tags taxonomy.
|
| 203 |
*/
|
| 204 |
-
public function pre_get_posts($query)
|
| 205 |
-
|
| 206 |
-
if ( is_admin() ) {
|
| 207 |
return;
|
| 208 |
}
|
| 209 |
/**
|
|
@@ -212,58 +252,57 @@ class WPToolset_Forms_Bootstrap
|
|
| 212 |
if (!$query->is_main_query()) {
|
| 213 |
return;
|
| 214 |
}
|
| 215 |
-
|
| 216 |
-
/**
|
| 217 |
-
* check terms
|
| 218 |
-
*/
|
| 219 |
-
if( $query->is_tax() )
|
| 220 |
-
$term = get_queried_object();
|
| 221 |
-
|
| 222 |
-
if ( empty($term) ) {
|
| 223 |
-
return;
|
| 224 |
-
}
|
| 225 |
-
/**
|
| 226 |
-
* check Types CPT
|
| 227 |
-
*/
|
| 228 |
-
$types_cpt = get_option( 'wpcf-custom-types');
|
| 229 |
if (!is_array($types_cpt) || empty($types_cpt)) {
|
| 230 |
return;
|
| 231 |
}
|
|
|
|
| 232 |
/**
|
| 233 |
-
*
|
| 234 |
*/
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
) {
|
| 243 |
-
$cpt_to_add[] = $cpt_slug;
|
| 244 |
}
|
| 245 |
}
|
| 246 |
}
|
| 247 |
}
|
| 248 |
/**
|
| 249 |
-
*
|
| 250 |
*/
|
| 251 |
-
if (
|
| 252 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 253 |
}
|
| 254 |
/**
|
| 255 |
-
*
|
| 256 |
*/
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
|
| 261 |
-
$
|
| 262 |
-
|
| 263 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 264 |
}
|
| 265 |
-
|
| 266 |
}
|
|
|
|
| 267 |
}
|
| 268 |
|
| 269 |
$GLOBALS['wptoolset_forms'] = new WPToolset_Forms_Bootstrap();
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/bootstrap.php $
|
| 6 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 7 |
+
* $LastChangedRevision: 1125405 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
|
|
| 11 |
require_once 'api.php';
|
| 12 |
|
| 13 |
+
define('WPTOOLSET_FORMS_VERSION', '0.1.1');
|
| 14 |
+
define('WPTOOLSET_FORMS_ABSPATH', dirname(__FILE__));
|
| 15 |
|
| 16 |
/**
|
| 17 |
* check we are as a embedded?
|
| 18 |
*/
|
| 19 |
+
if (defined('WPCF_RUNNING_EMBEDDED') && WPCF_RUNNING_EMBEDDED) {
|
| 20 |
+
define('WPTOOLSET_FORMS_RELPATH', wpcf_get_file_url(__FILE__, false));
|
| 21 |
}
|
| 22 |
/**
|
| 23 |
* setup WPTOOLSET_FORMS_RELPATH for plugin
|
| 24 |
*/
|
| 25 |
+
if (!defined('WPTOOLSET_FORMS_RELPATH')) {
|
| 26 |
+
define('WPTOOLSET_FORMS_RELPATH', plugins_url('', __FILE__));
|
| 27 |
}
|
| 28 |
+
if (!defined('WPTOOLSET_COMMON_PATH')) {
|
| 29 |
+
define('WPTOOLSET_COMMON_PATH', plugin_dir_path(__FILE__));
|
| 30 |
}
|
| 31 |
|
| 32 |
+
class WPToolset_Forms_Bootstrap {
|
|
|
|
| 33 |
|
| 34 |
private $__forms;
|
| 35 |
|
| 36 |
+
public final function __construct() {
|
|
|
|
| 37 |
// Custom conditinal AJAX check
|
| 38 |
+
add_action('wp_ajax_wptoolset_custom_conditional', array($this, 'ajaxCustomConditional'));
|
|
|
|
| 39 |
|
| 40 |
// Date conditinal AJAX check
|
| 41 |
+
add_action('wp_ajax_wptoolset_conditional', array($this, 'ajaxConditional'));
|
|
|
|
| 42 |
|
| 43 |
// Date extended localization AJAX callback
|
| 44 |
+
add_action('wp_ajax_wpt_localize_extended_date', array($this, 'wpt_localize_extended_date'));
|
| 45 |
+
add_action('wp_ajax_nopriv_wpt_localize_extended_date', array($this, 'wpt_localize_extended_date'));
|
| 46 |
+
|
| 47 |
+
// Taxonomy term suggest AJAX callback
|
| 48 |
+
add_action('wp_ajax_wpt_suggest_taxonomy_term', array($this, 'wpt_suggest_taxonomy_term'));
|
| 49 |
+
add_action('wp_ajax_nopriv_wpt_suggest_taxonomy_term', array($this, 'wpt_suggest_taxonomy_term'));
|
| 50 |
|
| 51 |
// File media popup
|
| 52 |
+
if ((isset($_GET['context']) && $_GET['context'] == 'wpt-fields-media-insert') || (isset($_SERVER['HTTP_REFERER']) && strpos($_SERVER['HTTP_REFERER'], 'context=wpt-fields-media-insert') !== false)
|
|
|
|
| 53 |
) {
|
| 54 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.file.php';
|
| 55 |
+
add_action('init', array('WPToolset_Field_File', 'mediaPopup'));
|
| 56 |
}
|
| 57 |
+
add_filter('sanitize_file_name', array($this, 'sanitize_file_name'));
|
| 58 |
|
| 59 |
+
add_filter('wptoolset_filter_wptoolset_repdrag_image', array($this, 'set_default_repdrag_image'), 10, 1);
|
| 60 |
/**
|
| 61 |
* common class for calendar
|
| 62 |
*/
|
| 63 |
+
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.scripts.php';
|
| 64 |
new WPToolset_Field_Date_Scripts();
|
| 65 |
|
| 66 |
+
add_action('pre_get_posts', array($this, 'pre_get_posts'));
|
| 67 |
}
|
| 68 |
|
| 69 |
// returns HTML
|
| 70 |
+
public function field($form_id, $config, $value) {
|
| 71 |
+
$form = $this->form($form_id, array());
|
| 72 |
+
return $form->metaform($config, $config['name'], $value);
|
|
|
|
| 73 |
}
|
| 74 |
|
| 75 |
// returns HTML
|
| 78 |
// return $form->editform( $config );
|
| 79 |
// }
|
| 80 |
|
| 81 |
+
public function form($form_id, $config = array()) {
|
| 82 |
+
if (isset($this->__forms[$form_id])) {
|
|
|
|
| 83 |
return $this->__forms[$form_id];
|
| 84 |
}
|
| 85 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.form_factory.php';
|
| 86 |
+
return $this->__forms[$form_id] = new FormFactory($form_id, $config);
|
| 87 |
}
|
| 88 |
|
| 89 |
+
public function validate_field($form_id, $config, $value) {
|
| 90 |
+
if (empty($config['validation'])) {
|
|
|
|
| 91 |
return true;
|
| 92 |
}
|
| 93 |
+
$form = $this->form($form_id, array());
|
| 94 |
+
return $form->validateField($config, $value);
|
| 95 |
}
|
| 96 |
|
| 97 |
+
public function ajaxCustomConditional() {
|
|
|
|
| 98 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.conditional.php';
|
| 99 |
WPToolset_Forms_Conditional::ajaxCustomConditional();
|
| 100 |
}
|
| 101 |
|
| 102 |
+
public function checkConditional($config) {
|
| 103 |
+
if (empty($config['conditional'])) {
|
|
|
|
| 104 |
return true;
|
| 105 |
}
|
| 106 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.conditional.php';
|
| 107 |
+
return WPToolset_Forms_Conditional::evaluate($config['conditional']);
|
| 108 |
}
|
| 109 |
|
| 110 |
+
public function addConditional($form_id, $config) {
|
| 111 |
+
$this->form($form_id)->addConditional($config);
|
|
|
|
| 112 |
}
|
| 113 |
|
| 114 |
+
public function ajaxConditional() {
|
|
|
|
| 115 |
$data = $_POST['conditions'];
|
| 116 |
$data['values'] = $_POST['values'];
|
| 117 |
+
echo $this->checkConditional(array('conditional' => $data));
|
| 118 |
die();
|
| 119 |
}
|
| 120 |
|
| 121 |
+
public function wpt_localize_extended_date() {
|
| 122 |
+
if (!isset($_POST['date'])) {
|
| 123 |
+
die();
|
| 124 |
+
}
|
| 125 |
+
$date = $_POST['date'];
|
| 126 |
+
$date_format = '';
|
| 127 |
+
if (isset($_POST['date-format'])) {
|
| 128 |
+
$date_format = $_POST['date-format'];
|
| 129 |
+
}
|
| 130 |
if ($date_format == '') {
|
| 131 |
$date_format = get_option('date_format');
|
| 132 |
}
|
|
|
|
| 133 |
$date = adodb_mktime(0, 0, 0, substr($date, 2, 2), substr($date, 0, 2), substr($date, 4, 4));
|
| 134 |
$date_format = str_replace('\\\\', '\\', $date_format);
|
| 135 |
+
echo json_encode(array('display' => adodb_date($date_format, $date), 'timestamp' => $date));
|
| 136 |
+
die();
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
/**
|
| 140 |
+
* wpt_suggest_taxonomy_term
|
| 141 |
+
*
|
| 142 |
+
* Renders the suggestions when adding new flat taxonomy terms on a CRED form
|
| 143 |
+
*
|
| 144 |
+
* Needs a non-empty q attribute and can take an optional non-empty taxonomy attribute on the $_REQUEST
|
| 145 |
+
*
|
| 146 |
+
* @since 1.5.0
|
| 147 |
+
*/
|
| 148 |
+
public function wpt_suggest_taxonomy_term() {
|
| 149 |
+
if (
|
| 150 |
+
!isset($_REQUEST['q']) || $_REQUEST['q'] == ''
|
| 151 |
+
) {
|
| 152 |
+
die();
|
| 153 |
+
}
|
| 154 |
+
global $wpdb;
|
| 155 |
+
$values_to_prepare = array();
|
| 156 |
+
if (function_exists("wpv_esc_like")) {
|
| 157 |
+
$term_name = '%' . wpv_esc_like($_REQUEST['q']) . '%';
|
| 158 |
+
} else {
|
| 159 |
+
if (function_exists("cred_wrap_esc_like")) {
|
| 160 |
+
$term_name = '%' . cred_wrap_esc_like($_REQUEST['q']) . '%';
|
| 161 |
+
}
|
| 162 |
+
}
|
| 163 |
+
$values_to_prepare[] = $term_name;
|
| 164 |
+
|
| 165 |
+
$tax_join = "";
|
| 166 |
+
$tax_where = "";
|
| 167 |
+
if (
|
| 168 |
+
isset($_REQUEST['taxonomy']) && $_REQUEST['taxonomy'] != ''
|
| 169 |
+
) {
|
| 170 |
+
$tax_join = " JOIN {$wpdb->term_taxonomy} tt ON t.term_id = tt.term_id ";
|
| 171 |
+
$tax_where = " AND tt.taxonomy = %s ";
|
| 172 |
+
$values_to_prepare[] = $_REQUEST['taxonomy'];
|
| 173 |
+
}
|
| 174 |
+
//
|
| 175 |
+
$results = $wpdb->get_results(
|
| 176 |
+
$wpdb->prepare(
|
| 177 |
+
"SELECT name FROM {$wpdb->terms} t {$tax_join}
|
| 178 |
+
WHERE t.name LIKE %s
|
| 179 |
+
{$tax_where}
|
| 180 |
+
ORDER BY name DESC
|
| 181 |
+
LIMIT 5", $values_to_prepare
|
| 182 |
+
)
|
| 183 |
+
);
|
| 184 |
+
foreach ($results as $row) {
|
| 185 |
+
echo $row->name . "\n";
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
die();
|
| 189 |
}
|
| 190 |
|
| 191 |
+
public function filterTypesField($field, $post_id = null, $_post_wpcf = array()) {
|
|
|
|
| 192 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.types.php';
|
| 193 |
+
return WPToolset_Types::filterField($field, $post_id, $_post_wpcf);
|
| 194 |
}
|
| 195 |
|
| 196 |
+
public function addFieldFilters($type) {
|
| 197 |
+
if ($class = $this->form('generic')->loadFieldClass($type)) {
|
| 198 |
+
call_user_func(array($class, 'addFilters'));
|
| 199 |
+
call_user_func(array($class, 'addActions'));
|
|
|
|
| 200 |
}
|
| 201 |
}
|
| 202 |
|
| 203 |
+
public function getConditionalData($form_id) {
|
| 204 |
+
return $this->form($form_id)->getConditionalClass()->getData();
|
|
|
|
| 205 |
}
|
| 206 |
|
| 207 |
+
public function strtotime($date, $format = null) {
|
|
|
|
| 208 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.php';
|
| 209 |
+
return WPToolset_Field_Date::strtotime($date, $format);
|
| 210 |
}
|
| 211 |
|
| 212 |
+
public function timetodate($timestamp, $format = null) {
|
|
|
|
| 213 |
require_once WPTOOLSET_FORMS_ABSPATH . '/classes/class.date.php';
|
| 214 |
+
return WPToolset_Field_Date::timetodate($timestamp, $format);
|
| 215 |
}
|
| 216 |
|
| 217 |
+
public function sanitize_file_name($filename) {
|
|
|
|
| 218 |
/**
|
| 219 |
* replace german special characters
|
| 220 |
*/
|
| 221 |
+
$de_from = array('ä', 'ö', 'ü', 'ß', 'Ä', 'Ö', 'Ü');
|
| 222 |
+
$de_to = array('ae', 'oe', 'ue', 'ss', 'Ae', 'Oe', 'Ue');
|
| 223 |
$filename = str_replace($de_from, $de_to, $filename);
|
| 224 |
/**
|
| 225 |
* replace polish special characters
|
| 226 |
*/
|
| 227 |
+
$pl_from = array('ą', 'ć', 'ę', 'ł', 'ń', 'ó', 'ś', 'ź', 'ż', 'Ą', 'Ć', 'Ę', 'Ł', 'Ń', 'Ó', 'Ś', 'Ź', 'Ż');
|
| 228 |
+
$pl_to = array('a', 'c', 'e', 'l', 'n', 'o', 's', 'z', 'z', 'A', 'C', 'E', 'L', 'N', 'O', 'S', 'Z', 'Z');
|
| 229 |
$filename = str_replace($pl_from, $pl_to, $filename);
|
| 230 |
/**
|
| 231 |
* remove special characters
|
| 232 |
*/
|
| 233 |
+
$filename = preg_replace('/[^A-Za-z0-9\._@]/', '-', $filename);
|
| 234 |
+
$filename = preg_replace('/%20/', '-', $filename);
|
| 235 |
return $filename;
|
| 236 |
}
|
| 237 |
|
| 238 |
+
public function set_default_repdrag_image($image) {
|
|
|
|
| 239 |
return WPTOOLSET_FORMS_RELPATH . '/images/move.png';
|
| 240 |
}
|
| 241 |
|
| 242 |
/**
|
| 243 |
* add custom post type to query when they use category or tags taxonomy.
|
| 244 |
*/
|
| 245 |
+
public function pre_get_posts($query) {
|
| 246 |
+
if (is_admin()) {
|
|
|
|
| 247 |
return;
|
| 248 |
}
|
| 249 |
/**
|
| 252 |
if (!$query->is_main_query()) {
|
| 253 |
return;
|
| 254 |
}
|
| 255 |
+
$types_cpt = get_option('wpcf-custom-types');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 256 |
if (!is_array($types_cpt) || empty($types_cpt)) {
|
| 257 |
return;
|
| 258 |
}
|
| 259 |
+
$cpt_to_add = array();
|
| 260 |
/**
|
| 261 |
+
* check category
|
| 262 |
*/
|
| 263 |
+
if (is_category()) {
|
| 264 |
+
foreach ($types_cpt as $cpt_slug => $cpt) {
|
| 265 |
+
if (array_key_exists('taxonomies', $cpt) && is_array($cpt['taxonomies'])) {
|
| 266 |
+
foreach ($cpt['taxonomies'] as $tax_slug => $value) {
|
| 267 |
+
if ('category' == $tax_slug && $value) {
|
| 268 |
+
$cpt_to_add[] = $cpt_slug;
|
| 269 |
+
}
|
|
|
|
|
|
|
| 270 |
}
|
| 271 |
}
|
| 272 |
}
|
| 273 |
}
|
| 274 |
/**
|
| 275 |
+
* check tags
|
| 276 |
*/
|
| 277 |
+
if (is_tag()) {
|
| 278 |
+
foreach ($types_cpt as $cpt_slug => $cpt) {
|
| 279 |
+
if (array_key_exists('taxonomies', $cpt) && is_array($cpt['taxonomies'])) {
|
| 280 |
+
foreach ($cpt['taxonomies'] as $tax_slug => $value) {
|
| 281 |
+
if ('post_tag' == $tax_slug && $value) {
|
| 282 |
+
$cpt_to_add[] = $cpt_slug;
|
| 283 |
+
}
|
| 284 |
+
}
|
| 285 |
+
}
|
| 286 |
+
}
|
| 287 |
}
|
| 288 |
/**
|
| 289 |
+
* change query if some CPT use this
|
| 290 |
*/
|
| 291 |
+
if (!empty($cpt_to_add)) {
|
| 292 |
+
/**
|
| 293 |
+
* remeber if is empty, then is post
|
| 294 |
+
*/
|
| 295 |
+
$current_types = $query->get('post_type');
|
| 296 |
+
if (empty($current_types)) {
|
| 297 |
+
$cpt_to_add[] = 'post';
|
| 298 |
+
} else {
|
| 299 |
+
$cpt_to_add = array_merge($current_types, $cpt_to_add);
|
| 300 |
+
}
|
| 301 |
+
$query->set('post_type', $cpt_to_add);
|
| 302 |
}
|
| 303 |
+
return;
|
| 304 |
}
|
| 305 |
+
|
| 306 |
}
|
| 307 |
|
| 308 |
$GLOBALS['wptoolset_forms'] = new WPToolset_Forms_Bootstrap();
|
embedded/common/toolset-forms/classes/class.audio.php
CHANGED
|
@@ -6,7 +6,7 @@ require_once 'class.file.php';
|
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.audio.php $
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.checkbox.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 6 |
* $LastChangedRevision: 1069430 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.checkbox.php $
|
| 5 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 6 |
* $LastChangedRevision: 1069430 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.checkboxes.php
CHANGED
|
@@ -4,7 +4,7 @@
|
|
| 4 |
*
|
| 5 |
* @author Srdjan
|
| 6 |
*
|
| 7 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 8 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 9 |
* $LastChangedRevision: 1069430 $
|
| 10 |
* $LastChangedBy: iworks $
|
| 4 |
*
|
| 5 |
* @author Srdjan
|
| 6 |
*
|
| 7 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.checkboxes.php $
|
| 8 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 9 |
* $LastChangedRevision: 1069430 $
|
| 10 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.colorpicker.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate: 2015-
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -18,8 +18,7 @@ class WPToolset_Field_Colorpicker extends FieldFactory
|
|
| 18 |
{
|
| 19 |
public function init()
|
| 20 |
{
|
| 21 |
-
|
| 22 |
-
if ( !is_admin() ) {
|
| 23 |
wp_enqueue_style( 'wp-color-picker' );
|
| 24 |
wp_enqueue_script(
|
| 25 |
'iris',
|
|
@@ -38,31 +37,30 @@ class WPToolset_Field_Colorpicker extends FieldFactory
|
|
| 38 |
$colorpicker_l10n = array(
|
| 39 |
'clear' => __( 'Clear' ),
|
| 40 |
'defaultString' => __( 'Default', 'wpv-views' ),
|
| 41 |
-
'pick' => __( 'Select
|
| 42 |
);
|
| 43 |
wp_localize_script( 'wp-color-picker', 'wpColorPickerL10n', $colorpicker_l10n );
|
| 44 |
}
|
| 45 |
-
|
| 46 |
'wptoolset-field-colorpicker',
|
| 47 |
WPTOOLSET_FORMS_RELPATH . '/js/colorpicker.js',
|
| 48 |
array('iris'),
|
| 49 |
WPTOOLSET_FORMS_VERSION,
|
| 50 |
true
|
| 51 |
);
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
|
| 56 |
static public function registerScripts()
|
| 57 |
{
|
| 58 |
-
|
| 59 |
}
|
| 60 |
|
| 61 |
public function enqueueScripts()
|
| 62 |
{
|
| 63 |
-
|
| 64 |
}
|
| 65 |
-
|
| 66 |
public function addTypeValidation($validation) {
|
| 67 |
$validation['hexadecimal'] = array(
|
| 68 |
'args' => array(
|
|
@@ -78,17 +76,23 @@ class WPToolset_Field_Colorpicker extends FieldFactory
|
|
| 78 |
$validation = $this->getValidationData();
|
| 79 |
$validation = $this->addTypeValidation($validation);
|
| 80 |
$this->setValidationData($validation);
|
| 81 |
-
|
| 82 |
-
$
|
| 83 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 84 |
$form = array();
|
| 85 |
$form['name'] = array(
|
| 86 |
'#type' => 'textfield',
|
| 87 |
'#title' => $this->getTitle(),
|
| 88 |
-
|
| 89 |
'#value' => $this->getValue(),
|
| 90 |
'#name' => $this->getName(),
|
| 91 |
-
'#attributes' =>
|
| 92 |
'#validate' => $validation,
|
| 93 |
'#after' => '',
|
| 94 |
'#repetitive' => $this->isRepetitive(),
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.colorpicker.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1120400 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 18 |
{
|
| 19 |
public function init()
|
| 20 |
{
|
| 21 |
+
if ( !is_admin() ) {
|
|
|
|
| 22 |
wp_enqueue_style( 'wp-color-picker' );
|
| 23 |
wp_enqueue_script(
|
| 24 |
'iris',
|
| 37 |
$colorpicker_l10n = array(
|
| 38 |
'clear' => __( 'Clear' ),
|
| 39 |
'defaultString' => __( 'Default', 'wpv-views' ),
|
| 40 |
+
'pick' => __( 'Select', 'wpv-views' )." Color"
|
| 41 |
);
|
| 42 |
wp_localize_script( 'wp-color-picker', 'wpColorPickerL10n', $colorpicker_l10n );
|
| 43 |
}
|
| 44 |
+
wp_register_script(
|
| 45 |
'wptoolset-field-colorpicker',
|
| 46 |
WPTOOLSET_FORMS_RELPATH . '/js/colorpicker.js',
|
| 47 |
array('iris'),
|
| 48 |
WPTOOLSET_FORMS_VERSION,
|
| 49 |
true
|
| 50 |
);
|
| 51 |
+
wp_enqueue_script( 'wptoolset-field-colorpicker' );
|
| 52 |
+
$this->set_placeholder_as_attribute();
|
| 53 |
+
}
|
| 54 |
|
| 55 |
static public function registerScripts()
|
| 56 |
{
|
|
|
|
| 57 |
}
|
| 58 |
|
| 59 |
public function enqueueScripts()
|
| 60 |
{
|
| 61 |
+
|
| 62 |
}
|
| 63 |
+
|
| 64 |
public function addTypeValidation($validation) {
|
| 65 |
$validation['hexadecimal'] = array(
|
| 66 |
'args' => array(
|
| 76 |
$validation = $this->getValidationData();
|
| 77 |
$validation = $this->addTypeValidation($validation);
|
| 78 |
$this->setValidationData($validation);
|
| 79 |
+
|
| 80 |
+
$attributes = $this->getAttr();
|
| 81 |
+
if ( isset($attributes['class'] ) ) {
|
| 82 |
+
$attributes['class'] .= ' ';
|
| 83 |
+
} else {
|
| 84 |
+
$attributes['class'] = '';
|
| 85 |
+
}
|
| 86 |
+
$attributes['class'] = 'js-wpt-colorpicker';
|
| 87 |
+
|
| 88 |
$form = array();
|
| 89 |
$form['name'] = array(
|
| 90 |
'#type' => 'textfield',
|
| 91 |
'#title' => $this->getTitle(),
|
| 92 |
+
'#description' => $this->getDescription(),
|
| 93 |
'#value' => $this->getValue(),
|
| 94 |
'#name' => $this->getName(),
|
| 95 |
+
'#attributes' => $attributes,
|
| 96 |
'#validate' => $validation,
|
| 97 |
'#after' => '',
|
| 98 |
'#repetitive' => $this->isRepetitive(),
|
embedded/common/toolset-forms/classes/class.conditional.php
CHANGED
|
@@ -493,7 +493,11 @@ if (!class_exists('WPV_Handle_Users_Functions')) {
|
|
| 493 |
return false;
|
| 494 |
}
|
| 495 |
|
| 496 |
-
private static function get_info()
|
|
|
|
|
|
|
|
|
|
|
|
|
| 497 |
global $current_user;
|
| 498 |
|
| 499 |
get_currentuserinfo();
|
| 493 |
return false;
|
| 494 |
}
|
| 495 |
|
| 496 |
+
private static function get_info()
|
| 497 |
+
{
|
| 498 |
+
if (!is_user_logged_in()) {
|
| 499 |
+
return false;
|
| 500 |
+
}
|
| 501 |
global $current_user;
|
| 502 |
|
| 503 |
get_currentuserinfo();
|
embedded/common/toolset-forms/classes/class.credaudio.php
CHANGED
|
@@ -7,7 +7,7 @@ require_once 'class.audio.php';
|
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.credaudio.php $
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.credfile.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.credfile.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.credimage.php
CHANGED
|
@@ -7,7 +7,7 @@ require_once 'class.image.php';
|
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.credimage.php $
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.credvideo.php
CHANGED
|
@@ -7,7 +7,7 @@ require_once 'class.video.php';
|
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
| 7 |
*
|
| 8 |
* @author Srdjan
|
| 9 |
*
|
| 10 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.credvideo.php $
|
| 11 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 12 |
* $LastChangedRevision: 1027712 $
|
| 13 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.date.php
CHANGED
|
@@ -17,6 +17,7 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 17 |
|
| 18 |
public function init()
|
| 19 |
{
|
|
|
|
| 20 |
}
|
| 21 |
|
| 22 |
public static function registerScripts()
|
|
@@ -29,8 +30,9 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 29 |
|
| 30 |
public static function addFilters()
|
| 31 |
{
|
| 32 |
-
if (has_filter('wptoolset_validation_value_date', array('WPToolset_Field_Date', 'filterValidationValue')))
|
| 33 |
return;
|
|
|
|
| 34 |
// Filter validation
|
| 35 |
add_filter('wptoolset_validation_value_date', array('WPToolset_Field_Date', 'filterValidationValue'));
|
| 36 |
add_filter('wptoolset_validation_rule_js', array('WPToolset_Field_Date', 'filterValidationRuleJs'));
|
|
@@ -122,9 +124,9 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 122 |
|
| 123 |
$attr_visible = array(
|
| 124 |
'class' => $def_class,
|
| 125 |
-
'style' => 'display:inline;width:150px;position:relative;
|
| 126 |
'readonly' => 'readonly',
|
| 127 |
-
'title' => esc_attr(__('Select
|
| 128 |
);
|
| 129 |
$attr_hidden = array('class' => $def_class_aux, 'data-ts' => $timestamp, 'data-wpt-type' => 'date');
|
| 130 |
|
|
@@ -137,7 +139,7 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 137 |
'#title' => $title,
|
| 138 |
'#description' => $this->getDescription(),
|
| 139 |
'#attributes' => $attr_visible,
|
| 140 |
-
'#name' => '',
|
| 141 |
'#value' => $datepicker,
|
| 142 |
'#inline' => true,
|
| 143 |
);
|
|
@@ -192,7 +194,7 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 192 |
'#default_value' => $hour,
|
| 193 |
'#name' => $this->getName() . '[hour]',
|
| 194 |
'#inline' => true,
|
| 195 |
-
'#attributes' => array('title' => esc_attr(__('Select
|
| 196 |
);
|
| 197 |
if (!empty($attributes_hour_minute)) {
|
| 198 |
$hour_element['#attributes'] = $attributes_hour_minute;
|
|
@@ -228,12 +230,14 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 228 |
'#inline' => true,
|
| 229 |
'#markup' => sprintf(
|
| 230 |
'<input type="button" class="button button-secondary js-wpt-date-clear wpt-date-clear" value="%s" %s/>',
|
| 231 |
-
esc_attr(__('Clear
|
| 232 |
/**
|
| 233 |
* show button if array is empty or timestamp in array is
|
| 234 |
* empty
|
| 235 |
*/
|
| 236 |
-
empty($time_value) ||
|
|
|
|
|
|
|
| 237 |
),
|
| 238 |
);
|
| 239 |
return $form;
|
|
@@ -269,6 +273,12 @@ class WPToolset_Field_Date extends FieldFactory
|
|
| 269 |
|
| 270 |
public static function filterValidationValue($value)
|
| 271 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 272 |
if (isset($value['datepicker'])) {
|
| 273 |
return $value['datepicker'];
|
| 274 |
}
|
| 17 |
|
| 18 |
public function init()
|
| 19 |
{
|
| 20 |
+
$this->set_placeholder_as_attribute();
|
| 21 |
}
|
| 22 |
|
| 23 |
public static function registerScripts()
|
| 30 |
|
| 31 |
public static function addFilters()
|
| 32 |
{
|
| 33 |
+
if (has_filter('wptoolset_validation_value_date', array('WPToolset_Field_Date', 'filterValidationValue'))) {
|
| 34 |
return;
|
| 35 |
+
}
|
| 36 |
// Filter validation
|
| 37 |
add_filter('wptoolset_validation_value_date', array('WPToolset_Field_Date', 'filterValidationValue'));
|
| 38 |
add_filter('wptoolset_validation_rule_js', array('WPToolset_Field_Date', 'filterValidationRuleJs'));
|
| 124 |
|
| 125 |
$attr_visible = array(
|
| 126 |
'class' => $def_class,
|
| 127 |
+
'style' => 'display:inline;width:150px;position:relative;',
|
| 128 |
'readonly' => 'readonly',
|
| 129 |
+
'title' => esc_attr(__('Select', 'wpv-views'))." Date"
|
| 130 |
);
|
| 131 |
$attr_hidden = array('class' => $def_class_aux, 'data-ts' => $timestamp, 'data-wpt-type' => 'date');
|
| 132 |
|
| 139 |
'#title' => $title,
|
| 140 |
'#description' => $this->getDescription(),
|
| 141 |
'#attributes' => $attr_visible,
|
| 142 |
+
'#name' => $this->getName() . '[display-only]',
|
| 143 |
'#value' => $datepicker,
|
| 144 |
'#inline' => true,
|
| 145 |
);
|
| 194 |
'#default_value' => $hour,
|
| 195 |
'#name' => $this->getName() . '[hour]',
|
| 196 |
'#inline' => true,
|
| 197 |
+
'#attributes' => array('title' => esc_attr(__('Select', 'wpv-views'))." Date"),
|
| 198 |
);
|
| 199 |
if (!empty($attributes_hour_minute)) {
|
| 200 |
$hour_element['#attributes'] = $attributes_hour_minute;
|
| 230 |
'#inline' => true,
|
| 231 |
'#markup' => sprintf(
|
| 232 |
'<input type="button" class="button button-secondary js-wpt-date-clear wpt-date-clear" value="%s" %s/>',
|
| 233 |
+
esc_attr(__('Clear', 'wpv-views'))." Date",
|
| 234 |
/**
|
| 235 |
* show button if array is empty or timestamp in array is
|
| 236 |
* empty
|
| 237 |
*/
|
| 238 |
+
empty($time_value) ||
|
| 239 |
+
(isset($time_value['timestamp']) &&
|
| 240 |
+
empty($time_value['timestamp']))? 'style="display:none" ':''
|
| 241 |
),
|
| 242 |
);
|
| 243 |
return $form;
|
| 273 |
|
| 274 |
public static function filterValidationValue($value)
|
| 275 |
{
|
| 276 |
+
/**
|
| 277 |
+
* validate fimestamp range is possible
|
| 278 |
+
*/
|
| 279 |
+
if (isset($value['timestamp'])) {
|
| 280 |
+
return $value['timestamp'];
|
| 281 |
+
}
|
| 282 |
if (isset($value['datepicker'])) {
|
| 283 |
return $value['datepicker'];
|
| 284 |
}
|
embedded/common/toolset-forms/classes/class.date.scripts.php
CHANGED
|
@@ -46,6 +46,15 @@ class WPToolset_Field_Date_Scripts
|
|
| 46 |
|
| 47 |
public function date_enqueue_scripts()
|
| 48 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 49 |
/**
|
| 50 |
* styles
|
| 51 |
*/
|
| 46 |
|
| 47 |
public function date_enqueue_scripts()
|
| 48 |
{
|
| 49 |
+
/**
|
| 50 |
+
* prevent load scripts on custom field group edit screen
|
| 51 |
+
*/
|
| 52 |
+
if ( is_admin() ) {
|
| 53 |
+
$screen = get_current_screen();
|
| 54 |
+
if ( 'types_page_wpcf-edit' == $screen->id ) {
|
| 55 |
+
return;
|
| 56 |
+
}
|
| 57 |
+
}
|
| 58 |
/**
|
| 59 |
* styles
|
| 60 |
*/
|
embedded/common/toolset-forms/classes/class.eforms.php
CHANGED
|
@@ -28,9 +28,9 @@
|
|
| 28 |
* @link http://enlimbo.net/forms
|
| 29 |
* @author srdjan <srdjan@enlimbo.net>
|
| 30 |
*
|
| 31 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 32 |
-
* $LastChangedDate: 2015-
|
| 33 |
-
* $LastChangedRevision:
|
| 34 |
* $LastChangedBy: iworks $
|
| 35 |
*
|
| 36 |
*/
|
|
@@ -101,7 +101,6 @@ class Enlimbo_Forms {
|
|
| 101 |
$cred_cred_settings = get_option('cred_cred_settings');
|
| 102 |
if (is_array($cred_cred_settings)) {
|
| 103 |
$this->form_settings['use_bootstrap'] = array_key_exists('use_bootstrap', $cred_cred_settings) && $cred_cred_settings['use_bootstrap'];
|
| 104 |
-
;
|
| 105 |
}
|
| 106 |
}
|
| 107 |
}
|
|
@@ -1117,7 +1116,10 @@ class Enlimbo_Forms {
|
|
| 1117 |
}
|
| 1118 |
|
| 1119 |
$parts = explode('[', $name);
|
| 1120 |
-
|
|
|
|
|
|
|
|
|
|
| 1121 |
if (!isset($_REQUEST[$parts[0]])) {
|
| 1122 |
return in_array($element['#type'], array('textfield', 'textarea')) ? '' : 0;
|
| 1123 |
}
|
| 28 |
* @link http://enlimbo.net/forms
|
| 29 |
* @author srdjan <srdjan@enlimbo.net>
|
| 30 |
*
|
| 31 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.eforms.php $
|
| 32 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 33 |
+
* $LastChangedRevision: 1120400 $
|
| 34 |
* $LastChangedBy: iworks $
|
| 35 |
*
|
| 36 |
*/
|
| 101 |
$cred_cred_settings = get_option('cred_cred_settings');
|
| 102 |
if (is_array($cred_cred_settings)) {
|
| 103 |
$this->form_settings['use_bootstrap'] = array_key_exists('use_bootstrap', $cred_cred_settings) && $cred_cred_settings['use_bootstrap'];
|
|
|
|
| 104 |
}
|
| 105 |
}
|
| 106 |
}
|
| 1116 |
}
|
| 1117 |
|
| 1118 |
$parts = explode('[', $name);
|
| 1119 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196173458/comments
|
| 1120 |
+
//Security Fixing
|
| 1121 |
+
//$parts = array_map(create function('&$a', 'return trim($a, \']\');'), $parts);
|
| 1122 |
+
$parts = array_map("cred_mytrimfunction", $parts);
|
| 1123 |
if (!isset($_REQUEST[$parts[0]])) {
|
| 1124 |
return in_array($element['#type'], array('textfield', 'textarea')) ? '' : 0;
|
| 1125 |
}
|
embedded/common/toolset-forms/classes/class.field_factory.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -28,6 +28,17 @@ abstract class FieldFactory extends FieldAbstract
|
|
| 28 |
{
|
| 29 |
$cred_cred_settings = get_option( 'cred_cred_settings' );
|
| 30 |
$this->_use_bootstrap = is_array($cred_cred_settings) && array_key_exists( 'use_bootstrap', $cred_cred_settings ) && $cred_cred_settings['use_bootstrap'];
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 31 |
}
|
| 32 |
|
| 33 |
public function set_metaform($metaform)
|
|
@@ -82,8 +93,11 @@ abstract class FieldFactory extends FieldAbstract
|
|
| 82 |
return $value;
|
| 83 |
}
|
| 84 |
|
| 85 |
-
public function getTitle()
|
| 86 |
{
|
|
|
|
|
|
|
|
|
|
| 87 |
return $this->_data['title'];
|
| 88 |
}
|
| 89 |
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.field_factory.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-02 10:49:00 +0000 (Mon, 02 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1103173 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 28 |
{
|
| 29 |
$cred_cred_settings = get_option( 'cred_cred_settings' );
|
| 30 |
$this->_use_bootstrap = is_array($cred_cred_settings) && array_key_exists( 'use_bootstrap', $cred_cred_settings ) && $cred_cred_settings['use_bootstrap'];
|
| 31 |
+
$this->set_placeholder_as_attribute();
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
public function set_placeholder_as_attribute()
|
| 35 |
+
{
|
| 36 |
+
if ( !isset($this->_data['attribute']) ) {
|
| 37 |
+
$this->_data['attribute'] = array();
|
| 38 |
+
}
|
| 39 |
+
if ( isset($this->_data['placeholder']) && !empty($this->_data['placeholder'])) {
|
| 40 |
+
$this->_data['attribute']['placeholder'] = htmlentities(stripcslashes($this->_data['placeholder']));
|
| 41 |
+
}
|
| 42 |
}
|
| 43 |
|
| 44 |
public function set_metaform($metaform)
|
| 93 |
return $value;
|
| 94 |
}
|
| 95 |
|
| 96 |
+
public function getTitle($_title = false)
|
| 97 |
{
|
| 98 |
+
if ( $_title && empty($this->_data['title']) && isset($this->_data['_title']) ) {
|
| 99 |
+
return $this->_data['_title'];
|
| 100 |
+
}
|
| 101 |
return $this->_data['title'];
|
| 102 |
}
|
| 103 |
|
embedded/common/toolset-forms/classes/class.fieldconfig.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 7 |
* $LastChangedRevision: 1069430 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.fieldconfig.php $
|
| 6 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 7 |
* $LastChangedRevision: 1069430 $
|
| 8 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.file.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -22,38 +22,55 @@ class WPToolset_Field_File extends WPToolset_Field_Textfield
|
|
| 22 |
|
| 23 |
public function init() {
|
| 24 |
WPToolset_Field_File::file_enqueue_scripts();
|
|
|
|
| 25 |
}
|
| 26 |
|
| 27 |
-
public static function file_enqueue_scripts()
|
| 28 |
-
wp_register_script(
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
if ( !wp_script_is( 'wptoolset-field-file', 'enqueued' ) ) {
|
| 33 |
-
|
| 34 |
-
|
|
|
|
|
|
|
| 35 |
global $post;
|
| 36 |
$for_post = (!empty( $post->ID ) ? 'post_id=' . $post->ID . '&' : '');
|
| 37 |
-
$js_data = array('title' => esc_js( __( 'Select
|
| 38 |
wp_localize_script( 'wptoolset-field-file', 'wptFileData', $js_data );
|
| 39 |
}
|
| 40 |
}
|
| 41 |
|
| 42 |
public function enqueueStyles() {
|
| 43 |
-
|
| 44 |
}
|
| 45 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 46 |
public function metaform() {
|
| 47 |
$value = $this->getValue();
|
| 48 |
$type = $this->getType();
|
| 49 |
$translated_type = '';
|
| 50 |
$form = array();
|
| 51 |
$preview = '';
|
| 52 |
-
|
| 53 |
// Get attachment by guid
|
| 54 |
if ( !empty( $value ) ) {
|
| 55 |
global $wpdb;
|
| 56 |
-
$attachment_id = $wpdb->get_var(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 57 |
}
|
| 58 |
|
| 59 |
// Set preview
|
|
@@ -102,6 +119,7 @@ class WPToolset_Field_File extends WPToolset_Field_Textfield
|
|
| 102 |
'#suffix' => ' ' . $button,
|
| 103 |
'#validate' => $this->getValidationData(),
|
| 104 |
'#repetitive' => $this->isRepetitive(),
|
|
|
|
| 105 |
);
|
| 106 |
|
| 107 |
$form[] = array(
|
|
@@ -128,10 +146,10 @@ class WPToolset_Field_File extends WPToolset_Field_Textfield
|
|
| 128 |
|
| 129 |
/**
|
| 130 |
* Adds column to media item table.
|
| 131 |
-
*
|
| 132 |
* @param type $form_fields
|
| 133 |
* @param type $post
|
| 134 |
-
* @return type
|
| 135 |
*/
|
| 136 |
public static function attachmentFieldsToEditFilter( $form_fields, $post ) {
|
| 137 |
// Reset form
|
|
@@ -152,9 +170,9 @@ class WPToolset_Field_File extends WPToolset_Field_Textfield
|
|
| 152 |
|
| 153 |
/**
|
| 154 |
* Filters media TABs.
|
| 155 |
-
*
|
| 156 |
* @param type $tabs
|
| 157 |
-
* @return type
|
| 158 |
*/
|
| 159 |
public static function mediaUploadTabsFilter( $tabs ) {
|
| 160 |
unset( $tabs['type_url'] );
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.file.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1120400 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 22 |
|
| 23 |
public function init() {
|
| 24 |
WPToolset_Field_File::file_enqueue_scripts();
|
| 25 |
+
$this->set_placeholder_as_attribute();
|
| 26 |
}
|
| 27 |
|
| 28 |
+
public static function file_enqueue_scripts(){
|
| 29 |
+
wp_register_script(
|
| 30 |
+
'wptoolset-field-file',
|
| 31 |
+
WPTOOLSET_FORMS_RELPATH . '/js/file-wp35.js',
|
| 32 |
+
array('jquery', 'jquery-masonry'),
|
| 33 |
+
WPTOOLSET_FORMS_VERSION,
|
| 34 |
+
true
|
| 35 |
+
);
|
| 36 |
+
|
| 37 |
if ( !wp_script_is( 'wptoolset-field-file', 'enqueued' ) ) {
|
| 38 |
+
wp_enqueue_script( 'wptoolset-field-file' );
|
| 39 |
+
wp_enqueue_media();
|
| 40 |
+
|
| 41 |
+
// add_thickbox();
|
| 42 |
global $post;
|
| 43 |
$for_post = (!empty( $post->ID ) ? 'post_id=' . $post->ID . '&' : '');
|
| 44 |
+
$js_data = array('title' => esc_js( __( 'Select', 'wpv-views' ) )." File", 'for_post' => $for_post, 'adminurl' => admin_url());
|
| 45 |
wp_localize_script( 'wptoolset-field-file', 'wptFileData', $js_data );
|
| 46 |
}
|
| 47 |
}
|
| 48 |
|
| 49 |
public function enqueueStyles() {
|
| 50 |
+
|
| 51 |
}
|
| 52 |
|
| 53 |
+
/**
|
| 54 |
+
*
|
| 55 |
+
* @global object $wpdb
|
| 56 |
+
*
|
| 57 |
+
*/
|
| 58 |
public function metaform() {
|
| 59 |
$value = $this->getValue();
|
| 60 |
$type = $this->getType();
|
| 61 |
$translated_type = '';
|
| 62 |
$form = array();
|
| 63 |
$preview = '';
|
| 64 |
+
|
| 65 |
// Get attachment by guid
|
| 66 |
if ( !empty( $value ) ) {
|
| 67 |
global $wpdb;
|
| 68 |
+
$attachment_id = $wpdb->get_var(
|
| 69 |
+
$wpdb->prepare(
|
| 70 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 71 |
+
$value
|
| 72 |
+
)
|
| 73 |
+
);
|
| 74 |
}
|
| 75 |
|
| 76 |
// Set preview
|
| 119 |
'#suffix' => ' ' . $button,
|
| 120 |
'#validate' => $this->getValidationData(),
|
| 121 |
'#repetitive' => $this->isRepetitive(),
|
| 122 |
+
'#attributes' => $this->getAttr(),
|
| 123 |
);
|
| 124 |
|
| 125 |
$form[] = array(
|
| 146 |
|
| 147 |
/**
|
| 148 |
* Adds column to media item table.
|
| 149 |
+
*
|
| 150 |
* @param type $form_fields
|
| 151 |
* @param type $post
|
| 152 |
+
* @return type
|
| 153 |
*/
|
| 154 |
public static function attachmentFieldsToEditFilter( $form_fields, $post ) {
|
| 155 |
// Reset form
|
| 170 |
|
| 171 |
/**
|
| 172 |
* Filters media TABs.
|
| 173 |
+
*
|
| 174 |
* @param type $tabs
|
| 175 |
+
* @return type
|
| 176 |
*/
|
| 177 |
public static function mediaUploadTabsFilter( $tabs ) {
|
| 178 |
unset( $tabs['type_url'] );
|
embedded/common/toolset-forms/classes/class.form_factory.php
CHANGED
|
@@ -10,9 +10,9 @@ define( "CLASS_NAME_PREFIX", "WPToolset_Field_" );
|
|
| 10 |
* Creation Form Class
|
| 11 |
* @author onTheGo System
|
| 12 |
*
|
| 13 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 14 |
-
* $LastChangedDate: 2015-01
|
| 15 |
-
* $LastChangedRevision:
|
| 16 |
* $LastChangedBy: iworks $
|
| 17 |
*
|
| 18 |
*
|
|
@@ -37,8 +37,12 @@ class FormFactory extends FormAbstract
|
|
| 37 |
|
| 38 |
wp_register_script( 'wptoolset-forms',
|
| 39 |
WPTOOLSET_FORMS_RELPATH . '/js/main.js',
|
| 40 |
-
array('jquery', 'underscore'), WPTOOLSET_FORMS_VERSION, false );
|
| 41 |
wp_enqueue_script( 'wptoolset-forms' );
|
|
|
|
|
|
|
|
|
|
|
|
|
| 42 |
|
| 43 |
if ( is_admin() ) {
|
| 44 |
wp_register_style( 'wptoolset-forms-admin',
|
|
@@ -238,8 +242,10 @@ class FormFactory extends FormAbstract
|
|
| 238 |
if ( current_user_can('manage_options') ) {
|
| 239 |
$htmlArray[] = sprintf(
|
| 240 |
'<div id="message" class="error"><p>%s</p><p>%s</p></div>',
|
|
|
|
|
|
|
| 241 |
sprintf(
|
| 242 |
-
__('There is a problem
|
| 243 |
$_cfg['title'],
|
| 244 |
$_cfg['type']
|
| 245 |
),
|
| 10 |
* Creation Form Class
|
| 11 |
* @author onTheGo System
|
| 12 |
*
|
| 13 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.form_factory.php $
|
| 14 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 15 |
+
* $LastChangedRevision: 1125405 $
|
| 16 |
* $LastChangedBy: iworks $
|
| 17 |
*
|
| 18 |
*
|
| 37 |
|
| 38 |
wp_register_script( 'wptoolset-forms',
|
| 39 |
WPTOOLSET_FORMS_RELPATH . '/js/main.js',
|
| 40 |
+
array('jquery', 'underscore', 'suggest'), WPTOOLSET_FORMS_VERSION, false );
|
| 41 |
wp_enqueue_script( 'wptoolset-forms' );
|
| 42 |
+
$wptoolset_forms_localization = array(
|
| 43 |
+
'ajaxurl' => admin_url( 'admin-ajax.php', null )
|
| 44 |
+
);
|
| 45 |
+
wp_localize_script( 'wptoolset-forms', 'wptoolset_forms_local', $wptoolset_forms_localization );
|
| 46 |
|
| 47 |
if ( is_admin() ) {
|
| 48 |
wp_register_style( 'wptoolset-forms-admin',
|
| 242 |
if ( current_user_can('manage_options') ) {
|
| 243 |
$htmlArray[] = sprintf(
|
| 244 |
'<div id="message" class="error"><p>%s</p><p>%s</p></div>',
|
| 245 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196628627/comments#310360880
|
| 246 |
+
//changed render to rendering
|
| 247 |
sprintf(
|
| 248 |
+
__('There is a problem rendering field <strong>%s (%s)</strong>.', 'wpv-views'),
|
| 249 |
$_cfg['title'],
|
| 250 |
$_cfg['type']
|
| 251 |
),
|
embedded/common/toolset-forms/classes/class.image.php
CHANGED
|
@@ -6,7 +6,7 @@ require_once 'class.file.php';
|
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.image.php $
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.radios.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -64,7 +64,15 @@ class WPToolset_Field_Radios extends FieldFactory
|
|
| 64 |
*/
|
| 65 |
$options[] = $one_option_data;
|
| 66 |
}
|
| 67 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 68 |
/**
|
| 69 |
* default_value
|
| 70 |
*/
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.radios.php $
|
| 5 |
+
* $LastChangedDate: 2015-02-18 14:28:53 +0000 (Wed, 18 Feb 2015) $
|
| 6 |
+
* $LastChangedRevision: 1093394 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 64 |
*/
|
| 65 |
$options[] = $one_option_data;
|
| 66 |
}
|
| 67 |
+
/**
|
| 68 |
+
* for user fields we reset title and description to avoid double
|
| 69 |
+
* display
|
| 70 |
+
*/
|
| 71 |
+
$title = $this->getTitle();
|
| 72 |
+
if ( empty($title) ) {
|
| 73 |
+
$title = $this->getTitle(true);
|
| 74 |
+
}
|
| 75 |
+
$options = apply_filters( 'wpt_field_options', $options, $title, 'select' );
|
| 76 |
/**
|
| 77 |
* default_value
|
| 78 |
*/
|
embedded/common/toolset-forms/classes/class.recaptcha.php
CHANGED
|
@@ -43,7 +43,7 @@ class WPToolset_Field_Recaptcha extends WPToolset_Field_Textfield
|
|
| 43 |
$capture = '';
|
| 44 |
if ($this->pubkey || !is_admin()) {
|
| 45 |
try {
|
| 46 |
-
$capture = recaptcha_get_html($this->pubkey);
|
| 47 |
} catch(Exception $e ) {
|
| 48 |
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188424989/comments
|
| 49 |
if ( current_user_can( 'manage_options' ) ) {
|
| 43 |
$capture = '';
|
| 44 |
if ($this->pubkey || !is_admin()) {
|
| 45 |
try {
|
| 46 |
+
$capture = recaptcha_get_html($this->pubkey,null,is_ssl());
|
| 47 |
} catch(Exception $e ) {
|
| 48 |
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188424989/comments
|
| 49 |
if ( current_user_can( 'manage_options' ) ) {
|
embedded/common/toolset-forms/classes/class.repetitive.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
/*
|
| 3 |
* Repetitive controller
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
/*
|
| 3 |
* Repetitive controller
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.repetitive.php $
|
| 6 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 7 |
* $LastChangedRevision: 1027712 $
|
| 8 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.select.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -43,14 +43,23 @@ class WPToolset_Field_Select extends FieldFactory
|
|
| 43 |
$options[] = $one_option_data;
|
| 44 |
}
|
| 45 |
}
|
| 46 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 47 |
/**
|
| 48 |
* default_value
|
| 49 |
*/
|
| 50 |
if ( !empty( $value ) || $value == '0' ) {
|
| 51 |
$data['default_value'] = $value;
|
| 52 |
}
|
| 53 |
-
|
| 54 |
$is_multiselect = array_key_exists('multiple', $attributes) && 'multiple' == $attributes['multiple'];
|
| 55 |
$default_value = isset( $data['default_value'] ) ? $data['default_value'] : null;
|
| 56 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/189219391/comments
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.select.php $
|
| 5 |
+
* $LastChangedDate: 2015-02-18 14:28:53 +0000 (Wed, 18 Feb 2015) $
|
| 6 |
+
* $LastChangedRevision: 1093394 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 43 |
$options[] = $one_option_data;
|
| 44 |
}
|
| 45 |
}
|
| 46 |
+
|
| 47 |
+
/**
|
| 48 |
+
* for user fields we reset title and description to avoid double
|
| 49 |
+
* display
|
| 50 |
+
*/
|
| 51 |
+
$title = $this->getTitle();
|
| 52 |
+
if ( empty($title) ) {
|
| 53 |
+
$title = $this->getTitle(true);
|
| 54 |
+
}
|
| 55 |
+
$options = apply_filters( 'wpt_field_options', $options, $title, 'select' );
|
| 56 |
/**
|
| 57 |
* default_value
|
| 58 |
*/
|
| 59 |
if ( !empty( $value ) || $value == '0' ) {
|
| 60 |
$data['default_value'] = $value;
|
| 61 |
}
|
| 62 |
+
|
| 63 |
$is_multiselect = array_key_exists('multiple', $attributes) && 'multiple' == $attributes['multiple'];
|
| 64 |
$default_value = isset( $data['default_value'] ) ? $data['default_value'] : null;
|
| 65 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/189219391/comments
|
embedded/common/toolset-forms/classes/class.skype.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -14,29 +14,38 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 14 |
|
| 15 |
protected $_defaults = array('skypename' => '', 'button_style' => 'btn2');
|
| 16 |
|
| 17 |
-
public function init()
|
| 18 |
-
|
| 19 |
-
|
| 20 |
add_action( 'wp_footer', array($this, 'editButtonTemplate') );
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
wp_enqueue_script( 'wptoolset-field-skype' );
|
| 26 |
add_thickbox();
|
| 27 |
$translation = array('title' => esc_js( __( 'Edit Skype button', 'wpv-views' ) ) );
|
| 28 |
-
wp_localize_script( 'wptoolset-field-skype', 'wptSkypeData',
|
| 29 |
-
|
| 30 |
-
|
| 31 |
}
|
| 32 |
|
| 33 |
public function enqueueStyles() {
|
| 34 |
-
|
| 35 |
}
|
| 36 |
|
| 37 |
public function metaform() {
|
| 38 |
$value = wp_parse_args( $this->getValue(), $this->_defaults );
|
| 39 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 40 |
$form = array();
|
| 41 |
$form[] = array(
|
| 42 |
'#type' => 'textfield',
|
|
@@ -46,7 +55,7 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 46 |
'#attributes' => array(),
|
| 47 |
'#value' => $value['skypename'],
|
| 48 |
'#validate' => $this->getValidationData(),
|
| 49 |
-
'#attributes' =>
|
| 50 |
'#repetitive' => $this->isRepetitive(),
|
| 51 |
);
|
| 52 |
$form['style'] = array(
|
|
@@ -63,7 +72,7 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 63 |
$button_element = array(
|
| 64 |
'#name' => '',
|
| 65 |
'#type' => 'button',
|
| 66 |
-
'#value' => esc_attr( __( 'Edit
|
| 67 |
'#attributes' => array('class' => 'js-wpt-skype-edit-button button button-small button-secondary'),
|
| 68 |
);
|
| 69 |
/*
|
|
@@ -102,7 +111,7 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 102 |
}
|
| 103 |
|
| 104 |
public function editform( $config = null ) {
|
| 105 |
-
|
| 106 |
}
|
| 107 |
|
| 108 |
public function mediaEditor(){
|
|
@@ -111,11 +120,11 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 111 |
|
| 112 |
/**
|
| 113 |
* Returns HTML formatted skype button.
|
| 114 |
-
*
|
| 115 |
* @param type $skypename
|
| 116 |
* @param type $template
|
| 117 |
* @param type $class
|
| 118 |
-
* @return type
|
| 119 |
*/
|
| 120 |
function getButton( $skypename, $template = '', $class = false ) {
|
| 121 |
|
|
@@ -179,10 +188,10 @@ class WPToolset_Field_Skype extends WPToolset_Field_Textfield
|
|
| 179 |
|
| 180 |
/**
|
| 181 |
* Returns HTML formatted skype button image.
|
| 182 |
-
*
|
| 183 |
* @param type $skypename
|
| 184 |
* @param type $template
|
| 185 |
-
* @return type
|
| 186 |
*/
|
| 187 |
public function getButtonImage( $skypename = '', $template = '', $class = '' ) {
|
| 188 |
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.skype.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1120400 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 14 |
|
| 15 |
protected $_defaults = array('skypename' => '', 'button_style' => 'btn2');
|
| 16 |
|
| 17 |
+
public function init()
|
| 18 |
+
{
|
| 19 |
+
add_action( 'admin_footer', array($this, 'editButtonTemplate') );
|
| 20 |
add_action( 'wp_footer', array($this, 'editButtonTemplate') );
|
| 21 |
+
|
| 22 |
+
wp_register_script(
|
| 23 |
+
'wptoolset-field-skype',
|
| 24 |
+
WPTOOLSET_FORMS_RELPATH . '/js/skype.js',
|
| 25 |
+
array('jquery'),
|
| 26 |
+
WPTOOLSET_FORMS_VERSION,
|
| 27 |
+
true
|
| 28 |
+
);
|
| 29 |
wp_enqueue_script( 'wptoolset-field-skype' );
|
| 30 |
add_thickbox();
|
| 31 |
$translation = array('title' => esc_js( __( 'Edit Skype button', 'wpv-views' ) ) );
|
| 32 |
+
wp_localize_script( 'wptoolset-field-skype', 'wptSkypeData', $translation );
|
| 33 |
+
$this->set_placeholder_as_attribute();
|
|
|
|
| 34 |
}
|
| 35 |
|
| 36 |
public function enqueueStyles() {
|
| 37 |
+
|
| 38 |
}
|
| 39 |
|
| 40 |
public function metaform() {
|
| 41 |
$value = wp_parse_args( $this->getValue(), $this->_defaults );
|
| 42 |
+
$attributes = $this->getAttr();
|
| 43 |
+
if ( isset($attributes['class'] ) ) {
|
| 44 |
+
$attributes['class'] .= ' ';
|
| 45 |
+
} else {
|
| 46 |
+
$attributes['class'] = '';
|
| 47 |
+
}
|
| 48 |
+
$attributes['class'] = 'js-wpt-skypename js-wpt-cond-trigger';// What is this js-wpt-cond-trigger classname for?
|
| 49 |
$form = array();
|
| 50 |
$form[] = array(
|
| 51 |
'#type' => 'textfield',
|
| 55 |
'#attributes' => array(),
|
| 56 |
'#value' => $value['skypename'],
|
| 57 |
'#validate' => $this->getValidationData(),
|
| 58 |
+
'#attributes' => $attributes,
|
| 59 |
'#repetitive' => $this->isRepetitive(),
|
| 60 |
);
|
| 61 |
$form['style'] = array(
|
| 72 |
$button_element = array(
|
| 73 |
'#name' => '',
|
| 74 |
'#type' => 'button',
|
| 75 |
+
'#value' => esc_attr( __( 'Edit', 'wpv-views' ) )." Skype button",
|
| 76 |
'#attributes' => array('class' => 'js-wpt-skype-edit-button button button-small button-secondary'),
|
| 77 |
);
|
| 78 |
/*
|
| 111 |
}
|
| 112 |
|
| 113 |
public function editform( $config = null ) {
|
| 114 |
+
|
| 115 |
}
|
| 116 |
|
| 117 |
public function mediaEditor(){
|
| 120 |
|
| 121 |
/**
|
| 122 |
* Returns HTML formatted skype button.
|
| 123 |
+
*
|
| 124 |
* @param type $skypename
|
| 125 |
* @param type $template
|
| 126 |
* @param type $class
|
| 127 |
+
* @return type
|
| 128 |
*/
|
| 129 |
function getButton( $skypename, $template = '', $class = false ) {
|
| 130 |
|
| 188 |
|
| 189 |
/**
|
| 190 |
* Returns HTML formatted skype button image.
|
| 191 |
+
*
|
| 192 |
* @param type $skypename
|
| 193 |
* @param type $template
|
| 194 |
+
* @return type
|
| 195 |
*/
|
| 196 |
public function getButtonImage( $skypename = '', $template = '', $class = '' ) {
|
| 197 |
|
embedded/common/toolset-forms/classes/class.submit.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -22,7 +22,7 @@ class WPToolset_Field_Submit extends WPToolset_Field_Textfield
|
|
| 22 |
'#title' => $this->getTitle(),
|
| 23 |
'#description' => $this->getDescription(),
|
| 24 |
'#name' => $this->getName(),
|
| 25 |
-
'#value' => $this->getValue(),
|
| 26 |
'#validate' => $this->getValidationData(),
|
| 27 |
'#attributes' => array(
|
| 28 |
'class' => '',
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.submit.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1120400 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 22 |
'#title' => $this->getTitle(),
|
| 23 |
'#description' => $this->getDescription(),
|
| 24 |
'#name' => $this->getName(),
|
| 25 |
+
'#value' => esc_attr(__($this->getValue(), 'wpv-views')),
|
| 26 |
'#validate' => $this->getValidationData(),
|
| 27 |
'#attributes' => array(
|
| 28 |
'class' => '',
|
embedded/common/toolset-forms/classes/class.taxonomy.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -26,40 +26,15 @@ class WPToolset_Field_Taxonomy extends WPToolset_Field_Textfield
|
|
| 26 |
$this->objValues[$term->slug] = $term;
|
| 27 |
$i++;
|
| 28 |
}
|
| 29 |
-
|
| 30 |
-
wp_register_script( 'wptoolset-jquery-autocompleter',
|
| 31 |
-
WPTOOLSET_FORMS_RELPATH . '/js/jquery.autocomplete.js',
|
| 32 |
-
array('jquery'), WPTOOLSET_FORMS_VERSION, true );
|
| 33 |
-
|
| 34 |
-
wp_register_style('wptoolset-autocompleter', WPTOOLSET_FORMS_RELPATH.'/css/autocompleter.css');
|
| 35 |
-
wp_enqueue_script('wptoolset-jquery-autocompleter');
|
| 36 |
add_action( 'wp_footer', array($this, 'javascript_autocompleter') );
|
| 37 |
}
|
| 38 |
|
| 39 |
public function javascript_autocompleter() {
|
| 40 |
-
$autosubmit = 'function onSelectItem(row)
|
| 41 |
-
{
|
| 42 |
-
jQuery("input#'.$this->getName().'").focus();
|
| 43 |
-
}';
|
| 44 |
-
$extra = '
|
| 45 |
-
function formatItem(row) {
|
| 46 |
-
return row[0];
|
| 47 |
-
}
|
| 48 |
-
function formatItem2(row) {
|
| 49 |
-
if(row.length == 3){
|
| 50 |
-
var attr = "attr=\"" + row[2] + "\"";
|
| 51 |
-
} else {
|
| 52 |
-
attr = "";
|
| 53 |
-
}
|
| 54 |
-
return "<span "+attr+">" + row[1] + " matches</span>" + row[0];
|
| 55 |
-
}';
|
| 56 |
-
$results = 1;
|
| 57 |
echo '<script type="text/javascript">
|
| 58 |
jQuery(document).ready(function() {
|
| 59 |
initTaxonomies("'. $this->values .'", "'.$this->getName().'", "'.WPTOOLSET_FORMS_RELPATH.'", "'.$this->_nameField.'");
|
| 60 |
});
|
| 61 |
-
'.$autosubmit.'
|
| 62 |
-
'.$extra.'
|
| 63 |
</script>';
|
| 64 |
}
|
| 65 |
|
| 2 |
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.taxonomy.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 26 |
$this->objValues[$term->slug] = $term;
|
| 27 |
$i++;
|
| 28 |
}
|
| 29 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 30 |
add_action( 'wp_footer', array($this, 'javascript_autocompleter') );
|
| 31 |
}
|
| 32 |
|
| 33 |
public function javascript_autocompleter() {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 34 |
echo '<script type="text/javascript">
|
| 35 |
jQuery(document).ready(function() {
|
| 36 |
initTaxonomies("'. $this->values .'", "'.$this->getName().'", "'.WPTOOLSET_FORMS_RELPATH.'", "'.$this->_nameField.'");
|
| 37 |
});
|
|
|
|
|
|
|
| 38 |
</script>';
|
| 39 |
}
|
| 40 |
|
embedded/common/toolset-forms/classes/class.taxonomyhierarchical.php
CHANGED
|
@@ -1,25 +1,24 @@
|
|
| 1 |
<?php
|
|
|
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
-
|
| 11 |
include_once 'class.textfield.php';
|
| 12 |
|
| 13 |
-
class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
| 14 |
-
|
| 15 |
protected $child;
|
| 16 |
protected $names;
|
| 17 |
protected $values = array();
|
| 18 |
protected $valuesId = array();
|
| 19 |
protected $objValues;
|
| 20 |
|
| 21 |
-
public function init()
|
| 22 |
-
{
|
| 23 |
global $post;
|
| 24 |
|
| 25 |
$this->objValues = array();
|
|
@@ -32,17 +31,17 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 32 |
}
|
| 33 |
}
|
| 34 |
|
| 35 |
-
$all = $this->buildTerms(get_terms($this->getName(),array('hide_empty'=>0,'fields'=>'all')));
|
| 36 |
|
| 37 |
|
| 38 |
|
| 39 |
-
$childs=array();
|
| 40 |
-
$names=array();
|
| 41 |
foreach ($all as $term) {
|
| 42 |
-
$names[$term['term_id']]
|
| 43 |
if (!isset($childs[$term['parent']]) || !is_array($childs[$term['parent']]))
|
| 44 |
-
$childs[$term['parent']]=array();
|
| 45 |
-
$childs[$term['parent']][]
|
| 46 |
}
|
| 47 |
|
| 48 |
// ksort($childs);
|
|
@@ -51,24 +50,23 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 51 |
$this->names = $names;
|
| 52 |
}
|
| 53 |
|
| 54 |
-
public function enqueueScripts()
|
| 55 |
-
|
| 56 |
}
|
| 57 |
|
| 58 |
-
public function enqueueStyles()
|
| 59 |
-
|
| 60 |
}
|
| 61 |
|
| 62 |
-
public function metaform()
|
| 63 |
-
|
| 64 |
-
$use_bootstrap = array_key_exists( 'use_bootstrap', $this->_data ) && $this->_data['use_bootstrap'];
|
| 65 |
$attributes = $this->getAttr();
|
| 66 |
-
|
| 67 |
$res = '';
|
| 68 |
$metaform = array();
|
| 69 |
$build_what = '';
|
| 70 |
|
| 71 |
-
if (
|
| 72 |
$metaform = $this->buildSelect();
|
| 73 |
$build_what = 'select';
|
| 74 |
} else {
|
|
@@ -77,14 +75,13 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 77 |
$build_what = 'checkboxes';
|
| 78 |
}
|
| 79 |
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
/**
|
| 89 |
* "Add new" button
|
| 90 |
*/
|
|
@@ -92,49 +89,47 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 92 |
'#type' => 'button',
|
| 93 |
'#title' => '',
|
| 94 |
'#description' => '',
|
| 95 |
-
'#name' => "btn_"
|
| 96 |
-
'#value' => apply_filters('toolset_button_add_new_text', esc_attr(
|
| 97 |
'#attributes' => array(
|
| 98 |
'style' => 'display:none;',
|
| 99 |
'data-taxonomy' => $taxname,
|
| 100 |
'data-build_what' => $build_what,
|
| 101 |
'data-after-selector' => 'js-wpt-hierarchical-taxonomy-add-new-' . $taxname,
|
| 102 |
-
'data-open' => apply_filters('toolset_button_add_new_text', esc_attr(
|
| 103 |
-
|
| 104 |
-
|
| 105 |
),
|
| 106 |
-
|
| 107 |
'#validate' => $this->getValidationData(),
|
| 108 |
);
|
| 109 |
|
| 110 |
// Input for new taxonomy
|
| 111 |
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
$metaform[] = array(
|
| 122 |
'#type' => 'textfield',
|
| 123 |
'#title' => '',
|
| 124 |
'#description' => '',
|
| 125 |
-
'#name' => "new_tax_text_"
|
| 126 |
'#value' => '',
|
| 127 |
'#attributes' => array(
|
| 128 |
'data-taxonomy' => $taxname,
|
| 129 |
-
|
| 130 |
-
|
| 131 |
),
|
| 132 |
'#validate' => $this->getValidationData(),
|
| 133 |
'#before' => $container,
|
| 134 |
-
|
| 135 |
);
|
| 136 |
|
| 137 |
-
|
| 138 |
* The select for parent
|
| 139 |
*/
|
| 140 |
$metaform[] = array(
|
|
@@ -146,13 +141,12 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 146 |
)),
|
| 147 |
'#default_value' => 0,
|
| 148 |
'#description' => '',
|
| 149 |
-
'#name' => "new_tax_select_"
|
| 150 |
'#attributes' => array(
|
| 151 |
'data-parent-text' => $attributes['parent_text'],
|
| 152 |
'data-taxonomy' => $taxname,
|
| 153 |
'class' => 'js-taxonomy-parent wpt-taxonomy-parent'
|
| 154 |
),
|
| 155 |
-
|
| 156 |
'#validate' => $this->getValidationData(),
|
| 157 |
);
|
| 158 |
|
|
@@ -163,39 +157,35 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 163 |
'#type' => 'button',
|
| 164 |
'#title' => '',
|
| 165 |
'#description' => '',
|
| 166 |
-
'#name' => "new_tax_button_"
|
| 167 |
-
'#value' => apply_filters('toolset_button_add_text', esc_attr(
|
| 168 |
'#attributes' => array(
|
| 169 |
'data-taxonomy' => $taxname,
|
| 170 |
'data-build_what' => $build_what,
|
| 171 |
-
|
| 172 |
),
|
| 173 |
-
|
| 174 |
'#validate' => $this->getValidationData(),
|
| 175 |
-
|
| 176 |
);
|
| 177 |
|
| 178 |
return $metaform;
|
| 179 |
-
|
| 180 |
}
|
| 181 |
|
| 182 |
-
private function buildTerms($obj_terms)
|
| 183 |
-
|
| 184 |
-
$tax_terms=array();
|
| 185 |
foreach ($obj_terms as $term) {
|
| 186 |
-
$tax_terms[]=array(
|
| 187 |
-
'name'
|
| 188 |
-
'count'
|
| 189 |
-
'parent'
|
| 190 |
-
'term_taxonomy_id'
|
| 191 |
-
'term_id'
|
| 192 |
);
|
| 193 |
}
|
| 194 |
return $tax_terms;
|
| 195 |
}
|
| 196 |
|
| 197 |
-
private function buildSelect()
|
| 198 |
-
{
|
| 199 |
$attributes = $this->getAttr();
|
| 200 |
|
| 201 |
$multiple = !isset($attributes['single_select']) || !$attributes['single_select'];
|
|
@@ -203,9 +193,8 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 203 |
$curr_options = $this->getOptions();
|
| 204 |
$values = $this->valuesId;
|
| 205 |
$options = array();
|
| 206 |
-
if(
|
| 207 |
-
|
| 208 |
-
foreach ($curr_options as $name=>$data) {
|
| 209 |
$option = array(
|
| 210 |
'#value' => $name,
|
| 211 |
'#title' => $data['value'],
|
|
@@ -223,7 +212,7 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 223 |
* default_value
|
| 224 |
*/
|
| 225 |
$default_value = null;
|
| 226 |
-
if (
|
| 227 |
$default_value = $this->valuesId[0];
|
| 228 |
}
|
| 229 |
/**
|
|
@@ -236,7 +225,7 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 236 |
'#description' => $this->getDescription(),
|
| 237 |
'#name' => $this->getName() . '[]',
|
| 238 |
'#options' => $options,
|
| 239 |
-
'#default_value' => isset(
|
| 240 |
'#validate' => $this->getValidationData(),
|
| 241 |
'#class' => 'form-inline',
|
| 242 |
'#repetitive' => $this->isRepetitive(),
|
|
@@ -258,18 +247,17 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 258 |
return $form;
|
| 259 |
}
|
| 260 |
|
| 261 |
-
private function getOptions($index = 0, $level = 0, $parent = -1)
|
| 262 |
-
|
| 263 |
-
if ( !isset($this->childs[$index]) || empty( $this->childs[$index] ) ) {
|
| 264 |
return;
|
| 265 |
}
|
| 266 |
$options = array();
|
| 267 |
|
| 268 |
-
foreach(
|
| 269 |
-
$options[$one] = array('value' => sprintf('%s%s', str_repeat(' ', 2
|
| 270 |
-
|
| 271 |
-
if (
|
| 272 |
-
foreach(
|
| 273 |
$options[$id] = $data;
|
| 274 |
}
|
| 275 |
}
|
|
@@ -277,24 +265,23 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 277 |
return $options;
|
| 278 |
}
|
| 279 |
|
| 280 |
-
private function buildCheckboxes(
|
| 281 |
-
{
|
| 282 |
if (isset($childs[$index])) {
|
| 283 |
-
$level_count = count(
|
| 284 |
-
foreach (
|
| 285 |
$name = $names[$tid];
|
| 286 |
/**
|
| 287 |
* check for "checked"
|
| 288 |
*/
|
| 289 |
$default_value = false;
|
| 290 |
-
if (
|
| 291 |
-
$default_value = in_array(
|
| 292 |
-
} else if (
|
| 293 |
-
$default_value = in_array(
|
| 294 |
}
|
| 295 |
$clases = array();
|
| 296 |
-
$clases[] = 'tax-'.sanitize_title($names[$tid]);
|
| 297 |
-
$clases[] = 'tax-'
|
| 298 |
/**
|
| 299 |
* filter: cred_checkboxes_class
|
| 300 |
* @param array $clases current array of classes
|
|
@@ -303,17 +290,17 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 303 |
*
|
| 304 |
* @return array
|
| 305 |
*/
|
| 306 |
-
$clases = apply_filters(
|
| 307 |
|
| 308 |
$item = array(
|
| 309 |
'#type' => 'checkbox',
|
| 310 |
'#title' => $names[$tid],
|
| 311 |
'#description' => '',
|
| 312 |
-
'#name' => $this->getName()."[]",
|
| 313 |
'#value' => $tid,
|
| 314 |
'#default_value' => $default_value,
|
| 315 |
'#validate' => $this->getValidationData(),
|
| 316 |
-
'#before' => sprintf(
|
| 317 |
'#after' => '</li>',
|
| 318 |
'#attributes' => array(
|
| 319 |
'data-parent' => $parent
|
|
@@ -321,34 +308,34 @@ class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield
|
|
| 321 |
'#pattern' => '<BEFORE><PREFIX><ELEMENT><LABEL><ERROR><SUFFIX><DESCRIPTION><AFTER>',
|
| 322 |
);
|
| 323 |
|
| 324 |
-
if (
|
| 325 |
if ($level > 0) {
|
| 326 |
-
$item['#before'] = '<li class="tax-children-of-'
|
| 327 |
-
} else
|
| 328 |
-
$item['#before'] = '<ul class="wpt-form-set wpt-form-set-checkboxes wpt-form-set-checkboxes-' . $this->getName() . '" data-level="0">'
|
| 329 |
}
|
| 330 |
}
|
| 331 |
-
if (
|
| 332 |
$item['#after'] = '</li>';
|
| 333 |
}
|
| 334 |
|
| 335 |
$metaform[] = $item;
|
| 336 |
|
| 337 |
-
if (
|
| 338 |
-
$metaform = $this->buildCheckboxes(
|
| 339 |
}
|
| 340 |
-
|
| 341 |
}
|
| 342 |
}
|
| 343 |
|
| 344 |
if (count($metaform)) {
|
| 345 |
if ($level == 0) {
|
| 346 |
$metaform[count($metaform) - 1]['#after'] .= '</ul>';
|
| 347 |
-
} else
|
| 348 |
$metaform[count($metaform) - 1]['#after'] .= '</ul></li>';
|
| 349 |
}
|
| 350 |
}
|
| 351 |
|
| 352 |
return $metaform;
|
| 353 |
}
|
|
|
|
| 354 |
}
|
| 1 |
<?php
|
| 2 |
+
|
| 3 |
/**
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.taxonomyhierarchical.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1113864 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
|
|
| 11 |
include_once 'class.textfield.php';
|
| 12 |
|
| 13 |
+
class WPToolset_Field_Taxonomyhierarchical extends WPToolset_Field_Textfield {
|
| 14 |
+
|
| 15 |
protected $child;
|
| 16 |
protected $names;
|
| 17 |
protected $values = array();
|
| 18 |
protected $valuesId = array();
|
| 19 |
protected $objValues;
|
| 20 |
|
| 21 |
+
public function init() {
|
|
|
|
| 22 |
global $post;
|
| 23 |
|
| 24 |
$this->objValues = array();
|
| 31 |
}
|
| 32 |
}
|
| 33 |
|
| 34 |
+
$all = $this->buildTerms(get_terms($this->getName(), array('hide_empty' => 0, 'fields' => 'all')));
|
| 35 |
|
| 36 |
|
| 37 |
|
| 38 |
+
$childs = array();
|
| 39 |
+
$names = array();
|
| 40 |
foreach ($all as $term) {
|
| 41 |
+
$names[$term['term_id']] = $term['name'];
|
| 42 |
if (!isset($childs[$term['parent']]) || !is_array($childs[$term['parent']]))
|
| 43 |
+
$childs[$term['parent']] = array();
|
| 44 |
+
$childs[$term['parent']][] = $term['term_id'];
|
| 45 |
}
|
| 46 |
|
| 47 |
// ksort($childs);
|
| 50 |
$this->names = $names;
|
| 51 |
}
|
| 52 |
|
| 53 |
+
public function enqueueScripts() {
|
| 54 |
+
|
| 55 |
}
|
| 56 |
|
| 57 |
+
public function enqueueStyles() {
|
| 58 |
+
|
| 59 |
}
|
| 60 |
|
| 61 |
+
public function metaform() {
|
| 62 |
+
$use_bootstrap = array_key_exists('use_bootstrap', $this->_data) && $this->_data['use_bootstrap'];
|
|
|
|
| 63 |
$attributes = $this->getAttr();
|
| 64 |
+
$taxname = $this->getName();
|
| 65 |
$res = '';
|
| 66 |
$metaform = array();
|
| 67 |
$build_what = '';
|
| 68 |
|
| 69 |
+
if (array_key_exists('display', $this->_data) && 'select' == $this->_data['display']) {
|
| 70 |
$metaform = $this->buildSelect();
|
| 71 |
$build_what = 'select';
|
| 72 |
} else {
|
| 75 |
$build_what = 'checkboxes';
|
| 76 |
}
|
| 77 |
|
| 78 |
+
/**
|
| 79 |
+
* TODO
|
| 80 |
+
*
|
| 81 |
+
* Use this to get the taxonomy labels for the "Add new" event
|
| 82 |
+
*
|
| 83 |
+
* $taxobject = get_taxonomy( $taxname );
|
| 84 |
+
*/
|
|
|
|
| 85 |
/**
|
| 86 |
* "Add new" button
|
| 87 |
*/
|
| 89 |
'#type' => 'button',
|
| 90 |
'#title' => '',
|
| 91 |
'#description' => '',
|
| 92 |
+
'#name' => "btn_" . $taxname,
|
| 93 |
+
'#value' => apply_filters('toolset_button_add_new_text', esc_attr($attributes['add_new_text'])),
|
| 94 |
'#attributes' => array(
|
| 95 |
'style' => 'display:none;',
|
| 96 |
'data-taxonomy' => $taxname,
|
| 97 |
'data-build_what' => $build_what,
|
| 98 |
'data-after-selector' => 'js-wpt-hierarchical-taxonomy-add-new-' . $taxname,
|
| 99 |
+
'data-open' => apply_filters('toolset_button_add_new_text', esc_attr($attributes['add_new_text'])),
|
| 100 |
+
'data-close' => apply_filters('toolset_button_cancel_text', esc_attr(__('Cancel', 'wpv-views'))), // TODO adjust the button value depending on open/close action
|
| 101 |
+
'class' => $use_bootstrap ? 'btn btn-default wpt-hierarchical-taxonomy-add-new-show-hide js-wpt-hierarchical-taxonomy-add-new-show-hide' : 'wpt-hierarchical-taxonomy-add-new-show-hide js-wpt-hierarchical-taxonomy-add-new-show-hide',
|
| 102 |
),
|
|
|
|
| 103 |
'#validate' => $this->getValidationData(),
|
| 104 |
);
|
| 105 |
|
| 106 |
// Input for new taxonomy
|
| 107 |
|
| 108 |
+
if ($use_bootstrap) {
|
| 109 |
+
$container = '<div style="display:none" class="form-group wpt-hierarchical-taxonomy-add-new js-wpt-hierarchical-taxonomy-add-new-' . $taxname . '" data-taxonomy="' . $taxname . '">';
|
| 110 |
+
} else {
|
| 111 |
+
$container = '<div style="display:none" class="wpt-hierarchical-taxonomy-add-new js-wpt-hierarchical-taxonomy-add-new-' . $taxname . '" data-taxonomy="' . $taxname . '">';
|
| 112 |
+
}
|
| 113 |
|
| 114 |
+
/**
|
| 115 |
+
* The textfield input
|
| 116 |
+
*/
|
| 117 |
$metaform[] = array(
|
| 118 |
'#type' => 'textfield',
|
| 119 |
'#title' => '',
|
| 120 |
'#description' => '',
|
| 121 |
+
'#name' => "new_tax_text_" . $taxname,
|
| 122 |
'#value' => '',
|
| 123 |
'#attributes' => array(
|
| 124 |
'data-taxonomy' => $taxname,
|
| 125 |
+
'data-taxtype' => 'hierarchical',
|
| 126 |
+
'class' => $use_bootstrap ? 'inline wpt-new-taxonomy-title js-wpt-new-taxonomy-title' : 'wpt-new-taxonomy-title js-wpt-new-taxonomy-title',
|
| 127 |
),
|
| 128 |
'#validate' => $this->getValidationData(),
|
| 129 |
'#before' => $container,
|
|
|
|
| 130 |
);
|
| 131 |
|
| 132 |
+
/**
|
| 133 |
* The select for parent
|
| 134 |
*/
|
| 135 |
$metaform[] = array(
|
| 141 |
)),
|
| 142 |
'#default_value' => 0,
|
| 143 |
'#description' => '',
|
| 144 |
+
'#name' => "new_tax_select_" . $taxname,
|
| 145 |
'#attributes' => array(
|
| 146 |
'data-parent-text' => $attributes['parent_text'],
|
| 147 |
'data-taxonomy' => $taxname,
|
| 148 |
'class' => 'js-taxonomy-parent wpt-taxonomy-parent'
|
| 149 |
),
|
|
|
|
| 150 |
'#validate' => $this->getValidationData(),
|
| 151 |
);
|
| 152 |
|
| 157 |
'#type' => 'button',
|
| 158 |
'#title' => '',
|
| 159 |
'#description' => '',
|
| 160 |
+
'#name' => "new_tax_button_" . $taxname,
|
| 161 |
+
'#value' => apply_filters('toolset_button_add_text', esc_attr($attributes['add_text'])),
|
| 162 |
'#attributes' => array(
|
| 163 |
'data-taxonomy' => $taxname,
|
| 164 |
'data-build_what' => $build_what,
|
| 165 |
+
'class' => $use_bootstrap ? 'btn btn-default wpt-hierarchical-taxonomy-add-new js-wpt-hierarchical-taxonomy-add-new' : 'wpt-hierarchical-taxonomy-add-new js-wpt-hierarchical-taxonomy-add-new',
|
| 166 |
),
|
|
|
|
| 167 |
'#validate' => $this->getValidationData(),
|
| 168 |
+
'#after' => '</div>',
|
| 169 |
);
|
| 170 |
|
| 171 |
return $metaform;
|
|
|
|
| 172 |
}
|
| 173 |
|
| 174 |
+
private function buildTerms($obj_terms) {
|
| 175 |
+
$tax_terms = array();
|
|
|
|
| 176 |
foreach ($obj_terms as $term) {
|
| 177 |
+
$tax_terms[] = array(
|
| 178 |
+
'name' => $term->name,
|
| 179 |
+
'count' => $term->count,
|
| 180 |
+
'parent' => $term->parent,
|
| 181 |
+
'term_taxonomy_id' => $term->term_taxonomy_id,
|
| 182 |
+
'term_id' => $term->term_id
|
| 183 |
);
|
| 184 |
}
|
| 185 |
return $tax_terms;
|
| 186 |
}
|
| 187 |
|
| 188 |
+
private function buildSelect() {
|
|
|
|
| 189 |
$attributes = $this->getAttr();
|
| 190 |
|
| 191 |
$multiple = !isset($attributes['single_select']) || !$attributes['single_select'];
|
| 193 |
$curr_options = $this->getOptions();
|
| 194 |
$values = $this->valuesId;
|
| 195 |
$options = array();
|
| 196 |
+
if ($curr_options) {
|
| 197 |
+
foreach ($curr_options as $name => $data) {
|
|
|
|
| 198 |
$option = array(
|
| 199 |
'#value' => $name,
|
| 200 |
'#title' => $data['value'],
|
| 212 |
* default_value
|
| 213 |
*/
|
| 214 |
$default_value = null;
|
| 215 |
+
if (count($this->valuesId)) {
|
| 216 |
$default_value = $this->valuesId[0];
|
| 217 |
}
|
| 218 |
/**
|
| 225 |
'#description' => $this->getDescription(),
|
| 226 |
'#name' => $this->getName() . '[]',
|
| 227 |
'#options' => $options,
|
| 228 |
+
'#default_value' => isset($data['default_value']) && !empty($data['default_value']) ? $data['default_value'] : $default_value,
|
| 229 |
'#validate' => $this->getValidationData(),
|
| 230 |
'#class' => 'form-inline',
|
| 231 |
'#repetitive' => $this->isRepetitive(),
|
| 247 |
return $form;
|
| 248 |
}
|
| 249 |
|
| 250 |
+
private function getOptions($index = 0, $level = 0, $parent = -1) {
|
| 251 |
+
if (!isset($this->childs[$index]) || empty($this->childs[$index])) {
|
|
|
|
| 252 |
return;
|
| 253 |
}
|
| 254 |
$options = array();
|
| 255 |
|
| 256 |
+
foreach ($this->childs[$index] as $one) {
|
| 257 |
+
$options[$one] = array('value' => sprintf('%s%s', str_repeat(' ', 2 * $level), $this->names[$one]),
|
| 258 |
+
'parent' => $parent);
|
| 259 |
+
if (isset($this->childs[$one]) && count($this->childs[$one])) {
|
| 260 |
+
foreach ($this->getOptions($one, $level + 1, $one) as $id => $data) {
|
| 261 |
$options[$id] = $data;
|
| 262 |
}
|
| 263 |
}
|
| 265 |
return $options;
|
| 266 |
}
|
| 267 |
|
| 268 |
+
private function buildCheckboxes($index, &$childs, &$names, &$metaform, $level = 0, $parent = -1) {
|
|
|
|
| 269 |
if (isset($childs[$index])) {
|
| 270 |
+
$level_count = count($childs[$index]);
|
| 271 |
+
foreach ($childs[$index] as $tkey => $tid) {
|
| 272 |
$name = $names[$tid];
|
| 273 |
/**
|
| 274 |
* check for "checked"
|
| 275 |
*/
|
| 276 |
$default_value = false;
|
| 277 |
+
if (isset($this->valuesId) && is_array($this->valuesId) && !empty($this->valuesId)) {
|
| 278 |
+
$default_value = in_array($tid, $this->valuesId);
|
| 279 |
+
} else if (is_array($this->getValue())) {
|
| 280 |
+
$default_value = in_array($tid, $this->getValue());
|
| 281 |
}
|
| 282 |
$clases = array();
|
| 283 |
+
$clases[] = 'tax-' . sanitize_title($names[$tid]);
|
| 284 |
+
$clases[] = 'tax-' . $this->_data['name'] . '-' . $tid;
|
| 285 |
/**
|
| 286 |
* filter: cred_checkboxes_class
|
| 287 |
* @param array $clases current array of classes
|
| 290 |
*
|
| 291 |
* @return array
|
| 292 |
*/
|
| 293 |
+
$clases = apply_filters('cred_item_li_class', $clases, array('id' => $tid, 'name' => $name), 'taxonomyhierarchical');
|
| 294 |
|
| 295 |
$item = array(
|
| 296 |
'#type' => 'checkbox',
|
| 297 |
'#title' => $names[$tid],
|
| 298 |
'#description' => '',
|
| 299 |
+
'#name' => $this->getName() . "[]",
|
| 300 |
'#value' => $tid,
|
| 301 |
'#default_value' => $default_value,
|
| 302 |
'#validate' => $this->getValidationData(),
|
| 303 |
+
'#before' => sprintf('<li class="%s">', implode(' ', $clases)),
|
| 304 |
'#after' => '</li>',
|
| 305 |
'#attributes' => array(
|
| 306 |
'data-parent' => $parent
|
| 308 |
'#pattern' => '<BEFORE><PREFIX><ELEMENT><LABEL><ERROR><SUFFIX><DESCRIPTION><AFTER>',
|
| 309 |
);
|
| 310 |
|
| 311 |
+
if ($tkey == 0) {
|
| 312 |
if ($level > 0) {
|
| 313 |
+
$item['#before'] = '<li class="tax-children-of-' . $parent . '"><ul class="wpt-form-set-children wpt-form-set-children-level-' . $level . '" data-level="' . $level . '">' . $item['#before'];
|
| 314 |
+
} else {
|
| 315 |
+
$item['#before'] = '<ul class="wpt-form-set wpt-form-set-checkboxes wpt-form-set-checkboxes-' . $this->getName() . '" data-level="0">' . $item['#before'];
|
| 316 |
}
|
| 317 |
}
|
| 318 |
+
if ($tkey == ( $level_count - 1 )) {
|
| 319 |
$item['#after'] = '</li>';
|
| 320 |
}
|
| 321 |
|
| 322 |
$metaform[] = $item;
|
| 323 |
|
| 324 |
+
if (isset($childs[$tid])) {
|
| 325 |
+
$metaform = $this->buildCheckboxes($tid, $childs, $names, $metaform, $level + 1, $tid);
|
| 326 |
}
|
|
|
|
| 327 |
}
|
| 328 |
}
|
| 329 |
|
| 330 |
if (count($metaform)) {
|
| 331 |
if ($level == 0) {
|
| 332 |
$metaform[count($metaform) - 1]['#after'] .= '</ul>';
|
| 333 |
+
} else {
|
| 334 |
$metaform[count($metaform) - 1]['#after'] .= '</ul></li>';
|
| 335 |
}
|
| 336 |
}
|
| 337 |
|
| 338 |
return $metaform;
|
| 339 |
}
|
| 340 |
+
|
| 341 |
}
|
embedded/common/toolset-forms/classes/class.textarea.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.textarea.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.textfield.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -22,8 +22,6 @@ class WPToolset_Field_Textfield extends FieldFactory
|
|
| 22 |
{
|
| 23 |
public function metaform()
|
| 24 |
{
|
| 25 |
-
$attributes = $this->getAttr();
|
| 26 |
-
|
| 27 |
$metaform = array();
|
| 28 |
$metaform[] = array(
|
| 29 |
'#type' => 'textfield',
|
|
@@ -33,7 +31,7 @@ class WPToolset_Field_Textfield extends FieldFactory
|
|
| 33 |
'#value' => $this->getValue(),
|
| 34 |
'#validate' => $this->getValidationData(),
|
| 35 |
'#repetitive' => $this->isRepetitive(),
|
| 36 |
-
'#attributes' => $
|
| 37 |
'wpml_action' => $this->getWPMLAction(),
|
| 38 |
);
|
| 39 |
return $metaform;
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.textfield.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-02 10:49:00 +0000 (Mon, 02 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1103173 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 22 |
{
|
| 23 |
public function metaform()
|
| 24 |
{
|
|
|
|
|
|
|
| 25 |
$metaform = array();
|
| 26 |
$metaform[] = array(
|
| 27 |
'#type' => 'textfield',
|
| 31 |
'#value' => $this->getValue(),
|
| 32 |
'#validate' => $this->getValidationData(),
|
| 33 |
'#repetitive' => $this->isRepetitive(),
|
| 34 |
+
'#attributes' => $this->getAttr(),
|
| 35 |
'wpml_action' => $this->getWPMLAction(),
|
| 36 |
);
|
| 37 |
return $metaform;
|
embedded/common/toolset-forms/classes/class.types.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/**
|
| 3 |
* Types fields specific
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -68,6 +68,7 @@ class WPToolset_Types
|
|
| 68 |
*
|
| 69 |
* Main settings that are returned.
|
| 70 |
*/
|
|
|
|
| 71 |
$_field = array(
|
| 72 |
'id' => $prefix . $field['id'] . $suffix, // Used as main ID (raw date wpt-id), used to connect conditional relations
|
| 73 |
'meta_key' => $prefix . $field['id'], // Used by Types (meta key of field saved to DB)
|
|
@@ -82,6 +83,7 @@ class WPToolset_Types
|
|
| 82 |
'repetitive' => self::isRepetitive( $field ), // Is repetitive?
|
| 83 |
'validation' => self::filterValidation( $field ), // Validation settings
|
| 84 |
'conditional' => self::filterConditional( $field, $post_id, $_post_wpcf ), // Conditional settings
|
|
|
|
| 85 |
);
|
| 86 |
|
| 87 |
/* Specific field settings
|
|
@@ -140,6 +142,7 @@ class WPToolset_Types
|
|
| 140 |
if ( $field['type'] == 'radio' ) {
|
| 141 |
$_field['type'] = 'radios';
|
| 142 |
}
|
|
|
|
| 143 |
return $cache[$cache_key] = $_field;
|
| 144 |
}
|
| 145 |
|
| 2 |
/**
|
| 3 |
* Types fields specific
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.types.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-02 10:49:00 +0000 (Mon, 02 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1103173 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 68 |
*
|
| 69 |
* Main settings that are returned.
|
| 70 |
*/
|
| 71 |
+
|
| 72 |
$_field = array(
|
| 73 |
'id' => $prefix . $field['id'] . $suffix, // Used as main ID (raw date wpt-id), used to connect conditional relations
|
| 74 |
'meta_key' => $prefix . $field['id'], // Used by Types (meta key of field saved to DB)
|
| 83 |
'repetitive' => self::isRepetitive( $field ), // Is repetitive?
|
| 84 |
'validation' => self::filterValidation( $field ), // Validation settings
|
| 85 |
'conditional' => self::filterConditional( $field, $post_id, $_post_wpcf ), // Conditional settings
|
| 86 |
+
'placeholder' => isset($field['data']) && isset($field['data']['placeholder'])? $field['data']['placeholder']:null, // HTML5 placeholder
|
| 87 |
);
|
| 88 |
|
| 89 |
/* Specific field settings
|
| 142 |
if ( $field['type'] == 'radio' ) {
|
| 143 |
$_field['type'] = 'radios';
|
| 144 |
}
|
| 145 |
+
|
| 146 |
return $cache[$cache_key] = $_field;
|
| 147 |
}
|
| 148 |
|
embedded/common/toolset-forms/classes/class.validation.php
CHANGED
|
@@ -132,16 +132,15 @@ class WPToolset_Forms_Validation
|
|
| 132 |
* @return \WP_Error|boolean
|
| 133 |
* @throws Exception
|
| 134 |
*/
|
| 135 |
-
public function validateField( $field ) {
|
| 136 |
-
$value = apply_filters( 'wptoolset_validation_value_' . $field->getType(),
|
| 137 |
-
$field->getValue() );
|
| 138 |
$rules = $this->_parseRules( $field->getValidationData(), $value );
|
| 139 |
// If not required but empty - skip
|
| 140 |
if ( !isset( $rules['required'] )
|
| 141 |
&& ( is_null( $value ) || $value === false || $value === '' ) ) {
|
| 142 |
return true;
|
| 143 |
}
|
| 144 |
-
|
| 145 |
try {
|
| 146 |
$errors = array();
|
| 147 |
foreach ( $rules as $rule => $args ) {
|
|
@@ -189,6 +188,11 @@ class WPToolset_Forms_Validation
|
|
| 189 |
public function validate( $rule, $args ) {
|
| 190 |
$validator = $this->_cake();
|
| 191 |
$rule = $this->_map_rule_js_to_php( $rule );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 192 |
if ( is_callable( array($validator, $rule) ) ) {
|
| 193 |
return call_user_func_array( array($validator, $rule), $args );
|
| 194 |
}
|
| 132 |
* @return \WP_Error|boolean
|
| 133 |
* @throws Exception
|
| 134 |
*/
|
| 135 |
+
public function validateField( $field ) {
|
| 136 |
+
$value = apply_filters( 'wptoolset_validation_value_' . $field->getType(), $field->getValue() );
|
|
|
|
| 137 |
$rules = $this->_parseRules( $field->getValidationData(), $value );
|
| 138 |
// If not required but empty - skip
|
| 139 |
if ( !isset( $rules['required'] )
|
| 140 |
&& ( is_null( $value ) || $value === false || $value === '' ) ) {
|
| 141 |
return true;
|
| 142 |
}
|
| 143 |
+
|
| 144 |
try {
|
| 145 |
$errors = array();
|
| 146 |
foreach ( $rules as $rule => $args ) {
|
| 188 |
public function validate( $rule, $args ) {
|
| 189 |
$validator = $this->_cake();
|
| 190 |
$rule = $this->_map_rule_js_to_php( $rule );
|
| 191 |
+
|
| 192 |
+
if ( 'skype' == $rule ) {
|
| 193 |
+
return $validator->custom($args[0]['skypename'], '/^([a-zA-Z0-9\,\.\-\_]+)$/');
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
if ( is_callable( array($validator, $rule) ) ) {
|
| 197 |
return call_user_func_array( array($validator, $rule), $args );
|
| 198 |
}
|
embedded/common/toolset-forms/classes/class.video.php
CHANGED
|
@@ -6,7 +6,7 @@ require_once 'class.file.php';
|
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.video.php $
|
| 10 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 11 |
* $LastChangedRevision: 1027712 $
|
| 12 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/classes/class.wysiwyg.php
CHANGED
|
@@ -6,7 +6,7 @@ require_once 'class.textarea.php';
|
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 10 |
* $LastChangedDate: 2014-10-29 15:57:36 +0000 (Wed, 29 Oct 2014) $
|
| 11 |
* $LastChangedRevision: 1016002 $
|
| 12 |
* $LastChangedBy: iworks $
|
| 6 |
*
|
| 7 |
* @author Srdjan
|
| 8 |
*
|
| 9 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/classes/class.wysiwyg.php $
|
| 10 |
* $LastChangedDate: 2014-10-29 15:57:36 +0000 (Wed, 29 Oct 2014) $
|
| 11 |
* $LastChangedRevision: 1016002 $
|
| 12 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/css/wpt-toolset-frontend.css
CHANGED
|
@@ -285,34 +285,17 @@ img.wpt-credfile-preview-upload {
|
|
| 285 |
}
|
| 286 |
|
| 287 |
/* Autocomplete */
|
| 288 |
-
.
|
|
|
|
|
|
|
|
|
|
|
|
|
| 289 |
padding: 0px;
|
| 290 |
-
border: 1px solid WindowFrame;
|
| 291 |
background-color: Window;
|
| 292 |
overflow: hidden;
|
| 293 |
}
|
| 294 |
|
| 295 |
-
.
|
| 296 |
-
width: 100%;
|
| 297 |
-
list-style-position: outside;
|
| 298 |
-
list-style: none;
|
| 299 |
-
padding: 0;
|
| 300 |
-
margin: 0;
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
.ac_results iframe {
|
| 304 |
-
display:none;/*sorry for IE5*/
|
| 305 |
-
display/**/:block;/*sorry for IE5*/
|
| 306 |
-
position:absolute;
|
| 307 |
-
top:0;
|
| 308 |
-
left:0;
|
| 309 |
-
z-index:-1;
|
| 310 |
-
filter:mask();
|
| 311 |
-
width:3000px;
|
| 312 |
-
height:3000px;
|
| 313 |
-
}
|
| 314 |
-
|
| 315 |
-
.ac_results li {
|
| 316 |
margin: 0px;
|
| 317 |
padding: 2px 5px;
|
| 318 |
cursor: pointer;
|
|
@@ -323,13 +306,7 @@ img.wpt-credfile-preview-upload {
|
|
| 323 |
overflow: hidden;
|
| 324 |
}
|
| 325 |
|
| 326 |
-
|
| 327 |
-
.ac_results li span{
|
| 328 |
-
float: right;
|
| 329 |
-
padding-right: 10px;
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
.ac_over {
|
| 333 |
background-color: Highlight;
|
| 334 |
color: HighlightText;
|
| 335 |
}
|
| 285 |
}
|
| 286 |
|
| 287 |
/* Autocomplete */
|
| 288 |
+
.wpt-suggest-taxonomy-term {
|
| 289 |
+
position: absolute;
|
| 290 |
+
display: none;
|
| 291 |
+
min-width: 100px;
|
| 292 |
+
outline: solid #ccc 1px;
|
| 293 |
padding: 0px;
|
|
|
|
| 294 |
background-color: Window;
|
| 295 |
overflow: hidden;
|
| 296 |
}
|
| 297 |
|
| 298 |
+
.wpt-suggest-taxonomy-term li {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 299 |
margin: 0px;
|
| 300 |
padding: 2px 5px;
|
| 301 |
cursor: pointer;
|
| 306 |
overflow: hidden;
|
| 307 |
}
|
| 308 |
|
| 309 |
+
.wpt-suggest-taxonomy-term-select {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 310 |
background-color: Highlight;
|
| 311 |
color: HighlightText;
|
| 312 |
}
|
embedded/common/toolset-forms/external/autocompleter.php
DELETED
|
@@ -1,53 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.5.1/embedded/common/toolset-forms/external/autocompleter.php $
|
| 5 |
-
* $LastChangedDate: 2014-05-29 08:44:10 +0000 (Thu, 29 May 2014) $
|
| 6 |
-
* $LastChangedRevision: 922956 $
|
| 7 |
-
* $LastChangedBy: iworks $
|
| 8 |
-
*
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
$path = dirname(__FILE__);
|
| 12 |
-
$file = '/wp-config.php';
|
| 13 |
-
while ( !is_file( $path.$file) ) {
|
| 14 |
-
$path = dirname($path);
|
| 15 |
-
}
|
| 16 |
-
require_once $path.$file;
|
| 17 |
-
function autocompleter()
|
| 18 |
-
{
|
| 19 |
-
$results = 1;
|
| 20 |
-
$wpdb =& $GLOBALS['wpdb'];
|
| 21 |
-
$search = @$wpdb->escape($_GET['q']);
|
| 22 |
-
if(strlen($search)){
|
| 23 |
-
switch($results){
|
| 24 |
-
case 1: //Tags and categories
|
| 25 |
-
$words = $wpdb->get_results("SELECT concat( name, '|', sum( count ) ) name, sum( count ) cnt FROM ".$wpdb->prefix."terms t, ".$wpdb->prefix."term_taxonomy tt WHERE t.term_id = tt.term_id AND name LIKE '$search%' GROUP BY t.term_id ORDER BY cnt DESC");
|
| 26 |
-
break;
|
| 27 |
-
case 2: //Only tags
|
| 28 |
-
$words = $wpdb->get_results("SELECT concat( name, '|', sum( count ) ) name, sum( count ) cnt FROM ".$wpdb->prefix."terms t, ".$wpdb->prefix."term_taxonomy tt WHERE t.term_id = tt.term_id AND tt.taxonomy='post_tag' AND name LIKE '$search%' GROUP BY t.term_id ORDER BY cnt DESC");
|
| 29 |
-
break;
|
| 30 |
-
case 3: //Only categories
|
| 31 |
-
$words = $wpdb->get_results("SELECT concat( name, '|', sum( count ) ) name, sum( count ) cnt FROM ".$wpdb->prefix."terms t, ".$wpdb->prefix."term_taxonomy tt WHERE t.term_id = tt.term_id AND tt.taxonomy='category' AND name LIKE '$search%' GROUP BY t.term_id ORDER BY cnt DESC");
|
| 32 |
-
break;
|
| 33 |
-
case 4: //Posts and pages titles
|
| 34 |
-
$words = $wpdb->get_results("SELECT concat( post_title, '|', 1 ) name, 1 cnt, ID FROM ".$wpdb->prefix."posts t WHERE post_status='publish' and (post_type='post' OR post_type='page') and post_date < NOW() and post_title LIKE '%$search%' ORDER BY post_title");
|
| 35 |
-
break;
|
| 36 |
-
case 5: //Posts titles
|
| 37 |
-
$words = $wpdb->get_results("SELECT concat( post_title, '|', 1 ) name, 1 cnt, ID FROM ".$wpdb->prefix."posts t WHERE post_status='publish' and (post_type='post') and post_date < NOW() and post_title LIKE '%$search%' ORDER BY post_title");
|
| 38 |
-
break;
|
| 39 |
-
case 6: //Pages titles
|
| 40 |
-
$words = $wpdb->get_results("SELECT concat( post_title, '|', 1 ) name, 1 cnt, ID FROM ".$wpdb->prefix."posts t WHERE post_status='publish' and (post_type='page') and post_date < NOW() and post_title LIKE '%$search%' ORDER BY post_title");
|
| 41 |
-
break;
|
| 42 |
-
}
|
| 43 |
-
foreach ($words as $word){
|
| 44 |
-
if($results > 3)
|
| 45 |
-
echo $word->name."|".get_permalink($word->ID)."\n";
|
| 46 |
-
else
|
| 47 |
-
echo $word->name."\n";
|
| 48 |
-
}
|
| 49 |
-
}
|
| 50 |
-
}
|
| 51 |
-
if($_GET['q']){
|
| 52 |
-
autocompleter();
|
| 53 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/toolset-forms/js/conditional.js
CHANGED
|
@@ -1,10 +1,10 @@
|
|
| 1 |
/**
|
| 2 |
* @see WPToolset_Forms_Conditional (classes/conditional.php)
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate: 2015-
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
-
* $LastChangedBy:
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
var wptCondTriggers = {}
|
|
@@ -147,13 +147,13 @@ var wptCond = (function ($) {
|
|
| 147 |
console.log('radio', radio);
|
| 148 |
}
|
| 149 |
break;
|
| 150 |
-
case 'select':
|
| 151 |
option = $('[name="' + $trigger.attr('name') + '"] option:selected', formID);
|
| 152 |
// If no option was selected, the value should be empty
|
| 153 |
val = '';
|
| 154 |
if (wptCondDebug) {
|
| 155 |
console.log('option', option);
|
| 156 |
-
}
|
| 157 |
if (option.length == 1) {
|
| 158 |
if ('undefined' == typeof (option.data('types-value'))) {
|
| 159 |
val = option.val();
|
|
@@ -168,7 +168,7 @@ var wptCond = (function ($) {
|
|
| 168 |
} else {
|
| 169 |
val.push($(this).data('types-value'));
|
| 170 |
}
|
| 171 |
-
});
|
| 172 |
}
|
| 173 |
break;
|
| 174 |
case 'checkbox':
|
|
@@ -525,12 +525,14 @@ var wptCond = (function ($) {
|
|
| 525 |
|
| 526 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/193595717/comments
|
| 527 |
//group issue on select
|
| 528 |
-
if (
|
| 529 |
-
|
| 530 |
-
|
| 531 |
-
|
| 532 |
-
value
|
| 533 |
-
|
|
|
|
|
|
|
| 534 |
}
|
| 535 |
//#####################################################################################
|
| 536 |
|
|
@@ -597,6 +599,9 @@ var wptCond = (function ($) {
|
|
| 597 |
});
|
| 598 |
|
| 599 |
var result = false;
|
|
|
|
|
|
|
|
|
|
| 600 |
|
| 601 |
try {
|
| 602 |
var parser = new ToolsetParser.Expression(expression);
|
|
@@ -606,8 +611,101 @@ var wptCond = (function ($) {
|
|
| 606 |
catch (e) {
|
| 607 |
console.info("Error in Tokenizer", e, expression, " there may be an error in your expression syntax");
|
| 608 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 609 |
|
| 610 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 611 |
|
| 612 |
});
|
| 613 |
wptCallbacks.conditionalCheck.fire(formID);
|
|
@@ -616,9 +714,11 @@ var wptCond = (function ($) {
|
|
| 616 |
function _showHide(show, $el)
|
| 617 |
{
|
| 618 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/193353994/comments#302703480
|
| 619 |
-
|
|
|
|
|
|
|
| 620 |
jQuery('.wpt-form-error').hide();
|
| 621 |
-
}
|
| 622 |
|
| 623 |
if (wptCondDebug) {
|
| 624 |
console.info('_showHide');
|
|
@@ -636,6 +736,10 @@ var wptCond = (function ($) {
|
|
| 636 |
}
|
| 637 |
|
| 638 |
if (show) {
|
|
|
|
|
|
|
|
|
|
|
|
|
| 639 |
$el.addClass('wpt-conditional-visible').removeClass('wpt-conditional-hidden js-wpt-remove-on-submit js-wpt-validation-ignore');
|
| 640 |
switch (effectmode) {
|
| 641 |
case 'fade-slide':
|
|
@@ -661,6 +765,7 @@ var wptCond = (function ($) {
|
|
| 661 |
$el.show();
|
| 662 |
break;
|
| 663 |
}
|
|
|
|
| 664 |
} else {
|
| 665 |
$el.addClass('wpt-conditional-hidden js-wpt-remove-on-submit js-wpt-validation-ignore').removeClass('wpt-conditional-visible');
|
| 666 |
switch (effectmode) {
|
|
@@ -687,6 +792,7 @@ var wptCond = (function ($) {
|
|
| 687 |
$el.hide();
|
| 688 |
break;
|
| 689 |
}
|
|
|
|
| 690 |
}
|
| 691 |
}
|
| 692 |
|
| 1 |
/**
|
| 2 |
* @see WPToolset_Forms_Conditional (classes/conditional.php)
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/js/conditional.js $
|
| 5 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 6 |
+
* $LastChangedRevision: 1125405 $
|
| 7 |
+
* $LastChangedBy: iworks $ Riccardo
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
var wptCondTriggers = {}
|
| 147 |
console.log('radio', radio);
|
| 148 |
}
|
| 149 |
break;
|
| 150 |
+
case 'select':
|
| 151 |
option = $('[name="' + $trigger.attr('name') + '"] option:selected', formID);
|
| 152 |
// If no option was selected, the value should be empty
|
| 153 |
val = '';
|
| 154 |
if (wptCondDebug) {
|
| 155 |
console.log('option', option);
|
| 156 |
+
}
|
| 157 |
if (option.length == 1) {
|
| 158 |
if ('undefined' == typeof (option.data('types-value'))) {
|
| 159 |
val = option.val();
|
| 168 |
} else {
|
| 169 |
val.push($(this).data('types-value'));
|
| 170 |
}
|
| 171 |
+
});
|
| 172 |
}
|
| 173 |
break;
|
| 174 |
case 'checkbox':
|
| 525 |
|
| 526 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/193595717/comments
|
| 527 |
//group issue on select
|
| 528 |
+
if (false) {
|
| 529 |
+
if ($trigger.is('select') && !$trigger.attr('multiple')) {
|
| 530 |
+
$("#" + $trigger.attr('id') + " > option").each(function () {
|
| 531 |
+
//console.log(value + " " + this.text + ' ' + this.value + ' ' + $(this).data('typesValue'));
|
| 532 |
+
if ($(this).data('typesValue') && $(this).data('typesValue') == value || this.text==value || value==this.value)
|
| 533 |
+
value = this.text;
|
| 534 |
+
});
|
| 535 |
+
}
|
| 536 |
}
|
| 537 |
//#####################################################################################
|
| 538 |
|
| 599 |
});
|
| 600 |
|
| 601 |
var result = false;
|
| 602 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196173370/comments#309696464
|
| 603 |
+
//Added a new check using text element on select
|
| 604 |
+
var result2 = false;
|
| 605 |
|
| 606 |
try {
|
| 607 |
var parser = new ToolsetParser.Expression(expression);
|
| 611 |
catch (e) {
|
| 612 |
console.info("Error in Tokenizer", e, expression, " there may be an error in your expression syntax");
|
| 613 |
}
|
| 614 |
+
|
| 615 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196173370/comments#309696464
|
| 616 |
+
//Added a new check using text element on select
|
| 617 |
+
// Get the values and update the expression.
|
| 618 |
+
_.each(c.triggers, function (t) {
|
| 619 |
+
var $trigger = _getTrigger(t, formID),
|
| 620 |
+
value = _getTriggerValue($trigger, formID),
|
| 621 |
+
is_array = $trigger.length > 1 ? true : false;
|
| 622 |
+
if (wptCondDebug) {
|
| 623 |
+
console.log("The value is ", value, " for element: ", t, $trigger);
|
| 624 |
+
}
|
| 625 |
|
| 626 |
+
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/193595717/comments
|
| 627 |
+
//group issue on select
|
| 628 |
+
if ($trigger.is('select') && !$trigger.attr('multiple')) {
|
| 629 |
+
$("#" + $trigger.attr('id') + " > option").each(function () {
|
| 630 |
+
//console.log(value + " " + this.text + ' ' + this.value + ' ' + $(this).data('typesValue'));
|
| 631 |
+
if ($(this).data('typesValue') && $(this).data('typesValue') == value || this.text==value || value==this.value)
|
| 632 |
+
value = this.text;
|
| 633 |
+
});
|
| 634 |
+
}
|
| 635 |
+
//#####################################################################################
|
| 636 |
+
|
| 637 |
+
if (typeof value != 'undefined') {
|
| 638 |
+
|
| 639 |
+
// make it a string by wrapping in quotes if
|
| 640 |
+
// 1. the value is an empty string
|
| 641 |
+
// 2. or it's not a number
|
| 642 |
+
|
| 643 |
+
// if the trigger is an array, eg checkboxes
|
| 644 |
+
// then convert value to ARRAY(...)
|
| 645 |
+
|
| 646 |
+
|
| 647 |
+
if (is_array === true) {
|
| 648 |
+
|
| 649 |
+
var val_array = '';
|
| 650 |
+
|
| 651 |
+
if (wptCondDebug) {
|
| 652 |
+
console.log();
|
| 653 |
+
}
|
| 654 |
+
|
| 655 |
+
if (value instanceof Array) {
|
| 656 |
+
for (var i = 0; i < value.length; i++) {
|
| 657 |
+
var val = value[i];
|
| 658 |
+
if (val === '' || isNaN(val)) {
|
| 659 |
+
val = '\'' + val + '\'';
|
| 660 |
+
}
|
| 661 |
+
|
| 662 |
+
if (val_array == '') {
|
| 663 |
+
val_array = val;
|
| 664 |
+
} else {
|
| 665 |
+
val_array += ',' + val;
|
| 666 |
+
}
|
| 667 |
+
}
|
| 668 |
+
} else {
|
| 669 |
+
if (isNaN(value)) {
|
| 670 |
+
value = '\'' + value + '\'';
|
| 671 |
+
}
|
| 672 |
+
val_array = value;
|
| 673 |
+
}
|
| 674 |
+
|
| 675 |
+
value = 'ARRAY(' + val_array + ')';
|
| 676 |
+
|
| 677 |
+
}
|
| 678 |
+
else
|
| 679 |
+
{
|
| 680 |
+
if (value === '' || isNaN(value)) {
|
| 681 |
+
value = '\'' + value + '\'';
|
| 682 |
+
}
|
| 683 |
+
}
|
| 684 |
+
|
| 685 |
+
// First replace the $(field_name) format
|
| 686 |
+
var replace = new RegExp('\\$\\(' + t + '\\)', 'g');
|
| 687 |
+
|
| 688 |
+
expression = expression.replace(replace, value);
|
| 689 |
+
|
| 690 |
+
// next replace the $field_name format
|
| 691 |
+
var replace_old = new RegExp('\\$' + t, 'g');
|
| 692 |
+
|
| 693 |
+
expression = expression.replace(replace_old, value);
|
| 694 |
+
|
| 695 |
+
}
|
| 696 |
+
|
| 697 |
+
});
|
| 698 |
+
|
| 699 |
+
try {
|
| 700 |
+
var parser = new ToolsetParser.Expression(expression);
|
| 701 |
+
parser.parse();
|
| 702 |
+
result2 = parser.eval();
|
| 703 |
+
}
|
| 704 |
+
catch (e) {
|
| 705 |
+
console.info("Error in Tokenizer", e, expression, " there may be an error in your expression syntax");
|
| 706 |
+
}
|
| 707 |
+
|
| 708 |
+
_showHide(result||result2, _getAffected(field, formID));
|
| 709 |
|
| 710 |
});
|
| 711 |
wptCallbacks.conditionalCheck.fire(formID);
|
| 714 |
function _showHide(show, $el)
|
| 715 |
{
|
| 716 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/193353994/comments#302703480
|
| 717 |
+
|
| 718 |
+
//TODO: check this cause side effect
|
| 719 |
+
/*if (jQuery('.wpt-form-error').length) {
|
| 720 |
jQuery('.wpt-form-error').hide();
|
| 721 |
+
}*/
|
| 722 |
|
| 723 |
if (wptCondDebug) {
|
| 724 |
console.info('_showHide');
|
| 736 |
}
|
| 737 |
|
| 738 |
if (show) {
|
| 739 |
+
if ( $el.hasClass('wpt-date') && 'object' == typeof wptDate) {
|
| 740 |
+
$('.js-wpt-date', $el).removeAttr('disabled');
|
| 741 |
+
wptDate.init('body');
|
| 742 |
+
}
|
| 743 |
$el.addClass('wpt-conditional-visible').removeClass('wpt-conditional-hidden js-wpt-remove-on-submit js-wpt-validation-ignore');
|
| 744 |
switch (effectmode) {
|
| 745 |
case 'fade-slide':
|
| 765 |
$el.show();
|
| 766 |
break;
|
| 767 |
}
|
| 768 |
+
$($el).find('input, textarea, button, select').prop("disabled", false);
|
| 769 |
} else {
|
| 770 |
$el.addClass('wpt-conditional-hidden js-wpt-remove-on-submit js-wpt-validation-ignore').removeClass('wpt-conditional-visible');
|
| 771 |
switch (effectmode) {
|
| 792 |
$el.hide();
|
| 793 |
break;
|
| 794 |
}
|
| 795 |
+
$($el).find('input, textarea, button, select').attr('disabled','disabled');
|
| 796 |
}
|
| 797 |
}
|
| 798 |
|
embedded/common/toolset-forms/js/date.js
CHANGED
|
@@ -107,7 +107,7 @@ var wptDate = (function ($) {
|
|
| 107 |
yearRange: wptDateData.yearMin + ':' + wptDateData.yearMax,
|
| 108 |
beforeShow: function(input) {
|
| 109 |
$(input).css({
|
| 110 |
-
zIndex:
|
| 111 |
})
|
| 112 |
}
|
| 113 |
});
|
| 107 |
yearRange: wptDateData.yearMin + ':' + wptDateData.yearMax,
|
| 108 |
beforeShow: function(input) {
|
| 109 |
$(input).css({
|
| 110 |
+
zIndex: 159999 // media library has z-index 160000
|
| 111 |
})
|
| 112 |
}
|
| 113 |
});
|
embedded/common/toolset-forms/js/file-wp35.js
ADDED
|
@@ -0,0 +1,98 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
*
|
| 3 |
+
* $HeadURL: https://www.onthegosystems.com/misc_svn/common/trunk/toolset-forms/js/file-wp35.js $
|
| 4 |
+
* $LastChangedDate: 2015-02-18 12:50:24 +0100 (Wed, 18 Feb 2015) $
|
| 5 |
+
* $LastChangedRevision: 31718 $
|
| 6 |
+
* $LastChangedBy: marcin $
|
| 7 |
+
*
|
| 8 |
+
*/
|
| 9 |
+
var wptFile = (function($, w) {
|
| 10 |
+
var frame = [];
|
| 11 |
+
var $item, $parent, $preview;
|
| 12 |
+
|
| 13 |
+
function init() {
|
| 14 |
+
// Fetch available headers and apply jQuery.masonry
|
| 15 |
+
// once the images have loaded.
|
| 16 |
+
var $headers = $('.available-headers');
|
| 17 |
+
|
| 18 |
+
$headers.imagesLoaded( function() {
|
| 19 |
+
$headers.masonry({
|
| 20 |
+
itemSelector: '.default-header',
|
| 21 |
+
isRTL: !! ( 'undefined' != typeof isRtl && isRtl )
|
| 22 |
+
});
|
| 23 |
+
});
|
| 24 |
+
/*
|
| 25 |
+
$('.js-wpt-field').on('click', 'a.js-wpt-file-upload', function() {
|
| 26 |
+
if ( $(this).data('attched-thickbox') ) {
|
| 27 |
+
return;
|
| 28 |
+
}
|
| 29 |
+
return wptFile.open(this, true);
|
| 30 |
+
});
|
| 31 |
+
*/
|
| 32 |
+
// Build the choose from library frame.
|
| 33 |
+
$('.js-wpt-field').on('click', 'a.js-wpt-file-upload', function( event ) {
|
| 34 |
+
var $el = $(this);
|
| 35 |
+
var $type = $el.data('wpt-type');
|
| 36 |
+
var $id = $el.parent().attr('id');
|
| 37 |
+
event.preventDefault();
|
| 38 |
+
|
| 39 |
+
// If the media frame already exists, reopen it.
|
| 40 |
+
if ( frame[$id] ) {
|
| 41 |
+
frame[$id].open();
|
| 42 |
+
return;
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
// Create the media frame.
|
| 46 |
+
frame[$id] = wp.media.frames.customHeader = wp.media({
|
| 47 |
+
// Set the title of the modal.
|
| 48 |
+
title: $el.html(),
|
| 49 |
+
|
| 50 |
+
// Tell the modal to show only images.
|
| 51 |
+
library: {
|
| 52 |
+
type: 'file' == $type? null:$type
|
| 53 |
+
},
|
| 54 |
+
|
| 55 |
+
// Customize the submit button.
|
| 56 |
+
button: {
|
| 57 |
+
// Set the text of the button.
|
| 58 |
+
text: $el.data('update'),
|
| 59 |
+
// Tell the button not to close the modal, since we're
|
| 60 |
+
// going to refresh the page when the image is selected.
|
| 61 |
+
close: false
|
| 62 |
+
}
|
| 63 |
+
});
|
| 64 |
+
|
| 65 |
+
// When an image is selected, run a callback.
|
| 66 |
+
frame[$id].on( 'select', function() {
|
| 67 |
+
// Grab the selected attachment.
|
| 68 |
+
var attachment = frame[$id].state().get('selection').first();
|
| 69 |
+
var $parent = $el.parent();
|
| 70 |
+
switch( $type ) {
|
| 71 |
+
case 'image':
|
| 72 |
+
$('.textfield', $parent).val(attachment.attributes.sizes.full.url);
|
| 73 |
+
if ( 0 == $('.wpt-file-preview img', $parent.parent()).length) {
|
| 74 |
+
$('.wpt-file-preview', $parent.parent()).append('<img src="">');
|
| 75 |
+
}
|
| 76 |
+
if ( 'undefined' != typeof attachment.attributes.sizes.thumbnail ) {
|
| 77 |
+
$('.wpt-file-preview img', $parent.parent()).attr('src', attachment.attributes.sizes.thumbnail.url);
|
| 78 |
+
} else {
|
| 79 |
+
$('.wpt-file-preview img', $parent.parent()).attr('src', attachment.attributes.sizes.full.url);
|
| 80 |
+
}
|
| 81 |
+
break;
|
| 82 |
+
default:
|
| 83 |
+
$('.textfield', $parent).val(attachment.attributes.url);
|
| 84 |
+
break;
|
| 85 |
+
}
|
| 86 |
+
frame[$id].close();
|
| 87 |
+
});
|
| 88 |
+
|
| 89 |
+
frame[$id].open();
|
| 90 |
+
});
|
| 91 |
+
}
|
| 92 |
+
return {
|
| 93 |
+
init: init,
|
| 94 |
+
};
|
| 95 |
+
})(jQuery);
|
| 96 |
+
|
| 97 |
+
jQuery(document).ready(wptFile.init);
|
| 98 |
+
|
embedded/common/toolset-forms/js/file.js
DELETED
|
@@ -1,68 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
*
|
| 3 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.5.1/embedded/common/toolset-forms/js/file.js $
|
| 4 |
-
* $LastChangedDate: 2014-08-22 01:02:43 +0000 (Fri, 22 Aug 2014) $
|
| 5 |
-
* $LastChangedRevision: 970205 $
|
| 6 |
-
* $LastChangedBy: brucepearson $
|
| 7 |
-
*
|
| 8 |
-
*/
|
| 9 |
-
var wptFile = (function($, w) {
|
| 10 |
-
var $item, $parent, $preview;
|
| 11 |
-
function init() {
|
| 12 |
-
$('.js-wpt-field').on('click', 'a.js-wpt-file-upload', function() {
|
| 13 |
-
if ( $(this).data('attched-thickbox') ) {
|
| 14 |
-
return;
|
| 15 |
-
}
|
| 16 |
-
return wptFile.open(this, true);
|
| 17 |
-
});
|
| 18 |
-
}
|
| 19 |
-
function initRow(row) {
|
| 20 |
-
$('.js-wpt-field', row).on('click', 'a.js-wpt-file-upload', function() {
|
| 21 |
-
$(this).data('attched-thickbox', true );
|
| 22 |
-
return wptFile.open(this, true);
|
| 23 |
-
});
|
| 24 |
-
}
|
| 25 |
-
function mediaInsert(url, type) {
|
| 26 |
-
$(':input', $item).first().val(url);
|
| 27 |
-
if (type == 'image') {
|
| 28 |
-
$preview.html('<img src="' + url + '" />');
|
| 29 |
-
} else {
|
| 30 |
-
$preview.html('');
|
| 31 |
-
}
|
| 32 |
-
tb_remove();
|
| 33 |
-
}
|
| 34 |
-
function mediaInsertTrigger(guid, type) {
|
| 35 |
-
window.parent.wptFile.mediaInsert(guid, type);
|
| 36 |
-
window.parent.jQuery('#TB_closeWindowButton').trigger('click');
|
| 37 |
-
}
|
| 38 |
-
function open(el)
|
| 39 |
-
{
|
| 40 |
-
height = $('body').height()-20;
|
| 41 |
-
if ( 800 < height ) {
|
| 42 |
-
height = 800;
|
| 43 |
-
}
|
| 44 |
-
width = $('body').width()-20;
|
| 45 |
-
if ( 670 < width ) {
|
| 46 |
-
width = 670;
|
| 47 |
-
}
|
| 48 |
-
$item = $(el).parents('.js-wpt-field-item');
|
| 49 |
-
$parent = $item.parents('.js-wpt-field');
|
| 50 |
-
$preview = $('.js-wpt-file-preview', $item);
|
| 51 |
-
type = 'file';
|
| 52 |
-
if ( $(el).data('wpt-type') ) {
|
| 53 |
-
type = $(el).data('wpt-type');
|
| 54 |
-
}
|
| 55 |
-
tb_show(wptFileData.title, wptFileData.adminurl + 'media-upload.php?' + wptFileData.for_post + 'type='+type+'&context=wpt-fields-media-insert&wpt[id]=' + $parent.data('wpt-id') + '&wpt[type]=' + $parent.data('wpt-type') + '&TB_iframe=true&width='+width+'&height='+height);
|
| 56 |
-
return false;
|
| 57 |
-
}
|
| 58 |
-
return {
|
| 59 |
-
init: init,
|
| 60 |
-
initRow: initRow,
|
| 61 |
-
open: open,
|
| 62 |
-
mediaInsert: mediaInsert,
|
| 63 |
-
mediaInsertTrigger: mediaInsertTrigger
|
| 64 |
-
};
|
| 65 |
-
})(jQuery);
|
| 66 |
-
|
| 67 |
-
jQuery(document).ready(wptFile.init);
|
| 68 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/toolset-forms/js/jquery.autocomplete.js
DELETED
|
@@ -1,507 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
original jQuery plugin by http://www.pengoworks.com/workshop/jquery/autocomplete.htm
|
| 3 |
-
just replaced $ with jQuery in order to be complaint with other JavaScript libraries.
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
jQuery.autocomplete = function(input, options) {
|
| 7 |
-
// Create a link to self
|
| 8 |
-
var me = this;
|
| 9 |
-
|
| 10 |
-
// Create jQuery object for input element
|
| 11 |
-
var $input = jQuery(input).attr("autocomplete", "off");
|
| 12 |
-
|
| 13 |
-
// Apply inputClass if necessary
|
| 14 |
-
if (options.inputClass) $input.addClass(options.inputClass);
|
| 15 |
-
|
| 16 |
-
// Create results
|
| 17 |
-
var results = document.createElement("div");
|
| 18 |
-
// Create jQuery object for results
|
| 19 |
-
var $results = jQuery(results);
|
| 20 |
-
$results.hide().addClass(options.resultsClass).css("position", "absolute");
|
| 21 |
-
if( options.width > 0 ) $results.css("width", options.width);
|
| 22 |
-
|
| 23 |
-
// Add to body element
|
| 24 |
-
jQuery("body").append(results);
|
| 25 |
-
|
| 26 |
-
input.autocompleter = me;
|
| 27 |
-
|
| 28 |
-
var timeout = null;
|
| 29 |
-
var prev = "";
|
| 30 |
-
var active = -1;
|
| 31 |
-
var cache = {};
|
| 32 |
-
var keyb = false;
|
| 33 |
-
var hasFocus = false;
|
| 34 |
-
var lastKeyPressCode = null;
|
| 35 |
-
|
| 36 |
-
// flush cache
|
| 37 |
-
function flushCache(){
|
| 38 |
-
cache = {};
|
| 39 |
-
cache.data = {};
|
| 40 |
-
cache.length = 0;
|
| 41 |
-
};
|
| 42 |
-
|
| 43 |
-
// flush cache
|
| 44 |
-
flushCache();
|
| 45 |
-
|
| 46 |
-
// if there is a data array supplied
|
| 47 |
-
if( options.data != null ){
|
| 48 |
-
var sFirstChar = "", stMatchSets = {}, row = [];
|
| 49 |
-
|
| 50 |
-
// no url was specified, we need to adjust the cache length to make sure it fits the local data store
|
| 51 |
-
if( typeof options.url != "string" ) options.cacheLength = 1;
|
| 52 |
-
|
| 53 |
-
// loop through the array and create a lookup structure
|
| 54 |
-
for( var i=0; i < options.data.length; i++ ){
|
| 55 |
-
// if row is a string, make an array otherwise just reference the array
|
| 56 |
-
row = ((typeof options.data[i] == "string") ? [options.data[i]] : options.data[i]);
|
| 57 |
-
|
| 58 |
-
// if the length is zero, don't add to list
|
| 59 |
-
if( row[0].length > 0 ){
|
| 60 |
-
// get the first character
|
| 61 |
-
sFirstChar = row[0].substring(0, 1).toLowerCase();
|
| 62 |
-
// if no lookup array for this character exists, look it up now
|
| 63 |
-
if( !stMatchSets[sFirstChar] ) stMatchSets[sFirstChar] = [];
|
| 64 |
-
// if the match is a string
|
| 65 |
-
stMatchSets[sFirstChar].push(row);
|
| 66 |
-
}
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
// add the data items to the cache
|
| 70 |
-
for( var k in stMatchSets ){
|
| 71 |
-
// increase the cache size
|
| 72 |
-
options.cacheLength++;
|
| 73 |
-
// add to the cache
|
| 74 |
-
addToCache(k, stMatchSets[k]);
|
| 75 |
-
}
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
$input
|
| 79 |
-
.keydown(function(e) {
|
| 80 |
-
// track last key pressed
|
| 81 |
-
lastKeyPressCode = e.keyCode;
|
| 82 |
-
switch(e.keyCode) {
|
| 83 |
-
case 38: // up
|
| 84 |
-
e.preventDefault();
|
| 85 |
-
moveSelect(-1);
|
| 86 |
-
break;
|
| 87 |
-
case 40: // down
|
| 88 |
-
e.preventDefault();
|
| 89 |
-
moveSelect(1);
|
| 90 |
-
break;
|
| 91 |
-
case 9: // tab
|
| 92 |
-
case 13: // return
|
| 93 |
-
if( selectCurrent() ){
|
| 94 |
-
// make sure to blur off the current field
|
| 95 |
-
$input.get(0).blur();
|
| 96 |
-
e.preventDefault();
|
| 97 |
-
}
|
| 98 |
-
break;
|
| 99 |
-
default:
|
| 100 |
-
active = -1;
|
| 101 |
-
if (timeout) clearTimeout(timeout);
|
| 102 |
-
timeout = setTimeout(function(){onChange();}, options.delay);
|
| 103 |
-
break;
|
| 104 |
-
}
|
| 105 |
-
})
|
| 106 |
-
.focus(function(){
|
| 107 |
-
// track whether the field has focus, we shouldn't process any results if the field no longer has focus
|
| 108 |
-
hasFocus = true;
|
| 109 |
-
})
|
| 110 |
-
.blur(function() {
|
| 111 |
-
// track whether the field has focus
|
| 112 |
-
hasFocus = false;
|
| 113 |
-
hideResults();
|
| 114 |
-
});
|
| 115 |
-
|
| 116 |
-
hideResultsNow();
|
| 117 |
-
|
| 118 |
-
function onChange() {
|
| 119 |
-
// ignore if the following keys are pressed: [del] [shift] [capslock]
|
| 120 |
-
if( lastKeyPressCode == 46 || (lastKeyPressCode > 8 && lastKeyPressCode < 32) ) return $results.hide();
|
| 121 |
-
var v = $input.val();
|
| 122 |
-
if (v == prev) return;
|
| 123 |
-
prev = v;
|
| 124 |
-
if (v.length >= options.minChars) {
|
| 125 |
-
$input.addClass(options.loadingClass);
|
| 126 |
-
requestData(v);
|
| 127 |
-
} else {
|
| 128 |
-
$input.removeClass(options.loadingClass);
|
| 129 |
-
$results.hide();
|
| 130 |
-
}
|
| 131 |
-
};
|
| 132 |
-
|
| 133 |
-
function moveSelect(step) {
|
| 134 |
-
|
| 135 |
-
var lis = jQuery("li", results);
|
| 136 |
-
if (!lis) return;
|
| 137 |
-
|
| 138 |
-
active += step;
|
| 139 |
-
|
| 140 |
-
if (active < 0) {
|
| 141 |
-
active = 0;
|
| 142 |
-
} else if (active >= lis.size()) {
|
| 143 |
-
active = lis.size() - 1;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
lis.removeClass("ac_over");
|
| 147 |
-
|
| 148 |
-
jQuery(lis[active]).addClass("ac_over");
|
| 149 |
-
|
| 150 |
-
// Weird behaviour in IE
|
| 151 |
-
// if (lis[active] && lis[active].scrollIntoView) {
|
| 152 |
-
// lis[active].scrollIntoView(false);
|
| 153 |
-
// }
|
| 154 |
-
|
| 155 |
-
};
|
| 156 |
-
|
| 157 |
-
function selectCurrent() {
|
| 158 |
-
var li = jQuery("li.ac_over", results)[0];
|
| 159 |
-
if (!li) {
|
| 160 |
-
var $li = jQuery("li", results);
|
| 161 |
-
if (options.selectOnly) {
|
| 162 |
-
if ($li.length == 1) li = $li[0];
|
| 163 |
-
} else if (options.selectFirst) {
|
| 164 |
-
li = $li[0];
|
| 165 |
-
}
|
| 166 |
-
}
|
| 167 |
-
if (li) {
|
| 168 |
-
selectItem(li);
|
| 169 |
-
return true;
|
| 170 |
-
} else {
|
| 171 |
-
return false;
|
| 172 |
-
}
|
| 173 |
-
};
|
| 174 |
-
|
| 175 |
-
function selectItem(li) {
|
| 176 |
-
if (!li) {
|
| 177 |
-
li = document.createElement("li");
|
| 178 |
-
li.extra = [];
|
| 179 |
-
li.selectValue = "";
|
| 180 |
-
}
|
| 181 |
-
var v = jQuery.trim(li.selectValue ? li.selectValue : li.innerHTML);
|
| 182 |
-
input.lastSelected = v;
|
| 183 |
-
prev = v;
|
| 184 |
-
$results.html("");
|
| 185 |
-
$input.val(v);
|
| 186 |
-
hideResultsNow();
|
| 187 |
-
if (options.onItemSelect) setTimeout(function() { options.onItemSelect(li) }, 1);
|
| 188 |
-
};
|
| 189 |
-
|
| 190 |
-
// selects a portion of the input string
|
| 191 |
-
function createSelection(start, end){
|
| 192 |
-
// get a reference to the input element
|
| 193 |
-
var field = $input.get(0);
|
| 194 |
-
if( field.createTextRange ){
|
| 195 |
-
var selRange = field.createTextRange();
|
| 196 |
-
selRange.collapse(true);
|
| 197 |
-
selRange.moveStart("character", start);
|
| 198 |
-
selRange.moveEnd("character", end);
|
| 199 |
-
selRange.select();
|
| 200 |
-
} else if( field.setSelectionRange ){
|
| 201 |
-
field.setSelectionRange(start, end);
|
| 202 |
-
} else {
|
| 203 |
-
if( field.selectionStart ){
|
| 204 |
-
field.selectionStart = start;
|
| 205 |
-
field.selectionEnd = end;
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
field.focus();
|
| 209 |
-
};
|
| 210 |
-
|
| 211 |
-
// fills in the input box w/the first match (assumed to be the best match)
|
| 212 |
-
function autoFill(sValue){
|
| 213 |
-
// if the last user key pressed was backspace, don't autofill
|
| 214 |
-
if( lastKeyPressCode != 8 ){
|
| 215 |
-
// fill in the value (keep the case the user has typed)
|
| 216 |
-
$input.val($input.val() + sValue.substring(prev.length));
|
| 217 |
-
// select the portion of the value not typed by the user (so the next character will erase)
|
| 218 |
-
createSelection(prev.length, sValue.length);
|
| 219 |
-
}
|
| 220 |
-
};
|
| 221 |
-
|
| 222 |
-
function showResults() {
|
| 223 |
-
// get the position of the input field right now (in case the DOM is shifted)
|
| 224 |
-
var pos = findPos(input);
|
| 225 |
-
// either use the specified width, or autocalculate based on form element
|
| 226 |
-
var iWidth = (options.width > 0) ? options.width : $input.width();
|
| 227 |
-
// reposition
|
| 228 |
-
$results.css({
|
| 229 |
-
width: parseInt(iWidth) + "px",
|
| 230 |
-
top: (pos.y + input.offsetHeight + 28) + "px",
|
| 231 |
-
left: pos.x + "px"
|
| 232 |
-
}).show();
|
| 233 |
-
};
|
| 234 |
-
|
| 235 |
-
function hideResults() {
|
| 236 |
-
if (timeout) clearTimeout(timeout);
|
| 237 |
-
timeout = setTimeout(hideResultsNow, 200);
|
| 238 |
-
};
|
| 239 |
-
|
| 240 |
-
function hideResultsNow() {
|
| 241 |
-
if (timeout) clearTimeout(timeout);
|
| 242 |
-
$input.removeClass(options.loadingClass);
|
| 243 |
-
if ($results.is(":visible")) {
|
| 244 |
-
$results.hide();
|
| 245 |
-
}
|
| 246 |
-
if (options.mustMatch) {
|
| 247 |
-
var v = $input.val();
|
| 248 |
-
if (v != input.lastSelected) {
|
| 249 |
-
selectItem(null);
|
| 250 |
-
}
|
| 251 |
-
}
|
| 252 |
-
};
|
| 253 |
-
|
| 254 |
-
function receiveData(q, data) {
|
| 255 |
-
if (data) {
|
| 256 |
-
$input.removeClass(options.loadingClass);
|
| 257 |
-
results.innerHTML = "";
|
| 258 |
-
|
| 259 |
-
// if the field no longer has focus or if there are no matches, do not display the drop down
|
| 260 |
-
if( !hasFocus || data.length == 0 ) return hideResultsNow();
|
| 261 |
-
|
| 262 |
-
if (jQuery.browser.msie) {
|
| 263 |
-
// we put a styled iframe behind the calendar so HTML SELECT elements don't show through
|
| 264 |
-
$results.append(document.createElement('iframe'));
|
| 265 |
-
}
|
| 266 |
-
results.appendChild(dataToDom(data));
|
| 267 |
-
// autofill in the complete box w/the first match as long as the user hasn't entered in more data
|
| 268 |
-
if( options.autoFill && ($input.val().toLowerCase() == q.toLowerCase()) ) autoFill(data[0][0]);
|
| 269 |
-
showResults();
|
| 270 |
-
} else {
|
| 271 |
-
hideResultsNow();
|
| 272 |
-
}
|
| 273 |
-
};
|
| 274 |
-
|
| 275 |
-
function parseData(data) {
|
| 276 |
-
if (!data) return null;
|
| 277 |
-
var parsed = [];
|
| 278 |
-
var rows = data.split(options.lineSeparator);
|
| 279 |
-
for (var i=0; i < rows.length; i++) {
|
| 280 |
-
var row = jQuery.trim(rows[i]);
|
| 281 |
-
if (row) {
|
| 282 |
-
parsed[parsed.length] = row.split(options.cellSeparator);
|
| 283 |
-
}
|
| 284 |
-
}
|
| 285 |
-
return parsed;
|
| 286 |
-
};
|
| 287 |
-
|
| 288 |
-
function dataToDom(data) {
|
| 289 |
-
var ul = document.createElement("ul");
|
| 290 |
-
var num = data.length;
|
| 291 |
-
|
| 292 |
-
// limited results to a max number
|
| 293 |
-
if( (options.maxItemsToShow > 0) && (options.maxItemsToShow < num) ) num = options.maxItemsToShow;
|
| 294 |
-
|
| 295 |
-
for (var i=0; i < num; i++) {
|
| 296 |
-
var row = data[i];
|
| 297 |
-
if (!row) continue;
|
| 298 |
-
var li = document.createElement("li");
|
| 299 |
-
if (options.formatItem) {
|
| 300 |
-
li.innerHTML = options.formatItem(row, i, num);
|
| 301 |
-
li.selectValue = row[0];
|
| 302 |
-
} else {
|
| 303 |
-
li.innerHTML = row[0];
|
| 304 |
-
li.selectValue = row[0];
|
| 305 |
-
}
|
| 306 |
-
var extra = null;
|
| 307 |
-
if (row.length > 1) {
|
| 308 |
-
extra = [];
|
| 309 |
-
for (var j=1; j < row.length; j++) {
|
| 310 |
-
extra[extra.length] = row[j];
|
| 311 |
-
}
|
| 312 |
-
}
|
| 313 |
-
li.extra = extra;
|
| 314 |
-
ul.appendChild(li);
|
| 315 |
-
jQuery(li).hover(
|
| 316 |
-
function() { jQuery("li", ul).removeClass("ac_over"); jQuery(this).addClass("ac_over"); active = jQuery("li", ul).indexOf(jQuery(this).get(0)); },
|
| 317 |
-
function() { jQuery(this).removeClass("ac_over"); }
|
| 318 |
-
).click(function(e) { e.preventDefault(); e.stopPropagation(); selectItem(this) });
|
| 319 |
-
}
|
| 320 |
-
return ul;
|
| 321 |
-
};
|
| 322 |
-
|
| 323 |
-
function requestData(q) {
|
| 324 |
-
if (!options.matchCase) q = q.toLowerCase();
|
| 325 |
-
var data = options.cacheLength ? loadFromCache(q) : null;
|
| 326 |
-
// recieve the cached data
|
| 327 |
-
if (data) {
|
| 328 |
-
receiveData(q, data);
|
| 329 |
-
// if an AJAX url has been supplied, try loading the data now
|
| 330 |
-
} else if( (typeof options.url == "string") && (options.url.length > 0) ){
|
| 331 |
-
jQuery.get(makeUrl(q), function(data) {
|
| 332 |
-
data = parseData(data);
|
| 333 |
-
addToCache(q, data);
|
| 334 |
-
receiveData(q, data);
|
| 335 |
-
});
|
| 336 |
-
// if there's been no data found, remove the loading class
|
| 337 |
-
} else {
|
| 338 |
-
$input.removeClass(options.loadingClass);
|
| 339 |
-
}
|
| 340 |
-
};
|
| 341 |
-
|
| 342 |
-
function makeUrl(q) {
|
| 343 |
-
var url = options.url + "?q=" + encodeURI(q);
|
| 344 |
-
for (var i in options.extraParams) {
|
| 345 |
-
url += "&" + i + "=" + encodeURI(options.extraParams[i]);
|
| 346 |
-
}
|
| 347 |
-
return url;
|
| 348 |
-
};
|
| 349 |
-
|
| 350 |
-
function loadFromCache(q) {
|
| 351 |
-
if (!q) return null;
|
| 352 |
-
if (cache.data[q]) return cache.data[q];
|
| 353 |
-
if (options.matchSubset) {
|
| 354 |
-
for (var i = q.length - 1; i >= options.minChars; i--) {
|
| 355 |
-
var qs = q.substr(0, i);
|
| 356 |
-
var c = cache.data[qs];
|
| 357 |
-
if (c) {
|
| 358 |
-
var csub = [];
|
| 359 |
-
for (var j = 0; j < c.length; j++) {
|
| 360 |
-
var x = c[j];
|
| 361 |
-
var x0 = x[0];
|
| 362 |
-
if (matchSubset(x0, q)) {
|
| 363 |
-
csub[csub.length] = x;
|
| 364 |
-
}
|
| 365 |
-
}
|
| 366 |
-
return csub;
|
| 367 |
-
}
|
| 368 |
-
}
|
| 369 |
-
}
|
| 370 |
-
return null;
|
| 371 |
-
};
|
| 372 |
-
|
| 373 |
-
function matchSubset(s, sub) {
|
| 374 |
-
if (!options.matchCase) s = s.toLowerCase();
|
| 375 |
-
var i = s.indexOf(sub);
|
| 376 |
-
if (i == -1) return false;
|
| 377 |
-
return i == 0 || options.matchContains;
|
| 378 |
-
};
|
| 379 |
-
|
| 380 |
-
this.flushCache = function() {
|
| 381 |
-
flushCache();
|
| 382 |
-
};
|
| 383 |
-
|
| 384 |
-
this.setExtraParams = function(p) {
|
| 385 |
-
options.extraParams = p;
|
| 386 |
-
};
|
| 387 |
-
|
| 388 |
-
this.findValue = function(){
|
| 389 |
-
var q = $input.val();
|
| 390 |
-
|
| 391 |
-
if (!options.matchCase) q = q.toLowerCase();
|
| 392 |
-
var data = options.cacheLength ? loadFromCache(q) : null;
|
| 393 |
-
if (data) {
|
| 394 |
-
findValueCallback(q, data);
|
| 395 |
-
} else if( (typeof options.url == "string") && (options.url.length > 0) ){
|
| 396 |
-
jQuery.get(makeUrl(q), function(data) {
|
| 397 |
-
data = parseData(data)
|
| 398 |
-
addToCache(q, data);
|
| 399 |
-
findValueCallback(q, data);
|
| 400 |
-
});
|
| 401 |
-
} else {
|
| 402 |
-
// no matches
|
| 403 |
-
findValueCallback(q, null);
|
| 404 |
-
}
|
| 405 |
-
}
|
| 406 |
-
|
| 407 |
-
function findValueCallback(q, data){
|
| 408 |
-
if (data) $input.removeClass(options.loadingClass);
|
| 409 |
-
|
| 410 |
-
var num = (data) ? data.length : 0;
|
| 411 |
-
var li = null;
|
| 412 |
-
|
| 413 |
-
for (var i=0; i < num; i++) {
|
| 414 |
-
var row = data[i];
|
| 415 |
-
|
| 416 |
-
if( row[0].toLowerCase() == q.toLowerCase() ){
|
| 417 |
-
li = document.createElement("li");
|
| 418 |
-
if (options.formatItem) {
|
| 419 |
-
li.innerHTML = options.formatItem(row, i, num);
|
| 420 |
-
li.selectValue = row[0];
|
| 421 |
-
} else {
|
| 422 |
-
li.innerHTML = row[0];
|
| 423 |
-
li.selectValue = row[0];
|
| 424 |
-
}
|
| 425 |
-
var extra = null;
|
| 426 |
-
if( row.length > 1 ){
|
| 427 |
-
extra = [];
|
| 428 |
-
for (var j=1; j < row.length; j++) {
|
| 429 |
-
extra[extra.length] = row[j];
|
| 430 |
-
}
|
| 431 |
-
}
|
| 432 |
-
li.extra = extra;
|
| 433 |
-
}
|
| 434 |
-
}
|
| 435 |
-
|
| 436 |
-
if( options.onFindValue ) setTimeout(function() { options.onFindValue(li) }, 1);
|
| 437 |
-
}
|
| 438 |
-
|
| 439 |
-
function addToCache(q, data) {
|
| 440 |
-
if (!data || !q || !options.cacheLength) return;
|
| 441 |
-
if (!cache.length || cache.length > options.cacheLength) {
|
| 442 |
-
flushCache();
|
| 443 |
-
cache.length++;
|
| 444 |
-
} else if (!cache[q]) {
|
| 445 |
-
cache.length++;
|
| 446 |
-
}
|
| 447 |
-
cache.data[q] = data;
|
| 448 |
-
};
|
| 449 |
-
|
| 450 |
-
function findPos(obj) {
|
| 451 |
-
var curleft = obj.offsetLeft || 0;
|
| 452 |
-
var curtop = obj.offsetTop || 0;
|
| 453 |
-
while (obj = obj.offsetParent) {
|
| 454 |
-
curleft += obj.offsetLeft
|
| 455 |
-
curtop += obj.offsetTop
|
| 456 |
-
}
|
| 457 |
-
return {x:curleft,y:curtop};
|
| 458 |
-
}
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
jQuery.fn.autocomplete = function(url, options, data) {
|
| 462 |
-
// Make sure options exists
|
| 463 |
-
options = options || {};
|
| 464 |
-
// Set url as option
|
| 465 |
-
options.url = url;
|
| 466 |
-
// set some bulk local data
|
| 467 |
-
options.data = ((typeof data == "object") && (data.constructor == Array)) ? data : null;
|
| 468 |
-
|
| 469 |
-
// Set default values for required options
|
| 470 |
-
options.inputClass = options.inputClass || "ac_input";
|
| 471 |
-
options.resultsClass = options.resultsClass || "ac_results";
|
| 472 |
-
options.lineSeparator = options.lineSeparator || "\n";
|
| 473 |
-
options.cellSeparator = options.cellSeparator || "|";
|
| 474 |
-
options.minChars = options.minChars || 1;
|
| 475 |
-
options.delay = options.delay || 400;
|
| 476 |
-
options.matchCase = options.matchCase || 0;
|
| 477 |
-
options.matchSubset = options.matchSubset || 1;
|
| 478 |
-
options.matchContains = options.matchContains || 0;
|
| 479 |
-
options.cacheLength = options.cacheLength || 1;
|
| 480 |
-
options.mustMatch = options.mustMatch || 0;
|
| 481 |
-
options.extraParams = options.extraParams || {};
|
| 482 |
-
options.loadingClass = options.loadingClass || "ac_loading";
|
| 483 |
-
options.selectFirst = options.selectFirst || false;
|
| 484 |
-
options.selectOnly = options.selectOnly || false;
|
| 485 |
-
options.maxItemsToShow = options.maxItemsToShow || -1;
|
| 486 |
-
options.autoFill = options.autoFill || false;
|
| 487 |
-
options.width = parseInt(options.width, 10) || 0;
|
| 488 |
-
|
| 489 |
-
this.each(function() {
|
| 490 |
-
var input = this;
|
| 491 |
-
new jQuery.autocomplete(input, options);
|
| 492 |
-
});
|
| 493 |
-
|
| 494 |
-
// Don't break the chain
|
| 495 |
-
return this;
|
| 496 |
-
}
|
| 497 |
-
|
| 498 |
-
jQuery.fn.autocompleteArray = function(data, options) {
|
| 499 |
-
return this.autocomplete(null, options, data);
|
| 500 |
-
}
|
| 501 |
-
|
| 502 |
-
jQuery.fn.indexOf = function(e){
|
| 503 |
-
for( var i=0; i<this.length; i++ ){
|
| 504 |
-
if( this[i] == e ) return i;
|
| 505 |
-
}
|
| 506 |
-
return -1;
|
| 507 |
-
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/toolset-forms/js/main.js
CHANGED
|
@@ -8,9 +8,9 @@ wptCallbacks.removeRepetitive = jQuery.Callbacks('unique');
|
|
| 8 |
wptCallbacks.conditionalCheck = jQuery.Callbacks('unique');
|
| 9 |
wptCallbacks.reset = jQuery.Callbacks('unique');
|
| 10 |
|
| 11 |
-
jQuery(document).ready(function() {
|
| 12 |
if (typeof wptValidation !== 'undefined') {
|
| 13 |
-
wptCallbacks.validationInit.add(function() {
|
| 14 |
wptValidation.init();
|
| 15 |
});
|
| 16 |
}
|
|
@@ -22,9 +22,11 @@ jQuery(document).ready(function() {
|
|
| 22 |
/**
|
| 23 |
* check taxonmies on submitted forms
|
| 24 |
*/
|
| 25 |
-
jQuery('.cred-taxonomy', jQuery('form.is_submitted')).each(function(){
|
| 26 |
parent = jQuery(this);
|
| 27 |
-
setTimeout(
|
|
|
|
|
|
|
| 28 |
});
|
| 29 |
});
|
| 30 |
|
|
@@ -42,8 +44,8 @@ function apply_filters(name, val) {
|
|
| 42 |
if (typeof wptFilters[name] === 'undefined')
|
| 43 |
return val;
|
| 44 |
var args = _.rest(_.toArray(arguments));
|
| 45 |
-
_.each(wptFilters[name], function(funcs, priority) {
|
| 46 |
-
_.each(funcs, function($callback) {
|
| 47 |
var _args = args.slice(0, $callback[1]);
|
| 48 |
args[0] = $callback[0].apply(null, _args);
|
| 49 |
});
|
|
@@ -57,8 +59,8 @@ function do_action(name) {
|
|
| 57 |
if (typeof wptFilters[name] === 'undefined')
|
| 58 |
return false;
|
| 59 |
var args = _.rest(_.toArray(arguments));
|
| 60 |
-
_.each(wptFilters[name], function(funcs, priority) {
|
| 61 |
-
_.each(funcs, function($callback) {
|
| 62 |
var _args = args.slice(0, $callback[1]);
|
| 63 |
$callback[0].apply(null, _args);
|
| 64 |
});
|
|
@@ -75,19 +77,20 @@ function showHideMostPopularButton(taxonomy, form)
|
|
| 75 |
var $taxonomy_box = jQuery('.shmpt-' + taxonomy, form);
|
| 76 |
var $tag_list = $taxonomy_box.find('.js-wpt-taxonomy-popular-add');
|
| 77 |
|
| 78 |
-
if(
|
|
|
|
| 79 |
|
| 80 |
-
if(
|
| 81 |
{
|
| 82 |
$button.show();
|
| 83 |
return true;
|
| 84 |
-
}else{
|
| 85 |
$button.hide();
|
| 86 |
return false;
|
| 87 |
}
|
| 88 |
}
|
| 89 |
|
| 90 |
-
jQuery(document).on('click', '.js-wpt-taxonomy-popular-show-hide', function() {
|
| 91 |
showHideMostPopularTaxonomy(this);
|
| 92 |
});
|
| 93 |
|
|
@@ -95,20 +98,20 @@ function showHideMostPopularTaxonomy(el)
|
|
| 95 |
{
|
| 96 |
var taxonomy = jQuery(el).data('taxonomy');
|
| 97 |
var form = jQuery(el).closest('form');
|
| 98 |
-
jQuery('.shmpt-'+taxonomy, form).toggle();
|
| 99 |
var curr = jQuery(el).val();
|
| 100 |
-
if (curr==jQuery(el).data('show-popular-text')) {
|
| 101 |
jQuery(el).val(jQuery(el).data('hide-popular-text'), form).addClass('btn-cancel');
|
| 102 |
} else {
|
| 103 |
jQuery(el).val(jQuery(el).data('show-popular-text'), form).removeClass('btn-cancel');
|
| 104 |
}
|
| 105 |
}
|
| 106 |
|
| 107 |
-
jQuery(document).on('click', '.js-wpt-taxonomy-popular-add', function() {
|
| 108 |
var thiz = jQuery(this);
|
| 109 |
-
var taxonomy = thiz.data(
|
| 110 |
-
var slug = thiz.data(
|
| 111 |
-
var _name = thiz.data(
|
| 112 |
addTaxonomy(_name, taxonomy, this);
|
| 113 |
return false;
|
| 114 |
});
|
|
@@ -116,79 +119,82 @@ jQuery(document).on('click', '.js-wpt-taxonomy-popular-add', function() {
|
|
| 116 |
function addTaxonomy(slug, taxonomy, el)
|
| 117 |
{
|
| 118 |
var form = jQuery(el).closest('form');
|
| 119 |
-
var curr = jQuery('input[name=tmp_'+taxonomy+']', form).val().trim();
|
| 120 |
-
if (''==curr) {
|
| 121 |
-
jQuery('input[name=tmp_'+taxonomy+']', form).val(slug);
|
| 122 |
setTaxonomy(taxonomy, el);
|
| 123 |
} else {
|
| 124 |
-
if (curr.indexOf(
|
| 125 |
-
jQuery('input[name=tmp_'+taxonomy+']', form).val(curr+','+slug);
|
| 126 |
setTaxonomy(taxonomy, el);
|
| 127 |
}
|
| 128 |
}
|
| 129 |
-
jQuery('input[name=tmp_'+taxonomy+']', form).val('');
|
| 130 |
}
|
| 131 |
|
| 132 |
-
jQuery(document).on('click', '.js-wpt-taxonomy-add-new', function() {
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
});
|
| 137 |
|
| 138 |
-
jQuery(document).on('keypress', '.js-wpt-new-taxonomy-title', function(e) {
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
|
| 152 |
function setTaxonomy(taxonomy, el)
|
| 153 |
{
|
| 154 |
var form = jQuery(el).closest('form');
|
| 155 |
-
var tmp_tax = jQuery('input[name=tmp_'+taxonomy+']', form).val();
|
| 156 |
-
if (tmp_tax.trim()=='')
|
| 157 |
-
|
|
|
|
| 158 |
var arr = tax.split(',');
|
| 159 |
-
if (jQuery.inArray(tmp_tax, arr)
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
jQuery('input[name=
|
|
|
|
| 163 |
updateTaxonomies(taxonomy, form);
|
| 164 |
}
|
| 165 |
|
| 166 |
function updateTaxonomies(taxonomy, form)
|
| 167 |
{
|
| 168 |
-
var taxonomies = jQuery('input[name='+taxonomy+']', form).val();
|
| 169 |
-
jQuery('div.tagchecklist-'+taxonomy, form).html('');
|
| 170 |
-
if (!taxonomies||(taxonomies&&taxonomies.trim()==''))
|
|
|
|
| 171 |
var toshow = taxonomies.split(',');
|
| 172 |
var str = '';
|
| 173 |
-
for (var i=0;i<toshow.length;i++) {
|
| 174 |
var sh = toshow[i].trim();
|
| 175 |
-
str += '<span><a href="#" class=\'ntdelbutton\' data-wpcf-i=\''+i+'\' id=\'post_tag-check-num-'+i+'\'>X</a> '+sh+'</span>';
|
| 176 |
}
|
| 177 |
-
jQuery('div.tagchecklist-'+taxonomy, form).html(str);
|
| 178 |
-
jQuery('div.tagchecklist-'+taxonomy+' a', form).bind('click', function() {
|
| 179 |
-
jQuery('input[name='+taxonomy+']', form).val('');
|
| 180 |
del = jQuery(this).data('wpcf-i');
|
| 181 |
var values = '';
|
| 182 |
-
for(i=0;i<toshow.length;i++
|
| 183 |
-
if (
|
| 184 |
continue;
|
| 185 |
}
|
| 186 |
-
if (
|
| 187 |
values += ',';
|
| 188 |
}
|
| 189 |
values += toshow[i];
|
| 190 |
}
|
| 191 |
-
jQuery('input[name='+taxonomy+']', form).val(values)
|
| 192 |
updateTaxonomies(taxonomy, form);
|
| 193 |
|
| 194 |
return false;
|
|
@@ -198,23 +204,21 @@ function updateTaxonomies(taxonomy, form)
|
|
| 198 |
|
| 199 |
function initTaxonomies(values, taxonomy, url, fieldId)
|
| 200 |
{
|
| 201 |
-
form = jQuery('#'+fieldId.replace(/_field_\d+$/, ''
|
| 202 |
-
jQuery('div.tagchecklist-'+taxonomy).html(values);
|
| 203 |
-
|
|
|
|
| 204 |
updateTaxonomies(taxonomy, form);
|
| 205 |
-
jQuery('input[name=tmp_'+taxonomy+']').
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
autoFill:true
|
| 216 |
-
}
|
| 217 |
-
);
|
| 218 |
}
|
| 219 |
|
| 220 |
toolsetForms.CRED_taxonomy = function () {
|
|
@@ -236,11 +240,11 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 236 |
}
|
| 237 |
|
| 238 |
self._fill_parent_drop_down = function () {
|
| 239 |
-
jQuery('select.js-taxonomy-parent').each
|
| 240 |
var select = jQuery(this);
|
| 241 |
|
| 242 |
// remove all the options
|
| 243 |
-
jQuery(this).find('option').each
|
| 244 |
if (jQuery(this).val() != '-1') {
|
| 245 |
jQuery(this).remove();
|
| 246 |
}
|
|
@@ -249,19 +253,19 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 249 |
var taxonomy = jQuery(this).data('taxonomy');
|
| 250 |
|
| 251 |
// Copy all the checkbox values if it's checkbox mode
|
| 252 |
-
jQuery('input[name="' + taxonomy + '\[\]"]').each
|
| 253 |
var id = jQuery(this).attr('id');
|
| 254 |
var label = jQuery(this).next('label');
|
| 255 |
var level = jQuery(this).closest('ul').data('level');
|
| 256 |
var prefix = '';
|
| 257 |
-
if (
|
| 258 |
prefix = "\xA0\xA0" + Array(level).join("\xA0\xA0");
|
| 259 |
}
|
| 260 |
select.append('<option value="' + jQuery(this).val() + '">' + prefix + label.text() + '</option>');
|
| 261 |
})
|
| 262 |
|
| 263 |
// Copy all the select option values if it's select mode
|
| 264 |
-
jQuery('select[name="' + taxonomy + '\[\]"]').find('option').each
|
| 265 |
var id = jQuery(this).val();
|
| 266 |
var text = jQuery(this).text();
|
| 267 |
select.append('<option value="' + id + '">' + text + '</option>');
|
|
@@ -276,6 +280,9 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 276 |
// replace the taxonomy button placeholders with the actual buttons.
|
| 277 |
jQuery('.js-taxonomy-button-placeholder').each(function () {
|
| 278 |
var placeholder = jQuery(this);
|
|
|
|
|
|
|
|
|
|
| 279 |
var taxonomy = jQuery(this).data('taxonomy');
|
| 280 |
var form = jQuery(this).closest('form');
|
| 281 |
var buttons = jQuery('[name="sh_' + taxonomy + '"],[name="btn_' + taxonomy + '"]', form);
|
|
@@ -286,11 +293,15 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 286 |
buttons.each(function () {
|
| 287 |
var button = jQuery(this, form);
|
| 288 |
|
| 289 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 290 |
placeholder.replaceWith(button);
|
| 291 |
|
| 292 |
if (button.hasClass('js-wpt-taxonomy-popular-show-hide')) {
|
| 293 |
-
if(
|
| 294 |
button.show();
|
| 295 |
}
|
| 296 |
} else {
|
|
@@ -301,56 +312,56 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 301 |
//Responsible of the issue https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188673095/comments
|
| 302 |
//changed selector
|
| 303 |
//var selector = button.data('after-selector');
|
| 304 |
-
selectors.push(
|
| 305 |
if (typeof selector !== 'undefined' && selector.length) {
|
| 306 |
var position = button;
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
|
| 311 |
}
|
| 312 |
})
|
| 313 |
}
|
| 314 |
});
|
| 315 |
}
|
| 316 |
|
| 317 |
-
jQuery(document).on('click', '.js-wpt-hierarchical-taxonomy-add-new-show-hide', function() {
|
| 318 |
-
if (
|
| 319 |
jQuery(this).val(jQuery(this).data('open')).removeClass('btn-cancel');
|
| 320 |
} else {
|
| 321 |
jQuery(this).val(jQuery(this).data('close')).addClass('btn-cancel');
|
| 322 |
}
|
| 323 |
-
var thiz = jQuery(this), taxonomy = thiz.data(
|
| 324 |
-
self.add_new_show_hide(
|
| 325 |
});
|
| 326 |
|
| 327 |
-
self.add_new_show_hide = function (
|
| 328 |
var form = jQuery(button).closest('form');
|
| 329 |
jQuery('.js-wpt-hierarchical-taxonomy-add-new-' + taxonomy, form).toggle();
|
| 330 |
-
self.hide_parent_button_if_no_terms(
|
| 331 |
}
|
| 332 |
|
| 333 |
-
jQuery(document).on('click', '.js-wpt-hierarchical-taxonomy-add-new', function() {
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
});
|
| 338 |
/*
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
|
| 348 |
|
| 349 |
-
self.terms_exist = function(
|
| 350 |
{
|
| 351 |
var form = jQuery(button).closest('form');
|
| 352 |
var build_what = jQuery(button).data('build_what'), parent = jQuery('[name="new_tax_select_' + taxonomy + '"]', form).val();
|
| 353 |
-
if (
|
| 354 |
var first_checkbox = jQuery('input[name="' + taxonomy + '\[\]"][data-parent="' + parent + '"]:first', form);
|
| 355 |
return first_checkbox.length > 0;
|
| 356 |
} else {
|
|
@@ -362,22 +373,22 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 362 |
};
|
| 363 |
|
| 364 |
self._add_new_flag = [];
|
| 365 |
-
self.hide_parent_button_if_no_terms = function(
|
| 366 |
{
|
| 367 |
var form = jQuery(button).closest('form');
|
| 368 |
var form_id = form.attr('id');
|
| 369 |
-
if ('undefined' == typeof self._add_new_flag[form_id]
|
| 370 |
self._add_new_flag[form_id] = '';
|
| 371 |
}
|
| 372 |
self._add_new_flag[form_id] = !self._add_new_flag[form_id];
|
| 373 |
-
if(
|
| 374 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).hide();
|
| 375 |
} else {
|
| 376 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).show();
|
| 377 |
}
|
| 378 |
};
|
| 379 |
|
| 380 |
-
self.add_taxonomy = function (
|
| 381 |
{
|
| 382 |
var form = jQuery(button).closest('form');
|
| 383 |
var new_taxonomy = jQuery('[name="new_tax_text_' + taxonomy + '"]', form).val();
|
|
@@ -390,7 +401,7 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 390 |
|
| 391 |
// make sure we don't already have a taxonomy with the same name.
|
| 392 |
var exists = false;
|
| 393 |
-
jQuery('input[name="' + taxonomy + '\[\]"]').each
|
| 394 |
var id = jQuery(this).attr('id');
|
| 395 |
var label = jQuery('label[for="' + id + '"]', form);
|
| 396 |
|
|
@@ -400,7 +411,7 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 400 |
}
|
| 401 |
});
|
| 402 |
|
| 403 |
-
jQuery('select[name="' + taxonomy + '\[\]"]', form).find('option').each
|
| 404 |
if (new_taxonomy == jQuery(this).text()) {
|
| 405 |
exists = true;
|
| 406 |
self._flash_it(jQuery(this));
|
|
@@ -413,43 +424,43 @@ toolsetForms.CRED_taxonomy = function () {
|
|
| 413 |
}
|
| 414 |
|
| 415 |
var parent = jQuery('[name="new_tax_select_' + taxonomy + '"]', form).val(),
|
| 416 |
-
|
| 417 |
-
|
| 418 |
-
|
| 419 |
-
|
| 420 |
|
| 421 |
-
if (
|
| 422 |
//Fix add new leaf
|
| 423 |
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188589136/comments
|
| 424 |
-
jQuery('div[data-item_name="taxonomyhierarchical-'+taxonomy+'"] li input[type=checkbox]', form).each(function() {
|
| 425 |
-
|
| 426 |
-
|
| 427 |
-
|
| 428 |
});
|
| 429 |
//#########################################################################################
|
| 430 |
|
| 431 |
var new_checkbox = '<li><input data-parent="' + parent + '" class="wpt-form-checkbox form-checkbox checkbox" type="checkbox" name="' + taxonomy + '[]" checked="checked" value="' + new_taxonomy + '"></input><label>' + new_taxonomy + '</label></li>';
|
| 432 |
-
|
| 433 |
var first_checkbox = jQuery('input[name="' + taxonomy + '\[\]"][data-parent="' + parent + '"]:first', form);
|
| 434 |
if (first_checkbox.length == 0) {
|
| 435 |
// there are no existing brothers
|
| 436 |
-
|
| 437 |
-
|
| 438 |
-
|
| 439 |
-
|
| 440 |
new_checkbox = '<ul class="wpt-form-set-children" data-level="' + level + '">' + new_checkbox + '</ul>';
|
| 441 |
-
|
| 442 |
//add_before = false;
|
| 443 |
//add_position = jQuery('input[name="' + taxonomy + '\[\]"][value="' + parent + '"]').closest('li');
|
| 444 |
-
|
| 445 |
} else {
|
| 446 |
// there are brothers
|
| 447 |
-
|
| 448 |
-
|
| 449 |
-
|
| 450 |
}
|
| 451 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).show();
|
| 452 |
-
} else if(
|
| 453 |
// Select control
|
| 454 |
|
| 455 |
jQuery('select[name="' + taxonomy + '\[\]"]').show();
|
|
@@ -533,20 +544,26 @@ toolsetForms.cred_tax = new toolsetForms.CRED_taxonomy();
|
|
| 533 |
|
| 534 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188725294/comments
|
| 535 |
//removed return key press
|
| 536 |
-
jQuery(function(){
|
| 537 |
-
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
|
| 541 |
-
|
| 542 |
-
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
|
| 550 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 551 |
});
|
| 552 |
|
| 8 |
wptCallbacks.conditionalCheck = jQuery.Callbacks('unique');
|
| 9 |
wptCallbacks.reset = jQuery.Callbacks('unique');
|
| 10 |
|
| 11 |
+
jQuery(document).ready(function () {
|
| 12 |
if (typeof wptValidation !== 'undefined') {
|
| 13 |
+
wptCallbacks.validationInit.add(function () {
|
| 14 |
wptValidation.init();
|
| 15 |
});
|
| 16 |
}
|
| 22 |
/**
|
| 23 |
* check taxonmies on submitted forms
|
| 24 |
*/
|
| 25 |
+
jQuery('.cred-taxonomy', jQuery('form.is_submitted')).each(function () {
|
| 26 |
parent = jQuery(this);
|
| 27 |
+
setTimeout(function () {
|
| 28 |
+
jQuery('input.wpt-taxonomy-add-new', parent).click();
|
| 29 |
+
}, 50);
|
| 30 |
});
|
| 31 |
});
|
| 32 |
|
| 44 |
if (typeof wptFilters[name] === 'undefined')
|
| 45 |
return val;
|
| 46 |
var args = _.rest(_.toArray(arguments));
|
| 47 |
+
_.each(wptFilters[name], function (funcs, priority) {
|
| 48 |
+
_.each(funcs, function ($callback) {
|
| 49 |
var _args = args.slice(0, $callback[1]);
|
| 50 |
args[0] = $callback[0].apply(null, _args);
|
| 51 |
});
|
| 59 |
if (typeof wptFilters[name] === 'undefined')
|
| 60 |
return false;
|
| 61 |
var args = _.rest(_.toArray(arguments));
|
| 62 |
+
_.each(wptFilters[name], function (funcs, priority) {
|
| 63 |
+
_.each(funcs, function ($callback) {
|
| 64 |
var _args = args.slice(0, $callback[1]);
|
| 65 |
$callback[0].apply(null, _args);
|
| 66 |
});
|
| 77 |
var $taxonomy_box = jQuery('.shmpt-' + taxonomy, form);
|
| 78 |
var $tag_list = $taxonomy_box.find('.js-wpt-taxonomy-popular-add');
|
| 79 |
|
| 80 |
+
if (!$button.hasClass('js-wpt-taxonomy-popular-show-hide'))
|
| 81 |
+
return true;
|
| 82 |
|
| 83 |
+
if ($tag_list.length > 0)
|
| 84 |
{
|
| 85 |
$button.show();
|
| 86 |
return true;
|
| 87 |
+
} else {
|
| 88 |
$button.hide();
|
| 89 |
return false;
|
| 90 |
}
|
| 91 |
}
|
| 92 |
|
| 93 |
+
jQuery(document).on('click', '.js-wpt-taxonomy-popular-show-hide', function () {
|
| 94 |
showHideMostPopularTaxonomy(this);
|
| 95 |
});
|
| 96 |
|
| 98 |
{
|
| 99 |
var taxonomy = jQuery(el).data('taxonomy');
|
| 100 |
var form = jQuery(el).closest('form');
|
| 101 |
+
jQuery('.shmpt-' + taxonomy, form).toggle();
|
| 102 |
var curr = jQuery(el).val();
|
| 103 |
+
if (curr == jQuery(el).data('show-popular-text')) {
|
| 104 |
jQuery(el).val(jQuery(el).data('hide-popular-text'), form).addClass('btn-cancel');
|
| 105 |
} else {
|
| 106 |
jQuery(el).val(jQuery(el).data('show-popular-text'), form).removeClass('btn-cancel');
|
| 107 |
}
|
| 108 |
}
|
| 109 |
|
| 110 |
+
jQuery(document).on('click', '.js-wpt-taxonomy-popular-add', function () {
|
| 111 |
var thiz = jQuery(this);
|
| 112 |
+
var taxonomy = thiz.data('taxonomy');
|
| 113 |
+
var slug = thiz.data('slug');
|
| 114 |
+
var _name = thiz.data('name');
|
| 115 |
addTaxonomy(_name, taxonomy, this);
|
| 116 |
return false;
|
| 117 |
});
|
| 119 |
function addTaxonomy(slug, taxonomy, el)
|
| 120 |
{
|
| 121 |
var form = jQuery(el).closest('form');
|
| 122 |
+
var curr = jQuery('input[name=tmp_' + taxonomy + ']', form).val().trim();
|
| 123 |
+
if ('' == curr) {
|
| 124 |
+
jQuery('input[name=tmp_' + taxonomy + ']', form).val(slug);
|
| 125 |
setTaxonomy(taxonomy, el);
|
| 126 |
} else {
|
| 127 |
+
if (curr.indexOf(slug) == -1) {
|
| 128 |
+
jQuery('input[name=tmp_' + taxonomy + ']', form).val(curr + ',' + slug);
|
| 129 |
setTaxonomy(taxonomy, el);
|
| 130 |
}
|
| 131 |
}
|
| 132 |
+
jQuery('input[name=tmp_' + taxonomy + ']', form).val('');
|
| 133 |
}
|
| 134 |
|
| 135 |
+
jQuery(document).on('click', '.js-wpt-taxonomy-add-new', function () {
|
| 136 |
+
var thiz = jQuery(this),
|
| 137 |
+
taxonomy = thiz.data('taxonomy');
|
| 138 |
+
setTaxonomy(taxonomy, this);
|
| 139 |
});
|
| 140 |
|
| 141 |
+
jQuery(document).on('keypress', '.js-wpt-new-taxonomy-title', function (e) {
|
| 142 |
+
if (13 === e.keyCode) {
|
| 143 |
+
e.preventDefault();
|
| 144 |
+
var thiz = jQuery(this),
|
| 145 |
+
taxonomy = thiz.data('taxonomy'),
|
| 146 |
+
taxtype = thiz.data('taxtype');
|
| 147 |
+
if (taxtype == 'hierarchical') {
|
| 148 |
+
toolsetForms.cred_tax.add_taxonomy(taxonomy, this);
|
| 149 |
+
} else {
|
| 150 |
+
setTaxonomy(taxonomy, this);
|
| 151 |
+
}
|
| 152 |
+
}
|
| 153 |
+
});
|
| 154 |
|
| 155 |
function setTaxonomy(taxonomy, el)
|
| 156 |
{
|
| 157 |
var form = jQuery(el).closest('form');
|
| 158 |
+
var tmp_tax = jQuery('input[name=tmp_' + taxonomy + ']', form).val();
|
| 159 |
+
if (tmp_tax.trim() == '')
|
| 160 |
+
return;
|
| 161 |
+
var tax = jQuery('input[name=' + taxonomy + ']', form).val();
|
| 162 |
var arr = tax.split(',');
|
| 163 |
+
if (jQuery.inArray(tmp_tax, arr) !== -1)
|
| 164 |
+
return;
|
| 165 |
+
var toadd = (tax == '') ? tmp_tax : tax + ',' + tmp_tax;
|
| 166 |
+
jQuery('input[name=' + taxonomy + ']', form).val(toadd);
|
| 167 |
+
jQuery('input[name=tmp_' + taxonomy + ']', form).val('');
|
| 168 |
updateTaxonomies(taxonomy, form);
|
| 169 |
}
|
| 170 |
|
| 171 |
function updateTaxonomies(taxonomy, form)
|
| 172 |
{
|
| 173 |
+
var taxonomies = jQuery('input[name=' + taxonomy + ']', form).val();
|
| 174 |
+
jQuery('div.tagchecklist-' + taxonomy, form).html('');
|
| 175 |
+
if (!taxonomies || (taxonomies && taxonomies.trim() == ''))
|
| 176 |
+
return;
|
| 177 |
var toshow = taxonomies.split(',');
|
| 178 |
var str = '';
|
| 179 |
+
for (var i = 0; i < toshow.length; i++) {
|
| 180 |
var sh = toshow[i].trim();
|
| 181 |
+
str += '<span><a href="#" class=\'ntdelbutton\' data-wpcf-i=\'' + i + '\' id=\'post_tag-check-num-' + i + '\'>X</a> ' + sh + '</span>';
|
| 182 |
}
|
| 183 |
+
jQuery('div.tagchecklist-' + taxonomy, form).html(str);
|
| 184 |
+
jQuery('div.tagchecklist-' + taxonomy + ' a', form).bind('click', function () {
|
| 185 |
+
jQuery('input[name=' + taxonomy + ']', form).val('');
|
| 186 |
del = jQuery(this).data('wpcf-i');
|
| 187 |
var values = '';
|
| 188 |
+
for (i = 0; i < toshow.length; i++) {
|
| 189 |
+
if (del == i) {
|
| 190 |
continue;
|
| 191 |
}
|
| 192 |
+
if (values) {
|
| 193 |
values += ',';
|
| 194 |
}
|
| 195 |
values += toshow[i];
|
| 196 |
}
|
| 197 |
+
jQuery('input[name=' + taxonomy + ']', form).val(values);
|
| 198 |
updateTaxonomies(taxonomy, form);
|
| 199 |
|
| 200 |
return false;
|
| 204 |
|
| 205 |
function initTaxonomies(values, taxonomy, url, fieldId)
|
| 206 |
{
|
| 207 |
+
form = jQuery('#' + fieldId.replace(/_field_\d+$/, '')).closest('form');
|
| 208 |
+
jQuery('div.tagchecklist-' + taxonomy).html(values);
|
| 209 |
+
|
| 210 |
+
jQuery('input[name=' + taxonomy + ']').val(values);
|
| 211 |
updateTaxonomies(taxonomy, form);
|
| 212 |
+
jQuery('input[name=tmp_' + taxonomy + ']').suggest(
|
| 213 |
+
wptoolset_forms_local.ajaxurl + '?action=wpt_suggest_taxonomy_term&taxonomy=' + taxonomy ,
|
| 214 |
+
{
|
| 215 |
+
resultsClass: 'wpt-suggest-taxonomy-term',
|
| 216 |
+
selectClass: 'wpt-suggest-taxonomy-term-select'
|
| 217 |
+
}
|
| 218 |
+
);
|
| 219 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/195723133/comments#308689055
|
| 220 |
+
if (jQuery('input[name=tmp_' + taxonomy + ']').val() != "")
|
| 221 |
+
jQuery("input[name='new_tax_button_" + taxonomy + "']").trigger("click");
|
|
|
|
|
|
|
|
|
|
| 222 |
}
|
| 223 |
|
| 224 |
toolsetForms.CRED_taxonomy = function () {
|
| 240 |
}
|
| 241 |
|
| 242 |
self._fill_parent_drop_down = function () {
|
| 243 |
+
jQuery('select.js-taxonomy-parent').each(function () {
|
| 244 |
var select = jQuery(this);
|
| 245 |
|
| 246 |
// remove all the options
|
| 247 |
+
jQuery(this).find('option').each(function () {
|
| 248 |
if (jQuery(this).val() != '-1') {
|
| 249 |
jQuery(this).remove();
|
| 250 |
}
|
| 253 |
var taxonomy = jQuery(this).data('taxonomy');
|
| 254 |
|
| 255 |
// Copy all the checkbox values if it's checkbox mode
|
| 256 |
+
jQuery('input[name="' + taxonomy + '\[\]"]').each(function () {
|
| 257 |
var id = jQuery(this).attr('id');
|
| 258 |
var label = jQuery(this).next('label');
|
| 259 |
var level = jQuery(this).closest('ul').data('level');
|
| 260 |
var prefix = '';
|
| 261 |
+
if (level) {
|
| 262 |
prefix = "\xA0\xA0" + Array(level).join("\xA0\xA0");
|
| 263 |
}
|
| 264 |
select.append('<option value="' + jQuery(this).val() + '">' + prefix + label.text() + '</option>');
|
| 265 |
})
|
| 266 |
|
| 267 |
// Copy all the select option values if it's select mode
|
| 268 |
+
jQuery('select[name="' + taxonomy + '\[\]"]').find('option').each(function () {
|
| 269 |
var id = jQuery(this).val();
|
| 270 |
var text = jQuery(this).text();
|
| 271 |
select.append('<option value="' + id + '">' + text + '</option>');
|
| 280 |
// replace the taxonomy button placeholders with the actual buttons.
|
| 281 |
jQuery('.js-taxonomy-button-placeholder').each(function () {
|
| 282 |
var placeholder = jQuery(this);
|
| 283 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/195150507/comments
|
| 284 |
+
var label = jQuery(this).attr('data-label');
|
| 285 |
+
//###########################################################################################
|
| 286 |
var taxonomy = jQuery(this).data('taxonomy');
|
| 287 |
var form = jQuery(this).closest('form');
|
| 288 |
var buttons = jQuery('[name="sh_' + taxonomy + '"],[name="btn_' + taxonomy + '"]', form);
|
| 293 |
buttons.each(function () {
|
| 294 |
var button = jQuery(this, form);
|
| 295 |
|
| 296 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/195150507/comments
|
| 297 |
+
if (label)
|
| 298 |
+
button.val(label);
|
| 299 |
+
//##########################################################################################
|
| 300 |
+
|
| 301 |
placeholder.replaceWith(button);
|
| 302 |
|
| 303 |
if (button.hasClass('js-wpt-taxonomy-popular-show-hide')) {
|
| 304 |
+
if (showHideMostPopularButton(taxonomy, form)) {
|
| 305 |
button.show();
|
| 306 |
}
|
| 307 |
} else {
|
| 312 |
//Responsible of the issue https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188673095/comments
|
| 313 |
//changed selector
|
| 314 |
//var selector = button.data('after-selector');
|
| 315 |
+
selectors.push(button.data('after-selector'))
|
| 316 |
if (typeof selector !== 'undefined' && selector.length) {
|
| 317 |
var position = button;
|
| 318 |
+
jQuery('.' + selectors[0]).detach();
|
| 319 |
+
jQuery('.' + selectors[0]).insertAfter(button);
|
| 320 |
+
position = jQuery('.' + selectors[0]);
|
| 321 |
+
selectors.pop();
|
| 322 |
}
|
| 323 |
})
|
| 324 |
}
|
| 325 |
});
|
| 326 |
}
|
| 327 |
|
| 328 |
+
jQuery(document).on('click', '.js-wpt-hierarchical-taxonomy-add-new-show-hide', function () {
|
| 329 |
+
if (jQuery(this).val() == jQuery(this).data('close')) {
|
| 330 |
jQuery(this).val(jQuery(this).data('open')).removeClass('btn-cancel');
|
| 331 |
} else {
|
| 332 |
jQuery(this).val(jQuery(this).data('close')).addClass('btn-cancel');
|
| 333 |
}
|
| 334 |
+
var thiz = jQuery(this), taxonomy = thiz.data('taxonomy');
|
| 335 |
+
self.add_new_show_hide(taxonomy, this);
|
| 336 |
});
|
| 337 |
|
| 338 |
+
self.add_new_show_hide = function (taxonomy, button) {
|
| 339 |
var form = jQuery(button).closest('form');
|
| 340 |
jQuery('.js-wpt-hierarchical-taxonomy-add-new-' + taxonomy, form).toggle();
|
| 341 |
+
self.hide_parent_button_if_no_terms(taxonomy, button);
|
| 342 |
}
|
| 343 |
|
| 344 |
+
jQuery(document).on('click', '.js-wpt-hierarchical-taxonomy-add-new', function () {
|
| 345 |
+
var thiz = jQuery(this),
|
| 346 |
+
taxonomy = thiz.data('taxonomy');
|
| 347 |
+
self.add_taxonomy(taxonomy, this);
|
| 348 |
});
|
| 349 |
/*
|
| 350 |
+
jQuery(document).on('keypress', '.js-wpt-new-taxonomy-title', function(e) {
|
| 351 |
+
if( 13 === e.keyCode ) {
|
| 352 |
+
e.preventDefault();
|
| 353 |
+
var thiz = jQuery(this),
|
| 354 |
+
taxonomy = thiz.data( 'taxonomy' );
|
| 355 |
+
self.add_taxonomy( taxonomy, this );
|
| 356 |
+
}
|
| 357 |
+
});
|
| 358 |
+
*/
|
| 359 |
|
| 360 |
+
self.terms_exist = function (taxonomy, button)
|
| 361 |
{
|
| 362 |
var form = jQuery(button).closest('form');
|
| 363 |
var build_what = jQuery(button).data('build_what'), parent = jQuery('[name="new_tax_select_' + taxonomy + '"]', form).val();
|
| 364 |
+
if (build_what === 'checkboxes') {
|
| 365 |
var first_checkbox = jQuery('input[name="' + taxonomy + '\[\]"][data-parent="' + parent + '"]:first', form);
|
| 366 |
return first_checkbox.length > 0;
|
| 367 |
} else {
|
| 373 |
};
|
| 374 |
|
| 375 |
self._add_new_flag = [];
|
| 376 |
+
self.hide_parent_button_if_no_terms = function (taxonomy, button)
|
| 377 |
{
|
| 378 |
var form = jQuery(button).closest('form');
|
| 379 |
var form_id = form.attr('id');
|
| 380 |
+
if ('undefined' == typeof self._add_new_flag[form_id]) {
|
| 381 |
self._add_new_flag[form_id] = '';
|
| 382 |
}
|
| 383 |
self._add_new_flag[form_id] = !self._add_new_flag[form_id];
|
| 384 |
+
if (self._add_new_flag[form_id] === false) {
|
| 385 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).hide();
|
| 386 |
} else {
|
| 387 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).show();
|
| 388 |
}
|
| 389 |
};
|
| 390 |
|
| 391 |
+
self.add_taxonomy = function (taxonomy, button)
|
| 392 |
{
|
| 393 |
var form = jQuery(button).closest('form');
|
| 394 |
var new_taxonomy = jQuery('[name="new_tax_text_' + taxonomy + '"]', form).val();
|
| 401 |
|
| 402 |
// make sure we don't already have a taxonomy with the same name.
|
| 403 |
var exists = false;
|
| 404 |
+
jQuery('input[name="' + taxonomy + '\[\]"]').each(function () {
|
| 405 |
var id = jQuery(this).attr('id');
|
| 406 |
var label = jQuery('label[for="' + id + '"]', form);
|
| 407 |
|
| 411 |
}
|
| 412 |
});
|
| 413 |
|
| 414 |
+
jQuery('select[name="' + taxonomy + '\[\]"]', form).find('option').each(function () {
|
| 415 |
if (new_taxonomy == jQuery(this).text()) {
|
| 416 |
exists = true;
|
| 417 |
self._flash_it(jQuery(this));
|
| 424 |
}
|
| 425 |
|
| 426 |
var parent = jQuery('[name="new_tax_select_' + taxonomy + '"]', form).val(),
|
| 427 |
+
add_position = null,
|
| 428 |
+
add_before = true,
|
| 429 |
+
div_fields_wrap = jQuery('div[data-item_name="taxonomyhierarchical-' + taxonomy + '"]', form),
|
| 430 |
+
level = 0;
|
| 431 |
|
| 432 |
+
if (build_what === 'checkboxes') {
|
| 433 |
//Fix add new leaf
|
| 434 |
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188589136/comments
|
| 435 |
+
jQuery('div[data-item_name="taxonomyhierarchical-' + taxonomy + '"] li input[type=checkbox]', form).each(function () {
|
| 436 |
+
if (this.value == parent || this.value == new_taxonomy) {
|
| 437 |
+
div_fields_wrap = jQuery(this).parent();
|
| 438 |
+
}
|
| 439 |
});
|
| 440 |
//#########################################################################################
|
| 441 |
|
| 442 |
var new_checkbox = '<li><input data-parent="' + parent + '" class="wpt-form-checkbox form-checkbox checkbox" type="checkbox" name="' + taxonomy + '[]" checked="checked" value="' + new_taxonomy + '"></input><label>' + new_taxonomy + '</label></li>';
|
| 443 |
+
// find the first checkbox sharing parent
|
| 444 |
var first_checkbox = jQuery('input[name="' + taxonomy + '\[\]"][data-parent="' + parent + '"]:first', form);
|
| 445 |
if (first_checkbox.length == 0) {
|
| 446 |
// there are no existing brothers
|
| 447 |
+
// so we need to compose the ul wrapper and append to the parent li
|
| 448 |
+
//add_position = jQuery('input[name="' + taxonomy + '\[\]"][value="' + parent + '"]').closest('li');
|
| 449 |
+
level = jQuery('input[name="' + taxonomy + '\[\]"][value="' + parent + '"]', form).closest('ul').data('level');
|
| 450 |
+
level++;
|
| 451 |
new_checkbox = '<ul class="wpt-form-set-children" data-level="' + level + '">' + new_checkbox + '</ul>';
|
| 452 |
+
//first_checkbox = ;
|
| 453 |
//add_before = false;
|
| 454 |
//add_position = jQuery('input[name="' + taxonomy + '\[\]"][value="' + parent + '"]').closest('li');
|
| 455 |
+
jQuery(new_checkbox).appendTo(div_fields_wrap);
|
| 456 |
} else {
|
| 457 |
// there are brothers
|
| 458 |
+
// so we need to insert before all of them
|
| 459 |
+
add_position = first_checkbox.closest('li');
|
| 460 |
+
jQuery(new_checkbox).insertBefore(add_position);
|
| 461 |
}
|
| 462 |
jQuery('[name="new_tax_select_' + taxonomy + '"]', form).show();
|
| 463 |
+
} else if (build_what === 'select') {
|
| 464 |
// Select control
|
| 465 |
|
| 466 |
jQuery('select[name="' + taxonomy + '\[\]"]').show();
|
| 544 |
|
| 545 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/188725294/comments
|
| 546 |
//removed return key press
|
| 547 |
+
jQuery(function () {
|
| 548 |
+
var keyStop = {
|
| 549 |
+
8: ":not(input:text, textarea, input:file, input:password)", // stop backspace = back
|
| 550 |
+
13: "input:text, input:password", // stop enter = submit
|
| 551 |
+
|
| 552 |
+
end: null
|
| 553 |
+
};
|
| 554 |
+
jQuery(document).bind("keydown", function (event) {
|
| 555 |
+
var thiz_selector = keyStop[event.which],
|
| 556 |
+
thiz_target = jQuery(event.target);
|
| 557 |
+
|
| 558 |
+
if (
|
| 559 |
+
thiz_target.closest( "form.cred-form" ).length
|
| 560 |
+
&& thiz_selector !== undefined
|
| 561 |
+
&& thiz_target.is(thiz_selector)
|
| 562 |
+
) {
|
| 563 |
+
event.preventDefault(); //stop event
|
| 564 |
+
}
|
| 565 |
+
|
| 566 |
+
return true;
|
| 567 |
+
});
|
| 568 |
});
|
| 569 |
|
embedded/common/toolset-forms/js/repetitive.js
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
/*
|
| 2 |
* Repetitive JS.
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
/*
|
| 2 |
* Repetitive JS.
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/js/repetitive.js $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/js/skype.js
CHANGED
|
@@ -11,7 +11,7 @@ var wptSkype = (function($) {
|
|
| 11 |
$('.js-wpt-skypename-popup', $popup).val($skypename.val());
|
| 12 |
$('[name="wpt-skypestyle-popup"][value="' + $style.val() + '"]', $popup)
|
| 13 |
.attr('checked', true);
|
| 14 |
-
tb_show(wptSkypeData.title, "#TB_inline?inlineId=tpl-wpt-skype-edit-button", "");
|
| 15 |
});
|
| 16 |
$('#wpt-skype-edit-button-popup').on('click', '.js-wpt-close-thickbox', function() {
|
| 17 |
$skypename.val($('.js-wpt-skypename-popup', $popup).val());
|
|
@@ -26,4 +26,4 @@ var wptSkype = (function($) {
|
|
| 26 |
};
|
| 27 |
})(jQuery);
|
| 28 |
|
| 29 |
-
jQuery(document).ready(wptSkype.init);
|
| 11 |
$('.js-wpt-skypename-popup', $popup).val($skypename.val());
|
| 12 |
$('[name="wpt-skypestyle-popup"][value="' + $style.val() + '"]', $popup)
|
| 13 |
.attr('checked', true);
|
| 14 |
+
tb_show(wptSkypeData.title, "#TB_inline?inlineId=tpl-wpt-skype-edit-button&height=500&width=600", "");
|
| 15 |
});
|
| 16 |
$('#wpt-skype-edit-button-popup').on('click', '.js-wpt-close-thickbox', function() {
|
| 17 |
$skypename.val($('.js-wpt-skypename-popup', $popup).val());
|
| 26 |
};
|
| 27 |
})(jQuery);
|
| 28 |
|
| 29 |
+
jQuery(document).ready(wptSkype.init);
|
embedded/common/toolset-forms/js/validation.js
CHANGED
|
@@ -7,9 +7,9 @@
|
|
| 7 |
*
|
| 8 |
* @see class WPToolset_Validation
|
| 9 |
*
|
| 10 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 11 |
-
* $LastChangedDate: 2015-01
|
| 12 |
-
* $LastChangedRevision:
|
| 13 |
* $LastChangedBy: iworks $
|
| 14 |
*
|
| 15 |
*/
|
|
@@ -17,33 +17,40 @@
|
|
| 17 |
|
| 18 |
var wptValidationForms = [];
|
| 19 |
var wptValidation = (function($) {
|
| 20 |
-
function init() {
|
| 21 |
/**
|
| 22 |
* add extension to validator method
|
| 23 |
*/
|
| 24 |
$.validator.addMethod("extension", function(value, element, param) {
|
| 25 |
param = typeof param === "string" ? param.replace(/,/g, "|") : param;
|
| 26 |
return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i"));
|
| 27 |
-
});
|
| 28 |
-
|
| 29 |
/**
|
| 30 |
* add hexadecimal to validator method
|
| 31 |
*/
|
| 32 |
-
$.validator.addMethod("hexadecimal", function(value, element, param) {
|
| 33 |
-
return value=="" || /(^#[0-9A-F]{6}$)|(^#[0-9A-F]{3}$)/i.test(value);
|
| 34 |
});
|
| 35 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 36 |
/**
|
| 37 |
* add extension to validator method require
|
| 38 |
*/
|
| 39 |
-
$.validator.addMethod("required", function(value, element, param) {
|
| 40 |
// check if dependency is met
|
| 41 |
if ( !this.depend(param, element) )
|
| 42 |
return "dependency-mismatch";
|
| 43 |
-
|
| 44 |
switch( element.nodeName.toLowerCase() ) {
|
| 45 |
-
case 'select':
|
| 46 |
-
var val = $(element).val();
|
| 47 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/189231348/comments
|
| 48 |
// we have data-types-value that in select contains the exactly value
|
| 49 |
$(element).find('option').each(function(index, option){
|
|
@@ -55,11 +62,11 @@ var wptValidation = (function($) {
|
|
| 55 |
});
|
| 56 |
//#########################################################################
|
| 57 |
return val && $.trim(val).length > 0;
|
| 58 |
-
case 'input':
|
| 59 |
// if (jQuery(element).hasClass("hasDatepicker")) {
|
| 60 |
// element = jQuery(element).siblings( 'input[type="hidden"]' );
|
| 61 |
// value = element.val();
|
| 62 |
-
// element = element[0];
|
| 63 |
// console.log(value+" -> "+this.getLength(value, element));
|
| 64 |
// return this.getLength(value, element) > 0;
|
| 65 |
// }
|
|
@@ -74,7 +81,7 @@ var wptValidation = (function($) {
|
|
| 74 |
return $.trim(value).length > 0;
|
| 75 |
}
|
| 76 |
});
|
| 77 |
-
|
| 78 |
/**
|
| 79 |
* Add validation method for datepicker adodb_xxx format for date fields
|
| 80 |
*/
|
|
@@ -164,7 +171,7 @@ var wptValidation = (function($) {
|
|
| 164 |
var _rule = {messages: {}};
|
| 165 |
_rule[rule] = value.args;
|
| 166 |
if (value.message !== 'undefined') {
|
| 167 |
-
_rule.messages[rule] = value.message;
|
| 168 |
}
|
| 169 |
element.rules('add', _rule);
|
| 170 |
element.addClass('js-wpt-validate');
|
| 7 |
*
|
| 8 |
* @see class WPToolset_Validation
|
| 9 |
*
|
| 10 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/js/validation.js $
|
| 11 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 12 |
+
* $LastChangedRevision: 1125405 $
|
| 13 |
* $LastChangedBy: iworks $
|
| 14 |
*
|
| 15 |
*/
|
| 17 |
|
| 18 |
var wptValidationForms = [];
|
| 19 |
var wptValidation = (function($) {
|
| 20 |
+
function init() {
|
| 21 |
/**
|
| 22 |
* add extension to validator method
|
| 23 |
*/
|
| 24 |
$.validator.addMethod("extension", function(value, element, param) {
|
| 25 |
param = typeof param === "string" ? param.replace(/,/g, "|") : param;
|
| 26 |
return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i"));
|
| 27 |
+
});
|
| 28 |
+
|
| 29 |
/**
|
| 30 |
* add hexadecimal to validator method
|
| 31 |
*/
|
| 32 |
+
$.validator.addMethod("hexadecimal", function(value, element, param) {
|
| 33 |
+
return value=="" || /(^#[0-9A-F]{6}$)|(^#[0-9A-F]{3}$)/i.test(value);
|
| 34 |
});
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* add skype to validator method
|
| 38 |
+
*/
|
| 39 |
+
$.validator.addMethod("skype", function(value, element, param) {
|
| 40 |
+
return value=="" || /^([a-z0-9\.\_\,\-\#]+)$/i.test(value);
|
| 41 |
+
});
|
| 42 |
+
|
| 43 |
/**
|
| 44 |
* add extension to validator method require
|
| 45 |
*/
|
| 46 |
+
$.validator.addMethod("required", function(value, element, param) {
|
| 47 |
// check if dependency is met
|
| 48 |
if ( !this.depend(param, element) )
|
| 49 |
return "dependency-mismatch";
|
| 50 |
+
|
| 51 |
switch( element.nodeName.toLowerCase() ) {
|
| 52 |
+
case 'select':
|
| 53 |
+
var val = $(element).val();
|
| 54 |
//Fix https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/189231348/comments
|
| 55 |
// we have data-types-value that in select contains the exactly value
|
| 56 |
$(element).find('option').each(function(index, option){
|
| 62 |
});
|
| 63 |
//#########################################################################
|
| 64 |
return val && $.trim(val).length > 0;
|
| 65 |
+
case 'input':
|
| 66 |
// if (jQuery(element).hasClass("hasDatepicker")) {
|
| 67 |
// element = jQuery(element).siblings( 'input[type="hidden"]' );
|
| 68 |
// value = element.val();
|
| 69 |
+
// element = element[0];
|
| 70 |
// console.log(value+" -> "+this.getLength(value, element));
|
| 71 |
// return this.getLength(value, element) > 0;
|
| 72 |
// }
|
| 81 |
return $.trim(value).length > 0;
|
| 82 |
}
|
| 83 |
});
|
| 84 |
+
|
| 85 |
/**
|
| 86 |
* Add validation method for datepicker adodb_xxx format for date fields
|
| 87 |
*/
|
| 171 |
var _rule = {messages: {}};
|
| 172 |
_rule[rule] = value.args;
|
| 173 |
if (value.message !== 'undefined') {
|
| 174 |
+
_rule.messages[rule] = value.message;
|
| 175 |
}
|
| 176 |
element.rules('add', _rule);
|
| 177 |
element.addClass('js-wpt-validate');
|
embedded/common/toolset-forms/lib/CakePHP-Validation.php
CHANGED
|
@@ -55,7 +55,7 @@ class WPToolset_Cake_Validation {
|
|
| 55 |
* @access private
|
| 56 |
*/
|
| 57 |
var $__pattern = array(
|
| 58 |
-
'hostname' => '(?:[
|
| 59 |
);
|
| 60 |
|
| 61 |
/**
|
|
@@ -950,13 +950,12 @@ class WPToolset_Cake_Validation {
|
|
| 950 |
$_this = &WPToolset_Cake_Validation::getInstance();
|
| 951 |
$_this->__populateIp();
|
| 952 |
$_this->check = $check;
|
| 953 |
-
$validChars = '([' . preg_quote('!"$&\'()*+,-.@_:;=~[]') . '\/0-
|
| 954 |
-
$_this->regex = '/^(?:(?:https?|ftps?|file|news|gopher):\/\/)' . (!empty($strict) ? '' : '?') .
|
| 955 |
-
|
| 956 |
-
|
| 957 |
-
|
| 958 |
-
|
| 959 |
-
'(?:#' . $validChars . '*)?$/iu';
|
| 960 |
return $_this->_check();
|
| 961 |
}
|
| 962 |
|
| 55 |
* @access private
|
| 56 |
*/
|
| 57 |
var $__pattern = array(
|
| 58 |
+
'hostname' => '(?:[_\p{L}0-9][-_\p{L}0-9]*\.)*(?:[\p{L}0-9][-\p{L}0-9]{0,62})\.(?:(?:[a-z]{2}\.)?[a-z]{2,})'
|
| 59 |
);
|
| 60 |
|
| 61 |
/**
|
| 950 |
$_this = &WPToolset_Cake_Validation::getInstance();
|
| 951 |
$_this->__populateIp();
|
| 952 |
$_this->check = $check;
|
| 953 |
+
$validChars = '([' . preg_quote('!"$&\'()*+,-.@_:;=~[]') . '\/0-9\p{L}\p{N}]|(%[0-9a-f]{2}))';
|
| 954 |
+
$_this->regex = '/^(?:(?:https?|ftps?|sftp|file|news|gopher):\/\/)' . (!empty($strict) ? '' : '?') .
|
| 955 |
+
'(?:' . $_this->__pattern['IPv4'] . '|\[' . $_this->__pattern['IPv6'] . '\]|' . $_this->__pattern['hostname'] . ')(?::[1-9][0-9]{0,4})?' .
|
| 956 |
+
'(?:\/?|\/' . $validChars . '*)?' .
|
| 957 |
+
'(?:\?' . $validChars . '*)?' .
|
| 958 |
+
'(?:#' . $validChars . '*)?$/iu';
|
|
|
|
| 959 |
return $_this->_check();
|
| 960 |
}
|
| 961 |
|
embedded/common/toolset-forms/readme.txt
CHANGED
|
@@ -30,6 +30,17 @@ function my_toolset_valid_image_extentions($valid_extensions)
|
|
| 30 |
|
| 31 |
= Changelog =
|
| 32 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
2014-12-29
|
| 34 |
|
| 35 |
- fixed display CPT in CT
|
| 30 |
|
| 31 |
= Changelog =
|
| 32 |
|
| 33 |
+
2015-03-25
|
| 34 |
+
|
| 35 |
+
- Fixed missing warning for date type field.
|
| 36 |
+
https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/196695908/comments
|
| 37 |
+
|
| 38 |
+
2015-02-06
|
| 39 |
+
|
| 40 |
+
- Fixed empty object in WPV_Handle_Users_Functions class when user is
|
| 41 |
+
not logged always return false.
|
| 42 |
+
https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/194981023/comments
|
| 43 |
+
|
| 44 |
2014-12-29
|
| 45 |
|
| 46 |
- fixed display CPT in CT
|
embedded/common/toolset-forms/templates/metaform-item.php
CHANGED
|
@@ -1,39 +1,40 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
-
if (
|
| 11 |
-
?>
|
| 12 |
-
<div class="js-wpt-field-item wpt-field-item">
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
</div>
|
| 21 |
-
<?php
|
| 22 |
} else {
|
| 23 |
$toolset_repdrag_image = '';
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
echo '<div class="wpt-repctl">';
|
| 28 |
-
|
| 29 |
}
|
| 30 |
echo $out;
|
| 31 |
-
if (
|
| 32 |
-
if (
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
echo
|
|
|
|
| 37 |
echo '" />';
|
| 38 |
echo '</div>';
|
| 39 |
}
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/templates/metaform-item.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1120400 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
+
if (is_admin()) {
|
| 11 |
+
?>
|
| 12 |
+
<div class="js-wpt-field-item wpt-field-item">
|
| 13 |
+
<?php echo $out; ?>
|
| 14 |
+
<?php if (@$cfg['repetitive']): ?>
|
| 15 |
+
<div class="wpt-repctl">
|
| 16 |
+
<div class="js-wpt-repdrag wpt-repdrag"> </div>
|
| 17 |
+
<a class="js-wpt-repdelete button button-small" data-wpt-type="<?php echo $cfg['type']; ?>" data-wpt-id="<?php echo $cfg['id']; ?>"><?php apply_filters('toolset_button_delete_repetition_text', printf(__('Delete %s', 'wpv-views'), strtolower($cfg['title'])), $cfg); ?></a>
|
| 18 |
+
</div>
|
| 19 |
+
<?php endif; ?>
|
| 20 |
+
</div>
|
| 21 |
+
<?php
|
| 22 |
} else {
|
| 23 |
$toolset_repdrag_image = '';
|
| 24 |
+
$button_extra_classnames = '';
|
| 25 |
+
if ($cfg['repetitive']) {
|
| 26 |
+
$toolset_repdrag_image = apply_filters('wptoolset_filter_wptoolset_repdrag_image', $toolset_repdrag_image);
|
| 27 |
echo '<div class="wpt-repctl">';
|
| 28 |
+
echo '<span class="js-wpt-repdrag wpt-repdrag"><img class="wpv-repdrag-image" src="' . $toolset_repdrag_image . '" /></span>';
|
| 29 |
}
|
| 30 |
echo $out;
|
| 31 |
+
if ($cfg['repetitive']) {
|
| 32 |
+
if (array_key_exists('use_bootstrap', $cfg) && $cfg['use_bootstrap']) {
|
| 33 |
+
$button_extra_classnames = ' btn btn-default btn-sm';
|
| 34 |
+
}
|
| 35 |
+
$str = sprintf('%s repetition', $cfg['title']);
|
| 36 |
+
echo '<input type="button" href="#" class="js-wpt-repdelete wpt-repdelete' . $button_extra_classnames . '" value="';
|
| 37 |
+
echo apply_filters('toolset_button_delete_repetition_text', esc_attr(__('Delete', 'wpv-views')) . " " . esc_attr($str), $cfg);
|
| 38 |
echo '" />';
|
| 39 |
echo '</div>';
|
| 40 |
}
|
embedded/common/toolset-forms/templates/metaform.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/common/toolset-forms/templates/metaform.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/common/toolset-forms/test.php
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
add_action( 'admin_init', '_wptoolset_forms_test_fields' );
|
| 3 |
-
add_action( 'admin_init', '_wptoolset_forms_test_form' );
|
| 4 |
-
add_action( 'edit_form_after_editor', '_wptoolset_forms_test_fields_render' );
|
| 5 |
-
add_action( 'admin_footer', '_wptoolset_forms_test_form_render' );
|
| 6 |
-
|
| 7 |
-
function _wptoolset_forms_test_fields() {
|
| 8 |
-
global $_html_test;
|
| 9 |
-
$fields = types_get_fields(); //debug($fields);
|
| 10 |
-
foreach ( $fields as $field ) {
|
| 11 |
-
$config = wptoolset_forms_types_filter_field( $field, 'testme' );
|
| 12 |
-
$_html_test .= wptoolset_form_field( 'post', $config );
|
| 13 |
-
}
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
function _wptoolset_forms_test_form() {
|
| 17 |
-
global $_html_test_2;
|
| 18 |
-
$form = wptoolset_form( 'types-form' );
|
| 19 |
-
$fields = types_get_fields(); //debug($fields);
|
| 20 |
-
foreach ( $fields as $field ) {
|
| 21 |
-
$config = wptoolset_forms_types_filter_field( $field, 'testme' );
|
| 22 |
-
$form->addField( $config );
|
| 23 |
-
}
|
| 24 |
-
$form->addSubmit();
|
| 25 |
-
$_html_test_2 = $form->createForm( 'types-form' );
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
function _wptoolset_forms_test_fields_render() {
|
| 29 |
-
global $_html_test; //debug($_html_test);
|
| 30 |
-
echo '<h2>'.__('Test group of elements', 'wpv-views').'</h2>' . $_html_test;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
function _wptoolset_forms_test_form_render() {
|
| 34 |
-
global $_html_test_2;
|
| 35 |
-
echo '<h2>'.__('Test form', 'wpv-views').'</h2>' . $_html_test_2;
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/utility/css/notifications.css
CHANGED
|
@@ -81,16 +81,10 @@ span.toolset-alert {
|
|
| 81 |
|
| 82 |
/* Explanation messages */
|
| 83 |
.toolset-help {
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
background: #
|
| 87 |
-
|
| 88 |
-
background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#f6fafa), color-stop(100%,#eff6f6));
|
| 89 |
-
background: -webkit-linear-gradient(top, #f6fafa 0%,#eff6f6 100%);
|
| 90 |
-
background: -o-linear-gradient(top, #f6fafa 0%,#eff6f6 100%);
|
| 91 |
-
background: -ms-linear-gradient(top, #f6fafa 0%,#eff6f6 100%);
|
| 92 |
-
background: linear-gradient(to bottom, #f6fafa 0%,#eff6f6 100%);
|
| 93 |
-
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f6fafa', endColorstr='#eff6f6',GradientType=0 );
|
| 94 |
}
|
| 95 |
|
| 96 |
.js-show-toolset-message {
|
|
@@ -98,9 +92,12 @@ span.toolset-alert {
|
|
| 98 |
}
|
| 99 |
|
| 100 |
.toolset-help-content {
|
| 101 |
-
|
| 102 |
-
|
|
|
|
|
|
|
| 103 |
color: #4f4f4f;
|
|
|
|
| 104 |
}
|
| 105 |
|
| 106 |
.toolset-help-content a {
|
|
@@ -129,49 +126,46 @@ span.toolset-alert {
|
|
| 129 |
}
|
| 130 |
.toolset-help-content .btn {
|
| 131 |
margin: 0 10px 0 0;
|
| 132 |
-
padding:
|
| 133 |
border: 0;
|
| 134 |
-
border-radius:
|
| 135 |
background: #11a99b;
|
| 136 |
color: #fff;
|
| 137 |
text-decoration: none;
|
| 138 |
text-shadow: none;
|
| 139 |
font-weight: bold;
|
| 140 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
| 141 |
|
| 142 |
.toolset-help-content .toolset-help-content-toolbar {
|
| 143 |
-
margin: 20px 0
|
| 144 |
}
|
| 145 |
|
| 146 |
.toolset-help-sidebar {
|
| 147 |
position: absolute;
|
| 148 |
-
top:
|
| 149 |
-
|
| 150 |
-
bottom:
|
| 151 |
-
width:
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
background: -
|
| 156 |
-
|
| 157 |
-
background: -ms-linear-gradient(top, #e5f4f3 0%,#dff1f0 100%);
|
| 158 |
-
background: linear-gradient(to bottom, #e5f4f3 0%,#dff1f0 100%);
|
| 159 |
-
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#e5f4f3', endColorstr='#dff1f0',GradientType=0 );
|
| 160 |
}
|
| 161 |
.toolset-help-sidebar-ico {
|
| 162 |
-
|
| 163 |
-
width: 93px;
|
| 164 |
-
height: 83px;
|
| 165 |
-
background: url('../img/icon-help-message.png') center center no-repeat;
|
| 166 |
-
vertical-align: middle;
|
| 167 |
}
|
| 168 |
|
| 169 |
.toolset-help-footer {
|
| 170 |
position: relative;
|
| 171 |
z-index: 1;
|
| 172 |
padding: 5px;
|
| 173 |
-
border-top: 1px solid #
|
| 174 |
-
background: #
|
| 175 |
text-align: right;
|
| 176 |
}
|
| 177 |
|
|
@@ -180,20 +174,24 @@ span.toolset-alert {
|
|
| 180 |
}
|
| 181 |
|
| 182 |
|
| 183 |
-
.toolset-help .icon-remove-sign
|
|
|
|
| 184 |
position: absolute;
|
| 185 |
-
top:
|
| 186 |
-
right:
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
|
|
|
|
|
|
| 190 |
font-size: 16px;
|
| 191 |
-
opacity: .6;
|
| 192 |
cursor: pointer;
|
| 193 |
}
|
| 194 |
|
| 195 |
-
.toolset-help .icon-remove-sign:hover
|
| 196 |
-
|
|
|
|
|
|
|
| 197 |
}
|
| 198 |
|
| 199 |
.toolset-help code {
|
| 81 |
|
| 82 |
/* Explanation messages */
|
| 83 |
.toolset-help {
|
| 84 |
+
display: table;
|
| 85 |
+
width: 100%;
|
| 86 |
+
background: #fff;
|
| 87 |
+
border: none;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 88 |
}
|
| 89 |
|
| 90 |
.js-show-toolset-message {
|
| 92 |
}
|
| 93 |
|
| 94 |
.toolset-help-content {
|
| 95 |
+
display: table-cell;
|
| 96 |
+
vertical-align: middle;
|
| 97 |
+
padding: 25px 25px 15px 180px;
|
| 98 |
+
height: 135px;
|
| 99 |
color: #4f4f4f;
|
| 100 |
+
border: solid 1px #cdcdcd;
|
| 101 |
}
|
| 102 |
|
| 103 |
.toolset-help-content a {
|
| 126 |
}
|
| 127 |
.toolset-help-content .btn {
|
| 128 |
margin: 0 10px 0 0;
|
| 129 |
+
padding: 4px 10px;
|
| 130 |
border: 0;
|
| 131 |
+
border-radius: 4px;
|
| 132 |
background: #11a99b;
|
| 133 |
color: #fff;
|
| 134 |
text-decoration: none;
|
| 135 |
text-shadow: none;
|
| 136 |
font-weight: bold;
|
| 137 |
}
|
| 138 |
+
|
| 139 |
+
.toolset-help-content .btn:hover {
|
| 140 |
+
background: #008C7D;
|
| 141 |
+
}
|
| 142 |
|
| 143 |
.toolset-help-content .toolset-help-content-toolbar {
|
| 144 |
+
margin: 20px 0 10px 0;
|
| 145 |
}
|
| 146 |
|
| 147 |
.toolset-help-sidebar {
|
| 148 |
position: absolute;
|
| 149 |
+
top: 1px;
|
| 150 |
+
left: 1px;
|
| 151 |
+
bottom: 1px;
|
| 152 |
+
width: 144px;
|
| 153 |
+
display: table-cell;
|
| 154 |
+
text-align: center;
|
| 155 |
+
vertical-align: middle;
|
| 156 |
+
background: url('../img/icon-help-message.png') center center no-repeat #333;
|
| 157 |
+
box-shadow: inset 0 0 15px #111;
|
|
|
|
|
|
|
|
|
|
| 158 |
}
|
| 159 |
.toolset-help-sidebar-ico {
|
| 160 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
| 161 |
}
|
| 162 |
|
| 163 |
.toolset-help-footer {
|
| 164 |
position: relative;
|
| 165 |
z-index: 1;
|
| 166 |
padding: 5px;
|
| 167 |
+
border-top: 1px solid #cdcdcd;
|
| 168 |
+
background: #fff;
|
| 169 |
text-align: right;
|
| 170 |
}
|
| 171 |
|
| 174 |
}
|
| 175 |
|
| 176 |
|
| 177 |
+
.toolset-help .icon-remove-sign,
|
| 178 |
+
.toolset-help .icon-remove {
|
| 179 |
position: absolute;
|
| 180 |
+
top: 0;
|
| 181 |
+
right: 0;
|
| 182 |
+
color: #999;
|
| 183 |
+
opacity: 1;
|
| 184 |
+
background: #fff;
|
| 185 |
+
border: solid 1px #cdcdcd;
|
| 186 |
+
padding: 2px 4px;
|
| 187 |
font-size: 16px;
|
|
|
|
| 188 |
cursor: pointer;
|
| 189 |
}
|
| 190 |
|
| 191 |
+
.toolset-help .icon-remove-sign:hover,
|
| 192 |
+
.toolset-help .icon-remove:hover {
|
| 193 |
+
background: #b94a48;
|
| 194 |
+
color: #fff;
|
| 195 |
}
|
| 196 |
|
| 197 |
.toolset-help code {
|
embedded/common/utility/css/select2/select2.css
CHANGED
|
@@ -1,5 +1,5 @@
|
|
| 1 |
/*
|
| 2 |
-
Version: 3.
|
| 3 |
*/
|
| 4 |
.select2-container {
|
| 5 |
margin: 0;
|
|
@@ -18,7 +18,6 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 18 |
/*
|
| 19 |
Force border-box so that % widths fit the parent
|
| 20 |
container without overlap because of margin/padding.
|
| 21 |
-
|
| 22 |
More Info : http://www.quirksmode.org/css/box.html
|
| 23 |
*/
|
| 24 |
-webkit-box-sizing: border-box; /* webkit */
|
|
@@ -33,12 +32,14 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 33 |
overflow: hidden;
|
| 34 |
position: relative;
|
| 35 |
|
| 36 |
-
border: 1px solid #
|
| 37 |
white-space: nowrap;
|
| 38 |
line-height: 26px;
|
| 39 |
-
color: #
|
| 40 |
text-decoration: none;
|
| 41 |
|
|
|
|
|
|
|
| 42 |
background-clip: padding-box;
|
| 43 |
|
| 44 |
-webkit-touch-callout: none;
|
|
@@ -47,23 +48,28 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 47 |
-ms-user-select: none;
|
| 48 |
user-select: none;
|
| 49 |
|
| 50 |
-
|
| 51 |
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 52 |
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 53 |
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 55 |
-
background-image: linear-gradient(top, #
|
|
|
|
|
|
|
|
|
|
|
|
|
| 56 |
}
|
| 57 |
|
| 58 |
.select2-container.select2-drop-above .select2-choice {
|
| 59 |
-
border-bottom-color: #
|
| 60 |
-
|
|
|
|
| 61 |
|
| 62 |
-
|
| 63 |
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 64 |
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 65 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 66 |
-
background-image: linear-gradient(
|
| 67 |
}
|
| 68 |
|
| 69 |
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
|
@@ -76,7 +82,15 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 76 |
overflow: hidden;
|
| 77 |
|
| 78 |
white-space: nowrap;
|
|
|
|
| 79 |
text-overflow: ellipsis;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 80 |
}
|
| 81 |
|
| 82 |
.select2-container .select2-choice abbr {
|
|
@@ -141,15 +155,6 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 141 |
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 142 |
}
|
| 143 |
|
| 144 |
-
.select2-drop-auto-width {
|
| 145 |
-
border-top: 1px solid #aaa;
|
| 146 |
-
width: auto;
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
.select2-drop-auto-width .select2-search {
|
| 150 |
-
padding-top: 4px;
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
.select2-drop.select2-drop-above {
|
| 154 |
margin-top: 1px;
|
| 155 |
border-top: 1px solid #aaa;
|
|
@@ -162,12 +167,21 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 162 |
}
|
| 163 |
|
| 164 |
.select2-drop-active {
|
| 165 |
-
border: 1px solid #
|
| 166 |
border-top: none;
|
| 167 |
}
|
| 168 |
|
| 169 |
.select2-drop.select2-drop-above.select2-drop-active {
|
| 170 |
-
border-top: 1px solid #
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 171 |
}
|
| 172 |
|
| 173 |
.select2-container .select2-choice .select2-arrow {
|
|
@@ -178,8 +192,8 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 178 |
right: 0;
|
| 179 |
top: 0;
|
| 180 |
|
| 181 |
-
border-left: 1px solid #
|
| 182 |
-
|
| 183 |
|
| 184 |
background-clip: padding-box;
|
| 185 |
|
|
@@ -188,7 +202,16 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 188 |
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 189 |
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 190 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 191 |
-
background-image: linear-gradient(top, #ccc 0%, #eee 60%);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 192 |
}
|
| 193 |
|
| 194 |
.select2-container .select2-choice .select2-arrow b {
|
|
@@ -198,6 +221,10 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 198 |
background: url('select2.png') no-repeat 0 1px;
|
| 199 |
}
|
| 200 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 201 |
.select2-search {
|
| 202 |
display: inline-block;
|
| 203 |
width: 100%;
|
|
@@ -233,7 +260,17 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 233 |
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 234 |
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 235 |
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 236 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 237 |
}
|
| 238 |
|
| 239 |
.select2-drop.select2-drop-above .select2-search input {
|
|
@@ -245,12 +282,12 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 245 |
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 246 |
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 247 |
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 248 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(
|
| 249 |
}
|
| 250 |
|
| 251 |
.select2-container-active .select2-choice,
|
| 252 |
.select2-container-active .select2-choices {
|
| 253 |
-
border: 1px solid #
|
| 254 |
outline: none;
|
| 255 |
|
| 256 |
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
|
@@ -265,24 +302,24 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 265 |
border-bottom-left-radius: 0;
|
| 266 |
border-bottom-right-radius: 0;
|
| 267 |
|
| 268 |
-
background-color: #
|
| 269 |
-
|
| 270 |
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 271 |
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 272 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 273 |
-
background-image: linear-gradient(top, #fff 0%, #eee 50%)
|
| 274 |
}
|
| 275 |
|
| 276 |
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 277 |
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 278 |
-
border: 1px solid #
|
| 279 |
border-top-color: transparent;
|
| 280 |
|
| 281 |
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 282 |
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 283 |
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 284 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 285 |
-
background-image: linear-gradient(bottom, #fff 0%, #eee 50%);
|
| 286 |
}
|
| 287 |
|
| 288 |
.select2-dropdown-open .select2-choice .select2-arrow {
|
|
@@ -290,10 +327,29 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 290 |
border-left: none;
|
| 291 |
filter: none;
|
| 292 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
| 293 |
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 294 |
background-position: -18px 1px;
|
| 295 |
}
|
| 296 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 297 |
/* results */
|
| 298 |
.select2-results {
|
| 299 |
max-height: 200px;
|
|
@@ -305,19 +361,16 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 305 |
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 306 |
}
|
| 307 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 308 |
.select2-results ul.select2-result-sub {
|
| 309 |
margin: 0;
|
| 310 |
padding-left: 0;
|
| 311 |
}
|
| 312 |
|
| 313 |
-
.select2-results ul.select2-result-sub > li .select2-result-label { padding-left: 20px }
|
| 314 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 40px }
|
| 315 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 60px }
|
| 316 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 80px }
|
| 317 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 100px }
|
| 318 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 110px }
|
| 319 |
-
.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 120px }
|
| 320 |
-
|
| 321 |
.select2-results li {
|
| 322 |
list-style: none;
|
| 323 |
display: list-item;
|
|
@@ -342,6 +395,14 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 342 |
user-select: none;
|
| 343 |
}
|
| 344 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 345 |
.select2-results .select2-highlighted {
|
| 346 |
background: #3875d7;
|
| 347 |
color: #fff;
|
|
@@ -361,12 +422,13 @@ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
|
|
| 361 |
color: #000;
|
| 362 |
}
|
| 363 |
|
| 364 |
-
|
| 365 |
.select2-results .select2-no-results,
|
| 366 |
.select2-results .select2-searching,
|
|
|
|
| 367 |
.select2-results .select2-selection-limit {
|
| 368 |
background: #f4f4f4;
|
| 369 |
display: list-item;
|
|
|
|
| 370 |
}
|
| 371 |
|
| 372 |
/*
|
|
@@ -392,6 +454,10 @@ disabled look for disabled choices in the results dropdown
|
|
| 392 |
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 393 |
}
|
| 394 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 395 |
.select2-more-results {
|
| 396 |
background: #f4f4f4;
|
| 397 |
display: list-item;
|
|
@@ -423,7 +489,7 @@ disabled look for disabled choices in the results dropdown
|
|
| 423 |
height: auto !important;
|
| 424 |
height: 1%;
|
| 425 |
margin: 0;
|
| 426 |
-
padding: 0;
|
| 427 |
position: relative;
|
| 428 |
|
| 429 |
border: 1px solid #aaa;
|
|
@@ -434,7 +500,11 @@ disabled look for disabled choices in the results dropdown
|
|
| 434 |
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 435 |
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 436 |
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 437 |
-
background-image: linear-gradient(
|
|
|
|
|
|
|
|
|
|
|
|
|
| 438 |
}
|
| 439 |
|
| 440 |
.select2-locked {
|
|
@@ -446,7 +516,7 @@ disabled look for disabled choices in the results dropdown
|
|
| 446 |
}
|
| 447 |
|
| 448 |
.select2-container-multi.select2-container-active .select2-choices {
|
| 449 |
-
border: 1px solid #
|
| 450 |
outline: none;
|
| 451 |
|
| 452 |
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
|
@@ -456,6 +526,10 @@ disabled look for disabled choices in the results dropdown
|
|
| 456 |
float: left;
|
| 457 |
list-style: none;
|
| 458 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
| 459 |
.select2-container-multi .select2-choices .select2-search-field {
|
| 460 |
margin: 0;
|
| 461 |
padding: 0;
|
|
@@ -512,7 +586,12 @@ disabled look for disabled choices in the results dropdown
|
|
| 512 |
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 513 |
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 514 |
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 515 |
-
background-image: linear-gradient(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 516 |
}
|
| 517 |
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 518 |
cursor: default;
|
|
@@ -533,11 +612,20 @@ disabled look for disabled choices in the results dropdown
|
|
| 533 |
outline: none;
|
| 534 |
background: url('select2.png') right top no-repeat;
|
| 535 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
| 536 |
|
| 537 |
.select2-container-multi .select2-search-choice-close {
|
| 538 |
left: 3px;
|
| 539 |
}
|
| 540 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 541 |
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 542 |
background-position: right -11px;
|
| 543 |
}
|
|
@@ -597,15 +685,20 @@ disabled look for disabled choices in the results dropdown
|
|
| 597 |
height: 100px;
|
| 598 |
overflow: scroll;
|
| 599 |
}
|
|
|
|
| 600 |
/* Retina-ize icons */
|
| 601 |
|
| 602 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution:
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
|
| 606 |
-
|
| 607 |
-
|
| 608 |
-
|
| 609 |
-
|
| 610 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 611 |
}
|
| 1 |
/*
|
| 2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
*/
|
| 4 |
.select2-container {
|
| 5 |
margin: 0;
|
| 18 |
/*
|
| 19 |
Force border-box so that % widths fit the parent
|
| 20 |
container without overlap because of margin/padding.
|
|
|
|
| 21 |
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
*/
|
| 23 |
-webkit-box-sizing: border-box; /* webkit */
|
| 32 |
overflow: hidden;
|
| 33 |
position: relative;
|
| 34 |
|
| 35 |
+
border: 1px solid #aaa;
|
| 36 |
white-space: nowrap;
|
| 37 |
line-height: 26px;
|
| 38 |
+
color: #444;
|
| 39 |
text-decoration: none;
|
| 40 |
|
| 41 |
+
border-radius: 4px;
|
| 42 |
+
|
| 43 |
background-clip: padding-box;
|
| 44 |
|
| 45 |
-webkit-touch-callout: none;
|
| 48 |
-ms-user-select: none;
|
| 49 |
user-select: none;
|
| 50 |
|
| 51 |
+
background-color: #fff;
|
| 52 |
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
+
padding: 0 8px 0 0;
|
| 61 |
}
|
| 62 |
|
| 63 |
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
+
border-bottom-color: #aaa;
|
| 65 |
+
|
| 66 |
+
border-radius: 0 0 4px 4px;
|
| 67 |
|
| 68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
}
|
| 74 |
|
| 75 |
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 82 |
overflow: hidden;
|
| 83 |
|
| 84 |
white-space: nowrap;
|
| 85 |
+
|
| 86 |
text-overflow: ellipsis;
|
| 87 |
+
float: none;
|
| 88 |
+
width: auto;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
+
margin-left: 26px;
|
| 93 |
+
margin-right: 0;
|
| 94 |
}
|
| 95 |
|
| 96 |
.select2-container .select2-choice abbr {
|
| 155 |
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
}
|
| 157 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 158 |
.select2-drop.select2-drop-above {
|
| 159 |
margin-top: 1px;
|
| 160 |
border-top: 1px solid #aaa;
|
| 167 |
}
|
| 168 |
|
| 169 |
.select2-drop-active {
|
| 170 |
+
border: 1px solid #5897fb;
|
| 171 |
border-top: none;
|
| 172 |
}
|
| 173 |
|
| 174 |
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
+
border-top: 1px solid #5897fb;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
.select2-drop-auto-width {
|
| 179 |
+
border-top: 1px solid #aaa;
|
| 180 |
+
width: auto;
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
.select2-drop-auto-width .select2-search {
|
| 184 |
+
padding-top: 4px;
|
| 185 |
}
|
| 186 |
|
| 187 |
.select2-container .select2-choice .select2-arrow {
|
| 192 |
right: 0;
|
| 193 |
top: 0;
|
| 194 |
|
| 195 |
+
border-left: 1px solid #aaa;
|
| 196 |
+
border-radius: 0 4px 4px 0;
|
| 197 |
|
| 198 |
background-clip: padding-box;
|
| 199 |
|
| 202 |
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
+
left: 0;
|
| 210 |
+
right: auto;
|
| 211 |
+
|
| 212 |
+
border-left: none;
|
| 213 |
+
border-right: 1px solid #aaa;
|
| 214 |
+
border-radius: 4px 0 0 4px;
|
| 215 |
}
|
| 216 |
|
| 217 |
.select2-container .select2-choice .select2-arrow b {
|
| 221 |
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
}
|
| 223 |
|
| 224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
+
background-position: 2px 1px;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
.select2-search {
|
| 229 |
display: inline-block;
|
| 230 |
width: 100%;
|
| 260 |
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
html[dir="rtl"] .select2-search input {
|
| 267 |
+
padding: 4px 5px 4px 20px;
|
| 268 |
+
|
| 269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
}
|
| 275 |
|
| 276 |
.select2-drop.select2-drop-above .select2-search input {
|
| 282 |
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
}
|
| 287 |
|
| 288 |
.select2-container-active .select2-choice,
|
| 289 |
.select2-container-active .select2-choices {
|
| 290 |
+
border: 1px solid #5897fb;
|
| 291 |
outline: none;
|
| 292 |
|
| 293 |
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 302 |
border-bottom-left-radius: 0;
|
| 303 |
border-bottom-right-radius: 0;
|
| 304 |
|
| 305 |
+
background-color: #eee;
|
| 306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
}
|
| 312 |
|
| 313 |
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
+
border: 1px solid #5897fb;
|
| 316 |
border-top-color: transparent;
|
| 317 |
|
| 318 |
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
}
|
| 324 |
|
| 325 |
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 327 |
border-left: none;
|
| 328 |
filter: none;
|
| 329 |
}
|
| 330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
+
border-right: none;
|
| 332 |
+
}
|
| 333 |
+
|
| 334 |
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
background-position: -18px 1px;
|
| 336 |
}
|
| 337 |
|
| 338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
+
background-position: -16px 1px;
|
| 340 |
+
}
|
| 341 |
+
|
| 342 |
+
.select2-hidden-accessible {
|
| 343 |
+
border: 0;
|
| 344 |
+
clip: rect(0 0 0 0);
|
| 345 |
+
height: 1px;
|
| 346 |
+
margin: -1px;
|
| 347 |
+
overflow: hidden;
|
| 348 |
+
padding: 0;
|
| 349 |
+
position: absolute;
|
| 350 |
+
width: 1px;
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
/* results */
|
| 354 |
.select2-results {
|
| 355 |
max-height: 200px;
|
| 361 |
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
}
|
| 363 |
|
| 364 |
+
html[dir="rtl"] .select2-results {
|
| 365 |
+
padding: 0 4px 0 0;
|
| 366 |
+
margin: 4px 0 4px 4px;
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
.select2-results ul.select2-result-sub {
|
| 370 |
margin: 0;
|
| 371 |
padding-left: 0;
|
| 372 |
}
|
| 373 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 374 |
.select2-results li {
|
| 375 |
list-style: none;
|
| 376 |
display: list-item;
|
| 395 |
user-select: none;
|
| 396 |
}
|
| 397 |
|
| 398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
+
|
| 406 |
.select2-results .select2-highlighted {
|
| 407 |
background: #3875d7;
|
| 408 |
color: #fff;
|
| 422 |
color: #000;
|
| 423 |
}
|
| 424 |
|
|
|
|
| 425 |
.select2-results .select2-no-results,
|
| 426 |
.select2-results .select2-searching,
|
| 427 |
+
.select2-results .select2-ajax-error,
|
| 428 |
.select2-results .select2-selection-limit {
|
| 429 |
background: #f4f4f4;
|
| 430 |
display: list-item;
|
| 431 |
+
padding-left: 5px;
|
| 432 |
}
|
| 433 |
|
| 434 |
/*
|
| 454 |
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
}
|
| 456 |
|
| 457 |
+
.select2-results .select2-ajax-error {
|
| 458 |
+
background: rgba(255, 50, 50, .2);
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
.select2-more-results {
|
| 462 |
background: #f4f4f4;
|
| 463 |
display: list-item;
|
| 489 |
height: auto !important;
|
| 490 |
height: 1%;
|
| 491 |
margin: 0;
|
| 492 |
+
padding: 0 5px 0 0;
|
| 493 |
position: relative;
|
| 494 |
|
| 495 |
border: 1px solid #aaa;
|
| 500 |
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
+
}
|
| 505 |
+
|
| 506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
+
padding: 0 0 0 5px;
|
| 508 |
}
|
| 509 |
|
| 510 |
.select2-locked {
|
| 516 |
}
|
| 517 |
|
| 518 |
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
+
border: 1px solid #5897fb;
|
| 520 |
outline: none;
|
| 521 |
|
| 522 |
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 526 |
float: left;
|
| 527 |
list-style: none;
|
| 528 |
}
|
| 529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
+
{
|
| 531 |
+
float: right;
|
| 532 |
+
}
|
| 533 |
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
margin: 0;
|
| 535 |
padding: 0;
|
| 586 |
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
+
}
|
| 591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
+
{
|
| 593 |
+
margin: 3px 5px 3px 0;
|
| 594 |
+
padding: 3px 18px 3px 5px;
|
| 595 |
}
|
| 596 |
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
cursor: default;
|
| 612 |
outline: none;
|
| 613 |
background: url('select2.png') right top no-repeat;
|
| 614 |
}
|
| 615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
+
right: auto;
|
| 617 |
+
left: 3px;
|
| 618 |
+
}
|
| 619 |
|
| 620 |
.select2-container-multi .select2-search-choice-close {
|
| 621 |
left: 3px;
|
| 622 |
}
|
| 623 |
|
| 624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
+
left: auto;
|
| 626 |
+
right: 2px;
|
| 627 |
+
}
|
| 628 |
+
|
| 629 |
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
background-position: right -11px;
|
| 631 |
}
|
| 685 |
height: 100px;
|
| 686 |
overflow: scroll;
|
| 687 |
}
|
| 688 |
+
|
| 689 |
/* Retina-ize icons */
|
| 690 |
|
| 691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
+
.select2-search input,
|
| 693 |
+
.select2-search-choice-close,
|
| 694 |
+
.select2-container .select2-choice abbr,
|
| 695 |
+
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
+
background-image: url('select2x2.png') !important;
|
| 697 |
+
background-repeat: no-repeat !important;
|
| 698 |
+
background-size: 60px 40px !important;
|
| 699 |
+
}
|
| 700 |
+
|
| 701 |
+
.select2-search input {
|
| 702 |
+
background-position: 100% -21px !important;
|
| 703 |
+
}
|
| 704 |
}
|
embedded/common/utility/img/icon-help-message.png
CHANGED
|
Binary file
|
embedded/common/utility/js/keyboard.js
ADDED
|
@@ -0,0 +1,961 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Title: KeyboardJS
|
| 3 |
+
* Version: v0.4.1
|
| 4 |
+
* Description: KeyboardJS is a flexible and easy to use keyboard binding
|
| 5 |
+
* library.
|
| 6 |
+
* Author: Robert Hurst.
|
| 7 |
+
*
|
| 8 |
+
* Copyright 2011, Robert William Hurst
|
| 9 |
+
* Licenced under the BSD License.
|
| 10 |
+
* See https://raw.github.com/RobertWHurst/KeyboardJS/master/license.txt
|
| 11 |
+
*/
|
| 12 |
+
(function(context, factory) {
|
| 13 |
+
|
| 14 |
+
//INDEXOF POLLYFILL
|
| 15 |
+
[].indexOf||(Array.prototype.indexOf=function(a,b,c){for(c=this.length,b=(c+~~b)%c;b<c&&(!(b in this)||this[b]!==a);b++);return b^c?b:-1;});
|
| 16 |
+
|
| 17 |
+
//AMD
|
| 18 |
+
if(typeof define === 'function' && define.amd) { define(constructAMD); }
|
| 19 |
+
|
| 20 |
+
//CommonJS
|
| 21 |
+
else if(typeof module !== 'undefined') {constructCommonJS()}
|
| 22 |
+
|
| 23 |
+
//GLOBAL
|
| 24 |
+
else { constructGlobal(); }
|
| 25 |
+
|
| 26 |
+
/**
|
| 27 |
+
* Construct AMD version of the library
|
| 28 |
+
*/
|
| 29 |
+
function constructAMD() {
|
| 30 |
+
|
| 31 |
+
//create a library instance
|
| 32 |
+
return init(context);
|
| 33 |
+
|
| 34 |
+
//spawns a library instance
|
| 35 |
+
function init(context) {
|
| 36 |
+
var library;
|
| 37 |
+
library = factory(context, 'amd');
|
| 38 |
+
library.fork = init;
|
| 39 |
+
return library;
|
| 40 |
+
}
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
/**
|
| 44 |
+
* Construct CommonJS version of the library
|
| 45 |
+
*/
|
| 46 |
+
function constructCommonJS() {
|
| 47 |
+
|
| 48 |
+
//create a library instance
|
| 49 |
+
module.exports = init(context);
|
| 50 |
+
|
| 51 |
+
return;
|
| 52 |
+
|
| 53 |
+
//spawns a library instance
|
| 54 |
+
function init(context) {
|
| 55 |
+
var library;
|
| 56 |
+
library = factory(context, 'CommonJS');
|
| 57 |
+
library.fork = init;
|
| 58 |
+
return library;
|
| 59 |
+
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Construct a Global version of the library
|
| 66 |
+
*/
|
| 67 |
+
function constructGlobal() {
|
| 68 |
+
var library;
|
| 69 |
+
|
| 70 |
+
//create a library instance
|
| 71 |
+
library = init(context);
|
| 72 |
+
|
| 73 |
+
//spawns a library instance
|
| 74 |
+
function init(context) {
|
| 75 |
+
var library, namespaces = [], previousValues = {};
|
| 76 |
+
|
| 77 |
+
library = factory(context, 'global');
|
| 78 |
+
library.fork = init;
|
| 79 |
+
library.noConflict = noConflict;
|
| 80 |
+
library.noConflict('KeyboardJS', 'k');
|
| 81 |
+
return library;
|
| 82 |
+
|
| 83 |
+
//sets library namespaces
|
| 84 |
+
function noConflict( ) {
|
| 85 |
+
var args, nI, newNamespaces;
|
| 86 |
+
|
| 87 |
+
newNamespaces = Array.prototype.slice.apply(arguments);
|
| 88 |
+
|
| 89 |
+
for(nI = 0; nI < namespaces.length; nI += 1) {
|
| 90 |
+
if(typeof previousValues[namespaces[nI]] === 'undefined') {
|
| 91 |
+
delete context[namespaces[nI]];
|
| 92 |
+
} else {
|
| 93 |
+
context[namespaces[nI]] = previousValues[namespaces[nI]];
|
| 94 |
+
}
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
previousValues = {};
|
| 98 |
+
|
| 99 |
+
for(nI = 0; nI < newNamespaces.length; nI += 1) {
|
| 100 |
+
if(typeof newNamespaces[nI] !== 'string') {
|
| 101 |
+
throw new Error('Cannot replace namespaces. All new namespaces must be strings.');
|
| 102 |
+
}
|
| 103 |
+
previousValues[newNamespaces[nI]] = context[newNamespaces[nI]];
|
| 104 |
+
context[newNamespaces[nI]] = library;
|
| 105 |
+
}
|
| 106 |
+
|
| 107 |
+
namespaces = newNamespaces;
|
| 108 |
+
|
| 109 |
+
return namespaces;
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
})(this, function(targetWindow, env) {
|
| 115 |
+
var KeyboardJS = {}, locales = {}, locale, map, macros, activeKeys = [], bindings = [], activeBindings = [],
|
| 116 |
+
activeMacros = [], aI, usLocale;
|
| 117 |
+
targetWindow = targetWindow || window;
|
| 118 |
+
|
| 119 |
+
///////////////////////
|
| 120 |
+
// DEFAULT US LOCALE //
|
| 121 |
+
///////////////////////
|
| 122 |
+
|
| 123 |
+
//define US locale
|
| 124 |
+
//If you create a new locale please submit it as a pull request or post
|
| 125 |
+
// it in the issue tracker at
|
| 126 |
+
// http://github.com/RobertWhurst/KeyboardJS/issues/
|
| 127 |
+
usLocale = {
|
| 128 |
+
"map": {
|
| 129 |
+
|
| 130 |
+
//general
|
| 131 |
+
"3": ["cancel"],
|
| 132 |
+
"8": ["backspace"],
|
| 133 |
+
"9": ["tab"],
|
| 134 |
+
"12": ["clear"],
|
| 135 |
+
"13": ["enter"],
|
| 136 |
+
"16": ["shift"],
|
| 137 |
+
"17": ["ctrl"],
|
| 138 |
+
"18": ["alt", "menu"],
|
| 139 |
+
"19": ["pause", "break"],
|
| 140 |
+
"20": ["capslock"],
|
| 141 |
+
"27": ["escape", "esc"],
|
| 142 |
+
"32": ["space", "spacebar"],
|
| 143 |
+
"33": ["pageup"],
|
| 144 |
+
"34": ["pagedown"],
|
| 145 |
+
"35": ["end"],
|
| 146 |
+
"36": ["home"],
|
| 147 |
+
"37": ["left"],
|
| 148 |
+
"38": ["up"],
|
| 149 |
+
"39": ["right"],
|
| 150 |
+
"40": ["down"],
|
| 151 |
+
"41": ["select"],
|
| 152 |
+
"42": ["printscreen"],
|
| 153 |
+
"43": ["execute"],
|
| 154 |
+
"44": ["snapshot"],
|
| 155 |
+
"45": ["insert", "ins"],
|
| 156 |
+
"46": ["delete", "del"],
|
| 157 |
+
"47": ["help"],
|
| 158 |
+
"91": ["command", "windows", "win", "super", "leftcommand", "leftwindows", "leftwin", "leftsuper"],
|
| 159 |
+
"92": ["command", "windows", "win", "super", "rightcommand", "rightwindows", "rightwin", "rightsuper"],
|
| 160 |
+
"145": ["scrolllock", "scroll"],
|
| 161 |
+
"186": ["semicolon", ";"],
|
| 162 |
+
"187": ["equal", "equalsign", "="],
|
| 163 |
+
"188": ["comma", ","],
|
| 164 |
+
"189": ["dash", "-"],
|
| 165 |
+
"190": ["period", "."],
|
| 166 |
+
"191": ["slash", "forwardslash", "/"],
|
| 167 |
+
"192": ["graveaccent", "`"],
|
| 168 |
+
"219": ["openbracket", "["],
|
| 169 |
+
"220": ["backslash", "\\"],
|
| 170 |
+
"221": ["closebracket", "]"],
|
| 171 |
+
"222": ["apostrophe", "'"],
|
| 172 |
+
|
| 173 |
+
//0-9
|
| 174 |
+
"48": ["zero", "0"],
|
| 175 |
+
"49": ["one", "1"],
|
| 176 |
+
"50": ["two", "2"],
|
| 177 |
+
"51": ["three", "3"],
|
| 178 |
+
"52": ["four", "4"],
|
| 179 |
+
"53": ["five", "5"],
|
| 180 |
+
"54": ["six", "6"],
|
| 181 |
+
"55": ["seven", "7"],
|
| 182 |
+
"56": ["eight", "8"],
|
| 183 |
+
"57": ["nine", "9"],
|
| 184 |
+
|
| 185 |
+
//numpad
|
| 186 |
+
"96": ["numzero", "num0"],
|
| 187 |
+
"97": ["numone", "num1"],
|
| 188 |
+
"98": ["numtwo", "num2"],
|
| 189 |
+
"99": ["numthree", "num3"],
|
| 190 |
+
"100": ["numfour", "num4"],
|
| 191 |
+
"101": ["numfive", "num5"],
|
| 192 |
+
"102": ["numsix", "num6"],
|
| 193 |
+
"103": ["numseven", "num7"],
|
| 194 |
+
"104": ["numeight", "num8"],
|
| 195 |
+
"105": ["numnine", "num9"],
|
| 196 |
+
"106": ["nummultiply", "num*"],
|
| 197 |
+
"107": ["numadd", "num+"],
|
| 198 |
+
"108": ["numenter"],
|
| 199 |
+
"109": ["numsubtract", "num-"],
|
| 200 |
+
"110": ["numdecimal", "num."],
|
| 201 |
+
"111": ["numdivide", "num/"],
|
| 202 |
+
"144": ["numlock", "num"],
|
| 203 |
+
|
| 204 |
+
//function keys
|
| 205 |
+
"112": ["f1"],
|
| 206 |
+
"113": ["f2"],
|
| 207 |
+
"114": ["f3"],
|
| 208 |
+
"115": ["f4"],
|
| 209 |
+
"116": ["f5"],
|
| 210 |
+
"117": ["f6"],
|
| 211 |
+
"118": ["f7"],
|
| 212 |
+
"119": ["f8"],
|
| 213 |
+
"120": ["f9"],
|
| 214 |
+
"121": ["f10"],
|
| 215 |
+
"122": ["f11"],
|
| 216 |
+
"123": ["f12"]
|
| 217 |
+
},
|
| 218 |
+
"macros": [
|
| 219 |
+
|
| 220 |
+
//secondary key symbols
|
| 221 |
+
['shift + `', ["tilde", "~"]],
|
| 222 |
+
['shift + 1', ["exclamation", "exclamationpoint", "!"]],
|
| 223 |
+
['shift + 2', ["at", "@"]],
|
| 224 |
+
['shift + 3', ["number", "#"]],
|
| 225 |
+
['shift + 4', ["dollar", "dollars", "dollarsign", "$"]],
|
| 226 |
+
['shift + 5', ["percent", "%"]],
|
| 227 |
+
['shift + 6', ["caret", "^"]],
|
| 228 |
+
['shift + 7', ["ampersand", "and", "&"]],
|
| 229 |
+
['shift + 8', ["asterisk", "*"]],
|
| 230 |
+
['shift + 9', ["openparen", "("]],
|
| 231 |
+
['shift + 0', ["closeparen", ")"]],
|
| 232 |
+
['shift + -', ["underscore", "_"]],
|
| 233 |
+
['shift + =', ["plus", "+"]],
|
| 234 |
+
['shift + (', ["opencurlybrace", "opencurlybracket", "{"]],
|
| 235 |
+
['shift + )', ["closecurlybrace", "closecurlybracket", "}"]],
|
| 236 |
+
['shift + \\', ["verticalbar", "|"]],
|
| 237 |
+
['shift + ;', ["colon", ":"]],
|
| 238 |
+
['shift + \'', ["quotationmark", "\""]],
|
| 239 |
+
['shift + !,', ["openanglebracket", "<"]],
|
| 240 |
+
['shift + .', ["closeanglebracket", ">"]],
|
| 241 |
+
['shift + /', ["questionmark", "?"]]
|
| 242 |
+
]
|
| 243 |
+
};
|
| 244 |
+
//a-z and A-Z
|
| 245 |
+
for (aI = 65; aI <= 90; aI += 1) {
|
| 246 |
+
usLocale.map[aI] = String.fromCharCode(aI + 32);
|
| 247 |
+
usLocale.macros.push(['shift + ' + String.fromCharCode(aI + 32) + ', capslock + ' + String.fromCharCode(aI + 32), [String.fromCharCode(aI)]]);
|
| 248 |
+
}
|
| 249 |
+
registerLocale('us', usLocale);
|
| 250 |
+
getSetLocale('us');
|
| 251 |
+
|
| 252 |
+
|
| 253 |
+
//////////
|
| 254 |
+
// INIT //
|
| 255 |
+
//////////
|
| 256 |
+
|
| 257 |
+
//enable the library
|
| 258 |
+
enable();
|
| 259 |
+
|
| 260 |
+
|
| 261 |
+
/////////
|
| 262 |
+
// API //
|
| 263 |
+
/////////
|
| 264 |
+
|
| 265 |
+
//assemble the library and return it
|
| 266 |
+
KeyboardJS.enable = enable;
|
| 267 |
+
KeyboardJS.disable = disable;
|
| 268 |
+
KeyboardJS.activeKeys = getActiveKeys;
|
| 269 |
+
KeyboardJS.releaseKey = removeActiveKey;
|
| 270 |
+
KeyboardJS.pressKey = addActiveKey;
|
| 271 |
+
KeyboardJS.on = createBinding;
|
| 272 |
+
KeyboardJS.clear = removeBindingByKeyCombo;
|
| 273 |
+
KeyboardJS.clear.key = removeBindingByKeyName;
|
| 274 |
+
KeyboardJS.locale = getSetLocale;
|
| 275 |
+
KeyboardJS.locale.register = registerLocale;
|
| 276 |
+
KeyboardJS.macro = createMacro;
|
| 277 |
+
KeyboardJS.macro.remove = removeMacro;
|
| 278 |
+
KeyboardJS.key = {};
|
| 279 |
+
KeyboardJS.key.name = getKeyName;
|
| 280 |
+
KeyboardJS.key.code = getKeyCode;
|
| 281 |
+
KeyboardJS.combo = {};
|
| 282 |
+
KeyboardJS.combo.active = isSatisfiedCombo;
|
| 283 |
+
KeyboardJS.combo.parse = parseKeyCombo;
|
| 284 |
+
KeyboardJS.combo.stringify = stringifyKeyCombo;
|
| 285 |
+
return KeyboardJS;
|
| 286 |
+
|
| 287 |
+
|
| 288 |
+
//////////////////////
|
| 289 |
+
// INSTANCE METHODS //
|
| 290 |
+
//////////////////////
|
| 291 |
+
|
| 292 |
+
/**
|
| 293 |
+
* Enables KeyboardJS
|
| 294 |
+
*/
|
| 295 |
+
function enable() {
|
| 296 |
+
if(targetWindow.addEventListener) {
|
| 297 |
+
targetWindow.document.addEventListener('keydown', keydown, false);
|
| 298 |
+
targetWindow.document.addEventListener('keyup', keyup, false);
|
| 299 |
+
targetWindow.addEventListener('blur', reset, false);
|
| 300 |
+
targetWindow.addEventListener('webkitfullscreenchange', reset, false);
|
| 301 |
+
targetWindow.addEventListener('mozfullscreenchange', reset, false);
|
| 302 |
+
} else if(targetWindow.attachEvent) {
|
| 303 |
+
targetWindow.document.attachEvent('onkeydown', keydown);
|
| 304 |
+
targetWindow.document.attachEvent('onkeyup', keyup);
|
| 305 |
+
targetWindow.attachEvent('onblur', reset);
|
| 306 |
+
}
|
| 307 |
+
}
|
| 308 |
+
|
| 309 |
+
/**
|
| 310 |
+
* Exits all active bindings and disables KeyboardJS
|
| 311 |
+
*/
|
| 312 |
+
function disable() {
|
| 313 |
+
reset();
|
| 314 |
+
if(targetWindow.removeEventListener) {
|
| 315 |
+
targetWindow.document.removeEventListener('keydown', keydown, false);
|
| 316 |
+
targetWindow.document.removeEventListener('keyup', keyup, false);
|
| 317 |
+
targetWindow.removeEventListener('blur', reset, false);
|
| 318 |
+
targetWindow.removeEventListener('webkitfullscreenchange', reset, false);
|
| 319 |
+
targetWindow.removeEventListener('mozfullscreenchange', reset, false);
|
| 320 |
+
} else if(targetWindow.detachEvent) {
|
| 321 |
+
targetWindow.document.detachEvent('onkeydown', keydown);
|
| 322 |
+
targetWindow.document.detachEvent('onkeyup', keyup);
|
| 323 |
+
targetWindow.detachEvent('onblur', reset);
|
| 324 |
+
}
|
| 325 |
+
}
|
| 326 |
+
|
| 327 |
+
|
| 328 |
+
////////////////////
|
| 329 |
+
// EVENT HANDLERS //
|
| 330 |
+
////////////////////
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* Exits all active bindings. Optionally passes an event to all binding
|
| 334 |
+
* handlers.
|
| 335 |
+
* @param {KeyboardEvent} event [Optional]
|
| 336 |
+
*/
|
| 337 |
+
function reset(event) {
|
| 338 |
+
activeKeys = [];
|
| 339 |
+
pruneMacros();
|
| 340 |
+
pruneBindings(event);
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
/**
|
| 344 |
+
* Key down event handler.
|
| 345 |
+
* @param {KeyboardEvent} event
|
| 346 |
+
*/
|
| 347 |
+
function keydown(event) {
|
| 348 |
+
var keyNames, keyName, kI;
|
| 349 |
+
keyNames = getKeyName(event.keyCode);
|
| 350 |
+
if(keyNames.length < 1) { return; }
|
| 351 |
+
event.isRepeat = false;
|
| 352 |
+
for(kI = 0; kI < keyNames.length; kI += 1) {
|
| 353 |
+
keyName = keyNames[kI];
|
| 354 |
+
if (getActiveKeys().indexOf(keyName) != -1)
|
| 355 |
+
event.isRepeat = true;
|
| 356 |
+
addActiveKey(keyName);
|
| 357 |
+
}
|
| 358 |
+
executeMacros();
|
| 359 |
+
executeBindings(event);
|
| 360 |
+
}
|
| 361 |
+
|
| 362 |
+
/**
|
| 363 |
+
* Key up event handler.
|
| 364 |
+
* @param {KeyboardEvent} event
|
| 365 |
+
*/
|
| 366 |
+
function keyup(event) {
|
| 367 |
+
var keyNames, kI;
|
| 368 |
+
keyNames = getKeyName(event.keyCode);
|
| 369 |
+
if(keyNames.length < 1) { return; }
|
| 370 |
+
for(kI = 0; kI < keyNames.length; kI += 1) {
|
| 371 |
+
removeActiveKey(keyNames[kI]);
|
| 372 |
+
}
|
| 373 |
+
pruneMacros();
|
| 374 |
+
pruneBindings(event);
|
| 375 |
+
}
|
| 376 |
+
|
| 377 |
+
/**
|
| 378 |
+
* Accepts a key code and returns the key names defined by the current
|
| 379 |
+
* locale.
|
| 380 |
+
* @param {Number} keyCode
|
| 381 |
+
* @return {Array} keyNames An array of key names defined for the key
|
| 382 |
+
* code as defined by the current locale.
|
| 383 |
+
*/
|
| 384 |
+
function getKeyName(keyCode) {
|
| 385 |
+
return map[keyCode] || [];
|
| 386 |
+
}
|
| 387 |
+
|
| 388 |
+
/**
|
| 389 |
+
* Accepts a key name and returns the key code defined by the current
|
| 390 |
+
* locale.
|
| 391 |
+
* @param {Number} keyName
|
| 392 |
+
* @return {Number|false}
|
| 393 |
+
*/
|
| 394 |
+
function getKeyCode(keyName) {
|
| 395 |
+
var keyCode;
|
| 396 |
+
for(keyCode in map) {
|
| 397 |
+
if(!map.hasOwnProperty(keyCode)) { continue; }
|
| 398 |
+
if(map[keyCode].indexOf(keyName) > -1) { return keyCode; }
|
| 399 |
+
}
|
| 400 |
+
return false;
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
|
| 404 |
+
////////////
|
| 405 |
+
// MACROS //
|
| 406 |
+
////////////
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
* Accepts a key combo and an array of key names to inject once the key
|
| 410 |
+
* combo is satisfied.
|
| 411 |
+
* @param {String} combo
|
| 412 |
+
* @param {Array} injectedKeys
|
| 413 |
+
*/
|
| 414 |
+
function createMacro(combo, injectedKeys) {
|
| 415 |
+
if(typeof combo !== 'string' && (typeof combo !== 'object' || typeof combo.push !== 'function')) {
|
| 416 |
+
throw new Error("Cannot create macro. The combo must be a string or array.");
|
| 417 |
+
}
|
| 418 |
+
if(typeof injectedKeys !== 'object' || typeof injectedKeys.push !== 'function') {
|
| 419 |
+
throw new Error("Cannot create macro. The injectedKeys must be an array.");
|
| 420 |
+
}
|
| 421 |
+
macros.push([combo, injectedKeys]);
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
/**
|
| 425 |
+
* Accepts a key combo and clears any and all macros bound to that key
|
| 426 |
+
* combo.
|
| 427 |
+
* @param {String} combo
|
| 428 |
+
*/
|
| 429 |
+
function removeMacro(combo) {
|
| 430 |
+
var macro;
|
| 431 |
+
if(typeof combo !== 'string' && (typeof combo !== 'object' || typeof combo.push !== 'function')) { throw new Error("Cannot remove macro. The combo must be a string or array."); }
|
| 432 |
+
for(mI = 0; mI < macros.length; mI += 1) {
|
| 433 |
+
macro = macros[mI];
|
| 434 |
+
if(compareCombos(combo, macro[0])) {
|
| 435 |
+
removeActiveKey(macro[1]);
|
| 436 |
+
macros.splice(mI, 1);
|
| 437 |
+
break;
|
| 438 |
+
}
|
| 439 |
+
}
|
| 440 |
+
}
|
| 441 |
+
|
| 442 |
+
/**
|
| 443 |
+
* Executes macros against the active keys. Each macro's key combo is
|
| 444 |
+
* checked and if found to be satisfied, the macro's key names are injected
|
| 445 |
+
* into active keys.
|
| 446 |
+
*/
|
| 447 |
+
function executeMacros() {
|
| 448 |
+
var mI, combo, kI;
|
| 449 |
+
for(mI = 0; mI < macros.length; mI += 1) {
|
| 450 |
+
combo = parseKeyCombo(macros[mI][0]);
|
| 451 |
+
if(activeMacros.indexOf(macros[mI]) === -1 && isSatisfiedCombo(combo)) {
|
| 452 |
+
activeMacros.push(macros[mI]);
|
| 453 |
+
for(kI = 0; kI < macros[mI][1].length; kI += 1) {
|
| 454 |
+
addActiveKey(macros[mI][1][kI]);
|
| 455 |
+
}
|
| 456 |
+
}
|
| 457 |
+
}
|
| 458 |
+
}
|
| 459 |
+
|
| 460 |
+
/**
|
| 461 |
+
* Prunes active macros. Checks each active macro's key combo and if found
|
| 462 |
+
* to no longer to be satisfied, each of the macro's key names are removed
|
| 463 |
+
* from active keys.
|
| 464 |
+
*/
|
| 465 |
+
function pruneMacros() {
|
| 466 |
+
var mI, combo, kI;
|
| 467 |
+
for(mI = 0; mI < activeMacros.length; mI += 1) {
|
| 468 |
+
combo = parseKeyCombo(activeMacros[mI][0]);
|
| 469 |
+
if(isSatisfiedCombo(combo) === false) {
|
| 470 |
+
for(kI = 0; kI < activeMacros[mI][1].length; kI += 1) {
|
| 471 |
+
removeActiveKey(activeMacros[mI][1][kI]);
|
| 472 |
+
}
|
| 473 |
+
activeMacros.splice(mI, 1);
|
| 474 |
+
mI -= 1;
|
| 475 |
+
}
|
| 476 |
+
}
|
| 477 |
+
}
|
| 478 |
+
|
| 479 |
+
|
| 480 |
+
//////////////
|
| 481 |
+
// BINDINGS //
|
| 482 |
+
//////////////
|
| 483 |
+
|
| 484 |
+
/**
|
| 485 |
+
* Creates a binding object, and, if provided, binds a key down hander and
|
| 486 |
+
* a key up handler. Returns a binding object that emits keyup and
|
| 487 |
+
* keydown events.
|
| 488 |
+
* @param {String} keyCombo
|
| 489 |
+
* @param {Function} keyDownCallback [Optional]
|
| 490 |
+
* @param {Function} keyUpCallback [Optional]
|
| 491 |
+
* @return {Object} binding
|
| 492 |
+
*/
|
| 493 |
+
function createBinding(keyCombo, keyDownCallback, keyUpCallback) {
|
| 494 |
+
var api = {}, binding, subBindings = [], bindingApi = {}, kI,
|
| 495 |
+
subCombo;
|
| 496 |
+
|
| 497 |
+
//break the combo down into a combo array
|
| 498 |
+
if(typeof keyCombo === 'string') {
|
| 499 |
+
keyCombo = parseKeyCombo(keyCombo);
|
| 500 |
+
}
|
| 501 |
+
|
| 502 |
+
//bind each sub combo contained within the combo string
|
| 503 |
+
for(kI = 0; kI < keyCombo.length; kI += 1) {
|
| 504 |
+
binding = {};
|
| 505 |
+
|
| 506 |
+
//stringify the combo again
|
| 507 |
+
subCombo = stringifyKeyCombo([keyCombo[kI]]);
|
| 508 |
+
|
| 509 |
+
//validate the sub combo
|
| 510 |
+
if(typeof subCombo !== 'string') { throw new Error('Failed to bind key combo. The key combo must be string.'); }
|
| 511 |
+
|
| 512 |
+
//create the binding
|
| 513 |
+
binding.keyCombo = subCombo;
|
| 514 |
+
binding.keyDownCallback = [];
|
| 515 |
+
binding.keyUpCallback = [];
|
| 516 |
+
|
| 517 |
+
//inject the key down and key up callbacks if given
|
| 518 |
+
if(keyDownCallback) { binding.keyDownCallback.push(keyDownCallback); }
|
| 519 |
+
if(keyUpCallback) { binding.keyUpCallback.push(keyUpCallback); }
|
| 520 |
+
|
| 521 |
+
//stash the new binding
|
| 522 |
+
bindings.push(binding);
|
| 523 |
+
subBindings.push(binding);
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
//build the binding api
|
| 527 |
+
api.clear = clear;
|
| 528 |
+
api.on = on;
|
| 529 |
+
return api;
|
| 530 |
+
|
| 531 |
+
/**
|
| 532 |
+
* Clears the binding
|
| 533 |
+
*/
|
| 534 |
+
function clear() {
|
| 535 |
+
var bI;
|
| 536 |
+
for(bI = 0; bI < subBindings.length; bI += 1) {
|
| 537 |
+
bindings.splice(bindings.indexOf(subBindings[bI]), 1);
|
| 538 |
+
}
|
| 539 |
+
}
|
| 540 |
+
|
| 541 |
+
/**
|
| 542 |
+
* Accepts an event name. and any number of callbacks. When the event is
|
| 543 |
+
* emitted, all callbacks are executed. Available events are key up and
|
| 544 |
+
* key down.
|
| 545 |
+
* @param {String} eventName
|
| 546 |
+
* @return {Object} subBinding
|
| 547 |
+
*/
|
| 548 |
+
function on(eventName ) {
|
| 549 |
+
var api = {}, callbacks, cI, bI;
|
| 550 |
+
|
| 551 |
+
//validate event name
|
| 552 |
+
if(typeof eventName !== 'string') { throw new Error('Cannot bind callback. The event name must be a string.'); }
|
| 553 |
+
if(eventName !== 'keyup' && eventName !== 'keydown') { throw new Error('Cannot bind callback. The event name must be a "keyup" or "keydown".'); }
|
| 554 |
+
|
| 555 |
+
//gather the callbacks
|
| 556 |
+
callbacks = Array.prototype.slice.apply(arguments, [1]);
|
| 557 |
+
|
| 558 |
+
//stash each the new binding
|
| 559 |
+
for(cI = 0; cI < callbacks.length; cI += 1) {
|
| 560 |
+
if(typeof callbacks[cI] === 'function') {
|
| 561 |
+
if(eventName === 'keyup') {
|
| 562 |
+
for(bI = 0; bI < subBindings.length; bI += 1) {
|
| 563 |
+
subBindings[bI].keyUpCallback.push(callbacks[cI]);
|
| 564 |
+
}
|
| 565 |
+
} else if(eventName === 'keydown') {
|
| 566 |
+
for(bI = 0; bI < subBindings.length; bI += 1) {
|
| 567 |
+
subBindings[bI].keyDownCallback.push(callbacks[cI]);
|
| 568 |
+
}
|
| 569 |
+
}
|
| 570 |
+
}
|
| 571 |
+
}
|
| 572 |
+
|
| 573 |
+
//construct and return the sub binding api
|
| 574 |
+
api.clear = clear;
|
| 575 |
+
return api;
|
| 576 |
+
|
| 577 |
+
/**
|
| 578 |
+
* Clears the binding
|
| 579 |
+
*/
|
| 580 |
+
function clear() {
|
| 581 |
+
var cI, bI;
|
| 582 |
+
for(cI = 0; cI < callbacks.length; cI += 1) {
|
| 583 |
+
if(typeof callbacks[cI] === 'function') {
|
| 584 |
+
if(eventName === 'keyup') {
|
| 585 |
+
for(bI = 0; bI < subBindings.length; bI += 1) {
|
| 586 |
+
subBindings[bI].keyUpCallback.splice(subBindings[bI].keyUpCallback.indexOf(callbacks[cI]), 1);
|
| 587 |
+
}
|
| 588 |
+
} else {
|
| 589 |
+
for(bI = 0; bI < subBindings.length; bI += 1) {
|
| 590 |
+
subBindings[bI].keyDownCallback.splice(subBindings[bI].keyDownCallback.indexOf(callbacks[cI]), 1);
|
| 591 |
+
}
|
| 592 |
+
}
|
| 593 |
+
}
|
| 594 |
+
}
|
| 595 |
+
}
|
| 596 |
+
}
|
| 597 |
+
}
|
| 598 |
+
|
| 599 |
+
/**
|
| 600 |
+
* Clears all binding attached to a given key combo. Key name order does not
|
| 601 |
+
* matter as long as the key combos equate.
|
| 602 |
+
* @param {String} keyCombo
|
| 603 |
+
*/
|
| 604 |
+
function removeBindingByKeyCombo(keyCombo) {
|
| 605 |
+
var bI, binding, keyName;
|
| 606 |
+
for(bI = 0; bI < bindings.length; bI += 1) {
|
| 607 |
+
binding = bindings[bI];
|
| 608 |
+
if(compareCombos(keyCombo, binding.keyCombo)) {
|
| 609 |
+
bindings.splice(bI, 1); bI -= 1;
|
| 610 |
+
}
|
| 611 |
+
}
|
| 612 |
+
}
|
| 613 |
+
|
| 614 |
+
/**
|
| 615 |
+
* Clears all binding attached to key combos containing a given key name.
|
| 616 |
+
* @param {String} keyName
|
| 617 |
+
*/
|
| 618 |
+
function removeBindingByKeyName(keyName) {
|
| 619 |
+
var bI, kI, binding;
|
| 620 |
+
if(keyName) {
|
| 621 |
+
for(bI = 0; bI < bindings.length; bI += 1) {
|
| 622 |
+
binding = bindings[bI];
|
| 623 |
+
for(kI = 0; kI < binding.keyCombo.length; kI += 1) {
|
| 624 |
+
if(binding.keyCombo[kI].indexOf(keyName) > -1) {
|
| 625 |
+
bindings.splice(bI, 1); bI -= 1;
|
| 626 |
+
break;
|
| 627 |
+
}
|
| 628 |
+
}
|
| 629 |
+
}
|
| 630 |
+
} else {
|
| 631 |
+
bindings = [];
|
| 632 |
+
}
|
| 633 |
+
}
|
| 634 |
+
|
| 635 |
+
/**
|
| 636 |
+
* Executes bindings that are active. Only allows the keys to be used once
|
| 637 |
+
* as to prevent binding overlap.
|
| 638 |
+
* @param {KeyboardEvent} event The keyboard event.
|
| 639 |
+
*/
|
| 640 |
+
function executeBindings(event) {
|
| 641 |
+
var bI, sBI, binding, bindingKeys, remainingKeys, cI, killEventBubble, kI, bindingKeysSatisfied,
|
| 642 |
+
index, sortedBindings = [], bindingWeight;
|
| 643 |
+
|
| 644 |
+
remainingKeys = [].concat(activeKeys);
|
| 645 |
+
for(bI = 0; bI < bindings.length; bI += 1) {
|
| 646 |
+
bindingWeight = extractComboKeys(bindings[bI].keyCombo).length;
|
| 647 |
+
if(!sortedBindings[bindingWeight]) { sortedBindings[bindingWeight] = []; }
|
| 648 |
+
sortedBindings[bindingWeight].push(bindings[bI]);
|
| 649 |
+
}
|
| 650 |
+
for(sBI = sortedBindings.length - 1; sBI >= 0; sBI -= 1) {
|
| 651 |
+
if(!sortedBindings[sBI]) { continue; }
|
| 652 |
+
for(bI = 0; bI < sortedBindings[sBI].length; bI += 1) {
|
| 653 |
+
binding = sortedBindings[sBI][bI];
|
| 654 |
+
bindingKeys = extractComboKeys(binding.keyCombo);
|
| 655 |
+
bindingKeysSatisfied = true;
|
| 656 |
+
for(kI = 0; kI < bindingKeys.length; kI += 1) {
|
| 657 |
+
if(remainingKeys.indexOf(bindingKeys[kI]) === -1) {
|
| 658 |
+
bindingKeysSatisfied = false;
|
| 659 |
+
break;
|
| 660 |
+
}
|
| 661 |
+
}
|
| 662 |
+
if(bindingKeysSatisfied && isSatisfiedCombo(binding.keyCombo)) {
|
| 663 |
+
activeBindings.push(binding);
|
| 664 |
+
for(kI = 0; kI < bindingKeys.length; kI += 1) {
|
| 665 |
+
index = remainingKeys.indexOf(bindingKeys[kI]);
|
| 666 |
+
if(index > -1) {
|
| 667 |
+
remainingKeys.splice(index, 1);
|
| 668 |
+
kI -= 1;
|
| 669 |
+
}
|
| 670 |
+
}
|
| 671 |
+
for(cI = 0; cI < binding.keyDownCallback.length; cI += 1) {
|
| 672 |
+
if (binding.keyDownCallback[cI](event, getActiveKeys(), binding.keyCombo) === false) {
|
| 673 |
+
killEventBubble = true;
|
| 674 |
+
}
|
| 675 |
+
}
|
| 676 |
+
if(killEventBubble === true) {
|
| 677 |
+
event.preventDefault();
|
| 678 |
+
event.stopPropagation();
|
| 679 |
+
}
|
| 680 |
+
}
|
| 681 |
+
}
|
| 682 |
+
}
|
| 683 |
+
}
|
| 684 |
+
|
| 685 |
+
/**
|
| 686 |
+
* Removes bindings that are no longer satisfied by the active keys. Also
|
| 687 |
+
* fires the key up callbacks.
|
| 688 |
+
* @param {KeyboardEvent} event
|
| 689 |
+
*/
|
| 690 |
+
function pruneBindings(event) {
|
| 691 |
+
var bI, cI, binding, killEventBubble;
|
| 692 |
+
for(bI = 0; bI < activeBindings.length; bI += 1) {
|
| 693 |
+
binding = activeBindings[bI];
|
| 694 |
+
if(isSatisfiedCombo(binding.keyCombo) === false) {
|
| 695 |
+
for(cI = 0; cI < binding.keyUpCallback.length; cI += 1) {
|
| 696 |
+
if (binding.keyUpCallback[cI](event, getActiveKeys(), binding.keyCombo) === false) {
|
| 697 |
+
killEventBubble = true;
|
| 698 |
+
}
|
| 699 |
+
}
|
| 700 |
+
if(killEventBubble === true) {
|
| 701 |
+
event.preventDefault();
|
| 702 |
+
event.stopPropagation();
|
| 703 |
+
}
|
| 704 |
+
activeBindings.splice(bI, 1);
|
| 705 |
+
bI -= 1;
|
| 706 |
+
}
|
| 707 |
+
}
|
| 708 |
+
}
|
| 709 |
+
|
| 710 |
+
|
| 711 |
+
///////////////////
|
| 712 |
+
// COMBO STRINGS //
|
| 713 |
+
///////////////////
|
| 714 |
+
|
| 715 |
+
/**
|
| 716 |
+
* Compares two key combos returning true when they are functionally
|
| 717 |
+
* equivalent.
|
| 718 |
+
* @param {String} keyComboArrayA keyCombo A key combo string or array.
|
| 719 |
+
* @param {String} keyComboArrayB keyCombo A key combo string or array.
|
| 720 |
+
* @return {Boolean}
|
| 721 |
+
*/
|
| 722 |
+
function compareCombos(keyComboArrayA, keyComboArrayB) {
|
| 723 |
+
var cI, sI, kI;
|
| 724 |
+
keyComboArrayA = parseKeyCombo(keyComboArrayA);
|
| 725 |
+
keyComboArrayB = parseKeyCombo(keyComboArrayB);
|
| 726 |
+
if(keyComboArrayA.length !== keyComboArrayB.length) { return false; }
|
| 727 |
+
for(cI = 0; cI < keyComboArrayA.length; cI += 1) {
|
| 728 |
+
if(keyComboArrayA[cI].length !== keyComboArrayB[cI].length) { return false; }
|
| 729 |
+
for(sI = 0; sI < keyComboArrayA[cI].length; sI += 1) {
|
| 730 |
+
if(keyComboArrayA[cI][sI].length !== keyComboArrayB[cI][sI].length) { return false; }
|
| 731 |
+
for(kI = 0; kI < keyComboArrayA[cI][sI].length; kI += 1) {
|
| 732 |
+
if(keyComboArrayB[cI][sI].indexOf(keyComboArrayA[cI][sI][kI]) === -1) { return false; }
|
| 733 |
+
}
|
| 734 |
+
}
|
| 735 |
+
}
|
| 736 |
+
return true;
|
| 737 |
+
}
|
| 738 |
+
|
| 739 |
+
/**
|
| 740 |
+
* Checks to see if a key combo string or key array is satisfied by the
|
| 741 |
+
* currently active keys. It does not take into account spent keys.
|
| 742 |
+
* @param {String} keyCombo A key combo string or array.
|
| 743 |
+
* @return {Boolean}
|
| 744 |
+
*/
|
| 745 |
+
function isSatisfiedCombo(keyCombo) {
|
| 746 |
+
var cI, sI, stage, kI, stageOffset = 0, index, comboMatches;
|
| 747 |
+
keyCombo = parseKeyCombo(keyCombo);
|
| 748 |
+
for(cI = 0; cI < keyCombo.length; cI += 1) {
|
| 749 |
+
comboMatches = true;
|
| 750 |
+
stageOffset = 0;
|
| 751 |
+
for(sI = 0; sI < keyCombo[cI].length; sI += 1) {
|
| 752 |
+
stage = [].concat(keyCombo[cI][sI]);
|
| 753 |
+
for(kI = stageOffset; kI < activeKeys.length; kI += 1) {
|
| 754 |
+
index = stage.indexOf(activeKeys[kI]);
|
| 755 |
+
if(index > -1) {
|
| 756 |
+
stage.splice(index, 1);
|
| 757 |
+
stageOffset = kI;
|
| 758 |
+
}
|
| 759 |
+
}
|
| 760 |
+
if(stage.length !== 0) { comboMatches = false; break; }
|
| 761 |
+
}
|
| 762 |
+
if(comboMatches) { return true; }
|
| 763 |
+
}
|
| 764 |
+
return false;
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
/**
|
| 768 |
+
* Accepts a key combo array or string and returns a flat array containing all keys referenced by
|
| 769 |
+
* the key combo.
|
| 770 |
+
* @param {String} keyCombo A key combo string or array.
|
| 771 |
+
* @return {Array}
|
| 772 |
+
*/
|
| 773 |
+
function extractComboKeys(keyCombo) {
|
| 774 |
+
var cI, sI, kI, keys = [];
|
| 775 |
+
keyCombo = parseKeyCombo(keyCombo);
|
| 776 |
+
for(cI = 0; cI < keyCombo.length; cI += 1) {
|
| 777 |
+
for(sI = 0; sI < keyCombo[cI].length; sI += 1) {
|
| 778 |
+
keys = keys.concat(keyCombo[cI][sI]);
|
| 779 |
+
}
|
| 780 |
+
}
|
| 781 |
+
return keys;
|
| 782 |
+
}
|
| 783 |
+
|
| 784 |
+
/**
|
| 785 |
+
* Parses a key combo string into a 3 dimensional array.
|
| 786 |
+
* - Level 1 - sub combos.
|
| 787 |
+
* - Level 2 - combo stages. A stage is a set of key name pairs that must
|
| 788 |
+
* be satisfied in the order they are defined.
|
| 789 |
+
* - Level 3 - each key name to the stage.
|
| 790 |
+
* @param {String|Array} keyCombo A key combo string.
|
| 791 |
+
* @return {Array}
|
| 792 |
+
*/
|
| 793 |
+
function parseKeyCombo(keyCombo) {
|
| 794 |
+
var s = keyCombo, i = 0, op = 0, ws = false, nc = false, combos = [], combo = [], stage = [], key = '';
|
| 795 |
+
|
| 796 |
+
if(typeof keyCombo === 'object' && typeof keyCombo.push === 'function') { return keyCombo; }
|
| 797 |
+
if(typeof keyCombo !== 'string') { throw new Error('Cannot parse "keyCombo" because its type is "' + (typeof keyCombo) + '". It must be a "string".'); }
|
| 798 |
+
|
| 799 |
+
//remove leading whitespace
|
| 800 |
+
while(s.charAt(i) === ' ') { i += 1; }
|
| 801 |
+
while(true) {
|
| 802 |
+
if(s.charAt(i) === ' ') {
|
| 803 |
+
//white space & next combo op
|
| 804 |
+
while(s.charAt(i) === ' ') { i += 1; }
|
| 805 |
+
ws = true;
|
| 806 |
+
} else if(s.charAt(i) === ',') {
|
| 807 |
+
if(op || nc) { throw new Error('Failed to parse key combo. Unexpected , at character index ' + i + '.'); }
|
| 808 |
+
nc = true;
|
| 809 |
+
i += 1;
|
| 810 |
+
} else if(s.charAt(i) === '+') {
|
| 811 |
+
//next key
|
| 812 |
+
if(key.length) { stage.push(key); key = ''; }
|
| 813 |
+
if(op || nc) { throw new Error('Failed to parse key combo. Unexpected + at character index ' + i + '.'); }
|
| 814 |
+
op = true;
|
| 815 |
+
i += 1;
|
| 816 |
+
} else if(s.charAt(i) === '>') {
|
| 817 |
+
//next stage op
|
| 818 |
+
if(key.length) { stage.push(key); key = ''; }
|
| 819 |
+
if(stage.length) { combo.push(stage); stage = []; }
|
| 820 |
+
if(op || nc) { throw new Error('Failed to parse key combo. Unexpected > at character index ' + i + '.'); }
|
| 821 |
+
op = true;
|
| 822 |
+
i += 1;
|
| 823 |
+
} else if(i < s.length - 1 && s.charAt(i) === '!' && (s.charAt(i + 1) === '>' || s.charAt(i + 1) === ',' || s.charAt(i + 1) === '+')) {
|
| 824 |
+
key += s.charAt(i + 1);
|
| 825 |
+
op = false;
|
| 826 |
+
ws = false;
|
| 827 |
+
nc = false;
|
| 828 |
+
i += 2;
|
| 829 |
+
} else if(i < s.length && s.charAt(i) !== '+' && s.charAt(i) !== '>' && s.charAt(i) !== ',' && s.charAt(i) !== ' ') {
|
| 830 |
+
//end combo
|
| 831 |
+
if(op === false && ws === true || nc === true) {
|
| 832 |
+
if(key.length) { stage.push(key); key = ''; }
|
| 833 |
+
if(stage.length) { combo.push(stage); stage = []; }
|
| 834 |
+
if(combo.length) { combos.push(combo); combo = []; }
|
| 835 |
+
}
|
| 836 |
+
op = false;
|
| 837 |
+
ws = false;
|
| 838 |
+
nc = false;
|
| 839 |
+
//key
|
| 840 |
+
while(i < s.length && s.charAt(i) !== '+' && s.charAt(i) !== '>' && s.charAt(i) !== ',' && s.charAt(i) !== ' ') {
|
| 841 |
+
key += s.charAt(i);
|
| 842 |
+
i += 1;
|
| 843 |
+
}
|
| 844 |
+
} else {
|
| 845 |
+
//unknown char
|
| 846 |
+
i += 1;
|
| 847 |
+
continue;
|
| 848 |
+
}
|
| 849 |
+
//end of combos string
|
| 850 |
+
if(i >= s.length) {
|
| 851 |
+
if(key.length) { stage.push(key); key = ''; }
|
| 852 |
+
if(stage.length) { combo.push(stage); stage = []; }
|
| 853 |
+
if(combo.length) { combos.push(combo); combo = []; }
|
| 854 |
+
break;
|
| 855 |
+
}
|
| 856 |
+
}
|
| 857 |
+
return combos;
|
| 858 |
+
}
|
| 859 |
+
|
| 860 |
+
/**
|
| 861 |
+
* Stringifys a key combo.
|
| 862 |
+
* @param {Array|String} keyComboArray A key combo array. If a key
|
| 863 |
+
* combo string is given it will be returned.
|
| 864 |
+
* @return {String}
|
| 865 |
+
*/
|
| 866 |
+
function stringifyKeyCombo(keyComboArray) {
|
| 867 |
+
var cI, ccI, output = [];
|
| 868 |
+
if(typeof keyComboArray === 'string') { return keyComboArray; }
|
| 869 |
+
if(typeof keyComboArray !== 'object' || typeof keyComboArray.push !== 'function') { throw new Error('Cannot stringify key combo.'); }
|
| 870 |
+
for(cI = 0; cI < keyComboArray.length; cI += 1) {
|
| 871 |
+
output[cI] = [];
|
| 872 |
+
for(ccI = 0; ccI < keyComboArray[cI].length; ccI += 1) {
|
| 873 |
+
output[cI][ccI] = keyComboArray[cI][ccI].join(' + ');
|
| 874 |
+
}
|
| 875 |
+
output[cI] = output[cI].join(' > ');
|
| 876 |
+
}
|
| 877 |
+
return output.join(' ');
|
| 878 |
+
}
|
| 879 |
+
|
| 880 |
+
|
| 881 |
+
/////////////////
|
| 882 |
+
// ACTIVE KEYS //
|
| 883 |
+
/////////////////
|
| 884 |
+
|
| 885 |
+
/**
|
| 886 |
+
* Returns the a copy of the active keys array.
|
| 887 |
+
* @return {Array}
|
| 888 |
+
*/
|
| 889 |
+
function getActiveKeys() {
|
| 890 |
+
return [].concat(activeKeys);
|
| 891 |
+
}
|
| 892 |
+
|
| 893 |
+
/**
|
| 894 |
+
* Adds a key to the active keys array, but only if it has not already been
|
| 895 |
+
* added.
|
| 896 |
+
* @param {String} keyName The key name string.
|
| 897 |
+
*/
|
| 898 |
+
function addActiveKey(keyName) {
|
| 899 |
+
if(keyName.match(/\s/)) { throw new Error('Cannot add key name ' + keyName + ' to active keys because it contains whitespace.'); }
|
| 900 |
+
if(activeKeys.indexOf(keyName) > -1) { return; }
|
| 901 |
+
activeKeys.push(keyName);
|
| 902 |
+
}
|
| 903 |
+
|
| 904 |
+
/**
|
| 905 |
+
* Removes a key from the active keys array.
|
| 906 |
+
* @param {String} keyNames The key name string.
|
| 907 |
+
*/
|
| 908 |
+
function removeActiveKey(keyName) {
|
| 909 |
+
var keyCode = getKeyCode(keyName);
|
| 910 |
+
if(keyCode === '91' || keyCode === '92') { activeKeys = []; } //remove all key on release of super.
|
| 911 |
+
else { activeKeys.splice(activeKeys.indexOf(keyName), 1); }
|
| 912 |
+
}
|
| 913 |
+
|
| 914 |
+
|
| 915 |
+
/////////////
|
| 916 |
+
// LOCALES //
|
| 917 |
+
/////////////
|
| 918 |
+
|
| 919 |
+
/**
|
| 920 |
+
* Registers a new locale. This is useful if you would like to add support for a new keyboard layout. It could also be useful for
|
| 921 |
+
* alternative key names. For example if you program games you could create a locale for your key mappings. Instead of key 65 mapped
|
| 922 |
+
* to 'a' you could map it to 'jump'.
|
| 923 |
+
* @param {String} localeName The name of the new locale.
|
| 924 |
+
* @param {Object} localeMap The locale map.
|
| 925 |
+
*/
|
| 926 |
+
function registerLocale(localeName, localeMap) {
|
| 927 |
+
|
| 928 |
+
//validate arguments
|
| 929 |
+
if(typeof localeName !== 'string') { throw new Error('Cannot register new locale. The locale name must be a string.'); }
|
| 930 |
+
if(typeof localeMap !== 'object') { throw new Error('Cannot register ' + localeName + ' locale. The locale map must be an object.'); }
|
| 931 |
+
if(typeof localeMap.map !== 'object') { throw new Error('Cannot register ' + localeName + ' locale. The locale map is invalid.'); }
|
| 932 |
+
|
| 933 |
+
//stash the locale
|
| 934 |
+
if(!localeMap.macros) { localeMap.macros = []; }
|
| 935 |
+
locales[localeName] = localeMap;
|
| 936 |
+
}
|
| 937 |
+
|
| 938 |
+
/**
|
| 939 |
+
* Swaps the current locale.
|
| 940 |
+
* @param {String} localeName The locale to activate.
|
| 941 |
+
* @return {Object}
|
| 942 |
+
*/
|
| 943 |
+
function getSetLocale(localeName) {
|
| 944 |
+
|
| 945 |
+
//if a new locale is given then set it
|
| 946 |
+
if(localeName) {
|
| 947 |
+
if(typeof localeName !== 'string') { throw new Error('Cannot set locale. The locale name must be a string.'); }
|
| 948 |
+
if(!locales[localeName]) { throw new Error('Cannot set locale to ' + localeName + ' because it does not exist. If you would like to submit a ' + localeName + ' locale map for KeyboardJS please submit it at https://github.com/RobertWHurst/KeyboardJS/issues.'); }
|
| 949 |
+
|
| 950 |
+
//set the current map and macros
|
| 951 |
+
map = locales[localeName].map;
|
| 952 |
+
macros = locales[localeName].macros;
|
| 953 |
+
|
| 954 |
+
//set the current locale
|
| 955 |
+
locale = localeName;
|
| 956 |
+
}
|
| 957 |
+
|
| 958 |
+
//return the current locale
|
| 959 |
+
return locale;
|
| 960 |
+
}
|
| 961 |
+
});
|
embedded/common/utility/js/keyboard.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
(function(e,b){[].indexOf||(Array.prototype.indexOf=function(g,f,h){for(h=this.length,f=(h+~~f)%h;f<h&&(!(f in this)||this[f]!==g);f++){}return f^h?f:-1});if(typeof define==="function"&&define.amd){define(a)}else{if(typeof module!=="undefined"){d()}else{c()}}function a(){return f(e);function f(h){var g;g=b(h,"amd");g.fork=f;return g}}function d(){module.exports=f(e);return;function f(h){var g;g=b(h,"CommonJS");g.fork=f;return g}}function c(){var f;f=g(e);function g(k){var j,l=[],h={};j=b(k,"global");j.fork=g;j.noConflict=i;j.noConflict("KeyboardJS","k");return j;function i(){var o,n,m;m=Array.prototype.slice.apply(arguments);for(n=0;n<l.length;n+=1){if(typeof h[l[n]]==="undefined"){delete k[l[n]]}else{k[l[n]]=h[l[n]]}}h={};for(n=0;n<m.length;n+=1){if(typeof m[n]!=="string"){throw new Error("Cannot replace namespaces. All new namespaces must be strings.")}h[m[n]]=k[m[n]];k[m[n]]=j}l=m;return l}}}})(this,function(H,e){var i={},w={},o,u,B,l=[],K=[],n=[],M=[],v,m;H=H||window;m={map:{"3":["cancel"],"8":["backspace"],"9":["tab"],"12":["clear"],"13":["enter"],"16":["shift"],"17":["ctrl"],"18":["alt","menu"],"19":["pause","break"],"20":["capslock"],"27":["escape","esc"],"32":["space","spacebar"],"33":["pageup"],"34":["pagedown"],"35":["end"],"36":["home"],"37":["left"],"38":["up"],"39":["right"],"40":["down"],"41":["select"],"42":["printscreen"],"43":["execute"],"44":["snapshot"],"45":["insert","ins"],"46":["delete","del"],"47":["help"],"91":["command","windows","win","super","leftcommand","leftwindows","leftwin","leftsuper"],"92":["command","windows","win","super","rightcommand","rightwindows","rightwin","rightsuper"],"145":["scrolllock","scroll"],"186":["semicolon",";"],"187":["equal","equalsign","="],"188":["comma",","],"189":["dash","-"],"190":["period","."],"191":["slash","forwardslash","/"],"192":["graveaccent","`"],"219":["openbracket","["],"220":["backslash","\\"],"221":["closebracket","]"],"222":["apostrophe","'"],"48":["zero","0"],"49":["one","1"],"50":["two","2"],"51":["three","3"],"52":["four","4"],"53":["five","5"],"54":["six","6"],"55":["seven","7"],"56":["eight","8"],"57":["nine","9"],"96":["numzero","num0"],"97":["numone","num1"],"98":["numtwo","num2"],"99":["numthree","num3"],"100":["numfour","num4"],"101":["numfive","num5"],"102":["numsix","num6"],"103":["numseven","num7"],"104":["numeight","num8"],"105":["numnine","num9"],"106":["nummultiply","num*"],"107":["numadd","num+"],"108":["numenter"],"109":["numsubtract","num-"],"110":["numdecimal","num."],"111":["numdivide","num/"],"144":["numlock","num"],"112":["f1"],"113":["f2"],"114":["f3"],"115":["f4"],"116":["f5"],"117":["f6"],"118":["f7"],"119":["f8"],"120":["f9"],"121":["f10"],"122":["f11"],"123":["f12"]},macros:[["shift + `",["tilde","~"]],["shift + 1",["exclamation","exclamationpoint","!"]],["shift + 2",["at","@"]],["shift + 3",["number","#"]],["shift + 4",["dollar","dollars","dollarsign","$"]],["shift + 5",["percent","%"]],["shift + 6",["caret","^"]],["shift + 7",["ampersand","and","&"]],["shift + 8",["asterisk","*"]],["shift + 9",["openparen","("]],["shift + 0",["closeparen",")"]],["shift + -",["underscore","_"]],["shift + =",["plus","+"]],["shift + (",["opencurlybrace","opencurlybracket","{"]],["shift + )",["closecurlybrace","closecurlybracket","}"]],["shift + \\",["verticalbar","|"]],["shift + ;",["colon",":"]],["shift + '",["quotationmark",'"']],["shift + !,",["openanglebracket","<"]],["shift + .",["closeanglebracket",">"]],["shift + /",["questionmark","?"]]]};for(v=65;v<=90;v+=1){m.map[v]=String.fromCharCode(v+32);m.macros.push(["shift + "+String.fromCharCode(v+32)+", capslock + "+String.fromCharCode(v+32),[String.fromCharCode(v)]])}C("us",m);g("us");f();i.enable=f;i.disable=d;i.activeKeys=L;i.releaseKey=k;i.pressKey=J;i.on=t;i.clear=A;i.clear.key=c;i.locale=g;i.locale.register=C;i.macro=G;i.macro.remove=h;i.key={};i.key.name=I;i.key.code=z;i.combo={};i.combo.active=a;i.combo.parse=q;i.combo.stringify=y;return i;function f(){if(H.addEventListener){H.document.addEventListener("keydown",p,false);H.document.addEventListener("keyup",F,false);H.addEventListener("blur",E,false);H.addEventListener("webkitfullscreenchange",E,false);H.addEventListener("mozfullscreenchange",E,false)}else{if(H.attachEvent){H.document.attachEvent("onkeydown",p);H.document.attachEvent("onkeyup",F);H.attachEvent("onblur",E)}}}function d(){E();if(H.removeEventListener){H.document.removeEventListener("keydown",p,false);H.document.removeEventListener("keyup",F,false);H.removeEventListener("blur",E,false);H.removeEventListener("webkitfullscreenchange",E,false);H.removeEventListener("mozfullscreenchange",E,false)}else{if(H.detachEvent){H.document.detachEvent("onkeydown",p);H.document.detachEvent("onkeyup",F);H.detachEvent("onblur",E)}}}function E(N){l=[];r();j(N)}function p(O){var Q,N,P;Q=I(O.keyCode);if(Q.length<1){return}O.isRepeat=false;for(P=0;P<Q.length;P+=1){N=Q[P];if(L().indexOf(N)!=-1){O.isRepeat=true}J(N)}s();b(O)}function F(N){var P,O;P=I(N.keyCode);if(P.length<1){return}for(O=0;O<P.length;O+=1){k(P[O])}r();j(N)}function I(N){return u[N]||[]}function z(N){var O;for(O in u){if(!u.hasOwnProperty(O)){continue}if(u[O].indexOf(N)>-1){return O}}return false}function G(O,N){if(typeof O!=="string"&&(typeof O!=="object"||typeof O.push!=="function")){throw new Error("Cannot create macro. The combo must be a string or array.")}if(typeof N!=="object"||typeof N.push!=="function"){throw new Error("Cannot create macro. The injectedKeys must be an array.")}B.push([O,N])}function h(O){var N;if(typeof O!=="string"&&(typeof O!=="object"||typeof O.push!=="function")){throw new Error("Cannot remove macro. The combo must be a string or array.")}for(mI=0;mI<B.length;mI+=1){N=B[mI];if(D(O,N[0])){k(N[1]);B.splice(mI,1);break}}}function s(){var N,P,O;for(N=0;N<B.length;N+=1){P=q(B[N][0]);if(M.indexOf(B[N])===-1&&a(P)){M.push(B[N]);for(O=0;O<B[N][1].length;O+=1){J(B[N][1][O])}}}}function r(){var N,P,O;for(N=0;N<M.length;N+=1){P=q(M[N][0]);if(a(P)===false){for(O=0;O<M[N][1].length;O+=1){k(M[N][1][O])}M.splice(N,1);N-=1}}}function t(V,X,O){var R={},U,N=[],Q={},T,W;if(typeof V==="string"){V=q(V)}for(T=0;T<V.length;T+=1){U={};W=y([V[T]]);if(typeof W!=="string"){throw new Error("Failed to bind key combo. The key combo must be string.")}U.keyCombo=W;U.keyDownCallback=[];U.keyUpCallback=[];if(X){U.keyDownCallback.push(X)}if(O){U.keyUpCallback.push(O)}K.push(U);N.push(U)}R.clear=P;R.on=S;return R;function P(){var Y;for(Y=0;Y<N.length;Y+=1){K.splice(K.indexOf(N[Y]),1)}}function S(aa){var ac={},ad,ab,Z;if(typeof aa!=="string"){throw new Error("Cannot bind callback. The event name must be a string.")}if(aa!=="keyup"&&aa!=="keydown"){throw new Error('Cannot bind callback. The event name must be a "keyup" or "keydown".')}ad=Array.prototype.slice.apply(arguments,[1]);for(ab=0;ab<ad.length;ab+=1){if(typeof ad[ab]==="function"){if(aa==="keyup"){for(Z=0;Z<N.length;Z+=1){N[Z].keyUpCallback.push(ad[ab])}}else{if(aa==="keydown"){for(Z=0;Z<N.length;Z+=1){N[Z].keyDownCallback.push(ad[ab])}}}}}ac.clear=Y;return ac;function Y(){var af,ae;for(af=0;af<ad.length;af+=1){if(typeof ad[af]==="function"){if(aa==="keyup"){for(ae=0;ae<N.length;ae+=1){N[ae].keyUpCallback.splice(N[ae].keyUpCallback.indexOf(ad[af]),1)}}else{for(ae=0;ae<N.length;ae+=1){N[ae].keyDownCallback.splice(N[ae].keyDownCallback.indexOf(ad[af]),1)}}}}}}}function A(Q){var N,P,O;for(N=0;N<K.length;N+=1){P=K[N];if(D(Q,P.keyCombo)){K.splice(N,1);N-=1}}}function c(O){var N,P,Q;if(O){for(N=0;N<K.length;N+=1){Q=K[N];for(P=0;P<Q.keyCombo.length;P+=1){if(Q.keyCombo[P].indexOf(O)>-1){K.splice(N,1);N-=1;break}}}}else{K=[]}}function b(O){var V,X,U,N,Z,Q,R,T,Y,S,P=[],W;Z=[].concat(l);for(V=0;V<K.length;V+=1){W=x(K[V].keyCombo).length;if(!P[W]){P[W]=[]}P[W].push(K[V])}for(X=P.length-1;X>=0;X-=1){if(!P[X]){continue}for(V=0;V<P[X].length;V+=1){U=P[X][V];N=x(U.keyCombo);Y=true;for(T=0;T<N.length;T+=1){if(Z.indexOf(N[T])===-1){Y=false;break}}if(Y&&a(U.keyCombo)){n.push(U);for(T=0;T<N.length;T+=1){S=Z.indexOf(N[T]);if(S>-1){Z.splice(S,1);T-=1}}for(Q=0;Q<U.keyDownCallback.length;Q+=1){if(U.keyDownCallback[Q](O,L(),U.keyCombo)===false){R=true}}if(R===true){O.preventDefault();O.stopPropagation()}}}}}function j(Q){var N,P,R,O;for(N=0;N<n.length;N+=1){R=n[N];if(a(R.keyCombo)===false){for(P=0;P<R.keyUpCallback.length;P+=1){if(R.keyUpCallback[P](Q,L(),R.keyCombo)===false){O=true}}if(O===true){Q.preventDefault();Q.stopPropagation()}n.splice(N,1);N-=1}}}function D(Q,P){var O,N,R;Q=q(Q);P=q(P);if(Q.length!==P.length){return false}for(O=0;O<Q.length;O+=1){if(Q[O].length!==P[O].length){return false}for(N=0;N<Q[O].length;N+=1){if(Q[O][N].length!==P[O][N].length){return false}for(R=0;R<Q[O][N].length;R+=1){if(P[O][N].indexOf(Q[O][N][R])===-1){return false}}}}return true}function a(U){var R,O,Q,T,S=0,P,N;U=q(U);for(R=0;R<U.length;R+=1){N=true;S=0;for(O=0;O<U[R].length;O+=1){Q=[].concat(U[R][O]);for(T=S;T<l.length;T+=1){P=Q.indexOf(l[T]);if(P>-1){Q.splice(P,1);S=T}}if(Q.length!==0){N=false;break}}if(N){return true}}return false}function x(R){var O,N,Q,P=[];R=q(R);for(O=0;O<R.length;O+=1){for(N=0;N<R[O].length;N+=1){P=P.concat(R[O][N])}}return P}function q(T){var V=T,P=0,Q=0,S=false,O=false,W=[],N=[],R=[],U="";if(typeof T==="object"&&typeof T.push==="function"){return T}if(typeof T!=="string"){throw new Error('Cannot parse "keyCombo" because its type is "'+(typeof T)+'". It must be a "string".')}while(V.charAt(P)===" "){P+=1}while(true){if(V.charAt(P)===" "){while(V.charAt(P)===" "){P+=1}S=true}else{if(V.charAt(P)===","){if(Q||O){throw new Error("Failed to parse key combo. Unexpected , at character index "+P+".")}O=true;P+=1}else{if(V.charAt(P)==="+"){if(U.length){R.push(U);U=""}if(Q||O){throw new Error("Failed to parse key combo. Unexpected + at character index "+P+".")}Q=true;P+=1}else{if(V.charAt(P)===">"){if(U.length){R.push(U);U=""}if(R.length){N.push(R);R=[]}if(Q||O){throw new Error("Failed to parse key combo. Unexpected > at character index "+P+".")}Q=true;P+=1}else{if(P<V.length-1&&V.charAt(P)==="!"&&(V.charAt(P+1)===">"||V.charAt(P+1)===","||V.charAt(P+1)==="+")){U+=V.charAt(P+1);Q=false;S=false;O=false;P+=2}else{if(P<V.length&&V.charAt(P)!=="+"&&V.charAt(P)!==">"&&V.charAt(P)!==","&&V.charAt(P)!==" "){if(Q===false&&S===true||O===true){if(U.length){R.push(U);U=""}if(R.length){N.push(R);R=[]}if(N.length){W.push(N);N=[]}}Q=false;S=false;O=false;while(P<V.length&&V.charAt(P)!=="+"&&V.charAt(P)!==">"&&V.charAt(P)!==","&&V.charAt(P)!==" "){U+=V.charAt(P);P+=1}}else{P+=1;continue}}}}}}if(P>=V.length){if(U.length){R.push(U);U=""}if(R.length){N.push(R);R=[]}if(N.length){W.push(N);N=[]}break}}return W}function y(N){var Q,P,O=[];if(typeof N==="string"){return N}if(typeof N!=="object"||typeof N.push!=="function"){throw new Error("Cannot stringify key combo.")}for(Q=0;Q<N.length;Q+=1){O[Q]=[];for(P=0;P<N[Q].length;P+=1){O[Q][P]=N[Q][P].join(" + ")}O[Q]=O[Q].join(" > ")}return O.join(" ")}function L(){return[].concat(l)}function J(N){if(N.match(/\s/)){throw new Error("Cannot add key name "+N+" to active keys because it contains whitespace.")}if(l.indexOf(N)>-1){return}l.push(N)}function k(N){var O=z(N);if(O==="91"||O==="92"){l=[]}else{l.splice(l.indexOf(N),1)}}function C(O,N){if(typeof O!=="string"){throw new Error("Cannot register new locale. The locale name must be a string.")}if(typeof N!=="object"){throw new Error("Cannot register "+O+" locale. The locale map must be an object.")}if(typeof N.map!=="object"){throw new Error("Cannot register "+O+" locale. The locale map is invalid.")}if(!N.macros){N.macros=[]}w[O]=N}function g(N){if(N){if(typeof N!=="string"){throw new Error("Cannot set locale. The locale name must be a string.")}if(!w[N]){throw new Error("Cannot set locale to "+N+" because it does not exist. If you would like to submit a "+N+" locale map for KeyboardJS please submit it at https://github.com/RobertWHurst/KeyboardJS/issues.")}u=w[N].map;B=w[N].macros;o=N}return o}});
|
embedded/common/utility/js/select2.min.js
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
/*
|
| 2 |
-
Copyright
|
| 3 |
|
| 4 |
-
Version: 3.
|
| 5 |
|
| 6 |
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
|
@@ -18,5 +18,6 @@ or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CO
|
|
| 18 |
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
*/
|
| 21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(a){var b,c,d,e;if(!a||a.length<1)return a;for(b="",c=0,d=a.length;d>c;c++)e=a.charAt(c),b+=m[e]||e;return b}function o(a,b){for(var c=0,d=b.length;d>c;c+=1)if(q(a,b[c]))return c;return-1}function p(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function q(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function r(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function s(a){return a.outerWidth(!1)-a.width()}function t(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function u(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function v(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function w(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function x(a,b){var c=v(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){o(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=n(a.toUpperCase()).indexOf(n(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw new Error(c+" must be a function or a falsy value")}function K(b){return a.isFunction(b)?b():b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(q(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=N(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=w(function(){return c.element.closest("body")}),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),u(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),t(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||p(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.nextSearchTerm=b},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:q(a.attr("locked"),"locked")||q(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,i=this.opts.id;g=function(d,e,j){var k,l,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),k=0,l=d.length;l>k;k+=1)m=d[k],o=m.disabled===!0,n=!o&&i(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+j),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("select2-result-sub"),g(m.children,s,j+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c||("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0&&(c.ajax.url=g),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(r(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return q(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,d,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var c=a.prop("disabled");c===b&&(c=!1),this.enable(!c);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass))}),a.on("propertychange.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=this.body().scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(t=this.body().offset(),m-=t.top,n-=t.left),r||(n=c.left+e-q),w={left:n,width:e},u?(w.bottom=i-c.top,w.top="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){var f,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close({focus:!0}),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),f=e.offset().top+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=e.offset().top-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled, .select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?o(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.ensureHighlightVisible(),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(e.opts.formatLoadMore(d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown()}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!q(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+f.formatSelectionTooBig(o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;
|
| 22 |
-
if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return q(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>"," </div>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e)),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(a){this.opened()&&(this.parent.close.apply(this,arguments),a=a||{focus:!0},this.focusser.removeAttr("disabled"),a.focus&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var b,d=this.container,e=this.dropdown;this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),t(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(b)})),e.on("mousedown",this.bind(function(){this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()?(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val():!1},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=q(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return q(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||this.focusser.focus(),q(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=r(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return q(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(q(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?(this.unselect(b.first()),this.search.width(10),h=e.length?e:f):a.which==c.DELETE?(this.unselect(b.first()),this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length||this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){o(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),A(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){for(;(e=o(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();var f=a.Event("select2-removing");f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented()||(b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}))}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));o(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-s(this.search)},resizeSearch:function(){var a,b,c,d,e,f=s(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),r(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){o(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)q(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],l=["opened","isFocused","container","dropdown"],m=["val","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple||!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(o(c[0],k)<0)throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),o(c[0],l)>=0||o(c[0],m)&&1==c.length)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return n(""+b).toUpperCase().indexOf(n(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:v,markMatch:E,escapeMarkup:F,stripDiacritics:n},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
|
|
|
| 1 |
/*
|
| 2 |
+
Copyright 2014 Igor Vaynberg
|
| 3 |
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
|
| 6 |
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 18 |
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
*/
|
| 21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
+
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
embedded/common/views/promote.php
DELETED
|
@@ -1,93 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
if (!function_exists('promote_types_and_views')) {
|
| 4 |
-
|
| 5 |
-
function is_promote_views() {
|
| 6 |
-
$promote_views = false;
|
| 7 |
-
if (defined('WPV_VERSION')) {
|
| 8 |
-
global $WP_Views;
|
| 9 |
-
if ($WP_Views) {
|
| 10 |
-
$promote_views = $WP_Views->is_embedded();
|
| 11 |
-
}
|
| 12 |
-
}
|
| 13 |
-
return $promote_views;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
function promote_types_and_views() {
|
| 17 |
-
static $promoted = false;
|
| 18 |
-
|
| 19 |
-
if (!$promoted) {
|
| 20 |
-
$promote_types = defined('WPCF_RUNNING_EMBEDDED');
|
| 21 |
-
$promote_views = is_promote_views();
|
| 22 |
-
|
| 23 |
-
if ($promote_types || $promote_views) {
|
| 24 |
-
add_action('admin_menu', 'promote_types_and_views_menu');
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
function promote_types_and_views_menu() {
|
| 30 |
-
$promote_types = defined('WPCF_RUNNING_EMBEDDED');
|
| 31 |
-
$promote_views = is_promote_views();
|
| 32 |
-
if ($promote_types || $promote_views) {
|
| 33 |
-
add_theme_page(__('Get Types and Views', 'wpv-views'), 'Get Types and Views', 'manage_options', 'wpv-get-types-views', 'promote_types_and_views_admin');
|
| 34 |
-
}
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
function promote_types_and_views_admin() {
|
| 38 |
-
?>
|
| 39 |
-
<div class="wrap">
|
| 40 |
-
<?php
|
| 41 |
-
|
| 42 |
-
$promote_types = defined('WPCF_RUNNING_EMBEDDED');
|
| 43 |
-
$promote_views = is_promote_views();
|
| 44 |
-
$affiliate_url = '';
|
| 45 |
-
if (function_exists('wpv_get_affiliate_url')) {
|
| 46 |
-
$affiliate_url = wpv_get_affiliate_url();
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
$icon_url = icl_get_file_relpath(dirname(__FILE__) . '/res/img/views-32.png') . '/views-32.png';
|
| 50 |
-
?>
|
| 51 |
-
<div class="icon32" style='background:url("<?php echo $icon_url; ?>") no-repeat;'><br /></div>
|
| 52 |
-
<h2><?php _e('Get Types and Views', 'wpv-views') ?></h2>
|
| 53 |
-
|
| 54 |
-
<p style="font-size: 130%;"><?php _e('Your theme was created using <strong>Types</strong> and <strong>Views</strong>. Developers use these two plugins to build complex websites, without coding.', 'wpv-views'); ?></p>
|
| 55 |
-
<p style="font-size: 120%;"><?php _e("Right now, you're using the embedded version, which creates the layout but doesn't include the editing interface. You can upgrade to the full version and customize your site yourself - you don't even need to know how to program!", 'wpv-views'); ?></p>
|
| 56 |
-
|
| 57 |
-
<p style="font-size: 120%;"><?php echo sprintf(__('Once you have installed the full versions of Types and Views you\'ll be able to create and edit your own content types, layouts and listings.', 'wpv-views'),
|
| 58 |
-
'http://wordpress.org/extend/plugins/types/',
|
| 59 |
-
'http://wp-types.com' . $affiliate_url); ?></p>
|
| 60 |
-
|
| 61 |
-
<p style="font-size: 140%; font-weight: bold; "><?php echo sprintf(__('<a href="%s" target="_blank">Learn more</a>', 'wpv-views'),
|
| 62 |
-
'http://wp-types.com' . $affiliate_url); ?></p>
|
| 63 |
-
|
| 64 |
-
<br /><hr /><br />
|
| 65 |
-
<ol>
|
| 66 |
-
<li><?php _e('Every purchase of Views entitles you to commercial-grade support and upgrades for one year.','wpv-views'); ?></li>
|
| 67 |
-
<li><?php _e('You can use Types and Views for as many themes and websites as you like.','wpv-views'); ?></li>
|
| 68 |
-
</ol>
|
| 69 |
-
|
| 70 |
-
<?php
|
| 71 |
-
|
| 72 |
-
//if ($promote_types && $promote_views) {
|
| 73 |
-
//
|
| 74 |
-
// wpv_promote_views_admin();
|
| 75 |
-
// echo "<hr />\n";
|
| 76 |
-
// wpcf_promote_types_admin();
|
| 77 |
-
//} else {
|
| 78 |
-
// if ($promote_types) {
|
| 79 |
-
// wpcf_promote_types_admin();
|
| 80 |
-
// } else {
|
| 81 |
-
// wpv_promote_views_admin();
|
| 82 |
-
// }
|
| 83 |
-
//}
|
| 84 |
-
|
| 85 |
-
?>
|
| 86 |
-
</div>
|
| 87 |
-
<?php
|
| 88 |
-
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
}
|
| 93 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
embedded/common/views/res/img/views-32.png
DELETED
|
Binary file
|
embedded/common/visual-editor/editor-addon.class.php
CHANGED
|
@@ -17,9 +17,17 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 17 |
* @param string $text_area
|
| 18 |
* @param boolean $standard_v is this a standard V button
|
| 19 |
*/
|
| 20 |
-
function add_form_button( $context, $text_area = '', $standard_v = true, $add_views = false, $codemirror_button = false )
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
global $wp_version;
|
| 22 |
-
|
| 23 |
if ( empty($context) && $text_area == '' ){
|
| 24 |
return;
|
| 25 |
}
|
|
@@ -84,21 +92,19 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 84 |
$menus = $this->sort_menus_alphabetically( $menus );
|
| 85 |
}
|
| 86 |
|
| 87 |
-
|
| 88 |
$this->_media_menu_direct_links = array();
|
| 89 |
-
$menus_output = $this->_output_media_menu( $menus, $text_area,
|
| 90 |
-
$standard_v );
|
| 91 |
|
| 92 |
$direct_links = implode( ' ', $this->_media_menu_direct_links );
|
| 93 |
$dropdown_class = 'js-editor_addon_dropdown-'.$this->name;
|
| 94 |
$icon_class = 'js-wpv-shortcode-post-icon-'.$this->name;
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
|
| 103 |
if( '' !== $this->media_button_image )
|
| 104 |
{
|
|
@@ -157,6 +163,9 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 157 |
|
| 158 |
/**
|
| 159 |
* Adding a "V" button to the menu (for user fields)
|
|
|
|
|
|
|
|
|
|
| 160 |
* @param string $context
|
| 161 |
* @param string $text_area
|
| 162 |
* @param boolean $standard_v is this a standard V button
|
|
@@ -193,13 +202,13 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 193 |
array(__('User Status', 'wpv-views'), 'wpv-user field="user_status"',__('Basic', 'wpv-views'),''),
|
| 194 |
array(__('User Spam Status', 'wpv-views'), 'wpv-user field="spam"',__('Basic', 'wpv-views'),'')
|
| 195 |
);
|
| 196 |
-
|
| 197 |
if ( isset( $sitepress ) && function_exists( 'wpml_string_shortcode' ) ) {
|
| 198 |
$nonce = wp_create_nonce('wpv_editor_callback');
|
| 199 |
$this->items[] = array(__('Translatable string', 'wpv-views'), 'wpml-string',__('Basic', 'wpv-views'),'WPViews.shortcodes_gui.wpv_insert_translatable_string_popup(\'' . $nonce . '\')');
|
| 200 |
}
|
| 201 |
-
|
| 202 |
-
|
| 203 |
|
| 204 |
$meta_keys = get_user_meta_keys();
|
| 205 |
$all_types_fields = get_option( 'wpcf-fields', array() );
|
|
@@ -213,7 +222,7 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 213 |
if ( preg_match($exclude_these_hidden_var , $key) ){
|
| 214 |
continue;
|
| 215 |
}
|
| 216 |
-
$this->items[] = array($key,
|
| 217 |
'wpv-user field="'.$key.'"',
|
| 218 |
__('Users fields', 'wpv-views'),'');
|
| 219 |
}
|
|
@@ -222,16 +231,16 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 222 |
if ( preg_match($exclude_these_hidden_var , $key) ){
|
| 223 |
continue;
|
| 224 |
}
|
| 225 |
-
$this->items[] = array($key,
|
| 226 |
'wpv-user field="'.$key.'"',
|
| 227 |
__('User fields', 'wpv-views'),'');
|
| 228 |
}
|
| 229 |
-
|
| 230 |
}
|
| 231 |
-
|
| 232 |
if ( function_exists('wpcf_init') ){
|
| 233 |
//Get types groups and fields
|
| 234 |
-
$groups = wpcf_admin_fields_get_groups( 'wp-types-user-group' );
|
| 235 |
$user_id = wpcf_usermeta_get_user();
|
| 236 |
$add = array();
|
| 237 |
if ( !empty( $groups ) ) {
|
|
@@ -242,16 +251,16 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 242 |
$fields = wpcf_admin_fields_get_fields_by_group( $group['id'],
|
| 243 |
'slug', true, false, true, 'wp-types-user-group',
|
| 244 |
'wpcf-usermeta' );
|
| 245 |
-
|
| 246 |
if ( !empty( $fields ) ) {
|
| 247 |
foreach ( $fields as $field_id => $field ) {
|
| 248 |
$add[] = $field['meta_key'];
|
| 249 |
$callback = 'wpcfFieldsEditorCallback(\'' . $field['id'] . '\', \'views-usermeta\', -1)';
|
| 250 |
-
$this->items[] = array($field['name'],
|
| 251 |
'types usermeta="'.$field['meta_key'].'"][/types',
|
| 252 |
-
$group['name'],$callback);
|
| 253 |
-
|
| 254 |
-
|
| 255 |
}
|
| 256 |
}
|
| 257 |
}
|
|
@@ -262,20 +271,20 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 262 |
foreach ( $cf_types as $cf_id => $cf ) {
|
| 263 |
if ( !in_array( $cf['meta_key'], $add) ){
|
| 264 |
$callback = 'wpcfFieldsEditorCallback(\'' . $cf['id'] . '\', \'views-usermeta\', -1)';
|
| 265 |
-
$this->items[] = array($cf['name'],
|
| 266 |
'types usermeta="'.$cf['meta_key'].'"][/types',
|
| 267 |
-
__('Types fields', 'wpv-views'),$callback);
|
| 268 |
-
|
| 269 |
}
|
| 270 |
}
|
| 271 |
}
|
| 272 |
-
|
| 273 |
$view_available = $wpdb->get_results("SELECT ID, post_title FROM {$wpdb->posts} WHERE post_type='view' AND post_status in ('publish')");
|
| 274 |
foreach($view_available as $view) {
|
| 275 |
|
| 276 |
$view_settings = get_post_meta($view->ID, '_wpv_settings', true);
|
| 277 |
if (isset($view_settings['query_type'][0]) && $view_settings['query_type'][0] == 'posts' && !$WP_Views->is_archive_view($view->ID)) {
|
| 278 |
-
|
| 279 |
$this->items[] = array($view->post_title,
|
| 280 |
$view->post_title,
|
| 281 |
__('Post View', 'wpv-views'),
|
|
@@ -283,12 +292,12 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 283 |
);
|
| 284 |
}
|
| 285 |
}
|
| 286 |
-
|
| 287 |
$out = array();
|
| 288 |
-
|
| 289 |
$menus = array();
|
| 290 |
$sub_menus = array();
|
| 291 |
-
|
| 292 |
if( $this->items )
|
| 293 |
foreach ( $this->items as $item ) {
|
| 294 |
$parts = explode( '-!-', $item[2] );
|
|
@@ -304,8 +313,8 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 304 |
$menu_level[$item[0]] = $item;
|
| 305 |
}
|
| 306 |
|
| 307 |
-
|
| 308 |
-
|
| 309 |
|
| 310 |
// Sort menus
|
| 311 |
if ( is_array( $menus ) ) {
|
|
@@ -365,7 +374,7 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 365 |
} else {
|
| 366 |
return apply_filters( 'wpv_add_media_buttons', $context . $out );
|
| 367 |
}
|
| 368 |
-
|
| 369 |
}
|
| 370 |
|
| 371 |
/**
|
|
@@ -567,12 +576,12 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 567 |
|
| 568 |
// add parent groups for vew templates
|
| 569 |
function add_view_template_parent_groups( $items ) {
|
| 570 |
-
global $post;
|
| 571 |
// get current View ID
|
| 572 |
$view_template_id = $post->ID;
|
| 573 |
|
| 574 |
// get all view templates attached in the Settings page for single view
|
| 575 |
-
$view_template_relations = $
|
| 576 |
|
| 577 |
// find view template groups and get their parents
|
| 578 |
$current_types = array();
|
|
@@ -656,13 +665,25 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 656 |
return $searchbar;
|
| 657 |
}
|
| 658 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 659 |
function add_view_type( &$menus, $post_type, $post_name ) {
|
| 660 |
global $wpdb;
|
| 661 |
$all_post_types = implode( ' ',
|
| 662 |
get_post_types( array('public' => true) ) );
|
| 663 |
|
| 664 |
-
$view_templates_available = $wpdb->get_results(
|
| 665 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 666 |
$menus[$post_name] = array();
|
| 667 |
$menus[$post_name]['css'] = $all_post_types;
|
| 668 |
|
|
@@ -706,22 +727,6 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 706 |
$vtemplate_index++;
|
| 707 |
}
|
| 708 |
}
|
| 709 |
-
|
| 710 |
-
function get_view_template_settings() {
|
| 711 |
-
$post_types = get_post_types();
|
| 712 |
-
|
| 713 |
-
$options = array();
|
| 714 |
-
$wpv_options = get_option( 'wpv_options' );
|
| 715 |
-
|
| 716 |
-
foreach ( $post_types as $type ) {
|
| 717 |
-
if ( isset( $wpv_options['views_template_for_' . $type] ) && !empty( $wpv_options['views_template_for_' . $type] ) ) {
|
| 718 |
-
$options[$type] = $wpv_options['views_template_for_' . $type];
|
| 719 |
-
}
|
| 720 |
-
}
|
| 721 |
-
|
| 722 |
-
return $options;
|
| 723 |
-
}
|
| 724 |
-
|
| 725 |
}
|
| 726 |
|
| 727 |
/*
|
|
@@ -729,8 +734,7 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 729 |
*/
|
| 730 |
function wpv_mce_add_button( $buttons )
|
| 731 |
{
|
| 732 |
-
array_push( $buttons, "separator",
|
| 733 |
-
str_replace( '-', '_', $this->name ) );
|
| 734 |
return $buttons;
|
| 735 |
}
|
| 736 |
|
|
@@ -777,8 +781,6 @@ if ( file_exists( dirname(__FILE__) . '/editor-addon-generic.class.php') && !cla
|
|
| 777 |
<?php
|
| 778 |
}
|
| 779 |
}
|
| 780 |
-
|
| 781 |
-
|
| 782 |
|
| 783 |
}
|
| 784 |
|
| 17 |
* @param string $text_area
|
| 18 |
* @param boolean $standard_v is this a standard V button
|
| 19 |
*/
|
| 20 |
+
function add_form_button( $context, $text_area = '', $standard_v = true, $add_views = false, $codemirror_button = false )
|
| 21 |
+
{
|
| 22 |
+
/**
|
| 23 |
+
* turn off button
|
| 24 |
+
*/
|
| 25 |
+
if ( !apply_filters('toolset_editor_add_form_buttons', true) ) {
|
| 26 |
+
return;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
global $wp_version;
|
| 30 |
+
|
| 31 |
if ( empty($context) && $text_area == '' ){
|
| 32 |
return;
|
| 33 |
}
|
| 92 |
$menus = $this->sort_menus_alphabetically( $menus );
|
| 93 |
}
|
| 94 |
|
|
|
|
| 95 |
$this->_media_menu_direct_links = array();
|
| 96 |
+
$menus_output = $this->_output_media_menu( $menus, $text_area, $standard_v );
|
|
|
|
| 97 |
|
| 98 |
$direct_links = implode( ' ', $this->_media_menu_direct_links );
|
| 99 |
$dropdown_class = 'js-editor_addon_dropdown-'.$this->name;
|
| 100 |
$icon_class = 'js-wpv-shortcode-post-icon-'.$this->name;
|
| 101 |
+
if ( $this->name == 'wpv-views' ) {
|
| 102 |
+
$button_label = __( 'Fields and Views', 'wpv-views' );
|
| 103 |
+
} else if ( $this->name == 'types' ) {
|
| 104 |
+
$button_label = __( 'Types', 'wpv-views' );
|
| 105 |
+
} else {
|
| 106 |
+
$button_label = '';
|
| 107 |
+
}
|
| 108 |
|
| 109 |
if( '' !== $this->media_button_image )
|
| 110 |
{
|
| 163 |
|
| 164 |
/**
|
| 165 |
* Adding a "V" button to the menu (for user fields)
|
| 166 |
+
*
|
| 167 |
+
* @global object $wpdb
|
| 168 |
+
*
|
| 169 |
* @param string $context
|
| 170 |
* @param string $text_area
|
| 171 |
* @param boolean $standard_v is this a standard V button
|
| 202 |
array(__('User Status', 'wpv-views'), 'wpv-user field="user_status"',__('Basic', 'wpv-views'),''),
|
| 203 |
array(__('User Spam Status', 'wpv-views'), 'wpv-user field="spam"',__('Basic', 'wpv-views'),'')
|
| 204 |
);
|
| 205 |
+
|
| 206 |
if ( isset( $sitepress ) && function_exists( 'wpml_string_shortcode' ) ) {
|
| 207 |
$nonce = wp_create_nonce('wpv_editor_callback');
|
| 208 |
$this->items[] = array(__('Translatable string', 'wpv-views'), 'wpml-string',__('Basic', 'wpv-views'),'WPViews.shortcodes_gui.wpv_insert_translatable_string_popup(\'' . $nonce . '\')');
|
| 209 |
}
|
| 210 |
+
|
| 211 |
+
|
| 212 |
|
| 213 |
$meta_keys = get_user_meta_keys();
|
| 214 |
$all_types_fields = get_option( 'wpcf-fields', array() );
|
| 222 |
if ( preg_match($exclude_these_hidden_var , $key) ){
|
| 223 |
continue;
|
| 224 |
}
|
| 225 |
+
$this->items[] = array($key,
|
| 226 |
'wpv-user field="'.$key.'"',
|
| 227 |
__('Users fields', 'wpv-views'),'');
|
| 228 |
}
|
| 231 |
if ( preg_match($exclude_these_hidden_var , $key) ){
|
| 232 |
continue;
|
| 233 |
}
|
| 234 |
+
$this->items[] = array($key,
|
| 235 |
'wpv-user field="'.$key.'"',
|
| 236 |
__('User fields', 'wpv-views'),'');
|
| 237 |
}
|
| 238 |
+
|
| 239 |
}
|
| 240 |
+
|
| 241 |
if ( function_exists('wpcf_init') ){
|
| 242 |
//Get types groups and fields
|
| 243 |
+
$groups = wpcf_admin_fields_get_groups( 'wp-types-user-group' );
|
| 244 |
$user_id = wpcf_usermeta_get_user();
|
| 245 |
$add = array();
|
| 246 |
if ( !empty( $groups ) ) {
|
| 251 |
$fields = wpcf_admin_fields_get_fields_by_group( $group['id'],
|
| 252 |
'slug', true, false, true, 'wp-types-user-group',
|
| 253 |
'wpcf-usermeta' );
|
| 254 |
+
|
| 255 |
if ( !empty( $fields ) ) {
|
| 256 |
foreach ( $fields as $field_id => $field ) {
|
| 257 |
$add[] = $field['meta_key'];
|
| 258 |
$callback = 'wpcfFieldsEditorCallback(\'' . $field['id'] . '\', \'views-usermeta\', -1)';
|
| 259 |
+
$this->items[] = array($field['name'],
|
| 260 |
'types usermeta="'.$field['meta_key'].'"][/types',
|
| 261 |
+
$group['name'],$callback);
|
| 262 |
+
|
| 263 |
+
|
| 264 |
}
|
| 265 |
}
|
| 266 |
}
|
| 271 |
foreach ( $cf_types as $cf_id => $cf ) {
|
| 272 |
if ( !in_array( $cf['meta_key'], $add) ){
|
| 273 |
$callback = 'wpcfFieldsEditorCallback(\'' . $cf['id'] . '\', \'views-usermeta\', -1)';
|
| 274 |
+
$this->items[] = array($cf['name'],
|
| 275 |
'types usermeta="'.$cf['meta_key'].'"][/types',
|
| 276 |
+
__('Types fields', 'wpv-views'),$callback);
|
| 277 |
+
|
| 278 |
}
|
| 279 |
}
|
| 280 |
}
|
| 281 |
+
|
| 282 |
$view_available = $wpdb->get_results("SELECT ID, post_title FROM {$wpdb->posts} WHERE post_type='view' AND post_status in ('publish')");
|
| 283 |
foreach($view_available as $view) {
|
| 284 |
|
| 285 |
$view_settings = get_post_meta($view->ID, '_wpv_settings', true);
|
| 286 |
if (isset($view_settings['query_type'][0]) && $view_settings['query_type'][0] == 'posts' && !$WP_Views->is_archive_view($view->ID)) {
|
| 287 |
+
|
| 288 |
$this->items[] = array($view->post_title,
|
| 289 |
$view->post_title,
|
| 290 |
__('Post View', 'wpv-views'),
|
| 292 |
);
|
| 293 |
}
|
| 294 |
}
|
| 295 |
+
|
| 296 |
$out = array();
|
| 297 |
+
|
| 298 |
$menus = array();
|
| 299 |
$sub_menus = array();
|
| 300 |
+
|
| 301 |
if( $this->items )
|
| 302 |
foreach ( $this->items as $item ) {
|
| 303 |
$parts = explode( '-!-', $item[2] );
|
| 313 |
$menu_level[$item[0]] = $item;
|
| 314 |
}
|
| 315 |
|
| 316 |
+
|
| 317 |
+
|
| 318 |
|
| 319 |
// Sort menus
|
| 320 |
if ( is_array( $menus ) ) {
|
| 374 |
} else {
|
| 375 |
return apply_filters( 'wpv_add_media_buttons', $context . $out );
|
| 376 |
}
|
| 377 |
+
|
| 378 |
}
|
| 379 |
|
| 380 |
/**
|
| 576 |
|
| 577 |
// add parent groups for vew templates
|
| 578 |
function add_view_template_parent_groups( $items ) {
|
| 579 |
+
global $post, $WPV_settings;
|
| 580 |
// get current View ID
|
| 581 |
$view_template_id = $post->ID;
|
| 582 |
|
| 583 |
// get all view templates attached in the Settings page for single view
|
| 584 |
+
$view_template_relations = $WPV_settings->get_view_template_settings();
|
| 585 |
|
| 586 |
// find view template groups and get their parents
|
| 587 |
$current_types = array();
|
| 665 |
return $searchbar;
|
| 666 |
}
|
| 667 |
|
| 668 |
+
/**
|
| 669 |
+
*
|
| 670 |
+
* @global object $wpdb
|
| 671 |
+
*
|
| 672 |
+
*/
|
| 673 |
function add_view_type( &$menus, $post_type, $post_name ) {
|
| 674 |
global $wpdb;
|
| 675 |
$all_post_types = implode( ' ',
|
| 676 |
get_post_types( array('public' => true) ) );
|
| 677 |
|
| 678 |
+
$view_templates_available = $wpdb->get_results(
|
| 679 |
+
$wpdb->prepare(
|
| 680 |
+
"SELECT ID, post_title, post_name FROM {$wpdb->posts}
|
| 681 |
+
WHERE post_type = %s
|
| 682 |
+
AND post_status in (%s)",
|
| 683 |
+
$post_type,
|
| 684 |
+
'publish'
|
| 685 |
+
)
|
| 686 |
+
);
|
| 687 |
$menus[$post_name] = array();
|
| 688 |
$menus[$post_name]['css'] = $all_post_types;
|
| 689 |
|
| 727 |
$vtemplate_index++;
|
| 728 |
}
|
| 729 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 730 |
}
|
| 731 |
|
| 732 |
/*
|
| 734 |
*/
|
| 735 |
function wpv_mce_add_button( $buttons )
|
| 736 |
{
|
| 737 |
+
array_push( $buttons, "separator", str_replace( '-', '_', $this->name ) );
|
|
|
|
| 738 |
return $buttons;
|
| 739 |
}
|
| 740 |
|
| 781 |
<?php
|
| 782 |
}
|
| 783 |
}
|
|
|
|
|
|
|
| 784 |
|
| 785 |
}
|
| 786 |
|
embedded/common/visual-editor/res/js/icl_editor_addon_plugin.js
CHANGED
|
@@ -802,41 +802,76 @@ var icl_editor = (function(window, $){
|
|
| 802 |
|
| 803 |
function isCodeMirror($textarea)
|
| 804 |
{
|
| 805 |
-
|
| 806 |
-
|
| 807 |
-
|
| 808 |
-
|
| 809 |
-
|
| 810 |
-
|
| 811 |
-
|
| 812 |
-
|
| 813 |
-
|
| 814 |
-
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
|
| 820 |
-
|
| 821 |
-
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
|
| 825 |
-
|
| 826 |
-
|
| 827 |
-
|
| 828 |
-
|
| 829 |
-
|
| 830 |
-
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
| 836 |
-
|
| 837 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 838 |
return false;
|
| 839 |
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 840 |
|
| 841 |
function getContent($area)
|
| 842 |
{
|
| 802 |
|
| 803 |
function isCodeMirror($textarea)
|
| 804 |
{
|
| 805 |
+
if ( ! $textarea.is('textarea') ) {
|
| 806 |
+
return false;
|
| 807 |
+
}
|
| 808 |
+
var textareaNext = $textarea[0].nextSibling;
|
| 809 |
+
if ( typeof textareaNext === 'undefined' ) {
|
| 810 |
+
return false;
|
| 811 |
+
}
|
| 812 |
+
if ( textareaNext ) {
|
| 813 |
+
//Usual way before WordPress 4.1
|
| 814 |
+
if (
|
| 815 |
+
textareaNext.CodeMirror
|
| 816 |
+
&& $textarea[0] == textareaNext.CodeMirror.getTextArea()
|
| 817 |
+
) {
|
| 818 |
+
return textareaNext.CodeMirror;
|
| 819 |
+
}
|
| 820 |
+
// Juan: CodeMirror panels wrap the CodeMirror div and themselves into a div.
|
| 821 |
+
// Depending on the panels position, the CodeMirror div becomes the first or last child of that wrapper.
|
| 822 |
+
// We need to check if the relevant node contains the right CodeMirror div as a child node.
|
| 823 |
+
// Note that we will do the same below, so we can have CodeMirror panels in main editors too.
|
| 824 |
+
var textareaNextHasPanels = isCodeMirrorWithPanels( $textarea, textareaNext );
|
| 825 |
+
if ( textareaNextHasPanels ) {
|
| 826 |
+
return textareaNextHasPanels;
|
| 827 |
+
}
|
| 828 |
+
// Emerson: WordPress 4.0+ introduces 'content-textarea-clone' div which in some instances is loaded after our textarea and before the CodeMirror div.
|
| 829 |
+
// This core feature in WP is used in their auto-resize editor and distraction free writing.
|
| 830 |
+
// This is particularly found in pages and post affecting syntax highlighting in main editors.
|
| 831 |
+
// Let's skip that node and check if the nextsibling is really the CodeMirror div.
|
| 832 |
+
var textareaNextNext = textareaNext.nextSibling;
|
| 833 |
+
if ( textareaNextNext ) {
|
| 834 |
+
if (
|
| 835 |
+
textareaNextNext.CodeMirror
|
| 836 |
+
&& $textarea[0] == textareaNextNext.CodeMirror.getTextArea()
|
| 837 |
+
) {
|
| 838 |
+
return textareaNextNext.CodeMirror;
|
| 839 |
+
}
|
| 840 |
+
var textareaNextNextHasPanels = isCodeMirrorWithPanels( $textarea, textareaNextNext );
|
| 841 |
+
if ( textareaNextNextHasPanels ) {
|
| 842 |
+
return textareaNextNextHasPanels;
|
| 843 |
+
}
|
| 844 |
+
}
|
| 845 |
+
}
|
| 846 |
return false;
|
| 847 |
};
|
| 848 |
+
|
| 849 |
+
function isCodeMirrorWithPanels( $textarea, candidateNode ) {
|
| 850 |
+
if ( ! $textarea.is('textarea') ) {
|
| 851 |
+
return false;
|
| 852 |
+
}
|
| 853 |
+
if ( typeof candidateNode === 'undefined' ) {
|
| 854 |
+
return false;
|
| 855 |
+
}
|
| 856 |
+
if ( candidateNode ) {
|
| 857 |
+
var candidateNodeFirstChild = candidateNode.firstChild,
|
| 858 |
+
candidateNodeLastChiild = candidateNode.lastChild;
|
| 859 |
+
if (
|
| 860 |
+
candidateNodeFirstChild
|
| 861 |
+
&& candidateNodeFirstChild.CodeMirror
|
| 862 |
+
&& $textarea[0] == candidateNodeFirstChild.CodeMirror.getTextArea()
|
| 863 |
+
) {
|
| 864 |
+
return candidateNodeFirstChild.CodeMirror;
|
| 865 |
+
} else if (
|
| 866 |
+
candidateNodeLastChiild
|
| 867 |
+
&& candidateNodeLastChiild.CodeMirror
|
| 868 |
+
&& $textarea[0] == candidateNodeLastChiild.CodeMirror.getTextArea()
|
| 869 |
+
) {
|
| 870 |
+
return candidateNodeLastChiild.CodeMirror;
|
| 871 |
+
}
|
| 872 |
+
}
|
| 873 |
+
return false;
|
| 874 |
+
}
|
| 875 |
|
| 876 |
function getContent($area)
|
| 877 |
{
|
embedded/common/wplogger.php
CHANGED
|
@@ -4,12 +4,12 @@
|
|
| 4 |
*
|
| 5 |
*
|
| 6 |
*
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
|
| 14 |
This program is free software; you can redistribute it and/or modify
|
| 15 |
it under the terms of the GNU General Public License as published by
|
| 4 |
*
|
| 5 |
*
|
| 6 |
*
|
| 7 |
+
Wordpress Logger
|
| 8 |
+
http://www.turingtarpit.com/2009/05/wordpress-logger-a-plugin-to-display-php-log-messages-in-safari-and-firefox/
|
| 9 |
+
Displays log messages in the browser console in Safari, Firefox and Opera. Useful for plugin and theme developers to debug PHP code.
|
| 10 |
+
0.3
|
| 11 |
+
Chandima Cumaranatunge
|
| 12 |
+
http://www.turingtarpit.com
|
| 13 |
|
| 14 |
This program is free software; you can redistribute it and/or modify
|
| 15 |
it under the terms of the GNU General Public License as published by
|
embedded/frontend.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Frontend functions.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -82,8 +82,11 @@ function wpcf_shortcode( $atts, $content = null, $code = '' ) {
|
|
| 82 |
* @param type $atts
|
| 83 |
* @return type
|
| 84 |
*/
|
| 85 |
-
function types_render_field( $field_id, $params, $content = null, $code = '' )
|
| 86 |
{
|
|
|
|
|
|
|
|
|
|
| 87 |
|
| 88 |
global $wpcf;
|
| 89 |
|
|
@@ -548,19 +551,63 @@ function wpcf_views_query( $query, $view_settings ) {
|
|
| 548 |
}
|
| 549 |
$options = $opt[$field_name]['data']['options'];
|
| 550 |
|
| 551 |
-
|
| 552 |
-
|
| 553 |
-
|
| 554 |
-
|
| 555 |
-
|
| 556 |
-
|
| 557 |
-
|
| 558 |
-
|
| 559 |
-
|
| 560 |
-
|
| 561 |
-
|
| 562 |
-
|
| 563 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 564 |
}
|
| 565 |
}
|
| 566 |
}
|
| 2 |
/*
|
| 3 |
* Frontend functions.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/frontend.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-10 06:46:08 +0000 (Tue, 10 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1109249 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 82 |
* @param type $atts
|
| 83 |
* @return type
|
| 84 |
*/
|
| 85 |
+
function types_render_field( $field_id = null, $params = array(), $content = null, $code = '' )
|
| 86 |
{
|
| 87 |
+
if ( empty($field_id) ) {
|
| 88 |
+
return '';
|
| 89 |
+
}
|
| 90 |
|
| 91 |
global $wpcf;
|
| 92 |
|
| 551 |
}
|
| 552 |
$options = $opt[$field_name]['data']['options'];
|
| 553 |
|
| 554 |
+
global $wp_version;
|
| 555 |
+
|
| 556 |
+
if ( version_compare( $wp_version, '4.1', '<' ) ) {
|
| 557 |
+
// We can not use nested meta_query entries
|
| 558 |
+
foreach ( $values as $value ) {
|
| 559 |
+
foreach ( $options as $key => $option ) {
|
| 560 |
+
if ( $option['title'] == $value ) {
|
| 561 |
+
$query['meta_query'][] = array(
|
| 562 |
+
'key' => $meta['key'],
|
| 563 |
+
'compare' => in_array( $orginal['compare'], array( '!=', 'NOT LIKE', 'NOT IN' ) ) ? 'NOT LIKE' : 'LIKE',
|
| 564 |
+
'value' => $key,
|
| 565 |
+
'type' => 'CHAR',
|
| 566 |
+
);
|
| 567 |
+
break;
|
| 568 |
+
}
|
| 569 |
+
}
|
| 570 |
+
}
|
| 571 |
+
} else {
|
| 572 |
+
// We can use nested meta_query entries
|
| 573 |
+
if ( count( $values ) < 2 ) {
|
| 574 |
+
// Only one value to filter by, so no need to add nested meta_query entries
|
| 575 |
+
foreach ( $values as $value ) {
|
| 576 |
+
foreach ( $options as $key => $option ) {
|
| 577 |
+
if ( $option['title'] == $value ) {
|
| 578 |
+
$query['meta_query'][] = array(
|
| 579 |
+
'key' => $meta['key'],
|
| 580 |
+
'compare' => in_array( $orginal['compare'], array( '!=', 'NOT LIKE', 'NOT IN' ) ) ? 'NOT LIKE' : 'LIKE',
|
| 581 |
+
'value' => $key,
|
| 582 |
+
'type' => 'CHAR',
|
| 583 |
+
);
|
| 584 |
+
break;
|
| 585 |
+
}
|
| 586 |
+
}
|
| 587 |
+
}
|
| 588 |
+
} else {
|
| 589 |
+
// We will translate each value into a meta_query clause and add them all as a nested meta_query entry
|
| 590 |
+
$inner_relation = in_array( $orginal['compare'], array( '!=', 'NOT LIKE', 'NOT IN' ) ) ? 'AND' : 'OR';
|
| 591 |
+
$inner_compare = in_array( $orginal['compare'], array( '!=', 'NOT LIKE', 'NOT IN' ) ) ? 'NOT LIKE' : 'LIKE';
|
| 592 |
+
$inner_meta_query = array(
|
| 593 |
+
'relation' => $inner_relation
|
| 594 |
+
);
|
| 595 |
+
foreach ( $values as $value ) {
|
| 596 |
+
foreach ( $options as $key => $option ) {
|
| 597 |
+
if ( $option['title'] == $value ) {
|
| 598 |
+
$inner_meta_query[] = array(
|
| 599 |
+
'key' => $meta['key'],
|
| 600 |
+
'compare' => $inner_compare,
|
| 601 |
+
'value' => $key,
|
| 602 |
+
'type' => 'CHAR',
|
| 603 |
+
);
|
| 604 |
+
break;
|
| 605 |
+
}
|
| 606 |
+
}
|
| 607 |
+
}
|
| 608 |
+
$query['meta_query'][] = $inner_meta_query;
|
| 609 |
+
}
|
| 610 |
+
}
|
| 611 |
}
|
| 612 |
}
|
| 613 |
}
|
embedded/functions.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
* Basic and init functions.
|
| 4 |
* Since Types 1.2 moved from /embedded/types.php
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -149,10 +149,6 @@ function wpcf_embedded_check_import()
|
|
| 149 |
$_POST['overwrite-fields'] = 1;
|
| 150 |
$_POST['overwrite-types'] = 1;
|
| 151 |
$_POST['overwrite-tax'] = 1;
|
| 152 |
-
// $_POST['delete-groups'] = 0;
|
| 153 |
-
// $_POST['delete-fields'] = 0;
|
| 154 |
-
// $_POST['delete-types'] = 0;
|
| 155 |
-
// $_POST['delete-tax'] = 0;
|
| 156 |
$_POST['post_relationship'] = 1;
|
| 157 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 158 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/import-export.php';
|
|
@@ -169,38 +165,6 @@ function wpcf_embedded_check_import()
|
|
| 169 |
}
|
| 170 |
}
|
| 171 |
|
| 172 |
-
/**
|
| 173 |
-
* Display information about upgrading to the plugin version of types.
|
| 174 |
-
*
|
| 175 |
-
*/
|
| 176 |
-
function wpcf_promote_types_admin()
|
| 177 |
-
{
|
| 178 |
-
$custom_types = get_option( 'wpcf-custom-types', array() );
|
| 179 |
-
|
| 180 |
-
?>
|
| 181 |
-
|
| 182 |
-
<?php
|
| 183 |
-
if ( sizeof( $custom_types ) > 0 ) {
|
| 184 |
-
echo '<p>' . __( 'Types creates Custom Post Types. These are user-defined WordPress content types. On your theme the following types are defined:',
|
| 185 |
-
'wpcf' ) . "</p>\n";
|
| 186 |
-
echo "<ul style='margin-left:20px;'>\n";
|
| 187 |
-
foreach ( $custom_types as $type ) {
|
| 188 |
-
echo "<li>" . $type['labels']['name'] . "</li>\n";
|
| 189 |
-
}
|
| 190 |
-
echo "</ul>\n";
|
| 191 |
-
}
|
| 192 |
-
|
| 193 |
-
?>
|
| 194 |
-
<p><?php
|
| 195 |
-
echo sprintf( __( 'If you want to edit these or create your own you can download the full version of <strong>Types</strong> from <a href="%s">%s</a>',
|
| 196 |
-
'wpcf' ), 'http://wordpress.org/extend/plugins/types/',
|
| 197 |
-
'http://wordpress.org/extend/plugins/types/' );
|
| 198 |
-
|
| 199 |
-
?></p>
|
| 200 |
-
|
| 201 |
-
<?php
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
/**
|
| 205 |
* Actions for outside fields control.
|
| 206 |
*
|
|
@@ -510,13 +474,12 @@ function wpcf_enqueue_scripts()
|
|
| 510 |
/**
|
| 511 |
* Basic JS
|
| 512 |
*/
|
| 513 |
-
wp_enqueue_script(
|
| 514 |
-
|
| 515 |
-
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
|
| 519 |
-
wp_enqueue_style('wpcf-css');
|
| 520 |
}
|
| 521 |
/**
|
| 522 |
* Basic JS
|
|
@@ -525,7 +488,7 @@ function wpcf_enqueue_scripts()
|
|
| 525 |
'wpcf-js-embedded',
|
| 526 |
WPCF_EMBEDDED_RES_RELPATH . '/js/basic.js',
|
| 527 |
array('jquery', 'jquery-ui-sortable', 'jquery-ui-draggable', 'jquery-ui-tabs'),
|
| 528 |
-
WPCF_VERSION
|
| 529 |
);
|
| 530 |
/*
|
| 531 |
*
|
| 3 |
* Basic and init functions.
|
| 4 |
* Since Types 1.2 moved from /embedded/types.php
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/functions.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1120400 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 149 |
$_POST['overwrite-fields'] = 1;
|
| 150 |
$_POST['overwrite-types'] = 1;
|
| 151 |
$_POST['overwrite-tax'] = 1;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 152 |
$_POST['post_relationship'] = 1;
|
| 153 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 154 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/import-export.php';
|
| 165 |
}
|
| 166 |
}
|
| 167 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 168 |
/**
|
| 169 |
* Actions for outside fields control.
|
| 170 |
*
|
| 474 |
/**
|
| 475 |
* Basic JS
|
| 476 |
*/
|
| 477 |
+
wp_enqueue_script(
|
| 478 |
+
'wpcf-js',
|
| 479 |
+
WPCF_RES_RELPATH . '/js/basic.js',
|
| 480 |
+
array('jquery', 'jquery-ui-sortable', 'jquery-ui-draggable', 'jquery-ui-tabs'),
|
| 481 |
+
WPCF_VERSION
|
| 482 |
+
);
|
|
|
|
| 483 |
}
|
| 484 |
/**
|
| 485 |
* Basic JS
|
| 488 |
'wpcf-js-embedded',
|
| 489 |
WPCF_EMBEDDED_RES_RELPATH . '/js/basic.js',
|
| 490 |
array('jquery', 'jquery-ui-sortable', 'jquery-ui-draggable', 'jquery-ui-tabs'),
|
| 491 |
+
WPCF_VERSION
|
| 492 |
);
|
| 493 |
/*
|
| 494 |
*
|
embedded/includes/ajax.php
CHANGED
|
@@ -2,6 +2,8 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
* All AJAX calls go here.
|
|
|
|
|
|
|
| 5 |
*/
|
| 6 |
function wpcf_ajax_embedded() {
|
| 7 |
|
|
@@ -11,9 +13,10 @@ function wpcf_ajax_embedded() {
|
|
| 11 |
}
|
| 12 |
} else {
|
| 13 |
|
| 14 |
-
if (
|
| 15 |
-
|
| 16 |
-
|
|
|
|
| 17 |
die( 'Verification failed' );
|
| 18 |
}
|
| 19 |
}
|
|
@@ -22,72 +25,80 @@ function wpcf_ajax_embedded() {
|
|
| 22 |
|
| 23 |
switch ( $_REQUEST['wpcf_action'] ) {
|
| 24 |
|
| 25 |
-
case 'editor_insert_date':
|
| 26 |
-
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields/date.php';
|
| 27 |
-
wpcf_fields_date_editor_form();
|
| 28 |
-
break;
|
| 29 |
-
|
| 30 |
case 'insert_skype_button':
|
|
|
|
|
|
|
|
|
|
|
|
|
| 31 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields/skype.php';
|
| 32 |
wpcf_fields_skype_meta_box_ajax();
|
| 33 |
break;
|
| 34 |
|
| 35 |
case 'editor_callback':
|
|
|
|
|
|
|
|
|
|
|
|
|
| 36 |
// Determine Field type and context
|
| 37 |
$views_usermeta = false;
|
|
|
|
|
|
|
|
|
|
| 38 |
if ( isset( $_GET['field_type'] ) && $_GET['field_type'] == 'usermeta' ) {
|
| 39 |
// Group filter
|
| 40 |
wp_enqueue_script( 'suggest' );
|
| 41 |
-
$field = types_get_field( $
|
| 42 |
$meta_type = 'usermeta';
|
| 43 |
}
|
| 44 |
elseif ( isset( $_GET['field_type'] ) && $_GET['field_type'] == 'views-usermeta' ){
|
| 45 |
-
$field = types_get_field( $
|
| 46 |
$meta_type = 'usermeta';
|
| 47 |
$views_usermeta = true;
|
| 48 |
}else {
|
| 49 |
-
$field = types_get_field( $
|
| 50 |
$meta_type = 'postmeta';
|
| 51 |
}
|
| 52 |
-
|
|
|
|
| 53 |
$shortcode = isset( $_GET['shortcode'] ) ? urldecode( $_GET['shortcode'] ) : null;
|
| 54 |
-
$callback = isset( $_GET['callback'] ) ? $_GET['callback'] : false;
|
| 55 |
if ( !empty( $field ) ) {
|
| 56 |
// Editor
|
| 57 |
WPCF_Loader::loadClass( 'editor' );
|
| 58 |
$editor = new WPCF_Editor();
|
| 59 |
-
$editor->frame( $field, $meta_type, $
|
| 60 |
$callback, $views_usermeta );
|
| 61 |
}
|
| 62 |
break;
|
| 63 |
|
| 64 |
case 'dismiss_message':
|
| 65 |
-
if
|
| 66 |
-
|
| 67 |
-
$messages[] = $_GET['id'];
|
| 68 |
-
update_option( 'wpcf_dismissed_messages', $messages );
|
| 69 |
}
|
| 70 |
-
break;
|
| 71 |
|
| 72 |
-
case '_dismiss_message':
|
| 73 |
if ( isset( $_GET['id'] ) ) {
|
| 74 |
-
$messages = get_option( '
|
| 75 |
-
$messages[
|
| 76 |
-
update_option( '
|
| 77 |
}
|
| 78 |
break;
|
| 79 |
|
| 80 |
case 'pr_add_child_post':
|
| 81 |
$output = 'Passed wrong parameters';
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
|
|
|
|
|
|
|
|
|
| 85 |
|
| 86 |
$relationships = get_option( 'wpcf_post_relationship', array() );
|
| 87 |
-
$
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
$
|
|
|
|
|
|
|
| 91 |
$data = $relationships[$parent_post_type][$post_type];
|
| 92 |
/*
|
| 93 |
* Since Types 1.1.5
|
|
@@ -95,8 +106,7 @@ function wpcf_ajax_embedded() {
|
|
| 95 |
* We save new post
|
| 96 |
* CHECKPOINT
|
| 97 |
*/
|
| 98 |
-
$id = $wpcf->relationship->add_new_child( $
|
| 99 |
-
$post_type );
|
| 100 |
|
| 101 |
if ( is_wp_error( $id ) ) {
|
| 102 |
$output = $id->get_error_message();
|
|
@@ -105,7 +115,7 @@ function wpcf_ajax_embedded() {
|
|
| 105 |
* Here we set Relationship
|
| 106 |
* CHECKPOINT
|
| 107 |
*/
|
| 108 |
-
$parent = get_post(
|
| 109 |
$child = get_post( $id );
|
| 110 |
if ( !empty( $parent->ID ) && !empty( $child->ID ) ) {
|
| 111 |
|
|
@@ -116,11 +126,10 @@ function wpcf_ajax_embedded() {
|
|
| 116 |
$wpcf->relationship->_set( $parent, $child, $data );
|
| 117 |
|
| 118 |
// Render new row
|
| 119 |
-
$output = $wpcf->relationship->child_row( $
|
| 120 |
$id, $data );
|
| 121 |
} else {
|
| 122 |
-
$output = __( 'Error creating post relationship',
|
| 123 |
-
'wpcf' );
|
| 124 |
}
|
| 125 |
}
|
| 126 |
} else {
|
|
@@ -142,14 +151,17 @@ function wpcf_ajax_embedded() {
|
|
| 142 |
|
| 143 |
case 'pr_save_all':
|
| 144 |
$output = '';
|
| 145 |
-
if ( isset( $_POST['post_id'] ) ) {
|
| 146 |
|
| 147 |
$parent_id = intval( $_POST['post_id'] );
|
|
|
|
| 148 |
if ( isset( $_POST['wpcf_post_relationship'][$parent_id] ) ) {
|
| 149 |
-
|
| 150 |
-
|
|
|
|
|
|
|
| 151 |
$output = $wpcf->relationship->child_meta_form(
|
| 152 |
-
$parent_id, strval( $
|
| 153 |
);
|
| 154 |
}
|
| 155 |
}
|
|
@@ -172,7 +184,7 @@ function wpcf_ajax_embedded() {
|
|
| 172 |
case 'pr_save_child_post':
|
| 173 |
ob_start(); // Try to catch any errors
|
| 174 |
$output = '';
|
| 175 |
-
if ( isset( $_GET['post_id'] )
|
| 176 |
&& isset( $_GET['parent_id'] )
|
| 177 |
&& isset( $_GET['post_type_parent'] )
|
| 178 |
&& isset( $_GET['post_type_child'] )
|
|
@@ -180,20 +192,21 @@ function wpcf_ajax_embedded() {
|
|
| 180 |
|
| 181 |
$parent_id = intval( $_GET['parent_id'] );
|
| 182 |
$child_id = intval( $_GET['post_id'] );
|
| 183 |
-
$parent_post_type =
|
| 184 |
-
$child_post_type =
|
|
|
|
| 185 |
if ( isset( $_POST['wpcf_post_relationship'][$parent_id][$child_id] ) ) {
|
| 186 |
-
$fields = (array) $_POST['wpcf_post_relationship'][$parent_id][$child_id];
|
| 187 |
-
$wpcf->relationship->save_child( $parent_id, $child_id,
|
| 188 |
-
|
| 189 |
-
$output = $wpcf->relationship->child_row(
|
|
|
|
| 190 |
$child_id,
|
| 191 |
-
$wpcf->relationship->settings( $parent_post_type,
|
| 192 |
-
|
| 193 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
. $child_id . '\');</script>';
|
| 197 |
}
|
| 198 |
}
|
| 199 |
}
|
|
@@ -215,7 +228,7 @@ function wpcf_ajax_embedded() {
|
|
| 215 |
case 'pr_delete_child_post':
|
| 216 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 217 |
$output = 'Passed wrong parameters';
|
| 218 |
-
if ( isset( $_GET['post_id'] ) ) {
|
| 219 |
$output = wpcf_pr_admin_delete_child_item( intval( $_GET['post_id'] ) );
|
| 220 |
}
|
| 221 |
echo json_encode( array(
|
|
@@ -226,10 +239,17 @@ function wpcf_ajax_embedded() {
|
|
| 226 |
case 'pr-update-belongs':
|
| 227 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 228 |
$output = 'Passed wrong parameters';
|
| 229 |
-
if (
|
| 230 |
-
|
| 231 |
-
|
| 232 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 233 |
$output = is_wp_error( $updated ) ? $updated->get_error_message() : $updated;
|
| 234 |
}
|
| 235 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
|
@@ -249,10 +269,10 @@ function wpcf_ajax_embedded() {
|
|
| 249 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 250 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 251 |
$output = 'Passed wrong parameters';
|
| 252 |
-
if ( isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 253 |
global $wpcf;
|
| 254 |
-
$parent = get_post(
|
| 255 |
-
$child_post_type =
|
| 256 |
|
| 257 |
if ( !empty( $parent->ID ) ) {
|
| 258 |
|
|
@@ -284,9 +304,9 @@ function wpcf_ajax_embedded() {
|
|
| 284 |
|
| 285 |
case 'pr_sort':
|
| 286 |
$output = 'Passed wrong parameters';
|
| 287 |
-
if ( isset( $_GET['field'] ) && isset( $_GET['sort'] ) && isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 288 |
$output = $wpcf->relationship->child_meta_form(
|
| 289 |
-
intval( $_GET['post_id'] ),
|
| 290 |
);
|
| 291 |
}
|
| 292 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
|
@@ -301,7 +321,8 @@ function wpcf_ajax_embedded() {
|
|
| 301 |
}
|
| 302 |
break;
|
| 303 |
|
| 304 |
-
|
|
|
|
| 305 |
$output = 'Passed wrong parameters';
|
| 306 |
if ( isset( $_GET['field'] ) && isset( $_GET['sort'] ) && isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 307 |
$output = $wpcf->relationship->child_meta_form(
|
|
@@ -318,20 +339,23 @@ function wpcf_ajax_embedded() {
|
|
| 318 |
'conditionals' => array('#post' => wptoolset_form_get_conditional_data( 'post' )),
|
| 319 |
) );
|
| 320 |
}
|
| 321 |
-
break
|
| 322 |
/* Usermeta */
|
| 323 |
case 'um_repetitive_add':
|
| 324 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 325 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 326 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 327 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 328 |
-
$field = wpcf_admin_fields_get_field( $_GET['field_id'], false,
|
| 329 |
false, false, 'wpcf-usermeta' );
|
| 330 |
-
if ( isset( $_GET['user_id'] ) ) {
|
| 331 |
-
$user_id = $_GET['user_id'];
|
| 332 |
-
} else {
|
| 333 |
-
$user_id = wpcf_usermeta_get_user();
|
| 334 |
-
}
|
| 335 |
global $wpcf;
|
| 336 |
$wpcf->usermeta_repeater->set( $user_id, $field );
|
| 337 |
/*
|
|
@@ -354,13 +378,17 @@ function wpcf_ajax_embedded() {
|
|
| 354 |
break;
|
| 355 |
|
| 356 |
case 'um_repetitive_delete':
|
| 357 |
-
if ( isset( $_POST['user_id'] )
|
|
|
|
|
|
|
|
|
|
| 358 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 359 |
-
$user_id = $_POST['user_id'];
|
| 360 |
|
| 361 |
-
$field = wpcf_admin_fields_get_field( $_POST['field_id'], false,
|
| 362 |
false, false, 'wpcf-usermeta' );
|
| 363 |
-
$meta_id = $_POST['meta_id'];
|
|
|
|
| 364 |
if ( !empty( $field ) && !empty( $user_id ) && !empty( $meta_id ) ) {
|
| 365 |
/*
|
| 366 |
*
|
|
@@ -388,25 +416,25 @@ function wpcf_ajax_embedded() {
|
|
| 388 |
break;
|
| 389 |
/* End Usermeta */
|
| 390 |
case 'repetitive_add':
|
| 391 |
-
if ( isset( $_GET['field_id'] ) ) {
|
| 392 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 393 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 394 |
-
$field = wpcf_admin_fields_get_field( $_GET['field_id'] );
|
| 395 |
-
$
|
| 396 |
|
| 397 |
/*
|
| 398 |
* When post is new - post_id is 0
|
| 399 |
* We can safely set post_id to 1 cause
|
| 400 |
* values compared are filtered anyway.
|
| 401 |
*/
|
| 402 |
-
if ( $
|
| 403 |
-
$
|
| 404 |
}
|
| 405 |
|
| 406 |
-
$
|
| 407 |
|
| 408 |
global $wpcf;
|
| 409 |
-
$wpcf->repeater->set( $
|
| 410 |
/*
|
| 411 |
*
|
| 412 |
* Force empty values!
|
|
@@ -427,12 +455,13 @@ function wpcf_ajax_embedded() {
|
|
| 427 |
break;
|
| 428 |
|
| 429 |
case 'repetitive_delete':
|
| 430 |
-
if ( isset( $_POST['post_id'] ) && isset( $_POST['field_id'] ) ) {
|
| 431 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 432 |
-
$
|
| 433 |
-
$
|
| 434 |
-
$
|
| 435 |
-
|
|
|
|
| 436 |
/*
|
| 437 |
*
|
| 438 |
*
|
|
@@ -440,7 +469,7 @@ function wpcf_ajax_embedded() {
|
|
| 440 |
* Since Types 1.2
|
| 441 |
*/
|
| 442 |
global $wpcf;
|
| 443 |
-
$wpcf->repeater->set( $
|
| 444 |
$wpcf->repeater->delete( $meta_id );
|
| 445 |
|
| 446 |
echo json_encode( array(
|
|
@@ -460,7 +489,7 @@ function wpcf_ajax_embedded() {
|
|
| 460 |
|
| 461 |
case 'cd_verify':
|
| 462 |
|
| 463 |
-
if ( empty( $_POST['wpcf'] ) && empty( $_POST['wpcf_post_relationship'] ) )
|
| 464 |
die();
|
| 465 |
}
|
| 466 |
WPCF_Loader::loadClass( 'helper.ajax' );
|
|
@@ -480,8 +509,8 @@ function wpcf_ajax_embedded() {
|
|
| 480 |
case 'cd_group_verify':
|
| 481 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 482 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/conditional-display.php';
|
| 483 |
-
$group = wpcf_admin_fields_get_group( $_POST['group_id'] );
|
| 484 |
-
if ( empty( $group ) ) {
|
| 485 |
echo json_encode( array(
|
| 486 |
'output' => ''
|
| 487 |
) );
|
|
@@ -493,23 +522,23 @@ function wpcf_ajax_embedded() {
|
|
| 493 |
// Filter meta values (switch them with $_POST values)
|
| 494 |
add_filter( 'get_post_metadata',
|
| 495 |
'wpcf_cd_meta_ajax_validation_filter', 10, 4 );
|
| 496 |
-
$
|
| 497 |
if ( isset( $_SERVER['HTTP_REFERER'] ) ) {
|
| 498 |
$split = explode( '?', $_SERVER['HTTP_REFERER'] );
|
| 499 |
if ( isset( $split[1] ) ) {
|
| 500 |
parse_str( $split[1], $vars );
|
| 501 |
if ( isset( $vars['post'] ) ) {
|
| 502 |
-
$
|
| 503 |
}
|
| 504 |
}
|
| 505 |
}
|
| 506 |
// Dummy post
|
| 507 |
-
if ( !$
|
| 508 |
-
$
|
| 509 |
-
$
|
| 510 |
}
|
| 511 |
if ( !empty( $group['conditional_display']['conditions'] ) ) {
|
| 512 |
-
$result = wpcf_cd_post_groups_filter( array(0 => $group), $
|
| 513 |
'group' );
|
| 514 |
if ( !empty( $result ) ) {
|
| 515 |
$result = array_shift( $result );
|
|
@@ -547,3 +576,43 @@ function wpcf_ajax_embedded() {
|
|
| 547 |
}
|
| 548 |
die();
|
| 549 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
* All AJAX calls go here.
|
| 5 |
+
*
|
| 6 |
+
* @todo auth
|
| 7 |
*/
|
| 8 |
function wpcf_ajax_embedded() {
|
| 9 |
|
| 13 |
}
|
| 14 |
} else {
|
| 15 |
|
| 16 |
+
if (
|
| 17 |
+
!isset( $_REQUEST['_wpnonce'] )
|
| 18 |
+
|| !wp_verify_nonce( $_REQUEST['_wpnonce'], $_REQUEST['wpcf_action'] )
|
| 19 |
+
) {
|
| 20 |
die( 'Verification failed' );
|
| 21 |
}
|
| 22 |
}
|
| 25 |
|
| 26 |
switch ( $_REQUEST['wpcf_action'] ) {
|
| 27 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 28 |
case 'insert_skype_button':
|
| 29 |
+
if( ! current_user_can( 'edit_posts' ) ) {
|
| 30 |
+
die( 'Authentication failed' );
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields/skype.php';
|
| 34 |
wpcf_fields_skype_meta_box_ajax();
|
| 35 |
break;
|
| 36 |
|
| 37 |
case 'editor_callback':
|
| 38 |
+
if( ! current_user_can( 'edit_posts' ) ) {
|
| 39 |
+
die( 'Authentication failed' );
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
// Determine Field type and context
|
| 43 |
$views_usermeta = false;
|
| 44 |
+
$field_id = sanitize_text_field( $_GET['field_id'] );
|
| 45 |
+
|
| 46 |
+
// todo this could be written in like four lines
|
| 47 |
if ( isset( $_GET['field_type'] ) && $_GET['field_type'] == 'usermeta' ) {
|
| 48 |
// Group filter
|
| 49 |
wp_enqueue_script( 'suggest' );
|
| 50 |
+
$field = types_get_field( $field_id, 'usermeta' );
|
| 51 |
$meta_type = 'usermeta';
|
| 52 |
}
|
| 53 |
elseif ( isset( $_GET['field_type'] ) && $_GET['field_type'] == 'views-usermeta' ){
|
| 54 |
+
$field = types_get_field( $field_id, 'usermeta' );
|
| 55 |
$meta_type = 'usermeta';
|
| 56 |
$views_usermeta = true;
|
| 57 |
}else {
|
| 58 |
+
$field = types_get_field( $field_id );
|
| 59 |
$meta_type = 'postmeta';
|
| 60 |
}
|
| 61 |
+
|
| 62 |
+
$parent_post_id = isset( $_GET['post_id'] ) ? intval( $_GET['post_id'] ) : null;
|
| 63 |
$shortcode = isset( $_GET['shortcode'] ) ? urldecode( $_GET['shortcode'] ) : null;
|
| 64 |
+
$callback = isset( $_GET['callback'] ) ? sanitize_text_field( $_GET['callback'] ) : false;
|
| 65 |
if ( !empty( $field ) ) {
|
| 66 |
// Editor
|
| 67 |
WPCF_Loader::loadClass( 'editor' );
|
| 68 |
$editor = new WPCF_Editor();
|
| 69 |
+
$editor->frame( $field, $meta_type, $parent_post_id, $shortcode,
|
| 70 |
$callback, $views_usermeta );
|
| 71 |
}
|
| 72 |
break;
|
| 73 |
|
| 74 |
case 'dismiss_message':
|
| 75 |
+
if( ! is_user_logged_in() ) {
|
| 76 |
+
die( 'Authentication failed' );
|
|
|
|
|
|
|
| 77 |
}
|
|
|
|
| 78 |
|
|
|
|
| 79 |
if ( isset( $_GET['id'] ) ) {
|
| 80 |
+
$messages = get_option( 'wpcf_dismissed_messages', array() );
|
| 81 |
+
$messages[] = sanitize_text_field( $_GET['id'] );
|
| 82 |
+
update_option( 'wpcf_dismissed_messages', $messages );
|
| 83 |
}
|
| 84 |
break;
|
| 85 |
|
| 86 |
case 'pr_add_child_post':
|
| 87 |
$output = 'Passed wrong parameters';
|
| 88 |
+
|
| 89 |
+
if ( current_user_can( 'edit_posts' )
|
| 90 |
+
&& isset( $_GET['post_id'] )
|
| 91 |
+
&& isset( $_GET['post_type_child'] )
|
| 92 |
+
&& isset( $_GET['post_type_parent'] ) )
|
| 93 |
+
{
|
| 94 |
|
| 95 |
$relationships = get_option( 'wpcf_post_relationship', array() );
|
| 96 |
+
$parent_post_id = intval( $_GET['post_id'] );
|
| 97 |
+
$parent_post = get_post( $parent_post_id );
|
| 98 |
+
if ( !empty( $parent_post->ID ) ) {
|
| 99 |
+
$post_type = sanitize_text_field( $_GET['post_type_child'] );
|
| 100 |
+
$parent_post_type = sanitize_text_field( $_GET['post_type_parent'] );
|
| 101 |
+
// @todo isset & error handling
|
| 102 |
$data = $relationships[$parent_post_type][$post_type];
|
| 103 |
/*
|
| 104 |
* Since Types 1.1.5
|
| 106 |
* We save new post
|
| 107 |
* CHECKPOINT
|
| 108 |
*/
|
| 109 |
+
$id = $wpcf->relationship->add_new_child( $parent_post->ID, $post_type );
|
|
|
|
| 110 |
|
| 111 |
if ( is_wp_error( $id ) ) {
|
| 112 |
$output = $id->get_error_message();
|
| 115 |
* Here we set Relationship
|
| 116 |
* CHECKPOINT
|
| 117 |
*/
|
| 118 |
+
$parent = get_post( $parent_post_id );
|
| 119 |
$child = get_post( $id );
|
| 120 |
if ( !empty( $parent->ID ) && !empty( $child->ID ) ) {
|
| 121 |
|
| 126 |
$wpcf->relationship->_set( $parent, $child, $data );
|
| 127 |
|
| 128 |
// Render new row
|
| 129 |
+
$output = $wpcf->relationship->child_row( $parent_post->ID,
|
| 130 |
$id, $data );
|
| 131 |
} else {
|
| 132 |
+
$output = __( 'Error creating post relationship', 'wpcf' );
|
|
|
|
| 133 |
}
|
| 134 |
}
|
| 135 |
} else {
|
| 151 |
|
| 152 |
case 'pr_save_all':
|
| 153 |
$output = '';
|
| 154 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_POST['post_id'] ) ) {
|
| 155 |
|
| 156 |
$parent_id = intval( $_POST['post_id'] );
|
| 157 |
+
$post_type = sanitize_text_field( $_POST['post_type'] );
|
| 158 |
if ( isset( $_POST['wpcf_post_relationship'][$parent_id] ) ) {
|
| 159 |
+
|
| 160 |
+
$children = wpcf_sanitize_post_realtionship_input( (array) $_POST['wpcf_post_relationship'][$parent_id] );
|
| 161 |
+
|
| 162 |
+
$wpcf->relationship->save_children( $parent_id, $children );
|
| 163 |
$output = $wpcf->relationship->child_meta_form(
|
| 164 |
+
$parent_id, strval( $post_type )
|
| 165 |
);
|
| 166 |
}
|
| 167 |
}
|
| 184 |
case 'pr_save_child_post':
|
| 185 |
ob_start(); // Try to catch any errors
|
| 186 |
$output = '';
|
| 187 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_GET['post_id'] )
|
| 188 |
&& isset( $_GET['parent_id'] )
|
| 189 |
&& isset( $_GET['post_type_parent'] )
|
| 190 |
&& isset( $_GET['post_type_child'] )
|
| 192 |
|
| 193 |
$parent_id = intval( $_GET['parent_id'] );
|
| 194 |
$child_id = intval( $_GET['post_id'] );
|
| 195 |
+
$parent_post_type = sanitize_text_field( $_GET['post_type_parent'] );
|
| 196 |
+
$child_post_type = sanitize_text_field( $_GET['post_type_child'] );
|
| 197 |
+
|
| 198 |
if ( isset( $_POST['wpcf_post_relationship'][$parent_id][$child_id] ) ) {
|
| 199 |
+
$fields = wpcf_sanitize_post_relationship_input_fields( (array) $_POST['wpcf_post_relationship'][$parent_id][$child_id] );
|
| 200 |
+
$wpcf->relationship->save_child( $parent_id, $child_id, $fields );
|
| 201 |
+
|
| 202 |
+
$output = $wpcf->relationship->child_row(
|
| 203 |
+
$parent_id,
|
| 204 |
$child_id,
|
| 205 |
+
$wpcf->relationship->settings( $parent_post_type, $child_post_type ) );
|
| 206 |
+
|
| 207 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
| 208 |
+
// TODO Move to conditional
|
| 209 |
+
$output .= '<script type="text/javascript">wpcfConditionalInit(\'#types-child-row-' . $child_id . '\');</script>';
|
|
|
|
| 210 |
}
|
| 211 |
}
|
| 212 |
}
|
| 228 |
case 'pr_delete_child_post':
|
| 229 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 230 |
$output = 'Passed wrong parameters';
|
| 231 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_GET['post_id'] ) ) {
|
| 232 |
$output = wpcf_pr_admin_delete_child_item( intval( $_GET['post_id'] ) );
|
| 233 |
}
|
| 234 |
echo json_encode( array(
|
| 239 |
case 'pr-update-belongs':
|
| 240 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 241 |
$output = 'Passed wrong parameters';
|
| 242 |
+
if ( current_user_can( 'edit_posts' )
|
| 243 |
+
&& isset( $_POST['post_id'] )
|
| 244 |
+
&& isset( $_POST['wpcf_pr_belongs'][$_POST['post_id']] ) )
|
| 245 |
+
{
|
| 246 |
+
$parent_post_id = intval( $_POST['post_id'] );
|
| 247 |
+
$belongs_assignments = array();
|
| 248 |
+
foreach( $_POST['wpcf_pr_belongs'][$parent_post_id] as $post_type_raw => $post_id_raw ) {
|
| 249 |
+
$belongs_assignments[ sanitize_text_field( $post_type_raw) ] = intval( $post_id_raw );
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
$updated = wpcf_pr_admin_update_belongs( $parent_post_id, $belongs_assignments );
|
| 253 |
$output = is_wp_error( $updated ) ? $updated->get_error_message() : $updated;
|
| 254 |
}
|
| 255 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
| 269 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 270 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 271 |
$output = 'Passed wrong parameters';
|
| 272 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 273 |
global $wpcf;
|
| 274 |
+
$parent = get_post( intval( $_GET['post_id'] ) );
|
| 275 |
+
$child_post_type = sanitize_text_field( $_GET['post_type'] );
|
| 276 |
|
| 277 |
if ( !empty( $parent->ID ) ) {
|
| 278 |
|
| 304 |
|
| 305 |
case 'pr_sort':
|
| 306 |
$output = 'Passed wrong parameters';
|
| 307 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_GET['field'] ) && isset( $_GET['sort'] ) && isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 308 |
$output = $wpcf->relationship->child_meta_form(
|
| 309 |
+
intval( $_GET['post_id'] ), sanitize_text_field( $_GET['post_type'] )
|
| 310 |
);
|
| 311 |
}
|
| 312 |
if ( !defined( 'WPTOOLSET_FORMS_VERSION' ) ) {
|
| 321 |
}
|
| 322 |
break;
|
| 323 |
|
| 324 |
+
// Not used anywhere
|
| 325 |
+
/*case 'pr_sort_parent':
|
| 326 |
$output = 'Passed wrong parameters';
|
| 327 |
if ( isset( $_GET['field'] ) && isset( $_GET['sort'] ) && isset( $_GET['post_id'] ) && isset( $_GET['post_type'] ) ) {
|
| 328 |
$output = $wpcf->relationship->child_meta_form(
|
| 339 |
'conditionals' => array('#post' => wptoolset_form_get_conditional_data( 'post' )),
|
| 340 |
) );
|
| 341 |
}
|
| 342 |
+
break;*/
|
| 343 |
/* Usermeta */
|
| 344 |
case 'um_repetitive_add':
|
| 345 |
+
|
| 346 |
+
if ( isset( $_GET['user_id'] ) ) {
|
| 347 |
+
$user_id = $_GET['user_id'];
|
| 348 |
+
} else {
|
| 349 |
+
$user_id = wpcf_usermeta_get_user();
|
| 350 |
+
}
|
| 351 |
+
|
| 352 |
+
if ( isset( $_GET['field_id'] )
|
| 353 |
+
&& current_user_can( 'edit_user', $user_id ) ) {
|
| 354 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 355 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 356 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 357 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_GET['field_id'] ), false,
|
| 358 |
false, false, 'wpcf-usermeta' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 359 |
global $wpcf;
|
| 360 |
$wpcf->usermeta_repeater->set( $user_id, $field );
|
| 361 |
/*
|
| 378 |
break;
|
| 379 |
|
| 380 |
case 'um_repetitive_delete':
|
| 381 |
+
if ( isset( $_POST['user_id'] )
|
| 382 |
+
&& isset( $_POST['field_id'] )
|
| 383 |
+
&& current_user_can( 'edit_user', intval( $_POST['user_id'] ) ) )
|
| 384 |
+
{
|
| 385 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 386 |
+
$user_id = intval( $_POST['user_id'] );
|
| 387 |
|
| 388 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_POST['field_id'] ), false,
|
| 389 |
false, false, 'wpcf-usermeta' );
|
| 390 |
+
$meta_id = intval( $_POST['meta_id'] );
|
| 391 |
+
|
| 392 |
if ( !empty( $field ) && !empty( $user_id ) && !empty( $meta_id ) ) {
|
| 393 |
/*
|
| 394 |
*
|
| 416 |
break;
|
| 417 |
/* End Usermeta */
|
| 418 |
case 'repetitive_add':
|
| 419 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_GET['field_id'] ) ) {
|
| 420 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 421 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 422 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_GET['field_id'] ) );
|
| 423 |
+
$parent_post_id = intval( $_GET['post_id'] );
|
| 424 |
|
| 425 |
/*
|
| 426 |
* When post is new - post_id is 0
|
| 427 |
* We can safely set post_id to 1 cause
|
| 428 |
* values compared are filtered anyway.
|
| 429 |
*/
|
| 430 |
+
if ( $parent_post_id == 0 ) {
|
| 431 |
+
$parent_post_id = 1;
|
| 432 |
}
|
| 433 |
|
| 434 |
+
$parent_post = get_post( $parent_post_id );
|
| 435 |
|
| 436 |
global $wpcf;
|
| 437 |
+
$wpcf->repeater->set( $parent_post, $field );
|
| 438 |
/*
|
| 439 |
*
|
| 440 |
* Force empty values!
|
| 455 |
break;
|
| 456 |
|
| 457 |
case 'repetitive_delete':
|
| 458 |
+
if ( current_user_can( 'edit_posts' ) && isset( $_POST['post_id'] ) && isset( $_POST['field_id'] ) ) {
|
| 459 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 460 |
+
$post_id = intval( $_POST['post_id'] );
|
| 461 |
+
$parent_post = get_post( $post_id );
|
| 462 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_POST['field_id'] ) );
|
| 463 |
+
$meta_id = intval( $_POST['meta_id'] );
|
| 464 |
+
if ( !empty( $field ) && !empty( $parent_post->ID ) && !empty( $meta_id ) ) {
|
| 465 |
/*
|
| 466 |
*
|
| 467 |
*
|
| 469 |
* Since Types 1.2
|
| 470 |
*/
|
| 471 |
global $wpcf;
|
| 472 |
+
$wpcf->repeater->set( $parent_post, $field );
|
| 473 |
$wpcf->repeater->delete( $meta_id );
|
| 474 |
|
| 475 |
echo json_encode( array(
|
| 489 |
|
| 490 |
case 'cd_verify':
|
| 491 |
|
| 492 |
+
if ( !current_user_can( 'edit_posts' ) || ( empty( $_POST['wpcf'] ) && empty( $_POST['wpcf_post_relationship'] ) ) ){
|
| 493 |
die();
|
| 494 |
}
|
| 495 |
WPCF_Loader::loadClass( 'helper.ajax' );
|
| 509 |
case 'cd_group_verify':
|
| 510 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 511 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/conditional-display.php';
|
| 512 |
+
$group = wpcf_admin_fields_get_group( sanitize_text_field( $_POST['group_id'] ) );
|
| 513 |
+
if ( !current_user_can( 'edit_posts' ) || empty( $group ) ) {
|
| 514 |
echo json_encode( array(
|
| 515 |
'output' => ''
|
| 516 |
) );
|
| 522 |
// Filter meta values (switch them with $_POST values)
|
| 523 |
add_filter( 'get_post_metadata',
|
| 524 |
'wpcf_cd_meta_ajax_validation_filter', 10, 4 );
|
| 525 |
+
$parent_post = false;
|
| 526 |
if ( isset( $_SERVER['HTTP_REFERER'] ) ) {
|
| 527 |
$split = explode( '?', $_SERVER['HTTP_REFERER'] );
|
| 528 |
if ( isset( $split[1] ) ) {
|
| 529 |
parse_str( $split[1], $vars );
|
| 530 |
if ( isset( $vars['post'] ) ) {
|
| 531 |
+
$parent_post = get_post( $vars['post'] );
|
| 532 |
}
|
| 533 |
}
|
| 534 |
}
|
| 535 |
// Dummy post
|
| 536 |
+
if ( !$parent_post ) {
|
| 537 |
+
$parent_post = new stdClass();
|
| 538 |
+
$parent_post->ID = 1;
|
| 539 |
}
|
| 540 |
if ( !empty( $group['conditional_display']['conditions'] ) ) {
|
| 541 |
+
$result = wpcf_cd_post_groups_filter( array(0 => $group), $parent_post,
|
| 542 |
'group' );
|
| 543 |
if ( !empty( $result ) ) {
|
| 544 |
$result = array_shift( $result );
|
| 576 |
}
|
| 577 |
die();
|
| 578 |
}
|
| 579 |
+
|
| 580 |
+
|
| 581 |
+
/**
|
| 582 |
+
* Sanitize input array with post children and their fields.
|
| 583 |
+
*
|
| 584 |
+
* @param array $children_raw See WPCF_Relationship::save_children().
|
| 585 |
+
* @return array Data with the same structure as input, but sanitized.
|
| 586 |
+
*
|
| 587 |
+
* @todo since
|
| 588 |
+
* @todo move to better location if such exists
|
| 589 |
+
*/
|
| 590 |
+
function wpcf_sanitize_post_realtionship_input( $children_raw ) {
|
| 591 |
+
$children = array();
|
| 592 |
+
foreach( $children_raw as $child_id_raw => $child_fields_raw ) {
|
| 593 |
+
$child_id = intval( $child_id_raw );
|
| 594 |
+
$children[ $child_id ] = wpcf_sanitize_post_relationship_input_fields( $child_fields_raw );
|
| 595 |
+
}
|
| 596 |
+
return $children;
|
| 597 |
+
}
|
| 598 |
+
|
| 599 |
+
|
| 600 |
+
/**
|
| 601 |
+
* Sanitize input array with post child fields.
|
| 602 |
+
*
|
| 603 |
+
* Note that only field keys are sanitized. Values can be arbitrary.
|
| 604 |
+
*
|
| 605 |
+
* @param array $fields_raw See WPCF_Relationship::save_child().
|
| 606 |
+
* @return array Data with the same structure as input, but sanitized.
|
| 607 |
+
*
|
| 608 |
+
* @todo since
|
| 609 |
+
* @todo move to better location if such exists
|
| 610 |
+
*/
|
| 611 |
+
function wpcf_sanitize_post_relationship_input_fields( $fields_raw ) {
|
| 612 |
+
$fields = array();
|
| 613 |
+
foreach( $fields_raw as $field_key_raw => $field_value_raw ) {
|
| 614 |
+
$field_key = sanitize_text_field( $field_key_raw );
|
| 615 |
+
$fields[ $field_key ] = $field_value_raw;
|
| 616 |
+
}
|
| 617 |
+
return $fields;
|
| 618 |
+
}
|
embedded/includes/api.php
CHANGED
|
@@ -10,8 +10,9 @@
|
|
| 10 |
|
| 11 |
/**
|
| 12 |
* Gets field.
|
| 13 |
-
*
|
| 14 |
-
* @param
|
|
|
|
| 15 |
* @return array
|
| 16 |
*/
|
| 17 |
function types_get_field( $field, $meta_type = 'postmeta' ) {
|
| 10 |
|
| 11 |
/**
|
| 12 |
* Gets field.
|
| 13 |
+
*
|
| 14 |
+
* @param string $field
|
| 15 |
+
* @param string $meta_type
|
| 16 |
* @return array
|
| 17 |
*/
|
| 18 |
function types_get_field( $field, $meta_type = 'postmeta' ) {
|
embedded/includes/classes/class.types.data.installer.php
ADDED
|
@@ -0,0 +1,268 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !class_exists('Types_Data_Installer') ) {
|
| 4 |
+
|
| 5 |
+
class Types_Data_Installer
|
| 6 |
+
{
|
| 7 |
+
private $data = array();
|
| 8 |
+
private $args = array();
|
| 9 |
+
private $fields = array();
|
| 10 |
+
private $user_fields = array();
|
| 11 |
+
private $reset_toolset_edit_last_list = array();
|
| 12 |
+
|
| 13 |
+
public function __construct($data, $args)
|
| 14 |
+
{
|
| 15 |
+
$this->data = $data;
|
| 16 |
+
$this->args = $args;
|
| 17 |
+
}
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* Create data for import.
|
| 21 |
+
*
|
| 22 |
+
* Populate and check data for import from Importer
|
| 23 |
+
*
|
| 24 |
+
* @since 1.6.6
|
| 25 |
+
*
|
| 26 |
+
* @return object data for import
|
| 27 |
+
*/
|
| 28 |
+
public function wpvdemo()
|
| 29 |
+
{
|
| 30 |
+
$data = new stdClass;
|
| 31 |
+
foreach(array('groups', 'user_groups', 'fields', 'user_fields', 'taxonomies', 'types') as $key) {
|
| 32 |
+
$data->$key = new stdClass;
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
$data->groups->group = $this->get_data_by_group_name('wp-types-group');
|
| 36 |
+
$data->user_groups->group = $this->get_data_by_group_name('wp-types-user-group');
|
| 37 |
+
|
| 38 |
+
$data->fields->field = $this->get_data_by_field_type('fields');
|
| 39 |
+
$data->user_fields->field = $this->get_data_by_field_type('user_fields');
|
| 40 |
+
|
| 41 |
+
$data->types->type = $this->get_data_by_type('wpcf-custom-types');
|
| 42 |
+
$data->taxonomies->taxonomy = $this->get_data_by_type('wpcf-custom-taxonomies');
|
| 43 |
+
|
| 44 |
+
return $data;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
/**
|
| 48 |
+
* Helper for group.
|
| 49 |
+
*
|
| 50 |
+
* Helper for importing group.
|
| 51 |
+
*
|
| 52 |
+
* @since 1.6.6
|
| 53 |
+
* @access private
|
| 54 |
+
*
|
| 55 |
+
* @param string $group_name Group name
|
| 56 |
+
*
|
| 57 |
+
* @return object data for import
|
| 58 |
+
*/
|
| 59 |
+
private function get_data_by_group_name($group_name)
|
| 60 |
+
{
|
| 61 |
+
$group = 'groups';
|
| 62 |
+
$element = 'group';
|
| 63 |
+
if ( 'wp-types-user-group' == $group_name ) {
|
| 64 |
+
$group = 'user_groups';
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
if (
|
| 68 |
+
isset($this->data->$group)
|
| 69 |
+
&& isset($this->data->$group->$element)
|
| 70 |
+
) {
|
| 71 |
+
return $this->get_data($group_name, $this->data->$group->$element);
|
| 72 |
+
}
|
| 73 |
+
return;
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
/**
|
| 77 |
+
* Build data for group.
|
| 78 |
+
*
|
| 79 |
+
* Build data to importing group.
|
| 80 |
+
*
|
| 81 |
+
* @since 1.6.6
|
| 82 |
+
* @access private
|
| 83 |
+
*
|
| 84 |
+
* @param string $group_name Group name
|
| 85 |
+
* @param object $group Group data
|
| 86 |
+
*
|
| 87 |
+
* @return object data for import
|
| 88 |
+
*/
|
| 89 |
+
private function get_data($group_name, $groups)
|
| 90 |
+
{
|
| 91 |
+
$this->reset_toolset_edit_last_list[$group_name] = array();
|
| 92 |
+
$date = date('Y-m-d H:i');
|
| 93 |
+
$new = array();
|
| 94 |
+
foreach($groups as $group ) {
|
| 95 |
+
if (
|
| 96 |
+
isset($this->args['force_skip_post_name'][$group_name])
|
| 97 |
+
&& in_array($group->__types_id, $this->args['force_skip_post_name'][$group_name])
|
| 98 |
+
) {
|
| 99 |
+
continue;
|
| 100 |
+
}
|
| 101 |
+
if (
|
| 102 |
+
isset($this->args['force_import_post_name'][$group_name])
|
| 103 |
+
&& in_array($group->__types_id, $this->args['force_import_post_name'][$group_name])
|
| 104 |
+
) {
|
| 105 |
+
$new[] = $group;
|
| 106 |
+
switch($group_name) {
|
| 107 |
+
case 'wp-types-group':
|
| 108 |
+
$this->fields += explode(',', $group->meta->_wp_types_group_fields);
|
| 109 |
+
break;
|
| 110 |
+
case 'wp-types-user-group':
|
| 111 |
+
$this->user_fields += explode(',', $group->meta->_wp_types_group_fields);
|
| 112 |
+
break;
|
| 113 |
+
}
|
| 114 |
+
$this->reset_toolset_edit_last_list[$group_name][] = $group->__types_id;
|
| 115 |
+
continue;
|
| 116 |
+
}
|
| 117 |
+
if (
|
| 118 |
+
isset($this->args['force_duplicate_post_name'][$group_name])
|
| 119 |
+
&& in_array($group->__types_id, $this->args['force_duplicate_post_name'][$group_name])
|
| 120 |
+
) {
|
| 121 |
+
$one = $group;
|
| 122 |
+
$one->__types_id = wp_unique_post_slug( sanitize_title_with_dashes($group->post_title, null, 'save'), null, 'publish', 'wp-types-group', null);
|
| 123 |
+
$one->__types_title = $one->post_title = sprintf('%s %s', $group->post_title, $date);
|
| 124 |
+
$new[$one->__types_id] = $one;
|
| 125 |
+
continue;
|
| 126 |
+
}
|
| 127 |
+
}
|
| 128 |
+
return $new;
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
/**
|
| 132 |
+
* Helper for CPT & CT.
|
| 133 |
+
*
|
| 134 |
+
* Helper for importing custom post types and custom taxonomies.
|
| 135 |
+
*
|
| 136 |
+
* @since 1.6.6
|
| 137 |
+
* @access private
|
| 138 |
+
*
|
| 139 |
+
* @param string $group_name Group name
|
| 140 |
+
*
|
| 141 |
+
* @return object data for import
|
| 142 |
+
*/
|
| 143 |
+
private function get_data_by_field_type($type)
|
| 144 |
+
{
|
| 145 |
+
if (
|
| 146 |
+
isset($this->data->fields)
|
| 147 |
+
&& isset($this->data->fields->field)
|
| 148 |
+
) {
|
| 149 |
+
$fields = $this->data->fields->field;
|
| 150 |
+
} else {
|
| 151 |
+
return;
|
| 152 |
+
}
|
| 153 |
+
$new = array();
|
| 154 |
+
foreach($fields as $field ) {
|
| 155 |
+
if ( in_array($field->id, $this->$type) )
|
| 156 |
+
{
|
| 157 |
+
$new[] = $field;
|
| 158 |
+
}
|
| 159 |
+
}
|
| 160 |
+
return $new;
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
/**
|
| 164 |
+
* Build data for CPT & CT
|
| 165 |
+
*
|
| 166 |
+
* Build data to importing custom post types and custom taxonomies.
|
| 167 |
+
*
|
| 168 |
+
* @since 1.6.6
|
| 169 |
+
* @access private
|
| 170 |
+
*
|
| 171 |
+
* @param string $group_name Group name
|
| 172 |
+
* @param object $group Group data
|
| 173 |
+
*
|
| 174 |
+
* @return object data for import
|
| 175 |
+
*/
|
| 176 |
+
private function get_data_by_type($group_name)
|
| 177 |
+
{
|
| 178 |
+
$group = 'types';
|
| 179 |
+
$element = 'type';
|
| 180 |
+
if ( 'wpcf-custom-taxonomies' == $group_name ) {
|
| 181 |
+
$group = 'taxonomies';
|
| 182 |
+
$element = 'taxonomy';
|
| 183 |
+
}
|
| 184 |
+
if (
|
| 185 |
+
isset($this->data->$group)
|
| 186 |
+
&& isset($this->data->$group->$element)
|
| 187 |
+
) {
|
| 188 |
+
$groups = $this->data->$group->$element;
|
| 189 |
+
} else {
|
| 190 |
+
return;
|
| 191 |
+
}
|
| 192 |
+
|
| 193 |
+
$this->reset_toolset_edit_last_list[$group_name] = array();
|
| 194 |
+
|
| 195 |
+
$date = date('Y-m-d H:i');
|
| 196 |
+
$new = array();
|
| 197 |
+
$data = get_option($group_name, array());
|
| 198 |
+
|
| 199 |
+
foreach ( $groups as $group) {
|
| 200 |
+
$slug = $group->slug->__toString();
|
| 201 |
+
if ( isset($data[$slug]) && !isset($data[$slug][TOOLSET_EDIT_LAST]) ) {
|
| 202 |
+
continue;
|
| 203 |
+
}
|
| 204 |
+
$this->reset_toolset_edit_last_list[$group_name][] = $slug;
|
| 205 |
+
if (
|
| 206 |
+
isset($this->args['force_skip_post_name'][$group_name])
|
| 207 |
+
&& in_array($group->__types_id, $this->args['force_skip_post_name'][$group_name])
|
| 208 |
+
) {
|
| 209 |
+
continue;
|
| 210 |
+
}
|
| 211 |
+
if (
|
| 212 |
+
isset($this->args['force_import_post_name'][$group_name])
|
| 213 |
+
&& in_array($group->__types_id, $this->args['force_import_post_name'][$group_name])
|
| 214 |
+
) {
|
| 215 |
+
$this->reset_toolset_edit_last_list[$group_name][] = (int)$group->ID;
|
| 216 |
+
$group->addChild('add', false);
|
| 217 |
+
$group->addChild('update', true);
|
| 218 |
+
$new[] = $group;
|
| 219 |
+
continue;
|
| 220 |
+
}
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
return $new;
|
| 224 |
+
}
|
| 225 |
+
|
| 226 |
+
/**
|
| 227 |
+
* Reset TOOLSET_EDIT_LAST.
|
| 228 |
+
*
|
| 229 |
+
* Function to reset TOOLSET_EDIT_LAST - last edit timestamp in Types
|
| 230 |
+
* definitions.
|
| 231 |
+
*
|
| 232 |
+
* @since 1.6.6
|
| 233 |
+
*
|
| 234 |
+
*/
|
| 235 |
+
public function reset_toolset_edit_last()
|
| 236 |
+
{
|
| 237 |
+
if (!empty($this->reset_toolset_edit_last_list)) {
|
| 238 |
+
foreach( $this->reset_toolset_edit_last_list as $group => $data) {
|
| 239 |
+
switch( $group ) {
|
| 240 |
+
case 'wp-types-group':
|
| 241 |
+
case 'wp-types-user-group':
|
| 242 |
+
foreach( $data as $slug) {
|
| 243 |
+
$post = get_page_by_path($slug, OBJECT, $group);
|
| 244 |
+
if ( $post ) {
|
| 245 |
+
delete_post_meta( $post->ID, TOOLSET_EDIT_LAST);
|
| 246 |
+
}
|
| 247 |
+
}
|
| 248 |
+
break;
|
| 249 |
+
case 'wpcf-custom-types':
|
| 250 |
+
case 'wpcf-custom-taxonomies':
|
| 251 |
+
$options = get_option( $group, array() );
|
| 252 |
+
$new = array();
|
| 253 |
+
foreach ( $options as $one ) {
|
| 254 |
+
if ( in_array($one['slug'], $data ) ) {
|
| 255 |
+
if ( isset( $one[TOOLSET_EDIT_LAST]) ) {
|
| 256 |
+
unset($one[TOOLSET_EDIT_LAST]);
|
| 257 |
+
}
|
| 258 |
+
}
|
| 259 |
+
$new[$one['slug']] = $one;
|
| 260 |
+
}
|
| 261 |
+
update_option($group, $new);
|
| 262 |
+
break;
|
| 263 |
+
}
|
| 264 |
+
}
|
| 265 |
+
}
|
| 266 |
+
}
|
| 267 |
+
}
|
| 268 |
+
}
|
embedded/includes/custom-taxonomies.php
CHANGED
|
@@ -46,6 +46,10 @@ function wpcf_custom_taxonomies_default() {
|
|
| 46 |
'choose_from_most_used' => 'Choose from the most used %s',
|
| 47 |
'menu_name' => '%s',
|
| 48 |
),
|
|
|
|
|
|
|
|
|
|
|
|
|
| 49 |
);
|
| 50 |
}
|
| 51 |
|
|
@@ -63,9 +67,9 @@ function wpcf_custom_taxonomies_init() {
|
|
| 63 |
|
| 64 |
/**
|
| 65 |
* Registers custom taxonomies.
|
| 66 |
-
*
|
| 67 |
* @param type $post_type
|
| 68 |
-
* @param type $data
|
| 69 |
*/
|
| 70 |
function wpcf_custom_taxonomies_register( $taxonomy, $data ) {
|
| 71 |
if ( !empty( $data['disabled'] ) ) {
|
|
@@ -133,6 +137,16 @@ function wpcf_custom_taxonomies_register( $taxonomy, $data ) {
|
|
| 133 |
} else {
|
| 134 |
$data['rewrite'] = false;
|
| 135 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 136 |
// Force removing capabilities here
|
| 137 |
unset( $data['capabilities'] );
|
| 138 |
register_taxonomy( $taxonomy,
|
|
@@ -142,8 +156,8 @@ function wpcf_custom_taxonomies_register( $taxonomy, $data ) {
|
|
| 142 |
|
| 143 |
/**
|
| 144 |
* Returns only active taxonomies.
|
| 145 |
-
*
|
| 146 |
-
* @return type
|
| 147 |
*/
|
| 148 |
function wpcf_get_active_custom_taxonomies() {
|
| 149 |
$taxonomies = get_option('wpcf-custom-taxonomies', array());
|
|
@@ -153,4 +167,4 @@ function wpcf_get_active_custom_taxonomies() {
|
|
| 153 |
}
|
| 154 |
}
|
| 155 |
return $taxonomies;
|
| 156 |
-
}
|
| 46 |
'choose_from_most_used' => 'Choose from the most used %s',
|
| 47 |
'menu_name' => '%s',
|
| 48 |
),
|
| 49 |
+
'meta_box_cb' => array(
|
| 50 |
+
'disabled' => false,
|
| 51 |
+
'callback' => null,
|
| 52 |
+
),
|
| 53 |
);
|
| 54 |
}
|
| 55 |
|
| 67 |
|
| 68 |
/**
|
| 69 |
* Registers custom taxonomies.
|
| 70 |
+
*
|
| 71 |
* @param type $post_type
|
| 72 |
+
* @param type $data
|
| 73 |
*/
|
| 74 |
function wpcf_custom_taxonomies_register( $taxonomy, $data ) {
|
| 75 |
if ( !empty( $data['disabled'] ) ) {
|
| 137 |
} else {
|
| 138 |
$data['rewrite'] = false;
|
| 139 |
}
|
| 140 |
+
/**
|
| 141 |
+
* meta_box_cb
|
| 142 |
+
*/
|
| 143 |
+
if ( isset($data['meta_box_cb']['disabled'])) {
|
| 144 |
+
$data['meta_box_cb'] = false;
|
| 145 |
+
} else if ( isset($data['meta_box_cb']['callback']) && !empty($data['meta_box_cb']['callback']) ){
|
| 146 |
+
$data['meta_box_cb'] = $data['meta_box_cb']['callback'];
|
| 147 |
+
} else {
|
| 148 |
+
unset($data['meta_box_cb']);
|
| 149 |
+
}
|
| 150 |
// Force removing capabilities here
|
| 151 |
unset( $data['capabilities'] );
|
| 152 |
register_taxonomy( $taxonomy,
|
| 156 |
|
| 157 |
/**
|
| 158 |
* Returns only active taxonomies.
|
| 159 |
+
*
|
| 160 |
+
* @return type
|
| 161 |
*/
|
| 162 |
function wpcf_get_active_custom_taxonomies() {
|
| 163 |
$taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 167 |
}
|
| 168 |
}
|
| 169 |
return $taxonomies;
|
| 170 |
+
}
|
embedded/includes/custom-types.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Custom Post Types embedded code.
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate:
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -200,38 +200,26 @@ function wpcf_custom_types_register( $post_type, $data ) {
|
|
| 200 |
$data['permalink_epmask'] = constant( $data['permalink_epmask'] );
|
| 201 |
}
|
| 202 |
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
do_action( 'wpcf_type_registered', $args );
|
| 207 |
-
|
| 208 |
-
/*
|
| 209 |
-
* Since Types 1.2
|
| 210 |
-
* We do not encourage plural and singular names to be same.
|
| 211 |
*/
|
| 212 |
-
$
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 220 |
|
| 221 |
-
|
| 222 |
-
$body = '';
|
| 223 |
-
if ( in_array( 'post_tag', $data['taxonomies'] ) ) {
|
| 224 |
-
$body = 'register_taxonomy_for_object_type("post_tag", "' . $post_type . '");';
|
| 225 |
-
}
|
| 226 |
-
if ( in_array( 'category', $data['taxonomies'] ) ) {
|
| 227 |
-
$body .= 'register_taxonomy_for_object_type("category", "' . $post_type . '");';
|
| 228 |
-
}
|
| 229 |
|
| 230 |
-
|
| 231 |
-
$post_type = str_replace( '-', '_', $post_type );
|
| 232 |
-
if ( $body != '' ) {
|
| 233 |
-
add_action( 'init', create_function('', $body ));
|
| 234 |
-
}
|
| 235 |
}
|
| 236 |
|
| 237 |
/**
|
|
@@ -297,3 +285,48 @@ function wpcf_get_active_custom_types() {
|
|
| 297 |
}
|
| 298 |
return $types;
|
| 299 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
*
|
| 4 |
* Custom Post Types embedded code.
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/custom-types.php $
|
| 7 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 8 |
+
* $LastChangedRevision: 1113864 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 200 |
$data['permalink_epmask'] = constant( $data['permalink_epmask'] );
|
| 201 |
}
|
| 202 |
|
| 203 |
+
/**
|
| 204 |
+
* set default support options
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 205 |
*/
|
| 206 |
+
$support_fields = array(
|
| 207 |
+
'editor' => false,
|
| 208 |
+
'author' => false,
|
| 209 |
+
'thumbnail' => false,
|
| 210 |
+
'excerpt' => false,
|
| 211 |
+
'trackbacks' => false,
|
| 212 |
+
'custom-fields' => false,
|
| 213 |
+
'comments' => false,
|
| 214 |
+
'revisions' => false,
|
| 215 |
+
'page-attributes' => false,
|
| 216 |
+
'post-formats' => false,
|
| 217 |
+
);
|
| 218 |
+
$data['supports'] = array_merge_recursive( $data['supports'], $support_fields );
|
| 219 |
|
| 220 |
+
$args = register_post_type( $post_type, apply_filters( 'wpcf_type', $data, $post_type ) );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 221 |
|
| 222 |
+
do_action( 'wpcf_type_registered', $args );
|
|
|
|
|
|
|
|
|
|
|
|
|
| 223 |
}
|
| 224 |
|
| 225 |
/**
|
| 285 |
}
|
| 286 |
return $types;
|
| 287 |
}
|
| 288 |
+
|
| 289 |
+
/** This action is documented in wp-admin/includes/dashboard.php */
|
| 290 |
+
add_action('dashboard_glance_items', 'wpcf_dashboard_glance_items');
|
| 291 |
+
|
| 292 |
+
/**
|
| 293 |
+
* Add CPT info to "At a Glance"
|
| 294 |
+
*
|
| 295 |
+
* Add to "At a Glance" WordPress admin dashboard widget information
|
| 296 |
+
* about number of posts.
|
| 297 |
+
*
|
| 298 |
+
* @since 1.6.6
|
| 299 |
+
*
|
| 300 |
+
*/
|
| 301 |
+
function wpcf_dashboard_glance_items()
|
| 302 |
+
{
|
| 303 |
+
$custom_types = get_option( 'wpcf-custom-types', array() );
|
| 304 |
+
ksort($custom_types);
|
| 305 |
+
if ( !empty( $custom_types ) ) {
|
| 306 |
+
foreach ( $custom_types as $post_type => $data ) {
|
| 307 |
+
if ( !isset($data['dashboard_glance']) || !$data['dashboard_glance']) {
|
| 308 |
+
continue;
|
| 309 |
+
}
|
| 310 |
+
if ( isset($data['disabled']) && $data['disabled'] ) {
|
| 311 |
+
continue;
|
| 312 |
+
}
|
| 313 |
+
$num_posts = wp_count_posts($post_type);
|
| 314 |
+
$num = number_format_i18n($num_posts->publish);
|
| 315 |
+
$text = _n( $data['labels']['singular_name'], $data['labels']['name'], intval($num_posts->publish) );
|
| 316 |
+
printf(
|
| 317 |
+
'<li class="page-count %s-count"><a href="%s"%s>%d %s</a></li>',
|
| 318 |
+
$post_type,
|
| 319 |
+
add_query_arg(
|
| 320 |
+
array(
|
| 321 |
+
'post_type' => $post_type,
|
| 322 |
+
),
|
| 323 |
+
admin_url('edit.php')
|
| 324 |
+
),
|
| 325 |
+
isset($data['icon'])? sprintf('class="dashicons-%s"', $data['icon']):'',
|
| 326 |
+
$num,
|
| 327 |
+
$text
|
| 328 |
+
);
|
| 329 |
+
}
|
| 330 |
+
}
|
| 331 |
+
}
|
| 332 |
+
|
embedded/includes/editor-support/post-relationship-editor-support.php
DELETED
|
@@ -1,4 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/*
|
| 3 |
-
*
|
| 4 |
-
*/
|
|
|
|
|
|
|
|
|
|
|
|
embedded/includes/examples/google_map.php
CHANGED
|
@@ -72,9 +72,13 @@ function wpcf_fields_google_map() {
|
|
| 72 |
'deps' => array('jquery'), // (optional) Same as WP's enqueue_script() param
|
| 73 |
'in_footer' => true, // (optional) Same as WP's enqueue_script() param
|
| 74 |
),
|
|
|
|
|
|
|
|
|
|
| 75 |
'wpcf-jquery-fields-my-field' => array(
|
| 76 |
'src' => get_stylesheet_directory_uri() . '/js/my-field.js', // This will load JS file
|
| 77 |
),
|
|
|
|
| 78 |
),
|
| 79 |
// Additional CSS on post edit page
|
| 80 |
'meta_box_css' => array(
|
|
@@ -85,14 +89,22 @@ function wpcf_fields_google_map() {
|
|
| 85 |
),
|
| 86 |
// Additional JS on group edit page
|
| 87 |
'group_form_js' => array(// Add JS when field is active on post edit page
|
|
|
|
|
|
|
|
|
|
| 88 |
'wpcf-jquery-fields-my-field' => array(
|
| 89 |
'inline' => 'wpcf_fields_google_map_group_form_js_inline', // This calls function that renders JS
|
| 90 |
'deps' => array('jquery'), // (optional) Same as WP's enqueue_script() param
|
| 91 |
'in_footer' => true, // (optional) Same as WP's enqueue_script() param
|
| 92 |
),
|
|
|
|
|
|
|
|
|
|
|
|
|
| 93 |
'wpcf-jquery-fields-my-field' => array(
|
| 94 |
'src' => get_stylesheet_directory_uri() . '/js/my-field.js', // This will load JS file
|
| 95 |
),
|
|
|
|
| 96 |
),
|
| 97 |
// Additional CSS on post edit page
|
| 98 |
'group_form_css' => array(
|
| 72 |
'deps' => array('jquery'), // (optional) Same as WP's enqueue_script() param
|
| 73 |
'in_footer' => true, // (optional) Same as WP's enqueue_script() param
|
| 74 |
),
|
| 75 |
+
/**
|
| 76 |
+
* example how to add javascript file
|
| 77 |
+
*
|
| 78 |
'wpcf-jquery-fields-my-field' => array(
|
| 79 |
'src' => get_stylesheet_directory_uri() . '/js/my-field.js', // This will load JS file
|
| 80 |
),
|
| 81 |
+
*/
|
| 82 |
),
|
| 83 |
// Additional CSS on post edit page
|
| 84 |
'meta_box_css' => array(
|
| 89 |
),
|
| 90 |
// Additional JS on group edit page
|
| 91 |
'group_form_js' => array(// Add JS when field is active on post edit page
|
| 92 |
+
/**
|
| 93 |
+
* example how to add javascript file wit callback fundtion
|
| 94 |
+
*
|
| 95 |
'wpcf-jquery-fields-my-field' => array(
|
| 96 |
'inline' => 'wpcf_fields_google_map_group_form_js_inline', // This calls function that renders JS
|
| 97 |
'deps' => array('jquery'), // (optional) Same as WP's enqueue_script() param
|
| 98 |
'in_footer' => true, // (optional) Same as WP's enqueue_script() param
|
| 99 |
),
|
| 100 |
+
*/
|
| 101 |
+
/**
|
| 102 |
+
* example how to add javascript file
|
| 103 |
+
*
|
| 104 |
'wpcf-jquery-fields-my-field' => array(
|
| 105 |
'src' => get_stylesheet_directory_uri() . '/js/my-field.js', // This will load JS file
|
| 106 |
),
|
| 107 |
+
*/
|
| 108 |
),
|
| 109 |
// Additional CSS on post edit page
|
| 110 |
'group_form_css' => array(
|
embedded/includes/fields-post.php
CHANGED
|
@@ -4,9 +4,9 @@
|
|
| 4 |
* Edit post page functions
|
| 5 |
*
|
| 6 |
*
|
| 7 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 8 |
-
* $LastChangedDate:
|
| 9 |
-
* $LastChangedRevision:
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
* Core file with stable and working functions.
|
|
@@ -521,7 +521,7 @@ function wpcf_admin_post_meta_box( $post, $group, $echo = '', $open_style_editor
|
|
| 521 |
$field['type'] = 'wysiwyg';
|
| 522 |
$group_output .= '</div>';
|
| 523 |
$group_output .= isset( $field['#after'] ) ? $field['#after'] : '';
|
| 524 |
-
$group_output .= '</div
|
| 525 |
} else {
|
| 526 |
if (
|
| 527 |
array_key_exists( '#type', $field )
|
|
@@ -1515,9 +1515,8 @@ function wpcf_admin_post_process_field( $field_object ) {
|
|
| 1515 |
* @param type $post_ID
|
| 1516 |
* @return type
|
| 1517 |
*/
|
| 1518 |
-
function wpcf_admin_post_get_post_groups_fields( $post = false,
|
| 1519 |
-
|
| 1520 |
-
|
| 1521 |
// Get post_type
|
| 1522 |
/*
|
| 1523 |
*
|
|
@@ -1533,8 +1532,7 @@ function wpcf_admin_post_get_post_groups_fields( $post = false,
|
|
| 1533 |
} else {
|
| 1534 |
if ( !isset( $_GET['post_type'] ) ) {
|
| 1535 |
$post_type = 'post';
|
| 1536 |
-
} else if ( in_array( $_GET['post_type'],
|
| 1537 |
-
get_post_types( array('show_ui' => true) ) ) ) {
|
| 1538 |
$post_type = $_GET['post_type'];
|
| 1539 |
} else {
|
| 1540 |
$post_type = 'post';
|
|
@@ -1568,10 +1566,8 @@ function wpcf_admin_post_get_post_groups_fields( $post = false,
|
|
| 1568 |
$post->_wpcf_post_template = false;
|
| 1569 |
$post->_wpcf_post_views_template = false;
|
| 1570 |
} else {
|
| 1571 |
-
$post->_wpcf_post_template = get_post_meta( $post->ID,
|
| 1572 |
-
|
| 1573 |
-
$post->_wpcf_post_views_template = get_post_meta( $post->ID,
|
| 1574 |
-
'_views_template', true );
|
| 1575 |
}
|
| 1576 |
|
| 1577 |
if ( empty( $post->_wpcf_post_terms ) ) {
|
|
@@ -1855,7 +1851,7 @@ function wpcf_admin_post_marketing_meta_box() {
|
|
| 1855 |
$output .= '<p><a href="' . admin_url( 'edit.php?post_type=view' ) . '">' . __( 'Create <strong>Views</strong> for content lists »',
|
| 1856 |
'wpcf' ) . '</a></p>';
|
| 1857 |
} else {
|
| 1858 |
-
$output .= '<p><strong>' . sprintf( __( "%sViews%s
|
| 1859 |
'wpcf' ),
|
| 1860 |
'<a href="http://wp-types.com/home/views-create-elegant-displays-for-your-content/?utm_source=typesplugin&utm_medium=postedit&utm_term=views&utm_content=promobox&utm_campaign=types" title="Views" target="_blank">',
|
| 1861 |
'</a>' )
|
| 4 |
* Edit post page functions
|
| 5 |
*
|
| 6 |
*
|
| 7 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields-post.php $
|
| 8 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 9 |
+
* $LastChangedRevision: 1120400 $
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
* Core file with stable and working functions.
|
| 521 |
$field['type'] = 'wysiwyg';
|
| 522 |
$group_output .= '</div>';
|
| 523 |
$group_output .= isset( $field['#after'] ) ? $field['#after'] : '';
|
| 524 |
+
$group_output .= '</div>';
|
| 525 |
} else {
|
| 526 |
if (
|
| 527 |
array_key_exists( '#type', $field )
|
| 1515 |
* @param type $post_ID
|
| 1516 |
* @return type
|
| 1517 |
*/
|
| 1518 |
+
function wpcf_admin_post_get_post_groups_fields( $post = false, $context = 'group' )
|
| 1519 |
+
{
|
|
|
|
| 1520 |
// Get post_type
|
| 1521 |
/*
|
| 1522 |
*
|
| 1532 |
} else {
|
| 1533 |
if ( !isset( $_GET['post_type'] ) ) {
|
| 1534 |
$post_type = 'post';
|
| 1535 |
+
} else if ( in_array( $_GET['post_type'], get_post_types( array('show_ui' => true) ) ) ) {
|
|
|
|
| 1536 |
$post_type = $_GET['post_type'];
|
| 1537 |
} else {
|
| 1538 |
$post_type = 'post';
|
| 1566 |
$post->_wpcf_post_template = false;
|
| 1567 |
$post->_wpcf_post_views_template = false;
|
| 1568 |
} else {
|
| 1569 |
+
$post->_wpcf_post_template = get_post_meta( $post->ID, '_wp_page_template', true );
|
| 1570 |
+
$post->_wpcf_post_views_template = get_post_meta( $post->ID, '_views_template', true );
|
|
|
|
|
|
|
| 1571 |
}
|
| 1572 |
|
| 1573 |
if ( empty( $post->_wpcf_post_terms ) ) {
|
| 1851 |
$output .= '<p><a href="' . admin_url( 'edit.php?post_type=view' ) . '">' . __( 'Create <strong>Views</strong> for content lists »',
|
| 1852 |
'wpcf' ) . '</a></p>';
|
| 1853 |
} else {
|
| 1854 |
+
$output .= '<p><strong>' . sprintf( __( "%sViews%s lets you build complete websites without coding.",
|
| 1855 |
'wpcf' ),
|
| 1856 |
'<a href="http://wp-types.com/home/views-create-elegant-displays-for-your-content/?utm_source=typesplugin&utm_medium=postedit&utm_term=views&utm_content=promobox&utm_campaign=types" title="Views" target="_blank">',
|
| 1857 |
'</a>' )
|
embedded/includes/fields.php
CHANGED
|
@@ -3,7 +3,6 @@
|
|
| 3 |
/**
|
| 4 |
* Gets all groups.
|
| 5 |
*
|
| 6 |
-
* @global type $wpdb
|
| 7 |
* @param string $post_type
|
| 8 |
* @param boolean|string $only_active
|
| 9 |
* @param boolean|string $add_fields - 'field_active', 'field_all', false (to omitt fields)
|
|
@@ -38,9 +37,10 @@ function wpcf_admin_fields_get_groups( $post_type = 'wp-types-group',
|
|
| 38 |
*
|
| 39 |
* Since 1.2 we enabled fetching by post title.
|
| 40 |
*
|
| 41 |
-
* @
|
| 42 |
-
* @param
|
| 43 |
-
* @
|
|
|
|
| 44 |
*/
|
| 45 |
function wpcf_admin_fields_get_group( $group_id, $post_type = 'wp-types-group',
|
| 46 |
$add_fields = false ) {
|
|
@@ -60,8 +60,9 @@ function wpcf_admin_fields_get_group( $group_id, $post_type = 'wp-types-group',
|
|
| 60 |
/**
|
| 61 |
* Converts post data.
|
| 62 |
*
|
| 63 |
-
* @param
|
| 64 |
-
* @
|
|
|
|
| 65 |
*/
|
| 66 |
function wpcf_admin_fields_adjust_group( $post, $add_fields = false ) {
|
| 67 |
if ( empty( $post ) ) {
|
|
@@ -91,20 +92,17 @@ function wpcf_admin_fields_adjust_group( $post, $add_fields = false ) {
|
|
| 91 |
/**
|
| 92 |
* Gets Fields Admin Styles supported by specific group.
|
| 93 |
*
|
| 94 |
-
* @global type $wpdb
|
| 95 |
* @param type $group_id
|
| 96 |
* @return type
|
| 97 |
*/
|
| 98 |
function wpcf_admin_get_groups_admin_styles_by_group( $group_id ) {
|
| 99 |
-
$admin_styles = get_post_meta( $group_id, '_wp_types_group_admin_styles',
|
| 100 |
-
true );
|
| 101 |
return trim( $admin_styles );
|
| 102 |
}
|
| 103 |
|
| 104 |
/**
|
| 105 |
* Saves group's admin styles
|
| 106 |
*
|
| 107 |
-
* @global type $wpdb
|
| 108 |
* @param type $group_id
|
| 109 |
* @param type $padmin_styles
|
| 110 |
*/
|
|
@@ -116,8 +114,15 @@ function wpcf_admin_fields_save_group_admin_styles( $group_id, $admin_styles ) {
|
|
| 116 |
* Gets all fields.
|
| 117 |
*
|
| 118 |
* @todo Move to WPCF_Fields
|
| 119 |
-
* @
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 120 |
* @return type
|
|
|
|
|
|
|
| 121 |
* added param $use_cache by Gen (used when adding new fields to group)
|
| 122 |
*/
|
| 123 |
function wpcf_admin_fields_get_fields( $only_active = false,
|
|
@@ -187,14 +192,26 @@ function wpcf_admin_fields_get_fields( $only_active = false,
|
|
| 187 |
return $cache[$cache_key];
|
| 188 |
}
|
| 189 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 190 |
/**
|
| 191 |
* Gets field by ID.
|
| 192 |
* Modified by Gen, 13.02.2013
|
| 193 |
*
|
| 194 |
-
* @
|
| 195 |
-
* @param
|
| 196 |
-
* @param
|
| 197 |
-
* @
|
|
|
|
|
|
|
| 198 |
*/
|
| 199 |
function wpcf_admin_fields_get_field( $field_id, $only_active = false,
|
| 200 |
$disabled_by_type = false, $strictly_active = false,
|
|
@@ -212,7 +229,6 @@ function wpcf_admin_fields_get_field( $field_id, $only_active = false,
|
|
| 212 |
* Gets field by slug.
|
| 213 |
* Modified by Gen, 13.02.2013
|
| 214 |
*
|
| 215 |
-
* @global type $wpdb
|
| 216 |
* @param type $slug
|
| 217 |
* @return type
|
| 218 |
*/
|
|
@@ -223,7 +239,6 @@ function wpcf_fields_get_field_by_slug( $slug, $meta_name = 'wpcf-fields' ) {
|
|
| 223 |
/**
|
| 224 |
* Gets all fields that belong to specific group.
|
| 225 |
*
|
| 226 |
-
* @global type $wpdb
|
| 227 |
* @param type $group_id
|
| 228 |
* @param type $key
|
| 229 |
* @param type $only_active
|
|
@@ -264,7 +279,6 @@ function wpcf_admin_fields_get_fields_by_group( $group_id, $key = 'slug',
|
|
| 264 |
/**
|
| 265 |
* Gets groups that have specific term.
|
| 266 |
*
|
| 267 |
-
* @global type $wpdb
|
| 268 |
* @param type $term_id
|
| 269 |
* @param type $fetch_empty
|
| 270 |
* @param type $only_active
|
|
@@ -322,14 +336,14 @@ function wpcf_admin_fields_get_groups_by_term( $term_id = false,
|
|
| 322 |
/**
|
| 323 |
* Gets groups that have specific post_type.
|
| 324 |
*
|
| 325 |
-
* @global
|
| 326 |
* @param type $post_type
|
| 327 |
* @param type $fetch_empty
|
| 328 |
* @param type $only_active
|
| 329 |
* @return type
|
| 330 |
*/
|
| 331 |
-
function wpcf_admin_get_groups_by_post_type( $post_type, $fetch_empty = true,
|
| 332 |
-
|
| 333 |
$args = array();
|
| 334 |
$args['post_type'] = 'wp-types-group';
|
| 335 |
$args['numberposts'] = -1;
|
|
@@ -377,23 +391,21 @@ function wpcf_admin_get_groups_by_post_type( $post_type, $fetch_empty = true,
|
|
| 377 |
// Distinct terms
|
| 378 |
if ( !is_null( $terms ) ) {
|
| 379 |
if ( !empty( $terms ) ) {
|
| 380 |
-
// $args['meta_query'] = array('relation' => 'OR');
|
| 381 |
$terms_sql = array();
|
| 382 |
$add = '';
|
| 383 |
if ( $fetch_empty ) {
|
| 384 |
$add = " OR m.meta_value LIKE 'all'";
|
| 385 |
}
|
| 386 |
foreach ( $terms as $term ) {
|
| 387 |
-
$terms_sql[] = $term;
|
| 388 |
}
|
| 389 |
-
$terms_sql = "AND (m.meta_value LIKE '%%," . implode( ",%%' OR m.meta_value LIKE '%%,",
|
| 390 |
-
$terms ) . ",%%' $add)";
|
| 391 |
global $wpdb;
|
| 392 |
$terms_sql = "SELECT * FROM $wpdb->posts p
|
| 393 |
-
|
| 394 |
-
|
| 395 |
-
|
| 396 |
-
|
| 397 |
$groups = $wpdb->get_results( $terms_sql );
|
| 398 |
if ( !empty( $groups ) ) {
|
| 399 |
foreach ( $groups as $key => $group ) {
|
|
@@ -415,7 +427,6 @@ function wpcf_admin_get_groups_by_post_type( $post_type, $fetch_empty = true,
|
|
| 415 |
/**
|
| 416 |
* Gets groups that have specific template.
|
| 417 |
*
|
| 418 |
-
* @global type $wpdb
|
| 419 |
* @param type $post_type
|
| 420 |
* @param type $fetch_empty
|
| 421 |
* @param type $only_active
|
| 3 |
/**
|
| 4 |
* Gets all groups.
|
| 5 |
*
|
|
|
|
| 6 |
* @param string $post_type
|
| 7 |
* @param boolean|string $only_active
|
| 8 |
* @param boolean|string $add_fields - 'field_active', 'field_all', false (to omitt fields)
|
| 37 |
*
|
| 38 |
* Since 1.2 we enabled fetching by post title.
|
| 39 |
*
|
| 40 |
+
* @param $group_id
|
| 41 |
+
* @param string $post_type
|
| 42 |
+
* @param bool $add_fields
|
| 43 |
+
* @return array
|
| 44 |
*/
|
| 45 |
function wpcf_admin_fields_get_group( $group_id, $post_type = 'wp-types-group',
|
| 46 |
$add_fields = false ) {
|
| 60 |
/**
|
| 61 |
* Converts post data.
|
| 62 |
*
|
| 63 |
+
* @param $post
|
| 64 |
+
* @param bool $add_fields
|
| 65 |
+
* @return array
|
| 66 |
*/
|
| 67 |
function wpcf_admin_fields_adjust_group( $post, $add_fields = false ) {
|
| 68 |
if ( empty( $post ) ) {
|
| 92 |
/**
|
| 93 |
* Gets Fields Admin Styles supported by specific group.
|
| 94 |
*
|
|
|
|
| 95 |
* @param type $group_id
|
| 96 |
* @return type
|
| 97 |
*/
|
| 98 |
function wpcf_admin_get_groups_admin_styles_by_group( $group_id ) {
|
| 99 |
+
$admin_styles = get_post_meta( $group_id, '_wp_types_group_admin_styles', true );
|
|
|
|
| 100 |
return trim( $admin_styles );
|
| 101 |
}
|
| 102 |
|
| 103 |
/**
|
| 104 |
* Saves group's admin styles
|
| 105 |
*
|
|
|
|
| 106 |
* @param type $group_id
|
| 107 |
* @param type $padmin_styles
|
| 108 |
*/
|
| 114 |
* Gets all fields.
|
| 115 |
*
|
| 116 |
* @todo Move to WPCF_Fields
|
| 117 |
+
* @param bool $only_active
|
| 118 |
+
* @param bool $disabled_by_type
|
| 119 |
+
* @param bool $strictly_active
|
| 120 |
+
* @param string $option_name
|
| 121 |
+
* @param bool $use_cache
|
| 122 |
+
* @param bool $clear_cache
|
| 123 |
* @return type
|
| 124 |
+
*
|
| 125 |
+
* added param $use_cache by Gen (used when adding new fields to group)
|
| 126 |
* added param $use_cache by Gen (used when adding new fields to group)
|
| 127 |
*/
|
| 128 |
function wpcf_admin_fields_get_fields( $only_active = false,
|
| 192 |
return $cache[$cache_key];
|
| 193 |
}
|
| 194 |
|
| 195 |
+
function wpcf_admin_fields_get_field_by_meta_key( $meta_key )
|
| 196 |
+
{
|
| 197 |
+
$fields = wpcf_admin_fields_get_fields();
|
| 198 |
+
foreach( $fields as $field) {
|
| 199 |
+
if ( $meta_key == $field['meta_key'] ) {
|
| 200 |
+
return $field;
|
| 201 |
+
}
|
| 202 |
+
}
|
| 203 |
+
}
|
| 204 |
+
|
| 205 |
/**
|
| 206 |
* Gets field by ID.
|
| 207 |
* Modified by Gen, 13.02.2013
|
| 208 |
*
|
| 209 |
+
* @param string $field_id
|
| 210 |
+
* @param bool $only_active
|
| 211 |
+
* @param bool $disabled_by_type
|
| 212 |
+
* @param bool $strictly_active
|
| 213 |
+
* @param string $option_name
|
| 214 |
+
* @return array
|
| 215 |
*/
|
| 216 |
function wpcf_admin_fields_get_field( $field_id, $only_active = false,
|
| 217 |
$disabled_by_type = false, $strictly_active = false,
|
| 229 |
* Gets field by slug.
|
| 230 |
* Modified by Gen, 13.02.2013
|
| 231 |
*
|
|
|
|
| 232 |
* @param type $slug
|
| 233 |
* @return type
|
| 234 |
*/
|
| 239 |
/**
|
| 240 |
* Gets all fields that belong to specific group.
|
| 241 |
*
|
|
|
|
| 242 |
* @param type $group_id
|
| 243 |
* @param type $key
|
| 244 |
* @param type $only_active
|
| 279 |
/**
|
| 280 |
* Gets groups that have specific term.
|
| 281 |
*
|
|
|
|
| 282 |
* @param type $term_id
|
| 283 |
* @param type $fetch_empty
|
| 284 |
* @param type $only_active
|
| 336 |
/**
|
| 337 |
* Gets groups that have specific post_type.
|
| 338 |
*
|
| 339 |
+
* @global object $wpdb
|
| 340 |
* @param type $post_type
|
| 341 |
* @param type $fetch_empty
|
| 342 |
* @param type $only_active
|
| 343 |
* @return type
|
| 344 |
*/
|
| 345 |
+
function wpcf_admin_get_groups_by_post_type( $post_type, $fetch_empty = true, $terms = null, $only_active = true )
|
| 346 |
+
{
|
| 347 |
$args = array();
|
| 348 |
$args['post_type'] = 'wp-types-group';
|
| 349 |
$args['numberposts'] = -1;
|
| 391 |
// Distinct terms
|
| 392 |
if ( !is_null( $terms ) ) {
|
| 393 |
if ( !empty( $terms ) ) {
|
|
|
|
| 394 |
$terms_sql = array();
|
| 395 |
$add = '';
|
| 396 |
if ( $fetch_empty ) {
|
| 397 |
$add = " OR m.meta_value LIKE 'all'";
|
| 398 |
}
|
| 399 |
foreach ( $terms as $term ) {
|
| 400 |
+
$terms_sql[] = esc_sql( $term );
|
| 401 |
}
|
| 402 |
+
$terms_sql = "AND (m.meta_value LIKE '%%," . implode( ",%%' OR m.meta_value LIKE '%%,", $terms_sql ) . ",%%' $add)";
|
|
|
|
| 403 |
global $wpdb;
|
| 404 |
$terms_sql = "SELECT * FROM $wpdb->posts p
|
| 405 |
+
JOIN $wpdb->postmeta m
|
| 406 |
+
WHERE p.post_type='wp-types-group' AND p.post_status='publish'
|
| 407 |
+
AND p.ID = m.post_id AND m.meta_key='_wp_types_group_terms'
|
| 408 |
+
$terms_sql";
|
| 409 |
$groups = $wpdb->get_results( $terms_sql );
|
| 410 |
if ( !empty( $groups ) ) {
|
| 411 |
foreach ( $groups as $key => $group ) {
|
| 427 |
/**
|
| 428 |
* Gets groups that have specific template.
|
| 429 |
*
|
|
|
|
| 430 |
* @param type $post_type
|
| 431 |
* @param type $fetch_empty
|
| 432 |
* @param type $only_active
|
embedded/includes/fields/audio.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/audio.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/includes/fields/checkbox.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/checkbox.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/includes/fields/date.php
CHANGED
|
@@ -321,8 +321,17 @@ function wpcf_fields_date_value_get_filter( $value, $field, $return = 'array',
|
|
| 321 |
if (
|
| 322 |
array_key_exists('datepicker', $value)
|
| 323 |
&& !array_key_exists('timestamp', $value)
|
| 324 |
-
|
| 325 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 326 |
$value['timestamp'] = $value['datepicker'];
|
| 327 |
unset($value['datepicker']);
|
| 328 |
}
|
|
@@ -388,15 +397,6 @@ function wpcf_fields_date_view( $params ) {
|
|
| 388 |
$output .= wpcf_fields_date_get_calendar( $params, true, false );
|
| 389 |
break;
|
| 390 |
|
| 391 |
-
case 'human-time-diff':
|
| 392 |
-
$date_out = human_time_diff($params['field_value']);
|
| 393 |
-
if ( $params['field_value'] < time() ) {
|
| 394 |
-
$output .= sprintf( __('%s ago', 'wpcf'), $date_out);;
|
| 395 |
-
} else {
|
| 396 |
-
$output .= sprintf( __('%s to go', 'wpcf'), $date_out);;
|
| 397 |
-
}
|
| 398 |
-
break;
|
| 399 |
-
|
| 400 |
default:
|
| 401 |
$field_name = '';
|
| 402 |
|
| 321 |
if (
|
| 322 |
array_key_exists('datepicker', $value)
|
| 323 |
&& !array_key_exists('timestamp', $value)
|
| 324 |
+
//Fix date pre-1970 issue
|
| 325 |
+
//https://wp-types.com/forums/topic/pre-1971-dates-throw-error/#post-288989
|
| 326 |
+
//https://icanlocalize.basecamphq.com/projects/7393061-toolset/todo_items/194818870/comments
|
| 327 |
+
&& (
|
| 328 |
+
preg_match( '/^\d+$/', $value['datepicker'] )
|
| 329 |
+
|| (
|
| 330 |
+
-12219292800 <= $value['datepicker']
|
| 331 |
+
&& $value['datepicker'] <= 32535215940
|
| 332 |
+
)
|
| 333 |
+
)
|
| 334 |
+
) {
|
| 335 |
$value['timestamp'] = $value['datepicker'];
|
| 336 |
unset($value['datepicker']);
|
| 337 |
}
|
| 397 |
$output .= wpcf_fields_date_get_calendar( $params, true, false );
|
| 398 |
break;
|
| 399 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 400 |
default:
|
| 401 |
$field_name = '';
|
| 402 |
|
embedded/includes/fields/date/calendar.php
CHANGED
|
@@ -1,20 +1,20 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
-
*
|
| 4 |
* Calendar view.
|
| 5 |
*/
|
| 6 |
|
| 7 |
/**
|
| 8 |
* Calendar view.
|
| 9 |
-
*
|
| 10 |
-
* @global
|
| 11 |
* @global type $m
|
| 12 |
* @global type $wp_locale
|
| 13 |
* @global type $posts
|
| 14 |
* @param type $params
|
| 15 |
* @param type $initial
|
| 16 |
* @param type $echo
|
| 17 |
-
* @return type
|
| 18 |
*/
|
| 19 |
function wpcf_fields_date_get_calendar( $params, $initial = true, $echo = true ) {
|
| 20 |
|
|
@@ -55,7 +55,13 @@ function wpcf_fields_date_get_calendar( $params, $initial = true, $echo = true )
|
|
| 55 |
// We need to get the month from MySQL
|
| 56 |
$thisyear = '' . intval( substr( $m, 0, 4 ) );
|
| 57 |
$d = (($w - 1) * 7) + 6; //it seems MySQL's weeks disagree with PHP's
|
| 58 |
-
$thismonth = $wpdb->get_var(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 59 |
} elseif ( !empty( $m ) ) {
|
| 60 |
$thisyear = '' . intval( substr( $m, 0, 4 ) );
|
| 61 |
if ( strlen( $m ) < 6 )
|
|
@@ -153,4 +159,4 @@ function wpcf_fields_date_get_calendar( $params, $initial = true, $echo = true )
|
|
| 153 |
echo apply_filters( 'get_calendar', $calendar_output );
|
| 154 |
else
|
| 155 |
return apply_filters( 'get_calendar', $calendar_output );
|
| 156 |
-
}
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
+
*
|
| 4 |
* Calendar view.
|
| 5 |
*/
|
| 6 |
|
| 7 |
/**
|
| 8 |
* Calendar view.
|
| 9 |
+
*
|
| 10 |
+
* @global object $wpdb
|
| 11 |
* @global type $m
|
| 12 |
* @global type $wp_locale
|
| 13 |
* @global type $posts
|
| 14 |
* @param type $params
|
| 15 |
* @param type $initial
|
| 16 |
* @param type $echo
|
| 17 |
+
* @return type
|
| 18 |
*/
|
| 19 |
function wpcf_fields_date_get_calendar( $params, $initial = true, $echo = true ) {
|
| 20 |
|
| 55 |
// We need to get the month from MySQL
|
| 56 |
$thisyear = '' . intval( substr( $m, 0, 4 ) );
|
| 57 |
$d = (($w - 1) * 7) + 6; //it seems MySQL's weeks disagree with PHP's
|
| 58 |
+
$thismonth = $wpdb->get_var(
|
| 59 |
+
$wpdb->prepare(
|
| 60 |
+
"SELECT DATE_FORMAT((DATE_ADD(%s, INTERVAL %d DAY) ), '%%m')",
|
| 61 |
+
sprintf('%d0101', $thisyear),
|
| 62 |
+
$d
|
| 63 |
+
)
|
| 64 |
+
);
|
| 65 |
} elseif ( !empty( $m ) ) {
|
| 66 |
$thisyear = '' . intval( substr( $m, 0, 4 ) );
|
| 67 |
if ( strlen( $m ) < 6 )
|
| 159 |
echo apply_filters( 'get_calendar', $calendar_output );
|
| 160 |
else
|
| 161 |
return apply_filters( 'get_calendar', $calendar_output );
|
| 162 |
+
}
|
embedded/includes/fields/date/functions.php
CHANGED
|
@@ -183,19 +183,19 @@ function wpcf_fields_date_custom_conditional_statement_filter( $null,
|
|
| 183 |
$null = array_shift( $null );
|
| 184 |
}
|
| 185 |
$null = wpcf_fields_date_value_get_filter( $null, $field, 'timestamp' );
|
| 186 |
-
if ( !is_numeric( $null ) ) {
|
| 187 |
-
$null = -1;
|
| 188 |
-
}
|
| 189 |
-
/**
|
| 190 |
-
* be sure do not return string if array is expected!
|
| 191 |
-
*/
|
| 192 |
-
if ( !$single && !is_array($null) ) {
|
| 193 |
-
return array($null);
|
| 194 |
-
}
|
| 195 |
-
}
|
| 196 |
-
return $null;
|
| 197 |
-
}
|
| 198 |
-
|
| 199 |
/**
|
| 200 |
* Returns most suitable date format.
|
| 201 |
*
|
|
@@ -502,23 +502,6 @@ function __wpcf_fields_date_check_leftover( $value, $field, $use_cache = true )
|
|
| 502 |
&& $meta['minute'] != adodb_date( 'i', $meta['timestamp'] ) ) ) {
|
| 503 |
|
| 504 |
$value = wpcf_fields_date_calculate_time( $meta );
|
| 505 |
-
|
| 506 |
-
/*
|
| 507 |
-
*
|
| 508 |
-
* If enabling clearing old values here,
|
| 509 |
-
* pay attention if field is repetitive.
|
| 510 |
-
*
|
| 511 |
-
* For now - old data is cleared on date save.
|
| 512 |
-
* wpcf_fields_date_value_save_filter()
|
| 513 |
-
*/
|
| 514 |
-
|
| 515 |
-
// Update meta
|
| 516 |
-
// $success = update_post_meta( $post_id, $field_slug, $value );
|
| 517 |
-
// Remove additional meta
|
| 518 |
-
// if ( $success ) {
|
| 519 |
-
// delete_post_meta( $post_id,
|
| 520 |
-
// '_wpcf_' . $field_id . '_hour_and_minute' );
|
| 521 |
-
// }
|
| 522 |
}
|
| 523 |
}
|
| 524 |
}
|
| 183 |
$null = array_shift( $null );
|
| 184 |
}
|
| 185 |
$null = wpcf_fields_date_value_get_filter( $null, $field, 'timestamp' );
|
| 186 |
+
if ( !is_numeric( $null ) ) {
|
| 187 |
+
$null = -1;
|
| 188 |
+
}
|
| 189 |
+
/**
|
| 190 |
+
* be sure do not return string if array is expected!
|
| 191 |
+
*/
|
| 192 |
+
if ( !$single && !is_array($null) ) {
|
| 193 |
+
return array($null);
|
| 194 |
+
}
|
| 195 |
+
}
|
| 196 |
+
return $null;
|
| 197 |
+
}
|
| 198 |
+
|
| 199 |
/**
|
| 200 |
* Returns most suitable date format.
|
| 201 |
*
|
| 502 |
&& $meta['minute'] != adodb_date( 'i', $meta['timestamp'] ) ) ) {
|
| 503 |
|
| 504 |
$value = wpcf_fields_date_calculate_time( $meta );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 505 |
}
|
| 506 |
}
|
| 507 |
}
|
embedded/includes/fields/embed.php
CHANGED
|
@@ -2,8 +2,8 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
* Register data (called automatically).
|
| 5 |
-
*
|
| 6 |
-
* @return type
|
| 7 |
*/
|
| 8 |
function wpcf_fields_embed() {
|
| 9 |
return array(
|
|
@@ -17,9 +17,9 @@ function wpcf_fields_embed() {
|
|
| 17 |
|
| 18 |
/**
|
| 19 |
* Meta box form.
|
| 20 |
-
*
|
| 21 |
* @param type $field
|
| 22 |
-
* @return string
|
| 23 |
*/
|
| 24 |
function wpcf_fields_embed_meta_box_form( $field ) {
|
| 25 |
$form = array();
|
|
@@ -32,7 +32,7 @@ function wpcf_fields_embed_meta_box_form( $field ) {
|
|
| 32 |
|
| 33 |
/**
|
| 34 |
* View function.
|
| 35 |
-
*
|
| 36 |
* @global type $wp_embed
|
| 37 |
* @param type $field
|
| 38 |
* @return string
|
|
@@ -59,10 +59,10 @@ function wpcf_fields_embed_view( $params ) {
|
|
| 59 |
return $output;
|
| 60 |
}
|
| 61 |
|
| 62 |
-
|
| 63 |
-
|
| 64 |
/**
|
| 65 |
* Editor callback form.
|
|
|
|
|
|
|
| 66 |
*/
|
| 67 |
function wpcf_fields_embed_editor_callback( $field, $data, $meta_type, $post ) {
|
| 68 |
|
|
@@ -79,9 +79,12 @@ function wpcf_fields_embed_editor_callback( $field, $data, $meta_type, $post ) {
|
|
| 79 |
if ( !empty( $file ) ) {
|
| 80 |
// Get attachment by guid
|
| 81 |
global $wpdb;
|
| 82 |
-
$attachment_id = $wpdb->get_var(
|
| 83 |
-
|
| 84 |
-
|
|
|
|
|
|
|
|
|
|
| 85 |
}
|
| 86 |
}
|
| 87 |
|
|
@@ -121,4 +124,4 @@ function wpcf_fields_embed_editor_submit( $data, $field, $context ) {
|
|
| 121 |
}
|
| 122 |
|
| 123 |
return $shortcode;
|
| 124 |
-
}
|
| 2 |
|
| 3 |
/**
|
| 4 |
* Register data (called automatically).
|
| 5 |
+
*
|
| 6 |
+
* @return type
|
| 7 |
*/
|
| 8 |
function wpcf_fields_embed() {
|
| 9 |
return array(
|
| 17 |
|
| 18 |
/**
|
| 19 |
* Meta box form.
|
| 20 |
+
*
|
| 21 |
* @param type $field
|
| 22 |
+
* @return string
|
| 23 |
*/
|
| 24 |
function wpcf_fields_embed_meta_box_form( $field ) {
|
| 25 |
$form = array();
|
| 32 |
|
| 33 |
/**
|
| 34 |
* View function.
|
| 35 |
+
*
|
| 36 |
* @global type $wp_embed
|
| 37 |
* @param type $field
|
| 38 |
* @return string
|
| 59 |
return $output;
|
| 60 |
}
|
| 61 |
|
|
|
|
|
|
|
| 62 |
/**
|
| 63 |
* Editor callback form.
|
| 64 |
+
*
|
| 65 |
+
* @global object $wpdb
|
| 66 |
*/
|
| 67 |
function wpcf_fields_embed_editor_callback( $field, $data, $meta_type, $post ) {
|
| 68 |
|
| 79 |
if ( !empty( $file ) ) {
|
| 80 |
// Get attachment by guid
|
| 81 |
global $wpdb;
|
| 82 |
+
$attachment_id = $wpdb->get_var(
|
| 83 |
+
$wpdb->prepare(
|
| 84 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 85 |
+
$file
|
| 86 |
+
)
|
| 87 |
+
);
|
| 88 |
}
|
| 89 |
}
|
| 90 |
|
| 124 |
}
|
| 125 |
|
| 126 |
return $shortcode;
|
| 127 |
+
}
|
embedded/includes/fields/file.php
CHANGED
|
@@ -1,10 +1,10 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
-
* $LastChangedBy:
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
/**
|
|
@@ -17,11 +17,6 @@ function wpcf_fields_file() {
|
|
| 17 |
'id' => 'wpcf-file',
|
| 18 |
'title' => __( 'File', 'wpcf' ),
|
| 19 |
'description' => __( 'File', 'wpcf' ),
|
| 20 |
-
'meta_box_js' => array(
|
| 21 |
-
'wpcf-jquery-fields-file' => array(
|
| 22 |
-
'inline' => 'wpcf_fields_file_meta_box_js_inline',
|
| 23 |
-
)
|
| 24 |
-
),
|
| 25 |
'validate' => array('required'),
|
| 26 |
);
|
| 27 |
}
|
|
@@ -29,6 +24,8 @@ function wpcf_fields_file() {
|
|
| 29 |
/**
|
| 30 |
* Form data for post edit page.
|
| 31 |
*
|
|
|
|
|
|
|
| 32 |
* @param type $field
|
| 33 |
*/
|
| 34 |
function wpcf_fields_file_meta_box_form( $field ) {
|
|
@@ -41,9 +38,12 @@ function wpcf_fields_file_meta_box_form( $field ) {
|
|
| 41 |
// Get attachment by guid
|
| 42 |
global $wpdb;
|
| 43 |
if ( !empty( $field['value'] ) ) {
|
| 44 |
-
$attachment_id = $wpdb->get_var(
|
| 45 |
-
|
| 46 |
-
|
|
|
|
|
|
|
|
|
|
| 47 |
}
|
| 48 |
|
| 49 |
// Set preview
|
|
@@ -100,74 +100,6 @@ function wpcf_fields_file_meta_box_form( $field ) {
|
|
| 100 |
return $form;
|
| 101 |
}
|
| 102 |
|
| 103 |
-
/**
|
| 104 |
-
* Renders inline JS.
|
| 105 |
-
*/
|
| 106 |
-
function wpcf_fields_file_meta_box_js_inline() {
|
| 107 |
-
global $post;
|
| 108 |
-
$for_post = (isset( $post ) ? 'post_id=' . $post->ID . '&' : '');
|
| 109 |
-
?>
|
| 110 |
-
<script type="text/javascript">
|
| 111 |
-
//<![CDATA[
|
| 112 |
-
jQuery(document).ready(function($){
|
| 113 |
-
window.wpcf_formfield = false;
|
| 114 |
-
$('.wpcf-fields-file-upload-link').live('click', function() {
|
| 115 |
-
window.wpcf_formfield = '#'+$(this).attr('id')+'-holder';
|
| 116 |
-
tb_show('', 'media-upload.php?<?php echo $for_post ?>type=file&context=wpcf-fields-media-insert&types[field_type]='+$(this).data('types').id+'&types[field_id]='+$(this).data('types').id+'&TB_iframe=true');
|
| 117 |
-
return false;
|
| 118 |
-
});
|
| 119 |
-
});
|
| 120 |
-
function wpcfFieldsFileMediaInsert(url, type) {
|
| 121 |
-
jQuery(window.wpcf_formfield).val(url);
|
| 122 |
-
if (type == 'image') {
|
| 123 |
-
jQuery(window.wpcf_formfield+'-preview').html('<img src="'+url+'" />');
|
| 124 |
-
} else {
|
| 125 |
-
jQuery(window.wpcf_formfield+'-preview').html('');
|
| 126 |
-
}
|
| 127 |
-
tb_remove();
|
| 128 |
-
window.wpcf_formfield = false;
|
| 129 |
-
}
|
| 130 |
-
//]]>
|
| 131 |
-
</script>
|
| 132 |
-
<?php
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/**
|
| 136 |
-
* Media popup JS.
|
| 137 |
-
*/
|
| 138 |
-
function wpcf_fields_file_media_admin_head() {
|
| 139 |
-
?>
|
| 140 |
-
<script type="text/javascript">
|
| 141 |
-
function wpcfFieldsFileMediaTrigger(guid, type) {
|
| 142 |
-
window.parent.wpcfFieldsFileMediaInsert(guid, type);
|
| 143 |
-
window.parent.jQuery('#TB_closeWindowButton').trigger('click');
|
| 144 |
-
}
|
| 145 |
-
<?php
|
| 146 |
-
if ( isset( $_GET['types']['field_type'] ) && in_array( $_GET['types']['field_type'],
|
| 147 |
-
array('audio', 'video') ) ):
|
| 148 |
-
?>
|
| 149 |
-
jQuery(document).ready(function($){
|
| 150 |
-
$('#media-upload-header').after('<div class="message updated"><p><?php printf(esc_js(__('Please note that not all video and audio formats are supported by the WordPress media player. Before you upload media files, have a look at %ssupported media formats%s.', 'wpcf')), '<a href="http://wp-types.com/documentation/user-guides/adding-audio-video-and-other-embedded-content-to-your-site/" target="_blank">', '</a>'); ?></p></div>');
|
| 151 |
-
});
|
| 152 |
-
<?php endif; ?>
|
| 153 |
-
</script>
|
| 154 |
-
<style type="text/css">
|
| 155 |
-
tr.submit, .ml-submit, #save, #media-items .A1B1 p:last-child { display: none; }
|
| 156 |
-
#media-search
|
| 157 |
-
{
|
| 158 |
-
position: static;
|
| 159 |
-
height: auto;
|
| 160 |
-
width: auto;
|
| 161 |
-
}
|
| 162 |
-
#media-search.search-box input[name="s"]
|
| 163 |
-
{
|
| 164 |
-
float: left;
|
| 165 |
-
width: auto;
|
| 166 |
-
}
|
| 167 |
-
</style>
|
| 168 |
-
<?php
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
/**
|
| 172 |
* Adds 'Types' column to media item table.
|
| 173 |
*
|
|
@@ -236,6 +168,9 @@ function wpcf_fields_file_view( $params ) {
|
|
| 236 |
|
| 237 |
/**
|
| 238 |
* Editor callback form.
|
|
|
|
|
|
|
|
|
|
| 239 |
*/
|
| 240 |
function wpcf_fields_file_editor_callback( $field, $data, $meta_type, $post ) {
|
| 241 |
|
|
@@ -252,14 +187,16 @@ function wpcf_fields_file_editor_callback( $field, $data, $meta_type, $post ) {
|
|
| 252 |
if ( !empty( $file ) ) {
|
| 253 |
// Get attachment by guid
|
| 254 |
global $wpdb;
|
| 255 |
-
$attachment_id = $wpdb->get_var(
|
| 256 |
-
|
| 257 |
-
|
|
|
|
|
|
|
|
|
|
| 258 |
}
|
| 259 |
}
|
| 260 |
|
| 261 |
// Set data
|
| 262 |
-
// $data['post_id'] = !empty( $post->ID ) ? $post->ID : -1;
|
| 263 |
$data['attachment_id'] = $attachment_id;
|
| 264 |
$data['file'] = !empty($file) ? $file : '';
|
| 265 |
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/file.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1113864 $
|
| 7 |
+
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 10 |
/**
|
| 17 |
'id' => 'wpcf-file',
|
| 18 |
'title' => __( 'File', 'wpcf' ),
|
| 19 |
'description' => __( 'File', 'wpcf' ),
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 20 |
'validate' => array('required'),
|
| 21 |
);
|
| 22 |
}
|
| 24 |
/**
|
| 25 |
* Form data for post edit page.
|
| 26 |
*
|
| 27 |
+
* @global object $wpdb
|
| 28 |
+
*
|
| 29 |
* @param type $field
|
| 30 |
*/
|
| 31 |
function wpcf_fields_file_meta_box_form( $field ) {
|
| 38 |
// Get attachment by guid
|
| 39 |
global $wpdb;
|
| 40 |
if ( !empty( $field['value'] ) ) {
|
| 41 |
+
$attachment_id = $wpdb->get_var(
|
| 42 |
+
$wpdb->prepare(
|
| 43 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 44 |
+
$field['value']
|
| 45 |
+
)
|
| 46 |
+
);
|
| 47 |
}
|
| 48 |
|
| 49 |
// Set preview
|
| 100 |
return $form;
|
| 101 |
}
|
| 102 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 103 |
/**
|
| 104 |
* Adds 'Types' column to media item table.
|
| 105 |
*
|
| 168 |
|
| 169 |
/**
|
| 170 |
* Editor callback form.
|
| 171 |
+
*
|
| 172 |
+
* @global object $wpdb
|
| 173 |
+
*
|
| 174 |
*/
|
| 175 |
function wpcf_fields_file_editor_callback( $field, $data, $meta_type, $post ) {
|
| 176 |
|
| 187 |
if ( !empty( $file ) ) {
|
| 188 |
// Get attachment by guid
|
| 189 |
global $wpdb;
|
| 190 |
+
$attachment_id = $wpdb->get_var(
|
| 191 |
+
$wpdb->prepare(
|
| 192 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 193 |
+
$file
|
| 194 |
+
)
|
| 195 |
+
);
|
| 196 |
}
|
| 197 |
}
|
| 198 |
|
| 199 |
// Set data
|
|
|
|
| 200 |
$data['attachment_id'] = $attachment_id;
|
| 201 |
$data['file'] = !empty($file) ? $file : '';
|
| 202 |
|
embedded/includes/fields/image.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -16,7 +16,7 @@ add_filter( 'types_view', 'wpcf_fields_image_view_filter', 10, 6 );
|
|
| 16 |
|
| 17 |
/**
|
| 18 |
* Register data (called automatically).
|
| 19 |
-
* @return type
|
| 20 |
*/
|
| 21 |
function wpcf_fields_image() {
|
| 22 |
return array(
|
|
@@ -24,46 +24,15 @@ function wpcf_fields_image() {
|
|
| 24 |
'title' => __( 'Image', 'wpcf' ),
|
| 25 |
'description' => __( 'Image', 'wpcf' ),
|
| 26 |
'validate' => array('required'),
|
| 27 |
-
'meta_box_js' => array(
|
| 28 |
-
'wpcf-jquery-fields-file' => array(
|
| 29 |
-
'inline' => 'wpcf_fields_file_meta_box_js_inline',
|
| 30 |
-
),
|
| 31 |
-
'wpcf-jquery-fields-image' => array(
|
| 32 |
-
'inline' => 'wpcf_fields_image_meta_box_js_inline',
|
| 33 |
-
),
|
| 34 |
-
),
|
| 35 |
'inherited_field_type' => 'file',
|
| 36 |
);
|
| 37 |
}
|
| 38 |
|
| 39 |
-
/**
|
| 40 |
-
* Renders inline JS.
|
| 41 |
-
*/
|
| 42 |
-
function wpcf_fields_image_meta_box_js_inline() {
|
| 43 |
-
global $post;
|
| 44 |
-
$for_post = (isset( $post ) ? 'post_id=' . $post->ID . '&' : '');
|
| 45 |
-
|
| 46 |
-
?>
|
| 47 |
-
<script type="text/javascript">
|
| 48 |
-
//<![CDATA[
|
| 49 |
-
jQuery(document).ready(function(){
|
| 50 |
-
wpcf_formfield = false;
|
| 51 |
-
jQuery('.wpcf-fields-image-upload-link').live('click', function() {
|
| 52 |
-
wpcf_formfield = '#'+jQuery(this).attr('id')+'-holder';
|
| 53 |
-
tb_show('<?php
|
| 54 |
-
echo esc_js( __( 'Upload image', 'wpcf' ) );
|
| 55 |
-
|
| 56 |
-
?>', 'media-upload.php?<?php echo $for_post ?>type=image&context=wpcf-fields-media-insert&TB_iframe=1&width=640&height=336');
|
| 57 |
-
return false;
|
| 58 |
-
});
|
| 59 |
-
});
|
| 60 |
-
//]]>
|
| 61 |
-
</script>
|
| 62 |
-
<?php
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
/**
|
| 66 |
* Editor callback form.
|
|
|
|
|
|
|
|
|
|
| 67 |
*/
|
| 68 |
function wpcf_fields_image_editor_callback( $field, $data, $context, $post ) {
|
| 69 |
|
|
@@ -84,9 +53,12 @@ function wpcf_fields_image_editor_callback( $field, $data, $context, $post ) {
|
|
| 84 |
if ( !empty( $image ) ) {
|
| 85 |
// Get attachment by guid
|
| 86 |
global $wpdb;
|
| 87 |
-
$attachment_id = $wpdb->get_var(
|
| 88 |
-
|
| 89 |
-
|
|
|
|
|
|
|
|
|
|
| 90 |
}
|
| 91 |
}
|
| 92 |
$data['image'] = $image;
|
|
@@ -264,8 +236,8 @@ function wpcf_fields_image_editor_submit( $data, $field, $context ) {
|
|
| 264 |
|
| 265 |
/**
|
| 266 |
* View function.
|
| 267 |
-
*
|
| 268 |
-
* @param type $params
|
| 269 |
*/
|
| 270 |
function wpcf_fields_image_view( $params ) {
|
| 271 |
|
|
@@ -311,7 +283,7 @@ function wpcf_fields_image_view( $params ) {
|
|
| 311 |
if ( !empty( $params['style'] ) ) {
|
| 312 |
$style[] = $params['style'];
|
| 313 |
}
|
| 314 |
-
|
| 315 |
// Compatibility with old parameters
|
| 316 |
$old_param = isset( $params['proportional'] ) && $params['proportional'] == 'true' ? 'proportional' : 'crop';
|
| 317 |
$resize = isset( $params['resize'] ) ? $params['resize'] : $old_param;
|
|
@@ -550,10 +522,9 @@ function wpcf_fields_image_resize_image( $url_path, $width = 300, $height = 200,
|
|
| 550 |
|
| 551 |
/**
|
| 552 |
* Gets all necessary data for processed image.
|
| 553 |
-
*
|
| 554 |
-
* @global type $wpdb
|
| 555 |
* @param type $image
|
| 556 |
-
* @return type
|
| 557 |
*/
|
| 558 |
function wpcf_fields_image_get_data( $image ) {
|
| 559 |
|
|
@@ -565,7 +536,7 @@ function wpcf_fields_image_get_data( $image ) {
|
|
| 565 |
if ( isset( $cache[$cache_key] ) ) {
|
| 566 |
return $cache[$cache_key];
|
| 567 |
}
|
| 568 |
-
|
| 569 |
WPCF_Loader::loadView( 'image' );
|
| 570 |
$utils = Types_Image_Utils::getInstance();
|
| 571 |
|
|
@@ -658,9 +629,9 @@ function wpcf_fields_image_get_data( $image ) {
|
|
| 658 |
|
| 659 |
/**
|
| 660 |
* Strips GET vars from value.
|
| 661 |
-
*
|
| 662 |
* @param type $value
|
| 663 |
-
* @return type
|
| 664 |
*/
|
| 665 |
function wpcf_fields_image_value_filter( $value ) {
|
| 666 |
if ( is_string( $value ) && !apply_filters('wpcf_allow_questionmark_in_image_url', false) ) {
|
|
@@ -671,8 +642,8 @@ function wpcf_fields_image_value_filter( $value ) {
|
|
| 671 |
|
| 672 |
/**
|
| 673 |
* Gets cache directory.
|
| 674 |
-
*
|
| 675 |
-
* @return \WP_Error
|
| 676 |
*/
|
| 677 |
function wpcf_fields_image_get_cache_directory( $suppress_filters = false ) {
|
| 678 |
WPCF_Loader::loadView( 'image' );
|
|
@@ -699,9 +670,9 @@ function wpcf_image_http_request_timeout( $timeout ) {
|
|
| 699 |
|
| 700 |
/**
|
| 701 |
* Fetches remote images.
|
| 702 |
-
*
|
| 703 |
* @param type $url
|
| 704 |
-
* @return \WP_Error
|
| 705 |
*/
|
| 706 |
function wpcf_fields_image_get_remote( $url ) {
|
| 707 |
|
|
@@ -800,8 +771,8 @@ function wpcf_fields_image_get_remote( $url ) {
|
|
| 800 |
|
| 801 |
/**
|
| 802 |
* Clears remote image cache.
|
| 803 |
-
*
|
| 804 |
-
* @param type $action
|
| 805 |
*/
|
| 806 |
function wpcf_fields_image_clear_cache( $cache_dir = null, $action = 'outdated' ) {
|
| 807 |
if ( is_null( $cache_dir ) ) {
|
|
@@ -830,7 +801,7 @@ function wpcf_fields_image_clear_cache( $cache_dir = null, $action = 'outdated'
|
|
| 830 |
|
| 831 |
/**
|
| 832 |
* Filters upload paths (to fix Windows issues).
|
| 833 |
-
*
|
| 834 |
* @param type $args
|
| 835 |
* @return type
|
| 836 |
*/
|
|
@@ -843,12 +814,12 @@ function wpcf_fields_image_uploads_realpath( $args ) {
|
|
| 843 |
if ( isset( $args[$fix] ) ) {
|
| 844 |
/*
|
| 845 |
* Since 1.1.5
|
| 846 |
-
*
|
| 847 |
* We need realpath(), open_basedir restriction check
|
| 848 |
-
*
|
| 849 |
* Suppressing warnings, checking realpath returning FALSE, check
|
| 850 |
* if open_basedir ini is set.
|
| 851 |
-
*
|
| 852 |
* https://icanlocalize.basecamphq.com/projects/7393061-wp-views/todo_items/153462252/comments
|
| 853 |
* http://php.net/manual/en/ini.sect.safe-mode.php
|
| 854 |
* http://php.net/manual/en/ini.core.php#ini.open-basedir
|
|
@@ -978,9 +949,9 @@ function wpcf_image_resize( $file, $max_w, $max_h, $crop = false,
|
|
| 978 |
|
| 979 |
/**
|
| 980 |
* Fixes for Win.
|
| 981 |
-
*
|
| 982 |
* For now we fix file path to have unified type slashes.
|
| 983 |
-
*
|
| 984 |
* @param type $file
|
| 985 |
* @param type $attachment_id
|
| 986 |
* @return type
|
|
@@ -1002,10 +973,10 @@ function wpcf_fields_image_win32_update_attached_file_filter( $file,
|
|
| 1002 |
|
| 1003 |
/**
|
| 1004 |
* Filters image view.
|
| 1005 |
-
*
|
| 1006 |
* This is added to handle image 'url' parameter.
|
| 1007 |
* We need to unwrap value. Also added to avoid cludging frontend.php.
|
| 1008 |
-
*
|
| 1009 |
* @param boolean $params
|
| 1010 |
* @param type $field
|
| 1011 |
* @return boolean
|
|
@@ -1030,7 +1001,7 @@ function wpcf_fields_image_view_filter( $output, $value, $type, $slug, $name,
|
|
| 1030 |
|
| 1031 |
/**
|
| 1032 |
* Adds image to library.
|
| 1033 |
-
*
|
| 1034 |
* @param type $post
|
| 1035 |
* @param type $abspath
|
| 1036 |
*/
|
|
@@ -1057,21 +1028,24 @@ function wpcf_image_add_to_library( $post, $abspath ){
|
|
| 1057 |
|
| 1058 |
/**
|
| 1059 |
* Checks if image is attachment.
|
| 1060 |
-
*
|
| 1061 |
-
* @global
|
| 1062 |
* @param type $guid
|
| 1063 |
* @return type
|
| 1064 |
*/
|
| 1065 |
function wpcf_image_is_attachment( $guid ) {
|
| 1066 |
global $wpdb;
|
| 1067 |
-
return $wpdb->get_var(
|
| 1068 |
-
|
| 1069 |
-
|
|
|
|
|
|
|
|
|
|
| 1070 |
}
|
| 1071 |
|
| 1072 |
/**
|
| 1073 |
* Gets attachment URL (in uploads, root or date structure).
|
| 1074 |
-
*
|
| 1075 |
* @param type $abspath
|
| 1076 |
* @return type
|
| 1077 |
*/
|
|
@@ -1082,7 +1056,7 @@ function wpcf_image_attachment_url( $abspath ) {
|
|
| 1082 |
|
| 1083 |
/**
|
| 1084 |
* Returns path to attachment relative to upload_dir.
|
| 1085 |
-
*
|
| 1086 |
* @param type $abspath
|
| 1087 |
* @return string '2014/01/img.jpg'
|
| 1088 |
*/
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/image.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1113864 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 16 |
|
| 17 |
/**
|
| 18 |
* Register data (called automatically).
|
| 19 |
+
* @return type
|
| 20 |
*/
|
| 21 |
function wpcf_fields_image() {
|
| 22 |
return array(
|
| 24 |
'title' => __( 'Image', 'wpcf' ),
|
| 25 |
'description' => __( 'Image', 'wpcf' ),
|
| 26 |
'validate' => array('required'),
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 27 |
'inherited_field_type' => 'file',
|
| 28 |
);
|
| 29 |
}
|
| 30 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 31 |
/**
|
| 32 |
* Editor callback form.
|
| 33 |
+
*
|
| 34 |
+
* @global object $wpdb
|
| 35 |
+
*
|
| 36 |
*/
|
| 37 |
function wpcf_fields_image_editor_callback( $field, $data, $context, $post ) {
|
| 38 |
|
| 53 |
if ( !empty( $image ) ) {
|
| 54 |
// Get attachment by guid
|
| 55 |
global $wpdb;
|
| 56 |
+
$attachment_id = $wpdb->get_var(
|
| 57 |
+
$wpdb->prepare(
|
| 58 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 59 |
+
$image
|
| 60 |
+
)
|
| 61 |
+
);
|
| 62 |
}
|
| 63 |
}
|
| 64 |
$data['image'] = $image;
|
| 236 |
|
| 237 |
/**
|
| 238 |
* View function.
|
| 239 |
+
*
|
| 240 |
+
* @param type $params
|
| 241 |
*/
|
| 242 |
function wpcf_fields_image_view( $params ) {
|
| 243 |
|
| 283 |
if ( !empty( $params['style'] ) ) {
|
| 284 |
$style[] = $params['style'];
|
| 285 |
}
|
| 286 |
+
|
| 287 |
// Compatibility with old parameters
|
| 288 |
$old_param = isset( $params['proportional'] ) && $params['proportional'] == 'true' ? 'proportional' : 'crop';
|
| 289 |
$resize = isset( $params['resize'] ) ? $params['resize'] : $old_param;
|
| 522 |
|
| 523 |
/**
|
| 524 |
* Gets all necessary data for processed image.
|
| 525 |
+
*
|
|
|
|
| 526 |
* @param type $image
|
| 527 |
+
* @return type
|
| 528 |
*/
|
| 529 |
function wpcf_fields_image_get_data( $image ) {
|
| 530 |
|
| 536 |
if ( isset( $cache[$cache_key] ) ) {
|
| 537 |
return $cache[$cache_key];
|
| 538 |
}
|
| 539 |
+
|
| 540 |
WPCF_Loader::loadView( 'image' );
|
| 541 |
$utils = Types_Image_Utils::getInstance();
|
| 542 |
|
| 629 |
|
| 630 |
/**
|
| 631 |
* Strips GET vars from value.
|
| 632 |
+
*
|
| 633 |
* @param type $value
|
| 634 |
+
* @return type
|
| 635 |
*/
|
| 636 |
function wpcf_fields_image_value_filter( $value ) {
|
| 637 |
if ( is_string( $value ) && !apply_filters('wpcf_allow_questionmark_in_image_url', false) ) {
|
| 642 |
|
| 643 |
/**
|
| 644 |
* Gets cache directory.
|
| 645 |
+
*
|
| 646 |
+
* @return \WP_Error
|
| 647 |
*/
|
| 648 |
function wpcf_fields_image_get_cache_directory( $suppress_filters = false ) {
|
| 649 |
WPCF_Loader::loadView( 'image' );
|
| 670 |
|
| 671 |
/**
|
| 672 |
* Fetches remote images.
|
| 673 |
+
*
|
| 674 |
* @param type $url
|
| 675 |
+
* @return \WP_Error
|
| 676 |
*/
|
| 677 |
function wpcf_fields_image_get_remote( $url ) {
|
| 678 |
|
| 771 |
|
| 772 |
/**
|
| 773 |
* Clears remote image cache.
|
| 774 |
+
*
|
| 775 |
+
* @param type $action
|
| 776 |
*/
|
| 777 |
function wpcf_fields_image_clear_cache( $cache_dir = null, $action = 'outdated' ) {
|
| 778 |
if ( is_null( $cache_dir ) ) {
|
| 801 |
|
| 802 |
/**
|
| 803 |
* Filters upload paths (to fix Windows issues).
|
| 804 |
+
*
|
| 805 |
* @param type $args
|
| 806 |
* @return type
|
| 807 |
*/
|
| 814 |
if ( isset( $args[$fix] ) ) {
|
| 815 |
/*
|
| 816 |
* Since 1.1.5
|
| 817 |
+
*
|
| 818 |
* We need realpath(), open_basedir restriction check
|
| 819 |
+
*
|
| 820 |
* Suppressing warnings, checking realpath returning FALSE, check
|
| 821 |
* if open_basedir ini is set.
|
| 822 |
+
*
|
| 823 |
* https://icanlocalize.basecamphq.com/projects/7393061-wp-views/todo_items/153462252/comments
|
| 824 |
* http://php.net/manual/en/ini.sect.safe-mode.php
|
| 825 |
* http://php.net/manual/en/ini.core.php#ini.open-basedir
|
| 949 |
|
| 950 |
/**
|
| 951 |
* Fixes for Win.
|
| 952 |
+
*
|
| 953 |
* For now we fix file path to have unified type slashes.
|
| 954 |
+
*
|
| 955 |
* @param type $file
|
| 956 |
* @param type $attachment_id
|
| 957 |
* @return type
|
| 973 |
|
| 974 |
/**
|
| 975 |
* Filters image view.
|
| 976 |
+
*
|
| 977 |
* This is added to handle image 'url' parameter.
|
| 978 |
* We need to unwrap value. Also added to avoid cludging frontend.php.
|
| 979 |
+
*
|
| 980 |
* @param boolean $params
|
| 981 |
* @param type $field
|
| 982 |
* @return boolean
|
| 1001 |
|
| 1002 |
/**
|
| 1003 |
* Adds image to library.
|
| 1004 |
+
*
|
| 1005 |
* @param type $post
|
| 1006 |
* @param type $abspath
|
| 1007 |
*/
|
| 1028 |
|
| 1029 |
/**
|
| 1030 |
* Checks if image is attachment.
|
| 1031 |
+
*
|
| 1032 |
+
* @global object $wpdb
|
| 1033 |
* @param type $guid
|
| 1034 |
* @return type
|
| 1035 |
*/
|
| 1036 |
function wpcf_image_is_attachment( $guid ) {
|
| 1037 |
global $wpdb;
|
| 1038 |
+
return $wpdb->get_var(
|
| 1039 |
+
$wpdb->prepare(
|
| 1040 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 1041 |
+
$guid
|
| 1042 |
+
)
|
| 1043 |
+
);
|
| 1044 |
}
|
| 1045 |
|
| 1046 |
/**
|
| 1047 |
* Gets attachment URL (in uploads, root or date structure).
|
| 1048 |
+
*
|
| 1049 |
* @param type $abspath
|
| 1050 |
* @return type
|
| 1051 |
*/
|
| 1056 |
|
| 1057 |
/**
|
| 1058 |
* Returns path to attachment relative to upload_dir.
|
| 1059 |
+
*
|
| 1060 |
* @param type $abspath
|
| 1061 |
* @return string '2014/01/img.jpg'
|
| 1062 |
*/
|
embedded/includes/fields/skype.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -18,7 +18,12 @@ function wpcf_fields_skype() {
|
|
| 18 |
'id' => 'wpcf-skype',
|
| 19 |
'title' => __( 'Skype', 'wpcf' ),
|
| 20 |
'description' => __( 'Skype', 'wpcf' ),
|
| 21 |
-
'validate' => array(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 22 |
);
|
| 23 |
}
|
| 24 |
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/skype.php $
|
| 5 |
+
* $LastChangedDate: 2015-02-18 14:28:53 +0000 (Wed, 18 Feb 2015) $
|
| 6 |
+
* $LastChangedRevision: 1093394 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 18 |
'id' => 'wpcf-skype',
|
| 19 |
'title' => __( 'Skype', 'wpcf' ),
|
| 20 |
'description' => __( 'Skype', 'wpcf' ),
|
| 21 |
+
'validate' => array(
|
| 22 |
+
'required',
|
| 23 |
+
'skype',
|
| 24 |
+
'maxlength' => array('value' => 32),
|
| 25 |
+
'minlength' => array('value' => 6)
|
| 26 |
+
),
|
| 27 |
);
|
| 28 |
}
|
| 29 |
|
embedded/includes/fields/textarea.php
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/textarea.php $
|
| 5 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 6 |
* $LastChangedRevision: 1027712 $
|
| 7 |
* $LastChangedBy: iworks $
|
embedded/includes/fields/video.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 5 |
-
* $LastChangedDate:
|
| 6 |
-
* $LastChangedRevision:
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
|
@@ -28,6 +28,8 @@ function wpcf_fields_video() {
|
|
| 28 |
* View function.
|
| 29 |
*
|
| 30 |
* @global type $wp_embed
|
|
|
|
|
|
|
| 31 |
* @param type $field
|
| 32 |
* @return string
|
| 33 |
*/
|
|
@@ -83,9 +85,12 @@ function wpcf_fields_video_editor_callback( $field, $data, $meta_type, $post ) {
|
|
| 83 |
if ( !empty( $file ) ) {
|
| 84 |
// Get attachment by guid
|
| 85 |
global $wpdb;
|
| 86 |
-
$attachment_id = $wpdb->get_var(
|
| 87 |
-
|
| 88 |
-
|
|
|
|
|
|
|
|
|
|
| 89 |
}
|
| 90 |
}
|
| 91 |
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/fields/video.php $
|
| 5 |
+
* $LastChangedDate: 2015-03-16 12:03:31 +0000 (Mon, 16 Mar 2015) $
|
| 6 |
+
* $LastChangedRevision: 1113864 $
|
| 7 |
* $LastChangedBy: iworks $
|
| 8 |
*
|
| 9 |
*/
|
| 28 |
* View function.
|
| 29 |
*
|
| 30 |
* @global type $wp_embed
|
| 31 |
+
* @global object $wpdb
|
| 32 |
+
*
|
| 33 |
* @param type $field
|
| 34 |
* @return string
|
| 35 |
*/
|
| 85 |
if ( !empty( $file ) ) {
|
| 86 |
// Get attachment by guid
|
| 87 |
global $wpdb;
|
| 88 |
+
$attachment_id = $wpdb->get_var(
|
| 89 |
+
$wpdb->prepare(
|
| 90 |
+
"SELECT ID FROM {$wpdb->posts} WHERE post_type = 'attachment' AND guid=%s",
|
| 91 |
+
$file
|
| 92 |
+
)
|
| 93 |
+
);
|
| 94 |
}
|
| 95 |
}
|
| 96 |
|
embedded/includes/fields/wysiwyg.php
CHANGED
|
@@ -140,13 +140,23 @@ function wpcf_fields_wysiwyg_view( $params ) {
|
|
| 140 |
}
|
| 141 |
$output .= $content;
|
| 142 |
} else {
|
| 143 |
-
|
| 144 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 145 |
}
|
| 146 |
-
|
| 147 |
-
|
| 148 |
if ( !empty( $params['style'] ) || !empty( $params['class'] ) ) {
|
| 149 |
$output .= '</div>';
|
| 150 |
}
|
| 151 |
return $output;
|
| 152 |
-
}
|
| 140 |
}
|
| 141 |
$output .= $content;
|
| 142 |
} else {
|
| 143 |
+
/**
|
| 144 |
+
* remove_shortcode playlist to avoid htmlspecialchars_decode on json
|
| 145 |
+
* data
|
| 146 |
+
*/
|
| 147 |
+
remove_shortcode('playlist', 'wp_playlist_shortcode');
|
| 148 |
+
$output .= apply_filters( 'the_content', htmlspecialchars_decode( stripslashes( $params['field_value'] ) ) );
|
| 149 |
+
if ( preg_match_all('/playlist[^\]]+/', $output, $matches ) ) {
|
| 150 |
+
foreach( $matches[0] as $one ) {
|
| 151 |
+
$re = '/'.$one.'/';
|
| 152 |
+
$one = preg_replace('/\&\#(8221|8243);/', '"', $one);
|
| 153 |
+
$output = preg_replace($re, $one, $output);
|
| 154 |
+
}
|
| 155 |
+
}
|
| 156 |
+
add_shortcode( 'playlist', 'wp_playlist_shortcode' );
|
| 157 |
}
|
|
|
|
|
|
|
| 158 |
if ( !empty( $params['style'] ) || !empty( $params['class'] ) ) {
|
| 159 |
$output .= '</div>';
|
| 160 |
}
|
| 161 |
return $output;
|
| 162 |
+
}
|
embedded/includes/import-export.php
CHANGED
|
@@ -2,19 +2,23 @@
|
|
| 2 |
/*
|
| 3 |
* Import/export data.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
-
* $LastChangedBy:
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
|
| 12 |
/**
|
| 13 |
* Imports data from XML.
|
|
|
|
|
|
|
|
|
|
| 14 |
*/
|
| 15 |
-
function wpcf_admin_import_data($data = '', $redirect = true,
|
| 16 |
-
|
| 17 |
global $wpdb;
|
|
|
|
| 18 |
|
| 19 |
libxml_use_internal_errors( true );
|
| 20 |
$data = simplexml_load_string( $data );
|
|
@@ -36,6 +40,20 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 36 |
$delete_types = isset( $_POST['delete-types'] );
|
| 37 |
$delete_tax = isset( $_POST['delete-tax'] );
|
| 38 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 39 |
/**
|
| 40 |
* process settings
|
| 41 |
*/
|
|
@@ -58,6 +76,7 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 58 |
$group = wpcf_admin_import_export_simplexml2array( $group );
|
| 59 |
$groups[$group['ID']] = $group;
|
| 60 |
}
|
|
|
|
| 61 |
// Set insert data from POST
|
| 62 |
if ( !empty( $_POST['groups'] ) ) {
|
| 63 |
foreach ( $_POST['groups'] as $group_id => $group ) {
|
|
@@ -90,10 +109,13 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 90 |
$post['post_name'] = $group['__types_id'];
|
| 91 |
}
|
| 92 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 93 |
-
$post_to_update = $wpdb->get_var(
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
|
|
|
|
|
|
|
|
|
| 97 |
// Update (may be forced by bulk action)
|
| 98 |
if ( $group['update'] || ($overwrite_groups && !empty( $post_to_update )) ) {
|
| 99 |
if ( !empty( $post_to_update ) ) {
|
|
@@ -150,6 +172,7 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 150 |
}
|
| 151 |
// Delete groups (forced, set in bulk actions)
|
| 152 |
}
|
|
|
|
| 153 |
if ( $delete_groups ) {
|
| 154 |
$groups_to_delete = get_posts(
|
| 155 |
array(
|
|
@@ -289,7 +312,7 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 289 |
// Process user groups
|
| 290 |
//print_r($data->user_groups);exit;
|
| 291 |
$groups_check = array();
|
| 292 |
-
if ( !empty( $data->user_groups ) ) {
|
| 293 |
$groups = array();
|
| 294 |
// Set insert data from XML
|
| 295 |
foreach ( $data->user_groups->group as $group ) {
|
|
@@ -321,10 +344,13 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 321 |
'post_content' => !empty( $group['post_content'] ) ? $group['post_content'] : '',
|
| 322 |
);
|
| 323 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 324 |
-
$post_to_update = $wpdb->get_var(
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
|
|
|
|
|
|
|
|
|
| 328 |
|
| 329 |
// Update (may be forced by bulk action)
|
| 330 |
if ( $group['update'] || ($overwrite_groups && !empty( $post_to_update )) ) {
|
|
@@ -509,7 +535,7 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 509 |
|
| 510 |
$types_existing = get_option( 'wpcf-custom-types', array() );
|
| 511 |
$types_check = array();
|
| 512 |
-
if ( !empty( $data->types
|
| 513 |
$types = array();
|
| 514 |
// Set insert data from XML
|
| 515 |
foreach ( $data->types->type as $type ) {
|
|
@@ -570,7 +596,7 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 570 |
|
| 571 |
$taxonomies_existing = get_option( 'wpcf-custom-taxonomies', array() );
|
| 572 |
$taxonomies_check = array();
|
| 573 |
-
if ( !empty( $data->taxonomies ) ) {
|
| 574 |
$taxonomies = array();
|
| 575 |
// Set insert data from XML
|
| 576 |
foreach ( $data->taxonomies->taxonomy as $taxonomy ) {
|
|
@@ -606,21 +632,28 @@ function wpcf_admin_import_data($data = '', $redirect = true,
|
|
| 606 |
'wpcf' ), $taxonomy_id ) );
|
| 607 |
}
|
| 608 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 609 |
// Delete taxonomies
|
| 610 |
if ( $delete_tax ) {
|
| 611 |
foreach ( $taxonomies_existing as $k => $v ) {
|
| 612 |
if ( !in_array( $k, $taxonomies_check ) ) {
|
| 613 |
unset( $taxonomies_existing[$k] );
|
| 614 |
-
wpcf_admin_message_store( sprintf( __( 'Custom taxonomy "%s" deleted',
|
| 615 |
-
'wpcf' ), $k ) );
|
| 616 |
}
|
| 617 |
}
|
| 618 |
} else {
|
| 619 |
if ( !empty( $_POST['taxonomies-to-be-deleted'] ) ) {
|
| 620 |
foreach ( $_POST['taxonomies-to-be-deleted'] as
|
| 621 |
$taxonomy_to_delete ) {
|
| 622 |
-
wpcf_admin_message_store( sprintf( __( 'Custom taxonomy "%s" deleted',
|
| 623 |
-
'wpcf' ),
|
| 624 |
$taxonomies_existing[$taxonomy_to_delete]['labels']['name'] ) );
|
| 625 |
unset( $taxonomies_existing[$taxonomy_to_delete] );
|
| 626 |
}
|
|
@@ -710,3 +743,4 @@ function wpcf_admin_import_export_simplexml2array($element)
|
|
| 710 |
|
| 711 |
return $element;
|
| 712 |
}
|
|
|
| 2 |
/*
|
| 3 |
* Import/export data.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/import-export.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
+
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
|
| 12 |
/**
|
| 13 |
* Imports data from XML.
|
| 14 |
+
*
|
| 15 |
+
* @global object $wpdb
|
| 16 |
+
*
|
| 17 |
*/
|
| 18 |
+
function wpcf_admin_import_data($data = '', $redirect = true, $context = 'types', $args = array() )
|
| 19 |
+
{
|
| 20 |
global $wpdb;
|
| 21 |
+
$data_installer = false;
|
| 22 |
|
| 23 |
libxml_use_internal_errors( true );
|
| 24 |
$data = simplexml_load_string( $data );
|
| 40 |
$delete_types = isset( $_POST['delete-types'] );
|
| 41 |
$delete_tax = isset( $_POST['delete-tax'] );
|
| 42 |
|
| 43 |
+
if ('wpvdemo' == $context && !empty($args)) {
|
| 44 |
+
/**
|
| 45 |
+
* allow overwrite
|
| 46 |
+
*/
|
| 47 |
+
$overwrite_groups = true;
|
| 48 |
+
$overwrite_fields = true;
|
| 49 |
+
$overwrite_types = true;
|
| 50 |
+
$overwrite_tax = true;
|
| 51 |
+
|
| 52 |
+
include_once dirname(__FILE__).'/classes/class.types.data.installer.php';
|
| 53 |
+
$data_installer = new Types_Data_Installer($data, $args);
|
| 54 |
+
$data = $data_installer->wpvdemo();
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
/**
|
| 58 |
* process settings
|
| 59 |
*/
|
| 76 |
$group = wpcf_admin_import_export_simplexml2array( $group );
|
| 77 |
$groups[$group['ID']] = $group;
|
| 78 |
}
|
| 79 |
+
|
| 80 |
// Set insert data from POST
|
| 81 |
if ( !empty( $_POST['groups'] ) ) {
|
| 82 |
foreach ( $_POST['groups'] as $group_id => $group ) {
|
| 109 |
$post['post_name'] = $group['__types_id'];
|
| 110 |
}
|
| 111 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 112 |
+
$post_to_update = $wpdb->get_var(
|
| 113 |
+
$wpdb->prepare(
|
| 114 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type = %s",
|
| 115 |
+
$group['post_title'],
|
| 116 |
+
'wp-types-group'
|
| 117 |
+
)
|
| 118 |
+
);
|
| 119 |
// Update (may be forced by bulk action)
|
| 120 |
if ( $group['update'] || ($overwrite_groups && !empty( $post_to_update )) ) {
|
| 121 |
if ( !empty( $post_to_update ) ) {
|
| 172 |
}
|
| 173 |
// Delete groups (forced, set in bulk actions)
|
| 174 |
}
|
| 175 |
+
|
| 176 |
if ( $delete_groups ) {
|
| 177 |
$groups_to_delete = get_posts(
|
| 178 |
array(
|
| 312 |
// Process user groups
|
| 313 |
//print_r($data->user_groups);exit;
|
| 314 |
$groups_check = array();
|
| 315 |
+
if ( !empty( $data->user_groups ) && isset( $data->user_groups->group) ) {
|
| 316 |
$groups = array();
|
| 317 |
// Set insert data from XML
|
| 318 |
foreach ( $data->user_groups->group as $group ) {
|
| 344 |
'post_content' => !empty( $group['post_content'] ) ? $group['post_content'] : '',
|
| 345 |
);
|
| 346 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 347 |
+
$post_to_update = $wpdb->get_var(
|
| 348 |
+
$wpdb->prepare(
|
| 349 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type = %s",
|
| 350 |
+
$group['post_title'],
|
| 351 |
+
'wp-types-user-group'
|
| 352 |
+
)
|
| 353 |
+
);
|
| 354 |
|
| 355 |
// Update (may be forced by bulk action)
|
| 356 |
if ( $group['update'] || ($overwrite_groups && !empty( $post_to_update )) ) {
|
| 535 |
|
| 536 |
$types_existing = get_option( 'wpcf-custom-types', array() );
|
| 537 |
$types_check = array();
|
| 538 |
+
if ( !empty($data->types) && isset($data->types->type) ) {
|
| 539 |
$types = array();
|
| 540 |
// Set insert data from XML
|
| 541 |
foreach ( $data->types->type as $type ) {
|
| 596 |
|
| 597 |
$taxonomies_existing = get_option( 'wpcf-custom-taxonomies', array() );
|
| 598 |
$taxonomies_check = array();
|
| 599 |
+
if ( !empty( $data->taxonomies ) && isset($data->taxonomies->taxonomy)) {
|
| 600 |
$taxonomies = array();
|
| 601 |
// Set insert data from XML
|
| 602 |
foreach ( $data->taxonomies->taxonomy as $taxonomy ) {
|
| 632 |
'wpcf' ), $taxonomy_id ) );
|
| 633 |
}
|
| 634 |
}
|
| 635 |
+
|
| 636 |
+
|
| 637 |
+
/**
|
| 638 |
+
* reset TOOLSET_EDIT_LAST
|
| 639 |
+
*/
|
| 640 |
+
if ( $data_installer ) {
|
| 641 |
+
$data_installer->reset_toolset_edit_last();
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
// Delete taxonomies
|
| 645 |
if ( $delete_tax ) {
|
| 646 |
foreach ( $taxonomies_existing as $k => $v ) {
|
| 647 |
if ( !in_array( $k, $taxonomies_check ) ) {
|
| 648 |
unset( $taxonomies_existing[$k] );
|
| 649 |
+
wpcf_admin_message_store( sprintf( __( 'Custom taxonomy "%s" deleted', 'wpcf' ), $k ) );
|
|
|
|
| 650 |
}
|
| 651 |
}
|
| 652 |
} else {
|
| 653 |
if ( !empty( $_POST['taxonomies-to-be-deleted'] ) ) {
|
| 654 |
foreach ( $_POST['taxonomies-to-be-deleted'] as
|
| 655 |
$taxonomy_to_delete ) {
|
| 656 |
+
wpcf_admin_message_store( sprintf( __( 'Custom taxonomy "%s" deleted', 'wpcf' ),
|
|
|
|
| 657 |
$taxonomies_existing[$taxonomy_to_delete]['labels']['name'] ) );
|
| 658 |
unset( $taxonomies_existing[$taxonomy_to_delete] );
|
| 659 |
}
|
| 743 |
|
| 744 |
return $element;
|
| 745 |
}
|
| 746 |
+
|
embedded/includes/module-manager.php
CHANGED
|
@@ -4,9 +4,9 @@
|
|
| 4 |
*
|
| 5 |
* Since Types 1.2
|
| 6 |
*
|
| 7 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 8 |
-
* $LastChangedDate:
|
| 9 |
-
* $LastChangedRevision:
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
*/
|
|
@@ -775,7 +775,7 @@ function wpcf_admin_export_selected_data ( array $items, $_type = 'all', $return
|
|
| 775 |
*
|
| 776 |
* Import selected items given by xmlstring.
|
| 777 |
*
|
| 778 |
-
* @global
|
| 779 |
* @global type $iclTranslationManagement
|
| 780 |
* @param type $data
|
| 781 |
* @param type $_type
|
|
@@ -850,10 +850,13 @@ function wpcf_admin_import_data_from_xmlstring( $data = '', $_type = 'types',
|
|
| 850 |
'post_content' => !empty( $group['post_content'] ) ? $group['post_content'] : '',
|
| 851 |
);
|
| 852 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 853 |
-
$post_to_update = $wpdb->get_var(
|
| 854 |
-
|
| 855 |
-
|
| 856 |
-
|
|
|
|
|
|
|
|
|
|
| 857 |
// Update (may be forced by bulk action)
|
| 858 |
if ( $group['update'] || (!empty( $post_to_update )) ) {
|
| 859 |
if ( !empty( $post_to_update ) ) {
|
| 4 |
*
|
| 5 |
* Since Types 1.2
|
| 6 |
*
|
| 7 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/module-manager.php $
|
| 8 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 9 |
+
* $LastChangedRevision: 1120400 $
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
*/
|
| 775 |
*
|
| 776 |
* Import selected items given by xmlstring.
|
| 777 |
*
|
| 778 |
+
* @global object $wpdb
|
| 779 |
* @global type $iclTranslationManagement
|
| 780 |
* @param type $data
|
| 781 |
* @param type $_type
|
| 850 |
'post_content' => !empty( $group['post_content'] ) ? $group['post_content'] : '',
|
| 851 |
);
|
| 852 |
if ( (isset( $group['add'] ) && $group['add'] ) ) {
|
| 853 |
+
$post_to_update = $wpdb->get_var(
|
| 854 |
+
$wpdb->prepare(
|
| 855 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type = %s",
|
| 856 |
+
$group['post_title'],
|
| 857 |
+
'wp-types-group'
|
| 858 |
+
)
|
| 859 |
+
);
|
| 860 |
// Update (may be forced by bulk action)
|
| 861 |
if ( $group['update'] || (!empty( $post_to_update )) ) {
|
| 862 |
if ( !empty( $post_to_update ) ) {
|
embedded/includes/post-relationship.php
CHANGED
|
@@ -2,14 +2,12 @@
|
|
| 2 |
/*
|
| 3 |
* Post relationship code.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-01
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 11 |
-
require_once WPCF_EMBEDDED_INC_ABSPATH . '/editor-support/post-relationship-editor-support.php';
|
| 12 |
-
|
| 13 |
add_action( 'wpcf_admin_post_init', 'wpcf_pr_admin_post_init_action', 10, 4 );
|
| 14 |
add_action( 'save_post', 'wpcf_pr_admin_save_post_hook', 20, 2 ); // Trigger afer main hook
|
| 15 |
|
|
@@ -139,7 +137,6 @@ function wpcf_pr_admin_post_meta_box( $post, $args )
|
|
| 139 |
_e( 'You will be able to manage child posts after saving this post.', 'wpcf' );
|
| 140 |
} else {
|
| 141 |
_e( 'You will be able to add parent posts after saving this post.', 'wpcf' );
|
| 142 |
-
// add_action( 'admin_footer', 'wpcf_admin_notice_post_locked_no_parent');
|
| 143 |
}
|
| 144 |
}
|
| 145 |
}
|
|
@@ -258,7 +255,7 @@ function wpcf_pr_admin_post_meta_box_output( $post, $args )
|
|
| 258 |
/**
|
| 259 |
* AJAX delete child item call.
|
| 260 |
*
|
| 261 |
-
* @param
|
| 262 |
* @return string
|
| 263 |
*/
|
| 264 |
function wpcf_pr_admin_delete_child_item( $post_id ) {
|
|
@@ -266,6 +263,22 @@ function wpcf_pr_admin_delete_child_item( $post_id ) {
|
|
| 266 |
return __( 'Post deleted', 'wpcf' );
|
| 267 |
}
|
| 268 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 269 |
/**
|
| 270 |
* Belongs form.
|
| 271 |
*
|
|
@@ -301,20 +314,59 @@ function wpcf_pr_admin_post_meta_box_belongs_form( $post, $type, $belongs )
|
|
| 301 |
if ( empty( $items ) ) {
|
| 302 |
return array();
|
| 303 |
}
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 310 |
|
| 311 |
foreach ( $items as $temp_post ) {
|
| 312 |
if ( !isset( $_titles[$temp_post]->post_title ) ) {
|
| 313 |
continue;
|
| 314 |
}
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 318 |
);
|
| 319 |
}
|
| 320 |
|
|
@@ -339,7 +391,7 @@ function wpcf_pr_admin_post_meta_box_belongs_form( $post, $type, $belongs )
|
|
| 339 |
/**
|
| 340 |
* Updates belongs data.
|
| 341 |
*
|
| 342 |
-
* @param
|
| 343 |
* @param array $data $post_type => $post_id
|
| 344 |
* @return string
|
| 345 |
*/
|
|
@@ -414,13 +466,13 @@ function wpcf_pr_admin_has_pagination( $post, $post_type, $page, $prev, $next,
|
|
| 414 |
$link = '';
|
| 415 |
$add = '';
|
| 416 |
if ( isset( $_GET['sort'] ) ) {
|
| 417 |
-
$add .= '&sort=' . $_GET['sort'];
|
| 418 |
}
|
| 419 |
if ( isset( $_GET['field'] ) ) {
|
| 420 |
-
$add .= '&field=' . $_GET['field'];
|
| 421 |
}
|
| 422 |
if ( isset( $_GET['post_type_sort_parent'] ) ) {
|
| 423 |
-
$add .= '&post_type_sort_parent=' . $_GET['post_type_sort_parent'];
|
| 424 |
}
|
| 425 |
|
| 426 |
/**
|
| 2 |
/*
|
| 3 |
* Post relationship code.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/post-relationship.php $
|
| 6 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 7 |
+
* $LastChangedRevision: 1125405 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
|
|
|
|
|
| 11 |
add_action( 'wpcf_admin_post_init', 'wpcf_pr_admin_post_init_action', 10, 4 );
|
| 12 |
add_action( 'save_post', 'wpcf_pr_admin_save_post_hook', 20, 2 ); // Trigger afer main hook
|
| 13 |
|
| 137 |
_e( 'You will be able to manage child posts after saving this post.', 'wpcf' );
|
| 138 |
} else {
|
| 139 |
_e( 'You will be able to add parent posts after saving this post.', 'wpcf' );
|
|
|
|
| 140 |
}
|
| 141 |
}
|
| 142 |
}
|
| 255 |
/**
|
| 256 |
* AJAX delete child item call.
|
| 257 |
*
|
| 258 |
+
* @param int $post_id
|
| 259 |
* @return string
|
| 260 |
*/
|
| 261 |
function wpcf_pr_admin_delete_child_item( $post_id ) {
|
| 263 |
return __( 'Post deleted', 'wpcf' );
|
| 264 |
}
|
| 265 |
|
| 266 |
+
/**
|
| 267 |
+
*
|
| 268 |
+
* Belongs form helper to build correct SQL string to prepare.
|
| 269 |
+
*
|
| 270 |
+
* Belongs form helper to build correct SQL string to $wpdb->prepare - replace
|
| 271 |
+
* any item by digital placeholder.
|
| 272 |
+
*
|
| 273 |
+
* @param any $item
|
| 274 |
+
* @return string
|
| 275 |
+
*
|
| 276 |
+
*/
|
| 277 |
+
function wpcf_pr_admin_post_meta_box_belongs_form_items_helper( $item )
|
| 278 |
+
{
|
| 279 |
+
return '%d';
|
| 280 |
+
}
|
| 281 |
+
|
| 282 |
/**
|
| 283 |
* Belongs form.
|
| 284 |
*
|
| 314 |
if ( empty( $items ) ) {
|
| 315 |
return array();
|
| 316 |
}
|
| 317 |
+
/**
|
| 318 |
+
* Filter array of parent objects.
|
| 319 |
+
*
|
| 320 |
+
* Allow to change array of parent objects, modyfiy titles, remove
|
| 321 |
+
* or add some data from list of avaiable post parents.
|
| 322 |
+
*
|
| 323 |
+
* @since 1.6.6
|
| 324 |
+
*
|
| 325 |
+
* @param array $args {
|
| 326 |
+
* Array of objects with all possible parents
|
| 327 |
+
*
|
| 328 |
+
* @param int $ID Post ID
|
| 329 |
+
* @param string $type Post title.
|
| 330 |
+
* }
|
| 331 |
+
* @param string $type Post Type of parent.
|
| 332 |
+
*/
|
| 333 |
+
$_titles = apply_filters(
|
| 334 |
+
'wpcf_pr_belongs_items',
|
| 335 |
+
$wpdb->get_results(
|
| 336 |
+
$wpdb->prepare(
|
| 337 |
+
sprintf(
|
| 338 |
+
'SELECT ID, post_title FROM %s WHERE ID IN (%s)',
|
| 339 |
+
$wpdb->posts,
|
| 340 |
+
implode(', ', array_map( 'wpcf_pr_admin_post_meta_box_belongs_form_items_helper', $items))
|
| 341 |
+
),
|
| 342 |
+
$items
|
| 343 |
+
),
|
| 344 |
+
OBJECT_K
|
| 345 |
+
),
|
| 346 |
+
$type
|
| 347 |
+
);
|
| 348 |
|
| 349 |
foreach ( $items as $temp_post ) {
|
| 350 |
if ( !isset( $_titles[$temp_post]->post_title ) ) {
|
| 351 |
continue;
|
| 352 |
}
|
| 353 |
+
/**
|
| 354 |
+
* Filter single parent data
|
| 355 |
+
*
|
| 356 |
+
* Allow change singla parent data.
|
| 357 |
+
*
|
| 358 |
+
* @since 1.6.6
|
| 359 |
+
*
|
| 360 |
+
* @param array $args Single parent title and id
|
| 361 |
+
* @param string $type Post Type of parent.
|
| 362 |
+
*/
|
| 363 |
+
$options[] = apply_filters(
|
| 364 |
+
'wpcf_pr_belongs_item',
|
| 365 |
+
array(
|
| 366 |
+
'#title' => $_titles[$temp_post]->post_title,
|
| 367 |
+
'#value' => $temp_post,
|
| 368 |
+
),
|
| 369 |
+
$type
|
| 370 |
);
|
| 371 |
}
|
| 372 |
|
| 391 |
/**
|
| 392 |
* Updates belongs data.
|
| 393 |
*
|
| 394 |
+
* @param int $post_id
|
| 395 |
* @param array $data $post_type => $post_id
|
| 396 |
* @return string
|
| 397 |
*/
|
| 466 |
$link = '';
|
| 467 |
$add = '';
|
| 468 |
if ( isset( $_GET['sort'] ) ) {
|
| 469 |
+
$add .= '&sort=' . sanitize_text_field( $_GET['sort'] );
|
| 470 |
}
|
| 471 |
if ( isset( $_GET['field'] ) ) {
|
| 472 |
+
$add .= '&field=' . sanitize_text_field( $_GET['field'] );
|
| 473 |
}
|
| 474 |
if ( isset( $_GET['post_type_sort_parent'] ) ) {
|
| 475 |
+
$add .= '&post_type_sort_parent=' . sanitize_text_field( $_GET['post_type_sort_parent'] );
|
| 476 |
}
|
| 477 |
|
| 478 |
/**
|
embedded/includes/relationship/child-table.php
CHANGED
|
@@ -15,7 +15,11 @@
|
|
| 15 |
|
| 16 |
<!--TITLE-->
|
| 17 |
<div class="wpcf-pr-has-title"><?php echo $this->child_post_type_object->label; ?></div>
|
| 18 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 19 |
<!--BUTTONS-->
|
| 20 |
|
| 21 |
<!--SAVE ALL-->
|
|
@@ -118,4 +122,4 @@ echo admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=pr_save_all'
|
|
| 118 |
<!--PAGINATION BOTTOM-->
|
| 119 |
<div class="wpcf-pagination-boottom"><?php echo $this->pagination_bottom; ?></div>
|
| 120 |
<hr />
|
| 121 |
-
</div>
|
| 15 |
|
| 16 |
<!--TITLE-->
|
| 17 |
<div class="wpcf-pr-has-title"><?php echo $this->child_post_type_object->label; ?></div>
|
| 18 |
+
<?php
|
| 19 |
+
if ( isset($this->child_post_type_object->description) && $this->child_post_type_object->description ) {
|
| 20 |
+
echo wpautop($this->child_post_type_object->description);
|
| 21 |
+
}
|
| 22 |
+
?>
|
| 23 |
<!--BUTTONS-->
|
| 24 |
|
| 25 |
<!--SAVE ALL-->
|
| 122 |
<!--PAGINATION BOTTOM-->
|
| 123 |
<div class="wpcf-pagination-boottom"><?php echo $this->pagination_bottom; ?></div>
|
| 124 |
<hr />
|
| 125 |
+
</div>
|
embedded/includes/usermeta-add-user.php
CHANGED
|
@@ -4,7 +4,6 @@
|
|
| 4 |
* Included on add_action('load-user-new.php') hook.
|
| 5 |
*/
|
| 6 |
add_action( 'in_admin_footer', 'wpcf_usermeta_add_user_templates' );
|
| 7 |
-
// if ( isset( $_REQUEST['action'] ) && in_array( $_REQUEST['action'], array('createuser') ) ) {
|
| 8 |
add_action( 'user_register', 'wpcf_usermets_add_user_submit' );
|
| 9 |
|
| 10 |
/**
|
|
@@ -43,4 +42,4 @@ function wpcf_usermeta_add_user_screen_init() {
|
|
| 43 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
| 44 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 45 |
remove_action( 'admin_footer', 'wpcf_admin_profile_js_validation' );
|
| 46 |
-
}
|
| 4 |
* Included on add_action('load-user-new.php') hook.
|
| 5 |
*/
|
| 6 |
add_action( 'in_admin_footer', 'wpcf_usermeta_add_user_templates' );
|
|
|
|
| 7 |
add_action( 'user_register', 'wpcf_usermets_add_user_submit' );
|
| 8 |
|
| 9 |
/**
|
| 42 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
| 43 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 44 |
remove_action( 'admin_footer', 'wpcf_admin_profile_js_validation' );
|
| 45 |
+
}
|
embedded/includes/usermeta-post.php
CHANGED
|
@@ -98,6 +98,7 @@ function wpcf_admin_userprofile_init($user_id){
|
|
| 98 |
if ( isset( $config['validation']['required'] ) ) {
|
| 99 |
$config['title'] .= '*';
|
| 100 |
}
|
|
|
|
| 101 |
$output .= '
|
| 102 |
<div class="wpcf-profile-field-line">
|
| 103 |
<div class="wpcf-profile-line-left">
|
| 98 |
if ( isset( $config['validation']['required'] ) ) {
|
| 99 |
$config['title'] .= '*';
|
| 100 |
}
|
| 101 |
+
$config['_title'] = $config['title'];
|
| 102 |
$output .= '
|
| 103 |
<div class="wpcf-profile-field-line">
|
| 104 |
<div class="wpcf-profile-line-left">
|
embedded/includes/usermeta.php
CHANGED
|
@@ -5,10 +5,9 @@ define("WORKINGTYPE", "usermeta");
|
|
| 5 |
|
| 6 |
/**
|
| 7 |
* Saves group's user roles.
|
| 8 |
-
*
|
| 9 |
-
* @global type $wpdb
|
| 10 |
* @param type $group_id
|
| 11 |
-
* @param type $post_types
|
| 12 |
*/
|
| 13 |
function wpcf_admin_fields_save_group_showfor($group_id, $post_types) {
|
| 14 |
if (empty($post_types)) {
|
|
@@ -23,16 +22,15 @@ function wpcf_admin_fields_save_group_showfor($group_id, $post_types) {
|
|
| 23 |
|
| 24 |
/**
|
| 25 |
* Gets user roles supported by specific group.
|
| 26 |
-
*
|
| 27 |
-
* @global type $wpdb
|
| 28 |
* @param type $group_id
|
| 29 |
-
* @return type
|
| 30 |
*/
|
| 31 |
function wpcf_admin_get_groups_showfor_by_group($group_id) {
|
| 32 |
$for_users = get_post_meta($group_id, '_wp_types_group_showfor', true);
|
| 33 |
-
if ($for_users == 'all') {
|
| 34 |
return array();
|
| 35 |
}
|
| 36 |
$for_users = explode(',', trim($for_users, ','));
|
| 37 |
return $for_users;
|
| 38 |
-
}
|
| 5 |
|
| 6 |
/**
|
| 7 |
* Saves group's user roles.
|
| 8 |
+
*
|
|
|
|
| 9 |
* @param type $group_id
|
| 10 |
+
* @param type $post_types
|
| 11 |
*/
|
| 12 |
function wpcf_admin_fields_save_group_showfor($group_id, $post_types) {
|
| 13 |
if (empty($post_types)) {
|
| 22 |
|
| 23 |
/**
|
| 24 |
* Gets user roles supported by specific group.
|
| 25 |
+
*
|
|
|
|
| 26 |
* @param type $group_id
|
| 27 |
+
* @return type
|
| 28 |
*/
|
| 29 |
function wpcf_admin_get_groups_showfor_by_group($group_id) {
|
| 30 |
$for_users = get_post_meta($group_id, '_wp_types_group_showfor', true);
|
| 31 |
+
if (empty($for_users) || $for_users == 'all') {
|
| 32 |
return array();
|
| 33 |
}
|
| 34 |
$for_users = explode(',', trim($for_users, ','));
|
| 35 |
return $for_users;
|
| 36 |
+
}
|
embedded/includes/wpml.php
CHANGED
|
@@ -1,16 +1,16 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
* @since Types 1.2
|
| 4 |
-
*
|
| 5 |
* All WPML specific functions should be moved here.
|
| 6 |
-
*
|
| 7 |
* Mind wpml_action parameter for field.
|
| 8 |
* Values:
|
| 9 |
* 0 nothing (ignore), 1 copy, 2 translate
|
| 10 |
*
|
| 11 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 12 |
-
* $LastChangedDate: 2015-
|
| 13 |
-
* $LastChangedRevision:
|
| 14 |
* $LastChangedBy: iworks $
|
| 15 |
*
|
| 16 |
*/
|
|
@@ -33,7 +33,7 @@ if ( defined( 'ICL_SITEPRESS_VERSION' ) ) {
|
|
| 33 |
add_filter( 'types_taxonomy', 'wpcf_wpml_taxonomy_translate', 10, 3 );
|
| 34 |
|
| 35 |
/*
|
| 36 |
-
*
|
| 37 |
* Filter terms used when:
|
| 38 |
* - Displaying Group form
|
| 39 |
* - Filtering Group on post edit screen
|
|
@@ -73,7 +73,7 @@ if ( defined( 'ICL_SITEPRESS_VERSION' ) ) {
|
|
| 73 |
'wpcf_wpml_sync_postmeta_hook_add', 10, 2 );
|
| 74 |
add_action( 'wpcf_postmeta_after_add_repetitive',
|
| 75 |
'wpcf_wpml_sync_postmeta_hook_add', 10, 2 );
|
| 76 |
-
|
| 77 |
// Fix to set correct parent and children for duplicated posts
|
| 78 |
add_action( 'icl_make_duplicate', 'wpcf_wpml_duplicated_post_relationships',
|
| 79 |
20, 4);
|
|
@@ -81,7 +81,7 @@ if ( defined( 'ICL_SITEPRESS_VERSION' ) ) {
|
|
| 81 |
|
| 82 |
/**
|
| 83 |
* Adds wpml_action property.
|
| 84 |
-
*
|
| 85 |
* @param type $fields
|
| 86 |
* @return array
|
| 87 |
*/
|
|
@@ -94,7 +94,7 @@ function wpcf_wpml_fields_filter( $fields ) {
|
|
| 94 |
|
| 95 |
/**
|
| 96 |
* Adds wpml_action property.
|
| 97 |
-
*
|
| 98 |
* @global type $iclTranslationManagement
|
| 99 |
* @param type $field
|
| 100 |
* @return array
|
|
@@ -129,7 +129,7 @@ function wpcf_wpml_field_filter( $field ) {
|
|
| 129 |
|
| 130 |
/**
|
| 131 |
* Returns WPML action by field type.
|
| 132 |
-
*
|
| 133 |
* @param type $type
|
| 134 |
* @return type
|
| 135 |
*/
|
|
@@ -151,10 +151,10 @@ function wpcf_wpml_init() {
|
|
| 151 |
|
| 152 |
/**
|
| 153 |
* WPML translate call.
|
| 154 |
-
*
|
| 155 |
* @param type $name
|
| 156 |
* @param type $string
|
| 157 |
-
* @return type
|
| 158 |
*/
|
| 159 |
function wpcf_translate( $name, $string, $context = 'plugin Types' ) {
|
| 160 |
if ( !function_exists( 'icl_t' ) || !is_string($string) || empty($string) ) {
|
|
@@ -165,10 +165,10 @@ function wpcf_translate( $name, $string, $context = 'plugin Types' ) {
|
|
| 165 |
|
| 166 |
/**
|
| 167 |
* Registers WPML translation string.
|
| 168 |
-
*
|
| 169 |
* @param type $context
|
| 170 |
* @param type $name
|
| 171 |
-
* @param type $value
|
| 172 |
*/
|
| 173 |
function wpcf_translate_register_string( $context, $name, $value,
|
| 174 |
$allow_empty_value = false ) {
|
|
@@ -180,7 +180,7 @@ function wpcf_translate_register_string( $context, $name, $value,
|
|
| 180 |
|
| 181 |
/**
|
| 182 |
* Relationship filter get_children query.
|
| 183 |
-
*
|
| 184 |
* @param type $_query string for get_posts()
|
| 185 |
* @param type $parent Parent
|
| 186 |
* @param type $post_type Children post type
|
|
@@ -202,9 +202,9 @@ function wpcf_wpml_relationship_get_children_query( $query, $parent, $post_type,
|
|
| 202 |
|
| 203 |
/**
|
| 204 |
* WPML editor filter
|
| 205 |
-
*
|
| 206 |
* @param type $cf_name
|
| 207 |
-
* @return type
|
| 208 |
*/
|
| 209 |
function wpcf_icl_editor_cf_name_filter( $cf_name ) {
|
| 210 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
|
@@ -225,10 +225,10 @@ function wpcf_icl_editor_cf_name_filter( $cf_name ) {
|
|
| 225 |
|
| 226 |
/**
|
| 227 |
* WPML editor filter
|
| 228 |
-
*
|
| 229 |
* @param type $cf_name
|
| 230 |
* @param type $description
|
| 231 |
-
* @return type
|
| 232 |
*/
|
| 233 |
function wpcf_icl_editor_cf_description_filter( $description, $cf_name ) {
|
| 234 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
|
@@ -250,10 +250,10 @@ function wpcf_icl_editor_cf_description_filter( $description, $cf_name ) {
|
|
| 250 |
|
| 251 |
/**
|
| 252 |
* WPML editor filter
|
| 253 |
-
*
|
| 254 |
* @param type $cf_name
|
| 255 |
* @param type $style
|
| 256 |
-
* @return type
|
| 257 |
*/
|
| 258 |
function wpcf_icl_editor_cf_style_filter( $style, $cf_name ) {
|
| 259 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
|
@@ -278,7 +278,7 @@ function wpcf_icl_editor_cf_style_filter( $style, $cf_name ) {
|
|
| 278 |
}
|
| 279 |
|
| 280 |
/**
|
| 281 |
-
* Bulk translation.
|
| 282 |
*/
|
| 283 |
function wpcf_admin_bulk_string_translation() {
|
| 284 |
if ( !function_exists( 'icl_register_string' ) ) {
|
|
@@ -412,9 +412,11 @@ function wpcf_post_relationship_set_translated_children( $parent_post_id ) {
|
|
| 412 |
|
| 413 |
global $wpdb;
|
| 414 |
|
| 415 |
-
$query =
|
| 416 |
-
|
| 417 |
-
|
|
|
|
|
|
|
| 418 |
|
| 419 |
foreach ( $original_children as $child_id ) {
|
| 420 |
|
|
@@ -483,13 +485,13 @@ function wpcf_post_relationship_set_translated_parent( $child_post_id ) {
|
|
| 483 |
|
| 484 |
/**
|
| 485 |
* Returns translated '_wpcf_belongs_XXX_id' if any.
|
| 486 |
-
*
|
| 487 |
* @global type $sitepress
|
| 488 |
* @param type $value
|
| 489 |
* @param type $object_id
|
| 490 |
* @param type $meta_key
|
| 491 |
* @param type $single
|
| 492 |
-
* @return type
|
| 493 |
*/
|
| 494 |
function wpcf_wpml_relationship_meta_belongs_filter( $value, $object_id,
|
| 495 |
$meta_key, $single ) {
|
|
@@ -520,7 +522,7 @@ function wpcf_wpml_relationship_meta_belongs_filter( $value, $object_id,
|
|
| 520 |
} else {
|
| 521 |
$value = array($meta_translated_id);
|
| 522 |
}
|
| 523 |
-
|
| 524 |
}
|
| 525 |
}
|
| 526 |
}
|
|
@@ -532,7 +534,7 @@ function wpcf_wpml_relationship_meta_belongs_filter( $value, $object_id,
|
|
| 532 |
|
| 533 |
/**
|
| 534 |
* Adjust translated IDs.
|
| 535 |
-
*
|
| 536 |
* @global type $sitepress
|
| 537 |
* @param type $parent_post_id
|
| 538 |
*/
|
|
@@ -584,9 +586,9 @@ function wpcf_wpml_relationship_save_post_hook( $parent_post_id ){
|
|
| 584 |
|
| 585 |
/**
|
| 586 |
* Registers translation data.
|
| 587 |
-
*
|
| 588 |
* @param type $post_type
|
| 589 |
-
* @param type $data
|
| 590 |
*/
|
| 591 |
function wpcf_custom_types_register_translation( $post_type, $data ) {
|
| 592 |
if ( !function_exists( 'icl_register_string' ) ) {
|
|
@@ -601,9 +603,9 @@ function wpcf_custom_types_register_translation( $post_type, $data ) {
|
|
| 601 |
|
| 602 |
/**
|
| 603 |
* Registers translation data.
|
| 604 |
-
*
|
| 605 |
* @param type $post_type
|
| 606 |
-
* @param type $data
|
| 607 |
*/
|
| 608 |
function wpcf_custom_taxonimies_register_translation( $taxonomy, $data ) {
|
| 609 |
if ( !function_exists( 'icl_register_string' ) ) {
|
|
@@ -618,7 +620,7 @@ function wpcf_custom_taxonimies_register_translation( $taxonomy, $data ) {
|
|
| 618 |
|
| 619 |
/**
|
| 620 |
* Registers labels.
|
| 621 |
-
*
|
| 622 |
* @param type $prefix
|
| 623 |
* @param type $data
|
| 624 |
* @param type $context
|
|
@@ -668,9 +670,9 @@ function wpcf_wpml_register_labels( $prefix, $data, $context = 'post' ) {
|
|
| 668 |
|
| 669 |
/**
|
| 670 |
* Translates data.
|
| 671 |
-
*
|
| 672 |
* @param type $post_type
|
| 673 |
-
* @param type $data
|
| 674 |
*/
|
| 675 |
function wpcf_wpml_post_types_translate( $data, $post_type ) {
|
| 676 |
if ( !function_exists( 'icl_t' ) ) {
|
|
@@ -700,9 +702,9 @@ function wpcf_wpml_post_types_translate( $data, $post_type ) {
|
|
| 700 |
|
| 701 |
/**
|
| 702 |
* Translates data.
|
| 703 |
-
*
|
| 704 |
* @param type $taxonomy
|
| 705 |
-
* @param type $data
|
| 706 |
*/
|
| 707 |
function wpcf_wpml_taxonomy_translate( $data, $taxonomy ) {
|
| 708 |
if ( !function_exists( 'icl_t' ) ) {
|
|
@@ -732,10 +734,10 @@ function wpcf_wpml_taxonomy_translate( $data, $taxonomy ) {
|
|
| 732 |
|
| 733 |
/**
|
| 734 |
* Filters terms on Group form filter.
|
| 735 |
-
*
|
| 736 |
* Do not complicate this, just replace term ID
|
| 737 |
* with corresponding original ID.
|
| 738 |
-
*
|
| 739 |
* @param array $terms array of terms objects.
|
| 740 |
* @return array
|
| 741 |
*/
|
|
@@ -758,7 +760,7 @@ function wpcf_wpml_group_form_filter_terms_filter( $terms ) {
|
|
| 758 |
// Only if translation found
|
| 759 |
if ( $term->term_id != $original_term_id ) {
|
| 760 |
/*
|
| 761 |
-
*
|
| 762 |
* Note that WPML will return term_id.
|
| 763 |
*/
|
| 764 |
$_term = $wpdb->get_row( $wpdb->prepare( "SELECT t.*, tt.* FROM $wpdb->terms AS t INNER JOIN $wpdb->term_taxonomy AS tt ON t.term_id = tt.term_id WHERE tt.taxonomy = %s AND t.term_id = %d LIMIT 1",
|
|
@@ -791,9 +793,9 @@ function wpcf_wpml_group_form_filter_terms_filter( $terms ) {
|
|
| 791 |
|
| 792 |
/**
|
| 793 |
* Adjusts term_id in group filter in post edit screen.
|
| 794 |
-
*
|
| 795 |
* @global type $sitepress
|
| 796 |
-
* @global
|
| 797 |
* @param type $group
|
| 798 |
* @return type
|
| 799 |
*/
|
|
@@ -844,11 +846,11 @@ function wpcf_wpml_post_group_filter_taxonomies( $group, $post, $context,
|
|
| 844 |
|
| 845 |
/**
|
| 846 |
* Append missing terms from saved filter.
|
| 847 |
-
*
|
| 848 |
* If terms are added in another language and still valid,
|
| 849 |
* append them as 'hidden' fields. That way we keep terms in sync if swithing
|
| 850 |
* languages in admin area.
|
| 851 |
-
*
|
| 852 |
* @global type $wpcf
|
| 853 |
* @param type $form
|
| 854 |
* @param type $settings
|
|
@@ -870,7 +872,7 @@ function wpcf_wpml_group_filter_add_missing_terms( $form, $settings ) {
|
|
| 870 |
}
|
| 871 |
/*
|
| 872 |
* Check if term is filtered out, but existing in saved option
|
| 873 |
-
* and if it's not translated already.
|
| 874 |
*/
|
| 875 |
if ( !isset( $wpcf->wpml->group_form_filter_taxonomies_filtered[$term_taxonomy_id] ) ) {
|
| 876 |
$_add = true;
|
|
@@ -904,7 +906,7 @@ function wpcf_wpml_group_filter_add_missing_terms( $form, $settings ) {
|
|
| 904 |
|
| 905 |
/**
|
| 906 |
* Sync when slug changed.
|
| 907 |
-
*
|
| 908 |
* @global type $sitepress
|
| 909 |
* @global type $sitepress_settings
|
| 910 |
* @param type $new_slug
|
|
@@ -934,7 +936,7 @@ function wpcf_wpml_post_type_renamed( $new_slug, $old_slug ) {
|
|
| 934 |
|
| 935 |
/**
|
| 936 |
* Sync when slug changed.
|
| 937 |
-
*
|
| 938 |
* @global type $sitepress
|
| 939 |
* @global type $sitepress_settings
|
| 940 |
* @param type $new_slug
|
|
@@ -960,7 +962,7 @@ function wpcf_wpml_taxonomy_renamed( $new_slug, $old_slug ) {
|
|
| 960 |
|
| 961 |
/**
|
| 962 |
* Relationship save child language.
|
| 963 |
-
*
|
| 964 |
* @global type $sitepress
|
| 965 |
* @param type $child
|
| 966 |
* @param type $parent
|
|
@@ -977,7 +979,7 @@ function wpcf_wpml_relationship_save_child( $child, $parent ) {
|
|
| 977 |
|
| 978 |
/**
|
| 979 |
* Checks if field is copied on post edit screen.
|
| 980 |
-
*
|
| 981 |
* @global type $sitepress
|
| 982 |
* @param type $field
|
| 983 |
* @param type $post
|
|
@@ -994,7 +996,7 @@ function wpcf_wpml_field_is_copied( $field, $post = null ) {
|
|
| 994 |
|
| 995 |
/**
|
| 996 |
* Checks if field is copied on profile edit screen.
|
| 997 |
-
*
|
| 998 |
* @global type $sitepress
|
| 999 |
* @param type $field
|
| 1000 |
* @return boolean
|
|
@@ -1011,7 +1013,7 @@ function wpcf_wpml_is_translated_profile_page( $field ) {
|
|
| 1011 |
|
| 1012 |
/**
|
| 1013 |
* Checks if field is copied.
|
| 1014 |
-
*
|
| 1015 |
* @param type $field
|
| 1016 |
* @return type
|
| 1017 |
*/
|
|
@@ -1022,7 +1024,7 @@ function wpcf_wpml_field_is_copy( $field ) {
|
|
| 1022 |
|
| 1023 |
/**
|
| 1024 |
* Checks if field is translated.
|
| 1025 |
-
*
|
| 1026 |
* @param type $field
|
| 1027 |
* @return type
|
| 1028 |
*/
|
|
@@ -1033,7 +1035,7 @@ function wpcf_wpml_field_is_translated( $field ) {
|
|
| 1033 |
|
| 1034 |
/**
|
| 1035 |
* Checks if field is ignored.
|
| 1036 |
-
*
|
| 1037 |
* @param type $field
|
| 1038 |
* @return type
|
| 1039 |
*/
|
|
@@ -1044,7 +1046,7 @@ function wpcf_wpml_field_is_ignored( $field ) {
|
|
| 1044 |
|
| 1045 |
/**
|
| 1046 |
* Determine if post is in original language.
|
| 1047 |
-
*
|
| 1048 |
* @global type $sitepress
|
| 1049 |
* @global type $pagenow
|
| 1050 |
* @param type $field
|
|
@@ -1057,7 +1059,7 @@ function wpcf_wpml_post_is_original( $post = null ) {
|
|
| 1057 |
// WPML There is no lang on new post
|
| 1058 |
if ( $pagenow == 'post-new.php' ) {
|
| 1059 |
$post_type = wpcf_admin_get_edited_post_type();
|
| 1060 |
-
$current_lang = isset( $_GET['lang'] ) ? $_GET['lang'] : $sitepress->get_current_language();
|
| 1061 |
if ( in_array( $post_type,
|
| 1062 |
array_keys( $sitepress->get_translatable_documents() ) ) ) {
|
| 1063 |
return $sitepress->get_default_language() == $current_lang;
|
|
@@ -1089,12 +1091,12 @@ function wpcf_wpml_have_original( $post = null ) {
|
|
| 1089 |
static $cache = array();
|
| 1090 |
global $pagenow;
|
| 1091 |
$res = false;
|
| 1092 |
-
|
| 1093 |
// WPML There is no lang on new post
|
| 1094 |
if ( $pagenow == 'post-new.php' ) {
|
| 1095 |
return isset( $_GET['trid'] );
|
| 1096 |
}
|
| 1097 |
-
|
| 1098 |
if ( empty( $post->ID ) ) {
|
| 1099 |
$post = wpcf_admin_get_edited_post();
|
| 1100 |
}
|
|
@@ -1107,11 +1109,17 @@ function wpcf_wpml_have_original( $post = null ) {
|
|
| 1107 |
$post_lang = $sitepress->get_element_language_details( $post->ID,
|
| 1108 |
'post_' . $post->post_type );
|
| 1109 |
if ( isset( $post_lang->language_code ) ) {
|
| 1110 |
-
|
| 1111 |
-
|
| 1112 |
-
|
| 1113 |
-
|
| 1114 |
-
AND
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1115 |
$res = (bool) $wpdb->get_var( $sql );
|
| 1116 |
}
|
| 1117 |
$cache[$cache_key] = $res;
|
|
@@ -1121,7 +1129,7 @@ function wpcf_wpml_have_original( $post = null ) {
|
|
| 1121 |
|
| 1122 |
/**
|
| 1123 |
* Removes temporarily hook to avoid deleting custom fields from translated post.
|
| 1124 |
-
*
|
| 1125 |
* @global type $sitepress
|
| 1126 |
* @param type $post
|
| 1127 |
* @param type $field
|
|
@@ -1135,7 +1143,7 @@ function wpcf_wpml_remove_delete_postmeta_hook_remove( $post, $field ) {
|
|
| 1135 |
|
| 1136 |
/**
|
| 1137 |
* Re-enables hook.
|
| 1138 |
-
*
|
| 1139 |
* @see wpcf_wpml_remove_delete_postmeta_hook_remove()
|
| 1140 |
* @global type $sitepress
|
| 1141 |
* @param type $post
|
|
@@ -1150,7 +1158,7 @@ function wpcf_wpml_remove_delete_postmeta_hook_add( $post, $field ) {
|
|
| 1150 |
|
| 1151 |
/**
|
| 1152 |
* Removes temporarily hook to fix asving repetitive fields.
|
| 1153 |
-
*
|
| 1154 |
* @global type $sitepress
|
| 1155 |
* @param type $post
|
| 1156 |
* @param type $field
|
|
@@ -1169,7 +1177,7 @@ function wpcf_wpml_sync_postmeta_hook_remove( $post, $field ) {
|
|
| 1169 |
|
| 1170 |
/**
|
| 1171 |
* Re-enables hook.
|
| 1172 |
-
*
|
| 1173 |
* @see wpcf_wpml_remove_delete_postmeta_hook_remove()
|
| 1174 |
* @global type $sitepress
|
| 1175 |
* @param type $post
|
|
@@ -1194,7 +1202,7 @@ function wpcf_wpml_warnings_init()
|
|
| 1194 |
* check is configuration done?!
|
| 1195 |
*/
|
| 1196 |
global $sitepress, $sitepress_settings;
|
| 1197 |
-
if ( icl_get_setting('st') ) {
|
| 1198 |
return;
|
| 1199 |
}
|
| 1200 |
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
* @since Types 1.2
|
| 4 |
+
*
|
| 5 |
* All WPML specific functions should be moved here.
|
| 6 |
+
*
|
| 7 |
* Mind wpml_action parameter for field.
|
| 8 |
* Values:
|
| 9 |
* 0 nothing (ignore), 1 copy, 2 translate
|
| 10 |
*
|
| 11 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/includes/wpml.php $
|
| 12 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 13 |
+
* $LastChangedRevision: 1120400 $
|
| 14 |
* $LastChangedBy: iworks $
|
| 15 |
*
|
| 16 |
*/
|
| 33 |
add_filter( 'types_taxonomy', 'wpcf_wpml_taxonomy_translate', 10, 3 );
|
| 34 |
|
| 35 |
/*
|
| 36 |
+
*
|
| 37 |
* Filter terms used when:
|
| 38 |
* - Displaying Group form
|
| 39 |
* - Filtering Group on post edit screen
|
| 73 |
'wpcf_wpml_sync_postmeta_hook_add', 10, 2 );
|
| 74 |
add_action( 'wpcf_postmeta_after_add_repetitive',
|
| 75 |
'wpcf_wpml_sync_postmeta_hook_add', 10, 2 );
|
| 76 |
+
|
| 77 |
// Fix to set correct parent and children for duplicated posts
|
| 78 |
add_action( 'icl_make_duplicate', 'wpcf_wpml_duplicated_post_relationships',
|
| 79 |
20, 4);
|
| 81 |
|
| 82 |
/**
|
| 83 |
* Adds wpml_action property.
|
| 84 |
+
*
|
| 85 |
* @param type $fields
|
| 86 |
* @return array
|
| 87 |
*/
|
| 94 |
|
| 95 |
/**
|
| 96 |
* Adds wpml_action property.
|
| 97 |
+
*
|
| 98 |
* @global type $iclTranslationManagement
|
| 99 |
* @param type $field
|
| 100 |
* @return array
|
| 129 |
|
| 130 |
/**
|
| 131 |
* Returns WPML action by field type.
|
| 132 |
+
*
|
| 133 |
* @param type $type
|
| 134 |
* @return type
|
| 135 |
*/
|
| 151 |
|
| 152 |
/**
|
| 153 |
* WPML translate call.
|
| 154 |
+
*
|
| 155 |
* @param type $name
|
| 156 |
* @param type $string
|
| 157 |
+
* @return type
|
| 158 |
*/
|
| 159 |
function wpcf_translate( $name, $string, $context = 'plugin Types' ) {
|
| 160 |
if ( !function_exists( 'icl_t' ) || !is_string($string) || empty($string) ) {
|
| 165 |
|
| 166 |
/**
|
| 167 |
* Registers WPML translation string.
|
| 168 |
+
*
|
| 169 |
* @param type $context
|
| 170 |
* @param type $name
|
| 171 |
+
* @param type $value
|
| 172 |
*/
|
| 173 |
function wpcf_translate_register_string( $context, $name, $value,
|
| 174 |
$allow_empty_value = false ) {
|
| 180 |
|
| 181 |
/**
|
| 182 |
* Relationship filter get_children query.
|
| 183 |
+
*
|
| 184 |
* @param type $_query string for get_posts()
|
| 185 |
* @param type $parent Parent
|
| 186 |
* @param type $post_type Children post type
|
| 202 |
|
| 203 |
/**
|
| 204 |
* WPML editor filter
|
| 205 |
+
*
|
| 206 |
* @param type $cf_name
|
| 207 |
+
* @return type
|
| 208 |
*/
|
| 209 |
function wpcf_icl_editor_cf_name_filter( $cf_name ) {
|
| 210 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 225 |
|
| 226 |
/**
|
| 227 |
* WPML editor filter
|
| 228 |
+
*
|
| 229 |
* @param type $cf_name
|
| 230 |
* @param type $description
|
| 231 |
+
* @return type
|
| 232 |
*/
|
| 233 |
function wpcf_icl_editor_cf_description_filter( $description, $cf_name ) {
|
| 234 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 250 |
|
| 251 |
/**
|
| 252 |
* WPML editor filter
|
| 253 |
+
*
|
| 254 |
* @param type $cf_name
|
| 255 |
* @param type $style
|
| 256 |
+
* @return type
|
| 257 |
*/
|
| 258 |
function wpcf_icl_editor_cf_style_filter( $style, $cf_name ) {
|
| 259 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 278 |
}
|
| 279 |
|
| 280 |
/**
|
| 281 |
+
* Bulk translation.
|
| 282 |
*/
|
| 283 |
function wpcf_admin_bulk_string_translation() {
|
| 284 |
if ( !function_exists( 'icl_register_string' ) ) {
|
| 412 |
|
| 413 |
global $wpdb;
|
| 414 |
|
| 415 |
+
$query = sprintf(
|
| 416 |
+
'SELECT post_id FROM %s WHERE meta_key= %%s AND meta_value= %%d',
|
| 417 |
+
$wpdb->postmeta
|
| 418 |
+
);
|
| 419 |
+
$original_children = $wpdb->get_col( $wpdb->prepare( $query, $meta_key, $original_post_id ) );
|
| 420 |
|
| 421 |
foreach ( $original_children as $child_id ) {
|
| 422 |
|
| 485 |
|
| 486 |
/**
|
| 487 |
* Returns translated '_wpcf_belongs_XXX_id' if any.
|
| 488 |
+
*
|
| 489 |
* @global type $sitepress
|
| 490 |
* @param type $value
|
| 491 |
* @param type $object_id
|
| 492 |
* @param type $meta_key
|
| 493 |
* @param type $single
|
| 494 |
+
* @return type
|
| 495 |
*/
|
| 496 |
function wpcf_wpml_relationship_meta_belongs_filter( $value, $object_id,
|
| 497 |
$meta_key, $single ) {
|
| 522 |
} else {
|
| 523 |
$value = array($meta_translated_id);
|
| 524 |
}
|
| 525 |
+
|
| 526 |
}
|
| 527 |
}
|
| 528 |
}
|
| 534 |
|
| 535 |
/**
|
| 536 |
* Adjust translated IDs.
|
| 537 |
+
*
|
| 538 |
* @global type $sitepress
|
| 539 |
* @param type $parent_post_id
|
| 540 |
*/
|
| 586 |
|
| 587 |
/**
|
| 588 |
* Registers translation data.
|
| 589 |
+
*
|
| 590 |
* @param type $post_type
|
| 591 |
+
* @param type $data
|
| 592 |
*/
|
| 593 |
function wpcf_custom_types_register_translation( $post_type, $data ) {
|
| 594 |
if ( !function_exists( 'icl_register_string' ) ) {
|
| 603 |
|
| 604 |
/**
|
| 605 |
* Registers translation data.
|
| 606 |
+
*
|
| 607 |
* @param type $post_type
|
| 608 |
+
* @param type $data
|
| 609 |
*/
|
| 610 |
function wpcf_custom_taxonimies_register_translation( $taxonomy, $data ) {
|
| 611 |
if ( !function_exists( 'icl_register_string' ) ) {
|
| 620 |
|
| 621 |
/**
|
| 622 |
* Registers labels.
|
| 623 |
+
*
|
| 624 |
* @param type $prefix
|
| 625 |
* @param type $data
|
| 626 |
* @param type $context
|
| 670 |
|
| 671 |
/**
|
| 672 |
* Translates data.
|
| 673 |
+
*
|
| 674 |
* @param type $post_type
|
| 675 |
+
* @param type $data
|
| 676 |
*/
|
| 677 |
function wpcf_wpml_post_types_translate( $data, $post_type ) {
|
| 678 |
if ( !function_exists( 'icl_t' ) ) {
|
| 702 |
|
| 703 |
/**
|
| 704 |
* Translates data.
|
| 705 |
+
*
|
| 706 |
* @param type $taxonomy
|
| 707 |
+
* @param type $data
|
| 708 |
*/
|
| 709 |
function wpcf_wpml_taxonomy_translate( $data, $taxonomy ) {
|
| 710 |
if ( !function_exists( 'icl_t' ) ) {
|
| 734 |
|
| 735 |
/**
|
| 736 |
* Filters terms on Group form filter.
|
| 737 |
+
*
|
| 738 |
* Do not complicate this, just replace term ID
|
| 739 |
* with corresponding original ID.
|
| 740 |
+
*
|
| 741 |
* @param array $terms array of terms objects.
|
| 742 |
* @return array
|
| 743 |
*/
|
| 760 |
// Only if translation found
|
| 761 |
if ( $term->term_id != $original_term_id ) {
|
| 762 |
/*
|
| 763 |
+
*
|
| 764 |
* Note that WPML will return term_id.
|
| 765 |
*/
|
| 766 |
$_term = $wpdb->get_row( $wpdb->prepare( "SELECT t.*, tt.* FROM $wpdb->terms AS t INNER JOIN $wpdb->term_taxonomy AS tt ON t.term_id = tt.term_id WHERE tt.taxonomy = %s AND t.term_id = %d LIMIT 1",
|
| 793 |
|
| 794 |
/**
|
| 795 |
* Adjusts term_id in group filter in post edit screen.
|
| 796 |
+
*
|
| 797 |
* @global type $sitepress
|
| 798 |
+
* @global object $wpdb
|
| 799 |
* @param type $group
|
| 800 |
* @return type
|
| 801 |
*/
|
| 846 |
|
| 847 |
/**
|
| 848 |
* Append missing terms from saved filter.
|
| 849 |
+
*
|
| 850 |
* If terms are added in another language and still valid,
|
| 851 |
* append them as 'hidden' fields. That way we keep terms in sync if swithing
|
| 852 |
* languages in admin area.
|
| 853 |
+
*
|
| 854 |
* @global type $wpcf
|
| 855 |
* @param type $form
|
| 856 |
* @param type $settings
|
| 872 |
}
|
| 873 |
/*
|
| 874 |
* Check if term is filtered out, but existing in saved option
|
| 875 |
+
* and if it's not translated already.
|
| 876 |
*/
|
| 877 |
if ( !isset( $wpcf->wpml->group_form_filter_taxonomies_filtered[$term_taxonomy_id] ) ) {
|
| 878 |
$_add = true;
|
| 906 |
|
| 907 |
/**
|
| 908 |
* Sync when slug changed.
|
| 909 |
+
*
|
| 910 |
* @global type $sitepress
|
| 911 |
* @global type $sitepress_settings
|
| 912 |
* @param type $new_slug
|
| 936 |
|
| 937 |
/**
|
| 938 |
* Sync when slug changed.
|
| 939 |
+
*
|
| 940 |
* @global type $sitepress
|
| 941 |
* @global type $sitepress_settings
|
| 942 |
* @param type $new_slug
|
| 962 |
|
| 963 |
/**
|
| 964 |
* Relationship save child language.
|
| 965 |
+
*
|
| 966 |
* @global type $sitepress
|
| 967 |
* @param type $child
|
| 968 |
* @param type $parent
|
| 979 |
|
| 980 |
/**
|
| 981 |
* Checks if field is copied on post edit screen.
|
| 982 |
+
*
|
| 983 |
* @global type $sitepress
|
| 984 |
* @param type $field
|
| 985 |
* @param type $post
|
| 996 |
|
| 997 |
/**
|
| 998 |
* Checks if field is copied on profile edit screen.
|
| 999 |
+
*
|
| 1000 |
* @global type $sitepress
|
| 1001 |
* @param type $field
|
| 1002 |
* @return boolean
|
| 1013 |
|
| 1014 |
/**
|
| 1015 |
* Checks if field is copied.
|
| 1016 |
+
*
|
| 1017 |
* @param type $field
|
| 1018 |
* @return type
|
| 1019 |
*/
|
| 1024 |
|
| 1025 |
/**
|
| 1026 |
* Checks if field is translated.
|
| 1027 |
+
*
|
| 1028 |
* @param type $field
|
| 1029 |
* @return type
|
| 1030 |
*/
|
| 1035 |
|
| 1036 |
/**
|
| 1037 |
* Checks if field is ignored.
|
| 1038 |
+
*
|
| 1039 |
* @param type $field
|
| 1040 |
* @return type
|
| 1041 |
*/
|
| 1046 |
|
| 1047 |
/**
|
| 1048 |
* Determine if post is in original language.
|
| 1049 |
+
*
|
| 1050 |
* @global type $sitepress
|
| 1051 |
* @global type $pagenow
|
| 1052 |
* @param type $field
|
| 1059 |
// WPML There is no lang on new post
|
| 1060 |
if ( $pagenow == 'post-new.php' ) {
|
| 1061 |
$post_type = wpcf_admin_get_edited_post_type();
|
| 1062 |
+
$current_lang = isset( $_GET['lang'] ) ? sanitize_text_field( $_GET['lang'] ) : $sitepress->get_current_language();
|
| 1063 |
if ( in_array( $post_type,
|
| 1064 |
array_keys( $sitepress->get_translatable_documents() ) ) ) {
|
| 1065 |
return $sitepress->get_default_language() == $current_lang;
|
| 1091 |
static $cache = array();
|
| 1092 |
global $pagenow;
|
| 1093 |
$res = false;
|
| 1094 |
+
|
| 1095 |
// WPML There is no lang on new post
|
| 1096 |
if ( $pagenow == 'post-new.php' ) {
|
| 1097 |
return isset( $_GET['trid'] );
|
| 1098 |
}
|
| 1099 |
+
|
| 1100 |
if ( empty( $post->ID ) ) {
|
| 1101 |
$post = wpcf_admin_get_edited_post();
|
| 1102 |
}
|
| 1109 |
$post_lang = $sitepress->get_element_language_details( $post->ID,
|
| 1110 |
'post_' . $post->post_type );
|
| 1111 |
if ( isset( $post_lang->language_code ) ) {
|
| 1112 |
+
|
| 1113 |
+
$sql = $wpdb->prepare(
|
| 1114 |
+
"SELECT trid FROM {$wpdb->prefix}icl_translations
|
| 1115 |
+
WHERE language_code = %s
|
| 1116 |
+
AND element_id = %d
|
| 1117 |
+
AND element_type = %s
|
| 1118 |
+
AND source_language_code IS NOT NULL",
|
| 1119 |
+
$post_lang->language_code,
|
| 1120 |
+
$post->ID,
|
| 1121 |
+
sprintf('post_%s', $post->post_type)
|
| 1122 |
+
);
|
| 1123 |
$res = (bool) $wpdb->get_var( $sql );
|
| 1124 |
}
|
| 1125 |
$cache[$cache_key] = $res;
|
| 1129 |
|
| 1130 |
/**
|
| 1131 |
* Removes temporarily hook to avoid deleting custom fields from translated post.
|
| 1132 |
+
*
|
| 1133 |
* @global type $sitepress
|
| 1134 |
* @param type $post
|
| 1135 |
* @param type $field
|
| 1143 |
|
| 1144 |
/**
|
| 1145 |
* Re-enables hook.
|
| 1146 |
+
*
|
| 1147 |
* @see wpcf_wpml_remove_delete_postmeta_hook_remove()
|
| 1148 |
* @global type $sitepress
|
| 1149 |
* @param type $post
|
| 1158 |
|
| 1159 |
/**
|
| 1160 |
* Removes temporarily hook to fix asving repetitive fields.
|
| 1161 |
+
*
|
| 1162 |
* @global type $sitepress
|
| 1163 |
* @param type $post
|
| 1164 |
* @param type $field
|
| 1177 |
|
| 1178 |
/**
|
| 1179 |
* Re-enables hook.
|
| 1180 |
+
*
|
| 1181 |
* @see wpcf_wpml_remove_delete_postmeta_hook_remove()
|
| 1182 |
* @global type $sitepress
|
| 1183 |
* @param type $post
|
| 1202 |
* check is configuration done?!
|
| 1203 |
*/
|
| 1204 |
global $sitepress, $sitepress_settings;
|
| 1205 |
+
if ( function_exists('icl_get_setting') && icl_get_setting('st') ) {
|
| 1206 |
return;
|
| 1207 |
}
|
| 1208 |
|
embedded/models/relationship.php
CHANGED
|
@@ -8,8 +8,9 @@ class WPCF_Relationship_Model
|
|
| 8 |
|
| 9 |
/**
|
| 10 |
* Fetch children by post type.
|
| 11 |
-
*
|
| 12 |
-
* @global
|
|
|
|
| 13 |
* @param type $post
|
| 14 |
* @param type $post_type
|
| 15 |
* @param string $data
|
|
@@ -17,8 +18,9 @@ class WPCF_Relationship_Model
|
|
| 17 |
* @param array $user_query - Override default query
|
| 18 |
* @return type
|
| 19 |
*/
|
| 20 |
-
public static function getChildrenByPostType( $post, $post_type, $data,
|
| 21 |
-
|
|
|
|
| 22 |
if ( empty( $post->ID ) ) {
|
| 23 |
return array();
|
| 24 |
}
|
|
@@ -28,15 +30,16 @@ class WPCF_Relationship_Model
|
|
| 28 |
$items = array();
|
| 29 |
|
| 30 |
// Merge with user query
|
| 31 |
-
$query = wp_parse_args(
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
|
|
|
| 40 |
);
|
| 41 |
|
| 42 |
// Cleanup data
|
|
@@ -49,9 +52,12 @@ class WPCF_Relationship_Model
|
|
| 49 |
|
| 50 |
// Set sorting
|
| 51 |
$query['order'] = esc_attr( strtoupper( strval( $params['sort'] ) ) );
|
|
|
|
|
|
|
|
|
|
| 52 |
|
| 53 |
/*
|
| 54 |
-
*
|
| 55 |
* Order by title
|
| 56 |
*/
|
| 57 |
if ( $params['field'] == '_wp_title' ) {
|
|
@@ -61,7 +67,7 @@ class WPCF_Relationship_Model
|
|
| 61 |
esc_attr( $params['field'] ) );
|
| 62 |
$items = get_posts( $query );
|
| 63 |
/*
|
| 64 |
-
*
|
| 65 |
* Order by parents
|
| 66 |
*/
|
| 67 |
} else if ( $params['field'] == '_wpcf_pr_parent' ) {
|
|
@@ -98,7 +104,7 @@ class WPCF_Relationship_Model
|
|
| 98 |
}
|
| 99 |
}
|
| 100 |
/*
|
| 101 |
-
*
|
| 102 |
* Order by body
|
| 103 |
*/
|
| 104 |
} else if ( $params['field'] == '_wp_body' ) {
|
|
@@ -107,9 +113,8 @@ class WPCF_Relationship_Model
|
|
| 107 |
FROM $wpdb->posts p
|
| 108 |
WHERE p.post_type = %s
|
| 109 |
AND p.post_status NOT IN ('auto-draft', 'trash', 'inherit')
|
| 110 |
-
ORDER BY p.post_content " . $query['order'];
|
| 111 |
-
$sorted = $wpdb->get_results( $wpdb->prepare( $_query,
|
| 112 |
-
$post_type ) );
|
| 113 |
if ( !empty( $sorted ) ) {
|
| 114 |
$query['orderby'] = 'post__in';
|
| 115 |
foreach ( $sorted as $key => $value ) {
|
|
@@ -121,8 +126,8 @@ class WPCF_Relationship_Model
|
|
| 121 |
esc_attr( $params['field'] ) );
|
| 122 |
$items = get_posts( $query );
|
| 123 |
/*
|
| 124 |
-
*
|
| 125 |
-
*
|
| 126 |
* Order by custom field
|
| 127 |
*/
|
| 128 |
} else {
|
|
@@ -175,18 +180,15 @@ class WPCF_Relationship_Model
|
|
| 175 |
}
|
| 176 |
}
|
| 177 |
}
|
| 178 |
-
|
| 179 |
-
*
|
| 180 |
-
*
|
| 181 |
* Regular
|
|
|
|
| 182 |
*/
|
| 183 |
} else {
|
| 184 |
-
$query = apply_filters( 'wpcf_relationship_get_children_query',
|
| 185 |
-
$query, $post, $post_type, $data );
|
| 186 |
$items = get_posts( $query );
|
| 187 |
}
|
| 188 |
-
|
| 189 |
return $items;
|
| 190 |
}
|
| 191 |
-
|
| 192 |
-
}
|
| 8 |
|
| 9 |
/**
|
| 10 |
* Fetch children by post type.
|
| 11 |
+
*
|
| 12 |
+
* @global object $wpdb
|
| 13 |
+
*
|
| 14 |
* @param type $post
|
| 15 |
* @param type $post_type
|
| 16 |
* @param string $data
|
| 18 |
* @param array $user_query - Override default query
|
| 19 |
* @return type
|
| 20 |
*/
|
| 21 |
+
public static function getChildrenByPostType( $post, $post_type, $data, $params = array(), $user_query = array() )
|
| 22 |
+
{
|
| 23 |
+
|
| 24 |
if ( empty( $post->ID ) ) {
|
| 25 |
return array();
|
| 26 |
}
|
| 30 |
$items = array();
|
| 31 |
|
| 32 |
// Merge with user query
|
| 33 |
+
$query = wp_parse_args(
|
| 34 |
+
$user_query,
|
| 35 |
+
array(
|
| 36 |
+
'post_type' => $post_type,
|
| 37 |
+
'numberposts' => -1,
|
| 38 |
+
'post_status' => array('publish', 'pending', 'draft', 'future', 'private'),
|
| 39 |
+
'meta_key' => '_wpcf_belongs_' . $post->post_type . '_id',
|
| 40 |
+
'meta_value' => $post->ID,
|
| 41 |
+
'suppress_filters' => 0,
|
| 42 |
+
)
|
| 43 |
);
|
| 44 |
|
| 45 |
// Cleanup data
|
| 52 |
|
| 53 |
// Set sorting
|
| 54 |
$query['order'] = esc_attr( strtoupper( strval( $params['sort'] ) ) );
|
| 55 |
+
if ( !preg_match('/^(A|DE)SC$/', $query['order']) ) {
|
| 56 |
+
$query['order'] = 'ASC';
|
| 57 |
+
}
|
| 58 |
|
| 59 |
/*
|
| 60 |
+
*
|
| 61 |
* Order by title
|
| 62 |
*/
|
| 63 |
if ( $params['field'] == '_wp_title' ) {
|
| 67 |
esc_attr( $params['field'] ) );
|
| 68 |
$items = get_posts( $query );
|
| 69 |
/*
|
| 70 |
+
*
|
| 71 |
* Order by parents
|
| 72 |
*/
|
| 73 |
} else if ( $params['field'] == '_wpcf_pr_parent' ) {
|
| 104 |
}
|
| 105 |
}
|
| 106 |
/*
|
| 107 |
+
*
|
| 108 |
* Order by body
|
| 109 |
*/
|
| 110 |
} else if ( $params['field'] == '_wp_body' ) {
|
| 113 |
FROM $wpdb->posts p
|
| 114 |
WHERE p.post_type = %s
|
| 115 |
AND p.post_status NOT IN ('auto-draft', 'trash', 'inherit')
|
| 116 |
+
ORDER BY p.post_content " . ( ( 'ASC' == $query['order'] ) ? 'ASC' : 'DESC' );
|
| 117 |
+
$sorted = $wpdb->get_results( $wpdb->prepare( $_query, $post_type ) );
|
|
|
|
| 118 |
if ( !empty( $sorted ) ) {
|
| 119 |
$query['orderby'] = 'post__in';
|
| 120 |
foreach ( $sorted as $key => $value ) {
|
| 126 |
esc_attr( $params['field'] ) );
|
| 127 |
$items = get_posts( $query );
|
| 128 |
/*
|
| 129 |
+
*
|
| 130 |
+
*
|
| 131 |
* Order by custom field
|
| 132 |
*/
|
| 133 |
} else {
|
| 180 |
}
|
| 181 |
}
|
| 182 |
}
|
| 183 |
+
/**
|
| 184 |
+
*
|
|
|
|
| 185 |
* Regular
|
| 186 |
+
*
|
| 187 |
*/
|
| 188 |
} else {
|
| 189 |
+
$query = apply_filters( 'wpcf_relationship_get_children_query', $query, $post, $post_type, $data );
|
|
|
|
| 190 |
$items = get_posts( $query );
|
| 191 |
}
|
|
|
|
| 192 |
return $items;
|
| 193 |
}
|
| 194 |
+
}
|
|
|
embedded/onthego-resources/loader.php
CHANGED
|
@@ -51,14 +51,13 @@ if( !function_exists('on_the_go_systems_branding_plugins_loaded') ) {
|
|
| 51 |
$latest = $key;
|
| 52 |
}
|
| 53 |
}
|
| 54 |
-
|
| 55 |
if ($latest > 0) {
|
| 56 |
require_once $onthegosystems_branding_paths[$latest]['path'] . '/onthegosystems-branding-loader.php';
|
| 57 |
ont_set_on_the_go_systems_uri_and_start( $onthegosystems_branding_paths[$latest]['url'] );
|
| 58 |
}
|
| 59 |
}
|
| 60 |
|
| 61 |
-
add_action( '
|
| 62 |
}
|
| 63 |
|
| 64 |
if( !function_exists('onthego_initialize') ) {
|
| 51 |
$latest = $key;
|
| 52 |
}
|
| 53 |
}
|
|
|
|
| 54 |
if ($latest > 0) {
|
| 55 |
require_once $onthegosystems_branding_paths[$latest]['path'] . '/onthegosystems-branding-loader.php';
|
| 56 |
ont_set_on_the_go_systems_uri_and_start( $onthegosystems_branding_paths[$latest]['url'] );
|
| 57 |
}
|
| 58 |
}
|
| 59 |
|
| 60 |
+
add_action( 'after_setup_theme', 'on_the_go_systems_branding_plugins_loaded');
|
| 61 |
}
|
| 62 |
|
| 63 |
if( !function_exists('onthego_initialize') ) {
|
embedded/onthego-resources/onthego-styles/onthego-admin-styles.css
CHANGED
|
@@ -11,6 +11,7 @@ li#toplevel_page_dd_layouts div.wp-menu-image:before, li#toplevel_page_dd_layout
|
|
| 11 |
padding-left: 3px;
|
| 12 |
padding-top: 5px; }
|
| 13 |
|
|
|
|
| 14 |
li#toplevel_page_views div.wp-menu-image:before {
|
| 15 |
font-family: "onthegosystems-icons"!important;
|
| 16 |
content: "\f11e";
|
|
@@ -59,6 +60,14 @@ li#toplevel_page_CRED_Commerce div.wp-menu-image:before {
|
|
| 59 |
padding-left: 3px;
|
| 60 |
padding-top: 3px; }
|
| 61 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 62 |
/* POST EDIT PAGE SHORT TAGS BUTTONS ICONS */
|
| 63 |
#wp-content-editor-tools [class^="icon-"] {
|
| 64 |
color: #888;
|
| 11 |
padding-left: 3px;
|
| 12 |
padding-top: 5px; }
|
| 13 |
|
| 14 |
+
li#toplevel_page_embedded-views div.wp-menu-image:before,
|
| 15 |
li#toplevel_page_views div.wp-menu-image:before {
|
| 16 |
font-family: "onthegosystems-icons"!important;
|
| 17 |
content: "\f11e";
|
| 60 |
padding-left: 3px;
|
| 61 |
padding-top: 3px; }
|
| 62 |
|
| 63 |
+
li#toplevel_page_toolset-packager div.wp-menu-image:before {
|
| 64 |
+
font-family: "onthegosystems-icons"!important;
|
| 65 |
+
content: "\f121";
|
| 66 |
+
font-size: 23px!important;
|
| 67 |
+
width: 30px;
|
| 68 |
+
padding-left: 3px;
|
| 69 |
+
padding-top: 3px; }
|
| 70 |
+
|
| 71 |
/* POST EDIT PAGE SHORT TAGS BUTTONS ICONS */
|
| 72 |
#wp-content-editor-tools [class^="icon-"] {
|
| 73 |
color: #888;
|
embedded/onthego-resources/onthego-styles/onthego-colors.css
CHANGED
|
@@ -5,7 +5,7 @@ This file is a collection of generic colors used in our styles
|
|
| 5 |
color: #444444; }
|
| 6 |
|
| 7 |
.ont-color-orange {
|
| 8 |
-
color: #
|
| 9 |
|
| 10 |
.ont-color-gray {
|
| 11 |
color: #888; }
|
| 5 |
color: #444444; }
|
| 6 |
|
| 7 |
.ont-color-orange {
|
| 8 |
+
color: #f05a28; }
|
| 9 |
|
| 10 |
.ont-color-gray {
|
| 11 |
color: #888; }
|
embedded/onthego-resources/onthegosystems-icons/.fontcustom-manifest.json
CHANGED
|
@@ -1,13 +1,13 @@
|
|
| 1 |
{
|
| 2 |
"checksum": {
|
| 3 |
-
"previous": "
|
| 4 |
-
"current": "
|
| 5 |
},
|
| 6 |
"fonts": [
|
| 7 |
-
"fonts/onthegosystems-
|
| 8 |
-
"fonts/onthegosystems-
|
| 9 |
-
"fonts/onthegosystems-
|
| 10 |
-
"fonts/onthegosystems-
|
| 11 |
],
|
| 12 |
"glyphs": {
|
| 13 |
"access": {
|
|
@@ -50,6 +50,14 @@
|
|
| 50 |
"codepoint": 61721,
|
| 51 |
"source": "vectors/module-logo.svg"
|
| 52 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 53 |
"toolset-logo": {
|
| 54 |
"codepoint": 61722,
|
| 55 |
"source": "vectors/toolset-logo.svg"
|
|
@@ -72,37 +80,37 @@
|
|
| 72 |
},
|
| 73 |
"wpml-logo": {
|
| 74 |
"codepoint": 61727,
|
| 75 |
-
"source": "vectors/wpml
|
| 76 |
}
|
| 77 |
},
|
| 78 |
"options": {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 79 |
"input": {
|
| 80 |
-
"
|
| 81 |
-
"
|
| 82 |
},
|
|
|
|
| 83 |
"output": {
|
| 84 |
-
"fonts": "fonts",
|
| 85 |
"css": "css",
|
|
|
|
| 86 |
"preview": "fonts"
|
| 87 |
},
|
| 88 |
-
"config": "fontcustom.yml",
|
| 89 |
-
"templates": [
|
| 90 |
-
"css",
|
| 91 |
-
"scss",
|
| 92 |
-
"preview"
|
| 93 |
-
],
|
| 94 |
-
"font_name": "onthegosystems-icons",
|
| 95 |
-
"css_selector": ".icon-{{glyph}}",
|
| 96 |
"preprocessor_path": null,
|
| 97 |
-
"autowidth": false,
|
| 98 |
-
"no_hash": false,
|
| 99 |
-
"debug": false,
|
| 100 |
-
"force": false,
|
| 101 |
-
"quiet": false,
|
| 102 |
"project_root": {
|
| 103 |
"pwd": null
|
| 104 |
},
|
| 105 |
-
"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 106 |
},
|
| 107 |
"templates": [
|
| 108 |
"css/onthegosystems-icons.css",
|
| 1 |
{
|
| 2 |
"checksum": {
|
| 3 |
+
"previous": "ea0d501b723f7b75d3147cf08210b5cf2c0c279dff82e74a178b3badd9bf0318",
|
| 4 |
+
"current": "ea0d501b723f7b75d3147cf08210b5cf2c0c279dff82e74a178b3badd9bf0318"
|
| 5 |
},
|
| 6 |
"fonts": [
|
| 7 |
+
"fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf",
|
| 8 |
+
"fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg",
|
| 9 |
+
"fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff",
|
| 10 |
+
"fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot"
|
| 11 |
],
|
| 12 |
"glyphs": {
|
| 13 |
"access": {
|
| 50 |
"codepoint": 61721,
|
| 51 |
"source": "vectors/module-logo.svg"
|
| 52 |
},
|
| 53 |
+
"packager": {
|
| 54 |
+
"codepoint": 61728,
|
| 55 |
+
"source": "vectors/packager.svg"
|
| 56 |
+
},
|
| 57 |
+
"packager-logo": {
|
| 58 |
+
"codepoint": 61729,
|
| 59 |
+
"source": "vectors/packager-logo.svg"
|
| 60 |
+
},
|
| 61 |
"toolset-logo": {
|
| 62 |
"codepoint": 61722,
|
| 63 |
"source": "vectors/toolset-logo.svg"
|
| 80 |
},
|
| 81 |
"wpml-logo": {
|
| 82 |
"codepoint": 61727,
|
| 83 |
+
"source": "vectors/wpml-logo.svg"
|
| 84 |
}
|
| 85 |
},
|
| 86 |
"options": {
|
| 87 |
+
"autowidth": false,
|
| 88 |
+
"config": "fontcustom.yml",
|
| 89 |
+
"css_selector": ".icon-{{glyph}}",
|
| 90 |
+
"debug": false,
|
| 91 |
+
"file_hash": false,
|
| 92 |
+
"font_name": "onthegosystems-icons",
|
| 93 |
+
"force": false,
|
| 94 |
"input": {
|
| 95 |
+
"templates": "vectors",
|
| 96 |
+
"vectors": "vectors"
|
| 97 |
},
|
| 98 |
+
"no_hash": false,
|
| 99 |
"output": {
|
|
|
|
| 100 |
"css": "css",
|
| 101 |
+
"fonts": "fonts",
|
| 102 |
"preview": "fonts"
|
| 103 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 104 |
"preprocessor_path": null,
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 105 |
"project_root": {
|
| 106 |
"pwd": null
|
| 107 |
},
|
| 108 |
+
"quiet": false,
|
| 109 |
+
"templates": [
|
| 110 |
+
"css",
|
| 111 |
+
"scss",
|
| 112 |
+
"preview"
|
| 113 |
+
]
|
| 114 |
},
|
| 115 |
"templates": [
|
| 116 |
"css/onthegosystems-icons.css",
|
embedded/onthego-resources/onthegosystems-icons/css/_onthegosystems-icons.scss
CHANGED
|
@@ -4,11 +4,11 @@
|
|
| 4 |
|
| 5 |
@font-face {
|
| 6 |
font-family: "onthegosystems-icons";
|
| 7 |
-
src: font-url("../fonts/onthegosystems-
|
| 8 |
-
src: font-url("../fonts/onthegosystems-
|
| 9 |
-
font-url("../fonts/onthegosystems-
|
| 10 |
-
font-url("../fonts/onthegosystems-
|
| 11 |
-
font-url("../fonts/onthegosystems-
|
| 12 |
font-weight: normal;
|
| 13 |
font-style: normal;
|
| 14 |
}
|
|
@@ -16,7 +16,7 @@
|
|
| 16 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 17 |
@font-face {
|
| 18 |
font-family: "onthegosystems-icons";
|
| 19 |
-
src: font-url("../fonts/onthegosystems-
|
| 20 |
}
|
| 21 |
}
|
| 22 |
|
|
@@ -33,6 +33,8 @@
|
|
| 33 |
.icon-layouts-logo:before,
|
| 34 |
.icon-module:before,
|
| 35 |
.icon-module-logo:before,
|
|
|
|
|
|
|
| 36 |
.icon-toolset-logo:before,
|
| 37 |
.icon-types:before,
|
| 38 |
.icon-types-logo:before,
|
|
@@ -63,6 +65,8 @@
|
|
| 63 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 64 |
.icon-module:before { content: "\f118"; }
|
| 65 |
.icon-module-logo:before { content: "\f119"; }
|
|
|
|
|
|
|
| 66 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 67 |
.icon-types:before { content: "\f11b"; }
|
| 68 |
.icon-types-logo:before { content: "\f11c"; }
|
| 4 |
|
| 5 |
@font-face {
|
| 6 |
font-family: "onthegosystems-icons";
|
| 7 |
+
src: font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot");
|
| 8 |
+
src: font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot?#iefix") format("embedded-opentype"),
|
| 9 |
+
font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff") format("woff"),
|
| 10 |
+
font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf") format("truetype"),
|
| 11 |
+
font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 12 |
font-weight: normal;
|
| 13 |
font-style: normal;
|
| 14 |
}
|
| 16 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 17 |
@font-face {
|
| 18 |
font-family: "onthegosystems-icons";
|
| 19 |
+
src: font-url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 20 |
}
|
| 21 |
}
|
| 22 |
|
| 33 |
.icon-layouts-logo:before,
|
| 34 |
.icon-module:before,
|
| 35 |
.icon-module-logo:before,
|
| 36 |
+
.icon-packager:before,
|
| 37 |
+
.icon-packager-logo:before,
|
| 38 |
.icon-toolset-logo:before,
|
| 39 |
.icon-types:before,
|
| 40 |
.icon-types-logo:before,
|
| 65 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 66 |
.icon-module:before { content: "\f118"; }
|
| 67 |
.icon-module-logo:before { content: "\f119"; }
|
| 68 |
+
.icon-packager:before { content: "\f120"; }
|
| 69 |
+
.icon-packager-logo:before { content: "\f121"; }
|
| 70 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 71 |
.icon-types:before { content: "\f11b"; }
|
| 72 |
.icon-types-logo:before { content: "\f11c"; }
|
embedded/onthego-resources/onthegosystems-icons/css/onthegosystems-icons.css
CHANGED
|
@@ -4,11 +4,11 @@
|
|
| 4 |
|
| 5 |
@font-face {
|
| 6 |
font-family: "onthegosystems-icons";
|
| 7 |
-
src: url("../fonts/onthegosystems-
|
| 8 |
-
src: url("../fonts/onthegosystems-
|
| 9 |
-
url("../fonts/onthegosystems-
|
| 10 |
-
url("../fonts/onthegosystems-
|
| 11 |
-
url("../fonts/onthegosystems-
|
| 12 |
font-weight: normal;
|
| 13 |
font-style: normal;
|
| 14 |
}
|
|
@@ -16,7 +16,7 @@
|
|
| 16 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 17 |
@font-face {
|
| 18 |
font-family: "onthegosystems-icons";
|
| 19 |
-
src: url("../fonts/onthegosystems-
|
| 20 |
}
|
| 21 |
}
|
| 22 |
|
|
@@ -33,6 +33,8 @@
|
|
| 33 |
.icon-layouts-logo:before,
|
| 34 |
.icon-module:before,
|
| 35 |
.icon-module-logo:before,
|
|
|
|
|
|
|
| 36 |
.icon-toolset-logo:before,
|
| 37 |
.icon-types:before,
|
| 38 |
.icon-types-logo:before,
|
|
@@ -63,6 +65,8 @@
|
|
| 63 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 64 |
.icon-module:before { content: "\f118"; }
|
| 65 |
.icon-module-logo:before { content: "\f119"; }
|
|
|
|
|
|
|
| 66 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 67 |
.icon-types:before { content: "\f11b"; }
|
| 68 |
.icon-types-logo:before { content: "\f11c"; }
|
| 4 |
|
| 5 |
@font-face {
|
| 6 |
font-family: "onthegosystems-icons";
|
| 7 |
+
src: url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot");
|
| 8 |
+
src: url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot?#iefix") format("embedded-opentype"),
|
| 9 |
+
url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff") format("woff"),
|
| 10 |
+
url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf") format("truetype"),
|
| 11 |
+
url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 12 |
font-weight: normal;
|
| 13 |
font-style: normal;
|
| 14 |
}
|
| 16 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 17 |
@font-face {
|
| 18 |
font-family: "onthegosystems-icons";
|
| 19 |
+
src: url("../fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 20 |
}
|
| 21 |
}
|
| 22 |
|
| 33 |
.icon-layouts-logo:before,
|
| 34 |
.icon-module:before,
|
| 35 |
.icon-module-logo:before,
|
| 36 |
+
.icon-packager:before,
|
| 37 |
+
.icon-packager-logo:before,
|
| 38 |
.icon-toolset-logo:before,
|
| 39 |
.icon-types:before,
|
| 40 |
.icon-types-logo:before,
|
| 65 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 66 |
.icon-module:before { content: "\f118"; }
|
| 67 |
.icon-module-logo:before { content: "\f119"; }
|
| 68 |
+
.icon-packager:before { content: "\f120"; }
|
| 69 |
+
.icon-packager-logo:before { content: "\f121"; }
|
| 70 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 71 |
.icon-types:before { content: "\f11b"; }
|
| 72 |
.icon-types-logo:before { content: "\f11c"; }
|
embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons-preview.html
CHANGED
|
@@ -141,11 +141,11 @@
|
|
| 141 |
|
| 142 |
@font-face {
|
| 143 |
font-family: "onthegosystems-icons";
|
| 144 |
-
src: url("./onthegosystems-
|
| 145 |
-
src: url("./onthegosystems-
|
| 146 |
-
url("./onthegosystems-
|
| 147 |
-
url("./onthegosystems-
|
| 148 |
-
url("./onthegosystems-
|
| 149 |
font-weight: normal;
|
| 150 |
font-style: normal;
|
| 151 |
}
|
|
@@ -153,7 +153,7 @@
|
|
| 153 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 154 |
@font-face {
|
| 155 |
font-family: "onthegosystems-icons";
|
| 156 |
-
src: url("./onthegosystems-
|
| 157 |
}
|
| 158 |
}
|
| 159 |
|
|
@@ -170,6 +170,8 @@
|
|
| 170 |
.icon-layouts-logo:before,
|
| 171 |
.icon-module:before,
|
| 172 |
.icon-module-logo:before,
|
|
|
|
|
|
|
| 173 |
.icon-toolset-logo:before,
|
| 174 |
.icon-types:before,
|
| 175 |
.icon-types-logo:before,
|
|
@@ -200,6 +202,8 @@
|
|
| 200 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 201 |
.icon-module:before { content: "\f118"; }
|
| 202 |
.icon-module-logo:before { content: "\f119"; }
|
|
|
|
|
|
|
| 203 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 204 |
.icon-types:before { content: "\f11b"; }
|
| 205 |
.icon-types-logo:before { content: "\f11c"; }
|
|
@@ -221,7 +225,7 @@
|
|
| 221 |
<body class="characters-off">
|
| 222 |
<div id="page" class="container">
|
| 223 |
<header>
|
| 224 |
-
<h1>onthegosystems-icons contains
|
| 225 |
<a onclick="toggleCharacters(); return false;" href="#">Toggle Preview Characters</a>
|
| 226 |
</header>
|
| 227 |
|
|
@@ -356,6 +360,32 @@
|
|
| 356 |
</div>
|
| 357 |
</div>
|
| 358 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 359 |
<div class="glyph">
|
| 360 |
<div class="preview-glyphs">
|
| 361 |
<span class="step size-12"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-14"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-16"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-18"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-21"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-24"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-36"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-48"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-60"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-72"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span>
|
| 141 |
|
| 142 |
@font-face {
|
| 143 |
font-family: "onthegosystems-icons";
|
| 144 |
+
src: url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot");
|
| 145 |
+
src: url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot?#iefix") format("embedded-opentype"),
|
| 146 |
+
url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff") format("woff"),
|
| 147 |
+
url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf") format("truetype"),
|
| 148 |
+
url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 149 |
font-weight: normal;
|
| 150 |
font-style: normal;
|
| 151 |
}
|
| 153 |
@media screen and (-webkit-min-device-pixel-ratio:0) {
|
| 154 |
@font-face {
|
| 155 |
font-family: "onthegosystems-icons";
|
| 156 |
+
src: url("./onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg#onthegosystems-icons") format("svg");
|
| 157 |
}
|
| 158 |
}
|
| 159 |
|
| 170 |
.icon-layouts-logo:before,
|
| 171 |
.icon-module:before,
|
| 172 |
.icon-module-logo:before,
|
| 173 |
+
.icon-packager:before,
|
| 174 |
+
.icon-packager-logo:before,
|
| 175 |
.icon-toolset-logo:before,
|
| 176 |
.icon-types:before,
|
| 177 |
.icon-types-logo:before,
|
| 202 |
.icon-layouts-logo:before { content: "\f117"; }
|
| 203 |
.icon-module:before { content: "\f118"; }
|
| 204 |
.icon-module-logo:before { content: "\f119"; }
|
| 205 |
+
.icon-packager:before { content: "\f120"; }
|
| 206 |
+
.icon-packager-logo:before { content: "\f121"; }
|
| 207 |
.icon-toolset-logo:before { content: "\f11a"; }
|
| 208 |
.icon-types:before { content: "\f11b"; }
|
| 209 |
.icon-types-logo:before { content: "\f11c"; }
|
| 225 |
<body class="characters-off">
|
| 226 |
<div id="page" class="container">
|
| 227 |
<header>
|
| 228 |
+
<h1>onthegosystems-icons contains 18 glyphs:</h1>
|
| 229 |
<a onclick="toggleCharacters(); return false;" href="#">Toggle Preview Characters</a>
|
| 230 |
</header>
|
| 231 |
|
| 360 |
</div>
|
| 361 |
</div>
|
| 362 |
|
| 363 |
+
<div class="glyph">
|
| 364 |
+
<div class="preview-glyphs">
|
| 365 |
+
<span class="step size-12"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-14"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-16"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-18"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-21"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-24"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-36"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-48"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-60"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span><span class="step size-72"><span class="letters">Pp</span><i id="icon-packager" class="icon-packager"></i></span>
|
| 366 |
+
</div>
|
| 367 |
+
<div class="preview-scale">
|
| 368 |
+
<span class="step">12</span><span class="step">14</span><span class="step">16</span><span class="step">18</span><span class="step">21</span><span class="step">24</span><span class="step">36</span><span class="step">48</span><span class="step">60</span><span class="step">72</span>
|
| 369 |
+
</div>
|
| 370 |
+
<div class="usage">
|
| 371 |
+
<input class="class" type="text" readonly="readonly" onClick="this.select();" value=".icon-packager" />
|
| 372 |
+
<input class="point" type="text" readonly="readonly" onClick="this.select();" value="&#xf120;" />
|
| 373 |
+
</div>
|
| 374 |
+
</div>
|
| 375 |
+
|
| 376 |
+
<div class="glyph">
|
| 377 |
+
<div class="preview-glyphs">
|
| 378 |
+
<span class="step size-12"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-14"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-16"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-18"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-21"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-24"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-36"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-48"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-60"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span><span class="step size-72"><span class="letters">Pp</span><i id="icon-packager-logo" class="icon-packager-logo"></i></span>
|
| 379 |
+
</div>
|
| 380 |
+
<div class="preview-scale">
|
| 381 |
+
<span class="step">12</span><span class="step">14</span><span class="step">16</span><span class="step">18</span><span class="step">21</span><span class="step">24</span><span class="step">36</span><span class="step">48</span><span class="step">60</span><span class="step">72</span>
|
| 382 |
+
</div>
|
| 383 |
+
<div class="usage">
|
| 384 |
+
<input class="class" type="text" readonly="readonly" onClick="this.select();" value=".icon-packager-logo" />
|
| 385 |
+
<input class="point" type="text" readonly="readonly" onClick="this.select();" value="&#xf121;" />
|
| 386 |
+
</div>
|
| 387 |
+
</div>
|
| 388 |
+
|
| 389 |
<div class="glyph">
|
| 390 |
<div class="preview-glyphs">
|
| 391 |
<span class="step size-12"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-14"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-16"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-18"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-21"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-24"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-36"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-48"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-60"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span><span class="step size-72"><span class="letters">Pp</span><i id="icon-toolset-logo" class="icon-toolset-logo"></i></span>
|
embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.woff
DELETED
|
Binary file
|
embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.eot → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.eot}
RENAMED
|
Binary file
|
embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.svg → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.svg}
RENAMED
|
@@ -1,28 +1,28 @@
|
|
| 1 |
<?xml version="1.0" standalone="no"?>
|
| 2 |
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
| 3 |
<!--
|
| 4 |
-
|
| 5 |
-->
|
| 6 |
-
<svg xmlns="http://www.w3.org/2000/svg">
|
| 7 |
<metadata>
|
| 8 |
-
Created by FontForge
|
| 9 |
By Riccardo Strobbia
|
| 10 |
-
|
| 11 |
</metadata>
|
| 12 |
<defs>
|
| 13 |
<font id="onthegosystems-icons" horiz-adv-x="512" >
|
| 14 |
<font-face
|
| 15 |
font-family="onthegosystems-icons"
|
| 16 |
-
font-weight="
|
| 17 |
font-stretch="normal"
|
| 18 |
units-per-em="512"
|
| 19 |
-
panose-1="2 0
|
| 20 |
ascent="448"
|
| 21 |
descent="-64"
|
| 22 |
bbox="53.2423 -38.4004 460.8 422.4"
|
| 23 |
underline-thickness="25.6"
|
| 24 |
underline-position="-51.2"
|
| 25 |
-
unicode-range="U+F110-
|
| 26 |
/>
|
| 27 |
<missing-glyph />
|
| 28 |
<glyph glyph-name="uniF11F" unicode=""
|
|
@@ -257,6 +257,12 @@ c1.7666 0.626953 3.46875 1.27344 5.09473 1.93945l0.390625 0.133789l0.40918 0.192
|
|
| 257 |
c1.47852 0.787109 2.86035 1.59961 4.15332 2.45117l0.217773 0.115234l0.0771484 0.0576172c1.05566 0.678711 2.02832 1.40137 2.95605 2.125l0.358398 0.249023l0.25 0.217773c0.838867 0.65918 1.62598 1.35059 2.34863 2.03516l0.102539 0.0898438l0.223633 0.249023
|
| 258 |
c0.588867 0.583008 1.13965 1.17188 1.63867 1.78613l0.275391 0.288086l0.160156 0.223633c0.563477 0.68457 1.0752 1.38867 1.50391 2.08691l0.0253906 0.0253906l0.0703125 0.102539c0.410156 0.671875 0.755859 1.35059 1.0752 2.02246l0.134766 0.275391
|
| 259 |
l0.115234 0.300781c0.275391 0.65918 0.537109 1.33105 0.691406 2.02148l0.0761719 0.186523v0.0439453c0.210938 0.78125 0.333008 1.5752 0.397461 2.375z" />
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 260 |
<glyph glyph-name="uniF114" unicode=""
|
| 261 |
d="M342.15 99.4111l0.0898438 1.29883l0.43457 -50.0029l-0.0380859 -1.03027l-0.0507812 -0.262695c-0.0644531 -0.799805 -0.199219 -1.58691 -0.397461 -2.37402v-0.0322266l-0.0761719 -0.172852c-0.154297 -0.68457 -0.416016 -1.36914 -0.691406 -2.03516
|
| 262 |
l-0.115234 -0.293945l-0.134766 -0.269531c-0.319336 -0.671875 -0.671875 -1.35645 -1.0752 -2.02148l-0.0703125 -0.102539l-0.0253906 -0.0263672c-0.428711 -0.709961 -0.94043 -1.40137 -1.50391 -2.08594l-0.15332 -0.217773l-0.275391 -0.306641
|
| 1 |
<?xml version="1.0" standalone="no"?>
|
| 2 |
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
| 3 |
<!--
|
| 4 |
+
2015-3-4: Created with FontForge (http://fontforge.org)
|
| 5 |
-->
|
| 6 |
+
<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" version="1.1">
|
| 7 |
<metadata>
|
| 8 |
+
Created by FontForge 20141127 at Wed Mar 4 12:40:05 2015
|
| 9 |
By Riccardo Strobbia
|
| 10 |
+
Copyright (c) 2015, Riccardo Strobbia
|
| 11 |
</metadata>
|
| 12 |
<defs>
|
| 13 |
<font id="onthegosystems-icons" horiz-adv-x="512" >
|
| 14 |
<font-face
|
| 15 |
font-family="onthegosystems-icons"
|
| 16 |
+
font-weight="400"
|
| 17 |
font-stretch="normal"
|
| 18 |
units-per-em="512"
|
| 19 |
+
panose-1="2 0 5 9 0 0 0 0 0 0"
|
| 20 |
ascent="448"
|
| 21 |
descent="-64"
|
| 22 |
bbox="53.2423 -38.4004 460.8 422.4"
|
| 23 |
underline-thickness="25.6"
|
| 24 |
underline-position="-51.2"
|
| 25 |
+
unicode-range="U+F110-F121"
|
| 26 |
/>
|
| 27 |
<missing-glyph />
|
| 28 |
<glyph glyph-name="uniF11F" unicode=""
|
| 257 |
c1.47852 0.787109 2.86035 1.59961 4.15332 2.45117l0.217773 0.115234l0.0771484 0.0576172c1.05566 0.678711 2.02832 1.40137 2.95605 2.125l0.358398 0.249023l0.25 0.217773c0.838867 0.65918 1.62598 1.35059 2.34863 2.03516l0.102539 0.0898438l0.223633 0.249023
|
| 258 |
c0.588867 0.583008 1.13965 1.17188 1.63867 1.78613l0.275391 0.288086l0.160156 0.223633c0.563477 0.68457 1.0752 1.38867 1.50391 2.08691l0.0253906 0.0253906l0.0703125 0.102539c0.410156 0.671875 0.755859 1.35059 1.0752 2.02246l0.134766 0.275391
|
| 259 |
l0.115234 0.300781c0.275391 0.65918 0.537109 1.33105 0.691406 2.02148l0.0761719 0.186523v0.0439453c0.210938 0.78125 0.333008 1.5752 0.397461 2.375z" />
|
| 260 |
+
<glyph glyph-name="uniF120" unicode=""
|
| 261 |
+
d="M373.56 379.779l73.6641 -73.6553v-242.989c0.945312 -11.4707 -8.60645 -21.041 -20.0859 -21.041h-341.385c-11.4609 0 -21.0312 9.54297 -21.0312 21.041v242.989l73.665 73.6553h235.173zM306.702 160.703h77.3633l-127.062 102.367l-128.188 -102.367h77.4912
|
| 262 |
+
v-67.9395h100.396v67.9395zM118.291 310.896h277.263l-31.5557 32.5283h-213.188z" />
|
| 263 |
+
<glyph glyph-name="uniF121" unicode=""
|
| 264 |
+
d="M170.238 102.4l85.7617 68.4805l85.1191 -68.4805h-51.8389v-45.4375h-67.1992v45.4375h-51.8428zM371.2 345.6h76.7998v-384h-384v384h76.7998v76.8008h76.7998v-76.8008h76.8008v76.8008h76.7998v-76.8008zM383.357 37.1221v162.558l-49.2754 49.2793h-157.442
|
| 265 |
+
l-49.2783 -49.2793v-162.558c0 -7.68066 6.39746 -14.0781 14.0781 -14.0781h228.479c7.67676 0 14.082 6.39746 13.4395 14.0781zM184.959 224.641h142.721l21.123 -21.7617h-185.602z" />
|
| 266 |
<glyph glyph-name="uniF114" unicode=""
|
| 267 |
d="M342.15 99.4111l0.0898438 1.29883l0.43457 -50.0029l-0.0380859 -1.03027l-0.0507812 -0.262695c-0.0644531 -0.799805 -0.199219 -1.58691 -0.397461 -2.37402v-0.0322266l-0.0761719 -0.172852c-0.154297 -0.68457 -0.416016 -1.36914 -0.691406 -2.03516
|
| 268 |
l-0.115234 -0.293945l-0.134766 -0.269531c-0.319336 -0.671875 -0.671875 -1.35645 -1.0752 -2.02148l-0.0703125 -0.102539l-0.0253906 -0.0263672c-0.428711 -0.709961 -0.94043 -1.40137 -1.50391 -2.08594l-0.15332 -0.217773l-0.275391 -0.306641
|
embedded/onthego-resources/onthegosystems-icons/fonts/{onthegosystems-icons_33da83f67be9c5797490c4baa29104c1.ttf → onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.ttf}
RENAMED
|
Binary file
|
embedded/onthego-resources/onthegosystems-icons/fonts/onthegosystems-icons_ea0d501b723f7b75d3147cf08210b5cf.woff
ADDED
|
Binary file
|
embedded/onthego-resources/onthegosystems-icons/vectors/packager-logo.svg
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="utf-8"?>
|
| 2 |
+
<!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) -->
|
| 3 |
+
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1 Tiny//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11-tiny.dtd">
|
| 4 |
+
<svg version="1.1" baseProfile="tiny" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"
|
| 5 |
+
x="0px" y="0px" width="141px" height="141px" viewBox="0 0 141 141" xml:space="preserve">
|
| 6 |
+
<g>
|
| 7 |
+
<polygon fill="#F05A29" points="46.882,95.175 61.159,95.175 61.159,107.688 79.665,107.688 79.665,95.175 93.941,95.175
|
| 8 |
+
70.5,76.316 "/>
|
| 9 |
+
<path fill="#F05A29" d="M102.225,28.2V7.05H81.075V28.2h-21.15V7.05h-21.15V28.2h-21.15v105.75h105.75V28.2H102.225z
|
| 10 |
+
M105.573,113.152c0.177,2.115-1.587,3.877-3.701,3.877H38.951c-2.115,0-3.877-1.762-3.877-3.877V68.385l13.571-13.571h43.358
|
| 11 |
+
l13.57,13.571V113.152z"/>
|
| 12 |
+
<polygon fill="#F05A29" points="50.936,61.511 44.944,67.504 96.057,67.504 90.24,61.511 "/>
|
| 13 |
+
</g>
|
| 14 |
+
</svg>
|
embedded/onthego-resources/onthegosystems-icons/vectors/packager.svg
ADDED
|
@@ -0,0 +1,9 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="utf-8"?>
|
| 2 |
+
<!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) -->
|
| 3 |
+
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1 Tiny//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11-tiny.dtd">
|
| 4 |
+
<svg version="1.1" baseProfile="tiny" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"
|
| 5 |
+
x="0px" y="0px" width="56.333px" height="52.166px" viewBox="0 0 56.333 52.166" xml:space="preserve">
|
| 6 |
+
<path fill="#333333" d="M41.101,7.506H15.226L7.121,15.61v26.735c0,1.265,1.053,2.315,2.314,2.315h37.561
|
| 7 |
+
c1.263,0,2.314-1.053,2.21-2.315V15.61L41.101,7.506z M33.745,31.61v7.475H22.699V31.61h-8.526l14.104-11.263l13.98,11.263H33.745z
|
| 8 |
+
M13.015,15.085l3.578-3.579h23.456l3.472,3.579H13.015z"/>
|
| 9 |
+
</svg>
|
embedded/onthego-resources/onthegosystems-icons/vectors/{wpml logo.svg → wpml-logo.svg}
RENAMED
|
File without changes
|
embedded/plugin.php
CHANGED
|
@@ -1,18 +1,18 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
-
Plugin Name: Types
|
| 4 |
Plugin URI: http://wordpress.org/extend/plugins/types/
|
| 5 |
Description: Define custom post types, custom taxonomy and custom fields.
|
| 6 |
Author: OnTheGoSystems
|
| 7 |
Author URI: http://www.onthegosystems.com
|
| 8 |
-
Version: 1.6.
|
| 9 |
*/
|
| 10 |
/**
|
| 11 |
*
|
| 12 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 13 |
-
* $LastChangedDate: 2015-
|
| 14 |
-
* $LastChangedRevision:
|
| 15 |
-
* $LastChangedBy:
|
| 16 |
*
|
| 17 |
*/
|
| 18 |
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
+
Plugin Name: Types - Complete Solution for Custom Fields and Types Embedded
|
| 4 |
Plugin URI: http://wordpress.org/extend/plugins/types/
|
| 5 |
Description: Define custom post types, custom taxonomy and custom fields.
|
| 6 |
Author: OnTheGoSystems
|
| 7 |
Author URI: http://www.onthegosystems.com
|
| 8 |
+
Version: 1.6.6
|
| 9 |
*/
|
| 10 |
/**
|
| 11 |
*
|
| 12 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/plugin.php $
|
| 13 |
+
* $LastChangedDate: 2015-04-01 14:17:52 +0000 (Wed, 01 Apr 2015) $
|
| 14 |
+
* $LastChangedRevision: 1125409 $
|
| 15 |
+
* $LastChangedBy: iworks $
|
| 16 |
*
|
| 17 |
*/
|
| 18 |
|
embedded/readme.txt
CHANGED
|
@@ -1,3 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
The Embedded version lets you create custom types, taxonomy and fields for your theme or plugin, without requiring any plugin.
|
| 2 |
|
| 3 |
= Instructions =
|
| 1 |
+
=== Types Embedded - Custom Fields and Custom Post Types Management ===
|
| 2 |
+
Contributors: brucepearson, AmirHelzer, jozik, mihaimihai, iworks
|
| 3 |
+
Donate link: http://wp-types.com
|
| 4 |
+
Tags: CMS, custom field, custom fields, custom post type, custom post types, post, post type, post types, cck, taxonomy, fields
|
| 5 |
+
License: GPLv2
|
| 6 |
+
Requires at least: 3.4
|
| 7 |
+
Tested up to: 4.1.1
|
| 8 |
+
Stable tag: 1.6.6
|
| 9 |
+
|
| 10 |
The Embedded version lets you create custom types, taxonomy and fields for your theme or plugin, without requiring any plugin.
|
| 11 |
|
| 12 |
= Instructions =
|
embedded/resources/css/basic.css
CHANGED
|
@@ -564,6 +564,17 @@ input.wpcf-form-error {
|
|
| 564 |
|
| 565 |
.status-inactive
|
| 566 |
{
|
| 567 |
-
opacity: .
|
| 568 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 569 |
}
|
| 564 |
|
| 565 |
.status-inactive
|
| 566 |
{
|
| 567 |
+
opacity: .7;
|
| 568 |
+
/*transition: all .4s;*/
|
| 569 |
+
}
|
| 570 |
+
|
| 571 |
+
.wpcf-table-column-name
|
| 572 |
+
{
|
| 573 |
+
min-width: 250px;
|
| 574 |
+
}
|
| 575 |
+
|
| 576 |
+
#wpcf_types_list
|
| 577 |
+
,#wpcf_tax_list
|
| 578 |
+
{
|
| 579 |
+
margin: 1.5em 0;
|
| 580 |
}
|
embedded/resources/css/colorbox.css
CHANGED
|
@@ -12,7 +12,7 @@
|
|
| 12 |
position:absolute;
|
| 13 |
top:0;
|
| 14 |
left:0;
|
| 15 |
-
z-index:
|
| 16 |
/* overflow:hidden;*/
|
| 17 |
}
|
| 18 |
|
|
@@ -82,4 +82,4 @@
|
|
| 82 |
.cboxIE #cboxMiddleRight {
|
| 83 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF);
|
| 84 |
}
|
| 85 |
-
/* Dialogs END */
|
| 12 |
position:absolute;
|
| 13 |
top:0;
|
| 14 |
left:0;
|
| 15 |
+
z-index: 20000;
|
| 16 |
/* overflow:hidden;*/
|
| 17 |
}
|
| 18 |
|
| 82 |
.cboxIE #cboxMiddleRight {
|
| 83 |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF);
|
| 84 |
}
|
| 85 |
+
/* Dialogs END */
|
embedded/resources/css/dashicons.css
CHANGED
|
@@ -1,6 +1,6 @@
|
|
| 1 |
/**
|
| 2 |
*
|
| 3 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 4 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 5 |
* $LastChangedRevision: 1027712 $
|
| 6 |
* $LastChangedBy: iworks $
|
| 1 |
/**
|
| 2 |
*
|
| 3 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/resources/css/dashicons.css $
|
| 4 |
* $LastChangedDate: 2014-11-18 06:47:25 +0000 (Tue, 18 Nov 2014) $
|
| 5 |
* $LastChangedRevision: 1027712 $
|
| 6 |
* $LastChangedBy: iworks $
|
embedded/resources/css/usermeta.css
CHANGED
|
@@ -33,8 +33,8 @@
|
|
| 33 |
max-width:40%;
|
| 34 |
height:auto;
|
| 35 |
}
|
| 36 |
-
.CodeMirror-wrap
|
| 37 |
-
|
| 38 |
border:1px solid #ccc;
|
| 39 |
}
|
| 40 |
.wpcf-admin-css-preview-style-edit{
|
|
@@ -78,4 +78,4 @@
|
|
| 78 |
}
|
| 79 |
#createuser .wpcf-profile-field-line .wpcf-profile-field-line {
|
| 80 |
margin-bottom: 10px;
|
| 81 |
-
}
|
| 33 |
max-width:40%;
|
| 34 |
height:auto;
|
| 35 |
}
|
| 36 |
+
.wpcf-fields-form .CodeMirror-wrap
|
| 37 |
+
{
|
| 38 |
border:1px solid #ccc;
|
| 39 |
}
|
| 40 |
.wpcf-admin-css-preview-style-edit{
|
| 78 |
}
|
| 79 |
#createuser .wpcf-profile-field-line .wpcf-profile-field-line {
|
| 80 |
margin-bottom: 10px;
|
| 81 |
+
}
|
embedded/resources/js/basic.js
CHANGED
|
@@ -4,9 +4,9 @@
|
|
| 4 |
* For now full and embedded version use this script.
|
| 5 |
* Before moving full-version-only code - make sure it's not needed here.
|
| 6 |
*
|
| 7 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 8 |
-
* $LastChangedDate: 2015-
|
| 9 |
-
* $LastChangedRevision:
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
*/
|
|
@@ -243,7 +243,7 @@ jQuery(document).ready(function(){
|
|
| 243 |
passed = false;
|
| 244 |
}
|
| 245 |
});
|
| 246 |
-
|
| 247 |
if (passed == false) {
|
| 248 |
// Bind message fade out
|
| 249 |
jQuery('.wpcf-forms-field-slug').live('keyup', function(){
|
|
@@ -265,6 +265,7 @@ jQuery(document).ready(function(){
|
|
| 265 |
var updateAdd = wpcfGetParameterByName('wpcf_ajax_update_add', jQuery(this).attr('href'));
|
| 266 |
var warning = wpcfGetParameterByName('wpcf_warning', jQuery(this).attr('href'));
|
| 267 |
var thisObject = jQuery(this);
|
|
|
|
| 268 |
if (warning != false) {
|
| 269 |
var answer = confirm(warning);
|
| 270 |
if (answer == false) {
|
|
@@ -275,7 +276,6 @@ jQuery(document).ready(function(){
|
|
| 275 |
url: jQuery(this).attr('href'),
|
| 276 |
type: 'get',
|
| 277 |
dataType: 'json',
|
| 278 |
-
// data: ,
|
| 279 |
cache: false,
|
| 280 |
beforeSend: function() {
|
| 281 |
if (update != false) {
|
|
@@ -300,6 +300,17 @@ jQuery(document).ready(function(){
|
|
| 300 |
&& data.wpcf_nonce_ajax_callback == wpcf_nonce_ajax_callback)) {
|
| 301 |
eval(data.execute);
|
| 302 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 303 |
}
|
| 304 |
if (callback != false) {
|
| 305 |
eval(callback+'(data, thisObject)');
|
|
@@ -371,6 +382,16 @@ jQuery(document).ready(function(){
|
|
| 371 |
jQuery('#wpcf-types-form-rewrite-toggle').slideUp();
|
| 372 |
}
|
| 373 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 374 |
jQuery('input[name="ct[show_in_menu]"]').change(function(){
|
| 375 |
if (jQuery(this).is(':checked')) {
|
| 376 |
jQuery('#wpcf-types-form-showinmenu-toggle').slideDown();
|
|
@@ -523,18 +544,6 @@ function wpcfLoadingButtonStop() {
|
|
| 523 |
//type modal didnt disappeared
|
| 524 |
jQuery('.types_modal_box').remove();
|
| 525 |
jQuery('.types_block_page').remove();
|
| 526 |
-
|
| 527 |
-
}
|
| 528 |
-
|
| 529 |
-
/**
|
| 530 |
-
* Controls supports title or body Warning.
|
| 531 |
-
*/
|
| 532 |
-
function wpcfTitleEditorCheck() {
|
| 533 |
-
if (!jQuery('#wpcf-supports-title').is(':checked') && !jQuery('#wpcf-supports-editor').is(':checked')) {
|
| 534 |
-
jQuery('#wpcf-types-title-editor-warning').fadeIn();
|
| 535 |
-
} else {
|
| 536 |
-
jQuery('#wpcf-types-title-editor-warning').fadeOut();
|
| 537 |
-
}
|
| 538 |
}
|
| 539 |
|
| 540 |
/**
|
| 4 |
* For now full and embedded version use this script.
|
| 5 |
* Before moving full-version-only code - make sure it's not needed here.
|
| 6 |
*
|
| 7 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/resources/js/basic.js $
|
| 8 |
+
* $LastChangedDate: 2015-03-10 06:46:08 +0000 (Tue, 10 Mar 2015) $
|
| 9 |
+
* $LastChangedRevision: 1109249 $
|
| 10 |
* $LastChangedBy: iworks $
|
| 11 |
*
|
| 12 |
*/
|
| 243 |
passed = false;
|
| 244 |
}
|
| 245 |
});
|
| 246 |
+
|
| 247 |
if (passed == false) {
|
| 248 |
// Bind message fade out
|
| 249 |
jQuery('.wpcf-forms-field-slug').live('keyup', function(){
|
| 265 |
var updateAdd = wpcfGetParameterByName('wpcf_ajax_update_add', jQuery(this).attr('href'));
|
| 266 |
var warning = wpcfGetParameterByName('wpcf_warning', jQuery(this).attr('href'));
|
| 267 |
var thisObject = jQuery(this);
|
| 268 |
+
var thisObjectTR = jQuery(this).closest('tr');
|
| 269 |
if (warning != false) {
|
| 270 |
var answer = confirm(warning);
|
| 271 |
if (answer == false) {
|
| 276 |
url: jQuery(this).attr('href'),
|
| 277 |
type: 'get',
|
| 278 |
dataType: 'json',
|
|
|
|
| 279 |
cache: false,
|
| 280 |
beforeSend: function() {
|
| 281 |
if (update != false) {
|
| 300 |
&& data.wpcf_nonce_ajax_callback == wpcf_nonce_ajax_callback)) {
|
| 301 |
eval(data.execute);
|
| 302 |
}
|
| 303 |
+
if (typeof data.status != 'undefined' ) {
|
| 304 |
+
if ( 'inactive' == data.status ) {
|
| 305 |
+
thisObjectTR.addClass('status-inactive');
|
| 306 |
+
|
| 307 |
+
} else {
|
| 308 |
+
thisObjectTR.removeClass('status-inactive');
|
| 309 |
+
}
|
| 310 |
+
}
|
| 311 |
+
if (typeof data.status_label != 'undefined' ) {
|
| 312 |
+
jQuery('td.status', thisObjectTR).html(data.status_label);
|
| 313 |
+
}
|
| 314 |
}
|
| 315 |
if (callback != false) {
|
| 316 |
eval(callback+'(data, thisObject)');
|
| 382 |
jQuery('#wpcf-types-form-rewrite-toggle').slideUp();
|
| 383 |
}
|
| 384 |
});
|
| 385 |
+
/**
|
| 386 |
+
* meta_box_cb
|
| 387 |
+
*/
|
| 388 |
+
jQuery('.wpcf-tax-form input[name="ct[meta_box_cb][disabled]"]').change(function(){
|
| 389 |
+
if (jQuery(this).is(':checked')) {
|
| 390 |
+
jQuery('#wpcf-types-form-meta_box_cb-toggle').slideUp();
|
| 391 |
+
} else {
|
| 392 |
+
jQuery('#wpcf-types-form-meta_box_cb-toggle').slideDown();
|
| 393 |
+
}
|
| 394 |
+
});
|
| 395 |
jQuery('input[name="ct[show_in_menu]"]').change(function(){
|
| 396 |
if (jQuery(this).is(':checked')) {
|
| 397 |
jQuery('#wpcf-types-form-showinmenu-toggle').slideDown();
|
| 544 |
//type modal didnt disappeared
|
| 545 |
jQuery('.types_modal_box').remove();
|
| 546 |
jQuery('.types_block_page').remove();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 547 |
}
|
| 548 |
|
| 549 |
/**
|
embedded/resources/js/fields-form.js
CHANGED
|
@@ -1,6 +1,6 @@
|
|
| 1 |
-
/*
|
| 2 |
* Group edit page JS
|
| 3 |
-
*
|
| 4 |
* This file should be used from now on as dedicated JS for group edit page.
|
| 5 |
* Avoid adding new functionalities to basic.js
|
| 6 |
*
|
|
@@ -9,9 +9,9 @@
|
|
| 9 |
* @since Types 1.1.5
|
| 10 |
* @autor srdjan
|
| 11 |
*
|
| 12 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 13 |
-
* $LastChangedDate:
|
| 14 |
-
* $LastChangedRevision:
|
| 15 |
* $LastChangedBy: iworks $
|
| 16 |
*
|
| 17 |
*/
|
|
@@ -25,7 +25,7 @@ jQuery(document).ready(function($){
|
|
| 25 |
handle: 'img.js-types-sort-button',
|
| 26 |
start: function(e, ui){
|
| 27 |
ui.placeholder.height(ui.item.find('.wpcf-form-fieldset').height());
|
| 28 |
-
}
|
| 29 |
});
|
| 30 |
}
|
| 31 |
});
|
|
@@ -39,7 +39,6 @@ jQuery(document).ready(function($){
|
|
| 39 |
start: function(e, ui){
|
| 40 |
ui.placeholder.height(ui.item.height() + 23);
|
| 41 |
}
|
| 42 |
-
|
| 43 |
});
|
| 44 |
|
| 45 |
$('.wpcf-fields-radio-sortable,.wpcf-fields-select-sortable').sortable({
|
|
@@ -48,7 +47,7 @@ jQuery(document).ready(function($){
|
|
| 48 |
handle: 'img.js-types-sort-button',
|
| 49 |
start: function(e, ui){
|
| 50 |
ui.placeholder.height(ui.item.height() - 2);
|
| 51 |
-
}
|
| 52 |
});
|
| 53 |
|
| 54 |
$('.wpcf-fields-checkboxes-sortable').sortable({
|
|
@@ -57,7 +56,7 @@ jQuery(document).ready(function($){
|
|
| 57 |
handle: 'img.js-types-sort-button',
|
| 58 |
start: function(e, ui){
|
| 59 |
ui.placeholder.height(ui.item.height() + 13);
|
| 60 |
-
}
|
| 61 |
});
|
| 62 |
|
| 63 |
$('[data-wpcf-type="checkbox"],[data-wpcf-type=checkboxes]').each( function() {
|
|
@@ -66,6 +65,16 @@ jQuery(document).ready(function($){
|
|
| 66 |
});
|
| 67 |
wpcf_checkbox_value_zero($(this));
|
| 68 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 69 |
});
|
| 70 |
|
| 71 |
function wpcf_checkbox_value_zero(field) {
|
|
@@ -75,15 +84,22 @@ function wpcf_checkbox_value_zero(field) {
|
|
| 75 |
jQuery(field).prev().remove();
|
| 76 |
jQuery(field).removeClass('wpcf-value-store-error-error');
|
| 77 |
}
|
| 78 |
-
|
| 79 |
var value = jQuery(field).val();
|
| 80 |
if (value === '') {
|
| 81 |
passed = false;
|
| 82 |
if (!jQuery(field).hasClass('wpcf-value-store-error-error')) {
|
| 83 |
jQuery(field).before('<div class="wpcf-form-error">' + jQuery(field).data('required-message') + '</div>').addClass('wpcf-value-store-error-error');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 84 |
}
|
| 85 |
jQuery(field).focus();
|
| 86 |
-
|
| 87 |
}
|
| 88 |
if (value === '0') {
|
| 89 |
passed = false;
|
|
@@ -92,8 +108,6 @@ function wpcf_checkbox_value_zero(field) {
|
|
| 92 |
}
|
| 93 |
jQuery(field).focus();
|
| 94 |
}
|
| 95 |
-
|
| 96 |
return !passed;
|
| 97 |
-
|
| 98 |
}
|
| 99 |
|
| 1 |
+
/*
|
| 2 |
* Group edit page JS
|
| 3 |
+
*
|
| 4 |
* This file should be used from now on as dedicated JS for group edit page.
|
| 5 |
* Avoid adding new functionalities to basic.js
|
| 6 |
*
|
| 9 |
* @since Types 1.1.5
|
| 10 |
* @autor srdjan
|
| 11 |
*
|
| 12 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/resources/js/fields-form.js $
|
| 13 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 14 |
+
* $LastChangedRevision: 1120400 $
|
| 15 |
* $LastChangedBy: iworks $
|
| 16 |
*
|
| 17 |
*/
|
| 25 |
handle: 'img.js-types-sort-button',
|
| 26 |
start: function(e, ui){
|
| 27 |
ui.placeholder.height(ui.item.find('.wpcf-form-fieldset').height());
|
| 28 |
+
}
|
| 29 |
});
|
| 30 |
}
|
| 31 |
});
|
| 39 |
start: function(e, ui){
|
| 40 |
ui.placeholder.height(ui.item.height() + 23);
|
| 41 |
}
|
|
|
|
| 42 |
});
|
| 43 |
|
| 44 |
$('.wpcf-fields-radio-sortable,.wpcf-fields-select-sortable').sortable({
|
| 47 |
handle: 'img.js-types-sort-button',
|
| 48 |
start: function(e, ui){
|
| 49 |
ui.placeholder.height(ui.item.height() - 2);
|
| 50 |
+
}
|
| 51 |
});
|
| 52 |
|
| 53 |
$('.wpcf-fields-checkboxes-sortable').sortable({
|
| 56 |
handle: 'img.js-types-sort-button',
|
| 57 |
start: function(e, ui){
|
| 58 |
ui.placeholder.height(ui.item.height() + 13);
|
| 59 |
+
}
|
| 60 |
});
|
| 61 |
|
| 62 |
$('[data-wpcf-type="checkbox"],[data-wpcf-type=checkboxes]').each( function() {
|
| 65 |
});
|
| 66 |
wpcf_checkbox_value_zero($(this));
|
| 67 |
});
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
* confitonal logic button close on group edit screen
|
| 71 |
+
*/
|
| 72 |
+
$('#conditional-logic-button-ok').live('click', function(){
|
| 73 |
+
$(this).parent().slideUp('slow', function() {
|
| 74 |
+
$('#conditional-logic-button-open').fadeIn();
|
| 75 |
+
});
|
| 76 |
+
return false;
|
| 77 |
+
});
|
| 78 |
});
|
| 79 |
|
| 80 |
function wpcf_checkbox_value_zero(field) {
|
| 84 |
jQuery(field).prev().remove();
|
| 85 |
jQuery(field).removeClass('wpcf-value-store-error-error');
|
| 86 |
}
|
| 87 |
+
|
| 88 |
var value = jQuery(field).val();
|
| 89 |
if (value === '') {
|
| 90 |
passed = false;
|
| 91 |
if (!jQuery(field).hasClass('wpcf-value-store-error-error')) {
|
| 92 |
jQuery(field).before('<div class="wpcf-form-error">' + jQuery(field).data('required-message') + '</div>').addClass('wpcf-value-store-error-error');
|
| 93 |
+
var legend = jQuery(field).closest('div.ui-draggable').children('fieldset').children('legend');
|
| 94 |
+
if ( legend.hasClass('legend-collapsed') ) {
|
| 95 |
+
legend.click();
|
| 96 |
+
}
|
| 97 |
+
var fieldset = jQuery(field).closest('fieldset');
|
| 98 |
+
if ( jQuery('legend.legend-collapsed', fieldset ) ) {
|
| 99 |
+
jQuery('legend.legend-collapsed', fieldset).click();
|
| 100 |
+
}
|
| 101 |
}
|
| 102 |
jQuery(field).focus();
|
|
|
|
| 103 |
}
|
| 104 |
if (value === '0') {
|
| 105 |
passed = false;
|
| 108 |
}
|
| 109 |
jQuery(field).focus();
|
| 110 |
}
|
|
|
|
| 111 |
return !passed;
|
|
|
|
| 112 |
}
|
| 113 |
|
embedded/resources/js/fields-post.js
CHANGED
|
@@ -173,6 +173,8 @@ var typesPostScreen = (function($){
|
|
| 173 |
$this.bind('blur', previewWarningShow);
|
| 174 |
}
|
| 175 |
});
|
|
|
|
|
|
|
| 176 |
});
|
| 177 |
}
|
| 178 |
function previewWarning(header, content) {
|
|
@@ -193,4 +195,4 @@ var typesPostScreen = (function($){
|
|
| 193 |
return {
|
| 194 |
previewWarning: previewWarning
|
| 195 |
};
|
| 196 |
-
})(jQuery);
|
| 173 |
$this.bind('blur', previewWarningShow);
|
| 174 |
}
|
| 175 |
});
|
| 176 |
+
$('.js-wpt-repadd,.js-wpt-repdelete,.js-wpt-date-clear').on('click', previewWarningShow);
|
| 177 |
+
$('.js-wpt-repdrag').on('mouseup', previewWarningShow);
|
| 178 |
});
|
| 179 |
}
|
| 180 |
function previewWarning(header, content) {
|
| 195 |
return {
|
| 196 |
previewWarning: previewWarning
|
| 197 |
};
|
| 198 |
+
})(jQuery);
|
embedded/resources/js/post-relationship.js
CHANGED
|
@@ -149,7 +149,7 @@ var tChildTable = (function($) {
|
|
| 149 |
|
| 150 |
tTagBox = {
|
| 151 |
clean: function(tags) {
|
| 152 |
-
var comma = postL10n.comma;
|
| 153 |
if (',' !== comma)
|
| 154 |
tags = tags.replace(new RegExp(comma, 'g'), ',');
|
| 155 |
tags = tags.replace(/\s*,\s*/g, ',').replace(/,+/g, ',').replace(/[,\s]+$/, '').replace(/^[,\s]+/, '');
|
|
@@ -159,7 +159,7 @@ var tChildTable = (function($) {
|
|
| 159 |
},
|
| 160 |
parseTags: function(el) {
|
| 161 |
var id = el.id, num = id.split('-check-num-')[1], taxbox = $(el).closest('.js-types-child-tagsdiv'),
|
| 162 |
-
thetags = taxbox.find('.the-tags'), comma = postL10n.comma,
|
| 163 |
current_tags = thetags.val().split(comma), new_tags = [];
|
| 164 |
delete current_tags[num];
|
| 165 |
|
|
@@ -179,14 +179,15 @@ var tChildTable = (function($) {
|
|
| 179 |
var thetags = $('.the-tags', el),
|
| 180 |
tagchecklist = $('.tagchecklist', el),
|
| 181 |
id = $(el).attr('id'),
|
| 182 |
-
current_tags, disabled
|
|
|
|
| 183 |
|
| 184 |
if (!thetags.length)
|
| 185 |
return;
|
| 186 |
|
| 187 |
disabled = thetags.prop('disabled');
|
| 188 |
|
| 189 |
-
current_tags = thetags.val().split(
|
| 190 |
tagchecklist.empty();
|
| 191 |
|
| 192 |
$.each(current_tags, function(key, val) {
|
|
@@ -217,7 +218,7 @@ var tChildTable = (function($) {
|
|
| 217 |
a = a || false;
|
| 218 |
var tags = $('.the-tags', el),
|
| 219 |
newtag = $('input.js-types-newtag', el),
|
| 220 |
-
comma = postL10n.comma,
|
| 221 |
newtags, text;
|
| 222 |
|
| 223 |
text = a ? $(a).text() : newtag.val();
|
|
@@ -286,8 +287,9 @@ var tChildTable = (function($) {
|
|
| 286 |
}
|
| 287 |
}).each(function() {
|
| 288 |
// var tax = $(this).closest('div.tagsdiv').attr('id');
|
| 289 |
-
var tax = $(this).data('types-tax')
|
| 290 |
-
|
|
|
|
| 291 |
});
|
| 292 |
|
| 293 |
// save tags on post save/publish
|
| 149 |
|
| 150 |
tTagBox = {
|
| 151 |
clean: function(tags) {
|
| 152 |
+
var comma = postL10n.comma || window.tagsBoxL10n.tagDelimiter;
|
| 153 |
if (',' !== comma)
|
| 154 |
tags = tags.replace(new RegExp(comma, 'g'), ',');
|
| 155 |
tags = tags.replace(/\s*,\s*/g, ',').replace(/,+/g, ',').replace(/[,\s]+$/, '').replace(/^[,\s]+/, '');
|
| 159 |
},
|
| 160 |
parseTags: function(el) {
|
| 161 |
var id = el.id, num = id.split('-check-num-')[1], taxbox = $(el).closest('.js-types-child-tagsdiv'),
|
| 162 |
+
thetags = taxbox.find('.the-tags'), comma = postL10n.comma || window.tagsBoxL10n.tagDelimiter,
|
| 163 |
current_tags = thetags.val().split(comma), new_tags = [];
|
| 164 |
delete current_tags[num];
|
| 165 |
|
| 179 |
var thetags = $('.the-tags', el),
|
| 180 |
tagchecklist = $('.tagchecklist', el),
|
| 181 |
id = $(el).attr('id'),
|
| 182 |
+
current_tags, disabled,
|
| 183 |
+
comma = postL10n.comma || window.tagsBoxL10n.tagDelimiter;
|
| 184 |
|
| 185 |
if (!thetags.length)
|
| 186 |
return;
|
| 187 |
|
| 188 |
disabled = thetags.prop('disabled');
|
| 189 |
|
| 190 |
+
current_tags = thetags.val().split(comma);
|
| 191 |
tagchecklist.empty();
|
| 192 |
|
| 193 |
$.each(current_tags, function(key, val) {
|
| 218 |
a = a || false;
|
| 219 |
var tags = $('.the-tags', el),
|
| 220 |
newtag = $('input.js-types-newtag', el),
|
| 221 |
+
comma = postL10n.comma || window.tagsBoxL10n.tagDelimiter,
|
| 222 |
newtags, text;
|
| 223 |
|
| 224 |
text = a ? $(a).text() : newtag.val();
|
| 287 |
}
|
| 288 |
}).each(function() {
|
| 289 |
// var tax = $(this).closest('div.tagsdiv').attr('id');
|
| 290 |
+
var tax = $(this).data('types-tax'),
|
| 291 |
+
comma = postL10n.comma || window.tagsBoxL10n.tagDelimiter;
|
| 292 |
+
$(this).suggest(ajaxurl + '?action=ajax-tag-search&tax=' + tax, {delay: 500, minchars: 2, multiple: true, multipleSep: comma + ' '});
|
| 293 |
});
|
| 294 |
|
| 295 |
// save tags on post save/publish
|
embedded/usermeta-init.php
CHANGED
|
@@ -10,9 +10,9 @@ $fields_access = new Post_Fields_Access;
|
|
| 10 |
* @author Gen gen.i@icanlocalize.com
|
| 11 |
* @since Types 1.3
|
| 12 |
*
|
| 13 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 14 |
-
* $LastChangedDate:
|
| 15 |
-
* $LastChangedRevision:
|
| 16 |
* $LastChangedBy: iworks $
|
| 17 |
*
|
| 18 |
*/
|
|
@@ -98,8 +98,7 @@ function wpcf_admin_menu_edit_user_fields() {
|
|
| 98 |
} else {
|
| 99 |
$title = __( 'Add New Usermeta Group', 'wpcf' );
|
| 100 |
}
|
| 101 |
-
|
| 102 |
-
|
| 103 |
$form = wpcf_form( 'wpcf_form_fields' );
|
| 104 |
echo '<br /><form method="post" action="" class="wpcf-fields-form '
|
| 105 |
. 'wpcf-form-validate" onsubmit="';
|
|
@@ -124,7 +123,7 @@ function wpcf_admin_menu_edit_user_fields() {
|
|
| 124 |
echo '">';
|
| 125 |
echo $form->renderForm();
|
| 126 |
echo '</form>';
|
| 127 |
-
|
| 128 |
}
|
| 129 |
|
| 130 |
/**
|
|
@@ -147,7 +146,7 @@ function wpcf_admin_menu_user_fields_control_hook() {
|
|
| 147 |
&& wp_verify_nonce( $_REQUEST['_wpnonce'],
|
| 148 |
'user_fields_control_bulk' )
|
| 149 |
&& (isset( $_POST['action'] ) || isset( $_POST['action2'] )) && !empty( $_POST['fields'] ) ) {
|
| 150 |
-
$action = $_POST['action'] == '-1' ? $_POST['action2'] : $_POST['action'];
|
| 151 |
wpcf_admin_user_fields_control_bulk_actions( $action );
|
| 152 |
}
|
| 153 |
|
|
@@ -165,13 +164,13 @@ function wpcf_admin_menu_user_fields_control_hook() {
|
|
| 165 |
*/
|
| 166 |
function wpcf_admin_menu_user_fields_control() {
|
| 167 |
global $wpcf_control_table;
|
| 168 |
-
|
| 169 |
echo '<br /><form method="post" action="" id="wpcf-custom-fields-control-form" class="wpcf-custom-fields-control-form '
|
| 170 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 171 |
echo wpcf_admin_custom_fields_control_form( $wpcf_control_table );
|
| 172 |
wp_nonce_field( 'user_fields_control_bulk' );
|
| 173 |
echo '</form>';
|
| 174 |
-
|
| 175 |
}
|
| 176 |
|
| 177 |
/**
|
|
@@ -180,18 +179,22 @@ function wpcf_admin_menu_user_fields_control() {
|
|
| 180 |
* @author Gen gen.i@icanlocalize.com
|
| 181 |
* @since Types 1.3
|
| 182 |
*/
|
| 183 |
-
function wpcf_usermeta_summary()
|
| 184 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 185 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 186 |
require_once WPCF_INC_ABSPATH . '/usermeta.php';
|
| 187 |
require_once WPCF_INC_ABSPATH . '/usermeta-list.php';
|
| 188 |
$to_display = wpcf_admin_fields_get_fields();
|
| 189 |
if ( !empty( $to_display ) ) {
|
| 190 |
-
add_action( 'wpcf_groups_list_table_after',
|
| 191 |
-
'wpcf_admin_promotional_text' );
|
| 192 |
}
|
| 193 |
wpcf_admin_usermeta_list();
|
| 194 |
-
|
| 195 |
}
|
| 196 |
|
| 197 |
//Add usermeta hook when user profile loaded
|
|
@@ -207,17 +210,13 @@ add_action( 'edit_user_profile_update', 'wpcf_admin_user_profile_save_hook' );
|
|
| 207 |
/**
|
| 208 |
* Add usermeta groups to post editor
|
| 209 |
*/
|
| 210 |
-
add_filter( 'editor_addon_menus_types',
|
| 211 |
-
'wpcf_admin_post_add_usermeta_to_editor_js' );
|
| 212 |
-
|
| 213 |
|
| 214 |
add_action( 'load-post.php', '__wpcf_usermeta_test', PHP_INT_MAX );
|
| 215 |
add_action( 'load-post-new.php', '__wpcf_usermeta_test', PHP_INT_MAX );
|
| 216 |
-
if ( is_admin() ) {
|
| 217 |
-
add_filter( 'wpcf_post_groups', '__wpcf_usermeta_test_groups' );
|
| 218 |
-
}
|
| 219 |
|
| 220 |
-
function __wpcf_usermeta_test()
|
|
|
|
| 221 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 222 |
$field['id'] = md5( 'date' . time() );
|
| 223 |
$here = array(basename( $_SERVER['REQUEST_URI'] ), basename( $_SERVER['SCRIPT_FILENAME'] ));
|
|
@@ -226,58 +225,27 @@ function __wpcf_usermeta_test() {
|
|
| 226 |
if ( $post ) {
|
| 227 |
$post_type = get_post_type( $post );
|
| 228 |
} else if ( !empty( $_GET['post'] ) ) {
|
| 229 |
-
$post_type = get_post_type( $_GET['post'] );
|
|
|
|
|
|
|
| 230 |
}
|
| 231 |
if ( ( $here[0] == ('index.php' || 'wp-admin')) && ( $here[1] != 'index.php') ) {
|
| 232 |
-
if (
|
| 233 |
-
|
| 234 |
-
|
|
|
|
| 235 |
return;
|
| 236 |
}
|
| 237 |
wpcf_admin_post_add_to_editor( $field );
|
| 238 |
}
|
| 239 |
}
|
| 240 |
|
| 241 |
-
function __wpcf_usermeta_test_groups( $groups ) {
|
| 242 |
-
if ( !empty( $groups ) ) {
|
| 243 |
-
return $groups;
|
| 244 |
-
}
|
| 245 |
-
$groups = wpcf_admin_fields_get_groups( 'wp-types-user-group' );
|
| 246 |
-
$check = false;
|
| 247 |
-
if ( !empty( $groups ) ) {
|
| 248 |
-
|
| 249 |
-
foreach ( $groups as $group_id => $group ) {
|
| 250 |
-
|
| 251 |
-
// Mark meta box as hidden
|
| 252 |
-
$groups[$group_id]['__show_meta_box'] = false;
|
| 253 |
-
|
| 254 |
-
if ( empty( $group['is_active'] ) ) {
|
| 255 |
-
unset( $groups[$group_id] );
|
| 256 |
-
continue;
|
| 257 |
-
}
|
| 258 |
-
$fields = wpcf_admin_fields_get_fields_by_group( $group['id'],
|
| 259 |
-
'slug', true, false, true, 'wp-types-user-group',
|
| 260 |
-
'wpcf-usermeta' );
|
| 261 |
-
if ( empty( $fields ) ) {
|
| 262 |
-
unset( $groups[$group_id] );
|
| 263 |
-
continue;
|
| 264 |
-
}
|
| 265 |
-
$check = true;
|
| 266 |
-
}
|
| 267 |
-
}
|
| 268 |
-
if ( !$check ) {
|
| 269 |
-
remove_action( 'admin_enqueue_scripts',
|
| 270 |
-
'wpcf_admin_post_add_to_editor_js' );
|
| 271 |
-
} else {
|
| 272 |
-
wpcf_edit_post_screen_scripts();
|
| 273 |
-
}
|
| 274 |
-
return $groups;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
if ( !isset( $_GET['post_type'] ) && isset( $_GET['post'] ) ) {
|
| 278 |
-
$post_type = get_post_type( $_GET['post'] );
|
| 279 |
-
} else if (
|
| 280 |
-
|
|
|
|
|
|
|
| 281 |
$post_type = $_GET['post_type'];
|
| 282 |
}
|
| 283 |
|
|
@@ -400,6 +368,8 @@ function wpcf_usermeta_get_shortcode( $field, $add = '', $content = '' ) {
|
|
| 400 |
/**
|
| 401 |
* Calls view function for specific usermeta field type.
|
| 402 |
*
|
|
|
|
|
|
|
| 403 |
* @param type $field
|
| 404 |
* @param type $atts (additional attributes: user_id, user_name, user_is_author, user_current)
|
| 405 |
* @return type
|
|
@@ -433,8 +403,12 @@ function types_render_usermeta( $field_id, $params, $content = null, $code = ''
|
|
| 433 |
if ( isset( $params['user_id'] ) ) {
|
| 434 |
$user_id = $params['user_id'];
|
| 435 |
} else if ( isset( $params['user_name'] ) ) { //Get user by login
|
| 436 |
-
$user_id = $wpdb->get_var(
|
| 437 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 438 |
} else if ( isset( $params['user_is_author'] ) ) { //Get Post author
|
| 439 |
$user_id = $post->post_author;
|
| 440 |
} else if ( isset( $params['user_current'] ) ) {//Get current logged user
|
|
@@ -563,6 +537,8 @@ function types_render_usermeta( $field_id, $params, $content = null, $code = ''
|
|
| 563 |
/**
|
| 564 |
* Calls view function for specific field type.
|
| 565 |
*
|
|
|
|
|
|
|
| 566 |
* @param type $field
|
| 567 |
* @param type $atts
|
| 568 |
* @return type
|
|
@@ -571,7 +547,7 @@ function types_render_usermeta_field( $field_id, $params, $content = null,
|
|
| 571 |
$code = '' ) {
|
| 572 |
|
| 573 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 574 |
-
global $wpcf, $post;
|
| 575 |
|
| 576 |
// HTML var holds actual output
|
| 577 |
$html = '';
|
|
@@ -603,8 +579,12 @@ function types_render_usermeta_field( $field_id, $params, $content = null,
|
|
| 603 |
if ( isset( $params['user_id'] ) ) {
|
| 604 |
$user_id = $params['user_id'];
|
| 605 |
} else if ( isset( $params['user_name'] ) ) { //Get user by login
|
| 606 |
-
$user_id = $wpdb->get_var(
|
| 607 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 608 |
} else if ( isset( $params['user_is_author'] ) ) { //Get Post author
|
| 609 |
$user_id = $post->post_author;
|
| 610 |
} else if ( isset( $params['user_current'] ) ) {//Get current logged user
|
|
@@ -721,9 +701,6 @@ function wpcf_admin_user_profile_load_hook( $user ){
|
|
| 721 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
| 722 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 723 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 724 |
-
add_action( 'admin_footer', 'wpcf_admin_fields_usermeta_styles' );
|
| 725 |
-
|
| 726 |
-
|
| 727 |
wpcf_admin_userprofile_init( $user );
|
| 728 |
}
|
| 729 |
|
|
@@ -746,8 +723,25 @@ function wpcf_admin_fields_usermeta_styles(){
|
|
| 746 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 747 |
$groups = wpcf_admin_fields_get_groups( 'wp-types-user-group' );
|
| 748 |
$content = '';
|
|
|
|
| 749 |
if ( !empty( $groups ) ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 750 |
foreach ( $groups as $group ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 751 |
$content .= str_replace( "}", '}'.PHP_EOL, wpcf_admin_get_groups_admin_styles_by_group( $group['id'] ) );
|
| 752 |
$content .= PHP_EOL;
|
| 753 |
}
|
|
@@ -996,18 +990,29 @@ class Post_Fields_Access
|
|
| 996 |
|
| 997 |
}
|
| 998 |
|
| 999 |
-
add_action( 'wp_ajax_wpcf_types_suggest_user',
|
| 1000 |
-
'wpcf_access_wpcf_types_suggest_user_ajax' );
|
| 1001 |
|
| 1002 |
/**
|
| 1003 |
* Suggest user AJAX.
|
|
|
|
|
|
|
|
|
|
| 1004 |
*/
|
| 1005 |
function wpcf_access_wpcf_types_suggest_user_ajax()
|
| 1006 |
{
|
| 1007 |
global $wpdb;
|
| 1008 |
$users = '';
|
| 1009 |
-
$q = wptoolset_esc_like(esc_sql( trim( $_GET['q'] ) ));
|
| 1010 |
-
$found = $wpdb->get_results(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1011 |
|
| 1012 |
if ( !empty( $found ) ) {
|
| 1013 |
foreach ( $found as $user ) {
|
|
@@ -1032,9 +1037,9 @@ function wpcf_get_usermeta_form_addon_submit( $views_usermeta = false ){
|
|
| 1032 |
}
|
| 1033 |
else {
|
| 1034 |
if ( $_POST['display_username_for_suser_selector'] == 'specific_user_by_id' ) {
|
| 1035 |
-
$add .= ' user_id="' . $_POST['display_username_for_suser_id_value'] . '"';
|
| 1036 |
} else {
|
| 1037 |
-
$add .= ' user_name="' . $_POST['display_username_for_suser_username_value'] . '"';
|
| 1038 |
}
|
| 1039 |
}
|
| 1040 |
}
|
|
@@ -1044,7 +1049,10 @@ function wpcf_get_usermeta_form_addon_submit( $views_usermeta = false ){
|
|
| 1044 |
/*
|
| 1045 |
* Usermeta fields addon.
|
| 1046 |
* Add form user users
|
| 1047 |
-
|
|
|
|
|
|
|
|
|
|
| 1048 |
|
| 1049 |
function wpcf_get_usermeta_form_addon( $settings = array() ){
|
| 1050 |
global $wpdb;
|
| 10 |
* @author Gen gen.i@icanlocalize.com
|
| 11 |
* @since Types 1.3
|
| 12 |
*
|
| 13 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/embedded/usermeta-init.php $
|
| 14 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 15 |
+
* $LastChangedRevision: 1125405 $
|
| 16 |
* $LastChangedBy: iworks $
|
| 17 |
*
|
| 18 |
*/
|
| 98 |
} else {
|
| 99 |
$title = __( 'Add New Usermeta Group', 'wpcf' );
|
| 100 |
}
|
| 101 |
+
wpcf_add_admin_header( $title );
|
|
|
|
| 102 |
$form = wpcf_form( 'wpcf_form_fields' );
|
| 103 |
echo '<br /><form method="post" action="" class="wpcf-fields-form '
|
| 104 |
. 'wpcf-form-validate" onsubmit="';
|
| 123 |
echo '">';
|
| 124 |
echo $form->renderForm();
|
| 125 |
echo '</form>';
|
| 126 |
+
wpcf_add_admin_footer();
|
| 127 |
}
|
| 128 |
|
| 129 |
/**
|
| 146 |
&& wp_verify_nonce( $_REQUEST['_wpnonce'],
|
| 147 |
'user_fields_control_bulk' )
|
| 148 |
&& (isset( $_POST['action'] ) || isset( $_POST['action2'] )) && !empty( $_POST['fields'] ) ) {
|
| 149 |
+
$action = ( $_POST['action'] == '-1' ) ? sanitize_text_field($_POST['action2']) : sanitize_text_field($_POST['action']);
|
| 150 |
wpcf_admin_user_fields_control_bulk_actions( $action );
|
| 151 |
}
|
| 152 |
|
| 164 |
*/
|
| 165 |
function wpcf_admin_menu_user_fields_control() {
|
| 166 |
global $wpcf_control_table;
|
| 167 |
+
wpcf_add_admin_header( __( 'User Fields Control', 'wpcf' ) );
|
| 168 |
echo '<br /><form method="post" action="" id="wpcf-custom-fields-control-form" class="wpcf-custom-fields-control-form '
|
| 169 |
. 'wpcf-form-validate" enctype="multipart/form-data">';
|
| 170 |
echo wpcf_admin_custom_fields_control_form( $wpcf_control_table );
|
| 171 |
wp_nonce_field( 'user_fields_control_bulk' );
|
| 172 |
echo '</form>';
|
| 173 |
+
wpcf_add_admin_footer();
|
| 174 |
}
|
| 175 |
|
| 176 |
/**
|
| 179 |
* @author Gen gen.i@icanlocalize.com
|
| 180 |
* @since Types 1.3
|
| 181 |
*/
|
| 182 |
+
function wpcf_usermeta_summary()
|
| 183 |
+
{
|
| 184 |
+
wpcf_add_admin_header(
|
| 185 |
+
__( 'User Fields', 'wpcf' ),
|
| 186 |
+
array('page' => 'wpcf-edit-usermeta'),
|
| 187 |
+
__('Add New Usermeta Group', 'wpcf')
|
| 188 |
+
);
|
| 189 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 190 |
require_once WPCF_INC_ABSPATH . '/usermeta.php';
|
| 191 |
require_once WPCF_INC_ABSPATH . '/usermeta-list.php';
|
| 192 |
$to_display = wpcf_admin_fields_get_fields();
|
| 193 |
if ( !empty( $to_display ) ) {
|
| 194 |
+
add_action( 'wpcf_groups_list_table_after', 'wpcf_admin_promotional_text' );
|
|
|
|
| 195 |
}
|
| 196 |
wpcf_admin_usermeta_list();
|
| 197 |
+
wpcf_add_admin_footer();
|
| 198 |
}
|
| 199 |
|
| 200 |
//Add usermeta hook when user profile loaded
|
| 210 |
/**
|
| 211 |
* Add usermeta groups to post editor
|
| 212 |
*/
|
| 213 |
+
add_filter( 'editor_addon_menus_types', 'wpcf_admin_post_add_usermeta_to_editor_js' );
|
|
|
|
|
|
|
| 214 |
|
| 215 |
add_action( 'load-post.php', '__wpcf_usermeta_test', PHP_INT_MAX );
|
| 216 |
add_action( 'load-post-new.php', '__wpcf_usermeta_test', PHP_INT_MAX );
|
|
|
|
|
|
|
|
|
|
| 217 |
|
| 218 |
+
function __wpcf_usermeta_test()
|
| 219 |
+
{
|
| 220 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 221 |
$field['id'] = md5( 'date' . time() );
|
| 222 |
$here = array(basename( $_SERVER['REQUEST_URI'] ), basename( $_SERVER['SCRIPT_FILENAME'] ));
|
| 225 |
if ( $post ) {
|
| 226 |
$post_type = get_post_type( $post );
|
| 227 |
} else if ( !empty( $_GET['post'] ) ) {
|
| 228 |
+
$post_type = get_post_type( sanitize_text_field( $_GET['post'] ) );
|
| 229 |
+
} else if ( !empty( $_GET['post_type'] ) ) {
|
| 230 |
+
$post_type = esc_html( sanitize_text_field( $_GET['post_type'] ) );
|
| 231 |
}
|
| 232 |
if ( ( $here[0] == ('index.php' || 'wp-admin')) && ( $here[1] != 'index.php') ) {
|
| 233 |
+
if (
|
| 234 |
+
isset( $post_type )
|
| 235 |
+
&& in_array( $post_type, array('view', 'view-template', 'cred-form') )
|
| 236 |
+
) {
|
| 237 |
return;
|
| 238 |
}
|
| 239 |
wpcf_admin_post_add_to_editor( $field );
|
| 240 |
}
|
| 241 |
}
|
| 242 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 243 |
if ( !isset( $_GET['post_type'] ) && isset( $_GET['post'] ) ) {
|
| 244 |
+
$post_type = get_post_type( sanitize_text_field( $_GET['post'] ) );
|
| 245 |
+
} else if (
|
| 246 |
+
isset( $_GET['post_type'] )
|
| 247 |
+
&& in_array( $_GET['post_type'], get_post_types( array('show_ui' => true) ) )
|
| 248 |
+
) {
|
| 249 |
$post_type = $_GET['post_type'];
|
| 250 |
}
|
| 251 |
|
| 368 |
/**
|
| 369 |
* Calls view function for specific usermeta field type.
|
| 370 |
*
|
| 371 |
+
* @global object $wpdb
|
| 372 |
+
*
|
| 373 |
* @param type $field
|
| 374 |
* @param type $atts (additional attributes: user_id, user_name, user_is_author, user_current)
|
| 375 |
* @return type
|
| 403 |
if ( isset( $params['user_id'] ) ) {
|
| 404 |
$user_id = $params['user_id'];
|
| 405 |
} else if ( isset( $params['user_name'] ) ) { //Get user by login
|
| 406 |
+
$user_id = $wpdb->get_var(
|
| 407 |
+
$wpdb->prepare(
|
| 408 |
+
"SELECT * FROM " . $wpdb->users . " WHERE user_login = %s",
|
| 409 |
+
$params['user_name']
|
| 410 |
+
)
|
| 411 |
+
);
|
| 412 |
} else if ( isset( $params['user_is_author'] ) ) { //Get Post author
|
| 413 |
$user_id = $post->post_author;
|
| 414 |
} else if ( isset( $params['user_current'] ) ) {//Get current logged user
|
| 537 |
/**
|
| 538 |
* Calls view function for specific field type.
|
| 539 |
*
|
| 540 |
+
* @global object $wpdb
|
| 541 |
+
*
|
| 542 |
* @param type $field
|
| 543 |
* @param type $atts
|
| 544 |
* @return type
|
| 547 |
$code = '' ) {
|
| 548 |
|
| 549 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 550 |
+
global $wpcf, $post, $wpdb;
|
| 551 |
|
| 552 |
// HTML var holds actual output
|
| 553 |
$html = '';
|
| 579 |
if ( isset( $params['user_id'] ) ) {
|
| 580 |
$user_id = $params['user_id'];
|
| 581 |
} else if ( isset( $params['user_name'] ) ) { //Get user by login
|
| 582 |
+
$user_id = $wpdb->get_var(
|
| 583 |
+
$wpdb->prepare(
|
| 584 |
+
"SELECT * FROM " . $wpdb->users . " WHERE user_login = %s",
|
| 585 |
+
$params['user_name']
|
| 586 |
+
)
|
| 587 |
+
);
|
| 588 |
} else if ( isset( $params['user_is_author'] ) ) { //Get Post author
|
| 589 |
$user_id = $post->post_author;
|
| 590 |
} else if ( isset( $params['user_current'] ) ) {//Get current logged user
|
| 701 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
| 702 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 703 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
|
|
|
|
|
|
|
|
|
| 704 |
wpcf_admin_userprofile_init( $user );
|
| 705 |
}
|
| 706 |
|
| 723 |
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 724 |
$groups = wpcf_admin_fields_get_groups( 'wp-types-user-group' );
|
| 725 |
$content = '';
|
| 726 |
+
|
| 727 |
if ( !empty( $groups ) ) {
|
| 728 |
+
global $user_id;
|
| 729 |
+
$user_role = false;
|
| 730 |
+
if ( !empty( $user_id ) ) {
|
| 731 |
+
$user_info = get_userdata($user_id);
|
| 732 |
+
$user_role = isset($user_info->roles) ? array_shift($user_info->roles) : 'subscriber';
|
| 733 |
+
unset($user_info);
|
| 734 |
+
}
|
| 735 |
foreach ( $groups as $group ) {
|
| 736 |
+
if ( !empty($user_id) ) {
|
| 737 |
+
$for_users = wpcf_admin_get_groups_showfor_by_group($group['id']);
|
| 738 |
+
if ( !empty($for_users) && !in_array($user_role, $for_users) ) {
|
| 739 |
+
continue;
|
| 740 |
+
}
|
| 741 |
+
}
|
| 742 |
+
if ( empty( $group['is_active'] ) ) {
|
| 743 |
+
continue;
|
| 744 |
+
}
|
| 745 |
$content .= str_replace( "}", '}'.PHP_EOL, wpcf_admin_get_groups_admin_styles_by_group( $group['id'] ) );
|
| 746 |
$content .= PHP_EOL;
|
| 747 |
}
|
| 990 |
|
| 991 |
}
|
| 992 |
|
| 993 |
+
add_action( 'wp_ajax_wpcf_types_suggest_user', 'wpcf_access_wpcf_types_suggest_user_ajax' );
|
|
|
|
| 994 |
|
| 995 |
/**
|
| 996 |
* Suggest user AJAX.
|
| 997 |
+
*
|
| 998 |
+
* @todo nonce
|
| 999 |
+
* @todo auth
|
| 1000 |
*/
|
| 1001 |
function wpcf_access_wpcf_types_suggest_user_ajax()
|
| 1002 |
{
|
| 1003 |
global $wpdb;
|
| 1004 |
$users = '';
|
| 1005 |
+
$q = '%'.wptoolset_esc_like(esc_sql( trim( $_GET['q'] ) )).'%';
|
| 1006 |
+
$found = $wpdb->get_results(
|
| 1007 |
+
$wpdb->prepare(
|
| 1008 |
+
"SELECT ID, display_name, user_login FROM $wpdb->users WHERE user_nicename LIKE %s OR user_login LIKE %s OR display_name LIKE %s OR user_email LIKE %s LIMIT %d",
|
| 1009 |
+
$q,
|
| 1010 |
+
$q,
|
| 1011 |
+
$q,
|
| 1012 |
+
$q,
|
| 1013 |
+
10
|
| 1014 |
+
)
|
| 1015 |
+
);
|
| 1016 |
|
| 1017 |
if ( !empty( $found ) ) {
|
| 1018 |
foreach ( $found as $user ) {
|
| 1037 |
}
|
| 1038 |
else {
|
| 1039 |
if ( $_POST['display_username_for_suser_selector'] == 'specific_user_by_id' ) {
|
| 1040 |
+
$add .= ' user_id="' . sanitize_text_field($_POST['display_username_for_suser_id_value']) . '"';
|
| 1041 |
} else {
|
| 1042 |
+
$add .= ' user_name="' . sanitize_text_field($_POST['display_username_for_suser_username_value']) . '"';
|
| 1043 |
}
|
| 1044 |
}
|
| 1045 |
}
|
| 1049 |
/*
|
| 1050 |
* Usermeta fields addon.
|
| 1051 |
* Add form user users
|
| 1052 |
+
*
|
| 1053 |
+
* @global object $wpdb
|
| 1054 |
+
*
|
| 1055 |
+
*/
|
| 1056 |
|
| 1057 |
function wpcf_get_usermeta_form_addon( $settings = array() ){
|
| 1058 |
global $wpdb;
|
embedded/views/image.php
CHANGED
|
@@ -649,10 +649,12 @@ class Types_Image_Utils
|
|
| 649 |
$upload_dir = self::uploadInfo();
|
| 650 |
if ( $upload_dir ) {
|
| 651 |
$parsed = parse_url( $imgUrl );
|
|
|
|
|
|
|
|
|
|
| 652 |
$upload_dir_parsed = parse_url( $upload_dir['baseurl'] );
|
| 653 |
// This works for regular installation and main blog on multisite
|
| 654 |
-
if ( (!is_multisite() || is_main_site()) && strpos( $parsed['path'],
|
| 655 |
-
$upload_dir_parsed['path'] ) === 0 ) {
|
| 656 |
return true;
|
| 657 |
// Check Multisite
|
| 658 |
} else if ( is_multisite() && !is_main_site() ) {
|
| 649 |
$upload_dir = self::uploadInfo();
|
| 650 |
if ( $upload_dir ) {
|
| 651 |
$parsed = parse_url( $imgUrl );
|
| 652 |
+
if ( !isset($upload_dir['baseurl'] ) ) {
|
| 653 |
+
return false;
|
| 654 |
+
}
|
| 655 |
$upload_dir_parsed = parse_url( $upload_dir['baseurl'] );
|
| 656 |
// This works for regular installation and main blog on multisite
|
| 657 |
+
if ( (!is_multisite() || is_main_site()) && strpos( $parsed['path'], $upload_dir_parsed['path'] ) === 0 ) {
|
|
|
|
| 658 |
return true;
|
| 659 |
// Check Multisite
|
| 660 |
} else if ( is_multisite() && !is_main_site() ) {
|
embedded/views/templates/editor-modal-checkbox.tpl.php
CHANGED
|
@@ -34,11 +34,11 @@ $data = array_merge( array(
|
|
| 34 |
<div id="cb-states" class="group-nested" data-bind="visible: cb_mode() == 'value'">
|
| 35 |
<p>
|
| 36 |
<label for="cb-sel" class="input-title"><?php _e( 'Selected:', 'wpcf' ); ?></label>
|
| 37 |
-
<input id="cb-sel" type="text" name="selected" value="<?php echo $data['selected']; ?>" />
|
| 38 |
</p>
|
| 39 |
<p>
|
| 40 |
<label for="cb-not-sel" class="input-title"><?php _e( 'Not selected:', 'wpcf' ); ?></label>
|
| 41 |
-
|
| 42 |
</p>
|
| 43 |
</div>
|
| 44 |
|
|
@@ -49,4 +49,4 @@ $data = array_merge( array(
|
|
| 49 |
</div>
|
| 50 |
|
| 51 |
|
| 52 |
-
</script><!--END TYPES MODAL CHECKBOX-->
|
| 34 |
<div id="cb-states" class="group-nested" data-bind="visible: cb_mode() == 'value'">
|
| 35 |
<p>
|
| 36 |
<label for="cb-sel" class="input-title"><?php _e( 'Selected:', 'wpcf' ); ?></label>
|
| 37 |
+
<input id="cb-sel" type="text" name="selected" value="<?php echo $data['selected']; ?>"placeholder="<?php _e('Enter selected value', 'wpcf'); ?>" />
|
| 38 |
</p>
|
| 39 |
<p>
|
| 40 |
<label for="cb-not-sel" class="input-title"><?php _e( 'Not selected:', 'wpcf' ); ?></label>
|
| 41 |
+
<input id="cb-not-sel" type="text" name="not_selected" value="<?php echo $data['not_selected']; ?>" placeholder="<?php _e('Enter not selected value', 'wpcf'); ?>" />
|
| 42 |
</p>
|
| 43 |
</div>
|
| 44 |
|
| 49 |
</div>
|
| 50 |
|
| 51 |
|
| 52 |
+
</script><!--END TYPES MODAL CHECKBOX-->
|
embedded/views/templates/editor-modal-checkboxes.tpl.php
CHANGED
|
@@ -42,11 +42,11 @@ $data = array_merge( array(
|
|
| 42 |
<h3><?php echo $cb[ 'title' ]; ?></h3>
|
| 43 |
<p>
|
| 44 |
<label for="cbs-sel-<?php echo $key ?>" class="input-title"><?php _e( 'Selected:', 'wpcf' ); ?></label>
|
| 45 |
-
<input id="cbs-sel-<?php echo $key ?>" type="text" name="options[<?php echo $cb[ 'id' ]; ?>][selected]" value="<?php echo $cb[ 'selected' ]; ?>" />
|
| 46 |
</p>
|
| 47 |
<p>
|
| 48 |
<label for="cbs-not-sel-<?php echo $key ?>" class="input-title"><?php _e( 'Not selected:', 'wpcf' ); ?></label>
|
| 49 |
-
<input id="cbs-not-sel-<?php echo $key ?>" type="text" name="options[<?php echo $cb[ 'id' ]; ?>][not_selected]" value="<?php echo $cb[ 'not_selected' ]; ?>" />
|
| 50 |
</p>
|
| 51 |
</div>
|
| 52 |
<?php endforeach; ?>
|
|
@@ -60,4 +60,4 @@ $data = array_merge( array(
|
|
| 60 |
|
| 61 |
</div>
|
| 62 |
|
| 63 |
-
</script><!--END TYPES MODAL CHECKBOXES-->
|
| 42 |
<h3><?php echo $cb[ 'title' ]; ?></h3>
|
| 43 |
<p>
|
| 44 |
<label for="cbs-sel-<?php echo $key ?>" class="input-title"><?php _e( 'Selected:', 'wpcf' ); ?></label>
|
| 45 |
+
<input id="cbs-sel-<?php echo $key ?>" type="text" name="options[<?php echo $cb[ 'id' ]; ?>][selected]" value="<?php echo $cb[ 'selected' ]; ?>" placeholder="<?php _e('Enter selected value', 'wpcf'); ?>" />
|
| 46 |
</p>
|
| 47 |
<p>
|
| 48 |
<label for="cbs-not-sel-<?php echo $key ?>" class="input-title"><?php _e( 'Not selected:', 'wpcf' ); ?></label>
|
| 49 |
+
<input id="cbs-not-sel-<?php echo $key ?>" type="text" name="options[<?php echo $cb[ 'id' ]; ?>][not_selected]" value="<?php echo $cb[ 'not_selected' ]; ?>" placeholder="<?php _e('Enter not selected value', 'wpcf'); ?>" />
|
| 50 |
</p>
|
| 51 |
</div>
|
| 52 |
<?php endforeach; ?>
|
| 60 |
|
| 61 |
</div>
|
| 62 |
|
| 63 |
+
</script><!--END TYPES MODAL CHECKBOXES-->
|
embedded/views/templates/editor-modal-date.tpl.php
CHANGED
|
@@ -27,10 +27,6 @@ $data = array_merge( array(
|
|
| 27 |
<input id="date-calendar" type="radio" name="style" value="calendar" data-bind="checked: date_mode, click: dateStyling" />
|
| 28 |
<label for="date-calendar"><?php _e( 'Show as calendar ', 'wpcf' ); ?></label>
|
| 29 |
</li>
|
| 30 |
-
<li>
|
| 31 |
-
<input id="date-human-time-diff" type="radio" name="style" value="human-time-diff" data-bind="checked: date_mode, click: dateStyling" />
|
| 32 |
-
<label for="date-human-time-diff"><?php _e( 'Show as human time diff ', 'wpcf' ); ?></label>
|
| 33 |
-
</li>
|
| 34 |
<li>
|
| 35 |
<input id="date-text" type="radio" name="style" value="text" data-bind="checked: date_mode, click: dateStyling" />
|
| 36 |
<label for="date-text"><?php _e( 'Show as text', 'wpcf' ); ?></label>
|
| 27 |
<input id="date-calendar" type="radio" name="style" value="calendar" data-bind="checked: date_mode, click: dateStyling" />
|
| 28 |
<label for="date-calendar"><?php _e( 'Show as calendar ', 'wpcf' ); ?></label>
|
| 29 |
</li>
|
|
|
|
|
|
|
|
|
|
|
|
|
| 30 |
<li>
|
| 31 |
<input id="date-text" type="radio" name="style" value="text" data-bind="checked: date_mode, click: dateStyling" />
|
| 32 |
<label for="date-text"><?php _e( 'Show as text', 'wpcf' ); ?></label>
|
help.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
/*
|
| 3 |
* Plugin contextual help
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
* $LastChangedDate: 2014-05-29 08:44:10 +0000 (Thu, 29 May 2014) $
|
| 7 |
* $LastChangedRevision: 922956 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 2 |
/*
|
| 3 |
* Plugin contextual help
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/help.php $
|
| 6 |
* $LastChangedDate: 2014-05-29 08:44:10 +0000 (Thu, 29 May 2014) $
|
| 7 |
* $LastChangedRevision: 922956 $
|
| 8 |
* $LastChangedBy: iworks $
|
includes/ajax.php
CHANGED
|
@@ -2,6 +2,9 @@
|
|
| 2 |
|
| 3 |
/**
|
| 4 |
* All AJAX calls go here.
|
|
|
|
|
|
|
|
|
|
| 5 |
*/
|
| 6 |
function wpcf_ajax() {
|
| 7 |
if (!current_user_can('manage_options')
|
|
@@ -23,10 +26,12 @@ function wpcf_ajax() {
|
|
| 23 |
case 'delete_usermeta':
|
| 24 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 25 |
if (isset($_GET['field_id'])) {
|
| 26 |
-
|
|
|
|
| 27 |
}
|
| 28 |
if (isset($_GET['field'])) {
|
| 29 |
-
|
|
|
|
| 30 |
}
|
| 31 |
echo json_encode(array(
|
| 32 |
'output' => ''
|
|
@@ -58,6 +63,8 @@ function wpcf_ajax() {
|
|
| 58 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 59 |
. intval($_GET['group_id']) . '").html("' . __('No', 'wpcf') . '");',
|
| 60 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
|
|
|
|
|
|
| 61 |
));
|
| 62 |
} else {
|
| 63 |
echo json_encode(array(
|
|
@@ -79,6 +86,8 @@ function wpcf_ajax() {
|
|
| 79 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 80 |
. intval($_GET['group_id']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 81 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
|
|
|
|
|
|
| 82 |
));
|
| 83 |
} else {
|
| 84 |
echo json_encode(array(
|
|
@@ -129,8 +138,8 @@ function wpcf_ajax() {
|
|
| 129 |
case 'remove_field_from_group':
|
| 130 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 131 |
if (isset($_GET['group_id']) && isset($_GET['field_id'])) {
|
| 132 |
-
wpcf_admin_fields_remove_field_from_group($_GET['group_id'],
|
| 133 |
-
$_GET['field_id']);
|
| 134 |
}
|
| 135 |
break;
|
| 136 |
|
|
@@ -146,6 +155,8 @@ function wpcf_ajax() {
|
|
| 146 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 147 |
. intval($_GET['group_id']) . '").html("' . __('No', 'wpcf') . '");',
|
| 148 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
|
|
|
|
|
|
| 149 |
));
|
| 150 |
} else {
|
| 151 |
echo json_encode(array(
|
|
@@ -166,6 +177,8 @@ function wpcf_ajax() {
|
|
| 166 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 167 |
. intval($_GET['group_id']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 168 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
|
|
|
|
|
|
| 169 |
));
|
| 170 |
} else {
|
| 171 |
echo json_encode(array(
|
|
@@ -194,15 +207,16 @@ function wpcf_ajax() {
|
|
| 194 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 195 |
if (isset($custom_types[$_GET['wpcf-post-type']])) {
|
| 196 |
$custom_types[$_GET['wpcf-post-type']]['disabled'] = 1;
|
|
|
|
| 197 |
update_option('wpcf-custom-types', $custom_types);
|
| 198 |
echo json_encode(array(
|
| 199 |
'output' => __('Post type deactivated', 'wpcf'),
|
| 200 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 201 |
-
. $_GET['wpcf-post-type'] . '").replaceWith(\''
|
| 202 |
. wpcf_admin_custom_types_get_ajax_activation_link(esc_attr(
|
| 203 |
$_GET['wpcf-post-type']))
|
| 204 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 205 |
-
. $_GET['wpcf-post-type'] . '").html("' . __('No', 'wpcf') . '");',
|
| 206 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 207 |
));
|
| 208 |
} else {
|
|
@@ -220,14 +234,15 @@ function wpcf_ajax() {
|
|
| 220 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 221 |
if (isset($custom_types[$_GET['wpcf-post-type']])) {
|
| 222 |
$custom_types[$_GET['wpcf-post-type']]['disabled'] = 0;
|
|
|
|
| 223 |
update_option('wpcf-custom-types', $custom_types);
|
| 224 |
echo json_encode(array(
|
| 225 |
'output' => __('Post type activated', 'wpcf'),
|
| 226 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 227 |
-
. $_GET['wpcf-post-type'] . '").replaceWith(\''
|
| 228 |
-
. wpcf_admin_custom_types_get_ajax_deactivation_link($_GET['wpcf-post-type'])
|
| 229 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 230 |
-
. $_GET['wpcf-post-type'] . '").html("' . __('Yes', 'wpcf') . '");',
|
| 231 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 232 |
));
|
| 233 |
} else {
|
|
@@ -245,9 +260,17 @@ function wpcf_ajax() {
|
|
| 245 |
$custom_type = strval($_GET['wpcf-post-type']);
|
| 246 |
|
| 247 |
/**
|
| 248 |
-
*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 249 |
*/
|
| 250 |
-
if ( apply_filters('wpcf_delete_relation_meta', false) ) {
|
| 251 |
global $wpdb;
|
| 252 |
$wpdb->delete(
|
| 253 |
$wpdb->postmeta,
|
|
@@ -270,6 +293,7 @@ function wpcf_ajax() {
|
|
| 270 |
&& array_key_exists( $custom_type, $custom_types[$post_type]['post_relationship']['has'] )
|
| 271 |
) {
|
| 272 |
unset($custom_types[$post_type]['post_relationship']['has'][$custom_type]);
|
|
|
|
| 273 |
}
|
| 274 |
/**
|
| 275 |
* remove "belongs" relation
|
|
@@ -279,6 +303,7 @@ function wpcf_ajax() {
|
|
| 279 |
&& array_key_exists( $custom_type, $custom_types[$post_type]['post_relationship']['belongs'] )
|
| 280 |
) {
|
| 281 |
unset($custom_types[$post_type]['post_relationship']['belongs'][$custom_type]);
|
|
|
|
| 282 |
}
|
| 283 |
}
|
| 284 |
}
|
|
@@ -287,7 +312,7 @@ function wpcf_ajax() {
|
|
| 287 |
echo json_encode(array(
|
| 288 |
'output' => '',
|
| 289 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 290 |
-
. $_GET['wpcf-post-type']
|
| 291 |
. '").parents("tr").css("background-color", "#FF0000").fadeOut();',
|
| 292 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 293 |
));
|
|
@@ -301,14 +326,15 @@ function wpcf_ajax() {
|
|
| 301 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 302 |
if (isset($custom_taxonomies[$_GET['wpcf-tax']])) {
|
| 303 |
$custom_taxonomies[$_GET['wpcf-tax']]['disabled'] = 1;
|
|
|
|
| 304 |
update_option('wpcf-custom-taxonomies', $custom_taxonomies);
|
| 305 |
echo json_encode(array(
|
| 306 |
'output' => __('Taxonomy deactivated', 'wpcf'),
|
| 307 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 308 |
-
. $_GET['wpcf-tax'] . '").replaceWith(\''
|
| 309 |
-
. wpcf_admin_custom_taxonomies_get_ajax_activation_link($_GET['wpcf-tax'])
|
| 310 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 311 |
-
. $_GET['wpcf-tax'] . '").html("' . __('No', 'wpcf') . '");',
|
| 312 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 313 |
));
|
| 314 |
} else {
|
|
@@ -326,14 +352,15 @@ function wpcf_ajax() {
|
|
| 326 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 327 |
if (isset($custom_taxonomies[$_GET['wpcf-tax']])) {
|
| 328 |
$custom_taxonomies[$_GET['wpcf-tax']]['disabled'] = 0;
|
|
|
|
| 329 |
update_option('wpcf-custom-taxonomies', $custom_taxonomies);
|
| 330 |
echo json_encode(array(
|
| 331 |
'output' => __('Taxonomy activated', 'wpcf'),
|
| 332 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 333 |
-
. $_GET['wpcf-tax'] . '").replaceWith(\''
|
| 334 |
-
. wpcf_admin_custom_taxonomies_get_ajax_deactivation_link($_GET['wpcf-tax'])
|
| 335 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 336 |
-
. $_GET['wpcf-tax'] . '").html("' . __('Yes', 'wpcf') . '");',
|
| 337 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 338 |
));
|
| 339 |
} else {
|
|
@@ -355,7 +382,7 @@ function wpcf_ajax() {
|
|
| 355 |
echo json_encode(array(
|
| 356 |
'output' => '',
|
| 357 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 358 |
-
. $_GET['wpcf-tax']
|
| 359 |
. '").parents("tr").css("background-color", "#FF0000").fadeOut();',
|
| 360 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 361 |
));
|
|
@@ -404,24 +431,25 @@ function wpcf_ajax() {
|
|
| 404 |
|
| 405 |
case 'group_form_collapsed':
|
| 406 |
require_once WPCF_INC_ABSPATH . '/fields-form.php';
|
| 407 |
-
$group_id = $_GET['group_id'];
|
| 408 |
-
$action = $_GET['toggle'];
|
| 409 |
-
$fieldset = $_GET['id'];
|
| 410 |
wpcf_admin_fields_form_save_open_fieldset($action, $fieldset,
|
| 411 |
$group_id);
|
| 412 |
break;
|
| 413 |
|
| 414 |
case 'form_fieldset_toggle':
|
| 415 |
-
$action = $_GET['toggle'];
|
| 416 |
-
$fieldset = $_GET['id'];
|
| 417 |
wpcf_admin_form_fieldset_save_toggle($action, $fieldset);
|
| 418 |
break;
|
| 419 |
|
| 420 |
case 'group_update_post_types':
|
| 421 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
|
|
|
| 422 |
$post_types = empty($_GET['wpcf']['group']['supports']) ? array() : $_GET['wpcf']['group']['supports'];
|
| 423 |
if (!empty($_GET['group_id'])) {
|
| 424 |
-
wpcf_admin_fields_save_group_post_types($_GET['group_id'],
|
| 425 |
$post_types);
|
| 426 |
$output = array();
|
| 427 |
foreach ($post_types as $post_type) {
|
|
@@ -452,7 +480,7 @@ function wpcf_ajax() {
|
|
| 452 |
}
|
| 453 |
}
|
| 454 |
if (!empty($_GET['group_id'])) {
|
| 455 |
-
wpcf_admin_fields_save_group_terms($_GET['group_id'], $terms);
|
| 456 |
$output = array();
|
| 457 |
foreach ($taxonomies_post as $taxonomy => $terms) {
|
| 458 |
$taxonomy = get_taxonomy($taxonomy);
|
|
@@ -488,10 +516,10 @@ function wpcf_ajax() {
|
|
| 488 |
case 'delete_field':
|
| 489 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 490 |
if (isset($_GET['field_id'])) {
|
| 491 |
-
wpcf_admin_fields_delete_field($_GET['field_id']);
|
| 492 |
}
|
| 493 |
if (isset($_GET['field'])) {
|
| 494 |
-
wpcf_admin_fields_delete_field($_GET['field']);
|
| 495 |
}
|
| 496 |
echo json_encode(array(
|
| 497 |
'output' => ''
|
|
@@ -523,7 +551,7 @@ function wpcf_ajax() {
|
|
| 523 |
));
|
| 524 |
} else {
|
| 525 |
$data['id'] = str_replace('_conditional_display', '',
|
| 526 |
-
$_GET['field']);
|
| 527 |
$output = wpcf_form_simple(wpcf_cd_admin_form_single_filter($data,
|
| 528 |
array(), null, false));
|
| 529 |
if (!empty($data['id'])) {
|
|
@@ -547,7 +575,7 @@ function wpcf_ajax() {
|
|
| 547 |
if (!empty($_GET['parent']) && !empty($_GET['child'])) {
|
| 548 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 549 |
require_once WPCF_INC_ABSPATH . '/post-relationship.php';
|
| 550 |
-
wpcf_pr_admin_edit_fields($_GET['parent'], $_GET['child']);
|
| 551 |
}
|
| 552 |
break;
|
| 553 |
|
|
@@ -571,8 +599,8 @@ function wpcf_ajax() {
|
|
| 571 |
if (isset($_GET['field']) && isset($_GET['subaction'])) {
|
| 572 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 573 |
$option = $_GET['meta_type'] == 'usermeta' ? 'wpcf-usermeta' : 'wpcf-fields';
|
| 574 |
-
$meta_type = $_GET['meta_type'];
|
| 575 |
-
$field = wpcf_admin_fields_get_field($_GET['field'], false, false,
|
| 576 |
false, $option);
|
| 577 |
|
| 578 |
$_txt_updates = $meta_type == 'usermeta' ? __( '%d users require update',
|
|
@@ -595,7 +623,7 @@ function wpcf_ajax() {
|
|
| 595 |
. sprintf($_txt_updates, count($posts)) . ' '
|
| 596 |
. '<a href="javascript:void(0);" class="button-primary" onclick="'
|
| 597 |
. 'wpcfCbSaveEmptyMigrate(jQuery(this).parent().parent().parent(), \''
|
| 598 |
-
. $_GET['field'] . '\', '
|
| 599 |
. count($posts) . ', \''
|
| 600 |
. wp_create_nonce('cb_save_empty_migrate') . '\', \'';
|
| 601 |
$output .= $_GET['subaction'] == 'save_check' ? 'save' : 'do_not_save';
|
|
@@ -623,7 +651,7 @@ function wpcf_ajax() {
|
|
| 623 |
$output = '<script type="text/javascript">wpcfCbMigrateStep('
|
| 624 |
. intval($_GET['total']) . ','
|
| 625 |
. $posts['offset'] . ','
|
| 626 |
-
. '\'' . $_GET['field'] . '\','
|
| 627 |
. '\'' . wp_create_nonce('cb_save_empty_migrate')
|
| 628 |
. '\', \'' . $meta_type . '\');</script>'
|
| 629 |
. number_format($posts['offset'])
|
| 2 |
|
| 3 |
/**
|
| 4 |
* All AJAX calls go here.
|
| 5 |
+
*
|
| 6 |
+
* @global object $wpdb
|
| 7 |
+
*
|
| 8 |
*/
|
| 9 |
function wpcf_ajax() {
|
| 10 |
if (!current_user_can('manage_options')
|
| 26 |
case 'delete_usermeta':
|
| 27 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 28 |
if (isset($_GET['field_id'])) {
|
| 29 |
+
$field_id = sanitize_text_field( $_GET['field_id'] );
|
| 30 |
+
wpcf_admin_fields_delete_field($field_id,'wp-types-user-group','wpcf-usermeta');
|
| 31 |
}
|
| 32 |
if (isset($_GET['field'])) {
|
| 33 |
+
$field = sanitize_text_field( $_GET['field'] );
|
| 34 |
+
wpcf_admin_fields_delete_field($field,'wp-types-user-group','wpcf-usermeta');
|
| 35 |
}
|
| 36 |
echo json_encode(array(
|
| 37 |
'output' => ''
|
| 63 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 64 |
. intval($_GET['group_id']) . '").html("' . __('No', 'wpcf') . '");',
|
| 65 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 66 |
+
'status' => 'inactive',
|
| 67 |
+
'status_label' => __('No', 'wpcf'),
|
| 68 |
));
|
| 69 |
} else {
|
| 70 |
echo json_encode(array(
|
| 86 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 87 |
. intval($_GET['group_id']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 88 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 89 |
+
'status' => 'active',
|
| 90 |
+
'status_label' => __('Yes', 'wpcf'),
|
| 91 |
));
|
| 92 |
} else {
|
| 93 |
echo json_encode(array(
|
| 138 |
case 'remove_field_from_group':
|
| 139 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 140 |
if (isset($_GET['group_id']) && isset($_GET['field_id'])) {
|
| 141 |
+
wpcf_admin_fields_remove_field_from_group(intval($_GET['group_id']),
|
| 142 |
+
sanitize_text_field($_GET['field_id']));
|
| 143 |
}
|
| 144 |
break;
|
| 145 |
|
| 155 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 156 |
. intval($_GET['group_id']) . '").html("' . __('No', 'wpcf') . '");',
|
| 157 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 158 |
+
'status' => 'inactive',
|
| 159 |
+
'status_label' => __('No', 'wpcf'),
|
| 160 |
));
|
| 161 |
} else {
|
| 162 |
echo json_encode(array(
|
| 177 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 178 |
. intval($_GET['group_id']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 179 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 180 |
+
'status' => 'active',
|
| 181 |
+
'status_label' => __('Yes', 'wpcf'),
|
| 182 |
));
|
| 183 |
} else {
|
| 184 |
echo json_encode(array(
|
| 207 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 208 |
if (isset($custom_types[$_GET['wpcf-post-type']])) {
|
| 209 |
$custom_types[$_GET['wpcf-post-type']]['disabled'] = 1;
|
| 210 |
+
$custom_types[$_GET['wpcf-post-type']][TOOLSET_EDIT_LAST] = time();
|
| 211 |
update_option('wpcf-custom-types', $custom_types);
|
| 212 |
echo json_encode(array(
|
| 213 |
'output' => __('Post type deactivated', 'wpcf'),
|
| 214 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 215 |
+
. sanitize_text_field($_GET['wpcf-post-type']) . '").replaceWith(\''
|
| 216 |
. wpcf_admin_custom_types_get_ajax_activation_link(esc_attr(
|
| 217 |
$_GET['wpcf-post-type']))
|
| 218 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 219 |
+
. sanitize_text_field($_GET['wpcf-post-type']) . '").html("' . __('No', 'wpcf') . '");',
|
| 220 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 221 |
));
|
| 222 |
} else {
|
| 234 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 235 |
if (isset($custom_types[$_GET['wpcf-post-type']])) {
|
| 236 |
$custom_types[$_GET['wpcf-post-type']]['disabled'] = 0;
|
| 237 |
+
$custom_types[$_GET['wpcf-post-type']][TOOLSET_EDIT_LAST] = time();
|
| 238 |
update_option('wpcf-custom-types', $custom_types);
|
| 239 |
echo json_encode(array(
|
| 240 |
'output' => __('Post type activated', 'wpcf'),
|
| 241 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 242 |
+
. sanitize_text_field($_GET['wpcf-post-type']) . '").replaceWith(\''
|
| 243 |
+
. wpcf_admin_custom_types_get_ajax_deactivation_link(sanitize_text_field($_GET['wpcf-post-type']))
|
| 244 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 245 |
+
. sanitize_text_field($_GET['wpcf-post-type']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 246 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 247 |
));
|
| 248 |
} else {
|
| 260 |
$custom_type = strval($_GET['wpcf-post-type']);
|
| 261 |
|
| 262 |
/**
|
| 263 |
+
* Delete relation between custom posts types
|
| 264 |
+
*
|
| 265 |
+
* Filter allow to delete all custom fields used to make
|
| 266 |
+
* a relation between posts.
|
| 267 |
+
*
|
| 268 |
+
* @since 1.6.4
|
| 269 |
+
*
|
| 270 |
+
* @param bool $delete True or false flag to delete relationships.
|
| 271 |
+
* @param string $var Currently deleted custom post type.
|
| 272 |
*/
|
| 273 |
+
if ( apply_filters('wpcf_delete_relation_meta', false, $custom_type) ) {
|
| 274 |
global $wpdb;
|
| 275 |
$wpdb->delete(
|
| 276 |
$wpdb->postmeta,
|
| 293 |
&& array_key_exists( $custom_type, $custom_types[$post_type]['post_relationship']['has'] )
|
| 294 |
) {
|
| 295 |
unset($custom_types[$post_type]['post_relationship']['has'][$custom_type]);
|
| 296 |
+
$custom_types[$post_type][TOOLSET_EDIT_LAST] = time();
|
| 297 |
}
|
| 298 |
/**
|
| 299 |
* remove "belongs" relation
|
| 303 |
&& array_key_exists( $custom_type, $custom_types[$post_type]['post_relationship']['belongs'] )
|
| 304 |
) {
|
| 305 |
unset($custom_types[$post_type]['post_relationship']['belongs'][$custom_type]);
|
| 306 |
+
$custom_types[$post_type][TOOLSET_EDIT_LAST] = time();
|
| 307 |
}
|
| 308 |
}
|
| 309 |
}
|
| 312 |
echo json_encode(array(
|
| 313 |
'output' => '',
|
| 314 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 315 |
+
. sanitize_text_field($_GET['wpcf-post-type'])
|
| 316 |
. '").parents("tr").css("background-color", "#FF0000").fadeOut();',
|
| 317 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 318 |
));
|
| 326 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 327 |
if (isset($custom_taxonomies[$_GET['wpcf-tax']])) {
|
| 328 |
$custom_taxonomies[$_GET['wpcf-tax']]['disabled'] = 1;
|
| 329 |
+
$custom_taxonomies[$_GET['wpcf-tax']][TOOLSET_EDIT_LAST] = time();
|
| 330 |
update_option('wpcf-custom-taxonomies', $custom_taxonomies);
|
| 331 |
echo json_encode(array(
|
| 332 |
'output' => __('Taxonomy deactivated', 'wpcf'),
|
| 333 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 334 |
+
. sanitize_text_field($_GET['wpcf-tax']) . '").replaceWith(\''
|
| 335 |
+
. wpcf_admin_custom_taxonomies_get_ajax_activation_link(sanitize_text_field($_GET['wpcf-tax']))
|
| 336 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 337 |
+
. sanitize_text_field($_GET['wpcf-tax']) . '").html("' . __('No', 'wpcf') . '");',
|
| 338 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 339 |
));
|
| 340 |
} else {
|
| 352 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 353 |
if (isset($custom_taxonomies[$_GET['wpcf-tax']])) {
|
| 354 |
$custom_taxonomies[$_GET['wpcf-tax']]['disabled'] = 0;
|
| 355 |
+
$custom_taxonomies[$_GET['wpcf-tax']][TOOLSET_EDIT_LAST] = time();
|
| 356 |
update_option('wpcf-custom-taxonomies', $custom_taxonomies);
|
| 357 |
echo json_encode(array(
|
| 358 |
'output' => __('Taxonomy activated', 'wpcf'),
|
| 359 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 360 |
+
. sanitize_text_field($_GET['wpcf-tax']) . '").replaceWith(\''
|
| 361 |
+
. wpcf_admin_custom_taxonomies_get_ajax_deactivation_link(sanitize_text_field($_GET['wpcf-tax']))
|
| 362 |
. '\');jQuery(".wpcf-table-column-active-'
|
| 363 |
+
. sanitize_text_field($_GET['wpcf-tax']) . '").html("' . __('Yes', 'wpcf') . '");',
|
| 364 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 365 |
));
|
| 366 |
} else {
|
| 382 |
echo json_encode(array(
|
| 383 |
'output' => '',
|
| 384 |
'execute' => 'jQuery("#wpcf-list-activate-'
|
| 385 |
+
. sanitize_text_field($_GET['wpcf-tax'])
|
| 386 |
. '").parents("tr").css("background-color", "#FF0000").fadeOut();',
|
| 387 |
'wpcf_nonce_ajax_callback' => wp_create_nonce('execute'),
|
| 388 |
));
|
| 431 |
|
| 432 |
case 'group_form_collapsed':
|
| 433 |
require_once WPCF_INC_ABSPATH . '/fields-form.php';
|
| 434 |
+
$group_id = sanitize_text_field($_GET['group_id']);
|
| 435 |
+
$action = sanitize_text_field($_GET['toggle']);
|
| 436 |
+
$fieldset = sanitize_text_field($_GET['id']);
|
| 437 |
wpcf_admin_fields_form_save_open_fieldset($action, $fieldset,
|
| 438 |
$group_id);
|
| 439 |
break;
|
| 440 |
|
| 441 |
case 'form_fieldset_toggle':
|
| 442 |
+
$action = sanitize_text_field($_GET['toggle']);
|
| 443 |
+
$fieldset = sanitize_text_field($_GET['id']);
|
| 444 |
wpcf_admin_form_fieldset_save_toggle($action, $fieldset);
|
| 445 |
break;
|
| 446 |
|
| 447 |
case 'group_update_post_types':
|
| 448 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 449 |
+
// @todo Sanitize this $post_types
|
| 450 |
$post_types = empty($_GET['wpcf']['group']['supports']) ? array() : $_GET['wpcf']['group']['supports'];
|
| 451 |
if (!empty($_GET['group_id'])) {
|
| 452 |
+
wpcf_admin_fields_save_group_post_types(sanitize_text_field($_GET['group_id']),
|
| 453 |
$post_types);
|
| 454 |
$output = array();
|
| 455 |
foreach ($post_types as $post_type) {
|
| 480 |
}
|
| 481 |
}
|
| 482 |
if (!empty($_GET['group_id'])) {
|
| 483 |
+
wpcf_admin_fields_save_group_terms(sanitize_text_field($_GET['group_id']), $terms);
|
| 484 |
$output = array();
|
| 485 |
foreach ($taxonomies_post as $taxonomy => $terms) {
|
| 486 |
$taxonomy = get_taxonomy($taxonomy);
|
| 516 |
case 'delete_field':
|
| 517 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 518 |
if (isset($_GET['field_id'])) {
|
| 519 |
+
wpcf_admin_fields_delete_field(sanitize_text_field($_GET['field_id']));
|
| 520 |
}
|
| 521 |
if (isset($_GET['field'])) {
|
| 522 |
+
wpcf_admin_fields_delete_field(sanitize_text_field($_GET['field']));
|
| 523 |
}
|
| 524 |
echo json_encode(array(
|
| 525 |
'output' => ''
|
| 551 |
));
|
| 552 |
} else {
|
| 553 |
$data['id'] = str_replace('_conditional_display', '',
|
| 554 |
+
sanitize_text_field($_GET['field']));
|
| 555 |
$output = wpcf_form_simple(wpcf_cd_admin_form_single_filter($data,
|
| 556 |
array(), null, false));
|
| 557 |
if (!empty($data['id'])) {
|
| 575 |
if (!empty($_GET['parent']) && !empty($_GET['child'])) {
|
| 576 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 577 |
require_once WPCF_INC_ABSPATH . '/post-relationship.php';
|
| 578 |
+
wpcf_pr_admin_edit_fields(sanitize_text_field($_GET['parent']), sanitize_text_field($_GET['child']));
|
| 579 |
}
|
| 580 |
break;
|
| 581 |
|
| 599 |
if (isset($_GET['field']) && isset($_GET['subaction'])) {
|
| 600 |
require_once WPCF_INC_ABSPATH . '/fields.php';
|
| 601 |
$option = $_GET['meta_type'] == 'usermeta' ? 'wpcf-usermeta' : 'wpcf-fields';
|
| 602 |
+
$meta_type = sanitize_text_field($_GET['meta_type']);
|
| 603 |
+
$field = wpcf_admin_fields_get_field(sanitize_text_field($_GET['field']), false, false,
|
| 604 |
false, $option);
|
| 605 |
|
| 606 |
$_txt_updates = $meta_type == 'usermeta' ? __( '%d users require update',
|
| 623 |
. sprintf($_txt_updates, count($posts)) . ' '
|
| 624 |
. '<a href="javascript:void(0);" class="button-primary" onclick="'
|
| 625 |
. 'wpcfCbSaveEmptyMigrate(jQuery(this).parent().parent().parent(), \''
|
| 626 |
+
. sanitize_text_field($_GET['field']) . '\', '
|
| 627 |
. count($posts) . ', \''
|
| 628 |
. wp_create_nonce('cb_save_empty_migrate') . '\', \'';
|
| 629 |
$output .= $_GET['subaction'] == 'save_check' ? 'save' : 'do_not_save';
|
| 651 |
$output = '<script type="text/javascript">wpcfCbMigrateStep('
|
| 652 |
. intval($_GET['total']) . ','
|
| 653 |
. $posts['offset'] . ','
|
| 654 |
+
. '\'' . sanitize_text_field($_GET['field']) . '\','
|
| 655 |
. '\'' . wp_create_nonce('cb_save_empty_migrate')
|
| 656 |
. '\', \'' . $meta_type . '\');</script>'
|
| 657 |
. number_format($posts['offset'])
|
includes/classes/class.wpcf.custom.fields.list.table.php
ADDED
|
@@ -0,0 +1,486 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*************************** LOAD THE BASE CLASS *******************************
|
| 4 |
+
*******************************************************************************
|
| 5 |
+
* The WP_List_Table class isn't automatically available to plugins, so we need
|
| 6 |
+
* to check if it's available and load it if necessary. In this tutorial, we are
|
| 7 |
+
* going to use the WP_List_Table class directly from WordPress core.
|
| 8 |
+
*
|
| 9 |
+
* IMPORTANT:
|
| 10 |
+
* Please note that the WP_List_Table class technically isn't an official API,
|
| 11 |
+
* and it could change at some point in the distant future. Should that happen,
|
| 12 |
+
* I will update this plugin with the most current techniques for your reference
|
| 13 |
+
* immediately.
|
| 14 |
+
*
|
| 15 |
+
* If you are really worried about future compatibility, you can make a copy of
|
| 16 |
+
* the WP_List_Table class (file path is shown just below) to use and distribute
|
| 17 |
+
* with your plugins. If you do that, just remember to change the name of the
|
| 18 |
+
* class to avoid conflicts with core.
|
| 19 |
+
*
|
| 20 |
+
* Since I will be keeping this tutorial up-to-date for the foreseeable future,
|
| 21 |
+
* I am going to work with the copy of the class provided in WordPress core.
|
| 22 |
+
*/
|
| 23 |
+
if(!class_exists('WP_List_Table')){
|
| 24 |
+
require_once( ABSPATH . 'wp-admin/includes/class-wp-list-table.php' );
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/************************** CREATE A PACKAGE CLASS *****************************
|
| 28 |
+
*******************************************************************************
|
| 29 |
+
* Create a new list table package that extends the core WP_List_Table class.
|
| 30 |
+
* WP_List_Table contains most of the framework for generating the table, but we
|
| 31 |
+
* need to define and override some methods so that our data can be displayed
|
| 32 |
+
* exactly the way we need it to be.
|
| 33 |
+
*
|
| 34 |
+
* To display this example on a page, you will first need to instantiate the class,
|
| 35 |
+
* then call $yourInstance->prepare_items() to handle any data manipulation, then
|
| 36 |
+
* finally call $yourInstance->display() to render the table to the page.
|
| 37 |
+
*
|
| 38 |
+
* Our theme for this list table is going to be movies.
|
| 39 |
+
*/
|
| 40 |
+
class WPCF_Custom_Fields_List_Table extends WP_List_Table
|
| 41 |
+
{
|
| 42 |
+
var $bulk_action_field_name = 'wpcf_cf_ids';
|
| 43 |
+
/** ************************************************************************
|
| 44 |
+
* REQUIRED. Set up a constructor that references the parent constructor. We
|
| 45 |
+
* use the parent reference to set some default configs.
|
| 46 |
+
***************************************************************************/
|
| 47 |
+
function __construct()
|
| 48 |
+
{
|
| 49 |
+
global $status, $page;
|
| 50 |
+
|
| 51 |
+
//Set parent defaults
|
| 52 |
+
parent::__construct( array(
|
| 53 |
+
'singular' => 'custom field group', //singular name of the listed records
|
| 54 |
+
'plural' => 'custom field groups', //plural name of the listed records
|
| 55 |
+
'ajax' => true //does this table support ajax?
|
| 56 |
+
) );
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
/** ************************************************************************
|
| 60 |
+
* Recommended. This method is called when the parent class can't find a method
|
| 61 |
+
* specifically build for a given column. Generally, it's recommended to include
|
| 62 |
+
* one method for each column you want to render, keeping your package class
|
| 63 |
+
* neat and organized. For example, if the class needs to process a column
|
| 64 |
+
* named 'title', it would first see if a method named $this->column_title()
|
| 65 |
+
* exists - if it does, that method will be used. If it doesn't, this one will
|
| 66 |
+
* be used. Generally, you should try to use custom column methods as much as
|
| 67 |
+
* possible.
|
| 68 |
+
*
|
| 69 |
+
* Since we have defined a column_title() method later on, this method doesn't
|
| 70 |
+
* need to concern itself with any column with a name of 'title'. Instead, it
|
| 71 |
+
* needs to handle everything else.
|
| 72 |
+
*
|
| 73 |
+
* For more detailed insight into how columns are handled, take a look at
|
| 74 |
+
* WP_List_Table::single_row_columns()
|
| 75 |
+
*
|
| 76 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 77 |
+
* @param array $column_name The name/slug of the column to be processed
|
| 78 |
+
* @return string Text or HTML to be placed inside the column <td>
|
| 79 |
+
**************************************************************************/
|
| 80 |
+
function column_default($item, $column_name)
|
| 81 |
+
{
|
| 82 |
+
switch($column_name){
|
| 83 |
+
case 'title':
|
| 84 |
+
case 'description':
|
| 85 |
+
return $item[$column_name];
|
| 86 |
+
case 'post_types':
|
| 87 |
+
$post_types = wpcf_admin_get_post_types_by_group($item['id']);
|
| 88 |
+
return empty($post_types) ? __('All post types', 'wpcf') : implode(', ', $post_types);
|
| 89 |
+
break;
|
| 90 |
+
case 'taxonomies':
|
| 91 |
+
$taxonomies = wpcf_admin_get_taxonomies_by_group($item['id']);
|
| 92 |
+
$output = '';
|
| 93 |
+
if (empty($taxonomies)) {
|
| 94 |
+
$output = __('None', 'wpcf');
|
| 95 |
+
} else {
|
| 96 |
+
foreach ($taxonomies as $taxonomy => $terms) {
|
| 97 |
+
$output .= '<em>' . $taxonomy . '</em>: ';
|
| 98 |
+
$terms_output = array();
|
| 99 |
+
foreach ($terms as $term_id => $term) {
|
| 100 |
+
$terms_output[] = $term['name'];
|
| 101 |
+
}
|
| 102 |
+
$output .= implode(', ', $terms_output) . '<br />';
|
| 103 |
+
}
|
| 104 |
+
}
|
| 105 |
+
return $output;
|
| 106 |
+
case 'status':
|
| 107 |
+
return 'active' == $item[$column_name]? __('Yes', 'wpcf'):__('No', 'wpcf');
|
| 108 |
+
default:
|
| 109 |
+
return print_r($item,true); //Show the whole array for troubleshooting purposes
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
/** ************************************************************************
|
| 114 |
+
* Recommended. This is a custom column method and is responsible for what
|
| 115 |
+
* is rendered in any column with a name/slug of 'title'. Every time the class
|
| 116 |
+
* needs to render a column, it first looks for a method named
|
| 117 |
+
* column_{$column_title} - if it exists, that method is run. If it doesn't
|
| 118 |
+
* exist, column_default() is called instead.
|
| 119 |
+
*
|
| 120 |
+
* This example also illustrates how to implement rollover actions. Actions
|
| 121 |
+
* should be an associative array formatted as 'slug'=>'link html' - and you
|
| 122 |
+
* will need to generate the URLs yourself. You could even ensure the links
|
| 123 |
+
*
|
| 124 |
+
*
|
| 125 |
+
* @see WP_List_Table::::single_row_columns()
|
| 126 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 127 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 128 |
+
**************************************************************************/
|
| 129 |
+
function column_title($item)
|
| 130 |
+
{
|
| 131 |
+
$edit_link = add_query_arg(
|
| 132 |
+
array(
|
| 133 |
+
'page' => 'wpcf-edit',
|
| 134 |
+
'group_id' => $item['id']
|
| 135 |
+
),
|
| 136 |
+
admin_url('admin.php')
|
| 137 |
+
);
|
| 138 |
+
|
| 139 |
+
//Build row actions
|
| 140 |
+
$actions = array(
|
| 141 |
+
'edit' => sprintf('<a href="%s">%s</a>', $edit_link, __('Edit', 'wpcf')),
|
| 142 |
+
'status' => 'active' == $item['status']? wpcf_admin_fields_get_ajax_deactivation_link($item['id']):wpcf_admin_fields_get_ajax_activation_link($item['id']),
|
| 143 |
+
'delete' => sprintf(
|
| 144 |
+
'<a href="%s" class="submitdelete wpcf-ajax-link" id="wpcf-list-delete-%d"">%s</a>',
|
| 145 |
+
add_query_arg(
|
| 146 |
+
array(
|
| 147 |
+
'action' => 'wpcf_ajax',
|
| 148 |
+
'wpcf_action' => 'delete_group',
|
| 149 |
+
'group_id' => $item['id'],
|
| 150 |
+
'wpcf_ajax_update' => 'wpcf_list_ajax_response_'.$item['id'],
|
| 151 |
+
'wpcf_ajax_callback' => 'wpcfRefresh',
|
| 152 |
+
'_wpnonce' => wp_create_nonce('delete_group'),
|
| 153 |
+
'wpcf_warning' => urlencode(__('Are you sure?', 'wpcf')),
|
| 154 |
+
),
|
| 155 |
+
admin_url('admin-ajax.php')
|
| 156 |
+
),
|
| 157 |
+
$item['id'],
|
| 158 |
+
__('Delete', 'wpcf')
|
| 159 |
+
),
|
| 160 |
+
);
|
| 161 |
+
|
| 162 |
+
//Return the title contents
|
| 163 |
+
return sprintf(
|
| 164 |
+
'<strong><a href="%s" class="row-title">%s</strong>%s',
|
| 165 |
+
$edit_link,
|
| 166 |
+
$item['title'],
|
| 167 |
+
$this->row_actions($actions)
|
| 168 |
+
);
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
/** ************************************************************************
|
| 172 |
+
* REQUIRED if displaying checkboxes or using bulk actions! The 'cb' column
|
| 173 |
+
* is given special treatment when columns are processed. It ALWAYS needs to
|
| 174 |
+
* have it's own method.
|
| 175 |
+
*
|
| 176 |
+
* @see WP_List_Table::::single_row_columns()
|
| 177 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 178 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 179 |
+
**************************************************************************/
|
| 180 |
+
function column_cb($item)
|
| 181 |
+
{
|
| 182 |
+
return sprintf(
|
| 183 |
+
'<input type="checkbox" name="%s[]" value="%s" />',
|
| 184 |
+
$this->bulk_action_field_name,
|
| 185 |
+
$item['id']
|
| 186 |
+
);
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
/** ************************************************************************
|
| 190 |
+
* REQUIRED! This method dictates the table's columns and titles. This should
|
| 191 |
+
* return an array where the key is the column slug (and class) and the value
|
| 192 |
+
* is the column's title text. If you need a checkbox for bulk actions, refer
|
| 193 |
+
* to the $columns array below.
|
| 194 |
+
*
|
| 195 |
+
* The 'cb' column is treated differently than the rest. If including a checkbox
|
| 196 |
+
* column in your table you must create a column_cb() method. If you don't need
|
| 197 |
+
* bulk actions or checkboxes, simply leave the 'cb' entry out of your array.
|
| 198 |
+
*
|
| 199 |
+
* @see WP_List_Table::::single_row_columns()
|
| 200 |
+
* @return array An associative array containing column information: 'slugs'=>'Visible Titles'
|
| 201 |
+
**************************************************************************/
|
| 202 |
+
function get_columns()
|
| 203 |
+
{
|
| 204 |
+
$columns = array(
|
| 205 |
+
'cb' => '<input type="checkbox" />', //Render a checkbox instead of text
|
| 206 |
+
'title' => __('Group Name', 'wpcf'),
|
| 207 |
+
'description' => __('Description', 'wpcf'),
|
| 208 |
+
'status' => __('Active', 'wpcf'),
|
| 209 |
+
'post_types' => __('Post types', 'wpcf'),
|
| 210 |
+
'taxonomies' => __('Taxonomies', 'wpcf'),
|
| 211 |
+
);
|
| 212 |
+
return $columns;
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
/** ************************************************************************
|
| 216 |
+
* Optional. If you want one or more columns to be sortable (ASC/DESC toggle),
|
| 217 |
+
* you will need to register it here. This should return an array where the
|
| 218 |
+
* key is the column that needs to be sortable, and the value is db column to
|
| 219 |
+
* sort by. Often, the key and value will be the same, but this is not always
|
| 220 |
+
* the case (as the value is a column name from the database, not the list table).
|
| 221 |
+
*
|
| 222 |
+
* This method merely defines which columns should be sortable and makes them
|
| 223 |
+
* clickable - it does not handle the actual sorting. You still need to detect
|
| 224 |
+
* the ORDERBY and ORDER querystring variables within prepare_items() and sort
|
| 225 |
+
* your data accordingly (usually by modifying your query).
|
| 226 |
+
*
|
| 227 |
+
* @return array An associative array containing all the columns that should be sortable: 'slugs'=>array('data_values',bool)
|
| 228 |
+
**************************************************************************/
|
| 229 |
+
function get_sortable_columns()
|
| 230 |
+
{
|
| 231 |
+
$sortable_columns = array(
|
| 232 |
+
'title' => array('title',true), //true means it's already sorted
|
| 233 |
+
'description' => array('description',false),
|
| 234 |
+
'status' => array('status',false)
|
| 235 |
+
);
|
| 236 |
+
return $sortable_columns;
|
| 237 |
+
}
|
| 238 |
+
|
| 239 |
+
/** ************************************************************************
|
| 240 |
+
* Optional. If you need to include bulk actions in your list table, this is
|
| 241 |
+
* the place to define them. Bulk actions are an associative array in the format
|
| 242 |
+
* 'slug'=>'Visible Title'
|
| 243 |
+
*
|
| 244 |
+
* If this method returns an empty value, no bulk action will be rendered. If
|
| 245 |
+
* you specify any bulk actions, the bulk actions box will be rendered with
|
| 246 |
+
* the table automatically on display().
|
| 247 |
+
*
|
| 248 |
+
* Also note that list tables are not automatically wrapped in <form> elements,
|
| 249 |
+
* so you will need to create those manually in order for bulk actions to function.
|
| 250 |
+
*
|
| 251 |
+
* @return array An associative array containing all the bulk actions: 'slugs'=>'Visible Titles'
|
| 252 |
+
**************************************************************************/
|
| 253 |
+
function get_bulk_actions()
|
| 254 |
+
{
|
| 255 |
+
$actions = array(
|
| 256 |
+
'activate' => __('Activate', 'wpcf'),
|
| 257 |
+
'deactivate' => __('Deactivate', 'wpcf'),
|
| 258 |
+
);
|
| 259 |
+
return $actions;
|
| 260 |
+
}
|
| 261 |
+
|
| 262 |
+
/** ************************************************************************
|
| 263 |
+
* Optional. You can handle your bulk actions anywhere or anyhow you prefer.
|
| 264 |
+
* For this example package, we will handle it in the class to keep things
|
| 265 |
+
* clean and organized.
|
| 266 |
+
*
|
| 267 |
+
* @global object $wpdb
|
| 268 |
+
*
|
| 269 |
+
* @see $this->prepare_items()
|
| 270 |
+
**************************************************************************/
|
| 271 |
+
function process_bulk_action()
|
| 272 |
+
{
|
| 273 |
+
global $wpdb;
|
| 274 |
+
$action = $this->current_action();
|
| 275 |
+
//Detect when a bulk action is being triggered...
|
| 276 |
+
switch($action) {
|
| 277 |
+
case 'deactivate':
|
| 278 |
+
if (
|
| 279 |
+
true
|
| 280 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 281 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 282 |
+
) {
|
| 283 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 284 |
+
$wpdb->update(
|
| 285 |
+
$wpdb->posts,
|
| 286 |
+
array( 'post_status' => 'draft' ),
|
| 287 |
+
array( 'ID' => $key, 'post_type' => 'wp-types-group' ),
|
| 288 |
+
array('%s'),
|
| 289 |
+
array('%d', '%s')
|
| 290 |
+
);
|
| 291 |
+
}
|
| 292 |
+
}
|
| 293 |
+
break;
|
| 294 |
+
case 'activate':
|
| 295 |
+
if (
|
| 296 |
+
true
|
| 297 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 298 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 299 |
+
) {
|
| 300 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 301 |
+
$wpdb->update(
|
| 302 |
+
$wpdb->posts,
|
| 303 |
+
array( 'post_status' => 'publish' ),
|
| 304 |
+
array( 'ID' => $key ),
|
| 305 |
+
array('%s'),
|
| 306 |
+
array('%d')
|
| 307 |
+
);
|
| 308 |
+
}
|
| 309 |
+
}
|
| 310 |
+
break;
|
| 311 |
+
}
|
| 312 |
+
wp_cache_delete(md5('group::_get_group'.'wp-types-group'),'types_cache_groups');
|
| 313 |
+
}
|
| 314 |
+
|
| 315 |
+
/** ************************************************************************
|
| 316 |
+
* REQUIRED! This is where you prepare your data for display. This method will
|
| 317 |
+
* usually be used to query the database, sort and filter the data, and generally
|
| 318 |
+
* get it ready to be displayed. At a minimum, we should set $this->items and
|
| 319 |
+
* $this->set_pagination_args(), although the following properties and methods
|
| 320 |
+
* are frequently interacted with here...
|
| 321 |
+
*
|
| 322 |
+
* @uses $this->_column_headers
|
| 323 |
+
* @uses $this->items
|
| 324 |
+
* @uses $this->get_columns()
|
| 325 |
+
* @uses $this->get_sortable_columns()
|
| 326 |
+
* @uses $this->get_pagenum()
|
| 327 |
+
* @uses $this->set_pagination_args()
|
| 328 |
+
**************************************************************************/
|
| 329 |
+
function prepare_items()
|
| 330 |
+
{
|
| 331 |
+
/**
|
| 332 |
+
* First, lets decide how many records per page to show
|
| 333 |
+
*/
|
| 334 |
+
$per_page = $this->get_items_per_page('wpcf_cf_per_page', 10);;
|
| 335 |
+
|
| 336 |
+
/**
|
| 337 |
+
* REQUIRED. Now we need to define our column headers. This includes a complete
|
| 338 |
+
* array of columns to be displayed (slugs & titles), a list of columns
|
| 339 |
+
* to keep hidden, and a list of columns that are sortable. Each of these
|
| 340 |
+
* can be defined in another method (as we've done here) before being
|
| 341 |
+
* used to build the value for our _column_headers property.
|
| 342 |
+
*/
|
| 343 |
+
$columns = $this->get_columns();
|
| 344 |
+
$hidden = array();
|
| 345 |
+
$sortable = $this->get_sortable_columns();
|
| 346 |
+
|
| 347 |
+
/**
|
| 348 |
+
* REQUIRED. Finally, we build an array to be used by the class for column
|
| 349 |
+
* headers. The $this->_column_headers property takes an array which contains
|
| 350 |
+
* 3 other arrays. One for all columns, one for hidden columns, and one
|
| 351 |
+
* for sortable columns.
|
| 352 |
+
*/
|
| 353 |
+
$this->_column_headers = array($columns, $hidden, $sortable);
|
| 354 |
+
|
| 355 |
+
/**
|
| 356 |
+
* Optional. You can handle your bulk actions however you see fit. In this
|
| 357 |
+
* case, we'll handle them within our package just to keep things clean.
|
| 358 |
+
*/
|
| 359 |
+
$this->process_bulk_action();
|
| 360 |
+
|
| 361 |
+
/**
|
| 362 |
+
* Instead of querying a database, we're going to fetch the example data
|
| 363 |
+
* property we created for use in this plugin. This makes this example
|
| 364 |
+
* package slightly different than one you might build on your own. In
|
| 365 |
+
* this example, we'll be using array manipulation to sort and paginate
|
| 366 |
+
* our data. In a real-world implementation, you will probably want to
|
| 367 |
+
* use sort and pagination data to build a custom query instead, as you'll
|
| 368 |
+
* be able to use your precisely-queried data immediately.
|
| 369 |
+
*/
|
| 370 |
+
|
| 371 |
+
$s = isset($_POST['s'])? mb_strtolower(trim($_POST['s'])):false;
|
| 372 |
+
|
| 373 |
+
$data = array();
|
| 374 |
+
$groups = wpcf_admin_fields_get_groups();
|
| 375 |
+
if ( !empty($groups) ){
|
| 376 |
+
foreach( array_values($groups) as $group ) {
|
| 377 |
+
$one = array(
|
| 378 |
+
'description' => $group['description'],
|
| 379 |
+
'id' => $group['id'],
|
| 380 |
+
'slug' => $group['slug'],
|
| 381 |
+
'status' => (isset($group['is_active']) && $group['is_active'])? 'active':'inactive',
|
| 382 |
+
'supports' => isset($group['supports'])? $group['supports']:array(),
|
| 383 |
+
'title' => $group['name'],
|
| 384 |
+
);
|
| 385 |
+
$add_one = true;
|
| 386 |
+
if ( $s ) {
|
| 387 |
+
$add_one = false;
|
| 388 |
+
foreach( array('description', 'id', 'slug', 'title' ) as $key ) {
|
| 389 |
+
if ( $add_one || empty( $one[$key] ) ) {
|
| 390 |
+
continue;
|
| 391 |
+
}
|
| 392 |
+
if ( is_numeric(strpos(mb_strtolower($one[$key]), $s))) {
|
| 393 |
+
$add_one = true;
|
| 394 |
+
}
|
| 395 |
+
}
|
| 396 |
+
}
|
| 397 |
+
if ( $add_one ) {
|
| 398 |
+
$data[] = $one;
|
| 399 |
+
}
|
| 400 |
+
}
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
/**
|
| 404 |
+
* This checks for sorting input and sorts the data in our array accordingly.
|
| 405 |
+
*/
|
| 406 |
+
usort($data, 'wpcf_usort_reorder');
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
* REQUIRED for pagination. Let's figure out what page the user is currently
|
| 410 |
+
* looking at. We'll need this later, so you should always include it in
|
| 411 |
+
* your own package classes.
|
| 412 |
+
*/
|
| 413 |
+
$current_page = $this->get_pagenum();
|
| 414 |
+
|
| 415 |
+
/**
|
| 416 |
+
* REQUIRED for pagination. Let's check how many items are in our data array.
|
| 417 |
+
* In real-world use, this would be the total number of items in your database,
|
| 418 |
+
* without filtering. We'll need this later, so you should always include it
|
| 419 |
+
* in your own package classes.
|
| 420 |
+
*/
|
| 421 |
+
$total_items = count($data);
|
| 422 |
+
|
| 423 |
+
/**
|
| 424 |
+
* The WP_List_Table class does not handle pagination for us, so we need
|
| 425 |
+
* to ensure that the data is trimmed to only the current page. We can use
|
| 426 |
+
* array_slice() to
|
| 427 |
+
*/
|
| 428 |
+
$data = array_slice($data,(($current_page-1)*$per_page),$per_page);
|
| 429 |
+
|
| 430 |
+
/**
|
| 431 |
+
* REQUIRED. Now we can add our *sorted* data to the items property, where
|
| 432 |
+
* it can be used by the rest of the class.
|
| 433 |
+
*/
|
| 434 |
+
$this->items = $data;
|
| 435 |
+
|
| 436 |
+
/**
|
| 437 |
+
* REQUIRED. We also have to register our pagination options & calculations.
|
| 438 |
+
*/
|
| 439 |
+
$this->set_pagination_args( array(
|
| 440 |
+
'total_items' => $total_items, //WE have to calculate the total number of items
|
| 441 |
+
'per_page' => $per_page, //WE have to determine how many items to show on a page
|
| 442 |
+
'total_pages' => ceil($total_items/$per_page) //WE have to calculate the total number of pages
|
| 443 |
+
) );
|
| 444 |
+
}
|
| 445 |
+
|
| 446 |
+
/**
|
| 447 |
+
* Generates content for a single row of the table
|
| 448 |
+
*
|
| 449 |
+
* @since 3.1.0
|
| 450 |
+
* @access public
|
| 451 |
+
*
|
| 452 |
+
* @param object $item The current item
|
| 453 |
+
*/
|
| 454 |
+
public function single_row( $item )
|
| 455 |
+
{
|
| 456 |
+
static $row_class = '';
|
| 457 |
+
$row_class = ( $row_class == '' ? 'alternate' : '' );
|
| 458 |
+
|
| 459 |
+
printf('<tr class="%s status-%s">', $row_class, $item['status']);
|
| 460 |
+
$this->single_row_columns( $item );
|
| 461 |
+
echo '</tr>';
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
public function no_items()
|
| 465 |
+
{
|
| 466 |
+
if ( isset($_POST['s']) ) {
|
| 467 |
+
_e('No custom field groups found.','wpcf');
|
| 468 |
+
return;
|
| 469 |
+
}
|
| 470 |
+
printf(
|
| 471 |
+
'<p>%s</p>',
|
| 472 |
+
__('To use custom fields, please create a group to hold them.', 'wpcf')
|
| 473 |
+
);
|
| 474 |
+
printf(
|
| 475 |
+
'<a class="button-primary" href="%s">%s</a>',
|
| 476 |
+
add_query_arg(
|
| 477 |
+
array(
|
| 478 |
+
'page' => 'wpcf-edit',
|
| 479 |
+
),
|
| 480 |
+
admin_url('admin.php')
|
| 481 |
+
),
|
| 482 |
+
__('Add New Group', 'wpcf')
|
| 483 |
+
);
|
| 484 |
+
}
|
| 485 |
+
|
| 486 |
+
}
|
includes/classes/class.wpcf.custom.post.types.list.table.php
ADDED
|
@@ -0,0 +1,468 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*************************** LOAD THE BASE CLASS *******************************
|
| 4 |
+
*******************************************************************************
|
| 5 |
+
* The WP_List_Table class isn't automatically available to plugins, so we need
|
| 6 |
+
* to check if it's available and load it if necessary. In this tutorial, we are
|
| 7 |
+
* going to use the WP_List_Table class directly from WordPress core.
|
| 8 |
+
*
|
| 9 |
+
* IMPORTANT:
|
| 10 |
+
* Please note that the WP_List_Table class technically isn't an official API,
|
| 11 |
+
* and it could change at some point in the distant future. Should that happen,
|
| 12 |
+
* I will update this plugin with the most current techniques for your reference
|
| 13 |
+
* immediately.
|
| 14 |
+
*
|
| 15 |
+
* If you are really worried about future compatibility, you can make a copy of
|
| 16 |
+
* the WP_List_Table class (file path is shown just below) to use and distribute
|
| 17 |
+
* with your plugins. If you do that, just remember to change the name of the
|
| 18 |
+
* class to avoid conflicts with core.
|
| 19 |
+
*
|
| 20 |
+
* Since I will be keeping this tutorial up-to-date for the foreseeable future,
|
| 21 |
+
* I am going to work with the copy of the class provided in WordPress core.
|
| 22 |
+
*/
|
| 23 |
+
if(!class_exists('WP_List_Table')){
|
| 24 |
+
require_once( ABSPATH . 'wp-admin/includes/class-wp-list-table.php' );
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/************************** CREATE A PACKAGE CLASS *****************************
|
| 28 |
+
*******************************************************************************
|
| 29 |
+
* Create a new list table package that extends the core WP_List_Table class.
|
| 30 |
+
* WP_List_Table contains most of the framework for generating the table, but we
|
| 31 |
+
* need to define and override some methods so that our data can be displayed
|
| 32 |
+
* exactly the way we need it to be.
|
| 33 |
+
*
|
| 34 |
+
* To display this example on a page, you will first need to instantiate the class,
|
| 35 |
+
* then call $yourInstance->prepare_items() to handle any data manipulation, then
|
| 36 |
+
* finally call $yourInstance->display() to render the table to the page.
|
| 37 |
+
*
|
| 38 |
+
* Our theme for this list table is going to be movies.
|
| 39 |
+
*/
|
| 40 |
+
class WPCF_Custom_Post_Types_List_Table extends WP_List_Table
|
| 41 |
+
{
|
| 42 |
+
var $custom_types;
|
| 43 |
+
var $bulk_action_field_name = 'wpcf_cpt_ids';
|
| 44 |
+
|
| 45 |
+
/** ************************************************************************
|
| 46 |
+
* REQUIRED. Set up a constructor that references the parent constructor. We
|
| 47 |
+
* use the parent reference to set some default configs.
|
| 48 |
+
***************************************************************************/
|
| 49 |
+
function __construct()
|
| 50 |
+
{
|
| 51 |
+
global $status, $page;
|
| 52 |
+
|
| 53 |
+
//Set parent defaults
|
| 54 |
+
parent::__construct( array(
|
| 55 |
+
'singular' => 'custom post type', //singular name of the listed records
|
| 56 |
+
'plural' => 'custom post types', //plural name of the listed records
|
| 57 |
+
'ajax' => true //does this table support ajax?
|
| 58 |
+
) );
|
| 59 |
+
|
| 60 |
+
$this->custom_types = get_option('wpcf-custom-types', array());
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
/** ************************************************************************
|
| 64 |
+
* Recommended. This method is called when the parent class can't find a method
|
| 65 |
+
* specifically build for a given column. Generally, it's recommended to include
|
| 66 |
+
* one method for each column you want to render, keeping your package class
|
| 67 |
+
* neat and organized. For example, if the class needs to process a column
|
| 68 |
+
* named 'title', it would first see if a method named $this->column_title()
|
| 69 |
+
* exists - if it does, that method will be used. If it doesn't, this one will
|
| 70 |
+
* be used. Generally, you should try to use custom column methods as much as
|
| 71 |
+
* possible.
|
| 72 |
+
*
|
| 73 |
+
* Since we have defined a column_title() method later on, this method doesn't
|
| 74 |
+
* need to concern itself with any column with a name of 'title'. Instead, it
|
| 75 |
+
* needs to handle everything else.
|
| 76 |
+
*
|
| 77 |
+
* For more detailed insight into how columns are handled, take a look at
|
| 78 |
+
* WP_List_Table::single_row_columns()
|
| 79 |
+
*
|
| 80 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 81 |
+
* @param array $column_name The name/slug of the column to be processed
|
| 82 |
+
* @return string Text or HTML to be placed inside the column <td>
|
| 83 |
+
**************************************************************************/
|
| 84 |
+
function column_default($item, $column_name)
|
| 85 |
+
{
|
| 86 |
+
switch($column_name){
|
| 87 |
+
case 'title':
|
| 88 |
+
case 'description':
|
| 89 |
+
return $item[$column_name];
|
| 90 |
+
case 'taxonomies':
|
| 91 |
+
$rows = array();
|
| 92 |
+
if (!empty($item[$column_name])) {
|
| 93 |
+
foreach ($item[$column_name] as $temp_tax => $true) {
|
| 94 |
+
$rows[] = stripslashes(wpcf_translate($temp_tax . ' name', $temp_tax, 'Types-TAX'));
|
| 95 |
+
}
|
| 96 |
+
}
|
| 97 |
+
return empty($rows)? __('None', 'wpcf'):implode(', ', $rows);
|
| 98 |
+
case 'status':
|
| 99 |
+
return 'active' == $item[$column_name]? __('Yes', 'wpcf'):__('No', 'wpcf');
|
| 100 |
+
default:
|
| 101 |
+
return print_r($item,true); //Show the whole array for troubleshooting purposes
|
| 102 |
+
}
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
/** ************************************************************************
|
| 106 |
+
* Recommended. This is a custom column method and is responsible for what
|
| 107 |
+
* is rendered in any column with a name/slug of 'title'. Every time the class
|
| 108 |
+
* needs to render a column, it first looks for a method named
|
| 109 |
+
* column_{$column_title} - if it exists, that method is run. If it doesn't
|
| 110 |
+
* exist, column_default() is called instead.
|
| 111 |
+
*
|
| 112 |
+
* This example also illustrates how to implement rollover actions. Actions
|
| 113 |
+
* should be an associative array formatted as 'slug'=>'link html' - and you
|
| 114 |
+
* will need to generate the URLs yourself. You could even ensure the links
|
| 115 |
+
*
|
| 116 |
+
*
|
| 117 |
+
* @see WP_List_Table::::single_row_columns()
|
| 118 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 119 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 120 |
+
**************************************************************************/
|
| 121 |
+
function column_title($item)
|
| 122 |
+
{
|
| 123 |
+
$edit_link = add_query_arg(
|
| 124 |
+
array(
|
| 125 |
+
'page' => 'wpcf-edit-type',
|
| 126 |
+
'wpcf-post-type' => $item['slug']
|
| 127 |
+
),
|
| 128 |
+
admin_url('admin.php')
|
| 129 |
+
);
|
| 130 |
+
|
| 131 |
+
//Build row actions
|
| 132 |
+
$actions = array(
|
| 133 |
+
'edit' => sprintf('<a href="%s">%s</a>', $edit_link, __('Edit', 'wpcf')),
|
| 134 |
+
'status' => 'active' == $item['status'] ? wpcf_admin_custom_types_get_ajax_deactivation_link($item['slug']):wpcf_admin_custom_types_get_ajax_activation_link($item['slug']),
|
| 135 |
+
'delete' => sprintf(
|
| 136 |
+
'<a href="%s" class="submitdelete wpcf-ajax-link" id="wpcf-list-delete-%s"">%s</a>',
|
| 137 |
+
add_query_arg(
|
| 138 |
+
array(
|
| 139 |
+
'action' => 'wpcf_ajax',
|
| 140 |
+
'wpcf_action' => 'delete_post_type',
|
| 141 |
+
'wpcf-post-type' => $item['slug'],
|
| 142 |
+
'wpcf_ajax_update' => 'wpcf_list_ajax_response_'.$item['slug'],
|
| 143 |
+
'wpcf_ajax_callback' => 'wpcfRefresh',
|
| 144 |
+
'_wpnonce' => wp_create_nonce('delete_post_type'),
|
| 145 |
+
'wpcf_warning' => urlencode(__('Are you sure?', 'wpcf')),
|
| 146 |
+
),
|
| 147 |
+
admin_url('admin-ajax.php')
|
| 148 |
+
),
|
| 149 |
+
$item['slug'],
|
| 150 |
+
__('Delete', 'wpcf')
|
| 151 |
+
),
|
| 152 |
+
);
|
| 153 |
+
|
| 154 |
+
//Return the title contents
|
| 155 |
+
return sprintf(
|
| 156 |
+
'<strong><a href="%s" class="row-title">%s</strong>%s',
|
| 157 |
+
$edit_link,
|
| 158 |
+
$item['title'],
|
| 159 |
+
$this->row_actions($actions)
|
| 160 |
+
);
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
/** ************************************************************************
|
| 164 |
+
* REQUIRED if displaying checkboxes or using bulk actions! The 'cb' column
|
| 165 |
+
* is given special treatment when columns are processed. It ALWAYS needs to
|
| 166 |
+
* have it's own method.
|
| 167 |
+
*
|
| 168 |
+
* @see WP_List_Table::::single_row_columns()
|
| 169 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 170 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 171 |
+
**************************************************************************/
|
| 172 |
+
function column_cb($item)
|
| 173 |
+
{
|
| 174 |
+
return sprintf(
|
| 175 |
+
'<input type="checkbox" name="%s[]" value="%s" />',
|
| 176 |
+
$this->bulk_action_field_name,
|
| 177 |
+
$item['slug']
|
| 178 |
+
);
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
/** ************************************************************************
|
| 182 |
+
* REQUIRED! This method dictates the table's columns and titles. This should
|
| 183 |
+
* return an array where the key is the column slug (and class) and the value
|
| 184 |
+
* is the column's title text. If you need a checkbox for bulk actions, refer
|
| 185 |
+
* to the $columns array below.
|
| 186 |
+
*
|
| 187 |
+
* The 'cb' column is treated differently than the rest. If including a checkbox
|
| 188 |
+
* column in your table you must create a column_cb() method. If you don't need
|
| 189 |
+
* bulk actions or checkboxes, simply leave the 'cb' entry out of your array.
|
| 190 |
+
*
|
| 191 |
+
* @see WP_List_Table::::single_row_columns()
|
| 192 |
+
* @return array An associative array containing column information: 'slugs'=>'Visible Titles'
|
| 193 |
+
**************************************************************************/
|
| 194 |
+
function get_columns()
|
| 195 |
+
{
|
| 196 |
+
$columns = array(
|
| 197 |
+
'cb' => '<input type="checkbox" />', //Render a checkbox instead of text
|
| 198 |
+
'title' => __('Post Type Name', 'wpcf'),
|
| 199 |
+
'description' => __('Description', 'wpcf'),
|
| 200 |
+
'status' => __('Active', 'wpcf'),
|
| 201 |
+
'taxonomies' => __('Taxonomies', 'wpcf'),
|
| 202 |
+
);
|
| 203 |
+
return $columns;
|
| 204 |
+
}
|
| 205 |
+
|
| 206 |
+
/** ************************************************************************
|
| 207 |
+
* Optional. If you want one or more columns to be sortable (ASC/DESC toggle),
|
| 208 |
+
* you will need to register it here. This should return an array where the
|
| 209 |
+
* key is the column that needs to be sortable, and the value is db column to
|
| 210 |
+
* sort by. Often, the key and value will be the same, but this is not always
|
| 211 |
+
* the case (as the value is a column name from the database, not the list table).
|
| 212 |
+
*
|
| 213 |
+
* This method merely defines which columns should be sortable and makes them
|
| 214 |
+
* clickable - it does not handle the actual sorting. You still need to detect
|
| 215 |
+
* the ORDERBY and ORDER querystring variables within prepare_items() and sort
|
| 216 |
+
* your data accordingly (usually by modifying your query).
|
| 217 |
+
*
|
| 218 |
+
* @return array An associative array containing all the columns that should be sortable: 'slugs'=>array('data_values',bool)
|
| 219 |
+
**************************************************************************/
|
| 220 |
+
function get_sortable_columns()
|
| 221 |
+
{
|
| 222 |
+
$sortable_columns = array(
|
| 223 |
+
'title' => array('title',true), //true means it's already sorted
|
| 224 |
+
'description' => array('description',false),
|
| 225 |
+
'status' => array('status',false)
|
| 226 |
+
);
|
| 227 |
+
return $sortable_columns;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
/** ************************************************************************
|
| 231 |
+
* Optional. If you need to include bulk actions in your list table, this is
|
| 232 |
+
* the place to define them. Bulk actions are an associative array in the format
|
| 233 |
+
* 'slug'=>'Visible Title'
|
| 234 |
+
*
|
| 235 |
+
* If this method returns an empty value, no bulk action will be rendered. If
|
| 236 |
+
* you specify any bulk actions, the bulk actions box will be rendered with
|
| 237 |
+
* the table automatically on display().
|
| 238 |
+
*
|
| 239 |
+
* Also note that list tables are not automatically wrapped in <form> elements,
|
| 240 |
+
* so you will need to create those manually in order for bulk actions to function.
|
| 241 |
+
*
|
| 242 |
+
* @return array An associative array containing all the bulk actions: 'slugs'=>'Visible Titles'
|
| 243 |
+
**************************************************************************/
|
| 244 |
+
function get_bulk_actions()
|
| 245 |
+
{
|
| 246 |
+
$actions = array(
|
| 247 |
+
'activate' => __('Activate', 'wpcf'),
|
| 248 |
+
'deactivate' => __('Deactivate', 'wpcf'),
|
| 249 |
+
);
|
| 250 |
+
return $actions;
|
| 251 |
+
}
|
| 252 |
+
|
| 253 |
+
/** ************************************************************************
|
| 254 |
+
* Optional. You can handle your bulk actions anywhere or anyhow you prefer.
|
| 255 |
+
* For this example package, we will handle it in the class to keep things
|
| 256 |
+
* clean and organized.
|
| 257 |
+
*
|
| 258 |
+
* @see $this->prepare_items()
|
| 259 |
+
**************************************************************************/
|
| 260 |
+
function process_bulk_action()
|
| 261 |
+
{
|
| 262 |
+
$action = $this->current_action();
|
| 263 |
+
//Detect when a bulk action is being triggered...
|
| 264 |
+
switch($action) {
|
| 265 |
+
case 'deactivate':
|
| 266 |
+
if (
|
| 267 |
+
!empty($this->custom_types)
|
| 268 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 269 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 270 |
+
) {
|
| 271 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 272 |
+
if ( !isset($this->custom_types[$key]) ) {
|
| 273 |
+
continue;
|
| 274 |
+
}
|
| 275 |
+
$this->custom_types[$key]['disabled'] = 1;
|
| 276 |
+
$this->custom_types[$key][TOOLSET_EDIT_LAST] = time();
|
| 277 |
+
}
|
| 278 |
+
update_option('wpcf-custom-types', $this->custom_types);
|
| 279 |
+
}
|
| 280 |
+
break;
|
| 281 |
+
case 'activate':
|
| 282 |
+
if (
|
| 283 |
+
!empty($this->custom_types)
|
| 284 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 285 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 286 |
+
) {
|
| 287 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 288 |
+
if ( !isset($this->custom_types[$key]) ) {
|
| 289 |
+
continue;
|
| 290 |
+
}
|
| 291 |
+
if ( isset($this->custom_types[$key]['disabled']) ) {
|
| 292 |
+
unset($this->custom_types[$key]['disabled']);
|
| 293 |
+
$this->custom_types[$key][TOOLSET_EDIT_LAST] = time();
|
| 294 |
+
}
|
| 295 |
+
}
|
| 296 |
+
update_option('wpcf-custom-types', $this->custom_types);
|
| 297 |
+
}
|
| 298 |
+
break;
|
| 299 |
+
}
|
| 300 |
+
}
|
| 301 |
+
|
| 302 |
+
/** ************************************************************************
|
| 303 |
+
* REQUIRED! This is where you prepare your data for display. This method will
|
| 304 |
+
* usually be used to query the database, sort and filter the data, and generally
|
| 305 |
+
* get it ready to be displayed. At a minimum, we should set $this->items and
|
| 306 |
+
* $this->set_pagination_args(), although the following properties and methods
|
| 307 |
+
* are frequently interacted with here...
|
| 308 |
+
*
|
| 309 |
+
* @uses $this->_column_headers
|
| 310 |
+
* @uses $this->items
|
| 311 |
+
* @uses $this->get_columns()
|
| 312 |
+
* @uses $this->get_sortable_columns()
|
| 313 |
+
* @uses $this->get_pagenum()
|
| 314 |
+
* @uses $this->set_pagination_args()
|
| 315 |
+
**************************************************************************/
|
| 316 |
+
function prepare_items()
|
| 317 |
+
{
|
| 318 |
+
/**
|
| 319 |
+
* First, lets decide how many records per page to show
|
| 320 |
+
*/
|
| 321 |
+
$per_page = $this->get_items_per_page('wpcf_cpt_per_page', 10);;
|
| 322 |
+
|
| 323 |
+
/**
|
| 324 |
+
* REQUIRED. Now we need to define our column headers. This includes a complete
|
| 325 |
+
* array of columns to be displayed (slugs & titles), a list of columns
|
| 326 |
+
* to keep hidden, and a list of columns that are sortable. Each of these
|
| 327 |
+
* can be defined in another method (as we've done here) before being
|
| 328 |
+
* used to build the value for our _column_headers property.
|
| 329 |
+
*/
|
| 330 |
+
$columns = $this->get_columns();
|
| 331 |
+
$hidden = array();
|
| 332 |
+
$sortable = $this->get_sortable_columns();
|
| 333 |
+
|
| 334 |
+
/**
|
| 335 |
+
* REQUIRED. Finally, we build an array to be used by the class for column
|
| 336 |
+
* headers. The $this->_column_headers property takes an array which contains
|
| 337 |
+
* 3 other arrays. One for all columns, one for hidden columns, and one
|
| 338 |
+
* for sortable columns.
|
| 339 |
+
*/
|
| 340 |
+
$this->_column_headers = array($columns, $hidden, $sortable);
|
| 341 |
+
|
| 342 |
+
/**
|
| 343 |
+
* Optional. You can handle your bulk actions however you see fit. In this
|
| 344 |
+
* case, we'll handle them within our package just to keep things clean.
|
| 345 |
+
*/
|
| 346 |
+
$this->process_bulk_action();
|
| 347 |
+
|
| 348 |
+
/**
|
| 349 |
+
* Instead of querying a database, we're going to fetch the example data
|
| 350 |
+
* property we created for use in this plugin. This makes this example
|
| 351 |
+
* package slightly different than one you might build on your own. In
|
| 352 |
+
* this example, we'll be using array manipulation to sort and paginate
|
| 353 |
+
* our data. In a real-world implementation, you will probably want to
|
| 354 |
+
* use sort and pagination data to build a custom query instead, as you'll
|
| 355 |
+
* be able to use your precisely-queried data immediately.
|
| 356 |
+
*/
|
| 357 |
+
|
| 358 |
+
$s = isset($_POST['s'])? mb_strtolower(trim($_POST['s'])):false;
|
| 359 |
+
|
| 360 |
+
$data = array();
|
| 361 |
+
if ( !empty($this->custom_types) ){
|
| 362 |
+
foreach( array_values($this->custom_types) as $type ) {
|
| 363 |
+
$one = array(
|
| 364 |
+
'description' => $type['description'],
|
| 365 |
+
'taxonomies' => isset($type['taxonomies'])? $type['taxonomies']:array(),
|
| 366 |
+
'slug' => $type['slug'],
|
| 367 |
+
'status' => isset($type['disabled'])? 'inactive':'active',
|
| 368 |
+
'title' => $type['labels']['singular_name'],
|
| 369 |
+
);
|
| 370 |
+
$add_one = true;
|
| 371 |
+
if ( $s ) {
|
| 372 |
+
$add_one = false;
|
| 373 |
+
foreach( array('description', 'slug', 'title' ) as $key ) {
|
| 374 |
+
if ( $add_one || empty( $one[$key] ) ) {
|
| 375 |
+
continue;
|
| 376 |
+
}
|
| 377 |
+
if ( is_numeric(strpos(mb_strtolower($one[$key]), $s))) {
|
| 378 |
+
$add_one = true;
|
| 379 |
+
}
|
| 380 |
+
}
|
| 381 |
+
}
|
| 382 |
+
if ( $add_one ) {
|
| 383 |
+
$data[] = $one;
|
| 384 |
+
}
|
| 385 |
+
}
|
| 386 |
+
}
|
| 387 |
+
|
| 388 |
+
/**
|
| 389 |
+
* This checks for sorting input and sorts the data in our array accordingly.
|
| 390 |
+
*/
|
| 391 |
+
usort($data, 'wpcf_usort_reorder');
|
| 392 |
+
|
| 393 |
+
/**
|
| 394 |
+
* REQUIRED for pagination. Let's figure out what page the user is currently
|
| 395 |
+
* looking at. We'll need this later, so you should always include it in
|
| 396 |
+
* your own package classes.
|
| 397 |
+
*/
|
| 398 |
+
$current_page = $this->get_pagenum();
|
| 399 |
+
|
| 400 |
+
/**
|
| 401 |
+
* REQUIRED for pagination. Let's check how many items are in our data array.
|
| 402 |
+
* In real-world use, this would be the total number of items in your database,
|
| 403 |
+
* without filtering. We'll need this later, so you should always include it
|
| 404 |
+
* in your own package classes.
|
| 405 |
+
*/
|
| 406 |
+
$total_items = count($data);
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
* The WP_List_Table class does not handle pagination for us, so we need
|
| 410 |
+
* to ensure that the data is trimmed to only the current page. We can use
|
| 411 |
+
* array_slice() to
|
| 412 |
+
*/
|
| 413 |
+
$data = array_slice($data,(($current_page-1)*$per_page),$per_page);
|
| 414 |
+
|
| 415 |
+
/**
|
| 416 |
+
* REQUIRED. Now we can add our *sorted* data to the items property, where
|
| 417 |
+
* it can be used by the rest of the class.
|
| 418 |
+
*/
|
| 419 |
+
$this->items = $data;
|
| 420 |
+
|
| 421 |
+
/**
|
| 422 |
+
* REQUIRED. We also have to register our pagination options & calculations.
|
| 423 |
+
*/
|
| 424 |
+
$this->set_pagination_args( array(
|
| 425 |
+
'total_items' => $total_items, //WE have to calculate the total number of items
|
| 426 |
+
'per_page' => $per_page, //WE have to determine how many items to show on a page
|
| 427 |
+
'total_pages' => ceil($total_items/$per_page) //WE have to calculate the total number of pages
|
| 428 |
+
) );
|
| 429 |
+
}
|
| 430 |
+
|
| 431 |
+
/**
|
| 432 |
+
* Generates content for a single row of the table
|
| 433 |
+
*
|
| 434 |
+
* @since 3.1.0
|
| 435 |
+
* @access public
|
| 436 |
+
*
|
| 437 |
+
* @param object $item The current item
|
| 438 |
+
*/
|
| 439 |
+
public function single_row( $item )
|
| 440 |
+
{
|
| 441 |
+
static $row_class = '';
|
| 442 |
+
$row_class = ( $row_class == '' ? 'alternate' : '' );
|
| 443 |
+
|
| 444 |
+
printf('<tr class="%s status-%s">', $row_class, $item['status']);
|
| 445 |
+
$this->single_row_columns( $item );
|
| 446 |
+
echo '</tr>';
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
public function no_items()
|
| 450 |
+
{
|
| 451 |
+
if ( isset($_POST['s']) ) {
|
| 452 |
+
_e('No custom post types found.','wpcf');
|
| 453 |
+
return;
|
| 454 |
+
}
|
| 455 |
+
wpcf_admin_ctt_list_header();
|
| 456 |
+
printf(
|
| 457 |
+
'<a class="button-primary" href="%s">%s</a>',
|
| 458 |
+
add_query_arg(
|
| 459 |
+
array(
|
| 460 |
+
'page' => 'wpcf-edit-type',
|
| 461 |
+
),
|
| 462 |
+
admin_url('admin.php')
|
| 463 |
+
),
|
| 464 |
+
__('Add New Custom Post Type', 'wpcf')
|
| 465 |
+
);
|
| 466 |
+
}
|
| 467 |
+
|
| 468 |
+
}
|
includes/classes/class.wpcf.custom.taxonomies.list.table.php
ADDED
|
@@ -0,0 +1,466 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*************************** LOAD THE BASE CLASS *******************************
|
| 4 |
+
*******************************************************************************
|
| 5 |
+
* The WP_List_Table class isn't automatically available to plugins, so we need
|
| 6 |
+
* to check if it's available and load it if necessary. In this tutorial, we are
|
| 7 |
+
* going to use the WP_List_Table class directly from WordPress core.
|
| 8 |
+
*
|
| 9 |
+
* IMPORTANT:
|
| 10 |
+
* Please note that the WP_List_Table class technically isn't an official API,
|
| 11 |
+
* and it could change at some point in the distant future. Should that happen,
|
| 12 |
+
* I will update this plugin with the most current techniques for your reference
|
| 13 |
+
* immediately.
|
| 14 |
+
*
|
| 15 |
+
* If you are really worried about future compatibility, you can make a copy of
|
| 16 |
+
* the WP_List_Table class (file path is shown just below) to use and distribute
|
| 17 |
+
* with your plugins. If you do that, just remember to change the name of the
|
| 18 |
+
* class to avoid conflicts with core.
|
| 19 |
+
*
|
| 20 |
+
* Since I will be keeping this tutorial up-to-date for the foreseeable future,
|
| 21 |
+
* I am going to work with the copy of the class provided in WordPress core.
|
| 22 |
+
*/
|
| 23 |
+
if(!class_exists('WP_List_Table')){
|
| 24 |
+
require_once( ABSPATH . 'wp-admin/includes/class-wp-list-table.php' );
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/************************** CREATE A PACKAGE CLASS *****************************
|
| 28 |
+
*******************************************************************************
|
| 29 |
+
* Create a new list table package that extends the core WP_List_Table class.
|
| 30 |
+
* WP_List_Table contains most of the framework for generating the table, but we
|
| 31 |
+
* need to define and override some methods so that our data can be displayed
|
| 32 |
+
* exactly the way we need it to be.
|
| 33 |
+
*
|
| 34 |
+
* To display this example on a page, you will first need to instantiate the class,
|
| 35 |
+
* then call $yourInstance->prepare_items() to handle any data manipulation, then
|
| 36 |
+
* finally call $yourInstance->display() to render the table to the page.
|
| 37 |
+
*
|
| 38 |
+
* Our theme for this list table is going to be movies.
|
| 39 |
+
*/
|
| 40 |
+
class WPCF_Custom_Taxonomies_List_Table extends WP_List_Table
|
| 41 |
+
{
|
| 42 |
+
var $custom_taxonomies;
|
| 43 |
+
var $bulk_action_field_name = 'wpcf_ct_ids';
|
| 44 |
+
|
| 45 |
+
/** ************************************************************************
|
| 46 |
+
* REQUIRED. Set up a constructor that references the parent constructor. We
|
| 47 |
+
* use the parent reference to set some default configs.
|
| 48 |
+
***************************************************************************/
|
| 49 |
+
function __construct()
|
| 50 |
+
{
|
| 51 |
+
global $status, $page;
|
| 52 |
+
|
| 53 |
+
//Set parent defaults
|
| 54 |
+
parent::__construct( array(
|
| 55 |
+
'singular' => 'custom taxonomy', //singular name of the listed records
|
| 56 |
+
'plural' => 'custom taxonomies', //plural name of the listed records
|
| 57 |
+
'ajax' => true //does this table support ajax?
|
| 58 |
+
) );
|
| 59 |
+
|
| 60 |
+
$this->custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
/** ************************************************************************
|
| 64 |
+
* Recommended. This method is called when the parent class can't find a method
|
| 65 |
+
* specifically build for a given column. Generally, it's recommended to include
|
| 66 |
+
* one method for each column you want to render, keeping your package class
|
| 67 |
+
* neat and organized. For example, if the class needs to process a column
|
| 68 |
+
* named 'title', it would first see if a method named $this->column_title()
|
| 69 |
+
* exists - if it does, that method will be used. If it doesn't, this one will
|
| 70 |
+
* be used. Generally, you should try to use custom column methods as much as
|
| 71 |
+
* possible.
|
| 72 |
+
*
|
| 73 |
+
* Since we have defined a column_title() method later on, this method doesn't
|
| 74 |
+
* need to concern itself with any column with a name of 'title'. Instead, it
|
| 75 |
+
* needs to handle everything else.
|
| 76 |
+
*
|
| 77 |
+
* For more detailed insight into how columns are handled, take a look at
|
| 78 |
+
* WP_List_Table::single_row_columns()
|
| 79 |
+
*
|
| 80 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 81 |
+
* @param array $column_name The name/slug of the column to be processed
|
| 82 |
+
* @return string Text or HTML to be placed inside the column <td>
|
| 83 |
+
**************************************************************************/
|
| 84 |
+
function column_default($item, $column_name)
|
| 85 |
+
{
|
| 86 |
+
switch($column_name){
|
| 87 |
+
case 'title':
|
| 88 |
+
case 'description':
|
| 89 |
+
return $item[$column_name];
|
| 90 |
+
case 'supports':
|
| 91 |
+
$rows = array();
|
| 92 |
+
if (!empty($item[$column_name])) {
|
| 93 |
+
foreach ($item[$column_name] as $temp_post_type => $true) {
|
| 94 |
+
$rows[] = stripslashes(wpcf_translate($temp_post_type . ' name', $temp_post_type, 'Types-CPT'));
|
| 95 |
+
}
|
| 96 |
+
}
|
| 97 |
+
return empty($rows)? __('None', 'wpcf'):implode(', ', $rows);
|
| 98 |
+
case 'status':
|
| 99 |
+
return 'active' == $item[$column_name]? __('Yes', 'wpcf'):__('No', 'wpcf');
|
| 100 |
+
default:
|
| 101 |
+
return print_r($item,true); //Show the whole array for troubleshooting purposes
|
| 102 |
+
}
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
/** ************************************************************************
|
| 106 |
+
* Recommended. This is a custom column method and is responsible for what
|
| 107 |
+
* is rendered in any column with a name/slug of 'title'. Every time the class
|
| 108 |
+
* needs to render a column, it first looks for a method named
|
| 109 |
+
* column_{$column_title} - if it exists, that method is run. If it doesn't
|
| 110 |
+
* exist, column_default() is called instead.
|
| 111 |
+
*
|
| 112 |
+
* This example also illustrates how to implement rollover actions. Actions
|
| 113 |
+
* should be an associative array formatted as 'slug'=>'link html' - and you
|
| 114 |
+
* will need to generate the URLs yourself. You could even ensure the links
|
| 115 |
+
*
|
| 116 |
+
*
|
| 117 |
+
* @see WP_List_Table::::single_row_columns()
|
| 118 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 119 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 120 |
+
**************************************************************************/
|
| 121 |
+
function column_title($item)
|
| 122 |
+
{
|
| 123 |
+
$edit_link = add_query_arg(
|
| 124 |
+
array(
|
| 125 |
+
'page' => 'wpcf-edit-tax',
|
| 126 |
+
'wpcf-tax' => $item['slug']
|
| 127 |
+
),
|
| 128 |
+
admin_url('admin.php')
|
| 129 |
+
);
|
| 130 |
+
|
| 131 |
+
//Build row actions
|
| 132 |
+
$actions = array(
|
| 133 |
+
'edit' => sprintf('<a href="%s">%s</a>', $edit_link, __('Edit', 'wpcf')),
|
| 134 |
+
'status' => 'active' == $item['status']? wpcf_admin_custom_taxonomies_get_ajax_deactivation_link($item['slug']):wpcf_admin_custom_taxonomies_get_ajax_activation_link($item['slug']),
|
| 135 |
+
'delete' => sprintf(
|
| 136 |
+
'<a href="%s" class="submitdelete wpcf-ajax-link" id="wpcf-list-delete-%s"">%s</a>',
|
| 137 |
+
add_query_arg(
|
| 138 |
+
array(
|
| 139 |
+
'action' => 'wpcf_ajax',
|
| 140 |
+
'wpcf_action' => 'delete_taxonomy',
|
| 141 |
+
'wpcf-tax' => $item['slug'],
|
| 142 |
+
'wpcf_ajax_update' => 'wpcf_list_ajax_response_'.$item['slug'],
|
| 143 |
+
'wpcf_ajax_callback' => 'wpcfRefresh',
|
| 144 |
+
'_wpnonce' => wp_create_nonce('delete_taxonomy'),
|
| 145 |
+
'wpcf_warning' => urlencode(__('Are you sure?', 'wpcf')),
|
| 146 |
+
),
|
| 147 |
+
admin_url('admin-ajax.php')
|
| 148 |
+
),
|
| 149 |
+
$item['slug'],
|
| 150 |
+
__('Delete', 'wpcf')
|
| 151 |
+
),
|
| 152 |
+
);
|
| 153 |
+
|
| 154 |
+
//Return the title contents
|
| 155 |
+
return sprintf(
|
| 156 |
+
'<strong><a href="%s" class="row-title">%s</strong>%s',
|
| 157 |
+
$edit_link,
|
| 158 |
+
$item['title'],
|
| 159 |
+
$this->row_actions($actions)
|
| 160 |
+
);
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
/** ************************************************************************
|
| 164 |
+
* REQUIRED if displaying checkboxes or using bulk actions! The 'cb' column
|
| 165 |
+
* is given special treatment when columns are processed. It ALWAYS needs to
|
| 166 |
+
* have it's own method.
|
| 167 |
+
*
|
| 168 |
+
* @see WP_List_Table::::single_row_columns()
|
| 169 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 170 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 171 |
+
**************************************************************************/
|
| 172 |
+
function column_cb($item)
|
| 173 |
+
{
|
| 174 |
+
return sprintf(
|
| 175 |
+
'<input type="checkbox" name="%s[]" value="%s" />',
|
| 176 |
+
$this->bulk_action_field_name,
|
| 177 |
+
$item['slug']
|
| 178 |
+
);
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
/** ************************************************************************
|
| 182 |
+
* REQUIRED! This method dictates the table's columns and titles. This should
|
| 183 |
+
* return an array where the key is the column slug (and class) and the value
|
| 184 |
+
* is the column's title text. If you need a checkbox for bulk actions, refer
|
| 185 |
+
* to the $columns array below.
|
| 186 |
+
*
|
| 187 |
+
* The 'cb' column is treated differently than the rest. If including a checkbox
|
| 188 |
+
* column in your table you must create a column_cb() method. If you don't need
|
| 189 |
+
* bulk actions or checkboxes, simply leave the 'cb' entry out of your array.
|
| 190 |
+
*
|
| 191 |
+
* @see WP_List_Table::::single_row_columns()
|
| 192 |
+
* @return array An associative array containing column information: 'slugs'=>'Visible Titles'
|
| 193 |
+
**************************************************************************/
|
| 194 |
+
function get_columns()
|
| 195 |
+
{
|
| 196 |
+
$columns = array(
|
| 197 |
+
'cb' => '<input type="checkbox" />', //Render a checkbox instead of text
|
| 198 |
+
'title' => __('Taxonomy Name', 'wpcf'),
|
| 199 |
+
'description' => __('Description', 'wpcf'),
|
| 200 |
+
'status' => __('Active', 'wpcf'),
|
| 201 |
+
'supports' => __('Post Types', 'wpcf'),
|
| 202 |
+
);
|
| 203 |
+
return $columns;
|
| 204 |
+
}
|
| 205 |
+
|
| 206 |
+
/** ************************************************************************
|
| 207 |
+
* Optional. If you want one or more columns to be sortable (ASC/DESC toggle),
|
| 208 |
+
* you will need to register it here. This should return an array where the
|
| 209 |
+
* key is the column that needs to be sortable, and the value is db column to
|
| 210 |
+
* sort by. Often, the key and value will be the same, but this is not always
|
| 211 |
+
* the case (as the value is a column name from the database, not the list table).
|
| 212 |
+
*
|
| 213 |
+
* This method merely defines which columns should be sortable and makes them
|
| 214 |
+
* clickable - it does not handle the actual sorting. You still need to detect
|
| 215 |
+
* the ORDERBY and ORDER querystring variables within prepare_items() and sort
|
| 216 |
+
* your data accordingly (usually by modifying your query).
|
| 217 |
+
*
|
| 218 |
+
* @return array An associative array containing all the columns that should be sortable: 'slugs'=>array('data_values',bool)
|
| 219 |
+
**************************************************************************/
|
| 220 |
+
function get_sortable_columns()
|
| 221 |
+
{
|
| 222 |
+
$sortable_columns = array(
|
| 223 |
+
'title' => array('title',true), //true means it's already sorted
|
| 224 |
+
'description' => array('description',false),
|
| 225 |
+
'status' => array('status',false)
|
| 226 |
+
);
|
| 227 |
+
return $sortable_columns;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
/** ************************************************************************
|
| 231 |
+
* Optional. If you need to include bulk actions in your list table, this is
|
| 232 |
+
* the place to define them. Bulk actions are an associative array in the format
|
| 233 |
+
* 'slug'=>'Visible Title'
|
| 234 |
+
*
|
| 235 |
+
* If this method returns an empty value, no bulk action will be rendered. If
|
| 236 |
+
* you specify any bulk actions, the bulk actions box will be rendered with
|
| 237 |
+
* the table automatically on display().
|
| 238 |
+
*
|
| 239 |
+
* Also note that list tables are not automatically wrapped in <form> elements,
|
| 240 |
+
* so you will need to create those manually in order for bulk actions to function.
|
| 241 |
+
*
|
| 242 |
+
* @return array An associative array containing all the bulk actions: 'slugs'=>'Visible Titles'
|
| 243 |
+
**************************************************************************/
|
| 244 |
+
function get_bulk_actions()
|
| 245 |
+
{
|
| 246 |
+
$actions = array(
|
| 247 |
+
'activate' => __('Activate', 'wpcf'),
|
| 248 |
+
'deactivate' => __('Deactivate', 'wpcf'),
|
| 249 |
+
);
|
| 250 |
+
return $actions;
|
| 251 |
+
}
|
| 252 |
+
|
| 253 |
+
/** ************************************************************************
|
| 254 |
+
* Optional. You can handle your bulk actions anywhere or anyhow you prefer.
|
| 255 |
+
* For this example package, we will handle it in the class to keep things
|
| 256 |
+
* clean and organized.
|
| 257 |
+
*
|
| 258 |
+
* @see $this->prepare_items()
|
| 259 |
+
**************************************************************************/
|
| 260 |
+
function process_bulk_action()
|
| 261 |
+
{
|
| 262 |
+
$action = $this->current_action();
|
| 263 |
+
//Detect when a bulk action is being triggered...
|
| 264 |
+
switch($action) {
|
| 265 |
+
case 'deactivate':
|
| 266 |
+
if (
|
| 267 |
+
!empty($this->custom_taxonomies)
|
| 268 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 269 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 270 |
+
) {
|
| 271 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 272 |
+
if ( !isset($this->custom_taxonomies[$key]) ) {
|
| 273 |
+
continue;
|
| 274 |
+
}
|
| 275 |
+
$this->custom_taxonomies[$key]['disabled'] = 1;
|
| 276 |
+
}
|
| 277 |
+
update_option('wpcf-custom-taxonomies', $this->custom_taxonomies);
|
| 278 |
+
}
|
| 279 |
+
break;
|
| 280 |
+
case 'activate':
|
| 281 |
+
if (
|
| 282 |
+
!empty($this->custom_taxonomies)
|
| 283 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 284 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 285 |
+
) {
|
| 286 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 287 |
+
if ( !isset($this->custom_taxonomies[$key]) ) {
|
| 288 |
+
continue;
|
| 289 |
+
}
|
| 290 |
+
if ( isset($this->custom_taxonomies[$key]['disabled']) ) {
|
| 291 |
+
unset($this->custom_taxonomies[$key]['disabled']);
|
| 292 |
+
}
|
| 293 |
+
}
|
| 294 |
+
update_option('wpcf-custom-taxonomies', $this->custom_taxonomies);
|
| 295 |
+
}
|
| 296 |
+
break;
|
| 297 |
+
}
|
| 298 |
+
}
|
| 299 |
+
|
| 300 |
+
/** ************************************************************************
|
| 301 |
+
* REQUIRED! This is where you prepare your data for display. This method will
|
| 302 |
+
* usually be used to query the database, sort and filter the data, and generally
|
| 303 |
+
* get it ready to be displayed. At a minimum, we should set $this->items and
|
| 304 |
+
* $this->set_pagination_args(), although the following properties and methods
|
| 305 |
+
* are frequently interacted with here...
|
| 306 |
+
*
|
| 307 |
+
* @uses $this->_column_headers
|
| 308 |
+
* @uses $this->items
|
| 309 |
+
* @uses $this->get_columns()
|
| 310 |
+
* @uses $this->get_sortable_columns()
|
| 311 |
+
* @uses $this->get_pagenum()
|
| 312 |
+
* @uses $this->set_pagination_args()
|
| 313 |
+
**************************************************************************/
|
| 314 |
+
function prepare_items()
|
| 315 |
+
{
|
| 316 |
+
/**
|
| 317 |
+
* First, lets decide how many records per page to show
|
| 318 |
+
*/
|
| 319 |
+
$per_page = $this->get_items_per_page('wpcf_ctt_per_page', 10);;
|
| 320 |
+
|
| 321 |
+
/**
|
| 322 |
+
* REQUIRED. Now we need to define our column headers. This includes a complete
|
| 323 |
+
* array of columns to be displayed (slugs & titles), a list of columns
|
| 324 |
+
* to keep hidden, and a list of columns that are sortable. Each of these
|
| 325 |
+
* can be defined in another method (as we've done here) before being
|
| 326 |
+
* used to build the value for our _column_headers property.
|
| 327 |
+
*/
|
| 328 |
+
$columns = $this->get_columns();
|
| 329 |
+
$hidden = array();
|
| 330 |
+
$sortable = $this->get_sortable_columns();
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* REQUIRED. Finally, we build an array to be used by the class for column
|
| 334 |
+
* headers. The $this->_column_headers property takes an array which contains
|
| 335 |
+
* 3 other arrays. One for all columns, one for hidden columns, and one
|
| 336 |
+
* for sortable columns.
|
| 337 |
+
*/
|
| 338 |
+
$this->_column_headers = array($columns, $hidden, $sortable);
|
| 339 |
+
|
| 340 |
+
/**
|
| 341 |
+
* Optional. You can handle your bulk actions however you see fit. In this
|
| 342 |
+
* case, we'll handle them within our package just to keep things clean.
|
| 343 |
+
*/
|
| 344 |
+
$this->process_bulk_action();
|
| 345 |
+
|
| 346 |
+
/**
|
| 347 |
+
* Instead of querying a database, we're going to fetch the example data
|
| 348 |
+
* property we created for use in this plugin. This makes this example
|
| 349 |
+
* package slightly different than one you might build on your own. In
|
| 350 |
+
* this example, we'll be using array manipulation to sort and paginate
|
| 351 |
+
* our data. In a real-world implementation, you will probably want to
|
| 352 |
+
* use sort and pagination data to build a custom query instead, as you'll
|
| 353 |
+
* be able to use your precisely-queried data immediately.
|
| 354 |
+
*/
|
| 355 |
+
|
| 356 |
+
$s = isset($_POST['s'])? mb_strtolower(trim($_POST['s'])):false;
|
| 357 |
+
|
| 358 |
+
$data = array();
|
| 359 |
+
if ( !empty($this->custom_taxonomies) ){
|
| 360 |
+
foreach( array_values($this->custom_taxonomies) as $taxonomy ) {
|
| 361 |
+
$one = array(
|
| 362 |
+
'description' => $taxonomy['description'],
|
| 363 |
+
'supports' => isset($taxonomy['supports'])? $taxonomy['supports']:array(),
|
| 364 |
+
'slug' => $taxonomy['slug'],
|
| 365 |
+
'status' => (isset($taxonomy['disabled']) && $taxonomy['disabled'])? 'inactive':'active',
|
| 366 |
+
'title' => $taxonomy['labels']['singular_name'],
|
| 367 |
+
);
|
| 368 |
+
$add_one = true;
|
| 369 |
+
if ( $s ) {
|
| 370 |
+
$add_one = false;
|
| 371 |
+
foreach( array('description', 'slug', 'title' ) as $key ) {
|
| 372 |
+
if ( $add_one || empty( $one[$key] ) ) {
|
| 373 |
+
continue;
|
| 374 |
+
}
|
| 375 |
+
if ( is_numeric(strpos(mb_strtolower($one[$key]), $s))) {
|
| 376 |
+
$add_one = true;
|
| 377 |
+
}
|
| 378 |
+
}
|
| 379 |
+
}
|
| 380 |
+
if ( $add_one ) {
|
| 381 |
+
$data[] = $one;
|
| 382 |
+
}
|
| 383 |
+
}
|
| 384 |
+
}
|
| 385 |
+
|
| 386 |
+
/**
|
| 387 |
+
* This checks for sorting input and sorts the data in our array accordingly.
|
| 388 |
+
*/
|
| 389 |
+
usort($data, 'wpcf_usort_reorder');
|
| 390 |
+
|
| 391 |
+
/**
|
| 392 |
+
* REQUIRED for pagination. Let's figure out what page the user is currently
|
| 393 |
+
* looking at. We'll need this later, so you should always include it in
|
| 394 |
+
* your own package classes.
|
| 395 |
+
*/
|
| 396 |
+
$current_page = $this->get_pagenum();
|
| 397 |
+
|
| 398 |
+
/**
|
| 399 |
+
* REQUIRED for pagination. Let's check how many items are in our data array.
|
| 400 |
+
* In real-world use, this would be the total number of items in your database,
|
| 401 |
+
* without filtering. We'll need this later, so you should always include it
|
| 402 |
+
* in your own package classes.
|
| 403 |
+
*/
|
| 404 |
+
$total_items = count($data);
|
| 405 |
+
|
| 406 |
+
/**
|
| 407 |
+
* The WP_List_Table class does not handle pagination for us, so we need
|
| 408 |
+
* to ensure that the data is trimmed to only the current page. We can use
|
| 409 |
+
* array_slice() to
|
| 410 |
+
*/
|
| 411 |
+
$data = array_slice($data,(($current_page-1)*$per_page),$per_page);
|
| 412 |
+
|
| 413 |
+
/**
|
| 414 |
+
* REQUIRED. Now we can add our *sorted* data to the items property, where
|
| 415 |
+
* it can be used by the rest of the class.
|
| 416 |
+
*/
|
| 417 |
+
$this->items = $data;
|
| 418 |
+
|
| 419 |
+
/**
|
| 420 |
+
* REQUIRED. We also have to register our pagination options & calculations.
|
| 421 |
+
*/
|
| 422 |
+
$this->set_pagination_args( array(
|
| 423 |
+
'total_items' => $total_items, //WE have to calculate the total number of items
|
| 424 |
+
'per_page' => $per_page, //WE have to determine how many items to show on a page
|
| 425 |
+
'total_pages' => ceil($total_items/$per_page) //WE have to calculate the total number of pages
|
| 426 |
+
) );
|
| 427 |
+
}
|
| 428 |
+
|
| 429 |
+
/**
|
| 430 |
+
* Generates content for a single row of the table
|
| 431 |
+
*
|
| 432 |
+
* @since 3.1.0
|
| 433 |
+
* @access public
|
| 434 |
+
*
|
| 435 |
+
* @param object $item The current item
|
| 436 |
+
*/
|
| 437 |
+
public function single_row( $item )
|
| 438 |
+
{
|
| 439 |
+
static $row_class = '';
|
| 440 |
+
$row_class = ( $row_class == '' ? 'alternate' : '' );
|
| 441 |
+
|
| 442 |
+
printf('<tr class="%s status-%s">', $row_class, $item['status']);
|
| 443 |
+
$this->single_row_columns( $item );
|
| 444 |
+
echo '</tr>';
|
| 445 |
+
}
|
| 446 |
+
|
| 447 |
+
public function no_items()
|
| 448 |
+
{
|
| 449 |
+
if ( isset($_POST['s']) ) {
|
| 450 |
+
_e('No custom taxonomies found.','wpcf');
|
| 451 |
+
return;
|
| 452 |
+
}
|
| 453 |
+
wpcf_admin_ctt_list_header();
|
| 454 |
+
printf(
|
| 455 |
+
'<a class="button-primary" href="%s">%s</a>',
|
| 456 |
+
add_query_arg(
|
| 457 |
+
array(
|
| 458 |
+
'page' => 'wpcf-edit-tax',
|
| 459 |
+
),
|
| 460 |
+
admin_url('admin.php')
|
| 461 |
+
),
|
| 462 |
+
__('Add New Taxonomy', 'wpcf')
|
| 463 |
+
);
|
| 464 |
+
}
|
| 465 |
+
|
| 466 |
+
}
|
includes/classes/class.wpcf.user.fields.list.table.php
ADDED
|
@@ -0,0 +1,475 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*************************** LOAD THE BASE CLASS *******************************
|
| 4 |
+
*******************************************************************************
|
| 5 |
+
* The WP_List_Table class isn't automatically available to plugins, so we need
|
| 6 |
+
* to check if it's available and load it if necessary. In this tutorial, we are
|
| 7 |
+
* going to use the WP_List_Table class directly from WordPress core.
|
| 8 |
+
*
|
| 9 |
+
* IMPORTANT:
|
| 10 |
+
* Please note that the WP_List_Table class technically isn't an official API,
|
| 11 |
+
* and it could change at some point in the distant future. Should that happen,
|
| 12 |
+
* I will update this plugin with the most current techniques for your reference
|
| 13 |
+
* immediately.
|
| 14 |
+
*
|
| 15 |
+
* If you are really worried about future compatibility, you can make a copy of
|
| 16 |
+
* the WP_List_Table class (file path is shown just below) to use and distribute
|
| 17 |
+
* with your plugins. If you do that, just remember to change the name of the
|
| 18 |
+
* class to avoid conflicts with core.
|
| 19 |
+
*
|
| 20 |
+
* Since I will be keeping this tutorial up-to-date for the foreseeable future,
|
| 21 |
+
* I am going to work with the copy of the class provided in WordPress core.
|
| 22 |
+
*/
|
| 23 |
+
if(!class_exists('WP_List_Table')){
|
| 24 |
+
require_once( ABSPATH . 'wp-admin/includes/class-wp-list-table.php' );
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/************************** CREATE A PACKAGE CLASS *****************************
|
| 28 |
+
*******************************************************************************
|
| 29 |
+
* Create a new list table package that extends the core WP_List_Table class.
|
| 30 |
+
* WP_List_Table contains most of the framework for generating the table, but we
|
| 31 |
+
* need to define and override some methods so that our data can be displayed
|
| 32 |
+
* exactly the way we need it to be.
|
| 33 |
+
*
|
| 34 |
+
* To display this example on a page, you will first need to instantiate the class,
|
| 35 |
+
* then call $yourInstance->prepare_items() to handle any data manipulation, then
|
| 36 |
+
* finally call $yourInstance->display() to render the table to the page.
|
| 37 |
+
*
|
| 38 |
+
* Our theme for this list table is going to be movies.
|
| 39 |
+
*/
|
| 40 |
+
class WPCF_User_Fields_List_Table extends WP_List_Table
|
| 41 |
+
{
|
| 42 |
+
var $bulk_action_field_name = 'wpcf_ids';
|
| 43 |
+
/** ************************************************************************
|
| 44 |
+
* REQUIRED. Set up a constructor that references the parent constructor. We
|
| 45 |
+
* use the parent reference to set some default configs.
|
| 46 |
+
***************************************************************************/
|
| 47 |
+
function __construct()
|
| 48 |
+
{
|
| 49 |
+
global $status, $page;
|
| 50 |
+
|
| 51 |
+
//Set parent defaults
|
| 52 |
+
parent::__construct( array(
|
| 53 |
+
'singular' => 'user field group', //singular name of the listed records
|
| 54 |
+
'plural' => 'user field groups', //plural name of the listed records
|
| 55 |
+
'ajax' => true //does this table support ajax?
|
| 56 |
+
) );
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
/** ************************************************************************
|
| 60 |
+
* Recommended. This method is called when the parent class can't find a method
|
| 61 |
+
* specifically build for a given column. Generally, it's recommended to include
|
| 62 |
+
* one method for each column you want to render, keeping your package class
|
| 63 |
+
* neat and organized. For example, if the class needs to process a column
|
| 64 |
+
* named 'title', it would first see if a method named $this->column_title()
|
| 65 |
+
* exists - if it does, that method will be used. If it doesn't, this one will
|
| 66 |
+
* be used. Generally, you should try to use custom column methods as much as
|
| 67 |
+
* possible.
|
| 68 |
+
*
|
| 69 |
+
* Since we have defined a column_title() method later on, this method doesn't
|
| 70 |
+
* need to concern itself with any column with a name of 'title'. Instead, it
|
| 71 |
+
* needs to handle everything else.
|
| 72 |
+
*
|
| 73 |
+
* For more detailed insight into how columns are handled, take a look at
|
| 74 |
+
* WP_List_Table::single_row_columns()
|
| 75 |
+
*
|
| 76 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 77 |
+
* @param array $column_name The name/slug of the column to be processed
|
| 78 |
+
* @return string Text or HTML to be placed inside the column <td>
|
| 79 |
+
**************************************************************************/
|
| 80 |
+
function column_default($item, $column_name)
|
| 81 |
+
{
|
| 82 |
+
switch($column_name){
|
| 83 |
+
case 'title':
|
| 84 |
+
case 'description':
|
| 85 |
+
return $item[$column_name];
|
| 86 |
+
case 'show_for':
|
| 87 |
+
$show_for = wpcf_admin_get_groups_showfor_by_group($item['id']);
|
| 88 |
+
if (function_exists('wpcf_access_register_caps')){
|
| 89 |
+
$show_for = __('This groups visibility is also controlled by the Access plugin.',
|
| 90 |
+
'wpcf');
|
| 91 |
+
}
|
| 92 |
+
else{
|
| 93 |
+
$show_for = (count($show_for) == 0) ? __('Displayed for all users roles', 'wpcf') : ucwords(implode($show_for, ', '));
|
| 94 |
+
}
|
| 95 |
+
return $show_for;
|
| 96 |
+
case 'status':
|
| 97 |
+
return 'active' == $item[$column_name]? __('Yes', 'wpcf'):__('No', 'wpcf');
|
| 98 |
+
default:
|
| 99 |
+
return print_r($item,true); //Show the whole array for troubleshooting purposes
|
| 100 |
+
}
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
/** ************************************************************************
|
| 104 |
+
* Recommended. This is a custom column method and is responsible for what
|
| 105 |
+
* is rendered in any column with a name/slug of 'title'. Every time the class
|
| 106 |
+
* needs to render a column, it first looks for a method named
|
| 107 |
+
* column_{$column_title} - if it exists, that method is run. If it doesn't
|
| 108 |
+
* exist, column_default() is called instead.
|
| 109 |
+
*
|
| 110 |
+
* This example also illustrates how to implement rollover actions. Actions
|
| 111 |
+
* should be an associative array formatted as 'slug'=>'link html' - and you
|
| 112 |
+
* will need to generate the URLs yourself. You could even ensure the links
|
| 113 |
+
*
|
| 114 |
+
*
|
| 115 |
+
* @see WP_List_Table::::single_row_columns()
|
| 116 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 117 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 118 |
+
**************************************************************************/
|
| 119 |
+
function column_title($item)
|
| 120 |
+
{
|
| 121 |
+
$edit_link = add_query_arg(
|
| 122 |
+
array(
|
| 123 |
+
'page' => 'wpcf-edit-usermeta',
|
| 124 |
+
'group_id' => $item['id']
|
| 125 |
+
),
|
| 126 |
+
admin_url('admin.php')
|
| 127 |
+
);
|
| 128 |
+
|
| 129 |
+
//Build row actions
|
| 130 |
+
$actions = array(
|
| 131 |
+
'edit' => sprintf('<a href="%s">%s</a>', $edit_link, __('Edit', 'wpcf')),
|
| 132 |
+
'status' => 'active' == $item['status']? wpcf_admin_usermeta_get_ajax_deactivation_link($item['id']):wpcf_admin_usermeta_get_ajax_activation_link($item['id']),
|
| 133 |
+
'delete' => sprintf(
|
| 134 |
+
'<a href="%s" class="submitdelete wpcf-ajax-link" id="wpcf-list-delete-%d"">%s</a>',
|
| 135 |
+
add_query_arg(
|
| 136 |
+
array(
|
| 137 |
+
'action' => 'wpcf_ajax',
|
| 138 |
+
'wpcf_action' => 'delete_usermeta_group',
|
| 139 |
+
'group_id' => $item['id'],
|
| 140 |
+
'wpcf_ajax_update' => 'wpcf_list_ajax_response_'.$item['id'],
|
| 141 |
+
'wpcf_ajax_callback' => 'wpcfRefresh',
|
| 142 |
+
'_wpnonce' => wp_create_nonce('delete_usermeta_group'),
|
| 143 |
+
'wpcf_warning' => urlencode(__('Are you sure?', 'wpcf')),
|
| 144 |
+
),
|
| 145 |
+
admin_url('admin-ajax.php')
|
| 146 |
+
),
|
| 147 |
+
$item['id'],
|
| 148 |
+
__('Delete', 'wpcf')
|
| 149 |
+
),
|
| 150 |
+
);
|
| 151 |
+
|
| 152 |
+
//Return the title contents
|
| 153 |
+
return sprintf(
|
| 154 |
+
'<strong><a href="%s" class="row-title">%s</strong>%s',
|
| 155 |
+
$edit_link,
|
| 156 |
+
$item['title'],
|
| 157 |
+
$this->row_actions($actions)
|
| 158 |
+
);
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
/** ************************************************************************
|
| 162 |
+
* REQUIRED if displaying checkboxes or using bulk actions! The 'cb' column
|
| 163 |
+
* is given special treatment when columns are processed. It ALWAYS needs to
|
| 164 |
+
* have it's own method.
|
| 165 |
+
*
|
| 166 |
+
* @see WP_List_Table::::single_row_columns()
|
| 167 |
+
* @param array $item A singular item (one full row's worth of data)
|
| 168 |
+
* @return string Text to be placed inside the column <td> (movie title only)
|
| 169 |
+
**************************************************************************/
|
| 170 |
+
function column_cb($item)
|
| 171 |
+
{
|
| 172 |
+
return sprintf(
|
| 173 |
+
'<input type="checkbox" name="%s[]" value="%s" />',
|
| 174 |
+
$this->bulk_action_field_name,
|
| 175 |
+
$item['id']
|
| 176 |
+
);
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
/** ************************************************************************
|
| 180 |
+
* REQUIRED! This method dictates the table's columns and titles. This should
|
| 181 |
+
* return an array where the key is the column slug (and class) and the value
|
| 182 |
+
* is the column's title text. If you need a checkbox for bulk actions, refer
|
| 183 |
+
* to the $columns array below.
|
| 184 |
+
*
|
| 185 |
+
* The 'cb' column is treated differently than the rest. If including a checkbox
|
| 186 |
+
* column in your table you must create a column_cb() method. If you don't need
|
| 187 |
+
* bulk actions or checkboxes, simply leave the 'cb' entry out of your array.
|
| 188 |
+
*
|
| 189 |
+
* @see WP_List_Table::::single_row_columns()
|
| 190 |
+
* @return array An associative array containing column information: 'slugs'=>'Visible Titles'
|
| 191 |
+
**************************************************************************/
|
| 192 |
+
function get_columns()
|
| 193 |
+
{
|
| 194 |
+
$columns = array(
|
| 195 |
+
'cb' => '<input type="checkbox" />', //Render a checkbox instead of text
|
| 196 |
+
'title' => __('Group Name', 'wpcf'),
|
| 197 |
+
'description' => __('Description', 'wpcf'),
|
| 198 |
+
'status' => __('Active', 'wpcf'),
|
| 199 |
+
'show_for' => __('Available for', 'wpcf'),
|
| 200 |
+
);
|
| 201 |
+
return $columns;
|
| 202 |
+
}
|
| 203 |
+
|
| 204 |
+
/** ************************************************************************
|
| 205 |
+
* Optional. If you want one or more columns to be sortable (ASC/DESC toggle),
|
| 206 |
+
* you will need to register it here. This should return an array where the
|
| 207 |
+
* key is the column that needs to be sortable, and the value is db column to
|
| 208 |
+
* sort by. Often, the key and value will be the same, but this is not always
|
| 209 |
+
* the case (as the value is a column name from the database, not the list table).
|
| 210 |
+
*
|
| 211 |
+
* This method merely defines which columns should be sortable and makes them
|
| 212 |
+
* clickable - it does not handle the actual sorting. You still need to detect
|
| 213 |
+
* the ORDERBY and ORDER querystring variables within prepare_items() and sort
|
| 214 |
+
* your data accordingly (usually by modifying your query).
|
| 215 |
+
*
|
| 216 |
+
* @return array An associative array containing all the columns that should be sortable: 'slugs'=>array('data_values',bool)
|
| 217 |
+
**************************************************************************/
|
| 218 |
+
function get_sortable_columns()
|
| 219 |
+
{
|
| 220 |
+
$sortable_columns = array(
|
| 221 |
+
'title' => array('title',true), //true means it's already sorted
|
| 222 |
+
'description' => array('description',false),
|
| 223 |
+
'status' => array('status',false)
|
| 224 |
+
);
|
| 225 |
+
return $sortable_columns;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
/** ************************************************************************
|
| 229 |
+
* Optional. If you need to include bulk actions in your list table, this is
|
| 230 |
+
* the place to define them. Bulk actions are an associative array in the format
|
| 231 |
+
* 'slug'=>'Visible Title'
|
| 232 |
+
*
|
| 233 |
+
* If this method returns an empty value, no bulk action will be rendered. If
|
| 234 |
+
* you specify any bulk actions, the bulk actions box will be rendered with
|
| 235 |
+
* the table automatically on display().
|
| 236 |
+
*
|
| 237 |
+
* Also note that list tables are not automatically wrapped in <form> elements,
|
| 238 |
+
* so you will need to create those manually in order for bulk actions to function.
|
| 239 |
+
*
|
| 240 |
+
* @return array An associative array containing all the bulk actions: 'slugs'=>'Visible Titles'
|
| 241 |
+
**************************************************************************/
|
| 242 |
+
function get_bulk_actions()
|
| 243 |
+
{
|
| 244 |
+
$actions = array(
|
| 245 |
+
'activate' => __('Activate', 'wpcf'),
|
| 246 |
+
'deactivate' => __('Deactivate', 'wpcf'),
|
| 247 |
+
);
|
| 248 |
+
return $actions;
|
| 249 |
+
}
|
| 250 |
+
|
| 251 |
+
/** ************************************************************************
|
| 252 |
+
* Optional. You can handle your bulk actions anywhere or anyhow you prefer.
|
| 253 |
+
* For this example package, we will handle it in the class to keep things
|
| 254 |
+
* clean and organized.
|
| 255 |
+
*
|
| 256 |
+
* @global object $wpdb
|
| 257 |
+
*
|
| 258 |
+
* @see $this->prepare_items()
|
| 259 |
+
**************************************************************************/
|
| 260 |
+
function process_bulk_action()
|
| 261 |
+
{
|
| 262 |
+
global $wpdb;
|
| 263 |
+
$action = $this->current_action();
|
| 264 |
+
//Detect when a bulk action is being triggered...
|
| 265 |
+
switch($action) {
|
| 266 |
+
case 'deactivate':
|
| 267 |
+
if (
|
| 268 |
+
true
|
| 269 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 270 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 271 |
+
) {
|
| 272 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 273 |
+
$wpdb->update(
|
| 274 |
+
$wpdb->posts,
|
| 275 |
+
array( 'post_status' => 'draft' ),
|
| 276 |
+
array( 'ID' => $key, 'post_type' => 'wp-types-user-group' ),
|
| 277 |
+
array('%s'),
|
| 278 |
+
array('%d', '%s')
|
| 279 |
+
);
|
| 280 |
+
}
|
| 281 |
+
}
|
| 282 |
+
break;
|
| 283 |
+
case 'activate':
|
| 284 |
+
if (
|
| 285 |
+
true
|
| 286 |
+
&& isset($_POST[$this->bulk_action_field_name])
|
| 287 |
+
&& !empty($_POST[$this->bulk_action_field_name])
|
| 288 |
+
) {
|
| 289 |
+
foreach( $_POST[$this->bulk_action_field_name] as $key ) {
|
| 290 |
+
$wpdb->update(
|
| 291 |
+
$wpdb->posts,
|
| 292 |
+
array( 'post_status' => 'publish' ),
|
| 293 |
+
array( 'ID' => $key ),
|
| 294 |
+
array('%s'),
|
| 295 |
+
array('%d')
|
| 296 |
+
);
|
| 297 |
+
}
|
| 298 |
+
}
|
| 299 |
+
break;
|
| 300 |
+
}
|
| 301 |
+
wp_cache_delete(md5('group::_get_group'.'wp-types-user-group'),'types_cache_groups');
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
/** ************************************************************************
|
| 305 |
+
* REQUIRED! This is where you prepare your data for display. This method will
|
| 306 |
+
* usually be used to query the database, sort and filter the data, and generally
|
| 307 |
+
* get it ready to be displayed. At a minimum, we should set $this->items and
|
| 308 |
+
* $this->set_pagination_args(), although the following properties and methods
|
| 309 |
+
* are frequently interacted with here...
|
| 310 |
+
*
|
| 311 |
+
* @uses $this->_column_headers
|
| 312 |
+
* @uses $this->items
|
| 313 |
+
* @uses $this->get_columns()
|
| 314 |
+
* @uses $this->get_sortable_columns()
|
| 315 |
+
* @uses $this->get_pagenum()
|
| 316 |
+
* @uses $this->set_pagination_args()
|
| 317 |
+
**************************************************************************/
|
| 318 |
+
function prepare_items()
|
| 319 |
+
{
|
| 320 |
+
/**
|
| 321 |
+
* First, lets decide how many records per page to show
|
| 322 |
+
*/
|
| 323 |
+
$per_page = $this->get_items_per_page('wpcf_uf_per_page', 10);;
|
| 324 |
+
|
| 325 |
+
/**
|
| 326 |
+
* REQUIRED. Now we need to define our column headers. This includes a complete
|
| 327 |
+
* array of columns to be displayed (slugs & titles), a list of columns
|
| 328 |
+
* to keep hidden, and a list of columns that are sortable. Each of these
|
| 329 |
+
* can be defined in another method (as we've done here) before being
|
| 330 |
+
* used to build the value for our _column_headers property.
|
| 331 |
+
*/
|
| 332 |
+
$columns = $this->get_columns();
|
| 333 |
+
$hidden = array();
|
| 334 |
+
$sortable = $this->get_sortable_columns();
|
| 335 |
+
|
| 336 |
+
/**
|
| 337 |
+
* REQUIRED. Finally, we build an array to be used by the class for column
|
| 338 |
+
* headers. The $this->_column_headers property takes an array which contains
|
| 339 |
+
* 3 other arrays. One for all columns, one for hidden columns, and one
|
| 340 |
+
* for sortable columns.
|
| 341 |
+
*/
|
| 342 |
+
$this->_column_headers = array($columns, $hidden, $sortable);
|
| 343 |
+
|
| 344 |
+
/**
|
| 345 |
+
* Optional. You can handle your bulk actions however you see fit. In this
|
| 346 |
+
* case, we'll handle them within our package just to keep things clean.
|
| 347 |
+
*/
|
| 348 |
+
$this->process_bulk_action();
|
| 349 |
+
|
| 350 |
+
/**
|
| 351 |
+
* Instead of querying a database, we're going to fetch the example data
|
| 352 |
+
* property we created for use in this plugin. This makes this example
|
| 353 |
+
* package slightly different than one you might build on your own. In
|
| 354 |
+
* this example, we'll be using array manipulation to sort and paginate
|
| 355 |
+
* our data. In a real-world implementation, you will probably want to
|
| 356 |
+
* use sort and pagination data to build a custom query instead, as you'll
|
| 357 |
+
* be able to use your precisely-queried data immediately.
|
| 358 |
+
*/
|
| 359 |
+
|
| 360 |
+
$s = isset($_POST['s'])? mb_strtolower(trim($_POST['s'])):false;
|
| 361 |
+
|
| 362 |
+
$data = array();
|
| 363 |
+
$groups = wpcf_admin_fields_get_groups('wp-types-user-group');
|
| 364 |
+
if ( !empty($groups) ){
|
| 365 |
+
foreach( array_values($groups) as $group ) {
|
| 366 |
+
$one = array(
|
| 367 |
+
'description' => $group['description'],
|
| 368 |
+
'id' => $group['id'],
|
| 369 |
+
'slug' => $group['slug'],
|
| 370 |
+
'status' => (isset($group['is_active']) && $group['is_active'])? 'active':'inactive',
|
| 371 |
+
'supports' => isset($group['supports'])? $group['supports']:array(),
|
| 372 |
+
'title' => $group['name'],
|
| 373 |
+
);
|
| 374 |
+
$add_one = true;
|
| 375 |
+
if ( $s ) {
|
| 376 |
+
$add_one = false;
|
| 377 |
+
foreach( array('description', 'id', 'slug', 'title' ) as $key ) {
|
| 378 |
+
if ( $add_one || empty( $one[$key] ) ) {
|
| 379 |
+
continue;
|
| 380 |
+
}
|
| 381 |
+
if ( is_numeric(strpos(mb_strtolower($one[$key]), $s))) {
|
| 382 |
+
$add_one = true;
|
| 383 |
+
}
|
| 384 |
+
}
|
| 385 |
+
}
|
| 386 |
+
if ( $add_one ) {
|
| 387 |
+
$data[] = $one;
|
| 388 |
+
}
|
| 389 |
+
}
|
| 390 |
+
}
|
| 391 |
+
|
| 392 |
+
/**
|
| 393 |
+
* This checks for sorting input and sorts the data in our array accordingly.
|
| 394 |
+
*/
|
| 395 |
+
usort($data, 'wpcf_usort_reorder');
|
| 396 |
+
|
| 397 |
+
/**
|
| 398 |
+
* REQUIRED for pagination. Let's figure out what page the user is currently
|
| 399 |
+
* looking at. We'll need this later, so you should always include it in
|
| 400 |
+
* your own package classes.
|
| 401 |
+
*/
|
| 402 |
+
$current_page = $this->get_pagenum();
|
| 403 |
+
|
| 404 |
+
/**
|
| 405 |
+
* REQUIRED for pagination. Let's check how many items are in our data array.
|
| 406 |
+
* In real-world use, this would be the total number of items in your database,
|
| 407 |
+
* without filtering. We'll need this later, so you should always include it
|
| 408 |
+
* in your own package classes.
|
| 409 |
+
*/
|
| 410 |
+
$total_items = count($data);
|
| 411 |
+
|
| 412 |
+
/**
|
| 413 |
+
* The WP_List_Table class does not handle pagination for us, so we need
|
| 414 |
+
* to ensure that the data is trimmed to only the current page. We can use
|
| 415 |
+
* array_slice() to
|
| 416 |
+
*/
|
| 417 |
+
$data = array_slice($data,(($current_page-1)*$per_page),$per_page);
|
| 418 |
+
|
| 419 |
+
/**
|
| 420 |
+
* REQUIRED. Now we can add our *sorted* data to the items property, where
|
| 421 |
+
* it can be used by the rest of the class.
|
| 422 |
+
*/
|
| 423 |
+
$this->items = $data;
|
| 424 |
+
|
| 425 |
+
/**
|
| 426 |
+
* REQUIRED. We also have to register our pagination options & calculations.
|
| 427 |
+
*/
|
| 428 |
+
$this->set_pagination_args( array(
|
| 429 |
+
'total_items' => $total_items, //WE have to calculate the total number of items
|
| 430 |
+
'per_page' => $per_page, //WE have to determine how many items to show on a page
|
| 431 |
+
'total_pages' => ceil($total_items/$per_page) //WE have to calculate the total number of pages
|
| 432 |
+
) );
|
| 433 |
+
}
|
| 434 |
+
|
| 435 |
+
/**
|
| 436 |
+
* Generates content for a single row of the table
|
| 437 |
+
*
|
| 438 |
+
* @since 3.1.0
|
| 439 |
+
* @access public
|
| 440 |
+
*
|
| 441 |
+
* @param object $item The current item
|
| 442 |
+
*/
|
| 443 |
+
public function single_row( $item )
|
| 444 |
+
{
|
| 445 |
+
static $row_class = '';
|
| 446 |
+
$row_class = ( $row_class == '' ? 'alternate' : '' );
|
| 447 |
+
|
| 448 |
+
printf('<tr class="%s status-%s">', $row_class, $item['status']);
|
| 449 |
+
$this->single_row_columns( $item );
|
| 450 |
+
echo '</tr>';
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
public function no_items()
|
| 454 |
+
{
|
| 455 |
+
if ( isset($_POST['s']) ) {
|
| 456 |
+
_e('No user field groups found.','wpcf');
|
| 457 |
+
return;
|
| 458 |
+
}
|
| 459 |
+
printf(
|
| 460 |
+
'<p>%s</p>',
|
| 461 |
+
__('User Fields, also known as user-meta, are additional fields that belong to user profiles.','wpcf')
|
| 462 |
+
);
|
| 463 |
+
printf(
|
| 464 |
+
'<a class="button-primary" href="%s">%s</a>',
|
| 465 |
+
add_query_arg(
|
| 466 |
+
array(
|
| 467 |
+
'page' => 'wpcf-edit-usermeta',
|
| 468 |
+
),
|
| 469 |
+
admin_url('admin.php')
|
| 470 |
+
),
|
| 471 |
+
__('Add New Usermeta Group', 'wpcf')
|
| 472 |
+
);
|
| 473 |
+
}
|
| 474 |
+
|
| 475 |
+
}
|
includes/common-functions.php
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
*
|
| 4 |
* Custom types form - common functions
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 8 |
* $LastChangedRevision: 1069430 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 3 |
*
|
| 4 |
* Custom types form - common functions
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/common-functions.php $
|
| 7 |
* $LastChangedDate: 2015-01-16 14:28:15 +0000 (Fri, 16 Jan 2015) $
|
| 8 |
* $LastChangedRevision: 1069430 $
|
| 9 |
* $LastChangedBy: iworks $
|
includes/conditional-display.php
CHANGED
|
@@ -31,7 +31,7 @@ function wpcf_cd_form_field_filter( $form, $data ) {
|
|
| 31 |
parse_str( $_SERVER['HTTP_REFERER'], $vars );
|
| 32 |
} else if ( isset( $_GET['group_id'] ) ) {
|
| 33 |
$vars = array();
|
| 34 |
-
$vars['group_id'] = $_GET['group_id'];
|
| 35 |
}
|
| 36 |
if ( !isset( $vars['group_id'] ) ) {
|
| 37 |
return $form + array(
|
|
@@ -165,7 +165,7 @@ function wpcf_cd_admin_form_filter( $data, $group = false ) {
|
|
| 165 |
'wpcf' ), $count_text ) . '</strong><br />'
|
| 166 |
. __( "Specify additional filters that control this group's display, based on values of custom fields.",
|
| 167 |
'wpcf' )
|
| 168 |
-
. '<br /><a class="button-secondary" onclick="jQuery(this).css(\'display\',\'none\').next().slideToggle();" ' . $wpcf_button_style30 . ' href="javascript:void(0);">'
|
| 169 |
. __( 'Edit', 'wpcf' ) . '</a><div id="wpcf-cd-group" class="wpcf-cd-fieldset" style="display:none;">',
|
| 170 |
);
|
| 171 |
}
|
|
@@ -197,7 +197,7 @@ function wpcf_cd_admin_form_filter( $data, $group = false ) {
|
|
| 197 |
$_add_id .= $group ? 'group' : 'field_' . $data['id'];
|
| 198 |
|
| 199 |
// Set link param
|
| 200 |
-
$_temp_group_id = isset( $_GET['group_id'] ) ? '&group_id=' . $_GET['group_id'] : '';
|
| 201 |
$_url = admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=add_condition'
|
| 202 |
. $_temp_group_id . '&_wpnonce='
|
| 203 |
. wp_create_nonce( 'add_condition' ) );
|
|
@@ -313,10 +313,21 @@ function wpcf_cd_admin_form_filter( $data, $group = false ) {
|
|
| 313 |
),
|
| 314 |
);
|
| 315 |
if ( $group ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 316 |
$form['cd']['wrap_close'] = array(
|
| 317 |
'#type' => 'markup',
|
| 318 |
-
'#markup' => '
|
| 319 |
-
. __( 'OK', 'wpcf' ) . '</a></div>',
|
| 320 |
);
|
| 321 |
}
|
| 322 |
return $group ? $form['cd'] : $form;
|
| 31 |
parse_str( $_SERVER['HTTP_REFERER'], $vars );
|
| 32 |
} else if ( isset( $_GET['group_id'] ) ) {
|
| 33 |
$vars = array();
|
| 34 |
+
$vars['group_id'] = sanitize_text_field( $_GET['group_id'] );
|
| 35 |
}
|
| 36 |
if ( !isset( $vars['group_id'] ) ) {
|
| 37 |
return $form + array(
|
| 165 |
'wpcf' ), $count_text ) . '</strong><br />'
|
| 166 |
. __( "Specify additional filters that control this group's display, based on values of custom fields.",
|
| 167 |
'wpcf' )
|
| 168 |
+
. '<br /><a class="button-secondary" id="conditional-logic-button-open" onclick="jQuery(this).css(\'display\',\'none\').next().slideToggle();" ' . $wpcf_button_style30 . ' href="javascript:void(0);">'
|
| 169 |
. __( 'Edit', 'wpcf' ) . '</a><div id="wpcf-cd-group" class="wpcf-cd-fieldset" style="display:none;">',
|
| 170 |
);
|
| 171 |
}
|
| 197 |
$_add_id .= $group ? 'group' : 'field_' . $data['id'];
|
| 198 |
|
| 199 |
// Set link param
|
| 200 |
+
$_temp_group_id = isset( $_GET['group_id'] ) ? '&group_id=' . sanitize_text_field( $_GET['group_id'] ) : '';
|
| 201 |
$_url = admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=add_condition'
|
| 202 |
. $_temp_group_id . '&_wpnonce='
|
| 203 |
. wp_create_nonce( 'add_condition' ) );
|
| 313 |
),
|
| 314 |
);
|
| 315 |
if ( $group ) {
|
| 316 |
+
$form['cd']['wrap_close_button'] = array(
|
| 317 |
+
'#name' => 'button',
|
| 318 |
+
'#type' => 'button',
|
| 319 |
+
'#value' => __('OK', 'wpcf'),
|
| 320 |
+
'#id' => 'conditional-logic-button-ok',
|
| 321 |
+
'#attributes' => array(
|
| 322 |
+
'class' => 'button-primary',
|
| 323 |
+
'href' => '#',
|
| 324 |
+
),
|
| 325 |
+
'#before' => '<br />',
|
| 326 |
+
|
| 327 |
+
);
|
| 328 |
$form['cd']['wrap_close'] = array(
|
| 329 |
'#type' => 'markup',
|
| 330 |
+
'#markup' => '</div>',
|
|
|
|
| 331 |
);
|
| 332 |
}
|
| 333 |
return $group ? $form['cd'] : $form;
|
includes/custom-taxonomies-form.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Custom taxonomies form
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-01
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -24,9 +24,9 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 24 |
$update = false;
|
| 25 |
|
| 26 |
if ( isset( $_GET['wpcf-tax'] ) ) {
|
| 27 |
-
$id = $_GET['wpcf-tax'];
|
| 28 |
} else if ( isset( $_POST['wpcf-tax'] ) ) {
|
| 29 |
-
$id = $_POST['wpcf-tax'];
|
| 30 |
}
|
| 31 |
|
| 32 |
if ( $id ) {
|
|
@@ -93,7 +93,6 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 93 |
'#markup' => '<div id="post-body-content">',
|
| 94 |
);
|
| 95 |
|
| 96 |
-
|
| 97 |
$form['table-1-open'] = array(
|
| 98 |
'#type' => 'markup',
|
| 99 |
'#markup' => '<table id="wpcf-types-form-name-table" class="wpcf-types-form-table widefat"><thead><tr><th colspan="2">' . __( 'Name and description',
|
|
@@ -104,19 +103,19 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 104 |
$form['name'] = array(
|
| 105 |
'#type' => 'textfield',
|
| 106 |
'#name' => 'ct[labels][name]',
|
| 107 |
-
'#title' => __( 'Custom taxonomy name plural', 'wpcf' ) . ' (<strong>' . __( 'required',
|
| 108 |
-
'wpcf' ) . '</strong>)',
|
| 109 |
'#description' => '<strong>' . __( 'Enter in plural!', 'wpcf' )
|
| 110 |
-
// . '</strong><br />' . __('Alphanumeric with whitespaces only', 'wpcf')
|
| 111 |
. '.',
|
| 112 |
'#value' => isset( $ct['labels']['name'] ) ? $ct['labels']['name'] : '',
|
| 113 |
'#validate' => array(
|
| 114 |
'required' => array('value' => true),
|
| 115 |
'maxlength' => array('value' => 30),
|
| 116 |
-
// 'alphanumeric' => array('value' => true),
|
| 117 |
),
|
| 118 |
'#pattern' => $table_row,
|
| 119 |
'#inline' => true,
|
|
|
|
|
|
|
|
|
|
| 120 |
);
|
| 121 |
$form['name-singular'] = array(
|
| 122 |
'#type' => 'textfield',
|
|
@@ -125,25 +124,26 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 125 |
'wpcf' ) . '</strong>)',
|
| 126 |
'#description' => '<strong>' . __( 'Enter in singular!', 'wpcf' )
|
| 127 |
. '</strong><br />'
|
| 128 |
-
// . __('Alphanumeric with whitespaces only', 'wpcf')
|
| 129 |
. '.',
|
| 130 |
'#value' => isset( $ct['labels']['singular_name'] ) ? $ct['labels']['singular_name'] : '',
|
| 131 |
'#validate' => array(
|
| 132 |
'required' => array('value' => true),
|
| 133 |
'maxlength' => array('value' => 30),
|
| 134 |
-
// 'alphanumeric' => array('value' => true),
|
| 135 |
),
|
| 136 |
'#pattern' => $table_row,
|
| 137 |
'#inline' => true,
|
|
|
|
|
|
|
|
|
|
| 138 |
);
|
| 139 |
|
| 140 |
/*
|
| 141 |
-
*
|
| 142 |
* IF isset $_POST['slug'] it means form is not submitted
|
| 143 |
*/
|
| 144 |
$attributes = array();
|
| 145 |
if ( !empty( $_POST['ct']['slug'] ) ) {
|
| 146 |
-
$reserved = wpcf_is_reserved_name( $_POST['ct']['slug'], 'taxonomy' );
|
| 147 |
if ( is_wp_error( $reserved ) ) {
|
| 148 |
$attributes = array(
|
| 149 |
'class' => 'wpcf-form-error',
|
|
@@ -168,7 +168,10 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 168 |
'nospecialchars' => array('value' => true),
|
| 169 |
'maxlength' => array('value' => 30),
|
| 170 |
),
|
| 171 |
-
'#attributes' => $attributes + array(
|
|
|
|
|
|
|
|
|
|
| 172 |
);
|
| 173 |
$form['description'] = array(
|
| 174 |
'#type' => 'textarea',
|
|
@@ -178,6 +181,7 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 178 |
'#attributes' => array(
|
| 179 |
'rows' => 4,
|
| 180 |
'cols' => 60,
|
|
|
|
| 181 |
),
|
| 182 |
'#pattern' => $table_row,
|
| 183 |
'#inline' => true,
|
|
@@ -191,13 +195,16 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 191 |
'#markup' => '</div>',
|
| 192 |
);
|
| 193 |
|
| 194 |
-
|
| 195 |
/**
|
| 196 |
* get box order
|
| 197 |
*/
|
| 198 |
-
$meta_box_order_defaults =
|
| 199 |
-
'
|
| 200 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 201 |
);
|
| 202 |
$screen = get_current_screen();
|
| 203 |
if ( false == ( $meta_box_order = get_user_option( 'meta-box-order_'.$screen->id) )) {
|
|
@@ -208,13 +215,20 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 208 |
}
|
| 209 |
}
|
| 210 |
|
| 211 |
-
$meta_boxes = array(
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 218 |
|
| 219 |
/**
|
| 220 |
* postbox-container-1
|
|
@@ -224,7 +238,7 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 224 |
'#type' => 'markup',
|
| 225 |
'#markup' => '<div id="postbox-container-1" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="side-sortables">',
|
| 226 |
);
|
| 227 |
-
foreach(
|
| 228 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 229 |
if ( is_callable($function) ) {
|
| 230 |
$form += $function($meta_boxes[$key], 'side');
|
|
@@ -245,7 +259,7 @@ function wpcf_admin_custom_taxonomies_form() {
|
|
| 245 |
'#type' => 'markup',
|
| 246 |
'#markup' => '<div id="postbox-container-2" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="normal-sortables">',
|
| 247 |
);
|
| 248 |
-
foreach(
|
| 249 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 250 |
if ( is_callable($function) ) {
|
| 251 |
$form += $function($meta_boxes[$key]);
|
|
@@ -294,6 +308,9 @@ function wpcf_admin_tax_form_js_validation()
|
|
| 294 |
|
| 295 |
/**
|
| 296 |
* Submit function
|
|
|
|
|
|
|
|
|
|
| 297 |
*/
|
| 298 |
function wpcf_admin_custom_taxonomies_form_submit( $form )
|
| 299 |
{
|
|
@@ -387,8 +404,14 @@ function wpcf_admin_custom_taxonomies_form_submit( $form )
|
|
| 387 |
$post_types = get_option( 'wpcf-custom-types', array() );
|
| 388 |
foreach ( $post_types as $id => $type ) {
|
| 389 |
if ( array_key_exists( $id, $data['supports'] ) ) {
|
|
|
|
|
|
|
|
|
|
| 390 |
$post_types[$id]['taxonomies'][$data['slug']] = 1;
|
| 391 |
} else {
|
|
|
|
|
|
|
|
|
|
| 392 |
unset( $post_types[$id]['taxonomies'][$data['slug']] );
|
| 393 |
}
|
| 394 |
}
|
|
@@ -396,6 +419,7 @@ function wpcf_admin_custom_taxonomies_form_submit( $form )
|
|
| 396 |
}
|
| 397 |
|
| 398 |
$custom_taxonomies[$tax] = $data;
|
|
|
|
| 399 |
update_option( 'wpcf-custom-taxonomies', $custom_taxonomies );
|
| 400 |
|
| 401 |
// WPML register strings
|
|
@@ -695,6 +719,31 @@ function wpcf_admin_metabox_options($data)
|
|
| 695 |
'#value' => !empty( $data['update_count_callback'] ) ? $data['update_count_callback'] : '',
|
| 696 |
'#inline' => true,
|
| 697 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 698 |
/**
|
| 699 |
* close
|
| 700 |
*/
|
| 3 |
*
|
| 4 |
* Custom taxonomies form
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/custom-taxonomies-form.php $
|
| 7 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 8 |
+
* $LastChangedRevision: 1125405 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 24 |
$update = false;
|
| 25 |
|
| 26 |
if ( isset( $_GET['wpcf-tax'] ) ) {
|
| 27 |
+
$id = sanitize_text_field( $_GET['wpcf-tax'] );
|
| 28 |
} else if ( isset( $_POST['wpcf-tax'] ) ) {
|
| 29 |
+
$id = sanitize_text_field( $_POST['wpcf-tax'] );
|
| 30 |
}
|
| 31 |
|
| 32 |
if ( $id ) {
|
| 93 |
'#markup' => '<div id="post-body-content">',
|
| 94 |
);
|
| 95 |
|
|
|
|
| 96 |
$form['table-1-open'] = array(
|
| 97 |
'#type' => 'markup',
|
| 98 |
'#markup' => '<table id="wpcf-types-form-name-table" class="wpcf-types-form-table widefat"><thead><tr><th colspan="2">' . __( 'Name and description',
|
| 103 |
$form['name'] = array(
|
| 104 |
'#type' => 'textfield',
|
| 105 |
'#name' => 'ct[labels][name]',
|
| 106 |
+
'#title' => __( 'Custom taxonomy name plural', 'wpcf' ) . ' (<strong>' . __( 'required', 'wpcf' ) . '</strong>)',
|
|
|
|
| 107 |
'#description' => '<strong>' . __( 'Enter in plural!', 'wpcf' )
|
|
|
|
| 108 |
. '.',
|
| 109 |
'#value' => isset( $ct['labels']['name'] ) ? $ct['labels']['name'] : '',
|
| 110 |
'#validate' => array(
|
| 111 |
'required' => array('value' => true),
|
| 112 |
'maxlength' => array('value' => 30),
|
|
|
|
| 113 |
),
|
| 114 |
'#pattern' => $table_row,
|
| 115 |
'#inline' => true,
|
| 116 |
+
'#attributes' => array(
|
| 117 |
+
'placeholder' => __('Enter custom taxonomy name plural','wpcf'),
|
| 118 |
+
),
|
| 119 |
);
|
| 120 |
$form['name-singular'] = array(
|
| 121 |
'#type' => 'textfield',
|
| 124 |
'wpcf' ) . '</strong>)',
|
| 125 |
'#description' => '<strong>' . __( 'Enter in singular!', 'wpcf' )
|
| 126 |
. '</strong><br />'
|
|
|
|
| 127 |
. '.',
|
| 128 |
'#value' => isset( $ct['labels']['singular_name'] ) ? $ct['labels']['singular_name'] : '',
|
| 129 |
'#validate' => array(
|
| 130 |
'required' => array('value' => true),
|
| 131 |
'maxlength' => array('value' => 30),
|
|
|
|
| 132 |
),
|
| 133 |
'#pattern' => $table_row,
|
| 134 |
'#inline' => true,
|
| 135 |
+
'#attributes' => array(
|
| 136 |
+
'placeholder' => __('Enter custom taxonomy name singular','wpcf'),
|
| 137 |
+
),
|
| 138 |
);
|
| 139 |
|
| 140 |
/*
|
| 141 |
+
*
|
| 142 |
* IF isset $_POST['slug'] it means form is not submitted
|
| 143 |
*/
|
| 144 |
$attributes = array();
|
| 145 |
if ( !empty( $_POST['ct']['slug'] ) ) {
|
| 146 |
+
$reserved = wpcf_is_reserved_name( sanitize_text_field( $_POST['ct']['slug'] ), 'taxonomy' );
|
| 147 |
if ( is_wp_error( $reserved ) ) {
|
| 148 |
$attributes = array(
|
| 149 |
'class' => 'wpcf-form-error',
|
| 168 |
'nospecialchars' => array('value' => true),
|
| 169 |
'maxlength' => array('value' => 30),
|
| 170 |
),
|
| 171 |
+
'#attributes' => $attributes + array(
|
| 172 |
+
'maxlength' => '30',
|
| 173 |
+
'placeholder' => __('Enter custom taxonomy slug','wpcf'),
|
| 174 |
+
),
|
| 175 |
);
|
| 176 |
$form['description'] = array(
|
| 177 |
'#type' => 'textarea',
|
| 181 |
'#attributes' => array(
|
| 182 |
'rows' => 4,
|
| 183 |
'cols' => 60,
|
| 184 |
+
'placeholder' => __('Enter custom taxonomy description','wpcf'),
|
| 185 |
),
|
| 186 |
'#pattern' => $table_row,
|
| 187 |
'#inline' => true,
|
| 195 |
'#markup' => '</div>',
|
| 196 |
);
|
| 197 |
|
|
|
|
| 198 |
/**
|
| 199 |
* get box order
|
| 200 |
*/
|
| 201 |
+
$meta_box_order_defaults = apply_filters(
|
| 202 |
+
'wpcf_meta_box_order_defaults',
|
| 203 |
+
array(
|
| 204 |
+
'side' => array('submitdiv', 'wpcf_visibility', 'post_types'),
|
| 205 |
+
'normal' => array('labels', 'options'),
|
| 206 |
+
),
|
| 207 |
+
'taxonomy'
|
| 208 |
);
|
| 209 |
$screen = get_current_screen();
|
| 210 |
if ( false == ( $meta_box_order = get_user_option( 'meta-box-order_'.$screen->id) )) {
|
| 215 |
}
|
| 216 |
}
|
| 217 |
|
| 218 |
+
$meta_boxes = array();
|
| 219 |
+
foreach( $meta_box_order_defaults as $key => $value ) {
|
| 220 |
+
foreach($value as $meta_box_key) {
|
| 221 |
+
$meta_boxes[$meta_box_key] = $ct;
|
| 222 |
+
}
|
| 223 |
+
}
|
| 224 |
+
$meta_boxes[ 'submitdiv'] = false;
|
| 225 |
+
|
| 226 |
+
foreach ( $meta_box_order as $key => $value ) {
|
| 227 |
+
if ( is_array($value) ) {
|
| 228 |
+
continue;
|
| 229 |
+
}
|
| 230 |
+
$meta_box_order[$key] = explode(',', $value);
|
| 231 |
+
}
|
| 232 |
|
| 233 |
/**
|
| 234 |
* postbox-container-1
|
| 238 |
'#type' => 'markup',
|
| 239 |
'#markup' => '<div id="postbox-container-1" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="side-sortables">',
|
| 240 |
);
|
| 241 |
+
foreach( $meta_box_order['side'] as $key ) {
|
| 242 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 243 |
if ( is_callable($function) ) {
|
| 244 |
$form += $function($meta_boxes[$key], 'side');
|
| 259 |
'#type' => 'markup',
|
| 260 |
'#markup' => '<div id="postbox-container-2" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="normal-sortables">',
|
| 261 |
);
|
| 262 |
+
foreach( $meta_box_order['normal'] as $key ) {
|
| 263 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 264 |
if ( is_callable($function) ) {
|
| 265 |
$form += $function($meta_boxes[$key]);
|
| 308 |
|
| 309 |
/**
|
| 310 |
* Submit function
|
| 311 |
+
*
|
| 312 |
+
* @global object $wpdb
|
| 313 |
+
*
|
| 314 |
*/
|
| 315 |
function wpcf_admin_custom_taxonomies_form_submit( $form )
|
| 316 |
{
|
| 404 |
$post_types = get_option( 'wpcf-custom-types', array() );
|
| 405 |
foreach ( $post_types as $id => $type ) {
|
| 406 |
if ( array_key_exists( $id, $data['supports'] ) ) {
|
| 407 |
+
if ( empty($post_types[$id]['taxonomies'][$data['slug']]) ) {
|
| 408 |
+
$post_types[$id][TOOLSET_EDIT_LAST] = time();
|
| 409 |
+
}
|
| 410 |
$post_types[$id]['taxonomies'][$data['slug']] = 1;
|
| 411 |
} else {
|
| 412 |
+
if ( !empty($post_types[$id]['taxonomies'][$data['slug']]) ) {
|
| 413 |
+
$post_types[$id][TOOLSET_EDIT_LAST] = time();
|
| 414 |
+
}
|
| 415 |
unset( $post_types[$id]['taxonomies'][$data['slug']] );
|
| 416 |
}
|
| 417 |
}
|
| 419 |
}
|
| 420 |
|
| 421 |
$custom_taxonomies[$tax] = $data;
|
| 422 |
+
$custom_taxonomies[$tax][TOOLSET_EDIT_LAST] = time();
|
| 423 |
update_option( 'wpcf-custom-taxonomies', $custom_taxonomies );
|
| 424 |
|
| 425 |
// WPML register strings
|
| 719 |
'#value' => !empty( $data['update_count_callback'] ) ? $data['update_count_callback'] : '',
|
| 720 |
'#inline' => true,
|
| 721 |
);
|
| 722 |
+
|
| 723 |
+
$form['meta_box_cb-header'] = array(
|
| 724 |
+
'#type' => 'markup',
|
| 725 |
+
'#markup' => sprintf('<h3>%s</h3>', __('Meta box callback function', 'wpcf')),
|
| 726 |
+
);
|
| 727 |
+
$form['meta_box_cb-disabled'] = array(
|
| 728 |
+
'#type' => 'checkbox',
|
| 729 |
+
'#force_boolean' => true,
|
| 730 |
+
'#title' => __( 'Hide taxonomy meta box.', 'wpcf' ),
|
| 731 |
+
'#name' => 'ct[meta_box_cb][disabled]',
|
| 732 |
+
'#default_value' => !empty( $data['meta_box_cb']['disabled'] ),
|
| 733 |
+
'#inline' => true,
|
| 734 |
+
'#description' => __( 'If you disable this, there will be no metabox on entry edit screen.', 'wpcf' ),
|
| 735 |
+
);
|
| 736 |
+
$hidden = empty( $data['meta_box_cb']['disabled'] ) ? '':' class="hidden"';
|
| 737 |
+
$form['meta_box_cb'] = array(
|
| 738 |
+
'#type' => 'textfield',
|
| 739 |
+
'#name' => 'ct[meta_box_cb][callback]',
|
| 740 |
+
'#title' => __('meta_box_cb', 'wpcf'),
|
| 741 |
+
'#description' => __( 'Provide a callback function name for the meta box display.', 'wpcf' ) . '<br />' . __( 'Default: None.', 'wpcf' ),
|
| 742 |
+
'#value' => !empty( $data['meta_box_cb']['callback']) ? $data['meta_box_cb']['callback'] : '',
|
| 743 |
+
'#inline' => true,
|
| 744 |
+
'#before' => '<div id="wpcf-types-form-meta_box_cb-toggle"' . $hidden . '>',
|
| 745 |
+
'#after' => '</div>',
|
| 746 |
+
);
|
| 747 |
/**
|
| 748 |
* close
|
| 749 |
*/
|
includes/custom-types-form.php
CHANGED
|
@@ -3,9 +3,9 @@
|
|
| 3 |
*
|
| 4 |
* Custom types form
|
| 5 |
*
|
| 6 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 7 |
-
* $LastChangedDate: 2015-01
|
| 8 |
-
* $LastChangedRevision:
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
|
@@ -18,15 +18,16 @@ function wpcf_admin_custom_types_form()
|
|
| 18 |
global $wpcf;
|
| 19 |
|
| 20 |
include_once dirname(__FILE__).'/common-functions.php';
|
|
|
|
| 21 |
|
| 22 |
$ct = array();
|
| 23 |
$id = false;
|
| 24 |
$update = false;
|
| 25 |
|
| 26 |
if ( isset( $_GET['wpcf-post-type'] ) ) {
|
| 27 |
-
$id = $_GET['wpcf-post-type'];
|
| 28 |
} elseif ( isset( $_POST['wpcf-post-type'] ) ) {
|
| 29 |
-
$id = $_POST['wpcf-post-type'];
|
| 30 |
}
|
| 31 |
|
| 32 |
if ( $id ) {
|
|
@@ -39,8 +40,7 @@ function wpcf_admin_custom_types_form()
|
|
| 39 |
flush_rewrite_rules();
|
| 40 |
}
|
| 41 |
} else {
|
| 42 |
-
wpcf_admin_message( __( 'Wrong custom post type specified', 'wpcf' ),
|
| 43 |
-
'error' );
|
| 44 |
return false;
|
| 45 |
}
|
| 46 |
} else {
|
|
@@ -125,12 +125,10 @@ function wpcf_admin_custom_types_form()
|
|
| 125 |
'#title' => __( 'Custom post type name plural', 'wpcf' ) . ' (<strong>' . __( 'required',
|
| 126 |
'wpcf' ) . '</strong>)',
|
| 127 |
'#description' => '<strong>' . __( 'Enter in plural!', 'wpcf' )
|
| 128 |
-
// . '</strong><br />' . __('Alphanumeric with whitespaces only', 'wpcf')
|
| 129 |
. '.',
|
| 130 |
'#value' => isset( $ct['labels']['name'] ) ? $ct['labels']['name'] : '',
|
| 131 |
'#validate' => array(
|
| 132 |
'required' => array('value' => 'true'),
|
| 133 |
-
// 'alphanumeric' => array('value' => 'true'),
|
| 134 |
),
|
| 135 |
'#pattern' => $table_row,
|
| 136 |
'#inline' => true,
|
|
@@ -138,6 +136,7 @@ function wpcf_admin_custom_types_form()
|
|
| 138 |
'#attributes' => array(
|
| 139 |
'data-wpcf_warning_same_as_slug' => $wpcf->post_types->message( 'warning_singular_plural_match' ),
|
| 140 |
'data-wpcf_warning_same_as_slug_ignore' => $wpcf->post_types->message( 'warning_singular_plural_match_ignore' ),
|
|
|
|
| 141 |
),
|
| 142 |
);
|
| 143 |
$form['name-singular'] = array(
|
|
@@ -147,25 +146,25 @@ function wpcf_admin_custom_types_form()
|
|
| 147 |
'wpcf' ) . '</strong>)',
|
| 148 |
'#description' => '<strong>' . __( 'Enter in singular!', 'wpcf' )
|
| 149 |
. '</strong><br />'
|
| 150 |
-
// . __('Alphanumeric with whitespaces only', 'wpcf')
|
| 151 |
. '.',
|
| 152 |
'#value' => isset( $ct['labels']['singular_name'] ) ? $ct['labels']['singular_name'] : '',
|
| 153 |
'#validate' => array(
|
| 154 |
'required' => array('value' => 'true'),
|
| 155 |
-
// 'alphanumeric' => array('value' => 'true'),
|
| 156 |
),
|
| 157 |
'#pattern' => $table_row,
|
| 158 |
'#inline' => true,
|
| 159 |
'#id' => 'name-singular',
|
|
|
|
|
|
|
|
|
|
| 160 |
);
|
| 161 |
|
| 162 |
-
|
| 163 |
-
*
|
| 164 |
* IF isset $_POST['slug'] it means form is not submitted
|
| 165 |
*/
|
| 166 |
$attributes = array();
|
| 167 |
if ( !empty( $_POST['ct']['slug'] ) ) {
|
| 168 |
-
$reserved = wpcf_is_reserved_name( $_POST['ct']['slug'], 'post_type' );
|
| 169 |
if ( is_wp_error( $reserved ) ) {
|
| 170 |
$attributes = array(
|
| 171 |
'class' => 'wpcf-form-error',
|
|
@@ -186,7 +185,10 @@ function wpcf_admin_custom_types_form()
|
|
| 186 |
'nospecialchars' => array('value' => 'true'),
|
| 187 |
'maxlength' => array('value' => '20'),
|
| 188 |
),
|
| 189 |
-
'#attributes' => $attributes + array(
|
|
|
|
|
|
|
|
|
|
| 190 |
'#id' => 'slug',
|
| 191 |
);
|
| 192 |
$form['description'] = array(
|
|
@@ -197,6 +199,7 @@ function wpcf_admin_custom_types_form()
|
|
| 197 |
'#attributes' => array(
|
| 198 |
'rows' => 4,
|
| 199 |
'cols' => 60,
|
|
|
|
| 200 |
),
|
| 201 |
'#pattern' => $table_row,
|
| 202 |
'#inline' => true,
|
|
@@ -422,11 +425,13 @@ function wpcf_admin_custom_types_form()
|
|
| 422 |
);
|
| 423 |
|
| 424 |
global $sitepress;
|
| 425 |
-
if (
|
| 426 |
-
|
| 427 |
-
|
|
|
|
|
|
|
| 428 |
$form['table-1-close']['#markup'] .= wpml_custom_post_translation_options( $ct['slug'] );
|
| 429 |
-
|
| 430 |
|
| 431 |
$form['post-body-content-close'] = array(
|
| 432 |
'#type' => 'markup',
|
|
@@ -436,9 +441,13 @@ function wpcf_admin_custom_types_form()
|
|
| 436 |
/**
|
| 437 |
* get box order
|
| 438 |
*/
|
| 439 |
-
$meta_box_order_defaults =
|
| 440 |
-
'
|
| 441 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 442 |
);
|
| 443 |
$screen = get_current_screen();
|
| 444 |
if ( false == ( $meta_box_order = get_user_option( 'meta-box-order_'.$screen->id) )) {
|
|
@@ -449,14 +458,20 @@ function wpcf_admin_custom_types_form()
|
|
| 449 |
}
|
| 450 |
}
|
| 451 |
|
| 452 |
-
$meta_boxes = array(
|
| 453 |
-
|
| 454 |
-
|
| 455 |
-
|
| 456 |
-
|
| 457 |
-
|
| 458 |
-
|
| 459 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 460 |
|
| 461 |
/**
|
| 462 |
* postbox-container-1
|
|
@@ -466,7 +481,7 @@ function wpcf_admin_custom_types_form()
|
|
| 466 |
'#type' => 'markup',
|
| 467 |
'#markup' => '<div id="postbox-container-1" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="side-sortables">',
|
| 468 |
);
|
| 469 |
-
foreach(
|
| 470 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 471 |
if ( is_callable($function) ) {
|
| 472 |
$form += $function($meta_boxes[$key]);
|
|
@@ -487,7 +502,7 @@ function wpcf_admin_custom_types_form()
|
|
| 487 |
'#type' => 'markup',
|
| 488 |
'#markup' => '<div id="postbox-container-2" class="postbox-container"><div class="meta-box-sortables ui-sortable">',
|
| 489 |
);
|
| 490 |
-
foreach(
|
| 491 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 492 |
if ( is_callable($function) ) {
|
| 493 |
$form += $function($meta_boxes[$key]);
|
|
@@ -536,6 +551,9 @@ function wpcf_admin_types_form_js_validation()
|
|
| 536 |
|
| 537 |
/**
|
| 538 |
* Submit function
|
|
|
|
|
|
|
|
|
|
| 539 |
*/
|
| 540 |
function wpcf_admin_custom_types_form_submit($form)
|
| 541 |
{
|
|
@@ -617,9 +635,11 @@ function wpcf_admin_custom_types_form_submit($form)
|
|
| 617 |
/**
|
| 618 |
* update post meta "_wp_types_group_post_types"
|
| 619 |
*/
|
| 620 |
-
$sql =
|
| 621 |
-
|
| 622 |
-
|
|
|
|
|
|
|
| 623 |
'_wp_types_group_post_types'
|
| 624 |
);
|
| 625 |
$all_meta = $wpdb->get_results($sql, OBJECT_K);
|
|
@@ -728,6 +748,11 @@ function wpcf_admin_custom_types_form_submit($form)
|
|
| 728 |
}
|
| 729 |
}
|
| 730 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 731 |
// Merging protected data
|
| 732 |
$custom_types[$post_type] = array_merge( $protected_data_check, $data );
|
| 733 |
|
|
@@ -778,7 +803,7 @@ function wpcf_admin_metabox_submitdiv($cf)
|
|
| 778 |
/**
|
| 779 |
* Visibility
|
| 780 |
*/
|
| 781 |
-
function wpcf_admin_metabox_wpcf_visibility($
|
| 782 |
{
|
| 783 |
$form = array();
|
| 784 |
$form['table-2-open'] = wpcf_admin_metabox_begin(__( 'Visibility', 'wpcf' ), 'wpcf_visibility', 'wpcf-types-form-visibility-table', false);
|
|
@@ -813,6 +838,16 @@ function wpcf_admin_metabox_wpcf_visibility($cf)
|
|
| 813 |
'#pattern' => '<BEFORE><p><LABEL><ELEMENT><ERROR></p><AFTER>',
|
| 814 |
'#after' => '</div>',
|
| 815 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 816 |
$form['table-2-close'] = wpcf_admin_metabox_end();
|
| 817 |
return $form;
|
| 818 |
}
|
|
@@ -860,7 +895,7 @@ function wpcf_admin_metabox_taxonomies($ct)
|
|
| 860 |
/**
|
| 861 |
* Labels
|
| 862 |
*/
|
| 863 |
-
function wpcf_admin_metabox_labels($
|
| 864 |
{
|
| 865 |
$form = array();
|
| 866 |
$form['table-4-open'] = wpcf_admin_metabox_begin(__( 'Labels', 'wpcf' ), 'labels', 'wpcf-types-form-table');
|
|
@@ -911,12 +946,6 @@ function wpcf_admin_metabox_display_sections($ct)
|
|
| 911 |
{
|
| 912 |
$form = array();
|
| 913 |
$form['table-5-open'] = wpcf_admin_metabox_begin(__( 'Display Sections', 'wpcf' ), 'display_sections', 'wpcf-types-form-supports-table');
|
| 914 |
-
$form['title-editor-warning'] = array(
|
| 915 |
-
'#type' => 'markup',
|
| 916 |
-
'#markup' => '<div id="wpcf-types-title-editor-warning" class="wpcf-form-error" style="display:none;">'
|
| 917 |
-
. __( 'WordPress does not allow disabling both the title and the editor. Please enable at least one of these.',
|
| 918 |
-
'wpcf' ) . '</div>',
|
| 919 |
-
);
|
| 920 |
$options = array(
|
| 921 |
'title' => array(
|
| 922 |
'#name' => 'ct[supports][title]',
|
|
@@ -926,9 +955,6 @@ function wpcf_admin_metabox_display_sections($ct)
|
|
| 926 |
'wpcf' ),
|
| 927 |
'#inline' => true,
|
| 928 |
'#id' => 'wpcf-supports-title',
|
| 929 |
-
'#attributes' => array(
|
| 930 |
-
'onclick' => 'wpcfTitleEditorCheck();',
|
| 931 |
-
),
|
| 932 |
),
|
| 933 |
'editor' => array(
|
| 934 |
'#name' => 'ct[supports][editor]',
|
|
@@ -937,9 +963,6 @@ function wpcf_admin_metabox_display_sections($ct)
|
|
| 937 |
'#description' => __( 'Content input box for writing.', 'wpcf' ),
|
| 938 |
'#inline' => true,
|
| 939 |
'#id' => 'wpcf-supports-editor',
|
| 940 |
-
'#attributes' => array(
|
| 941 |
-
'onclick' => 'wpcfTitleEditorCheck();',
|
| 942 |
-
),
|
| 943 |
),
|
| 944 |
'comments' => array(
|
| 945 |
'#name' => 'ct[supports][comments]',
|
| 3 |
*
|
| 4 |
* Custom types form
|
| 5 |
*
|
| 6 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/custom-types-form.php $
|
| 7 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 8 |
+
* $LastChangedRevision: 1125405 $
|
| 9 |
* $LastChangedBy: iworks $
|
| 10 |
*
|
| 11 |
*/
|
| 18 |
global $wpcf;
|
| 19 |
|
| 20 |
include_once dirname(__FILE__).'/common-functions.php';
|
| 21 |
+
include_once dirname(__FILE__).'/fields.php';
|
| 22 |
|
| 23 |
$ct = array();
|
| 24 |
$id = false;
|
| 25 |
$update = false;
|
| 26 |
|
| 27 |
if ( isset( $_GET['wpcf-post-type'] ) ) {
|
| 28 |
+
$id = sanitize_text_field( $_GET['wpcf-post-type'] );
|
| 29 |
} elseif ( isset( $_POST['wpcf-post-type'] ) ) {
|
| 30 |
+
$id = sanitize_text_field( $_POST['wpcf-post-type'] );
|
| 31 |
}
|
| 32 |
|
| 33 |
if ( $id ) {
|
| 40 |
flush_rewrite_rules();
|
| 41 |
}
|
| 42 |
} else {
|
| 43 |
+
wpcf_admin_message( __( 'Wrong custom post type specified', 'wpcf' ), 'error' );
|
|
|
|
| 44 |
return false;
|
| 45 |
}
|
| 46 |
} else {
|
| 125 |
'#title' => __( 'Custom post type name plural', 'wpcf' ) . ' (<strong>' . __( 'required',
|
| 126 |
'wpcf' ) . '</strong>)',
|
| 127 |
'#description' => '<strong>' . __( 'Enter in plural!', 'wpcf' )
|
|
|
|
| 128 |
. '.',
|
| 129 |
'#value' => isset( $ct['labels']['name'] ) ? $ct['labels']['name'] : '',
|
| 130 |
'#validate' => array(
|
| 131 |
'required' => array('value' => 'true'),
|
|
|
|
| 132 |
),
|
| 133 |
'#pattern' => $table_row,
|
| 134 |
'#inline' => true,
|
| 136 |
'#attributes' => array(
|
| 137 |
'data-wpcf_warning_same_as_slug' => $wpcf->post_types->message( 'warning_singular_plural_match' ),
|
| 138 |
'data-wpcf_warning_same_as_slug_ignore' => $wpcf->post_types->message( 'warning_singular_plural_match_ignore' ),
|
| 139 |
+
'placeholder' => __('Enter post type name plural', 'wpcf' ),
|
| 140 |
),
|
| 141 |
);
|
| 142 |
$form['name-singular'] = array(
|
| 146 |
'wpcf' ) . '</strong>)',
|
| 147 |
'#description' => '<strong>' . __( 'Enter in singular!', 'wpcf' )
|
| 148 |
. '</strong><br />'
|
|
|
|
| 149 |
. '.',
|
| 150 |
'#value' => isset( $ct['labels']['singular_name'] ) ? $ct['labels']['singular_name'] : '',
|
| 151 |
'#validate' => array(
|
| 152 |
'required' => array('value' => 'true'),
|
|
|
|
| 153 |
),
|
| 154 |
'#pattern' => $table_row,
|
| 155 |
'#inline' => true,
|
| 156 |
'#id' => 'name-singular',
|
| 157 |
+
'#attributes' => array(
|
| 158 |
+
'placeholder' => __('Enter post type name singular', 'wpcf' ),
|
| 159 |
+
),
|
| 160 |
);
|
| 161 |
|
| 162 |
+
/**
|
|
|
|
| 163 |
* IF isset $_POST['slug'] it means form is not submitted
|
| 164 |
*/
|
| 165 |
$attributes = array();
|
| 166 |
if ( !empty( $_POST['ct']['slug'] ) ) {
|
| 167 |
+
$reserved = wpcf_is_reserved_name( sanitize_text_field( $_POST['ct']['slug'] ), 'post_type' );
|
| 168 |
if ( is_wp_error( $reserved ) ) {
|
| 169 |
$attributes = array(
|
| 170 |
'class' => 'wpcf-form-error',
|
| 185 |
'nospecialchars' => array('value' => 'true'),
|
| 186 |
'maxlength' => array('value' => '20'),
|
| 187 |
),
|
| 188 |
+
'#attributes' => $attributes + array(
|
| 189 |
+
'maxlength' => '20',
|
| 190 |
+
'placeholder' => __('Enter post type slug', 'wpcf' ),
|
| 191 |
+
),
|
| 192 |
'#id' => 'slug',
|
| 193 |
);
|
| 194 |
$form['description'] = array(
|
| 199 |
'#attributes' => array(
|
| 200 |
'rows' => 4,
|
| 201 |
'cols' => 60,
|
| 202 |
+
'placeholder' => __('Enter post type description', 'wpcf' ),
|
| 203 |
),
|
| 204 |
'#pattern' => $table_row,
|
| 205 |
'#inline' => true,
|
| 425 |
);
|
| 426 |
|
| 427 |
global $sitepress;
|
| 428 |
+
if (
|
| 429 |
+
$update && isset( $sitepress )
|
| 430 |
+
&& version_compare( ICL_SITEPRESS_VERSION, '2.6.2', '>=' )
|
| 431 |
+
&& function_exists( 'wpml_custom_post_translation_options' )
|
| 432 |
+
) {
|
| 433 |
$form['table-1-close']['#markup'] .= wpml_custom_post_translation_options( $ct['slug'] );
|
| 434 |
+
}
|
| 435 |
|
| 436 |
$form['post-body-content-close'] = array(
|
| 437 |
'#type' => 'markup',
|
| 441 |
/**
|
| 442 |
* get box order
|
| 443 |
*/
|
| 444 |
+
$meta_box_order_defaults = apply_filters(
|
| 445 |
+
'wpcf_meta_box_order_defaults',
|
| 446 |
+
array(
|
| 447 |
+
'side' => array('submitdiv', 'wpcf_visibility', 'taxonomies'),
|
| 448 |
+
'normal' => array('labels', 'display_sections', 'options'),
|
| 449 |
+
),
|
| 450 |
+
'post_type'
|
| 451 |
);
|
| 452 |
$screen = get_current_screen();
|
| 453 |
if ( false == ( $meta_box_order = get_user_option( 'meta-box-order_'.$screen->id) )) {
|
| 458 |
}
|
| 459 |
}
|
| 460 |
|
| 461 |
+
$meta_boxes = array();
|
| 462 |
+
foreach( $meta_box_order_defaults as $key => $value ) {
|
| 463 |
+
foreach($value as $meta_box_key) {
|
| 464 |
+
$meta_boxes[$meta_box_key] = $ct;
|
| 465 |
+
}
|
| 466 |
+
}
|
| 467 |
+
$meta_boxes[ 'submitdiv'] = false;
|
| 468 |
+
|
| 469 |
+
foreach ( $meta_box_order as $key => $value ) {
|
| 470 |
+
if ( is_array($value) ) {
|
| 471 |
+
continue;
|
| 472 |
+
}
|
| 473 |
+
$meta_box_order[$key] = explode(',', $value);
|
| 474 |
+
}
|
| 475 |
|
| 476 |
/**
|
| 477 |
* postbox-container-1
|
| 481 |
'#type' => 'markup',
|
| 482 |
'#markup' => '<div id="postbox-container-1" class="postbox-container"><div class="meta-box-sortables ui-sortable" id="side-sortables">',
|
| 483 |
);
|
| 484 |
+
foreach( $meta_box_order['side'] as $key ) {
|
| 485 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 486 |
if ( is_callable($function) ) {
|
| 487 |
$form += $function($meta_boxes[$key]);
|
| 502 |
'#type' => 'markup',
|
| 503 |
'#markup' => '<div id="postbox-container-2" class="postbox-container"><div class="meta-box-sortables ui-sortable">',
|
| 504 |
);
|
| 505 |
+
foreach( $meta_box_order['normal'] as $key ) {
|
| 506 |
$function = sprintf('wpcf_admin_metabox_%s', $key);
|
| 507 |
if ( is_callable($function) ) {
|
| 508 |
$form += $function($meta_boxes[$key]);
|
| 551 |
|
| 552 |
/**
|
| 553 |
* Submit function
|
| 554 |
+
*
|
| 555 |
+
* @global object $wpdb
|
| 556 |
+
*
|
| 557 |
*/
|
| 558 |
function wpcf_admin_custom_types_form_submit($form)
|
| 559 |
{
|
| 635 |
/**
|
| 636 |
* update post meta "_wp_types_group_post_types"
|
| 637 |
*/
|
| 638 |
+
$sql = $wpdb->prepare(
|
| 639 |
+
sprintf(
|
| 640 |
+
'select meta_id, meta_value from %s where meta_key = %%s',
|
| 641 |
+
$wpdb->postmeta
|
| 642 |
+
),
|
| 643 |
'_wp_types_group_post_types'
|
| 644 |
);
|
| 645 |
$all_meta = $wpdb->get_results($sql, OBJECT_K);
|
| 748 |
}
|
| 749 |
}
|
| 750 |
|
| 751 |
+
/**
|
| 752 |
+
* set last edit time
|
| 753 |
+
*/
|
| 754 |
+
$data[TOOLSET_EDIT_LAST] = time();
|
| 755 |
+
|
| 756 |
// Merging protected data
|
| 757 |
$custom_types[$post_type] = array_merge( $protected_data_check, $data );
|
| 758 |
|
| 803 |
/**
|
| 804 |
* Visibility
|
| 805 |
*/
|
| 806 |
+
function wpcf_admin_metabox_wpcf_visibility($ct)
|
| 807 |
{
|
| 808 |
$form = array();
|
| 809 |
$form['table-2-open'] = wpcf_admin_metabox_begin(__( 'Visibility', 'wpcf' ), 'wpcf_visibility', 'wpcf-types-form-visibility-table', false);
|
| 838 |
'#pattern' => '<BEFORE><p><LABEL><ELEMENT><ERROR></p><AFTER>',
|
| 839 |
'#after' => '</div>',
|
| 840 |
);
|
| 841 |
+
/**
|
| 842 |
+
* dashboard glance option to show counters on admin dashbord widget
|
| 843 |
+
*/
|
| 844 |
+
$form['dashboard_glance'] = array(
|
| 845 |
+
'#type' => 'checkbox',
|
| 846 |
+
'#before' => sprintf('<h4>%s</h4>', __( 'Show in Right Now', 'wpcf' )),
|
| 847 |
+
'#name' => 'ct[dashboard_glance]',
|
| 848 |
+
'#title' => __( 'Show number of entries on "At a Glance" admin widget.', 'wpcf' ),
|
| 849 |
+
'#default_value' => !empty( $ct['dashboard_glance'] ),
|
| 850 |
+
);
|
| 851 |
$form['table-2-close'] = wpcf_admin_metabox_end();
|
| 852 |
return $form;
|
| 853 |
}
|
| 895 |
/**
|
| 896 |
* Labels
|
| 897 |
*/
|
| 898 |
+
function wpcf_admin_metabox_labels($ct)
|
| 899 |
{
|
| 900 |
$form = array();
|
| 901 |
$form['table-4-open'] = wpcf_admin_metabox_begin(__( 'Labels', 'wpcf' ), 'labels', 'wpcf-types-form-table');
|
| 946 |
{
|
| 947 |
$form = array();
|
| 948 |
$form['table-5-open'] = wpcf_admin_metabox_begin(__( 'Display Sections', 'wpcf' ), 'display_sections', 'wpcf-types-form-supports-table');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 949 |
$options = array(
|
| 950 |
'title' => array(
|
| 951 |
'#name' => 'ct[supports][title]',
|
| 955 |
'wpcf' ),
|
| 956 |
'#inline' => true,
|
| 957 |
'#id' => 'wpcf-supports-title',
|
|
|
|
|
|
|
|
|
|
| 958 |
),
|
| 959 |
'editor' => array(
|
| 960 |
'#name' => 'ct[supports][editor]',
|
| 963 |
'#description' => __( 'Content input box for writing.', 'wpcf' ),
|
| 964 |
'#inline' => true,
|
| 965 |
'#id' => 'wpcf-supports-editor',
|
|
|
|
|
|
|
|
|
|
| 966 |
),
|
| 967 |
'comments' => array(
|
| 968 |
'#name' => 'ct[supports][comments]',
|
includes/custom-types-taxonomies-list.php
CHANGED
|
@@ -3,10 +3,8 @@
|
|
| 3 |
* Custom Types and Taxonomies list functions
|
| 4 |
*/
|
| 5 |
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
*/
|
| 9 |
-
function wpcf_admin_ctt_list() {
|
| 10 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 11 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 12 |
|
|
@@ -18,111 +16,44 @@ function wpcf_admin_ctt_list() {
|
|
| 18 |
'wpcf')
|
| 19 |
. '</p>';
|
| 20 |
}
|
|
|
|
| 21 |
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
.
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
$type['description'], 'Types-CPT')),
|
| 60 |
-
ENT_QUOTES) : '';
|
| 61 |
-
$rows[$post_type]['active-' . $post_type] = !empty($type['disabled']) ? __('No',
|
| 62 |
-
'wpcf') : __('Yes', 'wpcf');
|
| 63 |
-
$rows[$post_type]['tax'] = array();
|
| 64 |
-
if (!empty($type['taxonomies'])) {
|
| 65 |
-
foreach ($type['taxonomies'] as $temp_tax => $true) {
|
| 66 |
-
$rows[$post_type]['tax'][] = stripslashes(wpcf_translate($temp_tax . ' name',
|
| 67 |
-
$temp_tax, 'Types-TAX'));
|
| 68 |
-
}
|
| 69 |
-
}
|
| 70 |
-
$rows[$post_type]['tax'] = !empty($rows[$post_type]['tax']) ? implode(', ',
|
| 71 |
-
$rows[$post_type]['tax']) : __('None', 'wpcf');
|
| 72 |
-
}
|
| 73 |
|
| 74 |
-
// Render table
|
| 75 |
-
wpcf_admin_widefat_table('wpcf_types_list', $header, $rows);
|
| 76 |
-
}
|
| 77 |
|
| 78 |
-
if (!empty($custom_taxonomies)) {
|
| 79 |
-
$rows = array();
|
| 80 |
-
$header = array(
|
| 81 |
-
'name' => __('Taxonomy Name', 'wpcf'),
|
| 82 |
-
'description' => __('Description', 'wpcf'),
|
| 83 |
-
'active' => __('Active', 'wpcf'),
|
| 84 |
-
'post_types' => __('Post Types', 'wpcf'),
|
| 85 |
-
);
|
| 86 |
-
foreach ($custom_taxonomies as $taxonomy => $data) {
|
| 87 |
-
$name = '';
|
| 88 |
-
$name .= '<a href="'
|
| 89 |
-
. admin_url('admin.php?page=wpcf-edit-tax&wpcf-tax='
|
| 90 |
-
. $taxonomy) . '">' . stripslashes(wpcf_translate($taxonomy . ' name',
|
| 91 |
-
$data['labels']['name'], 'Types-TAX')) . '</a>';
|
| 92 |
-
$name .= '<br />';
|
| 93 |
-
$name .= '<a href="'
|
| 94 |
-
. admin_url('admin.php?page=wpcf-edit-tax&wpcf-tax='
|
| 95 |
-
. $taxonomy) . '">' . __('Edit', 'wpcf') . '</a> | ';
|
| 96 |
-
$name .= empty($data['disabled']) ? wpcf_admin_custom_taxonomies_get_ajax_deactivation_link($taxonomy) . ' | ' : wpcf_admin_custom_taxonomies_get_ajax_activation_link($taxonomy) . ' | ';
|
| 97 |
-
$name .= '<a href="'
|
| 98 |
-
. admin_url('admin-ajax.php?action=wpcf_ajax&'
|
| 99 |
-
. 'wpcf_action=delete_taxonomy&wpcf-tax='
|
| 100 |
-
. $taxonomy . '&wpcf_ajax_callback=wpcfRefresh&wpcf_ajax_update=wpcf_list_ajax_response_'
|
| 101 |
-
. $taxonomy) . '&_wpnonce=' . wp_create_nonce('delete_taxonomy')
|
| 102 |
-
. '&wpcf_warning='
|
| 103 |
-
. __('Are you sure?', 'wpcf') . '" class="wpcf-ajax-link" id="wpcf-list-delete-'
|
| 104 |
-
. $taxonomy . '">'
|
| 105 |
-
. __('Delete Permanently', 'wpcf') . '</a>';
|
| 106 |
-
$name .= '<div id="wpcf_list_ajax_response_' . $taxonomy . '"></div>';
|
| 107 |
-
$rows[$taxonomy]['name'] = $name;
|
| 108 |
-
$rows[$taxonomy]['description'] = isset($data['description']) ? htmlspecialchars(stripslashes(wpcf_translate($taxonomy . ' description',
|
| 109 |
-
$data['description'], 'Types-TAX')),
|
| 110 |
-
ENT_QUOTES) : '';
|
| 111 |
-
$rows[$taxonomy]['active-' . $taxonomy] = !empty($data['disabled']) ? __('No',
|
| 112 |
-
'wpcf') : __('Yes', 'wpcf');
|
| 113 |
-
$rows[$taxonomy]['post_types'] = array();
|
| 114 |
-
if (!empty($data['supports'])) {
|
| 115 |
-
foreach ($data['supports'] as $temp_post_type => $true) {
|
| 116 |
-
$rows[$taxonomy]['post_types'][] = stripslashes(wpcf_translate($temp_post_type . ' name',
|
| 117 |
-
$temp_post_type, 'Types-CPT'));
|
| 118 |
-
}
|
| 119 |
-
}
|
| 120 |
-
$rows[$taxonomy]['post_types'] = !empty($rows[$taxonomy]['post_types']) ? implode(', ',
|
| 121 |
-
$rows[$taxonomy]['post_types']) : __('None', 'wpcf');
|
| 122 |
-
}
|
| 123 |
-
// Render table
|
| 124 |
-
echo '<br />';
|
| 125 |
-
wpcf_admin_widefat_table('wpcf_tax_list', $header, $rows);
|
| 126 |
-
}
|
| 127 |
-
do_action('wpcf_types_tax_list_table_after');
|
| 128 |
-
}
|
| 3 |
* Custom Types and Taxonomies list functions
|
| 4 |
*/
|
| 5 |
|
| 6 |
+
function wpcf_admin_ctt_list_header()
|
| 7 |
+
{
|
|
|
|
|
|
|
| 8 |
$custom_types = get_option('wpcf-custom-types', array());
|
| 9 |
$custom_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 10 |
|
| 16 |
'wpcf')
|
| 17 |
. '</p>';
|
| 18 |
}
|
| 19 |
+
}
|
| 20 |
|
| 21 |
+
function wpcf_admin_custom_post_types_list()
|
| 22 |
+
{
|
| 23 |
+
include_once dirname(__FILE__).'/classes/class.wpcf.custom.post.types.list.table.php';
|
| 24 |
+
//Create an instance of our package class...
|
| 25 |
+
$listTable = new WPCF_Custom_Post_Types_List_Table();
|
| 26 |
+
//Fetch, prepare, sort, and filter our data...
|
| 27 |
+
$listTable->prepare_items();
|
| 28 |
+
?>
|
| 29 |
+
<!-- Forms are NOT created automatically, so you need to wrap the table in one to use features like bulk actions -->
|
| 30 |
+
<form id="cpt-filter" method="post">
|
| 31 |
+
<!-- For plugins, we also need to ensure that the form posts back to our current page -->
|
| 32 |
+
<input type="hidden" name="page" value="<?php echo esc_attr($_REQUEST['page']); ?>" />
|
| 33 |
+
<?php $listTable->search_box(__('Search custom posts', 'wcpf'), 'search_id'); ?>
|
| 34 |
+
<!-- Now we can render the completed list table -->
|
| 35 |
+
<?php $listTable->display() ?>
|
| 36 |
+
</form>
|
| 37 |
+
<?php
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
function wpcf_admin_custom_taxonomies_list()
|
| 41 |
+
{
|
| 42 |
+
include_once dirname(__FILE__).'/classes/class.wpcf.custom.taxonomies.list.table.php';
|
| 43 |
+
//Create an instance of our package class...
|
| 44 |
+
$listTable = new WPCF_Custom_Taxonomies_List_Table();
|
| 45 |
+
//Fetch, prepare, sort, and filter our data...
|
| 46 |
+
$listTable->prepare_items();
|
| 47 |
+
?>
|
| 48 |
+
<!-- Forms are NOT created automatically, so you need to wrap the table in one to use features like bulk actions -->
|
| 49 |
+
<form id="ct-filter" method="post">
|
| 50 |
+
<!-- For plugins, we also need to ensure that the form posts back to our current page -->
|
| 51 |
+
<input type="hidden" name="page" value="<?php echo esc_attr($_REQUEST['page']); ?>" />
|
| 52 |
+
<?php $listTable->search_box(__('Search custom taxonomies', 'wcpf'), 'search_id'); ?>
|
| 53 |
+
<!-- Now we can render the completed list table -->
|
| 54 |
+
<?php $listTable->display() ?>
|
| 55 |
+
</form>
|
| 56 |
+
<?php
|
| 57 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 58 |
|
|
|
|
|
|
|
|
|
|
| 59 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
includes/fields-control.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Custom Fields Control Screen
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -25,7 +25,11 @@ function wpcf_admin_custom_fields_control_form($table) {
|
|
| 25 |
*/
|
| 26 |
class WPCF_Custom_Fields_Control_Table extends WP_List_Table
|
| 27 |
{
|
| 28 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 29 |
function prepare_items() {
|
| 30 |
global $wpdb;
|
| 31 |
$wpcf_per_page = 15;
|
|
@@ -119,10 +123,14 @@ class WPCF_Custom_Fields_Control_Table extends WP_List_Table
|
|
| 119 |
$sorted_keys = array();
|
| 120 |
$new_array = array();
|
| 121 |
foreach ($cf_types as $cf_id_temp => $cf_temp) {
|
| 122 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 123 |
}
|
| 124 |
asort($sorted_keys, SORT_STRING);
|
| 125 |
-
if ($_REQUEST['order']
|
| 126 |
$sorted_keys = array_reverse($sorted_keys, true);
|
| 127 |
}
|
| 128 |
foreach ($sorted_keys as $cf_id_temp => $groups_txt) {
|
|
@@ -237,22 +245,33 @@ class WPCF_Custom_Fields_Control_Table extends WP_List_Table
|
|
| 237 |
$actions['wpcf-remove-from-group-bulk'] = __('Remove from group', 'wpcf');
|
| 238 |
$actions['wpcf-change-type-bulk'] = __('Change type', 'wpcf');
|
| 239 |
$actions['wpcf-activate-bulk'] = __("Add to Types control", 'wpcf');
|
| 240 |
-
$actions['wpcf-deactivate-bulk'] = __("Stop controlling with Types",
|
| 241 |
-
'wpcf');
|
| 242 |
$actions['wpcf-delete-bulk'] = __("Delete", 'wpcf');
|
| 243 |
return $actions;
|
| 244 |
}
|
| 245 |
|
| 246 |
-
function view_switcher($current_mode = '')
|
| 247 |
-
|
|
|
|
|
|
|
| 248 |
if (empty($_GET['display_all'])) {
|
| 249 |
-
|
| 250 |
-
|
| 251 |
-
} else {
|
| 252 |
-
echo esc_url($_SERVER['REQUEST_URI']) . '&display_all=0">' . __('Show pagination',
|
| 253 |
-
'wpcf');
|
| 254 |
}
|
| 255 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 256 |
}
|
| 257 |
|
| 258 |
}
|
|
@@ -316,10 +335,18 @@ function wpcf_admin_custom_fields_control_js()
|
|
| 316 |
/**
|
| 317 |
* Submitted Bulk actions.
|
| 318 |
*/
|
| 319 |
-
function wpcf_admin_custom_fields_control_bulk_actions($action = '')
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 320 |
if ($action == 'wpcf-deactivate-bulk') {
|
| 321 |
$fields = wpcf_admin_fields_get_fields(false, true);
|
| 322 |
foreach ($_POST['fields'] as $field_id) {
|
|
|
|
| 323 |
if (isset($fields[$field_id])) {
|
| 324 |
$fields[$field_id]['data']['disabled'] = 1;
|
| 325 |
wpcf_admin_message_store(sprintf(__('Removed from Types control: %s',
|
|
@@ -332,7 +359,6 @@ function wpcf_admin_custom_fields_control_bulk_actions($action = '') {
|
|
| 332 |
$fields_bulk = wpcf_types_cf_under_control('add',
|
| 333 |
array('fields' => $_POST['fields']));
|
| 334 |
foreach ($fields_bulk as $field_id) {
|
| 335 |
-
// if (isset($fields[$field_id]) && empty($fields[$field_id]['data']['disabled_by_type'])) {
|
| 336 |
if (isset($fields[$field_id])) {
|
| 337 |
$fields[$field_id]['data']['disabled'] = 0;
|
| 338 |
}
|
|
@@ -345,6 +371,7 @@ function wpcf_admin_custom_fields_control_bulk_actions($action = '') {
|
|
| 345 |
$failed = array();
|
| 346 |
$success = array();
|
| 347 |
foreach ($_POST['fields'] as $field_id) {
|
|
|
|
| 348 |
$response = wpcf_admin_fields_delete_field($field_id);
|
| 349 |
if (!$response) {
|
| 350 |
$failed[] = str_replace('_' . md5('wpcf_not_controlled'), '',
|
|
@@ -367,7 +394,14 @@ function wpcf_admin_custom_fields_control_bulk_actions($action = '') {
|
|
| 367 |
);
|
| 368 |
}
|
| 369 |
}
|
| 370 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 371 |
die();
|
| 372 |
}
|
| 373 |
|
|
@@ -380,8 +414,9 @@ function wpcf_admin_custom_fields_control_bulk_ajax() {
|
|
| 380 |
}
|
| 381 |
if (!empty($_POST)) {
|
| 382 |
if (!empty($_POST['groups']) && !empty($_POST['fields'])) {
|
| 383 |
-
$action = isset($_POST['wpcf_action_control']) ? $_POST['wpcf_action_control'] : 'wpcf-add-to-group-bulk';
|
| 384 |
foreach ($_POST['groups'] as $group_id) {
|
|
|
|
| 385 |
switch ($action) {
|
| 386 |
case 'wpcf-add-to-group-bulk':
|
| 387 |
wpcf_admin_fields_save_group_fields($group_id,
|
|
@@ -399,7 +434,7 @@ function wpcf_admin_custom_fields_control_bulk_ajax() {
|
|
| 399 |
}
|
| 400 |
} else if (!empty($_POST['type']) && !empty($_POST['fields'])) {
|
| 401 |
wpcf_admin_custom_fields_change_type($_POST['fields'],
|
| 402 |
-
$_POST['type']);
|
| 403 |
}
|
| 404 |
echo '<script type="text/javascript">
|
| 405 |
window.parent.jQuery("#TB_closeWindowButton").click();
|
|
@@ -427,6 +462,7 @@ function wpcf_admin_custom_fields_control_bulk_ajax() {
|
|
| 427 |
die('Not valid action');
|
| 428 |
}
|
| 429 |
foreach ($_GET['fields'] as $field_id) {
|
|
|
|
| 430 |
$output[$field_id] = array(
|
| 431 |
'#type' => 'hidden',
|
| 432 |
'#name' => 'fields[]',
|
|
@@ -450,7 +486,7 @@ function wpcf_admin_custom_fields_control_bulk_ajax() {
|
|
| 450 |
|
| 451 |
/**
|
| 452 |
* Change type dropdown.
|
| 453 |
-
*
|
| 454 |
* @return array Form array
|
| 455 |
*/
|
| 456 |
function wpcf_admin_custom_fields_control_change_type_dropdown() {
|
| 2 |
/*
|
| 3 |
* Custom Fields Control Screen
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/fields-control.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 25 |
*/
|
| 26 |
class WPCF_Custom_Fields_Control_Table extends WP_List_Table
|
| 27 |
{
|
| 28 |
+
/**
|
| 29 |
+
*
|
| 30 |
+
* @global object $wpdb
|
| 31 |
+
*
|
| 32 |
+
*/
|
| 33 |
function prepare_items() {
|
| 34 |
global $wpdb;
|
| 35 |
$wpcf_per_page = 15;
|
| 123 |
$sorted_keys = array();
|
| 124 |
$new_array = array();
|
| 125 |
foreach ($cf_types as $cf_id_temp => $cf_temp) {
|
| 126 |
+
if ( isset($sort_matches[$_REQUEST['orderby']]) ) {
|
| 127 |
+
$sorted_keys[$cf_temp['id']] = strtolower( $cf_temp[$sort_matches[$_REQUEST['orderby']]] );
|
| 128 |
+
} else {
|
| 129 |
+
$sorted_keys[$cf_temp['id']] = strtolower( $cf_temp[$sort_matches['c']] );
|
| 130 |
+
}
|
| 131 |
}
|
| 132 |
asort($sorted_keys, SORT_STRING);
|
| 133 |
+
if ('desc' == $_REQUEST['order']) {
|
| 134 |
$sorted_keys = array_reverse($sorted_keys, true);
|
| 135 |
}
|
| 136 |
foreach ($sorted_keys as $cf_id_temp => $groups_txt) {
|
| 245 |
$actions['wpcf-remove-from-group-bulk'] = __('Remove from group', 'wpcf');
|
| 246 |
$actions['wpcf-change-type-bulk'] = __('Change type', 'wpcf');
|
| 247 |
$actions['wpcf-activate-bulk'] = __("Add to Types control", 'wpcf');
|
| 248 |
+
$actions['wpcf-deactivate-bulk'] = __("Stop controlling with Types", 'wpcf');
|
|
|
|
| 249 |
$actions['wpcf-delete-bulk'] = __("Delete", 'wpcf');
|
| 250 |
return $actions;
|
| 251 |
}
|
| 252 |
|
| 253 |
+
function view_switcher($current_mode = '')
|
| 254 |
+
{
|
| 255 |
+
$display = 0;
|
| 256 |
+
$text = __('Show pagination', 'wpcf');
|
| 257 |
if (empty($_GET['display_all'])) {
|
| 258 |
+
$display = 1;
|
| 259 |
+
$text = __('Display all items', 'wpcf');
|
|
|
|
|
|
|
|
|
|
| 260 |
}
|
| 261 |
+
$url = add_query_arg(
|
| 262 |
+
array(
|
| 263 |
+
'page' => 'wpcf-custom-fields-control',
|
| 264 |
+
'display_all' => $display,
|
| 265 |
+
),
|
| 266 |
+
admin_url('admin.php')
|
| 267 |
+
);
|
| 268 |
+
echo '<div style="clear:both; margin: 20px 0 10px 0; float: right;">';
|
| 269 |
+
printf(
|
| 270 |
+
'<a class="button button-secondary" href="%s">%s</a>',
|
| 271 |
+
$url,
|
| 272 |
+
$text
|
| 273 |
+
);
|
| 274 |
+
echo '</div>';
|
| 275 |
}
|
| 276 |
|
| 277 |
}
|
| 335 |
/**
|
| 336 |
* Submitted Bulk actions.
|
| 337 |
*/
|
| 338 |
+
function wpcf_admin_custom_fields_control_bulk_actions($action = '')
|
| 339 |
+
{
|
| 340 |
+
if (
|
| 341 |
+
!isset($_POST['_wpnonce'])
|
| 342 |
+
|| !wp_verify_nonce($_POST['_wpnonce'], 'custom_fields_control_bulk')
|
| 343 |
+
) {
|
| 344 |
+
return;
|
| 345 |
+
}
|
| 346 |
if ($action == 'wpcf-deactivate-bulk') {
|
| 347 |
$fields = wpcf_admin_fields_get_fields(false, true);
|
| 348 |
foreach ($_POST['fields'] as $field_id) {
|
| 349 |
+
$field_id = sanitize_text_field( $field_id );
|
| 350 |
if (isset($fields[$field_id])) {
|
| 351 |
$fields[$field_id]['data']['disabled'] = 1;
|
| 352 |
wpcf_admin_message_store(sprintf(__('Removed from Types control: %s',
|
| 359 |
$fields_bulk = wpcf_types_cf_under_control('add',
|
| 360 |
array('fields' => $_POST['fields']));
|
| 361 |
foreach ($fields_bulk as $field_id) {
|
|
|
|
| 362 |
if (isset($fields[$field_id])) {
|
| 363 |
$fields[$field_id]['data']['disabled'] = 0;
|
| 364 |
}
|
| 371 |
$failed = array();
|
| 372 |
$success = array();
|
| 373 |
foreach ($_POST['fields'] as $field_id) {
|
| 374 |
+
$field_id = sanitize_text_field( $field_id );
|
| 375 |
$response = wpcf_admin_fields_delete_field($field_id);
|
| 376 |
if (!$response) {
|
| 377 |
$failed[] = str_replace('_' . md5('wpcf_not_controlled'), '',
|
| 394 |
);
|
| 395 |
}
|
| 396 |
}
|
| 397 |
+
$url = add_query_arg(
|
| 398 |
+
array(
|
| 399 |
+
'page' => 'wpcf-custom-fields-control',
|
| 400 |
+
'display_all' => isset($_REQUEST['display_all'])? 1:0,
|
| 401 |
+
),
|
| 402 |
+
admin_url('admin.php')
|
| 403 |
+
);
|
| 404 |
+
wp_redirect($url);
|
| 405 |
die();
|
| 406 |
}
|
| 407 |
|
| 414 |
}
|
| 415 |
if (!empty($_POST)) {
|
| 416 |
if (!empty($_POST['groups']) && !empty($_POST['fields'])) {
|
| 417 |
+
$action = isset($_POST['wpcf_action_control']) ? sanitize_text_field( $_POST['wpcf_action_control'] ) : 'wpcf-add-to-group-bulk';
|
| 418 |
foreach ($_POST['groups'] as $group_id) {
|
| 419 |
+
$group_id = sanitize_text_field( $group_id );
|
| 420 |
switch ($action) {
|
| 421 |
case 'wpcf-add-to-group-bulk':
|
| 422 |
wpcf_admin_fields_save_group_fields($group_id,
|
| 434 |
}
|
| 435 |
} else if (!empty($_POST['type']) && !empty($_POST['fields'])) {
|
| 436 |
wpcf_admin_custom_fields_change_type($_POST['fields'],
|
| 437 |
+
sanitize_text_field( $_POST['type'] ));
|
| 438 |
}
|
| 439 |
echo '<script type="text/javascript">
|
| 440 |
window.parent.jQuery("#TB_closeWindowButton").click();
|
| 462 |
die('Not valid action');
|
| 463 |
}
|
| 464 |
foreach ($_GET['fields'] as $field_id) {
|
| 465 |
+
$field_id = sanitize_text_field( $field_id );
|
| 466 |
$output[$field_id] = array(
|
| 467 |
'#type' => 'hidden',
|
| 468 |
'#name' => 'fields[]',
|
| 486 |
|
| 487 |
/**
|
| 488 |
* Change type dropdown.
|
| 489 |
+
*
|
| 490 |
* @return array Form array
|
| 491 |
*/
|
| 492 |
function wpcf_admin_custom_fields_control_change_type_dropdown() {
|
includes/fields-form.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Fields and groups form functions.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -22,22 +22,31 @@ if ( version_compare( $wp_version, '3.5', '<' ) ) {
|
|
| 22 |
|
| 23 |
/**
|
| 24 |
* Saves fields and groups.
|
| 25 |
-
*
|
| 26 |
* If field name is changed in specific group - new one will be created,
|
| 27 |
* otherwise old one will be updated and will appear in that way in other grups.
|
| 28 |
-
*
|
| 29 |
-
* @return type
|
| 30 |
*/
|
| 31 |
-
function wpcf_admin_save_fields_groups_submit( $form )
|
| 32 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
return false;
|
| 34 |
}
|
| 35 |
-
|
|
|
|
| 36 |
|
| 37 |
-
$_POST['wpcf']['group'] = apply_filters( 'wpcf_group_pre_save',
|
| 38 |
-
$_POST['wpcf']['group'] );
|
| 39 |
|
| 40 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 41 |
|
| 42 |
$new_group = false;
|
| 43 |
|
|
@@ -46,37 +55,45 @@ function wpcf_admin_save_fields_groups_submit( $form ) {
|
|
| 46 |
// Basic check
|
| 47 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
| 48 |
// Check if group exists
|
| 49 |
-
$post = get_post( $_REQUEST['group_id'] );
|
| 50 |
// Name changed
|
| 51 |
if ( strtolower( $_POST['wpcf']['group']['name'] ) != strtolower( $post->post_title ) ) {
|
| 52 |
// Check if already exists
|
| 53 |
-
$exists = get_page_by_title( $_POST['wpcf']['group']['name'],
|
| 54 |
-
'OBJECT', 'wp-types-group' );
|
| 55 |
if ( !empty( $exists ) ) {
|
| 56 |
$form->triggerError();
|
| 57 |
-
wpcf_admin_message(
|
| 58 |
-
|
| 59 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 60 |
return $form;
|
| 61 |
}
|
| 62 |
}
|
| 63 |
if ( empty( $post ) || $post->post_type != 'wp-types-group' ) {
|
| 64 |
$form->triggerError();
|
| 65 |
-
wpcf_admin_message(
|
| 66 |
-
|
|
|
|
|
|
|
| 67 |
return $form;
|
| 68 |
}
|
| 69 |
$group_id = $post->ID;
|
| 70 |
} else {
|
| 71 |
$new_group = true;
|
| 72 |
// Check if already exists
|
| 73 |
-
$exists = get_page_by_title( $_POST['wpcf']['group']['name'], 'OBJECT',
|
| 74 |
-
'wp-types-group' );
|
| 75 |
if ( !empty( $exists ) ) {
|
| 76 |
$form->triggerError();
|
| 77 |
-
wpcf_admin_message(
|
| 78 |
-
|
| 79 |
-
'
|
|
|
|
|
|
|
|
|
|
|
|
|
| 80 |
return $form;
|
| 81 |
}
|
| 82 |
}
|
|
@@ -153,7 +170,7 @@ function wpcf_admin_save_fields_groups_submit( $form ) {
|
|
| 153 |
}
|
| 154 |
// Rename if needed
|
| 155 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
| 156 |
-
$_POST['wpcf']['group']['id'] = $_REQUEST['group_id'];
|
| 157 |
}
|
| 158 |
|
| 159 |
$group_id = wpcf_admin_fields_save_group( $_POST['wpcf']['group'] );
|
|
@@ -219,11 +236,11 @@ function wpcf_admin_fields_form() {
|
|
| 219 |
wpcf_admin_message( sprintf( __( "Group with ID %d do not exist",
|
| 220 |
'wpcf' ), intval( $_REQUEST['group_id'] ) ) );
|
| 221 |
} else {
|
| 222 |
-
$update['fields'] = wpcf_admin_fields_get_fields_by_group( $_REQUEST['group_id'], 'slug', false, true );
|
| 223 |
-
$update['post_types'] = wpcf_admin_get_post_types_by_group( $_REQUEST['group_id'] );
|
| 224 |
-
$update['taxonomies'] = wpcf_admin_get_taxonomies_by_group( $_REQUEST['group_id'] );
|
| 225 |
-
$update['templates'] = wpcf_admin_get_templates_by_group( $_REQUEST['group_id'] );
|
| 226 |
-
$update['admin_styles'] = wpcf_admin_get_groups_admin_styles_by_group( $_REQUEST['group_id'] );
|
| 227 |
}
|
| 228 |
}
|
| 229 |
|
|
@@ -356,50 +373,33 @@ function wpcf_admin_fields_form() {
|
|
| 356 |
'#type' => 'textfield',
|
| 357 |
'#name' => 'wpcf[group][name]',
|
| 358 |
'#id' => 'wpcf-group-name',
|
| 359 |
-
'#value' => $update ? $update['name']
|
| 360 |
'#inline' => true,
|
| 361 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
| 362 |
'#validate' => array(
|
| 363 |
'required' => array(
|
| 364 |
'value' => true,
|
| 365 |
),
|
| 366 |
)
|
| 367 |
);
|
| 368 |
-
if ( !$update ) {
|
| 369 |
-
$form['title']['#attributes']['data-label'] = addcslashes(__( 'Enter group title', 'wpcf' ), '"');
|
| 370 |
-
$form['title']['#attributes']['onfocus'] = 'if (jQuery(this).val() == jQuery(this).data(\'label\')) { jQuery(this).val(\'\'); }';
|
| 371 |
-
$form['title']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(jQuery(this).data(\'label\')) }';
|
| 372 |
-
}
|
| 373 |
$form['description'] = array(
|
| 374 |
'#type' => 'textarea',
|
| 375 |
'#id' => 'wpcf-group-description',
|
| 376 |
'#name' => 'wpcf[group][description]',
|
| 377 |
-
'#value' => $update ? $update['description']
|
|
|
|
|
|
|
|
|
|
| 378 |
);
|
| 379 |
-
if ( !$update ) {
|
| 380 |
-
$form['description']['#attributes']['data-label'] = addcslashes(__( 'Enter a description for this group', 'wpcf' ), '"');
|
| 381 |
-
$form['description']['#attributes']['onfocus'] = 'if (jQuery(this).val() == jQuery(this).data(\'label\')) { jQuery(this).val(\'\'); }';
|
| 382 |
-
$form['description']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(jQuery(this).data(\'label\')) }';
|
| 383 |
-
}
|
| 384 |
|
| 385 |
-
|
| 386 |
-
*
|
| 387 |
-
*
|
| 388 |
-
*
|
| 389 |
-
*
|
| 390 |
-
*
|
| 391 |
-
*
|
| 392 |
-
*
|
| 393 |
-
*
|
| 394 |
-
*
|
| 395 |
-
*
|
| 396 |
-
*
|
| 397 |
-
*
|
| 398 |
-
*
|
| 399 |
-
*
|
| 400 |
-
*
|
| 401 |
* FILTER BOX
|
| 402 |
* Since Types 1.2 we moved JS to /embedded/resources/js/custom-fields-form-filter.js
|
|
|
|
| 403 |
*/
|
| 404 |
// Support post types and taxonomies
|
| 405 |
|
|
@@ -431,17 +431,7 @@ function wpcf_admin_fields_form() {
|
|
| 431 |
}
|
| 432 |
|
| 433 |
|
| 434 |
-
|
| 435 |
-
*
|
| 436 |
-
*
|
| 437 |
-
*
|
| 438 |
-
*
|
| 439 |
-
*
|
| 440 |
-
*
|
| 441 |
-
*
|
| 442 |
-
*
|
| 443 |
-
*
|
| 444 |
-
*
|
| 445 |
* POST TYPE FILTER
|
| 446 |
*/
|
| 447 |
$temp = array(
|
|
@@ -450,8 +440,7 @@ function wpcf_admin_fields_form() {
|
|
| 450 |
'#name' => 'wpcf[group][supports]',
|
| 451 |
'#inline' => true,
|
| 452 |
);
|
| 453 |
-
|
| 454 |
-
*
|
| 455 |
* Here we use unique function for all filters
|
| 456 |
* Since Types 1.2
|
| 457 |
*/
|
|
@@ -460,15 +449,7 @@ function wpcf_admin_fields_form() {
|
|
| 460 |
implode( ',', $post_types_currently_supported ),
|
| 461 |
__( 'Displayed on all content types', 'wpcf' ), $temp );
|
| 462 |
|
| 463 |
-
|
| 464 |
-
*
|
| 465 |
-
*
|
| 466 |
-
*
|
| 467 |
-
*
|
| 468 |
-
*
|
| 469 |
-
*
|
| 470 |
-
*
|
| 471 |
-
*
|
| 472 |
* TAXONOMIES FILTER QUERY
|
| 473 |
*/
|
| 474 |
$taxonomies = apply_filters( 'wpcf_group_form_filter_taxonomies', get_taxonomies( '', 'objects' ) );
|
|
@@ -478,9 +459,7 @@ function wpcf_admin_fields_form() {
|
|
| 478 |
$form_tax_single = array();
|
| 479 |
|
| 480 |
|
| 481 |
-
|
| 482 |
-
*
|
| 483 |
-
*
|
| 484 |
* Filter toxonomies
|
| 485 |
*/
|
| 486 |
foreach ( $taxonomies as $category_slug => $category ) {
|
|
@@ -533,11 +512,7 @@ function wpcf_admin_fields_form() {
|
|
| 533 |
$tax_currently_supported[] = __( 'Not Selected', 'wpcf' );
|
| 534 |
}
|
| 535 |
|
| 536 |
-
|
| 537 |
-
*
|
| 538 |
-
*
|
| 539 |
-
*
|
| 540 |
-
*
|
| 541 |
* Since Types 1.2 we use unique function
|
| 542 |
*/
|
| 543 |
$form_tax = _wpcf_filter_wrap( 'custom_taxonomies', __( 'Terms:', 'wpcf' ),
|
|
@@ -546,20 +521,7 @@ function wpcf_admin_fields_form() {
|
|
| 546 |
|
| 547 |
|
| 548 |
|
| 549 |
-
|
| 550 |
-
*
|
| 551 |
-
*
|
| 552 |
-
*
|
| 553 |
-
*
|
| 554 |
-
*
|
| 555 |
-
*
|
| 556 |
-
*
|
| 557 |
-
*
|
| 558 |
-
*
|
| 559 |
-
*
|
| 560 |
-
*
|
| 561 |
-
*
|
| 562 |
-
*
|
| 563 |
* TEMPLATES
|
| 564 |
*/
|
| 565 |
// Choose templates
|
|
@@ -569,8 +531,7 @@ function wpcf_admin_fields_form() {
|
|
| 569 |
$options = array();
|
| 570 |
$options['default-template'] = array(
|
| 571 |
'#title' => __( 'Default Template' ),
|
| 572 |
-
'#default_value' => !empty( $update['templates'] ) && in_array( 'default',
|
| 573 |
-
$update['templates'] ),
|
| 574 |
'#name' => 'wpcf[group][templates][]',
|
| 575 |
'#value' => 'default',
|
| 576 |
'#inline' => true,
|
|
@@ -579,8 +540,7 @@ function wpcf_admin_fields_form() {
|
|
| 579 |
foreach ( $templates as $template_name => $template_filename ) {
|
| 580 |
$options[$template_filename] = array(
|
| 581 |
'#title' => $template_name,
|
| 582 |
-
'#default_value' => !empty( $update['templates'] ) && in_array( $template_filename,
|
| 583 |
-
$update['templates'] ),
|
| 584 |
'#name' => 'wpcf[group][templates][]',
|
| 585 |
'#value' => $template_filename,
|
| 586 |
'#inline' => true,
|
|
@@ -590,8 +550,7 @@ function wpcf_admin_fields_form() {
|
|
| 590 |
foreach ( $templates_views as $template_view ) {
|
| 591 |
$options[$template_view->post_name] = array(
|
| 592 |
'#title' => 'View Template ' . $template_view->post_title,
|
| 593 |
-
'#default_value' => !empty( $update['templates'] ) && in_array( $template_view->ID,
|
| 594 |
-
$update['templates'] ),
|
| 595 |
'#name' => 'wpcf[group][templates][]',
|
| 596 |
'#value' => $template_view->ID,
|
| 597 |
'#inline' => true,
|
|
@@ -629,37 +588,19 @@ function wpcf_admin_fields_form() {
|
|
| 629 |
'#options' => $options,
|
| 630 |
'#inline' => true,
|
| 631 |
);
|
| 632 |
-
// $form['templates'] = wpcf_admin_fields_form_nested_elements('templates',
|
| 633 |
-
// $form['templates'], __('Content templates:', 'wpcf'), $text,
|
| 634 |
-
// $empty_txt);
|
| 635 |
|
| 636 |
-
|
| 637 |
-
*
|
| 638 |
-
*
|
| 639 |
-
*
|
| 640 |
-
*
|
| 641 |
* Since Types 1.2 we use unique function
|
| 642 |
*/
|
| 643 |
-
$form_templates = _wpcf_filter_wrap(
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
|
| 650 |
|
| 651 |
-
|
| 652 |
-
*
|
| 653 |
-
*
|
| 654 |
-
*
|
| 655 |
-
*
|
| 656 |
-
*
|
| 657 |
-
*
|
| 658 |
-
*
|
| 659 |
-
*
|
| 660 |
-
*
|
| 661 |
-
*
|
| 662 |
-
*
|
| 663 |
* Now starting form
|
| 664 |
*/
|
| 665 |
$form['supports-table-open'] = array(
|
|
@@ -672,14 +613,8 @@ function wpcf_admin_fields_form() {
|
|
| 672 |
'wpcf' )
|
| 673 |
. '</p>',
|
| 674 |
);
|
| 675 |
-
|
| 676 |
-
|
| 677 |
-
*
|
| 678 |
-
*
|
| 679 |
-
*
|
| 680 |
-
*
|
| 681 |
-
*
|
| 682 |
-
*
|
| 683 |
* Join filter forms
|
| 684 |
*/
|
| 685 |
// Types
|
|
@@ -707,19 +642,10 @@ function wpcf_admin_fields_form() {
|
|
| 707 |
'#markup' => '</p>',
|
| 708 |
);
|
| 709 |
|
| 710 |
-
|
| 711 |
-
/*
|
| 712 |
-
*
|
| 713 |
-
*
|
| 714 |
-
*
|
| 715 |
-
*
|
| 716 |
-
*
|
| 717 |
-
*
|
| 718 |
-
*
|
| 719 |
* TODO Code from now on should be revised
|
| 720 |
*/
|
| 721 |
|
| 722 |
-
|
| 723 |
$count = 0;
|
| 724 |
$count +=!empty( $update['post_types'] ) ? 1 : 0;
|
| 725 |
$count +=!empty( $update['taxonomies'] ) ? 1 : 0;
|
|
@@ -821,7 +747,6 @@ function wpcf_admin_fields_form() {
|
|
| 821 |
'#type' => 'textarea',
|
| 822 |
'#name' => 'wpcf[group][admin_html_preview]',
|
| 823 |
'#inline' => true,
|
| 824 |
-
'#value' => '',
|
| 825 |
'#id' => 'wpcf-form-groups-admin-html-preview',
|
| 826 |
'#before' => '<h3>Field group HTML</h3>'
|
| 827 |
);
|
|
@@ -834,21 +759,18 @@ function wpcf_admin_fields_form() {
|
|
| 834 |
'#default_value' => '',
|
| 835 |
'#id' => 'wpcf-form-groups-css-fields-editor',
|
| 836 |
'#after' => '
|
| 837 |
-
|
| 838 |
-
|
| 839 |
-
|
| 840 |
-
|
| 841 |
-
|
| 842 |
-
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
| 846 |
'#before' => '<h3>Your CSS</h3>'
|
| 847 |
);
|
| 848 |
|
| 849 |
-
|
| 850 |
-
|
| 851 |
-
|
| 852 |
$admin_styles = _wpcf_filter_wrap( 'admin_styles',
|
| 853 |
__( 'Admin styles for fields:', 'wpcf' ), '', '', $temp,
|
| 854 |
__( 'Open style editor', 'wpcf' ) );
|
|
@@ -974,20 +896,20 @@ function wpcf_admin_fields_form() {
|
|
| 974 |
|
| 975 |
/**
|
| 976 |
* Dynamically adds new field on AJAX call.
|
| 977 |
-
*
|
| 978 |
-
* @param type $form_data
|
| 979 |
*/
|
| 980 |
function wpcf_fields_insert_ajax( $form_data = array() ) {
|
| 981 |
-
echo wpcf_fields_get_field_form( $_GET['field'] );
|
| 982 |
}
|
| 983 |
|
| 984 |
/**
|
| 985 |
* Dynamically adds existing field on AJAX call.
|
| 986 |
-
*
|
| 987 |
-
* @param type $form_data
|
| 988 |
*/
|
| 989 |
function wpcf_fields_insert_existing_ajax() {
|
| 990 |
-
$field = wpcf_admin_fields_get_field( $_GET['field'], false, true );
|
| 991 |
if ( !empty( $field ) ) {
|
| 992 |
echo wpcf_fields_get_field_form( $field['type'], $field );
|
| 993 |
} else {
|
|
@@ -997,10 +919,10 @@ function wpcf_fields_insert_existing_ajax() {
|
|
| 997 |
|
| 998 |
/**
|
| 999 |
* Returns HTML formatted field form (draggable).
|
| 1000 |
-
*
|
| 1001 |
* @param type $type
|
| 1002 |
* @param type $form_data
|
| 1003 |
-
* @return type
|
| 1004 |
*/
|
| 1005 |
function wpcf_fields_get_field_form( $type, $form_data = array() ) {
|
| 1006 |
$form = wpcf_fields_get_field_form_data( $type, $form_data );
|
|
@@ -1033,10 +955,10 @@ function wpcf_fields_get_field_form( $type, $form_data = array() ) {
|
|
| 1033 |
|
| 1034 |
/**
|
| 1035 |
* Processes field form data.
|
| 1036 |
-
*
|
| 1037 |
* @param type $type
|
| 1038 |
* @param type $form_data
|
| 1039 |
-
* @return type
|
| 1040 |
*/
|
| 1041 |
function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
| 1042 |
|
|
@@ -1123,31 +1045,26 @@ function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
|
| 1123 |
$form_field['name'] = array(
|
| 1124 |
'#type' => 'textfield',
|
| 1125 |
'#name' => 'name',
|
| 1126 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1127 |
'#validate' => array('required' => array('value' => true)),
|
| 1128 |
'#inline' => true,
|
| 1129 |
-
'#value' => __( 'Enter field name', 'wpcf' ),
|
| 1130 |
);
|
| 1131 |
-
if ( empty( $form_data['name'] ) ) {
|
| 1132 |
-
$form_field['name']['#attributes']['onclick'] = 'if (jQuery(this).val() == \''
|
| 1133 |
-
. __( 'Enter field name', 'wpcf' ) . '\') { jQuery(this).val(\'\'); }';
|
| 1134 |
-
$form_field['name']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(\''
|
| 1135 |
-
. __( 'Enter field name', 'wpcf' ) . '\') }';
|
| 1136 |
-
}
|
| 1137 |
$form_field['slug'] = array(
|
| 1138 |
'#type' => 'textfield',
|
| 1139 |
'#name' => 'slug',
|
| 1140 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1141 |
'#validate' => array('nospecialchars' => array('value' => true)),
|
| 1142 |
'#inline' => true,
|
| 1143 |
-
'#value' => __( 'Enter field slug', 'wpcf' ),
|
| 1144 |
);
|
| 1145 |
-
if ( empty( $form_data['slug'] ) ) {
|
| 1146 |
-
$form_field['slug']['#attributes']['onclick'] = 'if (jQuery(this).val() == \''
|
| 1147 |
-
. __( 'Enter field slug', 'wpcf' ) . '\') { jQuery(this).val(\'\'); }';
|
| 1148 |
-
$form_field['slug']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(\''
|
| 1149 |
-
. __( 'Enter field slug', 'wpcf' ) . '\') }';
|
| 1150 |
-
}
|
| 1151 |
|
| 1152 |
// If insert form callback is not provided, use generic form data
|
| 1153 |
if ( function_exists( 'wpcf_fields_' . $type . '_insert_form' ) ) {
|
|
@@ -1164,27 +1081,49 @@ function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
|
| 1164 |
$form_field['description'] = array(
|
| 1165 |
'#type' => 'textarea',
|
| 1166 |
'#name' => 'description',
|
| 1167 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1168 |
'#inline' => true,
|
| 1169 |
-
'#value' => __( 'Describe this field', 'wpcf' ),
|
| 1170 |
);
|
| 1171 |
-
|
| 1172 |
-
|
| 1173 |
-
|
| 1174 |
-
|
| 1175 |
-
|
| 1176 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1177 |
|
| 1178 |
if ( wpcf_admin_can_be_repetitive( $type ) ) {
|
| 1179 |
$temp_warning_message = '';
|
| 1180 |
-
// $temp_warning_message .= '<div class="wpcf-message wpcf-cd-repetitive-warning wpcf-error"';
|
| 1181 |
-
// if (empty($form_data['data']['repetitive'])) {
|
| 1182 |
-
// $temp_warning_message .= ' style="display:none;"';
|
| 1183 |
-
// }
|
| 1184 |
-
// $temp_warning_message .= '><p>'
|
| 1185 |
-
// . __('Since this field is repeating, you cannot use it to control the display of other fields.',
|
| 1186 |
-
// 'wpcf')
|
| 1187 |
-
// . '</p></div>';
|
| 1188 |
$form_field['repetitive'] = array(
|
| 1189 |
'#type' => 'radios',
|
| 1190 |
'#name' => 'repetitive',
|
|
@@ -1204,7 +1143,6 @@ function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
|
| 1204 |
),
|
| 1205 |
),
|
| 1206 |
'#default_value' => isset( $form_data['data']['repetitive'] ) ? $form_data['data']['repetitive'] : '0',
|
| 1207 |
-
// '#attributes' => array('onclick' => 'if (jQuery(this).is(\':checked\')) { jQuery(this).parent().find(\'.wpcf-cd-warning\').hide(); jQuery(this).parent().find(\'.wpcf-cd-repetitive-warning\').show(); } else { jQuery(this).parent().find(\'.wpcf-cd-warning\').show(); jQuery(this).parent().find(\'.wpcf-cd-repetitive-warning\').hide(); }'),
|
| 1208 |
'#after' => wpcf_admin_is_repetitive( $form_data ) ? '<div class="wpcf-message wpcf-cd-warning wpcf-error" style="display:none;"><p>' . __( "There may be multiple instances of this field already. When you switch back to single-field mode, all values of this field will be updated when it's edited.",
|
| 1209 |
'wpcf' ) . '</p></div>' . $temp_warning_message : $temp_warning_message,
|
| 1210 |
);
|
|
@@ -1296,11 +1234,11 @@ function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
|
| 1296 |
|
| 1297 |
/**
|
| 1298 |
* Adds validation box.
|
| 1299 |
-
*
|
| 1300 |
* @param type $name
|
| 1301 |
* @param string $field
|
| 1302 |
* @param type $form_data
|
| 1303 |
-
* @return type
|
| 1304 |
*/
|
| 1305 |
function wpcf_admin_fields_form_validation( $name, $field, $form_data = array() ) {
|
| 1306 |
$form = array();
|
|
@@ -1385,10 +1323,10 @@ function wpcf_admin_fields_form_js_validation() {
|
|
| 1385 |
|
| 1386 |
/**
|
| 1387 |
* Saves open fieldsets.
|
| 1388 |
-
*
|
| 1389 |
* @param type $action
|
| 1390 |
* @param type $fieldset
|
| 1391 |
-
* @param type $group_id
|
| 1392 |
*/
|
| 1393 |
function wpcf_admin_fields_form_save_open_fieldset( $action, $fieldset,
|
| 1394 |
$group_id = false ) {
|
|
@@ -1412,10 +1350,10 @@ function wpcf_admin_fields_form_save_open_fieldset( $action, $fieldset,
|
|
| 1412 |
|
| 1413 |
/**
|
| 1414 |
* Saves open fieldsets.
|
| 1415 |
-
*
|
| 1416 |
* @param type $action
|
| 1417 |
* @param type $fieldset
|
| 1418 |
-
* @param type $group_id
|
| 1419 |
*/
|
| 1420 |
function wpcf_admin_fields_form_fieldset_is_collapsed( $fieldset ) {
|
| 1421 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
|
@@ -1432,15 +1370,15 @@ function wpcf_admin_fields_form_fieldset_is_collapsed( $fieldset ) {
|
|
| 1432 |
|
| 1433 |
/**
|
| 1434 |
* Adds 'Edit' and 'Cancel' buttons, expandable div.
|
| 1435 |
-
*
|
| 1436 |
* @todo REMOVE THIS - Since Types 1.2 we do not need it
|
| 1437 |
-
*
|
| 1438 |
* @param type $id
|
| 1439 |
* @param type $element
|
| 1440 |
* @param type $title
|
| 1441 |
* @param type $list
|
| 1442 |
* @param type $empty_txt
|
| 1443 |
-
* @return string
|
| 1444 |
*/
|
| 1445 |
function wpcf_admin_fields_form_nested_elements( $id, $element, $title, $list,
|
| 1446 |
$empty_txt ) {
|
|
@@ -1479,33 +1417,33 @@ function wpcf_admin_fields_form_nested_elements( $id, $element, $title, $list,
|
|
| 1479 |
}
|
| 1480 |
|
| 1481 |
/*
|
| 1482 |
-
*
|
| 1483 |
-
*
|
| 1484 |
-
*
|
| 1485 |
-
*
|
| 1486 |
-
*
|
| 1487 |
-
*
|
| 1488 |
-
*
|
| 1489 |
-
*
|
| 1490 |
-
*
|
| 1491 |
-
*
|
| 1492 |
-
*
|
| 1493 |
-
*
|
| 1494 |
-
*
|
| 1495 |
-
*
|
| 1496 |
-
*
|
| 1497 |
-
*
|
| 1498 |
-
*
|
| 1499 |
-
*
|
| 1500 |
-
*
|
| 1501 |
-
*
|
| 1502 |
* From here add revised code
|
| 1503 |
*/
|
| 1504 |
|
| 1505 |
/**
|
| 1506 |
-
*
|
| 1507 |
* Use this to show filter item
|
| 1508 |
-
*
|
| 1509 |
* @since Types 1.2
|
| 1510 |
* @global type $wpcf_button_style
|
| 1511 |
* @global type $wpcf_button_style30
|
|
@@ -1531,7 +1469,7 @@ function _wpcf_filter_wrap( $id, $title, $txt, $txt_empty, $e, $edit_button = ''
|
|
| 1531 |
$edit = $edit_button;
|
| 1532 |
}
|
| 1533 |
/*
|
| 1534 |
-
*
|
| 1535 |
* Title and Edit button
|
| 1536 |
*/
|
| 1537 |
$form['filter_' . $unique_id . '_wrapper'] = array(
|
|
@@ -1545,9 +1483,7 @@ function _wpcf_filter_wrap( $id, $title, $txt, $txt_empty, $e, $edit_button = ''
|
|
| 1545 |
. $edit . '</a><div class="hidden" id="wpcf-form-fields-' . $id . '">',
|
| 1546 |
);
|
| 1547 |
|
| 1548 |
-
|
| 1549 |
-
*
|
| 1550 |
-
*
|
| 1551 |
* Form element as param
|
| 1552 |
* It may be single element or array of elements
|
| 1553 |
* Simply check if array has #type - indicates it is a form item
|
|
@@ -1556,15 +1492,12 @@ function _wpcf_filter_wrap( $id, $title, $txt, $txt_empty, $e, $edit_button = ''
|
|
| 1556 |
$form['filter_' . $unique_id . '_items'] = $e;
|
| 1557 |
} else {
|
| 1558 |
/*
|
| 1559 |
-
*
|
| 1560 |
* If array of elements just join
|
| 1561 |
*/
|
| 1562 |
$form = $form + (array) $e;
|
| 1563 |
}
|
| 1564 |
|
| 1565 |
-
|
| 1566 |
-
*
|
| 1567 |
-
*
|
| 1568 |
* OK button
|
| 1569 |
*/
|
| 1570 |
$form['filter_' . $unique_id . '_ok'] = array(
|
|
@@ -1577,9 +1510,7 @@ function _wpcf_filter_wrap( $id, $title, $txt, $txt_empty, $e, $edit_button = ''
|
|
| 1577 |
. __( 'OK', 'wpcf' ) . '</a> ',
|
| 1578 |
);
|
| 1579 |
|
| 1580 |
-
|
| 1581 |
-
*
|
| 1582 |
-
*
|
| 1583 |
* Cancel button
|
| 1584 |
*/
|
| 1585 |
$form['filter_' . $unique_id . '_cancel'] = array(
|
|
@@ -1592,9 +1523,7 @@ function _wpcf_filter_wrap( $id, $title, $txt, $txt_empty, $e, $edit_button = ''
|
|
| 1592 |
. __( 'Cancel', 'wpcf' ) . '</a>',
|
| 1593 |
);
|
| 1594 |
|
| 1595 |
-
|
| 1596 |
-
*
|
| 1597 |
-
*
|
| 1598 |
* Close wrapper
|
| 1599 |
*/
|
| 1600 |
$form['filter_' . $unique_id . 'wrapper_close'] = array(
|
| 2 |
/*
|
| 3 |
* Fields and groups form functions.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/fields-form.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 22 |
|
| 23 |
/**
|
| 24 |
* Saves fields and groups.
|
| 25 |
+
*
|
| 26 |
* If field name is changed in specific group - new one will be created,
|
| 27 |
* otherwise old one will be updated and will appear in that way in other grups.
|
| 28 |
+
*
|
| 29 |
+
* @return type
|
| 30 |
*/
|
| 31 |
+
function wpcf_admin_save_fields_groups_submit( $form )
|
| 32 |
+
{
|
| 33 |
+
if (
|
| 34 |
+
!isset( $_POST['wpcf'] )
|
| 35 |
+
|| !isset( $_POST['wpcf']['group'] )
|
| 36 |
+
|| !isset( $_POST['wpcf']['group']['name'] )
|
| 37 |
+
) {
|
| 38 |
return false;
|
| 39 |
}
|
| 40 |
+
// @todo maybe sanitize_text_field this too
|
| 41 |
+
$_POST['wpcf']['group']['name'] = trim(strip_tags($_POST['wpcf']['group']['name']));
|
| 42 |
|
| 43 |
+
$_POST['wpcf']['group'] = apply_filters( 'wpcf_group_pre_save', $_POST['wpcf']['group'] );
|
|
|
|
| 44 |
|
| 45 |
+
if ( empty($_POST['wpcf']['group']['name']) ) {
|
| 46 |
+
$form->triggerError();
|
| 47 |
+
wpcf_admin_message( __( 'Group name can not be empty.', 'wpcf' ), 'error');
|
| 48 |
+
return $form;
|
| 49 |
+
}
|
| 50 |
|
| 51 |
$new_group = false;
|
| 52 |
|
| 55 |
// Basic check
|
| 56 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
| 57 |
// Check if group exists
|
| 58 |
+
$post = get_post( intval($_REQUEST['group_id']) );
|
| 59 |
// Name changed
|
| 60 |
if ( strtolower( $_POST['wpcf']['group']['name'] ) != strtolower( $post->post_title ) ) {
|
| 61 |
// Check if already exists
|
| 62 |
+
$exists = get_page_by_title( $_POST['wpcf']['group']['name'], 'OBJECT', 'wp-types-group' );
|
|
|
|
| 63 |
if ( !empty( $exists ) ) {
|
| 64 |
$form->triggerError();
|
| 65 |
+
wpcf_admin_message(
|
| 66 |
+
sprintf(
|
| 67 |
+
__( "A group by name <em>%s</em> already exists. Please use a different name and save again.", 'wpcf' ),
|
| 68 |
+
htmlspecialchars($_POST['wpcf']['group']['name'])
|
| 69 |
+
),
|
| 70 |
+
'error'
|
| 71 |
+
);
|
| 72 |
return $form;
|
| 73 |
}
|
| 74 |
}
|
| 75 |
if ( empty( $post ) || $post->post_type != 'wp-types-group' ) {
|
| 76 |
$form->triggerError();
|
| 77 |
+
wpcf_admin_message(
|
| 78 |
+
sprintf( __( "Wrong group ID %d", 'wpcf' ), intval( $_REQUEST['group_id'] ) ),
|
| 79 |
+
'error'
|
| 80 |
+
);
|
| 81 |
return $form;
|
| 82 |
}
|
| 83 |
$group_id = $post->ID;
|
| 84 |
} else {
|
| 85 |
$new_group = true;
|
| 86 |
// Check if already exists
|
| 87 |
+
$exists = get_page_by_title( $_POST['wpcf']['group']['name'], 'OBJECT', 'wp-types-group' );
|
|
|
|
| 88 |
if ( !empty( $exists ) ) {
|
| 89 |
$form->triggerError();
|
| 90 |
+
wpcf_admin_message(
|
| 91 |
+
sprintf(
|
| 92 |
+
__( "A group by name <em>%s</em> already exists. Please use a different name and save again.", 'wpcf' ),
|
| 93 |
+
htmlspecialchars($_POST['wpcf']['group']['name'])
|
| 94 |
+
),
|
| 95 |
+
'error'
|
| 96 |
+
);
|
| 97 |
return $form;
|
| 98 |
}
|
| 99 |
}
|
| 170 |
}
|
| 171 |
// Rename if needed
|
| 172 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
| 173 |
+
$_POST['wpcf']['group']['id'] = intval($_REQUEST['group_id']);
|
| 174 |
}
|
| 175 |
|
| 176 |
$group_id = wpcf_admin_fields_save_group( $_POST['wpcf']['group'] );
|
| 236 |
wpcf_admin_message( sprintf( __( "Group with ID %d do not exist",
|
| 237 |
'wpcf' ), intval( $_REQUEST['group_id'] ) ) );
|
| 238 |
} else {
|
| 239 |
+
$update['fields'] = wpcf_admin_fields_get_fields_by_group( sanitize_text_field( $_REQUEST['group_id'] ), 'slug', false, true );
|
| 240 |
+
$update['post_types'] = wpcf_admin_get_post_types_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 241 |
+
$update['taxonomies'] = wpcf_admin_get_taxonomies_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 242 |
+
$update['templates'] = wpcf_admin_get_templates_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 243 |
+
$update['admin_styles'] = wpcf_admin_get_groups_admin_styles_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 244 |
}
|
| 245 |
}
|
| 246 |
|
| 373 |
'#type' => 'textfield',
|
| 374 |
'#name' => 'wpcf[group][name]',
|
| 375 |
'#id' => 'wpcf-group-name',
|
| 376 |
+
'#value' => $update ? $update['name']:'',
|
| 377 |
'#inline' => true,
|
| 378 |
+
'#attributes' => array(
|
| 379 |
+
'style' => 'width:100%;margin-bottom:10px;',
|
| 380 |
+
'placeholder' => __( 'Enter group title', 'wpcf' ),
|
| 381 |
+
),
|
| 382 |
'#validate' => array(
|
| 383 |
'required' => array(
|
| 384 |
'value' => true,
|
| 385 |
),
|
| 386 |
)
|
| 387 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 388 |
$form['description'] = array(
|
| 389 |
'#type' => 'textarea',
|
| 390 |
'#id' => 'wpcf-group-description',
|
| 391 |
'#name' => 'wpcf[group][description]',
|
| 392 |
+
'#value' => $update ? $update['description']:'',
|
| 393 |
+
'#attributes' => array(
|
| 394 |
+
'placeholder' => __( 'Enter a description for this group', 'wpcf' ),
|
| 395 |
+
),
|
| 396 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 397 |
|
| 398 |
+
/**
|
| 399 |
+
*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 400 |
* FILTER BOX
|
| 401 |
* Since Types 1.2 we moved JS to /embedded/resources/js/custom-fields-form-filter.js
|
| 402 |
+
*
|
| 403 |
*/
|
| 404 |
// Support post types and taxonomies
|
| 405 |
|
| 431 |
}
|
| 432 |
|
| 433 |
|
| 434 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 435 |
* POST TYPE FILTER
|
| 436 |
*/
|
| 437 |
$temp = array(
|
| 440 |
'#name' => 'wpcf[group][supports]',
|
| 441 |
'#inline' => true,
|
| 442 |
);
|
| 443 |
+
/**
|
|
|
|
| 444 |
* Here we use unique function for all filters
|
| 445 |
* Since Types 1.2
|
| 446 |
*/
|
| 449 |
implode( ',', $post_types_currently_supported ),
|
| 450 |
__( 'Displayed on all content types', 'wpcf' ), $temp );
|
| 451 |
|
| 452 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 453 |
* TAXONOMIES FILTER QUERY
|
| 454 |
*/
|
| 455 |
$taxonomies = apply_filters( 'wpcf_group_form_filter_taxonomies', get_taxonomies( '', 'objects' ) );
|
| 459 |
$form_tax_single = array();
|
| 460 |
|
| 461 |
|
| 462 |
+
/**
|
|
|
|
|
|
|
| 463 |
* Filter toxonomies
|
| 464 |
*/
|
| 465 |
foreach ( $taxonomies as $category_slug => $category ) {
|
| 512 |
$tax_currently_supported[] = __( 'Not Selected', 'wpcf' );
|
| 513 |
}
|
| 514 |
|
| 515 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
| 516 |
* Since Types 1.2 we use unique function
|
| 517 |
*/
|
| 518 |
$form_tax = _wpcf_filter_wrap( 'custom_taxonomies', __( 'Terms:', 'wpcf' ),
|
| 521 |
|
| 522 |
|
| 523 |
|
| 524 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 525 |
* TEMPLATES
|
| 526 |
*/
|
| 527 |
// Choose templates
|
| 531 |
$options = array();
|
| 532 |
$options['default-template'] = array(
|
| 533 |
'#title' => __( 'Default Template' ),
|
| 534 |
+
'#default_value' => !empty( $update['templates'] ) && in_array( 'default', $update['templates'] ),
|
|
|
|
| 535 |
'#name' => 'wpcf[group][templates][]',
|
| 536 |
'#value' => 'default',
|
| 537 |
'#inline' => true,
|
| 540 |
foreach ( $templates as $template_name => $template_filename ) {
|
| 541 |
$options[$template_filename] = array(
|
| 542 |
'#title' => $template_name,
|
| 543 |
+
'#default_value' => !empty( $update['templates'] ) && in_array( $template_filename, $update['templates'] ),
|
|
|
|
| 544 |
'#name' => 'wpcf[group][templates][]',
|
| 545 |
'#value' => $template_filename,
|
| 546 |
'#inline' => true,
|
| 550 |
foreach ( $templates_views as $template_view ) {
|
| 551 |
$options[$template_view->post_name] = array(
|
| 552 |
'#title' => 'View Template ' . $template_view->post_title,
|
| 553 |
+
'#default_value' => !empty( $update['templates'] ) && in_array( $template_view->ID, $update['templates'] ),
|
|
|
|
| 554 |
'#name' => 'wpcf[group][templates][]',
|
| 555 |
'#value' => $template_view->ID,
|
| 556 |
'#inline' => true,
|
| 588 |
'#options' => $options,
|
| 589 |
'#inline' => true,
|
| 590 |
);
|
|
|
|
|
|
|
|
|
|
| 591 |
|
| 592 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
| 593 |
* Since Types 1.2 we use unique function
|
| 594 |
*/
|
| 595 |
+
$form_templates = _wpcf_filter_wrap(
|
| 596 |
+
'templates',
|
| 597 |
+
__( 'Templates:', 'wpcf' ),
|
| 598 |
+
$text,
|
| 599 |
+
__( 'Not Selected', 'wpcf' ),
|
| 600 |
+
$form_templates
|
| 601 |
+
);
|
| 602 |
|
| 603 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 604 |
* Now starting form
|
| 605 |
*/
|
| 606 |
$form['supports-table-open'] = array(
|
| 613 |
'wpcf' )
|
| 614 |
. '</p>',
|
| 615 |
);
|
| 616 |
+
|
| 617 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 618 |
* Join filter forms
|
| 619 |
*/
|
| 620 |
// Types
|
| 642 |
'#markup' => '</p>',
|
| 643 |
);
|
| 644 |
|
| 645 |
+
/**
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 646 |
* TODO Code from now on should be revised
|
| 647 |
*/
|
| 648 |
|
|
|
|
| 649 |
$count = 0;
|
| 650 |
$count +=!empty( $update['post_types'] ) ? 1 : 0;
|
| 651 |
$count +=!empty( $update['taxonomies'] ) ? 1 : 0;
|
| 747 |
'#type' => 'textarea',
|
| 748 |
'#name' => 'wpcf[group][admin_html_preview]',
|
| 749 |
'#inline' => true,
|
|
|
|
| 750 |
'#id' => 'wpcf-form-groups-admin-html-preview',
|
| 751 |
'#before' => '<h3>Field group HTML</h3>'
|
| 752 |
);
|
| 759 |
'#default_value' => '',
|
| 760 |
'#id' => 'wpcf-form-groups-css-fields-editor',
|
| 761 |
'#after' => '
|
| 762 |
+
<div class="wpcf-update-preview-btn"><input type="button" value="Update preview" onclick="wpcfPreviewHtml()" style="float:right;" class="button-secondary"></div>
|
| 763 |
+
<h3>Field group preview</h3>
|
| 764 |
+
<div id="wpcf-update-preview-div">Preview here</div>
|
| 765 |
+
<script type="text/javascript">
|
| 766 |
+
var wpcfReadOnly = ' . json_encode( $preview_profile ) . ';
|
| 767 |
+
var wpcfEditMode = ' . json_encode( $edit_profile ) . ';
|
| 768 |
+
var wpcfDefaultCss = ' . json_encode( $admin_styles_value ) . ';
|
| 769 |
+
</script>
|
| 770 |
+
',
|
| 771 |
'#before' => '<h3>Your CSS</h3>'
|
| 772 |
);
|
| 773 |
|
|
|
|
|
|
|
|
|
|
| 774 |
$admin_styles = _wpcf_filter_wrap( 'admin_styles',
|
| 775 |
__( 'Admin styles for fields:', 'wpcf' ), '', '', $temp,
|
| 776 |
__( 'Open style editor', 'wpcf' ) );
|
| 896 |
|
| 897 |
/**
|
| 898 |
* Dynamically adds new field on AJAX call.
|
| 899 |
+
*
|
| 900 |
+
* @param type $form_data
|
| 901 |
*/
|
| 902 |
function wpcf_fields_insert_ajax( $form_data = array() ) {
|
| 903 |
+
echo wpcf_fields_get_field_form( sanitize_text_field( $_GET['field'] ) );
|
| 904 |
}
|
| 905 |
|
| 906 |
/**
|
| 907 |
* Dynamically adds existing field on AJAX call.
|
| 908 |
+
*
|
| 909 |
+
* @param type $form_data
|
| 910 |
*/
|
| 911 |
function wpcf_fields_insert_existing_ajax() {
|
| 912 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_GET['field'] ), false, true );
|
| 913 |
if ( !empty( $field ) ) {
|
| 914 |
echo wpcf_fields_get_field_form( $field['type'], $field );
|
| 915 |
} else {
|
| 919 |
|
| 920 |
/**
|
| 921 |
* Returns HTML formatted field form (draggable).
|
| 922 |
+
*
|
| 923 |
* @param type $type
|
| 924 |
* @param type $form_data
|
| 925 |
+
* @return type
|
| 926 |
*/
|
| 927 |
function wpcf_fields_get_field_form( $type, $form_data = array() ) {
|
| 928 |
$form = wpcf_fields_get_field_form_data( $type, $form_data );
|
| 955 |
|
| 956 |
/**
|
| 957 |
* Processes field form data.
|
| 958 |
+
*
|
| 959 |
* @param type $type
|
| 960 |
* @param type $form_data
|
| 961 |
+
* @return type
|
| 962 |
*/
|
| 963 |
function wpcf_fields_get_field_form_data( $type, $form_data = array() ) {
|
| 964 |
|
| 1045 |
$form_field['name'] = array(
|
| 1046 |
'#type' => 'textfield',
|
| 1047 |
'#name' => 'name',
|
| 1048 |
+
'#attributes' => array(
|
| 1049 |
+
'class' => 'wpcf-forms-set-legend wpcf-forms-field-name',
|
| 1050 |
+
'style' => 'width:100%;margin:10px 0 10px 0;',
|
| 1051 |
+
'placeholder' => __( 'Enter field name', 'wpcf' ),
|
| 1052 |
+
),
|
| 1053 |
'#validate' => array('required' => array('value' => true)),
|
| 1054 |
'#inline' => true,
|
|
|
|
| 1055 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1056 |
$form_field['slug'] = array(
|
| 1057 |
'#type' => 'textfield',
|
| 1058 |
'#name' => 'slug',
|
| 1059 |
+
'#attributes' => array(
|
| 1060 |
+
'class' => 'wpcf-forms-field-slug',
|
| 1061 |
+
'style' => 'width:100%;margin:0 0 10px 0;',
|
| 1062 |
+
'maxlength' => 255,
|
| 1063 |
+
'placeholder' => __( 'Enter field slug', 'wpcf' ),
|
| 1064 |
+
),
|
| 1065 |
'#validate' => array('nospecialchars' => array('value' => true)),
|
| 1066 |
'#inline' => true,
|
|
|
|
| 1067 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1068 |
|
| 1069 |
// If insert form callback is not provided, use generic form data
|
| 1070 |
if ( function_exists( 'wpcf_fields_' . $type . '_insert_form' ) ) {
|
| 1081 |
$form_field['description'] = array(
|
| 1082 |
'#type' => 'textarea',
|
| 1083 |
'#name' => 'description',
|
| 1084 |
+
'#attributes' => array(
|
| 1085 |
+
'rows' => 5,
|
| 1086 |
+
'cols' => 1,
|
| 1087 |
+
'style' => 'margin:0 0 10px 0;',
|
| 1088 |
+
'placeholder' => __( 'Describe this field', 'wpcf' ),
|
| 1089 |
+
),
|
| 1090 |
'#inline' => true,
|
|
|
|
| 1091 |
);
|
| 1092 |
+
|
| 1093 |
+
/**
|
| 1094 |
+
* add placeholder field
|
| 1095 |
+
*/
|
| 1096 |
+
switch($type)
|
| 1097 |
+
{
|
| 1098 |
+
case 'audio':
|
| 1099 |
+
case 'colorpicker':
|
| 1100 |
+
case 'date':
|
| 1101 |
+
case 'email':
|
| 1102 |
+
case 'embed':
|
| 1103 |
+
case 'file':
|
| 1104 |
+
case 'image':
|
| 1105 |
+
case 'numeric':
|
| 1106 |
+
case 'phone':
|
| 1107 |
+
case 'skype':
|
| 1108 |
+
case 'textarea':
|
| 1109 |
+
case 'textfield':
|
| 1110 |
+
case 'url':
|
| 1111 |
+
case 'video':
|
| 1112 |
+
$form_field['placeholder'] = array(
|
| 1113 |
+
'#type' => 'textfield',
|
| 1114 |
+
'#name' => 'placeholder',
|
| 1115 |
+
'#inline' => true,
|
| 1116 |
+
'#title' => __( 'Placeholder', 'wpcf' ),
|
| 1117 |
+
'#attributes' => array(
|
| 1118 |
+
'style' => 'width:100%;margin:0 0 10px 0;',
|
| 1119 |
+
'placeholder' => __('Enter placeholder', 'wpcf'),
|
| 1120 |
+
),
|
| 1121 |
+
);
|
| 1122 |
+
break;
|
| 1123 |
+
}
|
| 1124 |
|
| 1125 |
if ( wpcf_admin_can_be_repetitive( $type ) ) {
|
| 1126 |
$temp_warning_message = '';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1127 |
$form_field['repetitive'] = array(
|
| 1128 |
'#type' => 'radios',
|
| 1129 |
'#name' => 'repetitive',
|
| 1143 |
),
|
| 1144 |
),
|
| 1145 |
'#default_value' => isset( $form_data['data']['repetitive'] ) ? $form_data['data']['repetitive'] : '0',
|
|
|
|
| 1146 |
'#after' => wpcf_admin_is_repetitive( $form_data ) ? '<div class="wpcf-message wpcf-cd-warning wpcf-error" style="display:none;"><p>' . __( "There may be multiple instances of this field already. When you switch back to single-field mode, all values of this field will be updated when it's edited.",
|
| 1147 |
'wpcf' ) . '</p></div>' . $temp_warning_message : $temp_warning_message,
|
| 1148 |
);
|
| 1234 |
|
| 1235 |
/**
|
| 1236 |
* Adds validation box.
|
| 1237 |
+
*
|
| 1238 |
* @param type $name
|
| 1239 |
* @param string $field
|
| 1240 |
* @param type $form_data
|
| 1241 |
+
* @return type
|
| 1242 |
*/
|
| 1243 |
function wpcf_admin_fields_form_validation( $name, $field, $form_data = array() ) {
|
| 1244 |
$form = array();
|
| 1323 |
|
| 1324 |
/**
|
| 1325 |
* Saves open fieldsets.
|
| 1326 |
+
*
|
| 1327 |
* @param type $action
|
| 1328 |
* @param type $fieldset
|
| 1329 |
+
* @param type $group_id
|
| 1330 |
*/
|
| 1331 |
function wpcf_admin_fields_form_save_open_fieldset( $action, $fieldset,
|
| 1332 |
$group_id = false ) {
|
| 1350 |
|
| 1351 |
/**
|
| 1352 |
* Saves open fieldsets.
|
| 1353 |
+
*
|
| 1354 |
* @param type $action
|
| 1355 |
* @param type $fieldset
|
| 1356 |
+
* @param type $group_id
|
| 1357 |
*/
|
| 1358 |
function wpcf_admin_fields_form_fieldset_is_collapsed( $fieldset ) {
|
| 1359 |
if ( isset( $_REQUEST['group_id'] ) ) {
|
| 1370 |
|
| 1371 |
/**
|
| 1372 |
* Adds 'Edit' and 'Cancel' buttons, expandable div.
|
| 1373 |
+
*
|
| 1374 |
* @todo REMOVE THIS - Since Types 1.2 we do not need it
|
| 1375 |
+
*
|
| 1376 |
* @param type $id
|
| 1377 |
* @param type $element
|
| 1378 |
* @param type $title
|
| 1379 |
* @param type $list
|
| 1380 |
* @param type $empty_txt
|
| 1381 |
+
* @return string
|
| 1382 |
*/
|
| 1383 |
function wpcf_admin_fields_form_nested_elements( $id, $element, $title, $list,
|
| 1384 |
$empty_txt ) {
|
| 1417 |
}
|
| 1418 |
|
| 1419 |
/*
|
| 1420 |
+
*
|
| 1421 |
+
*
|
| 1422 |
+
*
|
| 1423 |
+
*
|
| 1424 |
+
*
|
| 1425 |
+
*
|
| 1426 |
+
*
|
| 1427 |
+
*
|
| 1428 |
+
*
|
| 1429 |
+
*
|
| 1430 |
+
*
|
| 1431 |
+
*
|
| 1432 |
+
*
|
| 1433 |
+
*
|
| 1434 |
+
*
|
| 1435 |
+
*
|
| 1436 |
+
*
|
| 1437 |
+
*
|
| 1438 |
+
*
|
| 1439 |
+
*
|
| 1440 |
* From here add revised code
|
| 1441 |
*/
|
| 1442 |
|
| 1443 |
/**
|
| 1444 |
+
*
|
| 1445 |
* Use this to show filter item
|
| 1446 |
+
*
|
| 1447 |
* @since Types 1.2
|
| 1448 |
* @global type $wpcf_button_style
|
| 1449 |
* @global type $wpcf_button_style30
|
| 1469 |
$edit = $edit_button;
|
| 1470 |
}
|
| 1471 |
/*
|
| 1472 |
+
*
|
| 1473 |
* Title and Edit button
|
| 1474 |
*/
|
| 1475 |
$form['filter_' . $unique_id . '_wrapper'] = array(
|
| 1483 |
. $edit . '</a><div class="hidden" id="wpcf-form-fields-' . $id . '">',
|
| 1484 |
);
|
| 1485 |
|
| 1486 |
+
/**
|
|
|
|
|
|
|
| 1487 |
* Form element as param
|
| 1488 |
* It may be single element or array of elements
|
| 1489 |
* Simply check if array has #type - indicates it is a form item
|
| 1492 |
$form['filter_' . $unique_id . '_items'] = $e;
|
| 1493 |
} else {
|
| 1494 |
/*
|
|
|
|
| 1495 |
* If array of elements just join
|
| 1496 |
*/
|
| 1497 |
$form = $form + (array) $e;
|
| 1498 |
}
|
| 1499 |
|
| 1500 |
+
/**
|
|
|
|
|
|
|
| 1501 |
* OK button
|
| 1502 |
*/
|
| 1503 |
$form['filter_' . $unique_id . '_ok'] = array(
|
| 1510 |
. __( 'OK', 'wpcf' ) . '</a> ',
|
| 1511 |
);
|
| 1512 |
|
| 1513 |
+
/**
|
|
|
|
|
|
|
| 1514 |
* Cancel button
|
| 1515 |
*/
|
| 1516 |
$form['filter_' . $unique_id . '_cancel'] = array(
|
| 1523 |
. __( 'Cancel', 'wpcf' ) . '</a>',
|
| 1524 |
);
|
| 1525 |
|
| 1526 |
+
/**
|
|
|
|
|
|
|
| 1527 |
* Close wrapper
|
| 1528 |
*/
|
| 1529 |
$form['filter_' . $unique_id . 'wrapper_close'] = array(
|
includes/fields-list.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Fields and groups list functions
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-02
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -12,101 +12,23 @@
|
|
| 12 |
/**
|
| 13 |
* Renders 'widefat' table.
|
| 14 |
*/
|
| 15 |
-
function wpcf_admin_fields_list()
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
$header = array(
|
| 33 |
-
'group_name' => __('Group name', 'wpcf'),
|
| 34 |
-
'group_description' => __('Description', 'wpcf'),
|
| 35 |
-
'group_active' => __('Active', 'wpcf'),
|
| 36 |
-
'group_post_types' => __('Post types', 'wpcf'),
|
| 37 |
-
'group_taxonomies' => __('Taxonomies', 'wpcf'),
|
| 38 |
-
);
|
| 39 |
-
foreach ($groups as $group) {
|
| 40 |
-
|
| 41 |
-
// Set 'name' column
|
| 42 |
-
$name = '';
|
| 43 |
-
$name .= '<a href="'
|
| 44 |
-
. admin_url('admin.php?page=wpcf-edit&group_id='
|
| 45 |
-
. $group['id']) . '">' . $group['name'] . '</a>';
|
| 46 |
-
$name .= '<br />';
|
| 47 |
-
$name .= '<a href="'
|
| 48 |
-
. admin_url('admin.php?page=wpcf-edit&group_id='
|
| 49 |
-
. $group['id']) . '">' . __('Edit', 'wpcf') . '</a> | ';
|
| 50 |
-
|
| 51 |
-
$name .= $group['is_active'] ? wpcf_admin_fields_get_ajax_deactivation_link($group['id']) . ' | ' : wpcf_admin_fields_get_ajax_activation_link($group['id']) . ' | ';
|
| 52 |
-
|
| 53 |
-
$name .= '<a href="'
|
| 54 |
-
. admin_url('admin-ajax.php?action=wpcf_ajax&'
|
| 55 |
-
. 'wpcf_action=delete_group&group_id='
|
| 56 |
-
. $group['id'] . '&wpcf_ajax_update=wpcf_list_ajax_response_'
|
| 57 |
-
. $group['id']) . '&_wpnonce=' . wp_create_nonce('delete_group')
|
| 58 |
-
. '&wpcf_warning='
|
| 59 |
-
. __('Are you sure?', 'wpcf') . '" class="wpcf-ajax-link" '
|
| 60 |
-
. 'id="wpcf-list-delete-' . $group['id'] . '">'
|
| 61 |
-
. __('Delete Permanently', 'wpcf') . '</a>';
|
| 62 |
-
|
| 63 |
-
$name .= '<div id="wpcf_list_ajax_response_' . $group['id'] . '"></div>';
|
| 64 |
-
|
| 65 |
-
$rows[$group['id']]['name'] = $name;
|
| 66 |
-
$rows[$group['id']]['raw_name'] = $group['name'];
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
$rows[$group['id']]['description'] = $group['description'];
|
| 70 |
-
$rows[$group['id']]['active-' . $group['id']] = $group['is_active'] ? __('Yes', 'wpcf') : __('No', 'wpcf');
|
| 71 |
-
$rows[$group['id']]['status'] = $group['is_active']? 'active':'inactive';
|
| 72 |
-
|
| 73 |
-
// Set 'post_tpes' column
|
| 74 |
-
$post_types = wpcf_admin_get_post_types_by_group($group['id']);
|
| 75 |
-
$rows[$group['id']]['post_types'] = empty($post_types) ? __('All post types', 'wpcf') : implode(', ', $post_types);
|
| 76 |
-
|
| 77 |
-
// Set 'taxonomies' column
|
| 78 |
-
$taxonomies = wpcf_admin_get_taxonomies_by_group($group['id']);
|
| 79 |
-
$output = '';
|
| 80 |
-
if (empty($taxonomies)) {
|
| 81 |
-
$output = __('None', 'wpcf');
|
| 82 |
-
} else {
|
| 83 |
-
foreach ($taxonomies as $taxonomy => $terms) {
|
| 84 |
-
$output .= '<em>' . $taxonomy . '</em>: ';
|
| 85 |
-
$terms_output = array();
|
| 86 |
-
foreach ($terms as $term_id => $term) {
|
| 87 |
-
$terms_output[] = $term['name'];
|
| 88 |
-
}
|
| 89 |
-
$output .= implode(', ', $terms_output) . '<br />';
|
| 90 |
-
}
|
| 91 |
-
}
|
| 92 |
-
$rows[$group['id']]['tax'] = $output;
|
| 93 |
-
}
|
| 94 |
-
uasort($rows, 'wpcf_admin_fields_list_sort');
|
| 95 |
-
|
| 96 |
-
// Render table
|
| 97 |
-
wpcf_admin_widefat_table('wpcf_groups_list', $header, $rows);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
do_action('wpcf_groups_list_table_after');
|
| 101 |
}
|
| 102 |
|
| 103 |
-
function wpcf_admin_fields_list_sort($a,$b)
|
| 104 |
-
{
|
| 105 |
-
$a = strtolower($a['raw_name']);
|
| 106 |
-
$b = strtolower($b['raw_name']);
|
| 107 |
-
if ($a == $b) {
|
| 108 |
-
return 0;
|
| 109 |
-
}
|
| 110 |
-
return ($a < $b) ? -1 : 1;
|
| 111 |
-
|
| 112 |
-
}
|
| 2 |
/*
|
| 3 |
* Fields and groups list functions
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/fields-list.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-02 10:49:00 +0000 (Mon, 02 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1103173 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 12 |
/**
|
| 13 |
* Renders 'widefat' table.
|
| 14 |
*/
|
| 15 |
+
function wpcf_admin_fields_list()
|
| 16 |
+
{
|
| 17 |
+
include_once dirname(__FILE__).'/classes/class.wpcf.custom.fields.list.table.php';
|
| 18 |
+
//Create an instance of our package class...
|
| 19 |
+
$listTable = new WPCF_Custom_Fields_List_Table();
|
| 20 |
+
//Fetch, prepare, sort, and filter our data...
|
| 21 |
+
$listTable->prepare_items();
|
| 22 |
+
?>
|
| 23 |
+
<!-- Forms are NOT created automatically, so you need to wrap the table in one to use features like bulk actions -->
|
| 24 |
+
<form id="cf-filter" method="post">
|
| 25 |
+
<!-- For plugins, we also need to ensure that the form posts back to our current page -->
|
| 26 |
+
<input type="hidden" name="page" value="<?php echo esc_attr($_REQUEST['page']); ?>" />
|
| 27 |
+
<?php $listTable->search_box(__('Search custom fields', 'wcpf'), 'search_id'); ?>
|
| 28 |
+
<!-- Now we can render the completed list table -->
|
| 29 |
+
<?php $listTable->display() ?>
|
| 30 |
+
</form>
|
| 31 |
+
<?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
do_action('wpcf_groups_list_table_after');
|
| 33 |
}
|
| 34 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
includes/fields.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Fields and groups functions
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -13,7 +13,6 @@ require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
|
| 13 |
/**
|
| 14 |
* Gets post_types supported by specific group.
|
| 15 |
*
|
| 16 |
-
* @global type $wpdb
|
| 17 |
* @param type $group_id
|
| 18 |
* @return type
|
| 19 |
*/
|
|
@@ -29,7 +28,8 @@ function wpcf_admin_get_post_types_by_group( $group_id ) {
|
|
| 29 |
/**
|
| 30 |
* Gets taxonomies supported by specific group.
|
| 31 |
*
|
| 32 |
-
* @global
|
|
|
|
| 33 |
* @param type $group_id
|
| 34 |
* @return type
|
| 35 |
*/
|
|
@@ -43,12 +43,13 @@ function wpcf_admin_get_taxonomies_by_group( $group_id ) {
|
|
| 43 |
$taxonomies = array();
|
| 44 |
if ( !empty( $terms ) ) {
|
| 45 |
foreach ( $terms as $term ) {
|
| 46 |
-
$term = $wpdb->get_row(
|
| 47 |
-
|
| 48 |
-
FROM {$wpdb->
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
|
|
|
| 52 |
if ( !empty( $term ) ) {
|
| 53 |
$taxonomies[$term['taxonomy']][$term['term_taxonomy_id']] = $term;
|
| 54 |
}
|
|
@@ -62,12 +63,11 @@ function wpcf_admin_get_taxonomies_by_group( $group_id ) {
|
|
| 62 |
/**
|
| 63 |
* Gets templates supported by specific group.
|
| 64 |
*
|
| 65 |
-
* @global type $wpdb
|
| 66 |
* @param type $group_id
|
| 67 |
* @return type
|
| 68 |
*/
|
| 69 |
-
function wpcf_admin_get_templates_by_group( $group_id )
|
| 70 |
-
|
| 71 |
$data = get_post_meta( $group_id, '_wp_types_group_templates', true );
|
| 72 |
if ( $data == 'all' ) {
|
| 73 |
return array();
|
|
@@ -94,12 +94,13 @@ function wpcf_admin_get_templates_by_group( $group_id ) {
|
|
| 94 |
* Activates group.
|
| 95 |
* Modified by Gen, 13.02.2013
|
| 96 |
*
|
| 97 |
-
* @global
|
|
|
|
| 98 |
* @param type $group_id
|
| 99 |
* @return type
|
| 100 |
*/
|
| 101 |
-
function wpcf_admin_fields_activate_group( $group_id,
|
| 102 |
-
|
| 103 |
global $wpdb;
|
| 104 |
return $wpdb->update( $wpdb->posts, array('post_status' => 'publish'),
|
| 105 |
array('ID' => intval( $group_id ), 'post_type' => $post_type),
|
|
@@ -111,7 +112,8 @@ function wpcf_admin_fields_activate_group( $group_id,
|
|
| 111 |
* Deactivates group.
|
| 112 |
* Modified by Gen, 13.02.2013
|
| 113 |
*
|
| 114 |
-
* @global
|
|
|
|
| 115 |
* @param type $group_id
|
| 116 |
* @return type
|
| 117 |
*/
|
|
@@ -127,8 +129,6 @@ function wpcf_admin_fields_deactivate_group( $group_id,
|
|
| 127 |
/**
|
| 128 |
* Removes specific field from group.
|
| 129 |
*
|
| 130 |
-
* @global type $wpdb
|
| 131 |
-
* @global type $wpdb
|
| 132 |
* @param type $group_id
|
| 133 |
* @param type $field_id
|
| 134 |
* @return type
|
|
@@ -151,6 +151,7 @@ function wpcf_admin_fields_remove_field_from_group( $group_id, $field_id ) {
|
|
| 151 |
*/
|
| 152 |
function wpcf_admin_fields_remove_field_from_group_bulk( $group_id, $fields ) {
|
| 153 |
foreach ( $fields as $field_id ) {
|
|
|
|
| 154 |
wpcf_admin_fields_remove_field_from_group( $group_id, $field_id );
|
| 155 |
}
|
| 156 |
}
|
|
@@ -159,6 +160,8 @@ function wpcf_admin_fields_remove_field_from_group_bulk( $group_id, $fields ) {
|
|
| 159 |
* Deletes field.
|
| 160 |
* Modified by Gen, 13.02.2013
|
| 161 |
*
|
|
|
|
|
|
|
| 162 |
* @param type $field_id
|
| 163 |
*/
|
| 164 |
function wpcf_admin_fields_delete_field( $field_id,
|
|
@@ -172,9 +175,13 @@ function wpcf_admin_fields_delete_field( $field_id,
|
|
| 172 |
wpcf_admin_fields_remove_field_from_group( $group['id'], $field_id );
|
| 173 |
}
|
| 174 |
// Remove from posts
|
| 175 |
-
if ( !wpcf_types_cf_under_control( 'check_outsider', $field_id,
|
| 176 |
-
|
| 177 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 178 |
foreach ( $results as $result ) {
|
| 179 |
delete_post_meta( $result->post_id, $result->meta_key );
|
| 180 |
}
|
|
@@ -191,7 +198,6 @@ function wpcf_admin_fields_delete_field( $field_id,
|
|
| 191 |
* Deletes group by ID.
|
| 192 |
* Modified by Gen, 13.02.2013
|
| 193 |
*
|
| 194 |
-
* @global type $wpdb
|
| 195 |
* @param type $group_id
|
| 196 |
* @return type
|
| 197 |
*/
|
|
@@ -240,6 +246,7 @@ function wpcf_admin_fields_save_group( $group, $post_type = 'wp-types-group' ) {
|
|
| 240 |
if ( !$group_id ) {
|
| 241 |
return false;
|
| 242 |
}
|
|
|
|
| 243 |
} else {
|
| 244 |
$group_id = wp_insert_post( $post, true );
|
| 245 |
if ( is_wp_error( $group_id ) ) {
|
|
@@ -550,7 +557,6 @@ function wpcf_admin_custom_fields_change_type( $fields, $type,
|
|
| 550 |
* Saves group's fields.
|
| 551 |
* Modified by Gen, 13.02.2013
|
| 552 |
*
|
| 553 |
-
* @global type $wpdb
|
| 554 |
* @param type $group_id
|
| 555 |
* @param type $fields
|
| 556 |
*/
|
|
@@ -571,7 +577,7 @@ function wpcf_admin_fields_save_group_fields( $group_id, $fields, $add = false,
|
|
| 571 |
$order[] = $field['id'];
|
| 572 |
}
|
| 573 |
foreach ( $fields as $field ) {
|
| 574 |
-
$order[] = $field;
|
| 575 |
}
|
| 576 |
$fields = $order;
|
| 577 |
}
|
|
@@ -587,7 +593,6 @@ function wpcf_admin_fields_save_group_fields( $group_id, $fields, $add = false,
|
|
| 587 |
/**
|
| 588 |
* Saves group's post types.
|
| 589 |
*
|
| 590 |
-
* @global type $wpdb
|
| 591 |
* @param type $group_id
|
| 592 |
* @param type $post_types
|
| 593 |
*/
|
|
@@ -603,7 +608,6 @@ function wpcf_admin_fields_save_group_post_types( $group_id, $post_types ) {
|
|
| 603 |
/**
|
| 604 |
* Saves group's terms.
|
| 605 |
*
|
| 606 |
-
* @global type $wpdb
|
| 607 |
* @param type $group_id
|
| 608 |
* @param type $terms
|
| 609 |
*/
|
|
@@ -619,7 +623,6 @@ function wpcf_admin_fields_save_group_terms( $group_id, $terms ) {
|
|
| 619 |
/**
|
| 620 |
* Saves group's templates.
|
| 621 |
*
|
| 622 |
-
* @global type $wpdb
|
| 623 |
* @param type $group_id
|
| 624 |
* @param type $terms
|
| 625 |
*/
|
|
@@ -635,6 +638,8 @@ function wpcf_admin_fields_save_group_templates( $group_id, $templates ) {
|
|
| 635 |
/**
|
| 636 |
* Returns HTML formatted AJAX activation link.
|
| 637 |
*
|
|
|
|
|
|
|
| 638 |
* @param type $group_id
|
| 639 |
* @return type
|
| 640 |
*/
|
|
@@ -678,7 +683,7 @@ function wpcf_admin_fields_checkbox_migrate_empty_check( $field, $action ) {
|
|
| 678 |
$filter = wpcf_admin_fields_get_filter_by_field( $field['id'] );
|
| 679 |
if ( !empty( $filter ) ) {
|
| 680 |
$posts = array();
|
| 681 |
-
$meta_key = wpcf_types_get_meta_prefix( $field ) . $field['id'];
|
| 682 |
$meta_query = '';
|
| 683 |
if ( $action == 'do_not_save_check' ) {
|
| 684 |
$meta_query = "(m.meta_key = '$meta_key' AND m.meta_value = '0')";
|
|
@@ -864,21 +869,27 @@ function wpcf_admin_fields_get_filter_by_field( $field ) {
|
|
| 864 |
/**
|
| 865 |
* Gets posts by filter fetched with wpcf_admin_fields_get_filter_by_field().
|
| 866 |
*
|
| 867 |
-
* @
|
| 868 |
-
* @param
|
| 869 |
-
* @return
|
| 870 |
*/
|
| 871 |
function wpcf_admin_fields_get_posts_by_filter( $filter, $meta_query = '' ) {
|
| 872 |
global $wpdb, $wpcf;
|
| 873 |
$query = array();
|
| 874 |
$join = array();
|
| 875 |
if ( $filter['types'] != 'all' && !empty( $filter['types'] ) ) {
|
| 876 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
| 877 |
} else {
|
| 878 |
$post_types = get_post_types( array('show_ui' => true), 'names' );
|
| 879 |
foreach ( $post_types as $post_type_slug => $post_type ) {
|
| 880 |
if ( in_array( $post_type_slug, $wpcf->excluded_post_types ) ) {
|
| 881 |
unset( $post_types[$post_type_slug] );
|
|
|
|
|
|
|
| 882 |
}
|
| 883 |
}
|
| 884 |
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
|
@@ -886,18 +897,26 @@ function wpcf_admin_fields_get_posts_by_filter( $filter, $meta_query = '' ) {
|
|
| 886 |
if ( $filter['terms'] != 'all' && !empty( $filter['terms'] ) ) {
|
| 887 |
$ttid = array();
|
| 888 |
foreach ( $filter['terms'] as $term_id ) {
|
| 889 |
-
$term_taxonomy_id = $wpdb->get_var(
|
| 890 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 891 |
if ( !empty( $term_taxonomy_id ) ) {
|
| 892 |
-
$ttid[] = $term_taxonomy_id;
|
| 893 |
}
|
| 894 |
}
|
| 895 |
$query[] = 't.term_taxonomy_id IN (\'' . implode( '\',\'', $ttid ) . '\')';
|
| 896 |
$join[] = "LEFT JOIN $wpdb->term_relationships t ON p.ID = t.object_id ";
|
| 897 |
}
|
| 898 |
if ( $filter['templates'] != 'all' && !empty( $filter['templates'] ) ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
| 899 |
$query[] = '(m.meta_key = \'_wp_page_template\' AND m.meta_value IN (\'' . implode( '\',\'',
|
| 900 |
-
$
|
| 901 |
}
|
| 902 |
if ( !empty( $meta_query )
|
| 903 |
|| ($filter['templates'] != 'all' && !empty( $filter['templates'] )) ) {
|
|
@@ -906,7 +925,8 @@ function wpcf_admin_fields_get_posts_by_filter( $filter, $meta_query = '' ) {
|
|
| 906 |
|
| 907 |
$_query = "SELECT p.ID FROM $wpdb->posts p " . implode( '', $join );
|
| 908 |
if ( !empty( $query ) ) {
|
| 909 |
-
$
|
|
|
|
| 910 |
$query ) . ' ';
|
| 911 |
if ( !empty( $meta_query ) ) {
|
| 912 |
$_query .= ' AND ' . $meta_query . ' ';
|
|
@@ -923,7 +943,7 @@ function wpcf_admin_fields_get_posts_by_filter( $filter, $meta_query = '' ) {
|
|
| 923 |
* Gets posts by filter with missing meta fetched
|
| 924 |
* with wpcf_admin_fields_get_filter_by_field().
|
| 925 |
*
|
| 926 |
-
* @global
|
| 927 |
* @param type $filter
|
| 928 |
* @return type
|
| 929 |
*/
|
|
@@ -933,12 +953,18 @@ function wpcf_admin_fields_get_posts_by_filter_missing_meta( $filter,
|
|
| 933 |
$query = array();
|
| 934 |
$join = array();
|
| 935 |
if ( $filter['types'] != 'all' && !empty( $filter['types'] ) ) {
|
| 936 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
| 937 |
} else {
|
| 938 |
$post_types = get_post_types( array('show_ui' => true), 'names' );
|
| 939 |
foreach ( $post_types as $post_type_slug => $post_type ) {
|
| 940 |
if ( in_array( $post_type_slug, $wpcf->excluded_post_types ) ) {
|
| 941 |
unset( $post_types[$post_type_slug] );
|
|
|
|
|
|
|
| 942 |
}
|
| 943 |
}
|
| 944 |
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
|
@@ -946,24 +972,33 @@ function wpcf_admin_fields_get_posts_by_filter_missing_meta( $filter,
|
|
| 946 |
if ( $filter['terms'] != 'all' && !empty( $filter['terms'] ) ) {
|
| 947 |
$ttid = array();
|
| 948 |
foreach ( $filter['terms'] as $term_id ) {
|
| 949 |
-
$term_taxonomy_id = $wpdb->get_var(
|
| 950 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 951 |
if ( !empty( $term_taxonomy_id ) ) {
|
| 952 |
-
$ttid[] = $term_taxonomy_id;
|
| 953 |
}
|
| 954 |
}
|
| 955 |
$query[] = 't.term_taxonomy_id IN (\'' . implode( '\',\'', $ttid ) . '\')';
|
| 956 |
$join[] = "LEFT JOIN $wpdb->term_relationships t ON p.ID = t.object_id ";
|
| 957 |
}
|
| 958 |
if ( $filter['templates'] != 'all' && !empty( $filter['templates'] ) ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
| 959 |
$query[] = '(m.meta_key = \'_wp_page_template\' AND m.meta_value IN (\'' . implode( '\',\'',
|
| 960 |
-
|
| 961 |
$join[] = "LEFT JOIN $wpdb->postmeta m ON p.ID = m.post_id ";
|
| 962 |
}
|
| 963 |
$_query = "SELECT DISTINCT p.ID FROM $wpdb->posts p " . implode( '', $join );
|
| 964 |
-
$_query .= "WHERE NOT EXISTS (SELECT * FROM $wpdb->postmeta mm WHERE p.ID = mm.post_id AND mm.meta_key = '$meta_key')";
|
| 965 |
if ( !empty( $query ) ) {
|
| 966 |
-
$
|
|
|
|
| 967 |
}
|
| 968 |
$_query .= "GROUP BY p.ID";
|
| 969 |
$posts = $wpdb->get_col( $_query );
|
|
@@ -973,6 +1008,8 @@ function wpcf_admin_fields_get_posts_by_filter_missing_meta( $filter,
|
|
| 973 |
/**
|
| 974 |
* Check how many posts needs checkboxes update.
|
| 975 |
*
|
|
|
|
|
|
|
| 976 |
* @param type $field
|
| 977 |
* @param type $action
|
| 978 |
* @return boolean|int
|
|
@@ -986,8 +1023,7 @@ function wpcf_admin_fields_checkboxes_migrate_empty_check( $field, $action ) {
|
|
| 986 |
if ( $action == 'do_not_save_check' ) {
|
| 987 |
$query = array();
|
| 988 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 989 |
-
|
| 990 |
-
$query[] = '\"' . $option_id . '\";i:0;';
|
| 991 |
}
|
| 992 |
$meta_query = "SELECT u.ID FROM {$wpdb->users} u
|
| 993 |
LEFT JOIN {$wpdb->usermeta} um ON u.ID = um.user_id
|
|
@@ -996,9 +1032,8 @@ function wpcf_admin_fields_checkboxes_migrate_empty_check( $field, $action ) {
|
|
| 996 |
} else if ( $action == 'save_check' ) {
|
| 997 |
$query = array();
|
| 998 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 999 |
-
// $query[] = '\"' . $option_id . '\";s:1:\"0\";';
|
| 1000 |
// Check only if missing
|
| 1001 |
-
$query[] = '\"' . $option_id . '\"';
|
| 1002 |
}
|
| 1003 |
$meta_query = "SELECT u.ID FROM {$wpdb->users} u
|
| 1004 |
LEFT JOIN {$wpdb->usermeta} um ON u.ID = um.user_id
|
|
@@ -1015,13 +1050,13 @@ function wpcf_admin_fields_checkboxes_migrate_empty_check( $field, $action ) {
|
|
| 1015 |
$filter = wpcf_admin_fields_get_filter_by_field( $field['id'] );
|
| 1016 |
if ( !empty( $filter ) ) {
|
| 1017 |
$posts = array();
|
| 1018 |
-
$meta_key = wpcf_types_get_meta_prefix( $field ) . $field['id'];
|
| 1019 |
$meta_query = '';
|
| 1020 |
// "wpcf-fields-checkboxes-option-1873650245";s:1:"1";
|
| 1021 |
if ( $action == 'do_not_save_check' ) {
|
| 1022 |
$query = array();
|
| 1023 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 1024 |
-
$query[] = '\"' . $option_id . '\";i:0;';
|
| 1025 |
}
|
| 1026 |
$meta_query = "(m.meta_key = '$meta_key' AND (m.meta_value LIKE '%%"
|
| 1027 |
. implode( "%%' OR m.meta_value LIKE '%%", $query ) . "%%'))";
|
|
@@ -1030,7 +1065,7 @@ function wpcf_admin_fields_checkboxes_migrate_empty_check( $field, $action ) {
|
|
| 1030 |
$query = array();
|
| 1031 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 1032 |
// Check only if missing
|
| 1033 |
-
$query[] = '\"' . $option_id . '\"';
|
| 1034 |
}
|
| 1035 |
$meta_query = "(m.meta_key = '$meta_key' AND (m.meta_value NOT LIKE '%%"
|
| 1036 |
. implode( "%%' OR m.meta_value NOT LIKE '%%", $query ) . "%%'))";
|
|
@@ -1226,3 +1261,71 @@ function wpcf_admin_fields_form_fix_styles()
|
|
| 1226 |
);
|
| 1227 |
}
|
| 1228 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
/*
|
| 3 |
* Fields and groups functions
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/fields.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 13 |
/**
|
| 14 |
* Gets post_types supported by specific group.
|
| 15 |
*
|
|
|
|
| 16 |
* @param type $group_id
|
| 17 |
* @return type
|
| 18 |
*/
|
| 28 |
/**
|
| 29 |
* Gets taxonomies supported by specific group.
|
| 30 |
*
|
| 31 |
+
* @global object $wpdb
|
| 32 |
+
*
|
| 33 |
* @param type $group_id
|
| 34 |
* @return type
|
| 35 |
*/
|
| 43 |
$taxonomies = array();
|
| 44 |
if ( !empty( $terms ) ) {
|
| 45 |
foreach ( $terms as $term ) {
|
| 46 |
+
$term = $wpdb->get_row(
|
| 47 |
+
$wpdb->prepare(
|
| 48 |
+
"SELECT tt.term_taxonomy_id, tt.taxonomy, t.term_id, t.slug, t.name FROM {$wpdb->term_taxonomy} tt JOIN {$wpdb->terms} t WHERE t.term_id = tt.term_id AND tt.term_taxonomy_id = %d",
|
| 49 |
+
$term
|
| 50 |
+
),
|
| 51 |
+
ARRAY_A
|
| 52 |
+
);
|
| 53 |
if ( !empty( $term ) ) {
|
| 54 |
$taxonomies[$term['taxonomy']][$term['term_taxonomy_id']] = $term;
|
| 55 |
}
|
| 63 |
/**
|
| 64 |
* Gets templates supported by specific group.
|
| 65 |
*
|
|
|
|
| 66 |
* @param type $group_id
|
| 67 |
* @return type
|
| 68 |
*/
|
| 69 |
+
function wpcf_admin_get_templates_by_group( $group_id )
|
| 70 |
+
{
|
| 71 |
$data = get_post_meta( $group_id, '_wp_types_group_templates', true );
|
| 72 |
if ( $data == 'all' ) {
|
| 73 |
return array();
|
| 94 |
* Activates group.
|
| 95 |
* Modified by Gen, 13.02.2013
|
| 96 |
*
|
| 97 |
+
* @global object $wpdb
|
| 98 |
+
*
|
| 99 |
* @param type $group_id
|
| 100 |
* @return type
|
| 101 |
*/
|
| 102 |
+
function wpcf_admin_fields_activate_group( $group_id, $post_type = 'wp-types-group' )
|
| 103 |
+
{
|
| 104 |
global $wpdb;
|
| 105 |
return $wpdb->update( $wpdb->posts, array('post_status' => 'publish'),
|
| 106 |
array('ID' => intval( $group_id ), 'post_type' => $post_type),
|
| 112 |
* Deactivates group.
|
| 113 |
* Modified by Gen, 13.02.2013
|
| 114 |
*
|
| 115 |
+
* @global object $wpdb
|
| 116 |
+
*
|
| 117 |
* @param type $group_id
|
| 118 |
* @return type
|
| 119 |
*/
|
| 129 |
/**
|
| 130 |
* Removes specific field from group.
|
| 131 |
*
|
|
|
|
|
|
|
| 132 |
* @param type $group_id
|
| 133 |
* @param type $field_id
|
| 134 |
* @return type
|
| 151 |
*/
|
| 152 |
function wpcf_admin_fields_remove_field_from_group_bulk( $group_id, $fields ) {
|
| 153 |
foreach ( $fields as $field_id ) {
|
| 154 |
+
$field_id = sanitize_text_field( $field_id );
|
| 155 |
wpcf_admin_fields_remove_field_from_group( $group_id, $field_id );
|
| 156 |
}
|
| 157 |
}
|
| 160 |
* Deletes field.
|
| 161 |
* Modified by Gen, 13.02.2013
|
| 162 |
*
|
| 163 |
+
* @global object $wpdb
|
| 164 |
+
*
|
| 165 |
* @param type $field_id
|
| 166 |
*/
|
| 167 |
function wpcf_admin_fields_delete_field( $field_id,
|
| 175 |
wpcf_admin_fields_remove_field_from_group( $group['id'], $field_id );
|
| 176 |
}
|
| 177 |
// Remove from posts
|
| 178 |
+
if ( !wpcf_types_cf_under_control( 'check_outsider', $field_id, $post_type, $meta_name ) ) {
|
| 179 |
+
$results = $wpdb->get_results(
|
| 180 |
+
$wpdb->prepare(
|
| 181 |
+
"SELECT post_id, meta_key FROM $wpdb->postmeta WHERE meta_key = %s",
|
| 182 |
+
wpcf_types_get_meta_prefix( $fields[$field_id] ) . strval( $field_id )
|
| 183 |
+
)
|
| 184 |
+
);
|
| 185 |
foreach ( $results as $result ) {
|
| 186 |
delete_post_meta( $result->post_id, $result->meta_key );
|
| 187 |
}
|
| 198 |
* Deletes group by ID.
|
| 199 |
* Modified by Gen, 13.02.2013
|
| 200 |
*
|
|
|
|
| 201 |
* @param type $group_id
|
| 202 |
* @return type
|
| 203 |
*/
|
| 246 |
if ( !$group_id ) {
|
| 247 |
return false;
|
| 248 |
}
|
| 249 |
+
update_post_meta( $group_id, TOOLSET_EDIT_LAST, time());
|
| 250 |
} else {
|
| 251 |
$group_id = wp_insert_post( $post, true );
|
| 252 |
if ( is_wp_error( $group_id ) ) {
|
| 557 |
* Saves group's fields.
|
| 558 |
* Modified by Gen, 13.02.2013
|
| 559 |
*
|
|
|
|
| 560 |
* @param type $group_id
|
| 561 |
* @param type $fields
|
| 562 |
*/
|
| 577 |
$order[] = $field['id'];
|
| 578 |
}
|
| 579 |
foreach ( $fields as $field ) {
|
| 580 |
+
$order[] = sanitize_text_field( $field );
|
| 581 |
}
|
| 582 |
$fields = $order;
|
| 583 |
}
|
| 593 |
/**
|
| 594 |
* Saves group's post types.
|
| 595 |
*
|
|
|
|
| 596 |
* @param type $group_id
|
| 597 |
* @param type $post_types
|
| 598 |
*/
|
| 608 |
/**
|
| 609 |
* Saves group's terms.
|
| 610 |
*
|
|
|
|
| 611 |
* @param type $group_id
|
| 612 |
* @param type $terms
|
| 613 |
*/
|
| 623 |
/**
|
| 624 |
* Saves group's templates.
|
| 625 |
*
|
|
|
|
| 626 |
* @param type $group_id
|
| 627 |
* @param type $terms
|
| 628 |
*/
|
| 638 |
/**
|
| 639 |
* Returns HTML formatted AJAX activation link.
|
| 640 |
*
|
| 641 |
+
* @global object $wpdb
|
| 642 |
+
*
|
| 643 |
* @param type $group_id
|
| 644 |
* @return type
|
| 645 |
*/
|
| 683 |
$filter = wpcf_admin_fields_get_filter_by_field( $field['id'] );
|
| 684 |
if ( !empty( $filter ) ) {
|
| 685 |
$posts = array();
|
| 686 |
+
$meta_key = esc_sql( wpcf_types_get_meta_prefix( $field ) . $field['id'] );
|
| 687 |
$meta_query = '';
|
| 688 |
if ( $action == 'do_not_save_check' ) {
|
| 689 |
$meta_query = "(m.meta_key = '$meta_key' AND m.meta_value = '0')";
|
| 869 |
/**
|
| 870 |
* Gets posts by filter fetched with wpcf_admin_fields_get_filter_by_field().
|
| 871 |
*
|
| 872 |
+
* @param array $filter
|
| 873 |
+
* @param string $meta_query This argument needs to be allways sanitized!
|
| 874 |
+
* @return array
|
| 875 |
*/
|
| 876 |
function wpcf_admin_fields_get_posts_by_filter( $filter, $meta_query = '' ) {
|
| 877 |
global $wpdb, $wpcf;
|
| 878 |
$query = array();
|
| 879 |
$join = array();
|
| 880 |
if ( $filter['types'] != 'all' && !empty( $filter['types'] ) ) {
|
| 881 |
+
$post_types = array();
|
| 882 |
+
foreach( $filter['types'] as $post_type ) {
|
| 883 |
+
$post_types[] = esc_sql( $post_type );
|
| 884 |
+
}
|
| 885 |
+
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
| 886 |
} else {
|
| 887 |
$post_types = get_post_types( array('show_ui' => true), 'names' );
|
| 888 |
foreach ( $post_types as $post_type_slug => $post_type ) {
|
| 889 |
if ( in_array( $post_type_slug, $wpcf->excluded_post_types ) ) {
|
| 890 |
unset( $post_types[$post_type_slug] );
|
| 891 |
+
} else {
|
| 892 |
+
$post_types[$post_type_slug] = esc_sql( $post_type );
|
| 893 |
}
|
| 894 |
}
|
| 895 |
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
| 897 |
if ( $filter['terms'] != 'all' && !empty( $filter['terms'] ) ) {
|
| 898 |
$ttid = array();
|
| 899 |
foreach ( $filter['terms'] as $term_id ) {
|
| 900 |
+
$term_taxonomy_id = $wpdb->get_var(
|
| 901 |
+
$wpdb->prepare(
|
| 902 |
+
"SELECT term_taxonomy_id FROM $wpdb->term_taxonomy WHERE term_id=%d",
|
| 903 |
+
$term_id
|
| 904 |
+
)
|
| 905 |
+
);
|
| 906 |
if ( !empty( $term_taxonomy_id ) ) {
|
| 907 |
+
$ttid[] = esc_sql( $term_taxonomy_id );
|
| 908 |
}
|
| 909 |
}
|
| 910 |
$query[] = 't.term_taxonomy_id IN (\'' . implode( '\',\'', $ttid ) . '\')';
|
| 911 |
$join[] = "LEFT JOIN $wpdb->term_relationships t ON p.ID = t.object_id ";
|
| 912 |
}
|
| 913 |
if ( $filter['templates'] != 'all' && !empty( $filter['templates'] ) ) {
|
| 914 |
+
$templates = array();
|
| 915 |
+
foreach( $filter['templates'] as $template ) {
|
| 916 |
+
$templates[] = esc_sql( $template );
|
| 917 |
+
}
|
| 918 |
$query[] = '(m.meta_key = \'_wp_page_template\' AND m.meta_value IN (\'' . implode( '\',\'',
|
| 919 |
+
$templates ) . '\'))';
|
| 920 |
}
|
| 921 |
if ( !empty( $meta_query )
|
| 922 |
|| ($filter['templates'] != 'all' && !empty( $filter['templates'] )) ) {
|
| 925 |
|
| 926 |
$_query = "SELECT p.ID FROM $wpdb->posts p " . implode( '', $join );
|
| 927 |
if ( !empty( $query ) ) {
|
| 928 |
+
$association = ( strtoupper( trim( $filter['association'] ) ) == 'OR' ) ? 'OR' : 'AND';
|
| 929 |
+
$_query .= "WHERE " . implode( ' ' . $association . ' ',
|
| 930 |
$query ) . ' ';
|
| 931 |
if ( !empty( $meta_query ) ) {
|
| 932 |
$_query .= ' AND ' . $meta_query . ' ';
|
| 943 |
* Gets posts by filter with missing meta fetched
|
| 944 |
* with wpcf_admin_fields_get_filter_by_field().
|
| 945 |
*
|
| 946 |
+
* @global object $wpdb
|
| 947 |
* @param type $filter
|
| 948 |
* @return type
|
| 949 |
*/
|
| 953 |
$query = array();
|
| 954 |
$join = array();
|
| 955 |
if ( $filter['types'] != 'all' && !empty( $filter['types'] ) ) {
|
| 956 |
+
$post_types = array();
|
| 957 |
+
foreach( $filter['types'] as $post_type ) {
|
| 958 |
+
$post_types[] = esc_sql( $post_type );
|
| 959 |
+
}
|
| 960 |
+
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
| 961 |
} else {
|
| 962 |
$post_types = get_post_types( array('show_ui' => true), 'names' );
|
| 963 |
foreach ( $post_types as $post_type_slug => $post_type ) {
|
| 964 |
if ( in_array( $post_type_slug, $wpcf->excluded_post_types ) ) {
|
| 965 |
unset( $post_types[$post_type_slug] );
|
| 966 |
+
} else {
|
| 967 |
+
$post_types[$post_type_slug] = esc_sql( $post_type );
|
| 968 |
}
|
| 969 |
}
|
| 970 |
$query[] = 'p.post_type IN (\'' . implode( '\',\'', $post_types ) . '\')';
|
| 972 |
if ( $filter['terms'] != 'all' && !empty( $filter['terms'] ) ) {
|
| 973 |
$ttid = array();
|
| 974 |
foreach ( $filter['terms'] as $term_id ) {
|
| 975 |
+
$term_taxonomy_id = $wpdb->get_var(
|
| 976 |
+
$wpdb->prepare(
|
| 977 |
+
"SELECT term_taxonomy_id FROM $wpdb->term_taxonomy WHERE term_id=%d",
|
| 978 |
+
$term_id
|
| 979 |
+
)
|
| 980 |
+
);
|
| 981 |
if ( !empty( $term_taxonomy_id ) ) {
|
| 982 |
+
$ttid[] = esc_sql( $term_taxonomy_id );
|
| 983 |
}
|
| 984 |
}
|
| 985 |
$query[] = 't.term_taxonomy_id IN (\'' . implode( '\',\'', $ttid ) . '\')';
|
| 986 |
$join[] = "LEFT JOIN $wpdb->term_relationships t ON p.ID = t.object_id ";
|
| 987 |
}
|
| 988 |
if ( $filter['templates'] != 'all' && !empty( $filter['templates'] ) ) {
|
| 989 |
+
$templates = array();
|
| 990 |
+
foreach( $filter['templates'] as $template ) {
|
| 991 |
+
$templates[] = esc_sql( $template );
|
| 992 |
+
}
|
| 993 |
$query[] = '(m.meta_key = \'_wp_page_template\' AND m.meta_value IN (\'' . implode( '\',\'',
|
| 994 |
+
$templates ) . '\'))';
|
| 995 |
$join[] = "LEFT JOIN $wpdb->postmeta m ON p.ID = m.post_id ";
|
| 996 |
}
|
| 997 |
$_query = "SELECT DISTINCT p.ID FROM $wpdb->posts p " . implode( '', $join );
|
| 998 |
+
$_query .= "WHERE NOT EXISTS (SELECT * FROM $wpdb->postmeta mm WHERE p.ID = mm.post_id AND mm.meta_key = '" . esc_sql( $meta_key ) . "')";
|
| 999 |
if ( !empty( $query ) ) {
|
| 1000 |
+
$association = ( strtoupper( trim( $filter['association'] ) ) == 'OR' ) ? 'OR' : 'AND';
|
| 1001 |
+
$_query .= "AND (" . implode( ' ' . $association . ' ', $query ) . ') ';
|
| 1002 |
}
|
| 1003 |
$_query .= "GROUP BY p.ID";
|
| 1004 |
$posts = $wpdb->get_col( $_query );
|
| 1008 |
/**
|
| 1009 |
* Check how many posts needs checkboxes update.
|
| 1010 |
*
|
| 1011 |
+
* @global object $wpdb
|
| 1012 |
+
*
|
| 1013 |
* @param type $field
|
| 1014 |
* @param type $action
|
| 1015 |
* @return boolean|int
|
| 1023 |
if ( $action == 'do_not_save_check' ) {
|
| 1024 |
$query = array();
|
| 1025 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 1026 |
+
$query[] = '\"' . esc_sql( $option_id ) . '\";i:0;';
|
|
|
|
| 1027 |
}
|
| 1028 |
$meta_query = "SELECT u.ID FROM {$wpdb->users} u
|
| 1029 |
LEFT JOIN {$wpdb->usermeta} um ON u.ID = um.user_id
|
| 1032 |
} else if ( $action == 'save_check' ) {
|
| 1033 |
$query = array();
|
| 1034 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
|
|
|
| 1035 |
// Check only if missing
|
| 1036 |
+
$query[] = '\"' . esc_sql( $option_id ) . '\"';
|
| 1037 |
}
|
| 1038 |
$meta_query = "SELECT u.ID FROM {$wpdb->users} u
|
| 1039 |
LEFT JOIN {$wpdb->usermeta} um ON u.ID = um.user_id
|
| 1050 |
$filter = wpcf_admin_fields_get_filter_by_field( $field['id'] );
|
| 1051 |
if ( !empty( $filter ) ) {
|
| 1052 |
$posts = array();
|
| 1053 |
+
$meta_key = esc_sql( wpcf_types_get_meta_prefix( $field ) . $field['id'] );
|
| 1054 |
$meta_query = '';
|
| 1055 |
// "wpcf-fields-checkboxes-option-1873650245";s:1:"1";
|
| 1056 |
if ( $action == 'do_not_save_check' ) {
|
| 1057 |
$query = array();
|
| 1058 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 1059 |
+
$query[] = '\"' . esc_sql( $option_id ) . '\";i:0;';
|
| 1060 |
}
|
| 1061 |
$meta_query = "(m.meta_key = '$meta_key' AND (m.meta_value LIKE '%%"
|
| 1062 |
. implode( "%%' OR m.meta_value LIKE '%%", $query ) . "%%'))";
|
| 1065 |
$query = array();
|
| 1066 |
foreach ( $field['data']['options'] as $option_id => $option_data ) {
|
| 1067 |
// Check only if missing
|
| 1068 |
+
$query[] = '\"' . esc_sql( $option_id ) . '\"';
|
| 1069 |
}
|
| 1070 |
$meta_query = "(m.meta_key = '$meta_key' AND (m.meta_value NOT LIKE '%%"
|
| 1071 |
. implode( "%%' OR m.meta_value NOT LIKE '%%", $query ) . "%%'))";
|
| 1261 |
);
|
| 1262 |
}
|
| 1263 |
|
| 1264 |
+
/**
|
| 1265 |
+
* add
|
| 1266 |
+
*/
|
| 1267 |
+
add_filter('wpcf_meta_box_order_defaults', 'wpcf_admin_fields_add_metabox', 10, 2);
|
| 1268 |
+
function wpcf_admin_fields_add_metabox($meta_boxes, $type )
|
| 1269 |
+
{
|
| 1270 |
+
if ( 'post_type' == $type ) {
|
| 1271 |
+
$key = 'custom_fields';
|
| 1272 |
+
if ( !in_array($key, $meta_boxes['side']) && !in_array($key, $meta_boxes['normal'])) {
|
| 1273 |
+
$meta_boxes['side'][] = $key;
|
| 1274 |
+
}
|
| 1275 |
+
}
|
| 1276 |
+
return $meta_boxes;
|
| 1277 |
+
}
|
| 1278 |
+
|
| 1279 |
+
function wpcf_admin_metabox_custom_fields($ct)
|
| 1280 |
+
{
|
| 1281 |
+
$form = array();
|
| 1282 |
+
$options = array();
|
| 1283 |
+
$groups = wpcf_admin_fields_get_groups('wp-types-group', true, true);
|
| 1284 |
+
foreach( $groups as $group ) {
|
| 1285 |
+
$post_types = wpcf_admin_get_post_types_by_group($group['id']);
|
| 1286 |
+
if ( empty($post_types) || (isset( $ct['wpcf-post-type']) && in_array($ct['wpcf-post-type'], $post_types)) ) {
|
| 1287 |
+
if ( !(empty($group['fields']) ) ) {
|
| 1288 |
+
foreach($group['fields'] as $field => $data) {
|
| 1289 |
+
if ( isset($data['data']['repetitive']) && $data['data']['repetitive']) {
|
| 1290 |
+
continue;
|
| 1291 |
+
}
|
| 1292 |
+
switch( $data['type'] ) {
|
| 1293 |
+
case 'embed':
|
| 1294 |
+
case 'checkboxes':
|
| 1295 |
+
case 'audio':
|
| 1296 |
+
case 'file':
|
| 1297 |
+
case 'textarea':
|
| 1298 |
+
case 'video':
|
| 1299 |
+
case 'wysiwyg':
|
| 1300 |
+
continue;
|
| 1301 |
+
default:
|
| 1302 |
+
$options[$field] = array(
|
| 1303 |
+
'#name' => 'ct[custom_fields][]',
|
| 1304 |
+
'#title' => sprintf( '%s <small>(%s)</small>', $data['name'], $data['type']),
|
| 1305 |
+
'#value' => $data['meta_key'],
|
| 1306 |
+
'#inline' => true,
|
| 1307 |
+
'#before' => '<li>',
|
| 1308 |
+
'#after' => '</li>',
|
| 1309 |
+
'#default_value' => intval(isset($ct['custom_fields']) && in_array($data['meta_key'], $ct['custom_fields']))
|
| 1310 |
+
);
|
| 1311 |
+
}
|
| 1312 |
+
}
|
| 1313 |
+
}
|
| 1314 |
+
}
|
| 1315 |
+
}
|
| 1316 |
+
unset($groups);
|
| 1317 |
+
|
| 1318 |
+
$form['table-custom_fields-open'] = wpcf_admin_metabox_begin(__( 'Custom Fields', 'wpcf' ), 'custom_fields', 'wpcf-types-form-visiblity-custom-fields-table', false);
|
| 1319 |
+
|
| 1320 |
+
$form['table-custom_fields-description'] = array(
|
| 1321 |
+
'#type' => 'checkboxes',
|
| 1322 |
+
'#options' => $options,
|
| 1323 |
+
'#name' => 'wpcf[group][supports]',
|
| 1324 |
+
'#inline' => true,
|
| 1325 |
+
'#before' => wpautop(__('Check which fields should be shown on custom post list as a column.', 'wpcf')).'<ul>',
|
| 1326 |
+
'#after' => '</ul>',
|
| 1327 |
+
);
|
| 1328 |
+
|
| 1329 |
+
$form['table-custom_fields-close'] = wpcf_admin_metabox_end();
|
| 1330 |
+
return $form;
|
| 1331 |
+
}
|
includes/fields/checkbox.php
CHANGED
|
@@ -119,12 +119,18 @@ function wpcf_fields_checkbox_insert_form( $form_data ) {
|
|
| 119 |
'#name' => 'display_value_not_selected',
|
| 120 |
'#value' => '',
|
| 121 |
'#inline' => true,
|
|
|
|
|
|
|
|
|
|
| 122 |
);
|
| 123 |
$form['display-value-2'] = array(
|
| 124 |
'#type' => 'textfield',
|
| 125 |
'#title' => __( 'Selected:', 'wpcf' ),
|
| 126 |
'#name' => 'display_value_selected',
|
| 127 |
'#value' => '',
|
|
|
|
|
|
|
|
|
|
| 128 |
);
|
| 129 |
$form['help'] = array(
|
| 130 |
'#type' => 'markup',
|
| 119 |
'#name' => 'display_value_not_selected',
|
| 120 |
'#value' => '',
|
| 121 |
'#inline' => true,
|
| 122 |
+
'#attributes' => array(
|
| 123 |
+
'placeholder' => __('Enter not selected value', 'wpcf'),
|
| 124 |
+
),
|
| 125 |
);
|
| 126 |
$form['display-value-2'] = array(
|
| 127 |
'#type' => 'textfield',
|
| 128 |
'#title' => __( 'Selected:', 'wpcf' ),
|
| 129 |
'#name' => 'display_value_selected',
|
| 130 |
'#value' => '',
|
| 131 |
+
'#attributes' => array(
|
| 132 |
+
'placeholder' => __('Enter selected value', 'wpcf'),
|
| 133 |
+
),
|
| 134 |
);
|
| 135 |
$form['help'] = array(
|
| 136 |
'#type' => 'markup',
|
includes/fields/checkboxes.php
CHANGED
|
@@ -112,7 +112,7 @@ function wpcf_fields_checkboxes_insert_form( $form_data, $parent_name = '' ) {
|
|
| 112 |
. admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=add_checkboxes_option&_wpnonce='
|
| 113 |
. wp_create_nonce( 'add_checkboxes_option' ) . '&wpcf_ajax_update_add='
|
| 114 |
. $id . '-sortable&parent_name=' . urlencode( $parent_name )
|
| 115 |
-
. '&page='. $_GET['page']
|
| 116 |
. '&count=' . $count)
|
| 117 |
. '" onclick="wpcfFieldsFormCountOptions(jQuery(this));"'
|
| 118 |
. ' class="button-secondary wpcf-ajax-link">'
|
|
@@ -136,8 +136,8 @@ function wpcf_fields_checkboxes_get_option( $parent_name = '',
|
|
| 136 |
$form_data = array(), $field = array() ) {
|
| 137 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-checkboxes-option-' . wpcf_unique_id( serialize( $form_data ) . $parent_name );
|
| 138 |
$form = array();
|
| 139 |
-
$count = isset( $_GET['count'] ) ? $_GET['count'] : 1;
|
| 140 |
-
$title = isset( $_GET['count'] ) ? __( 'Checkbox title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Checkbox title',
|
| 141 |
'wpcf' ) . ' 1';
|
| 142 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 143 |
$form[$id . '-id'] = $id;
|
|
@@ -220,12 +220,18 @@ function wpcf_fields_checkboxes_get_option( $parent_name = '',
|
|
| 220 |
'#name' => $parent_name . '[options][' . $id . '][display_value_not_selected]',
|
| 221 |
'#value' => isset( $form_data['display_value_not_selected'] ) ? $form_data['display_value_not_selected'] : '',
|
| 222 |
'#inline' => true,
|
|
|
|
|
|
|
|
|
|
| 223 |
);
|
| 224 |
$form[$id]['display-value-2'] = array(
|
| 225 |
'#type' => 'textfield',
|
| 226 |
'#title' => __( 'Selected:', 'wpcf' ),
|
| 227 |
'#name' => $parent_name . '[options][' . $id . '][display_value_selected]',
|
| 228 |
'#value' => isset( $form_data['display_value_selected'] ) ? $form_data['display_value_selected'] : '',
|
|
|
|
|
|
|
|
|
|
| 229 |
);
|
| 230 |
$form[$id . 'drag-close'] = array(
|
| 231 |
'#type' => 'markup',
|
|
@@ -247,7 +253,7 @@ function wpcf_fields_checkboxes_get_option_alt_text( $id, $parent_name = '',
|
|
| 247 |
$title = isset( $_GET['count'] ) ? __( 'Checkbox title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Checkbox title',
|
| 248 |
'wpcf' ) . ' 1';
|
| 249 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 250 |
-
$value = isset( $_GET['count'] ) ? $_GET['count'] : 1;
|
| 251 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 252 |
$value = isset( $form_data['display_value'] ) ? $form_data['display_value'] : $value;
|
| 253 |
$form = array(
|
|
@@ -261,4 +267,4 @@ function wpcf_fields_checkboxes_get_option_alt_text( $id, $parent_name = '',
|
|
| 261 |
'#after' => '</div>',
|
| 262 |
);
|
| 263 |
return $form;
|
| 264 |
-
}
|
| 112 |
. admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=add_checkboxes_option&_wpnonce='
|
| 113 |
. wp_create_nonce( 'add_checkboxes_option' ) . '&wpcf_ajax_update_add='
|
| 114 |
. $id . '-sortable&parent_name=' . urlencode( $parent_name )
|
| 115 |
+
. '&page='. sanitize_text_field( $_GET['page'] )
|
| 116 |
. '&count=' . $count)
|
| 117 |
. '" onclick="wpcfFieldsFormCountOptions(jQuery(this));"'
|
| 118 |
. ' class="button-secondary wpcf-ajax-link">'
|
| 136 |
$form_data = array(), $field = array() ) {
|
| 137 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-checkboxes-option-' . wpcf_unique_id( serialize( $form_data ) . $parent_name );
|
| 138 |
$form = array();
|
| 139 |
+
$count = isset( $_GET['count'] ) ? intval( $_GET['count'] ) : 1;
|
| 140 |
+
$title = isset( $_GET['count'] ) ? __( 'Checkbox title', 'wpcf' ) . ' ' . intval( $_GET['count'] ) : __( 'Checkbox title',
|
| 141 |
'wpcf' ) . ' 1';
|
| 142 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 143 |
$form[$id . '-id'] = $id;
|
| 220 |
'#name' => $parent_name . '[options][' . $id . '][display_value_not_selected]',
|
| 221 |
'#value' => isset( $form_data['display_value_not_selected'] ) ? $form_data['display_value_not_selected'] : '',
|
| 222 |
'#inline' => true,
|
| 223 |
+
'#attributes' => array(
|
| 224 |
+
'placeholder' => __('Enter not selected value', 'wpcf'),
|
| 225 |
+
),
|
| 226 |
);
|
| 227 |
$form[$id]['display-value-2'] = array(
|
| 228 |
'#type' => 'textfield',
|
| 229 |
'#title' => __( 'Selected:', 'wpcf' ),
|
| 230 |
'#name' => $parent_name . '[options][' . $id . '][display_value_selected]',
|
| 231 |
'#value' => isset( $form_data['display_value_selected'] ) ? $form_data['display_value_selected'] : '',
|
| 232 |
+
'#attributes' => array(
|
| 233 |
+
'placeholder' => __('Enter selected value', 'wpcf'),
|
| 234 |
+
),
|
| 235 |
);
|
| 236 |
$form[$id . 'drag-close'] = array(
|
| 237 |
'#type' => 'markup',
|
| 253 |
$title = isset( $_GET['count'] ) ? __( 'Checkbox title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Checkbox title',
|
| 254 |
'wpcf' ) . ' 1';
|
| 255 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 256 |
+
$value = isset( $_GET['count'] ) ? intval( $_GET['count'] ) : 1;
|
| 257 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 258 |
$value = isset( $form_data['display_value'] ) ? $form_data['display_value'] : $value;
|
| 259 |
$form = array(
|
| 267 |
'#after' => '</div>',
|
| 268 |
);
|
| 269 |
return $form;
|
| 270 |
+
}
|
includes/fields/radio.php
CHANGED
|
@@ -160,8 +160,7 @@ function wpcf_fields_radio_get_option( $parent_name = '', $form_data = array() )
|
|
| 160 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-radio-option-'
|
| 161 |
. wpcf_unique_id( serialize( $form_data ) );
|
| 162 |
$form = array();
|
| 163 |
-
$value = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Option title',
|
| 164 |
-
'wpcf' ) . ' 1';
|
| 165 |
$value = isset( $form_data['title'] ) ? $form_data['title'] : $value;
|
| 166 |
$form[$id . '-id'] = $id;
|
| 167 |
$form[$id . '-title'] = array(
|
|
@@ -173,6 +172,7 @@ function wpcf_fields_radio_get_option( $parent_name = '', $form_data = array() )
|
|
| 173 |
'#attributes' => array(
|
| 174 |
'style' => 'width:80px;',
|
| 175 |
'class' => 'wpcf-form-groups-radio-update-title-display-value',
|
|
|
|
| 176 |
),
|
| 177 |
'#before' => '<div class="js-types-sortable"><img src="'
|
| 178 |
. WPCF_RES_RELPATH
|
|
@@ -187,7 +187,7 @@ function wpcf_fields_radio_get_option( $parent_name = '', $form_data = array() )
|
|
| 187 |
. '-display-value-wrapper\').fadeOut(function(){jQuery(this).remove();}); }"'
|
| 188 |
. 'alt="' . __( 'Delete this option', 'wpcf' ) . '" />',
|
| 189 |
);
|
| 190 |
-
$value = isset( $_GET['count'] ) ? $_GET['count'] : 1;
|
| 191 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 192 |
$form[$id . '-value'] = array(
|
| 193 |
'#type' => 'textfield',
|
|
@@ -198,6 +198,7 @@ function wpcf_fields_radio_get_option( $parent_name = '', $form_data = array() )
|
|
| 198 |
'#attributes' => array(
|
| 199 |
'style' => 'width:80px;',
|
| 200 |
'class' => 'wpcf-compare-unique-value',
|
|
|
|
| 201 |
),
|
| 202 |
);
|
| 203 |
$form[$id . '-default'] = array(
|
|
@@ -223,10 +224,10 @@ function wpcf_fields_radio_get_option( $parent_name = '', $form_data = array() )
|
|
| 223 |
function wpcf_fields_radio_get_option_alt_text( $id, $parent_name = '',
|
| 224 |
$form_data = array() ) {
|
| 225 |
$form = array();
|
| 226 |
-
$title = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Option title',
|
| 227 |
'wpcf' ) . ' 1';
|
| 228 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 229 |
-
$value = isset( $_GET['count'] ) ? $_GET['count'] : 1;
|
| 230 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 231 |
$value = isset( $form_data['display_value'] ) ? $form_data['display_value'] : $value;
|
| 232 |
$form[$id . '-display-value'] = array(
|
|
@@ -238,6 +239,9 @@ function wpcf_fields_radio_get_option_alt_text( $id, $parent_name = '',
|
|
| 238 |
'#inline' => true,
|
| 239 |
'#before' => '<div id="' . $id . '-title-display-value-wrapper">',
|
| 240 |
'#after' => '</div>',
|
|
|
|
|
|
|
|
|
|
| 241 |
);
|
| 242 |
return $form;
|
| 243 |
-
}
|
| 160 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-radio-option-'
|
| 161 |
. wpcf_unique_id( serialize( $form_data ) );
|
| 162 |
$form = array();
|
| 163 |
+
$value = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . intval( $_GET['count'] ) : __( 'Option title', 'wpcf' ) . ' 1';
|
|
|
|
| 164 |
$value = isset( $form_data['title'] ) ? $form_data['title'] : $value;
|
| 165 |
$form[$id . '-id'] = $id;
|
| 166 |
$form[$id . '-title'] = array(
|
| 172 |
'#attributes' => array(
|
| 173 |
'style' => 'width:80px;',
|
| 174 |
'class' => 'wpcf-form-groups-radio-update-title-display-value',
|
| 175 |
+
'placeholder' => __('Title', 'wpcf'),
|
| 176 |
),
|
| 177 |
'#before' => '<div class="js-types-sortable"><img src="'
|
| 178 |
. WPCF_RES_RELPATH
|
| 187 |
. '-display-value-wrapper\').fadeOut(function(){jQuery(this).remove();}); }"'
|
| 188 |
. 'alt="' . __( 'Delete this option', 'wpcf' ) . '" />',
|
| 189 |
);
|
| 190 |
+
$value = isset( $_GET['count'] ) ? intval( $_GET['count'] ) : 1;
|
| 191 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 192 |
$form[$id . '-value'] = array(
|
| 193 |
'#type' => 'textfield',
|
| 198 |
'#attributes' => array(
|
| 199 |
'style' => 'width:80px;',
|
| 200 |
'class' => 'wpcf-compare-unique-value',
|
| 201 |
+
'placeholder' => __('Value', 'wpcf'),
|
| 202 |
),
|
| 203 |
);
|
| 204 |
$form[$id . '-default'] = array(
|
| 224 |
function wpcf_fields_radio_get_option_alt_text( $id, $parent_name = '',
|
| 225 |
$form_data = array() ) {
|
| 226 |
$form = array();
|
| 227 |
+
$title = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . intval( $_GET['count'] ) : __( 'Option title',
|
| 228 |
'wpcf' ) . ' 1';
|
| 229 |
$title = isset( $form_data['title'] ) ? $form_data['title'] : $title;
|
| 230 |
+
$value = isset( $_GET['count'] ) ? intval( $_GET['count'] ) : 1;
|
| 231 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 232 |
$value = isset( $form_data['display_value'] ) ? $form_data['display_value'] : $value;
|
| 233 |
$form[$id . '-display-value'] = array(
|
| 239 |
'#inline' => true,
|
| 240 |
'#before' => '<div id="' . $id . '-title-display-value-wrapper">',
|
| 241 |
'#after' => '</div>',
|
| 242 |
+
'#attributes' => array(
|
| 243 |
+
'placeholder' => __('Value to display', 'wpcf'),
|
| 244 |
+
),
|
| 245 |
);
|
| 246 |
return $form;
|
| 247 |
+
}
|
includes/fields/select.php
CHANGED
|
@@ -93,8 +93,7 @@ function wpcf_fields_select_get_option( $parent_name = '', $form_data = array()
|
|
| 93 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-select-option-'
|
| 94 |
. wpcf_unique_id( serialize( $form_data ) );
|
| 95 |
$form = array();
|
| 96 |
-
$value = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . $_GET['count'] : __( 'Option title',
|
| 97 |
-
'wpcf' ) . ' 1';
|
| 98 |
$value = isset( $form_data['title'] ) ? $form_data['title'] : $value;
|
| 99 |
$form[$id . '-title'] = array(
|
| 100 |
'#type' => 'textfield',
|
|
@@ -102,7 +101,10 @@ function wpcf_fields_select_get_option( $parent_name = '', $form_data = array()
|
|
| 102 |
'#name' => $parent_name . '[options][' . $id . '][title]',
|
| 103 |
'#value' => $value,
|
| 104 |
'#inline' => true,
|
| 105 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
| 106 |
'#before' => '<div class="js-types-sortable"><img src="'
|
| 107 |
. WPCF_RES_RELPATH
|
| 108 |
. '/images/move.png" class="js-types-sort-button" alt="'
|
|
@@ -113,7 +115,7 @@ function wpcf_fields_select_get_option( $parent_name = '', $form_data = array()
|
|
| 113 |
. '\')) { jQuery(this).parent().fadeOut(function(){jQuery(this).remove();}); }"'
|
| 114 |
. 'alt="' . __( 'Delete this option', 'wpcf' ) . '" />',
|
| 115 |
);
|
| 116 |
-
$value = isset( $_GET['count'] ) ? $_GET['count'] : 1;
|
| 117 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 118 |
$form[$id . '-value'] = array(
|
| 119 |
'#type' => 'textfield',
|
|
@@ -124,6 +126,7 @@ function wpcf_fields_select_get_option( $parent_name = '', $form_data = array()
|
|
| 124 |
'#attributes' => array(
|
| 125 |
'style' => 'width:80px;',
|
| 126 |
'class' => 'wpcf-compare-unique-value',
|
|
|
|
| 127 |
),
|
| 128 |
);
|
| 129 |
$form[$id . '-default'] = array(
|
|
@@ -137,4 +140,4 @@ function wpcf_fields_select_get_option( $parent_name = '', $form_data = array()
|
|
| 137 |
'#default_value' => isset( $form_data['default'] ) ? $form_data['default'] : false,
|
| 138 |
);
|
| 139 |
return $form;
|
| 140 |
-
}
|
| 93 |
$id = isset( $form_data['key'] ) ? $form_data['key'] : 'wpcf-fields-select-option-'
|
| 94 |
. wpcf_unique_id( serialize( $form_data ) );
|
| 95 |
$form = array();
|
| 96 |
+
$value = isset( $_GET['count'] ) ? __( 'Option title', 'wpcf' ) . ' ' . intval( $_GET['count'] ) : __( 'Option title', 'wpcf' ) . ' 1';
|
|
|
|
| 97 |
$value = isset( $form_data['title'] ) ? $form_data['title'] : $value;
|
| 98 |
$form[$id . '-title'] = array(
|
| 99 |
'#type' => 'textfield',
|
| 101 |
'#name' => $parent_name . '[options][' . $id . '][title]',
|
| 102 |
'#value' => $value,
|
| 103 |
'#inline' => true,
|
| 104 |
+
'#attributes' => array(
|
| 105 |
+
'style' => 'width:80px;',
|
| 106 |
+
'placeholder' => __('Title', 'wpcf'),
|
| 107 |
+
),
|
| 108 |
'#before' => '<div class="js-types-sortable"><img src="'
|
| 109 |
. WPCF_RES_RELPATH
|
| 110 |
. '/images/move.png" class="js-types-sort-button" alt="'
|
| 115 |
. '\')) { jQuery(this).parent().fadeOut(function(){jQuery(this).remove();}); }"'
|
| 116 |
. 'alt="' . __( 'Delete this option', 'wpcf' ) . '" />',
|
| 117 |
);
|
| 118 |
+
$value = isset( $_GET['count'] ) ? intval( $_GET['count'] ) : 1;
|
| 119 |
$value = isset( $form_data['value'] ) ? $form_data['value'] : $value;
|
| 120 |
$form[$id . '-value'] = array(
|
| 121 |
'#type' => 'textfield',
|
| 126 |
'#attributes' => array(
|
| 127 |
'style' => 'width:80px;',
|
| 128 |
'class' => 'wpcf-compare-unique-value',
|
| 129 |
+
'placeholder' => __('Value', 'wpcf'),
|
| 130 |
),
|
| 131 |
);
|
| 132 |
$form[$id . '-default'] = array(
|
| 140 |
'#default_value' => isset( $form_data['default'] ) ? $form_data['default'] : false,
|
| 141 |
);
|
| 142 |
return $form;
|
| 143 |
+
}
|
includes/import-export.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Import/export data.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -29,7 +29,7 @@ function wpcf_admin_import_export_form()
|
|
| 29 |
$show_first_screen = false;
|
| 30 |
if ( isset( $_POST['import-final'] ) ) {
|
| 31 |
if ( $_POST['mode'] == 'file' && !empty( $_POST['file'] ) ) {
|
| 32 |
-
$file = get_transient( $_POST['file'] );
|
| 33 |
if ( file_exists($file) ) {
|
| 34 |
$info = pathinfo($file);
|
| 35 |
$is_zip = $info['extension'] == 'zip' ? true : false;
|
|
@@ -70,7 +70,7 @@ function wpcf_admin_import_export_form()
|
|
| 70 |
}
|
| 71 |
}
|
| 72 |
if ( $_POST['mode'] == 'text' && !empty( $_POST['text'] ) ) {
|
| 73 |
-
$charset = !empty( $_POST['text-encoding'] ) ? $_POST['text-encoding'] : get_option( 'blog_charset' );
|
| 74 |
wpcf_admin_import_data( stripslashes( html_entity_decode( $_POST['text'],
|
| 75 |
ENT_QUOTES, $charset ) ) );
|
| 76 |
}
|
|
@@ -143,7 +143,7 @@ function wpcf_admin_import_export_form()
|
|
| 143 |
$match ) ) {
|
| 144 |
$charset = trim( $match[1], '"' );
|
| 145 |
} else {
|
| 146 |
-
$charset = !empty( $_POST['text-encoding'] ) ? $_POST['text-encoding'] : get_option( 'blog_charset' );
|
| 147 |
}
|
| 148 |
$form['text'] = array(
|
| 149 |
'#type' => 'hidden',
|
|
@@ -303,7 +303,7 @@ function wpcf_admin_import_export_file_upload_error($file, $error_msg)
|
|
| 303 |
/**
|
| 304 |
* Import settings.
|
| 305 |
*
|
| 306 |
-
* @global
|
| 307 |
* @param SimpleXMLElement $data
|
| 308 |
* @return string
|
| 309 |
*/
|
|
@@ -385,10 +385,13 @@ function wpcf_admin_import_export_settings($data)
|
|
| 385 |
'#inline' => true,
|
| 386 |
'#after' => '<br />',
|
| 387 |
);
|
| 388 |
-
$post = $wpdb->get_var(
|
| 389 |
-
|
| 390 |
-
WHERE post_title = %s AND post_type = %s",
|
| 391 |
-
|
|
|
|
|
|
|
|
|
|
| 392 |
if ( !empty( $post ) ) {
|
| 393 |
$form['group-add-' . $group['ID']]['#after'] = wpcf_form_simple(
|
| 394 |
array('group-add-update-' . $group['ID'] => array(
|
|
@@ -491,10 +494,13 @@ function wpcf_admin_import_export_settings($data)
|
|
| 491 |
'#inline' => true,
|
| 492 |
'#after' => '<br /><br />',
|
| 493 |
);
|
| 494 |
-
$post = $wpdb->get_var(
|
| 495 |
-
|
| 496 |
-
WHERE post_title = %s AND post_type = %s",
|
| 497 |
-
|
|
|
|
|
|
|
|
|
|
| 498 |
if ( !empty( $post ) ) {
|
| 499 |
$form['user-group-add-' . $group['ID']]['#after'] = wpcf_form_simple(
|
| 500 |
array('user-group-add-update-' . $group['ID'] => array(
|
| 2 |
/*
|
| 3 |
* Import/export data.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/import-export.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 29 |
$show_first_screen = false;
|
| 30 |
if ( isset( $_POST['import-final'] ) ) {
|
| 31 |
if ( $_POST['mode'] == 'file' && !empty( $_POST['file'] ) ) {
|
| 32 |
+
$file = get_transient( sanitize_text_field( $_POST['file'] ) );
|
| 33 |
if ( file_exists($file) ) {
|
| 34 |
$info = pathinfo($file);
|
| 35 |
$is_zip = $info['extension'] == 'zip' ? true : false;
|
| 70 |
}
|
| 71 |
}
|
| 72 |
if ( $_POST['mode'] == 'text' && !empty( $_POST['text'] ) ) {
|
| 73 |
+
$charset = !empty( $_POST['text-encoding'] ) ? sanitize_text_field( $_POST['text-encoding'] ) : get_option( 'blog_charset' );
|
| 74 |
wpcf_admin_import_data( stripslashes( html_entity_decode( $_POST['text'],
|
| 75 |
ENT_QUOTES, $charset ) ) );
|
| 76 |
}
|
| 143 |
$match ) ) {
|
| 144 |
$charset = trim( $match[1], '"' );
|
| 145 |
} else {
|
| 146 |
+
$charset = !empty( $_POST['text-encoding'] ) ? sanitize_text_field( $_POST['text-encoding'] ) : get_option( 'blog_charset' );
|
| 147 |
}
|
| 148 |
$form['text'] = array(
|
| 149 |
'#type' => 'hidden',
|
| 303 |
/**
|
| 304 |
* Import settings.
|
| 305 |
*
|
| 306 |
+
* @global object $wpdb
|
| 307 |
* @param SimpleXMLElement $data
|
| 308 |
* @return string
|
| 309 |
*/
|
| 385 |
'#inline' => true,
|
| 386 |
'#after' => '<br />',
|
| 387 |
);
|
| 388 |
+
$post = $wpdb->get_var(
|
| 389 |
+
$wpdb->prepare(
|
| 390 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type = %s",
|
| 391 |
+
$group['post_title'],
|
| 392 |
+
$group['post_type']
|
| 393 |
+
)
|
| 394 |
+
);
|
| 395 |
if ( !empty( $post ) ) {
|
| 396 |
$form['group-add-' . $group['ID']]['#after'] = wpcf_form_simple(
|
| 397 |
array('group-add-update-' . $group['ID'] => array(
|
| 494 |
'#inline' => true,
|
| 495 |
'#after' => '<br /><br />',
|
| 496 |
);
|
| 497 |
+
$post = $wpdb->get_var(
|
| 498 |
+
$wpdb->prepare(
|
| 499 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type = %s",
|
| 500 |
+
$group['post_title'],
|
| 501 |
+
$group['post_type']
|
| 502 |
+
)
|
| 503 |
+
);
|
| 504 |
if ( !empty( $post ) ) {
|
| 505 |
$form['user-group-add-' . $group['ID']]['#after'] = wpcf_form_simple(
|
| 506 |
array('user-group-add-update-' . $group['ID'] => array(
|
includes/migration.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Migration functions
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate:
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -12,11 +12,12 @@
|
|
| 12 |
/**
|
| 13 |
* Migration form.
|
| 14 |
*
|
|
|
|
|
|
|
| 15 |
* @return array
|
| 16 |
*/
|
| 17 |
-
function wpcf_admin_migration_form()
|
| 18 |
-
|
| 19 |
-
|
| 20 |
global $wpdb;
|
| 21 |
$wpcf_types = get_option('wpcf-custom-types', array());
|
| 22 |
$wpcf_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
|
@@ -35,7 +36,7 @@ function wpcf_admin_migration_form() {
|
|
| 35 |
if (!empty($cfui_types)) {
|
| 36 |
$form['types_title'] = array(
|
| 37 |
'#type' => 'markup',
|
| 38 |
-
'#markup' => '<h3>' . __('Custom Types UI Post Types') . '</h3>',
|
| 39 |
);
|
| 40 |
|
| 41 |
foreach ($cfui_types as $key => $cfui_type) {
|
|
@@ -43,8 +44,6 @@ function wpcf_admin_migration_form() {
|
|
| 43 |
$wpcf_types);
|
| 44 |
if ($exists) {
|
| 45 |
$attributes = array('readonly' => 'readonly', 'disabled' => 'disabled');
|
| 46 |
-
// wpcf_admin_message(sprintf(__("Custom Post Type %s will not be imported because post type with same name exist in Types",
|
| 47 |
-
// 'wpcf'), $cfui_type['label']), 'error');
|
| 48 |
$add = __('(exists)', 'wpcf');
|
| 49 |
} else {
|
| 50 |
$attributes = array();
|
|
@@ -76,8 +75,6 @@ function wpcf_admin_migration_form() {
|
|
| 76 |
$wpcf_taxonomies);
|
| 77 |
if ($exists) {
|
| 78 |
$attributes = array('readonly' => 'readonly', 'disabled' => 'disabled');
|
| 79 |
-
// wpcf_admin_message(sprintf(__("Custom Taxonomy %s will not be imported because taxonomy with same name exist in Types",
|
| 80 |
-
// 'wpcf'), $title), 'error');
|
| 81 |
$add = __('(exists)', 'wpcf');
|
| 82 |
} else {
|
| 83 |
$attributes = array();
|
|
@@ -108,9 +105,6 @@ function wpcf_admin_migration_form() {
|
|
| 108 |
);
|
| 109 |
};
|
| 110 |
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
// ACF
|
| 115 |
|
| 116 |
$acf_groups = get_posts('post_type=acf&status=publish&numberposts=-1');
|
|
@@ -149,8 +143,12 @@ function wpcf_admin_migration_form() {
|
|
| 149 |
}
|
| 150 |
|
| 151 |
foreach ($acf_groups as $acf_key => $acf_post) {
|
| 152 |
-
$group_id = $wpdb->get_var(
|
| 153 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 154 |
if (empty($group_id)) {
|
| 155 |
$add = __('Group will be created', 'wpcf');
|
| 156 |
} else {
|
|
@@ -234,12 +232,6 @@ function wpcf_admin_migration_form() {
|
|
| 234 |
'#name' => 'acf_posts[' . $acf_post->ID . '][fields][' . $meta_name . '][slug]',
|
| 235 |
'#value' => esc_attr($data['name']),
|
| 236 |
);
|
| 237 |
-
// @todo Not supported yet
|
| 238 |
-
// $form[$acf_post->ID . '_acf_field_' . $meta_name . '_details_order'] = array(
|
| 239 |
-
// '#type' => 'hidden',
|
| 240 |
-
// '#name' => 'acf_posts[' . $acf_post->ID . '][fields][' . $meta_name . '][order]',
|
| 241 |
-
// '#value' => esc_attr($data['order']),
|
| 242 |
-
// );
|
| 243 |
// Add options for radios and select
|
| 244 |
if (in_array($data['type'], array('radio', 'select'))
|
| 245 |
&& !empty($data['choices'])) {
|
|
@@ -253,9 +245,9 @@ function wpcf_admin_migration_form() {
|
|
| 253 |
$option_value = trim($temp[0]);
|
| 254 |
$option_title = trim($temp[1]);
|
| 255 |
}
|
| 256 |
-
|
| 257 |
$_key = sanitize_title($option_value);
|
| 258 |
-
|
| 259 |
$form[$acf_post->ID . '_acf_field_' . $meta_name . '_option_' . $_key . '_value'] = array(
|
| 260 |
'#type' => 'hidden',
|
| 261 |
'#name' => 'acf_posts[' . $acf_post->ID . '][fields][' . $meta_name . '][options][' . $_key . '][value]',
|
|
@@ -278,9 +270,6 @@ function wpcf_admin_migration_form() {
|
|
| 278 |
if (($exists && !$outsider) || !$supported) {
|
| 279 |
$attributes = array('disabled' => 'disabled');
|
| 280 |
if ($exists) {
|
| 281 |
-
// wpcf_admin_message(sprintf(__("Field %s will not be imported because field with same name exist in Types",
|
| 282 |
-
// 'wpcf'), $data['label']),
|
| 283 |
-
// 'error');
|
| 284 |
}
|
| 285 |
} else {
|
| 286 |
$attributes = array();
|
|
@@ -369,6 +358,7 @@ function wpcf_admin_migration_form_submit() {
|
|
| 369 |
$wpcf_types[$types_slug]['taxonomies'] = array();
|
| 370 |
}
|
| 371 |
$wpcf_types[$types_slug]['taxonomies'][$tax_slug] = 1;
|
|
|
|
| 372 |
}
|
| 373 |
}
|
| 374 |
|
|
@@ -389,9 +379,14 @@ function wpcf_admin_migration_form_submit() {
|
|
| 389 |
continue;
|
| 390 |
}
|
| 391 |
global $wpdb;
|
| 392 |
-
$group = $wpdb->get_row(
|
| 393 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 394 |
if (empty($group)) {
|
|
|
|
| 395 |
$group = array();
|
| 396 |
$group['name'] = $_POST['acf_posts'][$acf_group_id]['post_title'];
|
| 397 |
$group['description'] = $_POST['acf_posts'][$acf_group_id]['post_content'];
|
|
@@ -449,9 +444,9 @@ function wpcf_admin_migration_form_submit() {
|
|
| 449 |
|
| 450 |
/**
|
| 451 |
* Gets types data.
|
| 452 |
-
*
|
| 453 |
* @param type $cfui_type
|
| 454 |
-
* @return type
|
| 455 |
*/
|
| 456 |
function wpcf_admin_migrate_get_cfui_type_data($cfui_type) {
|
| 457 |
$cfui_types_migrated = array();
|
|
@@ -538,9 +533,9 @@ function wpcf_admin_migrate_get_cfui_type_data($cfui_type) {
|
|
| 538 |
|
| 539 |
/**
|
| 540 |
* Gets taxonomies data.
|
| 541 |
-
*
|
| 542 |
* @param type $cfui_tax
|
| 543 |
-
* @return type
|
| 544 |
*/
|
| 545 |
function wpcf_admin_migrate_get_cfui_tax_data($cfui_tax) {
|
| 546 |
$cfui_tax_migrated = array();
|
| 2 |
/*
|
| 3 |
* Migration functions
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/migration.php $
|
| 6 |
+
* $LastChangedDate: 2015-04-01 14:15:17 +0000 (Wed, 01 Apr 2015) $
|
| 7 |
+
* $LastChangedRevision: 1125405 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 12 |
/**
|
| 13 |
* Migration form.
|
| 14 |
*
|
| 15 |
+
* @global object $wpdb
|
| 16 |
+
*
|
| 17 |
* @return array
|
| 18 |
*/
|
| 19 |
+
function wpcf_admin_migration_form()
|
| 20 |
+
{
|
|
|
|
| 21 |
global $wpdb;
|
| 22 |
$wpcf_types = get_option('wpcf-custom-types', array());
|
| 23 |
$wpcf_taxonomies = get_option('wpcf-custom-taxonomies', array());
|
| 36 |
if (!empty($cfui_types)) {
|
| 37 |
$form['types_title'] = array(
|
| 38 |
'#type' => 'markup',
|
| 39 |
+
'#markup' => '<h3>' . __('Custom Types UI Post Types', 'wpcf') . '</h3>',
|
| 40 |
);
|
| 41 |
|
| 42 |
foreach ($cfui_types as $key => $cfui_type) {
|
| 44 |
$wpcf_types);
|
| 45 |
if ($exists) {
|
| 46 |
$attributes = array('readonly' => 'readonly', 'disabled' => 'disabled');
|
|
|
|
|
|
|
| 47 |
$add = __('(exists)', 'wpcf');
|
| 48 |
} else {
|
| 49 |
$attributes = array();
|
| 75 |
$wpcf_taxonomies);
|
| 76 |
if ($exists) {
|
| 77 |
$attributes = array('readonly' => 'readonly', 'disabled' => 'disabled');
|
|
|
|
|
|
|
| 78 |
$add = __('(exists)', 'wpcf');
|
| 79 |
} else {
|
| 80 |
$attributes = array();
|
| 105 |
);
|
| 106 |
};
|
| 107 |
|
|
|
|
|
|
|
|
|
|
| 108 |
// ACF
|
| 109 |
|
| 110 |
$acf_groups = get_posts('post_type=acf&status=publish&numberposts=-1');
|
| 143 |
}
|
| 144 |
|
| 145 |
foreach ($acf_groups as $acf_key => $acf_post) {
|
| 146 |
+
$group_id = $wpdb->get_var(
|
| 147 |
+
$wpdb->prepare(
|
| 148 |
+
"SELECT ID FROM $wpdb->posts WHERE post_title = %s AND post_type='wp-types-group'",
|
| 149 |
+
$acf_post->post_title
|
| 150 |
+
)
|
| 151 |
+
);
|
| 152 |
if (empty($group_id)) {
|
| 153 |
$add = __('Group will be created', 'wpcf');
|
| 154 |
} else {
|
| 232 |
'#name' => 'acf_posts[' . $acf_post->ID . '][fields][' . $meta_name . '][slug]',
|
| 233 |
'#value' => esc_attr($data['name']),
|
| 234 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 235 |
// Add options for radios and select
|
| 236 |
if (in_array($data['type'], array('radio', 'select'))
|
| 237 |
&& !empty($data['choices'])) {
|
| 245 |
$option_value = trim($temp[0]);
|
| 246 |
$option_title = trim($temp[1]);
|
| 247 |
}
|
| 248 |
+
|
| 249 |
$_key = sanitize_title($option_value);
|
| 250 |
+
|
| 251 |
$form[$acf_post->ID . '_acf_field_' . $meta_name . '_option_' . $_key . '_value'] = array(
|
| 252 |
'#type' => 'hidden',
|
| 253 |
'#name' => 'acf_posts[' . $acf_post->ID . '][fields][' . $meta_name . '][options][' . $_key . '][value]',
|
| 270 |
if (($exists && !$outsider) || !$supported) {
|
| 271 |
$attributes = array('disabled' => 'disabled');
|
| 272 |
if ($exists) {
|
|
|
|
|
|
|
|
|
|
| 273 |
}
|
| 274 |
} else {
|
| 275 |
$attributes = array();
|
| 358 |
$wpcf_types[$types_slug]['taxonomies'] = array();
|
| 359 |
}
|
| 360 |
$wpcf_types[$types_slug]['taxonomies'][$tax_slug] = 1;
|
| 361 |
+
$wpcf_types[$types_slug][TOOLSET_EDIT_LAST] = time();
|
| 362 |
}
|
| 363 |
}
|
| 364 |
|
| 379 |
continue;
|
| 380 |
}
|
| 381 |
global $wpdb;
|
| 382 |
+
$group = $wpdb->get_row(
|
| 383 |
+
$wpdb->prepare(
|
| 384 |
+
"SELECT ID, post_title FROM $wpdb->posts WHERE post_title = %s AND post_type='wp-types-group'",
|
| 385 |
+
$_POST['acf_posts'][$acf_group_id]['post_title']
|
| 386 |
+
)
|
| 387 |
+
);
|
| 388 |
if (empty($group)) {
|
| 389 |
+
// @todo Maybe sanitize here
|
| 390 |
$group = array();
|
| 391 |
$group['name'] = $_POST['acf_posts'][$acf_group_id]['post_title'];
|
| 392 |
$group['description'] = $_POST['acf_posts'][$acf_group_id]['post_content'];
|
| 444 |
|
| 445 |
/**
|
| 446 |
* Gets types data.
|
| 447 |
+
*
|
| 448 |
* @param type $cfui_type
|
| 449 |
+
* @return type
|
| 450 |
*/
|
| 451 |
function wpcf_admin_migrate_get_cfui_type_data($cfui_type) {
|
| 452 |
$cfui_types_migrated = array();
|
| 533 |
|
| 534 |
/**
|
| 535 |
* Gets taxonomies data.
|
| 536 |
+
*
|
| 537 |
* @param type $cfui_tax
|
| 538 |
+
* @return type
|
| 539 |
*/
|
| 540 |
function wpcf_admin_migrate_get_cfui_tax_data($cfui_tax) {
|
| 541 |
$cfui_tax_migrated = array();
|
includes/post-relationship.php
CHANGED
|
@@ -1,200 +1,41 @@
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
* Post relationship code.
|
| 4 |
-
*
|
| 5 |
*/
|
| 6 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
| 7 |
-
add_filter( 'wpcf_post_type_form', 'wpcf_pr_post_type_form_filter', 10, 2 );
|
| 8 |
add_action( 'wpcf_custom_types_save', 'wpcf_pr_custom_types_save_action' );
|
| 9 |
|
| 10 |
/**
|
| 11 |
-
* Init funtion.
|
| 12 |
*/
|
| 13 |
function wpcf_post_relationship_init() {
|
| 14 |
add_thickbox();
|
| 15 |
wp_enqueue_script( 'wpcf-post-relationship',
|
| 16 |
WPCF_EMBEDDED_RELPATH . '/resources/js/post-relationship.js',
|
| 17 |
array('jquery'), WPCF_VERSION );
|
|
|
|
| 18 |
}
|
| 19 |
|
| 20 |
/**
|
| 21 |
-
*
|
| 22 |
-
*
|
| 23 |
-
* @param type $form
|
| 24 |
-
* @param type $post_type
|
| 25 |
-
* @return string
|
| 26 |
*/
|
| 27 |
-
function wpcf_pr_post_type_form_filter( $form, $post_type ) {
|
| 28 |
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
if ( empty( $has ) || empty( $post_type['slug'] ) ) {
|
| 36 |
-
$txt_has = __( "Children: None", 'wpcf' );
|
| 37 |
-
} else {
|
| 38 |
-
$txt_has = array();
|
| 39 |
-
foreach ( $has as $pr_key => $pr_data ) {
|
| 40 |
-
$txt_has[] = isset( $post_types[$pr_key] ) ? $post_types[$pr_key]->labels->singular_name : $pr_key;
|
| 41 |
-
}
|
| 42 |
-
$txt_has = sprintf( __( "Children: %s", 'wpcf' ),
|
| 43 |
-
implode( ', ', $txt_has ) );
|
| 44 |
-
}
|
| 45 |
-
wpcf_admin_add_js_settings( 'wpcf_pr_has_empty_txt',
|
| 46 |
-
'\'' . __( "Children: None", 'wpcf' ) . '\'' );
|
| 47 |
-
wpcf_admin_add_js_settings( 'wpcf_pr_has_txt',
|
| 48 |
-
'\'' . __( "Children: %s", 'wpcf' ) . '\'' );
|
| 49 |
-
// Others belonging to
|
| 50 |
-
if ( !empty( $belongs ) ) {
|
| 51 |
-
$txt_belongs = array();
|
| 52 |
-
foreach ( $belongs as $pr_key => $pr_data ) {
|
| 53 |
-
$txt_belongs[] = isset( $post_types[$pr_key] ) ? $post_types[$pr_key]->labels->singular_name : $pr_key;
|
| 54 |
-
}
|
| 55 |
-
$txt_belongs = sprintf( __( "Parent: %s", 'wpcf' ),
|
| 56 |
-
implode( ', ', $txt_belongs ) );
|
| 57 |
-
} else {
|
| 58 |
-
$txt_belongs = __( "Parent: None", 'wpcf' );
|
| 59 |
-
}
|
| 60 |
-
wpcf_admin_add_js_settings( 'wpcf_pr_belongs_empty_txt',
|
| 61 |
-
'\'' . __( "Parent: None", 'wpcf' ) . '\'' );
|
| 62 |
-
wpcf_admin_add_js_settings( 'wpcf_pr_belongs_txt',
|
| 63 |
-
'\'' . __( "Parent: %s", 'wpcf' ) . '\'' );
|
| 64 |
-
|
| 65 |
-
$form['table-pr-open'] = array(
|
| 66 |
-
'#type' => 'markup',
|
| 67 |
-
'#markup' => '<table id="wpcf-types-form-pr-table" class="wpcf-types-form-table widefat"><thead><tr><th>'
|
| 68 |
-
. __( 'Post Relationship', 'wpcf' ) . '</th></tr></thead><tbody><tr><td>',
|
| 69 |
-
);
|
| 70 |
-
$form['table-pr-belongs'] = array(
|
| 71 |
-
'#type' => 'markup',
|
| 72 |
-
'#markup' => '<div style="margin: 10px 0 10px 0;"><span class="wpcf-pr-belongs-summary">' . $txt_belongs . '</span> '
|
| 73 |
-
. '<a href="javascript:void(0);" id="wpcf-pr-belongs-edit" class="button-secondary wpcf-pr-edit">'
|
| 74 |
-
. __( 'Edit', 'wpcf' ) . '</a>',
|
| 75 |
-
);
|
| 76 |
-
|
| 77 |
-
$options = array();
|
| 78 |
-
|
| 79 |
-
/**
|
| 80 |
-
* build excluded post types
|
| 81 |
-
*/
|
| 82 |
-
$excluded_post_types = $wpcf->excluded_post_types;
|
| 83 |
-
$excluded_post_types[] = $post_type['slug'];
|
| 84 |
-
|
| 85 |
-
foreach ( $post_types as $temp_post_type_slug => $temp_post_type ) {
|
| 86 |
-
if (
|
| 87 |
-
in_array( $temp_post_type_slug, $excluded_post_types )
|
| 88 |
-
|| (
|
| 89 |
-
!$temp_post_type->show_ui
|
| 90 |
-
&& !apply_filters('wpcf_show_ui_hide_in_relationships', true)
|
| 91 |
-
)
|
| 92 |
-
) {
|
| 93 |
-
continue;
|
| 94 |
-
}
|
| 95 |
-
// Check if it's in has
|
| 96 |
-
if ( isset( $has[$temp_post_type_slug] ) ) {
|
| 97 |
-
continue;
|
| 98 |
-
}
|
| 99 |
-
$options[$temp_post_type_slug]['#name'] = 'ct[post_relationship][belongs][' . $temp_post_type_slug . ']';
|
| 100 |
-
$options[$temp_post_type_slug]['#title'] = $temp_post_type->labels->singular_name;
|
| 101 |
-
$options[$temp_post_type_slug]['#default_value'] = isset( $belongs[$temp_post_type_slug] );
|
| 102 |
-
$options[$temp_post_type_slug]['#inline'] = true;
|
| 103 |
-
$options[$temp_post_type_slug]['#after'] = ' ';
|
| 104 |
-
if ( is_rtl() ) {
|
| 105 |
-
$options[$temp_post_type_slug]['#before'] = '<div style="float:right;margin-left:10px;">';
|
| 106 |
-
$options[$temp_post_type_slug]['#after'] .= '</div>';
|
| 107 |
}
|
| 108 |
}
|
| 109 |
-
$
|
| 110 |
-
'#type' => 'checkboxes',
|
| 111 |
-
'#options' => $options,
|
| 112 |
-
'#name' => 'ct[post_relationship]',
|
| 113 |
-
'#before' => '<div style="display:none; margin: 10px 0 20px 0;">',
|
| 114 |
-
'#after' => '<br /><br /><a href="javascript:void(0);" class="button-primary wpcf-pr-belongs-apply">'
|
| 115 |
-
. __( 'Apply', 'wpcf' ) . '</a> <a href="javascript:void(0);" class="button-secondary wpcf-pr-belongs-cancel">'
|
| 116 |
-
. __( 'Cancel', 'wpcf' ) . '</a></div></div>',
|
| 117 |
-
'#inline' => true,
|
| 118 |
-
);
|
| 119 |
-
$form['table-pr-has'] = array(
|
| 120 |
-
'#type' => 'markup',
|
| 121 |
-
'#markup' => '<div style="margin: 10px 0 5px 0;"><span class="wpcf-pr-has-summary">' . $txt_has . '</span> '
|
| 122 |
-
. '<a href="javascript:void(0);" id="wpcf-pr-has-edit" class="button-secondary wpcf-pr-edit">'
|
| 123 |
-
. __( 'Edit', 'wpcf' ) . '</a>',
|
| 124 |
-
);
|
| 125 |
-
$options = array();
|
| 126 |
-
foreach ( $post_types as $temp_post_type_slug => $temp_post_type ) {
|
| 127 |
-
if (
|
| 128 |
-
in_array( $temp_post_type_slug, $excluded_post_types )
|
| 129 |
-
|| (
|
| 130 |
-
!$temp_post_type->show_ui
|
| 131 |
-
&& !apply_filters('wpcf_show_ui_hide_in_relationships', true)
|
| 132 |
-
)
|
| 133 |
-
) {
|
| 134 |
-
continue;
|
| 135 |
-
}
|
| 136 |
-
// Check if it already belongs
|
| 137 |
-
if ( isset( $belongs[$temp_post_type_slug] ) ) {
|
| 138 |
-
continue;
|
| 139 |
-
}
|
| 140 |
-
$options[$temp_post_type_slug]['#name'] = 'ct[post_relationship][has][' . $temp_post_type_slug . ']';
|
| 141 |
-
$options[$temp_post_type_slug]['#title'] = $temp_post_type->labels->singular_name;
|
| 142 |
-
$options[$temp_post_type_slug]['#default_value'] = isset( $has[$temp_post_type_slug] );
|
| 143 |
-
$options[$temp_post_type_slug]['#inline'] = true;
|
| 144 |
-
$options[$temp_post_type_slug]['#after'] = isset( $has[$temp_post_type_slug] ) ? ''
|
| 145 |
-
. '<a href="'
|
| 146 |
-
. admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=pt_edit_fields&child='
|
| 147 |
-
. $temp_post_type_slug . '&parent='
|
| 148 |
-
. $post_type['slug']
|
| 149 |
-
. '&_wpnonce='
|
| 150 |
-
. wp_create_nonce( 'pt_edit_fields' )
|
| 151 |
-
. '&KeepThis=true&TB_iframe=true' )
|
| 152 |
-
. '" class="thickbox" title="'
|
| 153 |
-
. __('Select child fields to be displayed', 'wpcf') . '">('
|
| 154 |
-
. __( 'Edit fields' ) . ')</a> ' : ''
|
| 155 |
-
. '<a href="javascript:void(0);" style="color:Gray;" title="'
|
| 156 |
-
. __( 'Please save the page first, before you can edit the child items',
|
| 157 |
-
'wpcf' ) . '">('
|
| 158 |
-
. __( 'Edit fields' ) . ')</a> ';
|
| 159 |
-
if ( is_rtl() ) {
|
| 160 |
-
$options[$temp_post_type_slug]['#before'] = '<div style="float:right;margin-left:10px;">';
|
| 161 |
-
$options[$temp_post_type_slug]['#after'] .= '</div>';
|
| 162 |
-
}
|
| 163 |
-
}
|
| 164 |
-
$form['table-pr-belongs-form'] = array(
|
| 165 |
-
'#type' => 'checkboxes',
|
| 166 |
-
'#options' => $options,
|
| 167 |
-
'#name' => 'ct[post_relationship]',
|
| 168 |
-
'#before' => '<div style="display:none; margin: 10px 0 20px 0;">',
|
| 169 |
-
'#after' => '<br /><br /><a href="javascript:void(0);" class="button-primary wpcf-pr-has-apply">'
|
| 170 |
-
. __( 'Apply', 'wpcf' ) . '</a> <a href="javascript:void(0);" class="button-secondary wpcf-pr-has-cancel">'
|
| 171 |
-
. __( 'Cancel', 'wpcf' ) . '</a></div></div>',
|
| 172 |
-
'#inline' => true,
|
| 173 |
-
);
|
| 174 |
-
$form['table-pr-close'] = array(
|
| 175 |
-
'#type' => 'markup',
|
| 176 |
-
'#markup' => '</td></tr></tbody></table>',
|
| 177 |
-
);
|
| 178 |
-
$form['table-pr-explanation'] = array(
|
| 179 |
-
'#type' => 'markup',
|
| 180 |
-
'#markup' => '<p>'
|
| 181 |
-
. __( "You can choose which fields will show when editing parent pages.",
|
| 182 |
-
'wpcf' )
|
| 183 |
-
. '<br />' . __( "Click on the 'edit' button to select them for each parent.",
|
| 184 |
-
'wpcf' )
|
| 185 |
-
. '<br />'
|
| 186 |
-
. sprintf( __( 'Learn about %sPost Type Relationships%s', 'wpcf' ),
|
| 187 |
-
'<a href="http://wp-types.com/documentation/user-guides/creating-post-type-relationships/" target="_blank">',
|
| 188 |
-
' »</a>' )
|
| 189 |
-
. '</p>',
|
| 190 |
-
);
|
| 191 |
-
return $form;
|
| 192 |
}
|
| 193 |
|
| 194 |
/**
|
| 195 |
* Saves relationships.
|
| 196 |
-
*
|
| 197 |
-
* @param type $data
|
| 198 |
*/
|
| 199 |
function wpcf_pr_custom_types_save_action( $data ) {
|
| 200 |
$relationships = get_option( 'wpcf_post_relationship', array() );
|
|
@@ -238,13 +79,11 @@ function wpcf_pr_custom_types_save_action( $data ) {
|
|
| 238 |
|
| 239 |
/**
|
| 240 |
* Edit fields form.
|
| 241 |
-
*
|
| 242 |
-
* @global type $wpdb
|
| 243 |
* @param type $parent
|
| 244 |
-
* @param type $child
|
| 245 |
*/
|
| 246 |
function wpcf_pr_admin_edit_fields( $parent, $child ) {
|
| 247 |
-
global $wpdb;
|
| 248 |
|
| 249 |
$post_type_parent = get_post_type_object( $parent );
|
| 250 |
$post_type_child = get_post_type_object( $child );
|
|
@@ -261,7 +100,8 @@ function wpcf_pr_admin_edit_fields( $parent, $child ) {
|
|
| 261 |
wpcf_admin_ajax_head( 'Edit fields', 'wpcf' );
|
| 262 |
// Process submit
|
| 263 |
if ( isset( $_POST['_wpnonce'] ) && wp_verify_nonce( $_POST['_wpnonce'], 'pt_edit_fields' ) ) {
|
| 264 |
-
$relationships[$parent][$child]['fields_setting'] = $_POST['fields_setting'];
|
|
|
|
| 265 |
$relationships[$parent][$child]['fields'] = isset( $_POST['fields'] ) ? $_POST['fields'] : array();
|
| 266 |
update_option( 'wpcf_post_relationship', $relationships );
|
| 267 |
?>
|
|
@@ -376,7 +216,7 @@ function wpcf_pr_admin_edit_fields( $parent, $child ) {
|
|
| 376 |
if (jQuery('input[name="fields_setting"]:checked').val() == 'specific') {
|
| 377 |
jQuery('#wpcf-specific').show();
|
| 378 |
} else {
|
| 379 |
-
<?php if ( $repetitive_warning && 'only_list' != $form['select']['#default_value']) {
|
| 380 |
|
| 381 |
?>
|
| 382 |
jQuery('#wpcf-repetitive-warning').show();
|
|
@@ -401,3 +241,176 @@ function wpcf_pr_admin_edit_fields( $parent, $child ) {
|
|
| 401 |
<?php
|
| 402 |
wpcf_admin_ajax_footer();
|
| 403 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
<?php
|
| 2 |
/*
|
| 3 |
* Post relationship code.
|
| 4 |
+
*
|
| 5 |
*/
|
| 6 |
require_once WPCF_EMBEDDED_ABSPATH . '/includes/post-relationship.php';
|
|
|
|
| 7 |
add_action( 'wpcf_custom_types_save', 'wpcf_pr_custom_types_save_action' );
|
| 8 |
|
| 9 |
/**
|
| 10 |
+
* Init funtion.
|
| 11 |
*/
|
| 12 |
function wpcf_post_relationship_init() {
|
| 13 |
add_thickbox();
|
| 14 |
wp_enqueue_script( 'wpcf-post-relationship',
|
| 15 |
WPCF_EMBEDDED_RELPATH . '/resources/js/post-relationship.js',
|
| 16 |
array('jquery'), WPCF_VERSION );
|
| 17 |
+
add_filter('wpcf_meta_box_order_defaults', 'wpcf_post_relationship_add_metabox', 10, 2);
|
| 18 |
}
|
| 19 |
|
| 20 |
/**
|
| 21 |
+
* add metabox relationship to list
|
|
|
|
|
|
|
|
|
|
|
|
|
| 22 |
*/
|
|
|
|
| 23 |
|
| 24 |
+
function wpcf_post_relationship_add_metabox($meta_boxes, $type )
|
| 25 |
+
{
|
| 26 |
+
if ( 'post_type' == $type ) {
|
| 27 |
+
$key = 'relationship';
|
| 28 |
+
if ( !in_array($key, $meta_boxes['side']) && !in_array($key, $meta_boxes['normal'])) {
|
| 29 |
+
$meta_boxes['normal'][] = $key;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 30 |
}
|
| 31 |
}
|
| 32 |
+
return $meta_boxes;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
}
|
| 34 |
|
| 35 |
/**
|
| 36 |
* Saves relationships.
|
| 37 |
+
*
|
| 38 |
+
* @param type $data
|
| 39 |
*/
|
| 40 |
function wpcf_pr_custom_types_save_action( $data ) {
|
| 41 |
$relationships = get_option( 'wpcf_post_relationship', array() );
|
| 79 |
|
| 80 |
/**
|
| 81 |
* Edit fields form.
|
| 82 |
+
*
|
|
|
|
| 83 |
* @param type $parent
|
| 84 |
+
* @param type $child
|
| 85 |
*/
|
| 86 |
function wpcf_pr_admin_edit_fields( $parent, $child ) {
|
|
|
|
| 87 |
|
| 88 |
$post_type_parent = get_post_type_object( $parent );
|
| 89 |
$post_type_child = get_post_type_object( $child );
|
| 100 |
wpcf_admin_ajax_head( 'Edit fields', 'wpcf' );
|
| 101 |
// Process submit
|
| 102 |
if ( isset( $_POST['_wpnonce'] ) && wp_verify_nonce( $_POST['_wpnonce'], 'pt_edit_fields' ) ) {
|
| 103 |
+
$relationships[$parent][$child]['fields_setting'] = sanitize_text_field( $_POST['fields_setting'] );
|
| 104 |
+
// @todo Maybe sanitization here
|
| 105 |
$relationships[$parent][$child]['fields'] = isset( $_POST['fields'] ) ? $_POST['fields'] : array();
|
| 106 |
update_option( 'wpcf_post_relationship', $relationships );
|
| 107 |
?>
|
| 216 |
if (jQuery('input[name="fields_setting"]:checked').val() == 'specific') {
|
| 217 |
jQuery('#wpcf-specific').show();
|
| 218 |
} else {
|
| 219 |
+
<?php if ( $repetitive_warning && 'only_list' != $form['select']['#default_value']) {
|
| 220 |
|
| 221 |
?>
|
| 222 |
jQuery('#wpcf-repetitive-warning').show();
|
| 241 |
<?php
|
| 242 |
wpcf_admin_ajax_footer();
|
| 243 |
}
|
| 244 |
+
|
| 245 |
+
function wpcf_admin_metabox_relationship($post_type)
|
| 246 |
+
{
|
| 247 |
+
$form = array();
|
| 248 |
+
$form['table-pr-open'] = wpcf_admin_metabox_begin(__( 'Post Relationship', 'wpcf' ), 'relationship', 'wpcf-types-form-pr-table', false);
|
| 249 |
+
/**
|
| 250 |
+
* belongs/children section
|
| 251 |
+
*/
|
| 252 |
+
$has = wpcf_pr_admin_get_has( $post_type['slug'] );
|
| 253 |
+
$belongs = wpcf_pr_admin_get_belongs( $post_type['slug'] );
|
| 254 |
+
$post_types = get_post_types( '', 'objects' );
|
| 255 |
+
|
| 256 |
+
if ( empty( $has ) || empty( $post_type['slug'] ) ) {
|
| 257 |
+
$txt_has = __( "Children: None", 'wpcf' );
|
| 258 |
+
} else {
|
| 259 |
+
$txt_has = array();
|
| 260 |
+
foreach ( $has as $pr_key => $pr_data ) {
|
| 261 |
+
$txt_has[] = isset( $post_types[$pr_key] ) ? $post_types[$pr_key]->labels->singular_name : $pr_key;
|
| 262 |
+
}
|
| 263 |
+
$txt_has = sprintf( __( "Children: %s", 'wpcf' ), implode( ', ', $txt_has ) );
|
| 264 |
+
}
|
| 265 |
+
if ( !empty( $belongs ) ) {
|
| 266 |
+
$txt_belongs = array();
|
| 267 |
+
foreach ( $belongs as $pr_key => $pr_data ) {
|
| 268 |
+
$txt_belongs[] = isset( $post_types[$pr_key] ) ? $post_types[$pr_key]->labels->singular_name : $pr_key;
|
| 269 |
+
}
|
| 270 |
+
$txt_belongs = sprintf( __( "Parent: %s", 'wpcf' ),
|
| 271 |
+
implode( ', ', $txt_belongs ) );
|
| 272 |
+
} else {
|
| 273 |
+
$txt_belongs = __( "Parent: None", 'wpcf' );
|
| 274 |
+
}
|
| 275 |
+
// Others belonging to
|
| 276 |
+
if ( !empty( $belongs ) ) {
|
| 277 |
+
$txt_belongs = array();
|
| 278 |
+
foreach ( $belongs as $pr_key => $pr_data ) {
|
| 279 |
+
$txt_belongs[] = isset( $post_types[$pr_key] ) ? $post_types[$pr_key]->labels->singular_name : $pr_key;
|
| 280 |
+
}
|
| 281 |
+
$txt_belongs = sprintf( __( "Parent: %s", 'wpcf' ),
|
| 282 |
+
implode( ', ', $txt_belongs ) );
|
| 283 |
+
} else {
|
| 284 |
+
$txt_belongs = __( "Parent: None", 'wpcf' );
|
| 285 |
+
}
|
| 286 |
+
$form['table-pr-belongs'] = array(
|
| 287 |
+
'#type' => 'markup',
|
| 288 |
+
'#markup' => '<div style="margin: 10px 0 10px 0;"><span class="wpcf-pr-belongs-summary">' . $txt_belongs . '</span> '
|
| 289 |
+
. '<a href="javascript:void(0);" id="wpcf-pr-belongs-edit" class="button-secondary wpcf-pr-edit">'
|
| 290 |
+
. __( 'Edit', 'wpcf' ) . '</a>',
|
| 291 |
+
);
|
| 292 |
+
$options = array();
|
| 293 |
+
|
| 294 |
+
/**
|
| 295 |
+
* build excluded post types
|
| 296 |
+
*/
|
| 297 |
+
global $wpcf;
|
| 298 |
+
$excluded_post_types = $wpcf->excluded_post_types;
|
| 299 |
+
$excluded_post_types[] = $post_type['slug'];
|
| 300 |
+
|
| 301 |
+
foreach ( $post_types as $temp_post_type_slug => $temp_post_type ) {
|
| 302 |
+
if (
|
| 303 |
+
in_array( $temp_post_type_slug, $excluded_post_types )
|
| 304 |
+
|| (
|
| 305 |
+
!$temp_post_type->show_ui
|
| 306 |
+
&& !apply_filters('wpcf_show_ui_hide_in_relationships', true)
|
| 307 |
+
)
|
| 308 |
+
) {
|
| 309 |
+
continue;
|
| 310 |
+
}
|
| 311 |
+
// Check if it's in has
|
| 312 |
+
if ( isset( $has[$temp_post_type_slug] ) ) {
|
| 313 |
+
continue;
|
| 314 |
+
}
|
| 315 |
+
$options[$temp_post_type_slug]['#name'] = 'ct[post_relationship][belongs][' . $temp_post_type_slug . ']';
|
| 316 |
+
$options[$temp_post_type_slug]['#title'] = $temp_post_type->labels->singular_name;
|
| 317 |
+
$options[$temp_post_type_slug]['#default_value'] = isset( $belongs[$temp_post_type_slug] );
|
| 318 |
+
$options[$temp_post_type_slug]['#inline'] = true;
|
| 319 |
+
$options[$temp_post_type_slug]['#after'] = ' ';
|
| 320 |
+
if ( is_rtl() ) {
|
| 321 |
+
$options[$temp_post_type_slug]['#before'] = '<div style="float:right;margin-left:10px;">';
|
| 322 |
+
$options[$temp_post_type_slug]['#after'] .= '</div>';
|
| 323 |
+
}
|
| 324 |
+
}
|
| 325 |
+
$form['table-pr-has-form'] = array(
|
| 326 |
+
'#type' => 'checkboxes',
|
| 327 |
+
'#options' => $options,
|
| 328 |
+
'#name' => 'ct[post_relationship]',
|
| 329 |
+
'#before' => '<div style="display:none; margin: 10px 0 20px 0;">',
|
| 330 |
+
'#after' => '<br /><br /><a href="javascript:void(0);" class="button-primary wpcf-pr-belongs-apply">'
|
| 331 |
+
. __( 'Apply', 'wpcf' ) . '</a> <a href="javascript:void(0);" class="button-secondary wpcf-pr-belongs-cancel">'
|
| 332 |
+
. __( 'Cancel', 'wpcf' ) . '</a></div></div>',
|
| 333 |
+
'#inline' => true,
|
| 334 |
+
);
|
| 335 |
+
$form['table-pr-has'] = array(
|
| 336 |
+
'#type' => 'markup',
|
| 337 |
+
'#markup' => '<div style="margin: 10px 0 5px 0;"><span class="wpcf-pr-has-summary">' . $txt_has . '</span> '
|
| 338 |
+
. '<a href="javascript:void(0);" id="wpcf-pr-has-edit" class="button-secondary wpcf-pr-edit">'
|
| 339 |
+
. __( 'Edit', 'wpcf' ) . '</a>',
|
| 340 |
+
);
|
| 341 |
+
$options = array();
|
| 342 |
+
foreach ( $post_types as $temp_post_type_slug => $temp_post_type ) {
|
| 343 |
+
if (
|
| 344 |
+
in_array( $temp_post_type_slug, $excluded_post_types )
|
| 345 |
+
|| (
|
| 346 |
+
!$temp_post_type->show_ui
|
| 347 |
+
&& !apply_filters('wpcf_show_ui_hide_in_relationships', true)
|
| 348 |
+
)
|
| 349 |
+
) {
|
| 350 |
+
continue;
|
| 351 |
+
}
|
| 352 |
+
// Check if it already belongs
|
| 353 |
+
if ( isset( $belongs[$temp_post_type_slug] ) ) {
|
| 354 |
+
continue;
|
| 355 |
+
}
|
| 356 |
+
$options[$temp_post_type_slug]['#name'] = 'ct[post_relationship][has][' . $temp_post_type_slug . ']';
|
| 357 |
+
$options[$temp_post_type_slug]['#title'] = $temp_post_type->labels->singular_name;
|
| 358 |
+
$options[$temp_post_type_slug]['#default_value'] = isset( $has[$temp_post_type_slug] );
|
| 359 |
+
$options[$temp_post_type_slug]['#inline'] = true;
|
| 360 |
+
$options[$temp_post_type_slug]['#after'] = isset( $has[$temp_post_type_slug] ) ? ''
|
| 361 |
+
. '<a href="'
|
| 362 |
+
. admin_url( 'admin-ajax.php?action=wpcf_ajax&wpcf_action=pt_edit_fields&child='
|
| 363 |
+
. $temp_post_type_slug . '&parent='
|
| 364 |
+
. $post_type['slug']
|
| 365 |
+
. '&_wpnonce='
|
| 366 |
+
. wp_create_nonce( 'pt_edit_fields' )
|
| 367 |
+
. '&KeepThis=true&TB_iframe=true' )
|
| 368 |
+
. '" class="thickbox" title="'
|
| 369 |
+
. __('Select child fields to be displayed', 'wpcf') . '">('
|
| 370 |
+
. __( 'Edit fields' ) . ')</a> ' : ''
|
| 371 |
+
. '<a href="javascript:void(0);" style="color:Gray;" title="'
|
| 372 |
+
. __( 'Please save the page first, before you can edit the child items',
|
| 373 |
+
'wpcf' ) . '">('
|
| 374 |
+
. __( 'Edit fields' ) . ')</a> ';
|
| 375 |
+
if ( is_rtl() ) {
|
| 376 |
+
$options[$temp_post_type_slug]['#before'] = '<div style="float:right;margin-left:10px;">';
|
| 377 |
+
$options[$temp_post_type_slug]['#after'] .= '</div>';
|
| 378 |
+
}
|
| 379 |
+
}
|
| 380 |
+
$form['table-pr-belongs-form'] = array(
|
| 381 |
+
'#type' => 'checkboxes',
|
| 382 |
+
'#options' => $options,
|
| 383 |
+
'#name' => 'ct[post_relationship]',
|
| 384 |
+
'#before' => '<div style="display:none; margin: 10px 0 20px 0;">',
|
| 385 |
+
'#after' => '<br /><br /><a href="javascript:void(0);" class="button-primary wpcf-pr-has-apply">'
|
| 386 |
+
. __( 'Apply', 'wpcf' ) . '</a> <a href="javascript:void(0);" class="button-secondary wpcf-pr-has-cancel">'
|
| 387 |
+
. __( 'Cancel', 'wpcf' ) . '</a></div></div>',
|
| 388 |
+
'#inline' => true,
|
| 389 |
+
);
|
| 390 |
+
$form['table-pr-explanation'] = array(
|
| 391 |
+
'#type' => 'markup',
|
| 392 |
+
'#markup' => '<p>'
|
| 393 |
+
. __( "You can choose which fields will show when editing parent pages.",
|
| 394 |
+
'wpcf' )
|
| 395 |
+
. '<br />' . __( "Click on the 'edit' button to select them for each parent.",
|
| 396 |
+
'wpcf' )
|
| 397 |
+
. '<br />'
|
| 398 |
+
. sprintf( __( 'Learn about %sPost Type Relationships%s', 'wpcf' ),
|
| 399 |
+
'<a href="http://wp-types.com/documentation/user-guides/creating-post-type-relationships/" target="_blank">',
|
| 400 |
+
' »</a>' )
|
| 401 |
+
. '</p>',
|
| 402 |
+
);
|
| 403 |
+
/**
|
| 404 |
+
* close form
|
| 405 |
+
*/
|
| 406 |
+
$form['table-pr-close'] = wpcf_admin_metabox_end();
|
| 407 |
+
/**
|
| 408 |
+
* additional settings
|
| 409 |
+
*/
|
| 410 |
+
wpcf_admin_add_js_settings( 'wpcf_pr_has_empty_txt', '\'' . __( "Children: None", 'wpcf' ) . '\'' );
|
| 411 |
+
wpcf_admin_add_js_settings( 'wpcf_pr_has_txt', '\'' . __( "Children: %s", 'wpcf' ) . '\'' );
|
| 412 |
+
wpcf_admin_add_js_settings( 'wpcf_pr_belongs_empty_txt', '\'' . __( "Parent: None", 'wpcf' ) . '\'' );
|
| 413 |
+
wpcf_admin_add_js_settings( 'wpcf_pr_belongs_txt', '\'' . __( "Parent: %s", 'wpcf' ) . '\'' );
|
| 414 |
+
return $form;
|
| 415 |
+
}
|
| 416 |
+
|
includes/settings.php
CHANGED
|
@@ -187,6 +187,7 @@ function wpcf_admin_image_settings_form_submit($form) {
|
|
| 187 |
if (!isset($data[$setting])) {
|
| 188 |
$settings[$setting] = 0;
|
| 189 |
} else {
|
|
|
|
| 190 |
$settings[$setting] = $data[$setting];
|
| 191 |
}
|
| 192 |
}
|
|
@@ -203,27 +204,11 @@ function wpcf_admin_general_settings_form_submit($form) {
|
|
| 203 |
if (!isset($data[$setting])) {
|
| 204 |
$settings[$setting] = 0;
|
| 205 |
} else {
|
|
|
|
| 206 |
$settings[$setting] = $data[$setting];
|
| 207 |
}
|
| 208 |
}
|
| 209 |
update_option('wpcf_settings', $settings);
|
| 210 |
|
| 211 |
-
// Credits
|
| 212 |
-
// TODO Remove
|
| 213 |
-
// require_once WPCF_EMBEDDED_INC_ABSPATH . '/footer-credit.php';
|
| 214 |
-
// $option = get_option('wpcf_footer_credit', array());
|
| 215 |
-
// if (!isset($option['message'])) {
|
| 216 |
-
// $data = wpcf_footer_credit_defaults();
|
| 217 |
-
// shuffle($data);
|
| 218 |
-
// $option['message'] = rand(0, count($data));
|
| 219 |
-
// }
|
| 220 |
-
// if (!isset($_POST['show_credits'])) {
|
| 221 |
-
// update_option('wpcf_footer_credit',
|
| 222 |
-
// array('active' => 0, 'message' => $option['message']));
|
| 223 |
-
// } else {
|
| 224 |
-
// update_option('wpcf_footer_credit',
|
| 225 |
-
// array('active' => 1, 'message' => $option['message']));
|
| 226 |
-
// }
|
| 227 |
-
|
| 228 |
wpcf_admin_message_store(__('Settings saved', 'wpcf'));
|
| 229 |
}
|
| 187 |
if (!isset($data[$setting])) {
|
| 188 |
$settings[$setting] = 0;
|
| 189 |
} else {
|
| 190 |
+
// @todo Add sanitization here
|
| 191 |
$settings[$setting] = $data[$setting];
|
| 192 |
}
|
| 193 |
}
|
| 204 |
if (!isset($data[$setting])) {
|
| 205 |
$settings[$setting] = 0;
|
| 206 |
} else {
|
| 207 |
+
// @todo Add sanitization here
|
| 208 |
$settings[$setting] = $data[$setting];
|
| 209 |
}
|
| 210 |
}
|
| 211 |
update_option('wpcf_settings', $settings);
|
| 212 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 213 |
wpcf_admin_message_store(__('Settings saved', 'wpcf'));
|
| 214 |
}
|
includes/usermeta-control.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Custom Fields Control Screen
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -14,6 +14,9 @@
|
|
| 14 |
class WPCF_User_Fields_Control_Table extends WP_List_Table
|
| 15 |
{
|
| 16 |
|
|
|
|
|
|
|
|
|
|
| 17 |
function prepare_items() {
|
| 18 |
global $wpdb;
|
| 19 |
$wpcf_per_page = 15;
|
|
@@ -109,10 +112,14 @@ class WPCF_User_Fields_Control_Table extends WP_List_Table
|
|
| 109 |
$sorted_keys = array();
|
| 110 |
$new_array = array();
|
| 111 |
foreach ($cf_types as $cf_id_temp => $cf_temp) {
|
| 112 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 113 |
}
|
| 114 |
asort($sorted_keys, SORT_STRING);
|
| 115 |
-
if ($_REQUEST['order']
|
| 116 |
$sorted_keys = array_reverse($sorted_keys, true);
|
| 117 |
}
|
| 118 |
foreach ($sorted_keys as $cf_id_temp => $groups_txt) {
|
|
@@ -125,8 +132,7 @@ class WPCF_User_Fields_Control_Table extends WP_List_Table
|
|
| 125 |
if (!empty($_REQUEST['s'])) {
|
| 126 |
$search_results = array();
|
| 127 |
foreach ($cf_types as $search_id => $search_field) {
|
| 128 |
-
if (strpos(strval($search_field['name']),
|
| 129 |
-
strval(trim(stripslashes($_REQUEST['s'])))) !== false) {
|
| 130 |
$search_results[$search_id] = $cf_types[$search_id];
|
| 131 |
}
|
| 132 |
}
|
|
@@ -233,14 +239,28 @@ class WPCF_User_Fields_Control_Table extends WP_List_Table
|
|
| 233 |
return $actions;
|
| 234 |
}
|
| 235 |
|
| 236 |
-
function view_switcher($current_mode = '')
|
| 237 |
-
|
|
|
|
|
|
|
| 238 |
if (empty($_GET['display_all'])) {
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
echo esc_url($_SERVER['REQUEST_URI']) . '&display_all=0">' . __('Show pagination', 'wpcf');
|
| 242 |
}
|
| 243 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 244 |
}
|
| 245 |
|
| 246 |
}
|
|
@@ -249,16 +269,23 @@ class WPCF_User_Fields_Control_Table extends WP_List_Table
|
|
| 249 |
/**
|
| 250 |
* Submitted Bulk actions.
|
| 251 |
*/
|
| 252 |
-
function wpcf_admin_user_fields_control_bulk_actions($action = '')
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 253 |
|
| 254 |
if ($action == 'wpcf-deactivate-bulk') {
|
| 255 |
|
| 256 |
$fields = wpcf_admin_fields_get_fields(false, true, false, 'wpcf-usermeta');
|
| 257 |
foreach ($_POST['fields'] as $field_id) {
|
|
|
|
| 258 |
if (isset($fields[$field_id])) {
|
| 259 |
$fields[$field_id]['data']['disabled'] = 1;
|
| 260 |
-
wpcf_admin_message_store(sprintf(__('Removed from Types control: %s',
|
| 261 |
-
'wpcf'), $fields[$field_id]['name']));
|
| 262 |
}
|
| 263 |
}
|
| 264 |
wpcf_admin_fields_save_fields($fields, false, 'wpcf-usermeta');
|
|
@@ -266,13 +293,12 @@ function wpcf_admin_user_fields_control_bulk_actions($action = '') {
|
|
| 266 |
|
| 267 |
$fields = wpcf_admin_fields_get_fields(false, true, false, 'wpcf-usermeta');
|
| 268 |
$fields_bulk = wpcf_types_cf_under_control('add',
|
| 269 |
-
|
| 270 |
foreach ($fields_bulk as $field_id) {
|
| 271 |
if (isset($fields[$field_id])) {
|
| 272 |
$fields[$field_id]['data']['disabled'] = 0;
|
| 273 |
}
|
| 274 |
-
wpcf_admin_message_store(sprintf(__('Added to Types control: %s',
|
| 275 |
-
'wpcf'), $field_id));
|
| 276 |
}
|
| 277 |
wpcf_admin_fields_save_fields($fields, false, 'wpcf-usermeta');
|
| 278 |
} else if ($action == 'wpcf-delete-bulk') {
|
|
@@ -280,17 +306,16 @@ function wpcf_admin_user_fields_control_bulk_actions($action = '') {
|
|
| 280 |
$failed = array();
|
| 281 |
$success = array();
|
| 282 |
foreach ($_POST['fields'] as $field_id) {
|
|
|
|
| 283 |
$response = wpcf_admin_fields_delete_field($field_id, 'wp-types-user-group', 'wpcf-usermeta');
|
| 284 |
if (!$response) {
|
| 285 |
-
$failed[] = str_replace('_' . md5('wpcf_not_controlled'), '',
|
| 286 |
-
$field_id);
|
| 287 |
} else {
|
| 288 |
$success[] = $field_id;
|
| 289 |
}
|
| 290 |
}
|
| 291 |
if (!empty($success)) {
|
| 292 |
-
wpcf_admin_message_store(sprintf(__('Fields %s have been deleted.',
|
| 293 |
-
'wpcf'), implode(', ', $success)));
|
| 294 |
}
|
| 295 |
if (!empty($failed)) {
|
| 296 |
wpcf_admin_message_store(
|
|
@@ -302,7 +327,15 @@ function wpcf_admin_user_fields_control_bulk_actions($action = '') {
|
|
| 302 |
);
|
| 303 |
}
|
| 304 |
}
|
| 305 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 306 |
die();
|
| 307 |
}
|
| 308 |
|
|
@@ -363,8 +396,9 @@ function wpcf_admin_user_fields_control_bulk_ajax() {
|
|
| 363 |
}
|
| 364 |
if (!empty($_POST)) {
|
| 365 |
if (!empty($_POST['groups']) && !empty($_POST['fields'])) {
|
| 366 |
-
$action = isset($_POST['wpcf_action_control']) ? $_POST['wpcf_action_control'] : 'wpcf-add-to-group-bulk';
|
| 367 |
foreach ($_POST['groups'] as $group_id) {
|
|
|
|
| 368 |
switch ($action) {
|
| 369 |
case 'wpcf-add-to-group-bulk':
|
| 370 |
wpcf_admin_fields_save_group_fields($group_id,
|
|
@@ -382,7 +416,7 @@ function wpcf_admin_user_fields_control_bulk_ajax() {
|
|
| 382 |
}
|
| 383 |
} else if (!empty($_POST['type']) && !empty($_POST['fields'])) {
|
| 384 |
wpcf_admin_custom_fields_change_type($_POST['fields'],
|
| 385 |
-
$_POST['type'], 'wp-types-user-group', 'wpcf-usermeta');
|
| 386 |
}
|
| 387 |
echo '<script type="text/javascript">
|
| 388 |
window.parent.jQuery("#TB_closeWindowButton").click();
|
|
@@ -414,6 +448,7 @@ function wpcf_admin_user_fields_control_bulk_ajax() {
|
|
| 414 |
}
|
| 415 |
|
| 416 |
foreach ($_GET['fields'] as $field_id) {
|
|
|
|
| 417 |
$output[$field_id] = array(
|
| 418 |
'#type' => 'hidden',
|
| 419 |
'#name' => 'fields[]',
|
| 2 |
/*
|
| 3 |
* Custom Fields Control Screen
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/usermeta-control.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 14 |
class WPCF_User_Fields_Control_Table extends WP_List_Table
|
| 15 |
{
|
| 16 |
|
| 17 |
+
/**
|
| 18 |
+
* @global object $wpdb
|
| 19 |
+
*/
|
| 20 |
function prepare_items() {
|
| 21 |
global $wpdb;
|
| 22 |
$wpcf_per_page = 15;
|
| 112 |
$sorted_keys = array();
|
| 113 |
$new_array = array();
|
| 114 |
foreach ($cf_types as $cf_id_temp => $cf_temp) {
|
| 115 |
+
if ( isset($sort_matches[$_REQUEST['orderby']] ) ) {
|
| 116 |
+
$sorted_keys[$cf_temp['id']] = strtolower( $cf_temp[$sort_matches[$_REQUEST['orderby']]] );
|
| 117 |
+
} else {
|
| 118 |
+
$sorted_keys[$cf_temp['id']] = strtolower( $cf_temp[$sort_matches['c']] );
|
| 119 |
+
}
|
| 120 |
}
|
| 121 |
asort($sorted_keys, SORT_STRING);
|
| 122 |
+
if ('desc' == $_REQUEST['order']) {
|
| 123 |
$sorted_keys = array_reverse($sorted_keys, true);
|
| 124 |
}
|
| 125 |
foreach ($sorted_keys as $cf_id_temp => $groups_txt) {
|
| 132 |
if (!empty($_REQUEST['s'])) {
|
| 133 |
$search_results = array();
|
| 134 |
foreach ($cf_types as $search_id => $search_field) {
|
| 135 |
+
if (strpos(strval($search_field['name']), strval(trim(stripslashes($_REQUEST['s'])))) !== false) {
|
|
|
|
| 136 |
$search_results[$search_id] = $cf_types[$search_id];
|
| 137 |
}
|
| 138 |
}
|
| 239 |
return $actions;
|
| 240 |
}
|
| 241 |
|
| 242 |
+
function view_switcher($current_mode = '')
|
| 243 |
+
{
|
| 244 |
+
$display = 0;
|
| 245 |
+
$text = __('Show pagination', 'wpcf');
|
| 246 |
if (empty($_GET['display_all'])) {
|
| 247 |
+
$display = 1;
|
| 248 |
+
$text = __('Display all items', 'wpcf');
|
|
|
|
| 249 |
}
|
| 250 |
+
$url = add_query_arg(
|
| 251 |
+
array(
|
| 252 |
+
'page' => 'wpcf-user-fields-control',
|
| 253 |
+
'display_all' => $display,
|
| 254 |
+
),
|
| 255 |
+
admin_url('admin.php')
|
| 256 |
+
);
|
| 257 |
+
echo '<div style="clear:both; margin: 20px 0 10px 0; float: right;">';
|
| 258 |
+
printf(
|
| 259 |
+
'<a class="button button-secondary" href="%s">%s</a>',
|
| 260 |
+
$url,
|
| 261 |
+
$text
|
| 262 |
+
);
|
| 263 |
+
echo '</div>';
|
| 264 |
}
|
| 265 |
|
| 266 |
}
|
| 269 |
/**
|
| 270 |
* Submitted Bulk actions.
|
| 271 |
*/
|
| 272 |
+
function wpcf_admin_user_fields_control_bulk_actions($action = '')
|
| 273 |
+
{
|
| 274 |
+
if (
|
| 275 |
+
!isset($_POST['_wpnonce'])
|
| 276 |
+
|| !wp_verify_nonce($_POST['_wpnonce'], 'user_fields_control_bulk')
|
| 277 |
+
) {
|
| 278 |
+
return;
|
| 279 |
+
}
|
| 280 |
|
| 281 |
if ($action == 'wpcf-deactivate-bulk') {
|
| 282 |
|
| 283 |
$fields = wpcf_admin_fields_get_fields(false, true, false, 'wpcf-usermeta');
|
| 284 |
foreach ($_POST['fields'] as $field_id) {
|
| 285 |
+
$field_id = sanitize_text_field( $field_id );
|
| 286 |
if (isset($fields[$field_id])) {
|
| 287 |
$fields[$field_id]['data']['disabled'] = 1;
|
| 288 |
+
wpcf_admin_message_store(sprintf(__('Removed from Types control: %s', 'wpcf'), $fields[$field_id]['name']));
|
|
|
|
| 289 |
}
|
| 290 |
}
|
| 291 |
wpcf_admin_fields_save_fields($fields, false, 'wpcf-usermeta');
|
| 293 |
|
| 294 |
$fields = wpcf_admin_fields_get_fields(false, true, false, 'wpcf-usermeta');
|
| 295 |
$fields_bulk = wpcf_types_cf_under_control('add',
|
| 296 |
+
array('fields' => $_POST['fields']), 'wp-types-user-group', 'wpcf-usermeta');
|
| 297 |
foreach ($fields_bulk as $field_id) {
|
| 298 |
if (isset($fields[$field_id])) {
|
| 299 |
$fields[$field_id]['data']['disabled'] = 0;
|
| 300 |
}
|
| 301 |
+
wpcf_admin_message_store(sprintf(__('Added to Types control: %s', 'wpcf'), $field_id));
|
|
|
|
| 302 |
}
|
| 303 |
wpcf_admin_fields_save_fields($fields, false, 'wpcf-usermeta');
|
| 304 |
} else if ($action == 'wpcf-delete-bulk') {
|
| 306 |
$failed = array();
|
| 307 |
$success = array();
|
| 308 |
foreach ($_POST['fields'] as $field_id) {
|
| 309 |
+
$field_id = sanitize_text_field( $field_id );
|
| 310 |
$response = wpcf_admin_fields_delete_field($field_id, 'wp-types-user-group', 'wpcf-usermeta');
|
| 311 |
if (!$response) {
|
| 312 |
+
$failed[] = str_replace('_' . md5('wpcf_not_controlled'), '', $field_id);
|
|
|
|
| 313 |
} else {
|
| 314 |
$success[] = $field_id;
|
| 315 |
}
|
| 316 |
}
|
| 317 |
if (!empty($success)) {
|
| 318 |
+
wpcf_admin_message_store(sprintf(__('Fields %s have been deleted.', 'wpcf'), implode(', ', $success)));
|
|
|
|
| 319 |
}
|
| 320 |
if (!empty($failed)) {
|
| 321 |
wpcf_admin_message_store(
|
| 327 |
);
|
| 328 |
}
|
| 329 |
}
|
| 330 |
+
|
| 331 |
+
$url = add_query_arg(
|
| 332 |
+
array(
|
| 333 |
+
'page' => 'wpcf-user-fields-control',
|
| 334 |
+
'display_all' => isset($_REQUEST['display_all'])? 1:0,
|
| 335 |
+
),
|
| 336 |
+
admin_url('admin.php')
|
| 337 |
+
);
|
| 338 |
+
wp_redirect($url);
|
| 339 |
die();
|
| 340 |
}
|
| 341 |
|
| 396 |
}
|
| 397 |
if (!empty($_POST)) {
|
| 398 |
if (!empty($_POST['groups']) && !empty($_POST['fields'])) {
|
| 399 |
+
$action = isset($_POST['wpcf_action_control']) ? sanitize_text_field( $_POST['wpcf_action_control'] ) : 'wpcf-add-to-group-bulk';
|
| 400 |
foreach ($_POST['groups'] as $group_id) {
|
| 401 |
+
$group_id = sanitize_text_field( $group_id );
|
| 402 |
switch ($action) {
|
| 403 |
case 'wpcf-add-to-group-bulk':
|
| 404 |
wpcf_admin_fields_save_group_fields($group_id,
|
| 416 |
}
|
| 417 |
} else if (!empty($_POST['type']) && !empty($_POST['fields'])) {
|
| 418 |
wpcf_admin_custom_fields_change_type($_POST['fields'],
|
| 419 |
+
sanitize_text_field( $_POST['type'] ), 'wp-types-user-group', 'wpcf-usermeta');
|
| 420 |
}
|
| 421 |
echo '<script type="text/javascript">
|
| 422 |
window.parent.jQuery("#TB_closeWindowButton").click();
|
| 448 |
}
|
| 449 |
|
| 450 |
foreach ($_GET['fields'] as $field_id) {
|
| 451 |
+
$field_id = sanitize_text_field( $field_id );
|
| 452 |
$output[$field_id] = array(
|
| 453 |
'#type' => 'hidden',
|
| 454 |
'#name' => 'fields[]',
|
includes/usermeta-form.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Fields and groups form functions.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -23,55 +23,64 @@ if (version_compare($wp_version, '3.5', '<')) {
|
|
| 23 |
|
| 24 |
/**
|
| 25 |
* Saves user fields and groups.
|
| 26 |
-
*
|
| 27 |
* If field name is changed in specific group - new one will be created,
|
| 28 |
* otherwise old one will be updated and will appear in that way in other grups.
|
| 29 |
-
*
|
| 30 |
-
* @return type
|
| 31 |
*/
|
| 32 |
function wpcf_admin_save_usermeta_groups_submit($form) {
|
| 33 |
-
if (
|
|
|
|
|
|
|
|
|
|
|
|
|
| 34 |
return false;
|
| 35 |
}
|
| 36 |
-
|
| 37 |
-
$_POST['wpcf']['group']['name'] = trim($_POST['wpcf']['group']['name']);
|
| 38 |
|
| 39 |
-
$_POST['wpcf']['group'] =
|
| 40 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 41 |
|
| 42 |
-
global $wpdb;
|
| 43 |
-
|
| 44 |
$new_group = false;
|
| 45 |
|
| 46 |
$group_slug = $_POST['wpcf']['group']['slug'] = sanitize_title($_POST['wpcf']['group']['name']);
|
| 47 |
|
| 48 |
// Basic check
|
| 49 |
-
|
| 50 |
-
|
| 51 |
if (isset($_REQUEST['group_id'])) {
|
| 52 |
// Check if group exists
|
| 53 |
-
$post = get_post($_REQUEST['group_id']);
|
| 54 |
// Name changed
|
| 55 |
if (strtolower($_POST['wpcf']['group']['name']) != strtolower($post->post_title)) {
|
| 56 |
// Check if already exists
|
| 57 |
-
$exists = get_page_by_title($_POST['wpcf']['group']['name'],
|
| 58 |
-
'OBJECT', 'wp-types-user-group');
|
| 59 |
if (!empty($exists)) {
|
| 60 |
$form->triggerError();
|
| 61 |
-
wpcf_admin_message(
|
| 62 |
-
|
| 63 |
-
'
|
|
|
|
|
|
|
|
|
|
|
|
|
| 64 |
return $form;
|
| 65 |
}
|
| 66 |
}
|
| 67 |
if (empty($post) || $post->post_type != 'wp-types-user-group') {
|
| 68 |
$form->triggerError();
|
| 69 |
-
wpcf_admin_message(sprintf(__("Wrong group ID %d", 'wpcf'),
|
| 70 |
-
intval($_REQUEST['group_id'])), 'error');
|
| 71 |
return $form;
|
| 72 |
}
|
| 73 |
$group_id = $post->ID;
|
| 74 |
-
|
| 75 |
} else {
|
| 76 |
$new_group = true;
|
| 77 |
// Check if already exists
|
|
@@ -79,9 +88,13 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 79 |
'wp-types-user-group');
|
| 80 |
if (!empty($exists)) {
|
| 81 |
$form->triggerError();
|
| 82 |
-
wpcf_admin_message(
|
| 83 |
-
|
| 84 |
-
'
|
|
|
|
|
|
|
|
|
|
|
|
|
| 85 |
return $form;
|
| 86 |
}
|
| 87 |
}
|
|
@@ -101,7 +114,7 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 101 |
return $form;
|
| 102 |
}
|
| 103 |
}
|
| 104 |
-
|
| 105 |
foreach ($_POST['wpcf']['fields'] as $key => $field) {
|
| 106 |
$field = apply_filters('wpcf_field_pre_save', $field);
|
| 107 |
if (!empty($field['is_new'])) {
|
|
@@ -126,16 +139,16 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 126 |
if (!empty($field_id)) {
|
| 127 |
$fields[] = $field_id;
|
| 128 |
}
|
| 129 |
-
|
| 130 |
}
|
| 131 |
}
|
| 132 |
|
| 133 |
// Save group
|
| 134 |
$roles = isset($_POST['wpcf']['group']['supports']) ? $_POST['wpcf']['group']['supports'] : array();
|
| 135 |
-
|
| 136 |
// Rename if needed
|
| 137 |
if (isset($_REQUEST['group_id'])) {
|
| 138 |
-
$_POST['wpcf']['group']['id'] = $_REQUEST['group_id'];
|
| 139 |
}
|
| 140 |
|
| 141 |
$group_id = wpcf_admin_fields_save_group($_POST['wpcf']['group'], 'wp-types-user-group');
|
|
@@ -152,14 +165,14 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 152 |
$open_fieldsets);
|
| 153 |
}
|
| 154 |
}
|
| 155 |
-
|
| 156 |
-
|
| 157 |
// Rest of processes
|
| 158 |
if (!empty($group_id)) {
|
| 159 |
wpcf_admin_fields_save_group_fields($group_id, $fields, false, 'wp-types-user-group');
|
| 160 |
wpcf_admin_fields_save_group_showfor($group_id, $roles);
|
| 161 |
-
|
| 162 |
-
|
| 163 |
$_POST['wpcf']['group']['fields'] = isset($_POST['wpcf']['fields']) ? $_POST['wpcf']['fields'] : array();
|
| 164 |
do_action('wpcf_save_group', $_POST['wpcf']['group']);
|
| 165 |
wpcf_admin_message_store(apply_filters('types_message_usermeta_saved',
|
|
@@ -170,8 +183,8 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 170 |
} else {
|
| 171 |
wpcf_admin_message_store(__('Error saving group', 'wpcf'), 'error');
|
| 172 |
}
|
| 173 |
-
|
| 174 |
-
|
| 175 |
}
|
| 176 |
|
| 177 |
|
|
@@ -179,7 +192,7 @@ function wpcf_admin_save_usermeta_groups_submit($form) {
|
|
| 179 |
* Generates form data.
|
| 180 |
*/
|
| 181 |
function wpcf_admin_usermeta_form() {
|
| 182 |
-
|
| 183 |
wpcf_admin_add_js_settings('wpcf_nonce_toggle_group',
|
| 184 |
'\'' . wp_create_nonce('group_form_collapsed') . '\'');
|
| 185 |
wpcf_admin_add_js_settings('wpcf_nonce_toggle_fieldset',
|
|
@@ -195,15 +208,14 @@ function wpcf_admin_usermeta_form() {
|
|
| 195 |
$update = wpcf_admin_fields_get_group(intval($_REQUEST['group_id']), 'wp-types-user-group');
|
| 196 |
if (empty($update)) {
|
| 197 |
$update = false;
|
| 198 |
-
wpcf_admin_message(sprintf(__("Group with ID %d do not exist",
|
| 199 |
-
'wpcf'), intval($_REQUEST['group_id'])));
|
| 200 |
} else {
|
| 201 |
-
$update['fields'] = wpcf_admin_fields_get_fields_by_group($_REQUEST['group_id'], 'slug', false, true, false, 'wp-types-user-group', 'wpcf-usermeta');
|
| 202 |
-
$update['show_for'] = wpcf_admin_get_groups_showfor_by_group($_REQUEST['group_id']);
|
| 203 |
-
|
| 204 |
}
|
| 205 |
}
|
| 206 |
-
|
| 207 |
$form = array();
|
| 208 |
$form['#form']['callback'] = array('wpcf_admin_save_usermeta_groups_submit');
|
| 209 |
|
|
@@ -287,7 +299,7 @@ function wpcf_admin_usermeta_form() {
|
|
| 287 |
continue;
|
| 288 |
}
|
| 289 |
if ( !empty( $field['data']['removed_from_history'] ) ) {
|
| 290 |
-
|
| 291 |
}
|
| 292 |
$form['fields-existing'][$key] = array(
|
| 293 |
'#type' => 'markup',
|
|
@@ -322,7 +334,7 @@ function wpcf_admin_usermeta_form() {
|
|
| 322 |
'#type' => 'markup',
|
| 323 |
'#markup' => '</div>',
|
| 324 |
);
|
| 325 |
-
|
| 326 |
// Group data
|
| 327 |
|
| 328 |
$form['open-main'] = array(
|
|
@@ -334,40 +346,35 @@ function wpcf_admin_usermeta_form() {
|
|
| 334 |
'#type' => 'textfield',
|
| 335 |
'#name' => 'wpcf[group][name]',
|
| 336 |
'#id' => 'wpcf-group-name',
|
| 337 |
-
'#value' => $update ? $update['name'] :
|
| 338 |
'#inline' => true,
|
| 339 |
-
'#attributes' => array(
|
|
|
|
|
|
|
|
|
|
| 340 |
'#validate' => array(
|
| 341 |
'required' => array(
|
| 342 |
'value' => true,
|
| 343 |
),
|
| 344 |
)
|
| 345 |
);
|
| 346 |
-
if (!$update) {
|
| 347 |
-
$form['title']['#attributes']['data-label'] = addcslashes(__( 'Enter group title', 'wpcf' ), '"');
|
| 348 |
-
$form['title']['#attributes']['onfocus'] = 'if (jQuery(this).val() == jQuery(this).data(\'label\')) { jQuery(this).val(\'\'); }';
|
| 349 |
-
$form['title']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(jQuery(this).data(\'label\')) }';
|
| 350 |
-
}
|
| 351 |
$form['description'] = array(
|
| 352 |
'#type' => 'textarea',
|
| 353 |
'#id' => 'wpcf-group-description',
|
| 354 |
'#name' => 'wpcf[group][description]',
|
| 355 |
-
'#value' => $update ? $update['description'] :
|
| 356 |
-
|
|
|
|
|
|
|
| 357 |
);
|
| 358 |
-
if (!$update) {
|
| 359 |
-
$form['description']['#attributes']['data-label'] = addcslashes(__( 'Enter a description for this group', 'wpcf' ), '"');
|
| 360 |
-
$form['description']['#attributes']['onfocus'] = 'if (jQuery(this).val() == jQuery(this).data(\'label\')) { jQuery(this).val(\'\'); }';
|
| 361 |
-
$form['description']['#attributes']['onblur'] = 'if (jQuery(this).val() == \'\') { jQuery(this).val(jQuery(this).data(\'label\')) }';
|
| 362 |
-
}
|
| 363 |
|
| 364 |
-
|
| 365 |
-
|
| 366 |
$options = array();
|
| 367 |
$users_currently_supported = array();
|
| 368 |
$form_types = array();
|
| 369 |
-
|
| 370 |
-
|
| 371 |
$options[$role]['#title'] = ucwords($role);
|
| 372 |
$options[$role]['#default_value'] = ($update && !empty($update['show_for']) && in_array($role,
|
| 373 |
$update['show_for'])) ? 1 : 0;
|
|
@@ -380,9 +387,9 @@ function wpcf_admin_usermeta_form() {
|
|
| 380 |
$update['show_for'])) {
|
| 381 |
$users_currently_supported[] = ucwords($role);
|
| 382 |
}
|
| 383 |
-
|
| 384 |
-
|
| 385 |
-
|
| 386 |
$users_currently_supported[] = __('Displayed for all users roles',
|
| 387 |
'wpcf');
|
| 388 |
}
|
|
@@ -397,7 +404,7 @@ function wpcf_admin_usermeta_form() {
|
|
| 397 |
'#inline' => true,
|
| 398 |
);
|
| 399 |
/*
|
| 400 |
-
*
|
| 401 |
* Here we use unique function for all filters
|
| 402 |
* Since Types 1.1.4
|
| 403 |
*/
|
|
@@ -406,24 +413,24 @@ function wpcf_admin_usermeta_form() {
|
|
| 406 |
implode(', ', $users_currently_supported),
|
| 407 |
__('Displayed for all users roles', 'wpcf'), $temp);
|
| 408 |
|
| 409 |
-
|
| 410 |
* Now starting form
|
| 411 |
*/
|
| 412 |
-
|
| 413 |
-
|
| 414 |
-
|
| 415 |
-
|
| 416 |
'wpcf') .'</span></div>';
|
| 417 |
-
|
| 418 |
$form['supports-table-open'] = array(
|
| 419 |
'#type' => 'markup',
|
| 420 |
'#markup' => '<table class="widefat"><thead><tr><th>'
|
| 421 |
. __('Where to display this group', 'wpcf')
|
| 422 |
. '</th></tr></thead><tbody><tr><td>'
|
| 423 |
. '<p>'
|
| 424 |
-
. __('Each usermeta group can display different fields for user roles.',
|
| 425 |
'wpcf')
|
| 426 |
-
|
| 427 |
. '</p>',
|
| 428 |
);
|
| 429 |
/*
|
|
@@ -440,13 +447,13 @@ function wpcf_admin_usermeta_form() {
|
|
| 440 |
'#type' => 'markup',
|
| 441 |
'#markup' => '</td></tr></tbody></table><br />',
|
| 442 |
);
|
| 443 |
-
|
| 444 |
-
|
| 445 |
-
|
| 446 |
-
|
| 447 |
-
|
| 448 |
-
|
| 449 |
-
|
| 450 |
'#type' => 'markup',
|
| 451 |
'#markup' => '<table class="widefat" id="wpcf-admin-styles-box"><thead><tr><th>'
|
| 452 |
. __('Styling Editor', 'wpcf')
|
|
@@ -456,93 +463,93 @@ function wpcf_admin_usermeta_form() {
|
|
| 456 |
'wpcf')
|
| 457 |
. '</p>',
|
| 458 |
);
|
| 459 |
-
|
| 460 |
-
|
| 461 |
-
|
| 462 |
-
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
|
| 466 |
-
|
| 467 |
-
|
| 468 |
-
|
| 469 |
-
|
| 470 |
-
|
| 471 |
-
|
| 472 |
-
|
| 473 |
-
|
| 474 |
-
|
| 475 |
-
|
| 476 |
add_action( 'admin_enqueue_scripts', 'wpcf_admin_fields_form_fix_styles', PHP_INT_MAX );
|
| 477 |
-
|
| 478 |
-
|
| 479 |
-
|
| 480 |
-
|
| 481 |
-
|
| 482 |
-
|
| 483 |
'#name' => 'wpcf[group][preview]','#default_value' => '',
|
| 484 |
-
|
| 485 |
'#inline' => true,
|
| 486 |
-
|
| 487 |
-
|
| 488 |
-
|
| 489 |
-
|
| 490 |
-
|
| 491 |
-
|
| 492 |
'#name' => 'wpcf[group][preview]','#default_value' => '',
|
| 493 |
-
|
| 494 |
'#inline' => true,
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
|
| 498 |
-
|
| 499 |
'#type' => 'textarea',
|
| 500 |
'#name' => 'wpcf[group][admin_html_preview]',
|
| 501 |
'#inline' => true,
|
| 502 |
-
|
| 503 |
-
|
| 504 |
-
|
| 505 |
);
|
| 506 |
-
|
| 507 |
-
|
| 508 |
'#type' => 'textarea',
|
| 509 |
'#name' => 'wpcf[group][admin_styles]',
|
| 510 |
'#inline' => true,
|
| 511 |
-
|
| 512 |
-
|
| 513 |
-
|
| 514 |
-
|
| 515 |
-
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
|
| 519 |
-
|
| 520 |
-
|
| 521 |
-
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
| 525 |
);
|
| 526 |
-
|
| 527 |
-
|
| 528 |
-
|
| 529 |
-
|
| 530 |
-
|
| 531 |
__('Admin styles for fields:', 'wpcf'), '', '', $temp, __( 'Open style editor', 'wpcf' ) );
|
| 532 |
-
|
| 533 |
'#type' => 'markup',
|
| 534 |
'#markup' => '<p class="wpcf-filter-wrap">',
|
| 535 |
);
|
| 536 |
-
|
| 537 |
-
|
| 538 |
'#type' => 'markup',
|
| 539 |
'#markup' => '</td></tr></tbody></table><br />',
|
| 540 |
);
|
| 541 |
-
|
| 542 |
-
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
// Group fields
|
| 547 |
|
| 548 |
$form['fields_title'] = array(
|
|
@@ -636,8 +643,8 @@ function wpcf_admin_usermeta_form() {
|
|
| 636 |
'#markup' => '</div>',
|
| 637 |
);
|
| 638 |
|
| 639 |
-
|
| 640 |
-
|
| 641 |
'\'' . __( 'This group will appear on %pt% edit pages where content belongs to taxonomy: %tx% or View Template is: %vt%',
|
| 642 |
'wpcf' ) . '\'' );
|
| 643 |
wpcf_admin_add_js_settings( 'wpcf_filters_association_and',
|
|
@@ -663,12 +670,12 @@ function wpcf_admin_usermeta_form() {
|
|
| 663 |
|
| 664 |
/**
|
| 665 |
* Dynamically adds existing field on AJAX call.
|
| 666 |
-
*
|
| 667 |
-
* @param type $form_data
|
| 668 |
*/
|
| 669 |
function wpcf_usermeta_insert_existing_ajax() {
|
| 670 |
-
$field = wpcf_admin_fields_get_field( $_GET['field'], false, true, false, 'wpcf-usermeta');
|
| 671 |
-
|
| 672 |
if ( !empty( $field ) ) {
|
| 673 |
echo wpcf_fields_get_field_form( $field['type'], $field );
|
| 674 |
} else {
|
| 2 |
/*
|
| 3 |
* Fields and groups form functions.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/includes/usermeta-form.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-25 12:38:40 +0000 (Wed, 25 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1120400 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 23 |
|
| 24 |
/**
|
| 25 |
* Saves user fields and groups.
|
| 26 |
+
*
|
| 27 |
* If field name is changed in specific group - new one will be created,
|
| 28 |
* otherwise old one will be updated and will appear in that way in other grups.
|
| 29 |
+
*
|
| 30 |
+
* @return type
|
| 31 |
*/
|
| 32 |
function wpcf_admin_save_usermeta_groups_submit($form) {
|
| 33 |
+
if (
|
| 34 |
+
!isset($_POST['wpcf'])
|
| 35 |
+
|| !isset($_POST['wpcf']['group'])
|
| 36 |
+
|| !isset($_POST['wpcf']['group']['name'])
|
| 37 |
+
) {
|
| 38 |
return false;
|
| 39 |
}
|
|
|
|
|
|
|
| 40 |
|
| 41 |
+
$_POST['wpcf']['group']['name'] = trim(strip_tags($_POST['wpcf']['group']['name']));
|
| 42 |
+
|
| 43 |
+
$_POST['wpcf']['group'] = apply_filters('wpcf_group_pre_save', $_POST['wpcf']['group']);
|
| 44 |
+
|
| 45 |
+
if ( empty($_POST['wpcf']['group']['name']) ) {
|
| 46 |
+
$form->triggerError();
|
| 47 |
+
wpcf_admin_message( __( 'Group name can not be empty.', 'wpcf' ), 'error');
|
| 48 |
+
return $form;
|
| 49 |
+
}
|
| 50 |
|
|
|
|
|
|
|
| 51 |
$new_group = false;
|
| 52 |
|
| 53 |
$group_slug = $_POST['wpcf']['group']['slug'] = sanitize_title($_POST['wpcf']['group']['name']);
|
| 54 |
|
| 55 |
// Basic check
|
| 56 |
+
|
| 57 |
+
|
| 58 |
if (isset($_REQUEST['group_id'])) {
|
| 59 |
// Check if group exists
|
| 60 |
+
$post = get_post(intval($_REQUEST['group_id']));
|
| 61 |
// Name changed
|
| 62 |
if (strtolower($_POST['wpcf']['group']['name']) != strtolower($post->post_title)) {
|
| 63 |
// Check if already exists
|
| 64 |
+
$exists = get_page_by_title($_POST['wpcf']['group']['name'], 'OBJECT', 'wp-types-user-group');
|
|
|
|
| 65 |
if (!empty($exists)) {
|
| 66 |
$form->triggerError();
|
| 67 |
+
wpcf_admin_message(
|
| 68 |
+
sprintf(
|
| 69 |
+
__("A group by name <em>%s</em> already exists. Please use a different name and save again.", 'wpcf'),
|
| 70 |
+
htmlspecialchars($_POST['wpcf']['group']['name'])
|
| 71 |
+
),
|
| 72 |
+
'error'
|
| 73 |
+
);
|
| 74 |
return $form;
|
| 75 |
}
|
| 76 |
}
|
| 77 |
if (empty($post) || $post->post_type != 'wp-types-user-group') {
|
| 78 |
$form->triggerError();
|
| 79 |
+
wpcf_admin_message(sprintf(__("Wrong group ID %d", 'wpcf'), intval($_REQUEST['group_id'])), 'error');
|
|
|
|
| 80 |
return $form;
|
| 81 |
}
|
| 82 |
$group_id = $post->ID;
|
| 83 |
+
|
| 84 |
} else {
|
| 85 |
$new_group = true;
|
| 86 |
// Check if already exists
|
| 88 |
'wp-types-user-group');
|
| 89 |
if (!empty($exists)) {
|
| 90 |
$form->triggerError();
|
| 91 |
+
wpcf_admin_message(
|
| 92 |
+
sprintf(
|
| 93 |
+
__("A group by name <em>%s</em> already exists. Please use a different name and save again.", 'wpcf'),
|
| 94 |
+
htmlspecialchars($_POST['wpcf']['group']['name'])
|
| 95 |
+
),
|
| 96 |
+
'error'
|
| 97 |
+
);
|
| 98 |
return $form;
|
| 99 |
}
|
| 100 |
}
|
| 114 |
return $form;
|
| 115 |
}
|
| 116 |
}
|
| 117 |
+
|
| 118 |
foreach ($_POST['wpcf']['fields'] as $key => $field) {
|
| 119 |
$field = apply_filters('wpcf_field_pre_save', $field);
|
| 120 |
if (!empty($field['is_new'])) {
|
| 139 |
if (!empty($field_id)) {
|
| 140 |
$fields[] = $field_id;
|
| 141 |
}
|
| 142 |
+
|
| 143 |
}
|
| 144 |
}
|
| 145 |
|
| 146 |
// Save group
|
| 147 |
$roles = isset($_POST['wpcf']['group']['supports']) ? $_POST['wpcf']['group']['supports'] : array();
|
| 148 |
+
$admin_style = $_POST['wpcf']['group']['admin_styles'];
|
| 149 |
// Rename if needed
|
| 150 |
if (isset($_REQUEST['group_id'])) {
|
| 151 |
+
$_POST['wpcf']['group']['id'] = intval($_REQUEST['group_id']);
|
| 152 |
}
|
| 153 |
|
| 154 |
$group_id = wpcf_admin_fields_save_group($_POST['wpcf']['group'], 'wp-types-user-group');
|
| 165 |
$open_fieldsets);
|
| 166 |
}
|
| 167 |
}
|
| 168 |
+
|
| 169 |
+
|
| 170 |
// Rest of processes
|
| 171 |
if (!empty($group_id)) {
|
| 172 |
wpcf_admin_fields_save_group_fields($group_id, $fields, false, 'wp-types-user-group');
|
| 173 |
wpcf_admin_fields_save_group_showfor($group_id, $roles);
|
| 174 |
+
wpcf_admin_fields_save_group_admin_styles($group_id, $admin_style);
|
| 175 |
+
|
| 176 |
$_POST['wpcf']['group']['fields'] = isset($_POST['wpcf']['fields']) ? $_POST['wpcf']['fields'] : array();
|
| 177 |
do_action('wpcf_save_group', $_POST['wpcf']['group']);
|
| 178 |
wpcf_admin_message_store(apply_filters('types_message_usermeta_saved',
|
| 183 |
} else {
|
| 184 |
wpcf_admin_message_store(__('Error saving group', 'wpcf'), 'error');
|
| 185 |
}
|
| 186 |
+
|
| 187 |
+
|
| 188 |
}
|
| 189 |
|
| 190 |
|
| 192 |
* Generates form data.
|
| 193 |
*/
|
| 194 |
function wpcf_admin_usermeta_form() {
|
| 195 |
+
global $wpcf;
|
| 196 |
wpcf_admin_add_js_settings('wpcf_nonce_toggle_group',
|
| 197 |
'\'' . wp_create_nonce('group_form_collapsed') . '\'');
|
| 198 |
wpcf_admin_add_js_settings('wpcf_nonce_toggle_fieldset',
|
| 208 |
$update = wpcf_admin_fields_get_group(intval($_REQUEST['group_id']), 'wp-types-user-group');
|
| 209 |
if (empty($update)) {
|
| 210 |
$update = false;
|
| 211 |
+
wpcf_admin_message(sprintf(__("Group with ID %d do not exist", 'wpcf'), intval($_REQUEST['group_id'])));
|
|
|
|
| 212 |
} else {
|
| 213 |
+
$update['fields'] = wpcf_admin_fields_get_fields_by_group( sanitize_text_field( $_REQUEST['group_id'] ), 'slug', false, true, false, 'wp-types-user-group', 'wpcf-usermeta');
|
| 214 |
+
$update['show_for'] = wpcf_admin_get_groups_showfor_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 215 |
+
$update['admin_styles'] = wpcf_admin_get_groups_admin_styles_by_group( sanitize_text_field( $_REQUEST['group_id'] ) );
|
| 216 |
}
|
| 217 |
}
|
| 218 |
+
|
| 219 |
$form = array();
|
| 220 |
$form['#form']['callback'] = array('wpcf_admin_save_usermeta_groups_submit');
|
| 221 |
|
| 299 |
continue;
|
| 300 |
}
|
| 301 |
if ( !empty( $field['data']['removed_from_history'] ) ) {
|
| 302 |
+
continue;
|
| 303 |
}
|
| 304 |
$form['fields-existing'][$key] = array(
|
| 305 |
'#type' => 'markup',
|
| 334 |
'#type' => 'markup',
|
| 335 |
'#markup' => '</div>',
|
| 336 |
);
|
| 337 |
+
|
| 338 |
// Group data
|
| 339 |
|
| 340 |
$form['open-main'] = array(
|
| 346 |
'#type' => 'textfield',
|
| 347 |
'#name' => 'wpcf[group][name]',
|
| 348 |
'#id' => 'wpcf-group-name',
|
| 349 |
+
'#value' => $update ? $update['name'] : '',
|
| 350 |
'#inline' => true,
|
| 351 |
+
'#attributes' => array(
|
| 352 |
+
'style' => 'width:100%;margin-bottom:10px;',
|
| 353 |
+
'placeholder' => __('Enter group title', 'wpcf'),
|
| 354 |
+
),
|
| 355 |
'#validate' => array(
|
| 356 |
'required' => array(
|
| 357 |
'value' => true,
|
| 358 |
),
|
| 359 |
)
|
| 360 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 361 |
$form['description'] = array(
|
| 362 |
'#type' => 'textarea',
|
| 363 |
'#id' => 'wpcf-group-description',
|
| 364 |
'#name' => 'wpcf[group][description]',
|
| 365 |
+
'#value' => $update ? $update['description'] : '',
|
| 366 |
+
'#attributes' => array(
|
| 367 |
+
'placeholder' => __('Enter a description for this group', 'wpcf'),
|
| 368 |
+
),
|
| 369 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 370 |
|
| 371 |
+
// Show Fields for
|
| 372 |
+
global $wp_roles;
|
| 373 |
$options = array();
|
| 374 |
$users_currently_supported = array();
|
| 375 |
$form_types = array();
|
| 376 |
+
foreach ( $wp_roles->role_names as $role => $name ) :
|
| 377 |
+
$options[$role]['#name'] = 'wpcf[group][supports][' . $role . ']';
|
| 378 |
$options[$role]['#title'] = ucwords($role);
|
| 379 |
$options[$role]['#default_value'] = ($update && !empty($update['show_for']) && in_array($role,
|
| 380 |
$update['show_for'])) ? 1 : 0;
|
| 387 |
$update['show_for'])) {
|
| 388 |
$users_currently_supported[] = ucwords($role);
|
| 389 |
}
|
| 390 |
+
endforeach;
|
| 391 |
+
|
| 392 |
+
if (empty($users_currently_supported)) {
|
| 393 |
$users_currently_supported[] = __('Displayed for all users roles',
|
| 394 |
'wpcf');
|
| 395 |
}
|
| 404 |
'#inline' => true,
|
| 405 |
);
|
| 406 |
/*
|
| 407 |
+
*
|
| 408 |
* Here we use unique function for all filters
|
| 409 |
* Since Types 1.1.4
|
| 410 |
*/
|
| 413 |
implode(', ', $users_currently_supported),
|
| 414 |
__('Displayed for all users roles', 'wpcf'), $temp);
|
| 415 |
|
| 416 |
+
/*
|
| 417 |
* Now starting form
|
| 418 |
*/
|
| 419 |
+
$access_notification = '';
|
| 420 |
+
if (function_exists('wpcf_access_register_caps')){
|
| 421 |
+
$access_notification = '<div class="message custom wpcf-notif"><span class="wpcf-notif-congrats">'
|
| 422 |
+
. __('This groups visibility is also controlled by the Access plugin.',
|
| 423 |
'wpcf') .'</span></div>';
|
| 424 |
+
}
|
| 425 |
$form['supports-table-open'] = array(
|
| 426 |
'#type' => 'markup',
|
| 427 |
'#markup' => '<table class="widefat"><thead><tr><th>'
|
| 428 |
. __('Where to display this group', 'wpcf')
|
| 429 |
. '</th></tr></thead><tbody><tr><td>'
|
| 430 |
. '<p>'
|
| 431 |
+
. __('Each usermeta group can display different fields for user roles.',
|
| 432 |
'wpcf')
|
| 433 |
+
. $access_notification
|
| 434 |
. '</p>',
|
| 435 |
);
|
| 436 |
/*
|
| 447 |
'#type' => 'markup',
|
| 448 |
'#markup' => '</td></tr></tbody></table><br />',
|
| 449 |
);
|
| 450 |
+
|
| 451 |
+
|
| 452 |
+
|
| 453 |
+
|
| 454 |
+
/** Admin styles**/
|
| 455 |
+
|
| 456 |
+
$form['adminstyles-table-open'] = array(
|
| 457 |
'#type' => 'markup',
|
| 458 |
'#markup' => '<table class="widefat" id="wpcf-admin-styles-box"><thead><tr><th>'
|
| 459 |
. __('Styling Editor', 'wpcf')
|
| 463 |
'wpcf')
|
| 464 |
. '</p>',
|
| 465 |
);
|
| 466 |
+
|
| 467 |
+
$admin_styles_value = $preview_profile = $edit_profile = '';
|
| 468 |
+
if ( isset ($update['admin_styles']) ){
|
| 469 |
+
$admin_styles_value = $update['admin_styles'];
|
| 470 |
+
}
|
| 471 |
+
$temp = '';
|
| 472 |
+
if ($update){
|
| 473 |
+
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields.php';
|
| 474 |
+
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
| 475 |
+
require_once WPCF_EMBEDDED_INC_ABSPATH . '/fields-post.php';
|
| 476 |
+
require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta-post.php';
|
| 477 |
+
|
| 478 |
+
$user_id = wpcf_usermeta_get_user();
|
| 479 |
+
$preview_profile = wpcf_usermeta_preview_profile( $user_id, $update, 1 );
|
| 480 |
+
$group = $update;
|
| 481 |
+
$group['fields'] = wpcf_admin_usermeta_process_fields( $user_id, $group['fields'], true, false );
|
| 482 |
+
$edit_profile = wpcf_admin_render_fields($group, $user_id, 1);
|
| 483 |
add_action( 'admin_enqueue_scripts', 'wpcf_admin_fields_form_fix_styles', PHP_INT_MAX );
|
| 484 |
+
}
|
| 485 |
+
$temp[] = array(
|
| 486 |
+
'#type' => 'radio',
|
| 487 |
+
'#suffix' => '<br />',
|
| 488 |
+
'#value' => 'edit_mode',
|
| 489 |
+
'#title' => 'Edit mode',
|
| 490 |
'#name' => 'wpcf[group][preview]','#default_value' => '',
|
| 491 |
+
'#before' => '<div class="wpcf-admin-css-preview-style-edit">',
|
| 492 |
'#inline' => true,
|
| 493 |
+
'#attributes' => array('onclick' => 'changePreviewHtml(\'editmode\')','checked'=>'checked')
|
| 494 |
+
);
|
| 495 |
+
|
| 496 |
+
$temp[] = array(
|
| 497 |
+
'#type' => 'radio',
|
| 498 |
+
'#title' => 'Read Only',
|
| 499 |
'#name' => 'wpcf[group][preview]','#default_value' => '',
|
| 500 |
+
'#after' => '</div>',
|
| 501 |
'#inline' => true,
|
| 502 |
+
'#attributes' => array('onclick' => 'changePreviewHtml(\'readonly\')')
|
| 503 |
+
);
|
| 504 |
+
|
| 505 |
+
$temp[] = array(
|
| 506 |
'#type' => 'textarea',
|
| 507 |
'#name' => 'wpcf[group][admin_html_preview]',
|
| 508 |
'#inline' => true,
|
| 509 |
+
'#value' => '',
|
| 510 |
+
'#id' => 'wpcf-form-groups-admin-html-preview',
|
| 511 |
+
'#before' => '<h3>Field group HTML</h3>'
|
| 512 |
);
|
| 513 |
+
|
| 514 |
+
$temp[] = array(
|
| 515 |
'#type' => 'textarea',
|
| 516 |
'#name' => 'wpcf[group][admin_styles]',
|
| 517 |
'#inline' => true,
|
| 518 |
+
'#value' => $admin_styles_value,
|
| 519 |
+
'#default_value' => '',
|
| 520 |
+
'#id' => 'wpcf-form-groups-css-fields-editor',
|
| 521 |
+
'#after' => '
|
| 522 |
+
<div class="wpcf-update-preview-btn"><input type="button" value="Update preview" onclick="wpcfPreviewHtml()" style="float:right;" class="button-secondary"></div>
|
| 523 |
+
<h3>Field group preview</h3>
|
| 524 |
+
<div id="wpcf-update-preview-div">Preview here</div>
|
| 525 |
+
<script type="text/javascript">
|
| 526 |
+
var wpcfReadOnly = ' . json_encode($preview_profile) . ';
|
| 527 |
+
var wpcfEditMode = ' . json_encode($edit_profile) . ';
|
| 528 |
+
var wpcfDefaultCss = ' . json_encode($admin_styles_value) . ';
|
| 529 |
+
</script>
|
| 530 |
+
',
|
| 531 |
+
'#before' => '<h3>Your CSS</h3>'
|
| 532 |
);
|
| 533 |
+
|
| 534 |
+
|
| 535 |
+
|
| 536 |
+
|
| 537 |
+
$admin_styles = _wpcf_filter_wrap( 'admin_styles',
|
| 538 |
__('Admin styles for fields:', 'wpcf'), '', '', $temp, __( 'Open style editor', 'wpcf' ) );
|
| 539 |
+
$form['p_wrap_1_' . wpcf_unique_id(serialize($admin_styles))] = array(
|
| 540 |
'#type' => 'markup',
|
| 541 |
'#markup' => '<p class="wpcf-filter-wrap">',
|
| 542 |
);
|
| 543 |
+
$form = $form + $admin_styles;
|
| 544 |
+
$form['adminstyles-table-close'] = array(
|
| 545 |
'#type' => 'markup',
|
| 546 |
'#markup' => '</td></tr></tbody></table><br />',
|
| 547 |
);
|
| 548 |
+
/** End admin Styles **/
|
| 549 |
+
|
| 550 |
+
|
| 551 |
+
|
| 552 |
+
|
| 553 |
// Group fields
|
| 554 |
|
| 555 |
$form['fields_title'] = array(
|
| 643 |
'#markup' => '</div>',
|
| 644 |
);
|
| 645 |
|
| 646 |
+
|
| 647 |
+
wpcf_admin_add_js_settings( 'wpcf_filters_association_or',
|
| 648 |
'\'' . __( 'This group will appear on %pt% edit pages where content belongs to taxonomy: %tx% or View Template is: %vt%',
|
| 649 |
'wpcf' ) . '\'' );
|
| 650 |
wpcf_admin_add_js_settings( 'wpcf_filters_association_and',
|
| 670 |
|
| 671 |
/**
|
| 672 |
* Dynamically adds existing field on AJAX call.
|
| 673 |
+
*
|
| 674 |
+
* @param type $form_data
|
| 675 |
*/
|
| 676 |
function wpcf_usermeta_insert_existing_ajax() {
|
| 677 |
+
$field = wpcf_admin_fields_get_field( sanitize_text_field( $_GET['field'] ), false, true, false, 'wpcf-usermeta');
|
| 678 |
+
|
| 679 |
if ( !empty( $field ) ) {
|
| 680 |
echo wpcf_fields_get_field_form( $field['type'], $field );
|
| 681 |
} else {
|
includes/usermeta-list.php
CHANGED
|
@@ -6,74 +6,22 @@
|
|
| 6 |
/**
|
| 7 |
* Renders 'widefat' table.
|
| 8 |
*/
|
| 9 |
-
function wpcf_admin_usermeta_list()
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
'group_description' => __('Description', 'wpcf'),
|
| 27 |
-
'group_active' => __('Active', 'wpcf'),
|
| 28 |
-
'group_post_types' => __('Available for', 'wpcf'),
|
| 29 |
-
);
|
| 30 |
-
foreach ($groups as $group) {
|
| 31 |
-
|
| 32 |
-
// Set 'name' column
|
| 33 |
-
$name = '';
|
| 34 |
-
$name .= '<a href="'
|
| 35 |
-
. admin_url('admin.php?page=wpcf-edit-usermeta&group_id='
|
| 36 |
-
. $group['id']) . '">' . $group['name'] . '</a>';
|
| 37 |
-
$name .= '<br />';
|
| 38 |
-
$name .= '<a href="'
|
| 39 |
-
. admin_url('admin.php?page=wpcf-edit-usermeta&group_id='
|
| 40 |
-
. $group['id']) . '">' . __('Edit', 'wpcf') . '</a> | ';
|
| 41 |
-
|
| 42 |
-
$name .= $group['is_active'] ? wpcf_admin_usermeta_get_ajax_deactivation_link($group['id']) .
|
| 43 |
-
' | ' : wpcf_admin_usermeta_get_ajax_activation_link($group['id']) . ' | ';
|
| 44 |
-
|
| 45 |
-
$name .= '<a href="'
|
| 46 |
-
. admin_url('admin-ajax.php?action=wpcf_ajax&'
|
| 47 |
-
. 'wpcf_action=delete_usermeta_group&group_id='
|
| 48 |
-
. $group['id'] . '&wpcf_ajax_update=wpcf_list_ajax_response_'
|
| 49 |
-
. $group['id']) . '&_wpnonce=' . wp_create_nonce('delete_usermeta_group')
|
| 50 |
-
. '&wpcf_warning='
|
| 51 |
-
. __('Are you sure?', 'wpcf') . '" class="wpcf-ajax-link" '
|
| 52 |
-
. 'id="wpcf-list-delete-' . $group['id'] . '">'
|
| 53 |
-
. __('Delete Permanently', 'wpcf') . '</a>';
|
| 54 |
-
|
| 55 |
-
$name .= '<div id="wpcf_list_ajax_response_' . $group['id'] . '"></div>';
|
| 56 |
-
|
| 57 |
-
$rows[$group['id']]['name'] = $name;
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
$rows[$group['id']]['description'] = $group['description'];
|
| 61 |
-
$rows[$group['id']]['active-' . $group['id']] = $group['is_active'] ? __('Yes', 'wpcf') : __('No', 'wpcf');
|
| 62 |
-
$show_for = wpcf_admin_get_groups_showfor_by_group($group['id']);
|
| 63 |
-
if (function_exists('wpcf_access_register_caps')){
|
| 64 |
-
$show_for = __('This groups visibility is also controlled by the Access plugin.',
|
| 65 |
-
'wpcf');
|
| 66 |
-
}
|
| 67 |
-
else{
|
| 68 |
-
$show_for = (count($show_for) == 0) ? __('Displayed for all users roles', 'wpcf') : ucwords(implode($show_for, ', '));
|
| 69 |
-
}
|
| 70 |
-
$rows[$group['id']]['group_post_types'] = $show_for;
|
| 71 |
-
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
// Render table
|
| 75 |
-
wpcf_admin_widefat_table('wpcf_groups_list', $header, $rows);
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
do_action('wpcf_groups_list_table_after');
|
| 79 |
-
}
|
| 6 |
/**
|
| 7 |
* Renders 'widefat' table.
|
| 8 |
*/
|
| 9 |
+
function wpcf_admin_usermeta_list()
|
| 10 |
+
{
|
| 11 |
+
include_once dirname(__FILE__).'/classes/class.wpcf.user.fields.list.table.php';
|
| 12 |
+
//Create an instance of our package class...
|
| 13 |
+
$listTable = new WPCF_User_Fields_List_Table();
|
| 14 |
+
//Fetch, prepare, sort, and filter our data...
|
| 15 |
+
$listTable->prepare_items();
|
| 16 |
+
?>
|
| 17 |
+
<!-- Forms are NOT created automatically, so you need to wrap the table in one to use features like bulk actions -->
|
| 18 |
+
<form id="usermeta-filter" method="post">
|
| 19 |
+
<!-- For plugins, we also need to ensure that the form posts back to our current page -->
|
| 20 |
+
<input type="hidden" name="page" value="<?php echo esc_attr($_REQUEST['page']); ?>" />
|
| 21 |
+
<?php $listTable->search_box(__('Search user fields', 'wcpf'), 'search_id'); ?>
|
| 22 |
+
<!-- Now we can render the completed list table -->
|
| 23 |
+
<?php $listTable->display() ?>
|
| 24 |
+
</form>
|
| 25 |
+
<?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 26 |
do_action('wpcf_groups_list_table_after');
|
| 27 |
+
}
|
includes/usermeta.php
CHANGED
|
@@ -10,14 +10,14 @@ require_once WPCF_EMBEDDED_INC_ABSPATH . '/usermeta.php';
|
|
| 10 |
* @param type $group_id
|
| 11 |
* @return type
|
| 12 |
*/
|
| 13 |
-
function wpcf_admin_usermeta_get_ajax_activation_link($group_id)
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
}
|
| 22 |
|
| 23 |
/**
|
|
@@ -26,12 +26,46 @@ function wpcf_admin_usermeta_get_ajax_activation_link($group_id) {
|
|
| 26 |
* @return type
|
| 27 |
*/
|
| 28 |
function wpcf_admin_usermeta_get_ajax_deactivation_link($group_id) {
|
| 29 |
-
return
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
. __('Deactivate', 'wpcf') . '</a>';
|
| 36 |
}
|
| 37 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 10 |
* @param type $group_id
|
| 11 |
* @return type
|
| 12 |
*/
|
| 13 |
+
function wpcf_admin_usermeta_get_ajax_activation_link($group_id)
|
| 14 |
+
{
|
| 15 |
+
return sprintf(
|
| 16 |
+
'<a href="%s" class="wpcf-ajax-link" id="wpcf-list-activate-%d">%s</a>',
|
| 17 |
+
wpcf_admin_usermeta_get_ajax_link('activate', $group_id),
|
| 18 |
+
$group_id,
|
| 19 |
+
__('Activate', 'wpcf')
|
| 20 |
+
);
|
| 21 |
}
|
| 22 |
|
| 23 |
/**
|
| 26 |
* @return type
|
| 27 |
*/
|
| 28 |
function wpcf_admin_usermeta_get_ajax_deactivation_link($group_id) {
|
| 29 |
+
return sprintf(
|
| 30 |
+
'<a href="%s" class="wpcf-ajax-link" id="wpcf-list-activate-%d">%s</a>',
|
| 31 |
+
wpcf_admin_usermeta_get_ajax_link('deactivate', $group_id),
|
| 32 |
+
$group_id,
|
| 33 |
+
__('Deactivate', 'wpcf')
|
| 34 |
+
);
|
|
|
|
| 35 |
}
|
| 36 |
|
| 37 |
+
/**
|
| 38 |
+
* Helper function to build url
|
| 39 |
+
*
|
| 40 |
+
* @param string $status status of action
|
| 41 |
+
* @param int $group_id group id
|
| 42 |
+
* @return string link for Activate/Deactivate action
|
| 43 |
+
*/
|
| 44 |
+
function wpcf_admin_usermeta_get_ajax_link($status, $group_id)
|
| 45 |
+
{
|
| 46 |
+
/**
|
| 47 |
+
* sanitize status
|
| 48 |
+
*/
|
| 49 |
+
if ( !preg_match('/^(de)?activate$/', $status ) ) {
|
| 50 |
+
return '#wrong-status';
|
| 51 |
+
}
|
| 52 |
+
/**
|
| 53 |
+
* sanitize group_id
|
| 54 |
+
*/
|
| 55 |
+
if ( !is_numeric($group_id) ) {
|
| 56 |
+
return '#wrong-group_id';
|
| 57 |
+
}
|
| 58 |
+
/**
|
| 59 |
+
* build link
|
| 60 |
+
*/
|
| 61 |
+
return add_query_arg(
|
| 62 |
+
array(
|
| 63 |
+
'action' => 'wpcf_ajax',
|
| 64 |
+
'wpcf_action' => $status.'_user_group',
|
| 65 |
+
'group_id' => $group_id,
|
| 66 |
+
'wpcf_ajax_update' => 'wpcf_list_ajax_response_' . $group_id,
|
| 67 |
+
'_wpnonce' => '' . wp_create_nonce($status.'_user_group'),
|
| 68 |
+
),
|
| 69 |
+
admin_url('admin-ajax.php')
|
| 70 |
+
);
|
| 71 |
+
}
|
marketing/helpful-links.php
CHANGED
|
@@ -1,5 +1,12 @@
|
|
| 1 |
-
|
| 2 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
|
| 4 |
<ul style="margin-left:1em;">
|
| 5 |
<li>
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* $HeadURL: https://www.onthegosystems.com/misc_svn/cck/trunk/marketing/helpful-links.php $
|
| 4 |
+
* $LastChangedDate: 2015-02-26 07:51:21 +0100 (Thu, 26 Feb 2015) $
|
| 5 |
+
* $LastChangedRevision: 31922 $
|
| 6 |
+
* $LastChangedBy: marcin $
|
| 7 |
+
*
|
| 8 |
+
*/
|
| 9 |
+
?><h3><?php _e('Need Help?', 'wpcf'); ?></h3>
|
| 10 |
|
| 11 |
<ul style="margin-left:1em;">
|
| 12 |
<li>
|
plus/installer/changelog.txt
CHANGED
|
@@ -1,8 +1,15 @@
|
|
| 1 |
-
= 1.5.
|
| 2 |
-
*
|
| 3 |
|
| 4 |
-
= 1.5.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 5 |
|
|
|
|
| 6 |
* Fix for allowing embedded plugins to be updated
|
| 7 |
* Logic for the migration from embedded plugins to full plugins
|
| 8 |
|
| 1 |
+
= 1.5.3 =
|
| 2 |
+
* Fixed bug in WP_Installer::custom_plugins_api_call (filter for plugins_api) causing conflicts with other filters for plugins_api
|
| 3 |
|
| 4 |
+
= 1.5.2 =
|
| 5 |
+
* More meaningful errors when plugin downloads fail
|
| 6 |
+
* WordPress 4.2 compatibility
|
| 7 |
+
* Performance improvements (will not load in places where it's not needed and not make unnecessary requests to the CDN)
|
| 8 |
+
* Support putting deps.xml config file in the theme folder (root)
|
| 9 |
+
* Included code for importing data for toolset plugins
|
| 10 |
+
* Use CloudFront urls for products list files
|
| 11 |
|
| 12 |
+
= 1.5.1 =
|
| 13 |
* Fix for allowing embedded plugins to be updated
|
| 14 |
* Logic for the migration from embedded plugins to full plugins
|
| 15 |
|
plus/installer/includes/deps-loader.class.php
DELETED
|
@@ -1,558 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
class Installer_Deps_Loader{
|
| 4 |
-
|
| 5 |
-
private $config = array();
|
| 6 |
-
private $missing = array();
|
| 7 |
-
|
| 8 |
-
function __construct(){
|
| 9 |
-
|
| 10 |
-
//_disable_wp_redirects
|
| 11 |
-
if(isset($_POST['action']) && $_POST['action'] == 'wp_installer_fix_deps'){
|
| 12 |
-
add_filter('wp_redirect', '__return_false', 10000);
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
add_action('admin_init', array($this, 'init'), 30);
|
| 16 |
-
add_filter('installer_deps_missing', array($this, 'get_missing_deps'));
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function init(){
|
| 20 |
-
global $wp_installer_instances;
|
| 21 |
-
|
| 22 |
-
$repositories = array();
|
| 23 |
-
|
| 24 |
-
add_action('wp_ajax_wp_installer_fix_deps', array($this, 'run'));
|
| 25 |
-
|
| 26 |
-
foreach($wp_installer_instances as $instance) {
|
| 27 |
-
|
| 28 |
-
$config_file = dirname($instance['bootfile']) . '/deps.xml';
|
| 29 |
-
|
| 30 |
-
if (file_exists($config_file) && is_readable($config_file)) {
|
| 31 |
-
|
| 32 |
-
$config = $this->read_config($config_file);
|
| 33 |
-
$config_arr_key = md5($config_file) . '|' . $config['name'];
|
| 34 |
-
|
| 35 |
-
foreach ($config['repositories'] as $repository_id => $repository) {
|
| 36 |
-
|
| 37 |
-
foreach ($repository['plugins'] as $plugin) {
|
| 38 |
-
|
| 39 |
-
if(empty($plugin['version']) || $plugin['version'] == 'latest'){
|
| 40 |
-
$plugin['version'] = WP_Installer()->get_plugin_repository_version($repository_id, $plugin['name']);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
$plugin_full_name = $this->get_plugin_full_name($repository_id, $plugin['name'], $config);
|
| 45 |
-
if (!$plugin_full_name) continue;
|
| 46 |
-
|
| 47 |
-
$real_basename = $plugin['name'];
|
| 48 |
-
if (isset($plugin['format'])) {
|
| 49 |
-
$real_basename .= '-' . $plugin['format'];
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
$latest_version = WP_Installer()->get_plugin_repository_version($repository_id, $plugin['name']);
|
| 53 |
-
$installed_version = WP_Installer()->get_plugin_installed_version($plugin_full_name, $plugin['name']);
|
| 54 |
-
|
| 55 |
-
if ($this->is_plugin_installed($plugin['name']) && !$this->is_plugin_installed($real_basename)) { //FULL PLUGIN INSTALLED?
|
| 56 |
-
if (!$this->is_plugin_active($plugin['name'])) {
|
| 57 |
-
$this->missing[$config_arr_key][] = array(
|
| 58 |
-
'basename' => $plugin['name'],
|
| 59 |
-
'name' => $plugin_full_name,
|
| 60 |
-
'url' => $this->get_plugin_download_url($repository_id, $plugin['name'], $config),
|
| 61 |
-
'repository_id' => $repository_id,
|
| 62 |
-
'status' => __('inactive', 'installer')
|
| 63 |
-
);
|
| 64 |
-
} else {
|
| 65 |
-
continue;
|
| 66 |
-
}
|
| 67 |
-
} elseif (!$this->is_plugin_installed($real_basename)) {
|
| 68 |
-
$this->missing[$config_arr_key][] = array(
|
| 69 |
-
'basename' => $plugin['name'],
|
| 70 |
-
'name' => $plugin_full_name,
|
| 71 |
-
'url' => $this->get_plugin_download_url($repository_id, $plugin['name'], $config),
|
| 72 |
-
'repository_id' => $repository_id,
|
| 73 |
-
'status' => __('not installed', 'installer')
|
| 74 |
-
);
|
| 75 |
-
} elseif (version_compare($latest_version, $installed_version)) {
|
| 76 |
-
|
| 77 |
-
if(!$this->is_plugin_active($real_basename) && !$this->is_plugin_active($plugin['name'])){
|
| 78 |
-
$status = sprintf(__('inactive and out of date: installed - %s, available - %s', 'installer'), $installed_version, $latest_version);
|
| 79 |
-
}else{
|
| 80 |
-
$status = sprintf(__('out of date: installed - %s, available - %s', 'installer'), $installed_version, $latest_version);
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
$this->missing[$config_arr_key][] = array(
|
| 84 |
-
'basename' => $plugin['name'],
|
| 85 |
-
'name' => $plugin_full_name,
|
| 86 |
-
'url' => $this->get_plugin_download_url($repository_id, $plugin['name'], $config),
|
| 87 |
-
'repository_id' => $repository_id,
|
| 88 |
-
'status' => $status
|
| 89 |
-
);
|
| 90 |
-
} elseif (!$this->is_plugin_active($real_basename) && !$this->is_plugin_active($plugin['name'])) {
|
| 91 |
-
$this->missing[$config_arr_key][] = array(
|
| 92 |
-
'basename' => $plugin['name'],
|
| 93 |
-
'name' => $plugin_full_name,
|
| 94 |
-
'url' => $this->get_plugin_download_url($repository_id, $plugin['name'], $config),
|
| 95 |
-
'repository_id' => $repository_id,
|
| 96 |
-
'status' => __('inactive', 'installer')
|
| 97 |
-
);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
//set affiliate info if any
|
| 101 |
-
if (isset($repository['affiliate_id']) && isset($repository['affiliate_key'])) {
|
| 102 |
-
WP_Installer()->set_config('affiliate_id:' . $repository_id, $repository['affiliate_id']);
|
| 103 |
-
WP_Installer()->set_config('affiliate_key:' . $repository_id, $repository['affiliate_key']);
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
$this->config[$config_arr_key] = $config;
|
| 111 |
-
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
if($this->missing){
|
| 117 |
-
add_action('admin_notices', array($this, 'setup_notice'));
|
| 118 |
-
add_action('admin_footer', array($this, 'js_footer'));
|
| 119 |
-
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
public function read_config($config_file){
|
| 125 |
-
|
| 126 |
-
$repositories = array();
|
| 127 |
-
|
| 128 |
-
$repositories_xml = simplexml_load_file($config_file);
|
| 129 |
-
|
| 130 |
-
$array = json_decode(json_encode($repositories_xml), true);
|
| 131 |
-
|
| 132 |
-
$repositories_arr = isset($array['repositories']['repository'][0]) ? $array['repositories']['repository'] : array($array['repositories']['repository']);
|
| 133 |
-
|
| 134 |
-
foreach($repositories_arr as $r){
|
| 135 |
-
$r['plugins'] = isset($r['plugins']['plugin'][0]) ? $r['plugins']['plugin'] : array($r['plugins']['plugin']);
|
| 136 |
-
|
| 137 |
-
$repositories[$r['id']] = $r;
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
$config['repositories'] = $repositories;
|
| 141 |
-
$config['name'] = $array['name'];
|
| 142 |
-
|
| 143 |
-
return $config;
|
| 144 |
-
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
public function get_missing_deps(){
|
| 148 |
-
return $this->missing;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
public function setup_notice(){
|
| 152 |
-
?>
|
| 153 |
-
<div class="updated" id="wp_installer_fix_deps_notice" >
|
| 154 |
-
<?php foreach($this->missing as $key => $missing): ?>
|
| 155 |
-
<?php list($null, $name) = explode('|', $key); ?>
|
| 156 |
-
<p><strong><?php printf(__('%s needs these plugins to work:', 'installer'), $name); ?></strong></p>
|
| 157 |
-
<ul>
|
| 158 |
-
<?php foreach($missing as $p): ?>
|
| 159 |
-
<li>
|
| 160 |
-
<?php echo $p['name'] ?> (<?php echo $p['status'] ?>)
|
| 161 |
-
<?php if(!WP_Installer()->is_uploading_allowed()): ?>
|
| 162 |
-
| <a href="<?php echo $p['url'] ?>"><?php _e('Download', 'installer') ?></a>
|
| 163 |
-
<?php endif; ?>
|
| 164 |
-
</li>
|
| 165 |
-
<?php endforeach;?>
|
| 166 |
-
</ul>
|
| 167 |
-
|
| 168 |
-
<?php endforeach; ?>
|
| 169 |
-
|
| 170 |
-
<?php if(!WP_Installer()->is_uploading_allowed()): ?>
|
| 171 |
-
<p class="installer-warn-box">
|
| 172 |
-
<?php _e('Automatic downloading is not possible because WordPress cannot write into the plugins folder. Please use the download links above to get the zip files, unpack and upload to the plugins folder. If folders with the same name exist, please replace with the new ones.', 'installer') ?>
|
| 173 |
-
</p>
|
| 174 |
-
<?php endif; ?>
|
| 175 |
-
|
| 176 |
-
<p class="submit">
|
| 177 |
-
<input id="wp_installer_fix_deps" type="button" class="button-primary" value="<?php esc_attr_e('Install and activate', 'installer') ?>" <?php
|
| 178 |
-
disabled(!WP_Installer()->is_uploading_allowed()); ?> />
|
| 179 |
-
<span class="spinner"></span> <span id="wp_installer_fix_deps_status"></span>
|
| 180 |
-
</p>
|
| 181 |
-
|
| 182 |
-
</div>
|
| 183 |
-
|
| 184 |
-
<?php
|
| 185 |
-
|
| 186 |
-
}
|
| 187 |
-
|
| 188 |
-
public function is_plugin_installed($basename, $version = false, $compare = '='){
|
| 189 |
-
|
| 190 |
-
$is = false;
|
| 191 |
-
$plugins = get_plugins();
|
| 192 |
-
foreach($plugins as $plugin_id => $plugin_data){
|
| 193 |
-
|
| 194 |
-
if(dirname($plugin_id) == $basename){
|
| 195 |
-
if($version !== false ){
|
| 196 |
-
if(version_compare($plugin_data['Version'], $version, $compare)){
|
| 197 |
-
$is = true;
|
| 198 |
-
}
|
| 199 |
-
}else{
|
| 200 |
-
$is = true;
|
| 201 |
-
|
| 202 |
-
}
|
| 203 |
-
break;
|
| 204 |
-
|
| 205 |
-
}
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
return $is;
|
| 209 |
-
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
public function is_plugin_active($basename){
|
| 213 |
-
|
| 214 |
-
$is = false;
|
| 215 |
-
$plugins = get_plugins();
|
| 216 |
-
foreach($plugins as $plugin_id => $plugin_data){
|
| 217 |
-
if(dirname($plugin_id) == $basename && is_plugin_active($plugin_id)){
|
| 218 |
-
$is = true;
|
| 219 |
-
break;
|
| 220 |
-
|
| 221 |
-
}
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
return $is;
|
| 225 |
-
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
public function get_plugin_id($basename){
|
| 229 |
-
|
| 230 |
-
$plugin_wp_id = false;
|
| 231 |
-
|
| 232 |
-
$plugins = get_plugins();
|
| 233 |
-
foreach($plugins as $plugin_id => $plugin_data){
|
| 234 |
-
if(dirname($plugin_id) == $basename){
|
| 235 |
-
$plugin_wp_id = $plugin_id;
|
| 236 |
-
break;
|
| 237 |
-
|
| 238 |
-
}
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
return $plugin_wp_id;
|
| 242 |
-
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
function plugins_upgrade_check($update_plugins){
|
| 246 |
-
global $wp_installer_instances;
|
| 247 |
-
|
| 248 |
-
foreach($wp_installer_instances as $instance) {
|
| 249 |
-
|
| 250 |
-
$config_file = dirname($instance['bootfile']) . '/deps.xml';
|
| 251 |
-
|
| 252 |
-
if (file_exists($config_file) && is_readable($config_file)) {
|
| 253 |
-
|
| 254 |
-
$config = $this->read_config($config_file);
|
| 255 |
-
$config_arr_key = md5($config_file) . '|' . $config['name'];
|
| 256 |
-
|
| 257 |
-
foreach($config['repositories'] as $repository_id => $repository){
|
| 258 |
-
|
| 259 |
-
$downloads = $this->get_repository_downloads($repository_id, $config);
|
| 260 |
-
|
| 261 |
-
foreach($repository['plugins'] as $plugin){
|
| 262 |
-
|
| 263 |
-
if(!isset($downloads[$plugin['name']])) continue;
|
| 264 |
-
|
| 265 |
-
$real_basename = $plugin['name'];
|
| 266 |
-
if(isset($plugin['format']) && $plugin['format'] != 'standard'){
|
| 267 |
-
$real_basename .= '-' . $plugin['format'];
|
| 268 |
-
}
|
| 269 |
-
$plugin_wp_id = $this->get_plugin_id($real_basename);
|
| 270 |
-
if($plugin_wp_id){
|
| 271 |
-
|
| 272 |
-
$latest_version = WP_Installer()->get_plugin_repository_version($repository_id, $plugin['name']);
|
| 273 |
-
|
| 274 |
-
$response = new stdClass();
|
| 275 |
-
$response->id = 0;
|
| 276 |
-
$response->slug = $real_basename;
|
| 277 |
-
$response->plugin = $plugin_wp_id;
|
| 278 |
-
$response->new_version = $latest_version;
|
| 279 |
-
$response->upgrade_notice = '';
|
| 280 |
-
$response->url = $this->get_plugin_download_url($repository_id, $plugin['name'], $config);
|
| 281 |
-
$response->package = $this->get_plugin_download_url($repository_id, $plugin['name'], $config);
|
| 282 |
-
$update_plugins->checked[$plugin_wp_id] = $latest_version;
|
| 283 |
-
$update_plugins->response[$plugin_wp_id] = $response;
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
}
|
| 289 |
-
|
| 290 |
-
}
|
| 291 |
-
|
| 292 |
-
}
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
return $update_plugins;
|
| 296 |
-
}
|
| 297 |
-
|
| 298 |
-
public function run(){
|
| 299 |
-
global $wp_installer_instances;
|
| 300 |
-
|
| 301 |
-
$return['stop'] = 0;
|
| 302 |
-
|
| 303 |
-
foreach($wp_installer_instances as $instance) {
|
| 304 |
-
|
| 305 |
-
$config_file = dirname($instance['bootfile']) . '/deps.xml';
|
| 306 |
-
|
| 307 |
-
if (file_exists($config_file) && is_readable($config_file)) {
|
| 308 |
-
|
| 309 |
-
$config = $this->read_config($config_file);
|
| 310 |
-
$config_arr_key = md5($config_file) . '|' . $config['name'];
|
| 311 |
-
|
| 312 |
-
foreach($config['repositories'] as $repository_id => $repository){
|
| 313 |
-
|
| 314 |
-
$downloads = $this->get_repository_downloads($repository_id, $config);
|
| 315 |
-
|
| 316 |
-
foreach($repository['plugins'] as $plugin){
|
| 317 |
-
|
| 318 |
-
if(!isset($downloads[$plugin['name']])) continue;
|
| 319 |
-
|
| 320 |
-
$plugin_full_name = $this->get_plugin_full_name($repository_id, $plugin['name'], $config);
|
| 321 |
-
|
| 322 |
-
$latest_version = WP_Installer()->get_plugin_repository_version($repository_id, $plugin['name']);
|
| 323 |
-
$installed_version = WP_Installer()->get_plugin_installed_version($plugin_full_name, $plugin['name']);
|
| 324 |
-
|
| 325 |
-
$real_basename = $plugin['name'];
|
| 326 |
-
if(isset($plugin['format']) && $plugin['format'] != 'standard'){
|
| 327 |
-
$real_basename .= '-' . $plugin['format'];
|
| 328 |
-
}
|
| 329 |
-
|
| 330 |
-
$plugin_downloaded_once = false;
|
| 331 |
-
if(isset($_POST['plugins_downloaded'])){
|
| 332 |
-
$return['plugins_downloaded'] = $_POST['plugins_downloaded'];
|
| 333 |
-
if(in_array($real_basename, $_POST['plugins_downloaded'])){
|
| 334 |
-
$plugin_downloaded_once = true;
|
| 335 |
-
}
|
| 336 |
-
}else{
|
| 337 |
-
$return['plugins_downloaded'] = array();
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
if(!$plugin_downloaded_once && $this->is_plugin_installed($plugin['name']) && !$this->is_plugin_active($plugin['name']) && !$this->is_plugin_active($real_basename)){ // FULL PLUGIN PRESENT BUT INACTIVE
|
| 341 |
-
if($plugin_wp_id = $this->get_plugin_id($plugin['name'])){
|
| 342 |
-
//prevent redirects
|
| 343 |
-
add_filter('wp_redirect', '__return_false', 10000);
|
| 344 |
-
$ret = activate_plugin($plugin_wp_id);
|
| 345 |
-
$return['status_message'] = sprintf(__('Activated %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 346 |
-
}else{
|
| 347 |
-
|
| 348 |
-
$return['status_message'] = sprintf(__('Plugin not found: %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 349 |
-
$return['stop'] = 1;
|
| 350 |
-
}
|
| 351 |
-
break; // one operation at the time
|
| 352 |
-
}elseif(!$plugin_downloaded_once && !$this->is_plugin_installed($real_basename) && !$this->is_plugin_installed($plugin['name'])){
|
| 353 |
-
$ret = WP_Installer()->download_plugin($downloads[$plugin['name']]['basename'],
|
| 354 |
-
$downloads[$plugin['name']]['url']);
|
| 355 |
-
if($ret){
|
| 356 |
-
$return['status_message'] = sprintf(__('Installed %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 357 |
-
}else{
|
| 358 |
-
$return['status_message'] = sprintf(__('Failed to download %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 359 |
-
$return['stop'] = 1;
|
| 360 |
-
}
|
| 361 |
-
$return['plugins_downloaded'][] = $real_basename;
|
| 362 |
-
break; // one operation at the time
|
| 363 |
-
|
| 364 |
-
} elseif (version_compare($latest_version, $installed_version)) {
|
| 365 |
-
|
| 366 |
-
require_once ABSPATH . 'wp-admin/includes/class-wp-upgrader.php';
|
| 367 |
-
require_once WP_Installer()->plugin_path() . '/includes/installer-upgrader-skins.php';
|
| 368 |
-
|
| 369 |
-
$upgrader_skins = new Installer_Upgrader_Skins(); //use our custom (mute) Skin
|
| 370 |
-
$upgrader = new Plugin_Upgrader($upgrader_skins);
|
| 371 |
-
|
| 372 |
-
remove_action( 'upgrader_process_complete', array( 'Language_Pack_Upgrader', 'async_upgrade' ), 20 );
|
| 373 |
-
add_filter( 'site_transient_update_plugins', array( $this, 'plugins_upgrade_check') );
|
| 374 |
-
|
| 375 |
-
$plugin_wp_id = $this->get_plugin_id($real_basename);
|
| 376 |
-
$ret = $upgrader->upgrade($plugin_wp_id);
|
| 377 |
-
|
| 378 |
-
if($ret){
|
| 379 |
-
activate_plugin($plugin_wp_id);
|
| 380 |
-
$return['status_message'] = sprintf(__('Upgraded %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 381 |
-
}else{
|
| 382 |
-
$return['status_message'] = sprintf(__('Failed to upgrade %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 383 |
-
$return['stop'] = 1;
|
| 384 |
-
}
|
| 385 |
-
|
| 386 |
-
$return['plugins_downloaded'][] = $real_basename;
|
| 387 |
-
|
| 388 |
-
break; // one operation at the time
|
| 389 |
-
|
| 390 |
-
}elseif(!$this->is_plugin_active($real_basename) && !$this->is_plugin_active($plugin['name'])){
|
| 391 |
-
|
| 392 |
-
if($plugin_wp_id = $this->get_plugin_id($real_basename)){
|
| 393 |
-
//prevent redirects
|
| 394 |
-
add_filter('wp_redirect', '__return_false', 10000);
|
| 395 |
-
|
| 396 |
-
$ret = activate_plugin($plugin_wp_id);
|
| 397 |
-
$return['status_message'] = sprintf(__('Activated %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 398 |
-
}else{
|
| 399 |
-
|
| 400 |
-
$return['status_message'] = sprintf(__('Plugin not found: %s', 'installer'), $downloads[$plugin['name']]['name']);
|
| 401 |
-
$return['stop'] = 1;
|
| 402 |
-
}
|
| 403 |
-
break; // one operation at the time
|
| 404 |
-
|
| 405 |
-
}
|
| 406 |
-
|
| 407 |
-
}
|
| 408 |
-
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
}
|
| 412 |
-
}
|
| 413 |
-
|
| 414 |
-
if(empty($return['status_message'])){
|
| 415 |
-
$return['status_message'] = __('Operation complete!', 'installer');
|
| 416 |
-
$return['status_message'] .= ' <a href="#" id="wp_installer_fix_deps_dismiss">'. __('Dismiss', 'installer') . '</a>';
|
| 417 |
-
$return['stop'] = 1;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
echo json_encode($return);
|
| 421 |
-
exit;
|
| 422 |
-
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
public function get_repository_downloads($repository_id, $config){
|
| 426 |
-
|
| 427 |
-
if(!isset($this->repository_downloads[md5(serialize($config))][$repository_id])) {
|
| 428 |
-
|
| 429 |
-
$downloads = array();
|
| 430 |
-
$installer_settings = WP_Installer()->get_settings();
|
| 431 |
-
|
| 432 |
-
if (isset($installer_settings['repositories'][$repository_id])) {
|
| 433 |
-
|
| 434 |
-
foreach ($installer_settings['repositories'][$repository_id]['data']['packages'] as $package) {
|
| 435 |
-
|
| 436 |
-
foreach ($package['products'] as $product) {
|
| 437 |
-
|
| 438 |
-
$available_in_installer = WP_Installer()->is_product_available_for_download($product['name'], $repository_id);
|
| 439 |
-
|
| 440 |
-
foreach ($product['downloads'] as $download) {
|
| 441 |
-
|
| 442 |
-
if (!isset($downloads[$download['basename']]) || (empty($d['_installer_download_url']) && $available_in_installer)) {
|
| 443 |
-
|
| 444 |
-
$d['name'] = $download['name'];
|
| 445 |
-
$d['basename'] = $download['basename'];
|
| 446 |
-
$d['version'] = $download['version'];
|
| 447 |
-
$d['date'] = $download['date'];
|
| 448 |
-
$d['_installer_url'] = $available_in_installer;
|
| 449 |
-
|
| 450 |
-
/*
|
| 451 |
-
$format = 'standard';
|
| 452 |
-
foreach($config['repositories'][$repository_id]['plugins'] as $p){
|
| 453 |
-
if($p['name'] == $d['basename']){
|
| 454 |
-
if(isset($p['format'])){
|
| 455 |
-
$format = $p['format'];
|
| 456 |
-
}
|
| 457 |
-
break;
|
| 458 |
-
}
|
| 459 |
-
}
|
| 460 |
-
*/
|
| 461 |
-
|
| 462 |
-
//case of valid subscription
|
| 463 |
-
if($available_in_installer){
|
| 464 |
-
$d['url'] = WP_Installer()->append_site_key_to_download_url($download['url'], WP_Installer()->get_site_key($repository_id), $repository_id);
|
| 465 |
-
|
| 466 |
-
}else{
|
| 467 |
-
|
| 468 |
-
$d['url'] = $download['url'] . '&theme_key=' . $config['repositories'][$repository_id]['key']
|
| 469 |
-
. '&theme_name=' . urlencode($config['name']);
|
| 470 |
-
//. '&format=' . $format;
|
| 471 |
-
}
|
| 472 |
-
|
| 473 |
-
|
| 474 |
-
$downloads[$d['basename']] = $d;
|
| 475 |
-
}
|
| 476 |
-
|
| 477 |
-
}
|
| 478 |
-
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
}
|
| 482 |
-
|
| 483 |
-
}
|
| 484 |
-
|
| 485 |
-
$this->repository_downloads[md5(serialize($config))][$repository_id] = $downloads;
|
| 486 |
-
|
| 487 |
-
}
|
| 488 |
-
|
| 489 |
-
return $this->repository_downloads[md5(serialize($config))][$repository_id];
|
| 490 |
-
|
| 491 |
-
}
|
| 492 |
-
|
| 493 |
-
public function get_plugin_download_url($repository_id, $basename, $config){
|
| 494 |
-
|
| 495 |
-
$downloads = $this->get_repository_downloads($repository_id, $config);
|
| 496 |
-
|
| 497 |
-
return isset($downloads[$basename]) ? $downloads[$basename]['url'] : false;
|
| 498 |
-
|
| 499 |
-
}
|
| 500 |
-
|
| 501 |
-
public function get_plugin_full_name($repository_id, $basename, $config){
|
| 502 |
-
|
| 503 |
-
$downloads = $this->get_repository_downloads($repository_id, $config);
|
| 504 |
-
|
| 505 |
-
return isset($downloads[$basename]) ? $downloads[$basename]['name'] : false;
|
| 506 |
-
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
public function js_footer(){
|
| 510 |
-
?>
|
| 511 |
-
<script type='text/javascript'>
|
| 512 |
-
/* <![CDATA[ */
|
| 513 |
-
|
| 514 |
-
jQuery('#wp_installer_fix_deps').click(function(){
|
| 515 |
-
|
| 516 |
-
jQuery('#wp_installer_fix_deps').attr('disabled', 'disabled');
|
| 517 |
-
jQuery('#wp_installer_fix_deps_notice').find('.spinner').addClass('spinner-inline').show();
|
| 518 |
-
|
| 519 |
-
var plugins_downloaded = [];
|
| 520 |
-
wp_installer_deps_load_run(plugins_downloaded);
|
| 521 |
-
return false;
|
| 522 |
-
})
|
| 523 |
-
|
| 524 |
-
function wp_installer_deps_load_run(plugins_downloaded){
|
| 525 |
-
|
| 526 |
-
jQuery.ajax({
|
| 527 |
-
url: ajaxurl,
|
| 528 |
-
type: 'post',
|
| 529 |
-
dataType: 'json',
|
| 530 |
-
data: {action: 'wp_installer_fix_deps', plugins_downloaded: plugins_downloaded},
|
| 531 |
-
success: function(ret){
|
| 532 |
-
|
| 533 |
-
plugins_downloaded = ret.plugins_downloaded;
|
| 534 |
-
jQuery('#wp_installer_fix_deps_status').html(ret.status_message);
|
| 535 |
-
|
| 536 |
-
if(ret.stop){
|
| 537 |
-
jQuery('#wp_installer_fix_deps_notice').find('.spinner').removeClass('spinner-inline').hide();
|
| 538 |
-
|
| 539 |
-
}else{
|
| 540 |
-
|
| 541 |
-
wp_installer_deps_load_run(plugins_downloaded);
|
| 542 |
-
}
|
| 543 |
-
|
| 544 |
-
}
|
| 545 |
-
})
|
| 546 |
-
}
|
| 547 |
-
|
| 548 |
-
jQuery('#wp_installer_fix_deps_status').on('click', '#wp_installer_fix_deps_dismiss', function(){
|
| 549 |
-
jQuery('#wp_installer_fix_deps_notice').fadeOut();
|
| 550 |
-
return false;
|
| 551 |
-
})
|
| 552 |
-
|
| 553 |
-
/* ]]> */
|
| 554 |
-
</script>
|
| 555 |
-
<?php
|
| 556 |
-
}
|
| 557 |
-
|
| 558 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
plus/installer/includes/installer.class.php
CHANGED
|
@@ -23,35 +23,53 @@ final class WP_Installer{
|
|
| 23 |
}
|
| 24 |
|
| 25 |
public function __construct(){
|
| 26 |
-
|
| 27 |
-
$this->_gz_on = function_exists('gzuncompress') && function_exists('gzcompress');
|
| 28 |
|
|
|
|
|
|
|
|
|
|
| 29 |
$this->settings = $this->get_settings();
|
| 30 |
|
| 31 |
-
|
| 32 |
-
$this->load_repositories_list();
|
| 33 |
-
|
| 34 |
-
// default config
|
| 35 |
-
$this->config['plugins_install_tab'] = false;
|
| 36 |
-
|
| 37 |
-
add_action('init', array($this, 'init'));
|
| 38 |
|
| 39 |
-
add_action('admin_init', array($this, '
|
| 40 |
|
| 41 |
add_action('admin_menu', array($this, 'menu_setup'));
|
| 42 |
add_action('network_admin_menu', array($this, 'menu_setup'));
|
| 43 |
-
|
| 44 |
-
add_filter('wp_installer_buy_url', array($this, 'append_parameters_to_buy_url'));
|
| 45 |
-
|
| 46 |
-
add_filter( 'pre_set_site_transient_update_plugins', array( $this, 'plugins_upgrade_check') );
|
| 47 |
|
| 48 |
if(defined('DOING_AJAX') && isset($_POST['action']) && $_POST['action'] == 'installer_download_plugin'){
|
| 49 |
add_filter( 'site_transient_update_plugins', array( $this, 'plugins_upgrade_check') );
|
| 50 |
}
|
| 51 |
-
add_filter(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 52 |
|
| 53 |
-
add_action('
|
| 54 |
|
|
|
|
|
|
|
|
|
|
| 55 |
}
|
| 56 |
|
| 57 |
public function set_config($key, $value){
|
|
@@ -67,27 +85,22 @@ final class WP_Installer{
|
|
| 67 |
$this->_pre_1_0_clean_up();
|
| 68 |
}
|
| 69 |
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
// refresh repositories data on WP update schedule
|
| 75 |
-
// add_action('wp_maybe_auto_update', array($this, 'refresh_repositories_data'));
|
| 76 |
-
|
| 77 |
-
if(is_admin()){
|
| 78 |
-
wp_enqueue_script('installer-admin', $this->res_url() . '/res/js/admin.js', array('jquery'), $this->version());
|
| 79 |
-
wp_enqueue_style('installer-admin', $this->res_url() . '/res/css/admin.css', array(), $this->version());
|
| 80 |
-
}
|
| 81 |
|
| 82 |
-
if(
|
| 83 |
add_action('admin_notices', array($this, 'setup_plugins_page_notices'));
|
| 84 |
add_action('admin_notices', array($this, 'setup_plugins_renew_warnings'), 10);
|
| 85 |
add_action('admin_notices', array($this, 'queue_plugins_renew_warnings'), 20);
|
| 86 |
|
| 87 |
add_action('admin_init', array($this, 'setup_plugins_action_links'));
|
| 88 |
-
|
| 89 |
}
|
| 90 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 91 |
if(defined('DOING_AJAX')){
|
| 92 |
add_action('wp_ajax_save_site_key', array($this, 'save_site_key'));
|
| 93 |
add_action('wp_ajax_remove_site_key', array($this, 'remove_site_key'));
|
|
@@ -97,18 +110,31 @@ final class WP_Installer{
|
|
| 97 |
add_action('wp_ajax_installer_activate_plugin', array($this, 'activate_plugin'));
|
| 98 |
|
| 99 |
add_action('wp_ajax_installer_dismiss_nag', array($this, 'dismiss_nag'));
|
| 100 |
-
|
| 101 |
-
|
| 102 |
}
|
| 103 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 104 |
|
| 105 |
-
|
| 106 |
-
}
|
| 107 |
|
| 108 |
-
public function load_deps_loader(){
|
| 109 |
|
| 110 |
-
new Installer_Deps_Loader();
|
| 111 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 112 |
}
|
| 113 |
|
| 114 |
public function menu_setup(){
|
|
@@ -242,10 +268,22 @@ final class WP_Installer{
|
|
| 242 |
}
|
| 243 |
|
| 244 |
public function plugin_url() {
|
| 245 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 246 |
}
|
| 247 |
-
|
| 248 |
-
public function
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 249 |
if(isset($this->config['in_theme_folder']) && !empty($this->config['in_theme_folder'])){
|
| 250 |
$url = untrailingslashit(get_template_directory_uri() . '/' . $this->config['in_theme_folder']);
|
| 251 |
}else{
|
|
@@ -304,13 +342,6 @@ final class WP_Installer{
|
|
| 304 |
}
|
| 305 |
}
|
| 306 |
|
| 307 |
-
/*
|
| 308 |
-
echo '<pre>';
|
| 309 |
-
print_r($settings);
|
| 310 |
-
echo '</pre>';
|
| 311 |
-
exit;
|
| 312 |
-
*/
|
| 313 |
-
|
| 314 |
return $settings;
|
| 315 |
}
|
| 316 |
|
|
@@ -380,44 +411,40 @@ final class WP_Installer{
|
|
| 380 |
public function load_repositories_list(){
|
| 381 |
global $wp_installer_instances;
|
| 382 |
|
|
|
|
| 383 |
|
| 384 |
-
|
| 385 |
-
|
| 386 |
-
if(file_exists(dirname($instance['bootfile']) . '/repositories.xml')){
|
| 387 |
$config_file = dirname($instance['bootfile']) . '/repositories.xml';
|
| 388 |
|
| 389 |
-
if(file_exists(dirname($instance['bootfile']) . '/repositories.sandbox.xml')){
|
| 390 |
$config_file = dirname($instance['bootfile']) . '/repositories.sandbox.xml';
|
| 391 |
}
|
| 392 |
|
| 393 |
$repos = simplexml_load_file($config_file);
|
| 394 |
|
| 395 |
-
foreach($repos as $repo){
|
| 396 |
$id = strval($repo->id);
|
| 397 |
|
| 398 |
-
$data['api-url']
|
| 399 |
-
$data['products']
|
| 400 |
|
| 401 |
// excludes rule;
|
| 402 |
-
if(isset($this->config['repositories_exclude']) && in_array($id, $this->config['repositories_exclude'])){
|
| 403 |
continue;
|
| 404 |
}
|
| 405 |
|
| 406 |
// includes rule;
|
| 407 |
-
if(isset($this->config['repositories_include']) && !in_array($id, $this->config['repositories_include'])){
|
| 408 |
continue;
|
| 409 |
}
|
| 410 |
|
| 411 |
$this->repositories[$id] = $data;
|
| 412 |
|
| 413 |
-
|
| 414 |
}
|
| 415 |
|
| 416 |
}
|
| 417 |
-
|
| 418 |
}
|
| 419 |
|
| 420 |
-
|
| 421 |
}
|
| 422 |
|
| 423 |
public function filter_repositories_list(){
|
|
@@ -439,9 +466,18 @@ final class WP_Installer{
|
|
| 439 |
|
| 440 |
|
| 441 |
}
|
| 442 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 443 |
public function refresh_repositories_data(){
|
| 444 |
-
|
| 445 |
foreach($this->repositories as $id => $data){
|
| 446 |
|
| 447 |
$response = wp_remote_get($data['products']);
|
|
@@ -490,7 +526,7 @@ final class WP_Installer{
|
|
| 490 |
$this->settings['last_repositories_update']= time();
|
| 491 |
|
| 492 |
$this->save_settings();
|
| 493 |
-
|
| 494 |
}
|
| 495 |
|
| 496 |
public function show_products($args = array()){
|
|
@@ -709,7 +745,6 @@ final class WP_Installer{
|
|
| 709 |
}elseif($subscription_data){
|
| 710 |
$this->settings['repositories'][$repository_id]['subscription'] = array('key' => $site_key, 'data' => $subscription_data);
|
| 711 |
$this->save_settings();
|
| 712 |
-
|
| 713 |
}else{
|
| 714 |
$error = __('Invalid site key for the current site.', 'installer');
|
| 715 |
}
|
|
@@ -751,7 +786,28 @@ final class WP_Installer{
|
|
| 751 |
}
|
| 752 |
exit;
|
| 753 |
}
|
| 754 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 755 |
public function update_site_key(){
|
| 756 |
|
| 757 |
$error = '';
|
|
@@ -810,7 +866,7 @@ final class WP_Installer{
|
|
| 810 |
'site_url' => $this->get_installer_site_url($repository_id),
|
| 811 |
);
|
| 812 |
$args['timeout'] = 45;
|
| 813 |
-
|
| 814 |
$response = wp_remote_post($this->repositories[$repository_id]['api-url'], $args);
|
| 815 |
|
| 816 |
$this->api_debug_log("POST {$this->repositories[$repository_id]['api-url']}");
|
|
@@ -834,7 +890,7 @@ final class WP_Installer{
|
|
| 834 |
$this->api_debug_log($response);
|
| 835 |
$subscription_data = $response;
|
| 836 |
}
|
| 837 |
-
|
| 838 |
return $subscription_data;
|
| 839 |
|
| 840 |
}
|
|
@@ -1112,8 +1168,8 @@ final class WP_Installer{
|
|
| 1112 |
}
|
| 1113 |
|
| 1114 |
if(!empty($package['sub-packages'])){
|
| 1115 |
-
foreach($package['sub-packages'] as $
|
| 1116 |
-
foreach($
|
| 1117 |
if($product['name'] == $product_name && ($subscription_type == $product['subscription_type'] || $has_top_package)){
|
| 1118 |
return $available = true;
|
| 1119 |
}
|
|
@@ -1236,7 +1292,7 @@ final class WP_Installer{
|
|
| 1236 |
foreach($package['products'] as $product) {
|
| 1237 |
|
| 1238 |
foreach($product['downloads'] as $download){
|
| 1239 |
-
|
| 1240 |
if($download['basename'] == $plugin_basename){
|
| 1241 |
$version = $download['version'];
|
| 1242 |
break (3);
|
|
@@ -1294,7 +1350,7 @@ final class WP_Installer{
|
|
| 1294 |
//validate subscription
|
| 1295 |
$site_key = $this->get_repository_site_key($data['repository_id']);
|
| 1296 |
$subscription_data = $this->fetch_subscription_data($data['repository_id'], $site_key);
|
| 1297 |
-
|
| 1298 |
if($subscription_data && !is_wp_error($subscription_data) && $this->repository_has_valid_subscription($data['repository_id'])){
|
| 1299 |
|
| 1300 |
if($data['nonce'] == wp_create_nonce('install_plugin_' . $data['url'])){
|
|
@@ -1455,7 +1511,7 @@ final class WP_Installer{
|
|
| 1455 |
|
| 1456 |
}
|
| 1457 |
|
| 1458 |
-
public function custom_plugins_api_call($false
|
| 1459 |
|
| 1460 |
if($action == 'plugin_information'){
|
| 1461 |
|
|
@@ -1498,14 +1554,12 @@ final class WP_Installer{
|
|
| 1498 |
|
| 1499 |
}
|
| 1500 |
|
| 1501 |
-
return false;
|
| 1502 |
|
| 1503 |
}
|
| 1504 |
|
| 1505 |
public function plugins_upgrade_check($update_plugins){
|
| 1506 |
-
|
| 1507 |
-
$this->refresh_repositories_data();
|
| 1508 |
-
|
| 1509 |
if(!empty($this->settings['repositories'])){
|
| 1510 |
$plugins = get_plugins();
|
| 1511 |
|
|
@@ -1630,9 +1684,7 @@ final class WP_Installer{
|
|
| 1630 |
|
| 1631 |
public function localize_strings(){
|
| 1632 |
global $sitepress;
|
| 1633 |
-
|
| 1634 |
-
|
| 1635 |
-
|
| 1636 |
if(!empty($this->settings['repositories'])){
|
| 1637 |
foreach($this->settings['repositories'] as $repository_id => $repository){
|
| 1638 |
//set name as call2action when don't have any
|
|
@@ -1776,8 +1828,7 @@ final class WP_Installer{
|
|
| 1776 |
foreach($repository['data']['packages'] as $package_id => $package){
|
| 1777 |
|
| 1778 |
foreach($package['products'] as $product_id => $product){
|
| 1779 |
-
|
| 1780 |
-
$fprice = false;
|
| 1781 |
if($match['dtp'] == '%'){
|
| 1782 |
$fprice = round( $product['price'] * (1 - $match['amt']/100), 2 );
|
| 1783 |
$fprice = $fprice != round($fprice) ? sprintf('%.2f', $fprice) : round($fprice, 0);
|
|
@@ -1856,7 +1907,7 @@ final class WP_Installer{
|
|
| 1856 |
}
|
| 1857 |
|
| 1858 |
// order parents
|
| 1859 |
-
usort($ordered_packages,
|
| 1860 |
//order sub-packages
|
| 1861 |
foreach($ordered_packages as $package_id => $package){
|
| 1862 |
if(!empty($package['sub-packages'])) {
|
|
@@ -1873,6 +1924,10 @@ final class WP_Installer{
|
|
| 1873 |
|
| 1874 |
}
|
| 1875 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1876 |
public function filter_downloads_by_icl(){
|
| 1877 |
if(function_exists('wpml_site_uses_icl') && wpml_site_uses_icl()){
|
| 1878 |
|
|
@@ -1920,4 +1975,169 @@ final class WP_Installer{
|
|
| 1920 |
|
| 1921 |
return false;
|
| 1922 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1923 |
}
|
| 23 |
}
|
| 24 |
|
| 25 |
public function __construct(){
|
|
|
|
|
|
|
| 26 |
|
| 27 |
+
if(!is_admin() || !is_user_logged_in()) return; //Only for admin
|
| 28 |
+
|
| 29 |
+
$this->_gz_on = function_exists('gzuncompress') && function_exists('gzcompress');
|
| 30 |
$this->settings = $this->get_settings();
|
| 31 |
|
| 32 |
+
add_action('admin_notices', array($this, 'show_site_key_nags'));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
|
| 34 |
+
add_action('admin_init', array($this, 'load_embedded_plugins'), 0);
|
| 35 |
|
| 36 |
add_action('admin_menu', array($this, 'menu_setup'));
|
| 37 |
add_action('network_admin_menu', array($this, 'menu_setup'));
|
|
|
|
|
|
|
|
|
|
|
|
|
| 38 |
|
| 39 |
if(defined('DOING_AJAX') && isset($_POST['action']) && $_POST['action'] == 'installer_download_plugin'){
|
| 40 |
add_filter( 'site_transient_update_plugins', array( $this, 'plugins_upgrade_check') );
|
| 41 |
}
|
| 42 |
+
add_filter('plugins_api', array( $this, 'custom_plugins_api_call'), 10, 3);
|
| 43 |
+
add_filter('pre_set_site_transient_update_plugins', array( $this, 'plugins_upgrade_check'));
|
| 44 |
+
|
| 45 |
+
// register repositories
|
| 46 |
+
$this->load_repositories_list();
|
| 47 |
+
|
| 48 |
+
if(empty($this->settings['last_repositories_update']) || time() - $this->settings['last_repositories_update'] > 86400){
|
| 49 |
+
$this->refresh_repositories_data();
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
/* Original setup for plugins updates check
|
| 53 |
+
add_action('wp_maybe_auto_update', array($this, 'refresh_repositories_data'));
|
| 54 |
+
if(isset($_GET['force-check']) && $_GET['force-check']){
|
| 55 |
+
add_action('core_upgrade_preamble', array($this, 'refresh_repositories_data'));
|
| 56 |
+
}
|
| 57 |
+
add_action('wp_update_plugins', array($this, 'refresh_repositories_data'));
|
| 58 |
+
*/
|
| 59 |
+
|
| 60 |
+
// Hook to wp_update_plugins before the WP API request
|
| 61 |
+
// Using this in place of a missing hook in wp_update_plugins
|
| 62 |
+
// This is being triggered every time WP checks for plugin updates
|
| 63 |
+
add_filter('plugins_update_check_locales', array($this, 'update_plugins_information'));
|
| 64 |
+
|
| 65 |
+
// default config
|
| 66 |
+
$this->config['plugins_install_tab'] = false;
|
| 67 |
|
| 68 |
+
add_action('init', array($this, 'init'));
|
| 69 |
|
| 70 |
+
//add_filter('wp_installer_buy_url', array($this, 'append_parameters_to_buy_url'));
|
| 71 |
+
|
| 72 |
+
|
| 73 |
}
|
| 74 |
|
| 75 |
public function set_config($key, $value){
|
| 85 |
$this->_pre_1_0_clean_up();
|
| 86 |
}
|
| 87 |
|
| 88 |
+
wp_enqueue_script('installer-admin', $this->res_url() . '/res/js/admin.js', array('jquery'), $this->version());
|
| 89 |
+
wp_enqueue_style('installer-admin', $this->res_url() . '/res/css/admin.css', array(), $this->version());
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 90 |
|
| 91 |
+
if($pagenow == 'plugins.php'){
|
| 92 |
add_action('admin_notices', array($this, 'setup_plugins_page_notices'));
|
| 93 |
add_action('admin_notices', array($this, 'setup_plugins_renew_warnings'), 10);
|
| 94 |
add_action('admin_notices', array($this, 'queue_plugins_renew_warnings'), 20);
|
| 95 |
|
| 96 |
add_action('admin_init', array($this, 'setup_plugins_action_links'));
|
| 97 |
+
|
| 98 |
}
|
| 99 |
+
|
| 100 |
+
if($this->is_repositories_page()){
|
| 101 |
+
add_action('admin_init', array($this, 'validate_repository_subscription'));
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
if(defined('DOING_AJAX')){
|
| 105 |
add_action('wp_ajax_save_site_key', array($this, 'save_site_key'));
|
| 106 |
add_action('wp_ajax_remove_site_key', array($this, 'remove_site_key'));
|
| 110 |
add_action('wp_ajax_installer_activate_plugin', array($this, 'activate_plugin'));
|
| 111 |
|
| 112 |
add_action('wp_ajax_installer_dismiss_nag', array($this, 'dismiss_nag'));
|
|
|
|
|
|
|
| 113 |
}
|
| 114 |
|
| 115 |
+
if($pagenow == 'update.php'){
|
| 116 |
+
if(isset($_GET['action']) && $_GET['action'] == 'update-selected'){
|
| 117 |
+
add_action('admin_head', array($this, 'plugin_upgrade_custom_errors')); //iframe/bulk
|
| 118 |
+
}else{
|
| 119 |
+
add_action('all_admin_notices', array($this, 'plugin_upgrade_custom_errors')); //regular/singular
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
// WP 4.2
|
| 124 |
+
if(defined('DOING_AJAX')){
|
| 125 |
+
add_action('wp_ajax_update-plugin', array($this, 'plugin_upgrade_custom_errors'), 0); // high priority, before WP
|
| 126 |
+
}
|
| 127 |
|
|
|
|
|
|
|
| 128 |
|
|
|
|
| 129 |
|
|
|
|
| 130 |
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
public function load_embedded_plugins(){
|
| 134 |
+
if(file_exists($this->plugin_path() . '/embedded-plugins' )) {
|
| 135 |
+
include_once $this->plugin_path() . '/embedded-plugins/embedded-plugins.class.php';
|
| 136 |
+
$this->installer_embedded_plugins = new Installer_Embedded_Plugins();
|
| 137 |
+
}
|
| 138 |
}
|
| 139 |
|
| 140 |
public function menu_setup(){
|
| 268 |
}
|
| 269 |
|
| 270 |
public function plugin_url() {
|
| 271 |
+
if(isset($this->config['in_theme_folder']) && !empty($this->config['in_theme_folder'])){
|
| 272 |
+
$url = untrailingslashit(get_template_directory_uri() . '/' . $this->config['in_theme_folder']);
|
| 273 |
+
}else{
|
| 274 |
+
$url = untrailingslashit( plugins_url( '/', dirname(__FILE__) ) );
|
| 275 |
+
}
|
| 276 |
+
|
| 277 |
+
return $url;
|
| 278 |
}
|
| 279 |
+
|
| 280 |
+
public function is_repositories_page(){
|
| 281 |
+
global $pagenow;
|
| 282 |
+
|
| 283 |
+
return $pagenow == 'plugin-install.php' && isset($_GET['tab']) && $_GET['tab'] == 'commercial';
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
public function res_url(){
|
| 287 |
if(isset($this->config['in_theme_folder']) && !empty($this->config['in_theme_folder'])){
|
| 288 |
$url = untrailingslashit(get_template_directory_uri() . '/' . $this->config['in_theme_folder']);
|
| 289 |
}else{
|
| 342 |
}
|
| 343 |
}
|
| 344 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 345 |
return $settings;
|
| 346 |
}
|
| 347 |
|
| 411 |
public function load_repositories_list(){
|
| 412 |
global $wp_installer_instances;
|
| 413 |
|
| 414 |
+
foreach ($wp_installer_instances as $instance) {
|
| 415 |
|
| 416 |
+
if (file_exists(dirname($instance['bootfile']) . '/repositories.xml')) {
|
|
|
|
|
|
|
| 417 |
$config_file = dirname($instance['bootfile']) . '/repositories.xml';
|
| 418 |
|
| 419 |
+
if (file_exists(dirname($instance['bootfile']) . '/repositories.sandbox.xml')) {
|
| 420 |
$config_file = dirname($instance['bootfile']) . '/repositories.sandbox.xml';
|
| 421 |
}
|
| 422 |
|
| 423 |
$repos = simplexml_load_file($config_file);
|
| 424 |
|
| 425 |
+
foreach ($repos as $repo) {
|
| 426 |
$id = strval($repo->id);
|
| 427 |
|
| 428 |
+
$data['api-url'] = strval($repo->apiurl);
|
| 429 |
+
$data['products'] = strval($repo->products);
|
| 430 |
|
| 431 |
// excludes rule;
|
| 432 |
+
if (isset($this->config['repositories_exclude']) && in_array($id, $this->config['repositories_exclude'])) {
|
| 433 |
continue;
|
| 434 |
}
|
| 435 |
|
| 436 |
// includes rule;
|
| 437 |
+
if (isset($this->config['repositories_include']) && !in_array($id, $this->config['repositories_include'])) {
|
| 438 |
continue;
|
| 439 |
}
|
| 440 |
|
| 441 |
$this->repositories[$id] = $data;
|
| 442 |
|
|
|
|
| 443 |
}
|
| 444 |
|
| 445 |
}
|
|
|
|
| 446 |
}
|
| 447 |
|
|
|
|
| 448 |
}
|
| 449 |
|
| 450 |
public function filter_repositories_list(){
|
| 466 |
|
| 467 |
|
| 468 |
}
|
| 469 |
+
|
| 470 |
+
// Using this in place of a missing hook in wp_update_plugins
|
| 471 |
+
// This is being triggered every time WP checks for plugin updates
|
| 472 |
+
public function update_plugins_information($locale_data){
|
| 473 |
+
|
| 474 |
+
$this->refresh_repositories_data();
|
| 475 |
+
|
| 476 |
+
return $locale_data;
|
| 477 |
+
}
|
| 478 |
+
|
| 479 |
public function refresh_repositories_data(){
|
| 480 |
+
|
| 481 |
foreach($this->repositories as $id => $data){
|
| 482 |
|
| 483 |
$response = wp_remote_get($data['products']);
|
| 526 |
$this->settings['last_repositories_update']= time();
|
| 527 |
|
| 528 |
$this->save_settings();
|
| 529 |
+
|
| 530 |
}
|
| 531 |
|
| 532 |
public function show_products($args = array()){
|
| 745 |
}elseif($subscription_data){
|
| 746 |
$this->settings['repositories'][$repository_id]['subscription'] = array('key' => $site_key, 'data' => $subscription_data);
|
| 747 |
$this->save_settings();
|
|
|
|
| 748 |
}else{
|
| 749 |
$error = __('Invalid site key for the current site.', 'installer');
|
| 750 |
}
|
| 786 |
}
|
| 787 |
exit;
|
| 788 |
}
|
| 789 |
+
|
| 790 |
+
public function validate_repository_subscription(){
|
| 791 |
+
$repository_id = isset($_GET['validate_repository']) ? $_GET['validate_repository'] : false;
|
| 792 |
+
if($repository_id){
|
| 793 |
+
|
| 794 |
+
$site_key = $this->get_site_key($repository_id);
|
| 795 |
+
if($site_key) {
|
| 796 |
+
$subscription_data = $this->fetch_subscription_data($repository_id, $site_key);
|
| 797 |
+
if(empty($subscription_data)){
|
| 798 |
+
unset($this->settings['repositories'][$repository_id]['subscription']);
|
| 799 |
+
delete_site_transient('update_plugins');
|
| 800 |
+
$this->save_settings();
|
| 801 |
+
}
|
| 802 |
+
}
|
| 803 |
+
|
| 804 |
+
wp_redirect($this->menu_url() . '#repository-' . $repository_id);
|
| 805 |
+
exit;
|
| 806 |
+
|
| 807 |
+
}
|
| 808 |
+
|
| 809 |
+
}
|
| 810 |
+
|
| 811 |
public function update_site_key(){
|
| 812 |
|
| 813 |
$error = '';
|
| 866 |
'site_url' => $this->get_installer_site_url($repository_id),
|
| 867 |
);
|
| 868 |
$args['timeout'] = 45;
|
| 869 |
+
|
| 870 |
$response = wp_remote_post($this->repositories[$repository_id]['api-url'], $args);
|
| 871 |
|
| 872 |
$this->api_debug_log("POST {$this->repositories[$repository_id]['api-url']}");
|
| 890 |
$this->api_debug_log($response);
|
| 891 |
$subscription_data = $response;
|
| 892 |
}
|
| 893 |
+
|
| 894 |
return $subscription_data;
|
| 895 |
|
| 896 |
}
|
| 1168 |
}
|
| 1169 |
|
| 1170 |
if(!empty($package['sub-packages'])){
|
| 1171 |
+
foreach($package['sub-packages'] as $sub_package){
|
| 1172 |
+
foreach($sub_package['products'] as $product){
|
| 1173 |
if($product['name'] == $product_name && ($subscription_type == $product['subscription_type'] || $has_top_package)){
|
| 1174 |
return $available = true;
|
| 1175 |
}
|
| 1292 |
foreach($package['products'] as $product) {
|
| 1293 |
|
| 1294 |
foreach($product['downloads'] as $download){
|
| 1295 |
+
|
| 1296 |
if($download['basename'] == $plugin_basename){
|
| 1297 |
$version = $download['version'];
|
| 1298 |
break (3);
|
| 1350 |
//validate subscription
|
| 1351 |
$site_key = $this->get_repository_site_key($data['repository_id']);
|
| 1352 |
$subscription_data = $this->fetch_subscription_data($data['repository_id'], $site_key);
|
| 1353 |
+
|
| 1354 |
if($subscription_data && !is_wp_error($subscription_data) && $this->repository_has_valid_subscription($data['repository_id'])){
|
| 1355 |
|
| 1356 |
if($data['nonce'] == wp_create_nonce('install_plugin_' . $data['url'])){
|
| 1511 |
|
| 1512 |
}
|
| 1513 |
|
| 1514 |
+
public function custom_plugins_api_call($false, $action, $args){
|
| 1515 |
|
| 1516 |
if($action == 'plugin_information'){
|
| 1517 |
|
| 1554 |
|
| 1555 |
}
|
| 1556 |
|
| 1557 |
+
return $false;
|
| 1558 |
|
| 1559 |
}
|
| 1560 |
|
| 1561 |
public function plugins_upgrade_check($update_plugins){
|
| 1562 |
+
|
|
|
|
|
|
|
| 1563 |
if(!empty($this->settings['repositories'])){
|
| 1564 |
$plugins = get_plugins();
|
| 1565 |
|
| 1684 |
|
| 1685 |
public function localize_strings(){
|
| 1686 |
global $sitepress;
|
| 1687 |
+
|
|
|
|
|
|
|
| 1688 |
if(!empty($this->settings['repositories'])){
|
| 1689 |
foreach($this->settings['repositories'] as $repository_id => $repository){
|
| 1690 |
//set name as call2action when don't have any
|
| 1828 |
foreach($repository['data']['packages'] as $package_id => $package){
|
| 1829 |
|
| 1830 |
foreach($package['products'] as $product_id => $product){
|
| 1831 |
+
|
|
|
|
| 1832 |
if($match['dtp'] == '%'){
|
| 1833 |
$fprice = round( $product['price'] * (1 - $match['amt']/100), 2 );
|
| 1834 |
$fprice = $fprice != round($fprice) ? sprintf('%.2f', $fprice) : round($fprice, 0);
|
| 1907 |
}
|
| 1908 |
|
| 1909 |
// order parents
|
| 1910 |
+
usort($ordered_packages, array($this, '_order_packages_callback'));
|
| 1911 |
//order sub-packages
|
| 1912 |
foreach($ordered_packages as $package_id => $package){
|
| 1913 |
if(!empty($package['sub-packages'])) {
|
| 1924 |
|
| 1925 |
}
|
| 1926 |
|
| 1927 |
+
public function _order_packages_callback($a, $b){
|
| 1928 |
+
return $a['order'] > $b['order'];
|
| 1929 |
+
}
|
| 1930 |
+
|
| 1931 |
public function filter_downloads_by_icl(){
|
| 1932 |
if(function_exists('wpml_site_uses_icl') && wpml_site_uses_icl()){
|
| 1933 |
|
| 1975 |
|
| 1976 |
return false;
|
| 1977 |
}
|
| 1978 |
+
|
| 1979 |
+
public function plugin_upgrade_custom_errors(){
|
| 1980 |
+
|
| 1981 |
+
if ( isset($_REQUEST['action']) ) {
|
| 1982 |
+
|
| 1983 |
+
$action = isset($_REQUEST['action']) ? $_REQUEST['action'] : '';
|
| 1984 |
+
|
| 1985 |
+
//bulk mode
|
| 1986 |
+
if('update-selected' == $action) {
|
| 1987 |
+
|
| 1988 |
+
global $plugins;
|
| 1989 |
+
|
| 1990 |
+
if(isset($plugins) && is_array($plugins)) {
|
| 1991 |
+
|
| 1992 |
+
foreach ($plugins as $k => $plugin) {
|
| 1993 |
+
$plugin_repository = false;
|
| 1994 |
+
|
| 1995 |
+
foreach ($this->settings['repositories'] as $repository_id => $repository) {
|
| 1996 |
+
|
| 1997 |
+
foreach ($repository['data']['packages'] as $package) {
|
| 1998 |
+
|
| 1999 |
+
foreach ($package['products'] as $product) {
|
| 2000 |
+
|
| 2001 |
+
foreach ($product['downloads'] as $download) {
|
| 2002 |
+
|
| 2003 |
+
//match by folder, will change to match by name and folder
|
| 2004 |
+
if ($download['basename'] == dirname($plugin)) {
|
| 2005 |
+
$plugin_repository = $repository_id;
|
| 2006 |
+
$product_name = $repository['data']['product-name'];
|
| 2007 |
+
$plugin_name = $download['name'];
|
| 2008 |
+
break;
|
| 2009 |
+
}
|
| 2010 |
+
|
| 2011 |
+
}
|
| 2012 |
+
|
| 2013 |
+
}
|
| 2014 |
+
|
| 2015 |
+
}
|
| 2016 |
+
|
| 2017 |
+
}
|
| 2018 |
+
|
| 2019 |
+
if ($plugin_repository) {
|
| 2020 |
+
|
| 2021 |
+
//validate subscription
|
| 2022 |
+
static $sub_cache = array();
|
| 2023 |
+
|
| 2024 |
+
if(empty($sub_cache[$plugin_repository])){
|
| 2025 |
+
$site_key = $this->get_repository_site_key($plugin_repository);
|
| 2026 |
+
if ($site_key) {
|
| 2027 |
+
$subscription_data = $this->fetch_subscription_data($plugin_repository, $site_key);
|
| 2028 |
+
}
|
| 2029 |
+
$sub_cache[$plugin_repository]['site_key'] = $site_key;
|
| 2030 |
+
$sub_cache[$plugin_repository]['subscription_data'] = isset($subscription_data) ? $subscription_data : false;
|
| 2031 |
+
}else{
|
| 2032 |
+
|
| 2033 |
+
$site_key = $sub_cache[$plugin_repository]['site_key'];
|
| 2034 |
+
$subscription_data = $sub_cache[$plugin_repository]['subscription_data'];
|
| 2035 |
+
|
| 2036 |
+
}
|
| 2037 |
+
|
| 2038 |
+
if (empty($site_key) || empty($subscription_data)) {
|
| 2039 |
+
|
| 2040 |
+
|
| 2041 |
+
$error_message = sprintf(__("%s cannot update because your site's registration is not valid. Please %sregister %s%s again for this site first.", 'installer'),
|
| 2042 |
+
'<strong>' . $plugin_name . '</strong>', '<a target="_top" href="' . $this->menu_url() . '&validate_repository=' . $plugin_repository .
|
| 2043 |
+
'#repository-' . $plugin_repository . '">', $product_name, '</a>');
|
| 2044 |
+
|
| 2045 |
+
echo '<div class="updated error"><p>' . $error_message . '</p></div>';
|
| 2046 |
+
|
| 2047 |
+
unset($plugins[$k]);
|
| 2048 |
+
|
| 2049 |
+
|
| 2050 |
+
}
|
| 2051 |
+
|
| 2052 |
+
}
|
| 2053 |
+
|
| 2054 |
+
}
|
| 2055 |
+
|
| 2056 |
+
}
|
| 2057 |
+
|
| 2058 |
+
}
|
| 2059 |
+
|
| 2060 |
+
|
| 2061 |
+
if( 'upgrade-plugin' == $action || 'update-plugin' == $action ) {
|
| 2062 |
+
|
| 2063 |
+
$plugin = isset($_REQUEST['plugin']) ? trim($_REQUEST['plugin']) : '';
|
| 2064 |
+
|
| 2065 |
+
$plugin_repository = false;
|
| 2066 |
+
|
| 2067 |
+
foreach($this->settings['repositories'] as $repository_id => $repository){
|
| 2068 |
+
|
| 2069 |
+
foreach($repository['data']['packages'] as $package){
|
| 2070 |
+
|
| 2071 |
+
foreach($package['products'] as $product){
|
| 2072 |
+
|
| 2073 |
+
foreach($product['downloads'] as $download){
|
| 2074 |
+
|
| 2075 |
+
//match by folder, will change to match by name and folder
|
| 2076 |
+
if($download['basename'] == dirname($plugin)) {
|
| 2077 |
+
$plugin_repository = $repository_id;
|
| 2078 |
+
$product_name = $repository['data']['product-name'];
|
| 2079 |
+
$plugin_name = $download['name'];
|
| 2080 |
+
break;
|
| 2081 |
+
}
|
| 2082 |
+
|
| 2083 |
+
}
|
| 2084 |
+
|
| 2085 |
+
}
|
| 2086 |
+
|
| 2087 |
+
}
|
| 2088 |
+
|
| 2089 |
+
}
|
| 2090 |
+
|
| 2091 |
+
if($plugin_repository) {
|
| 2092 |
+
|
| 2093 |
+
//validate subscription
|
| 2094 |
+
$site_key = $this->get_repository_site_key($plugin_repository);
|
| 2095 |
+
if ($site_key) {
|
| 2096 |
+
$subscription_data = $this->fetch_subscription_data($plugin_repository, $site_key);
|
| 2097 |
+
}
|
| 2098 |
+
|
| 2099 |
+
if (empty($site_key) || empty($subscription_data)) {
|
| 2100 |
+
|
| 2101 |
+
$error_message = sprintf(__("%s cannot update because your site's registration is not valid. Please %sregister %s%s again for this site first.", 'installer'),
|
| 2102 |
+
'<strong>'.$plugin_name . '</strong>', '<a href="' . $this->menu_url() . '&validate_repository=' . $plugin_repository .
|
| 2103 |
+
'#repository-' . $plugin_repository . '">', $product_name, '</a>');
|
| 2104 |
+
|
| 2105 |
+
if(defined('DOING_AJAX')){ //WP 4.2
|
| 2106 |
+
|
| 2107 |
+
$status = array(
|
| 2108 |
+
'update' => 'plugin',
|
| 2109 |
+
'plugin' => $plugin,
|
| 2110 |
+
'slug' => sanitize_key( $_POST['slug'] ),
|
| 2111 |
+
'oldVersion' => '',
|
| 2112 |
+
'newVersion' => '',
|
| 2113 |
+
);
|
| 2114 |
+
|
| 2115 |
+
$status['errorCode'] = 'wp_installer_invalid_subscription';
|
| 2116 |
+
$status['error'] = $error_message;
|
| 2117 |
+
|
| 2118 |
+
wp_send_json_error( $status );
|
| 2119 |
+
|
| 2120 |
+
} else { // WP 4.1.1
|
| 2121 |
+
echo '<div class="updated error"><p>' . $error_message . '</p></div>';
|
| 2122 |
+
|
| 2123 |
+
|
| 2124 |
+
echo '<div class="wrap">';
|
| 2125 |
+
echo '<h2>' . __('Update Plugin') . '</h2>';
|
| 2126 |
+
echo '<a href="' . admin_url('plugins.php') . '">' . __('Return to the plugins page') . '</a>';
|
| 2127 |
+
echo '</div>';
|
| 2128 |
+
require_once(ABSPATH . 'wp-admin/admin-footer.php');
|
| 2129 |
+
exit;
|
| 2130 |
+
|
| 2131 |
+
}
|
| 2132 |
+
|
| 2133 |
+
}
|
| 2134 |
+
|
| 2135 |
+
|
| 2136 |
+
}
|
| 2137 |
+
|
| 2138 |
+
}
|
| 2139 |
+
}
|
| 2140 |
+
|
| 2141 |
+
}
|
| 2142 |
+
|
| 2143 |
}
|
plus/installer/installer.php
CHANGED
|
@@ -1,8 +1,7 @@
|
|
| 1 |
<?php
|
| 2 |
-
define('WP_INSTALLER_VERSION', '1.5.
|
| 3 |
|
| 4 |
include_once dirname(__FILE__) . '/includes/installer.class.php';
|
| 5 |
-
include_once dirname(__FILE__) . '/includes/deps-loader.class.php';
|
| 6 |
|
| 7 |
function WP_Installer() {
|
| 8 |
return WP_Installer::instance();
|
| 1 |
<?php
|
| 2 |
+
define('WP_INSTALLER_VERSION', '1.5.3');
|
| 3 |
|
| 4 |
include_once dirname(__FILE__) . '/includes/installer.class.php';
|
|
|
|
| 5 |
|
| 6 |
function WP_Installer() {
|
| 7 |
return WP_Installer::instance();
|
plus/installer/loader.php
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
Plugin Name: Installer
|
| 4 |
Plugin URI: http://wp-compatibility.com/installer-plugin/
|
| 5 |
Description: Need help buying, installing and upgrading commercial themes and plugins? **Installer** handles all this for you, right from the WordPress admin. Installer lets you find themes and plugins from different sources, then, buy them from within the WordPress admin. Instead of manually uploading and unpacking, you'll see those themes and plugins available, just like any other plugin you're getting from WordPress.org.
|
| 6 |
-
Version: 1.5.
|
| 7 |
Author: OnTheGoSystems Inc.
|
| 8 |
Author URI: http://www.onthegosystems.com/
|
| 9 |
*/
|
|
@@ -13,14 +13,22 @@ if ( ! defined( 'ABSPATH' ) ) {
|
|
| 13 |
exit; // Exit if accessed directly
|
| 14 |
}
|
| 15 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 16 |
|
| 17 |
$wp_installer_instance = dirname(__FILE__) . '/installer.php';
|
| 18 |
|
|
|
|
| 19 |
// Global stack of instances
|
| 20 |
global $wp_installer_instances;
|
| 21 |
$wp_installer_instances[$wp_installer_instance] = array(
|
| 22 |
'bootfile' => $wp_installer_instance,
|
| 23 |
-
'version' => '1.5.
|
| 24 |
);
|
| 25 |
|
| 26 |
// Only one of these in the end
|
| 3 |
Plugin Name: Installer
|
| 4 |
Plugin URI: http://wp-compatibility.com/installer-plugin/
|
| 5 |
Description: Need help buying, installing and upgrading commercial themes and plugins? **Installer** handles all this for you, right from the WordPress admin. Installer lets you find themes and plugins from different sources, then, buy them from within the WordPress admin. Instead of manually uploading and unpacking, you'll see those themes and plugins available, just like any other plugin you're getting from WordPress.org.
|
| 6 |
+
Version: 1.5.3
|
| 7 |
Author: OnTheGoSystems Inc.
|
| 8 |
Author URI: http://www.onthegosystems.com/
|
| 9 |
*/
|
| 13 |
exit; // Exit if accessed directly
|
| 14 |
}
|
| 15 |
|
| 16 |
+
//It should only be loaded on the admin side
|
| 17 |
+
if( !is_admin() ){
|
| 18 |
+
if(!function_exists('WP_Installer_Setup')){ function WP_Installer_Setup(){} }
|
| 19 |
+
$wp_installer_instance = null;
|
| 20 |
+
return;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
|
| 24 |
$wp_installer_instance = dirname(__FILE__) . '/installer.php';
|
| 25 |
|
| 26 |
+
|
| 27 |
// Global stack of instances
|
| 28 |
global $wp_installer_instances;
|
| 29 |
$wp_installer_instances[$wp_installer_instance] = array(
|
| 30 |
'bootfile' => $wp_installer_instance,
|
| 31 |
+
'version' => '1.5.3'
|
| 32 |
);
|
| 33 |
|
| 34 |
// Only one of these in the end
|
plus/installer/res/css/admin.css
CHANGED
|
@@ -50,6 +50,11 @@
|
|
| 50 |
color: #f00;
|
| 51 |
}
|
| 52 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 53 |
.installer-warn-box{
|
| 54 |
-webkit-border-radius: 5px;-moz-border-radius: 5px;border-radius: 5px;border:1px solid #962722;background-color:#F5C8C6;
|
| 55 |
color: #333;
|
|
@@ -140,4 +145,9 @@
|
|
| 140 |
|
| 141 |
.installer_highlight_package{
|
| 142 |
background-color: #fff9c0;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 143 |
}
|
| 50 |
color: #f00;
|
| 51 |
}
|
| 52 |
|
| 53 |
+
.installer-status-note{
|
| 54 |
+
color: #6F6E6D;
|
| 55 |
+
font-style: italic;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
.installer-warn-box{
|
| 59 |
-webkit-border-radius: 5px;-moz-border-radius: 5px;border-radius: 5px;border:1px solid #962722;background-color:#F5C8C6;
|
| 60 |
color: #333;
|
| 145 |
|
| 146 |
.installer_highlight_package{
|
| 147 |
background-color: #fff9c0;
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
.plugin_progress{
|
| 151 |
+
font-style: italic;
|
| 152 |
+
color: #777
|
| 153 |
}
|
plus/installer/res/js/admin.js
CHANGED
|
@@ -18,6 +18,27 @@
|
|
| 18 |
|
| 19 |
otgs_wp_installer.scroll_to_repository();
|
| 20 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
},
|
| 22 |
|
| 23 |
reset_errors: function(){
|
|
@@ -342,4 +363,5 @@
|
|
| 342 |
|
| 343 |
}
|
| 344 |
|
|
|
|
| 345 |
jQuery(document).ready(otgs_wp_installer.init);
|
| 18 |
|
| 19 |
otgs_wp_installer.scroll_to_repository();
|
| 20 |
|
| 21 |
+
if( pagenow == 'plugins'){
|
| 22 |
+
|
| 23 |
+
jQuery(document).ajaxSuccess(function(event, xhr, settings) {
|
| 24 |
+
var data = otgs_wp_installer.getQueryParameters(settings.data);
|
| 25 |
+
if(typeof data.action != 'undefined' && data.action == 'update-plugin'){
|
| 26 |
+
response = xhr.responseJSON.data;
|
| 27 |
+
console.log(typeof response.error);
|
| 28 |
+
if(typeof response.error != 'undefined'){
|
| 29 |
+
var default_error = jQuery('#' + response.slug + '-update .update-message').html();
|
| 30 |
+
jQuery('#' + response.slug + '-update .update-message').html(default_error + ' »<span class="installer-red-text"> ' + response.error + '</span>');
|
| 31 |
+
}
|
| 32 |
+
}
|
| 33 |
+
return false;
|
| 34 |
+
});
|
| 35 |
+
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
},
|
| 39 |
+
|
| 40 |
+
getQueryParameters : function(str) {
|
| 41 |
+
return (str || document.location.search).replace(/(^\?)/,'').split("&").map(function(n){return n = n.split("="),this[n[0]] = n[1],this}.bind({}))[0];
|
| 42 |
},
|
| 43 |
|
| 44 |
reset_errors: function(){
|
| 363 |
|
| 364 |
}
|
| 365 |
|
| 366 |
+
|
| 367 |
jQuery(document).ready(otgs_wp_installer.init);
|
plus/installer/res/js/iframeResizer.min.js
CHANGED
|
@@ -1,10 +1,10 @@
|
|
| 1 |
-
/*! iFrame Resizer (iframeSizer.min.js ) - v2.6.1 - 2014-09-03
|
| 2 |
-
* Desc: Force cross domain iframes to size to content.
|
| 3 |
-
* Requires: iframeResizer.contentWindow.min.js to be loaded into the target frame.
|
| 4 |
-
* Copyright: (c) 2014 David J. Bradshaw - dave@bradshaw.net
|
| 5 |
-
* License: MIT
|
| 6 |
-
*/
|
| 7 |
-
|
| 8 |
-
!function(){"use strict";function a(a,b,c){"addEventListener"in window?a.addEventListener(b,c,!1):"attachEvent"in window&&a.attachEvent("on"+b,c)}function b(){var a,b=["moz","webkit","o","ms"];for(a=0;a<b.length&&!w;a+=1)w=window[b[a]+"RequestAnimationFrame"];w||c(" RequestAnimationFrame not supported")}function c(a){y.log&&"object"==typeof console&&console.log(s+"[Host page"+u+"]"+a)}function d(a){function b(){function a(){h(z),f(),y.resizedCallback(z)}i(a,z,"resetPage")}function d(a){var b=a.id;c(" Removing iFrame: "+b),a.parentNode.removeChild(a),y.closedCallback(b),c(" --")}function e(){var a=x.substr(t).split(":");return{iframe:document.getElementById(a[0]),id:a[0],height:a[1],width:a[2],type:a[3]}}function j(a){var b=Number(y["max"+a]),d=Number(y["min"+a]),e=a.toLowerCase(),f=Number(z[e]);if(d>b)throw new Error("Value for min"+a+" can not be greater than max"+a);c(" Checking "+e+" is in range "+d+"-"+b),d>f&&(f=d,c(" Set "+e+" to min value")),f>b&&(f=b,c(" Set "+e+" to max value")),z[e]=""+f}function k(){var b=a.origin,d=z.iframe.src.split("/").slice(0,3).join("/");if(y.checkOrigin&&(c(" Checking connection is from: "+d),""+b!="null"&&b!==d))throw new Error("Unexpected message received from: "+b+" for "+z.iframe.id+". Message was: "+a.data+". This error can be disabled by adding the checkOrigin: false option.");return!0}function l(){return s===(""+x).substr(0,t)}function m(){var a=z.type in{"true":1,"false":1};return a&&c(" Ignoring init message from meta parent page"),a}function n(){var a=x.substr(x.indexOf(":")+r+6);c(" MessageCallback passed: {iframe: "+z.iframe.id+", message: "+a+"}"),y.messageCallback({iframe:z.iframe,message:a}),c(" --")}function o(){if(null===z.iframe)throw new Error("iFrame ("+z.id+") does not exist on "+u);return!0}function q(){c(" Reposition requested from iFrame"),v={x:z.width,y:z.height},f()}function w(){switch(z.type){case"close":d(z.iframe),y.resizedCallback(z);break;case"message":n();break;case"scrollTo":q();break;case"reset":g(z);break;case"init":b(),y.initCallback(z.iframe);break;default:b()}}var x=a.data,z={};l()&&(c(" Received: "+x),z=e(),j("Height"),j("Width"),!m()&&o()&&k()&&(w(),p=!1))}function e(){null===v&&(v={x:void 0!==window.pageXOffset?window.pageXOffset:document.documentElement.scrollLeft,y:void 0!==window.pageYOffset?window.pageYOffset:document.documentElement.scrollTop},c(" Get position: "+v.x+","+v.y))}function f(){null!==v&&(window.scrollTo(v.x,v.y),c(" Set position: "+v.x+","+v.y),v=null)}function g(a){function b(){h(a),j("reset","reset",a.iframe)}c(" Size reset requested by "+("init"===a.type?"host page":"iFrame")),e(),i(b,a,"init")}function h(a){function b(b){a.iframe.style[b]=a[b]+"px",c(" IFrame ("+a.iframe.id+") "+b+" set to "+a[b]+"px")}y.sizeHeight&&b("height"),y.sizeWidth&&b("width")}function i(a,b,d){d!==b.type&&w?(c(" Requesting animation frame"),w(a)):a()}function j(a,b,d){c("["+a+"] Sending msg to iframe ("+b+")"),d.contentWindow.postMessage(s+b,"*")}function k(){function b(){function a(a){1/0!==y[a]&&0!==y[a]&&(k.style[a]=y[a]+"px",c(" Set "+a+" = "+y[a]+"px"))}a("maxHeight"),a("minHeight"),a("maxWidth"),a("minWidth")}function d(a){return""===a&&(k.id=a="iFrameResizer"+o++,c(" Added missing iframe ID: "+a+" ("+k.src+")")),a}function e(){c(" IFrame scrolling "+(y.scrolling?"enabled":"disabled")+" for "+l),k.style.overflow=!1===y.scrolling?"hidden":"auto",k.scrolling=!1===y.scrolling?"no":"yes"}function f(){("number"==typeof y.bodyMargin||"0"===y.bodyMargin)&&(y.bodyMarginV1=y.bodyMargin,y.bodyMargin=""+y.bodyMargin+"px")}function h(){return l+":"+y.bodyMarginV1+":"+y.sizeWidth+":"+y.log+":"+y.interval+":"+y.enablePublicMethods+":"+y.autoResize+":"+y.bodyMargin+":"+y.heightCalculationMethod+":"+y.bodyBackground+":"+y.bodyPadding+":"+y.tolerance}function i(b){a(k,"load",function(){var a=p;j("iFrame.onload",b,k),!a&&y.heightCalculationMethod in x&&g({iframe:k,height:0,width:0,type:"init"})}),j("init",b,k)}var k=this,l=d(k.id);e(),b(),f(),i(h())}function l(a){if("object"!=typeof a)throw new TypeError("Options is not an object.")}function m(){function a(a){if("IFRAME"!==a.tagName.toUpperCase())throw new TypeError("Expected <IFRAME> tag, found <"+a.tagName+">.");k.call(a)}function b(a){a=a||{},l(a);for(var b in z)z.hasOwnProperty(b)&&(y[b]=a.hasOwnProperty(b)?a[b]:z[b])}return function(c,d){b(c),Array.prototype.forEach.call(document.querySelectorAll(d||"iframe"),a)}}function n(a){a.fn.iFrameResize=function(b){return b=b||{},l(b),y=a.extend({},z,b),this.filter("iframe").each(k).end()}}var o=0,p=!0,q="message",r=q.length,s="[iFrameSizer]",t=s.length,u="",v=null,w=window.requestAnimationFrame,x={max:1,scroll:1,bodyScroll:1,documentElementScroll:1},y={},z={autoResize:!0,bodyBackground:null,bodyMargin:null,bodyMarginV1:8,bodyPadding:null,checkOrigin:!0,enablePublicMethods:!1,heightCalculationMethod:"offset",interval:32,log:!1,maxHeight:1/0,maxWidth:1/0,minHeight:0,minWidth:0,scrolling:!1,sizeHeight:!0,sizeWidth:!1,tolerance:0,closedCallback:function(){},initCallback:function(){},messageCallback:function(){},resizedCallback:function(){}};b(),a(window,"message",d),"jQuery"in window&&n(jQuery),"function"==typeof define&&define.amd?define(function(){return m()}):window.iFrameResize=m()}();
|
| 9 |
-
//# sourceMappingURL=../src/iframeResizer.map
|
| 10 |
-
|
| 1 |
+
/*! iFrame Resizer (iframeSizer.min.js ) - v2.6.1 - 2014-09-03
|
| 2 |
+
* Desc: Force cross domain iframes to size to content.
|
| 3 |
+
* Requires: iframeResizer.contentWindow.min.js to be loaded into the target frame.
|
| 4 |
+
* Copyright: (c) 2014 David J. Bradshaw - dave@bradshaw.net
|
| 5 |
+
* License: MIT
|
| 6 |
+
*/
|
| 7 |
+
|
| 8 |
+
!function(){"use strict";function a(a,b,c){"addEventListener"in window?a.addEventListener(b,c,!1):"attachEvent"in window&&a.attachEvent("on"+b,c)}function b(){var a,b=["moz","webkit","o","ms"];for(a=0;a<b.length&&!w;a+=1)w=window[b[a]+"RequestAnimationFrame"];w||c(" RequestAnimationFrame not supported")}function c(a){y.log&&"object"==typeof console&&console.log(s+"[Host page"+u+"]"+a)}function d(a){function b(){function a(){h(z),f(),y.resizedCallback(z)}i(a,z,"resetPage")}function d(a){var b=a.id;c(" Removing iFrame: "+b),a.parentNode.removeChild(a),y.closedCallback(b),c(" --")}function e(){var a=x.substr(t).split(":");return{iframe:document.getElementById(a[0]),id:a[0],height:a[1],width:a[2],type:a[3]}}function j(a){var b=Number(y["max"+a]),d=Number(y["min"+a]),e=a.toLowerCase(),f=Number(z[e]);if(d>b)throw new Error("Value for min"+a+" can not be greater than max"+a);c(" Checking "+e+" is in range "+d+"-"+b),d>f&&(f=d,c(" Set "+e+" to min value")),f>b&&(f=b,c(" Set "+e+" to max value")),z[e]=""+f}function k(){var b=a.origin,d=z.iframe.src.split("/").slice(0,3).join("/");if(y.checkOrigin&&(c(" Checking connection is from: "+d),""+b!="null"&&b!==d))throw new Error("Unexpected message received from: "+b+" for "+z.iframe.id+". Message was: "+a.data+". This error can be disabled by adding the checkOrigin: false option.");return!0}function l(){return s===(""+x).substr(0,t)}function m(){var a=z.type in{"true":1,"false":1};return a&&c(" Ignoring init message from meta parent page"),a}function n(){var a=x.substr(x.indexOf(":")+r+6);c(" MessageCallback passed: {iframe: "+z.iframe.id+", message: "+a+"}"),y.messageCallback({iframe:z.iframe,message:a}),c(" --")}function o(){if(null===z.iframe)throw new Error("iFrame ("+z.id+") does not exist on "+u);return!0}function q(){c(" Reposition requested from iFrame"),v={x:z.width,y:z.height},f()}function w(){switch(z.type){case"close":d(z.iframe),y.resizedCallback(z);break;case"message":n();break;case"scrollTo":q();break;case"reset":g(z);break;case"init":b(),y.initCallback(z.iframe);break;default:b()}}var x=a.data,z={};l()&&(c(" Received: "+x),z=e(),j("Height"),j("Width"),!m()&&o()&&k()&&(w(),p=!1))}function e(){null===v&&(v={x:void 0!==window.pageXOffset?window.pageXOffset:document.documentElement.scrollLeft,y:void 0!==window.pageYOffset?window.pageYOffset:document.documentElement.scrollTop},c(" Get position: "+v.x+","+v.y))}function f(){null!==v&&(window.scrollTo(v.x,v.y),c(" Set position: "+v.x+","+v.y),v=null)}function g(a){function b(){h(a),j("reset","reset",a.iframe)}c(" Size reset requested by "+("init"===a.type?"host page":"iFrame")),e(),i(b,a,"init")}function h(a){function b(b){a.iframe.style[b]=a[b]+"px",c(" IFrame ("+a.iframe.id+") "+b+" set to "+a[b]+"px")}y.sizeHeight&&b("height"),y.sizeWidth&&b("width")}function i(a,b,d){d!==b.type&&w?(c(" Requesting animation frame"),w(a)):a()}function j(a,b,d){c("["+a+"] Sending msg to iframe ("+b+")"),d.contentWindow.postMessage(s+b,"*")}function k(){function b(){function a(a){1/0!==y[a]&&0!==y[a]&&(k.style[a]=y[a]+"px",c(" Set "+a+" = "+y[a]+"px"))}a("maxHeight"),a("minHeight"),a("maxWidth"),a("minWidth")}function d(a){return""===a&&(k.id=a="iFrameResizer"+o++,c(" Added missing iframe ID: "+a+" ("+k.src+")")),a}function e(){c(" IFrame scrolling "+(y.scrolling?"enabled":"disabled")+" for "+l),k.style.overflow=!1===y.scrolling?"hidden":"auto",k.scrolling=!1===y.scrolling?"no":"yes"}function f(){("number"==typeof y.bodyMargin||"0"===y.bodyMargin)&&(y.bodyMarginV1=y.bodyMargin,y.bodyMargin=""+y.bodyMargin+"px")}function h(){return l+":"+y.bodyMarginV1+":"+y.sizeWidth+":"+y.log+":"+y.interval+":"+y.enablePublicMethods+":"+y.autoResize+":"+y.bodyMargin+":"+y.heightCalculationMethod+":"+y.bodyBackground+":"+y.bodyPadding+":"+y.tolerance}function i(b){a(k,"load",function(){var a=p;j("iFrame.onload",b,k),!a&&y.heightCalculationMethod in x&&g({iframe:k,height:0,width:0,type:"init"})}),j("init",b,k)}var k=this,l=d(k.id);e(),b(),f(),i(h())}function l(a){if("object"!=typeof a)throw new TypeError("Options is not an object.")}function m(){function a(a){if("IFRAME"!==a.tagName.toUpperCase())throw new TypeError("Expected <IFRAME> tag, found <"+a.tagName+">.");k.call(a)}function b(a){a=a||{},l(a);for(var b in z)z.hasOwnProperty(b)&&(y[b]=a.hasOwnProperty(b)?a[b]:z[b])}return function(c,d){b(c),Array.prototype.forEach.call(document.querySelectorAll(d||"iframe"),a)}}function n(a){a.fn.iFrameResize=function(b){return b=b||{},l(b),y=a.extend({},z,b),this.filter("iframe").each(k).end()}}var o=0,p=!0,q="message",r=q.length,s="[iFrameSizer]",t=s.length,u="",v=null,w=window.requestAnimationFrame,x={max:1,scroll:1,bodyScroll:1,documentElementScroll:1},y={},z={autoResize:!0,bodyBackground:null,bodyMargin:null,bodyMarginV1:8,bodyPadding:null,checkOrigin:!0,enablePublicMethods:!1,heightCalculationMethod:"offset",interval:32,log:!1,maxHeight:1/0,maxWidth:1/0,minHeight:0,minWidth:0,scrolling:!1,sizeHeight:!0,sizeWidth:!1,tolerance:0,closedCallback:function(){},initCallback:function(){},messageCallback:function(){},resizedCallback:function(){}};b(),a(window,"message",d),"jQuery"in window&&n(jQuery),"function"==typeof define&&define.amd?define(function(){return m()}):window.iFrameResize=m()}();
|
| 9 |
+
//# sourceMappingURL=../src/iframeResizer.map
|
| 10 |
+
|
plus/types-access.php
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
/*
|
| 3 |
* Types Access teaser.
|
| 4 |
*
|
| 5 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 6 |
-
* $LastChangedDate: 2015-02
|
| 7 |
-
* $LastChangedRevision:
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
|
@@ -80,7 +80,7 @@ function wpcf_access_teaser_admin_menu_page()
|
|
| 80 |
/**
|
| 81 |
* show message
|
| 82 |
*/
|
| 83 |
-
|
| 84 |
echo '<div class="types-help"><div class="types-help-content"';
|
| 85 |
echo '<p>' . sprintf(__( 'This screen shows a preview of %sAccess%s - the access control and roles management addon for Types.',
|
| 86 |
'wpcf' ), '<strong><a href="http://wp-types.com/home/types-access/?utm_source=typesplugin&utm_medium=accessadmin&utm_term=Access&utm_campaign=typesplugin" target="_blank">','</a></strong>')
|
|
@@ -96,5 +96,5 @@ function wpcf_access_teaser_admin_menu_page()
|
|
| 96 |
echo '</div></div>';
|
| 97 |
require_once WPCF_ACCESS_INC . '/admin-edit-access.php';
|
| 98 |
wpcf_access_admin_edit_access( false );
|
| 99 |
-
|
| 100 |
}
|
| 2 |
/*
|
| 3 |
* Types Access teaser.
|
| 4 |
*
|
| 5 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/plus/types-access.php $
|
| 6 |
+
* $LastChangedDate: 2015-03-02 10:49:00 +0000 (Mon, 02 Mar 2015) $
|
| 7 |
+
* $LastChangedRevision: 1103173 $
|
| 8 |
* $LastChangedBy: iworks $
|
| 9 |
*
|
| 10 |
*/
|
| 80 |
/**
|
| 81 |
* show message
|
| 82 |
*/
|
| 83 |
+
wpcf_add_admin_header( __( 'Access', 'wpcf' ), 'icon-wpcf-access' );
|
| 84 |
echo '<div class="types-help"><div class="types-help-content"';
|
| 85 |
echo '<p>' . sprintf(__( 'This screen shows a preview of %sAccess%s - the access control and roles management addon for Types.',
|
| 86 |
'wpcf' ), '<strong><a href="http://wp-types.com/home/types-access/?utm_source=typesplugin&utm_medium=accessadmin&utm_term=Access&utm_campaign=typesplugin" target="_blank">','</a></strong>')
|
| 96 |
echo '</div></div>';
|
| 97 |
require_once WPCF_ACCESS_INC . '/admin-edit-access.php';
|
| 98 |
wpcf_access_admin_edit_access( false );
|
| 99 |
+
wpcf_add_admin_footer();
|
| 100 |
}
|
plus/types-access/includes/admin-edit-access.php
CHANGED
|
@@ -264,7 +264,7 @@ function wpcf_access_admin_edit_access($enabled = true) {
|
|
| 264 |
}
|
| 265 |
}
|
| 266 |
if (isset($cap['style']) && $cap['style'] == 'dropdown') {
|
| 267 |
-
|
| 268 |
} else {
|
| 269 |
$output .= wpcf_access_permissions_table($roles, $saved_data,
|
| 270 |
$caps, $area['id'], $group['id'], $enabled);
|
|
@@ -310,11 +310,11 @@ function wpcf_access_admin_edit_access($enabled = true) {
|
|
| 310 |
|
| 311 |
/**
|
| 312 |
* Renders dropdown with editable roles.
|
| 313 |
-
*
|
| 314 |
* @param type $roles
|
| 315 |
* @param type $name
|
| 316 |
* @param type $data
|
| 317 |
-
* @return string
|
| 318 |
*/
|
| 319 |
function wpcf_access_admin_roles_dropdown($roles, $name, $data = array(),
|
| 320 |
$dummy = false, $enabled = true, $exclude = array()) {
|
|
@@ -360,10 +360,10 @@ function wpcf_access_admin_roles_dropdown($roles, $name, $data = array(),
|
|
| 360 |
|
| 361 |
/**
|
| 362 |
* Auto-suggest users search.
|
| 363 |
-
*
|
| 364 |
* @param type $data
|
| 365 |
* @param type $name
|
| 366 |
-
* @return string
|
| 367 |
*/
|
| 368 |
function wpcf_access_admin_users_form($data, $name, $enabled = true,
|
| 369 |
$managed = true) {
|
|
@@ -386,12 +386,12 @@ function wpcf_access_admin_users_form($data, $name, $enabled = true,
|
|
| 386 |
|
| 387 |
/**
|
| 388 |
* Renders pre-defined table.
|
| 389 |
-
*
|
| 390 |
* @param type $type_slug
|
| 391 |
* @param type $roles
|
| 392 |
* @param type $name
|
| 393 |
* @param type $data
|
| 394 |
-
* @return string
|
| 395 |
*/
|
| 396 |
function wpcf_access_admin_predefined($type_slug, $roles, $name, $data,
|
| 397 |
$enabled = true) {
|
|
@@ -418,12 +418,12 @@ function wpcf_access_admin_predefined($type_slug, $roles, $name, $data,
|
|
| 418 |
|
| 419 |
/**
|
| 420 |
* Renders custom caps types table.
|
| 421 |
-
*
|
| 422 |
* @param type $type_slug
|
| 423 |
* @param type $roles
|
| 424 |
* @param type $name
|
| 425 |
* @param type $data
|
| 426 |
-
* @return string
|
| 427 |
*/
|
| 428 |
function wpcf_access_admin_edit_access_types_item($type_slug, $roles, $name,
|
| 429 |
$data, $enabled = true) {
|
|
@@ -455,12 +455,12 @@ function wpcf_access_admin_edit_access_types_item($type_slug, $roles, $name,
|
|
| 455 |
|
| 456 |
/**
|
| 457 |
* Renders custom caps tax table.
|
| 458 |
-
*
|
| 459 |
* @param type $type_slug
|
| 460 |
* @param type $roles
|
| 461 |
* @param type $name
|
| 462 |
* @param type $data
|
| 463 |
-
* @return string
|
| 464 |
*/
|
| 465 |
function wpcf_access_admin_edit_access_tax_item($type_slug, $roles, $name,
|
| 466 |
$data, $enabled = true) {
|
|
@@ -485,10 +485,10 @@ function wpcf_access_admin_edit_access_tax_item($type_slug, $roles, $name,
|
|
| 485 |
|
| 486 |
/**
|
| 487 |
* Reset caps button.
|
| 488 |
-
*
|
| 489 |
* @param type $type_slug
|
| 490 |
* @param type $type
|
| 491 |
-
* @return string
|
| 492 |
*/
|
| 493 |
function wpcf_access_reset_button($type_slug, $type = 'type', $enabled = true,
|
| 494 |
$managed = true) {
|
|
@@ -515,10 +515,10 @@ function wpcf_access_reset_button($type_slug, $type = 'type', $enabled = true,
|
|
| 515 |
|
| 516 |
/**
|
| 517 |
* Submit button.
|
| 518 |
-
*
|
| 519 |
* @param type $enabled
|
| 520 |
* @param type $managed
|
| 521 |
-
* @return type
|
| 522 |
*/
|
| 523 |
function wpcf_access_submit_button($enabled = true, $managed = true) {
|
| 524 |
$output = '';
|
|
@@ -538,9 +538,9 @@ function wpcf_access_submit_button($enabled = true, $managed = true) {
|
|
| 538 |
|
| 539 |
/**
|
| 540 |
* Custom roles form.
|
| 541 |
-
*
|
| 542 |
* @param type $roles
|
| 543 |
-
* @return string
|
| 544 |
*/
|
| 545 |
function wpcf_access_admin_set_custom_roles_level_form($roles, $enabled = true) {
|
| 546 |
$levels = wpcf_access_role_to_level_map();
|
|
@@ -704,11 +704,11 @@ function wpcf_access_admin_set_custom_roles_level_form($roles, $enabled = true)
|
|
| 704 |
|
| 705 |
/**
|
| 706 |
* HTML formatted permissions table.
|
| 707 |
-
*
|
| 708 |
* @param type $roles
|
| 709 |
* @param type $permissions
|
| 710 |
* @param type $name
|
| 711 |
-
* @return string
|
| 712 |
*/
|
| 713 |
function wpcf_access_permissions_table($roles, $permissions, $settings,
|
| 714 |
$group_id, $id, $enabled = true, $managed = true) {
|
|
@@ -816,9 +816,9 @@ function wpcf_access_permissions_table($roles, $permissions, $settings,
|
|
| 816 |
|
| 817 |
/**
|
| 818 |
* Suggest user form.
|
| 819 |
-
*
|
| 820 |
-
* @global
|
| 821 |
-
* @return string
|
| 822 |
*/
|
| 823 |
function wpcf_access_suggest_user($enabled = true, $managed = false) {
|
| 824 |
global $wpdb;
|
|
@@ -850,8 +850,8 @@ function wpcf_access_suggest_user($enabled = true, $managed = false) {
|
|
| 850 |
|
| 851 |
/**
|
| 852 |
* New role form.
|
| 853 |
-
*
|
| 854 |
-
* @return string
|
| 855 |
*/
|
| 856 |
function wpcf_access_new_role_form($enabled) {
|
| 857 |
$output = '';
|
|
@@ -876,9 +876,9 @@ function wpcf_access_new_role_form($enabled) {
|
|
| 876 |
|
| 877 |
/**
|
| 878 |
* Reassing role form.
|
| 879 |
-
*
|
| 880 |
* @param type $role
|
| 881 |
-
* @return string
|
| 882 |
*/
|
| 883 |
function wpcf_access_reassign_role_form($role) {
|
| 884 |
$output = '';
|
|
@@ -917,4 +917,4 @@ function wpcf_access_reassign_role_form($role) {
|
|
| 917 |
</div>';
|
| 918 |
$output .= '<div class="ajax-response"></div></div></div>';
|
| 919 |
return $output;
|
| 920 |
-
}
|
| 264 |
}
|
| 265 |
}
|
| 266 |
if (isset($cap['style']) && $cap['style'] == 'dropdown') {
|
| 267 |
+
|
| 268 |
} else {
|
| 269 |
$output .= wpcf_access_permissions_table($roles, $saved_data,
|
| 270 |
$caps, $area['id'], $group['id'], $enabled);
|
| 310 |
|
| 311 |
/**
|
| 312 |
* Renders dropdown with editable roles.
|
| 313 |
+
*
|
| 314 |
* @param type $roles
|
| 315 |
* @param type $name
|
| 316 |
* @param type $data
|
| 317 |
+
* @return string
|
| 318 |
*/
|
| 319 |
function wpcf_access_admin_roles_dropdown($roles, $name, $data = array(),
|
| 320 |
$dummy = false, $enabled = true, $exclude = array()) {
|
| 360 |
|
| 361 |
/**
|
| 362 |
* Auto-suggest users search.
|
| 363 |
+
*
|
| 364 |
* @param type $data
|
| 365 |
* @param type $name
|
| 366 |
+
* @return string
|
| 367 |
*/
|
| 368 |
function wpcf_access_admin_users_form($data, $name, $enabled = true,
|
| 369 |
$managed = true) {
|
| 386 |
|
| 387 |
/**
|
| 388 |
* Renders pre-defined table.
|
| 389 |
+
*
|
| 390 |
* @param type $type_slug
|
| 391 |
* @param type $roles
|
| 392 |
* @param type $name
|
| 393 |
* @param type $data
|
| 394 |
+
* @return string
|
| 395 |
*/
|
| 396 |
function wpcf_access_admin_predefined($type_slug, $roles, $name, $data,
|
| 397 |
$enabled = true) {
|
| 418 |
|
| 419 |
/**
|
| 420 |
* Renders custom caps types table.
|
| 421 |
+
*
|
| 422 |
* @param type $type_slug
|
| 423 |
* @param type $roles
|
| 424 |
* @param type $name
|
| 425 |
* @param type $data
|
| 426 |
+
* @return string
|
| 427 |
*/
|
| 428 |
function wpcf_access_admin_edit_access_types_item($type_slug, $roles, $name,
|
| 429 |
$data, $enabled = true) {
|
| 455 |
|
| 456 |
/**
|
| 457 |
* Renders custom caps tax table.
|
| 458 |
+
*
|
| 459 |
* @param type $type_slug
|
| 460 |
* @param type $roles
|
| 461 |
* @param type $name
|
| 462 |
* @param type $data
|
| 463 |
+
* @return string
|
| 464 |
*/
|
| 465 |
function wpcf_access_admin_edit_access_tax_item($type_slug, $roles, $name,
|
| 466 |
$data, $enabled = true) {
|
| 485 |
|
| 486 |
/**
|
| 487 |
* Reset caps button.
|
| 488 |
+
*
|
| 489 |
* @param type $type_slug
|
| 490 |
* @param type $type
|
| 491 |
+
* @return string
|
| 492 |
*/
|
| 493 |
function wpcf_access_reset_button($type_slug, $type = 'type', $enabled = true,
|
| 494 |
$managed = true) {
|
| 515 |
|
| 516 |
/**
|
| 517 |
* Submit button.
|
| 518 |
+
*
|
| 519 |
* @param type $enabled
|
| 520 |
* @param type $managed
|
| 521 |
+
* @return type
|
| 522 |
*/
|
| 523 |
function wpcf_access_submit_button($enabled = true, $managed = true) {
|
| 524 |
$output = '';
|
| 538 |
|
| 539 |
/**
|
| 540 |
* Custom roles form.
|
| 541 |
+
*
|
| 542 |
* @param type $roles
|
| 543 |
+
* @return string
|
| 544 |
*/
|
| 545 |
function wpcf_access_admin_set_custom_roles_level_form($roles, $enabled = true) {
|
| 546 |
$levels = wpcf_access_role_to_level_map();
|
| 704 |
|
| 705 |
/**
|
| 706 |
* HTML formatted permissions table.
|
| 707 |
+
*
|
| 708 |
* @param type $roles
|
| 709 |
* @param type $permissions
|
| 710 |
* @param type $name
|
| 711 |
+
* @return string
|
| 712 |
*/
|
| 713 |
function wpcf_access_permissions_table($roles, $permissions, $settings,
|
| 714 |
$group_id, $id, $enabled = true, $managed = true) {
|
| 816 |
|
| 817 |
/**
|
| 818 |
* Suggest user form.
|
| 819 |
+
*
|
| 820 |
+
* @global object $wpdb
|
| 821 |
+
* @return string
|
| 822 |
*/
|
| 823 |
function wpcf_access_suggest_user($enabled = true, $managed = false) {
|
| 824 |
global $wpdb;
|
| 850 |
|
| 851 |
/**
|
| 852 |
* New role form.
|
| 853 |
+
*
|
| 854 |
+
* @return string
|
| 855 |
*/
|
| 856 |
function wpcf_access_new_role_form($enabled) {
|
| 857 |
$output = '';
|
| 876 |
|
| 877 |
/**
|
| 878 |
* Reassing role form.
|
| 879 |
+
*
|
| 880 |
* @param type $role
|
| 881 |
+
* @return string
|
| 882 |
*/
|
| 883 |
function wpcf_access_reassign_role_form($role) {
|
| 884 |
$output = '';
|
| 917 |
</div>';
|
| 918 |
$output .= '<div class="ajax-response"></div></div></div>';
|
| 919 |
return $output;
|
| 920 |
+
}
|
readme.txt
CHANGED
|
@@ -5,7 +5,7 @@ Tags: CMS, custom field, custom fields, custom post type, custom post types, pos
|
|
| 5 |
License: GPLv2
|
| 6 |
Requires at least: 3.4
|
| 7 |
Tested up to: 4.1.1
|
| 8 |
-
Stable tag: 1.6.
|
| 9 |
|
| 10 |
The complete and reliable plugin for managing custom post types, custom taxonomy and custom fields.
|
| 11 |
|
|
@@ -143,22 +143,41 @@ Additionally, Types is the only plugin that lets you define parent/child relatio
|
|
| 143 |
|
| 144 |
== Screenshots ==
|
| 145 |
|
| 146 |
-
1.
|
| 147 |
-
2. Defining custom
|
| 148 |
-
3.
|
| 149 |
-
4.
|
| 150 |
-
5.
|
| 151 |
-
6.
|
| 152 |
-
7.
|
|
|
|
|
|
|
| 153 |
|
| 154 |
== Changelog ==
|
| 155 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 156 |
= 1.6.5.1 =
|
| 157 |
|
| 158 |
* Release date: 2015-02-24
|
| 159 |
-
*
|
| 160 |
-
*
|
| 161 |
-
*
|
| 162 |
|
| 163 |
= 1.6.5 =
|
| 164 |
|
| 5 |
License: GPLv2
|
| 6 |
Requires at least: 3.4
|
| 7 |
Tested up to: 4.1.1
|
| 8 |
+
Stable tag: 1.6.6
|
| 9 |
|
| 10 |
The complete and reliable plugin for managing custom post types, custom taxonomy and custom fields.
|
| 11 |
|
| 143 |
|
| 144 |
== Screenshots ==
|
| 145 |
|
| 146 |
+
1. Custom post types list
|
| 147 |
+
2. Defining custom taxonomy list
|
| 148 |
+
3. Defining custom post type
|
| 149 |
+
4. Defining custom fields (meta-groups)
|
| 150 |
+
5. Editing custom fields
|
| 151 |
+
6. Inserting custom fields to content
|
| 152 |
+
7. Bulk editing child content using Field Tables
|
| 153 |
+
8. Edit Custom Post Type
|
| 154 |
+
9. Edit Taxonomy
|
| 155 |
|
| 156 |
== Changelog ==
|
| 157 |
|
| 158 |
+
= 1.6.6 =
|
| 159 |
+
|
| 160 |
+
* Fixed problem with shortcode "playlist" used in WYSIWYG field. http://wp-types.com/forums/topic/media-play-list-not-outputting-from-custom-wysiwyg-field-js-error/
|
| 161 |
+
* Fixed empty title problem for filter "wpt_field_options" on user edit/add screen https://wp-types.com/forums/topic/populate-select-field-in-wpcf-um-group/
|
| 162 |
+
* Added ability to create CPT without title and editor. https://wp-types.com/forums/topic/inaccurate-warning-message-when-creatingediting-a-cpt/
|
| 163 |
+
* Added Skype field validation.
|
| 164 |
+
* Fixed problem with loading custom CSS when user meta group is inactive or not assign to certain user role.
|
| 165 |
+
* Added ability to add to menu link to archive of post type.
|
| 166 |
+
* Added ability to setup meta box callback function. https://wp-types.com/forums/topic/add-support-for-meta_box_cb-in-custom-taxonomy/
|
| 167 |
+
* Added ability to add HTML5 placeholder attribute for custom post fields.
|
| 168 |
+
* Fixed problem with CPT labels. https://wp-types.com/forums/topic/after-save-cpts-cutom-labels-always-revert-to-default-label/
|
| 169 |
+
* Added a filters to the post title as option text in the select dropdown for post parents. wpcf_pr_belongs_items for array of options and wpcf_pr_belongs_item for one option. https://wp-types.com/forums/topic/help-to-distinguish-duplicate-titles-in-post-relationship/
|
| 170 |
+
* Added ability to choose custom fields to display it on custom posts admin list.
|
| 171 |
+
* Fixed problem with saving parent data into child data. On parent edit screen.
|
| 172 |
+
* Added check group name for Custom Fields and User Fields.
|
| 173 |
+
* Fixed missing "Edit" button on group edit screen when we close custom logic form.
|
| 174 |
+
|
| 175 |
= 1.6.5.1 =
|
| 176 |
|
| 177 |
* Release date: 2015-02-24
|
| 178 |
+
* Fixed Installer patch to plugins.
|
| 179 |
+
* Fixed problem with "Access Control and User Roles" menu in Types, when Access is active http://wp-types.com/forums/topic/update-issues-fatal-error-require_once-failed-opening-required-wpcf_access_/
|
| 180 |
+
* Changed utm_media used in links on "Getting Started" pages.
|
| 181 |
|
| 182 |
= 1.6.5 =
|
| 183 |
|
resources/css/basic.css
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Full version CSS
|
| 3 |
-
|
| 4 |
-
Before moving out of embedded version - check twice.
|
| 5 |
-
NO DUPLICATES
|
| 6 |
-
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
resources/js/basic.js
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
/** * * Use this file only for scripts needed in full version.
|
| 2 |
* Before moving from embedded JS - make sure it's needed only here.
|
| 3 |
*
|
| 4 |
-
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.
|
| 1 |
/** * * Use this file only for scripts needed in full version.
|
| 2 |
* Before moving from embedded JS - make sure it's needed only here.
|
| 3 |
*
|
| 4 |
+
* $HeadURL: http://plugins.svn.wordpress.org/types/tags/1.6.6/resources/js/basic.
|
