Version Description
- Updated so that also widget data gets removed when you de-install the plugin, so now everything is completely removed
Download this release
Release Info
| Developer | socialdude |
| Plugin |  Social Share Icons & Social Share Buttons |
| Version | 2.6.5 |
| Comparing to | |
| See all releases | |
Code changes from version 2.6.4 to 2.6.5
- css/disable_sfsi.css +6 -6
- css/fonts/generator_config.txt +4 -4
- css/fonts/helvetica_0-demo.html +610 -610
- css/images/index.php +2 -2
- css/index.php +2 -2
- css/jquery-ui-1.10.4/images/index.php +2 -2
- css/jquery-ui-1.10.4/index.php +2 -2
- css/jquery-ui-1.10.4/jquery-ui-min.css +4 -4
- css/jquery-ui-1.10.4/jquery-ui.css +1195 -1195
- css/sfsi-admin-style.css +1231 -1231
- css/sfsi-style.css +3263 -3263
- freemius/assets/scss/_load.scss +4 -4
- freemius/assets/scss/_start.scss +3 -3
- freemius/assets/scss/_vars.scss +5 -5
- freemius/assets/scss/admin/connect.scss +471 -471
- freemius/includes/i18n.php +517 -517
- freemius/includes/managers/class-fs-admin-notice-manager.php +312 -312
- freemius/includes/sdk/Exceptions/ArgumentNotExistException.php +8 -8
- freemius/includes/sdk/Exceptions/EmptyArgumentException.php +8 -8
- freemius/includes/sdk/Exceptions/Exception.php +73 -73
- freemius/includes/sdk/Exceptions/InvalidArgumentException.php +7 -7
- freemius/includes/sdk/Exceptions/OAuthException.php +11 -11
- freemius/includes/sdk/Freemius.php +582 -582
- freemius/includes/sdk/FreemiusBase.php +188 -188
- freemius/start.php +307 -307
- freemius/templates/connect.php +406 -406
- helpers/linkedin-api/linkedin-api.php +134 -134
- helpers/sfsi_plus_OAuth.php +892 -892
- helpers/twitter-api/twitteroauth.php +241 -241
- images/icons_theme/badge/index.php +2 -2
- images/icons_theme/index.php +2 -2
- images/index.php +2 -2
- index.php +2 -2
- js/custom-admin.js +1981 -1981
- js/custom.js +320 -320
- js/custom.min.js +1 -1
css/disable_sfsi.css
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
-
@media (max-width: 767px)
|
| 2 |
-
{
|
| 3 |
-
#sfsi_plus_floater
|
| 4 |
-
{
|
| 5 |
-
display: none;
|
| 6 |
-
}
|
| 7 |
}
|
| 1 |
+
@media (max-width: 767px)
|
| 2 |
+
{
|
| 3 |
+
#sfsi_plus_floater
|
| 4 |
+
{
|
| 5 |
+
display: none;
|
| 6 |
+
}
|
| 7 |
}
|
css/fonts/generator_config.txt
CHANGED
|
@@ -1,5 +1,5 @@
|
|
| 1 |
-
# Font Squirrel Font-face Generator Configuration File
|
| 2 |
-
# Upload this file to the generator to recreate the settings
|
| 3 |
-
# you used to create these fonts.
|
| 4 |
-
|
| 5 |
{"mode":"optimal","formats":["ttf","woff","eotz"],"tt_instructor":"default","fix_vertical_metrics":"Y","fix_gasp":"xy","add_spaces":"Y","add_hyphens":"Y","fallback":"none","fallback_custom":"100","options_subset":"basic","subset_custom":"","subset_custom_range":"","subset_ot_features_list":"","css_stylesheet":"stylesheet.css","filename_suffix":"-webfont","emsquare":"2048","spacing_adjustment":"0"}
|
| 1 |
+
# Font Squirrel Font-face Generator Configuration File
|
| 2 |
+
# Upload this file to the generator to recreate the settings
|
| 3 |
+
# you used to create these fonts.
|
| 4 |
+
|
| 5 |
{"mode":"optimal","formats":["ttf","woff","eotz"],"tt_instructor":"default","fix_vertical_metrics":"Y","fix_gasp":"xy","add_spaces":"Y","add_hyphens":"Y","fallback":"none","fallback_custom":"100","options_subset":"basic","subset_custom":"","subset_custom_range":"","subset_ot_features_list":"","css_stylesheet":"stylesheet.css","filename_suffix":"-webfont","emsquare":"2048","spacing_adjustment":"0"}
|
css/fonts/helvetica_0-demo.html
CHANGED
|
@@ -1,610 +1,610 @@
|
|
| 1 |
-
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
| 2 |
-
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
| 3 |
-
|
| 4 |
-
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
|
| 5 |
-
<head>
|
| 6 |
-
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
|
| 7 |
-
<script src="http://ajax.googleapis.com/ajax/libs/jquery/1.7.2/jquery.min.js" type="text/javascript" charset="utf-8"></script>
|
| 8 |
-
<script src="specimen_files/easytabs.js" type="text/javascript" charset="utf-8"></script>
|
| 9 |
-
<link rel="stylesheet" href="specimen_files/specimen_stylesheet.css" type="text/css" charset="utf-8" />
|
| 10 |
-
<link rel="stylesheet" href="stylesheet.css" type="text/css" charset="utf-8" />
|
| 11 |
-
|
| 12 |
-
<style type="text/css">
|
| 13 |
-
body{
|
| 14 |
-
font-family: 'helveticaregular';
|
| 15 |
-
}
|
| 16 |
-
</style>
|
| 17 |
-
|
| 18 |
-
<title>Helvetica Regular Specimen</title>
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
<script type="text/javascript" charset="utf-8">
|
| 22 |
-
$(document).ready(function() {
|
| 23 |
-
$('#container').easyTabs({defaultContent:1});
|
| 24 |
-
});
|
| 25 |
-
</script>
|
| 26 |
-
</head>
|
| 27 |
-
|
| 28 |
-
<body>
|
| 29 |
-
<div id="container">
|
| 30 |
-
<div id="header">
|
| 31 |
-
Helvetica Regular </div>
|
| 32 |
-
<ul class="tabs">
|
| 33 |
-
<li><a href="#specimen">Specimen</a></li>
|
| 34 |
-
<li><a href="#layout">Sample Layout</a></li>
|
| 35 |
-
<li><a href="#glyphs">Glyphs & Languages</a></li>
|
| 36 |
-
<li><a href="#installing">Installing Webfonts</a></li>
|
| 37 |
-
|
| 38 |
-
</ul>
|
| 39 |
-
|
| 40 |
-
<div id="main_content">
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
<div id="specimen">
|
| 44 |
-
|
| 45 |
-
<div class="section">
|
| 46 |
-
<div class="grid12 firstcol">
|
| 47 |
-
<div class="huge">AaBb</div>
|
| 48 |
-
</div>
|
| 49 |
-
</div>
|
| 50 |
-
|
| 51 |
-
<div class="section">
|
| 52 |
-
<div class="glyph_range">A​B​C​D​E​F​G​H​I​J​K​L​M​N​O​P​Q​R​S​T​U​V​W​X​Y​Z​a​b​c​d​e​f​g​h​i​j​k​l​m​n​o​p​q​r​s​t​u​v​w​x​y​z​1​2​3​4​5​6​7​8​9​0​&​.​,​?​!​@​(​)​#​$​%​*​+​-​=​:​;</div>
|
| 53 |
-
</div>
|
| 54 |
-
<div class="section">
|
| 55 |
-
<div class="grid12 firstcol">
|
| 56 |
-
<table class="sample_table">
|
| 57 |
-
<tr><td>10</td><td class="size10">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 58 |
-
<tr><td>11</td><td class="size11">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 59 |
-
<tr><td>12</td><td class="size12">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 60 |
-
<tr><td>13</td><td class="size13">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 61 |
-
<tr><td>14</td><td class="size14">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 62 |
-
<tr><td>16</td><td class="size16">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 63 |
-
<tr><td>18</td><td class="size18">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 64 |
-
<tr><td>20</td><td class="size20">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 65 |
-
<tr><td>24</td><td class="size24">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 66 |
-
<tr><td>30</td><td class="size30">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 67 |
-
<tr><td>36</td><td class="size36">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 68 |
-
<tr><td>48</td><td class="size48">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 69 |
-
<tr><td>60</td><td class="size60">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 70 |
-
<tr><td>72</td><td class="size72">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 71 |
-
<tr><td>90</td><td class="size90">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 72 |
-
</table>
|
| 73 |
-
|
| 74 |
-
</div>
|
| 75 |
-
|
| 76 |
-
</div>
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
<div class="section" id="bodycomparison">
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
<div id="xheight">
|
| 84 |
-
<div class="fontbody">◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼body</div><div class="arialbody">body</div><div class="verdanabody">body</div><div class="georgiabody">body</div></div>
|
| 85 |
-
<div class="fontbody" style="z-index:1">
|
| 86 |
-
body<span>Helvetica Regular</span>
|
| 87 |
-
</div>
|
| 88 |
-
<div class="arialbody" style="z-index:1">
|
| 89 |
-
body<span>Arial</span>
|
| 90 |
-
</div>
|
| 91 |
-
<div class="verdanabody" style="z-index:1">
|
| 92 |
-
body<span>Verdana</span>
|
| 93 |
-
</div>
|
| 94 |
-
<div class="georgiabody" style="z-index:1">
|
| 95 |
-
body<span>Georgia</span>
|
| 96 |
-
</div>
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
</div>
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
<div class="section psample psample_row1" id="">
|
| 104 |
-
|
| 105 |
-
<div class="grid2 firstcol">
|
| 106 |
-
<p class="size10"><span>10.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 107 |
-
|
| 108 |
-
</div>
|
| 109 |
-
<div class="grid3">
|
| 110 |
-
<p class="size11"><span>11.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 111 |
-
|
| 112 |
-
</div>
|
| 113 |
-
<div class="grid3">
|
| 114 |
-
<p class="size12"><span>12.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 115 |
-
|
| 116 |
-
</div>
|
| 117 |
-
<div class="grid4">
|
| 118 |
-
<p class="size13"><span>13.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 119 |
-
|
| 120 |
-
</div>
|
| 121 |
-
<div class="white_blend"></div>
|
| 122 |
-
|
| 123 |
-
</div>
|
| 124 |
-
<div class="section psample psample_row2" id="">
|
| 125 |
-
<div class="grid3 firstcol">
|
| 126 |
-
<p class="size14"><span>14.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 127 |
-
|
| 128 |
-
</div>
|
| 129 |
-
<div class="grid4">
|
| 130 |
-
<p class="size16"><span>16.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 131 |
-
|
| 132 |
-
</div>
|
| 133 |
-
<div class="grid5">
|
| 134 |
-
<p class="size18"><span>18.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 135 |
-
|
| 136 |
-
</div>
|
| 137 |
-
|
| 138 |
-
<div class="white_blend"></div>
|
| 139 |
-
|
| 140 |
-
</div>
|
| 141 |
-
|
| 142 |
-
<div class="section psample psample_row3" id="">
|
| 143 |
-
<div class="grid5 firstcol">
|
| 144 |
-
<p class="size20"><span>20.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 145 |
-
</div>
|
| 146 |
-
<div class="grid7">
|
| 147 |
-
<p class="size24"><span>24.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 148 |
-
</div>
|
| 149 |
-
|
| 150 |
-
<div class="white_blend"></div>
|
| 151 |
-
|
| 152 |
-
</div>
|
| 153 |
-
|
| 154 |
-
<div class="section psample psample_row4" id="">
|
| 155 |
-
<div class="grid12 firstcol">
|
| 156 |
-
<p class="size30"><span>30.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 157 |
-
</div>
|
| 158 |
-
<div class="white_blend"></div>
|
| 159 |
-
|
| 160 |
-
</div>
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
<div class="section psample psample_row1 fullreverse">
|
| 165 |
-
<div class="grid2 firstcol">
|
| 166 |
-
<p class="size10"><span>10.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 167 |
-
|
| 168 |
-
</div>
|
| 169 |
-
<div class="grid3">
|
| 170 |
-
<p class="size11"><span>11.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 171 |
-
|
| 172 |
-
</div>
|
| 173 |
-
<div class="grid3">
|
| 174 |
-
<p class="size12"><span>12.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 175 |
-
|
| 176 |
-
</div>
|
| 177 |
-
<div class="grid4">
|
| 178 |
-
<p class="size13"><span>13.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 179 |
-
|
| 180 |
-
</div>
|
| 181 |
-
<div class="black_blend"></div>
|
| 182 |
-
|
| 183 |
-
</div>
|
| 184 |
-
|
| 185 |
-
<div class="section psample psample_row2 fullreverse">
|
| 186 |
-
<div class="grid3 firstcol">
|
| 187 |
-
<p class="size14"><span>14.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 188 |
-
|
| 189 |
-
</div>
|
| 190 |
-
<div class="grid4">
|
| 191 |
-
<p class="size16"><span>16.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 192 |
-
|
| 193 |
-
</div>
|
| 194 |
-
<div class="grid5">
|
| 195 |
-
<p class="size18"><span>18.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 196 |
-
|
| 197 |
-
</div>
|
| 198 |
-
<div class="black_blend"></div>
|
| 199 |
-
|
| 200 |
-
</div>
|
| 201 |
-
|
| 202 |
-
<div class="section psample fullreverse psample_row3" id="">
|
| 203 |
-
<div class="grid5 firstcol">
|
| 204 |
-
<p class="size20"><span>20.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 205 |
-
</div>
|
| 206 |
-
<div class="grid7">
|
| 207 |
-
<p class="size24"><span>24.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 208 |
-
</div>
|
| 209 |
-
|
| 210 |
-
<div class="black_blend"></div>
|
| 211 |
-
|
| 212 |
-
</div>
|
| 213 |
-
|
| 214 |
-
<div class="section psample fullreverse psample_row4" id="" style="border-bottom: 20px #000 solid;">
|
| 215 |
-
<div class="grid12 firstcol">
|
| 216 |
-
<p class="size30"><span>30.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 217 |
-
</div>
|
| 218 |
-
<div class="black_blend"></div>
|
| 219 |
-
|
| 220 |
-
</div>
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
</div>
|
| 226 |
-
|
| 227 |
-
<div id="layout">
|
| 228 |
-
|
| 229 |
-
<div class="section">
|
| 230 |
-
|
| 231 |
-
<div class="grid12 firstcol">
|
| 232 |
-
<h1>Lorem Ipsum Dolor</h1>
|
| 233 |
-
<h2>Etiam porta sem malesuada magna mollis euismod</h2>
|
| 234 |
-
|
| 235 |
-
<p class="byline">By <a href="#link">Aenean Lacinia</a></p>
|
| 236 |
-
</div>
|
| 237 |
-
</div>
|
| 238 |
-
<div class="section">
|
| 239 |
-
<div class="grid8 firstcol">
|
| 240 |
-
<p class="large">Donec sed odio dui. Morbi leo risus, porta ac consectetur ac, vestibulum at eros. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 241 |
-
|
| 242 |
-
|
| 243 |
-
<h3>Pellentesque ornare sem</h3>
|
| 244 |
-
|
| 245 |
-
<p>Maecenas sed diam eget risus varius blandit sit amet non magna. Maecenas faucibus mollis interdum. Donec ullamcorper nulla non metus auctor fringilla. Nullam id dolor id nibh ultricies vehicula ut id elit. Nullam id dolor id nibh ultricies vehicula ut id elit. </p>
|
| 246 |
-
|
| 247 |
-
<p>Aenean eu leo quam. Pellentesque ornare sem lacinia quam venenatis vestibulum. Lorem ipsum dolor sit amet, consectetur adipiscing elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. </p>
|
| 248 |
-
|
| 249 |
-
<p>Nulla vitae elit libero, a pharetra augue. Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Aenean lacinia bibendum nulla sed consectetur. </p>
|
| 250 |
-
|
| 251 |
-
<p>Nullam quis risus eget urna mollis ornare vel eu leo. Nullam quis risus eget urna mollis ornare vel eu leo. Maecenas sed diam eget risus varius blandit sit amet non magna. Donec ullamcorper nulla non metus auctor fringilla. </p>
|
| 252 |
-
|
| 253 |
-
<h3>Cras mattis consectetur</h3>
|
| 254 |
-
|
| 255 |
-
<p>Aenean eu leo quam. Pellentesque ornare sem lacinia quam venenatis vestibulum. Aenean lacinia bibendum nulla sed consectetur. Integer posuere erat a ante venenatis dapibus posuere velit aliquet. Cras mattis consectetur purus sit amet fermentum. </p>
|
| 256 |
-
|
| 257 |
-
<p>Nullam id dolor id nibh ultricies vehicula ut id elit. Nullam quis risus eget urna mollis ornare vel eu leo. Cras mattis consectetur purus sit amet fermentum.</p>
|
| 258 |
-
</div>
|
| 259 |
-
|
| 260 |
-
<div class="grid4 sidebar">
|
| 261 |
-
|
| 262 |
-
<div class="box reverse">
|
| 263 |
-
<p class="last">Nullam quis risus eget urna mollis ornare vel eu leo. Donec ullamcorper nulla non metus auctor fringilla. Cras mattis consectetur purus sit amet fermentum. Sed posuere consectetur est at lobortis. Lorem ipsum dolor sit amet, consectetur adipiscing elit. </p>
|
| 264 |
-
</div>
|
| 265 |
-
|
| 266 |
-
<p class="caption">Maecenas sed diam eget risus varius.</p>
|
| 267 |
-
|
| 268 |
-
<p>Vestibulum id ligula porta felis euismod semper. Integer posuere erat a ante venenatis dapibus posuere velit aliquet. Vestibulum id ligula porta felis euismod semper. Sed posuere consectetur est at lobortis. Maecenas sed diam eget risus varius blandit sit amet non magna. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
|
| 272 |
-
<p>Duis mollis, est non commodo luctus, nisi erat porttitor ligula, eget lacinia odio sem nec elit. Aenean lacinia bibendum nulla sed consectetur. Vivamus sagittis lacus vel augue laoreet rutrum faucibus dolor auctor. Aenean lacinia bibendum nulla sed consectetur. Nullam quis risus eget urna mollis ornare vel eu leo. </p>
|
| 273 |
-
|
| 274 |
-
<p>Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Donec ullamcorper nulla non metus auctor fringilla. Maecenas faucibus mollis interdum. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 275 |
-
|
| 276 |
-
</div>
|
| 277 |
-
</div>
|
| 278 |
-
|
| 279 |
-
</div>
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
<div id="glyphs">
|
| 287 |
-
<div class="section">
|
| 288 |
-
<div class="grid12 firstcol">
|
| 289 |
-
|
| 290 |
-
<h1>Language Support</h1>
|
| 291 |
-
<p>The subset of Helvetica Regular in this kit supports the following languages:<br />
|
| 292 |
-
|
| 293 |
-
Albanian, Basque, Breton, Chamorro, Danish, Dutch, English, Faroese, Finnish, French, Frisian, Galician, German, Icelandic, Italian, Malagasy, Norwegian, Portuguese, Spanish, Swedish </p>
|
| 294 |
-
<h1>Glyph Chart</h1>
|
| 295 |
-
<p>The subset of Helvetica Regular in this kit includes all the glyphs listed below. Unicode entities are included above each glyph to help you insert individual characters into your layout.</p>
|
| 296 |
-
<div id="glyph_chart">
|
| 297 |
-
|
| 298 |
-
<div><p>&#32;</p> </div>
|
| 299 |
-
<div><p>&#33;</p>!</div>
|
| 300 |
-
<div><p>&#34;</p>"</div>
|
| 301 |
-
<div><p>&#35;</p>#</div>
|
| 302 |
-
<div><p>&#36;</p>$</div>
|
| 303 |
-
<div><p>&#37;</p>%</div>
|
| 304 |
-
<div><p>&#38;</p>&</div>
|
| 305 |
-
<div><p>&#39;</p>'</div>
|
| 306 |
-
<div><p>&#40;</p>(</div>
|
| 307 |
-
<div><p>&#41;</p>)</div>
|
| 308 |
-
<div><p>&#42;</p>*</div>
|
| 309 |
-
<div><p>&#43;</p>+</div>
|
| 310 |
-
<div><p>&#44;</p>,</div>
|
| 311 |
-
<div><p>&#45;</p>-</div>
|
| 312 |
-
<div><p>&#46;</p>.</div>
|
| 313 |
-
<div><p>&#47;</p>/</div>
|
| 314 |
-
<div><p>&#48;</p>0</div>
|
| 315 |
-
<div><p>&#49;</p>1</div>
|
| 316 |
-
<div><p>&#50;</p>2</div>
|
| 317 |
-
<div><p>&#51;</p>3</div>
|
| 318 |
-
<div><p>&#52;</p>4</div>
|
| 319 |
-
<div><p>&#53;</p>5</div>
|
| 320 |
-
<div><p>&#54;</p>6</div>
|
| 321 |
-
<div><p>&#55;</p>7</div>
|
| 322 |
-
<div><p>&#56;</p>8</div>
|
| 323 |
-
<div><p>&#57;</p>9</div>
|
| 324 |
-
<div><p>&#58;</p>:</div>
|
| 325 |
-
<div><p>&#59;</p>;</div>
|
| 326 |
-
<div><p>&#60;</p><</div>
|
| 327 |
-
<div><p>&#61;</p>=</div>
|
| 328 |
-
<div><p>&#62;</p>></div>
|
| 329 |
-
<div><p>&#63;</p>?</div>
|
| 330 |
-
<div><p>&#64;</p>@</div>
|
| 331 |
-
<div><p>&#65;</p>A</div>
|
| 332 |
-
<div><p>&#66;</p>B</div>
|
| 333 |
-
<div><p>&#67;</p>C</div>
|
| 334 |
-
<div><p>&#68;</p>D</div>
|
| 335 |
-
<div><p>&#69;</p>E</div>
|
| 336 |
-
<div><p>&#70;</p>F</div>
|
| 337 |
-
<div><p>&#71;</p>G</div>
|
| 338 |
-
<div><p>&#72;</p>H</div>
|
| 339 |
-
<div><p>&#73;</p>I</div>
|
| 340 |
-
<div><p>&#74;</p>J</div>
|
| 341 |
-
<div><p>&#75;</p>K</div>
|
| 342 |
-
<div><p>&#76;</p>L</div>
|
| 343 |
-
<div><p>&#77;</p>M</div>
|
| 344 |
-
<div><p>&#78;</p>N</div>
|
| 345 |
-
<div><p>&#79;</p>O</div>
|
| 346 |
-
<div><p>&#80;</p>P</div>
|
| 347 |
-
<div><p>&#81;</p>Q</div>
|
| 348 |
-
<div><p>&#82;</p>R</div>
|
| 349 |
-
<div><p>&#83;</p>S</div>
|
| 350 |
-
<div><p>&#84;</p>T</div>
|
| 351 |
-
<div><p>&#85;</p>U</div>
|
| 352 |
-
<div><p>&#86;</p>V</div>
|
| 353 |
-
<div><p>&#87;</p>W</div>
|
| 354 |
-
<div><p>&#88;</p>X</div>
|
| 355 |
-
<div><p>&#89;</p>Y</div>
|
| 356 |
-
<div><p>&#90;</p>Z</div>
|
| 357 |
-
<div><p>&#91;</p>[</div>
|
| 358 |
-
<div><p>&#92;</p>\</div>
|
| 359 |
-
<div><p>&#93;</p>]</div>
|
| 360 |
-
<div><p>&#94;</p>^</div>
|
| 361 |
-
<div><p>&#95;</p>_</div>
|
| 362 |
-
<div><p>&#96;</p>`</div>
|
| 363 |
-
<div><p>&#97;</p>a</div>
|
| 364 |
-
<div><p>&#98;</p>b</div>
|
| 365 |
-
<div><p>&#99;</p>c</div>
|
| 366 |
-
<div><p>&#100;</p>d</div>
|
| 367 |
-
<div><p>&#101;</p>e</div>
|
| 368 |
-
<div><p>&#102;</p>f</div>
|
| 369 |
-
<div><p>&#103;</p>g</div>
|
| 370 |
-
<div><p>&#104;</p>h</div>
|
| 371 |
-
<div><p>&#105;</p>i</div>
|
| 372 |
-
<div><p>&#106;</p>j</div>
|
| 373 |
-
<div><p>&#107;</p>k</div>
|
| 374 |
-
<div><p>&#108;</p>l</div>
|
| 375 |
-
<div><p>&#109;</p>m</div>
|
| 376 |
-
<div><p>&#110;</p>n</div>
|
| 377 |
-
<div><p>&#111;</p>o</div>
|
| 378 |
-
<div><p>&#112;</p>p</div>
|
| 379 |
-
<div><p>&#113;</p>q</div>
|
| 380 |
-
<div><p>&#114;</p>r</div>
|
| 381 |
-
<div><p>&#115;</p>s</div>
|
| 382 |
-
<div><p>&#116;</p>t</div>
|
| 383 |
-
<div><p>&#117;</p>u</div>
|
| 384 |
-
<div><p>&#118;</p>v</div>
|
| 385 |
-
<div><p>&#119;</p>w</div>
|
| 386 |
-
<div><p>&#120;</p>x</div>
|
| 387 |
-
<div><p>&#121;</p>y</div>
|
| 388 |
-
<div><p>&#122;</p>z</div>
|
| 389 |
-
<div><p>&#123;</p>{</div>
|
| 390 |
-
<div><p>&#124;</p>|</div>
|
| 391 |
-
<div><p>&#125;</p>}</div>
|
| 392 |
-
<div><p>&#126;</p>~</div>
|
| 393 |
-
<div><p>&#160;</p> </div>
|
| 394 |
-
<div><p>&#161;</p>¡</div>
|
| 395 |
-
<div><p>&#162;</p>¢</div>
|
| 396 |
-
<div><p>&#163;</p>£</div>
|
| 397 |
-
<div><p>&#164;</p>¤</div>
|
| 398 |
-
<div><p>&#165;</p>¥</div>
|
| 399 |
-
<div><p>&#166;</p>¦</div>
|
| 400 |
-
<div><p>&#167;</p>§</div>
|
| 401 |
-
<div><p>&#168;</p>¨</div>
|
| 402 |
-
<div><p>&#169;</p>©</div>
|
| 403 |
-
<div><p>&#170;</p>ª</div>
|
| 404 |
-
<div><p>&#171;</p>«</div>
|
| 405 |
-
<div><p>&#172;</p>¬</div>
|
| 406 |
-
<div><p>&#173;</p>­</div>
|
| 407 |
-
<div><p>&#174;</p>®</div>
|
| 408 |
-
<div><p>&#175;</p>¯</div>
|
| 409 |
-
<div><p>&#176;</p>°</div>
|
| 410 |
-
<div><p>&#177;</p>±</div>
|
| 411 |
-
<div><p>&#178;</p>²</div>
|
| 412 |
-
<div><p>&#179;</p>³</div>
|
| 413 |
-
<div><p>&#180;</p>´</div>
|
| 414 |
-
<div><p>&#181;</p>µ</div>
|
| 415 |
-
<div><p>&#182;</p>¶</div>
|
| 416 |
-
<div><p>&#183;</p>·</div>
|
| 417 |
-
<div><p>&#184;</p>¸</div>
|
| 418 |
-
<div><p>&#185;</p>¹</div>
|
| 419 |
-
<div><p>&#186;</p>º</div>
|
| 420 |
-
<div><p>&#187;</p>»</div>
|
| 421 |
-
<div><p>&#188;</p>¼</div>
|
| 422 |
-
<div><p>&#189;</p>½</div>
|
| 423 |
-
<div><p>&#190;</p>¾</div>
|
| 424 |
-
<div><p>&#191;</p>¿</div>
|
| 425 |
-
<div><p>&#192;</p>À</div>
|
| 426 |
-
<div><p>&#193;</p>Á</div>
|
| 427 |
-
<div><p>&#194;</p>Â</div>
|
| 428 |
-
<div><p>&#195;</p>Ã</div>
|
| 429 |
-
<div><p>&#196;</p>Ä</div>
|
| 430 |
-
<div><p>&#197;</p>Å</div>
|
| 431 |
-
<div><p>&#198;</p>Æ</div>
|
| 432 |
-
<div><p>&#199;</p>Ç</div>
|
| 433 |
-
<div><p>&#200;</p>È</div>
|
| 434 |
-
<div><p>&#201;</p>É</div>
|
| 435 |
-
<div><p>&#202;</p>Ê</div>
|
| 436 |
-
<div><p>&#203;</p>Ë</div>
|
| 437 |
-
<div><p>&#204;</p>Ì</div>
|
| 438 |
-
<div><p>&#205;</p>Í</div>
|
| 439 |
-
<div><p>&#206;</p>Î</div>
|
| 440 |
-
<div><p>&#207;</p>Ï</div>
|
| 441 |
-
<div><p>&#208;</p>Ð</div>
|
| 442 |
-
<div><p>&#209;</p>Ñ</div>
|
| 443 |
-
<div><p>&#210;</p>Ò</div>
|
| 444 |
-
<div><p>&#211;</p>Ó</div>
|
| 445 |
-
<div><p>&#212;</p>Ô</div>
|
| 446 |
-
<div><p>&#213;</p>Õ</div>
|
| 447 |
-
<div><p>&#214;</p>Ö</div>
|
| 448 |
-
<div><p>&#215;</p>×</div>
|
| 449 |
-
<div><p>&#216;</p>Ø</div>
|
| 450 |
-
<div><p>&#217;</p>Ù</div>
|
| 451 |
-
<div><p>&#218;</p>Ú</div>
|
| 452 |
-
<div><p>&#219;</p>Û</div>
|
| 453 |
-
<div><p>&#220;</p>Ü</div>
|
| 454 |
-
<div><p>&#221;</p>Ý</div>
|
| 455 |
-
<div><p>&#222;</p>Þ</div>
|
| 456 |
-
<div><p>&#223;</p>ß</div>
|
| 457 |
-
<div><p>&#224;</p>à</div>
|
| 458 |
-
<div><p>&#225;</p>á</div>
|
| 459 |
-
<div><p>&#226;</p>â</div>
|
| 460 |
-
<div><p>&#227;</p>ã</div>
|
| 461 |
-
<div><p>&#228;</p>ä</div>
|
| 462 |
-
<div><p>&#229;</p>å</div>
|
| 463 |
-
<div><p>&#230;</p>æ</div>
|
| 464 |
-
<div><p>&#231;</p>ç</div>
|
| 465 |
-
<div><p>&#232;</p>è</div>
|
| 466 |
-
<div><p>&#233;</p>é</div>
|
| 467 |
-
<div><p>&#234;</p>ê</div>
|
| 468 |
-
<div><p>&#235;</p>ë</div>
|
| 469 |
-
<div><p>&#236;</p>ì</div>
|
| 470 |
-
<div><p>&#237;</p>í</div>
|
| 471 |
-
<div><p>&#238;</p>î</div>
|
| 472 |
-
<div><p>&#239;</p>ï</div>
|
| 473 |
-
<div><p>&#240;</p>ð</div>
|
| 474 |
-
<div><p>&#241;</p>ñ</div>
|
| 475 |
-
<div><p>&#242;</p>ò</div>
|
| 476 |
-
<div><p>&#243;</p>ó</div>
|
| 477 |
-
<div><p>&#244;</p>ô</div>
|
| 478 |
-
<div><p>&#245;</p>õ</div>
|
| 479 |
-
<div><p>&#246;</p>ö</div>
|
| 480 |
-
<div><p>&#247;</p>÷</div>
|
| 481 |
-
<div><p>&#248;</p>ø</div>
|
| 482 |
-
<div><p>&#249;</p>ù</div>
|
| 483 |
-
<div><p>&#250;</p>ú</div>
|
| 484 |
-
<div><p>&#251;</p>û</div>
|
| 485 |
-
<div><p>&#252;</p>ü</div>
|
| 486 |
-
<div><p>&#253;</p>ý</div>
|
| 487 |
-
<div><p>&#254;</p>þ</div>
|
| 488 |
-
<div><p>&#255;</p>ÿ</div>
|
| 489 |
-
<div><p>&#338;</p>Œ</div>
|
| 490 |
-
<div><p>&#339;</p>œ</div>
|
| 491 |
-
<div><p>&#376;</p>Ÿ</div>
|
| 492 |
-
<div><p>&#710;</p>ˆ</div>
|
| 493 |
-
<div><p>&#732;</p>˜</div>
|
| 494 |
-
<div><p>&#8192;</p> </div>
|
| 495 |
-
<div><p>&#8193;</p> </div>
|
| 496 |
-
<div><p>&#8194;</p> </div>
|
| 497 |
-
<div><p>&#8195;</p> </div>
|
| 498 |
-
<div><p>&#8196;</p> </div>
|
| 499 |
-
<div><p>&#8197;</p> </div>
|
| 500 |
-
<div><p>&#8198;</p> </div>
|
| 501 |
-
<div><p>&#8199;</p> </div>
|
| 502 |
-
<div><p>&#8200;</p> </div>
|
| 503 |
-
<div><p>&#8201;</p> </div>
|
| 504 |
-
<div><p>&#8202;</p> </div>
|
| 505 |
-
<div><p>&#8208;</p>‐</div>
|
| 506 |
-
<div><p>&#8209;</p>‑</div>
|
| 507 |
-
<div><p>&#8210;</p>‒</div>
|
| 508 |
-
<div><p>&#8211;</p>–</div>
|
| 509 |
-
<div><p>&#8212;</p>—</div>
|
| 510 |
-
<div><p>&#8216;</p>‘</div>
|
| 511 |
-
<div><p>&#8217;</p>’</div>
|
| 512 |
-
<div><p>&#8218;</p>‚</div>
|
| 513 |
-
<div><p>&#8220;</p>“</div>
|
| 514 |
-
<div><p>&#8221;</p>”</div>
|
| 515 |
-
<div><p>&#8222;</p>„</div>
|
| 516 |
-
<div><p>&#8226;</p>•</div>
|
| 517 |
-
<div><p>&#8230;</p>…</div>
|
| 518 |
-
<div><p>&#8239;</p> </div>
|
| 519 |
-
<div><p>&#8249;</p>‹</div>
|
| 520 |
-
<div><p>&#8250;</p>›</div>
|
| 521 |
-
<div><p>&#8287;</p> </div>
|
| 522 |
-
<div><p>&#8482;</p>™</div>
|
| 523 |
-
<div><p>&#9724;</p>◼</div>
|
| 524 |
-
<div><p>&#64257;</p>fi</div>
|
| 525 |
-
<div><p>&#64258;</p>fl</div>
|
| 526 |
-
</div>
|
| 527 |
-
</div>
|
| 528 |
-
|
| 529 |
-
|
| 530 |
-
</div>
|
| 531 |
-
</div>
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
<div id="specs">
|
| 535 |
-
|
| 536 |
-
</div>
|
| 537 |
-
|
| 538 |
-
<div id="installing">
|
| 539 |
-
<div class="section">
|
| 540 |
-
<div class="grid7 firstcol">
|
| 541 |
-
<h1>Installing Webfonts</h1>
|
| 542 |
-
|
| 543 |
-
<p>Webfonts are supported by all major browser platforms but not all in the same way. There are currently four different font formats that must be included in order to target all browsers. This includes TTF, WOFF, EOT and SVG.</p>
|
| 544 |
-
|
| 545 |
-
<h2>1. Upload your webfonts</h2>
|
| 546 |
-
<p>You must upload your webfont kit to your website. They should be in or near the same directory as your CSS files.</p>
|
| 547 |
-
|
| 548 |
-
<h2>2. Include the webfont stylesheet</h2>
|
| 549 |
-
<p>A special CSS @font-face declaration helps the various browsers select the appropriate font it needs without causing you a bunch of headaches. Learn more about this syntax by reading the <a href="http://www.fontspring.com/blog/further-hardening-of-the-bulletproof-syntax">Fontspring blog post</a> about it. The code for it is as follows:</p>
|
| 550 |
-
|
| 551 |
-
|
| 552 |
-
<code>
|
| 553 |
-
@font-face{
|
| 554 |
-
font-family: 'MyWebFont';
|
| 555 |
-
src: url('WebFont.eot');
|
| 556 |
-
src: url('WebFont.eot?#iefix') format('embedded-opentype'),
|
| 557 |
-
url('WebFont.woff') format('woff'),
|
| 558 |
-
url('WebFont.ttf') format('truetype'),
|
| 559 |
-
url('WebFont.svg#webfont') format('svg');
|
| 560 |
-
}
|
| 561 |
-
</code>
|
| 562 |
-
|
| 563 |
-
<p>We've already gone ahead and generated the code for you. All you have to do is link to the stylesheet in your HTML, like this:</p>
|
| 564 |
-
<code><link rel="stylesheet" href="stylesheet.css" type="text/css" charset="utf-8" /></code>
|
| 565 |
-
|
| 566 |
-
<h2>3. Modify your own stylesheet</h2>
|
| 567 |
-
<p>To take advantage of your new fonts, you must tell your stylesheet to use them. Look at the original @font-face declaration above and find the property called "font-family." The name linked there will be what you use to reference the font. Prepend that webfont name to the font stack in the "font-family" property, inside the selector you want to change. For example:</p>
|
| 568 |
-
<code>p { font-family: 'WebFont', Arial, sans-serif; }</code>
|
| 569 |
-
|
| 570 |
-
<h2>4. Test</h2>
|
| 571 |
-
<p>Getting webfonts to work cross-browser <em>can</em> be tricky. Use the information in the sidebar to help you if you find that fonts aren't loading in a particular browser.</p>
|
| 572 |
-
</div>
|
| 573 |
-
|
| 574 |
-
<div class="grid5 sidebar">
|
| 575 |
-
<div class="box">
|
| 576 |
-
<h2>Troubleshooting<br />Font-Face Problems</h2>
|
| 577 |
-
<p>Having trouble getting your webfonts to load in your new website? Here are some tips to sort out what might be the problem.</p>
|
| 578 |
-
|
| 579 |
-
<h3>Fonts not showing in any browser</h3>
|
| 580 |
-
|
| 581 |
-
<p>This sounds like you need to work on the plumbing. You either did not upload the fonts to the correct directory, or you did not link the fonts properly in the CSS. If you've confirmed that all this is correct and you still have a problem, take a look at your .htaccess file and see if requests are getting intercepted.</p>
|
| 582 |
-
|
| 583 |
-
<h3>Fonts not loading in iPhone or iPad</h3>
|
| 584 |
-
|
| 585 |
-
<p>The most common problem here is that you are serving the fonts from an IIS server. IIS refuses to serve files that have unknown MIME types. If that is the case, you must set the MIME type for SVG to "image/svg+xml" in the server settings. Follow these instructions from Microsoft if you need help.</p>
|
| 586 |
-
|
| 587 |
-
<h3>Fonts not loading in Firefox</h3>
|
| 588 |
-
|
| 589 |
-
<p>The primary reason for this failure? You are still using a version Firefox older than 3.5. So upgrade already! If that isn't it, then you are very likely serving fonts from a different domain. Firefox requires that all font assets be served from the same domain. Lastly it is possible that you need to add WOFF to your list of MIME types (if you are serving via IIS.)</p>
|
| 590 |
-
|
| 591 |
-
<h3>Fonts not loading in IE</h3>
|
| 592 |
-
|
| 593 |
-
<p>Are you looking at Internet Explorer on an actual Windows machine or are you cheating by using a service like Adobe BrowserLab? Many of these screenshot services do not render @font-face for IE. Best to test it on a real machine.</p>
|
| 594 |
-
|
| 595 |
-
<h3>Fonts not loading in IE9</h3>
|
| 596 |
-
|
| 597 |
-
<p>IE9, like Firefox, requires that fonts be served from the same domain as the website. Make sure that is the case.</p>
|
| 598 |
-
</div>
|
| 599 |
-
</div>
|
| 600 |
-
</div>
|
| 601 |
-
|
| 602 |
-
</div>
|
| 603 |
-
|
| 604 |
-
</div>
|
| 605 |
-
<div id="footer">
|
| 606 |
-
<p>©2010-2011 Font Squirrel. All rights reserved.</p>
|
| 607 |
-
</div>
|
| 608 |
-
</div>
|
| 609 |
-
</body>
|
| 610 |
-
</html>
|
| 1 |
+
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
| 2 |
+
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
| 3 |
+
|
| 4 |
+
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
|
| 5 |
+
<head>
|
| 6 |
+
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
|
| 7 |
+
<script src="http://ajax.googleapis.com/ajax/libs/jquery/1.7.2/jquery.min.js" type="text/javascript" charset="utf-8"></script>
|
| 8 |
+
<script src="specimen_files/easytabs.js" type="text/javascript" charset="utf-8"></script>
|
| 9 |
+
<link rel="stylesheet" href="specimen_files/specimen_stylesheet.css" type="text/css" charset="utf-8" />
|
| 10 |
+
<link rel="stylesheet" href="stylesheet.css" type="text/css" charset="utf-8" />
|
| 11 |
+
|
| 12 |
+
<style type="text/css">
|
| 13 |
+
body{
|
| 14 |
+
font-family: 'helveticaregular';
|
| 15 |
+
}
|
| 16 |
+
</style>
|
| 17 |
+
|
| 18 |
+
<title>Helvetica Regular Specimen</title>
|
| 19 |
+
|
| 20 |
+
|
| 21 |
+
<script type="text/javascript" charset="utf-8">
|
| 22 |
+
$(document).ready(function() {
|
| 23 |
+
$('#container').easyTabs({defaultContent:1});
|
| 24 |
+
});
|
| 25 |
+
</script>
|
| 26 |
+
</head>
|
| 27 |
+
|
| 28 |
+
<body>
|
| 29 |
+
<div id="container">
|
| 30 |
+
<div id="header">
|
| 31 |
+
Helvetica Regular </div>
|
| 32 |
+
<ul class="tabs">
|
| 33 |
+
<li><a href="#specimen">Specimen</a></li>
|
| 34 |
+
<li><a href="#layout">Sample Layout</a></li>
|
| 35 |
+
<li><a href="#glyphs">Glyphs & Languages</a></li>
|
| 36 |
+
<li><a href="#installing">Installing Webfonts</a></li>
|
| 37 |
+
|
| 38 |
+
</ul>
|
| 39 |
+
|
| 40 |
+
<div id="main_content">
|
| 41 |
+
|
| 42 |
+
|
| 43 |
+
<div id="specimen">
|
| 44 |
+
|
| 45 |
+
<div class="section">
|
| 46 |
+
<div class="grid12 firstcol">
|
| 47 |
+
<div class="huge">AaBb</div>
|
| 48 |
+
</div>
|
| 49 |
+
</div>
|
| 50 |
+
|
| 51 |
+
<div class="section">
|
| 52 |
+
<div class="glyph_range">A​B​C​D​E​F​G​H​I​J​K​L​M​N​O​P​Q​R​S​T​U​V​W​X​Y​Z​a​b​c​d​e​f​g​h​i​j​k​l​m​n​o​p​q​r​s​t​u​v​w​x​y​z​1​2​3​4​5​6​7​8​9​0​&​.​,​?​!​@​(​)​#​$​%​*​+​-​=​:​;</div>
|
| 53 |
+
</div>
|
| 54 |
+
<div class="section">
|
| 55 |
+
<div class="grid12 firstcol">
|
| 56 |
+
<table class="sample_table">
|
| 57 |
+
<tr><td>10</td><td class="size10">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 58 |
+
<tr><td>11</td><td class="size11">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 59 |
+
<tr><td>12</td><td class="size12">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 60 |
+
<tr><td>13</td><td class="size13">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 61 |
+
<tr><td>14</td><td class="size14">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 62 |
+
<tr><td>16</td><td class="size16">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 63 |
+
<tr><td>18</td><td class="size18">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 64 |
+
<tr><td>20</td><td class="size20">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 65 |
+
<tr><td>24</td><td class="size24">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 66 |
+
<tr><td>30</td><td class="size30">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 67 |
+
<tr><td>36</td><td class="size36">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 68 |
+
<tr><td>48</td><td class="size48">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 69 |
+
<tr><td>60</td><td class="size60">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 70 |
+
<tr><td>72</td><td class="size72">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 71 |
+
<tr><td>90</td><td class="size90">abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ</td></tr>
|
| 72 |
+
</table>
|
| 73 |
+
|
| 74 |
+
</div>
|
| 75 |
+
|
| 76 |
+
</div>
|
| 77 |
+
|
| 78 |
+
|
| 79 |
+
|
| 80 |
+
<div class="section" id="bodycomparison">
|
| 81 |
+
|
| 82 |
+
|
| 83 |
+
<div id="xheight">
|
| 84 |
+
<div class="fontbody">◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼◼body</div><div class="arialbody">body</div><div class="verdanabody">body</div><div class="georgiabody">body</div></div>
|
| 85 |
+
<div class="fontbody" style="z-index:1">
|
| 86 |
+
body<span>Helvetica Regular</span>
|
| 87 |
+
</div>
|
| 88 |
+
<div class="arialbody" style="z-index:1">
|
| 89 |
+
body<span>Arial</span>
|
| 90 |
+
</div>
|
| 91 |
+
<div class="verdanabody" style="z-index:1">
|
| 92 |
+
body<span>Verdana</span>
|
| 93 |
+
</div>
|
| 94 |
+
<div class="georgiabody" style="z-index:1">
|
| 95 |
+
body<span>Georgia</span>
|
| 96 |
+
</div>
|
| 97 |
+
|
| 98 |
+
|
| 99 |
+
|
| 100 |
+
</div>
|
| 101 |
+
|
| 102 |
+
|
| 103 |
+
<div class="section psample psample_row1" id="">
|
| 104 |
+
|
| 105 |
+
<div class="grid2 firstcol">
|
| 106 |
+
<p class="size10"><span>10.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 107 |
+
|
| 108 |
+
</div>
|
| 109 |
+
<div class="grid3">
|
| 110 |
+
<p class="size11"><span>11.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 111 |
+
|
| 112 |
+
</div>
|
| 113 |
+
<div class="grid3">
|
| 114 |
+
<p class="size12"><span>12.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 115 |
+
|
| 116 |
+
</div>
|
| 117 |
+
<div class="grid4">
|
| 118 |
+
<p class="size13"><span>13.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 119 |
+
|
| 120 |
+
</div>
|
| 121 |
+
<div class="white_blend"></div>
|
| 122 |
+
|
| 123 |
+
</div>
|
| 124 |
+
<div class="section psample psample_row2" id="">
|
| 125 |
+
<div class="grid3 firstcol">
|
| 126 |
+
<p class="size14"><span>14.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 127 |
+
|
| 128 |
+
</div>
|
| 129 |
+
<div class="grid4">
|
| 130 |
+
<p class="size16"><span>16.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 131 |
+
|
| 132 |
+
</div>
|
| 133 |
+
<div class="grid5">
|
| 134 |
+
<p class="size18"><span>18.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 135 |
+
|
| 136 |
+
</div>
|
| 137 |
+
|
| 138 |
+
<div class="white_blend"></div>
|
| 139 |
+
|
| 140 |
+
</div>
|
| 141 |
+
|
| 142 |
+
<div class="section psample psample_row3" id="">
|
| 143 |
+
<div class="grid5 firstcol">
|
| 144 |
+
<p class="size20"><span>20.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 145 |
+
</div>
|
| 146 |
+
<div class="grid7">
|
| 147 |
+
<p class="size24"><span>24.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 148 |
+
</div>
|
| 149 |
+
|
| 150 |
+
<div class="white_blend"></div>
|
| 151 |
+
|
| 152 |
+
</div>
|
| 153 |
+
|
| 154 |
+
<div class="section psample psample_row4" id="">
|
| 155 |
+
<div class="grid12 firstcol">
|
| 156 |
+
<p class="size30"><span>30.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 157 |
+
</div>
|
| 158 |
+
<div class="white_blend"></div>
|
| 159 |
+
|
| 160 |
+
</div>
|
| 161 |
+
|
| 162 |
+
|
| 163 |
+
|
| 164 |
+
<div class="section psample psample_row1 fullreverse">
|
| 165 |
+
<div class="grid2 firstcol">
|
| 166 |
+
<p class="size10"><span>10.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 167 |
+
|
| 168 |
+
</div>
|
| 169 |
+
<div class="grid3">
|
| 170 |
+
<p class="size11"><span>11.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 171 |
+
|
| 172 |
+
</div>
|
| 173 |
+
<div class="grid3">
|
| 174 |
+
<p class="size12"><span>12.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 175 |
+
|
| 176 |
+
</div>
|
| 177 |
+
<div class="grid4">
|
| 178 |
+
<p class="size13"><span>13.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 179 |
+
|
| 180 |
+
</div>
|
| 181 |
+
<div class="black_blend"></div>
|
| 182 |
+
|
| 183 |
+
</div>
|
| 184 |
+
|
| 185 |
+
<div class="section psample psample_row2 fullreverse">
|
| 186 |
+
<div class="grid3 firstcol">
|
| 187 |
+
<p class="size14"><span>14.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 188 |
+
|
| 189 |
+
</div>
|
| 190 |
+
<div class="grid4">
|
| 191 |
+
<p class="size16"><span>16.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 192 |
+
|
| 193 |
+
</div>
|
| 194 |
+
<div class="grid5">
|
| 195 |
+
<p class="size18"><span>18.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 196 |
+
|
| 197 |
+
</div>
|
| 198 |
+
<div class="black_blend"></div>
|
| 199 |
+
|
| 200 |
+
</div>
|
| 201 |
+
|
| 202 |
+
<div class="section psample fullreverse psample_row3" id="">
|
| 203 |
+
<div class="grid5 firstcol">
|
| 204 |
+
<p class="size20"><span>20.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 205 |
+
</div>
|
| 206 |
+
<div class="grid7">
|
| 207 |
+
<p class="size24"><span>24.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 208 |
+
</div>
|
| 209 |
+
|
| 210 |
+
<div class="black_blend"></div>
|
| 211 |
+
|
| 212 |
+
</div>
|
| 213 |
+
|
| 214 |
+
<div class="section psample fullreverse psample_row4" id="" style="border-bottom: 20px #000 solid;">
|
| 215 |
+
<div class="grid12 firstcol">
|
| 216 |
+
<p class="size30"><span>30.</span>Aenean lacinia bibendum nulla sed consectetur. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Nullam id dolor id nibh ultricies vehicula ut id elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. Nulla vitae elit libero, a pharetra augue.</p>
|
| 217 |
+
</div>
|
| 218 |
+
<div class="black_blend"></div>
|
| 219 |
+
|
| 220 |
+
</div>
|
| 221 |
+
|
| 222 |
+
|
| 223 |
+
|
| 224 |
+
|
| 225 |
+
</div>
|
| 226 |
+
|
| 227 |
+
<div id="layout">
|
| 228 |
+
|
| 229 |
+
<div class="section">
|
| 230 |
+
|
| 231 |
+
<div class="grid12 firstcol">
|
| 232 |
+
<h1>Lorem Ipsum Dolor</h1>
|
| 233 |
+
<h2>Etiam porta sem malesuada magna mollis euismod</h2>
|
| 234 |
+
|
| 235 |
+
<p class="byline">By <a href="#link">Aenean Lacinia</a></p>
|
| 236 |
+
</div>
|
| 237 |
+
</div>
|
| 238 |
+
<div class="section">
|
| 239 |
+
<div class="grid8 firstcol">
|
| 240 |
+
<p class="large">Donec sed odio dui. Morbi leo risus, porta ac consectetur ac, vestibulum at eros. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 241 |
+
|
| 242 |
+
|
| 243 |
+
<h3>Pellentesque ornare sem</h3>
|
| 244 |
+
|
| 245 |
+
<p>Maecenas sed diam eget risus varius blandit sit amet non magna. Maecenas faucibus mollis interdum. Donec ullamcorper nulla non metus auctor fringilla. Nullam id dolor id nibh ultricies vehicula ut id elit. Nullam id dolor id nibh ultricies vehicula ut id elit. </p>
|
| 246 |
+
|
| 247 |
+
<p>Aenean eu leo quam. Pellentesque ornare sem lacinia quam venenatis vestibulum. Lorem ipsum dolor sit amet, consectetur adipiscing elit. Cum sociis natoque penatibus et magnis dis parturient montes, nascetur ridiculus mus. </p>
|
| 248 |
+
|
| 249 |
+
<p>Nulla vitae elit libero, a pharetra augue. Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Aenean lacinia bibendum nulla sed consectetur. </p>
|
| 250 |
+
|
| 251 |
+
<p>Nullam quis risus eget urna mollis ornare vel eu leo. Nullam quis risus eget urna mollis ornare vel eu leo. Maecenas sed diam eget risus varius blandit sit amet non magna. Donec ullamcorper nulla non metus auctor fringilla. </p>
|
| 252 |
+
|
| 253 |
+
<h3>Cras mattis consectetur</h3>
|
| 254 |
+
|
| 255 |
+
<p>Aenean eu leo quam. Pellentesque ornare sem lacinia quam venenatis vestibulum. Aenean lacinia bibendum nulla sed consectetur. Integer posuere erat a ante venenatis dapibus posuere velit aliquet. Cras mattis consectetur purus sit amet fermentum. </p>
|
| 256 |
+
|
| 257 |
+
<p>Nullam id dolor id nibh ultricies vehicula ut id elit. Nullam quis risus eget urna mollis ornare vel eu leo. Cras mattis consectetur purus sit amet fermentum.</p>
|
| 258 |
+
</div>
|
| 259 |
+
|
| 260 |
+
<div class="grid4 sidebar">
|
| 261 |
+
|
| 262 |
+
<div class="box reverse">
|
| 263 |
+
<p class="last">Nullam quis risus eget urna mollis ornare vel eu leo. Donec ullamcorper nulla non metus auctor fringilla. Cras mattis consectetur purus sit amet fermentum. Sed posuere consectetur est at lobortis. Lorem ipsum dolor sit amet, consectetur adipiscing elit. </p>
|
| 264 |
+
</div>
|
| 265 |
+
|
| 266 |
+
<p class="caption">Maecenas sed diam eget risus varius.</p>
|
| 267 |
+
|
| 268 |
+
<p>Vestibulum id ligula porta felis euismod semper. Integer posuere erat a ante venenatis dapibus posuere velit aliquet. Vestibulum id ligula porta felis euismod semper. Sed posuere consectetur est at lobortis. Maecenas sed diam eget risus varius blandit sit amet non magna. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 269 |
+
|
| 270 |
+
|
| 271 |
+
|
| 272 |
+
<p>Duis mollis, est non commodo luctus, nisi erat porttitor ligula, eget lacinia odio sem nec elit. Aenean lacinia bibendum nulla sed consectetur. Vivamus sagittis lacus vel augue laoreet rutrum faucibus dolor auctor. Aenean lacinia bibendum nulla sed consectetur. Nullam quis risus eget urna mollis ornare vel eu leo. </p>
|
| 273 |
+
|
| 274 |
+
<p>Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Donec ullamcorper nulla non metus auctor fringilla. Maecenas faucibus mollis interdum. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. </p>
|
| 275 |
+
|
| 276 |
+
</div>
|
| 277 |
+
</div>
|
| 278 |
+
|
| 279 |
+
</div>
|
| 280 |
+
|
| 281 |
+
|
| 282 |
+
|
| 283 |
+
|
| 284 |
+
|
| 285 |
+
|
| 286 |
+
<div id="glyphs">
|
| 287 |
+
<div class="section">
|
| 288 |
+
<div class="grid12 firstcol">
|
| 289 |
+
|
| 290 |
+
<h1>Language Support</h1>
|
| 291 |
+
<p>The subset of Helvetica Regular in this kit supports the following languages:<br />
|
| 292 |
+
|
| 293 |
+
Albanian, Basque, Breton, Chamorro, Danish, Dutch, English, Faroese, Finnish, French, Frisian, Galician, German, Icelandic, Italian, Malagasy, Norwegian, Portuguese, Spanish, Swedish </p>
|
| 294 |
+
<h1>Glyph Chart</h1>
|
| 295 |
+
<p>The subset of Helvetica Regular in this kit includes all the glyphs listed below. Unicode entities are included above each glyph to help you insert individual characters into your layout.</p>
|
| 296 |
+
<div id="glyph_chart">
|
| 297 |
+
|
| 298 |
+
<div><p>&#32;</p> </div>
|
| 299 |
+
<div><p>&#33;</p>!</div>
|
| 300 |
+
<div><p>&#34;</p>"</div>
|
| 301 |
+
<div><p>&#35;</p>#</div>
|
| 302 |
+
<div><p>&#36;</p>$</div>
|
| 303 |
+
<div><p>&#37;</p>%</div>
|
| 304 |
+
<div><p>&#38;</p>&</div>
|
| 305 |
+
<div><p>&#39;</p>'</div>
|
| 306 |
+
<div><p>&#40;</p>(</div>
|
| 307 |
+
<div><p>&#41;</p>)</div>
|
| 308 |
+
<div><p>&#42;</p>*</div>
|
| 309 |
+
<div><p>&#43;</p>+</div>
|
| 310 |
+
<div><p>&#44;</p>,</div>
|
| 311 |
+
<div><p>&#45;</p>-</div>
|
| 312 |
+
<div><p>&#46;</p>.</div>
|
| 313 |
+
<div><p>&#47;</p>/</div>
|
| 314 |
+
<div><p>&#48;</p>0</div>
|
| 315 |
+
<div><p>&#49;</p>1</div>
|
| 316 |
+
<div><p>&#50;</p>2</div>
|
| 317 |
+
<div><p>&#51;</p>3</div>
|
| 318 |
+
<div><p>&#52;</p>4</div>
|
| 319 |
+
<div><p>&#53;</p>5</div>
|
| 320 |
+
<div><p>&#54;</p>6</div>
|
| 321 |
+
<div><p>&#55;</p>7</div>
|
| 322 |
+
<div><p>&#56;</p>8</div>
|
| 323 |
+
<div><p>&#57;</p>9</div>
|
| 324 |
+
<div><p>&#58;</p>:</div>
|
| 325 |
+
<div><p>&#59;</p>;</div>
|
| 326 |
+
<div><p>&#60;</p><</div>
|
| 327 |
+
<div><p>&#61;</p>=</div>
|
| 328 |
+
<div><p>&#62;</p>></div>
|
| 329 |
+
<div><p>&#63;</p>?</div>
|
| 330 |
+
<div><p>&#64;</p>@</div>
|
| 331 |
+
<div><p>&#65;</p>A</div>
|
| 332 |
+
<div><p>&#66;</p>B</div>
|
| 333 |
+
<div><p>&#67;</p>C</div>
|
| 334 |
+
<div><p>&#68;</p>D</div>
|
| 335 |
+
<div><p>&#69;</p>E</div>
|
| 336 |
+
<div><p>&#70;</p>F</div>
|
| 337 |
+
<div><p>&#71;</p>G</div>
|
| 338 |
+
<div><p>&#72;</p>H</div>
|
| 339 |
+
<div><p>&#73;</p>I</div>
|
| 340 |
+
<div><p>&#74;</p>J</div>
|
| 341 |
+
<div><p>&#75;</p>K</div>
|
| 342 |
+
<div><p>&#76;</p>L</div>
|
| 343 |
+
<div><p>&#77;</p>M</div>
|
| 344 |
+
<div><p>&#78;</p>N</div>
|
| 345 |
+
<div><p>&#79;</p>O</div>
|
| 346 |
+
<div><p>&#80;</p>P</div>
|
| 347 |
+
<div><p>&#81;</p>Q</div>
|
| 348 |
+
<div><p>&#82;</p>R</div>
|
| 349 |
+
<div><p>&#83;</p>S</div>
|
| 350 |
+
<div><p>&#84;</p>T</div>
|
| 351 |
+
<div><p>&#85;</p>U</div>
|
| 352 |
+
<div><p>&#86;</p>V</div>
|
| 353 |
+
<div><p>&#87;</p>W</div>
|
| 354 |
+
<div><p>&#88;</p>X</div>
|
| 355 |
+
<div><p>&#89;</p>Y</div>
|
| 356 |
+
<div><p>&#90;</p>Z</div>
|
| 357 |
+
<div><p>&#91;</p>[</div>
|
| 358 |
+
<div><p>&#92;</p>\</div>
|
| 359 |
+
<div><p>&#93;</p>]</div>
|
| 360 |
+
<div><p>&#94;</p>^</div>
|
| 361 |
+
<div><p>&#95;</p>_</div>
|
| 362 |
+
<div><p>&#96;</p>`</div>
|
| 363 |
+
<div><p>&#97;</p>a</div>
|
| 364 |
+
<div><p>&#98;</p>b</div>
|
| 365 |
+
<div><p>&#99;</p>c</div>
|
| 366 |
+
<div><p>&#100;</p>d</div>
|
| 367 |
+
<div><p>&#101;</p>e</div>
|
| 368 |
+
<div><p>&#102;</p>f</div>
|
| 369 |
+
<div><p>&#103;</p>g</div>
|
| 370 |
+
<div><p>&#104;</p>h</div>
|
| 371 |
+
<div><p>&#105;</p>i</div>
|
| 372 |
+
<div><p>&#106;</p>j</div>
|
| 373 |
+
<div><p>&#107;</p>k</div>
|
| 374 |
+
<div><p>&#108;</p>l</div>
|
| 375 |
+
<div><p>&#109;</p>m</div>
|
| 376 |
+
<div><p>&#110;</p>n</div>
|
| 377 |
+
<div><p>&#111;</p>o</div>
|
| 378 |
+
<div><p>&#112;</p>p</div>
|
| 379 |
+
<div><p>&#113;</p>q</div>
|
| 380 |
+
<div><p>&#114;</p>r</div>
|
| 381 |
+
<div><p>&#115;</p>s</div>
|
| 382 |
+
<div><p>&#116;</p>t</div>
|
| 383 |
+
<div><p>&#117;</p>u</div>
|
| 384 |
+
<div><p>&#118;</p>v</div>
|
| 385 |
+
<div><p>&#119;</p>w</div>
|
| 386 |
+
<div><p>&#120;</p>x</div>
|
| 387 |
+
<div><p>&#121;</p>y</div>
|
| 388 |
+
<div><p>&#122;</p>z</div>
|
| 389 |
+
<div><p>&#123;</p>{</div>
|
| 390 |
+
<div><p>&#124;</p>|</div>
|
| 391 |
+
<div><p>&#125;</p>}</div>
|
| 392 |
+
<div><p>&#126;</p>~</div>
|
| 393 |
+
<div><p>&#160;</p> </div>
|
| 394 |
+
<div><p>&#161;</p>¡</div>
|
| 395 |
+
<div><p>&#162;</p>¢</div>
|
| 396 |
+
<div><p>&#163;</p>£</div>
|
| 397 |
+
<div><p>&#164;</p>¤</div>
|
| 398 |
+
<div><p>&#165;</p>¥</div>
|
| 399 |
+
<div><p>&#166;</p>¦</div>
|
| 400 |
+
<div><p>&#167;</p>§</div>
|
| 401 |
+
<div><p>&#168;</p>¨</div>
|
| 402 |
+
<div><p>&#169;</p>©</div>
|
| 403 |
+
<div><p>&#170;</p>ª</div>
|
| 404 |
+
<div><p>&#171;</p>«</div>
|
| 405 |
+
<div><p>&#172;</p>¬</div>
|
| 406 |
+
<div><p>&#173;</p>­</div>
|
| 407 |
+
<div><p>&#174;</p>®</div>
|
| 408 |
+
<div><p>&#175;</p>¯</div>
|
| 409 |
+
<div><p>&#176;</p>°</div>
|
| 410 |
+
<div><p>&#177;</p>±</div>
|
| 411 |
+
<div><p>&#178;</p>²</div>
|
| 412 |
+
<div><p>&#179;</p>³</div>
|
| 413 |
+
<div><p>&#180;</p>´</div>
|
| 414 |
+
<div><p>&#181;</p>µ</div>
|
| 415 |
+
<div><p>&#182;</p>¶</div>
|
| 416 |
+
<div><p>&#183;</p>·</div>
|
| 417 |
+
<div><p>&#184;</p>¸</div>
|
| 418 |
+
<div><p>&#185;</p>¹</div>
|
| 419 |
+
<div><p>&#186;</p>º</div>
|
| 420 |
+
<div><p>&#187;</p>»</div>
|
| 421 |
+
<div><p>&#188;</p>¼</div>
|
| 422 |
+
<div><p>&#189;</p>½</div>
|
| 423 |
+
<div><p>&#190;</p>¾</div>
|
| 424 |
+
<div><p>&#191;</p>¿</div>
|
| 425 |
+
<div><p>&#192;</p>À</div>
|
| 426 |
+
<div><p>&#193;</p>Á</div>
|
| 427 |
+
<div><p>&#194;</p>Â</div>
|
| 428 |
+
<div><p>&#195;</p>Ã</div>
|
| 429 |
+
<div><p>&#196;</p>Ä</div>
|
| 430 |
+
<div><p>&#197;</p>Å</div>
|
| 431 |
+
<div><p>&#198;</p>Æ</div>
|
| 432 |
+
<div><p>&#199;</p>Ç</div>
|
| 433 |
+
<div><p>&#200;</p>È</div>
|
| 434 |
+
<div><p>&#201;</p>É</div>
|
| 435 |
+
<div><p>&#202;</p>Ê</div>
|
| 436 |
+
<div><p>&#203;</p>Ë</div>
|
| 437 |
+
<div><p>&#204;</p>Ì</div>
|
| 438 |
+
<div><p>&#205;</p>Í</div>
|
| 439 |
+
<div><p>&#206;</p>Î</div>
|
| 440 |
+
<div><p>&#207;</p>Ï</div>
|
| 441 |
+
<div><p>&#208;</p>Ð</div>
|
| 442 |
+
<div><p>&#209;</p>Ñ</div>
|
| 443 |
+
<div><p>&#210;</p>Ò</div>
|
| 444 |
+
<div><p>&#211;</p>Ó</div>
|
| 445 |
+
<div><p>&#212;</p>Ô</div>
|
| 446 |
+
<div><p>&#213;</p>Õ</div>
|
| 447 |
+
<div><p>&#214;</p>Ö</div>
|
| 448 |
+
<div><p>&#215;</p>×</div>
|
| 449 |
+
<div><p>&#216;</p>Ø</div>
|
| 450 |
+
<div><p>&#217;</p>Ù</div>
|
| 451 |
+
<div><p>&#218;</p>Ú</div>
|
| 452 |
+
<div><p>&#219;</p>Û</div>
|
| 453 |
+
<div><p>&#220;</p>Ü</div>
|
| 454 |
+
<div><p>&#221;</p>Ý</div>
|
| 455 |
+
<div><p>&#222;</p>Þ</div>
|
| 456 |
+
<div><p>&#223;</p>ß</div>
|
| 457 |
+
<div><p>&#224;</p>à</div>
|
| 458 |
+
<div><p>&#225;</p>á</div>
|
| 459 |
+
<div><p>&#226;</p>â</div>
|
| 460 |
+
<div><p>&#227;</p>ã</div>
|
| 461 |
+
<div><p>&#228;</p>ä</div>
|
| 462 |
+
<div><p>&#229;</p>å</div>
|
| 463 |
+
<div><p>&#230;</p>æ</div>
|
| 464 |
+
<div><p>&#231;</p>ç</div>
|
| 465 |
+
<div><p>&#232;</p>è</div>
|
| 466 |
+
<div><p>&#233;</p>é</div>
|
| 467 |
+
<div><p>&#234;</p>ê</div>
|
| 468 |
+
<div><p>&#235;</p>ë</div>
|
| 469 |
+
<div><p>&#236;</p>ì</div>
|
| 470 |
+
<div><p>&#237;</p>í</div>
|
| 471 |
+
<div><p>&#238;</p>î</div>
|
| 472 |
+
<div><p>&#239;</p>ï</div>
|
| 473 |
+
<div><p>&#240;</p>ð</div>
|
| 474 |
+
<div><p>&#241;</p>ñ</div>
|
| 475 |
+
<div><p>&#242;</p>ò</div>
|
| 476 |
+
<div><p>&#243;</p>ó</div>
|
| 477 |
+
<div><p>&#244;</p>ô</div>
|
| 478 |
+
<div><p>&#245;</p>õ</div>
|
| 479 |
+
<div><p>&#246;</p>ö</div>
|
| 480 |
+
<div><p>&#247;</p>÷</div>
|
| 481 |
+
<div><p>&#248;</p>ø</div>
|
| 482 |
+
<div><p>&#249;</p>ù</div>
|
| 483 |
+
<div><p>&#250;</p>ú</div>
|
| 484 |
+
<div><p>&#251;</p>û</div>
|
| 485 |
+
<div><p>&#252;</p>ü</div>
|
| 486 |
+
<div><p>&#253;</p>ý</div>
|
| 487 |
+
<div><p>&#254;</p>þ</div>
|
| 488 |
+
<div><p>&#255;</p>ÿ</div>
|
| 489 |
+
<div><p>&#338;</p>Œ</div>
|
| 490 |
+
<div><p>&#339;</p>œ</div>
|
| 491 |
+
<div><p>&#376;</p>Ÿ</div>
|
| 492 |
+
<div><p>&#710;</p>ˆ</div>
|
| 493 |
+
<div><p>&#732;</p>˜</div>
|
| 494 |
+
<div><p>&#8192;</p> </div>
|
| 495 |
+
<div><p>&#8193;</p> </div>
|
| 496 |
+
<div><p>&#8194;</p> </div>
|
| 497 |
+
<div><p>&#8195;</p> </div>
|
| 498 |
+
<div><p>&#8196;</p> </div>
|
| 499 |
+
<div><p>&#8197;</p> </div>
|
| 500 |
+
<div><p>&#8198;</p> </div>
|
| 501 |
+
<div><p>&#8199;</p> </div>
|
| 502 |
+
<div><p>&#8200;</p> </div>
|
| 503 |
+
<div><p>&#8201;</p> </div>
|
| 504 |
+
<div><p>&#8202;</p> </div>
|
| 505 |
+
<div><p>&#8208;</p>‐</div>
|
| 506 |
+
<div><p>&#8209;</p>‑</div>
|
| 507 |
+
<div><p>&#8210;</p>‒</div>
|
| 508 |
+
<div><p>&#8211;</p>–</div>
|
| 509 |
+
<div><p>&#8212;</p>—</div>
|
| 510 |
+
<div><p>&#8216;</p>‘</div>
|
| 511 |
+
<div><p>&#8217;</p>’</div>
|
| 512 |
+
<div><p>&#8218;</p>‚</div>
|
| 513 |
+
<div><p>&#8220;</p>“</div>
|
| 514 |
+
<div><p>&#8221;</p>”</div>
|
| 515 |
+
<div><p>&#8222;</p>„</div>
|
| 516 |
+
<div><p>&#8226;</p>•</div>
|
| 517 |
+
<div><p>&#8230;</p>…</div>
|
| 518 |
+
<div><p>&#8239;</p> </div>
|
| 519 |
+
<div><p>&#8249;</p>‹</div>
|
| 520 |
+
<div><p>&#8250;</p>›</div>
|
| 521 |
+
<div><p>&#8287;</p> </div>
|
| 522 |
+
<div><p>&#8482;</p>™</div>
|
| 523 |
+
<div><p>&#9724;</p>◼</div>
|
| 524 |
+
<div><p>&#64257;</p>fi</div>
|
| 525 |
+
<div><p>&#64258;</p>fl</div>
|
| 526 |
+
</div>
|
| 527 |
+
</div>
|
| 528 |
+
|
| 529 |
+
|
| 530 |
+
</div>
|
| 531 |
+
</div>
|
| 532 |
+
|
| 533 |
+
|
| 534 |
+
<div id="specs">
|
| 535 |
+
|
| 536 |
+
</div>
|
| 537 |
+
|
| 538 |
+
<div id="installing">
|
| 539 |
+
<div class="section">
|
| 540 |
+
<div class="grid7 firstcol">
|
| 541 |
+
<h1>Installing Webfonts</h1>
|
| 542 |
+
|
| 543 |
+
<p>Webfonts are supported by all major browser platforms but not all in the same way. There are currently four different font formats that must be included in order to target all browsers. This includes TTF, WOFF, EOT and SVG.</p>
|
| 544 |
+
|
| 545 |
+
<h2>1. Upload your webfonts</h2>
|
| 546 |
+
<p>You must upload your webfont kit to your website. They should be in or near the same directory as your CSS files.</p>
|
| 547 |
+
|
| 548 |
+
<h2>2. Include the webfont stylesheet</h2>
|
| 549 |
+
<p>A special CSS @font-face declaration helps the various browsers select the appropriate font it needs without causing you a bunch of headaches. Learn more about this syntax by reading the <a href="http://www.fontspring.com/blog/further-hardening-of-the-bulletproof-syntax">Fontspring blog post</a> about it. The code for it is as follows:</p>
|
| 550 |
+
|
| 551 |
+
|
| 552 |
+
<code>
|
| 553 |
+
@font-face{
|
| 554 |
+
font-family: 'MyWebFont';
|
| 555 |
+
src: url('WebFont.eot');
|
| 556 |
+
src: url('WebFont.eot?#iefix') format('embedded-opentype'),
|
| 557 |
+
url('WebFont.woff') format('woff'),
|
| 558 |
+
url('WebFont.ttf') format('truetype'),
|
| 559 |
+
url('WebFont.svg#webfont') format('svg');
|
| 560 |
+
}
|
| 561 |
+
</code>
|
| 562 |
+
|
| 563 |
+
<p>We've already gone ahead and generated the code for you. All you have to do is link to the stylesheet in your HTML, like this:</p>
|
| 564 |
+
<code><link rel="stylesheet" href="stylesheet.css" type="text/css" charset="utf-8" /></code>
|
| 565 |
+
|
| 566 |
+
<h2>3. Modify your own stylesheet</h2>
|
| 567 |
+
<p>To take advantage of your new fonts, you must tell your stylesheet to use them. Look at the original @font-face declaration above and find the property called "font-family." The name linked there will be what you use to reference the font. Prepend that webfont name to the font stack in the "font-family" property, inside the selector you want to change. For example:</p>
|
| 568 |
+
<code>p { font-family: 'WebFont', Arial, sans-serif; }</code>
|
| 569 |
+
|
| 570 |
+
<h2>4. Test</h2>
|
| 571 |
+
<p>Getting webfonts to work cross-browser <em>can</em> be tricky. Use the information in the sidebar to help you if you find that fonts aren't loading in a particular browser.</p>
|
| 572 |
+
</div>
|
| 573 |
+
|
| 574 |
+
<div class="grid5 sidebar">
|
| 575 |
+
<div class="box">
|
| 576 |
+
<h2>Troubleshooting<br />Font-Face Problems</h2>
|
| 577 |
+
<p>Having trouble getting your webfonts to load in your new website? Here are some tips to sort out what might be the problem.</p>
|
| 578 |
+
|
| 579 |
+
<h3>Fonts not showing in any browser</h3>
|
| 580 |
+
|
| 581 |
+
<p>This sounds like you need to work on the plumbing. You either did not upload the fonts to the correct directory, or you did not link the fonts properly in the CSS. If you've confirmed that all this is correct and you still have a problem, take a look at your .htaccess file and see if requests are getting intercepted.</p>
|
| 582 |
+
|
| 583 |
+
<h3>Fonts not loading in iPhone or iPad</h3>
|
| 584 |
+
|
| 585 |
+
<p>The most common problem here is that you are serving the fonts from an IIS server. IIS refuses to serve files that have unknown MIME types. If that is the case, you must set the MIME type for SVG to "image/svg+xml" in the server settings. Follow these instructions from Microsoft if you need help.</p>
|
| 586 |
+
|
| 587 |
+
<h3>Fonts not loading in Firefox</h3>
|
| 588 |
+
|
| 589 |
+
<p>The primary reason for this failure? You are still using a version Firefox older than 3.5. So upgrade already! If that isn't it, then you are very likely serving fonts from a different domain. Firefox requires that all font assets be served from the same domain. Lastly it is possible that you need to add WOFF to your list of MIME types (if you are serving via IIS.)</p>
|
| 590 |
+
|
| 591 |
+
<h3>Fonts not loading in IE</h3>
|
| 592 |
+
|
| 593 |
+
<p>Are you looking at Internet Explorer on an actual Windows machine or are you cheating by using a service like Adobe BrowserLab? Many of these screenshot services do not render @font-face for IE. Best to test it on a real machine.</p>
|
| 594 |
+
|
| 595 |
+
<h3>Fonts not loading in IE9</h3>
|
| 596 |
+
|
| 597 |
+
<p>IE9, like Firefox, requires that fonts be served from the same domain as the website. Make sure that is the case.</p>
|
| 598 |
+
</div>
|
| 599 |
+
</div>
|
| 600 |
+
</div>
|
| 601 |
+
|
| 602 |
+
</div>
|
| 603 |
+
|
| 604 |
+
</div>
|
| 605 |
+
<div id="footer">
|
| 606 |
+
<p>©2010-2011 Font Squirrel. All rights reserved.</p>
|
| 607 |
+
</div>
|
| 608 |
+
</div>
|
| 609 |
+
</body>
|
| 610 |
+
</html>
|
css/images/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
css/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
css/jquery-ui-1.10.4/images/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
css/jquery-ui-1.10.4/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
css/jquery-ui-1.10.4/jquery-ui-min.css
CHANGED
|
@@ -1,5 +1,5 @@
|
|
| 1 |
-
/*! jQuery UI - v1.10.4 - 2014-01-17
|
| 2 |
-
* http://jqueryui.com
|
| 3 |
-
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css, jquery.ui.theme.css
|
| 4 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 5 |
* Copyright 2014 jQuery Foundation and other contributors; Licensed MIT */@font-face{font-family:helveticaregular;src:url(../fonts/helvetica_0-webfont.eot);src:url(../fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'),url(../fonts/helvetica_0-webfont.woff) format('woff'),url(../fonts/helvetica_0-webfont.ttf) format('truetype'),url(../fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');font-weight:400;font-style:normal}.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:after,.ui-helper-clearfix:before{content:"";display:table;border-collapse:collapse}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{min-height:0}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-front{z-index:100}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:fixed;top:0;left:0;width:100%;height:100%}.ui-accordion .ui-accordion-header{display:block;cursor:pointer;position:relative;margin-top:10px;padding:.6em .5em;min-height:0;font-size:20px;font-weight:400}.ui-accordion .ui-accordion-icons{padding-left:62px;padding-right:40px}.ui-accordion .ui-accordion-noicons{padding-left:.7em}.ui-accordion .ui-accordion-icons .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-accordion-header-icon{position:absolute;left:.5em;top:50%;margin-top:-8px;display:none}.ui-accordion .ui-accordion-content{padding:1.6em 2em 1.4em;border-top:0}.ui-autocomplete{position:absolute;top:0;left:0;cursor:default}.ui-button{display:inline-block;position:relative;padding:0;line-height:normal;margin-right:.1em;cursor:pointer;vertical-align:middle;text-align:center;overflow:visible}.ui-button,.ui-button:active,.ui-button:hover,.ui-button:link,.ui-button:visited{text-decoration:none}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:normal}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-icons-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-icons-only .ui-button-icon-primary,.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary{left:.5em}.ui-button-icons-only .ui-button-icon-secondary,.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner,input.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-next,.ui-datepicker .ui-datepicker-prev{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-next-hover,.ui-datepicker .ui-datepicker-prev-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-next span,.ui-datepicker .ui-datepicker-prev span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:700;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td a,.ui-datepicker td span{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-dialog{overflow:hidden;position:absolute;top:0;left:0;padding:.2em;outline:0}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 0;white-space:nowrap;width:90%;overflow:hidden;text-overflow:ellipsis}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:20px;margin:-10px 0 0;padding:1px;height:20px}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:0 0;overflow:auto}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0;background-image:none;margin-top:.5em;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:12px;height:12px;right:-5px;bottom:-5px;background-position:16px 16px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-menu{list-style:none;padding:2px;margin:0;display:block;outline:0}.ui-menu .ui-menu{margin-top:-3px;position:absolute}.ui-menu .ui-menu-item{margin:0;padding:0;width:100%;list-style-image:url(data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7)}.ui-menu .ui-menu-divider{margin:5px -2px;height:0;font-size:0;line-height:0;border-width:1px 0 0}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:2px .4em;line-height:1.5;min-height:0;font-weight:400}.ui-menu .ui-menu-item a.ui-state-active,.ui-menu .ui-menu-item a.ui-state-focus{font-weight:400;margin:-1px}.ui-menu .ui-state-disabled{font-weight:400;margin:.4em 0 .2em;line-height:1.5}.ui-menu .ui-state-disabled a{cursor:default}.ui-menu-icons{position:relative}.ui-menu-icons .ui-menu-item a{position:relative;padding-left:2em}.ui-menu .ui-icon{position:absolute;top:.2em;left:.2em}.ui-menu .ui-menu-icon{position:static;float:right}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-progressbar .ui-progressbar-overlay{background:url(images/animated-overlay.gif);height:100%;filter:alpha(opacity=25);opacity:.25}.ui-progressbar-indeterminate .ui-progressbar-value{background-image:none}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:.1px;display:block}.ui-resizable-autohide .ui-resizable-handle,.ui-resizable-disabled .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted #000}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider.ui-state-disabled .ui-slider-handle,.ui-slider.ui-state-disabled .ui-slider-range{filter:inherit}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle}.ui-spinner-input{border:none;background:0 0;color:inherit;padding:0;margin:.2em 22px .2em .4em;vertical-align:middle}.ui-spinner-button{width:16px;height:50%;font-size:.5em;padding:0;margin:0;text-align:center;position:absolute;cursor:default;display:block;overflow:hidden;right:0}.ui-spinner a.ui-spinner-button{border-top:none;border-bottom:none;border-right:none}.ui-spinner .ui-icon{position:absolute;margin-top:-8px;top:50%;left:0}.ui-spinner-up{top:0}.ui-spinner-down{bottom:0}.ui-spinner .ui-icon-triangle-1-s{background-position:-65px -16px}.ui-tabs{position:relative;padding:.2em}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom-width:0;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav .ui-tabs-anchor{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor{cursor:text}.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:0 0}.ui-tooltip{padding:8px;position:absolute;z-index:9999;max-width:300px;-webkit-box-shadow:0 0 5px #aaa;box-shadow:0 0 5px #aaa}body .ui-tooltip{border-width:2px}.ui-widget{font-family:helveticaregular;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget button,.ui-widget input,.ui-widget select,.ui-widget textarea{font-family:helveticaregular;font-size:17px}.ui-widget-content{background:#fff;color:#414951}.ui-widget-content a{color:#222}.ui-widget-header{background:#fff;color:#222}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{background:#fff url(../images/arrow.png) right top no-repeat;font-weight:400;color:#414951}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-focus,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-focus,.ui-widget-header .ui-state-hover{background:#d22b30 url(../images/arrow.png) right -50px no-repeat;font-weight:400;color:#eee}.ui-state-focus a,.ui-state-focus a:hover,.ui-state-focus a:link,.ui-state-focus a:visited,.ui-state-hover a,.ui-state-hover a:hover,.ui-state-hover a:link,.ui-state-hover a:visited{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{background:#d22b30 url(../images/arrow.png) right -105px no-repeat;font-weight:400;color:#eee}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-state-error-text,.ui-widget-content .ui-state-error a,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error a,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:700}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:400}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-state-disabled .ui-icon{filter:Alpha(Opacity=35)}.ui-icon{width:16px;height:16px}.ui-icon,.ui-widget-content .ui-icon,.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-active .ui-icon,.ui-state-focus .ui-icon,.ui-state-hover .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-blank{background-position:16px 16px}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-on{background-position:-96px -144px}.ui-icon-radio-off{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-first,.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-left,.ui-corner-tl,.ui-corner-top{border-top-left-radius:0}.ui-corner-all,.ui-corner-right,.ui-corner-top,.ui-corner-tr{border-top-right-radius:0}.ui-corner-all,.ui-corner-bl,.ui-corner-bottom,.ui-corner-left{border-bottom-left-radius:0}.ui-corner-all,.ui-corner-bottom,.ui-corner-br,.ui-corner-right{border-bottom-right-radius:0}#accordion h3 span,#accordion1 h3 span{position:absolute;left:0;top:0;width:50px;height:49px;background:#31373d;line-height:50px;text-align:center;font-family:helveticaregular;font-size:20px;color:#FFF}#accordion h3.ui-state-active span,#accordion h3:hover span,#accordion1 h3.ui-state-active span,#accordion1 h3:hover span{background:#b8262a;color:#eee}
|
| 1 |
+
/*! jQuery UI - v1.10.4 - 2014-01-17
|
| 2 |
+
* http://jqueryui.com
|
| 3 |
+
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css, jquery.ui.theme.css
|
| 4 |
+
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 5 |
* Copyright 2014 jQuery Foundation and other contributors; Licensed MIT */@font-face{font-family:helveticaregular;src:url(../fonts/helvetica_0-webfont.eot);src:url(../fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'),url(../fonts/helvetica_0-webfont.woff) format('woff'),url(../fonts/helvetica_0-webfont.ttf) format('truetype'),url(../fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');font-weight:400;font-style:normal}.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:after,.ui-helper-clearfix:before{content:"";display:table;border-collapse:collapse}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{min-height:0}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-front{z-index:100}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:fixed;top:0;left:0;width:100%;height:100%}.ui-accordion .ui-accordion-header{display:block;cursor:pointer;position:relative;margin-top:10px;padding:.6em .5em;min-height:0;font-size:20px;font-weight:400}.ui-accordion .ui-accordion-icons{padding-left:62px;padding-right:40px}.ui-accordion .ui-accordion-noicons{padding-left:.7em}.ui-accordion .ui-accordion-icons .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-accordion-header-icon{position:absolute;left:.5em;top:50%;margin-top:-8px;display:none}.ui-accordion .ui-accordion-content{padding:1.6em 2em 1.4em;border-top:0}.ui-autocomplete{position:absolute;top:0;left:0;cursor:default}.ui-button{display:inline-block;position:relative;padding:0;line-height:normal;margin-right:.1em;cursor:pointer;vertical-align:middle;text-align:center;overflow:visible}.ui-button,.ui-button:active,.ui-button:hover,.ui-button:link,.ui-button:visited{text-decoration:none}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:normal}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-icons-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-icons-only .ui-button-icon-primary,.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary{left:.5em}.ui-button-icons-only .ui-button-icon-secondary,.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner,input.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-next,.ui-datepicker .ui-datepicker-prev{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-next-hover,.ui-datepicker .ui-datepicker-prev-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-next span,.ui-datepicker .ui-datepicker-prev span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:700;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td a,.ui-datepicker td span{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-dialog{overflow:hidden;position:absolute;top:0;left:0;padding:.2em;outline:0}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 0;white-space:nowrap;width:90%;overflow:hidden;text-overflow:ellipsis}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:20px;margin:-10px 0 0;padding:1px;height:20px}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:0 0;overflow:auto}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0;background-image:none;margin-top:.5em;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:12px;height:12px;right:-5px;bottom:-5px;background-position:16px 16px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-menu{list-style:none;padding:2px;margin:0;display:block;outline:0}.ui-menu .ui-menu{margin-top:-3px;position:absolute}.ui-menu .ui-menu-item{margin:0;padding:0;width:100%;list-style-image:url(data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7)}.ui-menu .ui-menu-divider{margin:5px -2px;height:0;font-size:0;line-height:0;border-width:1px 0 0}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:2px .4em;line-height:1.5;min-height:0;font-weight:400}.ui-menu .ui-menu-item a.ui-state-active,.ui-menu .ui-menu-item a.ui-state-focus{font-weight:400;margin:-1px}.ui-menu .ui-state-disabled{font-weight:400;margin:.4em 0 .2em;line-height:1.5}.ui-menu .ui-state-disabled a{cursor:default}.ui-menu-icons{position:relative}.ui-menu-icons .ui-menu-item a{position:relative;padding-left:2em}.ui-menu .ui-icon{position:absolute;top:.2em;left:.2em}.ui-menu .ui-menu-icon{position:static;float:right}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-progressbar .ui-progressbar-overlay{background:url(images/animated-overlay.gif);height:100%;filter:alpha(opacity=25);opacity:.25}.ui-progressbar-indeterminate .ui-progressbar-value{background-image:none}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:.1px;display:block}.ui-resizable-autohide .ui-resizable-handle,.ui-resizable-disabled .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted #000}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider.ui-state-disabled .ui-slider-handle,.ui-slider.ui-state-disabled .ui-slider-range{filter:inherit}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle}.ui-spinner-input{border:none;background:0 0;color:inherit;padding:0;margin:.2em 22px .2em .4em;vertical-align:middle}.ui-spinner-button{width:16px;height:50%;font-size:.5em;padding:0;margin:0;text-align:center;position:absolute;cursor:default;display:block;overflow:hidden;right:0}.ui-spinner a.ui-spinner-button{border-top:none;border-bottom:none;border-right:none}.ui-spinner .ui-icon{position:absolute;margin-top:-8px;top:50%;left:0}.ui-spinner-up{top:0}.ui-spinner-down{bottom:0}.ui-spinner .ui-icon-triangle-1-s{background-position:-65px -16px}.ui-tabs{position:relative;padding:.2em}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom-width:0;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav .ui-tabs-anchor{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor{cursor:text}.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:0 0}.ui-tooltip{padding:8px;position:absolute;z-index:9999;max-width:300px;-webkit-box-shadow:0 0 5px #aaa;box-shadow:0 0 5px #aaa}body .ui-tooltip{border-width:2px}.ui-widget{font-family:helveticaregular;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget button,.ui-widget input,.ui-widget select,.ui-widget textarea{font-family:helveticaregular;font-size:17px}.ui-widget-content{background:#fff;color:#414951}.ui-widget-content a{color:#222}.ui-widget-header{background:#fff;color:#222}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{background:#fff url(../images/arrow.png) right top no-repeat;font-weight:400;color:#414951}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-focus,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-focus,.ui-widget-header .ui-state-hover{background:#d22b30 url(../images/arrow.png) right -50px no-repeat;font-weight:400;color:#eee}.ui-state-focus a,.ui-state-focus a:hover,.ui-state-focus a:link,.ui-state-focus a:visited,.ui-state-hover a,.ui-state-hover a:hover,.ui-state-hover a:link,.ui-state-hover a:visited{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{background:#d22b30 url(../images/arrow.png) right -105px no-repeat;font-weight:400;color:#eee}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-state-error-text,.ui-widget-content .ui-state-error a,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error a,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:700}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:400}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-state-disabled .ui-icon{filter:Alpha(Opacity=35)}.ui-icon{width:16px;height:16px}.ui-icon,.ui-widget-content .ui-icon,.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-active .ui-icon,.ui-state-focus .ui-icon,.ui-state-hover .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-blank{background-position:16px 16px}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-on{background-position:-96px -144px}.ui-icon-radio-off{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-first,.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-left,.ui-corner-tl,.ui-corner-top{border-top-left-radius:0}.ui-corner-all,.ui-corner-right,.ui-corner-top,.ui-corner-tr{border-top-right-radius:0}.ui-corner-all,.ui-corner-bl,.ui-corner-bottom,.ui-corner-left{border-bottom-left-radius:0}.ui-corner-all,.ui-corner-bottom,.ui-corner-br,.ui-corner-right{border-bottom-right-radius:0}#accordion h3 span,#accordion1 h3 span{position:absolute;left:0;top:0;width:50px;height:49px;background:#31373d;line-height:50px;text-align:center;font-family:helveticaregular;font-size:20px;color:#FFF}#accordion h3.ui-state-active span,#accordion h3:hover span,#accordion1 h3.ui-state-active span,#accordion1 h3:hover span{background:#b8262a;color:#eee}
|
css/jquery-ui-1.10.4/jquery-ui.css
CHANGED
|
@@ -1,1195 +1,1195 @@
|
|
| 1 |
-
|
| 2 |
-
/*! jQuery UI - v1.10.4 - 2014-01-17
|
| 3 |
-
* http://jqueryui.com
|
| 4 |
-
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css, jquery.ui.theme.css
|
| 5 |
-
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 6 |
-
* Copyright 2014 jQuery Foundation and other contributors; Licensed MIT */
|
| 7 |
-
|
| 8 |
-
/* Layout helpers
|
| 9 |
-
----------------------------------*/
|
| 10 |
-
|
| 11 |
-
@font-face {
|
| 12 |
-
font-family: 'helveticaregular';
|
| 13 |
-
src: url('../fonts/helvetica_0-webfont.eot');
|
| 14 |
-
src: url('../fonts/helvetica_0-webfont.eot?#iefix') format('embedded-opentype'),
|
| 15 |
-
url('../fonts/helvetica_0-webfont.woff') format('woff'),
|
| 16 |
-
url('../fonts/helvetica_0-webfont.ttf') format('truetype'),
|
| 17 |
-
url('../fonts/helvetica_0-webfont.svg#helveticaregular') format('svg');
|
| 18 |
-
font-weight: normal;
|
| 19 |
-
font-style: normal;
|
| 20 |
-
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
.ui-helper-hidden {
|
| 25 |
-
display: none;
|
| 26 |
-
}
|
| 27 |
-
.ui-helper-hidden-accessible {
|
| 28 |
-
border: 0;
|
| 29 |
-
clip: rect(0 0 0 0);
|
| 30 |
-
height: 1px;
|
| 31 |
-
margin: -1px;
|
| 32 |
-
overflow: hidden;
|
| 33 |
-
padding: 0;
|
| 34 |
-
position: absolute;
|
| 35 |
-
width: 1px;
|
| 36 |
-
}
|
| 37 |
-
.ui-helper-reset {
|
| 38 |
-
margin: 0;
|
| 39 |
-
padding: 0;
|
| 40 |
-
border: 0;
|
| 41 |
-
outline: 0;
|
| 42 |
-
line-height: 1.3;
|
| 43 |
-
text-decoration: none;
|
| 44 |
-
font-size: 100%;
|
| 45 |
-
list-style: none;
|
| 46 |
-
}
|
| 47 |
-
.ui-helper-clearfix:before,
|
| 48 |
-
.ui-helper-clearfix:after {
|
| 49 |
-
content: "";
|
| 50 |
-
display: table;
|
| 51 |
-
border-collapse: collapse;
|
| 52 |
-
}
|
| 53 |
-
.ui-helper-clearfix:after {
|
| 54 |
-
clear: both;
|
| 55 |
-
}
|
| 56 |
-
.ui-helper-clearfix {
|
| 57 |
-
min-height: 0; /* support: IE7 */
|
| 58 |
-
}
|
| 59 |
-
.ui-helper-zfix {
|
| 60 |
-
width: 100%;
|
| 61 |
-
height: 100%;
|
| 62 |
-
top: 0;
|
| 63 |
-
left: 0;
|
| 64 |
-
position: absolute;
|
| 65 |
-
opacity: 0;
|
| 66 |
-
filter:Alpha(Opacity=0);
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.ui-front {
|
| 70 |
-
z-index: 100;
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
/* Interaction Cues
|
| 75 |
-
----------------------------------*/
|
| 76 |
-
.ui-state-disabled {
|
| 77 |
-
cursor: default !important;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
/* Icons
|
| 82 |
-
----------------------------------*/
|
| 83 |
-
|
| 84 |
-
/* states and images */
|
| 85 |
-
.ui-icon {
|
| 86 |
-
display: block;
|
| 87 |
-
text-indent: -99999px;
|
| 88 |
-
overflow: hidden;
|
| 89 |
-
background-repeat: no-repeat;
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
/* Misc visuals
|
| 94 |
-
----------------------------------*/
|
| 95 |
-
|
| 96 |
-
/* Overlays */
|
| 97 |
-
.ui-widget-overlay {
|
| 98 |
-
position: fixed;
|
| 99 |
-
top: 0;
|
| 100 |
-
left: 0;
|
| 101 |
-
width: 100%;
|
| 102 |
-
height: 100%;
|
| 103 |
-
}
|
| 104 |
-
.ui-accordion .ui-accordion-header {
|
| 105 |
-
display: block;
|
| 106 |
-
cursor: pointer;
|
| 107 |
-
position: relative;
|
| 108 |
-
margin-top: 10px;
|
| 109 |
-
padding: .6em .5em;
|
| 110 |
-
min-height: 0; /* support: IE7 */
|
| 111 |
-
font-size:20px;
|
| 112 |
-
font-weight:normal;
|
| 113 |
-
}
|
| 114 |
-
.ui-accordion .ui-accordion-icons {
|
| 115 |
-
padding-left: 62px;
|
| 116 |
-
padding-right: 40px;
|
| 117 |
-
}
|
| 118 |
-
.ui-accordion .ui-accordion-noicons {
|
| 119 |
-
padding-left: .7em;
|
| 120 |
-
}
|
| 121 |
-
.ui-accordion .ui-accordion-icons .ui-accordion-icons {
|
| 122 |
-
padding-left: 2.2em;
|
| 123 |
-
}
|
| 124 |
-
.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
|
| 125 |
-
position: absolute;
|
| 126 |
-
left: .5em;
|
| 127 |
-
top: 50%;
|
| 128 |
-
margin-top: -8px;
|
| 129 |
-
display:none;
|
| 130 |
-
}
|
| 131 |
-
.ui-accordion .ui-accordion-content {
|
| 132 |
-
padding:1.6em 2em 1.4em 2em;
|
| 133 |
-
border-top: 0;
|
| 134 |
-
}
|
| 135 |
-
.ui-autocomplete {
|
| 136 |
-
position: absolute;
|
| 137 |
-
top: 0;
|
| 138 |
-
left: 0;
|
| 139 |
-
cursor: default;
|
| 140 |
-
}
|
| 141 |
-
.ui-button {
|
| 142 |
-
display: inline-block;
|
| 143 |
-
position: relative;
|
| 144 |
-
padding: 0;
|
| 145 |
-
line-height: normal;
|
| 146 |
-
margin-right: .1em;
|
| 147 |
-
cursor: pointer;
|
| 148 |
-
vertical-align: middle;
|
| 149 |
-
text-align: center;
|
| 150 |
-
overflow: visible; /* removes extra width in IE */
|
| 151 |
-
}
|
| 152 |
-
.ui-button,
|
| 153 |
-
.ui-button:link,
|
| 154 |
-
.ui-button:visited,
|
| 155 |
-
.ui-button:hover,
|
| 156 |
-
.ui-button:active {
|
| 157 |
-
text-decoration: none;
|
| 158 |
-
}
|
| 159 |
-
/* to make room for the icon, a width needs to be set here */
|
| 160 |
-
.ui-button-icon-only {
|
| 161 |
-
width: 2.2em;
|
| 162 |
-
}
|
| 163 |
-
/* button elements seem to need a little more width */
|
| 164 |
-
button.ui-button-icon-only {
|
| 165 |
-
width: 2.4em;
|
| 166 |
-
}
|
| 167 |
-
.ui-button-icons-only {
|
| 168 |
-
width: 3.4em;
|
| 169 |
-
}
|
| 170 |
-
button.ui-button-icons-only {
|
| 171 |
-
width: 3.7em;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
/* button text element */
|
| 175 |
-
.ui-button .ui-button-text {
|
| 176 |
-
display: block;
|
| 177 |
-
line-height: normal;
|
| 178 |
-
}
|
| 179 |
-
.ui-button-text-only .ui-button-text {
|
| 180 |
-
padding: .4em 1em;
|
| 181 |
-
}
|
| 182 |
-
.ui-button-icon-only .ui-button-text,
|
| 183 |
-
.ui-button-icons-only .ui-button-text {
|
| 184 |
-
padding: .4em;
|
| 185 |
-
text-indent: -9999999px;
|
| 186 |
-
}
|
| 187 |
-
.ui-button-text-icon-primary .ui-button-text,
|
| 188 |
-
.ui-button-text-icons .ui-button-text {
|
| 189 |
-
padding: .4em 1em .4em 2.1em;
|
| 190 |
-
}
|
| 191 |
-
.ui-button-text-icon-secondary .ui-button-text,
|
| 192 |
-
.ui-button-text-icons .ui-button-text {
|
| 193 |
-
padding: .4em 2.1em .4em 1em;
|
| 194 |
-
}
|
| 195 |
-
.ui-button-text-icons .ui-button-text {
|
| 196 |
-
padding-left: 2.1em;
|
| 197 |
-
padding-right: 2.1em;
|
| 198 |
-
}
|
| 199 |
-
/* no icon support for input elements, provide padding by default */
|
| 200 |
-
input.ui-button {
|
| 201 |
-
padding: .4em 1em;
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
/* button icon element(s) */
|
| 205 |
-
.ui-button-icon-only .ui-icon,
|
| 206 |
-
.ui-button-text-icon-primary .ui-icon,
|
| 207 |
-
.ui-button-text-icon-secondary .ui-icon,
|
| 208 |
-
.ui-button-text-icons .ui-icon,
|
| 209 |
-
.ui-button-icons-only .ui-icon {
|
| 210 |
-
position: absolute;
|
| 211 |
-
top: 50%;
|
| 212 |
-
margin-top: -8px;
|
| 213 |
-
}
|
| 214 |
-
.ui-button-icon-only .ui-icon {
|
| 215 |
-
left: 50%;
|
| 216 |
-
margin-left: -8px;
|
| 217 |
-
}
|
| 218 |
-
.ui-button-text-icon-primary .ui-button-icon-primary,
|
| 219 |
-
.ui-button-text-icons .ui-button-icon-primary,
|
| 220 |
-
.ui-button-icons-only .ui-button-icon-primary {
|
| 221 |
-
left: .5em;
|
| 222 |
-
}
|
| 223 |
-
.ui-button-text-icon-secondary .ui-button-icon-secondary,
|
| 224 |
-
.ui-button-text-icons .ui-button-icon-secondary,
|
| 225 |
-
.ui-button-icons-only .ui-button-icon-secondary {
|
| 226 |
-
right: .5em;
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
/* button sets */
|
| 230 |
-
.ui-buttonset {
|
| 231 |
-
margin-right: 7px;
|
| 232 |
-
}
|
| 233 |
-
.ui-buttonset .ui-button {
|
| 234 |
-
margin-left: 0;
|
| 235 |
-
margin-right: -.3em;
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
/* workarounds */
|
| 239 |
-
/* reset extra padding in Firefox, see h5bp.com/l */
|
| 240 |
-
input.ui-button::-moz-focus-inner,
|
| 241 |
-
button.ui-button::-moz-focus-inner {
|
| 242 |
-
border: 0;
|
| 243 |
-
padding: 0;
|
| 244 |
-
}
|
| 245 |
-
.ui-datepicker {
|
| 246 |
-
width: 17em;
|
| 247 |
-
padding: .2em .2em 0;
|
| 248 |
-
display: none;
|
| 249 |
-
}
|
| 250 |
-
.ui-datepicker .ui-datepicker-header {
|
| 251 |
-
position: relative;
|
| 252 |
-
padding: .2em 0;
|
| 253 |
-
}
|
| 254 |
-
.ui-datepicker .ui-datepicker-prev,
|
| 255 |
-
.ui-datepicker .ui-datepicker-next {
|
| 256 |
-
position: absolute;
|
| 257 |
-
top: 2px;
|
| 258 |
-
width: 1.8em;
|
| 259 |
-
height: 1.8em;
|
| 260 |
-
}
|
| 261 |
-
.ui-datepicker .ui-datepicker-prev-hover,
|
| 262 |
-
.ui-datepicker .ui-datepicker-next-hover {
|
| 263 |
-
top: 1px;
|
| 264 |
-
}
|
| 265 |
-
.ui-datepicker .ui-datepicker-prev {
|
| 266 |
-
left: 2px;
|
| 267 |
-
}
|
| 268 |
-
.ui-datepicker .ui-datepicker-next {
|
| 269 |
-
right: 2px;
|
| 270 |
-
}
|
| 271 |
-
.ui-datepicker .ui-datepicker-prev-hover {
|
| 272 |
-
left: 1px;
|
| 273 |
-
}
|
| 274 |
-
.ui-datepicker .ui-datepicker-next-hover {
|
| 275 |
-
right: 1px;
|
| 276 |
-
}
|
| 277 |
-
.ui-datepicker .ui-datepicker-prev span,
|
| 278 |
-
.ui-datepicker .ui-datepicker-next span {
|
| 279 |
-
display: block;
|
| 280 |
-
position: absolute;
|
| 281 |
-
left: 50%;
|
| 282 |
-
margin-left: -8px;
|
| 283 |
-
top: 50%;
|
| 284 |
-
margin-top: -8px;
|
| 285 |
-
}
|
| 286 |
-
.ui-datepicker .ui-datepicker-title {
|
| 287 |
-
margin: 0 2.3em;
|
| 288 |
-
line-height: 1.8em;
|
| 289 |
-
text-align: center;
|
| 290 |
-
}
|
| 291 |
-
.ui-datepicker .ui-datepicker-title select {
|
| 292 |
-
font-size: 1em;
|
| 293 |
-
margin: 1px 0;
|
| 294 |
-
}
|
| 295 |
-
.ui-datepicker select.ui-datepicker-month,
|
| 296 |
-
.ui-datepicker select.ui-datepicker-year {
|
| 297 |
-
width: 49%;
|
| 298 |
-
}
|
| 299 |
-
.ui-datepicker table {
|
| 300 |
-
width: 100%;
|
| 301 |
-
font-size: .9em;
|
| 302 |
-
border-collapse: collapse;
|
| 303 |
-
margin: 0 0 .4em;
|
| 304 |
-
}
|
| 305 |
-
.ui-datepicker th {
|
| 306 |
-
padding: .7em .3em;
|
| 307 |
-
text-align: center;
|
| 308 |
-
font-weight: bold;
|
| 309 |
-
border: 0;
|
| 310 |
-
}
|
| 311 |
-
.ui-datepicker td {
|
| 312 |
-
border: 0;
|
| 313 |
-
padding: 1px;
|
| 314 |
-
}
|
| 315 |
-
.ui-datepicker td span,
|
| 316 |
-
.ui-datepicker td a {
|
| 317 |
-
display: block;
|
| 318 |
-
padding: .2em;
|
| 319 |
-
text-align: right;
|
| 320 |
-
text-decoration: none;
|
| 321 |
-
}
|
| 322 |
-
.ui-datepicker .ui-datepicker-buttonpane {
|
| 323 |
-
background-image: none;
|
| 324 |
-
margin: .7em 0 0 0;
|
| 325 |
-
padding: 0 .2em;
|
| 326 |
-
border-left: 0;
|
| 327 |
-
border-right: 0;
|
| 328 |
-
border-bottom: 0;
|
| 329 |
-
}
|
| 330 |
-
.ui-datepicker .ui-datepicker-buttonpane button {
|
| 331 |
-
float: right;
|
| 332 |
-
margin: .5em .2em .4em;
|
| 333 |
-
cursor: pointer;
|
| 334 |
-
padding: .2em .6em .3em .6em;
|
| 335 |
-
width: auto;
|
| 336 |
-
overflow: visible;
|
| 337 |
-
}
|
| 338 |
-
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
|
| 339 |
-
float: left;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
/* with multiple calendars */
|
| 343 |
-
.ui-datepicker.ui-datepicker-multi {
|
| 344 |
-
width: auto;
|
| 345 |
-
}
|
| 346 |
-
.ui-datepicker-multi .ui-datepicker-group {
|
| 347 |
-
float: left;
|
| 348 |
-
}
|
| 349 |
-
.ui-datepicker-multi .ui-datepicker-group table {
|
| 350 |
-
width: 95%;
|
| 351 |
-
margin: 0 auto .4em;
|
| 352 |
-
}
|
| 353 |
-
.ui-datepicker-multi-2 .ui-datepicker-group {
|
| 354 |
-
width: 50%;
|
| 355 |
-
}
|
| 356 |
-
.ui-datepicker-multi-3 .ui-datepicker-group {
|
| 357 |
-
width: 33.3%;
|
| 358 |
-
}
|
| 359 |
-
.ui-datepicker-multi-4 .ui-datepicker-group {
|
| 360 |
-
width: 25%;
|
| 361 |
-
}
|
| 362 |
-
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
|
| 363 |
-
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
|
| 364 |
-
border-left-width: 0;
|
| 365 |
-
}
|
| 366 |
-
.ui-datepicker-multi .ui-datepicker-buttonpane {
|
| 367 |
-
clear: left;
|
| 368 |
-
}
|
| 369 |
-
.ui-datepicker-row-break {
|
| 370 |
-
clear: both;
|
| 371 |
-
width: 100%;
|
| 372 |
-
font-size: 0;
|
| 373 |
-
}
|
| 374 |
-
|
| 375 |
-
/* RTL support */
|
| 376 |
-
.ui-datepicker-rtl {
|
| 377 |
-
direction: rtl;
|
| 378 |
-
}
|
| 379 |
-
.ui-datepicker-rtl .ui-datepicker-prev {
|
| 380 |
-
right: 2px;
|
| 381 |
-
left: auto;
|
| 382 |
-
}
|
| 383 |
-
.ui-datepicker-rtl .ui-datepicker-next {
|
| 384 |
-
left: 2px;
|
| 385 |
-
right: auto;
|
| 386 |
-
}
|
| 387 |
-
.ui-datepicker-rtl .ui-datepicker-prev:hover {
|
| 388 |
-
right: 1px;
|
| 389 |
-
left: auto;
|
| 390 |
-
}
|
| 391 |
-
.ui-datepicker-rtl .ui-datepicker-next:hover {
|
| 392 |
-
left: 1px;
|
| 393 |
-
right: auto;
|
| 394 |
-
}
|
| 395 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane {
|
| 396 |
-
clear: right;
|
| 397 |
-
}
|
| 398 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button {
|
| 399 |
-
float: left;
|
| 400 |
-
}
|
| 401 |
-
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
|
| 402 |
-
.ui-datepicker-rtl .ui-datepicker-group {
|
| 403 |
-
float: right;
|
| 404 |
-
}
|
| 405 |
-
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
|
| 406 |
-
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
|
| 407 |
-
border-right-width: 0;
|
| 408 |
-
border-left-width: 1px;
|
| 409 |
-
}
|
| 410 |
-
.ui-dialog {
|
| 411 |
-
overflow: hidden;
|
| 412 |
-
position: absolute;
|
| 413 |
-
top: 0;
|
| 414 |
-
left: 0;
|
| 415 |
-
padding: .2em;
|
| 416 |
-
outline: 0;
|
| 417 |
-
}
|
| 418 |
-
.ui-dialog .ui-dialog-titlebar {
|
| 419 |
-
padding: .4em 1em;
|
| 420 |
-
position: relative;
|
| 421 |
-
}
|
| 422 |
-
.ui-dialog .ui-dialog-title {
|
| 423 |
-
float: left;
|
| 424 |
-
margin: .1em 0;
|
| 425 |
-
white-space: nowrap;
|
| 426 |
-
width: 90%;
|
| 427 |
-
overflow: hidden;
|
| 428 |
-
text-overflow: ellipsis;
|
| 429 |
-
}
|
| 430 |
-
.ui-dialog .ui-dialog-titlebar-close {
|
| 431 |
-
position: absolute;
|
| 432 |
-
right: .3em;
|
| 433 |
-
top: 50%;
|
| 434 |
-
width: 20px;
|
| 435 |
-
margin: -10px 0 0 0;
|
| 436 |
-
padding: 1px;
|
| 437 |
-
height: 20px;
|
| 438 |
-
}
|
| 439 |
-
.ui-dialog .ui-dialog-content {
|
| 440 |
-
position: relative;
|
| 441 |
-
border: 0;
|
| 442 |
-
padding: .5em 1em;
|
| 443 |
-
background: none;
|
| 444 |
-
overflow: auto;
|
| 445 |
-
}
|
| 446 |
-
.ui-dialog .ui-dialog-buttonpane {
|
| 447 |
-
text-align: left;
|
| 448 |
-
border-width: 1px 0 0 0;
|
| 449 |
-
background-image: none;
|
| 450 |
-
margin-top: .5em;
|
| 451 |
-
padding: .3em 1em .5em .4em;
|
| 452 |
-
}
|
| 453 |
-
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
|
| 454 |
-
float: right;
|
| 455 |
-
}
|
| 456 |
-
.ui-dialog .ui-dialog-buttonpane button {
|
| 457 |
-
margin: .5em .4em .5em 0;
|
| 458 |
-
cursor: pointer;
|
| 459 |
-
}
|
| 460 |
-
.ui-dialog .ui-resizable-se {
|
| 461 |
-
width: 12px;
|
| 462 |
-
height: 12px;
|
| 463 |
-
right: -5px;
|
| 464 |
-
bottom: -5px;
|
| 465 |
-
background-position: 16px 16px;
|
| 466 |
-
}
|
| 467 |
-
.ui-draggable .ui-dialog-titlebar {
|
| 468 |
-
cursor: move;
|
| 469 |
-
}
|
| 470 |
-
.ui-menu {
|
| 471 |
-
list-style: none;
|
| 472 |
-
padding: 2px;
|
| 473 |
-
margin: 0;
|
| 474 |
-
display: block;
|
| 475 |
-
outline: none;
|
| 476 |
-
}
|
| 477 |
-
.ui-menu .ui-menu {
|
| 478 |
-
margin-top: -3px;
|
| 479 |
-
position: absolute;
|
| 480 |
-
}
|
| 481 |
-
.ui-menu .ui-menu-item {
|
| 482 |
-
margin: 0;
|
| 483 |
-
padding: 0;
|
| 484 |
-
width: 100%;
|
| 485 |
-
/* support: IE10, see #8844 */
|
| 486 |
-
list-style-image: url(data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7);
|
| 487 |
-
}
|
| 488 |
-
.ui-menu .ui-menu-divider {
|
| 489 |
-
margin: 5px -2px 5px -2px;
|
| 490 |
-
height: 0;
|
| 491 |
-
font-size: 0;
|
| 492 |
-
line-height: 0;
|
| 493 |
-
border-width: 1px 0 0 0;
|
| 494 |
-
}
|
| 495 |
-
.ui-menu .ui-menu-item a {
|
| 496 |
-
text-decoration: none;
|
| 497 |
-
display: block;
|
| 498 |
-
padding: 2px .4em;
|
| 499 |
-
line-height: 1.5;
|
| 500 |
-
min-height: 0; /* support: IE7 */
|
| 501 |
-
font-weight: normal;
|
| 502 |
-
}
|
| 503 |
-
.ui-menu .ui-menu-item a.ui-state-focus,
|
| 504 |
-
.ui-menu .ui-menu-item a.ui-state-active {
|
| 505 |
-
font-weight: normal;
|
| 506 |
-
margin: -1px;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
.ui-menu .ui-state-disabled {
|
| 510 |
-
font-weight: normal;
|
| 511 |
-
margin: .4em 0 .2em;
|
| 512 |
-
line-height: 1.5;
|
| 513 |
-
}
|
| 514 |
-
.ui-menu .ui-state-disabled a {
|
| 515 |
-
cursor: default;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
/* icon support */
|
| 519 |
-
.ui-menu-icons {
|
| 520 |
-
position: relative;
|
| 521 |
-
}
|
| 522 |
-
.ui-menu-icons .ui-menu-item a {
|
| 523 |
-
position: relative;
|
| 524 |
-
padding-left: 2em;
|
| 525 |
-
}
|
| 526 |
-
|
| 527 |
-
/* left-aligned */
|
| 528 |
-
.ui-menu .ui-icon {
|
| 529 |
-
position: absolute;
|
| 530 |
-
top: .2em;
|
| 531 |
-
left: .2em;
|
| 532 |
-
}
|
| 533 |
-
|
| 534 |
-
/* right-aligned */
|
| 535 |
-
.ui-menu .ui-menu-icon {
|
| 536 |
-
position: static;
|
| 537 |
-
float: right;
|
| 538 |
-
}
|
| 539 |
-
.ui-progressbar {
|
| 540 |
-
height: 2em;
|
| 541 |
-
text-align: left;
|
| 542 |
-
overflow: hidden;
|
| 543 |
-
}
|
| 544 |
-
.ui-progressbar .ui-progressbar-value {
|
| 545 |
-
margin: -1px;
|
| 546 |
-
height: 100%;
|
| 547 |
-
}
|
| 548 |
-
.ui-progressbar .ui-progressbar-overlay {
|
| 549 |
-
background: url("images/animated-overlay.gif");
|
| 550 |
-
height: 100%;
|
| 551 |
-
filter: alpha(opacity=25);
|
| 552 |
-
opacity: 0.25;
|
| 553 |
-
}
|
| 554 |
-
.ui-progressbar-indeterminate .ui-progressbar-value {
|
| 555 |
-
background-image: none;
|
| 556 |
-
}
|
| 557 |
-
.ui-resizable {
|
| 558 |
-
position: relative;
|
| 559 |
-
}
|
| 560 |
-
.ui-resizable-handle {
|
| 561 |
-
position: absolute;
|
| 562 |
-
font-size: 0.1px;
|
| 563 |
-
display: block;
|
| 564 |
-
}
|
| 565 |
-
.ui-resizable-disabled .ui-resizable-handle,
|
| 566 |
-
.ui-resizable-autohide .ui-resizable-handle {
|
| 567 |
-
display: none;
|
| 568 |
-
}
|
| 569 |
-
.ui-resizable-n {
|
| 570 |
-
cursor: n-resize;
|
| 571 |
-
height: 7px;
|
| 572 |
-
width: 100%;
|
| 573 |
-
top: -5px;
|
| 574 |
-
left: 0;
|
| 575 |
-
}
|
| 576 |
-
.ui-resizable-s {
|
| 577 |
-
cursor: s-resize;
|
| 578 |
-
height: 7px;
|
| 579 |
-
width: 100%;
|
| 580 |
-
bottom: -5px;
|
| 581 |
-
left: 0;
|
| 582 |
-
}
|
| 583 |
-
.ui-resizable-e {
|
| 584 |
-
cursor: e-resize;
|
| 585 |
-
width: 7px;
|
| 586 |
-
right: -5px;
|
| 587 |
-
top: 0;
|
| 588 |
-
height: 100%;
|
| 589 |
-
}
|
| 590 |
-
.ui-resizable-w {
|
| 591 |
-
cursor: w-resize;
|
| 592 |
-
width: 7px;
|
| 593 |
-
left: -5px;
|
| 594 |
-
top: 0;
|
| 595 |
-
height: 100%;
|
| 596 |
-
}
|
| 597 |
-
.ui-resizable-se {
|
| 598 |
-
cursor: se-resize;
|
| 599 |
-
width: 12px;
|
| 600 |
-
height: 12px;
|
| 601 |
-
right: 1px;
|
| 602 |
-
bottom: 1px;
|
| 603 |
-
}
|
| 604 |
-
.ui-resizable-sw {
|
| 605 |
-
cursor: sw-resize;
|
| 606 |
-
width: 9px;
|
| 607 |
-
height: 9px;
|
| 608 |
-
left: -5px;
|
| 609 |
-
bottom: -5px;
|
| 610 |
-
}
|
| 611 |
-
.ui-resizable-nw {
|
| 612 |
-
cursor: nw-resize;
|
| 613 |
-
width: 9px;
|
| 614 |
-
height: 9px;
|
| 615 |
-
left: -5px;
|
| 616 |
-
top: -5px;
|
| 617 |
-
}
|
| 618 |
-
.ui-resizable-ne {
|
| 619 |
-
cursor: ne-resize;
|
| 620 |
-
width: 9px;
|
| 621 |
-
height: 9px;
|
| 622 |
-
right: -5px;
|
| 623 |
-
top: -5px;
|
| 624 |
-
}
|
| 625 |
-
.ui-selectable-helper {
|
| 626 |
-
position: absolute;
|
| 627 |
-
z-index: 100;
|
| 628 |
-
border: 1px dotted black;
|
| 629 |
-
}
|
| 630 |
-
.ui-slider {
|
| 631 |
-
position: relative;
|
| 632 |
-
text-align: left;
|
| 633 |
-
}
|
| 634 |
-
.ui-slider .ui-slider-handle {
|
| 635 |
-
position: absolute;
|
| 636 |
-
z-index: 2;
|
| 637 |
-
width: 1.2em;
|
| 638 |
-
height: 1.2em;
|
| 639 |
-
cursor: default;
|
| 640 |
-
}
|
| 641 |
-
.ui-slider .ui-slider-range {
|
| 642 |
-
position: absolute;
|
| 643 |
-
z-index: 1;
|
| 644 |
-
font-size: .7em;
|
| 645 |
-
display: block;
|
| 646 |
-
border: 0;
|
| 647 |
-
background-position: 0 0;
|
| 648 |
-
}
|
| 649 |
-
|
| 650 |
-
/* For IE8 - See #6727 */
|
| 651 |
-
.ui-slider.ui-state-disabled .ui-slider-handle,
|
| 652 |
-
.ui-slider.ui-state-disabled .ui-slider-range {
|
| 653 |
-
filter: inherit;
|
| 654 |
-
}
|
| 655 |
-
|
| 656 |
-
.ui-slider-horizontal {
|
| 657 |
-
height: .8em;
|
| 658 |
-
}
|
| 659 |
-
.ui-slider-horizontal .ui-slider-handle {
|
| 660 |
-
top: -.3em;
|
| 661 |
-
margin-left: -.6em;
|
| 662 |
-
}
|
| 663 |
-
.ui-slider-horizontal .ui-slider-range {
|
| 664 |
-
top: 0;
|
| 665 |
-
height: 100%;
|
| 666 |
-
}
|
| 667 |
-
.ui-slider-horizontal .ui-slider-range-min {
|
| 668 |
-
left: 0;
|
| 669 |
-
}
|
| 670 |
-
.ui-slider-horizontal .ui-slider-range-max {
|
| 671 |
-
right: 0;
|
| 672 |
-
}
|
| 673 |
-
|
| 674 |
-
.ui-slider-vertical {
|
| 675 |
-
width: .8em;
|
| 676 |
-
height: 100px;
|
| 677 |
-
}
|
| 678 |
-
.ui-slider-vertical .ui-slider-handle {
|
| 679 |
-
left: -.3em;
|
| 680 |
-
margin-left: 0;
|
| 681 |
-
margin-bottom: -.6em;
|
| 682 |
-
}
|
| 683 |
-
.ui-slider-vertical .ui-slider-range {
|
| 684 |
-
left: 0;
|
| 685 |
-
width: 100%;
|
| 686 |
-
}
|
| 687 |
-
.ui-slider-vertical .ui-slider-range-min {
|
| 688 |
-
bottom: 0;
|
| 689 |
-
}
|
| 690 |
-
.ui-slider-vertical .ui-slider-range-max {
|
| 691 |
-
top: 0;
|
| 692 |
-
}
|
| 693 |
-
.ui-spinner {
|
| 694 |
-
position: relative;
|
| 695 |
-
display: inline-block;
|
| 696 |
-
overflow: hidden;
|
| 697 |
-
padding: 0;
|
| 698 |
-
vertical-align: middle;
|
| 699 |
-
}
|
| 700 |
-
.ui-spinner-input {
|
| 701 |
-
border: none;
|
| 702 |
-
background: none;
|
| 703 |
-
color: inherit;
|
| 704 |
-
padding: 0;
|
| 705 |
-
margin: .2em 0;
|
| 706 |
-
vertical-align: middle;
|
| 707 |
-
margin-left: .4em;
|
| 708 |
-
margin-right: 22px;
|
| 709 |
-
}
|
| 710 |
-
.ui-spinner-button {
|
| 711 |
-
width: 16px;
|
| 712 |
-
height: 50%;
|
| 713 |
-
font-size: .5em;
|
| 714 |
-
padding: 0;
|
| 715 |
-
margin: 0;
|
| 716 |
-
text-align: center;
|
| 717 |
-
position: absolute;
|
| 718 |
-
cursor: default;
|
| 719 |
-
display: block;
|
| 720 |
-
overflow: hidden;
|
| 721 |
-
right: 0;
|
| 722 |
-
}
|
| 723 |
-
/* more specificity required here to override default borders */
|
| 724 |
-
.ui-spinner a.ui-spinner-button {
|
| 725 |
-
border-top: none;
|
| 726 |
-
border-bottom: none;
|
| 727 |
-
border-right: none;
|
| 728 |
-
}
|
| 729 |
-
/* vertically center icon */
|
| 730 |
-
.ui-spinner .ui-icon {
|
| 731 |
-
position: absolute;
|
| 732 |
-
margin-top: -8px;
|
| 733 |
-
top: 50%;
|
| 734 |
-
left: 0;
|
| 735 |
-
}
|
| 736 |
-
.ui-spinner-up {
|
| 737 |
-
top: 0;
|
| 738 |
-
}
|
| 739 |
-
.ui-spinner-down {
|
| 740 |
-
bottom: 0;
|
| 741 |
-
}
|
| 742 |
-
|
| 743 |
-
/* TR overrides */
|
| 744 |
-
.ui-spinner .ui-icon-triangle-1-s {
|
| 745 |
-
/* need to fix icons sprite */
|
| 746 |
-
background-position: -65px -16px;
|
| 747 |
-
}
|
| 748 |
-
.ui-tabs {
|
| 749 |
-
position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
|
| 750 |
-
padding: .2em;
|
| 751 |
-
}
|
| 752 |
-
.ui-tabs .ui-tabs-nav {
|
| 753 |
-
margin: 0;
|
| 754 |
-
padding: .2em .2em 0;
|
| 755 |
-
}
|
| 756 |
-
.ui-tabs .ui-tabs-nav li {
|
| 757 |
-
list-style: none;
|
| 758 |
-
float: left;
|
| 759 |
-
position: relative;
|
| 760 |
-
top: 0;
|
| 761 |
-
margin: 1px .2em 0 0;
|
| 762 |
-
border-bottom-width: 0;
|
| 763 |
-
padding: 0;
|
| 764 |
-
white-space: nowrap;
|
| 765 |
-
}
|
| 766 |
-
.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
|
| 767 |
-
float: left;
|
| 768 |
-
padding: .5em 1em;
|
| 769 |
-
text-decoration: none;
|
| 770 |
-
}
|
| 771 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-active {
|
| 772 |
-
margin-bottom: -1px;
|
| 773 |
-
padding-bottom: 1px;
|
| 774 |
-
}
|
| 775 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,
|
| 776 |
-
.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,
|
| 777 |
-
.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
|
| 778 |
-
cursor: text;
|
| 779 |
-
}
|
| 780 |
-
.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
|
| 781 |
-
cursor: pointer;
|
| 782 |
-
}
|
| 783 |
-
.ui-tabs .ui-tabs-panel {
|
| 784 |
-
display: block;
|
| 785 |
-
border-width: 0;
|
| 786 |
-
padding: 1em 1.4em;
|
| 787 |
-
background: none;
|
| 788 |
-
}
|
| 789 |
-
.ui-tooltip {
|
| 790 |
-
padding: 8px;
|
| 791 |
-
position: absolute;
|
| 792 |
-
z-index: 9999;
|
| 793 |
-
max-width: 300px;
|
| 794 |
-
-webkit-box-shadow: 0 0 5px #aaa;
|
| 795 |
-
box-shadow: 0 0 5px #aaa;
|
| 796 |
-
}
|
| 797 |
-
body .ui-tooltip {
|
| 798 |
-
border-width: 2px;
|
| 799 |
-
}
|
| 800 |
-
|
| 801 |
-
/* Component containers
|
| 802 |
-
----------------------------------*/
|
| 803 |
-
.ui-widget {
|
| 804 |
-
font-family: 'helveticaregular';
|
| 805 |
-
font-size: 1.1em;
|
| 806 |
-
}
|
| 807 |
-
.ui-widget .ui-widget {
|
| 808 |
-
font-size: 1em;
|
| 809 |
-
}
|
| 810 |
-
.ui-widget input,
|
| 811 |
-
.ui-widget select,
|
| 812 |
-
.ui-widget textarea,
|
| 813 |
-
.ui-widget button {
|
| 814 |
-
font-family: 'helveticaregular';
|
| 815 |
-
font-size:17px;
|
| 816 |
-
}
|
| 817 |
-
.ui-widget-content {
|
| 818 |
-
background: #ffffff;
|
| 819 |
-
color: #414951;
|
| 820 |
-
}
|
| 821 |
-
.ui-widget-content a {
|
| 822 |
-
color: #222222;
|
| 823 |
-
}
|
| 824 |
-
.ui-widget-header {
|
| 825 |
-
background: #fff;
|
| 826 |
-
color: #222222;
|
| 827 |
-
}
|
| 828 |
-
.ui-widget-header a {
|
| 829 |
-
color: #222222;
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
/* Interaction states
|
| 833 |
-
----------------------------------*/
|
| 834 |
-
.ui-state-default,
|
| 835 |
-
.ui-widget-content .ui-state-default,
|
| 836 |
-
.ui-widget-header .ui-state-default {
|
| 837 |
-
background: #fff url(../images/arrow.png) right top no-repeat;
|
| 838 |
-
font-weight: normal;
|
| 839 |
-
color: #414951;
|
| 840 |
-
}
|
| 841 |
-
.ui-state-default a,
|
| 842 |
-
.ui-state-default a:link,
|
| 843 |
-
.ui-state-default a:visited {
|
| 844 |
-
color: #555555;
|
| 845 |
-
text-decoration: none;
|
| 846 |
-
}
|
| 847 |
-
.ui-state-hover,
|
| 848 |
-
.ui-widget-content .ui-state-hover,
|
| 849 |
-
.ui-widget-header .ui-state-hover,
|
| 850 |
-
/*.ui-state-focus, */
|
| 851 |
-
.ui-widget-content .ui-state-focus,
|
| 852 |
-
.ui-widget-header .ui-state-focus {
|
| 853 |
-
background: #d22b30 url(../images/arrow.png) right -50px no-repeat;
|
| 854 |
-
font-weight: normal;
|
| 855 |
-
color: #eee;
|
| 856 |
-
}
|
| 857 |
-
.ui-state-hover a,
|
| 858 |
-
.ui-state-hover a:hover,
|
| 859 |
-
.ui-state-hover a:link,
|
| 860 |
-
.ui-state-hover a:visited,
|
| 861 |
-
.ui-state-focus a,
|
| 862 |
-
.ui-state-focus a:hover,
|
| 863 |
-
.ui-state-focus a:link,
|
| 864 |
-
.ui-state-focus a:visited {
|
| 865 |
-
color: #212121;
|
| 866 |
-
text-decoration: none;
|
| 867 |
-
}
|
| 868 |
-
/*.ui-state-active,
|
| 869 |
-
.ui-widget-content .ui-state-active,
|
| 870 |
-
.ui-widget-header .ui-state-active {
|
| 871 |
-
background: #d22b30 url(../images/arrow.png) right -50px no-repeat;
|
| 872 |
-
font-weight: normal;
|
| 873 |
-
color: #fff;
|
| 874 |
-
}*/
|
| 875 |
-
|
| 876 |
-
|
| 877 |
-
.ui-state-active,
|
| 878 |
-
.ui-widget-content .ui-state-active,
|
| 879 |
-
.ui-widget-header .ui-state-active {
|
| 880 |
-
background: #d22b30 url(../images/arrow.png) right -105px no-repeat;
|
| 881 |
-
font-weight: normal;
|
| 882 |
-
color:#eeeeee;
|
| 883 |
-
}
|
| 884 |
-
|
| 885 |
-
|
| 886 |
-
|
| 887 |
-
.ui-state-active a,
|
| 888 |
-
.ui-state-active a:link,
|
| 889 |
-
.ui-state-active a:visited {
|
| 890 |
-
color: #212121;
|
| 891 |
-
text-decoration: none;
|
| 892 |
-
}
|
| 893 |
-
|
| 894 |
-
/* Interaction Cues
|
| 895 |
-
----------------------------------*/
|
| 896 |
-
.ui-state-highlight,
|
| 897 |
-
.ui-widget-content .ui-state-highlight,
|
| 898 |
-
.ui-widget-header .ui-state-highlight {
|
| 899 |
-
border: 1px solid #fcefa1;
|
| 900 |
-
background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;
|
| 901 |
-
color: #363636;
|
| 902 |
-
}
|
| 903 |
-
.ui-state-highlight a,
|
| 904 |
-
.ui-widget-content .ui-state-highlight a,
|
| 905 |
-
.ui-widget-header .ui-state-highlight a {
|
| 906 |
-
color: #363636;
|
| 907 |
-
}
|
| 908 |
-
.ui-state-error,
|
| 909 |
-
.ui-widget-content .ui-state-error,
|
| 910 |
-
.ui-widget-header .ui-state-error {
|
| 911 |
-
border: 1px solid #cd0a0a;
|
| 912 |
-
background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;
|
| 913 |
-
color: #cd0a0a;
|
| 914 |
-
}
|
| 915 |
-
.ui-state-error a,
|
| 916 |
-
.ui-widget-content .ui-state-error a,
|
| 917 |
-
.ui-widget-header .ui-state-error a {
|
| 918 |
-
color: #cd0a0a;
|
| 919 |
-
}
|
| 920 |
-
.ui-state-error-text,
|
| 921 |
-
.ui-widget-content .ui-state-error-text,
|
| 922 |
-
.ui-widget-header .ui-state-error-text {
|
| 923 |
-
color: #cd0a0a;
|
| 924 |
-
}
|
| 925 |
-
.ui-priority-primary,
|
| 926 |
-
.ui-widget-content .ui-priority-primary,
|
| 927 |
-
.ui-widget-header .ui-priority-primary {
|
| 928 |
-
font-weight: bold;
|
| 929 |
-
}
|
| 930 |
-
.ui-priority-secondary,
|
| 931 |
-
.ui-widget-content .ui-priority-secondary,
|
| 932 |
-
.ui-widget-header .ui-priority-secondary {
|
| 933 |
-
opacity: .7;
|
| 934 |
-
filter:Alpha(Opacity=70);
|
| 935 |
-
font-weight: normal;
|
| 936 |
-
}
|
| 937 |
-
.ui-state-disabled,
|
| 938 |
-
.ui-widget-content .ui-state-disabled,
|
| 939 |
-
.ui-widget-header .ui-state-disabled {
|
| 940 |
-
opacity: .35;
|
| 941 |
-
filter:Alpha(Opacity=35);
|
| 942 |
-
background-image: none;
|
| 943 |
-
}
|
| 944 |
-
.ui-state-disabled .ui-icon {
|
| 945 |
-
filter:Alpha(Opacity=35); /* For IE8 - See #6059 */
|
| 946 |
-
}
|
| 947 |
-
|
| 948 |
-
/* Icons
|
| 949 |
-
----------------------------------*/
|
| 950 |
-
|
| 951 |
-
/* states and images */
|
| 952 |
-
.ui-icon {
|
| 953 |
-
width: 16px;
|
| 954 |
-
height: 16px;
|
| 955 |
-
}
|
| 956 |
-
.ui-icon,
|
| 957 |
-
.ui-widget-content .ui-icon {
|
| 958 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 959 |
-
}
|
| 960 |
-
.ui-widget-header .ui-icon {
|
| 961 |
-
background-image: url(images/ui-icons_222222_256x240.png);
|
| 962 |
-
}
|
| 963 |
-
.ui-state-default .ui-icon {
|
| 964 |
-
background-image: url(images/ui-icons_888888_256x240.png);
|
| 965 |
-
}
|
| 966 |
-
.ui-state-hover .ui-icon,
|
| 967 |
-
.ui-state-focus .ui-icon {
|
| 968 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 969 |
-
}
|
| 970 |
-
.ui-state-active .ui-icon {
|
| 971 |
-
background-image: url(images/ui-icons_454545_256x240.png);
|
| 972 |
-
}
|
| 973 |
-
.ui-state-highlight .ui-icon {
|
| 974 |
-
background-image: url(images/ui-icons_2e83ff_256x240.png);
|
| 975 |
-
}
|
| 976 |
-
.ui-state-error .ui-icon,
|
| 977 |
-
.ui-state-error-text .ui-icon {
|
| 978 |
-
background-image: url(images/ui-icons_cd0a0a_256x240.png);
|
| 979 |
-
}
|
| 980 |
-
|
| 981 |
-
/* positioning */
|
| 982 |
-
.ui-icon-blank { background-position: 16px 16px; }
|
| 983 |
-
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 984 |
-
.ui-icon-carat-1-ne { background-position: -16px 0; }
|
| 985 |
-
.ui-icon-carat-1-e { background-position: -32px 0; }
|
| 986 |
-
.ui-icon-carat-1-se { background-position: -48px 0; }
|
| 987 |
-
.ui-icon-carat-1-s { background-position: -64px 0; }
|
| 988 |
-
.ui-icon-carat-1-sw { background-position: -80px 0; }
|
| 989 |
-
.ui-icon-carat-1-w { background-position: -96px 0; }
|
| 990 |
-
.ui-icon-carat-1-nw { background-position: -112px 0; }
|
| 991 |
-
.ui-icon-carat-2-n-s { background-position: -128px 0; }
|
| 992 |
-
.ui-icon-carat-2-e-w { background-position: -144px 0; }
|
| 993 |
-
.ui-icon-triangle-1-n { background-position: 0 -16px; }
|
| 994 |
-
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
|
| 995 |
-
.ui-icon-triangle-1-e { background-position: -32px -16px; }
|
| 996 |
-
.ui-icon-triangle-1-se { background-position: -48px -16px; }
|
| 997 |
-
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
| 998 |
-
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
|
| 999 |
-
.ui-icon-triangle-1-w { background-position: -96px -16px; }
|
| 1000 |
-
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
|
| 1001 |
-
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
|
| 1002 |
-
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
|
| 1003 |
-
.ui-icon-arrow-1-n { background-position: 0 -32px; }
|
| 1004 |
-
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
|
| 1005 |
-
.ui-icon-arrow-1-e { background-position: -32px -32px; }
|
| 1006 |
-
.ui-icon-arrow-1-se { background-position: -48px -32px; }
|
| 1007 |
-
.ui-icon-arrow-1-s { background-position: -64px -32px; }
|
| 1008 |
-
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
|
| 1009 |
-
.ui-icon-arrow-1-w { background-position: -96px -32px; }
|
| 1010 |
-
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
|
| 1011 |
-
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
|
| 1012 |
-
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
|
| 1013 |
-
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
|
| 1014 |
-
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
|
| 1015 |
-
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
|
| 1016 |
-
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
|
| 1017 |
-
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
|
| 1018 |
-
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
|
| 1019 |
-
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
|
| 1020 |
-
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
|
| 1021 |
-
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
|
| 1022 |
-
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
|
| 1023 |
-
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
|
| 1024 |
-
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
|
| 1025 |
-
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
|
| 1026 |
-
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
|
| 1027 |
-
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
|
| 1028 |
-
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
|
| 1029 |
-
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
|
| 1030 |
-
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
|
| 1031 |
-
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
|
| 1032 |
-
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
|
| 1033 |
-
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
|
| 1034 |
-
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
|
| 1035 |
-
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
|
| 1036 |
-
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
|
| 1037 |
-
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
|
| 1038 |
-
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
|
| 1039 |
-
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
|
| 1040 |
-
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
|
| 1041 |
-
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
|
| 1042 |
-
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
|
| 1043 |
-
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
|
| 1044 |
-
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
|
| 1045 |
-
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
|
| 1046 |
-
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
|
| 1047 |
-
.ui-icon-arrow-4 { background-position: 0 -80px; }
|
| 1048 |
-
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
|
| 1049 |
-
.ui-icon-extlink { background-position: -32px -80px; }
|
| 1050 |
-
.ui-icon-newwin { background-position: -48px -80px; }
|
| 1051 |
-
.ui-icon-refresh { background-position: -64px -80px; }
|
| 1052 |
-
.ui-icon-shuffle { background-position: -80px -80px; }
|
| 1053 |
-
.ui-icon-transfer-e-w { background-position: -96px -80px; }
|
| 1054 |
-
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
|
| 1055 |
-
.ui-icon-folder-collapsed { background-position: 0 -96px; }
|
| 1056 |
-
.ui-icon-folder-open { background-position: -16px -96px; }
|
| 1057 |
-
.ui-icon-document { background-position: -32px -96px; }
|
| 1058 |
-
.ui-icon-document-b { background-position: -48px -96px; }
|
| 1059 |
-
.ui-icon-note { background-position: -64px -96px; }
|
| 1060 |
-
.ui-icon-mail-closed { background-position: -80px -96px; }
|
| 1061 |
-
.ui-icon-mail-open { background-position: -96px -96px; }
|
| 1062 |
-
.ui-icon-suitcase { background-position: -112px -96px; }
|
| 1063 |
-
.ui-icon-comment { background-position: -128px -96px; }
|
| 1064 |
-
.ui-icon-person { background-position: -144px -96px; }
|
| 1065 |
-
.ui-icon-print { background-position: -160px -96px; }
|
| 1066 |
-
.ui-icon-trash { background-position: -176px -96px; }
|
| 1067 |
-
.ui-icon-locked { background-position: -192px -96px; }
|
| 1068 |
-
.ui-icon-unlocked { background-position: -208px -96px; }
|
| 1069 |
-
.ui-icon-bookmark { background-position: -224px -96px; }
|
| 1070 |
-
.ui-icon-tag { background-position: -240px -96px; }
|
| 1071 |
-
.ui-icon-home { background-position: 0 -112px; }
|
| 1072 |
-
.ui-icon-flag { background-position: -16px -112px; }
|
| 1073 |
-
.ui-icon-calendar { background-position: -32px -112px; }
|
| 1074 |
-
.ui-icon-cart { background-position: -48px -112px; }
|
| 1075 |
-
.ui-icon-pencil { background-position: -64px -112px; }
|
| 1076 |
-
.ui-icon-clock { background-position: -80px -112px; }
|
| 1077 |
-
.ui-icon-disk { background-position: -96px -112px; }
|
| 1078 |
-
.ui-icon-calculator { background-position: -112px -112px; }
|
| 1079 |
-
.ui-icon-zoomin { background-position: -128px -112px; }
|
| 1080 |
-
.ui-icon-zoomout { background-position: -144px -112px; }
|
| 1081 |
-
.ui-icon-search { background-position: -160px -112px; }
|
| 1082 |
-
.ui-icon-wrench { background-position: -176px -112px; }
|
| 1083 |
-
.ui-icon-gear { background-position: -192px -112px; }
|
| 1084 |
-
.ui-icon-heart { background-position: -208px -112px; }
|
| 1085 |
-
.ui-icon-star { background-position: -224px -112px; }
|
| 1086 |
-
.ui-icon-link { background-position: -240px -112px; }
|
| 1087 |
-
.ui-icon-cancel { background-position: 0 -128px; }
|
| 1088 |
-
.ui-icon-plus { background-position: -16px -128px; }
|
| 1089 |
-
.ui-icon-plusthick { background-position: -32px -128px; }
|
| 1090 |
-
.ui-icon-minus { background-position: -48px -128px; }
|
| 1091 |
-
.ui-icon-minusthick { background-position: -64px -128px; }
|
| 1092 |
-
.ui-icon-close { background-position: -80px -128px; }
|
| 1093 |
-
.ui-icon-closethick { background-position: -96px -128px; }
|
| 1094 |
-
.ui-icon-key { background-position: -112px -128px; }
|
| 1095 |
-
.ui-icon-lightbulb { background-position: -128px -128px; }
|
| 1096 |
-
.ui-icon-scissors { background-position: -144px -128px; }
|
| 1097 |
-
.ui-icon-clipboard { background-position: -160px -128px; }
|
| 1098 |
-
.ui-icon-copy { background-position: -176px -128px; }
|
| 1099 |
-
.ui-icon-contact { background-position: -192px -128px; }
|
| 1100 |
-
.ui-icon-image { background-position: -208px -128px; }
|
| 1101 |
-
.ui-icon-video { background-position: -224px -128px; }
|
| 1102 |
-
.ui-icon-script { background-position: -240px -128px; }
|
| 1103 |
-
.ui-icon-alert { background-position: 0 -144px; }
|
| 1104 |
-
.ui-icon-info { background-position: -16px -144px; }
|
| 1105 |
-
.ui-icon-notice { background-position: -32px -144px; }
|
| 1106 |
-
.ui-icon-help { background-position: -48px -144px; }
|
| 1107 |
-
.ui-icon-check { background-position: -64px -144px; }
|
| 1108 |
-
.ui-icon-bullet { background-position: -80px -144px; }
|
| 1109 |
-
.ui-icon-radio-on { background-position: -96px -144px; }
|
| 1110 |
-
.ui-icon-radio-off { background-position: -112px -144px; }
|
| 1111 |
-
.ui-icon-pin-w { background-position: -128px -144px; }
|
| 1112 |
-
.ui-icon-pin-s { background-position: -144px -144px; }
|
| 1113 |
-
.ui-icon-play { background-position: 0 -160px; }
|
| 1114 |
-
.ui-icon-pause { background-position: -16px -160px; }
|
| 1115 |
-
.ui-icon-seek-next { background-position: -32px -160px; }
|
| 1116 |
-
.ui-icon-seek-prev { background-position: -48px -160px; }
|
| 1117 |
-
.ui-icon-seek-end { background-position: -64px -160px; }
|
| 1118 |
-
.ui-icon-seek-start { background-position: -80px -160px; }
|
| 1119 |
-
/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
|
| 1120 |
-
.ui-icon-seek-first { background-position: -80px -160px; }
|
| 1121 |
-
.ui-icon-stop { background-position: -96px -160px; }
|
| 1122 |
-
.ui-icon-eject { background-position: -112px -160px; }
|
| 1123 |
-
.ui-icon-volume-off { background-position: -128px -160px; }
|
| 1124 |
-
.ui-icon-volume-on { background-position: -144px -160px; }
|
| 1125 |
-
.ui-icon-power { background-position: 0 -176px; }
|
| 1126 |
-
.ui-icon-signal-diag { background-position: -16px -176px; }
|
| 1127 |
-
.ui-icon-signal { background-position: -32px -176px; }
|
| 1128 |
-
.ui-icon-battery-0 { background-position: -48px -176px; }
|
| 1129 |
-
.ui-icon-battery-1 { background-position: -64px -176px; }
|
| 1130 |
-
.ui-icon-battery-2 { background-position: -80px -176px; }
|
| 1131 |
-
.ui-icon-battery-3 { background-position: -96px -176px; }
|
| 1132 |
-
.ui-icon-circle-plus { background-position: 0 -192px; }
|
| 1133 |
-
.ui-icon-circle-minus { background-position: -16px -192px; }
|
| 1134 |
-
.ui-icon-circle-close { background-position: -32px -192px; }
|
| 1135 |
-
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
|
| 1136 |
-
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
|
| 1137 |
-
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
|
| 1138 |
-
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
|
| 1139 |
-
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
|
| 1140 |
-
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
|
| 1141 |
-
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
|
| 1142 |
-
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
|
| 1143 |
-
.ui-icon-circle-zoomin { background-position: -176px -192px; }
|
| 1144 |
-
.ui-icon-circle-zoomout { background-position: -192px -192px; }
|
| 1145 |
-
.ui-icon-circle-check { background-position: -208px -192px; }
|
| 1146 |
-
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
|
| 1147 |
-
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
|
| 1148 |
-
.ui-icon-circlesmall-close { background-position: -32px -208px; }
|
| 1149 |
-
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
|
| 1150 |
-
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
|
| 1151 |
-
.ui-icon-squaresmall-close { background-position: -80px -208px; }
|
| 1152 |
-
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
|
| 1153 |
-
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
|
| 1154 |
-
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
|
| 1155 |
-
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
|
| 1156 |
-
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
| 1157 |
-
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
| 1158 |
-
|
| 1159 |
-
|
| 1160 |
-
/* Misc visuals
|
| 1161 |
-
----------------------------------*/
|
| 1162 |
-
|
| 1163 |
-
/* Corner radius */
|
| 1164 |
-
.ui-corner-all,
|
| 1165 |
-
.ui-corner-top,
|
| 1166 |
-
.ui-corner-left,
|
| 1167 |
-
.ui-corner-tl {
|
| 1168 |
-
border-top-left-radius: 0px;
|
| 1169 |
-
}
|
| 1170 |
-
.ui-corner-all,
|
| 1171 |
-
.ui-corner-top,
|
| 1172 |
-
.ui-corner-right,
|
| 1173 |
-
.ui-corner-tr {
|
| 1174 |
-
border-top-right-radius: 0px;
|
| 1175 |
-
}
|
| 1176 |
-
.ui-corner-all,
|
| 1177 |
-
.ui-corner-bottom,
|
| 1178 |
-
.ui-corner-left,
|
| 1179 |
-
.ui-corner-bl {
|
| 1180 |
-
border-bottom-left-radius: 0px;
|
| 1181 |
-
}
|
| 1182 |
-
.ui-corner-all,
|
| 1183 |
-
.ui-corner-bottom,
|
| 1184 |
-
.ui-corner-right,
|
| 1185 |
-
.ui-corner-br {
|
| 1186 |
-
border-bottom-right-radius: 0px;
|
| 1187 |
-
}
|
| 1188 |
-
|
| 1189 |
-
|
| 1190 |
-
|
| 1191 |
-
|
| 1192 |
-
#accordion h3 span,#accordion1 h3 span{ position: absolute; left:0px; top:0px; width:50px; height:49px; background:#31373d; line-height:50px; text-align: center; font-family: 'helveticaregular'; font-size:20px; color:#FFF;}
|
| 1193 |
-
|
| 1194 |
-
#accordion h3:hover span, #accordion1 h3:hover span{ background:#b8262a; color:#eee;}
|
| 1195 |
-
#accordion h3.ui-state-active span, #accordion1 h3.ui-state-active span{ background:#b8262a; color:#eee;}
|
| 1 |
+
|
| 2 |
+
/*! jQuery UI - v1.10.4 - 2014-01-17
|
| 3 |
+
* http://jqueryui.com
|
| 4 |
+
* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css, jquery.ui.theme.css
|
| 5 |
+
* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
|
| 6 |
+
* Copyright 2014 jQuery Foundation and other contributors; Licensed MIT */
|
| 7 |
+
|
| 8 |
+
/* Layout helpers
|
| 9 |
+
----------------------------------*/
|
| 10 |
+
|
| 11 |
+
@font-face {
|
| 12 |
+
font-family: 'helveticaregular';
|
| 13 |
+
src: url('../fonts/helvetica_0-webfont.eot');
|
| 14 |
+
src: url('../fonts/helvetica_0-webfont.eot?#iefix') format('embedded-opentype'),
|
| 15 |
+
url('../fonts/helvetica_0-webfont.woff') format('woff'),
|
| 16 |
+
url('../fonts/helvetica_0-webfont.ttf') format('truetype'),
|
| 17 |
+
url('../fonts/helvetica_0-webfont.svg#helveticaregular') format('svg');
|
| 18 |
+
font-weight: normal;
|
| 19 |
+
font-style: normal;
|
| 20 |
+
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
.ui-helper-hidden {
|
| 25 |
+
display: none;
|
| 26 |
+
}
|
| 27 |
+
.ui-helper-hidden-accessible {
|
| 28 |
+
border: 0;
|
| 29 |
+
clip: rect(0 0 0 0);
|
| 30 |
+
height: 1px;
|
| 31 |
+
margin: -1px;
|
| 32 |
+
overflow: hidden;
|
| 33 |
+
padding: 0;
|
| 34 |
+
position: absolute;
|
| 35 |
+
width: 1px;
|
| 36 |
+
}
|
| 37 |
+
.ui-helper-reset {
|
| 38 |
+
margin: 0;
|
| 39 |
+
padding: 0;
|
| 40 |
+
border: 0;
|
| 41 |
+
outline: 0;
|
| 42 |
+
line-height: 1.3;
|
| 43 |
+
text-decoration: none;
|
| 44 |
+
font-size: 100%;
|
| 45 |
+
list-style: none;
|
| 46 |
+
}
|
| 47 |
+
.ui-helper-clearfix:before,
|
| 48 |
+
.ui-helper-clearfix:after {
|
| 49 |
+
content: "";
|
| 50 |
+
display: table;
|
| 51 |
+
border-collapse: collapse;
|
| 52 |
+
}
|
| 53 |
+
.ui-helper-clearfix:after {
|
| 54 |
+
clear: both;
|
| 55 |
+
}
|
| 56 |
+
.ui-helper-clearfix {
|
| 57 |
+
min-height: 0; /* support: IE7 */
|
| 58 |
+
}
|
| 59 |
+
.ui-helper-zfix {
|
| 60 |
+
width: 100%;
|
| 61 |
+
height: 100%;
|
| 62 |
+
top: 0;
|
| 63 |
+
left: 0;
|
| 64 |
+
position: absolute;
|
| 65 |
+
opacity: 0;
|
| 66 |
+
filter:Alpha(Opacity=0);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.ui-front {
|
| 70 |
+
z-index: 100;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
|
| 74 |
+
/* Interaction Cues
|
| 75 |
+
----------------------------------*/
|
| 76 |
+
.ui-state-disabled {
|
| 77 |
+
cursor: default !important;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
|
| 81 |
+
/* Icons
|
| 82 |
+
----------------------------------*/
|
| 83 |
+
|
| 84 |
+
/* states and images */
|
| 85 |
+
.ui-icon {
|
| 86 |
+
display: block;
|
| 87 |
+
text-indent: -99999px;
|
| 88 |
+
overflow: hidden;
|
| 89 |
+
background-repeat: no-repeat;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
/* Misc visuals
|
| 94 |
+
----------------------------------*/
|
| 95 |
+
|
| 96 |
+
/* Overlays */
|
| 97 |
+
.ui-widget-overlay {
|
| 98 |
+
position: fixed;
|
| 99 |
+
top: 0;
|
| 100 |
+
left: 0;
|
| 101 |
+
width: 100%;
|
| 102 |
+
height: 100%;
|
| 103 |
+
}
|
| 104 |
+
.ui-accordion .ui-accordion-header {
|
| 105 |
+
display: block;
|
| 106 |
+
cursor: pointer;
|
| 107 |
+
position: relative;
|
| 108 |
+
margin-top: 10px;
|
| 109 |
+
padding: .6em .5em;
|
| 110 |
+
min-height: 0; /* support: IE7 */
|
| 111 |
+
font-size:20px;
|
| 112 |
+
font-weight:normal;
|
| 113 |
+
}
|
| 114 |
+
.ui-accordion .ui-accordion-icons {
|
| 115 |
+
padding-left: 62px;
|
| 116 |
+
padding-right: 40px;
|
| 117 |
+
}
|
| 118 |
+
.ui-accordion .ui-accordion-noicons {
|
| 119 |
+
padding-left: .7em;
|
| 120 |
+
}
|
| 121 |
+
.ui-accordion .ui-accordion-icons .ui-accordion-icons {
|
| 122 |
+
padding-left: 2.2em;
|
| 123 |
+
}
|
| 124 |
+
.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
|
| 125 |
+
position: absolute;
|
| 126 |
+
left: .5em;
|
| 127 |
+
top: 50%;
|
| 128 |
+
margin-top: -8px;
|
| 129 |
+
display:none;
|
| 130 |
+
}
|
| 131 |
+
.ui-accordion .ui-accordion-content {
|
| 132 |
+
padding:1.6em 2em 1.4em 2em;
|
| 133 |
+
border-top: 0;
|
| 134 |
+
}
|
| 135 |
+
.ui-autocomplete {
|
| 136 |
+
position: absolute;
|
| 137 |
+
top: 0;
|
| 138 |
+
left: 0;
|
| 139 |
+
cursor: default;
|
| 140 |
+
}
|
| 141 |
+
.ui-button {
|
| 142 |
+
display: inline-block;
|
| 143 |
+
position: relative;
|
| 144 |
+
padding: 0;
|
| 145 |
+
line-height: normal;
|
| 146 |
+
margin-right: .1em;
|
| 147 |
+
cursor: pointer;
|
| 148 |
+
vertical-align: middle;
|
| 149 |
+
text-align: center;
|
| 150 |
+
overflow: visible; /* removes extra width in IE */
|
| 151 |
+
}
|
| 152 |
+
.ui-button,
|
| 153 |
+
.ui-button:link,
|
| 154 |
+
.ui-button:visited,
|
| 155 |
+
.ui-button:hover,
|
| 156 |
+
.ui-button:active {
|
| 157 |
+
text-decoration: none;
|
| 158 |
+
}
|
| 159 |
+
/* to make room for the icon, a width needs to be set here */
|
| 160 |
+
.ui-button-icon-only {
|
| 161 |
+
width: 2.2em;
|
| 162 |
+
}
|
| 163 |
+
/* button elements seem to need a little more width */
|
| 164 |
+
button.ui-button-icon-only {
|
| 165 |
+
width: 2.4em;
|
| 166 |
+
}
|
| 167 |
+
.ui-button-icons-only {
|
| 168 |
+
width: 3.4em;
|
| 169 |
+
}
|
| 170 |
+
button.ui-button-icons-only {
|
| 171 |
+
width: 3.7em;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
/* button text element */
|
| 175 |
+
.ui-button .ui-button-text {
|
| 176 |
+
display: block;
|
| 177 |
+
line-height: normal;
|
| 178 |
+
}
|
| 179 |
+
.ui-button-text-only .ui-button-text {
|
| 180 |
+
padding: .4em 1em;
|
| 181 |
+
}
|
| 182 |
+
.ui-button-icon-only .ui-button-text,
|
| 183 |
+
.ui-button-icons-only .ui-button-text {
|
| 184 |
+
padding: .4em;
|
| 185 |
+
text-indent: -9999999px;
|
| 186 |
+
}
|
| 187 |
+
.ui-button-text-icon-primary .ui-button-text,
|
| 188 |
+
.ui-button-text-icons .ui-button-text {
|
| 189 |
+
padding: .4em 1em .4em 2.1em;
|
| 190 |
+
}
|
| 191 |
+
.ui-button-text-icon-secondary .ui-button-text,
|
| 192 |
+
.ui-button-text-icons .ui-button-text {
|
| 193 |
+
padding: .4em 2.1em .4em 1em;
|
| 194 |
+
}
|
| 195 |
+
.ui-button-text-icons .ui-button-text {
|
| 196 |
+
padding-left: 2.1em;
|
| 197 |
+
padding-right: 2.1em;
|
| 198 |
+
}
|
| 199 |
+
/* no icon support for input elements, provide padding by default */
|
| 200 |
+
input.ui-button {
|
| 201 |
+
padding: .4em 1em;
|
| 202 |
+
}
|
| 203 |
+
|
| 204 |
+
/* button icon element(s) */
|
| 205 |
+
.ui-button-icon-only .ui-icon,
|
| 206 |
+
.ui-button-text-icon-primary .ui-icon,
|
| 207 |
+
.ui-button-text-icon-secondary .ui-icon,
|
| 208 |
+
.ui-button-text-icons .ui-icon,
|
| 209 |
+
.ui-button-icons-only .ui-icon {
|
| 210 |
+
position: absolute;
|
| 211 |
+
top: 50%;
|
| 212 |
+
margin-top: -8px;
|
| 213 |
+
}
|
| 214 |
+
.ui-button-icon-only .ui-icon {
|
| 215 |
+
left: 50%;
|
| 216 |
+
margin-left: -8px;
|
| 217 |
+
}
|
| 218 |
+
.ui-button-text-icon-primary .ui-button-icon-primary,
|
| 219 |
+
.ui-button-text-icons .ui-button-icon-primary,
|
| 220 |
+
.ui-button-icons-only .ui-button-icon-primary {
|
| 221 |
+
left: .5em;
|
| 222 |
+
}
|
| 223 |
+
.ui-button-text-icon-secondary .ui-button-icon-secondary,
|
| 224 |
+
.ui-button-text-icons .ui-button-icon-secondary,
|
| 225 |
+
.ui-button-icons-only .ui-button-icon-secondary {
|
| 226 |
+
right: .5em;
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
/* button sets */
|
| 230 |
+
.ui-buttonset {
|
| 231 |
+
margin-right: 7px;
|
| 232 |
+
}
|
| 233 |
+
.ui-buttonset .ui-button {
|
| 234 |
+
margin-left: 0;
|
| 235 |
+
margin-right: -.3em;
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
/* workarounds */
|
| 239 |
+
/* reset extra padding in Firefox, see h5bp.com/l */
|
| 240 |
+
input.ui-button::-moz-focus-inner,
|
| 241 |
+
button.ui-button::-moz-focus-inner {
|
| 242 |
+
border: 0;
|
| 243 |
+
padding: 0;
|
| 244 |
+
}
|
| 245 |
+
.ui-datepicker {
|
| 246 |
+
width: 17em;
|
| 247 |
+
padding: .2em .2em 0;
|
| 248 |
+
display: none;
|
| 249 |
+
}
|
| 250 |
+
.ui-datepicker .ui-datepicker-header {
|
| 251 |
+
position: relative;
|
| 252 |
+
padding: .2em 0;
|
| 253 |
+
}
|
| 254 |
+
.ui-datepicker .ui-datepicker-prev,
|
| 255 |
+
.ui-datepicker .ui-datepicker-next {
|
| 256 |
+
position: absolute;
|
| 257 |
+
top: 2px;
|
| 258 |
+
width: 1.8em;
|
| 259 |
+
height: 1.8em;
|
| 260 |
+
}
|
| 261 |
+
.ui-datepicker .ui-datepicker-prev-hover,
|
| 262 |
+
.ui-datepicker .ui-datepicker-next-hover {
|
| 263 |
+
top: 1px;
|
| 264 |
+
}
|
| 265 |
+
.ui-datepicker .ui-datepicker-prev {
|
| 266 |
+
left: 2px;
|
| 267 |
+
}
|
| 268 |
+
.ui-datepicker .ui-datepicker-next {
|
| 269 |
+
right: 2px;
|
| 270 |
+
}
|
| 271 |
+
.ui-datepicker .ui-datepicker-prev-hover {
|
| 272 |
+
left: 1px;
|
| 273 |
+
}
|
| 274 |
+
.ui-datepicker .ui-datepicker-next-hover {
|
| 275 |
+
right: 1px;
|
| 276 |
+
}
|
| 277 |
+
.ui-datepicker .ui-datepicker-prev span,
|
| 278 |
+
.ui-datepicker .ui-datepicker-next span {
|
| 279 |
+
display: block;
|
| 280 |
+
position: absolute;
|
| 281 |
+
left: 50%;
|
| 282 |
+
margin-left: -8px;
|
| 283 |
+
top: 50%;
|
| 284 |
+
margin-top: -8px;
|
| 285 |
+
}
|
| 286 |
+
.ui-datepicker .ui-datepicker-title {
|
| 287 |
+
margin: 0 2.3em;
|
| 288 |
+
line-height: 1.8em;
|
| 289 |
+
text-align: center;
|
| 290 |
+
}
|
| 291 |
+
.ui-datepicker .ui-datepicker-title select {
|
| 292 |
+
font-size: 1em;
|
| 293 |
+
margin: 1px 0;
|
| 294 |
+
}
|
| 295 |
+
.ui-datepicker select.ui-datepicker-month,
|
| 296 |
+
.ui-datepicker select.ui-datepicker-year {
|
| 297 |
+
width: 49%;
|
| 298 |
+
}
|
| 299 |
+
.ui-datepicker table {
|
| 300 |
+
width: 100%;
|
| 301 |
+
font-size: .9em;
|
| 302 |
+
border-collapse: collapse;
|
| 303 |
+
margin: 0 0 .4em;
|
| 304 |
+
}
|
| 305 |
+
.ui-datepicker th {
|
| 306 |
+
padding: .7em .3em;
|
| 307 |
+
text-align: center;
|
| 308 |
+
font-weight: bold;
|
| 309 |
+
border: 0;
|
| 310 |
+
}
|
| 311 |
+
.ui-datepicker td {
|
| 312 |
+
border: 0;
|
| 313 |
+
padding: 1px;
|
| 314 |
+
}
|
| 315 |
+
.ui-datepicker td span,
|
| 316 |
+
.ui-datepicker td a {
|
| 317 |
+
display: block;
|
| 318 |
+
padding: .2em;
|
| 319 |
+
text-align: right;
|
| 320 |
+
text-decoration: none;
|
| 321 |
+
}
|
| 322 |
+
.ui-datepicker .ui-datepicker-buttonpane {
|
| 323 |
+
background-image: none;
|
| 324 |
+
margin: .7em 0 0 0;
|
| 325 |
+
padding: 0 .2em;
|
| 326 |
+
border-left: 0;
|
| 327 |
+
border-right: 0;
|
| 328 |
+
border-bottom: 0;
|
| 329 |
+
}
|
| 330 |
+
.ui-datepicker .ui-datepicker-buttonpane button {
|
| 331 |
+
float: right;
|
| 332 |
+
margin: .5em .2em .4em;
|
| 333 |
+
cursor: pointer;
|
| 334 |
+
padding: .2em .6em .3em .6em;
|
| 335 |
+
width: auto;
|
| 336 |
+
overflow: visible;
|
| 337 |
+
}
|
| 338 |
+
.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
|
| 339 |
+
float: left;
|
| 340 |
+
}
|
| 341 |
+
|
| 342 |
+
/* with multiple calendars */
|
| 343 |
+
.ui-datepicker.ui-datepicker-multi {
|
| 344 |
+
width: auto;
|
| 345 |
+
}
|
| 346 |
+
.ui-datepicker-multi .ui-datepicker-group {
|
| 347 |
+
float: left;
|
| 348 |
+
}
|
| 349 |
+
.ui-datepicker-multi .ui-datepicker-group table {
|
| 350 |
+
width: 95%;
|
| 351 |
+
margin: 0 auto .4em;
|
| 352 |
+
}
|
| 353 |
+
.ui-datepicker-multi-2 .ui-datepicker-group {
|
| 354 |
+
width: 50%;
|
| 355 |
+
}
|
| 356 |
+
.ui-datepicker-multi-3 .ui-datepicker-group {
|
| 357 |
+
width: 33.3%;
|
| 358 |
+
}
|
| 359 |
+
.ui-datepicker-multi-4 .ui-datepicker-group {
|
| 360 |
+
width: 25%;
|
| 361 |
+
}
|
| 362 |
+
.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
|
| 363 |
+
.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
|
| 364 |
+
border-left-width: 0;
|
| 365 |
+
}
|
| 366 |
+
.ui-datepicker-multi .ui-datepicker-buttonpane {
|
| 367 |
+
clear: left;
|
| 368 |
+
}
|
| 369 |
+
.ui-datepicker-row-break {
|
| 370 |
+
clear: both;
|
| 371 |
+
width: 100%;
|
| 372 |
+
font-size: 0;
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
/* RTL support */
|
| 376 |
+
.ui-datepicker-rtl {
|
| 377 |
+
direction: rtl;
|
| 378 |
+
}
|
| 379 |
+
.ui-datepicker-rtl .ui-datepicker-prev {
|
| 380 |
+
right: 2px;
|
| 381 |
+
left: auto;
|
| 382 |
+
}
|
| 383 |
+
.ui-datepicker-rtl .ui-datepicker-next {
|
| 384 |
+
left: 2px;
|
| 385 |
+
right: auto;
|
| 386 |
+
}
|
| 387 |
+
.ui-datepicker-rtl .ui-datepicker-prev:hover {
|
| 388 |
+
right: 1px;
|
| 389 |
+
left: auto;
|
| 390 |
+
}
|
| 391 |
+
.ui-datepicker-rtl .ui-datepicker-next:hover {
|
| 392 |
+
left: 1px;
|
| 393 |
+
right: auto;
|
| 394 |
+
}
|
| 395 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane {
|
| 396 |
+
clear: right;
|
| 397 |
+
}
|
| 398 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane button {
|
| 399 |
+
float: left;
|
| 400 |
+
}
|
| 401 |
+
.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
|
| 402 |
+
.ui-datepicker-rtl .ui-datepicker-group {
|
| 403 |
+
float: right;
|
| 404 |
+
}
|
| 405 |
+
.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
|
| 406 |
+
.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
|
| 407 |
+
border-right-width: 0;
|
| 408 |
+
border-left-width: 1px;
|
| 409 |
+
}
|
| 410 |
+
.ui-dialog {
|
| 411 |
+
overflow: hidden;
|
| 412 |
+
position: absolute;
|
| 413 |
+
top: 0;
|
| 414 |
+
left: 0;
|
| 415 |
+
padding: .2em;
|
| 416 |
+
outline: 0;
|
| 417 |
+
}
|
| 418 |
+
.ui-dialog .ui-dialog-titlebar {
|
| 419 |
+
padding: .4em 1em;
|
| 420 |
+
position: relative;
|
| 421 |
+
}
|
| 422 |
+
.ui-dialog .ui-dialog-title {
|
| 423 |
+
float: left;
|
| 424 |
+
margin: .1em 0;
|
| 425 |
+
white-space: nowrap;
|
| 426 |
+
width: 90%;
|
| 427 |
+
overflow: hidden;
|
| 428 |
+
text-overflow: ellipsis;
|
| 429 |
+
}
|
| 430 |
+
.ui-dialog .ui-dialog-titlebar-close {
|
| 431 |
+
position: absolute;
|
| 432 |
+
right: .3em;
|
| 433 |
+
top: 50%;
|
| 434 |
+
width: 20px;
|
| 435 |
+
margin: -10px 0 0 0;
|
| 436 |
+
padding: 1px;
|
| 437 |
+
height: 20px;
|
| 438 |
+
}
|
| 439 |
+
.ui-dialog .ui-dialog-content {
|
| 440 |
+
position: relative;
|
| 441 |
+
border: 0;
|
| 442 |
+
padding: .5em 1em;
|
| 443 |
+
background: none;
|
| 444 |
+
overflow: auto;
|
| 445 |
+
}
|
| 446 |
+
.ui-dialog .ui-dialog-buttonpane {
|
| 447 |
+
text-align: left;
|
| 448 |
+
border-width: 1px 0 0 0;
|
| 449 |
+
background-image: none;
|
| 450 |
+
margin-top: .5em;
|
| 451 |
+
padding: .3em 1em .5em .4em;
|
| 452 |
+
}
|
| 453 |
+
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
|
| 454 |
+
float: right;
|
| 455 |
+
}
|
| 456 |
+
.ui-dialog .ui-dialog-buttonpane button {
|
| 457 |
+
margin: .5em .4em .5em 0;
|
| 458 |
+
cursor: pointer;
|
| 459 |
+
}
|
| 460 |
+
.ui-dialog .ui-resizable-se {
|
| 461 |
+
width: 12px;
|
| 462 |
+
height: 12px;
|
| 463 |
+
right: -5px;
|
| 464 |
+
bottom: -5px;
|
| 465 |
+
background-position: 16px 16px;
|
| 466 |
+
}
|
| 467 |
+
.ui-draggable .ui-dialog-titlebar {
|
| 468 |
+
cursor: move;
|
| 469 |
+
}
|
| 470 |
+
.ui-menu {
|
| 471 |
+
list-style: none;
|
| 472 |
+
padding: 2px;
|
| 473 |
+
margin: 0;
|
| 474 |
+
display: block;
|
| 475 |
+
outline: none;
|
| 476 |
+
}
|
| 477 |
+
.ui-menu .ui-menu {
|
| 478 |
+
margin-top: -3px;
|
| 479 |
+
position: absolute;
|
| 480 |
+
}
|
| 481 |
+
.ui-menu .ui-menu-item {
|
| 482 |
+
margin: 0;
|
| 483 |
+
padding: 0;
|
| 484 |
+
width: 100%;
|
| 485 |
+
/* support: IE10, see #8844 */
|
| 486 |
+
list-style-image: url(data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7);
|
| 487 |
+
}
|
| 488 |
+
.ui-menu .ui-menu-divider {
|
| 489 |
+
margin: 5px -2px 5px -2px;
|
| 490 |
+
height: 0;
|
| 491 |
+
font-size: 0;
|
| 492 |
+
line-height: 0;
|
| 493 |
+
border-width: 1px 0 0 0;
|
| 494 |
+
}
|
| 495 |
+
.ui-menu .ui-menu-item a {
|
| 496 |
+
text-decoration: none;
|
| 497 |
+
display: block;
|
| 498 |
+
padding: 2px .4em;
|
| 499 |
+
line-height: 1.5;
|
| 500 |
+
min-height: 0; /* support: IE7 */
|
| 501 |
+
font-weight: normal;
|
| 502 |
+
}
|
| 503 |
+
.ui-menu .ui-menu-item a.ui-state-focus,
|
| 504 |
+
.ui-menu .ui-menu-item a.ui-state-active {
|
| 505 |
+
font-weight: normal;
|
| 506 |
+
margin: -1px;
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
.ui-menu .ui-state-disabled {
|
| 510 |
+
font-weight: normal;
|
| 511 |
+
margin: .4em 0 .2em;
|
| 512 |
+
line-height: 1.5;
|
| 513 |
+
}
|
| 514 |
+
.ui-menu .ui-state-disabled a {
|
| 515 |
+
cursor: default;
|
| 516 |
+
}
|
| 517 |
+
|
| 518 |
+
/* icon support */
|
| 519 |
+
.ui-menu-icons {
|
| 520 |
+
position: relative;
|
| 521 |
+
}
|
| 522 |
+
.ui-menu-icons .ui-menu-item a {
|
| 523 |
+
position: relative;
|
| 524 |
+
padding-left: 2em;
|
| 525 |
+
}
|
| 526 |
+
|
| 527 |
+
/* left-aligned */
|
| 528 |
+
.ui-menu .ui-icon {
|
| 529 |
+
position: absolute;
|
| 530 |
+
top: .2em;
|
| 531 |
+
left: .2em;
|
| 532 |
+
}
|
| 533 |
+
|
| 534 |
+
/* right-aligned */
|
| 535 |
+
.ui-menu .ui-menu-icon {
|
| 536 |
+
position: static;
|
| 537 |
+
float: right;
|
| 538 |
+
}
|
| 539 |
+
.ui-progressbar {
|
| 540 |
+
height: 2em;
|
| 541 |
+
text-align: left;
|
| 542 |
+
overflow: hidden;
|
| 543 |
+
}
|
| 544 |
+
.ui-progressbar .ui-progressbar-value {
|
| 545 |
+
margin: -1px;
|
| 546 |
+
height: 100%;
|
| 547 |
+
}
|
| 548 |
+
.ui-progressbar .ui-progressbar-overlay {
|
| 549 |
+
background: url("images/animated-overlay.gif");
|
| 550 |
+
height: 100%;
|
| 551 |
+
filter: alpha(opacity=25);
|
| 552 |
+
opacity: 0.25;
|
| 553 |
+
}
|
| 554 |
+
.ui-progressbar-indeterminate .ui-progressbar-value {
|
| 555 |
+
background-image: none;
|
| 556 |
+
}
|
| 557 |
+
.ui-resizable {
|
| 558 |
+
position: relative;
|
| 559 |
+
}
|
| 560 |
+
.ui-resizable-handle {
|
| 561 |
+
position: absolute;
|
| 562 |
+
font-size: 0.1px;
|
| 563 |
+
display: block;
|
| 564 |
+
}
|
| 565 |
+
.ui-resizable-disabled .ui-resizable-handle,
|
| 566 |
+
.ui-resizable-autohide .ui-resizable-handle {
|
| 567 |
+
display: none;
|
| 568 |
+
}
|
| 569 |
+
.ui-resizable-n {
|
| 570 |
+
cursor: n-resize;
|
| 571 |
+
height: 7px;
|
| 572 |
+
width: 100%;
|
| 573 |
+
top: -5px;
|
| 574 |
+
left: 0;
|
| 575 |
+
}
|
| 576 |
+
.ui-resizable-s {
|
| 577 |
+
cursor: s-resize;
|
| 578 |
+
height: 7px;
|
| 579 |
+
width: 100%;
|
| 580 |
+
bottom: -5px;
|
| 581 |
+
left: 0;
|
| 582 |
+
}
|
| 583 |
+
.ui-resizable-e {
|
| 584 |
+
cursor: e-resize;
|
| 585 |
+
width: 7px;
|
| 586 |
+
right: -5px;
|
| 587 |
+
top: 0;
|
| 588 |
+
height: 100%;
|
| 589 |
+
}
|
| 590 |
+
.ui-resizable-w {
|
| 591 |
+
cursor: w-resize;
|
| 592 |
+
width: 7px;
|
| 593 |
+
left: -5px;
|
| 594 |
+
top: 0;
|
| 595 |
+
height: 100%;
|
| 596 |
+
}
|
| 597 |
+
.ui-resizable-se {
|
| 598 |
+
cursor: se-resize;
|
| 599 |
+
width: 12px;
|
| 600 |
+
height: 12px;
|
| 601 |
+
right: 1px;
|
| 602 |
+
bottom: 1px;
|
| 603 |
+
}
|
| 604 |
+
.ui-resizable-sw {
|
| 605 |
+
cursor: sw-resize;
|
| 606 |
+
width: 9px;
|
| 607 |
+
height: 9px;
|
| 608 |
+
left: -5px;
|
| 609 |
+
bottom: -5px;
|
| 610 |
+
}
|
| 611 |
+
.ui-resizable-nw {
|
| 612 |
+
cursor: nw-resize;
|
| 613 |
+
width: 9px;
|
| 614 |
+
height: 9px;
|
| 615 |
+
left: -5px;
|
| 616 |
+
top: -5px;
|
| 617 |
+
}
|
| 618 |
+
.ui-resizable-ne {
|
| 619 |
+
cursor: ne-resize;
|
| 620 |
+
width: 9px;
|
| 621 |
+
height: 9px;
|
| 622 |
+
right: -5px;
|
| 623 |
+
top: -5px;
|
| 624 |
+
}
|
| 625 |
+
.ui-selectable-helper {
|
| 626 |
+
position: absolute;
|
| 627 |
+
z-index: 100;
|
| 628 |
+
border: 1px dotted black;
|
| 629 |
+
}
|
| 630 |
+
.ui-slider {
|
| 631 |
+
position: relative;
|
| 632 |
+
text-align: left;
|
| 633 |
+
}
|
| 634 |
+
.ui-slider .ui-slider-handle {
|
| 635 |
+
position: absolute;
|
| 636 |
+
z-index: 2;
|
| 637 |
+
width: 1.2em;
|
| 638 |
+
height: 1.2em;
|
| 639 |
+
cursor: default;
|
| 640 |
+
}
|
| 641 |
+
.ui-slider .ui-slider-range {
|
| 642 |
+
position: absolute;
|
| 643 |
+
z-index: 1;
|
| 644 |
+
font-size: .7em;
|
| 645 |
+
display: block;
|
| 646 |
+
border: 0;
|
| 647 |
+
background-position: 0 0;
|
| 648 |
+
}
|
| 649 |
+
|
| 650 |
+
/* For IE8 - See #6727 */
|
| 651 |
+
.ui-slider.ui-state-disabled .ui-slider-handle,
|
| 652 |
+
.ui-slider.ui-state-disabled .ui-slider-range {
|
| 653 |
+
filter: inherit;
|
| 654 |
+
}
|
| 655 |
+
|
| 656 |
+
.ui-slider-horizontal {
|
| 657 |
+
height: .8em;
|
| 658 |
+
}
|
| 659 |
+
.ui-slider-horizontal .ui-slider-handle {
|
| 660 |
+
top: -.3em;
|
| 661 |
+
margin-left: -.6em;
|
| 662 |
+
}
|
| 663 |
+
.ui-slider-horizontal .ui-slider-range {
|
| 664 |
+
top: 0;
|
| 665 |
+
height: 100%;
|
| 666 |
+
}
|
| 667 |
+
.ui-slider-horizontal .ui-slider-range-min {
|
| 668 |
+
left: 0;
|
| 669 |
+
}
|
| 670 |
+
.ui-slider-horizontal .ui-slider-range-max {
|
| 671 |
+
right: 0;
|
| 672 |
+
}
|
| 673 |
+
|
| 674 |
+
.ui-slider-vertical {
|
| 675 |
+
width: .8em;
|
| 676 |
+
height: 100px;
|
| 677 |
+
}
|
| 678 |
+
.ui-slider-vertical .ui-slider-handle {
|
| 679 |
+
left: -.3em;
|
| 680 |
+
margin-left: 0;
|
| 681 |
+
margin-bottom: -.6em;
|
| 682 |
+
}
|
| 683 |
+
.ui-slider-vertical .ui-slider-range {
|
| 684 |
+
left: 0;
|
| 685 |
+
width: 100%;
|
| 686 |
+
}
|
| 687 |
+
.ui-slider-vertical .ui-slider-range-min {
|
| 688 |
+
bottom: 0;
|
| 689 |
+
}
|
| 690 |
+
.ui-slider-vertical .ui-slider-range-max {
|
| 691 |
+
top: 0;
|
| 692 |
+
}
|
| 693 |
+
.ui-spinner {
|
| 694 |
+
position: relative;
|
| 695 |
+
display: inline-block;
|
| 696 |
+
overflow: hidden;
|
| 697 |
+
padding: 0;
|
| 698 |
+
vertical-align: middle;
|
| 699 |
+
}
|
| 700 |
+
.ui-spinner-input {
|
| 701 |
+
border: none;
|
| 702 |
+
background: none;
|
| 703 |
+
color: inherit;
|
| 704 |
+
padding: 0;
|
| 705 |
+
margin: .2em 0;
|
| 706 |
+
vertical-align: middle;
|
| 707 |
+
margin-left: .4em;
|
| 708 |
+
margin-right: 22px;
|
| 709 |
+
}
|
| 710 |
+
.ui-spinner-button {
|
| 711 |
+
width: 16px;
|
| 712 |
+
height: 50%;
|
| 713 |
+
font-size: .5em;
|
| 714 |
+
padding: 0;
|
| 715 |
+
margin: 0;
|
| 716 |
+
text-align: center;
|
| 717 |
+
position: absolute;
|
| 718 |
+
cursor: default;
|
| 719 |
+
display: block;
|
| 720 |
+
overflow: hidden;
|
| 721 |
+
right: 0;
|
| 722 |
+
}
|
| 723 |
+
/* more specificity required here to override default borders */
|
| 724 |
+
.ui-spinner a.ui-spinner-button {
|
| 725 |
+
border-top: none;
|
| 726 |
+
border-bottom: none;
|
| 727 |
+
border-right: none;
|
| 728 |
+
}
|
| 729 |
+
/* vertically center icon */
|
| 730 |
+
.ui-spinner .ui-icon {
|
| 731 |
+
position: absolute;
|
| 732 |
+
margin-top: -8px;
|
| 733 |
+
top: 50%;
|
| 734 |
+
left: 0;
|
| 735 |
+
}
|
| 736 |
+
.ui-spinner-up {
|
| 737 |
+
top: 0;
|
| 738 |
+
}
|
| 739 |
+
.ui-spinner-down {
|
| 740 |
+
bottom: 0;
|
| 741 |
+
}
|
| 742 |
+
|
| 743 |
+
/* TR overrides */
|
| 744 |
+
.ui-spinner .ui-icon-triangle-1-s {
|
| 745 |
+
/* need to fix icons sprite */
|
| 746 |
+
background-position: -65px -16px;
|
| 747 |
+
}
|
| 748 |
+
.ui-tabs {
|
| 749 |
+
position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
|
| 750 |
+
padding: .2em;
|
| 751 |
+
}
|
| 752 |
+
.ui-tabs .ui-tabs-nav {
|
| 753 |
+
margin: 0;
|
| 754 |
+
padding: .2em .2em 0;
|
| 755 |
+
}
|
| 756 |
+
.ui-tabs .ui-tabs-nav li {
|
| 757 |
+
list-style: none;
|
| 758 |
+
float: left;
|
| 759 |
+
position: relative;
|
| 760 |
+
top: 0;
|
| 761 |
+
margin: 1px .2em 0 0;
|
| 762 |
+
border-bottom-width: 0;
|
| 763 |
+
padding: 0;
|
| 764 |
+
white-space: nowrap;
|
| 765 |
+
}
|
| 766 |
+
.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
|
| 767 |
+
float: left;
|
| 768 |
+
padding: .5em 1em;
|
| 769 |
+
text-decoration: none;
|
| 770 |
+
}
|
| 771 |
+
.ui-tabs .ui-tabs-nav li.ui-tabs-active {
|
| 772 |
+
margin-bottom: -1px;
|
| 773 |
+
padding-bottom: 1px;
|
| 774 |
+
}
|
| 775 |
+
.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,
|
| 776 |
+
.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,
|
| 777 |
+
.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
|
| 778 |
+
cursor: text;
|
| 779 |
+
}
|
| 780 |
+
.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
|
| 781 |
+
cursor: pointer;
|
| 782 |
+
}
|
| 783 |
+
.ui-tabs .ui-tabs-panel {
|
| 784 |
+
display: block;
|
| 785 |
+
border-width: 0;
|
| 786 |
+
padding: 1em 1.4em;
|
| 787 |
+
background: none;
|
| 788 |
+
}
|
| 789 |
+
.ui-tooltip {
|
| 790 |
+
padding: 8px;
|
| 791 |
+
position: absolute;
|
| 792 |
+
z-index: 9999;
|
| 793 |
+
max-width: 300px;
|
| 794 |
+
-webkit-box-shadow: 0 0 5px #aaa;
|
| 795 |
+
box-shadow: 0 0 5px #aaa;
|
| 796 |
+
}
|
| 797 |
+
body .ui-tooltip {
|
| 798 |
+
border-width: 2px;
|
| 799 |
+
}
|
| 800 |
+
|
| 801 |
+
/* Component containers
|
| 802 |
+
----------------------------------*/
|
| 803 |
+
.ui-widget {
|
| 804 |
+
font-family: 'helveticaregular';
|
| 805 |
+
font-size: 1.1em;
|
| 806 |
+
}
|
| 807 |
+
.ui-widget .ui-widget {
|
| 808 |
+
font-size: 1em;
|
| 809 |
+
}
|
| 810 |
+
.ui-widget input,
|
| 811 |
+
.ui-widget select,
|
| 812 |
+
.ui-widget textarea,
|
| 813 |
+
.ui-widget button {
|
| 814 |
+
font-family: 'helveticaregular';
|
| 815 |
+
font-size:17px;
|
| 816 |
+
}
|
| 817 |
+
.ui-widget-content {
|
| 818 |
+
background: #ffffff;
|
| 819 |
+
color: #414951;
|
| 820 |
+
}
|
| 821 |
+
.ui-widget-content a {
|
| 822 |
+
color: #222222;
|
| 823 |
+
}
|
| 824 |
+
.ui-widget-header {
|
| 825 |
+
background: #fff;
|
| 826 |
+
color: #222222;
|
| 827 |
+
}
|
| 828 |
+
.ui-widget-header a {
|
| 829 |
+
color: #222222;
|
| 830 |
+
}
|
| 831 |
+
|
| 832 |
+
/* Interaction states
|
| 833 |
+
----------------------------------*/
|
| 834 |
+
.ui-state-default,
|
| 835 |
+
.ui-widget-content .ui-state-default,
|
| 836 |
+
.ui-widget-header .ui-state-default {
|
| 837 |
+
background: #fff url(../images/arrow.png) right top no-repeat;
|
| 838 |
+
font-weight: normal;
|
| 839 |
+
color: #414951;
|
| 840 |
+
}
|
| 841 |
+
.ui-state-default a,
|
| 842 |
+
.ui-state-default a:link,
|
| 843 |
+
.ui-state-default a:visited {
|
| 844 |
+
color: #555555;
|
| 845 |
+
text-decoration: none;
|
| 846 |
+
}
|
| 847 |
+
.ui-state-hover,
|
| 848 |
+
.ui-widget-content .ui-state-hover,
|
| 849 |
+
.ui-widget-header .ui-state-hover,
|
| 850 |
+
/*.ui-state-focus, */
|
| 851 |
+
.ui-widget-content .ui-state-focus,
|
| 852 |
+
.ui-widget-header .ui-state-focus {
|
| 853 |
+
background: #d22b30 url(../images/arrow.png) right -50px no-repeat;
|
| 854 |
+
font-weight: normal;
|
| 855 |
+
color: #eee;
|
| 856 |
+
}
|
| 857 |
+
.ui-state-hover a,
|
| 858 |
+
.ui-state-hover a:hover,
|
| 859 |
+
.ui-state-hover a:link,
|
| 860 |
+
.ui-state-hover a:visited,
|
| 861 |
+
.ui-state-focus a,
|
| 862 |
+
.ui-state-focus a:hover,
|
| 863 |
+
.ui-state-focus a:link,
|
| 864 |
+
.ui-state-focus a:visited {
|
| 865 |
+
color: #212121;
|
| 866 |
+
text-decoration: none;
|
| 867 |
+
}
|
| 868 |
+
/*.ui-state-active,
|
| 869 |
+
.ui-widget-content .ui-state-active,
|
| 870 |
+
.ui-widget-header .ui-state-active {
|
| 871 |
+
background: #d22b30 url(../images/arrow.png) right -50px no-repeat;
|
| 872 |
+
font-weight: normal;
|
| 873 |
+
color: #fff;
|
| 874 |
+
}*/
|
| 875 |
+
|
| 876 |
+
|
| 877 |
+
.ui-state-active,
|
| 878 |
+
.ui-widget-content .ui-state-active,
|
| 879 |
+
.ui-widget-header .ui-state-active {
|
| 880 |
+
background: #d22b30 url(../images/arrow.png) right -105px no-repeat;
|
| 881 |
+
font-weight: normal;
|
| 882 |
+
color:#eeeeee;
|
| 883 |
+
}
|
| 884 |
+
|
| 885 |
+
|
| 886 |
+
|
| 887 |
+
.ui-state-active a,
|
| 888 |
+
.ui-state-active a:link,
|
| 889 |
+
.ui-state-active a:visited {
|
| 890 |
+
color: #212121;
|
| 891 |
+
text-decoration: none;
|
| 892 |
+
}
|
| 893 |
+
|
| 894 |
+
/* Interaction Cues
|
| 895 |
+
----------------------------------*/
|
| 896 |
+
.ui-state-highlight,
|
| 897 |
+
.ui-widget-content .ui-state-highlight,
|
| 898 |
+
.ui-widget-header .ui-state-highlight {
|
| 899 |
+
border: 1px solid #fcefa1;
|
| 900 |
+
background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;
|
| 901 |
+
color: #363636;
|
| 902 |
+
}
|
| 903 |
+
.ui-state-highlight a,
|
| 904 |
+
.ui-widget-content .ui-state-highlight a,
|
| 905 |
+
.ui-widget-header .ui-state-highlight a {
|
| 906 |
+
color: #363636;
|
| 907 |
+
}
|
| 908 |
+
.ui-state-error,
|
| 909 |
+
.ui-widget-content .ui-state-error,
|
| 910 |
+
.ui-widget-header .ui-state-error {
|
| 911 |
+
border: 1px solid #cd0a0a;
|
| 912 |
+
background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;
|
| 913 |
+
color: #cd0a0a;
|
| 914 |
+
}
|
| 915 |
+
.ui-state-error a,
|
| 916 |
+
.ui-widget-content .ui-state-error a,
|
| 917 |
+
.ui-widget-header .ui-state-error a {
|
| 918 |
+
color: #cd0a0a;
|
| 919 |
+
}
|
| 920 |
+
.ui-state-error-text,
|
| 921 |
+
.ui-widget-content .ui-state-error-text,
|
| 922 |
+
.ui-widget-header .ui-state-error-text {
|
| 923 |
+
color: #cd0a0a;
|
| 924 |
+
}
|
| 925 |
+
.ui-priority-primary,
|
| 926 |
+
.ui-widget-content .ui-priority-primary,
|
| 927 |
+
.ui-widget-header .ui-priority-primary {
|
| 928 |
+
font-weight: bold;
|
| 929 |
+
}
|
| 930 |
+
.ui-priority-secondary,
|
| 931 |
+
.ui-widget-content .ui-priority-secondary,
|
| 932 |
+
.ui-widget-header .ui-priority-secondary {
|
| 933 |
+
opacity: .7;
|
| 934 |
+
filter:Alpha(Opacity=70);
|
| 935 |
+
font-weight: normal;
|
| 936 |
+
}
|
| 937 |
+
.ui-state-disabled,
|
| 938 |
+
.ui-widget-content .ui-state-disabled,
|
| 939 |
+
.ui-widget-header .ui-state-disabled {
|
| 940 |
+
opacity: .35;
|
| 941 |
+
filter:Alpha(Opacity=35);
|
| 942 |
+
background-image: none;
|
| 943 |
+
}
|
| 944 |
+
.ui-state-disabled .ui-icon {
|
| 945 |
+
filter:Alpha(Opacity=35); /* For IE8 - See #6059 */
|
| 946 |
+
}
|
| 947 |
+
|
| 948 |
+
/* Icons
|
| 949 |
+
----------------------------------*/
|
| 950 |
+
|
| 951 |
+
/* states and images */
|
| 952 |
+
.ui-icon {
|
| 953 |
+
width: 16px;
|
| 954 |
+
height: 16px;
|
| 955 |
+
}
|
| 956 |
+
.ui-icon,
|
| 957 |
+
.ui-widget-content .ui-icon {
|
| 958 |
+
background-image: url(images/ui-icons_222222_256x240.png);
|
| 959 |
+
}
|
| 960 |
+
.ui-widget-header .ui-icon {
|
| 961 |
+
background-image: url(images/ui-icons_222222_256x240.png);
|
| 962 |
+
}
|
| 963 |
+
.ui-state-default .ui-icon {
|
| 964 |
+
background-image: url(images/ui-icons_888888_256x240.png);
|
| 965 |
+
}
|
| 966 |
+
.ui-state-hover .ui-icon,
|
| 967 |
+
.ui-state-focus .ui-icon {
|
| 968 |
+
background-image: url(images/ui-icons_454545_256x240.png);
|
| 969 |
+
}
|
| 970 |
+
.ui-state-active .ui-icon {
|
| 971 |
+
background-image: url(images/ui-icons_454545_256x240.png);
|
| 972 |
+
}
|
| 973 |
+
.ui-state-highlight .ui-icon {
|
| 974 |
+
background-image: url(images/ui-icons_2e83ff_256x240.png);
|
| 975 |
+
}
|
| 976 |
+
.ui-state-error .ui-icon,
|
| 977 |
+
.ui-state-error-text .ui-icon {
|
| 978 |
+
background-image: url(images/ui-icons_cd0a0a_256x240.png);
|
| 979 |
+
}
|
| 980 |
+
|
| 981 |
+
/* positioning */
|
| 982 |
+
.ui-icon-blank { background-position: 16px 16px; }
|
| 983 |
+
.ui-icon-carat-1-n { background-position: 0 0; }
|
| 984 |
+
.ui-icon-carat-1-ne { background-position: -16px 0; }
|
| 985 |
+
.ui-icon-carat-1-e { background-position: -32px 0; }
|
| 986 |
+
.ui-icon-carat-1-se { background-position: -48px 0; }
|
| 987 |
+
.ui-icon-carat-1-s { background-position: -64px 0; }
|
| 988 |
+
.ui-icon-carat-1-sw { background-position: -80px 0; }
|
| 989 |
+
.ui-icon-carat-1-w { background-position: -96px 0; }
|
| 990 |
+
.ui-icon-carat-1-nw { background-position: -112px 0; }
|
| 991 |
+
.ui-icon-carat-2-n-s { background-position: -128px 0; }
|
| 992 |
+
.ui-icon-carat-2-e-w { background-position: -144px 0; }
|
| 993 |
+
.ui-icon-triangle-1-n { background-position: 0 -16px; }
|
| 994 |
+
.ui-icon-triangle-1-ne { background-position: -16px -16px; }
|
| 995 |
+
.ui-icon-triangle-1-e { background-position: -32px -16px; }
|
| 996 |
+
.ui-icon-triangle-1-se { background-position: -48px -16px; }
|
| 997 |
+
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
| 998 |
+
.ui-icon-triangle-1-sw { background-position: -80px -16px; }
|
| 999 |
+
.ui-icon-triangle-1-w { background-position: -96px -16px; }
|
| 1000 |
+
.ui-icon-triangle-1-nw { background-position: -112px -16px; }
|
| 1001 |
+
.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
|
| 1002 |
+
.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
|
| 1003 |
+
.ui-icon-arrow-1-n { background-position: 0 -32px; }
|
| 1004 |
+
.ui-icon-arrow-1-ne { background-position: -16px -32px; }
|
| 1005 |
+
.ui-icon-arrow-1-e { background-position: -32px -32px; }
|
| 1006 |
+
.ui-icon-arrow-1-se { background-position: -48px -32px; }
|
| 1007 |
+
.ui-icon-arrow-1-s { background-position: -64px -32px; }
|
| 1008 |
+
.ui-icon-arrow-1-sw { background-position: -80px -32px; }
|
| 1009 |
+
.ui-icon-arrow-1-w { background-position: -96px -32px; }
|
| 1010 |
+
.ui-icon-arrow-1-nw { background-position: -112px -32px; }
|
| 1011 |
+
.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
|
| 1012 |
+
.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
|
| 1013 |
+
.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
|
| 1014 |
+
.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
|
| 1015 |
+
.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
|
| 1016 |
+
.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
|
| 1017 |
+
.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
|
| 1018 |
+
.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
|
| 1019 |
+
.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
|
| 1020 |
+
.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
|
| 1021 |
+
.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
|
| 1022 |
+
.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
|
| 1023 |
+
.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
|
| 1024 |
+
.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
|
| 1025 |
+
.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
|
| 1026 |
+
.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
|
| 1027 |
+
.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
|
| 1028 |
+
.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
|
| 1029 |
+
.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
|
| 1030 |
+
.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
|
| 1031 |
+
.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
|
| 1032 |
+
.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
|
| 1033 |
+
.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
|
| 1034 |
+
.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
|
| 1035 |
+
.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
|
| 1036 |
+
.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
|
| 1037 |
+
.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
|
| 1038 |
+
.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
|
| 1039 |
+
.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
|
| 1040 |
+
.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
|
| 1041 |
+
.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
|
| 1042 |
+
.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
|
| 1043 |
+
.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
|
| 1044 |
+
.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
|
| 1045 |
+
.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
|
| 1046 |
+
.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
|
| 1047 |
+
.ui-icon-arrow-4 { background-position: 0 -80px; }
|
| 1048 |
+
.ui-icon-arrow-4-diag { background-position: -16px -80px; }
|
| 1049 |
+
.ui-icon-extlink { background-position: -32px -80px; }
|
| 1050 |
+
.ui-icon-newwin { background-position: -48px -80px; }
|
| 1051 |
+
.ui-icon-refresh { background-position: -64px -80px; }
|
| 1052 |
+
.ui-icon-shuffle { background-position: -80px -80px; }
|
| 1053 |
+
.ui-icon-transfer-e-w { background-position: -96px -80px; }
|
| 1054 |
+
.ui-icon-transferthick-e-w { background-position: -112px -80px; }
|
| 1055 |
+
.ui-icon-folder-collapsed { background-position: 0 -96px; }
|
| 1056 |
+
.ui-icon-folder-open { background-position: -16px -96px; }
|
| 1057 |
+
.ui-icon-document { background-position: -32px -96px; }
|
| 1058 |
+
.ui-icon-document-b { background-position: -48px -96px; }
|
| 1059 |
+
.ui-icon-note { background-position: -64px -96px; }
|
| 1060 |
+
.ui-icon-mail-closed { background-position: -80px -96px; }
|
| 1061 |
+
.ui-icon-mail-open { background-position: -96px -96px; }
|
| 1062 |
+
.ui-icon-suitcase { background-position: -112px -96px; }
|
| 1063 |
+
.ui-icon-comment { background-position: -128px -96px; }
|
| 1064 |
+
.ui-icon-person { background-position: -144px -96px; }
|
| 1065 |
+
.ui-icon-print { background-position: -160px -96px; }
|
| 1066 |
+
.ui-icon-trash { background-position: -176px -96px; }
|
| 1067 |
+
.ui-icon-locked { background-position: -192px -96px; }
|
| 1068 |
+
.ui-icon-unlocked { background-position: -208px -96px; }
|
| 1069 |
+
.ui-icon-bookmark { background-position: -224px -96px; }
|
| 1070 |
+
.ui-icon-tag { background-position: -240px -96px; }
|
| 1071 |
+
.ui-icon-home { background-position: 0 -112px; }
|
| 1072 |
+
.ui-icon-flag { background-position: -16px -112px; }
|
| 1073 |
+
.ui-icon-calendar { background-position: -32px -112px; }
|
| 1074 |
+
.ui-icon-cart { background-position: -48px -112px; }
|
| 1075 |
+
.ui-icon-pencil { background-position: -64px -112px; }
|
| 1076 |
+
.ui-icon-clock { background-position: -80px -112px; }
|
| 1077 |
+
.ui-icon-disk { background-position: -96px -112px; }
|
| 1078 |
+
.ui-icon-calculator { background-position: -112px -112px; }
|
| 1079 |
+
.ui-icon-zoomin { background-position: -128px -112px; }
|
| 1080 |
+
.ui-icon-zoomout { background-position: -144px -112px; }
|
| 1081 |
+
.ui-icon-search { background-position: -160px -112px; }
|
| 1082 |
+
.ui-icon-wrench { background-position: -176px -112px; }
|
| 1083 |
+
.ui-icon-gear { background-position: -192px -112px; }
|
| 1084 |
+
.ui-icon-heart { background-position: -208px -112px; }
|
| 1085 |
+
.ui-icon-star { background-position: -224px -112px; }
|
| 1086 |
+
.ui-icon-link { background-position: -240px -112px; }
|
| 1087 |
+
.ui-icon-cancel { background-position: 0 -128px; }
|
| 1088 |
+
.ui-icon-plus { background-position: -16px -128px; }
|
| 1089 |
+
.ui-icon-plusthick { background-position: -32px -128px; }
|
| 1090 |
+
.ui-icon-minus { background-position: -48px -128px; }
|
| 1091 |
+
.ui-icon-minusthick { background-position: -64px -128px; }
|
| 1092 |
+
.ui-icon-close { background-position: -80px -128px; }
|
| 1093 |
+
.ui-icon-closethick { background-position: -96px -128px; }
|
| 1094 |
+
.ui-icon-key { background-position: -112px -128px; }
|
| 1095 |
+
.ui-icon-lightbulb { background-position: -128px -128px; }
|
| 1096 |
+
.ui-icon-scissors { background-position: -144px -128px; }
|
| 1097 |
+
.ui-icon-clipboard { background-position: -160px -128px; }
|
| 1098 |
+
.ui-icon-copy { background-position: -176px -128px; }
|
| 1099 |
+
.ui-icon-contact { background-position: -192px -128px; }
|
| 1100 |
+
.ui-icon-image { background-position: -208px -128px; }
|
| 1101 |
+
.ui-icon-video { background-position: -224px -128px; }
|
| 1102 |
+
.ui-icon-script { background-position: -240px -128px; }
|
| 1103 |
+
.ui-icon-alert { background-position: 0 -144px; }
|
| 1104 |
+
.ui-icon-info { background-position: -16px -144px; }
|
| 1105 |
+
.ui-icon-notice { background-position: -32px -144px; }
|
| 1106 |
+
.ui-icon-help { background-position: -48px -144px; }
|
| 1107 |
+
.ui-icon-check { background-position: -64px -144px; }
|
| 1108 |
+
.ui-icon-bullet { background-position: -80px -144px; }
|
| 1109 |
+
.ui-icon-radio-on { background-position: -96px -144px; }
|
| 1110 |
+
.ui-icon-radio-off { background-position: -112px -144px; }
|
| 1111 |
+
.ui-icon-pin-w { background-position: -128px -144px; }
|
| 1112 |
+
.ui-icon-pin-s { background-position: -144px -144px; }
|
| 1113 |
+
.ui-icon-play { background-position: 0 -160px; }
|
| 1114 |
+
.ui-icon-pause { background-position: -16px -160px; }
|
| 1115 |
+
.ui-icon-seek-next { background-position: -32px -160px; }
|
| 1116 |
+
.ui-icon-seek-prev { background-position: -48px -160px; }
|
| 1117 |
+
.ui-icon-seek-end { background-position: -64px -160px; }
|
| 1118 |
+
.ui-icon-seek-start { background-position: -80px -160px; }
|
| 1119 |
+
/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
|
| 1120 |
+
.ui-icon-seek-first { background-position: -80px -160px; }
|
| 1121 |
+
.ui-icon-stop { background-position: -96px -160px; }
|
| 1122 |
+
.ui-icon-eject { background-position: -112px -160px; }
|
| 1123 |
+
.ui-icon-volume-off { background-position: -128px -160px; }
|
| 1124 |
+
.ui-icon-volume-on { background-position: -144px -160px; }
|
| 1125 |
+
.ui-icon-power { background-position: 0 -176px; }
|
| 1126 |
+
.ui-icon-signal-diag { background-position: -16px -176px; }
|
| 1127 |
+
.ui-icon-signal { background-position: -32px -176px; }
|
| 1128 |
+
.ui-icon-battery-0 { background-position: -48px -176px; }
|
| 1129 |
+
.ui-icon-battery-1 { background-position: -64px -176px; }
|
| 1130 |
+
.ui-icon-battery-2 { background-position: -80px -176px; }
|
| 1131 |
+
.ui-icon-battery-3 { background-position: -96px -176px; }
|
| 1132 |
+
.ui-icon-circle-plus { background-position: 0 -192px; }
|
| 1133 |
+
.ui-icon-circle-minus { background-position: -16px -192px; }
|
| 1134 |
+
.ui-icon-circle-close { background-position: -32px -192px; }
|
| 1135 |
+
.ui-icon-circle-triangle-e { background-position: -48px -192px; }
|
| 1136 |
+
.ui-icon-circle-triangle-s { background-position: -64px -192px; }
|
| 1137 |
+
.ui-icon-circle-triangle-w { background-position: -80px -192px; }
|
| 1138 |
+
.ui-icon-circle-triangle-n { background-position: -96px -192px; }
|
| 1139 |
+
.ui-icon-circle-arrow-e { background-position: -112px -192px; }
|
| 1140 |
+
.ui-icon-circle-arrow-s { background-position: -128px -192px; }
|
| 1141 |
+
.ui-icon-circle-arrow-w { background-position: -144px -192px; }
|
| 1142 |
+
.ui-icon-circle-arrow-n { background-position: -160px -192px; }
|
| 1143 |
+
.ui-icon-circle-zoomin { background-position: -176px -192px; }
|
| 1144 |
+
.ui-icon-circle-zoomout { background-position: -192px -192px; }
|
| 1145 |
+
.ui-icon-circle-check { background-position: -208px -192px; }
|
| 1146 |
+
.ui-icon-circlesmall-plus { background-position: 0 -208px; }
|
| 1147 |
+
.ui-icon-circlesmall-minus { background-position: -16px -208px; }
|
| 1148 |
+
.ui-icon-circlesmall-close { background-position: -32px -208px; }
|
| 1149 |
+
.ui-icon-squaresmall-plus { background-position: -48px -208px; }
|
| 1150 |
+
.ui-icon-squaresmall-minus { background-position: -64px -208px; }
|
| 1151 |
+
.ui-icon-squaresmall-close { background-position: -80px -208px; }
|
| 1152 |
+
.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
|
| 1153 |
+
.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
|
| 1154 |
+
.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
|
| 1155 |
+
.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
|
| 1156 |
+
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
| 1157 |
+
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
| 1158 |
+
|
| 1159 |
+
|
| 1160 |
+
/* Misc visuals
|
| 1161 |
+
----------------------------------*/
|
| 1162 |
+
|
| 1163 |
+
/* Corner radius */
|
| 1164 |
+
.ui-corner-all,
|
| 1165 |
+
.ui-corner-top,
|
| 1166 |
+
.ui-corner-left,
|
| 1167 |
+
.ui-corner-tl {
|
| 1168 |
+
border-top-left-radius: 0px;
|
| 1169 |
+
}
|
| 1170 |
+
.ui-corner-all,
|
| 1171 |
+
.ui-corner-top,
|
| 1172 |
+
.ui-corner-right,
|
| 1173 |
+
.ui-corner-tr {
|
| 1174 |
+
border-top-right-radius: 0px;
|
| 1175 |
+
}
|
| 1176 |
+
.ui-corner-all,
|
| 1177 |
+
.ui-corner-bottom,
|
| 1178 |
+
.ui-corner-left,
|
| 1179 |
+
.ui-corner-bl {
|
| 1180 |
+
border-bottom-left-radius: 0px;
|
| 1181 |
+
}
|
| 1182 |
+
.ui-corner-all,
|
| 1183 |
+
.ui-corner-bottom,
|
| 1184 |
+
.ui-corner-right,
|
| 1185 |
+
.ui-corner-br {
|
| 1186 |
+
border-bottom-right-radius: 0px;
|
| 1187 |
+
}
|
| 1188 |
+
|
| 1189 |
+
|
| 1190 |
+
|
| 1191 |
+
|
| 1192 |
+
#accordion h3 span,#accordion1 h3 span{ position: absolute; left:0px; top:0px; width:50px; height:49px; background:#31373d; line-height:50px; text-align: center; font-family: 'helveticaregular'; font-size:20px; color:#FFF;}
|
| 1193 |
+
|
| 1194 |
+
#accordion h3:hover span, #accordion1 h3:hover span{ background:#b8262a; color:#eee;}
|
| 1195 |
+
#accordion h3.ui-state-active span, #accordion1 h3.ui-state-active span{ background:#b8262a; color:#eee;}
|
css/sfsi-admin-style.css
CHANGED
|
@@ -1,1232 +1,1232 @@
|
|
| 1 |
-
@charset "utf-8";
|
| 2 |
-
@font-face {
|
| 3 |
-
font-family: helveticabold;
|
| 4 |
-
src: url(fonts/helvetica_bold_0-webfont.eot);
|
| 5 |
-
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
| 6 |
-
font-weight: 400;
|
| 7 |
-
font-style: normal;
|
| 8 |
-
}
|
| 9 |
-
@font-face {
|
| 10 |
-
font-family: helveticaregular;
|
| 11 |
-
src: url(fonts/helvetica_0-webfont.eot);
|
| 12 |
-
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
| 13 |
-
font-weight: 400;
|
| 14 |
-
font-style: normal;
|
| 15 |
-
}
|
| 16 |
-
@font-face {
|
| 17 |
-
font-family: helveticaneue-light;
|
| 18 |
-
src: url(fonts/helveticaneue-light.eot);
|
| 19 |
-
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
| 20 |
-
url(fonts/helveticaneue-light.woff) format('woff'),
|
| 21 |
-
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
| 22 |
-
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
| 23 |
-
font-weight: 400;
|
| 24 |
-
font-style: normal;
|
| 25 |
-
}
|
| 26 |
-
body {
|
| 27 |
-
margin: 0;
|
| 28 |
-
padding: 0;
|
| 29 |
-
}
|
| 30 |
-
/*Tab 1*/
|
| 31 |
-
.tab1 ul.plus_icn_listing li .custom, .tab1 ul.plus_icn_listing li .sfsicls_email, .tab1 ul.plus_icn_listing li .sfsicls_facebook, .tab1 ul.plus_icn_listing li .sfsicls_ggle_pls, .tab1 ul.plus_icn_listing li .sfsicls_instagram, .tab1 ul.plus_icn_listing li .sfsicls_houzz, .tab1 ul.plus_icn_listing li .sfsicls_linkdin, .tab1 ul.plus_icn_listing li .sfsicls_pinterest, .tab1 ul.plus_icn_listing li .sfsicls_rs_s, .tab1 ul.plus_icn_listing li .sfsicls_share, .tab1 ul.plus_icn_listing li .sfsicls_twt, .tab1 ul.plus_icn_listing li .sfsicls_utube {
|
| 32 |
-
background: url(../images/tab_1_icn_list.png) no-repeat;
|
| 33 |
-
float: left;
|
| 34 |
-
padding: 0 0 0 59px;
|
| 35 |
-
margin: 0 0 0 17px;
|
| 36 |
-
height: 52px;
|
| 37 |
-
line-height: 51px;
|
| 38 |
-
font-family: helveticaregular;
|
| 39 |
-
font-size: 22px;
|
| 40 |
-
}
|
| 41 |
-
.tab1 ul.plus_icn_listing li .sfsicls_rs_s {
|
| 42 |
-
background-position: 0 0;
|
| 43 |
-
color: #f7941d;
|
| 44 |
-
}
|
| 45 |
-
.tab1 ul.plus_icn_listing li .sfsicls_email {
|
| 46 |
-
background-position: 0 -73px;
|
| 47 |
-
color: #d1c800;
|
| 48 |
-
}
|
| 49 |
-
.tab1 ul.plus_icn_listing li .sfsicls_facebook {
|
| 50 |
-
background-position: 0 -145px;
|
| 51 |
-
color: #004088;
|
| 52 |
-
}
|
| 53 |
-
.tab1 ul.plus_icn_listing li .sfsicls_twt {
|
| 54 |
-
background-position: 0 -221px;
|
| 55 |
-
color: #00abe3;
|
| 56 |
-
}
|
| 57 |
-
.tab1 ul.plus_icn_listing li .sfsicls_ggle_pls {
|
| 58 |
-
background-position: 0 -295px;
|
| 59 |
-
color: #444749;
|
| 60 |
-
}
|
| 61 |
-
.tab1 ul.plus_icn_listing li .sfsicls_share {
|
| 62 |
-
background-position: 0 -372px;
|
| 63 |
-
color: #ef4746;
|
| 64 |
-
}
|
| 65 |
-
.tab1 ul.plus_icn_listing li .sfsicls_utube {
|
| 66 |
-
background-position: 0 -448px;
|
| 67 |
-
color: #f07963;
|
| 68 |
-
}
|
| 69 |
-
.tab1 ul.plus_icn_listing li .sfsicls_linkdin {
|
| 70 |
-
background-position: 0 -548px;
|
| 71 |
-
color: #1e88c9;
|
| 72 |
-
}
|
| 73 |
-
.tab1 ul.plus_icn_listing li .sfsicls_pinterest {
|
| 74 |
-
background-position: 0 -623px;
|
| 75 |
-
color: #f15f5d;
|
| 76 |
-
}
|
| 77 |
-
.tab1 ul.plus_icn_listing li .sfsicls_instagram {
|
| 78 |
-
background-position: 0 -781px;
|
| 79 |
-
color: #369;
|
| 80 |
-
}
|
| 81 |
-
.tab1 ul.plus_icn_listing li .sfsicls_houzz {
|
| 82 |
-
background-position: 0 -939px;
|
| 83 |
-
color: #369;
|
| 84 |
-
}
|
| 85 |
-
.tab1 ul.plus_icn_listing li .custom {
|
| 86 |
-
background-position: 0 -702px;
|
| 87 |
-
color: #5a6570;
|
| 88 |
-
}
|
| 89 |
-
.tab1 ul.plus_icn_listing li .sfsiplus_right_info {
|
| 90 |
-
width: 70%;
|
| 91 |
-
float: right;
|
| 92 |
-
font-family: helveticaregular;
|
| 93 |
-
margin-right: 13px;
|
| 94 |
-
}
|
| 95 |
-
ul.plus_icn_listing li .sfsiplus_right_info a {
|
| 96 |
-
text-decoration: underline;
|
| 97 |
-
color: #a4a9ad;
|
| 98 |
-
font-size: 16px;
|
| 99 |
-
}
|
| 100 |
-
ul.sfsiplus_icn_listing8 li .sfsiplus_right_info a {
|
| 101 |
-
text-decoration: underline;
|
| 102 |
-
color: #a4a9ad;
|
| 103 |
-
font-size: 16px;
|
| 104 |
-
}
|
| 105 |
-
.tab1 .tab_2_sav {
|
| 106 |
-
padding-top: 30px;
|
| 107 |
-
}
|
| 108 |
-
/*Tab 2*/
|
| 109 |
-
.tab2 .row h2.sfsicls_email, .tab2 .row h2.sfsicls_facebook, .tab2 .row h2.sfsicls_ggle_pls, .tab2 .row h2.sfsicls_instagram, .tab2 .row h2.sfsicls_houzz, .tab2 .row h2.sfsicls_linkdin, .tab2 .row h2.sfsicls_pinterest, .tab2 .row h2.sfsicls_rs_s, .tab2 .row h2.sfsicls_share, .tab2 .row h2.sfsicls_twt, .tab2 .row h2.sfsicls_utube {
|
| 110 |
-
background: url(../images/tab_1_icn_list.png) no-repeat;
|
| 111 |
-
padding: 0 0 0 70px;
|
| 112 |
-
margin: 15px 0 7px 21px;
|
| 113 |
-
height: 52px;
|
| 114 |
-
line-height: 51px;
|
| 115 |
-
font-family: helveticaregular;
|
| 116 |
-
font-size: 22px;
|
| 117 |
-
}
|
| 118 |
-
.tab2 .row h2.sfsicls_rs_s {
|
| 119 |
-
background-position: 0 0;
|
| 120 |
-
color: #f7941d;
|
| 121 |
-
}
|
| 122 |
-
.tab2 .row h2.sfsicls_email {
|
| 123 |
-
background-position: 0 -71px;
|
| 124 |
-
color: #d1c800;
|
| 125 |
-
}
|
| 126 |
-
.tab2 .row h2.sfsicls_facebook {
|
| 127 |
-
background-position: 0 -145px;
|
| 128 |
-
color: #004088;
|
| 129 |
-
}
|
| 130 |
-
.tab2 .row h2.sfsicls_twt {
|
| 131 |
-
background-position: 0 -221px;
|
| 132 |
-
color: #00abe3;
|
| 133 |
-
}
|
| 134 |
-
.tab2 .row h2.sfsicls_ggle_pls {
|
| 135 |
-
background-position: 0 -295px;
|
| 136 |
-
color: #444749;
|
| 137 |
-
}
|
| 138 |
-
.tab2 .row h2.sfsicls_share {
|
| 139 |
-
background-position: 0 -372px;
|
| 140 |
-
color: #ef4746;
|
| 141 |
-
}
|
| 142 |
-
.tab2 .row h2.sfsicls_utube {
|
| 143 |
-
background-position: 0 -448px;
|
| 144 |
-
color: #f07963;
|
| 145 |
-
}
|
| 146 |
-
.tab2 .row h2.sfsicls_linkdin {
|
| 147 |
-
background-position: 0 -548px;
|
| 148 |
-
color: #1e88c9;
|
| 149 |
-
}
|
| 150 |
-
.tab2 .row h2.sfsicls_pinterest {
|
| 151 |
-
background-position: 0 -623px;
|
| 152 |
-
color: #f15f5d;
|
| 153 |
-
}
|
| 154 |
-
.tab2 .row h2.sfsicls_instagram {
|
| 155 |
-
background-position: 0 -781px;
|
| 156 |
-
color: #369;
|
| 157 |
-
}
|
| 158 |
-
.tab2 .row h2.sfsicls_houzz {
|
| 159 |
-
background-position: 0 -939px;
|
| 160 |
-
color: #369;
|
| 161 |
-
}
|
| 162 |
-
.tab2 .inr_cont {
|
| 163 |
-
margin: 0 0 12px 94px;
|
| 164 |
-
}
|
| 165 |
-
ul.tab_2_email_sec .sf_arow {
|
| 166 |
-
width: 52px;
|
| 167 |
-
height: 52px;
|
| 168 |
-
float: left;
|
| 169 |
-
background: url(../images/sf_arow_icn.png) no-repeat;
|
| 170 |
-
margin: 0 0px 0 6px;
|
| 171 |
-
}
|
| 172 |
-
ul.tab_2_email_sec .email_icn {
|
| 173 |
-
background: url(../images/tab_1_icn_list.png) 0 -71px no-repeat;
|
| 174 |
-
width: 52px;
|
| 175 |
-
height: 52px;
|
| 176 |
-
float: left;
|
| 177 |
-
margin: 0 0 0 5px;
|
| 178 |
-
}
|
| 179 |
-
ul.tab_2_email_sec .subscribe_icn {
|
| 180 |
-
background: url(../images/tab_1_icn_list.png) 0 -860px no-repeat;
|
| 181 |
-
width: 52px;
|
| 182 |
-
height: 52px;
|
| 183 |
-
float: left;
|
| 184 |
-
margin: 0 0 0 5px;
|
| 185 |
-
}
|
| 186 |
-
ul.tab_2_email_sec li .radio {
|
| 187 |
-
float: left;
|
| 188 |
-
margin: 8px 0 0;
|
| 189 |
-
}
|
| 190 |
-
.row ul.tab_2_email_sec li label {
|
| 191 |
-
margin: 13px 0 0 7px;
|
| 192 |
-
font-size: 16px;
|
| 193 |
-
float: left;
|
| 194 |
-
width: 160px;
|
| 195 |
-
}
|
| 196 |
-
.row ul.tab_2_email_sec li label span
|
| 197 |
-
{
|
| 198 |
-
font-size: 15px;
|
| 199 |
-
color: #808080;
|
| 200 |
-
width: 100%;
|
| 201 |
-
float: left;
|
| 202 |
-
}
|
| 203 |
-
/*Tab 3*/
|
| 204 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_1, .sfsiplus_icns_tab_3 .sfsiplus_row_10_10, .sfsiplus_icns_tab_3 .sfsiplus_row_10_11, .sfsiplus_icns_tab_3 .sfsiplus_row_10_2, .sfsiplus_icns_tab_3 .sfsiplus_row_10_3, .sfsiplus_icns_tab_3 .sfsiplus_row_10_4, .sfsiplus_icns_tab_3 .sfsiplus_row_10_5, .sfsiplus_icns_tab_3 .sfsiplus_row_10_6, .sfsiplus_icns_tab_3 .sfsiplus_row_10_7, .sfsiplus_icns_tab_3 .sfsiplus_row_10_8, .sfsiplus_icns_tab_3 .sfsiplus_row_10_9, .sfsiplus_icns_tab_3 .sfsiplus_row_11_1, .sfsiplus_icns_tab_3 .sfsiplus_row_11_10, .sfsiplus_icns_tab_3 .sfsiplus_row_11_11, .sfsiplus_icns_tab_3 .sfsiplus_row_11_2, .sfsiplus_icns_tab_3 .sfsiplus_row_11_3, .sfsiplus_icns_tab_3 .sfsiplus_row_11_4, .sfsiplus_icns_tab_3 .sfsiplus_row_11_5, .sfsiplus_icns_tab_3 .sfsiplus_row_11_6, .sfsiplus_icns_tab_3 .sfsiplus_row_11_7, .sfsiplus_icns_tab_3 .sfsiplus_row_11_8, .sfsiplus_icns_tab_3 .sfsiplus_row_11_9, .sfsiplus_icns_tab_3 .sfsiplus_row_12_1, .sfsiplus_icns_tab_3 .sfsiplus_row_12_10, .sfsiplus_icns_tab_3 .sfsiplus_row_12_11, .sfsiplus_icns_tab_3 .sfsiplus_row_12_2, .sfsiplus_icns_tab_3 .sfsiplus_row_12_3, .sfsiplus_icns_tab_3 .sfsiplus_row_12_4, .sfsiplus_icns_tab_3 .sfsiplus_row_12_5, .sfsiplus_icns_tab_3 .sfsiplus_row_12_6, .sfsiplus_icns_tab_3 .sfsiplus_row_12_7, .sfsiplus_icns_tab_3 .sfsiplus_row_12_8, .sfsiplus_icns_tab_3 .sfsiplus_row_12_9, .sfsiplus_icns_tab_3 .sfsiplus_row_13_1, .sfsiplus_icns_tab_3 .sfsiplus_row_13_10, .sfsiplus_icns_tab_3 .sfsiplus_row_13_11, .sfsiplus_icns_tab_3 .sfsiplus_row_13_2, .sfsiplus_icns_tab_3 .sfsiplus_row_13_3, .sfsiplus_icns_tab_3 .sfsiplus_row_13_4, .sfsiplus_icns_tab_3 .sfsiplus_row_13_5, .sfsiplus_icns_tab_3 .sfsiplus_row_13_6, .sfsiplus_icns_tab_3 .sfsiplus_row_13_7, .sfsiplus_icns_tab_3 .sfsiplus_row_13_8, .sfsiplus_icns_tab_3 .sfsiplus_row_13_9, .sfsiplus_icns_tab_3 .sfsiplus_row_14_1, .sfsiplus_icns_tab_3 .sfsiplus_row_14_10, .sfsiplus_icns_tab_3 .sfsiplus_row_14_11, .sfsiplus_icns_tab_3 .sfsiplus_row_14_2, .sfsiplus_icns_tab_3 .sfsiplus_row_14_3, .sfsiplus_icns_tab_3 .sfsiplus_row_14_4, .sfsiplus_icns_tab_3 .sfsiplus_row_14_5, .sfsiplus_icns_tab_3 .sfsiplus_row_14_6, .sfsiplus_icns_tab_3 .sfsiplus_row_14_7, .sfsiplus_icns_tab_3 .sfsiplus_row_14_8, .sfsiplus_icns_tab_3 .sfsiplus_row_14_9, .sfsiplus_icns_tab_3 .sfsiplus_row_15_1, .sfsiplus_icns_tab_3 .sfsiplus_row_15_10, .sfsiplus_icns_tab_3 .sfsiplus_row_15_11, .sfsiplus_icns_tab_3 .sfsiplus_row_15_2, .sfsiplus_icns_tab_3 .sfsiplus_row_15_3, .sfsiplus_icns_tab_3 .sfsiplus_row_15_4, .sfsiplus_icns_tab_3 .sfsiplus_row_15_5, .sfsiplus_icns_tab_3 .sfsiplus_row_15_6, .sfsiplus_icns_tab_3 .sfsiplus_row_15_7, .sfsiplus_icns_tab_3 .sfsiplus_row_15_8, .sfsiplus_icns_tab_3 .sfsiplus_row_15_9, .sfsiplus_icns_tab_3 .sfsiplus_row_16_1, .sfsiplus_icns_tab_3 .sfsiplus_row_16_10, .sfsiplus_icns_tab_3 .sfsiplus_row_16_11, .sfsiplus_icns_tab_3 .sfsiplus_row_16_2, .sfsiplus_icns_tab_3 .sfsiplus_row_16_3, .sfsiplus_icns_tab_3 .sfsiplus_row_16_4, .sfsiplus_icns_tab_3 .sfsiplus_row_16_5, .sfsiplus_icns_tab_3 .sfsiplus_row_16_6, .sfsiplus_icns_tab_3 .sfsiplus_row_16_7, .sfsiplus_icns_tab_3 .sfsiplus_row_16_8, .sfsiplus_icns_tab_3 .sfsiplus_row_16_9, .sfsiplus_icns_tab_3 .sfsiplus_row_1_1, .sfsiplus_icns_tab_3 .sfsiplus_row_1_10, .sfsiplus_icns_tab_3 .sfsiplus_row_1_11, .sfsiplus_icns_tab_3 .sfsiplus_row_1_2, .sfsiplus_icns_tab_3 .sfsiplus_row_1_3, .sfsiplus_icns_tab_3 .sfsiplus_row_1_4, .sfsiplus_icns_tab_3 .sfsiplus_row_1_5, .sfsiplus_icns_tab_3 .sfsiplus_row_1_6, .sfsiplus_icns_tab_3 .sfsiplus_row_1_7, .sfsiplus_icns_tab_3 .sfsiplus_row_1_8, .sfsiplus_icns_tab_3 .sfsiplus_row_1_9, .sfsiplus_icns_tab_3 .sfsiplus_row_2_1, .sfsiplus_icns_tab_3 .sfsiplus_row_2_10, .sfsiplus_icns_tab_3 .sfsiplus_row_2_11, .sfsiplus_icns_tab_3 .sfsiplus_row_2_2, .sfsiplus_icns_tab_3 .sfsiplus_row_2_3, .sfsiplus_icns_tab_3 .sfsiplus_row_2_4, .sfsiplus_icns_tab_3 .sfsiplus_row_2_5, .sfsiplus_icns_tab_3 .sfsiplus_row_2_6, .sfsiplus_icns_tab_3 .sfsiplus_row_2_7, .sfsiplus_icns_tab_3 .sfsiplus_row_2_8, .sfsiplus_icns_tab_3 .sfsiplus_row_2_9, .sfsiplus_icns_tab_3 .sfsiplus_row_3_1, .sfsiplus_icns_tab_3 .sfsiplus_row_3_10, .sfsiplus_icns_tab_3 .sfsiplus_row_3_11, .sfsiplus_icns_tab_3 .sfsiplus_row_3_2, .sfsiplus_icns_tab_3 .sfsiplus_row_3_3, .sfsiplus_icns_tab_3 .sfsiplus_row_3_4, .sfsiplus_icns_tab_3 .sfsiplus_row_3_5, .sfsiplus_icns_tab_3 .sfsiplus_row_3_6, .sfsiplus_icns_tab_3 .sfsiplus_row_3_7, .sfsiplus_icns_tab_3 .sfsiplus_row_3_8, .sfsiplus_icns_tab_3 .sfsiplus_row_3_9, .sfsiplus_icns_tab_3 .sfsiplus_row_4_1, .sfsiplus_icns_tab_3 .sfsiplus_row_4_10, .sfsiplus_icns_tab_3 .sfsiplus_row_4_11, .sfsiplus_icns_tab_3 .sfsiplus_row_4_2, .sfsiplus_icns_tab_3 .sfsiplus_row_4_3, .sfsiplus_icns_tab_3 .sfsiplus_row_4_4, .sfsiplus_icns_tab_3 .sfsiplus_row_4_5, .sfsiplus_icns_tab_3 .sfsiplus_row_4_6, .sfsiplus_icns_tab_3 .sfsiplus_row_4_7, .sfsiplus_icns_tab_3 .sfsiplus_row_4_8, .sfsiplus_icns_tab_3 .sfsiplus_row_4_9, .sfsiplus_icns_tab_3 .sfsiplus_row_5_1, .sfsiplus_icns_tab_3 .sfsiplus_row_5_10, .sfsiplus_icns_tab_3 .sfsiplus_row_5_11, .sfsiplus_icns_tab_3 .sfsiplus_row_5_2, .sfsiplus_icns_tab_3 .sfsiplus_row_5_3, .sfsiplus_icns_tab_3 .sfsiplus_row_5_4, .sfsiplus_icns_tab_3 .sfsiplus_row_5_5, .sfsiplus_icns_tab_3 .sfsiplus_row_5_6, .sfsiplus_icns_tab_3 .sfsiplus_row_5_7, .sfsiplus_icns_tab_3 .sfsiplus_row_5_8, .sfsiplus_icns_tab_3 .sfsiplus_row_5_9, .sfsiplus_icns_tab_3 .sfsiplus_row_6_1, .sfsiplus_icns_tab_3 .sfsiplus_row_6_10, .sfsiplus_icns_tab_3 .sfsiplus_row_6_11, .sfsiplus_icns_tab_3 .sfsiplus_row_6_2, .sfsiplus_icns_tab_3 .sfsiplus_row_6_3, .sfsiplus_icns_tab_3 .sfsiplus_row_6_4, .sfsiplus_icns_tab_3 .sfsiplus_row_6_5, .sfsiplus_icns_tab_3 .sfsiplus_row_6_6, .sfsiplus_icns_tab_3 .sfsiplus_row_6_7, .sfsiplus_icns_tab_3 .sfsiplus_row_6_8, .sfsiplus_icns_tab_3 .sfsiplus_row_6_9, .sfsiplus_icns_tab_3 .sfsiplus_row_7_1, .sfsiplus_icns_tab_3 .sfsiplus_row_7_10, .sfsiplus_icns_tab_3 .sfsiplus_row_7_11, .sfsiplus_icns_tab_3 .sfsiplus_row_7_2, .sfsiplus_icns_tab_3 .sfsiplus_row_7_3, .sfsiplus_icns_tab_3 .sfsiplus_row_7_4, .sfsiplus_icns_tab_3 .sfsiplus_row_7_5, .sfsiplus_icns_tab_3 .sfsiplus_row_7_6, .sfsiplus_icns_tab_3 .sfsiplus_row_7_7, .sfsiplus_icns_tab_3 .sfsiplus_row_7_8, .sfsiplus_icns_tab_3 .sfsiplus_row_7_9, .sfsiplus_icns_tab_3 .sfsiplus_row_8_1, .sfsiplus_icns_tab_3 .sfsiplus_row_8_10, .sfsiplus_icns_tab_3 .sfsiplus_row_8_11, .sfsiplus_icns_tab_3 .sfsiplus_row_8_2, .sfsiplus_icns_tab_3 .sfsiplus_row_8_3, .sfsiplus_icns_tab_3 .sfsiplus_row_8_4, .sfsiplus_icns_tab_3 .sfsiplus_row_8_5, .sfsiplus_icns_tab_3 .sfsiplus_row_8_6, .sfsiplus_icns_tab_3 .sfsiplus_row_8_7, .sfsiplus_icns_tab_3 .sfsiplus_row_8_8, .sfsiplus_icns_tab_3 .sfsiplus_row_8_9, .sfsiplus_icns_tab_3 .sfsiplus_row_9_1, .sfsiplus_icns_tab_3 .sfsiplus_row_9_10, .sfsiplus_icns_tab_3 .sfsiplus_row_9_11, .sfsiplus_icns_tab_3 .sfsiplus_row_9_2, .sfsiplus_icns_tab_3 .sfsiplus_row_9_3, .sfsiplus_icns_tab_3 .sfsiplus_row_9_4, .sfsiplus_icns_tab_3 .sfsiplus_row_9_5, .sfsiplus_icns_tab_3 .sfsiplus_row_9_6, .sfsiplus_icns_tab_3 .sfsiplus_row_9_7, .sfsiplus_icns_tab_3 .sfsiplus_row_9_8, .sfsiplus_icns_tab_3 .sfsiplus_row_9_9, .sfsiplus_icns_tab_3 .sfsiplus_row_17_1, .sfsiplus_icns_tab_3 .sfsiplus_row_17_2, .sfsiplus_icns_tab_3 .sfsiplus_row_17_3, .sfsiplus_icns_tab_3 .sfsiplus_row_17_4, .sfsiplus_icns_tab_3 .sfsiplus_row_17_5, .sfsiplus_icns_tab_3 .sfsiplus_row_17_6, .sfsiplus_icns_tab_3 .sfsiplus_row_17_7, .sfsiplus_icns_tab_3 .sfsiplus_row_17_8, .sfsiplus_icns_tab_3 .sfsiplus_row_17_9, .sfsiplus_icns_tab_3 .sfsiplus_row_17_10, .sfsiplus_icns_tab_3 .sfsiplus_row_17_11 {
|
| 205 |
-
background: url(../images/tab_3_icns.png) no-repeat;
|
| 206 |
-
width: 53px;
|
| 207 |
-
height: 52px;
|
| 208 |
-
float: left;
|
| 209 |
-
margin: 0 4px 0 0;
|
| 210 |
-
}
|
| 211 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_1 {
|
| 212 |
-
background-position: -1px 0;
|
| 213 |
-
}
|
| 214 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_2 {
|
| 215 |
-
background-position: -60px 0;
|
| 216 |
-
}
|
| 217 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_3 {
|
| 218 |
-
background-position: -118px 0;
|
| 219 |
-
}
|
| 220 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_4 {
|
| 221 |
-
background-position: -176px 0;
|
| 222 |
-
}
|
| 223 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_5 {
|
| 224 |
-
background-position: -235px 0;
|
| 225 |
-
}
|
| 226 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_6 {
|
| 227 |
-
background-position: -293px 0;
|
| 228 |
-
}
|
| 229 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_7 {
|
| 230 |
-
background-position: -350px 0;
|
| 231 |
-
}
|
| 232 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_8 {
|
| 233 |
-
background-position: -409px 0;
|
| 234 |
-
}
|
| 235 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_9 {
|
| 236 |
-
background-position: -467px 0;
|
| 237 |
-
}
|
| 238 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_10 {
|
| 239 |
-
background-position: -526px 0;
|
| 240 |
-
}
|
| 241 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_1_11 {
|
| 242 |
-
background-position: -711px 0;
|
| 243 |
-
}
|
| 244 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_1 {
|
| 245 |
-
background-position: 0 -74px;
|
| 246 |
-
}
|
| 247 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_2 {
|
| 248 |
-
background-position: -60px -74px;
|
| 249 |
-
}
|
| 250 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_3 {
|
| 251 |
-
background-position: -118px -74px;
|
| 252 |
-
}
|
| 253 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_4 {
|
| 254 |
-
background-position: -176px -74px;
|
| 255 |
-
}
|
| 256 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_5 {
|
| 257 |
-
background-position: -235px -74px;
|
| 258 |
-
}
|
| 259 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_6 {
|
| 260 |
-
background-position: -293px -74px;
|
| 261 |
-
}
|
| 262 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_7 {
|
| 263 |
-
background-position: -350px -74px;
|
| 264 |
-
}
|
| 265 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_8 {
|
| 266 |
-
background-position: -409px -74px;
|
| 267 |
-
}
|
| 268 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_9 {
|
| 269 |
-
background-position: -467px -74px;
|
| 270 |
-
}
|
| 271 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_10 {
|
| 272 |
-
background-position: -526px -74px;
|
| 273 |
-
}
|
| 274 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_2_11 {
|
| 275 |
-
background-position: -711px -74px;
|
| 276 |
-
}
|
| 277 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_1 {
|
| 278 |
-
background-position: 0 -146px;
|
| 279 |
-
}
|
| 280 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_2 {
|
| 281 |
-
background-position: -60px -146px;
|
| 282 |
-
}
|
| 283 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_3 {
|
| 284 |
-
background-position: -118px -146px;
|
| 285 |
-
}
|
| 286 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_4 {
|
| 287 |
-
background-position: -176px -146px;
|
| 288 |
-
}
|
| 289 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_5 {
|
| 290 |
-
background-position: -235px -146px;
|
| 291 |
-
}
|
| 292 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_6 {
|
| 293 |
-
background-position: -293px -146px;
|
| 294 |
-
}
|
| 295 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_7 {
|
| 296 |
-
background-position: -350px -146px;
|
| 297 |
-
}
|
| 298 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_8 {
|
| 299 |
-
background-position: -409px -146px;
|
| 300 |
-
}
|
| 301 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_9 {
|
| 302 |
-
background-position: -467px -146px;
|
| 303 |
-
}
|
| 304 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_10 {
|
| 305 |
-
background-position: -526px -146px;
|
| 306 |
-
}
|
| 307 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_3_11 {
|
| 308 |
-
background-position: -711px -147px;
|
| 309 |
-
}
|
| 310 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_1 {
|
| 311 |
-
background-position: 0 -222px;
|
| 312 |
-
}
|
| 313 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_2 {
|
| 314 |
-
background-position: -60px -222px;
|
| 315 |
-
}
|
| 316 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_3 {
|
| 317 |
-
background-position: -118px -222px;
|
| 318 |
-
}
|
| 319 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_4 {
|
| 320 |
-
background-position: -176px -222px;
|
| 321 |
-
}
|
| 322 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_5 {
|
| 323 |
-
background-position: -235px -222px;
|
| 324 |
-
}
|
| 325 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_6 {
|
| 326 |
-
background-position: -293px -222px;
|
| 327 |
-
}
|
| 328 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_7 {
|
| 329 |
-
background-position: -350px -222px;
|
| 330 |
-
}
|
| 331 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_8 {
|
| 332 |
-
background-position: -409px -222px;
|
| 333 |
-
}
|
| 334 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_9 {
|
| 335 |
-
background-position: -467px -222px;
|
| 336 |
-
}
|
| 337 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_10 {
|
| 338 |
-
background-position: -526px -222px;
|
| 339 |
-
}
|
| 340 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_4_11 {
|
| 341 |
-
background-position: -711px -222px;
|
| 342 |
-
}
|
| 343 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_1 {
|
| 344 |
-
background-position: 0 -296px;
|
| 345 |
-
}
|
| 346 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_2 {
|
| 347 |
-
background-position: -60px -296px;
|
| 348 |
-
}
|
| 349 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_3 {
|
| 350 |
-
background-position: -118px -296px;
|
| 351 |
-
}
|
| 352 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_4 {
|
| 353 |
-
background-position: -176px -296px;
|
| 354 |
-
}
|
| 355 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_5 {
|
| 356 |
-
background-position: -235px -296px;
|
| 357 |
-
}
|
| 358 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_6 {
|
| 359 |
-
background-position: -293px -296px;
|
| 360 |
-
}
|
| 361 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_7 {
|
| 362 |
-
background-position: -350px -296px;
|
| 363 |
-
}
|
| 364 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_8 {
|
| 365 |
-
background-position: -409px -296px;
|
| 366 |
-
}
|
| 367 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_9 {
|
| 368 |
-
background-position: -467px -296px;
|
| 369 |
-
}
|
| 370 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_10 {
|
| 371 |
-
background-position: -526px -296px;
|
| 372 |
-
}
|
| 373 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_5_11 {
|
| 374 |
-
background-position: -711px -296px;
|
| 375 |
-
}
|
| 376 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_1 {
|
| 377 |
-
background-position: 0 -370px;
|
| 378 |
-
}
|
| 379 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_2 {
|
| 380 |
-
background-position: -60px -370px;
|
| 381 |
-
}
|
| 382 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_3 {
|
| 383 |
-
background-position: -118px -370px;
|
| 384 |
-
}
|
| 385 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_4 {
|
| 386 |
-
background-position: -176px -370px;
|
| 387 |
-
}
|
| 388 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_5 {
|
| 389 |
-
background-position: -235px -370px;
|
| 390 |
-
}
|
| 391 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_6 {
|
| 392 |
-
background-position: -293px -370px;
|
| 393 |
-
}
|
| 394 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_7 {
|
| 395 |
-
background-position: -350px -370px;
|
| 396 |
-
}
|
| 397 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_8 {
|
| 398 |
-
background-position: -409px -370px;
|
| 399 |
-
}
|
| 400 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_9 {
|
| 401 |
-
background-position: -468px -370px;
|
| 402 |
-
}
|
| 403 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_10 {
|
| 404 |
-
background-position: -526px -370px;
|
| 405 |
-
}
|
| 406 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_6_11 {
|
| 407 |
-
background-position: -711px -370px;
|
| 408 |
-
}
|
| 409 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_1 {
|
| 410 |
-
background-position: 0 -444px;
|
| 411 |
-
}
|
| 412 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_2 {
|
| 413 |
-
background-position: -60px -444px;
|
| 414 |
-
}
|
| 415 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_3 {
|
| 416 |
-
background-position: -118px -444px;
|
| 417 |
-
}
|
| 418 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_4 {
|
| 419 |
-
background-position: -176px -444px;
|
| 420 |
-
}
|
| 421 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_5 {
|
| 422 |
-
background-position: -235px -444px;
|
| 423 |
-
}
|
| 424 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_6 {
|
| 425 |
-
background-position: -293px -444px;
|
| 426 |
-
}
|
| 427 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_7 {
|
| 428 |
-
background-position: -350px -444px;
|
| 429 |
-
}
|
| 430 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_8 {
|
| 431 |
-
background-position: -409px -444px;
|
| 432 |
-
}
|
| 433 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_9 {
|
| 434 |
-
background-position: -466px -444px;
|
| 435 |
-
}
|
| 436 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_10 {
|
| 437 |
-
background-position: -526px -444px;
|
| 438 |
-
}
|
| 439 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_7_11 {
|
| 440 |
-
background-position: -711px -444px;
|
| 441 |
-
}
|
| 442 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_1 {
|
| 443 |
-
background-position: 0 -518px;
|
| 444 |
-
}
|
| 445 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_2 {
|
| 446 |
-
background-position: -60px -518px;
|
| 447 |
-
}
|
| 448 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_3 {
|
| 449 |
-
background-position: -118px -518px;
|
| 450 |
-
}
|
| 451 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_4 {
|
| 452 |
-
background-position: -176px -518px;
|
| 453 |
-
}
|
| 454 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_5 {
|
| 455 |
-
background-position: -235px -518px;
|
| 456 |
-
}
|
| 457 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_6 {
|
| 458 |
-
background-position: -293px -518px;
|
| 459 |
-
}
|
| 460 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_7 {
|
| 461 |
-
background-position: -350px -518px;
|
| 462 |
-
}
|
| 463 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_8 {
|
| 464 |
-
background-position: -409px -518px;
|
| 465 |
-
}
|
| 466 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_9 {
|
| 467 |
-
background-position: -467px -518px;
|
| 468 |
-
}
|
| 469 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_10 {
|
| 470 |
-
background-position: -526px -518px;
|
| 471 |
-
}
|
| 472 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_8_11 {
|
| 473 |
-
background-position: -711px -518px;
|
| 474 |
-
}
|
| 475 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_1 {
|
| 476 |
-
background-position: 0 -592px;
|
| 477 |
-
}
|
| 478 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_2 {
|
| 479 |
-
background-position: -60px -592px;
|
| 480 |
-
}
|
| 481 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_3 {
|
| 482 |
-
background-position: -118px -592px;
|
| 483 |
-
}
|
| 484 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_4 {
|
| 485 |
-
background-position: -176px -592px;
|
| 486 |
-
}
|
| 487 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_5 {
|
| 488 |
-
background-position: -235px -592px;
|
| 489 |
-
}
|
| 490 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_6 {
|
| 491 |
-
background-position: -293px -592px;
|
| 492 |
-
}
|
| 493 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_7 {
|
| 494 |
-
background-position: -350px -592px;
|
| 495 |
-
}
|
| 496 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_8 {
|
| 497 |
-
background-position: -409px -592px;
|
| 498 |
-
}
|
| 499 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_9 {
|
| 500 |
-
background-position: -467px -592px;
|
| 501 |
-
}
|
| 502 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_10 {
|
| 503 |
-
background-position: -526px -592px;
|
| 504 |
-
}
|
| 505 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_9_11 {
|
| 506 |
-
background-position: -711px -592px;
|
| 507 |
-
}
|
| 508 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_1 {
|
| 509 |
-
background-position: 0 -666px;
|
| 510 |
-
}
|
| 511 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_2 {
|
| 512 |
-
background-position: -60px -666px;
|
| 513 |
-
}
|
| 514 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_3 {
|
| 515 |
-
background-position: -118px -666px;
|
| 516 |
-
}
|
| 517 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_4 {
|
| 518 |
-
background-position: -176px -666px;
|
| 519 |
-
}
|
| 520 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_5 {
|
| 521 |
-
background-position: -235px -666px;
|
| 522 |
-
}
|
| 523 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_6 {
|
| 524 |
-
background-position: -293px -666px;
|
| 525 |
-
}
|
| 526 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_7 {
|
| 527 |
-
background-position: -350px -666px;
|
| 528 |
-
}
|
| 529 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_8 {
|
| 530 |
-
background-position: -409px -666px;
|
| 531 |
-
}
|
| 532 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_9 {
|
| 533 |
-
background-position: -467px -666px;
|
| 534 |
-
}
|
| 535 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_10 {
|
| 536 |
-
background-position: -526px -666px;
|
| 537 |
-
}
|
| 538 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_10_11 {
|
| 539 |
-
background-position: -711px -666px;
|
| 540 |
-
}
|
| 541 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_1 {
|
| 542 |
-
background-position: 0 -740px;
|
| 543 |
-
}
|
| 544 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_2 {
|
| 545 |
-
background-position: -60px -740px;
|
| 546 |
-
}
|
| 547 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_3 {
|
| 548 |
-
background-position: -118px -740px;
|
| 549 |
-
}
|
| 550 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_4 {
|
| 551 |
-
background-position: -176px -740px;
|
| 552 |
-
}
|
| 553 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_5 {
|
| 554 |
-
background-position: -235px -740px;
|
| 555 |
-
}
|
| 556 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_6 {
|
| 557 |
-
background-position: -293px -740px;
|
| 558 |
-
}
|
| 559 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_7 {
|
| 560 |
-
background-position: -350px -740px;
|
| 561 |
-
}
|
| 562 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_8 {
|
| 563 |
-
background-position: -409px -740px;
|
| 564 |
-
}
|
| 565 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_9 {
|
| 566 |
-
background-position: -467px -740px;
|
| 567 |
-
}
|
| 568 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_10 {
|
| 569 |
-
background-position: -526px -740px;
|
| 570 |
-
}
|
| 571 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_11_11 {
|
| 572 |
-
background-position: -711px -740px;
|
| 573 |
-
}
|
| 574 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_1 {
|
| 575 |
-
background-position: 0 -814px;
|
| 576 |
-
}
|
| 577 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_2 {
|
| 578 |
-
background-position: -60px -814px;
|
| 579 |
-
}
|
| 580 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_3 {
|
| 581 |
-
background-position: -118px -814px;
|
| 582 |
-
}
|
| 583 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_4 {
|
| 584 |
-
background-position: -176px -814px;
|
| 585 |
-
}
|
| 586 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_5 {
|
| 587 |
-
background-position: -235px -814px;
|
| 588 |
-
}
|
| 589 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_6 {
|
| 590 |
-
background-position: -293px -814px;
|
| 591 |
-
}
|
| 592 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_7 {
|
| 593 |
-
background-position: -350px -814px;
|
| 594 |
-
}
|
| 595 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_8 {
|
| 596 |
-
background-position: -409px -814px;
|
| 597 |
-
}
|
| 598 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_9 {
|
| 599 |
-
background-position: -467px -814px;
|
| 600 |
-
}
|
| 601 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_10 {
|
| 602 |
-
background-position: -526px -814px;
|
| 603 |
-
}
|
| 604 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_12_11 {
|
| 605 |
-
background-position: -711px -814px;
|
| 606 |
-
}
|
| 607 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_1 {
|
| 608 |
-
background-position: 0 -888px;
|
| 609 |
-
}
|
| 610 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_2 {
|
| 611 |
-
background-position: -60px -888px;
|
| 612 |
-
}
|
| 613 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_3 {
|
| 614 |
-
background-position: -118px -888px;
|
| 615 |
-
}
|
| 616 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_4 {
|
| 617 |
-
background-position: -176px -888px;
|
| 618 |
-
}
|
| 619 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_5 {
|
| 620 |
-
background-position: -235px -888px;
|
| 621 |
-
}
|
| 622 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_6 {
|
| 623 |
-
background-position: -293px -888px;
|
| 624 |
-
}
|
| 625 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_7 {
|
| 626 |
-
background-position: -350px -888px;
|
| 627 |
-
}
|
| 628 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_8 {
|
| 629 |
-
background-position: -409px -888px;
|
| 630 |
-
}
|
| 631 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_9 {
|
| 632 |
-
background-position: -467px -888px;
|
| 633 |
-
}
|
| 634 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_10 {
|
| 635 |
-
background-position: -526px -888px;
|
| 636 |
-
}
|
| 637 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_13_11 {
|
| 638 |
-
background-position: -711px -888px;
|
| 639 |
-
}
|
| 640 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_1 {
|
| 641 |
-
background-position: 0 -962px;
|
| 642 |
-
}
|
| 643 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_2 {
|
| 644 |
-
background-position: -60px -962px;
|
| 645 |
-
}
|
| 646 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_3 {
|
| 647 |
-
background-position: -118px -962px;
|
| 648 |
-
}
|
| 649 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_4 {
|
| 650 |
-
background-position: -176px -962px;
|
| 651 |
-
}
|
| 652 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_5 {
|
| 653 |
-
background-position: -235px -962px;
|
| 654 |
-
}
|
| 655 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_6 {
|
| 656 |
-
background-position: -293px -962px;
|
| 657 |
-
}
|
| 658 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_7 {
|
| 659 |
-
background-position: -350px -962px;
|
| 660 |
-
}
|
| 661 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_8 {
|
| 662 |
-
background-position: -409px -962px;
|
| 663 |
-
}
|
| 664 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_9 {
|
| 665 |
-
background-position: -467px -962px;
|
| 666 |
-
}
|
| 667 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_10 {
|
| 668 |
-
background-position: -526px -962px;
|
| 669 |
-
}
|
| 670 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_14_11 {
|
| 671 |
-
background-position: -711px -962px;
|
| 672 |
-
}
|
| 673 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_1 {
|
| 674 |
-
background-position: 0 -1036px;
|
| 675 |
-
}
|
| 676 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_2 {
|
| 677 |
-
background-position: -60px -1036px;
|
| 678 |
-
}
|
| 679 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_3 {
|
| 680 |
-
background-position: -118px -1036px;
|
| 681 |
-
}
|
| 682 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_4 {
|
| 683 |
-
background-position: -176px -1036px;
|
| 684 |
-
}
|
| 685 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_5 {
|
| 686 |
-
background-position: -235px -1036px;
|
| 687 |
-
}
|
| 688 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_6 {
|
| 689 |
-
background-position: -293px -1036px;
|
| 690 |
-
}
|
| 691 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_7 {
|
| 692 |
-
background-position: -350px -1036px;
|
| 693 |
-
}
|
| 694 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_8 {
|
| 695 |
-
background-position: -409px -1036px;
|
| 696 |
-
}
|
| 697 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_9 {
|
| 698 |
-
background-position: -467px -1036px;
|
| 699 |
-
}
|
| 700 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_10 {
|
| 701 |
-
background-position: -526px -1036px;
|
| 702 |
-
}
|
| 703 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_15_11 {
|
| 704 |
-
background-position: -711px -1036px;
|
| 705 |
-
}
|
| 706 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_1 {
|
| 707 |
-
background-position: 0 -1109px;
|
| 708 |
-
}
|
| 709 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_2 {
|
| 710 |
-
background-position: -60px -1109px;
|
| 711 |
-
}
|
| 712 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_3 {
|
| 713 |
-
background-position: -118px -1109px;
|
| 714 |
-
}
|
| 715 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_4 {
|
| 716 |
-
background-position: -176px -1109px;
|
| 717 |
-
}
|
| 718 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_5 {
|
| 719 |
-
background-position: -235px -1109px;
|
| 720 |
-
}
|
| 721 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_6 {
|
| 722 |
-
background-position: -293px -1109px;
|
| 723 |
-
}
|
| 724 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_7 {
|
| 725 |
-
background-position: -350px -1109px;
|
| 726 |
-
}
|
| 727 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_8 {
|
| 728 |
-
background-position: -409px -1109px;
|
| 729 |
-
}
|
| 730 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_9 {
|
| 731 |
-
background-position: -467px -1109px;
|
| 732 |
-
}
|
| 733 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_10 {
|
| 734 |
-
background-position: -526px -1109px;
|
| 735 |
-
}
|
| 736 |
-
.sfsiplus_icns_tab_3 .sfsiplus_row_16_11 {
|
| 737 |
-
background-position: -711px -1109px;
|
| 738 |
-
}
|
| 739 |
-
/*Admin menu*/
|
| 740 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options div.wp-menu-image {
|
| 741 |
-
display: none;
|
| 742 |
-
}
|
| 743 |
-
#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options {
|
| 744 |
-
padding: 0 0 0 38px;
|
| 745 |
-
font-family: helveticabold;
|
| 746 |
-
}
|
| 747 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options {
|
| 748 |
-
color: #e12522;
|
| 749 |
-
transition: 0s;
|
| 750 |
-
background: url(images/left_log_icn.png) 6px 15px no-repeat #000;
|
| 751 |
-
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
| 752 |
-
color: #fafafa;
|
| 753 |
-
}
|
| 754 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options:hover {
|
| 755 |
-
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
| 756 |
-
color: #fafafa;
|
| 757 |
-
}
|
| 758 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options a.wp-has-current-submenu, ul#adminmenu li.toplevel_page_sfsi-plus-options a.wp-has-current-submenu:hover {
|
| 759 |
-
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000;
|
| 760 |
-
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
| 761 |
-
color: #e12522;
|
| 762 |
-
}
|
| 763 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options a.current, ul#adminmenu li.toplevel_page_sfsi-plus-options a.current:hover {
|
| 764 |
-
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000 !important;
|
| 765 |
-
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
| 766 |
-
color: #e12522 !important;
|
| 767 |
-
}
|
| 768 |
-
/*tab 9 css*/
|
| 769 |
-
.tab9 .sfsi_plus_tab8_container
|
| 770 |
-
{
|
| 771 |
-
width: 100%; float: left;
|
| 772 |
-
}
|
| 773 |
-
.tab9 .sfsi_plus_tab8_subcontainer {
|
| 774 |
-
float: left;
|
| 775 |
-
padding: 20px 0;
|
| 776 |
-
width: 100%;
|
| 777 |
-
}
|
| 778 |
-
.tab9 h3.sfsi_plus_section_title {
|
| 779 |
-
font-weight: bold;
|
| 780 |
-
}
|
| 781 |
-
.tab9 .like_pop_box {
|
| 782 |
-
width: 100%;
|
| 783 |
-
margin: 35px auto auto;
|
| 784 |
-
position: relative;
|
| 785 |
-
text-align: center;
|
| 786 |
-
}
|
| 787 |
-
.tab9 .like_pop_box h2 {
|
| 788 |
-
font-family: helveticabold;
|
| 789 |
-
text-align: center;
|
| 790 |
-
color: #414951;
|
| 791 |
-
font-size: 26px;
|
| 792 |
-
}
|
| 793 |
-
.tab9 .sfsi_plus_subscribe_Popinner {
|
| 794 |
-
display: inline-block;
|
| 795 |
-
padding: 18px 20px;
|
| 796 |
-
-webkit-box-shadow: 0 0 5px #ccc;
|
| 797 |
-
border: 1px solid #ededed;
|
| 798 |
-
background: #FFF;
|
| 799 |
-
position: relative;
|
| 800 |
-
}
|
| 801 |
-
.tab9 .sfsi_plus_subscribe_Popinner .form-overlay {
|
| 802 |
-
height: 100%;
|
| 803 |
-
left: 0;
|
| 804 |
-
position: absolute;
|
| 805 |
-
top: 0;
|
| 806 |
-
width: 100%;
|
| 807 |
-
}
|
| 808 |
-
.tab9 .like_pop_box .sfsi_plus_subscribe_Popinner {
|
| 809 |
-
box-shadow: 0 0 5px #ccc;
|
| 810 |
-
}
|
| 811 |
-
.tab9 .like_pop_box .sfsi_plus_subscribe_Popinner h5 {
|
| 812 |
-
margin: 0 0 10px;
|
| 813 |
-
padding: 0;
|
| 814 |
-
color: #414951;
|
| 815 |
-
font-size: 22px;
|
| 816 |
-
text-align: center;
|
| 817 |
-
}
|
| 818 |
-
.tab9 .sfsi_plus_subscribe_Popinner h5 {
|
| 819 |
-
margin: 0 0 10px;
|
| 820 |
-
padding: 0;
|
| 821 |
-
color: #414951;
|
| 822 |
-
font-size: 18px;
|
| 823 |
-
text-align: center;
|
| 824 |
-
}
|
| 825 |
-
.tab9 .sfsi_plus_subscription_form_field {
|
| 826 |
-
float: left;
|
| 827 |
-
margin: 5px 0;
|
| 828 |
-
width: 100%;
|
| 829 |
-
}
|
| 830 |
-
.tab9 .sfsi_plus_subscription_form_field input {
|
| 831 |
-
padding: 10px 0px;
|
| 832 |
-
text-align: center;
|
| 833 |
-
width: 100%;
|
| 834 |
-
}
|
| 835 |
-
.tab9 .sfsi_plus_tab8_subcontainer label.sfsi_plus_label_text {
|
| 836 |
-
float: left;
|
| 837 |
-
margin: 10px 0;
|
| 838 |
-
width: 100%;
|
| 839 |
-
}
|
| 840 |
-
.tab9 ul.sfsi_plus_form_info {
|
| 841 |
-
list-style: none !important;
|
| 842 |
-
margin-left: 32px;
|
| 843 |
-
}
|
| 844 |
-
.tab9 ul.sfsi_plus_form_info li {
|
| 845 |
-
margin: 3px 0;
|
| 846 |
-
}
|
| 847 |
-
.tab9 .sfsi_plus_subscription_html {
|
| 848 |
-
background-color: #e5e5e5;
|
| 849 |
-
float: left;
|
| 850 |
-
margin: 12px 0 0 30px;
|
| 851 |
-
width: 90%;
|
| 852 |
-
}
|
| 853 |
-
.tab9 .sfsi_plus_seprater
|
| 854 |
-
{
|
| 855 |
-
border-bottom: 1px solid #ccc;
|
| 856 |
-
}
|
| 857 |
-
.tab9 .sfsi_plus_tab8_subcontainer h5.sfsi_plus_section_subtitle {
|
| 858 |
-
float: left;
|
| 859 |
-
font-size: 18px;
|
| 860 |
-
margin: 5px 0;
|
| 861 |
-
width: 100%;
|
| 862 |
-
}
|
| 863 |
-
.tab9 .sfsi_plus_left_container {
|
| 864 |
-
margin-top: 30px;
|
| 865 |
-
text-align: center;
|
| 866 |
-
width: 24%;
|
| 867 |
-
display: inline-block;
|
| 868 |
-
}
|
| 869 |
-
.tab9 .sfsi_plus_right_container {
|
| 870 |
-
display: inline-block;
|
| 871 |
-
margin-top: 30px;
|
| 872 |
-
padding: 0 20px;
|
| 873 |
-
vertical-align: top;
|
| 874 |
-
width: 72%;
|
| 875 |
-
}
|
| 876 |
-
.tab9 .row_tab {
|
| 877 |
-
display: inline-block;
|
| 878 |
-
margin-bottom: 30px;
|
| 879 |
-
width: 100%;
|
| 880 |
-
}
|
| 881 |
-
.tab9 .row_tab label {
|
| 882 |
-
color: #5a6570;
|
| 883 |
-
font-size: 16px;
|
| 884 |
-
}
|
| 885 |
-
.tab9 .row_tab div.sfsi_plus_field{
|
| 886 |
-
display: inline-block;
|
| 887 |
-
vertical-align: middle;
|
| 888 |
-
width: auto;
|
| 889 |
-
margin-right: 25px;
|
| 890 |
-
}
|
| 891 |
-
.tab9 .color_box {
|
| 892 |
-
width: 40px;
|
| 893 |
-
height: 34px;
|
| 894 |
-
border: 3px solid #fff;
|
| 895 |
-
box-shadow: 1px 2px 2px #ccc;
|
| 896 |
-
float: right;
|
| 897 |
-
position: relative;
|
| 898 |
-
margin-left: 13px;
|
| 899 |
-
}
|
| 900 |
-
.tab9 .color_box1 {
|
| 901 |
-
width: 100%;
|
| 902 |
-
height: 34px;
|
| 903 |
-
background: #5a6570;
|
| 904 |
-
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
| 905 |
-
}
|
| 906 |
-
.tab9 .corner {
|
| 907 |
-
width: 10px;
|
| 908 |
-
height: 10px;
|
| 909 |
-
background: #fff;
|
| 910 |
-
position: absolute;
|
| 911 |
-
right: 0;
|
| 912 |
-
bottom: 0;
|
| 913 |
-
}
|
| 914 |
-
.tab9 .sfsi_plus_right_container label {
|
| 915 |
-
color: #5a6570;
|
| 916 |
-
font-size: 18px;
|
| 917 |
-
}
|
| 918 |
-
.tab9 label.sfsi_plus_heding {
|
| 919 |
-
display: inline-block;
|
| 920 |
-
font-weight: bold;
|
| 921 |
-
padding-top: 10px;
|
| 922 |
-
width: 303px;
|
| 923 |
-
}
|
| 924 |
-
.tab9 .border_shadow {
|
| 925 |
-
display: inline-block;
|
| 926 |
-
vertical-align: top;
|
| 927 |
-
}
|
| 928 |
-
.tab9 .border_shadow li {
|
| 929 |
-
display: inline-block;
|
| 930 |
-
vertical-align: top;
|
| 931 |
-
padding-right: 20px;
|
| 932 |
-
}
|
| 933 |
-
.tab9 .border_shadow li span {
|
| 934 |
-
vertical-align: middle;
|
| 935 |
-
}
|
| 936 |
-
.tab9 .border_shadow .radio{
|
| 937 |
-
margin-right:5px;
|
| 938 |
-
}
|
| 939 |
-
.tab9 .sfsi_plus_field .rec-inp {
|
| 940 |
-
background: #e5e5e5 none repeat scroll 0 0;
|
| 941 |
-
height: 44px;
|
| 942 |
-
text-align: center;
|
| 943 |
-
width: 54px;
|
| 944 |
-
}
|
| 945 |
-
.tab9 .pix {
|
| 946 |
-
color: #5a6570;
|
| 947 |
-
font-size: 18px;
|
| 948 |
-
padding-left: 10px;
|
| 949 |
-
vertical-align: middle;
|
| 950 |
-
}
|
| 951 |
-
.tab9 .sfsi_plus_heding.autowidth {
|
| 952 |
-
width: auto;
|
| 953 |
-
margin-right: 15px;
|
| 954 |
-
}
|
| 955 |
-
.tab9 .sfsi_plus_heding.fixwidth {
|
| 956 |
-
width: 80px;
|
| 957 |
-
}
|
| 958 |
-
.tab9 .small {
|
| 959 |
-
background-color: #e5e5e5;
|
| 960 |
-
height: 44px;
|
| 961 |
-
width: 200px;
|
| 962 |
-
}
|
| 963 |
-
.tab9 .small.new-inp {
|
| 964 |
-
background-color: #e5e5e5;
|
| 965 |
-
height: 44px;
|
| 966 |
-
width: 277px;
|
| 967 |
-
}
|
| 968 |
-
.tab9 .small.color-code {
|
| 969 |
-
width: 138px !important;
|
| 970 |
-
}
|
| 971 |
-
.tab9 .select-same {
|
| 972 |
-
border: 1px solid #d6d6d6;
|
| 973 |
-
height: 47px !important;
|
| 974 |
-
width: 171px;
|
| 975 |
-
appearance:none;
|
| 976 |
-
-moz-appearance:none;
|
| 977 |
-
-webkit-appearance:none;
|
| 978 |
-
background-image: url(images/select-arrow.png);
|
| 979 |
-
background-repeat:no-repeat;
|
| 980 |
-
background-position:right 15px center;
|
| 981 |
-
}
|
| 982 |
-
.tab9 .sfsi_plus_same_width {
|
| 983 |
-
display: inline-block;
|
| 984 |
-
width: 100px !important;
|
| 985 |
-
}
|
| 986 |
-
.sfsi_plus_subscribe_Popinner .sfsi_plus_highlight {
|
| 987 |
-
border: 3px solid red !important;
|
| 988 |
-
}
|
| 989 |
-
.sfsi_plus_subscription_html xmp {
|
| 990 |
-
display: block;
|
| 991 |
-
padding: 0 10px;
|
| 992 |
-
white-space: pre-line;
|
| 993 |
-
word-wrap: break-word;
|
| 994 |
-
}
|
| 995 |
-
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li {
|
| 996 |
-
float: left;
|
| 997 |
-
width: 300px !important;
|
| 998 |
-
max-width: 300px !important;
|
| 999 |
-
min-width: 300px !important;
|
| 1000 |
-
}
|
| 1001 |
-
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec label {
|
| 1002 |
-
font-size: 17px;
|
| 1003 |
-
padding-right: 20px;
|
| 1004 |
-
width: 65px !important;
|
| 1005 |
-
display: inline-block;
|
| 1006 |
-
}
|
| 1007 |
-
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li input {
|
| 1008 |
-
background-color: #dedede;
|
| 1009 |
-
border: medium none;
|
| 1010 |
-
box-shadow: none;
|
| 1011 |
-
padding: 14px 8px;
|
| 1012 |
-
width: 80px;
|
| 1013 |
-
}
|
| 1014 |
-
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li ins {
|
| 1015 |
-
font-size: 17px;
|
| 1016 |
-
font-weight: 400;
|
| 1017 |
-
margin-left: 15px;
|
| 1018 |
-
text-decoration: none;
|
| 1019 |
-
}
|
| 1020 |
-
@media (max-width:1160px) {
|
| 1021 |
-
.sfsi_plus_subscription_html xmp {
|
| 1022 |
-
display: block;
|
| 1023 |
-
padding: 0 10px;
|
| 1024 |
-
white-space: pre-line;
|
| 1025 |
-
word-wrap: break-word;
|
| 1026 |
-
}
|
| 1027 |
-
}
|
| 1028 |
-
@media (max-width:1350px) {
|
| 1029 |
-
.tab9 .sfsi_plus_left_container {
|
| 1030 |
-
width: 100% !important;
|
| 1031 |
-
}
|
| 1032 |
-
.tab9 .sfsi_plus_right_container {
|
| 1033 |
-
width: 100%;
|
| 1034 |
-
}
|
| 1035 |
-
.tab9 .border_shadow {
|
| 1036 |
-
margin-top: 10px;
|
| 1037 |
-
}
|
| 1038 |
-
.tab9 .row_tab div.sfsi_plus_field {
|
| 1039 |
-
margin-bottom: 10px;
|
| 1040 |
-
}
|
| 1041 |
-
}
|
| 1042 |
-
@media (max-width:770px) {
|
| 1043 |
-
#sfsi_plus_form_heading_fontstyle {
|
| 1044 |
-
margin-left: 19px !important;
|
| 1045 |
-
margin-top: 10px !important;
|
| 1046 |
-
}
|
| 1047 |
-
}
|
| 1048 |
-
/*poonam Style*/
|
| 1049 |
-
.feedClaiming-overlay h1 {
|
| 1050 |
-
font-size: 22px !important;
|
| 1051 |
-
font-weight: bolder !important;
|
| 1052 |
-
margin-top: 7px !important;
|
| 1053 |
-
}
|
| 1054 |
-
.feedClaiming-overlay input[type="email"] {
|
| 1055 |
-
font-size: 16px;
|
| 1056 |
-
margin: 26px 0 0;
|
| 1057 |
-
padding: 10px 0;
|
| 1058 |
-
text-align: center;
|
| 1059 |
-
width: 100%;
|
| 1060 |
-
color: #bebebe !important;
|
| 1061 |
-
box-shadow: none;
|
| 1062 |
-
}
|
| 1063 |
-
.feedClaiming-overlay input[type="email"]::-webkit-input-placeholder {
|
| 1064 |
-
color: #bebebe !important;
|
| 1065 |
-
}
|
| 1066 |
-
.feedClaiming-overlay input[type="email"]:-moz-placeholder { /* Firefox 18- */
|
| 1067 |
-
color: #bebebe !important;
|
| 1068 |
-
}
|
| 1069 |
-
.feedClaiming-overlay input[type="email"]::-moz-placeholder { /* Firefox 19+ */
|
| 1070 |
-
color: #bebebe !important;
|
| 1071 |
-
}
|
| 1072 |
-
.feedClaiming-overlay input[type="email"]:-ms-input-placeholder {
|
| 1073 |
-
color: #bebebe !important;
|
| 1074 |
-
}
|
| 1075 |
-
.feedClaiming-overlay .save_button {
|
| 1076 |
-
padding: 0 !important;
|
| 1077 |
-
width: 100%;
|
| 1078 |
-
}
|
| 1079 |
-
.feedClaiming-overlay .save_button a#getMeFullAccess{
|
| 1080 |
-
border-radius: 4px;
|
| 1081 |
-
font-size: 18px;
|
| 1082 |
-
font-weight: bolder;
|
| 1083 |
-
}
|
| 1084 |
-
.feedClaiming-overlay .sfsicloseBtn {
|
| 1085 |
-
right: 8px !important;
|
| 1086 |
-
top: 8px !important;
|
| 1087 |
-
}
|
| 1088 |
-
.feedClaiming-overlay p {text-align:center !important; font-size: 12px !important;line-height: 23px !important;padding: 18px 0 0 !important; color:#bebebe !important; }
|
| 1089 |
-
.feedClaiming-overlay p a {display: inline-block;font-size: 12px;margin: 0;padding: 0;width: auto; color:#274da3 !important; }
|
| 1090 |
-
.feedClaiming-overlay .pop_up_box{padding: 25px 30px !important; width: 435px !important; min-height: 220px;}
|
| 1091 |
-
.follows-btn{float:left;width:25%;}
|
| 1092 |
-
.preview-btn{float:left;width:10%;}
|
| 1093 |
-
.social-img-link{float:left;width:15%;}
|
| 1094 |
-
.social-img-link img{vertical-align:middle;}
|
| 1095 |
-
.language-field{float:left;width:24%;}
|
| 1096 |
-
.language-field select{width:100%;}
|
| 1097 |
-
.icons_size{clear:both;}
|
| 1098 |
-
.plus_custom-img img, .sfsiplus_custom_section img, .sfsiplus_custom_iconOrder img, .plus_sfsi_sample_icons img{
|
| 1099 |
-
width: 51px;
|
| 1100 |
-
}
|
| 1101 |
-
.cstomskins_upload span.sfsi_plus-bgimage
|
| 1102 |
-
{
|
| 1103 |
-
background-size: 51px 51px !important;
|
| 1104 |
-
}
|
| 1105 |
-
|
| 1106 |
-
/* poonam */
|
| 1107 |
-
.sfsi_plus_premium_brdr_box{box-sizing: border-box;}
|
| 1108 |
-
.sf_si_plus_our_prmium_plugin-add, .sfsi_plus_prem_icons_added, .sfsi_plus_new_prmium_follw{background:#f3faf6;border:1px solid #12a252;padding: 25px 38px 35px 40px;clear: both;}
|
| 1109 |
-
.sf_si_plus_our_prmium_plugin-add{padding: 25px 38px 45px 44px;}
|
| 1110 |
-
.sf_si_plus_default_design ul{padding:0;margin:0;}
|
| 1111 |
-
.sf_si_plus_default_design ul li{list-style:none;font-size:20px;color:#1a1d20;clear:both;}
|
| 1112 |
-
.sf_si_plus_default_design ul li b{font-weight: bold;}
|
| 1113 |
-
.sf_si_plus_default_design ul li img{vertical-align: middle;}
|
| 1114 |
-
.sf_si_plus_default_design ul li h4{color:#1a1d20 !important;font-size:20px !important;font-weight:bold;padding-bottom:21px !important;}
|
| 1115 |
-
.sf_si_plus_default_design ul li h4 span{font-weight:normal;}
|
| 1116 |
-
.sf_si_plus_default_design ul li b span{font-weight:normal !important;}
|
| 1117 |
-
.sf_si_plus_default_design ul li{margin:0 !important;}
|
| 1118 |
-
.sf_si_plus_default_design ul li h4.sfsi_plus_second_themedTitle{padding-bottom:16px !important;}
|
| 1119 |
-
.sfsi_plus_row_table{clear:both;}
|
| 1120 |
-
.sfsi_plus_first_icon_field, .sfsi_plus_second_icon_img{display:table-cell;vertical-align:middle;padding: 5px 0;}
|
| 1121 |
-
.sfsi_plus_first_icon_field{width:125px;}
|
| 1122 |
-
.sfsi_plus_first_icon_field h2{font-size:18px !important;color:#1a1d20 !important;margin:0 !important; font-weight: bold !important;}
|
| 1123 |
-
.sfsi_plus_first_icon_field p{color:#1a1d20 !important;font-size:12px !important;margin:0 !important;padding:0 !important; line-height: 18px !important;}
|
| 1124 |
-
.sfsi_plus_cool_font_weight h2{font-weight:normal !important;}
|
| 1125 |
-
.sf_si_plus_prmium_head span{font-weight:normal;}
|
| 1126 |
-
.sf_si_plus_prmium_head h2{font-size:26px;color:#000;font-weight:bold !important;padding-bottom:13px !important; margin-top: 0;}
|
| 1127 |
-
.sf_si_plus_our_prmium_plugin-add .sf_si_plus_prmium_head h2{padding-bottom:23px !important;}
|
| 1128 |
-
.sfsi_plus_premium_row{clear:both;}
|
| 1129 |
-
.sfsi_plus_prem_cmn_rowlisting{width:225px;float:left;margin-top: 10px;margin-bottom:1px;}
|
| 1130 |
-
.sfsi_plus_prem_cmn_rowlisting span{color: #1a1d20;font-size:20px;display:table-cell;vertical-align: middle;padding-right:10px;}
|
| 1131 |
-
.sfsi_mainContainer .sfsi_plus_prem_cmn_rowlisting img{width:52px;height:52px; vertical-align: middle;}
|
| 1132 |
-
.sfsi_plus_need_another_tell_us, .sfsi_plus_need_another_one_link{clear:both;}
|
| 1133 |
-
.sfsi_plus_need_another_one_link p{color: #c1c3c5;font-size: 18.9px !important;}
|
| 1134 |
-
.sfsi_plus_need_another_one_link p a{color:#12a252 !important; text-decoration: none;}
|
| 1135 |
-
.sfsi_plus_need_another_one_link{padding:23px 0 20px 5px; }
|
| 1136 |
-
.sf_si_plus_all_features_premium a, .sfsi_plus_need_another_tell_us a{color:#12a252 !important;font-size:18.9px;font-weight:bold;border-bottom: 1px solid #12a252;text-decoration: none;}
|
| 1137 |
-
.sfsi_plus_need_another_tell_us a{margin-left:5px;}
|
| 1138 |
-
.sfsi_plus_new_prmium_follw {margin-top:20px; display: inline-block;padding:15px 75px 20px 24px;}
|
| 1139 |
-
.sfsi_plus_new_prmium_follw p{margin: 0 !important;}
|
| 1140 |
-
.sfsi_plus_new_prmium_follw p{color: #1a1d20 !important;font-size: 20px !important;font-family: helveticaregular !important;}
|
| 1141 |
-
.sfsi_plus_new_prmium_follw p a{color:#12a252 !important;border-bottom: 1px solid #12a252; text-decoration: none;}
|
| 1142 |
-
.sfsi_plus_new_prmium_follw p b{font-weight:bold;color:#1a1d20 !important;}
|
| 1143 |
-
p.sfsi_plus_prem_plu_desc a, p.sfsi_plus_prem_plu_desc_define a{text-decoration: none!important; color: #00a0d2 !important;}
|
| 1144 |
-
p.sfsi_plus_prem_plu_desc{ font-size:18px !important; }
|
| 1145 |
-
p.sfsi_plus_prem_plu_desc_define{ font-size:18px !important; border-left: 0px solid transparent !important;}
|
| 1146 |
-
.sfsi_plus_icons_prem_disc{ float:left; padding-top:20px; }
|
| 1147 |
-
.sfsi_plus_prem_show{padding-top:140px !important;}
|
| 1148 |
-
.sfsi_plus_first_icon_more h2{font-size:18px !important;color:#1a1d20 !important;margin:0 !important;padding-top:17px !important;padding-bottom:22px !important;}
|
| 1149 |
-
.sfsi_plus_fbpaget{float:left !important;padding: 4px 0 0 0px !important;width:100% !important;}
|
| 1150 |
-
.sfsi_plus_fbpaget .sfsi_plus_facebook_count{width: 100% !important;padding: 4px 0 0 0px !important;}
|
| 1151 |
-
.sfsi_plus_facebook_pagedeasc{ font-size: 14px!important; padding: 15px 0 0 60px ; width: 42%;float: right;line-height: 22px;color: #080808; }
|
| 1152 |
-
p.sfsi_plus_instagram_shared_premium,p.sfsi_plus_shared_premium {color: #1a1d20 !important;font-family: helveticaregular !important;padding-top:0 !important;}
|
| 1153 |
-
p.sfsi_plus_shared_premium a ,p.sfsi_plus_instagram_shared_premium a{text-decoration: none; color: #00a0d2 !important;}
|
| 1154 |
-
p.sfsi_plus_shared_premium b,p.sfsi_plus_instagram_shared_premium b{font-weight:bold;}
|
| 1155 |
-
p.sfsi_plus_instagram_shared_premium{float: right;width: 41%;line-height: 20px;color: #1f1d1d;font-size: 13px;}
|
| 1156 |
-
.sfsi_plus_fb_popup_contain{width:50%;display:inline-block;}
|
| 1157 |
-
.sfsi_plus_icons_align_other{width:auto; font-size: 15px !important;}
|
| 1158 |
-
|
| 1159 |
-
/* notification css*/
|
| 1160 |
-
.sfsi_plus_new_notification{ background-color:#fff; border:4px dashed #00c853;margin-bottom:30px;width: 100%;}
|
| 1161 |
-
.sfsi_plus_new_notification_header{ background-color:#e8faef;display: -webkit-box;display: -webkit-flex;display: -ms-flexbox;display: flex;-webkit-box-align: center;-webkit-align-items: center;-ms-flex-align: center;align-items: center;-webkit-box-pack: justify;-webkit-justify-content: space-between;-ms-flex-pack: justify;justify-content: space-between;padding:10px 0 12px 0;}
|
| 1162 |
-
.sfsi_plus_new_notification_header h1{ margin:0 !important;color:#00c853;font-size:18px;margin: 0 auto !important;font-family:Arial, Helvetica, sans-serif;}
|
| 1163 |
-
.sfsi_plus_new_notification_header h1 a{ margin:0 !important;color:#00c853;font-size:18px;margin: 0 auto !important;font-family:Arial, Helvetica, sans-serif; text-decoration: none;}
|
| 1164 |
-
.sfsi_plus_new_notification_cross {float: right;font-size:18px;font-weight: 700;line-height: 1;color: #00c853;font-family:Arial, Helvetica, sans-serif;margin-right: 15px; cursor: pointer;}
|
| 1165 |
-
.sfsi_plus_new_notification_body{width: 100%;background-color:#fff;display: -webkit-box;display: -webkit-flex;display: -ms-flexbox;display: flex;-webkit-box-align: center;-webkit-align-items: center;-ms-flex-align: center;align-items: center;-webkit-box-pack: justify;-webkit-justify-content: space-between;-ms-flex-pack: justify;justify-content: space-between;}
|
| 1166 |
-
.sfsi_plus_new_notification_image{margin:0 20px 0px 20px;width: 100%;text-align: center;overflow: hidden;}
|
| 1167 |
-
.sfsi_plus_new_notification_image img{ width:auto;}
|
| 1168 |
-
.sfsi_plus_new_notification_learnmore{float:right;}
|
| 1169 |
-
.sfsi_plus_new_notification_learnmore {background-color: #00c853; display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;width: 150px; margin-bottom: -4px;margin-right: -4px; position: relative;color: #fff;padding: 70px 10px;
|
| 1170 |
-
}
|
| 1171 |
-
.sfsi_plus_new_notification_body_link a{
|
| 1172 |
-
display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;
|
| 1173 |
-
}
|
| 1174 |
-
/*Tab 4*/
|
| 1175 |
-
.tab4 .sfsi_plus_tokenGenerateButton { margin: 25px 0; }
|
| 1176 |
-
.tab4 .sfsi_plus_tokenGenerateButton p { display: inline-block; margin-bottom: 11px; vertical-align: middle;width: 100%; }
|
| 1177 |
-
.tab4 .sfsi_plus_tokenGenerateButton a { background-color: #12a252; color: #fff; padding: 10px 20px; text-decoration: none; }
|
| 1178 |
-
.tab4 .sfsi_plus_instagramInstruction { float: left; margin-bottom: 12px; width: 450px;}
|
| 1179 |
-
.tab4 .sfsi_plus_instagramInstruction ul { padding-left: 14px !important; }
|
| 1180 |
-
.tab4 .sfsi_plus_instagramInstruction ul li { font-size: 13px !important; line-height: 20px !important; list-style: outside none bullets !important;margin-top: 5px !important;padding: 0 !important;}
|
| 1181 |
-
.tab4 .sfsi_instagram_follower{width: 50%;float: left;}
|
| 1182 |
-
|
| 1183 |
-
/* tab2 emailsection */
|
| 1184 |
-
.sfsi_plus_service_row{margin-right: -15px;margin-left: -15px;}
|
| 1185 |
-
.sfsi_plus_service_column{float: left;margin-bottom: 40px;margin-top: 15px;padding-left: 30px;width: 47%;}
|
| 1186 |
-
.sfsi_plus_service_column ul{margin-left: 11% !important;}
|
| 1187 |
-
.sfsi_plus_service_column ul li{padding-bottom:10px;font-size:16px;line-height: 25px; }
|
| 1188 |
-
.sfsi_plus_service_column ul li span{color:#12a252;}
|
| 1189 |
-
.sfsi_plus_service_column ul li::before {content: url(../images/tick-icon.png); position: relative; top: 0px; right: 10px; text-indent: -22px; float: left; }
|
| 1190 |
-
.sfsi_plus_inputbtn{clear: both;display: block;}
|
| 1191 |
-
.sfsi_plus_inputbtn input{width: 100%; padding: 15px 0px; text-align: center; margin-bottom: 10px; }
|
| 1192 |
-
.sfsi_plus_email_services_text{clear: both;}
|
| 1193 |
-
.sfsi_plus_email_services_paragraph{ width: 600px; float: left; margin-top: 10px; margin-bottom:40px;}
|
| 1194 |
-
.sfsi_plus_more_services_link a{ background-color: #12a252;color: #fff !important; padding:20px 0px;text-decoration: none;text-align: center;font-size: 20px;display: block;clear: both; font-weight: bold;}
|
| 1195 |
-
.sfsi_plus_subscribe_popbox_link a{color: #00a0d2 !important;}
|
| 1196 |
-
.sfsi_plus_email_services_paragraph ul{margin-left: 11% !important;}
|
| 1197 |
-
.sfsi_plus_email_services_paragraph ul li{padding-bottom:10px;font-size:16px; }
|
| 1198 |
-
.sfsi_plus_email_services_paragraph ul li span{color:#12a252;}
|
| 1199 |
-
.sfsi_plus_email_services_paragraph ul li::before {content: url(../images/tick-icon.png); position: relative; top: 5px; right: 10px; text-indent: -22px; float: left; }
|
| 1200 |
-
.sfsi_plus_email_last_paragraph {width: 60%; text-align: center !important; margin: 20px auto ! important; font-size: 16px !important; color: #a4a9ad !important; padding-top: 0px!important; }
|
| 1201 |
-
.sfsi_plus_email_last_paragraph a{color:#12a252 !important;font-family: 'helveticaneue-light' !important;}
|
| 1202 |
-
.pop_up_box.sfsi_pop_up.sfsi_pop_box{padding: 25px 30px 0 !important;}
|
| 1203 |
-
#adminmenu #toplevel_page_sfsi-plus-options ul .wp-first-item{
|
| 1204 |
-
display: none;
|
| 1205 |
-
}
|
| 1206 |
-
ul#adminmenu li.toplevel_page_sfsi-plus-options ul.wp-submenu a.current, ul#adminmenu li.toplevel_page_sfsi-plus-options ul.wp-submenu a.current:hover{
|
| 1207 |
-
background: none !important;
|
| 1208 |
-
|
| 1209 |
-
}
|
| 1210 |
-
/*new banner styles*/
|
| 1211 |
-
.sfsi_plus_new_notification_cat{width: 100%;min-height: 300px; max-width: 700px;}
|
| 1212 |
-
.sfsi_plus_new_notification_cat {background-color: #fff; margin: 30px auto;width: 100%;}
|
| 1213 |
-
.sfsi_plus_new_notification_header_cat {background-color: #e8faef;padding: 21px 0 21px 0;text-align: center;}
|
| 1214 |
-
.sfsi_plus_new_notification_header_cat h1 {margin: 0;color: #000000;font-size: 24px;margin: 0 auto !important;font-family: Arial, Helvetica, sans-serif;font-weight: bold !important;}
|
| 1215 |
-
.sfsi_plus_new_notification_header_cat h3{margin-top: 10px !important;font-size: 16px;color: #000000;}
|
| 1216 |
-
.sfsi_plus_new_notification_header_cat h3 a{text-decoration: none;color: #38B54A;}
|
| 1217 |
-
.sfsi_plus_new_notification_header_cat h1 a {margin: 0;color: #00c853;font-size: 18px;margin: 0 auto;font-family: Arial, Helvetica, sans-serif;text-decoration: none;}
|
| 1218 |
-
.sfsi_plus_new_notification_cross_cat {float: right;font-size: 18px;font-weight: 700;line-height: 1;color: #000000;font-family: Arial, Helvetica, sans-serif;margin-right: 15px;cursor: pointer;margin-top: -50px;}
|
| 1219 |
-
.sfsi_plus_new_notification_body_link_cat a {display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;}
|
| 1220 |
-
.sfsi_plus_new_notification_body_cat {width: 100%;background-color: #fff; }
|
| 1221 |
-
.sfsi_plus_new_notification_image_cat { width: 100%;text-align: center; overflow: hidden;}
|
| 1222 |
-
.sfsi_plus_new_notification_image_cat img {width: auto; border: 0;vertical-align: middle;}
|
| 1223 |
-
.sfsiplus_bottom_text{ background: #38B54A;text-align: center;padding: 15px 0px;font-size: 18px;font-weight: bold;color: #fff;}
|
| 1224 |
-
.sfsi_plus_new_notification_image_cat p{color: #000000;padding: 10px;font-size: 16px;}
|
| 1225 |
-
.sfsi_plus_new_notification_body_link_cat .sfsi_plus_tailored_icons_img{display: block;text-decoration: none; text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;margin: 28px 0px;}
|
| 1226 |
-
|
| 1227 |
-
/**curl error box*/
|
| 1228 |
-
.sfsiplus_curlerror{margin: 0px 0px 10px 94px;background: rgba(244, 67, 54, 0.08);padding: 20px; line-height: 20px;}
|
| 1229 |
-
.sfsi_plus_versionNotification .sfsiplus_curlerror{background:rgba(244, 67, 54, 0.08);padding: 20px; line-height: 20px; margin: 0px 0px 10px 0px;}
|
| 1230 |
-
.sfsi_plus_curlerror_cross{float: right;text-decoration: underline;margin-top: 10px;}
|
| 1231 |
-
.sfsiplus_curlerrortab4 a{color: #0073aa !important;}
|
| 1232 |
.sfsiplus_curlerror a{color: #0073aa !important;}
|
| 1 |
+
@charset "utf-8";
|
| 2 |
+
@font-face {
|
| 3 |
+
font-family: helveticabold;
|
| 4 |
+
src: url(fonts/helvetica_bold_0-webfont.eot);
|
| 5 |
+
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
| 6 |
+
font-weight: 400;
|
| 7 |
+
font-style: normal;
|
| 8 |
+
}
|
| 9 |
+
@font-face {
|
| 10 |
+
font-family: helveticaregular;
|
| 11 |
+
src: url(fonts/helvetica_0-webfont.eot);
|
| 12 |
+
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
| 13 |
+
font-weight: 400;
|
| 14 |
+
font-style: normal;
|
| 15 |
+
}
|
| 16 |
+
@font-face {
|
| 17 |
+
font-family: helveticaneue-light;
|
| 18 |
+
src: url(fonts/helveticaneue-light.eot);
|
| 19 |
+
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
| 20 |
+
url(fonts/helveticaneue-light.woff) format('woff'),
|
| 21 |
+
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
| 22 |
+
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
| 23 |
+
font-weight: 400;
|
| 24 |
+
font-style: normal;
|
| 25 |
+
}
|
| 26 |
+
body {
|
| 27 |
+
margin: 0;
|
| 28 |
+
padding: 0;
|
| 29 |
+
}
|
| 30 |
+
/*Tab 1*/
|
| 31 |
+
.tab1 ul.plus_icn_listing li .custom, .tab1 ul.plus_icn_listing li .sfsicls_email, .tab1 ul.plus_icn_listing li .sfsicls_facebook, .tab1 ul.plus_icn_listing li .sfsicls_ggle_pls, .tab1 ul.plus_icn_listing li .sfsicls_instagram, .tab1 ul.plus_icn_listing li .sfsicls_houzz, .tab1 ul.plus_icn_listing li .sfsicls_linkdin, .tab1 ul.plus_icn_listing li .sfsicls_pinterest, .tab1 ul.plus_icn_listing li .sfsicls_rs_s, .tab1 ul.plus_icn_listing li .sfsicls_share, .tab1 ul.plus_icn_listing li .sfsicls_twt, .tab1 ul.plus_icn_listing li .sfsicls_utube {
|
| 32 |
+
background: url(../images/tab_1_icn_list.png) no-repeat;
|
| 33 |
+
float: left;
|
| 34 |
+
padding: 0 0 0 59px;
|
| 35 |
+
margin: 0 0 0 17px;
|
| 36 |
+
height: 52px;
|
| 37 |
+
line-height: 51px;
|
| 38 |
+
font-family: helveticaregular;
|
| 39 |
+
font-size: 22px;
|
| 40 |
+
}
|
| 41 |
+
.tab1 ul.plus_icn_listing li .sfsicls_rs_s {
|
| 42 |
+
background-position: 0 0;
|
| 43 |
+
color: #f7941d;
|
| 44 |
+
}
|
| 45 |
+
.tab1 ul.plus_icn_listing li .sfsicls_email {
|
| 46 |
+
background-position: 0 -73px;
|
| 47 |
+
color: #d1c800;
|
| 48 |
+
}
|
| 49 |
+
.tab1 ul.plus_icn_listing li .sfsicls_facebook {
|
| 50 |
+
background-position: 0 -145px;
|
| 51 |
+
color: #004088;
|
| 52 |
+
}
|
| 53 |
+
.tab1 ul.plus_icn_listing li .sfsicls_twt {
|
| 54 |
+
background-position: 0 -221px;
|
| 55 |
+
color: #00abe3;
|
| 56 |
+
}
|
| 57 |
+
.tab1 ul.plus_icn_listing li .sfsicls_ggle_pls {
|
| 58 |
+
background-position: 0 -295px;
|
| 59 |
+
color: #444749;
|
| 60 |
+
}
|
| 61 |
+
.tab1 ul.plus_icn_listing li .sfsicls_share {
|
| 62 |
+
background-position: 0 -372px;
|
| 63 |
+
color: #ef4746;
|
| 64 |
+
}
|
| 65 |
+
.tab1 ul.plus_icn_listing li .sfsicls_utube {
|
| 66 |
+
background-position: 0 -448px;
|
| 67 |
+
color: #f07963;
|
| 68 |
+
}
|
| 69 |
+
.tab1 ul.plus_icn_listing li .sfsicls_linkdin {
|
| 70 |
+
background-position: 0 -548px;
|
| 71 |
+
color: #1e88c9;
|
| 72 |
+
}
|
| 73 |
+
.tab1 ul.plus_icn_listing li .sfsicls_pinterest {
|
| 74 |
+
background-position: 0 -623px;
|
| 75 |
+
color: #f15f5d;
|
| 76 |
+
}
|
| 77 |
+
.tab1 ul.plus_icn_listing li .sfsicls_instagram {
|
| 78 |
+
background-position: 0 -781px;
|
| 79 |
+
color: #369;
|
| 80 |
+
}
|
| 81 |
+
.tab1 ul.plus_icn_listing li .sfsicls_houzz {
|
| 82 |
+
background-position: 0 -939px;
|
| 83 |
+
color: #369;
|
| 84 |
+
}
|
| 85 |
+
.tab1 ul.plus_icn_listing li .custom {
|
| 86 |
+
background-position: 0 -702px;
|
| 87 |
+
color: #5a6570;
|
| 88 |
+
}
|
| 89 |
+
.tab1 ul.plus_icn_listing li .sfsiplus_right_info {
|
| 90 |
+
width: 70%;
|
| 91 |
+
float: right;
|
| 92 |
+
font-family: helveticaregular;
|
| 93 |
+
margin-right: 13px;
|
| 94 |
+
}
|
| 95 |
+
ul.plus_icn_listing li .sfsiplus_right_info a {
|
| 96 |
+
text-decoration: underline;
|
| 97 |
+
color: #a4a9ad;
|
| 98 |
+
font-size: 16px;
|
| 99 |
+
}
|
| 100 |
+
ul.sfsiplus_icn_listing8 li .sfsiplus_right_info a {
|
| 101 |
+
text-decoration: underline;
|
| 102 |
+
color: #a4a9ad;
|
| 103 |
+
font-size: 16px;
|
| 104 |
+
}
|
| 105 |
+
.tab1 .tab_2_sav {
|
| 106 |
+
padding-top: 30px;
|
| 107 |
+
}
|
| 108 |
+
/*Tab 2*/
|
| 109 |
+
.tab2 .row h2.sfsicls_email, .tab2 .row h2.sfsicls_facebook, .tab2 .row h2.sfsicls_ggle_pls, .tab2 .row h2.sfsicls_instagram, .tab2 .row h2.sfsicls_houzz, .tab2 .row h2.sfsicls_linkdin, .tab2 .row h2.sfsicls_pinterest, .tab2 .row h2.sfsicls_rs_s, .tab2 .row h2.sfsicls_share, .tab2 .row h2.sfsicls_twt, .tab2 .row h2.sfsicls_utube {
|
| 110 |
+
background: url(../images/tab_1_icn_list.png) no-repeat;
|
| 111 |
+
padding: 0 0 0 70px;
|
| 112 |
+
margin: 15px 0 7px 21px;
|
| 113 |
+
height: 52px;
|
| 114 |
+
line-height: 51px;
|
| 115 |
+
font-family: helveticaregular;
|
| 116 |
+
font-size: 22px;
|
| 117 |
+
}
|
| 118 |
+
.tab2 .row h2.sfsicls_rs_s {
|
| 119 |
+
background-position: 0 0;
|
| 120 |
+
color: #f7941d;
|
| 121 |
+
}
|
| 122 |
+
.tab2 .row h2.sfsicls_email {
|
| 123 |
+
background-position: 0 -71px;
|
| 124 |
+
color: #d1c800;
|
| 125 |
+
}
|
| 126 |
+
.tab2 .row h2.sfsicls_facebook {
|
| 127 |
+
background-position: 0 -145px;
|
| 128 |
+
color: #004088;
|
| 129 |
+
}
|
| 130 |
+
.tab2 .row h2.sfsicls_twt {
|
| 131 |
+
background-position: 0 -221px;
|
| 132 |
+
color: #00abe3;
|
| 133 |
+
}
|
| 134 |
+
.tab2 .row h2.sfsicls_ggle_pls {
|
| 135 |
+
background-position: 0 -295px;
|
| 136 |
+
color: #444749;
|
| 137 |
+
}
|
| 138 |
+
.tab2 .row h2.sfsicls_share {
|
| 139 |
+
background-position: 0 -372px;
|
| 140 |
+
color: #ef4746;
|
| 141 |
+
}
|
| 142 |
+
.tab2 .row h2.sfsicls_utube {
|
| 143 |
+
background-position: 0 -448px;
|
| 144 |
+
color: #f07963;
|
| 145 |
+
}
|
| 146 |
+
.tab2 .row h2.sfsicls_linkdin {
|
| 147 |
+
background-position: 0 -548px;
|
| 148 |
+
color: #1e88c9;
|
| 149 |
+
}
|
| 150 |
+
.tab2 .row h2.sfsicls_pinterest {
|
| 151 |
+
background-position: 0 -623px;
|
| 152 |
+
color: #f15f5d;
|
| 153 |
+
}
|
| 154 |
+
.tab2 .row h2.sfsicls_instagram {
|
| 155 |
+
background-position: 0 -781px;
|
| 156 |
+
color: #369;
|
| 157 |
+
}
|
| 158 |
+
.tab2 .row h2.sfsicls_houzz {
|
| 159 |
+
background-position: 0 -939px;
|
| 160 |
+
color: #369;
|
| 161 |
+
}
|
| 162 |
+
.tab2 .inr_cont {
|
| 163 |
+
margin: 0 0 12px 94px;
|
| 164 |
+
}
|
| 165 |
+
ul.tab_2_email_sec .sf_arow {
|
| 166 |
+
width: 52px;
|
| 167 |
+
height: 52px;
|
| 168 |
+
float: left;
|
| 169 |
+
background: url(../images/sf_arow_icn.png) no-repeat;
|
| 170 |
+
margin: 0 0px 0 6px;
|
| 171 |
+
}
|
| 172 |
+
ul.tab_2_email_sec .email_icn {
|
| 173 |
+
background: url(../images/tab_1_icn_list.png) 0 -71px no-repeat;
|
| 174 |
+
width: 52px;
|
| 175 |
+
height: 52px;
|
| 176 |
+
float: left;
|
| 177 |
+
margin: 0 0 0 5px;
|
| 178 |
+
}
|
| 179 |
+
ul.tab_2_email_sec .subscribe_icn {
|
| 180 |
+
background: url(../images/tab_1_icn_list.png) 0 -860px no-repeat;
|
| 181 |
+
width: 52px;
|
| 182 |
+
height: 52px;
|
| 183 |
+
float: left;
|
| 184 |
+
margin: 0 0 0 5px;
|
| 185 |
+
}
|
| 186 |
+
ul.tab_2_email_sec li .radio {
|
| 187 |
+
float: left;
|
| 188 |
+
margin: 8px 0 0;
|
| 189 |
+
}
|
| 190 |
+
.row ul.tab_2_email_sec li label {
|
| 191 |
+
margin: 13px 0 0 7px;
|
| 192 |
+
font-size: 16px;
|
| 193 |
+
float: left;
|
| 194 |
+
width: 160px;
|
| 195 |
+
}
|
| 196 |
+
.row ul.tab_2_email_sec li label span
|
| 197 |
+
{
|
| 198 |
+
font-size: 15px;
|
| 199 |
+
color: #808080;
|
| 200 |
+
width: 100%;
|
| 201 |
+
float: left;
|
| 202 |
+
}
|
| 203 |
+
/*Tab 3*/
|
| 204 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_1, .sfsiplus_icns_tab_3 .sfsiplus_row_10_10, .sfsiplus_icns_tab_3 .sfsiplus_row_10_11, .sfsiplus_icns_tab_3 .sfsiplus_row_10_2, .sfsiplus_icns_tab_3 .sfsiplus_row_10_3, .sfsiplus_icns_tab_3 .sfsiplus_row_10_4, .sfsiplus_icns_tab_3 .sfsiplus_row_10_5, .sfsiplus_icns_tab_3 .sfsiplus_row_10_6, .sfsiplus_icns_tab_3 .sfsiplus_row_10_7, .sfsiplus_icns_tab_3 .sfsiplus_row_10_8, .sfsiplus_icns_tab_3 .sfsiplus_row_10_9, .sfsiplus_icns_tab_3 .sfsiplus_row_11_1, .sfsiplus_icns_tab_3 .sfsiplus_row_11_10, .sfsiplus_icns_tab_3 .sfsiplus_row_11_11, .sfsiplus_icns_tab_3 .sfsiplus_row_11_2, .sfsiplus_icns_tab_3 .sfsiplus_row_11_3, .sfsiplus_icns_tab_3 .sfsiplus_row_11_4, .sfsiplus_icns_tab_3 .sfsiplus_row_11_5, .sfsiplus_icns_tab_3 .sfsiplus_row_11_6, .sfsiplus_icns_tab_3 .sfsiplus_row_11_7, .sfsiplus_icns_tab_3 .sfsiplus_row_11_8, .sfsiplus_icns_tab_3 .sfsiplus_row_11_9, .sfsiplus_icns_tab_3 .sfsiplus_row_12_1, .sfsiplus_icns_tab_3 .sfsiplus_row_12_10, .sfsiplus_icns_tab_3 .sfsiplus_row_12_11, .sfsiplus_icns_tab_3 .sfsiplus_row_12_2, .sfsiplus_icns_tab_3 .sfsiplus_row_12_3, .sfsiplus_icns_tab_3 .sfsiplus_row_12_4, .sfsiplus_icns_tab_3 .sfsiplus_row_12_5, .sfsiplus_icns_tab_3 .sfsiplus_row_12_6, .sfsiplus_icns_tab_3 .sfsiplus_row_12_7, .sfsiplus_icns_tab_3 .sfsiplus_row_12_8, .sfsiplus_icns_tab_3 .sfsiplus_row_12_9, .sfsiplus_icns_tab_3 .sfsiplus_row_13_1, .sfsiplus_icns_tab_3 .sfsiplus_row_13_10, .sfsiplus_icns_tab_3 .sfsiplus_row_13_11, .sfsiplus_icns_tab_3 .sfsiplus_row_13_2, .sfsiplus_icns_tab_3 .sfsiplus_row_13_3, .sfsiplus_icns_tab_3 .sfsiplus_row_13_4, .sfsiplus_icns_tab_3 .sfsiplus_row_13_5, .sfsiplus_icns_tab_3 .sfsiplus_row_13_6, .sfsiplus_icns_tab_3 .sfsiplus_row_13_7, .sfsiplus_icns_tab_3 .sfsiplus_row_13_8, .sfsiplus_icns_tab_3 .sfsiplus_row_13_9, .sfsiplus_icns_tab_3 .sfsiplus_row_14_1, .sfsiplus_icns_tab_3 .sfsiplus_row_14_10, .sfsiplus_icns_tab_3 .sfsiplus_row_14_11, .sfsiplus_icns_tab_3 .sfsiplus_row_14_2, .sfsiplus_icns_tab_3 .sfsiplus_row_14_3, .sfsiplus_icns_tab_3 .sfsiplus_row_14_4, .sfsiplus_icns_tab_3 .sfsiplus_row_14_5, .sfsiplus_icns_tab_3 .sfsiplus_row_14_6, .sfsiplus_icns_tab_3 .sfsiplus_row_14_7, .sfsiplus_icns_tab_3 .sfsiplus_row_14_8, .sfsiplus_icns_tab_3 .sfsiplus_row_14_9, .sfsiplus_icns_tab_3 .sfsiplus_row_15_1, .sfsiplus_icns_tab_3 .sfsiplus_row_15_10, .sfsiplus_icns_tab_3 .sfsiplus_row_15_11, .sfsiplus_icns_tab_3 .sfsiplus_row_15_2, .sfsiplus_icns_tab_3 .sfsiplus_row_15_3, .sfsiplus_icns_tab_3 .sfsiplus_row_15_4, .sfsiplus_icns_tab_3 .sfsiplus_row_15_5, .sfsiplus_icns_tab_3 .sfsiplus_row_15_6, .sfsiplus_icns_tab_3 .sfsiplus_row_15_7, .sfsiplus_icns_tab_3 .sfsiplus_row_15_8, .sfsiplus_icns_tab_3 .sfsiplus_row_15_9, .sfsiplus_icns_tab_3 .sfsiplus_row_16_1, .sfsiplus_icns_tab_3 .sfsiplus_row_16_10, .sfsiplus_icns_tab_3 .sfsiplus_row_16_11, .sfsiplus_icns_tab_3 .sfsiplus_row_16_2, .sfsiplus_icns_tab_3 .sfsiplus_row_16_3, .sfsiplus_icns_tab_3 .sfsiplus_row_16_4, .sfsiplus_icns_tab_3 .sfsiplus_row_16_5, .sfsiplus_icns_tab_3 .sfsiplus_row_16_6, .sfsiplus_icns_tab_3 .sfsiplus_row_16_7, .sfsiplus_icns_tab_3 .sfsiplus_row_16_8, .sfsiplus_icns_tab_3 .sfsiplus_row_16_9, .sfsiplus_icns_tab_3 .sfsiplus_row_1_1, .sfsiplus_icns_tab_3 .sfsiplus_row_1_10, .sfsiplus_icns_tab_3 .sfsiplus_row_1_11, .sfsiplus_icns_tab_3 .sfsiplus_row_1_2, .sfsiplus_icns_tab_3 .sfsiplus_row_1_3, .sfsiplus_icns_tab_3 .sfsiplus_row_1_4, .sfsiplus_icns_tab_3 .sfsiplus_row_1_5, .sfsiplus_icns_tab_3 .sfsiplus_row_1_6, .sfsiplus_icns_tab_3 .sfsiplus_row_1_7, .sfsiplus_icns_tab_3 .sfsiplus_row_1_8, .sfsiplus_icns_tab_3 .sfsiplus_row_1_9, .sfsiplus_icns_tab_3 .sfsiplus_row_2_1, .sfsiplus_icns_tab_3 .sfsiplus_row_2_10, .sfsiplus_icns_tab_3 .sfsiplus_row_2_11, .sfsiplus_icns_tab_3 .sfsiplus_row_2_2, .sfsiplus_icns_tab_3 .sfsiplus_row_2_3, .sfsiplus_icns_tab_3 .sfsiplus_row_2_4, .sfsiplus_icns_tab_3 .sfsiplus_row_2_5, .sfsiplus_icns_tab_3 .sfsiplus_row_2_6, .sfsiplus_icns_tab_3 .sfsiplus_row_2_7, .sfsiplus_icns_tab_3 .sfsiplus_row_2_8, .sfsiplus_icns_tab_3 .sfsiplus_row_2_9, .sfsiplus_icns_tab_3 .sfsiplus_row_3_1, .sfsiplus_icns_tab_3 .sfsiplus_row_3_10, .sfsiplus_icns_tab_3 .sfsiplus_row_3_11, .sfsiplus_icns_tab_3 .sfsiplus_row_3_2, .sfsiplus_icns_tab_3 .sfsiplus_row_3_3, .sfsiplus_icns_tab_3 .sfsiplus_row_3_4, .sfsiplus_icns_tab_3 .sfsiplus_row_3_5, .sfsiplus_icns_tab_3 .sfsiplus_row_3_6, .sfsiplus_icns_tab_3 .sfsiplus_row_3_7, .sfsiplus_icns_tab_3 .sfsiplus_row_3_8, .sfsiplus_icns_tab_3 .sfsiplus_row_3_9, .sfsiplus_icns_tab_3 .sfsiplus_row_4_1, .sfsiplus_icns_tab_3 .sfsiplus_row_4_10, .sfsiplus_icns_tab_3 .sfsiplus_row_4_11, .sfsiplus_icns_tab_3 .sfsiplus_row_4_2, .sfsiplus_icns_tab_3 .sfsiplus_row_4_3, .sfsiplus_icns_tab_3 .sfsiplus_row_4_4, .sfsiplus_icns_tab_3 .sfsiplus_row_4_5, .sfsiplus_icns_tab_3 .sfsiplus_row_4_6, .sfsiplus_icns_tab_3 .sfsiplus_row_4_7, .sfsiplus_icns_tab_3 .sfsiplus_row_4_8, .sfsiplus_icns_tab_3 .sfsiplus_row_4_9, .sfsiplus_icns_tab_3 .sfsiplus_row_5_1, .sfsiplus_icns_tab_3 .sfsiplus_row_5_10, .sfsiplus_icns_tab_3 .sfsiplus_row_5_11, .sfsiplus_icns_tab_3 .sfsiplus_row_5_2, .sfsiplus_icns_tab_3 .sfsiplus_row_5_3, .sfsiplus_icns_tab_3 .sfsiplus_row_5_4, .sfsiplus_icns_tab_3 .sfsiplus_row_5_5, .sfsiplus_icns_tab_3 .sfsiplus_row_5_6, .sfsiplus_icns_tab_3 .sfsiplus_row_5_7, .sfsiplus_icns_tab_3 .sfsiplus_row_5_8, .sfsiplus_icns_tab_3 .sfsiplus_row_5_9, .sfsiplus_icns_tab_3 .sfsiplus_row_6_1, .sfsiplus_icns_tab_3 .sfsiplus_row_6_10, .sfsiplus_icns_tab_3 .sfsiplus_row_6_11, .sfsiplus_icns_tab_3 .sfsiplus_row_6_2, .sfsiplus_icns_tab_3 .sfsiplus_row_6_3, .sfsiplus_icns_tab_3 .sfsiplus_row_6_4, .sfsiplus_icns_tab_3 .sfsiplus_row_6_5, .sfsiplus_icns_tab_3 .sfsiplus_row_6_6, .sfsiplus_icns_tab_3 .sfsiplus_row_6_7, .sfsiplus_icns_tab_3 .sfsiplus_row_6_8, .sfsiplus_icns_tab_3 .sfsiplus_row_6_9, .sfsiplus_icns_tab_3 .sfsiplus_row_7_1, .sfsiplus_icns_tab_3 .sfsiplus_row_7_10, .sfsiplus_icns_tab_3 .sfsiplus_row_7_11, .sfsiplus_icns_tab_3 .sfsiplus_row_7_2, .sfsiplus_icns_tab_3 .sfsiplus_row_7_3, .sfsiplus_icns_tab_3 .sfsiplus_row_7_4, .sfsiplus_icns_tab_3 .sfsiplus_row_7_5, .sfsiplus_icns_tab_3 .sfsiplus_row_7_6, .sfsiplus_icns_tab_3 .sfsiplus_row_7_7, .sfsiplus_icns_tab_3 .sfsiplus_row_7_8, .sfsiplus_icns_tab_3 .sfsiplus_row_7_9, .sfsiplus_icns_tab_3 .sfsiplus_row_8_1, .sfsiplus_icns_tab_3 .sfsiplus_row_8_10, .sfsiplus_icns_tab_3 .sfsiplus_row_8_11, .sfsiplus_icns_tab_3 .sfsiplus_row_8_2, .sfsiplus_icns_tab_3 .sfsiplus_row_8_3, .sfsiplus_icns_tab_3 .sfsiplus_row_8_4, .sfsiplus_icns_tab_3 .sfsiplus_row_8_5, .sfsiplus_icns_tab_3 .sfsiplus_row_8_6, .sfsiplus_icns_tab_3 .sfsiplus_row_8_7, .sfsiplus_icns_tab_3 .sfsiplus_row_8_8, .sfsiplus_icns_tab_3 .sfsiplus_row_8_9, .sfsiplus_icns_tab_3 .sfsiplus_row_9_1, .sfsiplus_icns_tab_3 .sfsiplus_row_9_10, .sfsiplus_icns_tab_3 .sfsiplus_row_9_11, .sfsiplus_icns_tab_3 .sfsiplus_row_9_2, .sfsiplus_icns_tab_3 .sfsiplus_row_9_3, .sfsiplus_icns_tab_3 .sfsiplus_row_9_4, .sfsiplus_icns_tab_3 .sfsiplus_row_9_5, .sfsiplus_icns_tab_3 .sfsiplus_row_9_6, .sfsiplus_icns_tab_3 .sfsiplus_row_9_7, .sfsiplus_icns_tab_3 .sfsiplus_row_9_8, .sfsiplus_icns_tab_3 .sfsiplus_row_9_9, .sfsiplus_icns_tab_3 .sfsiplus_row_17_1, .sfsiplus_icns_tab_3 .sfsiplus_row_17_2, .sfsiplus_icns_tab_3 .sfsiplus_row_17_3, .sfsiplus_icns_tab_3 .sfsiplus_row_17_4, .sfsiplus_icns_tab_3 .sfsiplus_row_17_5, .sfsiplus_icns_tab_3 .sfsiplus_row_17_6, .sfsiplus_icns_tab_3 .sfsiplus_row_17_7, .sfsiplus_icns_tab_3 .sfsiplus_row_17_8, .sfsiplus_icns_tab_3 .sfsiplus_row_17_9, .sfsiplus_icns_tab_3 .sfsiplus_row_17_10, .sfsiplus_icns_tab_3 .sfsiplus_row_17_11 {
|
| 205 |
+
background: url(../images/tab_3_icns.png) no-repeat;
|
| 206 |
+
width: 53px;
|
| 207 |
+
height: 52px;
|
| 208 |
+
float: left;
|
| 209 |
+
margin: 0 4px 0 0;
|
| 210 |
+
}
|
| 211 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_1 {
|
| 212 |
+
background-position: -1px 0;
|
| 213 |
+
}
|
| 214 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_2 {
|
| 215 |
+
background-position: -60px 0;
|
| 216 |
+
}
|
| 217 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_3 {
|
| 218 |
+
background-position: -118px 0;
|
| 219 |
+
}
|
| 220 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_4 {
|
| 221 |
+
background-position: -176px 0;
|
| 222 |
+
}
|
| 223 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_5 {
|
| 224 |
+
background-position: -235px 0;
|
| 225 |
+
}
|
| 226 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_6 {
|
| 227 |
+
background-position: -293px 0;
|
| 228 |
+
}
|
| 229 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_7 {
|
| 230 |
+
background-position: -350px 0;
|
| 231 |
+
}
|
| 232 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_8 {
|
| 233 |
+
background-position: -409px 0;
|
| 234 |
+
}
|
| 235 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_9 {
|
| 236 |
+
background-position: -467px 0;
|
| 237 |
+
}
|
| 238 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_10 {
|
| 239 |
+
background-position: -526px 0;
|
| 240 |
+
}
|
| 241 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_1_11 {
|
| 242 |
+
background-position: -711px 0;
|
| 243 |
+
}
|
| 244 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_1 {
|
| 245 |
+
background-position: 0 -74px;
|
| 246 |
+
}
|
| 247 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_2 {
|
| 248 |
+
background-position: -60px -74px;
|
| 249 |
+
}
|
| 250 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_3 {
|
| 251 |
+
background-position: -118px -74px;
|
| 252 |
+
}
|
| 253 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_4 {
|
| 254 |
+
background-position: -176px -74px;
|
| 255 |
+
}
|
| 256 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_5 {
|
| 257 |
+
background-position: -235px -74px;
|
| 258 |
+
}
|
| 259 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_6 {
|
| 260 |
+
background-position: -293px -74px;
|
| 261 |
+
}
|
| 262 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_7 {
|
| 263 |
+
background-position: -350px -74px;
|
| 264 |
+
}
|
| 265 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_8 {
|
| 266 |
+
background-position: -409px -74px;
|
| 267 |
+
}
|
| 268 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_9 {
|
| 269 |
+
background-position: -467px -74px;
|
| 270 |
+
}
|
| 271 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_10 {
|
| 272 |
+
background-position: -526px -74px;
|
| 273 |
+
}
|
| 274 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_2_11 {
|
| 275 |
+
background-position: -711px -74px;
|
| 276 |
+
}
|
| 277 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_1 {
|
| 278 |
+
background-position: 0 -146px;
|
| 279 |
+
}
|
| 280 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_2 {
|
| 281 |
+
background-position: -60px -146px;
|
| 282 |
+
}
|
| 283 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_3 {
|
| 284 |
+
background-position: -118px -146px;
|
| 285 |
+
}
|
| 286 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_4 {
|
| 287 |
+
background-position: -176px -146px;
|
| 288 |
+
}
|
| 289 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_5 {
|
| 290 |
+
background-position: -235px -146px;
|
| 291 |
+
}
|
| 292 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_6 {
|
| 293 |
+
background-position: -293px -146px;
|
| 294 |
+
}
|
| 295 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_7 {
|
| 296 |
+
background-position: -350px -146px;
|
| 297 |
+
}
|
| 298 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_8 {
|
| 299 |
+
background-position: -409px -146px;
|
| 300 |
+
}
|
| 301 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_9 {
|
| 302 |
+
background-position: -467px -146px;
|
| 303 |
+
}
|
| 304 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_10 {
|
| 305 |
+
background-position: -526px -146px;
|
| 306 |
+
}
|
| 307 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_3_11 {
|
| 308 |
+
background-position: -711px -147px;
|
| 309 |
+
}
|
| 310 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_1 {
|
| 311 |
+
background-position: 0 -222px;
|
| 312 |
+
}
|
| 313 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_2 {
|
| 314 |
+
background-position: -60px -222px;
|
| 315 |
+
}
|
| 316 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_3 {
|
| 317 |
+
background-position: -118px -222px;
|
| 318 |
+
}
|
| 319 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_4 {
|
| 320 |
+
background-position: -176px -222px;
|
| 321 |
+
}
|
| 322 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_5 {
|
| 323 |
+
background-position: -235px -222px;
|
| 324 |
+
}
|
| 325 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_6 {
|
| 326 |
+
background-position: -293px -222px;
|
| 327 |
+
}
|
| 328 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_7 {
|
| 329 |
+
background-position: -350px -222px;
|
| 330 |
+
}
|
| 331 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_8 {
|
| 332 |
+
background-position: -409px -222px;
|
| 333 |
+
}
|
| 334 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_9 {
|
| 335 |
+
background-position: -467px -222px;
|
| 336 |
+
}
|
| 337 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_10 {
|
| 338 |
+
background-position: -526px -222px;
|
| 339 |
+
}
|
| 340 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_4_11 {
|
| 341 |
+
background-position: -711px -222px;
|
| 342 |
+
}
|
| 343 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_1 {
|
| 344 |
+
background-position: 0 -296px;
|
| 345 |
+
}
|
| 346 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_2 {
|
| 347 |
+
background-position: -60px -296px;
|
| 348 |
+
}
|
| 349 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_3 {
|
| 350 |
+
background-position: -118px -296px;
|
| 351 |
+
}
|
| 352 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_4 {
|
| 353 |
+
background-position: -176px -296px;
|
| 354 |
+
}
|
| 355 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_5 {
|
| 356 |
+
background-position: -235px -296px;
|
| 357 |
+
}
|
| 358 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_6 {
|
| 359 |
+
background-position: -293px -296px;
|
| 360 |
+
}
|
| 361 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_7 {
|
| 362 |
+
background-position: -350px -296px;
|
| 363 |
+
}
|
| 364 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_8 {
|
| 365 |
+
background-position: -409px -296px;
|
| 366 |
+
}
|
| 367 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_9 {
|
| 368 |
+
background-position: -467px -296px;
|
| 369 |
+
}
|
| 370 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_10 {
|
| 371 |
+
background-position: -526px -296px;
|
| 372 |
+
}
|
| 373 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_5_11 {
|
| 374 |
+
background-position: -711px -296px;
|
| 375 |
+
}
|
| 376 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_1 {
|
| 377 |
+
background-position: 0 -370px;
|
| 378 |
+
}
|
| 379 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_2 {
|
| 380 |
+
background-position: -60px -370px;
|
| 381 |
+
}
|
| 382 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_3 {
|
| 383 |
+
background-position: -118px -370px;
|
| 384 |
+
}
|
| 385 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_4 {
|
| 386 |
+
background-position: -176px -370px;
|
| 387 |
+
}
|
| 388 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_5 {
|
| 389 |
+
background-position: -235px -370px;
|
| 390 |
+
}
|
| 391 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_6 {
|
| 392 |
+
background-position: -293px -370px;
|
| 393 |
+
}
|
| 394 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_7 {
|
| 395 |
+
background-position: -350px -370px;
|
| 396 |
+
}
|
| 397 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_8 {
|
| 398 |
+
background-position: -409px -370px;
|
| 399 |
+
}
|
| 400 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_9 {
|
| 401 |
+
background-position: -468px -370px;
|
| 402 |
+
}
|
| 403 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_10 {
|
| 404 |
+
background-position: -526px -370px;
|
| 405 |
+
}
|
| 406 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_6_11 {
|
| 407 |
+
background-position: -711px -370px;
|
| 408 |
+
}
|
| 409 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_1 {
|
| 410 |
+
background-position: 0 -444px;
|
| 411 |
+
}
|
| 412 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_2 {
|
| 413 |
+
background-position: -60px -444px;
|
| 414 |
+
}
|
| 415 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_3 {
|
| 416 |
+
background-position: -118px -444px;
|
| 417 |
+
}
|
| 418 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_4 {
|
| 419 |
+
background-position: -176px -444px;
|
| 420 |
+
}
|
| 421 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_5 {
|
| 422 |
+
background-position: -235px -444px;
|
| 423 |
+
}
|
| 424 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_6 {
|
| 425 |
+
background-position: -293px -444px;
|
| 426 |
+
}
|
| 427 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_7 {
|
| 428 |
+
background-position: -350px -444px;
|
| 429 |
+
}
|
| 430 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_8 {
|
| 431 |
+
background-position: -409px -444px;
|
| 432 |
+
}
|
| 433 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_9 {
|
| 434 |
+
background-position: -466px -444px;
|
| 435 |
+
}
|
| 436 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_10 {
|
| 437 |
+
background-position: -526px -444px;
|
| 438 |
+
}
|
| 439 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_7_11 {
|
| 440 |
+
background-position: -711px -444px;
|
| 441 |
+
}
|
| 442 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_1 {
|
| 443 |
+
background-position: 0 -518px;
|
| 444 |
+
}
|
| 445 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_2 {
|
| 446 |
+
background-position: -60px -518px;
|
| 447 |
+
}
|
| 448 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_3 {
|
| 449 |
+
background-position: -118px -518px;
|
| 450 |
+
}
|
| 451 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_4 {
|
| 452 |
+
background-position: -176px -518px;
|
| 453 |
+
}
|
| 454 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_5 {
|
| 455 |
+
background-position: -235px -518px;
|
| 456 |
+
}
|
| 457 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_6 {
|
| 458 |
+
background-position: -293px -518px;
|
| 459 |
+
}
|
| 460 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_7 {
|
| 461 |
+
background-position: -350px -518px;
|
| 462 |
+
}
|
| 463 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_8 {
|
| 464 |
+
background-position: -409px -518px;
|
| 465 |
+
}
|
| 466 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_9 {
|
| 467 |
+
background-position: -467px -518px;
|
| 468 |
+
}
|
| 469 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_10 {
|
| 470 |
+
background-position: -526px -518px;
|
| 471 |
+
}
|
| 472 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_8_11 {
|
| 473 |
+
background-position: -711px -518px;
|
| 474 |
+
}
|
| 475 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_1 {
|
| 476 |
+
background-position: 0 -592px;
|
| 477 |
+
}
|
| 478 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_2 {
|
| 479 |
+
background-position: -60px -592px;
|
| 480 |
+
}
|
| 481 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_3 {
|
| 482 |
+
background-position: -118px -592px;
|
| 483 |
+
}
|
| 484 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_4 {
|
| 485 |
+
background-position: -176px -592px;
|
| 486 |
+
}
|
| 487 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_5 {
|
| 488 |
+
background-position: -235px -592px;
|
| 489 |
+
}
|
| 490 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_6 {
|
| 491 |
+
background-position: -293px -592px;
|
| 492 |
+
}
|
| 493 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_7 {
|
| 494 |
+
background-position: -350px -592px;
|
| 495 |
+
}
|
| 496 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_8 {
|
| 497 |
+
background-position: -409px -592px;
|
| 498 |
+
}
|
| 499 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_9 {
|
| 500 |
+
background-position: -467px -592px;
|
| 501 |
+
}
|
| 502 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_10 {
|
| 503 |
+
background-position: -526px -592px;
|
| 504 |
+
}
|
| 505 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_9_11 {
|
| 506 |
+
background-position: -711px -592px;
|
| 507 |
+
}
|
| 508 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_1 {
|
| 509 |
+
background-position: 0 -666px;
|
| 510 |
+
}
|
| 511 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_2 {
|
| 512 |
+
background-position: -60px -666px;
|
| 513 |
+
}
|
| 514 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_3 {
|
| 515 |
+
background-position: -118px -666px;
|
| 516 |
+
}
|
| 517 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_4 {
|
| 518 |
+
background-position: -176px -666px;
|
| 519 |
+
}
|
| 520 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_5 {
|
| 521 |
+
background-position: -235px -666px;
|
| 522 |
+
}
|
| 523 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_6 {
|
| 524 |
+
background-position: -293px -666px;
|
| 525 |
+
}
|
| 526 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_7 {
|
| 527 |
+
background-position: -350px -666px;
|
| 528 |
+
}
|
| 529 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_8 {
|
| 530 |
+
background-position: -409px -666px;
|
| 531 |
+
}
|
| 532 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_9 {
|
| 533 |
+
background-position: -467px -666px;
|
| 534 |
+
}
|
| 535 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_10 {
|
| 536 |
+
background-position: -526px -666px;
|
| 537 |
+
}
|
| 538 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_10_11 {
|
| 539 |
+
background-position: -711px -666px;
|
| 540 |
+
}
|
| 541 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_1 {
|
| 542 |
+
background-position: 0 -740px;
|
| 543 |
+
}
|
| 544 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_2 {
|
| 545 |
+
background-position: -60px -740px;
|
| 546 |
+
}
|
| 547 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_3 {
|
| 548 |
+
background-position: -118px -740px;
|
| 549 |
+
}
|
| 550 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_4 {
|
| 551 |
+
background-position: -176px -740px;
|
| 552 |
+
}
|
| 553 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_5 {
|
| 554 |
+
background-position: -235px -740px;
|
| 555 |
+
}
|
| 556 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_6 {
|
| 557 |
+
background-position: -293px -740px;
|
| 558 |
+
}
|
| 559 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_7 {
|
| 560 |
+
background-position: -350px -740px;
|
| 561 |
+
}
|
| 562 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_8 {
|
| 563 |
+
background-position: -409px -740px;
|
| 564 |
+
}
|
| 565 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_9 {
|
| 566 |
+
background-position: -467px -740px;
|
| 567 |
+
}
|
| 568 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_10 {
|
| 569 |
+
background-position: -526px -740px;
|
| 570 |
+
}
|
| 571 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_11_11 {
|
| 572 |
+
background-position: -711px -740px;
|
| 573 |
+
}
|
| 574 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_1 {
|
| 575 |
+
background-position: 0 -814px;
|
| 576 |
+
}
|
| 577 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_2 {
|
| 578 |
+
background-position: -60px -814px;
|
| 579 |
+
}
|
| 580 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_3 {
|
| 581 |
+
background-position: -118px -814px;
|
| 582 |
+
}
|
| 583 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_4 {
|
| 584 |
+
background-position: -176px -814px;
|
| 585 |
+
}
|
| 586 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_5 {
|
| 587 |
+
background-position: -235px -814px;
|
| 588 |
+
}
|
| 589 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_6 {
|
| 590 |
+
background-position: -293px -814px;
|
| 591 |
+
}
|
| 592 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_7 {
|
| 593 |
+
background-position: -350px -814px;
|
| 594 |
+
}
|
| 595 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_8 {
|
| 596 |
+
background-position: -409px -814px;
|
| 597 |
+
}
|
| 598 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_9 {
|
| 599 |
+
background-position: -467px -814px;
|
| 600 |
+
}
|
| 601 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_10 {
|
| 602 |
+
background-position: -526px -814px;
|
| 603 |
+
}
|
| 604 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_12_11 {
|
| 605 |
+
background-position: -711px -814px;
|
| 606 |
+
}
|
| 607 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_1 {
|
| 608 |
+
background-position: 0 -888px;
|
| 609 |
+
}
|
| 610 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_2 {
|
| 611 |
+
background-position: -60px -888px;
|
| 612 |
+
}
|
| 613 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_3 {
|
| 614 |
+
background-position: -118px -888px;
|
| 615 |
+
}
|
| 616 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_4 {
|
| 617 |
+
background-position: -176px -888px;
|
| 618 |
+
}
|
| 619 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_5 {
|
| 620 |
+
background-position: -235px -888px;
|
| 621 |
+
}
|
| 622 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_6 {
|
| 623 |
+
background-position: -293px -888px;
|
| 624 |
+
}
|
| 625 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_7 {
|
| 626 |
+
background-position: -350px -888px;
|
| 627 |
+
}
|
| 628 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_8 {
|
| 629 |
+
background-position: -409px -888px;
|
| 630 |
+
}
|
| 631 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_9 {
|
| 632 |
+
background-position: -467px -888px;
|
| 633 |
+
}
|
| 634 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_10 {
|
| 635 |
+
background-position: -526px -888px;
|
| 636 |
+
}
|
| 637 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_13_11 {
|
| 638 |
+
background-position: -711px -888px;
|
| 639 |
+
}
|
| 640 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_1 {
|
| 641 |
+
background-position: 0 -962px;
|
| 642 |
+
}
|
| 643 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_2 {
|
| 644 |
+
background-position: -60px -962px;
|
| 645 |
+
}
|
| 646 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_3 {
|
| 647 |
+
background-position: -118px -962px;
|
| 648 |
+
}
|
| 649 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_4 {
|
| 650 |
+
background-position: -176px -962px;
|
| 651 |
+
}
|
| 652 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_5 {
|
| 653 |
+
background-position: -235px -962px;
|
| 654 |
+
}
|
| 655 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_6 {
|
| 656 |
+
background-position: -293px -962px;
|
| 657 |
+
}
|
| 658 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_7 {
|
| 659 |
+
background-position: -350px -962px;
|
| 660 |
+
}
|
| 661 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_8 {
|
| 662 |
+
background-position: -409px -962px;
|
| 663 |
+
}
|
| 664 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_9 {
|
| 665 |
+
background-position: -467px -962px;
|
| 666 |
+
}
|
| 667 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_10 {
|
| 668 |
+
background-position: -526px -962px;
|
| 669 |
+
}
|
| 670 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_14_11 {
|
| 671 |
+
background-position: -711px -962px;
|
| 672 |
+
}
|
| 673 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_1 {
|
| 674 |
+
background-position: 0 -1036px;
|
| 675 |
+
}
|
| 676 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_2 {
|
| 677 |
+
background-position: -60px -1036px;
|
| 678 |
+
}
|
| 679 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_3 {
|
| 680 |
+
background-position: -118px -1036px;
|
| 681 |
+
}
|
| 682 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_4 {
|
| 683 |
+
background-position: -176px -1036px;
|
| 684 |
+
}
|
| 685 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_5 {
|
| 686 |
+
background-position: -235px -1036px;
|
| 687 |
+
}
|
| 688 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_6 {
|
| 689 |
+
background-position: -293px -1036px;
|
| 690 |
+
}
|
| 691 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_7 {
|
| 692 |
+
background-position: -350px -1036px;
|
| 693 |
+
}
|
| 694 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_8 {
|
| 695 |
+
background-position: -409px -1036px;
|
| 696 |
+
}
|
| 697 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_9 {
|
| 698 |
+
background-position: -467px -1036px;
|
| 699 |
+
}
|
| 700 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_10 {
|
| 701 |
+
background-position: -526px -1036px;
|
| 702 |
+
}
|
| 703 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_15_11 {
|
| 704 |
+
background-position: -711px -1036px;
|
| 705 |
+
}
|
| 706 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_1 {
|
| 707 |
+
background-position: 0 -1109px;
|
| 708 |
+
}
|
| 709 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_2 {
|
| 710 |
+
background-position: -60px -1109px;
|
| 711 |
+
}
|
| 712 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_3 {
|
| 713 |
+
background-position: -118px -1109px;
|
| 714 |
+
}
|
| 715 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_4 {
|
| 716 |
+
background-position: -176px -1109px;
|
| 717 |
+
}
|
| 718 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_5 {
|
| 719 |
+
background-position: -235px -1109px;
|
| 720 |
+
}
|
| 721 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_6 {
|
| 722 |
+
background-position: -293px -1109px;
|
| 723 |
+
}
|
| 724 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_7 {
|
| 725 |
+
background-position: -350px -1109px;
|
| 726 |
+
}
|
| 727 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_8 {
|
| 728 |
+
background-position: -409px -1109px;
|
| 729 |
+
}
|
| 730 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_9 {
|
| 731 |
+
background-position: -467px -1109px;
|
| 732 |
+
}
|
| 733 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_10 {
|
| 734 |
+
background-position: -526px -1109px;
|
| 735 |
+
}
|
| 736 |
+
.sfsiplus_icns_tab_3 .sfsiplus_row_16_11 {
|
| 737 |
+
background-position: -711px -1109px;
|
| 738 |
+
}
|
| 739 |
+
/*Admin menu*/
|
| 740 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options div.wp-menu-image {
|
| 741 |
+
display: none;
|
| 742 |
+
}
|
| 743 |
+
#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options {
|
| 744 |
+
padding: 0 0 0 38px;
|
| 745 |
+
font-family: helveticabold;
|
| 746 |
+
}
|
| 747 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options {
|
| 748 |
+
color: #e12522;
|
| 749 |
+
transition: 0s;
|
| 750 |
+
background: url(images/left_log_icn.png) 6px 15px no-repeat #000;
|
| 751 |
+
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
| 752 |
+
color: #fafafa;
|
| 753 |
+
}
|
| 754 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options a.toplevel_page_sfsi-plus-options:hover {
|
| 755 |
+
background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;
|
| 756 |
+
color: #fafafa;
|
| 757 |
+
}
|
| 758 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options a.wp-has-current-submenu, ul#adminmenu li.toplevel_page_sfsi-plus-options a.wp-has-current-submenu:hover {
|
| 759 |
+
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000;
|
| 760 |
+
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
| 761 |
+
color: #e12522;
|
| 762 |
+
}
|
| 763 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options a.current, ul#adminmenu li.toplevel_page_sfsi-plus-options a.current:hover {
|
| 764 |
+
background: url(images/left_log_icn.png) 6px 15px no-repeat #000000 !important;
|
| 765 |
+
/*background: url(images/left_log_icn.png) 6px -43px no-repeat #444444;*/
|
| 766 |
+
color: #e12522 !important;
|
| 767 |
+
}
|
| 768 |
+
/*tab 9 css*/
|
| 769 |
+
.tab9 .sfsi_plus_tab8_container
|
| 770 |
+
{
|
| 771 |
+
width: 100%; float: left;
|
| 772 |
+
}
|
| 773 |
+
.tab9 .sfsi_plus_tab8_subcontainer {
|
| 774 |
+
float: left;
|
| 775 |
+
padding: 20px 0;
|
| 776 |
+
width: 100%;
|
| 777 |
+
}
|
| 778 |
+
.tab9 h3.sfsi_plus_section_title {
|
| 779 |
+
font-weight: bold;
|
| 780 |
+
}
|
| 781 |
+
.tab9 .like_pop_box {
|
| 782 |
+
width: 100%;
|
| 783 |
+
margin: 35px auto auto;
|
| 784 |
+
position: relative;
|
| 785 |
+
text-align: center;
|
| 786 |
+
}
|
| 787 |
+
.tab9 .like_pop_box h2 {
|
| 788 |
+
font-family: helveticabold;
|
| 789 |
+
text-align: center;
|
| 790 |
+
color: #414951;
|
| 791 |
+
font-size: 26px;
|
| 792 |
+
}
|
| 793 |
+
.tab9 .sfsi_plus_subscribe_Popinner {
|
| 794 |
+
display: inline-block;
|
| 795 |
+
padding: 18px 20px;
|
| 796 |
+
-webkit-box-shadow: 0 0 5px #ccc;
|
| 797 |
+
border: 1px solid #ededed;
|
| 798 |
+
background: #FFF;
|
| 799 |
+
position: relative;
|
| 800 |
+
}
|
| 801 |
+
.tab9 .sfsi_plus_subscribe_Popinner .form-overlay {
|
| 802 |
+
height: 100%;
|
| 803 |
+
left: 0;
|
| 804 |
+
position: absolute;
|
| 805 |
+
top: 0;
|
| 806 |
+
width: 100%;
|
| 807 |
+
}
|
| 808 |
+
.tab9 .like_pop_box .sfsi_plus_subscribe_Popinner {
|
| 809 |
+
box-shadow: 0 0 5px #ccc;
|
| 810 |
+
}
|
| 811 |
+
.tab9 .like_pop_box .sfsi_plus_subscribe_Popinner h5 {
|
| 812 |
+
margin: 0 0 10px;
|
| 813 |
+
padding: 0;
|
| 814 |
+
color: #414951;
|
| 815 |
+
font-size: 22px;
|
| 816 |
+
text-align: center;
|
| 817 |
+
}
|
| 818 |
+
.tab9 .sfsi_plus_subscribe_Popinner h5 {
|
| 819 |
+
margin: 0 0 10px;
|
| 820 |
+
padding: 0;
|
| 821 |
+
color: #414951;
|
| 822 |
+
font-size: 18px;
|
| 823 |
+
text-align: center;
|
| 824 |
+
}
|
| 825 |
+
.tab9 .sfsi_plus_subscription_form_field {
|
| 826 |
+
float: left;
|
| 827 |
+
margin: 5px 0;
|
| 828 |
+
width: 100%;
|
| 829 |
+
}
|
| 830 |
+
.tab9 .sfsi_plus_subscription_form_field input {
|
| 831 |
+
padding: 10px 0px;
|
| 832 |
+
text-align: center;
|
| 833 |
+
width: 100%;
|
| 834 |
+
}
|
| 835 |
+
.tab9 .sfsi_plus_tab8_subcontainer label.sfsi_plus_label_text {
|
| 836 |
+
float: left;
|
| 837 |
+
margin: 10px 0;
|
| 838 |
+
width: 100%;
|
| 839 |
+
}
|
| 840 |
+
.tab9 ul.sfsi_plus_form_info {
|
| 841 |
+
list-style: none !important;
|
| 842 |
+
margin-left: 32px;
|
| 843 |
+
}
|
| 844 |
+
.tab9 ul.sfsi_plus_form_info li {
|
| 845 |
+
margin: 3px 0;
|
| 846 |
+
}
|
| 847 |
+
.tab9 .sfsi_plus_subscription_html {
|
| 848 |
+
background-color: #e5e5e5;
|
| 849 |
+
float: left;
|
| 850 |
+
margin: 12px 0 0 30px;
|
| 851 |
+
width: 90%;
|
| 852 |
+
}
|
| 853 |
+
.tab9 .sfsi_plus_seprater
|
| 854 |
+
{
|
| 855 |
+
border-bottom: 1px solid #ccc;
|
| 856 |
+
}
|
| 857 |
+
.tab9 .sfsi_plus_tab8_subcontainer h5.sfsi_plus_section_subtitle {
|
| 858 |
+
float: left;
|
| 859 |
+
font-size: 18px;
|
| 860 |
+
margin: 5px 0;
|
| 861 |
+
width: 100%;
|
| 862 |
+
}
|
| 863 |
+
.tab9 .sfsi_plus_left_container {
|
| 864 |
+
margin-top: 30px;
|
| 865 |
+
text-align: center;
|
| 866 |
+
width: 24%;
|
| 867 |
+
display: inline-block;
|
| 868 |
+
}
|
| 869 |
+
.tab9 .sfsi_plus_right_container {
|
| 870 |
+
display: inline-block;
|
| 871 |
+
margin-top: 30px;
|
| 872 |
+
padding: 0 20px;
|
| 873 |
+
vertical-align: top;
|
| 874 |
+
width: 72%;
|
| 875 |
+
}
|
| 876 |
+
.tab9 .row_tab {
|
| 877 |
+
display: inline-block;
|
| 878 |
+
margin-bottom: 30px;
|
| 879 |
+
width: 100%;
|
| 880 |
+
}
|
| 881 |
+
.tab9 .row_tab label {
|
| 882 |
+
color: #5a6570;
|
| 883 |
+
font-size: 16px;
|
| 884 |
+
}
|
| 885 |
+
.tab9 .row_tab div.sfsi_plus_field{
|
| 886 |
+
display: inline-block;
|
| 887 |
+
vertical-align: middle;
|
| 888 |
+
width: auto;
|
| 889 |
+
margin-right: 25px;
|
| 890 |
+
}
|
| 891 |
+
.tab9 .color_box {
|
| 892 |
+
width: 40px;
|
| 893 |
+
height: 34px;
|
| 894 |
+
border: 3px solid #fff;
|
| 895 |
+
box-shadow: 1px 2px 2px #ccc;
|
| 896 |
+
float: right;
|
| 897 |
+
position: relative;
|
| 898 |
+
margin-left: 13px;
|
| 899 |
+
}
|
| 900 |
+
.tab9 .color_box1 {
|
| 901 |
+
width: 100%;
|
| 902 |
+
height: 34px;
|
| 903 |
+
background: #5a6570;
|
| 904 |
+
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
| 905 |
+
}
|
| 906 |
+
.tab9 .corner {
|
| 907 |
+
width: 10px;
|
| 908 |
+
height: 10px;
|
| 909 |
+
background: #fff;
|
| 910 |
+
position: absolute;
|
| 911 |
+
right: 0;
|
| 912 |
+
bottom: 0;
|
| 913 |
+
}
|
| 914 |
+
.tab9 .sfsi_plus_right_container label {
|
| 915 |
+
color: #5a6570;
|
| 916 |
+
font-size: 18px;
|
| 917 |
+
}
|
| 918 |
+
.tab9 label.sfsi_plus_heding {
|
| 919 |
+
display: inline-block;
|
| 920 |
+
font-weight: bold;
|
| 921 |
+
padding-top: 10px;
|
| 922 |
+
width: 303px;
|
| 923 |
+
}
|
| 924 |
+
.tab9 .border_shadow {
|
| 925 |
+
display: inline-block;
|
| 926 |
+
vertical-align: top;
|
| 927 |
+
}
|
| 928 |
+
.tab9 .border_shadow li {
|
| 929 |
+
display: inline-block;
|
| 930 |
+
vertical-align: top;
|
| 931 |
+
padding-right: 20px;
|
| 932 |
+
}
|
| 933 |
+
.tab9 .border_shadow li span {
|
| 934 |
+
vertical-align: middle;
|
| 935 |
+
}
|
| 936 |
+
.tab9 .border_shadow .radio{
|
| 937 |
+
margin-right:5px;
|
| 938 |
+
}
|
| 939 |
+
.tab9 .sfsi_plus_field .rec-inp {
|
| 940 |
+
background: #e5e5e5 none repeat scroll 0 0;
|
| 941 |
+
height: 44px;
|
| 942 |
+
text-align: center;
|
| 943 |
+
width: 54px;
|
| 944 |
+
}
|
| 945 |
+
.tab9 .pix {
|
| 946 |
+
color: #5a6570;
|
| 947 |
+
font-size: 18px;
|
| 948 |
+
padding-left: 10px;
|
| 949 |
+
vertical-align: middle;
|
| 950 |
+
}
|
| 951 |
+
.tab9 .sfsi_plus_heding.autowidth {
|
| 952 |
+
width: auto;
|
| 953 |
+
margin-right: 15px;
|
| 954 |
+
}
|
| 955 |
+
.tab9 .sfsi_plus_heding.fixwidth {
|
| 956 |
+
width: 80px;
|
| 957 |
+
}
|
| 958 |
+
.tab9 .small {
|
| 959 |
+
background-color: #e5e5e5;
|
| 960 |
+
height: 44px;
|
| 961 |
+
width: 200px;
|
| 962 |
+
}
|
| 963 |
+
.tab9 .small.new-inp {
|
| 964 |
+
background-color: #e5e5e5;
|
| 965 |
+
height: 44px;
|
| 966 |
+
width: 277px;
|
| 967 |
+
}
|
| 968 |
+
.tab9 .small.color-code {
|
| 969 |
+
width: 138px !important;
|
| 970 |
+
}
|
| 971 |
+
.tab9 .select-same {
|
| 972 |
+
border: 1px solid #d6d6d6;
|
| 973 |
+
height: 47px !important;
|
| 974 |
+
width: 171px;
|
| 975 |
+
appearance:none;
|
| 976 |
+
-moz-appearance:none;
|
| 977 |
+
-webkit-appearance:none;
|
| 978 |
+
background-image: url(images/select-arrow.png);
|
| 979 |
+
background-repeat:no-repeat;
|
| 980 |
+
background-position:right 15px center;
|
| 981 |
+
}
|
| 982 |
+
.tab9 .sfsi_plus_same_width {
|
| 983 |
+
display: inline-block;
|
| 984 |
+
width: 100px !important;
|
| 985 |
+
}
|
| 986 |
+
.sfsi_plus_subscribe_Popinner .sfsi_plus_highlight {
|
| 987 |
+
border: 3px solid red !important;
|
| 988 |
+
}
|
| 989 |
+
.sfsi_plus_subscription_html xmp {
|
| 990 |
+
display: block;
|
| 991 |
+
padding: 0 10px;
|
| 992 |
+
white-space: pre-line;
|
| 993 |
+
word-wrap: break-word;
|
| 994 |
+
}
|
| 995 |
+
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li {
|
| 996 |
+
float: left;
|
| 997 |
+
width: 300px !important;
|
| 998 |
+
max-width: 300px !important;
|
| 999 |
+
min-width: 300px !important;
|
| 1000 |
+
}
|
| 1001 |
+
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec label {
|
| 1002 |
+
font-size: 17px;
|
| 1003 |
+
padding-right: 20px;
|
| 1004 |
+
width: 65px !important;
|
| 1005 |
+
display: inline-block;
|
| 1006 |
+
}
|
| 1007 |
+
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li input {
|
| 1008 |
+
background-color: #dedede;
|
| 1009 |
+
border: medium none;
|
| 1010 |
+
box-shadow: none;
|
| 1011 |
+
padding: 14px 8px;
|
| 1012 |
+
width: 80px;
|
| 1013 |
+
}
|
| 1014 |
+
.sfsiplus_right_info ul.sfsi_plus_floaticon_margin_sec li ins {
|
| 1015 |
+
font-size: 17px;
|
| 1016 |
+
font-weight: 400;
|
| 1017 |
+
margin-left: 15px;
|
| 1018 |
+
text-decoration: none;
|
| 1019 |
+
}
|
| 1020 |
+
@media (max-width:1160px) {
|
| 1021 |
+
.sfsi_plus_subscription_html xmp {
|
| 1022 |
+
display: block;
|
| 1023 |
+
padding: 0 10px;
|
| 1024 |
+
white-space: pre-line;
|
| 1025 |
+
word-wrap: break-word;
|
| 1026 |
+
}
|
| 1027 |
+
}
|
| 1028 |
+
@media (max-width:1350px) {
|
| 1029 |
+
.tab9 .sfsi_plus_left_container {
|
| 1030 |
+
width: 100% !important;
|
| 1031 |
+
}
|
| 1032 |
+
.tab9 .sfsi_plus_right_container {
|
| 1033 |
+
width: 100%;
|
| 1034 |
+
}
|
| 1035 |
+
.tab9 .border_shadow {
|
| 1036 |
+
margin-top: 10px;
|
| 1037 |
+
}
|
| 1038 |
+
.tab9 .row_tab div.sfsi_plus_field {
|
| 1039 |
+
margin-bottom: 10px;
|
| 1040 |
+
}
|
| 1041 |
+
}
|
| 1042 |
+
@media (max-width:770px) {
|
| 1043 |
+
#sfsi_plus_form_heading_fontstyle {
|
| 1044 |
+
margin-left: 19px !important;
|
| 1045 |
+
margin-top: 10px !important;
|
| 1046 |
+
}
|
| 1047 |
+
}
|
| 1048 |
+
/*poonam Style*/
|
| 1049 |
+
.feedClaiming-overlay h1 {
|
| 1050 |
+
font-size: 22px !important;
|
| 1051 |
+
font-weight: bolder !important;
|
| 1052 |
+
margin-top: 7px !important;
|
| 1053 |
+
}
|
| 1054 |
+
.feedClaiming-overlay input[type="email"] {
|
| 1055 |
+
font-size: 16px;
|
| 1056 |
+
margin: 26px 0 0;
|
| 1057 |
+
padding: 10px 0;
|
| 1058 |
+
text-align: center;
|
| 1059 |
+
width: 100%;
|
| 1060 |
+
color: #bebebe !important;
|
| 1061 |
+
box-shadow: none;
|
| 1062 |
+
}
|
| 1063 |
+
.feedClaiming-overlay input[type="email"]::-webkit-input-placeholder {
|
| 1064 |
+
color: #bebebe !important;
|
| 1065 |
+
}
|
| 1066 |
+
.feedClaiming-overlay input[type="email"]:-moz-placeholder { /* Firefox 18- */
|
| 1067 |
+
color: #bebebe !important;
|
| 1068 |
+
}
|
| 1069 |
+
.feedClaiming-overlay input[type="email"]::-moz-placeholder { /* Firefox 19+ */
|
| 1070 |
+
color: #bebebe !important;
|
| 1071 |
+
}
|
| 1072 |
+
.feedClaiming-overlay input[type="email"]:-ms-input-placeholder {
|
| 1073 |
+
color: #bebebe !important;
|
| 1074 |
+
}
|
| 1075 |
+
.feedClaiming-overlay .save_button {
|
| 1076 |
+
padding: 0 !important;
|
| 1077 |
+
width: 100%;
|
| 1078 |
+
}
|
| 1079 |
+
.feedClaiming-overlay .save_button a#getMeFullAccess{
|
| 1080 |
+
border-radius: 4px;
|
| 1081 |
+
font-size: 18px;
|
| 1082 |
+
font-weight: bolder;
|
| 1083 |
+
}
|
| 1084 |
+
.feedClaiming-overlay .sfsicloseBtn {
|
| 1085 |
+
right: 8px !important;
|
| 1086 |
+
top: 8px !important;
|
| 1087 |
+
}
|
| 1088 |
+
.feedClaiming-overlay p {text-align:center !important; font-size: 12px !important;line-height: 23px !important;padding: 18px 0 0 !important; color:#bebebe !important; }
|
| 1089 |
+
.feedClaiming-overlay p a {display: inline-block;font-size: 12px;margin: 0;padding: 0;width: auto; color:#274da3 !important; }
|
| 1090 |
+
.feedClaiming-overlay .pop_up_box{padding: 25px 30px !important; width: 435px !important; min-height: 220px;}
|
| 1091 |
+
.follows-btn{float:left;width:25%;}
|
| 1092 |
+
.preview-btn{float:left;width:10%;}
|
| 1093 |
+
.social-img-link{float:left;width:15%;}
|
| 1094 |
+
.social-img-link img{vertical-align:middle;}
|
| 1095 |
+
.language-field{float:left;width:24%;}
|
| 1096 |
+
.language-field select{width:100%;}
|
| 1097 |
+
.icons_size{clear:both;}
|
| 1098 |
+
.plus_custom-img img, .sfsiplus_custom_section img, .sfsiplus_custom_iconOrder img, .plus_sfsi_sample_icons img{
|
| 1099 |
+
width: 51px;
|
| 1100 |
+
}
|
| 1101 |
+
.cstomskins_upload span.sfsi_plus-bgimage
|
| 1102 |
+
{
|
| 1103 |
+
background-size: 51px 51px !important;
|
| 1104 |
+
}
|
| 1105 |
+
|
| 1106 |
+
/* poonam */
|
| 1107 |
+
.sfsi_plus_premium_brdr_box{box-sizing: border-box;}
|
| 1108 |
+
.sf_si_plus_our_prmium_plugin-add, .sfsi_plus_prem_icons_added, .sfsi_plus_new_prmium_follw{background:#f3faf6;border:1px solid #12a252;padding: 25px 38px 35px 40px;clear: both;}
|
| 1109 |
+
.sf_si_plus_our_prmium_plugin-add{padding: 25px 38px 45px 44px;}
|
| 1110 |
+
.sf_si_plus_default_design ul{padding:0;margin:0;}
|
| 1111 |
+
.sf_si_plus_default_design ul li{list-style:none;font-size:20px;color:#1a1d20;clear:both;}
|
| 1112 |
+
.sf_si_plus_default_design ul li b{font-weight: bold;}
|
| 1113 |
+
.sf_si_plus_default_design ul li img{vertical-align: middle;}
|
| 1114 |
+
.sf_si_plus_default_design ul li h4{color:#1a1d20 !important;font-size:20px !important;font-weight:bold;padding-bottom:21px !important;}
|
| 1115 |
+
.sf_si_plus_default_design ul li h4 span{font-weight:normal;}
|
| 1116 |
+
.sf_si_plus_default_design ul li b span{font-weight:normal !important;}
|
| 1117 |
+
.sf_si_plus_default_design ul li{margin:0 !important;}
|
| 1118 |
+
.sf_si_plus_default_design ul li h4.sfsi_plus_second_themedTitle{padding-bottom:16px !important;}
|
| 1119 |
+
.sfsi_plus_row_table{clear:both;}
|
| 1120 |
+
.sfsi_plus_first_icon_field, .sfsi_plus_second_icon_img{display:table-cell;vertical-align:middle;padding: 5px 0;}
|
| 1121 |
+
.sfsi_plus_first_icon_field{width:125px;}
|
| 1122 |
+
.sfsi_plus_first_icon_field h2{font-size:18px !important;color:#1a1d20 !important;margin:0 !important; font-weight: bold !important;}
|
| 1123 |
+
.sfsi_plus_first_icon_field p{color:#1a1d20 !important;font-size:12px !important;margin:0 !important;padding:0 !important; line-height: 18px !important;}
|
| 1124 |
+
.sfsi_plus_cool_font_weight h2{font-weight:normal !important;}
|
| 1125 |
+
.sf_si_plus_prmium_head span{font-weight:normal;}
|
| 1126 |
+
.sf_si_plus_prmium_head h2{font-size:26px;color:#000;font-weight:bold !important;padding-bottom:13px !important; margin-top: 0;}
|
| 1127 |
+
.sf_si_plus_our_prmium_plugin-add .sf_si_plus_prmium_head h2{padding-bottom:23px !important;}
|
| 1128 |
+
.sfsi_plus_premium_row{clear:both;}
|
| 1129 |
+
.sfsi_plus_prem_cmn_rowlisting{width:225px;float:left;margin-top: 10px;margin-bottom:1px;}
|
| 1130 |
+
.sfsi_plus_prem_cmn_rowlisting span{color: #1a1d20;font-size:20px;display:table-cell;vertical-align: middle;padding-right:10px;}
|
| 1131 |
+
.sfsi_mainContainer .sfsi_plus_prem_cmn_rowlisting img{width:52px;height:52px; vertical-align: middle;}
|
| 1132 |
+
.sfsi_plus_need_another_tell_us, .sfsi_plus_need_another_one_link{clear:both;}
|
| 1133 |
+
.sfsi_plus_need_another_one_link p{color: #c1c3c5;font-size: 18.9px !important;}
|
| 1134 |
+
.sfsi_plus_need_another_one_link p a{color:#12a252 !important; text-decoration: none;}
|
| 1135 |
+
.sfsi_plus_need_another_one_link{padding:23px 0 20px 5px; }
|
| 1136 |
+
.sf_si_plus_all_features_premium a, .sfsi_plus_need_another_tell_us a{color:#12a252 !important;font-size:18.9px;font-weight:bold;border-bottom: 1px solid #12a252;text-decoration: none;}
|
| 1137 |
+
.sfsi_plus_need_another_tell_us a{margin-left:5px;}
|
| 1138 |
+
.sfsi_plus_new_prmium_follw {margin-top:20px; display: inline-block;padding:15px 75px 20px 24px;}
|
| 1139 |
+
.sfsi_plus_new_prmium_follw p{margin: 0 !important;}
|
| 1140 |
+
.sfsi_plus_new_prmium_follw p{color: #1a1d20 !important;font-size: 20px !important;font-family: helveticaregular !important;}
|
| 1141 |
+
.sfsi_plus_new_prmium_follw p a{color:#12a252 !important;border-bottom: 1px solid #12a252; text-decoration: none;}
|
| 1142 |
+
.sfsi_plus_new_prmium_follw p b{font-weight:bold;color:#1a1d20 !important;}
|
| 1143 |
+
p.sfsi_plus_prem_plu_desc a, p.sfsi_plus_prem_plu_desc_define a{text-decoration: none!important; color: #00a0d2 !important;}
|
| 1144 |
+
p.sfsi_plus_prem_plu_desc{ font-size:18px !important; }
|
| 1145 |
+
p.sfsi_plus_prem_plu_desc_define{ font-size:18px !important; border-left: 0px solid transparent !important;}
|
| 1146 |
+
.sfsi_plus_icons_prem_disc{ float:left; padding-top:20px; }
|
| 1147 |
+
.sfsi_plus_prem_show{padding-top:140px !important;}
|
| 1148 |
+
.sfsi_plus_first_icon_more h2{font-size:18px !important;color:#1a1d20 !important;margin:0 !important;padding-top:17px !important;padding-bottom:22px !important;}
|
| 1149 |
+
.sfsi_plus_fbpaget{float:left !important;padding: 4px 0 0 0px !important;width:100% !important;}
|
| 1150 |
+
.sfsi_plus_fbpaget .sfsi_plus_facebook_count{width: 100% !important;padding: 4px 0 0 0px !important;}
|
| 1151 |
+
.sfsi_plus_facebook_pagedeasc{ font-size: 14px!important; padding: 15px 0 0 60px ; width: 42%;float: right;line-height: 22px;color: #080808; }
|
| 1152 |
+
p.sfsi_plus_instagram_shared_premium,p.sfsi_plus_shared_premium {color: #1a1d20 !important;font-family: helveticaregular !important;padding-top:0 !important;}
|
| 1153 |
+
p.sfsi_plus_shared_premium a ,p.sfsi_plus_instagram_shared_premium a{text-decoration: none; color: #00a0d2 !important;}
|
| 1154 |
+
p.sfsi_plus_shared_premium b,p.sfsi_plus_instagram_shared_premium b{font-weight:bold;}
|
| 1155 |
+
p.sfsi_plus_instagram_shared_premium{float: right;width: 41%;line-height: 20px;color: #1f1d1d;font-size: 13px;}
|
| 1156 |
+
.sfsi_plus_fb_popup_contain{width:50%;display:inline-block;}
|
| 1157 |
+
.sfsi_plus_icons_align_other{width:auto; font-size: 15px !important;}
|
| 1158 |
+
|
| 1159 |
+
/* notification css*/
|
| 1160 |
+
.sfsi_plus_new_notification{ background-color:#fff; border:4px dashed #00c853;margin-bottom:30px;width: 100%;}
|
| 1161 |
+
.sfsi_plus_new_notification_header{ background-color:#e8faef;display: -webkit-box;display: -webkit-flex;display: -ms-flexbox;display: flex;-webkit-box-align: center;-webkit-align-items: center;-ms-flex-align: center;align-items: center;-webkit-box-pack: justify;-webkit-justify-content: space-between;-ms-flex-pack: justify;justify-content: space-between;padding:10px 0 12px 0;}
|
| 1162 |
+
.sfsi_plus_new_notification_header h1{ margin:0 !important;color:#00c853;font-size:18px;margin: 0 auto !important;font-family:Arial, Helvetica, sans-serif;}
|
| 1163 |
+
.sfsi_plus_new_notification_header h1 a{ margin:0 !important;color:#00c853;font-size:18px;margin: 0 auto !important;font-family:Arial, Helvetica, sans-serif; text-decoration: none;}
|
| 1164 |
+
.sfsi_plus_new_notification_cross {float: right;font-size:18px;font-weight: 700;line-height: 1;color: #00c853;font-family:Arial, Helvetica, sans-serif;margin-right: 15px; cursor: pointer;}
|
| 1165 |
+
.sfsi_plus_new_notification_body{width: 100%;background-color:#fff;display: -webkit-box;display: -webkit-flex;display: -ms-flexbox;display: flex;-webkit-box-align: center;-webkit-align-items: center;-ms-flex-align: center;align-items: center;-webkit-box-pack: justify;-webkit-justify-content: space-between;-ms-flex-pack: justify;justify-content: space-between;}
|
| 1166 |
+
.sfsi_plus_new_notification_image{margin:0 20px 0px 20px;width: 100%;text-align: center;overflow: hidden;}
|
| 1167 |
+
.sfsi_plus_new_notification_image img{ width:auto;}
|
| 1168 |
+
.sfsi_plus_new_notification_learnmore{float:right;}
|
| 1169 |
+
.sfsi_plus_new_notification_learnmore {background-color: #00c853; display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;width: 150px; margin-bottom: -4px;margin-right: -4px; position: relative;color: #fff;padding: 70px 10px;
|
| 1170 |
+
}
|
| 1171 |
+
.sfsi_plus_new_notification_body_link a{
|
| 1172 |
+
display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;
|
| 1173 |
+
}
|
| 1174 |
+
/*Tab 4*/
|
| 1175 |
+
.tab4 .sfsi_plus_tokenGenerateButton { margin: 25px 0; }
|
| 1176 |
+
.tab4 .sfsi_plus_tokenGenerateButton p { display: inline-block; margin-bottom: 11px; vertical-align: middle;width: 100%; }
|
| 1177 |
+
.tab4 .sfsi_plus_tokenGenerateButton a { background-color: #12a252; color: #fff; padding: 10px 20px; text-decoration: none; }
|
| 1178 |
+
.tab4 .sfsi_plus_instagramInstruction { float: left; margin-bottom: 12px; width: 450px;}
|
| 1179 |
+
.tab4 .sfsi_plus_instagramInstruction ul { padding-left: 14px !important; }
|
| 1180 |
+
.tab4 .sfsi_plus_instagramInstruction ul li { font-size: 13px !important; line-height: 20px !important; list-style: outside none bullets !important;margin-top: 5px !important;padding: 0 !important;}
|
| 1181 |
+
.tab4 .sfsi_instagram_follower{width: 50%;float: left;}
|
| 1182 |
+
|
| 1183 |
+
/* tab2 emailsection */
|
| 1184 |
+
.sfsi_plus_service_row{margin-right: -15px;margin-left: -15px;}
|
| 1185 |
+
.sfsi_plus_service_column{float: left;margin-bottom: 40px;margin-top: 15px;padding-left: 30px;width: 47%;}
|
| 1186 |
+
.sfsi_plus_service_column ul{margin-left: 11% !important;}
|
| 1187 |
+
.sfsi_plus_service_column ul li{padding-bottom:10px;font-size:16px;line-height: 25px; }
|
| 1188 |
+
.sfsi_plus_service_column ul li span{color:#12a252;}
|
| 1189 |
+
.sfsi_plus_service_column ul li::before {content: url(../images/tick-icon.png); position: relative; top: 0px; right: 10px; text-indent: -22px; float: left; }
|
| 1190 |
+
.sfsi_plus_inputbtn{clear: both;display: block;}
|
| 1191 |
+
.sfsi_plus_inputbtn input{width: 100%; padding: 15px 0px; text-align: center; margin-bottom: 10px; }
|
| 1192 |
+
.sfsi_plus_email_services_text{clear: both;}
|
| 1193 |
+
.sfsi_plus_email_services_paragraph{ width: 600px; float: left; margin-top: 10px; margin-bottom:40px;}
|
| 1194 |
+
.sfsi_plus_more_services_link a{ background-color: #12a252;color: #fff !important; padding:20px 0px;text-decoration: none;text-align: center;font-size: 20px;display: block;clear: both; font-weight: bold;}
|
| 1195 |
+
.sfsi_plus_subscribe_popbox_link a{color: #00a0d2 !important;}
|
| 1196 |
+
.sfsi_plus_email_services_paragraph ul{margin-left: 11% !important;}
|
| 1197 |
+
.sfsi_plus_email_services_paragraph ul li{padding-bottom:10px;font-size:16px; }
|
| 1198 |
+
.sfsi_plus_email_services_paragraph ul li span{color:#12a252;}
|
| 1199 |
+
.sfsi_plus_email_services_paragraph ul li::before {content: url(../images/tick-icon.png); position: relative; top: 5px; right: 10px; text-indent: -22px; float: left; }
|
| 1200 |
+
.sfsi_plus_email_last_paragraph {width: 60%; text-align: center !important; margin: 20px auto ! important; font-size: 16px !important; color: #a4a9ad !important; padding-top: 0px!important; }
|
| 1201 |
+
.sfsi_plus_email_last_paragraph a{color:#12a252 !important;font-family: 'helveticaneue-light' !important;}
|
| 1202 |
+
.pop_up_box.sfsi_pop_up.sfsi_pop_box{padding: 25px 30px 0 !important;}
|
| 1203 |
+
#adminmenu #toplevel_page_sfsi-plus-options ul .wp-first-item{
|
| 1204 |
+
display: none;
|
| 1205 |
+
}
|
| 1206 |
+
ul#adminmenu li.toplevel_page_sfsi-plus-options ul.wp-submenu a.current, ul#adminmenu li.toplevel_page_sfsi-plus-options ul.wp-submenu a.current:hover{
|
| 1207 |
+
background: none !important;
|
| 1208 |
+
|
| 1209 |
+
}
|
| 1210 |
+
/*new banner styles*/
|
| 1211 |
+
.sfsi_plus_new_notification_cat{width: 100%;min-height: 300px; max-width: 700px;}
|
| 1212 |
+
.sfsi_plus_new_notification_cat {background-color: #fff; margin: 30px auto;width: 100%;}
|
| 1213 |
+
.sfsi_plus_new_notification_header_cat {background-color: #e8faef;padding: 21px 0 21px 0;text-align: center;}
|
| 1214 |
+
.sfsi_plus_new_notification_header_cat h1 {margin: 0;color: #000000;font-size: 24px;margin: 0 auto !important;font-family: Arial, Helvetica, sans-serif;font-weight: bold !important;}
|
| 1215 |
+
.sfsi_plus_new_notification_header_cat h3{margin-top: 10px !important;font-size: 16px;color: #000000;}
|
| 1216 |
+
.sfsi_plus_new_notification_header_cat h3 a{text-decoration: none;color: #38B54A;}
|
| 1217 |
+
.sfsi_plus_new_notification_header_cat h1 a {margin: 0;color: #00c853;font-size: 18px;margin: 0 auto;font-family: Arial, Helvetica, sans-serif;text-decoration: none;}
|
| 1218 |
+
.sfsi_plus_new_notification_cross_cat {float: right;font-size: 18px;font-weight: 700;line-height: 1;color: #000000;font-family: Arial, Helvetica, sans-serif;margin-right: 15px;cursor: pointer;margin-top: -50px;}
|
| 1219 |
+
.sfsi_plus_new_notification_body_link_cat a {display: block;text-decoration: none;text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;}
|
| 1220 |
+
.sfsi_plus_new_notification_body_cat {width: 100%;background-color: #fff; }
|
| 1221 |
+
.sfsi_plus_new_notification_image_cat { width: 100%;text-align: center; overflow: hidden;}
|
| 1222 |
+
.sfsi_plus_new_notification_image_cat img {width: auto; border: 0;vertical-align: middle;}
|
| 1223 |
+
.sfsiplus_bottom_text{ background: #38B54A;text-align: center;padding: 15px 0px;font-size: 18px;font-weight: bold;color: #fff;}
|
| 1224 |
+
.sfsi_plus_new_notification_image_cat p{color: #000000;padding: 10px;font-size: 16px;}
|
| 1225 |
+
.sfsi_plus_new_notification_body_link_cat .sfsi_plus_tailored_icons_img{display: block;text-decoration: none; text-align: center;font-size: 20px;font-family: Arial, Helvetica, sans-serif;color: #fff;margin: 28px 0px;}
|
| 1226 |
+
|
| 1227 |
+
/**curl error box*/
|
| 1228 |
+
.sfsiplus_curlerror{margin: 0px 0px 10px 94px;background: rgba(244, 67, 54, 0.08);padding: 20px; line-height: 20px;}
|
| 1229 |
+
.sfsi_plus_versionNotification .sfsiplus_curlerror{background:rgba(244, 67, 54, 0.08);padding: 20px; line-height: 20px; margin: 0px 0px 10px 0px;}
|
| 1230 |
+
.sfsi_plus_curlerror_cross{float: right;text-decoration: underline;margin-top: 10px;}
|
| 1231 |
+
.sfsiplus_curlerrortab4 a{color: #0073aa !important;}
|
| 1232 |
.sfsiplus_curlerror a{color: #0073aa !important;}
|
css/sfsi-style.css
CHANGED
|
@@ -1,3264 +1,3264 @@
|
|
| 1 |
-
@charset "utf-8";
|
| 2 |
-
@font-face {
|
| 3 |
-
font-family: helveticabold;
|
| 4 |
-
src: url(fonts/helvetica_bold_0-webfont.eot);
|
| 5 |
-
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
| 6 |
-
font-weight: 400;
|
| 7 |
-
font-style: normal;
|
| 8 |
-
}
|
| 9 |
-
@font-face {
|
| 10 |
-
font-family: helveticaregular;
|
| 11 |
-
src: url(fonts/helvetica_0-webfont.eot);
|
| 12 |
-
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
| 13 |
-
font-weight: 400;
|
| 14 |
-
font-style: normal;
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
@font-face {
|
| 18 |
-
font-family: helveticaneue-light;
|
| 19 |
-
src: url(fonts/helveticaneue-light.eot);
|
| 20 |
-
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
| 21 |
-
url(fonts/helveticaneue-light.woff) format('woff'),
|
| 22 |
-
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
| 23 |
-
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
| 24 |
-
font-weight: 400;
|
| 25 |
-
font-style: normal;
|
| 26 |
-
}
|
| 27 |
-
body {
|
| 28 |
-
margin: 0;
|
| 29 |
-
padding: 0;
|
| 30 |
-
}
|
| 31 |
-
.clear {
|
| 32 |
-
clear: both;
|
| 33 |
-
}
|
| 34 |
-
.space {
|
| 35 |
-
clear: both;
|
| 36 |
-
padding: 30px 0 0;
|
| 37 |
-
width: 100%;
|
| 38 |
-
float: left;
|
| 39 |
-
}
|
| 40 |
-
.sfsi_mainContainer {
|
| 41 |
-
font-family: helveticaregular;
|
| 42 |
-
}
|
| 43 |
-
.sfsi_mainContainer h1, .sfsi_mainContainer h2, .sfsi_mainContainer h3, .sfsi_mainContainer h4, .sfsi_mainContainer h5, .sfsi_mainContainer h6, .sfsi_mainContainer li, .sfsi_mainContainer p, .sfsi_mainContainer ul {
|
| 44 |
-
margin: 0;
|
| 45 |
-
padding: 0;
|
| 46 |
-
font-weight: 400;
|
| 47 |
-
}
|
| 48 |
-
.sfsi_mainContainer img {
|
| 49 |
-
border: 0;
|
| 50 |
-
}
|
| 51 |
-
.main_contant p, .ui-accordion .ui-accordion-header {
|
| 52 |
-
font-family: 'helveticaneue-light';
|
| 53 |
-
}
|
| 54 |
-
.sfsi_mainContainer input, .sfsi_mainContainer select {
|
| 55 |
-
outline: 0;
|
| 56 |
-
}
|
| 57 |
-
.wapper {
|
| 58 |
-
padding: 48px 106px 40px 20px;
|
| 59 |
-
display: block;
|
| 60 |
-
background: #f1f1f1;
|
| 61 |
-
}
|
| 62 |
-
.main_contant {
|
| 63 |
-
margin: 0;
|
| 64 |
-
padding: 0;
|
| 65 |
-
}
|
| 66 |
-
.main_contant h1 {
|
| 67 |
-
padding: 0;
|
| 68 |
-
color: #1a1d20;
|
| 69 |
-
font-family: helveticabold;
|
| 70 |
-
font-size: 28px;
|
| 71 |
-
}
|
| 72 |
-
.main_contant p {
|
| 73 |
-
padding: 0;
|
| 74 |
-
color: #414951;
|
| 75 |
-
font-size: 17px;
|
| 76 |
-
line-height: 26px;
|
| 77 |
-
}
|
| 78 |
-
.main_contant p span {
|
| 79 |
-
text-decoration: underline;
|
| 80 |
-
font-family: helveticabold;
|
| 81 |
-
}
|
| 82 |
-
.like_txt {
|
| 83 |
-
margin: 30px 0 0;
|
| 84 |
-
padding: 0;
|
| 85 |
-
color: #12a252;
|
| 86 |
-
font-family: helveticaregular;
|
| 87 |
-
font-size: 20px;
|
| 88 |
-
line-height: 20px;
|
| 89 |
-
text-align: center;
|
| 90 |
-
}
|
| 91 |
-
.like_txt a {
|
| 92 |
-
color: #12a252;
|
| 93 |
-
}
|
| 94 |
-
#accordion p, #accordion1 p {
|
| 95 |
-
color: #5a6570;
|
| 96 |
-
text-align: left;
|
| 97 |
-
font-family: 'helveticaneue-light';
|
| 98 |
-
font-size: 17px;
|
| 99 |
-
line-height: 26px;
|
| 100 |
-
padding-top: 19px;
|
| 101 |
-
}
|
| 102 |
-
.sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .cstmdisplaysharingtxt { float: left; }
|
| 103 |
-
#accordion p:first-child, #accordion1 p:first-child {
|
| 104 |
-
padding-top: 0;
|
| 105 |
-
}
|
| 106 |
-
#accordion h4, #accordion1 h4 {
|
| 107 |
-
margin: 0;
|
| 108 |
-
padding: 30px 0 0;
|
| 109 |
-
color: #414951;
|
| 110 |
-
font-size: 20px;
|
| 111 |
-
line-height: 22px;
|
| 112 |
-
font-family: helveticaregular;
|
| 113 |
-
}
|
| 114 |
-
#accordion h4:first-child, #accordion1 h4:first-child {
|
| 115 |
-
padding-top: 0;
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
#accordion .tab8 h4:first-child, #accordion1 h4:first-child { margin-left: 0 !important}
|
| 119 |
-
|
| 120 |
-
.tab1, .tab2, .tab3, .tab4, .tab5, .tab6, .tab7 {
|
| 121 |
-
color: #5a6570;
|
| 122 |
-
text-align: left;
|
| 123 |
-
font-family: helveticaregular;
|
| 124 |
-
font-size: 18px;
|
| 125 |
-
line-height: 26px;
|
| 126 |
-
}
|
| 127 |
-
.tab4 ul.like_icon {
|
| 128 |
-
margin: 0;
|
| 129 |
-
padding: 20px 0 0;
|
| 130 |
-
list-style: none;
|
| 131 |
-
text-align: center;
|
| 132 |
-
}
|
| 133 |
-
.tab4 ul.like_icon li {
|
| 134 |
-
margin: 0;
|
| 135 |
-
padding: 0;
|
| 136 |
-
list-style: none;
|
| 137 |
-
display: inline-block;
|
| 138 |
-
}
|
| 139 |
-
.tab4 ul.like_icon li span {
|
| 140 |
-
margin: 0;
|
| 141 |
-
width: 54px;
|
| 142 |
-
display: block;
|
| 143 |
-
background: url(../images/count_bg.png) no-repeat;
|
| 144 |
-
height: 24px;
|
| 145 |
-
overflow: hidden;
|
| 146 |
-
padding: 10px 2px 2px;
|
| 147 |
-
font-size: 17px;
|
| 148 |
-
text-align: center;
|
| 149 |
-
line-height: 24px;
|
| 150 |
-
color: #5a6570;
|
| 151 |
-
}
|
| 152 |
-
.tab4 ul.like_icon li a {
|
| 153 |
-
color: #5a6570;
|
| 154 |
-
text-decoration: none;
|
| 155 |
-
}
|
| 156 |
-
.tab4 ul.enough_waffling {
|
| 157 |
-
margin: 0;
|
| 158 |
-
padding: 25px 0 27px;
|
| 159 |
-
list-style: none;
|
| 160 |
-
text-align: center;
|
| 161 |
-
}
|
| 162 |
-
.tab4 ul.enough_waffling li {
|
| 163 |
-
margin: 0 22px;
|
| 164 |
-
padding: 0;
|
| 165 |
-
list-style: none;
|
| 166 |
-
display: inline-block;
|
| 167 |
-
}
|
| 168 |
-
.tab4 ul.enough_waffling li span {
|
| 169 |
-
float: left;
|
| 170 |
-
}
|
| 171 |
-
.tab4 ul.enough_waffling li label {
|
| 172 |
-
margin: 0 0 0 20px;
|
| 173 |
-
float: left;
|
| 174 |
-
font-family: helveticaregular;
|
| 175 |
-
font-size: 18px;
|
| 176 |
-
font-weight: 400;
|
| 177 |
-
text-align: center;
|
| 178 |
-
line-height: 38px;
|
| 179 |
-
color: #5a6570;
|
| 180 |
-
}
|
| 181 |
-
.sfsi_mainContainer .checkbox {
|
| 182 |
-
width: 31px;
|
| 183 |
-
height: 31px;
|
| 184 |
-
background: url(../images/check_bg.jpg) no-repeat;
|
| 185 |
-
display: inherit;
|
| 186 |
-
}
|
| 187 |
-
.tab8 .social_icon_like1 li span.checkbox {
|
| 188 |
-
width: 31px;
|
| 189 |
-
height: 31px;
|
| 190 |
-
background: url(../images/check_bg.jpg) no-repeat;
|
| 191 |
-
display: inherit;
|
| 192 |
-
}
|
| 193 |
-
.tab8 .social_icon_like1 li a
|
| 194 |
-
{
|
| 195 |
-
float: left;
|
| 196 |
-
}
|
| 197 |
-
.sfsi_mainContainer .radio {
|
| 198 |
-
width: 40px;
|
| 199 |
-
height: 40px;
|
| 200 |
-
background: url(../images/radio_bg.png) no-repeat;
|
| 201 |
-
display: inherit;
|
| 202 |
-
}
|
| 203 |
-
.sfsi_mainContainer .select {
|
| 204 |
-
width: 127px;
|
| 205 |
-
height: 47px;
|
| 206 |
-
font-size: 17px;
|
| 207 |
-
background: url(../images/select_bg.jpg) no-repeat;
|
| 208 |
-
display: block;
|
| 209 |
-
padding-left: 16px;
|
| 210 |
-
line-height: 49px;
|
| 211 |
-
}
|
| 212 |
-
.sfsi_mainContainer .line {
|
| 213 |
-
background: #eaebee;
|
| 214 |
-
height: 1px;
|
| 215 |
-
font-size: 0;
|
| 216 |
-
margin: 15px 0 0;
|
| 217 |
-
clear: both;
|
| 218 |
-
width: 100%;
|
| 219 |
-
float: left;
|
| 220 |
-
}
|
| 221 |
-
.sfsiplus_specify_counts {
|
| 222 |
-
display: block;
|
| 223 |
-
margin-top: 15px;
|
| 224 |
-
padding-top: 15px;
|
| 225 |
-
clear: both;
|
| 226 |
-
width: 100%;
|
| 227 |
-
float: left;
|
| 228 |
-
border-top: 1px solid #eaebee;
|
| 229 |
-
}
|
| 230 |
-
.sfsiplus_specify_counts .radio_section {
|
| 231 |
-
width: 30px;
|
| 232 |
-
float: left;
|
| 233 |
-
margin: 12px 10px 0 0;
|
| 234 |
-
}
|
| 235 |
-
.sfsiplus_specify_counts .social_icon_like {
|
| 236 |
-
width: 54px;
|
| 237 |
-
float: left;
|
| 238 |
-
margin: 0 15px 0 0;
|
| 239 |
-
}
|
| 240 |
-
.sfsiplus_specify_counts .social_icon_like ul {
|
| 241 |
-
margin: 0;
|
| 242 |
-
padding: 0 !important;
|
| 243 |
-
list-style: none;
|
| 244 |
-
text-align: center;
|
| 245 |
-
}
|
| 246 |
-
.sfsiplus_specify_counts .social_icon_like li {
|
| 247 |
-
margin: 0;
|
| 248 |
-
padding: 0;
|
| 249 |
-
list-style: none;
|
| 250 |
-
display: inline-block;
|
| 251 |
-
}
|
| 252 |
-
.sfsiplus_specify_counts .social_icon_like li span {
|
| 253 |
-
margin: 0;
|
| 254 |
-
width: 54px;
|
| 255 |
-
display: block;
|
| 256 |
-
background: url(../images/count_bg.jpg) no-repeat;
|
| 257 |
-
height: 24px;
|
| 258 |
-
overflow: hidden;
|
| 259 |
-
padding: 10px 2px 2px;
|
| 260 |
-
font-family: helveticaregular;
|
| 261 |
-
font-size: 16px;
|
| 262 |
-
text-align: center;
|
| 263 |
-
line-height: 24px;
|
| 264 |
-
color: #5a6570;
|
| 265 |
-
}
|
| 266 |
-
.sfsiplus_specify_counts .social_icon_like li a {
|
| 267 |
-
color: #5a6570;
|
| 268 |
-
text-decoration: none;
|
| 269 |
-
}
|
| 270 |
-
.sfsiplus_specify_counts .listing {
|
| 271 |
-
width: 88%;
|
| 272 |
-
margin-top: -5px;
|
| 273 |
-
display: inherit;
|
| 274 |
-
float: left;
|
| 275 |
-
}
|
| 276 |
-
.sfsiplus_specify_counts .listing ul {
|
| 277 |
-
margin: 0;
|
| 278 |
-
padding: 0;
|
| 279 |
-
list-style: none;
|
| 280 |
-
text-align: left;
|
| 281 |
-
}
|
| 282 |
-
.sfsiplus_specify_counts .listing li {
|
| 283 |
-
margin: 15px 0 0;
|
| 284 |
-
padding: 0;
|
| 285 |
-
list-style: none;
|
| 286 |
-
clear: both;
|
| 287 |
-
line-height: 39px;
|
| 288 |
-
font-size: 17px;
|
| 289 |
-
}
|
| 290 |
-
.sfsiplus_specify_counts .listing li span {
|
| 291 |
-
float: left;
|
| 292 |
-
margin-right: 20px;
|
| 293 |
-
}
|
| 294 |
-
.sfsiplus_specify_counts .listing li .input {
|
| 295 |
-
background: #e5e5e5;
|
| 296 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 297 |
-
border: 0;
|
| 298 |
-
padding: 10px;
|
| 299 |
-
margin-left: 25px;
|
| 300 |
-
}
|
| 301 |
-
.sfsiplus_specify_counts .listing li .input_facebook {
|
| 302 |
-
width: 288px;
|
| 303 |
-
background: #e5e5e5;
|
| 304 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 305 |
-
border: 0;
|
| 306 |
-
padding: 10px;
|
| 307 |
-
margin-left: 16px;
|
| 308 |
-
}
|
| 309 |
-
.save_button {
|
| 310 |
-
width: 450px;
|
| 311 |
-
padding-top: 30px !important;
|
| 312 |
-
clear: both;
|
| 313 |
-
margin: auto;
|
| 314 |
-
}
|
| 315 |
-
.save_button a {
|
| 316 |
-
background: #12a252;
|
| 317 |
-
text-align: center;
|
| 318 |
-
font-size: 23px;
|
| 319 |
-
color: #FFF!important;
|
| 320 |
-
display: block;
|
| 321 |
-
padding: 11px 0;
|
| 322 |
-
text-decoration: none;
|
| 323 |
-
}
|
| 324 |
-
.save_button a:hover { background:#079345 }
|
| 325 |
-
|
| 326 |
-
.tab5 ul.plus_share_icon_order {
|
| 327 |
-
margin: 0;
|
| 328 |
-
padding: 0;
|
| 329 |
-
list-style: none;
|
| 330 |
-
text-align: left;
|
| 331 |
-
}
|
| 332 |
-
.tab5 ul.plus_share_icon_order li {
|
| 333 |
-
margin: 22px 6px 0 0;
|
| 334 |
-
padding: 0;
|
| 335 |
-
list-style: none;
|
| 336 |
-
float: left;
|
| 337 |
-
line-height: 37px;
|
| 338 |
-
}
|
| 339 |
-
.tab5 ul.plus_share_icon_order li:last-child {
|
| 340 |
-
margin: 22px 0 0 3px;
|
| 341 |
-
}
|
| 342 |
-
.tab5 .row {
|
| 343 |
-
border-top: 1px solid #eaebee;
|
| 344 |
-
margin-top: 25px;
|
| 345 |
-
padding-top: 15px;
|
| 346 |
-
clear: both;
|
| 347 |
-
display: block;
|
| 348 |
-
width: 100%;
|
| 349 |
-
float: left;
|
| 350 |
-
font-family: helveticaregular;
|
| 351 |
-
line-height: 42px;
|
| 352 |
-
}
|
| 353 |
-
.tab5 .icons_size {
|
| 354 |
-
position: relative;
|
| 355 |
-
}
|
| 356 |
-
.tab5 .icons_size span {
|
| 357 |
-
margin-right: 18px;
|
| 358 |
-
display: block;
|
| 359 |
-
float: left;
|
| 360 |
-
font-size: 18px;
|
| 361 |
-
font-weight: 400;
|
| 362 |
-
line-height: 46px;
|
| 363 |
-
}
|
| 364 |
-
.tab5 .icons_size span.last {
|
| 365 |
-
margin-left: 55px;
|
| 366 |
-
}
|
| 367 |
-
.tab5 .icons_size input {
|
| 368 |
-
width: 73px;
|
| 369 |
-
background: #e5e5e5;
|
| 370 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 371 |
-
border: 0;
|
| 372 |
-
padding: 13px 13px 12px;
|
| 373 |
-
margin-right: 18px;
|
| 374 |
-
float: left;
|
| 375 |
-
display: block;
|
| 376 |
-
}
|
| 377 |
-
.tab5 .icons_size select.styled {
|
| 378 |
-
position: absolute;
|
| 379 |
-
left: 0;
|
| 380 |
-
width: 135px;
|
| 381 |
-
height: 46px;
|
| 382 |
-
line-height: 46px;
|
| 383 |
-
}
|
| 384 |
-
.tab5 .icons_size .field {
|
| 385 |
-
position: relative;
|
| 386 |
-
float: left;
|
| 387 |
-
display: block;
|
| 388 |
-
margin-right: 20px;
|
| 389 |
-
}
|
| 390 |
-
.tab5 .icons_size ins {
|
| 391 |
-
margin-right: 25px;
|
| 392 |
-
float: left;
|
| 393 |
-
font-size: 17px;
|
| 394 |
-
font-weight: 400;
|
| 395 |
-
text-decoration: none;
|
| 396 |
-
}
|
| 397 |
-
.tab5 .icons_size ins.leave_empty {
|
| 398 |
-
line-height: 23px;
|
| 399 |
-
}
|
| 400 |
-
.tab5 .icons_size {
|
| 401 |
-
padding-top: 15px;
|
| 402 |
-
}
|
| 403 |
-
.tab5 ul.enough_waffling {
|
| 404 |
-
margin: -5px 0 0;
|
| 405 |
-
padding: 0;
|
| 406 |
-
list-style: none;
|
| 407 |
-
text-align: center;
|
| 408 |
-
}
|
| 409 |
-
.tab5 .new_wind .sfsiplus_row_onl ul.enough_waffling {
|
| 410 |
-
margin: 20px 0 0 0;
|
| 411 |
-
padding: 0;
|
| 412 |
-
list-style: none;
|
| 413 |
-
height: 38px;
|
| 414 |
-
text-align: left;
|
| 415 |
-
}
|
| 416 |
-
.tab5 ul.enough_waffling li {
|
| 417 |
-
margin: 0 22px;
|
| 418 |
-
padding: 0;
|
| 419 |
-
list-style: none;
|
| 420 |
-
display: inline-block;
|
| 421 |
-
}
|
| 422 |
-
.tab5 ul.enough_waffling li span {
|
| 423 |
-
float: left;
|
| 424 |
-
}
|
| 425 |
-
.tab5 ul.enough_waffling li label {
|
| 426 |
-
margin: 0 0 0 20px;
|
| 427 |
-
float: left;
|
| 428 |
-
font-family: helveticaregular;
|
| 429 |
-
font-size: 18px;
|
| 430 |
-
font-weight: 400;
|
| 431 |
-
text-align: center;
|
| 432 |
-
line-height: 38px;
|
| 433 |
-
color: #5a6570;
|
| 434 |
-
}
|
| 435 |
-
.sticking p {
|
| 436 |
-
float: left;
|
| 437 |
-
font-size: 18px!important;
|
| 438 |
-
}
|
| 439 |
-
.sticking p.list {
|
| 440 |
-
width: 168px;
|
| 441 |
-
}
|
| 442 |
-
.sticking p.link {
|
| 443 |
-
margin: 3px 0 0 12px;
|
| 444 |
-
padding: 0!important;
|
| 445 |
-
float: left;
|
| 446 |
-
}
|
| 447 |
-
.sticking .float {
|
| 448 |
-
margin-left: 188px;
|
| 449 |
-
margin-top: 3px;
|
| 450 |
-
float: left;
|
| 451 |
-
font-size: 17px;
|
| 452 |
-
}
|
| 453 |
-
.sticking ul {
|
| 454 |
-
margin: 0;
|
| 455 |
-
padding: 30px 0 0;
|
| 456 |
-
list-style: none;
|
| 457 |
-
float: left;
|
| 458 |
-
}
|
| 459 |
-
.sticking a {
|
| 460 |
-
color: #a4a9ad;
|
| 461 |
-
text-decoration: none;
|
| 462 |
-
}
|
| 463 |
-
.sticking .field {
|
| 464 |
-
position: relative;
|
| 465 |
-
float: left;
|
| 466 |
-
display: block;
|
| 467 |
-
margin-left: 20px;
|
| 468 |
-
}
|
| 469 |
-
.sticking .field .select {
|
| 470 |
-
width: 206px;
|
| 471 |
-
height: 47px;
|
| 472 |
-
background: url(../images/select_bg1.jpg) no-repeat;
|
| 473 |
-
display: block;
|
| 474 |
-
padding-left: 10px;
|
| 475 |
-
}
|
| 476 |
-
.sticking .field select.styled {
|
| 477 |
-
position: absolute;
|
| 478 |
-
left: 0;
|
| 479 |
-
top: 0;
|
| 480 |
-
width: 211px;
|
| 481 |
-
line-height: 46px;
|
| 482 |
-
height: 46px;
|
| 483 |
-
}
|
| 484 |
-
.mouseover_field {
|
| 485 |
-
width: 455px;
|
| 486 |
-
float: left;
|
| 487 |
-
font-size: 18px;
|
| 488 |
-
margin-top: 10px;
|
| 489 |
-
}
|
| 490 |
-
.mouseover_field label {
|
| 491 |
-
width: 125px;
|
| 492 |
-
float: left;
|
| 493 |
-
}
|
| 494 |
-
.mouseover_field input {
|
| 495 |
-
width: 256px;
|
| 496 |
-
float: left;
|
| 497 |
-
background: #e5e5e5;
|
| 498 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 499 |
-
border: 0;
|
| 500 |
-
padding: 10px;
|
| 501 |
-
}
|
| 502 |
-
.tab6 .social_icon_like1 {
|
| 503 |
-
width: 100%;
|
| 504 |
-
float: left;
|
| 505 |
-
margin: 0;
|
| 506 |
-
padding: 35px 0 0;
|
| 507 |
-
text-align: center;
|
| 508 |
-
}
|
| 509 |
-
.tab6 .social_icon_like1 ul {
|
| 510 |
-
margin: 0;
|
| 511 |
-
padding: 0;
|
| 512 |
-
list-style: none;
|
| 513 |
-
text-align: center;
|
| 514 |
-
}
|
| 515 |
-
.tab6 .social_icon_like1 li {
|
| 516 |
-
margin: 0 20px;
|
| 517 |
-
padding: 0;
|
| 518 |
-
width: auto;
|
| 519 |
-
list-style: none;
|
| 520 |
-
display: inline-block;
|
| 521 |
-
}
|
| 522 |
-
.tab6 .social_icon_like1 li span, .tab8 .social_icon_like1 li span {
|
| 523 |
-
margin: 0;
|
| 524 |
-
width: 44px;
|
| 525 |
-
display: block;
|
| 526 |
-
background: url(../images/count_bg1.png) no-repeat;
|
| 527 |
-
height: 22px;
|
| 528 |
-
overflow: hidden;
|
| 529 |
-
padding: 2px 2px 2px 10px;
|
| 530 |
-
font-family: helveticaregular;
|
| 531 |
-
font-size: 15px;
|
| 532 |
-
text-align: center;
|
| 533 |
-
line-height: 20px;
|
| 534 |
-
color: #5a6570;
|
| 535 |
-
float: left;
|
| 536 |
-
}
|
| 537 |
-
.tab6 .social_icon_like1 li img {
|
| 538 |
-
float: left;
|
| 539 |
-
margin-right: 5px;
|
| 540 |
-
display: block;
|
| 541 |
-
}
|
| 542 |
-
.tab6 .social_icon_like1 li a {
|
| 543 |
-
color: #5a6570;
|
| 544 |
-
text-decoration: none;
|
| 545 |
-
display: block;
|
| 546 |
-
}
|
| 547 |
-
.tab6 ul.usually {
|
| 548 |
-
margin: 28px 0 6px 60px;
|
| 549 |
-
padding: 0;
|
| 550 |
-
list-style: none;
|
| 551 |
-
}
|
| 552 |
-
.tab6 ul.usually li {
|
| 553 |
-
margin: 0;
|
| 554 |
-
padding: 0;
|
| 555 |
-
width: auto;
|
| 556 |
-
list-style: none;
|
| 557 |
-
text-align: left;
|
| 558 |
-
font-size: 17px;
|
| 559 |
-
}
|
| 560 |
-
.tab6 ul.enough_waffling {
|
| 561 |
-
margin: 25px 0 0;
|
| 562 |
-
padding: 0;
|
| 563 |
-
list-style: none;
|
| 564 |
-
text-align: center;
|
| 565 |
-
}
|
| 566 |
-
.tab6 ul.enough_waffling li {
|
| 567 |
-
margin: 0 22px;
|
| 568 |
-
padding: 0;
|
| 569 |
-
list-style: none;
|
| 570 |
-
display: inline-block;
|
| 571 |
-
}
|
| 572 |
-
.tab6 ul.enough_waffling li span {
|
| 573 |
-
float: left;
|
| 574 |
-
}
|
| 575 |
-
.tab6 ul.enough_waffling li label {
|
| 576 |
-
margin: 0 0 0 20px;
|
| 577 |
-
float: left;
|
| 578 |
-
font-family: helveticaregular;
|
| 579 |
-
font-size: 18px;
|
| 580 |
-
font-weight: 400;
|
| 581 |
-
text-align: center;
|
| 582 |
-
line-height: 38px;
|
| 583 |
-
color: #5a6570;
|
| 584 |
-
}
|
| 585 |
-
.tab6 .row {
|
| 586 |
-
border-top: 1px solid #eaebee;
|
| 587 |
-
margin-top: 25px;
|
| 588 |
-
padding-top: 15px;
|
| 589 |
-
clear: both;
|
| 590 |
-
display: block;
|
| 591 |
-
width: 100%;
|
| 592 |
-
float: left;
|
| 593 |
-
font-family: helveticaregular;
|
| 594 |
-
line-height: 42px;
|
| 595 |
-
}
|
| 596 |
-
.tab6 .options {
|
| 597 |
-
margin-top: 25px;
|
| 598 |
-
clear: both;
|
| 599 |
-
width: 100%;
|
| 600 |
-
float: left;
|
| 601 |
-
}
|
| 602 |
-
.tab6 .options label {
|
| 603 |
-
width: 345px;
|
| 604 |
-
float: left;
|
| 605 |
-
font-size: 18px;
|
| 606 |
-
font-family: helveticaregular;
|
| 607 |
-
color: #5a6570;
|
| 608 |
-
line-height: 46px;
|
| 609 |
-
}
|
| 610 |
-
.tab6 .options label.first {
|
| 611 |
-
font-family: helveticaregular;
|
| 612 |
-
font-size: 18px;
|
| 613 |
-
}
|
| 614 |
-
.tab6 .options input {
|
| 615 |
-
width: 308px;
|
| 616 |
-
float: left;
|
| 617 |
-
background: #e5e5e5;
|
| 618 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 619 |
-
border: 0;
|
| 620 |
-
padding: 10px;
|
| 621 |
-
}
|
| 622 |
-
.tab6 .options .field {
|
| 623 |
-
width: 223px;
|
| 624 |
-
float: left;
|
| 625 |
-
position: relative;
|
| 626 |
-
}
|
| 627 |
-
.tab6 .options .field .select {
|
| 628 |
-
width: 207px;
|
| 629 |
-
background: url(../images/select_bg1.jpg) no-repeat;
|
| 630 |
-
display: block;
|
| 631 |
-
padding-left: 17px;
|
| 632 |
-
font-family: helveticaregular;
|
| 633 |
-
}
|
| 634 |
-
.tab6 .options .field select.styled {
|
| 635 |
-
position: absolute;
|
| 636 |
-
left: 0;
|
| 637 |
-
top: 0;
|
| 638 |
-
width: 213px;
|
| 639 |
-
line-height: 46px;
|
| 640 |
-
height: 46px;
|
| 641 |
-
}
|
| 642 |
-
.tab7 h3 {
|
| 643 |
-
margin: 14px 0 6px;
|
| 644 |
-
padding: 0;
|
| 645 |
-
color: #a7a9ac;
|
| 646 |
-
font-family: helveticaregular;
|
| 647 |
-
font-size: 20px;
|
| 648 |
-
text-align: left;
|
| 649 |
-
}
|
| 650 |
-
.tab7 .close {
|
| 651 |
-
position: absolute;
|
| 652 |
-
right: 18px;
|
| 653 |
-
top: 18px;
|
| 654 |
-
}
|
| 655 |
-
.tab7 .text_options {
|
| 656 |
-
width: 400px;
|
| 657 |
-
float: left;
|
| 658 |
-
}
|
| 659 |
-
.tab7 .text_options.layout {
|
| 660 |
-
margin-left: 35px;
|
| 661 |
-
}
|
| 662 |
-
.tab7 .sfsiplus_row_tab {
|
| 663 |
-
margin-top: 10px;
|
| 664 |
-
width: 100%;
|
| 665 |
-
float: left;
|
| 666 |
-
}
|
| 667 |
-
.tab7 .text_options label {
|
| 668 |
-
width: 121px;
|
| 669 |
-
float: left;
|
| 670 |
-
line-height: 46px;
|
| 671 |
-
font-size: 18px;
|
| 672 |
-
}
|
| 673 |
-
.tab7 .text_options.layout label {
|
| 674 |
-
line-height: 20px;
|
| 675 |
-
font-size: 18px;
|
| 676 |
-
}
|
| 677 |
-
.tab7 .text_options.layout label.border {
|
| 678 |
-
line-height: 46px;
|
| 679 |
-
}
|
| 680 |
-
.tab7 .text_options input {
|
| 681 |
-
width: 274px;
|
| 682 |
-
float: left;
|
| 683 |
-
background: #e5e5e5;
|
| 684 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 685 |
-
border: 0;
|
| 686 |
-
padding: 13px 10px;
|
| 687 |
-
font-size: 17px;
|
| 688 |
-
color: #5a6570;
|
| 689 |
-
}
|
| 690 |
-
.tab7 .text_options input.small {
|
| 691 |
-
width: 138px;
|
| 692 |
-
}
|
| 693 |
-
.tab7 .text_options .field {
|
| 694 |
-
width: 223px;
|
| 695 |
-
float: left;
|
| 696 |
-
position: relative;
|
| 697 |
-
}
|
| 698 |
-
.tab7 .text_options .field .select {
|
| 699 |
-
width: 183px;
|
| 700 |
-
padding-right: 21px;
|
| 701 |
-
height: 47px;
|
| 702 |
-
background: url(../images/select_bg1.jpg) no-repeat;
|
| 703 |
-
display: block;
|
| 704 |
-
padding-left: 10px;
|
| 705 |
-
line-height: 46px;
|
| 706 |
-
font-size: 17px;
|
| 707 |
-
color: #414951;
|
| 708 |
-
}
|
| 709 |
-
.tab7 .text_options .field select.styled {
|
| 710 |
-
position: absolute;
|
| 711 |
-
left: 0;
|
| 712 |
-
top: 0;
|
| 713 |
-
width: 213px;
|
| 714 |
-
line-height: 46px;
|
| 715 |
-
height: 46px;
|
| 716 |
-
}
|
| 717 |
-
.tab7 .color_box {
|
| 718 |
-
width: 40px;
|
| 719 |
-
height: 34px;
|
| 720 |
-
border: 3px solid #fff;
|
| 721 |
-
box-shadow: 1px 2px 2px #ccc;
|
| 722 |
-
float: left;
|
| 723 |
-
position: relative;
|
| 724 |
-
margin-left: 13px;
|
| 725 |
-
}
|
| 726 |
-
.tab7 .color_box1 {
|
| 727 |
-
width: 100%;
|
| 728 |
-
height: 34px;
|
| 729 |
-
background: #5a6570;
|
| 730 |
-
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
| 731 |
-
}
|
| 732 |
-
.tab7 .corner {
|
| 733 |
-
width: 10px;
|
| 734 |
-
height: 10px;
|
| 735 |
-
background: #fff;
|
| 736 |
-
position: absolute;
|
| 737 |
-
right: 0;
|
| 738 |
-
bottom: 0;
|
| 739 |
-
}
|
| 740 |
-
.tab7 ul.border_shadow {
|
| 741 |
-
margin: 0;
|
| 742 |
-
padding: 5px 0 0;
|
| 743 |
-
list-style: none;
|
| 744 |
-
float: left;
|
| 745 |
-
width: 257px;
|
| 746 |
-
}
|
| 747 |
-
.tab7 ul.border_shadow li {
|
| 748 |
-
margin: 0;
|
| 749 |
-
padding: 0 0 0 40px;
|
| 750 |
-
list-style: none;
|
| 751 |
-
float: left;
|
| 752 |
-
}
|
| 753 |
-
.tab7 ul.border_shadow li:first-child {
|
| 754 |
-
padding: 0;
|
| 755 |
-
}
|
| 756 |
-
.tab7 ul.border_shadow li span {
|
| 757 |
-
float: left;
|
| 758 |
-
}
|
| 759 |
-
.tab7 ul.border_shadow li label {
|
| 760 |
-
float: left;
|
| 761 |
-
width: auto;
|
| 762 |
-
font-family: helveticaregular;
|
| 763 |
-
font-size: 18px;
|
| 764 |
-
font-weight: 400;
|
| 765 |
-
text-align: center;
|
| 766 |
-
line-height: 40px!important;
|
| 767 |
-
color: #5a6570;
|
| 768 |
-
padding: 0 0 0 20px;
|
| 769 |
-
}
|
| 770 |
-
.tab7 .row {
|
| 771 |
-
border-top: 1px solid #eaebee;
|
| 772 |
-
margin-top: 25px;
|
| 773 |
-
padding-top: 15px;
|
| 774 |
-
clear: both;
|
| 775 |
-
display: block;
|
| 776 |
-
width: 100%;
|
| 777 |
-
float: left;
|
| 778 |
-
font-family: helveticaregular;
|
| 779 |
-
line-height: 42px;
|
| 780 |
-
}
|
| 781 |
-
.tab7 .pop_up_show {
|
| 782 |
-
width: 100%;
|
| 783 |
-
float: left;
|
| 784 |
-
margin-top: 20px;
|
| 785 |
-
}
|
| 786 |
-
.tab7 .pop_up_show span {
|
| 787 |
-
float: left;
|
| 788 |
-
}
|
| 789 |
-
.tab7 .pop_up_show label {
|
| 790 |
-
float: left;
|
| 791 |
-
width: auto;
|
| 792 |
-
font-size: 18px;
|
| 793 |
-
font-weight: 400;
|
| 794 |
-
text-align: center;
|
| 795 |
-
line-height: 38px!important;
|
| 796 |
-
color: #5a6570;
|
| 797 |
-
padding: 0 0 0 20px;
|
| 798 |
-
}
|
| 799 |
-
.tab7 .pop_up_show input.add {
|
| 800 |
-
width: 257px;
|
| 801 |
-
float: left;
|
| 802 |
-
background: #e5e5e5;
|
| 803 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 804 |
-
border: 0;
|
| 805 |
-
padding: 10px;
|
| 806 |
-
margin-left: 40px;
|
| 807 |
-
}
|
| 808 |
-
.tab7 .pop_up_show input.seconds {
|
| 809 |
-
width: 60px;
|
| 810 |
-
background: #e5e5e5;
|
| 811 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 812 |
-
border: 0;
|
| 813 |
-
padding: 10px;
|
| 814 |
-
margin: 0 7px;
|
| 815 |
-
}
|
| 816 |
-
.tab7 .pop_up_show a {
|
| 817 |
-
text-decoration: underline;
|
| 818 |
-
color: #a4a9ad;
|
| 819 |
-
font-size: 16px;
|
| 820 |
-
margin-left: 20px;
|
| 821 |
-
}
|
| 822 |
-
.tab7 .pop_up_show .field {
|
| 823 |
-
width: 135px;
|
| 824 |
-
float: left;
|
| 825 |
-
position: relative;
|
| 826 |
-
margin-left: 20px;
|
| 827 |
-
font-size: 17px;
|
| 828 |
-
font-family: helveticaregular;
|
| 829 |
-
}
|
| 830 |
-
.tab7 .pop_up_show .field .select {
|
| 831 |
-
width: 127px;
|
| 832 |
-
height: 48px;
|
| 833 |
-
background: url(../images/select_bg.jpg) no-repeat;
|
| 834 |
-
display: block;
|
| 835 |
-
padding-left: 10px;
|
| 836 |
-
line-height: 46px;
|
| 837 |
-
font-size: 16px;
|
| 838 |
-
color: #5a6570;
|
| 839 |
-
}
|
| 840 |
-
.tab7 .pop_up_show .field select.styled {
|
| 841 |
-
position: absolute;
|
| 842 |
-
left: 0;
|
| 843 |
-
top: 0;
|
| 844 |
-
width: 135px;
|
| 845 |
-
line-height: 46px;
|
| 846 |
-
height: 46px;
|
| 847 |
-
}
|
| 848 |
-
.pop_up_box {
|
| 849 |
-
width: 474px;
|
| 850 |
-
background: #FFF;
|
| 851 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 852 |
-
margin: 200px auto;
|
| 853 |
-
padding: 20px 25px 0;
|
| 854 |
-
font-family: helveticaregular;
|
| 855 |
-
color: #5a6570;
|
| 856 |
-
min-height: 250px;
|
| 857 |
-
position: relative;
|
| 858 |
-
}
|
| 859 |
-
.pop_up_box h4, .pop_up_box_ex h4 {
|
| 860 |
-
font-size: 20px;
|
| 861 |
-
color: #5a6570;
|
| 862 |
-
text-align: center;
|
| 863 |
-
margin: 0;
|
| 864 |
-
padding: 0;
|
| 865 |
-
line-height: 22px;
|
| 866 |
-
}
|
| 867 |
-
.pop_up_box p, .pop_up_box_ex p {
|
| 868 |
-
font-size: 17px;
|
| 869 |
-
line-height: 28px;
|
| 870 |
-
color: #5a6570;
|
| 871 |
-
text-align: left;
|
| 872 |
-
margin: 0;
|
| 873 |
-
padding: 25px 0 0;
|
| 874 |
-
font-family: helveticaregular;
|
| 875 |
-
}
|
| 876 |
-
.sfsi_popupcntnr {
|
| 877 |
-
float: left;
|
| 878 |
-
width: 100%}
|
| 879 |
-
.sfsi_popupcntnr>h3 {
|
| 880 |
-
color: #000;
|
| 881 |
-
float: left;
|
| 882 |
-
font-weight: 700;
|
| 883 |
-
margin-bottom: 5px;
|
| 884 |
-
width: 100%}
|
| 885 |
-
ul.flwstep {
|
| 886 |
-
float: left;
|
| 887 |
-
width: 100%}
|
| 888 |
-
ul.flwstep>li {
|
| 889 |
-
color: #000;
|
| 890 |
-
font-size: 16px;
|
| 891 |
-
margin: 5px;
|
| 892 |
-
}
|
| 893 |
-
.upldbtn {
|
| 894 |
-
float: left;
|
| 895 |
-
text-align: center;
|
| 896 |
-
width: 100%}
|
| 897 |
-
.upload_butt {
|
| 898 |
-
background-color: #12a252;
|
| 899 |
-
border: none;
|
| 900 |
-
color: #fff;
|
| 901 |
-
font-weight: 700;
|
| 902 |
-
margin-top: 10px;
|
| 903 |
-
padding: 5px 45px;
|
| 904 |
-
width: auto;
|
| 905 |
-
cursor: pointer;
|
| 906 |
-
}
|
| 907 |
-
.pop_up_box .button {
|
| 908 |
-
background: #12a252;
|
| 909 |
-
font-size: 22px;
|
| 910 |
-
line-height: 24px;
|
| 911 |
-
color: #5a6570;
|
| 912 |
-
text-align: center;
|
| 913 |
-
min-height: 80px;
|
| 914 |
-
margin-top: 32px;
|
| 915 |
-
box-shadow: none;
|
| 916 |
-
word-wrap: break-word;
|
| 917 |
-
white-space: normal;
|
| 918 |
-
}
|
| 919 |
-
.pop_up_box .button:hover {
|
| 920 |
-
box-shadow: none!important;
|
| 921 |
-
}
|
| 922 |
-
.pop_up_box .button a.activate {
|
| 923 |
-
padding: 0px 0;
|
| 924 |
-
}
|
| 925 |
-
.pop_up_box a, .pop_up_box_ex a {
|
| 926 |
-
color: #a4a9ad;
|
| 927 |
-
font-size: 20px;
|
| 928 |
-
text-decoration: none;
|
| 929 |
-
text-align: center;
|
| 930 |
-
display: inline-block;
|
| 931 |
-
margin-top: 20px;
|
| 932 |
-
width: 100%;
|
| 933 |
-
}
|
| 934 |
-
.pop_up_box .upload {
|
| 935 |
-
width: 100%;
|
| 936 |
-
float: left;
|
| 937 |
-
text-align: left;
|
| 938 |
-
margin-top: 15px;
|
| 939 |
-
height: 46px;
|
| 940 |
-
}
|
| 941 |
-
.pop_up_box .upload label {
|
| 942 |
-
width: 135px;
|
| 943 |
-
float: left;
|
| 944 |
-
line-height: 45px;
|
| 945 |
-
font-size: 18px;
|
| 946 |
-
font-family: helveticaregular;
|
| 947 |
-
text-align: left;
|
| 948 |
-
}
|
| 949 |
-
.pop_up_box .upload input[type=text] {
|
| 950 |
-
width: 248px;
|
| 951 |
-
float: left;
|
| 952 |
-
background: #e5e5e5;
|
| 953 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 954 |
-
border: 0;
|
| 955 |
-
padding: 0 10px;
|
| 956 |
-
font-size: 16px;
|
| 957 |
-
height: 44px;
|
| 958 |
-
text-align: left;
|
| 959 |
-
color: #5a6570;
|
| 960 |
-
font-family: helveticaregular;
|
| 961 |
-
}
|
| 962 |
-
.pop_up_box .upload input.upload_butt {
|
| 963 |
-
width: 100px;
|
| 964 |
-
background: #12a252;
|
| 965 |
-
box-shadow: 0 0 0;
|
| 966 |
-
border: 0;
|
| 967 |
-
text-align: center;
|
| 968 |
-
font-size: 18px;
|
| 969 |
-
color: #fff;
|
| 970 |
-
font-family: helveticaregular;
|
| 971 |
-
height: 45px;
|
| 972 |
-
right: 32px;
|
| 973 |
-
top: 71px;
|
| 974 |
-
position: absolute;
|
| 975 |
-
}
|
| 976 |
-
.pop_up_box .upload a {
|
| 977 |
-
color: #12a252;
|
| 978 |
-
font-size: 18px;
|
| 979 |
-
text-decoration: underline;
|
| 980 |
-
font-family: helveticaregular;
|
| 981 |
-
margin: 0 0 16px 140px;
|
| 982 |
-
}
|
| 983 |
-
.pop_up_box a:hover, .pop_up_box_ex a:hover {
|
| 984 |
-
color: #a4a9ad;
|
| 985 |
-
}
|
| 986 |
-
.tab1 ul.plus_icn_listing {
|
| 987 |
-
list-style: none;
|
| 988 |
-
overflow: hidden;
|
| 989 |
-
border-top: #e7e8eb solid 1px;
|
| 990 |
-
margin: 35px 0 0;
|
| 991 |
-
}
|
| 992 |
-
.tab1 ul.plus_icn_listing li {
|
| 993 |
-
border-bottom: #eaebed solid 1px;
|
| 994 |
-
padding: 11px 0 11px 8px;
|
| 995 |
-
float: left;
|
| 996 |
-
width: 100%}
|
| 997 |
-
ul.plus_icn_listing li .tb_4_ck {
|
| 998 |
-
float: left;
|
| 999 |
-
margin: 10px 0 0;
|
| 1000 |
-
}
|
| 1001 |
-
ul.sfsiplus_icn_listing8 li .tb_4_ck {
|
| 1002 |
-
float: left;
|
| 1003 |
-
margin: 10px 0 0;
|
| 1004 |
-
}
|
| 1005 |
-
.tab8 .cstmdsplyulwpr .radio_section.tb_4_ck
|
| 1006 |
-
{
|
| 1007 |
-
margin-right: 10px !important;
|
| 1008 |
-
}
|
| 1009 |
-
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplsub{margin-top: 3px;}
|
| 1010 |
-
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdspllke{margin-top: 3px;}
|
| 1011 |
-
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplggpls{margin-top: 3px;}
|
| 1012 |
-
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdspltwtr{margin-top: 4px;}
|
| 1013 |
-
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplshr{margin-top: 3px;}
|
| 1014 |
-
.tab2 {
|
| 1015 |
-
overflow: hidden;
|
| 1016 |
-
}
|
| 1017 |
-
.tab2 .rss_url_row {
|
| 1018 |
-
width: 100%;
|
| 1019 |
-
float: left;
|
| 1020 |
-
margin: 0 0 10px;
|
| 1021 |
-
}
|
| 1022 |
-
.tab2 .rss_url_row h4 {
|
| 1023 |
-
float: left;
|
| 1024 |
-
line-height: 43px!important;
|
| 1025 |
-
}
|
| 1026 |
-
.tab2 .inr_cont input.add, .tab2 .inr_cont textarea.add_txt, .tab2 .rss_url_row input.add {
|
| 1027 |
-
width: 363px;
|
| 1028 |
-
float: left;
|
| 1029 |
-
background: #e5e5e5;
|
| 1030 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 1031 |
-
border: 0;
|
| 1032 |
-
padding: 12px 10px 11px;
|
| 1033 |
-
margin-left: 10px;
|
| 1034 |
-
}
|
| 1035 |
-
.tab2 .rss_url_row a.rit_link {
|
| 1036 |
-
float: left;
|
| 1037 |
-
margin: 10px 0 0 16px;
|
| 1038 |
-
font-size: 17px;
|
| 1039 |
-
}
|
| 1040 |
-
.tab2 .row {
|
| 1041 |
-
float: left;
|
| 1042 |
-
border-top: 2px solid #f2f3f4;
|
| 1043 |
-
clear: both;
|
| 1044 |
-
padding: 0 0 15px;
|
| 1045 |
-
width: 100%}
|
| 1046 |
-
.tab2 .row .tab_2_email_sec {
|
| 1047 |
-
list-style: none;
|
| 1048 |
-
margin: 17px 0 0;
|
| 1049 |
-
overflow: hidden;
|
| 1050 |
-
}
|
| 1051 |
-
.row ul.tab_2_email_sec li {
|
| 1052 |
-
float: left;
|
| 1053 |
-
margin-right: 10px;
|
| 1054 |
-
width: 32%;
|
| 1055 |
-
}
|
| 1056 |
-
.sfsiplusicnsdvwrp
|
| 1057 |
-
{
|
| 1058 |
-
width: 110px;
|
| 1059 |
-
float: left;
|
| 1060 |
-
}
|
| 1061 |
-
.row ul.tab_2_email_sec:first-child {
|
| 1062 |
-
margin-right: 2%
|
| 1063 |
-
}
|
| 1064 |
-
.inr_cont .fb_url {
|
| 1065 |
-
clear: both;
|
| 1066 |
-
}
|
| 1067 |
-
.inr_cont .fb_url .checkbox, .inr_cont .fb_url input.add, .inr_cont .fb_url label, .inr_cont .fb_url lable {
|
| 1068 |
-
float: left;
|
| 1069 |
-
}
|
| 1070 |
-
.inr_cont .fb_url input.add {
|
| 1071 |
-
margin-left: 19px;
|
| 1072 |
-
}
|
| 1073 |
-
.inr_cont .fb_url .checkbox {
|
| 1074 |
-
margin: 6px 0 0;
|
| 1075 |
-
}
|
| 1076 |
-
.inr_cont .fb_url label {
|
| 1077 |
-
line-height: 41px;
|
| 1078 |
-
margin: 0 0 0 15px;
|
| 1079 |
-
font-size: 18px;
|
| 1080 |
-
}
|
| 1081 |
-
.inr_cont textarea.add_txt {
|
| 1082 |
-
resize: none;
|
| 1083 |
-
margin: 0 0 0 19px!important;
|
| 1084 |
-
height: 60px;
|
| 1085 |
-
}
|
| 1086 |
-
.tab2 .inr_cont textarea.add_txt {
|
| 1087 |
-
width: 382px!important;
|
| 1088 |
-
height: 90px;
|
| 1089 |
-
overflow: hidden;
|
| 1090 |
-
}
|
| 1091 |
-
.tab2 .inr_cont input.add {
|
| 1092 |
-
width: 417px;
|
| 1093 |
-
}
|
| 1094 |
-
.red_txt, .tab2 .red_txt {
|
| 1095 |
-
color: #ef4745!important;
|
| 1096 |
-
text-align: center!important;
|
| 1097 |
-
padding-top: 5px!important;
|
| 1098 |
-
}
|
| 1099 |
-
.green_txt {
|
| 1100 |
-
color: #12A252!important;
|
| 1101 |
-
text-align: center!important;
|
| 1102 |
-
padding-top: 5px!important;
|
| 1103 |
-
}
|
| 1104 |
-
.red_txt {
|
| 1105 |
-
color: #f80000!important;
|
| 1106 |
-
text-align: center!important;
|
| 1107 |
-
padding-top: 5px!important;
|
| 1108 |
-
}
|
| 1109 |
-
.linked_tab_2 .fb_url label {
|
| 1110 |
-
width: 32%}
|
| 1111 |
-
.twt_tab_2 label {
|
| 1112 |
-
width: 18%}
|
| 1113 |
-
.bdr_top {
|
| 1114 |
-
border-top: none!important;
|
| 1115 |
-
}
|
| 1116 |
-
.linked_tab_2 .fb_url input.link_dbl {
|
| 1117 |
-
margin-bottom: 6px;
|
| 1118 |
-
}
|
| 1119 |
-
.tab3 {
|
| 1120 |
-
overflow: hidden;
|
| 1121 |
-
}
|
| 1122 |
-
.tab3 .row {
|
| 1123 |
-
padding: 15px 0;
|
| 1124 |
-
clear: both;
|
| 1125 |
-
overflow: hidden;
|
| 1126 |
-
}
|
| 1127 |
-
.tab3 .row.sfsiplusmousetxt
|
| 1128 |
-
{
|
| 1129 |
-
border: medium none;
|
| 1130 |
-
}
|
| 1131 |
-
.tab3 ul.tab_3_list {
|
| 1132 |
-
overflow: hidden;
|
| 1133 |
-
margin: 4px 0 11px;
|
| 1134 |
-
}
|
| 1135 |
-
.tab8 .sfsiplus_toglepstpgspn {
|
| 1136 |
-
font-weight: bold;
|
| 1137 |
-
}
|
| 1138 |
-
ul.tab_3_list li {
|
| 1139 |
-
background: url(../images/tab_3_list_bg.jpg) 13px 7px no-repeat;
|
| 1140 |
-
padding: 0 0 0 30px;
|
| 1141 |
-
color: #778088;
|
| 1142 |
-
font-family: helveticaregular;
|
| 1143 |
-
font-size: 17px;
|
| 1144 |
-
margin-bottom: 4px;
|
| 1145 |
-
}
|
| 1146 |
-
.tab5 ul.tab_3_list li
|
| 1147 |
-
{
|
| 1148 |
-
background: url(../images/tab_3_list_bg.jpg) 13px 18px no-repeat;
|
| 1149 |
-
}
|
| 1150 |
-
.tab3 .row h3 {
|
| 1151 |
-
margin: 0 0 20px;
|
| 1152 |
-
color: #414951;
|
| 1153 |
-
font-family: helveticabold;
|
| 1154 |
-
font-size: 20px;
|
| 1155 |
-
}
|
| 1156 |
-
ul.sfsiplus_tab_3_icns {
|
| 1157 |
-
list-style: none;
|
| 1158 |
-
margin: 34px 0 0;
|
| 1159 |
-
overflow: hidden;
|
| 1160 |
-
}
|
| 1161 |
-
ul.sfsiplus_tab_3_icns li {
|
| 1162 |
-
width: 100%;
|
| 1163 |
-
margin: 0 0 21px;
|
| 1164 |
-
float: left;
|
| 1165 |
-
}
|
| 1166 |
-
ul.sfsiplus_tab_3_icns label {
|
| 1167 |
-
float: left;
|
| 1168 |
-
line-height: 42px;
|
| 1169 |
-
color: #69737C;
|
| 1170 |
-
font-size: 18px;
|
| 1171 |
-
font-family: helveticaregular;
|
| 1172 |
-
min-width: 120px;
|
| 1173 |
-
}
|
| 1174 |
-
ul.sfsiplus_tab_3_icns li .sfsiplus_icns_tab_3, ul.sfsiplus_tab_3_icns li .radio {
|
| 1175 |
-
float: left;
|
| 1176 |
-
}
|
| 1177 |
-
.tab3 .sub_row {
|
| 1178 |
-
float: left;
|
| 1179 |
-
margin: 35px 0 0 4%;
|
| 1180 |
-
width: 90%}
|
| 1181 |
-
.tab3 .sub_row h4 {
|
| 1182 |
-
color: #a4a9ad!important;
|
| 1183 |
-
}
|
| 1184 |
-
.tab3 .sub_row label {
|
| 1185 |
-
float: left;
|
| 1186 |
-
margin: 0 20px;
|
| 1187 |
-
line-height: 36px;
|
| 1188 |
-
font-size: 18px;
|
| 1189 |
-
}
|
| 1190 |
-
.tab3 .sub_row p {
|
| 1191 |
-
padding-top: 18px!important;
|
| 1192 |
-
clear: both;
|
| 1193 |
-
overflow: hidden;
|
| 1194 |
-
}
|
| 1195 |
-
.sub_row .sub_sub_box p {
|
| 1196 |
-
padding-top: 18px!important;
|
| 1197 |
-
}
|
| 1198 |
-
.tab3 .sub_row .checkbox {
|
| 1199 |
-
float: left;
|
| 1200 |
-
margin-top: 4px;
|
| 1201 |
-
}
|
| 1202 |
-
.tab3 .sub_row .sub_sub_box {
|
| 1203 |
-
width: 80%;
|
| 1204 |
-
margin: 7px 0 15px 10%;
|
| 1205 |
-
float: left;
|
| 1206 |
-
}
|
| 1207 |
-
.tab3 .sub_row input.smal_inpt {
|
| 1208 |
-
width: 73px;
|
| 1209 |
-
background: #e5e5e5;
|
| 1210 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 1211 |
-
border: 0;
|
| 1212 |
-
padding: 10px;
|
| 1213 |
-
float: left;
|
| 1214 |
-
}
|
| 1215 |
-
.tab3 .sub_row .drop_lst {
|
| 1216 |
-
border: 1px solid #d6d6d6;
|
| 1217 |
-
font-size: 16px;
|
| 1218 |
-
color: #5a6570;
|
| 1219 |
-
width: 120px;
|
| 1220 |
-
}
|
| 1221 |
-
.tab3 .first_row, .tab3 .first_row p, .tab3 .first_row p .radio, .tab3 .first_row p label {
|
| 1222 |
-
float: left;
|
| 1223 |
-
}
|
| 1224 |
-
.tab3 .first_row {
|
| 1225 |
-
width: 90%;
|
| 1226 |
-
float: left;
|
| 1227 |
-
}
|
| 1228 |
-
.tab3 .first_row p {
|
| 1229 |
-
padding: 0!important;
|
| 1230 |
-
}
|
| 1231 |
-
.tab3 .first_row p label {
|
| 1232 |
-
line-height: 44px;
|
| 1233 |
-
margin: 0 10px;
|
| 1234 |
-
}
|
| 1235 |
-
.tab3 .first_row p:last-child {
|
| 1236 |
-
margin-left: 27%}
|
| 1237 |
-
.tab3 .tab_1_sav {
|
| 1238 |
-
padding-top: 20px!important;
|
| 1239 |
-
margin: 10px auto 20px;
|
| 1240 |
-
}
|
| 1241 |
-
.suc_msg {
|
| 1242 |
-
background: #12A252;
|
| 1243 |
-
color: #FFF;
|
| 1244 |
-
display: none;
|
| 1245 |
-
font-size: 23px;
|
| 1246 |
-
padding: 10px;
|
| 1247 |
-
text-align: left;
|
| 1248 |
-
text-decoration: none;
|
| 1249 |
-
}
|
| 1250 |
-
.error_msg {
|
| 1251 |
-
background: #D22B30;
|
| 1252 |
-
color: #FFF;
|
| 1253 |
-
display: none;
|
| 1254 |
-
font-size: 23px;
|
| 1255 |
-
padding: 10px;
|
| 1256 |
-
text-align: left;
|
| 1257 |
-
text-decoration: none;
|
| 1258 |
-
}
|
| 1259 |
-
.fileUPInput {
|
| 1260 |
-
cursor: pointer;
|
| 1261 |
-
position: relative;
|
| 1262 |
-
top: -43px;
|
| 1263 |
-
right: 0;
|
| 1264 |
-
z-index: 99;
|
| 1265 |
-
height: 42px;
|
| 1266 |
-
font-size: 5px;
|
| 1267 |
-
opacity: 0;
|
| 1268 |
-
-moz-opacity: 0;
|
| 1269 |
-
filter: alpha(opacity=0);
|
| 1270 |
-
width: 100%}
|
| 1271 |
-
.inputWrapper {
|
| 1272 |
-
height: 20px;
|
| 1273 |
-
width: 50px;
|
| 1274 |
-
overflow: hidden;
|
| 1275 |
-
position: relative;
|
| 1276 |
-
cursor: pointer;
|
| 1277 |
-
}
|
| 1278 |
-
.sfsiplus_custom-txt {
|
| 1279 |
-
background: none!important;
|
| 1280 |
-
padding-left: 2px!important;
|
| 1281 |
-
}
|
| 1282 |
-
.plus_custom-img {
|
| 1283 |
-
float: left;
|
| 1284 |
-
margin-left: 20px;
|
| 1285 |
-
}
|
| 1286 |
-
.loader-img {
|
| 1287 |
-
float: left;
|
| 1288 |
-
margin-left: -70px;
|
| 1289 |
-
display: none;
|
| 1290 |
-
}
|
| 1291 |
-
.pop-overlay {
|
| 1292 |
-
position: fixed;
|
| 1293 |
-
top: 0;
|
| 1294 |
-
left: 0;
|
| 1295 |
-
width: 100%;
|
| 1296 |
-
height: 100%;
|
| 1297 |
-
backgound-color: #d3d3d3;
|
| 1298 |
-
z-index: 10;
|
| 1299 |
-
padding: 20px;
|
| 1300 |
-
display: none;
|
| 1301 |
-
}
|
| 1302 |
-
.fb-overlay {
|
| 1303 |
-
position: fixed;
|
| 1304 |
-
top: 0;
|
| 1305 |
-
left: 0;
|
| 1306 |
-
width: 100%;
|
| 1307 |
-
height: 100%;
|
| 1308 |
-
backgound-color: #d3d3d3;
|
| 1309 |
-
z-index: -1000;
|
| 1310 |
-
padding: 20px;
|
| 1311 |
-
opacity: 0;
|
| 1312 |
-
display: block;
|
| 1313 |
-
}
|
| 1314 |
-
.inputError {
|
| 1315 |
-
border: 1px solid #f80000!important;
|
| 1316 |
-
}
|
| 1317 |
-
.sfsicloseBtn {
|
| 1318 |
-
position: absolute;
|
| 1319 |
-
top: 0;
|
| 1320 |
-
right: 0;
|
| 1321 |
-
cursor: pointer;
|
| 1322 |
-
}
|
| 1323 |
-
.top_arow {
|
| 1324 |
-
background: url(../images/top_aro.png) no-repeat;
|
| 1325 |
-
position: absolute;
|
| 1326 |
-
top: -29px;
|
| 1327 |
-
left: 38%;
|
| 1328 |
-
width: 33px;
|
| 1329 |
-
height: 29px;
|
| 1330 |
-
backgoround-color: #fff;
|
| 1331 |
-
}
|
| 1332 |
-
.sfsi_plus_tool_tip_2 .top_arow .sfsi_plus_inside, .top_arow .sfsi_plus_inside {
|
| 1333 |
-
float: left;
|
| 1334 |
-
}
|
| 1335 |
-
.sfsi_plus_tool_tip_2 .tool_tip>img, .tool_tip>img {
|
| 1336 |
-
display: inline-block;
|
| 1337 |
-
margin-right: 4px;
|
| 1338 |
-
float: left;
|
| 1339 |
-
}
|
| 1340 |
-
.sfsiplus_norm_row {
|
| 1341 |
-
float: left;
|
| 1342 |
-
min-width: 25px;
|
| 1343 |
-
}
|
| 1344 |
-
.sfsiplus_norm_row a {
|
| 1345 |
-
border: none;
|
| 1346 |
-
display: inline-block;
|
| 1347 |
-
position: relative;
|
| 1348 |
-
}
|
| 1349 |
-
.sfsi_plus_widget
|
| 1350 |
-
{
|
| 1351 |
-
min-height: 55px;
|
| 1352 |
-
}
|
| 1353 |
-
.sfsi_plus_tool_tip_2 a {
|
| 1354 |
-
min-height: 0!important;
|
| 1355 |
-
}
|
| 1356 |
-
.sfsi_plus_widget a img {
|
| 1357 |
-
box-shadow: none!important;
|
| 1358 |
-
outline: 0;
|
| 1359 |
-
}
|
| 1360 |
-
.sfsi_plus_wicons {
|
| 1361 |
-
display: inline-block;
|
| 1362 |
-
color: #000;
|
| 1363 |
-
}
|
| 1364 |
-
.sel-active {
|
| 1365 |
-
background-color: #f7941d;
|
| 1366 |
-
}
|
| 1367 |
-
.sfsi_plus_outr_div .close {
|
| 1368 |
-
position: absolute;
|
| 1369 |
-
right: 18px;
|
| 1370 |
-
top: 18px;
|
| 1371 |
-
}
|
| 1372 |
-
.sfsi_plus_outr_div h2 {
|
| 1373 |
-
color: #778088;
|
| 1374 |
-
font-family: helveticaregular;
|
| 1375 |
-
font-size: 26px;
|
| 1376 |
-
margin: 0 0 9px;
|
| 1377 |
-
padding: 0;
|
| 1378 |
-
text-align: center;
|
| 1379 |
-
font-weight: 400;
|
| 1380 |
-
}
|
| 1381 |
-
.sfsi_plus_outr_div ul li a {
|
| 1382 |
-
color: #5A6570;
|
| 1383 |
-
text-decoration: none;
|
| 1384 |
-
}
|
| 1385 |
-
.sfsi_plus_outr_div ul li {
|
| 1386 |
-
display: inline-block;
|
| 1387 |
-
list-style: none;
|
| 1388 |
-
margin: 0;
|
| 1389 |
-
padding: 0;
|
| 1390 |
-
float: none;
|
| 1391 |
-
}
|
| 1392 |
-
.expanded-area {
|
| 1393 |
-
display: none;
|
| 1394 |
-
}
|
| 1395 |
-
.sfsi_plus_wicons a {
|
| 1396 |
-
-webkit-transition: all .2s ease-in-out;
|
| 1397 |
-
-moz-transition: all .2s ease-in-out;
|
| 1398 |
-
-o-transition: all .2s ease-in-out;
|
| 1399 |
-
-ms-transition: all .2s ease-in-out;
|
| 1400 |
-
}
|
| 1401 |
-
.scale, .scale-div {
|
| 1402 |
-
-webkit-transform: scale(1.1);
|
| 1403 |
-
-moz-transform: scale(1.1);
|
| 1404 |
-
-o-transform: scale(1.1);
|
| 1405 |
-
transform: scale(1.1);
|
| 1406 |
-
}
|
| 1407 |
-
.sfsi_plus_Sicons {
|
| 1408 |
-
float: left;
|
| 1409 |
-
}
|
| 1410 |
-
.sfsi_pop_up .button a:hover {
|
| 1411 |
-
color: #fff;
|
| 1412 |
-
}
|
| 1413 |
-
.sfsi_pop_up .button:hover {
|
| 1414 |
-
background: #12a252;
|
| 1415 |
-
color: #fff;
|
| 1416 |
-
border: none;
|
| 1417 |
-
}
|
| 1418 |
-
ul.plus_icn_listing li .sfsiplus_right_info a {
|
| 1419 |
-
outline: 0;
|
| 1420 |
-
font-family: helveticaregular;
|
| 1421 |
-
}
|
| 1422 |
-
ul.sfsiplus_icn_listing8 li .sfsiplus_right_info a {
|
| 1423 |
-
outline: 0;
|
| 1424 |
-
font-family: helveticaregular;
|
| 1425 |
-
}
|
| 1426 |
-
.upload_pop_up .upload_butt {
|
| 1427 |
-
line-height: 27px;
|
| 1428 |
-
margin-left: 6px;
|
| 1429 |
-
}
|
| 1430 |
-
.sfsi_pop_up .addthis_toolbox {
|
| 1431 |
-
width: 80px;
|
| 1432 |
-
margin: 40px auto 0;
|
| 1433 |
-
}
|
| 1434 |
-
a.addthis_button_compact {
|
| 1435 |
-
margin-top: 0;
|
| 1436 |
-
width: auto;
|
| 1437 |
-
}
|
| 1438 |
-
.drop_lsts {
|
| 1439 |
-
left: 220px;
|
| 1440 |
-
position: relative;
|
| 1441 |
-
top: -40px;
|
| 1442 |
-
}
|
| 1443 |
-
.drop_lsts .styled {
|
| 1444 |
-
top: -42px;
|
| 1445 |
-
width: 127px;
|
| 1446 |
-
height: 33px;
|
| 1447 |
-
}
|
| 1448 |
-
.drop_lsts span {
|
| 1449 |
-
line-height: 50px;
|
| 1450 |
-
}
|
| 1451 |
-
.drag_drp {
|
| 1452 |
-
left: 11px;
|
| 1453 |
-
position: relative;
|
| 1454 |
-
top: 38px;
|
| 1455 |
-
font-size: 17px;
|
| 1456 |
-
}
|
| 1457 |
-
.listing ul li label {
|
| 1458 |
-
width: 224px;
|
| 1459 |
-
float: left;
|
| 1460 |
-
}
|
| 1461 |
-
.sfsiplus_row_onl {
|
| 1462 |
-
width: 100%;
|
| 1463 |
-
float: left;
|
| 1464 |
-
}
|
| 1465 |
-
#sfsi_plus_Show_popupOn_PageIDs option.sel-active {
|
| 1466 |
-
background: #f7941d;
|
| 1467 |
-
}
|
| 1468 |
-
.sfsi_plus_inside div iframe {
|
| 1469 |
-
float: left;
|
| 1470 |
-
margin: 0;
|
| 1471 |
-
}
|
| 1472 |
-
.sfsi_plus_inside div #___plus_0, .sfsi_plus_inside div #___plusone_0 {
|
| 1473 |
-
height: 27px;
|
| 1474 |
-
}
|
| 1475 |
-
.sfsi_plus_outr_div li {
|
| 1476 |
-
float: left;
|
| 1477 |
-
}
|
| 1478 |
-
.sfsi_plus_tool_tip_2 .sfsi_plus_inside div {
|
| 1479 |
-
min-height: 0;
|
| 1480 |
-
}
|
| 1481 |
-
#___plus_1>iframe {
|
| 1482 |
-
height: 30px;
|
| 1483 |
-
}
|
| 1484 |
-
.main_contant h1 {
|
| 1485 |
-
margin: 0 0 19px;
|
| 1486 |
-
}
|
| 1487 |
-
.main_contant p {
|
| 1488 |
-
margin: 0 0 26px;
|
| 1489 |
-
}
|
| 1490 |
-
.main_contant p>a {
|
| 1491 |
-
color: #1a1d20;
|
| 1492 |
-
text-decoration: underline;
|
| 1493 |
-
}
|
| 1494 |
-
.tab1 .gary_bg {
|
| 1495 |
-
background: #f1f1f1;
|
| 1496 |
-
}
|
| 1497 |
-
#accordion {
|
| 1498 |
-
margin-top: 4px;
|
| 1499 |
-
}
|
| 1500 |
-
.main_contant p>a, .tab1 p span {
|
| 1501 |
-
font-family: helveticabold;
|
| 1502 |
-
}
|
| 1503 |
-
.wapper .ui-accordion-header-active {
|
| 1504 |
-
margin-top: 20px!important;
|
| 1505 |
-
}
|
| 1506 |
-
.wapper .tab2 {
|
| 1507 |
-
padding: 20px 33px 12px 34px!important;
|
| 1508 |
-
}
|
| 1509 |
-
.wapper .tab2 p {
|
| 1510 |
-
margin-bottom: 6px;
|
| 1511 |
-
}
|
| 1512 |
-
.tab2 .twt_tab_2 label {
|
| 1513 |
-
width: 175px;
|
| 1514 |
-
}
|
| 1515 |
-
.tab2 .twt_fld {
|
| 1516 |
-
margin: 16px 0 23px;
|
| 1517 |
-
float: left;
|
| 1518 |
-
}
|
| 1519 |
-
.tab2 .twt_fld_2 {
|
| 1520 |
-
margin: 0 0 12px;
|
| 1521 |
-
float: left;
|
| 1522 |
-
}
|
| 1523 |
-
.tab2 .google_in {
|
| 1524 |
-
margin: 0 0 8px 94px;
|
| 1525 |
-
float: left;
|
| 1526 |
-
}
|
| 1527 |
-
.tab2 .google_in p.radio_section {
|
| 1528 |
-
padding-top: 8px!important;
|
| 1529 |
-
}
|
| 1530 |
-
.tab2 .google_in .fb_url input.add {
|
| 1531 |
-
width: 417px!important;
|
| 1532 |
-
}
|
| 1533 |
-
.tab2 .utube_inn {
|
| 1534 |
-
padding-bottom: 2px;
|
| 1535 |
-
float: left;
|
| 1536 |
-
}
|
| 1537 |
-
.tab2 .utube_inn label {
|
| 1538 |
-
max-width: 90%}
|
| 1539 |
-
.tab2 .utube_inn label span {
|
| 1540 |
-
font-family: helveticabold;
|
| 1541 |
-
}
|
| 1542 |
-
.tab2 .inr_cont p>a {
|
| 1543 |
-
font-family: helveticabold;
|
| 1544 |
-
color: #778088;
|
| 1545 |
-
text-decoration: none;
|
| 1546 |
-
}
|
| 1547 |
-
.sfsiplus_pinterest_section .inr_cont .pint_url {
|
| 1548 |
-
float: left;
|
| 1549 |
-
padding-top: 6px;
|
| 1550 |
-
clear: both;
|
| 1551 |
-
}
|
| 1552 |
-
.sfsiplus_pinterest_section .inr_cont .add {
|
| 1553 |
-
width: 417px!important;
|
| 1554 |
-
}
|
| 1555 |
-
.sfsiplus_linkedin_section .link_1, .sfsiplus_linkedin_section .link_2, .sfsiplus_linkedin_section .link_3, .sfsiplus_linkedin_section .link_4 {
|
| 1556 |
-
float: left;
|
| 1557 |
-
width: 100%}
|
| 1558 |
-
.sfsiplus_linkedin_section .link_1 input.add, .sfsiplus_linkedin_section .link_2 input.add, .sfsiplus_linkedin_section .link_3 input.add, .sfsiplus_linkedin_section .link_4 input.add {
|
| 1559 |
-
width: 417px;
|
| 1560 |
-
}
|
| 1561 |
-
.sfsiplus_linkedin_section .link_1 {
|
| 1562 |
-
margin-bottom: 7px;
|
| 1563 |
-
}
|
| 1564 |
-
.sfsiplus_linkedin_section .link_2 {
|
| 1565 |
-
margin-bottom: 12px;
|
| 1566 |
-
}
|
| 1567 |
-
.sfsiplus_linkedin_section .link_3, .sfsiplus_linkedin_section .link_4 {
|
| 1568 |
-
margin-bottom: 13px;
|
| 1569 |
-
}
|
| 1570 |
-
.tab2 .sfsiplus_linkedin_section .link_4 {
|
| 1571 |
-
margin-bottom: 0;
|
| 1572 |
-
}
|
| 1573 |
-
ul.tab_3_list li span {
|
| 1574 |
-
font-family: helveticabold;
|
| 1575 |
-
}
|
| 1576 |
-
.tab3 .Shuffle_auto {
|
| 1577 |
-
float: left;
|
| 1578 |
-
width: 80%;
|
| 1579 |
-
position: relative;
|
| 1580 |
-
top: -93px;
|
| 1581 |
-
}
|
| 1582 |
-
#accordion .tab4 h4, #accordion1 .tab4 h4 {
|
| 1583 |
-
|
| 1584 |
-
color: #414951;
|
| 1585 |
-
font-size: 20px;
|
| 1586 |
-
}
|
| 1587 |
-
.sfsiplus_specify_counts .listing li .input {
|
| 1588 |
-
width: 73px;
|
| 1589 |
-
}
|
| 1590 |
-
.sfsiplus_fbpgidwpr{width: 160px; float: left; font-weight: bold; font-size: 17px; color: #000000;}
|
| 1591 |
-
.sfsiplus_fbpgiddesc{font-weight: normal; width: 100%; font-size: 14px; color: #888888;padding: 4px 0 0 60px; }
|
| 1592 |
-
.sfsiplus_fbpgiddesc code
|
| 1593 |
-
{
|
| 1594 |
-
background: none repeat scroll 0 0 transparent;
|
| 1595 |
-
padding-right: 0px;
|
| 1596 |
-
padding-left: 0px;
|
| 1597 |
-
|
| 1598 |
-
}
|
| 1599 |
-
.sfsiplus_specify_counts .listing li .input.mypginpt {
|
| 1600 |
-
width: 288px;
|
| 1601 |
-
}
|
| 1602 |
-
.tab3 .Shuffle_auto .sub_sub_box .tab_3_option {
|
| 1603 |
-
padding-top: 0!important;
|
| 1604 |
-
margin-bottom: 10px!important;
|
| 1605 |
-
}
|
| 1606 |
-
.tab3 .sub_row {
|
| 1607 |
-
margin-top: 10px!important;
|
| 1608 |
-
}
|
| 1609 |
-
.tab4 {
|
| 1610 |
-
padding-top: 35px!important;
|
| 1611 |
-
}
|
| 1612 |
-
.tab4 .save_button {
|
| 1613 |
-
padding-top: 46px;
|
| 1614 |
-
}
|
| 1615 |
-
.tab5 {
|
| 1616 |
-
padding-top: 31px!important;
|
| 1617 |
-
}
|
| 1618 |
-
.tab6, .tab7 {
|
| 1619 |
-
padding-top: 28px!important;
|
| 1620 |
-
}
|
| 1621 |
-
.tab5 .sfsiplus_row_onl {
|
| 1622 |
-
margin-top: 15px;
|
| 1623 |
-
}
|
| 1624 |
-
.tab5 .sticking .link>a {
|
| 1625 |
-
color: #a4a9ad;
|
| 1626 |
-
text-decoration: underline;
|
| 1627 |
-
}
|
| 1628 |
-
.tab5 .mouse_txt h4 {
|
| 1629 |
-
margin-bottom: 8px!important;
|
| 1630 |
-
}
|
| 1631 |
-
.tab5 .save_button {
|
| 1632 |
-
padding-top: 54px;
|
| 1633 |
-
}
|
| 1634 |
-
.tab7 .like_pop_box h2 {
|
| 1635 |
-
font-family: helveticabold;
|
| 1636 |
-
text-align: center;
|
| 1637 |
-
color: #414951;
|
| 1638 |
-
font-size: 26px;
|
| 1639 |
-
}
|
| 1640 |
-
.tab1 ul.plus_icn_listing li .sfsiplus_right_info label:hover {
|
| 1641 |
-
text-decoration: none!important;
|
| 1642 |
-
}
|
| 1643 |
-
.tab1 ul.plus_icn_listing li .sfsiplus_right_info label.expanded-area {
|
| 1644 |
-
clear: both;
|
| 1645 |
-
float: left;
|
| 1646 |
-
margin-top: 14px;
|
| 1647 |
-
}
|
| 1648 |
-
.tab7 .space {
|
| 1649 |
-
margin-top: 14px;
|
| 1650 |
-
}
|
| 1651 |
-
.tab7 .pop_up_show label {
|
| 1652 |
-
font-family: helveticaregular!important;
|
| 1653 |
-
}
|
| 1654 |
-
.tab7 .save_button {
|
| 1655 |
-
padding-top: 78px;
|
| 1656 |
-
}
|
| 1657 |
-
.like_txt a {
|
| 1658 |
-
text-decoration: none;
|
| 1659 |
-
font-family: helveticaregular;
|
| 1660 |
-
}
|
| 1661 |
-
.bdr_btm_non {
|
| 1662 |
-
border-bottom: none!important;
|
| 1663 |
-
}
|
| 1664 |
-
.tab1 .tab_1_sav {
|
| 1665 |
-
padding-top: 13px;
|
| 1666 |
-
}
|
| 1667 |
-
#accordion .tab2 .sfsiplus_facebook_section .inr_cont p.extra_sp, #accordion1 .tab2 .sfsiplus_facebook_section .inr_cont p.extra_sp {
|
| 1668 |
-
padding-top: 7px;
|
| 1669 |
-
}
|
| 1670 |
-
.tab2 .sfsiplus_custom_section {
|
| 1671 |
-
width: 100%}
|
| 1672 |
-
.tab7 {
|
| 1673 |
-
padding-bottom: 40px!important;
|
| 1674 |
-
}
|
| 1675 |
-
.tab8 .save_button {
|
| 1676 |
-
padding-top: 0px;
|
| 1677 |
-
}
|
| 1678 |
-
.tab10 .save_button a {
|
| 1679 |
-
padding: 16px 0;
|
| 1680 |
-
}
|
| 1681 |
-
.tab2 .sfsiplus_twitter_section .twt_fld input.add, .tab2 .sfsiplus_twitter_section .twt_fld_2 textarea.add_txt {
|
| 1682 |
-
width: 464px!important;
|
| 1683 |
-
}
|
| 1684 |
-
.tab2 .utube_inn .fb_url label span {
|
| 1685 |
-
font-family: helveticaregular;
|
| 1686 |
-
}
|
| 1687 |
-
.tab1 label, .tab2 label, .tab3 label, .tab4 label, .tab5 label, .tab6 label, .tab7 label, .tab8 label, .tab9 label {
|
| 1688 |
-
cursor: default!important;
|
| 1689 |
-
}
|
| 1690 |
-
.tab5 .new_wind h4 {
|
| 1691 |
-
margin-bottom: 11px!important;
|
| 1692 |
-
}
|
| 1693 |
-
.pop_up_box .fb_2 span {
|
| 1694 |
-
height: 28px!important;
|
| 1695 |
-
}
|
| 1696 |
-
.pop_up_box .sfsi_plus_tool_tip_2 .fbb .fb_1 a {
|
| 1697 |
-
margin-top: 0;
|
| 1698 |
-
}
|
| 1699 |
-
.tab6 .social_icon_like1 ul li span {
|
| 1700 |
-
margin-top: -1px;
|
| 1701 |
-
}
|
| 1702 |
-
#sfpluspageLoad {
|
| 1703 |
-
background: url(../images/ajax-loader.gif) 50% 50% no-repeat #F9F9F9;
|
| 1704 |
-
height: 100%;
|
| 1705 |
-
left: 160px;
|
| 1706 |
-
opacity: 1;
|
| 1707 |
-
position: fixed;
|
| 1708 |
-
top: 0;
|
| 1709 |
-
width: 89%;
|
| 1710 |
-
z-index: 9999;
|
| 1711 |
-
}
|
| 1712 |
-
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 1713 |
-
background: #FFF;
|
| 1714 |
-
border: 1px solid #e7e7e7;
|
| 1715 |
-
box-shadow: #e7e7e7 0 0 2px 1px;
|
| 1716 |
-
display: block;
|
| 1717 |
-
float: left;
|
| 1718 |
-
margin: 0 0 0 -52px;
|
| 1719 |
-
/*padding: 5px 14px 5px 14px;*/
|
| 1720 |
-
position: absolute;
|
| 1721 |
-
z-index: 10000;
|
| 1722 |
-
border-bottom: #e5e5e5 solid 4px;
|
| 1723 |
-
width: 100px;
|
| 1724 |
-
}
|
| 1725 |
-
.sfsi_plus_tool_tip_2 {
|
| 1726 |
-
display: inline-table;
|
| 1727 |
-
}
|
| 1728 |
-
.sfsiplus_inerCnt, .sfsiplus_inerCnt:hover, .sfsiplus_inerCnt>a, .sfsiplus_inerCnt>a:hover, .widget-area .widget a {
|
| 1729 |
-
outline: 0;
|
| 1730 |
-
}
|
| 1731 |
-
.sfsi_plus_tool_tip_2_inr {
|
| 1732 |
-
bottom: 90%;
|
| 1733 |
-
left: 20%;
|
| 1734 |
-
opacity: 0;
|
| 1735 |
-
}
|
| 1736 |
-
.sfsi_plus_tool_tip_2 .bot_arow {
|
| 1737 |
-
background: url(../images/bot_tip_icn.png) no-repeat;
|
| 1738 |
-
position: absolute;
|
| 1739 |
-
bottom: -21px;
|
| 1740 |
-
left: 50%;
|
| 1741 |
-
width: 15px;
|
| 1742 |
-
height: 21px;
|
| 1743 |
-
margin-left: -10px;
|
| 1744 |
-
}
|
| 1745 |
-
.sfsi_plus_tool_tip_2 .top_big_arow {
|
| 1746 |
-
position: absolute;
|
| 1747 |
-
-webkit-transform: rotate(180deg);
|
| 1748 |
-
-moz-transform: rotate(180deg);
|
| 1749 |
-
-ms-transform: rotate(180deg);
|
| 1750 |
-
-o-transform: rotate(180deg);
|
| 1751 |
-
transform: rotate(180deg);
|
| 1752 |
-
top: -21px;
|
| 1753 |
-
left: 46%;
|
| 1754 |
-
width: 15px;
|
| 1755 |
-
height: 21px;
|
| 1756 |
-
margin-right: -5px;
|
| 1757 |
-
}
|
| 1758 |
-
.sfsi_plus_tool_tip_2_inr .gpls_visit>a, .sfsi_plus_tool_tip_2_inr .prints_visit_1 a, .sfsi_plus_tool_tip_2_inr .utub_visit>a {
|
| 1759 |
-
margin-top: 0;
|
| 1760 |
-
}
|
| 1761 |
-
.sfsi_plus_tool_tip_2_inr .linkin_1 a, .sfsi_plus_tool_tip_2_inr .linkin_2 a, .sfsi_plus_tool_tip_2_inr .linkin_3 a, .sfsi_plus_tool_tip_2_inr .linkin_4 a, .sfsi_plus_tool_tip_2_inr .prints_visit a {
|
| 1762 |
-
margin: 0;
|
| 1763 |
-
}
|
| 1764 |
-
.sfsiTlleftBig {
|
| 1765 |
-
bottom: 121%;
|
| 1766 |
-
left: 22%;
|
| 1767 |
-
margin-left: -54%}
|
| 1768 |
-
.sfsi_plus_Tlleft {
|
| 1769 |
-
bottom: 100%;
|
| 1770 |
-
left: 50%;
|
| 1771 |
-
margin-left: -66px !important;
|
| 1772 |
-
margin-bottom: 2px;
|
| 1773 |
-
}
|
| 1774 |
-
.sfsi_plc_btm {
|
| 1775 |
-
bottom: auto;
|
| 1776 |
-
top: 100%;
|
| 1777 |
-
left: 50%;
|
| 1778 |
-
margin-left: -63px;
|
| 1779 |
-
margin-top: 8px;
|
| 1780 |
-
margin-bottom: auto;
|
| 1781 |
-
}
|
| 1782 |
-
.sfsiplus_inerCnt {
|
| 1783 |
-
position: relative;
|
| 1784 |
-
z-index: inherit!important;
|
| 1785 |
-
float: left;
|
| 1786 |
-
width: 100%;
|
| 1787 |
-
float: left;
|
| 1788 |
-
}
|
| 1789 |
-
.sfsi_plus_wicons {
|
| 1790 |
-
margin-bottom: 30px;
|
| 1791 |
-
position: relative;
|
| 1792 |
-
padding-top: 5px;
|
| 1793 |
-
}
|
| 1794 |
-
.sfsiplus_norm_row .bot_no {
|
| 1795 |
-
position: absolute;
|
| 1796 |
-
padding: 1px 0;
|
| 1797 |
-
font-size: 12px!important;
|
| 1798 |
-
text-align: center;
|
| 1799 |
-
line-height: 12px!important;
|
| 1800 |
-
background: #fff;
|
| 1801 |
-
border-radius: 5px;
|
| 1802 |
-
left: 50%;
|
| 1803 |
-
margin-left: -20px;
|
| 1804 |
-
z-index: 9;
|
| 1805 |
-
border: 1px solid #333;
|
| 1806 |
-
top: 100%;
|
| 1807 |
-
white-space: pre;
|
| 1808 |
-
-webkit-box-sizing: border-box;
|
| 1809 |
-
-moz-box-sizing: border-box;
|
| 1810 |
-
box-sizing: border-box;
|
| 1811 |
-
margin-top: 10px;
|
| 1812 |
-
width: 40px;
|
| 1813 |
-
}
|
| 1814 |
-
.sfsiplus_norm_row .bot_no:before {
|
| 1815 |
-
content: url(images/count_top_arow.png);
|
| 1816 |
-
position: absolute;
|
| 1817 |
-
height: 9px;
|
| 1818 |
-
margin-left: -7.5px;
|
| 1819 |
-
top: -10px;
|
| 1820 |
-
left: 50%;
|
| 1821 |
-
width: 15px;
|
| 1822 |
-
}
|
| 1823 |
-
/*.sf_subscrbe .bot_no:before
|
| 1824 |
-
{
|
| 1825 |
-
content: url(images/count_left_arow.png);
|
| 1826 |
-
height: 9px;
|
| 1827 |
-
left: 0;
|
| 1828 |
-
margin-left: -12px;
|
| 1829 |
-
position: absolute;
|
| 1830 |
-
top: 0px;
|
| 1831 |
-
width: 15px;
|
| 1832 |
-
}*/
|
| 1833 |
-
.sf_subscrbe .bot_no
|
| 1834 |
-
{
|
| 1835 |
-
background: rgba(0, 0, 0, 0) url(images/count_left_arow.png) no-repeat scroll 0 0 / 27px auto;
|
| 1836 |
-
font-size: 12px !important;
|
| 1837 |
-
left: 67px;
|
| 1838 |
-
line-height: 17px !important;
|
| 1839 |
-
margin-left: 0px;
|
| 1840 |
-
/* margin-top: 9px;*/
|
| 1841 |
-
padding: 1px 0;
|
| 1842 |
-
/*position: absolute;*/
|
| 1843 |
-
text-align: center;
|
| 1844 |
-
/*top: -8px;*/
|
| 1845 |
-
white-space: pre;
|
| 1846 |
-
width: 33px;
|
| 1847 |
-
height: 19px;
|
| 1848 |
-
z-index: 9;
|
| 1849 |
-
display:inline-block;
|
| 1850 |
-
}
|
| 1851 |
-
.bot_no.sfsiSmBtn {
|
| 1852 |
-
font-size: 10px;
|
| 1853 |
-
margin-top: 4px;
|
| 1854 |
-
}
|
| 1855 |
-
.bot_no.sfsiSmBtn:before {
|
| 1856 |
-
margin-left: -8px;
|
| 1857 |
-
top: -9px;
|
| 1858 |
-
}
|
| 1859 |
-
.sfsiplus_norm_row .cbtn_vsmall {
|
| 1860 |
-
font-size: 9px;
|
| 1861 |
-
left: -28%;
|
| 1862 |
-
top: 4px;
|
| 1863 |
-
}
|
| 1864 |
-
.sfsiplus_norm_row .cbtn_vsmall:before {
|
| 1865 |
-
left: 31%;
|
| 1866 |
-
top: -9px;
|
| 1867 |
-
margin-left: -31%}
|
| 1868 |
-
h2.optional {
|
| 1869 |
-
font-family: helveticaregular;
|
| 1870 |
-
font-size: 25px;
|
| 1871 |
-
margin: 14px 0 19px;
|
| 1872 |
-
color: #5a6570;
|
| 1873 |
-
}
|
| 1874 |
-
.utube_tool_bdr .utub_visit {
|
| 1875 |
-
margin: 9px 0 0;
|
| 1876 |
-
height: 24px;
|
| 1877 |
-
display: inline-block;
|
| 1878 |
-
float: none;
|
| 1879 |
-
}
|
| 1880 |
-
.utube_tool_bdr .utub_2 {
|
| 1881 |
-
margin: 9px 0 0;
|
| 1882 |
-
height: 24px;
|
| 1883 |
-
width: 86px;
|
| 1884 |
-
display: inline-block;
|
| 1885 |
-
float: none;
|
| 1886 |
-
}
|
| 1887 |
-
.sfsi_plus_printst_tool_bdr {
|
| 1888 |
-
width: 79px;
|
| 1889 |
-
}
|
| 1890 |
-
.sfsi_plus_printst_tool_bdr .prints_visit {
|
| 1891 |
-
margin: 0 0 10px -22px;
|
| 1892 |
-
}
|
| 1893 |
-
.sfsi_plus_printst_tool_bdr .prints_visit_1 {
|
| 1894 |
-
margin: 0 0 0 -53px;
|
| 1895 |
-
}
|
| 1896 |
-
.sfsi_plus_fb_tool_bdr {
|
| 1897 |
-
width: 68px;
|
| 1898 |
-
height: auto;
|
| 1899 |
-
}
|
| 1900 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside {
|
| 1901 |
-
text-align: center;
|
| 1902 |
-
width: 100%;
|
| 1903 |
-
float: left;
|
| 1904 |
-
overflow: hidden;
|
| 1905 |
-
}
|
| 1906 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1 {
|
| 1907 |
-
margin: 2px 0 2px 0;
|
| 1908 |
-
height: 28px;
|
| 1909 |
-
display: inline-block;
|
| 1910 |
-
float: none;
|
| 1911 |
-
/* width: 62px;s*/
|
| 1912 |
-
}
|
| 1913 |
-
.sfsi_plus_inside img
|
| 1914 |
-
{
|
| 1915 |
-
vertical-align:sub !important;
|
| 1916 |
-
}
|
| 1917 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon2
|
| 1918 |
-
{
|
| 1919 |
-
margin: 2px 0 2px 0 ;
|
| 1920 |
-
height: 20px;
|
| 1921 |
-
/* width: 49px;*/
|
| 1922 |
-
display:block;
|
| 1923 |
-
overflow: hidden;
|
| 1924 |
-
}
|
| 1925 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon3 {
|
| 1926 |
-
margin: 2px 0 2px 0;
|
| 1927 |
-
height: 20px;
|
| 1928 |
-
/* width: 62px;*/
|
| 1929 |
-
display:inline-block;
|
| 1930 |
-
float: none;
|
| 1931 |
-
}
|
| 1932 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_1, .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_2, .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_3 {
|
| 1933 |
-
margin: 9px 0 0;
|
| 1934 |
-
height: 25px;
|
| 1935 |
-
}
|
| 1936 |
-
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside {
|
| 1937 |
-
text-align: center;
|
| 1938 |
-
float: left;
|
| 1939 |
-
width: 100%}
|
| 1940 |
-
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon1{
|
| 1941 |
-
margin: 2px 0;
|
| 1942 |
-
height: 24px;
|
| 1943 |
-
display: inline-block;
|
| 1944 |
-
float: none;
|
| 1945 |
-
/*width: 73px;*/
|
| 1946 |
-
}
|
| 1947 |
-
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon2 {
|
| 1948 |
-
margin: 2px 0;
|
| 1949 |
-
height: 20px;
|
| 1950 |
-
display:inline-block;
|
| 1951 |
-
float: none;
|
| 1952 |
-
/*max-width: 73px;*/
|
| 1953 |
-
width: 100%;
|
| 1954 |
-
}
|
| 1955 |
-
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .prints_visit, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .prints_visit_1 {
|
| 1956 |
-
margin: 9px 0 0;
|
| 1957 |
-
height: 20px;
|
| 1958 |
-
float: none;
|
| 1959 |
-
display: inline-block;
|
| 1960 |
-
}
|
| 1961 |
-
.sfsi_plus_printst_tool_bdr {
|
| 1962 |
-
/* margin-left: -59px;*/
|
| 1963 |
-
}
|
| 1964 |
-
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4>a>img, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon2>a>img, .utube_tool_bdr .sfsi_plus_inside .icon1>a>img {
|
| 1965 |
-
padding-top: 0;
|
| 1966 |
-
}
|
| 1967 |
-
.sfsi_plus_gpls_tool_bdr {
|
| 1968 |
-
width: 76px;
|
| 1969 |
-
}
|
| 1970 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1>a>img {
|
| 1971 |
-
padding-top: 0;
|
| 1972 |
-
}
|
| 1973 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside {
|
| 1974 |
-
text-align: center;
|
| 1975 |
-
width: 100%;
|
| 1976 |
-
float: left;
|
| 1977 |
-
}
|
| 1978 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1 {
|
| 1979 |
-
margin: 2px 0;
|
| 1980 |
-
display: inline-block;
|
| 1981 |
-
float: none;
|
| 1982 |
-
height: 29px;
|
| 1983 |
-
/*width: 76px;*/
|
| 1984 |
-
}
|
| 1985 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon2 {
|
| 1986 |
-
margin: 2px 0 2px 0;
|
| 1987 |
-
display:inline-block;
|
| 1988 |
-
float: none;
|
| 1989 |
-
height: 24px;
|
| 1990 |
-
width:100%;
|
| 1991 |
-
/* width: 38px;*/
|
| 1992 |
-
}
|
| 1993 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon3 {
|
| 1994 |
-
margin: 2px 0 2px 0;
|
| 1995 |
-
display:block;
|
| 1996 |
-
float: none;
|
| 1997 |
-
height: 24px;
|
| 1998 |
-
/* width: 76px;
|
| 1999 |
-
*/}
|
| 2000 |
-
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gpls_visit, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gtalk_2, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gtalk_3 {
|
| 2001 |
-
margin: 9px 0 0;
|
| 2002 |
-
height: 29px;
|
| 2003 |
-
}
|
| 2004 |
-
.sfsi_plus_fb_tool_bdr, .sfsi_plus_gpls_tool_bdr, .sfsi_plus_linkedin_tool_bdr, .sfsi_plus_printst_tool_bdr, .sfsi_plus_twt_tool_bdr {
|
| 2005 |
-
bottom: 100%;
|
| 2006 |
-
left: 50%;
|
| 2007 |
-
margin-bottom: 2px;
|
| 2008 |
-
}
|
| 2009 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside {
|
| 2010 |
-
text-align: center;
|
| 2011 |
-
width: 100%;
|
| 2012 |
-
float: left;
|
| 2013 |
-
}
|
| 2014 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 {
|
| 2015 |
-
margin: 2px 0!important;
|
| 2016 |
-
display: inline-block;
|
| 2017 |
-
float: none;
|
| 2018 |
-
vertical-align: middle;
|
| 2019 |
-
overflow: hidden;
|
| 2020 |
-
/*width: 100%;*/
|
| 2021 |
-
}
|
| 2022 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a {
|
| 2023 |
-
display: inline-block;
|
| 2024 |
-
vertical-align: middle;
|
| 2025 |
-
/*width: 100%;*/
|
| 2026 |
-
width:auto;
|
| 2027 |
-
}
|
| 2028 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a img{
|
| 2029 |
-
float: left;
|
| 2030 |
-
}
|
| 2031 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1 {
|
| 2032 |
-
margin: 2px 24px 2px !important;
|
| 2033 |
-
display: inline-block;
|
| 2034 |
-
float: none;
|
| 2035 |
-
/*width: 61px;*/
|
| 2036 |
-
overflow: hidden;
|
| 2037 |
-
height: 20px;
|
| 2038 |
-
}
|
| 2039 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1 iframe {
|
| 2040 |
-
/* width: 61px!important;*/
|
| 2041 |
-
}
|
| 2042 |
-
.sfsi_plus_tool_tip_2, .sfsi_plus_fb_tool_bdr, .sfsi_plus_twt_tool_bdr, .sfsi_plus_linkedin_tool_bdr, .sfsi_plus_printst_tool_bdr, .sfsi_plus_gpls_tool_bdr, .sfsi_plus_Tlleft {width:140px !important; padding:6px 0;}
|
| 2043 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon2 {
|
| 2044 |
-
margin: 0px 0!important;
|
| 2045 |
-
display:inline-block;
|
| 2046 |
-
float: none;
|
| 2047 |
-
height: 20px;
|
| 2048 |
-
/* width: 58px;s*/
|
| 2049 |
-
}
|
| 2050 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_1 {
|
| 2051 |
-
margin: 9px 0 0;
|
| 2052 |
-
display: inline-block;
|
| 2053 |
-
float: none;
|
| 2054 |
-
width: 58px;
|
| 2055 |
-
height: 20px;
|
| 2056 |
-
overflow: hidden;
|
| 2057 |
-
}
|
| 2058 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_1 iframe {
|
| 2059 |
-
width: 100%!important;
|
| 2060 |
-
}
|
| 2061 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_2 {
|
| 2062 |
-
margin: 9px 0 0;
|
| 2063 |
-
height: 20px;
|
| 2064 |
-
display: inline-block;
|
| 2065 |
-
float: none;
|
| 2066 |
-
width: 58px;
|
| 2067 |
-
}
|
| 2068 |
-
.utube_tool_bdr .sfsi_plus_inside {
|
| 2069 |
-
text-align: center;
|
| 2070 |
-
width: 100%;
|
| 2071 |
-
float: left;
|
| 2072 |
-
}
|
| 2073 |
-
.sfsi_plus_inside > div {}
|
| 2074 |
-
.utube_tool_bdr .sfsi_plus_inside .icon1{
|
| 2075 |
-
margin: 2px 0 2px;
|
| 2076 |
-
height: 24px;
|
| 2077 |
-
display: inline-block;
|
| 2078 |
-
float: none;
|
| 2079 |
-
width: 87px;
|
| 2080 |
-
}
|
| 2081 |
-
.utube_tool_bdr .sfsi_plus_inside .icon2 {
|
| 2082 |
-
margin: 2px 0 2;
|
| 2083 |
-
height: 24px;
|
| 2084 |
-
display:inline-block;
|
| 2085 |
-
float: none;
|
| 2086 |
-
min-width: 100px;
|
| 2087 |
-
width: auto;
|
| 2088 |
-
}
|
| 2089 |
-
.utube_tool_bdr {
|
| 2090 |
-
width: 93px;
|
| 2091 |
-
bottom: 100%;
|
| 2092 |
-
left: 50%;
|
| 2093 |
-
margin-bottom: 2px;
|
| 2094 |
-
}
|
| 2095 |
-
.sfsi_plus_linkedin_tool_bdr {
|
| 2096 |
-
width: 66px;
|
| 2097 |
-
}
|
| 2098 |
-
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside {
|
| 2099 |
-
text-align: center;
|
| 2100 |
-
float: left;
|
| 2101 |
-
width: 100%}
|
| 2102 |
-
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1{
|
| 2103 |
-
margin: 2px 0;
|
| 2104 |
-
display: inline-block;
|
| 2105 |
-
float: none;
|
| 2106 |
-
height: 23px;
|
| 2107 |
-
width: 100%;
|
| 2108 |
-
}
|
| 2109 |
-
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon2{
|
| 2110 |
-
margin: 2px 0;
|
| 2111 |
-
display:inline-block;
|
| 2112 |
-
float: none;
|
| 2113 |
-
height: 23px;
|
| 2114 |
-
width: 100%;
|
| 2115 |
-
}
|
| 2116 |
-
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon3 {
|
| 2117 |
-
margin: 2px 0;
|
| 2118 |
-
display:inline-block;
|
| 2119 |
-
float: none;
|
| 2120 |
-
height: 23px;
|
| 2121 |
-
width: 100%;
|
| 2122 |
-
}
|
| 2123 |
-
|
| 2124 |
-
|
| 2125 |
-
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4 {
|
| 2126 |
-
margin: 2px 0;
|
| 2127 |
-
display: inline-block;
|
| 2128 |
-
float: none;
|
| 2129 |
-
height: 28px;
|
| 2130 |
-
width: 66px;
|
| 2131 |
-
}
|
| 2132 |
-
.sfsi_plus_FrntInner .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1{ margin: 2px 0;}
|
| 2133 |
-
.sfsi_plus_widget .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4,
|
| 2134 |
-
.sfsi_plus_widget .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1,
|
| 2135 |
-
.sfsi_plus_widget .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1 { height: auto}
|
| 2136 |
-
|
| 2137 |
-
.sfsi_plus_linkedin_tool_bdr .linkin_1, .sfsi_plus_linkedin_tool_bdr .linkin_2, .sfsi_plus_linkedin_tool_bdr .linkin_3, .sfsi_plus_linkedin_tool_bdr .linkin_4 {
|
| 2138 |
-
margin: 9px 0 0!important;
|
| 2139 |
-
height: 20px;
|
| 2140 |
-
display: inline-block;
|
| 2141 |
-
float: none;
|
| 2142 |
-
overflow: hidden;
|
| 2143 |
-
}
|
| 2144 |
-
.sfsi_plus_twt_tool_bdr {
|
| 2145 |
-
width: 62px;
|
| 2146 |
-
height: auto;
|
| 2147 |
-
}
|
| 2148 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1>iframe {
|
| 2149 |
-
margin: 0px auto!important;
|
| 2150 |
-
float: left !important;
|
| 2151 |
-
width: 100%}
|
| 2152 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1>iframe #widget {
|
| 2153 |
-
text-align: center;
|
| 2154 |
-
}
|
| 2155 |
-
.sfsi_pop_up .button {
|
| 2156 |
-
border: none;
|
| 2157 |
-
padding: 0;
|
| 2158 |
-
}
|
| 2159 |
-
.pop_up_box .button a {
|
| 2160 |
-
color: #fff;
|
| 2161 |
-
line-height: normal;
|
| 2162 |
-
font-size: 22px;
|
| 2163 |
-
text-decoration: none;
|
| 2164 |
-
text-align: center;
|
| 2165 |
-
width: 482px;
|
| 2166 |
-
height: 80px;
|
| 2167 |
-
margin: 0;
|
| 2168 |
-
display: table-cell;
|
| 2169 |
-
vertical-align: middle;
|
| 2170 |
-
font-family: helveticabold;
|
| 2171 |
-
padding: 0 10px;
|
| 2172 |
-
}
|
| 2173 |
-
.tab3 ul.sfsiplus_tab_3_icns li .radio {
|
| 2174 |
-
margin-top: 7px;
|
| 2175 |
-
}
|
| 2176 |
-
.tab3 ul.sfsiplus_tab_3_icns li label { line-height: 50px!important; margin-left: 20px;}
|
| 2177 |
-
.sfsi_mainContainer input[type=email], .sfsi_mainContainer input[type=number], .sfsi_mainContainer input[type=password], .sfsi_mainContainer input[type=search], .sfsi_mainContainer input[type=tel], .sfsi_mainContainer input[type=text], .sfsi_mainContainer input[type=url], .sfsi_mainContainer select, .sfsi_mainContainer textarea {
|
| 2178 |
-
color: #5a6570!important;
|
| 2179 |
-
}
|
| 2180 |
-
.adminTooltip {
|
| 2181 |
-
left: 142px;
|
| 2182 |
-
position: absolute;
|
| 2183 |
-
}
|
| 2184 |
-
.adPopWidth {
|
| 2185 |
-
min-height: 100px!important;
|
| 2186 |
-
}
|
| 2187 |
-
.main_contant p>a.lit_txt, .tab4 p>a {
|
| 2188 |
-
font-family: helveticaregular;
|
| 2189 |
-
color: #414951;
|
| 2190 |
-
}
|
| 2191 |
-
.tab1 ul.plus_icn_listing li .sfsiplus_custom-txt {
|
| 2192 |
-
margin-left: 5px;
|
| 2193 |
-
}
|
| 2194 |
-
.tab1 ul.plus_icn_listing li .custom-img {
|
| 2195 |
-
margin-left: 18px;
|
| 2196 |
-
}
|
| 2197 |
-
.sfsiplus_linkedin_section .link_4>label.anthr_labl {
|
| 2198 |
-
height: 94px;
|
| 2199 |
-
}
|
| 2200 |
-
.tab3 .tab_3_sav {
|
| 2201 |
-
padding-top: 0;
|
| 2202 |
-
margin: -69px auto 20px;
|
| 2203 |
-
position: relative;
|
| 2204 |
-
z-index: 9;
|
| 2205 |
-
}
|
| 2206 |
-
.mediam_txt {
|
| 2207 |
-
font-family: helveticabold;
|
| 2208 |
-
}
|
| 2209 |
-
.sfsiCtxt {
|
| 2210 |
-
line-height: 51px;
|
| 2211 |
-
font-family: helveticaregular;
|
| 2212 |
-
font-size: 22px;
|
| 2213 |
-
float: left;
|
| 2214 |
-
padding-left: 19px;
|
| 2215 |
-
color: #5a6570;
|
| 2216 |
-
}
|
| 2217 |
-
.customstep2-img {
|
| 2218 |
-
width: 51px;
|
| 2219 |
-
float: left;
|
| 2220 |
-
}
|
| 2221 |
-
.tab2 .row h2.custom {
|
| 2222 |
-
margin: 15px 0 7px 21px;
|
| 2223 |
-
height: 52px;
|
| 2224 |
-
line-height: 51px;
|
| 2225 |
-
font-family: helveticaregular;
|
| 2226 |
-
font-size: 22px;
|
| 2227 |
-
}
|
| 2228 |
-
.plus_custom-links p.cus_link label {
|
| 2229 |
-
margin-left: 0;
|
| 2230 |
-
}
|
| 2231 |
-
.pop_up_box .sfsi_plus_tool_tip_2 .fbb .fb_1 a>img:hover {
|
| 2232 |
-
opacity: .9;
|
| 2233 |
-
}
|
| 2234 |
-
.tab2 .rss_url_row .sfrsTxt {
|
| 2235 |
-
font-size: 17px;
|
| 2236 |
-
line-height: 41px;
|
| 2237 |
-
margin: 0 0 0 4px;
|
| 2238 |
-
font-family: helveticaregular;
|
| 2239 |
-
}
|
| 2240 |
-
.tab2 .rss_url_row .sfrsTxt>strong {
|
| 2241 |
-
font-family: helveticaregular;
|
| 2242 |
-
}
|
| 2243 |
-
.tab2 .utube_inn p.extra_pp {
|
| 2244 |
-
float: left;
|
| 2245 |
-
width: 100%;
|
| 2246 |
-
margin: 0 0 0 48px;
|
| 2247 |
-
}
|
| 2248 |
-
.tab2 .utube_inn p.extra_pp label {
|
| 2249 |
-
float: left;
|
| 2250 |
-
line-height: 41px;
|
| 2251 |
-
margin-right: 8px;
|
| 2252 |
-
}
|
| 2253 |
-
.sfsi_inside .icon2 .fb_iframe_widget span {
|
| 2254 |
-
/* width: 500px!important; sunil*/
|
| 2255 |
-
}
|
| 2256 |
-
@media (max-width:767px) {
|
| 2257 |
-
.icon2 .fb_iframe_widget span {
|
| 2258 |
-
width: auto;
|
| 2259 |
-
}
|
| 2260 |
-
.sfsi_plus_outr_div
|
| 2261 |
-
{
|
| 2262 |
-
top: 10%
|
| 2263 |
-
}
|
| 2264 |
-
.sfsi_plus_outr_div h2
|
| 2265 |
-
{
|
| 2266 |
-
font-size: 22px!important;
|
| 2267 |
-
line-height: 28px;
|
| 2268 |
-
}
|
| 2269 |
-
.sfsi_plus_wicons {
|
| 2270 |
-
padding-top: 0;
|
| 2271 |
-
}
|
| 2272 |
-
}
|
| 2273 |
-
.sfsiplus_specify_counts .listing li .high_prb {
|
| 2274 |
-
height: 41px;
|
| 2275 |
-
}
|
| 2276 |
-
.sfsi_plus_Sicons {
|
| 2277 |
-
position: relative;
|
| 2278 |
-
}
|
| 2279 |
-
.sfsi_plus_Sicons .sf_subscrbe{ margin: 2px 3px 0 0; line-height: 0px;}
|
| 2280 |
-
.sfsi_plus_Sicons .sf_fb{ margin: 0 4px 0 5px; line-height: 0px;}
|
| 2281 |
-
.sfsi_plus_Sicons .sf_google{ margin: 0 5px 0 5px; line-height: 0px;}
|
| 2282 |
-
.sfsi_plus_Sicons .sf_twiter{ margin: 1px 7px 0 4px; line-height: 0px;}
|
| 2283 |
-
.sfsi_plus_Sicons .sf_addthis{ margin: 2px 7px 0 2px; line-height: 0px;}
|
| 2284 |
-
|
| 2285 |
-
.sfsi_plus_Sicons.left .sf_subscrbe{ margin: 2px 8px 0 0;}
|
| 2286 |
-
.sfsi_plus_Sicons.left .sf_fb{ margin: 0 8px 0 0;}
|
| 2287 |
-
.sfsi_plus_Sicons.left .sf_google{ margin: 0 8px 0 0;}
|
| 2288 |
-
.sfsi_plus_Sicons.left .sf_twiter{ margin: 1px 8px 0 0;}
|
| 2289 |
-
.sfsi_plus_Sicons.left .sf_addthis{ margin: 2px 7px 0 0;}
|
| 2290 |
-
|
| 2291 |
-
.sfsi_plus_Sicons.right .sf_subscrbe{ margin: 2px 0 0; }
|
| 2292 |
-
.sfsi_plus_Sicons.right .sf_fb{ margin: 0 0 0 7px; }
|
| 2293 |
-
.sfsi_plus_Sicons.right .sf_google{ margin: 0 0 0 8px; }
|
| 2294 |
-
.sfsi_plus_Sicons.right .sf_twiter{ margin: 1px 0 0 8px; }
|
| 2295 |
-
.sfsi_plus_Sicons.right .sf_addthis{ margin: 2px 0 0 8px; }
|
| 2296 |
-
|
| 2297 |
-
.sfsi_plus_Sicons .sf_subscrbe, .sfsi_plus_Sicons .sf_twiter
|
| 2298 |
-
{
|
| 2299 |
-
position: relative;
|
| 2300 |
-
width: 75px;
|
| 2301 |
-
}
|
| 2302 |
-
.sfsi_plus_Sicons .sf_twiter iframe
|
| 2303 |
-
{
|
| 2304 |
-
margin: 0px;
|
| 2305 |
-
height: 20px !important;
|
| 2306 |
-
overflow: visible !important;
|
| 2307 |
-
}
|
| 2308 |
-
.sfsi_plus_Sicons .sf_twiter iframe #widget
|
| 2309 |
-
{
|
| 2310 |
-
overflow: visible !important;
|
| 2311 |
-
|
| 2312 |
-
}
|
| 2313 |
-
.sfsi_plus_Sicons .sf_subscrbe a
|
| 2314 |
-
{
|
| 2315 |
-
width: auto;
|
| 2316 |
-
float: left;
|
| 2317 |
-
border: medium none;
|
| 2318 |
-
padding-top: 0px;
|
| 2319 |
-
}
|
| 2320 |
-
.sfsi_plus_Sicons .sf_subscrbe a:focus
|
| 2321 |
-
{
|
| 2322 |
-
outline: medium none;
|
| 2323 |
-
}
|
| 2324 |
-
.sfsi_plus_Sicons .sf_subscrbe a img
|
| 2325 |
-
{
|
| 2326 |
-
float: left;
|
| 2327 |
-
}
|
| 2328 |
-
.sfsi_plus_Sicons .sf_fb {
|
| 2329 |
-
position: relative;
|
| 2330 |
-
width: 75px;
|
| 2331 |
-
}
|
| 2332 |
-
.sfsi_plus_Sicons .fb_iframe_widget {
|
| 2333 |
-
float: none;
|
| 2334 |
-
width: auto;
|
| 2335 |
-
vertical-align: middle;
|
| 2336 |
-
margin: 2px 0 0;
|
| 2337 |
-
}
|
| 2338 |
-
/*absolute commented as for standard icon it was giving issue while icon was to be aligned centerd.*/
|
| 2339 |
-
.sfsi_plus_Sicons .sf_fb .fb_iframe_widget>span {
|
| 2340 |
-
position: relative;
|
| 2341 |
-
/*width: 450px!important;*/
|
| 2342 |
-
float: left;
|
| 2343 |
-
}
|
| 2344 |
-
.sfsi_plus_Sicons .sf_addthis, .sfsi_plus_Sicons .sf_google {
|
| 2345 |
-
position: relative;
|
| 2346 |
-
}
|
| 2347 |
-
.sf_google > div
|
| 2348 |
-
{
|
| 2349 |
-
width: 70px !important;
|
| 2350 |
-
}
|
| 2351 |
-
.sf_google iframe
|
| 2352 |
-
{
|
| 2353 |
-
width: 100% !important;
|
| 2354 |
-
}
|
| 2355 |
-
.sfsi_plus_Sicons .sf_google>div
|
| 2356 |
-
{
|
| 2357 |
-
float: left !important;
|
| 2358 |
-
margin-top: 1px !important;
|
| 2359 |
-
}
|
| 2360 |
-
.wrapper .sfsi_plus_Sicons .sf_addthis {
|
| 2361 |
-
margin: 7px 0 0 4px!important;
|
| 2362 |
-
}
|
| 2363 |
-
.tab2 .utube_inn label {
|
| 2364 |
-
font-size: 18px;
|
| 2365 |
-
}
|
| 2366 |
-
.sfsi_plc_btm {
|
| 2367 |
-
padding: 5px 14px 9px;
|
| 2368 |
-
}
|
| 2369 |
-
.tab7 .field {
|
| 2370 |
-
margin-top: 7px;
|
| 2371 |
-
}
|
| 2372 |
-
.sfsi_plus_outr_div ul li .cmcls img {
|
| 2373 |
-
margin-top: 0!important;
|
| 2374 |
-
}
|
| 2375 |
-
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt {
|
| 2376 |
-
float: left;
|
| 2377 |
-
}
|
| 2378 |
-
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt .bot_no {
|
| 2379 |
-
position: absolute;
|
| 2380 |
-
padding: 1px 0;
|
| 2381 |
-
font-size: 12px!important;
|
| 2382 |
-
line-height: 12px!important;
|
| 2383 |
-
text-align: center;
|
| 2384 |
-
background: #fff;
|
| 2385 |
-
border-radius: 5px;
|
| 2386 |
-
display: block;
|
| 2387 |
-
left: 50%;
|
| 2388 |
-
margin-left: -20px;
|
| 2389 |
-
border: 1px solid #333;
|
| 2390 |
-
white-space: pre;
|
| 2391 |
-
-webkit-box-sizing: border-box;
|
| 2392 |
-
-moz-box-sizing: border-box;
|
| 2393 |
-
box-sizing: border-box;
|
| 2394 |
-
margin-top: 6px;
|
| 2395 |
-
width: 40px;
|
| 2396 |
-
word-break: break-all;
|
| 2397 |
-
word-wrap: break-word;
|
| 2398 |
-
}
|
| 2399 |
-
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt .bot_no:before {
|
| 2400 |
-
content: url(images/count_top_arow.png);
|
| 2401 |
-
position: absolute;
|
| 2402 |
-
height: 9px;
|
| 2403 |
-
margin-left: -7.5px;
|
| 2404 |
-
top: -10px;
|
| 2405 |
-
left: 50%;
|
| 2406 |
-
width: 15px;
|
| 2407 |
-
}
|
| 2408 |
-
.sfsi_plus_outr_div {
|
| 2409 |
-
position: fixed;
|
| 2410 |
-
width: 100%;
|
| 2411 |
-
float: none;
|
| 2412 |
-
left: 50%;
|
| 2413 |
-
top: 20%;
|
| 2414 |
-
margin-left: -50%;
|
| 2415 |
-
opacity: 0;
|
| 2416 |
-
z-index: -1;
|
| 2417 |
-
display: block;
|
| 2418 |
-
text-align: center;
|
| 2419 |
-
}
|
| 2420 |
-
.sfsi_plus_outr_div .sfsi_plus_FrntInner {
|
| 2421 |
-
display: inline-block;
|
| 2422 |
-
padding: 15px 17px 27px 18px;
|
| 2423 |
-
background: #FFF;
|
| 2424 |
-
border: 1px solid #EDEDED;
|
| 2425 |
-
box-shadow: 0 0 5px #CCC;
|
| 2426 |
-
margin: 20px;
|
| 2427 |
-
position: relative;
|
| 2428 |
-
}
|
| 2429 |
-
.sfsi_plus_FrntInner .sfsiclpupwpr
|
| 2430 |
-
{
|
| 2431 |
-
position: absolute;
|
| 2432 |
-
right: -10px;
|
| 2433 |
-
top: -10px;
|
| 2434 |
-
width: 25px;
|
| 2435 |
-
cursor: pointer;
|
| 2436 |
-
}
|
| 2437 |
-
.sfsi_plus_FrntInner .sfsiclpupwpr img
|
| 2438 |
-
{
|
| 2439 |
-
width: auto;
|
| 2440 |
-
float: left;
|
| 2441 |
-
border: medium none;
|
| 2442 |
-
}
|
| 2443 |
-
.tab7 .like_pop_box {
|
| 2444 |
-
width: 100%;
|
| 2445 |
-
margin: 35px auto auto;
|
| 2446 |
-
position: relative;
|
| 2447 |
-
text-align: center;
|
| 2448 |
-
}
|
| 2449 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner {
|
| 2450 |
-
display: inline-block;
|
| 2451 |
-
padding: 18px 20px;
|
| 2452 |
-
box-shadow: 0 0 5px #ccc;
|
| 2453 |
-
-webkit-box-shadow: 0 0 5px #ccc;
|
| 2454 |
-
border: 1px solid #ededed;
|
| 2455 |
-
background: #FFF;
|
| 2456 |
-
}
|
| 2457 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner h2 {
|
| 2458 |
-
margin: 0 0 23px;
|
| 2459 |
-
padding: 0;
|
| 2460 |
-
color: #414951;
|
| 2461 |
-
font-family: helveticabold;
|
| 2462 |
-
font-size: 26px;
|
| 2463 |
-
text-align: center;
|
| 2464 |
-
}
|
| 2465 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner ul {
|
| 2466 |
-
margin: 0;
|
| 2467 |
-
padding: 0;
|
| 2468 |
-
list-style: none;
|
| 2469 |
-
text-align: center;
|
| 2470 |
-
}
|
| 2471 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner ul li {
|
| 2472 |
-
margin: 0;
|
| 2473 |
-
padding: 0;
|
| 2474 |
-
list-style: none;
|
| 2475 |
-
display: inline-block;
|
| 2476 |
-
}
|
| 2477 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner ul li span {
|
| 2478 |
-
margin: 0;
|
| 2479 |
-
width: 54px;
|
| 2480 |
-
display: block;
|
| 2481 |
-
background: url(../images/count_bg.png) no-repeat;
|
| 2482 |
-
height: 24px;
|
| 2483 |
-
overflow: hidden;
|
| 2484 |
-
padding: 10px 2px 2px;
|
| 2485 |
-
font-family: helveticaregular;
|
| 2486 |
-
font-size: 16px;
|
| 2487 |
-
text-align: center;
|
| 2488 |
-
line-height: 24px;
|
| 2489 |
-
color: #5a6570;
|
| 2490 |
-
}
|
| 2491 |
-
.tab7 .like_pop_box .sfsi_plus_Popinner ul li a {
|
| 2492 |
-
color: #5a6570;
|
| 2493 |
-
text-decoration: none;
|
| 2494 |
-
}
|
| 2495 |
-
.sfsi_plus_outr_div .sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2496 |
-
margin-bottom: 0;
|
| 2497 |
-
}
|
| 2498 |
-
.sfsi_plus_outr_div ul {
|
| 2499 |
-
list-style: none;
|
| 2500 |
-
margin: 0 0 24px;
|
| 2501 |
-
padding: 0;
|
| 2502 |
-
text-align: center;
|
| 2503 |
-
}
|
| 2504 |
-
a.sfsiColbtn {
|
| 2505 |
-
color: #5a6570!important;
|
| 2506 |
-
float: right;
|
| 2507 |
-
font-size: 14px;
|
| 2508 |
-
margin: -35px -30px 0 0;
|
| 2509 |
-
position: relative;
|
| 2510 |
-
right: 0;
|
| 2511 |
-
font-family: helveticaregular;
|
| 2512 |
-
width: 100px;
|
| 2513 |
-
text-decoration: none;
|
| 2514 |
-
}
|
| 2515 |
-
.tab3 a.sfsiColbtn {
|
| 2516 |
-
margin-top: -55px;
|
| 2517 |
-
}
|
| 2518 |
-
.sfsi_plus_FrntInner ul li:first-of-type .sfsi_plus_wicons {
|
| 2519 |
-
margin-left: 0!important;
|
| 2520 |
-
}
|
| 2521 |
-
ul.sfsiplus_tab_3_icns li .trans_bg {
|
| 2522 |
-
background: #000;
|
| 2523 |
-
padding-left: 3px;
|
| 2524 |
-
}
|
| 2525 |
-
.tab2 .sfsiplus_instagram_section {
|
| 2526 |
-
padding-bottom: 20px;
|
| 2527 |
-
}
|
| 2528 |
-
h1.abt_titl {
|
| 2529 |
-
text-align: center;
|
| 2530 |
-
margin: 19% 0 0;
|
| 2531 |
-
}
|
| 2532 |
-
.sfcm.sfsi_wicon { padding: 0; width: 100% !important; border: medium none !important; height: auto !important;}
|
| 2533 |
-
.fb_iframe_widget span {
|
| 2534 |
-
vertical-align: top!important;
|
| 2535 |
-
}
|
| 2536 |
-
.sfsi_plus_outr_div .sfsi_plus_FrntInner ul {
|
| 2537 |
-
margin: 0 0 0 3px;
|
| 2538 |
-
}
|
| 2539 |
-
.sfsi_plus_outr_div .sfsi_plus_FrntInner ul li {
|
| 2540 |
-
margin: 0 3px 0 0;
|
| 2541 |
-
}
|
| 2542 |
-
@-moz-document url-prefix() {
|
| 2543 |
-
.sfcm.sfsi_wicon {
|
| 2544 |
-
margin: -1px;
|
| 2545 |
-
padding: 0;
|
| 2546 |
-
}
|
| 2547 |
-
}@media (min-width:320px) and (max-width:480px) {
|
| 2548 |
-
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 2549 |
-
padding: 5px 14px 0;
|
| 2550 |
-
}
|
| 2551 |
-
.sfsi_plus_inside:last-child {
|
| 2552 |
-
margin-bottom: 18px;
|
| 2553 |
-
clear: both;
|
| 2554 |
-
}
|
| 2555 |
-
.sfsi_plus_outr_div {
|
| 2556 |
-
top: 10%}
|
| 2557 |
-
.sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2558 |
-
width: 31px!important;
|
| 2559 |
-
height: 31px!important;
|
| 2560 |
-
}
|
| 2561 |
-
.sfsi_plus_FrntInner .sfsi_plus_wicons img {
|
| 2562 |
-
width: 100%}
|
| 2563 |
-
}
|
| 2564 |
-
@media (max-width:320px) {
|
| 2565 |
-
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 2566 |
-
padding: 5px 14px 0;
|
| 2567 |
-
}
|
| 2568 |
-
.sfsi_plus_inside:last-child {
|
| 2569 |
-
margin-bottom: 18px;
|
| 2570 |
-
clear: both;
|
| 2571 |
-
}
|
| 2572 |
-
.sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2573 |
-
width: 31px!important;
|
| 2574 |
-
height: 31px!important;
|
| 2575 |
-
}
|
| 2576 |
-
.sfsi_plus_FrntInner .sfsi_plus_wicons img {
|
| 2577 |
-
width: 100%}
|
| 2578 |
-
}
|
| 2579 |
-
ul.SFSI_lsngfrm {
|
| 2580 |
-
float: left;
|
| 2581 |
-
width: 61%}
|
| 2582 |
-
ul.SFSI_instructions {
|
| 2583 |
-
float: left;
|
| 2584 |
-
width: 39%}
|
| 2585 |
-
ul.SFSI_instructions li {
|
| 2586 |
-
font-size: 12px!important;
|
| 2587 |
-
line-height: 25px!important;
|
| 2588 |
-
margin: 0!important;
|
| 2589 |
-
padding: 0 0 0 15px!important;
|
| 2590 |
-
width: 100%}
|
| 2591 |
-
|
| 2592 |
-
/*{Monad}*/
|
| 2593 |
-
/*Upload Skins css*/
|
| 2594 |
-
.cstmskin_popup
|
| 2595 |
-
{
|
| 2596 |
-
width: 500px;
|
| 2597 |
-
background: #FFF;
|
| 2598 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 2599 |
-
margin: 40px 0px auto;
|
| 2600 |
-
padding: 20px 25px 20px;
|
| 2601 |
-
font-family: helveticaregular;
|
| 2602 |
-
color: #5a6570;
|
| 2603 |
-
height: auto;
|
| 2604 |
-
float: left;
|
| 2605 |
-
position: relative;
|
| 2606 |
-
left: 35%;
|
| 2607 |
-
}
|
| 2608 |
-
.cstomskins_wrpr {
|
| 2609 |
-
float: left;
|
| 2610 |
-
width: 100%;
|
| 2611 |
-
}
|
| 2612 |
-
.custskinmsg {
|
| 2613 |
-
float: left;
|
| 2614 |
-
font-size: 15px;
|
| 2615 |
-
margin-top: 10px;
|
| 2616 |
-
width: 100%;
|
| 2617 |
-
}
|
| 2618 |
-
.custskinmsg > ul {
|
| 2619 |
-
color: #000;
|
| 2620 |
-
float: left;
|
| 2621 |
-
margin-top: 8px;
|
| 2622 |
-
width: 100%;
|
| 2623 |
-
}
|
| 2624 |
-
ul.cstmskin_iconlist {
|
| 2625 |
-
float: left;
|
| 2626 |
-
margin-top: 10px;
|
| 2627 |
-
width: 100%;
|
| 2628 |
-
}
|
| 2629 |
-
.cstmskin_iconlist > li {
|
| 2630 |
-
float: left;
|
| 2631 |
-
margin: 3px 0;
|
| 2632 |
-
width: 100%;
|
| 2633 |
-
}
|
| 2634 |
-
.cstm_icnname {
|
| 2635 |
-
float: left;
|
| 2636 |
-
width: 30%;
|
| 2637 |
-
}
|
| 2638 |
-
.cstmskins_btn > img {
|
| 2639 |
-
float: left;
|
| 2640 |
-
margin-right: 25px;
|
| 2641 |
-
}
|
| 2642 |
-
.cstmskin_btn
|
| 2643 |
-
{
|
| 2644 |
-
width: auto;
|
| 2645 |
-
float: left;
|
| 2646 |
-
padding: 3px 20px;
|
| 2647 |
-
color: #fff;
|
| 2648 |
-
background-color:#12a252;
|
| 2649 |
-
text-decoration: none;
|
| 2650 |
-
margin: 0 10px;
|
| 2651 |
-
}
|
| 2652 |
-
.cstmskins_sbmt
|
| 2653 |
-
{
|
| 2654 |
-
width: 100%;
|
| 2655 |
-
float: left;
|
| 2656 |
-
text-align: center;
|
| 2657 |
-
margin-top: 15px;
|
| 2658 |
-
}
|
| 2659 |
-
.done_btn
|
| 2660 |
-
{
|
| 2661 |
-
width: auto;
|
| 2662 |
-
padding: 3px 80px;
|
| 2663 |
-
color: #fff;
|
| 2664 |
-
background-color:#12a252;
|
| 2665 |
-
text-decoration: none;
|
| 2666 |
-
font-size: 18px;
|
| 2667 |
-
}
|
| 2668 |
-
.cstmskin_btn:hover, .done_btn:hover, .cstmskin_btn:focus, .done_btn:focus
|
| 2669 |
-
{
|
| 2670 |
-
color: #fff;
|
| 2671 |
-
}
|
| 2672 |
-
.skswrpr, .dlt_btn
|
| 2673 |
-
{
|
| 2674 |
-
display: none;
|
| 2675 |
-
}
|
| 2676 |
-
.cstmutbewpr
|
| 2677 |
-
{
|
| 2678 |
-
width: 100%;
|
| 2679 |
-
float: left;
|
| 2680 |
-
margin-top: 10px;
|
| 2681 |
-
}
|
| 2682 |
-
.cstmutbewpr ul.enough_waffling li
|
| 2683 |
-
{
|
| 2684 |
-
width: auto;
|
| 2685 |
-
float: left;
|
| 2686 |
-
margin-right: 20px;
|
| 2687 |
-
}
|
| 2688 |
-
.cstmutbewpr ul.enough_waffling li span
|
| 2689 |
-
{
|
| 2690 |
-
float: left;
|
| 2691 |
-
}
|
| 2692 |
-
.cstmutbewpr ul.enough_waffling li label
|
| 2693 |
-
{
|
| 2694 |
-
width: auto;
|
| 2695 |
-
float: left;
|
| 2696 |
-
margin-top: 10px;
|
| 2697 |
-
margin-left: 10px;
|
| 2698 |
-
}
|
| 2699 |
-
.cstmutbewpr .cstmutbtxtwpr
|
| 2700 |
-
{
|
| 2701 |
-
width: 100%;
|
| 2702 |
-
float: left;
|
| 2703 |
-
padding-top: 10px;
|
| 2704 |
-
}
|
| 2705 |
-
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr
|
| 2706 |
-
{
|
| 2707 |
-
width: 100%;
|
| 2708 |
-
float: left;
|
| 2709 |
-
display: none;
|
| 2710 |
-
}
|
| 2711 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p, #accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p
|
| 2712 |
-
{
|
| 2713 |
-
margin-left: 0px;
|
| 2714 |
-
}
|
| 2715 |
-
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr
|
| 2716 |
-
{
|
| 2717 |
-
width: 100%;
|
| 2718 |
-
float: left;
|
| 2719 |
-
display: none;
|
| 2720 |
-
}
|
| 2721 |
-
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p label, #accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p label
|
| 2722 |
-
{
|
| 2723 |
-
width: 120px;
|
| 2724 |
-
}
|
| 2725 |
-
.sfsi_plus_widget .sfsi_plus_wDiv .sfsi_plus_wicons .sfsiplus_inerCnt a, .sfsi_plus_widget .sfsi_plus_wDiv .sfsi_plus_wicons .sfsiplus_inerCnt a.sficn
|
| 2726 |
-
{
|
| 2727 |
-
padding: 0px;
|
| 2728 |
-
margin: 0px;
|
| 2729 |
-
width: 100%;
|
| 2730 |
-
/*float: left;*/
|
| 2731 |
-
border: medium none;
|
| 2732 |
-
}
|
| 2733 |
-
.sfsi_socialwpr
|
| 2734 |
-
{
|
| 2735 |
-
width: auto;
|
| 2736 |
-
float: left;
|
| 2737 |
-
}
|
| 2738 |
-
.sfsi_socialwpr .sf_fb
|
| 2739 |
-
{
|
| 2740 |
-
float:left;
|
| 2741 |
-
margin:5px 5px 5px 5px;
|
| 2742 |
-
min-height: 20px;
|
| 2743 |
-
}
|
| 2744 |
-
.sfsi_socialwpr .sf_google
|
| 2745 |
-
{
|
| 2746 |
-
float:left;
|
| 2747 |
-
margin:5px 5px 5px 5px;
|
| 2748 |
-
max-width:62px;
|
| 2749 |
-
min-width:35px;
|
| 2750 |
-
min-height: 20px;
|
| 2751 |
-
}
|
| 2752 |
-
.sfsi_socialwpr .sf_addthis
|
| 2753 |
-
{
|
| 2754 |
-
float:left;
|
| 2755 |
-
margin:5px 5px 5px 5px;
|
| 2756 |
-
min-height: 20px;
|
| 2757 |
-
}
|
| 2758 |
-
.sfsipyplfrm
|
| 2759 |
-
{
|
| 2760 |
-
float: left;
|
| 2761 |
-
margin-top: 10px;
|
| 2762 |
-
width: 100%;
|
| 2763 |
-
}
|
| 2764 |
-
.sfsipyplfrm input[type="submit"]
|
| 2765 |
-
{
|
| 2766 |
-
background: none repeat scroll 0 0 rgba(0, 0, 0, 0);
|
| 2767 |
-
border: medium none;
|
| 2768 |
-
color: #0074a2;
|
| 2769 |
-
cursor: pointer;
|
| 2770 |
-
font-weight: normal;
|
| 2771 |
-
margin: 0;
|
| 2772 |
-
padding: 5px 10px;
|
| 2773 |
-
text-decoration: underline;
|
| 2774 |
-
}
|
| 2775 |
-
.sfsipyplfrm input[type="submit"]:hover
|
| 2776 |
-
{
|
| 2777 |
-
color: #2ea2cc
|
| 2778 |
-
}
|
| 2779 |
-
.pop_up_box_ex {
|
| 2780 |
-
background: none repeat scroll 0 0 #fff;
|
| 2781 |
-
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 2782 |
-
color: #5a6570;
|
| 2783 |
-
font-family: helveticaregular;
|
| 2784 |
-
margin: 200px auto;
|
| 2785 |
-
min-height: 150px;
|
| 2786 |
-
padding: 20px 25px 0px;
|
| 2787 |
-
position: relative;
|
| 2788 |
-
width: 290px;
|
| 2789 |
-
}
|
| 2790 |
-
.pop_up_box_ex {
|
| 2791 |
-
color: #5a6570;
|
| 2792 |
-
font-family: helveticaregular;
|
| 2793 |
-
}
|
| 2794 |
-
|
| 2795 |
-
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_right_info {
|
| 2796 |
-
font-family: helveticaregular;
|
| 2797 |
-
width: 94.7%;
|
| 2798 |
-
float: left;
|
| 2799 |
-
}
|
| 2800 |
-
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_right_info p label.ckckslctn
|
| 2801 |
-
{
|
| 2802 |
-
display: none;
|
| 2803 |
-
}
|
| 2804 |
-
|
| 2805 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr > li {
|
| 2806 |
-
width:100% !important;
|
| 2807 |
-
max-width:100% !important;
|
| 2808 |
-
border-left: 45px solid transparent;
|
| 2809 |
-
-webkit-box-sizing: border-box;
|
| 2810 |
-
-moz-box-sizing: border-box;;
|
| 2811 |
-
-ms-box-sizing: border-box;
|
| 2812 |
-
-o-box-sizing: border-box;
|
| 2813 |
-
box-sizing: border-box;
|
| 2814 |
-
}
|
| 2815 |
-
|
| 2816 |
-
.tab8 .icons_size > input {
|
| 2817 |
-
background:none repeat scroll 0 0 #e5e5e5;
|
| 2818 |
-
width:80px;
|
| 2819 |
-
float:left;
|
| 2820 |
-
padding:10px 0;
|
| 2821 |
-
text-align:center;
|
| 2822 |
-
}
|
| 2823 |
-
.tab8 .icons_size > ins { margin-left:19px; }
|
| 2824 |
-
.tab8 .icons_size > span.last { width: auto !important; clear: left }
|
| 2825 |
-
.tab8 .radio_section.tb_4_ck { margin: 0 20px 0 0 !important; }
|
| 2826 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row,
|
| 2827 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr p,
|
| 2828 |
-
.tab8 .options {
|
| 2829 |
-
float: none;
|
| 2830 |
-
width: 100%;
|
| 2831 |
-
border-left: 60px solid transparent;
|
| 2832 |
-
-webkit-box-sizing: border-box;
|
| 2833 |
-
-moz-box-sizing: border-box;
|
| 2834 |
-
-o-box-sizing: border-box;
|
| 2835 |
-
-ms-box-sizing: border-box;
|
| 2836 |
-
box-sizing: border-box;
|
| 2837 |
-
}
|
| 2838 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr label { width: auto; }
|
| 2839 |
-
|
| 2840 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .social_icon_like1 ul { margin-left: 15px}
|
| 2841 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .social_icon_like1 li { width: auto; max-width: auto; min-width: auto; margin: 0 50px 0 0 }
|
| 2842 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .usually > li { width:85% !important; max-width: 100% !important; margin-left: 70px; font-family: 'helveticaneue-light'; padding-bottom: 5px}
|
| 2843 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .options > label { width:356px !important; margin:0; width: auto; margin-bottom: 0; margin-top: 0px; }
|
| 2844 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options .first.chcklbl { float: left !important; width: 335px !important; }
|
| 2845 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options .chckwpr { width:400px; float:right; }
|
| 2846 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options {
|
| 2847 |
-
width:90%;
|
| 2848 |
-
margin:0;
|
| 2849 |
-
font-family: 'helveticaneue-light';
|
| 2850 |
-
float: left;
|
| 2851 |
-
margin-bottom: 10px;
|
| 2852 |
-
max-width: 895px;
|
| 2853 |
-
border-left: none;
|
| 2854 |
-
}
|
| 2855 |
-
.sfsiplus_toggleonlystndrshrng { margin-bottom: 30px !important}
|
| 2856 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options.shareicontextfld { margin: 15px 0; }
|
| 2857 |
-
.tab8 .sfsiplus_tab_3_icns.flthmonpg .radio { margin-top:55px !important; }
|
| 2858 |
-
.tab8 .radiodisplaysection { float: left;}
|
| 2859 |
-
|
| 2860 |
-
|
| 2861 |
-
|
| 2862 |
-
/*palak css end*/
|
| 2863 |
-
/*modify by palak*/
|
| 2864 |
-
.tab8 ul.sfsiplus_icn_listing8 li {
|
| 2865 |
-
float: left;
|
| 2866 |
-
padding: 11px 0 40px 8px;
|
| 2867 |
-
width: 100%;
|
| 2868 |
-
max-width: 1000px;
|
| 2869 |
-
margin: 0
|
| 2870 |
-
}
|
| 2871 |
-
.sfsiplusplacethemanulywpr { max-width: 98% !important}
|
| 2872 |
-
|
| 2873 |
-
/*modify by palak*/
|
| 2874 |
-
/*modify by palak*/
|
| 2875 |
-
.tab8 ul.sfsiplus_icn_listing8 {
|
| 2876 |
-
list-style: outside none none;
|
| 2877 |
-
margin: 5px 0 0;
|
| 2878 |
-
overflow: hidden;
|
| 2879 |
-
}
|
| 2880 |
-
/*modify by palak*/
|
| 2881 |
-
.sfsiplus_right_info label.sfsiplus_sub-subtitle
|
| 2882 |
-
{
|
| 2883 |
-
font-size: 16px !important;
|
| 2884 |
-
font-weight: normal;
|
| 2885 |
-
}
|
| 2886 |
-
ul.plus_icn_listing li .sfsiplus_right_info label.sfsiplus_sub-subtitle a
|
| 2887 |
-
{
|
| 2888 |
-
font-size: 13px;
|
| 2889 |
-
}
|
| 2890 |
-
.tab8 ul.sfsiplus_tab_3_icns li .radio {
|
| 2891 |
-
margin-top: 7px;
|
| 2892 |
-
}
|
| 2893 |
-
|
| 2894 |
-
.tab8 ul.sfsiplus_tab_3_icns li label {
|
| 2895 |
-
line-height: 50px !important;
|
| 2896 |
-
}
|
| 2897 |
-
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns li {
|
| 2898 |
-
width: 50%;
|
| 2899 |
-
max-width: 450px;
|
| 2900 |
-
min-width: 420px;
|
| 2901 |
-
padding-left: 0;
|
| 2902 |
-
padding-bottom: 15px
|
| 2903 |
-
}
|
| 2904 |
-
|
| 2905 |
-
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr>li:nth-child(1),
|
| 2906 |
-
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr>li:nth-child(2) { width: 50% !important}
|
| 2907 |
-
.space.disblfltonmbl p.list { width: 100%; margin-bottom: 28px}
|
| 2908 |
-
|
| 2909 |
-
|
| 2910 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p { display: table}
|
| 2911 |
-
|
| 2912 |
-
/*modify by palak*/
|
| 2913 |
-
.tab8 .row
|
| 2914 |
-
{
|
| 2915 |
-
clear: both;
|
| 2916 |
-
display: block;
|
| 2917 |
-
float: left;
|
| 2918 |
-
font-family: helveticaregular;
|
| 2919 |
-
line-height: 42px;
|
| 2920 |
-
margin-top: 25px;
|
| 2921 |
-
padding-top: 15px;
|
| 2922 |
-
width: 100%;
|
| 2923 |
-
}
|
| 2924 |
-
/*modify by palak*/
|
| 2925 |
-
.tab8 .icons_size { margin-top: -12px; }
|
| 2926 |
-
.tab8 .icons_size { position: relative; font-family: 'helveticaneue-light'; width: 538px; float: right }
|
| 2927 |
-
.tab8 .icons_size span {
|
| 2928 |
-
display: block;
|
| 2929 |
-
float: left;
|
| 2930 |
-
font-size: 20px;
|
| 2931 |
-
font-weight: 400;
|
| 2932 |
-
line-height: 42px;
|
| 2933 |
-
margin-right: 18px;
|
| 2934 |
-
}
|
| 2935 |
-
|
| 2936 |
-
.tab8.icons_size span.last
|
| 2937 |
-
{
|
| 2938 |
-
margin-left: 55px;
|
| 2939 |
-
}
|
| 2940 |
-
.tab8 .icons_size ins
|
| 2941 |
-
{
|
| 2942 |
-
float: left;
|
| 2943 |
-
font-size: 17px;
|
| 2944 |
-
font-weight: 400;
|
| 2945 |
-
margin-right: 25px;
|
| 2946 |
-
text-decoration: none;
|
| 2947 |
-
margin-bottom: 20px;
|
| 2948 |
-
}
|
| 2949 |
-
.tab8 .social_icon_like1 {
|
| 2950 |
-
float: left;
|
| 2951 |
-
margin: 0;
|
| 2952 |
-
padding: 30px 0 0;
|
| 2953 |
-
text-align: center;
|
| 2954 |
-
width: 100%;
|
| 2955 |
-
}
|
| 2956 |
-
.tab8 .social_icon_like1 ul {
|
| 2957 |
-
list-style: outside none none;
|
| 2958 |
-
margin: 0;
|
| 2959 |
-
padding: 0;
|
| 2960 |
-
text-align: center;
|
| 2961 |
-
}
|
| 2962 |
-
.tab8 .social_icon_like1 li {
|
| 2963 |
-
display: inline-block;
|
| 2964 |
-
list-style: outside none none;
|
| 2965 |
-
margin: 0 0 0 45px !important;
|
| 2966 |
-
padding: 0;
|
| 2967 |
-
width: auto !important;
|
| 2968 |
-
min-width: 100px !important;
|
| 2969 |
-
}
|
| 2970 |
-
.tab8 .social_icon_like1 li a {
|
| 2971 |
-
color: #5a6570;
|
| 2972 |
-
display: block;
|
| 2973 |
-
text-decoration: none;
|
| 2974 |
-
}
|
| 2975 |
-
.tab8 .social_icon_like1 li img {
|
| 2976 |
-
display: block;
|
| 2977 |
-
float: left;
|
| 2978 |
-
margin-right: 5px;
|
| 2979 |
-
}
|
| 2980 |
-
.tab8 ul.usually {
|
| 2981 |
-
list-style: outside none none;
|
| 2982 |
-
margin: 28px 0 15px 60px;
|
| 2983 |
-
padding: 0;
|
| 2984 |
-
float: left
|
| 2985 |
-
}
|
| 2986 |
-
.tab8 ul.usually li {
|
| 2987 |
-
font-size: 17px;
|
| 2988 |
-
list-style: outside none none;
|
| 2989 |
-
margin: 0;
|
| 2990 |
-
padding: 0;
|
| 2991 |
-
text-align: left;
|
| 2992 |
-
width: auto;
|
| 2993 |
-
}
|
| 2994 |
-
.tab8 ul.enough_waffling {
|
| 2995 |
-
list-style: outside none none;
|
| 2996 |
-
margin: 25px 0 0;
|
| 2997 |
-
padding: 0;
|
| 2998 |
-
text-align: center;
|
| 2999 |
-
}
|
| 3000 |
-
.tab8 ul.enough_waffling li {
|
| 3001 |
-
display: inline-block;
|
| 3002 |
-
list-style: outside none none;
|
| 3003 |
-
margin: 0 22px;
|
| 3004 |
-
padding: 0;
|
| 3005 |
-
}
|
| 3006 |
-
.tab8 ul.enough_waffling li span {
|
| 3007 |
-
float: left;
|
| 3008 |
-
}
|
| 3009 |
-
.tab8 ul.enough_waffling li label {
|
| 3010 |
-
color: #5a6570;
|
| 3011 |
-
float: left;
|
| 3012 |
-
font-family: helveticaregular;
|
| 3013 |
-
font-size: 18px;
|
| 3014 |
-
font-weight: 400;
|
| 3015 |
-
line-height: 38px;
|
| 3016 |
-
margin: 0 0 0 20px;
|
| 3017 |
-
text-align: center;
|
| 3018 |
-
}
|
| 3019 |
-
/*modify by palak*/
|
| 3020 |
-
.tab8 .row {
|
| 3021 |
-
clear: both;
|
| 3022 |
-
display: block;
|
| 3023 |
-
float: left;
|
| 3024 |
-
font-family: helveticaregular;
|
| 3025 |
-
line-height: 42px;
|
| 3026 |
-
margin-top: 0px;
|
| 3027 |
-
padding-top: 10px;
|
| 3028 |
-
width: 100%;
|
| 3029 |
-
}
|
| 3030 |
-
/*modify by palak*/
|
| 3031 |
-
.tab8 .options {
|
| 3032 |
-
clear: both;
|
| 3033 |
-
float: left;
|
| 3034 |
-
margin-top: 25px;
|
| 3035 |
-
width: auto;
|
| 3036 |
-
float: none;
|
| 3037 |
-
}
|
| 3038 |
-
.tab8 .options label.first {
|
| 3039 |
-
font-family: 'helveticaneue-light';
|
| 3040 |
-
font-size: 18px;
|
| 3041 |
-
}
|
| 3042 |
-
.tab8 .options label {
|
| 3043 |
-
color: #5a6570;
|
| 3044 |
-
float: left;
|
| 3045 |
-
font-family: 'helveticaneue-light';
|
| 3046 |
-
font-size: 18px;
|
| 3047 |
-
line-height: 46px;
|
| 3048 |
-
width: 345px;
|
| 3049 |
-
}
|
| 3050 |
-
.tab8 .options input {
|
| 3051 |
-
background: none repeat scroll 0 0 #e5e5e5;
|
| 3052 |
-
border: 0 none;
|
| 3053 |
-
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 3054 |
-
float: left;
|
| 3055 |
-
padding: 10px;
|
| 3056 |
-
width: 308px;
|
| 3057 |
-
}
|
| 3058 |
-
.tab8 .options .field {
|
| 3059 |
-
float: left;
|
| 3060 |
-
position: relative;
|
| 3061 |
-
width: 223px;
|
| 3062 |
-
}
|
| 3063 |
-
.tab8 .options .field .select {
|
| 3064 |
-
background: url(../images/select_bg1.jpg) no-repeat scroll 0 0 rgba(0, 0, 0, 0);
|
| 3065 |
-
display: block;
|
| 3066 |
-
font-family: helveticaregular;
|
| 3067 |
-
padding-left: 17px;
|
| 3068 |
-
width: 207px;
|
| 3069 |
-
}
|
| 3070 |
-
.tab8 .options .field select.styled {
|
| 3071 |
-
height: 46px;
|
| 3072 |
-
left: 0;
|
| 3073 |
-
line-height: 46px;
|
| 3074 |
-
position: absolute;
|
| 3075 |
-
top: 0;
|
| 3076 |
-
width: 213px;
|
| 3077 |
-
}
|
| 3078 |
-
.tab8 .options .field select.styled {
|
| 3079 |
-
line-height: 46px;
|
| 3080 |
-
}
|
| 3081 |
-
.tab8 ul.sfsiplus_icn_listing8 li .snglchckcntr .sfsiplus_right_info {
|
| 3082 |
-
float: left;
|
| 3083 |
-
margin-right: 0;
|
| 3084 |
-
text-align: left;
|
| 3085 |
-
width: auto;
|
| 3086 |
-
font-family: 'helveticaneue-light';
|
| 3087 |
-
font-size: 18px;
|
| 3088 |
-
line-height: 30px;
|
| 3089 |
-
}
|
| 3090 |
-
.chckwpr .snglchckcntr:first-child { float:left; }
|
| 3091 |
-
.chckwpr .snglchckcntr:last-child { float:left; margin-left: 110px; }
|
| 3092 |
-
.chckwpr
|
| 3093 |
-
{
|
| 3094 |
-
width:100%;
|
| 3095 |
-
float:left;
|
| 3096 |
-
}
|
| 3097 |
-
.cstmutbchnlidwpr .utbe_instruction,.cstmutbchnlnmewpr .utbe_instruction, .lnkdin_instruction {
|
| 3098 |
-
float: left;
|
| 3099 |
-
line-height: 22px;
|
| 3100 |
-
margin-top: 10px;
|
| 3101 |
-
width: 100%;
|
| 3102 |
-
}
|
| 3103 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p
|
| 3104 |
-
{
|
| 3105 |
-
font-size: 20px;
|
| 3106 |
-
}
|
| 3107 |
-
#accordion .tab8 ul.sfsiplus_tab_3_icns { margin-top: 25px; }
|
| 3108 |
-
#accordion .tab8 ul.sfsiplus_tab_3_icns.flthmonpg { margin-left: 45px}
|
| 3109 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisplaysharingtxt { padding-top: 5px; display: inline;}
|
| 3110 |
-
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .labelhdng4,
|
| 3111 |
-
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .row h4.labelhdng4 { color: #555; font-size: 20px; margin-left: 20px; font-family: 'helveticaregular'}
|
| 3112 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row.sfsiplus_PostsSettings_section { border-left: 105px solid transparent; float: left; padding-top: 0}
|
| 3113 |
-
.sfsiplus_toggleonlystndrshrng { margin-bottom: 0 !important}
|
| 3114 |
-
.radiodisplaysection { float: left}
|
| 3115 |
-
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row.sfsiplus_PostsSettings_section>.labelhdng4 { margin-bottom: 20px !important}
|
| 3116 |
-
.sfsiplus_shwthmbfraftr { margin-top: 5px !important}
|
| 3117 |
-
label.sfsiplus_toglpstpgsbttl { float: left; margin-top: 5px !important}
|
| 3118 |
-
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .row h4 {
|
| 3119 |
-
font-family: 'helveticaneue-light';
|
| 3120 |
-
font-weight: normal;
|
| 3121 |
-
font-size: 18px;
|
| 3122 |
-
color: #69737c;
|
| 3123 |
-
float: left
|
| 3124 |
-
}
|
| 3125 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options .seconds.chcklbl { float: right; width: 400px !important; }
|
| 3126 |
-
.sfsibeforpstwpr
|
| 3127 |
-
{
|
| 3128 |
-
width: 100%;
|
| 3129 |
-
float: left;
|
| 3130 |
-
line-height: 18px;
|
| 3131 |
-
margin: 5px 0;
|
| 3132 |
-
}
|
| 3133 |
-
.sfsiaftrpstwpr
|
| 3134 |
-
{
|
| 3135 |
-
width: 100%;
|
| 3136 |
-
float: left;
|
| 3137 |
-
line-height: 18px;
|
| 3138 |
-
margin: 5px 0;
|
| 3139 |
-
}
|
| 3140 |
-
.sfsibeforpstwpr .sfsi_plus_Sicons span
|
| 3141 |
-
{
|
| 3142 |
-
font-size: 20px;
|
| 3143 |
-
}
|
| 3144 |
-
.sfsiaftrpstwpr .sfsi_plus_Sicons span
|
| 3145 |
-
{
|
| 3146 |
-
font-size: 20px;
|
| 3147 |
-
}
|
| 3148 |
-
.sfsibeforpstwpr .sfsi_plus_Sicons
|
| 3149 |
-
{
|
| 3150 |
-
|
| 3151 |
-
}
|
| 3152 |
-
.sfsiaftrpstwpr .sfsi_plus_Sicons
|
| 3153 |
-
{
|
| 3154 |
-
|
| 3155 |
-
}
|
| 3156 |
-
.sfsibeforpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr
|
| 3157 |
-
{
|
| 3158 |
-
width: auto;
|
| 3159 |
-
float: left;
|
| 3160 |
-
}
|
| 3161 |
-
.sfsiaftrpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr
|
| 3162 |
-
{
|
| 3163 |
-
width: auto;
|
| 3164 |
-
float: left;
|
| 3165 |
-
}
|
| 3166 |
-
.sfsibeforpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr .sfsi_plus_wicons
|
| 3167 |
-
{
|
| 3168 |
-
float: left;
|
| 3169 |
-
}
|
| 3170 |
-
.sfsiaftrpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr .sfsi_plus_wicons
|
| 3171 |
-
{
|
| 3172 |
-
float: left;
|
| 3173 |
-
}
|
| 3174 |
-
.sfsi_flicnsoptn3
|
| 3175 |
-
{
|
| 3176 |
-
color: #69737c;
|
| 3177 |
-
float: left;
|
| 3178 |
-
font-size: 20px;
|
| 3179 |
-
margin: 62px 5px 0 20px;
|
| 3180 |
-
font-family: 'helveticaneue-light';
|
| 3181 |
-
|
| 3182 |
-
width: 120px;
|
| 3183 |
-
}
|
| 3184 |
-
|
| 3185 |
-
.sfsi_ckckslctnlbl
|
| 3186 |
-
{
|
| 3187 |
-
font-weight: bold;
|
| 3188 |
-
}
|
| 3189 |
-
.sfsibeforpstwpr iframe{max-width: none; vertical-align: middle;}
|
| 3190 |
-
.sfsiaftrpstwpr iframe{max-width: none; vertical-align: middle;}
|
| 3191 |
-
.sfwp_fivestar_ul li { display: inline-block; padding-right: 20px; }
|
| 3192 |
-
.fb_iframe_widget iframe
|
| 3193 |
-
{
|
| 3194 |
-
max-width: none;
|
| 3195 |
-
}
|
| 3196 |
-
.sfsi_mainContainer p.bldtxtmsg{float: left; font-size: 15px; /*font-weight: bold;*/ margin-top: 12px; width: 100%;}
|
| 3197 |
-
.sfsi_mainContainer p.translatelilne{float: left; font-size: 15px; font-weight: bold;color: black; margin-top: 12px; width: 100%;}
|
| 3198 |
-
.sfsiplus_icn_listing8 li > div{width: auto; float: left;}
|
| 3199 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng
|
| 3200 |
-
{
|
| 3201 |
-
padding-bottom: 30px;
|
| 3202 |
-
float: left;
|
| 3203 |
-
}
|
| 3204 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng
|
| 3205 |
-
{
|
| 3206 |
-
background: medium none;
|
| 3207 |
-
}
|
| 3208 |
-
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng code
|
| 3209 |
-
{
|
| 3210 |
-
background: none repeat scroll 0 0 transparent;
|
| 3211 |
-
padding-left: 0px;
|
| 3212 |
-
padding-right: 0px;
|
| 3213 |
-
}
|
| 3214 |
-
.options.sfsipluspstvwpr {
|
| 3215 |
-
margin-left: 17% !important;
|
| 3216 |
-
margin-left: 0% !important;
|
| 3217 |
-
}
|
| 3218 |
-
.tab8 .row.sfsiplus_PostsSettings_section .options.sfsipluspstvwpr .first.chcklbl
|
| 3219 |
-
{
|
| 3220 |
-
width: 180px !important;
|
| 3221 |
-
}
|
| 3222 |
-
.sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr {
|
| 3223 |
-
overflow: visible;
|
| 3224 |
-
}
|
| 3225 |
-
/*.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1{margin: 2px 35px 2px !important;clear:both;}*/
|
| 3226 |
-
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a img{margin: 2px 12px 2px !important;clear:both;text-align:center;float:none;}
|
| 3227 |
-
.cstmicon1{text-align:center;}
|
| 3228 |
-
.sfsi_plus_Sicons img, #sfsiplusid_facebook img, #sfsiplusid_google img, #sfsiplusid_twitter img { height: 20px;}
|
| 3229 |
-
|
| 3230 |
-
.sfsi_plus_wicons a.sficn, .sfsi_plus_wicons .sfsi_plus_inside a, .sfsi_plus_Sicons div a
|
| 3231 |
-
{
|
| 3232 |
-
box-shadow: none;
|
| 3233 |
-
border: none;
|
| 3234 |
-
}
|
| 3235 |
-
|
| 3236 |
-
.sfsi_plus_Sicons .sf_pinit
|
| 3237 |
-
{
|
| 3238 |
-
margin-right: 4px;
|
| 3239 |
-
}
|
| 3240 |
-
.sfsi_plus_Sicons .sf_pinit > span
|
| 3241 |
-
{
|
| 3242 |
-
height: 22px !important;
|
| 3243 |
-
vertical-align: middle;
|
| 3244 |
-
}
|
| 3245 |
-
.sfsi_plus_Sicons .sf_pinit > span
|
| 3246 |
-
{
|
| 3247 |
-
height: 20px !important;
|
| 3248 |
-
vertical-align: middle;
|
| 3249 |
-
}
|
| 3250 |
-
|
| 3251 |
-
/*.sfsi_plus_Sicons .sf_pinit > span > span
|
| 3252 |
-
{
|
| 3253 |
-
display: inline-block;
|
| 3254 |
-
width: 47px !important;
|
| 3255 |
-
position: relative !important;
|
| 3256 |
-
margin-left: 40px;
|
| 3257 |
-
vertical-align: top;
|
| 3258 |
-
right: 0 !important;
|
| 3259 |
-
}*/
|
| 3260 |
-
.sfsibeforpstwpr .sfsi_plus_Sicons .sf_pinit span{font-size:11px !important;}
|
| 3261 |
-
.sfsiaftrpstwpr .sfsi_plus_Sicons .sf_pinit span{font-size:11px !important;}
|
| 3262 |
-
.sfsibeforpstwpr .sfsi_plus_Sicons .sfsi_plus_inside .icon2 span{font-size:11px !important;}
|
| 3263 |
-
.sfsiaftrpstwpr .sfsi_plus_Sicons .sfsi_plus_inside .icon2 span{font-size:11px !important;}
|
| 3264 |
.sfsi_plus_wicons a {box-shadow: none !important;}
|
| 1 |
+
@charset "utf-8";
|
| 2 |
+
@font-face {
|
| 3 |
+
font-family: helveticabold;
|
| 4 |
+
src: url(fonts/helvetica_bold_0-webfont.eot);
|
| 5 |
+
src: url(fonts/helvetica_bold_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_bold_0-webfont.woff) format('woff'), url(fonts/helvetica_bold_0-webfont.ttf) format('truetype'), url(fonts/helvetica_bold_0-webfont.svg#helveticabold) format('svg');
|
| 6 |
+
font-weight: 400;
|
| 7 |
+
font-style: normal;
|
| 8 |
+
}
|
| 9 |
+
@font-face {
|
| 10 |
+
font-family: helveticaregular;
|
| 11 |
+
src: url(fonts/helvetica_0-webfont.eot);
|
| 12 |
+
src: url(fonts/helvetica_0-webfont.eot?#iefix) format('embedded-opentype'), url(fonts/helvetica_0-webfont.woff) format('woff'), url(fonts/helvetica_0-webfont.ttf) format('truetype'), url(fonts/helvetica_0-webfont.svg#helveticaregular) format('svg');
|
| 13 |
+
font-weight: 400;
|
| 14 |
+
font-style: normal;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
@font-face {
|
| 18 |
+
font-family: helveticaneue-light;
|
| 19 |
+
src: url(fonts/helveticaneue-light.eot);
|
| 20 |
+
src: url(fonts/helveticaneue-light.eot?#iefix) format('embedded-opentype'),
|
| 21 |
+
url(fonts/helveticaneue-light.woff) format('woff'),
|
| 22 |
+
url(fonts/helveticaneue-light.ttf) format('truetype'),
|
| 23 |
+
url(fonts/helveticaneue-light.svg#helveticaneue-light) format('svg');
|
| 24 |
+
font-weight: 400;
|
| 25 |
+
font-style: normal;
|
| 26 |
+
}
|
| 27 |
+
body {
|
| 28 |
+
margin: 0;
|
| 29 |
+
padding: 0;
|
| 30 |
+
}
|
| 31 |
+
.clear {
|
| 32 |
+
clear: both;
|
| 33 |
+
}
|
| 34 |
+
.space {
|
| 35 |
+
clear: both;
|
| 36 |
+
padding: 30px 0 0;
|
| 37 |
+
width: 100%;
|
| 38 |
+
float: left;
|
| 39 |
+
}
|
| 40 |
+
.sfsi_mainContainer {
|
| 41 |
+
font-family: helveticaregular;
|
| 42 |
+
}
|
| 43 |
+
.sfsi_mainContainer h1, .sfsi_mainContainer h2, .sfsi_mainContainer h3, .sfsi_mainContainer h4, .sfsi_mainContainer h5, .sfsi_mainContainer h6, .sfsi_mainContainer li, .sfsi_mainContainer p, .sfsi_mainContainer ul {
|
| 44 |
+
margin: 0;
|
| 45 |
+
padding: 0;
|
| 46 |
+
font-weight: 400;
|
| 47 |
+
}
|
| 48 |
+
.sfsi_mainContainer img {
|
| 49 |
+
border: 0;
|
| 50 |
+
}
|
| 51 |
+
.main_contant p, .ui-accordion .ui-accordion-header {
|
| 52 |
+
font-family: 'helveticaneue-light';
|
| 53 |
+
}
|
| 54 |
+
.sfsi_mainContainer input, .sfsi_mainContainer select {
|
| 55 |
+
outline: 0;
|
| 56 |
+
}
|
| 57 |
+
.wapper {
|
| 58 |
+
padding: 48px 106px 40px 20px;
|
| 59 |
+
display: block;
|
| 60 |
+
background: #f1f1f1;
|
| 61 |
+
}
|
| 62 |
+
.main_contant {
|
| 63 |
+
margin: 0;
|
| 64 |
+
padding: 0;
|
| 65 |
+
}
|
| 66 |
+
.main_contant h1 {
|
| 67 |
+
padding: 0;
|
| 68 |
+
color: #1a1d20;
|
| 69 |
+
font-family: helveticabold;
|
| 70 |
+
font-size: 28px;
|
| 71 |
+
}
|
| 72 |
+
.main_contant p {
|
| 73 |
+
padding: 0;
|
| 74 |
+
color: #414951;
|
| 75 |
+
font-size: 17px;
|
| 76 |
+
line-height: 26px;
|
| 77 |
+
}
|
| 78 |
+
.main_contant p span {
|
| 79 |
+
text-decoration: underline;
|
| 80 |
+
font-family: helveticabold;
|
| 81 |
+
}
|
| 82 |
+
.like_txt {
|
| 83 |
+
margin: 30px 0 0;
|
| 84 |
+
padding: 0;
|
| 85 |
+
color: #12a252;
|
| 86 |
+
font-family: helveticaregular;
|
| 87 |
+
font-size: 20px;
|
| 88 |
+
line-height: 20px;
|
| 89 |
+
text-align: center;
|
| 90 |
+
}
|
| 91 |
+
.like_txt a {
|
| 92 |
+
color: #12a252;
|
| 93 |
+
}
|
| 94 |
+
#accordion p, #accordion1 p {
|
| 95 |
+
color: #5a6570;
|
| 96 |
+
text-align: left;
|
| 97 |
+
font-family: 'helveticaneue-light';
|
| 98 |
+
font-size: 17px;
|
| 99 |
+
line-height: 26px;
|
| 100 |
+
padding-top: 19px;
|
| 101 |
+
}
|
| 102 |
+
.sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .cstmdisplaysharingtxt { float: left; }
|
| 103 |
+
#accordion p:first-child, #accordion1 p:first-child {
|
| 104 |
+
padding-top: 0;
|
| 105 |
+
}
|
| 106 |
+
#accordion h4, #accordion1 h4 {
|
| 107 |
+
margin: 0;
|
| 108 |
+
padding: 30px 0 0;
|
| 109 |
+
color: #414951;
|
| 110 |
+
font-size: 20px;
|
| 111 |
+
line-height: 22px;
|
| 112 |
+
font-family: helveticaregular;
|
| 113 |
+
}
|
| 114 |
+
#accordion h4:first-child, #accordion1 h4:first-child {
|
| 115 |
+
padding-top: 0;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
#accordion .tab8 h4:first-child, #accordion1 h4:first-child { margin-left: 0 !important}
|
| 119 |
+
|
| 120 |
+
.tab1, .tab2, .tab3, .tab4, .tab5, .tab6, .tab7 {
|
| 121 |
+
color: #5a6570;
|
| 122 |
+
text-align: left;
|
| 123 |
+
font-family: helveticaregular;
|
| 124 |
+
font-size: 18px;
|
| 125 |
+
line-height: 26px;
|
| 126 |
+
}
|
| 127 |
+
.tab4 ul.like_icon {
|
| 128 |
+
margin: 0;
|
| 129 |
+
padding: 20px 0 0;
|
| 130 |
+
list-style: none;
|
| 131 |
+
text-align: center;
|
| 132 |
+
}
|
| 133 |
+
.tab4 ul.like_icon li {
|
| 134 |
+
margin: 0;
|
| 135 |
+
padding: 0;
|
| 136 |
+
list-style: none;
|
| 137 |
+
display: inline-block;
|
| 138 |
+
}
|
| 139 |
+
.tab4 ul.like_icon li span {
|
| 140 |
+
margin: 0;
|
| 141 |
+
width: 54px;
|
| 142 |
+
display: block;
|
| 143 |
+
background: url(../images/count_bg.png) no-repeat;
|
| 144 |
+
height: 24px;
|
| 145 |
+
overflow: hidden;
|
| 146 |
+
padding: 10px 2px 2px;
|
| 147 |
+
font-size: 17px;
|
| 148 |
+
text-align: center;
|
| 149 |
+
line-height: 24px;
|
| 150 |
+
color: #5a6570;
|
| 151 |
+
}
|
| 152 |
+
.tab4 ul.like_icon li a {
|
| 153 |
+
color: #5a6570;
|
| 154 |
+
text-decoration: none;
|
| 155 |
+
}
|
| 156 |
+
.tab4 ul.enough_waffling {
|
| 157 |
+
margin: 0;
|
| 158 |
+
padding: 25px 0 27px;
|
| 159 |
+
list-style: none;
|
| 160 |
+
text-align: center;
|
| 161 |
+
}
|
| 162 |
+
.tab4 ul.enough_waffling li {
|
| 163 |
+
margin: 0 22px;
|
| 164 |
+
padding: 0;
|
| 165 |
+
list-style: none;
|
| 166 |
+
display: inline-block;
|
| 167 |
+
}
|
| 168 |
+
.tab4 ul.enough_waffling li span {
|
| 169 |
+
float: left;
|
| 170 |
+
}
|
| 171 |
+
.tab4 ul.enough_waffling li label {
|
| 172 |
+
margin: 0 0 0 20px;
|
| 173 |
+
float: left;
|
| 174 |
+
font-family: helveticaregular;
|
| 175 |
+
font-size: 18px;
|
| 176 |
+
font-weight: 400;
|
| 177 |
+
text-align: center;
|
| 178 |
+
line-height: 38px;
|
| 179 |
+
color: #5a6570;
|
| 180 |
+
}
|
| 181 |
+
.sfsi_mainContainer .checkbox {
|
| 182 |
+
width: 31px;
|
| 183 |
+
height: 31px;
|
| 184 |
+
background: url(../images/check_bg.jpg) no-repeat;
|
| 185 |
+
display: inherit;
|
| 186 |
+
}
|
| 187 |
+
.tab8 .social_icon_like1 li span.checkbox {
|
| 188 |
+
width: 31px;
|
| 189 |
+
height: 31px;
|
| 190 |
+
background: url(../images/check_bg.jpg) no-repeat;
|
| 191 |
+
display: inherit;
|
| 192 |
+
}
|
| 193 |
+
.tab8 .social_icon_like1 li a
|
| 194 |
+
{
|
| 195 |
+
float: left;
|
| 196 |
+
}
|
| 197 |
+
.sfsi_mainContainer .radio {
|
| 198 |
+
width: 40px;
|
| 199 |
+
height: 40px;
|
| 200 |
+
background: url(../images/radio_bg.png) no-repeat;
|
| 201 |
+
display: inherit;
|
| 202 |
+
}
|
| 203 |
+
.sfsi_mainContainer .select {
|
| 204 |
+
width: 127px;
|
| 205 |
+
height: 47px;
|
| 206 |
+
font-size: 17px;
|
| 207 |
+
background: url(../images/select_bg.jpg) no-repeat;
|
| 208 |
+
display: block;
|
| 209 |
+
padding-left: 16px;
|
| 210 |
+
line-height: 49px;
|
| 211 |
+
}
|
| 212 |
+
.sfsi_mainContainer .line {
|
| 213 |
+
background: #eaebee;
|
| 214 |
+
height: 1px;
|
| 215 |
+
font-size: 0;
|
| 216 |
+
margin: 15px 0 0;
|
| 217 |
+
clear: both;
|
| 218 |
+
width: 100%;
|
| 219 |
+
float: left;
|
| 220 |
+
}
|
| 221 |
+
.sfsiplus_specify_counts {
|
| 222 |
+
display: block;
|
| 223 |
+
margin-top: 15px;
|
| 224 |
+
padding-top: 15px;
|
| 225 |
+
clear: both;
|
| 226 |
+
width: 100%;
|
| 227 |
+
float: left;
|
| 228 |
+
border-top: 1px solid #eaebee;
|
| 229 |
+
}
|
| 230 |
+
.sfsiplus_specify_counts .radio_section {
|
| 231 |
+
width: 30px;
|
| 232 |
+
float: left;
|
| 233 |
+
margin: 12px 10px 0 0;
|
| 234 |
+
}
|
| 235 |
+
.sfsiplus_specify_counts .social_icon_like {
|
| 236 |
+
width: 54px;
|
| 237 |
+
float: left;
|
| 238 |
+
margin: 0 15px 0 0;
|
| 239 |
+
}
|
| 240 |
+
.sfsiplus_specify_counts .social_icon_like ul {
|
| 241 |
+
margin: 0;
|
| 242 |
+
padding: 0 !important;
|
| 243 |
+
list-style: none;
|
| 244 |
+
text-align: center;
|
| 245 |
+
}
|
| 246 |
+
.sfsiplus_specify_counts .social_icon_like li {
|
| 247 |
+
margin: 0;
|
| 248 |
+
padding: 0;
|
| 249 |
+
list-style: none;
|
| 250 |
+
display: inline-block;
|
| 251 |
+
}
|
| 252 |
+
.sfsiplus_specify_counts .social_icon_like li span {
|
| 253 |
+
margin: 0;
|
| 254 |
+
width: 54px;
|
| 255 |
+
display: block;
|
| 256 |
+
background: url(../images/count_bg.jpg) no-repeat;
|
| 257 |
+
height: 24px;
|
| 258 |
+
overflow: hidden;
|
| 259 |
+
padding: 10px 2px 2px;
|
| 260 |
+
font-family: helveticaregular;
|
| 261 |
+
font-size: 16px;
|
| 262 |
+
text-align: center;
|
| 263 |
+
line-height: 24px;
|
| 264 |
+
color: #5a6570;
|
| 265 |
+
}
|
| 266 |
+
.sfsiplus_specify_counts .social_icon_like li a {
|
| 267 |
+
color: #5a6570;
|
| 268 |
+
text-decoration: none;
|
| 269 |
+
}
|
| 270 |
+
.sfsiplus_specify_counts .listing {
|
| 271 |
+
width: 88%;
|
| 272 |
+
margin-top: -5px;
|
| 273 |
+
display: inherit;
|
| 274 |
+
float: left;
|
| 275 |
+
}
|
| 276 |
+
.sfsiplus_specify_counts .listing ul {
|
| 277 |
+
margin: 0;
|
| 278 |
+
padding: 0;
|
| 279 |
+
list-style: none;
|
| 280 |
+
text-align: left;
|
| 281 |
+
}
|
| 282 |
+
.sfsiplus_specify_counts .listing li {
|
| 283 |
+
margin: 15px 0 0;
|
| 284 |
+
padding: 0;
|
| 285 |
+
list-style: none;
|
| 286 |
+
clear: both;
|
| 287 |
+
line-height: 39px;
|
| 288 |
+
font-size: 17px;
|
| 289 |
+
}
|
| 290 |
+
.sfsiplus_specify_counts .listing li span {
|
| 291 |
+
float: left;
|
| 292 |
+
margin-right: 20px;
|
| 293 |
+
}
|
| 294 |
+
.sfsiplus_specify_counts .listing li .input {
|
| 295 |
+
background: #e5e5e5;
|
| 296 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 297 |
+
border: 0;
|
| 298 |
+
padding: 10px;
|
| 299 |
+
margin-left: 25px;
|
| 300 |
+
}
|
| 301 |
+
.sfsiplus_specify_counts .listing li .input_facebook {
|
| 302 |
+
width: 288px;
|
| 303 |
+
background: #e5e5e5;
|
| 304 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 305 |
+
border: 0;
|
| 306 |
+
padding: 10px;
|
| 307 |
+
margin-left: 16px;
|
| 308 |
+
}
|
| 309 |
+
.save_button {
|
| 310 |
+
width: 450px;
|
| 311 |
+
padding-top: 30px !important;
|
| 312 |
+
clear: both;
|
| 313 |
+
margin: auto;
|
| 314 |
+
}
|
| 315 |
+
.save_button a {
|
| 316 |
+
background: #12a252;
|
| 317 |
+
text-align: center;
|
| 318 |
+
font-size: 23px;
|
| 319 |
+
color: #FFF!important;
|
| 320 |
+
display: block;
|
| 321 |
+
padding: 11px 0;
|
| 322 |
+
text-decoration: none;
|
| 323 |
+
}
|
| 324 |
+
.save_button a:hover { background:#079345 }
|
| 325 |
+
|
| 326 |
+
.tab5 ul.plus_share_icon_order {
|
| 327 |
+
margin: 0;
|
| 328 |
+
padding: 0;
|
| 329 |
+
list-style: none;
|
| 330 |
+
text-align: left;
|
| 331 |
+
}
|
| 332 |
+
.tab5 ul.plus_share_icon_order li {
|
| 333 |
+
margin: 22px 6px 0 0;
|
| 334 |
+
padding: 0;
|
| 335 |
+
list-style: none;
|
| 336 |
+
float: left;
|
| 337 |
+
line-height: 37px;
|
| 338 |
+
}
|
| 339 |
+
.tab5 ul.plus_share_icon_order li:last-child {
|
| 340 |
+
margin: 22px 0 0 3px;
|
| 341 |
+
}
|
| 342 |
+
.tab5 .row {
|
| 343 |
+
border-top: 1px solid #eaebee;
|
| 344 |
+
margin-top: 25px;
|
| 345 |
+
padding-top: 15px;
|
| 346 |
+
clear: both;
|
| 347 |
+
display: block;
|
| 348 |
+
width: 100%;
|
| 349 |
+
float: left;
|
| 350 |
+
font-family: helveticaregular;
|
| 351 |
+
line-height: 42px;
|
| 352 |
+
}
|
| 353 |
+
.tab5 .icons_size {
|
| 354 |
+
position: relative;
|
| 355 |
+
}
|
| 356 |
+
.tab5 .icons_size span {
|
| 357 |
+
margin-right: 18px;
|
| 358 |
+
display: block;
|
| 359 |
+
float: left;
|
| 360 |
+
font-size: 18px;
|
| 361 |
+
font-weight: 400;
|
| 362 |
+
line-height: 46px;
|
| 363 |
+
}
|
| 364 |
+
.tab5 .icons_size span.last {
|
| 365 |
+
margin-left: 55px;
|
| 366 |
+
}
|
| 367 |
+
.tab5 .icons_size input {
|
| 368 |
+
width: 73px;
|
| 369 |
+
background: #e5e5e5;
|
| 370 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 371 |
+
border: 0;
|
| 372 |
+
padding: 13px 13px 12px;
|
| 373 |
+
margin-right: 18px;
|
| 374 |
+
float: left;
|
| 375 |
+
display: block;
|
| 376 |
+
}
|
| 377 |
+
.tab5 .icons_size select.styled {
|
| 378 |
+
position: absolute;
|
| 379 |
+
left: 0;
|
| 380 |
+
width: 135px;
|
| 381 |
+
height: 46px;
|
| 382 |
+
line-height: 46px;
|
| 383 |
+
}
|
| 384 |
+
.tab5 .icons_size .field {
|
| 385 |
+
position: relative;
|
| 386 |
+
float: left;
|
| 387 |
+
display: block;
|
| 388 |
+
margin-right: 20px;
|
| 389 |
+
}
|
| 390 |
+
.tab5 .icons_size ins {
|
| 391 |
+
margin-right: 25px;
|
| 392 |
+
float: left;
|
| 393 |
+
font-size: 17px;
|
| 394 |
+
font-weight: 400;
|
| 395 |
+
text-decoration: none;
|
| 396 |
+
}
|
| 397 |
+
.tab5 .icons_size ins.leave_empty {
|
| 398 |
+
line-height: 23px;
|
| 399 |
+
}
|
| 400 |
+
.tab5 .icons_size {
|
| 401 |
+
padding-top: 15px;
|
| 402 |
+
}
|
| 403 |
+
.tab5 ul.enough_waffling {
|
| 404 |
+
margin: -5px 0 0;
|
| 405 |
+
padding: 0;
|
| 406 |
+
list-style: none;
|
| 407 |
+
text-align: center;
|
| 408 |
+
}
|
| 409 |
+
.tab5 .new_wind .sfsiplus_row_onl ul.enough_waffling {
|
| 410 |
+
margin: 20px 0 0 0;
|
| 411 |
+
padding: 0;
|
| 412 |
+
list-style: none;
|
| 413 |
+
height: 38px;
|
| 414 |
+
text-align: left;
|
| 415 |
+
}
|
| 416 |
+
.tab5 ul.enough_waffling li {
|
| 417 |
+
margin: 0 22px;
|
| 418 |
+
padding: 0;
|
| 419 |
+
list-style: none;
|
| 420 |
+
display: inline-block;
|
| 421 |
+
}
|
| 422 |
+
.tab5 ul.enough_waffling li span {
|
| 423 |
+
float: left;
|
| 424 |
+
}
|
| 425 |
+
.tab5 ul.enough_waffling li label {
|
| 426 |
+
margin: 0 0 0 20px;
|
| 427 |
+
float: left;
|
| 428 |
+
font-family: helveticaregular;
|
| 429 |
+
font-size: 18px;
|
| 430 |
+
font-weight: 400;
|
| 431 |
+
text-align: center;
|
| 432 |
+
line-height: 38px;
|
| 433 |
+
color: #5a6570;
|
| 434 |
+
}
|
| 435 |
+
.sticking p {
|
| 436 |
+
float: left;
|
| 437 |
+
font-size: 18px!important;
|
| 438 |
+
}
|
| 439 |
+
.sticking p.list {
|
| 440 |
+
width: 168px;
|
| 441 |
+
}
|
| 442 |
+
.sticking p.link {
|
| 443 |
+
margin: 3px 0 0 12px;
|
| 444 |
+
padding: 0!important;
|
| 445 |
+
float: left;
|
| 446 |
+
}
|
| 447 |
+
.sticking .float {
|
| 448 |
+
margin-left: 188px;
|
| 449 |
+
margin-top: 3px;
|
| 450 |
+
float: left;
|
| 451 |
+
font-size: 17px;
|
| 452 |
+
}
|
| 453 |
+
.sticking ul {
|
| 454 |
+
margin: 0;
|
| 455 |
+
padding: 30px 0 0;
|
| 456 |
+
list-style: none;
|
| 457 |
+
float: left;
|
| 458 |
+
}
|
| 459 |
+
.sticking a {
|
| 460 |
+
color: #a4a9ad;
|
| 461 |
+
text-decoration: none;
|
| 462 |
+
}
|
| 463 |
+
.sticking .field {
|
| 464 |
+
position: relative;
|
| 465 |
+
float: left;
|
| 466 |
+
display: block;
|
| 467 |
+
margin-left: 20px;
|
| 468 |
+
}
|
| 469 |
+
.sticking .field .select {
|
| 470 |
+
width: 206px;
|
| 471 |
+
height: 47px;
|
| 472 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
| 473 |
+
display: block;
|
| 474 |
+
padding-left: 10px;
|
| 475 |
+
}
|
| 476 |
+
.sticking .field select.styled {
|
| 477 |
+
position: absolute;
|
| 478 |
+
left: 0;
|
| 479 |
+
top: 0;
|
| 480 |
+
width: 211px;
|
| 481 |
+
line-height: 46px;
|
| 482 |
+
height: 46px;
|
| 483 |
+
}
|
| 484 |
+
.mouseover_field {
|
| 485 |
+
width: 455px;
|
| 486 |
+
float: left;
|
| 487 |
+
font-size: 18px;
|
| 488 |
+
margin-top: 10px;
|
| 489 |
+
}
|
| 490 |
+
.mouseover_field label {
|
| 491 |
+
width: 125px;
|
| 492 |
+
float: left;
|
| 493 |
+
}
|
| 494 |
+
.mouseover_field input {
|
| 495 |
+
width: 256px;
|
| 496 |
+
float: left;
|
| 497 |
+
background: #e5e5e5;
|
| 498 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 499 |
+
border: 0;
|
| 500 |
+
padding: 10px;
|
| 501 |
+
}
|
| 502 |
+
.tab6 .social_icon_like1 {
|
| 503 |
+
width: 100%;
|
| 504 |
+
float: left;
|
| 505 |
+
margin: 0;
|
| 506 |
+
padding: 35px 0 0;
|
| 507 |
+
text-align: center;
|
| 508 |
+
}
|
| 509 |
+
.tab6 .social_icon_like1 ul {
|
| 510 |
+
margin: 0;
|
| 511 |
+
padding: 0;
|
| 512 |
+
list-style: none;
|
| 513 |
+
text-align: center;
|
| 514 |
+
}
|
| 515 |
+
.tab6 .social_icon_like1 li {
|
| 516 |
+
margin: 0 20px;
|
| 517 |
+
padding: 0;
|
| 518 |
+
width: auto;
|
| 519 |
+
list-style: none;
|
| 520 |
+
display: inline-block;
|
| 521 |
+
}
|
| 522 |
+
.tab6 .social_icon_like1 li span, .tab8 .social_icon_like1 li span {
|
| 523 |
+
margin: 0;
|
| 524 |
+
width: 44px;
|
| 525 |
+
display: block;
|
| 526 |
+
background: url(../images/count_bg1.png) no-repeat;
|
| 527 |
+
height: 22px;
|
| 528 |
+
overflow: hidden;
|
| 529 |
+
padding: 2px 2px 2px 10px;
|
| 530 |
+
font-family: helveticaregular;
|
| 531 |
+
font-size: 15px;
|
| 532 |
+
text-align: center;
|
| 533 |
+
line-height: 20px;
|
| 534 |
+
color: #5a6570;
|
| 535 |
+
float: left;
|
| 536 |
+
}
|
| 537 |
+
.tab6 .social_icon_like1 li img {
|
| 538 |
+
float: left;
|
| 539 |
+
margin-right: 5px;
|
| 540 |
+
display: block;
|
| 541 |
+
}
|
| 542 |
+
.tab6 .social_icon_like1 li a {
|
| 543 |
+
color: #5a6570;
|
| 544 |
+
text-decoration: none;
|
| 545 |
+
display: block;
|
| 546 |
+
}
|
| 547 |
+
.tab6 ul.usually {
|
| 548 |
+
margin: 28px 0 6px 60px;
|
| 549 |
+
padding: 0;
|
| 550 |
+
list-style: none;
|
| 551 |
+
}
|
| 552 |
+
.tab6 ul.usually li {
|
| 553 |
+
margin: 0;
|
| 554 |
+
padding: 0;
|
| 555 |
+
width: auto;
|
| 556 |
+
list-style: none;
|
| 557 |
+
text-align: left;
|
| 558 |
+
font-size: 17px;
|
| 559 |
+
}
|
| 560 |
+
.tab6 ul.enough_waffling {
|
| 561 |
+
margin: 25px 0 0;
|
| 562 |
+
padding: 0;
|
| 563 |
+
list-style: none;
|
| 564 |
+
text-align: center;
|
| 565 |
+
}
|
| 566 |
+
.tab6 ul.enough_waffling li {
|
| 567 |
+
margin: 0 22px;
|
| 568 |
+
padding: 0;
|
| 569 |
+
list-style: none;
|
| 570 |
+
display: inline-block;
|
| 571 |
+
}
|
| 572 |
+
.tab6 ul.enough_waffling li span {
|
| 573 |
+
float: left;
|
| 574 |
+
}
|
| 575 |
+
.tab6 ul.enough_waffling li label {
|
| 576 |
+
margin: 0 0 0 20px;
|
| 577 |
+
float: left;
|
| 578 |
+
font-family: helveticaregular;
|
| 579 |
+
font-size: 18px;
|
| 580 |
+
font-weight: 400;
|
| 581 |
+
text-align: center;
|
| 582 |
+
line-height: 38px;
|
| 583 |
+
color: #5a6570;
|
| 584 |
+
}
|
| 585 |
+
.tab6 .row {
|
| 586 |
+
border-top: 1px solid #eaebee;
|
| 587 |
+
margin-top: 25px;
|
| 588 |
+
padding-top: 15px;
|
| 589 |
+
clear: both;
|
| 590 |
+
display: block;
|
| 591 |
+
width: 100%;
|
| 592 |
+
float: left;
|
| 593 |
+
font-family: helveticaregular;
|
| 594 |
+
line-height: 42px;
|
| 595 |
+
}
|
| 596 |
+
.tab6 .options {
|
| 597 |
+
margin-top: 25px;
|
| 598 |
+
clear: both;
|
| 599 |
+
width: 100%;
|
| 600 |
+
float: left;
|
| 601 |
+
}
|
| 602 |
+
.tab6 .options label {
|
| 603 |
+
width: 345px;
|
| 604 |
+
float: left;
|
| 605 |
+
font-size: 18px;
|
| 606 |
+
font-family: helveticaregular;
|
| 607 |
+
color: #5a6570;
|
| 608 |
+
line-height: 46px;
|
| 609 |
+
}
|
| 610 |
+
.tab6 .options label.first {
|
| 611 |
+
font-family: helveticaregular;
|
| 612 |
+
font-size: 18px;
|
| 613 |
+
}
|
| 614 |
+
.tab6 .options input {
|
| 615 |
+
width: 308px;
|
| 616 |
+
float: left;
|
| 617 |
+
background: #e5e5e5;
|
| 618 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 619 |
+
border: 0;
|
| 620 |
+
padding: 10px;
|
| 621 |
+
}
|
| 622 |
+
.tab6 .options .field {
|
| 623 |
+
width: 223px;
|
| 624 |
+
float: left;
|
| 625 |
+
position: relative;
|
| 626 |
+
}
|
| 627 |
+
.tab6 .options .field .select {
|
| 628 |
+
width: 207px;
|
| 629 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
| 630 |
+
display: block;
|
| 631 |
+
padding-left: 17px;
|
| 632 |
+
font-family: helveticaregular;
|
| 633 |
+
}
|
| 634 |
+
.tab6 .options .field select.styled {
|
| 635 |
+
position: absolute;
|
| 636 |
+
left: 0;
|
| 637 |
+
top: 0;
|
| 638 |
+
width: 213px;
|
| 639 |
+
line-height: 46px;
|
| 640 |
+
height: 46px;
|
| 641 |
+
}
|
| 642 |
+
.tab7 h3 {
|
| 643 |
+
margin: 14px 0 6px;
|
| 644 |
+
padding: 0;
|
| 645 |
+
color: #a7a9ac;
|
| 646 |
+
font-family: helveticaregular;
|
| 647 |
+
font-size: 20px;
|
| 648 |
+
text-align: left;
|
| 649 |
+
}
|
| 650 |
+
.tab7 .close {
|
| 651 |
+
position: absolute;
|
| 652 |
+
right: 18px;
|
| 653 |
+
top: 18px;
|
| 654 |
+
}
|
| 655 |
+
.tab7 .text_options {
|
| 656 |
+
width: 400px;
|
| 657 |
+
float: left;
|
| 658 |
+
}
|
| 659 |
+
.tab7 .text_options.layout {
|
| 660 |
+
margin-left: 35px;
|
| 661 |
+
}
|
| 662 |
+
.tab7 .sfsiplus_row_tab {
|
| 663 |
+
margin-top: 10px;
|
| 664 |
+
width: 100%;
|
| 665 |
+
float: left;
|
| 666 |
+
}
|
| 667 |
+
.tab7 .text_options label {
|
| 668 |
+
width: 121px;
|
| 669 |
+
float: left;
|
| 670 |
+
line-height: 46px;
|
| 671 |
+
font-size: 18px;
|
| 672 |
+
}
|
| 673 |
+
.tab7 .text_options.layout label {
|
| 674 |
+
line-height: 20px;
|
| 675 |
+
font-size: 18px;
|
| 676 |
+
}
|
| 677 |
+
.tab7 .text_options.layout label.border {
|
| 678 |
+
line-height: 46px;
|
| 679 |
+
}
|
| 680 |
+
.tab7 .text_options input {
|
| 681 |
+
width: 274px;
|
| 682 |
+
float: left;
|
| 683 |
+
background: #e5e5e5;
|
| 684 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 685 |
+
border: 0;
|
| 686 |
+
padding: 13px 10px;
|
| 687 |
+
font-size: 17px;
|
| 688 |
+
color: #5a6570;
|
| 689 |
+
}
|
| 690 |
+
.tab7 .text_options input.small {
|
| 691 |
+
width: 138px;
|
| 692 |
+
}
|
| 693 |
+
.tab7 .text_options .field {
|
| 694 |
+
width: 223px;
|
| 695 |
+
float: left;
|
| 696 |
+
position: relative;
|
| 697 |
+
}
|
| 698 |
+
.tab7 .text_options .field .select {
|
| 699 |
+
width: 183px;
|
| 700 |
+
padding-right: 21px;
|
| 701 |
+
height: 47px;
|
| 702 |
+
background: url(../images/select_bg1.jpg) no-repeat;
|
| 703 |
+
display: block;
|
| 704 |
+
padding-left: 10px;
|
| 705 |
+
line-height: 46px;
|
| 706 |
+
font-size: 17px;
|
| 707 |
+
color: #414951;
|
| 708 |
+
}
|
| 709 |
+
.tab7 .text_options .field select.styled {
|
| 710 |
+
position: absolute;
|
| 711 |
+
left: 0;
|
| 712 |
+
top: 0;
|
| 713 |
+
width: 213px;
|
| 714 |
+
line-height: 46px;
|
| 715 |
+
height: 46px;
|
| 716 |
+
}
|
| 717 |
+
.tab7 .color_box {
|
| 718 |
+
width: 40px;
|
| 719 |
+
height: 34px;
|
| 720 |
+
border: 3px solid #fff;
|
| 721 |
+
box-shadow: 1px 2px 2px #ccc;
|
| 722 |
+
float: left;
|
| 723 |
+
position: relative;
|
| 724 |
+
margin-left: 13px;
|
| 725 |
+
}
|
| 726 |
+
.tab7 .color_box1 {
|
| 727 |
+
width: 100%;
|
| 728 |
+
height: 34px;
|
| 729 |
+
background: #5a6570;
|
| 730 |
+
box-shadow: 1px -2px 15px -2px #d3d3d3 inset;
|
| 731 |
+
}
|
| 732 |
+
.tab7 .corner {
|
| 733 |
+
width: 10px;
|
| 734 |
+
height: 10px;
|
| 735 |
+
background: #fff;
|
| 736 |
+
position: absolute;
|
| 737 |
+
right: 0;
|
| 738 |
+
bottom: 0;
|
| 739 |
+
}
|
| 740 |
+
.tab7 ul.border_shadow {
|
| 741 |
+
margin: 0;
|
| 742 |
+
padding: 5px 0 0;
|
| 743 |
+
list-style: none;
|
| 744 |
+
float: left;
|
| 745 |
+
width: 257px;
|
| 746 |
+
}
|
| 747 |
+
.tab7 ul.border_shadow li {
|
| 748 |
+
margin: 0;
|
| 749 |
+
padding: 0 0 0 40px;
|
| 750 |
+
list-style: none;
|
| 751 |
+
float: left;
|
| 752 |
+
}
|
| 753 |
+
.tab7 ul.border_shadow li:first-child {
|
| 754 |
+
padding: 0;
|
| 755 |
+
}
|
| 756 |
+
.tab7 ul.border_shadow li span {
|
| 757 |
+
float: left;
|
| 758 |
+
}
|
| 759 |
+
.tab7 ul.border_shadow li label {
|
| 760 |
+
float: left;
|
| 761 |
+
width: auto;
|
| 762 |
+
font-family: helveticaregular;
|
| 763 |
+
font-size: 18px;
|
| 764 |
+
font-weight: 400;
|
| 765 |
+
text-align: center;
|
| 766 |
+
line-height: 40px!important;
|
| 767 |
+
color: #5a6570;
|
| 768 |
+
padding: 0 0 0 20px;
|
| 769 |
+
}
|
| 770 |
+
.tab7 .row {
|
| 771 |
+
border-top: 1px solid #eaebee;
|
| 772 |
+
margin-top: 25px;
|
| 773 |
+
padding-top: 15px;
|
| 774 |
+
clear: both;
|
| 775 |
+
display: block;
|
| 776 |
+
width: 100%;
|
| 777 |
+
float: left;
|
| 778 |
+
font-family: helveticaregular;
|
| 779 |
+
line-height: 42px;
|
| 780 |
+
}
|
| 781 |
+
.tab7 .pop_up_show {
|
| 782 |
+
width: 100%;
|
| 783 |
+
float: left;
|
| 784 |
+
margin-top: 20px;
|
| 785 |
+
}
|
| 786 |
+
.tab7 .pop_up_show span {
|
| 787 |
+
float: left;
|
| 788 |
+
}
|
| 789 |
+
.tab7 .pop_up_show label {
|
| 790 |
+
float: left;
|
| 791 |
+
width: auto;
|
| 792 |
+
font-size: 18px;
|
| 793 |
+
font-weight: 400;
|
| 794 |
+
text-align: center;
|
| 795 |
+
line-height: 38px!important;
|
| 796 |
+
color: #5a6570;
|
| 797 |
+
padding: 0 0 0 20px;
|
| 798 |
+
}
|
| 799 |
+
.tab7 .pop_up_show input.add {
|
| 800 |
+
width: 257px;
|
| 801 |
+
float: left;
|
| 802 |
+
background: #e5e5e5;
|
| 803 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 804 |
+
border: 0;
|
| 805 |
+
padding: 10px;
|
| 806 |
+
margin-left: 40px;
|
| 807 |
+
}
|
| 808 |
+
.tab7 .pop_up_show input.seconds {
|
| 809 |
+
width: 60px;
|
| 810 |
+
background: #e5e5e5;
|
| 811 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 812 |
+
border: 0;
|
| 813 |
+
padding: 10px;
|
| 814 |
+
margin: 0 7px;
|
| 815 |
+
}
|
| 816 |
+
.tab7 .pop_up_show a {
|
| 817 |
+
text-decoration: underline;
|
| 818 |
+
color: #a4a9ad;
|
| 819 |
+
font-size: 16px;
|
| 820 |
+
margin-left: 20px;
|
| 821 |
+
}
|
| 822 |
+
.tab7 .pop_up_show .field {
|
| 823 |
+
width: 135px;
|
| 824 |
+
float: left;
|
| 825 |
+
position: relative;
|
| 826 |
+
margin-left: 20px;
|
| 827 |
+
font-size: 17px;
|
| 828 |
+
font-family: helveticaregular;
|
| 829 |
+
}
|
| 830 |
+
.tab7 .pop_up_show .field .select {
|
| 831 |
+
width: 127px;
|
| 832 |
+
height: 48px;
|
| 833 |
+
background: url(../images/select_bg.jpg) no-repeat;
|
| 834 |
+
display: block;
|
| 835 |
+
padding-left: 10px;
|
| 836 |
+
line-height: 46px;
|
| 837 |
+
font-size: 16px;
|
| 838 |
+
color: #5a6570;
|
| 839 |
+
}
|
| 840 |
+
.tab7 .pop_up_show .field select.styled {
|
| 841 |
+
position: absolute;
|
| 842 |
+
left: 0;
|
| 843 |
+
top: 0;
|
| 844 |
+
width: 135px;
|
| 845 |
+
line-height: 46px;
|
| 846 |
+
height: 46px;
|
| 847 |
+
}
|
| 848 |
+
.pop_up_box {
|
| 849 |
+
width: 474px;
|
| 850 |
+
background: #FFF;
|
| 851 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 852 |
+
margin: 200px auto;
|
| 853 |
+
padding: 20px 25px 0;
|
| 854 |
+
font-family: helveticaregular;
|
| 855 |
+
color: #5a6570;
|
| 856 |
+
min-height: 250px;
|
| 857 |
+
position: relative;
|
| 858 |
+
}
|
| 859 |
+
.pop_up_box h4, .pop_up_box_ex h4 {
|
| 860 |
+
font-size: 20px;
|
| 861 |
+
color: #5a6570;
|
| 862 |
+
text-align: center;
|
| 863 |
+
margin: 0;
|
| 864 |
+
padding: 0;
|
| 865 |
+
line-height: 22px;
|
| 866 |
+
}
|
| 867 |
+
.pop_up_box p, .pop_up_box_ex p {
|
| 868 |
+
font-size: 17px;
|
| 869 |
+
line-height: 28px;
|
| 870 |
+
color: #5a6570;
|
| 871 |
+
text-align: left;
|
| 872 |
+
margin: 0;
|
| 873 |
+
padding: 25px 0 0;
|
| 874 |
+
font-family: helveticaregular;
|
| 875 |
+
}
|
| 876 |
+
.sfsi_popupcntnr {
|
| 877 |
+
float: left;
|
| 878 |
+
width: 100%}
|
| 879 |
+
.sfsi_popupcntnr>h3 {
|
| 880 |
+
color: #000;
|
| 881 |
+
float: left;
|
| 882 |
+
font-weight: 700;
|
| 883 |
+
margin-bottom: 5px;
|
| 884 |
+
width: 100%}
|
| 885 |
+
ul.flwstep {
|
| 886 |
+
float: left;
|
| 887 |
+
width: 100%}
|
| 888 |
+
ul.flwstep>li {
|
| 889 |
+
color: #000;
|
| 890 |
+
font-size: 16px;
|
| 891 |
+
margin: 5px;
|
| 892 |
+
}
|
| 893 |
+
.upldbtn {
|
| 894 |
+
float: left;
|
| 895 |
+
text-align: center;
|
| 896 |
+
width: 100%}
|
| 897 |
+
.upload_butt {
|
| 898 |
+
background-color: #12a252;
|
| 899 |
+
border: none;
|
| 900 |
+
color: #fff;
|
| 901 |
+
font-weight: 700;
|
| 902 |
+
margin-top: 10px;
|
| 903 |
+
padding: 5px 45px;
|
| 904 |
+
width: auto;
|
| 905 |
+
cursor: pointer;
|
| 906 |
+
}
|
| 907 |
+
.pop_up_box .button {
|
| 908 |
+
background: #12a252;
|
| 909 |
+
font-size: 22px;
|
| 910 |
+
line-height: 24px;
|
| 911 |
+
color: #5a6570;
|
| 912 |
+
text-align: center;
|
| 913 |
+
min-height: 80px;
|
| 914 |
+
margin-top: 32px;
|
| 915 |
+
box-shadow: none;
|
| 916 |
+
word-wrap: break-word;
|
| 917 |
+
white-space: normal;
|
| 918 |
+
}
|
| 919 |
+
.pop_up_box .button:hover {
|
| 920 |
+
box-shadow: none!important;
|
| 921 |
+
}
|
| 922 |
+
.pop_up_box .button a.activate {
|
| 923 |
+
padding: 0px 0;
|
| 924 |
+
}
|
| 925 |
+
.pop_up_box a, .pop_up_box_ex a {
|
| 926 |
+
color: #a4a9ad;
|
| 927 |
+
font-size: 20px;
|
| 928 |
+
text-decoration: none;
|
| 929 |
+
text-align: center;
|
| 930 |
+
display: inline-block;
|
| 931 |
+
margin-top: 20px;
|
| 932 |
+
width: 100%;
|
| 933 |
+
}
|
| 934 |
+
.pop_up_box .upload {
|
| 935 |
+
width: 100%;
|
| 936 |
+
float: left;
|
| 937 |
+
text-align: left;
|
| 938 |
+
margin-top: 15px;
|
| 939 |
+
height: 46px;
|
| 940 |
+
}
|
| 941 |
+
.pop_up_box .upload label {
|
| 942 |
+
width: 135px;
|
| 943 |
+
float: left;
|
| 944 |
+
line-height: 45px;
|
| 945 |
+
font-size: 18px;
|
| 946 |
+
font-family: helveticaregular;
|
| 947 |
+
text-align: left;
|
| 948 |
+
}
|
| 949 |
+
.pop_up_box .upload input[type=text] {
|
| 950 |
+
width: 248px;
|
| 951 |
+
float: left;
|
| 952 |
+
background: #e5e5e5;
|
| 953 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 954 |
+
border: 0;
|
| 955 |
+
padding: 0 10px;
|
| 956 |
+
font-size: 16px;
|
| 957 |
+
height: 44px;
|
| 958 |
+
text-align: left;
|
| 959 |
+
color: #5a6570;
|
| 960 |
+
font-family: helveticaregular;
|
| 961 |
+
}
|
| 962 |
+
.pop_up_box .upload input.upload_butt {
|
| 963 |
+
width: 100px;
|
| 964 |
+
background: #12a252;
|
| 965 |
+
box-shadow: 0 0 0;
|
| 966 |
+
border: 0;
|
| 967 |
+
text-align: center;
|
| 968 |
+
font-size: 18px;
|
| 969 |
+
color: #fff;
|
| 970 |
+
font-family: helveticaregular;
|
| 971 |
+
height: 45px;
|
| 972 |
+
right: 32px;
|
| 973 |
+
top: 71px;
|
| 974 |
+
position: absolute;
|
| 975 |
+
}
|
| 976 |
+
.pop_up_box .upload a {
|
| 977 |
+
color: #12a252;
|
| 978 |
+
font-size: 18px;
|
| 979 |
+
text-decoration: underline;
|
| 980 |
+
font-family: helveticaregular;
|
| 981 |
+
margin: 0 0 16px 140px;
|
| 982 |
+
}
|
| 983 |
+
.pop_up_box a:hover, .pop_up_box_ex a:hover {
|
| 984 |
+
color: #a4a9ad;
|
| 985 |
+
}
|
| 986 |
+
.tab1 ul.plus_icn_listing {
|
| 987 |
+
list-style: none;
|
| 988 |
+
overflow: hidden;
|
| 989 |
+
border-top: #e7e8eb solid 1px;
|
| 990 |
+
margin: 35px 0 0;
|
| 991 |
+
}
|
| 992 |
+
.tab1 ul.plus_icn_listing li {
|
| 993 |
+
border-bottom: #eaebed solid 1px;
|
| 994 |
+
padding: 11px 0 11px 8px;
|
| 995 |
+
float: left;
|
| 996 |
+
width: 100%}
|
| 997 |
+
ul.plus_icn_listing li .tb_4_ck {
|
| 998 |
+
float: left;
|
| 999 |
+
margin: 10px 0 0;
|
| 1000 |
+
}
|
| 1001 |
+
ul.sfsiplus_icn_listing8 li .tb_4_ck {
|
| 1002 |
+
float: left;
|
| 1003 |
+
margin: 10px 0 0;
|
| 1004 |
+
}
|
| 1005 |
+
.tab8 .cstmdsplyulwpr .radio_section.tb_4_ck
|
| 1006 |
+
{
|
| 1007 |
+
margin-right: 10px !important;
|
| 1008 |
+
}
|
| 1009 |
+
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplsub{margin-top: 3px;}
|
| 1010 |
+
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdspllke{margin-top: 3px;}
|
| 1011 |
+
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplggpls{margin-top: 3px;}
|
| 1012 |
+
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdspltwtr{margin-top: 4px;}
|
| 1013 |
+
.tab8 .social_icon_like1.cstmdsplyulwpr .cstmdsplshr{margin-top: 3px;}
|
| 1014 |
+
.tab2 {
|
| 1015 |
+
overflow: hidden;
|
| 1016 |
+
}
|
| 1017 |
+
.tab2 .rss_url_row {
|
| 1018 |
+
width: 100%;
|
| 1019 |
+
float: left;
|
| 1020 |
+
margin: 0 0 10px;
|
| 1021 |
+
}
|
| 1022 |
+
.tab2 .rss_url_row h4 {
|
| 1023 |
+
float: left;
|
| 1024 |
+
line-height: 43px!important;
|
| 1025 |
+
}
|
| 1026 |
+
.tab2 .inr_cont input.add, .tab2 .inr_cont textarea.add_txt, .tab2 .rss_url_row input.add {
|
| 1027 |
+
width: 363px;
|
| 1028 |
+
float: left;
|
| 1029 |
+
background: #e5e5e5;
|
| 1030 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 1031 |
+
border: 0;
|
| 1032 |
+
padding: 12px 10px 11px;
|
| 1033 |
+
margin-left: 10px;
|
| 1034 |
+
}
|
| 1035 |
+
.tab2 .rss_url_row a.rit_link {
|
| 1036 |
+
float: left;
|
| 1037 |
+
margin: 10px 0 0 16px;
|
| 1038 |
+
font-size: 17px;
|
| 1039 |
+
}
|
| 1040 |
+
.tab2 .row {
|
| 1041 |
+
float: left;
|
| 1042 |
+
border-top: 2px solid #f2f3f4;
|
| 1043 |
+
clear: both;
|
| 1044 |
+
padding: 0 0 15px;
|
| 1045 |
+
width: 100%}
|
| 1046 |
+
.tab2 .row .tab_2_email_sec {
|
| 1047 |
+
list-style: none;
|
| 1048 |
+
margin: 17px 0 0;
|
| 1049 |
+
overflow: hidden;
|
| 1050 |
+
}
|
| 1051 |
+
.row ul.tab_2_email_sec li {
|
| 1052 |
+
float: left;
|
| 1053 |
+
margin-right: 10px;
|
| 1054 |
+
width: 32%;
|
| 1055 |
+
}
|
| 1056 |
+
.sfsiplusicnsdvwrp
|
| 1057 |
+
{
|
| 1058 |
+
width: 110px;
|
| 1059 |
+
float: left;
|
| 1060 |
+
}
|
| 1061 |
+
.row ul.tab_2_email_sec:first-child {
|
| 1062 |
+
margin-right: 2%
|
| 1063 |
+
}
|
| 1064 |
+
.inr_cont .fb_url {
|
| 1065 |
+
clear: both;
|
| 1066 |
+
}
|
| 1067 |
+
.inr_cont .fb_url .checkbox, .inr_cont .fb_url input.add, .inr_cont .fb_url label, .inr_cont .fb_url lable {
|
| 1068 |
+
float: left;
|
| 1069 |
+
}
|
| 1070 |
+
.inr_cont .fb_url input.add {
|
| 1071 |
+
margin-left: 19px;
|
| 1072 |
+
}
|
| 1073 |
+
.inr_cont .fb_url .checkbox {
|
| 1074 |
+
margin: 6px 0 0;
|
| 1075 |
+
}
|
| 1076 |
+
.inr_cont .fb_url label {
|
| 1077 |
+
line-height: 41px;
|
| 1078 |
+
margin: 0 0 0 15px;
|
| 1079 |
+
font-size: 18px;
|
| 1080 |
+
}
|
| 1081 |
+
.inr_cont textarea.add_txt {
|
| 1082 |
+
resize: none;
|
| 1083 |
+
margin: 0 0 0 19px!important;
|
| 1084 |
+
height: 60px;
|
| 1085 |
+
}
|
| 1086 |
+
.tab2 .inr_cont textarea.add_txt {
|
| 1087 |
+
width: 382px!important;
|
| 1088 |
+
height: 90px;
|
| 1089 |
+
overflow: hidden;
|
| 1090 |
+
}
|
| 1091 |
+
.tab2 .inr_cont input.add {
|
| 1092 |
+
width: 417px;
|
| 1093 |
+
}
|
| 1094 |
+
.red_txt, .tab2 .red_txt {
|
| 1095 |
+
color: #ef4745!important;
|
| 1096 |
+
text-align: center!important;
|
| 1097 |
+
padding-top: 5px!important;
|
| 1098 |
+
}
|
| 1099 |
+
.green_txt {
|
| 1100 |
+
color: #12A252!important;
|
| 1101 |
+
text-align: center!important;
|
| 1102 |
+
padding-top: 5px!important;
|
| 1103 |
+
}
|
| 1104 |
+
.red_txt {
|
| 1105 |
+
color: #f80000!important;
|
| 1106 |
+
text-align: center!important;
|
| 1107 |
+
padding-top: 5px!important;
|
| 1108 |
+
}
|
| 1109 |
+
.linked_tab_2 .fb_url label {
|
| 1110 |
+
width: 32%}
|
| 1111 |
+
.twt_tab_2 label {
|
| 1112 |
+
width: 18%}
|
| 1113 |
+
.bdr_top {
|
| 1114 |
+
border-top: none!important;
|
| 1115 |
+
}
|
| 1116 |
+
.linked_tab_2 .fb_url input.link_dbl {
|
| 1117 |
+
margin-bottom: 6px;
|
| 1118 |
+
}
|
| 1119 |
+
.tab3 {
|
| 1120 |
+
overflow: hidden;
|
| 1121 |
+
}
|
| 1122 |
+
.tab3 .row {
|
| 1123 |
+
padding: 15px 0;
|
| 1124 |
+
clear: both;
|
| 1125 |
+
overflow: hidden;
|
| 1126 |
+
}
|
| 1127 |
+
.tab3 .row.sfsiplusmousetxt
|
| 1128 |
+
{
|
| 1129 |
+
border: medium none;
|
| 1130 |
+
}
|
| 1131 |
+
.tab3 ul.tab_3_list {
|
| 1132 |
+
overflow: hidden;
|
| 1133 |
+
margin: 4px 0 11px;
|
| 1134 |
+
}
|
| 1135 |
+
.tab8 .sfsiplus_toglepstpgspn {
|
| 1136 |
+
font-weight: bold;
|
| 1137 |
+
}
|
| 1138 |
+
ul.tab_3_list li {
|
| 1139 |
+
background: url(../images/tab_3_list_bg.jpg) 13px 7px no-repeat;
|
| 1140 |
+
padding: 0 0 0 30px;
|
| 1141 |
+
color: #778088;
|
| 1142 |
+
font-family: helveticaregular;
|
| 1143 |
+
font-size: 17px;
|
| 1144 |
+
margin-bottom: 4px;
|
| 1145 |
+
}
|
| 1146 |
+
.tab5 ul.tab_3_list li
|
| 1147 |
+
{
|
| 1148 |
+
background: url(../images/tab_3_list_bg.jpg) 13px 18px no-repeat;
|
| 1149 |
+
}
|
| 1150 |
+
.tab3 .row h3 {
|
| 1151 |
+
margin: 0 0 20px;
|
| 1152 |
+
color: #414951;
|
| 1153 |
+
font-family: helveticabold;
|
| 1154 |
+
font-size: 20px;
|
| 1155 |
+
}
|
| 1156 |
+
ul.sfsiplus_tab_3_icns {
|
| 1157 |
+
list-style: none;
|
| 1158 |
+
margin: 34px 0 0;
|
| 1159 |
+
overflow: hidden;
|
| 1160 |
+
}
|
| 1161 |
+
ul.sfsiplus_tab_3_icns li {
|
| 1162 |
+
width: 100%;
|
| 1163 |
+
margin: 0 0 21px;
|
| 1164 |
+
float: left;
|
| 1165 |
+
}
|
| 1166 |
+
ul.sfsiplus_tab_3_icns label {
|
| 1167 |
+
float: left;
|
| 1168 |
+
line-height: 42px;
|
| 1169 |
+
color: #69737C;
|
| 1170 |
+
font-size: 18px;
|
| 1171 |
+
font-family: helveticaregular;
|
| 1172 |
+
min-width: 120px;
|
| 1173 |
+
}
|
| 1174 |
+
ul.sfsiplus_tab_3_icns li .sfsiplus_icns_tab_3, ul.sfsiplus_tab_3_icns li .radio {
|
| 1175 |
+
float: left;
|
| 1176 |
+
}
|
| 1177 |
+
.tab3 .sub_row {
|
| 1178 |
+
float: left;
|
| 1179 |
+
margin: 35px 0 0 4%;
|
| 1180 |
+
width: 90%}
|
| 1181 |
+
.tab3 .sub_row h4 {
|
| 1182 |
+
color: #a4a9ad!important;
|
| 1183 |
+
}
|
| 1184 |
+
.tab3 .sub_row label {
|
| 1185 |
+
float: left;
|
| 1186 |
+
margin: 0 20px;
|
| 1187 |
+
line-height: 36px;
|
| 1188 |
+
font-size: 18px;
|
| 1189 |
+
}
|
| 1190 |
+
.tab3 .sub_row p {
|
| 1191 |
+
padding-top: 18px!important;
|
| 1192 |
+
clear: both;
|
| 1193 |
+
overflow: hidden;
|
| 1194 |
+
}
|
| 1195 |
+
.sub_row .sub_sub_box p {
|
| 1196 |
+
padding-top: 18px!important;
|
| 1197 |
+
}
|
| 1198 |
+
.tab3 .sub_row .checkbox {
|
| 1199 |
+
float: left;
|
| 1200 |
+
margin-top: 4px;
|
| 1201 |
+
}
|
| 1202 |
+
.tab3 .sub_row .sub_sub_box {
|
| 1203 |
+
width: 80%;
|
| 1204 |
+
margin: 7px 0 15px 10%;
|
| 1205 |
+
float: left;
|
| 1206 |
+
}
|
| 1207 |
+
.tab3 .sub_row input.smal_inpt {
|
| 1208 |
+
width: 73px;
|
| 1209 |
+
background: #e5e5e5;
|
| 1210 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 1211 |
+
border: 0;
|
| 1212 |
+
padding: 10px;
|
| 1213 |
+
float: left;
|
| 1214 |
+
}
|
| 1215 |
+
.tab3 .sub_row .drop_lst {
|
| 1216 |
+
border: 1px solid #d6d6d6;
|
| 1217 |
+
font-size: 16px;
|
| 1218 |
+
color: #5a6570;
|
| 1219 |
+
width: 120px;
|
| 1220 |
+
}
|
| 1221 |
+
.tab3 .first_row, .tab3 .first_row p, .tab3 .first_row p .radio, .tab3 .first_row p label {
|
| 1222 |
+
float: left;
|
| 1223 |
+
}
|
| 1224 |
+
.tab3 .first_row {
|
| 1225 |
+
width: 90%;
|
| 1226 |
+
float: left;
|
| 1227 |
+
}
|
| 1228 |
+
.tab3 .first_row p {
|
| 1229 |
+
padding: 0!important;
|
| 1230 |
+
}
|
| 1231 |
+
.tab3 .first_row p label {
|
| 1232 |
+
line-height: 44px;
|
| 1233 |
+
margin: 0 10px;
|
| 1234 |
+
}
|
| 1235 |
+
.tab3 .first_row p:last-child {
|
| 1236 |
+
margin-left: 27%}
|
| 1237 |
+
.tab3 .tab_1_sav {
|
| 1238 |
+
padding-top: 20px!important;
|
| 1239 |
+
margin: 10px auto 20px;
|
| 1240 |
+
}
|
| 1241 |
+
.suc_msg {
|
| 1242 |
+
background: #12A252;
|
| 1243 |
+
color: #FFF;
|
| 1244 |
+
display: none;
|
| 1245 |
+
font-size: 23px;
|
| 1246 |
+
padding: 10px;
|
| 1247 |
+
text-align: left;
|
| 1248 |
+
text-decoration: none;
|
| 1249 |
+
}
|
| 1250 |
+
.error_msg {
|
| 1251 |
+
background: #D22B30;
|
| 1252 |
+
color: #FFF;
|
| 1253 |
+
display: none;
|
| 1254 |
+
font-size: 23px;
|
| 1255 |
+
padding: 10px;
|
| 1256 |
+
text-align: left;
|
| 1257 |
+
text-decoration: none;
|
| 1258 |
+
}
|
| 1259 |
+
.fileUPInput {
|
| 1260 |
+
cursor: pointer;
|
| 1261 |
+
position: relative;
|
| 1262 |
+
top: -43px;
|
| 1263 |
+
right: 0;
|
| 1264 |
+
z-index: 99;
|
| 1265 |
+
height: 42px;
|
| 1266 |
+
font-size: 5px;
|
| 1267 |
+
opacity: 0;
|
| 1268 |
+
-moz-opacity: 0;
|
| 1269 |
+
filter: alpha(opacity=0);
|
| 1270 |
+
width: 100%}
|
| 1271 |
+
.inputWrapper {
|
| 1272 |
+
height: 20px;
|
| 1273 |
+
width: 50px;
|
| 1274 |
+
overflow: hidden;
|
| 1275 |
+
position: relative;
|
| 1276 |
+
cursor: pointer;
|
| 1277 |
+
}
|
| 1278 |
+
.sfsiplus_custom-txt {
|
| 1279 |
+
background: none!important;
|
| 1280 |
+
padding-left: 2px!important;
|
| 1281 |
+
}
|
| 1282 |
+
.plus_custom-img {
|
| 1283 |
+
float: left;
|
| 1284 |
+
margin-left: 20px;
|
| 1285 |
+
}
|
| 1286 |
+
.loader-img {
|
| 1287 |
+
float: left;
|
| 1288 |
+
margin-left: -70px;
|
| 1289 |
+
display: none;
|
| 1290 |
+
}
|
| 1291 |
+
.pop-overlay {
|
| 1292 |
+
position: fixed;
|
| 1293 |
+
top: 0;
|
| 1294 |
+
left: 0;
|
| 1295 |
+
width: 100%;
|
| 1296 |
+
height: 100%;
|
| 1297 |
+
backgound-color: #d3d3d3;
|
| 1298 |
+
z-index: 10;
|
| 1299 |
+
padding: 20px;
|
| 1300 |
+
display: none;
|
| 1301 |
+
}
|
| 1302 |
+
.fb-overlay {
|
| 1303 |
+
position: fixed;
|
| 1304 |
+
top: 0;
|
| 1305 |
+
left: 0;
|
| 1306 |
+
width: 100%;
|
| 1307 |
+
height: 100%;
|
| 1308 |
+
backgound-color: #d3d3d3;
|
| 1309 |
+
z-index: -1000;
|
| 1310 |
+
padding: 20px;
|
| 1311 |
+
opacity: 0;
|
| 1312 |
+
display: block;
|
| 1313 |
+
}
|
| 1314 |
+
.inputError {
|
| 1315 |
+
border: 1px solid #f80000!important;
|
| 1316 |
+
}
|
| 1317 |
+
.sfsicloseBtn {
|
| 1318 |
+
position: absolute;
|
| 1319 |
+
top: 0;
|
| 1320 |
+
right: 0;
|
| 1321 |
+
cursor: pointer;
|
| 1322 |
+
}
|
| 1323 |
+
.top_arow {
|
| 1324 |
+
background: url(../images/top_aro.png) no-repeat;
|
| 1325 |
+
position: absolute;
|
| 1326 |
+
top: -29px;
|
| 1327 |
+
left: 38%;
|
| 1328 |
+
width: 33px;
|
| 1329 |
+
height: 29px;
|
| 1330 |
+
backgoround-color: #fff;
|
| 1331 |
+
}
|
| 1332 |
+
.sfsi_plus_tool_tip_2 .top_arow .sfsi_plus_inside, .top_arow .sfsi_plus_inside {
|
| 1333 |
+
float: left;
|
| 1334 |
+
}
|
| 1335 |
+
.sfsi_plus_tool_tip_2 .tool_tip>img, .tool_tip>img {
|
| 1336 |
+
display: inline-block;
|
| 1337 |
+
margin-right: 4px;
|
| 1338 |
+
float: left;
|
| 1339 |
+
}
|
| 1340 |
+
.sfsiplus_norm_row {
|
| 1341 |
+
float: left;
|
| 1342 |
+
min-width: 25px;
|
| 1343 |
+
}
|
| 1344 |
+
.sfsiplus_norm_row a {
|
| 1345 |
+
border: none;
|
| 1346 |
+
display: inline-block;
|
| 1347 |
+
position: relative;
|
| 1348 |
+
}
|
| 1349 |
+
.sfsi_plus_widget
|
| 1350 |
+
{
|
| 1351 |
+
min-height: 55px;
|
| 1352 |
+
}
|
| 1353 |
+
.sfsi_plus_tool_tip_2 a {
|
| 1354 |
+
min-height: 0!important;
|
| 1355 |
+
}
|
| 1356 |
+
.sfsi_plus_widget a img {
|
| 1357 |
+
box-shadow: none!important;
|
| 1358 |
+
outline: 0;
|
| 1359 |
+
}
|
| 1360 |
+
.sfsi_plus_wicons {
|
| 1361 |
+
display: inline-block;
|
| 1362 |
+
color: #000;
|
| 1363 |
+
}
|
| 1364 |
+
.sel-active {
|
| 1365 |
+
background-color: #f7941d;
|
| 1366 |
+
}
|
| 1367 |
+
.sfsi_plus_outr_div .close {
|
| 1368 |
+
position: absolute;
|
| 1369 |
+
right: 18px;
|
| 1370 |
+
top: 18px;
|
| 1371 |
+
}
|
| 1372 |
+
.sfsi_plus_outr_div h2 {
|
| 1373 |
+
color: #778088;
|
| 1374 |
+
font-family: helveticaregular;
|
| 1375 |
+
font-size: 26px;
|
| 1376 |
+
margin: 0 0 9px;
|
| 1377 |
+
padding: 0;
|
| 1378 |
+
text-align: center;
|
| 1379 |
+
font-weight: 400;
|
| 1380 |
+
}
|
| 1381 |
+
.sfsi_plus_outr_div ul li a {
|
| 1382 |
+
color: #5A6570;
|
| 1383 |
+
text-decoration: none;
|
| 1384 |
+
}
|
| 1385 |
+
.sfsi_plus_outr_div ul li {
|
| 1386 |
+
display: inline-block;
|
| 1387 |
+
list-style: none;
|
| 1388 |
+
margin: 0;
|
| 1389 |
+
padding: 0;
|
| 1390 |
+
float: none;
|
| 1391 |
+
}
|
| 1392 |
+
.expanded-area {
|
| 1393 |
+
display: none;
|
| 1394 |
+
}
|
| 1395 |
+
.sfsi_plus_wicons a {
|
| 1396 |
+
-webkit-transition: all .2s ease-in-out;
|
| 1397 |
+
-moz-transition: all .2s ease-in-out;
|
| 1398 |
+
-o-transition: all .2s ease-in-out;
|
| 1399 |
+
-ms-transition: all .2s ease-in-out;
|
| 1400 |
+
}
|
| 1401 |
+
.scale, .scale-div {
|
| 1402 |
+
-webkit-transform: scale(1.1);
|
| 1403 |
+
-moz-transform: scale(1.1);
|
| 1404 |
+
-o-transform: scale(1.1);
|
| 1405 |
+
transform: scale(1.1);
|
| 1406 |
+
}
|
| 1407 |
+
.sfsi_plus_Sicons {
|
| 1408 |
+
float: left;
|
| 1409 |
+
}
|
| 1410 |
+
.sfsi_pop_up .button a:hover {
|
| 1411 |
+
color: #fff;
|
| 1412 |
+
}
|
| 1413 |
+
.sfsi_pop_up .button:hover {
|
| 1414 |
+
background: #12a252;
|
| 1415 |
+
color: #fff;
|
| 1416 |
+
border: none;
|
| 1417 |
+
}
|
| 1418 |
+
ul.plus_icn_listing li .sfsiplus_right_info a {
|
| 1419 |
+
outline: 0;
|
| 1420 |
+
font-family: helveticaregular;
|
| 1421 |
+
}
|
| 1422 |
+
ul.sfsiplus_icn_listing8 li .sfsiplus_right_info a {
|
| 1423 |
+
outline: 0;
|
| 1424 |
+
font-family: helveticaregular;
|
| 1425 |
+
}
|
| 1426 |
+
.upload_pop_up .upload_butt {
|
| 1427 |
+
line-height: 27px;
|
| 1428 |
+
margin-left: 6px;
|
| 1429 |
+
}
|
| 1430 |
+
.sfsi_pop_up .addthis_toolbox {
|
| 1431 |
+
width: 80px;
|
| 1432 |
+
margin: 40px auto 0;
|
| 1433 |
+
}
|
| 1434 |
+
a.addthis_button_compact {
|
| 1435 |
+
margin-top: 0;
|
| 1436 |
+
width: auto;
|
| 1437 |
+
}
|
| 1438 |
+
.drop_lsts {
|
| 1439 |
+
left: 220px;
|
| 1440 |
+
position: relative;
|
| 1441 |
+
top: -40px;
|
| 1442 |
+
}
|
| 1443 |
+
.drop_lsts .styled {
|
| 1444 |
+
top: -42px;
|
| 1445 |
+
width: 127px;
|
| 1446 |
+
height: 33px;
|
| 1447 |
+
}
|
| 1448 |
+
.drop_lsts span {
|
| 1449 |
+
line-height: 50px;
|
| 1450 |
+
}
|
| 1451 |
+
.drag_drp {
|
| 1452 |
+
left: 11px;
|
| 1453 |
+
position: relative;
|
| 1454 |
+
top: 38px;
|
| 1455 |
+
font-size: 17px;
|
| 1456 |
+
}
|
| 1457 |
+
.listing ul li label {
|
| 1458 |
+
width: 224px;
|
| 1459 |
+
float: left;
|
| 1460 |
+
}
|
| 1461 |
+
.sfsiplus_row_onl {
|
| 1462 |
+
width: 100%;
|
| 1463 |
+
float: left;
|
| 1464 |
+
}
|
| 1465 |
+
#sfsi_plus_Show_popupOn_PageIDs option.sel-active {
|
| 1466 |
+
background: #f7941d;
|
| 1467 |
+
}
|
| 1468 |
+
.sfsi_plus_inside div iframe {
|
| 1469 |
+
float: left;
|
| 1470 |
+
margin: 0;
|
| 1471 |
+
}
|
| 1472 |
+
.sfsi_plus_inside div #___plus_0, .sfsi_plus_inside div #___plusone_0 {
|
| 1473 |
+
height: 27px;
|
| 1474 |
+
}
|
| 1475 |
+
.sfsi_plus_outr_div li {
|
| 1476 |
+
float: left;
|
| 1477 |
+
}
|
| 1478 |
+
.sfsi_plus_tool_tip_2 .sfsi_plus_inside div {
|
| 1479 |
+
min-height: 0;
|
| 1480 |
+
}
|
| 1481 |
+
#___plus_1>iframe {
|
| 1482 |
+
height: 30px;
|
| 1483 |
+
}
|
| 1484 |
+
.main_contant h1 {
|
| 1485 |
+
margin: 0 0 19px;
|
| 1486 |
+
}
|
| 1487 |
+
.main_contant p {
|
| 1488 |
+
margin: 0 0 26px;
|
| 1489 |
+
}
|
| 1490 |
+
.main_contant p>a {
|
| 1491 |
+
color: #1a1d20;
|
| 1492 |
+
text-decoration: underline;
|
| 1493 |
+
}
|
| 1494 |
+
.tab1 .gary_bg {
|
| 1495 |
+
background: #f1f1f1;
|
| 1496 |
+
}
|
| 1497 |
+
#accordion {
|
| 1498 |
+
margin-top: 4px;
|
| 1499 |
+
}
|
| 1500 |
+
.main_contant p>a, .tab1 p span {
|
| 1501 |
+
font-family: helveticabold;
|
| 1502 |
+
}
|
| 1503 |
+
.wapper .ui-accordion-header-active {
|
| 1504 |
+
margin-top: 20px!important;
|
| 1505 |
+
}
|
| 1506 |
+
.wapper .tab2 {
|
| 1507 |
+
padding: 20px 33px 12px 34px!important;
|
| 1508 |
+
}
|
| 1509 |
+
.wapper .tab2 p {
|
| 1510 |
+
margin-bottom: 6px;
|
| 1511 |
+
}
|
| 1512 |
+
.tab2 .twt_tab_2 label {
|
| 1513 |
+
width: 175px;
|
| 1514 |
+
}
|
| 1515 |
+
.tab2 .twt_fld {
|
| 1516 |
+
margin: 16px 0 23px;
|
| 1517 |
+
float: left;
|
| 1518 |
+
}
|
| 1519 |
+
.tab2 .twt_fld_2 {
|
| 1520 |
+
margin: 0 0 12px;
|
| 1521 |
+
float: left;
|
| 1522 |
+
}
|
| 1523 |
+
.tab2 .google_in {
|
| 1524 |
+
margin: 0 0 8px 94px;
|
| 1525 |
+
float: left;
|
| 1526 |
+
}
|
| 1527 |
+
.tab2 .google_in p.radio_section {
|
| 1528 |
+
padding-top: 8px!important;
|
| 1529 |
+
}
|
| 1530 |
+
.tab2 .google_in .fb_url input.add {
|
| 1531 |
+
width: 417px!important;
|
| 1532 |
+
}
|
| 1533 |
+
.tab2 .utube_inn {
|
| 1534 |
+
padding-bottom: 2px;
|
| 1535 |
+
float: left;
|
| 1536 |
+
}
|
| 1537 |
+
.tab2 .utube_inn label {
|
| 1538 |
+
max-width: 90%}
|
| 1539 |
+
.tab2 .utube_inn label span {
|
| 1540 |
+
font-family: helveticabold;
|
| 1541 |
+
}
|
| 1542 |
+
.tab2 .inr_cont p>a {
|
| 1543 |
+
font-family: helveticabold;
|
| 1544 |
+
color: #778088;
|
| 1545 |
+
text-decoration: none;
|
| 1546 |
+
}
|
| 1547 |
+
.sfsiplus_pinterest_section .inr_cont .pint_url {
|
| 1548 |
+
float: left;
|
| 1549 |
+
padding-top: 6px;
|
| 1550 |
+
clear: both;
|
| 1551 |
+
}
|
| 1552 |
+
.sfsiplus_pinterest_section .inr_cont .add {
|
| 1553 |
+
width: 417px!important;
|
| 1554 |
+
}
|
| 1555 |
+
.sfsiplus_linkedin_section .link_1, .sfsiplus_linkedin_section .link_2, .sfsiplus_linkedin_section .link_3, .sfsiplus_linkedin_section .link_4 {
|
| 1556 |
+
float: left;
|
| 1557 |
+
width: 100%}
|
| 1558 |
+
.sfsiplus_linkedin_section .link_1 input.add, .sfsiplus_linkedin_section .link_2 input.add, .sfsiplus_linkedin_section .link_3 input.add, .sfsiplus_linkedin_section .link_4 input.add {
|
| 1559 |
+
width: 417px;
|
| 1560 |
+
}
|
| 1561 |
+
.sfsiplus_linkedin_section .link_1 {
|
| 1562 |
+
margin-bottom: 7px;
|
| 1563 |
+
}
|
| 1564 |
+
.sfsiplus_linkedin_section .link_2 {
|
| 1565 |
+
margin-bottom: 12px;
|
| 1566 |
+
}
|
| 1567 |
+
.sfsiplus_linkedin_section .link_3, .sfsiplus_linkedin_section .link_4 {
|
| 1568 |
+
margin-bottom: 13px;
|
| 1569 |
+
}
|
| 1570 |
+
.tab2 .sfsiplus_linkedin_section .link_4 {
|
| 1571 |
+
margin-bottom: 0;
|
| 1572 |
+
}
|
| 1573 |
+
ul.tab_3_list li span {
|
| 1574 |
+
font-family: helveticabold;
|
| 1575 |
+
}
|
| 1576 |
+
.tab3 .Shuffle_auto {
|
| 1577 |
+
float: left;
|
| 1578 |
+
width: 80%;
|
| 1579 |
+
position: relative;
|
| 1580 |
+
top: -93px;
|
| 1581 |
+
}
|
| 1582 |
+
#accordion .tab4 h4, #accordion1 .tab4 h4 {
|
| 1583 |
+
|
| 1584 |
+
color: #414951;
|
| 1585 |
+
font-size: 20px;
|
| 1586 |
+
}
|
| 1587 |
+
.sfsiplus_specify_counts .listing li .input {
|
| 1588 |
+
width: 73px;
|
| 1589 |
+
}
|
| 1590 |
+
.sfsiplus_fbpgidwpr{width: 160px; float: left; font-weight: bold; font-size: 17px; color: #000000;}
|
| 1591 |
+
.sfsiplus_fbpgiddesc{font-weight: normal; width: 100%; font-size: 14px; color: #888888;padding: 4px 0 0 60px; }
|
| 1592 |
+
.sfsiplus_fbpgiddesc code
|
| 1593 |
+
{
|
| 1594 |
+
background: none repeat scroll 0 0 transparent;
|
| 1595 |
+
padding-right: 0px;
|
| 1596 |
+
padding-left: 0px;
|
| 1597 |
+
|
| 1598 |
+
}
|
| 1599 |
+
.sfsiplus_specify_counts .listing li .input.mypginpt {
|
| 1600 |
+
width: 288px;
|
| 1601 |
+
}
|
| 1602 |
+
.tab3 .Shuffle_auto .sub_sub_box .tab_3_option {
|
| 1603 |
+
padding-top: 0!important;
|
| 1604 |
+
margin-bottom: 10px!important;
|
| 1605 |
+
}
|
| 1606 |
+
.tab3 .sub_row {
|
| 1607 |
+
margin-top: 10px!important;
|
| 1608 |
+
}
|
| 1609 |
+
.tab4 {
|
| 1610 |
+
padding-top: 35px!important;
|
| 1611 |
+
}
|
| 1612 |
+
.tab4 .save_button {
|
| 1613 |
+
padding-top: 46px;
|
| 1614 |
+
}
|
| 1615 |
+
.tab5 {
|
| 1616 |
+
padding-top: 31px!important;
|
| 1617 |
+
}
|
| 1618 |
+
.tab6, .tab7 {
|
| 1619 |
+
padding-top: 28px!important;
|
| 1620 |
+
}
|
| 1621 |
+
.tab5 .sfsiplus_row_onl {
|
| 1622 |
+
margin-top: 15px;
|
| 1623 |
+
}
|
| 1624 |
+
.tab5 .sticking .link>a {
|
| 1625 |
+
color: #a4a9ad;
|
| 1626 |
+
text-decoration: underline;
|
| 1627 |
+
}
|
| 1628 |
+
.tab5 .mouse_txt h4 {
|
| 1629 |
+
margin-bottom: 8px!important;
|
| 1630 |
+
}
|
| 1631 |
+
.tab5 .save_button {
|
| 1632 |
+
padding-top: 54px;
|
| 1633 |
+
}
|
| 1634 |
+
.tab7 .like_pop_box h2 {
|
| 1635 |
+
font-family: helveticabold;
|
| 1636 |
+
text-align: center;
|
| 1637 |
+
color: #414951;
|
| 1638 |
+
font-size: 26px;
|
| 1639 |
+
}
|
| 1640 |
+
.tab1 ul.plus_icn_listing li .sfsiplus_right_info label:hover {
|
| 1641 |
+
text-decoration: none!important;
|
| 1642 |
+
}
|
| 1643 |
+
.tab1 ul.plus_icn_listing li .sfsiplus_right_info label.expanded-area {
|
| 1644 |
+
clear: both;
|
| 1645 |
+
float: left;
|
| 1646 |
+
margin-top: 14px;
|
| 1647 |
+
}
|
| 1648 |
+
.tab7 .space {
|
| 1649 |
+
margin-top: 14px;
|
| 1650 |
+
}
|
| 1651 |
+
.tab7 .pop_up_show label {
|
| 1652 |
+
font-family: helveticaregular!important;
|
| 1653 |
+
}
|
| 1654 |
+
.tab7 .save_button {
|
| 1655 |
+
padding-top: 78px;
|
| 1656 |
+
}
|
| 1657 |
+
.like_txt a {
|
| 1658 |
+
text-decoration: none;
|
| 1659 |
+
font-family: helveticaregular;
|
| 1660 |
+
}
|
| 1661 |
+
.bdr_btm_non {
|
| 1662 |
+
border-bottom: none!important;
|
| 1663 |
+
}
|
| 1664 |
+
.tab1 .tab_1_sav {
|
| 1665 |
+
padding-top: 13px;
|
| 1666 |
+
}
|
| 1667 |
+
#accordion .tab2 .sfsiplus_facebook_section .inr_cont p.extra_sp, #accordion1 .tab2 .sfsiplus_facebook_section .inr_cont p.extra_sp {
|
| 1668 |
+
padding-top: 7px;
|
| 1669 |
+
}
|
| 1670 |
+
.tab2 .sfsiplus_custom_section {
|
| 1671 |
+
width: 100%}
|
| 1672 |
+
.tab7 {
|
| 1673 |
+
padding-bottom: 40px!important;
|
| 1674 |
+
}
|
| 1675 |
+
.tab8 .save_button {
|
| 1676 |
+
padding-top: 0px;
|
| 1677 |
+
}
|
| 1678 |
+
.tab10 .save_button a {
|
| 1679 |
+
padding: 16px 0;
|
| 1680 |
+
}
|
| 1681 |
+
.tab2 .sfsiplus_twitter_section .twt_fld input.add, .tab2 .sfsiplus_twitter_section .twt_fld_2 textarea.add_txt {
|
| 1682 |
+
width: 464px!important;
|
| 1683 |
+
}
|
| 1684 |
+
.tab2 .utube_inn .fb_url label span {
|
| 1685 |
+
font-family: helveticaregular;
|
| 1686 |
+
}
|
| 1687 |
+
.tab1 label, .tab2 label, .tab3 label, .tab4 label, .tab5 label, .tab6 label, .tab7 label, .tab8 label, .tab9 label {
|
| 1688 |
+
cursor: default!important;
|
| 1689 |
+
}
|
| 1690 |
+
.tab5 .new_wind h4 {
|
| 1691 |
+
margin-bottom: 11px!important;
|
| 1692 |
+
}
|
| 1693 |
+
.pop_up_box .fb_2 span {
|
| 1694 |
+
height: 28px!important;
|
| 1695 |
+
}
|
| 1696 |
+
.pop_up_box .sfsi_plus_tool_tip_2 .fbb .fb_1 a {
|
| 1697 |
+
margin-top: 0;
|
| 1698 |
+
}
|
| 1699 |
+
.tab6 .social_icon_like1 ul li span {
|
| 1700 |
+
margin-top: -1px;
|
| 1701 |
+
}
|
| 1702 |
+
#sfpluspageLoad {
|
| 1703 |
+
background: url(../images/ajax-loader.gif) 50% 50% no-repeat #F9F9F9;
|
| 1704 |
+
height: 100%;
|
| 1705 |
+
left: 160px;
|
| 1706 |
+
opacity: 1;
|
| 1707 |
+
position: fixed;
|
| 1708 |
+
top: 0;
|
| 1709 |
+
width: 89%;
|
| 1710 |
+
z-index: 9999;
|
| 1711 |
+
}
|
| 1712 |
+
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 1713 |
+
background: #FFF;
|
| 1714 |
+
border: 1px solid #e7e7e7;
|
| 1715 |
+
box-shadow: #e7e7e7 0 0 2px 1px;
|
| 1716 |
+
display: block;
|
| 1717 |
+
float: left;
|
| 1718 |
+
margin: 0 0 0 -52px;
|
| 1719 |
+
/*padding: 5px 14px 5px 14px;*/
|
| 1720 |
+
position: absolute;
|
| 1721 |
+
z-index: 10000;
|
| 1722 |
+
border-bottom: #e5e5e5 solid 4px;
|
| 1723 |
+
width: 100px;
|
| 1724 |
+
}
|
| 1725 |
+
.sfsi_plus_tool_tip_2 {
|
| 1726 |
+
display: inline-table;
|
| 1727 |
+
}
|
| 1728 |
+
.sfsiplus_inerCnt, .sfsiplus_inerCnt:hover, .sfsiplus_inerCnt>a, .sfsiplus_inerCnt>a:hover, .widget-area .widget a {
|
| 1729 |
+
outline: 0;
|
| 1730 |
+
}
|
| 1731 |
+
.sfsi_plus_tool_tip_2_inr {
|
| 1732 |
+
bottom: 90%;
|
| 1733 |
+
left: 20%;
|
| 1734 |
+
opacity: 0;
|
| 1735 |
+
}
|
| 1736 |
+
.sfsi_plus_tool_tip_2 .bot_arow {
|
| 1737 |
+
background: url(../images/bot_tip_icn.png) no-repeat;
|
| 1738 |
+
position: absolute;
|
| 1739 |
+
bottom: -21px;
|
| 1740 |
+
left: 50%;
|
| 1741 |
+
width: 15px;
|
| 1742 |
+
height: 21px;
|
| 1743 |
+
margin-left: -10px;
|
| 1744 |
+
}
|
| 1745 |
+
.sfsi_plus_tool_tip_2 .top_big_arow {
|
| 1746 |
+
position: absolute;
|
| 1747 |
+
-webkit-transform: rotate(180deg);
|
| 1748 |
+
-moz-transform: rotate(180deg);
|
| 1749 |
+
-ms-transform: rotate(180deg);
|
| 1750 |
+
-o-transform: rotate(180deg);
|
| 1751 |
+
transform: rotate(180deg);
|
| 1752 |
+
top: -21px;
|
| 1753 |
+
left: 46%;
|
| 1754 |
+
width: 15px;
|
| 1755 |
+
height: 21px;
|
| 1756 |
+
margin-right: -5px;
|
| 1757 |
+
}
|
| 1758 |
+
.sfsi_plus_tool_tip_2_inr .gpls_visit>a, .sfsi_plus_tool_tip_2_inr .prints_visit_1 a, .sfsi_plus_tool_tip_2_inr .utub_visit>a {
|
| 1759 |
+
margin-top: 0;
|
| 1760 |
+
}
|
| 1761 |
+
.sfsi_plus_tool_tip_2_inr .linkin_1 a, .sfsi_plus_tool_tip_2_inr .linkin_2 a, .sfsi_plus_tool_tip_2_inr .linkin_3 a, .sfsi_plus_tool_tip_2_inr .linkin_4 a, .sfsi_plus_tool_tip_2_inr .prints_visit a {
|
| 1762 |
+
margin: 0;
|
| 1763 |
+
}
|
| 1764 |
+
.sfsiTlleftBig {
|
| 1765 |
+
bottom: 121%;
|
| 1766 |
+
left: 22%;
|
| 1767 |
+
margin-left: -54%}
|
| 1768 |
+
.sfsi_plus_Tlleft {
|
| 1769 |
+
bottom: 100%;
|
| 1770 |
+
left: 50%;
|
| 1771 |
+
margin-left: -66px !important;
|
| 1772 |
+
margin-bottom: 2px;
|
| 1773 |
+
}
|
| 1774 |
+
.sfsi_plc_btm {
|
| 1775 |
+
bottom: auto;
|
| 1776 |
+
top: 100%;
|
| 1777 |
+
left: 50%;
|
| 1778 |
+
margin-left: -63px;
|
| 1779 |
+
margin-top: 8px;
|
| 1780 |
+
margin-bottom: auto;
|
| 1781 |
+
}
|
| 1782 |
+
.sfsiplus_inerCnt {
|
| 1783 |
+
position: relative;
|
| 1784 |
+
z-index: inherit!important;
|
| 1785 |
+
float: left;
|
| 1786 |
+
width: 100%;
|
| 1787 |
+
float: left;
|
| 1788 |
+
}
|
| 1789 |
+
.sfsi_plus_wicons {
|
| 1790 |
+
margin-bottom: 30px;
|
| 1791 |
+
position: relative;
|
| 1792 |
+
padding-top: 5px;
|
| 1793 |
+
}
|
| 1794 |
+
.sfsiplus_norm_row .bot_no {
|
| 1795 |
+
position: absolute;
|
| 1796 |
+
padding: 1px 0;
|
| 1797 |
+
font-size: 12px!important;
|
| 1798 |
+
text-align: center;
|
| 1799 |
+
line-height: 12px!important;
|
| 1800 |
+
background: #fff;
|
| 1801 |
+
border-radius: 5px;
|
| 1802 |
+
left: 50%;
|
| 1803 |
+
margin-left: -20px;
|
| 1804 |
+
z-index: 9;
|
| 1805 |
+
border: 1px solid #333;
|
| 1806 |
+
top: 100%;
|
| 1807 |
+
white-space: pre;
|
| 1808 |
+
-webkit-box-sizing: border-box;
|
| 1809 |
+
-moz-box-sizing: border-box;
|
| 1810 |
+
box-sizing: border-box;
|
| 1811 |
+
margin-top: 10px;
|
| 1812 |
+
width: 40px;
|
| 1813 |
+
}
|
| 1814 |
+
.sfsiplus_norm_row .bot_no:before {
|
| 1815 |
+
content: url(images/count_top_arow.png);
|
| 1816 |
+
position: absolute;
|
| 1817 |
+
height: 9px;
|
| 1818 |
+
margin-left: -7.5px;
|
| 1819 |
+
top: -10px;
|
| 1820 |
+
left: 50%;
|
| 1821 |
+
width: 15px;
|
| 1822 |
+
}
|
| 1823 |
+
/*.sf_subscrbe .bot_no:before
|
| 1824 |
+
{
|
| 1825 |
+
content: url(images/count_left_arow.png);
|
| 1826 |
+
height: 9px;
|
| 1827 |
+
left: 0;
|
| 1828 |
+
margin-left: -12px;
|
| 1829 |
+
position: absolute;
|
| 1830 |
+
top: 0px;
|
| 1831 |
+
width: 15px;
|
| 1832 |
+
}*/
|
| 1833 |
+
.sf_subscrbe .bot_no
|
| 1834 |
+
{
|
| 1835 |
+
background: rgba(0, 0, 0, 0) url(images/count_left_arow.png) no-repeat scroll 0 0 / 27px auto;
|
| 1836 |
+
font-size: 12px !important;
|
| 1837 |
+
left: 67px;
|
| 1838 |
+
line-height: 17px !important;
|
| 1839 |
+
margin-left: 0px;
|
| 1840 |
+
/* margin-top: 9px;*/
|
| 1841 |
+
padding: 1px 0;
|
| 1842 |
+
/*position: absolute;*/
|
| 1843 |
+
text-align: center;
|
| 1844 |
+
/*top: -8px;*/
|
| 1845 |
+
white-space: pre;
|
| 1846 |
+
width: 33px;
|
| 1847 |
+
height: 19px;
|
| 1848 |
+
z-index: 9;
|
| 1849 |
+
display:inline-block;
|
| 1850 |
+
}
|
| 1851 |
+
.bot_no.sfsiSmBtn {
|
| 1852 |
+
font-size: 10px;
|
| 1853 |
+
margin-top: 4px;
|
| 1854 |
+
}
|
| 1855 |
+
.bot_no.sfsiSmBtn:before {
|
| 1856 |
+
margin-left: -8px;
|
| 1857 |
+
top: -9px;
|
| 1858 |
+
}
|
| 1859 |
+
.sfsiplus_norm_row .cbtn_vsmall {
|
| 1860 |
+
font-size: 9px;
|
| 1861 |
+
left: -28%;
|
| 1862 |
+
top: 4px;
|
| 1863 |
+
}
|
| 1864 |
+
.sfsiplus_norm_row .cbtn_vsmall:before {
|
| 1865 |
+
left: 31%;
|
| 1866 |
+
top: -9px;
|
| 1867 |
+
margin-left: -31%}
|
| 1868 |
+
h2.optional {
|
| 1869 |
+
font-family: helveticaregular;
|
| 1870 |
+
font-size: 25px;
|
| 1871 |
+
margin: 14px 0 19px;
|
| 1872 |
+
color: #5a6570;
|
| 1873 |
+
}
|
| 1874 |
+
.utube_tool_bdr .utub_visit {
|
| 1875 |
+
margin: 9px 0 0;
|
| 1876 |
+
height: 24px;
|
| 1877 |
+
display: inline-block;
|
| 1878 |
+
float: none;
|
| 1879 |
+
}
|
| 1880 |
+
.utube_tool_bdr .utub_2 {
|
| 1881 |
+
margin: 9px 0 0;
|
| 1882 |
+
height: 24px;
|
| 1883 |
+
width: 86px;
|
| 1884 |
+
display: inline-block;
|
| 1885 |
+
float: none;
|
| 1886 |
+
}
|
| 1887 |
+
.sfsi_plus_printst_tool_bdr {
|
| 1888 |
+
width: 79px;
|
| 1889 |
+
}
|
| 1890 |
+
.sfsi_plus_printst_tool_bdr .prints_visit {
|
| 1891 |
+
margin: 0 0 10px -22px;
|
| 1892 |
+
}
|
| 1893 |
+
.sfsi_plus_printst_tool_bdr .prints_visit_1 {
|
| 1894 |
+
margin: 0 0 0 -53px;
|
| 1895 |
+
}
|
| 1896 |
+
.sfsi_plus_fb_tool_bdr {
|
| 1897 |
+
width: 68px;
|
| 1898 |
+
height: auto;
|
| 1899 |
+
}
|
| 1900 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside {
|
| 1901 |
+
text-align: center;
|
| 1902 |
+
width: 100%;
|
| 1903 |
+
float: left;
|
| 1904 |
+
overflow: hidden;
|
| 1905 |
+
}
|
| 1906 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1 {
|
| 1907 |
+
margin: 2px 0 2px 0;
|
| 1908 |
+
height: 28px;
|
| 1909 |
+
display: inline-block;
|
| 1910 |
+
float: none;
|
| 1911 |
+
/* width: 62px;s*/
|
| 1912 |
+
}
|
| 1913 |
+
.sfsi_plus_inside img
|
| 1914 |
+
{
|
| 1915 |
+
vertical-align:sub !important;
|
| 1916 |
+
}
|
| 1917 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon2
|
| 1918 |
+
{
|
| 1919 |
+
margin: 2px 0 2px 0 ;
|
| 1920 |
+
height: 20px;
|
| 1921 |
+
/* width: 49px;*/
|
| 1922 |
+
display:block;
|
| 1923 |
+
overflow: hidden;
|
| 1924 |
+
}
|
| 1925 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon3 {
|
| 1926 |
+
margin: 2px 0 2px 0;
|
| 1927 |
+
height: 20px;
|
| 1928 |
+
/* width: 62px;*/
|
| 1929 |
+
display:inline-block;
|
| 1930 |
+
float: none;
|
| 1931 |
+
}
|
| 1932 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_1, .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_2, .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .fb_3 {
|
| 1933 |
+
margin: 9px 0 0;
|
| 1934 |
+
height: 25px;
|
| 1935 |
+
}
|
| 1936 |
+
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside {
|
| 1937 |
+
text-align: center;
|
| 1938 |
+
float: left;
|
| 1939 |
+
width: 100%}
|
| 1940 |
+
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon1{
|
| 1941 |
+
margin: 2px 0;
|
| 1942 |
+
height: 24px;
|
| 1943 |
+
display: inline-block;
|
| 1944 |
+
float: none;
|
| 1945 |
+
/*width: 73px;*/
|
| 1946 |
+
}
|
| 1947 |
+
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon2 {
|
| 1948 |
+
margin: 2px 0;
|
| 1949 |
+
height: 20px;
|
| 1950 |
+
display:inline-block;
|
| 1951 |
+
float: none;
|
| 1952 |
+
/*max-width: 73px;*/
|
| 1953 |
+
width: 100%;
|
| 1954 |
+
}
|
| 1955 |
+
.sfsi_plus_printst_tool_bdr .sfsi_plus_inside .prints_visit, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .prints_visit_1 {
|
| 1956 |
+
margin: 9px 0 0;
|
| 1957 |
+
height: 20px;
|
| 1958 |
+
float: none;
|
| 1959 |
+
display: inline-block;
|
| 1960 |
+
}
|
| 1961 |
+
.sfsi_plus_printst_tool_bdr {
|
| 1962 |
+
/* margin-left: -59px;*/
|
| 1963 |
+
}
|
| 1964 |
+
.sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4>a>img, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon1>a>img, .sfsi_plus_printst_tool_bdr .sfsi_plus_inside .icon2>a>img, .utube_tool_bdr .sfsi_plus_inside .icon1>a>img {
|
| 1965 |
+
padding-top: 0;
|
| 1966 |
+
}
|
| 1967 |
+
.sfsi_plus_gpls_tool_bdr {
|
| 1968 |
+
width: 76px;
|
| 1969 |
+
}
|
| 1970 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1>a>img {
|
| 1971 |
+
padding-top: 0;
|
| 1972 |
+
}
|
| 1973 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside {
|
| 1974 |
+
text-align: center;
|
| 1975 |
+
width: 100%;
|
| 1976 |
+
float: left;
|
| 1977 |
+
}
|
| 1978 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1 {
|
| 1979 |
+
margin: 2px 0;
|
| 1980 |
+
display: inline-block;
|
| 1981 |
+
float: none;
|
| 1982 |
+
height: 29px;
|
| 1983 |
+
/*width: 76px;*/
|
| 1984 |
+
}
|
| 1985 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon2 {
|
| 1986 |
+
margin: 2px 0 2px 0;
|
| 1987 |
+
display:inline-block;
|
| 1988 |
+
float: none;
|
| 1989 |
+
height: 24px;
|
| 1990 |
+
width:100%;
|
| 1991 |
+
/* width: 38px;*/
|
| 1992 |
+
}
|
| 1993 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon3 {
|
| 1994 |
+
margin: 2px 0 2px 0;
|
| 1995 |
+
display:block;
|
| 1996 |
+
float: none;
|
| 1997 |
+
height: 24px;
|
| 1998 |
+
/* width: 76px;
|
| 1999 |
+
*/}
|
| 2000 |
+
.sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gpls_visit, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gtalk_2, .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .gtalk_3 {
|
| 2001 |
+
margin: 9px 0 0;
|
| 2002 |
+
height: 29px;
|
| 2003 |
+
}
|
| 2004 |
+
.sfsi_plus_fb_tool_bdr, .sfsi_plus_gpls_tool_bdr, .sfsi_plus_linkedin_tool_bdr, .sfsi_plus_printst_tool_bdr, .sfsi_plus_twt_tool_bdr {
|
| 2005 |
+
bottom: 100%;
|
| 2006 |
+
left: 50%;
|
| 2007 |
+
margin-bottom: 2px;
|
| 2008 |
+
}
|
| 2009 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside {
|
| 2010 |
+
text-align: center;
|
| 2011 |
+
width: 100%;
|
| 2012 |
+
float: left;
|
| 2013 |
+
}
|
| 2014 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 {
|
| 2015 |
+
margin: 2px 0!important;
|
| 2016 |
+
display: inline-block;
|
| 2017 |
+
float: none;
|
| 2018 |
+
vertical-align: middle;
|
| 2019 |
+
overflow: hidden;
|
| 2020 |
+
/*width: 100%;*/
|
| 2021 |
+
}
|
| 2022 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a {
|
| 2023 |
+
display: inline-block;
|
| 2024 |
+
vertical-align: middle;
|
| 2025 |
+
/*width: 100%;*/
|
| 2026 |
+
width:auto;
|
| 2027 |
+
}
|
| 2028 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a img{
|
| 2029 |
+
float: left;
|
| 2030 |
+
}
|
| 2031 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1 {
|
| 2032 |
+
margin: 2px 24px 2px !important;
|
| 2033 |
+
display: inline-block;
|
| 2034 |
+
float: none;
|
| 2035 |
+
/*width: 61px;*/
|
| 2036 |
+
overflow: hidden;
|
| 2037 |
+
height: 20px;
|
| 2038 |
+
}
|
| 2039 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1 iframe {
|
| 2040 |
+
/* width: 61px!important;*/
|
| 2041 |
+
}
|
| 2042 |
+
.sfsi_plus_tool_tip_2, .sfsi_plus_fb_tool_bdr, .sfsi_plus_twt_tool_bdr, .sfsi_plus_linkedin_tool_bdr, .sfsi_plus_printst_tool_bdr, .sfsi_plus_gpls_tool_bdr, .sfsi_plus_Tlleft {width:140px !important; padding:6px 0;}
|
| 2043 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon2 {
|
| 2044 |
+
margin: 0px 0!important;
|
| 2045 |
+
display:inline-block;
|
| 2046 |
+
float: none;
|
| 2047 |
+
height: 20px;
|
| 2048 |
+
/* width: 58px;s*/
|
| 2049 |
+
}
|
| 2050 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_1 {
|
| 2051 |
+
margin: 9px 0 0;
|
| 2052 |
+
display: inline-block;
|
| 2053 |
+
float: none;
|
| 2054 |
+
width: 58px;
|
| 2055 |
+
height: 20px;
|
| 2056 |
+
overflow: hidden;
|
| 2057 |
+
}
|
| 2058 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_1 iframe {
|
| 2059 |
+
width: 100%!important;
|
| 2060 |
+
}
|
| 2061 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .twt_2 {
|
| 2062 |
+
margin: 9px 0 0;
|
| 2063 |
+
height: 20px;
|
| 2064 |
+
display: inline-block;
|
| 2065 |
+
float: none;
|
| 2066 |
+
width: 58px;
|
| 2067 |
+
}
|
| 2068 |
+
.utube_tool_bdr .sfsi_plus_inside {
|
| 2069 |
+
text-align: center;
|
| 2070 |
+
width: 100%;
|
| 2071 |
+
float: left;
|
| 2072 |
+
}
|
| 2073 |
+
.sfsi_plus_inside > div {}
|
| 2074 |
+
.utube_tool_bdr .sfsi_plus_inside .icon1{
|
| 2075 |
+
margin: 2px 0 2px;
|
| 2076 |
+
height: 24px;
|
| 2077 |
+
display: inline-block;
|
| 2078 |
+
float: none;
|
| 2079 |
+
width: 87px;
|
| 2080 |
+
}
|
| 2081 |
+
.utube_tool_bdr .sfsi_plus_inside .icon2 {
|
| 2082 |
+
margin: 2px 0 2;
|
| 2083 |
+
height: 24px;
|
| 2084 |
+
display:inline-block;
|
| 2085 |
+
float: none;
|
| 2086 |
+
min-width: 100px;
|
| 2087 |
+
width: auto;
|
| 2088 |
+
}
|
| 2089 |
+
.utube_tool_bdr {
|
| 2090 |
+
width: 93px;
|
| 2091 |
+
bottom: 100%;
|
| 2092 |
+
left: 50%;
|
| 2093 |
+
margin-bottom: 2px;
|
| 2094 |
+
}
|
| 2095 |
+
.sfsi_plus_linkedin_tool_bdr {
|
| 2096 |
+
width: 66px;
|
| 2097 |
+
}
|
| 2098 |
+
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside {
|
| 2099 |
+
text-align: center;
|
| 2100 |
+
float: left;
|
| 2101 |
+
width: 100%}
|
| 2102 |
+
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1{
|
| 2103 |
+
margin: 2px 0;
|
| 2104 |
+
display: inline-block;
|
| 2105 |
+
float: none;
|
| 2106 |
+
height: 23px;
|
| 2107 |
+
width: 100%;
|
| 2108 |
+
}
|
| 2109 |
+
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon2{
|
| 2110 |
+
margin: 2px 0;
|
| 2111 |
+
display:inline-block;
|
| 2112 |
+
float: none;
|
| 2113 |
+
height: 23px;
|
| 2114 |
+
width: 100%;
|
| 2115 |
+
}
|
| 2116 |
+
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon3 {
|
| 2117 |
+
margin: 2px 0;
|
| 2118 |
+
display:inline-block;
|
| 2119 |
+
float: none;
|
| 2120 |
+
height: 23px;
|
| 2121 |
+
width: 100%;
|
| 2122 |
+
}
|
| 2123 |
+
|
| 2124 |
+
|
| 2125 |
+
.sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4 {
|
| 2126 |
+
margin: 2px 0;
|
| 2127 |
+
display: inline-block;
|
| 2128 |
+
float: none;
|
| 2129 |
+
height: 28px;
|
| 2130 |
+
width: 66px;
|
| 2131 |
+
}
|
| 2132 |
+
.sfsi_plus_FrntInner .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon1{ margin: 2px 0;}
|
| 2133 |
+
.sfsi_plus_widget .sfsi_plus_linkedin_tool_bdr .sfsi_plus_inside .icon4,
|
| 2134 |
+
.sfsi_plus_widget .sfsi_plus_gpls_tool_bdr .sfsi_plus_inside .icon1,
|
| 2135 |
+
.sfsi_plus_widget .sfsi_plus_fb_tool_bdr .sfsi_plus_inside .icon1 { height: auto}
|
| 2136 |
+
|
| 2137 |
+
.sfsi_plus_linkedin_tool_bdr .linkin_1, .sfsi_plus_linkedin_tool_bdr .linkin_2, .sfsi_plus_linkedin_tool_bdr .linkin_3, .sfsi_plus_linkedin_tool_bdr .linkin_4 {
|
| 2138 |
+
margin: 9px 0 0!important;
|
| 2139 |
+
height: 20px;
|
| 2140 |
+
display: inline-block;
|
| 2141 |
+
float: none;
|
| 2142 |
+
overflow: hidden;
|
| 2143 |
+
}
|
| 2144 |
+
.sfsi_plus_twt_tool_bdr {
|
| 2145 |
+
width: 62px;
|
| 2146 |
+
height: auto;
|
| 2147 |
+
}
|
| 2148 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1>iframe {
|
| 2149 |
+
margin: 0px auto!important;
|
| 2150 |
+
float: left !important;
|
| 2151 |
+
width: 100%}
|
| 2152 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1>iframe #widget {
|
| 2153 |
+
text-align: center;
|
| 2154 |
+
}
|
| 2155 |
+
.sfsi_pop_up .button {
|
| 2156 |
+
border: none;
|
| 2157 |
+
padding: 0;
|
| 2158 |
+
}
|
| 2159 |
+
.pop_up_box .button a {
|
| 2160 |
+
color: #fff;
|
| 2161 |
+
line-height: normal;
|
| 2162 |
+
font-size: 22px;
|
| 2163 |
+
text-decoration: none;
|
| 2164 |
+
text-align: center;
|
| 2165 |
+
width: 482px;
|
| 2166 |
+
height: 80px;
|
| 2167 |
+
margin: 0;
|
| 2168 |
+
display: table-cell;
|
| 2169 |
+
vertical-align: middle;
|
| 2170 |
+
font-family: helveticabold;
|
| 2171 |
+
padding: 0 10px;
|
| 2172 |
+
}
|
| 2173 |
+
.tab3 ul.sfsiplus_tab_3_icns li .radio {
|
| 2174 |
+
margin-top: 7px;
|
| 2175 |
+
}
|
| 2176 |
+
.tab3 ul.sfsiplus_tab_3_icns li label { line-height: 50px!important; margin-left: 20px;}
|
| 2177 |
+
.sfsi_mainContainer input[type=email], .sfsi_mainContainer input[type=number], .sfsi_mainContainer input[type=password], .sfsi_mainContainer input[type=search], .sfsi_mainContainer input[type=tel], .sfsi_mainContainer input[type=text], .sfsi_mainContainer input[type=url], .sfsi_mainContainer select, .sfsi_mainContainer textarea {
|
| 2178 |
+
color: #5a6570!important;
|
| 2179 |
+
}
|
| 2180 |
+
.adminTooltip {
|
| 2181 |
+
left: 142px;
|
| 2182 |
+
position: absolute;
|
| 2183 |
+
}
|
| 2184 |
+
.adPopWidth {
|
| 2185 |
+
min-height: 100px!important;
|
| 2186 |
+
}
|
| 2187 |
+
.main_contant p>a.lit_txt, .tab4 p>a {
|
| 2188 |
+
font-family: helveticaregular;
|
| 2189 |
+
color: #414951;
|
| 2190 |
+
}
|
| 2191 |
+
.tab1 ul.plus_icn_listing li .sfsiplus_custom-txt {
|
| 2192 |
+
margin-left: 5px;
|
| 2193 |
+
}
|
| 2194 |
+
.tab1 ul.plus_icn_listing li .custom-img {
|
| 2195 |
+
margin-left: 18px;
|
| 2196 |
+
}
|
| 2197 |
+
.sfsiplus_linkedin_section .link_4>label.anthr_labl {
|
| 2198 |
+
height: 94px;
|
| 2199 |
+
}
|
| 2200 |
+
.tab3 .tab_3_sav {
|
| 2201 |
+
padding-top: 0;
|
| 2202 |
+
margin: -69px auto 20px;
|
| 2203 |
+
position: relative;
|
| 2204 |
+
z-index: 9;
|
| 2205 |
+
}
|
| 2206 |
+
.mediam_txt {
|
| 2207 |
+
font-family: helveticabold;
|
| 2208 |
+
}
|
| 2209 |
+
.sfsiCtxt {
|
| 2210 |
+
line-height: 51px;
|
| 2211 |
+
font-family: helveticaregular;
|
| 2212 |
+
font-size: 22px;
|
| 2213 |
+
float: left;
|
| 2214 |
+
padding-left: 19px;
|
| 2215 |
+
color: #5a6570;
|
| 2216 |
+
}
|
| 2217 |
+
.customstep2-img {
|
| 2218 |
+
width: 51px;
|
| 2219 |
+
float: left;
|
| 2220 |
+
}
|
| 2221 |
+
.tab2 .row h2.custom {
|
| 2222 |
+
margin: 15px 0 7px 21px;
|
| 2223 |
+
height: 52px;
|
| 2224 |
+
line-height: 51px;
|
| 2225 |
+
font-family: helveticaregular;
|
| 2226 |
+
font-size: 22px;
|
| 2227 |
+
}
|
| 2228 |
+
.plus_custom-links p.cus_link label {
|
| 2229 |
+
margin-left: 0;
|
| 2230 |
+
}
|
| 2231 |
+
.pop_up_box .sfsi_plus_tool_tip_2 .fbb .fb_1 a>img:hover {
|
| 2232 |
+
opacity: .9;
|
| 2233 |
+
}
|
| 2234 |
+
.tab2 .rss_url_row .sfrsTxt {
|
| 2235 |
+
font-size: 17px;
|
| 2236 |
+
line-height: 41px;
|
| 2237 |
+
margin: 0 0 0 4px;
|
| 2238 |
+
font-family: helveticaregular;
|
| 2239 |
+
}
|
| 2240 |
+
.tab2 .rss_url_row .sfrsTxt>strong {
|
| 2241 |
+
font-family: helveticaregular;
|
| 2242 |
+
}
|
| 2243 |
+
.tab2 .utube_inn p.extra_pp {
|
| 2244 |
+
float: left;
|
| 2245 |
+
width: 100%;
|
| 2246 |
+
margin: 0 0 0 48px;
|
| 2247 |
+
}
|
| 2248 |
+
.tab2 .utube_inn p.extra_pp label {
|
| 2249 |
+
float: left;
|
| 2250 |
+
line-height: 41px;
|
| 2251 |
+
margin-right: 8px;
|
| 2252 |
+
}
|
| 2253 |
+
.sfsi_inside .icon2 .fb_iframe_widget span {
|
| 2254 |
+
/* width: 500px!important; sunil*/
|
| 2255 |
+
}
|
| 2256 |
+
@media (max-width:767px) {
|
| 2257 |
+
.icon2 .fb_iframe_widget span {
|
| 2258 |
+
width: auto;
|
| 2259 |
+
}
|
| 2260 |
+
.sfsi_plus_outr_div
|
| 2261 |
+
{
|
| 2262 |
+
top: 10%
|
| 2263 |
+
}
|
| 2264 |
+
.sfsi_plus_outr_div h2
|
| 2265 |
+
{
|
| 2266 |
+
font-size: 22px!important;
|
| 2267 |
+
line-height: 28px;
|
| 2268 |
+
}
|
| 2269 |
+
.sfsi_plus_wicons {
|
| 2270 |
+
padding-top: 0;
|
| 2271 |
+
}
|
| 2272 |
+
}
|
| 2273 |
+
.sfsiplus_specify_counts .listing li .high_prb {
|
| 2274 |
+
height: 41px;
|
| 2275 |
+
}
|
| 2276 |
+
.sfsi_plus_Sicons {
|
| 2277 |
+
position: relative;
|
| 2278 |
+
}
|
| 2279 |
+
.sfsi_plus_Sicons .sf_subscrbe{ margin: 2px 3px 0 0; line-height: 0px;}
|
| 2280 |
+
.sfsi_plus_Sicons .sf_fb{ margin: 0 4px 0 5px; line-height: 0px;}
|
| 2281 |
+
.sfsi_plus_Sicons .sf_google{ margin: 0 5px 0 5px; line-height: 0px;}
|
| 2282 |
+
.sfsi_plus_Sicons .sf_twiter{ margin: 1px 7px 0 4px; line-height: 0px;}
|
| 2283 |
+
.sfsi_plus_Sicons .sf_addthis{ margin: 2px 7px 0 2px; line-height: 0px;}
|
| 2284 |
+
|
| 2285 |
+
.sfsi_plus_Sicons.left .sf_subscrbe{ margin: 2px 8px 0 0;}
|
| 2286 |
+
.sfsi_plus_Sicons.left .sf_fb{ margin: 0 8px 0 0;}
|
| 2287 |
+
.sfsi_plus_Sicons.left .sf_google{ margin: 0 8px 0 0;}
|
| 2288 |
+
.sfsi_plus_Sicons.left .sf_twiter{ margin: 1px 8px 0 0;}
|
| 2289 |
+
.sfsi_plus_Sicons.left .sf_addthis{ margin: 2px 7px 0 0;}
|
| 2290 |
+
|
| 2291 |
+
.sfsi_plus_Sicons.right .sf_subscrbe{ margin: 2px 0 0; }
|
| 2292 |
+
.sfsi_plus_Sicons.right .sf_fb{ margin: 0 0 0 7px; }
|
| 2293 |
+
.sfsi_plus_Sicons.right .sf_google{ margin: 0 0 0 8px; }
|
| 2294 |
+
.sfsi_plus_Sicons.right .sf_twiter{ margin: 1px 0 0 8px; }
|
| 2295 |
+
.sfsi_plus_Sicons.right .sf_addthis{ margin: 2px 0 0 8px; }
|
| 2296 |
+
|
| 2297 |
+
.sfsi_plus_Sicons .sf_subscrbe, .sfsi_plus_Sicons .sf_twiter
|
| 2298 |
+
{
|
| 2299 |
+
position: relative;
|
| 2300 |
+
width: 75px;
|
| 2301 |
+
}
|
| 2302 |
+
.sfsi_plus_Sicons .sf_twiter iframe
|
| 2303 |
+
{
|
| 2304 |
+
margin: 0px;
|
| 2305 |
+
height: 20px !important;
|
| 2306 |
+
overflow: visible !important;
|
| 2307 |
+
}
|
| 2308 |
+
.sfsi_plus_Sicons .sf_twiter iframe #widget
|
| 2309 |
+
{
|
| 2310 |
+
overflow: visible !important;
|
| 2311 |
+
|
| 2312 |
+
}
|
| 2313 |
+
.sfsi_plus_Sicons .sf_subscrbe a
|
| 2314 |
+
{
|
| 2315 |
+
width: auto;
|
| 2316 |
+
float: left;
|
| 2317 |
+
border: medium none;
|
| 2318 |
+
padding-top: 0px;
|
| 2319 |
+
}
|
| 2320 |
+
.sfsi_plus_Sicons .sf_subscrbe a:focus
|
| 2321 |
+
{
|
| 2322 |
+
outline: medium none;
|
| 2323 |
+
}
|
| 2324 |
+
.sfsi_plus_Sicons .sf_subscrbe a img
|
| 2325 |
+
{
|
| 2326 |
+
float: left;
|
| 2327 |
+
}
|
| 2328 |
+
.sfsi_plus_Sicons .sf_fb {
|
| 2329 |
+
position: relative;
|
| 2330 |
+
width: 75px;
|
| 2331 |
+
}
|
| 2332 |
+
.sfsi_plus_Sicons .fb_iframe_widget {
|
| 2333 |
+
float: none;
|
| 2334 |
+
width: auto;
|
| 2335 |
+
vertical-align: middle;
|
| 2336 |
+
margin: 2px 0 0;
|
| 2337 |
+
}
|
| 2338 |
+
/*absolute commented as for standard icon it was giving issue while icon was to be aligned centerd.*/
|
| 2339 |
+
.sfsi_plus_Sicons .sf_fb .fb_iframe_widget>span {
|
| 2340 |
+
position: relative;
|
| 2341 |
+
/*width: 450px!important;*/
|
| 2342 |
+
float: left;
|
| 2343 |
+
}
|
| 2344 |
+
.sfsi_plus_Sicons .sf_addthis, .sfsi_plus_Sicons .sf_google {
|
| 2345 |
+
position: relative;
|
| 2346 |
+
}
|
| 2347 |
+
.sf_google > div
|
| 2348 |
+
{
|
| 2349 |
+
width: 70px !important;
|
| 2350 |
+
}
|
| 2351 |
+
.sf_google iframe
|
| 2352 |
+
{
|
| 2353 |
+
width: 100% !important;
|
| 2354 |
+
}
|
| 2355 |
+
.sfsi_plus_Sicons .sf_google>div
|
| 2356 |
+
{
|
| 2357 |
+
float: left !important;
|
| 2358 |
+
margin-top: 1px !important;
|
| 2359 |
+
}
|
| 2360 |
+
.wrapper .sfsi_plus_Sicons .sf_addthis {
|
| 2361 |
+
margin: 7px 0 0 4px!important;
|
| 2362 |
+
}
|
| 2363 |
+
.tab2 .utube_inn label {
|
| 2364 |
+
font-size: 18px;
|
| 2365 |
+
}
|
| 2366 |
+
.sfsi_plc_btm {
|
| 2367 |
+
padding: 5px 14px 9px;
|
| 2368 |
+
}
|
| 2369 |
+
.tab7 .field {
|
| 2370 |
+
margin-top: 7px;
|
| 2371 |
+
}
|
| 2372 |
+
.sfsi_plus_outr_div ul li .cmcls img {
|
| 2373 |
+
margin-top: 0!important;
|
| 2374 |
+
}
|
| 2375 |
+
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt {
|
| 2376 |
+
float: left;
|
| 2377 |
+
}
|
| 2378 |
+
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt .bot_no {
|
| 2379 |
+
position: absolute;
|
| 2380 |
+
padding: 1px 0;
|
| 2381 |
+
font-size: 12px!important;
|
| 2382 |
+
line-height: 12px!important;
|
| 2383 |
+
text-align: center;
|
| 2384 |
+
background: #fff;
|
| 2385 |
+
border-radius: 5px;
|
| 2386 |
+
display: block;
|
| 2387 |
+
left: 50%;
|
| 2388 |
+
margin-left: -20px;
|
| 2389 |
+
border: 1px solid #333;
|
| 2390 |
+
white-space: pre;
|
| 2391 |
+
-webkit-box-sizing: border-box;
|
| 2392 |
+
-moz-box-sizing: border-box;
|
| 2393 |
+
box-sizing: border-box;
|
| 2394 |
+
margin-top: 6px;
|
| 2395 |
+
width: 40px;
|
| 2396 |
+
word-break: break-all;
|
| 2397 |
+
word-wrap: break-word;
|
| 2398 |
+
}
|
| 2399 |
+
.sfsi_plus_outr_div ul li .sfsiplus_inerCnt .bot_no:before {
|
| 2400 |
+
content: url(images/count_top_arow.png);
|
| 2401 |
+
position: absolute;
|
| 2402 |
+
height: 9px;
|
| 2403 |
+
margin-left: -7.5px;
|
| 2404 |
+
top: -10px;
|
| 2405 |
+
left: 50%;
|
| 2406 |
+
width: 15px;
|
| 2407 |
+
}
|
| 2408 |
+
.sfsi_plus_outr_div {
|
| 2409 |
+
position: fixed;
|
| 2410 |
+
width: 100%;
|
| 2411 |
+
float: none;
|
| 2412 |
+
left: 50%;
|
| 2413 |
+
top: 20%;
|
| 2414 |
+
margin-left: -50%;
|
| 2415 |
+
opacity: 0;
|
| 2416 |
+
z-index: -1;
|
| 2417 |
+
display: block;
|
| 2418 |
+
text-align: center;
|
| 2419 |
+
}
|
| 2420 |
+
.sfsi_plus_outr_div .sfsi_plus_FrntInner {
|
| 2421 |
+
display: inline-block;
|
| 2422 |
+
padding: 15px 17px 27px 18px;
|
| 2423 |
+
background: #FFF;
|
| 2424 |
+
border: 1px solid #EDEDED;
|
| 2425 |
+
box-shadow: 0 0 5px #CCC;
|
| 2426 |
+
margin: 20px;
|
| 2427 |
+
position: relative;
|
| 2428 |
+
}
|
| 2429 |
+
.sfsi_plus_FrntInner .sfsiclpupwpr
|
| 2430 |
+
{
|
| 2431 |
+
position: absolute;
|
| 2432 |
+
right: -10px;
|
| 2433 |
+
top: -10px;
|
| 2434 |
+
width: 25px;
|
| 2435 |
+
cursor: pointer;
|
| 2436 |
+
}
|
| 2437 |
+
.sfsi_plus_FrntInner .sfsiclpupwpr img
|
| 2438 |
+
{
|
| 2439 |
+
width: auto;
|
| 2440 |
+
float: left;
|
| 2441 |
+
border: medium none;
|
| 2442 |
+
}
|
| 2443 |
+
.tab7 .like_pop_box {
|
| 2444 |
+
width: 100%;
|
| 2445 |
+
margin: 35px auto auto;
|
| 2446 |
+
position: relative;
|
| 2447 |
+
text-align: center;
|
| 2448 |
+
}
|
| 2449 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner {
|
| 2450 |
+
display: inline-block;
|
| 2451 |
+
padding: 18px 20px;
|
| 2452 |
+
box-shadow: 0 0 5px #ccc;
|
| 2453 |
+
-webkit-box-shadow: 0 0 5px #ccc;
|
| 2454 |
+
border: 1px solid #ededed;
|
| 2455 |
+
background: #FFF;
|
| 2456 |
+
}
|
| 2457 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner h2 {
|
| 2458 |
+
margin: 0 0 23px;
|
| 2459 |
+
padding: 0;
|
| 2460 |
+
color: #414951;
|
| 2461 |
+
font-family: helveticabold;
|
| 2462 |
+
font-size: 26px;
|
| 2463 |
+
text-align: center;
|
| 2464 |
+
}
|
| 2465 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner ul {
|
| 2466 |
+
margin: 0;
|
| 2467 |
+
padding: 0;
|
| 2468 |
+
list-style: none;
|
| 2469 |
+
text-align: center;
|
| 2470 |
+
}
|
| 2471 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner ul li {
|
| 2472 |
+
margin: 0;
|
| 2473 |
+
padding: 0;
|
| 2474 |
+
list-style: none;
|
| 2475 |
+
display: inline-block;
|
| 2476 |
+
}
|
| 2477 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner ul li span {
|
| 2478 |
+
margin: 0;
|
| 2479 |
+
width: 54px;
|
| 2480 |
+
display: block;
|
| 2481 |
+
background: url(../images/count_bg.png) no-repeat;
|
| 2482 |
+
height: 24px;
|
| 2483 |
+
overflow: hidden;
|
| 2484 |
+
padding: 10px 2px 2px;
|
| 2485 |
+
font-family: helveticaregular;
|
| 2486 |
+
font-size: 16px;
|
| 2487 |
+
text-align: center;
|
| 2488 |
+
line-height: 24px;
|
| 2489 |
+
color: #5a6570;
|
| 2490 |
+
}
|
| 2491 |
+
.tab7 .like_pop_box .sfsi_plus_Popinner ul li a {
|
| 2492 |
+
color: #5a6570;
|
| 2493 |
+
text-decoration: none;
|
| 2494 |
+
}
|
| 2495 |
+
.sfsi_plus_outr_div .sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2496 |
+
margin-bottom: 0;
|
| 2497 |
+
}
|
| 2498 |
+
.sfsi_plus_outr_div ul {
|
| 2499 |
+
list-style: none;
|
| 2500 |
+
margin: 0 0 24px;
|
| 2501 |
+
padding: 0;
|
| 2502 |
+
text-align: center;
|
| 2503 |
+
}
|
| 2504 |
+
a.sfsiColbtn {
|
| 2505 |
+
color: #5a6570!important;
|
| 2506 |
+
float: right;
|
| 2507 |
+
font-size: 14px;
|
| 2508 |
+
margin: -35px -30px 0 0;
|
| 2509 |
+
position: relative;
|
| 2510 |
+
right: 0;
|
| 2511 |
+
font-family: helveticaregular;
|
| 2512 |
+
width: 100px;
|
| 2513 |
+
text-decoration: none;
|
| 2514 |
+
}
|
| 2515 |
+
.tab3 a.sfsiColbtn {
|
| 2516 |
+
margin-top: -55px;
|
| 2517 |
+
}
|
| 2518 |
+
.sfsi_plus_FrntInner ul li:first-of-type .sfsi_plus_wicons {
|
| 2519 |
+
margin-left: 0!important;
|
| 2520 |
+
}
|
| 2521 |
+
ul.sfsiplus_tab_3_icns li .trans_bg {
|
| 2522 |
+
background: #000;
|
| 2523 |
+
padding-left: 3px;
|
| 2524 |
+
}
|
| 2525 |
+
.tab2 .sfsiplus_instagram_section {
|
| 2526 |
+
padding-bottom: 20px;
|
| 2527 |
+
}
|
| 2528 |
+
h1.abt_titl {
|
| 2529 |
+
text-align: center;
|
| 2530 |
+
margin: 19% 0 0;
|
| 2531 |
+
}
|
| 2532 |
+
.sfcm.sfsi_wicon { padding: 0; width: 100% !important; border: medium none !important; height: auto !important;}
|
| 2533 |
+
.fb_iframe_widget span {
|
| 2534 |
+
vertical-align: top!important;
|
| 2535 |
+
}
|
| 2536 |
+
.sfsi_plus_outr_div .sfsi_plus_FrntInner ul {
|
| 2537 |
+
margin: 0 0 0 3px;
|
| 2538 |
+
}
|
| 2539 |
+
.sfsi_plus_outr_div .sfsi_plus_FrntInner ul li {
|
| 2540 |
+
margin: 0 3px 0 0;
|
| 2541 |
+
}
|
| 2542 |
+
@-moz-document url-prefix() {
|
| 2543 |
+
.sfcm.sfsi_wicon {
|
| 2544 |
+
margin: -1px;
|
| 2545 |
+
padding: 0;
|
| 2546 |
+
}
|
| 2547 |
+
}@media (min-width:320px) and (max-width:480px) {
|
| 2548 |
+
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 2549 |
+
padding: 5px 14px 0;
|
| 2550 |
+
}
|
| 2551 |
+
.sfsi_plus_inside:last-child {
|
| 2552 |
+
margin-bottom: 18px;
|
| 2553 |
+
clear: both;
|
| 2554 |
+
}
|
| 2555 |
+
.sfsi_plus_outr_div {
|
| 2556 |
+
top: 10%}
|
| 2557 |
+
.sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2558 |
+
width: 31px!important;
|
| 2559 |
+
height: 31px!important;
|
| 2560 |
+
}
|
| 2561 |
+
.sfsi_plus_FrntInner .sfsi_plus_wicons img {
|
| 2562 |
+
width: 100%}
|
| 2563 |
+
}
|
| 2564 |
+
@media (max-width:320px) {
|
| 2565 |
+
.sfsi_plus_tool_tip_2, .tool_tip {
|
| 2566 |
+
padding: 5px 14px 0;
|
| 2567 |
+
}
|
| 2568 |
+
.sfsi_plus_inside:last-child {
|
| 2569 |
+
margin-bottom: 18px;
|
| 2570 |
+
clear: both;
|
| 2571 |
+
}
|
| 2572 |
+
.sfsi_plus_FrntInner .sfsi_plus_wicons {
|
| 2573 |
+
width: 31px!important;
|
| 2574 |
+
height: 31px!important;
|
| 2575 |
+
}
|
| 2576 |
+
.sfsi_plus_FrntInner .sfsi_plus_wicons img {
|
| 2577 |
+
width: 100%}
|
| 2578 |
+
}
|
| 2579 |
+
ul.SFSI_lsngfrm {
|
| 2580 |
+
float: left;
|
| 2581 |
+
width: 61%}
|
| 2582 |
+
ul.SFSI_instructions {
|
| 2583 |
+
float: left;
|
| 2584 |
+
width: 39%}
|
| 2585 |
+
ul.SFSI_instructions li {
|
| 2586 |
+
font-size: 12px!important;
|
| 2587 |
+
line-height: 25px!important;
|
| 2588 |
+
margin: 0!important;
|
| 2589 |
+
padding: 0 0 0 15px!important;
|
| 2590 |
+
width: 100%}
|
| 2591 |
+
|
| 2592 |
+
/*{Monad}*/
|
| 2593 |
+
/*Upload Skins css*/
|
| 2594 |
+
.cstmskin_popup
|
| 2595 |
+
{
|
| 2596 |
+
width: 500px;
|
| 2597 |
+
background: #FFF;
|
| 2598 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 2599 |
+
margin: 40px 0px auto;
|
| 2600 |
+
padding: 20px 25px 20px;
|
| 2601 |
+
font-family: helveticaregular;
|
| 2602 |
+
color: #5a6570;
|
| 2603 |
+
height: auto;
|
| 2604 |
+
float: left;
|
| 2605 |
+
position: relative;
|
| 2606 |
+
left: 35%;
|
| 2607 |
+
}
|
| 2608 |
+
.cstomskins_wrpr {
|
| 2609 |
+
float: left;
|
| 2610 |
+
width: 100%;
|
| 2611 |
+
}
|
| 2612 |
+
.custskinmsg {
|
| 2613 |
+
float: left;
|
| 2614 |
+
font-size: 15px;
|
| 2615 |
+
margin-top: 10px;
|
| 2616 |
+
width: 100%;
|
| 2617 |
+
}
|
| 2618 |
+
.custskinmsg > ul {
|
| 2619 |
+
color: #000;
|
| 2620 |
+
float: left;
|
| 2621 |
+
margin-top: 8px;
|
| 2622 |
+
width: 100%;
|
| 2623 |
+
}
|
| 2624 |
+
ul.cstmskin_iconlist {
|
| 2625 |
+
float: left;
|
| 2626 |
+
margin-top: 10px;
|
| 2627 |
+
width: 100%;
|
| 2628 |
+
}
|
| 2629 |
+
.cstmskin_iconlist > li {
|
| 2630 |
+
float: left;
|
| 2631 |
+
margin: 3px 0;
|
| 2632 |
+
width: 100%;
|
| 2633 |
+
}
|
| 2634 |
+
.cstm_icnname {
|
| 2635 |
+
float: left;
|
| 2636 |
+
width: 30%;
|
| 2637 |
+
}
|
| 2638 |
+
.cstmskins_btn > img {
|
| 2639 |
+
float: left;
|
| 2640 |
+
margin-right: 25px;
|
| 2641 |
+
}
|
| 2642 |
+
.cstmskin_btn
|
| 2643 |
+
{
|
| 2644 |
+
width: auto;
|
| 2645 |
+
float: left;
|
| 2646 |
+
padding: 3px 20px;
|
| 2647 |
+
color: #fff;
|
| 2648 |
+
background-color:#12a252;
|
| 2649 |
+
text-decoration: none;
|
| 2650 |
+
margin: 0 10px;
|
| 2651 |
+
}
|
| 2652 |
+
.cstmskins_sbmt
|
| 2653 |
+
{
|
| 2654 |
+
width: 100%;
|
| 2655 |
+
float: left;
|
| 2656 |
+
text-align: center;
|
| 2657 |
+
margin-top: 15px;
|
| 2658 |
+
}
|
| 2659 |
+
.done_btn
|
| 2660 |
+
{
|
| 2661 |
+
width: auto;
|
| 2662 |
+
padding: 3px 80px;
|
| 2663 |
+
color: #fff;
|
| 2664 |
+
background-color:#12a252;
|
| 2665 |
+
text-decoration: none;
|
| 2666 |
+
font-size: 18px;
|
| 2667 |
+
}
|
| 2668 |
+
.cstmskin_btn:hover, .done_btn:hover, .cstmskin_btn:focus, .done_btn:focus
|
| 2669 |
+
{
|
| 2670 |
+
color: #fff;
|
| 2671 |
+
}
|
| 2672 |
+
.skswrpr, .dlt_btn
|
| 2673 |
+
{
|
| 2674 |
+
display: none;
|
| 2675 |
+
}
|
| 2676 |
+
.cstmutbewpr
|
| 2677 |
+
{
|
| 2678 |
+
width: 100%;
|
| 2679 |
+
float: left;
|
| 2680 |
+
margin-top: 10px;
|
| 2681 |
+
}
|
| 2682 |
+
.cstmutbewpr ul.enough_waffling li
|
| 2683 |
+
{
|
| 2684 |
+
width: auto;
|
| 2685 |
+
float: left;
|
| 2686 |
+
margin-right: 20px;
|
| 2687 |
+
}
|
| 2688 |
+
.cstmutbewpr ul.enough_waffling li span
|
| 2689 |
+
{
|
| 2690 |
+
float: left;
|
| 2691 |
+
}
|
| 2692 |
+
.cstmutbewpr ul.enough_waffling li label
|
| 2693 |
+
{
|
| 2694 |
+
width: auto;
|
| 2695 |
+
float: left;
|
| 2696 |
+
margin-top: 10px;
|
| 2697 |
+
margin-left: 10px;
|
| 2698 |
+
}
|
| 2699 |
+
.cstmutbewpr .cstmutbtxtwpr
|
| 2700 |
+
{
|
| 2701 |
+
width: 100%;
|
| 2702 |
+
float: left;
|
| 2703 |
+
padding-top: 10px;
|
| 2704 |
+
}
|
| 2705 |
+
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr
|
| 2706 |
+
{
|
| 2707 |
+
width: 100%;
|
| 2708 |
+
float: left;
|
| 2709 |
+
display: none;
|
| 2710 |
+
}
|
| 2711 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p, #accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p
|
| 2712 |
+
{
|
| 2713 |
+
margin-left: 0px;
|
| 2714 |
+
}
|
| 2715 |
+
.cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr
|
| 2716 |
+
{
|
| 2717 |
+
width: 100%;
|
| 2718 |
+
float: left;
|
| 2719 |
+
display: none;
|
| 2720 |
+
}
|
| 2721 |
+
#accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlnmewpr p label, #accordion .cstmutbewpr .cstmutbtxtwpr .cstmutbchnlidwpr p label
|
| 2722 |
+
{
|
| 2723 |
+
width: 120px;
|
| 2724 |
+
}
|
| 2725 |
+
.sfsi_plus_widget .sfsi_plus_wDiv .sfsi_plus_wicons .sfsiplus_inerCnt a, .sfsi_plus_widget .sfsi_plus_wDiv .sfsi_plus_wicons .sfsiplus_inerCnt a.sficn
|
| 2726 |
+
{
|
| 2727 |
+
padding: 0px;
|
| 2728 |
+
margin: 0px;
|
| 2729 |
+
width: 100%;
|
| 2730 |
+
/*float: left;*/
|
| 2731 |
+
border: medium none;
|
| 2732 |
+
}
|
| 2733 |
+
.sfsi_socialwpr
|
| 2734 |
+
{
|
| 2735 |
+
width: auto;
|
| 2736 |
+
float: left;
|
| 2737 |
+
}
|
| 2738 |
+
.sfsi_socialwpr .sf_fb
|
| 2739 |
+
{
|
| 2740 |
+
float:left;
|
| 2741 |
+
margin:5px 5px 5px 5px;
|
| 2742 |
+
min-height: 20px;
|
| 2743 |
+
}
|
| 2744 |
+
.sfsi_socialwpr .sf_google
|
| 2745 |
+
{
|
| 2746 |
+
float:left;
|
| 2747 |
+
margin:5px 5px 5px 5px;
|
| 2748 |
+
max-width:62px;
|
| 2749 |
+
min-width:35px;
|
| 2750 |
+
min-height: 20px;
|
| 2751 |
+
}
|
| 2752 |
+
.sfsi_socialwpr .sf_addthis
|
| 2753 |
+
{
|
| 2754 |
+
float:left;
|
| 2755 |
+
margin:5px 5px 5px 5px;
|
| 2756 |
+
min-height: 20px;
|
| 2757 |
+
}
|
| 2758 |
+
.sfsipyplfrm
|
| 2759 |
+
{
|
| 2760 |
+
float: left;
|
| 2761 |
+
margin-top: 10px;
|
| 2762 |
+
width: 100%;
|
| 2763 |
+
}
|
| 2764 |
+
.sfsipyplfrm input[type="submit"]
|
| 2765 |
+
{
|
| 2766 |
+
background: none repeat scroll 0 0 rgba(0, 0, 0, 0);
|
| 2767 |
+
border: medium none;
|
| 2768 |
+
color: #0074a2;
|
| 2769 |
+
cursor: pointer;
|
| 2770 |
+
font-weight: normal;
|
| 2771 |
+
margin: 0;
|
| 2772 |
+
padding: 5px 10px;
|
| 2773 |
+
text-decoration: underline;
|
| 2774 |
+
}
|
| 2775 |
+
.sfsipyplfrm input[type="submit"]:hover
|
| 2776 |
+
{
|
| 2777 |
+
color: #2ea2cc
|
| 2778 |
+
}
|
| 2779 |
+
.pop_up_box_ex {
|
| 2780 |
+
background: none repeat scroll 0 0 #fff;
|
| 2781 |
+
box-shadow: 0 0 5px 3px #d8d8d8;
|
| 2782 |
+
color: #5a6570;
|
| 2783 |
+
font-family: helveticaregular;
|
| 2784 |
+
margin: 200px auto;
|
| 2785 |
+
min-height: 150px;
|
| 2786 |
+
padding: 20px 25px 0px;
|
| 2787 |
+
position: relative;
|
| 2788 |
+
width: 290px;
|
| 2789 |
+
}
|
| 2790 |
+
.pop_up_box_ex {
|
| 2791 |
+
color: #5a6570;
|
| 2792 |
+
font-family: helveticaregular;
|
| 2793 |
+
}
|
| 2794 |
+
|
| 2795 |
+
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_right_info {
|
| 2796 |
+
font-family: helveticaregular;
|
| 2797 |
+
width: 94.7%;
|
| 2798 |
+
float: left;
|
| 2799 |
+
}
|
| 2800 |
+
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_right_info p label.ckckslctn
|
| 2801 |
+
{
|
| 2802 |
+
display: none;
|
| 2803 |
+
}
|
| 2804 |
+
|
| 2805 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr > li {
|
| 2806 |
+
width:100% !important;
|
| 2807 |
+
max-width:100% !important;
|
| 2808 |
+
border-left: 45px solid transparent;
|
| 2809 |
+
-webkit-box-sizing: border-box;
|
| 2810 |
+
-moz-box-sizing: border-box;;
|
| 2811 |
+
-ms-box-sizing: border-box;
|
| 2812 |
+
-o-box-sizing: border-box;
|
| 2813 |
+
box-sizing: border-box;
|
| 2814 |
+
}
|
| 2815 |
+
|
| 2816 |
+
.tab8 .icons_size > input {
|
| 2817 |
+
background:none repeat scroll 0 0 #e5e5e5;
|
| 2818 |
+
width:80px;
|
| 2819 |
+
float:left;
|
| 2820 |
+
padding:10px 0;
|
| 2821 |
+
text-align:center;
|
| 2822 |
+
}
|
| 2823 |
+
.tab8 .icons_size > ins { margin-left:19px; }
|
| 2824 |
+
.tab8 .icons_size > span.last { width: auto !important; clear: left }
|
| 2825 |
+
.tab8 .radio_section.tb_4_ck { margin: 0 20px 0 0 !important; }
|
| 2826 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row,
|
| 2827 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr p,
|
| 2828 |
+
.tab8 .options {
|
| 2829 |
+
float: none;
|
| 2830 |
+
width: 100%;
|
| 2831 |
+
border-left: 60px solid transparent;
|
| 2832 |
+
-webkit-box-sizing: border-box;
|
| 2833 |
+
-moz-box-sizing: border-box;
|
| 2834 |
+
-o-box-sizing: border-box;
|
| 2835 |
+
-ms-box-sizing: border-box;
|
| 2836 |
+
box-sizing: border-box;
|
| 2837 |
+
}
|
| 2838 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr label { width: auto; }
|
| 2839 |
+
|
| 2840 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .social_icon_like1 ul { margin-left: 15px}
|
| 2841 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .social_icon_like1 li { width: auto; max-width: auto; min-width: auto; margin: 0 50px 0 0 }
|
| 2842 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .usually > li { width:85% !important; max-width: 100% !important; margin-left: 70px; font-family: 'helveticaneue-light'; padding-bottom: 5px}
|
| 2843 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .options > label { width:356px !important; margin:0; width: auto; margin-bottom: 0; margin-top: 0px; }
|
| 2844 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options .first.chcklbl { float: left !important; width: 335px !important; }
|
| 2845 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options .chckwpr { width:400px; float:right; }
|
| 2846 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options {
|
| 2847 |
+
width:90%;
|
| 2848 |
+
margin:0;
|
| 2849 |
+
font-family: 'helveticaneue-light';
|
| 2850 |
+
float: left;
|
| 2851 |
+
margin-bottom: 10px;
|
| 2852 |
+
max-width: 895px;
|
| 2853 |
+
border-left: none;
|
| 2854 |
+
}
|
| 2855 |
+
.sfsiplus_toggleonlystndrshrng { margin-bottom: 30px !important}
|
| 2856 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options.shareicontextfld { margin: 15px 0; }
|
| 2857 |
+
.tab8 .sfsiplus_tab_3_icns.flthmonpg .radio { margin-top:55px !important; }
|
| 2858 |
+
.tab8 .radiodisplaysection { float: left;}
|
| 2859 |
+
|
| 2860 |
+
|
| 2861 |
+
|
| 2862 |
+
/*palak css end*/
|
| 2863 |
+
/*modify by palak*/
|
| 2864 |
+
.tab8 ul.sfsiplus_icn_listing8 li {
|
| 2865 |
+
float: left;
|
| 2866 |
+
padding: 11px 0 40px 8px;
|
| 2867 |
+
width: 100%;
|
| 2868 |
+
max-width: 1000px;
|
| 2869 |
+
margin: 0
|
| 2870 |
+
}
|
| 2871 |
+
.sfsiplusplacethemanulywpr { max-width: 98% !important}
|
| 2872 |
+
|
| 2873 |
+
/*modify by palak*/
|
| 2874 |
+
/*modify by palak*/
|
| 2875 |
+
.tab8 ul.sfsiplus_icn_listing8 {
|
| 2876 |
+
list-style: outside none none;
|
| 2877 |
+
margin: 5px 0 0;
|
| 2878 |
+
overflow: hidden;
|
| 2879 |
+
}
|
| 2880 |
+
/*modify by palak*/
|
| 2881 |
+
.sfsiplus_right_info label.sfsiplus_sub-subtitle
|
| 2882 |
+
{
|
| 2883 |
+
font-size: 16px !important;
|
| 2884 |
+
font-weight: normal;
|
| 2885 |
+
}
|
| 2886 |
+
ul.plus_icn_listing li .sfsiplus_right_info label.sfsiplus_sub-subtitle a
|
| 2887 |
+
{
|
| 2888 |
+
font-size: 13px;
|
| 2889 |
+
}
|
| 2890 |
+
.tab8 ul.sfsiplus_tab_3_icns li .radio {
|
| 2891 |
+
margin-top: 7px;
|
| 2892 |
+
}
|
| 2893 |
+
|
| 2894 |
+
.tab8 ul.sfsiplus_tab_3_icns li label {
|
| 2895 |
+
line-height: 50px !important;
|
| 2896 |
+
}
|
| 2897 |
+
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns li {
|
| 2898 |
+
width: 50%;
|
| 2899 |
+
max-width: 450px;
|
| 2900 |
+
min-width: 420px;
|
| 2901 |
+
padding-left: 0;
|
| 2902 |
+
padding-bottom: 15px
|
| 2903 |
+
}
|
| 2904 |
+
|
| 2905 |
+
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr>li:nth-child(1),
|
| 2906 |
+
.tab8 ul.sfsiplus_icn_listing8 li .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr>li:nth-child(2) { width: 50% !important}
|
| 2907 |
+
.space.disblfltonmbl p.list { width: 100%; margin-bottom: 28px}
|
| 2908 |
+
|
| 2909 |
+
|
| 2910 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p { display: table}
|
| 2911 |
+
|
| 2912 |
+
/*modify by palak*/
|
| 2913 |
+
.tab8 .row
|
| 2914 |
+
{
|
| 2915 |
+
clear: both;
|
| 2916 |
+
display: block;
|
| 2917 |
+
float: left;
|
| 2918 |
+
font-family: helveticaregular;
|
| 2919 |
+
line-height: 42px;
|
| 2920 |
+
margin-top: 25px;
|
| 2921 |
+
padding-top: 15px;
|
| 2922 |
+
width: 100%;
|
| 2923 |
+
}
|
| 2924 |
+
/*modify by palak*/
|
| 2925 |
+
.tab8 .icons_size { margin-top: -12px; }
|
| 2926 |
+
.tab8 .icons_size { position: relative; font-family: 'helveticaneue-light'; width: 538px; float: right }
|
| 2927 |
+
.tab8 .icons_size span {
|
| 2928 |
+
display: block;
|
| 2929 |
+
float: left;
|
| 2930 |
+
font-size: 20px;
|
| 2931 |
+
font-weight: 400;
|
| 2932 |
+
line-height: 42px;
|
| 2933 |
+
margin-right: 18px;
|
| 2934 |
+
}
|
| 2935 |
+
|
| 2936 |
+
.tab8.icons_size span.last
|
| 2937 |
+
{
|
| 2938 |
+
margin-left: 55px;
|
| 2939 |
+
}
|
| 2940 |
+
.tab8 .icons_size ins
|
| 2941 |
+
{
|
| 2942 |
+
float: left;
|
| 2943 |
+
font-size: 17px;
|
| 2944 |
+
font-weight: 400;
|
| 2945 |
+
margin-right: 25px;
|
| 2946 |
+
text-decoration: none;
|
| 2947 |
+
margin-bottom: 20px;
|
| 2948 |
+
}
|
| 2949 |
+
.tab8 .social_icon_like1 {
|
| 2950 |
+
float: left;
|
| 2951 |
+
margin: 0;
|
| 2952 |
+
padding: 30px 0 0;
|
| 2953 |
+
text-align: center;
|
| 2954 |
+
width: 100%;
|
| 2955 |
+
}
|
| 2956 |
+
.tab8 .social_icon_like1 ul {
|
| 2957 |
+
list-style: outside none none;
|
| 2958 |
+
margin: 0;
|
| 2959 |
+
padding: 0;
|
| 2960 |
+
text-align: center;
|
| 2961 |
+
}
|
| 2962 |
+
.tab8 .social_icon_like1 li {
|
| 2963 |
+
display: inline-block;
|
| 2964 |
+
list-style: outside none none;
|
| 2965 |
+
margin: 0 0 0 45px !important;
|
| 2966 |
+
padding: 0;
|
| 2967 |
+
width: auto !important;
|
| 2968 |
+
min-width: 100px !important;
|
| 2969 |
+
}
|
| 2970 |
+
.tab8 .social_icon_like1 li a {
|
| 2971 |
+
color: #5a6570;
|
| 2972 |
+
display: block;
|
| 2973 |
+
text-decoration: none;
|
| 2974 |
+
}
|
| 2975 |
+
.tab8 .social_icon_like1 li img {
|
| 2976 |
+
display: block;
|
| 2977 |
+
float: left;
|
| 2978 |
+
margin-right: 5px;
|
| 2979 |
+
}
|
| 2980 |
+
.tab8 ul.usually {
|
| 2981 |
+
list-style: outside none none;
|
| 2982 |
+
margin: 28px 0 15px 60px;
|
| 2983 |
+
padding: 0;
|
| 2984 |
+
float: left
|
| 2985 |
+
}
|
| 2986 |
+
.tab8 ul.usually li {
|
| 2987 |
+
font-size: 17px;
|
| 2988 |
+
list-style: outside none none;
|
| 2989 |
+
margin: 0;
|
| 2990 |
+
padding: 0;
|
| 2991 |
+
text-align: left;
|
| 2992 |
+
width: auto;
|
| 2993 |
+
}
|
| 2994 |
+
.tab8 ul.enough_waffling {
|
| 2995 |
+
list-style: outside none none;
|
| 2996 |
+
margin: 25px 0 0;
|
| 2997 |
+
padding: 0;
|
| 2998 |
+
text-align: center;
|
| 2999 |
+
}
|
| 3000 |
+
.tab8 ul.enough_waffling li {
|
| 3001 |
+
display: inline-block;
|
| 3002 |
+
list-style: outside none none;
|
| 3003 |
+
margin: 0 22px;
|
| 3004 |
+
padding: 0;
|
| 3005 |
+
}
|
| 3006 |
+
.tab8 ul.enough_waffling li span {
|
| 3007 |
+
float: left;
|
| 3008 |
+
}
|
| 3009 |
+
.tab8 ul.enough_waffling li label {
|
| 3010 |
+
color: #5a6570;
|
| 3011 |
+
float: left;
|
| 3012 |
+
font-family: helveticaregular;
|
| 3013 |
+
font-size: 18px;
|
| 3014 |
+
font-weight: 400;
|
| 3015 |
+
line-height: 38px;
|
| 3016 |
+
margin: 0 0 0 20px;
|
| 3017 |
+
text-align: center;
|
| 3018 |
+
}
|
| 3019 |
+
/*modify by palak*/
|
| 3020 |
+
.tab8 .row {
|
| 3021 |
+
clear: both;
|
| 3022 |
+
display: block;
|
| 3023 |
+
float: left;
|
| 3024 |
+
font-family: helveticaregular;
|
| 3025 |
+
line-height: 42px;
|
| 3026 |
+
margin-top: 0px;
|
| 3027 |
+
padding-top: 10px;
|
| 3028 |
+
width: 100%;
|
| 3029 |
+
}
|
| 3030 |
+
/*modify by palak*/
|
| 3031 |
+
.tab8 .options {
|
| 3032 |
+
clear: both;
|
| 3033 |
+
float: left;
|
| 3034 |
+
margin-top: 25px;
|
| 3035 |
+
width: auto;
|
| 3036 |
+
float: none;
|
| 3037 |
+
}
|
| 3038 |
+
.tab8 .options label.first {
|
| 3039 |
+
font-family: 'helveticaneue-light';
|
| 3040 |
+
font-size: 18px;
|
| 3041 |
+
}
|
| 3042 |
+
.tab8 .options label {
|
| 3043 |
+
color: #5a6570;
|
| 3044 |
+
float: left;
|
| 3045 |
+
font-family: 'helveticaneue-light';
|
| 3046 |
+
font-size: 18px;
|
| 3047 |
+
line-height: 46px;
|
| 3048 |
+
width: 345px;
|
| 3049 |
+
}
|
| 3050 |
+
.tab8 .options input {
|
| 3051 |
+
background: none repeat scroll 0 0 #e5e5e5;
|
| 3052 |
+
border: 0 none;
|
| 3053 |
+
box-shadow: 2px 2px 3px #dcdcdc inset;
|
| 3054 |
+
float: left;
|
| 3055 |
+
padding: 10px;
|
| 3056 |
+
width: 308px;
|
| 3057 |
+
}
|
| 3058 |
+
.tab8 .options .field {
|
| 3059 |
+
float: left;
|
| 3060 |
+
position: relative;
|
| 3061 |
+
width: 223px;
|
| 3062 |
+
}
|
| 3063 |
+
.tab8 .options .field .select {
|
| 3064 |
+
background: url(../images/select_bg1.jpg) no-repeat scroll 0 0 rgba(0, 0, 0, 0);
|
| 3065 |
+
display: block;
|
| 3066 |
+
font-family: helveticaregular;
|
| 3067 |
+
padding-left: 17px;
|
| 3068 |
+
width: 207px;
|
| 3069 |
+
}
|
| 3070 |
+
.tab8 .options .field select.styled {
|
| 3071 |
+
height: 46px;
|
| 3072 |
+
left: 0;
|
| 3073 |
+
line-height: 46px;
|
| 3074 |
+
position: absolute;
|
| 3075 |
+
top: 0;
|
| 3076 |
+
width: 213px;
|
| 3077 |
+
}
|
| 3078 |
+
.tab8 .options .field select.styled {
|
| 3079 |
+
line-height: 46px;
|
| 3080 |
+
}
|
| 3081 |
+
.tab8 ul.sfsiplus_icn_listing8 li .snglchckcntr .sfsiplus_right_info {
|
| 3082 |
+
float: left;
|
| 3083 |
+
margin-right: 0;
|
| 3084 |
+
text-align: left;
|
| 3085 |
+
width: auto;
|
| 3086 |
+
font-family: 'helveticaneue-light';
|
| 3087 |
+
font-size: 18px;
|
| 3088 |
+
line-height: 30px;
|
| 3089 |
+
}
|
| 3090 |
+
.chckwpr .snglchckcntr:first-child { float:left; }
|
| 3091 |
+
.chckwpr .snglchckcntr:last-child { float:left; margin-left: 110px; }
|
| 3092 |
+
.chckwpr
|
| 3093 |
+
{
|
| 3094 |
+
width:100%;
|
| 3095 |
+
float:left;
|
| 3096 |
+
}
|
| 3097 |
+
.cstmutbchnlidwpr .utbe_instruction,.cstmutbchnlnmewpr .utbe_instruction, .lnkdin_instruction {
|
| 3098 |
+
float: left;
|
| 3099 |
+
line-height: 22px;
|
| 3100 |
+
margin-top: 10px;
|
| 3101 |
+
width: 100%;
|
| 3102 |
+
}
|
| 3103 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p
|
| 3104 |
+
{
|
| 3105 |
+
font-size: 20px;
|
| 3106 |
+
}
|
| 3107 |
+
#accordion .tab8 ul.sfsiplus_tab_3_icns { margin-top: 25px; }
|
| 3108 |
+
#accordion .tab8 ul.sfsiplus_tab_3_icns.flthmonpg { margin-left: 45px}
|
| 3109 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisplaysharingtxt { padding-top: 5px; display: inline;}
|
| 3110 |
+
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .labelhdng4,
|
| 3111 |
+
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .row h4.labelhdng4 { color: #555; font-size: 20px; margin-left: 20px; font-family: 'helveticaregular'}
|
| 3112 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row.sfsiplus_PostsSettings_section { border-left: 105px solid transparent; float: left; padding-top: 0}
|
| 3113 |
+
.sfsiplus_toggleonlystndrshrng { margin-bottom: 0 !important}
|
| 3114 |
+
.radiodisplaysection { float: left}
|
| 3115 |
+
.tab8 .sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr .row.sfsiplus_PostsSettings_section>.labelhdng4 { margin-bottom: 20px !important}
|
| 3116 |
+
.sfsiplus_shwthmbfraftr { margin-top: 5px !important}
|
| 3117 |
+
label.sfsiplus_toglpstpgsbttl { float: left; margin-top: 5px !important}
|
| 3118 |
+
#accordion .tab8 ul.sfsiplus_shwthmbfraftr .row h4 {
|
| 3119 |
+
font-family: 'helveticaneue-light';
|
| 3120 |
+
font-weight: normal;
|
| 3121 |
+
font-size: 18px;
|
| 3122 |
+
color: #69737c;
|
| 3123 |
+
float: left
|
| 3124 |
+
}
|
| 3125 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options .seconds.chcklbl { float: right; width: 400px !important; }
|
| 3126 |
+
.sfsibeforpstwpr
|
| 3127 |
+
{
|
| 3128 |
+
width: 100%;
|
| 3129 |
+
float: left;
|
| 3130 |
+
line-height: 18px;
|
| 3131 |
+
margin: 5px 0;
|
| 3132 |
+
}
|
| 3133 |
+
.sfsiaftrpstwpr
|
| 3134 |
+
{
|
| 3135 |
+
width: 100%;
|
| 3136 |
+
float: left;
|
| 3137 |
+
line-height: 18px;
|
| 3138 |
+
margin: 5px 0;
|
| 3139 |
+
}
|
| 3140 |
+
.sfsibeforpstwpr .sfsi_plus_Sicons span
|
| 3141 |
+
{
|
| 3142 |
+
font-size: 20px;
|
| 3143 |
+
}
|
| 3144 |
+
.sfsiaftrpstwpr .sfsi_plus_Sicons span
|
| 3145 |
+
{
|
| 3146 |
+
font-size: 20px;
|
| 3147 |
+
}
|
| 3148 |
+
.sfsibeforpstwpr .sfsi_plus_Sicons
|
| 3149 |
+
{
|
| 3150 |
+
|
| 3151 |
+
}
|
| 3152 |
+
.sfsiaftrpstwpr .sfsi_plus_Sicons
|
| 3153 |
+
{
|
| 3154 |
+
|
| 3155 |
+
}
|
| 3156 |
+
.sfsibeforpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr
|
| 3157 |
+
{
|
| 3158 |
+
width: auto;
|
| 3159 |
+
float: left;
|
| 3160 |
+
}
|
| 3161 |
+
.sfsiaftrpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr
|
| 3162 |
+
{
|
| 3163 |
+
width: auto;
|
| 3164 |
+
float: left;
|
| 3165 |
+
}
|
| 3166 |
+
.sfsibeforpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr .sfsi_plus_wicons
|
| 3167 |
+
{
|
| 3168 |
+
float: left;
|
| 3169 |
+
}
|
| 3170 |
+
.sfsiaftrpstwpr .sfsiplus_norm_row.sfsi_plus_wDivothr .sfsi_plus_wicons
|
| 3171 |
+
{
|
| 3172 |
+
float: left;
|
| 3173 |
+
}
|
| 3174 |
+
.sfsi_flicnsoptn3
|
| 3175 |
+
{
|
| 3176 |
+
color: #69737c;
|
| 3177 |
+
float: left;
|
| 3178 |
+
font-size: 20px;
|
| 3179 |
+
margin: 62px 5px 0 20px;
|
| 3180 |
+
font-family: 'helveticaneue-light';
|
| 3181 |
+
|
| 3182 |
+
width: 120px;
|
| 3183 |
+
}
|
| 3184 |
+
|
| 3185 |
+
.sfsi_ckckslctnlbl
|
| 3186 |
+
{
|
| 3187 |
+
font-weight: bold;
|
| 3188 |
+
}
|
| 3189 |
+
.sfsibeforpstwpr iframe{max-width: none; vertical-align: middle;}
|
| 3190 |
+
.sfsiaftrpstwpr iframe{max-width: none; vertical-align: middle;}
|
| 3191 |
+
.sfwp_fivestar_ul li { display: inline-block; padding-right: 20px; }
|
| 3192 |
+
.fb_iframe_widget iframe
|
| 3193 |
+
{
|
| 3194 |
+
max-width: none;
|
| 3195 |
+
}
|
| 3196 |
+
.sfsi_mainContainer p.bldtxtmsg{float: left; font-size: 15px; /*font-weight: bold;*/ margin-top: 12px; width: 100%;}
|
| 3197 |
+
.sfsi_mainContainer p.translatelilne{float: left; font-size: 15px; font-weight: bold;color: black; margin-top: 12px; width: 100%;}
|
| 3198 |
+
.sfsiplus_icn_listing8 li > div{width: auto; float: left;}
|
| 3199 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng
|
| 3200 |
+
{
|
| 3201 |
+
padding-bottom: 30px;
|
| 3202 |
+
float: left;
|
| 3203 |
+
}
|
| 3204 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng
|
| 3205 |
+
{
|
| 3206 |
+
background: medium none;
|
| 3207 |
+
}
|
| 3208 |
+
#accordion .tab8 .sfsiplus_icn_listing8 li .sfsiplus_right_info p.cstmdisextrpdng code
|
| 3209 |
+
{
|
| 3210 |
+
background: none repeat scroll 0 0 transparent;
|
| 3211 |
+
padding-left: 0px;
|
| 3212 |
+
padding-right: 0px;
|
| 3213 |
+
}
|
| 3214 |
+
.options.sfsipluspstvwpr {
|
| 3215 |
+
margin-left: 17% !important;
|
| 3216 |
+
margin-left: 0% !important;
|
| 3217 |
+
}
|
| 3218 |
+
.tab8 .row.sfsiplus_PostsSettings_section .options.sfsipluspstvwpr .first.chcklbl
|
| 3219 |
+
{
|
| 3220 |
+
width: 180px !important;
|
| 3221 |
+
}
|
| 3222 |
+
.sfsiplus_tab_3_icns.sfsiplus_shwthmbfraftr {
|
| 3223 |
+
overflow: visible;
|
| 3224 |
+
}
|
| 3225 |
+
/*.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .icon1{margin: 2px 35px 2px !important;clear:both;}*/
|
| 3226 |
+
.sfsi_plus_twt_tool_bdr .sfsi_plus_inside .cstmicon1 a img{margin: 2px 12px 2px !important;clear:both;text-align:center;float:none;}
|
| 3227 |
+
.cstmicon1{text-align:center;}
|
| 3228 |
+
.sfsi_plus_Sicons img, #sfsiplusid_facebook img, #sfsiplusid_google img, #sfsiplusid_twitter img { height: 20px;}
|
| 3229 |
+
|
| 3230 |
+
.sfsi_plus_wicons a.sficn, .sfsi_plus_wicons .sfsi_plus_inside a, .sfsi_plus_Sicons div a
|
| 3231 |
+
{
|
| 3232 |
+
box-shadow: none;
|
| 3233 |
+
border: none;
|
| 3234 |
+
}
|
| 3235 |
+
|
| 3236 |
+
.sfsi_plus_Sicons .sf_pinit
|
| 3237 |
+
{
|
| 3238 |
+
margin-right: 4px;
|
| 3239 |
+
}
|
| 3240 |
+
.sfsi_plus_Sicons .sf_pinit > span
|
| 3241 |
+
{
|
| 3242 |
+
height: 22px !important;
|
| 3243 |
+
vertical-align: middle;
|
| 3244 |
+
}
|
| 3245 |
+
.sfsi_plus_Sicons .sf_pinit > span
|
| 3246 |
+
{
|
| 3247 |
+
height: 20px !important;
|
| 3248 |
+
vertical-align: middle;
|
| 3249 |
+
}
|
| 3250 |
+
|
| 3251 |
+
/*.sfsi_plus_Sicons .sf_pinit > span > span
|
| 3252 |
+
{
|
| 3253 |
+
display: inline-block;
|
| 3254 |
+
width: 47px !important;
|
| 3255 |
+
position: relative !important;
|
| 3256 |
+
margin-left: 40px;
|
| 3257 |
+
vertical-align: top;
|
| 3258 |
+
right: 0 !important;
|
| 3259 |
+
}*/
|
| 3260 |
+
.sfsibeforpstwpr .sfsi_plus_Sicons .sf_pinit span{font-size:11px !important;}
|
| 3261 |
+
.sfsiaftrpstwpr .sfsi_plus_Sicons .sf_pinit span{font-size:11px !important;}
|
| 3262 |
+
.sfsibeforpstwpr .sfsi_plus_Sicons .sfsi_plus_inside .icon2 span{font-size:11px !important;}
|
| 3263 |
+
.sfsiaftrpstwpr .sfsi_plus_Sicons .sfsi_plus_inside .icon2 span{font-size:11px !important;}
|
| 3264 |
.sfsi_plus_wicons a {box-shadow: none !important;}
|
freemius/assets/scss/_load.scss
CHANGED
|
@@ -1,4 +1,4 @@
|
|
| 1 |
-
@import 'mixins';
|
| 2 |
-
@import "vars";
|
| 3 |
-
@import "functions";
|
| 4 |
-
@import "colors";
|
| 1 |
+
@import 'mixins';
|
| 2 |
+
@import "vars";
|
| 3 |
+
@import "functions";
|
| 4 |
+
@import "colors";
|
freemius/assets/scss/_start.scss
CHANGED
|
@@ -1,4 +1,4 @@
|
|
| 1 |
-
@import "vars";
|
| 2 |
-
@import "colors";
|
| 3 |
-
@import "mixins";
|
| 4 |
@import "functions";
|
| 1 |
+
@import "vars";
|
| 2 |
+
@import "colors";
|
| 3 |
+
@import "mixins";
|
| 4 |
@import "functions";
|
freemius/assets/scss/_vars.scss
CHANGED
|
@@ -1,6 +1,6 @@
|
|
| 1 |
-
$is_production: true;
|
| 2 |
-
|
| 3 |
-
$img_common: if($is_production == true, '//img.freemius.com', 'http://img.freemius:8080');
|
| 4 |
-
|
| 5 |
-
$layout_width: 960px;
|
| 6 |
$admin_mobile_max_width: 782px;
|
| 1 |
+
$is_production: true;
|
| 2 |
+
|
| 3 |
+
$img_common: if($is_production == true, '//img.freemius.com', 'http://img.freemius:8080');
|
| 4 |
+
|
| 5 |
+
$layout_width: 960px;
|
| 6 |
$admin_mobile_max_width: 782px;
|
freemius/assets/scss/admin/connect.scss
CHANGED
|
@@ -1,471 +1,471 @@
|
|
| 1 |
-
@import "../start";
|
| 2 |
-
|
| 3 |
-
$form_width: 480px;
|
| 4 |
-
|
| 5 |
-
#fs_connect
|
| 6 |
-
{
|
| 7 |
-
width: $form_width;
|
| 8 |
-
@include box-shadow(0px 1px 2px rgba(0, 0, 0, 0.3));
|
| 9 |
-
margin: 20px 0;
|
| 10 |
-
|
| 11 |
-
@media screen and (max-width: ($form_width - 1)) {
|
| 12 |
-
@include box-shadow(none);
|
| 13 |
-
width: auto;
|
| 14 |
-
margin: 0 0 0 -10px;
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
.fs-content
|
| 18 |
-
{
|
| 19 |
-
background: #fff;
|
| 20 |
-
padding: 15px 20px;
|
| 21 |
-
|
| 22 |
-
.fs-error {
|
| 23 |
-
background: snow;
|
| 24 |
-
color: $fs-logo-magenta-color;
|
| 25 |
-
border: 1px solid $fs-logo-magenta-color;
|
| 26 |
-
@include box-shadow(0 1px 1px 0 rgba(0,0,0,.1));
|
| 27 |
-
text-align: center;
|
| 28 |
-
padding: 5px;
|
| 29 |
-
margin-bottom: 10px;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
p
|
| 33 |
-
{
|
| 34 |
-
margin: 0;
|
| 35 |
-
padding: 0;
|
| 36 |
-
font-size: 1.2em;
|
| 37 |
-
}
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
.fs-license-key-container {
|
| 41 |
-
position: relative;
|
| 42 |
-
width: 280px;
|
| 43 |
-
margin: 10px auto 0 auto;
|
| 44 |
-
|
| 45 |
-
input {
|
| 46 |
-
width: 100%;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
.dashicons {
|
| 50 |
-
position: absolute;
|
| 51 |
-
top: 5px;
|
| 52 |
-
right: 5px;
|
| 53 |
-
}
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
.fs-actions
|
| 57 |
-
{
|
| 58 |
-
padding: 10px 20px;
|
| 59 |
-
background: #C0C7CA;
|
| 60 |
-
|
| 61 |
-
.button
|
| 62 |
-
{
|
| 63 |
-
padding: 0 10px 1px;
|
| 64 |
-
line-height: 35px;
|
| 65 |
-
height: 37px;
|
| 66 |
-
font-size: 16px;
|
| 67 |
-
margin-bottom: 0;
|
| 68 |
-
|
| 69 |
-
.dashicons
|
| 70 |
-
{
|
| 71 |
-
font-size: 37px;
|
| 72 |
-
margin-left: -8px;
|
| 73 |
-
margin-right: 12px;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
&.button-primary
|
| 77 |
-
{
|
| 78 |
-
padding-right: 15px;
|
| 79 |
-
padding-left: 15px;
|
| 80 |
-
|
| 81 |
-
&:after
|
| 82 |
-
{
|
| 83 |
-
content: ' \279C';
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
&.fs-loading
|
| 87 |
-
{
|
| 88 |
-
&:after
|
| 89 |
-
{
|
| 90 |
-
content: '';
|
| 91 |
-
}
|
| 92 |
-
}
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
&.button-secondary
|
| 96 |
-
{
|
| 97 |
-
float: right;
|
| 98 |
-
}
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
// .fs-skip
|
| 102 |
-
// {
|
| 103 |
-
// line-height: 38px;
|
| 104 |
-
// vertical-align: middle;
|
| 105 |
-
// text-decoration: none;
|
| 106 |
-
// margin-left: 10px;
|
| 107 |
-
// }
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
&.fs-anonymous-disabled
|
| 111 |
-
{
|
| 112 |
-
.fs-actions
|
| 113 |
-
{
|
| 114 |
-
.button.button-primary
|
| 115 |
-
{
|
| 116 |
-
width: 100%;
|
| 117 |
-
}
|
| 118 |
-
}
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
.fs-permissions
|
| 122 |
-
{
|
| 123 |
-
padding: 10px 20px;
|
| 124 |
-
background: #FEFEFE;
|
| 125 |
-
// background: #F1F1F1;
|
| 126 |
-
@include transition(background 0.5s ease);
|
| 127 |
-
|
| 128 |
-
.fs-license-sync-disclaimer {
|
| 129 |
-
text-align: center;
|
| 130 |
-
margin-top: 0;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
.fs-trigger
|
| 134 |
-
{
|
| 135 |
-
font-size: 0.9em;
|
| 136 |
-
text-decoration: none;
|
| 137 |
-
text-align: center;
|
| 138 |
-
display: block;
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
ul
|
| 142 |
-
{
|
| 143 |
-
height: 0;
|
| 144 |
-
overflow: hidden;
|
| 145 |
-
margin: 0;
|
| 146 |
-
|
| 147 |
-
li
|
| 148 |
-
{
|
| 149 |
-
margin-bottom: 12px;
|
| 150 |
-
|
| 151 |
-
&:last-child
|
| 152 |
-
{
|
| 153 |
-
margin-bottom: 0;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
i.dashicons
|
| 157 |
-
{
|
| 158 |
-
float: left;
|
| 159 |
-
font-size: 40px;
|
| 160 |
-
width: 40px;
|
| 161 |
-
height: 40px;
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
div
|
| 165 |
-
{
|
| 166 |
-
margin-left: 55px;
|
| 167 |
-
|
| 168 |
-
span
|
| 169 |
-
{
|
| 170 |
-
font-weight: bold;
|
| 171 |
-
text-transform: uppercase;
|
| 172 |
-
color: #23282d;
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
p
|
| 176 |
-
{
|
| 177 |
-
margin: 2px 0 0 0;
|
| 178 |
-
}
|
| 179 |
-
}
|
| 180 |
-
}
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
&.fs-open
|
| 184 |
-
{
|
| 185 |
-
background: #fff;
|
| 186 |
-
|
| 187 |
-
ul
|
| 188 |
-
{
|
| 189 |
-
height: auto;
|
| 190 |
-
margin: 20px 20px 10px 20px;
|
| 191 |
-
}
|
| 192 |
-
}
|
| 193 |
-
|
| 194 |
-
@media screen and (max-width: ($form_width - 1)) {
|
| 195 |
-
background: #fff;
|
| 196 |
-
|
| 197 |
-
.fs-trigger
|
| 198 |
-
{
|
| 199 |
-
display: none;
|
| 200 |
-
}
|
| 201 |
-
|
| 202 |
-
ul
|
| 203 |
-
{
|
| 204 |
-
height: auto;
|
| 205 |
-
margin: 20px;
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
.fs-freemium-licensing {
|
| 211 |
-
padding: 8px;
|
| 212 |
-
// background: #0085BA;
|
| 213 |
-
background: #777;
|
| 214 |
-
color: #fff;
|
| 215 |
-
|
| 216 |
-
p {
|
| 217 |
-
text-align: center;
|
| 218 |
-
display: block;
|
| 219 |
-
margin: 0;
|
| 220 |
-
padding: 0;
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
a {
|
| 224 |
-
color: #C2EEFF;
|
| 225 |
-
text-decoration: underline;
|
| 226 |
-
}
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
$icon_size: 80px;
|
| 230 |
-
$wp_logo_padding: $icon_size / 10;
|
| 231 |
-
$icons_top: 10px;
|
| 232 |
-
|
| 233 |
-
.fs-visual
|
| 234 |
-
{
|
| 235 |
-
padding: 12px;
|
| 236 |
-
line-height: 0;
|
| 237 |
-
background: #fafafa;
|
| 238 |
-
height: $icon_size;
|
| 239 |
-
position: relative;
|
| 240 |
-
|
| 241 |
-
.fs-site-icon
|
| 242 |
-
{
|
| 243 |
-
position: absolute;
|
| 244 |
-
left: 20px;
|
| 245 |
-
top: $icons_top;
|
| 246 |
-
}
|
| 247 |
-
|
| 248 |
-
.fs-connect-logo
|
| 249 |
-
{
|
| 250 |
-
position: absolute;
|
| 251 |
-
right: 20px;
|
| 252 |
-
top: $icons_top;
|
| 253 |
-
}
|
| 254 |
-
|
| 255 |
-
.fs-plugin-icon
|
| 256 |
-
{
|
| 257 |
-
position: absolute;
|
| 258 |
-
top: $icons_top;
|
| 259 |
-
left: 50%;
|
| 260 |
-
margin-left: - ($icon_size / 2);
|
| 261 |
-
}
|
| 262 |
-
|
| 263 |
-
.fs-plugin-icon,
|
| 264 |
-
.fs-site-icon,
|
| 265 |
-
img,
|
| 266 |
-
object
|
| 267 |
-
{
|
| 268 |
-
width: $icon_size;
|
| 269 |
-
height: $icon_size;
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
.dashicons-wordpress
|
| 273 |
-
{
|
| 274 |
-
font-size: $icon_size - ($wp_logo_padding * 2);
|
| 275 |
-
background: $wordpress_color;
|
| 276 |
-
color: #fff;
|
| 277 |
-
width: $icon_size - ($wp_logo_padding * 2);
|
| 278 |
-
height: $icon_size - ($wp_logo_padding * 2);
|
| 279 |
-
padding: $wp_logo_padding;
|
| 280 |
-
}
|
| 281 |
-
|
| 282 |
-
.dashicons-plus
|
| 283 |
-
{
|
| 284 |
-
position: absolute;
|
| 285 |
-
top: 50%;
|
| 286 |
-
font-size: 30px;
|
| 287 |
-
margin-top: -10px;
|
| 288 |
-
color: #bbb;
|
| 289 |
-
|
| 290 |
-
&.fs-first
|
| 291 |
-
{
|
| 292 |
-
left: 28%;
|
| 293 |
-
}
|
| 294 |
-
&.fs-second
|
| 295 |
-
{
|
| 296 |
-
left: 65%;
|
| 297 |
-
}
|
| 298 |
-
}
|
| 299 |
-
|
| 300 |
-
.fs-plugin-icon,
|
| 301 |
-
.fs-connect-logo,
|
| 302 |
-
.fs-site-icon
|
| 303 |
-
{
|
| 304 |
-
border: 1px solid #ccc;
|
| 305 |
-
padding: 1px;
|
| 306 |
-
background: #fff;
|
| 307 |
-
}
|
| 308 |
-
}
|
| 309 |
-
|
| 310 |
-
.fs-terms
|
| 311 |
-
{
|
| 312 |
-
text-align: center;
|
| 313 |
-
font-size: 0.85em;
|
| 314 |
-
padding: 5px;
|
| 315 |
-
background: rgba(0, 0, 0, 0.05);
|
| 316 |
-
|
| 317 |
-
&, a
|
| 318 |
-
{
|
| 319 |
-
color: #999;
|
| 320 |
-
}
|
| 321 |
-
|
| 322 |
-
a
|
| 323 |
-
{
|
| 324 |
-
text-decoration: none;
|
| 325 |
-
}
|
| 326 |
-
}
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
.rtl
|
| 330 |
-
{
|
| 331 |
-
#fs_connect
|
| 332 |
-
{
|
| 333 |
-
.fs-actions
|
| 334 |
-
{
|
| 335 |
-
padding: 10px 20px;
|
| 336 |
-
background: #C0C7CA;
|
| 337 |
-
|
| 338 |
-
.button
|
| 339 |
-
{
|
| 340 |
-
.dashicons
|
| 341 |
-
{
|
| 342 |
-
font-size: 37px;
|
| 343 |
-
margin-left: -8px;
|
| 344 |
-
margin-right: 12px;
|
| 345 |
-
}
|
| 346 |
-
|
| 347 |
-
&.button-primary
|
| 348 |
-
{
|
| 349 |
-
&:after
|
| 350 |
-
{
|
| 351 |
-
content: ' \000bb';
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
&.fs-loading
|
| 355 |
-
{
|
| 356 |
-
&:after
|
| 357 |
-
{
|
| 358 |
-
content: '';
|
| 359 |
-
}
|
| 360 |
-
}
|
| 361 |
-
}
|
| 362 |
-
|
| 363 |
-
&.button-secondary
|
| 364 |
-
{
|
| 365 |
-
float: left;
|
| 366 |
-
}
|
| 367 |
-
}
|
| 368 |
-
}
|
| 369 |
-
|
| 370 |
-
.fs-permissions
|
| 371 |
-
{
|
| 372 |
-
ul
|
| 373 |
-
{
|
| 374 |
-
li
|
| 375 |
-
{
|
| 376 |
-
div
|
| 377 |
-
{
|
| 378 |
-
margin-right: 55px;
|
| 379 |
-
margin-left: 0;
|
| 380 |
-
}
|
| 381 |
-
|
| 382 |
-
i.dashicons
|
| 383 |
-
{
|
| 384 |
-
float: right;
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
}
|
| 388 |
-
}
|
| 389 |
-
}
|
| 390 |
-
|
| 391 |
-
.fs-visual
|
| 392 |
-
{
|
| 393 |
-
.fs-site-icon
|
| 394 |
-
{
|
| 395 |
-
right: 20px;
|
| 396 |
-
left: auto;
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
.fs-connect-logo
|
| 400 |
-
{
|
| 401 |
-
right: auto;
|
| 402 |
-
left: 20px;
|
| 403 |
-
}
|
| 404 |
-
}
|
| 405 |
-
}
|
| 406 |
-
}
|
| 407 |
-
|
| 408 |
-
.wp-pointer-content
|
| 409 |
-
{
|
| 410 |
-
#fs_connect
|
| 411 |
-
{
|
| 412 |
-
margin: 0;
|
| 413 |
-
@include box-shadow(none);
|
| 414 |
-
}
|
| 415 |
-
}
|
| 416 |
-
|
| 417 |
-
.fs-opt-in-pointer
|
| 418 |
-
{
|
| 419 |
-
.wp-pointer-content
|
| 420 |
-
{
|
| 421 |
-
padding: 0;
|
| 422 |
-
}
|
| 423 |
-
|
| 424 |
-
&.wp-pointer-top
|
| 425 |
-
{
|
| 426 |
-
.wp-pointer-arrow
|
| 427 |
-
{
|
| 428 |
-
border-bottom-color: #dfdfdf;
|
| 429 |
-
}
|
| 430 |
-
.wp-pointer-arrow-inner
|
| 431 |
-
{
|
| 432 |
-
border-bottom-color: #fafafa;
|
| 433 |
-
}
|
| 434 |
-
}
|
| 435 |
-
|
| 436 |
-
&.wp-pointer-bottom
|
| 437 |
-
{
|
| 438 |
-
.wp-pointer-arrow
|
| 439 |
-
{
|
| 440 |
-
border-top-color: #dfdfdf;
|
| 441 |
-
}
|
| 442 |
-
.wp-pointer-arrow-inner
|
| 443 |
-
{
|
| 444 |
-
border-top-color: #fafafa;
|
| 445 |
-
}
|
| 446 |
-
}
|
| 447 |
-
|
| 448 |
-
&.wp-pointer-left
|
| 449 |
-
{
|
| 450 |
-
.wp-pointer-arrow
|
| 451 |
-
{
|
| 452 |
-
border-right-color: #dfdfdf;
|
| 453 |
-
}
|
| 454 |
-
.wp-pointer-arrow-inner
|
| 455 |
-
{
|
| 456 |
-
border-right-color: #fafafa;
|
| 457 |
-
}
|
| 458 |
-
}
|
| 459 |
-
|
| 460 |
-
&.wp-pointer-right
|
| 461 |
-
{
|
| 462 |
-
.wp-pointer-arrow
|
| 463 |
-
{
|
| 464 |
-
border-left-color: #dfdfdf;
|
| 465 |
-
}
|
| 466 |
-
.wp-pointer-arrow-inner
|
| 467 |
-
{
|
| 468 |
-
border-left-color: #fafafa;
|
| 469 |
-
}
|
| 470 |
-
}
|
| 471 |
-
}
|
| 1 |
+
@import "../start";
|
| 2 |
+
|
| 3 |
+
$form_width: 480px;
|
| 4 |
+
|
| 5 |
+
#fs_connect
|
| 6 |
+
{
|
| 7 |
+
width: $form_width;
|
| 8 |
+
@include box-shadow(0px 1px 2px rgba(0, 0, 0, 0.3));
|
| 9 |
+
margin: 20px 0;
|
| 10 |
+
|
| 11 |
+
@media screen and (max-width: ($form_width - 1)) {
|
| 12 |
+
@include box-shadow(none);
|
| 13 |
+
width: auto;
|
| 14 |
+
margin: 0 0 0 -10px;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
.fs-content
|
| 18 |
+
{
|
| 19 |
+
background: #fff;
|
| 20 |
+
padding: 15px 20px;
|
| 21 |
+
|
| 22 |
+
.fs-error {
|
| 23 |
+
background: snow;
|
| 24 |
+
color: $fs-logo-magenta-color;
|
| 25 |
+
border: 1px solid $fs-logo-magenta-color;
|
| 26 |
+
@include box-shadow(0 1px 1px 0 rgba(0,0,0,.1));
|
| 27 |
+
text-align: center;
|
| 28 |
+
padding: 5px;
|
| 29 |
+
margin-bottom: 10px;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
p
|
| 33 |
+
{
|
| 34 |
+
margin: 0;
|
| 35 |
+
padding: 0;
|
| 36 |
+
font-size: 1.2em;
|
| 37 |
+
}
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
.fs-license-key-container {
|
| 41 |
+
position: relative;
|
| 42 |
+
width: 280px;
|
| 43 |
+
margin: 10px auto 0 auto;
|
| 44 |
+
|
| 45 |
+
input {
|
| 46 |
+
width: 100%;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
.dashicons {
|
| 50 |
+
position: absolute;
|
| 51 |
+
top: 5px;
|
| 52 |
+
right: 5px;
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
.fs-actions
|
| 57 |
+
{
|
| 58 |
+
padding: 10px 20px;
|
| 59 |
+
background: #C0C7CA;
|
| 60 |
+
|
| 61 |
+
.button
|
| 62 |
+
{
|
| 63 |
+
padding: 0 10px 1px;
|
| 64 |
+
line-height: 35px;
|
| 65 |
+
height: 37px;
|
| 66 |
+
font-size: 16px;
|
| 67 |
+
margin-bottom: 0;
|
| 68 |
+
|
| 69 |
+
.dashicons
|
| 70 |
+
{
|
| 71 |
+
font-size: 37px;
|
| 72 |
+
margin-left: -8px;
|
| 73 |
+
margin-right: 12px;
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
&.button-primary
|
| 77 |
+
{
|
| 78 |
+
padding-right: 15px;
|
| 79 |
+
padding-left: 15px;
|
| 80 |
+
|
| 81 |
+
&:after
|
| 82 |
+
{
|
| 83 |
+
content: ' \279C';
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
&.fs-loading
|
| 87 |
+
{
|
| 88 |
+
&:after
|
| 89 |
+
{
|
| 90 |
+
content: '';
|
| 91 |
+
}
|
| 92 |
+
}
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
&.button-secondary
|
| 96 |
+
{
|
| 97 |
+
float: right;
|
| 98 |
+
}
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
// .fs-skip
|
| 102 |
+
// {
|
| 103 |
+
// line-height: 38px;
|
| 104 |
+
// vertical-align: middle;
|
| 105 |
+
// text-decoration: none;
|
| 106 |
+
// margin-left: 10px;
|
| 107 |
+
// }
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
&.fs-anonymous-disabled
|
| 111 |
+
{
|
| 112 |
+
.fs-actions
|
| 113 |
+
{
|
| 114 |
+
.button.button-primary
|
| 115 |
+
{
|
| 116 |
+
width: 100%;
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
.fs-permissions
|
| 122 |
+
{
|
| 123 |
+
padding: 10px 20px;
|
| 124 |
+
background: #FEFEFE;
|
| 125 |
+
// background: #F1F1F1;
|
| 126 |
+
@include transition(background 0.5s ease);
|
| 127 |
+
|
| 128 |
+
.fs-license-sync-disclaimer {
|
| 129 |
+
text-align: center;
|
| 130 |
+
margin-top: 0;
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
.fs-trigger
|
| 134 |
+
{
|
| 135 |
+
font-size: 0.9em;
|
| 136 |
+
text-decoration: none;
|
| 137 |
+
text-align: center;
|
| 138 |
+
display: block;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
ul
|
| 142 |
+
{
|
| 143 |
+
height: 0;
|
| 144 |
+
overflow: hidden;
|
| 145 |
+
margin: 0;
|
| 146 |
+
|
| 147 |
+
li
|
| 148 |
+
{
|
| 149 |
+
margin-bottom: 12px;
|
| 150 |
+
|
| 151 |
+
&:last-child
|
| 152 |
+
{
|
| 153 |
+
margin-bottom: 0;
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
i.dashicons
|
| 157 |
+
{
|
| 158 |
+
float: left;
|
| 159 |
+
font-size: 40px;
|
| 160 |
+
width: 40px;
|
| 161 |
+
height: 40px;
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
div
|
| 165 |
+
{
|
| 166 |
+
margin-left: 55px;
|
| 167 |
+
|
| 168 |
+
span
|
| 169 |
+
{
|
| 170 |
+
font-weight: bold;
|
| 171 |
+
text-transform: uppercase;
|
| 172 |
+
color: #23282d;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
p
|
| 176 |
+
{
|
| 177 |
+
margin: 2px 0 0 0;
|
| 178 |
+
}
|
| 179 |
+
}
|
| 180 |
+
}
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
&.fs-open
|
| 184 |
+
{
|
| 185 |
+
background: #fff;
|
| 186 |
+
|
| 187 |
+
ul
|
| 188 |
+
{
|
| 189 |
+
height: auto;
|
| 190 |
+
margin: 20px 20px 10px 20px;
|
| 191 |
+
}
|
| 192 |
+
}
|
| 193 |
+
|
| 194 |
+
@media screen and (max-width: ($form_width - 1)) {
|
| 195 |
+
background: #fff;
|
| 196 |
+
|
| 197 |
+
.fs-trigger
|
| 198 |
+
{
|
| 199 |
+
display: none;
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
+
ul
|
| 203 |
+
{
|
| 204 |
+
height: auto;
|
| 205 |
+
margin: 20px;
|
| 206 |
+
}
|
| 207 |
+
}
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
.fs-freemium-licensing {
|
| 211 |
+
padding: 8px;
|
| 212 |
+
// background: #0085BA;
|
| 213 |
+
background: #777;
|
| 214 |
+
color: #fff;
|
| 215 |
+
|
| 216 |
+
p {
|
| 217 |
+
text-align: center;
|
| 218 |
+
display: block;
|
| 219 |
+
margin: 0;
|
| 220 |
+
padding: 0;
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
a {
|
| 224 |
+
color: #C2EEFF;
|
| 225 |
+
text-decoration: underline;
|
| 226 |
+
}
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
$icon_size: 80px;
|
| 230 |
+
$wp_logo_padding: $icon_size / 10;
|
| 231 |
+
$icons_top: 10px;
|
| 232 |
+
|
| 233 |
+
.fs-visual
|
| 234 |
+
{
|
| 235 |
+
padding: 12px;
|
| 236 |
+
line-height: 0;
|
| 237 |
+
background: #fafafa;
|
| 238 |
+
height: $icon_size;
|
| 239 |
+
position: relative;
|
| 240 |
+
|
| 241 |
+
.fs-site-icon
|
| 242 |
+
{
|
| 243 |
+
position: absolute;
|
| 244 |
+
left: 20px;
|
| 245 |
+
top: $icons_top;
|
| 246 |
+
}
|
| 247 |
+
|
| 248 |
+
.fs-connect-logo
|
| 249 |
+
{
|
| 250 |
+
position: absolute;
|
| 251 |
+
right: 20px;
|
| 252 |
+
top: $icons_top;
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
.fs-plugin-icon
|
| 256 |
+
{
|
| 257 |
+
position: absolute;
|
| 258 |
+
top: $icons_top;
|
| 259 |
+
left: 50%;
|
| 260 |
+
margin-left: - ($icon_size / 2);
|
| 261 |
+
}
|
| 262 |
+
|
| 263 |
+
.fs-plugin-icon,
|
| 264 |
+
.fs-site-icon,
|
| 265 |
+
img,
|
| 266 |
+
object
|
| 267 |
+
{
|
| 268 |
+
width: $icon_size;
|
| 269 |
+
height: $icon_size;
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
.dashicons-wordpress
|
| 273 |
+
{
|
| 274 |
+
font-size: $icon_size - ($wp_logo_padding * 2);
|
| 275 |
+
background: $wordpress_color;
|
| 276 |
+
color: #fff;
|
| 277 |
+
width: $icon_size - ($wp_logo_padding * 2);
|
| 278 |
+
height: $icon_size - ($wp_logo_padding * 2);
|
| 279 |
+
padding: $wp_logo_padding;
|
| 280 |
+
}
|
| 281 |
+
|
| 282 |
+
.dashicons-plus
|
| 283 |
+
{
|
| 284 |
+
position: absolute;
|
| 285 |
+
top: 50%;
|
| 286 |
+
font-size: 30px;
|
| 287 |
+
margin-top: -10px;
|
| 288 |
+
color: #bbb;
|
| 289 |
+
|
| 290 |
+
&.fs-first
|
| 291 |
+
{
|
| 292 |
+
left: 28%;
|
| 293 |
+
}
|
| 294 |
+
&.fs-second
|
| 295 |
+
{
|
| 296 |
+
left: 65%;
|
| 297 |
+
}
|
| 298 |
+
}
|
| 299 |
+
|
| 300 |
+
.fs-plugin-icon,
|
| 301 |
+
.fs-connect-logo,
|
| 302 |
+
.fs-site-icon
|
| 303 |
+
{
|
| 304 |
+
border: 1px solid #ccc;
|
| 305 |
+
padding: 1px;
|
| 306 |
+
background: #fff;
|
| 307 |
+
}
|
| 308 |
+
}
|
| 309 |
+
|
| 310 |
+
.fs-terms
|
| 311 |
+
{
|
| 312 |
+
text-align: center;
|
| 313 |
+
font-size: 0.85em;
|
| 314 |
+
padding: 5px;
|
| 315 |
+
background: rgba(0, 0, 0, 0.05);
|
| 316 |
+
|
| 317 |
+
&, a
|
| 318 |
+
{
|
| 319 |
+
color: #999;
|
| 320 |
+
}
|
| 321 |
+
|
| 322 |
+
a
|
| 323 |
+
{
|
| 324 |
+
text-decoration: none;
|
| 325 |
+
}
|
| 326 |
+
}
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
.rtl
|
| 330 |
+
{
|
| 331 |
+
#fs_connect
|
| 332 |
+
{
|
| 333 |
+
.fs-actions
|
| 334 |
+
{
|
| 335 |
+
padding: 10px 20px;
|
| 336 |
+
background: #C0C7CA;
|
| 337 |
+
|
| 338 |
+
.button
|
| 339 |
+
{
|
| 340 |
+
.dashicons
|
| 341 |
+
{
|
| 342 |
+
font-size: 37px;
|
| 343 |
+
margin-left: -8px;
|
| 344 |
+
margin-right: 12px;
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
&.button-primary
|
| 348 |
+
{
|
| 349 |
+
&:after
|
| 350 |
+
{
|
| 351 |
+
content: ' \000bb';
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
&.fs-loading
|
| 355 |
+
{
|
| 356 |
+
&:after
|
| 357 |
+
{
|
| 358 |
+
content: '';
|
| 359 |
+
}
|
| 360 |
+
}
|
| 361 |
+
}
|
| 362 |
+
|
| 363 |
+
&.button-secondary
|
| 364 |
+
{
|
| 365 |
+
float: left;
|
| 366 |
+
}
|
| 367 |
+
}
|
| 368 |
+
}
|
| 369 |
+
|
| 370 |
+
.fs-permissions
|
| 371 |
+
{
|
| 372 |
+
ul
|
| 373 |
+
{
|
| 374 |
+
li
|
| 375 |
+
{
|
| 376 |
+
div
|
| 377 |
+
{
|
| 378 |
+
margin-right: 55px;
|
| 379 |
+
margin-left: 0;
|
| 380 |
+
}
|
| 381 |
+
|
| 382 |
+
i.dashicons
|
| 383 |
+
{
|
| 384 |
+
float: right;
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
}
|
| 388 |
+
}
|
| 389 |
+
}
|
| 390 |
+
|
| 391 |
+
.fs-visual
|
| 392 |
+
{
|
| 393 |
+
.fs-site-icon
|
| 394 |
+
{
|
| 395 |
+
right: 20px;
|
| 396 |
+
left: auto;
|
| 397 |
+
}
|
| 398 |
+
|
| 399 |
+
.fs-connect-logo
|
| 400 |
+
{
|
| 401 |
+
right: auto;
|
| 402 |
+
left: 20px;
|
| 403 |
+
}
|
| 404 |
+
}
|
| 405 |
+
}
|
| 406 |
+
}
|
| 407 |
+
|
| 408 |
+
.wp-pointer-content
|
| 409 |
+
{
|
| 410 |
+
#fs_connect
|
| 411 |
+
{
|
| 412 |
+
margin: 0;
|
| 413 |
+
@include box-shadow(none);
|
| 414 |
+
}
|
| 415 |
+
}
|
| 416 |
+
|
| 417 |
+
.fs-opt-in-pointer
|
| 418 |
+
{
|
| 419 |
+
.wp-pointer-content
|
| 420 |
+
{
|
| 421 |
+
padding: 0;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
&.wp-pointer-top
|
| 425 |
+
{
|
| 426 |
+
.wp-pointer-arrow
|
| 427 |
+
{
|
| 428 |
+
border-bottom-color: #dfdfdf;
|
| 429 |
+
}
|
| 430 |
+
.wp-pointer-arrow-inner
|
| 431 |
+
{
|
| 432 |
+
border-bottom-color: #fafafa;
|
| 433 |
+
}
|
| 434 |
+
}
|
| 435 |
+
|
| 436 |
+
&.wp-pointer-bottom
|
| 437 |
+
{
|
| 438 |
+
.wp-pointer-arrow
|
| 439 |
+
{
|
| 440 |
+
border-top-color: #dfdfdf;
|
| 441 |
+
}
|
| 442 |
+
.wp-pointer-arrow-inner
|
| 443 |
+
{
|
| 444 |
+
border-top-color: #fafafa;
|
| 445 |
+
}
|
| 446 |
+
}
|
| 447 |
+
|
| 448 |
+
&.wp-pointer-left
|
| 449 |
+
{
|
| 450 |
+
.wp-pointer-arrow
|
| 451 |
+
{
|
| 452 |
+
border-right-color: #dfdfdf;
|
| 453 |
+
}
|
| 454 |
+
.wp-pointer-arrow-inner
|
| 455 |
+
{
|
| 456 |
+
border-right-color: #fafafa;
|
| 457 |
+
}
|
| 458 |
+
}
|
| 459 |
+
|
| 460 |
+
&.wp-pointer-right
|
| 461 |
+
{
|
| 462 |
+
.wp-pointer-arrow
|
| 463 |
+
{
|
| 464 |
+
border-left-color: #dfdfdf;
|
| 465 |
+
}
|
| 466 |
+
.wp-pointer-arrow-inner
|
| 467 |
+
{
|
| 468 |
+
border-left-color: #fafafa;
|
| 469 |
+
}
|
| 470 |
+
}
|
| 471 |
+
}
|
freemius/includes/i18n.php
CHANGED
|
@@ -1,518 +1,518 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* @package Freemius
|
| 4 |
-
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
-
* @since 1.1.4
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
-
exit;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
require_once dirname( __FILE__ ) . '/l10n.php';
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* All strings can now be overridden.
|
| 17 |
-
*
|
| 18 |
-
* For example, if we want to override:
|
| 19 |
-
* 'you-are-step-away' => 'You are just one step away - %s',
|
| 20 |
-
*
|
| 21 |
-
* We can use the filter:
|
| 22 |
-
* fs_override_i18n( array(
|
| 23 |
-
* 'opt-in-connect' => __( "Yes - I'm in!", '{your-text_domain}' ),
|
| 24 |
-
* 'skip' => __( 'Not today', '{your-text_domain}' ),
|
| 25 |
-
* ), '{plugin_slug}' );
|
| 26 |
-
*
|
| 27 |
-
* Or with the Freemius instance:
|
| 28 |
-
*
|
| 29 |
-
* my_freemius->override_i18n( array(
|
| 30 |
-
* 'opt-in-connect' => __( "Yes - I'm in!", '{your-text_domain}' ),
|
| 31 |
-
* 'skip' => __( 'Not today', '{your-text_domain}' ),
|
| 32 |
-
* );
|
| 33 |
-
*/
|
| 34 |
-
global $fs_text;
|
| 35 |
-
|
| 36 |
-
$fs_text = array(
|
| 37 |
-
'account' => _fs_text( 'Account' ),
|
| 38 |
-
'addon' => _fs_text( 'Add On' ),
|
| 39 |
-
'contact-us' => _fs_text( 'Contact Us' ),
|
| 40 |
-
'contact-support' => _fs_text( 'Contact Support' ),
|
| 41 |
-
'change-ownership' => _fs_text( 'Change Ownership' ),
|
| 42 |
-
'support' => _fs_text( 'Support' ),
|
| 43 |
-
'support-forum' => _fs_text( 'Support Forum' ),
|
| 44 |
-
'add-ons' => _fs_text( 'Add Ons' ),
|
| 45 |
-
'upgrade' => _fs_x( 'Upgrade', 'verb' ),
|
| 46 |
-
'awesome' => _fs_text( 'Awesome' ),
|
| 47 |
-
'pricing' => _fs_x( 'Pricing', 'noun' ),
|
| 48 |
-
'price' => _fs_x( 'Price', 'noun' ),
|
| 49 |
-
'unlimited-updates' => _fs_text( 'Unlimited Updates' ),
|
| 50 |
-
'downgrade' => _fs_x( 'Downgrade', 'verb' ),
|
| 51 |
-
'cancel-trial' => _fs_text( 'Cancel Trial' ),
|
| 52 |
-
'free-trial' => _fs_text( 'Free Trial' ),
|
| 53 |
-
'start-free-x' => _fs_text( 'Start my free %s' ),
|
| 54 |
-
'no-commitment-x' => _fs_text( 'No commitment for %s - cancel anytime' ),
|
| 55 |
-
'after-x-pay-as-little-y' => _fs_text( 'After your free %s, pay as little as %s' ),
|
| 56 |
-
'details' => _fs_text( 'Details' ),
|
| 57 |
-
'account-details' => _fs_text( 'Account Details' ),
|
| 58 |
-
'delete' => _fs_x( 'Delete', 'verb' ),
|
| 59 |
-
'show' => _fs_x( 'Show', 'verb' ),
|
| 60 |
-
'hide' => _fs_x( 'Hide', 'verb' ),
|
| 61 |
-
'edit' => _fs_x( 'Edit', 'verb' ),
|
| 62 |
-
'update' => _fs_x( 'Update', 'verb' ),
|
| 63 |
-
'date' => _fs_text( 'Date' ),
|
| 64 |
-
'amount' => _fs_text( 'Amount' ),
|
| 65 |
-
'invoice' => _fs_text( 'Invoice' ),
|
| 66 |
-
'billing' => _fs_text( 'Billing' ),
|
| 67 |
-
'payments' => _fs_text( 'Payments' ),
|
| 68 |
-
'delete-account' => _fs_text( 'Delete Account' ),
|
| 69 |
-
'dismiss' => _fs_x( 'Dismiss', 'as close a window' ),
|
| 70 |
-
'plan' => _fs_x( 'Plan', 'as product pricing plan' ),
|
| 71 |
-
'change-plan' => _fs_text( 'Change Plan' ),
|
| 72 |
-
'download-x-version' => _fs_x( 'Download %s Version', 'as download professional version' ),
|
| 73 |
-
'download-x-version-now' => _fs_x( 'Download %s version now', 'as download professional version now' ),
|
| 74 |
-
'download-latest' => _fs_x( 'Download Latest', 'as download latest version' ),
|
| 75 |
-
'you-have-x-license' => _fs_x( 'You have a %s license.', 'E.g. you have a professional license.' ),
|
| 76 |
-
'new' => _fs_text( 'New' ),
|
| 77 |
-
'free' => _fs_text( 'Free' ),
|
| 78 |
-
'trial' => _fs_x( 'Trial', 'as trial plan' ),
|
| 79 |
-
'start-trial' => _fs_x( 'Start Trial', 'as starting a trial plan' ),
|
| 80 |
-
'purchase' => _fs_x( 'Purchase', 'verb' ),
|
| 81 |
-
'purchase-license' => _fs_text( 'Purchase License' ),
|
| 82 |
-
'buy' => _fs_x( 'Buy', 'verb' ),
|
| 83 |
-
'buy-license' => _fs_text( 'Buy License' ),
|
| 84 |
-
'license-single-site' => _fs_text( 'Single Site License' ),
|
| 85 |
-
'license-unlimited' => _fs_text( 'Unlimited Licenses' ),
|
| 86 |
-
'license-x-sites' => _fs_text( 'Up to %s Sites' ),
|
| 87 |
-
'renew-license-now' => _fs_text( '%sRenew your license now%s to access version %s features and support.' ),
|
| 88 |
-
'ask-for-upgrade-email-address' => _fs_text( "Enter the email address you've used for the upgrade below and we will resend you the license key." ),
|
| 89 |
-
'x-plan' => _fs_x( '%s Plan', 'e.g. Professional Plan' ),
|
| 90 |
-
'you-are-step-away' => _fs_text( 'You are just one step away - %s' ),
|
| 91 |
-
'activate-x-now' => _fs_x( 'Complete "%s" Activation Now',
|
| 92 |
-
'%s - plugin name. As complete "Jetpack" activation now' ),
|
| 93 |
-
'few-plugin-tweaks' => _fs_text( 'We made a few tweaks to the plugin, %s' ),
|
| 94 |
-
'optin-x-now' => _fs_text( 'Opt-in to make "%s" Better!' ),
|
| 95 |
-
'error' => _fs_text( 'Error' ),
|
| 96 |
-
'failed-finding-main-path' => _fs_text( 'Freemius SDK couldn\'t find the plugin\'s main file. Please contact sdk@freemius.com with the current error.' ),
|
| 97 |
-
#region Account
|
| 98 |
-
|
| 99 |
-
'expiration' => _fs_x( 'Expiration', 'as expiration date' ),
|
| 100 |
-
'license' => _fs_x( 'License', 'as software license' ),
|
| 101 |
-
'not-verified' => _fs_text( 'not verified' ),
|
| 102 |
-
'verify-email' => _fs_text( 'Verify Email' ),
|
| 103 |
-
'expires-in' => _fs_x( 'Expires in %s', 'e.g. expires in 2 months' ),
|
| 104 |
-
'renews-in' => _fs_x( 'Auto renews in %s', 'e.g. auto renews in 2 months' ),
|
| 105 |
-
'no-expiration' => _fs_text( 'No expiration' ),
|
| 106 |
-
'expired' => _fs_text( 'Expired' ),
|
| 107 |
-
'cancelled' => _fs_text( 'Cancelled' ),
|
| 108 |
-
'in-x' => _fs_x( 'In %s', 'e.g. In 2 hours' ),
|
| 109 |
-
'x-ago' => _fs_x( '%s ago', 'e.g. 2 min ago' ),
|
| 110 |
-
/* translators: %s: Version number (e.g. 4.6 or higher) */
|
| 111 |
-
'x-or-higher' => _fs_text( '%s or higher' ),
|
| 112 |
-
'version' => _fs_x( 'Version', 'as plugin version' ),
|
| 113 |
-
'name' => _fs_text( 'Name' ),
|
| 114 |
-
'email' => _fs_text( 'Email' ),
|
| 115 |
-
'email-address' => _fs_text( 'Email address' ),
|
| 116 |
-
'verified' => _fs_text( 'Verified' ),
|
| 117 |
-
'module' => _fs_text( 'Module' ),
|
| 118 |
-
'module-type' => _fs_text( 'Module Type' ),
|
| 119 |
-
'plugin' => _fs_text( 'Plugin' ),
|
| 120 |
-
'plugins' => _fs_text( 'Plugins' ),
|
| 121 |
-
'theme' => _fs_text( 'Theme' ),
|
| 122 |
-
'themes' => _fs_text( 'Themes' ),
|
| 123 |
-
'path' => _fs_x( 'Path', 'as file/folder path' ),
|
| 124 |
-
'title' => _fs_text( 'Title' ),
|
| 125 |
-
'free-version' => _fs_text( 'Free version' ),
|
| 126 |
-
'premium-version' => _fs_text( 'Premium version' ),
|
| 127 |
-
'slug' => _fs_x( 'Slug', 'as WP plugin slug' ),
|
| 128 |
-
'id' => _fs_text( 'ID' ),
|
| 129 |
-
'users' => _fs_text( 'Users' ),
|
| 130 |
-
'plugin-installs' => _fs_text( 'Plugin Installs' ),
|
| 131 |
-
'module-installs' => _fs_text( '%s Installs' ),
|
| 132 |
-
'sites' => _fs_x( 'Sites', 'like websites' ),
|
| 133 |
-
'user-id' => _fs_text( 'User ID' ),
|
| 134 |
-
'site-id' => _fs_text( 'Site ID' ),
|
| 135 |
-
'public-key' => _fs_text( 'Public Key' ),
|
| 136 |
-
'secret-key' => _fs_text( 'Secret Key' ),
|
| 137 |
-
'no-secret' => _fs_x( 'No Secret', 'as secret encryption key missing' ),
|
| 138 |
-
'no-id' => _fs_text( 'No ID' ),
|
| 139 |
-
'sync-license' => _fs_x( 'Sync License', 'as synchronize license' ),
|
| 140 |
-
'sync' => _fs_x( 'Sync', 'as synchronize' ),
|
| 141 |
-
'activate-license' => _fs_text( 'Activate License' ),
|
| 142 |
-
'activate-free-version' => _fs_text( 'Activate Free Version' ),
|
| 143 |
-
'activate-license-message' => _fs_text( 'Please enter the license key that you received in the email right after the purchase:' ),
|
| 144 |
-
'activating-license' => _fs_text( 'Activating license...' ),
|
| 145 |
-
'change-license' => _fs_text( 'Change License' ),
|
| 146 |
-
'update-license' => _fs_text( 'Update License' ),
|
| 147 |
-
'deactivate-license' => _fs_text( 'Deactivate License' ),
|
| 148 |
-
'activate' => _fs_text( 'Activate' ),
|
| 149 |
-
'deactivate' => _fs_text( 'Deactivate' ),
|
| 150 |
-
'skip-deactivate' => _fs_text( 'Skip & Deactivate' ),
|
| 151 |
-
'skip-and-x' => _fs_text( 'Skip & %s' ),
|
| 152 |
-
'no-deactivate' => _fs_text( 'No - just deactivate' ),
|
| 153 |
-
'yes-do-your-thing' => _fs_text( 'Yes - do your thing' ),
|
| 154 |
-
'active' => _fs_x( 'Active', 'active mode' ),
|
| 155 |
-
'is-active' => _fs_x( 'Is Active', 'is active mode?' ),
|
| 156 |
-
'install-now' => _fs_text( 'Install Now' ),
|
| 157 |
-
'install-update-now' => _fs_text( 'Install Update Now' ),
|
| 158 |
-
'more-information-about-x' => _fs_text( 'More information about %s' ),
|
| 159 |
-
'localhost' => _fs_text( 'Localhost' ),
|
| 160 |
-
'activate-x-plan' => _fs_x( 'Activate %s Plan', 'as activate Professional plan' ),
|
| 161 |
-
'x-left' => _fs_x( '%s left', 'as 5 licenses left' ),
|
| 162 |
-
'last-license' => _fs_text( 'Last license' ),
|
| 163 |
-
'what-is-your-x' => _fs_text( 'What is your %s?' ),
|
| 164 |
-
'activate-this-addon' => _fs_text( 'Activate this add-on' ),
|
| 165 |
-
'deactivate-license-confirm' => _fs_text( 'Deactivating your license will block all premium features, but will enable you to activate the license on another site. Are you sure you want to proceed?' ),
|
| 166 |
-
'delete-account-x-confirm' => _fs_text( 'Deleting the account will automatically deactivate your %s plan license so you can use it on other sites. If you want to terminate the recurring payments as well, click the "Cancel" button, and first "Downgrade" your account. Are you sure you would like to continue with the deletion?' ),
|
| 167 |
-
'delete-account-confirm' => _fs_text( 'Deletion is not temporary. Only delete if you no longer want to use this plugin anymore. Are you sure you would like to continue with the deletion?' ),
|
| 168 |
-
'downgrade-x-confirm' => _fs_text( 'Downgrading your plan will immediately stop all future recurring payments and your %s plan license will expire in %s.' ),
|
| 169 |
-
'cancel-trial-confirm' => _fs_text( 'Cancelling the trial will immediately block access to all premium features. Are you sure?' ),
|
| 170 |
-
'after-downgrade-non-blocking' => _fs_text( 'You can still enjoy all %s features but you will not have access to plugin updates and support.' ),
|
| 171 |
-
'after-downgrade-blocking' => _fs_text( 'Once your license expires you can still use the Free version but you will NOT have access to the %s features.' ),
|
| 172 |
-
'proceed-confirmation' => _fs_text( 'Are you sure you want to proceed?' ),
|
| 173 |
-
#endregion Account
|
| 174 |
-
|
| 175 |
-
'add-ons-for-x' => _fs_text( 'Add Ons for %s' ),
|
| 176 |
-
'add-ons-missing' => _fs_text( 'We could\'nt load the add-ons list. It\'s probably an issue on our side, please try to come back in few minutes.' ),
|
| 177 |
-
#region Plugin Deactivation
|
| 178 |
-
'anonymous-feedback' => _fs_text( 'Anonymous feedback' ),
|
| 179 |
-
'quick-feedback' => _fs_text( 'Quick feedback' ),
|
| 180 |
-
'deactivation-share-reason' => _fs_text( 'If you have a moment, please let us know why you are deactivating' ),
|
| 181 |
-
'deactivation-modal-button-confirm' => _fs_text( 'Yes - Deactivate' ),
|
| 182 |
-
'deactivation-modal-button-submit' => _fs_text( 'Submit & Deactivate' ),
|
| 183 |
-
'cancel' => _fs_text( 'Cancel' ),
|
| 184 |
-
'reason-no-longer-needed' => _fs_text( 'I no longer need the plugin' ),
|
| 185 |
-
'reason-found-a-better-plugin' => _fs_text( 'I found a better plugin' ),
|
| 186 |
-
'reason-needed-for-a-short-period' => _fs_text( 'I only needed the plugin for a short period' ),
|
| 187 |
-
'reason-broke-my-site' => _fs_text( 'The plugin broke my site' ),
|
| 188 |
-
'reason-suddenly-stopped-working' => _fs_text( 'The plugin suddenly stopped working' ),
|
| 189 |
-
'reason-cant-pay-anymore' => _fs_text( "I can't pay for it anymore" ),
|
| 190 |
-
'reason-temporary-deactivation' => _fs_text( "It's a temporary deactivation. I'm just debugging an issue." ),
|
| 191 |
-
'reason-other' => _fs_x( 'Other',
|
| 192 |
-
'the text of the "other" reason for deactivating the plugin that is shown in the modal box.' ),
|
| 193 |
-
'ask-for-reason-message' => _fs_text( 'Kindly tell us the reason so we can improve.' ),
|
| 194 |
-
'placeholder-plugin-name' => _fs_text( "What's the plugin's name?" ),
|
| 195 |
-
'placeholder-comfortable-price' => _fs_text( 'What price would you feel comfortable paying?' ),
|
| 196 |
-
'reason-couldnt-make-it-work' => _fs_text( "I couldn't understand how to make it work" ),
|
| 197 |
-
'reason-great-but-need-specific-feature' => _fs_text( "The plugin is great, but I need specific feature that you don't support" ),
|
| 198 |
-
'reason-not-working' => _fs_text( 'The plugin is not working' ),
|
| 199 |
-
'reason-not-what-i-was-looking-for' => _fs_text( "It's not what I was looking for" ),
|
| 200 |
-
'reason-didnt-work-as-expected' => _fs_text( "The plugin didn't work as expected" ),
|
| 201 |
-
'placeholder-feature' => _fs_text( 'What feature?' ),
|
| 202 |
-
'placeholder-share-what-didnt-work' => _fs_text( "Kindly share what didn't work so we can fix it for future users..." ),
|
| 203 |
-
'placeholder-what-youve-been-looking-for' => _fs_text( "What you've been looking for?" ),
|
| 204 |
-
'placeholder-what-did-you-expect' => _fs_text( "What did you expect?" ),
|
| 205 |
-
'reason-didnt-work' => _fs_text( "The plugin didn't work" ),
|
| 206 |
-
'reason-dont-like-to-share-my-information' => _fs_text( "I don't like to share my information with you" ),
|
| 207 |
-
'dont-have-to-share-any-data' => _fs_text( "You might have missed it, but you don't have to share any data and can just %s the opt-in." ),
|
| 208 |
-
#endregion Plugin Deactivation
|
| 209 |
-
|
| 210 |
-
#region Connect
|
| 211 |
-
'hey-x' => _fs_x( 'Hey %s,', 'greeting' ),
|
| 212 |
-
'thanks-x' => _fs_x( 'Thanks %s!', 'a greeting. E.g. Thanks John!' ),
|
| 213 |
-
'connect-message' => _fs_text( 'Never miss an important update - opt-in to our security and feature updates notifications, and non-sensitive diagnostic tracking with %4$s.' ),
|
| 214 |
-
'connect-message_on-update' => _fs_text( 'Please help us improve %1$s! If you opt-in, some data about your usage of %1$s will be sent to %4$s. If you skip this, that\'s okay! %1$s will still work just fine.' ),
|
| 215 |
-
'pending-activation-message' => _fs_text( 'You should receive an activation email for %s to your mailbox at %s. Please make sure you click the activation button in that email to %s.' ),
|
| 216 |
-
'complete-the-install' => _fs_text( 'complete the install' ),
|
| 217 |
-
'start-the-trial' => _fs_text( 'start the trial' ),
|
| 218 |
-
'thanks-for-purchasing' => _fs_text( 'Thanks for purchasing %s! To get started, please enter your license key:' ),
|
| 219 |
-
'license-sync-disclaimer' => _fs_text( 'The plugin will be periodically sending data to %s to check for plugin updates and verify the validity of your license.' ),
|
| 220 |
-
'what-permissions' => _fs_text( 'What permissions are being granted?' ),
|
| 221 |
-
'permissions-profile' => _fs_text( 'Your Profile Overview' ),
|
| 222 |
-
'permissions-profile_desc' => _fs_text( 'Name and email address' ),
|
| 223 |
-
'permissions-site' => _fs_text( 'Your Site Overview' ),
|
| 224 |
-
'permissions-site_desc' => _fs_text( 'Site URL, WP version, PHP info, plugins & themes' ),
|
| 225 |
-
'permissions-events' => _fs_text( 'Current Plugin Events' ),
|
| 226 |
-
'permissions-events_desc' => _fs_text( 'Activation, deactivation and uninstall' ),
|
| 227 |
-
'permissions-plugins_themes' => _fs_text( 'Plugins & Themes' ),
|
| 228 |
-
'permissions-plugins_themes_desc' => _fs_text( 'Titles, versions and state.' ),
|
| 229 |
-
'permissions-admin-notices' => _fs_text( 'Admin Notices' ),
|
| 230 |
-
'permissions-newsletter' => _fs_text( 'Newsletter' ),
|
| 231 |
-
'permissions-newsletter_desc' => _fs_text( 'Updates, announcements, marketing, no spam' ),
|
| 232 |
-
'privacy-policy' => _fs_text( 'Privacy Policy' ),
|
| 233 |
-
'tos' => _fs_text( 'Terms of Service' ),
|
| 234 |
-
'activating' => _fs_x( 'Activating', 'as activating plugin' ),
|
| 235 |
-
'sending-email' => _fs_x( 'Sending email', 'as in the process of sending an email' ),
|
| 236 |
-
'opt-in-connect' => _fs_x( 'Allow & Continue', 'button label' ),
|
| 237 |
-
'agree-activate-license' => _fs_x( 'Agree & Activate License', 'button label' ),
|
| 238 |
-
'skip' => _fs_x( 'Skip', 'verb' ),
|
| 239 |
-
'click-here-to-use-plugin-anonymously' => _fs_text( 'Click here to use the plugin anonymously' ),
|
| 240 |
-
'resend-activation-email' => _fs_text( 'Re-send activation email' ),
|
| 241 |
-
'license-key' => _fs_text( 'License key' ),
|
| 242 |
-
'send-license-key' => _fs_text( 'Send License Key' ),
|
| 243 |
-
'sending-license-key' => _fs_text( 'Sending license key' ),
|
| 244 |
-
'have-license-key' => _fs_text( 'Have a license key?' ),
|
| 245 |
-
'dont-have-license-key' => _fs_text( 'Don\'t have a license key?' ),
|
| 246 |
-
'cant-find-license-key' => _fs_text( "Can't find your license key?" ),
|
| 247 |
-
'email-not-found' => _fs_text( "We couldn't find your email address in the system, are you sure it's the right address?" ),
|
| 248 |
-
'no-active-licenses' => _fs_text( "We can't see any active licenses associated with that email address, are you sure it's the right address?" ),
|
| 249 |
-
'opt-in' => _fs_text( 'Opt In' ),
|
| 250 |
-
'opt-out' => _fs_text( 'Opt Out' ),
|
| 251 |
-
'opt-out-cancel' => _fs_text( 'On second thought - I want to continue helping' ),
|
| 252 |
-
'opting-out' => _fs_text( 'Opting out...' ),
|
| 253 |
-
'opting-in' => _fs_text( 'Opting in...' ),
|
| 254 |
-
'opt-out-message-appreciation' => _fs_text( 'We appreciate your help in making the %s better by letting us track some usage data.' ),
|
| 255 |
-
'opt-out-message-usage-tracking' => _fs_text( "Usage tracking is done in the name of making %s better. Making a better user experience, prioritizing new features, and more good things. We'd really appreciate if you'll reconsider letting us continue with the tracking." ),
|
| 256 |
-
'opt-out-message-clicking-opt-out' => _fs_text( 'By clicking "Opt Out", we will no longer be sending any data from %s to %s.' ),
|
| 257 |
-
#endregion Connect
|
| 258 |
-
|
| 259 |
-
#region Screenshots
|
| 260 |
-
'screenshots' => _fs_text( 'Screenshots' ),
|
| 261 |
-
'view-full-size-x' => _fs_text( 'Click to view full-size screenshot %d' ),
|
| 262 |
-
#endregion Screenshots
|
| 263 |
-
|
| 264 |
-
#region Debug
|
| 265 |
-
'freemius-debug' => _fs_text( 'Freemius Debug' ),
|
| 266 |
-
'on' => _fs_x( 'On', 'as turned on' ),
|
| 267 |
-
'off' => _fs_x( 'Off', 'as turned off' ),
|
| 268 |
-
'debugging' => _fs_x( 'Debugging', 'as code debugging' ),
|
| 269 |
-
'freemius-state' => _fs_text( 'Freemius State' ),
|
| 270 |
-
'connected' => _fs_x( 'Connected', 'as connection was successful' ),
|
| 271 |
-
'blocked' => _fs_x( 'Blocked', 'as connection blocked' ),
|
| 272 |
-
'api' => _fs_x( 'API', 'as application program interface' ),
|
| 273 |
-
'sdk' => _fs_x( 'SDK', 'as software development kit versions' ),
|
| 274 |
-
'sdk-versions' => _fs_x( 'SDK Versions', 'as software development kit versions' ),
|
| 275 |
-
'plugin-path' => _fs_x( 'Plugin Path', 'as plugin folder path' ),
|
| 276 |
-
'sdk-path' => _fs_x( 'SDK Path', 'as sdk path' ),
|
| 277 |
-
'addons-of-x' => _fs_text( 'Add Ons of Plugin %s' ),
|
| 278 |
-
'delete-all-confirm' => _fs_text( 'Are you sure you want to delete all Freemius data?' ),
|
| 279 |
-
'actions' => _fs_text( 'Actions' ),
|
| 280 |
-
'delete-all-accounts' => _fs_text( 'Delete All Accounts' ),
|
| 281 |
-
'start-fresh' => _fs_text( 'Start Fresh' ),
|
| 282 |
-
'clear-api-cache' => _fs_text( 'Clear API Cache' ),
|
| 283 |
-
'sync-data-from-server' => _fs_text( 'Sync Data From Server' ),
|
| 284 |
-
'scheduled-crons' => _fs_text( 'Scheduled Crons' ),
|
| 285 |
-
'cron-type' => _fs_text( 'Cron Type' ),
|
| 286 |
-
'plugins-themes-sync' => _fs_text( 'Plugins & Themes Sync' ),
|
| 287 |
-
'licenses' => _fs_text( 'Licenses' ),
|
| 288 |
-
'debug-log' => _fs_text( 'Debug Log' ),
|
| 289 |
-
'all' => _fs_text( 'All' ),
|
| 290 |
-
'file' => _fs_text( 'File' ),
|
| 291 |
-
'function' => _fs_text( 'Function' ),
|
| 292 |
-
'process-id' => _fs_text( 'Process ID' ),
|
| 293 |
-
'logger' => _fs_text( 'Logger' ),
|
| 294 |
-
'message' => _fs_text( 'Message' ),
|
| 295 |
-
'download' => _fs_text( 'Download' ),
|
| 296 |
-
'filter' => _fs_text( 'Filter' ),
|
| 297 |
-
'type' => _fs_text( 'Type' ),
|
| 298 |
-
'all-types' => _fs_text( 'All Types' ),
|
| 299 |
-
'all-requests' => _fs_text( 'All Requests' ),
|
| 300 |
-
#endregion Debug
|
| 301 |
-
|
| 302 |
-
#region Expressions
|
| 303 |
-
'congrats' => _fs_x( 'Congrats', 'as congratulations' ),
|
| 304 |
-
'oops' => _fs_x( 'Oops', 'exclamation' ),
|
| 305 |
-
'yee-haw' => _fs_x( 'Yee-haw', 'interjection expressing joy or exuberance' ),
|
| 306 |
-
'woot' => _fs_x( 'W00t',
|
| 307 |
-
'(especially in electronic communication) used to express elation, enthusiasm, or triumph.' ),
|
| 308 |
-
'right-on' => _fs_x( 'Right on', 'a positive response' ),
|
| 309 |
-
'hmm' => _fs_x( 'Hmm',
|
| 310 |
-
'something somebody says when they are thinking about what you have just said. ' ),
|
| 311 |
-
'ok' => _fs_text( 'O.K' ),
|
| 312 |
-
'hey' => _fs_x( 'Hey', 'exclamation' ),
|
| 313 |
-
'heads-up' => _fs_x( 'Heads up',
|
| 314 |
-
'advance notice of something that will need attention.' ),
|
| 315 |
-
#endregion Expressions
|
| 316 |
-
|
| 317 |
-
#region Admin Notices
|
| 318 |
-
'you-have-latest' => _fs_text( 'Seems like you got the latest release.' ),
|
| 319 |
-
'you-are-good' => _fs_text( 'You are all good!' ),
|
| 320 |
-
'user-exist-message' => _fs_text( 'Sorry, we could not complete the email update. Another user with the same email is already registered.' ),
|
| 321 |
-
'user-exist-message_ownership' => _fs_text( 'If you would like to give up the ownership of the plugin\'s account to %s click the Change Ownership button.' ),
|
| 322 |
-
'email-updated-message' => _fs_text( 'Your email was successfully updated. You should receive an email with confirmation instructions in few moments.' ),
|
| 323 |
-
'name-updated-message' => _fs_text( 'Your name was successfully updated.' ),
|
| 324 |
-
'x-updated' => _fs_text( 'You have successfully updated your %s.' ),
|
| 325 |
-
'name-update-failed-message' => _fs_text( 'Please provide your full name.' ),
|
| 326 |
-
'verification-email-sent-message' => _fs_text( 'Verification mail was just sent to %s. If you can\'t find it after 5 min, please check your spam box.' ),
|
| 327 |
-
'addons-info-external-message' => _fs_text( 'Just letting you know that the add-ons information of %s is being pulled from an external server.' ),
|
| 328 |
-
'no-cc-required' => _fs_text( 'No credit card required' ),
|
| 329 |
-
'premium-activated-message' => _fs_text( 'Premium plugin version was successfully activated.' ),
|
| 330 |
-
'successful-version-upgrade-message' => _fs_text( 'The upgrade of %s was successfully completed.' ),
|
| 331 |
-
'activation-with-plan-x-message' => _fs_text( 'Your account was successfully activated with the %s plan.' ),
|
| 332 |
-
'download-latest-x-version-now' => _fs_text( 'Download the latest %s version now' ),
|
| 333 |
-
'follow-steps-to-complete-upgrade' => _fs_text( 'Please follow these steps to complete the upgrade' ),
|
| 334 |
-
'download-latest-x-version' => _fs_text( 'Download the latest %s version' ),
|
| 335 |
-
'download-latest-version' => _fs_text( 'Download the latest version' ),
|
| 336 |
-
'deactivate-free-version' => _fs_text( 'Deactivate the free version' ),
|
| 337 |
-
'upload-and-activate' => _fs_text( 'Upload and activate the downloaded version' ),
|
| 338 |
-
'howto-upload-activate' => _fs_text( 'How to upload and activate?' ),
|
| 339 |
-
'addon-successfully-purchased-message' => _fs_x( '%s Add-on was successfully purchased.',
|
| 340 |
-
'%s - product name, e.g. Facebook add-on was successfully...' ),
|
| 341 |
-
'addon-successfully-upgraded-message' => _fs_text( 'Your %s Add-on plan was successfully upgraded.' ),
|
| 342 |
-
'email-verified-message' => _fs_text( 'Your email has been successfully verified - you are AWESOME!' ),
|
| 343 |
-
'plan-upgraded-message' => _fs_text( 'Your plan was successfully upgraded.' ),
|
| 344 |
-
'plan-changed-to-x-message' => _fs_text( 'Your plan was successfully changed to %s.' ),
|
| 345 |
-
'license-expired-blocking-message' => _fs_text( 'Your license has expired. You can still continue using the free plugin forever.' ),
|
| 346 |
-
'license-cancelled' => _fs_text( 'Your license has been cancelled. If you think it\'s a mistake, please contact support.' ),
|
| 347 |
-
'trial-started-message' => _fs_text( 'Your trial has been successfully started.' ),
|
| 348 |
-
'license-activated-message' => _fs_text( 'Your license was successfully activated.' ),
|
| 349 |
-
'no-active-license-message' => _fs_text( 'It looks like your site currently doesn\'t have an active license.' ),
|
| 350 |
-
'license-deactivation-message' => _fs_text( 'Your license was successfully deactivated, you are back to the %s plan.' ),
|
| 351 |
-
'license-deactivation-failed-message' => _fs_text( 'It looks like the license deactivation failed.' ),
|
| 352 |
-
'license-activation-failed-message' => _fs_text( 'It looks like the license could not be activated.' ),
|
| 353 |
-
'server-error-message' => _fs_text( 'Error received from the server:' ),
|
| 354 |
-
'trial-expired-message' => _fs_text( 'Your trial has expired. You can still continue using all our free features.' ),
|
| 355 |
-
'plan-x-downgraded-message' => _fs_text( 'Your plan was successfully downgraded. Your %s plan license will expire in %s.' ),
|
| 356 |
-
'plan-downgraded-failure-message' => _fs_text( 'Seems like we are having some temporary issue with your plan downgrade. Please try again in few minutes.' ),
|
| 357 |
-
'trial-cancel-no-trial-message' => _fs_text( 'It looks like you are not in trial mode anymore so there\'s nothing to cancel :)' ),
|
| 358 |
-
'trial-cancel-message' => _fs_text( 'Your %s free trial was successfully cancelled.' ),
|
| 359 |
-
'version-x-released' => _fs_x( 'Version %s was released.', '%s - numeric version number' ),
|
| 360 |
-
'please-download-x' => _fs_text( 'Please download %s.' ),
|
| 361 |
-
'latest-x-version' => _fs_x( 'the latest %s version here',
|
| 362 |
-
'%s - plan name, as the latest professional version here' ),
|
| 363 |
-
'trial-x-promotion-message' => _fs_text( 'How do you like %s so far? Test all our %s premium features with a %d-day free trial.' ),
|
| 364 |
-
'start-free-trial' => _fs_x( 'Start free trial', 'call to action' ),
|
| 365 |
-
'starting-trial' => _fs_text( 'Starting trial' ),
|
| 366 |
-
'please-wait' => _fs_text( 'Please wait' ),
|
| 367 |
-
'trial-cancel-failure-message' => _fs_text( 'Seems like we are having some temporary issue with your trial cancellation. Please try again in few minutes.' ),
|
| 368 |
-
'trial-utilized' => _fs_text( 'You already utilized a trial before.' ),
|
| 369 |
-
'in-trial-mode' => _fs_text( 'You are already running the plugin in a trial mode.' ),
|
| 370 |
-
'trial-plan-x-not-exist' => _fs_text( 'Plan %s do not exist, therefore, can\'t start a trial.' ),
|
| 371 |
-
'plan-x-no-trial' => _fs_text( 'Plan %s does not support a trial period.' ),
|
| 372 |
-
'no-trials' => _fs_text( 'None of the plugin\'s plans supports a trial period.' ),
|
| 373 |
-
'unexpected-api-error' => _fs_text( 'Unexpected API error. Please contact the plugin\'s author with the following error.' ),
|
| 374 |
-
'no-commitment-for-x-days' => _fs_text( 'No commitment for %s days - cancel anytime!' ),
|
| 375 |
-
'license-expired-non-blocking-message' => _fs_text( 'Your license has expired. You can still continue using all the %s features, but you\'ll need to renew your license to continue getting updates and support.' ),
|
| 376 |
-
'could-not-activate-x' => _fs_text( 'Couldn\'t activate %s.' ),
|
| 377 |
-
'contact-us-with-error-message' => _fs_text( 'Please contact us with the following message:' ),
|
| 378 |
-
'plan-did-not-change-message' => _fs_text( 'It looks like you are still on the %s plan. If you did upgrade or change your plan, it\'s probably an issue on our side - sorry.' ),
|
| 379 |
-
'contact-us-here' => _fs_text( 'Please contact us here' ),
|
| 380 |
-
'plan-did-not-change-email-message' => _fs_text( 'I have upgraded my account but when I try to Sync the License, the plan remains %s.' ),
|
| 381 |
-
#endregion Admin Notices
|
| 382 |
-
#region Connectivity Issues
|
| 383 |
-
'connectivity-test-fails-message' => _fs_text( 'From unknown reason, the API connectivity test failed.' ),
|
| 384 |
-
'connectivity-test-maybe-temporary' => _fs_text( 'It\'s probably a temporary issue on our end. Just to be sure, with your permission, would it be o.k to run another connectivity test?' ),
|
| 385 |
-
'curl-missing-message' => _fs_text( 'We use PHP cURL library for the API calls, which is a very common library and usually installed out of the box. Unfortunately, cURL is not installed on your server.' ),
|
| 386 |
-
'cloudflare-blocks-connection-message' => _fs_text( 'From unknown reason, CloudFlare, the firewall we use, blocks the connection.' ),
|
| 387 |
-
'x-requires-access-to-api' => _fs_x( '%s requires an access to our API.',
|
| 388 |
-
'as pluginX requires an access to our API' ),
|
| 389 |
-
'squid-blocks-connection-message' => _fs_text( 'It looks like your server is using Squid ACL (access control lists), which blocks the connection.' ),
|
| 390 |
-
'squid-no-clue-title' => _fs_text( 'I don\'t know what is Squid or ACL, help me!' ),
|
| 391 |
-
'squid-no-clue-desc' => _fs_text( 'We\'ll make sure to contact your hosting company and resolve the issue. You will get a follow-up email to %s once we have an update.' ),
|
| 392 |
-
'sysadmin-title' => _fs_text( 'I\'m a system administrator' ),
|
| 393 |
-
'squid-sysadmin-desc' => _fs_text( 'Great, please whitelist the following domains: %s. Once you are done, deactivate the plugin and activate it again.' ),
|
| 394 |
-
'curl-missing-no-clue-title' => _fs_text( 'I don\'t know what is cURL or how to install it, help me!' ),
|
| 395 |
-
'curl-missing-no-clue-desc' => _fs_text( 'We\'ll make sure to contact your hosting company and resolve the issue. You will get a follow-up email to %s once we have an update.' ),
|
| 396 |
-
'curl-missing-sysadmin-desc' => _fs_text( 'Great, please install cURL and enable it in your php.ini file. To make sure it was successfully activated, use \'phpinfo()\'. Once activated, deactivate the plugin and reactivate it back again.' ),
|
| 397 |
-
'happy-to-resolve-issue-asap' => _fs_text( 'We are sure it\'s an issue on our side and more than happy to resolve it for you ASAP if you give us a chance.' ),
|
| 398 |
-
'contact-support-before-deactivation' => _fs_text( 'Sorry for the inconvenience and we are here to help if you give us a chance.' ),
|
| 399 |
-
'fix-issue-title' => _fs_text( 'Yes - I\'m giving you a chance to fix it' ),
|
| 400 |
-
'fix-issue-desc' => _fs_text( 'We will do our best to whitelist your server and resolve this issue ASAP. You will get a follow-up email to %s once we have an update.' ),
|
| 401 |
-
'install-previous-title' => _fs_text( 'Let\'s try your previous version' ),
|
| 402 |
-
'install-previous-desc' => _fs_text( 'Uninstall this version and install the previous one.' ),
|
| 403 |
-
'deactivate-plugin-title' => _fs_text( 'That\'s exhausting, please deactivate' ),
|
| 404 |
-
'deactivate-plugin-desc' => _fs_text( 'We feel your frustration and sincerely apologize for the inconvenience. Hope to see you again in the future.' ),
|
| 405 |
-
'fix-request-sent-message' => _fs_text( 'Thank for giving us the chance to fix it! A message was just sent to our technical staff. We will get back to you as soon as we have an update to %s. Appreciate your patience.' ),
|
| 406 |
-
'server-blocking-access' => _fs_x( 'Your server is blocking the access to Freemius\' API, which is crucial for %1s synchronization. Please contact your host to whitelist %2s',
|
| 407 |
-
'%1s - plugin title, %2s - API domain' ),
|
| 408 |
-
'wrong-authentication-param-message' => _fs_text( 'It seems like one of the authentication parameters is wrong. Update your Public Key, Secret Key & User ID, and try again.' ),
|
| 409 |
-
#endregion Connectivity Issues
|
| 410 |
-
#region Change Owner
|
| 411 |
-
'change-owner-request-sent-x' => _fs_text( 'Please check your mailbox, you should receive an email via %s to confirm the ownership change. From security reasons, you must confirm the change within the next 15 min. If you cannot find the email, please check your spam folder.' ),
|
| 412 |
-
'change-owner-request_owner-confirmed' => _fs_text( 'Thanks for confirming the ownership change. An email was just sent to %s for final approval.' ),
|
| 413 |
-
'change-owner-request_candidate-confirmed' => _fs_text( '%s is the new owner of the account.' ),
|
| 414 |
-
#endregion Change Owner
|
| 415 |
-
'addon-x-cannot-run-without-y' => _fs_x( '%s cannot run without %s.',
|
| 416 |
-
'addonX cannot run without pluginY' ),
|
| 417 |
-
'addon-x-cannot-run-without-parent' => _fs_x( '%s cannot run without the plugin.', 'addonX cannot run...' ),
|
| 418 |
-
'plugin-x-activation-message' => _fs_x( '%s activation was successfully completed.',
|
| 419 |
-
'pluginX activation was successfully...' ),
|
| 420 |
-
'features-and-pricing' => _fs_x( 'Features & Pricing', 'Plugin installer section title' ),
|
| 421 |
-
'free-addon-not-deployed' => _fs_text( 'Add-on must be deployed to WordPress.org or Freemius.' ),
|
| 422 |
-
'paid-addon-not-deployed' => _fs_text( 'Paid add-on must be deployed to Freemius.' ),
|
| 423 |
-
#--------------------------------------------------------------------------------
|
| 424 |
-
#region Add-On Licensing
|
| 425 |
-
#--------------------------------------------------------------------------------
|
| 426 |
-
'addon-no-license-message' => _fs_text( '%s is a premium only add-on. You have to purchase a license first before activating the plugin.' ),
|
| 427 |
-
'addon-trial-cancelled-message' => _fs_text( '%s free trial was successfully cancelled. Since the add-on is premium only it was automatically deactivated. If you like to use it in the future, you\'ll have to purchase a license.' ),
|
| 428 |
-
#endregion
|
| 429 |
-
#--------------------------------------------------------------------------------
|
| 430 |
-
#region Billing Cycles
|
| 431 |
-
#--------------------------------------------------------------------------------
|
| 432 |
-
'monthly' => _fs_x( 'Monthly', 'as every month' ),
|
| 433 |
-
'mo' => _fs_x( 'mo', 'as monthly period' ),
|
| 434 |
-
'annual' => _fs_x( 'Annual', 'as once a year' ),
|
| 435 |
-
'annually' => _fs_x( 'Annually', 'as once a year' ),
|
| 436 |
-
'once' => _fs_x( 'Once', 'as once a year' ),
|
| 437 |
-
'year' => _fs_x( 'year', 'as annual period' ),
|
| 438 |
-
'lifetime' => _fs_text( 'Lifetime' ),
|
| 439 |
-
'best' => _fs_x( 'Best', 'e.g. the best product' ),
|
| 440 |
-
'billed-x' => _fs_x( 'Billed %s', 'e.g. billed monthly' ),
|
| 441 |
-
'save-x' => _fs_x( 'Save %s', 'as a discount of $5 or 10%' ),
|
| 442 |
-
#endregion Billing Cycles
|
| 443 |
-
'view-details' => _fs_text( 'View details' ),
|
| 444 |
-
#--------------------------------------------------------------------------------
|
| 445 |
-
#region Trial
|
| 446 |
-
#--------------------------------------------------------------------------------
|
| 447 |
-
'approve-start-trial' => _fs_x( 'Approve & Start Trial', 'button label' ),
|
| 448 |
-
/* translators: %1$s: Number of trial days; %2$s: Plan name; */
|
| 449 |
-
'start-trial-prompt-header' => _fs_text( 'You are 1-click away from starting your %1$s-day free trial of the %2$s plan.' ),
|
| 450 |
-
/* translators: %s: Link to freemius.com */
|
| 451 |
-
'start-trial-prompt-message' => _fs_text( 'For compliance with the WordPress.org guidelines, before we start the trial we ask that you opt-in with your user and non-sensitive site information, allowing the plugin to periodically send data to %s to check for version updates and to validate your trial.' ),
|
| 452 |
-
|
| 453 |
-
#endregion
|
| 454 |
-
#--------------------------------------------------------------------------------
|
| 455 |
-
#region Billing Details
|
| 456 |
-
#--------------------------------------------------------------------------------
|
| 457 |
-
'business-name' => _fs_text( 'Business name' ),
|
| 458 |
-
'tax-vat-id' => _fs_text( 'Tax / VAT ID' ),
|
| 459 |
-
'address-line-n' => _fs_text( 'Address Line %d' ),
|
| 460 |
-
'country' => _fs_text( 'Country' ),
|
| 461 |
-
'select-country' => _fs_text( 'Select Country' ),
|
| 462 |
-
'city' => _fs_text( 'City' ),
|
| 463 |
-
'town' => _fs_text( 'Town' ),
|
| 464 |
-
'state' => _fs_text( 'State' ),
|
| 465 |
-
'province' => _fs_text( 'Province' ),
|
| 466 |
-
'zip-postal-code' => _fs_text( 'ZIP / Postal Code' ),
|
| 467 |
-
#endregion
|
| 468 |
-
);
|
| 469 |
-
|
| 470 |
-
/**
|
| 471 |
-
* Localization of the strings in the plugin/theme info dialog box.
|
| 472 |
-
*
|
| 473 |
-
* $fs_module_info_text should ONLY include strings that are not located in $fs_text.
|
| 474 |
-
*
|
| 475 |
-
* @author Vova Feldman (@svovaf)
|
| 476 |
-
* @since 1.2.2
|
| 477 |
-
*/
|
| 478 |
-
global $fs_module_info_text;
|
| 479 |
-
|
| 480 |
-
$fs_module_info_text = array(
|
| 481 |
-
'description' => _fs_x( 'Description', 'Plugin installer section title' ),
|
| 482 |
-
'installation' => _fs_x( 'Installation', 'Plugin installer section title' ),
|
| 483 |
-
'faq' => _fs_x( 'FAQ', 'Plugin installer section title' ),
|
| 484 |
-
'changelog' => _fs_x( 'Changelog', 'Plugin installer section title' ),
|
| 485 |
-
'reviews' => _fs_x( 'Reviews', 'Plugin installer section title' ),
|
| 486 |
-
'other_notes' => _fs_x( 'Other Notes', 'Plugin installer section title' ),
|
| 487 |
-
/* translators: %s: 1 or One */
|
| 488 |
-
'x-star' => _fs_text( '%s star' ),
|
| 489 |
-
/* translators: %s: Number larger than 1 */
|
| 490 |
-
'x-stars' => _fs_text( '%s stars' ),
|
| 491 |
-
/* translators: %s: 1 or One */
|
| 492 |
-
'x-rating' => _fs_text( '%s rating' ),
|
| 493 |
-
/* translators: %s: Number larger than 1 */
|
| 494 |
-
'x-ratings' => _fs_text( '%s ratings' ),
|
| 495 |
-
/* translators: %s: 1 or One (Number of times downloaded) */
|
| 496 |
-
'x-time' => _fs_text( '%s time' ),
|
| 497 |
-
/* translators: %s: Number of times downloaded */
|
| 498 |
-
'x-times' => _fs_text( '%s times' ),
|
| 499 |
-
/* translators: %s: # of stars (e.g. 5 stars) */
|
| 500 |
-
'click-to-reviews' => _fs_text( 'Click to see reviews that provided a rating of %s' ),
|
| 501 |
-
'last-updated:' => _fs_text( 'Last Updated' ),
|
| 502 |
-
'requires-wordpress-version:' => _fs_text( 'Requires WordPress Version:' ),
|
| 503 |
-
'author:' => _fs_x( 'Author:', 'as the plugin author' ),
|
| 504 |
-
'compatible-up-to:' => _fs_text( 'Compatible up to:' ),
|
| 505 |
-
'downloaded:' => _fs_text( 'Downloaded:' ),
|
| 506 |
-
'wp-org-plugin-page' => _fs_text( 'WordPress.org Plugin Page' ),
|
| 507 |
-
'plugin-homepage' => _fs_text( 'Plugin Homepage' ),
|
| 508 |
-
'donate-to-plugin' => _fs_text( 'Donate to this plugin' ),
|
| 509 |
-
'average-rating' => _fs_text( 'Average Rating' ),
|
| 510 |
-
'based-on-x' => _fs_text( 'based on %s' ),
|
| 511 |
-
'warning:' => _fs_text( 'Warning:' ),
|
| 512 |
-
'contributors' => _fs_text( 'Contributors' ),
|
| 513 |
-
'plugin-install' => _fs_text( 'Plugin Install' ),
|
| 514 |
-
'not-tested-warning' => _fs_text( 'This plugin has not been tested with your current version of WordPress.' ),
|
| 515 |
-
'not-compatible-warning' => _fs_text( 'This plugin has not been marked as compatible with your version of WordPress.' ),
|
| 516 |
-
'newer-installed' => _fs_text( 'Newer Version (%s) Installed' ),
|
| 517 |
-
'latest-installed' => _fs_text( 'Latest Version Installed' ),
|
| 518 |
);
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* @package Freemius
|
| 4 |
+
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
+
* @since 1.1.4
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
+
exit;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
require_once dirname( __FILE__ ) . '/l10n.php';
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* All strings can now be overridden.
|
| 17 |
+
*
|
| 18 |
+
* For example, if we want to override:
|
| 19 |
+
* 'you-are-step-away' => 'You are just one step away - %s',
|
| 20 |
+
*
|
| 21 |
+
* We can use the filter:
|
| 22 |
+
* fs_override_i18n( array(
|
| 23 |
+
* 'opt-in-connect' => __( "Yes - I'm in!", '{your-text_domain}' ),
|
| 24 |
+
* 'skip' => __( 'Not today', '{your-text_domain}' ),
|
| 25 |
+
* ), '{plugin_slug}' );
|
| 26 |
+
*
|
| 27 |
+
* Or with the Freemius instance:
|
| 28 |
+
*
|
| 29 |
+
* my_freemius->override_i18n( array(
|
| 30 |
+
* 'opt-in-connect' => __( "Yes - I'm in!", '{your-text_domain}' ),
|
| 31 |
+
* 'skip' => __( 'Not today', '{your-text_domain}' ),
|
| 32 |
+
* );
|
| 33 |
+
*/
|
| 34 |
+
global $fs_text;
|
| 35 |
+
|
| 36 |
+
$fs_text = array(
|
| 37 |
+
'account' => _fs_text( 'Account' ),
|
| 38 |
+
'addon' => _fs_text( 'Add On' ),
|
| 39 |
+
'contact-us' => _fs_text( 'Contact Us' ),
|
| 40 |
+
'contact-support' => _fs_text( 'Contact Support' ),
|
| 41 |
+
'change-ownership' => _fs_text( 'Change Ownership' ),
|
| 42 |
+
'support' => _fs_text( 'Support' ),
|
| 43 |
+
'support-forum' => _fs_text( 'Support Forum' ),
|
| 44 |
+
'add-ons' => _fs_text( 'Add Ons' ),
|
| 45 |
+
'upgrade' => _fs_x( 'Upgrade', 'verb' ),
|
| 46 |
+
'awesome' => _fs_text( 'Awesome' ),
|
| 47 |
+
'pricing' => _fs_x( 'Pricing', 'noun' ),
|
| 48 |
+
'price' => _fs_x( 'Price', 'noun' ),
|
| 49 |
+
'unlimited-updates' => _fs_text( 'Unlimited Updates' ),
|
| 50 |
+
'downgrade' => _fs_x( 'Downgrade', 'verb' ),
|
| 51 |
+
'cancel-trial' => _fs_text( 'Cancel Trial' ),
|
| 52 |
+
'free-trial' => _fs_text( 'Free Trial' ),
|
| 53 |
+
'start-free-x' => _fs_text( 'Start my free %s' ),
|
| 54 |
+
'no-commitment-x' => _fs_text( 'No commitment for %s - cancel anytime' ),
|
| 55 |
+
'after-x-pay-as-little-y' => _fs_text( 'After your free %s, pay as little as %s' ),
|
| 56 |
+
'details' => _fs_text( 'Details' ),
|
| 57 |
+
'account-details' => _fs_text( 'Account Details' ),
|
| 58 |
+
'delete' => _fs_x( 'Delete', 'verb' ),
|
| 59 |
+
'show' => _fs_x( 'Show', 'verb' ),
|
| 60 |
+
'hide' => _fs_x( 'Hide', 'verb' ),
|
| 61 |
+
'edit' => _fs_x( 'Edit', 'verb' ),
|
| 62 |
+
'update' => _fs_x( 'Update', 'verb' ),
|
| 63 |
+
'date' => _fs_text( 'Date' ),
|
| 64 |
+
'amount' => _fs_text( 'Amount' ),
|
| 65 |
+
'invoice' => _fs_text( 'Invoice' ),
|
| 66 |
+
'billing' => _fs_text( 'Billing' ),
|
| 67 |
+
'payments' => _fs_text( 'Payments' ),
|
| 68 |
+
'delete-account' => _fs_text( 'Delete Account' ),
|
| 69 |
+
'dismiss' => _fs_x( 'Dismiss', 'as close a window' ),
|
| 70 |
+
'plan' => _fs_x( 'Plan', 'as product pricing plan' ),
|
| 71 |
+
'change-plan' => _fs_text( 'Change Plan' ),
|
| 72 |
+
'download-x-version' => _fs_x( 'Download %s Version', 'as download professional version' ),
|
| 73 |
+
'download-x-version-now' => _fs_x( 'Download %s version now', 'as download professional version now' ),
|
| 74 |
+
'download-latest' => _fs_x( 'Download Latest', 'as download latest version' ),
|
| 75 |
+
'you-have-x-license' => _fs_x( 'You have a %s license.', 'E.g. you have a professional license.' ),
|
| 76 |
+
'new' => _fs_text( 'New' ),
|
| 77 |
+
'free' => _fs_text( 'Free' ),
|
| 78 |
+
'trial' => _fs_x( 'Trial', 'as trial plan' ),
|
| 79 |
+
'start-trial' => _fs_x( 'Start Trial', 'as starting a trial plan' ),
|
| 80 |
+
'purchase' => _fs_x( 'Purchase', 'verb' ),
|
| 81 |
+
'purchase-license' => _fs_text( 'Purchase License' ),
|
| 82 |
+
'buy' => _fs_x( 'Buy', 'verb' ),
|
| 83 |
+
'buy-license' => _fs_text( 'Buy License' ),
|
| 84 |
+
'license-single-site' => _fs_text( 'Single Site License' ),
|
| 85 |
+
'license-unlimited' => _fs_text( 'Unlimited Licenses' ),
|
| 86 |
+
'license-x-sites' => _fs_text( 'Up to %s Sites' ),
|
| 87 |
+
'renew-license-now' => _fs_text( '%sRenew your license now%s to access version %s features and support.' ),
|
| 88 |
+
'ask-for-upgrade-email-address' => _fs_text( "Enter the email address you've used for the upgrade below and we will resend you the license key." ),
|
| 89 |
+
'x-plan' => _fs_x( '%s Plan', 'e.g. Professional Plan' ),
|
| 90 |
+
'you-are-step-away' => _fs_text( 'You are just one step away - %s' ),
|
| 91 |
+
'activate-x-now' => _fs_x( 'Complete "%s" Activation Now',
|
| 92 |
+
'%s - plugin name. As complete "Jetpack" activation now' ),
|
| 93 |
+
'few-plugin-tweaks' => _fs_text( 'We made a few tweaks to the plugin, %s' ),
|
| 94 |
+
'optin-x-now' => _fs_text( 'Opt-in to make "%s" Better!' ),
|
| 95 |
+
'error' => _fs_text( 'Error' ),
|
| 96 |
+
'failed-finding-main-path' => _fs_text( 'Freemius SDK couldn\'t find the plugin\'s main file. Please contact sdk@freemius.com with the current error.' ),
|
| 97 |
+
#region Account
|
| 98 |
+
|
| 99 |
+
'expiration' => _fs_x( 'Expiration', 'as expiration date' ),
|
| 100 |
+
'license' => _fs_x( 'License', 'as software license' ),
|
| 101 |
+
'not-verified' => _fs_text( 'not verified' ),
|
| 102 |
+
'verify-email' => _fs_text( 'Verify Email' ),
|
| 103 |
+
'expires-in' => _fs_x( 'Expires in %s', 'e.g. expires in 2 months' ),
|
| 104 |
+
'renews-in' => _fs_x( 'Auto renews in %s', 'e.g. auto renews in 2 months' ),
|
| 105 |
+
'no-expiration' => _fs_text( 'No expiration' ),
|
| 106 |
+
'expired' => _fs_text( 'Expired' ),
|
| 107 |
+
'cancelled' => _fs_text( 'Cancelled' ),
|
| 108 |
+
'in-x' => _fs_x( 'In %s', 'e.g. In 2 hours' ),
|
| 109 |
+
'x-ago' => _fs_x( '%s ago', 'e.g. 2 min ago' ),
|
| 110 |
+
/* translators: %s: Version number (e.g. 4.6 or higher) */
|
| 111 |
+
'x-or-higher' => _fs_text( '%s or higher' ),
|
| 112 |
+
'version' => _fs_x( 'Version', 'as plugin version' ),
|
| 113 |
+
'name' => _fs_text( 'Name' ),
|
| 114 |
+
'email' => _fs_text( 'Email' ),
|
| 115 |
+
'email-address' => _fs_text( 'Email address' ),
|
| 116 |
+
'verified' => _fs_text( 'Verified' ),
|
| 117 |
+
'module' => _fs_text( 'Module' ),
|
| 118 |
+
'module-type' => _fs_text( 'Module Type' ),
|
| 119 |
+
'plugin' => _fs_text( 'Plugin' ),
|
| 120 |
+
'plugins' => _fs_text( 'Plugins' ),
|
| 121 |
+
'theme' => _fs_text( 'Theme' ),
|
| 122 |
+
'themes' => _fs_text( 'Themes' ),
|
| 123 |
+
'path' => _fs_x( 'Path', 'as file/folder path' ),
|
| 124 |
+
'title' => _fs_text( 'Title' ),
|
| 125 |
+
'free-version' => _fs_text( 'Free version' ),
|
| 126 |
+
'premium-version' => _fs_text( 'Premium version' ),
|
| 127 |
+
'slug' => _fs_x( 'Slug', 'as WP plugin slug' ),
|
| 128 |
+
'id' => _fs_text( 'ID' ),
|
| 129 |
+
'users' => _fs_text( 'Users' ),
|
| 130 |
+
'plugin-installs' => _fs_text( 'Plugin Installs' ),
|
| 131 |
+
'module-installs' => _fs_text( '%s Installs' ),
|
| 132 |
+
'sites' => _fs_x( 'Sites', 'like websites' ),
|
| 133 |
+
'user-id' => _fs_text( 'User ID' ),
|
| 134 |
+
'site-id' => _fs_text( 'Site ID' ),
|
| 135 |
+
'public-key' => _fs_text( 'Public Key' ),
|
| 136 |
+
'secret-key' => _fs_text( 'Secret Key' ),
|
| 137 |
+
'no-secret' => _fs_x( 'No Secret', 'as secret encryption key missing' ),
|
| 138 |
+
'no-id' => _fs_text( 'No ID' ),
|
| 139 |
+
'sync-license' => _fs_x( 'Sync License', 'as synchronize license' ),
|
| 140 |
+
'sync' => _fs_x( 'Sync', 'as synchronize' ),
|
| 141 |
+
'activate-license' => _fs_text( 'Activate License' ),
|
| 142 |
+
'activate-free-version' => _fs_text( 'Activate Free Version' ),
|
| 143 |
+
'activate-license-message' => _fs_text( 'Please enter the license key that you received in the email right after the purchase:' ),
|
| 144 |
+
'activating-license' => _fs_text( 'Activating license...' ),
|
| 145 |
+
'change-license' => _fs_text( 'Change License' ),
|
| 146 |
+
'update-license' => _fs_text( 'Update License' ),
|
| 147 |
+
'deactivate-license' => _fs_text( 'Deactivate License' ),
|
| 148 |
+
'activate' => _fs_text( 'Activate' ),
|
| 149 |
+
'deactivate' => _fs_text( 'Deactivate' ),
|
| 150 |
+
'skip-deactivate' => _fs_text( 'Skip & Deactivate' ),
|
| 151 |
+
'skip-and-x' => _fs_text( 'Skip & %s' ),
|
| 152 |
+
'no-deactivate' => _fs_text( 'No - just deactivate' ),
|
| 153 |
+
'yes-do-your-thing' => _fs_text( 'Yes - do your thing' ),
|
| 154 |
+
'active' => _fs_x( 'Active', 'active mode' ),
|
| 155 |
+
'is-active' => _fs_x( 'Is Active', 'is active mode?' ),
|
| 156 |
+
'install-now' => _fs_text( 'Install Now' ),
|
| 157 |
+
'install-update-now' => _fs_text( 'Install Update Now' ),
|
| 158 |
+
'more-information-about-x' => _fs_text( 'More information about %s' ),
|
| 159 |
+
'localhost' => _fs_text( 'Localhost' ),
|
| 160 |
+
'activate-x-plan' => _fs_x( 'Activate %s Plan', 'as activate Professional plan' ),
|
| 161 |
+
'x-left' => _fs_x( '%s left', 'as 5 licenses left' ),
|
| 162 |
+
'last-license' => _fs_text( 'Last license' ),
|
| 163 |
+
'what-is-your-x' => _fs_text( 'What is your %s?' ),
|
| 164 |
+
'activate-this-addon' => _fs_text( 'Activate this add-on' ),
|
| 165 |
+
'deactivate-license-confirm' => _fs_text( 'Deactivating your license will block all premium features, but will enable you to activate the license on another site. Are you sure you want to proceed?' ),
|
| 166 |
+
'delete-account-x-confirm' => _fs_text( 'Deleting the account will automatically deactivate your %s plan license so you can use it on other sites. If you want to terminate the recurring payments as well, click the "Cancel" button, and first "Downgrade" your account. Are you sure you would like to continue with the deletion?' ),
|
| 167 |
+
'delete-account-confirm' => _fs_text( 'Deletion is not temporary. Only delete if you no longer want to use this plugin anymore. Are you sure you would like to continue with the deletion?' ),
|
| 168 |
+
'downgrade-x-confirm' => _fs_text( 'Downgrading your plan will immediately stop all future recurring payments and your %s plan license will expire in %s.' ),
|
| 169 |
+
'cancel-trial-confirm' => _fs_text( 'Cancelling the trial will immediately block access to all premium features. Are you sure?' ),
|
| 170 |
+
'after-downgrade-non-blocking' => _fs_text( 'You can still enjoy all %s features but you will not have access to plugin updates and support.' ),
|
| 171 |
+
'after-downgrade-blocking' => _fs_text( 'Once your license expires you can still use the Free version but you will NOT have access to the %s features.' ),
|
| 172 |
+
'proceed-confirmation' => _fs_text( 'Are you sure you want to proceed?' ),
|
| 173 |
+
#endregion Account
|
| 174 |
+
|
| 175 |
+
'add-ons-for-x' => _fs_text( 'Add Ons for %s' ),
|
| 176 |
+
'add-ons-missing' => _fs_text( 'We could\'nt load the add-ons list. It\'s probably an issue on our side, please try to come back in few minutes.' ),
|
| 177 |
+
#region Plugin Deactivation
|
| 178 |
+
'anonymous-feedback' => _fs_text( 'Anonymous feedback' ),
|
| 179 |
+
'quick-feedback' => _fs_text( 'Quick feedback' ),
|
| 180 |
+
'deactivation-share-reason' => _fs_text( 'If you have a moment, please let us know why you are deactivating' ),
|
| 181 |
+
'deactivation-modal-button-confirm' => _fs_text( 'Yes - Deactivate' ),
|
| 182 |
+
'deactivation-modal-button-submit' => _fs_text( 'Submit & Deactivate' ),
|
| 183 |
+
'cancel' => _fs_text( 'Cancel' ),
|
| 184 |
+
'reason-no-longer-needed' => _fs_text( 'I no longer need the plugin' ),
|
| 185 |
+
'reason-found-a-better-plugin' => _fs_text( 'I found a better plugin' ),
|
| 186 |
+
'reason-needed-for-a-short-period' => _fs_text( 'I only needed the plugin for a short period' ),
|
| 187 |
+
'reason-broke-my-site' => _fs_text( 'The plugin broke my site' ),
|
| 188 |
+
'reason-suddenly-stopped-working' => _fs_text( 'The plugin suddenly stopped working' ),
|
| 189 |
+
'reason-cant-pay-anymore' => _fs_text( "I can't pay for it anymore" ),
|
| 190 |
+
'reason-temporary-deactivation' => _fs_text( "It's a temporary deactivation. I'm just debugging an issue." ),
|
| 191 |
+
'reason-other' => _fs_x( 'Other',
|
| 192 |
+
'the text of the "other" reason for deactivating the plugin that is shown in the modal box.' ),
|
| 193 |
+
'ask-for-reason-message' => _fs_text( 'Kindly tell us the reason so we can improve.' ),
|
| 194 |
+
'placeholder-plugin-name' => _fs_text( "What's the plugin's name?" ),
|
| 195 |
+
'placeholder-comfortable-price' => _fs_text( 'What price would you feel comfortable paying?' ),
|
| 196 |
+
'reason-couldnt-make-it-work' => _fs_text( "I couldn't understand how to make it work" ),
|
| 197 |
+
'reason-great-but-need-specific-feature' => _fs_text( "The plugin is great, but I need specific feature that you don't support" ),
|
| 198 |
+
'reason-not-working' => _fs_text( 'The plugin is not working' ),
|
| 199 |
+
'reason-not-what-i-was-looking-for' => _fs_text( "It's not what I was looking for" ),
|
| 200 |
+
'reason-didnt-work-as-expected' => _fs_text( "The plugin didn't work as expected" ),
|
| 201 |
+
'placeholder-feature' => _fs_text( 'What feature?' ),
|
| 202 |
+
'placeholder-share-what-didnt-work' => _fs_text( "Kindly share what didn't work so we can fix it for future users..." ),
|
| 203 |
+
'placeholder-what-youve-been-looking-for' => _fs_text( "What you've been looking for?" ),
|
| 204 |
+
'placeholder-what-did-you-expect' => _fs_text( "What did you expect?" ),
|
| 205 |
+
'reason-didnt-work' => _fs_text( "The plugin didn't work" ),
|
| 206 |
+
'reason-dont-like-to-share-my-information' => _fs_text( "I don't like to share my information with you" ),
|
| 207 |
+
'dont-have-to-share-any-data' => _fs_text( "You might have missed it, but you don't have to share any data and can just %s the opt-in." ),
|
| 208 |
+
#endregion Plugin Deactivation
|
| 209 |
+
|
| 210 |
+
#region Connect
|
| 211 |
+
'hey-x' => _fs_x( 'Hey %s,', 'greeting' ),
|
| 212 |
+
'thanks-x' => _fs_x( 'Thanks %s!', 'a greeting. E.g. Thanks John!' ),
|
| 213 |
+
'connect-message' => _fs_text( 'Never miss an important update - opt-in to our security and feature updates notifications, and non-sensitive diagnostic tracking with %4$s.' ),
|
| 214 |
+
'connect-message_on-update' => _fs_text( 'Please help us improve %1$s! If you opt-in, some data about your usage of %1$s will be sent to %4$s. If you skip this, that\'s okay! %1$s will still work just fine.' ),
|
| 215 |
+
'pending-activation-message' => _fs_text( 'You should receive an activation email for %s to your mailbox at %s. Please make sure you click the activation button in that email to %s.' ),
|
| 216 |
+
'complete-the-install' => _fs_text( 'complete the install' ),
|
| 217 |
+
'start-the-trial' => _fs_text( 'start the trial' ),
|
| 218 |
+
'thanks-for-purchasing' => _fs_text( 'Thanks for purchasing %s! To get started, please enter your license key:' ),
|
| 219 |
+
'license-sync-disclaimer' => _fs_text( 'The plugin will be periodically sending data to %s to check for plugin updates and verify the validity of your license.' ),
|
| 220 |
+
'what-permissions' => _fs_text( 'What permissions are being granted?' ),
|
| 221 |
+
'permissions-profile' => _fs_text( 'Your Profile Overview' ),
|
| 222 |
+
'permissions-profile_desc' => _fs_text( 'Name and email address' ),
|
| 223 |
+
'permissions-site' => _fs_text( 'Your Site Overview' ),
|
| 224 |
+
'permissions-site_desc' => _fs_text( 'Site URL, WP version, PHP info, plugins & themes' ),
|
| 225 |
+
'permissions-events' => _fs_text( 'Current Plugin Events' ),
|
| 226 |
+
'permissions-events_desc' => _fs_text( 'Activation, deactivation and uninstall' ),
|
| 227 |
+
'permissions-plugins_themes' => _fs_text( 'Plugins & Themes' ),
|
| 228 |
+
'permissions-plugins_themes_desc' => _fs_text( 'Titles, versions and state.' ),
|
| 229 |
+
'permissions-admin-notices' => _fs_text( 'Admin Notices' ),
|
| 230 |
+
'permissions-newsletter' => _fs_text( 'Newsletter' ),
|
| 231 |
+
'permissions-newsletter_desc' => _fs_text( 'Updates, announcements, marketing, no spam' ),
|
| 232 |
+
'privacy-policy' => _fs_text( 'Privacy Policy' ),
|
| 233 |
+
'tos' => _fs_text( 'Terms of Service' ),
|
| 234 |
+
'activating' => _fs_x( 'Activating', 'as activating plugin' ),
|
| 235 |
+
'sending-email' => _fs_x( 'Sending email', 'as in the process of sending an email' ),
|
| 236 |
+
'opt-in-connect' => _fs_x( 'Allow & Continue', 'button label' ),
|
| 237 |
+
'agree-activate-license' => _fs_x( 'Agree & Activate License', 'button label' ),
|
| 238 |
+
'skip' => _fs_x( 'Skip', 'verb' ),
|
| 239 |
+
'click-here-to-use-plugin-anonymously' => _fs_text( 'Click here to use the plugin anonymously' ),
|
| 240 |
+
'resend-activation-email' => _fs_text( 'Re-send activation email' ),
|
| 241 |
+
'license-key' => _fs_text( 'License key' ),
|
| 242 |
+
'send-license-key' => _fs_text( 'Send License Key' ),
|
| 243 |
+
'sending-license-key' => _fs_text( 'Sending license key' ),
|
| 244 |
+
'have-license-key' => _fs_text( 'Have a license key?' ),
|
| 245 |
+
'dont-have-license-key' => _fs_text( 'Don\'t have a license key?' ),
|
| 246 |
+
'cant-find-license-key' => _fs_text( "Can't find your license key?" ),
|
| 247 |
+
'email-not-found' => _fs_text( "We couldn't find your email address in the system, are you sure it's the right address?" ),
|
| 248 |
+
'no-active-licenses' => _fs_text( "We can't see any active licenses associated with that email address, are you sure it's the right address?" ),
|
| 249 |
+
'opt-in' => _fs_text( 'Opt In' ),
|
| 250 |
+
'opt-out' => _fs_text( 'Opt Out' ),
|
| 251 |
+
'opt-out-cancel' => _fs_text( 'On second thought - I want to continue helping' ),
|
| 252 |
+
'opting-out' => _fs_text( 'Opting out...' ),
|
| 253 |
+
'opting-in' => _fs_text( 'Opting in...' ),
|
| 254 |
+
'opt-out-message-appreciation' => _fs_text( 'We appreciate your help in making the %s better by letting us track some usage data.' ),
|
| 255 |
+
'opt-out-message-usage-tracking' => _fs_text( "Usage tracking is done in the name of making %s better. Making a better user experience, prioritizing new features, and more good things. We'd really appreciate if you'll reconsider letting us continue with the tracking." ),
|
| 256 |
+
'opt-out-message-clicking-opt-out' => _fs_text( 'By clicking "Opt Out", we will no longer be sending any data from %s to %s.' ),
|
| 257 |
+
#endregion Connect
|
| 258 |
+
|
| 259 |
+
#region Screenshots
|
| 260 |
+
'screenshots' => _fs_text( 'Screenshots' ),
|
| 261 |
+
'view-full-size-x' => _fs_text( 'Click to view full-size screenshot %d' ),
|
| 262 |
+
#endregion Screenshots
|
| 263 |
+
|
| 264 |
+
#region Debug
|
| 265 |
+
'freemius-debug' => _fs_text( 'Freemius Debug' ),
|
| 266 |
+
'on' => _fs_x( 'On', 'as turned on' ),
|
| 267 |
+
'off' => _fs_x( 'Off', 'as turned off' ),
|
| 268 |
+
'debugging' => _fs_x( 'Debugging', 'as code debugging' ),
|
| 269 |
+
'freemius-state' => _fs_text( 'Freemius State' ),
|
| 270 |
+
'connected' => _fs_x( 'Connected', 'as connection was successful' ),
|
| 271 |
+
'blocked' => _fs_x( 'Blocked', 'as connection blocked' ),
|
| 272 |
+
'api' => _fs_x( 'API', 'as application program interface' ),
|
| 273 |
+
'sdk' => _fs_x( 'SDK', 'as software development kit versions' ),
|
| 274 |
+
'sdk-versions' => _fs_x( 'SDK Versions', 'as software development kit versions' ),
|
| 275 |
+
'plugin-path' => _fs_x( 'Plugin Path', 'as plugin folder path' ),
|
| 276 |
+
'sdk-path' => _fs_x( 'SDK Path', 'as sdk path' ),
|
| 277 |
+
'addons-of-x' => _fs_text( 'Add Ons of Plugin %s' ),
|
| 278 |
+
'delete-all-confirm' => _fs_text( 'Are you sure you want to delete all Freemius data?' ),
|
| 279 |
+
'actions' => _fs_text( 'Actions' ),
|
| 280 |
+
'delete-all-accounts' => _fs_text( 'Delete All Accounts' ),
|
| 281 |
+
'start-fresh' => _fs_text( 'Start Fresh' ),
|
| 282 |
+
'clear-api-cache' => _fs_text( 'Clear API Cache' ),
|
| 283 |
+
'sync-data-from-server' => _fs_text( 'Sync Data From Server' ),
|
| 284 |
+
'scheduled-crons' => _fs_text( 'Scheduled Crons' ),
|
| 285 |
+
'cron-type' => _fs_text( 'Cron Type' ),
|
| 286 |
+
'plugins-themes-sync' => _fs_text( 'Plugins & Themes Sync' ),
|
| 287 |
+
'licenses' => _fs_text( 'Licenses' ),
|
| 288 |
+
'debug-log' => _fs_text( 'Debug Log' ),
|
| 289 |
+
'all' => _fs_text( 'All' ),
|
| 290 |
+
'file' => _fs_text( 'File' ),
|
| 291 |
+
'function' => _fs_text( 'Function' ),
|
| 292 |
+
'process-id' => _fs_text( 'Process ID' ),
|
| 293 |
+
'logger' => _fs_text( 'Logger' ),
|
| 294 |
+
'message' => _fs_text( 'Message' ),
|
| 295 |
+
'download' => _fs_text( 'Download' ),
|
| 296 |
+
'filter' => _fs_text( 'Filter' ),
|
| 297 |
+
'type' => _fs_text( 'Type' ),
|
| 298 |
+
'all-types' => _fs_text( 'All Types' ),
|
| 299 |
+
'all-requests' => _fs_text( 'All Requests' ),
|
| 300 |
+
#endregion Debug
|
| 301 |
+
|
| 302 |
+
#region Expressions
|
| 303 |
+
'congrats' => _fs_x( 'Congrats', 'as congratulations' ),
|
| 304 |
+
'oops' => _fs_x( 'Oops', 'exclamation' ),
|
| 305 |
+
'yee-haw' => _fs_x( 'Yee-haw', 'interjection expressing joy or exuberance' ),
|
| 306 |
+
'woot' => _fs_x( 'W00t',
|
| 307 |
+
'(especially in electronic communication) used to express elation, enthusiasm, or triumph.' ),
|
| 308 |
+
'right-on' => _fs_x( 'Right on', 'a positive response' ),
|
| 309 |
+
'hmm' => _fs_x( 'Hmm',
|
| 310 |
+
'something somebody says when they are thinking about what you have just said. ' ),
|
| 311 |
+
'ok' => _fs_text( 'O.K' ),
|
| 312 |
+
'hey' => _fs_x( 'Hey', 'exclamation' ),
|
| 313 |
+
'heads-up' => _fs_x( 'Heads up',
|
| 314 |
+
'advance notice of something that will need attention.' ),
|
| 315 |
+
#endregion Expressions
|
| 316 |
+
|
| 317 |
+
#region Admin Notices
|
| 318 |
+
'you-have-latest' => _fs_text( 'Seems like you got the latest release.' ),
|
| 319 |
+
'you-are-good' => _fs_text( 'You are all good!' ),
|
| 320 |
+
'user-exist-message' => _fs_text( 'Sorry, we could not complete the email update. Another user with the same email is already registered.' ),
|
| 321 |
+
'user-exist-message_ownership' => _fs_text( 'If you would like to give up the ownership of the plugin\'s account to %s click the Change Ownership button.' ),
|
| 322 |
+
'email-updated-message' => _fs_text( 'Your email was successfully updated. You should receive an email with confirmation instructions in few moments.' ),
|
| 323 |
+
'name-updated-message' => _fs_text( 'Your name was successfully updated.' ),
|
| 324 |
+
'x-updated' => _fs_text( 'You have successfully updated your %s.' ),
|
| 325 |
+
'name-update-failed-message' => _fs_text( 'Please provide your full name.' ),
|
| 326 |
+
'verification-email-sent-message' => _fs_text( 'Verification mail was just sent to %s. If you can\'t find it after 5 min, please check your spam box.' ),
|
| 327 |
+
'addons-info-external-message' => _fs_text( 'Just letting you know that the add-ons information of %s is being pulled from an external server.' ),
|
| 328 |
+
'no-cc-required' => _fs_text( 'No credit card required' ),
|
| 329 |
+
'premium-activated-message' => _fs_text( 'Premium plugin version was successfully activated.' ),
|
| 330 |
+
'successful-version-upgrade-message' => _fs_text( 'The upgrade of %s was successfully completed.' ),
|
| 331 |
+
'activation-with-plan-x-message' => _fs_text( 'Your account was successfully activated with the %s plan.' ),
|
| 332 |
+
'download-latest-x-version-now' => _fs_text( 'Download the latest %s version now' ),
|
| 333 |
+
'follow-steps-to-complete-upgrade' => _fs_text( 'Please follow these steps to complete the upgrade' ),
|
| 334 |
+
'download-latest-x-version' => _fs_text( 'Download the latest %s version' ),
|
| 335 |
+
'download-latest-version' => _fs_text( 'Download the latest version' ),
|
| 336 |
+
'deactivate-free-version' => _fs_text( 'Deactivate the free version' ),
|
| 337 |
+
'upload-and-activate' => _fs_text( 'Upload and activate the downloaded version' ),
|
| 338 |
+
'howto-upload-activate' => _fs_text( 'How to upload and activate?' ),
|
| 339 |
+
'addon-successfully-purchased-message' => _fs_x( '%s Add-on was successfully purchased.',
|
| 340 |
+
'%s - product name, e.g. Facebook add-on was successfully...' ),
|
| 341 |
+
'addon-successfully-upgraded-message' => _fs_text( 'Your %s Add-on plan was successfully upgraded.' ),
|
| 342 |
+
'email-verified-message' => _fs_text( 'Your email has been successfully verified - you are AWESOME!' ),
|
| 343 |
+
'plan-upgraded-message' => _fs_text( 'Your plan was successfully upgraded.' ),
|
| 344 |
+
'plan-changed-to-x-message' => _fs_text( 'Your plan was successfully changed to %s.' ),
|
| 345 |
+
'license-expired-blocking-message' => _fs_text( 'Your license has expired. You can still continue using the free plugin forever.' ),
|
| 346 |
+
'license-cancelled' => _fs_text( 'Your license has been cancelled. If you think it\'s a mistake, please contact support.' ),
|
| 347 |
+
'trial-started-message' => _fs_text( 'Your trial has been successfully started.' ),
|
| 348 |
+
'license-activated-message' => _fs_text( 'Your license was successfully activated.' ),
|
| 349 |
+
'no-active-license-message' => _fs_text( 'It looks like your site currently doesn\'t have an active license.' ),
|
| 350 |
+
'license-deactivation-message' => _fs_text( 'Your license was successfully deactivated, you are back to the %s plan.' ),
|
| 351 |
+
'license-deactivation-failed-message' => _fs_text( 'It looks like the license deactivation failed.' ),
|
| 352 |
+
'license-activation-failed-message' => _fs_text( 'It looks like the license could not be activated.' ),
|
| 353 |
+
'server-error-message' => _fs_text( 'Error received from the server:' ),
|
| 354 |
+
'trial-expired-message' => _fs_text( 'Your trial has expired. You can still continue using all our free features.' ),
|
| 355 |
+
'plan-x-downgraded-message' => _fs_text( 'Your plan was successfully downgraded. Your %s plan license will expire in %s.' ),
|
| 356 |
+
'plan-downgraded-failure-message' => _fs_text( 'Seems like we are having some temporary issue with your plan downgrade. Please try again in few minutes.' ),
|
| 357 |
+
'trial-cancel-no-trial-message' => _fs_text( 'It looks like you are not in trial mode anymore so there\'s nothing to cancel :)' ),
|
| 358 |
+
'trial-cancel-message' => _fs_text( 'Your %s free trial was successfully cancelled.' ),
|
| 359 |
+
'version-x-released' => _fs_x( 'Version %s was released.', '%s - numeric version number' ),
|
| 360 |
+
'please-download-x' => _fs_text( 'Please download %s.' ),
|
| 361 |
+
'latest-x-version' => _fs_x( 'the latest %s version here',
|
| 362 |
+
'%s - plan name, as the latest professional version here' ),
|
| 363 |
+
'trial-x-promotion-message' => _fs_text( 'How do you like %s so far? Test all our %s premium features with a %d-day free trial.' ),
|
| 364 |
+
'start-free-trial' => _fs_x( 'Start free trial', 'call to action' ),
|
| 365 |
+
'starting-trial' => _fs_text( 'Starting trial' ),
|
| 366 |
+
'please-wait' => _fs_text( 'Please wait' ),
|
| 367 |
+
'trial-cancel-failure-message' => _fs_text( 'Seems like we are having some temporary issue with your trial cancellation. Please try again in few minutes.' ),
|
| 368 |
+
'trial-utilized' => _fs_text( 'You already utilized a trial before.' ),
|
| 369 |
+
'in-trial-mode' => _fs_text( 'You are already running the plugin in a trial mode.' ),
|
| 370 |
+
'trial-plan-x-not-exist' => _fs_text( 'Plan %s do not exist, therefore, can\'t start a trial.' ),
|
| 371 |
+
'plan-x-no-trial' => _fs_text( 'Plan %s does not support a trial period.' ),
|
| 372 |
+
'no-trials' => _fs_text( 'None of the plugin\'s plans supports a trial period.' ),
|
| 373 |
+
'unexpected-api-error' => _fs_text( 'Unexpected API error. Please contact the plugin\'s author with the following error.' ),
|
| 374 |
+
'no-commitment-for-x-days' => _fs_text( 'No commitment for %s days - cancel anytime!' ),
|
| 375 |
+
'license-expired-non-blocking-message' => _fs_text( 'Your license has expired. You can still continue using all the %s features, but you\'ll need to renew your license to continue getting updates and support.' ),
|
| 376 |
+
'could-not-activate-x' => _fs_text( 'Couldn\'t activate %s.' ),
|
| 377 |
+
'contact-us-with-error-message' => _fs_text( 'Please contact us with the following message:' ),
|
| 378 |
+
'plan-did-not-change-message' => _fs_text( 'It looks like you are still on the %s plan. If you did upgrade or change your plan, it\'s probably an issue on our side - sorry.' ),
|
| 379 |
+
'contact-us-here' => _fs_text( 'Please contact us here' ),
|
| 380 |
+
'plan-did-not-change-email-message' => _fs_text( 'I have upgraded my account but when I try to Sync the License, the plan remains %s.' ),
|
| 381 |
+
#endregion Admin Notices
|
| 382 |
+
#region Connectivity Issues
|
| 383 |
+
'connectivity-test-fails-message' => _fs_text( 'From unknown reason, the API connectivity test failed.' ),
|
| 384 |
+
'connectivity-test-maybe-temporary' => _fs_text( 'It\'s probably a temporary issue on our end. Just to be sure, with your permission, would it be o.k to run another connectivity test?' ),
|
| 385 |
+
'curl-missing-message' => _fs_text( 'We use PHP cURL library for the API calls, which is a very common library and usually installed out of the box. Unfortunately, cURL is not installed on your server.' ),
|
| 386 |
+
'cloudflare-blocks-connection-message' => _fs_text( 'From unknown reason, CloudFlare, the firewall we use, blocks the connection.' ),
|
| 387 |
+
'x-requires-access-to-api' => _fs_x( '%s requires an access to our API.',
|
| 388 |
+
'as pluginX requires an access to our API' ),
|
| 389 |
+
'squid-blocks-connection-message' => _fs_text( 'It looks like your server is using Squid ACL (access control lists), which blocks the connection.' ),
|
| 390 |
+
'squid-no-clue-title' => _fs_text( 'I don\'t know what is Squid or ACL, help me!' ),
|
| 391 |
+
'squid-no-clue-desc' => _fs_text( 'We\'ll make sure to contact your hosting company and resolve the issue. You will get a follow-up email to %s once we have an update.' ),
|
| 392 |
+
'sysadmin-title' => _fs_text( 'I\'m a system administrator' ),
|
| 393 |
+
'squid-sysadmin-desc' => _fs_text( 'Great, please whitelist the following domains: %s. Once you are done, deactivate the plugin and activate it again.' ),
|
| 394 |
+
'curl-missing-no-clue-title' => _fs_text( 'I don\'t know what is cURL or how to install it, help me!' ),
|
| 395 |
+
'curl-missing-no-clue-desc' => _fs_text( 'We\'ll make sure to contact your hosting company and resolve the issue. You will get a follow-up email to %s once we have an update.' ),
|
| 396 |
+
'curl-missing-sysadmin-desc' => _fs_text( 'Great, please install cURL and enable it in your php.ini file. To make sure it was successfully activated, use \'phpinfo()\'. Once activated, deactivate the plugin and reactivate it back again.' ),
|
| 397 |
+
'happy-to-resolve-issue-asap' => _fs_text( 'We are sure it\'s an issue on our side and more than happy to resolve it for you ASAP if you give us a chance.' ),
|
| 398 |
+
'contact-support-before-deactivation' => _fs_text( 'Sorry for the inconvenience and we are here to help if you give us a chance.' ),
|
| 399 |
+
'fix-issue-title' => _fs_text( 'Yes - I\'m giving you a chance to fix it' ),
|
| 400 |
+
'fix-issue-desc' => _fs_text( 'We will do our best to whitelist your server and resolve this issue ASAP. You will get a follow-up email to %s once we have an update.' ),
|
| 401 |
+
'install-previous-title' => _fs_text( 'Let\'s try your previous version' ),
|
| 402 |
+
'install-previous-desc' => _fs_text( 'Uninstall this version and install the previous one.' ),
|
| 403 |
+
'deactivate-plugin-title' => _fs_text( 'That\'s exhausting, please deactivate' ),
|
| 404 |
+
'deactivate-plugin-desc' => _fs_text( 'We feel your frustration and sincerely apologize for the inconvenience. Hope to see you again in the future.' ),
|
| 405 |
+
'fix-request-sent-message' => _fs_text( 'Thank for giving us the chance to fix it! A message was just sent to our technical staff. We will get back to you as soon as we have an update to %s. Appreciate your patience.' ),
|
| 406 |
+
'server-blocking-access' => _fs_x( 'Your server is blocking the access to Freemius\' API, which is crucial for %1s synchronization. Please contact your host to whitelist %2s',
|
| 407 |
+
'%1s - plugin title, %2s - API domain' ),
|
| 408 |
+
'wrong-authentication-param-message' => _fs_text( 'It seems like one of the authentication parameters is wrong. Update your Public Key, Secret Key & User ID, and try again.' ),
|
| 409 |
+
#endregion Connectivity Issues
|
| 410 |
+
#region Change Owner
|
| 411 |
+
'change-owner-request-sent-x' => _fs_text( 'Please check your mailbox, you should receive an email via %s to confirm the ownership change. From security reasons, you must confirm the change within the next 15 min. If you cannot find the email, please check your spam folder.' ),
|
| 412 |
+
'change-owner-request_owner-confirmed' => _fs_text( 'Thanks for confirming the ownership change. An email was just sent to %s for final approval.' ),
|
| 413 |
+
'change-owner-request_candidate-confirmed' => _fs_text( '%s is the new owner of the account.' ),
|
| 414 |
+
#endregion Change Owner
|
| 415 |
+
'addon-x-cannot-run-without-y' => _fs_x( '%s cannot run without %s.',
|
| 416 |
+
'addonX cannot run without pluginY' ),
|
| 417 |
+
'addon-x-cannot-run-without-parent' => _fs_x( '%s cannot run without the plugin.', 'addonX cannot run...' ),
|
| 418 |
+
'plugin-x-activation-message' => _fs_x( '%s activation was successfully completed.',
|
| 419 |
+
'pluginX activation was successfully...' ),
|
| 420 |
+
'features-and-pricing' => _fs_x( 'Features & Pricing', 'Plugin installer section title' ),
|
| 421 |
+
'free-addon-not-deployed' => _fs_text( 'Add-on must be deployed to WordPress.org or Freemius.' ),
|
| 422 |
+
'paid-addon-not-deployed' => _fs_text( 'Paid add-on must be deployed to Freemius.' ),
|
| 423 |
+
#--------------------------------------------------------------------------------
|
| 424 |
+
#region Add-On Licensing
|
| 425 |
+
#--------------------------------------------------------------------------------
|
| 426 |
+
'addon-no-license-message' => _fs_text( '%s is a premium only add-on. You have to purchase a license first before activating the plugin.' ),
|
| 427 |
+
'addon-trial-cancelled-message' => _fs_text( '%s free trial was successfully cancelled. Since the add-on is premium only it was automatically deactivated. If you like to use it in the future, you\'ll have to purchase a license.' ),
|
| 428 |
+
#endregion
|
| 429 |
+
#--------------------------------------------------------------------------------
|
| 430 |
+
#region Billing Cycles
|
| 431 |
+
#--------------------------------------------------------------------------------
|
| 432 |
+
'monthly' => _fs_x( 'Monthly', 'as every month' ),
|
| 433 |
+
'mo' => _fs_x( 'mo', 'as monthly period' ),
|
| 434 |
+
'annual' => _fs_x( 'Annual', 'as once a year' ),
|
| 435 |
+
'annually' => _fs_x( 'Annually', 'as once a year' ),
|
| 436 |
+
'once' => _fs_x( 'Once', 'as once a year' ),
|
| 437 |
+
'year' => _fs_x( 'year', 'as annual period' ),
|
| 438 |
+
'lifetime' => _fs_text( 'Lifetime' ),
|
| 439 |
+
'best' => _fs_x( 'Best', 'e.g. the best product' ),
|
| 440 |
+
'billed-x' => _fs_x( 'Billed %s', 'e.g. billed monthly' ),
|
| 441 |
+
'save-x' => _fs_x( 'Save %s', 'as a discount of $5 or 10%' ),
|
| 442 |
+
#endregion Billing Cycles
|
| 443 |
+
'view-details' => _fs_text( 'View details' ),
|
| 444 |
+
#--------------------------------------------------------------------------------
|
| 445 |
+
#region Trial
|
| 446 |
+
#--------------------------------------------------------------------------------
|
| 447 |
+
'approve-start-trial' => _fs_x( 'Approve & Start Trial', 'button label' ),
|
| 448 |
+
/* translators: %1$s: Number of trial days; %2$s: Plan name; */
|
| 449 |
+
'start-trial-prompt-header' => _fs_text( 'You are 1-click away from starting your %1$s-day free trial of the %2$s plan.' ),
|
| 450 |
+
/* translators: %s: Link to freemius.com */
|
| 451 |
+
'start-trial-prompt-message' => _fs_text( 'For compliance with the WordPress.org guidelines, before we start the trial we ask that you opt-in with your user and non-sensitive site information, allowing the plugin to periodically send data to %s to check for version updates and to validate your trial.' ),
|
| 452 |
+
|
| 453 |
+
#endregion
|
| 454 |
+
#--------------------------------------------------------------------------------
|
| 455 |
+
#region Billing Details
|
| 456 |
+
#--------------------------------------------------------------------------------
|
| 457 |
+
'business-name' => _fs_text( 'Business name' ),
|
| 458 |
+
'tax-vat-id' => _fs_text( 'Tax / VAT ID' ),
|
| 459 |
+
'address-line-n' => _fs_text( 'Address Line %d' ),
|
| 460 |
+
'country' => _fs_text( 'Country' ),
|
| 461 |
+
'select-country' => _fs_text( 'Select Country' ),
|
| 462 |
+
'city' => _fs_text( 'City' ),
|
| 463 |
+
'town' => _fs_text( 'Town' ),
|
| 464 |
+
'state' => _fs_text( 'State' ),
|
| 465 |
+
'province' => _fs_text( 'Province' ),
|
| 466 |
+
'zip-postal-code' => _fs_text( 'ZIP / Postal Code' ),
|
| 467 |
+
#endregion
|
| 468 |
+
);
|
| 469 |
+
|
| 470 |
+
/**
|
| 471 |
+
* Localization of the strings in the plugin/theme info dialog box.
|
| 472 |
+
*
|
| 473 |
+
* $fs_module_info_text should ONLY include strings that are not located in $fs_text.
|
| 474 |
+
*
|
| 475 |
+
* @author Vova Feldman (@svovaf)
|
| 476 |
+
* @since 1.2.2
|
| 477 |
+
*/
|
| 478 |
+
global $fs_module_info_text;
|
| 479 |
+
|
| 480 |
+
$fs_module_info_text = array(
|
| 481 |
+
'description' => _fs_x( 'Description', 'Plugin installer section title' ),
|
| 482 |
+
'installation' => _fs_x( 'Installation', 'Plugin installer section title' ),
|
| 483 |
+
'faq' => _fs_x( 'FAQ', 'Plugin installer section title' ),
|
| 484 |
+
'changelog' => _fs_x( 'Changelog', 'Plugin installer section title' ),
|
| 485 |
+
'reviews' => _fs_x( 'Reviews', 'Plugin installer section title' ),
|
| 486 |
+
'other_notes' => _fs_x( 'Other Notes', 'Plugin installer section title' ),
|
| 487 |
+
/* translators: %s: 1 or One */
|
| 488 |
+
'x-star' => _fs_text( '%s star' ),
|
| 489 |
+
/* translators: %s: Number larger than 1 */
|
| 490 |
+
'x-stars' => _fs_text( '%s stars' ),
|
| 491 |
+
/* translators: %s: 1 or One */
|
| 492 |
+
'x-rating' => _fs_text( '%s rating' ),
|
| 493 |
+
/* translators: %s: Number larger than 1 */
|
| 494 |
+
'x-ratings' => _fs_text( '%s ratings' ),
|
| 495 |
+
/* translators: %s: 1 or One (Number of times downloaded) */
|
| 496 |
+
'x-time' => _fs_text( '%s time' ),
|
| 497 |
+
/* translators: %s: Number of times downloaded */
|
| 498 |
+
'x-times' => _fs_text( '%s times' ),
|
| 499 |
+
/* translators: %s: # of stars (e.g. 5 stars) */
|
| 500 |
+
'click-to-reviews' => _fs_text( 'Click to see reviews that provided a rating of %s' ),
|
| 501 |
+
'last-updated:' => _fs_text( 'Last Updated' ),
|
| 502 |
+
'requires-wordpress-version:' => _fs_text( 'Requires WordPress Version:' ),
|
| 503 |
+
'author:' => _fs_x( 'Author:', 'as the plugin author' ),
|
| 504 |
+
'compatible-up-to:' => _fs_text( 'Compatible up to:' ),
|
| 505 |
+
'downloaded:' => _fs_text( 'Downloaded:' ),
|
| 506 |
+
'wp-org-plugin-page' => _fs_text( 'WordPress.org Plugin Page' ),
|
| 507 |
+
'plugin-homepage' => _fs_text( 'Plugin Homepage' ),
|
| 508 |
+
'donate-to-plugin' => _fs_text( 'Donate to this plugin' ),
|
| 509 |
+
'average-rating' => _fs_text( 'Average Rating' ),
|
| 510 |
+
'based-on-x' => _fs_text( 'based on %s' ),
|
| 511 |
+
'warning:' => _fs_text( 'Warning:' ),
|
| 512 |
+
'contributors' => _fs_text( 'Contributors' ),
|
| 513 |
+
'plugin-install' => _fs_text( 'Plugin Install' ),
|
| 514 |
+
'not-tested-warning' => _fs_text( 'This plugin has not been tested with your current version of WordPress.' ),
|
| 515 |
+
'not-compatible-warning' => _fs_text( 'This plugin has not been marked as compatible with your version of WordPress.' ),
|
| 516 |
+
'newer-installed' => _fs_text( 'Newer Version (%s) Installed' ),
|
| 517 |
+
'latest-installed' => _fs_text( 'Latest Version Installed' ),
|
| 518 |
);
|
freemius/includes/managers/class-fs-admin-notice-manager.php
CHANGED
|
@@ -1,313 +1,313 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* @package Freemius
|
| 4 |
-
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
-
* @since 1.0.7
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
-
exit;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
class FS_Admin_Notice_Manager {
|
| 14 |
-
/**
|
| 15 |
-
* @var string
|
| 16 |
-
*/
|
| 17 |
-
protected $_slug;
|
| 18 |
-
/**
|
| 19 |
-
* @var string
|
| 20 |
-
*/
|
| 21 |
-
protected $_title;
|
| 22 |
-
/**
|
| 23 |
-
* @var array[]
|
| 24 |
-
*/
|
| 25 |
-
private $_admin_messages = array();
|
| 26 |
-
/**
|
| 27 |
-
* @var FS_Key_Value_Storage
|
| 28 |
-
*/
|
| 29 |
-
private $_sticky_storage;
|
| 30 |
-
/**
|
| 31 |
-
* @var FS_Plugin_Manager[]
|
| 32 |
-
*/
|
| 33 |
-
private static $_instances = array();
|
| 34 |
-
/**
|
| 35 |
-
* @var FS_Logger
|
| 36 |
-
*/
|
| 37 |
-
protected $_logger;
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* @param string $slug
|
| 41 |
-
* @param string $title
|
| 42 |
-
*
|
| 43 |
-
* @return FS_Admin_Notice_Manager
|
| 44 |
-
*/
|
| 45 |
-
static function instance( $slug, $title = '' ) {
|
| 46 |
-
if ( ! isset( self::$_instances[ $slug ] ) ) {
|
| 47 |
-
self::$_instances[ $slug ] = new FS_Admin_Notice_Manager( $slug, $title );
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
return self::$_instances[ $slug ];
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
protected function __construct( $slug, $title = '' ) {
|
| 54 |
-
$this->_logger = FS_Logger::get_logger( WP_FS__SLUG . '_' . $slug . '_data', WP_FS__DEBUG_SDK, WP_FS__ECHO_DEBUG_SDK );
|
| 55 |
-
|
| 56 |
-
$this->_slug = $slug;
|
| 57 |
-
$this->_title = ! empty( $title ) ? $title : '';
|
| 58 |
-
$this->_sticky_storage = FS_Key_Value_Storage::instance( 'admin_notices', $this->_slug );
|
| 59 |
-
|
| 60 |
-
if ( is_admin() ) {
|
| 61 |
-
if ( 0 < count( $this->_sticky_storage ) ) {
|
| 62 |
-
// If there are sticky notices for the current slug, add a callback
|
| 63 |
-
// to the AJAX action that handles message dismiss.
|
| 64 |
-
add_action( "wp_ajax_fs_dismiss_notice_action_{$slug}", array(
|
| 65 |
-
&$this,
|
| 66 |
-
'dismiss_notice_ajax_callback'
|
| 67 |
-
) );
|
| 68 |
-
|
| 69 |
-
foreach ( $this->_sticky_storage as $id => $msg ) {
|
| 70 |
-
// Add admin notice.
|
| 71 |
-
$this->add(
|
| 72 |
-
$msg['message'],
|
| 73 |
-
$msg['title'],
|
| 74 |
-
$msg['type'],
|
| 75 |
-
true,
|
| 76 |
-
$msg['all'],
|
| 77 |
-
$msg['id'],
|
| 78 |
-
false
|
| 79 |
-
);
|
| 80 |
-
}
|
| 81 |
-
}
|
| 82 |
-
}
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* Remove sticky message by ID.
|
| 87 |
-
*
|
| 88 |
-
* @author Vova Feldman (@svovaf)
|
| 89 |
-
* @since 1.0.7
|
| 90 |
-
*
|
| 91 |
-
*/
|
| 92 |
-
function dismiss_notice_ajax_callback() {
|
| 93 |
-
$this->_sticky_storage->remove( $_POST['message_id'] );
|
| 94 |
-
wp_die();
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
/**
|
| 98 |
-
* Rendered sticky message dismiss JavaScript.
|
| 99 |
-
*
|
| 100 |
-
* @author Vova Feldman (@svovaf)
|
| 101 |
-
* @since 1.0.7
|
| 102 |
-
*/
|
| 103 |
-
static function _add_sticky_dismiss_javascript() {
|
| 104 |
-
$params = array();
|
| 105 |
-
fs_require_once_template( 'sticky-admin-notice-js.php', $params );
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
private static $_added_sticky_javascript = false;
|
| 109 |
-
|
| 110 |
-
/**
|
| 111 |
-
* Hook to the admin_footer to add sticky message dismiss JavaScript handler.
|
| 112 |
-
*
|
| 113 |
-
* @author Vova Feldman (@svovaf)
|
| 114 |
-
* @since 1.0.7
|
| 115 |
-
*/
|
| 116 |
-
private static function has_sticky_messages() {
|
| 117 |
-
if ( ! self::$_added_sticky_javascript ) {
|
| 118 |
-
add_action( 'admin_footer', array( 'FS_Admin_Notice_Manager', '_add_sticky_dismiss_javascript' ) );
|
| 119 |
-
}
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
/**
|
| 123 |
-
* Handle admin_notices by printing the admin messages stacked in the queue.
|
| 124 |
-
*
|
| 125 |
-
* @author Vova Feldman (@svovaf)
|
| 126 |
-
* @since 1.0.4
|
| 127 |
-
*
|
| 128 |
-
*/
|
| 129 |
-
function _admin_notices_hook() {
|
| 130 |
-
$notice_type = 'admin_notices';
|
| 131 |
-
|
| 132 |
-
if ( function_exists( 'current_user_can' ) &&
|
| 133 |
-
! current_user_can( 'manage_options' )
|
| 134 |
-
) {
|
| 135 |
-
// Only show messages to admins.
|
| 136 |
-
return;
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
if ( ! isset( $this->_admin_messages[ $notice_type ] ) || ! is_array( $this->_admin_messages[ $notice_type ] ) ) {
|
| 140 |
-
return;
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
foreach ( $this->_admin_messages[ $notice_type ] as $id => $msg ) {
|
| 144 |
-
fs_require_template( 'admin-notice.php', $msg );
|
| 145 |
-
|
| 146 |
-
if ( $msg['sticky'] ) {
|
| 147 |
-
self::has_sticky_messages();
|
| 148 |
-
}
|
| 149 |
-
}
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
/**
|
| 153 |
-
* Handle all_admin_notices by printing the admin messages stacked in the queue.
|
| 154 |
-
*
|
| 155 |
-
* @author Vova Feldman (@svovaf)
|
| 156 |
-
* @since 1.0.4
|
| 157 |
-
*
|
| 158 |
-
*/
|
| 159 |
-
function _all_admin_notices_hook() {
|
| 160 |
-
$notice_type = 'all_admin_notices';
|
| 161 |
-
|
| 162 |
-
if ( ! isset( $this->_admin_messages[ $notice_type ] ) || ! is_array( $this->_admin_messages[ $notice_type ] ) ) {
|
| 163 |
-
return;
|
| 164 |
-
}
|
| 165 |
-
|
| 166 |
-
foreach ( $this->_admin_messages[ $notice_type ] as $id => $msg ) {
|
| 167 |
-
fs_require_template( 'all-admin-notice.php', $msg );
|
| 168 |
-
}
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
/**
|
| 172 |
-
* Enqueue common stylesheet to style admin notice.
|
| 173 |
-
*
|
| 174 |
-
* @author Vova Feldman (@svovaf)
|
| 175 |
-
* @since 1.0.7
|
| 176 |
-
*/
|
| 177 |
-
function _enqueue_styles() {
|
| 178 |
-
fs_enqueue_local_style( 'fs_common', '/admin/common.css' );
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
/**
|
| 182 |
-
* Add admin message to admin messages queue, and hook to admin_notices / all_admin_notices if not yet hooked.
|
| 183 |
-
*
|
| 184 |
-
* @author Vova Feldman (@svovaf)
|
| 185 |
-
* @since 1.0.4
|
| 186 |
-
*
|
| 187 |
-
* @param string $message
|
| 188 |
-
* @param string $title
|
| 189 |
-
* @param string $type
|
| 190 |
-
* @param bool $is_sticky
|
| 191 |
-
* @param bool $all_admin
|
| 192 |
-
* @param string $id Message ID
|
| 193 |
-
* @param bool $store_if_sticky
|
| 194 |
-
*
|
| 195 |
-
* @uses add_action()
|
| 196 |
-
*/
|
| 197 |
-
function add( $message, $title = '', $type = 'success', $is_sticky = false, $all_admin = false, $id = '', $store_if_sticky = true ) {
|
| 198 |
-
$key = ( $all_admin ? 'all_admin_notices' : 'admin_notices' );
|
| 199 |
-
|
| 200 |
-
if ( ! isset( $this->_admin_messages[ $key ] ) ) {
|
| 201 |
-
$this->_admin_messages[ $key ] = array();
|
| 202 |
-
|
| 203 |
-
add_action( $key, array( &$this, "_{$key}_hook" ) );
|
| 204 |
-
add_action( 'admin_enqueue_scripts', array( &$this, '_enqueue_styles' ) );
|
| 205 |
-
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
if ( '' === $id ) {
|
| 209 |
-
$id = md5( $title . ' ' . $message . ' ' . $type );
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
$message_object = array(
|
| 213 |
-
'message' => $message,
|
| 214 |
-
'title' => $title,
|
| 215 |
-
'type' => $type,
|
| 216 |
-
'sticky' => $is_sticky,
|
| 217 |
-
'id' => $id,
|
| 218 |
-
'all' => $all_admin,
|
| 219 |
-
'slug' => $this->_slug,
|
| 220 |
-
'plugin' => $this->_title,
|
| 221 |
-
);
|
| 222 |
-
|
| 223 |
-
if ( $is_sticky && $store_if_sticky ) {
|
| 224 |
-
$this->_sticky_storage->{$id} = $message_object;
|
| 225 |
-
}
|
| 226 |
-
|
| 227 |
-
$this->_admin_messages[ $key ][ $id ] = $message_object;
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
/**
|
| 231 |
-
* @author Vova Feldman (@svovaf)
|
| 232 |
-
* @since 1.0.7
|
| 233 |
-
*
|
| 234 |
-
* @param string|string[] $ids
|
| 235 |
-
*/
|
| 236 |
-
function remove_sticky( $ids ) {
|
| 237 |
-
if ( ! is_array( $ids ) ) {
|
| 238 |
-
$ids = array( $ids );
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
foreach ( $ids as $id ) {
|
| 242 |
-
// Remove from sticky storage.
|
| 243 |
-
$this->_sticky_storage->remove( $id );
|
| 244 |
-
|
| 245 |
-
// Remove from current admin messages.
|
| 246 |
-
if ( isset( $this->_admin_messages['all_admin_notices'] ) && isset( $this->_admin_messages['all_admin_notices'][ $id ] ) ) {
|
| 247 |
-
unset( $this->_admin_messages['all_admin_notices'][ $id ] );
|
| 248 |
-
}
|
| 249 |
-
if ( isset( $this->_admin_messages['admin_notices'] ) && isset( $this->_admin_messages['admin_notices'][ $id ] ) ) {
|
| 250 |
-
unset( $this->_admin_messages['admin_notices'][ $id ] );
|
| 251 |
-
}
|
| 252 |
-
}
|
| 253 |
-
}
|
| 254 |
-
|
| 255 |
-
/**
|
| 256 |
-
* Check if sticky message exists by id.
|
| 257 |
-
*
|
| 258 |
-
* @author Vova Feldman (@svovaf)
|
| 259 |
-
* @since 1.0.9
|
| 260 |
-
*
|
| 261 |
-
* @param $id
|
| 262 |
-
*
|
| 263 |
-
* @return bool
|
| 264 |
-
*/
|
| 265 |
-
function has_sticky( $id ) {
|
| 266 |
-
return isset( $this->_sticky_storage[ $id ] );
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
/**
|
| 270 |
-
* Adds sticky admin notification.
|
| 271 |
-
*
|
| 272 |
-
* @author Vova Feldman (@svovaf)
|
| 273 |
-
* @since 1.0.7
|
| 274 |
-
*
|
| 275 |
-
* @param string $message
|
| 276 |
-
* @param string $id Message ID
|
| 277 |
-
* @param string $title
|
| 278 |
-
* @param string $type
|
| 279 |
-
* @param bool $all_admin
|
| 280 |
-
*/
|
| 281 |
-
function add_sticky( $message, $id, $title = '', $type = 'success', $all_admin = false ) {
|
| 282 |
-
$message = fs_apply_filter( $this->_slug, "sticky_message_{$id}", $message );
|
| 283 |
-
$title = fs_apply_filter( $this->_slug, "sticky_title_{$id}", $title );
|
| 284 |
-
|
| 285 |
-
$this->add( $message, $title, $type, true, $all_admin, $id );
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
/**
|
| 289 |
-
* Clear all sticky messages.
|
| 290 |
-
*
|
| 291 |
-
* @author Vova Feldman (@svovaf)
|
| 292 |
-
* @since 1.0.8
|
| 293 |
-
*/
|
| 294 |
-
function clear_all_sticky() {
|
| 295 |
-
$this->_sticky_storage->clear_all();
|
| 296 |
-
}
|
| 297 |
-
|
| 298 |
-
/**
|
| 299 |
-
* Add admin message to all admin messages queue, and hook to all_admin_notices if not yet hooked.
|
| 300 |
-
*
|
| 301 |
-
* @author Vova Feldman (@svovaf)
|
| 302 |
-
* @since 1.0.4
|
| 303 |
-
*
|
| 304 |
-
* @param string $message
|
| 305 |
-
* @param string $title
|
| 306 |
-
* @param string $type
|
| 307 |
-
* @param bool $is_sticky
|
| 308 |
-
* @param string $id Message ID
|
| 309 |
-
*/
|
| 310 |
-
function add_all( $message, $title = '', $type = 'success', $is_sticky = false, $id = '' ) {
|
| 311 |
-
$this->add( $message, $title, $type, $is_sticky, true, $id );
|
| 312 |
-
}
|
| 313 |
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* @package Freemius
|
| 4 |
+
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
+
* @since 1.0.7
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
+
exit;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
class FS_Admin_Notice_Manager {
|
| 14 |
+
/**
|
| 15 |
+
* @var string
|
| 16 |
+
*/
|
| 17 |
+
protected $_slug;
|
| 18 |
+
/**
|
| 19 |
+
* @var string
|
| 20 |
+
*/
|
| 21 |
+
protected $_title;
|
| 22 |
+
/**
|
| 23 |
+
* @var array[]
|
| 24 |
+
*/
|
| 25 |
+
private $_admin_messages = array();
|
| 26 |
+
/**
|
| 27 |
+
* @var FS_Key_Value_Storage
|
| 28 |
+
*/
|
| 29 |
+
private $_sticky_storage;
|
| 30 |
+
/**
|
| 31 |
+
* @var FS_Plugin_Manager[]
|
| 32 |
+
*/
|
| 33 |
+
private static $_instances = array();
|
| 34 |
+
/**
|
| 35 |
+
* @var FS_Logger
|
| 36 |
+
*/
|
| 37 |
+
protected $_logger;
|
| 38 |
+
|
| 39 |
+
/**
|
| 40 |
+
* @param string $slug
|
| 41 |
+
* @param string $title
|
| 42 |
+
*
|
| 43 |
+
* @return FS_Admin_Notice_Manager
|
| 44 |
+
*/
|
| 45 |
+
static function instance( $slug, $title = '' ) {
|
| 46 |
+
if ( ! isset( self::$_instances[ $slug ] ) ) {
|
| 47 |
+
self::$_instances[ $slug ] = new FS_Admin_Notice_Manager( $slug, $title );
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
return self::$_instances[ $slug ];
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
protected function __construct( $slug, $title = '' ) {
|
| 54 |
+
$this->_logger = FS_Logger::get_logger( WP_FS__SLUG . '_' . $slug . '_data', WP_FS__DEBUG_SDK, WP_FS__ECHO_DEBUG_SDK );
|
| 55 |
+
|
| 56 |
+
$this->_slug = $slug;
|
| 57 |
+
$this->_title = ! empty( $title ) ? $title : '';
|
| 58 |
+
$this->_sticky_storage = FS_Key_Value_Storage::instance( 'admin_notices', $this->_slug );
|
| 59 |
+
|
| 60 |
+
if ( is_admin() ) {
|
| 61 |
+
if ( 0 < count( $this->_sticky_storage ) ) {
|
| 62 |
+
// If there are sticky notices for the current slug, add a callback
|
| 63 |
+
// to the AJAX action that handles message dismiss.
|
| 64 |
+
add_action( "wp_ajax_fs_dismiss_notice_action_{$slug}", array(
|
| 65 |
+
&$this,
|
| 66 |
+
'dismiss_notice_ajax_callback'
|
| 67 |
+
) );
|
| 68 |
+
|
| 69 |
+
foreach ( $this->_sticky_storage as $id => $msg ) {
|
| 70 |
+
// Add admin notice.
|
| 71 |
+
$this->add(
|
| 72 |
+
$msg['message'],
|
| 73 |
+
$msg['title'],
|
| 74 |
+
$msg['type'],
|
| 75 |
+
true,
|
| 76 |
+
$msg['all'],
|
| 77 |
+
$msg['id'],
|
| 78 |
+
false
|
| 79 |
+
);
|
| 80 |
+
}
|
| 81 |
+
}
|
| 82 |
+
}
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
/**
|
| 86 |
+
* Remove sticky message by ID.
|
| 87 |
+
*
|
| 88 |
+
* @author Vova Feldman (@svovaf)
|
| 89 |
+
* @since 1.0.7
|
| 90 |
+
*
|
| 91 |
+
*/
|
| 92 |
+
function dismiss_notice_ajax_callback() {
|
| 93 |
+
$this->_sticky_storage->remove( $_POST['message_id'] );
|
| 94 |
+
wp_die();
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
* Rendered sticky message dismiss JavaScript.
|
| 99 |
+
*
|
| 100 |
+
* @author Vova Feldman (@svovaf)
|
| 101 |
+
* @since 1.0.7
|
| 102 |
+
*/
|
| 103 |
+
static function _add_sticky_dismiss_javascript() {
|
| 104 |
+
$params = array();
|
| 105 |
+
fs_require_once_template( 'sticky-admin-notice-js.php', $params );
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
private static $_added_sticky_javascript = false;
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Hook to the admin_footer to add sticky message dismiss JavaScript handler.
|
| 112 |
+
*
|
| 113 |
+
* @author Vova Feldman (@svovaf)
|
| 114 |
+
* @since 1.0.7
|
| 115 |
+
*/
|
| 116 |
+
private static function has_sticky_messages() {
|
| 117 |
+
if ( ! self::$_added_sticky_javascript ) {
|
| 118 |
+
add_action( 'admin_footer', array( 'FS_Admin_Notice_Manager', '_add_sticky_dismiss_javascript' ) );
|
| 119 |
+
}
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
/**
|
| 123 |
+
* Handle admin_notices by printing the admin messages stacked in the queue.
|
| 124 |
+
*
|
| 125 |
+
* @author Vova Feldman (@svovaf)
|
| 126 |
+
* @since 1.0.4
|
| 127 |
+
*
|
| 128 |
+
*/
|
| 129 |
+
function _admin_notices_hook() {
|
| 130 |
+
$notice_type = 'admin_notices';
|
| 131 |
+
|
| 132 |
+
if ( function_exists( 'current_user_can' ) &&
|
| 133 |
+
! current_user_can( 'manage_options' )
|
| 134 |
+
) {
|
| 135 |
+
// Only show messages to admins.
|
| 136 |
+
return;
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
if ( ! isset( $this->_admin_messages[ $notice_type ] ) || ! is_array( $this->_admin_messages[ $notice_type ] ) ) {
|
| 140 |
+
return;
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
foreach ( $this->_admin_messages[ $notice_type ] as $id => $msg ) {
|
| 144 |
+
fs_require_template( 'admin-notice.php', $msg );
|
| 145 |
+
|
| 146 |
+
if ( $msg['sticky'] ) {
|
| 147 |
+
self::has_sticky_messages();
|
| 148 |
+
}
|
| 149 |
+
}
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
/**
|
| 153 |
+
* Handle all_admin_notices by printing the admin messages stacked in the queue.
|
| 154 |
+
*
|
| 155 |
+
* @author Vova Feldman (@svovaf)
|
| 156 |
+
* @since 1.0.4
|
| 157 |
+
*
|
| 158 |
+
*/
|
| 159 |
+
function _all_admin_notices_hook() {
|
| 160 |
+
$notice_type = 'all_admin_notices';
|
| 161 |
+
|
| 162 |
+
if ( ! isset( $this->_admin_messages[ $notice_type ] ) || ! is_array( $this->_admin_messages[ $notice_type ] ) ) {
|
| 163 |
+
return;
|
| 164 |
+
}
|
| 165 |
+
|
| 166 |
+
foreach ( $this->_admin_messages[ $notice_type ] as $id => $msg ) {
|
| 167 |
+
fs_require_template( 'all-admin-notice.php', $msg );
|
| 168 |
+
}
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
/**
|
| 172 |
+
* Enqueue common stylesheet to style admin notice.
|
| 173 |
+
*
|
| 174 |
+
* @author Vova Feldman (@svovaf)
|
| 175 |
+
* @since 1.0.7
|
| 176 |
+
*/
|
| 177 |
+
function _enqueue_styles() {
|
| 178 |
+
fs_enqueue_local_style( 'fs_common', '/admin/common.css' );
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
/**
|
| 182 |
+
* Add admin message to admin messages queue, and hook to admin_notices / all_admin_notices if not yet hooked.
|
| 183 |
+
*
|
| 184 |
+
* @author Vova Feldman (@svovaf)
|
| 185 |
+
* @since 1.0.4
|
| 186 |
+
*
|
| 187 |
+
* @param string $message
|
| 188 |
+
* @param string $title
|
| 189 |
+
* @param string $type
|
| 190 |
+
* @param bool $is_sticky
|
| 191 |
+
* @param bool $all_admin
|
| 192 |
+
* @param string $id Message ID
|
| 193 |
+
* @param bool $store_if_sticky
|
| 194 |
+
*
|
| 195 |
+
* @uses add_action()
|
| 196 |
+
*/
|
| 197 |
+
function add( $message, $title = '', $type = 'success', $is_sticky = false, $all_admin = false, $id = '', $store_if_sticky = true ) {
|
| 198 |
+
$key = ( $all_admin ? 'all_admin_notices' : 'admin_notices' );
|
| 199 |
+
|
| 200 |
+
if ( ! isset( $this->_admin_messages[ $key ] ) ) {
|
| 201 |
+
$this->_admin_messages[ $key ] = array();
|
| 202 |
+
|
| 203 |
+
add_action( $key, array( &$this, "_{$key}_hook" ) );
|
| 204 |
+
add_action( 'admin_enqueue_scripts', array( &$this, '_enqueue_styles' ) );
|
| 205 |
+
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
if ( '' === $id ) {
|
| 209 |
+
$id = md5( $title . ' ' . $message . ' ' . $type );
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
$message_object = array(
|
| 213 |
+
'message' => $message,
|
| 214 |
+
'title' => $title,
|
| 215 |
+
'type' => $type,
|
| 216 |
+
'sticky' => $is_sticky,
|
| 217 |
+
'id' => $id,
|
| 218 |
+
'all' => $all_admin,
|
| 219 |
+
'slug' => $this->_slug,
|
| 220 |
+
'plugin' => $this->_title,
|
| 221 |
+
);
|
| 222 |
+
|
| 223 |
+
if ( $is_sticky && $store_if_sticky ) {
|
| 224 |
+
$this->_sticky_storage->{$id} = $message_object;
|
| 225 |
+
}
|
| 226 |
+
|
| 227 |
+
$this->_admin_messages[ $key ][ $id ] = $message_object;
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
/**
|
| 231 |
+
* @author Vova Feldman (@svovaf)
|
| 232 |
+
* @since 1.0.7
|
| 233 |
+
*
|
| 234 |
+
* @param string|string[] $ids
|
| 235 |
+
*/
|
| 236 |
+
function remove_sticky( $ids ) {
|
| 237 |
+
if ( ! is_array( $ids ) ) {
|
| 238 |
+
$ids = array( $ids );
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
foreach ( $ids as $id ) {
|
| 242 |
+
// Remove from sticky storage.
|
| 243 |
+
$this->_sticky_storage->remove( $id );
|
| 244 |
+
|
| 245 |
+
// Remove from current admin messages.
|
| 246 |
+
if ( isset( $this->_admin_messages['all_admin_notices'] ) && isset( $this->_admin_messages['all_admin_notices'][ $id ] ) ) {
|
| 247 |
+
unset( $this->_admin_messages['all_admin_notices'][ $id ] );
|
| 248 |
+
}
|
| 249 |
+
if ( isset( $this->_admin_messages['admin_notices'] ) && isset( $this->_admin_messages['admin_notices'][ $id ] ) ) {
|
| 250 |
+
unset( $this->_admin_messages['admin_notices'][ $id ] );
|
| 251 |
+
}
|
| 252 |
+
}
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
/**
|
| 256 |
+
* Check if sticky message exists by id.
|
| 257 |
+
*
|
| 258 |
+
* @author Vova Feldman (@svovaf)
|
| 259 |
+
* @since 1.0.9
|
| 260 |
+
*
|
| 261 |
+
* @param $id
|
| 262 |
+
*
|
| 263 |
+
* @return bool
|
| 264 |
+
*/
|
| 265 |
+
function has_sticky( $id ) {
|
| 266 |
+
return isset( $this->_sticky_storage[ $id ] );
|
| 267 |
+
}
|
| 268 |
+
|
| 269 |
+
/**
|
| 270 |
+
* Adds sticky admin notification.
|
| 271 |
+
*
|
| 272 |
+
* @author Vova Feldman (@svovaf)
|
| 273 |
+
* @since 1.0.7
|
| 274 |
+
*
|
| 275 |
+
* @param string $message
|
| 276 |
+
* @param string $id Message ID
|
| 277 |
+
* @param string $title
|
| 278 |
+
* @param string $type
|
| 279 |
+
* @param bool $all_admin
|
| 280 |
+
*/
|
| 281 |
+
function add_sticky( $message, $id, $title = '', $type = 'success', $all_admin = false ) {
|
| 282 |
+
$message = fs_apply_filter( $this->_slug, "sticky_message_{$id}", $message );
|
| 283 |
+
$title = fs_apply_filter( $this->_slug, "sticky_title_{$id}", $title );
|
| 284 |
+
|
| 285 |
+
$this->add( $message, $title, $type, true, $all_admin, $id );
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
/**
|
| 289 |
+
* Clear all sticky messages.
|
| 290 |
+
*
|
| 291 |
+
* @author Vova Feldman (@svovaf)
|
| 292 |
+
* @since 1.0.8
|
| 293 |
+
*/
|
| 294 |
+
function clear_all_sticky() {
|
| 295 |
+
$this->_sticky_storage->clear_all();
|
| 296 |
+
}
|
| 297 |
+
|
| 298 |
+
/**
|
| 299 |
+
* Add admin message to all admin messages queue, and hook to all_admin_notices if not yet hooked.
|
| 300 |
+
*
|
| 301 |
+
* @author Vova Feldman (@svovaf)
|
| 302 |
+
* @since 1.0.4
|
| 303 |
+
*
|
| 304 |
+
* @param string $message
|
| 305 |
+
* @param string $title
|
| 306 |
+
* @param string $type
|
| 307 |
+
* @param bool $is_sticky
|
| 308 |
+
* @param string $id Message ID
|
| 309 |
+
*/
|
| 310 |
+
function add_all( $message, $title = '', $type = 'success', $is_sticky = false, $id = '' ) {
|
| 311 |
+
$this->add( $message, $title, $type, $is_sticky, true, $id );
|
| 312 |
+
}
|
| 313 |
}
|
freemius/includes/sdk/Exceptions/ArgumentNotExistException.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
if ( ! class_exists( 'Freemius_ArgumentNotExistException' ) ) {
|
| 7 |
-
class Freemius_ArgumentNotExistException extends Freemius_InvalidArgumentException {
|
| 8 |
-
}
|
| 9 |
}
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 3 |
+
exit;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( ! class_exists( 'Freemius_ArgumentNotExistException' ) ) {
|
| 7 |
+
class Freemius_ArgumentNotExistException extends Freemius_InvalidArgumentException {
|
| 8 |
+
}
|
| 9 |
}
|
freemius/includes/sdk/Exceptions/EmptyArgumentException.php
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
if ( ! class_exists( 'Freemius_EmptyArgumentException' ) ) {
|
| 7 |
-
class Freemius_EmptyArgumentException extends Freemius_InvalidArgumentException {
|
| 8 |
-
}
|
| 9 |
}
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 3 |
+
exit;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( ! class_exists( 'Freemius_EmptyArgumentException' ) ) {
|
| 7 |
+
class Freemius_EmptyArgumentException extends Freemius_InvalidArgumentException {
|
| 8 |
+
}
|
| 9 |
}
|
freemius/includes/sdk/Exceptions/Exception.php
CHANGED
|
@@ -1,74 +1,74 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
-
/**
|
| 4 |
-
* Thrown when an API call returns an exception.
|
| 5 |
-
*
|
| 6 |
-
*/
|
| 7 |
-
class Freemius_Exception extends Exception {
|
| 8 |
-
protected $_result;
|
| 9 |
-
protected $_type;
|
| 10 |
-
protected $_code;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Make a new API Exception with the given result.
|
| 14 |
-
*
|
| 15 |
-
* @param array $result The result from the API server.
|
| 16 |
-
*/
|
| 17 |
-
public function __construct( $result ) {
|
| 18 |
-
$this->_result = $result;
|
| 19 |
-
|
| 20 |
-
$code = 0;
|
| 21 |
-
$message = 'Unknown error, please check GetResult().';
|
| 22 |
-
$type = '';
|
| 23 |
-
|
| 24 |
-
if ( isset( $result['error'] ) && is_array( $result['error'] ) ) {
|
| 25 |
-
if ( isset( $result['error']['code'] ) ) {
|
| 26 |
-
$code = $result['error']['code'];
|
| 27 |
-
}
|
| 28 |
-
if ( isset( $result['error']['message'] ) ) {
|
| 29 |
-
$message = $result['error']['message'];
|
| 30 |
-
}
|
| 31 |
-
if ( isset( $result['error']['type'] ) ) {
|
| 32 |
-
$type = $result['error']['type'];
|
| 33 |
-
}
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
$this->_type = $type;
|
| 37 |
-
$this->_code = $code;
|
| 38 |
-
|
| 39 |
-
parent::__construct( $message, is_numeric( $code ) ? $code : 0 );
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
/**
|
| 43 |
-
* Return the associated result object returned by the API server.
|
| 44 |
-
*
|
| 45 |
-
* @return array The result from the API server
|
| 46 |
-
*/
|
| 47 |
-
public function getResult() {
|
| 48 |
-
return $this->_result;
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function getStringCode() {
|
| 52 |
-
return $this->_code;
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
public function getType() {
|
| 56 |
-
return $this->_type;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* To make debugging easier.
|
| 61 |
-
*
|
| 62 |
-
* @return string The string representation of the error
|
| 63 |
-
*/
|
| 64 |
-
public function __toString() {
|
| 65 |
-
$str = $this->getType() . ': ';
|
| 66 |
-
|
| 67 |
-
if ( $this->code != 0 ) {
|
| 68 |
-
$str .= $this->getStringCode() . ': ';
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
return $str . $this->getMessage();
|
| 72 |
-
}
|
| 73 |
-
}
|
| 74 |
}
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
+
/**
|
| 4 |
+
* Thrown when an API call returns an exception.
|
| 5 |
+
*
|
| 6 |
+
*/
|
| 7 |
+
class Freemius_Exception extends Exception {
|
| 8 |
+
protected $_result;
|
| 9 |
+
protected $_type;
|
| 10 |
+
protected $_code;
|
| 11 |
+
|
| 12 |
+
/**
|
| 13 |
+
* Make a new API Exception with the given result.
|
| 14 |
+
*
|
| 15 |
+
* @param array $result The result from the API server.
|
| 16 |
+
*/
|
| 17 |
+
public function __construct( $result ) {
|
| 18 |
+
$this->_result = $result;
|
| 19 |
+
|
| 20 |
+
$code = 0;
|
| 21 |
+
$message = 'Unknown error, please check GetResult().';
|
| 22 |
+
$type = '';
|
| 23 |
+
|
| 24 |
+
if ( isset( $result['error'] ) && is_array( $result['error'] ) ) {
|
| 25 |
+
if ( isset( $result['error']['code'] ) ) {
|
| 26 |
+
$code = $result['error']['code'];
|
| 27 |
+
}
|
| 28 |
+
if ( isset( $result['error']['message'] ) ) {
|
| 29 |
+
$message = $result['error']['message'];
|
| 30 |
+
}
|
| 31 |
+
if ( isset( $result['error']['type'] ) ) {
|
| 32 |
+
$type = $result['error']['type'];
|
| 33 |
+
}
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
$this->_type = $type;
|
| 37 |
+
$this->_code = $code;
|
| 38 |
+
|
| 39 |
+
parent::__construct( $message, is_numeric( $code ) ? $code : 0 );
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* Return the associated result object returned by the API server.
|
| 44 |
+
*
|
| 45 |
+
* @return array The result from the API server
|
| 46 |
+
*/
|
| 47 |
+
public function getResult() {
|
| 48 |
+
return $this->_result;
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
public function getStringCode() {
|
| 52 |
+
return $this->_code;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
public function getType() {
|
| 56 |
+
return $this->_type;
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
/**
|
| 60 |
+
* To make debugging easier.
|
| 61 |
+
*
|
| 62 |
+
* @return string The string representation of the error
|
| 63 |
+
*/
|
| 64 |
+
public function __toString() {
|
| 65 |
+
$str = $this->getType() . ': ';
|
| 66 |
+
|
| 67 |
+
if ( $this->code != 0 ) {
|
| 68 |
+
$str .= $this->getStringCode() . ': ';
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
return $str . $this->getMessage();
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
}
|
freemius/includes/sdk/Exceptions/InvalidArgumentException.php
CHANGED
|
@@ -1,8 +1,8 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 7 |
-
class Freemius_InvalidArgumentException extends Freemius_Exception { }
|
| 8 |
}
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
+
exit;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( ! class_exists( 'Freemius_InvalidArgumentException' ) ) {
|
| 7 |
+
class Freemius_InvalidArgumentException extends Freemius_Exception { }
|
| 8 |
}
|
freemius/includes/sdk/Exceptions/OAuthException.php
CHANGED
|
@@ -1,12 +1,12 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
-
exit;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
if ( ! class_exists( 'Freemius_OAuthException' ) ) {
|
| 7 |
-
class Freemius_OAuthException extends Freemius_Exception {
|
| 8 |
-
public function __construct( $pResult ) {
|
| 9 |
-
parent::__construct( $pResult );
|
| 10 |
-
}
|
| 11 |
-
}
|
| 12 |
}
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! class_exists( 'Freemius_Exception' ) ) {
|
| 3 |
+
exit;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( ! class_exists( 'Freemius_OAuthException' ) ) {
|
| 7 |
+
class Freemius_OAuthException extends Freemius_Exception {
|
| 8 |
+
public function __construct( $pResult ) {
|
| 9 |
+
parent::__construct( $pResult );
|
| 10 |
+
}
|
| 11 |
+
}
|
| 12 |
}
|
freemius/includes/sdk/Freemius.php
CHANGED
|
@@ -1,583 +1,583 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Copyright 2014 Freemius, Inc.
|
| 4 |
-
*
|
| 5 |
-
* Licensed under the GPL v2 (the "License"); you may
|
| 6 |
-
* not use this file except in compliance with the License. You may obtain
|
| 7 |
-
* a copy of the License at
|
| 8 |
-
*
|
| 9 |
-
* http://choosealicense.com/licenses/gpl-v2/
|
| 10 |
-
*
|
| 11 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 12 |
-
* distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
|
| 13 |
-
* WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
|
| 14 |
-
* License for the specific language governing permissions and limitations
|
| 15 |
-
* under the License.
|
| 16 |
-
*/
|
| 17 |
-
|
| 18 |
-
require_once dirname( __FILE__ ) . '/FreemiusBase.php';
|
| 19 |
-
|
| 20 |
-
if ( ! defined( 'FS_SDK__USER_AGENT' ) ) {
|
| 21 |
-
define( 'FS_SDK__USER_AGENT', 'fs-php-' . Freemius_Api_Base::VERSION );
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
if ( ! defined( 'FS_SDK__SIMULATE_NO_CURL' ) ) {
|
| 25 |
-
define( 'FS_SDK__SIMULATE_NO_CURL', false );
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
if ( ! defined( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE' ) ) {
|
| 29 |
-
define( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE', false );
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
if ( ! defined( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL' ) ) {
|
| 33 |
-
define( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL', false );
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
if ( ! defined( 'FS_SDK__HAS_CURL' ) ) {
|
| 37 |
-
define( 'FS_SDK__HAS_CURL', ! FS_SDK__SIMULATE_NO_CURL && function_exists( 'curl_version' ) );
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
if ( ! FS_SDK__HAS_CURL ) {
|
| 41 |
-
$curl_version = array( 'version' => '7.0.0' );
|
| 42 |
-
} else {
|
| 43 |
-
$curl_version = curl_version();
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
if ( ! defined( 'FS_API__PROTOCOL' ) ) {
|
| 47 |
-
define( 'FS_API__PROTOCOL', version_compare( $curl_version['version'], '7.37', '>=' ) ? 'https' : 'http' );
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
if ( ! defined( 'FS_API__LOGGER_ON' ) ) {
|
| 51 |
-
define( 'FS_API__LOGGER_ON', false );
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
if ( ! defined( 'FS_API__ADDRESS' ) ) {
|
| 55 |
-
define( 'FS_API__ADDRESS', '://api.freemius.com' );
|
| 56 |
-
}
|
| 57 |
-
if ( ! defined( 'FS_API__SANDBOX_ADDRESS' ) ) {
|
| 58 |
-
define( 'FS_API__SANDBOX_ADDRESS', '://sandbox-api.freemius.com' );
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
if ( class_exists( 'Freemius_Api' ) ) {
|
| 62 |
-
return;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
class Freemius_Api extends Freemius_Api_Base {
|
| 66 |
-
private static $_logger = array();
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* @param string $pScope 'app', 'developer', 'user' or 'install'.
|
| 70 |
-
* @param number $pID Element's id.
|
| 71 |
-
* @param string $pPublic Public key.
|
| 72 |
-
* @param string|bool $pSecret Element's secret key.
|
| 73 |
-
* @param bool $pSandbox Whether or not to run API in sandbox mode.
|
| 74 |
-
*/
|
| 75 |
-
public function __construct( $pScope, $pID, $pPublic, $pSecret = false, $pSandbox = false ) {
|
| 76 |
-
// If secret key not provided, use public key encryption.
|
| 77 |
-
if ( is_bool( $pSecret ) ) {
|
| 78 |
-
$pSecret = $pPublic;
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
parent::Init( $pScope, $pID, $pPublic, $pSecret, $pSandbox );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public static function GetUrl( $pCanonizedPath = '', $pIsSandbox = false ) {
|
| 85 |
-
$address = ( $pIsSandbox ? FS_API__SANDBOX_ADDRESS : FS_API__ADDRESS );
|
| 86 |
-
|
| 87 |
-
if ( ':' === $address[0] ) {
|
| 88 |
-
$address = self::$_protocol . $address;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
return $address . $pCanonizedPath;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
#region Servers Clock Diff ------------------------------------------------------
|
| 95 |
-
|
| 96 |
-
/**
|
| 97 |
-
* @var int Clock diff in seconds between current server to API server.
|
| 98 |
-
*/
|
| 99 |
-
private static $_clock_diff = 0;
|
| 100 |
-
|
| 101 |
-
/**
|
| 102 |
-
* Set clock diff for all API calls.
|
| 103 |
-
*
|
| 104 |
-
* @since 1.0.3
|
| 105 |
-
*
|
| 106 |
-
* @param $pSeconds
|
| 107 |
-
*/
|
| 108 |
-
public static function SetClockDiff( $pSeconds ) {
|
| 109 |
-
self::$_clock_diff = $pSeconds;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
/**
|
| 113 |
-
* Find clock diff between current server to API server.
|
| 114 |
-
*
|
| 115 |
-
* @since 1.0.2
|
| 116 |
-
* @return int Clock diff in seconds.
|
| 117 |
-
*/
|
| 118 |
-
public static function FindClockDiff() {
|
| 119 |
-
$time = time();
|
| 120 |
-
$pong = self::Ping();
|
| 121 |
-
|
| 122 |
-
return ( $time - strtotime( $pong->timestamp ) );
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
#endregion Servers Clock Diff ------------------------------------------------------
|
| 126 |
-
|
| 127 |
-
/**
|
| 128 |
-
* @var string http or https
|
| 129 |
-
*/
|
| 130 |
-
private static $_protocol = FS_API__PROTOCOL;
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* Set API connection protocol.
|
| 134 |
-
*
|
| 135 |
-
* @since 1.0.4
|
| 136 |
-
*/
|
| 137 |
-
public static function SetHttp() {
|
| 138 |
-
self::$_protocol = 'http';
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
/**
|
| 142 |
-
* @since 1.0.4
|
| 143 |
-
*
|
| 144 |
-
* @return bool
|
| 145 |
-
*/
|
| 146 |
-
public static function IsHttps() {
|
| 147 |
-
return ( 'https' === self::$_protocol );
|
| 148 |
-
}
|
| 149 |
-
|
| 150 |
-
/**
|
| 151 |
-
* Sign request with the following HTTP headers:
|
| 152 |
-
* Content-MD5: MD5(HTTP Request body)
|
| 153 |
-
* Date: Current date (i.e Sat, 14 Feb 2015 20:24:46 +0000)
|
| 154 |
-
* Authorization: FS {scope_entity_id}:{scope_entity_public_key}:base64encode(sha256(string_to_sign,
|
| 155 |
-
* {scope_entity_secret_key}))
|
| 156 |
-
*
|
| 157 |
-
* @param string $pResourceUrl
|
| 158 |
-
* @param array $pCurlOptions
|
| 159 |
-
*
|
| 160 |
-
* @return array
|
| 161 |
-
*/
|
| 162 |
-
function SignRequest( $pResourceUrl, $pCurlOptions ) {
|
| 163 |
-
$eol = "\n";
|
| 164 |
-
$content_md5 = '';
|
| 165 |
-
$now = ( time() - self::$_clock_diff );
|
| 166 |
-
$date = date( 'r', $now );
|
| 167 |
-
$content_type = '';
|
| 168 |
-
|
| 169 |
-
if ( isset( $pCurlOptions[ CURLOPT_POST ] ) && 0 < $pCurlOptions[ CURLOPT_POST ] ) {
|
| 170 |
-
$content_md5 = md5( $pCurlOptions[ CURLOPT_POSTFIELDS ] );
|
| 171 |
-
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Content-MD5: ' . $content_md5;
|
| 172 |
-
$content_type = 'application/json';
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Date: ' . $date;
|
| 176 |
-
|
| 177 |
-
$string_to_sign = implode( $eol, array(
|
| 178 |
-
$pCurlOptions[ CURLOPT_CUSTOMREQUEST ],
|
| 179 |
-
$content_md5,
|
| 180 |
-
$content_type,
|
| 181 |
-
$date,
|
| 182 |
-
$pResourceUrl
|
| 183 |
-
) );
|
| 184 |
-
|
| 185 |
-
// If secret and public keys are identical, it means that
|
| 186 |
-
// the signature uses public key hash encoding.
|
| 187 |
-
$auth_type = ( $this->_secret !== $this->_public ) ? 'FS' : 'FSP';
|
| 188 |
-
|
| 189 |
-
// Add authorization header.
|
| 190 |
-
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Authorization: ' .
|
| 191 |
-
$auth_type . ' ' .
|
| 192 |
-
$this->_id . ':' .
|
| 193 |
-
$this->_public . ':' .
|
| 194 |
-
self::Base64UrlEncode(
|
| 195 |
-
hash_hmac( 'sha256', $string_to_sign, $this->_secret )
|
| 196 |
-
);
|
| 197 |
-
|
| 198 |
-
return $pCurlOptions;
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
/**
|
| 202 |
-
* Get API request URL signed via query string.
|
| 203 |
-
*
|
| 204 |
-
* @param string $pPath
|
| 205 |
-
*
|
| 206 |
-
* @throws Freemius_Exception
|
| 207 |
-
*
|
| 208 |
-
* @return string
|
| 209 |
-
*/
|
| 210 |
-
function GetSignedUrl( $pPath ) {
|
| 211 |
-
$resource = explode( '?', $this->CanonizePath( $pPath ) );
|
| 212 |
-
$pResourceUrl = $resource[0];
|
| 213 |
-
|
| 214 |
-
$eol = "\n";
|
| 215 |
-
$content_md5 = '';
|
| 216 |
-
$content_type = '';
|
| 217 |
-
$now = ( time() - self::$_clock_diff );
|
| 218 |
-
$date = date( 'r', $now );
|
| 219 |
-
|
| 220 |
-
$string_to_sign = implode( $eol, array(
|
| 221 |
-
'GET',
|
| 222 |
-
$content_md5,
|
| 223 |
-
$content_type,
|
| 224 |
-
$date,
|
| 225 |
-
$pResourceUrl
|
| 226 |
-
) );
|
| 227 |
-
|
| 228 |
-
// If secret and public keys are identical, it means that
|
| 229 |
-
// the signature uses public key hash encoding.
|
| 230 |
-
$auth_type = ( $this->_secret !== $this->_public ) ? 'FS' : 'FSP';
|
| 231 |
-
|
| 232 |
-
return Freemius_Api::GetUrl(
|
| 233 |
-
$pResourceUrl . '?' .
|
| 234 |
-
( 1 < count( $resource ) && ! empty( $resource[1] ) ? $resource[1] . '&' : '' ) .
|
| 235 |
-
http_build_query( array(
|
| 236 |
-
'auth_date' => $date,
|
| 237 |
-
'authorization' => $auth_type . ' ' . $this->_id . ':' .
|
| 238 |
-
$this->_public . ':' .
|
| 239 |
-
self::Base64UrlEncode( hash_hmac(
|
| 240 |
-
'sha256', $string_to_sign, $this->_secret
|
| 241 |
-
) )
|
| 242 |
-
) ), $this->_isSandbox );
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
/**
|
| 246 |
-
* @param resource $pCurlHandler
|
| 247 |
-
* @param array $pCurlOptions
|
| 248 |
-
*
|
| 249 |
-
* @return mixed
|
| 250 |
-
*/
|
| 251 |
-
private static function ExecuteRequest( &$pCurlHandler, &$pCurlOptions ) {
|
| 252 |
-
$start = microtime( true );
|
| 253 |
-
|
| 254 |
-
$result = curl_exec( $pCurlHandler );
|
| 255 |
-
|
| 256 |
-
if ( FS_API__LOGGER_ON ) {
|
| 257 |
-
$end = microtime( true );
|
| 258 |
-
|
| 259 |
-
$has_body = ( isset( $pCurlOptions[ CURLOPT_POST ] ) && 0 < $pCurlOptions[ CURLOPT_POST ] );
|
| 260 |
-
|
| 261 |
-
self::$_logger[] = array(
|
| 262 |
-
'id' => count( self::$_logger ),
|
| 263 |
-
'start' => $start,
|
| 264 |
-
'end' => $end,
|
| 265 |
-
'total' => ( $end - $start ),
|
| 266 |
-
'method' => $pCurlOptions[ CURLOPT_CUSTOMREQUEST ],
|
| 267 |
-
'path' => $pCurlOptions[ CURLOPT_URL ],
|
| 268 |
-
'body' => $has_body ? $pCurlOptions[ CURLOPT_POSTFIELDS ] : null,
|
| 269 |
-
'result' => $result,
|
| 270 |
-
'code' => curl_getinfo( $pCurlHandler, CURLINFO_HTTP_CODE ),
|
| 271 |
-
'backtrace' => debug_backtrace(),
|
| 272 |
-
);
|
| 273 |
-
}
|
| 274 |
-
|
| 275 |
-
return $result;
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
-
/**
|
| 279 |
-
* @return array
|
| 280 |
-
*/
|
| 281 |
-
static function GetLogger() {
|
| 282 |
-
return self::$_logger;
|
| 283 |
-
}
|
| 284 |
-
|
| 285 |
-
/**
|
| 286 |
-
* @param string $pCanonizedPath
|
| 287 |
-
* @param string $pMethod
|
| 288 |
-
* @param array $pParams
|
| 289 |
-
* @param null|resource $pCurlHandler
|
| 290 |
-
* @param bool $pIsSandbox
|
| 291 |
-
* @param null|callable $pBeforeExecutionFunction
|
| 292 |
-
*
|
| 293 |
-
* @return object[]|object|null
|
| 294 |
-
*
|
| 295 |
-
* @throws \Freemius_Exception
|
| 296 |
-
*/
|
| 297 |
-
private static function MakeStaticRequest(
|
| 298 |
-
$pCanonizedPath,
|
| 299 |
-
$pMethod = 'GET',
|
| 300 |
-
$pParams = array(),
|
| 301 |
-
$pCurlHandler = null,
|
| 302 |
-
$pIsSandbox = false,
|
| 303 |
-
$pBeforeExecutionFunction = null
|
| 304 |
-
) {
|
| 305 |
-
if ( ! FS_SDK__HAS_CURL ) {
|
| 306 |
-
self::ThrowNoCurlException();
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
// Connectivity errors simulation.
|
| 310 |
-
if ( FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE ) {
|
| 311 |
-
self::ThrowCloudFlareDDoSException();
|
| 312 |
-
} else if ( FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL ) {
|
| 313 |
-
self::ThrowSquidAclException();
|
| 314 |
-
}
|
| 315 |
-
|
| 316 |
-
if ( ! $pCurlHandler ) {
|
| 317 |
-
$pCurlHandler = curl_init();
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
$opts = array(
|
| 321 |
-
CURLOPT_CONNECTTIMEOUT => 10,
|
| 322 |
-
CURLOPT_RETURNTRANSFER => true,
|
| 323 |
-
CURLOPT_TIMEOUT => 60,
|
| 324 |
-
CURLOPT_USERAGENT => FS_SDK__USER_AGENT,
|
| 325 |
-
CURLOPT_HTTPHEADER => array(),
|
| 326 |
-
);
|
| 327 |
-
|
| 328 |
-
if ( 'POST' === $pMethod || 'PUT' === $pMethod ) {
|
| 329 |
-
if ( is_array( $pParams ) && 0 < count( $pParams ) ) {
|
| 330 |
-
$opts[ CURLOPT_HTTPHEADER ][] = 'Content-Type: application/json';
|
| 331 |
-
$opts[ CURLOPT_POST ] = count( $pParams );
|
| 332 |
-
$opts[ CURLOPT_POSTFIELDS ] = json_encode( $pParams );
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
$opts[ CURLOPT_RETURNTRANSFER ] = true;
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
$request_url = self::GetUrl( $pCanonizedPath, $pIsSandbox );
|
| 339 |
-
|
| 340 |
-
$opts[ CURLOPT_URL ] = $request_url;
|
| 341 |
-
$opts[ CURLOPT_CUSTOMREQUEST ] = $pMethod;
|
| 342 |
-
|
| 343 |
-
$resource = explode( '?', $pCanonizedPath );
|
| 344 |
-
|
| 345 |
-
// disable the 'Expect: 100-continue' behaviour. This causes CURL to wait
|
| 346 |
-
// for 2 seconds if the server does not support this header.
|
| 347 |
-
$opts[ CURLOPT_HTTPHEADER ][] = 'Expect:';
|
| 348 |
-
|
| 349 |
-
if ( 'https' === substr( strtolower( $request_url ), 0, 5 ) ) {
|
| 350 |
-
$opts[ CURLOPT_SSL_VERIFYHOST ] = false;
|
| 351 |
-
$opts[ CURLOPT_SSL_VERIFYPEER ] = false;
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
if ( false !== $pBeforeExecutionFunction &&
|
| 355 |
-
is_callable( $pBeforeExecutionFunction )
|
| 356 |
-
) {
|
| 357 |
-
$opts = call_user_func( $pBeforeExecutionFunction, $resource[0], $opts );
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
curl_setopt_array( $pCurlHandler, $opts );
|
| 361 |
-
$result = self::ExecuteRequest( $pCurlHandler, $opts );
|
| 362 |
-
|
| 363 |
-
/*if (curl_errno($ch) == 60) // CURLE_SSL_CACERT
|
| 364 |
-
{
|
| 365 |
-
self::errorLog('Invalid or no certificate authority found, using bundled information');
|
| 366 |
-
curl_setopt($ch, CURLOPT_CAINFO,
|
| 367 |
-
dirname(__FILE__) . '/fb_ca_chain_bundle.crt');
|
| 368 |
-
$result = curl_exec($ch);
|
| 369 |
-
}*/
|
| 370 |
-
|
| 371 |
-
// With dual stacked DNS responses, it's possible for a server to
|
| 372 |
-
// have IPv6 enabled but not have IPv6 connectivity. If this is
|
| 373 |
-
// the case, curl will try IPv4 first and if that fails, then it will
|
| 374 |
-
// fall back to IPv6 and the error EHOSTUNREACH is returned by the
|
| 375 |
-
// operating system.
|
| 376 |
-
if ( false === $result && empty( $opts[ CURLOPT_IPRESOLVE ] ) ) {
|
| 377 |
-
$matches = array();
|
| 378 |
-
$regex = '/Failed to connect to ([^:].*): Network is unreachable/';
|
| 379 |
-
if ( preg_match( $regex, curl_error( $pCurlHandler ), $matches ) ) {
|
| 380 |
-
if ( strlen( @inet_pton( $matches[1] ) ) === 16 ) {
|
| 381 |
-
// self::errorLog('Invalid IPv6 configuration on server, Please disable or get native IPv6 on your server.');
|
| 382 |
-
$opts[ CURLOPT_IPRESOLVE ] = CURL_IPRESOLVE_V4;
|
| 383 |
-
curl_setopt( $pCurlHandler, CURLOPT_IPRESOLVE, CURL_IPRESOLVE_V4 );
|
| 384 |
-
$result = self::ExecuteRequest( $pCurlHandler, $opts );
|
| 385 |
-
}
|
| 386 |
-
}
|
| 387 |
-
}
|
| 388 |
-
|
| 389 |
-
if ( $result === false ) {
|
| 390 |
-
self::ThrowCurlException( $pCurlHandler );
|
| 391 |
-
}
|
| 392 |
-
|
| 393 |
-
curl_close( $pCurlHandler );
|
| 394 |
-
|
| 395 |
-
if ( empty( $result ) ) {
|
| 396 |
-
return null;
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
$decoded = json_decode( $result );
|
| 400 |
-
|
| 401 |
-
if ( is_null( $decoded ) ) {
|
| 402 |
-
if ( preg_match( '/Please turn JavaScript on/i', $result ) &&
|
| 403 |
-
preg_match( '/text\/javascript/', $result )
|
| 404 |
-
) {
|
| 405 |
-
self::ThrowCloudFlareDDoSException( $result );
|
| 406 |
-
} else if ( preg_match( '/Access control configuration prevents your request from being allowed at this time. Please contact your service provider if you feel this is incorrect./', $result ) &&
|
| 407 |
-
preg_match( '/squid/', $result )
|
| 408 |
-
) {
|
| 409 |
-
self::ThrowSquidAclException( $result );
|
| 410 |
-
} else {
|
| 411 |
-
$decoded = (object) array(
|
| 412 |
-
'error' => (object) array(
|
| 413 |
-
'type' => 'Unknown',
|
| 414 |
-
'message' => $result,
|
| 415 |
-
'code' => 'unknown',
|
| 416 |
-
'http' => 402
|
| 417 |
-
)
|
| 418 |
-
);
|
| 419 |
-
}
|
| 420 |
-
}
|
| 421 |
-
|
| 422 |
-
return $decoded;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
|
| 426 |
-
/**
|
| 427 |
-
* Makes an HTTP request. This method can be overridden by subclasses if
|
| 428 |
-
* developers want to do fancier things or use something other than curl to
|
| 429 |
-
* make the request.
|
| 430 |
-
*
|
| 431 |
-
* @param string $pCanonizedPath The URL to make the request to
|
| 432 |
-
* @param string $pMethod HTTP method
|
| 433 |
-
* @param array $pParams The parameters to use for the POST body
|
| 434 |
-
* @param null|resource $pCurlHandler Initialized curl handle
|
| 435 |
-
*
|
| 436 |
-
* @return object[]|object|null
|
| 437 |
-
*
|
| 438 |
-
* @throws Freemius_Exception
|
| 439 |
-
*/
|
| 440 |
-
public function MakeRequest(
|
| 441 |
-
$pCanonizedPath,
|
| 442 |
-
$pMethod = 'GET',
|
| 443 |
-
$pParams = array(),
|
| 444 |
-
$pCurlHandler = null
|
| 445 |
-
) {
|
| 446 |
-
$resource = explode( '?', $pCanonizedPath );
|
| 447 |
-
|
| 448 |
-
// Only sign request if not ping.json connectivity test.
|
| 449 |
-
$sign_request = ( '/v1/ping.json' !== strtolower( substr( $resource[0], - strlen( '/v1/ping.json' ) ) ) );
|
| 450 |
-
|
| 451 |
-
return self::MakeStaticRequest(
|
| 452 |
-
$pCanonizedPath,
|
| 453 |
-
$pMethod,
|
| 454 |
-
$pParams,
|
| 455 |
-
$pCurlHandler,
|
| 456 |
-
$this->_isSandbox,
|
| 457 |
-
$sign_request ? array( &$this, 'SignRequest' ) : null
|
| 458 |
-
);
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
#region Connectivity Test ------------------------------------------------------
|
| 462 |
-
|
| 463 |
-
/**
|
| 464 |
-
* If successful connectivity to the API endpoint using ping.json endpoint.
|
| 465 |
-
*
|
| 466 |
-
* - OR -
|
| 467 |
-
*
|
| 468 |
-
* Validate if ping result object is valid.
|
| 469 |
-
*
|
| 470 |
-
* @param mixed $pPong
|
| 471 |
-
*
|
| 472 |
-
* @return bool
|
| 473 |
-
*/
|
| 474 |
-
public static function Test( $pPong = null ) {
|
| 475 |
-
$pong = is_null( $pPong ) ?
|
| 476 |
-
self::Ping() :
|
| 477 |
-
$pPong;
|
| 478 |
-
|
| 479 |
-
return (
|
| 480 |
-
is_object( $pong ) &&
|
| 481 |
-
isset( $pong->api ) &&
|
| 482 |
-
'pong' === $pong->api
|
| 483 |
-
);
|
| 484 |
-
}
|
| 485 |
-
|
| 486 |
-
/**
|
| 487 |
-
* Ping API to test connectivity.
|
| 488 |
-
*
|
| 489 |
-
* @return object
|
| 490 |
-
*/
|
| 491 |
-
public static function Ping() {
|
| 492 |
-
try {
|
| 493 |
-
$result = self::MakeStaticRequest( '/v' . FS_API__VERSION . '/ping.json' );
|
| 494 |
-
} catch ( Freemius_Exception $e ) {
|
| 495 |
-
// Map to error object.
|
| 496 |
-
$result = (object) $e->getResult();
|
| 497 |
-
} catch ( Exception $e ) {
|
| 498 |
-
// Map to error object.
|
| 499 |
-
$result = (object) array(
|
| 500 |
-
'error' => array(
|
| 501 |
-
'type' => 'Unknown',
|
| 502 |
-
'message' => $e->getMessage() . ' (' . $e->getFile() . ': ' . $e->getLine() . ')',
|
| 503 |
-
'code' => 'unknown',
|
| 504 |
-
'http' => 402
|
| 505 |
-
)
|
| 506 |
-
);
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
return $result;
|
| 510 |
-
}
|
| 511 |
-
|
| 512 |
-
#endregion Connectivity Test ------------------------------------------------------
|
| 513 |
-
|
| 514 |
-
#region Connectivity Exceptions ------------------------------------------------------
|
| 515 |
-
|
| 516 |
-
/**
|
| 517 |
-
* @param resource $pCurlHandler
|
| 518 |
-
*
|
| 519 |
-
* @throws Freemius_Exception
|
| 520 |
-
*/
|
| 521 |
-
private static function ThrowCurlException( $pCurlHandler ) {
|
| 522 |
-
$e = new Freemius_Exception( array(
|
| 523 |
-
'error' => array(
|
| 524 |
-
'code' => curl_errno( $pCurlHandler ),
|
| 525 |
-
'message' => curl_error( $pCurlHandler ),
|
| 526 |
-
'type' => 'CurlException',
|
| 527 |
-
),
|
| 528 |
-
) );
|
| 529 |
-
|
| 530 |
-
curl_close( $pCurlHandler );
|
| 531 |
-
throw $e;
|
| 532 |
-
}
|
| 533 |
-
|
| 534 |
-
/**
|
| 535 |
-
* @param string $pResult
|
| 536 |
-
*
|
| 537 |
-
* @throws Freemius_Exception
|
| 538 |
-
*/
|
| 539 |
-
private static function ThrowNoCurlException( $pResult = '' ) {
|
| 540 |
-
throw new Freemius_Exception( array(
|
| 541 |
-
'error' => (object) array(
|
| 542 |
-
'type' => 'cUrlMissing',
|
| 543 |
-
'message' => $pResult,
|
| 544 |
-
'code' => 'curl_missing',
|
| 545 |
-
'http' => 402
|
| 546 |
-
)
|
| 547 |
-
) );
|
| 548 |
-
}
|
| 549 |
-
|
| 550 |
-
/**
|
| 551 |
-
* @param string $pResult
|
| 552 |
-
*
|
| 553 |
-
* @throws Freemius_Exception
|
| 554 |
-
*/
|
| 555 |
-
private static function ThrowCloudFlareDDoSException( $pResult = '' ) {
|
| 556 |
-
throw new Freemius_Exception( array(
|
| 557 |
-
'error' => (object) array(
|
| 558 |
-
'type' => 'CloudFlareDDoSProtection',
|
| 559 |
-
'message' => $pResult,
|
| 560 |
-
'code' => 'cloudflare_ddos_protection',
|
| 561 |
-
'http' => 402
|
| 562 |
-
)
|
| 563 |
-
) );
|
| 564 |
-
}
|
| 565 |
-
|
| 566 |
-
/**
|
| 567 |
-
* @param string $pResult
|
| 568 |
-
*
|
| 569 |
-
* @throws Freemius_Exception
|
| 570 |
-
*/
|
| 571 |
-
private static function ThrowSquidAclException( $pResult = '' ) {
|
| 572 |
-
throw new Freemius_Exception( array(
|
| 573 |
-
'error' => (object) array(
|
| 574 |
-
'type' => 'SquidCacheBlock',
|
| 575 |
-
'message' => $pResult,
|
| 576 |
-
'code' => 'squid_cache_block',
|
| 577 |
-
'http' => 402
|
| 578 |
-
)
|
| 579 |
-
) );
|
| 580 |
-
}
|
| 581 |
-
|
| 582 |
-
#endregion Connectivity Exceptions ------------------------------------------------------
|
| 583 |
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Copyright 2014 Freemius, Inc.
|
| 4 |
+
*
|
| 5 |
+
* Licensed under the GPL v2 (the "License"); you may
|
| 6 |
+
* not use this file except in compliance with the License. You may obtain
|
| 7 |
+
* a copy of the License at
|
| 8 |
+
*
|
| 9 |
+
* http://choosealicense.com/licenses/gpl-v2/
|
| 10 |
+
*
|
| 11 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 12 |
+
* distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
|
| 13 |
+
* WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
|
| 14 |
+
* License for the specific language governing permissions and limitations
|
| 15 |
+
* under the License.
|
| 16 |
+
*/
|
| 17 |
+
|
| 18 |
+
require_once dirname( __FILE__ ) . '/FreemiusBase.php';
|
| 19 |
+
|
| 20 |
+
if ( ! defined( 'FS_SDK__USER_AGENT' ) ) {
|
| 21 |
+
define( 'FS_SDK__USER_AGENT', 'fs-php-' . Freemius_Api_Base::VERSION );
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
if ( ! defined( 'FS_SDK__SIMULATE_NO_CURL' ) ) {
|
| 25 |
+
define( 'FS_SDK__SIMULATE_NO_CURL', false );
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
if ( ! defined( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE' ) ) {
|
| 29 |
+
define( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE', false );
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
if ( ! defined( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL' ) ) {
|
| 33 |
+
define( 'FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL', false );
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
if ( ! defined( 'FS_SDK__HAS_CURL' ) ) {
|
| 37 |
+
define( 'FS_SDK__HAS_CURL', ! FS_SDK__SIMULATE_NO_CURL && function_exists( 'curl_version' ) );
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
if ( ! FS_SDK__HAS_CURL ) {
|
| 41 |
+
$curl_version = array( 'version' => '7.0.0' );
|
| 42 |
+
} else {
|
| 43 |
+
$curl_version = curl_version();
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if ( ! defined( 'FS_API__PROTOCOL' ) ) {
|
| 47 |
+
define( 'FS_API__PROTOCOL', version_compare( $curl_version['version'], '7.37', '>=' ) ? 'https' : 'http' );
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
if ( ! defined( 'FS_API__LOGGER_ON' ) ) {
|
| 51 |
+
define( 'FS_API__LOGGER_ON', false );
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
if ( ! defined( 'FS_API__ADDRESS' ) ) {
|
| 55 |
+
define( 'FS_API__ADDRESS', '://api.freemius.com' );
|
| 56 |
+
}
|
| 57 |
+
if ( ! defined( 'FS_API__SANDBOX_ADDRESS' ) ) {
|
| 58 |
+
define( 'FS_API__SANDBOX_ADDRESS', '://sandbox-api.freemius.com' );
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
if ( class_exists( 'Freemius_Api' ) ) {
|
| 62 |
+
return;
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
class Freemius_Api extends Freemius_Api_Base {
|
| 66 |
+
private static $_logger = array();
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* @param string $pScope 'app', 'developer', 'user' or 'install'.
|
| 70 |
+
* @param number $pID Element's id.
|
| 71 |
+
* @param string $pPublic Public key.
|
| 72 |
+
* @param string|bool $pSecret Element's secret key.
|
| 73 |
+
* @param bool $pSandbox Whether or not to run API in sandbox mode.
|
| 74 |
+
*/
|
| 75 |
+
public function __construct( $pScope, $pID, $pPublic, $pSecret = false, $pSandbox = false ) {
|
| 76 |
+
// If secret key not provided, use public key encryption.
|
| 77 |
+
if ( is_bool( $pSecret ) ) {
|
| 78 |
+
$pSecret = $pPublic;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
parent::Init( $pScope, $pID, $pPublic, $pSecret, $pSandbox );
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
public static function GetUrl( $pCanonizedPath = '', $pIsSandbox = false ) {
|
| 85 |
+
$address = ( $pIsSandbox ? FS_API__SANDBOX_ADDRESS : FS_API__ADDRESS );
|
| 86 |
+
|
| 87 |
+
if ( ':' === $address[0] ) {
|
| 88 |
+
$address = self::$_protocol . $address;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
return $address . $pCanonizedPath;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
#region Servers Clock Diff ------------------------------------------------------
|
| 95 |
+
|
| 96 |
+
/**
|
| 97 |
+
* @var int Clock diff in seconds between current server to API server.
|
| 98 |
+
*/
|
| 99 |
+
private static $_clock_diff = 0;
|
| 100 |
+
|
| 101 |
+
/**
|
| 102 |
+
* Set clock diff for all API calls.
|
| 103 |
+
*
|
| 104 |
+
* @since 1.0.3
|
| 105 |
+
*
|
| 106 |
+
* @param $pSeconds
|
| 107 |
+
*/
|
| 108 |
+
public static function SetClockDiff( $pSeconds ) {
|
| 109 |
+
self::$_clock_diff = $pSeconds;
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
/**
|
| 113 |
+
* Find clock diff between current server to API server.
|
| 114 |
+
*
|
| 115 |
+
* @since 1.0.2
|
| 116 |
+
* @return int Clock diff in seconds.
|
| 117 |
+
*/
|
| 118 |
+
public static function FindClockDiff() {
|
| 119 |
+
$time = time();
|
| 120 |
+
$pong = self::Ping();
|
| 121 |
+
|
| 122 |
+
return ( $time - strtotime( $pong->timestamp ) );
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
#endregion Servers Clock Diff ------------------------------------------------------
|
| 126 |
+
|
| 127 |
+
/**
|
| 128 |
+
* @var string http or https
|
| 129 |
+
*/
|
| 130 |
+
private static $_protocol = FS_API__PROTOCOL;
|
| 131 |
+
|
| 132 |
+
/**
|
| 133 |
+
* Set API connection protocol.
|
| 134 |
+
*
|
| 135 |
+
* @since 1.0.4
|
| 136 |
+
*/
|
| 137 |
+
public static function SetHttp() {
|
| 138 |
+
self::$_protocol = 'http';
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
/**
|
| 142 |
+
* @since 1.0.4
|
| 143 |
+
*
|
| 144 |
+
* @return bool
|
| 145 |
+
*/
|
| 146 |
+
public static function IsHttps() {
|
| 147 |
+
return ( 'https' === self::$_protocol );
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
/**
|
| 151 |
+
* Sign request with the following HTTP headers:
|
| 152 |
+
* Content-MD5: MD5(HTTP Request body)
|
| 153 |
+
* Date: Current date (i.e Sat, 14 Feb 2015 20:24:46 +0000)
|
| 154 |
+
* Authorization: FS {scope_entity_id}:{scope_entity_public_key}:base64encode(sha256(string_to_sign,
|
| 155 |
+
* {scope_entity_secret_key}))
|
| 156 |
+
*
|
| 157 |
+
* @param string $pResourceUrl
|
| 158 |
+
* @param array $pCurlOptions
|
| 159 |
+
*
|
| 160 |
+
* @return array
|
| 161 |
+
*/
|
| 162 |
+
function SignRequest( $pResourceUrl, $pCurlOptions ) {
|
| 163 |
+
$eol = "\n";
|
| 164 |
+
$content_md5 = '';
|
| 165 |
+
$now = ( time() - self::$_clock_diff );
|
| 166 |
+
$date = date( 'r', $now );
|
| 167 |
+
$content_type = '';
|
| 168 |
+
|
| 169 |
+
if ( isset( $pCurlOptions[ CURLOPT_POST ] ) && 0 < $pCurlOptions[ CURLOPT_POST ] ) {
|
| 170 |
+
$content_md5 = md5( $pCurlOptions[ CURLOPT_POSTFIELDS ] );
|
| 171 |
+
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Content-MD5: ' . $content_md5;
|
| 172 |
+
$content_type = 'application/json';
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Date: ' . $date;
|
| 176 |
+
|
| 177 |
+
$string_to_sign = implode( $eol, array(
|
| 178 |
+
$pCurlOptions[ CURLOPT_CUSTOMREQUEST ],
|
| 179 |
+
$content_md5,
|
| 180 |
+
$content_type,
|
| 181 |
+
$date,
|
| 182 |
+
$pResourceUrl
|
| 183 |
+
) );
|
| 184 |
+
|
| 185 |
+
// If secret and public keys are identical, it means that
|
| 186 |
+
// the signature uses public key hash encoding.
|
| 187 |
+
$auth_type = ( $this->_secret !== $this->_public ) ? 'FS' : 'FSP';
|
| 188 |
+
|
| 189 |
+
// Add authorization header.
|
| 190 |
+
$pCurlOptions[ CURLOPT_HTTPHEADER ][] = 'Authorization: ' .
|
| 191 |
+
$auth_type . ' ' .
|
| 192 |
+
$this->_id . ':' .
|
| 193 |
+
$this->_public . ':' .
|
| 194 |
+
self::Base64UrlEncode(
|
| 195 |
+
hash_hmac( 'sha256', $string_to_sign, $this->_secret )
|
| 196 |
+
);
|
| 197 |
+
|
| 198 |
+
return $pCurlOptions;
|
| 199 |
+
}
|
| 200 |
+
|
| 201 |
+
/**
|
| 202 |
+
* Get API request URL signed via query string.
|
| 203 |
+
*
|
| 204 |
+
* @param string $pPath
|
| 205 |
+
*
|
| 206 |
+
* @throws Freemius_Exception
|
| 207 |
+
*
|
| 208 |
+
* @return string
|
| 209 |
+
*/
|
| 210 |
+
function GetSignedUrl( $pPath ) {
|
| 211 |
+
$resource = explode( '?', $this->CanonizePath( $pPath ) );
|
| 212 |
+
$pResourceUrl = $resource[0];
|
| 213 |
+
|
| 214 |
+
$eol = "\n";
|
| 215 |
+
$content_md5 = '';
|
| 216 |
+
$content_type = '';
|
| 217 |
+
$now = ( time() - self::$_clock_diff );
|
| 218 |
+
$date = date( 'r', $now );
|
| 219 |
+
|
| 220 |
+
$string_to_sign = implode( $eol, array(
|
| 221 |
+
'GET',
|
| 222 |
+
$content_md5,
|
| 223 |
+
$content_type,
|
| 224 |
+
$date,
|
| 225 |
+
$pResourceUrl
|
| 226 |
+
) );
|
| 227 |
+
|
| 228 |
+
// If secret and public keys are identical, it means that
|
| 229 |
+
// the signature uses public key hash encoding.
|
| 230 |
+
$auth_type = ( $this->_secret !== $this->_public ) ? 'FS' : 'FSP';
|
| 231 |
+
|
| 232 |
+
return Freemius_Api::GetUrl(
|
| 233 |
+
$pResourceUrl . '?' .
|
| 234 |
+
( 1 < count( $resource ) && ! empty( $resource[1] ) ? $resource[1] . '&' : '' ) .
|
| 235 |
+
http_build_query( array(
|
| 236 |
+
'auth_date' => $date,
|
| 237 |
+
'authorization' => $auth_type . ' ' . $this->_id . ':' .
|
| 238 |
+
$this->_public . ':' .
|
| 239 |
+
self::Base64UrlEncode( hash_hmac(
|
| 240 |
+
'sha256', $string_to_sign, $this->_secret
|
| 241 |
+
) )
|
| 242 |
+
) ), $this->_isSandbox );
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
/**
|
| 246 |
+
* @param resource $pCurlHandler
|
| 247 |
+
* @param array $pCurlOptions
|
| 248 |
+
*
|
| 249 |
+
* @return mixed
|
| 250 |
+
*/
|
| 251 |
+
private static function ExecuteRequest( &$pCurlHandler, &$pCurlOptions ) {
|
| 252 |
+
$start = microtime( true );
|
| 253 |
+
|
| 254 |
+
$result = curl_exec( $pCurlHandler );
|
| 255 |
+
|
| 256 |
+
if ( FS_API__LOGGER_ON ) {
|
| 257 |
+
$end = microtime( true );
|
| 258 |
+
|
| 259 |
+
$has_body = ( isset( $pCurlOptions[ CURLOPT_POST ] ) && 0 < $pCurlOptions[ CURLOPT_POST ] );
|
| 260 |
+
|
| 261 |
+
self::$_logger[] = array(
|
| 262 |
+
'id' => count( self::$_logger ),
|
| 263 |
+
'start' => $start,
|
| 264 |
+
'end' => $end,
|
| 265 |
+
'total' => ( $end - $start ),
|
| 266 |
+
'method' => $pCurlOptions[ CURLOPT_CUSTOMREQUEST ],
|
| 267 |
+
'path' => $pCurlOptions[ CURLOPT_URL ],
|
| 268 |
+
'body' => $has_body ? $pCurlOptions[ CURLOPT_POSTFIELDS ] : null,
|
| 269 |
+
'result' => $result,
|
| 270 |
+
'code' => curl_getinfo( $pCurlHandler, CURLINFO_HTTP_CODE ),
|
| 271 |
+
'backtrace' => debug_backtrace(),
|
| 272 |
+
);
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
+
return $result;
|
| 276 |
+
}
|
| 277 |
+
|
| 278 |
+
/**
|
| 279 |
+
* @return array
|
| 280 |
+
*/
|
| 281 |
+
static function GetLogger() {
|
| 282 |
+
return self::$_logger;
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
/**
|
| 286 |
+
* @param string $pCanonizedPath
|
| 287 |
+
* @param string $pMethod
|
| 288 |
+
* @param array $pParams
|
| 289 |
+
* @param null|resource $pCurlHandler
|
| 290 |
+
* @param bool $pIsSandbox
|
| 291 |
+
* @param null|callable $pBeforeExecutionFunction
|
| 292 |
+
*
|
| 293 |
+
* @return object[]|object|null
|
| 294 |
+
*
|
| 295 |
+
* @throws \Freemius_Exception
|
| 296 |
+
*/
|
| 297 |
+
private static function MakeStaticRequest(
|
| 298 |
+
$pCanonizedPath,
|
| 299 |
+
$pMethod = 'GET',
|
| 300 |
+
$pParams = array(),
|
| 301 |
+
$pCurlHandler = null,
|
| 302 |
+
$pIsSandbox = false,
|
| 303 |
+
$pBeforeExecutionFunction = null
|
| 304 |
+
) {
|
| 305 |
+
if ( ! FS_SDK__HAS_CURL ) {
|
| 306 |
+
self::ThrowNoCurlException();
|
| 307 |
+
}
|
| 308 |
+
|
| 309 |
+
// Connectivity errors simulation.
|
| 310 |
+
if ( FS_SDK__SIMULATE_NO_API_CONNECTIVITY_CLOUDFLARE ) {
|
| 311 |
+
self::ThrowCloudFlareDDoSException();
|
| 312 |
+
} else if ( FS_SDK__SIMULATE_NO_API_CONNECTIVITY_SQUID_ACL ) {
|
| 313 |
+
self::ThrowSquidAclException();
|
| 314 |
+
}
|
| 315 |
+
|
| 316 |
+
if ( ! $pCurlHandler ) {
|
| 317 |
+
$pCurlHandler = curl_init();
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
$opts = array(
|
| 321 |
+
CURLOPT_CONNECTTIMEOUT => 10,
|
| 322 |
+
CURLOPT_RETURNTRANSFER => true,
|
| 323 |
+
CURLOPT_TIMEOUT => 60,
|
| 324 |
+
CURLOPT_USERAGENT => FS_SDK__USER_AGENT,
|
| 325 |
+
CURLOPT_HTTPHEADER => array(),
|
| 326 |
+
);
|
| 327 |
+
|
| 328 |
+
if ( 'POST' === $pMethod || 'PUT' === $pMethod ) {
|
| 329 |
+
if ( is_array( $pParams ) && 0 < count( $pParams ) ) {
|
| 330 |
+
$opts[ CURLOPT_HTTPHEADER ][] = 'Content-Type: application/json';
|
| 331 |
+
$opts[ CURLOPT_POST ] = count( $pParams );
|
| 332 |
+
$opts[ CURLOPT_POSTFIELDS ] = json_encode( $pParams );
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
$opts[ CURLOPT_RETURNTRANSFER ] = true;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
$request_url = self::GetUrl( $pCanonizedPath, $pIsSandbox );
|
| 339 |
+
|
| 340 |
+
$opts[ CURLOPT_URL ] = $request_url;
|
| 341 |
+
$opts[ CURLOPT_CUSTOMREQUEST ] = $pMethod;
|
| 342 |
+
|
| 343 |
+
$resource = explode( '?', $pCanonizedPath );
|
| 344 |
+
|
| 345 |
+
// disable the 'Expect: 100-continue' behaviour. This causes CURL to wait
|
| 346 |
+
// for 2 seconds if the server does not support this header.
|
| 347 |
+
$opts[ CURLOPT_HTTPHEADER ][] = 'Expect:';
|
| 348 |
+
|
| 349 |
+
if ( 'https' === substr( strtolower( $request_url ), 0, 5 ) ) {
|
| 350 |
+
$opts[ CURLOPT_SSL_VERIFYHOST ] = false;
|
| 351 |
+
$opts[ CURLOPT_SSL_VERIFYPEER ] = false;
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
if ( false !== $pBeforeExecutionFunction &&
|
| 355 |
+
is_callable( $pBeforeExecutionFunction )
|
| 356 |
+
) {
|
| 357 |
+
$opts = call_user_func( $pBeforeExecutionFunction, $resource[0], $opts );
|
| 358 |
+
}
|
| 359 |
+
|
| 360 |
+
curl_setopt_array( $pCurlHandler, $opts );
|
| 361 |
+
$result = self::ExecuteRequest( $pCurlHandler, $opts );
|
| 362 |
+
|
| 363 |
+
/*if (curl_errno($ch) == 60) // CURLE_SSL_CACERT
|
| 364 |
+
{
|
| 365 |
+
self::errorLog('Invalid or no certificate authority found, using bundled information');
|
| 366 |
+
curl_setopt($ch, CURLOPT_CAINFO,
|
| 367 |
+
dirname(__FILE__) . '/fb_ca_chain_bundle.crt');
|
| 368 |
+
$result = curl_exec($ch);
|
| 369 |
+
}*/
|
| 370 |
+
|
| 371 |
+
// With dual stacked DNS responses, it's possible for a server to
|
| 372 |
+
// have IPv6 enabled but not have IPv6 connectivity. If this is
|
| 373 |
+
// the case, curl will try IPv4 first and if that fails, then it will
|
| 374 |
+
// fall back to IPv6 and the error EHOSTUNREACH is returned by the
|
| 375 |
+
// operating system.
|
| 376 |
+
if ( false === $result && empty( $opts[ CURLOPT_IPRESOLVE ] ) ) {
|
| 377 |
+
$matches = array();
|
| 378 |
+
$regex = '/Failed to connect to ([^:].*): Network is unreachable/';
|
| 379 |
+
if ( preg_match( $regex, curl_error( $pCurlHandler ), $matches ) ) {
|
| 380 |
+
if ( strlen( @inet_pton( $matches[1] ) ) === 16 ) {
|
| 381 |
+
// self::errorLog('Invalid IPv6 configuration on server, Please disable or get native IPv6 on your server.');
|
| 382 |
+
$opts[ CURLOPT_IPRESOLVE ] = CURL_IPRESOLVE_V4;
|
| 383 |
+
curl_setopt( $pCurlHandler, CURLOPT_IPRESOLVE, CURL_IPRESOLVE_V4 );
|
| 384 |
+
$result = self::ExecuteRequest( $pCurlHandler, $opts );
|
| 385 |
+
}
|
| 386 |
+
}
|
| 387 |
+
}
|
| 388 |
+
|
| 389 |
+
if ( $result === false ) {
|
| 390 |
+
self::ThrowCurlException( $pCurlHandler );
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
curl_close( $pCurlHandler );
|
| 394 |
+
|
| 395 |
+
if ( empty( $result ) ) {
|
| 396 |
+
return null;
|
| 397 |
+
}
|
| 398 |
+
|
| 399 |
+
$decoded = json_decode( $result );
|
| 400 |
+
|
| 401 |
+
if ( is_null( $decoded ) ) {
|
| 402 |
+
if ( preg_match( '/Please turn JavaScript on/i', $result ) &&
|
| 403 |
+
preg_match( '/text\/javascript/', $result )
|
| 404 |
+
) {
|
| 405 |
+
self::ThrowCloudFlareDDoSException( $result );
|
| 406 |
+
} else if ( preg_match( '/Access control configuration prevents your request from being allowed at this time. Please contact your service provider if you feel this is incorrect./', $result ) &&
|
| 407 |
+
preg_match( '/squid/', $result )
|
| 408 |
+
) {
|
| 409 |
+
self::ThrowSquidAclException( $result );
|
| 410 |
+
} else {
|
| 411 |
+
$decoded = (object) array(
|
| 412 |
+
'error' => (object) array(
|
| 413 |
+
'type' => 'Unknown',
|
| 414 |
+
'message' => $result,
|
| 415 |
+
'code' => 'unknown',
|
| 416 |
+
'http' => 402
|
| 417 |
+
)
|
| 418 |
+
);
|
| 419 |
+
}
|
| 420 |
+
}
|
| 421 |
+
|
| 422 |
+
return $decoded;
|
| 423 |
+
}
|
| 424 |
+
|
| 425 |
+
|
| 426 |
+
/**
|
| 427 |
+
* Makes an HTTP request. This method can be overridden by subclasses if
|
| 428 |
+
* developers want to do fancier things or use something other than curl to
|
| 429 |
+
* make the request.
|
| 430 |
+
*
|
| 431 |
+
* @param string $pCanonizedPath The URL to make the request to
|
| 432 |
+
* @param string $pMethod HTTP method
|
| 433 |
+
* @param array $pParams The parameters to use for the POST body
|
| 434 |
+
* @param null|resource $pCurlHandler Initialized curl handle
|
| 435 |
+
*
|
| 436 |
+
* @return object[]|object|null
|
| 437 |
+
*
|
| 438 |
+
* @throws Freemius_Exception
|
| 439 |
+
*/
|
| 440 |
+
public function MakeRequest(
|
| 441 |
+
$pCanonizedPath,
|
| 442 |
+
$pMethod = 'GET',
|
| 443 |
+
$pParams = array(),
|
| 444 |
+
$pCurlHandler = null
|
| 445 |
+
) {
|
| 446 |
+
$resource = explode( '?', $pCanonizedPath );
|
| 447 |
+
|
| 448 |
+
// Only sign request if not ping.json connectivity test.
|
| 449 |
+
$sign_request = ( '/v1/ping.json' !== strtolower( substr( $resource[0], - strlen( '/v1/ping.json' ) ) ) );
|
| 450 |
+
|
| 451 |
+
return self::MakeStaticRequest(
|
| 452 |
+
$pCanonizedPath,
|
| 453 |
+
$pMethod,
|
| 454 |
+
$pParams,
|
| 455 |
+
$pCurlHandler,
|
| 456 |
+
$this->_isSandbox,
|
| 457 |
+
$sign_request ? array( &$this, 'SignRequest' ) : null
|
| 458 |
+
);
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
#region Connectivity Test ------------------------------------------------------
|
| 462 |
+
|
| 463 |
+
/**
|
| 464 |
+
* If successful connectivity to the API endpoint using ping.json endpoint.
|
| 465 |
+
*
|
| 466 |
+
* - OR -
|
| 467 |
+
*
|
| 468 |
+
* Validate if ping result object is valid.
|
| 469 |
+
*
|
| 470 |
+
* @param mixed $pPong
|
| 471 |
+
*
|
| 472 |
+
* @return bool
|
| 473 |
+
*/
|
| 474 |
+
public static function Test( $pPong = null ) {
|
| 475 |
+
$pong = is_null( $pPong ) ?
|
| 476 |
+
self::Ping() :
|
| 477 |
+
$pPong;
|
| 478 |
+
|
| 479 |
+
return (
|
| 480 |
+
is_object( $pong ) &&
|
| 481 |
+
isset( $pong->api ) &&
|
| 482 |
+
'pong' === $pong->api
|
| 483 |
+
);
|
| 484 |
+
}
|
| 485 |
+
|
| 486 |
+
/**
|
| 487 |
+
* Ping API to test connectivity.
|
| 488 |
+
*
|
| 489 |
+
* @return object
|
| 490 |
+
*/
|
| 491 |
+
public static function Ping() {
|
| 492 |
+
try {
|
| 493 |
+
$result = self::MakeStaticRequest( '/v' . FS_API__VERSION . '/ping.json' );
|
| 494 |
+
} catch ( Freemius_Exception $e ) {
|
| 495 |
+
// Map to error object.
|
| 496 |
+
$result = (object) $e->getResult();
|
| 497 |
+
} catch ( Exception $e ) {
|
| 498 |
+
// Map to error object.
|
| 499 |
+
$result = (object) array(
|
| 500 |
+
'error' => array(
|
| 501 |
+
'type' => 'Unknown',
|
| 502 |
+
'message' => $e->getMessage() . ' (' . $e->getFile() . ': ' . $e->getLine() . ')',
|
| 503 |
+
'code' => 'unknown',
|
| 504 |
+
'http' => 402
|
| 505 |
+
)
|
| 506 |
+
);
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
return $result;
|
| 510 |
+
}
|
| 511 |
+
|
| 512 |
+
#endregion Connectivity Test ------------------------------------------------------
|
| 513 |
+
|
| 514 |
+
#region Connectivity Exceptions ------------------------------------------------------
|
| 515 |
+
|
| 516 |
+
/**
|
| 517 |
+
* @param resource $pCurlHandler
|
| 518 |
+
*
|
| 519 |
+
* @throws Freemius_Exception
|
| 520 |
+
*/
|
| 521 |
+
private static function ThrowCurlException( $pCurlHandler ) {
|
| 522 |
+
$e = new Freemius_Exception( array(
|
| 523 |
+
'error' => array(
|
| 524 |
+
'code' => curl_errno( $pCurlHandler ),
|
| 525 |
+
'message' => curl_error( $pCurlHandler ),
|
| 526 |
+
'type' => 'CurlException',
|
| 527 |
+
),
|
| 528 |
+
) );
|
| 529 |
+
|
| 530 |
+
curl_close( $pCurlHandler );
|
| 531 |
+
throw $e;
|
| 532 |
+
}
|
| 533 |
+
|
| 534 |
+
/**
|
| 535 |
+
* @param string $pResult
|
| 536 |
+
*
|
| 537 |
+
* @throws Freemius_Exception
|
| 538 |
+
*/
|
| 539 |
+
private static function ThrowNoCurlException( $pResult = '' ) {
|
| 540 |
+
throw new Freemius_Exception( array(
|
| 541 |
+
'error' => (object) array(
|
| 542 |
+
'type' => 'cUrlMissing',
|
| 543 |
+
'message' => $pResult,
|
| 544 |
+
'code' => 'curl_missing',
|
| 545 |
+
'http' => 402
|
| 546 |
+
)
|
| 547 |
+
) );
|
| 548 |
+
}
|
| 549 |
+
|
| 550 |
+
/**
|
| 551 |
+
* @param string $pResult
|
| 552 |
+
*
|
| 553 |
+
* @throws Freemius_Exception
|
| 554 |
+
*/
|
| 555 |
+
private static function ThrowCloudFlareDDoSException( $pResult = '' ) {
|
| 556 |
+
throw new Freemius_Exception( array(
|
| 557 |
+
'error' => (object) array(
|
| 558 |
+
'type' => 'CloudFlareDDoSProtection',
|
| 559 |
+
'message' => $pResult,
|
| 560 |
+
'code' => 'cloudflare_ddos_protection',
|
| 561 |
+
'http' => 402
|
| 562 |
+
)
|
| 563 |
+
) );
|
| 564 |
+
}
|
| 565 |
+
|
| 566 |
+
/**
|
| 567 |
+
* @param string $pResult
|
| 568 |
+
*
|
| 569 |
+
* @throws Freemius_Exception
|
| 570 |
+
*/
|
| 571 |
+
private static function ThrowSquidAclException( $pResult = '' ) {
|
| 572 |
+
throw new Freemius_Exception( array(
|
| 573 |
+
'error' => (object) array(
|
| 574 |
+
'type' => 'SquidCacheBlock',
|
| 575 |
+
'message' => $pResult,
|
| 576 |
+
'code' => 'squid_cache_block',
|
| 577 |
+
'http' => 402
|
| 578 |
+
)
|
| 579 |
+
) );
|
| 580 |
+
}
|
| 581 |
+
|
| 582 |
+
#endregion Connectivity Exceptions ------------------------------------------------------
|
| 583 |
}
|
freemius/includes/sdk/FreemiusBase.php
CHANGED
|
@@ -1,188 +1,188 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Copyright 2014 Freemius, Inc.
|
| 4 |
-
*
|
| 5 |
-
* Licensed under the GPL v2 (the "License"); you may
|
| 6 |
-
* not use this file except in compliance with the License. You may obtain
|
| 7 |
-
* a copy of the License at
|
| 8 |
-
*
|
| 9 |
-
* http://choosealicense.com/licenses/gpl-v2/
|
| 10 |
-
*
|
| 11 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 12 |
-
* distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
|
| 13 |
-
* WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
|
| 14 |
-
* License for the specific language governing permissions and limitations
|
| 15 |
-
* under the License.
|
| 16 |
-
*/
|
| 17 |
-
|
| 18 |
-
if ( ! defined( 'FS_API__VERSION' ) ) {
|
| 19 |
-
define( 'FS_API__VERSION', '1' );
|
| 20 |
-
}
|
| 21 |
-
if ( ! defined( 'FS_SDK__PATH' ) ) {
|
| 22 |
-
define( 'FS_SDK__PATH', dirname( __FILE__ ) );
|
| 23 |
-
}
|
| 24 |
-
if ( ! defined( 'FS_SDK__EXCEPTIONS_PATH' ) ) {
|
| 25 |
-
define( 'FS_SDK__EXCEPTIONS_PATH', FS_SDK__PATH . '/Exceptions/' );
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
if ( ! function_exists( 'json_decode' ) ) {
|
| 29 |
-
throw new Exception( 'Freemius needs the JSON PHP extension.' );
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
// Include all exception files.
|
| 33 |
-
$exceptions = array(
|
| 34 |
-
'Exception',
|
| 35 |
-
'InvalidArgumentException',
|
| 36 |
-
'ArgumentNotExistException',
|
| 37 |
-
'EmptyArgumentException',
|
| 38 |
-
'OAuthException'
|
| 39 |
-
);
|
| 40 |
-
|
| 41 |
-
foreach ( $exceptions as $e ) {
|
| 42 |
-
require_once FS_SDK__EXCEPTIONS_PATH . $e . '.php';
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
if ( class_exists( 'Freemius_Api_Base' ) ) {
|
| 46 |
-
return;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
abstract class Freemius_Api_Base {
|
| 50 |
-
const VERSION = '1.0.4';
|
| 51 |
-
const FORMAT = 'json';
|
| 52 |
-
|
| 53 |
-
protected $_id;
|
| 54 |
-
protected $_public;
|
| 55 |
-
protected $_secret;
|
| 56 |
-
protected $_scope;
|
| 57 |
-
protected $_isSandbox;
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* @param string $pScope 'app', 'developer', 'plugin', 'user' or 'install'.
|
| 61 |
-
* @param number $pID Element's id.
|
| 62 |
-
* @param string $pPublic Public key.
|
| 63 |
-
* @param string $pSecret Element's secret key.
|
| 64 |
-
* @param bool $pIsSandbox Whether or not to run API in sandbox mode.
|
| 65 |
-
*/
|
| 66 |
-
public function Init( $pScope, $pID, $pPublic, $pSecret, $pIsSandbox = false ) {
|
| 67 |
-
$this->_id = $pID;
|
| 68 |
-
$this->_public = $pPublic;
|
| 69 |
-
$this->_secret = $pSecret;
|
| 70 |
-
$this->_scope = $pScope;
|
| 71 |
-
$this->_isSandbox = $pIsSandbox;
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public function IsSandbox() {
|
| 75 |
-
return $this->_isSandbox;
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
function CanonizePath( $pPath ) {
|
| 79 |
-
$pPath = trim( $pPath, '/' );
|
| 80 |
-
$query_pos = strpos( $pPath, '?' );
|
| 81 |
-
$query = '';
|
| 82 |
-
|
| 83 |
-
if ( false !== $query_pos ) {
|
| 84 |
-
$query = substr( $pPath, $query_pos );
|
| 85 |
-
$pPath = substr( $pPath, 0, $query_pos );
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
// Trim '.json' suffix.
|
| 89 |
-
$format_length = strlen( '.' . self::FORMAT );
|
| 90 |
-
$start = $format_length * ( - 1 ); //negative
|
| 91 |
-
if ( substr( strtolower( $pPath ), $start ) === ( '.' . self::FORMAT ) ) {
|
| 92 |
-
$pPath = substr( $pPath, 0, strlen( $pPath ) - $format_length );
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
switch ( $this->_scope ) {
|
| 96 |
-
case 'app':
|
| 97 |
-
$base = '/apps/' . $this->_id;
|
| 98 |
-
break;
|
| 99 |
-
case 'developer':
|
| 100 |
-
$base = '/developers/' . $this->_id;
|
| 101 |
-
break;
|
| 102 |
-
case 'user':
|
| 103 |
-
$base = '/users/' . $this->_id;
|
| 104 |
-
break;
|
| 105 |
-
case 'plugin':
|
| 106 |
-
$base = '/plugins/' . $this->_id;
|
| 107 |
-
break;
|
| 108 |
-
case 'install':
|
| 109 |
-
$base = '/installs/' . $this->_id;
|
| 110 |
-
break;
|
| 111 |
-
default:
|
| 112 |
-
throw new Freemius_Exception( 'Scope not implemented.' );
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
return '/v' . FS_API__VERSION . $base .
|
| 116 |
-
( ! empty( $pPath ) ? '/' : '' ) . $pPath .
|
| 117 |
-
( ( false === strpos( $pPath, '.' ) ) ? '.' . self::FORMAT : '' ) . $query;
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
abstract function MakeRequest( $pCanonizedPath, $pMethod = 'GET', $pParams = array() );
|
| 121 |
-
|
| 122 |
-
/**
|
| 123 |
-
* @param string $pPath
|
| 124 |
-
* @param string $pMethod
|
| 125 |
-
* @param array $pParams
|
| 126 |
-
*
|
| 127 |
-
* @return object[]|object|null
|
| 128 |
-
*/
|
| 129 |
-
private function _Api( $pPath, $pMethod = 'GET', $pParams = array() ) {
|
| 130 |
-
$pMethod = strtoupper( $pMethod );
|
| 131 |
-
|
| 132 |
-
try {
|
| 133 |
-
$result = $this->MakeRequest( $pPath, $pMethod, $pParams );
|
| 134 |
-
} catch ( Freemius_Exception $e ) {
|
| 135 |
-
// Map to error object.
|
| 136 |
-
$result = (object) $e->getResult();
|
| 137 |
-
} catch ( Exception $e ) {
|
| 138 |
-
// Map to error object.
|
| 139 |
-
$result = (object) array(
|
| 140 |
-
'error' => array(
|
| 141 |
-
'type' => 'Unknown',
|
| 142 |
-
'message' => $e->getMessage() . ' (' . $e->getFile() . ': ' . $e->getLine() . ')',
|
| 143 |
-
'code' => 'unknown',
|
| 144 |
-
'http' => 402
|
| 145 |
-
)
|
| 146 |
-
);
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
return $result;
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
public function Api( $pPath, $pMethod = 'GET', $pParams = array() ) {
|
| 153 |
-
return $this->_Api( $this->CanonizePath( $pPath ), $pMethod, $pParams );
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Base64 encoding that does not need to be urlencode()ed.
|
| 158 |
-
* Exactly the same as base64_encode except it uses
|
| 159 |
-
* - instead of +
|
| 160 |
-
* _ instead of /
|
| 161 |
-
* No padded =
|
| 162 |
-
*
|
| 163 |
-
* @param string $input base64UrlEncoded string
|
| 164 |
-
*
|
| 165 |
-
* @return string
|
| 166 |
-
*/
|
| 167 |
-
protected static function Base64UrlDecode( $input ) {
|
| 168 |
-
return base64_decode( strtr( $input, '-_', '+/' ) );
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
/**
|
| 172 |
-
* Base64 encoding that does not need to be urlencode()ed.
|
| 173 |
-
* Exactly the same as base64_encode except it uses
|
| 174 |
-
* - instead of +
|
| 175 |
-
* _ instead of /
|
| 176 |
-
*
|
| 177 |
-
* @param string $input string
|
| 178 |
-
*
|
| 179 |
-
* @return string base64Url encoded string
|
| 180 |
-
*/
|
| 181 |
-
protected static function Base64UrlEncode( $input ) {
|
| 182 |
-
$str = strtr( base64_encode( $input ), '+/', '-_' );
|
| 183 |
-
$str = str_replace( '=', '', $str );
|
| 184 |
-
|
| 185 |
-
return $str;
|
| 186 |
-
}
|
| 187 |
-
|
| 188 |
-
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Copyright 2014 Freemius, Inc.
|
| 4 |
+
*
|
| 5 |
+
* Licensed under the GPL v2 (the "License"); you may
|
| 6 |
+
* not use this file except in compliance with the License. You may obtain
|
| 7 |
+
* a copy of the License at
|
| 8 |
+
*
|
| 9 |
+
* http://choosealicense.com/licenses/gpl-v2/
|
| 10 |
+
*
|
| 11 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 12 |
+
* distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
|
| 13 |
+
* WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
|
| 14 |
+
* License for the specific language governing permissions and limitations
|
| 15 |
+
* under the License.
|
| 16 |
+
*/
|
| 17 |
+
|
| 18 |
+
if ( ! defined( 'FS_API__VERSION' ) ) {
|
| 19 |
+
define( 'FS_API__VERSION', '1' );
|
| 20 |
+
}
|
| 21 |
+
if ( ! defined( 'FS_SDK__PATH' ) ) {
|
| 22 |
+
define( 'FS_SDK__PATH', dirname( __FILE__ ) );
|
| 23 |
+
}
|
| 24 |
+
if ( ! defined( 'FS_SDK__EXCEPTIONS_PATH' ) ) {
|
| 25 |
+
define( 'FS_SDK__EXCEPTIONS_PATH', FS_SDK__PATH . '/Exceptions/' );
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
if ( ! function_exists( 'json_decode' ) ) {
|
| 29 |
+
throw new Exception( 'Freemius needs the JSON PHP extension.' );
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
// Include all exception files.
|
| 33 |
+
$exceptions = array(
|
| 34 |
+
'Exception',
|
| 35 |
+
'InvalidArgumentException',
|
| 36 |
+
'ArgumentNotExistException',
|
| 37 |
+
'EmptyArgumentException',
|
| 38 |
+
'OAuthException'
|
| 39 |
+
);
|
| 40 |
+
|
| 41 |
+
foreach ( $exceptions as $e ) {
|
| 42 |
+
require_once FS_SDK__EXCEPTIONS_PATH . $e . '.php';
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
if ( class_exists( 'Freemius_Api_Base' ) ) {
|
| 46 |
+
return;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
abstract class Freemius_Api_Base {
|
| 50 |
+
const VERSION = '1.0.4';
|
| 51 |
+
const FORMAT = 'json';
|
| 52 |
+
|
| 53 |
+
protected $_id;
|
| 54 |
+
protected $_public;
|
| 55 |
+
protected $_secret;
|
| 56 |
+
protected $_scope;
|
| 57 |
+
protected $_isSandbox;
|
| 58 |
+
|
| 59 |
+
/**
|
| 60 |
+
* @param string $pScope 'app', 'developer', 'plugin', 'user' or 'install'.
|
| 61 |
+
* @param number $pID Element's id.
|
| 62 |
+
* @param string $pPublic Public key.
|
| 63 |
+
* @param string $pSecret Element's secret key.
|
| 64 |
+
* @param bool $pIsSandbox Whether or not to run API in sandbox mode.
|
| 65 |
+
*/
|
| 66 |
+
public function Init( $pScope, $pID, $pPublic, $pSecret, $pIsSandbox = false ) {
|
| 67 |
+
$this->_id = $pID;
|
| 68 |
+
$this->_public = $pPublic;
|
| 69 |
+
$this->_secret = $pSecret;
|
| 70 |
+
$this->_scope = $pScope;
|
| 71 |
+
$this->_isSandbox = $pIsSandbox;
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
public function IsSandbox() {
|
| 75 |
+
return $this->_isSandbox;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
function CanonizePath( $pPath ) {
|
| 79 |
+
$pPath = trim( $pPath, '/' );
|
| 80 |
+
$query_pos = strpos( $pPath, '?' );
|
| 81 |
+
$query = '';
|
| 82 |
+
|
| 83 |
+
if ( false !== $query_pos ) {
|
| 84 |
+
$query = substr( $pPath, $query_pos );
|
| 85 |
+
$pPath = substr( $pPath, 0, $query_pos );
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
// Trim '.json' suffix.
|
| 89 |
+
$format_length = strlen( '.' . self::FORMAT );
|
| 90 |
+
$start = $format_length * ( - 1 ); //negative
|
| 91 |
+
if ( substr( strtolower( $pPath ), $start ) === ( '.' . self::FORMAT ) ) {
|
| 92 |
+
$pPath = substr( $pPath, 0, strlen( $pPath ) - $format_length );
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
switch ( $this->_scope ) {
|
| 96 |
+
case 'app':
|
| 97 |
+
$base = '/apps/' . $this->_id;
|
| 98 |
+
break;
|
| 99 |
+
case 'developer':
|
| 100 |
+
$base = '/developers/' . $this->_id;
|
| 101 |
+
break;
|
| 102 |
+
case 'user':
|
| 103 |
+
$base = '/users/' . $this->_id;
|
| 104 |
+
break;
|
| 105 |
+
case 'plugin':
|
| 106 |
+
$base = '/plugins/' . $this->_id;
|
| 107 |
+
break;
|
| 108 |
+
case 'install':
|
| 109 |
+
$base = '/installs/' . $this->_id;
|
| 110 |
+
break;
|
| 111 |
+
default:
|
| 112 |
+
throw new Freemius_Exception( 'Scope not implemented.' );
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
return '/v' . FS_API__VERSION . $base .
|
| 116 |
+
( ! empty( $pPath ) ? '/' : '' ) . $pPath .
|
| 117 |
+
( ( false === strpos( $pPath, '.' ) ) ? '.' . self::FORMAT : '' ) . $query;
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
abstract function MakeRequest( $pCanonizedPath, $pMethod = 'GET', $pParams = array() );
|
| 121 |
+
|
| 122 |
+
/**
|
| 123 |
+
* @param string $pPath
|
| 124 |
+
* @param string $pMethod
|
| 125 |
+
* @param array $pParams
|
| 126 |
+
*
|
| 127 |
+
* @return object[]|object|null
|
| 128 |
+
*/
|
| 129 |
+
private function _Api( $pPath, $pMethod = 'GET', $pParams = array() ) {
|
| 130 |
+
$pMethod = strtoupper( $pMethod );
|
| 131 |
+
|
| 132 |
+
try {
|
| 133 |
+
$result = $this->MakeRequest( $pPath, $pMethod, $pParams );
|
| 134 |
+
} catch ( Freemius_Exception $e ) {
|
| 135 |
+
// Map to error object.
|
| 136 |
+
$result = (object) $e->getResult();
|
| 137 |
+
} catch ( Exception $e ) {
|
| 138 |
+
// Map to error object.
|
| 139 |
+
$result = (object) array(
|
| 140 |
+
'error' => array(
|
| 141 |
+
'type' => 'Unknown',
|
| 142 |
+
'message' => $e->getMessage() . ' (' . $e->getFile() . ': ' . $e->getLine() . ')',
|
| 143 |
+
'code' => 'unknown',
|
| 144 |
+
'http' => 402
|
| 145 |
+
)
|
| 146 |
+
);
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
return $result;
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
public function Api( $pPath, $pMethod = 'GET', $pParams = array() ) {
|
| 153 |
+
return $this->_Api( $this->CanonizePath( $pPath ), $pMethod, $pParams );
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
/**
|
| 157 |
+
* Base64 encoding that does not need to be urlencode()ed.
|
| 158 |
+
* Exactly the same as base64_encode except it uses
|
| 159 |
+
* - instead of +
|
| 160 |
+
* _ instead of /
|
| 161 |
+
* No padded =
|
| 162 |
+
*
|
| 163 |
+
* @param string $input base64UrlEncoded string
|
| 164 |
+
*
|
| 165 |
+
* @return string
|
| 166 |
+
*/
|
| 167 |
+
protected static function Base64UrlDecode( $input ) {
|
| 168 |
+
return base64_decode( strtr( $input, '-_', '+/' ) );
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
/**
|
| 172 |
+
* Base64 encoding that does not need to be urlencode()ed.
|
| 173 |
+
* Exactly the same as base64_encode except it uses
|
| 174 |
+
* - instead of +
|
| 175 |
+
* _ instead of /
|
| 176 |
+
*
|
| 177 |
+
* @param string $input string
|
| 178 |
+
*
|
| 179 |
+
* @return string base64Url encoded string
|
| 180 |
+
*/
|
| 181 |
+
protected static function Base64UrlEncode( $input ) {
|
| 182 |
+
$str = strtr( base64_encode( $input ), '+/', '-_' );
|
| 183 |
+
$str = str_replace( '=', '', $str );
|
| 184 |
+
|
| 185 |
+
return $str;
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
}
|
freemius/start.php
CHANGED
|
@@ -1,308 +1,308 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* @package Freemius
|
| 4 |
-
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
-
* @since 1.0.3
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
-
exit;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Freemius SDK Version.
|
| 15 |
-
*
|
| 16 |
-
* @var string
|
| 17 |
-
*/
|
| 18 |
-
$this_sdk_version = '1.2.1.6.1';
|
| 19 |
-
|
| 20 |
-
#region SDK Selection Logic --------------------------------------------------------------------
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Special logic added on 1.1.6 to make sure that every Freemius powered plugin
|
| 24 |
-
* will ALWAYS be loaded with the newest SDK from the active Freemius powered plugins.
|
| 25 |
-
*
|
| 26 |
-
* Since Freemius SDK is backward compatible, this will make sure that all Freemius powered
|
| 27 |
-
* plugins will run correctly.
|
| 28 |
-
*
|
| 29 |
-
* @since 1.1.6
|
| 30 |
-
*/
|
| 31 |
-
|
| 32 |
-
global $fs_active_plugins;
|
| 33 |
-
|
| 34 |
-
$this_sdk_relative_path = plugin_basename( dirname( __FILE__ ) );
|
| 35 |
-
|
| 36 |
-
if ( ! isset( $fs_active_plugins ) ) {
|
| 37 |
-
// Require SDK essentials.
|
| 38 |
-
require_once dirname( __FILE__ ) . '/includes/fs-essential-functions.php';
|
| 39 |
-
|
| 40 |
-
// Load all Freemius powered active plugins.
|
| 41 |
-
$fs_active_plugins = get_option( 'fs_active_plugins', new stdClass() );
|
| 42 |
-
|
| 43 |
-
if ( ! isset( $fs_active_plugins->plugins ) ) {
|
| 44 |
-
$fs_active_plugins->plugins = array();
|
| 45 |
-
}
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
if ( ! function_exists( 'fs_find_direct_caller_plugin_file' ) ) {
|
| 49 |
-
require_once dirname( __FILE__ ) . '/includes/supplements/fs-essential-functions-1.1.7.1.php';
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
// Update current SDK info based on the SDK path.
|
| 53 |
-
if ( ! isset( $fs_active_plugins->plugins[ $this_sdk_relative_path ] ) ||
|
| 54 |
-
$this_sdk_version != $fs_active_plugins->plugins[ $this_sdk_relative_path ]->version
|
| 55 |
-
) {
|
| 56 |
-
$fs_active_plugins->plugins[ $this_sdk_relative_path ] = (object) array(
|
| 57 |
-
'version' => $this_sdk_version,
|
| 58 |
-
'timestamp' => time(),
|
| 59 |
-
'plugin_path' => plugin_basename( fs_find_direct_caller_plugin_file( __FILE__ ) ),
|
| 60 |
-
);
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
$is_current_sdk_newest = isset( $fs_active_plugins->newest ) && ( $this_sdk_relative_path == $fs_active_plugins->newest->sdk_path );
|
| 64 |
-
|
| 65 |
-
if ( ! isset( $fs_active_plugins->newest ) ) {
|
| 66 |
-
/**
|
| 67 |
-
* This will be executed only once, for the first time a Freemius powered plugin is activated.
|
| 68 |
-
*/
|
| 69 |
-
fs_update_sdk_newest_version( $this_sdk_relative_path, $fs_active_plugins->plugins[ $this_sdk_relative_path ]->plugin_path );
|
| 70 |
-
|
| 71 |
-
$is_current_sdk_newest = true;
|
| 72 |
-
} else if ( version_compare( $fs_active_plugins->newest->version, $this_sdk_version, '<' ) ) {
|
| 73 |
-
/**
|
| 74 |
-
* Current SDK is newer than the newest stored SDK.
|
| 75 |
-
*/
|
| 76 |
-
fs_update_sdk_newest_version( $this_sdk_relative_path, $fs_active_plugins->plugins[ $this_sdk_relative_path ]->plugin_path );
|
| 77 |
-
|
| 78 |
-
if ( class_exists( 'Freemius' ) ) {
|
| 79 |
-
// Older SDK version was already loaded.
|
| 80 |
-
|
| 81 |
-
if ( ! $fs_active_plugins->newest->in_activation ) {
|
| 82 |
-
// Re-order plugins to load this plugin first.
|
| 83 |
-
fs_newest_sdk_plugin_first();
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
// Refresh page.
|
| 87 |
-
fs_redirect( $_SERVER['REQUEST_URI'] );
|
| 88 |
-
}
|
| 89 |
-
} else {
|
| 90 |
-
if ( ! function_exists( 'get_plugins' ) ) {
|
| 91 |
-
require_once ABSPATH . 'wp-admin/includes/plugin.php';
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
$is_newest_sdk_plugin_activate = is_plugin_active( $fs_active_plugins->newest->plugin_path );
|
| 95 |
-
|
| 96 |
-
if ( $is_current_sdk_newest &&
|
| 97 |
-
! $is_newest_sdk_plugin_activate &&
|
| 98 |
-
! $fs_active_plugins->newest->in_activation
|
| 99 |
-
) {
|
| 100 |
-
// If current SDK is the newest and the plugin is NOT active, it means
|
| 101 |
-
// that the current plugin in activation mode.
|
| 102 |
-
$fs_active_plugins->newest->in_activation = true;
|
| 103 |
-
update_option( 'fs_active_plugins', $fs_active_plugins );
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
$is_newest_sdk_path_valid = ( $is_newest_sdk_plugin_activate || $fs_active_plugins->newest->in_activation ) && file_exists( fs_normalize_path( WP_PLUGIN_DIR . '/' . $this_sdk_relative_path . '/start.php' ) );
|
| 107 |
-
|
| 108 |
-
if ( ! $is_newest_sdk_path_valid && ! $is_current_sdk_newest ) {
|
| 109 |
-
// Plugin with newest SDK is no longer active, or SDK was moved to a different location.
|
| 110 |
-
unset( $fs_active_plugins->plugins[ $fs_active_plugins->newest->sdk_path ] );
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
if ( ! ( $is_newest_sdk_plugin_activate || $fs_active_plugins->newest->in_activation ) ||
|
| 114 |
-
! $is_newest_sdk_path_valid ||
|
| 115 |
-
// Is newest SDK downgraded.
|
| 116 |
-
( $this_sdk_relative_path == $fs_active_plugins->newest->sdk_path &&
|
| 117 |
-
version_compare( $fs_active_plugins->newest->version, $this_sdk_version, '>' ) )
|
| 118 |
-
) {
|
| 119 |
-
/**
|
| 120 |
-
* Plugin with newest SDK is no longer active.
|
| 121 |
-
* OR
|
| 122 |
-
* The newest SDK was in the current plugin. BUT, seems like the version of
|
| 123 |
-
* the SDK was downgraded to a lower SDK.
|
| 124 |
-
*/
|
| 125 |
-
// Find the active plugin with the newest SDK version and update the newest reference.
|
| 126 |
-
fs_fallback_to_newest_active_sdk();
|
| 127 |
-
} else {
|
| 128 |
-
if ( $is_newest_sdk_plugin_activate &&
|
| 129 |
-
$this_sdk_relative_path == $fs_active_plugins->newest->sdk_path &&
|
| 130 |
-
( $fs_active_plugins->newest->in_activation ||
|
| 131 |
-
( class_exists( 'Freemius' ) && ( ! defined( 'WP_FS__SDK_VERSION' ) || version_compare( WP_FS__SDK_VERSION, $this_sdk_version, '<' ) ) )
|
| 132 |
-
)
|
| 133 |
-
|
| 134 |
-
) {
|
| 135 |
-
if ( $fs_active_plugins->newest->in_activation ) {
|
| 136 |
-
// Plugin no more in activation.
|
| 137 |
-
$fs_active_plugins->newest->in_activation = false;
|
| 138 |
-
update_option( 'fs_active_plugins', $fs_active_plugins );
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
// Reorder plugins to load plugin with newest SDK first.
|
| 142 |
-
if ( fs_newest_sdk_plugin_first() ) {
|
| 143 |
-
// Refresh page after re-order to make sure activated plugin loads newest SDK.
|
| 144 |
-
if ( class_exists( 'Freemius' ) ) {
|
| 145 |
-
fs_redirect( $_SERVER['REQUEST_URI'] );
|
| 146 |
-
}
|
| 147 |
-
}
|
| 148 |
-
}
|
| 149 |
-
}
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
if ( class_exists( 'Freemius' ) ) {
|
| 153 |
-
// SDK was already loaded.
|
| 154 |
-
return;
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
if ( version_compare( $this_sdk_version, $fs_active_plugins->newest->version, '<' ) ) {
|
| 158 |
-
$newest_sdk_starter = fs_normalize_path( WP_PLUGIN_DIR . '/' . $fs_active_plugins->newest->sdk_path . '/start.php' );
|
| 159 |
-
|
| 160 |
-
if ( file_exists( $newest_sdk_starter ) ) {
|
| 161 |
-
// Reorder plugins to load plugin with newest SDK first.
|
| 162 |
-
fs_newest_sdk_plugin_first();
|
| 163 |
-
|
| 164 |
-
// There's a newer SDK version, load it instead of the current one!
|
| 165 |
-
require_once $newest_sdk_starter;
|
| 166 |
-
|
| 167 |
-
return;
|
| 168 |
-
}
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
#endregion SDK Selection Logic --------------------------------------------------------------------
|
| 172 |
-
|
| 173 |
-
#region Hooks & Filters Collection --------------------------------------------------------------------
|
| 174 |
-
|
| 175 |
-
/**
|
| 176 |
-
* Freemius hooks (actions & filters) tags structure:
|
| 177 |
-
*
|
| 178 |
-
* fs_{filter/action_name}_{plugin_slug}
|
| 179 |
-
*
|
| 180 |
-
* --------------------------------------------------------
|
| 181 |
-
*
|
| 182 |
-
* Usage with WordPress' add_action() / add_filter():
|
| 183 |
-
*
|
| 184 |
-
* add_action('fs_{filter/action_name}_{plugin_slug}', $callable);
|
| 185 |
-
*
|
| 186 |
-
* --------------------------------------------------------
|
| 187 |
-
*
|
| 188 |
-
* Usage with Freemius' instance add_action() / add_filter():
|
| 189 |
-
*
|
| 190 |
-
* // No need to add 'fs_' prefix nor '_{plugin_slug}' suffix.
|
| 191 |
-
* my_freemius()->add_action('{action_name}', $callable);
|
| 192 |
-
*
|
| 193 |
-
* --------------------------------------------------------
|
| 194 |
-
*
|
| 195 |
-
* Freemius filters collection:
|
| 196 |
-
*
|
| 197 |
-
* fs_connect_url_{plugin_slug}
|
| 198 |
-
* fs_trial_promotion_message_{plugin_slug}
|
| 199 |
-
* fs_is_long_term_user_{plugin_slug}
|
| 200 |
-
* fs_uninstall_reasons_{plugin_slug}
|
| 201 |
-
* fs_is_plugin_update_{plugin_slug}
|
| 202 |
-
* fs_api_domains_{plugin_slug}
|
| 203 |
-
* fs_email_template_sections_{plugin_slug}
|
| 204 |
-
* fs_support_forum_submenu_{plugin_slug}
|
| 205 |
-
* fs_support_forum_url_{plugin_slug}
|
| 206 |
-
* fs_connect_message_{plugin_slug}
|
| 207 |
-
* fs_connect_message_on_update_{plugin_slug}
|
| 208 |
-
* fs_uninstall_confirmation_message_{plugin_slug}
|
| 209 |
-
* fs_pending_activation_message_{plugin_slug}
|
| 210 |
-
* fs_is_submenu_visible_{plugin_slug}
|
| 211 |
-
* fs_plugin_icon_{plugin_slug}
|
| 212 |
-
* fs_show_trial_{plugin_slug}
|
| 213 |
-
*
|
| 214 |
-
* --------------------------------------------------------
|
| 215 |
-
*
|
| 216 |
-
* Freemius actions collection:
|
| 217 |
-
*
|
| 218 |
-
* fs_after_license_loaded_{plugin_slug}
|
| 219 |
-
* fs_after_license_change_{plugin_slug}
|
| 220 |
-
* fs_after_plans_sync_{plugin_slug}
|
| 221 |
-
*
|
| 222 |
-
* fs_after_account_details_{plugin_slug}
|
| 223 |
-
* fs_after_account_user_sync_{plugin_slug}
|
| 224 |
-
* fs_after_account_plan_sync_{plugin_slug}
|
| 225 |
-
* fs_before_account_load_{plugin_slug}
|
| 226 |
-
* fs_after_account_connection_{plugin_slug}
|
| 227 |
-
* fs_account_property_edit_{plugin_slug}
|
| 228 |
-
* fs_account_email_verified_{plugin_slug}
|
| 229 |
-
* fs_account_page_load_before_departure_{plugin_slug}
|
| 230 |
-
* fs_before_account_delete_{plugin_slug}
|
| 231 |
-
* fs_after_account_delete_{plugin_slug}
|
| 232 |
-
*
|
| 233 |
-
* fs_sdk_version_update_{plugin_slug}
|
| 234 |
-
* fs_plugin_version_update_{plugin_slug}
|
| 235 |
-
*
|
| 236 |
-
* fs_initiated_{plugin_slug}
|
| 237 |
-
* fs_after_init_plugin_registered_{plugin_slug}
|
| 238 |
-
* fs_after_init_plugin_anonymous_{plugin_slug}
|
| 239 |
-
* fs_after_init_plugin_pending_activations_{plugin_slug}
|
| 240 |
-
* fs_after_init_addon_registered_{plugin_slug}
|
| 241 |
-
* fs_after_init_addon_anonymous_{plugin_slug}
|
| 242 |
-
* fs_after_init_addon_pending_activations_{plugin_slug}
|
| 243 |
-
*
|
| 244 |
-
* fs_after_premium_version_activation_{plugin_slug}
|
| 245 |
-
* fs_after_free_version_reactivation_{plugin_slug}
|
| 246 |
-
*
|
| 247 |
-
* fs_after_uninstall_{plugin_slug}
|
| 248 |
-
* fs_before_admin_menu_init_{plugin_slug}
|
| 249 |
-
*/
|
| 250 |
-
|
| 251 |
-
#endregion Hooks & Filters Collection --------------------------------------------------------------------
|
| 252 |
-
|
| 253 |
-
if ( ! class_exists( 'Freemius' ) ) {
|
| 254 |
-
|
| 255 |
-
if ( ! defined( 'WP_FS__SDK_VERSION' ) ) {
|
| 256 |
-
define( 'WP_FS__SDK_VERSION', $this_sdk_version );
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
// Load SDK files.
|
| 260 |
-
require_once dirname( __FILE__ ) . '/require.php';
|
| 261 |
-
|
| 262 |
-
/**
|
| 263 |
-
* Quick shortcut to get Freemius for specified plugin.
|
| 264 |
-
* Used by various templates.
|
| 265 |
-
*
|
| 266 |
-
* @param string $slug
|
| 267 |
-
*
|
| 268 |
-
* @return Freemius
|
| 269 |
-
*/
|
| 270 |
-
function freemius( $slug ) {
|
| 271 |
-
return Freemius::instance( $slug );
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
/**
|
| 275 |
-
* @param string $slug
|
| 276 |
-
* @param number $plugin_id
|
| 277 |
-
* @param string $public_key
|
| 278 |
-
* @param bool $is_live Is live or test plugin.
|
| 279 |
-
* @param bool $is_premium Hints freemius if running the premium plugin or not.
|
| 280 |
-
*
|
| 281 |
-
* @return Freemius
|
| 282 |
-
*
|
| 283 |
-
* @deprecated Please use fs_dynamic_init().
|
| 284 |
-
*/
|
| 285 |
-
function fs_init( $slug, $plugin_id, $public_key, $is_live = true, $is_premium = true ) {
|
| 286 |
-
$fs = Freemius::instance( $slug, true );
|
| 287 |
-
$fs->init( $plugin_id, $public_key, $is_live, $is_premium );
|
| 288 |
-
|
| 289 |
-
return $fs;
|
| 290 |
-
}
|
| 291 |
-
|
| 292 |
-
/**
|
| 293 |
-
* @param array<string,string> $module Plugin or Theme details.
|
| 294 |
-
*
|
| 295 |
-
* @return Freemius
|
| 296 |
-
* @throws Freemius_Exception
|
| 297 |
-
*/
|
| 298 |
-
function fs_dynamic_init( $module ) {
|
| 299 |
-
$fs = Freemius::instance( $module['slug'], true );
|
| 300 |
-
$fs->dynamic_init( $module );
|
| 301 |
-
|
| 302 |
-
return $fs;
|
| 303 |
-
}
|
| 304 |
-
|
| 305 |
-
function fs_dump_log() {
|
| 306 |
-
FS_Logger::dump();
|
| 307 |
-
}
|
| 308 |
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* @package Freemius
|
| 4 |
+
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
+
* @since 1.0.3
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
+
exit;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* Freemius SDK Version.
|
| 15 |
+
*
|
| 16 |
+
* @var string
|
| 17 |
+
*/
|
| 18 |
+
$this_sdk_version = '1.2.1.6.1';
|
| 19 |
+
|
| 20 |
+
#region SDK Selection Logic --------------------------------------------------------------------
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Special logic added on 1.1.6 to make sure that every Freemius powered plugin
|
| 24 |
+
* will ALWAYS be loaded with the newest SDK from the active Freemius powered plugins.
|
| 25 |
+
*
|
| 26 |
+
* Since Freemius SDK is backward compatible, this will make sure that all Freemius powered
|
| 27 |
+
* plugins will run correctly.
|
| 28 |
+
*
|
| 29 |
+
* @since 1.1.6
|
| 30 |
+
*/
|
| 31 |
+
|
| 32 |
+
global $fs_active_plugins;
|
| 33 |
+
|
| 34 |
+
$this_sdk_relative_path = plugin_basename( dirname( __FILE__ ) );
|
| 35 |
+
|
| 36 |
+
if ( ! isset( $fs_active_plugins ) ) {
|
| 37 |
+
// Require SDK essentials.
|
| 38 |
+
require_once dirname( __FILE__ ) . '/includes/fs-essential-functions.php';
|
| 39 |
+
|
| 40 |
+
// Load all Freemius powered active plugins.
|
| 41 |
+
$fs_active_plugins = get_option( 'fs_active_plugins', new stdClass() );
|
| 42 |
+
|
| 43 |
+
if ( ! isset( $fs_active_plugins->plugins ) ) {
|
| 44 |
+
$fs_active_plugins->plugins = array();
|
| 45 |
+
}
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
if ( ! function_exists( 'fs_find_direct_caller_plugin_file' ) ) {
|
| 49 |
+
require_once dirname( __FILE__ ) . '/includes/supplements/fs-essential-functions-1.1.7.1.php';
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
// Update current SDK info based on the SDK path.
|
| 53 |
+
if ( ! isset( $fs_active_plugins->plugins[ $this_sdk_relative_path ] ) ||
|
| 54 |
+
$this_sdk_version != $fs_active_plugins->plugins[ $this_sdk_relative_path ]->version
|
| 55 |
+
) {
|
| 56 |
+
$fs_active_plugins->plugins[ $this_sdk_relative_path ] = (object) array(
|
| 57 |
+
'version' => $this_sdk_version,
|
| 58 |
+
'timestamp' => time(),
|
| 59 |
+
'plugin_path' => plugin_basename( fs_find_direct_caller_plugin_file( __FILE__ ) ),
|
| 60 |
+
);
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
$is_current_sdk_newest = isset( $fs_active_plugins->newest ) && ( $this_sdk_relative_path == $fs_active_plugins->newest->sdk_path );
|
| 64 |
+
|
| 65 |
+
if ( ! isset( $fs_active_plugins->newest ) ) {
|
| 66 |
+
/**
|
| 67 |
+
* This will be executed only once, for the first time a Freemius powered plugin is activated.
|
| 68 |
+
*/
|
| 69 |
+
fs_update_sdk_newest_version( $this_sdk_relative_path, $fs_active_plugins->plugins[ $this_sdk_relative_path ]->plugin_path );
|
| 70 |
+
|
| 71 |
+
$is_current_sdk_newest = true;
|
| 72 |
+
} else if ( version_compare( $fs_active_plugins->newest->version, $this_sdk_version, '<' ) ) {
|
| 73 |
+
/**
|
| 74 |
+
* Current SDK is newer than the newest stored SDK.
|
| 75 |
+
*/
|
| 76 |
+
fs_update_sdk_newest_version( $this_sdk_relative_path, $fs_active_plugins->plugins[ $this_sdk_relative_path ]->plugin_path );
|
| 77 |
+
|
| 78 |
+
if ( class_exists( 'Freemius' ) ) {
|
| 79 |
+
// Older SDK version was already loaded.
|
| 80 |
+
|
| 81 |
+
if ( ! $fs_active_plugins->newest->in_activation ) {
|
| 82 |
+
// Re-order plugins to load this plugin first.
|
| 83 |
+
fs_newest_sdk_plugin_first();
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
// Refresh page.
|
| 87 |
+
fs_redirect( $_SERVER['REQUEST_URI'] );
|
| 88 |
+
}
|
| 89 |
+
} else {
|
| 90 |
+
if ( ! function_exists( 'get_plugins' ) ) {
|
| 91 |
+
require_once ABSPATH . 'wp-admin/includes/plugin.php';
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
$is_newest_sdk_plugin_activate = is_plugin_active( $fs_active_plugins->newest->plugin_path );
|
| 95 |
+
|
| 96 |
+
if ( $is_current_sdk_newest &&
|
| 97 |
+
! $is_newest_sdk_plugin_activate &&
|
| 98 |
+
! $fs_active_plugins->newest->in_activation
|
| 99 |
+
) {
|
| 100 |
+
// If current SDK is the newest and the plugin is NOT active, it means
|
| 101 |
+
// that the current plugin in activation mode.
|
| 102 |
+
$fs_active_plugins->newest->in_activation = true;
|
| 103 |
+
update_option( 'fs_active_plugins', $fs_active_plugins );
|
| 104 |
+
}
|
| 105 |
+
|
| 106 |
+
$is_newest_sdk_path_valid = ( $is_newest_sdk_plugin_activate || $fs_active_plugins->newest->in_activation ) && file_exists( fs_normalize_path( WP_PLUGIN_DIR . '/' . $this_sdk_relative_path . '/start.php' ) );
|
| 107 |
+
|
| 108 |
+
if ( ! $is_newest_sdk_path_valid && ! $is_current_sdk_newest ) {
|
| 109 |
+
// Plugin with newest SDK is no longer active, or SDK was moved to a different location.
|
| 110 |
+
unset( $fs_active_plugins->plugins[ $fs_active_plugins->newest->sdk_path ] );
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
if ( ! ( $is_newest_sdk_plugin_activate || $fs_active_plugins->newest->in_activation ) ||
|
| 114 |
+
! $is_newest_sdk_path_valid ||
|
| 115 |
+
// Is newest SDK downgraded.
|
| 116 |
+
( $this_sdk_relative_path == $fs_active_plugins->newest->sdk_path &&
|
| 117 |
+
version_compare( $fs_active_plugins->newest->version, $this_sdk_version, '>' ) )
|
| 118 |
+
) {
|
| 119 |
+
/**
|
| 120 |
+
* Plugin with newest SDK is no longer active.
|
| 121 |
+
* OR
|
| 122 |
+
* The newest SDK was in the current plugin. BUT, seems like the version of
|
| 123 |
+
* the SDK was downgraded to a lower SDK.
|
| 124 |
+
*/
|
| 125 |
+
// Find the active plugin with the newest SDK version and update the newest reference.
|
| 126 |
+
fs_fallback_to_newest_active_sdk();
|
| 127 |
+
} else {
|
| 128 |
+
if ( $is_newest_sdk_plugin_activate &&
|
| 129 |
+
$this_sdk_relative_path == $fs_active_plugins->newest->sdk_path &&
|
| 130 |
+
( $fs_active_plugins->newest->in_activation ||
|
| 131 |
+
( class_exists( 'Freemius' ) && ( ! defined( 'WP_FS__SDK_VERSION' ) || version_compare( WP_FS__SDK_VERSION, $this_sdk_version, '<' ) ) )
|
| 132 |
+
)
|
| 133 |
+
|
| 134 |
+
) {
|
| 135 |
+
if ( $fs_active_plugins->newest->in_activation ) {
|
| 136 |
+
// Plugin no more in activation.
|
| 137 |
+
$fs_active_plugins->newest->in_activation = false;
|
| 138 |
+
update_option( 'fs_active_plugins', $fs_active_plugins );
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
// Reorder plugins to load plugin with newest SDK first.
|
| 142 |
+
if ( fs_newest_sdk_plugin_first() ) {
|
| 143 |
+
// Refresh page after re-order to make sure activated plugin loads newest SDK.
|
| 144 |
+
if ( class_exists( 'Freemius' ) ) {
|
| 145 |
+
fs_redirect( $_SERVER['REQUEST_URI'] );
|
| 146 |
+
}
|
| 147 |
+
}
|
| 148 |
+
}
|
| 149 |
+
}
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
if ( class_exists( 'Freemius' ) ) {
|
| 153 |
+
// SDK was already loaded.
|
| 154 |
+
return;
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
if ( version_compare( $this_sdk_version, $fs_active_plugins->newest->version, '<' ) ) {
|
| 158 |
+
$newest_sdk_starter = fs_normalize_path( WP_PLUGIN_DIR . '/' . $fs_active_plugins->newest->sdk_path . '/start.php' );
|
| 159 |
+
|
| 160 |
+
if ( file_exists( $newest_sdk_starter ) ) {
|
| 161 |
+
// Reorder plugins to load plugin with newest SDK first.
|
| 162 |
+
fs_newest_sdk_plugin_first();
|
| 163 |
+
|
| 164 |
+
// There's a newer SDK version, load it instead of the current one!
|
| 165 |
+
require_once $newest_sdk_starter;
|
| 166 |
+
|
| 167 |
+
return;
|
| 168 |
+
}
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
#endregion SDK Selection Logic --------------------------------------------------------------------
|
| 172 |
+
|
| 173 |
+
#region Hooks & Filters Collection --------------------------------------------------------------------
|
| 174 |
+
|
| 175 |
+
/**
|
| 176 |
+
* Freemius hooks (actions & filters) tags structure:
|
| 177 |
+
*
|
| 178 |
+
* fs_{filter/action_name}_{plugin_slug}
|
| 179 |
+
*
|
| 180 |
+
* --------------------------------------------------------
|
| 181 |
+
*
|
| 182 |
+
* Usage with WordPress' add_action() / add_filter():
|
| 183 |
+
*
|
| 184 |
+
* add_action('fs_{filter/action_name}_{plugin_slug}', $callable);
|
| 185 |
+
*
|
| 186 |
+
* --------------------------------------------------------
|
| 187 |
+
*
|
| 188 |
+
* Usage with Freemius' instance add_action() / add_filter():
|
| 189 |
+
*
|
| 190 |
+
* // No need to add 'fs_' prefix nor '_{plugin_slug}' suffix.
|
| 191 |
+
* my_freemius()->add_action('{action_name}', $callable);
|
| 192 |
+
*
|
| 193 |
+
* --------------------------------------------------------
|
| 194 |
+
*
|
| 195 |
+
* Freemius filters collection:
|
| 196 |
+
*
|
| 197 |
+
* fs_connect_url_{plugin_slug}
|
| 198 |
+
* fs_trial_promotion_message_{plugin_slug}
|
| 199 |
+
* fs_is_long_term_user_{plugin_slug}
|
| 200 |
+
* fs_uninstall_reasons_{plugin_slug}
|
| 201 |
+
* fs_is_plugin_update_{plugin_slug}
|
| 202 |
+
* fs_api_domains_{plugin_slug}
|
| 203 |
+
* fs_email_template_sections_{plugin_slug}
|
| 204 |
+
* fs_support_forum_submenu_{plugin_slug}
|
| 205 |
+
* fs_support_forum_url_{plugin_slug}
|
| 206 |
+
* fs_connect_message_{plugin_slug}
|
| 207 |
+
* fs_connect_message_on_update_{plugin_slug}
|
| 208 |
+
* fs_uninstall_confirmation_message_{plugin_slug}
|
| 209 |
+
* fs_pending_activation_message_{plugin_slug}
|
| 210 |
+
* fs_is_submenu_visible_{plugin_slug}
|
| 211 |
+
* fs_plugin_icon_{plugin_slug}
|
| 212 |
+
* fs_show_trial_{plugin_slug}
|
| 213 |
+
*
|
| 214 |
+
* --------------------------------------------------------
|
| 215 |
+
*
|
| 216 |
+
* Freemius actions collection:
|
| 217 |
+
*
|
| 218 |
+
* fs_after_license_loaded_{plugin_slug}
|
| 219 |
+
* fs_after_license_change_{plugin_slug}
|
| 220 |
+
* fs_after_plans_sync_{plugin_slug}
|
| 221 |
+
*
|
| 222 |
+
* fs_after_account_details_{plugin_slug}
|
| 223 |
+
* fs_after_account_user_sync_{plugin_slug}
|
| 224 |
+
* fs_after_account_plan_sync_{plugin_slug}
|
| 225 |
+
* fs_before_account_load_{plugin_slug}
|
| 226 |
+
* fs_after_account_connection_{plugin_slug}
|
| 227 |
+
* fs_account_property_edit_{plugin_slug}
|
| 228 |
+
* fs_account_email_verified_{plugin_slug}
|
| 229 |
+
* fs_account_page_load_before_departure_{plugin_slug}
|
| 230 |
+
* fs_before_account_delete_{plugin_slug}
|
| 231 |
+
* fs_after_account_delete_{plugin_slug}
|
| 232 |
+
*
|
| 233 |
+
* fs_sdk_version_update_{plugin_slug}
|
| 234 |
+
* fs_plugin_version_update_{plugin_slug}
|
| 235 |
+
*
|
| 236 |
+
* fs_initiated_{plugin_slug}
|
| 237 |
+
* fs_after_init_plugin_registered_{plugin_slug}
|
| 238 |
+
* fs_after_init_plugin_anonymous_{plugin_slug}
|
| 239 |
+
* fs_after_init_plugin_pending_activations_{plugin_slug}
|
| 240 |
+
* fs_after_init_addon_registered_{plugin_slug}
|
| 241 |
+
* fs_after_init_addon_anonymous_{plugin_slug}
|
| 242 |
+
* fs_after_init_addon_pending_activations_{plugin_slug}
|
| 243 |
+
*
|
| 244 |
+
* fs_after_premium_version_activation_{plugin_slug}
|
| 245 |
+
* fs_after_free_version_reactivation_{plugin_slug}
|
| 246 |
+
*
|
| 247 |
+
* fs_after_uninstall_{plugin_slug}
|
| 248 |
+
* fs_before_admin_menu_init_{plugin_slug}
|
| 249 |
+
*/
|
| 250 |
+
|
| 251 |
+
#endregion Hooks & Filters Collection --------------------------------------------------------------------
|
| 252 |
+
|
| 253 |
+
if ( ! class_exists( 'Freemius' ) ) {
|
| 254 |
+
|
| 255 |
+
if ( ! defined( 'WP_FS__SDK_VERSION' ) ) {
|
| 256 |
+
define( 'WP_FS__SDK_VERSION', $this_sdk_version );
|
| 257 |
+
}
|
| 258 |
+
|
| 259 |
+
// Load SDK files.
|
| 260 |
+
require_once dirname( __FILE__ ) . '/require.php';
|
| 261 |
+
|
| 262 |
+
/**
|
| 263 |
+
* Quick shortcut to get Freemius for specified plugin.
|
| 264 |
+
* Used by various templates.
|
| 265 |
+
*
|
| 266 |
+
* @param string $slug
|
| 267 |
+
*
|
| 268 |
+
* @return Freemius
|
| 269 |
+
*/
|
| 270 |
+
function freemius( $slug ) {
|
| 271 |
+
return Freemius::instance( $slug );
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
/**
|
| 275 |
+
* @param string $slug
|
| 276 |
+
* @param number $plugin_id
|
| 277 |
+
* @param string $public_key
|
| 278 |
+
* @param bool $is_live Is live or test plugin.
|
| 279 |
+
* @param bool $is_premium Hints freemius if running the premium plugin or not.
|
| 280 |
+
*
|
| 281 |
+
* @return Freemius
|
| 282 |
+
*
|
| 283 |
+
* @deprecated Please use fs_dynamic_init().
|
| 284 |
+
*/
|
| 285 |
+
function fs_init( $slug, $plugin_id, $public_key, $is_live = true, $is_premium = true ) {
|
| 286 |
+
$fs = Freemius::instance( $slug, true );
|
| 287 |
+
$fs->init( $plugin_id, $public_key, $is_live, $is_premium );
|
| 288 |
+
|
| 289 |
+
return $fs;
|
| 290 |
+
}
|
| 291 |
+
|
| 292 |
+
/**
|
| 293 |
+
* @param array<string,string> $module Plugin or Theme details.
|
| 294 |
+
*
|
| 295 |
+
* @return Freemius
|
| 296 |
+
* @throws Freemius_Exception
|
| 297 |
+
*/
|
| 298 |
+
function fs_dynamic_init( $module ) {
|
| 299 |
+
$fs = Freemius::instance( $module['slug'], true );
|
| 300 |
+
$fs->dynamic_init( $module );
|
| 301 |
+
|
| 302 |
+
return $fs;
|
| 303 |
+
}
|
| 304 |
+
|
| 305 |
+
function fs_dump_log() {
|
| 306 |
+
FS_Logger::dump();
|
| 307 |
+
}
|
| 308 |
}
|
freemius/templates/connect.php
CHANGED
|
@@ -1,407 +1,407 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* @package Freemius
|
| 4 |
-
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
-
* @since 1.0.7
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
-
exit;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* @var array $VARS
|
| 15 |
-
*/
|
| 16 |
-
$slug = $VARS['slug'];
|
| 17 |
-
$fs = freemius( $slug );
|
| 18 |
-
$is_pending_activation = $fs->is_pending_activation();
|
| 19 |
-
$is_premium_only = $fs->is_only_premium();
|
| 20 |
-
$has_paid_plans = $fs->has_paid_plan();
|
| 21 |
-
$is_premium_code = $fs->is_premium();
|
| 22 |
-
$is_freemium = $fs->is_freemium();
|
| 23 |
-
|
| 24 |
-
$fs->_enqueue_connect_essentials();
|
| 25 |
-
|
| 26 |
-
$current_user = Freemius::_get_current_wp_user();
|
| 27 |
-
|
| 28 |
-
$first_name = $current_user->user_firstname;
|
| 29 |
-
if ( empty( $first_name ) ) {
|
| 30 |
-
$first_name = $current_user->nickname;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
$site_url = get_site_url();
|
| 34 |
-
$protocol_pos = strpos( $site_url, '://' );
|
| 35 |
-
if ( false !== $protocol_pos ) {
|
| 36 |
-
$site_url = substr( $site_url, $protocol_pos + 3 );
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
$freemius_site_www = 'https://freemius.com';
|
| 40 |
-
|
| 41 |
-
$freemius_site_url = $freemius_site_www . '/' . ($fs->has_paid_plan() ?
|
| 42 |
-
'wordpress/' :
|
| 43 |
-
// Insights platform information.
|
| 44 |
-
'wordpress/usage-tracking/');
|
| 45 |
-
|
| 46 |
-
$freemius_site_url .= '?' . http_build_query( array(
|
| 47 |
-
'id' => $fs->get_id(),
|
| 48 |
-
'slug' => $slug,
|
| 49 |
-
) );
|
| 50 |
-
|
| 51 |
-
$freemius_link = '<a href="' . $freemius_site_url . '" target="_blank" tabindex="1">freemius.com</a>';
|
| 52 |
-
|
| 53 |
-
$error = fs_request_get( 'error' );
|
| 54 |
-
|
| 55 |
-
$require_license_key = $is_premium_only ||
|
| 56 |
-
( $is_freemium && $is_premium_code && fs_request_get_bool( 'require_license', true ) );
|
| 57 |
-
|
| 58 |
-
if ( $is_pending_activation ) {
|
| 59 |
-
$require_license_key = false;
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
if ( $require_license_key ) {
|
| 63 |
-
$fs->_add_license_activation_dialog_box();
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
$fs_user = Freemius::_get_user_by_email( $current_user->user_email );
|
| 67 |
-
$activate_with_current_user = is_object( $fs_user ) && ! $is_pending_activation;
|
| 68 |
-
?>
|
| 69 |
-
<div id="fs_connect"
|
| 70 |
-
class="wrap<?php if ( ! $fs->is_enable_anonymous() || $is_pending_activation || $require_license_key ) {
|
| 71 |
-
echo ' fs-anonymous-disabled';
|
| 72 |
-
} ?>">
|
| 73 |
-
<div class="fs-visual">
|
| 74 |
-
<b class="fs-site-icon"><i class="dashicons dashicons-wordpress"></i></b>
|
| 75 |
-
<i class="dashicons dashicons-plus fs-first"></i>
|
| 76 |
-
<?php
|
| 77 |
-
$vars = array( 'slug' => $slug );
|
| 78 |
-
fs_require_once_template( 'plugin-icon.php', $vars );
|
| 79 |
-
?>
|
| 80 |
-
<i class="dashicons dashicons-plus fs-second"></i>
|
| 81 |
-
<img class="fs-connect-logo" width="80" height="80" src="//img.freemius.com/connect-logo.png"/>
|
| 82 |
-
</div>
|
| 83 |
-
<div class="fs-content">
|
| 84 |
-
<?php if ( ! empty( $error ) ) : ?>
|
| 85 |
-
<p class="fs-error"><?php echo esc_html( $error ) ?></p>
|
| 86 |
-
<?php endif ?>
|
| 87 |
-
<p><?php
|
| 88 |
-
$button_label = 'opt-in-connect';
|
| 89 |
-
|
| 90 |
-
if ( $is_pending_activation ) {
|
| 91 |
-
$button_label = 'resend-activation-email';
|
| 92 |
-
|
| 93 |
-
echo $fs->apply_filters( 'pending_activation_message', sprintf(
|
| 94 |
-
__fs( 'thanks-x', $slug ) . '<br>' .
|
| 95 |
-
__fs( 'pending-activation-message', $slug ),
|
| 96 |
-
$first_name,
|
| 97 |
-
'<b>' . $fs->get_plugin_name() . '</b>',
|
| 98 |
-
'<b>' . $current_user->user_email . '</b>',
|
| 99 |
-
__fs( 'complete-the-install', $slug )
|
| 100 |
-
) );
|
| 101 |
-
} else if ( $require_license_key ) {
|
| 102 |
-
$button_label = 'agree-activate-license';
|
| 103 |
-
|
| 104 |
-
echo $fs->apply_filters( 'connect-message_on-premium',
|
| 105 |
-
sprintf( __fs( 'hey-x', $slug ), $first_name ) . '<br>' .
|
| 106 |
-
sprintf( __fs( 'thanks-for-purchasing', $slug ), '<b>' . $fs->get_plugin_name() . '</b>' ),
|
| 107 |
-
$first_name,
|
| 108 |
-
$fs->get_plugin_name()
|
| 109 |
-
);
|
| 110 |
-
} else {
|
| 111 |
-
$filter = 'connect_message';
|
| 112 |
-
$default_optin_message = 'connect-message';
|
| 113 |
-
|
| 114 |
-
if ( $fs->is_plugin_update() ) {
|
| 115 |
-
// If Freemius was added on a plugin update, set different
|
| 116 |
-
// opt-in message.
|
| 117 |
-
$default_optin_message = 'connect-message_on-update';
|
| 118 |
-
|
| 119 |
-
// If user customized the opt-in message on update, use
|
| 120 |
-
// that message. Otherwise, fallback to regular opt-in
|
| 121 |
-
// custom message if exist.
|
| 122 |
-
if ( $fs->has_filter( 'connect_message_on_update' ) ) {
|
| 123 |
-
$filter = 'connect_message_on_update';
|
| 124 |
-
}
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
echo $fs->apply_filters( $filter,
|
| 128 |
-
sprintf( __fs( 'hey-x', $slug ), $first_name ) . '<br>' .
|
| 129 |
-
sprintf(
|
| 130 |
-
__fs( $default_optin_message, $slug ),
|
| 131 |
-
'<b>' . $fs->get_plugin_name() . '</b>',
|
| 132 |
-
'<b>' . $current_user->user_login . '</b>',
|
| 133 |
-
'<a href="' . $site_url . '" target="_blank">' . $site_url . '</a>',
|
| 134 |
-
$freemius_link
|
| 135 |
-
),
|
| 136 |
-
$first_name,
|
| 137 |
-
$fs->get_plugin_name(),
|
| 138 |
-
$current_user->user_login,
|
| 139 |
-
'<a href="' . $site_url . '" target="_blank">' . $site_url . '</a>',
|
| 140 |
-
$freemius_link
|
| 141 |
-
);
|
| 142 |
-
}
|
| 143 |
-
?></p>
|
| 144 |
-
<?php if ( $require_license_key ) : ?>
|
| 145 |
-
<div class="fs-license-key-container">
|
| 146 |
-
<input id="fs_license_key" name="fs_key" type="text" required maxlength="32"
|
| 147 |
-
placeholder="<?php _efs( 'license-key', $slug ) ?>" tabindex="1"/>
|
| 148 |
-
<i class="dashicons dashicons-admin-network"></i>
|
| 149 |
-
<a class="show-license-resend-modal show-license-resend-modal-<?php echo $slug; ?>"
|
| 150 |
-
href="#"><?php _efs( 'cant-find-license-key' ); ?></a>
|
| 151 |
-
</div>
|
| 152 |
-
<?php endif ?>
|
| 153 |
-
</div>
|
| 154 |
-
<div class="fs-actions">
|
| 155 |
-
<?php if ( $fs->is_enable_anonymous() && ! $is_pending_activation && ! $require_license_key ) : ?>
|
| 156 |
-
<a href="<?php echo fs_nonce_url( $fs->_get_admin_page_url( '', array( 'fs_action' => $slug . '_skip_activation' ) ), $slug . '_skip_activation' ) ?>"
|
| 157 |
-
class="button button-secondary" tabindex="2"><?php _efs( 'skip', $slug ) ?></a>
|
| 158 |
-
<?php endif ?>
|
| 159 |
-
|
| 160 |
-
<?php if ( $activate_with_current_user ) : ?>
|
| 161 |
-
<form action="" method="POST">
|
| 162 |
-
<input type="hidden" name="fs_action" value="<?php echo $slug ?>_activate_existing">
|
| 163 |
-
<?php wp_nonce_field( 'activate_existing_' . $fs->get_public_key() ) ?>
|
| 164 |
-
<button class="button button-primary" tabindex="1"
|
| 165 |
-
type="submit"<?php if ( $require_license_key ) {
|
| 166 |
-
echo ' disabled="disabled"';
|
| 167 |
-
} ?>><?php _efs( $button_label, $slug ) ?></button>
|
| 168 |
-
</form>
|
| 169 |
-
<?php else : ?>
|
| 170 |
-
<form method="post" action="<?php echo WP_FS__ADDRESS ?>/action/service/user/install/">
|
| 171 |
-
<?php $params = $fs->get_opt_in_params() ?>
|
| 172 |
-
<?php foreach ( $params as $name => $value ) : ?>
|
| 173 |
-
<input type="hidden" name="<?php echo $name ?>" value="<?php echo esc_attr( $value ) ?>">
|
| 174 |
-
<?php endforeach ?>
|
| 175 |
-
<button class="button button-primary" tabindex="1"
|
| 176 |
-
type="submit"<?php if ( $require_license_key ) {
|
| 177 |
-
echo ' disabled="disabled"';
|
| 178 |
-
} ?>><?php _efs( $button_label, $slug ) ?></button>
|
| 179 |
-
</form>
|
| 180 |
-
<?php endif ?>
|
| 181 |
-
</div><?php
|
| 182 |
-
|
| 183 |
-
// Set core permission list items.
|
| 184 |
-
$permissions = array(
|
| 185 |
-
'profile' => array(
|
| 186 |
-
'icon-class' => 'dashicons dashicons-admin-users',
|
| 187 |
-
'label' => __fs( 'permissions-profile' ),
|
| 188 |
-
'desc' => __fs( 'permissions-profile_desc' ),
|
| 189 |
-
'priority' => 5,
|
| 190 |
-
),
|
| 191 |
-
'site' => array(
|
| 192 |
-
'icon-class' => 'dashicons dashicons-admin-settings',
|
| 193 |
-
'label' => __fs( 'permissions-site' ),
|
| 194 |
-
'desc' => __fs( 'permissions-site_desc' ),
|
| 195 |
-
'priority' => 10,
|
| 196 |
-
),
|
| 197 |
-
'notices' => array(
|
| 198 |
-
'icon-class' => 'dashicons dashicons-testimonial',
|
| 199 |
-
'label' => __fs( 'permissions-admin-notices' ),
|
| 200 |
-
'desc' => __fs( 'permissions-newsletter_desc' ),
|
| 201 |
-
'priority' => 13,
|
| 202 |
-
),
|
| 203 |
-
'events' => array(
|
| 204 |
-
'icon-class' => 'dashicons dashicons-admin-plugins',
|
| 205 |
-
'label' => __fs( 'permissions-events' ),
|
| 206 |
-
'desc' => __fs( 'permissions-events_desc' ),
|
| 207 |
-
'priority' => 20,
|
| 208 |
-
),
|
| 209 |
-
// 'plugins_themes' => array(
|
| 210 |
-
// 'icon-class' => 'dashicons dashicons-admin-settings',
|
| 211 |
-
// 'label' => __fs( 'permissions-plugins_themes' ),
|
| 212 |
-
// 'desc' => __fs( 'permissions-plugins_themes_desc' ),
|
| 213 |
-
// 'priority' => 30,
|
| 214 |
-
// ),
|
| 215 |
-
);
|
| 216 |
-
|
| 217 |
-
// Add newsletter permissions if enabled.
|
| 218 |
-
if ( $fs->is_permission_requested( 'newsletter' ) ) {
|
| 219 |
-
$permissions['newsletter'] = array(
|
| 220 |
-
'icon-class' => 'dashicons dashicons-email-alt',
|
| 221 |
-
'label' => __fs( 'permissions-newsletter' ),
|
| 222 |
-
'desc' => __fs( 'permissions-newsletter_desc' ),
|
| 223 |
-
'priority' => 15,
|
| 224 |
-
);
|
| 225 |
-
}
|
| 226 |
-
|
| 227 |
-
// Allow filtering of the permissions list.
|
| 228 |
-
$permissions = $fs->apply_filters( 'permission_list', $permissions );
|
| 229 |
-
|
| 230 |
-
// Sort by priority.
|
| 231 |
-
uasort( $permissions, 'fs_sort_by_priority' );
|
| 232 |
-
|
| 233 |
-
if ( ! empty( $permissions ) ) : ?>
|
| 234 |
-
<div class="fs-permissions">
|
| 235 |
-
<?php if ( $require_license_key ) : ?>
|
| 236 |
-
<p class="fs-license-sync-disclaimer"><?php printf( __fs( 'license-sync-disclaimer', $slug ), $freemius_link ) ?></p>
|
| 237 |
-
<?php endif ?>
|
| 238 |
-
<a class="fs-trigger" href="#" tabindex="1"><?php _efs( 'what-permissions', $slug ) ?></a>
|
| 239 |
-
<ul><?php
|
| 240 |
-
foreach ( $permissions as $id => $permission ) : ?>
|
| 241 |
-
<li id="fs-permission-<?php echo esc_attr( $id ); ?>"
|
| 242 |
-
class="fs-permission fs-<?php echo esc_attr( $id ); ?>">
|
| 243 |
-
<i class="<?php echo esc_attr( $permission['icon-class'] ); ?>"></i>
|
| 244 |
-
|
| 245 |
-
<div>
|
| 246 |
-
<span><?php echo esc_html( $permission['label'] ); ?></span>
|
| 247 |
-
|
| 248 |
-
<p><?php echo esc_html( $permission['desc'] ); ?></p>
|
| 249 |
-
</div>
|
| 250 |
-
</li>
|
| 251 |
-
<?php endforeach; ?>
|
| 252 |
-
</ul>
|
| 253 |
-
</div>
|
| 254 |
-
<?php endif ?>
|
| 255 |
-
<?php if ( $is_premium_code && $is_freemium ) : ?>
|
| 256 |
-
<div class="fs-freemium-licensing">
|
| 257 |
-
<p>
|
| 258 |
-
<?php if ( $require_license_key ) : ?>
|
| 259 |
-
<?php _efs( 'dont-have-license-key', $slug ) ?>
|
| 260 |
-
<a data-require-license="false" tabindex="1"><?php _efs( 'activate-free-version', $slug ) ?></a>
|
| 261 |
-
<?php else : ?>
|
| 262 |
-
<?php _efs( 'have-license-key', $slug ) ?>
|
| 263 |
-
<a data-require-license="true" tabindex="1"><?php _efs( 'activate-license', $slug ) ?></a>
|
| 264 |
-
<?php endif ?>
|
| 265 |
-
</p>
|
| 266 |
-
</div>
|
| 267 |
-
<?php endif ?>
|
| 268 |
-
<div class="fs-terms">
|
| 269 |
-
<a href="https://freemius.com/privacy/" target="_blank"
|
| 270 |
-
tabindex="1"><?php _efs( 'privacy-policy', $slug ) ?></a>
|
| 271 |
-
-
|
| 272 |
-
<a href="<?php echo $freemius_site_www ?>/terms/" target="_blank" tabindex="1"><?php _efs( 'tos', $slug ) ?></a>
|
| 273 |
-
</div>
|
| 274 |
-
</div>
|
| 275 |
-
<script type="text/javascript">
|
| 276 |
-
(function ($) {
|
| 277 |
-
var $primaryCta = $('.fs-actions .button.button-primary'),
|
| 278 |
-
$form = $('.fs-actions form'),
|
| 279 |
-
requireLicenseKey = <?php echo $require_license_key ? 'true' : 'false' ?>,
|
| 280 |
-
hasContextUser = <?php echo $activate_with_current_user ? 'true' : 'false' ?>,
|
| 281 |
-
$licenseSecret,
|
| 282 |
-
$licenseKeyInput = $('#fs_license_key');
|
| 283 |
-
|
| 284 |
-
$('.fs-actions .button').on('click', function () {
|
| 285 |
-
// Set loading mode.
|
| 286 |
-
$(document.body).css({'cursor': 'wait'});
|
| 287 |
-
|
| 288 |
-
var $this = $(this);
|
| 289 |
-
$this.css({'cursor': 'wait'});
|
| 290 |
-
|
| 291 |
-
setTimeout(function () {
|
| 292 |
-
$this.attr('disabled', 'disabled');
|
| 293 |
-
}, 200);
|
| 294 |
-
});
|
| 295 |
-
|
| 296 |
-
$form.on('submit', function () {
|
| 297 |
-
/**
|
| 298 |
-
* @author Vova Feldman (@svovaf)
|
| 299 |
-
* @since 1.1.9
|
| 300 |
-
*/
|
| 301 |
-
if (requireLicenseKey) {
|
| 302 |
-
if (!hasContextUser) {
|
| 303 |
-
$('.fs-error').remove();
|
| 304 |
-
|
| 305 |
-
/**
|
| 306 |
-
* Use the AJAX opt-in when license key is required to potentially
|
| 307 |
-
* process the after install failure hook.
|
| 308 |
-
*
|
| 309 |
-
* @author Vova Feldman (@svovaf)
|
| 310 |
-
* @since 1.2.1.5
|
| 311 |
-
*/
|
| 312 |
-
$.ajax({
|
| 313 |
-
url : ajaxurl,
|
| 314 |
-
method : 'POST',
|
| 315 |
-
data : {
|
| 316 |
-
action : 'fs_activate_license_<?php echo $slug ?>',
|
| 317 |
-
slug : '<?php echo $slug ?>',
|
| 318 |
-
license_key: $licenseKeyInput.val()
|
| 319 |
-
},
|
| 320 |
-
success: function (result) {
|
| 321 |
-
var resultObj = $.parseJSON(result);
|
| 322 |
-
if (resultObj.success) {
|
| 323 |
-
// Redirect to the "Account" page and sync the license.
|
| 324 |
-
window.location.href = resultObj.next_page;
|
| 325 |
-
} else {
|
| 326 |
-
// Show error.
|
| 327 |
-
$('.fs-content').prepend('<p class="fs-error">' + resultObj.error + '</p>');
|
| 328 |
-
|
| 329 |
-
// Reset loading mode.
|
| 330 |
-
$primaryCta.removeClass('fs-loading').css({'cursor': 'auto'});
|
| 331 |
-
$primaryCta.html(<?php echo json_encode(__fs( $button_label, $slug )) ?>);
|
| 332 |
-
$primaryCta.prop('disabled', false);
|
| 333 |
-
$(document.body).css({'cursor': 'auto'});
|
| 334 |
-
}
|
| 335 |
-
}
|
| 336 |
-
});
|
| 337 |
-
|
| 338 |
-
return false;
|
| 339 |
-
}
|
| 340 |
-
else {
|
| 341 |
-
if (null == $licenseSecret) {
|
| 342 |
-
$licenseSecret = $('<input type="hidden" name="license_secret_key" value="" />');
|
| 343 |
-
$form.append($licenseSecret);
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
// Update secret key if premium only plugin.
|
| 347 |
-
$licenseSecret.val($licenseKeyInput.val());
|
| 348 |
-
}
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
return true;
|
| 352 |
-
});
|
| 353 |
-
|
| 354 |
-
$primaryCta.on('click', function () {
|
| 355 |
-
$(this).addClass('fs-loading');
|
| 356 |
-
$(this).html(<?php echo json_encode(__fs( $is_pending_activation ? 'sending-email' : 'activating' , $slug )) ?> +'...');
|
| 357 |
-
});
|
| 358 |
-
|
| 359 |
-
$('.fs-permissions .fs-trigger').on('click', function () {
|
| 360 |
-
$('.fs-permissions').toggleClass('fs-open');
|
| 361 |
-
});
|
| 362 |
-
|
| 363 |
-
if (requireLicenseKey) {
|
| 364 |
-
/**
|
| 365 |
-
* Submit license key on enter.
|
| 366 |
-
*
|
| 367 |
-
* @author Vova Feldman (@svovaf)
|
| 368 |
-
* @since 1.1.9
|
| 369 |
-
*/
|
| 370 |
-
$licenseKeyInput.keypress(function (e) {
|
| 371 |
-
if (e.which == 13) {
|
| 372 |
-
if ('' !== $(this).val()) {
|
| 373 |
-
$primaryCta.click();
|
| 374 |
-
return false;
|
| 375 |
-
}
|
| 376 |
-
}
|
| 377 |
-
});
|
| 378 |
-
|
| 379 |
-
/**
|
| 380 |
-
* Disable activation button when empty license key.
|
| 381 |
-
*
|
| 382 |
-
* @author Vova Feldman (@svovaf)
|
| 383 |
-
* @since 1.1.9
|
| 384 |
-
*/
|
| 385 |
-
$licenseKeyInput.on('keyup paste delete cut', function () {
|
| 386 |
-
setTimeout(function () {
|
| 387 |
-
if ('' === $licenseKeyInput.val()) {
|
| 388 |
-
$primaryCta.attr('disabled', 'disabled');
|
| 389 |
-
} else {
|
| 390 |
-
$primaryCta.prop('disabled', false);
|
| 391 |
-
}
|
| 392 |
-
}, 100);
|
| 393 |
-
}).focus();
|
| 394 |
-
}
|
| 395 |
-
|
| 396 |
-
/**
|
| 397 |
-
* Set license mode trigger URL.
|
| 398 |
-
*
|
| 399 |
-
* @author Vova Feldman (@svovaf)
|
| 400 |
-
* @since 1.1.9
|
| 401 |
-
*/
|
| 402 |
-
var $connectLicenseModeTrigger = $('#fs_connect .fs-freemium-licensing a');
|
| 403 |
-
if ($connectLicenseModeTrigger.length > 0) {
|
| 404 |
-
$connectLicenseModeTrigger.attr('href', window.location.href + '&require_license=' + $connectLicenseModeTrigger.attr('data-require-license'))
|
| 405 |
-
}
|
| 406 |
-
})(jQuery);
|
| 407 |
</script>
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* @package Freemius
|
| 4 |
+
* @copyright Copyright (c) 2015, Freemius, Inc.
|
| 5 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 6 |
+
* @since 1.0.7
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 10 |
+
exit;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* @var array $VARS
|
| 15 |
+
*/
|
| 16 |
+
$slug = $VARS['slug'];
|
| 17 |
+
$fs = freemius( $slug );
|
| 18 |
+
$is_pending_activation = $fs->is_pending_activation();
|
| 19 |
+
$is_premium_only = $fs->is_only_premium();
|
| 20 |
+
$has_paid_plans = $fs->has_paid_plan();
|
| 21 |
+
$is_premium_code = $fs->is_premium();
|
| 22 |
+
$is_freemium = $fs->is_freemium();
|
| 23 |
+
|
| 24 |
+
$fs->_enqueue_connect_essentials();
|
| 25 |
+
|
| 26 |
+
$current_user = Freemius::_get_current_wp_user();
|
| 27 |
+
|
| 28 |
+
$first_name = $current_user->user_firstname;
|
| 29 |
+
if ( empty( $first_name ) ) {
|
| 30 |
+
$first_name = $current_user->nickname;
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
$site_url = get_site_url();
|
| 34 |
+
$protocol_pos = strpos( $site_url, '://' );
|
| 35 |
+
if ( false !== $protocol_pos ) {
|
| 36 |
+
$site_url = substr( $site_url, $protocol_pos + 3 );
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
$freemius_site_www = 'https://freemius.com';
|
| 40 |
+
|
| 41 |
+
$freemius_site_url = $freemius_site_www . '/' . ($fs->has_paid_plan() ?
|
| 42 |
+
'wordpress/' :
|
| 43 |
+
// Insights platform information.
|
| 44 |
+
'wordpress/usage-tracking/');
|
| 45 |
+
|
| 46 |
+
$freemius_site_url .= '?' . http_build_query( array(
|
| 47 |
+
'id' => $fs->get_id(),
|
| 48 |
+
'slug' => $slug,
|
| 49 |
+
) );
|
| 50 |
+
|
| 51 |
+
$freemius_link = '<a href="' . $freemius_site_url . '" target="_blank" tabindex="1">freemius.com</a>';
|
| 52 |
+
|
| 53 |
+
$error = fs_request_get( 'error' );
|
| 54 |
+
|
| 55 |
+
$require_license_key = $is_premium_only ||
|
| 56 |
+
( $is_freemium && $is_premium_code && fs_request_get_bool( 'require_license', true ) );
|
| 57 |
+
|
| 58 |
+
if ( $is_pending_activation ) {
|
| 59 |
+
$require_license_key = false;
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
if ( $require_license_key ) {
|
| 63 |
+
$fs->_add_license_activation_dialog_box();
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
$fs_user = Freemius::_get_user_by_email( $current_user->user_email );
|
| 67 |
+
$activate_with_current_user = is_object( $fs_user ) && ! $is_pending_activation;
|
| 68 |
+
?>
|
| 69 |
+
<div id="fs_connect"
|
| 70 |
+
class="wrap<?php if ( ! $fs->is_enable_anonymous() || $is_pending_activation || $require_license_key ) {
|
| 71 |
+
echo ' fs-anonymous-disabled';
|
| 72 |
+
} ?>">
|
| 73 |
+
<div class="fs-visual">
|
| 74 |
+
<b class="fs-site-icon"><i class="dashicons dashicons-wordpress"></i></b>
|
| 75 |
+
<i class="dashicons dashicons-plus fs-first"></i>
|
| 76 |
+
<?php
|
| 77 |
+
$vars = array( 'slug' => $slug );
|
| 78 |
+
fs_require_once_template( 'plugin-icon.php', $vars );
|
| 79 |
+
?>
|
| 80 |
+
<i class="dashicons dashicons-plus fs-second"></i>
|
| 81 |
+
<img class="fs-connect-logo" width="80" height="80" src="//img.freemius.com/connect-logo.png"/>
|
| 82 |
+
</div>
|
| 83 |
+
<div class="fs-content">
|
| 84 |
+
<?php if ( ! empty( $error ) ) : ?>
|
| 85 |
+
<p class="fs-error"><?php echo esc_html( $error ) ?></p>
|
| 86 |
+
<?php endif ?>
|
| 87 |
+
<p><?php
|
| 88 |
+
$button_label = 'opt-in-connect';
|
| 89 |
+
|
| 90 |
+
if ( $is_pending_activation ) {
|
| 91 |
+
$button_label = 'resend-activation-email';
|
| 92 |
+
|
| 93 |
+
echo $fs->apply_filters( 'pending_activation_message', sprintf(
|
| 94 |
+
__fs( 'thanks-x', $slug ) . '<br>' .
|
| 95 |
+
__fs( 'pending-activation-message', $slug ),
|
| 96 |
+
$first_name,
|
| 97 |
+
'<b>' . $fs->get_plugin_name() . '</b>',
|
| 98 |
+
'<b>' . $current_user->user_email . '</b>',
|
| 99 |
+
__fs( 'complete-the-install', $slug )
|
| 100 |
+
) );
|
| 101 |
+
} else if ( $require_license_key ) {
|
| 102 |
+
$button_label = 'agree-activate-license';
|
| 103 |
+
|
| 104 |
+
echo $fs->apply_filters( 'connect-message_on-premium',
|
| 105 |
+
sprintf( __fs( 'hey-x', $slug ), $first_name ) . '<br>' .
|
| 106 |
+
sprintf( __fs( 'thanks-for-purchasing', $slug ), '<b>' . $fs->get_plugin_name() . '</b>' ),
|
| 107 |
+
$first_name,
|
| 108 |
+
$fs->get_plugin_name()
|
| 109 |
+
);
|
| 110 |
+
} else {
|
| 111 |
+
$filter = 'connect_message';
|
| 112 |
+
$default_optin_message = 'connect-message';
|
| 113 |
+
|
| 114 |
+
if ( $fs->is_plugin_update() ) {
|
| 115 |
+
// If Freemius was added on a plugin update, set different
|
| 116 |
+
// opt-in message.
|
| 117 |
+
$default_optin_message = 'connect-message_on-update';
|
| 118 |
+
|
| 119 |
+
// If user customized the opt-in message on update, use
|
| 120 |
+
// that message. Otherwise, fallback to regular opt-in
|
| 121 |
+
// custom message if exist.
|
| 122 |
+
if ( $fs->has_filter( 'connect_message_on_update' ) ) {
|
| 123 |
+
$filter = 'connect_message_on_update';
|
| 124 |
+
}
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
echo $fs->apply_filters( $filter,
|
| 128 |
+
sprintf( __fs( 'hey-x', $slug ), $first_name ) . '<br>' .
|
| 129 |
+
sprintf(
|
| 130 |
+
__fs( $default_optin_message, $slug ),
|
| 131 |
+
'<b>' . $fs->get_plugin_name() . '</b>',
|
| 132 |
+
'<b>' . $current_user->user_login . '</b>',
|
| 133 |
+
'<a href="' . $site_url . '" target="_blank">' . $site_url . '</a>',
|
| 134 |
+
$freemius_link
|
| 135 |
+
),
|
| 136 |
+
$first_name,
|
| 137 |
+
$fs->get_plugin_name(),
|
| 138 |
+
$current_user->user_login,
|
| 139 |
+
'<a href="' . $site_url . '" target="_blank">' . $site_url . '</a>',
|
| 140 |
+
$freemius_link
|
| 141 |
+
);
|
| 142 |
+
}
|
| 143 |
+
?></p>
|
| 144 |
+
<?php if ( $require_license_key ) : ?>
|
| 145 |
+
<div class="fs-license-key-container">
|
| 146 |
+
<input id="fs_license_key" name="fs_key" type="text" required maxlength="32"
|
| 147 |
+
placeholder="<?php _efs( 'license-key', $slug ) ?>" tabindex="1"/>
|
| 148 |
+
<i class="dashicons dashicons-admin-network"></i>
|
| 149 |
+
<a class="show-license-resend-modal show-license-resend-modal-<?php echo $slug; ?>"
|
| 150 |
+
href="#"><?php _efs( 'cant-find-license-key' ); ?></a>
|
| 151 |
+
</div>
|
| 152 |
+
<?php endif ?>
|
| 153 |
+
</div>
|
| 154 |
+
<div class="fs-actions">
|
| 155 |
+
<?php if ( $fs->is_enable_anonymous() && ! $is_pending_activation && ! $require_license_key ) : ?>
|
| 156 |
+
<a href="<?php echo fs_nonce_url( $fs->_get_admin_page_url( '', array( 'fs_action' => $slug . '_skip_activation' ) ), $slug . '_skip_activation' ) ?>"
|
| 157 |
+
class="button button-secondary" tabindex="2"><?php _efs( 'skip', $slug ) ?></a>
|
| 158 |
+
<?php endif ?>
|
| 159 |
+
|
| 160 |
+
<?php if ( $activate_with_current_user ) : ?>
|
| 161 |
+
<form action="" method="POST">
|
| 162 |
+
<input type="hidden" name="fs_action" value="<?php echo $slug ?>_activate_existing">
|
| 163 |
+
<?php wp_nonce_field( 'activate_existing_' . $fs->get_public_key() ) ?>
|
| 164 |
+
<button class="button button-primary" tabindex="1"
|
| 165 |
+
type="submit"<?php if ( $require_license_key ) {
|
| 166 |
+
echo ' disabled="disabled"';
|
| 167 |
+
} ?>><?php _efs( $button_label, $slug ) ?></button>
|
| 168 |
+
</form>
|
| 169 |
+
<?php else : ?>
|
| 170 |
+
<form method="post" action="<?php echo WP_FS__ADDRESS ?>/action/service/user/install/">
|
| 171 |
+
<?php $params = $fs->get_opt_in_params() ?>
|
| 172 |
+
<?php foreach ( $params as $name => $value ) : ?>
|
| 173 |
+
<input type="hidden" name="<?php echo $name ?>" value="<?php echo esc_attr( $value ) ?>">
|
| 174 |
+
<?php endforeach ?>
|
| 175 |
+
<button class="button button-primary" tabindex="1"
|
| 176 |
+
type="submit"<?php if ( $require_license_key ) {
|
| 177 |
+
echo ' disabled="disabled"';
|
| 178 |
+
} ?>><?php _efs( $button_label, $slug ) ?></button>
|
| 179 |
+
</form>
|
| 180 |
+
<?php endif ?>
|
| 181 |
+
</div><?php
|
| 182 |
+
|
| 183 |
+
// Set core permission list items.
|
| 184 |
+
$permissions = array(
|
| 185 |
+
'profile' => array(
|
| 186 |
+
'icon-class' => 'dashicons dashicons-admin-users',
|
| 187 |
+
'label' => __fs( 'permissions-profile' ),
|
| 188 |
+
'desc' => __fs( 'permissions-profile_desc' ),
|
| 189 |
+
'priority' => 5,
|
| 190 |
+
),
|
| 191 |
+
'site' => array(
|
| 192 |
+
'icon-class' => 'dashicons dashicons-admin-settings',
|
| 193 |
+
'label' => __fs( 'permissions-site' ),
|
| 194 |
+
'desc' => __fs( 'permissions-site_desc' ),
|
| 195 |
+
'priority' => 10,
|
| 196 |
+
),
|
| 197 |
+
'notices' => array(
|
| 198 |
+
'icon-class' => 'dashicons dashicons-testimonial',
|
| 199 |
+
'label' => __fs( 'permissions-admin-notices' ),
|
| 200 |
+
'desc' => __fs( 'permissions-newsletter_desc' ),
|
| 201 |
+
'priority' => 13,
|
| 202 |
+
),
|
| 203 |
+
'events' => array(
|
| 204 |
+
'icon-class' => 'dashicons dashicons-admin-plugins',
|
| 205 |
+
'label' => __fs( 'permissions-events' ),
|
| 206 |
+
'desc' => __fs( 'permissions-events_desc' ),
|
| 207 |
+
'priority' => 20,
|
| 208 |
+
),
|
| 209 |
+
// 'plugins_themes' => array(
|
| 210 |
+
// 'icon-class' => 'dashicons dashicons-admin-settings',
|
| 211 |
+
// 'label' => __fs( 'permissions-plugins_themes' ),
|
| 212 |
+
// 'desc' => __fs( 'permissions-plugins_themes_desc' ),
|
| 213 |
+
// 'priority' => 30,
|
| 214 |
+
// ),
|
| 215 |
+
);
|
| 216 |
+
|
| 217 |
+
// Add newsletter permissions if enabled.
|
| 218 |
+
if ( $fs->is_permission_requested( 'newsletter' ) ) {
|
| 219 |
+
$permissions['newsletter'] = array(
|
| 220 |
+
'icon-class' => 'dashicons dashicons-email-alt',
|
| 221 |
+
'label' => __fs( 'permissions-newsletter' ),
|
| 222 |
+
'desc' => __fs( 'permissions-newsletter_desc' ),
|
| 223 |
+
'priority' => 15,
|
| 224 |
+
);
|
| 225 |
+
}
|
| 226 |
+
|
| 227 |
+
// Allow filtering of the permissions list.
|
| 228 |
+
$permissions = $fs->apply_filters( 'permission_list', $permissions );
|
| 229 |
+
|
| 230 |
+
// Sort by priority.
|
| 231 |
+
uasort( $permissions, 'fs_sort_by_priority' );
|
| 232 |
+
|
| 233 |
+
if ( ! empty( $permissions ) ) : ?>
|
| 234 |
+
<div class="fs-permissions">
|
| 235 |
+
<?php if ( $require_license_key ) : ?>
|
| 236 |
+
<p class="fs-license-sync-disclaimer"><?php printf( __fs( 'license-sync-disclaimer', $slug ), $freemius_link ) ?></p>
|
| 237 |
+
<?php endif ?>
|
| 238 |
+
<a class="fs-trigger" href="#" tabindex="1"><?php _efs( 'what-permissions', $slug ) ?></a>
|
| 239 |
+
<ul><?php
|
| 240 |
+
foreach ( $permissions as $id => $permission ) : ?>
|
| 241 |
+
<li id="fs-permission-<?php echo esc_attr( $id ); ?>"
|
| 242 |
+
class="fs-permission fs-<?php echo esc_attr( $id ); ?>">
|
| 243 |
+
<i class="<?php echo esc_attr( $permission['icon-class'] ); ?>"></i>
|
| 244 |
+
|
| 245 |
+
<div>
|
| 246 |
+
<span><?php echo esc_html( $permission['label'] ); ?></span>
|
| 247 |
+
|
| 248 |
+
<p><?php echo esc_html( $permission['desc'] ); ?></p>
|
| 249 |
+
</div>
|
| 250 |
+
</li>
|
| 251 |
+
<?php endforeach; ?>
|
| 252 |
+
</ul>
|
| 253 |
+
</div>
|
| 254 |
+
<?php endif ?>
|
| 255 |
+
<?php if ( $is_premium_code && $is_freemium ) : ?>
|
| 256 |
+
<div class="fs-freemium-licensing">
|
| 257 |
+
<p>
|
| 258 |
+
<?php if ( $require_license_key ) : ?>
|
| 259 |
+
<?php _efs( 'dont-have-license-key', $slug ) ?>
|
| 260 |
+
<a data-require-license="false" tabindex="1"><?php _efs( 'activate-free-version', $slug ) ?></a>
|
| 261 |
+
<?php else : ?>
|
| 262 |
+
<?php _efs( 'have-license-key', $slug ) ?>
|
| 263 |
+
<a data-require-license="true" tabindex="1"><?php _efs( 'activate-license', $slug ) ?></a>
|
| 264 |
+
<?php endif ?>
|
| 265 |
+
</p>
|
| 266 |
+
</div>
|
| 267 |
+
<?php endif ?>
|
| 268 |
+
<div class="fs-terms">
|
| 269 |
+
<a href="https://freemius.com/privacy/" target="_blank"
|
| 270 |
+
tabindex="1"><?php _efs( 'privacy-policy', $slug ) ?></a>
|
| 271 |
+
-
|
| 272 |
+
<a href="<?php echo $freemius_site_www ?>/terms/" target="_blank" tabindex="1"><?php _efs( 'tos', $slug ) ?></a>
|
| 273 |
+
</div>
|
| 274 |
+
</div>
|
| 275 |
+
<script type="text/javascript">
|
| 276 |
+
(function ($) {
|
| 277 |
+
var $primaryCta = $('.fs-actions .button.button-primary'),
|
| 278 |
+
$form = $('.fs-actions form'),
|
| 279 |
+
requireLicenseKey = <?php echo $require_license_key ? 'true' : 'false' ?>,
|
| 280 |
+
hasContextUser = <?php echo $activate_with_current_user ? 'true' : 'false' ?>,
|
| 281 |
+
$licenseSecret,
|
| 282 |
+
$licenseKeyInput = $('#fs_license_key');
|
| 283 |
+
|
| 284 |
+
$('.fs-actions .button').on('click', function () {
|
| 285 |
+
// Set loading mode.
|
| 286 |
+
$(document.body).css({'cursor': 'wait'});
|
| 287 |
+
|
| 288 |
+
var $this = $(this);
|
| 289 |
+
$this.css({'cursor': 'wait'});
|
| 290 |
+
|
| 291 |
+
setTimeout(function () {
|
| 292 |
+
$this.attr('disabled', 'disabled');
|
| 293 |
+
}, 200);
|
| 294 |
+
});
|
| 295 |
+
|
| 296 |
+
$form.on('submit', function () {
|
| 297 |
+
/**
|
| 298 |
+
* @author Vova Feldman (@svovaf)
|
| 299 |
+
* @since 1.1.9
|
| 300 |
+
*/
|
| 301 |
+
if (requireLicenseKey) {
|
| 302 |
+
if (!hasContextUser) {
|
| 303 |
+
$('.fs-error').remove();
|
| 304 |
+
|
| 305 |
+
/**
|
| 306 |
+
* Use the AJAX opt-in when license key is required to potentially
|
| 307 |
+
* process the after install failure hook.
|
| 308 |
+
*
|
| 309 |
+
* @author Vova Feldman (@svovaf)
|
| 310 |
+
* @since 1.2.1.5
|
| 311 |
+
*/
|
| 312 |
+
$.ajax({
|
| 313 |
+
url : ajaxurl,
|
| 314 |
+
method : 'POST',
|
| 315 |
+
data : {
|
| 316 |
+
action : 'fs_activate_license_<?php echo $slug ?>',
|
| 317 |
+
slug : '<?php echo $slug ?>',
|
| 318 |
+
license_key: $licenseKeyInput.val()
|
| 319 |
+
},
|
| 320 |
+
success: function (result) {
|
| 321 |
+
var resultObj = $.parseJSON(result);
|
| 322 |
+
if (resultObj.success) {
|
| 323 |
+
// Redirect to the "Account" page and sync the license.
|
| 324 |
+
window.location.href = resultObj.next_page;
|
| 325 |
+
} else {
|
| 326 |
+
// Show error.
|
| 327 |
+
$('.fs-content').prepend('<p class="fs-error">' + resultObj.error + '</p>');
|
| 328 |
+
|
| 329 |
+
// Reset loading mode.
|
| 330 |
+
$primaryCta.removeClass('fs-loading').css({'cursor': 'auto'});
|
| 331 |
+
$primaryCta.html(<?php echo json_encode(__fs( $button_label, $slug )) ?>);
|
| 332 |
+
$primaryCta.prop('disabled', false);
|
| 333 |
+
$(document.body).css({'cursor': 'auto'});
|
| 334 |
+
}
|
| 335 |
+
}
|
| 336 |
+
});
|
| 337 |
+
|
| 338 |
+
return false;
|
| 339 |
+
}
|
| 340 |
+
else {
|
| 341 |
+
if (null == $licenseSecret) {
|
| 342 |
+
$licenseSecret = $('<input type="hidden" name="license_secret_key" value="" />');
|
| 343 |
+
$form.append($licenseSecret);
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
// Update secret key if premium only plugin.
|
| 347 |
+
$licenseSecret.val($licenseKeyInput.val());
|
| 348 |
+
}
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
return true;
|
| 352 |
+
});
|
| 353 |
+
|
| 354 |
+
$primaryCta.on('click', function () {
|
| 355 |
+
$(this).addClass('fs-loading');
|
| 356 |
+
$(this).html(<?php echo json_encode(__fs( $is_pending_activation ? 'sending-email' : 'activating' , $slug )) ?> +'...');
|
| 357 |
+
});
|
| 358 |
+
|
| 359 |
+
$('.fs-permissions .fs-trigger').on('click', function () {
|
| 360 |
+
$('.fs-permissions').toggleClass('fs-open');
|
| 361 |
+
});
|
| 362 |
+
|
| 363 |
+
if (requireLicenseKey) {
|
| 364 |
+
/**
|
| 365 |
+
* Submit license key on enter.
|
| 366 |
+
*
|
| 367 |
+
* @author Vova Feldman (@svovaf)
|
| 368 |
+
* @since 1.1.9
|
| 369 |
+
*/
|
| 370 |
+
$licenseKeyInput.keypress(function (e) {
|
| 371 |
+
if (e.which == 13) {
|
| 372 |
+
if ('' !== $(this).val()) {
|
| 373 |
+
$primaryCta.click();
|
| 374 |
+
return false;
|
| 375 |
+
}
|
| 376 |
+
}
|
| 377 |
+
});
|
| 378 |
+
|
| 379 |
+
/**
|
| 380 |
+
* Disable activation button when empty license key.
|
| 381 |
+
*
|
| 382 |
+
* @author Vova Feldman (@svovaf)
|
| 383 |
+
* @since 1.1.9
|
| 384 |
+
*/
|
| 385 |
+
$licenseKeyInput.on('keyup paste delete cut', function () {
|
| 386 |
+
setTimeout(function () {
|
| 387 |
+
if ('' === $licenseKeyInput.val()) {
|
| 388 |
+
$primaryCta.attr('disabled', 'disabled');
|
| 389 |
+
} else {
|
| 390 |
+
$primaryCta.prop('disabled', false);
|
| 391 |
+
}
|
| 392 |
+
}, 100);
|
| 393 |
+
}).focus();
|
| 394 |
+
}
|
| 395 |
+
|
| 396 |
+
/**
|
| 397 |
+
* Set license mode trigger URL.
|
| 398 |
+
*
|
| 399 |
+
* @author Vova Feldman (@svovaf)
|
| 400 |
+
* @since 1.1.9
|
| 401 |
+
*/
|
| 402 |
+
var $connectLicenseModeTrigger = $('#fs_connect .fs-freemium-licensing a');
|
| 403 |
+
if ($connectLicenseModeTrigger.length > 0) {
|
| 404 |
+
$connectLicenseModeTrigger.attr('href', window.location.href + '&require_license=' + $connectLicenseModeTrigger.attr('data-require-license'))
|
| 405 |
+
}
|
| 406 |
+
})(jQuery);
|
| 407 |
</script>
|
helpers/linkedin-api/linkedin-api.php
CHANGED
|
@@ -1,134 +1,134 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
require_once(SFSI_PLUS_DOCROOT.'/helpers/sfsi_plus_OAuth.php');
|
| 3 |
-
|
| 4 |
-
class Plus_LinkedIn {
|
| 5 |
-
public $base_url = "http://api.linkedin.com";
|
| 6 |
-
public $secure_base_url = "https://api.linkedin.com";
|
| 7 |
-
public $oauth_callback = "oob";
|
| 8 |
-
public $consumer;
|
| 9 |
-
public $request_token;
|
| 10 |
-
public $access_token;
|
| 11 |
-
public $oauth_verifier;
|
| 12 |
-
public $signature_method;
|
| 13 |
-
public $request_token_path;
|
| 14 |
-
public $access_token_path;
|
| 15 |
-
public $authorize_path;
|
| 16 |
-
|
| 17 |
-
function __construct($consumer_key, $consumer_secret,$request_token, $oauth_callback = NULL)
|
| 18 |
-
{
|
| 19 |
-
|
| 20 |
-
if($oauth_callback) {
|
| 21 |
-
$this->oauth_callback = $oauth_callback;
|
| 22 |
-
}
|
| 23 |
-
$this->request_token=
|
| 24 |
-
$this->consumer = new Plus_OAuthConsumer($consumer_key, $consumer_secret, $this->oauth_callback);
|
| 25 |
-
$this->signature_method = new Plus_OAuthSignatureMethod_HMAC_SHA1();
|
| 26 |
-
$this->request_token_path = $this->secure_base_url . "/uas/oauth/requestToken?scope=r_basicprofile+r_emailaddress+r_network+w_messages";
|
| 27 |
-
$this->access_token_path = $this->secure_base_url . "/uas/oauth/accessToken";
|
| 28 |
-
$this->authorize_path = $this->secure_base_url . "/uas/oauth/authorize";
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
function getRequestToken()
|
| 32 |
-
{
|
| 33 |
-
$consumer = $this->consumer;
|
| 34 |
-
$request = Plus_OAuthRequest::from_consumer_and_token($consumer, NULL, "GET", $this->request_token_path);
|
| 35 |
-
$request->set_parameter("oauth_callback", $this->oauth_callback);
|
| 36 |
-
$request->sign_request($this->signature_method, $consumer, NULL);
|
| 37 |
-
$headers = Array();
|
| 38 |
-
$url = $request->to_url();
|
| 39 |
-
$response = $this->httpRequest($url, $headers, "GET");
|
| 40 |
-
parse_str($response, $response_params);
|
| 41 |
-
$this->request_token = new Plus_OAuthConsumer($response_params['oauth_token'], $response_params['oauth_token_secret'], 1);
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
function generateAuthorizeUrl()
|
| 45 |
-
{
|
| 46 |
-
$consumer = $this->consumer;
|
| 47 |
-
$request_token = $this->request_token;
|
| 48 |
-
return $this->authorize_path . "?oauth_token=" . $request_token->key;
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
function getAccessToken($oauth_verifier)
|
| 52 |
-
{
|
| 53 |
-
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->request_token, "GET", $this->access_token_path);
|
| 54 |
-
$request->set_parameter("oauth_verifier", $oauth_verifier);
|
| 55 |
-
$request->sign_request($this->signature_method, $this->consumer, $this->request_token);
|
| 56 |
-
$headers = Array();
|
| 57 |
-
$url = $request->to_url();
|
| 58 |
-
$response = $this->httpRequest($url, $headers, "GET");
|
| 59 |
-
parse_str($response, $response_params);
|
| 60 |
-
$this->access_token = new Plus_OAuthConsumer($response_params['oauth_token'], $response_params['oauth_token_secret'], 1);
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
function getCompanyFollowersById($companyID = "")
|
| 64 |
-
{
|
| 65 |
-
$api_url = $this->base_url . "/v1/companies/".$companyID.":(num-followers)/";
|
| 66 |
-
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->access_token, "GET", $api_url);
|
| 67 |
-
$request->sign_request($this->signature_method, $this->consumer, $this->access_token);
|
| 68 |
-
$auth_header = $request->to_header("https://api.linkedin.com"); # this is the realm
|
| 69 |
-
$response = $this->httpRequest($api_url, $auth_header, "GET");
|
| 70 |
-
return $response;
|
| 71 |
-
}
|
| 72 |
-
function getCompanyFollowersByName($companyName = "")
|
| 73 |
-
{
|
| 74 |
-
$api_url = $this->base_url . "/v1/companies/universal-name=".$companyName.":(num-followers)/";
|
| 75 |
-
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->access_token, "GET", $api_url);
|
| 76 |
-
$request->sign_request($this->signature_method, $this->consumer, $this->access_token);
|
| 77 |
-
$auth_header = $request->to_header("https://api.linkedin.com"); # this is the realm
|
| 78 |
-
$response = $this->httpRequest($api_url, $auth_header, "GET");
|
| 79 |
-
|
| 80 |
-
return $response;
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
function httpRequest($url, $auth_header, $method, $body = NULL)
|
| 86 |
-
{
|
| 87 |
-
if (!$method) {
|
| 88 |
-
$method = "GET";
|
| 89 |
-
};
|
| 90 |
-
|
| 91 |
-
$curl = curl_init();
|
| 92 |
-
curl_setopt($curl, CURLOPT_URL, $url);
|
| 93 |
-
curl_setopt($curl, CURLOPT_HEADER, 0);
|
| 94 |
-
curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1);
|
| 95 |
-
curl_setopt($curl, CURLOPT_HTTPHEADER, array($auth_header)); // Set the headers.
|
| 96 |
-
|
| 97 |
-
if ($body) {
|
| 98 |
-
curl_setopt($curl, CURLOPT_POST, 1);
|
| 99 |
-
curl_setopt($curl, CURLOPT_POSTFIELDS, $body);
|
| 100 |
-
curl_setopt($curl, CURLOPT_CUSTOMREQUEST, $method);
|
| 101 |
-
curl_setopt($curl, CURLOPT_HTTPHEADER, array($auth_header, "Content-Type: text/xml;charset=utf-8"));
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
$data = curl_exec($curl);
|
| 105 |
-
curl_close($curl);
|
| 106 |
-
return $data;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
function Plus_array_msort($array, $cols)
|
| 112 |
-
{
|
| 113 |
-
$colarr = array();
|
| 114 |
-
foreach ($cols as $col => $order) {
|
| 115 |
-
$colarr[$col] = array();
|
| 116 |
-
foreach ($array as $k => $row) { $colarr[$col]['_'.$k] = strtolower($row[$col]); }
|
| 117 |
-
}
|
| 118 |
-
$eval = 'array_multisort(';
|
| 119 |
-
foreach ($cols as $col => $order) {
|
| 120 |
-
$eval .= '$colarr[\''.$col.'\'],'.$order.',';
|
| 121 |
-
}
|
| 122 |
-
$eval = substr($eval,0,-1).');';
|
| 123 |
-
eval($eval);
|
| 124 |
-
$ret = array();
|
| 125 |
-
foreach ($colarr as $col => $arr) {
|
| 126 |
-
foreach ($arr as $k => $v) {
|
| 127 |
-
$k = substr($k,1);
|
| 128 |
-
if (!isset($ret[$k])) $ret[$k] = $array[$k];
|
| 129 |
-
$ret[$k][$col] = $array[$k][$col];
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
return $ret;
|
| 133 |
-
|
| 134 |
-
}
|
| 1 |
+
<?php
|
| 2 |
+
require_once(SFSI_PLUS_DOCROOT.'/helpers/sfsi_plus_OAuth.php');
|
| 3 |
+
|
| 4 |
+
class Plus_LinkedIn {
|
| 5 |
+
public $base_url = "http://api.linkedin.com";
|
| 6 |
+
public $secure_base_url = "https://api.linkedin.com";
|
| 7 |
+
public $oauth_callback = "oob";
|
| 8 |
+
public $consumer;
|
| 9 |
+
public $request_token;
|
| 10 |
+
public $access_token;
|
| 11 |
+
public $oauth_verifier;
|
| 12 |
+
public $signature_method;
|
| 13 |
+
public $request_token_path;
|
| 14 |
+
public $access_token_path;
|
| 15 |
+
public $authorize_path;
|
| 16 |
+
|
| 17 |
+
function __construct($consumer_key, $consumer_secret,$request_token, $oauth_callback = NULL)
|
| 18 |
+
{
|
| 19 |
+
|
| 20 |
+
if($oauth_callback) {
|
| 21 |
+
$this->oauth_callback = $oauth_callback;
|
| 22 |
+
}
|
| 23 |
+
$this->request_token=
|
| 24 |
+
$this->consumer = new Plus_OAuthConsumer($consumer_key, $consumer_secret, $this->oauth_callback);
|
| 25 |
+
$this->signature_method = new Plus_OAuthSignatureMethod_HMAC_SHA1();
|
| 26 |
+
$this->request_token_path = $this->secure_base_url . "/uas/oauth/requestToken?scope=r_basicprofile+r_emailaddress+r_network+w_messages";
|
| 27 |
+
$this->access_token_path = $this->secure_base_url . "/uas/oauth/accessToken";
|
| 28 |
+
$this->authorize_path = $this->secure_base_url . "/uas/oauth/authorize";
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
function getRequestToken()
|
| 32 |
+
{
|
| 33 |
+
$consumer = $this->consumer;
|
| 34 |
+
$request = Plus_OAuthRequest::from_consumer_and_token($consumer, NULL, "GET", $this->request_token_path);
|
| 35 |
+
$request->set_parameter("oauth_callback", $this->oauth_callback);
|
| 36 |
+
$request->sign_request($this->signature_method, $consumer, NULL);
|
| 37 |
+
$headers = Array();
|
| 38 |
+
$url = $request->to_url();
|
| 39 |
+
$response = $this->httpRequest($url, $headers, "GET");
|
| 40 |
+
parse_str($response, $response_params);
|
| 41 |
+
$this->request_token = new Plus_OAuthConsumer($response_params['oauth_token'], $response_params['oauth_token_secret'], 1);
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
function generateAuthorizeUrl()
|
| 45 |
+
{
|
| 46 |
+
$consumer = $this->consumer;
|
| 47 |
+
$request_token = $this->request_token;
|
| 48 |
+
return $this->authorize_path . "?oauth_token=" . $request_token->key;
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
function getAccessToken($oauth_verifier)
|
| 52 |
+
{
|
| 53 |
+
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->request_token, "GET", $this->access_token_path);
|
| 54 |
+
$request->set_parameter("oauth_verifier", $oauth_verifier);
|
| 55 |
+
$request->sign_request($this->signature_method, $this->consumer, $this->request_token);
|
| 56 |
+
$headers = Array();
|
| 57 |
+
$url = $request->to_url();
|
| 58 |
+
$response = $this->httpRequest($url, $headers, "GET");
|
| 59 |
+
parse_str($response, $response_params);
|
| 60 |
+
$this->access_token = new Plus_OAuthConsumer($response_params['oauth_token'], $response_params['oauth_token_secret'], 1);
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
function getCompanyFollowersById($companyID = "")
|
| 64 |
+
{
|
| 65 |
+
$api_url = $this->base_url . "/v1/companies/".$companyID.":(num-followers)/";
|
| 66 |
+
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->access_token, "GET", $api_url);
|
| 67 |
+
$request->sign_request($this->signature_method, $this->consumer, $this->access_token);
|
| 68 |
+
$auth_header = $request->to_header("https://api.linkedin.com"); # this is the realm
|
| 69 |
+
$response = $this->httpRequest($api_url, $auth_header, "GET");
|
| 70 |
+
return $response;
|
| 71 |
+
}
|
| 72 |
+
function getCompanyFollowersByName($companyName = "")
|
| 73 |
+
{
|
| 74 |
+
$api_url = $this->base_url . "/v1/companies/universal-name=".$companyName.":(num-followers)/";
|
| 75 |
+
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->access_token, "GET", $api_url);
|
| 76 |
+
$request->sign_request($this->signature_method, $this->consumer, $this->access_token);
|
| 77 |
+
$auth_header = $request->to_header("https://api.linkedin.com"); # this is the realm
|
| 78 |
+
$response = $this->httpRequest($api_url, $auth_header, "GET");
|
| 79 |
+
|
| 80 |
+
return $response;
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
function httpRequest($url, $auth_header, $method, $body = NULL)
|
| 86 |
+
{
|
| 87 |
+
if (!$method) {
|
| 88 |
+
$method = "GET";
|
| 89 |
+
};
|
| 90 |
+
|
| 91 |
+
$curl = curl_init();
|
| 92 |
+
curl_setopt($curl, CURLOPT_URL, $url);
|
| 93 |
+
curl_setopt($curl, CURLOPT_HEADER, 0);
|
| 94 |
+
curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1);
|
| 95 |
+
curl_setopt($curl, CURLOPT_HTTPHEADER, array($auth_header)); // Set the headers.
|
| 96 |
+
|
| 97 |
+
if ($body) {
|
| 98 |
+
curl_setopt($curl, CURLOPT_POST, 1);
|
| 99 |
+
curl_setopt($curl, CURLOPT_POSTFIELDS, $body);
|
| 100 |
+
curl_setopt($curl, CURLOPT_CUSTOMREQUEST, $method);
|
| 101 |
+
curl_setopt($curl, CURLOPT_HTTPHEADER, array($auth_header, "Content-Type: text/xml;charset=utf-8"));
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
$data = curl_exec($curl);
|
| 105 |
+
curl_close($curl);
|
| 106 |
+
return $data;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
function Plus_array_msort($array, $cols)
|
| 112 |
+
{
|
| 113 |
+
$colarr = array();
|
| 114 |
+
foreach ($cols as $col => $order) {
|
| 115 |
+
$colarr[$col] = array();
|
| 116 |
+
foreach ($array as $k => $row) { $colarr[$col]['_'.$k] = strtolower($row[$col]); }
|
| 117 |
+
}
|
| 118 |
+
$eval = 'array_multisort(';
|
| 119 |
+
foreach ($cols as $col => $order) {
|
| 120 |
+
$eval .= '$colarr[\''.$col.'\'],'.$order.',';
|
| 121 |
+
}
|
| 122 |
+
$eval = substr($eval,0,-1).');';
|
| 123 |
+
eval($eval);
|
| 124 |
+
$ret = array();
|
| 125 |
+
foreach ($colarr as $col => $arr) {
|
| 126 |
+
foreach ($arr as $k => $v) {
|
| 127 |
+
$k = substr($k,1);
|
| 128 |
+
if (!isset($ret[$k])) $ret[$k] = $array[$k];
|
| 129 |
+
$ret[$k][$col] = $array[$k][$col];
|
| 130 |
+
}
|
| 131 |
+
}
|
| 132 |
+
return $ret;
|
| 133 |
+
|
| 134 |
+
}
|
helpers/sfsi_plus_OAuth.php
CHANGED
|
@@ -1,893 +1,893 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
// vim: foldmethod=marker
|
| 3 |
-
|
| 4 |
-
/* Generic exception class
|
| 5 |
-
*/
|
| 6 |
-
if (!class_exists('Plus_OAuthException')) {
|
| 7 |
-
class Plus_OAuthException extends Exception {
|
| 8 |
-
// pass
|
| 9 |
-
}
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
if (!class_exists('Plus_OAuthConsumer')) {
|
| 13 |
-
class Plus_OAuthConsumer {
|
| 14 |
-
public $key;
|
| 15 |
-
public $secret;
|
| 16 |
-
|
| 17 |
-
function __construct($key, $secret, $callback_url=NULL) {
|
| 18 |
-
$this->key = $key;
|
| 19 |
-
$this->secret = $secret;
|
| 20 |
-
$this->callback_url = $callback_url;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
function __toString() {
|
| 24 |
-
return "Plus_OAuthConsumer[key=$this->key,secret=$this->secret]";
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
if (!class_exists('Plus_OAuthToken')) {
|
| 30 |
-
class Plus_OAuthToken {
|
| 31 |
-
// access tokens and request tokens
|
| 32 |
-
public $key;
|
| 33 |
-
public $secret;
|
| 34 |
-
|
| 35 |
-
/**
|
| 36 |
-
* key = the token
|
| 37 |
-
* secret = the token secret
|
| 38 |
-
*/
|
| 39 |
-
function __construct($key, $secret) {
|
| 40 |
-
$this->key = $key;
|
| 41 |
-
$this->secret = $secret;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* generates the basic string serialization of a token that a server
|
| 46 |
-
* would respond to request_token and access_token calls with
|
| 47 |
-
*/
|
| 48 |
-
function to_string() {
|
| 49 |
-
return "oauth_token=" .
|
| 50 |
-
Plus_OAuthUtil::urlencode_rfc3986($this->key) .
|
| 51 |
-
"&oauth_token_secret=" .
|
| 52 |
-
Plus_OAuthUtil::urlencode_rfc3986($this->secret);
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
function __toString() {
|
| 56 |
-
return $this->to_string();
|
| 57 |
-
}
|
| 58 |
-
}
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* A class for implementing a Signature Method
|
| 63 |
-
* See section 9 ("Signing Requests") in the spec
|
| 64 |
-
*/
|
| 65 |
-
if (!class_exists('Plus_OAuthSignatureMethod')) {
|
| 66 |
-
abstract class Plus_OAuthSignatureMethod {
|
| 67 |
-
/**
|
| 68 |
-
* Needs to return the name of the Signature Method (ie HMAC-SHA1)
|
| 69 |
-
* @return string
|
| 70 |
-
*/
|
| 71 |
-
abstract public function get_name();
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Build up the signature
|
| 75 |
-
* NOTE: The output of this function MUST NOT be urlencoded.
|
| 76 |
-
* the encoding is handled in OAuthRequest when the final
|
| 77 |
-
* request is serialized
|
| 78 |
-
* @param OAuthRequest $request
|
| 79 |
-
* @param OAuthConsumer $consumer
|
| 80 |
-
* @param OAuthToken $token
|
| 81 |
-
* @return string
|
| 82 |
-
*/
|
| 83 |
-
abstract public function build_signature($request, $consumer, $token);
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* Verifies that a given signature is correct
|
| 87 |
-
* @param OAuthRequest $request
|
| 88 |
-
* @param OAuthConsumer $consumer
|
| 89 |
-
* @param OAuthToken $token
|
| 90 |
-
* @param string $signature
|
| 91 |
-
* @return bool
|
| 92 |
-
*/
|
| 93 |
-
public function check_signature($request, $consumer, $token, $signature) {
|
| 94 |
-
$built = $this->build_signature($request, $consumer, $token);
|
| 95 |
-
return $built == $signature;
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
|
| 102 |
-
* where the Signature Base String is the text and the key is the concatenated values (each first
|
| 103 |
-
* encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
|
| 104 |
-
* character (ASCII code 38) even if empty.
|
| 105 |
-
* - Chapter 9.2 ("HMAC-SHA1")
|
| 106 |
-
*/
|
| 107 |
-
if (!class_exists('Plus_OAuthSignatureMethod_HMAC_SHA1')) {
|
| 108 |
-
class Plus_OAuthSignatureMethod_HMAC_SHA1 extends Plus_OAuthSignatureMethod {
|
| 109 |
-
function get_name() {
|
| 110 |
-
return "HMAC-SHA1";
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
public function build_signature($request, $consumer, $token) {
|
| 114 |
-
$base_string = $request->get_signature_base_string();
|
| 115 |
-
$request->base_string = $base_string;
|
| 116 |
-
|
| 117 |
-
$key_parts = array(
|
| 118 |
-
$consumer->secret,
|
| 119 |
-
($token) ? $token->secret : ""
|
| 120 |
-
);
|
| 121 |
-
|
| 122 |
-
$key_parts = Plus_OAuthUtil::urlencode_rfc3986($key_parts);
|
| 123 |
-
$key = implode('&', $key_parts);
|
| 124 |
-
|
| 125 |
-
return base64_encode(hash_hmac('sha1', $base_string, $key, true));
|
| 126 |
-
}
|
| 127 |
-
}
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* The PLAINTEXT method does not provide any security protection and SHOULD only be used
|
| 132 |
-
* over a secure channel such as HTTPS. It does not use the Signature Base String.
|
| 133 |
-
* - Chapter 9.4 ("PLAINTEXT")
|
| 134 |
-
*/
|
| 135 |
-
if (!class_exists('Plus_OAuthSignatureMethod_PLAINTEXT')) {
|
| 136 |
-
class Plus_OAuthSignatureMethod_PLAINTEXT extends Plus_OAuthSignatureMethod {
|
| 137 |
-
public function get_name() {
|
| 138 |
-
return "PLAINTEXT";
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
/**
|
| 142 |
-
* oauth_signature is set to the concatenated encoded values of the Consumer Secret and
|
| 143 |
-
* Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
|
| 144 |
-
* empty. The result MUST be encoded again.
|
| 145 |
-
* - Chapter 9.4.1 ("Generating Signatures")
|
| 146 |
-
*
|
| 147 |
-
* Please note that the second encoding MUST NOT happen in the SignatureMethod, as
|
| 148 |
-
* OAuthRequest handles this!
|
| 149 |
-
*/
|
| 150 |
-
public function build_signature($request, $consumer, $token) {
|
| 151 |
-
$key_parts = array(
|
| 152 |
-
$consumer->secret,
|
| 153 |
-
($token) ? $token->secret : ""
|
| 154 |
-
);
|
| 155 |
-
|
| 156 |
-
$key_parts = Plus_OAuthUtil::urlencode_rfc3986($key_parts);
|
| 157 |
-
$key = implode('&', $key_parts);
|
| 158 |
-
$request->base_string = $key;
|
| 159 |
-
|
| 160 |
-
return $key;
|
| 161 |
-
}
|
| 162 |
-
}
|
| 163 |
-
}
|
| 164 |
-
/**
|
| 165 |
-
* The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
|
| 166 |
-
* [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
|
| 167 |
-
* EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
|
| 168 |
-
* verified way to the Service Provider, in a manner which is beyond the scope of this
|
| 169 |
-
* specification.
|
| 170 |
-
* - Chapter 9.3 ("RSA-SHA1")
|
| 171 |
-
*/
|
| 172 |
-
if (!class_exists('Plus_OAuthSignatureMethod_RSA_SHA1')) {
|
| 173 |
-
abstract class Plus_OAuthSignatureMethod_RSA_SHA1 extends Plus_OAuthSignatureMethod {
|
| 174 |
-
public function get_name() {
|
| 175 |
-
return "RSA-SHA1";
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 179 |
-
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 180 |
-
// (2) fetch via http using a url provided by the requester
|
| 181 |
-
// (3) some sort of specific discovery code based on request
|
| 182 |
-
//
|
| 183 |
-
// Either way should return a string representation of the certificate
|
| 184 |
-
protected abstract function fetch_public_cert(&$request);
|
| 185 |
-
|
| 186 |
-
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 187 |
-
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 188 |
-
//
|
| 189 |
-
// Either way should return a string representation of the certificate
|
| 190 |
-
protected abstract function fetch_private_cert(&$request);
|
| 191 |
-
|
| 192 |
-
public function build_signature($request, $consumer, $token) {
|
| 193 |
-
$base_string = $request->get_signature_base_string();
|
| 194 |
-
$request->base_string = $base_string;
|
| 195 |
-
|
| 196 |
-
// Fetch the private key cert based on the request
|
| 197 |
-
$cert = $this->fetch_private_cert($request);
|
| 198 |
-
|
| 199 |
-
// Pull the private key ID from the certificate
|
| 200 |
-
$privatekeyid = openssl_get_privatekey($cert);
|
| 201 |
-
|
| 202 |
-
// Sign using the key
|
| 203 |
-
$ok = openssl_sign($base_string, $signature, $privatekeyid);
|
| 204 |
-
|
| 205 |
-
// Release the key resource
|
| 206 |
-
openssl_free_key($privatekeyid);
|
| 207 |
-
|
| 208 |
-
return base64_encode($signature);
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
public function check_signature($request, $consumer, $token, $signature) {
|
| 212 |
-
$decoded_sig = base64_decode($signature);
|
| 213 |
-
|
| 214 |
-
$base_string = $request->get_signature_base_string();
|
| 215 |
-
|
| 216 |
-
// Fetch the public key cert based on the request
|
| 217 |
-
$cert = $this->fetch_public_cert($request);
|
| 218 |
-
|
| 219 |
-
// Pull the public key ID from the certificate
|
| 220 |
-
$publickeyid = openssl_get_publickey($cert);
|
| 221 |
-
|
| 222 |
-
// Check the computed signature against the one passed in the query
|
| 223 |
-
$ok = openssl_verify($base_string, $decoded_sig, $publickeyid);
|
| 224 |
-
|
| 225 |
-
// Release the key resource
|
| 226 |
-
openssl_free_key($publickeyid);
|
| 227 |
-
|
| 228 |
-
return $ok == 1;
|
| 229 |
-
}
|
| 230 |
-
}
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
if (!class_exists('Plus_OAuthRequest')) {
|
| 234 |
-
class Plus_OAuthRequest {
|
| 235 |
-
private $parameters;
|
| 236 |
-
private $http_method;
|
| 237 |
-
private $http_url;
|
| 238 |
-
// for debug purposes
|
| 239 |
-
public $base_string;
|
| 240 |
-
public static $version = '1.0';
|
| 241 |
-
public static $POST_INPUT = 'php://input';
|
| 242 |
-
|
| 243 |
-
function __construct($http_method, $http_url, $parameters=NULL) {
|
| 244 |
-
@$parameters or $parameters = array();
|
| 245 |
-
$parameters = array_merge( Plus_OAuthUtil::parse_parameters(parse_url($http_url, PHP_URL_QUERY)), $parameters);
|
| 246 |
-
$this->parameters = $parameters;
|
| 247 |
-
$this->http_method = $http_method;
|
| 248 |
-
$this->http_url = $http_url;
|
| 249 |
-
}
|
| 250 |
-
|
| 251 |
-
|
| 252 |
-
/**
|
| 253 |
-
* attempt to build up a request from what was passed to the server
|
| 254 |
-
*/
|
| 255 |
-
public static function from_request($http_method=NULL, $http_url=NULL, $parameters=NULL) {
|
| 256 |
-
$scheme = (!isset($_SERVER['HTTPS']) || $_SERVER['HTTPS'] != "on")
|
| 257 |
-
? 'http'
|
| 258 |
-
: 'https';
|
| 259 |
-
@$http_url or $http_url = $scheme .
|
| 260 |
-
'://' . $_SERVER['HTTP_HOST'] .
|
| 261 |
-
':' .
|
| 262 |
-
$_SERVER['SERVER_PORT'] .
|
| 263 |
-
$_SERVER['REQUEST_URI'];
|
| 264 |
-
@$http_method or $http_method = $_SERVER['REQUEST_METHOD'];
|
| 265 |
-
|
| 266 |
-
// We weren't handed any parameters, so let's find the ones relevant to
|
| 267 |
-
// this request.
|
| 268 |
-
// If you run XML-RPC or similar you should use this to provide your own
|
| 269 |
-
// parsed parameter-list
|
| 270 |
-
if (!$parameters) {
|
| 271 |
-
// Find request headers
|
| 272 |
-
$request_headers = Plus_OAuthUtil::get_headers();
|
| 273 |
-
|
| 274 |
-
// Parse the query-string to find GET parameters
|
| 275 |
-
$parameters = Plus_OAuthUtil::parse_parameters($_SERVER['QUERY_STRING']);
|
| 276 |
-
|
| 277 |
-
// It's a POST request of the proper content-type, so parse POST
|
| 278 |
-
// parameters and add those overriding any duplicates from GET
|
| 279 |
-
if ($http_method == "POST"
|
| 280 |
-
&& @strstr($request_headers["Content-Type"],
|
| 281 |
-
"application/x-www-form-urlencoded")
|
| 282 |
-
) {
|
| 283 |
-
$post_data = Plus_OAuthUtil::parse_parameters(
|
| 284 |
-
file_get_contents(self::$POST_INPUT)
|
| 285 |
-
);
|
| 286 |
-
$parameters = array_merge($parameters, $post_data);
|
| 287 |
-
}
|
| 288 |
-
|
| 289 |
-
// We have a Authorization-header with OAuth data. Parse the header
|
| 290 |
-
// and add those overriding any duplicates from GET or POST
|
| 291 |
-
if (@substr($request_headers['Authorization'], 0, 6) == "OAuth ") {
|
| 292 |
-
$header_parameters = Plus_OAuthUtil::split_header(
|
| 293 |
-
$request_headers['Authorization']
|
| 294 |
-
);
|
| 295 |
-
$parameters = array_merge($parameters, $header_parameters);
|
| 296 |
-
}
|
| 297 |
-
|
| 298 |
-
}
|
| 299 |
-
|
| 300 |
-
return new Plus_OAuthRequest($http_method, $http_url, $parameters);
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
/**
|
| 304 |
-
* pretty much a helper function to set up the request
|
| 305 |
-
*/
|
| 306 |
-
public static function from_consumer_and_token($consumer, $token, $http_method, $http_url, $parameters=NULL) {
|
| 307 |
-
@$parameters or $parameters = array();
|
| 308 |
-
$defaults = array("oauth_version" => Plus_OAuthRequest::$version,
|
| 309 |
-
"oauth_nonce" => Plus_OAuthRequest::generate_nonce(),
|
| 310 |
-
"oauth_timestamp" => Plus_OAuthRequest::generate_timestamp(),
|
| 311 |
-
"oauth_consumer_key" => $consumer->key);
|
| 312 |
-
if ($token)
|
| 313 |
-
$defaults['oauth_token'] = $token->key;
|
| 314 |
-
|
| 315 |
-
$parameters = array_merge($defaults, $parameters);
|
| 316 |
-
|
| 317 |
-
return new Plus_OAuthRequest($http_method, $http_url, $parameters);
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
public function set_parameter($name, $value, $allow_duplicates = true) {
|
| 321 |
-
if ($allow_duplicates && isset($this->parameters[$name])) {
|
| 322 |
-
// We have already added parameter(s) with this name, so add to the list
|
| 323 |
-
if (is_scalar($this->parameters[$name])) {
|
| 324 |
-
// This is the first duplicate, so transform scalar (string)
|
| 325 |
-
// into an array so we can add the duplicates
|
| 326 |
-
$this->parameters[$name] = array($this->parameters[$name]);
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
$this->parameters[$name][] = $value;
|
| 330 |
-
} else {
|
| 331 |
-
$this->parameters[$name] = $value;
|
| 332 |
-
}
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
public function get_parameter($name) {
|
| 336 |
-
return isset($this->parameters[$name]) ? $this->parameters[$name] : null;
|
| 337 |
-
}
|
| 338 |
-
|
| 339 |
-
public function get_parameters() {
|
| 340 |
-
return $this->parameters;
|
| 341 |
-
}
|
| 342 |
-
|
| 343 |
-
public function unset_parameter($name) {
|
| 344 |
-
unset($this->parameters[$name]);
|
| 345 |
-
}
|
| 346 |
-
|
| 347 |
-
/**
|
| 348 |
-
* The request parameters, sorted and concatenated into a normalized string.
|
| 349 |
-
* @return string
|
| 350 |
-
*/
|
| 351 |
-
public function get_signable_parameters() {
|
| 352 |
-
// Grab all parameters
|
| 353 |
-
$params = $this->parameters;
|
| 354 |
-
|
| 355 |
-
// Remove oauth_signature if present
|
| 356 |
-
// Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
|
| 357 |
-
if (isset($params['oauth_signature'])) {
|
| 358 |
-
unset($params['oauth_signature']);
|
| 359 |
-
}
|
| 360 |
-
|
| 361 |
-
return Plus_OAuthUtil::build_http_query($params);
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
/**
|
| 365 |
-
* Returns the base string of this request
|
| 366 |
-
*
|
| 367 |
-
* The base string defined as the method, the url
|
| 368 |
-
* and the parameters (normalized), each urlencoded
|
| 369 |
-
* and the concated with &.
|
| 370 |
-
*/
|
| 371 |
-
public function get_signature_base_string() {
|
| 372 |
-
$parts = array(
|
| 373 |
-
$this->get_normalized_http_method(),
|
| 374 |
-
$this->get_normalized_http_url(),
|
| 375 |
-
$this->get_signable_parameters()
|
| 376 |
-
);
|
| 377 |
-
|
| 378 |
-
$parts = Plus_OAuthUtil::urlencode_rfc3986($parts);
|
| 379 |
-
|
| 380 |
-
return implode('&', $parts);
|
| 381 |
-
}
|
| 382 |
-
|
| 383 |
-
/**
|
| 384 |
-
* just uppercases the http method
|
| 385 |
-
*/
|
| 386 |
-
public function get_normalized_http_method() {
|
| 387 |
-
return strtoupper($this->http_method);
|
| 388 |
-
}
|
| 389 |
-
|
| 390 |
-
/**
|
| 391 |
-
* parses the url and rebuilds it to be
|
| 392 |
-
* scheme://host/path
|
| 393 |
-
*/
|
| 394 |
-
public function get_normalized_http_url() {
|
| 395 |
-
$parts = parse_url($this->http_url);
|
| 396 |
-
|
| 397 |
-
$port = @$parts['port'];
|
| 398 |
-
$scheme = $parts['scheme'];
|
| 399 |
-
$host = $parts['host'];
|
| 400 |
-
$path = @$parts['path'];
|
| 401 |
-
|
| 402 |
-
$port or $port = ($scheme == 'https') ? '443' : '80';
|
| 403 |
-
|
| 404 |
-
if (($scheme == 'https' && $port != '443')
|
| 405 |
-
|| ($scheme == 'http' && $port != '80')) {
|
| 406 |
-
$host = "$host:$port";
|
| 407 |
-
}
|
| 408 |
-
return "$scheme://$host$path";
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
/**
|
| 412 |
-
* builds a url usable for a GET request
|
| 413 |
-
*/
|
| 414 |
-
public function to_url() {
|
| 415 |
-
$post_data = $this->to_postdata();
|
| 416 |
-
$out = $this->get_normalized_http_url();
|
| 417 |
-
if ($post_data) {
|
| 418 |
-
$out .= '?'.$post_data;
|
| 419 |
-
}
|
| 420 |
-
return $out;
|
| 421 |
-
}
|
| 422 |
-
|
| 423 |
-
/**
|
| 424 |
-
* builds the data one would send in a POST request
|
| 425 |
-
*/
|
| 426 |
-
public function to_postdata() {
|
| 427 |
-
return Plus_OAuthUtil::build_http_query($this->parameters);
|
| 428 |
-
}
|
| 429 |
-
|
| 430 |
-
/**
|
| 431 |
-
* builds the Authorization: header
|
| 432 |
-
*/
|
| 433 |
-
public function to_header($realm=null) {
|
| 434 |
-
$first = true;
|
| 435 |
-
if($realm) {
|
| 436 |
-
$out = 'Authorization: OAuth realm="' . Plus_OAuthUtil::urlencode_rfc3986($realm) . '"';
|
| 437 |
-
$first = false;
|
| 438 |
-
} else
|
| 439 |
-
$out = 'Authorization: OAuth';
|
| 440 |
-
|
| 441 |
-
$total = array();
|
| 442 |
-
foreach ($this->parameters as $k => $v) {
|
| 443 |
-
if (substr($k, 0, 5) != "oauth") continue;
|
| 444 |
-
if (is_array($v)) {
|
| 445 |
-
throw new Plus_OAuthException('Arrays not supported in headers');
|
| 446 |
-
}
|
| 447 |
-
$out .= ($first) ? ' ' : ',';
|
| 448 |
-
$out .= Plus_OAuthUtil::urlencode_rfc3986($k) .
|
| 449 |
-
'="' .
|
| 450 |
-
Plus_OAuthUtil::urlencode_rfc3986($v) .
|
| 451 |
-
'"';
|
| 452 |
-
$first = false;
|
| 453 |
-
}
|
| 454 |
-
return $out;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
public function __toString() {
|
| 458 |
-
return $this->to_url();
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
|
| 462 |
-
public function sign_request($signature_method, $consumer, $token) {
|
| 463 |
-
$this->set_parameter(
|
| 464 |
-
"oauth_signature_method",
|
| 465 |
-
$signature_method->get_name(),
|
| 466 |
-
false
|
| 467 |
-
);
|
| 468 |
-
$signature = $this->build_signature($signature_method, $consumer, $token);
|
| 469 |
-
$this->set_parameter("oauth_signature", $signature, false);
|
| 470 |
-
}
|
| 471 |
-
|
| 472 |
-
public function build_signature($signature_method, $consumer, $token) {
|
| 473 |
-
$signature = $signature_method->build_signature($this, $consumer, $token);
|
| 474 |
-
return $signature;
|
| 475 |
-
}
|
| 476 |
-
|
| 477 |
-
/**
|
| 478 |
-
* util function: current timestamp
|
| 479 |
-
*/
|
| 480 |
-
private static function generate_timestamp() {
|
| 481 |
-
return time();
|
| 482 |
-
}
|
| 483 |
-
|
| 484 |
-
/**
|
| 485 |
-
* util function: current nonce
|
| 486 |
-
*/
|
| 487 |
-
private static function generate_nonce() {
|
| 488 |
-
$mt = microtime();
|
| 489 |
-
$rand = mt_rand();
|
| 490 |
-
|
| 491 |
-
return md5($mt . $rand); // md5s look nicer than numbers
|
| 492 |
-
}
|
| 493 |
-
}
|
| 494 |
-
}
|
| 495 |
-
|
| 496 |
-
if (!class_exists('Plus_OAuthServer')) {
|
| 497 |
-
class Plus_OAuthServer {
|
| 498 |
-
protected $timestamp_threshold = 300; // in seconds, five minutes
|
| 499 |
-
protected $version = '1.0'; // hi blaine
|
| 500 |
-
protected $signature_methods = array();
|
| 501 |
-
|
| 502 |
-
protected $data_store;
|
| 503 |
-
|
| 504 |
-
function __construct($data_store) {
|
| 505 |
-
$this->data_store = $data_store;
|
| 506 |
-
}
|
| 507 |
-
|
| 508 |
-
public function add_signature_method($signature_method) {
|
| 509 |
-
$this->signature_methods[$signature_method->get_name()] =
|
| 510 |
-
$signature_method;
|
| 511 |
-
}
|
| 512 |
-
|
| 513 |
-
// high level functions
|
| 514 |
-
|
| 515 |
-
/**
|
| 516 |
-
* process a request_token request
|
| 517 |
-
* returns the request token on success
|
| 518 |
-
*/
|
| 519 |
-
public function fetch_request_token(&$request) {
|
| 520 |
-
$this->get_version($request);
|
| 521 |
-
|
| 522 |
-
$consumer = $this->get_consumer($request);
|
| 523 |
-
|
| 524 |
-
// no token required for the initial token request
|
| 525 |
-
$token = NULL;
|
| 526 |
-
|
| 527 |
-
$this->check_signature($request, $consumer, $token);
|
| 528 |
-
|
| 529 |
-
// Rev A change
|
| 530 |
-
$callback = $request->get_parameter('oauth_callback');
|
| 531 |
-
$new_token = $this->data_store->new_request_token($consumer, $callback);
|
| 532 |
-
|
| 533 |
-
return $new_token;
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
/**
|
| 537 |
-
* process an access_token request
|
| 538 |
-
* returns the access token on success
|
| 539 |
-
*/
|
| 540 |
-
public function fetch_access_token(&$request) {
|
| 541 |
-
$this->get_version($request);
|
| 542 |
-
|
| 543 |
-
$consumer = $this->get_consumer($request);
|
| 544 |
-
|
| 545 |
-
// requires authorized request token
|
| 546 |
-
$token = $this->get_token($request, $consumer, "request");
|
| 547 |
-
|
| 548 |
-
$this->check_signature($request, $consumer, $token);
|
| 549 |
-
|
| 550 |
-
// Rev A change
|
| 551 |
-
$verifier = $request->get_parameter('oauth_verifier');
|
| 552 |
-
$new_token = $this->data_store->new_access_token($token, $consumer, $verifier);
|
| 553 |
-
|
| 554 |
-
return $new_token;
|
| 555 |
-
}
|
| 556 |
-
|
| 557 |
-
/**
|
| 558 |
-
* verify an api call, checks all the parameters
|
| 559 |
-
*/
|
| 560 |
-
public function verify_request(&$request) {
|
| 561 |
-
$this->get_version($request);
|
| 562 |
-
$consumer = $this->get_consumer($request);
|
| 563 |
-
$token = $this->get_token($request, $consumer, "access");
|
| 564 |
-
$this->check_signature($request, $consumer, $token);
|
| 565 |
-
return array($consumer, $token);
|
| 566 |
-
}
|
| 567 |
-
|
| 568 |
-
// Internals from here
|
| 569 |
-
/**
|
| 570 |
-
* version 1
|
| 571 |
-
*/
|
| 572 |
-
private function get_version(&$request) {
|
| 573 |
-
$version = $request->get_parameter("oauth_version");
|
| 574 |
-
if (!$version) {
|
| 575 |
-
// Service Providers MUST assume the protocol version to be 1.0 if this parameter is not present.
|
| 576 |
-
// Chapter 7.0 ("Accessing Protected Ressources")
|
| 577 |
-
$version = '1.0';
|
| 578 |
-
}
|
| 579 |
-
if ($version !== $this->version) {
|
| 580 |
-
throw new Plus_OAuthException("OAuth version '$version' not supported");
|
| 581 |
-
}
|
| 582 |
-
return $version;
|
| 583 |
-
}
|
| 584 |
-
|
| 585 |
-
/**
|
| 586 |
-
* figure out the signature with some defaults
|
| 587 |
-
*/
|
| 588 |
-
private function get_signature_method(&$request) {
|
| 589 |
-
$signature_method =
|
| 590 |
-
@$request->get_parameter("oauth_signature_method");
|
| 591 |
-
|
| 592 |
-
if (!$signature_method) {
|
| 593 |
-
// According to chapter 7 ("Accessing Protected Ressources") the signature-method
|
| 594 |
-
// parameter is required, and we can't just fallback to PLAINTEXT
|
| 595 |
-
throw new Plus_OAuthException('No signature method parameter. This parameter is required');
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
if (!in_array($signature_method,
|
| 599 |
-
array_keys($this->signature_methods))) {
|
| 600 |
-
throw new Plus_OAuthException(
|
| 601 |
-
"Signature method '$signature_method' not supported " .
|
| 602 |
-
"try one of the following: " .
|
| 603 |
-
implode(", ", array_keys($this->signature_methods))
|
| 604 |
-
);
|
| 605 |
-
}
|
| 606 |
-
return $this->signature_methods[$signature_method];
|
| 607 |
-
}
|
| 608 |
-
|
| 609 |
-
/**
|
| 610 |
-
* try to find the consumer for the provided request's consumer key
|
| 611 |
-
*/
|
| 612 |
-
private function get_consumer(&$request) {
|
| 613 |
-
$consumer_key = @$request->get_parameter("oauth_consumer_key");
|
| 614 |
-
if (!$consumer_key) {
|
| 615 |
-
throw new Plus_OAuthException("Invalid consumer key");
|
| 616 |
-
}
|
| 617 |
-
|
| 618 |
-
$consumer = $this->data_store->lookup_consumer($consumer_key);
|
| 619 |
-
if (!$consumer) {
|
| 620 |
-
throw new Plus_OAuthException("Invalid consumer");
|
| 621 |
-
}
|
| 622 |
-
|
| 623 |
-
return $consumer;
|
| 624 |
-
}
|
| 625 |
-
|
| 626 |
-
/**
|
| 627 |
-
* try to find the token for the provided request's token key
|
| 628 |
-
*/
|
| 629 |
-
private function get_token(&$request, $consumer, $token_type="access") {
|
| 630 |
-
$token_field = @$request->get_parameter('oauth_token');
|
| 631 |
-
$token = $this->data_store->lookup_token(
|
| 632 |
-
$consumer, $token_type, $token_field
|
| 633 |
-
);
|
| 634 |
-
if (!$token) {
|
| 635 |
-
throw new Plus_OAuthException("Invalid $token_type token: $token_field");
|
| 636 |
-
}
|
| 637 |
-
return $token;
|
| 638 |
-
}
|
| 639 |
-
|
| 640 |
-
/**
|
| 641 |
-
* all-in-one function to check the signature on a request
|
| 642 |
-
* should guess the signature method appropriately
|
| 643 |
-
*/
|
| 644 |
-
private function check_signature(&$request, $consumer, $token) {
|
| 645 |
-
// this should probably be in a different method
|
| 646 |
-
$timestamp = @$request->get_parameter('oauth_timestamp');
|
| 647 |
-
$nonce = @$request->get_parameter('oauth_nonce');
|
| 648 |
-
|
| 649 |
-
$this->check_timestamp($timestamp);
|
| 650 |
-
$this->check_nonce($consumer, $token, $nonce, $timestamp);
|
| 651 |
-
|
| 652 |
-
$signature_method = $this->get_signature_method($request);
|
| 653 |
-
|
| 654 |
-
$signature = $request->get_parameter('oauth_signature');
|
| 655 |
-
$valid_sig = $signature_method->check_signature(
|
| 656 |
-
$request,
|
| 657 |
-
$consumer,
|
| 658 |
-
$token,
|
| 659 |
-
$signature
|
| 660 |
-
);
|
| 661 |
-
|
| 662 |
-
if (!$valid_sig) {
|
| 663 |
-
throw new Plus_OAuthException("Invalid signature");
|
| 664 |
-
}
|
| 665 |
-
}
|
| 666 |
-
|
| 667 |
-
/**
|
| 668 |
-
* check that the timestamp is new enough
|
| 669 |
-
*/
|
| 670 |
-
private function check_timestamp($timestamp) {
|
| 671 |
-
if( ! $timestamp )
|
| 672 |
-
throw new Plus_OAuthException(
|
| 673 |
-
'Missing timestamp parameter. The parameter is required'
|
| 674 |
-
);
|
| 675 |
-
|
| 676 |
-
// verify that timestamp is recentish
|
| 677 |
-
$now = time();
|
| 678 |
-
if (abs($now - $timestamp) > $this->timestamp_threshold) {
|
| 679 |
-
throw new Plus_OAuthException(
|
| 680 |
-
"Expired timestamp, yours $timestamp, ours $now"
|
| 681 |
-
);
|
| 682 |
-
}
|
| 683 |
-
}
|
| 684 |
-
|
| 685 |
-
/**
|
| 686 |
-
* check that the nonce is not repeated
|
| 687 |
-
*/
|
| 688 |
-
private function check_nonce($consumer, $token, $nonce, $timestamp) {
|
| 689 |
-
if( ! $nonce )
|
| 690 |
-
throw new Plus_OAuthException(
|
| 691 |
-
'Missing nonce parameter. The parameter is required'
|
| 692 |
-
);
|
| 693 |
-
|
| 694 |
-
// verify that the nonce is uniqueish
|
| 695 |
-
$found = $this->data_store->lookup_nonce(
|
| 696 |
-
$consumer,
|
| 697 |
-
$token,
|
| 698 |
-
$nonce,
|
| 699 |
-
$timestamp
|
| 700 |
-
);
|
| 701 |
-
if ($found) {
|
| 702 |
-
throw new Plus_OAuthException("Nonce already used: $nonce");
|
| 703 |
-
}
|
| 704 |
-
}
|
| 705 |
-
|
| 706 |
-
}
|
| 707 |
-
}
|
| 708 |
-
|
| 709 |
-
if (!class_exists('Plus_OAuthDataStore')) {
|
| 710 |
-
class Plus_OAuthDataStore {
|
| 711 |
-
function lookup_consumer($consumer_key) {
|
| 712 |
-
// implement me
|
| 713 |
-
}
|
| 714 |
-
|
| 715 |
-
function lookup_token($consumer, $token_type, $token) {
|
| 716 |
-
// implement me
|
| 717 |
-
}
|
| 718 |
-
|
| 719 |
-
function lookup_nonce($consumer, $token, $nonce, $timestamp) {
|
| 720 |
-
// implement me
|
| 721 |
-
}
|
| 722 |
-
|
| 723 |
-
function new_request_token($consumer, $callback = null) {
|
| 724 |
-
// return a new token attached to this consumer
|
| 725 |
-
}
|
| 726 |
-
|
| 727 |
-
function new_access_token($token, $consumer, $verifier = null) {
|
| 728 |
-
// return a new access token attached to this consumer
|
| 729 |
-
// for the user associated with this token if the request token
|
| 730 |
-
// is authorized
|
| 731 |
-
// should also invalidate the request token
|
| 732 |
-
}
|
| 733 |
-
|
| 734 |
-
}
|
| 735 |
-
}
|
| 736 |
-
|
| 737 |
-
if (!class_exists('Plus_OAuthUtil')) {
|
| 738 |
-
class Plus_OAuthUtil {
|
| 739 |
-
public static function urlencode_rfc3986($input) {
|
| 740 |
-
if (is_array($input)) {
|
| 741 |
-
return array_map(array('Plus_OAuthUtil', 'urlencode_rfc3986'), $input);
|
| 742 |
-
} else if (is_scalar($input)) {
|
| 743 |
-
return str_replace(
|
| 744 |
-
'+',
|
| 745 |
-
' ',
|
| 746 |
-
str_replace('%7E', '~', rawurlencode($input))
|
| 747 |
-
);
|
| 748 |
-
} else {
|
| 749 |
-
return '';
|
| 750 |
-
}
|
| 751 |
-
}
|
| 752 |
-
|
| 753 |
-
|
| 754 |
-
// This decode function isn't taking into consideration the above
|
| 755 |
-
// modifications to the encoding process. However, this method doesn't
|
| 756 |
-
// seem to be used anywhere so leaving it as is.
|
| 757 |
-
public static function urldecode_rfc3986($string) {
|
| 758 |
-
return urldecode($string);
|
| 759 |
-
}
|
| 760 |
-
|
| 761 |
-
// Utility function for turning the Authorization: header into
|
| 762 |
-
// parameters, has to do some unescaping
|
| 763 |
-
// Can filter out any non-oauth parameters if needed (default behaviour)
|
| 764 |
-
public static function split_header($header, $only_allow_oauth_parameters = true) {
|
| 765 |
-
$pattern = '/(([-_a-z]*)=("([^"]*)"|([^,]*)),?)/';
|
| 766 |
-
$offset = 0;
|
| 767 |
-
$params = array();
|
| 768 |
-
while (preg_match($pattern, $header, $matches, PREG_OFFSET_CAPTURE, $offset) > 0) {
|
| 769 |
-
$match = $matches[0];
|
| 770 |
-
$header_name = $matches[2][0];
|
| 771 |
-
$header_content = (isset($matches[5])) ? $matches[5][0] : $matches[4][0];
|
| 772 |
-
if (preg_match('/^oauth_/', $header_name) || !$only_allow_oauth_parameters) {
|
| 773 |
-
$params[$header_name] = Plus_OAuthUtil::urldecode_rfc3986($header_content);
|
| 774 |
-
}
|
| 775 |
-
$offset = $match[1] + strlen($match[0]);
|
| 776 |
-
}
|
| 777 |
-
|
| 778 |
-
if (isset($params['realm'])) {
|
| 779 |
-
unset($params['realm']);
|
| 780 |
-
}
|
| 781 |
-
|
| 782 |
-
return $params;
|
| 783 |
-
}
|
| 784 |
-
|
| 785 |
-
// helper to try to sort out headers for people who aren't running apache
|
| 786 |
-
public static function get_headers() {
|
| 787 |
-
if (function_exists('apache_request_headers')) {
|
| 788 |
-
// we need this to get the actual Authorization: header
|
| 789 |
-
// because apache tends to tell us it doesn't exist
|
| 790 |
-
$headers = apache_request_headers();
|
| 791 |
-
|
| 792 |
-
// sanitize the output of apache_request_headers because
|
| 793 |
-
// we always want the keys to be Cased-Like-This and arh()
|
| 794 |
-
// returns the headers in the same case as they are in the
|
| 795 |
-
// request
|
| 796 |
-
$out = array();
|
| 797 |
-
foreach( $headers AS $key => $value ) {
|
| 798 |
-
$key = str_replace(
|
| 799 |
-
" ",
|
| 800 |
-
"-",
|
| 801 |
-
ucwords(strtolower(str_replace("-", " ", $key)))
|
| 802 |
-
);
|
| 803 |
-
$out[$key] = $value;
|
| 804 |
-
}
|
| 805 |
-
} else {
|
| 806 |
-
// otherwise we don't have apache and are just going to have to hope
|
| 807 |
-
// that $_SERVER actually contains what we need
|
| 808 |
-
$out = array();
|
| 809 |
-
if( isset($_SERVER['CONTENT_TYPE']) )
|
| 810 |
-
$out['Content-Type'] = $_SERVER['CONTENT_TYPE'];
|
| 811 |
-
if( isset($_ENV['CONTENT_TYPE']) )
|
| 812 |
-
$out['Content-Type'] = $_ENV['CONTENT_TYPE'];
|
| 813 |
-
|
| 814 |
-
foreach ($_SERVER as $key => $value) {
|
| 815 |
-
if (substr($key, 0, 5) == "HTTP_") {
|
| 816 |
-
// this is chaos, basically it is just there to capitalize the first
|
| 817 |
-
// letter of every word that is not an initial HTTP and strip HTTP
|
| 818 |
-
// code from przemek
|
| 819 |
-
$key = str_replace(
|
| 820 |
-
" ",
|
| 821 |
-
"-",
|
| 822 |
-
ucwords(strtolower(str_replace("_", " ", substr($key, 5))))
|
| 823 |
-
);
|
| 824 |
-
$out[$key] = $value;
|
| 825 |
-
}
|
| 826 |
-
}
|
| 827 |
-
}
|
| 828 |
-
return $out;
|
| 829 |
-
}
|
| 830 |
-
|
| 831 |
-
// This function takes a input like a=b&a=c&d=e and returns the parsed
|
| 832 |
-
// parameters like this
|
| 833 |
-
// array('a' => array('b','c'), 'd' => 'e')
|
| 834 |
-
public static function parse_parameters( $input ) {
|
| 835 |
-
if (!isset($input) || !$input) return array();
|
| 836 |
-
|
| 837 |
-
$pairs = explode('&', $input);
|
| 838 |
-
|
| 839 |
-
$parsed_parameters = array();
|
| 840 |
-
foreach ($pairs as $pair) {
|
| 841 |
-
$split = explode('=', $pair, 2);
|
| 842 |
-
$parameter = Plus_OAuthUtil::urldecode_rfc3986($split[0]);
|
| 843 |
-
$value = isset($split[1]) ? Plus_OAuthUtil::urldecode_rfc3986($split[1]) : '';
|
| 844 |
-
|
| 845 |
-
if (isset($parsed_parameters[$parameter])) {
|
| 846 |
-
// We have already recieved parameter(s) with this name, so add to the list
|
| 847 |
-
// of parameters with this name
|
| 848 |
-
|
| 849 |
-
if (is_scalar($parsed_parameters[$parameter])) {
|
| 850 |
-
// This is the first duplicate, so transform scalar (string) into an array
|
| 851 |
-
// so we can add the duplicates
|
| 852 |
-
$parsed_parameters[$parameter] = array($parsed_parameters[$parameter]);
|
| 853 |
-
}
|
| 854 |
-
|
| 855 |
-
$parsed_parameters[$parameter][] = $value;
|
| 856 |
-
} else {
|
| 857 |
-
$parsed_parameters[$parameter] = $value;
|
| 858 |
-
}
|
| 859 |
-
}
|
| 860 |
-
return $parsed_parameters;
|
| 861 |
-
}
|
| 862 |
-
|
| 863 |
-
public static function build_http_query($params) {
|
| 864 |
-
if (!$params) return '';
|
| 865 |
-
|
| 866 |
-
// Urlencode both keys and values
|
| 867 |
-
$keys = Plus_OAuthUtil::urlencode_rfc3986(array_keys($params));
|
| 868 |
-
$values = Plus_OAuthUtil::urlencode_rfc3986(array_values($params));
|
| 869 |
-
$params = array_combine($keys, $values);
|
| 870 |
-
|
| 871 |
-
// Parameters are sorted by name, using lexicographical byte value ordering.
|
| 872 |
-
// Ref: Spec: 9.1.1 (1)
|
| 873 |
-
uksort($params, 'strcmp');
|
| 874 |
-
|
| 875 |
-
$pairs = array();
|
| 876 |
-
foreach ($params as $parameter => $value) {
|
| 877 |
-
if (is_array($value)) {
|
| 878 |
-
// If two or more parameters share the same name, they are sorted by their value
|
| 879 |
-
// Ref: Spec: 9.1.1 (1)
|
| 880 |
-
natsort($value);
|
| 881 |
-
foreach ($value as $duplicate_value) {
|
| 882 |
-
$pairs[] = $parameter . '=' . $duplicate_value;
|
| 883 |
-
}
|
| 884 |
-
} else {
|
| 885 |
-
$pairs[] = $parameter . '=' . $value;
|
| 886 |
-
}
|
| 887 |
-
}
|
| 888 |
-
// For each parameter, the name is separated from the corresponding value by an '=' character (ASCII code 61)
|
| 889 |
-
// Each name-value pair is separated by an '&' character (ASCII code 38)
|
| 890 |
-
return implode('&', $pairs);
|
| 891 |
-
}
|
| 892 |
-
}
|
| 893 |
}
|
| 1 |
+
<?php
|
| 2 |
+
// vim: foldmethod=marker
|
| 3 |
+
|
| 4 |
+
/* Generic exception class
|
| 5 |
+
*/
|
| 6 |
+
if (!class_exists('Plus_OAuthException')) {
|
| 7 |
+
class Plus_OAuthException extends Exception {
|
| 8 |
+
// pass
|
| 9 |
+
}
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
if (!class_exists('Plus_OAuthConsumer')) {
|
| 13 |
+
class Plus_OAuthConsumer {
|
| 14 |
+
public $key;
|
| 15 |
+
public $secret;
|
| 16 |
+
|
| 17 |
+
function __construct($key, $secret, $callback_url=NULL) {
|
| 18 |
+
$this->key = $key;
|
| 19 |
+
$this->secret = $secret;
|
| 20 |
+
$this->callback_url = $callback_url;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
function __toString() {
|
| 24 |
+
return "Plus_OAuthConsumer[key=$this->key,secret=$this->secret]";
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
if (!class_exists('Plus_OAuthToken')) {
|
| 30 |
+
class Plus_OAuthToken {
|
| 31 |
+
// access tokens and request tokens
|
| 32 |
+
public $key;
|
| 33 |
+
public $secret;
|
| 34 |
+
|
| 35 |
+
/**
|
| 36 |
+
* key = the token
|
| 37 |
+
* secret = the token secret
|
| 38 |
+
*/
|
| 39 |
+
function __construct($key, $secret) {
|
| 40 |
+
$this->key = $key;
|
| 41 |
+
$this->secret = $secret;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
/**
|
| 45 |
+
* generates the basic string serialization of a token that a server
|
| 46 |
+
* would respond to request_token and access_token calls with
|
| 47 |
+
*/
|
| 48 |
+
function to_string() {
|
| 49 |
+
return "oauth_token=" .
|
| 50 |
+
Plus_OAuthUtil::urlencode_rfc3986($this->key) .
|
| 51 |
+
"&oauth_token_secret=" .
|
| 52 |
+
Plus_OAuthUtil::urlencode_rfc3986($this->secret);
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
function __toString() {
|
| 56 |
+
return $this->to_string();
|
| 57 |
+
}
|
| 58 |
+
}
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
/**
|
| 62 |
+
* A class for implementing a Signature Method
|
| 63 |
+
* See section 9 ("Signing Requests") in the spec
|
| 64 |
+
*/
|
| 65 |
+
if (!class_exists('Plus_OAuthSignatureMethod')) {
|
| 66 |
+
abstract class Plus_OAuthSignatureMethod {
|
| 67 |
+
/**
|
| 68 |
+
* Needs to return the name of the Signature Method (ie HMAC-SHA1)
|
| 69 |
+
* @return string
|
| 70 |
+
*/
|
| 71 |
+
abstract public function get_name();
|
| 72 |
+
|
| 73 |
+
/**
|
| 74 |
+
* Build up the signature
|
| 75 |
+
* NOTE: The output of this function MUST NOT be urlencoded.
|
| 76 |
+
* the encoding is handled in OAuthRequest when the final
|
| 77 |
+
* request is serialized
|
| 78 |
+
* @param OAuthRequest $request
|
| 79 |
+
* @param OAuthConsumer $consumer
|
| 80 |
+
* @param OAuthToken $token
|
| 81 |
+
* @return string
|
| 82 |
+
*/
|
| 83 |
+
abstract public function build_signature($request, $consumer, $token);
|
| 84 |
+
|
| 85 |
+
/**
|
| 86 |
+
* Verifies that a given signature is correct
|
| 87 |
+
* @param OAuthRequest $request
|
| 88 |
+
* @param OAuthConsumer $consumer
|
| 89 |
+
* @param OAuthToken $token
|
| 90 |
+
* @param string $signature
|
| 91 |
+
* @return bool
|
| 92 |
+
*/
|
| 93 |
+
public function check_signature($request, $consumer, $token, $signature) {
|
| 94 |
+
$built = $this->build_signature($request, $consumer, $token);
|
| 95 |
+
return $built == $signature;
|
| 96 |
+
}
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
/**
|
| 101 |
+
* The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
|
| 102 |
+
* where the Signature Base String is the text and the key is the concatenated values (each first
|
| 103 |
+
* encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
|
| 104 |
+
* character (ASCII code 38) even if empty.
|
| 105 |
+
* - Chapter 9.2 ("HMAC-SHA1")
|
| 106 |
+
*/
|
| 107 |
+
if (!class_exists('Plus_OAuthSignatureMethod_HMAC_SHA1')) {
|
| 108 |
+
class Plus_OAuthSignatureMethod_HMAC_SHA1 extends Plus_OAuthSignatureMethod {
|
| 109 |
+
function get_name() {
|
| 110 |
+
return "HMAC-SHA1";
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
public function build_signature($request, $consumer, $token) {
|
| 114 |
+
$base_string = $request->get_signature_base_string();
|
| 115 |
+
$request->base_string = $base_string;
|
| 116 |
+
|
| 117 |
+
$key_parts = array(
|
| 118 |
+
$consumer->secret,
|
| 119 |
+
($token) ? $token->secret : ""
|
| 120 |
+
);
|
| 121 |
+
|
| 122 |
+
$key_parts = Plus_OAuthUtil::urlencode_rfc3986($key_parts);
|
| 123 |
+
$key = implode('&', $key_parts);
|
| 124 |
+
|
| 125 |
+
return base64_encode(hash_hmac('sha1', $base_string, $key, true));
|
| 126 |
+
}
|
| 127 |
+
}
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
/**
|
| 131 |
+
* The PLAINTEXT method does not provide any security protection and SHOULD only be used
|
| 132 |
+
* over a secure channel such as HTTPS. It does not use the Signature Base String.
|
| 133 |
+
* - Chapter 9.4 ("PLAINTEXT")
|
| 134 |
+
*/
|
| 135 |
+
if (!class_exists('Plus_OAuthSignatureMethod_PLAINTEXT')) {
|
| 136 |
+
class Plus_OAuthSignatureMethod_PLAINTEXT extends Plus_OAuthSignatureMethod {
|
| 137 |
+
public function get_name() {
|
| 138 |
+
return "PLAINTEXT";
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
/**
|
| 142 |
+
* oauth_signature is set to the concatenated encoded values of the Consumer Secret and
|
| 143 |
+
* Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
|
| 144 |
+
* empty. The result MUST be encoded again.
|
| 145 |
+
* - Chapter 9.4.1 ("Generating Signatures")
|
| 146 |
+
*
|
| 147 |
+
* Please note that the second encoding MUST NOT happen in the SignatureMethod, as
|
| 148 |
+
* OAuthRequest handles this!
|
| 149 |
+
*/
|
| 150 |
+
public function build_signature($request, $consumer, $token) {
|
| 151 |
+
$key_parts = array(
|
| 152 |
+
$consumer->secret,
|
| 153 |
+
($token) ? $token->secret : ""
|
| 154 |
+
);
|
| 155 |
+
|
| 156 |
+
$key_parts = Plus_OAuthUtil::urlencode_rfc3986($key_parts);
|
| 157 |
+
$key = implode('&', $key_parts);
|
| 158 |
+
$request->base_string = $key;
|
| 159 |
+
|
| 160 |
+
return $key;
|
| 161 |
+
}
|
| 162 |
+
}
|
| 163 |
+
}
|
| 164 |
+
/**
|
| 165 |
+
* The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
|
| 166 |
+
* [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
|
| 167 |
+
* EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
|
| 168 |
+
* verified way to the Service Provider, in a manner which is beyond the scope of this
|
| 169 |
+
* specification.
|
| 170 |
+
* - Chapter 9.3 ("RSA-SHA1")
|
| 171 |
+
*/
|
| 172 |
+
if (!class_exists('Plus_OAuthSignatureMethod_RSA_SHA1')) {
|
| 173 |
+
abstract class Plus_OAuthSignatureMethod_RSA_SHA1 extends Plus_OAuthSignatureMethod {
|
| 174 |
+
public function get_name() {
|
| 175 |
+
return "RSA-SHA1";
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 179 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 180 |
+
// (2) fetch via http using a url provided by the requester
|
| 181 |
+
// (3) some sort of specific discovery code based on request
|
| 182 |
+
//
|
| 183 |
+
// Either way should return a string representation of the certificate
|
| 184 |
+
protected abstract function fetch_public_cert(&$request);
|
| 185 |
+
|
| 186 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 187 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 188 |
+
//
|
| 189 |
+
// Either way should return a string representation of the certificate
|
| 190 |
+
protected abstract function fetch_private_cert(&$request);
|
| 191 |
+
|
| 192 |
+
public function build_signature($request, $consumer, $token) {
|
| 193 |
+
$base_string = $request->get_signature_base_string();
|
| 194 |
+
$request->base_string = $base_string;
|
| 195 |
+
|
| 196 |
+
// Fetch the private key cert based on the request
|
| 197 |
+
$cert = $this->fetch_private_cert($request);
|
| 198 |
+
|
| 199 |
+
// Pull the private key ID from the certificate
|
| 200 |
+
$privatekeyid = openssl_get_privatekey($cert);
|
| 201 |
+
|
| 202 |
+
// Sign using the key
|
| 203 |
+
$ok = openssl_sign($base_string, $signature, $privatekeyid);
|
| 204 |
+
|
| 205 |
+
// Release the key resource
|
| 206 |
+
openssl_free_key($privatekeyid);
|
| 207 |
+
|
| 208 |
+
return base64_encode($signature);
|
| 209 |
+
}
|
| 210 |
+
|
| 211 |
+
public function check_signature($request, $consumer, $token, $signature) {
|
| 212 |
+
$decoded_sig = base64_decode($signature);
|
| 213 |
+
|
| 214 |
+
$base_string = $request->get_signature_base_string();
|
| 215 |
+
|
| 216 |
+
// Fetch the public key cert based on the request
|
| 217 |
+
$cert = $this->fetch_public_cert($request);
|
| 218 |
+
|
| 219 |
+
// Pull the public key ID from the certificate
|
| 220 |
+
$publickeyid = openssl_get_publickey($cert);
|
| 221 |
+
|
| 222 |
+
// Check the computed signature against the one passed in the query
|
| 223 |
+
$ok = openssl_verify($base_string, $decoded_sig, $publickeyid);
|
| 224 |
+
|
| 225 |
+
// Release the key resource
|
| 226 |
+
openssl_free_key($publickeyid);
|
| 227 |
+
|
| 228 |
+
return $ok == 1;
|
| 229 |
+
}
|
| 230 |
+
}
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
if (!class_exists('Plus_OAuthRequest')) {
|
| 234 |
+
class Plus_OAuthRequest {
|
| 235 |
+
private $parameters;
|
| 236 |
+
private $http_method;
|
| 237 |
+
private $http_url;
|
| 238 |
+
// for debug purposes
|
| 239 |
+
public $base_string;
|
| 240 |
+
public static $version = '1.0';
|
| 241 |
+
public static $POST_INPUT = 'php://input';
|
| 242 |
+
|
| 243 |
+
function __construct($http_method, $http_url, $parameters=NULL) {
|
| 244 |
+
@$parameters or $parameters = array();
|
| 245 |
+
$parameters = array_merge( Plus_OAuthUtil::parse_parameters(parse_url($http_url, PHP_URL_QUERY)), $parameters);
|
| 246 |
+
$this->parameters = $parameters;
|
| 247 |
+
$this->http_method = $http_method;
|
| 248 |
+
$this->http_url = $http_url;
|
| 249 |
+
}
|
| 250 |
+
|
| 251 |
+
|
| 252 |
+
/**
|
| 253 |
+
* attempt to build up a request from what was passed to the server
|
| 254 |
+
*/
|
| 255 |
+
public static function from_request($http_method=NULL, $http_url=NULL, $parameters=NULL) {
|
| 256 |
+
$scheme = (!isset($_SERVER['HTTPS']) || $_SERVER['HTTPS'] != "on")
|
| 257 |
+
? 'http'
|
| 258 |
+
: 'https';
|
| 259 |
+
@$http_url or $http_url = $scheme .
|
| 260 |
+
'://' . $_SERVER['HTTP_HOST'] .
|
| 261 |
+
':' .
|
| 262 |
+
$_SERVER['SERVER_PORT'] .
|
| 263 |
+
$_SERVER['REQUEST_URI'];
|
| 264 |
+
@$http_method or $http_method = $_SERVER['REQUEST_METHOD'];
|
| 265 |
+
|
| 266 |
+
// We weren't handed any parameters, so let's find the ones relevant to
|
| 267 |
+
// this request.
|
| 268 |
+
// If you run XML-RPC or similar you should use this to provide your own
|
| 269 |
+
// parsed parameter-list
|
| 270 |
+
if (!$parameters) {
|
| 271 |
+
// Find request headers
|
| 272 |
+
$request_headers = Plus_OAuthUtil::get_headers();
|
| 273 |
+
|
| 274 |
+
// Parse the query-string to find GET parameters
|
| 275 |
+
$parameters = Plus_OAuthUtil::parse_parameters($_SERVER['QUERY_STRING']);
|
| 276 |
+
|
| 277 |
+
// It's a POST request of the proper content-type, so parse POST
|
| 278 |
+
// parameters and add those overriding any duplicates from GET
|
| 279 |
+
if ($http_method == "POST"
|
| 280 |
+
&& @strstr($request_headers["Content-Type"],
|
| 281 |
+
"application/x-www-form-urlencoded")
|
| 282 |
+
) {
|
| 283 |
+
$post_data = Plus_OAuthUtil::parse_parameters(
|
| 284 |
+
file_get_contents(self::$POST_INPUT)
|
| 285 |
+
);
|
| 286 |
+
$parameters = array_merge($parameters, $post_data);
|
| 287 |
+
}
|
| 288 |
+
|
| 289 |
+
// We have a Authorization-header with OAuth data. Parse the header
|
| 290 |
+
// and add those overriding any duplicates from GET or POST
|
| 291 |
+
if (@substr($request_headers['Authorization'], 0, 6) == "OAuth ") {
|
| 292 |
+
$header_parameters = Plus_OAuthUtil::split_header(
|
| 293 |
+
$request_headers['Authorization']
|
| 294 |
+
);
|
| 295 |
+
$parameters = array_merge($parameters, $header_parameters);
|
| 296 |
+
}
|
| 297 |
+
|
| 298 |
+
}
|
| 299 |
+
|
| 300 |
+
return new Plus_OAuthRequest($http_method, $http_url, $parameters);
|
| 301 |
+
}
|
| 302 |
+
|
| 303 |
+
/**
|
| 304 |
+
* pretty much a helper function to set up the request
|
| 305 |
+
*/
|
| 306 |
+
public static function from_consumer_and_token($consumer, $token, $http_method, $http_url, $parameters=NULL) {
|
| 307 |
+
@$parameters or $parameters = array();
|
| 308 |
+
$defaults = array("oauth_version" => Plus_OAuthRequest::$version,
|
| 309 |
+
"oauth_nonce" => Plus_OAuthRequest::generate_nonce(),
|
| 310 |
+
"oauth_timestamp" => Plus_OAuthRequest::generate_timestamp(),
|
| 311 |
+
"oauth_consumer_key" => $consumer->key);
|
| 312 |
+
if ($token)
|
| 313 |
+
$defaults['oauth_token'] = $token->key;
|
| 314 |
+
|
| 315 |
+
$parameters = array_merge($defaults, $parameters);
|
| 316 |
+
|
| 317 |
+
return new Plus_OAuthRequest($http_method, $http_url, $parameters);
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
public function set_parameter($name, $value, $allow_duplicates = true) {
|
| 321 |
+
if ($allow_duplicates && isset($this->parameters[$name])) {
|
| 322 |
+
// We have already added parameter(s) with this name, so add to the list
|
| 323 |
+
if (is_scalar($this->parameters[$name])) {
|
| 324 |
+
// This is the first duplicate, so transform scalar (string)
|
| 325 |
+
// into an array so we can add the duplicates
|
| 326 |
+
$this->parameters[$name] = array($this->parameters[$name]);
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
$this->parameters[$name][] = $value;
|
| 330 |
+
} else {
|
| 331 |
+
$this->parameters[$name] = $value;
|
| 332 |
+
}
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
public function get_parameter($name) {
|
| 336 |
+
return isset($this->parameters[$name]) ? $this->parameters[$name] : null;
|
| 337 |
+
}
|
| 338 |
+
|
| 339 |
+
public function get_parameters() {
|
| 340 |
+
return $this->parameters;
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
public function unset_parameter($name) {
|
| 344 |
+
unset($this->parameters[$name]);
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
/**
|
| 348 |
+
* The request parameters, sorted and concatenated into a normalized string.
|
| 349 |
+
* @return string
|
| 350 |
+
*/
|
| 351 |
+
public function get_signable_parameters() {
|
| 352 |
+
// Grab all parameters
|
| 353 |
+
$params = $this->parameters;
|
| 354 |
+
|
| 355 |
+
// Remove oauth_signature if present
|
| 356 |
+
// Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
|
| 357 |
+
if (isset($params['oauth_signature'])) {
|
| 358 |
+
unset($params['oauth_signature']);
|
| 359 |
+
}
|
| 360 |
+
|
| 361 |
+
return Plus_OAuthUtil::build_http_query($params);
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
/**
|
| 365 |
+
* Returns the base string of this request
|
| 366 |
+
*
|
| 367 |
+
* The base string defined as the method, the url
|
| 368 |
+
* and the parameters (normalized), each urlencoded
|
| 369 |
+
* and the concated with &.
|
| 370 |
+
*/
|
| 371 |
+
public function get_signature_base_string() {
|
| 372 |
+
$parts = array(
|
| 373 |
+
$this->get_normalized_http_method(),
|
| 374 |
+
$this->get_normalized_http_url(),
|
| 375 |
+
$this->get_signable_parameters()
|
| 376 |
+
);
|
| 377 |
+
|
| 378 |
+
$parts = Plus_OAuthUtil::urlencode_rfc3986($parts);
|
| 379 |
+
|
| 380 |
+
return implode('&', $parts);
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
/**
|
| 384 |
+
* just uppercases the http method
|
| 385 |
+
*/
|
| 386 |
+
public function get_normalized_http_method() {
|
| 387 |
+
return strtoupper($this->http_method);
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
/**
|
| 391 |
+
* parses the url and rebuilds it to be
|
| 392 |
+
* scheme://host/path
|
| 393 |
+
*/
|
| 394 |
+
public function get_normalized_http_url() {
|
| 395 |
+
$parts = parse_url($this->http_url);
|
| 396 |
+
|
| 397 |
+
$port = @$parts['port'];
|
| 398 |
+
$scheme = $parts['scheme'];
|
| 399 |
+
$host = $parts['host'];
|
| 400 |
+
$path = @$parts['path'];
|
| 401 |
+
|
| 402 |
+
$port or $port = ($scheme == 'https') ? '443' : '80';
|
| 403 |
+
|
| 404 |
+
if (($scheme == 'https' && $port != '443')
|
| 405 |
+
|| ($scheme == 'http' && $port != '80')) {
|
| 406 |
+
$host = "$host:$port";
|
| 407 |
+
}
|
| 408 |
+
return "$scheme://$host$path";
|
| 409 |
+
}
|
| 410 |
+
|
| 411 |
+
/**
|
| 412 |
+
* builds a url usable for a GET request
|
| 413 |
+
*/
|
| 414 |
+
public function to_url() {
|
| 415 |
+
$post_data = $this->to_postdata();
|
| 416 |
+
$out = $this->get_normalized_http_url();
|
| 417 |
+
if ($post_data) {
|
| 418 |
+
$out .= '?'.$post_data;
|
| 419 |
+
}
|
| 420 |
+
return $out;
|
| 421 |
+
}
|
| 422 |
+
|
| 423 |
+
/**
|
| 424 |
+
* builds the data one would send in a POST request
|
| 425 |
+
*/
|
| 426 |
+
public function to_postdata() {
|
| 427 |
+
return Plus_OAuthUtil::build_http_query($this->parameters);
|
| 428 |
+
}
|
| 429 |
+
|
| 430 |
+
/**
|
| 431 |
+
* builds the Authorization: header
|
| 432 |
+
*/
|
| 433 |
+
public function to_header($realm=null) {
|
| 434 |
+
$first = true;
|
| 435 |
+
if($realm) {
|
| 436 |
+
$out = 'Authorization: OAuth realm="' . Plus_OAuthUtil::urlencode_rfc3986($realm) . '"';
|
| 437 |
+
$first = false;
|
| 438 |
+
} else
|
| 439 |
+
$out = 'Authorization: OAuth';
|
| 440 |
+
|
| 441 |
+
$total = array();
|
| 442 |
+
foreach ($this->parameters as $k => $v) {
|
| 443 |
+
if (substr($k, 0, 5) != "oauth") continue;
|
| 444 |
+
if (is_array($v)) {
|
| 445 |
+
throw new Plus_OAuthException('Arrays not supported in headers');
|
| 446 |
+
}
|
| 447 |
+
$out .= ($first) ? ' ' : ',';
|
| 448 |
+
$out .= Plus_OAuthUtil::urlencode_rfc3986($k) .
|
| 449 |
+
'="' .
|
| 450 |
+
Plus_OAuthUtil::urlencode_rfc3986($v) .
|
| 451 |
+
'"';
|
| 452 |
+
$first = false;
|
| 453 |
+
}
|
| 454 |
+
return $out;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
public function __toString() {
|
| 458 |
+
return $this->to_url();
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
|
| 462 |
+
public function sign_request($signature_method, $consumer, $token) {
|
| 463 |
+
$this->set_parameter(
|
| 464 |
+
"oauth_signature_method",
|
| 465 |
+
$signature_method->get_name(),
|
| 466 |
+
false
|
| 467 |
+
);
|
| 468 |
+
$signature = $this->build_signature($signature_method, $consumer, $token);
|
| 469 |
+
$this->set_parameter("oauth_signature", $signature, false);
|
| 470 |
+
}
|
| 471 |
+
|
| 472 |
+
public function build_signature($signature_method, $consumer, $token) {
|
| 473 |
+
$signature = $signature_method->build_signature($this, $consumer, $token);
|
| 474 |
+
return $signature;
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
/**
|
| 478 |
+
* util function: current timestamp
|
| 479 |
+
*/
|
| 480 |
+
private static function generate_timestamp() {
|
| 481 |
+
return time();
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
/**
|
| 485 |
+
* util function: current nonce
|
| 486 |
+
*/
|
| 487 |
+
private static function generate_nonce() {
|
| 488 |
+
$mt = microtime();
|
| 489 |
+
$rand = mt_rand();
|
| 490 |
+
|
| 491 |
+
return md5($mt . $rand); // md5s look nicer than numbers
|
| 492 |
+
}
|
| 493 |
+
}
|
| 494 |
+
}
|
| 495 |
+
|
| 496 |
+
if (!class_exists('Plus_OAuthServer')) {
|
| 497 |
+
class Plus_OAuthServer {
|
| 498 |
+
protected $timestamp_threshold = 300; // in seconds, five minutes
|
| 499 |
+
protected $version = '1.0'; // hi blaine
|
| 500 |
+
protected $signature_methods = array();
|
| 501 |
+
|
| 502 |
+
protected $data_store;
|
| 503 |
+
|
| 504 |
+
function __construct($data_store) {
|
| 505 |
+
$this->data_store = $data_store;
|
| 506 |
+
}
|
| 507 |
+
|
| 508 |
+
public function add_signature_method($signature_method) {
|
| 509 |
+
$this->signature_methods[$signature_method->get_name()] =
|
| 510 |
+
$signature_method;
|
| 511 |
+
}
|
| 512 |
+
|
| 513 |
+
// high level functions
|
| 514 |
+
|
| 515 |
+
/**
|
| 516 |
+
* process a request_token request
|
| 517 |
+
* returns the request token on success
|
| 518 |
+
*/
|
| 519 |
+
public function fetch_request_token(&$request) {
|
| 520 |
+
$this->get_version($request);
|
| 521 |
+
|
| 522 |
+
$consumer = $this->get_consumer($request);
|
| 523 |
+
|
| 524 |
+
// no token required for the initial token request
|
| 525 |
+
$token = NULL;
|
| 526 |
+
|
| 527 |
+
$this->check_signature($request, $consumer, $token);
|
| 528 |
+
|
| 529 |
+
// Rev A change
|
| 530 |
+
$callback = $request->get_parameter('oauth_callback');
|
| 531 |
+
$new_token = $this->data_store->new_request_token($consumer, $callback);
|
| 532 |
+
|
| 533 |
+
return $new_token;
|
| 534 |
+
}
|
| 535 |
+
|
| 536 |
+
/**
|
| 537 |
+
* process an access_token request
|
| 538 |
+
* returns the access token on success
|
| 539 |
+
*/
|
| 540 |
+
public function fetch_access_token(&$request) {
|
| 541 |
+
$this->get_version($request);
|
| 542 |
+
|
| 543 |
+
$consumer = $this->get_consumer($request);
|
| 544 |
+
|
| 545 |
+
// requires authorized request token
|
| 546 |
+
$token = $this->get_token($request, $consumer, "request");
|
| 547 |
+
|
| 548 |
+
$this->check_signature($request, $consumer, $token);
|
| 549 |
+
|
| 550 |
+
// Rev A change
|
| 551 |
+
$verifier = $request->get_parameter('oauth_verifier');
|
| 552 |
+
$new_token = $this->data_store->new_access_token($token, $consumer, $verifier);
|
| 553 |
+
|
| 554 |
+
return $new_token;
|
| 555 |
+
}
|
| 556 |
+
|
| 557 |
+
/**
|
| 558 |
+
* verify an api call, checks all the parameters
|
| 559 |
+
*/
|
| 560 |
+
public function verify_request(&$request) {
|
| 561 |
+
$this->get_version($request);
|
| 562 |
+
$consumer = $this->get_consumer($request);
|
| 563 |
+
$token = $this->get_token($request, $consumer, "access");
|
| 564 |
+
$this->check_signature($request, $consumer, $token);
|
| 565 |
+
return array($consumer, $token);
|
| 566 |
+
}
|
| 567 |
+
|
| 568 |
+
// Internals from here
|
| 569 |
+
/**
|
| 570 |
+
* version 1
|
| 571 |
+
*/
|
| 572 |
+
private function get_version(&$request) {
|
| 573 |
+
$version = $request->get_parameter("oauth_version");
|
| 574 |
+
if (!$version) {
|
| 575 |
+
// Service Providers MUST assume the protocol version to be 1.0 if this parameter is not present.
|
| 576 |
+
// Chapter 7.0 ("Accessing Protected Ressources")
|
| 577 |
+
$version = '1.0';
|
| 578 |
+
}
|
| 579 |
+
if ($version !== $this->version) {
|
| 580 |
+
throw new Plus_OAuthException("OAuth version '$version' not supported");
|
| 581 |
+
}
|
| 582 |
+
return $version;
|
| 583 |
+
}
|
| 584 |
+
|
| 585 |
+
/**
|
| 586 |
+
* figure out the signature with some defaults
|
| 587 |
+
*/
|
| 588 |
+
private function get_signature_method(&$request) {
|
| 589 |
+
$signature_method =
|
| 590 |
+
@$request->get_parameter("oauth_signature_method");
|
| 591 |
+
|
| 592 |
+
if (!$signature_method) {
|
| 593 |
+
// According to chapter 7 ("Accessing Protected Ressources") the signature-method
|
| 594 |
+
// parameter is required, and we can't just fallback to PLAINTEXT
|
| 595 |
+
throw new Plus_OAuthException('No signature method parameter. This parameter is required');
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
if (!in_array($signature_method,
|
| 599 |
+
array_keys($this->signature_methods))) {
|
| 600 |
+
throw new Plus_OAuthException(
|
| 601 |
+
"Signature method '$signature_method' not supported " .
|
| 602 |
+
"try one of the following: " .
|
| 603 |
+
implode(", ", array_keys($this->signature_methods))
|
| 604 |
+
);
|
| 605 |
+
}
|
| 606 |
+
return $this->signature_methods[$signature_method];
|
| 607 |
+
}
|
| 608 |
+
|
| 609 |
+
/**
|
| 610 |
+
* try to find the consumer for the provided request's consumer key
|
| 611 |
+
*/
|
| 612 |
+
private function get_consumer(&$request) {
|
| 613 |
+
$consumer_key = @$request->get_parameter("oauth_consumer_key");
|
| 614 |
+
if (!$consumer_key) {
|
| 615 |
+
throw new Plus_OAuthException("Invalid consumer key");
|
| 616 |
+
}
|
| 617 |
+
|
| 618 |
+
$consumer = $this->data_store->lookup_consumer($consumer_key);
|
| 619 |
+
if (!$consumer) {
|
| 620 |
+
throw new Plus_OAuthException("Invalid consumer");
|
| 621 |
+
}
|
| 622 |
+
|
| 623 |
+
return $consumer;
|
| 624 |
+
}
|
| 625 |
+
|
| 626 |
+
/**
|
| 627 |
+
* try to find the token for the provided request's token key
|
| 628 |
+
*/
|
| 629 |
+
private function get_token(&$request, $consumer, $token_type="access") {
|
| 630 |
+
$token_field = @$request->get_parameter('oauth_token');
|
| 631 |
+
$token = $this->data_store->lookup_token(
|
| 632 |
+
$consumer, $token_type, $token_field
|
| 633 |
+
);
|
| 634 |
+
if (!$token) {
|
| 635 |
+
throw new Plus_OAuthException("Invalid $token_type token: $token_field");
|
| 636 |
+
}
|
| 637 |
+
return $token;
|
| 638 |
+
}
|
| 639 |
+
|
| 640 |
+
/**
|
| 641 |
+
* all-in-one function to check the signature on a request
|
| 642 |
+
* should guess the signature method appropriately
|
| 643 |
+
*/
|
| 644 |
+
private function check_signature(&$request, $consumer, $token) {
|
| 645 |
+
// this should probably be in a different method
|
| 646 |
+
$timestamp = @$request->get_parameter('oauth_timestamp');
|
| 647 |
+
$nonce = @$request->get_parameter('oauth_nonce');
|
| 648 |
+
|
| 649 |
+
$this->check_timestamp($timestamp);
|
| 650 |
+
$this->check_nonce($consumer, $token, $nonce, $timestamp);
|
| 651 |
+
|
| 652 |
+
$signature_method = $this->get_signature_method($request);
|
| 653 |
+
|
| 654 |
+
$signature = $request->get_parameter('oauth_signature');
|
| 655 |
+
$valid_sig = $signature_method->check_signature(
|
| 656 |
+
$request,
|
| 657 |
+
$consumer,
|
| 658 |
+
$token,
|
| 659 |
+
$signature
|
| 660 |
+
);
|
| 661 |
+
|
| 662 |
+
if (!$valid_sig) {
|
| 663 |
+
throw new Plus_OAuthException("Invalid signature");
|
| 664 |
+
}
|
| 665 |
+
}
|
| 666 |
+
|
| 667 |
+
/**
|
| 668 |
+
* check that the timestamp is new enough
|
| 669 |
+
*/
|
| 670 |
+
private function check_timestamp($timestamp) {
|
| 671 |
+
if( ! $timestamp )
|
| 672 |
+
throw new Plus_OAuthException(
|
| 673 |
+
'Missing timestamp parameter. The parameter is required'
|
| 674 |
+
);
|
| 675 |
+
|
| 676 |
+
// verify that timestamp is recentish
|
| 677 |
+
$now = time();
|
| 678 |
+
if (abs($now - $timestamp) > $this->timestamp_threshold) {
|
| 679 |
+
throw new Plus_OAuthException(
|
| 680 |
+
"Expired timestamp, yours $timestamp, ours $now"
|
| 681 |
+
);
|
| 682 |
+
}
|
| 683 |
+
}
|
| 684 |
+
|
| 685 |
+
/**
|
| 686 |
+
* check that the nonce is not repeated
|
| 687 |
+
*/
|
| 688 |
+
private function check_nonce($consumer, $token, $nonce, $timestamp) {
|
| 689 |
+
if( ! $nonce )
|
| 690 |
+
throw new Plus_OAuthException(
|
| 691 |
+
'Missing nonce parameter. The parameter is required'
|
| 692 |
+
);
|
| 693 |
+
|
| 694 |
+
// verify that the nonce is uniqueish
|
| 695 |
+
$found = $this->data_store->lookup_nonce(
|
| 696 |
+
$consumer,
|
| 697 |
+
$token,
|
| 698 |
+
$nonce,
|
| 699 |
+
$timestamp
|
| 700 |
+
);
|
| 701 |
+
if ($found) {
|
| 702 |
+
throw new Plus_OAuthException("Nonce already used: $nonce");
|
| 703 |
+
}
|
| 704 |
+
}
|
| 705 |
+
|
| 706 |
+
}
|
| 707 |
+
}
|
| 708 |
+
|
| 709 |
+
if (!class_exists('Plus_OAuthDataStore')) {
|
| 710 |
+
class Plus_OAuthDataStore {
|
| 711 |
+
function lookup_consumer($consumer_key) {
|
| 712 |
+
// implement me
|
| 713 |
+
}
|
| 714 |
+
|
| 715 |
+
function lookup_token($consumer, $token_type, $token) {
|
| 716 |
+
// implement me
|
| 717 |
+
}
|
| 718 |
+
|
| 719 |
+
function lookup_nonce($consumer, $token, $nonce, $timestamp) {
|
| 720 |
+
// implement me
|
| 721 |
+
}
|
| 722 |
+
|
| 723 |
+
function new_request_token($consumer, $callback = null) {
|
| 724 |
+
// return a new token attached to this consumer
|
| 725 |
+
}
|
| 726 |
+
|
| 727 |
+
function new_access_token($token, $consumer, $verifier = null) {
|
| 728 |
+
// return a new access token attached to this consumer
|
| 729 |
+
// for the user associated with this token if the request token
|
| 730 |
+
// is authorized
|
| 731 |
+
// should also invalidate the request token
|
| 732 |
+
}
|
| 733 |
+
|
| 734 |
+
}
|
| 735 |
+
}
|
| 736 |
+
|
| 737 |
+
if (!class_exists('Plus_OAuthUtil')) {
|
| 738 |
+
class Plus_OAuthUtil {
|
| 739 |
+
public static function urlencode_rfc3986($input) {
|
| 740 |
+
if (is_array($input)) {
|
| 741 |
+
return array_map(array('Plus_OAuthUtil', 'urlencode_rfc3986'), $input);
|
| 742 |
+
} else if (is_scalar($input)) {
|
| 743 |
+
return str_replace(
|
| 744 |
+
'+',
|
| 745 |
+
' ',
|
| 746 |
+
str_replace('%7E', '~', rawurlencode($input))
|
| 747 |
+
);
|
| 748 |
+
} else {
|
| 749 |
+
return '';
|
| 750 |
+
}
|
| 751 |
+
}
|
| 752 |
+
|
| 753 |
+
|
| 754 |
+
// This decode function isn't taking into consideration the above
|
| 755 |
+
// modifications to the encoding process. However, this method doesn't
|
| 756 |
+
// seem to be used anywhere so leaving it as is.
|
| 757 |
+
public static function urldecode_rfc3986($string) {
|
| 758 |
+
return urldecode($string);
|
| 759 |
+
}
|
| 760 |
+
|
| 761 |
+
// Utility function for turning the Authorization: header into
|
| 762 |
+
// parameters, has to do some unescaping
|
| 763 |
+
// Can filter out any non-oauth parameters if needed (default behaviour)
|
| 764 |
+
public static function split_header($header, $only_allow_oauth_parameters = true) {
|
| 765 |
+
$pattern = '/(([-_a-z]*)=("([^"]*)"|([^,]*)),?)/';
|
| 766 |
+
$offset = 0;
|
| 767 |
+
$params = array();
|
| 768 |
+
while (preg_match($pattern, $header, $matches, PREG_OFFSET_CAPTURE, $offset) > 0) {
|
| 769 |
+
$match = $matches[0];
|
| 770 |
+
$header_name = $matches[2][0];
|
| 771 |
+
$header_content = (isset($matches[5])) ? $matches[5][0] : $matches[4][0];
|
| 772 |
+
if (preg_match('/^oauth_/', $header_name) || !$only_allow_oauth_parameters) {
|
| 773 |
+
$params[$header_name] = Plus_OAuthUtil::urldecode_rfc3986($header_content);
|
| 774 |
+
}
|
| 775 |
+
$offset = $match[1] + strlen($match[0]);
|
| 776 |
+
}
|
| 777 |
+
|
| 778 |
+
if (isset($params['realm'])) {
|
| 779 |
+
unset($params['realm']);
|
| 780 |
+
}
|
| 781 |
+
|
| 782 |
+
return $params;
|
| 783 |
+
}
|
| 784 |
+
|
| 785 |
+
// helper to try to sort out headers for people who aren't running apache
|
| 786 |
+
public static function get_headers() {
|
| 787 |
+
if (function_exists('apache_request_headers')) {
|
| 788 |
+
// we need this to get the actual Authorization: header
|
| 789 |
+
// because apache tends to tell us it doesn't exist
|
| 790 |
+
$headers = apache_request_headers();
|
| 791 |
+
|
| 792 |
+
// sanitize the output of apache_request_headers because
|
| 793 |
+
// we always want the keys to be Cased-Like-This and arh()
|
| 794 |
+
// returns the headers in the same case as they are in the
|
| 795 |
+
// request
|
| 796 |
+
$out = array();
|
| 797 |
+
foreach( $headers AS $key => $value ) {
|
| 798 |
+
$key = str_replace(
|
| 799 |
+
" ",
|
| 800 |
+
"-",
|
| 801 |
+
ucwords(strtolower(str_replace("-", " ", $key)))
|
| 802 |
+
);
|
| 803 |
+
$out[$key] = $value;
|
| 804 |
+
}
|
| 805 |
+
} else {
|
| 806 |
+
// otherwise we don't have apache and are just going to have to hope
|
| 807 |
+
// that $_SERVER actually contains what we need
|
| 808 |
+
$out = array();
|
| 809 |
+
if( isset($_SERVER['CONTENT_TYPE']) )
|
| 810 |
+
$out['Content-Type'] = $_SERVER['CONTENT_TYPE'];
|
| 811 |
+
if( isset($_ENV['CONTENT_TYPE']) )
|
| 812 |
+
$out['Content-Type'] = $_ENV['CONTENT_TYPE'];
|
| 813 |
+
|
| 814 |
+
foreach ($_SERVER as $key => $value) {
|
| 815 |
+
if (substr($key, 0, 5) == "HTTP_") {
|
| 816 |
+
// this is chaos, basically it is just there to capitalize the first
|
| 817 |
+
// letter of every word that is not an initial HTTP and strip HTTP
|
| 818 |
+
// code from przemek
|
| 819 |
+
$key = str_replace(
|
| 820 |
+
" ",
|
| 821 |
+
"-",
|
| 822 |
+
ucwords(strtolower(str_replace("_", " ", substr($key, 5))))
|
| 823 |
+
);
|
| 824 |
+
$out[$key] = $value;
|
| 825 |
+
}
|
| 826 |
+
}
|
| 827 |
+
}
|
| 828 |
+
return $out;
|
| 829 |
+
}
|
| 830 |
+
|
| 831 |
+
// This function takes a input like a=b&a=c&d=e and returns the parsed
|
| 832 |
+
// parameters like this
|
| 833 |
+
// array('a' => array('b','c'), 'd' => 'e')
|
| 834 |
+
public static function parse_parameters( $input ) {
|
| 835 |
+
if (!isset($input) || !$input) return array();
|
| 836 |
+
|
| 837 |
+
$pairs = explode('&', $input);
|
| 838 |
+
|
| 839 |
+
$parsed_parameters = array();
|
| 840 |
+
foreach ($pairs as $pair) {
|
| 841 |
+
$split = explode('=', $pair, 2);
|
| 842 |
+
$parameter = Plus_OAuthUtil::urldecode_rfc3986($split[0]);
|
| 843 |
+
$value = isset($split[1]) ? Plus_OAuthUtil::urldecode_rfc3986($split[1]) : '';
|
| 844 |
+
|
| 845 |
+
if (isset($parsed_parameters[$parameter])) {
|
| 846 |
+
// We have already recieved parameter(s) with this name, so add to the list
|
| 847 |
+
// of parameters with this name
|
| 848 |
+
|
| 849 |
+
if (is_scalar($parsed_parameters[$parameter])) {
|
| 850 |
+
// This is the first duplicate, so transform scalar (string) into an array
|
| 851 |
+
// so we can add the duplicates
|
| 852 |
+
$parsed_parameters[$parameter] = array($parsed_parameters[$parameter]);
|
| 853 |
+
}
|
| 854 |
+
|
| 855 |
+
$parsed_parameters[$parameter][] = $value;
|
| 856 |
+
} else {
|
| 857 |
+
$parsed_parameters[$parameter] = $value;
|
| 858 |
+
}
|
| 859 |
+
}
|
| 860 |
+
return $parsed_parameters;
|
| 861 |
+
}
|
| 862 |
+
|
| 863 |
+
public static function build_http_query($params) {
|
| 864 |
+
if (!$params) return '';
|
| 865 |
+
|
| 866 |
+
// Urlencode both keys and values
|
| 867 |
+
$keys = Plus_OAuthUtil::urlencode_rfc3986(array_keys($params));
|
| 868 |
+
$values = Plus_OAuthUtil::urlencode_rfc3986(array_values($params));
|
| 869 |
+
$params = array_combine($keys, $values);
|
| 870 |
+
|
| 871 |
+
// Parameters are sorted by name, using lexicographical byte value ordering.
|
| 872 |
+
// Ref: Spec: 9.1.1 (1)
|
| 873 |
+
uksort($params, 'strcmp');
|
| 874 |
+
|
| 875 |
+
$pairs = array();
|
| 876 |
+
foreach ($params as $parameter => $value) {
|
| 877 |
+
if (is_array($value)) {
|
| 878 |
+
// If two or more parameters share the same name, they are sorted by their value
|
| 879 |
+
// Ref: Spec: 9.1.1 (1)
|
| 880 |
+
natsort($value);
|
| 881 |
+
foreach ($value as $duplicate_value) {
|
| 882 |
+
$pairs[] = $parameter . '=' . $duplicate_value;
|
| 883 |
+
}
|
| 884 |
+
} else {
|
| 885 |
+
$pairs[] = $parameter . '=' . $value;
|
| 886 |
+
}
|
| 887 |
+
}
|
| 888 |
+
// For each parameter, the name is separated from the corresponding value by an '=' character (ASCII code 61)
|
| 889 |
+
// Each name-value pair is separated by an '&' character (ASCII code 38)
|
| 890 |
+
return implode('&', $pairs);
|
| 891 |
+
}
|
| 892 |
+
}
|
| 893 |
}
|
helpers/twitter-api/twitteroauth.php
CHANGED
|
@@ -1,241 +1,241 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* Abraham Williams (abraham@abrah.am) http://abrah.am
|
| 5 |
-
*
|
| 6 |
-
* The first PHP Library to support OAuth for Twitter's REST API.
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
/* Load OAuth lib. You can find it at http://oauth.net */
|
| 10 |
-
require_once(SFSI_PLUS_DOCROOT.'/helpers/sfsi_plus_OAuth.php');
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Twitter OAuth class
|
| 14 |
-
*/
|
| 15 |
-
class Plus_TwitterOAuth {
|
| 16 |
-
/* Contains the last HTTP status code returned. */
|
| 17 |
-
public $http_code;
|
| 18 |
-
/* Contains the last API call. */
|
| 19 |
-
public $url;
|
| 20 |
-
/* Set up the API root URL. */
|
| 21 |
-
public $host = "https://api.twitter.com/1.1/";
|
| 22 |
-
/* Set timeout default. */
|
| 23 |
-
public $timeout = 30;
|
| 24 |
-
/* Set connect timeout. */
|
| 25 |
-
public $connecttimeout = 30;
|
| 26 |
-
/* Verify SSL Cert. */
|
| 27 |
-
public $ssl_verifypeer = FALSE;
|
| 28 |
-
/* Respons format. */
|
| 29 |
-
public $format = 'json';
|
| 30 |
-
/* Decode returned json data. */
|
| 31 |
-
public $decode_json = TRUE;
|
| 32 |
-
/* Contains the last HTTP headers returned. */
|
| 33 |
-
public $http_info;
|
| 34 |
-
/* Set the useragnet. */
|
| 35 |
-
public $useragent = 'TwitterOAuth v0.2.0-beta2';
|
| 36 |
-
/* Immediately retry the API call if the response was not successful. */
|
| 37 |
-
//public $retry = TRUE;
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
/**
|
| 43 |
-
* Set API URLS
|
| 44 |
-
*/
|
| 45 |
-
function accessTokenURL() { return 'https://api.twitter.com/oauth/access_token'; }
|
| 46 |
-
function authenticateURL() { return 'https://api.twitter.com/oauth/authenticate'; }
|
| 47 |
-
function authorizeURL() { return 'https://api.twitter.com/oauth/authorize'; }
|
| 48 |
-
function requestTokenURL() { return 'https://api.twitter.com/oauth/request_token'; }
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Debug helpers
|
| 52 |
-
*/
|
| 53 |
-
function lastStatusCode() { return $this->http_status; }
|
| 54 |
-
function lastAPICall() { return $this->last_api_call; }
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* construct TwitterOAuth object
|
| 58 |
-
*/
|
| 59 |
-
function __construct($consumer_key, $consumer_secret, $oauth_token = NULL, $oauth_token_secret = NULL) {
|
| 60 |
-
$this->sha1_method = new Plus_OAuthSignatureMethod_HMAC_SHA1();
|
| 61 |
-
$this->consumer = new Plus_OAuthConsumer($consumer_key, $consumer_secret);
|
| 62 |
-
if (!empty($oauth_token) && !empty($oauth_token_secret)) {
|
| 63 |
-
$this->token = new Plus_OAuthConsumer($oauth_token, $oauth_token_secret);
|
| 64 |
-
} else {
|
| 65 |
-
$this->token = NULL;
|
| 66 |
-
}
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
/**
|
| 71 |
-
* Get a request_token from Twitter
|
| 72 |
-
*
|
| 73 |
-
* @returns a key/value array containing oauth_token and oauth_token_secret
|
| 74 |
-
*/
|
| 75 |
-
function getRequestToken($oauth_callback) {
|
| 76 |
-
$parameters = array();
|
| 77 |
-
$parameters['oauth_callback'] = $oauth_callback;
|
| 78 |
-
$request = $this->oAuthRequest($this->requestTokenURL(), 'GET', $parameters);
|
| 79 |
-
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 80 |
-
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 81 |
-
return $token;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* Get the authorize URL
|
| 86 |
-
*
|
| 87 |
-
* @returns a string
|
| 88 |
-
*/
|
| 89 |
-
function getAuthorizeURL($token, $sign_in_with_twitter = TRUE) {
|
| 90 |
-
if (is_array($token)) {
|
| 91 |
-
$token = $token['oauth_token'];
|
| 92 |
-
}
|
| 93 |
-
if (empty($sign_in_with_twitter)) {
|
| 94 |
-
return $this->authorizeURL() . "?oauth_token={$token}";
|
| 95 |
-
} else {
|
| 96 |
-
return $this->authenticateURL() . "?oauth_token={$token}";
|
| 97 |
-
}
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* Exchange request token and secret for an access token and
|
| 102 |
-
* secret, to sign API calls.
|
| 103 |
-
*
|
| 104 |
-
* @returns array("oauth_token" => "the-access-token",
|
| 105 |
-
* "oauth_token_secret" => "the-access-secret",
|
| 106 |
-
* "user_id" => "9436992",
|
| 107 |
-
* "screen_name" => "abraham")
|
| 108 |
-
*/
|
| 109 |
-
function getAccessToken($oauth_verifier) {
|
| 110 |
-
$parameters = array();
|
| 111 |
-
$parameters['oauth_verifier'] = $oauth_verifier;
|
| 112 |
-
$request = $this->oAuthRequest($this->accessTokenURL(), 'GET', $parameters);
|
| 113 |
-
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 114 |
-
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 115 |
-
return $token;
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
/**
|
| 119 |
-
* One time exchange of username and password for access token and secret.
|
| 120 |
-
*
|
| 121 |
-
* @returns array("oauth_token" => "the-access-token",
|
| 122 |
-
* "oauth_token_secret" => "the-access-secret",
|
| 123 |
-
* "user_id" => "9436992",
|
| 124 |
-
* "screen_name" => "abraham",
|
| 125 |
-
* "x_auth_expires" => "0")
|
| 126 |
-
*/
|
| 127 |
-
function getXAuthToken($username, $password) {
|
| 128 |
-
$parameters = array();
|
| 129 |
-
$parameters['x_auth_username'] = $username;
|
| 130 |
-
$parameters['x_auth_password'] = $password;
|
| 131 |
-
$parameters['x_auth_mode'] = 'client_auth';
|
| 132 |
-
$request = $this->oAuthRequest($this->accessTokenURL(), 'POST', $parameters);
|
| 133 |
-
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 134 |
-
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 135 |
-
return $token;
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
* GET wrapper for oAuthRequest.
|
| 140 |
-
*/
|
| 141 |
-
function get($url, $parameters = array()) {
|
| 142 |
-
$response = $this->oAuthRequest($url, 'GET', $parameters);
|
| 143 |
-
if ($this->format === 'json' && $this->decode_json) {
|
| 144 |
-
return json_decode($response);
|
| 145 |
-
}
|
| 146 |
-
return $response;
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
/**
|
| 150 |
-
* POST wrapper for oAuthRequest.
|
| 151 |
-
*/
|
| 152 |
-
function post($url, $parameters = array()) {
|
| 153 |
-
$response = $this->oAuthRequest($url, 'POST', $parameters);
|
| 154 |
-
if ($this->format === 'json' && $this->decode_json) {
|
| 155 |
-
return json_decode($response);
|
| 156 |
-
}
|
| 157 |
-
return $response;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
/**
|
| 161 |
-
* DELETE wrapper for oAuthReqeust.
|
| 162 |
-
*/
|
| 163 |
-
function delete($url, $parameters = array()) {
|
| 164 |
-
$response = $this->oAuthRequest($url, 'DELETE', $parameters);
|
| 165 |
-
if ($this->format === 'json' && $this->decode_json) {
|
| 166 |
-
return json_decode($response);
|
| 167 |
-
}
|
| 168 |
-
return $response;
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
/**
|
| 172 |
-
* Format and sign an OAuth / API request
|
| 173 |
-
*/
|
| 174 |
-
function oAuthRequest($url, $method, $parameters) {
|
| 175 |
-
if (strrpos($url, 'https://') !== 0 && strrpos($url, 'http://') !== 0) {
|
| 176 |
-
$url = "{$this->host}{$url}.{$this->format}";
|
| 177 |
-
}
|
| 178 |
-
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->token, $method, $url, $parameters);
|
| 179 |
-
$request->sign_request($this->sha1_method, $this->consumer, $this->token);
|
| 180 |
-
switch ($method) {
|
| 181 |
-
case 'GET':
|
| 182 |
-
return $this->http($request->to_url(), 'GET');
|
| 183 |
-
default:
|
| 184 |
-
return $this->http($request->get_normalized_http_url(), $method, $request->to_postdata());
|
| 185 |
-
}
|
| 186 |
-
}
|
| 187 |
-
|
| 188 |
-
/**
|
| 189 |
-
* Make an HTTP request
|
| 190 |
-
*
|
| 191 |
-
* @return API results
|
| 192 |
-
*/
|
| 193 |
-
function http($url, $method, $postfields = NULL) {
|
| 194 |
-
$this->http_info = array();
|
| 195 |
-
$ci = curl_init();
|
| 196 |
-
/* Curl settings */
|
| 197 |
-
curl_setopt($ci, CURLOPT_USERAGENT, $this->useragent);
|
| 198 |
-
curl_setopt($ci, CURLOPT_CONNECTTIMEOUT, $this->connecttimeout);
|
| 199 |
-
curl_setopt($ci, CURLOPT_TIMEOUT, $this->timeout);
|
| 200 |
-
curl_setopt($ci, CURLOPT_RETURNTRANSFER, TRUE);
|
| 201 |
-
curl_setopt($ci, CURLOPT_HTTPHEADER, array('Expect:'));
|
| 202 |
-
curl_setopt($ci, CURLOPT_SSL_VERIFYPEER, $this->ssl_verifypeer);
|
| 203 |
-
curl_setopt($ci, CURLOPT_HEADERFUNCTION, array($this, 'getHeader'));
|
| 204 |
-
curl_setopt($ci, CURLOPT_HEADER, FALSE);
|
| 205 |
-
|
| 206 |
-
switch ($method) {
|
| 207 |
-
case 'POST':
|
| 208 |
-
curl_setopt($ci, CURLOPT_POST, TRUE);
|
| 209 |
-
if (!empty($postfields)) {
|
| 210 |
-
curl_setopt($ci, CURLOPT_POSTFIELDS, $postfields);
|
| 211 |
-
}
|
| 212 |
-
break;
|
| 213 |
-
case 'DELETE':
|
| 214 |
-
curl_setopt($ci, CURLOPT_CUSTOMREQUEST, 'DELETE');
|
| 215 |
-
if (!empty($postfields)) {
|
| 216 |
-
$url = "{$url}?{$postfields}";
|
| 217 |
-
}
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
curl_setopt($ci, CURLOPT_URL, $url);
|
| 221 |
-
$response = curl_exec($ci);
|
| 222 |
-
$this->http_code = curl_getinfo($ci, CURLINFO_HTTP_CODE);
|
| 223 |
-
$this->http_info = array_merge($this->http_info, curl_getinfo($ci));
|
| 224 |
-
$this->url = $url;
|
| 225 |
-
curl_close ($ci);
|
| 226 |
-
return $response;
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
/**
|
| 230 |
-
* Get the header info to store.
|
| 231 |
-
*/
|
| 232 |
-
function getHeader($ch, $header) {
|
| 233 |
-
$i = strpos($header, ':');
|
| 234 |
-
if (!empty($i)) {
|
| 235 |
-
$key = str_replace('-', '_', strtolower(substr($header, 0, $i)));
|
| 236 |
-
$value = trim(substr($header, $i + 2));
|
| 237 |
-
$this->http_header[$key] = $value;
|
| 238 |
-
}
|
| 239 |
-
return strlen($header);
|
| 240 |
-
}
|
| 241 |
-
}
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* Abraham Williams (abraham@abrah.am) http://abrah.am
|
| 5 |
+
*
|
| 6 |
+
* The first PHP Library to support OAuth for Twitter's REST API.
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
/* Load OAuth lib. You can find it at http://oauth.net */
|
| 10 |
+
require_once(SFSI_PLUS_DOCROOT.'/helpers/sfsi_plus_OAuth.php');
|
| 11 |
+
|
| 12 |
+
/**
|
| 13 |
+
* Twitter OAuth class
|
| 14 |
+
*/
|
| 15 |
+
class Plus_TwitterOAuth {
|
| 16 |
+
/* Contains the last HTTP status code returned. */
|
| 17 |
+
public $http_code;
|
| 18 |
+
/* Contains the last API call. */
|
| 19 |
+
public $url;
|
| 20 |
+
/* Set up the API root URL. */
|
| 21 |
+
public $host = "https://api.twitter.com/1.1/";
|
| 22 |
+
/* Set timeout default. */
|
| 23 |
+
public $timeout = 30;
|
| 24 |
+
/* Set connect timeout. */
|
| 25 |
+
public $connecttimeout = 30;
|
| 26 |
+
/* Verify SSL Cert. */
|
| 27 |
+
public $ssl_verifypeer = FALSE;
|
| 28 |
+
/* Respons format. */
|
| 29 |
+
public $format = 'json';
|
| 30 |
+
/* Decode returned json data. */
|
| 31 |
+
public $decode_json = TRUE;
|
| 32 |
+
/* Contains the last HTTP headers returned. */
|
| 33 |
+
public $http_info;
|
| 34 |
+
/* Set the useragnet. */
|
| 35 |
+
public $useragent = 'TwitterOAuth v0.2.0-beta2';
|
| 36 |
+
/* Immediately retry the API call if the response was not successful. */
|
| 37 |
+
//public $retry = TRUE;
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* Set API URLS
|
| 44 |
+
*/
|
| 45 |
+
function accessTokenURL() { return 'https://api.twitter.com/oauth/access_token'; }
|
| 46 |
+
function authenticateURL() { return 'https://api.twitter.com/oauth/authenticate'; }
|
| 47 |
+
function authorizeURL() { return 'https://api.twitter.com/oauth/authorize'; }
|
| 48 |
+
function requestTokenURL() { return 'https://api.twitter.com/oauth/request_token'; }
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Debug helpers
|
| 52 |
+
*/
|
| 53 |
+
function lastStatusCode() { return $this->http_status; }
|
| 54 |
+
function lastAPICall() { return $this->last_api_call; }
|
| 55 |
+
|
| 56 |
+
/**
|
| 57 |
+
* construct TwitterOAuth object
|
| 58 |
+
*/
|
| 59 |
+
function __construct($consumer_key, $consumer_secret, $oauth_token = NULL, $oauth_token_secret = NULL) {
|
| 60 |
+
$this->sha1_method = new Plus_OAuthSignatureMethod_HMAC_SHA1();
|
| 61 |
+
$this->consumer = new Plus_OAuthConsumer($consumer_key, $consumer_secret);
|
| 62 |
+
if (!empty($oauth_token) && !empty($oauth_token_secret)) {
|
| 63 |
+
$this->token = new Plus_OAuthConsumer($oauth_token, $oauth_token_secret);
|
| 64 |
+
} else {
|
| 65 |
+
$this->token = NULL;
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
|
| 70 |
+
/**
|
| 71 |
+
* Get a request_token from Twitter
|
| 72 |
+
*
|
| 73 |
+
* @returns a key/value array containing oauth_token and oauth_token_secret
|
| 74 |
+
*/
|
| 75 |
+
function getRequestToken($oauth_callback) {
|
| 76 |
+
$parameters = array();
|
| 77 |
+
$parameters['oauth_callback'] = $oauth_callback;
|
| 78 |
+
$request = $this->oAuthRequest($this->requestTokenURL(), 'GET', $parameters);
|
| 79 |
+
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 80 |
+
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 81 |
+
return $token;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
/**
|
| 85 |
+
* Get the authorize URL
|
| 86 |
+
*
|
| 87 |
+
* @returns a string
|
| 88 |
+
*/
|
| 89 |
+
function getAuthorizeURL($token, $sign_in_with_twitter = TRUE) {
|
| 90 |
+
if (is_array($token)) {
|
| 91 |
+
$token = $token['oauth_token'];
|
| 92 |
+
}
|
| 93 |
+
if (empty($sign_in_with_twitter)) {
|
| 94 |
+
return $this->authorizeURL() . "?oauth_token={$token}";
|
| 95 |
+
} else {
|
| 96 |
+
return $this->authenticateURL() . "?oauth_token={$token}";
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
/**
|
| 101 |
+
* Exchange request token and secret for an access token and
|
| 102 |
+
* secret, to sign API calls.
|
| 103 |
+
*
|
| 104 |
+
* @returns array("oauth_token" => "the-access-token",
|
| 105 |
+
* "oauth_token_secret" => "the-access-secret",
|
| 106 |
+
* "user_id" => "9436992",
|
| 107 |
+
* "screen_name" => "abraham")
|
| 108 |
+
*/
|
| 109 |
+
function getAccessToken($oauth_verifier) {
|
| 110 |
+
$parameters = array();
|
| 111 |
+
$parameters['oauth_verifier'] = $oauth_verifier;
|
| 112 |
+
$request = $this->oAuthRequest($this->accessTokenURL(), 'GET', $parameters);
|
| 113 |
+
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 114 |
+
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 115 |
+
return $token;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
/**
|
| 119 |
+
* One time exchange of username and password for access token and secret.
|
| 120 |
+
*
|
| 121 |
+
* @returns array("oauth_token" => "the-access-token",
|
| 122 |
+
* "oauth_token_secret" => "the-access-secret",
|
| 123 |
+
* "user_id" => "9436992",
|
| 124 |
+
* "screen_name" => "abraham",
|
| 125 |
+
* "x_auth_expires" => "0")
|
| 126 |
+
*/
|
| 127 |
+
function getXAuthToken($username, $password) {
|
| 128 |
+
$parameters = array();
|
| 129 |
+
$parameters['x_auth_username'] = $username;
|
| 130 |
+
$parameters['x_auth_password'] = $password;
|
| 131 |
+
$parameters['x_auth_mode'] = 'client_auth';
|
| 132 |
+
$request = $this->oAuthRequest($this->accessTokenURL(), 'POST', $parameters);
|
| 133 |
+
$token = Plus_OAuthUtil::parse_parameters($request);
|
| 134 |
+
$this->token = new Plus_OAuthConsumer($token['oauth_token'], $token['oauth_token_secret']);
|
| 135 |
+
return $token;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
/**
|
| 139 |
+
* GET wrapper for oAuthRequest.
|
| 140 |
+
*/
|
| 141 |
+
function get($url, $parameters = array()) {
|
| 142 |
+
$response = $this->oAuthRequest($url, 'GET', $parameters);
|
| 143 |
+
if ($this->format === 'json' && $this->decode_json) {
|
| 144 |
+
return json_decode($response);
|
| 145 |
+
}
|
| 146 |
+
return $response;
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
/**
|
| 150 |
+
* POST wrapper for oAuthRequest.
|
| 151 |
+
*/
|
| 152 |
+
function post($url, $parameters = array()) {
|
| 153 |
+
$response = $this->oAuthRequest($url, 'POST', $parameters);
|
| 154 |
+
if ($this->format === 'json' && $this->decode_json) {
|
| 155 |
+
return json_decode($response);
|
| 156 |
+
}
|
| 157 |
+
return $response;
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
/**
|
| 161 |
+
* DELETE wrapper for oAuthReqeust.
|
| 162 |
+
*/
|
| 163 |
+
function delete($url, $parameters = array()) {
|
| 164 |
+
$response = $this->oAuthRequest($url, 'DELETE', $parameters);
|
| 165 |
+
if ($this->format === 'json' && $this->decode_json) {
|
| 166 |
+
return json_decode($response);
|
| 167 |
+
}
|
| 168 |
+
return $response;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
/**
|
| 172 |
+
* Format and sign an OAuth / API request
|
| 173 |
+
*/
|
| 174 |
+
function oAuthRequest($url, $method, $parameters) {
|
| 175 |
+
if (strrpos($url, 'https://') !== 0 && strrpos($url, 'http://') !== 0) {
|
| 176 |
+
$url = "{$this->host}{$url}.{$this->format}";
|
| 177 |
+
}
|
| 178 |
+
$request = Plus_OAuthRequest::from_consumer_and_token($this->consumer, $this->token, $method, $url, $parameters);
|
| 179 |
+
$request->sign_request($this->sha1_method, $this->consumer, $this->token);
|
| 180 |
+
switch ($method) {
|
| 181 |
+
case 'GET':
|
| 182 |
+
return $this->http($request->to_url(), 'GET');
|
| 183 |
+
default:
|
| 184 |
+
return $this->http($request->get_normalized_http_url(), $method, $request->to_postdata());
|
| 185 |
+
}
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
/**
|
| 189 |
+
* Make an HTTP request
|
| 190 |
+
*
|
| 191 |
+
* @return API results
|
| 192 |
+
*/
|
| 193 |
+
function http($url, $method, $postfields = NULL) {
|
| 194 |
+
$this->http_info = array();
|
| 195 |
+
$ci = curl_init();
|
| 196 |
+
/* Curl settings */
|
| 197 |
+
curl_setopt($ci, CURLOPT_USERAGENT, $this->useragent);
|
| 198 |
+
curl_setopt($ci, CURLOPT_CONNECTTIMEOUT, $this->connecttimeout);
|
| 199 |
+
curl_setopt($ci, CURLOPT_TIMEOUT, $this->timeout);
|
| 200 |
+
curl_setopt($ci, CURLOPT_RETURNTRANSFER, TRUE);
|
| 201 |
+
curl_setopt($ci, CURLOPT_HTTPHEADER, array('Expect:'));
|
| 202 |
+
curl_setopt($ci, CURLOPT_SSL_VERIFYPEER, $this->ssl_verifypeer);
|
| 203 |
+
curl_setopt($ci, CURLOPT_HEADERFUNCTION, array($this, 'getHeader'));
|
| 204 |
+
curl_setopt($ci, CURLOPT_HEADER, FALSE);
|
| 205 |
+
|
| 206 |
+
switch ($method) {
|
| 207 |
+
case 'POST':
|
| 208 |
+
curl_setopt($ci, CURLOPT_POST, TRUE);
|
| 209 |
+
if (!empty($postfields)) {
|
| 210 |
+
curl_setopt($ci, CURLOPT_POSTFIELDS, $postfields);
|
| 211 |
+
}
|
| 212 |
+
break;
|
| 213 |
+
case 'DELETE':
|
| 214 |
+
curl_setopt($ci, CURLOPT_CUSTOMREQUEST, 'DELETE');
|
| 215 |
+
if (!empty($postfields)) {
|
| 216 |
+
$url = "{$url}?{$postfields}";
|
| 217 |
+
}
|
| 218 |
+
}
|
| 219 |
+
|
| 220 |
+
curl_setopt($ci, CURLOPT_URL, $url);
|
| 221 |
+
$response = curl_exec($ci);
|
| 222 |
+
$this->http_code = curl_getinfo($ci, CURLINFO_HTTP_CODE);
|
| 223 |
+
$this->http_info = array_merge($this->http_info, curl_getinfo($ci));
|
| 224 |
+
$this->url = $url;
|
| 225 |
+
curl_close ($ci);
|
| 226 |
+
return $response;
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
/**
|
| 230 |
+
* Get the header info to store.
|
| 231 |
+
*/
|
| 232 |
+
function getHeader($ch, $header) {
|
| 233 |
+
$i = strpos($header, ':');
|
| 234 |
+
if (!empty($i)) {
|
| 235 |
+
$key = str_replace('-', '_', strtolower(substr($header, 0, $i)));
|
| 236 |
+
$value = trim(substr($header, $i + 2));
|
| 237 |
+
$this->http_header[$key] = $value;
|
| 238 |
+
}
|
| 239 |
+
return strlen($header);
|
| 240 |
+
}
|
| 241 |
+
}
|
images/icons_theme/badge/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
images/icons_theme/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
images/index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
index.php
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
echo _('Access Denied');
|
| 3 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
echo _('Access Denied');
|
| 3 |
?>
|
js/custom-admin.js
CHANGED
|
@@ -1,1982 +1,1982 @@
|
|
| 1 |
-
function sfsi_plus_update_index() {
|
| 2 |
-
var s = 1;
|
| 3 |
-
SFSI("ul.plus_icn_listing li.plus_custom").each(function() {
|
| 4 |
-
SFSI(this).children("span.sfsiplus_custom-txt").html("Custom " + s), s++;
|
| 5 |
-
}), cntt = 1, SFSI("div.cm_lnk").each(function() {
|
| 6 |
-
SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom " + cntt + ":"),
|
| 7 |
-
cntt++;
|
| 8 |
-
}), cntt = 1, SFSI("div.plus_custom_m").find("div.sfsiplus_custom_section").each(function() {
|
| 9 |
-
SFSI(this).find("label").html("Custom " + cntt + ":"), cntt++;
|
| 10 |
-
});
|
| 11 |
-
}
|
| 12 |
-
function sfsipluscollapse(s)
|
| 13 |
-
{
|
| 14 |
-
var i = !0, e = SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"), t = SFSI(s).closest("div.ui-accordion-content").first();
|
| 15 |
-
e.toggleClass("ui-corner-all", i).toggleClass("accordion-header-active ui-state-active ui-corner-top", !i).attr("aria-selected", (!i).toString()),
|
| 16 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", i).toggleClass("ui-icon-triangle-1-s", !i),
|
| 17 |
-
t.toggleClass("accordion-content-active", !i), i ? t.slideUp() :t.slideDown();
|
| 18 |
-
}
|
| 19 |
-
function sfsi_plus_delete_CusIcon(s, i)
|
| 20 |
-
{
|
| 21 |
-
sfsiplus_beForeLoad();
|
| 22 |
-
var e = {
|
| 23 |
-
action:"plus_deleteIcons",
|
| 24 |
-
icon_name:i.attr("name")
|
| 25 |
-
};
|
| 26 |
-
SFSI.ajax({
|
| 27 |
-
url:ajax_object.ajax_url,
|
| 28 |
-
type:"post",
|
| 29 |
-
data:e,
|
| 30 |
-
dataType:"json",
|
| 31 |
-
success:function(e) {
|
| 32 |
-
if ("success" == e.res) {
|
| 33 |
-
sfsiplus_showErrorSuc("success", "Saved !", 1);
|
| 34 |
-
var t = e.last_index + 1;
|
| 35 |
-
var attr = i.attr("name");
|
| 36 |
-
attr = attr.replace('plus', '');
|
| 37 |
-
SFSI("#plus_total_cusotm_icons").val(e.total_up), SFSI(s).closest(".plus_custom").remove(),
|
| 38 |
-
SFSI("li.plus_custom:last-child").addClass("bdr_btm_non"), SFSI(".plus_custom-links").find("div." + attr).remove(),
|
| 39 |
-
SFSI(".plus_custom_m").find("div." + attr).remove(), SFSI(".plus_share_icon_order").children("li." + attr).remove(),
|
| 40 |
-
SFSI("ul.plus_sfsi_sample_icons").children("li." + attr).remove();
|
| 41 |
-
var n = e.total_up + 1;
|
| 42 |
-
4 == e.total_up && SFSI(".plus_icn_listing").append('<li id="plus_c' + t + '" class="plus_custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="plussfsiICON_' + t + '_display" type="checkbox" value="yes" class="styled" style="display:none;" element-type="sfsiplus-cusotm-icon" isNew="yes" /></div> <span class="plus_custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="plus_CImg_' + t + '" /> </span> <span class="custom sfsiplus_custom-txt">Custom' + n + ' </span> <div class="sfsiplus_right_info"> <p><span>'+object_name1.It_depends+':</span> '+object_name1.Upload_a+'</p><div class="inputWrapper"></div></li>');
|
| 43 |
-
} else sfsiplus_showErrorSuc("error", "Unkown error , please try again", 1);
|
| 44 |
-
return sfsi_plus_update_index(), plus_update_Sec5Iconorder(), sfsi_plus_update_step1(), sfsi_plus_update_step5(),
|
| 45 |
-
sfsiplus_afterLoad(), "suc";
|
| 46 |
-
}
|
| 47 |
-
});
|
| 48 |
-
}
|
| 49 |
-
function plus_update_Sec5Iconorder()
|
| 50 |
-
{
|
| 51 |
-
SFSI("ul.plus_share_icon_order").children("li").each(function() {
|
| 52 |
-
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
| 53 |
-
});
|
| 54 |
-
}
|
| 55 |
-
function sfsi_plus_section_Display(s, i)
|
| 56 |
-
{
|
| 57 |
-
"hide" == i ? (SFSI("." + s + " :input").prop("disabled", !0), SFSI("." + s + " :button").prop("disabled", !0),
|
| 58 |
-
SFSI("." + s).hide()) :(SFSI("." + s + " :input").removeAttr("disabled", !0), SFSI("." + s + " :button").removeAttr("disabled", !0),
|
| 59 |
-
SFSI("." + s).show());
|
| 60 |
-
}
|
| 61 |
-
function sfsi_plus_depened_sections()
|
| 62 |
-
{
|
| 63 |
-
if ("sfsi" == SFSI("input[name='sfsi_plus_rss_icons']:checked").val()) {
|
| 64 |
-
for (i = 0; 16 > i; i++) {
|
| 65 |
-
var s = i + 1, e = 74 * i;
|
| 66 |
-
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-588px -" + e + "px");
|
| 67 |
-
}
|
| 68 |
-
var t = SFSI(".icon_img").attr("src");
|
| 69 |
-
if(t)
|
| 70 |
-
{
|
| 71 |
-
if (t.indexOf("subscribe") !=-1)
|
| 72 |
-
{
|
| 73 |
-
var n = t.replace("subscribe.png", "sf_arow_icn.png");
|
| 74 |
-
}
|
| 75 |
-
else
|
| 76 |
-
{
|
| 77 |
-
var n = t.replace("email.png", "sf_arow_icn.png");
|
| 78 |
-
}
|
| 79 |
-
SFSI(".icon_img").attr("src", n);
|
| 80 |
-
}
|
| 81 |
-
}
|
| 82 |
-
else
|
| 83 |
-
{
|
| 84 |
-
if("email" == SFSI("input[name='sfsi_plus_rss_icons']:checked").val())
|
| 85 |
-
{
|
| 86 |
-
for (SFSI(".sfsiplus_row_1_2").css("background-position", "-58px 0"), i = 0; 16 > i; i++) {
|
| 87 |
-
var s = i + 1, e = 74 * i;
|
| 88 |
-
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-58px -" + e + "px");
|
| 89 |
-
}
|
| 90 |
-
var t = SFSI(".icon_img").attr("src");
|
| 91 |
-
if (t) {
|
| 92 |
-
if (t.indexOf("sf_arow_icn") !=-1)
|
| 93 |
-
{
|
| 94 |
-
var n = t.replace("sf_arow_icn.png", "email.png");
|
| 95 |
-
}
|
| 96 |
-
else
|
| 97 |
-
{
|
| 98 |
-
var n = t.replace("subscribe.png", "email.png");
|
| 99 |
-
}
|
| 100 |
-
SFSI(".icon_img").attr("src", n);
|
| 101 |
-
}
|
| 102 |
-
}
|
| 103 |
-
else
|
| 104 |
-
{
|
| 105 |
-
for (SFSI(".sfsiplus_row_1_2").css("background-position", "-649px 0"), i = 0; 16 > i; i++) {
|
| 106 |
-
var s = i + 1, e = 74 * i;
|
| 107 |
-
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-649px -" + e + "px");
|
| 108 |
-
}
|
| 109 |
-
var t = SFSI(".icon_img").attr("src");
|
| 110 |
-
if (t) {
|
| 111 |
-
if (t.indexOf("email") !=-1)
|
| 112 |
-
{
|
| 113 |
-
var n = t.replace("email.png", "subscribe.png");
|
| 114 |
-
}
|
| 115 |
-
else
|
| 116 |
-
{
|
| 117 |
-
var n = t.replace("sf_arow_icn.png", "subscribe.png");
|
| 118 |
-
}
|
| 119 |
-
SFSI(".icon_img").attr("src", n);
|
| 120 |
-
}
|
| 121 |
-
}
|
| 122 |
-
}
|
| 123 |
-
SFSI("input[name='sfsi_plus_rss_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_rss_section", "show") :sfsi_plus_section_Display("sfsiplus_rss_section", "hide"),
|
| 124 |
-
SFSI("input[name='sfsi_plus_email_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_email_section", "show") :sfsi_plus_section_Display("sfsiplus_email_section", "hide"),
|
| 125 |
-
SFSI("input[name='sfsi_plus_facebook_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_facebook_section", "show") :sfsi_plus_section_Display("sfsiplus_facebook_section", "hide"),
|
| 126 |
-
SFSI("input[name='sfsi_plus_twitter_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_twitter_section", "show") :sfsi_plus_section_Display("sfsiplus_twitter_section", "hide"),
|
| 127 |
-
SFSI("input[name='sfsi_plus_google_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_google_section", "show") :sfsi_plus_section_Display("sfsiplus_google_section", "hide"),
|
| 128 |
-
SFSI("input[name='sfsi_plus_share_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_share_section", "show") :sfsi_plus_section_Display("sfsiplus_share_section", "hide"),
|
| 129 |
-
SFSI("input[name='sfsi_plus_youtube_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_youtube_section", "show") :sfsi_plus_section_Display("sfsiplus_youtube_section", "hide"),
|
| 130 |
-
SFSI("input[name='sfsi_plus_pinterest_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_pinterest_section", "show") :sfsi_plus_section_Display("sfsiplus_pinterest_section", "hide"),
|
| 131 |
-
SFSI("input[name='sfsi_plus_instagram_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_instagram_section", "show") :sfsi_plus_section_Display("sfsiplus_instagram_section", "hide"),
|
| 132 |
-
SFSI("input[name='sfsi_plus_houzz_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_houzz_section", "show") :sfsi_plus_section_Display("sfsiplus_houzz_section", "hide"),
|
| 133 |
-
SFSI("input[name='sfsi_plus_linkedin_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_linkedin_section", "show") :sfsi_plus_section_Display("sfsiplus_linkedin_section", "hide"),
|
| 134 |
-
SFSI("input[element-type='sfsiplus-cusotm-icon']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_custom_section", "show") :sfsi_plus_section_Display("sfsiplus_custom_section", "hide");
|
| 135 |
-
}
|
| 136 |
-
function PlusCustomIConSectionsUpdate()
|
| 137 |
-
{
|
| 138 |
-
sfsi_plus_section_Display("counter".ele, show);
|
| 139 |
-
}
|
| 140 |
-
// Upload Custom Skin {Monad}
|
| 141 |
-
function plus_sfsi_customskin_upload(s, ref)
|
| 142 |
-
{
|
| 143 |
-
var ttl = jQuery(ref).attr("title");
|
| 144 |
-
var i = s, e = {
|
| 145 |
-
action:"plus_UploadSkins",
|
| 146 |
-
custom_imgurl:i
|
| 147 |
-
};
|
| 148 |
-
SFSI.ajax({
|
| 149 |
-
url:ajax_object.ajax_url,
|
| 150 |
-
type:"post",
|
| 151 |
-
data:e,
|
| 152 |
-
success:function(msg) {
|
| 153 |
-
if (msg.res = "success")
|
| 154 |
-
{
|
| 155 |
-
var arr = s.split('=');
|
| 156 |
-
jQuery(ref).prev('.imgskin').attr('src', arr[1]);
|
| 157 |
-
jQuery(ref).prev('.imgskin').css("display","block");
|
| 158 |
-
jQuery(ref).text("Update");
|
| 159 |
-
jQuery(ref).next('.dlt_btn').css("display","block");
|
| 160 |
-
}
|
| 161 |
-
}
|
| 162 |
-
});
|
| 163 |
-
}
|
| 164 |
-
// Delete Custom Skin {Monad}
|
| 165 |
-
function sfsiplus_deleteskin_icon(s)
|
| 166 |
-
{
|
| 167 |
-
var iconname = jQuery(s).attr("title");
|
| 168 |
-
var nonce = jQuery(s).attr("data-nonce");
|
| 169 |
-
var i = iconname, e = {
|
| 170 |
-
action:"plus_DeleteSkin",
|
| 171 |
-
iconname:i,
|
| 172 |
-
nonce:nonce
|
| 173 |
-
};
|
| 174 |
-
|
| 175 |
-
SFSI.ajax({
|
| 176 |
-
url:ajax_object.ajax_url,
|
| 177 |
-
type:"post",
|
| 178 |
-
data:e,
|
| 179 |
-
dataType: "json",
|
| 180 |
-
success:function(msg) {
|
| 181 |
-
if (msg.res === "success")
|
| 182 |
-
{
|
| 183 |
-
SFSI(s).prev("a").text("Upload");
|
| 184 |
-
SFSI(s).prev("a").prev("img").attr("src",'');
|
| 185 |
-
SFSI(s).prev("a").prev("img").css("display","none");
|
| 186 |
-
SFSI(s).css("display","none");
|
| 187 |
-
}
|
| 188 |
-
else
|
| 189 |
-
{
|
| 190 |
-
alert("Whoops! something went wrong.")
|
| 191 |
-
}
|
| 192 |
-
}
|
| 193 |
-
});
|
| 194 |
-
}
|
| 195 |
-
// Save Custom Skin {Monad}
|
| 196 |
-
function SFSI_plus_done()
|
| 197 |
-
{
|
| 198 |
-
e = { action:"plus_Iamdone" };
|
| 199 |
-
|
| 200 |
-
SFSI.ajax({
|
| 201 |
-
url:ajax_object.ajax_url,
|
| 202 |
-
type:"post",
|
| 203 |
-
data:e,
|
| 204 |
-
success:function(msg) {
|
| 205 |
-
jQuery("li.cstomskins_upload").children(".sfsiplus_icns_tab_3").html(msg);
|
| 206 |
-
SFSI("input[name='sfsi_plus_rss_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_rss_section", "show") :sfsi_plus_section_Display("sfsiplus_rss_section", "hide"),SFSI("input[name='sfsi_plus_email_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_email_section", "show") :sfsi_plus_section_Display("sfsiplus_email_section", "hide"),SFSI("input[name='sfsi_plus_facebook_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_facebook_section", "show") :sfsi_plus_section_Display("sfsiplus_facebook_section", "hide"), SFSI("input[name='sfsi_plus_twitter_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_twitter_section", "show") :sfsi_plus_section_Display("sfsiplus_twitter_section", "hide"),SFSI("input[name='sfsi_plus_google_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_google_section", "show") :sfsi_plus_section_Display("sfsiplus_google_section", "hide"), SFSI("input[name='sfsi_plus_share_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_share_section", "show") :sfsi_plus_section_Display("sfsiplus_share_section", "hide"), SFSI("input[name='sfsi_plus_youtube_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_youtube_section", "show") :sfsi_plus_section_Display("sfsiplus_youtube_section", "hide"), SFSI("input[name='sfsi_plus_pinterest_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_pinterest_section", "show") :sfsi_plus_section_Display("sfsiplus_pinterest_section", "hide"), SFSI("input[name='sfsi_plus_instagram_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_instagram_section", "show") :sfsi_plus_section_Display("sfsiplus_instagram_section", "hide"), SFSI("input[name='sfsi_plus_houzz_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_houzz_section", "show") :sfsi_plus_section_Display("sfsiplus_houzz_section", "hide"), SFSI("input[name='sfsi_plus_linkedin_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_linkedin_section", "show") :sfsi_plus_section_Display("sfsiplus_linkedin_section", "hide"), SFSI("input[element-type='sfsiplus-cusotm-icon']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_custom_section", "show") :sfsi_plus_section_Display("sfsiplus_custom_section", "hide");
|
| 207 |
-
SFSI(".cstmskins-overlay").hide("slow");
|
| 208 |
-
sfsi_plus_update_step3() && sfsipluscollapse(this);
|
| 209 |
-
}
|
| 210 |
-
});
|
| 211 |
-
}
|
| 212 |
-
// Upload Custom Icons {Monad}
|
| 213 |
-
function plus_sfsi_newcustomicon_upload(s)
|
| 214 |
-
{
|
| 215 |
-
var i = s, e = {
|
| 216 |
-
action:"plus_UploadIcons",
|
| 217 |
-
custom_imgurl:i
|
| 218 |
-
};
|
| 219 |
-
SFSI.ajax({
|
| 220 |
-
url:ajax_object.ajax_url,
|
| 221 |
-
type:"post",
|
| 222 |
-
data:e,
|
| 223 |
-
dataType:"json",
|
| 224 |
-
async:!0,
|
| 225 |
-
success:function(s) {
|
| 226 |
-
if(s.res == 'success')
|
| 227 |
-
{
|
| 228 |
-
sfsiplus_afterIconSuccess(s);
|
| 229 |
-
}
|
| 230 |
-
else
|
| 231 |
-
{
|
| 232 |
-
SFSI(".upload-overlay").hide("slow");
|
| 233 |
-
SFSI(".uperror").html(s.res);
|
| 234 |
-
sfsiplus_showErrorSuc("Error", "Some Error Occured During Upload Custom Icon", 1)
|
| 235 |
-
}
|
| 236 |
-
}
|
| 237 |
-
});
|
| 238 |
-
}
|
| 239 |
-
function sfsi_plus_update_step1()
|
| 240 |
-
{
|
| 241 |
-
var nonce = SFSI("#sfsi_plus_save1").attr("data-nonce");
|
| 242 |
-
global_error = 0, sfsiplus_beForeLoad(), sfsi_plus_depened_sections();
|
| 243 |
-
var s = !1, i = SFSI("input[name='sfsi_plus_rss_display']:checked").val(), e = SFSI("input[name='sfsi_plus_email_display']:checked").val(), t = SFSI("input[name='sfsi_plus_facebook_display']:checked").val(), n = SFSI("input[name='sfsi_plus_twitter_display']:checked").val(), o = SFSI("input[name='sfsi_plus_google_display']:checked").val(), a = SFSI("input[name='sfsi_plus_share_display']:checked").val(), r = SFSI("input[name='sfsi_plus_youtube_display']:checked").val(), c = SFSI("input[name='sfsi_plus_pinterest_display']:checked").val(), p = SFSI("input[name='sfsi_plus_linkedin_display']:checked").val(), _ = SFSI("input[name='sfsi_plus_instagram_display']:checked").val(), houzz = SFSI("input[name='sfsi_plus_houzz_display']:checked").val(), l = SFSI("input[name='sfsi_custom1_display']:checked").val(), S = SFSI("input[name='sfsi_custom2_display']:checked").val(), u = SFSI("input[name='sfsi_custom3_display']:checked").val(), f = SFSI("input[name='sfsi_custom4_display']:checked").val(), d = SFSI("input[name='sfsi_custom5_display']:checked").val(), I = {
|
| 244 |
-
action:"plus_updateSrcn1",
|
| 245 |
-
sfsi_plus_rss_display:i,
|
| 246 |
-
sfsi_plus_email_display:e,
|
| 247 |
-
sfsi_plus_facebook_display:t,
|
| 248 |
-
sfsi_plus_twitter_display:n,
|
| 249 |
-
sfsi_plus_google_display:o,
|
| 250 |
-
sfsi_plus_share_display:a,
|
| 251 |
-
sfsi_plus_youtube_display:r,
|
| 252 |
-
sfsi_plus_pinterest_display:c,
|
| 253 |
-
sfsi_plus_linkedin_display:p,
|
| 254 |
-
sfsi_plus_instagram_display:_,
|
| 255 |
-
sfsi_plus_houzz_display:houzz,
|
| 256 |
-
sfsi_custom1_display:l,
|
| 257 |
-
sfsi_custom2_display:S,
|
| 258 |
-
sfsi_custom3_display:u,
|
| 259 |
-
sfsi_custom4_display:f,
|
| 260 |
-
sfsi_custom5_display:d,
|
| 261 |
-
nonce:nonce
|
| 262 |
-
};
|
| 263 |
-
SFSI.ajax({
|
| 264 |
-
url:ajax_object.ajax_url,
|
| 265 |
-
type:"post",
|
| 266 |
-
data:I,
|
| 267 |
-
async:!0,
|
| 268 |
-
dataType:"json",
|
| 269 |
-
success:function(i) {
|
| 270 |
-
if(i=="wrong_nonce")
|
| 271 |
-
{
|
| 272 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 1);
|
| 273 |
-
s = !1;
|
| 274 |
-
sfsiplus_afterLoad();
|
| 275 |
-
}
|
| 276 |
-
else
|
| 277 |
-
{
|
| 278 |
-
"success" == i ? (sfsiplus_showErrorSuc("success", "Saved !", 1), sfsipluscollapse("#sfsi_plus_save1"),
|
| 279 |
-
sfsi_plus_make_popBox()) :(global_error = 1, sfsiplus_showErrorSuc("error", "Unkown error , please try again", 1),
|
| 280 |
-
s = !1), sfsiplus_afterLoad();
|
| 281 |
-
}
|
| 282 |
-
}
|
| 283 |
-
});
|
| 284 |
-
}
|
| 285 |
-
function sfsi_plus_update_step2()
|
| 286 |
-
{
|
| 287 |
-
var nonce = SFSI("#sfsi_plus_save2").attr("data-nonce");
|
| 288 |
-
var s = sfsi_plus_validationStep2();
|
| 289 |
-
if (!s) return global_error = 1, !1;
|
| 290 |
-
sfsiplus_beForeLoad();
|
| 291 |
-
var i = 1 == SFSI("input[name='sfsi_plus_rss_url']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_url']").val(), e = 1 == SFSI("input[name='sfsi_plus_rss_icons']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_icons']:checked").val(), t = 1 == SFSI("input[name='sfsi_plus_facebookPage_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookPage_option']:checked").val(), n = 1 == SFSI("input[name='sfsi_plus_facebookLike_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookLike_option']:checked").val(), o = 1 == SFSI("input[name='sfsi_plus_facebookShare_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookShare_option']:checked").val(), a = SFSI("input[name='sfsi_plus_facebookPage_url']").val(), r = 1 == SFSI("input[name='sfsi_plus_twitter_followme']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_followme']:checked").val(), c = 1 == SFSI("input[name='sfsi_plus_twitter_followUserName']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_followUserName']").val(), p = 1 == SFSI("input[name='sfsi_plus_twitter_aboutPage']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_aboutPage']:checked").val(), _ = 1 == SFSI("input[name='sfsi_plus_twitter_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_page']:checked").val(), l = SFSI("input[name='sfsi_plus_twitter_pageURL']").val(), S = SFSI("textarea[name='sfsi_plus_twitter_aboutPageText']").val(), u = 1 == SFSI("input[name='sfsi_plus_google_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_page']:checked").val(), f = 1 == SFSI("input[name='sfsi_plus_googleLike_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_googleLike_option']:checked").val(), d = SFSI("input[name='sfsi_plus_google_pageURL']").val(), I = 1 == SFSI("input[name='sfsi_plus_googleShare_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_googleShare_option']:checked").val(), m = 1 == SFSI("input[name='sfsi_plus_youtube_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_page']:checked").val(), F = 1 == SFSI("input[name='sfsi_plus_youtube_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_pageUrl']").val(), h = 1 == SFSI("input[name='sfsi_plus_youtube_follow']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_follow']:checked").val(), cls = SFSI("input[name='sfsi_plus_youtubeusernameorid']:checked").val(), v = SFSI("input[name='sfsi_plus_ytube_user']").val(), vchid = SFSI("input[name='sfsi_plus_ytube_chnlid']").val(), g = 1 == SFSI("input[name='sfsi_plus_pinterest_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_page']:checked").val(), k = 1 == SFSI("input[name='sfsi_plus_pinterest_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_pageUrl']").val(), y = 1 == SFSI("input[name='sfsi_plus_pinterest_pingBlog']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_pingBlog']:checked").val(), b = 1 == SFSI("input[name='sfsi_plus_instagram_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_pageUrl']").val(), houzz = 1 == SFSI("input[name='sfsi_plus_houzz_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_pageUrl']").val(), w = 1 == SFSI("input[name='sfsi_plus_linkedin_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_page']:checked").val(), x = 1 == SFSI("input[name='sfsi_plus_linkedin_pageURL']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_pageURL']").val(), C = 1 == SFSI("input[name='sfsi_plus_linkedin_follow']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_follow']:checked").val(), D = SFSI("input[name='sfsi_plus_linkedin_followCompany']").val(), U = 1 == SFSI("input[name='sfsi_plus_linkedin_SharePage']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_SharePage']:checked").val(), O = SFSI("input[name='sfsi_plus_linkedin_recommendBusines']:checked").val(), T = SFSI("input[name='sfsi_plus_linkedin_recommendProductId']").val(), j = SFSI("input[name='sfsi_plus_linkedin_recommendCompany']").val(), P = {};
|
| 292 |
-
SFSI("input[name='sfsi_plus_CustomIcon_links[]']").each(function() {
|
| 293 |
-
P[SFSI(this).attr("file-id")] = this.value;
|
| 294 |
-
});
|
| 295 |
-
var M = {
|
| 296 |
-
action:"plus_updateSrcn2",
|
| 297 |
-
sfsi_plus_rss_url:i,
|
| 298 |
-
sfsi_plus_rss_icons:e,
|
| 299 |
-
sfsi_plus_facebookPage_option:t,
|
| 300 |
-
sfsi_plus_facebookLike_option:n,
|
| 301 |
-
sfsi_plus_facebookShare_option:o,
|
| 302 |
-
sfsi_plus_facebookPage_url:a,
|
| 303 |
-
sfsi_plus_twitter_followme:r,
|
| 304 |
-
sfsi_plus_twitter_followUserName:c,
|
| 305 |
-
sfsi_plus_twitter_aboutPage:p,
|
| 306 |
-
sfsi_plus_twitter_page:_,
|
| 307 |
-
sfsi_plus_twitter_pageURL:l,
|
| 308 |
-
sfsi_plus_twitter_aboutPageText:S,
|
| 309 |
-
sfsi_plus_google_page:u,
|
| 310 |
-
sfsi_plus_googleLike_option:f,
|
| 311 |
-
sfsi_plus_google_pageURL:d,
|
| 312 |
-
sfsi_plus_googleShare_option:I,
|
| 313 |
-
sfsi_plus_youtube_page:m,
|
| 314 |
-
sfsi_plus_youtube_pageUrl:F,
|
| 315 |
-
sfsi_plus_youtube_follow:h,
|
| 316 |
-
sfsi_plus_youtubeusernameorid:cls,
|
| 317 |
-
sfsi_plus_ytube_user:v,
|
| 318 |
-
sfsi_plus_ytube_chnlid:vchid,
|
| 319 |
-
sfsi_plus_pinterest_page:g,
|
| 320 |
-
sfsi_plus_pinterest_pageUrl:k,
|
| 321 |
-
sfsi_plus_instagram_pageUrl:b,
|
| 322 |
-
sfsi_plus_houzz_pageUrl:houzz,
|
| 323 |
-
sfsi_plus_pinterest_pingBlog:y,
|
| 324 |
-
sfsi_plus_linkedin_page:w,
|
| 325 |
-
sfsi_plus_linkedin_pageURL:x,
|
| 326 |
-
sfsi_plus_linkedin_follow:C,
|
| 327 |
-
sfsi_plus_linkedin_followCompany:D,
|
| 328 |
-
sfsi_plus_linkedin_SharePage:U,
|
| 329 |
-
sfsi_plus_linkedin_recommendBusines:O,
|
| 330 |
-
sfsi_plus_linkedin_recommendCompany:j,
|
| 331 |
-
sfsi_plus_linkedin_recommendProductId:T,
|
| 332 |
-
sfsi_plus_custom_links:P,
|
| 333 |
-
nonce:nonce
|
| 334 |
-
};
|
| 335 |
-
SFSI.ajax({
|
| 336 |
-
url:ajax_object.ajax_url,
|
| 337 |
-
type:"post",
|
| 338 |
-
data:M,
|
| 339 |
-
async:!0,
|
| 340 |
-
dataType:"json",
|
| 341 |
-
success:function(s) {
|
| 342 |
-
if(s == "wrong_nonce")
|
| 343 |
-
{
|
| 344 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 2);
|
| 345 |
-
return_value = !1;
|
| 346 |
-
sfsiplus_afterLoad();
|
| 347 |
-
}
|
| 348 |
-
else
|
| 349 |
-
{
|
| 350 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 2), sfsipluscollapse("#sfsi_plus_save2"),
|
| 351 |
-
sfsi_plus_depened_sections()) :(global_error = 1, sfsiplus_showErrorSuc("error", "Unkown error , please try again", 2),
|
| 352 |
-
return_value = !1), sfsiplus_afterLoad();
|
| 353 |
-
}
|
| 354 |
-
}
|
| 355 |
-
});
|
| 356 |
-
}
|
| 357 |
-
function sfsi_plus_update_step3()
|
| 358 |
-
{
|
| 359 |
-
var nonce = SFSI("#sfsi_plus_save3").attr("data-nonce");
|
| 360 |
-
var s = sfsi_plus_validationStep3();
|
| 361 |
-
if (!s) return global_error = 1, !1;
|
| 362 |
-
sfsiplus_beForeLoad();
|
| 363 |
-
var i = SFSI("input[name='sfsi_plus_actvite_theme']:checked").val(), e = SFSI("input[name='sfsi_plus_mouseOver']:checked").val(), t = SFSI("input[name='sfsi_plus_shuffle_icons']:checked").val(), n = SFSI("input[name='sfsi_plus_shuffle_Firstload']:checked").val(), o = SFSI("#sfsi_plus_mouseOver_effect option:selected").val(), a = SFSI("input[name='sfsi_plus_shuffle_interval']:checked").val(), r = SFSI("input[name='sfsi_plus_shuffle_intervalTime']").val(), c = SFSI("input[name='sfsi_plus_specialIcon_animation']:checked").val(), p = SFSI("input[name='sfsi_plus_specialIcon_MouseOver']:checked").val(), _ = SFSI("input[name='sfsi_plus_specialIcon_Firstload']:checked").val(), l = SFSI("#sfsi_plus_specialIcon_Firstload_Icons option:selected").val(), S = SFSI("input[name='sfsi_plus_specialIcon_interval']:checked").val(), u = SFSI("input[name='sfsi_plus_specialIcon_intervalTime']").val(), f = SFSI("#sfsi_plus_specialIcon_intervalIcons option:selected").val(), d = {
|
| 364 |
-
action:"plus_updateSrcn3",
|
| 365 |
-
sfsi_plus_actvite_theme:i,
|
| 366 |
-
sfsi_plus_mouseOver:e,
|
| 367 |
-
sfsi_plus_shuffle_icons:t,
|
| 368 |
-
sfsi_plus_shuffle_Firstload:n,
|
| 369 |
-
sfsi_plus_mouseOver_effect:o,
|
| 370 |
-
sfsi_plus_shuffle_interval:a,
|
| 371 |
-
sfsi_plus_shuffle_intervalTime:r,
|
| 372 |
-
sfsi_plus_specialIcon_animation:c,
|
| 373 |
-
sfsi_plus_specialIcon_MouseOver:p,
|
| 374 |
-
sfsi_plus_specialIcon_Firstload:_,
|
| 375 |
-
sfsi_plus_specialIcon_Firstload_Icons:l,
|
| 376 |
-
sfsi_plus_specialIcon_interval:S,
|
| 377 |
-
sfsi_plus_specialIcon_intervalTime:u,
|
| 378 |
-
sfsi_plus_specialIcon_intervalIcons:f,
|
| 379 |
-
nonce:nonce
|
| 380 |
-
};
|
| 381 |
-
SFSI.ajax({
|
| 382 |
-
url:ajax_object.ajax_url,
|
| 383 |
-
type:"post",
|
| 384 |
-
data:d,
|
| 385 |
-
async:!0,
|
| 386 |
-
dataType:"json",
|
| 387 |
-
success:function(s) {
|
| 388 |
-
if(s == "wrong_nonce")
|
| 389 |
-
{
|
| 390 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 3);
|
| 391 |
-
return_value = !1;
|
| 392 |
-
sfsiplus_afterLoad();
|
| 393 |
-
}
|
| 394 |
-
else
|
| 395 |
-
{
|
| 396 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 3), sfsipluscollapse("#sfsi_plus_save3")) :(sfsiplus_showErrorSuc("error", "Unkown error , please try again", 3),
|
| 397 |
-
return_value = !1), sfsiplus_afterLoad();
|
| 398 |
-
}
|
| 399 |
-
}
|
| 400 |
-
});
|
| 401 |
-
}
|
| 402 |
-
function sfsi_plus_show_counts()
|
| 403 |
-
{
|
| 404 |
-
"yes" == SFSI("input[name='sfsi_plus_display_counts']:checked").val() ? (SFSI(".sfsiplus_count_sections").slideDown(),
|
| 405 |
-
sfsi_plus_showPreviewCounts()) :(SFSI(".sfsiplus_count_sections").slideUp(), sfsi_plus_showPreviewCounts());
|
| 406 |
-
}
|
| 407 |
-
function sfsi_plus_showPreviewCounts()
|
| 408 |
-
{
|
| 409 |
-
var s = 0;
|
| 410 |
-
1 == SFSI("input[name='sfsi_plus_rss_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_rss_countsDisplay").css("opacity", 1),
|
| 411 |
-
s = 1) :SFSI("#sfsi_plus_rss_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_email_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_email_countsDisplay").css("opacity", 1),
|
| 412 |
-
s = 1) :SFSI("#sfsi_plus_email_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity", 1),
|
| 413 |
-
s = 1) :SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_twitter_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_twitter_countsDisplay").css("opacity", 1),
|
| 414 |
-
s = 1) :SFSI("#sfsi_plus_twitter_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_google_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_google_countsDisplay").css("opacity", 1),
|
| 415 |
-
s = 1) :SFSI("#sfsi_plus_google_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_linkedIn_countsDisplay").css("opacity", 1),
|
| 416 |
-
s = 1) :SFSI("#sfsi_plus_linkedIn_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity", 1),
|
| 417 |
-
s = 1) :SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_pinterest_countsDisplay").css("opacity", 1),
|
| 418 |
-
s = 1) :SFSI("#sfsi_plus_pinterest_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_shares_countsDisplay").css("opacity", 1),
|
| 419 |
-
s = 1) :SFSI("#sfsi_plus_shares_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity", 1),
|
| 420 |
-
s = 1) :SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_houzz_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_houzz_countsDisplay").css("opacity", 1),
|
| 421 |
-
s = 1) :SFSI("#sfsi_plus_houzz_countsDisplay").css("opacity", 0), 0 == s || "no" == SFSI("input[name='sfsi_plus_display_counts']:checked").val() ? SFSI(".sfsi_Cdisplay").hide() :SFSI(".sfsi_Cdisplay").show();
|
| 422 |
-
}
|
| 423 |
-
function sfsi_plus_show_OnpostsDisplay()
|
| 424 |
-
{
|
| 425 |
-
//"yes" == SFSI("input[name='sfsi_plus_show_Onposts']:checked").val() ? SFSI(".sfsiplus_PostsSettings_section").slideDown() :SFSI(".sfsiplus_PostsSettings_section").slideUp();
|
| 426 |
-
}
|
| 427 |
-
function sfsi_plus_update_step4()
|
| 428 |
-
{
|
| 429 |
-
var nonce = SFSI("#sfsi_plus_save4").attr("data-nonce");
|
| 430 |
-
var s = !1, i = sfsi_plus_validationStep4();
|
| 431 |
-
if (!i) return global_error = 1, !1;
|
| 432 |
-
sfsiplus_beForeLoad();
|
| 433 |
-
var e = SFSI("input[name='sfsi_plus_display_counts']:checked").val(), t = 1 == SFSI("input[name='sfsi_plus_email_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_countsDisplay']:checked").val(), n = 1 == SFSI("input[name='sfsi_plus_email_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_countsFrom']:checked").val(), o = SFSI("input[name='sfsi_plus_email_manualCounts']").val(), a = SFSI("input[name='sfsi_plus_google_api_key']").val(), r = 1 == SFSI("input[name='sfsi_plus_rss_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_countsDisplay']:checked").val(), c = SFSI("input[name='sfsi_plus_rss_manualCounts']").val(), p = 1 == SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_countsDisplay']:checked").val(), _ = 1 == SFSI("input[name='sfsi_plus_facebook_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val(), mp = SFSI("input[name='sfsi_plus_facebook_mypageCounts']").val(), l = SFSI("input[name='sfsi_plus_facebook_manualCounts']").val(), S = 1 == SFSI("input[name='sfsi_plus_twitter_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_countsDisplay']:checked").val(), u = 1 == SFSI("input[name='sfsi_plus_twitter_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_countsFrom']:checked").val(), f = SFSI("input[name='sfsi_plus_twitter_manualCounts']").val(), d = SFSI("input[name='sfsiplus_tw_consumer_key']").val(), I = SFSI("input[name='sfsiplus_tw_consumer_secret']").val(), m = SFSI("input[name='sfsiplus_tw_oauth_access_token']").val(), F = SFSI("input[name='sfsiplus_tw_oauth_access_token_secret']").val(), h = 1 == SFSI("input[name='sfsi_plus_google_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_countsDisplay']:checked").val(), v = 1 == SFSI("input[name='sfsi_plus_google_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val(), g = SFSI("input[name='sfsi_plus_google_manualCounts']").val(), k = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val(), y = SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").val(), b = SFSI("input[name='sfsi_plus_ln_company']").val(), w = SFSI("input[name='sfsi_plus_ln_api_key']").val(), x = SFSI("input[name='sfsi_plus_ln_secret_key']").val(), C = SFSI("input[name='sfsi_plus_ln_oAuth_user_token']").val(), D = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']:checked").val(), k = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val(), y = SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").val(), U = 1 == SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_countsDisplay']:checked").val(), O = 1 == SFSI("input[name='sfsi_plus_youtube_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_countsFrom']:checked").val(), T = SFSI("input[name='sfsi_plus_youtube_manualCounts']").val(), j = SFSI("input[name='sfsi_plus_youtube_user']").val(), P = 1 == SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_countsDisplay']:checked").val(), M = 1 == SFSI("input[name='sfsi_plus_pinterest_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_countsFrom']:checked").val(), L = SFSI("input[name='sfsi_plus_pinterest_manualCounts']").val(), B = SFSI("input[name='sfsi_plus_pinterest_user']").val(), E = SFSI("input[name='sfsi_plus_pinterest_board']").val(), z = 1 == SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_countsDisplay']:checked").val(), A = 1 == SFSI("input[name='sfsi_plus_instagram_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val(), N = SFSI("input[name='sfsi_plus_instagram_manualCounts']").val(), H = SFSI("input[name='sfsi_plus_instagram_User']").val(), R = 1 == SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_shares_countsDisplay']:checked").val(), W = 1 == SFSI("input[name='sfsi_plus_shares_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val(), q = SFSI("input[name='sfsi_plus_shares_manualCounts']").val(), houzzDisplay = 1 == SFSI("input[name='sfsi_plus_houzz_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_countsDisplay']:checked").val(), houzzFrom = 1 == SFSI("input[name='sfsi_plus_houzz_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_countsFrom']:checked").val(), houzzCount = SFSI("input[name='sfsi_plus_houzz_manualCounts']").val(), $ = {
|
| 434 |
-
action:"plus_updateSrcn4",
|
| 435 |
-
sfsi_plus_display_counts:e,
|
| 436 |
-
sfsi_plus_email_countsDisplay:t,
|
| 437 |
-
sfsi_plus_email_countsFrom:n,
|
| 438 |
-
sfsi_plus_email_manualCounts:o,
|
| 439 |
-
sfsi_plus_rss_countsDisplay:r,
|
| 440 |
-
sfsi_plus_rss_manualCounts:c,
|
| 441 |
-
sfsi_plus_facebook_countsDisplay:p,
|
| 442 |
-
sfsi_plus_facebook_countsFrom:_,
|
| 443 |
-
sfsi_plus_facebook_mypageCounts:mp,
|
| 444 |
-
sfsi_plus_facebook_manualCounts:l,
|
| 445 |
-
sfsi_plus_twitter_countsDisplay:S,
|
| 446 |
-
sfsi_plus_twitter_countsFrom:u,
|
| 447 |
-
sfsi_plus_twitter_manualCounts:f,
|
| 448 |
-
sfsiplus_tw_consumer_key:d,
|
| 449 |
-
sfsiplus_tw_consumer_secret:I,
|
| 450 |
-
sfsiplus_tw_oauth_access_token:m,
|
| 451 |
-
sfsiplus_tw_oauth_access_token_secret:F,
|
| 452 |
-
sfsi_plus_google_countsDisplay:h,
|
| 453 |
-
sfsi_plus_google_countsFrom:v,
|
| 454 |
-
sfsi_plus_google_manualCounts:g,
|
| 455 |
-
sfsi_plus_google_api_key:a,
|
| 456 |
-
sfsi_plus_linkedIn_countsDisplay:D,
|
| 457 |
-
sfsi_plus_linkedIn_countsFrom:k,
|
| 458 |
-
sfsi_plus_linkedIn_manualCounts:y,
|
| 459 |
-
sfsi_plus_ln_company:b,
|
| 460 |
-
sfsi_plus_ln_api_key:w,
|
| 461 |
-
sfsi_plus_ln_secret_key:x,
|
| 462 |
-
sfsi_plus_ln_oAuth_user_token:C,
|
| 463 |
-
sfsi_plus_youtube_countsDisplay:U,
|
| 464 |
-
sfsi_plus_youtube_countsFrom:O,
|
| 465 |
-
sfsi_plus_youtube_manualCounts:T,
|
| 466 |
-
sfsi_plus_youtube_user:j,
|
| 467 |
-
sfsi_plus_youtube_channelId: SFSI("input[name='sfsi_plus_youtube_channelId']").val(),
|
| 468 |
-
sfsi_plus_pinterest_countsDisplay:P,
|
| 469 |
-
sfsi_plus_pinterest_countsFrom:M,
|
| 470 |
-
sfsi_plus_pinterest_manualCounts:L,
|
| 471 |
-
sfsi_plus_pinterest_user:B,
|
| 472 |
-
sfsi_plus_pinterest_board:E,
|
| 473 |
-
sfsi_plus_instagram_countsDisplay:z,
|
| 474 |
-
sfsi_plus_instagram_countsFrom:A,
|
| 475 |
-
sfsi_plus_instagram_manualCounts:N,
|
| 476 |
-
sfsi_plus_instagram_User:H,
|
| 477 |
-
sfsi_plus_instagram_clientid:SFSI("input[name='sfsi_plus_instagram_clientid']").val(),
|
| 478 |
-
sfsi_plus_instagram_appurl:SFSI("input[name='sfsi_plus_instagram_appurl']").val(),
|
| 479 |
-
sfsi_plus_instagram_token:SFSI("input[name='sfsi_plus_instagram_token']").val(),
|
| 480 |
-
sfsi_plus_shares_countsDisplay:R,
|
| 481 |
-
sfsi_plus_shares_countsFrom:W,
|
| 482 |
-
sfsi_plus_shares_manualCounts:q,
|
| 483 |
-
sfsi_plus_houzz_countsDisplay:houzzDisplay,
|
| 484 |
-
sfsi_plus_houzz_countsFrom:houzzFrom,
|
| 485 |
-
sfsi_plus_houzz_manualCounts:houzzCount,
|
| 486 |
-
nonce:nonce
|
| 487 |
-
};
|
| 488 |
-
return SFSI.ajax({
|
| 489 |
-
url:ajax_object.ajax_url,
|
| 490 |
-
type:"post",
|
| 491 |
-
data:$,
|
| 492 |
-
dataType:"json",
|
| 493 |
-
async:!0,
|
| 494 |
-
success:function(s) {
|
| 495 |
-
if(s == "wrong_nonce")
|
| 496 |
-
{
|
| 497 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 4);
|
| 498 |
-
global_error = 1;
|
| 499 |
-
sfsiplus_afterLoad();
|
| 500 |
-
}
|
| 501 |
-
else
|
| 502 |
-
{
|
| 503 |
-
"success" == s.res ? (sfsiplus_showErrorSuc("success", "Saved !", 4), sfsipluscollapse("#sfsi_plus_save4"),
|
| 504 |
-
sfsi_plus_showPreviewCounts()) :(sfsiplus_showErrorSuc("error", "Unkown error , please try again", 4),
|
| 505 |
-
global_error = 1), sfsiplus_afterLoad();
|
| 506 |
-
}
|
| 507 |
-
}
|
| 508 |
-
}), s;
|
| 509 |
-
}
|
| 510 |
-
function sfsi_plus_update_step5()
|
| 511 |
-
{
|
| 512 |
-
var nonce = SFSI("#sfsi_plus_save5").attr("data-nonce");
|
| 513 |
-
sfsi_plus_update_step3();
|
| 514 |
-
var s = sfsi_plus_validationStep5();
|
| 515 |
-
if (!s) return global_error = 1, !1;
|
| 516 |
-
sfsiplus_beForeLoad();
|
| 517 |
-
var i = SFSI("input[name='sfsi_plus_icons_size']").val(), e = SFSI("input[name='sfsi_plus_icons_perRow']").val(), t = SFSI("input[name='sfsi_plus_icons_spacing']").val(), n = SFSI("#sfsi_plus_icons_Alignment").val(),
|
| 518 |
-
followicon = SFSI("#sfsi_plus_follow_icons_language").val(),
|
| 519 |
-
facebookicon = SFSI("#sfsi_plus_facebook_icons_language").val(),
|
| 520 |
-
twittericon = SFSI("#sfsi_plus_twitter_icons_language").val(),
|
| 521 |
-
googleicon = SFSI("#sfsi_plus_google_icons_language").val(),
|
| 522 |
-
lang = SFSI("#sfsi_plus_icons_language").val(), o = SFSI("input[name='sfsi_plus_icons_ClickPageOpen']:checked").val(), a = SFSI("input[name='sfsi_plus_icons_float']:checked").val(), dsb = SFSI("input[name='sfsi_plus_disable_floaticons']:checked").val(), dsbv = SFSI("input[name='sfsi_plus_disable_viewport']:checked").val(), r = SFSI("#sfsi_plus_icons_floatPosition").val(), c = SFSI("input[name='sfsi_plus_icons_stick']:checked").val(), p = SFSI("#sfsi_plus_rssIcon_order").attr("data-index"), _ = SFSI("#sfsi_plus_emailIcon_order").attr("data-index"), l = SFSI("#sfsi_plus_googleIcon_order").attr("data-index"), S = SFSI("#sfsi_plus_facebookIcon_order").attr("data-index"), u = SFSI("#sfsi_plus_twitterIcon_order").attr("data-index"), f = SFSI("#sfsi_plus_youtubeIcon_order").attr("data-index"), d = SFSI("#sfsi_plus_pinterestIcon_order").attr("data-index"), I = SFSI("#sfsi_plus_instagramIcon_order").attr("data-index"), m = SFSI("#sfsi_plus_shareIcon_order").attr("data-index"), F = SFSI("#sfsi_plus_linkedinIcon_order").attr("data-index"), houzzOrder = SFSI("#sfsi_plus_houzzIcon_order").attr("data-index"), h = new Array();
|
| 523 |
-
SFSI(".sfsiplus_custom_iconOrder").each(function()
|
| 524 |
-
{
|
| 525 |
-
h.push({
|
| 526 |
-
order:SFSI(this).attr("data-index"),
|
| 527 |
-
ele:SFSI(this).attr("element-id")
|
| 528 |
-
});
|
| 529 |
-
});
|
| 530 |
-
var v = 1 == SFSI("input[name='sfsi_plus_rss_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_MouseOverText']").val(), g = 1 == SFSI("input[name='sfsi_plus_email_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_MouseOverText']").val(), k = 1 == SFSI("input[name='sfsi_plus_twitter_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_MouseOverText']").val(), y = 1 == SFSI("input[name='sfsi_plus_facebook_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_MouseOverText']").val(), b = 1 == SFSI("input[name='sfsi_plus_google_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_MouseOverText']").val(), w = 1 == SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").val(), x = 1 == SFSI("input[name='sfsi_plus_youtube_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_MouseOverText']").val(), C = 1 == SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").val(), insD = 1 == SFSI("input[name='sfsi_plus_instagram_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_MouseOverText']").val(), D = 1 == SFSI("input[name='sfsi_plus_houzz_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_MouseOverText']").val(), U = 1 == SFSI("input[name='sfsi_plus_share_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_share_MouseOverText']").val(), O = {};
|
| 531 |
-
SFSI("input[name='sfsi_plus_custom_MouseOverTexts[]']").each(function() {
|
| 532 |
-
O[SFSI(this).attr("file-id")] = this.value;
|
| 533 |
-
});
|
| 534 |
-
var T = {
|
| 535 |
-
action:"plus_updateSrcn5",
|
| 536 |
-
sfsi_plus_icons_size:i,
|
| 537 |
-
sfsi_plus_icons_Alignment:n,
|
| 538 |
-
sfsi_plus_icons_perRow:e,
|
| 539 |
-
sfsi_plus_follow_icons_language:followicon,
|
| 540 |
-
sfsi_plus_facebook_icons_language:facebookicon,
|
| 541 |
-
sfsi_plus_twitter_icons_language:twittericon,
|
| 542 |
-
sfsi_plus_google_icons_language:googleicon,
|
| 543 |
-
sfsi_plus_icons_language:lang,
|
| 544 |
-
sfsi_plus_icons_spacing:t,
|
| 545 |
-
sfsi_plus_icons_ClickPageOpen:o,
|
| 546 |
-
sfsi_plus_icons_float:a,
|
| 547 |
-
sfsi_plus_disable_floaticons:dsb,
|
| 548 |
-
sfsi_plus_disable_viewport: dsbv,
|
| 549 |
-
sfsi_plus_icons_floatPosition:r,
|
| 550 |
-
sfsi_plus_icons_stick:c,
|
| 551 |
-
sfsi_plus_rss_MouseOverText:v,
|
| 552 |
-
sfsi_plus_email_MouseOverText:g,
|
| 553 |
-
sfsi_plus_twitter_MouseOverText:k,
|
| 554 |
-
sfsi_plus_facebook_MouseOverText:y,
|
| 555 |
-
sfsi_plus_google_MouseOverText:b,
|
| 556 |
-
sfsi_plus_youtube_MouseOverText:x,
|
| 557 |
-
sfsi_plus_linkedIn_MouseOverText:w,
|
| 558 |
-
sfsi_plus_pinterest_MouseOverText:C,
|
| 559 |
-
sfsi_plus_share_MouseOverText:U,
|
| 560 |
-
sfsi_plus_instagram_MouseOverText:insD,
|
| 561 |
-
sfsi_plus_houzz_MouseOverText:D,
|
| 562 |
-
sfsi_plus_custom_MouseOverTexts:O,
|
| 563 |
-
sfsi_plus_rssIcon_order:p,
|
| 564 |
-
sfsi_plus_emailIcon_order:_,
|
| 565 |
-
sfsi_plus_facebookIcon_order:S,
|
| 566 |
-
sfsi_plus_twitterIcon_order:u,
|
| 567 |
-
sfsi_plus_googleIcon_order:l,
|
| 568 |
-
sfsi_plus_youtubeIcon_order:f,
|
| 569 |
-
sfsi_plus_pinterestIcon_order:d,
|
| 570 |
-
sfsi_plus_shareIcon_order:m,
|
| 571 |
-
sfsi_plus_instagramIcon_order:I,
|
| 572 |
-
sfsi_plus_houzzIcon_order:houzzOrder,
|
| 573 |
-
sfsi_plus_linkedinIcon_order:F,
|
| 574 |
-
sfsi_plus_custom_orders:h,
|
| 575 |
-
nonce:nonce
|
| 576 |
-
};
|
| 577 |
-
SFSI.ajax({
|
| 578 |
-
url:ajax_object.ajax_url,
|
| 579 |
-
type:"post",
|
| 580 |
-
data:T,
|
| 581 |
-
dataType:"json",
|
| 582 |
-
async:!0,
|
| 583 |
-
success:function(s) {
|
| 584 |
-
if(s == "wrong_nonce")
|
| 585 |
-
{
|
| 586 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 5);
|
| 587 |
-
global_error = 1;
|
| 588 |
-
sfsiplus_afterLoad();
|
| 589 |
-
}
|
| 590 |
-
else
|
| 591 |
-
{
|
| 592 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 5), sfsipluscollapse("#sfsi_plus_save5")) :(global_error = 1,
|
| 593 |
-
sfsiplus_showErrorSuc("error", "Unkown error , please try again", 5)), sfsiplus_afterLoad();
|
| 594 |
-
}
|
| 595 |
-
}
|
| 596 |
-
});
|
| 597 |
-
}
|
| 598 |
-
function sfsi_plus_update_step6()
|
| 599 |
-
{
|
| 600 |
-
var nonce = SFSI("#sfsi_plus_save6").attr("data-nonce");
|
| 601 |
-
sfsiplus_beForeLoad();
|
| 602 |
-
var s = SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(), i = SFSI("input[name='sfsi_plus_textBefor_icons']").val(), e = SFSI("#sfsi_plus_icons_alignment").val(), t = SFSI("#sfsi_plus_icons_DisplayCounts").val(), n = {
|
| 603 |
-
action:"plus_updateSrcn6",
|
| 604 |
-
sfsi_plus_show_Onposts:s,
|
| 605 |
-
sfsi_plus_icons_DisplayCounts:t,
|
| 606 |
-
sfsi_plus_icons_alignment:e,
|
| 607 |
-
sfsi_plus_textBefor_icons:i,
|
| 608 |
-
nonce:nonce
|
| 609 |
-
};
|
| 610 |
-
SFSI.ajax({
|
| 611 |
-
url:ajax_object.ajax_url,
|
| 612 |
-
type:"post",
|
| 613 |
-
data:n,
|
| 614 |
-
dataType:"json",
|
| 615 |
-
async:!0,
|
| 616 |
-
success:function(s) {
|
| 617 |
-
if(s == "wrong_nonce")
|
| 618 |
-
{
|
| 619 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 6);
|
| 620 |
-
global_error = 1;
|
| 621 |
-
sfsiplus_afterLoad();
|
| 622 |
-
}
|
| 623 |
-
else
|
| 624 |
-
{
|
| 625 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 6), sfsipluscollapse("#sfsi_plus_save6")) :(global_error = 1,
|
| 626 |
-
sfsiplus_showErrorSuc("error", "Unkown error , please try again", 6)), sfsiplus_afterLoad();
|
| 627 |
-
}
|
| 628 |
-
}
|
| 629 |
-
});
|
| 630 |
-
}
|
| 631 |
-
function sfsi_plus_update_step7()
|
| 632 |
-
{
|
| 633 |
-
var nonce = SFSI("#sfsi_plus_save7").attr("data-nonce");
|
| 634 |
-
var s = sfsi_plus_validationStep7();
|
| 635 |
-
if (!s) return global_error = 1, !1;
|
| 636 |
-
sfsiplus_beForeLoad();
|
| 637 |
-
var i = SFSI("input[name='sfsi_plus_popup_text']").val(), e = SFSI("#sfsi_plus_popup_font option:selected").val(), t = (SFSI("#sfsi_plus_popup_fontStyle option:selected").val(),
|
| 638 |
-
SFSI("input[name='sfsi_plus_popup_fontColor']").val()), n = SFSI("input[name='sfsi_plus_popup_fontSize']").val(), o = SFSI("input[name='sfsi_plus_popup_background_color']").val(), a = SFSI("input[name='sfsi_plus_popup_border_color']").val(), r = SFSI("input[name='sfsi_plus_popup_border_thickness']").val(), c = SFSI("input[name='sfsi_plus_popup_border_shadow']:checked").val(), p = SFSI("input[name='sfsi_plus_Show_popupOn']:checked").val(), _ = [];
|
| 639 |
-
SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s, i) {
|
| 640 |
-
_[s] = SFSI(i).val();
|
| 641 |
-
});
|
| 642 |
-
var l = SFSI("input[name='sfsi_plus_Shown_pop']:checked").val(), S = SFSI("input[name='sfsi_plus_Shown_popupOnceTime']").val(), u = SFSI("#sfsi_plus_Shown_popuplimitPerUserTime").val(), f = {
|
| 643 |
-
action:"plus_updateSrcn7",
|
| 644 |
-
sfsi_plus_popup_text:i,
|
| 645 |
-
sfsi_plus_popup_font:e,
|
| 646 |
-
sfsi_plus_popup_fontColor:t,
|
| 647 |
-
sfsi_plus_popup_fontSize:n,
|
| 648 |
-
sfsi_plus_popup_background_color:o,
|
| 649 |
-
sfsi_plus_popup_border_color:a,
|
| 650 |
-
sfsi_plus_popup_border_thickness:r,
|
| 651 |
-
sfsi_plus_popup_border_shadow:c,
|
| 652 |
-
sfsi_plus_Show_popupOn:p,
|
| 653 |
-
sfsi_plus_Show_popupOn_PageIDs:_,
|
| 654 |
-
sfsi_plus_Shown_pop:l,
|
| 655 |
-
sfsi_plus_Shown_popupOnceTime:S,
|
| 656 |
-
sfsi_plus_Shown_popuplimitPerUserTime:u,
|
| 657 |
-
nonce:nonce
|
| 658 |
-
};
|
| 659 |
-
SFSI.ajax({
|
| 660 |
-
url:ajax_object.ajax_url,
|
| 661 |
-
type:"post",
|
| 662 |
-
data:f,
|
| 663 |
-
dataType:"json",
|
| 664 |
-
async:!0,
|
| 665 |
-
success:function(s) {
|
| 666 |
-
if(s == "wrong_nonce")
|
| 667 |
-
{
|
| 668 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
| 669 |
-
sfsiplus_afterLoad();
|
| 670 |
-
}
|
| 671 |
-
else
|
| 672 |
-
{
|
| 673 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 7), sfsipluscollapse("#sfsi_plus_save7")) :sfsiplus_showErrorSuc("error", "Unkown error , please try again", 7),
|
| 674 |
-
sfsiplus_afterLoad();
|
| 675 |
-
}
|
| 676 |
-
}
|
| 677 |
-
});
|
| 678 |
-
}
|
| 679 |
-
function sfsi_plus_update_step8()
|
| 680 |
-
{
|
| 681 |
-
var nonce = SFSI("#sfsi_plus_save8").attr("data-nonce");
|
| 682 |
-
var s = sfsi_plus_validationStep7();
|
| 683 |
-
s = true;
|
| 684 |
-
if (!s) return global_error = 1, !1;
|
| 685 |
-
sfsiplus_beForeLoad();
|
| 686 |
-
var i = SFSI("input[name='sfsi_plus_show_via_widget']:checked").val(),
|
| 687 |
-
e = SFSI("input[name='sfsi_plus_float_on_page']:checked").val(),
|
| 688 |
-
t = SFSI("input[name='sfsi_plus_float_page_position']:checked").val(),
|
| 689 |
-
n = SFSI("input[name='sfsi_plus_place_item_manually']:checked").val(),
|
| 690 |
-
o = SFSI("input[name='sfsi_plus_show_item_onposts']:checked").val(),
|
| 691 |
-
a = SFSI("input[name='sfsi_plus_display_button_type']:checked").val(),
|
| 692 |
-
r = SFSI("input[name='sfsi_plus_post_icons_size']").val(),
|
| 693 |
-
c = SFSI("input[name='sfsi_plus_post_icons_spacing']").val(),
|
| 694 |
-
p = SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(),
|
| 695 |
-
v = SFSI("input[name='sfsi_plus_textBefor_icons']").val(),
|
| 696 |
-
x = SFSI("#sfsi_plus_icons_alignment").val(),
|
| 697 |
-
z = SFSI("#sfsi_plus_icons_DisplayCounts").val(),
|
| 698 |
-
b = SFSI("input[name='sfsi_plus_display_before_posts']:checked").val(),
|
| 699 |
-
d = SFSI("input[name='sfsi_plus_display_after_posts']:checked").val(),
|
| 700 |
-
/*f = SFSI("input[name='sfsi_plus_display_on_postspage']:checked").val(),
|
| 701 |
-
g = SFSI("input[name='sfsi_plus_display_on_homepage']:checked").val(),*/
|
| 702 |
-
f = SFSI("input[name='sfsi_plus_display_before_blogposts']:checked").val(),
|
| 703 |
-
g = SFSI("input[name='sfsi_plus_display_after_blogposts']:checked").val(),
|
| 704 |
-
rsub = SFSI("input[name='sfsi_plus_rectsub']:checked").val(),
|
| 705 |
-
rfb = SFSI("input[name='sfsi_plus_rectfb']:checked").val(),
|
| 706 |
-
rgp = SFSI("input[name='sfsi_plus_rectgp']:checked").val(),
|
| 707 |
-
rshr = SFSI("input[name='sfsi_plus_rectshr']:checked").val(),
|
| 708 |
-
rtwr = SFSI("input[name='sfsi_plus_recttwtr']:checked").val(),
|
| 709 |
-
rpin = SFSI("input[name='sfsi_plus_rectpinit']:checked").val(),
|
| 710 |
-
rfbshare = SFSI("input[name='sfsi_plus_rectfbshare']:checked").val(),
|
| 711 |
-
_ = [];
|
| 712 |
-
/*SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s, i) {
|
| 713 |
-
_[s] = SFSI(i).val()
|
| 714 |
-
});*/
|
| 715 |
-
var mst = SFSI("input[name='sfsi_plus_icons_floatMargin_top']").val(), msb = SFSI("input[name='sfsi_plus_icons_floatMargin_bottom']").val(), msl = SFSI("input[name='sfsi_plus_icons_floatMargin_left']").val(), msr = SFSI("input[name='sfsi_plus_icons_floatMargin_right']").val();
|
| 716 |
-
|
| 717 |
-
var f = {
|
| 718 |
-
action: "plus_updateSrcn8",
|
| 719 |
-
sfsi_plus_show_via_widget: i,
|
| 720 |
-
sfsi_plus_float_on_page: e,
|
| 721 |
-
sfsi_plus_float_page_position: t,
|
| 722 |
-
sfsi_plus_icons_floatMargin_top:mst,
|
| 723 |
-
sfsi_plus_icons_floatMargin_bottom:msb,
|
| 724 |
-
sfsi_plus_icons_floatMargin_left:msl,
|
| 725 |
-
sfsi_plus_icons_floatMargin_right:msr,
|
| 726 |
-
sfsi_plus_place_item_manually: n,
|
| 727 |
-
sfsi_plus_show_item_onposts: o,
|
| 728 |
-
sfsi_plus_display_button_type: a,
|
| 729 |
-
sfsi_plus_post_icons_size: r,
|
| 730 |
-
sfsi_plus_post_icons_spacing: c,
|
| 731 |
-
sfsi_plus_show_Onposts: p,
|
| 732 |
-
sfsi_plus_textBefor_icons: v,
|
| 733 |
-
sfsi_plus_icons_alignment: x,
|
| 734 |
-
sfsi_plus_icons_DisplayCounts: z,
|
| 735 |
-
sfsi_plus_display_before_posts: b,
|
| 736 |
-
sfsi_plus_display_after_posts: d,
|
| 737 |
-
/*sfsi_plus_display_on_postspage: f,
|
| 738 |
-
sfsi_plus_display_on_homepage: g*/
|
| 739 |
-
sfsi_plus_display_before_blogposts: f,
|
| 740 |
-
sfsi_plus_display_after_blogposts: g,
|
| 741 |
-
sfsi_plus_rectsub: rsub,
|
| 742 |
-
sfsi_plus_rectfb: rfb,
|
| 743 |
-
sfsi_plus_rectgp: rgp,
|
| 744 |
-
sfsi_plus_rectshr: rshr,
|
| 745 |
-
sfsi_plus_recttwtr: rtwr,
|
| 746 |
-
sfsi_plus_rectpinit: rpin,
|
| 747 |
-
sfsi_plus_rectfbshare: rfbshare,
|
| 748 |
-
nonce:nonce
|
| 749 |
-
};
|
| 750 |
-
SFSI.ajax({
|
| 751 |
-
url: ajax_object.ajax_url,
|
| 752 |
-
type: "post",
|
| 753 |
-
data: f,
|
| 754 |
-
dataType: "json",
|
| 755 |
-
async: !0,
|
| 756 |
-
success: function(s) {
|
| 757 |
-
if(s == "wrong_nonce")
|
| 758 |
-
{
|
| 759 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 8);
|
| 760 |
-
sfsiplus_afterLoad();
|
| 761 |
-
}
|
| 762 |
-
else
|
| 763 |
-
{
|
| 764 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 8), sfsipluscollapse("#sfsi_plus_save8")) : sfsiplus_showErrorSuc("error", "Unkown error , please try again", 8), sfsiplus_afterLoad()
|
| 765 |
-
}
|
| 766 |
-
}
|
| 767 |
-
})
|
| 768 |
-
}
|
| 769 |
-
function sfsi_plus_update_step9()
|
| 770 |
-
{
|
| 771 |
-
var nonce = SFSI("#sfsi_plus_save9").attr("data-nonce");
|
| 772 |
-
sfsiplus_beForeLoad();
|
| 773 |
-
var ie = SFSI("input[name='sfsi_plus_form_adjustment']:checked").val(),
|
| 774 |
-
je = SFSI("input[name='sfsi_plus_form_height']").val(),
|
| 775 |
-
ke = SFSI("input[name='sfsi_plus_form_width']").val(),
|
| 776 |
-
le = SFSI("input[name='sfsi_plus_form_border']:checked").val(),
|
| 777 |
-
me = SFSI("input[name='sfsi_plus_form_border_thickness']").val(),
|
| 778 |
-
ne = SFSI("input[name='sfsi_plus_form_border_color']").val(),
|
| 779 |
-
oe = SFSI("input[name='sfsi_plus_form_background']").val(),
|
| 780 |
-
|
| 781 |
-
ae = SFSI("input[name='sfsi_plus_form_heading_text']").val(),
|
| 782 |
-
be = SFSI("#sfsi_plus_form_heading_font option:selected").val(),
|
| 783 |
-
ce = SFSI("#sfsi_plus_form_heading_fontstyle option:selected").val(),
|
| 784 |
-
de = SFSI("input[name='sfsi_plus_form_heading_fontcolor']").val(),
|
| 785 |
-
ee = SFSI("input[name='sfsi_plus_form_heading_fontsize']").val(),
|
| 786 |
-
fe = SFSI("#sfsi_plus_form_heading_fontalign option:selected").val(),
|
| 787 |
-
|
| 788 |
-
ue = SFSI("input[name='sfsi_plus_form_field_text']").val(),
|
| 789 |
-
ve = SFSI("#sfsi_plus_form_field_font option:selected").val(),
|
| 790 |
-
we = SFSI("#sfsi_plus_form_field_fontstyle option:selected").val(),
|
| 791 |
-
xe = SFSI("input[name='sfsi_plus_form_field_fontcolor']").val(),
|
| 792 |
-
ye = SFSI("input[name='sfsi_plus_form_field_fontsize']").val(),
|
| 793 |
-
ze = SFSI("#sfsi_plus_form_field_fontalign option:selected").val(),
|
| 794 |
-
|
| 795 |
-
i = SFSI("input[name='sfsi_plus_form_button_text']").val(),
|
| 796 |
-
j = SFSI("#sfsi_plus_form_button_font option:selected").val(),
|
| 797 |
-
k = SFSI("#sfsi_plus_form_button_fontstyle option:selected").val(),
|
| 798 |
-
l = SFSI("input[name='sfsi_plus_form_button_fontcolor']").val(),
|
| 799 |
-
m = SFSI("input[name='sfsi_plus_form_button_fontsize']").val(),
|
| 800 |
-
n = SFSI("#sfsi_plus_form_button_fontalign option:selected").val(),
|
| 801 |
-
o = SFSI("input[name='sfsi_plus_form_button_background']").val();
|
| 802 |
-
|
| 803 |
-
var f = {
|
| 804 |
-
action:"plus_updateSrcn9",
|
| 805 |
-
sfsi_plus_form_adjustment:ie,
|
| 806 |
-
sfsi_plus_form_height:je,
|
| 807 |
-
sfsi_plus_form_width:ke,
|
| 808 |
-
sfsi_plus_form_border:le,
|
| 809 |
-
sfsi_plus_form_border_thickness:me,
|
| 810 |
-
sfsi_plus_form_border_color: ne,
|
| 811 |
-
sfsi_plus_form_background: oe,
|
| 812 |
-
|
| 813 |
-
sfsi_plus_form_heading_text:ae,
|
| 814 |
-
sfsi_plus_form_heading_font:be,
|
| 815 |
-
sfsi_plus_form_heading_fontstyle:ce,
|
| 816 |
-
sfsi_plus_form_heading_fontcolor:de,
|
| 817 |
-
sfsi_plus_form_heading_fontsize:ee,
|
| 818 |
-
sfsi_plus_form_heading_fontalign:fe,
|
| 819 |
-
|
| 820 |
-
sfsi_plus_form_field_text:ue,
|
| 821 |
-
sfsi_plus_form_field_font:ve,
|
| 822 |
-
sfsi_plus_form_field_fontstyle:we,
|
| 823 |
-
sfsi_plus_form_field_fontcolor:xe,
|
| 824 |
-
sfsi_plus_form_field_fontsize:ye,
|
| 825 |
-
sfsi_plus_form_field_fontalign:ze,
|
| 826 |
-
|
| 827 |
-
sfsi_plus_form_button_text:i,
|
| 828 |
-
sfsi_plus_form_button_font:j,
|
| 829 |
-
sfsi_plus_form_button_fontstyle:k,
|
| 830 |
-
sfsi_plus_form_button_fontcolor:l,
|
| 831 |
-
sfsi_plus_form_button_fontsize:m,
|
| 832 |
-
sfsi_plus_form_button_fontalign:n,
|
| 833 |
-
sfsi_plus_form_button_background:o,
|
| 834 |
-
|
| 835 |
-
nonce:nonce
|
| 836 |
-
};
|
| 837 |
-
SFSI.ajax({
|
| 838 |
-
url:ajax_object.ajax_url,
|
| 839 |
-
type:"post",
|
| 840 |
-
data:f,
|
| 841 |
-
dataType:"json",
|
| 842 |
-
async:!0,
|
| 843 |
-
success:function(s) {
|
| 844 |
-
if(s == "wrong_nonce")
|
| 845 |
-
{
|
| 846 |
-
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 9);
|
| 847 |
-
sfsiplus_afterLoad();
|
| 848 |
-
}
|
| 849 |
-
else
|
| 850 |
-
{
|
| 851 |
-
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 9), sfsipluscollapse("#sfsi_plus_save9"), sfsi_plus_create_suscriber_form()) :sfsiplus_showErrorSuc("error", "Unkown error , please try again", 9),
|
| 852 |
-
sfsiplus_afterLoad();
|
| 853 |
-
}
|
| 854 |
-
}
|
| 855 |
-
});
|
| 856 |
-
}
|
| 857 |
-
function sfsiplus_afterIconSuccess(s)
|
| 858 |
-
{
|
| 859 |
-
if (s.res = "success") {
|
| 860 |
-
var i = s.key + 1, e = s.element, t = e + 1;
|
| 861 |
-
SFSI("#plus_total_cusotm_icons").val(s.element);
|
| 862 |
-
SFSI(".upload-overlay").hide("slow");
|
| 863 |
-
SFSI(".uperror").html("");
|
| 864 |
-
sfsiplus_showErrorSuc("success", "Custom Icon updated successfully", 1);
|
| 865 |
-
d = new Date();
|
| 866 |
-
|
| 867 |
-
SFSI("li.plus_custom:last-child").removeClass("bdr_btm_non");
|
| 868 |
-
SFSI("li.plus_custom:last-child").children("span.plus_custom-img").children("img").attr("src", s.img_path+ "?" + d.getTime());
|
| 869 |
-
SFSI("input[name=plussfsiICON_" + s.key + "]").removeAttr("ele-type");
|
| 870 |
-
SFSI("input[name=plussfsiICON_" + s.key + "]").removeAttr("isnew");
|
| 871 |
-
icons_name = SFSI("li.plus_custom:last-child").find("input.styled").attr("name");
|
| 872 |
-
var n = icons_name.split("_");
|
| 873 |
-
s.key = s.key, s.img_path += "?" + d.getTime(), 5 > e && SFSI(".plus_icn_listing").append('<li id="plus_c' + i + '" class="plus_custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="plussfsiICON_' + i + '" type="checkbox" value="yes" class="styled" style="display:none;" element-type="sfsiplus-cusotm-icon" isNew="yes" /></div> <span class="plus_custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="plus_CImg_' + i + '" /> </span> <span class="custom sfsiplus_custom-txt">Custom' + t + ' </span> <div class="sfsiplus_right_info"> <p><span>'+object_name1.It_depends+':</span> '+object_name1.Upload_a+'</p><div class="inputWrapper"></div></li>'),
|
| 874 |
-
SFSI(".sfsiplus_custom_section").show(), SFSI(".plus_custom-links").append(' <div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url sfsiplus_custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_plus_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');
|
| 875 |
-
var o = SFSI("div.plus_custom_m").find("div.mouseover_field").length;
|
| 876 |
-
SFSI("div.plus_custom_m").append(0 == o % 2 ? '<div class="clear"> </div> <div class="mouseover_field sfsiplus_custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>' :'<div class="cHover " ><div class="mouseover_field sfsiplus_custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>'),
|
| 877 |
-
SFSI("ul.plus_share_icon_order").append('<li class="sfsiplus_custom_iconOrder sfsiICON_' + s.key + '" data-index="" element-id="' + s.key + '" id=""><a href="#" title="Custom Icon" ><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/></a></li>'),
|
| 878 |
-
SFSI("ul.plus_sfsi_sample_icons").append('<li class="sfsiICON_' + s.key + '" element-id="' + s.key + '" ><div><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),
|
| 879 |
-
sfsi_plus_update_index(), plus_update_Sec5Iconorder(), sfsi_plus_update_step1(), sfsi_plus_update_step2(),
|
| 880 |
-
sfsi_plus_update_step5(), SFSI(".upload-overlay").css("pointer-events", "auto"), sfsi_plus_showPreviewCounts(),
|
| 881 |
-
sfsiplus_afterLoad();
|
| 882 |
-
}
|
| 883 |
-
}
|
| 884 |
-
function sfsiplus_beforeIconSubmit(s)
|
| 885 |
-
{
|
| 886 |
-
if (SFSI(".uperror").html("Uploading....."), window.File && window.FileReader && window.FileList && window.Blob) {
|
| 887 |
-
SFSI(s).val() || SFSI(".uperror").html("File is empty");
|
| 888 |
-
var i = s.files[0].size, e = s.files[0].type;
|
| 889 |
-
switch (e) {
|
| 890 |
-
case "image/png":
|
| 891 |
-
case "image/gif":
|
| 892 |
-
case "image/jpeg":
|
| 893 |
-
case "image/pjpeg":
|
| 894 |
-
break;
|
| 895 |
-
|
| 896 |
-
default:
|
| 897 |
-
return SFSI(".uperror").html("Unsupported file"), !1;
|
| 898 |
-
}
|
| 899 |
-
return i > 1048576 ? (SFSI(".uperror").html("Image should be less than 1 MB"), !1) :!0;
|
| 900 |
-
}
|
| 901 |
-
return !0;
|
| 902 |
-
}
|
| 903 |
-
function sfsiplus_bytesToSize(s)
|
| 904 |
-
{
|
| 905 |
-
var i = [ "Bytes", "KB", "MB", "GB", "TB" ];
|
| 906 |
-
if (0 == s) return "0 Bytes";
|
| 907 |
-
var e = parseInt(Math.floor(Math.log(s) / Math.log(1024)));
|
| 908 |
-
return Math.round(s / Math.pow(1024, e), 2) + " " + i[e];
|
| 909 |
-
}
|
| 910 |
-
function sfsiplus_showErrorSuc(s, i, e)
|
| 911 |
-
{
|
| 912 |
-
if ("error" == s) var t = "errorMsg"; else var t = "sucMsg";
|
| 913 |
-
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
| 914 |
-
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function() {
|
| 915 |
-
SFSI("." + t).slideUp("slow");
|
| 916 |
-
}, 5e3), !1;
|
| 917 |
-
}
|
| 918 |
-
function sfsiplus_beForeLoad()
|
| 919 |
-
{
|
| 920 |
-
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events","none");
|
| 921 |
-
}
|
| 922 |
-
function sfsiplus_afterLoad()
|
| 923 |
-
{
|
| 924 |
-
SFSI("input").removeClass("inputError"), SFSI(".save_button >a").html(object_name.Sa_ve),
|
| 925 |
-
SFSI(".tab10>div.save_button >a").html(object_name1.Save_All_Settings),
|
| 926 |
-
SFSI(".save_button >a").css("pointer-events", "auto"), SFSI(".save_button >a").removeAttr("onclick"),
|
| 927 |
-
SFSI(".loader-img").hide();
|
| 928 |
-
}
|
| 929 |
-
function sfsi_plus_make_popBox()
|
| 930 |
-
{
|
| 931 |
-
var s = 0;
|
| 932 |
-
SFSI(".plus_sfsi_sample_icons >li").each(function() {
|
| 933 |
-
"none" != SFSI(this).css("display") && (s = 1);
|
| 934 |
-
}), 0 == s ? SFSI(".sfsi_plus_Popinner").hide() :SFSI(".sfsi_plus_Popinner").show(), "" != SFSI('input[name="sfsi_plus_popup_text"]').val() ? (SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),
|
| 935 |
-
SFSI(".sfsi_plus_Popinner >h2").show()) :SFSI(".sfsi_plus_Popinner >h2").hide(), SFSI(".sfsi_plus_Popinner").css({
|
| 936 |
-
"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),
|
| 937 |
-
"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),
|
| 938 |
-
"border-style":"solid"
|
| 939 |
-
}), SFSI(".sfsi_plus_Popinner").css("background-color", SFSI('input[name="sfsi_plus_popup_background_color"]').val()),
|
| 940 |
-
SFSI(".sfsi_plus_Popinner h2").css("font-family", SFSI("#sfsi_plus_popup_font").val()), SFSI(".sfsi_plus_Popinner h2").css("font-style", SFSI("#sfsi_plus_popup_fontStyle").val()),
|
| 941 |
-
SFSI(".sfsi_plus_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),
|
| 942 |
-
SFSI(".sfsi_plus_Popinner >h2").css("color", SFSI('input[name="sfsi_plus_popup_fontColor"]').val() + " !important"),
|
| 943 |
-
"yes" == SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_plus_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") :SFSI(".sfsi_plus_Popinner").css("box-shadow", "none");
|
| 944 |
-
}
|
| 945 |
-
function sfsi_plus_stick_widget(s)
|
| 946 |
-
{
|
| 947 |
-
0 == sfsiplus_initTop.length && (SFSI(".sfsi_plus_widget").each(function(s) {
|
| 948 |
-
sfsiplus_initTop[s] = SFSI(this).position().top;
|
| 949 |
-
}), console.log(sfsiplus_initTop));
|
| 950 |
-
var i = SFSI(window).scrollTop(), e = [], t = [];
|
| 951 |
-
SFSI(".sfsi_plus_widget").each(function(s) {
|
| 952 |
-
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
| 953 |
-
});
|
| 954 |
-
var n = !1;
|
| 955 |
-
for (var o in e) {
|
| 956 |
-
var a = parseInt(o) + 1;
|
| 957 |
-
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
| 958 |
-
position:"fixed",
|
| 959 |
-
top:s
|
| 960 |
-
}), SFSI(t[a]).css({
|
| 961 |
-
position:"",
|
| 962 |
-
top:sfsiplus_initTop[a]
|
| 963 |
-
}), n = !0) :SFSI(t[o]).css({
|
| 964 |
-
position:"",
|
| 965 |
-
top:sfsiplus_initTop[o]
|
| 966 |
-
});
|
| 967 |
-
}
|
| 968 |
-
if (!n) {
|
| 969 |
-
var r = e.length - 1, c = -1;
|
| 970 |
-
e.length > 1 && (c = e.length - 2), sfsiplus_initTop[r] < i ? (SFSI(t[r]).css({
|
| 971 |
-
position:"fixed",
|
| 972 |
-
top:s
|
| 973 |
-
}), c >= 0 && SFSI(t[c]).css({
|
| 974 |
-
position:"",
|
| 975 |
-
top:sfsiplus_initTop[c]
|
| 976 |
-
})) :(SFSI(t[r]).css({
|
| 977 |
-
position:"",
|
| 978 |
-
top:sfsiplus_initTop[r]
|
| 979 |
-
}), c >= 0 && e[c] < i);
|
| 980 |
-
}
|
| 981 |
-
}
|
| 982 |
-
function sfsi_plus_setCookie(s, i, e)
|
| 983 |
-
{
|
| 984 |
-
var t = new Date();
|
| 985 |
-
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
| 986 |
-
var n = "expires=" + t.toGMTString();
|
| 987 |
-
document.cookie = s + "=" + i + "; " + n;
|
| 988 |
-
}
|
| 989 |
-
function sfsfi_plus_getCookie(s)
|
| 990 |
-
{
|
| 991 |
-
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
| 992 |
-
var n = e[t].trim();
|
| 993 |
-
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
| 994 |
-
}
|
| 995 |
-
return "";
|
| 996 |
-
}
|
| 997 |
-
function sfsi_plus_hideFooter() {}
|
| 998 |
-
|
| 999 |
-
window.onerror = function() {}, SFSI = jQuery.noConflict(), SFSI(window).load(function() {
|
| 1000 |
-
SFSI("#sfpluspageLoad").fadeOut(2e3);
|
| 1001 |
-
});
|
| 1002 |
-
|
| 1003 |
-
//changes done {Monad}
|
| 1004 |
-
function sfsi_plus_selectText(containerid) {
|
| 1005 |
-
if (document.selection) {
|
| 1006 |
-
var range = document.body.createTextRange();
|
| 1007 |
-
range.moveToElementText(document.getElementById(containerid));
|
| 1008 |
-
range.select();
|
| 1009 |
-
} else if (window.getSelection()) {
|
| 1010 |
-
var range = document.createRange();
|
| 1011 |
-
range.selectNode(document.getElementById(containerid));
|
| 1012 |
-
window.getSelection().removeAllRanges();
|
| 1013 |
-
window.getSelection().addRange(range);
|
| 1014 |
-
}
|
| 1015 |
-
}
|
| 1016 |
-
function sfsi_plus_create_suscriber_form()
|
| 1017 |
-
{
|
| 1018 |
-
//Popbox customization
|
| 1019 |
-
"no" == SFSI('input[name="sfsi_plus_form_adjustment"]:checked').val() ? SFSI(".sfsi_plus_subscribe_Popinner").css({"width": parseInt(SFSI('input[name="sfsi_plus_form_width"]').val()),"height":parseInt(SFSI('input[name="sfsi_plus_form_height"]').val())}) : SFSI(".sfsi_plus_subscribe_Popinner").css({"width": '',"height": ''});
|
| 1020 |
-
|
| 1021 |
-
"yes" == SFSI('input[name="sfsi_plus_form_adjustment"]:checked').val() ? SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").css({"width": "100%"}): '';
|
| 1022 |
-
|
| 1023 |
-
"yes" == SFSI('input[name="sfsi_plus_form_border"]:checked').val() ? SFSI(".sfsi_plus_subscribe_Popinner").css({"border": SFSI('input[name="sfsi_plus_form_border_thickness"]').val()+"px solid "+SFSI('input[name="sfsi_plus_form_border_color"]').val()}) : SFSI(".sfsi_plus_subscribe_Popinner").css("border", "none");
|
| 1024 |
-
|
| 1025 |
-
SFSI('input[name="sfsi_plus_form_background"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").css("background-color", SFSI('input[name="sfsi_plus_form_background"]').val())) : '';
|
| 1026 |
-
|
| 1027 |
-
//Heading customization
|
| 1028 |
-
SFSI('input[name="sfsi_plus_form_heading_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").html(SFSI('input[name="sfsi_plus_form_heading_text"]').val())) : SFSI(".sfsi_plus_subscribe_Popinner > form > h5").html('');
|
| 1029 |
-
|
| 1030 |
-
SFSI('#sfsi_plus_form_heading_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-family", SFSI("#sfsi_plus_form_heading_font").val())) : '';
|
| 1031 |
-
|
| 1032 |
-
if(SFSI('#sfsi_plus_form_heading_fontstyle').val() != 'bold')
|
| 1033 |
-
{
|
| 1034 |
-
SFSI('#sfsi_plus_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-style", SFSI("#sfsi_plus_form_heading_fontstyle").val())) : '';
|
| 1035 |
-
SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-weight", '');
|
| 1036 |
-
}
|
| 1037 |
-
else
|
| 1038 |
-
{
|
| 1039 |
-
SFSI('#sfsi_plus_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-weight","bold")) : '';
|
| 1040 |
-
SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-style", '');
|
| 1041 |
-
}
|
| 1042 |
-
|
| 1043 |
-
SFSI('input[name="sfsi_plus_form_heading_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("color", SFSI('input[name="sfsi_plus_form_heading_fontcolor"]').val())) : '';
|
| 1044 |
-
|
| 1045 |
-
SFSI('input[name="sfsi_plus_form_heading_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_heading_fontsize"]').val())})) : '';
|
| 1046 |
-
|
| 1047 |
-
SFSI('#sfsi_plus_form_heading_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("text-align", SFSI("#sfsi_plus_form_heading_fontalign").val())) : '';
|
| 1048 |
-
|
| 1049 |
-
//Field customization
|
| 1050 |
-
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", '');
|
| 1051 |
-
|
| 1052 |
-
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".sfsi_plus_left_container > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".sfsi_plus_left_container > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
| 1053 |
-
|
| 1054 |
-
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".like_pop_box > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".like_pop_box > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
| 1055 |
-
|
| 1056 |
-
SFSI('#sfsi_plus_form_field_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-family", SFSI("#sfsi_plus_form_field_font").val())) : '';
|
| 1057 |
-
|
| 1058 |
-
if(SFSI('#sfsi_plus_form_field_fontstyle').val() != "bold")
|
| 1059 |
-
{
|
| 1060 |
-
SFSI('#sfsi_plus_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", SFSI("#sfsi_plus_form_field_fontstyle").val())) : '';
|
| 1061 |
-
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", '');
|
| 1062 |
-
}
|
| 1063 |
-
else
|
| 1064 |
-
{
|
| 1065 |
-
SFSI('#sfsi_plus_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", 'bold')) : '';
|
| 1066 |
-
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", '');
|
| 1067 |
-
}
|
| 1068 |
-
|
| 1069 |
-
SFSI('input[name="sfsi_plus_form_field_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("color", SFSI('input[name="sfsi_plus_form_field_fontcolor"]').val())) : '';
|
| 1070 |
-
|
| 1071 |
-
SFSI('input[name="sfsi_plus_form_field_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_field_fontsize"]').val())})) : '';
|
| 1072 |
-
|
| 1073 |
-
SFSI('#sfsi_plus_form_field_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("text-align", SFSI("#sfsi_plus_form_field_fontalign").val())) : '';
|
| 1074 |
-
|
| 1075 |
-
//Button customization
|
| 1076 |
-
SFSI('input[name="sfsi_plus_form_button_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').attr("value", SFSI('input[name="sfsi_plus_form_button_text"]').val())) : '';
|
| 1077 |
-
|
| 1078 |
-
SFSI('#sfsi_plus_form_button_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-family", SFSI("#sfsi_plus_form_button_font").val())) : '';
|
| 1079 |
-
|
| 1080 |
-
if(SFSI('#sfsi_plus_form_button_fontstyle').val() != "bold")
|
| 1081 |
-
{
|
| 1082 |
-
SFSI('#sfsi_plus_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", SFSI("#sfsi_plus_form_button_fontstyle").val())) : '';
|
| 1083 |
-
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", '');
|
| 1084 |
-
}
|
| 1085 |
-
else
|
| 1086 |
-
{
|
| 1087 |
-
SFSI('#sfsi_plus_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", 'bold')) : '';
|
| 1088 |
-
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", '');
|
| 1089 |
-
}
|
| 1090 |
-
|
| 1091 |
-
SFSI('input[name="sfsi_plus_form_button_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("color", SFSI('input[name="sfsi_plus_form_button_fontcolor"]').val())) : '';
|
| 1092 |
-
|
| 1093 |
-
SFSI('input[name="sfsi_plus_form_button_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_button_fontsize"]').val())})) : '';
|
| 1094 |
-
|
| 1095 |
-
SFSI('#sfsi_plus_form_button_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("text-align", SFSI("#sfsi_plus_form_button_fontalign").val())) : '';
|
| 1096 |
-
|
| 1097 |
-
SFSI('input[name="sfsi_plus_form_button_background"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("background-color", SFSI('input[name="sfsi_plus_form_button_background"]').val())) : '';
|
| 1098 |
-
|
| 1099 |
-
var innerHTML = SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").html();
|
| 1100 |
-
var styleCss = SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").attr("style");
|
| 1101 |
-
innerHTML = '<div style="'+styleCss+'">'+innerHTML+'</div>';
|
| 1102 |
-
SFSI(".sfsi_plus_subscription_html > xmp").html(innerHTML);
|
| 1103 |
-
|
| 1104 |
-
/*var data = {
|
| 1105 |
-
action:"getForm",
|
| 1106 |
-
heading: SFSI('input[name="sfsi_plus_form_heading_text"]').val(),
|
| 1107 |
-
placeholder:SFSI('input[name="sfsi_plus_form_field_text"]').val(),
|
| 1108 |
-
button:SFSI('input[name="sfsi_plus_form_button_text"]').val()
|
| 1109 |
-
};
|
| 1110 |
-
SFSI.ajax({
|
| 1111 |
-
url:ajax_object.ajax_url,
|
| 1112 |
-
type:"post",
|
| 1113 |
-
data:data,
|
| 1114 |
-
success:function(s) {
|
| 1115 |
-
SFSI(".sfsi_plus_subscription_html").html(s);
|
| 1116 |
-
}
|
| 1117 |
-
});*/
|
| 1118 |
-
}
|
| 1119 |
-
|
| 1120 |
-
var global_error = 0;
|
| 1121 |
-
SFSI(document).ready(function(s) {
|
| 1122 |
-
//changes done {Monad}
|
| 1123 |
-
|
| 1124 |
-
SFSI(".lanOnchange").change(function(){
|
| 1125 |
-
var currentDrpdown = SFSI(this).parents(".icons_size");
|
| 1126 |
-
var data = {
|
| 1127 |
-
action:"getIconPreview",
|
| 1128 |
-
iconValue: SFSI(this).val(),
|
| 1129 |
-
iconname: SFSI(this).attr( "data-iconUrl" )
|
| 1130 |
-
};
|
| 1131 |
-
SFSI.ajax({
|
| 1132 |
-
url:ajax_object.ajax_url,
|
| 1133 |
-
type:"post",
|
| 1134 |
-
data:data,
|
| 1135 |
-
success:function(s) {
|
| 1136 |
-
currentDrpdown.children(".social-img-link").html(s);
|
| 1137 |
-
}
|
| 1138 |
-
});
|
| 1139 |
-
});
|
| 1140 |
-
|
| 1141 |
-
SFSI(".sfsiplus_tab_3_icns").on("click", ".cstomskins_upload", function() {
|
| 1142 |
-
SFSI(".cstmskins-overlay").show("slow", function() {
|
| 1143 |
-
e = 0;
|
| 1144 |
-
});
|
| 1145 |
-
});
|
| 1146 |
-
/*SFSI("#custmskin_clspop").live("click", function() {*/
|
| 1147 |
-
SFSI(document).on("click", '#custmskin_clspop', function () {
|
| 1148 |
-
SFSI_plus_done();
|
| 1149 |
-
SFSI(".cstmskins-overlay").hide("slow");
|
| 1150 |
-
});
|
| 1151 |
-
|
| 1152 |
-
sfsi_plus_create_suscriber_form();
|
| 1153 |
-
|
| 1154 |
-
SFSI('input[name="sfsi_plus_form_heading_text"], input[name="sfsi_plus_form_border_thickness"], input[name="sfsi_plus_form_height"], input[name="sfsi_plus_form_width"], input[name="sfsi_plus_form_heading_fontsize"], input[name="sfsi_plus_form_field_text"], input[name="sfsi_plus_form_field_fontsize"], input[name="sfsi_plus_form_button_text"], input[name="sfsi_plus_form_button_fontsize"]').on("keyup", sfsi_plus_create_suscriber_form);
|
| 1155 |
-
|
| 1156 |
-
SFSI('input[name="sfsi_plus_form_border_color"], input[name="sfsi_plus_form_background"] ,input[name="sfsi_plus_form_heading_fontcolor"], input[name="sfsi_plus_form_field_fontcolor"] ,input[name="sfsi_plus_form_button_fontcolor"],input[name="sfsi_plus_form_button_background"]').on("focus", sfsi_plus_create_suscriber_form);
|
| 1157 |
-
|
| 1158 |
-
SFSI("#sfsi_plus_form_heading_font, #sfsi_plus_form_heading_fontstyle, #sfsi_plus_form_heading_fontalign, #sfsi_plus_form_field_font, #sfsi_plus_form_field_fontstyle, #sfsi_plus_form_field_fontalign, #sfsi_plus_form_button_font, #sfsi_plus_form_button_fontstyle, #sfsi_plus_form_button_fontalign").on("change", sfsi_plus_create_suscriber_form );
|
| 1159 |
-
|
| 1160 |
-
/*SFSI(".radio").live("click", function() {*/
|
| 1161 |
-
SFSI(document).on("click", '.radio', function () {
|
| 1162 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1163 |
-
switch(s.attr("name")) {
|
| 1164 |
-
case 'sfsi_plus_form_adjustment':
|
| 1165 |
-
if(s.val() == 'no')
|
| 1166 |
-
s.parents(".row_tab").next(".row_tab").show("fast");
|
| 1167 |
-
else
|
| 1168 |
-
s.parents(".row_tab").next(".row_tab").hide("fast");
|
| 1169 |
-
sfsi_plus_create_suscriber_form()
|
| 1170 |
-
break;
|
| 1171 |
-
case 'sfsi_plus_form_border':
|
| 1172 |
-
if(s.val() == 'yes')
|
| 1173 |
-
s.parents(".row_tab").next(".row_tab").show("fast");
|
| 1174 |
-
else
|
| 1175 |
-
s.parents(".row_tab").next(".row_tab").hide("fast");
|
| 1176 |
-
sfsi_plus_create_suscriber_form()
|
| 1177 |
-
break;
|
| 1178 |
-
default:
|
| 1179 |
-
}
|
| 1180 |
-
});
|
| 1181 |
-
|
| 1182 |
-
//pooja 28-12-2015
|
| 1183 |
-
SFSI('#sfsi_plus_form_border_color').wpColorPicker({
|
| 1184 |
-
defaultColor: false,
|
| 1185 |
-
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1186 |
-
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1187 |
-
hide: true,
|
| 1188 |
-
palettes: true
|
| 1189 |
-
}),
|
| 1190 |
-
SFSI('#sfsi_plus_form_background').wpColorPicker({
|
| 1191 |
-
defaultColor: false,
|
| 1192 |
-
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1193 |
-
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1194 |
-
hide: true,
|
| 1195 |
-
palettes: true
|
| 1196 |
-
}),
|
| 1197 |
-
SFSI('#sfsi_plus_form_heading_fontcolor').wpColorPicker({
|
| 1198 |
-
defaultColor: false,
|
| 1199 |
-
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1200 |
-
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1201 |
-
hide: true,
|
| 1202 |
-
palettes: true
|
| 1203 |
-
}),
|
| 1204 |
-
SFSI('#sfsi_plus_form_button_fontcolor').wpColorPicker({
|
| 1205 |
-
defaultColor: false,
|
| 1206 |
-
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1207 |
-
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1208 |
-
hide: true,
|
| 1209 |
-
palettes: true
|
| 1210 |
-
}),
|
| 1211 |
-
SFSI('#sfsi_plus_form_button_background').wpColorPicker({
|
| 1212 |
-
defaultColor: false,
|
| 1213 |
-
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1214 |
-
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1215 |
-
hide: true,
|
| 1216 |
-
palettes: true
|
| 1217 |
-
});
|
| 1218 |
-
/*SFSI("#sfsiPlusFormBorderColor").ColorPicker({
|
| 1219 |
-
color:"#f80000",
|
| 1220 |
-
onBeforeShow:function() {
|
| 1221 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_border_color").val());
|
| 1222 |
-
},
|
| 1223 |
-
onShow:function(s) {
|
| 1224 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1225 |
-
},
|
| 1226 |
-
onHide:function(s) {
|
| 1227 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1228 |
-
},
|
| 1229 |
-
onChange:function(s, i) {
|
| 1230 |
-
SFSI("#sfsi_plus_form_border_color").val("#" + i), SFSI("#sfsiPlusFormBorderColor").css("background", "#" + i);
|
| 1231 |
-
sfsi_plus_create_suscriber_form();
|
| 1232 |
-
},
|
| 1233 |
-
onClick:function(s, i) {
|
| 1234 |
-
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiPlusFormBorderColor").css("background", "#" + i);
|
| 1235 |
-
sfsi_plus_create_suscriber_form();
|
| 1236 |
-
}
|
| 1237 |
-
}),
|
| 1238 |
-
SFSI("#sfsiPlusFormBackground").ColorPicker({
|
| 1239 |
-
color:"#f80000",
|
| 1240 |
-
onBeforeShow:function() {
|
| 1241 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_background").val());
|
| 1242 |
-
},
|
| 1243 |
-
onShow:function(s) {
|
| 1244 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1245 |
-
},
|
| 1246 |
-
onHide:function(s) {
|
| 1247 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1248 |
-
},
|
| 1249 |
-
onChange:function(s, i) {
|
| 1250 |
-
SFSI("#sfsi_plus_form_background").val("#" + i), SFSI("#sfsiPlusFormBackground").css("background", "#" + i);
|
| 1251 |
-
sfsi_plus_create_suscriber_form();
|
| 1252 |
-
},
|
| 1253 |
-
onClick:function(s, i) {
|
| 1254 |
-
SFSI("#sfsi_plus_form_background").val("#" + i), SFSI("#sfsiPlusFormBackground").css("background", "#" + i);
|
| 1255 |
-
sfsi_plus_create_suscriber_form();
|
| 1256 |
-
}
|
| 1257 |
-
}),
|
| 1258 |
-
SFSI("#sfsiPlusFormHeadingFontcolor").ColorPicker({
|
| 1259 |
-
color:"#f80000",
|
| 1260 |
-
onBeforeShow:function() {
|
| 1261 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_heading_fontcolor").val());
|
| 1262 |
-
},
|
| 1263 |
-
onShow:function(s) {
|
| 1264 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1265 |
-
},
|
| 1266 |
-
onHide:function(s) {
|
| 1267 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1268 |
-
},
|
| 1269 |
-
onChange:function(s, i) {
|
| 1270 |
-
SFSI("#sfsi_plus_form_heading_fontcolor").val("#"+i), SFSI("#sfsiPlusFormHeadingFontcolor").css("background","#"+i);
|
| 1271 |
-
sfsi_plus_create_suscriber_form();
|
| 1272 |
-
},
|
| 1273 |
-
onClick:function(s, i) {
|
| 1274 |
-
SFSI("#sfsi_plus_form_heading_fontcolor").val("#"+i), SFSI("#sfsiPlusFormHeadingFontcolor").css("background","#"+i);
|
| 1275 |
-
sfsi_plus_create_suscriber_form();
|
| 1276 |
-
}
|
| 1277 |
-
}),
|
| 1278 |
-
SFSI("#sfsiPlusFormFieldFontcolor").ColorPicker({
|
| 1279 |
-
color:"#f80000",
|
| 1280 |
-
onBeforeShow:function() {
|
| 1281 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_field_fontcolor").val());
|
| 1282 |
-
},
|
| 1283 |
-
onShow:function(s) {
|
| 1284 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1285 |
-
},
|
| 1286 |
-
onHide:function(s) {
|
| 1287 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1288 |
-
},
|
| 1289 |
-
onChange:function(s, i) {
|
| 1290 |
-
SFSI("#sfsi_plus_form_field_fontcolor").val("#" + i), SFSI("#sfsiPlusFormFieldFontcolor").css("background", "#" +i);
|
| 1291 |
-
sfsi_plus_create_suscriber_form();
|
| 1292 |
-
},
|
| 1293 |
-
onClick:function(s, i) {
|
| 1294 |
-
SFSI("#sfsi_plus_form_field_fontcolor").val("#" + i), SFSI("#sfsiPlusFormFieldFontcolor").css("background", "#" +i);
|
| 1295 |
-
sfsi_plus_create_suscriber_form();
|
| 1296 |
-
}
|
| 1297 |
-
}),
|
| 1298 |
-
SFSI("#sfsiPlusFormButtonFontcolor").ColorPicker({
|
| 1299 |
-
color:"#f80000",
|
| 1300 |
-
onBeforeShow:function() {
|
| 1301 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_button_fontcolor").val());
|
| 1302 |
-
},
|
| 1303 |
-
onShow:function(s) {
|
| 1304 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1305 |
-
},
|
| 1306 |
-
onHide:function(s) {
|
| 1307 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1308 |
-
},
|
| 1309 |
-
onChange:function(s, i) {
|
| 1310 |
-
SFSI("#sfsi_plus_form_button_fontcolor").val("#"+i), SFSI("#sfsiPlusFormButtonFontcolor").css("background", "#"+i);
|
| 1311 |
-
sfsi_plus_create_suscriber_form();
|
| 1312 |
-
},
|
| 1313 |
-
onClick:function(s, i) {
|
| 1314 |
-
SFSI("#sfsi_plus_form_button_fontcolor").val("#"+i), SFSI("#sfsiPlusFormButtonFontcolor").css("background", "#"+i);
|
| 1315 |
-
sfsi_plus_create_suscriber_form();
|
| 1316 |
-
}
|
| 1317 |
-
}),
|
| 1318 |
-
SFSI("#sfsiPlusFormButtonBackground").ColorPicker({
|
| 1319 |
-
color:"#f80000",
|
| 1320 |
-
onBeforeShow:function() {
|
| 1321 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_button_background").val());
|
| 1322 |
-
},
|
| 1323 |
-
onShow:function(s) {
|
| 1324 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1325 |
-
},
|
| 1326 |
-
onHide:function(s) {
|
| 1327 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1328 |
-
},
|
| 1329 |
-
onChange:function(s, i) {
|
| 1330 |
-
SFSI("#sfsi_plus_form_button_background").val("#"+i), SFSI("#sfsiPlusFormButtonBackground").css("background","#"+i);
|
| 1331 |
-
sfsi_plus_create_suscriber_form();
|
| 1332 |
-
},
|
| 1333 |
-
onClick:function(s, i) {
|
| 1334 |
-
SFSI("#sfsi_plus_form_button_background").val("#"+i), SFSI("#sfsiPlusFormButtonBackground").css("background","#"+i);
|
| 1335 |
-
sfsi_plus_create_suscriber_form();
|
| 1336 |
-
}
|
| 1337 |
-
});*/
|
| 1338 |
-
//changes done {Monad}
|
| 1339 |
-
|
| 1340 |
-
function i() {
|
| 1341 |
-
SFSI(".uperror").html(""), sfsiplus_afterLoad();
|
| 1342 |
-
var s = SFSI('input[name="' + SFSI("#upload_id").val() + '"]');
|
| 1343 |
-
s.removeAttr("checked");
|
| 1344 |
-
var i = SFSI(s).parent().find("span:first");
|
| 1345 |
-
return SFSI(i).css("background-position", "0px 0px"), SFSI(".upload-overlay").hide("slow"),
|
| 1346 |
-
!1;
|
| 1347 |
-
}
|
| 1348 |
-
SFSI("#accordion").accordion({
|
| 1349 |
-
collapsible:!0,
|
| 1350 |
-
active:!1,
|
| 1351 |
-
heightStyle:"content",
|
| 1352 |
-
event:"click",
|
| 1353 |
-
beforeActivate:function(s, i) {
|
| 1354 |
-
if (i.newHeader[0]) var e = i.newHeader, t = e.next(".ui-accordion-content"); else var e = i.oldHeader, t = e.next(".ui-accordion-content");
|
| 1355 |
-
var n = "true" == e.attr("aria-selected");
|
| 1356 |
-
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
| 1357 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
| 1358 |
-
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() :t.slideDown(), !1;
|
| 1359 |
-
}
|
| 1360 |
-
}),
|
| 1361 |
-
SFSI("#accordion1").accordion({
|
| 1362 |
-
collapsible:!0,
|
| 1363 |
-
active:!1,
|
| 1364 |
-
heightStyle:"content",
|
| 1365 |
-
event:"click",
|
| 1366 |
-
beforeActivate:function(s, i) {
|
| 1367 |
-
if (i.newHeader[0]) var e = i.newHeader, t = e.next(".ui-accordion-content"); else var e = i.oldHeader, t = e.next(".ui-accordion-content");
|
| 1368 |
-
var n = "true" == e.attr("aria-selected");
|
| 1369 |
-
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
| 1370 |
-
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
| 1371 |
-
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() :t.slideDown(), !1;
|
| 1372 |
-
}
|
| 1373 |
-
}),
|
| 1374 |
-
SFSI(".closeSec").on("click", function() {
|
| 1375 |
-
var s = !0, i = SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(), e = SFSI(this).closest("div.ui-accordion-content").first();
|
| 1376 |
-
i.toggleClass("ui-corner-all", s).toggleClass("accordion-header-active ui-state-active ui-corner-top", !s).attr("aria-selected", (!s).toString()),
|
| 1377 |
-
i.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", s).toggleClass("ui-icon-triangle-1-s", !s),
|
| 1378 |
-
e.toggleClass("accordion-content-active", !s), s ? e.slideUp() :e.slideDown();
|
| 1379 |
-
}),
|
| 1380 |
-
SFSI(document).click(function(s) {
|
| 1381 |
-
var i = SFSI(".sfsi_plus_FrntInner"), e = SFSI(".sfsi_plus_wDiv"), t = SFSI("#at15s");
|
| 1382 |
-
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
| 1383 |
-
}),
|
| 1384 |
-
SFSI(".sfsi_plus_outr_div").find(".addthis_button").mousemove(function() {
|
| 1385 |
-
var s = SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().top + 10;
|
| 1386 |
-
SFSI("#at15s").css({
|
| 1387 |
-
top:s + "px",
|
| 1388 |
-
left:SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().left + "px"
|
| 1389 |
-
});
|
| 1390 |
-
}),
|
| 1391 |
-
|
| 1392 |
-
//pooja 28-12-2015
|
| 1393 |
-
SFSI('#sfsi_plus_popup_background_color').wpColorPicker({
|
| 1394 |
-
defaultColor: false,
|
| 1395 |
-
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1396 |
-
clear: function() {sfsi_plus_make_popBox()},
|
| 1397 |
-
hide: true,
|
| 1398 |
-
palettes: true
|
| 1399 |
-
}),
|
| 1400 |
-
SFSI('#sfsi_plus_popup_border_color').wpColorPicker({
|
| 1401 |
-
defaultColor: false,
|
| 1402 |
-
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1403 |
-
clear: function() {sfsi_plus_make_popBox()},
|
| 1404 |
-
hide: true,
|
| 1405 |
-
palettes: true
|
| 1406 |
-
}),
|
| 1407 |
-
SFSI('#sfsi_plus_popup_fontColor').wpColorPicker({
|
| 1408 |
-
defaultColor: false,
|
| 1409 |
-
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1410 |
-
clear: function() {sfsi_plus_make_popBox()},
|
| 1411 |
-
hide: true,
|
| 1412 |
-
palettes: true
|
| 1413 |
-
}),
|
| 1414 |
-
|
| 1415 |
-
/*SFSI("#sfsifontCloroPicker").ColorPicker({
|
| 1416 |
-
color:"#f80000",
|
| 1417 |
-
onBeforeShow:function() {
|
| 1418 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_fontColor").val());
|
| 1419 |
-
},
|
| 1420 |
-
onShow:function(s) {
|
| 1421 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1422 |
-
},
|
| 1423 |
-
onHide:function(s) {
|
| 1424 |
-
return SFSI(s).fadeOut(500), sfsi_plus_make_popBox(), !1;
|
| 1425 |
-
},
|
| 1426 |
-
onChange:function(s, i) {
|
| 1427 |
-
SFSI("#sfsi_plus_popup_fontColor").val("#" + i), SFSI("#sfsifontCloroPicker").css("background", "#" + i),
|
| 1428 |
-
sfsi_plus_make_popBox();
|
| 1429 |
-
},
|
| 1430 |
-
onClick:function(s, i) {
|
| 1431 |
-
SFSI("#sfsi_plus_popup_fontColor").val("#" + i), SFSI("#sfsifontCloroPicker").css("background", "#" + i),
|
| 1432 |
-
sfsi_plus_make_popBox();
|
| 1433 |
-
}
|
| 1434 |
-
}),*/
|
| 1435 |
-
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseover(function() {
|
| 1436 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
| 1437 |
-
}),
|
| 1438 |
-
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseleave(function() {
|
| 1439 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
| 1440 |
-
}),
|
| 1441 |
-
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseover(function() {
|
| 1442 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
| 1443 |
-
}),
|
| 1444 |
-
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 1445 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
| 1446 |
-
}),
|
| 1447 |
-
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseover(function() {
|
| 1448 |
-
SFSI(this).css("opacity", "0.9");
|
| 1449 |
-
}),
|
| 1450 |
-
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 1451 |
-
SFSI(this).css("opacity", "1");
|
| 1452 |
-
/*{Monad}*/
|
| 1453 |
-
}),
|
| 1454 |
-
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function() {
|
| 1455 |
-
SFSI(this).css("opacity", "0.9");
|
| 1456 |
-
}),
|
| 1457 |
-
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function() {
|
| 1458 |
-
SFSI(this).css("opacity", "1");
|
| 1459 |
-
}),
|
| 1460 |
-
|
| 1461 |
-
//pooja 28-12-2015
|
| 1462 |
-
|
| 1463 |
-
/*SFSI("#sfsiBackgroundColorPicker").ColorPicker({
|
| 1464 |
-
color:"#f80000",
|
| 1465 |
-
onBeforeShow:function() {
|
| 1466 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_background_color").val());
|
| 1467 |
-
},
|
| 1468 |
-
onShow:function(s) {
|
| 1469 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1470 |
-
},
|
| 1471 |
-
onHide:function(s) {
|
| 1472 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1473 |
-
},
|
| 1474 |
-
onChange:function(s, i) {
|
| 1475 |
-
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiBackgroundColorPicker").css("background","#"+i),
|
| 1476 |
-
sfsi_plus_make_popBox();
|
| 1477 |
-
},
|
| 1478 |
-
onClick:function(s, i) {
|
| 1479 |
-
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiBackgroundColorPicker").css("background","#"+i),
|
| 1480 |
-
sfsi_plus_make_popBox();
|
| 1481 |
-
}
|
| 1482 |
-
}),
|
| 1483 |
-
SFSI("#sfsiBorderColorPicker").ColorPicker({
|
| 1484 |
-
color:"#f80000",
|
| 1485 |
-
onBeforeShow:function() {
|
| 1486 |
-
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_border_color").val());
|
| 1487 |
-
},
|
| 1488 |
-
onShow:function(s) {
|
| 1489 |
-
return SFSI(s).fadeIn(500), !1;
|
| 1490 |
-
},
|
| 1491 |
-
onHide:function(s) {
|
| 1492 |
-
return SFSI(s).fadeOut(500), !1;
|
| 1493 |
-
},
|
| 1494 |
-
onChange:function(s, i) {
|
| 1495 |
-
SFSI("#sfsi_plus_popup_border_color").val("#" + i), SFSI("#sfsiBorderColorPicker").css("background", "#" + i),
|
| 1496 |
-
sfsi_plus_make_popBox();
|
| 1497 |
-
},
|
| 1498 |
-
onClick:function(s, i) {
|
| 1499 |
-
SFSI("#sfsi_plus_popup_border_color").val("#" + i), SFSI("#sfsiBorderColorPicker").css("background", "#" + i),
|
| 1500 |
-
sfsi_plus_make_popBox();
|
| 1501 |
-
}
|
| 1502 |
-
}),*/
|
| 1503 |
-
SFSI("#sfsi_plus_save1").on("click", function() {
|
| 1504 |
-
sfsi_plus_update_step1() && sfsipluscollapse(this);
|
| 1505 |
-
}),
|
| 1506 |
-
SFSI("#sfsi_plus_save2").on("click", function() {
|
| 1507 |
-
sfsi_plus_update_step2() && sfsipluscollapse(this);
|
| 1508 |
-
}),
|
| 1509 |
-
SFSI("#sfsi_plus_save3").on("click", function() {
|
| 1510 |
-
sfsi_plus_update_step3() && sfsipluscollapse(this);
|
| 1511 |
-
}),
|
| 1512 |
-
SFSI("#sfsi_plus_save4").on("click", function() {
|
| 1513 |
-
sfsi_plus_update_step4() && sfsipluscollapse(this);
|
| 1514 |
-
}),
|
| 1515 |
-
SFSI("#sfsi_plus_save5").on("click", function() {
|
| 1516 |
-
sfsi_plus_update_step5() && sfsipluscollapse(this);
|
| 1517 |
-
}),
|
| 1518 |
-
SFSI("#sfsi_plus_save6").on("click", function() {
|
| 1519 |
-
sfsi_plus_update_step6() && sfsipluscollapse(this);
|
| 1520 |
-
}),
|
| 1521 |
-
SFSI("#sfsi_plus_save7").on("click", function() {
|
| 1522 |
-
sfsi_plus_update_step7() && sfsipluscollapse(this);
|
| 1523 |
-
}),
|
| 1524 |
-
SFSI("#sfsi_plus_save8").on("click", function() {
|
| 1525 |
-
sfsi_plus_update_step8() && sfsipluscollapse(this);
|
| 1526 |
-
}),
|
| 1527 |
-
SFSI("#sfsi_plus_save9").on("click", function() {
|
| 1528 |
-
sfsi_plus_update_step9() && sfsipluscollapse(this);
|
| 1529 |
-
}),
|
| 1530 |
-
SFSI("#save_plus_all_settings").on("click", function() {
|
| 1531 |
-
return SFSI("#save_plus_all_settings").text("Saving.."), SFSI(".save_button >a").css("pointer-events", "none"),
|
| 1532 |
-
sfsi_plus_update_step1(), sfsi_plus_update_step9(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Which icons do you want to show on your site?" tab.', 8),
|
| 1533 |
-
global_error = 0, !1) :(sfsi_plus_update_step2(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "What do you want the icons to do?" tab.', 8),
|
| 1534 |
-
global_error = 0, !1) :(sfsi_plus_update_step3(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "What design & animation do you want to give your icons?" tab.', 8),
|
| 1535 |
-
global_error = 0, !1) :(sfsi_plus_update_step4(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display "counts" next to your icons?" tab.', 8),
|
| 1536 |
-
global_error = 0, !1) :(sfsi_plus_update_step5(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Any other wishes for your main icons?" tab.', 8),
|
| 1537 |
-
global_error = 0, !1) :(sfsi_plus_update_step6(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display icons at the end of every post?" tab.', 8),
|
| 1538 |
-
global_error = 0, !1) :(sfsi_plus_update_step7(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display a pop-up, asking people to subscribe?" tab.', 8),
|
| 1539 |
-
global_error = 0, !1) : sfsi_plus_update_step8(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Where shall they be displayed?" tab.', 8),
|
| 1540 |
-
/*global_error = 0, !1) :void (0 == global_error && sfsiplus_showErrorSuc("success", 'Saved! Now go to the <a href="widgets.php">widget</a> area and place the widget into your sidebar (if not done already)', 8))))))));*/
|
| 1541 |
-
global_error = 0, !1) :void (0 == global_error && sfsiplus_showErrorSuc("success", '', 8))))))));
|
| 1542 |
-
}),
|
| 1543 |
-
/*SFSI(".fileUPInput").live("change", function() {*/
|
| 1544 |
-
SFSI(document).on("change", '.fileUPInput', function () {
|
| 1545 |
-
sfsiplus_beForeLoad(), sfsiplus_beforeIconSubmit(this) && (SFSI(".upload-overlay").css("pointer-events", "none"),
|
| 1546 |
-
SFSI("#customIconFrm").ajaxForm({
|
| 1547 |
-
dataType:"json",
|
| 1548 |
-
success:sfsiplus_afterIconSuccess,
|
| 1549 |
-
resetForm:!0
|
| 1550 |
-
}).submit());
|
| 1551 |
-
}),
|
| 1552 |
-
SFSI(".pop-up").on("click", function() {
|
| 1553 |
-
("fbex-s2" == SFSI(this).attr("data-id") || "googlex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
| 1554 |
-
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
| 1555 |
-
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
| 1556 |
-
}),
|
| 1557 |
-
/*SFSI("#close_popup").live("click", function() {*/
|
| 1558 |
-
SFSI(document).on("click", '#close_popup', function () {
|
| 1559 |
-
SFSI(".read-overlay").hide("slow");
|
| 1560 |
-
});
|
| 1561 |
-
var e = 0;
|
| 1562 |
-
SFSI(".plus_icn_listing").on("click", ".checkbox", function() {
|
| 1563 |
-
if (1 == e) return !1;
|
| 1564 |
-
"yes" == SFSI(this).attr("dynamic_ele") && (s = SFSI(this).parent().find("input:checkbox:first"),
|
| 1565 |
-
s.is(":checked") ? SFSI(s).attr("checked", !1) :SFSI(s).attr("checked", !0)), s = SFSI(this).parent().find("input:checkbox:first"),
|
| 1566 |
-
"yes" == SFSI(s).attr("isNew") && ("0px 0px" == SFSI(this).css("background-position") ? (SFSI(s).attr("checked", !0),
|
| 1567 |
-
SFSI(this).css("background-position", "0px -36px")) :(SFSI(s).removeAttr("checked", !0),
|
| 1568 |
-
SFSI(this).css("background-position", "0px 0px")));
|
| 1569 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1570 |
-
if (s.is(":checked") && "sfsiplus-cusotm-icon" == s.attr("element-type")) SFSI(".fileUPInput").attr("name", "custom_icons[]"),
|
| 1571 |
-
SFSI(".upload-overlay").show("slow", function() {
|
| 1572 |
-
e = 0;
|
| 1573 |
-
}),
|
| 1574 |
-
SFSI("#upload_id").val(s.attr("name")); else if (!s.is(":checked") && "sfsiplus-cusotm-icon" == s.attr("element-type")) return s.attr("ele-type") ? (SFSI(this).attr("checked", !0),
|
| 1575 |
-
SFSI(this).css("background-position", "0px -36px"), e = 0, !1) :confirm("Are you sure want to delete this Icon..?? ") ? "suc" == sfsi_plus_delete_CusIcon(this, s) ? (s.attr("checked", !1),
|
| 1576 |
-
SFSI(this).css("background-position", "0px 0px"), e = 0, !1) :(e = 0, !1) :(s.attr("checked", !0),
|
| 1577 |
-
SFSI(this).css("background-position", "0px -36px"), e = 0, !1);
|
| 1578 |
-
}),
|
| 1579 |
-
SFSI(".plus_icn_listing").on("click", ".checkbox", function() {
|
| 1580 |
-
checked = SFSI(this).parent().find("input:checkbox:first"), "sfsi_plus_email_display" != checked.attr("name") || checked.is(":checked") || SFSI(".demail-1").show("slow");
|
| 1581 |
-
}),
|
| 1582 |
-
SFSI("#deac_email2").on("click", function() {
|
| 1583 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").show("slow");
|
| 1584 |
-
}),
|
| 1585 |
-
SFSI("#deac_email3").on("click", function() {
|
| 1586 |
-
SFSI(".demail-2").hide("slow"), SFSI(".demail-3").show("slow");
|
| 1587 |
-
}),
|
| 1588 |
-
SFSI(".hideemailpop").on("click", function() {
|
| 1589 |
-
SFSI('input[name="sfsi_plus_email_display"]').attr("checked", !0),
|
| 1590 |
-
SFSI('input[name="sfsi_plus_email_display"]').parent().find("span:first").css("background-position", "0px -36px"),
|
| 1591 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
| 1592 |
-
}),
|
| 1593 |
-
SFSI(".hidePop").on("click", function() {
|
| 1594 |
-
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
| 1595 |
-
}),
|
| 1596 |
-
SFSI(".sfsiplus_activate_footer").on("click", function() {
|
| 1597 |
-
var nonce = SFSI(this).attr("data-nonce");
|
| 1598 |
-
SFSI(this).text("activating....");
|
| 1599 |
-
var s = {
|
| 1600 |
-
action:"plus_activateFooter",
|
| 1601 |
-
nonce:nonce
|
| 1602 |
-
};
|
| 1603 |
-
SFSI.ajax({
|
| 1604 |
-
url:ajax_object.ajax_url,
|
| 1605 |
-
type:"post",
|
| 1606 |
-
data:s,
|
| 1607 |
-
dataType:"json",
|
| 1608 |
-
success:function(s) {
|
| 1609 |
-
if(s.res == "wrong_nonce")
|
| 1610 |
-
{
|
| 1611 |
-
SFSI(".sfsiplus_activate_footer").css("font-size", "18px");
|
| 1612 |
-
SFSI(".sfsiplus_activate_footer").text("Unauthorised Request, Try again after refreshing page");
|
| 1613 |
-
}
|
| 1614 |
-
else
|
| 1615 |
-
{
|
| 1616 |
-
"success" == s.res && (SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"),
|
| 1617 |
-
SFSI(".demail-3").hide("slow"), SFSI(".sfsiplus_activate_footer").text("Ok, activate link"));
|
| 1618 |
-
}
|
| 1619 |
-
}
|
| 1620 |
-
});
|
| 1621 |
-
}),
|
| 1622 |
-
SFSI(".sfsiplus_removeFooter").on("click", function() {
|
| 1623 |
-
var nonce = SFSI(this).attr("data-nonce");
|
| 1624 |
-
SFSI(this).text("working....");
|
| 1625 |
-
var s = {
|
| 1626 |
-
action:"plus_removeFooter",
|
| 1627 |
-
nonce:nonce
|
| 1628 |
-
};
|
| 1629 |
-
SFSI.ajax({
|
| 1630 |
-
url:ajax_object.ajax_url,
|
| 1631 |
-
type:"post",
|
| 1632 |
-
data:s,
|
| 1633 |
-
dataType:"json",
|
| 1634 |
-
success:function(s) {
|
| 1635 |
-
if(s.res == "wrong_nonce")
|
| 1636 |
-
{
|
| 1637 |
-
SFSI(".sfsiplus_removeFooter").text("Unauthorised Request, Try again after refreshing page");
|
| 1638 |
-
}
|
| 1639 |
-
else
|
| 1640 |
-
{
|
| 1641 |
-
"success" == s.res && (SFSI(".sfsiplus_removeFooter").fadeOut("slow"), SFSI(".sfsiplus_footerLnk").fadeOut("slow"));
|
| 1642 |
-
}
|
| 1643 |
-
}
|
| 1644 |
-
});
|
| 1645 |
-
}),
|
| 1646 |
-
/*SFSI(".radio").live("click", function() {*/
|
| 1647 |
-
SFSI(document).on("click", '.radio', function () {
|
| 1648 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1649 |
-
"sfsi_plus_display_counts" == s.attr("name") && sfsi_plus_show_counts();
|
| 1650 |
-
}),
|
| 1651 |
-
SFSI("#close_Uploadpopup").on("click", i), /*SFSI(".radio").live("click", function() {*/SFSI(document).on("click", '.radio', function () {
|
| 1652 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1653 |
-
"sfsi_plus_show_Onposts" == s.attr("name") && sfsi_plus_show_OnpostsDisplay();
|
| 1654 |
-
}),
|
| 1655 |
-
sfsi_plus_show_OnpostsDisplay(),
|
| 1656 |
-
sfsi_plus_depened_sections(),
|
| 1657 |
-
sfsi_plus_show_counts(),
|
| 1658 |
-
sfsi_plus_showPreviewCounts(),
|
| 1659 |
-
SFSI(".plus_share_icon_order").sortable({
|
| 1660 |
-
update:function() {
|
| 1661 |
-
SFSI(".plus_share_icon_order li").each(function() {
|
| 1662 |
-
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
| 1663 |
-
});
|
| 1664 |
-
},
|
| 1665 |
-
revert:!0
|
| 1666 |
-
}),
|
| 1667 |
-
/*SFSI(".radio").live("click", function() {*/
|
| 1668 |
-
SFSI(document).on("click", '.radio', function () {
|
| 1669 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1670 |
-
"sfsi_plus_email_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_email_countsDisplay"]').prop("checked", !0),
|
| 1671 |
-
SFSI('input[name="sfsi_plus_email_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1672 |
-
"manual" == SFSI("input[name='sfsi_plus_email_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_email_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_email_manualCounts']").slideUp()),
|
| 1673 |
-
"sfsi_plus_facebook_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_facebook_countsDisplay"]').prop("checked", !0),
|
| 1674 |
-
SFSI('input[name="sfsi_plus_facebook_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1675 |
-
"mypage" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_facebook_mypageCounts']").slideDown(),SFSI(".sfsiplus_fbpgidwpr").slideDown()) :(SFSI("input[name='sfsi_plus_facebook_mypageCounts']").slideUp(),SFSI(".sfsiplus_fbpgidwpr").slideUp()),
|
| 1676 |
-
"manual" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_facebook_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_facebook_manualCounts']").slideUp()),
|
| 1677 |
-
"sfsi_plus_facebook_countsFrom" == s.attr("name") && (("mypage" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() || "likes" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val()) ? (SFSI(".sfsi_plus_facebook_pagedeasc").slideDown()) : (SFSI(".sfsi_plus_facebook_pagedeasc").slideUp())),
|
| 1678 |
-
|
| 1679 |
-
|
| 1680 |
-
"sfsi_plus_twitter_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_twitter_countsDisplay"]').prop("checked", !0),
|
| 1681 |
-
SFSI('input[name="sfsi_plus_twitter_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1682 |
-
"manual" == SFSI("input[name='sfsi_plus_twitter_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_twitter_manualCounts']").slideDown(),
|
| 1683 |
-
SFSI(".tw_follow_options").slideUp()) :(SFSI("input[name='sfsi_plus_twitter_manualCounts']").slideUp(),
|
| 1684 |
-
SFSI(".tw_follow_options").slideDown())), "sfsi_plus_google_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_google_countsDisplay"]').prop("checked", !0),
|
| 1685 |
-
SFSI('input[name="sfsi_plus_google_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1686 |
-
"manual" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI("input[name='sfsi_plus_google_manualCounts']").slideDown(),
|
| 1687 |
-
SFSI(".google_option").slideUp()), "likes" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI("input[name='sfsi_plus_google_manualCounts']").slideUp(),
|
| 1688 |
-
SFSI(".google_option").slideUp()), "follower" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI(".google_option").slideDown(),
|
| 1689 |
-
SFSI("input[name='sfsi_plus_google_manualCounts']").slideUp())), "sfsi_plus_linkedIn_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_linkedIn_countsDisplay"]').prop("checked", !0),
|
| 1690 |
-
SFSI('input[name="sfsi_plus_linkedIn_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1691 |
-
"manual" == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").slideDown(),
|
| 1692 |
-
SFSI(".linkedIn_options").slideUp()) :(SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").slideUp(),
|
| 1693 |
-
SFSI(".linkedIn_options").slideDown())), "sfsi_plus_youtube_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_youtube_countsDisplay"]').prop("checked", !0),
|
| 1694 |
-
SFSI('input[name="sfsi_plus_youtube_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1695 |
-
"manual" == SFSI("input[name='sfsi_plus_youtube_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_youtube_manualCounts']").slideDown(),
|
| 1696 |
-
SFSI(".youtube_options").slideUp()) :(SFSI("input[name='sfsi_plus_youtube_manualCounts']").slideUp(),
|
| 1697 |
-
SFSI(".youtube_options").slideDown())), "sfsi_plus_pinterest_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_pinterest_countsDisplay"]').prop("checked", !0),
|
| 1698 |
-
SFSI('input[name="sfsi_plus_pinterest_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1699 |
-
"manual" == SFSI("input[name='sfsi_plus_pinterest_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_pinterest_manualCounts']").slideDown(),
|
| 1700 |
-
SFSI(".pin_options").slideUp()) :SFSI("input[name='sfsi_plus_pinterest_manualCounts']").slideUp()),
|
| 1701 |
-
"sfsi_plus_instagram_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_instagram_countsDisplay"]').prop("checked", !0),
|
| 1702 |
-
SFSI('input[name="sfsi_plus_instagram_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1703 |
-
"manual" == SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_instagram_manualCounts']").slideDown(),
|
| 1704 |
-
SFSI(".instagram_userLi").slideUp()) :(SFSI("input[name='sfsi_plus_instagram_manualCounts']").slideUp(),
|
| 1705 |
-
SFSI(".instagram_userLi").slideDown())), "sfsi_plus_shares_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_shares_countsDisplay"]').prop("checked", !0),
|
| 1706 |
-
SFSI('input[name="sfsi_plus_shares_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1707 |
-
"manual" == SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_shares_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_shares_manualCounts']").slideUp());
|
| 1708 |
-
}), sfsi_plus_make_popBox(), SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("keyup", sfsi_plus_make_popBox),
|
| 1709 |
-
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("focus", sfsi_plus_make_popBox),
|
| 1710 |
-
SFSI("#sfsi_plus_popup_font ,#sfsi_plus_popup_fontStyle").on("change", sfsi_plus_make_popBox),
|
| 1711 |
-
/*SFSI(".radio").live("click", function() {*/
|
| 1712 |
-
SFSI(document).on("click", '.radio', function () {
|
| 1713 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1714 |
-
"sfsi_plus_popup_border_shadow" == s.attr("name") && sfsi_plus_make_popBox();
|
| 1715 |
-
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function(s) {
|
| 1716 |
-
s.stopPropagation();
|
| 1717 |
-
var i = SFSI("#sfsi_plus_floater_sec").val();
|
| 1718 |
-
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 1719 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 1720 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 1721 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 1722 |
-
"z-index":"999"
|
| 1723 |
-
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1724 |
-
opacity:1,
|
| 1725 |
-
"z-index":10
|
| 1726 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1727 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1728 |
-
opacity:1,
|
| 1729 |
-
"z-index":10
|
| 1730 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1731 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1732 |
-
opacity:1,
|
| 1733 |
-
"z-index":10
|
| 1734 |
-
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 1735 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 1736 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1737 |
-
opacity:1,
|
| 1738 |
-
"z-index":10
|
| 1739 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 1740 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 1741 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1742 |
-
opacity:1,
|
| 1743 |
-
"z-index":1e3
|
| 1744 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 1745 |
-
}) :SFSI("img.sfsi_wicon").on("mouseenter", function() {
|
| 1746 |
-
var s = SFSI("#sfsi_plus_floater_sec").val();
|
| 1747 |
-
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 1748 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 1749 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 1750 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 1751 |
-
"z-index":"999"
|
| 1752 |
-
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1753 |
-
opacity:1,
|
| 1754 |
-
"z-index":10
|
| 1755 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1756 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1757 |
-
opacity:1,
|
| 1758 |
-
"z-index":10
|
| 1759 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1760 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1761 |
-
opacity:1,
|
| 1762 |
-
"z-index":10
|
| 1763 |
-
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 1764 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 1765 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1766 |
-
opacity:1,
|
| 1767 |
-
"z-index":10
|
| 1768 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 1769 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 1770 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1771 |
-
opacity:1,
|
| 1772 |
-
"z-index":10
|
| 1773 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 1774 |
-
}), SFSI("div.sfsi_plus_wicons").on("mouseleave", function() {
|
| 1775 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "fade_in" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 1776 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "scale" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale"),
|
| 1777 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "combo" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && (SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 1778 |
-
SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale")), "google" == SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").attr("id") ? SFSI("body").on("click", function() {
|
| 1779 |
-
SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 1780 |
-
}) :(SFSI(this).css({
|
| 1781 |
-
"z-index":"0"
|
| 1782 |
-
}), SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide());
|
| 1783 |
-
}),
|
| 1784 |
-
SFSI("body").on("click", function() {
|
| 1785 |
-
SFSI(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 1786 |
-
}),
|
| 1787 |
-
SFSI(".adminTooltip >a").on("hover", function() {
|
| 1788 |
-
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "1"),
|
| 1789 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").show();
|
| 1790 |
-
}),
|
| 1791 |
-
SFSI(".adminTooltip").on("mouseleave", function() {
|
| 1792 |
-
"none" != SFSI(".sfsi_plus_gpls_tool_bdr").css("display") && 0 != SFSI(".sfsi_plus_gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function() {
|
| 1793 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide();
|
| 1794 |
-
}) :(SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"),
|
| 1795 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide());
|
| 1796 |
-
}),
|
| 1797 |
-
SFSI(".expand-area").on("click", function() {
|
| 1798 |
-
object_name.Re_ad == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
| 1799 |
-
SFSI(this).text(object_name1.Coll_apse)) :(SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
| 1800 |
-
SFSI(this).text(object_name.Re_ad));
|
| 1801 |
-
}),
|
| 1802 |
-
/*SFSI(".radio").live("click", function(){*/
|
| 1803 |
-
SFSI(document).on("click", '.radio', function () {
|
| 1804 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1805 |
-
"sfsi_plus_icons_float" == s.attr("name") && "yes" == s.val() && (SFSI(".float_options").slideDown("slow"),
|
| 1806 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').removeAttr("checked"),
|
| 1807 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').parent().find("span").attr("style", "background-position:0px -41px;"),
|
| 1808 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').parent().find("span").attr("style", "background-position:0px -0px;")),
|
| 1809 |
-
("sfsi_plus_icons_stick" == s.attr("name") && "yes" == s.val() || "sfsi_plus_icons_float" == s.attr("name") && "no" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
| 1810 |
-
SFSI('input[name="sfsi_plus_icons_float"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_plus_icons_float"][value="yes"]').prop("checked", !1),
|
| 1811 |
-
SFSI('input[name="sfsi_plus_icons_float"][value="no"]').parent().find("span.radio").attr("style", "background-position:0px -41px;"),
|
| 1812 |
-
SFSI('input[name="sfsi_plus_icons_float"][value="yes"]').parent().find("span.radio").attr("style", "background-position:0px -0px;"));
|
| 1813 |
-
}),
|
| 1814 |
-
SFSI(".sfsi_plus_wDiv").length > 0 && setTimeout(function() {
|
| 1815 |
-
var s = parseInt(SFSI(".sfsi_plus_wDiv").height()) + 0 + "px";
|
| 1816 |
-
SFSI(".sfsi_plus_holders").each(function() {
|
| 1817 |
-
SFSI(this).css("height", s);
|
| 1818 |
-
});
|
| 1819 |
-
}, 200),
|
| 1820 |
-
/*SFSI(".checkbox").live("click", function() {*/
|
| 1821 |
-
SFSI(document).on("click", '.checkbox', function () {
|
| 1822 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1823 |
-
("sfsi_plus_shuffle_Firstload" == s.attr("name") && "checked" == s.attr("checked") || "sfsi_plus_shuffle_interval" == s.attr("name") && "checked" == s.attr("checked")) && (SFSI('input[name="sfsi_plus_shuffle_icons"]').parent().find("span").css("background-position", "0px -36px"),
|
| 1824 |
-
SFSI('input[name="sfsi_plus_shuffle_icons"]').attr("checked", "checked")), "sfsi_plus_shuffle_icons" == s.attr("name") && "checked" != s.attr("checked") && (SFSI('input[name="sfsi_plus_shuffle_Firstload"]').removeAttr("checked"),
|
| 1825 |
-
SFSI('input[name="sfsi_plus_shuffle_Firstload"]').parent().find("span").css("background-position", "0px 0px"),
|
| 1826 |
-
SFSI('input[name="sfsi_plus_shuffle_interval"]').removeAttr("checked"), SFSI('input[name="sfsi_plus_shuffle_interval"]').parent().find("span").css("background-position", "0px 0px"));
|
| 1827 |
-
});
|
| 1828 |
-
|
| 1829 |
-
SFSI("body").on("click", "#getMeFullAccess", function(){
|
| 1830 |
-
var email = SFSI(this).parents("form").find("input[type='email']").val();
|
| 1831 |
-
var feedid = SFSI(this).parents("form").find("input[name='feedid']").val();
|
| 1832 |
-
var error = false;
|
| 1833 |
-
var regEx = /^\w+([-+.']\w+)*@\w+([-.]\w+)*\.\w+([-.]\w+)*$/;
|
| 1834 |
-
|
| 1835 |
-
if(email === '')
|
| 1836 |
-
{
|
| 1837 |
-
error = true;
|
| 1838 |
-
}
|
| 1839 |
-
|
| 1840 |
-
if(!regEx.test(email))
|
| 1841 |
-
{
|
| 1842 |
-
error = true;
|
| 1843 |
-
}
|
| 1844 |
-
|
| 1845 |
-
if(!error)
|
| 1846 |
-
{
|
| 1847 |
-
SFSI(this).parents("form").submit();
|
| 1848 |
-
}
|
| 1849 |
-
else
|
| 1850 |
-
{
|
| 1851 |
-
alert("Error: Please provide your email address.");
|
| 1852 |
-
}
|
| 1853 |
-
});
|
| 1854 |
-
|
| 1855 |
-
SFSI('form#calimingOptimizationForm').on('keypress', function(e) {
|
| 1856 |
-
var keyCode = e.keyCode || e.which;
|
| 1857 |
-
if (keyCode === 13) {
|
| 1858 |
-
e.preventDefault();
|
| 1859 |
-
return false;
|
| 1860 |
-
}
|
| 1861 |
-
});
|
| 1862 |
-
|
| 1863 |
-
/*SFSI(".checkbox").live("click", function()
|
| 1864 |
-
{
|
| 1865 |
-
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1866 |
-
"sfsi_plus_float_on_page" == s.attr("name") && "yes" == s.val() && (
|
| 1867 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').removeAttr("checked"),
|
| 1868 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').parent().find("span").attr("style", "background-position:0px -41px;"),
|
| 1869 |
-
SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').parent().find("span").attr("style", "background-position:0px -0px;"));
|
| 1870 |
-
});
|
| 1871 |
-
SFSI(".radio").live("click", function()
|
| 1872 |
-
{
|
| 1873 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 1874 |
-
var a = SFSI(".cstmfltonpgstck");
|
| 1875 |
-
("sfsi_plus_icons_stick" == s.attr("name") && "yes" == s.val()) && (
|
| 1876 |
-
SFSI('input[name="sfsi_plus_float_on_page"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_plus_float_on_page"][value="yes"]').prop("checked", !1),
|
| 1877 |
-
SFSI('input[name="sfsi_plus_float_on_page"][value="no"]').parent().find("span.checkbox").attr("style", "background-position:0px -41px;"),
|
| 1878 |
-
SFSI('input[name="sfsi_plus_float_on_page"][value="yes"]').parent().find("span.checkbox").attr("style", "background-position:0px -0px;"),
|
| 1879 |
-
jQuery(a).children(".checkbox").css("background-position", "0px 0px" ), sfsiplus_toggleflotpage(a));
|
| 1880 |
-
});*/
|
| 1881 |
-
});
|
| 1882 |
-
|
| 1883 |
-
//for utube channel name and id
|
| 1884 |
-
function showhideutube(ref)
|
| 1885 |
-
{
|
| 1886 |
-
var chnlslctn = SFSI(ref).children("input").val();
|
| 1887 |
-
if(chnlslctn == "name")
|
| 1888 |
-
{
|
| 1889 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown();
|
| 1890 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp();
|
| 1891 |
-
}
|
| 1892 |
-
else
|
| 1893 |
-
{
|
| 1894 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown();
|
| 1895 |
-
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp();
|
| 1896 |
-
}
|
| 1897 |
-
}
|
| 1898 |
-
|
| 1899 |
-
var sfsiplus_initTop = new Array();
|
| 1900 |
-
|
| 1901 |
-
function sfsiplus_toggleflotpage(ref)
|
| 1902 |
-
{
|
| 1903 |
-
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
| 1904 |
-
if(pos == "0px 0px")
|
| 1905 |
-
{
|
| 1906 |
-
jQuery(ref).next(".sfsiplus_right_info").children("p").children(".sfsiplus_sub-subtitle").hide();
|
| 1907 |
-
jQuery(ref).next(".sfsiplus_right_info").children(".sfsiplus_tab_3_icns").hide();
|
| 1908 |
-
}
|
| 1909 |
-
else
|
| 1910 |
-
{
|
| 1911 |
-
jQuery(ref).next(".sfsiplus_right_info").children("p").children(".sfsiplus_sub-subtitle").show();
|
| 1912 |
-
jQuery(ref).next(".sfsiplus_right_info").children(".sfsiplus_tab_3_icns").show();
|
| 1913 |
-
}
|
| 1914 |
-
}
|
| 1915 |
-
function sfsiplus_togglbtmsection(show, hide, ref)
|
| 1916 |
-
{
|
| 1917 |
-
jQuery(ref).parent("ul").children("li.clckbltglcls").each(function(index, element)
|
| 1918 |
-
{
|
| 1919 |
-
jQuery(this).children(".radio").css("background-position", "0px 0px");
|
| 1920 |
-
jQuery(this).children(".styled").attr("checked", "false");
|
| 1921 |
-
});
|
| 1922 |
-
jQuery(ref).children(".radio").css("background-position", "0px -41px");
|
| 1923 |
-
jQuery(ref).children(".styled").attr("checked", "true");
|
| 1924 |
-
|
| 1925 |
-
jQuery("."+show).show();
|
| 1926 |
-
jQuery("."+show).children(".radiodisplaysection").show();
|
| 1927 |
-
jQuery("."+hide).hide();
|
| 1928 |
-
jQuery("."+hide).children(".radiodisplaysection").hide();
|
| 1929 |
-
/*jQuery(ref).parent("ul").children("li").each(function(index, element)
|
| 1930 |
-
{
|
| 1931 |
-
var pos = jQuery(this).children(".radio").css("background-position");
|
| 1932 |
-
if(pos == "0px 0px")
|
| 1933 |
-
{
|
| 1934 |
-
jQuery(this).children(".radiodisplaysection").hide();
|
| 1935 |
-
}
|
| 1936 |
-
else
|
| 1937 |
-
{
|
| 1938 |
-
jQuery(this).children(".radiodisplaysection").show();
|
| 1939 |
-
}
|
| 1940 |
-
});
|
| 1941 |
-
var pos = jQuery(ref).children(".radio").css("background-position");
|
| 1942 |
-
if(pos != "0px 0px")
|
| 1943 |
-
{
|
| 1944 |
-
jQuery(ref).children(".radiodisplaysection").show();
|
| 1945 |
-
}
|
| 1946 |
-
else
|
| 1947 |
-
{
|
| 1948 |
-
jQuery(ref).children(".radiodisplaysection").hide();
|
| 1949 |
-
}*/
|
| 1950 |
-
}
|
| 1951 |
-
function checkforinfoslction(ref)
|
| 1952 |
-
{
|
| 1953 |
-
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
| 1954 |
-
if(pos == "0px 0px")
|
| 1955 |
-
{
|
| 1956 |
-
jQuery(ref).next(".sfsiplus_right_info").children("p").children("label").hide();
|
| 1957 |
-
}
|
| 1958 |
-
else
|
| 1959 |
-
{
|
| 1960 |
-
jQuery(ref).next(".sfsiplus_right_info").children("p").children("label").show();
|
| 1961 |
-
}
|
| 1962 |
-
}
|
| 1963 |
-
SFSI("body").on("click", ".sfsi_plus_tokenGenerateButton a", function(){
|
| 1964 |
-
var clienId = SFSI("input[name='sfsi_plus_instagram_clientid']").val();
|
| 1965 |
-
var redirectUrl = SFSI("input[name='sfsi_plus_instagram_appurl']").val();
|
| 1966 |
-
|
| 1967 |
-
var scope = "likes+comments+basic+public_content+follower_list+relationships";
|
| 1968 |
-
var instaUrl = "https://www.instagram.com/oauth/authorize/?client_id=<id>&redirect_uri=<url>&response_type=token&scope="+scope;
|
| 1969 |
-
|
| 1970 |
-
if(clienId !== '' && redirectUrl !== '')
|
| 1971 |
-
{
|
| 1972 |
-
instaUrl = instaUrl.replace('<id>', clienId);
|
| 1973 |
-
instaUrl = instaUrl.replace('<url>', redirectUrl);
|
| 1974 |
-
|
| 1975 |
-
window.open(instaUrl, '_blank');
|
| 1976 |
-
}
|
| 1977 |
-
else
|
| 1978 |
-
{
|
| 1979 |
-
alert("Please enter client id and redirect url first");
|
| 1980 |
-
}
|
| 1981 |
-
|
| 1982 |
});
|
| 1 |
+
function sfsi_plus_update_index() {
|
| 2 |
+
var s = 1;
|
| 3 |
+
SFSI("ul.plus_icn_listing li.plus_custom").each(function() {
|
| 4 |
+
SFSI(this).children("span.sfsiplus_custom-txt").html("Custom " + s), s++;
|
| 5 |
+
}), cntt = 1, SFSI("div.cm_lnk").each(function() {
|
| 6 |
+
SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom " + cntt + ":"),
|
| 7 |
+
cntt++;
|
| 8 |
+
}), cntt = 1, SFSI("div.plus_custom_m").find("div.sfsiplus_custom_section").each(function() {
|
| 9 |
+
SFSI(this).find("label").html("Custom " + cntt + ":"), cntt++;
|
| 10 |
+
});
|
| 11 |
+
}
|
| 12 |
+
function sfsipluscollapse(s)
|
| 13 |
+
{
|
| 14 |
+
var i = !0, e = SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"), t = SFSI(s).closest("div.ui-accordion-content").first();
|
| 15 |
+
e.toggleClass("ui-corner-all", i).toggleClass("accordion-header-active ui-state-active ui-corner-top", !i).attr("aria-selected", (!i).toString()),
|
| 16 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", i).toggleClass("ui-icon-triangle-1-s", !i),
|
| 17 |
+
t.toggleClass("accordion-content-active", !i), i ? t.slideUp() :t.slideDown();
|
| 18 |
+
}
|
| 19 |
+
function sfsi_plus_delete_CusIcon(s, i)
|
| 20 |
+
{
|
| 21 |
+
sfsiplus_beForeLoad();
|
| 22 |
+
var e = {
|
| 23 |
+
action:"plus_deleteIcons",
|
| 24 |
+
icon_name:i.attr("name")
|
| 25 |
+
};
|
| 26 |
+
SFSI.ajax({
|
| 27 |
+
url:ajax_object.ajax_url,
|
| 28 |
+
type:"post",
|
| 29 |
+
data:e,
|
| 30 |
+
dataType:"json",
|
| 31 |
+
success:function(e) {
|
| 32 |
+
if ("success" == e.res) {
|
| 33 |
+
sfsiplus_showErrorSuc("success", "Saved !", 1);
|
| 34 |
+
var t = e.last_index + 1;
|
| 35 |
+
var attr = i.attr("name");
|
| 36 |
+
attr = attr.replace('plus', '');
|
| 37 |
+
SFSI("#plus_total_cusotm_icons").val(e.total_up), SFSI(s).closest(".plus_custom").remove(),
|
| 38 |
+
SFSI("li.plus_custom:last-child").addClass("bdr_btm_non"), SFSI(".plus_custom-links").find("div." + attr).remove(),
|
| 39 |
+
SFSI(".plus_custom_m").find("div." + attr).remove(), SFSI(".plus_share_icon_order").children("li." + attr).remove(),
|
| 40 |
+
SFSI("ul.plus_sfsi_sample_icons").children("li." + attr).remove();
|
| 41 |
+
var n = e.total_up + 1;
|
| 42 |
+
4 == e.total_up && SFSI(".plus_icn_listing").append('<li id="plus_c' + t + '" class="plus_custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="plussfsiICON_' + t + '_display" type="checkbox" value="yes" class="styled" style="display:none;" element-type="sfsiplus-cusotm-icon" isNew="yes" /></div> <span class="plus_custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="plus_CImg_' + t + '" /> </span> <span class="custom sfsiplus_custom-txt">Custom' + n + ' </span> <div class="sfsiplus_right_info"> <p><span>'+object_name1.It_depends+':</span> '+object_name1.Upload_a+'</p><div class="inputWrapper"></div></li>');
|
| 43 |
+
} else sfsiplus_showErrorSuc("error", "Unkown error , please try again", 1);
|
| 44 |
+
return sfsi_plus_update_index(), plus_update_Sec5Iconorder(), sfsi_plus_update_step1(), sfsi_plus_update_step5(),
|
| 45 |
+
sfsiplus_afterLoad(), "suc";
|
| 46 |
+
}
|
| 47 |
+
});
|
| 48 |
+
}
|
| 49 |
+
function plus_update_Sec5Iconorder()
|
| 50 |
+
{
|
| 51 |
+
SFSI("ul.plus_share_icon_order").children("li").each(function() {
|
| 52 |
+
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
| 53 |
+
});
|
| 54 |
+
}
|
| 55 |
+
function sfsi_plus_section_Display(s, i)
|
| 56 |
+
{
|
| 57 |
+
"hide" == i ? (SFSI("." + s + " :input").prop("disabled", !0), SFSI("." + s + " :button").prop("disabled", !0),
|
| 58 |
+
SFSI("." + s).hide()) :(SFSI("." + s + " :input").removeAttr("disabled", !0), SFSI("." + s + " :button").removeAttr("disabled", !0),
|
| 59 |
+
SFSI("." + s).show());
|
| 60 |
+
}
|
| 61 |
+
function sfsi_plus_depened_sections()
|
| 62 |
+
{
|
| 63 |
+
if ("sfsi" == SFSI("input[name='sfsi_plus_rss_icons']:checked").val()) {
|
| 64 |
+
for (i = 0; 16 > i; i++) {
|
| 65 |
+
var s = i + 1, e = 74 * i;
|
| 66 |
+
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-588px -" + e + "px");
|
| 67 |
+
}
|
| 68 |
+
var t = SFSI(".icon_img").attr("src");
|
| 69 |
+
if(t)
|
| 70 |
+
{
|
| 71 |
+
if (t.indexOf("subscribe") !=-1)
|
| 72 |
+
{
|
| 73 |
+
var n = t.replace("subscribe.png", "sf_arow_icn.png");
|
| 74 |
+
}
|
| 75 |
+
else
|
| 76 |
+
{
|
| 77 |
+
var n = t.replace("email.png", "sf_arow_icn.png");
|
| 78 |
+
}
|
| 79 |
+
SFSI(".icon_img").attr("src", n);
|
| 80 |
+
}
|
| 81 |
+
}
|
| 82 |
+
else
|
| 83 |
+
{
|
| 84 |
+
if("email" == SFSI("input[name='sfsi_plus_rss_icons']:checked").val())
|
| 85 |
+
{
|
| 86 |
+
for (SFSI(".sfsiplus_row_1_2").css("background-position", "-58px 0"), i = 0; 16 > i; i++) {
|
| 87 |
+
var s = i + 1, e = 74 * i;
|
| 88 |
+
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-58px -" + e + "px");
|
| 89 |
+
}
|
| 90 |
+
var t = SFSI(".icon_img").attr("src");
|
| 91 |
+
if (t) {
|
| 92 |
+
if (t.indexOf("sf_arow_icn") !=-1)
|
| 93 |
+
{
|
| 94 |
+
var n = t.replace("sf_arow_icn.png", "email.png");
|
| 95 |
+
}
|
| 96 |
+
else
|
| 97 |
+
{
|
| 98 |
+
var n = t.replace("subscribe.png", "email.png");
|
| 99 |
+
}
|
| 100 |
+
SFSI(".icon_img").attr("src", n);
|
| 101 |
+
}
|
| 102 |
+
}
|
| 103 |
+
else
|
| 104 |
+
{
|
| 105 |
+
for (SFSI(".sfsiplus_row_1_2").css("background-position", "-649px 0"), i = 0; 16 > i; i++) {
|
| 106 |
+
var s = i + 1, e = 74 * i;
|
| 107 |
+
SFSI(".sfsiplus_row_" + s + "_2").css("background-position", "-649px -" + e + "px");
|
| 108 |
+
}
|
| 109 |
+
var t = SFSI(".icon_img").attr("src");
|
| 110 |
+
if (t) {
|
| 111 |
+
if (t.indexOf("email") !=-1)
|
| 112 |
+
{
|
| 113 |
+
var n = t.replace("email.png", "subscribe.png");
|
| 114 |
+
}
|
| 115 |
+
else
|
| 116 |
+
{
|
| 117 |
+
var n = t.replace("sf_arow_icn.png", "subscribe.png");
|
| 118 |
+
}
|
| 119 |
+
SFSI(".icon_img").attr("src", n);
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
}
|
| 123 |
+
SFSI("input[name='sfsi_plus_rss_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_rss_section", "show") :sfsi_plus_section_Display("sfsiplus_rss_section", "hide"),
|
| 124 |
+
SFSI("input[name='sfsi_plus_email_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_email_section", "show") :sfsi_plus_section_Display("sfsiplus_email_section", "hide"),
|
| 125 |
+
SFSI("input[name='sfsi_plus_facebook_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_facebook_section", "show") :sfsi_plus_section_Display("sfsiplus_facebook_section", "hide"),
|
| 126 |
+
SFSI("input[name='sfsi_plus_twitter_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_twitter_section", "show") :sfsi_plus_section_Display("sfsiplus_twitter_section", "hide"),
|
| 127 |
+
SFSI("input[name='sfsi_plus_google_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_google_section", "show") :sfsi_plus_section_Display("sfsiplus_google_section", "hide"),
|
| 128 |
+
SFSI("input[name='sfsi_plus_share_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_share_section", "show") :sfsi_plus_section_Display("sfsiplus_share_section", "hide"),
|
| 129 |
+
SFSI("input[name='sfsi_plus_youtube_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_youtube_section", "show") :sfsi_plus_section_Display("sfsiplus_youtube_section", "hide"),
|
| 130 |
+
SFSI("input[name='sfsi_plus_pinterest_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_pinterest_section", "show") :sfsi_plus_section_Display("sfsiplus_pinterest_section", "hide"),
|
| 131 |
+
SFSI("input[name='sfsi_plus_instagram_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_instagram_section", "show") :sfsi_plus_section_Display("sfsiplus_instagram_section", "hide"),
|
| 132 |
+
SFSI("input[name='sfsi_plus_houzz_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_houzz_section", "show") :sfsi_plus_section_Display("sfsiplus_houzz_section", "hide"),
|
| 133 |
+
SFSI("input[name='sfsi_plus_linkedin_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_linkedin_section", "show") :sfsi_plus_section_Display("sfsiplus_linkedin_section", "hide"),
|
| 134 |
+
SFSI("input[element-type='sfsiplus-cusotm-icon']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_custom_section", "show") :sfsi_plus_section_Display("sfsiplus_custom_section", "hide");
|
| 135 |
+
}
|
| 136 |
+
function PlusCustomIConSectionsUpdate()
|
| 137 |
+
{
|
| 138 |
+
sfsi_plus_section_Display("counter".ele, show);
|
| 139 |
+
}
|
| 140 |
+
// Upload Custom Skin {Monad}
|
| 141 |
+
function plus_sfsi_customskin_upload(s, ref)
|
| 142 |
+
{
|
| 143 |
+
var ttl = jQuery(ref).attr("title");
|
| 144 |
+
var i = s, e = {
|
| 145 |
+
action:"plus_UploadSkins",
|
| 146 |
+
custom_imgurl:i
|
| 147 |
+
};
|
| 148 |
+
SFSI.ajax({
|
| 149 |
+
url:ajax_object.ajax_url,
|
| 150 |
+
type:"post",
|
| 151 |
+
data:e,
|
| 152 |
+
success:function(msg) {
|
| 153 |
+
if (msg.res = "success")
|
| 154 |
+
{
|
| 155 |
+
var arr = s.split('=');
|
| 156 |
+
jQuery(ref).prev('.imgskin').attr('src', arr[1]);
|
| 157 |
+
jQuery(ref).prev('.imgskin').css("display","block");
|
| 158 |
+
jQuery(ref).text("Update");
|
| 159 |
+
jQuery(ref).next('.dlt_btn').css("display","block");
|
| 160 |
+
}
|
| 161 |
+
}
|
| 162 |
+
});
|
| 163 |
+
}
|
| 164 |
+
// Delete Custom Skin {Monad}
|
| 165 |
+
function sfsiplus_deleteskin_icon(s)
|
| 166 |
+
{
|
| 167 |
+
var iconname = jQuery(s).attr("title");
|
| 168 |
+
var nonce = jQuery(s).attr("data-nonce");
|
| 169 |
+
var i = iconname, e = {
|
| 170 |
+
action:"plus_DeleteSkin",
|
| 171 |
+
iconname:i,
|
| 172 |
+
nonce:nonce
|
| 173 |
+
};
|
| 174 |
+
|
| 175 |
+
SFSI.ajax({
|
| 176 |
+
url:ajax_object.ajax_url,
|
| 177 |
+
type:"post",
|
| 178 |
+
data:e,
|
| 179 |
+
dataType: "json",
|
| 180 |
+
success:function(msg) {
|
| 181 |
+
if (msg.res === "success")
|
| 182 |
+
{
|
| 183 |
+
SFSI(s).prev("a").text("Upload");
|
| 184 |
+
SFSI(s).prev("a").prev("img").attr("src",'');
|
| 185 |
+
SFSI(s).prev("a").prev("img").css("display","none");
|
| 186 |
+
SFSI(s).css("display","none");
|
| 187 |
+
}
|
| 188 |
+
else
|
| 189 |
+
{
|
| 190 |
+
alert("Whoops! something went wrong.")
|
| 191 |
+
}
|
| 192 |
+
}
|
| 193 |
+
});
|
| 194 |
+
}
|
| 195 |
+
// Save Custom Skin {Monad}
|
| 196 |
+
function SFSI_plus_done()
|
| 197 |
+
{
|
| 198 |
+
e = { action:"plus_Iamdone" };
|
| 199 |
+
|
| 200 |
+
SFSI.ajax({
|
| 201 |
+
url:ajax_object.ajax_url,
|
| 202 |
+
type:"post",
|
| 203 |
+
data:e,
|
| 204 |
+
success:function(msg) {
|
| 205 |
+
jQuery("li.cstomskins_upload").children(".sfsiplus_icns_tab_3").html(msg);
|
| 206 |
+
SFSI("input[name='sfsi_plus_rss_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_rss_section", "show") :sfsi_plus_section_Display("sfsiplus_rss_section", "hide"),SFSI("input[name='sfsi_plus_email_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_email_section", "show") :sfsi_plus_section_Display("sfsiplus_email_section", "hide"),SFSI("input[name='sfsi_plus_facebook_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_facebook_section", "show") :sfsi_plus_section_Display("sfsiplus_facebook_section", "hide"), SFSI("input[name='sfsi_plus_twitter_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_twitter_section", "show") :sfsi_plus_section_Display("sfsiplus_twitter_section", "hide"),SFSI("input[name='sfsi_plus_google_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_google_section", "show") :sfsi_plus_section_Display("sfsiplus_google_section", "hide"), SFSI("input[name='sfsi_plus_share_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_share_section", "show") :sfsi_plus_section_Display("sfsiplus_share_section", "hide"), SFSI("input[name='sfsi_plus_youtube_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_youtube_section", "show") :sfsi_plus_section_Display("sfsiplus_youtube_section", "hide"), SFSI("input[name='sfsi_plus_pinterest_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_pinterest_section", "show") :sfsi_plus_section_Display("sfsiplus_pinterest_section", "hide"), SFSI("input[name='sfsi_plus_instagram_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_instagram_section", "show") :sfsi_plus_section_Display("sfsiplus_instagram_section", "hide"), SFSI("input[name='sfsi_plus_houzz_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_houzz_section", "show") :sfsi_plus_section_Display("sfsiplus_houzz_section", "hide"), SFSI("input[name='sfsi_plus_linkedin_display']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_linkedin_section", "show") :sfsi_plus_section_Display("sfsiplus_linkedin_section", "hide"), SFSI("input[element-type='sfsiplus-cusotm-icon']").prop("checked") ? sfsi_plus_section_Display("sfsiplus_custom_section", "show") :sfsi_plus_section_Display("sfsiplus_custom_section", "hide");
|
| 207 |
+
SFSI(".cstmskins-overlay").hide("slow");
|
| 208 |
+
sfsi_plus_update_step3() && sfsipluscollapse(this);
|
| 209 |
+
}
|
| 210 |
+
});
|
| 211 |
+
}
|
| 212 |
+
// Upload Custom Icons {Monad}
|
| 213 |
+
function plus_sfsi_newcustomicon_upload(s)
|
| 214 |
+
{
|
| 215 |
+
var i = s, e = {
|
| 216 |
+
action:"plus_UploadIcons",
|
| 217 |
+
custom_imgurl:i
|
| 218 |
+
};
|
| 219 |
+
SFSI.ajax({
|
| 220 |
+
url:ajax_object.ajax_url,
|
| 221 |
+
type:"post",
|
| 222 |
+
data:e,
|
| 223 |
+
dataType:"json",
|
| 224 |
+
async:!0,
|
| 225 |
+
success:function(s) {
|
| 226 |
+
if(s.res == 'success')
|
| 227 |
+
{
|
| 228 |
+
sfsiplus_afterIconSuccess(s);
|
| 229 |
+
}
|
| 230 |
+
else
|
| 231 |
+
{
|
| 232 |
+
SFSI(".upload-overlay").hide("slow");
|
| 233 |
+
SFSI(".uperror").html(s.res);
|
| 234 |
+
sfsiplus_showErrorSuc("Error", "Some Error Occured During Upload Custom Icon", 1)
|
| 235 |
+
}
|
| 236 |
+
}
|
| 237 |
+
});
|
| 238 |
+
}
|
| 239 |
+
function sfsi_plus_update_step1()
|
| 240 |
+
{
|
| 241 |
+
var nonce = SFSI("#sfsi_plus_save1").attr("data-nonce");
|
| 242 |
+
global_error = 0, sfsiplus_beForeLoad(), sfsi_plus_depened_sections();
|
| 243 |
+
var s = !1, i = SFSI("input[name='sfsi_plus_rss_display']:checked").val(), e = SFSI("input[name='sfsi_plus_email_display']:checked").val(), t = SFSI("input[name='sfsi_plus_facebook_display']:checked").val(), n = SFSI("input[name='sfsi_plus_twitter_display']:checked").val(), o = SFSI("input[name='sfsi_plus_google_display']:checked").val(), a = SFSI("input[name='sfsi_plus_share_display']:checked").val(), r = SFSI("input[name='sfsi_plus_youtube_display']:checked").val(), c = SFSI("input[name='sfsi_plus_pinterest_display']:checked").val(), p = SFSI("input[name='sfsi_plus_linkedin_display']:checked").val(), _ = SFSI("input[name='sfsi_plus_instagram_display']:checked").val(), houzz = SFSI("input[name='sfsi_plus_houzz_display']:checked").val(), l = SFSI("input[name='sfsi_custom1_display']:checked").val(), S = SFSI("input[name='sfsi_custom2_display']:checked").val(), u = SFSI("input[name='sfsi_custom3_display']:checked").val(), f = SFSI("input[name='sfsi_custom4_display']:checked").val(), d = SFSI("input[name='sfsi_custom5_display']:checked").val(), I = {
|
| 244 |
+
action:"plus_updateSrcn1",
|
| 245 |
+
sfsi_plus_rss_display:i,
|
| 246 |
+
sfsi_plus_email_display:e,
|
| 247 |
+
sfsi_plus_facebook_display:t,
|
| 248 |
+
sfsi_plus_twitter_display:n,
|
| 249 |
+
sfsi_plus_google_display:o,
|
| 250 |
+
sfsi_plus_share_display:a,
|
| 251 |
+
sfsi_plus_youtube_display:r,
|
| 252 |
+
sfsi_plus_pinterest_display:c,
|
| 253 |
+
sfsi_plus_linkedin_display:p,
|
| 254 |
+
sfsi_plus_instagram_display:_,
|
| 255 |
+
sfsi_plus_houzz_display:houzz,
|
| 256 |
+
sfsi_custom1_display:l,
|
| 257 |
+
sfsi_custom2_display:S,
|
| 258 |
+
sfsi_custom3_display:u,
|
| 259 |
+
sfsi_custom4_display:f,
|
| 260 |
+
sfsi_custom5_display:d,
|
| 261 |
+
nonce:nonce
|
| 262 |
+
};
|
| 263 |
+
SFSI.ajax({
|
| 264 |
+
url:ajax_object.ajax_url,
|
| 265 |
+
type:"post",
|
| 266 |
+
data:I,
|
| 267 |
+
async:!0,
|
| 268 |
+
dataType:"json",
|
| 269 |
+
success:function(i) {
|
| 270 |
+
if(i=="wrong_nonce")
|
| 271 |
+
{
|
| 272 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 1);
|
| 273 |
+
s = !1;
|
| 274 |
+
sfsiplus_afterLoad();
|
| 275 |
+
}
|
| 276 |
+
else
|
| 277 |
+
{
|
| 278 |
+
"success" == i ? (sfsiplus_showErrorSuc("success", "Saved !", 1), sfsipluscollapse("#sfsi_plus_save1"),
|
| 279 |
+
sfsi_plus_make_popBox()) :(global_error = 1, sfsiplus_showErrorSuc("error", "Unkown error , please try again", 1),
|
| 280 |
+
s = !1), sfsiplus_afterLoad();
|
| 281 |
+
}
|
| 282 |
+
}
|
| 283 |
+
});
|
| 284 |
+
}
|
| 285 |
+
function sfsi_plus_update_step2()
|
| 286 |
+
{
|
| 287 |
+
var nonce = SFSI("#sfsi_plus_save2").attr("data-nonce");
|
| 288 |
+
var s = sfsi_plus_validationStep2();
|
| 289 |
+
if (!s) return global_error = 1, !1;
|
| 290 |
+
sfsiplus_beForeLoad();
|
| 291 |
+
var i = 1 == SFSI("input[name='sfsi_plus_rss_url']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_url']").val(), e = 1 == SFSI("input[name='sfsi_plus_rss_icons']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_icons']:checked").val(), t = 1 == SFSI("input[name='sfsi_plus_facebookPage_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookPage_option']:checked").val(), n = 1 == SFSI("input[name='sfsi_plus_facebookLike_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookLike_option']:checked").val(), o = 1 == SFSI("input[name='sfsi_plus_facebookShare_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebookShare_option']:checked").val(), a = SFSI("input[name='sfsi_plus_facebookPage_url']").val(), r = 1 == SFSI("input[name='sfsi_plus_twitter_followme']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_followme']:checked").val(), c = 1 == SFSI("input[name='sfsi_plus_twitter_followUserName']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_followUserName']").val(), p = 1 == SFSI("input[name='sfsi_plus_twitter_aboutPage']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_aboutPage']:checked").val(), _ = 1 == SFSI("input[name='sfsi_plus_twitter_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_page']:checked").val(), l = SFSI("input[name='sfsi_plus_twitter_pageURL']").val(), S = SFSI("textarea[name='sfsi_plus_twitter_aboutPageText']").val(), u = 1 == SFSI("input[name='sfsi_plus_google_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_page']:checked").val(), f = 1 == SFSI("input[name='sfsi_plus_googleLike_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_googleLike_option']:checked").val(), d = SFSI("input[name='sfsi_plus_google_pageURL']").val(), I = 1 == SFSI("input[name='sfsi_plus_googleShare_option']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_googleShare_option']:checked").val(), m = 1 == SFSI("input[name='sfsi_plus_youtube_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_page']:checked").val(), F = 1 == SFSI("input[name='sfsi_plus_youtube_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_pageUrl']").val(), h = 1 == SFSI("input[name='sfsi_plus_youtube_follow']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_follow']:checked").val(), cls = SFSI("input[name='sfsi_plus_youtubeusernameorid']:checked").val(), v = SFSI("input[name='sfsi_plus_ytube_user']").val(), vchid = SFSI("input[name='sfsi_plus_ytube_chnlid']").val(), g = 1 == SFSI("input[name='sfsi_plus_pinterest_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_page']:checked").val(), k = 1 == SFSI("input[name='sfsi_plus_pinterest_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_pageUrl']").val(), y = 1 == SFSI("input[name='sfsi_plus_pinterest_pingBlog']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_pingBlog']:checked").val(), b = 1 == SFSI("input[name='sfsi_plus_instagram_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_pageUrl']").val(), houzz = 1 == SFSI("input[name='sfsi_plus_houzz_pageUrl']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_pageUrl']").val(), w = 1 == SFSI("input[name='sfsi_plus_linkedin_page']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_page']:checked").val(), x = 1 == SFSI("input[name='sfsi_plus_linkedin_pageURL']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_pageURL']").val(), C = 1 == SFSI("input[name='sfsi_plus_linkedin_follow']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_follow']:checked").val(), D = SFSI("input[name='sfsi_plus_linkedin_followCompany']").val(), U = 1 == SFSI("input[name='sfsi_plus_linkedin_SharePage']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedin_SharePage']:checked").val(), O = SFSI("input[name='sfsi_plus_linkedin_recommendBusines']:checked").val(), T = SFSI("input[name='sfsi_plus_linkedin_recommendProductId']").val(), j = SFSI("input[name='sfsi_plus_linkedin_recommendCompany']").val(), P = {};
|
| 292 |
+
SFSI("input[name='sfsi_plus_CustomIcon_links[]']").each(function() {
|
| 293 |
+
P[SFSI(this).attr("file-id")] = this.value;
|
| 294 |
+
});
|
| 295 |
+
var M = {
|
| 296 |
+
action:"plus_updateSrcn2",
|
| 297 |
+
sfsi_plus_rss_url:i,
|
| 298 |
+
sfsi_plus_rss_icons:e,
|
| 299 |
+
sfsi_plus_facebookPage_option:t,
|
| 300 |
+
sfsi_plus_facebookLike_option:n,
|
| 301 |
+
sfsi_plus_facebookShare_option:o,
|
| 302 |
+
sfsi_plus_facebookPage_url:a,
|
| 303 |
+
sfsi_plus_twitter_followme:r,
|
| 304 |
+
sfsi_plus_twitter_followUserName:c,
|
| 305 |
+
sfsi_plus_twitter_aboutPage:p,
|
| 306 |
+
sfsi_plus_twitter_page:_,
|
| 307 |
+
sfsi_plus_twitter_pageURL:l,
|
| 308 |
+
sfsi_plus_twitter_aboutPageText:S,
|
| 309 |
+
sfsi_plus_google_page:u,
|
| 310 |
+
sfsi_plus_googleLike_option:f,
|
| 311 |
+
sfsi_plus_google_pageURL:d,
|
| 312 |
+
sfsi_plus_googleShare_option:I,
|
| 313 |
+
sfsi_plus_youtube_page:m,
|
| 314 |
+
sfsi_plus_youtube_pageUrl:F,
|
| 315 |
+
sfsi_plus_youtube_follow:h,
|
| 316 |
+
sfsi_plus_youtubeusernameorid:cls,
|
| 317 |
+
sfsi_plus_ytube_user:v,
|
| 318 |
+
sfsi_plus_ytube_chnlid:vchid,
|
| 319 |
+
sfsi_plus_pinterest_page:g,
|
| 320 |
+
sfsi_plus_pinterest_pageUrl:k,
|
| 321 |
+
sfsi_plus_instagram_pageUrl:b,
|
| 322 |
+
sfsi_plus_houzz_pageUrl:houzz,
|
| 323 |
+
sfsi_plus_pinterest_pingBlog:y,
|
| 324 |
+
sfsi_plus_linkedin_page:w,
|
| 325 |
+
sfsi_plus_linkedin_pageURL:x,
|
| 326 |
+
sfsi_plus_linkedin_follow:C,
|
| 327 |
+
sfsi_plus_linkedin_followCompany:D,
|
| 328 |
+
sfsi_plus_linkedin_SharePage:U,
|
| 329 |
+
sfsi_plus_linkedin_recommendBusines:O,
|
| 330 |
+
sfsi_plus_linkedin_recommendCompany:j,
|
| 331 |
+
sfsi_plus_linkedin_recommendProductId:T,
|
| 332 |
+
sfsi_plus_custom_links:P,
|
| 333 |
+
nonce:nonce
|
| 334 |
+
};
|
| 335 |
+
SFSI.ajax({
|
| 336 |
+
url:ajax_object.ajax_url,
|
| 337 |
+
type:"post",
|
| 338 |
+
data:M,
|
| 339 |
+
async:!0,
|
| 340 |
+
dataType:"json",
|
| 341 |
+
success:function(s) {
|
| 342 |
+
if(s == "wrong_nonce")
|
| 343 |
+
{
|
| 344 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 2);
|
| 345 |
+
return_value = !1;
|
| 346 |
+
sfsiplus_afterLoad();
|
| 347 |
+
}
|
| 348 |
+
else
|
| 349 |
+
{
|
| 350 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 2), sfsipluscollapse("#sfsi_plus_save2"),
|
| 351 |
+
sfsi_plus_depened_sections()) :(global_error = 1, sfsiplus_showErrorSuc("error", "Unkown error , please try again", 2),
|
| 352 |
+
return_value = !1), sfsiplus_afterLoad();
|
| 353 |
+
}
|
| 354 |
+
}
|
| 355 |
+
});
|
| 356 |
+
}
|
| 357 |
+
function sfsi_plus_update_step3()
|
| 358 |
+
{
|
| 359 |
+
var nonce = SFSI("#sfsi_plus_save3").attr("data-nonce");
|
| 360 |
+
var s = sfsi_plus_validationStep3();
|
| 361 |
+
if (!s) return global_error = 1, !1;
|
| 362 |
+
sfsiplus_beForeLoad();
|
| 363 |
+
var i = SFSI("input[name='sfsi_plus_actvite_theme']:checked").val(), e = SFSI("input[name='sfsi_plus_mouseOver']:checked").val(), t = SFSI("input[name='sfsi_plus_shuffle_icons']:checked").val(), n = SFSI("input[name='sfsi_plus_shuffle_Firstload']:checked").val(), o = SFSI("#sfsi_plus_mouseOver_effect option:selected").val(), a = SFSI("input[name='sfsi_plus_shuffle_interval']:checked").val(), r = SFSI("input[name='sfsi_plus_shuffle_intervalTime']").val(), c = SFSI("input[name='sfsi_plus_specialIcon_animation']:checked").val(), p = SFSI("input[name='sfsi_plus_specialIcon_MouseOver']:checked").val(), _ = SFSI("input[name='sfsi_plus_specialIcon_Firstload']:checked").val(), l = SFSI("#sfsi_plus_specialIcon_Firstload_Icons option:selected").val(), S = SFSI("input[name='sfsi_plus_specialIcon_interval']:checked").val(), u = SFSI("input[name='sfsi_plus_specialIcon_intervalTime']").val(), f = SFSI("#sfsi_plus_specialIcon_intervalIcons option:selected").val(), d = {
|
| 364 |
+
action:"plus_updateSrcn3",
|
| 365 |
+
sfsi_plus_actvite_theme:i,
|
| 366 |
+
sfsi_plus_mouseOver:e,
|
| 367 |
+
sfsi_plus_shuffle_icons:t,
|
| 368 |
+
sfsi_plus_shuffle_Firstload:n,
|
| 369 |
+
sfsi_plus_mouseOver_effect:o,
|
| 370 |
+
sfsi_plus_shuffle_interval:a,
|
| 371 |
+
sfsi_plus_shuffle_intervalTime:r,
|
| 372 |
+
sfsi_plus_specialIcon_animation:c,
|
| 373 |
+
sfsi_plus_specialIcon_MouseOver:p,
|
| 374 |
+
sfsi_plus_specialIcon_Firstload:_,
|
| 375 |
+
sfsi_plus_specialIcon_Firstload_Icons:l,
|
| 376 |
+
sfsi_plus_specialIcon_interval:S,
|
| 377 |
+
sfsi_plus_specialIcon_intervalTime:u,
|
| 378 |
+
sfsi_plus_specialIcon_intervalIcons:f,
|
| 379 |
+
nonce:nonce
|
| 380 |
+
};
|
| 381 |
+
SFSI.ajax({
|
| 382 |
+
url:ajax_object.ajax_url,
|
| 383 |
+
type:"post",
|
| 384 |
+
data:d,
|
| 385 |
+
async:!0,
|
| 386 |
+
dataType:"json",
|
| 387 |
+
success:function(s) {
|
| 388 |
+
if(s == "wrong_nonce")
|
| 389 |
+
{
|
| 390 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 3);
|
| 391 |
+
return_value = !1;
|
| 392 |
+
sfsiplus_afterLoad();
|
| 393 |
+
}
|
| 394 |
+
else
|
| 395 |
+
{
|
| 396 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 3), sfsipluscollapse("#sfsi_plus_save3")) :(sfsiplus_showErrorSuc("error", "Unkown error , please try again", 3),
|
| 397 |
+
return_value = !1), sfsiplus_afterLoad();
|
| 398 |
+
}
|
| 399 |
+
}
|
| 400 |
+
});
|
| 401 |
+
}
|
| 402 |
+
function sfsi_plus_show_counts()
|
| 403 |
+
{
|
| 404 |
+
"yes" == SFSI("input[name='sfsi_plus_display_counts']:checked").val() ? (SFSI(".sfsiplus_count_sections").slideDown(),
|
| 405 |
+
sfsi_plus_showPreviewCounts()) :(SFSI(".sfsiplus_count_sections").slideUp(), sfsi_plus_showPreviewCounts());
|
| 406 |
+
}
|
| 407 |
+
function sfsi_plus_showPreviewCounts()
|
| 408 |
+
{
|
| 409 |
+
var s = 0;
|
| 410 |
+
1 == SFSI("input[name='sfsi_plus_rss_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_rss_countsDisplay").css("opacity", 1),
|
| 411 |
+
s = 1) :SFSI("#sfsi_plus_rss_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_email_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_email_countsDisplay").css("opacity", 1),
|
| 412 |
+
s = 1) :SFSI("#sfsi_plus_email_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity", 1),
|
| 413 |
+
s = 1) :SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_twitter_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_twitter_countsDisplay").css("opacity", 1),
|
| 414 |
+
s = 1) :SFSI("#sfsi_plus_twitter_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_google_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_google_countsDisplay").css("opacity", 1),
|
| 415 |
+
s = 1) :SFSI("#sfsi_plus_google_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_linkedIn_countsDisplay").css("opacity", 1),
|
| 416 |
+
s = 1) :SFSI("#sfsi_plus_linkedIn_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity", 1),
|
| 417 |
+
s = 1) :SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_pinterest_countsDisplay").css("opacity", 1),
|
| 418 |
+
s = 1) :SFSI("#sfsi_plus_pinterest_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_shares_countsDisplay").css("opacity", 1),
|
| 419 |
+
s = 1) :SFSI("#sfsi_plus_shares_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity", 1),
|
| 420 |
+
s = 1) :SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity", 0), 1 == SFSI("input[name='sfsi_plus_houzz_countsDisplay']").prop("checked") ? (SFSI("#sfsi_plus_houzz_countsDisplay").css("opacity", 1),
|
| 421 |
+
s = 1) :SFSI("#sfsi_plus_houzz_countsDisplay").css("opacity", 0), 0 == s || "no" == SFSI("input[name='sfsi_plus_display_counts']:checked").val() ? SFSI(".sfsi_Cdisplay").hide() :SFSI(".sfsi_Cdisplay").show();
|
| 422 |
+
}
|
| 423 |
+
function sfsi_plus_show_OnpostsDisplay()
|
| 424 |
+
{
|
| 425 |
+
//"yes" == SFSI("input[name='sfsi_plus_show_Onposts']:checked").val() ? SFSI(".sfsiplus_PostsSettings_section").slideDown() :SFSI(".sfsiplus_PostsSettings_section").slideUp();
|
| 426 |
+
}
|
| 427 |
+
function sfsi_plus_update_step4()
|
| 428 |
+
{
|
| 429 |
+
var nonce = SFSI("#sfsi_plus_save4").attr("data-nonce");
|
| 430 |
+
var s = !1, i = sfsi_plus_validationStep4();
|
| 431 |
+
if (!i) return global_error = 1, !1;
|
| 432 |
+
sfsiplus_beForeLoad();
|
| 433 |
+
var e = SFSI("input[name='sfsi_plus_display_counts']:checked").val(), t = 1 == SFSI("input[name='sfsi_plus_email_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_countsDisplay']:checked").val(), n = 1 == SFSI("input[name='sfsi_plus_email_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_countsFrom']:checked").val(), o = SFSI("input[name='sfsi_plus_email_manualCounts']").val(), a = SFSI("input[name='sfsi_plus_google_api_key']").val(), r = 1 == SFSI("input[name='sfsi_plus_rss_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_countsDisplay']:checked").val(), c = SFSI("input[name='sfsi_plus_rss_manualCounts']").val(), p = 1 == SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_countsDisplay']:checked").val(), _ = 1 == SFSI("input[name='sfsi_plus_facebook_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val(), mp = SFSI("input[name='sfsi_plus_facebook_mypageCounts']").val(), l = SFSI("input[name='sfsi_plus_facebook_manualCounts']").val(), S = 1 == SFSI("input[name='sfsi_plus_twitter_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_countsDisplay']:checked").val(), u = 1 == SFSI("input[name='sfsi_plus_twitter_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_countsFrom']:checked").val(), f = SFSI("input[name='sfsi_plus_twitter_manualCounts']").val(), d = SFSI("input[name='sfsiplus_tw_consumer_key']").val(), I = SFSI("input[name='sfsiplus_tw_consumer_secret']").val(), m = SFSI("input[name='sfsiplus_tw_oauth_access_token']").val(), F = SFSI("input[name='sfsiplus_tw_oauth_access_token_secret']").val(), h = 1 == SFSI("input[name='sfsi_plus_google_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_countsDisplay']:checked").val(), v = 1 == SFSI("input[name='sfsi_plus_google_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val(), g = SFSI("input[name='sfsi_plus_google_manualCounts']").val(), k = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val(), y = SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").val(), b = SFSI("input[name='sfsi_plus_ln_company']").val(), w = SFSI("input[name='sfsi_plus_ln_api_key']").val(), x = SFSI("input[name='sfsi_plus_ln_secret_key']").val(), C = SFSI("input[name='sfsi_plus_ln_oAuth_user_token']").val(), D = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsDisplay']:checked").val(), k = 1 == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val(), y = SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").val(), U = 1 == SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_countsDisplay']:checked").val(), O = 1 == SFSI("input[name='sfsi_plus_youtube_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_countsFrom']:checked").val(), T = SFSI("input[name='sfsi_plus_youtube_manualCounts']").val(), j = SFSI("input[name='sfsi_plus_youtube_user']").val(), P = 1 == SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_countsDisplay']:checked").val(), M = 1 == SFSI("input[name='sfsi_plus_pinterest_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_countsFrom']:checked").val(), L = SFSI("input[name='sfsi_plus_pinterest_manualCounts']").val(), B = SFSI("input[name='sfsi_plus_pinterest_user']").val(), E = SFSI("input[name='sfsi_plus_pinterest_board']").val(), z = 1 == SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_countsDisplay']:checked").val(), A = 1 == SFSI("input[name='sfsi_plus_instagram_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val(), N = SFSI("input[name='sfsi_plus_instagram_manualCounts']").val(), H = SFSI("input[name='sfsi_plus_instagram_User']").val(), R = 1 == SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_shares_countsDisplay']:checked").val(), W = 1 == SFSI("input[name='sfsi_plus_shares_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val(), q = SFSI("input[name='sfsi_plus_shares_manualCounts']").val(), houzzDisplay = 1 == SFSI("input[name='sfsi_plus_houzz_countsDisplay']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_countsDisplay']:checked").val(), houzzFrom = 1 == SFSI("input[name='sfsi_plus_houzz_countsFrom']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_countsFrom']:checked").val(), houzzCount = SFSI("input[name='sfsi_plus_houzz_manualCounts']").val(), $ = {
|
| 434 |
+
action:"plus_updateSrcn4",
|
| 435 |
+
sfsi_plus_display_counts:e,
|
| 436 |
+
sfsi_plus_email_countsDisplay:t,
|
| 437 |
+
sfsi_plus_email_countsFrom:n,
|
| 438 |
+
sfsi_plus_email_manualCounts:o,
|
| 439 |
+
sfsi_plus_rss_countsDisplay:r,
|
| 440 |
+
sfsi_plus_rss_manualCounts:c,
|
| 441 |
+
sfsi_plus_facebook_countsDisplay:p,
|
| 442 |
+
sfsi_plus_facebook_countsFrom:_,
|
| 443 |
+
sfsi_plus_facebook_mypageCounts:mp,
|
| 444 |
+
sfsi_plus_facebook_manualCounts:l,
|
| 445 |
+
sfsi_plus_twitter_countsDisplay:S,
|
| 446 |
+
sfsi_plus_twitter_countsFrom:u,
|
| 447 |
+
sfsi_plus_twitter_manualCounts:f,
|
| 448 |
+
sfsiplus_tw_consumer_key:d,
|
| 449 |
+
sfsiplus_tw_consumer_secret:I,
|
| 450 |
+
sfsiplus_tw_oauth_access_token:m,
|
| 451 |
+
sfsiplus_tw_oauth_access_token_secret:F,
|
| 452 |
+
sfsi_plus_google_countsDisplay:h,
|
| 453 |
+
sfsi_plus_google_countsFrom:v,
|
| 454 |
+
sfsi_plus_google_manualCounts:g,
|
| 455 |
+
sfsi_plus_google_api_key:a,
|
| 456 |
+
sfsi_plus_linkedIn_countsDisplay:D,
|
| 457 |
+
sfsi_plus_linkedIn_countsFrom:k,
|
| 458 |
+
sfsi_plus_linkedIn_manualCounts:y,
|
| 459 |
+
sfsi_plus_ln_company:b,
|
| 460 |
+
sfsi_plus_ln_api_key:w,
|
| 461 |
+
sfsi_plus_ln_secret_key:x,
|
| 462 |
+
sfsi_plus_ln_oAuth_user_token:C,
|
| 463 |
+
sfsi_plus_youtube_countsDisplay:U,
|
| 464 |
+
sfsi_plus_youtube_countsFrom:O,
|
| 465 |
+
sfsi_plus_youtube_manualCounts:T,
|
| 466 |
+
sfsi_plus_youtube_user:j,
|
| 467 |
+
sfsi_plus_youtube_channelId: SFSI("input[name='sfsi_plus_youtube_channelId']").val(),
|
| 468 |
+
sfsi_plus_pinterest_countsDisplay:P,
|
| 469 |
+
sfsi_plus_pinterest_countsFrom:M,
|
| 470 |
+
sfsi_plus_pinterest_manualCounts:L,
|
| 471 |
+
sfsi_plus_pinterest_user:B,
|
| 472 |
+
sfsi_plus_pinterest_board:E,
|
| 473 |
+
sfsi_plus_instagram_countsDisplay:z,
|
| 474 |
+
sfsi_plus_instagram_countsFrom:A,
|
| 475 |
+
sfsi_plus_instagram_manualCounts:N,
|
| 476 |
+
sfsi_plus_instagram_User:H,
|
| 477 |
+
sfsi_plus_instagram_clientid:SFSI("input[name='sfsi_plus_instagram_clientid']").val(),
|
| 478 |
+
sfsi_plus_instagram_appurl:SFSI("input[name='sfsi_plus_instagram_appurl']").val(),
|
| 479 |
+
sfsi_plus_instagram_token:SFSI("input[name='sfsi_plus_instagram_token']").val(),
|
| 480 |
+
sfsi_plus_shares_countsDisplay:R,
|
| 481 |
+
sfsi_plus_shares_countsFrom:W,
|
| 482 |
+
sfsi_plus_shares_manualCounts:q,
|
| 483 |
+
sfsi_plus_houzz_countsDisplay:houzzDisplay,
|
| 484 |
+
sfsi_plus_houzz_countsFrom:houzzFrom,
|
| 485 |
+
sfsi_plus_houzz_manualCounts:houzzCount,
|
| 486 |
+
nonce:nonce
|
| 487 |
+
};
|
| 488 |
+
return SFSI.ajax({
|
| 489 |
+
url:ajax_object.ajax_url,
|
| 490 |
+
type:"post",
|
| 491 |
+
data:$,
|
| 492 |
+
dataType:"json",
|
| 493 |
+
async:!0,
|
| 494 |
+
success:function(s) {
|
| 495 |
+
if(s == "wrong_nonce")
|
| 496 |
+
{
|
| 497 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 4);
|
| 498 |
+
global_error = 1;
|
| 499 |
+
sfsiplus_afterLoad();
|
| 500 |
+
}
|
| 501 |
+
else
|
| 502 |
+
{
|
| 503 |
+
"success" == s.res ? (sfsiplus_showErrorSuc("success", "Saved !", 4), sfsipluscollapse("#sfsi_plus_save4"),
|
| 504 |
+
sfsi_plus_showPreviewCounts()) :(sfsiplus_showErrorSuc("error", "Unkown error , please try again", 4),
|
| 505 |
+
global_error = 1), sfsiplus_afterLoad();
|
| 506 |
+
}
|
| 507 |
+
}
|
| 508 |
+
}), s;
|
| 509 |
+
}
|
| 510 |
+
function sfsi_plus_update_step5()
|
| 511 |
+
{
|
| 512 |
+
var nonce = SFSI("#sfsi_plus_save5").attr("data-nonce");
|
| 513 |
+
sfsi_plus_update_step3();
|
| 514 |
+
var s = sfsi_plus_validationStep5();
|
| 515 |
+
if (!s) return global_error = 1, !1;
|
| 516 |
+
sfsiplus_beForeLoad();
|
| 517 |
+
var i = SFSI("input[name='sfsi_plus_icons_size']").val(), e = SFSI("input[name='sfsi_plus_icons_perRow']").val(), t = SFSI("input[name='sfsi_plus_icons_spacing']").val(), n = SFSI("#sfsi_plus_icons_Alignment").val(),
|
| 518 |
+
followicon = SFSI("#sfsi_plus_follow_icons_language").val(),
|
| 519 |
+
facebookicon = SFSI("#sfsi_plus_facebook_icons_language").val(),
|
| 520 |
+
twittericon = SFSI("#sfsi_plus_twitter_icons_language").val(),
|
| 521 |
+
googleicon = SFSI("#sfsi_plus_google_icons_language").val(),
|
| 522 |
+
lang = SFSI("#sfsi_plus_icons_language").val(), o = SFSI("input[name='sfsi_plus_icons_ClickPageOpen']:checked").val(), a = SFSI("input[name='sfsi_plus_icons_float']:checked").val(), dsb = SFSI("input[name='sfsi_plus_disable_floaticons']:checked").val(), dsbv = SFSI("input[name='sfsi_plus_disable_viewport']:checked").val(), r = SFSI("#sfsi_plus_icons_floatPosition").val(), c = SFSI("input[name='sfsi_plus_icons_stick']:checked").val(), p = SFSI("#sfsi_plus_rssIcon_order").attr("data-index"), _ = SFSI("#sfsi_plus_emailIcon_order").attr("data-index"), l = SFSI("#sfsi_plus_googleIcon_order").attr("data-index"), S = SFSI("#sfsi_plus_facebookIcon_order").attr("data-index"), u = SFSI("#sfsi_plus_twitterIcon_order").attr("data-index"), f = SFSI("#sfsi_plus_youtubeIcon_order").attr("data-index"), d = SFSI("#sfsi_plus_pinterestIcon_order").attr("data-index"), I = SFSI("#sfsi_plus_instagramIcon_order").attr("data-index"), m = SFSI("#sfsi_plus_shareIcon_order").attr("data-index"), F = SFSI("#sfsi_plus_linkedinIcon_order").attr("data-index"), houzzOrder = SFSI("#sfsi_plus_houzzIcon_order").attr("data-index"), h = new Array();
|
| 523 |
+
SFSI(".sfsiplus_custom_iconOrder").each(function()
|
| 524 |
+
{
|
| 525 |
+
h.push({
|
| 526 |
+
order:SFSI(this).attr("data-index"),
|
| 527 |
+
ele:SFSI(this).attr("element-id")
|
| 528 |
+
});
|
| 529 |
+
});
|
| 530 |
+
var v = 1 == SFSI("input[name='sfsi_plus_rss_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_rss_MouseOverText']").val(), g = 1 == SFSI("input[name='sfsi_plus_email_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_email_MouseOverText']").val(), k = 1 == SFSI("input[name='sfsi_plus_twitter_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_twitter_MouseOverText']").val(), y = 1 == SFSI("input[name='sfsi_plus_facebook_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_facebook_MouseOverText']").val(), b = 1 == SFSI("input[name='sfsi_plus_google_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_google_MouseOverText']").val(), w = 1 == SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").val(), x = 1 == SFSI("input[name='sfsi_plus_youtube_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_youtube_MouseOverText']").val(), C = 1 == SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").val(), insD = 1 == SFSI("input[name='sfsi_plus_instagram_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_instagram_MouseOverText']").val(), D = 1 == SFSI("input[name='sfsi_plus_houzz_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_houzz_MouseOverText']").val(), U = 1 == SFSI("input[name='sfsi_plus_share_MouseOverText']").prop("disabled") ? "" :SFSI("input[name='sfsi_plus_share_MouseOverText']").val(), O = {};
|
| 531 |
+
SFSI("input[name='sfsi_plus_custom_MouseOverTexts[]']").each(function() {
|
| 532 |
+
O[SFSI(this).attr("file-id")] = this.value;
|
| 533 |
+
});
|
| 534 |
+
var T = {
|
| 535 |
+
action:"plus_updateSrcn5",
|
| 536 |
+
sfsi_plus_icons_size:i,
|
| 537 |
+
sfsi_plus_icons_Alignment:n,
|
| 538 |
+
sfsi_plus_icons_perRow:e,
|
| 539 |
+
sfsi_plus_follow_icons_language:followicon,
|
| 540 |
+
sfsi_plus_facebook_icons_language:facebookicon,
|
| 541 |
+
sfsi_plus_twitter_icons_language:twittericon,
|
| 542 |
+
sfsi_plus_google_icons_language:googleicon,
|
| 543 |
+
sfsi_plus_icons_language:lang,
|
| 544 |
+
sfsi_plus_icons_spacing:t,
|
| 545 |
+
sfsi_plus_icons_ClickPageOpen:o,
|
| 546 |
+
sfsi_plus_icons_float:a,
|
| 547 |
+
sfsi_plus_disable_floaticons:dsb,
|
| 548 |
+
sfsi_plus_disable_viewport: dsbv,
|
| 549 |
+
sfsi_plus_icons_floatPosition:r,
|
| 550 |
+
sfsi_plus_icons_stick:c,
|
| 551 |
+
sfsi_plus_rss_MouseOverText:v,
|
| 552 |
+
sfsi_plus_email_MouseOverText:g,
|
| 553 |
+
sfsi_plus_twitter_MouseOverText:k,
|
| 554 |
+
sfsi_plus_facebook_MouseOverText:y,
|
| 555 |
+
sfsi_plus_google_MouseOverText:b,
|
| 556 |
+
sfsi_plus_youtube_MouseOverText:x,
|
| 557 |
+
sfsi_plus_linkedIn_MouseOverText:w,
|
| 558 |
+
sfsi_plus_pinterest_MouseOverText:C,
|
| 559 |
+
sfsi_plus_share_MouseOverText:U,
|
| 560 |
+
sfsi_plus_instagram_MouseOverText:insD,
|
| 561 |
+
sfsi_plus_houzz_MouseOverText:D,
|
| 562 |
+
sfsi_plus_custom_MouseOverTexts:O,
|
| 563 |
+
sfsi_plus_rssIcon_order:p,
|
| 564 |
+
sfsi_plus_emailIcon_order:_,
|
| 565 |
+
sfsi_plus_facebookIcon_order:S,
|
| 566 |
+
sfsi_plus_twitterIcon_order:u,
|
| 567 |
+
sfsi_plus_googleIcon_order:l,
|
| 568 |
+
sfsi_plus_youtubeIcon_order:f,
|
| 569 |
+
sfsi_plus_pinterestIcon_order:d,
|
| 570 |
+
sfsi_plus_shareIcon_order:m,
|
| 571 |
+
sfsi_plus_instagramIcon_order:I,
|
| 572 |
+
sfsi_plus_houzzIcon_order:houzzOrder,
|
| 573 |
+
sfsi_plus_linkedinIcon_order:F,
|
| 574 |
+
sfsi_plus_custom_orders:h,
|
| 575 |
+
nonce:nonce
|
| 576 |
+
};
|
| 577 |
+
SFSI.ajax({
|
| 578 |
+
url:ajax_object.ajax_url,
|
| 579 |
+
type:"post",
|
| 580 |
+
data:T,
|
| 581 |
+
dataType:"json",
|
| 582 |
+
async:!0,
|
| 583 |
+
success:function(s) {
|
| 584 |
+
if(s == "wrong_nonce")
|
| 585 |
+
{
|
| 586 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 5);
|
| 587 |
+
global_error = 1;
|
| 588 |
+
sfsiplus_afterLoad();
|
| 589 |
+
}
|
| 590 |
+
else
|
| 591 |
+
{
|
| 592 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 5), sfsipluscollapse("#sfsi_plus_save5")) :(global_error = 1,
|
| 593 |
+
sfsiplus_showErrorSuc("error", "Unkown error , please try again", 5)), sfsiplus_afterLoad();
|
| 594 |
+
}
|
| 595 |
+
}
|
| 596 |
+
});
|
| 597 |
+
}
|
| 598 |
+
function sfsi_plus_update_step6()
|
| 599 |
+
{
|
| 600 |
+
var nonce = SFSI("#sfsi_plus_save6").attr("data-nonce");
|
| 601 |
+
sfsiplus_beForeLoad();
|
| 602 |
+
var s = SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(), i = SFSI("input[name='sfsi_plus_textBefor_icons']").val(), e = SFSI("#sfsi_plus_icons_alignment").val(), t = SFSI("#sfsi_plus_icons_DisplayCounts").val(), n = {
|
| 603 |
+
action:"plus_updateSrcn6",
|
| 604 |
+
sfsi_plus_show_Onposts:s,
|
| 605 |
+
sfsi_plus_icons_DisplayCounts:t,
|
| 606 |
+
sfsi_plus_icons_alignment:e,
|
| 607 |
+
sfsi_plus_textBefor_icons:i,
|
| 608 |
+
nonce:nonce
|
| 609 |
+
};
|
| 610 |
+
SFSI.ajax({
|
| 611 |
+
url:ajax_object.ajax_url,
|
| 612 |
+
type:"post",
|
| 613 |
+
data:n,
|
| 614 |
+
dataType:"json",
|
| 615 |
+
async:!0,
|
| 616 |
+
success:function(s) {
|
| 617 |
+
if(s == "wrong_nonce")
|
| 618 |
+
{
|
| 619 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 6);
|
| 620 |
+
global_error = 1;
|
| 621 |
+
sfsiplus_afterLoad();
|
| 622 |
+
}
|
| 623 |
+
else
|
| 624 |
+
{
|
| 625 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 6), sfsipluscollapse("#sfsi_plus_save6")) :(global_error = 1,
|
| 626 |
+
sfsiplus_showErrorSuc("error", "Unkown error , please try again", 6)), sfsiplus_afterLoad();
|
| 627 |
+
}
|
| 628 |
+
}
|
| 629 |
+
});
|
| 630 |
+
}
|
| 631 |
+
function sfsi_plus_update_step7()
|
| 632 |
+
{
|
| 633 |
+
var nonce = SFSI("#sfsi_plus_save7").attr("data-nonce");
|
| 634 |
+
var s = sfsi_plus_validationStep7();
|
| 635 |
+
if (!s) return global_error = 1, !1;
|
| 636 |
+
sfsiplus_beForeLoad();
|
| 637 |
+
var i = SFSI("input[name='sfsi_plus_popup_text']").val(), e = SFSI("#sfsi_plus_popup_font option:selected").val(), t = (SFSI("#sfsi_plus_popup_fontStyle option:selected").val(),
|
| 638 |
+
SFSI("input[name='sfsi_plus_popup_fontColor']").val()), n = SFSI("input[name='sfsi_plus_popup_fontSize']").val(), o = SFSI("input[name='sfsi_plus_popup_background_color']").val(), a = SFSI("input[name='sfsi_plus_popup_border_color']").val(), r = SFSI("input[name='sfsi_plus_popup_border_thickness']").val(), c = SFSI("input[name='sfsi_plus_popup_border_shadow']:checked").val(), p = SFSI("input[name='sfsi_plus_Show_popupOn']:checked").val(), _ = [];
|
| 639 |
+
SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s, i) {
|
| 640 |
+
_[s] = SFSI(i).val();
|
| 641 |
+
});
|
| 642 |
+
var l = SFSI("input[name='sfsi_plus_Shown_pop']:checked").val(), S = SFSI("input[name='sfsi_plus_Shown_popupOnceTime']").val(), u = SFSI("#sfsi_plus_Shown_popuplimitPerUserTime").val(), f = {
|
| 643 |
+
action:"plus_updateSrcn7",
|
| 644 |
+
sfsi_plus_popup_text:i,
|
| 645 |
+
sfsi_plus_popup_font:e,
|
| 646 |
+
sfsi_plus_popup_fontColor:t,
|
| 647 |
+
sfsi_plus_popup_fontSize:n,
|
| 648 |
+
sfsi_plus_popup_background_color:o,
|
| 649 |
+
sfsi_plus_popup_border_color:a,
|
| 650 |
+
sfsi_plus_popup_border_thickness:r,
|
| 651 |
+
sfsi_plus_popup_border_shadow:c,
|
| 652 |
+
sfsi_plus_Show_popupOn:p,
|
| 653 |
+
sfsi_plus_Show_popupOn_PageIDs:_,
|
| 654 |
+
sfsi_plus_Shown_pop:l,
|
| 655 |
+
sfsi_plus_Shown_popupOnceTime:S,
|
| 656 |
+
sfsi_plus_Shown_popuplimitPerUserTime:u,
|
| 657 |
+
nonce:nonce
|
| 658 |
+
};
|
| 659 |
+
SFSI.ajax({
|
| 660 |
+
url:ajax_object.ajax_url,
|
| 661 |
+
type:"post",
|
| 662 |
+
data:f,
|
| 663 |
+
dataType:"json",
|
| 664 |
+
async:!0,
|
| 665 |
+
success:function(s) {
|
| 666 |
+
if(s == "wrong_nonce")
|
| 667 |
+
{
|
| 668 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 7);
|
| 669 |
+
sfsiplus_afterLoad();
|
| 670 |
+
}
|
| 671 |
+
else
|
| 672 |
+
{
|
| 673 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 7), sfsipluscollapse("#sfsi_plus_save7")) :sfsiplus_showErrorSuc("error", "Unkown error , please try again", 7),
|
| 674 |
+
sfsiplus_afterLoad();
|
| 675 |
+
}
|
| 676 |
+
}
|
| 677 |
+
});
|
| 678 |
+
}
|
| 679 |
+
function sfsi_plus_update_step8()
|
| 680 |
+
{
|
| 681 |
+
var nonce = SFSI("#sfsi_plus_save8").attr("data-nonce");
|
| 682 |
+
var s = sfsi_plus_validationStep7();
|
| 683 |
+
s = true;
|
| 684 |
+
if (!s) return global_error = 1, !1;
|
| 685 |
+
sfsiplus_beForeLoad();
|
| 686 |
+
var i = SFSI("input[name='sfsi_plus_show_via_widget']:checked").val(),
|
| 687 |
+
e = SFSI("input[name='sfsi_plus_float_on_page']:checked").val(),
|
| 688 |
+
t = SFSI("input[name='sfsi_plus_float_page_position']:checked").val(),
|
| 689 |
+
n = SFSI("input[name='sfsi_plus_place_item_manually']:checked").val(),
|
| 690 |
+
o = SFSI("input[name='sfsi_plus_show_item_onposts']:checked").val(),
|
| 691 |
+
a = SFSI("input[name='sfsi_plus_display_button_type']:checked").val(),
|
| 692 |
+
r = SFSI("input[name='sfsi_plus_post_icons_size']").val(),
|
| 693 |
+
c = SFSI("input[name='sfsi_plus_post_icons_spacing']").val(),
|
| 694 |
+
p = SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(),
|
| 695 |
+
v = SFSI("input[name='sfsi_plus_textBefor_icons']").val(),
|
| 696 |
+
x = SFSI("#sfsi_plus_icons_alignment").val(),
|
| 697 |
+
z = SFSI("#sfsi_plus_icons_DisplayCounts").val(),
|
| 698 |
+
b = SFSI("input[name='sfsi_plus_display_before_posts']:checked").val(),
|
| 699 |
+
d = SFSI("input[name='sfsi_plus_display_after_posts']:checked").val(),
|
| 700 |
+
/*f = SFSI("input[name='sfsi_plus_display_on_postspage']:checked").val(),
|
| 701 |
+
g = SFSI("input[name='sfsi_plus_display_on_homepage']:checked").val(),*/
|
| 702 |
+
f = SFSI("input[name='sfsi_plus_display_before_blogposts']:checked").val(),
|
| 703 |
+
g = SFSI("input[name='sfsi_plus_display_after_blogposts']:checked").val(),
|
| 704 |
+
rsub = SFSI("input[name='sfsi_plus_rectsub']:checked").val(),
|
| 705 |
+
rfb = SFSI("input[name='sfsi_plus_rectfb']:checked").val(),
|
| 706 |
+
rgp = SFSI("input[name='sfsi_plus_rectgp']:checked").val(),
|
| 707 |
+
rshr = SFSI("input[name='sfsi_plus_rectshr']:checked").val(),
|
| 708 |
+
rtwr = SFSI("input[name='sfsi_plus_recttwtr']:checked").val(),
|
| 709 |
+
rpin = SFSI("input[name='sfsi_plus_rectpinit']:checked").val(),
|
| 710 |
+
rfbshare = SFSI("input[name='sfsi_plus_rectfbshare']:checked").val(),
|
| 711 |
+
_ = [];
|
| 712 |
+
/*SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s, i) {
|
| 713 |
+
_[s] = SFSI(i).val()
|
| 714 |
+
});*/
|
| 715 |
+
var mst = SFSI("input[name='sfsi_plus_icons_floatMargin_top']").val(), msb = SFSI("input[name='sfsi_plus_icons_floatMargin_bottom']").val(), msl = SFSI("input[name='sfsi_plus_icons_floatMargin_left']").val(), msr = SFSI("input[name='sfsi_plus_icons_floatMargin_right']").val();
|
| 716 |
+
|
| 717 |
+
var f = {
|
| 718 |
+
action: "plus_updateSrcn8",
|
| 719 |
+
sfsi_plus_show_via_widget: i,
|
| 720 |
+
sfsi_plus_float_on_page: e,
|
| 721 |
+
sfsi_plus_float_page_position: t,
|
| 722 |
+
sfsi_plus_icons_floatMargin_top:mst,
|
| 723 |
+
sfsi_plus_icons_floatMargin_bottom:msb,
|
| 724 |
+
sfsi_plus_icons_floatMargin_left:msl,
|
| 725 |
+
sfsi_plus_icons_floatMargin_right:msr,
|
| 726 |
+
sfsi_plus_place_item_manually: n,
|
| 727 |
+
sfsi_plus_show_item_onposts: o,
|
| 728 |
+
sfsi_plus_display_button_type: a,
|
| 729 |
+
sfsi_plus_post_icons_size: r,
|
| 730 |
+
sfsi_plus_post_icons_spacing: c,
|
| 731 |
+
sfsi_plus_show_Onposts: p,
|
| 732 |
+
sfsi_plus_textBefor_icons: v,
|
| 733 |
+
sfsi_plus_icons_alignment: x,
|
| 734 |
+
sfsi_plus_icons_DisplayCounts: z,
|
| 735 |
+
sfsi_plus_display_before_posts: b,
|
| 736 |
+
sfsi_plus_display_after_posts: d,
|
| 737 |
+
/*sfsi_plus_display_on_postspage: f,
|
| 738 |
+
sfsi_plus_display_on_homepage: g*/
|
| 739 |
+
sfsi_plus_display_before_blogposts: f,
|
| 740 |
+
sfsi_plus_display_after_blogposts: g,
|
| 741 |
+
sfsi_plus_rectsub: rsub,
|
| 742 |
+
sfsi_plus_rectfb: rfb,
|
| 743 |
+
sfsi_plus_rectgp: rgp,
|
| 744 |
+
sfsi_plus_rectshr: rshr,
|
| 745 |
+
sfsi_plus_recttwtr: rtwr,
|
| 746 |
+
sfsi_plus_rectpinit: rpin,
|
| 747 |
+
sfsi_plus_rectfbshare: rfbshare,
|
| 748 |
+
nonce:nonce
|
| 749 |
+
};
|
| 750 |
+
SFSI.ajax({
|
| 751 |
+
url: ajax_object.ajax_url,
|
| 752 |
+
type: "post",
|
| 753 |
+
data: f,
|
| 754 |
+
dataType: "json",
|
| 755 |
+
async: !0,
|
| 756 |
+
success: function(s) {
|
| 757 |
+
if(s == "wrong_nonce")
|
| 758 |
+
{
|
| 759 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 8);
|
| 760 |
+
sfsiplus_afterLoad();
|
| 761 |
+
}
|
| 762 |
+
else
|
| 763 |
+
{
|
| 764 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 8), sfsipluscollapse("#sfsi_plus_save8")) : sfsiplus_showErrorSuc("error", "Unkown error , please try again", 8), sfsiplus_afterLoad()
|
| 765 |
+
}
|
| 766 |
+
}
|
| 767 |
+
})
|
| 768 |
+
}
|
| 769 |
+
function sfsi_plus_update_step9()
|
| 770 |
+
{
|
| 771 |
+
var nonce = SFSI("#sfsi_plus_save9").attr("data-nonce");
|
| 772 |
+
sfsiplus_beForeLoad();
|
| 773 |
+
var ie = SFSI("input[name='sfsi_plus_form_adjustment']:checked").val(),
|
| 774 |
+
je = SFSI("input[name='sfsi_plus_form_height']").val(),
|
| 775 |
+
ke = SFSI("input[name='sfsi_plus_form_width']").val(),
|
| 776 |
+
le = SFSI("input[name='sfsi_plus_form_border']:checked").val(),
|
| 777 |
+
me = SFSI("input[name='sfsi_plus_form_border_thickness']").val(),
|
| 778 |
+
ne = SFSI("input[name='sfsi_plus_form_border_color']").val(),
|
| 779 |
+
oe = SFSI("input[name='sfsi_plus_form_background']").val(),
|
| 780 |
+
|
| 781 |
+
ae = SFSI("input[name='sfsi_plus_form_heading_text']").val(),
|
| 782 |
+
be = SFSI("#sfsi_plus_form_heading_font option:selected").val(),
|
| 783 |
+
ce = SFSI("#sfsi_plus_form_heading_fontstyle option:selected").val(),
|
| 784 |
+
de = SFSI("input[name='sfsi_plus_form_heading_fontcolor']").val(),
|
| 785 |
+
ee = SFSI("input[name='sfsi_plus_form_heading_fontsize']").val(),
|
| 786 |
+
fe = SFSI("#sfsi_plus_form_heading_fontalign option:selected").val(),
|
| 787 |
+
|
| 788 |
+
ue = SFSI("input[name='sfsi_plus_form_field_text']").val(),
|
| 789 |
+
ve = SFSI("#sfsi_plus_form_field_font option:selected").val(),
|
| 790 |
+
we = SFSI("#sfsi_plus_form_field_fontstyle option:selected").val(),
|
| 791 |
+
xe = SFSI("input[name='sfsi_plus_form_field_fontcolor']").val(),
|
| 792 |
+
ye = SFSI("input[name='sfsi_plus_form_field_fontsize']").val(),
|
| 793 |
+
ze = SFSI("#sfsi_plus_form_field_fontalign option:selected").val(),
|
| 794 |
+
|
| 795 |
+
i = SFSI("input[name='sfsi_plus_form_button_text']").val(),
|
| 796 |
+
j = SFSI("#sfsi_plus_form_button_font option:selected").val(),
|
| 797 |
+
k = SFSI("#sfsi_plus_form_button_fontstyle option:selected").val(),
|
| 798 |
+
l = SFSI("input[name='sfsi_plus_form_button_fontcolor']").val(),
|
| 799 |
+
m = SFSI("input[name='sfsi_plus_form_button_fontsize']").val(),
|
| 800 |
+
n = SFSI("#sfsi_plus_form_button_fontalign option:selected").val(),
|
| 801 |
+
o = SFSI("input[name='sfsi_plus_form_button_background']").val();
|
| 802 |
+
|
| 803 |
+
var f = {
|
| 804 |
+
action:"plus_updateSrcn9",
|
| 805 |
+
sfsi_plus_form_adjustment:ie,
|
| 806 |
+
sfsi_plus_form_height:je,
|
| 807 |
+
sfsi_plus_form_width:ke,
|
| 808 |
+
sfsi_plus_form_border:le,
|
| 809 |
+
sfsi_plus_form_border_thickness:me,
|
| 810 |
+
sfsi_plus_form_border_color: ne,
|
| 811 |
+
sfsi_plus_form_background: oe,
|
| 812 |
+
|
| 813 |
+
sfsi_plus_form_heading_text:ae,
|
| 814 |
+
sfsi_plus_form_heading_font:be,
|
| 815 |
+
sfsi_plus_form_heading_fontstyle:ce,
|
| 816 |
+
sfsi_plus_form_heading_fontcolor:de,
|
| 817 |
+
sfsi_plus_form_heading_fontsize:ee,
|
| 818 |
+
sfsi_plus_form_heading_fontalign:fe,
|
| 819 |
+
|
| 820 |
+
sfsi_plus_form_field_text:ue,
|
| 821 |
+
sfsi_plus_form_field_font:ve,
|
| 822 |
+
sfsi_plus_form_field_fontstyle:we,
|
| 823 |
+
sfsi_plus_form_field_fontcolor:xe,
|
| 824 |
+
sfsi_plus_form_field_fontsize:ye,
|
| 825 |
+
sfsi_plus_form_field_fontalign:ze,
|
| 826 |
+
|
| 827 |
+
sfsi_plus_form_button_text:i,
|
| 828 |
+
sfsi_plus_form_button_font:j,
|
| 829 |
+
sfsi_plus_form_button_fontstyle:k,
|
| 830 |
+
sfsi_plus_form_button_fontcolor:l,
|
| 831 |
+
sfsi_plus_form_button_fontsize:m,
|
| 832 |
+
sfsi_plus_form_button_fontalign:n,
|
| 833 |
+
sfsi_plus_form_button_background:o,
|
| 834 |
+
|
| 835 |
+
nonce:nonce
|
| 836 |
+
};
|
| 837 |
+
SFSI.ajax({
|
| 838 |
+
url:ajax_object.ajax_url,
|
| 839 |
+
type:"post",
|
| 840 |
+
data:f,
|
| 841 |
+
dataType:"json",
|
| 842 |
+
async:!0,
|
| 843 |
+
success:function(s) {
|
| 844 |
+
if(s == "wrong_nonce")
|
| 845 |
+
{
|
| 846 |
+
sfsiplus_showErrorSuc("error", "Unauthorised Request, Try again after refreshing page", 9);
|
| 847 |
+
sfsiplus_afterLoad();
|
| 848 |
+
}
|
| 849 |
+
else
|
| 850 |
+
{
|
| 851 |
+
"success" == s ? (sfsiplus_showErrorSuc("success", "Saved !", 9), sfsipluscollapse("#sfsi_plus_save9"), sfsi_plus_create_suscriber_form()) :sfsiplus_showErrorSuc("error", "Unkown error , please try again", 9),
|
| 852 |
+
sfsiplus_afterLoad();
|
| 853 |
+
}
|
| 854 |
+
}
|
| 855 |
+
});
|
| 856 |
+
}
|
| 857 |
+
function sfsiplus_afterIconSuccess(s)
|
| 858 |
+
{
|
| 859 |
+
if (s.res = "success") {
|
| 860 |
+
var i = s.key + 1, e = s.element, t = e + 1;
|
| 861 |
+
SFSI("#plus_total_cusotm_icons").val(s.element);
|
| 862 |
+
SFSI(".upload-overlay").hide("slow");
|
| 863 |
+
SFSI(".uperror").html("");
|
| 864 |
+
sfsiplus_showErrorSuc("success", "Custom Icon updated successfully", 1);
|
| 865 |
+
d = new Date();
|
| 866 |
+
|
| 867 |
+
SFSI("li.plus_custom:last-child").removeClass("bdr_btm_non");
|
| 868 |
+
SFSI("li.plus_custom:last-child").children("span.plus_custom-img").children("img").attr("src", s.img_path+ "?" + d.getTime());
|
| 869 |
+
SFSI("input[name=plussfsiICON_" + s.key + "]").removeAttr("ele-type");
|
| 870 |
+
SFSI("input[name=plussfsiICON_" + s.key + "]").removeAttr("isnew");
|
| 871 |
+
icons_name = SFSI("li.plus_custom:last-child").find("input.styled").attr("name");
|
| 872 |
+
var n = icons_name.split("_");
|
| 873 |
+
s.key = s.key, s.img_path += "?" + d.getTime(), 5 > e && SFSI(".plus_icn_listing").append('<li id="plus_c' + i + '" class="plus_custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="plussfsiICON_' + i + '" type="checkbox" value="yes" class="styled" style="display:none;" element-type="sfsiplus-cusotm-icon" isNew="yes" /></div> <span class="plus_custom-img"><img src="' + SFSI("#plugin_url").val() + 'images/custom.png" id="plus_CImg_' + i + '" /> </span> <span class="custom sfsiplus_custom-txt">Custom' + t + ' </span> <div class="sfsiplus_right_info"> <p><span>'+object_name1.It_depends+':</span> '+object_name1.Upload_a+'</p><div class="inputWrapper"></div></li>'),
|
| 874 |
+
SFSI(".sfsiplus_custom_section").show(), SFSI(".plus_custom-links").append(' <div class="row sfsiICON_' + s.key + ' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="' + s.img_path + "?" + d.getTime() + '" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom ' + e + '</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url sfsiplus_custom_section sfsiICON_' + s.key + '" ><label>Link :</label><input file-id="' + s.key + '" name="sfsi_plus_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');
|
| 875 |
+
var o = SFSI("div.plus_custom_m").find("div.mouseover_field").length;
|
| 876 |
+
SFSI("div.plus_custom_m").append(0 == o % 2 ? '<div class="clear"> </div> <div class="mouseover_field sfsiplus_custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>' :'<div class="cHover " ><div class="mouseover_field sfsiplus_custom_section sfsiICON_' + s.key + '"><label>Custom ' + e + ':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="' + s.key + '" /></div>'),
|
| 877 |
+
SFSI("ul.plus_share_icon_order").append('<li class="sfsiplus_custom_iconOrder sfsiICON_' + s.key + '" data-index="" element-id="' + s.key + '" id=""><a href="#" title="Custom Icon" ><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/></a></li>'),
|
| 878 |
+
SFSI("ul.plus_sfsi_sample_icons").append('<li class="sfsiICON_' + s.key + '" element-id="' + s.key + '" ><div><img src="' + s.img_path + '" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),
|
| 879 |
+
sfsi_plus_update_index(), plus_update_Sec5Iconorder(), sfsi_plus_update_step1(), sfsi_plus_update_step2(),
|
| 880 |
+
sfsi_plus_update_step5(), SFSI(".upload-overlay").css("pointer-events", "auto"), sfsi_plus_showPreviewCounts(),
|
| 881 |
+
sfsiplus_afterLoad();
|
| 882 |
+
}
|
| 883 |
+
}
|
| 884 |
+
function sfsiplus_beforeIconSubmit(s)
|
| 885 |
+
{
|
| 886 |
+
if (SFSI(".uperror").html("Uploading....."), window.File && window.FileReader && window.FileList && window.Blob) {
|
| 887 |
+
SFSI(s).val() || SFSI(".uperror").html("File is empty");
|
| 888 |
+
var i = s.files[0].size, e = s.files[0].type;
|
| 889 |
+
switch (e) {
|
| 890 |
+
case "image/png":
|
| 891 |
+
case "image/gif":
|
| 892 |
+
case "image/jpeg":
|
| 893 |
+
case "image/pjpeg":
|
| 894 |
+
break;
|
| 895 |
+
|
| 896 |
+
default:
|
| 897 |
+
return SFSI(".uperror").html("Unsupported file"), !1;
|
| 898 |
+
}
|
| 899 |
+
return i > 1048576 ? (SFSI(".uperror").html("Image should be less than 1 MB"), !1) :!0;
|
| 900 |
+
}
|
| 901 |
+
return !0;
|
| 902 |
+
}
|
| 903 |
+
function sfsiplus_bytesToSize(s)
|
| 904 |
+
{
|
| 905 |
+
var i = [ "Bytes", "KB", "MB", "GB", "TB" ];
|
| 906 |
+
if (0 == s) return "0 Bytes";
|
| 907 |
+
var e = parseInt(Math.floor(Math.log(s) / Math.log(1024)));
|
| 908 |
+
return Math.round(s / Math.pow(1024, e), 2) + " " + i[e];
|
| 909 |
+
}
|
| 910 |
+
function sfsiplus_showErrorSuc(s, i, e)
|
| 911 |
+
{
|
| 912 |
+
if ("error" == s) var t = "errorMsg"; else var t = "sucMsg";
|
| 913 |
+
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
| 914 |
+
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function() {
|
| 915 |
+
SFSI("." + t).slideUp("slow");
|
| 916 |
+
}, 5e3), !1;
|
| 917 |
+
}
|
| 918 |
+
function sfsiplus_beForeLoad()
|
| 919 |
+
{
|
| 920 |
+
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events","none");
|
| 921 |
+
}
|
| 922 |
+
function sfsiplus_afterLoad()
|
| 923 |
+
{
|
| 924 |
+
SFSI("input").removeClass("inputError"), SFSI(".save_button >a").html(object_name.Sa_ve),
|
| 925 |
+
SFSI(".tab10>div.save_button >a").html(object_name1.Save_All_Settings),
|
| 926 |
+
SFSI(".save_button >a").css("pointer-events", "auto"), SFSI(".save_button >a").removeAttr("onclick"),
|
| 927 |
+
SFSI(".loader-img").hide();
|
| 928 |
+
}
|
| 929 |
+
function sfsi_plus_make_popBox()
|
| 930 |
+
{
|
| 931 |
+
var s = 0;
|
| 932 |
+
SFSI(".plus_sfsi_sample_icons >li").each(function() {
|
| 933 |
+
"none" != SFSI(this).css("display") && (s = 1);
|
| 934 |
+
}), 0 == s ? SFSI(".sfsi_plus_Popinner").hide() :SFSI(".sfsi_plus_Popinner").show(), "" != SFSI('input[name="sfsi_plus_popup_text"]').val() ? (SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),
|
| 935 |
+
SFSI(".sfsi_plus_Popinner >h2").show()) :SFSI(".sfsi_plus_Popinner >h2").hide(), SFSI(".sfsi_plus_Popinner").css({
|
| 936 |
+
"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),
|
| 937 |
+
"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),
|
| 938 |
+
"border-style":"solid"
|
| 939 |
+
}), SFSI(".sfsi_plus_Popinner").css("background-color", SFSI('input[name="sfsi_plus_popup_background_color"]').val()),
|
| 940 |
+
SFSI(".sfsi_plus_Popinner h2").css("font-family", SFSI("#sfsi_plus_popup_font").val()), SFSI(".sfsi_plus_Popinner h2").css("font-style", SFSI("#sfsi_plus_popup_fontStyle").val()),
|
| 941 |
+
SFSI(".sfsi_plus_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),
|
| 942 |
+
SFSI(".sfsi_plus_Popinner >h2").css("color", SFSI('input[name="sfsi_plus_popup_fontColor"]').val() + " !important"),
|
| 943 |
+
"yes" == SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_plus_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") :SFSI(".sfsi_plus_Popinner").css("box-shadow", "none");
|
| 944 |
+
}
|
| 945 |
+
function sfsi_plus_stick_widget(s)
|
| 946 |
+
{
|
| 947 |
+
0 == sfsiplus_initTop.length && (SFSI(".sfsi_plus_widget").each(function(s) {
|
| 948 |
+
sfsiplus_initTop[s] = SFSI(this).position().top;
|
| 949 |
+
}), console.log(sfsiplus_initTop));
|
| 950 |
+
var i = SFSI(window).scrollTop(), e = [], t = [];
|
| 951 |
+
SFSI(".sfsi_plus_widget").each(function(s) {
|
| 952 |
+
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
| 953 |
+
});
|
| 954 |
+
var n = !1;
|
| 955 |
+
for (var o in e) {
|
| 956 |
+
var a = parseInt(o) + 1;
|
| 957 |
+
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
| 958 |
+
position:"fixed",
|
| 959 |
+
top:s
|
| 960 |
+
}), SFSI(t[a]).css({
|
| 961 |
+
position:"",
|
| 962 |
+
top:sfsiplus_initTop[a]
|
| 963 |
+
}), n = !0) :SFSI(t[o]).css({
|
| 964 |
+
position:"",
|
| 965 |
+
top:sfsiplus_initTop[o]
|
| 966 |
+
});
|
| 967 |
+
}
|
| 968 |
+
if (!n) {
|
| 969 |
+
var r = e.length - 1, c = -1;
|
| 970 |
+
e.length > 1 && (c = e.length - 2), sfsiplus_initTop[r] < i ? (SFSI(t[r]).css({
|
| 971 |
+
position:"fixed",
|
| 972 |
+
top:s
|
| 973 |
+
}), c >= 0 && SFSI(t[c]).css({
|
| 974 |
+
position:"",
|
| 975 |
+
top:sfsiplus_initTop[c]
|
| 976 |
+
})) :(SFSI(t[r]).css({
|
| 977 |
+
position:"",
|
| 978 |
+
top:sfsiplus_initTop[r]
|
| 979 |
+
}), c >= 0 && e[c] < i);
|
| 980 |
+
}
|
| 981 |
+
}
|
| 982 |
+
function sfsi_plus_setCookie(s, i, e)
|
| 983 |
+
{
|
| 984 |
+
var t = new Date();
|
| 985 |
+
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
| 986 |
+
var n = "expires=" + t.toGMTString();
|
| 987 |
+
document.cookie = s + "=" + i + "; " + n;
|
| 988 |
+
}
|
| 989 |
+
function sfsfi_plus_getCookie(s)
|
| 990 |
+
{
|
| 991 |
+
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
| 992 |
+
var n = e[t].trim();
|
| 993 |
+
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
| 994 |
+
}
|
| 995 |
+
return "";
|
| 996 |
+
}
|
| 997 |
+
function sfsi_plus_hideFooter() {}
|
| 998 |
+
|
| 999 |
+
window.onerror = function() {}, SFSI = jQuery.noConflict(), SFSI(window).load(function() {
|
| 1000 |
+
SFSI("#sfpluspageLoad").fadeOut(2e3);
|
| 1001 |
+
});
|
| 1002 |
+
|
| 1003 |
+
//changes done {Monad}
|
| 1004 |
+
function sfsi_plus_selectText(containerid) {
|
| 1005 |
+
if (document.selection) {
|
| 1006 |
+
var range = document.body.createTextRange();
|
| 1007 |
+
range.moveToElementText(document.getElementById(containerid));
|
| 1008 |
+
range.select();
|
| 1009 |
+
} else if (window.getSelection()) {
|
| 1010 |
+
var range = document.createRange();
|
| 1011 |
+
range.selectNode(document.getElementById(containerid));
|
| 1012 |
+
window.getSelection().removeAllRanges();
|
| 1013 |
+
window.getSelection().addRange(range);
|
| 1014 |
+
}
|
| 1015 |
+
}
|
| 1016 |
+
function sfsi_plus_create_suscriber_form()
|
| 1017 |
+
{
|
| 1018 |
+
//Popbox customization
|
| 1019 |
+
"no" == SFSI('input[name="sfsi_plus_form_adjustment"]:checked').val() ? SFSI(".sfsi_plus_subscribe_Popinner").css({"width": parseInt(SFSI('input[name="sfsi_plus_form_width"]').val()),"height":parseInt(SFSI('input[name="sfsi_plus_form_height"]').val())}) : SFSI(".sfsi_plus_subscribe_Popinner").css({"width": '',"height": ''});
|
| 1020 |
+
|
| 1021 |
+
"yes" == SFSI('input[name="sfsi_plus_form_adjustment"]:checked').val() ? SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").css({"width": "100%"}): '';
|
| 1022 |
+
|
| 1023 |
+
"yes" == SFSI('input[name="sfsi_plus_form_border"]:checked').val() ? SFSI(".sfsi_plus_subscribe_Popinner").css({"border": SFSI('input[name="sfsi_plus_form_border_thickness"]').val()+"px solid "+SFSI('input[name="sfsi_plus_form_border_color"]').val()}) : SFSI(".sfsi_plus_subscribe_Popinner").css("border", "none");
|
| 1024 |
+
|
| 1025 |
+
SFSI('input[name="sfsi_plus_form_background"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").css("background-color", SFSI('input[name="sfsi_plus_form_background"]').val())) : '';
|
| 1026 |
+
|
| 1027 |
+
//Heading customization
|
| 1028 |
+
SFSI('input[name="sfsi_plus_form_heading_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").html(SFSI('input[name="sfsi_plus_form_heading_text"]').val())) : SFSI(".sfsi_plus_subscribe_Popinner > form > h5").html('');
|
| 1029 |
+
|
| 1030 |
+
SFSI('#sfsi_plus_form_heading_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-family", SFSI("#sfsi_plus_form_heading_font").val())) : '';
|
| 1031 |
+
|
| 1032 |
+
if(SFSI('#sfsi_plus_form_heading_fontstyle').val() != 'bold')
|
| 1033 |
+
{
|
| 1034 |
+
SFSI('#sfsi_plus_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-style", SFSI("#sfsi_plus_form_heading_fontstyle").val())) : '';
|
| 1035 |
+
SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-weight", '');
|
| 1036 |
+
}
|
| 1037 |
+
else
|
| 1038 |
+
{
|
| 1039 |
+
SFSI('#sfsi_plus_form_heading_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-weight","bold")) : '';
|
| 1040 |
+
SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("font-style", '');
|
| 1041 |
+
}
|
| 1042 |
+
|
| 1043 |
+
SFSI('input[name="sfsi_plus_form_heading_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("color", SFSI('input[name="sfsi_plus_form_heading_fontcolor"]').val())) : '';
|
| 1044 |
+
|
| 1045 |
+
SFSI('input[name="sfsi_plus_form_heading_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_heading_fontsize"]').val())})) : '';
|
| 1046 |
+
|
| 1047 |
+
SFSI('#sfsi_plus_form_heading_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner > form > h5").css("text-align", SFSI("#sfsi_plus_form_heading_fontalign").val())) : '';
|
| 1048 |
+
|
| 1049 |
+
//Field customization
|
| 1050 |
+
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').attr("placeholder", '');
|
| 1051 |
+
|
| 1052 |
+
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".sfsi_plus_left_container > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".sfsi_plus_left_container > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
| 1053 |
+
|
| 1054 |
+
SFSI('input[name="sfsi_plus_form_field_text"]').val() != "" ? (SFSI(".like_pop_box > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val(SFSI('input[name="sfsi_plus_form_field_text"]').val())) : SFSI(".like_pop_box > .sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').val('');
|
| 1055 |
+
|
| 1056 |
+
SFSI('#sfsi_plus_form_field_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-family", SFSI("#sfsi_plus_form_field_font").val())) : '';
|
| 1057 |
+
|
| 1058 |
+
if(SFSI('#sfsi_plus_form_field_fontstyle').val() != "bold")
|
| 1059 |
+
{
|
| 1060 |
+
SFSI('#sfsi_plus_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", SFSI("#sfsi_plus_form_field_fontstyle").val())) : '';
|
| 1061 |
+
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", '');
|
| 1062 |
+
}
|
| 1063 |
+
else
|
| 1064 |
+
{
|
| 1065 |
+
SFSI('#sfsi_plus_form_field_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-weight", 'bold')) : '';
|
| 1066 |
+
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("font-style", '');
|
| 1067 |
+
}
|
| 1068 |
+
|
| 1069 |
+
SFSI('input[name="sfsi_plus_form_field_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("color", SFSI('input[name="sfsi_plus_form_field_fontcolor"]').val())) : '';
|
| 1070 |
+
|
| 1071 |
+
SFSI('input[name="sfsi_plus_form_field_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_field_fontsize"]').val())})) : '';
|
| 1072 |
+
|
| 1073 |
+
SFSI('#sfsi_plus_form_field_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="data[Widget][email]"]').css("text-align", SFSI("#sfsi_plus_form_field_fontalign").val())) : '';
|
| 1074 |
+
|
| 1075 |
+
//Button customization
|
| 1076 |
+
SFSI('input[name="sfsi_plus_form_button_text"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').attr("value", SFSI('input[name="sfsi_plus_form_button_text"]').val())) : '';
|
| 1077 |
+
|
| 1078 |
+
SFSI('#sfsi_plus_form_button_font').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-family", SFSI("#sfsi_plus_form_button_font").val())) : '';
|
| 1079 |
+
|
| 1080 |
+
if(SFSI('#sfsi_plus_form_button_fontstyle').val() != "bold")
|
| 1081 |
+
{
|
| 1082 |
+
SFSI('#sfsi_plus_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", SFSI("#sfsi_plus_form_button_fontstyle").val())) : '';
|
| 1083 |
+
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", '');
|
| 1084 |
+
}
|
| 1085 |
+
else
|
| 1086 |
+
{
|
| 1087 |
+
SFSI('#sfsi_plus_form_button_fontstyle').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-weight", 'bold')) : '';
|
| 1088 |
+
SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("font-style", '');
|
| 1089 |
+
}
|
| 1090 |
+
|
| 1091 |
+
SFSI('input[name="sfsi_plus_form_button_fontcolor"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("color", SFSI('input[name="sfsi_plus_form_button_fontcolor"]').val())) : '';
|
| 1092 |
+
|
| 1093 |
+
SFSI('input[name="sfsi_plus_form_button_fontsize"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css({"font-size": parseInt(SFSI('input[name="sfsi_plus_form_button_fontsize"]').val())})) : '';
|
| 1094 |
+
|
| 1095 |
+
SFSI('#sfsi_plus_form_button_fontalign').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("text-align", SFSI("#sfsi_plus_form_button_fontalign").val())) : '';
|
| 1096 |
+
|
| 1097 |
+
SFSI('input[name="sfsi_plus_form_button_background"]').val() != "" ? (SFSI(".sfsi_plus_subscribe_Popinner").find('input[name="subscribe"]').css("background-color", SFSI('input[name="sfsi_plus_form_button_background"]').val())) : '';
|
| 1098 |
+
|
| 1099 |
+
var innerHTML = SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").html();
|
| 1100 |
+
var styleCss = SFSI(".sfsi_plus_html > .sfsi_plus_subscribe_Popinner").attr("style");
|
| 1101 |
+
innerHTML = '<div style="'+styleCss+'">'+innerHTML+'</div>';
|
| 1102 |
+
SFSI(".sfsi_plus_subscription_html > xmp").html(innerHTML);
|
| 1103 |
+
|
| 1104 |
+
/*var data = {
|
| 1105 |
+
action:"getForm",
|
| 1106 |
+
heading: SFSI('input[name="sfsi_plus_form_heading_text"]').val(),
|
| 1107 |
+
placeholder:SFSI('input[name="sfsi_plus_form_field_text"]').val(),
|
| 1108 |
+
button:SFSI('input[name="sfsi_plus_form_button_text"]').val()
|
| 1109 |
+
};
|
| 1110 |
+
SFSI.ajax({
|
| 1111 |
+
url:ajax_object.ajax_url,
|
| 1112 |
+
type:"post",
|
| 1113 |
+
data:data,
|
| 1114 |
+
success:function(s) {
|
| 1115 |
+
SFSI(".sfsi_plus_subscription_html").html(s);
|
| 1116 |
+
}
|
| 1117 |
+
});*/
|
| 1118 |
+
}
|
| 1119 |
+
|
| 1120 |
+
var global_error = 0;
|
| 1121 |
+
SFSI(document).ready(function(s) {
|
| 1122 |
+
//changes done {Monad}
|
| 1123 |
+
|
| 1124 |
+
SFSI(".lanOnchange").change(function(){
|
| 1125 |
+
var currentDrpdown = SFSI(this).parents(".icons_size");
|
| 1126 |
+
var data = {
|
| 1127 |
+
action:"getIconPreview",
|
| 1128 |
+
iconValue: SFSI(this).val(),
|
| 1129 |
+
iconname: SFSI(this).attr( "data-iconUrl" )
|
| 1130 |
+
};
|
| 1131 |
+
SFSI.ajax({
|
| 1132 |
+
url:ajax_object.ajax_url,
|
| 1133 |
+
type:"post",
|
| 1134 |
+
data:data,
|
| 1135 |
+
success:function(s) {
|
| 1136 |
+
currentDrpdown.children(".social-img-link").html(s);
|
| 1137 |
+
}
|
| 1138 |
+
});
|
| 1139 |
+
});
|
| 1140 |
+
|
| 1141 |
+
SFSI(".sfsiplus_tab_3_icns").on("click", ".cstomskins_upload", function() {
|
| 1142 |
+
SFSI(".cstmskins-overlay").show("slow", function() {
|
| 1143 |
+
e = 0;
|
| 1144 |
+
});
|
| 1145 |
+
});
|
| 1146 |
+
/*SFSI("#custmskin_clspop").live("click", function() {*/
|
| 1147 |
+
SFSI(document).on("click", '#custmskin_clspop', function () {
|
| 1148 |
+
SFSI_plus_done();
|
| 1149 |
+
SFSI(".cstmskins-overlay").hide("slow");
|
| 1150 |
+
});
|
| 1151 |
+
|
| 1152 |
+
sfsi_plus_create_suscriber_form();
|
| 1153 |
+
|
| 1154 |
+
SFSI('input[name="sfsi_plus_form_heading_text"], input[name="sfsi_plus_form_border_thickness"], input[name="sfsi_plus_form_height"], input[name="sfsi_plus_form_width"], input[name="sfsi_plus_form_heading_fontsize"], input[name="sfsi_plus_form_field_text"], input[name="sfsi_plus_form_field_fontsize"], input[name="sfsi_plus_form_button_text"], input[name="sfsi_plus_form_button_fontsize"]').on("keyup", sfsi_plus_create_suscriber_form);
|
| 1155 |
+
|
| 1156 |
+
SFSI('input[name="sfsi_plus_form_border_color"], input[name="sfsi_plus_form_background"] ,input[name="sfsi_plus_form_heading_fontcolor"], input[name="sfsi_plus_form_field_fontcolor"] ,input[name="sfsi_plus_form_button_fontcolor"],input[name="sfsi_plus_form_button_background"]').on("focus", sfsi_plus_create_suscriber_form);
|
| 1157 |
+
|
| 1158 |
+
SFSI("#sfsi_plus_form_heading_font, #sfsi_plus_form_heading_fontstyle, #sfsi_plus_form_heading_fontalign, #sfsi_plus_form_field_font, #sfsi_plus_form_field_fontstyle, #sfsi_plus_form_field_fontalign, #sfsi_plus_form_button_font, #sfsi_plus_form_button_fontstyle, #sfsi_plus_form_button_fontalign").on("change", sfsi_plus_create_suscriber_form );
|
| 1159 |
+
|
| 1160 |
+
/*SFSI(".radio").live("click", function() {*/
|
| 1161 |
+
SFSI(document).on("click", '.radio', function () {
|
| 1162 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1163 |
+
switch(s.attr("name")) {
|
| 1164 |
+
case 'sfsi_plus_form_adjustment':
|
| 1165 |
+
if(s.val() == 'no')
|
| 1166 |
+
s.parents(".row_tab").next(".row_tab").show("fast");
|
| 1167 |
+
else
|
| 1168 |
+
s.parents(".row_tab").next(".row_tab").hide("fast");
|
| 1169 |
+
sfsi_plus_create_suscriber_form()
|
| 1170 |
+
break;
|
| 1171 |
+
case 'sfsi_plus_form_border':
|
| 1172 |
+
if(s.val() == 'yes')
|
| 1173 |
+
s.parents(".row_tab").next(".row_tab").show("fast");
|
| 1174 |
+
else
|
| 1175 |
+
s.parents(".row_tab").next(".row_tab").hide("fast");
|
| 1176 |
+
sfsi_plus_create_suscriber_form()
|
| 1177 |
+
break;
|
| 1178 |
+
default:
|
| 1179 |
+
}
|
| 1180 |
+
});
|
| 1181 |
+
|
| 1182 |
+
//pooja 28-12-2015
|
| 1183 |
+
SFSI('#sfsi_plus_form_border_color').wpColorPicker({
|
| 1184 |
+
defaultColor: false,
|
| 1185 |
+
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1186 |
+
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1187 |
+
hide: true,
|
| 1188 |
+
palettes: true
|
| 1189 |
+
}),
|
| 1190 |
+
SFSI('#sfsi_plus_form_background').wpColorPicker({
|
| 1191 |
+
defaultColor: false,
|
| 1192 |
+
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1193 |
+
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1194 |
+
hide: true,
|
| 1195 |
+
palettes: true
|
| 1196 |
+
}),
|
| 1197 |
+
SFSI('#sfsi_plus_form_heading_fontcolor').wpColorPicker({
|
| 1198 |
+
defaultColor: false,
|
| 1199 |
+
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1200 |
+
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1201 |
+
hide: true,
|
| 1202 |
+
palettes: true
|
| 1203 |
+
}),
|
| 1204 |
+
SFSI('#sfsi_plus_form_button_fontcolor').wpColorPicker({
|
| 1205 |
+
defaultColor: false,
|
| 1206 |
+
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1207 |
+
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1208 |
+
hide: true,
|
| 1209 |
+
palettes: true
|
| 1210 |
+
}),
|
| 1211 |
+
SFSI('#sfsi_plus_form_button_background').wpColorPicker({
|
| 1212 |
+
defaultColor: false,
|
| 1213 |
+
change: function(event, ui){sfsi_plus_create_suscriber_form()},
|
| 1214 |
+
clear: function() {sfsi_plus_create_suscriber_form()},
|
| 1215 |
+
hide: true,
|
| 1216 |
+
palettes: true
|
| 1217 |
+
});
|
| 1218 |
+
/*SFSI("#sfsiPlusFormBorderColor").ColorPicker({
|
| 1219 |
+
color:"#f80000",
|
| 1220 |
+
onBeforeShow:function() {
|
| 1221 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_border_color").val());
|
| 1222 |
+
},
|
| 1223 |
+
onShow:function(s) {
|
| 1224 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1225 |
+
},
|
| 1226 |
+
onHide:function(s) {
|
| 1227 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1228 |
+
},
|
| 1229 |
+
onChange:function(s, i) {
|
| 1230 |
+
SFSI("#sfsi_plus_form_border_color").val("#" + i), SFSI("#sfsiPlusFormBorderColor").css("background", "#" + i);
|
| 1231 |
+
sfsi_plus_create_suscriber_form();
|
| 1232 |
+
},
|
| 1233 |
+
onClick:function(s, i) {
|
| 1234 |
+
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiPlusFormBorderColor").css("background", "#" + i);
|
| 1235 |
+
sfsi_plus_create_suscriber_form();
|
| 1236 |
+
}
|
| 1237 |
+
}),
|
| 1238 |
+
SFSI("#sfsiPlusFormBackground").ColorPicker({
|
| 1239 |
+
color:"#f80000",
|
| 1240 |
+
onBeforeShow:function() {
|
| 1241 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_background").val());
|
| 1242 |
+
},
|
| 1243 |
+
onShow:function(s) {
|
| 1244 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1245 |
+
},
|
| 1246 |
+
onHide:function(s) {
|
| 1247 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1248 |
+
},
|
| 1249 |
+
onChange:function(s, i) {
|
| 1250 |
+
SFSI("#sfsi_plus_form_background").val("#" + i), SFSI("#sfsiPlusFormBackground").css("background", "#" + i);
|
| 1251 |
+
sfsi_plus_create_suscriber_form();
|
| 1252 |
+
},
|
| 1253 |
+
onClick:function(s, i) {
|
| 1254 |
+
SFSI("#sfsi_plus_form_background").val("#" + i), SFSI("#sfsiPlusFormBackground").css("background", "#" + i);
|
| 1255 |
+
sfsi_plus_create_suscriber_form();
|
| 1256 |
+
}
|
| 1257 |
+
}),
|
| 1258 |
+
SFSI("#sfsiPlusFormHeadingFontcolor").ColorPicker({
|
| 1259 |
+
color:"#f80000",
|
| 1260 |
+
onBeforeShow:function() {
|
| 1261 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_heading_fontcolor").val());
|
| 1262 |
+
},
|
| 1263 |
+
onShow:function(s) {
|
| 1264 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1265 |
+
},
|
| 1266 |
+
onHide:function(s) {
|
| 1267 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1268 |
+
},
|
| 1269 |
+
onChange:function(s, i) {
|
| 1270 |
+
SFSI("#sfsi_plus_form_heading_fontcolor").val("#"+i), SFSI("#sfsiPlusFormHeadingFontcolor").css("background","#"+i);
|
| 1271 |
+
sfsi_plus_create_suscriber_form();
|
| 1272 |
+
},
|
| 1273 |
+
onClick:function(s, i) {
|
| 1274 |
+
SFSI("#sfsi_plus_form_heading_fontcolor").val("#"+i), SFSI("#sfsiPlusFormHeadingFontcolor").css("background","#"+i);
|
| 1275 |
+
sfsi_plus_create_suscriber_form();
|
| 1276 |
+
}
|
| 1277 |
+
}),
|
| 1278 |
+
SFSI("#sfsiPlusFormFieldFontcolor").ColorPicker({
|
| 1279 |
+
color:"#f80000",
|
| 1280 |
+
onBeforeShow:function() {
|
| 1281 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_field_fontcolor").val());
|
| 1282 |
+
},
|
| 1283 |
+
onShow:function(s) {
|
| 1284 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1285 |
+
},
|
| 1286 |
+
onHide:function(s) {
|
| 1287 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1288 |
+
},
|
| 1289 |
+
onChange:function(s, i) {
|
| 1290 |
+
SFSI("#sfsi_plus_form_field_fontcolor").val("#" + i), SFSI("#sfsiPlusFormFieldFontcolor").css("background", "#" +i);
|
| 1291 |
+
sfsi_plus_create_suscriber_form();
|
| 1292 |
+
},
|
| 1293 |
+
onClick:function(s, i) {
|
| 1294 |
+
SFSI("#sfsi_plus_form_field_fontcolor").val("#" + i), SFSI("#sfsiPlusFormFieldFontcolor").css("background", "#" +i);
|
| 1295 |
+
sfsi_plus_create_suscriber_form();
|
| 1296 |
+
}
|
| 1297 |
+
}),
|
| 1298 |
+
SFSI("#sfsiPlusFormButtonFontcolor").ColorPicker({
|
| 1299 |
+
color:"#f80000",
|
| 1300 |
+
onBeforeShow:function() {
|
| 1301 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_button_fontcolor").val());
|
| 1302 |
+
},
|
| 1303 |
+
onShow:function(s) {
|
| 1304 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1305 |
+
},
|
| 1306 |
+
onHide:function(s) {
|
| 1307 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1308 |
+
},
|
| 1309 |
+
onChange:function(s, i) {
|
| 1310 |
+
SFSI("#sfsi_plus_form_button_fontcolor").val("#"+i), SFSI("#sfsiPlusFormButtonFontcolor").css("background", "#"+i);
|
| 1311 |
+
sfsi_plus_create_suscriber_form();
|
| 1312 |
+
},
|
| 1313 |
+
onClick:function(s, i) {
|
| 1314 |
+
SFSI("#sfsi_plus_form_button_fontcolor").val("#"+i), SFSI("#sfsiPlusFormButtonFontcolor").css("background", "#"+i);
|
| 1315 |
+
sfsi_plus_create_suscriber_form();
|
| 1316 |
+
}
|
| 1317 |
+
}),
|
| 1318 |
+
SFSI("#sfsiPlusFormButtonBackground").ColorPicker({
|
| 1319 |
+
color:"#f80000",
|
| 1320 |
+
onBeforeShow:function() {
|
| 1321 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_form_button_background").val());
|
| 1322 |
+
},
|
| 1323 |
+
onShow:function(s) {
|
| 1324 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1325 |
+
},
|
| 1326 |
+
onHide:function(s) {
|
| 1327 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1328 |
+
},
|
| 1329 |
+
onChange:function(s, i) {
|
| 1330 |
+
SFSI("#sfsi_plus_form_button_background").val("#"+i), SFSI("#sfsiPlusFormButtonBackground").css("background","#"+i);
|
| 1331 |
+
sfsi_plus_create_suscriber_form();
|
| 1332 |
+
},
|
| 1333 |
+
onClick:function(s, i) {
|
| 1334 |
+
SFSI("#sfsi_plus_form_button_background").val("#"+i), SFSI("#sfsiPlusFormButtonBackground").css("background","#"+i);
|
| 1335 |
+
sfsi_plus_create_suscriber_form();
|
| 1336 |
+
}
|
| 1337 |
+
});*/
|
| 1338 |
+
//changes done {Monad}
|
| 1339 |
+
|
| 1340 |
+
function i() {
|
| 1341 |
+
SFSI(".uperror").html(""), sfsiplus_afterLoad();
|
| 1342 |
+
var s = SFSI('input[name="' + SFSI("#upload_id").val() + '"]');
|
| 1343 |
+
s.removeAttr("checked");
|
| 1344 |
+
var i = SFSI(s).parent().find("span:first");
|
| 1345 |
+
return SFSI(i).css("background-position", "0px 0px"), SFSI(".upload-overlay").hide("slow"),
|
| 1346 |
+
!1;
|
| 1347 |
+
}
|
| 1348 |
+
SFSI("#accordion").accordion({
|
| 1349 |
+
collapsible:!0,
|
| 1350 |
+
active:!1,
|
| 1351 |
+
heightStyle:"content",
|
| 1352 |
+
event:"click",
|
| 1353 |
+
beforeActivate:function(s, i) {
|
| 1354 |
+
if (i.newHeader[0]) var e = i.newHeader, t = e.next(".ui-accordion-content"); else var e = i.oldHeader, t = e.next(".ui-accordion-content");
|
| 1355 |
+
var n = "true" == e.attr("aria-selected");
|
| 1356 |
+
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
| 1357 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
| 1358 |
+
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() :t.slideDown(), !1;
|
| 1359 |
+
}
|
| 1360 |
+
}),
|
| 1361 |
+
SFSI("#accordion1").accordion({
|
| 1362 |
+
collapsible:!0,
|
| 1363 |
+
active:!1,
|
| 1364 |
+
heightStyle:"content",
|
| 1365 |
+
event:"click",
|
| 1366 |
+
beforeActivate:function(s, i) {
|
| 1367 |
+
if (i.newHeader[0]) var e = i.newHeader, t = e.next(".ui-accordion-content"); else var e = i.oldHeader, t = e.next(".ui-accordion-content");
|
| 1368 |
+
var n = "true" == e.attr("aria-selected");
|
| 1369 |
+
return e.toggleClass("ui-corner-all", n).toggleClass("accordion-header-active ui-state-active ui-corner-top", !n).attr("aria-selected", (!n).toString()),
|
| 1370 |
+
e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", n).toggleClass("ui-icon-triangle-1-s", !n),
|
| 1371 |
+
t.toggleClass("accordion-content-active", !n), n ? t.slideUp() :t.slideDown(), !1;
|
| 1372 |
+
}
|
| 1373 |
+
}),
|
| 1374 |
+
SFSI(".closeSec").on("click", function() {
|
| 1375 |
+
var s = !0, i = SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(), e = SFSI(this).closest("div.ui-accordion-content").first();
|
| 1376 |
+
i.toggleClass("ui-corner-all", s).toggleClass("accordion-header-active ui-state-active ui-corner-top", !s).attr("aria-selected", (!s).toString()),
|
| 1377 |
+
i.children(".ui-icon").toggleClass("ui-icon-triangle-1-e", s).toggleClass("ui-icon-triangle-1-s", !s),
|
| 1378 |
+
e.toggleClass("accordion-content-active", !s), s ? e.slideUp() :e.slideDown();
|
| 1379 |
+
}),
|
| 1380 |
+
SFSI(document).click(function(s) {
|
| 1381 |
+
var i = SFSI(".sfsi_plus_FrntInner"), e = SFSI(".sfsi_plus_wDiv"), t = SFSI("#at15s");
|
| 1382 |
+
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
| 1383 |
+
}),
|
| 1384 |
+
SFSI(".sfsi_plus_outr_div").find(".addthis_button").mousemove(function() {
|
| 1385 |
+
var s = SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().top + 10;
|
| 1386 |
+
SFSI("#at15s").css({
|
| 1387 |
+
top:s + "px",
|
| 1388 |
+
left:SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().left + "px"
|
| 1389 |
+
});
|
| 1390 |
+
}),
|
| 1391 |
+
|
| 1392 |
+
//pooja 28-12-2015
|
| 1393 |
+
SFSI('#sfsi_plus_popup_background_color').wpColorPicker({
|
| 1394 |
+
defaultColor: false,
|
| 1395 |
+
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1396 |
+
clear: function() {sfsi_plus_make_popBox()},
|
| 1397 |
+
hide: true,
|
| 1398 |
+
palettes: true
|
| 1399 |
+
}),
|
| 1400 |
+
SFSI('#sfsi_plus_popup_border_color').wpColorPicker({
|
| 1401 |
+
defaultColor: false,
|
| 1402 |
+
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1403 |
+
clear: function() {sfsi_plus_make_popBox()},
|
| 1404 |
+
hide: true,
|
| 1405 |
+
palettes: true
|
| 1406 |
+
}),
|
| 1407 |
+
SFSI('#sfsi_plus_popup_fontColor').wpColorPicker({
|
| 1408 |
+
defaultColor: false,
|
| 1409 |
+
change: function(event, ui){sfsi_plus_make_popBox()},
|
| 1410 |
+
clear: function() {sfsi_plus_make_popBox()},
|
| 1411 |
+
hide: true,
|
| 1412 |
+
palettes: true
|
| 1413 |
+
}),
|
| 1414 |
+
|
| 1415 |
+
/*SFSI("#sfsifontCloroPicker").ColorPicker({
|
| 1416 |
+
color:"#f80000",
|
| 1417 |
+
onBeforeShow:function() {
|
| 1418 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_fontColor").val());
|
| 1419 |
+
},
|
| 1420 |
+
onShow:function(s) {
|
| 1421 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1422 |
+
},
|
| 1423 |
+
onHide:function(s) {
|
| 1424 |
+
return SFSI(s).fadeOut(500), sfsi_plus_make_popBox(), !1;
|
| 1425 |
+
},
|
| 1426 |
+
onChange:function(s, i) {
|
| 1427 |
+
SFSI("#sfsi_plus_popup_fontColor").val("#" + i), SFSI("#sfsifontCloroPicker").css("background", "#" + i),
|
| 1428 |
+
sfsi_plus_make_popBox();
|
| 1429 |
+
},
|
| 1430 |
+
onClick:function(s, i) {
|
| 1431 |
+
SFSI("#sfsi_plus_popup_fontColor").val("#" + i), SFSI("#sfsifontCloroPicker").css("background", "#" + i),
|
| 1432 |
+
sfsi_plus_make_popBox();
|
| 1433 |
+
}
|
| 1434 |
+
}),*/
|
| 1435 |
+
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseover(function() {
|
| 1436 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
| 1437 |
+
}),
|
| 1438 |
+
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseleave(function() {
|
| 1439 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
| 1440 |
+
}),
|
| 1441 |
+
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseover(function() {
|
| 1442 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
| 1443 |
+
}),
|
| 1444 |
+
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 1445 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
| 1446 |
+
}),
|
| 1447 |
+
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseover(function() {
|
| 1448 |
+
SFSI(this).css("opacity", "0.9");
|
| 1449 |
+
}),
|
| 1450 |
+
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 1451 |
+
SFSI(this).css("opacity", "1");
|
| 1452 |
+
/*{Monad}*/
|
| 1453 |
+
}),
|
| 1454 |
+
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function() {
|
| 1455 |
+
SFSI(this).css("opacity", "0.9");
|
| 1456 |
+
}),
|
| 1457 |
+
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function() {
|
| 1458 |
+
SFSI(this).css("opacity", "1");
|
| 1459 |
+
}),
|
| 1460 |
+
|
| 1461 |
+
//pooja 28-12-2015
|
| 1462 |
+
|
| 1463 |
+
/*SFSI("#sfsiBackgroundColorPicker").ColorPicker({
|
| 1464 |
+
color:"#f80000",
|
| 1465 |
+
onBeforeShow:function() {
|
| 1466 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_background_color").val());
|
| 1467 |
+
},
|
| 1468 |
+
onShow:function(s) {
|
| 1469 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1470 |
+
},
|
| 1471 |
+
onHide:function(s) {
|
| 1472 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1473 |
+
},
|
| 1474 |
+
onChange:function(s, i) {
|
| 1475 |
+
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiBackgroundColorPicker").css("background","#"+i),
|
| 1476 |
+
sfsi_plus_make_popBox();
|
| 1477 |
+
},
|
| 1478 |
+
onClick:function(s, i) {
|
| 1479 |
+
SFSI("#sfsi_plus_popup_background_color").val("#" + i), SFSI("#sfsiBackgroundColorPicker").css("background","#"+i),
|
| 1480 |
+
sfsi_plus_make_popBox();
|
| 1481 |
+
}
|
| 1482 |
+
}),
|
| 1483 |
+
SFSI("#sfsiBorderColorPicker").ColorPicker({
|
| 1484 |
+
color:"#f80000",
|
| 1485 |
+
onBeforeShow:function() {
|
| 1486 |
+
s(this).ColorPickerSetColor(SFSI("#sfsi_plus_popup_border_color").val());
|
| 1487 |
+
},
|
| 1488 |
+
onShow:function(s) {
|
| 1489 |
+
return SFSI(s).fadeIn(500), !1;
|
| 1490 |
+
},
|
| 1491 |
+
onHide:function(s) {
|
| 1492 |
+
return SFSI(s).fadeOut(500), !1;
|
| 1493 |
+
},
|
| 1494 |
+
onChange:function(s, i) {
|
| 1495 |
+
SFSI("#sfsi_plus_popup_border_color").val("#" + i), SFSI("#sfsiBorderColorPicker").css("background", "#" + i),
|
| 1496 |
+
sfsi_plus_make_popBox();
|
| 1497 |
+
},
|
| 1498 |
+
onClick:function(s, i) {
|
| 1499 |
+
SFSI("#sfsi_plus_popup_border_color").val("#" + i), SFSI("#sfsiBorderColorPicker").css("background", "#" + i),
|
| 1500 |
+
sfsi_plus_make_popBox();
|
| 1501 |
+
}
|
| 1502 |
+
}),*/
|
| 1503 |
+
SFSI("#sfsi_plus_save1").on("click", function() {
|
| 1504 |
+
sfsi_plus_update_step1() && sfsipluscollapse(this);
|
| 1505 |
+
}),
|
| 1506 |
+
SFSI("#sfsi_plus_save2").on("click", function() {
|
| 1507 |
+
sfsi_plus_update_step2() && sfsipluscollapse(this);
|
| 1508 |
+
}),
|
| 1509 |
+
SFSI("#sfsi_plus_save3").on("click", function() {
|
| 1510 |
+
sfsi_plus_update_step3() && sfsipluscollapse(this);
|
| 1511 |
+
}),
|
| 1512 |
+
SFSI("#sfsi_plus_save4").on("click", function() {
|
| 1513 |
+
sfsi_plus_update_step4() && sfsipluscollapse(this);
|
| 1514 |
+
}),
|
| 1515 |
+
SFSI("#sfsi_plus_save5").on("click", function() {
|
| 1516 |
+
sfsi_plus_update_step5() && sfsipluscollapse(this);
|
| 1517 |
+
}),
|
| 1518 |
+
SFSI("#sfsi_plus_save6").on("click", function() {
|
| 1519 |
+
sfsi_plus_update_step6() && sfsipluscollapse(this);
|
| 1520 |
+
}),
|
| 1521 |
+
SFSI("#sfsi_plus_save7").on("click", function() {
|
| 1522 |
+
sfsi_plus_update_step7() && sfsipluscollapse(this);
|
| 1523 |
+
}),
|
| 1524 |
+
SFSI("#sfsi_plus_save8").on("click", function() {
|
| 1525 |
+
sfsi_plus_update_step8() && sfsipluscollapse(this);
|
| 1526 |
+
}),
|
| 1527 |
+
SFSI("#sfsi_plus_save9").on("click", function() {
|
| 1528 |
+
sfsi_plus_update_step9() && sfsipluscollapse(this);
|
| 1529 |
+
}),
|
| 1530 |
+
SFSI("#save_plus_all_settings").on("click", function() {
|
| 1531 |
+
return SFSI("#save_plus_all_settings").text("Saving.."), SFSI(".save_button >a").css("pointer-events", "none"),
|
| 1532 |
+
sfsi_plus_update_step1(), sfsi_plus_update_step9(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Which icons do you want to show on your site?" tab.', 8),
|
| 1533 |
+
global_error = 0, !1) :(sfsi_plus_update_step2(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "What do you want the icons to do?" tab.', 8),
|
| 1534 |
+
global_error = 0, !1) :(sfsi_plus_update_step3(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "What design & animation do you want to give your icons?" tab.', 8),
|
| 1535 |
+
global_error = 0, !1) :(sfsi_plus_update_step4(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display "counts" next to your icons?" tab.', 8),
|
| 1536 |
+
global_error = 0, !1) :(sfsi_plus_update_step5(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Any other wishes for your main icons?" tab.', 8),
|
| 1537 |
+
global_error = 0, !1) :(sfsi_plus_update_step6(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display icons at the end of every post?" tab.', 8),
|
| 1538 |
+
global_error = 0, !1) :(sfsi_plus_update_step7(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Do you want to display a pop-up, asking people to subscribe?" tab.', 8),
|
| 1539 |
+
global_error = 0, !1) : sfsi_plus_update_step8(), 1 == global_error ? (sfsiplus_showErrorSuc("error", 'Some Selection error in "Where shall they be displayed?" tab.', 8),
|
| 1540 |
+
/*global_error = 0, !1) :void (0 == global_error && sfsiplus_showErrorSuc("success", 'Saved! Now go to the <a href="widgets.php">widget</a> area and place the widget into your sidebar (if not done already)', 8))))))));*/
|
| 1541 |
+
global_error = 0, !1) :void (0 == global_error && sfsiplus_showErrorSuc("success", '', 8))))))));
|
| 1542 |
+
}),
|
| 1543 |
+
/*SFSI(".fileUPInput").live("change", function() {*/
|
| 1544 |
+
SFSI(document).on("change", '.fileUPInput', function () {
|
| 1545 |
+
sfsiplus_beForeLoad(), sfsiplus_beforeIconSubmit(this) && (SFSI(".upload-overlay").css("pointer-events", "none"),
|
| 1546 |
+
SFSI("#customIconFrm").ajaxForm({
|
| 1547 |
+
dataType:"json",
|
| 1548 |
+
success:sfsiplus_afterIconSuccess,
|
| 1549 |
+
resetForm:!0
|
| 1550 |
+
}).submit());
|
| 1551 |
+
}),
|
| 1552 |
+
SFSI(".pop-up").on("click", function() {
|
| 1553 |
+
("fbex-s2" == SFSI(this).attr("data-id") || "googlex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
| 1554 |
+
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
| 1555 |
+
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
| 1556 |
+
}),
|
| 1557 |
+
/*SFSI("#close_popup").live("click", function() {*/
|
| 1558 |
+
SFSI(document).on("click", '#close_popup', function () {
|
| 1559 |
+
SFSI(".read-overlay").hide("slow");
|
| 1560 |
+
});
|
| 1561 |
+
var e = 0;
|
| 1562 |
+
SFSI(".plus_icn_listing").on("click", ".checkbox", function() {
|
| 1563 |
+
if (1 == e) return !1;
|
| 1564 |
+
"yes" == SFSI(this).attr("dynamic_ele") && (s = SFSI(this).parent().find("input:checkbox:first"),
|
| 1565 |
+
s.is(":checked") ? SFSI(s).attr("checked", !1) :SFSI(s).attr("checked", !0)), s = SFSI(this).parent().find("input:checkbox:first"),
|
| 1566 |
+
"yes" == SFSI(s).attr("isNew") && ("0px 0px" == SFSI(this).css("background-position") ? (SFSI(s).attr("checked", !0),
|
| 1567 |
+
SFSI(this).css("background-position", "0px -36px")) :(SFSI(s).removeAttr("checked", !0),
|
| 1568 |
+
SFSI(this).css("background-position", "0px 0px")));
|
| 1569 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1570 |
+
if (s.is(":checked") && "sfsiplus-cusotm-icon" == s.attr("element-type")) SFSI(".fileUPInput").attr("name", "custom_icons[]"),
|
| 1571 |
+
SFSI(".upload-overlay").show("slow", function() {
|
| 1572 |
+
e = 0;
|
| 1573 |
+
}),
|
| 1574 |
+
SFSI("#upload_id").val(s.attr("name")); else if (!s.is(":checked") && "sfsiplus-cusotm-icon" == s.attr("element-type")) return s.attr("ele-type") ? (SFSI(this).attr("checked", !0),
|
| 1575 |
+
SFSI(this).css("background-position", "0px -36px"), e = 0, !1) :confirm("Are you sure want to delete this Icon..?? ") ? "suc" == sfsi_plus_delete_CusIcon(this, s) ? (s.attr("checked", !1),
|
| 1576 |
+
SFSI(this).css("background-position", "0px 0px"), e = 0, !1) :(e = 0, !1) :(s.attr("checked", !0),
|
| 1577 |
+
SFSI(this).css("background-position", "0px -36px"), e = 0, !1);
|
| 1578 |
+
}),
|
| 1579 |
+
SFSI(".plus_icn_listing").on("click", ".checkbox", function() {
|
| 1580 |
+
checked = SFSI(this).parent().find("input:checkbox:first"), "sfsi_plus_email_display" != checked.attr("name") || checked.is(":checked") || SFSI(".demail-1").show("slow");
|
| 1581 |
+
}),
|
| 1582 |
+
SFSI("#deac_email2").on("click", function() {
|
| 1583 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").show("slow");
|
| 1584 |
+
}),
|
| 1585 |
+
SFSI("#deac_email3").on("click", function() {
|
| 1586 |
+
SFSI(".demail-2").hide("slow"), SFSI(".demail-3").show("slow");
|
| 1587 |
+
}),
|
| 1588 |
+
SFSI(".hideemailpop").on("click", function() {
|
| 1589 |
+
SFSI('input[name="sfsi_plus_email_display"]').attr("checked", !0),
|
| 1590 |
+
SFSI('input[name="sfsi_plus_email_display"]').parent().find("span:first").css("background-position", "0px -36px"),
|
| 1591 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
| 1592 |
+
}),
|
| 1593 |
+
SFSI(".hidePop").on("click", function() {
|
| 1594 |
+
SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"), SFSI(".demail-3").hide("slow");
|
| 1595 |
+
}),
|
| 1596 |
+
SFSI(".sfsiplus_activate_footer").on("click", function() {
|
| 1597 |
+
var nonce = SFSI(this).attr("data-nonce");
|
| 1598 |
+
SFSI(this).text("activating....");
|
| 1599 |
+
var s = {
|
| 1600 |
+
action:"plus_activateFooter",
|
| 1601 |
+
nonce:nonce
|
| 1602 |
+
};
|
| 1603 |
+
SFSI.ajax({
|
| 1604 |
+
url:ajax_object.ajax_url,
|
| 1605 |
+
type:"post",
|
| 1606 |
+
data:s,
|
| 1607 |
+
dataType:"json",
|
| 1608 |
+
success:function(s) {
|
| 1609 |
+
if(s.res == "wrong_nonce")
|
| 1610 |
+
{
|
| 1611 |
+
SFSI(".sfsiplus_activate_footer").css("font-size", "18px");
|
| 1612 |
+
SFSI(".sfsiplus_activate_footer").text("Unauthorised Request, Try again after refreshing page");
|
| 1613 |
+
}
|
| 1614 |
+
else
|
| 1615 |
+
{
|
| 1616 |
+
"success" == s.res && (SFSI(".demail-1").hide("slow"), SFSI(".demail-2").hide("slow"),
|
| 1617 |
+
SFSI(".demail-3").hide("slow"), SFSI(".sfsiplus_activate_footer").text("Ok, activate link"));
|
| 1618 |
+
}
|
| 1619 |
+
}
|
| 1620 |
+
});
|
| 1621 |
+
}),
|
| 1622 |
+
SFSI(".sfsiplus_removeFooter").on("click", function() {
|
| 1623 |
+
var nonce = SFSI(this).attr("data-nonce");
|
| 1624 |
+
SFSI(this).text("working....");
|
| 1625 |
+
var s = {
|
| 1626 |
+
action:"plus_removeFooter",
|
| 1627 |
+
nonce:nonce
|
| 1628 |
+
};
|
| 1629 |
+
SFSI.ajax({
|
| 1630 |
+
url:ajax_object.ajax_url,
|
| 1631 |
+
type:"post",
|
| 1632 |
+
data:s,
|
| 1633 |
+
dataType:"json",
|
| 1634 |
+
success:function(s) {
|
| 1635 |
+
if(s.res == "wrong_nonce")
|
| 1636 |
+
{
|
| 1637 |
+
SFSI(".sfsiplus_removeFooter").text("Unauthorised Request, Try again after refreshing page");
|
| 1638 |
+
}
|
| 1639 |
+
else
|
| 1640 |
+
{
|
| 1641 |
+
"success" == s.res && (SFSI(".sfsiplus_removeFooter").fadeOut("slow"), SFSI(".sfsiplus_footerLnk").fadeOut("slow"));
|
| 1642 |
+
}
|
| 1643 |
+
}
|
| 1644 |
+
});
|
| 1645 |
+
}),
|
| 1646 |
+
/*SFSI(".radio").live("click", function() {*/
|
| 1647 |
+
SFSI(document).on("click", '.radio', function () {
|
| 1648 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1649 |
+
"sfsi_plus_display_counts" == s.attr("name") && sfsi_plus_show_counts();
|
| 1650 |
+
}),
|
| 1651 |
+
SFSI("#close_Uploadpopup").on("click", i), /*SFSI(".radio").live("click", function() {*/SFSI(document).on("click", '.radio', function () {
|
| 1652 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1653 |
+
"sfsi_plus_show_Onposts" == s.attr("name") && sfsi_plus_show_OnpostsDisplay();
|
| 1654 |
+
}),
|
| 1655 |
+
sfsi_plus_show_OnpostsDisplay(),
|
| 1656 |
+
sfsi_plus_depened_sections(),
|
| 1657 |
+
sfsi_plus_show_counts(),
|
| 1658 |
+
sfsi_plus_showPreviewCounts(),
|
| 1659 |
+
SFSI(".plus_share_icon_order").sortable({
|
| 1660 |
+
update:function() {
|
| 1661 |
+
SFSI(".plus_share_icon_order li").each(function() {
|
| 1662 |
+
SFSI(this).attr("data-index", SFSI(this).index() + 1);
|
| 1663 |
+
});
|
| 1664 |
+
},
|
| 1665 |
+
revert:!0
|
| 1666 |
+
}),
|
| 1667 |
+
/*SFSI(".radio").live("click", function() {*/
|
| 1668 |
+
SFSI(document).on("click", '.radio', function () {
|
| 1669 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1670 |
+
"sfsi_plus_email_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_email_countsDisplay"]').prop("checked", !0),
|
| 1671 |
+
SFSI('input[name="sfsi_plus_email_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1672 |
+
"manual" == SFSI("input[name='sfsi_plus_email_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_email_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_email_manualCounts']").slideUp()),
|
| 1673 |
+
"sfsi_plus_facebook_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_facebook_countsDisplay"]').prop("checked", !0),
|
| 1674 |
+
SFSI('input[name="sfsi_plus_facebook_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1675 |
+
"mypage" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_facebook_mypageCounts']").slideDown(),SFSI(".sfsiplus_fbpgidwpr").slideDown()) :(SFSI("input[name='sfsi_plus_facebook_mypageCounts']").slideUp(),SFSI(".sfsiplus_fbpgidwpr").slideUp()),
|
| 1676 |
+
"manual" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_facebook_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_facebook_manualCounts']").slideUp()),
|
| 1677 |
+
"sfsi_plus_facebook_countsFrom" == s.attr("name") && (("mypage" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val() || "likes" == SFSI("input[name='sfsi_plus_facebook_countsFrom']:checked").val()) ? (SFSI(".sfsi_plus_facebook_pagedeasc").slideDown()) : (SFSI(".sfsi_plus_facebook_pagedeasc").slideUp())),
|
| 1678 |
+
|
| 1679 |
+
|
| 1680 |
+
"sfsi_plus_twitter_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_twitter_countsDisplay"]').prop("checked", !0),
|
| 1681 |
+
SFSI('input[name="sfsi_plus_twitter_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1682 |
+
"manual" == SFSI("input[name='sfsi_plus_twitter_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_twitter_manualCounts']").slideDown(),
|
| 1683 |
+
SFSI(".tw_follow_options").slideUp()) :(SFSI("input[name='sfsi_plus_twitter_manualCounts']").slideUp(),
|
| 1684 |
+
SFSI(".tw_follow_options").slideDown())), "sfsi_plus_google_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_google_countsDisplay"]').prop("checked", !0),
|
| 1685 |
+
SFSI('input[name="sfsi_plus_google_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1686 |
+
"manual" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI("input[name='sfsi_plus_google_manualCounts']").slideDown(),
|
| 1687 |
+
SFSI(".google_option").slideUp()), "likes" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI("input[name='sfsi_plus_google_manualCounts']").slideUp(),
|
| 1688 |
+
SFSI(".google_option").slideUp()), "follower" == SFSI("input[name='sfsi_plus_google_countsFrom']:checked").val() && (SFSI(".google_option").slideDown(),
|
| 1689 |
+
SFSI("input[name='sfsi_plus_google_manualCounts']").slideUp())), "sfsi_plus_linkedIn_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_linkedIn_countsDisplay"]').prop("checked", !0),
|
| 1690 |
+
SFSI('input[name="sfsi_plus_linkedIn_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1691 |
+
"manual" == SFSI("input[name='sfsi_plus_linkedIn_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").slideDown(),
|
| 1692 |
+
SFSI(".linkedIn_options").slideUp()) :(SFSI("input[name='sfsi_plus_linkedIn_manualCounts']").slideUp(),
|
| 1693 |
+
SFSI(".linkedIn_options").slideDown())), "sfsi_plus_youtube_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_youtube_countsDisplay"]').prop("checked", !0),
|
| 1694 |
+
SFSI('input[name="sfsi_plus_youtube_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1695 |
+
"manual" == SFSI("input[name='sfsi_plus_youtube_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_youtube_manualCounts']").slideDown(),
|
| 1696 |
+
SFSI(".youtube_options").slideUp()) :(SFSI("input[name='sfsi_plus_youtube_manualCounts']").slideUp(),
|
| 1697 |
+
SFSI(".youtube_options").slideDown())), "sfsi_plus_pinterest_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_pinterest_countsDisplay"]').prop("checked", !0),
|
| 1698 |
+
SFSI('input[name="sfsi_plus_pinterest_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1699 |
+
"manual" == SFSI("input[name='sfsi_plus_pinterest_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_pinterest_manualCounts']").slideDown(),
|
| 1700 |
+
SFSI(".pin_options").slideUp()) :SFSI("input[name='sfsi_plus_pinterest_manualCounts']").slideUp()),
|
| 1701 |
+
"sfsi_plus_instagram_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_instagram_countsDisplay"]').prop("checked", !0),
|
| 1702 |
+
SFSI('input[name="sfsi_plus_instagram_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1703 |
+
"manual" == SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val() ? (SFSI("input[name='sfsi_plus_instagram_manualCounts']").slideDown(),
|
| 1704 |
+
SFSI(".instagram_userLi").slideUp()) :(SFSI("input[name='sfsi_plus_instagram_manualCounts']").slideUp(),
|
| 1705 |
+
SFSI(".instagram_userLi").slideDown())), "sfsi_plus_shares_countsFrom" == s.attr("name") && (SFSI('input[name="sfsi_plus_shares_countsDisplay"]').prop("checked", !0),
|
| 1706 |
+
SFSI('input[name="sfsi_plus_shares_countsDisplay"]').parent().find("span.checkbox").attr("style", "background-position:0px -36px;"),
|
| 1707 |
+
"manual" == SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val() ? SFSI("input[name='sfsi_plus_shares_manualCounts']").slideDown() :SFSI("input[name='sfsi_plus_shares_manualCounts']").slideUp());
|
| 1708 |
+
}), sfsi_plus_make_popBox(), SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("keyup", sfsi_plus_make_popBox),
|
| 1709 |
+
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("focus", sfsi_plus_make_popBox),
|
| 1710 |
+
SFSI("#sfsi_plus_popup_font ,#sfsi_plus_popup_fontStyle").on("change", sfsi_plus_make_popBox),
|
| 1711 |
+
/*SFSI(".radio").live("click", function() {*/
|
| 1712 |
+
SFSI(document).on("click", '.radio', function () {
|
| 1713 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1714 |
+
"sfsi_plus_popup_border_shadow" == s.attr("name") && sfsi_plus_make_popBox();
|
| 1715 |
+
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function(s) {
|
| 1716 |
+
s.stopPropagation();
|
| 1717 |
+
var i = SFSI("#sfsi_plus_floater_sec").val();
|
| 1718 |
+
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 1719 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 1720 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 1721 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 1722 |
+
"z-index":"999"
|
| 1723 |
+
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1724 |
+
opacity:1,
|
| 1725 |
+
"z-index":10
|
| 1726 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1727 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1728 |
+
opacity:1,
|
| 1729 |
+
"z-index":10
|
| 1730 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1731 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1732 |
+
opacity:1,
|
| 1733 |
+
"z-index":10
|
| 1734 |
+
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 1735 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 1736 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1737 |
+
opacity:1,
|
| 1738 |
+
"z-index":10
|
| 1739 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 1740 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 1741 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1742 |
+
opacity:1,
|
| 1743 |
+
"z-index":1e3
|
| 1744 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 1745 |
+
}) :SFSI("img.sfsi_wicon").on("mouseenter", function() {
|
| 1746 |
+
var s = SFSI("#sfsi_plus_floater_sec").val();
|
| 1747 |
+
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 1748 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 1749 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 1750 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 1751 |
+
"z-index":"999"
|
| 1752 |
+
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1753 |
+
opacity:1,
|
| 1754 |
+
"z-index":10
|
| 1755 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1756 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1757 |
+
opacity:1,
|
| 1758 |
+
"z-index":10
|
| 1759 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 1760 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1761 |
+
opacity:1,
|
| 1762 |
+
"z-index":10
|
| 1763 |
+
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 1764 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 1765 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1766 |
+
opacity:1,
|
| 1767 |
+
"z-index":10
|
| 1768 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 1769 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 1770 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 1771 |
+
opacity:1,
|
| 1772 |
+
"z-index":10
|
| 1773 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 1774 |
+
}), SFSI("div.sfsi_plus_wicons").on("mouseleave", function() {
|
| 1775 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "fade_in" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 1776 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "scale" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale"),
|
| 1777 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "combo" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && (SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 1778 |
+
SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale")), "google" == SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").attr("id") ? SFSI("body").on("click", function() {
|
| 1779 |
+
SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 1780 |
+
}) :(SFSI(this).css({
|
| 1781 |
+
"z-index":"0"
|
| 1782 |
+
}), SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide());
|
| 1783 |
+
}),
|
| 1784 |
+
SFSI("body").on("click", function() {
|
| 1785 |
+
SFSI(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 1786 |
+
}),
|
| 1787 |
+
SFSI(".adminTooltip >a").on("hover", function() {
|
| 1788 |
+
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "1"),
|
| 1789 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").show();
|
| 1790 |
+
}),
|
| 1791 |
+
SFSI(".adminTooltip").on("mouseleave", function() {
|
| 1792 |
+
"none" != SFSI(".sfsi_plus_gpls_tool_bdr").css("display") && 0 != SFSI(".sfsi_plus_gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function() {
|
| 1793 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide();
|
| 1794 |
+
}) :(SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"),
|
| 1795 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide());
|
| 1796 |
+
}),
|
| 1797 |
+
SFSI(".expand-area").on("click", function() {
|
| 1798 |
+
object_name.Re_ad == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
| 1799 |
+
SFSI(this).text(object_name1.Coll_apse)) :(SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
| 1800 |
+
SFSI(this).text(object_name.Re_ad));
|
| 1801 |
+
}),
|
| 1802 |
+
/*SFSI(".radio").live("click", function(){*/
|
| 1803 |
+
SFSI(document).on("click", '.radio', function () {
|
| 1804 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1805 |
+
"sfsi_plus_icons_float" == s.attr("name") && "yes" == s.val() && (SFSI(".float_options").slideDown("slow"),
|
| 1806 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').removeAttr("checked"),
|
| 1807 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').parent().find("span").attr("style", "background-position:0px -41px;"),
|
| 1808 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').parent().find("span").attr("style", "background-position:0px -0px;")),
|
| 1809 |
+
("sfsi_plus_icons_stick" == s.attr("name") && "yes" == s.val() || "sfsi_plus_icons_float" == s.attr("name") && "no" == s.val()) && (SFSI(".float_options").slideUp("slow"),
|
| 1810 |
+
SFSI('input[name="sfsi_plus_icons_float"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_plus_icons_float"][value="yes"]').prop("checked", !1),
|
| 1811 |
+
SFSI('input[name="sfsi_plus_icons_float"][value="no"]').parent().find("span.radio").attr("style", "background-position:0px -41px;"),
|
| 1812 |
+
SFSI('input[name="sfsi_plus_icons_float"][value="yes"]').parent().find("span.radio").attr("style", "background-position:0px -0px;"));
|
| 1813 |
+
}),
|
| 1814 |
+
SFSI(".sfsi_plus_wDiv").length > 0 && setTimeout(function() {
|
| 1815 |
+
var s = parseInt(SFSI(".sfsi_plus_wDiv").height()) + 0 + "px";
|
| 1816 |
+
SFSI(".sfsi_plus_holders").each(function() {
|
| 1817 |
+
SFSI(this).css("height", s);
|
| 1818 |
+
});
|
| 1819 |
+
}, 200),
|
| 1820 |
+
/*SFSI(".checkbox").live("click", function() {*/
|
| 1821 |
+
SFSI(document).on("click", '.checkbox', function () {
|
| 1822 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1823 |
+
("sfsi_plus_shuffle_Firstload" == s.attr("name") && "checked" == s.attr("checked") || "sfsi_plus_shuffle_interval" == s.attr("name") && "checked" == s.attr("checked")) && (SFSI('input[name="sfsi_plus_shuffle_icons"]').parent().find("span").css("background-position", "0px -36px"),
|
| 1824 |
+
SFSI('input[name="sfsi_plus_shuffle_icons"]').attr("checked", "checked")), "sfsi_plus_shuffle_icons" == s.attr("name") && "checked" != s.attr("checked") && (SFSI('input[name="sfsi_plus_shuffle_Firstload"]').removeAttr("checked"),
|
| 1825 |
+
SFSI('input[name="sfsi_plus_shuffle_Firstload"]').parent().find("span").css("background-position", "0px 0px"),
|
| 1826 |
+
SFSI('input[name="sfsi_plus_shuffle_interval"]').removeAttr("checked"), SFSI('input[name="sfsi_plus_shuffle_interval"]').parent().find("span").css("background-position", "0px 0px"));
|
| 1827 |
+
});
|
| 1828 |
+
|
| 1829 |
+
SFSI("body").on("click", "#getMeFullAccess", function(){
|
| 1830 |
+
var email = SFSI(this).parents("form").find("input[type='email']").val();
|
| 1831 |
+
var feedid = SFSI(this).parents("form").find("input[name='feedid']").val();
|
| 1832 |
+
var error = false;
|
| 1833 |
+
var regEx = /^\w+([-+.']\w+)*@\w+([-.]\w+)*\.\w+([-.]\w+)*$/;
|
| 1834 |
+
|
| 1835 |
+
if(email === '')
|
| 1836 |
+
{
|
| 1837 |
+
error = true;
|
| 1838 |
+
}
|
| 1839 |
+
|
| 1840 |
+
if(!regEx.test(email))
|
| 1841 |
+
{
|
| 1842 |
+
error = true;
|
| 1843 |
+
}
|
| 1844 |
+
|
| 1845 |
+
if(!error)
|
| 1846 |
+
{
|
| 1847 |
+
SFSI(this).parents("form").submit();
|
| 1848 |
+
}
|
| 1849 |
+
else
|
| 1850 |
+
{
|
| 1851 |
+
alert("Error: Please provide your email address.");
|
| 1852 |
+
}
|
| 1853 |
+
});
|
| 1854 |
+
|
| 1855 |
+
SFSI('form#calimingOptimizationForm').on('keypress', function(e) {
|
| 1856 |
+
var keyCode = e.keyCode || e.which;
|
| 1857 |
+
if (keyCode === 13) {
|
| 1858 |
+
e.preventDefault();
|
| 1859 |
+
return false;
|
| 1860 |
+
}
|
| 1861 |
+
});
|
| 1862 |
+
|
| 1863 |
+
/*SFSI(".checkbox").live("click", function()
|
| 1864 |
+
{
|
| 1865 |
+
var s = SFSI(this).parent().find("input:checkbox:first");
|
| 1866 |
+
"sfsi_plus_float_on_page" == s.attr("name") && "yes" == s.val() && (
|
| 1867 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').attr("checked", !0), SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').removeAttr("checked"),
|
| 1868 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="no"]').parent().find("span").attr("style", "background-position:0px -41px;"),
|
| 1869 |
+
SFSI('input[name="sfsi_plus_icons_stick"][value="yes"]').parent().find("span").attr("style", "background-position:0px -0px;"));
|
| 1870 |
+
});
|
| 1871 |
+
SFSI(".radio").live("click", function()
|
| 1872 |
+
{
|
| 1873 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 1874 |
+
var a = SFSI(".cstmfltonpgstck");
|
| 1875 |
+
("sfsi_plus_icons_stick" == s.attr("name") && "yes" == s.val()) && (
|
| 1876 |
+
SFSI('input[name="sfsi_plus_float_on_page"][value="no"]').prop("checked", !0), SFSI('input[name="sfsi_plus_float_on_page"][value="yes"]').prop("checked", !1),
|
| 1877 |
+
SFSI('input[name="sfsi_plus_float_on_page"][value="no"]').parent().find("span.checkbox").attr("style", "background-position:0px -41px;"),
|
| 1878 |
+
SFSI('input[name="sfsi_plus_float_on_page"][value="yes"]').parent().find("span.checkbox").attr("style", "background-position:0px -0px;"),
|
| 1879 |
+
jQuery(a).children(".checkbox").css("background-position", "0px 0px" ), sfsiplus_toggleflotpage(a));
|
| 1880 |
+
});*/
|
| 1881 |
+
});
|
| 1882 |
+
|
| 1883 |
+
//for utube channel name and id
|
| 1884 |
+
function showhideutube(ref)
|
| 1885 |
+
{
|
| 1886 |
+
var chnlslctn = SFSI(ref).children("input").val();
|
| 1887 |
+
if(chnlslctn == "name")
|
| 1888 |
+
{
|
| 1889 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown();
|
| 1890 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp();
|
| 1891 |
+
}
|
| 1892 |
+
else
|
| 1893 |
+
{
|
| 1894 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown();
|
| 1895 |
+
SFSI(ref).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp();
|
| 1896 |
+
}
|
| 1897 |
+
}
|
| 1898 |
+
|
| 1899 |
+
var sfsiplus_initTop = new Array();
|
| 1900 |
+
|
| 1901 |
+
function sfsiplus_toggleflotpage(ref)
|
| 1902 |
+
{
|
| 1903 |
+
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
| 1904 |
+
if(pos == "0px 0px")
|
| 1905 |
+
{
|
| 1906 |
+
jQuery(ref).next(".sfsiplus_right_info").children("p").children(".sfsiplus_sub-subtitle").hide();
|
| 1907 |
+
jQuery(ref).next(".sfsiplus_right_info").children(".sfsiplus_tab_3_icns").hide();
|
| 1908 |
+
}
|
| 1909 |
+
else
|
| 1910 |
+
{
|
| 1911 |
+
jQuery(ref).next(".sfsiplus_right_info").children("p").children(".sfsiplus_sub-subtitle").show();
|
| 1912 |
+
jQuery(ref).next(".sfsiplus_right_info").children(".sfsiplus_tab_3_icns").show();
|
| 1913 |
+
}
|
| 1914 |
+
}
|
| 1915 |
+
function sfsiplus_togglbtmsection(show, hide, ref)
|
| 1916 |
+
{
|
| 1917 |
+
jQuery(ref).parent("ul").children("li.clckbltglcls").each(function(index, element)
|
| 1918 |
+
{
|
| 1919 |
+
jQuery(this).children(".radio").css("background-position", "0px 0px");
|
| 1920 |
+
jQuery(this).children(".styled").attr("checked", "false");
|
| 1921 |
+
});
|
| 1922 |
+
jQuery(ref).children(".radio").css("background-position", "0px -41px");
|
| 1923 |
+
jQuery(ref).children(".styled").attr("checked", "true");
|
| 1924 |
+
|
| 1925 |
+
jQuery("."+show).show();
|
| 1926 |
+
jQuery("."+show).children(".radiodisplaysection").show();
|
| 1927 |
+
jQuery("."+hide).hide();
|
| 1928 |
+
jQuery("."+hide).children(".radiodisplaysection").hide();
|
| 1929 |
+
/*jQuery(ref).parent("ul").children("li").each(function(index, element)
|
| 1930 |
+
{
|
| 1931 |
+
var pos = jQuery(this).children(".radio").css("background-position");
|
| 1932 |
+
if(pos == "0px 0px")
|
| 1933 |
+
{
|
| 1934 |
+
jQuery(this).children(".radiodisplaysection").hide();
|
| 1935 |
+
}
|
| 1936 |
+
else
|
| 1937 |
+
{
|
| 1938 |
+
jQuery(this).children(".radiodisplaysection").show();
|
| 1939 |
+
}
|
| 1940 |
+
});
|
| 1941 |
+
var pos = jQuery(ref).children(".radio").css("background-position");
|
| 1942 |
+
if(pos != "0px 0px")
|
| 1943 |
+
{
|
| 1944 |
+
jQuery(ref).children(".radiodisplaysection").show();
|
| 1945 |
+
}
|
| 1946 |
+
else
|
| 1947 |
+
{
|
| 1948 |
+
jQuery(ref).children(".radiodisplaysection").hide();
|
| 1949 |
+
}*/
|
| 1950 |
+
}
|
| 1951 |
+
function checkforinfoslction(ref)
|
| 1952 |
+
{
|
| 1953 |
+
var pos = jQuery(ref).children(".checkbox").css("background-position");
|
| 1954 |
+
if(pos == "0px 0px")
|
| 1955 |
+
{
|
| 1956 |
+
jQuery(ref).next(".sfsiplus_right_info").children("p").children("label").hide();
|
| 1957 |
+
}
|
| 1958 |
+
else
|
| 1959 |
+
{
|
| 1960 |
+
jQuery(ref).next(".sfsiplus_right_info").children("p").children("label").show();
|
| 1961 |
+
}
|
| 1962 |
+
}
|
| 1963 |
+
SFSI("body").on("click", ".sfsi_plus_tokenGenerateButton a", function(){
|
| 1964 |
+
var clienId = SFSI("input[name='sfsi_plus_instagram_clientid']").val();
|
| 1965 |
+
var redirectUrl = SFSI("input[name='sfsi_plus_instagram_appurl']").val();
|
| 1966 |
+
|
| 1967 |
+
var scope = "likes+comments+basic+public_content+follower_list+relationships";
|
| 1968 |
+
var instaUrl = "https://www.instagram.com/oauth/authorize/?client_id=<id>&redirect_uri=<url>&response_type=token&scope="+scope;
|
| 1969 |
+
|
| 1970 |
+
if(clienId !== '' && redirectUrl !== '')
|
| 1971 |
+
{
|
| 1972 |
+
instaUrl = instaUrl.replace('<id>', clienId);
|
| 1973 |
+
instaUrl = instaUrl.replace('<url>', redirectUrl);
|
| 1974 |
+
|
| 1975 |
+
window.open(instaUrl, '_blank');
|
| 1976 |
+
}
|
| 1977 |
+
else
|
| 1978 |
+
{
|
| 1979 |
+
alert("Please enter client id and redirect url first");
|
| 1980 |
+
}
|
| 1981 |
+
|
| 1982 |
});
|
js/custom.js
CHANGED
|
@@ -1,321 +1,321 @@
|
|
| 1 |
-
jQuery(document).ready(function(e) {
|
| 2 |
-
jQuery("#sfsi_plus_floater").attr("data-top",jQuery(document).height());
|
| 3 |
-
});
|
| 4 |
-
|
| 5 |
-
function sfsiplus_showErrorSuc(s, i, e) {
|
| 6 |
-
if ("error" == s) var t = "errorMsg"; else var t = "sucMsg";
|
| 7 |
-
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
| 8 |
-
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function() {
|
| 9 |
-
SFSI("." + t).slideUp("slow");
|
| 10 |
-
}, 5e3), !1;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
function sfsiplus_beForeLoad() {
|
| 14 |
-
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events", "none");
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
function sfsi_plus_make_popBox() {
|
| 18 |
-
var s = 0;
|
| 19 |
-
SFSI(".plus_sfsi_sample_icons >li").each(function() {
|
| 20 |
-
"none" != SFSI(this).css("display") && (s = 1);
|
| 21 |
-
}), 0 == s ? SFSI(".sfsi_plus_Popinner").hide() :SFSI(".sfsi_plus_Popinner").show(), "" != SFSI('input[name="sfsi_plus_popup_text"]').val() ? (SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),
|
| 22 |
-
SFSI(".sfsi_plus_Popinner >h2").show()) :SFSI(".sfsi_plus_Popinner >h2").hide(), SFSI(".sfsi_plus_Popinner").css({
|
| 23 |
-
"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),
|
| 24 |
-
"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),
|
| 25 |
-
"border-style":"solid"
|
| 26 |
-
}), SFSI(".sfsi_plus_Popinner").css("background-color", SFSI('input[name="sfsi_plus_popup_background_color"]').val()),
|
| 27 |
-
SFSI(".sfsi_plus_Popinner h2").css("font-family", SFSI("#sfsi_plus_popup_font").val()), SFSI(".sfsi_plus_Popinner h2").css("font-style", SFSI("#sfsi_plus_popup_fontStyle").val()),
|
| 28 |
-
SFSI(".sfsi_plus_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),
|
| 29 |
-
SFSI(".sfsi_plus_Popinner >h2").css("color", SFSI('input[name="sfsi_plus_popup_fontColor"]').val() + " !important"),
|
| 30 |
-
"yes" == SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_plus_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") :SFSI(".sfsi_plus_Popinner").css("box-shadow", "none");
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
function sfsi_plus_stick_widget(s) {
|
| 34 |
-
0 == sfsiplus_initTop.length && (SFSI(".sfsi_plus_widget").each(function(s) {
|
| 35 |
-
sfsiplus_initTop[s] = SFSI(this).position().top;
|
| 36 |
-
}), console.log(sfsiplus_initTop));
|
| 37 |
-
var i = SFSI(window).scrollTop(), e = [], t = [];
|
| 38 |
-
SFSI(".sfsi_plus_widget").each(function(s) {
|
| 39 |
-
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
| 40 |
-
});
|
| 41 |
-
var n = !1;
|
| 42 |
-
for (var o in e) {
|
| 43 |
-
var a = parseInt(o) + 1;
|
| 44 |
-
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
| 45 |
-
position:"fixed",
|
| 46 |
-
top:s
|
| 47 |
-
}), SFSI(t[a]).css({
|
| 48 |
-
position:"",
|
| 49 |
-
top:sfsiplus_initTop[a]
|
| 50 |
-
}), n = !0) :SFSI(t[o]).css({
|
| 51 |
-
position:"",
|
| 52 |
-
top:sfsiplus_initTop[o]
|
| 53 |
-
});
|
| 54 |
-
}
|
| 55 |
-
if (!n) {
|
| 56 |
-
var r = e.length - 1, c = -1;
|
| 57 |
-
e.length > 1 && (c = e.length - 2), sfsiplus_initTop[r] < i ? (SFSI(t[r]).css({
|
| 58 |
-
position:"fixed",
|
| 59 |
-
top:s
|
| 60 |
-
}), c >= 0 && SFSI(t[c]).css({
|
| 61 |
-
position:"",
|
| 62 |
-
top:sfsiplus_initTop[c]
|
| 63 |
-
})) :(SFSI(t[r]).css({
|
| 64 |
-
position:"",
|
| 65 |
-
top:sfsiplus_initTop[r]
|
| 66 |
-
}), c >= 0 && e[c] < i);
|
| 67 |
-
}
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
function sfsi_plus_float_widget(s) {
|
| 71 |
-
function iplus()
|
| 72 |
-
{
|
| 73 |
-
rplus = "Microsoft Internet Explorer" === navigator.appName ? aplus - document.documentElement.scrollTop :aplus - window.pageYOffset,
|
| 74 |
-
Math.abs(rplus) > 0 ? (window.removeEventListener("scroll", iplus), aplus -= rplus * oplus, SFSI("#sfsi_plus_floater").css({
|
| 75 |
-
top:(aplus + t).toString() + "px"
|
| 76 |
-
}), setTimeout(iplus, n)) :window.addEventListener("scroll", iplus, !1);
|
| 77 |
-
|
| 78 |
-
}
|
| 79 |
-
/*function eplus()
|
| 80 |
-
{
|
| 81 |
-
var documentheight = SFSI("#sfsi_plus_floater").attr("data-top");
|
| 82 |
-
var fltrhght = parseInt(SFSI("#sfsi_plus_floater").height());
|
| 83 |
-
var fltrtp = parseInt(SFSI("#sfsi_plus_floater").css("top"));
|
| 84 |
-
if(parseInt(fltrhght)+parseInt(fltrtp) <=documentheight)
|
| 85 |
-
{
|
| 86 |
-
window.addEventListener("scroll", iplus, !1);
|
| 87 |
-
}
|
| 88 |
-
else
|
| 89 |
-
{
|
| 90 |
-
window.removeEventListener("scroll", iplus);
|
| 91 |
-
SFSI("#sfsi_plus_floater").css("top",documentheight+"px");
|
| 92 |
-
}
|
| 93 |
-
}*/
|
| 94 |
-
|
| 95 |
-
SFSI( window ).scroll(function() {
|
| 96 |
-
var documentheight = SFSI("#sfsi_plus_floater").attr("data-top");
|
| 97 |
-
var fltrhght = parseInt(SFSI("#sfsi_plus_floater").height());
|
| 98 |
-
var fltrtp = parseInt(SFSI("#sfsi_plus_floater").css("top"));
|
| 99 |
-
if(parseInt(fltrhght)+parseInt(fltrtp) <=documentheight)
|
| 100 |
-
{
|
| 101 |
-
window.addEventListener("scroll", iplus, !1);
|
| 102 |
-
}
|
| 103 |
-
else
|
| 104 |
-
{
|
| 105 |
-
window.removeEventListener("scroll", iplus);
|
| 106 |
-
SFSI("#sfsi_plus_floater").css("top",documentheight+"px");
|
| 107 |
-
}
|
| 108 |
-
});
|
| 109 |
-
|
| 110 |
-
if ("center" == s)
|
| 111 |
-
{
|
| 112 |
-
var t = ( jQuery(window).height() - SFSI("#sfsi_plus_floater").height() ) / 2;
|
| 113 |
-
}
|
| 114 |
-
else if ("bottom" == s)
|
| 115 |
-
{
|
| 116 |
-
var t = window.innerHeight - SFSI("#sfsi_plus_floater").height();
|
| 117 |
-
}
|
| 118 |
-
else
|
| 119 |
-
{
|
| 120 |
-
var t = parseInt(s);
|
| 121 |
-
}
|
| 122 |
-
var n = 50, oplus = .1, aplus = 0, rplus = 0;
|
| 123 |
-
//SFSI("#sfsi_plus_floater"), window.onscroll = eplus;
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
function sfsi_plus_shuffle() {
|
| 127 |
-
var s = [];
|
| 128 |
-
SFSI(".sfsi_plus_wicons ").each(function(i) {
|
| 129 |
-
SFSI(this).text().match(/^\s*$/) || (s[i] = "<div class='" + SFSI(this).attr("class") + "'>" + SFSI(this).html() + "</div>",
|
| 130 |
-
SFSI(this).fadeOut("slow"), SFSI(this).insertBefore(SFSI(this).prev(".sfsi_plus_wicons")),
|
| 131 |
-
SFSI(this).fadeIn("slow"));
|
| 132 |
-
}), s = sfsiplus_Shuffle(s), $("#sfsi_plus_wDiv").html("");
|
| 133 |
-
for (var i = 0; i < testArray.length; i++) $("#sfsi_plus_wDiv").append(s[i]);
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
function sfsiplus_Shuffle(s) {
|
| 137 |
-
for (var i, e, t = s.length; t; i = parseInt(Math.random() * t), e = s[--t], s[t] = s[i],
|
| 138 |
-
s[i] = e) ;
|
| 139 |
-
return s;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
function sfsi_plus_setCookie(s, i, e) {
|
| 143 |
-
var t = new Date();
|
| 144 |
-
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
| 145 |
-
var n = "expires=" + t.toGMTString();
|
| 146 |
-
document.cookie = s + "=" + i + "; " + n;
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
function sfsfi_plus_getCookie(s) {
|
| 150 |
-
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
| 151 |
-
var n = e[t].trim();
|
| 152 |
-
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
| 153 |
-
}
|
| 154 |
-
return "";
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
function sfsi_plus_hideFooter() {}
|
| 158 |
-
|
| 159 |
-
window.onerror = function() {}, SFSI = jQuery.noConflict(), SFSI(window).load(function() {
|
| 160 |
-
SFSI("#sfpluspageLoad").fadeOut(2e3);
|
| 161 |
-
});
|
| 162 |
-
|
| 163 |
-
var global_error = 0;
|
| 164 |
-
|
| 165 |
-
SFSI(document).ready(function(s) {
|
| 166 |
-
|
| 167 |
-
//changes done {Monad}
|
| 168 |
-
SFSI("head").append('<meta http-equiv="Cache-Control" content="no-cache, no-store, must-revalidate" />'),
|
| 169 |
-
SFSI("head").append('<meta http-equiv="Pragma" content="no-cache" />'), SFSI("head").append('<meta http-equiv="Expires" content="0" />'),
|
| 170 |
-
SFSI(document).click(function(s)
|
| 171 |
-
{
|
| 172 |
-
var i = SFSI(".sfsi_plus_FrntInner_changedmonad"), e = SFSI(".sfsi_plus_wDiv"), t = SFSI("#at15s");
|
| 173 |
-
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
| 174 |
-
}),
|
| 175 |
-
SFSI(".sfsi_plus_outr_div").find(".addthis_button").mousemove(function() {
|
| 176 |
-
var s = SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().top + 10;
|
| 177 |
-
SFSI("#at15s").css({
|
| 178 |
-
top:s + "px",
|
| 179 |
-
left:SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().left + "px"
|
| 180 |
-
});
|
| 181 |
-
}),
|
| 182 |
-
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseover(function() {
|
| 183 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
| 184 |
-
}),
|
| 185 |
-
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseleave(function() {
|
| 186 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
| 187 |
-
}),
|
| 188 |
-
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseover(function() {
|
| 189 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
| 190 |
-
}),
|
| 191 |
-
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 192 |
-
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
| 193 |
-
}),
|
| 194 |
-
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseover(function() {
|
| 195 |
-
SFSI(this).css("opacity", "0.9");
|
| 196 |
-
}),
|
| 197 |
-
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 198 |
-
SFSI(this).css("opacity", "1");
|
| 199 |
-
}),
|
| 200 |
-
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function() {
|
| 201 |
-
SFSI(this).css("opacity", "0.9");
|
| 202 |
-
}),
|
| 203 |
-
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function() {
|
| 204 |
-
SFSI(this).css("opacity", "1");
|
| 205 |
-
}),
|
| 206 |
-
SFSI(".pop-up").on("click", function() {
|
| 207 |
-
("fbex-s2" == SFSI(this).attr("data-id") || "googlex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
| 208 |
-
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
| 209 |
-
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
| 210 |
-
}),
|
| 211 |
-
/*SFSI("#close_popup").live("click", function() {*/
|
| 212 |
-
SFSI(document).on("click", '#close_popup', function () {
|
| 213 |
-
SFSI(".read-overlay").hide("slow");
|
| 214 |
-
});
|
| 215 |
-
var e = 0;
|
| 216 |
-
sfsi_plus_make_popBox(),
|
| 217 |
-
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("keyup", sfsi_plus_make_popBox),
|
| 218 |
-
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("focus", sfsi_plus_make_popBox),
|
| 219 |
-
SFSI("#sfsi_plus_popup_font ,#sfsi_plus_popup_fontStyle").on("change", sfsi_plus_make_popBox),
|
| 220 |
-
/*SFSI(".radio").live("click", function(){*/
|
| 221 |
-
SFSI(document).on("click", '.radio', function () {
|
| 222 |
-
var s = SFSI(this).parent().find("input:radio:first");
|
| 223 |
-
"sfsi_plus_popup_border_shadow" == s.attr("name") && sfsi_plus_make_popBox();
|
| 224 |
-
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function(s) {
|
| 225 |
-
s.stopPropagation();
|
| 226 |
-
var i = SFSI("#sfsi_plus_floater_sec").val();
|
| 227 |
-
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 228 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 229 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 230 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 231 |
-
"z-index":"999"
|
| 232 |
-
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 233 |
-
opacity:1,
|
| 234 |
-
"z-index":10
|
| 235 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 236 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 237 |
-
opacity:1,
|
| 238 |
-
"z-index":10
|
| 239 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 240 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 241 |
-
opacity:1,
|
| 242 |
-
"z-index":10
|
| 243 |
-
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 244 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 245 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 246 |
-
opacity:1,
|
| 247 |
-
"z-index":10
|
| 248 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 249 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 250 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 251 |
-
opacity:1,
|
| 252 |
-
"z-index":1e3
|
| 253 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 254 |
-
}) :SFSI("img.sfsi_wicon").on("mouseenter", function() {
|
| 255 |
-
var s = SFSI("#sfsi_plus_floater_sec").val();
|
| 256 |
-
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 257 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 258 |
-
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 259 |
-
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 260 |
-
"z-index":"999"
|
| 261 |
-
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 262 |
-
opacity:1,
|
| 263 |
-
"z-index":10
|
| 264 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 265 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 266 |
-
opacity:1,
|
| 267 |
-
"z-index":10
|
| 268 |
-
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 269 |
-
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 270 |
-
opacity:1,
|
| 271 |
-
"z-index":10
|
| 272 |
-
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 273 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 274 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 275 |
-
opacity:1,
|
| 276 |
-
"z-index":10
|
| 277 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 278 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 279 |
-
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 280 |
-
opacity:1,
|
| 281 |
-
"z-index":10
|
| 282 |
-
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 283 |
-
}), SFSI("div.sfsi_plus_wicons").on("mouseleave", function() {
|
| 284 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "fade_in" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 285 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "scale" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale"),
|
| 286 |
-
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "combo" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && (SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 287 |
-
SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale")), "sfsiplusid_google" == SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").attr("id") ? SFSI("body").on("click", function() {
|
| 288 |
-
SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 289 |
-
}) :(SFSI(this).css({
|
| 290 |
-
"z-index":"0"
|
| 291 |
-
}), SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide());
|
| 292 |
-
}), SFSI("body").on("click", function() {
|
| 293 |
-
SFSI(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 294 |
-
}), SFSI(".adminTooltip >a").on("hover", function() {
|
| 295 |
-
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "1"),
|
| 296 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").show();
|
| 297 |
-
}), SFSI(".adminTooltip").on("mouseleave", function() {
|
| 298 |
-
"none" != SFSI(".sfsi_plus_gpls_tool_bdr").css("display") && 0 != SFSI(".sfsi_plus_gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function() {
|
| 299 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide();
|
| 300 |
-
}) :(SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"),
|
| 301 |
-
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide());
|
| 302 |
-
}), SFSI(".expand-area").on("click", function() {
|
| 303 |
-
"Read more" == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
| 304 |
-
SFSI(this).text("Collapse")) :(SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
| 305 |
-
SFSI(this).text("Read more"));
|
| 306 |
-
}), SFSI(".sfsi_plus_wDiv").length > 0 && setTimeout(function() {
|
| 307 |
-
var s = parseInt(SFSI(".sfsi_plus_wDiv").height()) + 15 + "px";
|
| 308 |
-
SFSI(".sfsi_plus_holders").each(function() {
|
| 309 |
-
SFSI(this).css("height", s);
|
| 310 |
-
});
|
| 311 |
-
SFSI(".sfsi_plus_widget").css("min-height", "auto");
|
| 312 |
-
}, 200);
|
| 313 |
-
});
|
| 314 |
-
|
| 315 |
-
//hiding popup on close button
|
| 316 |
-
function sfsiplushidemepopup()
|
| 317 |
-
{
|
| 318 |
-
SFSI(".sfsi_plus_FrntInner").fadeOut();
|
| 319 |
-
}
|
| 320 |
-
|
| 321 |
var sfsiplus_initTop = new Array();
|
| 1 |
+
jQuery(document).ready(function(e) {
|
| 2 |
+
jQuery("#sfsi_plus_floater").attr("data-top",jQuery(document).height());
|
| 3 |
+
});
|
| 4 |
+
|
| 5 |
+
function sfsiplus_showErrorSuc(s, i, e) {
|
| 6 |
+
if ("error" == s) var t = "errorMsg"; else var t = "sucMsg";
|
| 7 |
+
return SFSI(".tab" + e + ">." + t).html(i), SFSI(".tab" + e + ">." + t).show(),
|
| 8 |
+
SFSI(".tab" + e + ">." + t).effect("highlight", {}, 5e3), setTimeout(function() {
|
| 9 |
+
SFSI("." + t).slideUp("slow");
|
| 10 |
+
}, 5e3), !1;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
function sfsiplus_beForeLoad() {
|
| 14 |
+
SFSI(".loader-img").show(), SFSI(".save_button >a").html("Saving..."), SFSI(".save_button >a").css("pointer-events", "none");
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
function sfsi_plus_make_popBox() {
|
| 18 |
+
var s = 0;
|
| 19 |
+
SFSI(".plus_sfsi_sample_icons >li").each(function() {
|
| 20 |
+
"none" != SFSI(this).css("display") && (s = 1);
|
| 21 |
+
}), 0 == s ? SFSI(".sfsi_plus_Popinner").hide() :SFSI(".sfsi_plus_Popinner").show(), "" != SFSI('input[name="sfsi_plus_popup_text"]').val() ? (SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),
|
| 22 |
+
SFSI(".sfsi_plus_Popinner >h2").show()) :SFSI(".sfsi_plus_Popinner >h2").hide(), SFSI(".sfsi_plus_Popinner").css({
|
| 23 |
+
"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),
|
| 24 |
+
"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),
|
| 25 |
+
"border-style":"solid"
|
| 26 |
+
}), SFSI(".sfsi_plus_Popinner").css("background-color", SFSI('input[name="sfsi_plus_popup_background_color"]').val()),
|
| 27 |
+
SFSI(".sfsi_plus_Popinner h2").css("font-family", SFSI("#sfsi_plus_popup_font").val()), SFSI(".sfsi_plus_Popinner h2").css("font-style", SFSI("#sfsi_plus_popup_fontStyle").val()),
|
| 28 |
+
SFSI(".sfsi_plus_Popinner >h2").css("font-size", parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),
|
| 29 |
+
SFSI(".sfsi_plus_Popinner >h2").css("color", SFSI('input[name="sfsi_plus_popup_fontColor"]').val() + " !important"),
|
| 30 |
+
"yes" == SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val() ? SFSI(".sfsi_plus_Popinner").css("box-shadow", "12px 30px 18px #CCCCCC") :SFSI(".sfsi_plus_Popinner").css("box-shadow", "none");
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
function sfsi_plus_stick_widget(s) {
|
| 34 |
+
0 == sfsiplus_initTop.length && (SFSI(".sfsi_plus_widget").each(function(s) {
|
| 35 |
+
sfsiplus_initTop[s] = SFSI(this).position().top;
|
| 36 |
+
}), console.log(sfsiplus_initTop));
|
| 37 |
+
var i = SFSI(window).scrollTop(), e = [], t = [];
|
| 38 |
+
SFSI(".sfsi_plus_widget").each(function(s) {
|
| 39 |
+
e[s] = SFSI(this).position().top, t[s] = SFSI(this);
|
| 40 |
+
});
|
| 41 |
+
var n = !1;
|
| 42 |
+
for (var o in e) {
|
| 43 |
+
var a = parseInt(o) + 1;
|
| 44 |
+
e[o] < i && e[a] > i && a < e.length ? (SFSI(t[o]).css({
|
| 45 |
+
position:"fixed",
|
| 46 |
+
top:s
|
| 47 |
+
}), SFSI(t[a]).css({
|
| 48 |
+
position:"",
|
| 49 |
+
top:sfsiplus_initTop[a]
|
| 50 |
+
}), n = !0) :SFSI(t[o]).css({
|
| 51 |
+
position:"",
|
| 52 |
+
top:sfsiplus_initTop[o]
|
| 53 |
+
});
|
| 54 |
+
}
|
| 55 |
+
if (!n) {
|
| 56 |
+
var r = e.length - 1, c = -1;
|
| 57 |
+
e.length > 1 && (c = e.length - 2), sfsiplus_initTop[r] < i ? (SFSI(t[r]).css({
|
| 58 |
+
position:"fixed",
|
| 59 |
+
top:s
|
| 60 |
+
}), c >= 0 && SFSI(t[c]).css({
|
| 61 |
+
position:"",
|
| 62 |
+
top:sfsiplus_initTop[c]
|
| 63 |
+
})) :(SFSI(t[r]).css({
|
| 64 |
+
position:"",
|
| 65 |
+
top:sfsiplus_initTop[r]
|
| 66 |
+
}), c >= 0 && e[c] < i);
|
| 67 |
+
}
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
function sfsi_plus_float_widget(s) {
|
| 71 |
+
function iplus()
|
| 72 |
+
{
|
| 73 |
+
rplus = "Microsoft Internet Explorer" === navigator.appName ? aplus - document.documentElement.scrollTop :aplus - window.pageYOffset,
|
| 74 |
+
Math.abs(rplus) > 0 ? (window.removeEventListener("scroll", iplus), aplus -= rplus * oplus, SFSI("#sfsi_plus_floater").css({
|
| 75 |
+
top:(aplus + t).toString() + "px"
|
| 76 |
+
}), setTimeout(iplus, n)) :window.addEventListener("scroll", iplus, !1);
|
| 77 |
+
|
| 78 |
+
}
|
| 79 |
+
/*function eplus()
|
| 80 |
+
{
|
| 81 |
+
var documentheight = SFSI("#sfsi_plus_floater").attr("data-top");
|
| 82 |
+
var fltrhght = parseInt(SFSI("#sfsi_plus_floater").height());
|
| 83 |
+
var fltrtp = parseInt(SFSI("#sfsi_plus_floater").css("top"));
|
| 84 |
+
if(parseInt(fltrhght)+parseInt(fltrtp) <=documentheight)
|
| 85 |
+
{
|
| 86 |
+
window.addEventListener("scroll", iplus, !1);
|
| 87 |
+
}
|
| 88 |
+
else
|
| 89 |
+
{
|
| 90 |
+
window.removeEventListener("scroll", iplus);
|
| 91 |
+
SFSI("#sfsi_plus_floater").css("top",documentheight+"px");
|
| 92 |
+
}
|
| 93 |
+
}*/
|
| 94 |
+
|
| 95 |
+
SFSI( window ).scroll(function() {
|
| 96 |
+
var documentheight = SFSI("#sfsi_plus_floater").attr("data-top");
|
| 97 |
+
var fltrhght = parseInt(SFSI("#sfsi_plus_floater").height());
|
| 98 |
+
var fltrtp = parseInt(SFSI("#sfsi_plus_floater").css("top"));
|
| 99 |
+
if(parseInt(fltrhght)+parseInt(fltrtp) <=documentheight)
|
| 100 |
+
{
|
| 101 |
+
window.addEventListener("scroll", iplus, !1);
|
| 102 |
+
}
|
| 103 |
+
else
|
| 104 |
+
{
|
| 105 |
+
window.removeEventListener("scroll", iplus);
|
| 106 |
+
SFSI("#sfsi_plus_floater").css("top",documentheight+"px");
|
| 107 |
+
}
|
| 108 |
+
});
|
| 109 |
+
|
| 110 |
+
if ("center" == s)
|
| 111 |
+
{
|
| 112 |
+
var t = ( jQuery(window).height() - SFSI("#sfsi_plus_floater").height() ) / 2;
|
| 113 |
+
}
|
| 114 |
+
else if ("bottom" == s)
|
| 115 |
+
{
|
| 116 |
+
var t = window.innerHeight - SFSI("#sfsi_plus_floater").height();
|
| 117 |
+
}
|
| 118 |
+
else
|
| 119 |
+
{
|
| 120 |
+
var t = parseInt(s);
|
| 121 |
+
}
|
| 122 |
+
var n = 50, oplus = .1, aplus = 0, rplus = 0;
|
| 123 |
+
//SFSI("#sfsi_plus_floater"), window.onscroll = eplus;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
function sfsi_plus_shuffle() {
|
| 127 |
+
var s = [];
|
| 128 |
+
SFSI(".sfsi_plus_wicons ").each(function(i) {
|
| 129 |
+
SFSI(this).text().match(/^\s*$/) || (s[i] = "<div class='" + SFSI(this).attr("class") + "'>" + SFSI(this).html() + "</div>",
|
| 130 |
+
SFSI(this).fadeOut("slow"), SFSI(this).insertBefore(SFSI(this).prev(".sfsi_plus_wicons")),
|
| 131 |
+
SFSI(this).fadeIn("slow"));
|
| 132 |
+
}), s = sfsiplus_Shuffle(s), $("#sfsi_plus_wDiv").html("");
|
| 133 |
+
for (var i = 0; i < testArray.length; i++) $("#sfsi_plus_wDiv").append(s[i]);
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
function sfsiplus_Shuffle(s) {
|
| 137 |
+
for (var i, e, t = s.length; t; i = parseInt(Math.random() * t), e = s[--t], s[t] = s[i],
|
| 138 |
+
s[i] = e) ;
|
| 139 |
+
return s;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
function sfsi_plus_setCookie(s, i, e) {
|
| 143 |
+
var t = new Date();
|
| 144 |
+
t.setTime(t.getTime() + 1e3 * 60 * 60 * 24 * e);
|
| 145 |
+
var n = "expires=" + t.toGMTString();
|
| 146 |
+
document.cookie = s + "=" + i + "; " + n;
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
function sfsfi_plus_getCookie(s) {
|
| 150 |
+
for (var i = s + "=", e = document.cookie.split(";"), t = 0; t < e.length; t++) {
|
| 151 |
+
var n = e[t].trim();
|
| 152 |
+
if (0 == n.indexOf(i)) return n.substring(i.length, n.length);
|
| 153 |
+
}
|
| 154 |
+
return "";
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
function sfsi_plus_hideFooter() {}
|
| 158 |
+
|
| 159 |
+
window.onerror = function() {}, SFSI = jQuery.noConflict(), SFSI(window).load(function() {
|
| 160 |
+
SFSI("#sfpluspageLoad").fadeOut(2e3);
|
| 161 |
+
});
|
| 162 |
+
|
| 163 |
+
var global_error = 0;
|
| 164 |
+
|
| 165 |
+
SFSI(document).ready(function(s) {
|
| 166 |
+
|
| 167 |
+
//changes done {Monad}
|
| 168 |
+
SFSI("head").append('<meta http-equiv="Cache-Control" content="no-cache, no-store, must-revalidate" />'),
|
| 169 |
+
SFSI("head").append('<meta http-equiv="Pragma" content="no-cache" />'), SFSI("head").append('<meta http-equiv="Expires" content="0" />'),
|
| 170 |
+
SFSI(document).click(function(s)
|
| 171 |
+
{
|
| 172 |
+
var i = SFSI(".sfsi_plus_FrntInner_changedmonad"), e = SFSI(".sfsi_plus_wDiv"), t = SFSI("#at15s");
|
| 173 |
+
i.is(s.target) || 0 !== i.has(s.target).length || e.is(s.target) || 0 !== e.has(s.target).length || t.is(s.target) || 0 !== t.has(s.target).length || i.fadeOut();
|
| 174 |
+
}),
|
| 175 |
+
SFSI(".sfsi_plus_outr_div").find(".addthis_button").mousemove(function() {
|
| 176 |
+
var s = SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().top + 10;
|
| 177 |
+
SFSI("#at15s").css({
|
| 178 |
+
top:s + "px",
|
| 179 |
+
left:SFSI(".sfsi_plus_outr_div").find(".addthis_button").offset().left + "px"
|
| 180 |
+
});
|
| 181 |
+
}),
|
| 182 |
+
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseover(function() {
|
| 183 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn_hover.svg");
|
| 184 |
+
}),
|
| 185 |
+
SFSI("div#sfsiplusid_linkedin").find(".icon4").find("a").find("img").mouseleave(function() {
|
| 186 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/linkedIn.svg");
|
| 187 |
+
}),
|
| 188 |
+
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseover(function() {
|
| 189 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube_hover.svg");
|
| 190 |
+
}),
|
| 191 |
+
SFSI("div#sfsiplusid_youtube").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 192 |
+
SFSI(this).attr("src", ajax_object.plugin_url + "images/visit_icons/youtube.svg");
|
| 193 |
+
}),
|
| 194 |
+
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseover(function() {
|
| 195 |
+
SFSI(this).css("opacity", "0.9");
|
| 196 |
+
}),
|
| 197 |
+
SFSI("div#sfsiplusid_facebook").find(".icon1").find("a").find("img").mouseleave(function() {
|
| 198 |
+
SFSI(this).css("opacity", "1");
|
| 199 |
+
}),
|
| 200 |
+
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseover(function() {
|
| 201 |
+
SFSI(this).css("opacity", "0.9");
|
| 202 |
+
}),
|
| 203 |
+
SFSI("div#sfsiplusid_twitter").find(".cstmicon1").find("a").find("img").mouseleave(function() {
|
| 204 |
+
SFSI(this).css("opacity", "1");
|
| 205 |
+
}),
|
| 206 |
+
SFSI(".pop-up").on("click", function() {
|
| 207 |
+
("fbex-s2" == SFSI(this).attr("data-id") || "googlex-s2" == SFSI(this).attr("data-id") || "linkex-s2" == SFSI(this).attr("data-id")) && (SFSI("." + SFSI(this).attr("data-id")).hide(),
|
| 208 |
+
SFSI("." + SFSI(this).attr("data-id")).css("opacity", "1"), SFSI("." + SFSI(this).attr("data-id")).css("z-index", "1000")),
|
| 209 |
+
SFSI("." + SFSI(this).attr("data-id")).show("slow");
|
| 210 |
+
}),
|
| 211 |
+
/*SFSI("#close_popup").live("click", function() {*/
|
| 212 |
+
SFSI(document).on("click", '#close_popup', function () {
|
| 213 |
+
SFSI(".read-overlay").hide("slow");
|
| 214 |
+
});
|
| 215 |
+
var e = 0;
|
| 216 |
+
sfsi_plus_make_popBox(),
|
| 217 |
+
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("keyup", sfsi_plus_make_popBox),
|
| 218 |
+
SFSI('input[name="sfsi_plus_popup_text"] ,input[name="sfsi_plus_popup_background_color"],input[name="sfsi_plus_popup_border_color"],input[name="sfsi_plus_popup_border_thickness"],input[name="sfsi_plus_popup_fontSize"],input[name="sfsi_plus_popup_fontColor"]').on("focus", sfsi_plus_make_popBox),
|
| 219 |
+
SFSI("#sfsi_plus_popup_font ,#sfsi_plus_popup_fontStyle").on("change", sfsi_plus_make_popBox),
|
| 220 |
+
/*SFSI(".radio").live("click", function(){*/
|
| 221 |
+
SFSI(document).on("click", '.radio', function () {
|
| 222 |
+
var s = SFSI(this).parent().find("input:radio:first");
|
| 223 |
+
"sfsi_plus_popup_border_shadow" == s.attr("name") && sfsi_plus_make_popBox();
|
| 224 |
+
}), /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent) ? SFSI("img.sfsi_wicon").on("click", function(s) {
|
| 225 |
+
s.stopPropagation();
|
| 226 |
+
var i = SFSI("#sfsi_plus_floater_sec").val();
|
| 227 |
+
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 228 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 229 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 230 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 231 |
+
"z-index":"999"
|
| 232 |
+
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 233 |
+
opacity:1,
|
| 234 |
+
"z-index":10
|
| 235 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 236 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 237 |
+
opacity:1,
|
| 238 |
+
"z-index":10
|
| 239 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 240 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 241 |
+
opacity:1,
|
| 242 |
+
"z-index":10
|
| 243 |
+
})), ("top-left" == i || "top-right" == i) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 244 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 245 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 246 |
+
opacity:1,
|
| 247 |
+
"z-index":10
|
| 248 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 249 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 250 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 251 |
+
opacity:1,
|
| 252 |
+
"z-index":1e3
|
| 253 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 254 |
+
}) :SFSI("img.sfsi_wicon").on("mouseenter", function() {
|
| 255 |
+
var s = SFSI("#sfsi_plus_floater_sec").val();
|
| 256 |
+
SFSI("div.sfsi_plus_wicons").css("z-index", "0"), SFSI(this).parent().parent().parent().siblings("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide(),
|
| 257 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").length > 0 && (SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_tool_tip_2").css("z-index", "0"),
|
| 258 |
+
SFSI(this).parent().parent().parent().parent().siblings("li").find("div.sfsi_plus_wicons").find(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide()),
|
| 259 |
+
SFSI(this).parent().parent().parent().css("z-index", "1000000"), SFSI(this).parent().parent().css({
|
| 260 |
+
"z-index":"999"
|
| 261 |
+
}), SFSI(this).attr("effect") && "fade_in" == SFSI(this).attr("effect") && (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 262 |
+
opacity:1,
|
| 263 |
+
"z-index":10
|
| 264 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "scale" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 265 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 266 |
+
opacity:1,
|
| 267 |
+
"z-index":10
|
| 268 |
+
}), SFSI(this).parent().css("opacity", "1")), SFSI(this).attr("effect") && "combo" == SFSI(this).attr("effect") && (SFSI(this).parent().addClass("scale"),
|
| 269 |
+
SFSI(this).parent().css("opacity", "1"), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 270 |
+
opacity:1,
|
| 271 |
+
"z-index":10
|
| 272 |
+
})), ("top-left" == s || "top-right" == s) && SFSI(this).parent().parent().parent().parent("#sfsi_plus_floater").length > 0 && "sfsi_plus_floater" == SFSI(this).parent().parent().parent().parent().attr("id") ? (SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").addClass("sfsi_plc_btm"),
|
| 273 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").addClass("top_big_arow"),
|
| 274 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 275 |
+
opacity:1,
|
| 276 |
+
"z-index":10
|
| 277 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show()) :(SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").find("span.bot_arow").removeClass("top_big_arow"),
|
| 278 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").removeClass("sfsi_plc_btm"),
|
| 279 |
+
SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").css({
|
| 280 |
+
opacity:1,
|
| 281 |
+
"z-index":10
|
| 282 |
+
}), SFSI(this).parentsUntil("div").siblings("div.sfsi_plus_tool_tip_2").show());
|
| 283 |
+
}), SFSI("div.sfsi_plus_wicons").on("mouseleave", function() {
|
| 284 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "fade_in" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 285 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "scale" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale"),
|
| 286 |
+
SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && "combo" == SFSI(this).children("div.sfsiplus_inerCnt").children("a.sficn").attr("effect") && (SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").css("opacity", "0.6"),
|
| 287 |
+
SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").removeClass("scale")), "sfsiplusid_google" == SFSI(this).children("div.sfsiplus_inerCnt").find("a.sficn").attr("id") ? SFSI("body").on("click", function() {
|
| 288 |
+
SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 289 |
+
}) :(SFSI(this).css({
|
| 290 |
+
"z-index":"0"
|
| 291 |
+
}), SFSI(this).children(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide());
|
| 292 |
+
}), SFSI("body").on("click", function() {
|
| 293 |
+
SFSI(".sfsiplus_inerCnt").find("div.sfsi_plus_tool_tip_2").hide();
|
| 294 |
+
}), SFSI(".adminTooltip >a").on("hover", function() {
|
| 295 |
+
SFSI(this).offset().top, SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "1"),
|
| 296 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").show();
|
| 297 |
+
}), SFSI(".adminTooltip").on("mouseleave", function() {
|
| 298 |
+
"none" != SFSI(".sfsi_plus_gpls_tool_bdr").css("display") && 0 != SFSI(".sfsi_plus_gpls_tool_bdr").css("opacity") ? SFSI(".pop_up_box ").on("click", function() {
|
| 299 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"), SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide();
|
| 300 |
+
}) :(SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").css("opacity", "0"),
|
| 301 |
+
SFSI(this).parent("div").find("div.sfsi_plus_tool_tip_2_inr").hide());
|
| 302 |
+
}), SFSI(".expand-area").on("click", function() {
|
| 303 |
+
"Read more" == SFSI(this).text() ? (SFSI(this).siblings("p").children("label").fadeIn("slow"),
|
| 304 |
+
SFSI(this).text("Collapse")) :(SFSI(this).siblings("p").children("label").fadeOut("slow"),
|
| 305 |
+
SFSI(this).text("Read more"));
|
| 306 |
+
}), SFSI(".sfsi_plus_wDiv").length > 0 && setTimeout(function() {
|
| 307 |
+
var s = parseInt(SFSI(".sfsi_plus_wDiv").height()) + 15 + "px";
|
| 308 |
+
SFSI(".sfsi_plus_holders").each(function() {
|
| 309 |
+
SFSI(this).css("height", s);
|
| 310 |
+
});
|
| 311 |
+
SFSI(".sfsi_plus_widget").css("min-height", "auto");
|
| 312 |
+
}, 200);
|
| 313 |
+
});
|
| 314 |
+
|
| 315 |
+
//hiding popup on close button
|
| 316 |
+
function sfsiplushidemepopup()
|
| 317 |
+
{
|
| 318 |
+
SFSI(".sfsi_plus_FrntInner").fadeOut();
|
| 319 |
+
}
|
| 320 |
+
|
| 321 |
var sfsiplus_initTop = new Array();
|
js/custom.min.js
CHANGED
|
@@ -1,2 +1,2 @@
|
|
| 1 |
-
function sfsi_plus_update_index(){var s=1;SFSI("ul.icn_listing li.custom").each(function(){SFSI(this).children("span.sfsiplus_custom-txt").html("Custom "+s),s++}),cntt=1,SFSI("div.cm_lnk").each(function(){SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom "+cntt+":"),cntt++}),cntt=1,SFSI("div.custom_m").find("div.sfsiplus_custom_section").each(function(){SFSI(this).find("label").html("Custom "+cntt+":"),cntt++})}function sfsipluscollapse(s){var i=!0,e=SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"),t=SFSI(s).closest("div.ui-accordion-content").first();e.toggleClass("ui-corner-all",i).toggleClass("accordion-header-active ui-state-active ui-corner-top",!i).attr("aria-selected",(!i).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",i).toggleClass("ui-icon-triangle-1-s",!i),t.toggleClass("accordion-content-active",!i),i?t.slideUp():t.slideDown()}function sfsi_plus_delete_CusIcon(s,i){sfsiplus_beForeLoad();var e={action:"deleteIcons",icon_name:i.attr("name")};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,dataType:"json",success:function(e){if("success"==e.res){sfsiplus_showErrorSuc("success","Saved !",1);var t=e.last_index+1;SFSI("#total_cusotm_icons").val(e.total_up),SFSI(s).closest(".custom").remove(),SFSI("li.custom:last").addClass("bdr_btm_non"),SFSI(".custom-links").find("div."+i.attr("name")).remove(),SFSI(".custom_m").find("div."+i.attr("name")).remove(),SFSI(".share_icon_order").children("li."+i.attr("name")).remove(),SFSI("ul.sfsi_sample_icons").children("li."+i.attr("name")).remove();var n=e.total_up+1;4==e.total_up&&SFSI(".icn_listing").append('<li id="c'+t+'" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="sfsiICON_'+t+'_display" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="'+SFSI("#plugin_url").val()+'images/custom.png" id="CImg_'+t+'" /> </span> <span class="custom sfsiplus_custom-txt">Custom'+n+' </span> <div class="sfsiplus_right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>')}else sfsiplus_showErrorSuc("error","Unkown error , please try again",1);return sfsi_plus_update_index(),plus_update_Sec5Iconorder(),sfsi_plus_update_step1(),sfsi_plus_update_step5(),sfsiplus_afterLoad(),"suc"}})}function plus_update_Sec5Iconorder(){SFSI("ul.share_icon_order").children("li").each(function(){SFSI(this).attr("data-index",SFSI(this).index()+1)})}function sfsi_plus_section_Display(s,i){"hide"==i?(SFSI("."+s+" :input").prop("disabled",!0),SFSI("."+s+" :button").prop("disabled",!0),SFSI("."+s).hide()):(SFSI("."+s+" :input").removeAttr("disabled",!0),SFSI("."+s+" :button").removeAttr("disabled",!0),SFSI("."+s).show())}function sfsi_plus_depened_sections(){if("sfsi"==SFSI("input[name='sfsi_rss_icons']:checked").val()){for(i=0;16>i;i++){var s=i+1,e=74*i;SFSI(".sfsiplus_row_"+s+"_2").css("background-position","-588px -"+e+"px")}var t=SFSI(".icon_img").attr("src"),n=t.replace("email.png","sf_asfsiplus_row_icn.png");SFSI(".icon_img").attr("src",n)}else{for(SFSI(".sfsiplus_row_1_2").css("background-position","-58px 0"),i=0;16>i;i++){var s=i+1,e=74*i;SFSI(".sfsiplus_row_"+s+"_2").css("background-position","-58px -"+e+"px")}var t=SFSI(".icon_img").attr("src");if(t){var n=t.replace("sf_asfsiplus_row_icn.png","email.png");SFSI(".icon_img").attr("src",n)}}SFSI("input[name='sfsi_rss_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_rss_section","show"):sfsi_plus_section_Display("sfsiplus_rss_section","hide"),SFSI("input[name='sfsi_email_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_email_section","show"):sfsi_plus_section_Display("sfsiplus_email_section","hide"),SFSI("input[name='sfsi_facebook_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_facebook_section","show"):sfsi_plus_section_Display("sfsiplus_facebook_section","hide"),SFSI("input[name='sfsi_twitter_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_twitter_section","show"):sfsi_plus_section_Display("sfsiplus_twitter_section","hide"),SFSI("input[name='sfsi_google_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_google_section","show"):sfsi_plus_section_Display("sfsiplus_google_section","hide"),SFSI("input[name='sfsi_share_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_share_section","show"):sfsi_plus_section_Display("sfsiplus_share_section","hide"),SFSI("input[name='sfsi_youtube_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_youtube_section","show"):sfsi_plus_section_Display("sfsiplus_youtube_section","hide"),SFSI("input[name='sfsi_pinterest_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_pinterest_section","show"):sfsi_plus_section_Display("sfsiplus_pinterest_section","hide"),SFSI("input[name='sfsi_instagram_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_instagram_section","show"):sfsi_plus_section_Display("sfsiplus_instagram_section","hide"),SFSI("input[name='sfsi_linkedin_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_linkedin_section","show"):sfsi_plus_section_Display("sfsiplus_linkedin_section","hide"),SFSI("input[element-type='cusotm-icon']").prop("checked")?sfsi_plus_section_Display("sfsiplus_custom_section","show"):sfsi_plus_section_Display("sfsiplus_custom_section","hide")}function PlusCustomIConSectionsUpdate(){sfsi_plus_section_Display("counter".ele,show)}function sfsi_customskin_upload(s,i){var e=(jQuery(i).attr("title"),s),t={action:"UploadSkins",custom_imgurl:e};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:t,success:function(e){if(e.res="success"){var t=s.split("=");jQuery(i).prev(".imgskin").attr("src",t[1]),jQuery(i).prev(".imgskin").css("display","block"),jQuery(i).text("Update"),jQuery(i).next(".dlt_btn").css("display","block")}}})}function sfsiplus_deleteskin_icon(s){var i=jQuery(s).attr("title"),e=i,t={action:"DeleteSkin",iconname:e};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:t,success:function(i){(i.res="success")&&(SFSI(s).prev("a").text("Upload"),SFSI(s).prev("a").prev("img").attr("src",""),SFSI(s).prev("a").prev("img").css("display","none"),SFSI(s).css("display","none"))}})}function SFSI_plus_done(){e={action:"Iamdone"},SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,success:function(s){jQuery("li.cstomskins_upload").children(".sfsiplus_icns_tab_3").html(s),SFSI("input[name='sfsi_rss_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_rss_section","show"):sfsi_plus_section_Display("sfsiplus_rss_section","hide"),SFSI("input[name='sfsi_email_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_email_section","show"):sfsi_plus_section_Display("sfsiplus_email_section","hide"),SFSI("input[name='sfsi_facebook_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_facebook_section","show"):sfsi_plus_section_Display("sfsiplus_facebook_section","hide"),SFSI("input[name='sfsi_twitter_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_twitter_section","show"):sfsi_plus_section_Display("sfsiplus_twitter_section","hide"),SFSI("input[name='sfsi_google_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_google_section","show"):sfsi_plus_section_Display("sfsiplus_google_section","hide"),SFSI("input[name='sfsi_share_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_share_section","show"):sfsi_plus_section_Display("sfsiplus_share_section","hide"),SFSI("input[name='sfsi_youtube_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_youtube_section","show"):sfsi_plus_section_Display("sfsiplus_youtube_section","hide"),SFSI("input[name='sfsi_pinterest_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_pinterest_section","show"):sfsi_plus_section_Display("sfsiplus_pinterest_section","hide"),SFSI("input[name='sfsi_instagram_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_instagram_section","show"):sfsi_plus_section_Display("sfsiplus_instagram_section","hide"),SFSI("input[name='sfsi_linkedin_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_linkedin_section","show"):sfsi_plus_section_Display("sfsiplus_linkedin_section","hide"),SFSI("input[element-type='cusotm-icon']").prop("checked")?sfsi_plus_section_Display("sfsiplus_custom_section","show"):sfsi_plus_section_Display("sfsiplus_custom_section","hide"),SFSI(".cstmskins-overlay").hide("slow"),sfsi_plus_update_step3()&&sfsipluscollapse(this)}})}function sfsi_newcustomicon_upload(s){var i=s,e={action:"UploadIcons",custom_imgurl:i};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,dataType:"json",async:!0,success:function(s){sfsiplus_afterIconSuccess(s)}})}function sfsi_plus_update_step1(){global_error=0,sfsiplus_beForeLoad(),sfsi_plus_depened_sections();var s=!1,i=SFSI("input[name='sfsi_rss_display']:checked").val(),e=SFSI("input[name='sfsi_email_display']:checked").val(),t=SFSI("input[name='sfsi_facebook_display']:checked").val(),n=SFSI("input[name='sfsi_twitter_display']:checked").val(),o=SFSI("input[name='sfsi_google_display']:checked").val(),a=SFSI("input[name='sfsi_share_display']:checked").val(),c=SFSI("input[name='sfsi_youtube_display']:checked").val(),r=SFSI("input[name='sfsi_pinterest_display']:checked").val(),p=SFSI("input[name='sfsi_linkedin_display']:checked").val(),_=SFSI("input[name='sfsi_instagram_display']:checked").val(),l=SFSI("input[name='sfsi_custom1_display']:checked").val(),S=SFSI("input[name='sfsi_custom2_display']:checked").val(),u=SFSI("input[name='sfsi_custom3_display']:checked").val(),f=SFSI("input[name='sfsi_custom4_display']:checked").val(),d=SFSI("input[name='sfsi_custom5_display']:checked").val(),m={action:"updateSrcn1",sfsi_rss_display:i,sfsi_email_display:e,sfsi_facebook_display:t,sfsi_twitter_display:n,sfsi_google_display:o,sfsi_share_display:a,sfsi_youtube_display:c,sfsi_pinterest_display:r,sfsi_linkedin_display:p,sfsi_instagram_display:_,sfsi_custom1_display:l,sfsi_custom2_display:S,sfsi_custom3_display:u,sfsi_custom4_display:f,sfsi_custom5_display:d};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:m,async:!0,dataType:"json",success:function(i){"success"==i?(sfsiplus_showErrorSuc("success","Saved !",1),sfsipluscollapse("#sfsi_save1"),sfsi_plus_make_popBox()):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",1),s=!1),sfsiplus_afterLoad()}})}function sfsi_plus_update_step2(){var s=sfsi_plus_validationStep2();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=1==SFSI("input[name='sfsi_rss_url']").prop("disabled")?"":SFSI("input[name='sfsi_rss_url']").val(),e=1==SFSI("input[name='sfsi_rss_icons']").prop("disabled")?"":SFSI("input[name='sfsi_rss_icons']:checked").val(),t=1==SFSI("input[name='sfsi_facebookPage_option']").prop("disabled")?"":SFSI("input[name='sfsi_facebookPage_option']:checked").val(),n=1==SFSI("input[name='sfsi_plus_facebookLike_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebookLike_option']:checked").val(),o=1==SFSI("input[name='sfsi_plus_facebookShare_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebookShare_option']:checked").val(),a=SFSI("input[name='sfsi_facebookPage_url']").val(),c=1==SFSI("input[name='sfsi_plus_twitter_followme']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_followme']:checked").val(),r=1==SFSI("input[name='sfsi_twitter_followUserName']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_followUserName']").val(),p=1==SFSI("input[name='sfsi_plus_twitter_aboutPage']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_aboutPage']:checked").val(),_=1==SFSI("input[name='sfsi_plus_twitter_page']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_page']:checked").val(),l=SFSI("input[name='sfsi_twitter_pageURL']").val(),S=SFSI("textarea[name='sfsi_twitter_aboutPageText']").val(),u=1==SFSI("input[name='sfsi_google_page']").prop("disabled")?"":SFSI("input[name='sfsi_google_page']:checked").val(),f=1==SFSI("input[name='sfsi_googleLike_option']").prop("disabled")?"":SFSI("input[name='sfsi_googleLike_option']:checked").val(),d=SFSI("input[name='sfsi_google_pageURL']").val(),m=1==SFSI("input[name='sfsi_plus_googleShare_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_googleShare_option']:checked").val(),I=1==SFSI("input[name='sfsi_youtube_page']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_page']:checked").val(),F=1==SFSI("input[name='sfsi_plus_youtube_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_pageUrl']").val(),h=1==SFSI("input[name='sfsi_youtube_follow']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_follow']:checked").val(),v=SFSI("input[name='sfsi_plus_youtubeusernameorid']:checked").val(),g=SFSI("input[name='sfsi_plus_ytube_user']").val(),k=SFSI("input[name='sfsi_plus_ytube_chnlid']").val(),y=1==SFSI("input[name='sfsi_plus_pinterest_page']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_page']:checked").val(),b=1==SFSI("input[name='sfsi_plus_pinterest_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_pageUrl']").val(),w=1==SFSI("input[name='sfsi_pinterest_pingBlog']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_pingBlog']:checked").val(),x=1==SFSI("input[name='sfsi_plus_instagram_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_pageUrl']").val(),C=1==SFSI("input[name='sfsi_linkedin_page']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_page']:checked").val(),D=1==SFSI("input[name='sfsi_linkedin_pageURL']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_pageURL']").val(),U=1==SFSI("input[name='sfsi_linkedin_follow']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_follow']:checked").val(),j=SFSI("input[name='sfsi_linkedin_followCompany']").val(),O=1==SFSI("input[name='sfsi_linkedin_SharePage']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_SharePage']:checked").val(),T=SFSI("input[name='sfsi_plus_linkedin_recommendBusines']:checked").val(),P=SFSI("input[name='sfsi_linkedin_recommendProductId']").val(),M=SFSI("input[name='sfsi_linkedin_recommendCompany']").val(),L={};SFSI("input[name='sfsi_plus_CustomIcon_links[]']").each(function(){L[SFSI(this).attr("file-id")]=this.value});var B={action:"updateSrcn2",sfsi_rss_url:i,sfsi_rss_icons:e,sfsi_facebookPage_option:t,sfsi_plus_facebookLike_option:n,sfsi_plus_facebookShare_option:o,sfsi_facebookPage_url:a,sfsi_plus_twitter_followme:c,sfsi_twitter_followUserName:r,sfsi_twitter_aboutPage:p,sfsi_twitter_page:_,sfsi_twitter_pageURL:l,sfsi_twitter_aboutPageText:S,sfsi_google_page:u,sfsi_googleLike_option:f,sfsi_google_pageURL:d,sfsi_plus_googleShare_option:m,sfsi_youtube_page:I,sfsi_youtube_pageUrl:F,sfsi_youtube_follow:h,sfsi_plus_youtubeusernameorid:v,sfsi_plus_ytube_user:g,sfsi_plus_ytube_chnlid:k,sfsi_pinterest_page:y,sfsi_pinterest_pageUrl:b,sfsi_plus_instagram_pageUrl:x,sfsi_pinterest_pingBlog:w,sfsi_linkedin_page:C,sfsi_linkedin_pageURL:D,sfsi_linkedin_follow:U,sfsi_linkedin_followCompany:j,sfsi_linkedin_SharePage:O,sfsi_plus_linkedin_recommendBusines:T,sfsi_linkedin_recommendCompany:M,sfsi_linkedin_recommendProductId:P,sfsi_plus_custom_links:L};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:B,async:!0,dataType:"json",success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",2),sfsipluscollapse("#sfsi_save2"),sfsi_plus_depened_sections()):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",2),return_value=!1),sfsiplus_afterLoad()}})}function sfsi_plus_update_step3(){var s=sfsi_plus_validationStep3();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_actvite_theme']:checked").val(),e=SFSI("input[name='sfsi_mouseOver']:checked").val(),t=SFSI("input[name='sfsi_plus_shuffle_icons']:checked").val(),n=SFSI("input[name='sfsi_plus_shuffle_Firstload']:checked").val(),o=SFSI("#sfsi_mouseOver_effect option:selected").val(),a=SFSI("input[name='sfsi_plus_shuffle_interval']:checked").val(),c=SFSI("input[name='sfsi_plus_shuffle_intervalTime']").val(),r=SFSI("input[name='sfsi_plus_specialIcon_animation']:checked").val(),p=SFSI("input[name='sfsi_plus_specialIcon_MouseOver']:checked").val(),_=SFSI("input[name='sfsi_plus_specialIcon_Firstload']:checked").val(),l=SFSI("#sfsi_plus_specialIcon_Firstload_Icons option:selected").val(),S=SFSI("input[name='sfsi_plus_specialIcon_interval']:checked").val(),u=SFSI("input[name='sfsi_plus_specialIcon_intervalTime']").val(),f=SFSI("#sfsi_plus_specialIcon_intervalIcons option:selected").val(),d={action:"updateSrcn3",sfsi_plus_actvite_theme:i,sfsi_mouseOver:e,sfsi_plus_shuffle_icons:t,sfsi_plus_shuffle_Firstload:n,sfsi_mouseOver_effect:o,sfsi_plus_shuffle_interval:a,sfsi_plus_shuffle_intervalTime:c,sfsi_plus_specialIcon_animation:r,sfsi_plus_specialIcon_MouseOver:p,sfsi_plus_specialIcon_Firstload:_,sfsi_plus_specialIcon_Firstload_Icons:l,sfsi_plus_specialIcon_interval:S,sfsi_plus_specialIcon_intervalTime:u,sfsi_plus_specialIcon_intervalIcons:f};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:d,async:!0,dataType:"json",success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",3),sfsipluscollapse("#sfsi_save3")):(sfsiplus_showErrorSuc("error","Unkown error , please try again",3),return_value=!1),sfsiplus_afterLoad()}})}function sfsi_plus_show_counts(){"yes"==SFSI("input[name='sfsi_display_counts']:checked").val()?(SFSI(".count_sections").slideDown(),sfsi_plus_showPreviewCounts()):(SFSI(".count_sections").slideUp(),sfsi_plus_showPreviewCounts())}function sfsi_plus_showPreviewCounts(){var s=0;1==SFSI("input[name='sfsi_rss_countsDisplay']").prop("checked")?(SFSI("#sfsi_rss_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_rss_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_email_countsDisplay']").prop("checked")?(SFSI("#sfsi_email_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_email_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_facebook_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_twitter_countsDisplay']").prop("checked")?(SFSI("#sfsi_twitter_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_twitter_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_google_countsDisplay']").prop("checked")?(SFSI("#sfsi_google_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_google_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("checked")?(SFSI("#sfsi_linkedIn_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_linkedIn_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_youtube_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("checked")?(SFSI("#sfsi_pinterest_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_pinterest_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_shares_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_plus_shares_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity",0),0==s||"no"==SFSI("input[name='sfsi_display_counts']:checked").val()?SFSI(".sfsi_Cdisplay").hide():SFSI(".sfsi_Cdisplay").show()}function sfsi_plus_show_OnpostsDisplay(){"yes"==SFSI("input[name='sfsi_plus_show_Onposts']:checked").val()?SFSI(".sfsiplus_PostsSettings_section").slideDown():SFSI(".sfsiplus_PostsSettings_section").slideUp()}function sfsi_plus_update_step4(){var s=!1,i=sfsi_plus_validationStep4();if(!i)return global_error=1,!1;sfsiplus_beForeLoad();var e=SFSI("input[name='sfsi_display_counts']:checked").val(),t=1==SFSI("input[name='sfsi_email_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_email_countsDisplay']:checked").val(),n=1==SFSI("input[name='sfsi_email_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_email_countsFrom']:checked").val(),o=SFSI("input[name='sfsi_plus_email_manualCounts']").val(),a=SFSI("input[name='sfsi_plus_google_api_key']").val(),c=1==SFSI("input[name='sfsi_rss_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_rss_countsDisplay']:checked").val(),r=SFSI("input[name='sfsi_plus_rss_manualCounts']").val(),p=1==SFSI("input[name='sfsi_facebook_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_facebook_countsDisplay']:checked").val(),_=1==SFSI("input[name='sfsi_facebook_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_facebook_countsFrom']:checked").val(),l=SFSI("input[name='sfsi_facebook_manualCounts']").val(),S=1==SFSI("input[name='sfsi_twitter_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_countsDisplay']:checked").val(),u=1==SFSI("input[name='sfsi_twitter_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_countsFrom']:checked").val(),f=SFSI("input[name='sfsi_twitter_manualCounts']").val(),d=SFSI("input[name='sfsiplus_tw_consumer_key']").val(),m=SFSI("input[name='sfsiplus_tw_consumer_secret']").val(),I=SFSI("input[name='sfsiplus_tw_oauth_access_token']").val(),F=SFSI("input[name='sfsiplus_tw_oauth_access_token_secret']").val(),h=1==SFSI("input[name='sfsi_google_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_google_countsDisplay']:checked").val(),v=1==SFSI("input[name='sfsi_google_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_google_countsFrom']:checked").val(),g=SFSI("input[name='sfsi_google_manualCounts']").val(),k=1==SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),y=SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),b=SFSI("input[name='sfsi_plus_ln_company']").val(),w=SFSI("input[name='ln_api_key']").val(),x=SFSI("input[name='sfsi_plus_ln_secret_key']").val(),C=SFSI("input[name='ln_oAuth_user_token']").val(),D=1==SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsDisplay']:checked").val(),k=1==SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),y=SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),U=1==SFSI("input[name='sfsi_youtube_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_countsDisplay']:checked").val(),j=1==SFSI("input[name='sfsi_youtube_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_countsFrom']:checked").val(),O=SFSI("input[name='sfsi_youtube_manualCounts']").val(),T=SFSI("input[name='sfsi_youtube_user']").val(),P=1==SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_countsDisplay']:checked").val(),M=1==SFSI("input[name='sfsi_pinterest_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val(),L=SFSI("input[name='sfsi_plus_pinterest_manualCounts']").val(),B=SFSI("input[name='sfsi_plus_pinterest_user']").val(),E=SFSI("input[name='sfsi_plus_pinterest_board']").val(),z=1==SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_countsDisplay']:checked").val(),A=1==SFSI("input[name='sfsi_plus_instagram_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val(),N=SFSI("input[name='sfsi_plus_instagram_manualCounts']").val(),H=SFSI("input[name='sfsi_plus_instagram_User']").val(),R=1==SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_plus_shares_countsDisplay']:checked").val(),Q=1==SFSI("input[name='sfsi_plus_shares_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val(),W=SFSI("input[name='sfsi_plus_shares_manualCounts']").val(),q={action:"updateSrcn4",sfsi_display_counts:e,sfsi_email_countsDisplay:t,sfsi_email_countsFrom:n,sfsi_email_manualCounts:o,sfsi_rss_countsDisplay:c,sfsi_rss_manualCounts:r,sfsi_facebook_countsDisplay:p,sfsi_facebook_countsFrom:_,sfsi_facebook_manualCounts:l,sfsi_twitter_countsDisplay:S,sfsi_twitter_countsFrom:u,sfsi_twitter_manualCounts:f,sfsiplus_tw_consumer_key:d,sfsiplus_tw_consumer_secret:m,sfsiplus_tw_oauth_access_token:I,sfsiplus_tw_oauth_access_token_secret:F,sfsi_google_countsDisplay:h,sfsi_google_countsFrom:v,sfsi_google_manualCounts:g,sfsi_google_api_key:a,sfsi_linkedIn_countsDisplay:D,sfsi_linkedIn_countsFrom:k,sfsi_linkedIn_manualCounts:y,ln_company:b,ln_api_key:w,sfsi_plus_ln_secret_key:x,ln_oAuth_user_token:C,sfsi_youtube_countsDisplay:U,sfsi_youtube_countsFrom:j,sfsi_youtube_manualCounts:O,sfsi_youtube_user:T,sfsi_pinterest_countsDisplay:P,sfsi_pinterest_countsFrom:M,sfsi_plus_pinterest_manualCounts:L,sfsi_plus_pinterest_user:B,sfsi_plus_pinterest_board:E,sfsi_plus_instagram_countsDisplay:z,sfsi_plus_instagram_countsFrom:A,sfsi_plus_instagram_manualCounts:N,sfsi_plus_instagram_User:H,sfsi_plus_shares_countsDisplay:R,sfsi_plus_shares_countsFrom:Q,sfsi_plus_shares_manualCounts:W};return SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:q,dataType:"json",async:!0,success:function(s){"success"==s.res?(sfsiplus_showErrorSuc("success","Saved !",4),sfsipluscollapse("#sfsi_save4"),sfsi_plus_showPreviewCounts()):(sfsiplus_showErrorSuc("error","Unkown error , please try again",4),global_error=1),sfsiplus_afterLoad()}}),s}function sfsi_plus_update_step5(){var s=sfsi_plus_validationStep5();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_icons_size']").val(),e=SFSI("input[name='sfsi_plus_icons_perRow']").val(),t=SFSI("input[name='sfsi_plus_icons_spacing']").val(),n=SFSI("#sfsi_plus_icons_Alignment").val(),o=SFSI("input[name='sfsi_plus_icons_ClickPageOpen']:checked").val(),a=SFSI("input[name='sfsi_plus_icons_float']:checked").val(),c=SFSI("input[name='sfsi_plus_disable_floaticons']:checked").val(),r=SFSI("#sfsi_plus_icons_floatPosition").val(),p=SFSI("input[name='sfsi_plus_icons_stick']:checked").val(),_=SFSI("#sfsi_plus_rssIcon_order").attr("data-index"),l=SFSI("#sfsi_plus_emailIcon_order").attr("data-index"),S=SFSI("#sfsi_plus_googleIcon_order").attr("data-index"),u=SFSI("#sfsi_plus_facebookIcon_order").attr("data-index"),f=SFSI("#sfsi_plus_twitterIcon_order").attr("data-index"),d=SFSI("#sfsi_plus_youtubeIcon_order").attr("data-index"),m=SFSI("#sfsi_plus_pinterestIcon_order").attr("data-index"),I=SFSI("#sfsi_plus_instagramIcon_order").attr("data-index"),F=SFSI("#sfsi_plus_shareIcon_order").attr("data-index"),h=SFSI("#sfsi_plus_linkedinIcon_order").attr("data-index"),v=new Array;SFSI(".sfsiplus_custom_iconOrder").each(function(){v.push({order:SFSI(this).attr("data-index"),ele:SFSI(this).attr("element-id")})});var g=1==SFSI("input[name='sfsi_plus_rss_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_rss_MouseOverText']").val(),k=1==SFSI("input[name='sfsi_plus_email_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_email_MouseOverText']").val(),y=1==SFSI("input[name='sfsi_plus_twitter_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_MouseOverText']").val(),b=1==SFSI("input[name='sfsi_plus_facebook_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebook_MouseOverText']").val(),w=1==SFSI("input[name='sfsi_plus_google_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_google_MouseOverText']").val(),x=1==SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").val(),C=1==SFSI("input[name='sfsi_plus_youtube_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_youtube_MouseOverText']").val(),D=1==SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").val(),U=1==SFSI("input[name='sfsi_plus_instagram_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_MouseOverText']").val(),j=1==SFSI("input[name='sfsi_plus_share_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_share_MouseOverText']").val(),O={};SFSI("input[name='sfsi_plus_custom_MouseOverTexts[]']").each(function(){O[SFSI(this).attr("file-id")]=this.value});var T={action:"updateSrcn5",sfsi_plus_icons_size:i,sfsi_plus_icons_Alignment:n,sfsi_plus_icons_perRow:e,sfsi_plus_icons_spacing:t,sfsi_plus_icons_ClickPageOpen:o,sfsi_plus_icons_float:a,sfsi_plus_disable_floaticons:c,sfsi_plus_icons_floatPosition:r,sfsi_plus_icons_stick:p,sfsi_plus_rss_MouseOverText:g,sfsi_plus_email_MouseOverText:k,sfsi_plus_twitter_MouseOverText:y,sfsi_plus_facebook_MouseOverText:b,sfsi_plus_google_MouseOverText:w,sfsi_plus_youtube_MouseOverText:C,sfsi_plus_linkedIn_MouseOverText:x,sfsi_plus_pinterest_MouseOverText:D,sfsi_plus_share_MouseOverText:j,sfsi_plus_instagram_MouseOverText:U,sfsi_plus_custom_MouseOverTexts:O,sfsi_plus_rssIcon_order:_,sfsi_plus_emailIcon_order:l,sfsi_plus_facebookIcon_order:u,sfsi_plus_twitterIcon_order:f,sfsi_plus_googleIcon_order:S,sfsi_plus_youtubeIcon_order:d,sfsi_plus_pinterestIcon_order:m,sfsi_plus_shareIcon_order:F,sfsi_plus_instagramIcon_order:I,sfsi_plus_linkedinIcon_order:h,sfsi_plus_custom_orders:v};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:T,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",5),sfsipluscollapse("#sfsi_save5")):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",5)),sfsiplus_afterLoad()}})}function sfsi_plus_update_step6(){sfsiplus_beForeLoad();var s=SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(),i=SFSI("input[name='sfsi_plus_textBefor_icons']").val(),e=SFSI("#sfsi_plus_icons_alignment").val(),t=SFSI("#sfsi_plus_icons_DisplayCounts").val(),n={action:"updateSrcn6",sfsi_plus_show_Onposts:s,sfsi_plus_icons_DisplayCounts:t,sfsi_plus_icons_alignment:e,sfsi_plus_textBefor_icons:i};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:n,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",6),sfsipluscollapse("#sfsi_save6")):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",6)),sfsiplus_afterLoad()}})}function sfsi_plus_update_step7(){var s=sfsi_plus_validationStep7();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_popup_text']").val(),e=SFSI("#sfsi_plus_popup_font option:selected").val(),t=(SFSI("#sfsi_plus_popup_fontStyle option:selected").val(),SFSI("input[name='sfsi_plus_popup_fontColor']").val()),n=SFSI("input[name='sfsi_plus_popup_fontSize']").val(),o=SFSI("input[name='sfsi_plus_popup_background_color']").val(),a=SFSI("input[name='sfsi_plus_popup_border_color']").val(),c=SFSI("input[name='sfsi_plus_popup_border_thickness']").val(),r=SFSI("input[name='sfsi_plus_popup_border_shadow']:checked").val(),p=SFSI("input[name='sfsi_plus_Show_popupOn']:checked").val(),_=[];SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s,i){_[s]=SFSI(i).val()});var l=SFSI("input[name='sfsi_plus_Shown_pop']:checked").val(),S=SFSI("input[name='sfsi_plus_Shown_popupOnceTime']").val(),u=SFSI("#sfsi_plus_Shown_popuplimitPerUserTime").val(),f={action:"updateSrcn7",sfsi_plus_popup_text:i,sfsi_plus_popup_font:e,sfsi_plus_popup_fontColor:t,sfsi_plus_popup_fontSize:n,sfsi_plus_popup_background_color:o,sfsi_plus_popup_border_color:a,sfsi_plus_popup_border_thickness:c,sfsi_plus_popup_border_shadow:r,sfsi_plus_Show_popupOn:p,sfsi_plus_Show_popupOn_PageIDs:_,sfsi_plus_Shown_pop:l,sfsi_plus_Shown_popupOnceTime:S,sfsi_plus_Shown_popuplimitPerUserTime:u};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:f,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",7),sfsipluscollapse("#sfsi_save7")):sfsiplus_showErrorSuc("error","Unkown error , please try again",7),sfsiplus_afterLoad()}})}function sfsiplus_afterIconSuccess(s){if(s.res="success"){var i=s.key+1,e=s.element,t=e+1;SFSI("#total_cusotm_icons").val(s.element),SFSI(".upload-overlay").hide("slow"),SFSI(".uperror").html(""),sfsiplus_showErrorSuc("success","Custom Icon updated successfully",1),d=new Date,SFSI("input[name=sfsiICON_"+s.key+"]").removeAttr("ele-type"),SFSI("input[name=sfsiICON_"+s.key+"]").removeAttr("isnew"),SFSI("li.custom:last").removeClass("bdr_btm_non"),SFSI("li.custom:last").children("span.custom-img").children("img").attr("src",s.img_path+"?"+d.getTime()),icons_name=SFSI("li.custom:last").find("input.styled").attr("name");var n=icons_name.split("_");s.key=n[1],s.img_path+="?"+d.getTime(),5>e&&SFSI(".icn_listing").append('<li id="c'+i+'" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="sfsiICON_'+i+'" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="'+SFSI("#plugin_url").val()+'images/custom.png" id="CImg_'+i+'" /> </span> <span class="custom sfsiplus_custom-txt">Custom'+t+' </span> <div class="sfsiplus_right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>'),SFSI(".sfsiplus_custom_section").show(),SFSI(".custom-links").append(' <div class="row sfsiICON_'+s.key+' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="'+s.img_path+"?"+d.getTime()+'" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom '+e+'</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url sfsiplus_custom_section sfsiICON_'+s.key+'" ><label>Link :</label><input file-id="'+s.key+'" name="sfsi_plus_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');var o=SFSI("div.custom_m").find("div.mouseover_field").length;SFSI("div.custom_m").append(0==o%2?'<div class="clear"> </div> <div class="mouseover_field sfsiplus_custom_section sfsiICON_'+s.key+'"><label>Custom '+e+':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="'+s.key+'" /></div>':'<div class="cHover " ><div class="mouseover_field sfsiplus_custom_section sfsiICON_'+s.key+'"><label>Custom '+e+':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="'+s.key+'" /></div>'),SFSI("ul.share_icon_order").append('<li class="sfsiplus_custom_iconOrder sfsiICON_'+s.key+'" data-index="" element-id="'+s.key+'" id=""><a href="#" title="Custom Icon" ><img src="'+s.img_path+'" alt="Linked In" class="sfcm"/></a></li>'),SFSI("ul.sfsi_sample_icons").append('<li class="sfsiICON_'+s.key+'" element-id="'+s.key+'" ><div><img src="'+s.img_path+'" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),sfsi_plus_update_index(),plus_update_Sec5Iconorder(),sfsi_plus_update_step1(),sfsi_plus_update_step2(),sfsi_plus_update_step5(),SFSI(".upload-overlay").css("pointer-events","auto"),sfsi_plus_showPreviewCounts(),sfsiplus_afterLoad()
|
| 2 |
}}function sfsiplus_beforeIconSubmit(s){if(SFSI(".uperror").html("Uploading....."),window.File&&window.FileReader&&window.FileList&&window.Blob){SFSI(s).val()||SFSI(".uperror").html("File is empty");var i=s.files[0].size,e=s.files[0].type;switch(e){case"image/png":case"image/gif":case"image/jpeg":case"image/pjpeg":break;default:return SFSI(".uperror").html("Unsupported file"),!1}return i>1048576?(SFSI(".uperror").html("Image should be less than 1 MB"),!1):!0}return!0}function sfsiplus_bytesToSize(s){var i=["Bytes","KB","MB","GB","TB"];if(0==s)return"0 Bytes";var e=parseInt(Math.floor(Math.log(s)/Math.log(1024)));return Math.round(s/Math.pow(1024,e),2)+" "+i[e]}function sfsiplus_showErrorSuc(s,i,e){if("error"==s)var t="errorMsg";else var t="sucMsg";return SFSI(".tab"+e+">."+t).html(i),SFSI(".tab"+e+">."+t).show(),SFSI(".tab"+e+">."+t).effect("highlight",{},5e3),setTimeout(function(){SFSI("."+t).slideUp("slow")},5e3),!1}function sfsiplus_beForeLoad(){SFSI(".loader-img").show(),SFSI(".save_button >a").html("Saving..."),SFSI(".save_button >a").css("pointer-events","none")}function sfsiplus_afterLoad(){SFSI("input").removeClass("inputError"),SFSI(".save_button >a").html("Save"),SFSI(".tab8>div.save_button >a").html("Save All Settings"),SFSI(".save_button >a").css("pointer-events","auto"),SFSI(".save_button >a").removeAttr("onclick"),SFSI(".loader-img").hide()}function sfsi_plus_make_popBox(){var s=0;SFSI(".sfsi_sample_icons >li").each(function(){"none"!=SFSI(this).css("display")&&(s=1)}),0==s?SFSI(".sfsi_plus_Popinner").hide():SFSI(".sfsi_plus_Popinner").show(),""!=SFSI('input[name="sfsi_plus_popup_text"]').val()?(SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),SFSI(".sfsi_plus_Popinner >h2").show()):SFSI(".sfsi_plus_Popinner >h2").hide(),SFSI(".sfsi_plus_Popinner").css({"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),"border-style":"solid"}),SFSI(".sfsi_plus_Popinner").css("background-color",SFSI('input[name="sfsi_plus_popup_background_color"]').val()),SFSI(".sfsi_plus_Popinner h2").css("font-family",SFSI("#sfsi_plus_popup_font").val()),SFSI(".sfsi_plus_Popinner h2").css("font-style",SFSI("#sfsi_plus_popup_fontStyle").val()),SFSI(".sfsi_plus_Popinner >h2").css("font-size",parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),SFSI(".sfsi_plus_Popinner >h2").css("color",SFSI('input[name="sfsi_plus_popup_fontColor"]').val()+" !important"),"yes"==SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val()?SFSI(".sfsi_plus_Popinner").css("box-shadow","12px 30px 18px #CCCCCC"):SFSI(".sfsi_plus_Popinner").css("box-shadow","none")}function sfsi_plus_stick_widget(s){0==sfsiplus_initTop.length&&(SFSI(".sfsi_plus_widget").each(function(s){sfsiplus_initTop[s]=SFSI(this).position().top}),console.log(sfsiplus_initTop));var i=SFSI(window).scrollTop(),e=[],t=[];SFSI(".sfsi_plus_widget").each(function(s){e[s]=SFSI(this).position().top,t[s]=SFSI(this)});var n=!1;for(var o in e){var a=parseInt(o)+1;e[o]<i&&e[a]>i&&a<e.length?(SFSI(t[o]).css({position:"fixed",top:s}),SFSI(t[a]).css({position:"",top:sfsiplus_initTop[a]}),n=!0):SFSI(t[o]).css({position:"",top:sfsiplus_initTop[o]})}if(!n){var c=e.length-1,r=-1;e.length>1&&(r=e.length-2),sfsiplus_initTop[c]<i?(SFSI(t[c]).css({position:"fixed",top:s}),r>=0&&SFSI(t[r]).css({position:"",top:sfsiplus_initTop[r]})):(SFSI(t[c]).css({position:"",top:sfsiplus_initTop[c]}),r>=0&&e[r]<i)}}function sfsi_plus_float_widget(s){function i(){c="Microsoft Internet Explorer"===navigator.appName?a-document.documentElement.scrollTop:a-window.pageYOffset,Math.abs(c)>0?(window.removeEventListener("scroll",i),a-=c*o,SFSI("#sfsi_plus_floater").css({top:(a+t).toString()+"px"}),setTimeout(i,n)):window.addEventListener("scroll",i,!1)}function e(){var s=SFSI("#sfsi_plus_floater").attr("data-top"),e=parseInt(SFSI("#sfsi_plus_floater").height()),t=parseInt(SFSI("#sfsi_plus_floater").css("top"));parseInt(e)+parseInt(t)<=s?window.addEventListener("scroll",i,!1):(window.removeEventListener("scroll",i),SFSI("#sfsi_plus_floater").css("top",s+"px"))}if("center"==s)var t=window.innerHeight/2;else if("bottom"==s)var t=window.innerHeight-SFSI("#sfsi_plus_floater").height();else var t=parseInt(s);var n=50,o=.1,a=0,c=0;SFSI("#sfsi_plus_floater"),window.onscroll=e}function sfsi_plus_shuffle(){var s=[];SFSI(".sfsi_plus_wicons ").each(function(i){SFSI(this).text().match(/^\s*$/)||(s[i]="<div class='"+SFSI(this).attr("class")+"'>"+SFSI(this).html()+"</div>",SFSI(this).fadeOut("slow"),SFSI(this).insertBefore(SFSI(this).prev(".sfsi_plus_wicons")),SFSI(this).fadeIn("slow"))}),s=sfsiplus_Shuffle(s),$("#sfsi_plus_wDiv").html("");for(var i=0;i<testArray.length;i++)$("#sfsi_plus_wDiv").append(s[i])}function sfsiplus_Shuffle(s){for(var i,e,t=s.length;t;i=parseInt(Math.random()*t),e=s[--t],s[t]=s[i],s[i]=e);return s}function sfsi_plus_setCookie(s,i,e){var t=new Date;t.setTime(t.getTime()+864e5*e);var n="expires="+t.toGMTString();document.cookie=s+"="+i+"; "+n}function sfsfi_plus_getCookie(s){for(var i=s+"=",e=document.cookie.split(";"),t=0;t<e.length;t++){var n=e[t].trim();if(0==n.indexOf(i))return n.substring(i.length,n.length)}return""}function sfsi_plus_hideFooter(){}function showhideutube(s){var i=SFSI(s).children("input").val();"name"==i?(SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown(),SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp()):(SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown(),SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp())}function sfsiplushidemepopup(){SFSI(".sfsi_plus_FrntInner").fadeOut()}jQuery(document).ready(function(){jQuery("#sfsi_plus_floater").attr("data-top",jQuery(document).height())}),window.onerror=function(){},SFSI=jQuery.noConflict(),SFSI(window).load(function(){SFSI("#sfpluspageLoad").fadeOut(2e3)});var global_error=0;SFSI(document).ready(function(s){function i(){SFSI(".uperror").html(""),sfsiplus_afterLoad();var s=SFSI('input[name="'+SFSI("#upload_id").val()+'"]');s.removeAttr("checked");var i=SFSI(s).parent().find("span:first");return SFSI(i).css("background-position","0px 0px"),SFSI(".upload-overlay").hide("slow"),!1}SFSI(".sfsiplus_tab_3_icns").on("click",".cstomskins_upload",function(){SFSI(".cstmskins-overlay").show("slow",function(){e=0})}),SFSI("#custmskin_clspop").live("click",function(){SFSI_plus_done(),SFSI(".cstmskins-overlay").hide("slow")}),SFSI("head").append('<meta http-equiv="Cache-Control" content="no-cache, no-store, must-revalidate" />'),SFSI("head").append('<meta http-equiv="Pragma" content="no-cache" />'),SFSI("head").append('<meta http-equiv="Expires" content="0" />'),SFSI("#accordion").accordion({collapsible:!0,active:!1,heightStyle:"content",event:"click",beforeActivate:function(s,i){if(i.newHeader[0])var e=i.newHeader,t=e.next(".ui-accordion-content");else var e=i.oldHeader,t=e.next(".ui-accordion-content");var n="true"==e.attr("aria-selected");return e.toggleClass("ui-corner-all",n).toggleClass("accordion-header-active ui-state-active ui-corner-top",!n).attr("aria-selected",(!n).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",n).toggleClass("ui-icon-triangle-1-s",!n),t.toggleClass("accordion-content-active",!n),n?t.slideUp():t.slideDown(),!1}}),SFSI("#accordion1").accordion({collapsible:!0,active:!1,heightStyle:"content",event:"click",beforeActivate:function(s,i){if(i.newHeader[0])var e=i.newHeader,t=e.next(".ui-accordion-content");else var e=i.oldHeader,t=e.next(".ui-accordion-content");var n="true"==e.attr("aria-selected");return e.toggleClass("ui-corner-all",n).toggleClass("accordion-header-active ui-state-active ui-corner-top",!n).attr("aria-selected",(!n).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",n).toggleClass("ui-icon-triangle-1-s",!n),t.toggleClass("accordion-content-active",!n),n?t.slideUp():t.slideDown(),!1}}),SFSI(".closeSec").on("click",function(){var s=!0,i=SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(),e=SFSI(this).closest("div.ui-accordion-content").first();i.toggleClass("ui-corner-all",s).toggleClass("accordion-header-active ui-state-active ui-corner-top",!s).attr("aria-selected",(!s).toString()),i.children(".ui-icon
|
| 1 |
+
function sfsi_plus_update_index(){var s=1;SFSI("ul.icn_listing li.custom").each(function(){SFSI(this).children("span.sfsiplus_custom-txt").html("Custom "+s),s++}),cntt=1,SFSI("div.cm_lnk").each(function(){SFSI(this).find("h2.custom").find("span.sfsiCtxt").html("Custom "+cntt+":"),cntt++}),cntt=1,SFSI("div.custom_m").find("div.sfsiplus_custom_section").each(function(){SFSI(this).find("label").html("Custom "+cntt+":"),cntt++})}function sfsipluscollapse(s){var i=!0,e=SFSI(s).closest("div.ui-accordion-content").prev("h3.ui-accordion-header"),t=SFSI(s).closest("div.ui-accordion-content").first();e.toggleClass("ui-corner-all",i).toggleClass("accordion-header-active ui-state-active ui-corner-top",!i).attr("aria-selected",(!i).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",i).toggleClass("ui-icon-triangle-1-s",!i),t.toggleClass("accordion-content-active",!i),i?t.slideUp():t.slideDown()}function sfsi_plus_delete_CusIcon(s,i){sfsiplus_beForeLoad();var e={action:"deleteIcons",icon_name:i.attr("name")};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,dataType:"json",success:function(e){if("success"==e.res){sfsiplus_showErrorSuc("success","Saved !",1);var t=e.last_index+1;SFSI("#total_cusotm_icons").val(e.total_up),SFSI(s).closest(".custom").remove(),SFSI("li.custom:last").addClass("bdr_btm_non"),SFSI(".custom-links").find("div."+i.attr("name")).remove(),SFSI(".custom_m").find("div."+i.attr("name")).remove(),SFSI(".share_icon_order").children("li."+i.attr("name")).remove(),SFSI("ul.sfsi_sample_icons").children("li."+i.attr("name")).remove();var n=e.total_up+1;4==e.total_up&&SFSI(".icn_listing").append('<li id="c'+t+'" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="sfsiICON_'+t+'_display" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="'+SFSI("#plugin_url").val()+'images/custom.png" id="CImg_'+t+'" /> </span> <span class="custom sfsiplus_custom-txt">Custom'+n+' </span> <div class="sfsiplus_right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>')}else sfsiplus_showErrorSuc("error","Unkown error , please try again",1);return sfsi_plus_update_index(),plus_update_Sec5Iconorder(),sfsi_plus_update_step1(),sfsi_plus_update_step5(),sfsiplus_afterLoad(),"suc"}})}function plus_update_Sec5Iconorder(){SFSI("ul.share_icon_order").children("li").each(function(){SFSI(this).attr("data-index",SFSI(this).index()+1)})}function sfsi_plus_section_Display(s,i){"hide"==i?(SFSI("."+s+" :input").prop("disabled",!0),SFSI("."+s+" :button").prop("disabled",!0),SFSI("."+s).hide()):(SFSI("."+s+" :input").removeAttr("disabled",!0),SFSI("."+s+" :button").removeAttr("disabled",!0),SFSI("."+s).show())}function sfsi_plus_depened_sections(){if("sfsi"==SFSI("input[name='sfsi_rss_icons']:checked").val()){for(i=0;16>i;i++){var s=i+1,e=74*i;SFSI(".sfsiplus_row_"+s+"_2").css("background-position","-588px -"+e+"px")}var t=SFSI(".icon_img").attr("src"),n=t.replace("email.png","sf_asfsiplus_row_icn.png");SFSI(".icon_img").attr("src",n)}else{for(SFSI(".sfsiplus_row_1_2").css("background-position","-58px 0"),i=0;16>i;i++){var s=i+1,e=74*i;SFSI(".sfsiplus_row_"+s+"_2").css("background-position","-58px -"+e+"px")}var t=SFSI(".icon_img").attr("src");if(t){var n=t.replace("sf_asfsiplus_row_icn.png","email.png");SFSI(".icon_img").attr("src",n)}}SFSI("input[name='sfsi_rss_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_rss_section","show"):sfsi_plus_section_Display("sfsiplus_rss_section","hide"),SFSI("input[name='sfsi_email_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_email_section","show"):sfsi_plus_section_Display("sfsiplus_email_section","hide"),SFSI("input[name='sfsi_facebook_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_facebook_section","show"):sfsi_plus_section_Display("sfsiplus_facebook_section","hide"),SFSI("input[name='sfsi_twitter_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_twitter_section","show"):sfsi_plus_section_Display("sfsiplus_twitter_section","hide"),SFSI("input[name='sfsi_google_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_google_section","show"):sfsi_plus_section_Display("sfsiplus_google_section","hide"),SFSI("input[name='sfsi_share_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_share_section","show"):sfsi_plus_section_Display("sfsiplus_share_section","hide"),SFSI("input[name='sfsi_youtube_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_youtube_section","show"):sfsi_plus_section_Display("sfsiplus_youtube_section","hide"),SFSI("input[name='sfsi_pinterest_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_pinterest_section","show"):sfsi_plus_section_Display("sfsiplus_pinterest_section","hide"),SFSI("input[name='sfsi_instagram_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_instagram_section","show"):sfsi_plus_section_Display("sfsiplus_instagram_section","hide"),SFSI("input[name='sfsi_linkedin_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_linkedin_section","show"):sfsi_plus_section_Display("sfsiplus_linkedin_section","hide"),SFSI("input[element-type='cusotm-icon']").prop("checked")?sfsi_plus_section_Display("sfsiplus_custom_section","show"):sfsi_plus_section_Display("sfsiplus_custom_section","hide")}function PlusCustomIConSectionsUpdate(){sfsi_plus_section_Display("counter".ele,show)}function sfsi_customskin_upload(s,i){var e=(jQuery(i).attr("title"),s),t={action:"UploadSkins",custom_imgurl:e};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:t,success:function(e){if(e.res="success"){var t=s.split("=");jQuery(i).prev(".imgskin").attr("src",t[1]),jQuery(i).prev(".imgskin").css("display","block"),jQuery(i).text("Update"),jQuery(i).next(".dlt_btn").css("display","block")}}})}function sfsiplus_deleteskin_icon(s){var i=jQuery(s).attr("title"),e=i,t={action:"DeleteSkin",iconname:e};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:t,success:function(i){(i.res="success")&&(SFSI(s).prev("a").text("Upload"),SFSI(s).prev("a").prev("img").attr("src",""),SFSI(s).prev("a").prev("img").css("display","none"),SFSI(s).css("display","none"))}})}function SFSI_plus_done(){e={action:"Iamdone"},SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,success:function(s){jQuery("li.cstomskins_upload").children(".sfsiplus_icns_tab_3").html(s),SFSI("input[name='sfsi_rss_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_rss_section","show"):sfsi_plus_section_Display("sfsiplus_rss_section","hide"),SFSI("input[name='sfsi_email_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_email_section","show"):sfsi_plus_section_Display("sfsiplus_email_section","hide"),SFSI("input[name='sfsi_facebook_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_facebook_section","show"):sfsi_plus_section_Display("sfsiplus_facebook_section","hide"),SFSI("input[name='sfsi_twitter_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_twitter_section","show"):sfsi_plus_section_Display("sfsiplus_twitter_section","hide"),SFSI("input[name='sfsi_google_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_google_section","show"):sfsi_plus_section_Display("sfsiplus_google_section","hide"),SFSI("input[name='sfsi_share_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_share_section","show"):sfsi_plus_section_Display("sfsiplus_share_section","hide"),SFSI("input[name='sfsi_youtube_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_youtube_section","show"):sfsi_plus_section_Display("sfsiplus_youtube_section","hide"),SFSI("input[name='sfsi_pinterest_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_pinterest_section","show"):sfsi_plus_section_Display("sfsiplus_pinterest_section","hide"),SFSI("input[name='sfsi_instagram_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_instagram_section","show"):sfsi_plus_section_Display("sfsiplus_instagram_section","hide"),SFSI("input[name='sfsi_linkedin_display']").prop("checked")?sfsi_plus_section_Display("sfsiplus_linkedin_section","show"):sfsi_plus_section_Display("sfsiplus_linkedin_section","hide"),SFSI("input[element-type='cusotm-icon']").prop("checked")?sfsi_plus_section_Display("sfsiplus_custom_section","show"):sfsi_plus_section_Display("sfsiplus_custom_section","hide"),SFSI(".cstmskins-overlay").hide("slow"),sfsi_plus_update_step3()&&sfsipluscollapse(this)}})}function sfsi_newcustomicon_upload(s){var i=s,e={action:"UploadIcons",custom_imgurl:i};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:e,dataType:"json",async:!0,success:function(s){sfsiplus_afterIconSuccess(s)}})}function sfsi_plus_update_step1(){global_error=0,sfsiplus_beForeLoad(),sfsi_plus_depened_sections();var s=!1,i=SFSI("input[name='sfsi_rss_display']:checked").val(),e=SFSI("input[name='sfsi_email_display']:checked").val(),t=SFSI("input[name='sfsi_facebook_display']:checked").val(),n=SFSI("input[name='sfsi_twitter_display']:checked").val(),o=SFSI("input[name='sfsi_google_display']:checked").val(),a=SFSI("input[name='sfsi_share_display']:checked").val(),c=SFSI("input[name='sfsi_youtube_display']:checked").val(),r=SFSI("input[name='sfsi_pinterest_display']:checked").val(),p=SFSI("input[name='sfsi_linkedin_display']:checked").val(),_=SFSI("input[name='sfsi_instagram_display']:checked").val(),l=SFSI("input[name='sfsi_custom1_display']:checked").val(),S=SFSI("input[name='sfsi_custom2_display']:checked").val(),u=SFSI("input[name='sfsi_custom3_display']:checked").val(),f=SFSI("input[name='sfsi_custom4_display']:checked").val(),d=SFSI("input[name='sfsi_custom5_display']:checked").val(),m={action:"updateSrcn1",sfsi_rss_display:i,sfsi_email_display:e,sfsi_facebook_display:t,sfsi_twitter_display:n,sfsi_google_display:o,sfsi_share_display:a,sfsi_youtube_display:c,sfsi_pinterest_display:r,sfsi_linkedin_display:p,sfsi_instagram_display:_,sfsi_custom1_display:l,sfsi_custom2_display:S,sfsi_custom3_display:u,sfsi_custom4_display:f,sfsi_custom5_display:d};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:m,async:!0,dataType:"json",success:function(i){"success"==i?(sfsiplus_showErrorSuc("success","Saved !",1),sfsipluscollapse("#sfsi_save1"),sfsi_plus_make_popBox()):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",1),s=!1),sfsiplus_afterLoad()}})}function sfsi_plus_update_step2(){var s=sfsi_plus_validationStep2();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=1==SFSI("input[name='sfsi_rss_url']").prop("disabled")?"":SFSI("input[name='sfsi_rss_url']").val(),e=1==SFSI("input[name='sfsi_rss_icons']").prop("disabled")?"":SFSI("input[name='sfsi_rss_icons']:checked").val(),t=1==SFSI("input[name='sfsi_facebookPage_option']").prop("disabled")?"":SFSI("input[name='sfsi_facebookPage_option']:checked").val(),n=1==SFSI("input[name='sfsi_plus_facebookLike_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebookLike_option']:checked").val(),o=1==SFSI("input[name='sfsi_plus_facebookShare_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebookShare_option']:checked").val(),a=SFSI("input[name='sfsi_facebookPage_url']").val(),c=1==SFSI("input[name='sfsi_plus_twitter_followme']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_followme']:checked").val(),r=1==SFSI("input[name='sfsi_twitter_followUserName']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_followUserName']").val(),p=1==SFSI("input[name='sfsi_plus_twitter_aboutPage']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_aboutPage']:checked").val(),_=1==SFSI("input[name='sfsi_plus_twitter_page']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_page']:checked").val(),l=SFSI("input[name='sfsi_twitter_pageURL']").val(),S=SFSI("textarea[name='sfsi_twitter_aboutPageText']").val(),u=1==SFSI("input[name='sfsi_google_page']").prop("disabled")?"":SFSI("input[name='sfsi_google_page']:checked").val(),f=1==SFSI("input[name='sfsi_googleLike_option']").prop("disabled")?"":SFSI("input[name='sfsi_googleLike_option']:checked").val(),d=SFSI("input[name='sfsi_google_pageURL']").val(),m=1==SFSI("input[name='sfsi_plus_googleShare_option']").prop("disabled")?"":SFSI("input[name='sfsi_plus_googleShare_option']:checked").val(),I=1==SFSI("input[name='sfsi_youtube_page']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_page']:checked").val(),F=1==SFSI("input[name='sfsi_plus_youtube_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_pageUrl']").val(),h=1==SFSI("input[name='sfsi_youtube_follow']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_follow']:checked").val(),v=SFSI("input[name='sfsi_plus_youtubeusernameorid']:checked").val(),g=SFSI("input[name='sfsi_plus_ytube_user']").val(),k=SFSI("input[name='sfsi_plus_ytube_chnlid']").val(),y=1==SFSI("input[name='sfsi_plus_pinterest_page']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_page']:checked").val(),b=1==SFSI("input[name='sfsi_plus_pinterest_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_pageUrl']").val(),w=1==SFSI("input[name='sfsi_pinterest_pingBlog']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_pingBlog']:checked").val(),x=1==SFSI("input[name='sfsi_plus_instagram_pageUrl']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_pageUrl']").val(),C=1==SFSI("input[name='sfsi_linkedin_page']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_page']:checked").val(),D=1==SFSI("input[name='sfsi_linkedin_pageURL']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_pageURL']").val(),U=1==SFSI("input[name='sfsi_linkedin_follow']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_follow']:checked").val(),j=SFSI("input[name='sfsi_linkedin_followCompany']").val(),O=1==SFSI("input[name='sfsi_linkedin_SharePage']").prop("disabled")?"":SFSI("input[name='sfsi_linkedin_SharePage']:checked").val(),T=SFSI("input[name='sfsi_plus_linkedin_recommendBusines']:checked").val(),P=SFSI("input[name='sfsi_linkedin_recommendProductId']").val(),M=SFSI("input[name='sfsi_linkedin_recommendCompany']").val(),L={};SFSI("input[name='sfsi_plus_CustomIcon_links[]']").each(function(){L[SFSI(this).attr("file-id")]=this.value});var B={action:"updateSrcn2",sfsi_rss_url:i,sfsi_rss_icons:e,sfsi_facebookPage_option:t,sfsi_plus_facebookLike_option:n,sfsi_plus_facebookShare_option:o,sfsi_facebookPage_url:a,sfsi_plus_twitter_followme:c,sfsi_twitter_followUserName:r,sfsi_twitter_aboutPage:p,sfsi_twitter_page:_,sfsi_twitter_pageURL:l,sfsi_twitter_aboutPageText:S,sfsi_google_page:u,sfsi_googleLike_option:f,sfsi_google_pageURL:d,sfsi_plus_googleShare_option:m,sfsi_youtube_page:I,sfsi_youtube_pageUrl:F,sfsi_youtube_follow:h,sfsi_plus_youtubeusernameorid:v,sfsi_plus_ytube_user:g,sfsi_plus_ytube_chnlid:k,sfsi_pinterest_page:y,sfsi_pinterest_pageUrl:b,sfsi_plus_instagram_pageUrl:x,sfsi_pinterest_pingBlog:w,sfsi_linkedin_page:C,sfsi_linkedin_pageURL:D,sfsi_linkedin_follow:U,sfsi_linkedin_followCompany:j,sfsi_linkedin_SharePage:O,sfsi_plus_linkedin_recommendBusines:T,sfsi_linkedin_recommendCompany:M,sfsi_linkedin_recommendProductId:P,sfsi_plus_custom_links:L};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:B,async:!0,dataType:"json",success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",2),sfsipluscollapse("#sfsi_save2"),sfsi_plus_depened_sections()):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",2),return_value=!1),sfsiplus_afterLoad()}})}function sfsi_plus_update_step3(){var s=sfsi_plus_validationStep3();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_actvite_theme']:checked").val(),e=SFSI("input[name='sfsi_mouseOver']:checked").val(),t=SFSI("input[name='sfsi_plus_shuffle_icons']:checked").val(),n=SFSI("input[name='sfsi_plus_shuffle_Firstload']:checked").val(),o=SFSI("#sfsi_mouseOver_effect option:selected").val(),a=SFSI("input[name='sfsi_plus_shuffle_interval']:checked").val(),c=SFSI("input[name='sfsi_plus_shuffle_intervalTime']").val(),r=SFSI("input[name='sfsi_plus_specialIcon_animation']:checked").val(),p=SFSI("input[name='sfsi_plus_specialIcon_MouseOver']:checked").val(),_=SFSI("input[name='sfsi_plus_specialIcon_Firstload']:checked").val(),l=SFSI("#sfsi_plus_specialIcon_Firstload_Icons option:selected").val(),S=SFSI("input[name='sfsi_plus_specialIcon_interval']:checked").val(),u=SFSI("input[name='sfsi_plus_specialIcon_intervalTime']").val(),f=SFSI("#sfsi_plus_specialIcon_intervalIcons option:selected").val(),d={action:"updateSrcn3",sfsi_plus_actvite_theme:i,sfsi_mouseOver:e,sfsi_plus_shuffle_icons:t,sfsi_plus_shuffle_Firstload:n,sfsi_mouseOver_effect:o,sfsi_plus_shuffle_interval:a,sfsi_plus_shuffle_intervalTime:c,sfsi_plus_specialIcon_animation:r,sfsi_plus_specialIcon_MouseOver:p,sfsi_plus_specialIcon_Firstload:_,sfsi_plus_specialIcon_Firstload_Icons:l,sfsi_plus_specialIcon_interval:S,sfsi_plus_specialIcon_intervalTime:u,sfsi_plus_specialIcon_intervalIcons:f};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:d,async:!0,dataType:"json",success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",3),sfsipluscollapse("#sfsi_save3")):(sfsiplus_showErrorSuc("error","Unkown error , please try again",3),return_value=!1),sfsiplus_afterLoad()}})}function sfsi_plus_show_counts(){"yes"==SFSI("input[name='sfsi_display_counts']:checked").val()?(SFSI(".count_sections").slideDown(),sfsi_plus_showPreviewCounts()):(SFSI(".count_sections").slideUp(),sfsi_plus_showPreviewCounts())}function sfsi_plus_showPreviewCounts(){var s=0;1==SFSI("input[name='sfsi_rss_countsDisplay']").prop("checked")?(SFSI("#sfsi_rss_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_rss_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_email_countsDisplay']").prop("checked")?(SFSI("#sfsi_email_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_email_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_facebook_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_facebook_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_facebook_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_twitter_countsDisplay']").prop("checked")?(SFSI("#sfsi_twitter_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_twitter_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_google_countsDisplay']").prop("checked")?(SFSI("#sfsi_google_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_google_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("checked")?(SFSI("#sfsi_linkedIn_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_linkedIn_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_youtube_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_youtube_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_youtube_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_pinterest_countsDisplay']").prop("checked")?(SFSI("#sfsi_pinterest_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_pinterest_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_shares_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_plus_shares_countsDisplay").css("opacity",0),1==SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("checked")?(SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity",1),s=1):SFSI("#sfsi_plus_instagram_countsDisplay").css("opacity",0),0==s||"no"==SFSI("input[name='sfsi_display_counts']:checked").val()?SFSI(".sfsi_Cdisplay").hide():SFSI(".sfsi_Cdisplay").show()}function sfsi_plus_show_OnpostsDisplay(){"yes"==SFSI("input[name='sfsi_plus_show_Onposts']:checked").val()?SFSI(".sfsiplus_PostsSettings_section").slideDown():SFSI(".sfsiplus_PostsSettings_section").slideUp()}function sfsi_plus_update_step4(){var s=!1,i=sfsi_plus_validationStep4();if(!i)return global_error=1,!1;sfsiplus_beForeLoad();var e=SFSI("input[name='sfsi_display_counts']:checked").val(),t=1==SFSI("input[name='sfsi_email_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_email_countsDisplay']:checked").val(),n=1==SFSI("input[name='sfsi_email_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_email_countsFrom']:checked").val(),o=SFSI("input[name='sfsi_plus_email_manualCounts']").val(),a=SFSI("input[name='sfsi_plus_google_api_key']").val(),c=1==SFSI("input[name='sfsi_rss_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_rss_countsDisplay']:checked").val(),r=SFSI("input[name='sfsi_plus_rss_manualCounts']").val(),p=1==SFSI("input[name='sfsi_facebook_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_facebook_countsDisplay']:checked").val(),_=1==SFSI("input[name='sfsi_facebook_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_facebook_countsFrom']:checked").val(),l=SFSI("input[name='sfsi_facebook_manualCounts']").val(),S=1==SFSI("input[name='sfsi_twitter_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_countsDisplay']:checked").val(),u=1==SFSI("input[name='sfsi_twitter_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_twitter_countsFrom']:checked").val(),f=SFSI("input[name='sfsi_twitter_manualCounts']").val(),d=SFSI("input[name='sfsiplus_tw_consumer_key']").val(),m=SFSI("input[name='sfsiplus_tw_consumer_secret']").val(),I=SFSI("input[name='sfsiplus_tw_oauth_access_token']").val(),F=SFSI("input[name='sfsiplus_tw_oauth_access_token_secret']").val(),h=1==SFSI("input[name='sfsi_google_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_google_countsDisplay']:checked").val(),v=1==SFSI("input[name='sfsi_google_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_google_countsFrom']:checked").val(),g=SFSI("input[name='sfsi_google_manualCounts']").val(),k=1==SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),y=SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),b=SFSI("input[name='sfsi_plus_ln_company']").val(),w=SFSI("input[name='ln_api_key']").val(),x=SFSI("input[name='sfsi_plus_ln_secret_key']").val(),C=SFSI("input[name='ln_oAuth_user_token']").val(),D=1==SFSI("input[name='sfsi_linkedIn_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsDisplay']:checked").val(),k=1==SFSI("input[name='sfsi_linkedIn_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_linkedIn_countsFrom']:checked").val(),y=SFSI("input[name='sfsi_linkedIn_manualCounts']").val(),U=1==SFSI("input[name='sfsi_youtube_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_countsDisplay']:checked").val(),j=1==SFSI("input[name='sfsi_youtube_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_youtube_countsFrom']:checked").val(),O=SFSI("input[name='sfsi_youtube_manualCounts']").val(),T=SFSI("input[name='sfsi_youtube_user']").val(),P=1==SFSI("input[name='sfsi_pinterest_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_countsDisplay']:checked").val(),M=1==SFSI("input[name='sfsi_pinterest_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_pinterest_countsFrom']:checked").val(),L=SFSI("input[name='sfsi_plus_pinterest_manualCounts']").val(),B=SFSI("input[name='sfsi_plus_pinterest_user']").val(),E=SFSI("input[name='sfsi_plus_pinterest_board']").val(),z=1==SFSI("input[name='sfsi_plus_instagram_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_countsDisplay']:checked").val(),A=1==SFSI("input[name='sfsi_plus_instagram_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_countsFrom']:checked").val(),N=SFSI("input[name='sfsi_plus_instagram_manualCounts']").val(),H=SFSI("input[name='sfsi_plus_instagram_User']").val(),R=1==SFSI("input[name='sfsi_plus_shares_countsDisplay']").prop("disabled")?"":SFSI("input[name='sfsi_plus_shares_countsDisplay']:checked").val(),Q=1==SFSI("input[name='sfsi_plus_shares_countsFrom']").prop("disabled")?"":SFSI("input[name='sfsi_plus_shares_countsFrom']:checked").val(),W=SFSI("input[name='sfsi_plus_shares_manualCounts']").val(),q={action:"updateSrcn4",sfsi_display_counts:e,sfsi_email_countsDisplay:t,sfsi_email_countsFrom:n,sfsi_email_manualCounts:o,sfsi_rss_countsDisplay:c,sfsi_rss_manualCounts:r,sfsi_facebook_countsDisplay:p,sfsi_facebook_countsFrom:_,sfsi_facebook_manualCounts:l,sfsi_twitter_countsDisplay:S,sfsi_twitter_countsFrom:u,sfsi_twitter_manualCounts:f,sfsiplus_tw_consumer_key:d,sfsiplus_tw_consumer_secret:m,sfsiplus_tw_oauth_access_token:I,sfsiplus_tw_oauth_access_token_secret:F,sfsi_google_countsDisplay:h,sfsi_google_countsFrom:v,sfsi_google_manualCounts:g,sfsi_google_api_key:a,sfsi_linkedIn_countsDisplay:D,sfsi_linkedIn_countsFrom:k,sfsi_linkedIn_manualCounts:y,ln_company:b,ln_api_key:w,sfsi_plus_ln_secret_key:x,ln_oAuth_user_token:C,sfsi_youtube_countsDisplay:U,sfsi_youtube_countsFrom:j,sfsi_youtube_manualCounts:O,sfsi_youtube_user:T,sfsi_pinterest_countsDisplay:P,sfsi_pinterest_countsFrom:M,sfsi_plus_pinterest_manualCounts:L,sfsi_plus_pinterest_user:B,sfsi_plus_pinterest_board:E,sfsi_plus_instagram_countsDisplay:z,sfsi_plus_instagram_countsFrom:A,sfsi_plus_instagram_manualCounts:N,sfsi_plus_instagram_User:H,sfsi_plus_shares_countsDisplay:R,sfsi_plus_shares_countsFrom:Q,sfsi_plus_shares_manualCounts:W};return SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:q,dataType:"json",async:!0,success:function(s){"success"==s.res?(sfsiplus_showErrorSuc("success","Saved !",4),sfsipluscollapse("#sfsi_save4"),sfsi_plus_showPreviewCounts()):(sfsiplus_showErrorSuc("error","Unkown error , please try again",4),global_error=1),sfsiplus_afterLoad()}}),s}function sfsi_plus_update_step5(){var s=sfsi_plus_validationStep5();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_icons_size']").val(),e=SFSI("input[name='sfsi_plus_icons_perRow']").val(),t=SFSI("input[name='sfsi_plus_icons_spacing']").val(),n=SFSI("#sfsi_plus_icons_Alignment").val(),o=SFSI("input[name='sfsi_plus_icons_ClickPageOpen']:checked").val(),a=SFSI("input[name='sfsi_plus_icons_float']:checked").val(),c=SFSI("input[name='sfsi_plus_disable_floaticons']:checked").val(),r=SFSI("#sfsi_plus_icons_floatPosition").val(),p=SFSI("input[name='sfsi_plus_icons_stick']:checked").val(),_=SFSI("#sfsi_plus_rssIcon_order").attr("data-index"),l=SFSI("#sfsi_plus_emailIcon_order").attr("data-index"),S=SFSI("#sfsi_plus_googleIcon_order").attr("data-index"),u=SFSI("#sfsi_plus_facebookIcon_order").attr("data-index"),f=SFSI("#sfsi_plus_twitterIcon_order").attr("data-index"),d=SFSI("#sfsi_plus_youtubeIcon_order").attr("data-index"),m=SFSI("#sfsi_plus_pinterestIcon_order").attr("data-index"),I=SFSI("#sfsi_plus_instagramIcon_order").attr("data-index"),F=SFSI("#sfsi_plus_shareIcon_order").attr("data-index"),h=SFSI("#sfsi_plus_linkedinIcon_order").attr("data-index"),v=new Array;SFSI(".sfsiplus_custom_iconOrder").each(function(){v.push({order:SFSI(this).attr("data-index"),ele:SFSI(this).attr("element-id")})});var g=1==SFSI("input[name='sfsi_plus_rss_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_rss_MouseOverText']").val(),k=1==SFSI("input[name='sfsi_plus_email_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_email_MouseOverText']").val(),y=1==SFSI("input[name='sfsi_plus_twitter_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_twitter_MouseOverText']").val(),b=1==SFSI("input[name='sfsi_plus_facebook_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_facebook_MouseOverText']").val(),w=1==SFSI("input[name='sfsi_plus_google_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_google_MouseOverText']").val(),x=1==SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_linkedIn_MouseOverText']").val(),C=1==SFSI("input[name='sfsi_plus_youtube_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_youtube_MouseOverText']").val(),D=1==SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_pinterest_MouseOverText']").val(),U=1==SFSI("input[name='sfsi_plus_instagram_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_instagram_MouseOverText']").val(),j=1==SFSI("input[name='sfsi_plus_share_MouseOverText']").prop("disabled")?"":SFSI("input[name='sfsi_plus_share_MouseOverText']").val(),O={};SFSI("input[name='sfsi_plus_custom_MouseOverTexts[]']").each(function(){O[SFSI(this).attr("file-id")]=this.value});var T={action:"updateSrcn5",sfsi_plus_icons_size:i,sfsi_plus_icons_Alignment:n,sfsi_plus_icons_perRow:e,sfsi_plus_icons_spacing:t,sfsi_plus_icons_ClickPageOpen:o,sfsi_plus_icons_float:a,sfsi_plus_disable_floaticons:c,sfsi_plus_icons_floatPosition:r,sfsi_plus_icons_stick:p,sfsi_plus_rss_MouseOverText:g,sfsi_plus_email_MouseOverText:k,sfsi_plus_twitter_MouseOverText:y,sfsi_plus_facebook_MouseOverText:b,sfsi_plus_google_MouseOverText:w,sfsi_plus_youtube_MouseOverText:C,sfsi_plus_linkedIn_MouseOverText:x,sfsi_plus_pinterest_MouseOverText:D,sfsi_plus_share_MouseOverText:j,sfsi_plus_instagram_MouseOverText:U,sfsi_plus_custom_MouseOverTexts:O,sfsi_plus_rssIcon_order:_,sfsi_plus_emailIcon_order:l,sfsi_plus_facebookIcon_order:u,sfsi_plus_twitterIcon_order:f,sfsi_plus_googleIcon_order:S,sfsi_plus_youtubeIcon_order:d,sfsi_plus_pinterestIcon_order:m,sfsi_plus_shareIcon_order:F,sfsi_plus_instagramIcon_order:I,sfsi_plus_linkedinIcon_order:h,sfsi_plus_custom_orders:v};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:T,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",5),sfsipluscollapse("#sfsi_save5")):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",5)),sfsiplus_afterLoad()}})}function sfsi_plus_update_step6(){sfsiplus_beForeLoad();var s=SFSI("input[name='sfsi_plus_show_Onposts']:checked").val(),i=SFSI("input[name='sfsi_plus_textBefor_icons']").val(),e=SFSI("#sfsi_plus_icons_alignment").val(),t=SFSI("#sfsi_plus_icons_DisplayCounts").val(),n={action:"updateSrcn6",sfsi_plus_show_Onposts:s,sfsi_plus_icons_DisplayCounts:t,sfsi_plus_icons_alignment:e,sfsi_plus_textBefor_icons:i};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:n,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",6),sfsipluscollapse("#sfsi_save6")):(global_error=1,sfsiplus_showErrorSuc("error","Unkown error , please try again",6)),sfsiplus_afterLoad()}})}function sfsi_plus_update_step7(){var s=sfsi_plus_validationStep7();if(!s)return global_error=1,!1;sfsiplus_beForeLoad();var i=SFSI("input[name='sfsi_plus_popup_text']").val(),e=SFSI("#sfsi_plus_popup_font option:selected").val(),t=(SFSI("#sfsi_plus_popup_fontStyle option:selected").val(),SFSI("input[name='sfsi_plus_popup_fontColor']").val()),n=SFSI("input[name='sfsi_plus_popup_fontSize']").val(),o=SFSI("input[name='sfsi_plus_popup_background_color']").val(),a=SFSI("input[name='sfsi_plus_popup_border_color']").val(),c=SFSI("input[name='sfsi_plus_popup_border_thickness']").val(),r=SFSI("input[name='sfsi_plus_popup_border_shadow']:checked").val(),p=SFSI("input[name='sfsi_plus_Show_popupOn']:checked").val(),_=[];SFSI("#sfsi_plus_Show_popupOn_PageIDs :selected").each(function(s,i){_[s]=SFSI(i).val()});var l=SFSI("input[name='sfsi_plus_Shown_pop']:checked").val(),S=SFSI("input[name='sfsi_plus_Shown_popupOnceTime']").val(),u=SFSI("#sfsi_plus_Shown_popuplimitPerUserTime").val(),f={action:"updateSrcn7",sfsi_plus_popup_text:i,sfsi_plus_popup_font:e,sfsi_plus_popup_fontColor:t,sfsi_plus_popup_fontSize:n,sfsi_plus_popup_background_color:o,sfsi_plus_popup_border_color:a,sfsi_plus_popup_border_thickness:c,sfsi_plus_popup_border_shadow:r,sfsi_plus_Show_popupOn:p,sfsi_plus_Show_popupOn_PageIDs:_,sfsi_plus_Shown_pop:l,sfsi_plus_Shown_popupOnceTime:S,sfsi_plus_Shown_popuplimitPerUserTime:u};SFSI.ajax({url:ajax_object.ajax_url,type:"post",data:f,dataType:"json",async:!0,success:function(s){"success"==s?(sfsiplus_showErrorSuc("success","Saved !",7),sfsipluscollapse("#sfsi_save7")):sfsiplus_showErrorSuc("error","Unkown error , please try again",7),sfsiplus_afterLoad()}})}function sfsiplus_afterIconSuccess(s){if(s.res="success"){var i=s.key+1,e=s.element,t=e+1;SFSI("#total_cusotm_icons").val(s.element),SFSI(".upload-overlay").hide("slow"),SFSI(".uperror").html(""),sfsiplus_showErrorSuc("success","Custom Icon updated successfully",1),d=new Date,SFSI("input[name=sfsiICON_"+s.key+"]").removeAttr("ele-type"),SFSI("input[name=sfsiICON_"+s.key+"]").removeAttr("isnew"),SFSI("li.custom:last").removeClass("bdr_btm_non"),SFSI("li.custom:last").children("span.custom-img").children("img").attr("src",s.img_path+"?"+d.getTime()),icons_name=SFSI("li.custom:last").find("input.styled").attr("name");var n=icons_name.split("_");s.key=n[1],s.img_path+="?"+d.getTime(),5>e&&SFSI(".icn_listing").append('<li id="c'+i+'" class="custom bdr_btm_non"><div class="radio_section tb_4_ck"><span class="checkbox" dynamic_ele="yes" style="background-position: 0px 0px;"></span><input name="sfsiICON_'+i+'" type="checkbox" value="yes" class="styled" style="display:none;" element-type="cusotm-icon" isNew="yes" /></div> <span class="custom-img"><img src="'+SFSI("#plugin_url").val()+'images/custom.png" id="CImg_'+i+'" /> </span> <span class="custom sfsiplus_custom-txt">Custom'+t+' </span> <div class="sfsiplus_right_info"> <p><span>It depends:</span> Upload a custom icon if you have other accounts/websites you want to link to.</p><div class="inputWrapper"></div></li>'),SFSI(".sfsiplus_custom_section").show(),SFSI(".custom-links").append(' <div class="row sfsiICON_'+s.key+' cm_lnk"> <h2 class="custom"> <span class="customstep2-img"> <img src="'+s.img_path+"?"+d.getTime()+'" style="border-radius:48%" /> </span> <span class="sfsiCtxt">Custom '+e+'</span> </h2> <div class="inr_cont "><p>Where do you want this icon to link to?</p> <p class="radio_section fb_url sfsiplus_custom_section sfsiICON_'+s.key+'" ><label>Link :</label><input file-id="'+s.key+'" name="sfsi_plus_CustomIcon_links[]" type="text" value="" placeholder="http://" class="add" /></p></div></div>');var o=SFSI("div.custom_m").find("div.mouseover_field").length;SFSI("div.custom_m").append(0==o%2?'<div class="clear"> </div> <div class="mouseover_field sfsiplus_custom_section sfsiICON_'+s.key+'"><label>Custom '+e+':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="'+s.key+'" /></div>':'<div class="cHover " ><div class="mouseover_field sfsiplus_custom_section sfsiICON_'+s.key+'"><label>Custom '+e+':</label><input name="sfsi_plus_custom_MouseOverTexts[]" value="" type="text" file-id="'+s.key+'" /></div>'),SFSI("ul.share_icon_order").append('<li class="sfsiplus_custom_iconOrder sfsiICON_'+s.key+'" data-index="" element-id="'+s.key+'" id=""><a href="#" title="Custom Icon" ><img src="'+s.img_path+'" alt="Linked In" class="sfcm"/></a></li>'),SFSI("ul.sfsi_sample_icons").append('<li class="sfsiICON_'+s.key+'" element-id="'+s.key+'" ><div><img src="'+s.img_path+'" alt="Linked In" class="sfcm"/><span class="sfsi_Cdisplay">12k</span></div></li>'),sfsi_plus_update_index(),plus_update_Sec5Iconorder(),sfsi_plus_update_step1(),sfsi_plus_update_step2(),sfsi_plus_update_step5(),SFSI(".upload-overlay").css("pointer-events","auto"),sfsi_plus_showPreviewCounts(),sfsiplus_afterLoad()
|
| 2 |
}}function sfsiplus_beforeIconSubmit(s){if(SFSI(".uperror").html("Uploading....."),window.File&&window.FileReader&&window.FileList&&window.Blob){SFSI(s).val()||SFSI(".uperror").html("File is empty");var i=s.files[0].size,e=s.files[0].type;switch(e){case"image/png":case"image/gif":case"image/jpeg":case"image/pjpeg":break;default:return SFSI(".uperror").html("Unsupported file"),!1}return i>1048576?(SFSI(".uperror").html("Image should be less than 1 MB"),!1):!0}return!0}function sfsiplus_bytesToSize(s){var i=["Bytes","KB","MB","GB","TB"];if(0==s)return"0 Bytes";var e=parseInt(Math.floor(Math.log(s)/Math.log(1024)));return Math.round(s/Math.pow(1024,e),2)+" "+i[e]}function sfsiplus_showErrorSuc(s,i,e){if("error"==s)var t="errorMsg";else var t="sucMsg";return SFSI(".tab"+e+">."+t).html(i),SFSI(".tab"+e+">."+t).show(),SFSI(".tab"+e+">."+t).effect("highlight",{},5e3),setTimeout(function(){SFSI("."+t).slideUp("slow")},5e3),!1}function sfsiplus_beForeLoad(){SFSI(".loader-img").show(),SFSI(".save_button >a").html("Saving..."),SFSI(".save_button >a").css("pointer-events","none")}function sfsiplus_afterLoad(){SFSI("input").removeClass("inputError"),SFSI(".save_button >a").html("Save"),SFSI(".tab8>div.save_button >a").html("Save All Settings"),SFSI(".save_button >a").css("pointer-events","auto"),SFSI(".save_button >a").removeAttr("onclick"),SFSI(".loader-img").hide()}function sfsi_plus_make_popBox(){var s=0;SFSI(".sfsi_sample_icons >li").each(function(){"none"!=SFSI(this).css("display")&&(s=1)}),0==s?SFSI(".sfsi_plus_Popinner").hide():SFSI(".sfsi_plus_Popinner").show(),""!=SFSI('input[name="sfsi_plus_popup_text"]').val()?(SFSI(".sfsi_plus_Popinner >h2").html(SFSI('input[name="sfsi_plus_popup_text"]').val()),SFSI(".sfsi_plus_Popinner >h2").show()):SFSI(".sfsi_plus_Popinner >h2").hide(),SFSI(".sfsi_plus_Popinner").css({"border-color":SFSI('input[name="sfsi_plus_popup_border_color"]').val(),"border-width":SFSI('input[name="sfsi_plus_popup_border_thickness"]').val(),"border-style":"solid"}),SFSI(".sfsi_plus_Popinner").css("background-color",SFSI('input[name="sfsi_plus_popup_background_color"]').val()),SFSI(".sfsi_plus_Popinner h2").css("font-family",SFSI("#sfsi_plus_popup_font").val()),SFSI(".sfsi_plus_Popinner h2").css("font-style",SFSI("#sfsi_plus_popup_fontStyle").val()),SFSI(".sfsi_plus_Popinner >h2").css("font-size",parseInt(SFSI('input[name="sfsi_plus_popup_fontSize"]').val())),SFSI(".sfsi_plus_Popinner >h2").css("color",SFSI('input[name="sfsi_plus_popup_fontColor"]').val()+" !important"),"yes"==SFSI('input[name="sfsi_plus_popup_border_shadow"]:checked').val()?SFSI(".sfsi_plus_Popinner").css("box-shadow","12px 30px 18px #CCCCCC"):SFSI(".sfsi_plus_Popinner").css("box-shadow","none")}function sfsi_plus_stick_widget(s){0==sfsiplus_initTop.length&&(SFSI(".sfsi_plus_widget").each(function(s){sfsiplus_initTop[s]=SFSI(this).position().top}),console.log(sfsiplus_initTop));var i=SFSI(window).scrollTop(),e=[],t=[];SFSI(".sfsi_plus_widget").each(function(s){e[s]=SFSI(this).position().top,t[s]=SFSI(this)});var n=!1;for(var o in e){var a=parseInt(o)+1;e[o]<i&&e[a]>i&&a<e.length?(SFSI(t[o]).css({position:"fixed",top:s}),SFSI(t[a]).css({position:"",top:sfsiplus_initTop[a]}),n=!0):SFSI(t[o]).css({position:"",top:sfsiplus_initTop[o]})}if(!n){var c=e.length-1,r=-1;e.length>1&&(r=e.length-2),sfsiplus_initTop[c]<i?(SFSI(t[c]).css({position:"fixed",top:s}),r>=0&&SFSI(t[r]).css({position:"",top:sfsiplus_initTop[r]})):(SFSI(t[c]).css({position:"",top:sfsiplus_initTop[c]}),r>=0&&e[r]<i)}}function sfsi_plus_float_widget(s){function i(){c="Microsoft Internet Explorer"===navigator.appName?a-document.documentElement.scrollTop:a-window.pageYOffset,Math.abs(c)>0?(window.removeEventListener("scroll",i),a-=c*o,SFSI("#sfsi_plus_floater").css({top:(a+t).toString()+"px"}),setTimeout(i,n)):window.addEventListener("scroll",i,!1)}function e(){var s=SFSI("#sfsi_plus_floater").attr("data-top"),e=parseInt(SFSI("#sfsi_plus_floater").height()),t=parseInt(SFSI("#sfsi_plus_floater").css("top"));parseInt(e)+parseInt(t)<=s?window.addEventListener("scroll",i,!1):(window.removeEventListener("scroll",i),SFSI("#sfsi_plus_floater").css("top",s+"px"))}if("center"==s)var t=window.innerHeight/2;else if("bottom"==s)var t=window.innerHeight-SFSI("#sfsi_plus_floater").height();else var t=parseInt(s);var n=50,o=.1,a=0,c=0;SFSI("#sfsi_plus_floater"),window.onscroll=e}function sfsi_plus_shuffle(){var s=[];SFSI(".sfsi_plus_wicons ").each(function(i){SFSI(this).text().match(/^\s*$/)||(s[i]="<div class='"+SFSI(this).attr("class")+"'>"+SFSI(this).html()+"</div>",SFSI(this).fadeOut("slow"),SFSI(this).insertBefore(SFSI(this).prev(".sfsi_plus_wicons")),SFSI(this).fadeIn("slow"))}),s=sfsiplus_Shuffle(s),$("#sfsi_plus_wDiv").html("");for(var i=0;i<testArray.length;i++)$("#sfsi_plus_wDiv").append(s[i])}function sfsiplus_Shuffle(s){for(var i,e,t=s.length;t;i=parseInt(Math.random()*t),e=s[--t],s[t]=s[i],s[i]=e);return s}function sfsi_plus_setCookie(s,i,e){var t=new Date;t.setTime(t.getTime()+864e5*e);var n="expires="+t.toGMTString();document.cookie=s+"="+i+"; "+n}function sfsfi_plus_getCookie(s){for(var i=s+"=",e=document.cookie.split(";"),t=0;t<e.length;t++){var n=e[t].trim();if(0==n.indexOf(i))return n.substring(i.length,n.length)}return""}function sfsi_plus_hideFooter(){}function showhideutube(s){var i=SFSI(s).children("input").val();"name"==i?(SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideDown(),SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideUp()):(SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlidwpr").slideDown(),SFSI(s).parent(".enough_waffling").next(".cstmutbtxtwpr").children(".cstmutbchnlnmewpr").slideUp())}function sfsiplushidemepopup(){SFSI(".sfsi_plus_FrntInner").fadeOut()}jQuery(document).ready(function(){jQuery("#sfsi_plus_floater").attr("data-top",jQuery(document).height())}),window.onerror=function(){},SFSI=jQuery.noConflict(),SFSI(window).load(function(){SFSI("#sfpluspageLoad").fadeOut(2e3)});var global_error=0;SFSI(document).ready(function(s){function i(){SFSI(".uperror").html(""),sfsiplus_afterLoad();var s=SFSI('input[name="'+SFSI("#upload_id").val()+'"]');s.removeAttr("checked");var i=SFSI(s).parent().find("span:first");return SFSI(i).css("background-position","0px 0px"),SFSI(".upload-overlay").hide("slow"),!1}SFSI(".sfsiplus_tab_3_icns").on("click",".cstomskins_upload",function(){SFSI(".cstmskins-overlay").show("slow",function(){e=0})}),SFSI("#custmskin_clspop").live("click",function(){SFSI_plus_done(),SFSI(".cstmskins-overlay").hide("slow")}),SFSI("head").append('<meta http-equiv="Cache-Control" content="no-cache, no-store, must-revalidate" />'),SFSI("head").append('<meta http-equiv="Pragma" content="no-cache" />'),SFSI("head").append('<meta http-equiv="Expires" content="0" />'),SFSI("#accordion").accordion({collapsible:!0,active:!1,heightStyle:"content",event:"click",beforeActivate:function(s,i){if(i.newHeader[0])var e=i.newHeader,t=e.next(".ui-accordion-content");else var e=i.oldHeader,t=e.next(".ui-accordion-content");var n="true"==e.attr("aria-selected");return e.toggleClass("ui-corner-all",n).toggleClass("accordion-header-active ui-state-active ui-corner-top",!n).attr("aria-selected",(!n).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",n).toggleClass("ui-icon-triangle-1-s",!n),t.toggleClass("accordion-content-active",!n),n?t.slideUp():t.slideDown(),!1}}),SFSI("#accordion1").accordion({collapsible:!0,active:!1,heightStyle:"content",event:"click",beforeActivate:function(s,i){if(i.newHeader[0])var e=i.newHeader,t=e.next(".ui-accordion-content");else var e=i.oldHeader,t=e.next(".ui-accordion-content");var n="true"==e.attr("aria-selected");return e.toggleClass("ui-corner-all",n).toggleClass("accordion-header-active ui-state-active ui-corner-top",!n).attr("aria-selected",(!n).toString()),e.children(".ui-icon").toggleClass("ui-icon-triangle-1-e",n).toggleClass("ui-icon-triangle-1-s",!n),t.toggleClass("accordion-content-active",!n),n?t.slideUp():t.slideDown(),!1}}),SFSI(".closeSec").on("click",function(){var s=!0,i=SFSI(this).closest("div.ui-accordion-content").prev("h3.ui-accordion-header").first(),e=SFSI(this).closest("div.ui-accordion-content").first();i.toggleClass("ui-corner-all",s).toggleClass("accordion-header-active ui-state-active ui-corner-top",!s).attr("aria-selected",(!s).toString()),i.children(".ui-icon
|
