Version Description
Download this release
Release Info
Developer | unitecms |
Plugin | Unlimited Elements For Elementor (Free Widgets, Addons, Templates) |
Version | 1.4.65 |
Comparing to | |
See all releases |
Version 1.4.65
- assets_internal/css/uc_front.css +167 -0
- assets_internal/css/uc_layout_preview.css +51 -0
- assets_internal/js/uc_form.js +270 -0
- assets_internal/js/uc_woocommerce.js +47 -0
- assets_libraries/MooTools-Core-1.5.2.js +6131 -0
- assets_libraries/animate/animate.css +1579 -0
- assets_libraries/animate/wow.min.js +2 -0
- assets_libraries/bxslider/LICENSE.md +12 -0
- assets_libraries/bxslider/README.md +766 -0
- assets_libraries/bxslider/images/bx_loader.gif +0 -0
- assets_libraries/bxslider/images/controls.png +0 -0
- assets_libraries/bxslider/jquery.bxslider.css +177 -0
- assets_libraries/bxslider/jquery.bxslider.js +1607 -0
- assets_libraries/bxslider/jquery.bxslider.min.css +1 -0
- assets_libraries/bxslider/jquery.bxslider.min.js +7 -0
- assets_libraries/bxslider/vendor/jquery.easing.1.3.js +205 -0
- assets_libraries/bxslider/vendor/jquery.fitvids.js +80 -0
- assets_libraries/countdown/jquery.countdown.js +246 -0
- assets_libraries/fancybox3/jquery.fancybox.min.css +1 -0
- assets_libraries/fancybox3/jquery.fancybox.min.js +12 -0
- assets_libraries/font-awesome5/css/fa-brands-400.eot +0 -0
- assets_libraries/font-awesome5/css/fa-brands-400.svg +3202 -0
assets_internal/css/uc_front.css
ADDED
@@ -0,0 +1,167 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
|
2 |
+
.uc-grid-front{
|
3 |
+
box-sizing: border-box;
|
4 |
+
}
|
5 |
+
|
6 |
+
.uc-grid-front .wow {visibility:hidden;}
|
7 |
+
|
8 |
+
.uc-grid-front .uc-grid-row{
|
9 |
+
display:block;
|
10 |
+
clear:both;
|
11 |
+
max-width:100%;
|
12 |
+
box-sizing: border-box;
|
13 |
+
padding-top:30px;
|
14 |
+
padding-bottom:30px;
|
15 |
+
position:relative;
|
16 |
+
}
|
17 |
+
|
18 |
+
|
19 |
+
.uc-grid-front .uc-grid-row .uc-grid-row-container{
|
20 |
+
margin:0px auto;
|
21 |
+
clear:both;
|
22 |
+
max-width:960px;
|
23 |
+
box-sizing:border-box;
|
24 |
+
position:relative;
|
25 |
+
}
|
26 |
+
|
27 |
+
.uc-grid-front .uc-grid-col{
|
28 |
+
box-sizing: border-box;
|
29 |
+
float:left;
|
30 |
+
min-height:1px;
|
31 |
+
position:relative;
|
32 |
+
padding-left:15px;
|
33 |
+
padding-right:15px;
|
34 |
+
position:relative;
|
35 |
+
}
|
36 |
+
|
37 |
+
.uc-grid-front .uc-grid-col .uc-grid-col-addon{
|
38 |
+
margin-top:10px;
|
39 |
+
position:relative;
|
40 |
+
box-sizing:border-box;
|
41 |
+
}
|
42 |
+
|
43 |
+
.uc-grid-front .uc-grid-col .uc-grid-col-addon:first-child{
|
44 |
+
margin-top:0px;
|
45 |
+
}
|
46 |
+
|
47 |
+
.uc-grid-front .uc-col-clear{
|
48 |
+
clear:both;
|
49 |
+
}
|
50 |
+
|
51 |
+
.uc-grid-front .uc-colsize-1_1{
|
52 |
+
width:100%;
|
53 |
+
}
|
54 |
+
|
55 |
+
.uc-grid-front .uc-colsize-1_2{
|
56 |
+
width:50%;
|
57 |
+
}
|
58 |
+
|
59 |
+
.uc-grid-front .uc-colsize-1_3{
|
60 |
+
width:33.333333%;
|
61 |
+
}
|
62 |
+
|
63 |
+
.uc-grid-front .uc-colsize-1_4{
|
64 |
+
width:25%;
|
65 |
+
}
|
66 |
+
|
67 |
+
.uc-grid-front .uc-colsize-1_5{
|
68 |
+
width: 20%;
|
69 |
+
}
|
70 |
+
|
71 |
+
.uc-grid-front .uc-colsize-2_5{
|
72 |
+
width: 40%
|
73 |
+
}
|
74 |
+
|
75 |
+
.uc-grid-front .uc-colsize-3_5{
|
76 |
+
width: 60%
|
77 |
+
}
|
78 |
+
|
79 |
+
.uc-grid-front .uc-colsize-4_5{
|
80 |
+
width: 80%
|
81 |
+
}
|
82 |
+
|
83 |
+
.uc-grid-front .uc-colsize-1_6{
|
84 |
+
width:16.666666%;
|
85 |
+
}
|
86 |
+
|
87 |
+
.uc-grid-front .uc-colsize-2_3{
|
88 |
+
width: 66.666666%
|
89 |
+
}
|
90 |
+
|
91 |
+
.uc-grid-front .uc-colsize-3_4{
|
92 |
+
width: 75%
|
93 |
+
}
|
94 |
+
|
95 |
+
|
96 |
+
.uc-grid-front .uc-colsize-5_6{
|
97 |
+
width: 83.333333%
|
98 |
+
}
|
99 |
+
|
100 |
+
.uc-grid-front .uc-shape-devider{
|
101 |
+
position:absolute;
|
102 |
+
left:0px;
|
103 |
+
height:150px;
|
104 |
+
width:100%;
|
105 |
+
background-repeat:repeat-x;
|
106 |
+
background-size:100% 150px;
|
107 |
+
pointer-events:none;
|
108 |
+
z-index:100;
|
109 |
+
background-color:transparent;
|
110 |
+
}
|
111 |
+
|
112 |
+
.uc-grid-front .uc-shape-devider.uc-shape-devider-top{
|
113 |
+
top:0px;
|
114 |
+
}
|
115 |
+
|
116 |
+
.uc-grid-front .uc-shape-devider.uc-shape-devider-bottom{
|
117 |
+
bottom:-1px;
|
118 |
+
transform: rotateX(180deg);
|
119 |
+
}
|
120 |
+
|
121 |
+
.uc-grid-front .uc-grid-background-overlay{
|
122 |
+
position:absolute;
|
123 |
+
width:100%;
|
124 |
+
height:100%;
|
125 |
+
box-sizing: border-box;
|
126 |
+
z-index:0;
|
127 |
+
top:0px;
|
128 |
+
left:0px;
|
129 |
+
}
|
130 |
+
|
131 |
+
@media (max-width:768px) {
|
132 |
+
|
133 |
+
.uc-grid-front .uc-grid-col{
|
134 |
+
width:100% !important;
|
135 |
+
float:none !important;
|
136 |
+
padding-top:10px;
|
137 |
+
}
|
138 |
+
|
139 |
+
.uc-grid-front .uc-grid-col.uc-col-first{
|
140 |
+
padding-top:0px;
|
141 |
+
}
|
142 |
+
|
143 |
+
.uc-grid-front .uc-grid-row .uc-grid-row-container{
|
144 |
+
width:100% !important;
|
145 |
+
}
|
146 |
+
|
147 |
+
}
|
148 |
+
|
149 |
+
|
150 |
+
@media (max-width:480px) {
|
151 |
+
.uc-hide-mobile{display:none !important}
|
152 |
+
}
|
153 |
+
|
154 |
+
@media (min-width:481px) and (max-width:768px){
|
155 |
+
.uc-hide-tablet{display:none !important}
|
156 |
+
}
|
157 |
+
|
158 |
+
@media (min-width:769px){
|
159 |
+
|
160 |
+
.uc-grid-front .uc-grid-row.uc-hide-desktop{display:none !important}
|
161 |
+
|
162 |
+
.uc-grid-front .uc-grid-col.uc-hide-desktop .uc-grid-col-inner{display:none !important}
|
163 |
+
|
164 |
+
.uc-grid-front .uc-grid-col-addon.uc-hide-desktop{display:none !important}
|
165 |
+
|
166 |
+
}
|
167 |
+
|
assets_internal/css/uc_layout_preview.css
ADDED
@@ -0,0 +1,51 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
html, body, div, span, applet, object, iframe,
|
2 |
+
h1, h2, h3, h4, h5, h6, p, blockquote, pre,
|
3 |
+
a, abbr, acronym, address, big, cite, code,
|
4 |
+
del, dfn, em, font, img, ins, kbd, q, s, samp,
|
5 |
+
small, strike, strong, sub, sup, tt, var,
|
6 |
+
b, u, i, center,
|
7 |
+
dl, dt, dd, ol, ul, li,
|
8 |
+
fieldset, form, label, legend,
|
9 |
+
table, caption, tbody, tfoot, thead, tr, th, td {
|
10 |
+
margin: 0;
|
11 |
+
padding: 0;
|
12 |
+
border: 0;
|
13 |
+
outline: 0;
|
14 |
+
font-size: 100%;
|
15 |
+
vertical-align: baseline;
|
16 |
+
background: transparent;
|
17 |
+
}
|
18 |
+
body {
|
19 |
+
line-height: 1.15; /* 1 */
|
20 |
+
-webkit-text-size-adjust: 100%;
|
21 |
+
}
|
22 |
+
ol, ul {
|
23 |
+
list-style: none;
|
24 |
+
}
|
25 |
+
blockquote, q {
|
26 |
+
quotes: none;
|
27 |
+
}
|
28 |
+
blockquote:before, blockquote:after,
|
29 |
+
q:before, q:after {
|
30 |
+
content: '';
|
31 |
+
content: none;
|
32 |
+
}
|
33 |
+
|
34 |
+
/* remember to define focus styles! */
|
35 |
+
:focus {
|
36 |
+
outline: 0;
|
37 |
+
}
|
38 |
+
|
39 |
+
/* remember to highlight inserts somehow! */
|
40 |
+
ins {
|
41 |
+
text-decoration: none;
|
42 |
+
}
|
43 |
+
del {
|
44 |
+
text-decoration: line-through;
|
45 |
+
}
|
46 |
+
|
47 |
+
/* tables still need 'cellspacing="0"' in the markup */
|
48 |
+
table {
|
49 |
+
border-collapse: collapse;
|
50 |
+
border-spacing: 0;
|
51 |
+
}
|
assets_internal/js/uc_form.js
ADDED
@@ -0,0 +1,270 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"use strict";
|
2 |
+
|
3 |
+
function UniteCreatorFormFront(){
|
4 |
+
|
5 |
+
var g_objLoader, g_objError, g_objSuccess, g_objButton, g_objFormContent;
|
6 |
+
|
7 |
+
|
8 |
+
/**
|
9 |
+
* trace
|
10 |
+
*/
|
11 |
+
function trace(str){
|
12 |
+
console.log(str);
|
13 |
+
}
|
14 |
+
|
15 |
+
/**
|
16 |
+
* get parent form
|
17 |
+
*/
|
18 |
+
function getParentForm(objChild){
|
19 |
+
var objForm = objChild.parents(".uc-form");
|
20 |
+
|
21 |
+
if(objForm.length == 0){
|
22 |
+
trace(objChild);
|
23 |
+
throw new Error("Form not found from child object");
|
24 |
+
}
|
25 |
+
|
26 |
+
return(objForm);
|
27 |
+
}
|
28 |
+
|
29 |
+
/**
|
30 |
+
* get form data
|
31 |
+
*/
|
32 |
+
function getFormData(objForm){
|
33 |
+
|
34 |
+
var arrFields = objForm.find("input,textarea,select");
|
35 |
+
|
36 |
+
var arrData = [];
|
37 |
+
jQuery.each(arrFields, function(index, input){
|
38 |
+
var objInput = jQuery(input);
|
39 |
+
var inputData = {};
|
40 |
+
|
41 |
+
var type = objInput.attr("type");
|
42 |
+
if(type == "submit")
|
43 |
+
return(true);
|
44 |
+
|
45 |
+
var isRequired = objInput.data("required");
|
46 |
+
|
47 |
+
inputData["name"] = objInput.prop("name");
|
48 |
+
inputData["value"] = objInput.val();
|
49 |
+
|
50 |
+
if(isRequired)
|
51 |
+
inputData["required"] = true;
|
52 |
+
|
53 |
+
var title = objInput.data("title");
|
54 |
+
if(!title)
|
55 |
+
title = "";
|
56 |
+
inputData["title"] = title;
|
57 |
+
|
58 |
+
arrData.push(inputData);
|
59 |
+
});
|
60 |
+
|
61 |
+
return(arrData);
|
62 |
+
}
|
63 |
+
|
64 |
+
/**
|
65 |
+
* set loading state
|
66 |
+
*/
|
67 |
+
function setStateLoading(){
|
68 |
+
|
69 |
+
if(g_objError)
|
70 |
+
g_objError.hide();
|
71 |
+
|
72 |
+
if(g_objLoader){
|
73 |
+
g_objLoader.show();
|
74 |
+
g_objButton.hide();
|
75 |
+
}
|
76 |
+
|
77 |
+
}
|
78 |
+
|
79 |
+
/**
|
80 |
+
* set success state
|
81 |
+
*/
|
82 |
+
function setStateSuccess(){
|
83 |
+
|
84 |
+
if(g_objLoader)
|
85 |
+
g_objLoader.hide();
|
86 |
+
|
87 |
+
g_objButton.show();
|
88 |
+
|
89 |
+
if(g_objError)
|
90 |
+
g_objError.hide();
|
91 |
+
|
92 |
+
if(g_objSuccess){
|
93 |
+
g_objFormContent.hide();
|
94 |
+
g_objSuccess.show();
|
95 |
+
}else{
|
96 |
+
alert("Form Sent!");
|
97 |
+
}
|
98 |
+
|
99 |
+
}
|
100 |
+
|
101 |
+
|
102 |
+
/**
|
103 |
+
* set error state
|
104 |
+
*/
|
105 |
+
function setStateError(message){
|
106 |
+
|
107 |
+
if(g_objLoader)
|
108 |
+
g_objLoader.hide();
|
109 |
+
|
110 |
+
g_objButton.show();
|
111 |
+
|
112 |
+
if(g_objError){
|
113 |
+
g_objError.show();
|
114 |
+
g_objError.html(message);
|
115 |
+
}else{
|
116 |
+
alert(message);
|
117 |
+
}
|
118 |
+
|
119 |
+
}
|
120 |
+
|
121 |
+
|
122 |
+
/**
|
123 |
+
* process response
|
124 |
+
*/
|
125 |
+
function processSubmitResponse(response){
|
126 |
+
|
127 |
+
if(!response){
|
128 |
+
setStateError("Empty ajax response!");
|
129 |
+
return(false);
|
130 |
+
}
|
131 |
+
|
132 |
+
if(typeof response != "object"){
|
133 |
+
|
134 |
+
try{
|
135 |
+
response = jQuery.parseJSON(response);
|
136 |
+
}catch(e){
|
137 |
+
setStateError("Ajax Error!!! not ajax response");
|
138 |
+
trace(response);
|
139 |
+
return(false);
|
140 |
+
}
|
141 |
+
}
|
142 |
+
|
143 |
+
if(response == -1){
|
144 |
+
setStateError("ajax error!!!");
|
145 |
+
return(false);
|
146 |
+
}
|
147 |
+
|
148 |
+
if(response == 0){
|
149 |
+
setStateError("ajax error, action not found");
|
150 |
+
return(false);
|
151 |
+
}
|
152 |
+
|
153 |
+
if(typeof response.success === "undefined"){
|
154 |
+
setStateError("The 'success' param is a must!");
|
155 |
+
return(false);
|
156 |
+
}
|
157 |
+
|
158 |
+
if(response.success === false){
|
159 |
+
setStateError(response.message);
|
160 |
+
return(false);
|
161 |
+
}
|
162 |
+
|
163 |
+
//success!!!
|
164 |
+
|
165 |
+
setStateSuccess();
|
166 |
+
|
167 |
+
}
|
168 |
+
|
169 |
+
|
170 |
+
/**
|
171 |
+
* on form submit
|
172 |
+
*/
|
173 |
+
function onSubmitClick(event){
|
174 |
+
|
175 |
+
event.preventDefault();
|
176 |
+
|
177 |
+
var objButton = jQuery(this);
|
178 |
+
var objForm = getParentForm(objButton);
|
179 |
+
|
180 |
+
var arrFormData = getFormData(objForm);
|
181 |
+
|
182 |
+
|
183 |
+
//set objects
|
184 |
+
g_objFormContent = objForm.find(".uc-form-content");
|
185 |
+
if(g_objFormContent.length == 0)
|
186 |
+
throw new Error("Form content div not found");
|
187 |
+
|
188 |
+
g_objButton = objButton;
|
189 |
+
if(g_objButton.length == 0)
|
190 |
+
throw new Error("Submit button not found");
|
191 |
+
|
192 |
+
g_objLoader = objForm.find(".uc-form-loading");
|
193 |
+
if(g_objLoader.length == 0)
|
194 |
+
g_objLoader = null;
|
195 |
+
|
196 |
+
g_objError = objForm.find(".uc-form-error");
|
197 |
+
if(g_objError.length == 0)
|
198 |
+
g_objError = null;
|
199 |
+
|
200 |
+
g_objSuccess = jQuery(".uc-form-success");
|
201 |
+
if(g_objSuccess.length == 0)
|
202 |
+
g_objSuccess = null;
|
203 |
+
|
204 |
+
|
205 |
+
var objData = {};
|
206 |
+
objData.action = "bloxbuilder_ajax_action";
|
207 |
+
objData.client_action = "send_form";
|
208 |
+
objData.form_data = arrFormData;
|
209 |
+
|
210 |
+
var ajaxOptions = {
|
211 |
+
type:"post",
|
212 |
+
url:g_urlFormAjaxUC,
|
213 |
+
dataType: 'json',
|
214 |
+
data:objData,
|
215 |
+
success:function(response){
|
216 |
+
|
217 |
+
processSubmitResponse(response);
|
218 |
+
},
|
219 |
+
error:function(jqXHR, textStatus, errorThrown){
|
220 |
+
trace(jqXHR.responseText);
|
221 |
+
setStateError("Error Occured!");
|
222 |
+
}
|
223 |
+
};
|
224 |
+
|
225 |
+
setStateLoading();
|
226 |
+
|
227 |
+
jQuery.ajax(ajaxOptions);
|
228 |
+
}
|
229 |
+
|
230 |
+
|
231 |
+
/**
|
232 |
+
* init form
|
233 |
+
*/
|
234 |
+
function initForm(objForm){
|
235 |
+
|
236 |
+
var isInited = objForm.data("inited");
|
237 |
+
if(isInited == true)
|
238 |
+
return(false);
|
239 |
+
|
240 |
+
var objSubmit = objForm.find(".uc-submit-button");
|
241 |
+
if(objSubmit.length == 0)
|
242 |
+
return(false);
|
243 |
+
|
244 |
+
objSubmit.click(onSubmitClick);
|
245 |
+
|
246 |
+
objForm.data("inited",true);
|
247 |
+
}
|
248 |
+
|
249 |
+
|
250 |
+
/**
|
251 |
+
* init the forms
|
252 |
+
*/
|
253 |
+
this.init = function(){
|
254 |
+
|
255 |
+
var objForms = jQuery(".uc-form");
|
256 |
+
if(objForms.length == 0)
|
257 |
+
return(false);
|
258 |
+
|
259 |
+
if(typeof g_urlFormAjaxUC == "undefined")
|
260 |
+
throw new Error("ajax url not found");
|
261 |
+
|
262 |
+
objForms.each(function(index, form){
|
263 |
+
var objForm = jQuery(form);
|
264 |
+
initForm(objForm);
|
265 |
+
});
|
266 |
+
|
267 |
+
};
|
268 |
+
|
269 |
+
}
|
270 |
+
|
assets_internal/js/uc_woocommerce.js
ADDED
@@ -0,0 +1,47 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
|
2 |
+
function UCWooIntegrate(){
|
3 |
+
|
4 |
+
var t = this;
|
5 |
+
|
6 |
+
/**
|
7 |
+
* print in console
|
8 |
+
*/
|
9 |
+
function trace(str){
|
10 |
+
|
11 |
+
console.log(str);
|
12 |
+
|
13 |
+
}
|
14 |
+
|
15 |
+
/**
|
16 |
+
* filter change
|
17 |
+
*/
|
18 |
+
function onSelectFilterChange(){
|
19 |
+
|
20 |
+
var objSelect = jQuery(this);
|
21 |
+
var objForm = objSelect.parents("form");
|
22 |
+
|
23 |
+
objForm.submit();
|
24 |
+
|
25 |
+
}
|
26 |
+
|
27 |
+
|
28 |
+
/**
|
29 |
+
* init the object
|
30 |
+
*/
|
31 |
+
this.init = function(){
|
32 |
+
|
33 |
+
var objFilterSelects = jQuery("select.uc-woo-filter");
|
34 |
+
|
35 |
+
objFilterSelects.on("change", onSelectFilterChange);
|
36 |
+
|
37 |
+
}
|
38 |
+
|
39 |
+
}
|
40 |
+
|
41 |
+
|
42 |
+
jQuery(document).ready(function(){
|
43 |
+
|
44 |
+
var objUCWoo = new UCWooIntegrate();
|
45 |
+
objUCWoo.init();
|
46 |
+
|
47 |
+
});
|
assets_libraries/MooTools-Core-1.5.2.js
ADDED
@@ -0,0 +1,6131 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* MooTools: the javascript framework. license: MIT-style license. copyright: Copyright (c) 2006-2015 [Valerio Proietti](http://mad4milk.net/).*/
|
2 |
+
/*!
|
3 |
+
Web Build: http://mootools.net/core/builder/e426a9ae7167c5807b173d5deff673fc
|
4 |
+
*/
|
5 |
+
/*
|
6 |
+
---
|
7 |
+
|
8 |
+
name: Core
|
9 |
+
|
10 |
+
description: The heart of MooTools.
|
11 |
+
|
12 |
+
license: MIT-style license.
|
13 |
+
|
14 |
+
copyright: Copyright (c) 2006-2015 [Valerio Proietti](http://mad4milk.net/).
|
15 |
+
|
16 |
+
authors: The MooTools production team (http://mootools.net/developers/)
|
17 |
+
|
18 |
+
inspiration:
|
19 |
+
- Class implementation inspired by [Base.js](http://dean.edwards.name/weblog/2006/03/base/) Copyright (c) 2006 Dean Edwards, [GNU Lesser General Public License](http://opensource.org/licenses/lgpl-license.php)
|
20 |
+
- Some functionality inspired by [Prototype.js](http://prototypejs.org) Copyright (c) 2005-2007 Sam Stephenson, [MIT License](http://opensource.org/licenses/mit-license.php)
|
21 |
+
|
22 |
+
provides: [Core, MooTools, Type, typeOf, instanceOf, Native]
|
23 |
+
|
24 |
+
...
|
25 |
+
*/
|
26 |
+
/*! MooTools: the javascript framework. license: MIT-style license. copyright: Copyright (c) 2006-2015 [Valerio Proietti](http://mad4milk.net/).*/
|
27 |
+
(function(){
|
28 |
+
|
29 |
+
this.MooTools = {
|
30 |
+
version: '1.5.2',
|
31 |
+
build: 'ed01297a1a19de0675404640e7377cf97694e131'
|
32 |
+
};
|
33 |
+
|
34 |
+
// typeOf, instanceOf
|
35 |
+
|
36 |
+
var typeOf = this.typeOf = function(item){
|
37 |
+
if (item == null) return 'null';
|
38 |
+
if (item.$family != null) return item.$family();
|
39 |
+
|
40 |
+
if (item.nodeName){
|
41 |
+
if (item.nodeType == 1) return 'element';
|
42 |
+
if (item.nodeType == 3) return (/\S/).test(item.nodeValue) ? 'textnode' : 'whitespace';
|
43 |
+
} else if (typeof item.length == 'number'){
|
44 |
+
if ('callee' in item) return 'arguments';
|
45 |
+
if ('item' in item) return 'collection';
|
46 |
+
}
|
47 |
+
|
48 |
+
return typeof item;
|
49 |
+
};
|
50 |
+
|
51 |
+
var instanceOf = this.instanceOf = function(item, object){
|
52 |
+
if (item == null) return false;
|
53 |
+
var constructor = item.$constructor || item.constructor;
|
54 |
+
while (constructor){
|
55 |
+
if (constructor === object) return true;
|
56 |
+
constructor = constructor.parent;
|
57 |
+
}
|
58 |
+
/*<ltIE8>*/
|
59 |
+
if (!item.hasOwnProperty) return false;
|
60 |
+
/*</ltIE8>*/
|
61 |
+
return item instanceof object;
|
62 |
+
};
|
63 |
+
|
64 |
+
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
65 |
+
|
66 |
+
/*<ltIE8>*/
|
67 |
+
var enumerables = true;
|
68 |
+
for (var i in {toString: 1}) enumerables = null;
|
69 |
+
if (enumerables) enumerables = ['hasOwnProperty', 'valueOf', 'isPrototypeOf', 'propertyIsEnumerable', 'toLocaleString', 'toString', 'constructor'];
|
70 |
+
function forEachObjectEnumberableKey(object, fn, bind) {
|
71 |
+
if (enumerables) for (var i = enumerables.length; i--;){
|
72 |
+
var k = enumerables[i];
|
73 |
+
// signature has key-value, so overloadSetter can directly pass the
|
74 |
+
// method function, without swapping arguments.
|
75 |
+
if (hasOwnProperty.call(object, k)) fn.call(bind, k, object[k]);
|
76 |
+
}
|
77 |
+
}
|
78 |
+
/*</ltIE8>*/
|
79 |
+
|
80 |
+
// Function overloading
|
81 |
+
|
82 |
+
var Function = this.Function;
|
83 |
+
|
84 |
+
Function.prototype.overloadSetter = function(usePlural){
|
85 |
+
var self = this;
|
86 |
+
return function(a, b){
|
87 |
+
if (a == null) return this;
|
88 |
+
if (usePlural || typeof a != 'string'){
|
89 |
+
for (var k in a) self.call(this, k, a[k]);
|
90 |
+
/*<ltIE8>*/
|
91 |
+
forEachObjectEnumberableKey(a, self, this);
|
92 |
+
/*</ltIE8>*/
|
93 |
+
} else {
|
94 |
+
self.call(this, a, b);
|
95 |
+
}
|
96 |
+
return this;
|
97 |
+
};
|
98 |
+
};
|
99 |
+
|
100 |
+
Function.prototype.overloadGetter = function(usePlural){
|
101 |
+
var self = this;
|
102 |
+
return function(a){
|
103 |
+
var args, result;
|
104 |
+
if (typeof a != 'string') args = a;
|
105 |
+
else if (arguments.length > 1) args = arguments;
|
106 |
+
else if (usePlural) args = [a];
|
107 |
+
if (args){
|
108 |
+
result = {};
|
109 |
+
for (var i = 0; i < args.length; i++) result[args[i]] = self.call(this, args[i]);
|
110 |
+
} else {
|
111 |
+
result = self.call(this, a);
|
112 |
+
}
|
113 |
+
return result;
|
114 |
+
};
|
115 |
+
};
|
116 |
+
|
117 |
+
Function.prototype.extend = function(key, value){
|
118 |
+
this[key] = value;
|
119 |
+
}.overloadSetter();
|
120 |
+
|
121 |
+
Function.prototype.implement = function(key, value){
|
122 |
+
this.prototype[key] = value;
|
123 |
+
}.overloadSetter();
|
124 |
+
|
125 |
+
// From
|
126 |
+
|
127 |
+
var slice = Array.prototype.slice;
|
128 |
+
|
129 |
+
Function.from = function(item){
|
130 |
+
return (typeOf(item) == 'function') ? item : function(){
|
131 |
+
return item;
|
132 |
+
};
|
133 |
+
};
|
134 |
+
|
135 |
+
Array.from = function(item){
|
136 |
+
if (item == null) return [];
|
137 |
+
return (Type.isEnumerable(item) && typeof item != 'string') ? (typeOf(item) == 'array') ? item : slice.call(item) : [item];
|
138 |
+
};
|
139 |
+
|
140 |
+
Number.from = function(item){
|
141 |
+
var number = parseFloat(item);
|
142 |
+
return isFinite(number) ? number : null;
|
143 |
+
};
|
144 |
+
|
145 |
+
String.from = function(item){
|
146 |
+
return item + '';
|
147 |
+
};
|
148 |
+
|
149 |
+
// hide, protect
|
150 |
+
|
151 |
+
Function.implement({
|
152 |
+
|
153 |
+
hide: function(){
|
154 |
+
this.$hidden = true;
|
155 |
+
return this;
|
156 |
+
},
|
157 |
+
|
158 |
+
protect: function(){
|
159 |
+
this.$protected = true;
|
160 |
+
return this;
|
161 |
+
}
|
162 |
+
|
163 |
+
});
|
164 |
+
|
165 |
+
// Type
|
166 |
+
|
167 |
+
var Type = this.Type = function(name, object){
|
168 |
+
if (name){
|
169 |
+
var lower = name.toLowerCase();
|
170 |
+
var typeCheck = function(item){
|
171 |
+
return (typeOf(item) == lower);
|
172 |
+
};
|
173 |
+
|
174 |
+
Type['is' + name] = typeCheck;
|
175 |
+
if (object != null){
|
176 |
+
object.prototype.$family = (function(){
|
177 |
+
return lower;
|
178 |
+
}).hide();
|
179 |
+
|
180 |
+
}
|
181 |
+
}
|
182 |
+
|
183 |
+
if (object == null) return null;
|
184 |
+
|
185 |
+
object.extend(this);
|
186 |
+
object.$constructor = Type;
|
187 |
+
object.prototype.$constructor = object;
|
188 |
+
|
189 |
+
return object;
|
190 |
+
};
|
191 |
+
|
192 |
+
var toString = Object.prototype.toString;
|
193 |
+
|
194 |
+
Type.isEnumerable = function(item){
|
195 |
+
return (item != null && typeof item.length == 'number' && toString.call(item) != '[object Function]' );
|
196 |
+
};
|
197 |
+
|
198 |
+
var hooks = {};
|
199 |
+
|
200 |
+
var hooksOf = function(object){
|
201 |
+
var type = typeOf(object.prototype);
|
202 |
+
return hooks[type] || (hooks[type] = []);
|
203 |
+
};
|
204 |
+
|
205 |
+
var implement = function(name, method){
|
206 |
+
if (method && method.$hidden) return;
|
207 |
+
|
208 |
+
var hooks = hooksOf(this);
|
209 |
+
|
210 |
+
for (var i = 0; i < hooks.length; i++){
|
211 |
+
var hook = hooks[i];
|
212 |
+
if (typeOf(hook) == 'type') implement.call(hook, name, method);
|
213 |
+
else hook.call(this, name, method);
|
214 |
+
}
|
215 |
+
|
216 |
+
var previous = this.prototype[name];
|
217 |
+
if (previous == null || !previous.$protected) this.prototype[name] = method;
|
218 |
+
|
219 |
+
if (this[name] == null && typeOf(method) == 'function') extend.call(this, name, function(item){
|
220 |
+
return method.apply(item, slice.call(arguments, 1));
|
221 |
+
});
|
222 |
+
};
|
223 |
+
|
224 |
+
var extend = function(name, method){
|
225 |
+
if (method && method.$hidden) return;
|
226 |
+
var previous = this[name];
|
227 |
+
if (previous == null || !previous.$protected) this[name] = method;
|
228 |
+
};
|
229 |
+
|
230 |
+
Type.implement({
|
231 |
+
|
232 |
+
implement: implement.overloadSetter(),
|
233 |
+
|
234 |
+
extend: extend.overloadSetter(),
|
235 |
+
|
236 |
+
alias: function(name, existing){
|
237 |
+
implement.call(this, name, this.prototype[existing]);
|
238 |
+
}.overloadSetter(),
|
239 |
+
|
240 |
+
mirror: function(hook){
|
241 |
+
hooksOf(this).push(hook);
|
242 |
+
return this;
|
243 |
+
}
|
244 |
+
|
245 |
+
});
|
246 |
+
|
247 |
+
new Type('Type', Type);
|
248 |
+
|
249 |
+
// Default Types
|
250 |
+
|
251 |
+
var force = function(name, object, methods){
|
252 |
+
var isType = (object != Object),
|
253 |
+
prototype = object.prototype;
|
254 |
+
|
255 |
+
if (isType) object = new Type(name, object);
|
256 |
+
|
257 |
+
for (var i = 0, l = methods.length; i < l; i++){
|
258 |
+
var key = methods[i],
|
259 |
+
generic = object[key],
|
260 |
+
proto = prototype[key];
|
261 |
+
|
262 |
+
if (generic) generic.protect();
|
263 |
+
if (isType && proto) object.implement(key, proto.protect());
|
264 |
+
}
|
265 |
+
|
266 |
+
if (isType){
|
267 |
+
var methodsEnumerable = prototype.propertyIsEnumerable(methods[0]);
|
268 |
+
object.forEachMethod = function(fn){
|
269 |
+
if (!methodsEnumerable) for (var i = 0, l = methods.length; i < l; i++){
|
270 |
+
fn.call(prototype, prototype[methods[i]], methods[i]);
|
271 |
+
}
|
272 |
+
for (var key in prototype) fn.call(prototype, prototype[key], key);
|
273 |
+
};
|
274 |
+
}
|
275 |
+
|
276 |
+
return force;
|
277 |
+
};
|
278 |
+
|
279 |
+
force('String', String, [
|
280 |
+
'charAt', 'charCodeAt', 'concat', 'contains', 'indexOf', 'lastIndexOf', 'match', 'quote', 'replace', 'search',
|
281 |
+
'slice', 'split', 'substr', 'substring', 'trim', 'toLowerCase', 'toUpperCase'
|
282 |
+
])('Array', Array, [
|
283 |
+
'pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift', 'concat', 'join', 'slice',
|
284 |
+
'indexOf', 'lastIndexOf', 'filter', 'forEach', 'every', 'map', 'some', 'reduce', 'reduceRight', 'contains'
|
285 |
+
])('Number', Number, [
|
286 |
+
'toExponential', 'toFixed', 'toLocaleString', 'toPrecision'
|
287 |
+
])('Function', Function, [
|
288 |
+
'apply', 'call', 'bind'
|
289 |
+
])('RegExp', RegExp, [
|
290 |
+
'exec', 'test'
|
291 |
+
])('Object', Object, [
|
292 |
+
'create', 'defineProperty', 'defineProperties', 'keys',
|
293 |
+
'getPrototypeOf', 'getOwnPropertyDescriptor', 'getOwnPropertyNames',
|
294 |
+
'preventExtensions', 'isExtensible', 'seal', 'isSealed', 'freeze', 'isFrozen'
|
295 |
+
])('Date', Date, ['now']);
|
296 |
+
|
297 |
+
Object.extend = extend.overloadSetter();
|
298 |
+
|
299 |
+
Date.extend('now', function(){
|
300 |
+
return +(new Date);
|
301 |
+
});
|
302 |
+
|
303 |
+
new Type('Boolean', Boolean);
|
304 |
+
|
305 |
+
// fixes NaN returning as Number
|
306 |
+
|
307 |
+
Number.prototype.$family = function(){
|
308 |
+
return isFinite(this) ? 'number' : 'null';
|
309 |
+
}.hide();
|
310 |
+
|
311 |
+
// Number.random
|
312 |
+
|
313 |
+
Number.extend('random', function(min, max){
|
314 |
+
return Math.floor(Math.random() * (max - min + 1) + min);
|
315 |
+
});
|
316 |
+
|
317 |
+
// forEach, each, keys
|
318 |
+
|
319 |
+
Array.implement({
|
320 |
+
|
321 |
+
/*<!ES5>*/
|
322 |
+
forEach: function(fn, bind){
|
323 |
+
for (var i = 0, l = this.length; i < l; i++){
|
324 |
+
if (i in this) fn.call(bind, this[i], i, this);
|
325 |
+
}
|
326 |
+
},
|
327 |
+
/*</!ES5>*/
|
328 |
+
|
329 |
+
each: function(fn, bind){
|
330 |
+
Array.forEach(this, fn, bind);
|
331 |
+
return this;
|
332 |
+
}
|
333 |
+
|
334 |
+
});
|
335 |
+
|
336 |
+
Object.extend({
|
337 |
+
|
338 |
+
keys: function(object){
|
339 |
+
var keys = [];
|
340 |
+
for (var k in object){
|
341 |
+
if (hasOwnProperty.call(object, k)) keys.push(k);
|
342 |
+
}
|
343 |
+
/*<ltIE8>*/
|
344 |
+
forEachObjectEnumberableKey(object, function(k){
|
345 |
+
keys.push(k);
|
346 |
+
});
|
347 |
+
/*</ltIE8>*/
|
348 |
+
return keys;
|
349 |
+
},
|
350 |
+
|
351 |
+
forEach: function(object, fn, bind){
|
352 |
+
Object.keys(object).forEach(function(key){
|
353 |
+
fn.call(bind, object[key], key, object);
|
354 |
+
});
|
355 |
+
}
|
356 |
+
|
357 |
+
});
|
358 |
+
|
359 |
+
Object.each = Object.forEach;
|
360 |
+
|
361 |
+
|
362 |
+
// Array & Object cloning, Object merging and appending
|
363 |
+
|
364 |
+
var cloneOf = function(item){
|
365 |
+
switch (typeOf(item)){
|
366 |
+
case 'array': return item.clone();
|
367 |
+
case 'object': return Object.clone(item);
|
368 |
+
default: return item;
|
369 |
+
}
|
370 |
+
};
|
371 |
+
|
372 |
+
Array.implement('clone', function(){
|
373 |
+
var i = this.length, clone = new Array(i);
|
374 |
+
while (i--) clone[i] = cloneOf(this[i]);
|
375 |
+
return clone;
|
376 |
+
});
|
377 |
+
|
378 |
+
var mergeOne = function(source, key, current){
|
379 |
+
switch (typeOf(current)){
|
380 |
+
case 'object':
|
381 |
+
if (typeOf(source[key]) == 'object') Object.merge(source[key], current);
|
382 |
+
else source[key] = Object.clone(current);
|
383 |
+
break;
|
384 |
+
case 'array': source[key] = current.clone(); break;
|
385 |
+
default: source[key] = current;
|
386 |
+
}
|
387 |
+
return source;
|
388 |
+
};
|
389 |
+
|
390 |
+
Object.extend({
|
391 |
+
|
392 |
+
merge: function(source, k, v){
|
393 |
+
if (typeOf(k) == 'string') return mergeOne(source, k, v);
|
394 |
+
for (var i = 1, l = arguments.length; i < l; i++){
|
395 |
+
var object = arguments[i];
|
396 |
+
for (var key in object) mergeOne(source, key, object[key]);
|
397 |
+
}
|
398 |
+
return source;
|
399 |
+
},
|
400 |
+
|
401 |
+
clone: function(object){
|
402 |
+
var clone = {};
|
403 |
+
for (var key in object) clone[key] = cloneOf(object[key]);
|
404 |
+
return clone;
|
405 |
+
},
|
406 |
+
|
407 |
+
append: function(original){
|
408 |
+
for (var i = 1, l = arguments.length; i < l; i++){
|
409 |
+
var extended = arguments[i] || {};
|
410 |
+
for (var key in extended) original[key] = extended[key];
|
411 |
+
}
|
412 |
+
return original;
|
413 |
+
}
|
414 |
+
|
415 |
+
});
|
416 |
+
|
417 |
+
// Object-less types
|
418 |
+
|
419 |
+
['Object', 'WhiteSpace', 'TextNode', 'Collection', 'Arguments'].each(function(name){
|
420 |
+
new Type(name);
|
421 |
+
});
|
422 |
+
|
423 |
+
// Unique ID
|
424 |
+
|
425 |
+
var UID = Date.now();
|
426 |
+
|
427 |
+
String.extend('uniqueID', function(){
|
428 |
+
return (UID++).toString(36);
|
429 |
+
});
|
430 |
+
|
431 |
+
|
432 |
+
|
433 |
+
})();
|
434 |
+
|
435 |
+
/*
|
436 |
+
---
|
437 |
+
|
438 |
+
name: Array
|
439 |
+
|
440 |
+
description: Contains Array Prototypes like each, contains, and erase.
|
441 |
+
|
442 |
+
license: MIT-style license.
|
443 |
+
|
444 |
+
requires: [Type]
|
445 |
+
|
446 |
+
provides: Array
|
447 |
+
|
448 |
+
...
|
449 |
+
*/
|
450 |
+
|
451 |
+
Array.implement({
|
452 |
+
|
453 |
+
/*<!ES5>*/
|
454 |
+
every: function(fn, bind){
|
455 |
+
for (var i = 0, l = this.length >>> 0; i < l; i++){
|
456 |
+
if ((i in this) && !fn.call(bind, this[i], i, this)) return false;
|
457 |
+
}
|
458 |
+
return true;
|
459 |
+
},
|
460 |
+
|
461 |
+
filter: function(fn, bind){
|
462 |
+
var results = [];
|
463 |
+
for (var value, i = 0, l = this.length >>> 0; i < l; i++) if (i in this){
|
464 |
+
value = this[i];
|
465 |
+
if (fn.call(bind, value, i, this)) results.push(value);
|
466 |
+
}
|
467 |
+
return results;
|
468 |
+
},
|
469 |
+
|
470 |
+
indexOf: function(item, from){
|
471 |
+
var length = this.length >>> 0;
|
472 |
+
for (var i = (from < 0) ? Math.max(0, length + from) : from || 0; i < length; i++){
|
473 |
+
if (this[i] === item) return i;
|
474 |
+
}
|
475 |
+
return -1;
|
476 |
+
},
|
477 |
+
|
478 |
+
map: function(fn, bind){
|
479 |
+
var length = this.length >>> 0, results = Array(length);
|
480 |
+
for (var i = 0; i < length; i++){
|
481 |
+
if (i in this) results[i] = fn.call(bind, this[i], i, this);
|
482 |
+
}
|
483 |
+
return results;
|
484 |
+
},
|
485 |
+
|
486 |
+
some: function(fn, bind){
|
487 |
+
for (var i = 0, l = this.length >>> 0; i < l; i++){
|
488 |
+
if ((i in this) && fn.call(bind, this[i], i, this)) return true;
|
489 |
+
}
|
490 |
+
return false;
|
491 |
+
},
|
492 |
+
/*</!ES5>*/
|
493 |
+
|
494 |
+
clean: function(){
|
495 |
+
return this.filter(function(item){
|
496 |
+
return item != null;
|
497 |
+
});
|
498 |
+
},
|
499 |
+
|
500 |
+
invoke: function(methodName){
|
501 |
+
var args = Array.slice(arguments, 1);
|
502 |
+
return this.map(function(item){
|
503 |
+
return item[methodName].apply(item, args);
|
504 |
+
});
|
505 |
+
},
|
506 |
+
|
507 |
+
associate: function(keys){
|
508 |
+
var obj = {}, length = Math.min(this.length, keys.length);
|
509 |
+
for (var i = 0; i < length; i++) obj[keys[i]] = this[i];
|
510 |
+
return obj;
|
511 |
+
},
|
512 |
+
|
513 |
+
link: function(object){
|
514 |
+
var result = {};
|
515 |
+
for (var i = 0, l = this.length; i < l; i++){
|
516 |
+
for (var key in object){
|
517 |
+
if (object[key](this[i])){
|
518 |
+
result[key] = this[i];
|
519 |
+
delete object[key];
|
520 |
+
break;
|
521 |
+
}
|
522 |
+
}
|
523 |
+
}
|
524 |
+
return result;
|
525 |
+
},
|
526 |
+
|
527 |
+
contains: function(item, from){
|
528 |
+
return this.indexOf(item, from) != -1;
|
529 |
+
},
|
530 |
+
|
531 |
+
append: function(array){
|
532 |
+
this.push.apply(this, array);
|
533 |
+
return this;
|
534 |
+
},
|
535 |
+
|
536 |
+
getLast: function(){
|
537 |
+
return (this.length) ? this[this.length - 1] : null;
|
538 |
+
},
|
539 |
+
|
540 |
+
getRandom: function(){
|
541 |
+
return (this.length) ? this[Number.random(0, this.length - 1)] : null;
|
542 |
+
},
|
543 |
+
|
544 |
+
include: function(item){
|
545 |
+
if (!this.contains(item)) this.push(item);
|
546 |
+
return this;
|
547 |
+
},
|
548 |
+
|
549 |
+
combine: function(array){
|
550 |
+
for (var i = 0, l = array.length; i < l; i++) this.include(array[i]);
|
551 |
+
return this;
|
552 |
+
},
|
553 |
+
|
554 |
+
erase: function(item){
|
555 |
+
for (var i = this.length; i--;){
|
556 |
+
if (this[i] === item) this.splice(i, 1);
|
557 |
+
}
|
558 |
+
return this;
|
559 |
+
},
|
560 |
+
|
561 |
+
empty: function(){
|
562 |
+
this.length = 0;
|
563 |
+
return this;
|
564 |
+
},
|
565 |
+
|
566 |
+
flatten: function(){
|
567 |
+
var array = [];
|
568 |
+
for (var i = 0, l = this.length; i < l; i++){
|
569 |
+
var type = typeOf(this[i]);
|
570 |
+
if (type == 'null') continue;
|
571 |
+
array = array.concat((type == 'array' || type == 'collection' || type == 'arguments' || instanceOf(this[i], Array)) ? Array.flatten(this[i]) : this[i]);
|
572 |
+
}
|
573 |
+
return array;
|
574 |
+
},
|
575 |
+
|
576 |
+
pick: function(){
|
577 |
+
for (var i = 0, l = this.length; i < l; i++){
|
578 |
+
if (this[i] != null) return this[i];
|
579 |
+
}
|
580 |
+
return null;
|
581 |
+
},
|
582 |
+
|
583 |
+
hexToRgb: function(array){
|
584 |
+
if (this.length != 3) return null;
|
585 |
+
var rgb = this.map(function(value){
|
586 |
+
if (value.length == 1) value += value;
|
587 |
+
return parseInt(value, 16);
|
588 |
+
});
|
589 |
+
return (array) ? rgb : 'rgb(' + rgb + ')';
|
590 |
+
},
|
591 |
+
|
592 |
+
rgbToHex: function(array){
|
593 |
+
if (this.length < 3) return null;
|
594 |
+
if (this.length == 4 && this[3] == 0 && !array) return 'transparent';
|
595 |
+
var hex = [];
|
596 |
+
for (var i = 0; i < 3; i++){
|
597 |
+
var bit = (this[i] - 0).toString(16);
|
598 |
+
hex.push((bit.length == 1) ? '0' + bit : bit);
|
599 |
+
}
|
600 |
+
return (array) ? hex : '#' + hex.join('');
|
601 |
+
}
|
602 |
+
|
603 |
+
});
|
604 |
+
|
605 |
+
|
606 |
+
|
607 |
+
/*
|
608 |
+
---
|
609 |
+
|
610 |
+
name: Function
|
611 |
+
|
612 |
+
description: Contains Function Prototypes like create, bind, pass, and delay.
|
613 |
+
|
614 |
+
license: MIT-style license.
|
615 |
+
|
616 |
+
requires: Type
|
617 |
+
|
618 |
+
provides: Function
|
619 |
+
|
620 |
+
...
|
621 |
+
*/
|
622 |
+
|
623 |
+
Function.extend({
|
624 |
+
|
625 |
+
attempt: function(){
|
626 |
+
for (var i = 0, l = arguments.length; i < l; i++){
|
627 |
+
try {
|
628 |
+
return arguments[i]();
|
629 |
+
} catch (e){}
|
630 |
+
}
|
631 |
+
return null;
|
632 |
+
}
|
633 |
+
|
634 |
+
});
|
635 |
+
|
636 |
+
Function.implement({
|
637 |
+
|
638 |
+
attempt: function(args, bind){
|
639 |
+
try {
|
640 |
+
return this.apply(bind, Array.from(args));
|
641 |
+
} catch (e){}
|
642 |
+
|
643 |
+
return null;
|
644 |
+
},
|
645 |
+
|
646 |
+
/*<!ES5-bind>*/
|
647 |
+
bind: function(that){
|
648 |
+
var self = this,
|
649 |
+
args = arguments.length > 1 ? Array.slice(arguments, 1) : null,
|
650 |
+
F = function(){};
|
651 |
+
|
652 |
+
var bound = function(){
|
653 |
+
var context = that, length = arguments.length;
|
654 |
+
if (this instanceof bound){
|
655 |
+
F.prototype = self.prototype;
|
656 |
+
context = new F;
|
657 |
+
}
|
658 |
+
var result = (!args && !length)
|
659 |
+
? self.call(context)
|
660 |
+
: self.apply(context, args && length ? args.concat(Array.slice(arguments)) : args || arguments);
|
661 |
+
return context == that ? result : context;
|
662 |
+
};
|
663 |
+
return bound;
|
664 |
+
},
|
665 |
+
/*</!ES5-bind>*/
|
666 |
+
|
667 |
+
pass: function(args, bind){
|
668 |
+
var self = this;
|
669 |
+
if (args != null) args = Array.from(args);
|
670 |
+
return function(){
|
671 |
+
return self.apply(bind, args || arguments);
|
672 |
+
};
|
673 |
+
},
|
674 |
+
|
675 |
+
delay: function(delay, bind, args){
|
676 |
+
return setTimeout(this.pass((args == null ? [] : args), bind), delay);
|
677 |
+
},
|
678 |
+
|
679 |
+
periodical: function(periodical, bind, args){
|
680 |
+
return setInterval(this.pass((args == null ? [] : args), bind), periodical);
|
681 |
+
}
|
682 |
+
|
683 |
+
});
|
684 |
+
|
685 |
+
|
686 |
+
|
687 |
+
/*
|
688 |
+
---
|
689 |
+
|
690 |
+
name: Number
|
691 |
+
|
692 |
+
description: Contains Number Prototypes like limit, round, times, and ceil.
|
693 |
+
|
694 |
+
license: MIT-style license.
|
695 |
+
|
696 |
+
requires: Type
|
697 |
+
|
698 |
+
provides: Number
|
699 |
+
|
700 |
+
...
|
701 |
+
*/
|
702 |
+
|
703 |
+
Number.implement({
|
704 |
+
|
705 |
+
limit: function(min, max){
|
706 |
+
return Math.min(max, Math.max(min, this));
|
707 |
+
},
|
708 |
+
|
709 |
+
round: function(precision){
|
710 |
+
precision = Math.pow(10, precision || 0).toFixed(precision < 0 ? -precision : 0);
|
711 |
+
return Math.round(this * precision) / precision;
|
712 |
+
},
|
713 |
+
|
714 |
+
times: function(fn, bind){
|
715 |
+
for (var i = 0; i < this; i++) fn.call(bind, i, this);
|
716 |
+
},
|
717 |
+
|
718 |
+
toFloat: function(){
|
719 |
+
return parseFloat(this);
|
720 |
+
},
|
721 |
+
|
722 |
+
toInt: function(base){
|
723 |
+
return parseInt(this, base || 10);
|
724 |
+
}
|
725 |
+
|
726 |
+
});
|
727 |
+
|
728 |
+
Number.alias('each', 'times');
|
729 |
+
|
730 |
+
(function(math){
|
731 |
+
var methods = {};
|
732 |
+
math.each(function(name){
|
733 |
+
if (!Number[name]) methods[name] = function(){
|
734 |
+
return Math[name].apply(null, [this].concat(Array.from(arguments)));
|
735 |
+
};
|
736 |
+
});
|
737 |
+
Number.implement(methods);
|
738 |
+
})(['abs', 'acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'exp', 'floor', 'log', 'max', 'min', 'pow', 'sin', 'sqrt', 'tan']);
|
739 |
+
|
740 |
+
/*
|
741 |
+
---
|
742 |
+
|
743 |
+
name: String
|
744 |
+
|
745 |
+
description: Contains String Prototypes like camelCase, capitalize, test, and toInt.
|
746 |
+
|
747 |
+
license: MIT-style license.
|
748 |
+
|
749 |
+
requires: [Type, Array]
|
750 |
+
|
751 |
+
provides: String
|
752 |
+
|
753 |
+
...
|
754 |
+
*/
|
755 |
+
|
756 |
+
String.implement({
|
757 |
+
|
758 |
+
//<!ES6>
|
759 |
+
contains: function(string, index){
|
760 |
+
return (index ? String(this).slice(index) : String(this)).indexOf(string) > -1;
|
761 |
+
},
|
762 |
+
//</!ES6>
|
763 |
+
|
764 |
+
test: function(regex, params){
|
765 |
+
return ((typeOf(regex) == 'regexp') ? regex : new RegExp('' + regex, params)).test(this);
|
766 |
+
},
|
767 |
+
|
768 |
+
trim: function(){
|
769 |
+
return String(this).replace(/^\s+|\s+$/g, '');
|
770 |
+
},
|
771 |
+
|
772 |
+
clean: function(){
|
773 |
+
return String(this).replace(/\s+/g, ' ').trim();
|
774 |
+
},
|
775 |
+
|
776 |
+
camelCase: function(){
|
777 |
+
return String(this).replace(/-\D/g, function(match){
|
778 |
+
return match.charAt(1).toUpperCase();
|
779 |
+
});
|
780 |
+
},
|
781 |
+
|
782 |
+
hyphenate: function(){
|
783 |
+
return String(this).replace(/[A-Z]/g, function(match){
|
784 |
+
return ('-' + match.charAt(0).toLowerCase());
|
785 |
+
});
|
786 |
+
},
|
787 |
+
|
788 |
+
capitalize: function(){
|
789 |
+
return String(this).replace(/\b[a-z]/g, function(match){
|
790 |
+
return match.toUpperCase();
|
791 |
+
});
|
792 |
+
},
|
793 |
+
|
794 |
+
escapeRegExp: function(){
|
795 |
+
return String(this).replace(/([-.*+?^${}()|[\]\/\\])/g, '\\$1');
|
796 |
+
},
|
797 |
+
|
798 |
+
toInt: function(base){
|
799 |
+
return parseInt(this, base || 10);
|
800 |
+
},
|
801 |
+
|
802 |
+
toFloat: function(){
|
803 |
+
return parseFloat(this);
|
804 |
+
},
|
805 |
+
|
806 |
+
hexToRgb: function(array){
|
807 |
+
var hex = String(this).match(/^#?(\w{1,2})(\w{1,2})(\w{1,2})$/);
|
808 |
+
return (hex) ? hex.slice(1).hexToRgb(array) : null;
|
809 |
+
},
|
810 |
+
|
811 |
+
rgbToHex: function(array){
|
812 |
+
var rgb = String(this).match(/\d{1,3}/g);
|
813 |
+
return (rgb) ? rgb.rgbToHex(array) : null;
|
814 |
+
},
|
815 |
+
|
816 |
+
substitute: function(object, regexp){
|
817 |
+
return String(this).replace(regexp || (/\\?\{([^{}]+)\}/g), function(match, name){
|
818 |
+
if (match.charAt(0) == '\\') return match.slice(1);
|
819 |
+
return (object[name] != null) ? object[name] : '';
|
820 |
+
});
|
821 |
+
}
|
822 |
+
|
823 |
+
});
|
824 |
+
|
825 |
+
|
826 |
+
|
827 |
+
/*
|
828 |
+
---
|
829 |
+
|
830 |
+
name: Browser
|
831 |
+
|
832 |
+
description: The Browser Object. Contains Browser initialization, Window and Document, and the Browser Hash.
|
833 |
+
|
834 |
+
license: MIT-style license.
|
835 |
+
|
836 |
+
requires: [Array, Function, Number, String]
|
837 |
+
|
838 |
+
provides: [Browser, Window, Document]
|
839 |
+
|
840 |
+
...
|
841 |
+
*/
|
842 |
+
|
843 |
+
(function(){
|
844 |
+
|
845 |
+
var document = this.document;
|
846 |
+
var window = document.window = this;
|
847 |
+
|
848 |
+
var parse = function(ua, platform){
|
849 |
+
ua = ua.toLowerCase();
|
850 |
+
platform = (platform ? platform.toLowerCase() : '');
|
851 |
+
|
852 |
+
// chrome is included in the edge UA, so need to check for edge first,
|
853 |
+
// before checking if it's chrome.
|
854 |
+
var UA = ua.match(/(edge)[\s\/:]([\w\d\.]+)/);
|
855 |
+
if (!UA){
|
856 |
+
UA = ua.match(/(opera|ie|firefox|chrome|trident|crios|version)[\s\/:]([\w\d\.]+)?.*?(safari|(?:rv[\s\/:]|version[\s\/:])([\w\d\.]+)|$)/) || [null, 'unknown', 0];
|
857 |
+
}
|
858 |
+
|
859 |
+
if (UA[1] == 'trident'){
|
860 |
+
UA[1] = 'ie';
|
861 |
+
if (UA[4]) UA[2] = UA[4];
|
862 |
+
} else if (UA[1] == 'crios'){
|
863 |
+
UA[1] = 'chrome';
|
864 |
+
}
|
865 |
+
|
866 |
+
platform = ua.match(/ip(?:ad|od|hone)/) ? 'ios' : (ua.match(/(?:webos|android)/) || ua.match(/mac|win|linux/) || ['other'])[0];
|
867 |
+
if (platform == 'win') platform = 'windows';
|
868 |
+
|
869 |
+
return {
|
870 |
+
extend: Function.prototype.extend,
|
871 |
+
name: (UA[1] == 'version') ? UA[3] : UA[1],
|
872 |
+
version: parseFloat((UA[1] == 'opera' && UA[4]) ? UA[4] : UA[2]),
|
873 |
+
platform: platform
|
874 |
+
};
|
875 |
+
};
|
876 |
+
|
877 |
+
var Browser = this.Browser = parse(navigator.userAgent, navigator.platform);
|
878 |
+
|
879 |
+
if (Browser.name == 'ie' && document.documentMode){
|
880 |
+
Browser.version = document.documentMode;
|
881 |
+
}
|
882 |
+
|
883 |
+
Browser.extend({
|
884 |
+
Features: {
|
885 |
+
xpath: !!(document.evaluate),
|
886 |
+
air: !!(window.runtime),
|
887 |
+
query: !!(document.querySelector),
|
888 |
+
json: !!(window.JSON)
|
889 |
+
},
|
890 |
+
parseUA: parse
|
891 |
+
});
|
892 |
+
|
893 |
+
|
894 |
+
|
895 |
+
// Request
|
896 |
+
|
897 |
+
Browser.Request = (function(){
|
898 |
+
|
899 |
+
var XMLHTTP = function(){
|
900 |
+
return new XMLHttpRequest();
|
901 |
+
};
|
902 |
+
|
903 |
+
var MSXML2 = function(){
|
904 |
+
return new ActiveXObject('MSXML2.XMLHTTP');
|
905 |
+
};
|
906 |
+
|
907 |
+
var MSXML = function(){
|
908 |
+
return new ActiveXObject('Microsoft.XMLHTTP');
|
909 |
+
};
|
910 |
+
|
911 |
+
return Function.attempt(function(){
|
912 |
+
XMLHTTP();
|
913 |
+
return XMLHTTP;
|
914 |
+
}, function(){
|
915 |
+
MSXML2();
|
916 |
+
return MSXML2;
|
917 |
+
}, function(){
|
918 |
+
MSXML();
|
919 |
+
return MSXML;
|
920 |
+
});
|
921 |
+
|
922 |
+
})();
|
923 |
+
|
924 |
+
Browser.Features.xhr = !!(Browser.Request);
|
925 |
+
|
926 |
+
|
927 |
+
|
928 |
+
// String scripts
|
929 |
+
|
930 |
+
Browser.exec = function(text){
|
931 |
+
if (!text) return text;
|
932 |
+
if (window.execScript){
|
933 |
+
window.execScript(text);
|
934 |
+
} else {
|
935 |
+
var script = document.createElement('script');
|
936 |
+
script.setAttribute('type', 'text/javascript');
|
937 |
+
script.text = text;
|
938 |
+
document.head.appendChild(script);
|
939 |
+
document.head.removeChild(script);
|
940 |
+
}
|
941 |
+
return text;
|
942 |
+
};
|
943 |
+
|
944 |
+
String.implement('stripScripts', function(exec){
|
945 |
+
var scripts = '';
|
946 |
+
var text = this.replace(/<script[^>]*>([\s\S]*?)<\/script>/gi, function(all, code){
|
947 |
+
scripts += code + '\n';
|
948 |
+
return '';
|
949 |
+
});
|
950 |
+
if (exec === true) Browser.exec(scripts);
|
951 |
+
else if (typeOf(exec) == 'function') exec(scripts, text);
|
952 |
+
return text;
|
953 |
+
});
|
954 |
+
|
955 |
+
// Window, Document
|
956 |
+
|
957 |
+
Browser.extend({
|
958 |
+
Document: this.Document,
|
959 |
+
Window: this.Window,
|
960 |
+
Element: this.Element,
|
961 |
+
Event: this.Event
|
962 |
+
});
|
963 |
+
|
964 |
+
this.Window = this.$constructor = new Type('Window', function(){});
|
965 |
+
|
966 |
+
this.$family = Function.from('window').hide();
|
967 |
+
|
968 |
+
Window.mirror(function(name, method){
|
969 |
+
window[name] = method;
|
970 |
+
});
|
971 |
+
|
972 |
+
this.Document = document.$constructor = new Type('Document', function(){});
|
973 |
+
|
974 |
+
document.$family = Function.from('document').hide();
|
975 |
+
|
976 |
+
Document.mirror(function(name, method){
|
977 |
+
document[name] = method;
|
978 |
+
});
|
979 |
+
|
980 |
+
document.html = document.documentElement;
|
981 |
+
if (!document.head) document.head = document.getElementsByTagName('head')[0];
|
982 |
+
|
983 |
+
if (document.execCommand) try {
|
984 |
+
document.execCommand("BackgroundImageCache", false, true);
|
985 |
+
} catch (e){}
|
986 |
+
|
987 |
+
/*<ltIE9>*/
|
988 |
+
if (this.attachEvent && !this.addEventListener){
|
989 |
+
var unloadEvent = function(){
|
990 |
+
this.detachEvent('onunload', unloadEvent);
|
991 |
+
document.head = document.html = document.window = null;
|
992 |
+
window = this.Window = document = null;
|
993 |
+
};
|
994 |
+
this.attachEvent('onunload', unloadEvent);
|
995 |
+
}
|
996 |
+
|
997 |
+
// IE fails on collections and <select>.options (refers to <select>)
|
998 |
+
var arrayFrom = Array.from;
|
999 |
+
try {
|
1000 |
+
arrayFrom(document.html.childNodes);
|
1001 |
+
} catch(e){
|
1002 |
+
Array.from = function(item){
|
1003 |
+
if (typeof item != 'string' && Type.isEnumerable(item) && typeOf(item) != 'array'){
|
1004 |
+
var i = item.length, array = new Array(i);
|
1005 |
+
while (i--) array[i] = item[i];
|
1006 |
+
return array;
|
1007 |
+
}
|
1008 |
+
return arrayFrom(item);
|
1009 |
+
};
|
1010 |
+
|
1011 |
+
var prototype = Array.prototype,
|
1012 |
+
slice = prototype.slice;
|
1013 |
+
['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift', 'concat', 'join', 'slice'].each(function(name){
|
1014 |
+
var method = prototype[name];
|
1015 |
+
Array[name] = function(item){
|
1016 |
+
return method.apply(Array.from(item), slice.call(arguments, 1));
|
1017 |
+
};
|
1018 |
+
});
|
1019 |
+
}
|
1020 |
+
/*</ltIE9>*/
|
1021 |
+
|
1022 |
+
|
1023 |
+
|
1024 |
+
})();
|
1025 |
+
|
1026 |
+
/*
|
1027 |
+
---
|
1028 |
+
|
1029 |
+
name: Class
|
1030 |
+
|
1031 |
+
description: Contains the Class Function for easily creating, extending, and implementing reusable Classes.
|
1032 |
+
|
1033 |
+
license: MIT-style license.
|
1034 |
+
|
1035 |
+
requires: [Array, String, Function, Number]
|
1036 |
+
|
1037 |
+
provides: Class
|
1038 |
+
|
1039 |
+
...
|
1040 |
+
*/
|
1041 |
+
|
1042 |
+
(function(){
|
1043 |
+
|
1044 |
+
var Class = this.Class = new Type('Class', function(params){
|
1045 |
+
if (instanceOf(params, Function)) params = {initialize: params};
|
1046 |
+
|
1047 |
+
var newClass = function(){
|
1048 |
+
reset(this);
|
1049 |
+
if (newClass.$prototyping) return this;
|
1050 |
+
this.$caller = null;
|
1051 |
+
this.$family = null;
|
1052 |
+
var value = (this.initialize) ? this.initialize.apply(this, arguments) : this;
|
1053 |
+
this.$caller = this.caller = null;
|
1054 |
+
return value;
|
1055 |
+
}.extend(this).implement(params);
|
1056 |
+
|
1057 |
+
newClass.$constructor = Class;
|
1058 |
+
newClass.prototype.$constructor = newClass;
|
1059 |
+
newClass.prototype.parent = parent;
|
1060 |
+
|
1061 |
+
return newClass;
|
1062 |
+
});
|
1063 |
+
|
1064 |
+
var parent = function(){
|
1065 |
+
if (!this.$caller) throw new Error('The method "parent" cannot be called.');
|
1066 |
+
var name = this.$caller.$name,
|
1067 |
+
parent = this.$caller.$owner.parent,
|
1068 |
+
previous = (parent) ? parent.prototype[name] : null;
|
1069 |
+
if (!previous) throw new Error('The method "' + name + '" has no parent.');
|
1070 |
+
return previous.apply(this, arguments);
|
1071 |
+
};
|
1072 |
+
|
1073 |
+
var reset = function(object){
|
1074 |
+
for (var key in object){
|
1075 |
+
var value = object[key];
|
1076 |
+
switch (typeOf(value)){
|
1077 |
+
case 'object':
|
1078 |
+
var F = function(){};
|
1079 |
+
F.prototype = value;
|
1080 |
+
object[key] = reset(new F);
|
1081 |
+
break;
|
1082 |
+
case 'array': object[key] = value.clone(); break;
|
1083 |
+
}
|
1084 |
+
}
|
1085 |
+
return object;
|
1086 |
+
};
|
1087 |
+
|
1088 |
+
var wrap = function(self, key, method){
|
1089 |
+
if (method.$origin) method = method.$origin;
|
1090 |
+
var wrapper = function(){
|
1091 |
+
if (method.$protected && this.$caller == null) throw new Error('The method "' + key + '" cannot be called.');
|
1092 |
+
var caller = this.caller, current = this.$caller;
|
1093 |
+
this.caller = current; this.$caller = wrapper;
|
1094 |
+
var result = method.apply(this, arguments);
|
1095 |
+
this.$caller = current; this.caller = caller;
|
1096 |
+
return result;
|
1097 |
+
}.extend({$owner: self, $origin: method, $name: key});
|
1098 |
+
return wrapper;
|
1099 |
+
};
|
1100 |
+
|
1101 |
+
var implement = function(key, value, retain){
|
1102 |
+
if (Class.Mutators.hasOwnProperty(key)){
|
1103 |
+
value = Class.Mutators[key].call(this, value);
|
1104 |
+
if (value == null) return this;
|
1105 |
+
}
|
1106 |
+
|
1107 |
+
if (typeOf(value) == 'function'){
|
1108 |
+
if (value.$hidden) return this;
|
1109 |
+
this.prototype[key] = (retain) ? value : wrap(this, key, value);
|
1110 |
+
} else {
|
1111 |
+
Object.merge(this.prototype, key, value);
|
1112 |
+
}
|
1113 |
+
|
1114 |
+
return this;
|
1115 |
+
};
|
1116 |
+
|
1117 |
+
var getInstance = function(klass){
|
1118 |
+
klass.$prototyping = true;
|
1119 |
+
var proto = new klass;
|
1120 |
+
delete klass.$prototyping;
|
1121 |
+
return proto;
|
1122 |
+
};
|
1123 |
+
|
1124 |
+
Class.implement('implement', implement.overloadSetter());
|
1125 |
+
|
1126 |
+
Class.Mutators = {
|
1127 |
+
|
1128 |
+
Extends: function(parent){
|
1129 |
+
this.parent = parent;
|
1130 |
+
this.prototype = getInstance(parent);
|
1131 |
+
},
|
1132 |
+
|
1133 |
+
Implements: function(items){
|
1134 |
+
Array.from(items).each(function(item){
|
1135 |
+
var instance = new item;
|
1136 |
+
for (var key in instance) implement.call(this, key, instance[key], true);
|
1137 |
+
}, this);
|
1138 |
+
}
|
1139 |
+
};
|
1140 |
+
|
1141 |
+
})();
|
1142 |
+
|
1143 |
+
/*
|
1144 |
+
---
|
1145 |
+
|
1146 |
+
name: Class.Extras
|
1147 |
+
|
1148 |
+
description: Contains Utility Classes that can be implemented into your own Classes to ease the execution of many common tasks.
|
1149 |
+
|
1150 |
+
license: MIT-style license.
|
1151 |
+
|
1152 |
+
requires: Class
|
1153 |
+
|
1154 |
+
provides: [Class.Extras, Chain, Events, Options]
|
1155 |
+
|
1156 |
+
...
|
1157 |
+
*/
|
1158 |
+
|
1159 |
+
(function(){
|
1160 |
+
|
1161 |
+
this.Chain = new Class({
|
1162 |
+
|
1163 |
+
$chain: [],
|
1164 |
+
|
1165 |
+
chain: function(){
|
1166 |
+
this.$chain.append(Array.flatten(arguments));
|
1167 |
+
return this;
|
1168 |
+
},
|
1169 |
+
|
1170 |
+
callChain: function(){
|
1171 |
+
return (this.$chain.length) ? this.$chain.shift().apply(this, arguments) : false;
|
1172 |
+
},
|
1173 |
+
|
1174 |
+
clearChain: function(){
|
1175 |
+
this.$chain.empty();
|
1176 |
+
return this;
|
1177 |
+
}
|
1178 |
+
|
1179 |
+
});
|
1180 |
+
|
1181 |
+
var removeOn = function(string){
|
1182 |
+
return string.replace(/^on([A-Z])/, function(full, first){
|
1183 |
+
return first.toLowerCase();
|
1184 |
+
});
|
1185 |
+
};
|
1186 |
+
|
1187 |
+
this.Events = new Class({
|
1188 |
+
|
1189 |
+
$events: {},
|
1190 |
+
|
1191 |
+
addEvent: function(type, fn, internal){
|
1192 |
+
type = removeOn(type);
|
1193 |
+
|
1194 |
+
|
1195 |
+
|
1196 |
+
this.$events[type] = (this.$events[type] || []).include(fn);
|
1197 |
+
if (internal) fn.internal = true;
|
1198 |
+
return this;
|
1199 |
+
},
|
1200 |
+
|
1201 |
+
addEvents: function(events){
|
1202 |
+
for (var type in events) this.addEvent(type, events[type]);
|
1203 |
+
return this;
|
1204 |
+
},
|
1205 |
+
|
1206 |
+
fireEvent: function(type, args, delay){
|
1207 |
+
type = removeOn(type);
|
1208 |
+
var events = this.$events[type];
|
1209 |
+
if (!events) return this;
|
1210 |
+
args = Array.from(args);
|
1211 |
+
events.each(function(fn){
|
1212 |
+
if (delay) fn.delay(delay, this, args);
|
1213 |
+
else fn.apply(this, args);
|
1214 |
+
}, this);
|
1215 |
+
return this;
|
1216 |
+
},
|
1217 |
+
|
1218 |
+
removeEvent: function(type, fn){
|
1219 |
+
type = removeOn(type);
|
1220 |
+
var events = this.$events[type];
|
1221 |
+
if (events && !fn.internal){
|
1222 |
+
var index = events.indexOf(fn);
|
1223 |
+
if (index != -1) delete events[index];
|
1224 |
+
}
|
1225 |
+
return this;
|
1226 |
+
},
|
1227 |
+
|
1228 |
+
removeEvents: function(events){
|
1229 |
+
var type;
|
1230 |
+
if (typeOf(events) == 'object'){
|
1231 |
+
for (type in events) this.removeEvent(type, events[type]);
|
1232 |
+
return this;
|
1233 |
+
}
|
1234 |
+
if (events) events = removeOn(events);
|
1235 |
+
for (type in this.$events){
|
1236 |
+
if (events && events != type) continue;
|
1237 |
+
var fns = this.$events[type];
|
1238 |
+
for (var i = fns.length; i--;) if (i in fns){
|
1239 |
+
this.removeEvent(type, fns[i]);
|
1240 |
+
}
|
1241 |
+
}
|
1242 |
+
return this;
|
1243 |
+
}
|
1244 |
+
|
1245 |
+
});
|
1246 |
+
|
1247 |
+
this.Options = new Class({
|
1248 |
+
|
1249 |
+
setOptions: function(){
|
1250 |
+
var options = this.options = Object.merge.apply(null, [{}, this.options].append(arguments));
|
1251 |
+
if (this.addEvent) for (var option in options){
|
1252 |
+
if (typeOf(options[option]) != 'function' || !(/^on[A-Z]/).test(option)) continue;
|
1253 |
+
this.addEvent(option, options[option]);
|
1254 |
+
delete options[option];
|
1255 |
+
}
|
1256 |
+
return this;
|
1257 |
+
}
|
1258 |
+
|
1259 |
+
});
|
1260 |
+
|
1261 |
+
})();
|
1262 |
+
|
1263 |
+
/*
|
1264 |
+
---
|
1265 |
+
|
1266 |
+
name: Object
|
1267 |
+
|
1268 |
+
description: Object generic methods
|
1269 |
+
|
1270 |
+
license: MIT-style license.
|
1271 |
+
|
1272 |
+
requires: Type
|
1273 |
+
|
1274 |
+
provides: [Object, Hash]
|
1275 |
+
|
1276 |
+
...
|
1277 |
+
*/
|
1278 |
+
|
1279 |
+
(function(){
|
1280 |
+
|
1281 |
+
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
1282 |
+
|
1283 |
+
Object.extend({
|
1284 |
+
|
1285 |
+
subset: function(object, keys){
|
1286 |
+
var results = {};
|
1287 |
+
for (var i = 0, l = keys.length; i < l; i++){
|
1288 |
+
var k = keys[i];
|
1289 |
+
if (k in object) results[k] = object[k];
|
1290 |
+
}
|
1291 |
+
return results;
|
1292 |
+
},
|
1293 |
+
|
1294 |
+
map: function(object, fn, bind){
|
1295 |
+
var results = {};
|
1296 |
+
var keys = Object.keys(object);
|
1297 |
+
for (var i = 0; i < keys.length; i++){
|
1298 |
+
var key = keys[i];
|
1299 |
+
results[key] = fn.call(bind, object[key], key, object);
|
1300 |
+
}
|
1301 |
+
return results;
|
1302 |
+
},
|
1303 |
+
|
1304 |
+
filter: function(object, fn, bind){
|
1305 |
+
var results = {};
|
1306 |
+
var keys = Object.keys(object);
|
1307 |
+
for (var i = 0; i < keys.length; i++){
|
1308 |
+
var key = keys[i], value = object[key];
|
1309 |
+
if (fn.call(bind, value, key, object)) results[key] = value;
|
1310 |
+
}
|
1311 |
+
return results;
|
1312 |
+
},
|
1313 |
+
|
1314 |
+
every: function(object, fn, bind){
|
1315 |
+
var keys = Object.keys(object);
|
1316 |
+
for (var i = 0; i < keys.length; i++){
|
1317 |
+
var key = keys[i];
|
1318 |
+
if (!fn.call(bind, object[key], key)) return false;
|
1319 |
+
}
|
1320 |
+
return true;
|
1321 |
+
},
|
1322 |
+
|
1323 |
+
some: function(object, fn, bind){
|
1324 |
+
var keys = Object.keys(object);
|
1325 |
+
for (var i = 0; i < keys.length; i++){
|
1326 |
+
var key = keys[i];
|
1327 |
+
if (fn.call(bind, object[key], key)) return true;
|
1328 |
+
}
|
1329 |
+
return false;
|
1330 |
+
},
|
1331 |
+
|
1332 |
+
values: function(object){
|
1333 |
+
var values = [];
|
1334 |
+
var keys = Object.keys(object);
|
1335 |
+
for (var i = 0; i < keys.length; i++){
|
1336 |
+
var k = keys[i];
|
1337 |
+
values.push(object[k]);
|
1338 |
+
}
|
1339 |
+
return values;
|
1340 |
+
},
|
1341 |
+
|
1342 |
+
getLength: function(object){
|
1343 |
+
return Object.keys(object).length;
|
1344 |
+
},
|
1345 |
+
|
1346 |
+
keyOf: function(object, value){
|
1347 |
+
var keys = Object.keys(object);
|
1348 |
+
for (var i = 0; i < keys.length; i++){
|
1349 |
+
var key = keys[i];
|
1350 |
+
if (object[key] === value) return key;
|
1351 |
+
}
|
1352 |
+
return null;
|
1353 |
+
},
|
1354 |
+
|
1355 |
+
contains: function(object, value){
|
1356 |
+
return Object.keyOf(object, value) != null;
|
1357 |
+
},
|
1358 |
+
|
1359 |
+
toQueryString: function(object, base){
|
1360 |
+
var queryString = [];
|
1361 |
+
|
1362 |
+
Object.each(object, function(value, key){
|
1363 |
+
if (base) key = base + '[' + key + ']';
|
1364 |
+
var result;
|
1365 |
+
switch (typeOf(value)){
|
1366 |
+
case 'object': result = Object.toQueryString(value, key); break;
|
1367 |
+
case 'array':
|
1368 |
+
var qs = {};
|
1369 |
+
value.each(function(val, i){
|
1370 |
+
qs[i] = val;
|
1371 |
+
});
|
1372 |
+
result = Object.toQueryString(qs, key);
|
1373 |
+
break;
|
1374 |
+
default: result = key + '=' + encodeURIComponent(value);
|
1375 |
+
}
|
1376 |
+
if (value != null) queryString.push(result);
|
1377 |
+
});
|
1378 |
+
|
1379 |
+
return queryString.join('&');
|
1380 |
+
}
|
1381 |
+
|
1382 |
+
});
|
1383 |
+
|
1384 |
+
})();
|
1385 |
+
|
1386 |
+
|
1387 |
+
|
1388 |
+
/*
|
1389 |
+
---
|
1390 |
+
name: Slick.Parser
|
1391 |
+
description: Standalone CSS3 Selector parser
|
1392 |
+
provides: Slick.Parser
|
1393 |
+
...
|
1394 |
+
*/
|
1395 |
+
|
1396 |
+
;(function(){
|
1397 |
+
|
1398 |
+
var parsed,
|
1399 |
+
separatorIndex,
|
1400 |
+
combinatorIndex,
|
1401 |
+
reversed,
|
1402 |
+
cache = {},
|
1403 |
+
reverseCache = {},
|
1404 |
+
reUnescape = /\\/g;
|
1405 |
+
|
1406 |
+
var parse = function(expression, isReversed){
|
1407 |
+
if (expression == null) return null;
|
1408 |
+
if (expression.Slick === true) return expression;
|
1409 |
+
expression = ('' + expression).replace(/^\s+|\s+$/g, '');
|
1410 |
+
reversed = !!isReversed;
|
1411 |
+
var currentCache = (reversed) ? reverseCache : cache;
|
1412 |
+
if (currentCache[expression]) return currentCache[expression];
|
1413 |
+
parsed = {
|
1414 |
+
Slick: true,
|
1415 |
+
expressions: [],
|
1416 |
+
raw: expression,
|
1417 |
+
reverse: function(){
|
1418 |
+
return parse(this.raw, true);
|
1419 |
+
}
|
1420 |
+
};
|
1421 |
+
separatorIndex = -1;
|
1422 |
+
while (expression != (expression = expression.replace(regexp, parser)));
|
1423 |
+
parsed.length = parsed.expressions.length;
|
1424 |
+
return currentCache[parsed.raw] = (reversed) ? reverse(parsed) : parsed;
|
1425 |
+
};
|
1426 |
+
|
1427 |
+
var reverseCombinator = function(combinator){
|
1428 |
+
if (combinator === '!') return ' ';
|
1429 |
+
else if (combinator === ' ') return '!';
|
1430 |
+
else if ((/^!/).test(combinator)) return combinator.replace(/^!/, '');
|
1431 |
+
else return '!' + combinator;
|
1432 |
+
};
|
1433 |
+
|
1434 |
+
var reverse = function(expression){
|
1435 |
+
var expressions = expression.expressions;
|
1436 |
+
for (var i = 0; i < expressions.length; i++){
|
1437 |
+
var exp = expressions[i];
|
1438 |
+
var last = {parts: [], tag: '*', combinator: reverseCombinator(exp[0].combinator)};
|
1439 |
+
|
1440 |
+
for (var j = 0; j < exp.length; j++){
|
1441 |
+
var cexp = exp[j];
|
1442 |
+
if (!cexp.reverseCombinator) cexp.reverseCombinator = ' ';
|
1443 |
+
cexp.combinator = cexp.reverseCombinator;
|
1444 |
+
delete cexp.reverseCombinator;
|
1445 |
+
}
|
1446 |
+
|
1447 |
+
exp.reverse().push(last);
|
1448 |
+
}
|
1449 |
+
return expression;
|
1450 |
+
};
|
1451 |
+
|
1452 |
+
var escapeRegExp = function(string){// Credit: XRegExp 0.6.1 (c) 2007-2008 Steven Levithan <http://stevenlevithan.com/regex/xregexp/> MIT License
|
1453 |
+
return string.replace(/[-[\]{}()*+?.\\^$|,#\s]/g, function(match){
|
1454 |
+
return '\\' + match;
|
1455 |
+
});
|
1456 |
+
};
|
1457 |
+
|
1458 |
+
var regexp = new RegExp(
|
1459 |
+
/*
|
1460 |
+
#!/usr/bin/env ruby
|
1461 |
+
puts "\t\t" + DATA.read.gsub(/\(\?x\)|\s+#.*$|\s+|\\$|\\n/,'')
|
1462 |
+
__END__
|
1463 |
+
"(?x)^(?:\
|
1464 |
+
\\s* ( , ) \\s* # Separator \n\
|
1465 |
+
| \\s* ( <combinator>+ ) \\s* # Combinator \n\
|
1466 |
+
| ( \\s+ ) # CombinatorChildren \n\
|
1467 |
+
| ( <unicode>+ | \\* ) # Tag \n\
|
1468 |
+
| \\# ( <unicode>+ ) # ID \n\
|
1469 |
+
| \\. ( <unicode>+ ) # ClassName \n\
|
1470 |
+
| # Attribute \n\
|
1471 |
+
\\[ \
|
1472 |
+
\\s* (<unicode1>+) (?: \
|
1473 |
+
\\s* ([*^$!~|]?=) (?: \
|
1474 |
+
\\s* (?:\
|
1475 |
+
([\"']?)(.*?)\\9 \
|
1476 |
+
)\
|
1477 |
+
) \
|
1478 |
+
)? \\s* \
|
1479 |
+
\\](?!\\]) \n\
|
1480 |
+
| :+ ( <unicode>+ )(?:\
|
1481 |
+
\\( (?:\
|
1482 |
+
(?:([\"'])([^\\12]*)\\12)|((?:\\([^)]+\\)|[^()]*)+)\
|
1483 |
+
) \\)\
|
1484 |
+
)?\
|
1485 |
+
)"
|
1486 |
+
*/
|
1487 |
+
"^(?:\\s*(,)\\s*|\\s*(<combinator>+)\\s*|(\\s+)|(<unicode>+|\\*)|\\#(<unicode>+)|\\.(<unicode>+)|\\[\\s*(<unicode1>+)(?:\\s*([*^$!~|]?=)(?:\\s*(?:([\"']?)(.*?)\\9)))?\\s*\\](?!\\])|(:+)(<unicode>+)(?:\\((?:(?:([\"'])([^\\13]*)\\13)|((?:\\([^)]+\\)|[^()]*)+))\\))?)"
|
1488 |
+
.replace(/<combinator>/, '[' + escapeRegExp(">+~`!@$%^&={}\\;</") + ']')
|
1489 |
+
.replace(/<unicode>/g, '(?:[\\w\\u00a1-\\uFFFF-]|\\\\[^\\s0-9a-f])')
|
1490 |
+
.replace(/<unicode1>/g, '(?:[:\\w\\u00a1-\\uFFFF-]|\\\\[^\\s0-9a-f])')
|
1491 |
+
);
|
1492 |
+
|
1493 |
+
function parser(
|
1494 |
+
rawMatch,
|
1495 |
+
|
1496 |
+
separator,
|
1497 |
+
combinator,
|
1498 |
+
combinatorChildren,
|
1499 |
+
|
1500 |
+
tagName,
|
1501 |
+
id,
|
1502 |
+
className,
|
1503 |
+
|
1504 |
+
attributeKey,
|
1505 |
+
attributeOperator,
|
1506 |
+
attributeQuote,
|
1507 |
+
attributeValue,
|
1508 |
+
|
1509 |
+
pseudoMarker,
|
1510 |
+
pseudoClass,
|
1511 |
+
pseudoQuote,
|
1512 |
+
pseudoClassQuotedValue,
|
1513 |
+
pseudoClassValue
|
1514 |
+
){
|
1515 |
+
if (separator || separatorIndex === -1){
|
1516 |
+
parsed.expressions[++separatorIndex] = [];
|
1517 |
+
combinatorIndex = -1;
|
1518 |
+
if (separator) return '';
|
1519 |
+
}
|
1520 |
+
|
1521 |
+
if (combinator || combinatorChildren || combinatorIndex === -1){
|
1522 |
+
combinator = combinator || ' ';
|
1523 |
+
var currentSeparator = parsed.expressions[separatorIndex];
|
1524 |
+
if (reversed && currentSeparator[combinatorIndex])
|
1525 |
+
currentSeparator[combinatorIndex].reverseCombinator = reverseCombinator(combinator);
|
1526 |
+
currentSeparator[++combinatorIndex] = {combinator: combinator, tag: '*'};
|
1527 |
+
}
|
1528 |
+
|
1529 |
+
var currentParsed = parsed.expressions[separatorIndex][combinatorIndex];
|
1530 |
+
|
1531 |
+
if (tagName){
|
1532 |
+
currentParsed.tag = tagName.replace(reUnescape, '');
|
1533 |
+
|
1534 |
+
} else if (id){
|
1535 |
+
currentParsed.id = id.replace(reUnescape, '');
|
1536 |
+
|
1537 |
+
} else if (className){
|
1538 |
+
className = className.replace(reUnescape, '');
|
1539 |
+
|
1540 |
+
if (!currentParsed.classList) currentParsed.classList = [];
|
1541 |
+
if (!currentParsed.classes) currentParsed.classes = [];
|
1542 |
+
currentParsed.classList.push(className);
|
1543 |
+
currentParsed.classes.push({
|
1544 |
+
value: className,
|
1545 |
+
regexp: new RegExp('(^|\\s)' + escapeRegExp(className) + '(\\s|$)')
|
1546 |
+
});
|
1547 |
+
|
1548 |
+
} else if (pseudoClass){
|
1549 |
+
pseudoClassValue = pseudoClassValue || pseudoClassQuotedValue;
|
1550 |
+
pseudoClassValue = pseudoClassValue ? pseudoClassValue.replace(reUnescape, '') : null;
|
1551 |
+
|
1552 |
+
if (!currentParsed.pseudos) currentParsed.pseudos = [];
|
1553 |
+
currentParsed.pseudos.push({
|
1554 |
+
key: pseudoClass.replace(reUnescape, ''),
|
1555 |
+
value: pseudoClassValue,
|
1556 |
+
type: pseudoMarker.length == 1 ? 'class' : 'element'
|
1557 |
+
});
|
1558 |
+
|
1559 |
+
} else if (attributeKey){
|
1560 |
+
attributeKey = attributeKey.replace(reUnescape, '');
|
1561 |
+
attributeValue = (attributeValue || '').replace(reUnescape, '');
|
1562 |
+
|
1563 |
+
var test, regexp;
|
1564 |
+
|
1565 |
+
switch (attributeOperator){
|
1566 |
+
case '^=' : regexp = new RegExp( '^'+ escapeRegExp(attributeValue) ); break;
|
1567 |
+
case '$=' : regexp = new RegExp( escapeRegExp(attributeValue) +'$' ); break;
|
1568 |
+
case '~=' : regexp = new RegExp( '(^|\\s)'+ escapeRegExp(attributeValue) +'(\\s|$)' ); break;
|
1569 |
+
case '|=' : regexp = new RegExp( '^'+ escapeRegExp(attributeValue) +'(-|$)' ); break;
|
1570 |
+
case '=' : test = function(value){
|
1571 |
+
return attributeValue == value;
|
1572 |
+
}; break;
|
1573 |
+
case '*=' : test = function(value){
|
1574 |
+
return value && value.indexOf(attributeValue) > -1;
|
1575 |
+
}; break;
|
1576 |
+
case '!=' : test = function(value){
|
1577 |
+
return attributeValue != value;
|
1578 |
+
}; break;
|
1579 |
+
default : test = function(value){
|
1580 |
+
return !!value;
|
1581 |
+
};
|
1582 |
+
}
|
1583 |
+
|
1584 |
+
if (attributeValue == '' && (/^[*$^]=$/).test(attributeOperator)) test = function(){
|
1585 |
+
return false;
|
1586 |
+
};
|
1587 |
+
|
1588 |
+
if (!test) test = function(value){
|
1589 |
+
return value && regexp.test(value);
|
1590 |
+
};
|
1591 |
+
|
1592 |
+
if (!currentParsed.attributes) currentParsed.attributes = [];
|
1593 |
+
currentParsed.attributes.push({
|
1594 |
+
key: attributeKey,
|
1595 |
+
operator: attributeOperator,
|
1596 |
+
value: attributeValue,
|
1597 |
+
test: test
|
1598 |
+
});
|
1599 |
+
|
1600 |
+
}
|
1601 |
+
|
1602 |
+
return '';
|
1603 |
+
};
|
1604 |
+
|
1605 |
+
// Slick NS
|
1606 |
+
|
1607 |
+
var Slick = (this.Slick || {});
|
1608 |
+
|
1609 |
+
Slick.parse = function(expression){
|
1610 |
+
return parse(expression);
|
1611 |
+
};
|
1612 |
+
|
1613 |
+
Slick.escapeRegExp = escapeRegExp;
|
1614 |
+
|
1615 |
+
if (!this.Slick) this.Slick = Slick;
|
1616 |
+
|
1617 |
+
}).apply(/*<CommonJS>*/(typeof exports != 'undefined') ? exports : /*</CommonJS>*/this);
|
1618 |
+
|
1619 |
+
/*
|
1620 |
+
---
|
1621 |
+
name: Slick.Finder
|
1622 |
+
description: The new, superfast css selector engine.
|
1623 |
+
provides: Slick.Finder
|
1624 |
+
requires: Slick.Parser
|
1625 |
+
...
|
1626 |
+
*/
|
1627 |
+
|
1628 |
+
;(function(){
|
1629 |
+
|
1630 |
+
var local = {},
|
1631 |
+
featuresCache = {},
|
1632 |
+
toString = Object.prototype.toString;
|
1633 |
+
|
1634 |
+
// Feature / Bug detection
|
1635 |
+
|
1636 |
+
local.isNativeCode = function(fn){
|
1637 |
+
return (/\{\s*\[native code\]\s*\}/).test('' + fn);
|
1638 |
+
};
|
1639 |
+
|
1640 |
+
local.isXML = function(document){
|
1641 |
+
return (!!document.xmlVersion) || (!!document.xml) || (toString.call(document) == '[object XMLDocument]') ||
|
1642 |
+
(document.nodeType == 9 && document.documentElement.nodeName != 'HTML');
|
1643 |
+
};
|
1644 |
+
|
1645 |
+
local.setDocument = function(document){
|
1646 |
+
|
1647 |
+
// convert elements / window arguments to document. if document cannot be extrapolated, the function returns.
|
1648 |
+
var nodeType = document.nodeType;
|
1649 |
+
if (nodeType == 9); // document
|
1650 |
+
else if (nodeType) document = document.ownerDocument; // node
|
1651 |
+
else if (document.navigator) document = document.document; // window
|
1652 |
+
else return;
|
1653 |
+
|
1654 |
+
// check if it's the old document
|
1655 |
+
|
1656 |
+
if (this.document === document) return;
|
1657 |
+
this.document = document;
|
1658 |
+
|
1659 |
+
// check if we have done feature detection on this document before
|
1660 |
+
|
1661 |
+
var root = document.documentElement,
|
1662 |
+
rootUid = this.getUIDXML(root),
|
1663 |
+
features = featuresCache[rootUid],
|
1664 |
+
feature;
|
1665 |
+
|
1666 |
+
if (features){
|
1667 |
+
for (feature in features){
|
1668 |
+
this[feature] = features[feature];
|
1669 |
+
}
|
1670 |
+
return;
|
1671 |
+
}
|
1672 |
+
|
1673 |
+
features = featuresCache[rootUid] = {};
|
1674 |
+
|
1675 |
+
features.root = root;
|
1676 |
+
features.isXMLDocument = this.isXML(document);
|
1677 |
+
|
1678 |
+
features.brokenStarGEBTN
|
1679 |
+
= features.starSelectsClosedQSA
|
1680 |
+
= features.idGetsName
|
1681 |
+
= features.brokenMixedCaseQSA
|
1682 |
+
= features.brokenGEBCN
|
1683 |
+
= features.brokenCheckedQSA
|
1684 |
+
= features.brokenEmptyAttributeQSA
|
1685 |
+
= features.isHTMLDocument
|
1686 |
+
= features.nativeMatchesSelector
|
1687 |
+
= false;
|
1688 |
+
|
1689 |
+
var starSelectsClosed, starSelectsComments,
|
1690 |
+
brokenSecondClassNameGEBCN, cachedGetElementsByClassName,
|
1691 |
+
brokenFormAttributeGetter;
|
1692 |
+
|
1693 |
+
var selected, id = 'slick_uniqueid';
|
1694 |
+
var testNode = document.createElement('div');
|
1695 |
+
|
1696 |
+
var testRoot = document.body || document.getElementsByTagName('body')[0] || root;
|
1697 |
+
testRoot.appendChild(testNode);
|
1698 |
+
|
1699 |
+
// on non-HTML documents innerHTML and getElementsById doesnt work properly
|
1700 |
+
try {
|
1701 |
+
testNode.innerHTML = '<a id="'+id+'"></a>';
|
1702 |
+
features.isHTMLDocument = !!document.getElementById(id);
|
1703 |
+
} catch(e){}
|
1704 |
+
|
1705 |
+
if (features.isHTMLDocument){
|
1706 |
+
|
1707 |
+
testNode.style.display = 'none';
|
1708 |
+
|
1709 |
+
// IE returns comment nodes for getElementsByTagName('*') for some documents
|
1710 |
+
testNode.appendChild(document.createComment(''));
|
1711 |
+
starSelectsComments = (testNode.getElementsByTagName('*').length > 1);
|
1712 |
+
|
1713 |
+
// IE returns closed nodes (EG:"</foo>") for getElementsByTagName('*') for some documents
|
1714 |
+
try {
|
1715 |
+
testNode.innerHTML = 'foo</foo>';
|
1716 |
+
selected = testNode.getElementsByTagName('*');
|
1717 |
+
starSelectsClosed = (selected && !!selected.length && selected[0].nodeName.charAt(0) == '/');
|
1718 |
+
} catch(e){};
|
1719 |
+
|
1720 |
+
features.brokenStarGEBTN = starSelectsComments || starSelectsClosed;
|
1721 |
+
|
1722 |
+
// IE returns elements with the name instead of just id for getElementsById for some documents
|
1723 |
+
try {
|
1724 |
+
testNode.innerHTML = '<a name="'+ id +'"></a><b id="'+ id +'"></b>';
|
1725 |
+
features.idGetsName = document.getElementById(id) === testNode.firstChild;
|
1726 |
+
} catch(e){}
|
1727 |
+
|
1728 |
+
if (testNode.getElementsByClassName){
|
1729 |
+
|
1730 |
+
// Safari 3.2 getElementsByClassName caches results
|
1731 |
+
try {
|
1732 |
+
testNode.innerHTML = '<a class="f"></a><a class="b"></a>';
|
1733 |
+
testNode.getElementsByClassName('b').length;
|
1734 |
+
testNode.firstChild.className = 'b';
|
1735 |
+
cachedGetElementsByClassName = (testNode.getElementsByClassName('b').length != 2);
|
1736 |
+
} catch(e){};
|
1737 |
+
|
1738 |
+
// Opera 9.6 getElementsByClassName doesnt detects the class if its not the first one
|
1739 |
+
try {
|
1740 |
+
testNode.innerHTML = '<a class="a"></a><a class="f b a"></a>';
|
1741 |
+
brokenSecondClassNameGEBCN = (testNode.getElementsByClassName('a').length != 2);
|
1742 |
+
} catch(e){}
|
1743 |
+
|
1744 |
+
features.brokenGEBCN = cachedGetElementsByClassName || brokenSecondClassNameGEBCN;
|
1745 |
+
}
|
1746 |
+
|
1747 |
+
if (testNode.querySelectorAll){
|
1748 |
+
// IE 8 returns closed nodes (EG:"</foo>") for querySelectorAll('*') for some documents
|
1749 |
+
try {
|
1750 |
+
testNode.innerHTML = 'foo</foo>';
|
1751 |
+
selected = testNode.querySelectorAll('*');
|
1752 |
+
features.starSelectsClosedQSA = (selected && !!selected.length && selected[0].nodeName.charAt(0) == '/');
|
1753 |
+
} catch(e){}
|
1754 |
+
|
1755 |
+
// Safari 3.2 querySelectorAll doesnt work with mixedcase on quirksmode
|
1756 |
+
try {
|
1757 |
+
testNode.innerHTML = '<a class="MiX"></a>';
|
1758 |
+
features.brokenMixedCaseQSA = !testNode.querySelectorAll('.MiX').length;
|
1759 |
+
} catch(e){}
|
1760 |
+
|
1761 |
+
// Webkit and Opera dont return selected options on querySelectorAll
|
1762 |
+
try {
|
1763 |
+
testNode.innerHTML = '<select><option selected="selected">a</option></select>';
|
1764 |
+
features.brokenCheckedQSA = (testNode.querySelectorAll(':checked').length == 0);
|
1765 |
+
} catch(e){};
|
1766 |
+
|
1767 |
+
// IE returns incorrect results for attr[*^$]="" selectors on querySelectorAll
|
1768 |
+
try {
|
1769 |
+
testNode.innerHTML = '<a class=""></a>';
|
1770 |
+
features.brokenEmptyAttributeQSA = (testNode.querySelectorAll('[class*=""]').length != 0);
|
1771 |
+
} catch(e){}
|
1772 |
+
|
1773 |
+
}
|
1774 |
+
|
1775 |
+
// IE6-7, if a form has an input of id x, form.getAttribute(x) returns a reference to the input
|
1776 |
+
try {
|
1777 |
+
testNode.innerHTML = '<form action="s"><input id="action"/></form>';
|
1778 |
+
brokenFormAttributeGetter = (testNode.firstChild.getAttribute('action') != 's');
|
1779 |
+
} catch(e){}
|
1780 |
+
|
1781 |
+
// native matchesSelector function
|
1782 |
+
|
1783 |
+
features.nativeMatchesSelector = root.matches || /*root.msMatchesSelector ||*/ root.mozMatchesSelector || root.webkitMatchesSelector;
|
1784 |
+
if (features.nativeMatchesSelector) try {
|
1785 |
+
// if matchesSelector trows errors on incorrect sintaxes we can use it
|
1786 |
+
features.nativeMatchesSelector.call(root, ':slick');
|
1787 |
+
features.nativeMatchesSelector = null;
|
1788 |
+
} catch(e){}
|
1789 |
+
|
1790 |
+
}
|
1791 |
+
|
1792 |
+
try {
|
1793 |
+
root.slick_expando = 1;
|
1794 |
+
delete root.slick_expando;
|
1795 |
+
features.getUID = this.getUIDHTML;
|
1796 |
+
} catch(e){
|
1797 |
+
features.getUID = this.getUIDXML;
|
1798 |
+
}
|
1799 |
+
|
1800 |
+
testRoot.removeChild(testNode);
|
1801 |
+
testNode = selected = testRoot = null;
|
1802 |
+
|
1803 |
+
// getAttribute
|
1804 |
+
|
1805 |
+
features.getAttribute = (features.isHTMLDocument && brokenFormAttributeGetter) ? function(node, name){
|
1806 |
+
var method = this.attributeGetters[name];
|
1807 |
+
if (method) return method.call(node);
|
1808 |
+
var attributeNode = node.getAttributeNode(name);
|
1809 |
+
return (attributeNode) ? attributeNode.nodeValue : null;
|
1810 |
+
} : function(node, name){
|
1811 |
+
var method = this.attributeGetters[name];
|
1812 |
+
return (method) ? method.call(node) : node.getAttribute(name);
|
1813 |
+
};
|
1814 |
+
|
1815 |
+
// hasAttribute
|
1816 |
+
|
1817 |
+
features.hasAttribute = (root && this.isNativeCode(root.hasAttribute)) ? function(node, attribute){
|
1818 |
+
return node.hasAttribute(attribute);
|
1819 |
+
} : function(node, attribute){
|
1820 |
+
node = node.getAttributeNode(attribute);
|
1821 |
+
return !!(node && (node.specified || node.nodeValue));
|
1822 |
+
};
|
1823 |
+
|
1824 |
+
// contains
|
1825 |
+
// FIXME: Add specs: local.contains should be different for xml and html documents?
|
1826 |
+
var nativeRootContains = root && this.isNativeCode(root.contains),
|
1827 |
+
nativeDocumentContains = document && this.isNativeCode(document.contains);
|
1828 |
+
|
1829 |
+
features.contains = (nativeRootContains && nativeDocumentContains) ? function(context, node){
|
1830 |
+
return context.contains(node);
|
1831 |
+
} : (nativeRootContains && !nativeDocumentContains) ? function(context, node){
|
1832 |
+
// IE8 does not have .contains on document.
|
1833 |
+
return context === node || ((context === document) ? document.documentElement : context).contains(node);
|
1834 |
+
} : (root && root.compareDocumentPosition) ? function(context, node){
|
1835 |
+
return context === node || !!(context.compareDocumentPosition(node) & 16);
|
1836 |
+
} : function(context, node){
|
1837 |
+
if (node) do {
|
1838 |
+
if (node === context) return true;
|
1839 |
+
} while ((node = node.parentNode));
|
1840 |
+
return false;
|
1841 |
+
};
|
1842 |
+
|
1843 |
+
// document order sorting
|
1844 |
+
// credits to Sizzle (http://sizzlejs.com/)
|
1845 |
+
|
1846 |
+
features.documentSorter = (root.compareDocumentPosition) ? function(a, b){
|
1847 |
+
if (!a.compareDocumentPosition || !b.compareDocumentPosition) return 0;
|
1848 |
+
return a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
|
1849 |
+
} : ('sourceIndex' in root) ? function(a, b){
|
1850 |
+
if (!a.sourceIndex || !b.sourceIndex) return 0;
|
1851 |
+
return a.sourceIndex - b.sourceIndex;
|
1852 |
+
} : (document.createRange) ? function(a, b){
|
1853 |
+
if (!a.ownerDocument || !b.ownerDocument) return 0;
|
1854 |
+
var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
|
1855 |
+
aRange.setStart(a, 0);
|
1856 |
+
aRange.setEnd(a, 0);
|
1857 |
+
bRange.setStart(b, 0);
|
1858 |
+
bRange.setEnd(b, 0);
|
1859 |
+
return aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
|
1860 |
+
} : null ;
|
1861 |
+
|
1862 |
+
root = null;
|
1863 |
+
|
1864 |
+
for (feature in features){
|
1865 |
+
this[feature] = features[feature];
|
1866 |
+
}
|
1867 |
+
};
|
1868 |
+
|
1869 |
+
// Main Method
|
1870 |
+
|
1871 |
+
var reSimpleSelector = /^([#.]?)((?:[\w-]+|\*))$/,
|
1872 |
+
reEmptyAttribute = /\[.+[*$^]=(?:""|'')?\]/,
|
1873 |
+
qsaFailExpCache = {};
|
1874 |
+
|
1875 |
+
local.search = function(context, expression, append, first){
|
1876 |
+
|
1877 |
+
var found = this.found = (first) ? null : (append || []);
|
1878 |
+
|
1879 |
+
if (!context) return found;
|
1880 |
+
else if (context.navigator) context = context.document; // Convert the node from a window to a document
|
1881 |
+
else if (!context.nodeType) return found;
|
1882 |
+
|
1883 |
+
// setup
|
1884 |
+
|
1885 |
+
var parsed, i,
|
1886 |
+
uniques = this.uniques = {},
|
1887 |
+
hasOthers = !!(append && append.length),
|
1888 |
+
contextIsDocument = (context.nodeType == 9);
|
1889 |
+
|
1890 |
+
if (this.document !== (contextIsDocument ? context : context.ownerDocument)) this.setDocument(context);
|
1891 |
+
|
1892 |
+
// avoid duplicating items already in the append array
|
1893 |
+
if (hasOthers) for (i = found.length; i--;) uniques[this.getUID(found[i])] = true;
|
1894 |
+
|
1895 |
+
// expression checks
|
1896 |
+
|
1897 |
+
if (typeof expression == 'string'){ // expression is a string
|
1898 |
+
|
1899 |
+
/*<simple-selectors-override>*/
|
1900 |
+
var simpleSelector = expression.match(reSimpleSelector);
|
1901 |
+
simpleSelectors: if (simpleSelector){
|
1902 |
+
|
1903 |
+
var symbol = simpleSelector[1],
|
1904 |
+
name = simpleSelector[2],
|
1905 |
+
node, nodes;
|
1906 |
+
|
1907 |
+
if (!symbol){
|
1908 |
+
|
1909 |
+
if (name == '*' && this.brokenStarGEBTN) break simpleSelectors;
|
1910 |
+
nodes = context.getElementsByTagName(name);
|
1911 |
+
if (first) return nodes[0] || null;
|
1912 |
+
for (i = 0; node = nodes[i++];){
|
1913 |
+
if (!(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1914 |
+
}
|
1915 |
+
|
1916 |
+
} else if (symbol == '#'){
|
1917 |
+
|
1918 |
+
if (!this.isHTMLDocument || !contextIsDocument) break simpleSelectors;
|
1919 |
+
node = context.getElementById(name);
|
1920 |
+
if (!node) return found;
|
1921 |
+
if (this.idGetsName && node.getAttributeNode('id').nodeValue != name) break simpleSelectors;
|
1922 |
+
if (first) return node || null;
|
1923 |
+
if (!(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1924 |
+
|
1925 |
+
} else if (symbol == '.'){
|
1926 |
+
|
1927 |
+
if (!this.isHTMLDocument || ((!context.getElementsByClassName || this.brokenGEBCN) && context.querySelectorAll)) break simpleSelectors;
|
1928 |
+
if (context.getElementsByClassName && !this.brokenGEBCN){
|
1929 |
+
nodes = context.getElementsByClassName(name);
|
1930 |
+
if (first) return nodes[0] || null;
|
1931 |
+
for (i = 0; node = nodes[i++];){
|
1932 |
+
if (!(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1933 |
+
}
|
1934 |
+
} else {
|
1935 |
+
var matchClass = new RegExp('(^|\\s)'+ Slick.escapeRegExp(name) +'(\\s|$)');
|
1936 |
+
nodes = context.getElementsByTagName('*');
|
1937 |
+
for (i = 0; node = nodes[i++];){
|
1938 |
+
className = node.className;
|
1939 |
+
if (!(className && matchClass.test(className))) continue;
|
1940 |
+
if (first) return node;
|
1941 |
+
if (!(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1942 |
+
}
|
1943 |
+
}
|
1944 |
+
|
1945 |
+
}
|
1946 |
+
|
1947 |
+
if (hasOthers) this.sort(found);
|
1948 |
+
return (first) ? null : found;
|
1949 |
+
|
1950 |
+
}
|
1951 |
+
/*</simple-selectors-override>*/
|
1952 |
+
|
1953 |
+
/*<query-selector-override>*/
|
1954 |
+
querySelector: if (context.querySelectorAll){
|
1955 |
+
|
1956 |
+
if (!this.isHTMLDocument
|
1957 |
+
|| qsaFailExpCache[expression]
|
1958 |
+
//TODO: only skip when expression is actually mixed case
|
1959 |
+
|| this.brokenMixedCaseQSA
|
1960 |
+
|| (this.brokenCheckedQSA && expression.indexOf(':checked') > -1)
|
1961 |
+
|| (this.brokenEmptyAttributeQSA && reEmptyAttribute.test(expression))
|
1962 |
+
|| (!contextIsDocument //Abort when !contextIsDocument and...
|
1963 |
+
// there are multiple expressions in the selector
|
1964 |
+
// since we currently only fix non-document rooted QSA for single expression selectors
|
1965 |
+
&& expression.indexOf(',') > -1
|
1966 |
+
)
|
1967 |
+
|| Slick.disableQSA
|
1968 |
+
) break querySelector;
|
1969 |
+
|
1970 |
+
var _expression = expression, _context = context;
|
1971 |
+
if (!contextIsDocument){
|
1972 |
+
// non-document rooted QSA
|
1973 |
+
// credits to Andrew Dupont
|
1974 |
+
var currentId = _context.getAttribute('id'), slickid = 'slickid__';
|
1975 |
+
_context.setAttribute('id', slickid);
|
1976 |
+
_expression = '#' + slickid + ' ' + _expression;
|
1977 |
+
context = _context.parentNode;
|
1978 |
+
}
|
1979 |
+
|
1980 |
+
try {
|
1981 |
+
if (first) return context.querySelector(_expression) || null;
|
1982 |
+
else nodes = context.querySelectorAll(_expression);
|
1983 |
+
} catch(e){
|
1984 |
+
qsaFailExpCache[expression] = 1;
|
1985 |
+
break querySelector;
|
1986 |
+
} finally {
|
1987 |
+
if (!contextIsDocument){
|
1988 |
+
if (currentId) _context.setAttribute('id', currentId);
|
1989 |
+
else _context.removeAttribute('id');
|
1990 |
+
context = _context;
|
1991 |
+
}
|
1992 |
+
}
|
1993 |
+
|
1994 |
+
if (this.starSelectsClosedQSA) for (i = 0; node = nodes[i++];){
|
1995 |
+
if (node.nodeName > '@' && !(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1996 |
+
} else for (i = 0; node = nodes[i++];){
|
1997 |
+
if (!(hasOthers && uniques[this.getUID(node)])) found.push(node);
|
1998 |
+
}
|
1999 |
+
|
2000 |
+
if (hasOthers) this.sort(found);
|
2001 |
+
return found;
|
2002 |
+
|
2003 |
+
}
|
2004 |
+
/*</query-selector-override>*/
|
2005 |
+
|
2006 |
+
parsed = this.Slick.parse(expression);
|
2007 |
+
if (!parsed.length) return found;
|
2008 |
+
} else if (expression == null){ // there is no expression
|
2009 |
+
return found;
|
2010 |
+
} else if (expression.Slick){ // expression is a parsed Slick object
|
2011 |
+
parsed = expression;
|
2012 |
+
} else if (this.contains(context.documentElement || context, expression)){ // expression is a node
|
2013 |
+
(found) ? found.push(expression) : found = expression;
|
2014 |
+
return found;
|
2015 |
+
} else { // other junk
|
2016 |
+
return found;
|
2017 |
+
}
|
2018 |
+
|
2019 |
+
/*<pseudo-selectors>*//*<nth-pseudo-selectors>*/
|
2020 |
+
|
2021 |
+
// cache elements for the nth selectors
|
2022 |
+
|
2023 |
+
this.posNTH = {};
|
2024 |
+
this.posNTHLast = {};
|
2025 |
+
this.posNTHType = {};
|
2026 |
+
this.posNTHTypeLast = {};
|
2027 |
+
|
2028 |
+
/*</nth-pseudo-selectors>*//*</pseudo-selectors>*/
|
2029 |
+
|
2030 |
+
// if append is null and there is only a single selector with one expression use pushArray, else use pushUID
|
2031 |
+
this.push = (!hasOthers && (first || (parsed.length == 1 && parsed.expressions[0].length == 1))) ? this.pushArray : this.pushUID;
|
2032 |
+
|
2033 |
+
if (found == null) found = [];
|
2034 |
+
|
2035 |
+
// default engine
|
2036 |
+
|
2037 |
+
var j, m, n;
|
2038 |
+
var combinator, tag, id, classList, classes, attributes, pseudos;
|
2039 |
+
var currentItems, currentExpression, currentBit, lastBit, expressions = parsed.expressions;
|
2040 |
+
|
2041 |
+
search: for (i = 0; (currentExpression = expressions[i]); i++) for (j = 0; (currentBit = currentExpression[j]); j++){
|
2042 |
+
|
2043 |
+
combinator = 'combinator:' + currentBit.combinator;
|
2044 |
+
if (!this[combinator]) continue search;
|
2045 |
+
|
2046 |
+
tag = (this.isXMLDocument) ? currentBit.tag : currentBit.tag.toUpperCase();
|
2047 |
+
id = currentBit.id;
|
2048 |
+
classList = currentBit.classList;
|
2049 |
+
classes = currentBit.classes;
|
2050 |
+
attributes = currentBit.attributes;
|
2051 |
+
pseudos = currentBit.pseudos;
|
2052 |
+
lastBit = (j === (currentExpression.length - 1));
|
2053 |
+
|
2054 |
+
this.bitUniques = {};
|
2055 |
+
|
2056 |
+
if (lastBit){
|
2057 |
+
this.uniques = uniques;
|
2058 |
+
this.found = found;
|
2059 |
+
} else {
|
2060 |
+
this.uniques = {};
|
2061 |
+
this.found = [];
|
2062 |
+
}
|
2063 |
+
|
2064 |
+
if (j === 0){
|
2065 |
+
this[combinator](context, tag, id, classes, attributes, pseudos, classList);
|
2066 |
+
if (first && lastBit && found.length) break search;
|
2067 |
+
} else {
|
2068 |
+
if (first && lastBit) for (m = 0, n = currentItems.length; m < n; m++){
|
2069 |
+
this[combinator](currentItems[m], tag, id, classes, attributes, pseudos, classList);
|
2070 |
+
if (found.length) break search;
|
2071 |
+
} else for (m = 0, n = currentItems.length; m < n; m++) this[combinator](currentItems[m], tag, id, classes, attributes, pseudos, classList);
|
2072 |
+
}
|
2073 |
+
|
2074 |
+
currentItems = this.found;
|
2075 |
+
}
|
2076 |
+
|
2077 |
+
// should sort if there are nodes in append and if you pass multiple expressions.
|
2078 |
+
if (hasOthers || (parsed.expressions.length > 1)) this.sort(found);
|
2079 |
+
|
2080 |
+
return (first) ? (found[0] || null) : found;
|
2081 |
+
};
|
2082 |
+
|
2083 |
+
// Utils
|
2084 |
+
|
2085 |
+
local.uidx = 1;
|
2086 |
+
local.uidk = 'slick-uniqueid';
|
2087 |
+
|
2088 |
+
local.getUIDXML = function(node){
|
2089 |
+
var uid = node.getAttribute(this.uidk);
|
2090 |
+
if (!uid){
|
2091 |
+
uid = this.uidx++;
|
2092 |
+
node.setAttribute(this.uidk, uid);
|
2093 |
+
}
|
2094 |
+
return uid;
|
2095 |
+
};
|
2096 |
+
|
2097 |
+
local.getUIDHTML = function(node){
|
2098 |
+
return node.uniqueNumber || (node.uniqueNumber = this.uidx++);
|
2099 |
+
};
|
2100 |
+
|
2101 |
+
// sort based on the setDocument documentSorter method.
|
2102 |
+
|
2103 |
+
local.sort = function(results){
|
2104 |
+
if (!this.documentSorter) return results;
|
2105 |
+
results.sort(this.documentSorter);
|
2106 |
+
return results;
|
2107 |
+
};
|
2108 |
+
|
2109 |
+
/*<pseudo-selectors>*//*<nth-pseudo-selectors>*/
|
2110 |
+
|
2111 |
+
local.cacheNTH = {};
|
2112 |
+
|
2113 |
+
local.matchNTH = /^([+-]?\d*)?([a-z]+)?([+-]\d+)?$/;
|
2114 |
+
|
2115 |
+
local.parseNTHArgument = function(argument){
|
2116 |
+
var parsed = argument.match(this.matchNTH);
|
2117 |
+
if (!parsed) return false;
|
2118 |
+
var special = parsed[2] || false;
|
2119 |
+
var a = parsed[1] || 1;
|
2120 |
+
if (a == '-') a = -1;
|
2121 |
+
var b = +parsed[3] || 0;
|
2122 |
+
parsed =
|
2123 |
+
(special == 'n') ? {a: a, b: b} :
|
2124 |
+
(special == 'odd') ? {a: 2, b: 1} :
|
2125 |
+
(special == 'even') ? {a: 2, b: 0} : {a: 0, b: a};
|
2126 |
+
|
2127 |
+
return (this.cacheNTH[argument] = parsed);
|
2128 |
+
};
|
2129 |
+
|
2130 |
+
local.createNTHPseudo = function(child, sibling, positions, ofType){
|
2131 |
+
return function(node, argument){
|
2132 |
+
var uid = this.getUID(node);
|
2133 |
+
if (!this[positions][uid]){
|
2134 |
+
var parent = node.parentNode;
|
2135 |
+
if (!parent) return false;
|
2136 |
+
var el = parent[child], count = 1;
|
2137 |
+
if (ofType){
|
2138 |
+
var nodeName = node.nodeName;
|
2139 |
+
do {
|
2140 |
+
if (el.nodeName != nodeName) continue;
|
2141 |
+
this[positions][this.getUID(el)] = count++;
|
2142 |
+
} while ((el = el[sibling]));
|
2143 |
+
} else {
|
2144 |
+
do {
|
2145 |
+
if (el.nodeType != 1) continue;
|
2146 |
+
this[positions][this.getUID(el)] = count++;
|
2147 |
+
} while ((el = el[sibling]));
|
2148 |
+
}
|
2149 |
+
}
|
2150 |
+
argument = argument || 'n';
|
2151 |
+
var parsed = this.cacheNTH[argument] || this.parseNTHArgument(argument);
|
2152 |
+
if (!parsed) return false;
|
2153 |
+
var a = parsed.a, b = parsed.b, pos = this[positions][uid];
|
2154 |
+
if (a == 0) return b == pos;
|
2155 |
+
if (a > 0){
|
2156 |
+
if (pos < b) return false;
|
2157 |
+
} else {
|
2158 |
+
if (b < pos) return false;
|
2159 |
+
}
|
2160 |
+
return ((pos - b) % a) == 0;
|
2161 |
+
};
|
2162 |
+
};
|
2163 |
+
|
2164 |
+
/*</nth-pseudo-selectors>*//*</pseudo-selectors>*/
|
2165 |
+
|
2166 |
+
local.pushArray = function(node, tag, id, classes, attributes, pseudos){
|
2167 |
+
if (this.matchSelector(node, tag, id, classes, attributes, pseudos)) this.found.push(node);
|
2168 |
+
};
|
2169 |
+
|
2170 |
+
local.pushUID = function(node, tag, id, classes, attributes, pseudos){
|
2171 |
+
var uid = this.getUID(node);
|
2172 |
+
if (!this.uniques[uid] && this.matchSelector(node, tag, id, classes, attributes, pseudos)){
|
2173 |
+
this.uniques[uid] = true;
|
2174 |
+
this.found.push(node);
|
2175 |
+
}
|
2176 |
+
};
|
2177 |
+
|
2178 |
+
local.matchNode = function(node, selector){
|
2179 |
+
if (this.isHTMLDocument && this.nativeMatchesSelector){
|
2180 |
+
try {
|
2181 |
+
return this.nativeMatchesSelector.call(node, selector.replace(/\[([^=]+)=\s*([^'"\]]+?)\s*\]/g, '[$1="$2"]'));
|
2182 |
+
} catch(matchError){}
|
2183 |
+
}
|
2184 |
+
|
2185 |
+
var parsed = this.Slick.parse(selector);
|
2186 |
+
if (!parsed) return true;
|
2187 |
+
|
2188 |
+
// simple (single) selectors
|
2189 |
+
var expressions = parsed.expressions, simpleExpCounter = 0, i, currentExpression;
|
2190 |
+
for (i = 0; (currentExpression = expressions[i]); i++){
|
2191 |
+
if (currentExpression.length == 1){
|
2192 |
+
var exp = currentExpression[0];
|
2193 |
+
if (this.matchSelector(node, (this.isXMLDocument) ? exp.tag : exp.tag.toUpperCase(), exp.id, exp.classes, exp.attributes, exp.pseudos)) return true;
|
2194 |
+
simpleExpCounter++;
|
2195 |
+
}
|
2196 |
+
}
|
2197 |
+
|
2198 |
+
if (simpleExpCounter == parsed.length) return false;
|
2199 |
+
|
2200 |
+
var nodes = this.search(this.document, parsed), item;
|
2201 |
+
for (i = 0; item = nodes[i++];){
|
2202 |
+
if (item === node) return true;
|
2203 |
+
}
|
2204 |
+
return false;
|
2205 |
+
};
|
2206 |
+
|
2207 |
+
local.matchPseudo = function(node, name, argument){
|
2208 |
+
var pseudoName = 'pseudo:' + name;
|
2209 |
+
if (this[pseudoName]) return this[pseudoName](node, argument);
|
2210 |
+
var attribute = this.getAttribute(node, name);
|
2211 |
+
return (argument) ? argument == attribute : !!attribute;
|
2212 |
+
};
|
2213 |
+
|
2214 |
+
local.matchSelector = function(node, tag, id, classes, attributes, pseudos){
|
2215 |
+
if (tag){
|
2216 |
+
var nodeName = (this.isXMLDocument) ? node.nodeName : node.nodeName.toUpperCase();
|
2217 |
+
if (tag == '*'){
|
2218 |
+
if (nodeName < '@') return false; // Fix for comment nodes and closed nodes
|
2219 |
+
} else {
|
2220 |
+
if (nodeName != tag) return false;
|
2221 |
+
}
|
2222 |
+
}
|
2223 |
+
|
2224 |
+
if (id && node.getAttribute('id') != id) return false;
|
2225 |
+
|
2226 |
+
var i, part, cls;
|
2227 |
+
if (classes) for (i = classes.length; i--;){
|
2228 |
+
cls = this.getAttribute(node, 'class');
|
2229 |
+
if (!(cls && classes[i].regexp.test(cls))) return false;
|
2230 |
+
}
|
2231 |
+
if (attributes) for (i = attributes.length; i--;){
|
2232 |
+
part = attributes[i];
|
2233 |
+
if (part.operator ? !part.test(this.getAttribute(node, part.key)) : !this.hasAttribute(node, part.key)) return false;
|
2234 |
+
}
|
2235 |
+
if (pseudos) for (i = pseudos.length; i--;){
|
2236 |
+
part = pseudos[i];
|
2237 |
+
if (!this.matchPseudo(node, part.key, part.value)) return false;
|
2238 |
+
}
|
2239 |
+
return true;
|
2240 |
+
};
|
2241 |
+
|
2242 |
+
var combinators = {
|
2243 |
+
|
2244 |
+
' ': function(node, tag, id, classes, attributes, pseudos, classList){ // all child nodes, any level
|
2245 |
+
|
2246 |
+
var i, item, children;
|
2247 |
+
|
2248 |
+
if (this.isHTMLDocument){
|
2249 |
+
getById: if (id){
|
2250 |
+
item = this.document.getElementById(id);
|
2251 |
+
if ((!item && node.all) || (this.idGetsName && item && item.getAttributeNode('id').nodeValue != id)){
|
2252 |
+
// all[id] returns all the elements with that name or id inside node
|
2253 |
+
// if theres just one it will return the element, else it will be a collection
|
2254 |
+
children = node.all[id];
|
2255 |
+
if (!children) return;
|
2256 |
+
if (!children[0]) children = [children];
|
2257 |
+
for (i = 0; item = children[i++];){
|
2258 |
+
var idNode = item.getAttributeNode('id');
|
2259 |
+
if (idNode && idNode.nodeValue == id){
|
2260 |
+
this.push(item, tag, null, classes, attributes, pseudos);
|
2261 |
+
break;
|
2262 |
+
}
|
2263 |
+
}
|
2264 |
+
return;
|
2265 |
+
}
|
2266 |
+
if (!item){
|
2267 |
+
// if the context is in the dom we return, else we will try GEBTN, breaking the getById label
|
2268 |
+
if (this.contains(this.root, node)) return;
|
2269 |
+
else break getById;
|
2270 |
+
} else if (this.document !== node && !this.contains(node, item)) return;
|
2271 |
+
this.push(item, tag, null, classes, attributes, pseudos);
|
2272 |
+
return;
|
2273 |
+
}
|
2274 |
+
getByClass: if (classes && node.getElementsByClassName && !this.brokenGEBCN){
|
2275 |
+
children = node.getElementsByClassName(classList.join(' '));
|
2276 |
+
if (!(children && children.length)) break getByClass;
|
2277 |
+
for (i = 0; item = children[i++];) this.push(item, tag, id, null, attributes, pseudos);
|
2278 |
+
return;
|
2279 |
+
}
|
2280 |
+
}
|
2281 |
+
getByTag: {
|
2282 |
+
children = node.getElementsByTagName(tag);
|
2283 |
+
if (!(children && children.length)) break getByTag;
|
2284 |
+
if (!this.brokenStarGEBTN) tag = null;
|
2285 |
+
for (i = 0; item = children[i++];) this.push(item, tag, id, classes, attributes, pseudos);
|
2286 |
+
}
|
2287 |
+
},
|
2288 |
+
|
2289 |
+
'>': function(node, tag, id, classes, attributes, pseudos){ // direct children
|
2290 |
+
if ((node = node.firstChild)) do {
|
2291 |
+
if (node.nodeType == 1) this.push(node, tag, id, classes, attributes, pseudos);
|
2292 |
+
} while ((node = node.nextSibling));
|
2293 |
+
},
|
2294 |
+
|
2295 |
+
'+': function(node, tag, id, classes, attributes, pseudos){ // next sibling
|
2296 |
+
while ((node = node.nextSibling)) if (node.nodeType == 1){
|
2297 |
+
this.push(node, tag, id, classes, attributes, pseudos);
|
2298 |
+
break;
|
2299 |
+
}
|
2300 |
+
},
|
2301 |
+
|
2302 |
+
'^': function(node, tag, id, classes, attributes, pseudos){ // first child
|
2303 |
+
node = node.firstChild;
|
2304 |
+
if (node){
|
2305 |
+
if (node.nodeType == 1) this.push(node, tag, id, classes, attributes, pseudos);
|
2306 |
+
else this['combinator:+'](node, tag, id, classes, attributes, pseudos);
|
2307 |
+
}
|
2308 |
+
},
|
2309 |
+
|
2310 |
+
'~': function(node, tag, id, classes, attributes, pseudos){ // next siblings
|
2311 |
+
while ((node = node.nextSibling)){
|
2312 |
+
if (node.nodeType != 1) continue;
|
2313 |
+
var uid = this.getUID(node);
|
2314 |
+
if (this.bitUniques[uid]) break;
|
2315 |
+
this.bitUniques[uid] = true;
|
2316 |
+
this.push(node, tag, id, classes, attributes, pseudos);
|
2317 |
+
}
|
2318 |
+
},
|
2319 |
+
|
2320 |
+
'++': function(node, tag, id, classes, attributes, pseudos){ // next sibling and previous sibling
|
2321 |
+
this['combinator:+'](node, tag, id, classes, attributes, pseudos);
|
2322 |
+
this['combinator:!+'](node, tag, id, classes, attributes, pseudos);
|
2323 |
+
},
|
2324 |
+
|
2325 |
+
'~~': function(node, tag, id, classes, attributes, pseudos){ // next siblings and previous siblings
|
2326 |
+
this['combinator:~'](node, tag, id, classes, attributes, pseudos);
|
2327 |
+
this['combinator:!~'](node, tag, id, classes, attributes, pseudos);
|
2328 |
+
},
|
2329 |
+
|
2330 |
+
'!': function(node, tag, id, classes, attributes, pseudos){ // all parent nodes up to document
|
2331 |
+
while ((node = node.parentNode)) if (node !== this.document) this.push(node, tag, id, classes, attributes, pseudos);
|
2332 |
+
},
|
2333 |
+
|
2334 |
+
'!>': function(node, tag, id, classes, attributes, pseudos){ // direct parent (one level)
|
2335 |
+
node = node.parentNode;
|
2336 |
+
if (node !== this.document) this.push(node, tag, id, classes, attributes, pseudos);
|
2337 |
+
},
|
2338 |
+
|
2339 |
+
'!+': function(node, tag, id, classes, attributes, pseudos){ // previous sibling
|
2340 |
+
while ((node = node.previousSibling)) if (node.nodeType == 1){
|
2341 |
+
this.push(node, tag, id, classes, attributes, pseudos);
|
2342 |
+
break;
|
2343 |
+
}
|
2344 |
+
},
|
2345 |
+
|
2346 |
+
'!^': function(node, tag, id, classes, attributes, pseudos){ // last child
|
2347 |
+
node = node.lastChild;
|
2348 |
+
if (node){
|
2349 |
+
if (node.nodeType == 1) this.push(node, tag, id, classes, attributes, pseudos);
|
2350 |
+
else this['combinator:!+'](node, tag, id, classes, attributes, pseudos);
|
2351 |
+
}
|
2352 |
+
},
|
2353 |
+
|
2354 |
+
'!~': function(node, tag, id, classes, attributes, pseudos){ // previous siblings
|
2355 |
+
while ((node = node.previousSibling)){
|
2356 |
+
if (node.nodeType != 1) continue;
|
2357 |
+
var uid = this.getUID(node);
|
2358 |
+
if (this.bitUniques[uid]) break;
|
2359 |
+
this.bitUniques[uid] = true;
|
2360 |
+
this.push(node, tag, id, classes, attributes, pseudos);
|
2361 |
+
}
|
2362 |
+
}
|
2363 |
+
|
2364 |
+
};
|
2365 |
+
|
2366 |
+
for (var c in combinators) local['combinator:' + c] = combinators[c];
|
2367 |
+
|
2368 |
+
var pseudos = {
|
2369 |
+
|
2370 |
+
/*<pseudo-selectors>*/
|
2371 |
+
|
2372 |
+
'empty': function(node){
|
2373 |
+
var child = node.firstChild;
|
2374 |
+
return !(child && child.nodeType == 1) && !(node.innerText || node.textContent || '').length;
|
2375 |
+
},
|
2376 |
+
|
2377 |
+
'not': function(node, expression){
|
2378 |
+
return !this.matchNode(node, expression);
|
2379 |
+
},
|
2380 |
+
|
2381 |
+
'contains': function(node, text){
|
2382 |
+
return (node.innerText || node.textContent || '').indexOf(text) > -1;
|
2383 |
+
},
|
2384 |
+
|
2385 |
+
'first-child': function(node){
|
2386 |
+
while ((node = node.previousSibling)) if (node.nodeType == 1) return false;
|
2387 |
+
return true;
|
2388 |
+
},
|
2389 |
+
|
2390 |
+
'last-child': function(node){
|
2391 |
+
while ((node = node.nextSibling)) if (node.nodeType == 1) return false;
|
2392 |
+
return true;
|
2393 |
+
},
|
2394 |
+
|
2395 |
+
'only-child': function(node){
|
2396 |
+
var prev = node;
|
2397 |
+
while ((prev = prev.previousSibling)) if (prev.nodeType == 1) return false;
|
2398 |
+
var next = node;
|
2399 |
+
while ((next = next.nextSibling)) if (next.nodeType == 1) return false;
|
2400 |
+
return true;
|
2401 |
+
},
|
2402 |
+
|
2403 |
+
/*<nth-pseudo-selectors>*/
|
2404 |
+
|
2405 |
+
'nth-child': local.createNTHPseudo('firstChild', 'nextSibling', 'posNTH'),
|
2406 |
+
|
2407 |
+
'nth-last-child': local.createNTHPseudo('lastChild', 'previousSibling', 'posNTHLast'),
|
2408 |
+
|
2409 |
+
'nth-of-type': local.createNTHPseudo('firstChild', 'nextSibling', 'posNTHType', true),
|
2410 |
+
|
2411 |
+
'nth-last-of-type': local.createNTHPseudo('lastChild', 'previousSibling', 'posNTHTypeLast', true),
|
2412 |
+
|
2413 |
+
'index': function(node, index){
|
2414 |
+
return this['pseudo:nth-child'](node, '' + (index + 1));
|
2415 |
+
},
|
2416 |
+
|
2417 |
+
'even': function(node){
|
2418 |
+
return this['pseudo:nth-child'](node, '2n');
|
2419 |
+
},
|
2420 |
+
|
2421 |
+
'odd': function(node){
|
2422 |
+
return this['pseudo:nth-child'](node, '2n+1');
|
2423 |
+
},
|
2424 |
+
|
2425 |
+
/*</nth-pseudo-selectors>*/
|
2426 |
+
|
2427 |
+
/*<of-type-pseudo-selectors>*/
|
2428 |
+
|
2429 |
+
'first-of-type': function(node){
|
2430 |
+
var nodeName = node.nodeName;
|
2431 |
+
while ((node = node.previousSibling)) if (node.nodeName == nodeName) return false;
|
2432 |
+
return true;
|
2433 |
+
},
|
2434 |
+
|
2435 |
+
'last-of-type': function(node){
|
2436 |
+
var nodeName = node.nodeName;
|
2437 |
+
while ((node = node.nextSibling)) if (node.nodeName == nodeName) return false;
|
2438 |
+
return true;
|
2439 |
+
},
|
2440 |
+
|
2441 |
+
'only-of-type': function(node){
|
2442 |
+
var prev = node, nodeName = node.nodeName;
|
2443 |
+
while ((prev = prev.previousSibling)) if (prev.nodeName == nodeName) return false;
|
2444 |
+
var next = node;
|
2445 |
+
while ((next = next.nextSibling)) if (next.nodeName == nodeName) return false;
|
2446 |
+
return true;
|
2447 |
+
},
|
2448 |
+
|
2449 |
+
/*</of-type-pseudo-selectors>*/
|
2450 |
+
|
2451 |
+
// custom pseudos
|
2452 |
+
|
2453 |
+
'enabled': function(node){
|
2454 |
+
return !node.disabled;
|
2455 |
+
},
|
2456 |
+
|
2457 |
+
'disabled': function(node){
|
2458 |
+
return node.disabled;
|
2459 |
+
},
|
2460 |
+
|
2461 |
+
'checked': function(node){
|
2462 |
+
return node.checked || node.selected;
|
2463 |
+
},
|
2464 |
+
|
2465 |
+
'focus': function(node){
|
2466 |
+
return this.isHTMLDocument && this.document.activeElement === node && (node.href || node.type || this.hasAttribute(node, 'tabindex'));
|
2467 |
+
},
|
2468 |
+
|
2469 |
+
'root': function(node){
|
2470 |
+
return (node === this.root);
|
2471 |
+
},
|
2472 |
+
|
2473 |
+
'selected': function(node){
|
2474 |
+
return node.selected;
|
2475 |
+
}
|
2476 |
+
|
2477 |
+
/*</pseudo-selectors>*/
|
2478 |
+
};
|
2479 |
+
|
2480 |
+
for (var p in pseudos) local['pseudo:' + p] = pseudos[p];
|
2481 |
+
|
2482 |
+
// attributes methods
|
2483 |
+
|
2484 |
+
var attributeGetters = local.attributeGetters = {
|
2485 |
+
|
2486 |
+
'for': function(){
|
2487 |
+
return ('htmlFor' in this) ? this.htmlFor : this.getAttribute('for');
|
2488 |
+
},
|
2489 |
+
|
2490 |
+
'href': function(){
|
2491 |
+
return ('href' in this) ? this.getAttribute('href', 2) : this.getAttribute('href');
|
2492 |
+
},
|
2493 |
+
|
2494 |
+
'style': function(){
|
2495 |
+
return (this.style) ? this.style.cssText : this.getAttribute('style');
|
2496 |
+
},
|
2497 |
+
|
2498 |
+
'tabindex': function(){
|
2499 |
+
var attributeNode = this.getAttributeNode('tabindex');
|
2500 |
+
return (attributeNode && attributeNode.specified) ? attributeNode.nodeValue : null;
|
2501 |
+
},
|
2502 |
+
|
2503 |
+
'type': function(){
|
2504 |
+
return this.getAttribute('type');
|
2505 |
+
},
|
2506 |
+
|
2507 |
+
'maxlength': function(){
|
2508 |
+
var attributeNode = this.getAttributeNode('maxLength');
|
2509 |
+
return (attributeNode && attributeNode.specified) ? attributeNode.nodeValue : null;
|
2510 |
+
}
|
2511 |
+
|
2512 |
+
};
|
2513 |
+
|
2514 |
+
attributeGetters.MAXLENGTH = attributeGetters.maxLength = attributeGetters.maxlength;
|
2515 |
+
|
2516 |
+
// Slick
|
2517 |
+
|
2518 |
+
var Slick = local.Slick = (this.Slick || {});
|
2519 |
+
|
2520 |
+
Slick.version = '1.1.7';
|
2521 |
+
|
2522 |
+
// Slick finder
|
2523 |
+
|
2524 |
+
Slick.search = function(context, expression, append){
|
2525 |
+
return local.search(context, expression, append);
|
2526 |
+
};
|
2527 |
+
|
2528 |
+
Slick.find = function(context, expression){
|
2529 |
+
return local.search(context, expression, null, true);
|
2530 |
+
};
|
2531 |
+
|
2532 |
+
// Slick containment checker
|
2533 |
+
|
2534 |
+
Slick.contains = function(container, node){
|
2535 |
+
local.setDocument(container);
|
2536 |
+
return local.contains(container, node);
|
2537 |
+
};
|
2538 |
+
|
2539 |
+
// Slick attribute getter
|
2540 |
+
|
2541 |
+
Slick.getAttribute = function(node, name){
|
2542 |
+
local.setDocument(node);
|
2543 |
+
return local.getAttribute(node, name);
|
2544 |
+
};
|
2545 |
+
|
2546 |
+
Slick.hasAttribute = function(node, name){
|
2547 |
+
local.setDocument(node);
|
2548 |
+
return local.hasAttribute(node, name);
|
2549 |
+
};
|
2550 |
+
|
2551 |
+
// Slick matcher
|
2552 |
+
|
2553 |
+
Slick.match = function(node, selector){
|
2554 |
+
if (!(node && selector)) return false;
|
2555 |
+
if (!selector || selector === node) return true;
|
2556 |
+
local.setDocument(node);
|
2557 |
+
return local.matchNode(node, selector);
|
2558 |
+
};
|
2559 |
+
|
2560 |
+
// Slick attribute accessor
|
2561 |
+
|
2562 |
+
Slick.defineAttributeGetter = function(name, fn){
|
2563 |
+
local.attributeGetters[name] = fn;
|
2564 |
+
return this;
|
2565 |
+
};
|
2566 |
+
|
2567 |
+
Slick.lookupAttributeGetter = function(name){
|
2568 |
+
return local.attributeGetters[name];
|
2569 |
+
};
|
2570 |
+
|
2571 |
+
// Slick pseudo accessor
|
2572 |
+
|
2573 |
+
Slick.definePseudo = function(name, fn){
|
2574 |
+
local['pseudo:' + name] = function(node, argument){
|
2575 |
+
return fn.call(node, argument);
|
2576 |
+
};
|
2577 |
+
return this;
|
2578 |
+
};
|
2579 |
+
|
2580 |
+
Slick.lookupPseudo = function(name){
|
2581 |
+
var pseudo = local['pseudo:' + name];
|
2582 |
+
if (pseudo) return function(argument){
|
2583 |
+
return pseudo.call(this, argument);
|
2584 |
+
};
|
2585 |
+
return null;
|
2586 |
+
};
|
2587 |
+
|
2588 |
+
// Slick overrides accessor
|
2589 |
+
|
2590 |
+
Slick.override = function(regexp, fn){
|
2591 |
+
local.override(regexp, fn);
|
2592 |
+
return this;
|
2593 |
+
};
|
2594 |
+
|
2595 |
+
Slick.isXML = local.isXML;
|
2596 |
+
|
2597 |
+
Slick.uidOf = function(node){
|
2598 |
+
return local.getUIDHTML(node);
|
2599 |
+
};
|
2600 |
+
|
2601 |
+
if (!this.Slick) this.Slick = Slick;
|
2602 |
+
|
2603 |
+
}).apply(/*<CommonJS>*/(typeof exports != 'undefined') ? exports : /*</CommonJS>*/this);
|
2604 |
+
|
2605 |
+
/*
|
2606 |
+
---
|
2607 |
+
|
2608 |
+
name: Element
|
2609 |
+
|
2610 |
+
description: One of the most important items in MooTools. Contains the dollar function, the dollars function, and an handful of cross-browser, time-saver methods to let you easily work with HTML Elements.
|
2611 |
+
|
2612 |
+
license: MIT-style license.
|
2613 |
+
|
2614 |
+
requires: [Window, Document, Array, String, Function, Object, Number, Slick.Parser, Slick.Finder]
|
2615 |
+
|
2616 |
+
provides: [Element, Elements, $, $$, IFrame, Selectors]
|
2617 |
+
|
2618 |
+
...
|
2619 |
+
*/
|
2620 |
+
|
2621 |
+
var Element = this.Element = function(tag, props){
|
2622 |
+
var konstructor = Element.Constructors[tag];
|
2623 |
+
if (konstructor) return konstructor(props);
|
2624 |
+
if (typeof tag != 'string') return document.id(tag).set(props);
|
2625 |
+
|
2626 |
+
if (!props) props = {};
|
2627 |
+
|
2628 |
+
if (!(/^[\w-]+$/).test(tag)){
|
2629 |
+
var parsed = Slick.parse(tag).expressions[0][0];
|
2630 |
+
tag = (parsed.tag == '*') ? 'div' : parsed.tag;
|
2631 |
+
if (parsed.id && props.id == null) props.id = parsed.id;
|
2632 |
+
|
2633 |
+
var attributes = parsed.attributes;
|
2634 |
+
if (attributes) for (var attr, i = 0, l = attributes.length; i < l; i++){
|
2635 |
+
attr = attributes[i];
|
2636 |
+
if (props[attr.key] != null) continue;
|
2637 |
+
|
2638 |
+
if (attr.value != null && attr.operator == '=') props[attr.key] = attr.value;
|
2639 |
+
else if (!attr.value && !attr.operator) props[attr.key] = true;
|
2640 |
+
}
|
2641 |
+
|
2642 |
+
if (parsed.classList && props['class'] == null) props['class'] = parsed.classList.join(' ');
|
2643 |
+
}
|
2644 |
+
|
2645 |
+
return document.newElement(tag, props);
|
2646 |
+
};
|
2647 |
+
|
2648 |
+
|
2649 |
+
if (Browser.Element){
|
2650 |
+
Element.prototype = Browser.Element.prototype;
|
2651 |
+
// IE8 and IE9 require the wrapping.
|
2652 |
+
Element.prototype._fireEvent = (function(fireEvent){
|
2653 |
+
return function(type, event){
|
2654 |
+
return fireEvent.call(this, type, event);
|
2655 |
+
};
|
2656 |
+
})(Element.prototype.fireEvent);
|
2657 |
+
}
|
2658 |
+
|
2659 |
+
new Type('Element', Element).mirror(function(name){
|
2660 |
+
if (Array.prototype[name]) return;
|
2661 |
+
|
2662 |
+
var obj = {};
|
2663 |
+
obj[name] = function(){
|
2664 |
+
var results = [], args = arguments, elements = true;
|
2665 |
+
for (var i = 0, l = this.length; i < l; i++){
|
2666 |
+
var element = this[i], result = results[i] = element[name].apply(element, args);
|
2667 |
+
elements = (elements && typeOf(result) == 'element');
|
2668 |
+
}
|
2669 |
+
return (elements) ? new Elements(results) : results;
|
2670 |
+
};
|
2671 |
+
|
2672 |
+
Elements.implement(obj);
|
2673 |
+
});
|
2674 |
+
|
2675 |
+
if (!Browser.Element){
|
2676 |
+
Element.parent = Object;
|
2677 |
+
|
2678 |
+
Element.Prototype = {
|
2679 |
+
'$constructor': Element,
|
2680 |
+
'$family': Function.from('element').hide()
|
2681 |
+
};
|
2682 |
+
|
2683 |
+
Element.mirror(function(name, method){
|
2684 |
+
Element.Prototype[name] = method;
|
2685 |
+
});
|
2686 |
+
}
|
2687 |
+
|
2688 |
+
Element.Constructors = {};
|
2689 |
+
|
2690 |
+
|
2691 |
+
|
2692 |
+
var IFrame = new Type('IFrame', function(){
|
2693 |
+
var params = Array.link(arguments, {
|
2694 |
+
properties: Type.isObject,
|
2695 |
+
iframe: function(obj){
|
2696 |
+
return (obj != null);
|
2697 |
+
}
|
2698 |
+
});
|
2699 |
+
|
2700 |
+
var props = params.properties || {}, iframe;
|
2701 |
+
if (params.iframe) iframe = document.id(params.iframe);
|
2702 |
+
var onload = props.onload || function(){};
|
2703 |
+
delete props.onload;
|
2704 |
+
props.id = props.name = [props.id, props.name, iframe ? (iframe.id || iframe.name) : 'IFrame_' + String.uniqueID()].pick();
|
2705 |
+
iframe = new Element(iframe || 'iframe', props);
|
2706 |
+
|
2707 |
+
var onLoad = function(){
|
2708 |
+
onload.call(iframe.contentWindow);
|
2709 |
+
};
|
2710 |
+
|
2711 |
+
if (window.frames[props.id]) onLoad();
|
2712 |
+
else iframe.addListener('load', onLoad);
|
2713 |
+
return iframe;
|
2714 |
+
});
|
2715 |
+
|
2716 |
+
var Elements = this.Elements = function(nodes){
|
2717 |
+
if (nodes && nodes.length){
|
2718 |
+
var uniques = {}, node;
|
2719 |
+
for (var i = 0; node = nodes[i++];){
|
2720 |
+
var uid = Slick.uidOf(node);
|
2721 |
+
if (!uniques[uid]){
|
2722 |
+
uniques[uid] = true;
|
2723 |
+
this.push(node);
|
2724 |
+
}
|
2725 |
+
}
|
2726 |
+
}
|
2727 |
+
};
|
2728 |
+
|
2729 |
+
Elements.prototype = {length: 0};
|
2730 |
+
Elements.parent = Array;
|
2731 |
+
|
2732 |
+
new Type('Elements', Elements).implement({
|
2733 |
+
|
2734 |
+
filter: function(filter, bind){
|
2735 |
+
if (!filter) return this;
|
2736 |
+
return new Elements(Array.filter(this, (typeOf(filter) == 'string') ? function(item){
|
2737 |
+
return item.match(filter);
|
2738 |
+
} : filter, bind));
|
2739 |
+
}.protect(),
|
2740 |
+
|
2741 |
+
push: function(){
|
2742 |
+
var length = this.length;
|
2743 |
+
for (var i = 0, l = arguments.length; i < l; i++){
|
2744 |
+
var item = document.id(arguments[i]);
|
2745 |
+
if (item) this[length++] = item;
|
2746 |
+
}
|
2747 |
+
return (this.length = length);
|
2748 |
+
}.protect(),
|
2749 |
+
|
2750 |
+
unshift: function(){
|
2751 |
+
var items = [];
|
2752 |
+
for (var i = 0, l = arguments.length; i < l; i++){
|
2753 |
+
var item = document.id(arguments[i]);
|
2754 |
+
if (item) items.push(item);
|
2755 |
+
}
|
2756 |
+
return Array.prototype.unshift.apply(this, items);
|
2757 |
+
}.protect(),
|
2758 |
+
|
2759 |
+
concat: function(){
|
2760 |
+
var newElements = new Elements(this);
|
2761 |
+
for (var i = 0, l = arguments.length; i < l; i++){
|
2762 |
+
var item = arguments[i];
|
2763 |
+
if (Type.isEnumerable(item)) newElements.append(item);
|
2764 |
+
else newElements.push(item);
|
2765 |
+
}
|
2766 |
+
return newElements;
|
2767 |
+
}.protect(),
|
2768 |
+
|
2769 |
+
append: function(collection){
|
2770 |
+
for (var i = 0, l = collection.length; i < l; i++) this.push(collection[i]);
|
2771 |
+
return this;
|
2772 |
+
}.protect(),
|
2773 |
+
|
2774 |
+
empty: function(){
|
2775 |
+
while (this.length) delete this[--this.length];
|
2776 |
+
return this;
|
2777 |
+
}.protect()
|
2778 |
+
|
2779 |
+
});
|
2780 |
+
|
2781 |
+
|
2782 |
+
|
2783 |
+
(function(){
|
2784 |
+
|
2785 |
+
// FF, IE
|
2786 |
+
var splice = Array.prototype.splice, object = {'0': 0, '1': 1, length: 2};
|
2787 |
+
|
2788 |
+
splice.call(object, 1, 1);
|
2789 |
+
if (object[1] == 1) Elements.implement('splice', function(){
|
2790 |
+
var length = this.length;
|
2791 |
+
var result = splice.apply(this, arguments);
|
2792 |
+
while (length >= this.length) delete this[length--];
|
2793 |
+
return result;
|
2794 |
+
}.protect());
|
2795 |
+
|
2796 |
+
Array.forEachMethod(function(method, name){
|
2797 |
+
Elements.implement(name, method);
|
2798 |
+
});
|
2799 |
+
|
2800 |
+
Array.mirror(Elements);
|
2801 |
+
|
2802 |
+
/*<ltIE8>*/
|
2803 |
+
var createElementAcceptsHTML;
|
2804 |
+
try {
|
2805 |
+
createElementAcceptsHTML = (document.createElement('<input name=x>').name == 'x');
|
2806 |
+
} catch (e){}
|
2807 |
+
|
2808 |
+
var escapeQuotes = function(html){
|
2809 |
+
return ('' + html).replace(/&/g, '&').replace(/"/g, '"');
|
2810 |
+
};
|
2811 |
+
/*</ltIE8>*/
|
2812 |
+
|
2813 |
+
/*<ltIE9>*/
|
2814 |
+
// #2479 - IE8 Cannot set HTML of style element
|
2815 |
+
var canChangeStyleHTML = (function(){
|
2816 |
+
var div = document.createElement('style'),
|
2817 |
+
flag = false;
|
2818 |
+
try {
|
2819 |
+
div.innerHTML = '#justTesing{margin: 0px;}';
|
2820 |
+
flag = !!div.innerHTML;
|
2821 |
+
} catch(e){}
|
2822 |
+
return flag;
|
2823 |
+
})();
|
2824 |
+
/*</ltIE9>*/
|
2825 |
+
|
2826 |
+
Document.implement({
|
2827 |
+
|
2828 |
+
newElement: function(tag, props){
|
2829 |
+
if (props){
|
2830 |
+
if (props.checked != null) props.defaultChecked = props.checked;
|
2831 |
+
if ((props.type == 'checkbox' || props.type == 'radio') && props.value == null) props.value = 'on';
|
2832 |
+
/*<ltIE9>*/ // IE needs the type to be set before changing content of style element
|
2833 |
+
if (!canChangeStyleHTML && tag == 'style'){
|
2834 |
+
var styleElement = document.createElement('style');
|
2835 |
+
styleElement.setAttribute('type', 'text/css');
|
2836 |
+
if (props.type) delete props.type;
|
2837 |
+
return this.id(styleElement).set(props);
|
2838 |
+
}
|
2839 |
+
/*</ltIE9>*/
|
2840 |
+
/*<ltIE8>*/// Fix for readonly name and type properties in IE < 8
|
2841 |
+
if (createElementAcceptsHTML){
|
2842 |
+
tag = '<' + tag;
|
2843 |
+
if (props.name) tag += ' name="' + escapeQuotes(props.name) + '"';
|
2844 |
+
if (props.type) tag += ' type="' + escapeQuotes(props.type) + '"';
|
2845 |
+
tag += '>';
|
2846 |
+
delete props.name;
|
2847 |
+
delete props.type;
|
2848 |
+
}
|
2849 |
+
/*</ltIE8>*/
|
2850 |
+
}
|
2851 |
+
return this.id(this.createElement(tag)).set(props);
|
2852 |
+
}
|
2853 |
+
|
2854 |
+
});
|
2855 |
+
|
2856 |
+
})();
|
2857 |
+
|
2858 |
+
(function(){
|
2859 |
+
|
2860 |
+
Slick.uidOf(window);
|
2861 |
+
Slick.uidOf(document);
|
2862 |
+
|
2863 |
+
Document.implement({
|
2864 |
+
|
2865 |
+
newTextNode: function(text){
|
2866 |
+
return this.createTextNode(text);
|
2867 |
+
},
|
2868 |
+
|
2869 |
+
getDocument: function(){
|
2870 |
+
return this;
|
2871 |
+
},
|
2872 |
+
|
2873 |
+
getWindow: function(){
|
2874 |
+
return this.window;
|
2875 |
+
},
|
2876 |
+
|
2877 |
+
id: (function(){
|
2878 |
+
|
2879 |
+
var types = {
|
2880 |
+
|
2881 |
+
string: function(id, nocash, doc){
|
2882 |
+
id = Slick.find(doc, '#' + id.replace(/(\W)/g, '\\$1'));
|
2883 |
+
return (id) ? types.element(id, nocash) : null;
|
2884 |
+
},
|
2885 |
+
|
2886 |
+
element: function(el, nocash){
|
2887 |
+
Slick.uidOf(el);
|
2888 |
+
if (!nocash && !el.$family && !(/^(?:object|embed)$/i).test(el.tagName)){
|
2889 |
+
var fireEvent = el.fireEvent;
|
2890 |
+
// wrapping needed in IE7, or else crash
|
2891 |
+
el._fireEvent = function(type, event){
|
2892 |
+
return fireEvent(type, event);
|
2893 |
+
};
|
2894 |
+
Object.append(el, Element.Prototype);
|
2895 |
+
}
|
2896 |
+
return el;
|
2897 |
+
},
|
2898 |
+
|
2899 |
+
object: function(obj, nocash, doc){
|
2900 |
+
if (obj.toElement) return types.element(obj.toElement(doc), nocash);
|
2901 |
+
return null;
|
2902 |
+
}
|
2903 |
+
|
2904 |
+
};
|
2905 |
+
|
2906 |
+
types.textnode = types.whitespace = types.window = types.document = function(zero){
|
2907 |
+
return zero;
|
2908 |
+
};
|
2909 |
+
|
2910 |
+
return function(el, nocash, doc){
|
2911 |
+
if (el && el.$family && el.uniqueNumber) return el;
|
2912 |
+
var type = typeOf(el);
|
2913 |
+
return (types[type]) ? types[type](el, nocash, doc || document) : null;
|
2914 |
+
};
|
2915 |
+
|
2916 |
+
})()
|
2917 |
+
|
2918 |
+
});
|
2919 |
+
|
2920 |
+
if (window.$ == null) Window.implement('$', function(el, nc){
|
2921 |
+
return document.id(el, nc, this.document);
|
2922 |
+
});
|
2923 |
+
|
2924 |
+
Window.implement({
|
2925 |
+
|
2926 |
+
getDocument: function(){
|
2927 |
+
return this.document;
|
2928 |
+
},
|
2929 |
+
|
2930 |
+
getWindow: function(){
|
2931 |
+
return this;
|
2932 |
+
}
|
2933 |
+
|
2934 |
+
});
|
2935 |
+
|
2936 |
+
[Document, Element].invoke('implement', {
|
2937 |
+
|
2938 |
+
getElements: function(expression){
|
2939 |
+
return Slick.search(this, expression, new Elements);
|
2940 |
+
},
|
2941 |
+
|
2942 |
+
getElement: function(expression){
|
2943 |
+
return document.id(Slick.find(this, expression));
|
2944 |
+
}
|
2945 |
+
|
2946 |
+
});
|
2947 |
+
|
2948 |
+
var contains = {contains: function(element){
|
2949 |
+
return Slick.contains(this, element);
|
2950 |
+
}};
|
2951 |
+
|
2952 |
+
if (!document.contains) Document.implement(contains);
|
2953 |
+
if (!document.createElement('div').contains) Element.implement(contains);
|
2954 |
+
|
2955 |
+
|
2956 |
+
|
2957 |
+
// tree walking
|
2958 |
+
|
2959 |
+
var injectCombinator = function(expression, combinator){
|
2960 |
+
if (!expression) return combinator;
|
2961 |
+
|
2962 |
+
expression = Object.clone(Slick.parse(expression));
|
2963 |
+
|
2964 |
+
var expressions = expression.expressions;
|
2965 |
+
for (var i = expressions.length; i--;)
|
2966 |
+
expressions[i][0].combinator = combinator;
|
2967 |
+
|
2968 |
+
return expression;
|
2969 |
+
};
|
2970 |
+
|
2971 |
+
Object.forEach({
|
2972 |
+
getNext: '~',
|
2973 |
+
getPrevious: '!~',
|
2974 |
+
getParent: '!'
|
2975 |
+
}, function(combinator, method){
|
2976 |
+
Element.implement(method, function(expression){
|
2977 |
+
return this.getElement(injectCombinator(expression, combinator));
|
2978 |
+
});
|
2979 |
+
});
|
2980 |
+
|
2981 |
+
Object.forEach({
|
2982 |
+
getAllNext: '~',
|
2983 |
+
getAllPrevious: '!~',
|
2984 |
+
getSiblings: '~~',
|
2985 |
+
getChildren: '>',
|
2986 |
+
getParents: '!'
|
2987 |
+
}, function(combinator, method){
|
2988 |
+
Element.implement(method, function(expression){
|
2989 |
+
return this.getElements(injectCombinator(expression, combinator));
|
2990 |
+
});
|
2991 |
+
});
|
2992 |
+
|
2993 |
+
Element.implement({
|
2994 |
+
|
2995 |
+
getFirst: function(expression){
|
2996 |
+
return document.id(Slick.search(this, injectCombinator(expression, '>'))[0]);
|
2997 |
+
},
|
2998 |
+
|
2999 |
+
getLast: function(expression){
|
3000 |
+
return document.id(Slick.search(this, injectCombinator(expression, '>')).getLast());
|
3001 |
+
},
|
3002 |
+
|
3003 |
+
getWindow: function(){
|
3004 |
+
return this.ownerDocument.window;
|
3005 |
+
},
|
3006 |
+
|
3007 |
+
getDocument: function(){
|
3008 |
+
return this.ownerDocument;
|
3009 |
+
},
|
3010 |
+
|
3011 |
+
getElementById: function(id){
|
3012 |
+
return document.id(Slick.find(this, '#' + ('' + id).replace(/(\W)/g, '\\$1')));
|
3013 |
+
},
|
3014 |
+
|
3015 |
+
match: function(expression){
|
3016 |
+
return !expression || Slick.match(this, expression);
|
3017 |
+
}
|
3018 |
+
|
3019 |
+
});
|
3020 |
+
|
3021 |
+
|
3022 |
+
|
3023 |
+
if (window.$$ == null) Window.implement('$$', function(selector){
|
3024 |
+
if (arguments.length == 1){
|
3025 |
+
if (typeof selector == 'string') return Slick.search(this.document, selector, new Elements);
|
3026 |
+
else if (Type.isEnumerable(selector)) return new Elements(selector);
|
3027 |
+
}
|
3028 |
+
return new Elements(arguments);
|
3029 |
+
});
|
3030 |
+
|
3031 |
+
// Inserters
|
3032 |
+
|
3033 |
+
var inserters = {
|
3034 |
+
|
3035 |
+
before: function(context, element){
|
3036 |
+
var parent = element.parentNode;
|
3037 |
+
if (parent) parent.insertBefore(context, element);
|
3038 |
+
},
|
3039 |
+
|
3040 |
+
after: function(context, element){
|
3041 |
+
var parent = element.parentNode;
|
3042 |
+
if (parent) parent.insertBefore(context, element.nextSibling);
|
3043 |
+
},
|
3044 |
+
|
3045 |
+
bottom: function(context, element){
|
3046 |
+
element.appendChild(context);
|
3047 |
+
},
|
3048 |
+
|
3049 |
+
top: function(context, element){
|
3050 |
+
element.insertBefore(context, element.firstChild);
|
3051 |
+
}
|
3052 |
+
|
3053 |
+
};
|
3054 |
+
|
3055 |
+
inserters.inside = inserters.bottom;
|
3056 |
+
|
3057 |
+
|
3058 |
+
|
3059 |
+
// getProperty / setProperty
|
3060 |
+
|
3061 |
+
var propertyGetters = {}, propertySetters = {};
|
3062 |
+
|
3063 |
+
// properties
|
3064 |
+
|
3065 |
+
var properties = {};
|
3066 |
+
Array.forEach([
|
3067 |
+
'type', 'value', 'defaultValue', 'accessKey', 'cellPadding', 'cellSpacing', 'colSpan',
|
3068 |
+
'frameBorder', 'rowSpan', 'tabIndex', 'useMap'
|
3069 |
+
], function(property){
|
3070 |
+
properties[property.toLowerCase()] = property;
|
3071 |
+
});
|
3072 |
+
|
3073 |
+
properties.html = 'innerHTML';
|
3074 |
+
properties.text = (document.createElement('div').textContent == null) ? 'innerText': 'textContent';
|
3075 |
+
|
3076 |
+
Object.forEach(properties, function(real, key){
|
3077 |
+
propertySetters[key] = function(node, value){
|
3078 |
+
node[real] = value;
|
3079 |
+
};
|
3080 |
+
propertyGetters[key] = function(node){
|
3081 |
+
return node[real];
|
3082 |
+
};
|
3083 |
+
});
|
3084 |
+
|
3085 |
+
/*<ltIE9>*/
|
3086 |
+
propertySetters.text = (function(setter){
|
3087 |
+
return function(node, value){
|
3088 |
+
if (node.get('tag') == 'style') node.set('html', value);
|
3089 |
+
else node[properties.text] = value;
|
3090 |
+
};
|
3091 |
+
})(propertySetters.text);
|
3092 |
+
|
3093 |
+
propertyGetters.text = (function(getter){
|
3094 |
+
return function(node){
|
3095 |
+
return (node.get('tag') == 'style') ? node.innerHTML : getter(node);
|
3096 |
+
};
|
3097 |
+
})(propertyGetters.text);
|
3098 |
+
/*</ltIE9>*/
|
3099 |
+
|
3100 |
+
// Booleans
|
3101 |
+
|
3102 |
+
var bools = [
|
3103 |
+
'compact', 'nowrap', 'ismap', 'declare', 'noshade', 'checked',
|
3104 |
+
'disabled', 'readOnly', 'multiple', 'selected', 'noresize',
|
3105 |
+
'defer', 'defaultChecked', 'autofocus', 'controls', 'autoplay',
|
3106 |
+
'loop'
|
3107 |
+
];
|
3108 |
+
|
3109 |
+
var booleans = {};
|
3110 |
+
Array.forEach(bools, function(bool){
|
3111 |
+
var lower = bool.toLowerCase();
|
3112 |
+
booleans[lower] = bool;
|
3113 |
+
propertySetters[lower] = function(node, value){
|
3114 |
+
node[bool] = !!value;
|
3115 |
+
};
|
3116 |
+
propertyGetters[lower] = function(node){
|
3117 |
+
return !!node[bool];
|
3118 |
+
};
|
3119 |
+
});
|
3120 |
+
|
3121 |
+
// Special cases
|
3122 |
+
|
3123 |
+
Object.append(propertySetters, {
|
3124 |
+
|
3125 |
+
'class': function(node, value){
|
3126 |
+
('className' in node) ? node.className = (value || '') : node.setAttribute('class', value);
|
3127 |
+
},
|
3128 |
+
|
3129 |
+
'for': function(node, value){
|
3130 |
+
('htmlFor' in node) ? node.htmlFor = value : node.setAttribute('for', value);
|
3131 |
+
},
|
3132 |
+
|
3133 |
+
'style': function(node, value){
|
3134 |
+
(node.style) ? node.style.cssText = value : node.setAttribute('style', value);
|
3135 |
+
},
|
3136 |
+
|
3137 |
+
'value': function(node, value){
|
3138 |
+
node.value = (value != null) ? value : '';
|
3139 |
+
}
|
3140 |
+
|
3141 |
+
});
|
3142 |
+
|
3143 |
+
propertyGetters['class'] = function(node){
|
3144 |
+
return ('className' in node) ? node.className || null : node.getAttribute('class');
|
3145 |
+
};
|
3146 |
+
|
3147 |
+
/* <webkit> */
|
3148 |
+
var el = document.createElement('button');
|
3149 |
+
// IE sets type as readonly and throws
|
3150 |
+
try { el.type = 'button'; } catch(e){}
|
3151 |
+
if (el.type != 'button') propertySetters.type = function(node, value){
|
3152 |
+
node.setAttribute('type', value);
|
3153 |
+
};
|
3154 |
+
el = null;
|
3155 |
+
/* </webkit> */
|
3156 |
+
|
3157 |
+
/*<IE>*/
|
3158 |
+
|
3159 |
+
/*<ltIE9>*/
|
3160 |
+
// #2479 - IE8 Cannot set HTML of style element
|
3161 |
+
var canChangeStyleHTML = (function(){
|
3162 |
+
var div = document.createElement('style'),
|
3163 |
+
flag = false;
|
3164 |
+
try {
|
3165 |
+
div.innerHTML = '#justTesing{margin: 0px;}';
|
3166 |
+
flag = !!div.innerHTML;
|
3167 |
+
} catch(e){}
|
3168 |
+
return flag;
|
3169 |
+
})();
|
3170 |
+
/*</ltIE9>*/
|
3171 |
+
|
3172 |
+
var input = document.createElement('input'), volatileInputValue, html5InputSupport;
|
3173 |
+
|
3174 |
+
// #2178
|
3175 |
+
input.value = 't';
|
3176 |
+
input.type = 'submit';
|
3177 |
+
volatileInputValue = input.value != 't';
|
3178 |
+
|
3179 |
+
// #2443 - IE throws "Invalid Argument" when trying to use html5 input types
|
3180 |
+
try {
|
3181 |
+
input.value = '';
|
3182 |
+
input.type = 'email';
|
3183 |
+
html5InputSupport = input.type == 'email';
|
3184 |
+
} catch(e){}
|
3185 |
+
|
3186 |
+
input = null;
|
3187 |
+
|
3188 |
+
if (volatileInputValue || !html5InputSupport) propertySetters.type = function(node, type){
|
3189 |
+
try {
|
3190 |
+
var value = node.value;
|
3191 |
+
node.type = type;
|
3192 |
+
node.value = value;
|
3193 |
+
} catch (e){}
|
3194 |
+
};
|
3195 |
+
/*</IE>*/
|
3196 |
+
|
3197 |
+
/* getProperty, setProperty */
|
3198 |
+
|
3199 |
+
/* <ltIE9> */
|
3200 |
+
var pollutesGetAttribute = (function(div){
|
3201 |
+
div.random = 'attribute';
|
3202 |
+
return (div.getAttribute('random') == 'attribute');
|
3203 |
+
})(document.createElement('div'));
|
3204 |
+
|
3205 |
+
var hasCloneBug = (function(test){
|
3206 |
+
test.innerHTML = '<object><param name="should_fix" value="the unknown" /></object>';
|
3207 |
+
return test.cloneNode(true).firstChild.childNodes.length != 1;
|
3208 |
+
})(document.createElement('div'));
|
3209 |
+
/* </ltIE9> */
|
3210 |
+
|
3211 |
+
var hasClassList = !!document.createElement('div').classList;
|
3212 |
+
|
3213 |
+
var classes = function(className){
|
3214 |
+
var classNames = (className || '').clean().split(" "), uniques = {};
|
3215 |
+
return classNames.filter(function(className){
|
3216 |
+
if (className !== "" && !uniques[className]) return uniques[className] = className;
|
3217 |
+
});
|
3218 |
+
};
|
3219 |
+
|
3220 |
+
var addToClassList = function(name){
|
3221 |
+
this.classList.add(name);
|
3222 |
+
};
|
3223 |
+
|
3224 |
+
var removeFromClassList = function(name){
|
3225 |
+
this.classList.remove(name);
|
3226 |
+
};
|
3227 |
+
|
3228 |
+
Element.implement({
|
3229 |
+
|
3230 |
+
setProperty: function(name, value){
|
3231 |
+
var setter = propertySetters[name.toLowerCase()];
|
3232 |
+
if (setter){
|
3233 |
+
setter(this, value);
|
3234 |
+
} else {
|
3235 |
+
/* <ltIE9> */
|
3236 |
+
var attributeWhiteList;
|
3237 |
+
if (pollutesGetAttribute) attributeWhiteList = this.retrieve('$attributeWhiteList', {});
|
3238 |
+
/* </ltIE9> */
|
3239 |
+
|
3240 |
+
if (value == null){
|
3241 |
+
this.removeAttribute(name);
|
3242 |
+
/* <ltIE9> */
|
3243 |
+
if (pollutesGetAttribute) delete attributeWhiteList[name];
|
3244 |
+
/* </ltIE9> */
|
3245 |
+
} else {
|
3246 |
+
this.setAttribute(name, '' + value);
|
3247 |
+
/* <ltIE9> */
|
3248 |
+
if (pollutesGetAttribute) attributeWhiteList[name] = true;
|
3249 |
+
/* </ltIE9> */
|
3250 |
+
}
|
3251 |
+
}
|
3252 |
+
return this;
|
3253 |
+
},
|
3254 |
+
|
3255 |
+
setProperties: function(attributes){
|
3256 |
+
for (var attribute in attributes) this.setProperty(attribute, attributes[attribute]);
|
3257 |
+
return this;
|
3258 |
+
},
|
3259 |
+
|
3260 |
+
getProperty: function(name){
|
3261 |
+
var getter = propertyGetters[name.toLowerCase()];
|
3262 |
+
if (getter) return getter(this);
|
3263 |
+
/* <ltIE9> */
|
3264 |
+
if (pollutesGetAttribute){
|
3265 |
+
var attr = this.getAttributeNode(name), attributeWhiteList = this.retrieve('$attributeWhiteList', {});
|
3266 |
+
if (!attr) return null;
|
3267 |
+
if (attr.expando && !attributeWhiteList[name]){
|
3268 |
+
var outer = this.outerHTML;
|
3269 |
+
// segment by the opening tag and find mention of attribute name
|
3270 |
+
if (outer.substr(0, outer.search(/\/?['"]?>(?![^<]*<['"])/)).indexOf(name) < 0) return null;
|
3271 |
+
attributeWhiteList[name] = true;
|
3272 |
+
}
|
3273 |
+
}
|
3274 |
+
/* </ltIE9> */
|
3275 |
+
var result = Slick.getAttribute(this, name);
|
3276 |
+
return (!result && !Slick.hasAttribute(this, name)) ? null : result;
|
3277 |
+
},
|
3278 |
+
|
3279 |
+
getProperties: function(){
|
3280 |
+
var args = Array.from(arguments);
|
3281 |
+
return args.map(this.getProperty, this).associate(args);
|
3282 |
+
},
|
3283 |
+
|
3284 |
+
removeProperty: function(name){
|
3285 |
+
return this.setProperty(name, null);
|
3286 |
+
},
|
3287 |
+
|
3288 |
+
removeProperties: function(){
|
3289 |
+
Array.each(arguments, this.removeProperty, this);
|
3290 |
+
return this;
|
3291 |
+
},
|
3292 |
+
|
3293 |
+
set: function(prop, value){
|
3294 |
+
var property = Element.Properties[prop];
|
3295 |
+
(property && property.set) ? property.set.call(this, value) : this.setProperty(prop, value);
|
3296 |
+
}.overloadSetter(),
|
3297 |
+
|
3298 |
+
get: function(prop){
|
3299 |
+
var property = Element.Properties[prop];
|
3300 |
+
return (property && property.get) ? property.get.apply(this) : this.getProperty(prop);
|
3301 |
+
}.overloadGetter(),
|
3302 |
+
|
3303 |
+
erase: function(prop){
|
3304 |
+
var property = Element.Properties[prop];
|
3305 |
+
(property && property.erase) ? property.erase.apply(this) : this.removeProperty(prop);
|
3306 |
+
return this;
|
3307 |
+
},
|
3308 |
+
|
3309 |
+
hasClass: hasClassList ? function(className){
|
3310 |
+
return this.classList.contains(className);
|
3311 |
+
} : function(className){
|
3312 |
+
return classes(this.className).contains(className);
|
3313 |
+
},
|
3314 |
+
|
3315 |
+
addClass: hasClassList ? function(className){
|
3316 |
+
classes(className).forEach(addToClassList, this);
|
3317 |
+
return this;
|
3318 |
+
} : function(className){
|
3319 |
+
this.className = classes(className + ' ' + this.className).join(' ');
|
3320 |
+
return this;
|
3321 |
+
},
|
3322 |
+
|
3323 |
+
removeClass: hasClassList ? function(className){
|
3324 |
+
classes(className).forEach(removeFromClassList, this);
|
3325 |
+
return this;
|
3326 |
+
} : function(className){
|
3327 |
+
var classNames = classes(this.className);
|
3328 |
+
classes(className).forEach(classNames.erase, classNames);
|
3329 |
+
this.className = classNames.join(' ');
|
3330 |
+
return this;
|
3331 |
+
},
|
3332 |
+
|
3333 |
+
toggleClass: function(className, force){
|
3334 |
+
if (force == null) force = !this.hasClass(className);
|
3335 |
+
return (force) ? this.addClass(className) : this.removeClass(className);
|
3336 |
+
},
|
3337 |
+
|
3338 |
+
adopt: function(){
|
3339 |
+
var parent = this, fragment, elements = Array.flatten(arguments), length = elements.length;
|
3340 |
+
if (length > 1) parent = fragment = document.createDocumentFragment();
|
3341 |
+
|
3342 |
+
for (var i = 0; i < length; i++){
|
3343 |
+
var element = document.id(elements[i], true);
|
3344 |
+
if (element) parent.appendChild(element);
|
3345 |
+
}
|
3346 |
+
|
3347 |
+
if (fragment) this.appendChild(fragment);
|
3348 |
+
|
3349 |
+
return this;
|
3350 |
+
},
|
3351 |
+
|
3352 |
+
appendText: function(text, where){
|
3353 |
+
return this.grab(this.getDocument().newTextNode(text), where);
|
3354 |
+
},
|
3355 |
+
|
3356 |
+
grab: function(el, where){
|
3357 |
+
inserters[where || 'bottom'](document.id(el, true), this);
|
3358 |
+
return this;
|
3359 |
+
},
|
3360 |
+
|
3361 |
+
inject: function(el, where){
|
3362 |
+
inserters[where || 'bottom'](this, document.id(el, true));
|
3363 |
+
return this;
|
3364 |
+
},
|
3365 |
+
|
3366 |
+
replaces: function(el){
|
3367 |
+
el = document.id(el, true);
|
3368 |
+
el.parentNode.replaceChild(this, el);
|
3369 |
+
return this;
|
3370 |
+
},
|
3371 |
+
|
3372 |
+
wraps: function(el, where){
|
3373 |
+
el = document.id(el, true);
|
3374 |
+
return this.replaces(el).grab(el, where);
|
3375 |
+
},
|
3376 |
+
|
3377 |
+
getSelected: function(){
|
3378 |
+
this.selectedIndex; // Safari 3.2.1
|
3379 |
+
return new Elements(Array.from(this.options).filter(function(option){
|
3380 |
+
return option.selected;
|
3381 |
+
}));
|
3382 |
+
},
|
3383 |
+
|
3384 |
+
toQueryString: function(){
|
3385 |
+
var queryString = [];
|
3386 |
+
this.getElements('input, select, textarea').each(function(el){
|
3387 |
+
var type = el.type;
|
3388 |
+
if (!el.name || el.disabled || type == 'submit' || type == 'reset' || type == 'file' || type == 'image') return;
|
3389 |
+
|
3390 |
+
var value = (el.get('tag') == 'select') ? el.getSelected().map(function(opt){
|
3391 |
+
// IE
|
3392 |
+
return document.id(opt).get('value');
|
3393 |
+
}) : ((type == 'radio' || type == 'checkbox') && !el.checked) ? null : el.get('value');
|
3394 |
+
|
3395 |
+
Array.from(value).each(function(val){
|
3396 |
+
if (typeof val != 'undefined') queryString.push(encodeURIComponent(el.name) + '=' + encodeURIComponent(val));
|
3397 |
+
});
|
3398 |
+
});
|
3399 |
+
return queryString.join('&');
|
3400 |
+
}
|
3401 |
+
|
3402 |
+
});
|
3403 |
+
|
3404 |
+
|
3405 |
+
// appendHTML
|
3406 |
+
|
3407 |
+
var appendInserters = {
|
3408 |
+
before: 'beforeBegin',
|
3409 |
+
after: 'afterEnd',
|
3410 |
+
bottom: 'beforeEnd',
|
3411 |
+
top: 'afterBegin',
|
3412 |
+
inside: 'beforeEnd'
|
3413 |
+
};
|
3414 |
+
|
3415 |
+
Element.implement('appendHTML', ('insertAdjacentHTML' in document.createElement('div')) ? function(html, where){
|
3416 |
+
this.insertAdjacentHTML(appendInserters[where || 'bottom'], html);
|
3417 |
+
return this;
|
3418 |
+
} : function(html, where){
|
3419 |
+
var temp = new Element('div', {html: html}),
|
3420 |
+
children = temp.childNodes,
|
3421 |
+
fragment = temp.firstChild;
|
3422 |
+
|
3423 |
+
if (!fragment) return this;
|
3424 |
+
if (children.length > 1){
|
3425 |
+
fragment = document.createDocumentFragment();
|
3426 |
+
for (var i = 0, l = children.length; i < l; i++){
|
3427 |
+
fragment.appendChild(children[i]);
|
3428 |
+
}
|
3429 |
+
}
|
3430 |
+
|
3431 |
+
inserters[where || 'bottom'](fragment, this);
|
3432 |
+
return this;
|
3433 |
+
});
|
3434 |
+
|
3435 |
+
var collected = {}, storage = {};
|
3436 |
+
|
3437 |
+
var get = function(uid){
|
3438 |
+
return (storage[uid] || (storage[uid] = {}));
|
3439 |
+
};
|
3440 |
+
|
3441 |
+
var clean = function(item){
|
3442 |
+
var uid = item.uniqueNumber;
|
3443 |
+
if (item.removeEvents) item.removeEvents();
|
3444 |
+
if (item.clearAttributes) item.clearAttributes();
|
3445 |
+
if (uid != null){
|
3446 |
+
delete collected[uid];
|
3447 |
+
delete storage[uid];
|
3448 |
+
}
|
3449 |
+
return item;
|
3450 |
+
};
|
3451 |
+
|
3452 |
+
var formProps = {input: 'checked', option: 'selected', textarea: 'value'};
|
3453 |
+
|
3454 |
+
Element.implement({
|
3455 |
+
|
3456 |
+
destroy: function(){
|
3457 |
+
var children = clean(this).getElementsByTagName('*');
|
3458 |
+
Array.each(children, clean);
|
3459 |
+
Element.dispose(this);
|
3460 |
+
return null;
|
3461 |
+
},
|
3462 |
+
|
3463 |
+
empty: function(){
|
3464 |
+
Array.from(this.childNodes).each(Element.dispose);
|
3465 |
+
return this;
|
3466 |
+
},
|
3467 |
+
|
3468 |
+
dispose: function(){
|
3469 |
+
return (this.parentNode) ? this.parentNode.removeChild(this) : this;
|
3470 |
+
},
|
3471 |
+
|
3472 |
+
clone: function(contents, keepid){
|
3473 |
+
contents = contents !== false;
|
3474 |
+
var clone = this.cloneNode(contents), ce = [clone], te = [this], i;
|
3475 |
+
|
3476 |
+
if (contents){
|
3477 |
+
ce.append(Array.from(clone.getElementsByTagName('*')));
|
3478 |
+
te.append(Array.from(this.getElementsByTagName('*')));
|
3479 |
+
}
|
3480 |
+
|
3481 |
+
for (i = ce.length; i--;){
|
3482 |
+
var node = ce[i], element = te[i];
|
3483 |
+
if (!keepid) node.removeAttribute('id');
|
3484 |
+
/*<ltIE9>*/
|
3485 |
+
if (node.clearAttributes){
|
3486 |
+
node.clearAttributes();
|
3487 |
+
node.mergeAttributes(element);
|
3488 |
+
node.removeAttribute('uniqueNumber');
|
3489 |
+
if (node.options){
|
3490 |
+
var no = node.options, eo = element.options;
|
3491 |
+
for (var j = no.length; j--;) no[j].selected = eo[j].selected;
|
3492 |
+
}
|
3493 |
+
}
|
3494 |
+
/*</ltIE9>*/
|
3495 |
+
var prop = formProps[element.tagName.toLowerCase()];
|
3496 |
+
if (prop && element[prop]) node[prop] = element[prop];
|
3497 |
+
}
|
3498 |
+
|
3499 |
+
/*<ltIE9>*/
|
3500 |
+
if (hasCloneBug){
|
3501 |
+
var co = clone.getElementsByTagName('object'), to = this.getElementsByTagName('object');
|
3502 |
+
for (i = co.length; i--;) co[i].outerHTML = to[i].outerHTML;
|
3503 |
+
}
|
3504 |
+
/*</ltIE9>*/
|
3505 |
+
return document.id(clone);
|
3506 |
+
}
|
3507 |
+
|
3508 |
+
});
|
3509 |
+
|
3510 |
+
[Element, Window, Document].invoke('implement', {
|
3511 |
+
|
3512 |
+
addListener: function(type, fn){
|
3513 |
+
if (window.attachEvent && !window.addEventListener){
|
3514 |
+
collected[Slick.uidOf(this)] = this;
|
3515 |
+
}
|
3516 |
+
if (this.addEventListener) this.addEventListener(type, fn, !!arguments[2]);
|
3517 |
+
else this.attachEvent('on' + type, fn);
|
3518 |
+
return this;
|
3519 |
+
},
|
3520 |
+
|
3521 |
+
removeListener: function(type, fn){
|
3522 |
+
if (this.removeEventListener) this.removeEventListener(type, fn, !!arguments[2]);
|
3523 |
+
else this.detachEvent('on' + type, fn);
|
3524 |
+
return this;
|
3525 |
+
},
|
3526 |
+
|
3527 |
+
retrieve: function(property, dflt){
|
3528 |
+
var storage = get(Slick.uidOf(this)), prop = storage[property];
|
3529 |
+
if (dflt != null && prop == null) prop = storage[property] = dflt;
|
3530 |
+
return prop != null ? prop : null;
|
3531 |
+
},
|
3532 |
+
|
3533 |
+
store: function(property, value){
|
3534 |
+
var storage = get(Slick.uidOf(this));
|
3535 |
+
storage[property] = value;
|
3536 |
+
return this;
|
3537 |
+
},
|
3538 |
+
|
3539 |
+
eliminate: function(property){
|
3540 |
+
var storage = get(Slick.uidOf(this));
|
3541 |
+
delete storage[property];
|
3542 |
+
return this;
|
3543 |
+
}
|
3544 |
+
|
3545 |
+
});
|
3546 |
+
|
3547 |
+
/*<ltIE9>*/
|
3548 |
+
if (window.attachEvent && !window.addEventListener){
|
3549 |
+
var gc = function(){
|
3550 |
+
Object.each(collected, clean);
|
3551 |
+
if (window.CollectGarbage) CollectGarbage();
|
3552 |
+
window.removeListener('unload', gc);
|
3553 |
+
};
|
3554 |
+
window.addListener('unload', gc);
|
3555 |
+
}
|
3556 |
+
/*</ltIE9>*/
|
3557 |
+
|
3558 |
+
Element.Properties = {};
|
3559 |
+
|
3560 |
+
|
3561 |
+
|
3562 |
+
Element.Properties.style = {
|
3563 |
+
|
3564 |
+
set: function(style){
|
3565 |
+
this.style.cssText = style;
|
3566 |
+
},
|
3567 |
+
|
3568 |
+
get: function(){
|
3569 |
+
return this.style.cssText;
|
3570 |
+
},
|
3571 |
+
|
3572 |
+
erase: function(){
|
3573 |
+
this.style.cssText = '';
|
3574 |
+
}
|
3575 |
+
|
3576 |
+
};
|
3577 |
+
|
3578 |
+
Element.Properties.tag = {
|
3579 |
+
|
3580 |
+
get: function(){
|
3581 |
+
return this.tagName.toLowerCase();
|
3582 |
+
}
|
3583 |
+
|
3584 |
+
};
|
3585 |
+
|
3586 |
+
Element.Properties.html = {
|
3587 |
+
|
3588 |
+
set: function(html){
|
3589 |
+
if (html == null) html = '';
|
3590 |
+
else if (typeOf(html) == 'array') html = html.join('');
|
3591 |
+
|
3592 |
+
/*<ltIE9>*/
|
3593 |
+
if (this.styleSheet && !canChangeStyleHTML) this.styleSheet.cssText = html;
|
3594 |
+
else /*</ltIE9>*/this.innerHTML = html;
|
3595 |
+
},
|
3596 |
+
erase: function(){
|
3597 |
+
this.set('html', '');
|
3598 |
+
}
|
3599 |
+
|
3600 |
+
};
|
3601 |
+
|
3602 |
+
var supportsHTML5Elements = true, supportsTableInnerHTML = true, supportsTRInnerHTML = true;
|
3603 |
+
|
3604 |
+
/*<ltIE9>*/
|
3605 |
+
// technique by jdbarlett - http://jdbartlett.com/innershiv/
|
3606 |
+
var div = document.createElement('div');
|
3607 |
+
div.innerHTML = '<nav></nav>';
|
3608 |
+
supportsHTML5Elements = (div.childNodes.length == 1);
|
3609 |
+
if (!supportsHTML5Elements){
|
3610 |
+
var tags = 'abbr article aside audio canvas datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video'.split(' '),
|
3611 |
+
fragment = document.createDocumentFragment(), l = tags.length;
|
3612 |
+
while (l--) fragment.createElement(tags[l]);
|
3613 |
+
}
|
3614 |
+
div = null;
|
3615 |
+
/*</ltIE9>*/
|
3616 |
+
|
3617 |
+
/*<IE>*/
|
3618 |
+
supportsTableInnerHTML = Function.attempt(function(){
|
3619 |
+
var table = document.createElement('table');
|
3620 |
+
table.innerHTML = '<tr><td></td></tr>';
|
3621 |
+
return true;
|
3622 |
+
});
|
3623 |
+
|
3624 |
+
/*<ltFF4>*/
|
3625 |
+
var tr = document.createElement('tr'), html = '<td></td>';
|
3626 |
+
tr.innerHTML = html;
|
3627 |
+
supportsTRInnerHTML = (tr.innerHTML == html);
|
3628 |
+
tr = null;
|
3629 |
+
/*</ltFF4>*/
|
3630 |
+
|
3631 |
+
if (!supportsTableInnerHTML || !supportsTRInnerHTML || !supportsHTML5Elements){
|
3632 |
+
|
3633 |
+
Element.Properties.html.set = (function(set){
|
3634 |
+
|
3635 |
+
var translations = {
|
3636 |
+
table: [1, '<table>', '</table>'],
|
3637 |
+
select: [1, '<select>', '</select>'],
|
3638 |
+
tbody: [2, '<table><tbody>', '</tbody></table>'],
|
3639 |
+
tr: [3, '<table><tbody><tr>', '</tr></tbody></table>']
|
3640 |
+
};
|
3641 |
+
|
3642 |
+
translations.thead = translations.tfoot = translations.tbody;
|
3643 |
+
|
3644 |
+
return function(html){
|
3645 |
+
|
3646 |
+
/*<ltIE9>*/
|
3647 |
+
if (this.styleSheet) return set.call(this, html);
|
3648 |
+
/*</ltIE9>*/
|
3649 |
+
var wrap = translations[this.get('tag')];
|
3650 |
+
if (!wrap && !supportsHTML5Elements) wrap = [0, '', ''];
|
3651 |
+
if (!wrap) return set.call(this, html);
|
3652 |
+
|
3653 |
+
var level = wrap[0], wrapper = document.createElement('div'), target = wrapper;
|
3654 |
+
if (!supportsHTML5Elements) fragment.appendChild(wrapper);
|
3655 |
+
wrapper.innerHTML = [wrap[1], html, wrap[2]].flatten().join('');
|
3656 |
+
while (level--) target = target.firstChild;
|
3657 |
+
this.empty().adopt(target.childNodes);
|
3658 |
+
if (!supportsHTML5Elements) fragment.removeChild(wrapper);
|
3659 |
+
wrapper = null;
|
3660 |
+
};
|
3661 |
+
|
3662 |
+
})(Element.Properties.html.set);
|
3663 |
+
}
|
3664 |
+
/*</IE>*/
|
3665 |
+
|
3666 |
+
/*<ltIE9>*/
|
3667 |
+
var testForm = document.createElement('form');
|
3668 |
+
testForm.innerHTML = '<select><option>s</option></select>';
|
3669 |
+
|
3670 |
+
if (testForm.firstChild.value != 's') Element.Properties.value = {
|
3671 |
+
|
3672 |
+
set: function(value){
|
3673 |
+
var tag = this.get('tag');
|
3674 |
+
if (tag != 'select') return this.setProperty('value', value);
|
3675 |
+
var options = this.getElements('option');
|
3676 |
+
value = String(value);
|
3677 |
+
for (var i = 0; i < options.length; i++){
|
3678 |
+
var option = options[i],
|
3679 |
+
attr = option.getAttributeNode('value'),
|
3680 |
+
optionValue = (attr && attr.specified) ? option.value : option.get('text');
|
3681 |
+
if (optionValue === value) return option.selected = true;
|
3682 |
+
}
|
3683 |
+
},
|
3684 |
+
|
3685 |
+
get: function(){
|
3686 |
+
var option = this, tag = option.get('tag');
|
3687 |
+
|
3688 |
+
if (tag != 'select' && tag != 'option') return this.getProperty('value');
|
3689 |
+
|
3690 |
+
if (tag == 'select' && !(option = option.getSelected()[0])) return '';
|
3691 |
+
|
3692 |
+
var attr = option.getAttributeNode('value');
|
3693 |
+
return (attr && attr.specified) ? option.value : option.get('text');
|
3694 |
+
}
|
3695 |
+
|
3696 |
+
};
|
3697 |
+
testForm = null;
|
3698 |
+
/*</ltIE9>*/
|
3699 |
+
|
3700 |
+
/*<IE>*/
|
3701 |
+
if (document.createElement('div').getAttributeNode('id')) Element.Properties.id = {
|
3702 |
+
set: function(id){
|
3703 |
+
this.id = this.getAttributeNode('id').value = id;
|
3704 |
+
},
|
3705 |
+
get: function(){
|
3706 |
+
return this.id || null;
|
3707 |
+
},
|
3708 |
+
erase: function(){
|
3709 |
+
this.id = this.getAttributeNode('id').value = '';
|
3710 |
+
}
|
3711 |
+
};
|
3712 |
+
/*</IE>*/
|
3713 |
+
|
3714 |
+
})();
|
3715 |
+
|
3716 |
+
/*
|
3717 |
+
---
|
3718 |
+
|
3719 |
+
name: Event
|
3720 |
+
|
3721 |
+
description: Contains the Event Type, to make the event object cross-browser.
|
3722 |
+
|
3723 |
+
license: MIT-style license.
|
3724 |
+
|
3725 |
+
requires: [Window, Document, Array, Function, String, Object]
|
3726 |
+
|
3727 |
+
provides: Event
|
3728 |
+
|
3729 |
+
...
|
3730 |
+
*/
|
3731 |
+
|
3732 |
+
(function(){
|
3733 |
+
|
3734 |
+
var _keys = {};
|
3735 |
+
var normalizeWheelSpeed = function(event){
|
3736 |
+
var normalized;
|
3737 |
+
if (event.wheelDelta){
|
3738 |
+
normalized = event.wheelDelta % 120 == 0 ? event.wheelDelta / 120 : event.wheelDelta / 12;
|
3739 |
+
} else {
|
3740 |
+
var rawAmount = event.deltaY || event.detail || 0;
|
3741 |
+
normalized = -(rawAmount % 3 == 0 ? rawAmount / 3 : rawAmount * 10);
|
3742 |
+
}
|
3743 |
+
return normalized;
|
3744 |
+
}
|
3745 |
+
|
3746 |
+
var DOMEvent = this.DOMEvent = new Type('DOMEvent', function(event, win){
|
3747 |
+
if (!win) win = window;
|
3748 |
+
event = event || win.event;
|
3749 |
+
if (event.$extended) return event;
|
3750 |
+
this.event = event;
|
3751 |
+
this.$extended = true;
|
3752 |
+
this.shift = event.shiftKey;
|
3753 |
+
this.control = event.ctrlKey;
|
3754 |
+
this.alt = event.altKey;
|
3755 |
+
this.meta = event.metaKey;
|
3756 |
+
var type = this.type = event.type;
|
3757 |
+
var target = event.target || event.srcElement;
|
3758 |
+
while (target && target.nodeType == 3) target = target.parentNode;
|
3759 |
+
this.target = document.id(target);
|
3760 |
+
|
3761 |
+
if (type.indexOf('key') == 0){
|
3762 |
+
var code = this.code = (event.which || event.keyCode);
|
3763 |
+
if (!this.shift || type != 'keypress') this.key = _keys[code];
|
3764 |
+
if (type == 'keydown' || type == 'keyup'){
|
3765 |
+
if (code > 111 && code < 124) this.key = 'f' + (code - 111);
|
3766 |
+
else if (code > 95 && code < 106) this.key = code - 96;
|
3767 |
+
}
|
3768 |
+
if (this.key == null) this.key = String.fromCharCode(code).toLowerCase();
|
3769 |
+
} else if (type == 'click' || type == 'dblclick' || type == 'contextmenu' || type == 'wheel' || type == 'DOMMouseScroll' || type.indexOf('mouse') == 0){
|
3770 |
+
var doc = win.document;
|
3771 |
+
doc = (!doc.compatMode || doc.compatMode == 'CSS1Compat') ? doc.html : doc.body;
|
3772 |
+
this.page = {
|
3773 |
+
x: (event.pageX != null) ? event.pageX : event.clientX + doc.scrollLeft,
|
3774 |
+
y: (event.pageY != null) ? event.pageY : event.clientY + doc.scrollTop
|
3775 |
+
};
|
3776 |
+
this.client = {
|
3777 |
+
x: (event.pageX != null) ? event.pageX - win.pageXOffset : event.clientX,
|
3778 |
+
y: (event.pageY != null) ? event.pageY - win.pageYOffset : event.clientY
|
3779 |
+
};
|
3780 |
+
if (type == 'DOMMouseScroll' || type == 'wheel' || type == 'mousewheel') this.wheel = normalizeWheelSpeed(event);
|
3781 |
+
this.rightClick = (event.which == 3 || event.button == 2);
|
3782 |
+
if (type == 'mouseover' || type == 'mouseout' || type == 'mouseenter' || type == 'mouseleave'){
|
3783 |
+
var overTarget = type == 'mouseover' || type == 'mouseenter';
|
3784 |
+
var related = event.relatedTarget || event[(overTarget ? 'from' : 'to') + 'Element'];
|
3785 |
+
while (related && related.nodeType == 3) related = related.parentNode;
|
3786 |
+
this.relatedTarget = document.id(related);
|
3787 |
+
}
|
3788 |
+
} else if (type.indexOf('touch') == 0 || type.indexOf('gesture') == 0){
|
3789 |
+
this.rotation = event.rotation;
|
3790 |
+
this.scale = event.scale;
|
3791 |
+
this.targetTouches = event.targetTouches;
|
3792 |
+
this.changedTouches = event.changedTouches;
|
3793 |
+
var touches = this.touches = event.touches;
|
3794 |
+
if (touches && touches[0]){
|
3795 |
+
var touch = touches[0];
|
3796 |
+
this.page = {x: touch.pageX, y: touch.pageY};
|
3797 |
+
this.client = {x: touch.clientX, y: touch.clientY};
|
3798 |
+
}
|
3799 |
+
}
|
3800 |
+
|
3801 |
+
if (!this.client) this.client = {};
|
3802 |
+
if (!this.page) this.page = {};
|
3803 |
+
});
|
3804 |
+
|
3805 |
+
DOMEvent.implement({
|
3806 |
+
|
3807 |
+
stop: function(){
|
3808 |
+
return this.preventDefault().stopPropagation();
|
3809 |
+
},
|
3810 |
+
|
3811 |
+
stopPropagation: function(){
|
3812 |
+
if (this.event.stopPropagation) this.event.stopPropagation();
|
3813 |
+
else this.event.cancelBubble = true;
|
3814 |
+
return this;
|
3815 |
+
},
|
3816 |
+
|
3817 |
+
preventDefault: function(){
|
3818 |
+
if (this.event.preventDefault) this.event.preventDefault();
|
3819 |
+
else this.event.returnValue = false;
|
3820 |
+
return this;
|
3821 |
+
}
|
3822 |
+
|
3823 |
+
});
|
3824 |
+
|
3825 |
+
DOMEvent.defineKey = function(code, key){
|
3826 |
+
_keys[code] = key;
|
3827 |
+
return this;
|
3828 |
+
};
|
3829 |
+
|
3830 |
+
DOMEvent.defineKeys = DOMEvent.defineKey.overloadSetter(true);
|
3831 |
+
|
3832 |
+
DOMEvent.defineKeys({
|
3833 |
+
'38': 'up', '40': 'down', '37': 'left', '39': 'right',
|
3834 |
+
'27': 'esc', '32': 'space', '8': 'backspace', '9': 'tab',
|
3835 |
+
'46': 'delete', '13': 'enter'
|
3836 |
+
});
|
3837 |
+
|
3838 |
+
})();
|
3839 |
+
|
3840 |
+
|
3841 |
+
|
3842 |
+
|
3843 |
+
|
3844 |
+
/*
|
3845 |
+
---
|
3846 |
+
|
3847 |
+
name: Element.Event
|
3848 |
+
|
3849 |
+
description: Contains Element methods for dealing with events. This file also includes mouseenter and mouseleave custom Element Events, if necessary.
|
3850 |
+
|
3851 |
+
license: MIT-style license.
|
3852 |
+
|
3853 |
+
requires: [Element, Event]
|
3854 |
+
|
3855 |
+
provides: Element.Event
|
3856 |
+
|
3857 |
+
...
|
3858 |
+
*/
|
3859 |
+
|
3860 |
+
(function(){
|
3861 |
+
|
3862 |
+
Element.Properties.events = {set: function(events){
|
3863 |
+
this.addEvents(events);
|
3864 |
+
}};
|
3865 |
+
|
3866 |
+
[Element, Window, Document].invoke('implement', {
|
3867 |
+
|
3868 |
+
addEvent: function(type, fn){
|
3869 |
+
var events = this.retrieve('events', {});
|
3870 |
+
if (!events[type]) events[type] = {keys: [], values: []};
|
3871 |
+
if (events[type].keys.contains(fn)) return this;
|
3872 |
+
events[type].keys.push(fn);
|
3873 |
+
var realType = type,
|
3874 |
+
custom = Element.Events[type],
|
3875 |
+
condition = fn,
|
3876 |
+
self = this;
|
3877 |
+
if (custom){
|
3878 |
+
if (custom.onAdd) custom.onAdd.call(this, fn, type);
|
3879 |
+
if (custom.condition){
|
3880 |
+
condition = function(event){
|
3881 |
+
if (custom.condition.call(this, event, type)) return fn.call(this, event);
|
3882 |
+
return true;
|
3883 |
+
};
|
3884 |
+
}
|
3885 |
+
if (custom.base) realType = Function.from(custom.base).call(this, type);
|
3886 |
+
}
|
3887 |
+
var defn = function(){
|
3888 |
+
return fn.call(self);
|
3889 |
+
};
|
3890 |
+
var nativeEvent = Element.NativeEvents[realType];
|
3891 |
+
if (nativeEvent){
|
3892 |
+
if (nativeEvent == 2){
|
3893 |
+
defn = function(event){
|
3894 |
+
event = new DOMEvent(event, self.getWindow());
|
3895 |
+
if (condition.call(self, event) === false) event.stop();
|
3896 |
+
};
|
3897 |
+
}
|
3898 |
+
this.addListener(realType, defn, arguments[2]);
|
3899 |
+
}
|
3900 |
+
events[type].values.push(defn);
|
3901 |
+
return this;
|
3902 |
+
},
|
3903 |
+
|
3904 |
+
removeEvent: function(type, fn){
|
3905 |
+
var events = this.retrieve('events');
|
3906 |
+
if (!events || !events[type]) return this;
|
3907 |
+
var list = events[type];
|
3908 |
+
var index = list.keys.indexOf(fn);
|
3909 |
+
if (index == -1) return this;
|
3910 |
+
var value = list.values[index];
|
3911 |
+
delete list.keys[index];
|
3912 |
+
delete list.values[index];
|
3913 |
+
var custom = Element.Events[type];
|
3914 |
+
if (custom){
|
3915 |
+
if (custom.onRemove) custom.onRemove.call(this, fn, type);
|
3916 |
+
if (custom.base) type = Function.from(custom.base).call(this, type);
|
3917 |
+
}
|
3918 |
+
return (Element.NativeEvents[type]) ? this.removeListener(type, value, arguments[2]) : this;
|
3919 |
+
},
|
3920 |
+
|
3921 |
+
addEvents: function(events){
|
3922 |
+
for (var event in events) this.addEvent(event, events[event]);
|
3923 |
+
return this;
|
3924 |
+
},
|
3925 |
+
|
3926 |
+
removeEvents: function(events){
|
3927 |
+
var type;
|
3928 |
+
if (typeOf(events) == 'object'){
|
3929 |
+
for (type in events) this.removeEvent(type, events[type]);
|
3930 |
+
return this;
|
3931 |
+
}
|
3932 |
+
var attached = this.retrieve('events');
|
3933 |
+
if (!attached) return this;
|
3934 |
+
if (!events){
|
3935 |
+
for (type in attached) this.removeEvents(type);
|
3936 |
+
this.eliminate('events');
|
3937 |
+
} else if (attached[events]){
|
3938 |
+
attached[events].keys.each(function(fn){
|
3939 |
+
this.removeEvent(events, fn);
|
3940 |
+
}, this);
|
3941 |
+
delete attached[events];
|
3942 |
+
}
|
3943 |
+
return this;
|
3944 |
+
},
|
3945 |
+
|
3946 |
+
fireEvent: function(type, args, delay){
|
3947 |
+
var events = this.retrieve('events');
|
3948 |
+
if (!events || !events[type]) return this;
|
3949 |
+
args = Array.from(args);
|
3950 |
+
|
3951 |
+
events[type].keys.each(function(fn){
|
3952 |
+
if (delay) fn.delay(delay, this, args);
|
3953 |
+
else fn.apply(this, args);
|
3954 |
+
}, this);
|
3955 |
+
return this;
|
3956 |
+
},
|
3957 |
+
|
3958 |
+
cloneEvents: function(from, type){
|
3959 |
+
from = document.id(from);
|
3960 |
+
var events = from.retrieve('events');
|
3961 |
+
if (!events) return this;
|
3962 |
+
if (!type){
|
3963 |
+
for (var eventType in events) this.cloneEvents(from, eventType);
|
3964 |
+
} else if (events[type]){
|
3965 |
+
events[type].keys.each(function(fn){
|
3966 |
+
this.addEvent(type, fn);
|
3967 |
+
}, this);
|
3968 |
+
}
|
3969 |
+
return this;
|
3970 |
+
}
|
3971 |
+
|
3972 |
+
});
|
3973 |
+
|
3974 |
+
Element.NativeEvents = {
|
3975 |
+
click: 2, dblclick: 2, mouseup: 2, mousedown: 2, contextmenu: 2, //mouse buttons
|
3976 |
+
wheel: 2, mousewheel: 2, DOMMouseScroll: 2, //mouse wheel
|
3977 |
+
mouseover: 2, mouseout: 2, mousemove: 2, selectstart: 2, selectend: 2, //mouse movement
|
3978 |
+
keydown: 2, keypress: 2, keyup: 2, //keyboard
|
3979 |
+
orientationchange: 2, // mobile
|
3980 |
+
touchstart: 2, touchmove: 2, touchend: 2, touchcancel: 2, // touch
|
3981 |
+
gesturestart: 2, gesturechange: 2, gestureend: 2, // gesture
|
3982 |
+
focus: 2, blur: 2, change: 2, reset: 2, select: 2, submit: 2, paste: 2, input: 2, //form elements
|
3983 |
+
load: 2, unload: 1, beforeunload: 2, resize: 1, move: 1, DOMContentLoaded: 1, readystatechange: 1, //window
|
3984 |
+
hashchange: 1, popstate: 2, pageshow: 2, pagehide: 2, // history
|
3985 |
+
error: 1, abort: 1, scroll: 1, message: 2 //misc
|
3986 |
+
};
|
3987 |
+
|
3988 |
+
Element.Events = {
|
3989 |
+
mousewheel: {
|
3990 |
+
base: 'onwheel' in document ? 'wheel' : 'onmousewheel' in document ? 'mousewheel' : 'DOMMouseScroll'
|
3991 |
+
}
|
3992 |
+
};
|
3993 |
+
|
3994 |
+
var check = function(event){
|
3995 |
+
var related = event.relatedTarget;
|
3996 |
+
if (related == null) return true;
|
3997 |
+
if (!related) return false;
|
3998 |
+
return (related != this && related.prefix != 'xul' && typeOf(this) != 'document' && !this.contains(related));
|
3999 |
+
};
|
4000 |
+
|
4001 |
+
if ('onmouseenter' in document.documentElement){
|
4002 |
+
Element.NativeEvents.mouseenter = Element.NativeEvents.mouseleave = 2;
|
4003 |
+
Element.MouseenterCheck = check;
|
4004 |
+
} else {
|
4005 |
+
Element.Events.mouseenter = {
|
4006 |
+
base: 'mouseover',
|
4007 |
+
condition: check
|
4008 |
+
};
|
4009 |
+
|
4010 |
+
Element.Events.mouseleave = {
|
4011 |
+
base: 'mouseout',
|
4012 |
+
condition: check
|
4013 |
+
};
|
4014 |
+
}
|
4015 |
+
|
4016 |
+
/*<ltIE9>*/
|
4017 |
+
if (!window.addEventListener){
|
4018 |
+
Element.NativeEvents.propertychange = 2;
|
4019 |
+
Element.Events.change = {
|
4020 |
+
base: function(){
|
4021 |
+
var type = this.type;
|
4022 |
+
return (this.get('tag') == 'input' && (type == 'radio' || type == 'checkbox')) ? 'propertychange' : 'change';
|
4023 |
+
},
|
4024 |
+
condition: function(event){
|
4025 |
+
return event.type != 'propertychange' || event.event.propertyName == 'checked';
|
4026 |
+
}
|
4027 |
+
};
|
4028 |
+
}
|
4029 |
+
/*</ltIE9>*/
|
4030 |
+
|
4031 |
+
|
4032 |
+
|
4033 |
+
})();
|
4034 |
+
|
4035 |
+
/*
|
4036 |
+
---
|
4037 |
+
|
4038 |
+
name: Element.Delegation
|
4039 |
+
|
4040 |
+
description: Extends the Element native object to include the delegate method for more efficient event management.
|
4041 |
+
|
4042 |
+
license: MIT-style license.
|
4043 |
+
|
4044 |
+
requires: [Element.Event]
|
4045 |
+
|
4046 |
+
provides: [Element.Delegation]
|
4047 |
+
|
4048 |
+
...
|
4049 |
+
*/
|
4050 |
+
|
4051 |
+
(function(){
|
4052 |
+
|
4053 |
+
var eventListenerSupport = !!window.addEventListener;
|
4054 |
+
|
4055 |
+
Element.NativeEvents.focusin = Element.NativeEvents.focusout = 2;
|
4056 |
+
|
4057 |
+
var bubbleUp = function(self, match, fn, event, target){
|
4058 |
+
while (target && target != self){
|
4059 |
+
if (match(target, event)) return fn.call(target, event, target);
|
4060 |
+
target = document.id(target.parentNode);
|
4061 |
+
}
|
4062 |
+
};
|
4063 |
+
|
4064 |
+
var map = {
|
4065 |
+
mouseenter: {
|
4066 |
+
base: 'mouseover',
|
4067 |
+
condition: Element.MouseenterCheck
|
4068 |
+
},
|
4069 |
+
mouseleave: {
|
4070 |
+
base: 'mouseout',
|
4071 |
+
condition: Element.MouseenterCheck
|
4072 |
+
},
|
4073 |
+
focus: {
|
4074 |
+
base: 'focus' + (eventListenerSupport ? '' : 'in'),
|
4075 |
+
capture: true
|
4076 |
+
},
|
4077 |
+
blur: {
|
4078 |
+
base: eventListenerSupport ? 'blur' : 'focusout',
|
4079 |
+
capture: true
|
4080 |
+
}
|
4081 |
+
};
|
4082 |
+
|
4083 |
+
/*<ltIE9>*/
|
4084 |
+
var _key = '$delegation:';
|
4085 |
+
var formObserver = function(type){
|
4086 |
+
|
4087 |
+
return {
|
4088 |
+
|
4089 |
+
base: 'focusin',
|
4090 |
+
|
4091 |
+
remove: function(self, uid){
|
4092 |
+
var list = self.retrieve(_key + type + 'listeners', {})[uid];
|
4093 |
+
if (list && list.forms) for (var i = list.forms.length; i--;){
|
4094 |
+
// the form may have been destroyed, so it won't have the
|
4095 |
+
// removeEvent method anymore. In that case the event was
|
4096 |
+
// removed as well.
|
4097 |
+
if (list.forms[i].removeEvent) list.forms[i].removeEvent(type, list.fns[i]);
|
4098 |
+
}
|
4099 |
+
},
|
4100 |
+
|
4101 |
+
listen: function(self, match, fn, event, target, uid){
|
4102 |
+
var form = (target.get('tag') == 'form') ? target : event.target.getParent('form');
|
4103 |
+
if (!form) return;
|
4104 |
+
|
4105 |
+
var listeners = self.retrieve(_key + type + 'listeners', {}),
|
4106 |
+
listener = listeners[uid] || {forms: [], fns: []},
|
4107 |
+
forms = listener.forms, fns = listener.fns;
|
4108 |
+
|
4109 |
+
if (forms.indexOf(form) != -1) return;
|
4110 |
+
forms.push(form);
|
4111 |
+
|
4112 |
+
var _fn = function(event){
|
4113 |
+
bubbleUp(self, match, fn, event, target);
|
4114 |
+
};
|
4115 |
+
form.addEvent(type, _fn);
|
4116 |
+
fns.push(_fn);
|
4117 |
+
|
4118 |
+
listeners[uid] = listener;
|
4119 |
+
self.store(_key + type + 'listeners', listeners);
|
4120 |
+
}
|
4121 |
+
};
|
4122 |
+
};
|
4123 |
+
|
4124 |
+
var inputObserver = function(type){
|
4125 |
+
return {
|
4126 |
+
base: 'focusin',
|
4127 |
+
listen: function(self, match, fn, event, target){
|
4128 |
+
var events = {blur: function(){
|
4129 |
+
this.removeEvents(events);
|
4130 |
+
}};
|
4131 |
+
events[type] = function(event){
|
4132 |
+
bubbleUp(self, match, fn, event, target);
|
4133 |
+
};
|
4134 |
+
event.target.addEvents(events);
|
4135 |
+
}
|
4136 |
+
};
|
4137 |
+
};
|
4138 |
+
|
4139 |
+
if (!eventListenerSupport) Object.append(map, {
|
4140 |
+
submit: formObserver('submit'),
|
4141 |
+
reset: formObserver('reset'),
|
4142 |
+
change: inputObserver('change'),
|
4143 |
+
select: inputObserver('select')
|
4144 |
+
});
|
4145 |
+
/*</ltIE9>*/
|
4146 |
+
|
4147 |
+
var proto = Element.prototype,
|
4148 |
+
addEvent = proto.addEvent,
|
4149 |
+
removeEvent = proto.removeEvent;
|
4150 |
+
|
4151 |
+
var relay = function(old, method){
|
4152 |
+
return function(type, fn, useCapture){
|
4153 |
+
if (type.indexOf(':relay') == -1) return old.call(this, type, fn, useCapture);
|
4154 |
+
var parsed = Slick.parse(type).expressions[0][0];
|
4155 |
+
if (parsed.pseudos[0].key != 'relay') return old.call(this, type, fn, useCapture);
|
4156 |
+
var newType = parsed.tag;
|
4157 |
+
parsed.pseudos.slice(1).each(function(pseudo){
|
4158 |
+
newType += ':' + pseudo.key + (pseudo.value ? '(' + pseudo.value + ')' : '');
|
4159 |
+
});
|
4160 |
+
old.call(this, type, fn);
|
4161 |
+
return method.call(this, newType, parsed.pseudos[0].value, fn);
|
4162 |
+
};
|
4163 |
+
};
|
4164 |
+
|
4165 |
+
var delegation = {
|
4166 |
+
|
4167 |
+
addEvent: function(type, match, fn){
|
4168 |
+
var storage = this.retrieve('$delegates', {}), stored = storage[type];
|
4169 |
+
if (stored) for (var _uid in stored){
|
4170 |
+
if (stored[_uid].fn == fn && stored[_uid].match == match) return this;
|
4171 |
+
}
|
4172 |
+
|
4173 |
+
var _type = type, _match = match, _fn = fn, _map = map[type] || {};
|
4174 |
+
type = _map.base || _type;
|
4175 |
+
|
4176 |
+
match = function(target){
|
4177 |
+
return Slick.match(target, _match);
|
4178 |
+
};
|
4179 |
+
|
4180 |
+
var elementEvent = Element.Events[_type];
|
4181 |
+
if (_map.condition || elementEvent && elementEvent.condition){
|
4182 |
+
var __match = match, condition = _map.condition || elementEvent.condition;
|
4183 |
+
match = function(target, event){
|
4184 |
+
return __match(target, event) && condition.call(target, event, type);
|
4185 |
+
};
|
4186 |
+
}
|
4187 |
+
|
4188 |
+
var self = this, uid = String.uniqueID();
|
4189 |
+
var delegator = _map.listen ? function(event, target){
|
4190 |
+
if (!target && event && event.target) target = event.target;
|
4191 |
+
if (target) _map.listen(self, match, fn, event, target, uid);
|
4192 |
+
} : function(event, target){
|
4193 |
+
if (!target && event && event.target) target = event.target;
|
4194 |
+
if (target) bubbleUp(self, match, fn, event, target);
|
4195 |
+
};
|
4196 |
+
|
4197 |
+
if (!stored) stored = {};
|
4198 |
+
stored[uid] = {
|
4199 |
+
match: _match,
|
4200 |
+
fn: _fn,
|
4201 |
+
delegator: delegator
|
4202 |
+
};
|
4203 |
+
storage[_type] = stored;
|
4204 |
+
return addEvent.call(this, type, delegator, _map.capture);
|
4205 |
+
},
|
4206 |
+
|
4207 |
+
removeEvent: function(type, match, fn, _uid){
|
4208 |
+
var storage = this.retrieve('$delegates', {}), stored = storage[type];
|
4209 |
+
if (!stored) return this;
|
4210 |
+
|
4211 |
+
if (_uid){
|
4212 |
+
var _type = type, delegator = stored[_uid].delegator, _map = map[type] || {};
|
4213 |
+
type = _map.base || _type;
|
4214 |
+
if (_map.remove) _map.remove(this, _uid);
|
4215 |
+
delete stored[_uid];
|
4216 |
+
storage[_type] = stored;
|
4217 |
+
return removeEvent.call(this, type, delegator, _map.capture);
|
4218 |
+
}
|
4219 |
+
|
4220 |
+
var __uid, s;
|
4221 |
+
if (fn) for (__uid in stored){
|
4222 |
+
s = stored[__uid];
|
4223 |
+
if (s.match == match && s.fn == fn) return delegation.removeEvent.call(this, type, match, fn, __uid);
|
4224 |
+
} else for (__uid in stored){
|
4225 |
+
s = stored[__uid];
|
4226 |
+
if (s.match == match) delegation.removeEvent.call(this, type, match, s.fn, __uid);
|
4227 |
+
}
|
4228 |
+
return this;
|
4229 |
+
}
|
4230 |
+
|
4231 |
+
};
|
4232 |
+
|
4233 |
+
[Element, Window, Document].invoke('implement', {
|
4234 |
+
addEvent: relay(addEvent, delegation.addEvent),
|
4235 |
+
removeEvent: relay(removeEvent, delegation.removeEvent)
|
4236 |
+
});
|
4237 |
+
|
4238 |
+
})();
|
4239 |
+
|
4240 |
+
/*
|
4241 |
+
---
|
4242 |
+
|
4243 |
+
name: Element.Style
|
4244 |
+
|
4245 |
+
description: Contains methods for interacting with the styles of Elements in a fashionable way.
|
4246 |
+
|
4247 |
+
license: MIT-style license.
|
4248 |
+
|
4249 |
+
requires: Element
|
4250 |
+
|
4251 |
+
provides: Element.Style
|
4252 |
+
|
4253 |
+
...
|
4254 |
+
*/
|
4255 |
+
|
4256 |
+
(function(){
|
4257 |
+
|
4258 |
+
var html = document.html, el;
|
4259 |
+
|
4260 |
+
//<ltIE9>
|
4261 |
+
// Check for oldIE, which does not remove styles when they're set to null
|
4262 |
+
el = document.createElement('div');
|
4263 |
+
el.style.color = 'red';
|
4264 |
+
el.style.color = null;
|
4265 |
+
var doesNotRemoveStyles = el.style.color == 'red';
|
4266 |
+
|
4267 |
+
// check for oldIE, which returns border* shorthand styles in the wrong order (color-width-style instead of width-style-color)
|
4268 |
+
var border = '1px solid #123abc';
|
4269 |
+
el.style.border = border;
|
4270 |
+
var returnsBordersInWrongOrder = el.style.border != border;
|
4271 |
+
el = null;
|
4272 |
+
//</ltIE9>
|
4273 |
+
|
4274 |
+
var hasGetComputedStyle = !!window.getComputedStyle,
|
4275 |
+
supportBorderRadius = document.createElement('div').style.borderRadius != null;
|
4276 |
+
|
4277 |
+
Element.Properties.styles = {set: function(styles){
|
4278 |
+
this.setStyles(styles);
|
4279 |
+
}};
|
4280 |
+
|
4281 |
+
var hasOpacity = (html.style.opacity != null),
|
4282 |
+
hasFilter = (html.style.filter != null),
|
4283 |
+
reAlpha = /alpha\(opacity=([\d.]+)\)/i;
|
4284 |
+
|
4285 |
+
var setVisibility = function(element, opacity){
|
4286 |
+
element.store('$opacity', opacity);
|
4287 |
+
element.style.visibility = opacity > 0 || opacity == null ? 'visible' : 'hidden';
|
4288 |
+
};
|
4289 |
+
|
4290 |
+
//<ltIE9>
|
4291 |
+
var setFilter = function(element, regexp, value){
|
4292 |
+
var style = element.style,
|
4293 |
+
filter = style.filter || element.getComputedStyle('filter') || '';
|
4294 |
+
style.filter = (regexp.test(filter) ? filter.replace(regexp, value) : filter + ' ' + value).trim();
|
4295 |
+
if (!style.filter) style.removeAttribute('filter');
|
4296 |
+
};
|
4297 |
+
//</ltIE9>
|
4298 |
+
|
4299 |
+
var setOpacity = (hasOpacity ? function(element, opacity){
|
4300 |
+
element.style.opacity = opacity;
|
4301 |
+
} : (hasFilter ? function(element, opacity){
|
4302 |
+
if (!element.currentStyle || !element.currentStyle.hasLayout) element.style.zoom = 1;
|
4303 |
+
if (opacity == null || opacity == 1){
|
4304 |
+
setFilter(element, reAlpha, '');
|
4305 |
+
if (opacity == 1 && getOpacity(element) != 1) setFilter(element, reAlpha, 'alpha(opacity=100)');
|
4306 |
+
} else {
|
4307 |
+
setFilter(element, reAlpha, 'alpha(opacity=' + (opacity * 100).limit(0, 100).round() + ')');
|
4308 |
+
}
|
4309 |
+
} : setVisibility));
|
4310 |
+
|
4311 |
+
var getOpacity = (hasOpacity ? function(element){
|
4312 |
+
var opacity = element.style.opacity || element.getComputedStyle('opacity');
|
4313 |
+
return (opacity == '') ? 1 : opacity.toFloat();
|
4314 |
+
} : (hasFilter ? function(element){
|
4315 |
+
var filter = (element.style.filter || element.getComputedStyle('filter')),
|
4316 |
+
opacity;
|
4317 |
+
if (filter) opacity = filter.match(reAlpha);
|
4318 |
+
return (opacity == null || filter == null) ? 1 : (opacity[1] / 100);
|
4319 |
+
} : function(element){
|
4320 |
+
var opacity = element.retrieve('$opacity');
|
4321 |
+
if (opacity == null) opacity = (element.style.visibility == 'hidden' ? 0 : 1);
|
4322 |
+
return opacity;
|
4323 |
+
}));
|
4324 |
+
|
4325 |
+
var floatName = (html.style.cssFloat == null) ? 'styleFloat' : 'cssFloat',
|
4326 |
+
namedPositions = {left: '0%', top: '0%', center: '50%', right: '100%', bottom: '100%'},
|
4327 |
+
hasBackgroundPositionXY = (html.style.backgroundPositionX != null),
|
4328 |
+
prefixPattern = /^-(ms)-/;
|
4329 |
+
|
4330 |
+
var camelCase = function(property){
|
4331 |
+
return property.replace(prefixPattern, '$1-').camelCase();
|
4332 |
+
}
|
4333 |
+
|
4334 |
+
//<ltIE9>
|
4335 |
+
var removeStyle = function(style, property){
|
4336 |
+
if (property == 'backgroundPosition'){
|
4337 |
+
style.removeAttribute(property + 'X');
|
4338 |
+
property += 'Y';
|
4339 |
+
}
|
4340 |
+
style.removeAttribute(property);
|
4341 |
+
};
|
4342 |
+
//</ltIE9>
|
4343 |
+
|
4344 |
+
Element.implement({
|
4345 |
+
|
4346 |
+
getComputedStyle: function(property){
|
4347 |
+
if (!hasGetComputedStyle && this.currentStyle) return this.currentStyle[camelCase(property)];
|
4348 |
+
var defaultView = Element.getDocument(this).defaultView,
|
4349 |
+
computed = defaultView ? defaultView.getComputedStyle(this, null) : null;
|
4350 |
+
return (computed) ? computed.getPropertyValue((property == floatName) ? 'float' : property.hyphenate()) : '';
|
4351 |
+
},
|
4352 |
+
|
4353 |
+
setStyle: function(property, value){
|
4354 |
+
if (property == 'opacity'){
|
4355 |
+
if (value != null) value = parseFloat(value);
|
4356 |
+
setOpacity(this, value);
|
4357 |
+
return this;
|
4358 |
+
}
|
4359 |
+
property = camelCase(property == 'float' ? floatName : property);
|
4360 |
+
if (typeOf(value) != 'string'){
|
4361 |
+
var map = (Element.Styles[property] || '@').split(' ');
|
4362 |
+
value = Array.from(value).map(function(val, i){
|
4363 |
+
if (!map[i]) return '';
|
4364 |
+
return (typeOf(val) == 'number') ? map[i].replace('@', Math.round(val)) : val;
|
4365 |
+
}).join(' ');
|
4366 |
+
} else if (value == String(Number(value))){
|
4367 |
+
value = Math.round(value);
|
4368 |
+
}
|
4369 |
+
this.style[property] = value;
|
4370 |
+
//<ltIE9>
|
4371 |
+
if ((value == '' || value == null) && doesNotRemoveStyles && this.style.removeAttribute){
|
4372 |
+
removeStyle(this.style, property);
|
4373 |
+
}
|
4374 |
+
//</ltIE9>
|
4375 |
+
return this;
|
4376 |
+
},
|
4377 |
+
|
4378 |
+
getStyle: function(property){
|
4379 |
+
if (property == 'opacity') return getOpacity(this);
|
4380 |
+
property = camelCase(property == 'float' ? floatName : property);
|
4381 |
+
if (supportBorderRadius && property.indexOf('borderRadius') != -1){
|
4382 |
+
return ['borderTopLeftRadius', 'borderTopRightRadius', 'borderBottomRightRadius', 'borderBottomLeftRadius'].map(function(corner){
|
4383 |
+
return this.style[corner] || '0px';
|
4384 |
+
}, this).join(' ');
|
4385 |
+
}
|
4386 |
+
var result = this.style[property];
|
4387 |
+
if (!result || property == 'zIndex'){
|
4388 |
+
if (Element.ShortStyles.hasOwnProperty(property)){
|
4389 |
+
result = [];
|
4390 |
+
for (var s in Element.ShortStyles[property]) result.push(this.getStyle(s));
|
4391 |
+
return result.join(' ');
|
4392 |
+
}
|
4393 |
+
result = this.getComputedStyle(property);
|
4394 |
+
}
|
4395 |
+
if (hasBackgroundPositionXY && /^backgroundPosition[XY]?$/.test(property)){
|
4396 |
+
return result.replace(/(top|right|bottom|left)/g, function(position){
|
4397 |
+
return namedPositions[position];
|
4398 |
+
}) || '0px';
|
4399 |
+
}
|
4400 |
+
if (!result && property == 'backgroundPosition') return '0px 0px';
|
4401 |
+
if (result){
|
4402 |
+
result = String(result);
|
4403 |
+
var color = result.match(/rgba?\([\d\s,]+\)/);
|
4404 |
+
if (color) result = result.replace(color[0], color[0].rgbToHex());
|
4405 |
+
}
|
4406 |
+
if (!hasGetComputedStyle && !this.style[property]){
|
4407 |
+
if ((/^(height|width)$/).test(property) && !(/px$/.test(result))){
|
4408 |
+
var values = (property == 'width') ? ['left', 'right'] : ['top', 'bottom'], size = 0;
|
4409 |
+
values.each(function(value){
|
4410 |
+
size += this.getStyle('border-' + value + '-width').toInt() + this.getStyle('padding-' + value).toInt();
|
4411 |
+
}, this);
|
4412 |
+
return this['offset' + property.capitalize()] - size + 'px';
|
4413 |
+
}
|
4414 |
+
if ((/^border(.+)Width|margin|padding/).test(property) && isNaN(parseFloat(result))){
|
4415 |
+
return '0px';
|
4416 |
+
}
|
4417 |
+
}
|
4418 |
+
//<ltIE9>
|
4419 |
+
if (returnsBordersInWrongOrder && /^border(Top|Right|Bottom|Left)?$/.test(property) && /^#/.test(result)){
|
4420 |
+
return result.replace(/^(.+)\s(.+)\s(.+)$/, '$2 $3 $1');
|
4421 |
+
}
|
4422 |
+
//</ltIE9>
|
4423 |
+
|
4424 |
+
return result;
|
4425 |
+
},
|
4426 |
+
|
4427 |
+
setStyles: function(styles){
|
4428 |
+
for (var style in styles) this.setStyle(style, styles[style]);
|
4429 |
+
return this;
|
4430 |
+
},
|
4431 |
+
|
4432 |
+
getStyles: function(){
|
4433 |
+
var result = {};
|
4434 |
+
Array.flatten(arguments).each(function(key){
|
4435 |
+
result[key] = this.getStyle(key);
|
4436 |
+
}, this);
|
4437 |
+
return result;
|
4438 |
+
}
|
4439 |
+
|
4440 |
+
});
|
4441 |
+
|
4442 |
+
Element.Styles = {
|
4443 |
+
left: '@px', top: '@px', bottom: '@px', right: '@px',
|
4444 |
+
width: '@px', height: '@px', maxWidth: '@px', maxHeight: '@px', minWidth: '@px', minHeight: '@px',
|
4445 |
+
backgroundColor: 'rgb(@, @, @)', backgroundSize: '@px', backgroundPosition: '@px @px', color: 'rgb(@, @, @)',
|
4446 |
+
fontSize: '@px', letterSpacing: '@px', lineHeight: '@px', clip: 'rect(@px @px @px @px)',
|
4447 |
+
margin: '@px @px @px @px', padding: '@px @px @px @px', border: '@px @ rgb(@, @, @) @px @ rgb(@, @, @) @px @ rgb(@, @, @)',
|
4448 |
+
borderWidth: '@px @px @px @px', borderStyle: '@ @ @ @', borderColor: 'rgb(@, @, @) rgb(@, @, @) rgb(@, @, @) rgb(@, @, @)',
|
4449 |
+
zIndex: '@', 'zoom': '@', fontWeight: '@', textIndent: '@px', opacity: '@', borderRadius: '@px @px @px @px'
|
4450 |
+
};
|
4451 |
+
|
4452 |
+
|
4453 |
+
|
4454 |
+
|
4455 |
+
|
4456 |
+
Element.ShortStyles = {margin: {}, padding: {}, border: {}, borderWidth: {}, borderStyle: {}, borderColor: {}};
|
4457 |
+
|
4458 |
+
['Top', 'Right', 'Bottom', 'Left'].each(function(direction){
|
4459 |
+
var Short = Element.ShortStyles;
|
4460 |
+
var All = Element.Styles;
|
4461 |
+
['margin', 'padding'].each(function(style){
|
4462 |
+
var sd = style + direction;
|
4463 |
+
Short[style][sd] = All[sd] = '@px';
|
4464 |
+
});
|
4465 |
+
var bd = 'border' + direction;
|
4466 |
+
Short.border[bd] = All[bd] = '@px @ rgb(@, @, @)';
|
4467 |
+
var bdw = bd + 'Width', bds = bd + 'Style', bdc = bd + 'Color';
|
4468 |
+
Short[bd] = {};
|
4469 |
+
Short.borderWidth[bdw] = Short[bd][bdw] = All[bdw] = '@px';
|
4470 |
+
Short.borderStyle[bds] = Short[bd][bds] = All[bds] = '@';
|
4471 |
+
Short.borderColor[bdc] = Short[bd][bdc] = All[bdc] = 'rgb(@, @, @)';
|
4472 |
+
});
|
4473 |
+
|
4474 |
+
if (hasBackgroundPositionXY) Element.ShortStyles.backgroundPosition = {backgroundPositionX: '@', backgroundPositionY: '@'};
|
4475 |
+
})();
|
4476 |
+
|
4477 |
+
/*
|
4478 |
+
---
|
4479 |
+
|
4480 |
+
name: Element.Dimensions
|
4481 |
+
|
4482 |
+
description: Contains methods to work with size, scroll, or positioning of Elements and the window object.
|
4483 |
+
|
4484 |
+
license: MIT-style license.
|
4485 |
+
|
4486 |
+
credits:
|
4487 |
+
- Element positioning based on the [qooxdoo](http://qooxdoo.org/) code and smart browser fixes, [LGPL License](http://www.gnu.org/licenses/lgpl.html).
|
4488 |
+
- Viewport dimensions based on [YUI](http://developer.yahoo.com/yui/) code, [BSD License](http://developer.yahoo.com/yui/license.html).
|
4489 |
+
|
4490 |
+
requires: [Element, Element.Style]
|
4491 |
+
|
4492 |
+
provides: [Element.Dimensions]
|
4493 |
+
|
4494 |
+
...
|
4495 |
+
*/
|
4496 |
+
|
4497 |
+
(function(){
|
4498 |
+
|
4499 |
+
var element = document.createElement('div'),
|
4500 |
+
child = document.createElement('div');
|
4501 |
+
element.style.height = '0';
|
4502 |
+
element.appendChild(child);
|
4503 |
+
var brokenOffsetParent = (child.offsetParent === element);
|
4504 |
+
element = child = null;
|
4505 |
+
|
4506 |
+
var heightComponents = ['height', 'paddingTop', 'paddingBottom', 'borderTopWidth', 'borderBottomWidth'],
|
4507 |
+
widthComponents = ['width', 'paddingLeft', 'paddingRight', 'borderLeftWidth', 'borderRightWidth'];
|
4508 |
+
|
4509 |
+
var svgCalculateSize = function(el){
|
4510 |
+
|
4511 |
+
var gCS = window.getComputedStyle(el),
|
4512 |
+
bounds = {x: 0, y: 0};
|
4513 |
+
|
4514 |
+
heightComponents.each(function(css){
|
4515 |
+
bounds.y += parseFloat(gCS[css]);
|
4516 |
+
});
|
4517 |
+
widthComponents.each(function(css){
|
4518 |
+
bounds.x += parseFloat(gCS[css]);
|
4519 |
+
});
|
4520 |
+
return bounds;
|
4521 |
+
};
|
4522 |
+
|
4523 |
+
var isOffset = function(el){
|
4524 |
+
return styleString(el, 'position') != 'static' || isBody(el);
|
4525 |
+
};
|
4526 |
+
|
4527 |
+
var isOffsetStatic = function(el){
|
4528 |
+
return isOffset(el) || (/^(?:table|td|th)$/i).test(el.tagName);
|
4529 |
+
};
|
4530 |
+
|
4531 |
+
Element.implement({
|
4532 |
+
|
4533 |
+
scrollTo: function(x, y){
|
4534 |
+
if (isBody(this)){
|
4535 |
+
this.getWindow().scrollTo(x, y);
|
4536 |
+
} else {
|
4537 |
+
this.scrollLeft = x;
|
4538 |
+
this.scrollTop = y;
|
4539 |
+
}
|
4540 |
+
return this;
|
4541 |
+
},
|
4542 |
+
|
4543 |
+
getSize: function(){
|
4544 |
+
if (isBody(this)) return this.getWindow().getSize();
|
4545 |
+
|
4546 |
+
//<ltIE9>
|
4547 |
+
// This if clause is because IE8- cannot calculate getBoundingClientRect of elements with visibility hidden.
|
4548 |
+
if (!window.getComputedStyle) return {x: this.offsetWidth, y: this.offsetHeight};
|
4549 |
+
//</ltIE9>
|
4550 |
+
|
4551 |
+
// This svg section under, calling `svgCalculateSize()`, can be removed when FF fixed the svg size bug.
|
4552 |
+
// Bug info: https://bugzilla.mozilla.org/show_bug.cgi?id=530985
|
4553 |
+
if (this.get('tag') == 'svg') return svgCalculateSize(this);
|
4554 |
+
|
4555 |
+
try {
|
4556 |
+
var bounds = this.getBoundingClientRect();
|
4557 |
+
return {x: bounds.width, y: bounds.height};
|
4558 |
+
} catch(e) {
|
4559 |
+
return {x: 0, y: 0};
|
4560 |
+
}
|
4561 |
+
},
|
4562 |
+
|
4563 |
+
getScrollSize: function(){
|
4564 |
+
if (isBody(this)) return this.getWindow().getScrollSize();
|
4565 |
+
return {x: this.scrollWidth, y: this.scrollHeight};
|
4566 |
+
},
|
4567 |
+
|
4568 |
+
getScroll: function(){
|
4569 |
+
if (isBody(this)) return this.getWindow().getScroll();
|
4570 |
+
return {x: this.scrollLeft, y: this.scrollTop};
|
4571 |
+
},
|
4572 |
+
|
4573 |
+
getScrolls: function(){
|
4574 |
+
var element = this.parentNode, position = {x: 0, y: 0};
|
4575 |
+
while (element && !isBody(element)){
|
4576 |
+
position.x += element.scrollLeft;
|
4577 |
+
position.y += element.scrollTop;
|
4578 |
+
element = element.parentNode;
|
4579 |
+
}
|
4580 |
+
return position;
|
4581 |
+
},
|
4582 |
+
|
4583 |
+
getOffsetParent: brokenOffsetParent ? function(){
|
4584 |
+
var element = this;
|
4585 |
+
if (isBody(element) || styleString(element, 'position') == 'fixed') return null;
|
4586 |
+
|
4587 |
+
var isOffsetCheck = (styleString(element, 'position') == 'static') ? isOffsetStatic : isOffset;
|
4588 |
+
while ((element = element.parentNode)){
|
4589 |
+
if (isOffsetCheck(element)) return element;
|
4590 |
+
}
|
4591 |
+
return null;
|
4592 |
+
} : function(){
|
4593 |
+
var element = this;
|
4594 |
+
if (isBody(element) || styleString(element, 'position') == 'fixed') return null;
|
4595 |
+
|
4596 |
+
try {
|
4597 |
+
return element.offsetParent;
|
4598 |
+
} catch(e){}
|
4599 |
+
return null;
|
4600 |
+
},
|
4601 |
+
|
4602 |
+
getOffsets: function(){
|
4603 |
+
var hasGetBoundingClientRect = this.getBoundingClientRect;
|
4604 |
+
|
4605 |
+
if (hasGetBoundingClientRect){
|
4606 |
+
var bound = this.getBoundingClientRect(),
|
4607 |
+
html = document.id(this.getDocument().documentElement),
|
4608 |
+
htmlScroll = html.getScroll(),
|
4609 |
+
elemScrolls = this.getScrolls(),
|
4610 |
+
isFixed = (styleString(this, 'position') == 'fixed');
|
4611 |
+
|
4612 |
+
return {
|
4613 |
+
x: bound.left.toFloat() + elemScrolls.x + ((isFixed) ? 0 : htmlScroll.x) - html.clientLeft,
|
4614 |
+
y: bound.top.toFloat() + elemScrolls.y + ((isFixed) ? 0 : htmlScroll.y) - html.clientTop
|
4615 |
+
};
|
4616 |
+
}
|
4617 |
+
|
4618 |
+
var element = this, position = {x: 0, y: 0};
|
4619 |
+
if (isBody(this)) return position;
|
4620 |
+
|
4621 |
+
while (element && !isBody(element)){
|
4622 |
+
position.x += element.offsetLeft;
|
4623 |
+
position.y += element.offsetTop;
|
4624 |
+
|
4625 |
+
element = element.offsetParent;
|
4626 |
+
}
|
4627 |
+
|
4628 |
+
return position;
|
4629 |
+
},
|
4630 |
+
|
4631 |
+
getPosition: function(relative){
|
4632 |
+
var offset = this.getOffsets(),
|
4633 |
+
scroll = this.getScrolls();
|
4634 |
+
var position = {
|
4635 |
+
x: offset.x - scroll.x,
|
4636 |
+
y: offset.y - scroll.y
|
4637 |
+
};
|
4638 |
+
|
4639 |
+
if (relative && (relative = document.id(relative))){
|
4640 |
+
var relativePosition = relative.getPosition();
|
4641 |
+
return {x: position.x - relativePosition.x - leftBorder(relative), y: position.y - relativePosition.y - topBorder(relative)};
|
4642 |
+
}
|
4643 |
+
return position;
|
4644 |
+
},
|
4645 |
+
|
4646 |
+
getCoordinates: function(element){
|
4647 |
+
if (isBody(this)) return this.getWindow().getCoordinates();
|
4648 |
+
var position = this.getPosition(element),
|
4649 |
+
size = this.getSize();
|
4650 |
+
var obj = {
|
4651 |
+
left: position.x,
|
4652 |
+
top: position.y,
|
4653 |
+
width: size.x,
|
4654 |
+
height: size.y
|
4655 |
+
};
|
4656 |
+
obj.right = obj.left + obj.width;
|
4657 |
+
obj.bottom = obj.top + obj.height;
|
4658 |
+
return obj;
|
4659 |
+
},
|
4660 |
+
|
4661 |
+
computePosition: function(obj){
|
4662 |
+
return {
|
4663 |
+
left: obj.x - styleNumber(this, 'margin-left'),
|
4664 |
+
top: obj.y - styleNumber(this, 'margin-top')
|
4665 |
+
};
|
4666 |
+
},
|
4667 |
+
|
4668 |
+
setPosition: function(obj){
|
4669 |
+
return this.setStyles(this.computePosition(obj));
|
4670 |
+
}
|
4671 |
+
|
4672 |
+
});
|
4673 |
+
|
4674 |
+
|
4675 |
+
[Document, Window].invoke('implement', {
|
4676 |
+
|
4677 |
+
getSize: function(){
|
4678 |
+
var doc = getCompatElement(this);
|
4679 |
+
return {x: doc.clientWidth, y: doc.clientHeight};
|
4680 |
+
},
|
4681 |
+
|
4682 |
+
getScroll: function(){
|
4683 |
+
var win = this.getWindow(), doc = getCompatElement(this);
|
4684 |
+
return {x: win.pageXOffset || doc.scrollLeft, y: win.pageYOffset || doc.scrollTop};
|
4685 |
+
},
|
4686 |
+
|
4687 |
+
getScrollSize: function(){
|
4688 |
+
var doc = getCompatElement(this),
|
4689 |
+
min = this.getSize(),
|
4690 |
+
body = this.getDocument().body;
|
4691 |
+
|
4692 |
+
return {x: Math.max(doc.scrollWidth, body.scrollWidth, min.x), y: Math.max(doc.scrollHeight, body.scrollHeight, min.y)};
|
4693 |
+
},
|
4694 |
+
|
4695 |
+
getPosition: function(){
|
4696 |
+
return {x: 0, y: 0};
|
4697 |
+
},
|
4698 |
+
|
4699 |
+
getCoordinates: function(){
|
4700 |
+
var size = this.getSize();
|
4701 |
+
return {top: 0, left: 0, bottom: size.y, right: size.x, height: size.y, width: size.x};
|
4702 |
+
}
|
4703 |
+
|
4704 |
+
});
|
4705 |
+
|
4706 |
+
// private methods
|
4707 |
+
|
4708 |
+
var styleString = Element.getComputedStyle;
|
4709 |
+
|
4710 |
+
function styleNumber(element, style){
|
4711 |
+
return styleString(element, style).toInt() || 0;
|
4712 |
+
}
|
4713 |
+
|
4714 |
+
|
4715 |
+
|
4716 |
+
function topBorder(element){
|
4717 |
+
return styleNumber(element, 'border-top-width');
|
4718 |
+
}
|
4719 |
+
|
4720 |
+
function leftBorder(element){
|
4721 |
+
return styleNumber(element, 'border-left-width');
|
4722 |
+
}
|
4723 |
+
|
4724 |
+
function isBody(element){
|
4725 |
+
return (/^(?:body|html)$/i).test(element.tagName);
|
4726 |
+
}
|
4727 |
+
|
4728 |
+
function getCompatElement(element){
|
4729 |
+
var doc = element.getDocument();
|
4730 |
+
return (!doc.compatMode || doc.compatMode == 'CSS1Compat') ? doc.html : doc.body;
|
4731 |
+
}
|
4732 |
+
|
4733 |
+
})();
|
4734 |
+
|
4735 |
+
//aliases
|
4736 |
+
Element.alias({position: 'setPosition'}); //compatability
|
4737 |
+
|
4738 |
+
[Window, Document, Element].invoke('implement', {
|
4739 |
+
|
4740 |
+
getHeight: function(){
|
4741 |
+
return this.getSize().y;
|
4742 |
+
},
|
4743 |
+
|
4744 |
+
getWidth: function(){
|
4745 |
+
return this.getSize().x;
|
4746 |
+
},
|
4747 |
+
|
4748 |
+
getScrollTop: function(){
|
4749 |
+
return this.getScroll().y;
|
4750 |
+
},
|
4751 |
+
|
4752 |
+
getScrollLeft: function(){
|
4753 |
+
return this.getScroll().x;
|
4754 |
+
},
|
4755 |
+
|
4756 |
+
getScrollHeight: function(){
|
4757 |
+
return this.getScrollSize().y;
|
4758 |
+
},
|
4759 |
+
|
4760 |
+
getScrollWidth: function(){
|
4761 |
+
return this.getScrollSize().x;
|
4762 |
+
},
|
4763 |
+
|
4764 |
+
getTop: function(){
|
4765 |
+
return this.getPosition().y;
|
4766 |
+
},
|
4767 |
+
|
4768 |
+
getLeft: function(){
|
4769 |
+
return this.getPosition().x;
|
4770 |
+
}
|
4771 |
+
|
4772 |
+
});
|
4773 |
+
|
4774 |
+
/*
|
4775 |
+
---
|
4776 |
+
|
4777 |
+
name: Fx
|
4778 |
+
|
4779 |
+
description: Contains the basic animation logic to be extended by all other Fx Classes.
|
4780 |
+
|
4781 |
+
license: MIT-style license.
|
4782 |
+
|
4783 |
+
requires: [Chain, Events, Options]
|
4784 |
+
|
4785 |
+
provides: Fx
|
4786 |
+
|
4787 |
+
...
|
4788 |
+
*/
|
4789 |
+
|
4790 |
+
(function(){
|
4791 |
+
|
4792 |
+
var Fx = this.Fx = new Class({
|
4793 |
+
|
4794 |
+
Implements: [Chain, Events, Options],
|
4795 |
+
|
4796 |
+
options: {
|
4797 |
+
/*
|
4798 |
+
onStart: nil,
|
4799 |
+
onCancel: nil,
|
4800 |
+
onComplete: nil,
|
4801 |
+
*/
|
4802 |
+
fps: 60,
|
4803 |
+
unit: false,
|
4804 |
+
duration: 500,
|
4805 |
+
frames: null,
|
4806 |
+
frameSkip: true,
|
4807 |
+
link: 'ignore'
|
4808 |
+
},
|
4809 |
+
|
4810 |
+
initialize: function(options){
|
4811 |
+
this.subject = this.subject || this;
|
4812 |
+
this.setOptions(options);
|
4813 |
+
},
|
4814 |
+
|
4815 |
+
getTransition: function(){
|
4816 |
+
return function(p){
|
4817 |
+
return -(Math.cos(Math.PI * p) - 1) / 2;
|
4818 |
+
};
|
4819 |
+
},
|
4820 |
+
|
4821 |
+
step: function(now){
|
4822 |
+
if (this.options.frameSkip){
|
4823 |
+
var diff = (this.time != null) ? (now - this.time) : 0, frames = diff / this.frameInterval;
|
4824 |
+
this.time = now;
|
4825 |
+
this.frame += frames;
|
4826 |
+
} else {
|
4827 |
+
this.frame++;
|
4828 |
+
}
|
4829 |
+
|
4830 |
+
if (this.frame < this.frames){
|
4831 |
+
var delta = this.transition(this.frame / this.frames);
|
4832 |
+
this.set(this.compute(this.from, this.to, delta));
|
4833 |
+
} else {
|
4834 |
+
this.frame = this.frames;
|
4835 |
+
this.set(this.compute(this.from, this.to, 1));
|
4836 |
+
this.stop();
|
4837 |
+
}
|
4838 |
+
},
|
4839 |
+
|
4840 |
+
set: function(now){
|
4841 |
+
return now;
|
4842 |
+
},
|
4843 |
+
|
4844 |
+
compute: function(from, to, delta){
|
4845 |
+
return Fx.compute(from, to, delta);
|
4846 |
+
},
|
4847 |
+
|
4848 |
+
check: function(){
|
4849 |
+
if (!this.isRunning()) return true;
|
4850 |
+
switch (this.options.link){
|
4851 |
+
case 'cancel': this.cancel(); return true;
|
4852 |
+
case 'chain': this.chain(this.caller.pass(arguments, this)); return false;
|
4853 |
+
}
|
4854 |
+
return false;
|
4855 |
+
},
|
4856 |
+
|
4857 |
+
start: function(from, to){
|
4858 |
+
if (!this.check(from, to)) return this;
|
4859 |
+
this.from = from;
|
4860 |
+
this.to = to;
|
4861 |
+
this.frame = (this.options.frameSkip) ? 0 : -1;
|
4862 |
+
this.time = null;
|
4863 |
+
this.transition = this.getTransition();
|
4864 |
+
var frames = this.options.frames, fps = this.options.fps, duration = this.options.duration;
|
4865 |
+
this.duration = Fx.Durations[duration] || duration.toInt();
|
4866 |
+
this.frameInterval = 1000 / fps;
|
4867 |
+
this.frames = frames || Math.round(this.duration / this.frameInterval);
|
4868 |
+
this.fireEvent('start', this.subject);
|
4869 |
+
pushInstance.call(this, fps);
|
4870 |
+
return this;
|
4871 |
+
},
|
4872 |
+
|
4873 |
+
stop: function(){
|
4874 |
+
if (this.isRunning()){
|
4875 |
+
this.time = null;
|
4876 |
+
pullInstance.call(this, this.options.fps);
|
4877 |
+
if (this.frames == this.frame){
|
4878 |
+
this.fireEvent('complete', this.subject);
|
4879 |
+
if (!this.callChain()) this.fireEvent('chainComplete', this.subject);
|
4880 |
+
} else {
|
4881 |
+
this.fireEvent('stop', this.subject);
|
4882 |
+
}
|
4883 |
+
}
|
4884 |
+
return this;
|
4885 |
+
},
|
4886 |
+
|
4887 |
+
cancel: function(){
|
4888 |
+
if (this.isRunning()){
|
4889 |
+
this.time = null;
|
4890 |
+
pullInstance.call(this, this.options.fps);
|
4891 |
+
this.frame = this.frames;
|
4892 |
+
this.fireEvent('cancel', this.subject).clearChain();
|
4893 |
+
}
|
4894 |
+
return this;
|
4895 |
+
},
|
4896 |
+
|
4897 |
+
pause: function(){
|
4898 |
+
if (this.isRunning()){
|
4899 |
+
this.time = null;
|
4900 |
+
pullInstance.call(this, this.options.fps);
|
4901 |
+
}
|
4902 |
+
return this;
|
4903 |
+
},
|
4904 |
+
|
4905 |
+
resume: function(){
|
4906 |
+
if (this.isPaused()) pushInstance.call(this, this.options.fps);
|
4907 |
+
return this;
|
4908 |
+
},
|
4909 |
+
|
4910 |
+
isRunning: function(){
|
4911 |
+
var list = instances[this.options.fps];
|
4912 |
+
return list && list.contains(this);
|
4913 |
+
},
|
4914 |
+
|
4915 |
+
isPaused: function(){
|
4916 |
+
return (this.frame < this.frames) && !this.isRunning();
|
4917 |
+
}
|
4918 |
+
|
4919 |
+
});
|
4920 |
+
|
4921 |
+
Fx.compute = function(from, to, delta){
|
4922 |
+
return (to - from) * delta + from;
|
4923 |
+
};
|
4924 |
+
|
4925 |
+
Fx.Durations = {'short': 250, 'normal': 500, 'long': 1000};
|
4926 |
+
|
4927 |
+
// global timers
|
4928 |
+
|
4929 |
+
var instances = {}, timers = {};
|
4930 |
+
|
4931 |
+
var loop = function(){
|
4932 |
+
var now = Date.now();
|
4933 |
+
for (var i = this.length; i--;){
|
4934 |
+
var instance = this[i];
|
4935 |
+
if (instance) instance.step(now);
|
4936 |
+
}
|
4937 |
+
};
|
4938 |
+
|
4939 |
+
var pushInstance = function(fps){
|
4940 |
+
var list = instances[fps] || (instances[fps] = []);
|
4941 |
+
list.push(this);
|
4942 |
+
if (!timers[fps]) timers[fps] = loop.periodical(Math.round(1000 / fps), list);
|
4943 |
+
};
|
4944 |
+
|
4945 |
+
var pullInstance = function(fps){
|
4946 |
+
var list = instances[fps];
|
4947 |
+
if (list){
|
4948 |
+
list.erase(this);
|
4949 |
+
if (!list.length && timers[fps]){
|
4950 |
+
delete instances[fps];
|
4951 |
+
timers[fps] = clearInterval(timers[fps]);
|
4952 |
+
}
|
4953 |
+
}
|
4954 |
+
};
|
4955 |
+
|
4956 |
+
})();
|
4957 |
+
|
4958 |
+
/*
|
4959 |
+
---
|
4960 |
+
|
4961 |
+
name: Fx.CSS
|
4962 |
+
|
4963 |
+
description: Contains the CSS animation logic. Used by Fx.Tween, Fx.Morph, Fx.Elements.
|
4964 |
+
|
4965 |
+
license: MIT-style license.
|
4966 |
+
|
4967 |
+
requires: [Fx, Element.Style]
|
4968 |
+
|
4969 |
+
provides: Fx.CSS
|
4970 |
+
|
4971 |
+
...
|
4972 |
+
*/
|
4973 |
+
|
4974 |
+
Fx.CSS = new Class({
|
4975 |
+
|
4976 |
+
Extends: Fx,
|
4977 |
+
|
4978 |
+
//prepares the base from/to object
|
4979 |
+
|
4980 |
+
prepare: function(element, property, values){
|
4981 |
+
values = Array.from(values);
|
4982 |
+
var from = values[0], to = values[1];
|
4983 |
+
if (to == null){
|
4984 |
+
to = from;
|
4985 |
+
from = element.getStyle(property);
|
4986 |
+
var unit = this.options.unit;
|
4987 |
+
// adapted from: https://github.com/ryanmorr/fx/blob/master/fx.js#L299
|
4988 |
+
if (unit && from && typeof from == 'string' && from.slice(-unit.length) != unit && parseFloat(from) != 0){
|
4989 |
+
element.setStyle(property, to + unit);
|
4990 |
+
var value = element.getComputedStyle(property);
|
4991 |
+
// IE and Opera support pixelLeft or pixelWidth
|
4992 |
+
if (!(/px$/.test(value))){
|
4993 |
+
value = element.style[('pixel-' + property).camelCase()];
|
4994 |
+
if (value == null){
|
4995 |
+
// adapted from Dean Edwards' http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
|
4996 |
+
var left = element.style.left;
|
4997 |
+
element.style.left = to + unit;
|
4998 |
+
value = element.style.pixelLeft;
|
4999 |
+
element.style.left = left;
|
5000 |
+
}
|
5001 |
+
}
|
5002 |
+
from = (to || 1) / (parseFloat(value) || 1) * (parseFloat(from) || 0);
|
5003 |
+
element.setStyle(property, from + unit);
|
5004 |
+
}
|
5005 |
+
}
|
5006 |
+
return {from: this.parse(from), to: this.parse(to)};
|
5007 |
+
},
|
5008 |
+
|
5009 |
+
//parses a value into an array
|
5010 |
+
|
5011 |
+
parse: function(value){
|
5012 |
+
value = Function.from(value)();
|
5013 |
+
value = (typeof value == 'string') ? value.split(' ') : Array.from(value);
|
5014 |
+
return value.map(function(val){
|
5015 |
+
val = String(val);
|
5016 |
+
var found = false;
|
5017 |
+
Object.each(Fx.CSS.Parsers, function(parser, key){
|
5018 |
+
if (found) return;
|
5019 |
+
var parsed = parser.parse(val);
|
5020 |
+
if (parsed || parsed === 0) found = {value: parsed, parser: parser};
|
5021 |
+
});
|
5022 |
+
found = found || {value: val, parser: Fx.CSS.Parsers.String};
|
5023 |
+
return found;
|
5024 |
+
});
|
5025 |
+
},
|
5026 |
+
|
5027 |
+
//computes by a from and to prepared objects, using their parsers.
|
5028 |
+
|
5029 |
+
compute: function(from, to, delta){
|
5030 |
+
var computed = [];
|
5031 |
+
(Math.min(from.length, to.length)).times(function(i){
|
5032 |
+
computed.push({value: from[i].parser.compute(from[i].value, to[i].value, delta), parser: from[i].parser});
|
5033 |
+
});
|
5034 |
+
computed.$family = Function.from('fx:css:value');
|
5035 |
+
return computed;
|
5036 |
+
},
|
5037 |
+
|
5038 |
+
//serves the value as settable
|
5039 |
+
|
5040 |
+
serve: function(value, unit){
|
5041 |
+
if (typeOf(value) != 'fx:css:value') value = this.parse(value);
|
5042 |
+
var returned = [];
|
5043 |
+
value.each(function(bit){
|
5044 |
+
returned = returned.concat(bit.parser.serve(bit.value, unit));
|
5045 |
+
});
|
5046 |
+
return returned;
|
5047 |
+
},
|
5048 |
+
|
5049 |
+
//renders the change to an element
|
5050 |
+
|
5051 |
+
render: function(element, property, value, unit){
|
5052 |
+
element.setStyle(property, this.serve(value, unit));
|
5053 |
+
},
|
5054 |
+
|
5055 |
+
//searches inside the page css to find the values for a selector
|
5056 |
+
|
5057 |
+
search: function(selector){
|
5058 |
+
if (Fx.CSS.Cache[selector]) return Fx.CSS.Cache[selector];
|
5059 |
+
var to = {}, selectorTest = new RegExp('^' + selector.escapeRegExp() + '$');
|
5060 |
+
|
5061 |
+
var searchStyles = function(rules){
|
5062 |
+
Array.each(rules, function(rule, i){
|
5063 |
+
if (rule.media){
|
5064 |
+
searchStyles(rule.rules || rule.cssRules);
|
5065 |
+
return;
|
5066 |
+
}
|
5067 |
+
if (!rule.style) return;
|
5068 |
+
var selectorText = (rule.selectorText) ? rule.selectorText.replace(/^\w+/, function(m){
|
5069 |
+
return m.toLowerCase();
|
5070 |
+
}) : null;
|
5071 |
+
if (!selectorText || !selectorTest.test(selectorText)) return;
|
5072 |
+
Object.each(Element.Styles, function(value, style){
|
5073 |
+
if (!rule.style[style] || Element.ShortStyles[style]) return;
|
5074 |
+
value = String(rule.style[style]);
|
5075 |
+
to[style] = ((/^rgb/).test(value)) ? value.rgbToHex() : value;
|
5076 |
+
});
|
5077 |
+
});
|
5078 |
+
};
|
5079 |
+
|
5080 |
+
Array.each(document.styleSheets, function(sheet, j){
|
5081 |
+
var href = sheet.href;
|
5082 |
+
if (href && href.indexOf('://') > -1 && href.indexOf(document.domain) == -1) return;
|
5083 |
+
var rules = sheet.rules || sheet.cssRules;
|
5084 |
+
searchStyles(rules);
|
5085 |
+
});
|
5086 |
+
return Fx.CSS.Cache[selector] = to;
|
5087 |
+
}
|
5088 |
+
|
5089 |
+
});
|
5090 |
+
|
5091 |
+
Fx.CSS.Cache = {};
|
5092 |
+
|
5093 |
+
Fx.CSS.Parsers = {
|
5094 |
+
|
5095 |
+
Color: {
|
5096 |
+
parse: function(value){
|
5097 |
+
if (value.match(/^#[0-9a-f]{3,6}$/i)) return value.hexToRgb(true);
|
5098 |
+
return ((value = value.match(/(\d+),\s*(\d+),\s*(\d+)/))) ? [value[1], value[2], value[3]] : false;
|
5099 |
+
},
|
5100 |
+
compute: function(from, to, delta){
|
5101 |
+
return from.map(function(value, i){
|
5102 |
+
return Math.round(Fx.compute(from[i], to[i], delta));
|
5103 |
+
});
|
5104 |
+
},
|
5105 |
+
serve: function(value){
|
5106 |
+
return value.map(Number);
|
5107 |
+
}
|
5108 |
+
},
|
5109 |
+
|
5110 |
+
Number: {
|
5111 |
+
parse: parseFloat,
|
5112 |
+
compute: Fx.compute,
|
5113 |
+
serve: function(value, unit){
|
5114 |
+
return (unit) ? value + unit : value;
|
5115 |
+
}
|
5116 |
+
},
|
5117 |
+
|
5118 |
+
String: {
|
5119 |
+
parse: Function.from(false),
|
5120 |
+
compute: function(zero, one){
|
5121 |
+
return one;
|
5122 |
+
},
|
5123 |
+
serve: function(zero){
|
5124 |
+
return zero;
|
5125 |
+
}
|
5126 |
+
}
|
5127 |
+
|
5128 |
+
};
|
5129 |
+
|
5130 |
+
|
5131 |
+
|
5132 |
+
/*
|
5133 |
+
---
|
5134 |
+
|
5135 |
+
name: Fx.Morph
|
5136 |
+
|
5137 |
+
description: Formerly Fx.Styles, effect to transition any number of CSS properties for an element using an object of rules, or CSS based selector rules.
|
5138 |
+
|
5139 |
+
license: MIT-style license.
|
5140 |
+
|
5141 |
+
requires: Fx.CSS
|
5142 |
+
|
5143 |
+
provides: Fx.Morph
|
5144 |
+
|
5145 |
+
...
|
5146 |
+
*/
|
5147 |
+
|
5148 |
+
Fx.Morph = new Class({
|
5149 |
+
|
5150 |
+
Extends: Fx.CSS,
|
5151 |
+
|
5152 |
+
initialize: function(element, options){
|
5153 |
+
this.element = this.subject = document.id(element);
|
5154 |
+
this.parent(options);
|
5155 |
+
},
|
5156 |
+
|
5157 |
+
set: function(now){
|
5158 |
+
if (typeof now == 'string') now = this.search(now);
|
5159 |
+
for (var p in now) this.render(this.element, p, now[p], this.options.unit);
|
5160 |
+
return this;
|
5161 |
+
},
|
5162 |
+
|
5163 |
+
compute: function(from, to, delta){
|
5164 |
+
var now = {};
|
5165 |
+
for (var p in from) now[p] = this.parent(from[p], to[p], delta);
|
5166 |
+
return now;
|
5167 |
+
},
|
5168 |
+
|
5169 |
+
start: function(properties){
|
5170 |
+
if (!this.check(properties)) return this;
|
5171 |
+
if (typeof properties == 'string') properties = this.search(properties);
|
5172 |
+
var from = {}, to = {};
|
5173 |
+
for (var p in properties){
|
5174 |
+
var parsed = this.prepare(this.element, p, properties[p]);
|
5175 |
+
from[p] = parsed.from;
|
5176 |
+
to[p] = parsed.to;
|
5177 |
+
}
|
5178 |
+
return this.parent(from, to);
|
5179 |
+
}
|
5180 |
+
|
5181 |
+
});
|
5182 |
+
|
5183 |
+
Element.Properties.morph = {
|
5184 |
+
|
5185 |
+
set: function(options){
|
5186 |
+
this.get('morph').cancel().setOptions(options);
|
5187 |
+
return this;
|
5188 |
+
},
|
5189 |
+
|
5190 |
+
get: function(){
|
5191 |
+
var morph = this.retrieve('morph');
|
5192 |
+
if (!morph){
|
5193 |
+
morph = new Fx.Morph(this, {link: 'cancel'});
|
5194 |
+
this.store('morph', morph);
|
5195 |
+
}
|
5196 |
+
return morph;
|
5197 |
+
}
|
5198 |
+
|
5199 |
+
};
|
5200 |
+
|
5201 |
+
Element.implement({
|
5202 |
+
|
5203 |
+
morph: function(props){
|
5204 |
+
this.get('morph').start(props);
|
5205 |
+
return this;
|
5206 |
+
}
|
5207 |
+
|
5208 |
+
});
|
5209 |
+
|
5210 |
+
/*
|
5211 |
+
---
|
5212 |
+
|
5213 |
+
name: Fx.Transitions
|
5214 |
+
|
5215 |
+
description: Contains a set of advanced transitions to be used with any of the Fx Classes.
|
5216 |
+
|
5217 |
+
license: MIT-style license.
|
5218 |
+
|
5219 |
+
credits:
|
5220 |
+
- Easing Equations by Robert Penner, <http://www.robertpenner.com/easing/>, modified and optimized to be used with MooTools.
|
5221 |
+
|
5222 |
+
requires: Fx
|
5223 |
+
|
5224 |
+
provides: Fx.Transitions
|
5225 |
+
|
5226 |
+
...
|
5227 |
+
*/
|
5228 |
+
|
5229 |
+
Fx.implement({
|
5230 |
+
|
5231 |
+
getTransition: function(){
|
5232 |
+
var trans = this.options.transition || Fx.Transitions.Sine.easeInOut;
|
5233 |
+
if (typeof trans == 'string'){
|
5234 |
+
var data = trans.split(':');
|
5235 |
+
trans = Fx.Transitions;
|
5236 |
+
trans = trans[data[0]] || trans[data[0].capitalize()];
|
5237 |
+
if (data[1]) trans = trans['ease' + data[1].capitalize() + (data[2] ? data[2].capitalize() : '')];
|
5238 |
+
}
|
5239 |
+
return trans;
|
5240 |
+
}
|
5241 |
+
|
5242 |
+
});
|
5243 |
+
|
5244 |
+
Fx.Transition = function(transition, params){
|
5245 |
+
params = Array.from(params);
|
5246 |
+
var easeIn = function(pos){
|
5247 |
+
return transition(pos, params);
|
5248 |
+
};
|
5249 |
+
return Object.append(easeIn, {
|
5250 |
+
easeIn: easeIn,
|
5251 |
+
easeOut: function(pos){
|
5252 |
+
return 1 - transition(1 - pos, params);
|
5253 |
+
},
|
5254 |
+
easeInOut: function(pos){
|
5255 |
+
return (pos <= 0.5 ? transition(2 * pos, params) : (2 - transition(2 * (1 - pos), params))) / 2;
|
5256 |
+
}
|
5257 |
+
});
|
5258 |
+
};
|
5259 |
+
|
5260 |
+
Fx.Transitions = {
|
5261 |
+
|
5262 |
+
linear: function(zero){
|
5263 |
+
return zero;
|
5264 |
+
}
|
5265 |
+
|
5266 |
+
};
|
5267 |
+
|
5268 |
+
|
5269 |
+
|
5270 |
+
Fx.Transitions.extend = function(transitions){
|
5271 |
+
for (var transition in transitions) Fx.Transitions[transition] = new Fx.Transition(transitions[transition]);
|
5272 |
+
};
|
5273 |
+
|
5274 |
+
Fx.Transitions.extend({
|
5275 |
+
|
5276 |
+
Pow: function(p, x){
|
5277 |
+
return Math.pow(p, x && x[0] || 6);
|
5278 |
+
},
|
5279 |
+
|
5280 |
+
Expo: function(p){
|
5281 |
+
return Math.pow(2, 8 * (p - 1));
|
5282 |
+
},
|
5283 |
+
|
5284 |
+
Circ: function(p){
|
5285 |
+
return 1 - Math.sin(Math.acos(p));
|
5286 |
+
},
|
5287 |
+
|
5288 |
+
Sine: function(p){
|
5289 |
+
return 1 - Math.cos(p * Math.PI / 2);
|
5290 |
+
},
|
5291 |
+
|
5292 |
+
Back: function(p, x){
|
5293 |
+
x = x && x[0] || 1.618;
|
5294 |
+
return Math.pow(p, 2) * ((x + 1) * p - x);
|
5295 |
+
},
|
5296 |
+
|
5297 |
+
Bounce: function(p){
|
5298 |
+
var value;
|
5299 |
+
for (var a = 0, b = 1; 1; a += b, b /= 2){
|
5300 |
+
if (p >= (7 - 4 * a) / 11){
|
5301 |
+
value = b * b - Math.pow((11 - 6 * a - 11 * p) / 4, 2);
|
5302 |
+
break;
|
5303 |
+
}
|
5304 |
+
}
|
5305 |
+
return value;
|
5306 |
+
},
|
5307 |
+
|
5308 |
+
Elastic: function(p, x){
|
5309 |
+
return Math.pow(2, 10 * --p) * Math.cos(20 * p * Math.PI * (x && x[0] || 1) / 3);
|
5310 |
+
}
|
5311 |
+
|
5312 |
+
});
|
5313 |
+
|
5314 |
+
['Quad', 'Cubic', 'Quart', 'Quint'].each(function(transition, i){
|
5315 |
+
Fx.Transitions[transition] = new Fx.Transition(function(p){
|
5316 |
+
return Math.pow(p, i + 2);
|
5317 |
+
});
|
5318 |
+
});
|
5319 |
+
|
5320 |
+
/*
|
5321 |
+
---
|
5322 |
+
|
5323 |
+
name: Fx.Tween
|
5324 |
+
|
5325 |
+
description: Formerly Fx.Style, effect to transition any CSS property for an element.
|
5326 |
+
|
5327 |
+
license: MIT-style license.
|
5328 |
+
|
5329 |
+
requires: Fx.CSS
|
5330 |
+
|
5331 |
+
provides: [Fx.Tween, Element.fade, Element.highlight]
|
5332 |
+
|
5333 |
+
...
|
5334 |
+
*/
|
5335 |
+
|
5336 |
+
Fx.Tween = new Class({
|
5337 |
+
|
5338 |
+
Extends: Fx.CSS,
|
5339 |
+
|
5340 |
+
initialize: function(element, options){
|
5341 |
+
this.element = this.subject = document.id(element);
|
5342 |
+
this.parent(options);
|
5343 |
+
},
|
5344 |
+
|
5345 |
+
set: function(property, now){
|
5346 |
+
if (arguments.length == 1){
|
5347 |
+
now = property;
|
5348 |
+
property = this.property || this.options.property;
|
5349 |
+
}
|
5350 |
+
this.render(this.element, property, now, this.options.unit);
|
5351 |
+
return this;
|
5352 |
+
},
|
5353 |
+
|
5354 |
+
start: function(property, from, to){
|
5355 |
+
if (!this.check(property, from, to)) return this;
|
5356 |
+
var args = Array.flatten(arguments);
|
5357 |
+
this.property = this.options.property || args.shift();
|
5358 |
+
var parsed = this.prepare(this.element, this.property, args);
|
5359 |
+
return this.parent(parsed.from, parsed.to);
|
5360 |
+
}
|
5361 |
+
|
5362 |
+
});
|
5363 |
+
|
5364 |
+
Element.Properties.tween = {
|
5365 |
+
|
5366 |
+
set: function(options){
|
5367 |
+
this.get('tween').cancel().setOptions(options);
|
5368 |
+
return this;
|
5369 |
+
},
|
5370 |
+
|
5371 |
+
get: function(){
|
5372 |
+
var tween = this.retrieve('tween');
|
5373 |
+
if (!tween){
|
5374 |
+
tween = new Fx.Tween(this, {link: 'cancel'});
|
5375 |
+
this.store('tween', tween);
|
5376 |
+
}
|
5377 |
+
return tween;
|
5378 |
+
}
|
5379 |
+
|
5380 |
+
};
|
5381 |
+
|
5382 |
+
Element.implement({
|
5383 |
+
|
5384 |
+
tween: function(property, from, to){
|
5385 |
+
this.get('tween').start(property, from, to);
|
5386 |
+
return this;
|
5387 |
+
},
|
5388 |
+
|
5389 |
+
fade: function(how){
|
5390 |
+
var fade = this.get('tween'), method, args = ['opacity'].append(arguments), toggle;
|
5391 |
+
if (args[1] == null) args[1] = 'toggle';
|
5392 |
+
switch (args[1]){
|
5393 |
+
case 'in': method = 'start'; args[1] = 1; break;
|
5394 |
+
case 'out': method = 'start'; args[1] = 0; break;
|
5395 |
+
case 'show': method = 'set'; args[1] = 1; break;
|
5396 |
+
case 'hide': method = 'set'; args[1] = 0; break;
|
5397 |
+
case 'toggle':
|
5398 |
+
var flag = this.retrieve('fade:flag', this.getStyle('opacity') == 1);
|
5399 |
+
method = 'start';
|
5400 |
+
args[1] = flag ? 0 : 1;
|
5401 |
+
this.store('fade:flag', !flag);
|
5402 |
+
toggle = true;
|
5403 |
+
break;
|
5404 |
+
default: method = 'start';
|
5405 |
+
}
|
5406 |
+
if (!toggle) this.eliminate('fade:flag');
|
5407 |
+
fade[method].apply(fade, args);
|
5408 |
+
var to = args[args.length - 1];
|
5409 |
+
|
5410 |
+
if (method == 'set'){
|
5411 |
+
this.setStyle('visibility', to == 0 ? 'hidden' : 'visible');
|
5412 |
+
} else if (to != 0){
|
5413 |
+
if (fade.$chain.length){
|
5414 |
+
fade.chain(function(){
|
5415 |
+
this.element.setStyle('visibility', 'visible');
|
5416 |
+
this.callChain();
|
5417 |
+
});
|
5418 |
+
} else {
|
5419 |
+
this.setStyle('visibility', 'visible');
|
5420 |
+
}
|
5421 |
+
} else {
|
5422 |
+
fade.chain(function(){
|
5423 |
+
if (this.element.getStyle('opacity')) return;
|
5424 |
+
this.element.setStyle('visibility', 'hidden');
|
5425 |
+
this.callChain();
|
5426 |
+
});
|
5427 |
+
}
|
5428 |
+
|
5429 |
+
return this;
|
5430 |
+
},
|
5431 |
+
|
5432 |
+
highlight: function(start, end){
|
5433 |
+
if (!end){
|
5434 |
+
end = this.retrieve('highlight:original', this.getStyle('background-color'));
|
5435 |
+
end = (end == 'transparent') ? '#fff' : end;
|
5436 |
+
}
|
5437 |
+
var tween = this.get('tween');
|
5438 |
+
tween.start('background-color', start || '#ffff88', end).chain(function(){
|
5439 |
+
this.setStyle('background-color', this.retrieve('highlight:original'));
|
5440 |
+
tween.callChain();
|
5441 |
+
}.bind(this));
|
5442 |
+
return this;
|
5443 |
+
}
|
5444 |
+
|
5445 |
+
});
|
5446 |
+
|
5447 |
+
/*
|
5448 |
+
---
|
5449 |
+
|
5450 |
+
name: Request
|
5451 |
+
|
5452 |
+
description: Powerful all purpose Request Class. Uses XMLHTTPRequest.
|
5453 |
+
|
5454 |
+
license: MIT-style license.
|
5455 |
+
|
5456 |
+
requires: [Object, Element, Chain, Events, Options, Browser]
|
5457 |
+
|
5458 |
+
provides: Request
|
5459 |
+
|
5460 |
+
...
|
5461 |
+
*/
|
5462 |
+
|
5463 |
+
(function(){
|
5464 |
+
|
5465 |
+
var empty = function(){},
|
5466 |
+
progressSupport = ('onprogress' in new Browser.Request);
|
5467 |
+
|
5468 |
+
var Request = this.Request = new Class({
|
5469 |
+
|
5470 |
+
Implements: [Chain, Events, Options],
|
5471 |
+
|
5472 |
+
options: {/*
|
5473 |
+
onRequest: function(){},
|
5474 |
+
onLoadstart: function(event, xhr){},
|
5475 |
+
onProgress: function(event, xhr){},
|
5476 |
+
onComplete: function(){},
|
5477 |
+
onCancel: function(){},
|
5478 |
+
onSuccess: function(responseText, responseXML){},
|
5479 |
+
onFailure: function(xhr){},
|
5480 |
+
onException: function(headerName, value){},
|
5481 |
+
onTimeout: function(){},
|
5482 |
+
user: '',
|
5483 |
+
password: '',
|
5484 |
+
withCredentials: false,*/
|
5485 |
+
url: '',
|
5486 |
+
data: '',
|
5487 |
+
headers: {
|
5488 |
+
'X-Requested-With': 'XMLHttpRequest',
|
5489 |
+
'Accept': 'text/javascript, text/html, application/xml, text/xml, */*'
|
5490 |
+
},
|
5491 |
+
async: true,
|
5492 |
+
format: false,
|
5493 |
+
method: 'post',
|
5494 |
+
link: 'ignore',
|
5495 |
+
isSuccess: null,
|
5496 |
+
emulation: true,
|
5497 |
+
urlEncoded: true,
|
5498 |
+
encoding: 'utf-8',
|
5499 |
+
evalScripts: false,
|
5500 |
+
evalResponse: false,
|
5501 |
+
timeout: 0,
|
5502 |
+
noCache: false
|
5503 |
+
},
|
5504 |
+
|
5505 |
+
initialize: function(options){
|
5506 |
+
this.xhr = new Browser.Request();
|
5507 |
+
this.setOptions(options);
|
5508 |
+
this.headers = this.options.headers;
|
5509 |
+
},
|
5510 |
+
|
5511 |
+
onStateChange: function(){
|
5512 |
+
var xhr = this.xhr;
|
5513 |
+
if (xhr.readyState != 4 || !this.running) return;
|
5514 |
+
this.running = false;
|
5515 |
+
this.status = 0;
|
5516 |
+
Function.attempt(function(){
|
5517 |
+
var status = xhr.status;
|
5518 |
+
this.status = (status == 1223) ? 204 : status;
|
5519 |
+
}.bind(this));
|
5520 |
+
xhr.onreadystatechange = empty;
|
5521 |
+
if (progressSupport) xhr.onprogress = xhr.onloadstart = empty;
|
5522 |
+
if (this.timer){
|
5523 |
+
clearTimeout(this.timer);
|
5524 |
+
delete this.timer;
|
5525 |
+
}
|
5526 |
+
|
5527 |
+
this.response = {text: this.xhr.responseText || '', xml: this.xhr.responseXML};
|
5528 |
+
if (this.options.isSuccess.call(this, this.status))
|
5529 |
+
this.success(this.response.text, this.response.xml);
|
5530 |
+
else
|
5531 |
+
this.failure();
|
5532 |
+
},
|
5533 |
+
|
5534 |
+
isSuccess: function(){
|
5535 |
+
var status = this.status;
|
5536 |
+
return (status >= 200 && status < 300);
|
5537 |
+
},
|
5538 |
+
|
5539 |
+
isRunning: function(){
|
5540 |
+
return !!this.running;
|
5541 |
+
},
|
5542 |
+
|
5543 |
+
processScripts: function(text){
|
5544 |
+
if (this.options.evalResponse || (/(ecma|java)script/).test(this.getHeader('Content-type'))) return Browser.exec(text);
|
5545 |
+
return text.stripScripts(this.options.evalScripts);
|
5546 |
+
},
|
5547 |
+
|
5548 |
+
success: function(text, xml){
|
5549 |
+
this.onSuccess(this.processScripts(text), xml);
|
5550 |
+
},
|
5551 |
+
|
5552 |
+
onSuccess: function(){
|
5553 |
+
this.fireEvent('complete', arguments).fireEvent('success', arguments).callChain();
|
5554 |
+
},
|
5555 |
+
|
5556 |
+
failure: function(){
|
5557 |
+
this.onFailure();
|
5558 |
+
},
|
5559 |
+
|
5560 |
+
onFailure: function(){
|
5561 |
+
this.fireEvent('complete').fireEvent('failure', this.xhr);
|
5562 |
+
},
|
5563 |
+
|
5564 |
+
loadstart: function(event){
|
5565 |
+
this.fireEvent('loadstart', [event, this.xhr]);
|
5566 |
+
},
|
5567 |
+
|
5568 |
+
progress: function(event){
|
5569 |
+
this.fireEvent('progress', [event, this.xhr]);
|
5570 |
+
},
|
5571 |
+
|
5572 |
+
timeout: function(){
|
5573 |
+
this.fireEvent('timeout', this.xhr);
|
5574 |
+
},
|
5575 |
+
|
5576 |
+
setHeader: function(name, value){
|
5577 |
+
this.headers[name] = value;
|
5578 |
+
return this;
|
5579 |
+
},
|
5580 |
+
|
5581 |
+
getHeader: function(name){
|
5582 |
+
return Function.attempt(function(){
|
5583 |
+
return this.xhr.getResponseHeader(name);
|
5584 |
+
}.bind(this));
|
5585 |
+
},
|
5586 |
+
|
5587 |
+
check: function(){
|
5588 |
+
if (!this.running) return true;
|
5589 |
+
switch (this.options.link){
|
5590 |
+
case 'cancel': this.cancel(); return true;
|
5591 |
+
case 'chain': this.chain(this.caller.pass(arguments, this)); return false;
|
5592 |
+
}
|
5593 |
+
return false;
|
5594 |
+
},
|
5595 |
+
|
5596 |
+
send: function(options){
|
5597 |
+
if (!this.check(options)) return this;
|
5598 |
+
|
5599 |
+
this.options.isSuccess = this.options.isSuccess || this.isSuccess;
|
5600 |
+
this.running = true;
|
5601 |
+
|
5602 |
+
var type = typeOf(options);
|
5603 |
+
if (type == 'string' || type == 'element') options = {data: options};
|
5604 |
+
|
5605 |
+
var old = this.options;
|
5606 |
+
options = Object.append({data: old.data, url: old.url, method: old.method}, options);
|
5607 |
+
var data = options.data, url = String(options.url), method = options.method.toLowerCase();
|
5608 |
+
|
5609 |
+
switch (typeOf(data)){
|
5610 |
+
case 'element': data = document.id(data).toQueryString(); break;
|
5611 |
+
case 'object': case 'hash': data = Object.toQueryString(data);
|
5612 |
+
}
|
5613 |
+
|
5614 |
+
if (this.options.format){
|
5615 |
+
var format = 'format=' + this.options.format;
|
5616 |
+
data = (data) ? format + '&' + data : format;
|
5617 |
+
}
|
5618 |
+
|
5619 |
+
if (this.options.emulation && !['get', 'post'].contains(method)){
|
5620 |
+
var _method = '_method=' + method;
|
5621 |
+
data = (data) ? _method + '&' + data : _method;
|
5622 |
+
method = 'post';
|
5623 |
+
}
|
5624 |
+
|
5625 |
+
if (this.options.urlEncoded && ['post', 'put'].contains(method)){
|
5626 |
+
var encoding = (this.options.encoding) ? '; charset=' + this.options.encoding : '';
|
5627 |
+
this.headers['Content-type'] = 'application/x-www-form-urlencoded' + encoding;
|
5628 |
+
}
|
5629 |
+
|
5630 |
+
if (!url) url = document.location.pathname;
|
5631 |
+
|
5632 |
+
var trimPosition = url.lastIndexOf('/');
|
5633 |
+
if (trimPosition > -1 && (trimPosition = url.indexOf('#')) > -1) url = url.substr(0, trimPosition);
|
5634 |
+
|
5635 |
+
if (this.options.noCache)
|
5636 |
+
url += (url.indexOf('?') > -1 ? '&' : '?') + String.uniqueID();
|
5637 |
+
|
5638 |
+
if (data && (method == 'get' || method == 'delete')){
|
5639 |
+
url += (url.indexOf('?') > -1 ? '&' : '?') + data;
|
5640 |
+
data = null;
|
5641 |
+
}
|
5642 |
+
|
5643 |
+
var xhr = this.xhr;
|
5644 |
+
if (progressSupport){
|
5645 |
+
xhr.onloadstart = this.loadstart.bind(this);
|
5646 |
+
xhr.onprogress = this.progress.bind(this);
|
5647 |
+
}
|
5648 |
+
|
5649 |
+
xhr.open(method.toUpperCase(), url, this.options.async, this.options.user, this.options.password);
|
5650 |
+
if ((this.options.withCredentials) && 'withCredentials' in xhr) xhr.withCredentials = true;
|
5651 |
+
|
5652 |
+
xhr.onreadystatechange = this.onStateChange.bind(this);
|
5653 |
+
|
5654 |
+
Object.each(this.headers, function(value, key){
|
5655 |
+
try {
|
5656 |
+
xhr.setRequestHeader(key, value);
|
5657 |
+
} catch (e){
|
5658 |
+
this.fireEvent('exception', [key, value]);
|
5659 |
+
}
|
5660 |
+
}, this);
|
5661 |
+
|
5662 |
+
this.fireEvent('request');
|
5663 |
+
xhr.send(data);
|
5664 |
+
if (!this.options.async) this.onStateChange();
|
5665 |
+
else if (this.options.timeout) this.timer = this.timeout.delay(this.options.timeout, this);
|
5666 |
+
return this;
|
5667 |
+
},
|
5668 |
+
|
5669 |
+
cancel: function(){
|
5670 |
+
if (!this.running) return this;
|
5671 |
+
this.running = false;
|
5672 |
+
var xhr = this.xhr;
|
5673 |
+
xhr.abort();
|
5674 |
+
if (this.timer){
|
5675 |
+
clearTimeout(this.timer);
|
5676 |
+
delete this.timer;
|
5677 |
+
}
|
5678 |
+
xhr.onreadystatechange = empty;
|
5679 |
+
if (progressSupport) xhr.onprogress = xhr.onloadstart = empty;
|
5680 |
+
this.xhr = new Browser.Request();
|
5681 |
+
this.fireEvent('cancel');
|
5682 |
+
return this;
|
5683 |
+
}
|
5684 |
+
|
5685 |
+
});
|
5686 |
+
|
5687 |
+
var methods = {};
|
5688 |
+
['get', 'post', 'put', 'delete', 'patch', 'head', 'GET', 'POST', 'PUT', 'DELETE', 'PATCH', 'HEAD'].each(function(method){
|
5689 |
+
methods[method] = function(data){
|
5690 |
+
var object = {
|
5691 |
+
method: method
|
5692 |
+
};
|
5693 |
+
if (data != null) object.data = data;
|
5694 |
+
return this.send(object);
|
5695 |
+
};
|
5696 |
+
});
|
5697 |
+
|
5698 |
+
Request.implement(methods);
|
5699 |
+
|
5700 |
+
Element.Properties.send = {
|
5701 |
+
|
5702 |
+
set: function(options){
|
5703 |
+
var send = this.get('send').cancel();
|
5704 |
+
send.setOptions(options);
|
5705 |
+
return this;
|
5706 |
+
},
|
5707 |
+
|
5708 |
+
get: function(){
|
5709 |
+
var send = this.retrieve('send');
|
5710 |
+
if (!send){
|
5711 |
+
send = new Request({
|
5712 |
+
data: this, link: 'cancel', method: this.get('method') || 'post', url: this.get('action')
|
5713 |
+
});
|
5714 |
+
this.store('send', send);
|
5715 |
+
}
|
5716 |
+
return send;
|
5717 |
+
}
|
5718 |
+
|
5719 |
+
};
|
5720 |
+
|
5721 |
+
Element.implement({
|
5722 |
+
|
5723 |
+
send: function(url){
|
5724 |
+
var sender = this.get('send');
|
5725 |
+
sender.send({data: this, url: url || sender.options.url});
|
5726 |
+
return this;
|
5727 |
+
}
|
5728 |
+
|
5729 |
+
});
|
5730 |
+
|
5731 |
+
})();
|
5732 |
+
|
5733 |
+
/*
|
5734 |
+
---
|
5735 |
+
|
5736 |
+
name: Request.HTML
|
5737 |
+
|
5738 |
+
description: Extends the basic Request Class with additional methods for interacting with HTML responses.
|
5739 |
+
|
5740 |
+
license: MIT-style license.
|
5741 |
+
|
5742 |
+
requires: [Element, Request]
|
5743 |
+
|
5744 |
+
provides: Request.HTML
|
5745 |
+
|
5746 |
+
...
|
5747 |
+
*/
|
5748 |
+
|
5749 |
+
Request.HTML = new Class({
|
5750 |
+
|
5751 |
+
Extends: Request,
|
5752 |
+
|
5753 |
+
options: {
|
5754 |
+
update: false,
|
5755 |
+
append: false,
|
5756 |
+
evalScripts: true,
|
5757 |
+
filter: false,
|
5758 |
+
headers: {
|
5759 |
+
Accept: 'text/html, application/xml, text/xml, */*'
|
5760 |
+
}
|
5761 |
+
},
|
5762 |
+
|
5763 |
+
success: function(text){
|
5764 |
+
var options = this.options, response = this.response;
|
5765 |
+
|
5766 |
+
response.html = text.stripScripts(function(script){
|
5767 |
+
response.javascript = script;
|
5768 |
+
});
|
5769 |
+
|
5770 |
+
var match = response.html.match(/<body[^>]*>([\s\S]*?)<\/body>/i);
|
5771 |
+
if (match) response.html = match[1];
|
5772 |
+
var temp = new Element('div').set('html', response.html);
|
5773 |
+
|
5774 |
+
response.tree = temp.childNodes;
|
5775 |
+
response.elements = temp.getElements(options.filter || '*');
|
5776 |
+
|
5777 |
+
if (options.filter) response.tree = response.elements;
|
5778 |
+
if (options.update){
|
5779 |
+
var update = document.id(options.update).empty();
|
5780 |
+
if (options.filter) update.adopt(response.elements);
|
5781 |
+
else update.set('html', response.html);
|
5782 |
+
} else if (options.append){
|
5783 |
+
var append = document.id(options.append);
|
5784 |
+
if (options.filter) response.elements.reverse().inject(append);
|
5785 |
+
else append.adopt(temp.getChildren());
|
5786 |
+
}
|
5787 |
+
if (options.evalScripts) Browser.exec(response.javascript);
|
5788 |
+
|
5789 |
+
this.onSuccess(response.tree, response.elements, response.html, response.javascript);
|
5790 |
+
}
|
5791 |
+
|
5792 |
+
});
|
5793 |
+
|
5794 |
+
Element.Properties.load = {
|
5795 |
+
|
5796 |
+
set: function(options){
|
5797 |
+
var load = this.get('load').cancel();
|
5798 |
+
load.setOptions(options);
|
5799 |
+
return this;
|
5800 |
+
},
|
5801 |
+
|
5802 |
+
get: function(){
|
5803 |
+
var load = this.retrieve('load');
|
5804 |
+
if (!load){
|
5805 |
+
load = new Request.HTML({data: this, link: 'cancel', update: this, method: 'get'});
|
5806 |
+
this.store('load', load);
|
5807 |
+
}
|
5808 |
+
return load;
|
5809 |
+
}
|
5810 |
+
|
5811 |
+
};
|
5812 |
+
|
5813 |
+
Element.implement({
|
5814 |
+
|
5815 |
+
load: function(){
|
5816 |
+
this.get('load').send(Array.link(arguments, {data: Type.isObject, url: Type.isString}));
|
5817 |
+
return this;
|
5818 |
+
}
|
5819 |
+
|
5820 |
+
});
|
5821 |
+
|
5822 |
+
/*
|
5823 |
+
---
|
5824 |
+
|
5825 |
+
name: JSON
|
5826 |
+
|
5827 |
+
description: JSON encoder and decoder.
|
5828 |
+
|
5829 |
+
license: MIT-style license.
|
5830 |
+
|
5831 |
+
SeeAlso: <http://www.json.org/>
|
5832 |
+
|
5833 |
+
requires: [Array, String, Number, Function]
|
5834 |
+
|
5835 |
+
provides: JSON
|
5836 |
+
|
5837 |
+
...
|
5838 |
+
*/
|
5839 |
+
|
5840 |
+
if (typeof JSON == 'undefined') this.JSON = {};
|
5841 |
+
|
5842 |
+
|
5843 |
+
|
5844 |
+
(function(){
|
5845 |
+
|
5846 |
+
var special = {'\b': '\\b', '\t': '\\t', '\n': '\\n', '\f': '\\f', '\r': '\\r', '"' : '\\"', '\\': '\\\\'};
|
5847 |
+
|
5848 |
+
var escape = function(chr){
|
5849 |
+
return special[chr] || '\\u' + ('0000' + chr.charCodeAt(0).toString(16)).slice(-4);
|
5850 |
+
};
|
5851 |
+
|
5852 |
+
JSON.validate = function(string){
|
5853 |
+
string = string.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@').
|
5854 |
+
replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']').
|
5855 |
+
replace(/(?:^|:|,)(?:\s*\[)+/g, '');
|
5856 |
+
|
5857 |
+
return (/^[\],:{}\s]*$/).test(string);
|
5858 |
+
};
|
5859 |
+
|
5860 |
+
JSON.encode = JSON.stringify ? function(obj){
|
5861 |
+
return JSON.stringify(obj);
|
5862 |
+
} : function(obj){
|
5863 |
+
if (obj && obj.toJSON) obj = obj.toJSON();
|
5864 |
+
|
5865 |
+
switch (typeOf(obj)){
|
5866 |
+
case 'string':
|
5867 |
+
return '"' + obj.replace(/[\x00-\x1f\\"]/g, escape) + '"';
|
5868 |
+
case 'array':
|
5869 |
+
return '[' + obj.map(JSON.encode).clean() + ']';
|
5870 |
+
case 'object': case 'hash':
|
5871 |
+
var string = [];
|
5872 |
+
Object.each(obj, function(value, key){
|
5873 |
+
var json = JSON.encode(value);
|
5874 |
+
if (json) string.push(JSON.encode(key) + ':' + json);
|
5875 |
+
});
|
5876 |
+
return '{' + string + '}';
|
5877 |
+
case 'number': case 'boolean': return '' + obj;
|
5878 |
+
case 'null': return 'null';
|
5879 |
+
}
|
5880 |
+
|
5881 |
+
return null;
|
5882 |
+
};
|
5883 |
+
|
5884 |
+
JSON.secure = true;
|
5885 |
+
|
5886 |
+
|
5887 |
+
JSON.decode = function(string, secure){
|
5888 |
+
if (!string || typeOf(string) != 'string') return null;
|
5889 |
+
|
5890 |
+
if (secure == null) secure = JSON.secure;
|
5891 |
+
if (secure){
|
5892 |
+
if (JSON.parse) return JSON.parse(string);
|
5893 |
+
if (!JSON.validate(string)) throw new Error('JSON could not decode the input; security is enabled and the value is not secure.');
|
5894 |
+
}
|
5895 |
+
|
5896 |
+
return eval('(' + string + ')');
|
5897 |
+
};
|
5898 |
+
|
5899 |
+
})();
|
5900 |
+
|
5901 |
+
/*
|
5902 |
+
---
|
5903 |
+
|
5904 |
+
name: Request.JSON
|
5905 |
+
|
5906 |
+
description: Extends the basic Request Class with additional methods for sending and receiving JSON data.
|
5907 |
+
|
5908 |
+
license: MIT-style license.
|
5909 |
+
|
5910 |
+
requires: [Request, JSON]
|
5911 |
+
|
5912 |
+
provides: Request.JSON
|
5913 |
+
|
5914 |
+
...
|
5915 |
+
*/
|
5916 |
+
|
5917 |
+
Request.JSON = new Class({
|
5918 |
+
|
5919 |
+
Extends: Request,
|
5920 |
+
|
5921 |
+
options: {
|
5922 |
+
/*onError: function(text, error){},*/
|
5923 |
+
secure: true
|
5924 |
+
},
|
5925 |
+
|
5926 |
+
initialize: function(options){
|
5927 |
+
this.parent(options);
|
5928 |
+
Object.append(this.headers, {
|
5929 |
+
'Accept': 'application/json',
|
5930 |
+
'X-Request': 'JSON'
|
5931 |
+
});
|
5932 |
+
},
|
5933 |
+
|
5934 |
+
success: function(text){
|
5935 |
+
var json;
|
5936 |
+
try {
|
5937 |
+
json = this.response.json = JSON.decode(text, this.options.secure);
|
5938 |
+
} catch (error){
|
5939 |
+
this.fireEvent('error', [text, error]);
|
5940 |
+
return;
|
5941 |
+
}
|
5942 |
+
if (json == null) this.onFailure();
|
5943 |
+
else this.onSuccess(json, text);
|
5944 |
+
}
|
5945 |
+
|
5946 |
+
});
|
5947 |
+
|
5948 |
+
/*
|
5949 |
+
---
|
5950 |
+
|
5951 |
+
name: Cookie
|
5952 |
+
|
5953 |
+
description: Class for creating, reading, and deleting browser Cookies.
|
5954 |
+
|
5955 |
+
license: MIT-style license.
|
5956 |
+
|
5957 |
+
credits:
|
5958 |
+
- Based on the functions by Peter-Paul Koch (http://quirksmode.org).
|
5959 |
+
|
5960 |
+
requires: [Options, Browser]
|
5961 |
+
|
5962 |
+
provides: Cookie
|
5963 |
+
|
5964 |
+
...
|
5965 |
+
*/
|
5966 |
+
|
5967 |
+
var Cookie = new Class({
|
5968 |
+
|
5969 |
+
Implements: Options,
|
5970 |
+
|
5971 |
+
options: {
|
5972 |
+
path: '/',
|
5973 |
+
domain: false,
|
5974 |
+
duration: false,
|
5975 |
+
secure: false,
|
5976 |
+
document: document,
|
5977 |
+
encode: true,
|
5978 |
+
httpOnly: false
|
5979 |
+
},
|
5980 |
+
|
5981 |
+
initialize: function(key, options){
|
5982 |
+
this.key = key;
|
5983 |
+
this.setOptions(options);
|
5984 |
+
},
|
5985 |
+
|
5986 |
+
write: function(value){
|
5987 |
+
if (this.options.encode) value = encodeURIComponent(value);
|
5988 |
+
if (this.options.domain) value += '; domain=' + this.options.domain;
|
5989 |
+
if (this.options.path) value += '; path=' + this.options.path;
|
5990 |
+
if (this.options.duration){
|
5991 |
+
var date = new Date();
|
5992 |
+
date.setTime(date.getTime() + this.options.duration * 24 * 60 * 60 * 1000);
|
5993 |
+
value += '; expires=' + date.toGMTString();
|
5994 |
+
}
|
5995 |
+
if (this.options.secure) value += '; secure';
|
5996 |
+
if (this.options.httpOnly) value += '; HttpOnly';
|
5997 |
+
this.options.document.cookie = this.key + '=' + value;
|
5998 |
+
return this;
|
5999 |
+
},
|
6000 |
+
|
6001 |
+
read: function(){
|
6002 |
+
var value = this.options.document.cookie.match('(?:^|;)\\s*' + this.key.escapeRegExp() + '=([^;]*)');
|
6003 |
+
return (value) ? decodeURIComponent(value[1]) : null;
|
6004 |
+
},
|
6005 |
+
|
6006 |
+
dispose: function(){
|
6007 |
+
new Cookie(this.key, Object.merge({}, this.options, {duration: -1})).write('');
|
6008 |
+
return this;
|
6009 |
+
}
|
6010 |
+
|
6011 |
+
});
|
6012 |
+
|
6013 |
+
Cookie.write = function(key, value, options){
|
6014 |
+
return new Cookie(key, options).write(value);
|
6015 |
+
};
|
6016 |
+
|
6017 |
+
Cookie.read = function(key){
|
6018 |
+
return new Cookie(key).read();
|
6019 |
+
};
|
6020 |
+
|
6021 |
+
Cookie.dispose = function(key, options){
|
6022 |
+
return new Cookie(key, options).dispose();
|
6023 |
+
};
|
6024 |
+
|
6025 |
+
/*
|
6026 |
+
---
|
6027 |
+
|
6028 |
+
name: DOMReady
|
6029 |
+
|
6030 |
+
description: Contains the custom event domready.
|
6031 |
+
|
6032 |
+
license: MIT-style license.
|
6033 |
+
|
6034 |
+
requires: [Browser, Element, Element.Event]
|
6035 |
+
|
6036 |
+
provides: [DOMReady, DomReady]
|
6037 |
+
|
6038 |
+
...
|
6039 |
+
*/
|
6040 |
+
|
6041 |
+
(function(window, document){
|
6042 |
+
|
6043 |
+
var ready,
|
6044 |
+
loaded,
|
6045 |
+
checks = [],
|
6046 |
+
shouldPoll,
|
6047 |
+
timer,
|
6048 |
+
testElement = document.createElement('div');
|
6049 |
+
|
6050 |
+
var domready = function(){
|
6051 |
+
clearTimeout(timer);
|
6052 |
+
if (!ready) {
|
6053 |
+
Browser.loaded = ready = true;
|
6054 |
+
document.removeListener('DOMContentLoaded', domready).removeListener('readystatechange', check);
|
6055 |
+
document.fireEvent('domready');
|
6056 |
+
window.fireEvent('domready');
|
6057 |
+
}
|
6058 |
+
// cleanup scope vars
|
6059 |
+
document = window = testElement = null;
|
6060 |
+
};
|
6061 |
+
|
6062 |
+
var check = function(){
|
6063 |
+
for (var i = checks.length; i--;) if (checks[i]()){
|
6064 |
+
domready();
|
6065 |
+
return true;
|
6066 |
+
}
|
6067 |
+
return false;
|
6068 |
+
};
|
6069 |
+
|
6070 |
+
var poll = function(){
|
6071 |
+
clearTimeout(timer);
|
6072 |
+
if (!check()) timer = setTimeout(poll, 10);
|
6073 |
+
};
|
6074 |
+
|
6075 |
+
document.addListener('DOMContentLoaded', domready);
|
6076 |
+
|
6077 |
+
/*<ltIE8>*/
|
6078 |
+
// doScroll technique by Diego Perini http://javascript.nwbox.com/IEContentLoaded/
|
6079 |
+
// testElement.doScroll() throws when the DOM is not ready, only in the top window
|
6080 |
+
var doScrollWorks = function(){
|
6081 |
+
try {
|
6082 |
+
testElement.doScroll();
|
6083 |
+
return true;
|
6084 |
+
} catch (e){}
|
6085 |
+
return false;
|
6086 |
+
};
|
6087 |
+
// If doScroll works already, it can't be used to determine domready
|
6088 |
+
// e.g. in an iframe
|
6089 |
+
if (testElement.doScroll && !doScrollWorks()){
|
6090 |
+
checks.push(doScrollWorks);
|
6091 |
+
shouldPoll = true;
|
6092 |
+
}
|
6093 |
+
/*</ltIE8>*/
|
6094 |
+
|
6095 |
+
if (document.readyState) checks.push(function(){
|
6096 |
+
var state = document.readyState;
|
6097 |
+
return (state == 'loaded' || state == 'complete');
|
6098 |
+
});
|
6099 |
+
|
6100 |
+
if ('onreadystatechange' in document) document.addListener('readystatechange', check);
|
6101 |
+
else shouldPoll = true;
|
6102 |
+
|
6103 |
+
if (shouldPoll) poll();
|
6104 |
+
|
6105 |
+
Element.Events.domready = {
|
6106 |
+
onAdd: function(fn){
|
6107 |
+
if (ready) fn.call(this);
|
6108 |
+
}
|
6109 |
+
};
|
6110 |
+
|
6111 |
+
// Make sure that domready fires before load
|
6112 |
+
Element.Events.load = {
|
6113 |
+
base: 'load',
|
6114 |
+
onAdd: function(fn){
|
6115 |
+
if (loaded && this == window) fn.call(this);
|
6116 |
+
},
|
6117 |
+
condition: function(){
|
6118 |
+
if (this == window){
|
6119 |
+
domready();
|
6120 |
+
delete Element.Events.load;
|
6121 |
+
}
|
6122 |
+
return true;
|
6123 |
+
}
|
6124 |
+
};
|
6125 |
+
|
6126 |
+
// This is based on the custom load event
|
6127 |
+
window.addEvent('load', function(){
|
6128 |
+
loaded = true;
|
6129 |
+
});
|
6130 |
+
|
6131 |
+
})(window, document);
|
assets_libraries/animate/animate.css
ADDED
@@ -0,0 +1,1579 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
@charset "UTF-8";
|
2 |
+
|
3 |
+
/*!
|
4 |
+
* animate.css -http://daneden.me/animate
|
5 |
+
* Version - 3.5.2
|
6 |
+
* Licensed under the MIT license - http://opensource.org/licenses/MIT
|
7 |
+
*
|
8 |
+
* Copyright (c) 2017 Daniel Eden
|
9 |
+
*/
|
10 |
+
|
11 |
+
.animated {
|
12 |
+
animation-duration: 1s;
|
13 |
+
animation-fill-mode: both;
|
14 |
+
}
|
15 |
+
|
16 |
+
.animated.infinite {
|
17 |
+
animation-iteration-count: infinite;
|
18 |
+
}
|
19 |
+
|
20 |
+
.animated.hinge {
|
21 |
+
animation-duration: 2s;
|
22 |
+
}
|
23 |
+
|
24 |
+
.animated.flipOutX,
|
25 |
+
.animated.flipOutY,
|
26 |
+
.animated.bounceIn,
|
27 |
+
.animated.bounceOut {
|
28 |
+
animation-duration: .75s;
|
29 |
+
}
|
30 |
+
|
31 |
+
@keyframes bounce {
|
32 |
+
from, 20%, 53%, 80%, to {
|
33 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
34 |
+
transform: translate3d(0,0,0);
|
35 |
+
}
|
36 |
+
|
37 |
+
40%, 43% {
|
38 |
+
animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
|
39 |
+
transform: translate3d(0, -30px, 0);
|
40 |
+
}
|
41 |
+
|
42 |
+
70% {
|
43 |
+
animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
|
44 |
+
transform: translate3d(0, -15px, 0);
|
45 |
+
}
|
46 |
+
|
47 |
+
90% {
|
48 |
+
transform: translate3d(0,-4px,0);
|
49 |
+
}
|
50 |
+
}
|
51 |
+
|
52 |
+
.bounce {
|
53 |
+
animation-name: bounce;
|
54 |
+
transform-origin: center bottom;
|
55 |
+
}
|
56 |
+
|
57 |
+
@keyframes flash {
|
58 |
+
from, 50%, to {
|
59 |
+
opacity: 1;
|
60 |
+
}
|
61 |
+
|
62 |
+
25%, 75% {
|
63 |
+
opacity: 0;
|
64 |
+
}
|
65 |
+
}
|
66 |
+
|
67 |
+
.flash {
|
68 |
+
animation-name: flash;
|
69 |
+
}
|
70 |
+
|
71 |
+
/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
|
72 |
+
|
73 |
+
@keyframes pulse {
|
74 |
+
from {
|
75 |
+
transform: scale3d(1, 1, 1);
|
76 |
+
}
|
77 |
+
|
78 |
+
50% {
|
79 |
+
transform: scale3d(1.05, 1.05, 1.05);
|
80 |
+
}
|
81 |
+
|
82 |
+
to {
|
83 |
+
transform: scale3d(1, 1, 1);
|
84 |
+
}
|
85 |
+
}
|
86 |
+
|
87 |
+
.pulse {
|
88 |
+
animation-name: pulse;
|
89 |
+
}
|
90 |
+
|
91 |
+
@keyframes rubberBand {
|
92 |
+
from {
|
93 |
+
transform: scale3d(1, 1, 1);
|
94 |
+
}
|
95 |
+
|
96 |
+
30% {
|
97 |
+
transform: scale3d(1.25, 0.75, 1);
|
98 |
+
}
|
99 |
+
|
100 |
+
40% {
|
101 |
+
transform: scale3d(0.75, 1.25, 1);
|
102 |
+
}
|
103 |
+
|
104 |
+
50% {
|
105 |
+
transform: scale3d(1.15, 0.85, 1);
|
106 |
+
}
|
107 |
+
|
108 |
+
65% {
|
109 |
+
transform: scale3d(.95, 1.05, 1);
|
110 |
+
}
|
111 |
+
|
112 |
+
75% {
|
113 |
+
transform: scale3d(1.05, .95, 1);
|
114 |
+
}
|
115 |
+
|
116 |
+
to {
|
117 |
+
transform: scale3d(1, 1, 1);
|
118 |
+
}
|
119 |
+
}
|
120 |
+
|
121 |
+
.rubberBand {
|
122 |
+
animation-name: rubberBand;
|
123 |
+
}
|
124 |
+
|
125 |
+
@keyframes shake {
|
126 |
+
from, to {
|
127 |
+
transform: translate3d(0, 0, 0);
|
128 |
+
}
|
129 |
+
|
130 |
+
10%, 30%, 50%, 70%, 90% {
|
131 |
+
transform: translate3d(-10px, 0, 0);
|
132 |
+
}
|
133 |
+
|
134 |
+
20%, 40%, 60%, 80% {
|
135 |
+
transform: translate3d(10px, 0, 0);
|
136 |
+
}
|
137 |
+
}
|
138 |
+
|
139 |
+
.shake {
|
140 |
+
animation-name: shake;
|
141 |
+
}
|
142 |
+
|
143 |
+
@keyframes headShake {
|
144 |
+
0% {
|
145 |
+
transform: translateX(0);
|
146 |
+
}
|
147 |
+
|
148 |
+
6.5% {
|
149 |
+
transform: translateX(-6px) rotateY(-9deg);
|
150 |
+
}
|
151 |
+
|
152 |
+
18.5% {
|
153 |
+
transform: translateX(5px) rotateY(7deg);
|
154 |
+
}
|
155 |
+
|
156 |
+
31.5% {
|
157 |
+
transform: translateX(-3px) rotateY(-5deg);
|
158 |
+
}
|
159 |
+
|
160 |
+
43.5% {
|
161 |
+
transform: translateX(2px) rotateY(3deg);
|
162 |
+
}
|
163 |
+
|
164 |
+
50% {
|
165 |
+
transform: translateX(0);
|
166 |
+
}
|
167 |
+
}
|
168 |
+
|
169 |
+
.headShake {
|
170 |
+
animation-timing-function: ease-in-out;
|
171 |
+
animation-name: headShake;
|
172 |
+
}
|
173 |
+
|
174 |
+
@keyframes swing {
|
175 |
+
20% {
|
176 |
+
transform: rotate3d(0, 0, 1, 15deg);
|
177 |
+
}
|
178 |
+
|
179 |
+
40% {
|
180 |
+
transform: rotate3d(0, 0, 1, -10deg);
|
181 |
+
}
|
182 |
+
|
183 |
+
60% {
|
184 |
+
transform: rotate3d(0, 0, 1, 5deg);
|
185 |
+
}
|
186 |
+
|
187 |
+
80% {
|
188 |
+
transform: rotate3d(0, 0, 1, -5deg);
|
189 |
+
}
|
190 |
+
|
191 |
+
to {
|
192 |
+
transform: rotate3d(0, 0, 1, 0deg);
|
193 |
+
}
|
194 |
+
}
|
195 |
+
|
196 |
+
.swing {
|
197 |
+
transform-origin: top center;
|
198 |
+
animation-name: swing;
|
199 |
+
}
|
200 |
+
|
201 |
+
@keyframes tada {
|
202 |
+
from {
|
203 |
+
transform: scale3d(1, 1, 1);
|
204 |
+
}
|
205 |
+
|
206 |
+
10%, 20% {
|
207 |
+
transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
|
208 |
+
}
|
209 |
+
|
210 |
+
30%, 50%, 70%, 90% {
|
211 |
+
transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
|
212 |
+
}
|
213 |
+
|
214 |
+
40%, 60%, 80% {
|
215 |
+
transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
|
216 |
+
}
|
217 |
+
|
218 |
+
to {
|
219 |
+
transform: scale3d(1, 1, 1);
|
220 |
+
}
|
221 |
+
}
|
222 |
+
|
223 |
+
.tada {
|
224 |
+
animation-name: tada;
|
225 |
+
}
|
226 |
+
|
227 |
+
/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
|
228 |
+
|
229 |
+
@keyframes wobble {
|
230 |
+
from {
|
231 |
+
transform: none;
|
232 |
+
}
|
233 |
+
|
234 |
+
15% {
|
235 |
+
transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
|
236 |
+
}
|
237 |
+
|
238 |
+
30% {
|
239 |
+
transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
|
240 |
+
}
|
241 |
+
|
242 |
+
45% {
|
243 |
+
transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
|
244 |
+
}
|
245 |
+
|
246 |
+
60% {
|
247 |
+
transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
|
248 |
+
}
|
249 |
+
|
250 |
+
75% {
|
251 |
+
transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
|
252 |
+
}
|
253 |
+
|
254 |
+
to {
|
255 |
+
transform: none;
|
256 |
+
}
|
257 |
+
}
|
258 |
+
|
259 |
+
.wobble {
|
260 |
+
animation-name: wobble;
|
261 |
+
}
|
262 |
+
|
263 |
+
@keyframes jello {
|
264 |
+
from, 11.1%, to {
|
265 |
+
transform: none;
|
266 |
+
}
|
267 |
+
|
268 |
+
22.2% {
|
269 |
+
transform: skewX(-12.5deg) skewY(-12.5deg);
|
270 |
+
}
|
271 |
+
|
272 |
+
33.3% {
|
273 |
+
transform: skewX(6.25deg) skewY(6.25deg);
|
274 |
+
}
|
275 |
+
|
276 |
+
44.4% {
|
277 |
+
transform: skewX(-3.125deg) skewY(-3.125deg);
|
278 |
+
}
|
279 |
+
|
280 |
+
55.5% {
|
281 |
+
transform: skewX(1.5625deg) skewY(1.5625deg);
|
282 |
+
}
|
283 |
+
|
284 |
+
66.6% {
|
285 |
+
transform: skewX(-0.78125deg) skewY(-0.78125deg);
|
286 |
+
}
|
287 |
+
|
288 |
+
77.7% {
|
289 |
+
transform: skewX(0.390625deg) skewY(0.390625deg);
|
290 |
+
}
|
291 |
+
|
292 |
+
88.8% {
|
293 |
+
transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
|
294 |
+
}
|
295 |
+
}
|
296 |
+
|
297 |
+
.jello {
|
298 |
+
animation-name: jello;
|
299 |
+
transform-origin: center;
|
300 |
+
}
|
301 |
+
|
302 |
+
@keyframes bounceIn {
|
303 |
+
from, 20%, 40%, 60%, 80%, to {
|
304 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
305 |
+
}
|
306 |
+
|
307 |
+
0% {
|
308 |
+
opacity: 0;
|
309 |
+
transform: scale3d(.3, .3, .3);
|
310 |
+
}
|
311 |
+
|
312 |
+
20% {
|
313 |
+
transform: scale3d(1.1, 1.1, 1.1);
|
314 |
+
}
|
315 |
+
|
316 |
+
40% {
|
317 |
+
transform: scale3d(.9, .9, .9);
|
318 |
+
}
|
319 |
+
|
320 |
+
60% {
|
321 |
+
opacity: 1;
|
322 |
+
transform: scale3d(1.03, 1.03, 1.03);
|
323 |
+
}
|
324 |
+
|
325 |
+
80% {
|
326 |
+
transform: scale3d(.97, .97, .97);
|
327 |
+
}
|
328 |
+
|
329 |
+
to {
|
330 |
+
opacity: 1;
|
331 |
+
transform: scale3d(1, 1, 1);
|
332 |
+
}
|
333 |
+
}
|
334 |
+
|
335 |
+
.bounceIn {
|
336 |
+
animation-name: bounceIn;
|
337 |
+
}
|
338 |
+
|
339 |
+
@keyframes bounceInDown {
|
340 |
+
from, 60%, 75%, 90%, to {
|
341 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
342 |
+
}
|
343 |
+
|
344 |
+
0% {
|
345 |
+
opacity: 0;
|
346 |
+
transform: translate3d(0, -3000px, 0);
|
347 |
+
}
|
348 |
+
|
349 |
+
60% {
|
350 |
+
opacity: 1;
|
351 |
+
transform: translate3d(0, 25px, 0);
|
352 |
+
}
|
353 |
+
|
354 |
+
75% {
|
355 |
+
transform: translate3d(0, -10px, 0);
|
356 |
+
}
|
357 |
+
|
358 |
+
90% {
|
359 |
+
transform: translate3d(0, 5px, 0);
|
360 |
+
}
|
361 |
+
|
362 |
+
to {
|
363 |
+
transform: none;
|
364 |
+
}
|
365 |
+
}
|
366 |
+
|
367 |
+
.bounceInDown {
|
368 |
+
animation-name: bounceInDown;
|
369 |
+
}
|
370 |
+
|
371 |
+
@keyframes bounceInLeft {
|
372 |
+
from, 60%, 75%, 90%, to {
|
373 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
374 |
+
}
|
375 |
+
|
376 |
+
0% {
|
377 |
+
opacity: 0;
|
378 |
+
transform: translate3d(-3000px, 0, 0);
|
379 |
+
}
|
380 |
+
|
381 |
+
60% {
|
382 |
+
opacity: 1;
|
383 |
+
transform: translate3d(25px, 0, 0);
|
384 |
+
}
|
385 |
+
|
386 |
+
75% {
|
387 |
+
transform: translate3d(-10px, 0, 0);
|
388 |
+
}
|
389 |
+
|
390 |
+
90% {
|
391 |
+
transform: translate3d(5px, 0, 0);
|
392 |
+
}
|
393 |
+
|
394 |
+
to {
|
395 |
+
transform: none;
|
396 |
+
}
|
397 |
+
}
|
398 |
+
|
399 |
+
.bounceInLeft {
|
400 |
+
animation-name: bounceInLeft;
|
401 |
+
}
|
402 |
+
|
403 |
+
@keyframes bounceInRight {
|
404 |
+
from, 60%, 75%, 90%, to {
|
405 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
406 |
+
}
|
407 |
+
|
408 |
+
from {
|
409 |
+
opacity: 0;
|
410 |
+
transform: translate3d(3000px, 0, 0);
|
411 |
+
}
|
412 |
+
|
413 |
+
60% {
|
414 |
+
opacity: 1;
|
415 |
+
transform: translate3d(-25px, 0, 0);
|
416 |
+
}
|
417 |
+
|
418 |
+
75% {
|
419 |
+
transform: translate3d(10px, 0, 0);
|
420 |
+
}
|
421 |
+
|
422 |
+
90% {
|
423 |
+
transform: translate3d(-5px, 0, 0);
|
424 |
+
}
|
425 |
+
|
426 |
+
to {
|
427 |
+
transform: none;
|
428 |
+
}
|
429 |
+
}
|
430 |
+
|
431 |
+
.bounceInRight {
|
432 |
+
animation-name: bounceInRight;
|
433 |
+
}
|
434 |
+
|
435 |
+
@keyframes bounceInUp {
|
436 |
+
from, 60%, 75%, 90%, to {
|
437 |
+
animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
|
438 |
+
}
|
439 |
+
|
440 |
+
from {
|
441 |
+
opacity: 0;
|
442 |
+
transform: translate3d(0, 3000px, 0);
|
443 |
+
}
|
444 |
+
|
445 |
+
60% {
|
446 |
+
opacity: 1;
|
447 |
+
transform: translate3d(0, -20px, 0);
|
448 |
+
}
|
449 |
+
|
450 |
+
75% {
|
451 |
+
transform: translate3d(0, 10px, 0);
|
452 |
+
}
|
453 |
+
|
454 |
+
90% {
|
455 |
+
transform: translate3d(0, -5px, 0);
|
456 |
+
}
|
457 |
+
|
458 |
+
to {
|
459 |
+
transform: translate3d(0, 0, 0);
|
460 |
+
}
|
461 |
+
}
|
462 |
+
|
463 |
+
.bounceInUp {
|
464 |
+
animation-name: bounceInUp;
|
465 |
+
}
|
466 |
+
|
467 |
+
@keyframes bounceOut {
|
468 |
+
20% {
|
469 |
+
transform: scale3d(.9, .9, .9);
|
470 |
+
}
|
471 |
+
|
472 |
+
50%, 55% {
|
473 |
+
opacity: 1;
|
474 |
+
transform: scale3d(1.1, 1.1, 1.1);
|
475 |
+
}
|
476 |
+
|
477 |
+
to {
|
478 |
+
opacity: 0;
|
479 |
+
transform: scale3d(.3, .3, .3);
|
480 |
+
}
|
481 |
+
}
|
482 |
+
|
483 |
+
.bounceOut {
|
484 |
+
animation-name: bounceOut;
|
485 |
+
}
|
486 |
+
|
487 |
+
@keyframes bounceOutDown {
|
488 |
+
20% {
|
489 |
+
transform: translate3d(0, 10px, 0);
|
490 |
+
}
|
491 |
+
|
492 |
+
40%, 45% {
|
493 |
+
opacity: 1;
|
494 |
+
transform: translate3d(0, -20px, 0);
|
495 |
+
}
|
496 |
+
|
497 |
+
to {
|
498 |
+
opacity: 0;
|
499 |
+
transform: translate3d(0, 2000px, 0);
|
500 |
+
}
|
501 |
+
}
|
502 |
+
|
503 |
+
.bounceOutDown {
|
504 |
+
animation-name: bounceOutDown;
|
505 |
+
}
|
506 |
+
|
507 |
+
@keyframes bounceOutLeft {
|
508 |
+
20% {
|
509 |
+
opacity: 1;
|
510 |
+
transform: translate3d(20px, 0, 0);
|
511 |
+
}
|
512 |
+
|
513 |
+
to {
|
514 |
+
opacity: 0;
|
515 |
+
transform: translate3d(-2000px, 0, 0);
|
516 |
+
}
|
517 |
+
}
|
518 |
+
|
519 |
+
.bounceOutLeft {
|
520 |
+
animation-name: bounceOutLeft;
|
521 |
+
}
|
522 |
+
|
523 |
+
@keyframes bounceOutRight {
|
524 |
+
20% {
|
525 |
+
opacity: 1;
|
526 |
+
transform: translate3d(-20px, 0, 0);
|
527 |
+
}
|
528 |
+
|
529 |
+
to {
|
530 |
+
opacity: 0;
|
531 |
+
transform: translate3d(2000px, 0, 0);
|
532 |
+
}
|
533 |
+
}
|
534 |
+
|
535 |
+
.bounceOutRight {
|
536 |
+
animation-name: bounceOutRight;
|
537 |
+
}
|
538 |
+
|
539 |
+
@keyframes bounceOutUp {
|
540 |
+
20% {
|
541 |
+
transform: translate3d(0, -10px, 0);
|
542 |
+
}
|
543 |
+
|
544 |
+
40%, 45% {
|
545 |
+
opacity: 1;
|
546 |
+
transform: translate3d(0, 20px, 0);
|
547 |
+
}
|
548 |
+
|
549 |
+
to {
|
550 |
+
opacity: 0;
|
551 |
+
transform: translate3d(0, -2000px, 0);
|
552 |
+
}
|
553 |
+
}
|
554 |
+
|
555 |
+
.bounceOutUp {
|
556 |
+
animation-name: bounceOutUp;
|
557 |
+
}
|
558 |
+
|
559 |
+
@keyframes fadeIn {
|
560 |
+
from {
|
561 |
+
opacity: 0;
|
562 |
+
}
|
563 |
+
|
564 |
+
to {
|
565 |
+
opacity: 1;
|
566 |
+
}
|
567 |
+
}
|
568 |
+
|
569 |
+
.fadeIn {
|
570 |
+
animation-name: fadeIn;
|
571 |
+
}
|
572 |
+
|
573 |
+
@keyframes fadeInDown {
|
574 |
+
from {
|
575 |
+
opacity: 0;
|
576 |
+
transform: translate3d(0, -100%, 0);
|
577 |
+
}
|
578 |
+
|
579 |
+
to {
|
580 |
+
opacity: 1;
|
581 |
+
transform: none;
|
582 |
+
}
|
583 |
+
}
|
584 |
+
|
585 |
+
.fadeInDown {
|
586 |
+
animation-name: fadeInDown;
|
587 |
+
}
|
588 |
+
|
589 |
+
@keyframes fadeInDownBig {
|
590 |
+
from {
|
591 |
+
opacity: 0;
|
592 |
+
transform: translate3d(0, -2000px, 0);
|
593 |
+
}
|
594 |
+
|
595 |
+
to {
|
596 |
+
opacity: 1;
|
597 |
+
transform: none;
|
598 |
+
}
|
599 |
+
}
|
600 |
+
|
601 |
+
.fadeInDownBig {
|
602 |
+
animation-name: fadeInDownBig;
|
603 |
+
}
|
604 |
+
|
605 |
+
@keyframes fadeInLeft {
|
606 |
+
from {
|
607 |
+
opacity: 0;
|
608 |
+
transform: translate3d(-100%, 0, 0);
|
609 |
+
}
|
610 |
+
|
611 |
+
to {
|
612 |
+
opacity: 1;
|
613 |
+
transform: none;
|
614 |
+
}
|
615 |
+
}
|
616 |
+
|
617 |
+
.fadeInLeft {
|
618 |
+
animation-name: fadeInLeft;
|
619 |
+
}
|
620 |
+
|
621 |
+
@keyframes fadeInLeftBig {
|
622 |
+
from {
|
623 |
+
opacity: 0;
|
624 |
+
transform: translate3d(-2000px, 0, 0);
|
625 |
+
}
|
626 |
+
|
627 |
+
to {
|
628 |
+
opacity: 1;
|
629 |
+
transform: none;
|
630 |
+
}
|
631 |
+
}
|
632 |
+
|
633 |
+
.fadeInLeftBig {
|
634 |
+
animation-name: fadeInLeftBig;
|
635 |
+
}
|
636 |
+
|
637 |
+
@keyframes fadeInRight {
|
638 |
+
from {
|
639 |
+
opacity: 0;
|
640 |
+
transform: translate3d(100%, 0, 0);
|
641 |
+
}
|
642 |
+
|
643 |
+
to {
|
644 |
+
opacity: 1;
|
645 |
+
transform: none;
|
646 |
+
}
|
647 |
+
}
|
648 |
+
|
649 |
+
.fadeInRight {
|
650 |
+
animation-name: fadeInRight;
|
651 |
+
}
|
652 |
+
|
653 |
+
@keyframes fadeInRightBig {
|
654 |
+
from {
|
655 |
+
opacity: 0;
|
656 |
+
transform: translate3d(2000px, 0, 0);
|
657 |
+
}
|
658 |
+
|
659 |
+
to {
|
660 |
+
opacity: 1;
|
661 |
+
transform: none;
|
662 |
+
}
|
663 |
+
}
|
664 |
+
|
665 |
+
.fadeInRightBig {
|
666 |
+
animation-name: fadeInRightBig;
|
667 |
+
}
|
668 |
+
|
669 |
+
@keyframes fadeInUp {
|
670 |
+
from {
|
671 |
+
opacity: 0;
|
672 |
+
transform: translate3d(0, 100%, 0);
|
673 |
+
}
|
674 |
+
|
675 |
+
to {
|
676 |
+
opacity: 1;
|
677 |
+
transform: none;
|
678 |
+
}
|
679 |
+
}
|
680 |
+
|
681 |
+
.fadeInUp {
|
682 |
+
animation-name: fadeInUp;
|
683 |
+
}
|
684 |
+
|
685 |
+
@keyframes fadeInUpBig {
|
686 |
+
from {
|
687 |
+
opacity: 0;
|
688 |
+
transform: translate3d(0, 2000px, 0);
|
689 |
+
}
|
690 |
+
|
691 |
+
to {
|
692 |
+
opacity: 1;
|
693 |
+
transform: none;
|
694 |
+
}
|
695 |
+
}
|
696 |
+
|
697 |
+
.fadeInUpBig {
|
698 |
+
animation-name: fadeInUpBig;
|
699 |
+
}
|
700 |
+
|
701 |
+
@keyframes fadeOut {
|
702 |
+
from {
|
703 |
+
opacity: 1;
|
704 |
+
}
|
705 |
+
|
706 |
+
to {
|
707 |
+
opacity: 0;
|
708 |
+
}
|
709 |
+
}
|
710 |
+
|
711 |
+
.fadeOut {
|
712 |
+
animation-name: fadeOut;
|
713 |
+
}
|
714 |
+
|
715 |
+
@keyframes fadeOutDown {
|
716 |
+
from {
|
717 |
+
opacity: 1;
|
718 |
+
}
|
719 |
+
|
720 |
+
to {
|
721 |
+
opacity: 0;
|
722 |
+
transform: translate3d(0, 100%, 0);
|
723 |
+
}
|
724 |
+
}
|
725 |
+
|
726 |
+
.fadeOutDown {
|
727 |
+
animation-name: fadeOutDown;
|
728 |
+
}
|
729 |
+
|
730 |
+
@keyframes fadeOutDownBig {
|
731 |
+
from {
|
732 |
+
opacity: 1;
|
733 |
+
}
|
734 |
+
|
735 |
+
to {
|
736 |
+
opacity: 0;
|
737 |
+
transform: translate3d(0, 2000px, 0);
|
738 |
+
}
|
739 |
+
}
|
740 |
+
|
741 |
+
.fadeOutDownBig {
|
742 |
+
animation-name: fadeOutDownBig;
|
743 |
+
}
|
744 |
+
|
745 |
+
@keyframes fadeOutLeft {
|
746 |
+
from {
|
747 |
+
opacity: 1;
|
748 |
+
}
|
749 |
+
|
750 |
+
to {
|
751 |
+
opacity: 0;
|
752 |
+
transform: translate3d(-100%, 0, 0);
|
753 |
+
}
|
754 |
+
}
|
755 |
+
|
756 |
+
.fadeOutLeft {
|
757 |
+
animation-name: fadeOutLeft;
|
758 |
+
}
|
759 |
+
|
760 |
+
@keyframes fadeOutLeftBig {
|
761 |
+
from {
|
762 |
+
opacity: 1;
|
763 |
+
}
|
764 |
+
|
765 |
+
to {
|
766 |
+
opacity: 0;
|
767 |
+
transform: translate3d(-2000px, 0, 0);
|
768 |
+
}
|
769 |
+
}
|
770 |
+
|
771 |
+
.fadeOutLeftBig {
|
772 |
+
animation-name: fadeOutLeftBig;
|
773 |
+
}
|
774 |
+
|
775 |
+
@keyframes fadeOutRight {
|
776 |
+
from {
|
777 |
+
opacity: 1;
|
778 |
+
}
|
779 |
+
|
780 |
+
to {
|
781 |
+
opacity: 0;
|
782 |
+
transform: translate3d(100%, 0, 0);
|
783 |
+
}
|
784 |
+
}
|
785 |
+
|
786 |
+
.fadeOutRight {
|
787 |
+
animation-name: fadeOutRight;
|
788 |
+
}
|
789 |
+
|
790 |
+
@keyframes fadeOutRightBig {
|
791 |
+
from {
|
792 |
+
opacity: 1;
|
793 |
+
}
|
794 |
+
|
795 |
+
to {
|
796 |
+
opacity: 0;
|
797 |
+
transform: translate3d(2000px, 0, 0);
|
798 |
+
}
|
799 |
+
}
|
800 |
+
|
801 |
+
.fadeOutRightBig {
|
802 |
+
animation-name: fadeOutRightBig;
|
803 |
+
}
|
804 |
+
|
805 |
+
@keyframes fadeOutUp {
|
806 |
+
from {
|
807 |
+
opacity: 1;
|
808 |
+
}
|
809 |
+
|
810 |
+
to {
|
811 |
+
opacity: 0;
|
812 |
+
transform: translate3d(0, -100%, 0);
|
813 |
+
}
|
814 |
+
}
|
815 |
+
|
816 |
+
.fadeOutUp {
|
817 |
+
animation-name: fadeOutUp;
|
818 |
+
}
|
819 |
+
|
820 |
+
@keyframes fadeOutUpBig {
|
821 |
+
from {
|
822 |
+
opacity: 1;
|
823 |
+
}
|
824 |
+
|
825 |
+
to {
|
826 |
+
opacity: 0;
|
827 |
+
transform: translate3d(0, -2000px, 0);
|
828 |
+
}
|
829 |
+
}
|
830 |
+
|
831 |
+
.fadeOutUpBig {
|
832 |
+
animation-name: fadeOutUpBig;
|
833 |
+
}
|
834 |
+
|
835 |
+
@keyframes flip {
|
836 |
+
from {
|
837 |
+
transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
|
838 |
+
animation-timing-function: ease-out;
|
839 |
+
}
|
840 |
+
|
841 |
+
40% {
|
842 |
+
transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
|
843 |
+
animation-timing-function: ease-out;
|
844 |
+
}
|
845 |
+
|
846 |
+
50% {
|
847 |
+
transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
|
848 |
+
animation-timing-function: ease-in;
|
849 |
+
}
|
850 |
+
|
851 |
+
80% {
|
852 |
+
transform: perspective(400px) scale3d(.95, .95, .95);
|
853 |
+
animation-timing-function: ease-in;
|
854 |
+
}
|
855 |
+
|
856 |
+
to {
|
857 |
+
transform: perspective(400px);
|
858 |
+
animation-timing-function: ease-in;
|
859 |
+
}
|
860 |
+
}
|
861 |
+
|
862 |
+
.animated.flip {
|
863 |
+
-webkit-backface-visibility: visible;
|
864 |
+
backface-visibility: visible;
|
865 |
+
animation-name: flip;
|
866 |
+
}
|
867 |
+
|
868 |
+
@keyframes flipInX {
|
869 |
+
from {
|
870 |
+
transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
|
871 |
+
animation-timing-function: ease-in;
|
872 |
+
opacity: 0;
|
873 |
+
}
|
874 |
+
|
875 |
+
40% {
|
876 |
+
transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
|
877 |
+
animation-timing-function: ease-in;
|
878 |
+
}
|
879 |
+
|
880 |
+
60% {
|
881 |
+
transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
|
882 |
+
opacity: 1;
|
883 |
+
}
|
884 |
+
|
885 |
+
80% {
|
886 |
+
transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
|
887 |
+
}
|
888 |
+
|
889 |
+
to {
|
890 |
+
transform: perspective(400px);
|
891 |
+
}
|
892 |
+
}
|
893 |
+
|
894 |
+
.flipInX {
|
895 |
+
-webkit-backface-visibility: visible !important;
|
896 |
+
backface-visibility: visible !important;
|
897 |
+
animation-name: flipInX;
|
898 |
+
}
|
899 |
+
|
900 |
+
@keyframes flipInY {
|
901 |
+
from {
|
902 |
+
transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
|
903 |
+
animation-timing-function: ease-in;
|
904 |
+
opacity: 0;
|
905 |
+
}
|
906 |
+
|
907 |
+
40% {
|
908 |
+
transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
|
909 |
+
animation-timing-function: ease-in;
|
910 |
+
}
|
911 |
+
|
912 |
+
60% {
|
913 |
+
transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
|
914 |
+
opacity: 1;
|
915 |
+
}
|
916 |
+
|
917 |
+
80% {
|
918 |
+
transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
|
919 |
+
}
|
920 |
+
|
921 |
+
to {
|
922 |
+
transform: perspective(400px);
|
923 |
+
}
|
924 |
+
}
|
925 |
+
|
926 |
+
.flipInY {
|
927 |
+
-webkit-backface-visibility: visible !important;
|
928 |
+
backface-visibility: visible !important;
|
929 |
+
animation-name: flipInY;
|
930 |
+
}
|
931 |
+
|
932 |
+
@keyframes flipOutX {
|
933 |
+
from {
|
934 |
+
transform: perspective(400px);
|
935 |
+
}
|
936 |
+
|
937 |
+
30% {
|
938 |
+
transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
|
939 |
+
opacity: 1;
|
940 |
+
}
|
941 |
+
|
942 |
+
to {
|
943 |
+
transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
|
944 |
+
opacity: 0;
|
945 |
+
}
|
946 |
+
}
|
947 |
+
|
948 |
+
.flipOutX {
|
949 |
+
animation-name: flipOutX;
|
950 |
+
-webkit-backface-visibility: visible !important;
|
951 |
+
backface-visibility: visible !important;
|
952 |
+
}
|
953 |
+
|
954 |
+
@keyframes flipOutY {
|
955 |
+
from {
|
956 |
+
transform: perspective(400px);
|
957 |
+
}
|
958 |
+
|
959 |
+
30% {
|
960 |
+
transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
|
961 |
+
opacity: 1;
|
962 |
+
}
|
963 |
+
|
964 |
+
to {
|
965 |
+
transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
|
966 |
+
opacity: 0;
|
967 |
+
}
|
968 |
+
}
|
969 |
+
|
970 |
+
.flipOutY {
|
971 |
+
-webkit-backface-visibility: visible !important;
|
972 |
+
backface-visibility: visible !important;
|
973 |
+
animation-name: flipOutY;
|
974 |
+
}
|
975 |
+
|
976 |
+
@keyframes lightSpeedIn {
|
977 |
+
from {
|
978 |
+
transform: translate3d(100%, 0, 0) skewX(-30deg);
|
979 |
+
opacity: 0;
|
980 |
+
}
|
981 |
+
|
982 |
+
60% {
|
983 |
+
transform: skewX(20deg);
|
984 |
+
opacity: 1;
|
985 |
+
}
|
986 |
+
|
987 |
+
80% {
|
988 |
+
transform: skewX(-5deg);
|
989 |
+
opacity: 1;
|
990 |
+
}
|
991 |
+
|
992 |
+
to {
|
993 |
+
transform: none;
|
994 |
+
opacity: 1;
|
995 |
+
}
|
996 |
+
}
|
997 |
+
|
998 |
+
.lightSpeedIn {
|
999 |
+
animation-name: lightSpeedIn;
|
1000 |
+
animation-timing-function: ease-out;
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
@keyframes lightSpeedOut {
|
1004 |
+
from {
|
1005 |
+
opacity: 1;
|
1006 |
+
}
|
1007 |
+
|
1008 |
+
to {
|
1009 |
+
transform: translate3d(100%, 0, 0) skewX(30deg);
|
1010 |
+
opacity: 0;
|
1011 |
+
}
|
1012 |
+
}
|
1013 |
+
|
1014 |
+
.lightSpeedOut {
|
1015 |
+
animation-name: lightSpeedOut;
|
1016 |
+
animation-timing-function: ease-in;
|
1017 |
+
}
|
1018 |
+
|
1019 |
+
@keyframes rotateIn {
|
1020 |
+
from {
|
1021 |
+
transform-origin: center;
|
1022 |
+
transform: rotate3d(0, 0, 1, -200deg);
|
1023 |
+
opacity: 0;
|
1024 |
+
}
|
1025 |
+
|
1026 |
+
to {
|
1027 |
+
transform-origin: center;
|
1028 |
+
transform: none;
|
1029 |
+
opacity: 1;
|
1030 |
+
}
|
1031 |
+
}
|
1032 |
+
|
1033 |
+
.rotateIn {
|
1034 |
+
animation-name: rotateIn;
|
1035 |
+
}
|
1036 |
+
|
1037 |
+
@keyframes rotateInDownLeft {
|
1038 |
+
from {
|
1039 |
+
transform-origin: left bottom;
|
1040 |
+
transform: rotate3d(0, 0, 1, -45deg);
|
1041 |
+
opacity: 0;
|
1042 |
+
}
|
1043 |
+
|
1044 |
+
to {
|
1045 |
+
transform-origin: left bottom;
|
1046 |
+
transform: none;
|
1047 |
+
opacity: 1;
|
1048 |
+
}
|
1049 |
+
}
|
1050 |
+
|
1051 |
+
.rotateInDownLeft {
|
1052 |
+
animation-name: rotateInDownLeft;
|
1053 |
+
}
|
1054 |
+
|
1055 |
+
@keyframes rotateInDownRight {
|
1056 |
+
from {
|
1057 |
+
transform-origin: right bottom;
|
1058 |
+
transform: rotate3d(0, 0, 1, 45deg);
|
1059 |
+
opacity: 0;
|
1060 |
+
}
|
1061 |
+
|
1062 |
+
to {
|
1063 |
+
transform-origin: right bottom;
|
1064 |
+
transform: none;
|
1065 |
+
opacity: 1;
|
1066 |
+
}
|
1067 |
+
}
|
1068 |
+
|
1069 |
+
.rotateInDownRight {
|
1070 |
+
animation-name: rotateInDownRight;
|
1071 |
+
}
|
1072 |
+
|
1073 |
+
@keyframes rotateInUpLeft {
|
1074 |
+
from {
|
1075 |
+
transform-origin: left bottom;
|
1076 |
+
transform: rotate3d(0, 0, 1, 45deg);
|
1077 |
+
opacity: 0;
|
1078 |
+
}
|
1079 |
+
|
1080 |
+
to {
|
1081 |
+
transform-origin: left bottom;
|
1082 |
+
transform: none;
|
1083 |
+
opacity: 1;
|
1084 |
+
}
|
1085 |
+
}
|
1086 |
+
|
1087 |
+
.rotateInUpLeft {
|
1088 |
+
animation-name: rotateInUpLeft;
|
1089 |
+
}
|
1090 |
+
|
1091 |
+
@keyframes rotateInUpRight {
|
1092 |
+
from {
|
1093 |
+
transform-origin: right bottom;
|
1094 |
+
transform: rotate3d(0, 0, 1, -90deg);
|
1095 |
+
opacity: 0;
|
1096 |
+
}
|
1097 |
+
|
1098 |
+
to {
|
1099 |
+
transform-origin: right bottom;
|
1100 |
+
transform: none;
|
1101 |
+
opacity: 1;
|
1102 |
+
}
|
1103 |
+
}
|
1104 |
+
|
1105 |
+
.rotateInUpRight {
|
1106 |
+
animation-name: rotateInUpRight;
|
1107 |
+
}
|
1108 |
+
|
1109 |
+
@keyframes rotateOut {
|
1110 |
+
from {
|
1111 |
+
transform-origin: center;
|
1112 |
+
opacity: 1;
|
1113 |
+
}
|
1114 |
+
|
1115 |
+
to {
|
1116 |
+
transform-origin: center;
|
1117 |
+
transform: rotate3d(0, 0, 1, 200deg);
|
1118 |
+
opacity: 0;
|
1119 |
+
}
|
1120 |
+
}
|
1121 |
+
|
1122 |
+
.rotateOut {
|
1123 |
+
animation-name: rotateOut;
|
1124 |
+
}
|
1125 |
+
|
1126 |
+
@keyframes rotateOutDownLeft {
|
1127 |
+
from {
|
1128 |
+
transform-origin: left bottom;
|
1129 |
+
opacity: 1;
|
1130 |
+
}
|
1131 |
+
|
1132 |
+
to {
|
1133 |
+
transform-origin: left bottom;
|
1134 |
+
transform: rotate3d(0, 0, 1, 45deg);
|
1135 |
+
opacity: 0;
|
1136 |
+
}
|
1137 |
+
}
|
1138 |
+
|
1139 |
+
.rotateOutDownLeft {
|
1140 |
+
animation-name: rotateOutDownLeft;
|
1141 |
+
}
|
1142 |
+
|
1143 |
+
@keyframes rotateOutDownRight {
|
1144 |
+
from {
|
1145 |
+
transform-origin: right bottom;
|
1146 |
+
opacity: 1;
|
1147 |
+
}
|
1148 |
+
|
1149 |
+
to {
|
1150 |
+
transform-origin: right bottom;
|
1151 |
+
transform: rotate3d(0, 0, 1, -45deg);
|
1152 |
+
opacity: 0;
|
1153 |
+
}
|
1154 |
+
}
|
1155 |
+
|
1156 |
+
.rotateOutDownRight {
|
1157 |
+
animation-name: rotateOutDownRight;
|
1158 |
+
}
|
1159 |
+
|
1160 |
+
@keyframes rotateOutUpLeft {
|
1161 |
+
from {
|
1162 |
+
transform-origin: left bottom;
|
1163 |
+
opacity: 1;
|
1164 |
+
}
|
1165 |
+
|
1166 |
+
to {
|
1167 |
+
transform-origin: left bottom;
|
1168 |
+
transform: rotate3d(0, 0, 1, -45deg);
|
1169 |
+
opacity: 0;
|
1170 |
+
}
|
1171 |
+
}
|
1172 |
+
|
1173 |
+
.rotateOutUpLeft {
|
1174 |
+
animation-name: rotateOutUpLeft;
|
1175 |
+
}
|
1176 |
+
|
1177 |
+
@keyframes rotateOutUpRight {
|
1178 |
+
from {
|
1179 |
+
transform-origin: right bottom;
|
1180 |
+
opacity: 1;
|
1181 |
+
}
|
1182 |
+
|
1183 |
+
to {
|
1184 |
+
transform-origin: right bottom;
|
1185 |
+
transform: rotate3d(0, 0, 1, 90deg);
|
1186 |
+
opacity: 0;
|
1187 |
+
}
|
1188 |
+
}
|
1189 |
+
|
1190 |
+
.rotateOutUpRight {
|
1191 |
+
animation-name: rotateOutUpRight;
|
1192 |
+
}
|
1193 |
+
|
1194 |
+
@keyframes hinge {
|
1195 |
+
0% {
|
1196 |
+
transform-origin: top left;
|
1197 |
+
animation-timing-function: ease-in-out;
|
1198 |
+
}
|
1199 |
+
|
1200 |
+
20%, 60% {
|
1201 |
+
transform: rotate3d(0, 0, 1, 80deg);
|
1202 |
+
transform-origin: top left;
|
1203 |
+
animation-timing-function: ease-in-out;
|
1204 |
+
}
|
1205 |
+
|
1206 |
+
40%, 80% {
|
1207 |
+
transform: rotate3d(0, 0, 1, 60deg);
|
1208 |
+
transform-origin: top left;
|
1209 |
+
animation-timing-function: ease-in-out;
|
1210 |
+
opacity: 1;
|
1211 |
+
}
|
1212 |
+
|
1213 |
+
to {
|
1214 |
+
transform: translate3d(0, 700px, 0);
|
1215 |
+
opacity: 0;
|
1216 |
+
}
|
1217 |
+
}
|
1218 |
+
|
1219 |
+
.hinge {
|
1220 |
+
animation-name: hinge;
|
1221 |
+
}
|
1222 |
+
|
1223 |
+
@keyframes jackInTheBox {
|
1224 |
+
from {
|
1225 |
+
opacity: 0;
|
1226 |
+
transform: scale(0.1) rotate(30deg);
|
1227 |
+
transform-origin: center bottom;
|
1228 |
+
}
|
1229 |
+
|
1230 |
+
50% {
|
1231 |
+
transform: rotate(-10deg);
|
1232 |
+
}
|
1233 |
+
|
1234 |
+
70% {
|
1235 |
+
transform: rotate(3deg);
|
1236 |
+
}
|
1237 |
+
|
1238 |
+
to {
|
1239 |
+
opacity: 1;
|
1240 |
+
transform: scale(1);
|
1241 |
+
}
|
1242 |
+
}
|
1243 |
+
|
1244 |
+
.jackInTheBox {
|
1245 |
+
animation-name: jackInTheBox;
|
1246 |
+
}
|
1247 |
+
|
1248 |
+
/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
|
1249 |
+
|
1250 |
+
@keyframes rollIn {
|
1251 |
+
from {
|
1252 |
+
opacity: 0;
|
1253 |
+
transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
|
1254 |
+
}
|
1255 |
+
|
1256 |
+
to {
|
1257 |
+
opacity: 1;
|
1258 |
+
transform: none;
|
1259 |
+
}
|
1260 |
+
}
|
1261 |
+
|
1262 |
+
.rollIn {
|
1263 |
+
animation-name: rollIn;
|
1264 |
+
}
|
1265 |
+
|
1266 |
+
/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
|
1267 |
+
|
1268 |
+
@keyframes rollOut {
|
1269 |
+
from {
|
1270 |
+
opacity: 1;
|
1271 |
+
}
|
1272 |
+
|
1273 |
+
to {
|
1274 |
+
opacity: 0;
|
1275 |
+
transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
|
1276 |
+
}
|
1277 |
+
}
|
1278 |
+
|
1279 |
+
.rollOut {
|
1280 |
+
animation-name: rollOut;
|
1281 |
+
}
|
1282 |
+
|
1283 |
+
@keyframes zoomIn {
|
1284 |
+
from {
|
1285 |
+
opacity: 0;
|
1286 |
+
transform: scale3d(.3, .3, .3);
|
1287 |
+
}
|
1288 |
+
|
1289 |
+
50% {
|
1290 |
+
opacity: 1;
|
1291 |
+
}
|
1292 |
+
}
|
1293 |
+
|
1294 |
+
.zoomIn {
|
1295 |
+
animation-name: zoomIn;
|
1296 |
+
}
|
1297 |
+
|
1298 |
+
@keyframes zoomInDown {
|
1299 |
+
from {
|
1300 |
+
opacity: 0;
|
1301 |
+
transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
|
1302 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1303 |
+
}
|
1304 |
+
|
1305 |
+
60% {
|
1306 |
+
opacity: 1;
|
1307 |
+
transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
|
1308 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1309 |
+
}
|
1310 |
+
}
|
1311 |
+
|
1312 |
+
.zoomInDown {
|
1313 |
+
animation-name: zoomInDown;
|
1314 |
+
}
|
1315 |
+
|
1316 |
+
@keyframes zoomInLeft {
|
1317 |
+
from {
|
1318 |
+
opacity: 0;
|
1319 |
+
transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
|
1320 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1321 |
+
}
|
1322 |
+
|
1323 |
+
60% {
|
1324 |
+
opacity: 1;
|
1325 |
+
transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
|
1326 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1327 |
+
}
|
1328 |
+
}
|
1329 |
+
|
1330 |
+
.zoomInLeft {
|
1331 |
+
animation-name: zoomInLeft;
|
1332 |
+
}
|
1333 |
+
|
1334 |
+
@keyframes zoomInRight {
|
1335 |
+
from {
|
1336 |
+
opacity: 0;
|
1337 |
+
transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
|
1338 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1339 |
+
}
|
1340 |
+
|
1341 |
+
60% {
|
1342 |
+
opacity: 1;
|
1343 |
+
transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
|
1344 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1345 |
+
}
|
1346 |
+
}
|
1347 |
+
|
1348 |
+
.zoomInRight {
|
1349 |
+
animation-name: zoomInRight;
|
1350 |
+
}
|
1351 |
+
|
1352 |
+
@keyframes zoomInUp {
|
1353 |
+
from {
|
1354 |
+
opacity: 0;
|
1355 |
+
transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
|
1356 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1357 |
+
}
|
1358 |
+
|
1359 |
+
60% {
|
1360 |
+
opacity: 1;
|
1361 |
+
transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
|
1362 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1363 |
+
}
|
1364 |
+
}
|
1365 |
+
|
1366 |
+
.zoomInUp {
|
1367 |
+
animation-name: zoomInUp;
|
1368 |
+
}
|
1369 |
+
|
1370 |
+
@keyframes zoomOut {
|
1371 |
+
from {
|
1372 |
+
opacity: 1;
|
1373 |
+
}
|
1374 |
+
|
1375 |
+
50% {
|
1376 |
+
opacity: 0;
|
1377 |
+
transform: scale3d(.3, .3, .3);
|
1378 |
+
}
|
1379 |
+
|
1380 |
+
to {
|
1381 |
+
opacity: 0;
|
1382 |
+
}
|
1383 |
+
}
|
1384 |
+
|
1385 |
+
.zoomOut {
|
1386 |
+
animation-name: zoomOut;
|
1387 |
+
}
|
1388 |
+
|
1389 |
+
@keyframes zoomOutDown {
|
1390 |
+
40% {
|
1391 |
+
opacity: 1;
|
1392 |
+
transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
|
1393 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1394 |
+
}
|
1395 |
+
|
1396 |
+
to {
|
1397 |
+
opacity: 0;
|
1398 |
+
transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
|
1399 |
+
transform-origin: center bottom;
|
1400 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1401 |
+
}
|
1402 |
+
}
|
1403 |
+
|
1404 |
+
.zoomOutDown {
|
1405 |
+
animation-name: zoomOutDown;
|
1406 |
+
}
|
1407 |
+
|
1408 |
+
@keyframes zoomOutLeft {
|
1409 |
+
40% {
|
1410 |
+
opacity: 1;
|
1411 |
+
transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
|
1412 |
+
}
|
1413 |
+
|
1414 |
+
to {
|
1415 |
+
opacity: 0;
|
1416 |
+
transform: scale(.1) translate3d(-2000px, 0, 0);
|
1417 |
+
transform-origin: left center;
|
1418 |
+
}
|
1419 |
+
}
|
1420 |
+
|
1421 |
+
.zoomOutLeft {
|
1422 |
+
animation-name: zoomOutLeft;
|
1423 |
+
}
|
1424 |
+
|
1425 |
+
@keyframes zoomOutRight {
|
1426 |
+
40% {
|
1427 |
+
opacity: 1;
|
1428 |
+
transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
|
1429 |
+
}
|
1430 |
+
|
1431 |
+
to {
|
1432 |
+
opacity: 0;
|
1433 |
+
transform: scale(.1) translate3d(2000px, 0, 0);
|
1434 |
+
transform-origin: right center;
|
1435 |
+
}
|
1436 |
+
}
|
1437 |
+
|
1438 |
+
.zoomOutRight {
|
1439 |
+
animation-name: zoomOutRight;
|
1440 |
+
}
|
1441 |
+
|
1442 |
+
@keyframes zoomOutUp {
|
1443 |
+
40% {
|
1444 |
+
opacity: 1;
|
1445 |
+
transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
|
1446 |
+
animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
|
1447 |
+
}
|
1448 |
+
|
1449 |
+
to {
|
1450 |
+
opacity: 0;
|
1451 |
+
transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
|
1452 |
+
transform-origin: center bottom;
|
1453 |
+
animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
|
1454 |
+
}
|
1455 |
+
}
|
1456 |
+
|
1457 |
+
.zoomOutUp {
|
1458 |
+
animation-name: zoomOutUp;
|
1459 |
+
}
|
1460 |
+
|
1461 |
+
@keyframes slideInDown {
|
1462 |
+
from {
|
1463 |
+
transform: translate3d(0, -100%, 0);
|
1464 |
+
visibility: visible;
|
1465 |
+
}
|
1466 |
+
|
1467 |
+
to {
|
1468 |
+
transform: translate3d(0, 0, 0);
|
1469 |
+
}
|
1470 |
+
}
|
1471 |
+
|
1472 |
+
.slideInDown {
|
1473 |
+
animation-name: slideInDown;
|
1474 |
+
}
|
1475 |
+
|
1476 |
+
@keyframes slideInLeft {
|
1477 |
+
from {
|
1478 |
+
transform: translate3d(-100%, 0, 0);
|
1479 |
+
visibility: visible;
|
1480 |
+
}
|
1481 |
+
|
1482 |
+
to {
|
1483 |
+
transform: translate3d(0, 0, 0);
|
1484 |
+
}
|
1485 |
+
}
|
1486 |
+
|
1487 |
+
.slideInLeft {
|
1488 |
+
animation-name: slideInLeft;
|
1489 |
+
}
|
1490 |
+
|
1491 |
+
@keyframes slideInRight {
|
1492 |
+
from {
|
1493 |
+
transform: translate3d(100%, 0, 0);
|
1494 |
+
visibility: visible;
|
1495 |
+
}
|
1496 |
+
|
1497 |
+
to {
|
1498 |
+
transform: translate3d(0, 0, 0);
|
1499 |
+
}
|
1500 |
+
}
|
1501 |
+
|
1502 |
+
.slideInRight {
|
1503 |
+
animation-name: slideInRight;
|
1504 |
+
}
|
1505 |
+
|
1506 |
+
@keyframes slideInUp {
|
1507 |
+
from {
|
1508 |
+
transform: translate3d(0, 100%, 0);
|
1509 |
+
visibility: visible;
|
1510 |
+
}
|
1511 |
+
|
1512 |
+
to {
|
1513 |
+
transform: translate3d(0, 0, 0);
|
1514 |
+
}
|
1515 |
+
}
|
1516 |
+
|
1517 |
+
.slideInUp {
|
1518 |
+
animation-name: slideInUp;
|
1519 |
+
}
|
1520 |
+
|
1521 |
+
@keyframes slideOutDown {
|
1522 |
+
from {
|
1523 |
+
transform: translate3d(0, 0, 0);
|
1524 |
+
}
|
1525 |
+
|
1526 |
+
to {
|
1527 |
+
visibility: hidden;
|
1528 |
+
transform: translate3d(0, 100%, 0);
|
1529 |
+
}
|
1530 |
+
}
|
1531 |
+
|
1532 |
+
.slideOutDown {
|
1533 |
+
animation-name: slideOutDown;
|
1534 |
+
}
|
1535 |
+
|
1536 |
+
@keyframes slideOutLeft {
|
1537 |
+
from {
|
1538 |
+
transform: translate3d(0, 0, 0);
|
1539 |
+
}
|
1540 |
+
|
1541 |
+
to {
|
1542 |
+
visibility: hidden;
|
1543 |
+
transform: translate3d(-100%, 0, 0);
|
1544 |
+
}
|
1545 |
+
}
|
1546 |
+
|
1547 |
+
.slideOutLeft {
|
1548 |
+
animation-name: slideOutLeft;
|
1549 |
+
}
|
1550 |
+
|
1551 |
+
@keyframes slideOutRight {
|
1552 |
+
from {
|
1553 |
+
transform: translate3d(0, 0, 0);
|
1554 |
+
}
|
1555 |
+
|
1556 |
+
to {
|
1557 |
+
visibility: hidden;
|
1558 |
+
transform: translate3d(100%, 0, 0);
|
1559 |
+
}
|
1560 |
+
}
|
1561 |
+
|
1562 |
+
.slideOutRight {
|
1563 |
+
animation-name: slideOutRight;
|
1564 |
+
}
|
1565 |
+
|
1566 |
+
@keyframes slideOutUp {
|
1567 |
+
from {
|
1568 |
+
transform: translate3d(0, 0, 0);
|
1569 |
+
}
|
1570 |
+
|
1571 |
+
to {
|
1572 |
+
visibility: hidden;
|
1573 |
+
transform: translate3d(0, -100%, 0);
|
1574 |
+
}
|
1575 |
+
}
|
1576 |
+
|
1577 |
+
.slideOutUp {
|
1578 |
+
animation-name: slideOutUp;
|
1579 |
+
}
|
assets_libraries/animate/wow.min.js
ADDED
@@ -0,0 +1,2 @@
|
|
|
|
|
1 |
+
/*! WOW - v1.1.3 - 2016-05-06
|
2 |
+
* Copyright (c) 2016 Matthieu Aussaguel;*/(function(){var a,b,c,d,e,f=function(a,b){return function(){return a.apply(b,arguments)}},g=[].indexOf||function(a){for(var b=0,c=this.length;c>b;b++)if(b in this&&this[b]===a)return b;return-1};b=function(){function a(){}return a.prototype.extend=function(a,b){var c,d;for(c in b)d=b[c],null==a[c]&&(a[c]=d);return a},a.prototype.isMobile=function(a){return/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(a)},a.prototype.createEvent=function(a,b,c,d){var e;return null==b&&(b=!1),null==c&&(c=!1),null==d&&(d=null),null!=document.createEvent?(e=document.createEvent("CustomEvent"),e.initCustomEvent(a,b,c,d)):null!=document.createEventObject?(e=document.createEventObject(),e.eventType=a):e.eventName=a,e},a.prototype.emitEvent=function(a,b){return null!=a.dispatchEvent?a.dispatchEvent(b):b in(null!=a)?a[b]():"on"+b in(null!=a)?a["on"+b]():void 0},a.prototype.addEvent=function(a,b,c){return null!=a.addEventListener?a.addEventListener(b,c,!1):null!=a.attachEvent?a.attachEvent("on"+b,c):a[b]=c},a.prototype.removeEvent=function(a,b,c){return null!=a.removeEventListener?a.removeEventListener(b,c,!1):null!=a.detachEvent?a.detachEvent("on"+b,c):delete a[b]},a.prototype.innerHeight=function(){return"innerHeight"in window?window.innerHeight:document.documentElement.clientHeight},a}(),c=this.WeakMap||this.MozWeakMap||(c=function(){function a(){this.keys=[],this.values=[]}return a.prototype.get=function(a){var b,c,d,e,f;for(f=this.keys,b=d=0,e=f.length;e>d;b=++d)if(c=f[b],c===a)return this.values[b]},a.prototype.set=function(a,b){var c,d,e,f,g;for(g=this.keys,c=e=0,f=g.length;f>e;c=++e)if(d=g[c],d===a)return void(this.values[c]=b);return this.keys.push(a),this.values.push(b)},a}()),a=this.MutationObserver||this.WebkitMutationObserver||this.MozMutationObserver||(a=function(){function a(){"undefined"!=typeof console&&null!==console&&console.warn("MutationObserver is not supported by your browser."),"undefined"!=typeof console&&null!==console&&console.warn("WOW.js cannot detect dom mutations, please call .sync() after loading new content.")}return a.notSupported=!0,a.prototype.observe=function(){},a}()),d=this.getComputedStyle||function(a,b){return this.getPropertyValue=function(b){var c;return"float"===b&&(b="styleFloat"),e.test(b)&&b.replace(e,function(a,b){return b.toUpperCase()}),(null!=(c=a.currentStyle)?c[b]:void 0)||null},this},e=/(\-([a-z]){1})/g,this.WOW=function(){function e(a){null==a&&(a={}),this.scrollCallback=f(this.scrollCallback,this),this.scrollHandler=f(this.scrollHandler,this),this.resetAnimation=f(this.resetAnimation,this),this.start=f(this.start,this),this.scrolled=!0,this.config=this.util().extend(a,this.defaults),null!=a.scrollContainer&&(this.config.scrollContainer=document.querySelector(a.scrollContainer)),this.animationNameCache=new c,this.wowEvent=this.util().createEvent(this.config.boxClass)}return e.prototype.defaults={boxClass:"wow",animateClass:"animated",offset:0,mobile:!0,live:!0,callback:null,scrollContainer:null},e.prototype.init=function(){var a;return this.element=window.document.documentElement,"interactive"===(a=document.readyState)||"complete"===a?this.start():this.util().addEvent(document,"DOMContentLoaded",this.start),this.finished=[]},e.prototype.start=function(){var b,c,d,e;if(this.stopped=!1,this.boxes=function(){var a,c,d,e;for(d=this.element.querySelectorAll("."+this.config.boxClass),e=[],a=0,c=d.length;c>a;a++)b=d[a],e.push(b);return e}.call(this),this.all=function(){var a,c,d,e;for(d=this.boxes,e=[],a=0,c=d.length;c>a;a++)b=d[a],e.push(b);return e}.call(this),this.boxes.length)if(this.disabled())this.resetStyle();else for(e=this.boxes,c=0,d=e.length;d>c;c++)b=e[c],this.applyStyle(b,!0);return this.disabled()||(this.util().addEvent(this.config.scrollContainer||window,"scroll",this.scrollHandler),this.util().addEvent(window,"resize",this.scrollHandler),this.interval=setInterval(this.scrollCallback,50)),this.config.live?new a(function(a){return function(b){var c,d,e,f,g;for(g=[],c=0,d=b.length;d>c;c++)f=b[c],g.push(function(){var a,b,c,d;for(c=f.addedNodes||[],d=[],a=0,b=c.length;b>a;a++)e=c[a],d.push(this.doSync(e));return d}.call(a));return g}}(this)).observe(document.body,{childList:!0,subtree:!0}):void 0},e.prototype.stop=function(){return this.stopped=!0,this.util().removeEvent(this.config.scrollContainer||window,"scroll",this.scrollHandler),this.util().removeEvent(window,"resize",this.scrollHandler),null!=this.interval?clearInterval(this.interval):void 0},e.prototype.sync=function(b){return a.notSupported?this.doSync(this.element):void 0},e.prototype.doSync=function(a){var b,c,d,e,f;if(null==a&&(a=this.element),1===a.nodeType){for(a=a.parentNode||a,e=a.querySelectorAll("."+this.config.boxClass),f=[],c=0,d=e.length;d>c;c++)b=e[c],g.call(this.all,b)<0?(this.boxes.push(b),this.all.push(b),this.stopped||this.disabled()?this.resetStyle():this.applyStyle(b,!0),f.push(this.scrolled=!0)):f.push(void 0);return f}},e.prototype.show=function(a){return this.applyStyle(a),a.className=a.className+" "+this.config.animateClass,null!=this.config.callback&&this.config.callback(a),this.util().emitEvent(a,this.wowEvent),this.util().addEvent(a,"animationend",this.resetAnimation),this.util().addEvent(a,"oanimationend",this.resetAnimation),this.util().addEvent(a,"webkitAnimationEnd",this.resetAnimation),this.util().addEvent(a,"MSAnimationEnd",this.resetAnimation),a},e.prototype.applyStyle=function(a,b){var c,d,e;return d=a.getAttribute("data-wow-duration"),c=a.getAttribute("data-wow-delay"),e=a.getAttribute("data-wow-iteration"),this.animate(function(f){return function(){return f.customStyle(a,b,d,c,e)}}(this))},e.prototype.animate=function(){return"requestAnimationFrame"in window?function(a){return window.requestAnimationFrame(a)}:function(a){return a()}}(),e.prototype.resetStyle=function(){var a,b,c,d,e;for(d=this.boxes,e=[],b=0,c=d.length;c>b;b++)a=d[b],e.push(a.style.visibility="visible");return e},e.prototype.resetAnimation=function(a){var b;return a.type.toLowerCase().indexOf("animationend")>=0?(b=a.target||a.srcElement,b.className=b.className.replace(this.config.animateClass,"").trim()):void 0},e.prototype.customStyle=function(a,b,c,d,e){return b&&this.cacheAnimationName(a),a.style.visibility=b?"hidden":"visible",c&&this.vendorSet(a.style,{animationDuration:c}),d&&this.vendorSet(a.style,{animationDelay:d}),e&&this.vendorSet(a.style,{animationIterationCount:e}),this.vendorSet(a.style,{animationName:b?"none":this.cachedAnimationName(a)}),a},e.prototype.vendors=["moz","webkit"],e.prototype.vendorSet=function(a,b){var c,d,e,f;d=[];for(c in b)e=b[c],a[""+c]=e,d.push(function(){var b,d,g,h;for(g=this.vendors,h=[],b=0,d=g.length;d>b;b++)f=g[b],h.push(a[""+f+c.charAt(0).toUpperCase()+c.substr(1)]=e);return h}.call(this));return d},e.prototype.vendorCSS=function(a,b){var c,e,f,g,h,i;for(h=d(a),g=h.getPropertyCSSValue(b),f=this.vendors,c=0,e=f.length;e>c;c++)i=f[c],g=g||h.getPropertyCSSValue("-"+i+"-"+b);return g},e.prototype.animationName=function(a){var b;try{b=this.vendorCSS(a,"animation-name").cssText}catch(c){b=d(a).getPropertyValue("animation-name")}return"none"===b?"":b},e.prototype.cacheAnimationName=function(a){return this.animationNameCache.set(a,this.animationName(a))},e.prototype.cachedAnimationName=function(a){return this.animationNameCache.get(a)},e.prototype.scrollHandler=function(){return this.scrolled=!0},e.prototype.scrollCallback=function(){var a;return!this.scrolled||(this.scrolled=!1,this.boxes=function(){var b,c,d,e;for(d=this.boxes,e=[],b=0,c=d.length;c>b;b++)a=d[b],a&&(this.isVisible(a)?this.show(a):e.push(a));return e}.call(this),this.boxes.length||this.config.live)?void 0:this.stop()},e.prototype.offsetTop=function(a){for(var b;void 0===a.offsetTop;)a=a.parentNode;for(b=a.offsetTop;a=a.offsetParent;)b+=a.offsetTop;return b},e.prototype.isVisible=function(a){var b,c,d,e,f;return c=a.getAttribute("data-wow-offset")||this.config.offset,f=this.config.scrollContainer&&this.config.scrollContainer.scrollTop||window.pageYOffset,e=f+Math.min(this.element.clientHeight,this.util().innerHeight())-c,d=this.offsetTop(a),b=d+a.clientHeight,e>=d&&b>=f},e.prototype.util=function(){return null!=this._util?this._util:this._util=new b},e.prototype.disabled=function(){return!this.config.mobile&&this.util().isMobile(navigator.userAgent)},e}()}).call(this);
|
assets_libraries/bxslider/LICENSE.md
ADDED
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
License
|
2 |
+
-------
|
3 |
+
|
4 |
+
The MIT License (MIT)
|
5 |
+
|
6 |
+
Copyright © 2014 [Steven Wanderski](https://twitter.com/stevenwanderski)
|
7 |
+
|
8 |
+
Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
|
9 |
+
|
10 |
+
The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
|
11 |
+
|
12 |
+
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
|
assets_libraries/bxslider/README.md
ADDED
@@ -0,0 +1,766 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
#⚠️ Looking for a maintainer ⚠️
|
2 |
+
Please contact me if you are interested in keeping our community alive:
|
3 |
+
https://github.com/stevenwanderski/bxslider-4/issues/1095
|
4 |
+
|
5 |
+
---
|
6 |
+
|
7 |
+
#bxSlider 4.2.12
|
8 |
+
##The fully-loaded, responsive jQuery content slider
|
9 |
+
|
10 |
+
###Why should I use this slider?
|
11 |
+
* Fully responsive - will adapt to any device
|
12 |
+
* Horizontal, vertical, and fade modes
|
13 |
+
* Slides can contain images, video, or HTML content
|
14 |
+
* Full callback API and public methods
|
15 |
+
* Small file size, fully themed, simple to implement
|
16 |
+
* Browser support: Firefox, Chrome, Safari, iOS, Android, IE7+
|
17 |
+
* Tons of configuration options
|
18 |
+
|
19 |
+
For complete documentation, tons of examples, and a good time, visit:
|
20 |
+
|
21 |
+
[http://bxslider.com](http://bxslider.com)
|
22 |
+
|
23 |
+
Written by: Steven Wanderski - [http://stevenwanderski.com](http://stevenwanderski.com)
|
24 |
+
|
25 |
+
###License
|
26 |
+
Released under the MIT license - http://opensource.org/licenses/MIT
|
27 |
+
|
28 |
+
Let's get on with it!
|
29 |
+
|
30 |
+
##Installation
|
31 |
+
|
32 |
+
###Step 1: Link required files
|
33 |
+
|
34 |
+
First and most important, the jQuery library needs to be included (no need to download - link directly from Google). Next, download the package from this site and link the bxSlider CSS file (for the theme) and the bxSlider Javascript file.
|
35 |
+
|
36 |
+
```html
|
37 |
+
<!-- jQuery library (served from Google) -->
|
38 |
+
<script src="https://ajax.googleapis.com/ajax/libs/jquery/1.11.3/jquery.min.js"></script>
|
39 |
+
<!-- bxSlider Javascript file -->
|
40 |
+
<script src="/js/jquery.bxslider.min.js"></script>
|
41 |
+
<!-- bxSlider CSS file -->
|
42 |
+
<link href="/lib/jquery.bxslider.css" rel="stylesheet" />
|
43 |
+
```
|
44 |
+
|
45 |
+
###Step 2: Create HTML markup
|
46 |
+
|
47 |
+
Create a `<ul class="bxslider">` element, with a `<li>` for each slide. Slides can contain images, video, or any other HTML content!
|
48 |
+
|
49 |
+
```html
|
50 |
+
<ul class="bxslider">
|
51 |
+
<li><img src="/images/pic1.jpg" /></li>
|
52 |
+
<li><img src="/images/pic2.jpg" /></li>
|
53 |
+
<li><img src="/images/pic3.jpg" /></li>
|
54 |
+
<li><img src="/images/pic4.jpg" /></li>
|
55 |
+
</ul>
|
56 |
+
```
|
57 |
+
|
58 |
+
###Step 3: Call the bxSlider
|
59 |
+
|
60 |
+
Call .bxSlider() on `<ul class="bxslider">`. Note that the call must be made inside of a $(document).ready() call, or the plugin will not work!
|
61 |
+
|
62 |
+
```javascript
|
63 |
+
$(document).ready(function(){
|
64 |
+
$('.bxslider').bxSlider();
|
65 |
+
});
|
66 |
+
```
|
67 |
+
|
68 |
+
##Configuration options
|
69 |
+
|
70 |
+
###General
|
71 |
+
|
72 |
+
**mode**
|
73 |
+
Type of transition between slides
|
74 |
+
```
|
75 |
+
default: 'horizontal'
|
76 |
+
options: 'horizontal', 'vertical', 'fade'
|
77 |
+
```
|
78 |
+
|
79 |
+
**speed**
|
80 |
+
Slide transition duration (in ms)
|
81 |
+
```
|
82 |
+
default: 500
|
83 |
+
options: integer
|
84 |
+
```
|
85 |
+
|
86 |
+
**slideMargin**
|
87 |
+
Margin between each slide
|
88 |
+
```
|
89 |
+
default: 0
|
90 |
+
options: integer
|
91 |
+
```
|
92 |
+
|
93 |
+
**startSlide**
|
94 |
+
Starting slide index (zero-based)
|
95 |
+
```
|
96 |
+
default: 0
|
97 |
+
options: integer
|
98 |
+
```
|
99 |
+
|
100 |
+
**randomStart**
|
101 |
+
Start slider on a random slide
|
102 |
+
```
|
103 |
+
default: false
|
104 |
+
options: boolean (true / false)
|
105 |
+
```
|
106 |
+
|
107 |
+
**slideSelector**
|
108 |
+
Element to use as slides (ex. <code>'div.slide'</code>).<br />Note: by default, bxSlider will use all immediate children of the slider element
|
109 |
+
```
|
110 |
+
default: ''
|
111 |
+
options: jQuery selector
|
112 |
+
```
|
113 |
+
|
114 |
+
**infiniteLoop**
|
115 |
+
If <code>true</code>, clicking "Next" while on the last slide will transition to the first slide and vice-versa
|
116 |
+
```
|
117 |
+
default: true
|
118 |
+
options: boolean (true / false)
|
119 |
+
```
|
120 |
+
|
121 |
+
**hideControlOnEnd**
|
122 |
+
If <code>true</code>, "Prev" and "Next" controls will receive a class <code>disabled</code> when slide is the first or the last<br/>Note: Only used when <code>infiniteLoop: false</code>
|
123 |
+
```
|
124 |
+
default: false
|
125 |
+
options: boolean (true / false)
|
126 |
+
```
|
127 |
+
|
128 |
+
**easing**
|
129 |
+
The type of "easing" to use during transitions. If using CSS transitions, include a value for the <code>transition-timing-function</code> property. If not using CSS transitions, you may include <code>plugins/jquery.easing.1.3.js</code> for many options.<br />See <a href="http://gsgd.co.uk/sandbox/jquery/easing/" target="_blank">http://gsgd.co.uk/sandbox/jquery/easing/</a> for more info.
|
130 |
+
```
|
131 |
+
default: null
|
132 |
+
options: if using CSS: 'linear', 'ease', 'ease-in', 'ease-out', 'ease-in-out', 'cubic-bezier(n,n,n,n)'. If not using CSS: 'swing', 'linear' (see the above file for more options)
|
133 |
+
```
|
134 |
+
|
135 |
+
**captions**
|
136 |
+
Include image captions. Captions are derived from the image's <code>title</code> attribute
|
137 |
+
```
|
138 |
+
default: false
|
139 |
+
options: boolean (true / false)
|
140 |
+
```
|
141 |
+
|
142 |
+
**ticker**
|
143 |
+
Use slider in ticker mode (similar to a news ticker)
|
144 |
+
```
|
145 |
+
default: false
|
146 |
+
options: boolean (true / false)
|
147 |
+
```
|
148 |
+
|
149 |
+
**tickerHover**
|
150 |
+
Ticker will pause when mouse hovers over slider. Note: this functionality does NOT work if using CSS transitions!
|
151 |
+
```
|
152 |
+
default: false
|
153 |
+
options: boolean (true / false)
|
154 |
+
```
|
155 |
+
|
156 |
+
**adaptiveHeight**
|
157 |
+
Dynamically adjust slider height based on each slide's height
|
158 |
+
```
|
159 |
+
default: false
|
160 |
+
options: boolean (true / false)
|
161 |
+
```
|
162 |
+
|
163 |
+
**adaptiveHeightSpeed**
|
164 |
+
Slide height transition duration (in ms). Note: only used if <code>adaptiveHeight: true</code>
|
165 |
+
```
|
166 |
+
default: 500
|
167 |
+
options: integer
|
168 |
+
```
|
169 |
+
|
170 |
+
**video**
|
171 |
+
If any slides contain video, set this to <code>true</code>. Also, include <code>plugins/jquery.fitvids.js</code><br />See <a href="http://fitvidsjs.com/" target="_blank">http://fitvidsjs.com/</a> for more info
|
172 |
+
```
|
173 |
+
default: false
|
174 |
+
options: boolean (true / false)
|
175 |
+
```
|
176 |
+
|
177 |
+
**responsive**
|
178 |
+
Enable or disable auto resize of the slider. Useful if you need to use fixed width sliders.
|
179 |
+
```
|
180 |
+
default: true
|
181 |
+
options: boolean (true /false)
|
182 |
+
```
|
183 |
+
|
184 |
+
**useCSS**
|
185 |
+
If true, CSS transitions will be used for horizontal and vertical slide animations (this uses native hardware acceleration). If false, jQuery animate() will be used.
|
186 |
+
```
|
187 |
+
default: true
|
188 |
+
options: boolean (true / false)
|
189 |
+
```
|
190 |
+
|
191 |
+
**preloadImages**
|
192 |
+
If 'all', preloads all images before starting the slider. If 'visible', preloads only images in the initially visible slides before starting the slider (tip: use 'visible' if all slides are identical dimensions)
|
193 |
+
```
|
194 |
+
default: 'visible'
|
195 |
+
options: 'all', 'visible'
|
196 |
+
```
|
197 |
+
|
198 |
+
**touchEnabled**
|
199 |
+
If <code>true</code>, slider will allow touch swipe transitions
|
200 |
+
```
|
201 |
+
default: true
|
202 |
+
options: boolean (true / false)
|
203 |
+
```
|
204 |
+
|
205 |
+
**swipeThreshold**
|
206 |
+
Amount of pixels a touch swipe needs to exceed in order to execute a slide transition. Note: only used if <code>touchEnabled: true</code>
|
207 |
+
```
|
208 |
+
default: 50
|
209 |
+
options: integer
|
210 |
+
```
|
211 |
+
|
212 |
+
**oneToOneTouch**
|
213 |
+
If <code>true</code>, non-fade slides follow the finger as it swipes
|
214 |
+
```
|
215 |
+
default: true
|
216 |
+
options: boolean (true / false)
|
217 |
+
```
|
218 |
+
|
219 |
+
**preventDefaultSwipeX**
|
220 |
+
If <code>true</code>, touch screen will not move along the x-axis as the finger swipes
|
221 |
+
```
|
222 |
+
default: true
|
223 |
+
options: boolean (true / false)
|
224 |
+
```
|
225 |
+
|
226 |
+
**preventDefaultSwipeY**
|
227 |
+
If <code>true</code>, touch screen will not move along the y-axis as the finger swipes
|
228 |
+
```
|
229 |
+
default: false
|
230 |
+
options: boolean (true / false)
|
231 |
+
```
|
232 |
+
|
233 |
+
**wrapperClass**
|
234 |
+
Class to wrap the slider in. Change to prevent from using default bxSlider styles.
|
235 |
+
```
|
236 |
+
default: 'bx-wrapper'
|
237 |
+
options: string
|
238 |
+
```
|
239 |
+
|
240 |
+
###Pager
|
241 |
+
|
242 |
+
**pager**
|
243 |
+
If <code>true</code>, a pager will be added
|
244 |
+
```
|
245 |
+
default: true
|
246 |
+
options: boolean (true / false)
|
247 |
+
```
|
248 |
+
|
249 |
+
**pagerType**
|
250 |
+
If <code>'full'</code>, a pager link will be generated for each slide. If <code>'short'</code>, a x / y pager will be used (ex. 1 / 5)
|
251 |
+
```
|
252 |
+
default: 'full'
|
253 |
+
options: 'full', 'short'
|
254 |
+
```
|
255 |
+
|
256 |
+
**pagerShortSeparator**
|
257 |
+
If <code>pagerType: 'short'</code>, pager will use this value as the separating character
|
258 |
+
```
|
259 |
+
default: ' / '
|
260 |
+
options: string
|
261 |
+
```
|
262 |
+
|
263 |
+
**pagerSelector**
|
264 |
+
Element used to populate the populate the pager. By default, the pager is appended to the bx-viewport
|
265 |
+
```
|
266 |
+
default: ''
|
267 |
+
options: jQuery selector
|
268 |
+
```
|
269 |
+
|
270 |
+
**pagerCustom**
|
271 |
+
Parent element to be used as the pager. Parent element must contain a <code><a data-slide-index="x"></code> element for each slide. See example <a href="/examples/thumbnail-method-1">here</a>. Not for use with dynamic carousels.
|
272 |
+
```
|
273 |
+
default: null
|
274 |
+
options: jQuery selector
|
275 |
+
```
|
276 |
+
|
277 |
+
**buildPager**
|
278 |
+
If supplied, function is called on every slide element, and the returned value is used as the pager item markup.<br />See <a href="http://bxslider.com/examples">examples</a> for detailed implementation
|
279 |
+
```
|
280 |
+
default: null
|
281 |
+
options: function(slideIndex)
|
282 |
+
```
|
283 |
+
|
284 |
+
###Controls
|
285 |
+
|
286 |
+
**controls**
|
287 |
+
If <code>true</code>, "Next" / "Prev" controls will be added
|
288 |
+
```
|
289 |
+
default: true
|
290 |
+
options: boolean (true / false)
|
291 |
+
```
|
292 |
+
|
293 |
+
**nextText**
|
294 |
+
Text to be used for the "Next" control
|
295 |
+
```
|
296 |
+
default: 'Next'
|
297 |
+
options: string
|
298 |
+
```
|
299 |
+
|
300 |
+
**prevText**
|
301 |
+
Text to be used for the "Prev" control
|
302 |
+
```
|
303 |
+
default: 'Prev'
|
304 |
+
options: string
|
305 |
+
```
|
306 |
+
|
307 |
+
**nextSelector**
|
308 |
+
Element used to populate the "Next" control
|
309 |
+
```
|
310 |
+
default: null
|
311 |
+
options: jQuery selector
|
312 |
+
```
|
313 |
+
|
314 |
+
**prevSelector**
|
315 |
+
Element used to populate the "Prev" control
|
316 |
+
```
|
317 |
+
default: null
|
318 |
+
options: jQuery selector
|
319 |
+
```
|
320 |
+
|
321 |
+
**autoControls**
|
322 |
+
If <code>true</code>, "Start" / "Stop" controls will be added
|
323 |
+
```
|
324 |
+
default: false
|
325 |
+
options: boolean (true / false)
|
326 |
+
```
|
327 |
+
|
328 |
+
**startText**
|
329 |
+
Text to be used for the "Start" control
|
330 |
+
```
|
331 |
+
default: 'Start'
|
332 |
+
options: string
|
333 |
+
```
|
334 |
+
|
335 |
+
**stopText**
|
336 |
+
Text to be used for the "Stop" control
|
337 |
+
```
|
338 |
+
default: 'Stop'
|
339 |
+
options: string
|
340 |
+
```
|
341 |
+
|
342 |
+
**autoControlsCombine**
|
343 |
+
When slideshow is playing only "Stop" control is displayed and vice-versa
|
344 |
+
```
|
345 |
+
default: false
|
346 |
+
options: boolean (true / false)
|
347 |
+
```
|
348 |
+
|
349 |
+
**autoControlsSelector**
|
350 |
+
Element used to populate the auto controls
|
351 |
+
```
|
352 |
+
default: null
|
353 |
+
options: jQuery selector
|
354 |
+
```
|
355 |
+
|
356 |
+
**keyboardEnabled**
|
357 |
+
Enable keyboard navigation for visible sliders
|
358 |
+
```
|
359 |
+
default: false
|
360 |
+
options: boolean (true / false)
|
361 |
+
```
|
362 |
+
|
363 |
+
###Auto
|
364 |
+
|
365 |
+
**auto**
|
366 |
+
Slides will automatically transition
|
367 |
+
```
|
368 |
+
default: false
|
369 |
+
options: boolean (true / false)
|
370 |
+
```
|
371 |
+
**stopAutoOnClick**
|
372 |
+
Auto will stop on interaction with controls
|
373 |
+
```
|
374 |
+
default: false
|
375 |
+
options: boolean (true / false)
|
376 |
+
```
|
377 |
+
|
378 |
+
**pause**
|
379 |
+
The amount of time (in ms) between each auto transition
|
380 |
+
```
|
381 |
+
default: 4000
|
382 |
+
options: integer
|
383 |
+
```
|
384 |
+
|
385 |
+
**autoStart**
|
386 |
+
Auto show starts playing on load. If <code>false</code>, slideshow will start when the "Start" control is clicked
|
387 |
+
```
|
388 |
+
default: true
|
389 |
+
options: boolean (true / false)
|
390 |
+
```
|
391 |
+
|
392 |
+
**autoDirection**
|
393 |
+
The direction of auto show slide transitions
|
394 |
+
```
|
395 |
+
default: 'next'
|
396 |
+
options: 'next', 'prev'
|
397 |
+
```
|
398 |
+
|
399 |
+
**autoHover**
|
400 |
+
Auto show will pause when mouse hovers over slider
|
401 |
+
```
|
402 |
+
default: false
|
403 |
+
options: boolean (true / false)
|
404 |
+
```
|
405 |
+
|
406 |
+
**autoDelay**
|
407 |
+
Time (in ms) auto show should wait before starting
|
408 |
+
```
|
409 |
+
default: 0
|
410 |
+
options: integer
|
411 |
+
```
|
412 |
+
|
413 |
+
###Carousel
|
414 |
+
|
415 |
+
**minSlides**
|
416 |
+
The minimum number of slides to be shown. Slides will be sized down if carousel becomes smaller than the original size.
|
417 |
+
```
|
418 |
+
default: 1
|
419 |
+
options: integer
|
420 |
+
```
|
421 |
+
|
422 |
+
**maxSlides**
|
423 |
+
The maximum number of slides to be shown. Slides will be sized up if carousel becomes larger than the original size.
|
424 |
+
```
|
425 |
+
default: 1
|
426 |
+
options: integer
|
427 |
+
```
|
428 |
+
|
429 |
+
**moveSlides**
|
430 |
+
The number of slides to move on transition. This value must be <code>>= minSlides</code>, and <code><= maxSlides</code>. If zero (default), the number of fully-visible slides will be used.
|
431 |
+
```
|
432 |
+
default: 0
|
433 |
+
options: integer
|
434 |
+
```
|
435 |
+
|
436 |
+
**slideWidth**
|
437 |
+
The width of each slide. This setting is required for all horizontal carousels!
|
438 |
+
```
|
439 |
+
default: 0
|
440 |
+
options: integer
|
441 |
+
```
|
442 |
+
|
443 |
+
**shrinkItems**
|
444 |
+
The Carousel will only show whole items and shrink the images to fit the viewport based on maxSlides/MinSlides.
|
445 |
+
```
|
446 |
+
default: false
|
447 |
+
options: boolean (true / false)
|
448 |
+
```
|
449 |
+
|
450 |
+
###Keyboard
|
451 |
+
|
452 |
+
**keyboardEnabled**
|
453 |
+
Allows for keyboard control of visible slider. Keypress ignored if slider not visible.
|
454 |
+
```
|
455 |
+
default: false
|
456 |
+
options: boolean (true / false)
|
457 |
+
```
|
458 |
+
|
459 |
+
###Accessibility
|
460 |
+
**ariaLive**
|
461 |
+
Adds Aria Live attribute to slider.
|
462 |
+
```
|
463 |
+
default: true
|
464 |
+
options: boolean (true / false)
|
465 |
+
```
|
466 |
+
|
467 |
+
**ariaHidden**
|
468 |
+
Adds Aria Hidden attribute to any nonvisible slides.
|
469 |
+
```
|
470 |
+
default: true
|
471 |
+
options: boolean (true / false)
|
472 |
+
```
|
473 |
+
|
474 |
+
###Callbacks
|
475 |
+
|
476 |
+
**onSliderLoad**
|
477 |
+
Executes immediately after the slider is fully loaded
|
478 |
+
```
|
479 |
+
default: function(){}
|
480 |
+
options: function(currentIndex){ // your code here }
|
481 |
+
arguments:
|
482 |
+
currentIndex: element index of the current slide
|
483 |
+
```
|
484 |
+
|
485 |
+
**onSliderResize**
|
486 |
+
Executes immediately after the slider is resized
|
487 |
+
```
|
488 |
+
default: function(){}
|
489 |
+
options: function(currentIndex){ // your code here }
|
490 |
+
arguments:
|
491 |
+
currentIndex: element index of the current slide
|
492 |
+
```
|
493 |
+
|
494 |
+
**onSlideBefore**
|
495 |
+
Executes immediately before each slide transition.
|
496 |
+
```
|
497 |
+
default: function(){}
|
498 |
+
options: function($slideElement, oldIndex, newIndex){ // your code here }
|
499 |
+
arguments:
|
500 |
+
$slideElement: jQuery element of the destination element
|
501 |
+
oldIndex: element index of the previous slide (before the transition)
|
502 |
+
newIndex: element index of the destination slide (after the transition)
|
503 |
+
```
|
504 |
+
|
505 |
+
**onSlideAfter**
|
506 |
+
Executes immediately after each slide transition. Function argument is the current slide element (when transition completes).
|
507 |
+
```
|
508 |
+
default: function(){}
|
509 |
+
options: function($slideElement, oldIndex, newIndex){ // your code here }
|
510 |
+
arguments:
|
511 |
+
$slideElement: jQuery element of the destination element
|
512 |
+
oldIndex: element index of the previous slide (before the transition)
|
513 |
+
newIndex: element index of the destination slide (after the transition)
|
514 |
+
```
|
515 |
+
|
516 |
+
**onSlideNext**
|
517 |
+
Executes immediately before each "Next" slide transition. Function argument is the target (next) slide element.
|
518 |
+
```
|
519 |
+
default: function(){}
|
520 |
+
options: function($slideElement, oldIndex, newIndex){ // your code here }
|
521 |
+
arguments:
|
522 |
+
$slideElement: jQuery element of the destination element
|
523 |
+
oldIndex: element index of the previous slide (before the transition)
|
524 |
+
newIndex: element index of the destination slide (after the transition)
|
525 |
+
```
|
526 |
+
|
527 |
+
**onSlidePrev**
|
528 |
+
Executes immediately before each "Prev" slide transition. Function argument is the target (prev) slide element.
|
529 |
+
```
|
530 |
+
default: function(){}
|
531 |
+
options: function($slideElement, oldIndex, newIndex){ // your code here }
|
532 |
+
arguments:
|
533 |
+
$slideElement: jQuery element of the destination element
|
534 |
+
oldIndex: element index of the previous slide (before the transition)
|
535 |
+
newIndex: element index of the destination slide (after the transition)
|
536 |
+
```
|
537 |
+
|
538 |
+
###Public methods
|
539 |
+
|
540 |
+
**goToSlide**
|
541 |
+
Performs a slide transition to the supplied slide index (zero-based)
|
542 |
+
```
|
543 |
+
example:
|
544 |
+
slider = $('.bxslider').bxSlider();
|
545 |
+
slider.goToSlide(3);
|
546 |
+
```
|
547 |
+
|
548 |
+
**goToNextSlide**
|
549 |
+
Performs a "Next" slide transition
|
550 |
+
```
|
551 |
+
example:
|
552 |
+
slider = $('.bxslider').bxSlider();
|
553 |
+
slider.goToNextSlide();
|
554 |
+
```
|
555 |
+
|
556 |
+
**goToPrevSlide**
|
557 |
+
Performs a "Prev" slide transition
|
558 |
+
```
|
559 |
+
example:
|
560 |
+
slider = $('.bxslider').bxSlider();
|
561 |
+
slider.goToPrevSlide();
|
562 |
+
```
|
563 |
+
|
564 |
+
**startAuto**
|
565 |
+
Starts the auto show. Provide an argument <code>false</code> to prevent the auto controls from being updated.
|
566 |
+
```
|
567 |
+
example:
|
568 |
+
slider = $('.bxslider').bxSlider();
|
569 |
+
slider.startAuto();
|
570 |
+
```
|
571 |
+
|
572 |
+
**stopAuto**
|
573 |
+
Stops the auto show. Provide an argument <code>false</code> to prevent the auto controls from being updated.
|
574 |
+
```
|
575 |
+
example:
|
576 |
+
slider = $('.bxslider').bxSlider();
|
577 |
+
slider.stopAuto();
|
578 |
+
```
|
579 |
+
|
580 |
+
**getCurrentSlide**
|
581 |
+
Returns the current active slide
|
582 |
+
```
|
583 |
+
example:
|
584 |
+
slider = $('.bxslider').bxSlider();
|
585 |
+
var current = slider.getCurrentSlide();
|
586 |
+
```
|
587 |
+
|
588 |
+
**getSlideCount**
|
589 |
+
Returns the total number of slides in the slider
|
590 |
+
```
|
591 |
+
example:
|
592 |
+
slider = $('.bxslider').bxSlider();
|
593 |
+
var slideQty = slider.getSlideCount();
|
594 |
+
```
|
595 |
+
|
596 |
+
**redrawSlider**
|
597 |
+
Redraw the slider. Useful when needing to redraw a hidden slider after it is unhidden.
|
598 |
+
```
|
599 |
+
example:
|
600 |
+
slider = $('.bxslider').bxSlider();
|
601 |
+
slider.redrawSlider();
|
602 |
+
```
|
603 |
+
|
604 |
+
**reloadSlider**
|
605 |
+
Reload the slider. Useful when adding slides on the fly. Accepts an optional settings object. <a href="/examples/reload-slider-settings">See here for an example.</a>
|
606 |
+
```
|
607 |
+
example:
|
608 |
+
slider = $('.bxslider').bxSlider();
|
609 |
+
slider.reloadSlider();
|
610 |
+
```
|
611 |
+
|
612 |
+
**destroySlider**
|
613 |
+
Destroy the slider. This reverts all slider elements back to their original state (before calling the slider).
|
614 |
+
```
|
615 |
+
example:
|
616 |
+
slider = $('.bxslider').bxSlider();
|
617 |
+
slider.destroySlider();
|
618 |
+
```
|
619 |
+
|
620 |
+
### Local Development with Gulp
|
621 |
+
|
622 |
+
**Unfamiliar with npm? Don't have node installed?** [Download and install node.js](http://nodejs.org/download/) before proceeding.
|
623 |
+
|
624 |
+
From the command line:
|
625 |
+
|
626 |
+
1. Install the CLI: `npm install --global gulp-cli`
|
627 |
+
2. Run `npm install` to install local development tools
|
628 |
+
3. Run `gulp` which will build the project
|
629 |
+
|
630 |
+
## Contributing
|
631 |
+
|
632 |
+
Everyone is welcome to help [contribute](CONTRIBUTING.md) and improve this project. There are several ways you can contribute:
|
633 |
+
|
634 |
+
* Reporting issues (please read [issue guidelines](https://github.com/necolas/issue-guidelines))
|
635 |
+
* Suggesting new features
|
636 |
+
* Writing or refactoring code
|
637 |
+
* Fixing [issues](https://github.com/roots/roots/issues)
|
638 |
+
|
639 |
+
## Changelog
|
640 |
+
|
641 |
+
### Version 4.2.12
|
642 |
+
* Fixes auto control theme
|
643 |
+
|
644 |
+
### Version 4.2.11
|
645 |
+
* Removes auto-centering for sliders with no pager or controls
|
646 |
+
|
647 |
+
### Version 4.2.10
|
648 |
+
* Bumps npm and bower versions
|
649 |
+
|
650 |
+
### Version 4.2.9
|
651 |
+
* Removes node engine version requirement
|
652 |
+
|
653 |
+
### Version 4.2.8
|
654 |
+
* Removes auto-centering from the theme file (`jquery.bxslider.css`)
|
655 |
+
|
656 |
+
### Version 4.2.7
|
657 |
+
* Allows new version to be published to NPM
|
658 |
+
|
659 |
+
### Version 4.2.6
|
660 |
+
* Fix: jQuery 3 support
|
661 |
+
* Adds Gulp and removes Grunt (for easier local development)
|
662 |
+
|
663 |
+
### Version 4.2.5
|
664 |
+
* Fix: Vertical carousel minSlides not working #840
|
665 |
+
* Fix: slider breaks with css animations if settings.speed set to 0 #838
|
666 |
+
* Fix: Slider runs into undefined state when reloadSlider is called before initialization was finished #833
|
667 |
+
|
668 |
+
### Version 4.2.4
|
669 |
+
NOTICE: We have switched to a Grunt based build process in order to leverage [Assemble](http://assemble.io) for local documentation building. Please review the above notes about Grunt for the commands available.
|
670 |
+
|
671 |
+
* Fix: Fixed transition from first to last slide during infinite loop #778
|
672 |
+
* Fix: Reload on multiple sliders doesn't work? #755
|
673 |
+
* Fix: bxSlider with text only #746
|
674 |
+
* Fix: bower missing main and ignore entries #738
|
675 |
+
* Fix: Tickermode transitionend event bubbling #737
|
676 |
+
* Fix: Initializing before destroyed breaks slider #748
|
677 |
+
* Enhancement: Added shrinkItems carousel setting #772
|
678 |
+
* Enhancement: Maintain auto display of slides after a manual selection #594
|
679 |
+
* Enhancement: Slider getter through jquery object #739
|
680 |
+
* Enhancement: Add aria attributes #751
|
681 |
+
* Enhancement: Slider element in every callback and a new method getSliderElement (#780)
|
682 |
+
* Enhancement: Local Documentiation and examples. I have added buildable documentation to the repo. This will expand over time and allow for community corrections as needed. Please see above Grunt notes on how to build.
|
683 |
+
|
684 |
+
|
685 |
+
### Version 4.2.3
|
686 |
+
* Minor bug fix
|
687 |
+
|
688 |
+
### Version 4.2.2
|
689 |
+
* Fix: Remove unused plugin variable (#733)
|
690 |
+
* Fix: `updateAfterSlideTransition` not being called (#704)
|
691 |
+
* Fix: Slider stops auto advancing (#702)
|
692 |
+
* Fix: Refresh page, slider show the last item at the first in mode: 'horizontal' (#694)
|
693 |
+
* Fix: horizintal ticker stutters on loop (#669)
|
694 |
+
* Fix: Wrong bx-wrapper bottom margin with controls=true and pager=false (#647)
|
695 |
+
* Fix: add css tickerHover. (#629)
|
696 |
+
* Fix: Slider refusing to scale down, only up (#611)
|
697 |
+
* Fix: bxSlider freezes on touch devices (#540)
|
698 |
+
* Fix: Multiple fixes and improvements for Windows Mobile Devices (#596)
|
699 |
+
* Fix: Accessing bxslider's slider object inside its “onSliderLoad” callback returns undefined (#475)
|
700 |
+
* Fix: infiniteLoop glitch when scrolling from first to last slide (#429)
|
701 |
+
* Enhancement: Cancel transitions on callbacks by returning false. (#411)
|
702 |
+
* Enhancement: Added Keyboard arrow left and right support (#239)
|
703 |
+
|
704 |
+
### Version 4.2.1
|
705 |
+
* Fix: Merge Conflict in dist
|
706 |
+
* Fix: modified bower.json
|
707 |
+
|
708 |
+
### Version 4.2.0
|
709 |
+
* Fix: Reverse #714, fixes #722.
|
710 |
+
* Fix: Repo Tag #729
|
711 |
+
* Fix: #720 pagerCustom issues
|
712 |
+
|
713 |
+
4.2.0 Introduces a streamlined build process using [gulp](www.gulpjs.com). Along with this new build process the projects folder structure has been changed. You will find a `dist` folder with all assets ready to use, including both minified and unminified versions of the javascript. These assets should be ready to go. In `src` you will find the uncompiled assets, including a new less version of the css for bxslider. This is an important step for bxslider. It will help speed development up and keep work clean. It also paves the way for a big revamp we have planned in the future.
|
714 |
+
|
715 |
+
**Unfamiliar with npm? Don't have node installed?** [Download and install node.js](http://nodejs.org/download/) before proceeding.
|
716 |
+
|
717 |
+
From the command line:
|
718 |
+
|
719 |
+
1. Install [gulp](http://gulpjs.com) globally with `npm install -g gulp`
|
720 |
+
2. Navigate to the project directory, then run `npm install`
|
721 |
+
|
722 |
+
You now have all the necessary dependencies to run the build process.
|
723 |
+
|
724 |
+
### Available gulp commands
|
725 |
+
|
726 |
+
* `gulp` — Compile and optimize all files to `dist`
|
727 |
+
* `gulp styles` — Compile css assets only to `dist`
|
728 |
+
* `gulp scripts` — Compile js assets only to `dist`
|
729 |
+
* `gulp images` - Run lossless compression on all the images and copy to `dist`
|
730 |
+
* `gulp jshint` — Checks JS and JSON code for errors based on our .jshintrc settings
|
731 |
+
|
732 |
+
|
733 |
+
### Version 4.1.3
|
734 |
+
* Fix: responsive issue for horizontal mode for issue #611, #714
|
735 |
+
* Fix: extra space on the left when using fade mode. #715
|
736 |
+
* Fix: wrongly removing custom pager in destroySlider #610
|
737 |
+
* Fix: bug with reloading slider with custom pager #545
|
738 |
+
* Fix: Issue with infinite scroll sometimes returning to 0 #481
|
739 |
+
* Fix: When "infiniteLoop" is used, true is not passed to a clone method. #346
|
740 |
+
* Fix: "pagerCustom" won't work when using reloadSlider #171
|
741 |
+
* Fix: Remove vendor prefix for translateZ(0) #565
|
742 |
+
* Fix: give styles on focus for accessibility #228
|
743 |
+
* Fix: Minified Version out of sync.
|
744 |
+
* Fix: Remove -5px left #517
|
745 |
+
* Enhancement: Invert order call of appendControls() and appendPager() #226
|
746 |
+
* Enhancement: Various Indentation and typos in docs fixed. #551, #578
|
747 |
+
* Enhancement: Update jsDelivr with update.json for autoupdate of CDN
|
748 |
+
* Enhancement: Tag Repo so it can be included in CDNJS
|
749 |
+
* Created development branch to work from. Eventually will restructure entire repo to follow best practice setup.
|
750 |
+
|
751 |
+
|
752 |
+
### Version 4.1.2
|
753 |
+
* Added `bower.json` configuration file. Manage bxSlider as a dependency using [bower](http://bower.io/).
|
754 |
+
|
755 |
+
### Version 4.1.1
|
756 |
+
* Removed imagesLoaded library and added iframe preloading support
|
757 |
+
* Added responsive option - setting to false will prevent $(window).resize binding
|
758 |
+
|
759 |
+
### Version 4.1
|
760 |
+
* Carousel mode (minSlides / maxSlides) was re-written to be more intuitive.
|
761 |
+
* SlideWidth now acts as it should (slides respect the width value).
|
762 |
+
* SlideWidth now properly parsed: accepts string ("600px") or integer (600).
|
763 |
+
* Slider now only needs to load visible slides (by default) in order to initialize which results in much faster loading. A "preloadImages" setting allows for configuration.
|
764 |
+
|
765 |
+
|
766 |
+
Long live Zep.
|
assets_libraries/bxslider/images/bx_loader.gif
ADDED
Binary file
|
assets_libraries/bxslider/images/controls.png
ADDED
Binary file
|
assets_libraries/bxslider/jquery.bxslider.css
ADDED
@@ -0,0 +1,177 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/** VARIABLES
|
2 |
+
===================================*/
|
3 |
+
/** RESET AND LAYOUT
|
4 |
+
===================================*/
|
5 |
+
.bx-wrapper {
|
6 |
+
position: relative;
|
7 |
+
margin-bottom: 60px;
|
8 |
+
padding: 0;
|
9 |
+
*zoom: 1;
|
10 |
+
-ms-touch-action: pan-y;
|
11 |
+
touch-action: pan-y;
|
12 |
+
}
|
13 |
+
.bx-wrapper img {
|
14 |
+
max-width: 100%;
|
15 |
+
display: block;
|
16 |
+
}
|
17 |
+
.bxslider {
|
18 |
+
margin: 0;
|
19 |
+
padding: 0;
|
20 |
+
}
|
21 |
+
ul.bxslider {
|
22 |
+
list-style: none;
|
23 |
+
}
|
24 |
+
.bx-viewport {
|
25 |
+
/*fix other elements on the page moving (on Chrome)*/
|
26 |
+
-webkit-transform: translatez(0);
|
27 |
+
}
|
28 |
+
/** THEME
|
29 |
+
===================================*/
|
30 |
+
.bx-wrapper {
|
31 |
+
-moz-box-shadow: 0 0 5px #ccc;
|
32 |
+
-webkit-box-shadow: 0 0 5px #ccc;
|
33 |
+
box-shadow: 0 0 5px #ccc;
|
34 |
+
border: 5px solid #fff;
|
35 |
+
background: #fff;
|
36 |
+
}
|
37 |
+
.bx-wrapper .bx-pager,
|
38 |
+
.bx-wrapper .bx-controls-auto {
|
39 |
+
position: absolute;
|
40 |
+
bottom: -30px;
|
41 |
+
width: 100%;
|
42 |
+
}
|
43 |
+
/* LOADER */
|
44 |
+
.bx-wrapper .bx-loading {
|
45 |
+
min-height: 50px;
|
46 |
+
background: url('images/bx_loader.gif') center center no-repeat #ffffff;
|
47 |
+
height: 100%;
|
48 |
+
width: 100%;
|
49 |
+
position: absolute;
|
50 |
+
top: 0;
|
51 |
+
left: 0;
|
52 |
+
z-index: 2000;
|
53 |
+
}
|
54 |
+
/* PAGER */
|
55 |
+
.bx-wrapper .bx-pager {
|
56 |
+
text-align: center;
|
57 |
+
font-size: .85em;
|
58 |
+
font-family: Arial;
|
59 |
+
font-weight: bold;
|
60 |
+
color: #666;
|
61 |
+
padding-top: 20px;
|
62 |
+
}
|
63 |
+
.bx-wrapper .bx-pager.bx-default-pager a {
|
64 |
+
background: #666;
|
65 |
+
text-indent: -9999px;
|
66 |
+
display: block;
|
67 |
+
width: 10px;
|
68 |
+
height: 10px;
|
69 |
+
margin: 0 5px;
|
70 |
+
outline: 0;
|
71 |
+
-moz-border-radius: 5px;
|
72 |
+
-webkit-border-radius: 5px;
|
73 |
+
border-radius: 5px;
|
74 |
+
}
|
75 |
+
.bx-wrapper .bx-pager.bx-default-pager a:hover,
|
76 |
+
.bx-wrapper .bx-pager.bx-default-pager a.active,
|
77 |
+
.bx-wrapper .bx-pager.bx-default-pager a:focus {
|
78 |
+
background: #000;
|
79 |
+
}
|
80 |
+
.bx-wrapper .bx-pager-item,
|
81 |
+
.bx-wrapper .bx-controls-auto .bx-controls-auto-item {
|
82 |
+
display: inline-block;
|
83 |
+
vertical-align: bottom;
|
84 |
+
*zoom: 1;
|
85 |
+
*display: inline;
|
86 |
+
}
|
87 |
+
.bx-wrapper .bx-pager-item {
|
88 |
+
font-size: 0;
|
89 |
+
line-height: 0;
|
90 |
+
}
|
91 |
+
/* DIRECTION CONTROLS (NEXT / PREV) */
|
92 |
+
.bx-wrapper .bx-prev {
|
93 |
+
left: 10px;
|
94 |
+
background: url('images/controls.png') no-repeat 0 -32px;
|
95 |
+
}
|
96 |
+
.bx-wrapper .bx-prev:hover,
|
97 |
+
.bx-wrapper .bx-prev:focus {
|
98 |
+
background-position: 0 0;
|
99 |
+
}
|
100 |
+
.bx-wrapper .bx-next {
|
101 |
+
right: 10px;
|
102 |
+
background: url('images/controls.png') no-repeat -43px -32px;
|
103 |
+
}
|
104 |
+
.bx-wrapper .bx-next:hover,
|
105 |
+
.bx-wrapper .bx-next:focus {
|
106 |
+
background-position: -43px 0;
|
107 |
+
}
|
108 |
+
.bx-wrapper .bx-controls-direction a {
|
109 |
+
position: absolute;
|
110 |
+
top: 50%;
|
111 |
+
margin-top: -16px;
|
112 |
+
outline: 0;
|
113 |
+
width: 32px;
|
114 |
+
height: 32px;
|
115 |
+
text-indent: -9999px;
|
116 |
+
z-index: 9999;
|
117 |
+
}
|
118 |
+
.bx-wrapper .bx-controls-direction a.disabled {
|
119 |
+
display: none;
|
120 |
+
}
|
121 |
+
/* AUTO CONTROLS (START / STOP) */
|
122 |
+
.bx-wrapper .bx-controls-auto {
|
123 |
+
text-align: center;
|
124 |
+
}
|
125 |
+
.bx-wrapper .bx-controls-auto .bx-start {
|
126 |
+
display: block;
|
127 |
+
text-indent: -9999px;
|
128 |
+
width: 10px;
|
129 |
+
height: 11px;
|
130 |
+
outline: 0;
|
131 |
+
background: url('images/controls.png') -86px -11px no-repeat;
|
132 |
+
margin: 0 3px;
|
133 |
+
}
|
134 |
+
.bx-wrapper .bx-controls-auto .bx-start:hover,
|
135 |
+
.bx-wrapper .bx-controls-auto .bx-start.active,
|
136 |
+
.bx-wrapper .bx-controls-auto .bx-start:focus {
|
137 |
+
background-position: -86px 0;
|
138 |
+
}
|
139 |
+
.bx-wrapper .bx-controls-auto .bx-stop {
|
140 |
+
display: block;
|
141 |
+
text-indent: -9999px;
|
142 |
+
width: 9px;
|
143 |
+
height: 11px;
|
144 |
+
outline: 0;
|
145 |
+
background: url('images/controls.png') -86px -44px no-repeat;
|
146 |
+
margin: 0 3px;
|
147 |
+
}
|
148 |
+
.bx-wrapper .bx-controls-auto .bx-stop:hover,
|
149 |
+
.bx-wrapper .bx-controls-auto .bx-stop.active,
|
150 |
+
.bx-wrapper .bx-controls-auto .bx-stop:focus {
|
151 |
+
background-position: -86px -33px;
|
152 |
+
}
|
153 |
+
/* PAGER WITH AUTO-CONTROLS HYBRID LAYOUT */
|
154 |
+
.bx-wrapper .bx-controls.bx-has-controls-auto.bx-has-pager .bx-pager {
|
155 |
+
text-align: left;
|
156 |
+
width: 80%;
|
157 |
+
}
|
158 |
+
.bx-wrapper .bx-controls.bx-has-controls-auto.bx-has-pager .bx-controls-auto {
|
159 |
+
right: 0;
|
160 |
+
width: 35px;
|
161 |
+
}
|
162 |
+
/* IMAGE CAPTIONS */
|
163 |
+
.bx-wrapper .bx-caption {
|
164 |
+
position: absolute;
|
165 |
+
bottom: 0;
|
166 |
+
left: 0;
|
167 |
+
background: #666;
|
168 |
+
background: rgba(80, 80, 80, 0.75);
|
169 |
+
width: 100%;
|
170 |
+
}
|
171 |
+
.bx-wrapper .bx-caption span {
|
172 |
+
color: #fff;
|
173 |
+
font-family: Arial;
|
174 |
+
display: block;
|
175 |
+
font-size: .85em;
|
176 |
+
padding: 10px;
|
177 |
+
}
|
assets_libraries/bxslider/jquery.bxslider.js
ADDED
@@ -0,0 +1,1607 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* bxSlider v4.2.12
|
3 |
+
* Copyright 2013-2015 Steven Wanderski
|
4 |
+
* Written while drinking Belgian ales and listening to jazz
|
5 |
+
* Licensed under MIT (http://opensource.org/licenses/MIT)
|
6 |
+
*/
|
7 |
+
|
8 |
+
;(function($) {
|
9 |
+
|
10 |
+
var defaults = {
|
11 |
+
|
12 |
+
// GENERAL
|
13 |
+
mode: 'horizontal',
|
14 |
+
slideSelector: '',
|
15 |
+
infiniteLoop: true,
|
16 |
+
hideControlOnEnd: false,
|
17 |
+
speed: 500,
|
18 |
+
easing: null,
|
19 |
+
slideMargin: 0,
|
20 |
+
startSlide: 0,
|
21 |
+
randomStart: false,
|
22 |
+
captions: false,
|
23 |
+
ticker: false,
|
24 |
+
tickerHover: false,
|
25 |
+
adaptiveHeight: false,
|
26 |
+
adaptiveHeightSpeed: 500,
|
27 |
+
video: false,
|
28 |
+
useCSS: true,
|
29 |
+
preloadImages: 'visible',
|
30 |
+
responsive: true,
|
31 |
+
slideZIndex: 50,
|
32 |
+
wrapperClass: 'bx-wrapper',
|
33 |
+
|
34 |
+
// TOUCH
|
35 |
+
touchEnabled: true,
|
36 |
+
swipeThreshold: 50,
|
37 |
+
oneToOneTouch: true,
|
38 |
+
preventDefaultSwipeX: true,
|
39 |
+
preventDefaultSwipeY: false,
|
40 |
+
|
41 |
+
// ACCESSIBILITY
|
42 |
+
ariaLive: true,
|
43 |
+
ariaHidden: true,
|
44 |
+
|
45 |
+
// KEYBOARD
|
46 |
+
keyboardEnabled: false,
|
47 |
+
|
48 |
+
// PAGER
|
49 |
+
pager: true,
|
50 |
+
pagerType: 'full',
|
51 |
+
pagerShortSeparator: ' / ',
|
52 |
+
pagerSelector: null,
|
53 |
+
buildPager: null,
|
54 |
+
pagerCustom: null,
|
55 |
+
|
56 |
+
// CONTROLS
|
57 |
+
controls: true,
|
58 |
+
nextText: 'Next',
|
59 |
+
prevText: 'Prev',
|
60 |
+
nextSelector: null,
|
61 |
+
prevSelector: null,
|
62 |
+
autoControls: false,
|
63 |
+
startText: 'Start',
|
64 |
+
stopText: 'Stop',
|
65 |
+
autoControlsCombine: false,
|
66 |
+
autoControlsSelector: null,
|
67 |
+
|
68 |
+
// AUTO
|
69 |
+
auto: false,
|
70 |
+
pause: 4000,
|
71 |
+
autoStart: true,
|
72 |
+
autoDirection: 'next',
|
73 |
+
stopAutoOnClick: false,
|
74 |
+
autoHover: false,
|
75 |
+
autoDelay: 0,
|
76 |
+
autoSlideForOnePage: false,
|
77 |
+
|
78 |
+
// CAROUSEL
|
79 |
+
minSlides: 1,
|
80 |
+
maxSlides: 1,
|
81 |
+
moveSlides: 0,
|
82 |
+
slideWidth: 0,
|
83 |
+
shrinkItems: false,
|
84 |
+
|
85 |
+
// CALLBACKS
|
86 |
+
onSliderLoad: function() { return true; },
|
87 |
+
onSlideBefore: function() { return true; },
|
88 |
+
onSlideAfter: function() { return true; },
|
89 |
+
onSlideNext: function() { return true; },
|
90 |
+
onSlidePrev: function() { return true; },
|
91 |
+
onSliderResize: function() { return true; }
|
92 |
+
};
|
93 |
+
|
94 |
+
$.fn.bxSlider = function(options) {
|
95 |
+
|
96 |
+
if (this.length === 0) {
|
97 |
+
return this;
|
98 |
+
}
|
99 |
+
|
100 |
+
// support multiple elements
|
101 |
+
if (this.length > 1) {
|
102 |
+
this.each(function() {
|
103 |
+
$(this).bxSlider(options);
|
104 |
+
});
|
105 |
+
return this;
|
106 |
+
}
|
107 |
+
|
108 |
+
// create a namespace to be used throughout the plugin
|
109 |
+
var slider = {},
|
110 |
+
// set a reference to our slider element
|
111 |
+
el = this,
|
112 |
+
// get the original window dimens (thanks a lot IE)
|
113 |
+
windowWidth = $(window).width(),
|
114 |
+
windowHeight = $(window).height();
|
115 |
+
|
116 |
+
// Return if slider is already initialized
|
117 |
+
if ($(el).data('bxSlider')) { return; }
|
118 |
+
|
119 |
+
/**
|
120 |
+
* ===================================================================================
|
121 |
+
* = PRIVATE FUNCTIONS
|
122 |
+
* ===================================================================================
|
123 |
+
*/
|
124 |
+
|
125 |
+
/**
|
126 |
+
* Initializes namespace settings to be used throughout plugin
|
127 |
+
*/
|
128 |
+
var init = function() {
|
129 |
+
// Return if slider is already initialized
|
130 |
+
if ($(el).data('bxSlider')) { return; }
|
131 |
+
// merge user-supplied options with the defaults
|
132 |
+
slider.settings = $.extend({}, defaults, options);
|
133 |
+
// parse slideWidth setting
|
134 |
+
slider.settings.slideWidth = parseInt(slider.settings.slideWidth);
|
135 |
+
// store the original children
|
136 |
+
slider.children = el.children(slider.settings.slideSelector);
|
137 |
+
// check if actual number of slides is less than minSlides / maxSlides
|
138 |
+
if (slider.children.length < slider.settings.minSlides) { slider.settings.minSlides = slider.children.length; }
|
139 |
+
if (slider.children.length < slider.settings.maxSlides) { slider.settings.maxSlides = slider.children.length; }
|
140 |
+
// if random start, set the startSlide setting to random number
|
141 |
+
if (slider.settings.randomStart) { slider.settings.startSlide = Math.floor(Math.random() * slider.children.length); }
|
142 |
+
// store active slide information
|
143 |
+
slider.active = { index: slider.settings.startSlide };
|
144 |
+
// store if the slider is in carousel mode (displaying / moving multiple slides)
|
145 |
+
slider.carousel = slider.settings.minSlides > 1 || slider.settings.maxSlides > 1 ? true : false;
|
146 |
+
// if carousel, force preloadImages = 'all'
|
147 |
+
if (slider.carousel) { slider.settings.preloadImages = 'all'; }
|
148 |
+
// calculate the min / max width thresholds based on min / max number of slides
|
149 |
+
// used to setup and update carousel slides dimensions
|
150 |
+
slider.minThreshold = (slider.settings.minSlides * slider.settings.slideWidth) + ((slider.settings.minSlides - 1) * slider.settings.slideMargin);
|
151 |
+
slider.maxThreshold = (slider.settings.maxSlides * slider.settings.slideWidth) + ((slider.settings.maxSlides - 1) * slider.settings.slideMargin);
|
152 |
+
// store the current state of the slider (if currently animating, working is true)
|
153 |
+
slider.working = false;
|
154 |
+
// initialize the controls object
|
155 |
+
slider.controls = {};
|
156 |
+
// initialize an auto interval
|
157 |
+
slider.interval = null;
|
158 |
+
// determine which property to use for transitions
|
159 |
+
slider.animProp = slider.settings.mode === 'vertical' ? 'top' : 'left';
|
160 |
+
// determine if hardware acceleration can be used
|
161 |
+
slider.usingCSS = slider.settings.useCSS && slider.settings.mode !== 'fade' && (function() {
|
162 |
+
// create our test div element
|
163 |
+
var div = document.createElement('div'),
|
164 |
+
// css transition properties
|
165 |
+
props = ['WebkitPerspective', 'MozPerspective', 'OPerspective', 'msPerspective'];
|
166 |
+
// test for each property
|
167 |
+
for (var i = 0; i < props.length; i++) {
|
168 |
+
if (div.style[props[i]] !== undefined) {
|
169 |
+
slider.cssPrefix = props[i].replace('Perspective', '').toLowerCase();
|
170 |
+
slider.animProp = '-' + slider.cssPrefix + '-transform';
|
171 |
+
return true;
|
172 |
+
}
|
173 |
+
}
|
174 |
+
return false;
|
175 |
+
}());
|
176 |
+
// if vertical mode always make maxSlides and minSlides equal
|
177 |
+
if (slider.settings.mode === 'vertical') { slider.settings.maxSlides = slider.settings.minSlides; }
|
178 |
+
// save original style data
|
179 |
+
el.data('origStyle', el.attr('style'));
|
180 |
+
el.children(slider.settings.slideSelector).each(function() {
|
181 |
+
$(this).data('origStyle', $(this).attr('style'));
|
182 |
+
});
|
183 |
+
|
184 |
+
// perform all DOM / CSS modifications
|
185 |
+
setup();
|
186 |
+
};
|
187 |
+
|
188 |
+
/**
|
189 |
+
* Performs all DOM and CSS modifications
|
190 |
+
*/
|
191 |
+
var setup = function() {
|
192 |
+
var preloadSelector = slider.children.eq(slider.settings.startSlide); // set the default preload selector (visible)
|
193 |
+
|
194 |
+
// wrap el in a wrapper
|
195 |
+
el.wrap('<div class="' + slider.settings.wrapperClass + '"><div class="bx-viewport"></div></div>');
|
196 |
+
// store a namespace reference to .bx-viewport
|
197 |
+
slider.viewport = el.parent();
|
198 |
+
|
199 |
+
// add aria-live if the setting is enabled and ticker mode is disabled
|
200 |
+
if (slider.settings.ariaLive && !slider.settings.ticker) {
|
201 |
+
slider.viewport.attr('aria-live', 'polite');
|
202 |
+
}
|
203 |
+
// add a loading div to display while images are loading
|
204 |
+
slider.loader = $('<div class="bx-loading" />');
|
205 |
+
slider.viewport.prepend(slider.loader);
|
206 |
+
// set el to a massive width, to hold any needed slides
|
207 |
+
// also strip any margin and padding from el
|
208 |
+
el.css({
|
209 |
+
width: slider.settings.mode === 'horizontal' ? (slider.children.length * 1000 + 215) + '%' : 'auto',
|
210 |
+
position: 'relative'
|
211 |
+
});
|
212 |
+
// if using CSS, add the easing property
|
213 |
+
if (slider.usingCSS && slider.settings.easing) {
|
214 |
+
el.css('-' + slider.cssPrefix + '-transition-timing-function', slider.settings.easing);
|
215 |
+
// if not using CSS and no easing value was supplied, use the default JS animation easing (swing)
|
216 |
+
} else if (!slider.settings.easing) {
|
217 |
+
slider.settings.easing = 'swing';
|
218 |
+
}
|
219 |
+
// make modifications to the viewport (.bx-viewport)
|
220 |
+
slider.viewport.css({
|
221 |
+
width: '100%',
|
222 |
+
overflow: 'hidden',
|
223 |
+
position: 'relative'
|
224 |
+
});
|
225 |
+
slider.viewport.parent().css({
|
226 |
+
maxWidth: getViewportMaxWidth()
|
227 |
+
});
|
228 |
+
// apply css to all slider children
|
229 |
+
slider.children.css({
|
230 |
+
float: slider.settings.mode === 'horizontal' ? 'left' : 'none',
|
231 |
+
listStyle: 'none',
|
232 |
+
position: 'relative'
|
233 |
+
});
|
234 |
+
// apply the calculated width after the float is applied to prevent scrollbar interference
|
235 |
+
slider.children.css('width', getSlideWidth());
|
236 |
+
// if slideMargin is supplied, add the css
|
237 |
+
if (slider.settings.mode === 'horizontal' && slider.settings.slideMargin > 0) { slider.children.css('marginRight', slider.settings.slideMargin); }
|
238 |
+
if (slider.settings.mode === 'vertical' && slider.settings.slideMargin > 0) { slider.children.css('marginBottom', slider.settings.slideMargin); }
|
239 |
+
// if "fade" mode, add positioning and z-index CSS
|
240 |
+
if (slider.settings.mode === 'fade') {
|
241 |
+
slider.children.css({
|
242 |
+
position: 'absolute',
|
243 |
+
zIndex: 0,
|
244 |
+
display: 'none'
|
245 |
+
});
|
246 |
+
// prepare the z-index on the showing element
|
247 |
+
slider.children.eq(slider.settings.startSlide).css({zIndex: slider.settings.slideZIndex, display: 'block'});
|
248 |
+
}
|
249 |
+
// create an element to contain all slider controls (pager, start / stop, etc)
|
250 |
+
slider.controls.el = $('<div class="bx-controls" />');
|
251 |
+
// if captions are requested, add them
|
252 |
+
if (slider.settings.captions) { appendCaptions(); }
|
253 |
+
// check if startSlide is last slide
|
254 |
+
slider.active.last = slider.settings.startSlide === getPagerQty() - 1;
|
255 |
+
// if video is true, set up the fitVids plugin
|
256 |
+
if (slider.settings.video) { el.fitVids(); }
|
257 |
+
if (slider.settings.preloadImages === 'all' || slider.settings.ticker) { preloadSelector = slider.children; }
|
258 |
+
// only check for control addition if not in "ticker" mode
|
259 |
+
if (!slider.settings.ticker) {
|
260 |
+
// if controls are requested, add them
|
261 |
+
if (slider.settings.controls) { appendControls(); }
|
262 |
+
// if auto is true, and auto controls are requested, add them
|
263 |
+
if (slider.settings.auto && slider.settings.autoControls) { appendControlsAuto(); }
|
264 |
+
// if pager is requested, add it
|
265 |
+
if (slider.settings.pager) { appendPager(); }
|
266 |
+
// if any control option is requested, add the controls wrapper
|
267 |
+
if (slider.settings.controls || slider.settings.autoControls || slider.settings.pager) { slider.viewport.after(slider.controls.el); }
|
268 |
+
// if ticker mode, do not allow a pager
|
269 |
+
} else {
|
270 |
+
slider.settings.pager = false;
|
271 |
+
}
|
272 |
+
loadElements(preloadSelector, start);
|
273 |
+
};
|
274 |
+
|
275 |
+
var loadElements = function(selector, callback) {
|
276 |
+
var total = selector.find('img:not([src=""]), iframe').length,
|
277 |
+
count = 0;
|
278 |
+
if (total === 0) {
|
279 |
+
callback();
|
280 |
+
return;
|
281 |
+
}
|
282 |
+
selector.find('img:not([src=""]), iframe').each(function() {
|
283 |
+
$(this).one('load error', function() {
|
284 |
+
if (++count === total) { callback(); }
|
285 |
+
}).each(function() {
|
286 |
+
if (this.complete) { $(this).trigger('load'); }
|
287 |
+
});
|
288 |
+
});
|
289 |
+
};
|
290 |
+
|
291 |
+
/**
|
292 |
+
* Start the slider
|
293 |
+
*/
|
294 |
+
var start = function() {
|
295 |
+
// if infinite loop, prepare additional slides
|
296 |
+
if (slider.settings.infiniteLoop && slider.settings.mode !== 'fade' && !slider.settings.ticker) {
|
297 |
+
var slice = slider.settings.mode === 'vertical' ? slider.settings.minSlides : slider.settings.maxSlides,
|
298 |
+
sliceAppend = slider.children.slice(0, slice).clone(true).addClass('bx-clone'),
|
299 |
+
slicePrepend = slider.children.slice(-slice).clone(true).addClass('bx-clone');
|
300 |
+
if (slider.settings.ariaHidden) {
|
301 |
+
sliceAppend.attr('aria-hidden', true);
|
302 |
+
slicePrepend.attr('aria-hidden', true);
|
303 |
+
}
|
304 |
+
el.append(sliceAppend).prepend(slicePrepend);
|
305 |
+
}
|
306 |
+
// remove the loading DOM element
|
307 |
+
slider.loader.remove();
|
308 |
+
// set the left / top position of "el"
|
309 |
+
setSlidePosition();
|
310 |
+
// if "vertical" mode, always use adaptiveHeight to prevent odd behavior
|
311 |
+
if (slider.settings.mode === 'vertical') { slider.settings.adaptiveHeight = true; }
|
312 |
+
// set the viewport height
|
313 |
+
slider.viewport.height(getViewportHeight());
|
314 |
+
// make sure everything is positioned just right (same as a window resize)
|
315 |
+
el.redrawSlider();
|
316 |
+
// onSliderLoad callback
|
317 |
+
slider.settings.onSliderLoad.call(el, slider.active.index);
|
318 |
+
// slider has been fully initialized
|
319 |
+
slider.initialized = true;
|
320 |
+
// bind the resize call to the window
|
321 |
+
if (slider.settings.responsive) { $(window).bind('resize', resizeWindow); }
|
322 |
+
// if auto is true and has more than 1 page, start the show
|
323 |
+
if (slider.settings.auto && slider.settings.autoStart && (getPagerQty() > 1 || slider.settings.autoSlideForOnePage)) { initAuto(); }
|
324 |
+
// if ticker is true, start the ticker
|
325 |
+
if (slider.settings.ticker) { initTicker(); }
|
326 |
+
// if pager is requested, make the appropriate pager link active
|
327 |
+
if (slider.settings.pager) { updatePagerActive(slider.settings.startSlide); }
|
328 |
+
// check for any updates to the controls (like hideControlOnEnd updates)
|
329 |
+
if (slider.settings.controls) { updateDirectionControls(); }
|
330 |
+
// if touchEnabled is true, setup the touch events
|
331 |
+
if (slider.settings.touchEnabled && !slider.settings.ticker) { initTouch(); }
|
332 |
+
// if keyboardEnabled is true, setup the keyboard events
|
333 |
+
if (slider.settings.keyboardEnabled && !slider.settings.ticker) {
|
334 |
+
$(document).keydown(keyPress);
|
335 |
+
}
|
336 |
+
};
|
337 |
+
|
338 |
+
/**
|
339 |
+
* Returns the calculated height of the viewport, used to determine either adaptiveHeight or the maxHeight value
|
340 |
+
*/
|
341 |
+
var getViewportHeight = function() {
|
342 |
+
var height = 0;
|
343 |
+
// first determine which children (slides) should be used in our height calculation
|
344 |
+
var children = $();
|
345 |
+
// if mode is not "vertical" and adaptiveHeight is false, include all children
|
346 |
+
if (slider.settings.mode !== 'vertical' && !slider.settings.adaptiveHeight) {
|
347 |
+
children = slider.children;
|
348 |
+
} else {
|
349 |
+
// if not carousel, return the single active child
|
350 |
+
if (!slider.carousel) {
|
351 |
+
children = slider.children.eq(slider.active.index);
|
352 |
+
// if carousel, return a slice of children
|
353 |
+
} else {
|
354 |
+
// get the individual slide index
|
355 |
+
var currentIndex = slider.settings.moveSlides === 1 ? slider.active.index : slider.active.index * getMoveBy();
|
356 |
+
// add the current slide to the children
|
357 |
+
children = slider.children.eq(currentIndex);
|
358 |
+
// cycle through the remaining "showing" slides
|
359 |
+
for (i = 1; i <= slider.settings.maxSlides - 1; i++) {
|
360 |
+
// if looped back to the start
|
361 |
+
if (currentIndex + i >= slider.children.length) {
|
362 |
+
children = children.add(slider.children.eq(i - 1));
|
363 |
+
} else {
|
364 |
+
children = children.add(slider.children.eq(currentIndex + i));
|
365 |
+
}
|
366 |
+
}
|
367 |
+
}
|
368 |
+
}
|
369 |
+
// if "vertical" mode, calculate the sum of the heights of the children
|
370 |
+
if (slider.settings.mode === 'vertical') {
|
371 |
+
children.each(function(index) {
|
372 |
+
height += $(this).outerHeight();
|
373 |
+
});
|
374 |
+
// add user-supplied margins
|
375 |
+
if (slider.settings.slideMargin > 0) {
|
376 |
+
height += slider.settings.slideMargin * (slider.settings.minSlides - 1);
|
377 |
+
}
|
378 |
+
// if not "vertical" mode, calculate the max height of the children
|
379 |
+
} else {
|
380 |
+
height = Math.max.apply(Math, children.map(function() {
|
381 |
+
return $(this).outerHeight(false);
|
382 |
+
}).get());
|
383 |
+
}
|
384 |
+
|
385 |
+
if (slider.viewport.css('box-sizing') === 'border-box') {
|
386 |
+
height += parseFloat(slider.viewport.css('padding-top')) + parseFloat(slider.viewport.css('padding-bottom')) +
|
387 |
+
parseFloat(slider.viewport.css('border-top-width')) + parseFloat(slider.viewport.css('border-bottom-width'));
|
388 |
+
} else if (slider.viewport.css('box-sizing') === 'padding-box') {
|
389 |
+
height += parseFloat(slider.viewport.css('padding-top')) + parseFloat(slider.viewport.css('padding-bottom'));
|
390 |
+
}
|
391 |
+
|
392 |
+
return height;
|
393 |
+
};
|
394 |
+
|
395 |
+
/**
|
396 |
+
* Returns the calculated width to be used for the outer wrapper / viewport
|
397 |
+
*/
|
398 |
+
var getViewportMaxWidth = function() {
|
399 |
+
var width = '100%';
|
400 |
+
if (slider.settings.slideWidth > 0) {
|
401 |
+
if (slider.settings.mode === 'horizontal') {
|
402 |
+
width = (slider.settings.maxSlides * slider.settings.slideWidth) + ((slider.settings.maxSlides - 1) * slider.settings.slideMargin);
|
403 |
+
} else {
|
404 |
+
width = slider.settings.slideWidth;
|
405 |
+
}
|
406 |
+
}
|
407 |
+
return width;
|
408 |
+
};
|
409 |
+
|
410 |
+
/**
|
411 |
+
* Returns the calculated width to be applied to each slide
|
412 |
+
*/
|
413 |
+
var getSlideWidth = function() {
|
414 |
+
var newElWidth = slider.settings.slideWidth, // start with any user-supplied slide width
|
415 |
+
wrapWidth = slider.viewport.width(); // get the current viewport width
|
416 |
+
// if slide width was not supplied, or is larger than the viewport use the viewport width
|
417 |
+
if (slider.settings.slideWidth === 0 ||
|
418 |
+
(slider.settings.slideWidth > wrapWidth && !slider.carousel) ||
|
419 |
+
slider.settings.mode === 'vertical') {
|
420 |
+
newElWidth = wrapWidth;
|
421 |
+
// if carousel, use the thresholds to determine the width
|
422 |
+
} else if (slider.settings.maxSlides > 1 && slider.settings.mode === 'horizontal') {
|
423 |
+
if (wrapWidth > slider.maxThreshold) {
|
424 |
+
return newElWidth;
|
425 |
+
} else if (wrapWidth < slider.minThreshold) {
|
426 |
+
newElWidth = (wrapWidth - (slider.settings.slideMargin * (slider.settings.minSlides - 1))) / slider.settings.minSlides;
|
427 |
+
} else if (slider.settings.shrinkItems) {
|
428 |
+
newElWidth = Math.floor((wrapWidth + slider.settings.slideMargin) / (Math.ceil((wrapWidth + slider.settings.slideMargin) / (newElWidth + slider.settings.slideMargin))) - slider.settings.slideMargin);
|
429 |
+
}
|
430 |
+
}
|
431 |
+
return newElWidth;
|
432 |
+
};
|
433 |
+
|
434 |
+
/**
|
435 |
+
* Returns the number of slides currently visible in the viewport (includes partially visible slides)
|
436 |
+
*/
|
437 |
+
var getNumberSlidesShowing = function() {
|
438 |
+
var slidesShowing = 1,
|
439 |
+
childWidth = null;
|
440 |
+
if (slider.settings.mode === 'horizontal' && slider.settings.slideWidth > 0) {
|
441 |
+
// if viewport is smaller than minThreshold, return minSlides
|
442 |
+
if (slider.viewport.width() < slider.minThreshold) {
|
443 |
+
slidesShowing = slider.settings.minSlides;
|
444 |
+
// if viewport is larger than maxThreshold, return maxSlides
|
445 |
+
} else if (slider.viewport.width() > slider.maxThreshold) {
|
446 |
+
slidesShowing = slider.settings.maxSlides;
|
447 |
+
// if viewport is between min / max thresholds, divide viewport width by first child width
|
448 |
+
} else {
|
449 |
+
childWidth = slider.children.first().width() + slider.settings.slideMargin;
|
450 |
+
slidesShowing = Math.floor((slider.viewport.width() +
|
451 |
+
slider.settings.slideMargin) / childWidth);
|
452 |
+
}
|
453 |
+
// if "vertical" mode, slides showing will always be minSlides
|
454 |
+
} else if (slider.settings.mode === 'vertical') {
|
455 |
+
slidesShowing = slider.settings.minSlides;
|
456 |
+
}
|
457 |
+
return slidesShowing;
|
458 |
+
};
|
459 |
+
|
460 |
+
/**
|
461 |
+
* Returns the number of pages (one full viewport of slides is one "page")
|
462 |
+
*/
|
463 |
+
var getPagerQty = function() {
|
464 |
+
var pagerQty = 0,
|
465 |
+
breakPoint = 0,
|
466 |
+
counter = 0;
|
467 |
+
// if moveSlides is specified by the user
|
468 |
+
if (slider.settings.moveSlides > 0) {
|
469 |
+
if (slider.settings.infiniteLoop) {
|
470 |
+
pagerQty = Math.ceil(slider.children.length / getMoveBy());
|
471 |
+
} else {
|
472 |
+
// when breakpoint goes above children length, counter is the number of pages
|
473 |
+
while (breakPoint < slider.children.length) {
|
474 |
+
++pagerQty;
|
475 |
+
breakPoint = counter + getNumberSlidesShowing();
|
476 |
+
counter += slider.settings.moveSlides <= getNumberSlidesShowing() ? slider.settings.moveSlides : getNumberSlidesShowing();
|
477 |
+
}
|
478 |
+
}
|
479 |
+
// if moveSlides is 0 (auto) divide children length by sides showing, then round up
|
480 |
+
} else {
|
481 |
+
pagerQty = Math.ceil(slider.children.length / getNumberSlidesShowing());
|
482 |
+
}
|
483 |
+
return pagerQty;
|
484 |
+
};
|
485 |
+
|
486 |
+
/**
|
487 |
+
* Returns the number of individual slides by which to shift the slider
|
488 |
+
*/
|
489 |
+
var getMoveBy = function() {
|
490 |
+
// if moveSlides was set by the user and moveSlides is less than number of slides showing
|
491 |
+
if (slider.settings.moveSlides > 0 && slider.settings.moveSlides <= getNumberSlidesShowing()) {
|
492 |
+
return slider.settings.moveSlides;
|
493 |
+
}
|
494 |
+
// if moveSlides is 0 (auto)
|
495 |
+
return getNumberSlidesShowing();
|
496 |
+
};
|
497 |
+
|
498 |
+
/**
|
499 |
+
* Sets the slider's (el) left or top position
|
500 |
+
*/
|
501 |
+
var setSlidePosition = function() {
|
502 |
+
var position, lastChild, lastShowingIndex;
|
503 |
+
// if last slide, not infinite loop, and number of children is larger than specified maxSlides
|
504 |
+
if (slider.children.length > slider.settings.maxSlides && slider.active.last && !slider.settings.infiniteLoop) {
|
505 |
+
if (slider.settings.mode === 'horizontal') {
|
506 |
+
// get the last child's position
|
507 |
+
lastChild = slider.children.last();
|
508 |
+
position = lastChild.position();
|
509 |
+
// set the left position
|
510 |
+
setPositionProperty(-(position.left - (slider.viewport.width() - lastChild.outerWidth())), 'reset', 0);
|
511 |
+
} else if (slider.settings.mode === 'vertical') {
|
512 |
+
// get the last showing index's position
|
513 |
+
lastShowingIndex = slider.children.length - slider.settings.minSlides;
|
514 |
+
position = slider.children.eq(lastShowingIndex).position();
|
515 |
+
// set the top position
|
516 |
+
setPositionProperty(-position.top, 'reset', 0);
|
517 |
+
}
|
518 |
+
// if not last slide
|
519 |
+
} else {
|
520 |
+
// get the position of the first showing slide
|
521 |
+
position = slider.children.eq(slider.active.index * getMoveBy()).position();
|
522 |
+
// check for last slide
|
523 |
+
if (slider.active.index === getPagerQty() - 1) { slider.active.last = true; }
|
524 |
+
// set the respective position
|
525 |
+
if (position !== undefined) {
|
526 |
+
if (slider.settings.mode === 'horizontal') { setPositionProperty(-position.left, 'reset', 0); }
|
527 |
+
else if (slider.settings.mode === 'vertical') { setPositionProperty(-position.top, 'reset', 0); }
|
528 |
+
}
|
529 |
+
}
|
530 |
+
};
|
531 |
+
|
532 |
+
/**
|
533 |
+
* Sets the el's animating property position (which in turn will sometimes animate el).
|
534 |
+
* If using CSS, sets the transform property. If not using CSS, sets the top / left property.
|
535 |
+
*
|
536 |
+
* @param value (int)
|
537 |
+
* - the animating property's value
|
538 |
+
*
|
539 |
+
* @param type (string) 'slide', 'reset', 'ticker'
|
540 |
+
* - the type of instance for which the function is being
|
541 |
+
*
|
542 |
+
* @param duration (int)
|
543 |
+
* - the amount of time (in ms) the transition should occupy
|
544 |
+
*
|
545 |
+
* @param params (array) optional
|
546 |
+
* - an optional parameter containing any variables that need to be passed in
|
547 |
+
*/
|
548 |
+
var setPositionProperty = function(value, type, duration, params) {
|
549 |
+
var animateObj, propValue;
|
550 |
+
// use CSS transform
|
551 |
+
if (slider.usingCSS) {
|
552 |
+
// determine the translate3d value
|
553 |
+
propValue = slider.settings.mode === 'vertical' ? 'translate3d(0, ' + value + 'px, 0)' : 'translate3d(' + value + 'px, 0, 0)';
|
554 |
+
// add the CSS transition-duration
|
555 |
+
el.css('-' + slider.cssPrefix + '-transition-duration', duration / 1000 + 's');
|
556 |
+
if (type === 'slide') {
|
557 |
+
// set the property value
|
558 |
+
el.css(slider.animProp, propValue);
|
559 |
+
if (duration !== 0) {
|
560 |
+
// bind a callback method - executes when CSS transition completes
|
561 |
+
el.bind('transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd', function(e) {
|
562 |
+
//make sure it's the correct one
|
563 |
+
if (!$(e.target).is(el)) { return; }
|
564 |
+
// unbind the callback
|
565 |
+
el.unbind('transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd');
|
566 |
+
updateAfterSlideTransition();
|
567 |
+
});
|
568 |
+
} else { //duration = 0
|
569 |
+
updateAfterSlideTransition();
|
570 |
+
}
|
571 |
+
} else if (type === 'reset') {
|
572 |
+
el.css(slider.animProp, propValue);
|
573 |
+
} else if (type === 'ticker') {
|
574 |
+
// make the transition use 'linear'
|
575 |
+
el.css('-' + slider.cssPrefix + '-transition-timing-function', 'linear');
|
576 |
+
el.css(slider.animProp, propValue);
|
577 |
+
if (duration !== 0) {
|
578 |
+
el.bind('transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd', function(e) {
|
579 |
+
//make sure it's the correct one
|
580 |
+
if (!$(e.target).is(el)) { return; }
|
581 |
+
// unbind the callback
|
582 |
+
el.unbind('transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd');
|
583 |
+
// reset the position
|
584 |
+
setPositionProperty(params.resetValue, 'reset', 0);
|
585 |
+
// start the loop again
|
586 |
+
tickerLoop();
|
587 |
+
});
|
588 |
+
} else { //duration = 0
|
589 |
+
setPositionProperty(params.resetValue, 'reset', 0);
|
590 |
+
tickerLoop();
|
591 |
+
}
|
592 |
+
}
|
593 |
+
// use JS animate
|
594 |
+
} else {
|
595 |
+
animateObj = {};
|
596 |
+
animateObj[slider.animProp] = value;
|
597 |
+
if (type === 'slide') {
|
598 |
+
el.animate(animateObj, duration, slider.settings.easing, function() {
|
599 |
+
updateAfterSlideTransition();
|
600 |
+
});
|
601 |
+
} else if (type === 'reset') {
|
602 |
+
el.css(slider.animProp, value);
|
603 |
+
} else if (type === 'ticker') {
|
604 |
+
el.animate(animateObj, duration, 'linear', function() {
|
605 |
+
setPositionProperty(params.resetValue, 'reset', 0);
|
606 |
+
// run the recursive loop after animation
|
607 |
+
tickerLoop();
|
608 |
+
});
|
609 |
+
}
|
610 |
+
}
|
611 |
+
};
|
612 |
+
|
613 |
+
/**
|
614 |
+
* Populates the pager with proper amount of pages
|
615 |
+
*/
|
616 |
+
var populatePager = function() {
|
617 |
+
var pagerHtml = '',
|
618 |
+
linkContent = '',
|
619 |
+
pagerQty = getPagerQty();
|
620 |
+
// loop through each pager item
|
621 |
+
for (var i = 0; i < pagerQty; i++) {
|
622 |
+
linkContent = '';
|
623 |
+
// if a buildPager function is supplied, use it to get pager link value, else use index + 1
|
624 |
+
if (slider.settings.buildPager && $.isFunction(slider.settings.buildPager) || slider.settings.pagerCustom) {
|
625 |
+
linkContent = slider.settings.buildPager(i);
|
626 |
+
slider.pagerEl.addClass('bx-custom-pager');
|
627 |
+
} else {
|
628 |
+
linkContent = i + 1;
|
629 |
+
slider.pagerEl.addClass('bx-default-pager');
|
630 |
+
}
|
631 |
+
// var linkContent = slider.settings.buildPager && $.isFunction(slider.settings.buildPager) ? slider.settings.buildPager(i) : i + 1;
|
632 |
+
// add the markup to the string
|
633 |
+
pagerHtml += '<div class="bx-pager-item"><a href="" data-slide-index="' + i + '" class="bx-pager-link">' + linkContent + '</a></div>';
|
634 |
+
}
|
635 |
+
// populate the pager element with pager links
|
636 |
+
slider.pagerEl.html(pagerHtml);
|
637 |
+
};
|
638 |
+
|
639 |
+
/**
|
640 |
+
* Appends the pager to the controls element
|
641 |
+
*/
|
642 |
+
var appendPager = function() {
|
643 |
+
if (!slider.settings.pagerCustom) {
|
644 |
+
// create the pager DOM element
|
645 |
+
slider.pagerEl = $('<div class="bx-pager" />');
|
646 |
+
// if a pager selector was supplied, populate it with the pager
|
647 |
+
if (slider.settings.pagerSelector) {
|
648 |
+
$(slider.settings.pagerSelector).html(slider.pagerEl);
|
649 |
+
// if no pager selector was supplied, add it after the wrapper
|
650 |
+
} else {
|
651 |
+
slider.controls.el.addClass('bx-has-pager').append(slider.pagerEl);
|
652 |
+
}
|
653 |
+
// populate the pager
|
654 |
+
populatePager();
|
655 |
+
} else {
|
656 |
+
slider.pagerEl = $(slider.settings.pagerCustom);
|
657 |
+
}
|
658 |
+
// assign the pager click binding
|
659 |
+
slider.pagerEl.on('click touchend', 'a', clickPagerBind);
|
660 |
+
};
|
661 |
+
|
662 |
+
/**
|
663 |
+
* Appends prev / next controls to the controls element
|
664 |
+
*/
|
665 |
+
var appendControls = function() {
|
666 |
+
slider.controls.next = $('<a class="bx-next" href="">' + slider.settings.nextText + '</a>');
|
667 |
+
slider.controls.prev = $('<a class="bx-prev" href="">' + slider.settings.prevText + '</a>');
|
668 |
+
// bind click actions to the controls
|
669 |
+
slider.controls.next.bind('click touchend', clickNextBind);
|
670 |
+
slider.controls.prev.bind('click touchend', clickPrevBind);
|
671 |
+
// if nextSelector was supplied, populate it
|
672 |
+
if (slider.settings.nextSelector) {
|
673 |
+
$(slider.settings.nextSelector).append(slider.controls.next);
|
674 |
+
}
|
675 |
+
// if prevSelector was supplied, populate it
|
676 |
+
if (slider.settings.prevSelector) {
|
677 |
+
$(slider.settings.prevSelector).append(slider.controls.prev);
|
678 |
+
}
|
679 |
+
// if no custom selectors were supplied
|
680 |
+
if (!slider.settings.nextSelector && !slider.settings.prevSelector) {
|
681 |
+
// add the controls to the DOM
|
682 |
+
slider.controls.directionEl = $('<div class="bx-controls-direction" />');
|
683 |
+
// add the control elements to the directionEl
|
684 |
+
slider.controls.directionEl.append(slider.controls.prev).append(slider.controls.next);
|
685 |
+
// slider.viewport.append(slider.controls.directionEl);
|
686 |
+
slider.controls.el.addClass('bx-has-controls-direction').append(slider.controls.directionEl);
|
687 |
+
}
|
688 |
+
};
|
689 |
+
|
690 |
+
/**
|
691 |
+
* Appends start / stop auto controls to the controls element
|
692 |
+
*/
|
693 |
+
var appendControlsAuto = function() {
|
694 |
+
slider.controls.start = $('<div class="bx-controls-auto-item"><a class="bx-start" href="">' + slider.settings.startText + '</a></div>');
|
695 |
+
slider.controls.stop = $('<div class="bx-controls-auto-item"><a class="bx-stop" href="">' + slider.settings.stopText + '</a></div>');
|
696 |
+
// add the controls to the DOM
|
697 |
+
slider.controls.autoEl = $('<div class="bx-controls-auto" />');
|
698 |
+
// bind click actions to the controls
|
699 |
+
slider.controls.autoEl.on('click', '.bx-start', clickStartBind);
|
700 |
+
slider.controls.autoEl.on('click', '.bx-stop', clickStopBind);
|
701 |
+
// if autoControlsCombine, insert only the "start" control
|
702 |
+
if (slider.settings.autoControlsCombine) {
|
703 |
+
slider.controls.autoEl.append(slider.controls.start);
|
704 |
+
// if autoControlsCombine is false, insert both controls
|
705 |
+
} else {
|
706 |
+
slider.controls.autoEl.append(slider.controls.start).append(slider.controls.stop);
|
707 |
+
}
|
708 |
+
// if auto controls selector was supplied, populate it with the controls
|
709 |
+
if (slider.settings.autoControlsSelector) {
|
710 |
+
$(slider.settings.autoControlsSelector).html(slider.controls.autoEl);
|
711 |
+
// if auto controls selector was not supplied, add it after the wrapper
|
712 |
+
} else {
|
713 |
+
slider.controls.el.addClass('bx-has-controls-auto').append(slider.controls.autoEl);
|
714 |
+
}
|
715 |
+
// update the auto controls
|
716 |
+
updateAutoControls(slider.settings.autoStart ? 'stop' : 'start');
|
717 |
+
};
|
718 |
+
|
719 |
+
/**
|
720 |
+
* Appends image captions to the DOM
|
721 |
+
*/
|
722 |
+
var appendCaptions = function() {
|
723 |
+
// cycle through each child
|
724 |
+
slider.children.each(function(index) {
|
725 |
+
// get the image title attribute
|
726 |
+
var title = $(this).find('img:first').attr('title');
|
727 |
+
// append the caption
|
728 |
+
if (title !== undefined && ('' + title).length) {
|
729 |
+
$(this).append('<div class="bx-caption"><span>' + title + '</span></div>');
|
730 |
+
}
|
731 |
+
});
|
732 |
+
};
|
733 |
+
|
734 |
+
/**
|
735 |
+
* Click next binding
|
736 |
+
*
|
737 |
+
* @param e (event)
|
738 |
+
* - DOM event object
|
739 |
+
*/
|
740 |
+
var clickNextBind = function(e) {
|
741 |
+
e.preventDefault();
|
742 |
+
if (slider.controls.el.hasClass('disabled')) { return; }
|
743 |
+
// if auto show is running, stop it
|
744 |
+
if (slider.settings.auto && slider.settings.stopAutoOnClick) { el.stopAuto(); }
|
745 |
+
el.goToNextSlide();
|
746 |
+
};
|
747 |
+
|
748 |
+
/**
|
749 |
+
* Click prev binding
|
750 |
+
*
|
751 |
+
* @param e (event)
|
752 |
+
* - DOM event object
|
753 |
+
*/
|
754 |
+
var clickPrevBind = function(e) {
|
755 |
+
e.preventDefault();
|
756 |
+
if (slider.controls.el.hasClass('disabled')) { return; }
|
757 |
+
// if auto show is running, stop it
|
758 |
+
if (slider.settings.auto && slider.settings.stopAutoOnClick) { el.stopAuto(); }
|
759 |
+
el.goToPrevSlide();
|
760 |
+
};
|
761 |
+
|
762 |
+
/**
|
763 |
+
* Click start binding
|
764 |
+
*
|
765 |
+
* @param e (event)
|
766 |
+
* - DOM event object
|
767 |
+
*/
|
768 |
+
var clickStartBind = function(e) {
|
769 |
+
el.startAuto();
|
770 |
+
e.preventDefault();
|
771 |
+
};
|
772 |
+
|
773 |
+
/**
|
774 |
+
* Click stop binding
|
775 |
+
*
|
776 |
+
* @param e (event)
|
777 |
+
* - DOM event object
|
778 |
+
*/
|
779 |
+
var clickStopBind = function(e) {
|
780 |
+
el.stopAuto();
|
781 |
+
e.preventDefault();
|
782 |
+
};
|
783 |
+
|
784 |
+
/**
|
785 |
+
* Click pager binding
|
786 |
+
*
|
787 |
+
* @param e (event)
|
788 |
+
* - DOM event object
|
789 |
+
*/
|
790 |
+
var clickPagerBind = function(e) {
|
791 |
+
var pagerLink, pagerIndex;
|
792 |
+
e.preventDefault();
|
793 |
+
if (slider.controls.el.hasClass('disabled')) {
|
794 |
+
return;
|
795 |
+
}
|
796 |
+
// if auto show is running, stop it
|
797 |
+
if (slider.settings.auto && slider.settings.stopAutoOnClick) { el.stopAuto(); }
|
798 |
+
pagerLink = $(e.currentTarget);
|
799 |
+
if (pagerLink.attr('data-slide-index') !== undefined) {
|
800 |
+
pagerIndex = parseInt(pagerLink.attr('data-slide-index'));
|
801 |
+
// if clicked pager link is not active, continue with the goToSlide call
|
802 |
+
if (pagerIndex !== slider.active.index) { el.goToSlide(pagerIndex); }
|
803 |
+
}
|
804 |
+
};
|
805 |
+
|
806 |
+
/**
|
807 |
+
* Updates the pager links with an active class
|
808 |
+
*
|
809 |
+
* @param slideIndex (int)
|
810 |
+
* - index of slide to make active
|
811 |
+
*/
|
812 |
+
var updatePagerActive = function(slideIndex) {
|
813 |
+
// if "short" pager type
|
814 |
+
var len = slider.children.length; // nb of children
|
815 |
+
if (slider.settings.pagerType === 'short') {
|
816 |
+
if (slider.settings.maxSlides > 1) {
|
817 |
+
len = Math.ceil(slider.children.length / slider.settings.maxSlides);
|
818 |
+
}
|
819 |
+
slider.pagerEl.html((slideIndex + 1) + slider.settings.pagerShortSeparator + len);
|
820 |
+
return;
|
821 |
+
}
|
822 |
+
// remove all pager active classes
|
823 |
+
slider.pagerEl.find('a').removeClass('active');
|
824 |
+
// apply the active class for all pagers
|
825 |
+
slider.pagerEl.each(function(i, el) { $(el).find('a').eq(slideIndex).addClass('active'); });
|
826 |
+
};
|
827 |
+
|
828 |
+
/**
|
829 |
+
* Performs needed actions after a slide transition
|
830 |
+
*/
|
831 |
+
var updateAfterSlideTransition = function() {
|
832 |
+
// if infinite loop is true
|
833 |
+
if (slider.settings.infiniteLoop) {
|
834 |
+
var position = '';
|
835 |
+
// first slide
|
836 |
+
if (slider.active.index === 0) {
|
837 |
+
// set the new position
|
838 |
+
position = slider.children.eq(0).position();
|
839 |
+
// carousel, last slide
|
840 |
+
} else if (slider.active.index === getPagerQty() - 1 && slider.carousel) {
|
841 |
+
position = slider.children.eq((getPagerQty() - 1) * getMoveBy()).position();
|
842 |
+
// last slide
|
843 |
+
} else if (slider.active.index === slider.children.length - 1) {
|
844 |
+
position = slider.children.eq(slider.children.length - 1).position();
|
845 |
+
}
|
846 |
+
if (position) {
|
847 |
+
if (slider.settings.mode === 'horizontal') { setPositionProperty(-position.left, 'reset', 0); }
|
848 |
+
else if (slider.settings.mode === 'vertical') { setPositionProperty(-position.top, 'reset', 0); }
|
849 |
+
}
|
850 |
+
}
|
851 |
+
// declare that the transition is complete
|
852 |
+
slider.working = false;
|
853 |
+
// onSlideAfter callback
|
854 |
+
slider.settings.onSlideAfter.call(el, slider.children.eq(slider.active.index), slider.oldIndex, slider.active.index);
|
855 |
+
};
|
856 |
+
|
857 |
+
/**
|
858 |
+
* Updates the auto controls state (either active, or combined switch)
|
859 |
+
*
|
860 |
+
* @param state (string) "start", "stop"
|
861 |
+
* - the new state of the auto show
|
862 |
+
*/
|
863 |
+
var updateAutoControls = function(state) {
|
864 |
+
// if autoControlsCombine is true, replace the current control with the new state
|
865 |
+
if (slider.settings.autoControlsCombine) {
|
866 |
+
slider.controls.autoEl.html(slider.controls[state]);
|
867 |
+
// if autoControlsCombine is false, apply the "active" class to the appropriate control
|
868 |
+
} else {
|
869 |
+
slider.controls.autoEl.find('a').removeClass('active');
|
870 |
+
slider.controls.autoEl.find('a:not(.bx-' + state + ')').addClass('active');
|
871 |
+
}
|
872 |
+
};
|
873 |
+
|
874 |
+
/**
|
875 |
+
* Updates the direction controls (checks if either should be hidden)
|
876 |
+
*/
|
877 |
+
var updateDirectionControls = function() {
|
878 |
+
if (getPagerQty() === 1) {
|
879 |
+
slider.controls.prev.addClass('disabled');
|
880 |
+
slider.controls.next.addClass('disabled');
|
881 |
+
} else if (!slider.settings.infiniteLoop && slider.settings.hideControlOnEnd) {
|
882 |
+
// if first slide
|
883 |
+
if (slider.active.index === 0) {
|
884 |
+
slider.controls.prev.addClass('disabled');
|
885 |
+
slider.controls.next.removeClass('disabled');
|
886 |
+
// if last slide
|
887 |
+
} else if (slider.active.index === getPagerQty() - 1) {
|
888 |
+
slider.controls.next.addClass('disabled');
|
889 |
+
slider.controls.prev.removeClass('disabled');
|
890 |
+
// if any slide in the middle
|
891 |
+
} else {
|
892 |
+
slider.controls.prev.removeClass('disabled');
|
893 |
+
slider.controls.next.removeClass('disabled');
|
894 |
+
}
|
895 |
+
}
|
896 |
+
};
|
897 |
+
|
898 |
+
/**
|
899 |
+
* Initializes the auto process
|
900 |
+
*/
|
901 |
+
var initAuto = function() {
|
902 |
+
// if autoDelay was supplied, launch the auto show using a setTimeout() call
|
903 |
+
if (slider.settings.autoDelay > 0) {
|
904 |
+
var timeout = setTimeout(el.startAuto, slider.settings.autoDelay);
|
905 |
+
// if autoDelay was not supplied, start the auto show normally
|
906 |
+
} else {
|
907 |
+
el.startAuto();
|
908 |
+
|
909 |
+
//add focus and blur events to ensure its running if timeout gets paused
|
910 |
+
$(window).focus(function() {
|
911 |
+
el.startAuto();
|
912 |
+
}).blur(function() {
|
913 |
+
el.stopAuto();
|
914 |
+
});
|
915 |
+
}
|
916 |
+
// if autoHover is requested
|
917 |
+
if (slider.settings.autoHover) {
|
918 |
+
// on el hover
|
919 |
+
el.hover(function() {
|
920 |
+
// if the auto show is currently playing (has an active interval)
|
921 |
+
if (slider.interval) {
|
922 |
+
// stop the auto show and pass true argument which will prevent control update
|
923 |
+
el.stopAuto(true);
|
924 |
+
// create a new autoPaused value which will be used by the relative "mouseout" event
|
925 |
+
slider.autoPaused = true;
|
926 |
+
}
|
927 |
+
}, function() {
|
928 |
+
// if the autoPaused value was created be the prior "mouseover" event
|
929 |
+
if (slider.autoPaused) {
|
930 |
+
// start the auto show and pass true argument which will prevent control update
|
931 |
+
el.startAuto(true);
|
932 |
+
// reset the autoPaused value
|
933 |
+
slider.autoPaused = null;
|
934 |
+
}
|
935 |
+
});
|
936 |
+
}
|
937 |
+
};
|
938 |
+
|
939 |
+
/**
|
940 |
+
* Initializes the ticker process
|
941 |
+
*/
|
942 |
+
var initTicker = function() {
|
943 |
+
var startPosition = 0,
|
944 |
+
position, transform, value, idx, ratio, property, newSpeed, totalDimens;
|
945 |
+
// if autoDirection is "next", append a clone of the entire slider
|
946 |
+
if (slider.settings.autoDirection === 'next') {
|
947 |
+
el.append(slider.children.clone().addClass('bx-clone'));
|
948 |
+
// if autoDirection is "prev", prepend a clone of the entire slider, and set the left position
|
949 |
+
} else {
|
950 |
+
el.prepend(slider.children.clone().addClass('bx-clone'));
|
951 |
+
position = slider.children.first().position();
|
952 |
+
startPosition = slider.settings.mode === 'horizontal' ? -position.left : -position.top;
|
953 |
+
}
|
954 |
+
setPositionProperty(startPosition, 'reset', 0);
|
955 |
+
// do not allow controls in ticker mode
|
956 |
+
slider.settings.pager = false;
|
957 |
+
slider.settings.controls = false;
|
958 |
+
slider.settings.autoControls = false;
|
959 |
+
// if autoHover is requested
|
960 |
+
if (slider.settings.tickerHover) {
|
961 |
+
if (slider.usingCSS) {
|
962 |
+
idx = slider.settings.mode === 'horizontal' ? 4 : 5;
|
963 |
+
slider.viewport.hover(function() {
|
964 |
+
transform = el.css('-' + slider.cssPrefix + '-transform');
|
965 |
+
value = parseFloat(transform.split(',')[idx]);
|
966 |
+
setPositionProperty(value, 'reset', 0);
|
967 |
+
}, function() {
|
968 |
+
totalDimens = 0;
|
969 |
+
slider.children.each(function(index) {
|
970 |
+
totalDimens += slider.settings.mode === 'horizontal' ? $(this).outerWidth(true) : $(this).outerHeight(true);
|
971 |
+
});
|
972 |
+
// calculate the speed ratio (used to determine the new speed to finish the paused animation)
|
973 |
+
ratio = slider.settings.speed / totalDimens;
|
974 |
+
// determine which property to use
|
975 |
+
property = slider.settings.mode === 'horizontal' ? 'left' : 'top';
|
976 |
+
// calculate the new speed
|
977 |
+
newSpeed = ratio * (totalDimens - (Math.abs(parseInt(value))));
|
978 |
+
tickerLoop(newSpeed);
|
979 |
+
});
|
980 |
+
} else {
|
981 |
+
// on el hover
|
982 |
+
slider.viewport.hover(function() {
|
983 |
+
el.stop();
|
984 |
+
}, function() {
|
985 |
+
// calculate the total width of children (used to calculate the speed ratio)
|
986 |
+
totalDimens = 0;
|
987 |
+
slider.children.each(function(index) {
|
988 |
+
totalDimens += slider.settings.mode === 'horizontal' ? $(this).outerWidth(true) : $(this).outerHeight(true);
|
989 |
+
});
|
990 |
+
// calculate the speed ratio (used to determine the new speed to finish the paused animation)
|
991 |
+
ratio = slider.settings.speed / totalDimens;
|
992 |
+
// determine which property to use
|
993 |
+
property = slider.settings.mode === 'horizontal' ? 'left' : 'top';
|
994 |
+
// calculate the new speed
|
995 |
+
newSpeed = ratio * (totalDimens - (Math.abs(parseInt(el.css(property)))));
|
996 |
+
tickerLoop(newSpeed);
|
997 |
+
});
|
998 |
+
}
|
999 |
+
}
|
1000 |
+
// start the ticker loop
|
1001 |
+
tickerLoop();
|
1002 |
+
};
|
1003 |
+
|
1004 |
+
/**
|
1005 |
+
* Runs a continuous loop, news ticker-style
|
1006 |
+
*/
|
1007 |
+
var tickerLoop = function(resumeSpeed) {
|
1008 |
+
var speed = resumeSpeed ? resumeSpeed : slider.settings.speed,
|
1009 |
+
position = {left: 0, top: 0},
|
1010 |
+
reset = {left: 0, top: 0},
|
1011 |
+
animateProperty, resetValue, params;
|
1012 |
+
|
1013 |
+
// if "next" animate left position to last child, then reset left to 0
|
1014 |
+
if (slider.settings.autoDirection === 'next') {
|
1015 |
+
position = el.find('.bx-clone').first().position();
|
1016 |
+
// if "prev" animate left position to 0, then reset left to first non-clone child
|
1017 |
+
} else {
|
1018 |
+
reset = slider.children.first().position();
|
1019 |
+
}
|
1020 |
+
animateProperty = slider.settings.mode === 'horizontal' ? -position.left : -position.top;
|
1021 |
+
resetValue = slider.settings.mode === 'horizontal' ? -reset.left : -reset.top;
|
1022 |
+
params = {resetValue: resetValue};
|
1023 |
+
setPositionProperty(animateProperty, 'ticker', speed, params);
|
1024 |
+
};
|
1025 |
+
|
1026 |
+
/**
|
1027 |
+
* Check if el is on screen
|
1028 |
+
*/
|
1029 |
+
var isOnScreen = function(el) {
|
1030 |
+
var win = $(window),
|
1031 |
+
viewport = {
|
1032 |
+
top: win.scrollTop(),
|
1033 |
+
left: win.scrollLeft()
|
1034 |
+
},
|
1035 |
+
bounds = el.offset();
|
1036 |
+
|
1037 |
+
viewport.right = viewport.left + win.width();
|
1038 |
+
viewport.bottom = viewport.top + win.height();
|
1039 |
+
bounds.right = bounds.left + el.outerWidth();
|
1040 |
+
bounds.bottom = bounds.top + el.outerHeight();
|
1041 |
+
|
1042 |
+
return (!(viewport.right < bounds.left || viewport.left > bounds.right || viewport.bottom < bounds.top || viewport.top > bounds.bottom));
|
1043 |
+
};
|
1044 |
+
|
1045 |
+
/**
|
1046 |
+
* Initializes keyboard events
|
1047 |
+
*/
|
1048 |
+
var keyPress = function(e) {
|
1049 |
+
var activeElementTag = document.activeElement.tagName.toLowerCase(),
|
1050 |
+
tagFilters = 'input|textarea',
|
1051 |
+
p = new RegExp(activeElementTag,['i']),
|
1052 |
+
result = p.exec(tagFilters);
|
1053 |
+
|
1054 |
+
if (result == null && isOnScreen(el)) {
|
1055 |
+
if (e.keyCode === 39) {
|
1056 |
+
clickNextBind(e);
|
1057 |
+
return false;
|
1058 |
+
} else if (e.keyCode === 37) {
|
1059 |
+
clickPrevBind(e);
|
1060 |
+
return false;
|
1061 |
+
}
|
1062 |
+
}
|
1063 |
+
};
|
1064 |
+
|
1065 |
+
/**
|
1066 |
+
* Initializes touch events
|
1067 |
+
*/
|
1068 |
+
var initTouch = function() {
|
1069 |
+
// initialize object to contain all touch values
|
1070 |
+
slider.touch = {
|
1071 |
+
start: {x: 0, y: 0},
|
1072 |
+
end: {x: 0, y: 0}
|
1073 |
+
};
|
1074 |
+
slider.viewport.bind('touchstart MSPointerDown pointerdown', onTouchStart);
|
1075 |
+
|
1076 |
+
//for browsers that have implemented pointer events and fire a click after
|
1077 |
+
//every pointerup regardless of whether pointerup is on same screen location as pointerdown or not
|
1078 |
+
slider.viewport.on('click', '.bxslider a', function(e) {
|
1079 |
+
if (slider.viewport.hasClass('click-disabled')) {
|
1080 |
+
e.preventDefault();
|
1081 |
+
slider.viewport.removeClass('click-disabled');
|
1082 |
+
}
|
1083 |
+
});
|
1084 |
+
};
|
1085 |
+
|
1086 |
+
/**
|
1087 |
+
* Event handler for "touchstart"
|
1088 |
+
*
|
1089 |
+
* @param e (event)
|
1090 |
+
* - DOM event object
|
1091 |
+
*/
|
1092 |
+
var onTouchStart = function(e) {
|
1093 |
+
//disable slider controls while user is interacting with slides to avoid slider freeze that happens on touch devices when a slide swipe happens immediately after interacting with slider controls
|
1094 |
+
slider.controls.el.addClass('disabled');
|
1095 |
+
|
1096 |
+
if (slider.working) {
|
1097 |
+
e.preventDefault();
|
1098 |
+
slider.controls.el.removeClass('disabled');
|
1099 |
+
} else {
|
1100 |
+
// record the original position when touch starts
|
1101 |
+
slider.touch.originalPos = el.position();
|
1102 |
+
var orig = e.originalEvent,
|
1103 |
+
touchPoints = (typeof orig.changedTouches !== 'undefined') ? orig.changedTouches : [orig];
|
1104 |
+
// record the starting touch x, y coordinates
|
1105 |
+
slider.touch.start.x = touchPoints[0].pageX;
|
1106 |
+
slider.touch.start.y = touchPoints[0].pageY;
|
1107 |
+
|
1108 |
+
if (slider.viewport.get(0).setPointerCapture) {
|
1109 |
+
slider.pointerId = orig.pointerId;
|
1110 |
+
slider.viewport.get(0).setPointerCapture(slider.pointerId);
|
1111 |
+
}
|
1112 |
+
// bind a "touchmove" event to the viewport
|
1113 |
+
slider.viewport.bind('touchmove MSPointerMove pointermove', onTouchMove);
|
1114 |
+
// bind a "touchend" event to the viewport
|
1115 |
+
slider.viewport.bind('touchend MSPointerUp pointerup', onTouchEnd);
|
1116 |
+
slider.viewport.bind('MSPointerCancel pointercancel', onPointerCancel);
|
1117 |
+
}
|
1118 |
+
};
|
1119 |
+
|
1120 |
+
/**
|
1121 |
+
* Cancel Pointer for Windows Phone
|
1122 |
+
*
|
1123 |
+
* @param e (event)
|
1124 |
+
* - DOM event object
|
1125 |
+
*/
|
1126 |
+
var onPointerCancel = function(e) {
|
1127 |
+
/* onPointerCancel handler is needed to deal with situations when a touchend
|
1128 |
+
doesn't fire after a touchstart (this happens on windows phones only) */
|
1129 |
+
setPositionProperty(slider.touch.originalPos.left, 'reset', 0);
|
1130 |
+
|
1131 |
+
//remove handlers
|
1132 |
+
slider.controls.el.removeClass('disabled');
|
1133 |
+
slider.viewport.unbind('MSPointerCancel pointercancel', onPointerCancel);
|
1134 |
+
slider.viewport.unbind('touchmove MSPointerMove pointermove', onTouchMove);
|
1135 |
+
slider.viewport.unbind('touchend MSPointerUp pointerup', onTouchEnd);
|
1136 |
+
if (slider.viewport.get(0).releasePointerCapture) {
|
1137 |
+
slider.viewport.get(0).releasePointerCapture(slider.pointerId);
|
1138 |
+
}
|
1139 |
+
};
|
1140 |
+
|
1141 |
+
/**
|
1142 |
+
* Event handler for "touchmove"
|
1143 |
+
*
|
1144 |
+
* @param e (event)
|
1145 |
+
* - DOM event object
|
1146 |
+
*/
|
1147 |
+
var onTouchMove = function(e) {
|
1148 |
+
var orig = e.originalEvent,
|
1149 |
+
touchPoints = (typeof orig.changedTouches !== 'undefined') ? orig.changedTouches : [orig],
|
1150 |
+
// if scrolling on y axis, do not prevent default
|
1151 |
+
xMovement = Math.abs(touchPoints[0].pageX - slider.touch.start.x),
|
1152 |
+
yMovement = Math.abs(touchPoints[0].pageY - slider.touch.start.y),
|
1153 |
+
value = 0,
|
1154 |
+
change = 0;
|
1155 |
+
|
1156 |
+
// x axis swipe
|
1157 |
+
if ((xMovement * 3) > yMovement && slider.settings.preventDefaultSwipeX) {
|
1158 |
+
e.preventDefault();
|
1159 |
+
// y axis swipe
|
1160 |
+
} else if ((yMovement * 3) > xMovement && slider.settings.preventDefaultSwipeY) {
|
1161 |
+
e.preventDefault();
|
1162 |
+
}
|
1163 |
+
if (slider.settings.mode !== 'fade' && slider.settings.oneToOneTouch) {
|
1164 |
+
// if horizontal, drag along x axis
|
1165 |
+
if (slider.settings.mode === 'horizontal') {
|
1166 |
+
change = touchPoints[0].pageX - slider.touch.start.x;
|
1167 |
+
value = slider.touch.originalPos.left + change;
|
1168 |
+
// if vertical, drag along y axis
|
1169 |
+
} else {
|
1170 |
+
change = touchPoints[0].pageY - slider.touch.start.y;
|
1171 |
+
value = slider.touch.originalPos.top + change;
|
1172 |
+
}
|
1173 |
+
setPositionProperty(value, 'reset', 0);
|
1174 |
+
}
|
1175 |
+
};
|
1176 |
+
|
1177 |
+
/**
|
1178 |
+
* Event handler for "touchend"
|
1179 |
+
*
|
1180 |
+
* @param e (event)
|
1181 |
+
* - DOM event object
|
1182 |
+
*/
|
1183 |
+
var onTouchEnd = function(e) {
|
1184 |
+
slider.viewport.unbind('touchmove MSPointerMove pointermove', onTouchMove);
|
1185 |
+
//enable slider controls as soon as user stops interacing with slides
|
1186 |
+
slider.controls.el.removeClass('disabled');
|
1187 |
+
var orig = e.originalEvent,
|
1188 |
+
touchPoints = (typeof orig.changedTouches !== 'undefined') ? orig.changedTouches : [orig],
|
1189 |
+
value = 0,
|
1190 |
+
distance = 0;
|
1191 |
+
// record end x, y positions
|
1192 |
+
slider.touch.end.x = touchPoints[0].pageX;
|
1193 |
+
slider.touch.end.y = touchPoints[0].pageY;
|
1194 |
+
// if fade mode, check if absolute x distance clears the threshold
|
1195 |
+
if (slider.settings.mode === 'fade') {
|
1196 |
+
distance = Math.abs(slider.touch.start.x - slider.touch.end.x);
|
1197 |
+
if (distance >= slider.settings.swipeThreshold) {
|
1198 |
+
if (slider.touch.start.x > slider.touch.end.x) {
|
1199 |
+
el.goToNextSlide();
|
1200 |
+
} else {
|
1201 |
+
el.goToPrevSlide();
|
1202 |
+
}
|
1203 |
+
el.stopAuto();
|
1204 |
+
}
|
1205 |
+
// not fade mode
|
1206 |
+
} else {
|
1207 |
+
// calculate distance and el's animate property
|
1208 |
+
if (slider.settings.mode === 'horizontal') {
|
1209 |
+
distance = slider.touch.end.x - slider.touch.start.x;
|
1210 |
+
value = slider.touch.originalPos.left;
|
1211 |
+
} else {
|
1212 |
+
distance = slider.touch.end.y - slider.touch.start.y;
|
1213 |
+
value = slider.touch.originalPos.top;
|
1214 |
+
}
|
1215 |
+
// if not infinite loop and first / last slide, do not attempt a slide transition
|
1216 |
+
if (!slider.settings.infiniteLoop && ((slider.active.index === 0 && distance > 0) || (slider.active.last && distance < 0))) {
|
1217 |
+
setPositionProperty(value, 'reset', 200);
|
1218 |
+
} else {
|
1219 |
+
// check if distance clears threshold
|
1220 |
+
if (Math.abs(distance) >= slider.settings.swipeThreshold) {
|
1221 |
+
if (distance < 0) {
|
1222 |
+
el.goToNextSlide();
|
1223 |
+
} else {
|
1224 |
+
el.goToPrevSlide();
|
1225 |
+
}
|
1226 |
+
el.stopAuto();
|
1227 |
+
} else {
|
1228 |
+
// el.animate(property, 200);
|
1229 |
+
setPositionProperty(value, 'reset', 200);
|
1230 |
+
}
|
1231 |
+
}
|
1232 |
+
}
|
1233 |
+
slider.viewport.unbind('touchend MSPointerUp pointerup', onTouchEnd);
|
1234 |
+
if (slider.viewport.get(0).releasePointerCapture) {
|
1235 |
+
slider.viewport.get(0).releasePointerCapture(slider.pointerId);
|
1236 |
+
}
|
1237 |
+
};
|
1238 |
+
|
1239 |
+
/**
|
1240 |
+
* Window resize event callback
|
1241 |
+
*/
|
1242 |
+
var resizeWindow = function(e) {
|
1243 |
+
// don't do anything if slider isn't initialized.
|
1244 |
+
if (!slider.initialized) { return; }
|
1245 |
+
// Delay if slider working.
|
1246 |
+
if (slider.working) {
|
1247 |
+
window.setTimeout(resizeWindow, 10);
|
1248 |
+
} else {
|
1249 |
+
// get the new window dimens (again, thank you IE)
|
1250 |
+
var windowWidthNew = $(window).width(),
|
1251 |
+
windowHeightNew = $(window).height();
|
1252 |
+
// make sure that it is a true window resize
|
1253 |
+
// *we must check this because our dinosaur friend IE fires a window resize event when certain DOM elements
|
1254 |
+
// are resized. Can you just die already?*
|
1255 |
+
if (windowWidth !== windowWidthNew || windowHeight !== windowHeightNew) {
|
1256 |
+
// set the new window dimens
|
1257 |
+
windowWidth = windowWidthNew;
|
1258 |
+
windowHeight = windowHeightNew;
|
1259 |
+
// update all dynamic elements
|
1260 |
+
el.redrawSlider();
|
1261 |
+
// Call user resize handler
|
1262 |
+
slider.settings.onSliderResize.call(el, slider.active.index);
|
1263 |
+
}
|
1264 |
+
}
|
1265 |
+
};
|
1266 |
+
|
1267 |
+
/**
|
1268 |
+
* Adds an aria-hidden=true attribute to each element
|
1269 |
+
*
|
1270 |
+
* @param startVisibleIndex (int)
|
1271 |
+
* - the first visible element's index
|
1272 |
+
*/
|
1273 |
+
var applyAriaHiddenAttributes = function(startVisibleIndex) {
|
1274 |
+
var numberOfSlidesShowing = getNumberSlidesShowing();
|
1275 |
+
// only apply attributes if the setting is enabled and not in ticker mode
|
1276 |
+
if (slider.settings.ariaHidden && !slider.settings.ticker) {
|
1277 |
+
// add aria-hidden=true to all elements
|
1278 |
+
slider.children.attr('aria-hidden', 'true');
|
1279 |
+
// get the visible elements and change to aria-hidden=false
|
1280 |
+
slider.children.slice(startVisibleIndex, startVisibleIndex + numberOfSlidesShowing).attr('aria-hidden', 'false');
|
1281 |
+
}
|
1282 |
+
};
|
1283 |
+
|
1284 |
+
/**
|
1285 |
+
* Returns index according to present page range
|
1286 |
+
*
|
1287 |
+
* @param slideOndex (int)
|
1288 |
+
* - the desired slide index
|
1289 |
+
*/
|
1290 |
+
var setSlideIndex = function(slideIndex) {
|
1291 |
+
if (slideIndex < 0) {
|
1292 |
+
if (slider.settings.infiniteLoop) {
|
1293 |
+
return getPagerQty() - 1;
|
1294 |
+
}else {
|
1295 |
+
//we don't go to undefined slides
|
1296 |
+
return slider.active.index;
|
1297 |
+
}
|
1298 |
+
// if slideIndex is greater than children length, set active index to 0 (this happens during infinite loop)
|
1299 |
+
} else if (slideIndex >= getPagerQty()) {
|
1300 |
+
if (slider.settings.infiniteLoop) {
|
1301 |
+
return 0;
|
1302 |
+
} else {
|
1303 |
+
//we don't move to undefined pages
|
1304 |
+
return slider.active.index;
|
1305 |
+
}
|
1306 |
+
// set active index to requested slide
|
1307 |
+
} else {
|
1308 |
+
return slideIndex;
|
1309 |
+
}
|
1310 |
+
};
|
1311 |
+
|
1312 |
+
/**
|
1313 |
+
* ===================================================================================
|
1314 |
+
* = PUBLIC FUNCTIONS
|
1315 |
+
* ===================================================================================
|
1316 |
+
*/
|
1317 |
+
|
1318 |
+
/**
|
1319 |
+
* Performs slide transition to the specified slide
|
1320 |
+
*
|
1321 |
+
* @param slideIndex (int)
|
1322 |
+
* - the destination slide's index (zero-based)
|
1323 |
+
*
|
1324 |
+
* @param direction (string)
|
1325 |
+
* - INTERNAL USE ONLY - the direction of travel ("prev" / "next")
|
1326 |
+
*/
|
1327 |
+
el.goToSlide = function(slideIndex, direction) {
|
1328 |
+
// onSlideBefore, onSlideNext, onSlidePrev callbacks
|
1329 |
+
// Allow transition canceling based on returned value
|
1330 |
+
var performTransition = true,
|
1331 |
+
moveBy = 0,
|
1332 |
+
position = {left: 0, top: 0},
|
1333 |
+
lastChild = null,
|
1334 |
+
lastShowingIndex, eq, value, requestEl;
|
1335 |
+
// store the old index
|
1336 |
+
slider.oldIndex = slider.active.index;
|
1337 |
+
//set new index
|
1338 |
+
slider.active.index = setSlideIndex(slideIndex);
|
1339 |
+
|
1340 |
+
// if plugin is currently in motion, ignore request
|
1341 |
+
if (slider.working || slider.active.index === slider.oldIndex) { return; }
|
1342 |
+
// declare that plugin is in motion
|
1343 |
+
slider.working = true;
|
1344 |
+
|
1345 |
+
performTransition = slider.settings.onSlideBefore.call(el, slider.children.eq(slider.active.index), slider.oldIndex, slider.active.index);
|
1346 |
+
|
1347 |
+
// If transitions canceled, reset and return
|
1348 |
+
if (typeof (performTransition) !== 'undefined' && !performTransition) {
|
1349 |
+
slider.active.index = slider.oldIndex; // restore old index
|
1350 |
+
slider.working = false; // is not in motion
|
1351 |
+
return;
|
1352 |
+
}
|
1353 |
+
|
1354 |
+
if (direction === 'next') {
|
1355 |
+
// Prevent canceling in future functions or lack there-of from negating previous commands to cancel
|
1356 |
+
if (!slider.settings.onSlideNext.call(el, slider.children.eq(slider.active.index), slider.oldIndex, slider.active.index)) {
|
1357 |
+
performTransition = false;
|
1358 |
+
}
|
1359 |
+
} else if (direction === 'prev') {
|
1360 |
+
// Prevent canceling in future functions or lack there-of from negating previous commands to cancel
|
1361 |
+
if (!slider.settings.onSlidePrev.call(el, slider.children.eq(slider.active.index), slider.oldIndex, slider.active.index)) {
|
1362 |
+
performTransition = false;
|
1363 |
+
}
|
1364 |
+
}
|
1365 |
+
|
1366 |
+
// check if last slide
|
1367 |
+
slider.active.last = slider.active.index >= getPagerQty() - 1;
|
1368 |
+
// update the pager with active class
|
1369 |
+
if (slider.settings.pager || slider.settings.pagerCustom) { updatePagerActive(slider.active.index); }
|
1370 |
+
// // check for direction control update
|
1371 |
+
if (slider.settings.controls) { updateDirectionControls(); }
|
1372 |
+
// if slider is set to mode: "fade"
|
1373 |
+
if (slider.settings.mode === 'fade') {
|
1374 |
+
// if adaptiveHeight is true and next height is different from current height, animate to the new height
|
1375 |
+
if (slider.settings.adaptiveHeight && slider.viewport.height() !== getViewportHeight()) {
|
1376 |
+
slider.viewport.animate({height: getViewportHeight()}, slider.settings.adaptiveHeightSpeed);
|
1377 |
+
}
|
1378 |
+
// fade out the visible child and reset its z-index value
|
1379 |
+
slider.children.filter(':visible').fadeOut(slider.settings.speed).css({zIndex: 0});
|
1380 |
+
// fade in the newly requested slide
|
1381 |
+
slider.children.eq(slider.active.index).css('zIndex', slider.settings.slideZIndex + 1).fadeIn(slider.settings.speed, function() {
|
1382 |
+
$(this).css('zIndex', slider.settings.slideZIndex);
|
1383 |
+
updateAfterSlideTransition();
|
1384 |
+
});
|
1385 |
+
// slider mode is not "fade"
|
1386 |
+
} else {
|
1387 |
+
// if adaptiveHeight is true and next height is different from current height, animate to the new height
|
1388 |
+
if (slider.settings.adaptiveHeight && slider.viewport.height() !== getViewportHeight()) {
|
1389 |
+
slider.viewport.animate({height: getViewportHeight()}, slider.settings.adaptiveHeightSpeed);
|
1390 |
+
}
|
1391 |
+
// if carousel and not infinite loop
|
1392 |
+
if (!slider.settings.infiniteLoop && slider.carousel && slider.active.last) {
|
1393 |
+
if (slider.settings.mode === 'horizontal') {
|
1394 |
+
// get the last child position
|
1395 |
+
lastChild = slider.children.eq(slider.children.length - 1);
|
1396 |
+
position = lastChild.position();
|
1397 |
+
// calculate the position of the last slide
|
1398 |
+
moveBy = slider.viewport.width() - lastChild.outerWidth();
|
1399 |
+
} else {
|
1400 |
+
// get last showing index position
|
1401 |
+
lastShowingIndex = slider.children.length - slider.settings.minSlides;
|
1402 |
+
position = slider.children.eq(lastShowingIndex).position();
|
1403 |
+
}
|
1404 |
+
// horizontal carousel, going previous while on first slide (infiniteLoop mode)
|
1405 |
+
} else if (slider.carousel && slider.active.last && direction === 'prev') {
|
1406 |
+
// get the last child position
|
1407 |
+
eq = slider.settings.moveSlides === 1 ? slider.settings.maxSlides - getMoveBy() : ((getPagerQty() - 1) * getMoveBy()) - (slider.children.length - slider.settings.maxSlides);
|
1408 |
+
lastChild = el.children('.bx-clone').eq(eq);
|
1409 |
+
position = lastChild.position();
|
1410 |
+
// if infinite loop and "Next" is clicked on the last slide
|
1411 |
+
} else if (direction === 'next' && slider.active.index === 0) {
|
1412 |
+
// get the last clone position
|
1413 |
+
position = el.find('> .bx-clone').eq(slider.settings.maxSlides).position();
|
1414 |
+
slider.active.last = false;
|
1415 |
+
// normal non-zero requests
|
1416 |
+
} else if (slideIndex >= 0) {
|
1417 |
+
//parseInt is applied to allow floats for slides/page
|
1418 |
+
requestEl = slideIndex * parseInt(getMoveBy());
|
1419 |
+
position = slider.children.eq(requestEl).position();
|
1420 |
+
}
|
1421 |
+
|
1422 |
+
/* If the position doesn't exist
|
1423 |
+
* (e.g. if you destroy the slider on a next click),
|
1424 |
+
* it doesn't throw an error.
|
1425 |
+
*/
|
1426 |
+
if (typeof (position) !== 'undefined') {
|
1427 |
+
value = slider.settings.mode === 'horizontal' ? -(position.left - moveBy) : -position.top;
|
1428 |
+
// plugin values to be animated
|
1429 |
+
setPositionProperty(value, 'slide', slider.settings.speed);
|
1430 |
+
} else {
|
1431 |
+
slider.working = false;
|
1432 |
+
}
|
1433 |
+
}
|
1434 |
+
if (slider.settings.ariaHidden) { applyAriaHiddenAttributes(slider.active.index * getMoveBy()); }
|
1435 |
+
};
|
1436 |
+
|
1437 |
+
/**
|
1438 |
+
* Transitions to the next slide in the show
|
1439 |
+
*/
|
1440 |
+
el.goToNextSlide = function() {
|
1441 |
+
// if infiniteLoop is false and last page is showing, disregard call
|
1442 |
+
if (!slider.settings.infiniteLoop && slider.active.last) { return; }
|
1443 |
+
var pagerIndex = parseInt(slider.active.index) + 1;
|
1444 |
+
el.goToSlide(pagerIndex, 'next');
|
1445 |
+
};
|
1446 |
+
|
1447 |
+
/**
|
1448 |
+
* Transitions to the prev slide in the show
|
1449 |
+
*/
|
1450 |
+
el.goToPrevSlide = function() {
|
1451 |
+
// if infiniteLoop is false and last page is showing, disregard call
|
1452 |
+
if (!slider.settings.infiniteLoop && slider.active.index === 0) { return; }
|
1453 |
+
var pagerIndex = parseInt(slider.active.index) - 1;
|
1454 |
+
el.goToSlide(pagerIndex, 'prev');
|
1455 |
+
};
|
1456 |
+
|
1457 |
+
/**
|
1458 |
+
* Starts the auto show
|
1459 |
+
*
|
1460 |
+
* @param preventControlUpdate (boolean)
|
1461 |
+
* - if true, auto controls state will not be updated
|
1462 |
+
*/
|
1463 |
+
el.startAuto = function(preventControlUpdate) {
|
1464 |
+
// if an interval already exists, disregard call
|
1465 |
+
if (slider.interval) { return; }
|
1466 |
+
// create an interval
|
1467 |
+
slider.interval = setInterval(function() {
|
1468 |
+
if (slider.settings.autoDirection === 'next') {
|
1469 |
+
el.goToNextSlide();
|
1470 |
+
} else {
|
1471 |
+
el.goToPrevSlide();
|
1472 |
+
}
|
1473 |
+
}, slider.settings.pause);
|
1474 |
+
// if auto controls are displayed and preventControlUpdate is not true
|
1475 |
+
if (slider.settings.autoControls && preventControlUpdate !== true) { updateAutoControls('stop'); }
|
1476 |
+
};
|
1477 |
+
|
1478 |
+
/**
|
1479 |
+
* Stops the auto show
|
1480 |
+
*
|
1481 |
+
* @param preventControlUpdate (boolean)
|
1482 |
+
* - if true, auto controls state will not be updated
|
1483 |
+
*/
|
1484 |
+
el.stopAuto = function(preventControlUpdate) {
|
1485 |
+
// if no interval exists, disregard call
|
1486 |
+
if (!slider.interval) { return; }
|
1487 |
+
// clear the interval
|
1488 |
+
clearInterval(slider.interval);
|
1489 |
+
slider.interval = null;
|
1490 |
+
// if auto controls are displayed and preventControlUpdate is not true
|
1491 |
+
if (slider.settings.autoControls && preventControlUpdate !== true) { updateAutoControls('start'); }
|
1492 |
+
};
|
1493 |
+
|
1494 |
+
/**
|
1495 |
+
* Returns current slide index (zero-based)
|
1496 |
+
*/
|
1497 |
+
el.getCurrentSlide = function() {
|
1498 |
+
return slider.active.index;
|
1499 |
+
};
|
1500 |
+
|
1501 |
+
/**
|
1502 |
+
* Returns current slide element
|
1503 |
+
*/
|
1504 |
+
el.getCurrentSlideElement = function() {
|
1505 |
+
return slider.children.eq(slider.active.index);
|
1506 |
+
};
|
1507 |
+
|
1508 |
+
/**
|
1509 |
+
* Returns a slide element
|
1510 |
+
* @param index (int)
|
1511 |
+
* - The index (zero-based) of the element you want returned.
|
1512 |
+
*/
|
1513 |
+
el.getSlideElement = function(index) {
|
1514 |
+
return slider.children.eq(index);
|
1515 |
+
};
|
1516 |
+
|
1517 |
+
/**
|
1518 |
+
* Returns number of slides in show
|
1519 |
+
*/
|
1520 |
+
el.getSlideCount = function() {
|
1521 |
+
return slider.children.length;
|
1522 |
+
};
|
1523 |
+
|
1524 |
+
/**
|
1525 |
+
* Return slider.working variable
|
1526 |
+
*/
|
1527 |
+
el.isWorking = function() {
|
1528 |
+
return slider.working;
|
1529 |
+
};
|
1530 |
+
|
1531 |
+
/**
|
1532 |
+
* Update all dynamic slider elements
|
1533 |
+
*/
|
1534 |
+
el.redrawSlider = function() {
|
1535 |
+
// resize all children in ratio to new screen size
|
1536 |
+
slider.children.add(el.find('.bx-clone')).outerWidth(getSlideWidth());
|
1537 |
+
// adjust the height
|
1538 |
+
slider.viewport.css('height', getViewportHeight());
|
1539 |
+
// update the slide position
|
1540 |
+
if (!slider.settings.ticker) { setSlidePosition(); }
|
1541 |
+
// if active.last was true before the screen resize, we want
|
1542 |
+
// to keep it last no matter what screen size we end on
|
1543 |
+
if (slider.active.last) { slider.active.index = getPagerQty() - 1; }
|
1544 |
+
// if the active index (page) no longer exists due to the resize, simply set the index as last
|
1545 |
+
if (slider.active.index >= getPagerQty()) { slider.active.last = true; }
|
1546 |
+
// if a pager is being displayed and a custom pager is not being used, update it
|
1547 |
+
if (slider.settings.pager && !slider.settings.pagerCustom) {
|
1548 |
+
populatePager();
|
1549 |
+
updatePagerActive(slider.active.index);
|
1550 |
+
}
|
1551 |
+
if (slider.settings.ariaHidden) { applyAriaHiddenAttributes(slider.active.index * getMoveBy()); }
|
1552 |
+
};
|
1553 |
+
|
1554 |
+
/**
|
1555 |
+
* Destroy the current instance of the slider (revert everything back to original state)
|
1556 |
+
*/
|
1557 |
+
el.destroySlider = function() {
|
1558 |
+
// don't do anything if slider has already been destroyed
|
1559 |
+
if (!slider.initialized) { return; }
|
1560 |
+
slider.initialized = false;
|
1561 |
+
$('.bx-clone', this).remove();
|
1562 |
+
slider.children.each(function() {
|
1563 |
+
if ($(this).data('origStyle') !== undefined) {
|
1564 |
+
$(this).attr('style', $(this).data('origStyle'));
|
1565 |
+
} else {
|
1566 |
+
$(this).removeAttr('style');
|
1567 |
+
}
|
1568 |
+
});
|
1569 |
+
if ($(this).data('origStyle') !== undefined) {
|
1570 |
+
this.attr('style', $(this).data('origStyle'));
|
1571 |
+
} else {
|
1572 |
+
$(this).removeAttr('style');
|
1573 |
+
}
|
1574 |
+
$(this).unwrap().unwrap();
|
1575 |
+
if (slider.controls.el) { slider.controls.el.remove(); }
|
1576 |
+
if (slider.controls.next) { slider.controls.next.remove(); }
|
1577 |
+
if (slider.controls.prev) { slider.controls.prev.remove(); }
|
1578 |
+
if (slider.pagerEl && slider.settings.controls && !slider.settings.pagerCustom) { slider.pagerEl.remove(); }
|
1579 |
+
$('.bx-caption', this).remove();
|
1580 |
+
if (slider.controls.autoEl) { slider.controls.autoEl.remove(); }
|
1581 |
+
clearInterval(slider.interval);
|
1582 |
+
if (slider.settings.responsive) { $(window).unbind('resize', resizeWindow); }
|
1583 |
+
if (slider.settings.keyboardEnabled) { $(document).unbind('keydown', keyPress); }
|
1584 |
+
//remove self reference in data
|
1585 |
+
$(this).removeData('bxSlider');
|
1586 |
+
};
|
1587 |
+
|
1588 |
+
/**
|
1589 |
+
* Reload the slider (revert all DOM changes, and re-initialize)
|
1590 |
+
*/
|
1591 |
+
el.reloadSlider = function(settings) {
|
1592 |
+
if (settings !== undefined) { options = settings; }
|
1593 |
+
el.destroySlider();
|
1594 |
+
init();
|
1595 |
+
//store reference to self in order to access public functions later
|
1596 |
+
$(el).data('bxSlider', this);
|
1597 |
+
};
|
1598 |
+
|
1599 |
+
init();
|
1600 |
+
|
1601 |
+
$(el).data('bxSlider', this);
|
1602 |
+
|
1603 |
+
// returns the current jQuery object
|
1604 |
+
return this;
|
1605 |
+
};
|
1606 |
+
|
1607 |
+
})(jQuery);
|
assets_libraries/bxslider/jquery.bxslider.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
.bx-wrapper{position:relative;margin-bottom:60px;padding:0;-ms-touch-action:pan-y;touch-action:pan-y;-moz-box-shadow:0 0 5px #ccc;-webkit-box-shadow:0 0 5px #ccc;box-shadow:0 0 5px #ccc;border:5px solid #fff;background:#fff}.bx-wrapper img{max-width:100%;display:block}.bxslider{margin:0;padding:0}ul.bxslider{list-style:none}.bx-viewport{-webkit-transform:translatez(0)}.bx-wrapper .bx-controls-auto,.bx-wrapper .bx-pager{position:absolute;bottom:-30px;width:100%}.bx-wrapper .bx-loading{min-height:50px;background:url(images/bx_loader.gif) center center no-repeat #fff;height:100%;width:100%;position:absolute;top:0;left:0;z-index:2000}.bx-wrapper .bx-pager{text-align:center;font-size:.85em;font-family:Arial;font-weight:700;color:#666;padding-top:20px}.bx-wrapper .bx-pager.bx-default-pager a{background:#666;text-indent:-9999px;display:block;width:10px;height:10px;margin:0 5px;outline:0;-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.bx-wrapper .bx-pager.bx-default-pager a.active,.bx-wrapper .bx-pager.bx-default-pager a:focus,.bx-wrapper .bx-pager.bx-default-pager a:hover{background:#000}.bx-wrapper .bx-controls-auto .bx-controls-auto-item,.bx-wrapper .bx-pager-item{display:inline-block;vertical-align:bottom}.bx-wrapper .bx-pager-item{font-size:0;line-height:0}.bx-wrapper .bx-prev{left:10px;background:url(images/controls.png) 0 -32px no-repeat}.bx-wrapper .bx-prev:focus,.bx-wrapper .bx-prev:hover{background-position:0 0}.bx-wrapper .bx-next{right:10px;background:url(images/controls.png) -43px -32px no-repeat}.bx-wrapper .bx-next:focus,.bx-wrapper .bx-next:hover{background-position:-43px 0}.bx-wrapper .bx-controls-direction a{position:absolute;top:50%;margin-top:-16px;outline:0;width:32px;height:32px;text-indent:-9999px;z-index:9999}.bx-wrapper .bx-controls-direction a.disabled{display:none}.bx-wrapper .bx-controls-auto{text-align:center}.bx-wrapper .bx-controls-auto .bx-start{display:block;text-indent:-9999px;width:10px;height:11px;outline:0;background:url(images/controls.png) -86px -11px no-repeat;margin:0 3px}.bx-wrapper .bx-controls-auto .bx-start.active,.bx-wrapper .bx-controls-auto .bx-start:focus,.bx-wrapper .bx-controls-auto .bx-start:hover{background-position:-86px 0}.bx-wrapper .bx-controls-auto .bx-stop{display:block;text-indent:-9999px;width:9px;height:11px;outline:0;background:url(images/controls.png) -86px -44px no-repeat;margin:0 3px}.bx-wrapper .bx-controls-auto .bx-stop.active,.bx-wrapper .bx-controls-auto .bx-stop:focus,.bx-wrapper .bx-controls-auto .bx-stop:hover{background-position:-86px -33px}.bx-wrapper .bx-controls.bx-has-controls-auto.bx-has-pager .bx-pager{text-align:left;width:80%}.bx-wrapper .bx-controls.bx-has-controls-auto.bx-has-pager .bx-controls-auto{right:0;width:35px}.bx-wrapper .bx-caption{position:absolute;bottom:0;left:0;background:#666;background:rgba(80,80,80,.75);width:100%}.bx-wrapper .bx-caption span{color:#fff;font-family:Arial;display:block;font-size:.85em;padding:10px}
|
assets_libraries/bxslider/jquery.bxslider.min.js
ADDED
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* bxSlider v4.2.12
|
3 |
+
* Copyright 2013-2015 Steven Wanderski
|
4 |
+
* Written while drinking Belgian ales and listening to jazz
|
5 |
+
* Licensed under MIT (http://opensource.org/licenses/MIT)
|
6 |
+
*/
|
7 |
+
!function(t){var e={mode:"horizontal",slideSelector:"",infiniteLoop:!0,hideControlOnEnd:!1,speed:500,easing:null,slideMargin:0,startSlide:0,randomStart:!1,captions:!1,ticker:!1,tickerHover:!1,adaptiveHeight:!1,adaptiveHeightSpeed:500,video:!1,useCSS:!0,preloadImages:"visible",responsive:!0,slideZIndex:50,wrapperClass:"bx-wrapper",touchEnabled:!0,swipeThreshold:50,oneToOneTouch:!0,preventDefaultSwipeX:!0,preventDefaultSwipeY:!1,ariaLive:!0,ariaHidden:!0,keyboardEnabled:!1,pager:!0,pagerType:"full",pagerShortSeparator:" / ",pagerSelector:null,buildPager:null,pagerCustom:null,controls:!0,nextText:"Next",prevText:"Prev",nextSelector:null,prevSelector:null,autoControls:!1,startText:"Start",stopText:"Stop",autoControlsCombine:!1,autoControlsSelector:null,auto:!1,pause:4e3,autoStart:!0,autoDirection:"next",stopAutoOnClick:!1,autoHover:!1,autoDelay:0,autoSlideForOnePage:!1,minSlides:1,maxSlides:1,moveSlides:0,slideWidth:0,shrinkItems:!1,onSliderLoad:function(){return!0},onSlideBefore:function(){return!0},onSlideAfter:function(){return!0},onSlideNext:function(){return!0},onSlidePrev:function(){return!0},onSliderResize:function(){return!0}};t.fn.bxSlider=function(n){if(0===this.length)return this;if(this.length>1)return this.each(function(){t(this).bxSlider(n)}),this;var s={},o=this,r=t(window).width(),a=t(window).height();if(!t(o).data("bxSlider")){var l=function(){t(o).data("bxSlider")||(s.settings=t.extend({},e,n),s.settings.slideWidth=parseInt(s.settings.slideWidth),s.children=o.children(s.settings.slideSelector),s.children.length<s.settings.minSlides&&(s.settings.minSlides=s.children.length),s.children.length<s.settings.maxSlides&&(s.settings.maxSlides=s.children.length),s.settings.randomStart&&(s.settings.startSlide=Math.floor(Math.random()*s.children.length)),s.active={index:s.settings.startSlide},s.carousel=s.settings.minSlides>1||s.settings.maxSlides>1,s.carousel&&(s.settings.preloadImages="all"),s.minThreshold=s.settings.minSlides*s.settings.slideWidth+(s.settings.minSlides-1)*s.settings.slideMargin,s.maxThreshold=s.settings.maxSlides*s.settings.slideWidth+(s.settings.maxSlides-1)*s.settings.slideMargin,s.working=!1,s.controls={},s.interval=null,s.animProp="vertical"===s.settings.mode?"top":"left",s.usingCSS=s.settings.useCSS&&"fade"!==s.settings.mode&&function(){for(var t=document.createElement("div"),e=["WebkitPerspective","MozPerspective","OPerspective","msPerspective"],i=0;i<e.length;i++)if(void 0!==t.style[e[i]])return s.cssPrefix=e[i].replace("Perspective","").toLowerCase(),s.animProp="-"+s.cssPrefix+"-transform",!0;return!1}(),"vertical"===s.settings.mode&&(s.settings.maxSlides=s.settings.minSlides),o.data("origStyle",o.attr("style")),o.children(s.settings.slideSelector).each(function(){t(this).data("origStyle",t(this).attr("style"))}),d())},d=function(){var e=s.children.eq(s.settings.startSlide);o.wrap('<div class="'+s.settings.wrapperClass+'"><div class="bx-viewport"></div></div>'),s.viewport=o.parent(),s.settings.ariaLive&&!s.settings.ticker&&s.viewport.attr("aria-live","polite"),s.loader=t('<div class="bx-loading" />'),s.viewport.prepend(s.loader),o.css({width:"horizontal"===s.settings.mode?1e3*s.children.length+215+"%":"auto",position:"relative"}),s.usingCSS&&s.settings.easing?o.css("-"+s.cssPrefix+"-transition-timing-function",s.settings.easing):s.settings.easing||(s.settings.easing="swing"),s.viewport.css({width:"100%",overflow:"hidden",position:"relative"}),s.viewport.parent().css({maxWidth:u()}),s.children.css({float:"horizontal"===s.settings.mode?"left":"none",listStyle:"none",position:"relative"}),s.children.css("width",h()),"horizontal"===s.settings.mode&&s.settings.slideMargin>0&&s.children.css("marginRight",s.settings.slideMargin),"vertical"===s.settings.mode&&s.settings.slideMargin>0&&s.children.css("marginBottom",s.settings.slideMargin),"fade"===s.settings.mode&&(s.children.css({position:"absolute",zIndex:0,display:"none"}),s.children.eq(s.settings.startSlide).css({zIndex:s.settings.slideZIndex,display:"block"})),s.controls.el=t('<div class="bx-controls" />'),s.settings.captions&&P(),s.active.last=s.settings.startSlide===f()-1,s.settings.video&&o.fitVids(),("all"===s.settings.preloadImages||s.settings.ticker)&&(e=s.children),s.settings.ticker?s.settings.pager=!1:(s.settings.controls&&C(),s.settings.auto&&s.settings.autoControls&&T(),s.settings.pager&&w(),(s.settings.controls||s.settings.autoControls||s.settings.pager)&&s.viewport.after(s.controls.el)),c(e,g)},c=function(e,i){var n=e.find('img:not([src=""]), iframe').length,s=0;return 0===n?void i():void e.find('img:not([src=""]), iframe').each(function(){t(this).one("load error",function(){++s===n&&i()}).each(function(){this.complete&&t(this).trigger("load")})})},g=function(){if(s.settings.infiniteLoop&&"fade"!==s.settings.mode&&!s.settings.ticker){var e="vertical"===s.settings.mode?s.settings.minSlides:s.settings.maxSlides,i=s.children.slice(0,e).clone(!0).addClass("bx-clone"),n=s.children.slice(-e).clone(!0).addClass("bx-clone");s.settings.ariaHidden&&(i.attr("aria-hidden",!0),n.attr("aria-hidden",!0)),o.append(i).prepend(n)}s.loader.remove(),m(),"vertical"===s.settings.mode&&(s.settings.adaptiveHeight=!0),s.viewport.height(p()),o.redrawSlider(),s.settings.onSliderLoad.call(o,s.active.index),s.initialized=!0,s.settings.responsive&&t(window).bind("resize",Z),s.settings.auto&&s.settings.autoStart&&(f()>1||s.settings.autoSlideForOnePage)&&H(),s.settings.ticker&&W(),s.settings.pager&&I(s.settings.startSlide),s.settings.controls&&D(),s.settings.touchEnabled&&!s.settings.ticker&&N(),s.settings.keyboardEnabled&&!s.settings.ticker&&t(document).keydown(F)},p=function(){var e=0,n=t();if("vertical"===s.settings.mode||s.settings.adaptiveHeight)if(s.carousel){var o=1===s.settings.moveSlides?s.active.index:s.active.index*x();for(n=s.children.eq(o),i=1;i<=s.settings.maxSlides-1;i++)n=o+i>=s.children.length?n.add(s.children.eq(i-1)):n.add(s.children.eq(o+i))}else n=s.children.eq(s.active.index);else n=s.children;return"vertical"===s.settings.mode?(n.each(function(i){e+=t(this).outerHeight()}),s.settings.slideMargin>0&&(e+=s.settings.slideMargin*(s.settings.minSlides-1))):e=Math.max.apply(Math,n.map(function(){return t(this).outerHeight(!1)}).get()),"border-box"===s.viewport.css("box-sizing")?e+=parseFloat(s.viewport.css("padding-top"))+parseFloat(s.viewport.css("padding-bottom"))+parseFloat(s.viewport.css("border-top-width"))+parseFloat(s.viewport.css("border-bottom-width")):"padding-box"===s.viewport.css("box-sizing")&&(e+=parseFloat(s.viewport.css("padding-top"))+parseFloat(s.viewport.css("padding-bottom"))),e},u=function(){var t="100%";return s.settings.slideWidth>0&&(t="horizontal"===s.settings.mode?s.settings.maxSlides*s.settings.slideWidth+(s.settings.maxSlides-1)*s.settings.slideMargin:s.settings.slideWidth),t},h=function(){var t=s.settings.slideWidth,e=s.viewport.width();if(0===s.settings.slideWidth||s.settings.slideWidth>e&&!s.carousel||"vertical"===s.settings.mode)t=e;else if(s.settings.maxSlides>1&&"horizontal"===s.settings.mode){if(e>s.maxThreshold)return t;e<s.minThreshold?t=(e-s.settings.slideMargin*(s.settings.minSlides-1))/s.settings.minSlides:s.settings.shrinkItems&&(t=Math.floor((e+s.settings.slideMargin)/Math.ceil((e+s.settings.slideMargin)/(t+s.settings.slideMargin))-s.settings.slideMargin))}return t},v=function(){var t=1,e=null;return"horizontal"===s.settings.mode&&s.settings.slideWidth>0?s.viewport.width()<s.minThreshold?t=s.settings.minSlides:s.viewport.width()>s.maxThreshold?t=s.settings.maxSlides:(e=s.children.first().width()+s.settings.slideMargin,t=Math.floor((s.viewport.width()+s.settings.slideMargin)/e)):"vertical"===s.settings.mode&&(t=s.settings.minSlides),t},f=function(){var t=0,e=0,i=0;if(s.settings.moveSlides>0)if(s.settings.infiniteLoop)t=Math.ceil(s.children.length/x());else for(;e<s.children.length;)++t,e=i+v(),i+=s.settings.moveSlides<=v()?s.settings.moveSlides:v();else t=Math.ceil(s.children.length/v());return t},x=function(){return s.settings.moveSlides>0&&s.settings.moveSlides<=v()?s.settings.moveSlides:v()},m=function(){var t,e,i;s.children.length>s.settings.maxSlides&&s.active.last&&!s.settings.infiniteLoop?"horizontal"===s.settings.mode?(e=s.children.last(),t=e.position(),S(-(t.left-(s.viewport.width()-e.outerWidth())),"reset",0)):"vertical"===s.settings.mode&&(i=s.children.length-s.settings.minSlides,t=s.children.eq(i).position(),S(-t.top,"reset",0)):(t=s.children.eq(s.active.index*x()).position(),s.active.index===f()-1&&(s.active.last=!0),void 0!==t&&("horizontal"===s.settings.mode?S(-t.left,"reset",0):"vertical"===s.settings.mode&&S(-t.top,"reset",0)))},S=function(e,i,n,r){var a,l;s.usingCSS?(l="vertical"===s.settings.mode?"translate3d(0, "+e+"px, 0)":"translate3d("+e+"px, 0, 0)",o.css("-"+s.cssPrefix+"-transition-duration",n/1e3+"s"),"slide"===i?(o.css(s.animProp,l),0!==n?o.bind("transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd",function(e){t(e.target).is(o)&&(o.unbind("transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd"),q())}):q()):"reset"===i?o.css(s.animProp,l):"ticker"===i&&(o.css("-"+s.cssPrefix+"-transition-timing-function","linear"),o.css(s.animProp,l),0!==n?o.bind("transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd",function(e){t(e.target).is(o)&&(o.unbind("transitionend webkitTransitionEnd oTransitionEnd MSTransitionEnd"),S(r.resetValue,"reset",0),L())}):(S(r.resetValue,"reset",0),L()))):(a={},a[s.animProp]=e,"slide"===i?o.animate(a,n,s.settings.easing,function(){q()}):"reset"===i?o.css(s.animProp,e):"ticker"===i&&o.animate(a,n,"linear",function(){S(r.resetValue,"reset",0),L()}))},b=function(){for(var e="",i="",n=f(),o=0;o<n;o++)i="",s.settings.buildPager&&t.isFunction(s.settings.buildPager)||s.settings.pagerCustom?(i=s.settings.buildPager(o),s.pagerEl.addClass("bx-custom-pager")):(i=o+1,s.pagerEl.addClass("bx-default-pager")),e+='<div class="bx-pager-item"><a href="" data-slide-index="'+o+'" class="bx-pager-link">'+i+"</a></div>";s.pagerEl.html(e)},w=function(){s.settings.pagerCustom?s.pagerEl=t(s.settings.pagerCustom):(s.pagerEl=t('<div class="bx-pager" />'),s.settings.pagerSelector?t(s.settings.pagerSelector).html(s.pagerEl):s.controls.el.addClass("bx-has-pager").append(s.pagerEl),b()),s.pagerEl.on("click touchend","a",z)},C=function(){s.controls.next=t('<a class="bx-next" href="">'+s.settings.nextText+"</a>"),s.controls.prev=t('<a class="bx-prev" href="">'+s.settings.prevText+"</a>"),s.controls.next.bind("click touchend",E),s.controls.prev.bind("click touchend",k),s.settings.nextSelector&&t(s.settings.nextSelector).append(s.controls.next),s.settings.prevSelector&&t(s.settings.prevSelector).append(s.controls.prev),s.settings.nextSelector||s.settings.prevSelector||(s.controls.directionEl=t('<div class="bx-controls-direction" />'),s.controls.directionEl.append(s.controls.prev).append(s.controls.next),s.controls.el.addClass("bx-has-controls-direction").append(s.controls.directionEl))},T=function(){s.controls.start=t('<div class="bx-controls-auto-item"><a class="bx-start" href="">'+s.settings.startText+"</a></div>"),s.controls.stop=t('<div class="bx-controls-auto-item"><a class="bx-stop" href="">'+s.settings.stopText+"</a></div>"),s.controls.autoEl=t('<div class="bx-controls-auto" />'),s.controls.autoEl.on("click",".bx-start",M),s.controls.autoEl.on("click",".bx-stop",y),s.settings.autoControlsCombine?s.controls.autoEl.append(s.controls.start):s.controls.autoEl.append(s.controls.start).append(s.controls.stop),s.settings.autoControlsSelector?t(s.settings.autoControlsSelector).html(s.controls.autoEl):s.controls.el.addClass("bx-has-controls-auto").append(s.controls.autoEl),A(s.settings.autoStart?"stop":"start")},P=function(){s.children.each(function(e){var i=t(this).find("img:first").attr("title");void 0!==i&&(""+i).length&&t(this).append('<div class="bx-caption"><span>'+i+"</span></div>")})},E=function(t){t.preventDefault(),s.controls.el.hasClass("disabled")||(s.settings.auto&&s.settings.stopAutoOnClick&&o.stopAuto(),o.goToNextSlide())},k=function(t){t.preventDefault(),s.controls.el.hasClass("disabled")||(s.settings.auto&&s.settings.stopAutoOnClick&&o.stopAuto(),o.goToPrevSlide())},M=function(t){o.startAuto(),t.preventDefault()},y=function(t){o.stopAuto(),t.preventDefault()},z=function(e){var i,n;e.preventDefault(),s.controls.el.hasClass("disabled")||(s.settings.auto&&s.settings.stopAutoOnClick&&o.stopAuto(),i=t(e.currentTarget),void 0!==i.attr("data-slide-index")&&(n=parseInt(i.attr("data-slide-index")),n!==s.active.index&&o.goToSlide(n)))},I=function(e){var i=s.children.length;return"short"===s.settings.pagerType?(s.settings.maxSlides>1&&(i=Math.ceil(s.children.length/s.settings.maxSlides)),void s.pagerEl.html(e+1+s.settings.pagerShortSeparator+i)):(s.pagerEl.find("a").removeClass("active"),void s.pagerEl.each(function(i,n){t(n).find("a").eq(e).addClass("active")}))},q=function(){if(s.settings.infiniteLoop){var t="";0===s.active.index?t=s.children.eq(0).position():s.active.index===f()-1&&s.carousel?t=s.children.eq((f()-1)*x()).position():s.active.index===s.children.length-1&&(t=s.children.eq(s.children.length-1).position()),t&&("horizontal"===s.settings.mode?S(-t.left,"reset",0):"vertical"===s.settings.mode&&S(-t.top,"reset",0))}s.working=!1,s.settings.onSlideAfter.call(o,s.children.eq(s.active.index),s.oldIndex,s.active.index)},A=function(t){s.settings.autoControlsCombine?s.controls.autoEl.html(s.controls[t]):(s.controls.autoEl.find("a").removeClass("active"),s.controls.autoEl.find("a:not(.bx-"+t+")").addClass("active"))},D=function(){1===f()?(s.controls.prev.addClass("disabled"),s.controls.next.addClass("disabled")):!s.settings.infiniteLoop&&s.settings.hideControlOnEnd&&(0===s.active.index?(s.controls.prev.addClass("disabled"),s.controls.next.removeClass("disabled")):s.active.index===f()-1?(s.controls.next.addClass("disabled"),s.controls.prev.removeClass("disabled")):(s.controls.prev.removeClass("disabled"),s.controls.next.removeClass("disabled")))},H=function(){if(s.settings.autoDelay>0){setTimeout(o.startAuto,s.settings.autoDelay)}else o.startAuto(),t(window).focus(function(){o.startAuto()}).blur(function(){o.stopAuto()});s.settings.autoHover&&o.hover(function(){s.interval&&(o.stopAuto(!0),s.autoPaused=!0)},function(){s.autoPaused&&(o.startAuto(!0),s.autoPaused=null)})},W=function(){var e,i,n,r,a,l,d,c,g=0;"next"===s.settings.autoDirection?o.append(s.children.clone().addClass("bx-clone")):(o.prepend(s.children.clone().addClass("bx-clone")),e=s.children.first().position(),g="horizontal"===s.settings.mode?-e.left:-e.top),S(g,"reset",0),s.settings.pager=!1,s.settings.controls=!1,s.settings.autoControls=!1,s.settings.tickerHover&&(s.usingCSS?(r="horizontal"===s.settings.mode?4:5,s.viewport.hover(function(){i=o.css("-"+s.cssPrefix+"-transform"),n=parseFloat(i.split(",")[r]),S(n,"reset",0)},function(){c=0,s.children.each(function(e){c+="horizontal"===s.settings.mode?t(this).outerWidth(!0):t(this).outerHeight(!0)}),a=s.settings.speed/c,l="horizontal"===s.settings.mode?"left":"top",d=a*(c-Math.abs(parseInt(n))),L(d)})):s.viewport.hover(function(){o.stop()},function(){c=0,s.children.each(function(e){c+="horizontal"===s.settings.mode?t(this).outerWidth(!0):t(this).outerHeight(!0)}),a=s.settings.speed/c,l="horizontal"===s.settings.mode?"left":"top",d=a*(c-Math.abs(parseInt(o.css(l)))),L(d)})),L()},L=function(t){var e,i,n,r=t?t:s.settings.speed,a={left:0,top:0},l={left:0,top:0};"next"===s.settings.autoDirection?a=o.find(".bx-clone").first().position():l=s.children.first().position(),e="horizontal"===s.settings.mode?-a.left:-a.top,i="horizontal"===s.settings.mode?-l.left:-l.top,n={resetValue:i},S(e,"ticker",r,n)},O=function(e){var i=t(window),n={top:i.scrollTop(),left:i.scrollLeft()},s=e.offset();return n.right=n.left+i.width(),n.bottom=n.top+i.height(),s.right=s.left+e.outerWidth(),s.bottom=s.top+e.outerHeight(),!(n.right<s.left||n.left>s.right||n.bottom<s.top||n.top>s.bottom)},F=function(t){var e=document.activeElement.tagName.toLowerCase(),i="input|textarea",n=new RegExp(e,["i"]),s=n.exec(i);if(null==s&&O(o)){if(39===t.keyCode)return E(t),!1;if(37===t.keyCode)return k(t),!1}},N=function(){s.touch={start:{x:0,y:0},end:{x:0,y:0}},s.viewport.bind("touchstart MSPointerDown pointerdown",X),s.viewport.on("click",".bxslider a",function(t){s.viewport.hasClass("click-disabled")&&(t.preventDefault(),s.viewport.removeClass("click-disabled"))})},X=function(t){if(s.controls.el.addClass("disabled"),s.working)t.preventDefault(),s.controls.el.removeClass("disabled");else{s.touch.originalPos=o.position();var e=t.originalEvent,i="undefined"!=typeof e.changedTouches?e.changedTouches:[e];s.touch.start.x=i[0].pageX,s.touch.start.y=i[0].pageY,s.viewport.get(0).setPointerCapture&&(s.pointerId=e.pointerId,s.viewport.get(0).setPointerCapture(s.pointerId)),s.viewport.bind("touchmove MSPointerMove pointermove",V),s.viewport.bind("touchend MSPointerUp pointerup",R),s.viewport.bind("MSPointerCancel pointercancel",Y)}},Y=function(t){S(s.touch.originalPos.left,"reset",0),s.controls.el.removeClass("disabled"),s.viewport.unbind("MSPointerCancel pointercancel",Y),s.viewport.unbind("touchmove MSPointerMove pointermove",V),s.viewport.unbind("touchend MSPointerUp pointerup",R),s.viewport.get(0).releasePointerCapture&&s.viewport.get(0).releasePointerCapture(s.pointerId)},V=function(t){var e=t.originalEvent,i="undefined"!=typeof e.changedTouches?e.changedTouches:[e],n=Math.abs(i[0].pageX-s.touch.start.x),o=Math.abs(i[0].pageY-s.touch.start.y),r=0,a=0;3*n>o&&s.settings.preventDefaultSwipeX?t.preventDefault():3*o>n&&s.settings.preventDefaultSwipeY&&t.preventDefault(),"fade"!==s.settings.mode&&s.settings.oneToOneTouch&&("horizontal"===s.settings.mode?(a=i[0].pageX-s.touch.start.x,r=s.touch.originalPos.left+a):(a=i[0].pageY-s.touch.start.y,r=s.touch.originalPos.top+a),S(r,"reset",0))},R=function(t){s.viewport.unbind("touchmove MSPointerMove pointermove",V),s.controls.el.removeClass("disabled");var e=t.originalEvent,i="undefined"!=typeof e.changedTouches?e.changedTouches:[e],n=0,r=0;s.touch.end.x=i[0].pageX,s.touch.end.y=i[0].pageY,"fade"===s.settings.mode?(r=Math.abs(s.touch.start.x-s.touch.end.x),r>=s.settings.swipeThreshold&&(s.touch.start.x>s.touch.end.x?o.goToNextSlide():o.goToPrevSlide(),o.stopAuto())):("horizontal"===s.settings.mode?(r=s.touch.end.x-s.touch.start.x,n=s.touch.originalPos.left):(r=s.touch.end.y-s.touch.start.y,n=s.touch.originalPos.top),!s.settings.infiniteLoop&&(0===s.active.index&&r>0||s.active.last&&r<0)?S(n,"reset",200):Math.abs(r)>=s.settings.swipeThreshold?(r<0?o.goToNextSlide():o.goToPrevSlide(),o.stopAuto()):S(n,"reset",200)),s.viewport.unbind("touchend MSPointerUp pointerup",R),s.viewport.get(0).releasePointerCapture&&s.viewport.get(0).releasePointerCapture(s.pointerId)},Z=function(e){if(s.initialized)if(s.working)window.setTimeout(Z,10);else{var i=t(window).width(),n=t(window).height();r===i&&a===n||(r=i,a=n,o.redrawSlider(),s.settings.onSliderResize.call(o,s.active.index))}},B=function(t){var e=v();s.settings.ariaHidden&&!s.settings.ticker&&(s.children.attr("aria-hidden","true"),s.children.slice(t,t+e).attr("aria-hidden","false"))},U=function(t){return t<0?s.settings.infiniteLoop?f()-1:s.active.index:t>=f()?s.settings.infiniteLoop?0:s.active.index:t};return o.goToSlide=function(e,i){var n,r,a,l,d=!0,c=0,g={left:0,top:0},u=null;if(s.oldIndex=s.active.index,s.active.index=U(e),!s.working&&s.active.index!==s.oldIndex){if(s.working=!0,d=s.settings.onSlideBefore.call(o,s.children.eq(s.active.index),s.oldIndex,s.active.index),"undefined"!=typeof d&&!d)return s.active.index=s.oldIndex,void(s.working=!1);"next"===i?s.settings.onSlideNext.call(o,s.children.eq(s.active.index),s.oldIndex,s.active.index)||(d=!1):"prev"===i&&(s.settings.onSlidePrev.call(o,s.children.eq(s.active.index),s.oldIndex,s.active.index)||(d=!1)),s.active.last=s.active.index>=f()-1,(s.settings.pager||s.settings.pagerCustom)&&I(s.active.index),s.settings.controls&&D(),"fade"===s.settings.mode?(s.settings.adaptiveHeight&&s.viewport.height()!==p()&&s.viewport.animate({height:p()},s.settings.adaptiveHeightSpeed),s.children.filter(":visible").fadeOut(s.settings.speed).css({zIndex:0}),s.children.eq(s.active.index).css("zIndex",s.settings.slideZIndex+1).fadeIn(s.settings.speed,function(){t(this).css("zIndex",s.settings.slideZIndex),q()})):(s.settings.adaptiveHeight&&s.viewport.height()!==p()&&s.viewport.animate({height:p()},s.settings.adaptiveHeightSpeed),!s.settings.infiniteLoop&&s.carousel&&s.active.last?"horizontal"===s.settings.mode?(u=s.children.eq(s.children.length-1),g=u.position(),c=s.viewport.width()-u.outerWidth()):(n=s.children.length-s.settings.minSlides,g=s.children.eq(n).position()):s.carousel&&s.active.last&&"prev"===i?(r=1===s.settings.moveSlides?s.settings.maxSlides-x():(f()-1)*x()-(s.children.length-s.settings.maxSlides),u=o.children(".bx-clone").eq(r),g=u.position()):"next"===i&&0===s.active.index?(g=o.find("> .bx-clone").eq(s.settings.maxSlides).position(),s.active.last=!1):e>=0&&(l=e*parseInt(x()),g=s.children.eq(l).position()),"undefined"!=typeof g?(a="horizontal"===s.settings.mode?-(g.left-c):-g.top,S(a,"slide",s.settings.speed)):s.working=!1),s.settings.ariaHidden&&B(s.active.index*x())}},o.goToNextSlide=function(){if(s.settings.infiniteLoop||!s.active.last){var t=parseInt(s.active.index)+1;o.goToSlide(t,"next")}},o.goToPrevSlide=function(){if(s.settings.infiniteLoop||0!==s.active.index){var t=parseInt(s.active.index)-1;o.goToSlide(t,"prev")}},o.startAuto=function(t){s.interval||(s.interval=setInterval(function(){"next"===s.settings.autoDirection?o.goToNextSlide():o.goToPrevSlide()},s.settings.pause),s.settings.autoControls&&t!==!0&&A("stop"))},o.stopAuto=function(t){s.interval&&(clearInterval(s.interval),s.interval=null,s.settings.autoControls&&t!==!0&&A("start"))},o.getCurrentSlide=function(){return s.active.index},o.getCurrentSlideElement=function(){return s.children.eq(s.active.index)},o.getSlideElement=function(t){return s.children.eq(t)},o.getSlideCount=function(){return s.children.length},o.isWorking=function(){return s.working},o.redrawSlider=function(){s.children.add(o.find(".bx-clone")).outerWidth(h()),s.viewport.css("height",p()),s.settings.ticker||m(),s.active.last&&(s.active.index=f()-1),s.active.index>=f()&&(s.active.last=!0),s.settings.pager&&!s.settings.pagerCustom&&(b(),I(s.active.index)),s.settings.ariaHidden&&B(s.active.index*x())},o.destroySlider=function(){s.initialized&&(s.initialized=!1,t(".bx-clone",this).remove(),s.children.each(function(){void 0!==t(this).data("origStyle")?t(this).attr("style",t(this).data("origStyle")):t(this).removeAttr("style")}),void 0!==t(this).data("origStyle")?this.attr("style",t(this).data("origStyle")):t(this).removeAttr("style"),t(this).unwrap().unwrap(),s.controls.el&&s.controls.el.remove(),s.controls.next&&s.controls.next.remove(),s.controls.prev&&s.controls.prev.remove(),s.pagerEl&&s.settings.controls&&!s.settings.pagerCustom&&s.pagerEl.remove(),t(".bx-caption",this).remove(),s.controls.autoEl&&s.controls.autoEl.remove(),clearInterval(s.interval),s.settings.responsive&&t(window).unbind("resize",Z),s.settings.keyboardEnabled&&t(document).unbind("keydown",F),t(this).removeData("bxSlider"))},o.reloadSlider=function(e){void 0!==e&&(n=e),o.destroySlider(),l(),t(o).data("bxSlider",this)},l(),t(o).data("bxSlider",this),this}}}(jQuery);
|
assets_libraries/bxslider/vendor/jquery.easing.1.3.js
ADDED
@@ -0,0 +1,205 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
|
3 |
+
*
|
4 |
+
* Uses the built in easing capabilities added In jQuery 1.1
|
5 |
+
* to offer multiple easing options
|
6 |
+
*
|
7 |
+
* TERMS OF USE - jQuery Easing
|
8 |
+
*
|
9 |
+
* Open source under the BSD License.
|
10 |
+
*
|
11 |
+
* Copyright © 2008 George McGinley Smith
|
12 |
+
* All rights reserved.
|
13 |
+
*
|
14 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
15 |
+
* are permitted provided that the following conditions are met:
|
16 |
+
*
|
17 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
18 |
+
* conditions and the following disclaimer.
|
19 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
20 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
21 |
+
* provided with the distribution.
|
22 |
+
*
|
23 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
24 |
+
* or promote products derived from this software without specific prior written permission.
|
25 |
+
*
|
26 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
27 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
28 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
29 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
30 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
31 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
32 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
33 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
34 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
35 |
+
*
|
36 |
+
*/
|
37 |
+
|
38 |
+
// t: current time, b: begInnIng value, c: change In value, d: duration
|
39 |
+
jQuery.easing['jswing'] = jQuery.easing['swing'];
|
40 |
+
|
41 |
+
jQuery.extend( jQuery.easing,
|
42 |
+
{
|
43 |
+
def: 'easeOutQuad',
|
44 |
+
swing: function (x, t, b, c, d) {
|
45 |
+
//alert(jQuery.easing.default);
|
46 |
+
return jQuery.easing[jQuery.easing.def](x, t, b, c, d);
|
47 |
+
},
|
48 |
+
easeInQuad: function (x, t, b, c, d) {
|
49 |
+
return c*(t/=d)*t + b;
|
50 |
+
},
|
51 |
+
easeOutQuad: function (x, t, b, c, d) {
|
52 |
+
return -c *(t/=d)*(t-2) + b;
|
53 |
+
},
|
54 |
+
easeInOutQuad: function (x, t, b, c, d) {
|
55 |
+
if ((t/=d/2) < 1) return c/2*t*t + b;
|
56 |
+
return -c/2 * ((--t)*(t-2) - 1) + b;
|
57 |
+
},
|
58 |
+
easeInCubic: function (x, t, b, c, d) {
|
59 |
+
return c*(t/=d)*t*t + b;
|
60 |
+
},
|
61 |
+
easeOutCubic: function (x, t, b, c, d) {
|
62 |
+
return c*((t=t/d-1)*t*t + 1) + b;
|
63 |
+
},
|
64 |
+
easeInOutCubic: function (x, t, b, c, d) {
|
65 |
+
if ((t/=d/2) < 1) return c/2*t*t*t + b;
|
66 |
+
return c/2*((t-=2)*t*t + 2) + b;
|
67 |
+
},
|
68 |
+
easeInQuart: function (x, t, b, c, d) {
|
69 |
+
return c*(t/=d)*t*t*t + b;
|
70 |
+
},
|
71 |
+
easeOutQuart: function (x, t, b, c, d) {
|
72 |
+
return -c * ((t=t/d-1)*t*t*t - 1) + b;
|
73 |
+
},
|
74 |
+
easeInOutQuart: function (x, t, b, c, d) {
|
75 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
|
76 |
+
return -c/2 * ((t-=2)*t*t*t - 2) + b;
|
77 |
+
},
|
78 |
+
easeInQuint: function (x, t, b, c, d) {
|
79 |
+
return c*(t/=d)*t*t*t*t + b;
|
80 |
+
},
|
81 |
+
easeOutQuint: function (x, t, b, c, d) {
|
82 |
+
return c*((t=t/d-1)*t*t*t*t + 1) + b;
|
83 |
+
},
|
84 |
+
easeInOutQuint: function (x, t, b, c, d) {
|
85 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
|
86 |
+
return c/2*((t-=2)*t*t*t*t + 2) + b;
|
87 |
+
},
|
88 |
+
easeInSine: function (x, t, b, c, d) {
|
89 |
+
return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
|
90 |
+
},
|
91 |
+
easeOutSine: function (x, t, b, c, d) {
|
92 |
+
return c * Math.sin(t/d * (Math.PI/2)) + b;
|
93 |
+
},
|
94 |
+
easeInOutSine: function (x, t, b, c, d) {
|
95 |
+
return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
|
96 |
+
},
|
97 |
+
easeInExpo: function (x, t, b, c, d) {
|
98 |
+
return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
|
99 |
+
},
|
100 |
+
easeOutExpo: function (x, t, b, c, d) {
|
101 |
+
return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
|
102 |
+
},
|
103 |
+
easeInOutExpo: function (x, t, b, c, d) {
|
104 |
+
if (t==0) return b;
|
105 |
+
if (t==d) return b+c;
|
106 |
+
if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
|
107 |
+
return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
108 |
+
},
|
109 |
+
easeInCirc: function (x, t, b, c, d) {
|
110 |
+
return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
|
111 |
+
},
|
112 |
+
easeOutCirc: function (x, t, b, c, d) {
|
113 |
+
return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
|
114 |
+
},
|
115 |
+
easeInOutCirc: function (x, t, b, c, d) {
|
116 |
+
if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
|
117 |
+
return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
|
118 |
+
},
|
119 |
+
easeInElastic: function (x, t, b, c, d) {
|
120 |
+
var s=1.70158;var p=0;var a=c;
|
121 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
122 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
123 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
124 |
+
return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
125 |
+
},
|
126 |
+
easeOutElastic: function (x, t, b, c, d) {
|
127 |
+
var s=1.70158;var p=0;var a=c;
|
128 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
129 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
130 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
131 |
+
return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
|
132 |
+
},
|
133 |
+
easeInOutElastic: function (x, t, b, c, d) {
|
134 |
+
var s=1.70158;var p=0;var a=c;
|
135 |
+
if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
|
136 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
137 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
138 |
+
if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
139 |
+
return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
|
140 |
+
},
|
141 |
+
easeInBack: function (x, t, b, c, d, s) {
|
142 |
+
if (s == undefined) s = 1.70158;
|
143 |
+
return c*(t/=d)*t*((s+1)*t - s) + b;
|
144 |
+
},
|
145 |
+
easeOutBack: function (x, t, b, c, d, s) {
|
146 |
+
if (s == undefined) s = 1.70158;
|
147 |
+
return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
|
148 |
+
},
|
149 |
+
easeInOutBack: function (x, t, b, c, d, s) {
|
150 |
+
if (s == undefined) s = 1.70158;
|
151 |
+
if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
|
152 |
+
return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
|
153 |
+
},
|
154 |
+
easeInBounce: function (x, t, b, c, d) {
|
155 |
+
return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b;
|
156 |
+
},
|
157 |
+
easeOutBounce: function (x, t, b, c, d) {
|
158 |
+
if ((t/=d) < (1/2.75)) {
|
159 |
+
return c*(7.5625*t*t) + b;
|
160 |
+
} else if (t < (2/2.75)) {
|
161 |
+
return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
|
162 |
+
} else if (t < (2.5/2.75)) {
|
163 |
+
return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
|
164 |
+
} else {
|
165 |
+
return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
|
166 |
+
}
|
167 |
+
},
|
168 |
+
easeInOutBounce: function (x, t, b, c, d) {
|
169 |
+
if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
|
170 |
+
return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
|
171 |
+
}
|
172 |
+
});
|
173 |
+
|
174 |
+
/*
|
175 |
+
*
|
176 |
+
* TERMS OF USE - EASING EQUATIONS
|
177 |
+
*
|
178 |
+
* Open source under the BSD License.
|
179 |
+
*
|
180 |
+
* Copyright © 2001 Robert Penner
|
181 |
+
* All rights reserved.
|
182 |
+
*
|
183 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
184 |
+
* are permitted provided that the following conditions are met:
|
185 |
+
*
|
186 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
187 |
+
* conditions and the following disclaimer.
|
188 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
189 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
190 |
+
* provided with the distribution.
|
191 |
+
*
|
192 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
193 |
+
* or promote products derived from this software without specific prior written permission.
|
194 |
+
*
|
195 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
196 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
197 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
198 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
199 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
200 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
201 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
202 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
203 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
204 |
+
*
|
205 |
+
*/
|
assets_libraries/bxslider/vendor/jquery.fitvids.js
ADDED
@@ -0,0 +1,80 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*global jQuery */
|
2 |
+
/*jshint multistr:true browser:true */
|
3 |
+
/*!
|
4 |
+
* FitVids 1.0
|
5 |
+
*
|
6 |
+
* Copyright 2011, Chris Coyier - http://css-tricks.com + Dave Rupert - http://daverupert.com
|
7 |
+
* Credit to Thierry Koblentz - http://www.alistapart.com/articles/creating-intrinsic-ratios-for-video/
|
8 |
+
* Released under the WTFPL license - http://sam.zoy.org/wtfpl/
|
9 |
+
*
|
10 |
+
* Date: Thu Sept 01 18:00:00 2011 -0500
|
11 |
+
*/
|
12 |
+
|
13 |
+
(function( $ ){
|
14 |
+
|
15 |
+
"use strict";
|
16 |
+
|
17 |
+
$.fn.fitVids = function( options ) {
|
18 |
+
var settings = {
|
19 |
+
customSelector: null
|
20 |
+
};
|
21 |
+
|
22 |
+
var div = document.createElement('div'),
|
23 |
+
ref = document.getElementsByTagName('base')[0] || document.getElementsByTagName('script')[0];
|
24 |
+
|
25 |
+
div.className = 'fit-vids-style';
|
26 |
+
div.innerHTML = '­<style> \
|
27 |
+
.fluid-width-video-wrapper { \
|
28 |
+
width: 100%; \
|
29 |
+
position: relative; \
|
30 |
+
padding: 0; \
|
31 |
+
} \
|
32 |
+
\
|
33 |
+
.fluid-width-video-wrapper iframe, \
|
34 |
+
.fluid-width-video-wrapper object, \
|
35 |
+
.fluid-width-video-wrapper embed { \
|
36 |
+
position: absolute; \
|
37 |
+
top: 0; \
|
38 |
+
left: 0; \
|
39 |
+
width: 100%; \
|
40 |
+
height: 100%; \
|
41 |
+
} \
|
42 |
+
</style>';
|
43 |
+
|
44 |
+
ref.parentNode.insertBefore(div,ref);
|
45 |
+
|
46 |
+
if ( options ) {
|
47 |
+
$.extend( settings, options );
|
48 |
+
}
|
49 |
+
|
50 |
+
return this.each(function(){
|
51 |
+
var selectors = [
|
52 |
+
"iframe[src*='player.vimeo.com']",
|
53 |
+
"iframe[src*='www.youtube.com']",
|
54 |
+
"iframe[src*='www.kickstarter.com']",
|
55 |
+
"object",
|
56 |
+
"embed"
|
57 |
+
];
|
58 |
+
|
59 |
+
if (settings.customSelector) {
|
60 |
+
selectors.push(settings.customSelector);
|
61 |
+
}
|
62 |
+
|
63 |
+
var $allVideos = $(this).find(selectors.join(','));
|
64 |
+
|
65 |
+
$allVideos.each(function(){
|
66 |
+
var $this = $(this);
|
67 |
+
if (this.tagName.toLowerCase() === 'embed' && $this.parent('object').length || $this.parent('.fluid-width-video-wrapper').length) { return; }
|
68 |
+
var height = ( this.tagName.toLowerCase() === 'object' || ($this.attr('height') && !isNaN(parseInt($this.attr('height'), 10))) ) ? parseInt($this.attr('height'), 10) : $this.height(),
|
69 |
+
width = !isNaN(parseInt($this.attr('width'), 10)) ? parseInt($this.attr('width'), 10) : $this.width(),
|
70 |
+
aspectRatio = height / width;
|
71 |
+
if(!$this.attr('id')){
|
72 |
+
var videoID = 'fitvid' + Math.floor(Math.random()*999999);
|
73 |
+
$this.attr('id', videoID);
|
74 |
+
}
|
75 |
+
$this.wrap('<div class="fluid-width-video-wrapper"></div>').parent('.fluid-width-video-wrapper').css('padding-top', (aspectRatio * 100)+"%");
|
76 |
+
$this.removeAttr('height').removeAttr('width');
|
77 |
+
});
|
78 |
+
});
|
79 |
+
};
|
80 |
+
})( jQuery );
|
assets_libraries/countdown/jquery.countdown.js
ADDED
@@ -0,0 +1,246 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* The Final Countdown for jQuery v2.2.0 (http://hilios.github.io/jQuery.countdown/)
|
3 |
+
* Copyright (c) 2016 Edson Hilios
|
4 |
+
*
|
5 |
+
* Permission is hereby granted, free of charge, to any person obtaining a copy of
|
6 |
+
* this software and associated documentation files (the "Software"), to deal in
|
7 |
+
* the Software without restriction, including without limitation the rights to
|
8 |
+
* use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
|
9 |
+
* the Software, and to permit persons to whom the Software is furnished to do so,
|
10 |
+
* subject to the following conditions:
|
11 |
+
*
|
12 |
+
* The above copyright notice and this permission notice shall be included in all
|
13 |
+
* copies or substantial portions of the Software.
|
14 |
+
*
|
15 |
+
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
16 |
+
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
|
17 |
+
* FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
|
18 |
+
* COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
|
19 |
+
* IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
|
20 |
+
* CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
|
21 |
+
*/
|
22 |
+
(function(factory) {
|
23 |
+
"use strict";
|
24 |
+
if (typeof define === "function" && define.amd) {
|
25 |
+
define([ "jquery" ], factory);
|
26 |
+
} else {
|
27 |
+
factory(jQuery);
|
28 |
+
}
|
29 |
+
})(function($) {
|
30 |
+
"use strict";
|
31 |
+
var instances = [], matchers = [], defaultOptions = {
|
32 |
+
precision: 100,
|
33 |
+
elapse: false,
|
34 |
+
defer: false
|
35 |
+
};
|
36 |
+
matchers.push(/^[0-9]*$/.source);
|
37 |
+
matchers.push(/([0-9]{1,2}\/){2}[0-9]{4}( [0-9]{1,2}(:[0-9]{2}){2})?/.source);
|
38 |
+
matchers.push(/[0-9]{4}([\/\-][0-9]{1,2}){2}( [0-9]{1,2}(:[0-9]{2}){2})?/.source);
|
39 |
+
matchers = new RegExp(matchers.join("|"));
|
40 |
+
function parseDateString(dateString) {
|
41 |
+
if (dateString instanceof Date) {
|
42 |
+
return dateString;
|
43 |
+
}
|
44 |
+
if (String(dateString).match(matchers)) {
|
45 |
+
if (String(dateString).match(/^[0-9]*$/)) {
|
46 |
+
dateString = Number(dateString);
|
47 |
+
}
|
48 |
+
if (String(dateString).match(/\-/)) {
|
49 |
+
dateString = String(dateString).replace(/\-/g, "/");
|
50 |
+
}
|
51 |
+
return new Date(dateString);
|
52 |
+
} else {
|
53 |
+
throw new Error("Couldn't cast `" + dateString + "` to a date object.");
|
54 |
+
}
|
55 |
+
}
|
56 |
+
var DIRECTIVE_KEY_MAP = {
|
57 |
+
Y: "years",
|
58 |
+
m: "months",
|
59 |
+
n: "daysToMonth",
|
60 |
+
d: "daysToWeek",
|
61 |
+
w: "weeks",
|
62 |
+
W: "weeksToMonth",
|
63 |
+
H: "hours",
|
64 |
+
M: "minutes",
|
65 |
+
S: "seconds",
|
66 |
+
D: "totalDays",
|
67 |
+
I: "totalHours",
|
68 |
+
N: "totalMinutes",
|
69 |
+
T: "totalSeconds"
|
70 |
+
};
|
71 |
+
function escapedRegExp(str) {
|
72 |
+
var sanitize = str.toString().replace(/([.?*+^$[\]\\(){}|-])/g, "\\$1");
|
73 |
+
return new RegExp(sanitize);
|
74 |
+
}
|
75 |
+
function strftime(offsetObject) {
|
76 |
+
return function(format) {
|
77 |
+
var directives = format.match(/%(-|!)?[A-Z]{1}(:[^;]+;)?/gi);
|
78 |
+
if (directives) {
|
79 |
+
for (var i = 0, len = directives.length; i < len; ++i) {
|
80 |
+
var directive = directives[i].match(/%(-|!)?([a-zA-Z]{1})(:[^;]+;)?/), regexp = escapedRegExp(directive[0]), modifier = directive[1] || "", plural = directive[3] || "", value = null;
|
81 |
+
directive = directive[2];
|
82 |
+
if (DIRECTIVE_KEY_MAP.hasOwnProperty(directive)) {
|
83 |
+
value = DIRECTIVE_KEY_MAP[directive];
|
84 |
+
value = Number(offsetObject[value]);
|
85 |
+
}
|
86 |
+
if (value !== null) {
|
87 |
+
if (modifier === "!") {
|
88 |
+
value = pluralize(plural, value);
|
89 |
+
}
|
90 |
+
if (modifier === "") {
|
91 |
+
if (value < 10) {
|
92 |
+
value = "0" + value.toString();
|
93 |
+
}
|
94 |
+
}
|
95 |
+
format = format.replace(regexp, value.toString());
|
96 |
+
}
|
97 |
+
}
|
98 |
+
}
|
99 |
+
format = format.replace(/%%/, "%");
|
100 |
+
return format;
|
101 |
+
};
|
102 |
+
}
|
103 |
+
function pluralize(format, count) {
|
104 |
+
var plural = "s", singular = "";
|
105 |
+
if (format) {
|
106 |
+
format = format.replace(/(:|;|\s)/gi, "").split(/\,/);
|
107 |
+
if (format.length === 1) {
|
108 |
+
plural = format[0];
|
109 |
+
} else {
|
110 |
+
singular = format[0];
|
111 |
+
plural = format[1];
|
112 |
+
}
|
113 |
+
}
|
114 |
+
if (Math.abs(count) > 1) {
|
115 |
+
return plural;
|
116 |
+
} else {
|
117 |
+
return singular;
|
118 |
+
}
|
119 |
+
}
|
120 |
+
var Countdown = function(el, finalDate, options) {
|
121 |
+
this.el = el;
|
122 |
+
this.$el = $(el);
|
123 |
+
this.interval = null;
|
124 |
+
this.offset = {};
|
125 |
+
this.options = $.extend({}, defaultOptions);
|
126 |
+
this.instanceNumber = instances.length;
|
127 |
+
instances.push(this);
|
128 |
+
this.$el.data("countdown-instance", this.instanceNumber);
|
129 |
+
if (options) {
|
130 |
+
if (typeof options === "function") {
|
131 |
+
this.$el.on("update.countdown", options);
|
132 |
+
this.$el.on("stoped.countdown", options);
|
133 |
+
this.$el.on("finish.countdown", options);
|
134 |
+
} else {
|
135 |
+
this.options = $.extend({}, defaultOptions, options);
|
136 |
+
}
|
137 |
+
}
|
138 |
+
this.setFinalDate(finalDate);
|
139 |
+
if (this.options.defer === false) {
|
140 |
+
this.start();
|
141 |
+
}
|
142 |
+
};
|
143 |
+
$.extend(Countdown.prototype, {
|
144 |
+
start: function() {
|
145 |
+
if (this.interval !== null) {
|
146 |
+
clearInterval(this.interval);
|
147 |
+
}
|
148 |
+
var self = this;
|
149 |
+
this.update();
|
150 |
+
this.interval = setInterval(function() {
|
151 |
+
self.update.call(self);
|
152 |
+
}, this.options.precision);
|
153 |
+
},
|
154 |
+
stop: function() {
|
155 |
+
clearInterval(this.interval);
|
156 |
+
this.interval = null;
|
157 |
+
this.dispatchEvent("stoped");
|
158 |
+
},
|
159 |
+
toggle: function() {
|
160 |
+
if (this.interval) {
|
161 |
+
this.stop();
|
162 |
+
} else {
|
163 |
+
this.start();
|
164 |
+
}
|
165 |
+
},
|
166 |
+
pause: function() {
|
167 |
+
this.stop();
|
168 |
+
},
|
169 |
+
resume: function() {
|
170 |
+
this.start();
|
171 |
+
},
|
172 |
+
remove: function() {
|
173 |
+
this.stop.call(this);
|
174 |
+
instances[this.instanceNumber] = null;
|
175 |
+
delete this.$el.data().countdownInstance;
|
176 |
+
},
|
177 |
+
setFinalDate: function(value) {
|
178 |
+
this.finalDate = parseDateString(value);
|
179 |
+
},
|
180 |
+
update: function() {
|
181 |
+
if (this.$el.closest("html").length === 0) {
|
182 |
+
this.remove();
|
183 |
+
return;
|
184 |
+
}
|
185 |
+
var hasEventsAttached = $._data(this.el, "events") !== undefined, now = new Date(), newTotalSecsLeft;
|
186 |
+
newTotalSecsLeft = this.finalDate.getTime() - now.getTime();
|
187 |
+
newTotalSecsLeft = Math.ceil(newTotalSecsLeft / 1e3);
|
188 |
+
newTotalSecsLeft = !this.options.elapse && newTotalSecsLeft < 0 ? 0 : Math.abs(newTotalSecsLeft);
|
189 |
+
if (this.totalSecsLeft === newTotalSecsLeft || !hasEventsAttached) {
|
190 |
+
return;
|
191 |
+
} else {
|
192 |
+
this.totalSecsLeft = newTotalSecsLeft;
|
193 |
+
}
|
194 |
+
this.elapsed = now >= this.finalDate;
|
195 |
+
this.offset = {
|
196 |
+
seconds: this.totalSecsLeft % 60,
|
197 |
+
minutes: Math.floor(this.totalSecsLeft / 60) % 60,
|
198 |
+
hours: Math.floor(this.totalSecsLeft / 60 / 60) % 24,
|
199 |
+
days: Math.floor(this.totalSecsLeft / 60 / 60 / 24) % 7,
|
200 |
+
daysToWeek: Math.floor(this.totalSecsLeft / 60 / 60 / 24) % 7,
|
201 |
+
daysToMonth: Math.floor(this.totalSecsLeft / 60 / 60 / 24 % 30.4368),
|
202 |
+
weeks: Math.floor(this.totalSecsLeft / 60 / 60 / 24 / 7),
|
203 |
+
weeksToMonth: Math.floor(this.totalSecsLeft / 60 / 60 / 24 / 7) % 4,
|
204 |
+
months: Math.floor(this.totalSecsLeft / 60 / 60 / 24 / 30.4368),
|
205 |
+
years: Math.abs(this.finalDate.getFullYear() - now.getFullYear()),
|
206 |
+
totalDays: Math.floor(this.totalSecsLeft / 60 / 60 / 24),
|
207 |
+
totalHours: Math.floor(this.totalSecsLeft / 60 / 60),
|
208 |
+
totalMinutes: Math.floor(this.totalSecsLeft / 60),
|
209 |
+
totalSeconds: this.totalSecsLeft
|
210 |
+
};
|
211 |
+
if (!this.options.elapse && this.totalSecsLeft === 0) {
|
212 |
+
this.stop();
|
213 |
+
this.dispatchEvent("finish");
|
214 |
+
} else {
|
215 |
+
this.dispatchEvent("update");
|
216 |
+
}
|
217 |
+
},
|
218 |
+
dispatchEvent: function(eventName) {
|
219 |
+
var event = $.Event(eventName + ".countdown");
|
220 |
+
event.finalDate = this.finalDate;
|
221 |
+
event.elapsed = this.elapsed;
|
222 |
+
event.offset = $.extend({}, this.offset);
|
223 |
+
event.strftime = strftime(this.offset);
|
224 |
+
this.$el.trigger(event);
|
225 |
+
}
|
226 |
+
});
|
227 |
+
$.fn.countdownUC = function() {
|
228 |
+
var argumentsArray = Array.prototype.slice.call(arguments, 0);
|
229 |
+
return this.each(function() {
|
230 |
+
var instanceNumber = $(this).data("countdown-instance");
|
231 |
+
if (instanceNumber !== undefined) {
|
232 |
+
var instance = instances[instanceNumber], method = argumentsArray[0];
|
233 |
+
if (Countdown.prototype.hasOwnProperty(method)) {
|
234 |
+
instance[method].apply(instance, argumentsArray.slice(1));
|
235 |
+
} else if (String(method).match(/^[$A-Z_][0-9A-Z_$]*$/i) === null) {
|
236 |
+
instance.setFinalDate.call(instance, method);
|
237 |
+
instance.start();
|
238 |
+
} else {
|
239 |
+
$.error("Method %s does not exist on jQuery.countdown".replace(/\%s/gi, method));
|
240 |
+
}
|
241 |
+
} else {
|
242 |
+
new Countdown(this, argumentsArray[0], argumentsArray[1]);
|
243 |
+
}
|
244 |
+
});
|
245 |
+
};
|
246 |
+
});
|
assets_libraries/fancybox3/jquery.fancybox.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
@charset "UTF-8";body.fancybox-active{overflow:hidden}body.fancybox-iosfix{position:fixed;left:0;right:0}.fancybox-is-hidden{position:absolute;top:-9999px;left:-9999px;visibility:hidden}.fancybox-container{position:fixed;top:0;left:0;width:100%;height:100%;z-index:99992;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateZ(0);transform:translateZ(0);font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,sans-serif}.fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-stage{position:absolute;top:0;right:0;bottom:0;left:0}.fancybox-outer{overflow-y:auto;-webkit-overflow-scrolling:touch}.fancybox-bg{background:#1e1e1e;opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71)}.fancybox-is-open .fancybox-bg{opacity:.87;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-caption-wrap,.fancybox-infobar,.fancybox-toolbar{position:absolute;direction:ltr;z-index:99997;opacity:0;visibility:hidden;transition:opacity .25s,visibility 0s linear .25s;box-sizing:border-box}.fancybox-show-caption .fancybox-caption-wrap,.fancybox-show-infobar .fancybox-infobar,.fancybox-show-toolbar .fancybox-toolbar{opacity:1;visibility:visible;transition:opacity .25s,visibility 0s}.fancybox-infobar{top:0;left:0;font-size:13px;padding:0 10px;height:44px;min-width:44px;line-height:44px;color:#ccc;text-align:center;pointer-events:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-touch-callout:none;-webkit-tap-highlight-color:transparent;-webkit-font-smoothing:subpixel-antialiased;mix-blend-mode:exclusion}.fancybox-toolbar{top:0;right:0;margin:0;padding:0}.fancybox-stage{overflow:hidden;direction:ltr;z-index:99994;-webkit-transform:translateZ(0)}.fancybox-is-closing .fancybox-stage{overflow:visible}.fancybox-slide{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;overflow:auto;outline:none;white-space:normal;box-sizing:border-box;text-align:center;z-index:99994;-webkit-overflow-scrolling:touch;display:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform}.fancybox-slide:before{content:"";display:inline-block;vertical-align:middle;height:100%;width:0}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--current,.fancybox-slide--next,.fancybox-slide--previous{display:block}.fancybox-slide--image{overflow:visible}.fancybox-slide--image:before{display:none}.fancybox-slide--video .fancybox-content,.fancybox-slide--video iframe{background:#000}.fancybox-slide--map .fancybox-content,.fancybox-slide--map iframe{background:#e5e3df}.fancybox-slide--next{z-index:99995}.fancybox-slide>*{display:inline-block;position:relative;padding:24px;margin:44px 0;border-width:0;vertical-align:middle;text-align:left;background-color:#fff;overflow:auto;box-sizing:border-box}.fancybox-slide>base,.fancybox-slide>link,.fancybox-slide>meta,.fancybox-slide>script,.fancybox-slide>style,.fancybox-slide>title{display:none}.fancybox-slide .fancybox-image-wrap{position:absolute;top:0;left:0;margin:0;padding:0;border:0;z-index:99995;background:transparent;cursor:default;overflow:visible;-webkit-transform-origin:top left;transform-origin:top left;background-size:100% 100%;background-repeat:no-repeat;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform}.fancybox-can-zoomOut .fancybox-image-wrap{cursor:zoom-out}.fancybox-can-zoomIn .fancybox-image-wrap{cursor:zoom-in}.fancybox-can-drag .fancybox-image-wrap{cursor:-webkit-grab;cursor:grab}.fancybox-is-dragging .fancybox-image-wrap{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-image,.fancybox-spaceball{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;border:0;max-width:none;max-height:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-spaceball{z-index:1}.fancybox-slide--iframe .fancybox-content{padding:0;width:80%;height:80%;max-width:calc(100% - 100px);max-height:calc(100% - 88px);overflow:visible;background:#fff}.fancybox-iframe{display:block;padding:0;border:0;height:100%}.fancybox-error,.fancybox-iframe{margin:0;width:100%;background:#fff}.fancybox-error{padding:40px;max-width:380px;cursor:default}.fancybox-error p{margin:0;padding:0;color:#444;font-size:16px;line-height:20px}.fancybox-button{box-sizing:border-box;display:inline-block;vertical-align:top;width:44px;height:44px;margin:0;padding:10px;border:0;border-radius:0;background:rgba(30,30,30,.6);transition:color .3s ease;cursor:pointer;outline:none}.fancybox-button,.fancybox-button:link,.fancybox-button:visited{color:#ccc}.fancybox-button:focus,.fancybox-button:hover{color:#fff}.fancybox-button[disabled]{color:#ccc;cursor:default;opacity:.6}.fancybox-button svg{display:block;position:relative;overflow:visible;shape-rendering:geometricPrecision}.fancybox-button svg path{fill:currentColor;stroke:currentColor;stroke-linejoin:round;stroke-width:3}.fancybox-button--share svg path{stroke-width:1}.fancybox-button--pause svg path:nth-child(1),.fancybox-button--play svg path:nth-child(2){display:none}.fancybox-button--zoom svg path{fill:transparent}.fancybox-navigation{display:none}.fancybox-show-nav .fancybox-navigation{display:block}.fancybox-navigation button{position:absolute;top:50%;margin:-50px 0 0;z-index:99997;background:transparent;width:60px;height:100px;padding:17px}.fancybox-navigation button:before{content:"";position:absolute;top:30px;right:10px;width:40px;height:40px;background:rgba(30,30,30,.6)}.fancybox-navigation .fancybox-button--arrow_left{left:0}.fancybox-navigation .fancybox-button--arrow_right{right:0}.fancybox-close-small{position:absolute;top:0;right:0;width:40px;height:40px;padding:0;margin:0;border:0;border-radius:0;background:transparent;z-index:10;cursor:pointer}.fancybox-close-small:after{content:"×";position:absolute;top:5px;right:5px;width:30px;height:30px;font:22px/30px Arial,Helvetica Neue,Helvetica,sans-serif;color:#888;font-weight:300;text-align:center;border-radius:50%;border-width:0;background-color:transparent;transition:background-color .25s;box-sizing:border-box;z-index:2}.fancybox-close-small:focus{outline:none}.fancybox-close-small:focus:after{outline:1px dotted #888}.fancybox-close-small:hover:after{color:#555;background:#eee}.fancybox-slide--iframe .fancybox-close-small,.fancybox-slide--image .fancybox-close-small{top:0;right:-40px}.fancybox-slide--iframe .fancybox-close-small:after,.fancybox-slide--image .fancybox-close-small:after{font-size:35px;color:#aaa}.fancybox-slide--iframe .fancybox-close-small:hover:after,.fancybox-slide--image .fancybox-close-small:hover:after{color:#fff;background:transparent}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-drag .fancybox-close-small{display:none}.fancybox-caption-wrap{bottom:0;left:0;right:0;padding:60px 2vw 0;background:linear-gradient(180deg,transparent 0,rgba(0,0,0,.1) 20%,rgba(0,0,0,.2) 40%,rgba(0,0,0,.6) 80%,rgba(0,0,0,.8));pointer-events:none}.fancybox-caption{padding:30px 0;border-top:1px solid hsla(0,0%,100%,.4);font-size:14px;color:#fff;line-height:20px;-webkit-text-size-adjust:none}.fancybox-caption a,.fancybox-caption button,.fancybox-caption select{pointer-events:all;position:relative}.fancybox-caption a{color:#fff;text-decoration:underline}.fancybox-slide>.fancybox-loading{border:6px solid hsla(0,0%,39%,.4);border-top:6px solid hsla(0,0%,100%,.6);border-radius:100%;height:50px;width:50px;-webkit-animation:a .8s infinite linear;animation:a .8s infinite linear;background:transparent;position:absolute;top:50%;left:50%;margin-top:-30px;margin-left:-30px;z-index:99999}@-webkit-keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1)}.fancybox-fx-slide.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0);opacity:0}.fancybox-fx-slide.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0);opacity:0}.fancybox-fx-slide.fancybox-slide--current{-webkit-transform:translateZ(0);transform:translateZ(0);opacity:1}.fancybox-fx-fade.fancybox-slide--next,.fancybox-fx-fade.fancybox-slide--previous{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1)}.fancybox-fx-fade.fancybox-slide--current{opacity:1}.fancybox-fx-zoom-in-out.fancybox-slide--previous{-webkit-transform:scale3d(1.5,1.5,1.5);transform:scale3d(1.5,1.5,1.5);opacity:0}.fancybox-fx-zoom-in-out.fancybox-slide--next{-webkit-transform:scale3d(.5,.5,.5);transform:scale3d(.5,.5,.5);opacity:0}.fancybox-fx-zoom-in-out.fancybox-slide--current{-webkit-transform:scaleX(1);transform:scaleX(1);opacity:1}.fancybox-fx-rotate.fancybox-slide--previous{-webkit-transform:rotate(-1turn);transform:rotate(-1turn);opacity:0}.fancybox-fx-rotate.fancybox-slide--next{-webkit-transform:rotate(1turn);transform:rotate(1turn);opacity:0}.fancybox-fx-rotate.fancybox-slide--current{-webkit-transform:rotate(0deg);transform:rotate(0deg);opacity:1}.fancybox-fx-circular.fancybox-slide--previous{-webkit-transform:scale3d(0,0,0) translate3d(-100%,0,0);transform:scale3d(0,0,0) translate3d(-100%,0,0);opacity:0}.fancybox-fx-circular.fancybox-slide--next{-webkit-transform:scale3d(0,0,0) translate3d(100%,0,0);transform:scale3d(0,0,0) translate3d(100%,0,0);opacity:0}.fancybox-fx-circular.fancybox-slide--current{-webkit-transform:scaleX(1) translateZ(0);transform:scaleX(1) translateZ(0);opacity:1}.fancybox-fx-tube.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0) scale(.1) skew(-10deg);transform:translate3d(-100%,0,0) scale(.1) skew(-10deg)}.fancybox-fx-tube.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0) scale(.1) skew(10deg);transform:translate3d(100%,0,0) scale(.1) skew(10deg)}.fancybox-fx-tube.fancybox-slide--current{-webkit-transform:translateZ(0) scale(1);transform:translateZ(0) scale(1)}.fancybox-share{padding:30px;border-radius:3px;background:#f4f4f4;max-width:90%;text-align:center}.fancybox-share h1{color:#222;margin:0 0 20px;font-size:35px;font-weight:700}.fancybox-share p{margin:0;padding:0}p.fancybox-share__links{margin-right:-10px}.fancybox-share__button{display:inline-block;text-decoration:none;margin:0 10px 10px 0;padding:0 15px;min-width:130px;border:0;border-radius:3px;background:#fff;white-space:nowrap;font-size:14px;font-weight:700;line-height:40px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;color:#fff;transition:all .2s}.fancybox-share__button:hover{text-decoration:none}.fancybox-share__button--fb{background:#3b5998}.fancybox-share__button--fb:hover{background:#344e86}.fancybox-share__button--pt{background:#bd081d}.fancybox-share__button--pt:hover{background:#aa0719}.fancybox-share__button--tw{background:#1da1f2}.fancybox-share__button--tw:hover{background:#0d95e8}.fancybox-share__button svg{position:relative;top:-1px;width:25px;height:25px;margin-right:7px;vertical-align:middle}.fancybox-share__button svg path{fill:#fff}.fancybox-share__input{box-sizing:border-box;width:100%;margin:10px 0 0;padding:10px 15px;background:transparent;color:#5d5b5b;font-size:14px;outline:none;border:0;border-bottom:2px solid #d7d7d7}.fancybox-thumbs{display:none;position:absolute;top:0;bottom:0;right:0;width:212px;margin:0;padding:2px 2px 4px;background:#fff;-webkit-tap-highlight-color:transparent;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;box-sizing:border-box;z-index:99995}.fancybox-thumbs-x{overflow-y:hidden;overflow-x:auto}.fancybox-show-thumbs .fancybox-thumbs{display:block}.fancybox-show-thumbs .fancybox-inner{right:212px}.fancybox-thumbs>ul{list-style:none;position:absolute;position:relative;width:100%;height:100%;margin:0;padding:0;overflow-x:hidden;overflow-y:auto;font-size:0;white-space:nowrap}.fancybox-thumbs-x>ul{overflow:hidden}.fancybox-thumbs-y>ul::-webkit-scrollbar{width:7px}.fancybox-thumbs-y>ul::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3)}.fancybox-thumbs-y>ul::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px}.fancybox-thumbs>ul>li{float:left;overflow:hidden;padding:0;margin:2px;width:100px;height:75px;max-width:calc(50% - 4px);max-height:calc(100% - 8px);position:relative;cursor:pointer;outline:none;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box}li.fancybox-thumbs-loading{background:rgba(0,0,0,.1)}.fancybox-thumbs>ul>li>img{position:absolute;top:0;left:0;max-width:none;max-height:none;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-thumbs>ul>li:before{content:"";position:absolute;top:0;right:0;bottom:0;left:0;border:4px solid #4ea7f9;z-index:99991;opacity:0;transition:all .2s cubic-bezier(.25,.46,.45,.94)}.fancybox-thumbs>ul>li.fancybox-thumbs-active:before{opacity:1}@media (max-width:800px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs>ul>li{max-width:calc(100% - 10px)}}
|
assets_libraries/fancybox3/jquery.fancybox.min.js
ADDED
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
// ==================================================
|
2 |
+
// fancyBox v3.2.10
|
3 |
+
//
|
4 |
+
// Licensed GPLv3 for open source use
|
5 |
+
// or fancyBox Commercial License for commercial use
|
6 |
+
//
|
7 |
+
// http://fancyapps.com/fancybox/
|
8 |
+
// Copyright 2017 fancyApps
|
9 |
+
//
|
10 |
+
// ==================================================
|
11 |
+
!function(t,e,n,o){"use strict";function i(t){var e=n(t.currentTarget),o=t.data?t.data.options:{},i=e.attr("data-fancybox")||"",a=0,s=[];t.isDefaultPrevented()||(t.preventDefault(),i?(s=o.selector?n(o.selector):t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+i+'"]'):n('[data-fancybox="'+i+'"]'),a=s.index(e),a<0&&(a=0)):s=[e],n.fancybox.open(s,o,a))}if(n){if(n.fn.fancybox)return void("console"in t&&console.log("fancyBox already initialized"));var a={loop:!1,margin:[44,0],gutter:50,keyboard:!0,arrows:!0,infobar:!0,toolbar:!0,buttons:["slideShow","fullScreen","thumbs","share","close"],idleTime:3,smallBtn:"auto",protect:!1,modal:!1,image:{preload:"auto"},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen allowtransparency="true" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},defaultType:"image",animationEffect:"zoom",animationDuration:500,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption-wrap"><div class="fancybox-caption"></div></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}<p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}"><svg viewBox="0 0 40 40"><path d="M20,23 L20,8 L20,23 L13,16 L20,23 L27,16 L20,23 M26,28 L13,28 L27,28 L14,28" /></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg viewBox="0 0 40 40"><path d="M 18,17 m-8,0 a 8,8 0 1,0 16,0 a 8,8 0 1,0 -16,0 M25,23 L31,29 L25,23" /></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg viewBox="0 0 40 40"><path d="M10,10 L30,30 M30,10 L10,30" /></svg></button>',smallBtn:'<button data-fancybox-close class="fancybox-close-small" title="{{CLOSE}}"></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><svg viewBox="0 0 40 40"><path d="M10,20 L30,20 L10,20 L18,28 L10,20 L18,12 L10,20"></path></svg></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><svg viewBox="0 0 40 40"><path d="M30,20 L10,20 L30,20 L22,28 L30,20 L22,12 L30,20"></path></svg></button>'},parentEl:"body",autoFocus:!1,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:4e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{idleTime:!1,margin:0,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schliessen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Maßstab"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},u=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),d=function(){var t,n=e.createElement("fakeelement"),i={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in i)if(n.style[t]!==o)return i[t];return"transitionend"}(),f=function(t){return t&&t.length&&t[0].offsetHeight},p=function(t,o,i){var a=this;a.opts=n.extend(!0,{index:i},n.fancybox.defaults,o||{}),n.fancybox.isMobile&&(a.opts=n.extend(!0,{},a.opts,a.opts.mobile)),o&&n.isArray(o.buttons)&&(a.opts.buttons=o.buttons),a.id=a.opts.id||++c,a.group=[],a.currIndex=parseInt(a.opts.index,10)||0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=null,a.createGroup(t),a.group.length&&(a.$lastFocus=n(e.activeElement).blur(),a.slides={},a.init())};n.extend(p.prototype,{init:function(){var i,a,s,c=this,l=c.group[c.currIndex],u=l.opts,d=n.fancybox.scrollbarWidth;c.scrollTop=r.scrollTop(),c.scrollLeft=r.scrollLeft(),n.fancybox.getInstance()||(n("body").addClass("fancybox-active"),/iPad|iPhone|iPod/.test(navigator.userAgent)&&!t.MSStream?"image"!==l.type&&n("body").css("top",n("body").scrollTop()*-1).addClass("fancybox-iosfix"):!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(d===o&&(i=n('<div style="width:50px;height:50px;overflow:scroll;" />').appendTo("body"),d=n.fancybox.scrollbarWidth=i[0].offsetWidth-i[0].clientWidth,i.remove()),n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar { margin-right: '+d+"px; }</style>"),n("body").addClass("compensate-for-scrollbar"))),s="",n.each(u.buttons,function(t,e){s+=u.btnTpl[e]||""}),a=n(c.translate(c,u.baseTpl.replace("{{buttons}}",s).replace("{{arrows}}",u.btnTpl.arrowLeft+u.btnTpl.arrowRight))).attr("id","fancybox-container-"+c.id).addClass("fancybox-is-hidden").addClass(u.baseClass).data("FancyBox",c).appendTo(u.parentEl),c.$refs={container:a},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){c.$refs[t]=a.find(".fancybox-"+t)}),c.trigger("onInit"),c.activate(),c.jumpTo(c.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang];return e.replace(/\{\{(\w+)\}\}/g,function(t,e){var i=n[e];return i===o?t:i})},createGroup:function(t){var e=this,i=n.makeArray(t);n.each(i,function(t,i){var a,s,r,c,l,u={},d={};n.isPlainObject(i)?(u=i,d=i.opts||i):"object"===n.type(i)&&n(i).length?(a=n(i),d=a.data(),d=n.extend({},d,d.options||{}),d.$orig=a,u.src=d.src||a.attr("href"),u.type||u.src||(u.type="inline",u.src=i)):u={type:"html",src:i+""},u.opts=n.extend(!0,{},e.opts,d),n.isArray(d.buttons)&&(u.opts.buttons=d.buttons),s=u.type||u.opts.type,c=u.src||"",!s&&c&&(c.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?s="image":c.match(/\.(pdf)((\?|#).*)?$/i)?s="pdf":(r=c.match(/\.(mp4|mov|ogv)((\?|#).*)?$/i))?(s="video",u.opts.videoFormat||(u.opts.videoFormat="video/"+("ogv"===r[1]?"ogg":r[1]))):"#"===c.charAt(0)&&(s="inline")),s?u.type=s:e.trigger("objectNeedsType",u),u.index=e.group.length,u.opts.$orig&&!u.opts.$orig.length&&delete u.opts.$orig,!u.opts.$thumb&&u.opts.$orig&&(u.opts.$thumb=u.opts.$orig.find("img:first")),u.opts.$thumb&&!u.opts.$thumb.length&&delete u.opts.$thumb,"function"===n.type(u.opts.caption)&&(u.opts.caption=u.opts.caption.apply(i,[e,u])),"function"===n.type(e.opts.caption)&&(u.opts.caption=e.opts.caption.apply(i,[e,u])),u.opts.caption instanceof n||(u.opts.caption=u.opts.caption===o?"":u.opts.caption+""),"ajax"===s&&(l=c.split(/\s+/,2),l.length>1&&(u.src=l.shift(),u.opts.filter=l.shift())),"auto"==u.opts.smallBtn&&(n.inArray(s,["html","inline","ajax"])>-1?(u.opts.toolbar=!1,u.opts.smallBtn=!0):u.opts.smallBtn=!1),"pdf"===s&&(u.type="iframe",u.opts.iframe.preload=!1),u.opts.modal&&(u.opts=n.extend(!0,u.opts,{infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),e.group.push(u)})},addEvents:function(){var o=this;o.removeEvents(),o.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),o.close(t)}).on("click.fb-prev touchend.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),o.previous()}).on("click.fb-next touchend.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),o.next()}).on("click.fb","[data-fancybox-zoom]",function(t){o[o.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?u(function(){o.update()}):(o.$refs.stage.hide(),setTimeout(function(){o.$refs.stage.show(),o.update()},600))}),r.on("focusin.fb",function(t){var i=n.fancybox?n.fancybox.getInstance():null;i.isClosing||!i.current||!i.current.opts.trapFocus||n(t.target).hasClass("fancybox-container")||n(t.target).is(e)||i&&"fixed"!==n(t.target).css("position")&&!i.$refs.container.has(t.target).length&&(t.stopPropagation(),i.focus(),s.scrollTop(o.scrollTop).scrollLeft(o.scrollLeft))}),r.on("keydown.fb",function(t){var e=o.current,i=t.keyCode||t.which;if(e&&e.opts.keyboard&&!n(t.target).is("input")&&!n(t.target).is("textarea"))return 8===i||27===i?(t.preventDefault(),void o.close(t)):37===i||38===i?(t.preventDefault(),void o.previous()):39===i||40===i?(t.preventDefault(),void o.next()):void o.trigger("afterKeydown",t,i)}),o.group[o.currIndex].opts.idleTime&&(o.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){o.idleSecondsCounter=0,o.isIdle&&o.showControls(),o.isIdle=!1}),o.idleInterval=t.setInterval(function(){o.idleSecondsCounter++,o.idleSecondsCounter>=o.group[o.currIndex].opts.idleTime&&!o.isDragging&&(o.isIdle=!0,o.idleSecondsCounter=0,o.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("focusin.fb keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e,i){var a,s,r,c,l,u,d,p=this,h=p.group.length;if(!(p.isDragging||p.isClosing||p.isAnimating&&p.firstRun)){if(t=parseInt(t,10),s=p.current?p.current.opts.loop:p.opts.loop,!s&&(t<0||t>=h))return!1;if(a=p.firstRun=null===p.firstRun,!(h<2&&!a&&p.isDragging)){if(c=p.current,p.prevIndex=p.currIndex,p.prevPos=p.currPos,r=p.createSlide(t),h>1&&((s||r.index>0)&&p.createSlide(t-1),(s||r.index<h-1)&&p.createSlide(t+1)),p.current=r,p.currIndex=r.index,p.currPos=r.pos,p.trigger("beforeShow",a),p.updateControls(),u=n.fancybox.getTranslate(r.$slide),r.isMoved=(0!==u.left||0!==u.top)&&!r.$slide.hasClass("fancybox-animated"),r.forcedDuration=o,n.isNumeric(e)?r.forcedDuration=e:e=r.opts[a?"animationDuration":"transitionDuration"],e=parseInt(e,10),a)return r.opts.animationEffect&&e&&p.$refs.container.css("transition-duration",e+"ms"),p.$refs.container.removeClass("fancybox-is-hidden"),f(p.$refs.container),p.$refs.container.addClass("fancybox-is-open"),r.$slide.addClass("fancybox-slide--current"),p.loadSlide(r),void p.preload("image");n.each(p.slides,function(t,e){n.fancybox.stop(e.$slide)}),r.$slide.removeClass("fancybox-slide--next fancybox-slide--previous").addClass("fancybox-slide--current"),r.isMoved?(l=Math.round(r.$slide.width()),n.each(p.slides,function(t,o){var i=o.pos-r.pos;n.fancybox.animate(o.$slide,{top:0,left:i*l+i*o.opts.gutter},e,function(){o.$slide.removeAttr("style").removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===p.currPos&&(r.isMoved=!1,p.complete())})})):p.$refs.stage.children().removeAttr("style"),r.isLoaded?p.revealContent(r):p.loadSlide(r),p.preload("image"),c.pos!==r.pos&&(d="fancybox-slide--"+(c.pos>r.pos?"next":"previous"),c.$slide.removeClass("fancybox-slide--complete fancybox-slide--current fancybox-slide--next fancybox-slide--previous"),c.isComplete=!1,e&&(r.isMoved||r.opts.transitionEffect)&&(r.isMoved?c.$slide.addClass(d):(d="fancybox-animated "+d+" fancybox-fx-"+r.opts.transitionEffect,n.fancybox.animate(c.$slide,d,e,function(){c.$slide.removeClass(d).removeAttr("style")}))))}}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,i){var a,s,r,c,l,u=this,d=u.current,f=d.$content,p=parseInt(d.$slide.width(),10),h=parseInt(d.$slide.height(),10),g=d.width,b=d.height;"image"!=d.type||d.hasError||!f||u.isAnimating||(n.fancybox.stop(f),u.isAnimating=!0,t=t===o?.5*p:t,e=e===o?.5*h:e,a=n.fancybox.getTranslate(f),c=g/a.width,l=b/a.height,s=.5*p-.5*g,r=.5*h-.5*b,g>p&&(s=a.left*c-(t*c-t),s>0&&(s=0),s<p-g&&(s=p-g)),b>h&&(r=a.top*l-(e*l-e),r>0&&(r=0),r<h-b&&(r=h-b)),u.updateCursor(g,b),n.fancybox.animate(f,{top:r,left:s,scaleX:c,scaleY:l},i||330,function(){u.isAnimating=!1}),u.SlideShow&&u.SlideShow.isActive&&u.SlideShow.stop())},scaleToFit:function(t){var e,o=this,i=o.current,a=i.$content;"image"!=i.type||i.hasError||!a||o.isAnimating||(n.fancybox.stop(a),o.isAnimating=!0,e=o.getFitPos(i),o.updateCursor(e.width,e.height),n.fancybox.animate(a,{top:e.top,left:e.left,scaleX:e.width/a.width(),scaleY:e.height/a.height()},t||330,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,i,a,s,r=this,c=t.$content,l=t.width,u=t.height,d=t.opts.margin;return!(!c||!c.length||!l&&!u)&&("number"===n.type(d)&&(d=[d,d]),2==d.length&&(d=[d[0],d[1],d[0],d[1]]),e=parseInt(r.$refs.stage.width(),10)-(d[1]+d[3]),o=parseInt(r.$refs.stage.height(),10)-(d[0]+d[2]),i=Math.min(1,e/l,o/u),a=Math.floor(i*l),s=Math.floor(i*u),{top:Math.floor(.5*(o-s))+d[0],left:Math.floor(.5*(e-a))+d[3],width:a,height:s})},update:function(){var t=this;n.each(t.slides,function(e,n){t.updateSlide(n)})},updateSlide:function(t,e){var o=this,i=t&&t.$content;i&&(t.width||t.height)&&(o.isAnimating=!1,n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&o.updateCursor()),t.$slide.trigger("refresh"),o.trigger("onUpdate",t)},centerSlide:function(t,e){var i,a,s=this;s.current&&(i=Math.round(t.$slide.width()),a=t.pos-s.current.pos,n.fancybox.animate(t.$slide,{top:0,left:a*i+a*t.opts.gutter,opacity:1},e===o?0:e,null,!1))},updateCursor:function(t,e){var n,i=this,a=i.$refs.container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-drag fancybox-can-zoomOut");i.current&&!i.isClosing&&(i.isZoomable()?(a.addClass("fancybox-is-zoomable"),n=t!==o&&e!==o?t<i.current.width&&e<i.current.height:i.isScaledDown(),n?a.addClass("fancybox-can-zoomIn"):i.current.opts.touch?a.addClass("fancybox-can-drag"):a.addClass("fancybox-can-zoomOut")):i.current.opts.touch&&a.addClass("fancybox-can-drag"))},isZoomable:function(){var t,e=this,o=e.current;if(o&&!e.isClosing)return!!("image"===o.type&&o.isLoaded&&!o.hasError&&("zoom"===o.opts.clickContent||n.isFunction(o.opts.clickContent)&&"zoom"===o.opts.clickContent(o))&&(t=e.getFitPos(o),o.width>t.width||o.height>t.height))},isScaledDown:function(){var t=this,e=t.current,o=e.$content,i=!1;return o&&(i=n.fancybox.getTranslate(o),i=i.width<e.width||i.height<e.height),i},canPan:function(){var t=this,e=t.current,n=e.$content,o=!1;return n&&(o=t.getFitPos(e),o=Math.abs(n.width()-o.width)>1||Math.abs(n.height()-o.height)>1),o},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){switch(t.isLoading=!0,a.trigger("beforeLoad",t),e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass("fancybox-slide--"+(e||"unknown")).addClass(t.opts.slideClass),e){case"image":a.setImage(t);break;case"iframe":a.setIframe(t);break;case"html":a.setContent(t,t.src||t.content);break;case"inline":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case"ajax":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&a.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&a.setError(t)}})),o.one("onReset",function(){i.abort()});break;case"video":a.setContent(t,'<video controls><source src="'+t.src+'" type="'+t.opts.videoFormat+"\">Your browser doesn't support HTML5 video</video>");break;default:a.setError(t)}return!0}},setImage:function(e){var o,i,a,s,r=this,c=e.opts.srcset||e.opts.image.srcset;if(c){a=t.devicePixelRatio||1,s=t.innerWidth*a,i=c.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),i.sort(function(t,e){return t.value-e.value});for(var l=0;l<i.length;l++){var u=i[l];if("w"===u.postfix&&u.value>=s||"x"===u.postfix&&u.value>=a){o=u;break}}!o&&i.length&&(o=i[i.length-1]),o&&(e.src=o.url,e.width&&e.height&&"w"==o.postfix&&(e.height=e.width/e.height*o.value,e.width=o.value))}e.$content=n('<div class="fancybox-image-wrap"></div>').addClass("fancybox-is-hidden").appendTo(e.$slide),e.opts.preload!==!1&&e.opts.width&&e.opts.height&&(e.opts.thumb||e.opts.$thumb)?(e.width=e.opts.width,e.height=e.opts.height,e.$ghost=n("<img />").one("error",function(){n(this).remove(),e.$ghost=null,r.setBigImage(e)}).one("load",function(){r.afterLoad(e),r.setBigImage(e)}).addClass("fancybox-image").appendTo(e.$content).attr("src",e.opts.thumb||e.opts.$thumb.attr("src"))):r.setBigImage(e)},setBigImage:function(t){var e=this,o=n("<img />");t.$image=o.one("error",function(){e.setError(t)}).one("load",function(){clearTimeout(t.timouts),t.timouts=null,e.isClosing||(t.width=t.opts.width||this.naturalWidth,t.height=t.opts.height||this.naturalHeight,t.opts.image.srcset&&o.attr("sizes","100vw").attr("srcset",t.opts.image.srcset),e.hideLoading(t),t.$ghost?t.timouts=setTimeout(function(){t.timouts=null,t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))):e.afterLoad(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(o[0].complete||"complete"==o[0].readyState)&&o[0].naturalWidth&&o[0].naturalHeight?o.trigger("load"):o[0].error?o.trigger("error"):t.timouts=setTimeout(function(){o[0].complete||t.hasError||e.showLoading(t)},100)},setIframe:function(t){var e,i=this,a=t.opts.iframe,s=t.$slide;t.$content=n('<div class="fancybox-content'+(a.preload?" fancybox-is-hidden":"")+'"></div>').css(a.css).appendTo(s),e=n(a.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(a.attr).appendTo(t.$content),a.preload?(i.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),i.afterLoad(t)}),s.on("refresh.fb",function(){var n,i,s,r=t.$content,c=a.css.width,l=a.css.height;if(1===e[0].isReady){try{i=e.contents(),s=i.find("body")}catch(t){}s&&s.length&&(c===o&&(n=e[0].contentWindow.document.documentElement.scrollWidth,c=Math.ceil(s.outerWidth(!0)+(r.width()-n)),c+=r.outerWidth()-r.innerWidth()),l===o&&(l=Math.ceil(s.outerHeight(!0)),l+=r.outerHeight()-r.innerHeight()),c&&r.width(c),l&&r.height(l)),r.removeClass("fancybox-is-hidden")}})):this.afterLoad(t),e.attr("src",t.src),t.opts.smallBtn===!0&&t.$content.prepend(i.translate(t,t.opts.btnTpl.smallBtn)),s.one("onReset",function(){try{n(this).find("iframe").hide().attr("src","//about:blank")}catch(t){}n(this).empty(),t.isLoaded=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$slide.empty(),l(e)&&e.parent().length?(e.parent(".fancybox-slide--inline").trigger("onReset"),t.$placeholder=n("<div></div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents(),3===e[0].nodeType&&(e=n("<div>").html(e))),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1)}),t.$content=n(e).appendTo(t.$slide),this.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.removeClass("fancybox-slide--"+t.type),this.setContent(t,this.translate(t,t.opts.errorTpl))},showLoading:function(t){var e=this;t=t||e.current,t&&!t.$spinner&&(t.$spinner=n(e.opts.spinnerTpl).appendTo(t.$slide))},hideLoading:function(t){var e=this;t=t||e.current,t&&t.$spinner&&(t.$spinner.remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),t.opts.smallBtn&&!t.$smallBtn&&(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content.filter("div,form").first())),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.revealContent(t))},revealContent:function(t){var e,i,a,s,r,c=this,l=t.$slide,u=!1;return e=t.opts[c.firstRun?"animationEffect":"transitionEffect"],a=t.opts[c.firstRun?"animationDuration":"transitionDuration"],a=parseInt(t.forcedDuration===o?a:t.forcedDuration,10),!t.isMoved&&t.pos===c.currPos&&a||(e=!1),"zoom"!==e||t.pos===c.currPos&&a&&"image"===t.type&&!t.hasError&&(u=c.getThumbPos(t))||(e="fade"),"zoom"===e?(r=c.getFitPos(t),r.scaleX=r.width/u.width,r.scaleY=r.height/u.height,delete r.width,delete r.height,s=t.opts.zoomOpacity,"auto"==s&&(s=Math.abs(t.width/t.height-u.width/u.height)>.1),s&&(u.opacity=.1,r.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),u),f(t.$content),void n.fancybox.animate(t.$content,r,a,function(){c.complete()})):(c.updateSlide(t),e?(n.fancybox.stop(l),i="fancybox-animated fancybox-slide--"+(t.pos>=c.prevPos?"next":"previous")+" fancybox-fx-"+e,l.removeAttr("style").removeClass("fancybox-slide--current fancybox-slide--next fancybox-slide--previous").addClass(i),t.$content.removeClass("fancybox-is-hidden"),f(l),void n.fancybox.animate(l,"fancybox-slide--current",a,function(e){l.removeClass(i).removeAttr("style"),t.pos===c.currPos&&c.complete()},!0)):(f(l),t.$content.removeClass("fancybox-is-hidden"),void(t.pos===c.currPos&&c.complete())))},getThumbPos:function(o){var i,a=this,s=!1,r=function(e){for(var o,i=e[0],a=i.getBoundingClientRect(),s=[];null!==i.parentElement;)"hidden"!==n(i.parentElement).css("overflow")&&"auto"!==n(i.parentElement).css("overflow")||s.push(i.parentElement.getBoundingClientRect()),i=i.parentElement;return o=s.every(function(t){var e=Math.min(a.right,t.right)-Math.max(a.left,t.left),n=Math.min(a.bottom,t.bottom)-Math.max(a.top,t.top);return e>0&&n>0}),o&&a.bottom>0&&a.right>0&&a.left<n(t).width()&&a.top<n(t).height()},c=o.opts.$thumb,l=c?c.offset():0;return l&&c[0].ownerDocument===e&&r(c)&&(i=a.$refs.stage.offset(),s={top:l.top-i.top+parseFloat(c.css("border-top-width")||0),left:l.left-i.left+parseFloat(c.css("border-left-width")||0),width:c.width(),height:c.height(),scaleX:1,scaleY:1}),s},complete:function(){var t=this,o=t.current,i={};o.isMoved||!o.isLoaded||o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),t.preload("inline"),f(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(t.slides,function(e,o){o.pos>=t.currPos-1&&o.pos<=t.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),t.slides=i,t.updateCursor(),t.trigger("afterShow"),o.$slide.find("video,audio").first().trigger("play"),(n(e.activeElement).is("[disabled]")||o.opts.autoFocus&&"image"!=o.type&&"iframe"!==o.type)&&t.focus())},preload:function(t){var e=this,n=e.slides[e.currPos+1],o=e.slides[e.currPos-1];n&&n.type===t&&e.loadSlide(n),o&&o.type===t&&e.loadSlide(o)},focus:function(){var t,e=this.current;this.isClosing||(e&&e.isComplete&&(t=e.$slide.find("input[autofocus]:enabled:visible:first"),t.length||(t=e.$slide.find("button,:input,[tabindex],a").filter(":enabled:visible:first"))),t=t&&t.length?t:this.$refs.container,t.focus())},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l=this,p=l.current,h=function(){l.cleanUp(t)};return!l.isClosing&&(l.isClosing=!0,l.trigger("beforeClose",t)===!1?(l.isClosing=!1,u(function(){l.update()}),!1):(l.removeEvents(),p.timouts&&clearTimeout(p.timouts),a=p.$content,o=p.opts.animationEffect,i=n.isNumeric(e)?e:o?p.opts.animationDuration:0,p.$slide.off(d).removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),p.$slide.siblings().trigger("onReset").remove(),i&&l.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing"),l.hideLoading(p),l.hideControls(),l.updateCursor(),"zoom"!==o||t!==!0&&a&&i&&"image"===p.type&&!p.hasError&&(c=l.getThumbPos(p))||(o="fade"),"zoom"===o?(n.fancybox.stop(a),r=n.fancybox.getTranslate(a),r.width=r.width*r.scaleX,r.height=r.height*r.scaleY,s=p.opts.zoomOpacity,"auto"==s&&(s=Math.abs(p.width/p.height-c.width/c.height)>.1),s&&(c.opacity=0),r.scaleX=r.width/c.width,r.scaleY=r.height/c.height,r.width=c.width,r.height=c.height,n.fancybox.setTranslate(p.$content,r),f(p.$content),n.fancybox.animate(p.$content,c,i,h),!0):(o&&i?t===!0?setTimeout(h,i):n.fancybox.animate(p.$slide.removeClass("fancybox-slide--current"),"fancybox-animated fancybox-slide--previous fancybox-fx-"+o,i,h):h(),!0)))},cleanUp:function(t){var o,i,a=this,r=n("body");a.current.$slide.trigger("onReset"),a.$refs.container.empty().remove(),a.trigger("afterClose",t),a.$lastFocus&&a.current.opts.backFocus&&a.$lastFocus.focus(),a.current=null,o=n.fancybox.getInstance(),o?o.activate():(s.scrollTop(a.scrollTop).scrollLeft(a.scrollLeft),r.removeClass("fancybox-active compensate-for-scrollbar"),r.hasClass("fancybox-iosfix")&&(i=parseInt(e.body.style.top,10),r.removeClass("fancybox-iosfix").css("top","").scrollTop(i*-1)),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;return s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),o===!1?o:void("afterClose"!==t&&a.$refs?a.$refs.container.trigger(t+".fb",i):r.trigger(t+".fb",i))},updateControls:function(t){var e=this,n=e.current,o=n.index,i=n.opts.caption,a=e.$refs.container,s=e.$refs.caption;n.$slide.trigger("refresh"),e.$caption=i&&i.length?s.html(i):null,e.isHiddenControls||e.isIdle||e.showControls(),a.find("[data-fancybox-count]").html(e.group.length),a.find("[data-fancybox-index]").html(o+1),a.find("[data-fancybox-prev]").prop("disabled",!n.opts.loop&&o<=0),a.find("[data-fancybox-next]").prop("disabled",!n.opts.loop&&o>=e.group.length-1),"image"===n.type?a.find("[data-fancybox-download]").attr("href",n.opts.image.src||n.src).show():a.find("[data-fancybox-download],[data-fancybox-zoom]").hide()},hideControls:function(){this.isHiddenControls=!0,this.$refs.container.removeClass("fancybox-show-infobar fancybox-show-toolbar fancybox-show-caption fancybox-show-nav")},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.isHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal),t.$caption?n.addClass("fancybox-show-caption "):n.removeClass("fancybox-show-caption")},toggleControls:function(){this.isHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.2.10",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof p&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new p(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close())},destroy:function(){this.close(!0),r.off("click.fb-start")},isMobile:e.createTouch!==o&&/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;if(!t||!t.length)return!1;if(e=t.eq(0).css("transform"),e&&e.indexOf("matrix")!==-1?(e=e.split("(")[1],e=e.split(")")[0],e=e.split(",")):e=[],e.length)e=e.length>10?[e[13],e[12],e[0],e[5]]:[e[5],e[4],e[0],e[3]],e=e.map(parseFloat);else{e=[0,0,1,1];var n=/\.*translate\((.*)px,(.*)px\)/i,o=n.exec(t.eq(0).attr("style"));o&&(e[0]=parseFloat(o[2]),e[1]=parseFloat(o[1]))}return{top:e[0],left:e[1],scaleX:e[2],scaleY:e[3],opacity:parseFloat(t.css("opacity")),width:t.width(),height:t.height()}},setTranslate:function(t,e){var n="",i={};if(t&&e)return e.left===o&&e.top===o||(n=(e.left===o?t.position().left:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o&&(n=(n.length?n+" ":"")+"scale("+e.scaleX+", "+e.scaleY+")"),n.length&&(i.transform=n),e.opacity!==o&&(i.opacity=e.opacity),e.width!==o&&(i.width=e.width),e.height!==o&&(i.height=e.height),t.css(i)},animate:function(t,e,i,a,s){n.isFunction(i)&&(a=i,i=null),n.isPlainObject(e)||t.removeAttr("style"),t.on(d,function(i){(!i||!i.originalEvent||t.is(i.originalEvent.target)&&"z-index"!=i.originalEvent.propertyName)&&(n.fancybox.stop(t),n.isPlainObject(e)?(e.scaleX!==o&&e.scaleY!==o&&(t.css("transition-duration",""),e.width=Math.round(t.width()*e.scaleX),e.height=Math.round(t.height()*e.scaleY),e.scaleX=1,e.scaleY=1,n.fancybox.setTranslate(t,e)),s===!1&&t.removeAttr("style")):s!==!0&&t.removeClass(e),n.isFunction(a)&&a(i))}),n.isNumeric(i)&&t.css("transition-duration",i+"ms"),n.isPlainObject(e)?n.fancybox.setTranslate(t,e):t.addClass(e),e.scaleX&&t.hasClass("fancybox-image-wrap")&&t.parent().addClass("fancybox-is-scaling"),t.data("timer",setTimeout(function(){t.trigger("transitionend")},i+16))},stop:function(t){clearTimeout(t.data("timer")),t.off("transitionend").css("transition-duration",""),t.hasClass("fancybox-image-wrap")&&t.parent().removeClass("fancybox-is-scaling")}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},i):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},i),this},r.on("click.fb-start","[data-fancybox]",i)}}(window,document,window.jQuery||jQuery),function(t){"use strict";var e=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e},n={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"
|
12 |
+
},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1,api:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},metacafe:{matcher:/metacafe.com\/watch\/(\d+)\/(.*)?/,type:"iframe",url:"//www.metacafe.com/embed/$1/?ap=1"},dailymotion:{matcher:/dailymotion.com\/video\/(.*)\/?(.*)/,params:{additionalInfos:0,autoStart:1},type:"iframe",url:"//www.dailymotion.com/embed/video/$1"},vine:{matcher:/vine.co\/v\/([a-zA-Z0-9\?\=\-]+)/,type:"iframe",url:"//vine.co/v/$1/embed/simple"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12])+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}};t(document).on("objectNeedsType.fb",function(o,i,a){var s,r,c,l,u,d,f,p=a.src||"",h=!1;s=t.extend(!0,{},n,a.opts.media),t.each(s,function(n,o){if(c=p.match(o.matcher)){if(h=o.type,d={},o.paramPlace&&c[o.paramPlace]){u=c[o.paramPlace],"?"==u[0]&&(u=u.substring(1)),u=u.split("&");for(var i=0;i<u.length;++i){var s=u[i].split("=",2);2==s.length&&(d[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,a.opts[n],d),p="function"===t.type(o.url)?o.url.call(this,c,l,a):e(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,a):e(o.thumb,c),"vimeo"===n&&(p=p.replace("&%23","#")),!1}}),h?(a.src=p,a.type=h,a.opts.thumb||a.opts.$thumb&&a.opts.$thumb.length||(a.opts.thumb=r),"iframe"===h&&(t.extend(!0,a.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}}),a.contentProvider=f,a.opts.slideClass+=" fancybox-slide--"+("gmap_place"==f||"gmap_search"==f?"map":"video"))):p&&(a.type=a.opts.defaultType)})}(window.jQuery||jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,i=o.length;e<i;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],i=("scroll"===n||"auto"===n)&&e.scrollHeight>e.clientHeight,a=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-stage")||t.is("body"))break}return e},u=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};u.prototype.destroy=function(){this.$container.off(".fb.touch")},u.prototype.ontouchstart=function(o){var i=this,c=n(o.target),u=i.instance,d=u.current,f=d.$content,p="touchstart"==o.type;if(p&&i.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!d||i.instance.isAnimating||i.instance.isClosing)return o.stopPropagation(),void o.preventDefault();if(i.realPoints=i.startPoints=a(o),i.startPoints){if(o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=f,i.opts=d.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.sliderStartPos=i.sliderLastPos||{top:0,left:0},i.contentStartPos=n.fancybox.getTranslate(i.$content),i.contentLastPos=null,i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(d.$slide[0].clientWidth),i.canvasHeight=Math.round(d.$slide[0].clientHeight),n(e).off(".fb.touch").on(p?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(i,"ontouchend")).on(p?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(i,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",i.onscroll,!0),!i.opts&&!u.canPan()||!c.is(i.$stage)&&!i.$stage.find(c).length)return void(c.is("img")&&o.preventDefault());n.fancybox.isMobile&&(l(c)||l(c.parent()))||o.preventDefault(),1===i.startPoints.length&&("image"===d.type&&(i.contentStartPos.width>i.canvasWidth+1||i.contentStartPos.height>i.canvasHeight+1)?(n.fancybox.stop(i.$content),i.$content.css("transition-duration",""),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass("fancybox-controls--isGrabbing")),2!==i.startPoints.length||u.isAnimating||d.hasError||"image"!==d.type||!d.isLoaded&&!d.$ghost||(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.$content.css("transition-duration",""),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))}}},u.prototype.onscroll=function(t){self.isScrolling=!0},u.prototype.ontouchmove=function(t){var e=this,o=n(t.target);return e.isScrolling||!o.is(e.$stage)&&!e.$stage.find(o).length?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.instance.canPan())&&e.newPoints&&e.newPoints.length&&(e.isSwiping&&e.isSwiping===!0||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},u.prototype.onSwipe=function(e){var a,s=this,r=s.isSwiping,c=s.sliderStartPos.left||0;if(r!==!0)"x"==r&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?c+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?c-=Math.pow(-s.distanceX,.8):c+=s.distanceX),s.sliderLastPos={top:"x"==r?0:s.sliderStartPos.top+s.distanceY,left:c},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,s.instance.group.length<2&&s.opts.vertical?s.isSwiping="y":s.instance.isDragging||s.opts.vertical===!1||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?"y":"x"),s.canTap=!1,"y"===s.isSwiping&&n.fancybox.isMobile&&(l(s.$target)||l(s.$target.parent())))return void(s.isScrolling=!0);s.instance.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(s.instance.slides,function(t,e){n.fancybox.stop(e.$slide),e.$slide.css("transition-duration",""),e.inTransition=!1,e.pos===s.instance.current.pos&&(s.sliderStartPos.left=n.fancybox.getTranslate(e.$slide).left)}),s.instance.SlideShow&&s.instance.SlideShow.isActive&&s.instance.SlideShow.stop()}},u.prototype.onPan=function(){var t=this;return s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5)?void(t.startPoints=t.newPoints):(t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&(i(t.requestId),t.requestId=null),void(t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})))},u.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,u=s.distanceY,d=s.contentStartPos,f=d.left,p=d.top,h=d.width,g=d.height;return i=h>r?f+l:f,a=p+u,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),h>r&&(l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i<n&&(i=n+1-Math.pow(n-f-l,.8)||0)),g>c&&(u>0&&a>e&&(a=e-1+Math.pow(-e+p+u,.8)||0),u<0&&a<o&&(a=o+1-Math.pow(o-p-u,.8)||0)),{top:a,left:i,scaleX:d.scaleX,scaleY:d.scaleY}},u.prototype.limitPosition=function(t,e,n,o){var i=this,a=i.canvasWidth,s=i.canvasHeight;return n>a?(t=t>0?0:t,t=t<a-n?a-n:t):t=Math.max(0,a/2-n/2),o>s?(e=e>0?0:e,e=e<s-o?s-o:e):e=Math.max(0,s/2-o/2),{top:e,left:t}},u.prototype.onZoom=function(){var e=this,a=e.contentStartPos.width,r=e.contentStartPos.height,c=e.contentStartPos.left,l=e.contentStartPos.top,u=s(e.newPoints[0],e.newPoints[1]),d=u/e.startDistanceBetweenFingers,f=Math.floor(a*d),p=Math.floor(r*d),h=(a-f)*e.percentageOfImageAtPinchPointX,g=(r-p)*e.percentageOfImageAtPinchPointY,b=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),m=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=b-e.centerPointStartX,v=m-e.centerPointStartY,x=c+(h+y),w=l+(g+v),$={top:w,left:x,scaleX:e.contentStartPos.scaleX*d,scaleY:e.contentStartPos.scaleY*d};e.canTap=!1,e.newWidth=f,e.newHeight=p,e.contentLastPos=$,e.requestId&&(i(e.requestId),e.requestId=null),e.requestId=o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},u.prototype.ontouchend=function(t){var o=this,s=Math.max((new Date).getTime()-o.startTime,1),r=o.isSwiping,c=o.isPanning,l=o.isZooming,u=o.isScrolling;return o.endPoints=a(t),o.$container.removeClass("fancybox-controls--isGrabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(i(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap?o.onTap(t):(o.speed=366,o.velocityX=o.distanceX/s*.5,o.velocityY=o.distanceY/s*.5,o.speedX=Math.max(.5*o.speed,Math.min(1.5*o.speed,1/Math.abs(o.velocityX)*o.speed)),void(c?o.endPanning():l?o.endZooming():o.endSwiping(r,u)))},u.prototype.endSwiping=function(t,e){var o=this,i=!1,a=o.instance.group.length;o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},150),i=o.instance.close(!0,300)):"x"==t&&o.distanceX>50&&a>1?i=o.instance.previous(o.speedX):"x"==t&&o.distanceX<-50&&a>1&&(i=o.instance.next(o.speedX)),i!==!1||"x"!=t&&"y"!=t||(e||a<2?o.instance.centerSlide(o.instance.current,150):o.instance.jumpTo(o.instance.current.index)),o.$container.removeClass("fancybox-is-sliding")},u.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(i.opts.momentum===!1?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+i.velocityX*i.speed,e=i.contentLastPos.top+i.velocityY*i.speed),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,330))},u.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),r<a.canvasWidth&&c<a.canvasHeight?a.instance.scaleToFit(150):r>s.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.setTranslate(a.content,n.fancybox.getTranslate(a.$content)),n.fancybox.animate(a.$content,o,150)))},u.prototype.onTap=function(t){var e,o=this,i=n(t.target),s=o.instance,r=s.current,c=t&&a(t)||o.startPoints,l=c[0]?c[0].x-o.$stage.offset().left:0,u=c[0]?c[0].y-o.$stage.offset().top:0,d=function(e){var i=r.opts[e];if(n.isFunction(i)&&(i=i.apply(s,[r,t])),i)switch(i){case"close":s.close(o.startEvent);break;case"toggleControls":s.toggleControls(!0);break;case"next":s.next();break;case"nextOrClose":s.group.length>1?s.next():s.close(o.startEvent);break;case"zoom":"image"==r.type&&(r.isLoaded||r.$ghost)&&(s.canPan()?s.scaleToFit():s.isScaledDown()?s.scaleToActual(l,u):s.group.length<2&&s.close(o.startEvent))}};if((!t.originalEvent||2!=t.originalEvent.button)&&(i.is("img")||!(l>i[0].clientWidth+i.offset().left))){if(i.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))e="Outside";else if(i.is(".fancybox-slide"))e="Slide";else{if(!s.current.$content||!s.current.$content.find(i).addBack().filter(i).length)return;e="Content"}if(o.tapped){if(clearTimeout(o.tapped),o.tapped=null,Math.abs(l-o.tapX)>50||Math.abs(u-o.tapY)>50)return this;d("dblclick"+e)}else o.tapX=l,o.tapY=u,r.opts["dblclick"+e]&&r.opts["dblclick"+e]!==r.opts["click"+e]?o.tapped=setTimeout(function(){o.tapped=null,d("click"+e)},500):d("click"+e);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new u(e))})}(window,document,window.jQuery||jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg viewBox="0 0 40 40"><path d="M13,12 L27,20 L13,27 Z" /><path d="M15,10 v19 M23,10 v19" /></svg></button>'},slideShow:{autoStart:!1,speed:3e3}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this;t.$button=t.instance.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),(t.instance.group.length<2||!t.instance.group[t.instance.currIndex].opts.slideShow)&&t.$button.hide()},set:function(t){var e=this;e.instance&&e.instance.current&&(t===!0||e.instance.current.opts.loop||e.instance.currIndex<e.instance.group.length-1)?e.timer=setTimeout(function(){e.isActive&&e.instance.jumpTo((e.instance.currIndex+1)%e.instance.group.length)},e.instance.current.opts.slideShow.speed):(e.stop(),e.instance.idleSecondsCounter=0,e.instance.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null},start:function(){var t=this,e=t.instance.current;e&&(t.isActive=!0,t.$button.attr("title",e.opts.i18n[e.opts.lang].PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.set(!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",e.opts.i18n[e.opts.lang].PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var i=e&&e.SlideShow;o?i&&n.opts.slideShow.autoStart&&i.start():i&&i.isActive&&i.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,i,a,s){var r=o&&o.SlideShow;!r||!i.opts.slideShow||80!==s&&32!==s||e(t.activeElement).is("button,a,input")||(a.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())})}(document,window.jQuery||jQuery),function(t,e){"use strict";var n=function(){var e,n,o,i=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],a={};for(n=0;n<i.length;n++)if(e=i[n],e&&e[1]in t){for(o=0;o<e.length;o++)a[i[0][o]]=e[o];return a}return!1}();if(!n)return void(e&&e.fancybox&&(e.fancybox.defaults.btnTpl.fullScreen=!1));var o={request:function(e){e=e||t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e||t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fullscreen" title="{{FULL_SCREEN}}"><svg viewBox="0 0 40 40"><path d="M9,12 h22 v16 h-22 v-16 v16 h22 v-16 Z" /></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on({"onInit.fb":function(t,e){var n;e&&e.group[e.currIndex].opts.fullScreen?(n=e.$refs.container,n.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle(n[0])}),e.opts.fullScreen&&e.opts.fullScreen.autoStart===!0&&o.request(n[0]),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()},"afterKeydown.fb":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle(e.$refs.container[0]))},"beforeClose.fb":function(t){t&&t.FullScreen&&o.exit()}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.current.$content.css("transition","none"),n.isAnimating=!1,n.update(!0,!0,0)),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t))})}(document,window.jQuery||jQuery),function(t,e){"use strict";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg viewBox="0 0 120 120"><path d="M30,30 h14 v14 h-14 Z M50,30 h14 v14 h-14 Z M70,30 h14 v14 h-14 Z M30,50 h14 v14 h-14 Z M50,50 h14 v14 h-14 Z M70,50 h14 v14 h-14 Z M30,70 h14 v14 h-14 Z M50,70 h14 v14 h-14 Z M70,70 h14 v14 h-14 Z" /></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var n=function(t){this.init(t)};e.extend(n.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this;e.instance=t,t.Thumbs=e;var n=t.group[0],o=t.group[1];e.opts=t.group[t.currIndex].opts.thumbs,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]"),e.opts&&n&&o&&("image"==n.type||n.opts.thumb||n.opts.$thumb)&&("image"==o.type||o.opts.thumb||o.opts.$thumb)?(e.$button.show().on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,n,o=this,i=o.instance,a=o.opts.parentEl;o.$grid=e('<div class="fancybox-thumbs fancybox-thumbs-'+o.opts.axis+'"></div>').appendTo(i.$refs.container.find(a).addBack().filter(a)),t="<ul>",e.each(i.group,function(e,o){n=o.opts.thumb||(o.opts.$thumb?o.opts.$thumb.attr("src"):null),n||"image"!==o.type||(n=o.src),n&&n.length&&(t+='<li data-index="'+e+'" tabindex="0" class="fancybox-thumbs-loading"><img data-src="'+n+'" /></li>')}),t+="</ul>",o.$list=e(t).appendTo(o.$grid).on("click","li",function(){i.jumpTo(e(this).data("index"))}),o.$list.find("img").hide().one("load",function(){var t,n,o,i,a=e(this).parent().removeClass("fancybox-thumbs-loading"),s=a.outerWidth(),r=a.outerHeight();t=this.naturalWidth||this.width,n=this.naturalHeight||this.height,o=t/s,i=n/r,o>=1&&i>=1&&(o>i?(t/=i,n=r):(t=s,n/=o)),e(this).css({width:Math.floor(t),height:Math.floor(n),"margin-top":n>r?Math.floor(.3*r-.3*n):Math.floor(.5*r-.5*n),"margin-left":Math.floor(.5*s-.5*t)}).show()}).each(function(){this.src=e(this).data("src")}),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"))+i.group.length*o.$list.children().eq(0).outerWidth(!0)+"px")},focus:function(t){var e,n,o=this,i=o.$list;o.instance.current&&(e=i.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+o.instance.current.index+'"]').addClass("fancybox-thumbs-active"),n=e.position(),"y"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===o.opts.axis&&(n.left<i.parent().scrollLeft()||n.left>i.parent().scrollLeft()+(i.parent().width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){this.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),this.isVisible?(this.$grid||this.create(),this.instance.trigger("onThumbsShow"),this.focus(0)):this.$grid&&this.instance.trigger("onThumbsHide"),this.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var o;e&&!e.Thumbs&&(o=new n(e),o.isActive&&o.opts.autoStart===!0&&o.show())},"beforeShow.fb":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&n.opts.hideOnClose!==!1&&n.$grid.hide()}})}(document,window.jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg viewBox="0 0 40 40"><path d="M6,30 C8,18 19,16 23,16 L23,16 L23,10 L33,20 L23,29 L23,24 C19,24 8,27 6,30 Z"></svg></button>'},share:{tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p class="fancybox-share__links"><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" /></p></div>'}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,i=e.fancybox.getInstance();i&&(t=i.current.opts.hash===!1?i.current.src:window.location,o=i.current.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===i.current.type?encodeURIComponent(i.current.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,o),type:"html",opts:{animationEffect:"fade",animationDuration:250,afterLoad:function(t,e){e.$content.find(".fancybox-share__links a").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})}}}))})}(document,window.jQuery||jQuery),function(t,e,n){"use strict";function o(){var t=e.location.hash.substr(1),n=t.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join("-");return o<1&&(o=1),{hash:t,index:o,gallery:i}}function i(t){var e;""!==t.gallery&&(e=n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1),e.length||(e=n("#"+n.escapeSelector(t.gallery))),e.length&&(s=!1,e.trigger("click")))}function a(t){var e;return!!t&&(e=t.current?t.current.opts:t.opts,e.hash||(e.$orig?e.$orig.data("fancybox"):""))}n.escapeSelector||(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)});var s=!0,r=null,c=null;n(function(){n.fancybox.defaults.hash!==!1&&(n(t).on({"onInit.fb":function(t,e){var n,i;e.group[e.currIndex].opts.hash!==!1&&(n=o(),i=a(e),i&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,i){var l;i&&i.opts.hash!==!1&&(l=a(o),l&&""!==l&&(e.location.hash.indexOf(l)<0&&(o.opts.origHash=e.location.hash),r=l+(o.group.length>1?"-"+(i.index+1):""),"replaceState"in e.history?(c&&clearTimeout(c),c=setTimeout(function(){e.history[s?"pushState":"replaceState"]({},t.title,e.location.pathname+e.location.search+"#"+r),c=null,s=!1},300)):e.location.hash=r))},"beforeClose.fb":function(o,i,s){var l,u;c&&clearTimeout(c),s.opts.hash!==!1&&(l=a(i),u=i&&i.opts.origHash?i.opts.origHash:"",l&&""!==l&&("replaceState"in history?e.history.replaceState({},t.title,e.location.pathname+e.location.search+u):(e.location.hash=u,n(e).scrollTop(i.scrollTop).scrollLeft(i.scrollLeft))),r=null)}}),n(e).on("hashchange.fb",function(){var t=o();n.fancybox.getInstance()?!r||r===t.gallery+"-"+t.index||1===t.index&&r==t.gallery||(r=null,n.fancybox.close()):""!==t.gallery&&i(t)}),setTimeout(function(){i(o())},50))})}(document,window,window.jQuery||jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,i=(new Date).getTime();e.group.length<1||o.opts.wheel===!1||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))})}})}(document,window.jQuery||jQuery);
|
assets_libraries/font-awesome5/css/fa-brands-400.eot
ADDED
Binary file
|
assets_libraries/font-awesome5/css/fa-brands-400.svg
ADDED
@@ -0,0 +1,3442 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?xml version="1.0" standalone="no"?>
|
2 |
+
<!--
|
3 |
+
Font Awesome Free 5.9.0 by @fontawesome - https://fontawesome.com
|
4 |
+
License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
|
5 |
+
-->
|
6 |
+
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
7 |
+
<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" version="1.1">
|
8 |
+
<metadata>
|
9 |
+
Created by FontForge 20190112 at Tue Jun 4 15:16:44 2019
|
10 |
+
By Robert Madole
|
11 |
+
Copyright (c) Font Awesome
|
12 |
+
</metadata>
|
13 |
+
<defs>
|
14 |
+
<font id="FontAwesome5Brands-Regular" horiz-adv-x="448" >
|
15 |
+
<font-face
|
16 |
+
font-family="Font Awesome 5 Brands Regular"
|
17 |
+
font-weight="400"
|
18 |
+
font-stretch="normal"
|
19 |
+
units-per-em="512"
|
20 |
+
panose-1="2 0 5 3 0 0 0 0 0 0"
|
21 |
+
ascent="448"
|
22 |
+
descent="-64"
|
23 |
+
bbox="-0.200195 -66.9505 641.5 448.3"
|
24 |
+
underline-thickness="25"
|
25 |
+
underline-position="-51"
|
26 |
+
unicode-range="U+0020-F842"
|
27 |
+
/>
|
28 |
+
<missing-glyph />
|
29 |
+
<glyph glyph-name="twitter-square" unicode=""
|
30 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM351.1 257.2c12.8008 9.2998 24 20.8994 32.9004 34c-11.7998 -5.10059 -24.5996 -8.7998 -37.7998 -10.2002
|
31 |
+
c13.5996 8.09961 23.8994 20.9004 28.7998 36.0996c-12.5996 -7.5 -26.7998 -13 -41.5996 -15.7998c-12 12.7998 -29 20.7002 -47.9004 20.7002c-40 0 -73.2998 -36.0996 -64 -80.5996c-54.4004 2.7998 -102.9 28.7998 -135.2 68.5996
|
32 |
+
c-5.7002 -9.7002 -8.89941 -20.9004 -8.89941 -33.0996v-0.107422c0 -19.3584 13.0811 -43.7715 29.1992 -54.4932c-10.6992 0.400391 -20.8994 3.40039 -29.5996 8.2998v-0.799805c0 -31.8994 22.5 -58.2998 52.5 -64.3994
|
33 |
+
c-10.4004 -2.7002 -19.5 -2.7002 -29.5996 -1.2002c8.2998 -26 32.5 -44.9004 61.2998 -45.5c-22.5 -17.6006 -50.7002 -28 -81.4004 -28c-5.39941 0 -10.5 0.200195 -15.7998 0.799805c29 -18.5996 63.5 -29.4004 100.7 -29.4004c120.6 0 186.6 99.9004 186.6 186.601
|
34 |
+
c0 2.7998 0 5.7002 -0.200195 8.5z" />
|
35 |
+
<glyph glyph-name="facebook-square" unicode=""
|
36 |
+
d="M400 416c26.4961 0 48 -21.5039 48 -48v-352c0 -26.4961 -21.5039 -48 -48 -48h-137.25v152.31h57.7803l11 71.6904h-68.7803v46.5498c0 19.6104 9.61035 38.7305 40.4199 38.7305h31.2705v61s-28.3809 4.83984 -55.5205 4.83984
|
37 |
+
c-56.6699 0 -93.6699 -34.3301 -93.6699 -96.4805v-54.6396h-63v-71.6904h63v-152.31h-137.25c-26.4961 0 -48 21.5039 -48 48v352c0 26.4961 21.5039 48 48 48h352z" />
|
38 |
+
<glyph glyph-name="linkedin" unicode=""
|
39 |
+
d="M416 416c17.5996 0 32 -14.5 32 -32.2998v-383.4c0 -17.7998 -14.4004 -32.2998 -32 -32.2998h-384.1c-17.6006 0 -31.9004 14.5 -31.9004 32.2998v383.4c0 17.7998 14.2998 32.2998 31.9004 32.2998h384.1zM135.4 32h0.0996094v213.8h-66.5v-213.8h66.4004zM102.2 275
|
40 |
+
c21.2998 0 38.5 17.2002 38.5 38.5c0 21.2002 -17.2998 38.5 -38.5 38.5c-21.2998 0 -38.5 -17.2998 -38.5 -38.5s17.2002 -38.5 38.5 -38.5zM384.3 32v117.2c0 57.5996 -12.5 101.899 -79.7002 101.899c-32.2998 0 -54 -17.6992 -62.8994 -34.5h-0.900391v29.2002h-63.7002
|
41 |
+
v-213.8h66.4004v105.8c0 27.9004 5.2998 54.9004 39.9004 54.9004c34 0 34.5 -31.9004 34.5 -56.7002v-104h66.3994z" />
|
42 |
+
<glyph glyph-name="github-square" unicode=""
|
43 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM277.3 32.2998c66 22 110.8 84.9004 110.7 158.3c0 91.8008 -74.4004 161.5 -166.2 161.5s-162 -69.6992 -162 -161.5
|
44 |
+
c0 -73.3994 46.2002 -136.199 112.2 -158.3c8.5 -1.5 11.5 3.7002 11.5 8c0 4.10059 -0.200195 26.7002 -0.200195 40.6006c0 0 -46.3994 -10 -56.0996 19.6992c0 0 -7.60059 19.2002 -18.4004 24.2002c0 0 -15.0996 10.4004 1.10059 10.2002
|
45 |
+
c0 0 16.3994 -1.2998 25.5 -17.0996c14.5 -25.6006 38.7998 -18.2002 48.2998 -13.9004c1.5 10.5996 5.7998 18 10.5996 22.2998c-37 4.10059 -74.2998 9.5 -74.2998 73.1006c0 18.1992 5 27.2998 15.5996 39c-1.7998 4.39941 -7.39941 22.0996 1.7002 45
|
46 |
+
c13.9004 4.2998 45.7002 -17.9004 45.7002 -17.9004c13.2002 3.7002 27.5 5.59961 41.5996 5.59961c14.1006 0 28.4004 -1.89941 41.6006 -5.59961c0 0 31.7998 22.2002 45.7002 17.9004c9.09961 -23 3.39941 -40.7002 1.69922 -45
|
47 |
+
c10.6006 -11.7002 17.1006 -20.8008 17.1006 -39c0 -63.9004 -39 -69 -76 -73.1006c6.09961 -5.2002 11.2998 -15.0996 11.2998 -30.7002c0 -22.2998 -0.200195 -49.8994 -0.200195 -55.2998c0 -4.2998 3.10059 -9.5 11.5 -8zM179.2 93.4004
|
48 |
+
c-1.90039 -0.400391 -3.7002 0.399414 -3.90039 1.69922c-0.200195 1.5 1.10059 2.80078 3 3.2002c1.90039 0.200195 3.7002 -0.599609 3.90039 -1.89941c0.299805 -1.30078 -1 -2.60059 -3 -3zM169.7 94.2998c0 1.5 -1.7998 2.60059 -3.7002 2.40039
|
49 |
+
c-2 0 -3.5 -1.10059 -3.5 -2.40039c0 -1.5 1.5 -2.59961 3.7002 -2.39941c2 0 3.5 1.09961 3.5 2.39941zM156 95.4004c-0.400391 -1.30078 -2.40039 -1.90039 -4.09961 -1.30078c-1.90039 0.400391 -3.2002 1.90039 -2.80078 3.2002
|
50 |
+
c0.400391 1.2998 2.40039 1.90039 4.10059 1.5c2 -0.599609 3.2998 -2.09961 2.7998 -3.39941zM143.7 100.8c0.899414 0.799805 0.399414 2.7998 -0.900391 4.10059c-1.5 1.5 -3.39941 1.69922 -4.2998 0.599609c-1 -0.900391 -0.599609 -2.7998 0.900391 -4.09961
|
51 |
+
c1.5 -1.5 3.39941 -1.7002 4.2998 -0.600586zM134.6 109.9c1.10059 0.799805 1.10059 2.59961 0 4.09961c-0.899414 1.5 -2.59961 2.2002 -3.69922 1.2998c-1.10059 -0.700195 -1.10059 -2.39941 0 -3.89941c1.09961 -1.5 2.7998 -2.10059 3.69922 -1.5zM128.1 119.6
|
52 |
+
c0.900391 0.700195 0.700195 2.2002 -0.399414 3.5c-1.10059 1 -2.60059 1.5 -3.5 0.600586c-0.900391 -0.700195 -0.700195 -2.2002 0.399414 -3.5c1.10059 -1 2.60059 -1.5 3.5 -0.600586zM121.4 127c0.399414 0.799805 -0.200195 1.90039 -1.5 2.59961
|
53 |
+
c-1.30078 0.5 -2.40039 0.200195 -2.80078 -0.399414c-0.399414 -0.900391 0.200195 -2 1.5 -2.60059c1.10059 -0.699219 2.40039 -0.5 2.80078 0.400391z" />
|
54 |
+
<glyph glyph-name="twitter" unicode="" horiz-adv-x="512"
|
55 |
+
d="M459.37 296.284c0.325195 -4.54785 0.325195 -9.09766 0.325195 -13.6455c0 -138.72 -105.583 -298.558 -298.559 -298.558c-59.4521 0 -114.68 17.2188 -161.137 47.1055c8.44727 -0.973633 16.5684 -1.29883 25.3398 -1.29883
|
56 |
+
c49.0547 0 94.2129 16.5684 130.274 44.832c-46.1318 0.975586 -84.792 31.1885 -98.1123 72.7725c6.49805 -0.974609 12.9951 -1.62402 19.8184 -1.62402c9.4209 0 18.8428 1.2998 27.6133 3.57324c-48.0811 9.74707 -84.1426 51.9795 -84.1426 102.984v1.29883
|
57 |
+
c13.9688 -7.79688 30.2139 -12.6699 47.4307 -13.3184c-28.2637 18.8428 -46.7803 51.0049 -46.7803 87.3906c0 19.4922 5.19629 37.3604 14.2939 52.9541c51.6543 -63.6748 129.3 -105.258 216.364 -109.807c-1.62402 7.79688 -2.59863 15.918 -2.59863 24.04
|
58 |
+
c0 57.8271 46.7822 104.934 104.934 104.934c30.2139 0 57.502 -12.6699 76.6709 -33.1367c23.7148 4.54785 46.4551 13.3193 66.5986 25.3398c-7.79785 -24.3662 -24.3662 -44.833 -46.1318 -57.8271c21.1172 2.27344 41.584 8.12207 60.4258 16.2432
|
59 |
+
c-14.292 -20.791 -32.1611 -39.3086 -52.6279 -54.2529z" />
|
60 |
+
<glyph glyph-name="facebook" unicode="" horiz-adv-x="512"
|
61 |
+
d="M504 192c0 -123.78 -90.6904 -226.38 -209.25 -245v173.31h57.7803l11 71.6904h-68.7803v46.5498c0 19.6104 9.61035 38.7305 40.4102 38.7305h31.2803v61s-28.3809 4.83984 -55.5205 4.83984c-56.6699 0 -93.6699 -34.3301 -93.6699 -96.4805v-54.6396h-63v-71.6904h63
|
62 |
+
v-173.31c-118.56 18.6201 -209.25 121.22 -209.25 245c0 137 111 248 248 248s248 -111 248 -248z" />
|
63 |
+
<glyph glyph-name="github" unicode="" horiz-adv-x="496"
|
64 |
+
d="M165.9 50.5996c0 -2 -2.30078 -3.59961 -5.2002 -3.59961c-3.2998 -0.299805 -5.60059 1.2998 -5.60059 3.59961c0 2 2.30078 3.60059 5.2002 3.60059c3 0.299805 5.60059 -1.2998 5.60059 -3.60059zM134.8 55.0996c0.700195 2 3.60059 3 6.2002 2.30078
|
65 |
+
c3 -0.900391 4.90039 -3.2002 4.2998 -5.2002c-0.599609 -2 -3.59961 -3 -6.2002 -2c-3 0.599609 -5 2.89941 -4.2998 4.89941zM179 56.7998c2.90039 0.299805 5.59961 -1 5.90039 -2.89941c0.299805 -2 -1.7002 -3.90039 -4.60059 -4.60059
|
66 |
+
c-3 -0.700195 -5.59961 0.600586 -5.89941 2.60059c-0.300781 2.2998 1.69922 4.19922 4.59961 4.89941zM244.8 440c138.7 0 251.2 -105.3 251.2 -244c0 -110.9 -67.7998 -205.8 -167.8 -239c-12.7002 -2.2998 -17.2998 5.59961 -17.2998 12.0996
|
67 |
+
c0 8.2002 0.299805 49.9004 0.299805 83.6006c0 23.5 -7.7998 38.5 -17 46.3994c55.8994 6.30078 114.8 14 114.8 110.5c0 27.4004 -9.7998 41.2002 -25.7998 58.9004c2.59961 6.5 11.0996 33.2002 -2.60059 67.9004c-20.8994 6.59961 -69 -27 -69 -27
|
68 |
+
c-20 5.59961 -41.5 8.5 -62.7998 8.5s-42.7998 -2.90039 -62.7998 -8.5c0 0 -48.0996 33.5 -69 27c-13.7002 -34.6006 -5.2002 -61.4004 -2.59961 -67.9004c-16 -17.5996 -23.6006 -31.4004 -23.6006 -58.9004c0 -96.1992 56.4004 -104.3 112.3 -110.5
|
69 |
+
c-7.19922 -6.59961 -13.6992 -17.6992 -16 -33.6992c-14.2998 -6.60059 -51 -17.7002 -72.8994 20.8994c-13.7002 23.7998 -38.6006 25.7998 -38.6006 25.7998c-24.5 0.300781 -1.59961 -15.3994 -1.59961 -15.3994c16.4004 -7.5 27.7998 -36.6006 27.7998 -36.6006
|
70 |
+
c14.7002 -44.7998 84.7002 -29.7998 84.7002 -29.7998c0 -21 0.299805 -55.2002 0.299805 -61.3994c0 -6.5 -4.5 -14.4004 -17.2998 -12.1006c-99.7002 33.4004 -169.5 128.3 -169.5 239.2c0 138.7 106.1 244 244.8 244zM97.2002 95.0996
|
71 |
+
c1.2998 1.30078 3.59961 0.600586 5.2002 -1c1.69922 -1.89941 2 -4.19922 0.699219 -5.19922c-1.2998 -1.30078 -3.59961 -0.600586 -5.19922 1c-1.7002 1.89941 -2 4.19922 -0.700195 5.19922zM86.4004 103.2c0.699219 1 2.2998 1.2998 4.2998 0.700195
|
72 |
+
c2 -1 3 -2.60059 2.2998 -3.90039c-0.700195 -1.40039 -2.7002 -1.7002 -4.2998 -0.700195c-2 1 -3 2.60059 -2.2998 3.90039zM118.8 67.5996c1.2998 1.60059 4.2998 1.30078 6.5 -1c2 -1.89941 2.60059 -4.89941 1.2998 -6.19922
|
73 |
+
c-1.2998 -1.60059 -4.19922 -1.30078 -6.5 1c-2.2998 1.89941 -2.89941 4.89941 -1.2998 6.19922zM107.4 82.2998c1.59961 1.2998 4.19922 0.299805 5.59961 -2c1.59961 -2.2998 1.59961 -4.89941 0 -6.2002c-1.2998 -1 -4 0 -5.59961 2.30078
|
74 |
+
c-1.60059 2.2998 -1.60059 4.89941 0 5.89941z" />
|
75 |
+
<glyph glyph-name="pinterest" unicode="" horiz-adv-x="496"
|
76 |
+
d="M496 192c0 -137 -111 -248 -248 -248c-25.5996 0 -50.2002 3.90039 -73.4004 11.0996c10.1006 16.5 25.2002 43.5 30.8008 65c3 11.6006 15.3994 59 15.3994 59c8.10059 -15.3994 31.7002 -28.5 56.7998 -28.5c74.8008 0 128.7 68.8008 128.7 154.301
|
77 |
+
c0 81.8994 -66.8994 143.199 -152.899 143.199c-107 0 -163.9 -71.7998 -163.9 -150.1c0 -36.4004 19.4004 -81.7002 50.2998 -96.0996c4.7002 -2.2002 7.2002 -1.2002 8.2998 3.2998c0.800781 3.39941 5 20.2998 6.90039 28.0996
|
78 |
+
c0.599609 2.5 0.299805 4.7002 -1.7002 7.10059c-10.0996 12.5 -18.2998 35.2998 -18.2998 56.5996c0 54.7002 41.4004 107.6 112 107.6c60.9004 0 103.6 -41.5 103.6 -100.899c0 -67.1006 -33.8994 -113.601 -78 -113.601c-24.2998 0 -42.5996 20.1006 -36.6992 44.8008
|
79 |
+
c7 29.5 20.5 61.2998 20.5 82.5996c0 19 -10.2002 34.9004 -31.4004 34.9004c-24.9004 0 -44.9004 -25.7002 -44.9004 -60.2002c0 -22 7.40039 -36.7998 7.40039 -36.7998s-24.5 -103.801 -29 -123.2c-5 -21.4004 -3 -51.6006 -0.900391 -71.2002
|
80 |
+
c-92.1992 36.0996 -157.6 125.9 -157.6 231c0 137 111 248 248 248s248 -111 248 -248z" />
|
81 |
+
<glyph glyph-name="pinterest-square" unicode=""
|
82 |
+
d="M448 368v-352c0 -26.5 -21.5 -48 -48 -48h-245.6c9.7998 16.4004 22.3994 40 27.3994 59.2998c3 11.5 15.2998 58.4004 15.2998 58.4004c8 -15.2998 31.4004 -28.2002 56.3008 -28.2002c74.0996 0 127.399 68.0996 127.399 152.7
|
83 |
+
c0 81.0996 -66.2002 141.8 -151.399 141.8c-106 0 -162.2 -71.0996 -162.2 -148.6c0 -36 19.2002 -80.8008 49.7998 -95.1006c4.7002 -2.2002 7.09961 -1.2002 8.2002 3.2998c0.799805 3.40039 5 20.1006 6.7998 27.8008c0.599609 2.5 0.299805 4.59961 -1.7002 7
|
84 |
+
c-10.0996 12.2998 -18.2998 34.8994 -18.2998 56c0 54.1992 41 106.6 110.9 106.6c60.2998 0 102.6 -41.0996 102.6 -99.9004c0 -66.3994 -33.5 -112.399 -77.2002 -112.399c-24.0996 0 -42.0996 19.8994 -36.3994 44.3994c6.89941 29.2002 20.2998 60.7002 20.2998 81.8008
|
85 |
+
c0 53 -75.5 45.6992 -75.5 -25c0 -21.7002 7.2998 -36.5 7.2998 -36.5c-31.4004 -132.801 -36.0996 -134.5 -29.5996 -192.601l2.19922 -0.799805h-88.5996c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48z" />
|
86 |
+
<glyph glyph-name="google-plus-square" unicode=""
|
87 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM164 92c57.7002 0 96 40.5 96 97.5996c0 6.5 -0.599609 11.6006 -1.59961 16.6006h-94.4004v-34.4004h56.9004
|
88 |
+
c-2.40039 -14.5996 -17.2002 -43.0996 -56.8008 -43.0996c-34.0996 0 -61.8994 28.2998 -61.8994 63.2002c0 35 27.7998 63.1992 61.8994 63.1992c19.5 0 32.4004 -8.2998 39.8008 -15.3994l27.0996 26.0996c-17.5 16.4004 -40 26.2002 -67 26.2002
|
89 |
+
c-55.2998 0 -100 -44.7002 -100 -100s44.7002 -100 100 -100zM384 173.8v29.2002h-29v29h-29.2002v-29h-29v-29.2002h29v-29h29.2002v29h29z" />
|
90 |
+
<glyph glyph-name="google-plus-g" unicode="" horiz-adv-x="640"
|
91 |
+
d="M386.061 219.504c1.83398 -9.69238 3.14355 -19.3838 3.14355 -31.9561c0 -109.753 -73.6055 -187.548 -184.404 -187.548c-106.084 0 -192 85.915 -192 192s85.916 192 192 192c51.8643 0 95.083 -18.8594 128.611 -50.292l-52.126 -50.0303
|
92 |
+
c-14.1455 13.6211 -39.0283 29.5996 -76.4854 29.5996c-65.4834 0 -118.92 -54.2217 -118.92 -121.277s53.4365 -121.277 118.92 -121.277c75.9609 0 104.514 54.7451 108.965 82.7734h-108.965v66.0088h181.261v-0.000976562zM571.467 213.067h55.7334v-56.001h-55.7334
|
93 |
+
v-55.7334h-56.001v55.7334h-55.7324v56.001h55.7324v55.7324h56.001v-55.7324z" />
|
94 |
+
<glyph glyph-name="linkedin-in" unicode=""
|
95 |
+
d="M100.28 0h-92.8799v299.1h92.8799v-299.1zM53.79 339.9c-29.7002 0 -53.79 24.5996 -53.79 54.2998c0 29.6914 24.0977 53.79 53.79 53.79s53.79 -24.0986 53.79 -53.79c0 -29.7002 -24.0996 -54.2998 -53.79 -54.2998zM447.9 0h-92.6807v145.6
|
96 |
+
c0 34.7002 -0.700195 79.2002 -48.29 79.2002c-48.29 0 -55.6895 -37.7002 -55.6895 -76.7002v-148.1h-92.7803v299.1h89.0801v-40.7998h1.2998c12.4004 23.5 42.6904 48.2998 87.8799 48.2998c94 0 111.28 -61.8994 111.28 -142.3v-164.3h-0.0996094z" />
|
97 |
+
<glyph glyph-name="github-alt" unicode="" horiz-adv-x="480"
|
98 |
+
d="M186.1 119.3c0 -20.8994 -10.8994 -55.0996 -36.6992 -55.0996c-25.8008 0 -36.7002 34.2002 -36.7002 55.0996c0 20.9004 10.8994 55.1006 36.7002 55.1006c25.7998 0 36.6992 -34.2002 36.6992 -55.1006zM480 169.8c0 -31.8994 -3.2002 -65.7002 -17.5 -95
|
99 |
+
c-37.9004 -76.5996 -142.1 -74.7998 -216.7 -74.7998c-75.7998 0 -186.2 -2.7002 -225.6 74.7998c-14.6006 29 -20.2002 63.1006 -20.2002 95c0 41.9004 13.9004 81.5 41.5 113.601c-5.2002 15.7998 -7.7002 32.3994 -7.7002 48.7998
|
100 |
+
c0 21.5 4.90039 32.2998 14.6006 51.7998c45.2998 0 74.2998 -9 108.8 -36c29 6.90039 58.7998 10 88.7002 10c27 0 54.1992 -2.90039 80.3994 -9.2002c34 26.7002 63 35.2002 107.8 35.2002c9.80078 -19.5 14.6006 -30.2998 14.6006 -51.7998
|
101 |
+
c0 -16.4004 -2.60059 -32.7002 -7.7002 -48.2002c27.5 -32.4004 39 -72.2998 39 -114.2zM415.7 119.3c0 43.9004 -26.7002 82.6006 -73.5 82.6006c-18.9004 0 -37 -3.40039 -56 -6c-14.9004 -2.30078 -29.7998 -3.2002 -45.1006 -3.2002
|
102 |
+
c-15.1992 0 -30.0996 0.899414 -45.0996 3.2002c-18.7002 2.59961 -37 6 -56 6c-46.7998 0 -73.5 -38.7002 -73.5 -82.6006c0 -87.7998 80.4004 -101.3 150.4 -101.3h48.1992c70.3008 0 150.601 13.4004 150.601 101.3zM333.1 174.4
|
103 |
+
c25.8008 0 36.7002 -34.2002 36.7002 -55.1006c0 -20.8994 -10.8994 -55.0996 -36.7002 -55.0996c-25.7998 0 -36.6992 34.2002 -36.6992 55.0996c0 20.9004 10.8994 55.1006 36.6992 55.1006z" />
|
104 |
+
<glyph glyph-name="maxcdn" unicode="" horiz-adv-x="512"
|
105 |
+
d="M461.1 5.2998h-97.3994l51.8994 242.7c2.30078 10.2002 0.900391 19.5 -4.39941 25.7002c-5 6.09961 -13.7002 9.59961 -24.2002 9.59961h-49.2998l-59.5 -278h-97.4004l59.5 278h-83.3994l-59.5 -278h-97.4004l59.5 278l-44.5996 95.4004h372.1
|
106 |
+
c39.4004 0 75.2998 -16.2998 98.2998 -44.9004c23.2998 -28.5996 31.7998 -67.3994 23.6006 -105.899z" />
|
107 |
+
<glyph glyph-name="html5" unicode="" horiz-adv-x="384"
|
108 |
+
d="M0 416h384l-34.9004 -395.8l-157.6 -52.2002l-156.6 52.2002zM308.2 288.1l4.39941 47.7002h-241.1l12.7998 -145.6h166.9l-6 -62.2002l-53.7002 -14.5l-53.5 14.5l-3.5 38.0996h-47.7002l6 -75.7998l98.7002 -27.2998h1.09961v0.299805l97.9004 27l13.5996 148.4h-175.6
|
109 |
+
l-4.09961 49.3994h183.8z" />
|
110 |
+
<glyph glyph-name="css3" unicode="" horiz-adv-x="512"
|
111 |
+
d="M480 416l-64 -368l-223.3 -80l-192.7 80l19.5996 94.7998h82l-8 -40.5996l116.4 -44.4004l134.1 44.4004l18.8008 97.0996h-333.4l16 82h333.7l10.5 52.7002h-333.4l16.2998 82h407.4z" />
|
112 |
+
<glyph glyph-name="btc" unicode="" horiz-adv-x="384"
|
113 |
+
d="M310.204 205.362c46.0059 -11.0283 74.9971 -38.4443 69.3262 -99.8906c-7.24805 -76.5723 -61.5967 -97.0547 -142.896 -101.467v-68.0049h-48.5273v66.7451c-12.29 0 -25.21 0 -38.4443 0.314453v-67.0596h-48.5283v68.0049s-8.88867 0.31543 -97.3701 0.31543
|
114 |
+
l9.76758 57.666c34.7305 -0.614258 50.3301 -3.4209 53.2549 16.0703v217.43c-4.60645 24.5664 -24.709 22.1045 -63.0234 21.4268v51.6777c58.748 -0.275391 79.5283 -0.539062 97.3701 0v79.4092h48.5283v-77.833c12.9189 0.31543 25.8389 0.629883 38.4443 0.629883
|
115 |
+
v77.2031h48.5273v-79.4092c62.3926 -5.35547 109.492 -24.5781 114.851 -81.9287c4.09668 -41.9102 -13.5508 -67.1201 -41.2803 -81.2998zM150.608 313.447v-96.7402c27.416 0 113.126 -6.30273 113.126 48.2119c0 57.0352 -85.7109 48.5283 -113.126 48.5283z
|
116 |
+
M150.608 61.6709c32.7715 0 133.126 -6.93262 133.127 53.2529c0 62.3936 -100.355 53.2549 -133.127 53.2549v-106.508z" />
|
117 |
+
<glyph glyph-name="youtube" unicode="" horiz-adv-x="576"
|
118 |
+
d="M549.655 323.917c11.4121 -42.8672 11.4121 -132.305 11.4121 -132.305s0 -89.4385 -11.4121 -132.306c-6.28125 -23.6494 -24.7871 -41.5 -48.2842 -47.8203c-42.5908 -11.4863 -213.371 -11.4863 -213.371 -11.4863s-170.78 0 -213.371 11.4863
|
119 |
+
c-23.4971 6.32031 -42.0029 24.1709 -48.2842 47.8203c-11.4121 42.8672 -11.4121 132.306 -11.4121 132.306s0 89.4375 11.4121 132.305c6.28125 23.6504 24.7871 42.2754 48.2842 48.5967c42.5908 11.4863 213.371 11.4863 213.371 11.4863s170.781 0 213.371 -11.4863
|
120 |
+
c23.4971 -6.32031 42.0029 -24.9463 48.2842 -48.5967zM232.145 110.409l142.739 81.2012l-142.739 81.2051v-162.406z" />
|
121 |
+
<glyph glyph-name="xing" unicode="" horiz-adv-x="384"
|
122 |
+
d="M162.7 238c-1.7998 -3.2998 -25.2002 -44.4004 -70.1006 -123.5c-4.89941 -8.2998 -10.7998 -12.5 -17.6992 -12.5h-65.1006c-7.7002 0 -12.0996 7.5 -8.5 14.4004l69 121.3c0.200195 0 0.200195 0.0996094 0 0.299805l-43.8994 75.5996
|
123 |
+
c-4.30078 7.80078 0.299805 14.1006 8.5 14.1006h65.0996c7.2998 0 13.2998 -4.10059 18 -12.2002zM382.6 401.9l-144 -253v-0.300781l91.6006 -166.6c3.89941 -7.09961 0.200195 -14.0996 -8.5 -14.0996h-65.2002c-7.59961 0 -13.5996 4 -18 12.1992l-92.4004 168.5
|
124 |
+
c3.30078 5.80078 51.5 90.8008 144.801 255.2c4.59961 8.10059 10.3994 12.2002 17.5 12.2002h65.6992c8 0 12.3008 -6.7002 8.5 -14.0996z" />
|
125 |
+
<glyph glyph-name="xing-square" unicode=""
|
126 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM140.4 127.8c4.89941 0 9.09961 2.90039 12.5996 9.10059c32.0996 56.5 48.7998 85.8994 50.0996 88.1992l-31.8994 55.3008
|
127 |
+
c-3.40039 5.7998 -7.7002 8.69922 -12.9004 8.69922h-46.5996c-5.7998 0 -9 -4.5 -6 -10.0996l31.3994 -54c0.100586 -0.0996094 0.100586 -0.200195 0 -0.200195l-49.2998 -86.7002c-2.7002 -5 0.5 -10.2998 6 -10.2998h46.6006zM360.1 341.9
|
128 |
+
c2.80078 5.2998 -0.299805 10.0996 -6 10h-46.8994c-5.10059 0 -9.2002 -2.90039 -12.5 -8.7002c-66.6006 -117.4 -101.101 -178.2 -103.4 -182.3l66 -120.301c3.2002 -5.7998 7.40039 -8.69922 12.9004 -8.69922h46.5996c6.10059 0 8.7998 5 6 10.0996l-65.5 119v0.200195z
|
129 |
+
" />
|
130 |
+
<glyph glyph-name="dropbox" unicode="" horiz-adv-x="528"
|
131 |
+
d="M264.4 331.7l-132 -84.2998l132 -84.3008l-132 -84.2998l-132.4 85.1006l132.3 84.2998l-132.3 83.5l132.3 84.2998zM131.6 52.2998l132 84.2998l132 -84.2998l-132 -84.2998zM264.4 163.9l132 84.2998l-132 83.5996l131.3 84.2002l132.3 -84.2998l-132.3 -84.2998
|
132 |
+
l132.3 -84.2002l-132.3 -84.2998z" />
|
133 |
+
<glyph glyph-name="stack-overflow" unicode="" horiz-adv-x="384"
|
134 |
+
d="M290.7 137l-8.2002 -39l-195.7 41l8.2002 39.2998zM341.7 224l-25.5 -30.7998l-153.5 128.3l25.5 30.7998zM310.5 184.3l-16.7998 -36.2998l-181.2 84.5l16.7002 36.5zM262 416l119.3 -160.3l-32 -24l-119.3 160.3zM282.5 88v-39.7002h-200v39.7002h200zM322.2 8v120h40
|
135 |
+
v-160h-359.5v160h40v-120h279.5z" />
|
136 |
+
<glyph glyph-name="instagram" unicode=""
|
137 |
+
d="M224.1 307c63.6006 0 114.9 -51.2998 114.9 -114.9c0 -63.5996 -51.2998 -114.899 -114.9 -114.899c-63.5996 0 -114.899 51.2998 -114.899 114.899c0 63.6006 51.2998 114.9 114.899 114.9zM224.1 117.4c41.1006 0 74.7002 33.5 74.7002 74.6992
|
138 |
+
c0 41.2002 -33.5 74.7002 -74.7002 74.7002c-41.1992 0 -74.6992 -33.5 -74.6992 -74.7002c0 -41.1992 33.5996 -74.6992 74.6992 -74.6992zM370.5 311.7c0 -14.9004 -12 -26.7998 -26.7998 -26.7998c-14.9004 0 -26.7998 12 -26.7998 26.7998s12 26.7998 26.7998 26.7998
|
139 |
+
s26.7998 -12 26.7998 -26.7998zM446.6 284.5c2.10059 -37 2.10059 -147.8 0 -184.8c-1.7998 -35.9004 -10 -67.7002 -36.1992 -93.9004c-26.2002 -26.2998 -58 -34.5 -93.9004 -36.2002c-37 -2.09961 -147.9 -2.09961 -184.9 0
|
140 |
+
c-35.8994 1.80078 -67.5996 10 -93.8994 36.2002s-34.5 58 -36.2002 93.9004c-2.09961 37 -2.09961 147.899 0 184.899c1.7998 35.9004 9.90039 67.7002 36.2002 93.9004s58.0996 34.4004 93.8994 36.0996c37 2.10059 147.9 2.10059 184.9 0
|
141 |
+
c35.9004 -1.7998 67.7002 -10 93.9004 -36.1992c26.2998 -26.2002 34.5 -58 36.1992 -93.9004zM398.8 60c11.7002 29.4004 9 99.5 9 132.1c0 32.6006 2.7002 102.601 -9 132.101c-7.89941 19.7002 -23 34.7998 -42.5996 42.5996c-29.4004 11.6006 -99.5 9 -132.101 9
|
142 |
+
c-32.5996 0 -102.6 2.7002 -132.1 -9c-19.7002 -7.89941 -34.7998 -23 -42.5996 -42.5996c-11.6006 -29.4004 -9 -99.5 -9 -132.101c0 -32.5996 -2.7002 -102.6 9 -132.1c7.89941 -19.7002 23 -34.7998 42.5996 -42.5996c29.4004 -11.6006 99.5 -9 132.1 -9
|
143 |
+
c32.6006 0 102.601 -2.7002 132.101 9c19.7002 7.89941 34.7998 23 42.5996 42.5996z" />
|
144 |
+
<glyph glyph-name="flickr" unicode=""
|
145 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM144.5 129c35.0996 0 63.5 28.4004 63.5 63.5s-28.4004 63.5 -63.5 63.5s-63.5 -28.4004 -63.5 -63.5s28.4004 -63.5 63.5 -63.5z
|
146 |
+
M303.5 129c35.0996 0 63.5 28.4004 63.5 63.5s-28.4004 63.5 -63.5 63.5s-63.5 -28.4004 -63.5 -63.5s28.4004 -63.5 63.5 -63.5z" />
|
147 |
+
<glyph glyph-name="adn" unicode="" horiz-adv-x="496"
|
148 |
+
d="M248 280.5l64.9004 -98.7998h-129.801zM496 192c0 -136.9 -111.1 -248 -248 -248s-248 111.1 -248 248s111.1 248 248 248s248 -111.1 248 -248zM396.2 109.3l-148.2 223.2l-148.2 -223.2h30.4004l33.5996 51.7002h168.601l33.5996 -51.7002h30.2002z" />
|
149 |
+
<glyph glyph-name="bitbucket" unicode="" horiz-adv-x="512"
|
150 |
+
d="M22.2002 416l466.8 -0.200195c0.776367 -0.0107422 2.03027 -0.100586 2.7998 -0.200195c7.39648 -1.21875 13.3984 -8.29102 13.3984 -15.7871c0 -0.697266 -0.0888672 -1.82324 -0.198242 -2.5127l-67.9004 -416.8
|
151 |
+
c-1.2168 -7.39746 -8.29004 -13.4014 -15.7871 -13.4014c-0.0585938 0 -0.154297 0.000976562 -0.212891 0.000976562h-325.699c-10.1016 0.0820312 -19.6445 8.23535 -21.3008 18.2002l-67.8994 412.101c-0.0966797 0.769531 -0.186523 2.02344 -0.200195 2.7998
|
152 |
+
c0.108398 8.72168 7.27539 15.8008 15.999 15.8008c0.0556641 0 0.145508 0 0.201172 -0.000976562zM308.1 118.2l25.2002 147h-157.3l28.0996 -147h104z" />
|
153 |
+
<glyph glyph-name="tumblr" unicode="" horiz-adv-x="320"
|
154 |
+
d="M309.8 -32.2998c-13.5996 -14.5 -50 -31.7002 -97.3994 -31.7002c-120.801 0 -147 88.7998 -147 140.6v144h-47.5c-5.5 0 -10 4.5 -10 10v68c0 7.2002 4.5 13.6006 11.2998 16c62 21.8008 81.5 76 84.2998 117.101c0.799805 11 6.5 16.2998 16.0996 16.2998h70.9004
|
155 |
+
c5.5 0 10 -4.5 10 -10v-115.2h83c5.5 0 10 -4.39941 10 -9.89941v-81.7002c0 -5.5 -4.5 -10 -10 -10h-83.4004v-133.2c0 -34.2002 23.7002 -53.5996 68 -35.7998c4.80078 1.89941 9 3.2002 12.7002 2.2002c3.5 -0.900391 5.7998 -3.40039 7.40039 -7.90039l22 -64.2998
|
156 |
+
c1.7998 -5 3.2998 -10.6006 -0.400391 -14.5z" />
|
157 |
+
<glyph glyph-name="tumblr-square" unicode=""
|
158 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM317.7 51.7998c2.2998 2.40039 1.2998 5.90039 0.299805 9.10059l-13.7998 40.1992c-1 2.80078 -2.40039 4.40039 -4.60059 4.90039
|
159 |
+
c-2.39941 0.599609 -5 -0.200195 -8 -1.40039c-27.6992 -11.0996 -42.5 1 -42.5 22.4004v83.2998h52.1006c3.39941 0 6.2002 2.7998 6.2002 6.2002v51.0996c0 3.40039 -2.80078 6.2002 -6.2002 6.2002h-51.9004v72c0 3.40039 -2.7998 6.2002 -6.2002 6.2002h-44.2998
|
160 |
+
c-5.89941 0 -9.5 -3.2998 -10 -10.2002c-1.7998 -25.7002 -13.8994 -59.5 -52.7002 -73.2002c-4.2998 -1.5 -7.09961 -5.5 -7.09961 -10v-42.5c0 -3.39941 2.7998 -6.19922 6.2002 -6.19922h29.7002v-90c0 -32.4004 16.3994 -87.9004 91.8994 -87.9004
|
161 |
+
c29.7002 0 52.4004 10.7002 60.9004 19.7998z" />
|
162 |
+
<glyph glyph-name="apple" unicode="" horiz-adv-x="384"
|
163 |
+
d="M318.7 179.3c0 -1.89941 -3.5 -61.2002 61.7002 -91.8994c-12.2002 -36.8008 -54 -118.601 -102.601 -119.301c-28.0996 0 -44.5996 17.9004 -76.3994 17.9004c-32.8008 0 -50.6006 -17.2998 -75.8008 -17.9004c-48.1992 -1.5 -94.3994 88.5 -107.199 125.2
|
164 |
+
c-9.60059 27.9336 -14.4004 55 -14.4004 81.2002c0 88.7002 59.2998 132.3 115.1 133.2c27 0 61.4004 -19.7002 76.4004 -19.7002c14.2002 0 53 23.5 88.5 20.7002c37.5 -2.90039 65.9004 -17.7002 84.7002 -44.6006c-33.6006 -20.3994 -50.2002 -48.0996 -50 -84.7998z
|
165 |
+
M262.1 343.5c-19.5996 -22.9004 -43.3994 -36.2998 -69.5 -34.2998c-2.19922 27.5996 8.10059 52.0996 25.6006 71.8994c15.8994 18.5 43.7998 33.5 67.8994 34.9004c0.800781 -10.5996 3.30078 -40.0996 -24 -72.5z" />
|
166 |
+
<glyph glyph-name="windows" unicode=""
|
167 |
+
d="M0 354.3l183.6 25.2998v-177.399h-183.6v152.1zM0 29.7002v149.899h183.6v-175.199zM203.8 1.7002v177.899h244.2v-211.6zM203.8 382.3l244.2 33.7002v-213.8h-244.2v180.1z" />
|
168 |
+
<glyph glyph-name="android" unicode=""
|
169 |
+
d="M89.5996 243.5v-115.8c0 -15.4004 -12.0996 -27.7002 -27.5 -27.7002c-15.2998 0 -30.0996 12.4004 -30.0996 27.7002v115.8c0 15.0996 14.7998 27.5 30.0996 27.5c15.1006 0 27.5 -12.4004 27.5 -27.5zM100.4 86.5v179.4h247.3v-179.4
|
170 |
+
c0 -16.4004 -13.2002 -29.5996 -29.4004 -29.5996h-20.2002v-61.1006c0 -36.7998 -55.5 -36.7002 -55.5 0v61.1006h-37.1992v-61.1006c0 -36.5996 -55.2002 -36.8994 -55.2002 0l-0.299805 61.1006h-19.9004c-16.4004 0 -29.5996 13.1992 -29.5996 29.5996zM348.4 275.6
|
171 |
+
h-249.101c0 42.8008 25.6006 80 63.6006 99.4004l-19.1006 35.2998c-2.7998 4.90039 4.2998 8 6.7002 3.7998l19.4004 -35.5996c34.8994 15.5 75 14.7002 108.3 0l19.2998 35.5c2.5 4.2998 9.5 1.09961 6.7002 -3.7998l-19.1006 -35.2002
|
172 |
+
c37.7002 -19.4004 63.3008 -56.5996 63.3008 -99.4004zM177.7 331.1c0 5.7002 -4.60059 10.5 -10.5 10.5c-5.7002 0 -10.2002 -4.7998 -10.2002 -10.5c0 -5.69922 4.59961 -10.5 10.2002 -10.5c5.89941 0 10.5 4.80078 10.5 10.5zM291.1 331.1
|
173 |
+
c0 5.7002 -4.59961 10.5 -10.1992 10.5c-5.90039 0 -10.5 -4.7998 -10.5 -10.5c0 -5.69922 4.59961 -10.5 10.5 -10.5c5.59961 0 10.1992 4.80078 10.1992 10.5zM385.9 271c15.2998 0 30.0996 -12.0996 30.0996 -27.5v-115.8
|
174 |
+
c0 -15.2998 -14.7002 -27.7002 -30.0996 -27.7002c-15.1006 0 -27.5 12.2998 -27.5 27.7002v115.8c0 15.4004 12.3994 27.5 27.5 27.5z" />
|
175 |
+
<glyph glyph-name="linux" unicode=""
|
176 |
+
d="M220.8 324.7c-1.09961 0.599609 -3.09961 0.399414 -3.39941 1.7002c-0.200195 0.399414 0.199219 0.899414 0.599609 1.09961c1.59961 0.900391 3.7998 0.599609 5.5 -0.0996094c1.2998 -0.600586 3.40039 -1.5 3.2002 -2.90039
|
177 |
+
c-0.100586 -1.09961 -1.7998 -1.5 -2.90039 -1.5c-1.2002 0 -2 1.2002 -3 1.7002zM198.9 323c-1 -0.0996094 -2.7002 0.400391 -2.80078 1.40039c-0.199219 1.39941 1.90039 2.2998 3.2002 2.89941c1.7002 0.700195 3.90039 1 5.5 0.100586
|
178 |
+
c0.400391 -0.200195 0.799805 -0.700195 0.600586 -1.10059c-0.400391 -1.2002 -2.40039 -1 -3.5 -1.59961c-1 -0.5 -1.80078 -1.7002 -3 -1.7002zM420 44.2002c11.0996 -12.4004 15.9004 -21.5 15.5 -29.7002c-0.5 -8.2002 -6.5 -13.7998 -13.9004 -18.2998
|
179 |
+
c-14.8994 -9 -37.2998 -15.7998 -50.8994 -32.2002c-14.2002 -16.9004 -31.7002 -26.5996 -48.2998 -27.9004c-16.5 -1.2998 -32 6.30078 -40.3008 23v0.100586c-1.09961 2.09961 -1.89941 4.39941 -2.5 6.7002c-21.5 -1.2002 -40.1992 5.2998 -55.0996 4.09961
|
180 |
+
c-22 -1.2002 -35.7998 -6.5 -48.2998 -6.59961c-4.7998 -10.6006 -14.2998 -17.6006 -25.9004 -20.2002c-16 -3.7002 -36.0996 0 -55.8994 10.3994c-18.5 9.80078 -42 8.90039 -59.3008 12.5c-8.69922 1.80078 -16.2998 5 -20.0996 12.3008
|
181 |
+
c-3.7002 7.2998 -3 17.2998 2.2002 31.6992c1.7002 5.10059 0.399414 12.7002 -0.799805 20.8008c-0.600586 3.89941 -1.2002 7.89941 -1.2002 11.7998c0 4.2998 0.700195 8.5 2.7998 12.3994c4.5 8.5 11.7998 12.1006 18.5 14.5c6.7002 2.40039 12.7998 4 17 8.30078
|
182 |
+
c5.2002 5.5 10.0996 14.3994 16.5996 20.1992c-2.59961 17.2002 0.200195 35.4004 6.2002 53.3008c12.6006 37.8994 39.2002 74.1992 58.1006 96.6992c16.0996 22.9004 20.7998 41.3008 22.5 64.7002c1.09961 31.7998 -24.5 135.4 77.8994 135.2
|
183 |
+
c80.9004 -0.0996094 76.2998 -85.4004 75.7998 -131.3c-0.299805 -30.1006 16.3008 -50.5 33.4004 -72c15.2002 -18 35.0996 -44.2998 46.5 -74.4004c9.2998 -24.5996 12.9004 -51.7998 3.7002 -79.0996c1.39941 -0.5 2.7998 -1.2002 4.09961 -2
|
184 |
+
c1.40039 -0.799805 2.7002 -1.7998 4 -2.90039c6.60059 -5.59961 8.7002 -14.2998 10.5 -22.3994c1.90039 -8.10059 3.60059 -15.7002 7.2002 -19.7002zM223.7 360.7c-3.2002 -7.2002 -3.90039 -14.9004 -2.90039 -21.7998c3.60059 -0.900391 8.90039 -2.40039 13 -4.40039
|
185 |
+
c-2.09961 12.2002 4.5 23.5 11.7998 23c8.90039 -0.299805 13.9004 -15.5 9.10059 -27.2998c-0.799805 -1.90039 -2.7998 -3.40039 -3.90039 -4.60059c6.7002 -2.2998 11 -4.09961 12.6006 -4.89941c7.89941 9.5 10.7998 26.2002 4.2998 40.3994
|
186 |
+
c-9.7998 21.4004 -34.2002 21.8008 -44 -0.399414zM183 372.2c-18.9004 0 -24 -37.5 -8.40039 -52.1006c7.80078 5.7002 6.90039 4.7002 5.90039 5.5c-8 6.90039 -6.59961 27.4004 1.7998 28.1006c6.2998 0.5 10.7998 -10.7002 9.60059 -19.6006
|
187 |
+
c3.09961 2.10059 6.69922 3.60059 10.1992 4.60059c1.7002 19.2998 -9 33.5 -19.0996 33.5zM169.4 311.5c-4.2002 -3.2998 -5.60059 -7.40039 -4.2002 -12.2998c1.5 -4.90039 6.09961 -10.5 14.7002 -15.2998c7.7998 -4.60059 12 -11.5 20 -15
|
188 |
+
c2.59961 -1.10059 5.69922 -1.90039 9.59961 -2.10059c18.4004 -1.09961 27.0996 11.2998 38.2002 14.9004c11.7002 3.7002 20.0996 11 22.7002 18.0996c3.19922 8.5 -2.10059 14.7002 -10.5 18.2002c-11.3008 4.90039 -16.3008 5.2002 -22.6006 9.2998
|
189 |
+
c-10.2998 6.60059 -18.7998 8.90039 -25.8994 8.90039c-14.4004 0 -23.2002 -9.7998 -27.9004 -14.2002c-0.5 -0.5 -7.90039 -5.90039 -14.0996 -10.5zM172.7 -22.5c2.09961 20.5 -31.5 49 -41 68.9004l-19.6006 35.5996c-6.7998 9.2002 -13.7998 14.7998 -21.8994 16
|
190 |
+
c-7.7002 1.2002 -12.6006 -1.40039 -17.7002 -6.90039c-4.7998 -5.09961 -8.7998 -12.2998 -14.2998 -18c-7.7998 -6.5 -9.2998 -6.19922 -19.6006 -9.89941c-6.2998 -2.2002 -11.2998 -4.60059 -14.7998 -11.2998c-2.7002 -5 -2.09961 -12.2002 -0.899414 -20
|
191 |
+
c1.19922 -7.90039 3 -16.3008 0.599609 -23.9004v-0.200195c-5 -13.7002 -5 -21.7002 -2.59961 -26.3994c7.89941 -15.4004 46.5996 -6.10059 76.5 -21.9004c31.3994 -16.4004 72.5996 -17.0996 75.2998 18zM171.3 3.40039c37.6006 -25.7002 82.2002 -15.7002 114.3 7.19922
|
192 |
+
c3.2002 11 6.30078 21.3008 6.80078 29c0.799805 15.2002 1.59961 28.7002 4.39941 39.9004c3.10059 12.5996 9.2998 23.0996 21.4004 27.2998c2.2998 21.1006 18.7002 21.1006 38.2998 12.5c18.9004 -8.5 26 -16 22.7998 -26.0996c1 0 2 0.0996094 4.2002 0
|
193 |
+
c5.2002 16.8994 -14.2998 28 -30.7002 34.7998c2.90039 12 2.40039 24.0996 -0.399414 35.7002c-6 25.2998 -22.6006 47.7998 -35.2002 59c-2.2998 0.0996094 -2.10059 -1.90039 2.59961 -6.5c11.6006 -10.7002 37.1006 -49.2002 23.2998 -84.9004
|
194 |
+
c-3.89941 1 -7.59961 1.5 -10.8994 1.40039c-5.2998 29.0996 -17.5 53.2002 -23.6006 64.5996c-11.5 21.4004 -29.5 65.2998 -37.1992 95.7002c-4.5 -6.40039 -12.4004 -11.9004 -22.3008 -15c-4.69922 -1.5 -9.69922 -5.5 -15.8994 -9
|
195 |
+
c-13.9004 -8 -30 -8.7998 -42.4004 1.2002c-4.5 3.59961 -8 7.59961 -12.5996 10.2998c-1.60059 0.900391 -5.10059 3.2998 -6.2002 4.09961c-2 -37.7998 -27.2998 -85.2998 -39.2998 -112.699c-8.2998 -19.7002 -13.2002 -40.8008 -13.7998 -61.5
|
196 |
+
c-21.8008 29.0996 -5.90039 66.2998 2.59961 82.3994c9.5 17.6006 11 22.5 8.7002 20.7998c-8.60059 -14 -22 -36.2998 -27.2002 -59.1992c-2.7002 -11.9004 -3.2002 -24 0.299805 -35.2002s11.1006 -21.5 24.6006 -29.9004c0 0 24.7998 -14.2998 38.2998 -32.5
|
197 |
+
c7.39941 -10 9.7002 -18.7002 7.39941 -24.8994c-2.5 -6.7002 -9.59961 -8.90039 -16.6992 -8.90039c4.7998 -6 10.2998 -13 14.3994 -19.5996zM428.7 14.9004c0.299805 5.09961 -3.10059 13 -13.7002 24.5996c-10 11.2998 -7.2002 33.0996 -17.0996 41.5996
|
198 |
+
c-6.90039 6 -13.6006 5.40039 -22.6006 5.10059c-7.7002 -8.7998 -25.7998 -19.6006 -38.3994 -16.2998c-11.5 2.89941 -18 16.2998 -18.8008 29.5c-0.299805 -0.200195 -0.699219 -0.300781 -1 -0.5c-7.09961 -3.90039 -11.0996 -10.8008 -13.6992 -21.1006
|
199 |
+
c-2.5 -10.2002 -3.40039 -23.5 -4.2002 -38.7002c-0.700195 -11.7998 -6.2002 -26.3994 -9.90039 -40.5996c-3.5 -13.2002 -5.7998 -25.2002 -1.09961 -36.2998c7.2002 -14.5 19.5 -20.4004 33.7002 -19.2998c14.1992 1.09961 30.3994 9.7998 43.5996 25.5
|
200 |
+
c22 26.5996 62.2998 29.6992 63.2002 46.5zM173.3 299.3c-3.5 2.7998 -3.09961 6.60059 -1.7002 6.5c2.40039 -0.299805 2.80078 -3.5 4.30078 -4.89941c2 -1.90039 4.59961 -4.40039 7.69922 -6.90039c6.2002 -4.90039 14.5 -9.7002 24.9004 -9.7002
|
201 |
+
s22.5 6 29.9004 10.2002c4.19922 2.40039 9.5 6.59961 13.8994 9.7998c3.40039 2.5 3.2002 5.40039 6 5.10059c2.7998 -0.300781 0.799805 -3.2002 -3.09961 -6.60059c-3.90039 -3.39941 -9.90039 -7.7998 -14.7998 -10.3994
|
202 |
+
c-9.30078 -4.90039 -20.2002 -10.8008 -31.8008 -10.8008c-11.5 0 -20.6992 5.40039 -27.2998 10.6006c-3.2998 2.59961 -6 5.2002 -8 7.09961z" />
|
203 |
+
<glyph glyph-name="dribbble" unicode="" horiz-adv-x="512"
|
204 |
+
d="M256 440c136.748 0 248 -111.252 248 -248s-111.252 -248 -248 -248s-248 111.252 -248 248s111.252 248 248 248zM419.97 325.634c-4.46582 -6.04102 -39.9629 -51.5459 -118.284 -83.5225c7.43652 -15.2217 12.8652 -27.5732 18.6172 -41.6143
|
205 |
+
c70.4844 8.86426 140.519 -5.34082 147.502 -6.81836c-0.46582 49.998 -18.332 95.9092 -47.835 131.955zM396.421 350.13c-52.0947 46.2188 -122.885 63.6816 -190.061 47.4893c5.85449 -7.83984 44.3281 -60.2324 79.04 -124.008
|
206 |
+
c75.3232 28.2324 107.211 71.0918 111.021 76.5186zM165.941 383.38c-59.2637 -27.9531 -103.562 -82.585 -117.298 -148.318c9.47461 -0.125 96.7471 -0.503906 195.834 25.8096c-35.0986 62.3926 -72.9512 114.85 -78.5361 122.509zM44.1699 191.677
|
207 |
+
c0 -54.4072 20.624 -104.082 54.457 -141.636c34.3369 58.7793 103.932 120.731 180.531 142.306c-5.31738 12.0342 -11.1104 24.0811 -17.1738 35.9492c-105.786 -31.6592 -208.438 -30.3359 -217.706 -30.1455c-0.0654297 -2.15137 -0.108398 -4.30762 -0.108398 -6.47363
|
208 |
+
zM125.977 24.5645c62.7539 -48.9355 144.656 -56.8955 212.769 -27.8828c-3.15039 18.585 -15.4492 83.3555 -45.1895 160.639c-85.4004 -29.1348 -145.452 -87.5234 -167.579 -132.756zM374.357 16.0752c47.5215 32.1338 81.3525 83.0371 90.7949 141.978
|
209 |
+
c-7.24707 2.28711 -65.5674 19.6816 -131.947 9.05566c27.7061 -76.1367 38.9805 -138.147 41.1523 -151.033z" />
|
210 |
+
<glyph glyph-name="skype" unicode=""
|
211 |
+
d="M424.7 148.2c14.5996 -18.9004 23.2998 -42.5 23.2002 -68.1006c0 -61.7998 -50.2002 -112 -112 -112c-25.6006 0 -49.2002 8.7002 -68.2002 23.3008c-14.1006 -3 -28.9004 -4.7002 -43.7998 -4.7002c-113.4 0 -205.301 91.7998 -205.301 205.3
|
212 |
+
c0 14.9004 1.80078 29.7998 4.7002 43.7998c-14.5996 18.9004 -23.2998 42.5 -23.2998 68.2002c0 61.7998 50.2002 112 112 112c25.7002 0 49.2998 -8.7002 68.2998 -23.4004c14.1006 3 28.9004 4.7002 43.7998 4.7002c113.4 0 205.301 -91.7998 205.301 -205.3
|
213 |
+
c0 -14.9004 -1.80078 -29.7998 -4.7002 -43.7998zM230.1 56.7002c54.9004 0 112 27.3994 112 86.5c0 50.7998 -49.2998 68.2998 -90.6992 77.5996c-48.3008 11.2002 -69.1006 13.2002 -69.1006 33c0 15.5 16.2998 22.5 42 22.5c45.7998 0 46.7002 -33.5 75 -33.5
|
214 |
+
c18.9004 0 30.2998 14.9004 30.2998 31.7998c0 33.5 -55.6992 55.4004 -110.8 55.4004c-50.5 0 -109.1 -21.9004 -109.1 -81.0996c0 -65.2002 55.2998 -71.8008 117.8 -87.2002c26 -6.40039 42 -9.2998 42 -28c0 -14.9004 -16.5996 -26.2998 -42.2998 -26.2998
|
215 |
+
c-54 0 -56.9004 44.8994 -88.1006 44.8994c-20.5 0 -29.5 -14.5996 -29.5 -30.5996c0 -35.7998 54.9004 -65 120.5 -65z" />
|
216 |
+
<glyph glyph-name="foursquare" unicode="" horiz-adv-x="368"
|
217 |
+
d="M323.1 445c40 0 50.7002 -22.7998 42.2002 -65.2002l-48.5996 -243c-3.7002 -14.5 -9.2002 -39.7002 -44.2998 -39.7002h-83.4004c-3.40039 0 -3.7002 0.300781 -6.7998 -3.09961c0 0 -2.2002 -2.5 -131.101 -151.9
|
218 |
+
c-10.0996 -11.6992 -26.6992 -9.59961 -32.8994 -7.09961c-6.10059 2.40039 -18.2002 9.7998 -18.2002 30.0996v433.801c0 17.7998 12.4004 46.0996 49.9004 46.0996h273.199zM306.8 371.2c2.10059 9.7998 -5.2998 17.5 -13.5 17.5h-219
|
219 |
+
c-9.7998 0 -16.5996 -8.90039 -16.5996 -16.6006v-338.8c0 -0.899414 0.899414 -1.2002 1.7998 -0.299805c80.5996 96.9004 89.5 108.3 89.5 108.3c9.2998 10.7998 13 12.6006 26.5 12.6006h73.5c10.0996 0 16 8.59961 16.9004 13.5
|
220 |
+
c0.899414 5 9.59961 49.8994 11.3994 58.7998c1.7998 9 -6.5 18.2002 -14.7998 18.2002h-90.4004c-12 0 -20.5996 8.59961 -20.5996 20.5996v13c0 12 8.59961 20.2998 20.5996 20.2998h106.4c7.40039 0 15.7002 6.7002 16.9004 13.2002z" />
|
221 |
+
<glyph glyph-name="trello" unicode=""
|
222 |
+
d="M392.3 416c30.7998 -0.200195 55.7002 -25.2002 55.6006 -56v-336c0 -30.7998 -24.9004 -55.7998 -55.7002 -56h-336.2c-30.9004 0 -56 25.0996 -56 56c0 340 -0.0996094 336 0 336c0 30.9004 25.0996 56 56.0996 56h336.2zM197 76.7002h0.0996094v254.2
|
223 |
+
c0 14.8994 -12.0996 26.8994 -26.8994 26.8994h-82.9004c-14.8994 0 -26.8994 -12.0996 -26.8994 -26.8994v-254.2c0.0996094 -14.7998 12.1992 -26.7002 27 -26.6006h82.6992c14.8008 0 26.7002 11.9004 26.9004 26.6006zM390.1 188.7v142.1
|
224 |
+
c0 14.9004 -12.0996 26.9004 -26.8994 26.9004h-81.1006c-14.7998 0 -26.7998 -12.1006 -26.7998 -26.9004v-142.1c0 -14.9004 12.1006 -26.9004 26.9004 -26.9004h81c14.8994 0 26.8994 12.1006 26.8994 26.9004z" />
|
225 |
+
<glyph glyph-name="gratipay" unicode="" horiz-adv-x="496"
|
226 |
+
d="M248 440c136.9 0 248 -111.1 248 -248s-111.1 -248 -248 -248s-248 111.1 -248 248s111.1 248 248 248zM362.6 213.6c8.80078 12 19.1006 50.4004 -13.7998 72c-27.7002 18.1006 -54.2002 4.2002 -68.0996 -11.8994c-15.1006 -16.9004 -45.7998 -17.9004 -61.7002 0
|
227 |
+
c-13.9004 16.0996 -40.4004 30 -68.5 11.8994c-32.7002 -21.5996 -22.2998 -60.0996 -13.5996 -72l112.699 -152.699z" />
|
228 |
+
<glyph glyph-name="vk" unicode="" horiz-adv-x="576"
|
229 |
+
d="M545 330.3c-7.40039 -34.2998 -79.2998 -135.5 -79.4004 -135.6c-6.19922 -10 -8.69922 -15 0 -26.2002c3.40039 -4.7998 79.1006 -76.5996 90.3008 -111.5c4.89941 -16.5996 -3.60059 -25 -20.4004 -25h-58.9004c-22.3994 0 -29 17.9004 -69 57.9004
|
230 |
+
c-35 33.6992 -50 38.0996 -58.6992 38.0996c-18.8008 0 -15.4004 -6.2998 -15.4004 -73.0996c0 -14.5 -4.59961 -22.9004 -42.0996 -22.9004c-62.4004 0 -131 37.9004 -179.7 107.8c-73.1006 102.4 -93.1006 179.9 -93.1006 195.5c0 8.7998 3.40039 16.7002 20.2002 16.7002
|
231 |
+
h58.9004c15.0996 0 20.7998 -6.59961 26.5996 -22.9004c28.7998 -84 77.4004 -157.399 97.4004 -157.399c7.5 0 10.8994 3.5 10.8994 22.5v86.7998c-2.19922 40 -23.3994 43.2998 -23.3994 57.5c0 6.5 5.59961 13.5 15 13.5h92.5996
|
232 |
+
c12.4004 0 16.6006 -6.7002 16.6006 -21.7002v-116.7c0 -12.5 5.69922 -16.8994 9.39941 -16.8994c7.5 0 13.7998 4.39941 27.5 18.0996c42.4004 47.4004 72.4004 120.5 72.4004 120.5c3.7002 8.7998 10.5996 16.7002 25.5996 16.7002h58.9004
|
233 |
+
c17.7998 0 21.5 -9.2002 17.7998 -21.7002z" />
|
234 |
+
<glyph glyph-name="weibo" unicode="" horiz-adv-x="512"
|
235 |
+
d="M407 270.4c7.59961 24 -13.4004 46.7998 -37.4004 41.6992c-22 -4.7998 -28.7998 28.1006 -7.09961 32.8008c50.0996 10.8994 92.2998 -37.1006 76.5 -84.8008c-6.7998 -21.1992 -38.7998 -10.7998 -32 10.3008zM214.8 1.2998c-106.3 0 -214.8 51.4004 -214.8 136.3
|
236 |
+
c0 44.3008 28 95.4004 76.2998 143.7c99.7002 99.7002 203.2 100.9 173.601 5.7002c-4 -13.0996 12.2998 -5.7002 12.2998 -6c79.5 33.5996 140.5 16.7998 114 -51.4004c-3.7002 -9.39941 1.09961 -10.8994 8.2998 -13.0996c135.7 -42.2998 34.7998 -215.2 -169.7 -215.2z
|
237 |
+
M358.5 147.6c-5.40039 55.7002 -78.5 94 -163.4 85.7002c-84.7998 -8.59961 -148.8 -60.2998 -143.399 -116c5.39941 -55.7002 78.5 -94 163.399 -85.7002c84.8008 8.60059 148.801 60.3008 143.4 116zM347.9 412.9c102.3 21.5996 189.3 -74.5 157.399 -174.301
|
238 |
+
c-8.2998 -25 -44.7998 -12.1992 -37.3994 12c23.0996 71.2002 -39.4004 139.2 -111.7 124c-25.1006 -5.39941 -34.2002 32.7002 -8.2998 38.3008zM269.4 101.9c-17.1006 -38.8008 -66.8008 -60 -109.101 -46.3008c-40.7998 13.1006 -58 53.4004 -40.2998 89.7002
|
239 |
+
c17.7002 35.4004 63.0996 55.4004 103.4 45.1006c42 -10.8008 63.0996 -50.2002 46 -88.5zM183.1 131.9c-12.8994 5.39941 -30 -0.300781 -38 -12.9004c-8.2998 -12.9004 -4.2998 -28 8.60059 -34c13.0996 -6 30.7998 -0.299805 39.0996 12.9004
|
240 |
+
c8 13.0996 3.7002 28.2998 -9.7002 34zM215.7 145.3c-5.10059 1.7002 -11.4004 -0.599609 -14.2998 -5.39941c-2.90039 -5.10059 -1.40039 -10.6006 3.69922 -12.9004c5.10059 -2 11.7002 0.299805 14.6006 5.40039c2.7998 5.19922 1.09961 10.8994 -4 12.8994z" />
|
241 |
+
<glyph glyph-name="renren" unicode="" horiz-adv-x="512"
|
242 |
+
d="M214 278.9c0 -110.4 -61 -205.4 -147.6 -247.4c-36.4004 43.2998 -58.4004 98.7998 -58.4004 159.9c0 122.699 89.0996 224.399 206 244.1v-156.6zM255 -56c-42.9004 0 -83.2998 11 -118.5 30.4004c57.2002 36.0996 103.4 90.6992 118.5 154.6
|
243 |
+
c15.5 -63.9004 61.7002 -118.5 118.8 -154.7c-35.0996 -19.2998 -75.5 -30.2998 -118.8 -30.2998zM445.6 31.5c-86.5996 42 -147.6 136.9 -147.6 247.4v156.6c116.9 -19.7002 206 -121.4 206 -244.1c0 -61.1006 -22 -116.601 -58.4004 -159.9z" />
|
244 |
+
<glyph glyph-name="pagelines" unicode="" horiz-adv-x="384"
|
245 |
+
d="M384 135.3c-55.0996 -136.7 -187.1 -54 -187.1 -54c-40.5 -81.7998 -107.4 -134.399 -184.601 -134.7c-16.0996 0 -16.5996 24.4004 0 24.4004c64.4004 0.299805 120.5 42.7002 157.2 110.1c-41.0996 -15.8994 -118.6 -27.8994 -161.6 82.2002
|
246 |
+
c109 44.9004 159.1 -11.2002 178.3 -45.5c9.89941 24.4004 17 50.9004 21.5996 79.7002c0 0 -139.7 -21.9004 -149.5 98.0996c119.101 47.9004 152.601 -76.6992 152.601 -76.6992c1.59961 16.6992 3.2998 52.5996 3.2998 53.3994c0 0 -106.3 73.7002 -38.1006 165.2
|
247 |
+
c124.601 -43 61.4004 -162.4 61.4004 -162.4c0.5 -1.59961 0.5 -23.7998 0 -33.3994c0 0 45.2002 89 136.4 57.5c-4.2002 -134 -141.9 -106.4 -141.9 -106.4c-4.40039 -27.3994 -11.2002 -53.3994 -20 -77.5c0 0 83 91.7998 172 20z" />
|
248 |
+
<glyph glyph-name="stack-exchange" unicode=""
|
249 |
+
d="M17.7002 115.7h412.7v-22c0 -37.7002 -29.3008 -68 -65.3008 -68h-19l-86.7998 -89.7002v89.7002h-176.3c-36 0 -65.2998 30.2998 -65.2998 68v22zM17.7002 139.3v85h412.7v-85h-412.7zM17.7002 248.7v85h412.7v-85h-412.7zM365 448
|
250 |
+
c36 0 65.2998 -30.2998 65.4004 -67.7002v-22.2998h-412.7v22.2998c0 37.4004 29.2998 67.7002 65.2998 67.7002h282z" />
|
251 |
+
<glyph glyph-name="vimeo-square" unicode=""
|
252 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM383.8 266.4c1.90039 41.5996 -13.5996 63 -46.5 64c-44.2998 1.39941 -74.3994 -23.6006 -90.0996 -75.1006
|
253 |
+
c19.5996 8.40039 48.5996 10.6006 45.2002 -22.2002c-0.900391 -11.0996 -8.10059 -27.0996 -21.5 -48.2998c-37.2002 -58.7002 -46.3008 -39.0996 -66.8008 90.5c-5.7998 36.5 -21.0996 53.5 -46 51.1006c-22 -2 -57.1992 -38 -94.0996 -70.4004l15 -19.4004
|
254 |
+
c14.2998 10.1006 22.7002 15.1006 25.0996 15.1006c20.8008 0 31.5 -54.1006 56.7002 -146.4c12.9004 -34.3994 28.6006 -51.5996 47.2998 -51.5996c30.1006 0 66.9004 28.2998 110.4 84.7998c42.0996 54.0996 63.9004 96.7998 65.2998 127.9z" />
|
255 |
+
<glyph glyph-name="slack" unicode=""
|
256 |
+
d="M94.1201 132.9c0 -25.9004 -21.1602 -47.0605 -47.0605 -47.0605c-25.8994 0 -47.0596 21.1602 -47.0596 47.0605c0 25.8994 21.1602 47.0596 47.0596 47.0596h47.0605v-47.0596zM117.84 132.9c0 25.8994 21.1602 47.0596 47.0605 47.0596
|
257 |
+
c25.8994 0 47.0596 -21.1602 47.0596 -47.0596v-117.841c0 -25.8994 -21.1602 -47.0596 -47.0596 -47.0596c-25.9004 0 -47.0605 21.1602 -47.0605 47.0596v117.841zM164.9 321.88c-25.9004 0 -47.0605 21.1602 -47.0605 47.0605c0 25.8994 21.1602 47.0596 47.0605 47.0596
|
258 |
+
c25.8994 0 47.0596 -21.1602 47.0596 -47.0596v-47.0605h-47.0596zM164.9 298.16c25.8994 0 47.0596 -21.1602 47.0596 -47.0605c0 -25.8994 -21.1602 -47.0596 -47.0596 -47.0596h-117.841c-25.8994 0 -47.0596 21.1602 -47.0596 47.0596
|
259 |
+
c0 25.9004 21.1602 47.0605 47.0596 47.0605h117.841zM353.88 251.1c0 25.9004 21.1602 47.0605 47.0605 47.0605c25.8994 0 47.0596 -21.1602 47.0596 -47.0605c0 -25.8994 -21.1602 -47.0596 -47.0596 -47.0596h-47.0605v47.0596zM330.16 251.1
|
260 |
+
c0 -25.8994 -21.1602 -47.0596 -47.0605 -47.0596c-25.8994 0 -47.0596 21.1602 -47.0596 47.0596v117.841c0 25.8994 21.1602 47.0596 47.0596 47.0596c25.9004 0 47.0605 -21.1602 47.0605 -47.0596v-117.841zM283.1 62.1201c25.9004 0 47.0605 -21.1602 47.0605 -47.0605
|
261 |
+
c0 -25.8994 -21.1602 -47.0596 -47.0605 -47.0596c-25.8994 0 -47.0596 21.1602 -47.0596 47.0596v47.0605h47.0596zM283.1 85.8398c-25.8994 0 -47.0596 21.1602 -47.0596 47.0605c0 25.8994 21.1602 47.0596 47.0596 47.0596h117.841
|
262 |
+
c25.8994 0 47.0596 -21.1602 47.0596 -47.0596c0 -25.9004 -21.1602 -47.0605 -47.0596 -47.0605h-117.841z" />
|
263 |
+
<glyph glyph-name="wordpress" unicode="" horiz-adv-x="512"
|
264 |
+
d="M61.7002 278.6l101.5 -278c-71 34.4004 -119.9 107.2 -119.9 191.4c0 30.9004 6.60059 60.0996 18.4004 86.5996zM399.6 202.7c0 -18.2002 -7 -39.2998 -16 -68.7002l-21.1992 -70.9004l-76.9004 228.7c12.7998 0.700195 24.2998 2 24.2998 2
|
265 |
+
c11.4004 1.2998 10.1006 18.2002 -1.39941 17.5c0 0 -34.5 -2.7002 -56.7002 -2.7002c-20.9004 0 -56 2.7002 -56 2.7002c-11.4004 0.700195 -12.7998 -16.7998 -1.2998 -17.5c0 0 10.7998 -1.2998 22.2998 -2l33.0996 -90.7998l-46.5996 -139.6l-77.5 230.399
|
266 |
+
c12.7998 0.700195 24.2998 2 24.2998 2c11.4004 1.2998 10.0996 18.2002 -1.40039 17.5c0 0 -34.5 -2.7002 -56.6992 -2.7002c-4 0 -8.7002 0.100586 -13.7002 0.300781c38.0996 57.7998 103.5 95.8994 177.8 95.8994c55.4004 0 105.8 -21.2002 143.7 -55.8994
|
267 |
+
c-1 0.0996094 -1.90039 0.199219 -2.7998 0.199219c-20.9004 0 -35.7002 -18.1992 -35.7002 -37.7998c0 -17.5 10.0996 -32.3994 20.8994 -49.8994c8.10059 -14.2002 17.5 -32.4004 17.5 -58.7002zM259.7 173.4l65.3994 -179.2c0.400391 -1 0.900391 -2 1.5 -2.90039
|
268 |
+
c-22.0996 -7.7998 -45.7998 -12.0996 -70.5996 -12.0996c-20.9004 0 -41 3.09961 -60.0996 8.7002zM442.7 294.1c16.5996 -30.2998 26 -65.0996 26 -102.1c0 -78.5 -42.5 -147 -105.8 -183.9l65 187.9c12.1992 30.4004 16.1992 54.5996 16.1992 76.2002
|
269 |
+
c0 7.89941 -0.5 15.0996 -1.39941 21.8994zM504 192c0 -136.8 -111.3 -248 -248 -248c-136.8 0 -248 111.3 -248 248c0 136.8 111.2 248 248 248c136.7 0 248 -111.2 248 -248zM492.6 192c0 130.5 -106.199 236.6 -236.6 236.6c-130.5 0 -236.6 -106.1 -236.6 -236.6
|
270 |
+
s106.199 -236.6 236.6 -236.6c130.5 0 236.6 106.1 236.6 236.6z" />
|
271 |
+
<glyph glyph-name="openid" unicode=""
|
272 |
+
d="M271.5 16l-68 -32c-115 10.2998 -203.5 71.5 -203.5 145.8c0 71.5 82.5 131 191.7 144.3v-43c-71.5 -12.5 -124 -53 -124 -101.3c0 -51 58.5 -93.2998 135.7 -103v340l68 33.2002v-384h0.0996094zM448 157l-131.3 28.5l36.7998 20.7002c-19.5 11.5 -43.5 20 -70 24.7998
|
273 |
+
v43c46.2002 -5.5 87.7002 -19.5 120.3 -39.2998l35 19.7998z" />
|
274 |
+
<glyph glyph-name="yahoo" unicode=""
|
275 |
+
d="M252 156l4 -220c-12.7002 2.2002 -23.5 3.90039 -32.2998 3.90039c-8.40039 0 -19.2002 -1.7002 -32.2998 -3.90039l4 220c-55 94.7998 -110.4 196.8 -174 292c11.8994 -3.09961 23 -3.90039 33.1992 -3.90039c9 0 20.4004 0.800781 34.1006 3.90039
|
276 |
+
c40.8994 -72.2002 82.0996 -138.7 135 -225.5c37.2998 61.5996 91.0996 144.1 134.899 225.5c11.1006 -2.90039 22 -3.90039 32.9004 -3.90039c11.5 0 23.2002 1 35 3.90039c-34.4004 -47.9004 -131.6 -216.9 -174.5 -292z" />
|
277 |
+
<glyph glyph-name="google" unicode="" horiz-adv-x="488"
|
278 |
+
d="M488 186.2c0 -141.5 -96.9004 -242.2 -240 -242.2c-137.2 0 -248 110.8 -248 248s110.8 248 248 248c66.7998 0 123 -24.5 166.3 -64.9004l-67.5 -64.8994c-88.2998 85.2002 -252.5 21.2002 -252.5 -118.2c0 -86.5 69.1006 -156.6 153.7 -156.6
|
279 |
+
c98.2002 0 135 70.3994 140.8 106.899h-140.8v85.2998h236.1c2.30078 -12.6992 3.90039 -24.8994 3.90039 -41.3994z" />
|
280 |
+
<glyph glyph-name="reddit" unicode="" horiz-adv-x="512"
|
281 |
+
d="M201.5 142.5c-13.7998 0 -24.9004 11.0996 -24.9004 24.5996c0 13.8008 11.1006 24.9004 24.9004 24.9004c13.5996 0 24.5996 -11.0996 24.5996 -24.9004c0 -13.5996 -11.0996 -24.5996 -24.5996 -24.5996zM504 192c0 -137 -111 -248 -248 -248s-248 111 -248 248
|
282 |
+
s111 248 248 248s248 -111 248 -248zM371.7 233.2c-9.40039 0 -17.7002 -3.90039 -23.7998 -10c-22.4004 15.5 -52.6006 25.5 -86.1006 26.5996l17.4004 78.2998l55.3994 -12.5c0 -13.5996 11.1006 -24.5996 24.6006 -24.5996c13.7998 0 24.8994 11.2998 24.8994 24.9004
|
283 |
+
c0 13.5996 -11.0996 24.8994 -24.8994 24.8994c-9.7002 0 -18 -5.7998 -22.1006 -13.7998l-61.1992 13.5996c-3 0.800781 -6.10059 -1.39941 -6.90039 -4.39941l-19.0996 -86.4004c-33.2002 -1.39941 -63.1006 -11.2998 -85.5 -26.7998
|
284 |
+
c-6.10059 6.40039 -14.7002 10.2002 -24.1006 10.2002c-34.8994 0 -46.2998 -46.9004 -14.3994 -62.7998c-1.10059 -5 -1.7002 -10.2002 -1.7002 -15.5c0 -52.6006 59.2002 -95.2002 132 -95.2002c73.0996 0 132.3 42.5996 132.3 95.2002
|
285 |
+
c0 5.2998 -0.599609 10.7998 -1.90039 15.7998c31.3008 16 19.8008 62.5 -14.8994 62.5zM302.8 117c2.2002 2.2002 6.10059 2.2002 8.2998 0c2.5 -2.5 2.5 -6.40039 0 -8.59961c-22.8994 -22.8008 -87.3994 -22.8008 -110.199 0c-2.5 2.19922 -2.5 6.09961 0 8.59961
|
286 |
+
c2.19922 2.2002 6.09961 2.2002 8.2998 0c17.5 -17.9004 75.3994 -18.2002 93.5996 0zM310.5 192c13.9004 0 24.9004 -11.0996 24.9004 -24.9004c0 -13.5 -11.1006 -24.5996 -24.9004 -24.5996c-13.5 0 -24.5996 11 -24.5996 24.5996c0 13.8008 11 24.9004 24.5996 24.9004z
|
287 |
+
" />
|
288 |
+
<glyph glyph-name="reddit-square" unicode=""
|
289 |
+
d="M283.2 102.5c2.7002 -2.7002 2.7002 -6.7998 0 -9.2002c-24.5 -24.5 -93.7998 -24.5996 -118.4 0c-2.7002 2.40039 -2.7002 6.5 0 9.2002c2.40039 2.40039 6.5 2.40039 8.90039 0c18.7002 -19.2002 81 -19.5996 100.5 0c2.39941 2.2998 6.59961 2.2998 9 0zM191.9 156.3
|
290 |
+
c0 -14.5996 -11.9004 -26.5 -26.5 -26.5c-14.9004 0 -26.8008 11.9004 -26.8008 26.5c0 14.9004 11.9004 26.7998 26.8008 26.7998c14.5996 0 26.5 -11.8994 26.5 -26.7998zM282.6 183.1c14.9004 0 26.8008 -11.8994 26.8008 -26.7998
|
291 |
+
c0 -14.5996 -11.9004 -26.5 -26.8008 -26.5c-14.5996 0 -26.5 11.9004 -26.5 26.5c0 14.9004 11.9004 26.7998 26.5 26.7998zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM348.3 227.4
|
292 |
+
c-10.0996 0 -19 -4.2002 -25.5996 -10.7002c-24.1006 16.7002 -56.5 27.3994 -92.5 28.5996l18.7002 84.2002l59.5 -13.4004c0 -14.5996 11.8994 -26.5 26.5 -26.5c14.8994 0 26.7998 12.2002 26.7998 26.8008c0 14.5996 -11.9004 26.7998 -26.7998 26.7998
|
293 |
+
c-10.4004 0 -19.3008 -6.2002 -23.8008 -14.9004l-65.6992 14.6006c-3.30078 0.899414 -6.5 -1.5 -7.40039 -4.80078l-20.5 -92.7998c-35.7002 -1.5 -67.7998 -12.2002 -91.9004 -28.8994c-6.5 6.7998 -15.7998 11 -25.8994 11c-37.5 0 -49.7998 -50.4004 -15.5 -67.5
|
294 |
+
c-1.2002 -5.40039 -1.7998 -11 -1.7998 -16.7002c0 -56.5 63.6992 -102.3 141.899 -102.3c78.5 0 142.2 45.7998 142.2 102.3c0 5.7002 -0.599609 11.5996 -2.09961 17c33.5996 17.2002 21.1992 67.2002 -16.1006 67.2002z" />
|
295 |
+
<glyph glyph-name="stumbleupon-circle" unicode="" horiz-adv-x="496"
|
296 |
+
d="M256 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM256 262.5c9.7998 0 17.7998 -8 17.7002 -17.5996v-20.6006l22.8994 -10.7002l34.1006 10.1006v23.7002c0 40.2998 -34 72.5996 -74.7002 72.5996
|
297 |
+
c-40.5 0 -74.7002 -32.0996 -74.7002 -72.0996v-108.4c0 -9.90039 -8 -17.7998 -17.7998 -17.7998s-17.7998 7.7998 -17.7998 17.7998v45.7998h-57.2998v-46.5c0 -41.3994 33.5 -74.8994 74.8994 -74.8994c41 0 74.9004 33 74.9004 73.8994v106.9
|
298 |
+
c0 9.7998 8 17.7998 17.7998 17.7998zM423.6 138.9c0 0 0 0.5 0.100586 46.3994h-57.2998v-48c0 -9.7002 -8 -17.5996 -17.8008 -17.5996c-9.7998 0 -17.7998 7.7998 -17.7998 17.5996v47.1006l-34.0996 -10.1006l-22.9004 10.7002v-46.7998
|
299 |
+
c0 -41 33.7002 -74.2002 74.9004 -74.2002c41.3994 0 74.8994 33.5 74.8994 74.9004z" />
|
300 |
+
<glyph glyph-name="stumbleupon" unicode="" horiz-adv-x="512"
|
301 |
+
d="M502.9 182v-69.7002c0 -62.0996 -50.3008 -112.399 -112.4 -112.399c-61.7998 0 -112.4 49.7998 -112.4 111.3v70.2002l34.3008 -16l51.0996 15.1992v-70.5996c0 -14.7002 12 -26.5 26.7002 -26.5s26.7998 11.7998 26.7998 26.5v72h85.9004zM278.2 240.2v30.8994
|
302 |
+
c0 14.7002 -12 26.7002 -26.7002 26.7002s-26.7002 -12 -26.7002 -26.7002v-160.3c0 -61.2998 -50.7998 -110.8 -112.399 -110.8c-62.1006 0 -112.4 50.2998 -112.4 112.3v69.7002h86v-68.5996c0 -14.9004 12 -26.7002 26.7002 -26.7002s26.7002 11.7998 26.7002 26.7002
|
303 |
+
v162.399c0 60 51.2998 108.2 112.1 108.2c61 0 112.1 -48.5 112.1 -109v-35.5996l-51.0996 -15.2002z" />
|
304 |
+
<glyph glyph-name="delicious" unicode=""
|
305 |
+
d="M446.5 380c1 -3.7998 1.5 -7.90039 1.59961 -12v-352.1c0 -26.5 -21.5 -48 -48 -48h-352c-4.09961 0 -8.19922 0.5 -12 1.5c-7.69922 2 -14.5996 5.7998 -20.2998 11c-1.2002 1.09961 -2.2998 2.19922 -3.2998 3.2998c-5.2002 5.7002 -9 12.5996 -11 20.2998
|
306 |
+
c-1 3.7998 -1.5 7.90039 -1.5 12v352c0 26.5 21.5 48 48 47.9004h352c4.09961 0 8.2002 -0.5 12 -1.5c1.90039 -0.400391 3.7002 -1 5.40039 -1.7002c1.89941 -0.700195 3.69922 -1.5 5.5 -2.5c1.39941 -0.700195 2.69922 -1.5 4 -2.40039
|
307 |
+
c1.09961 -0.799805 2.19922 -1.59961 3.2998 -2.5c2.5 -2 4.7998 -4.2998 6.89941 -6.7998c1.7002 -2.09961 3.30078 -4.5 4.7002 -6.90039c1.2998 -2.2998 2.40039 -4.59961 3.2998 -7.09961c0.5 -1.5 1 -3 1.40039 -4.5zM416 16v176h-192v192h-176
|
308 |
+
c-8.7998 0 -16 -7.2002 -16 -16v-176h192v-192h176c8.7998 0 16 7.2002 16 16z" />
|
309 |
+
<glyph glyph-name="digg" unicode="" horiz-adv-x="512"
|
310 |
+
d="M81.7002 275.7v76.2998h51v-250.7h-132.7v174.4h81.7002zM81.7002 142.3v92.2998h-30.7998v-92.2998h30.7998zM378.9 275.7h133.1v-243.7h-133.1v40.7998h81.7998v28.5h-81.7998v174.4zM460.7 142.3v92.2998h-30.7998v-92.2998h30.7998zM225.1 101.3v174.4h133.301
|
311 |
+
v-243.7h-133.301v40.7998h82.1006v28.5h-82.1006zM276.3 234.6v-92.2998h30.7998v92.2998h-30.7998zM153.3 352h51.2998v-51h-51.2998v51zM153.3 275.7h51.2998v-174.4h-51.2998v174.4z" />
|
312 |
+
<glyph glyph-name="pied-piper-pp" unicode=""
|
313 |
+
d="M205.3 273.4c0 -21.1006 -14.2002 -38.1006 -31.7002 -38.1006c-7.09961 0 -12.7998 1.2002 -17.1992 3.7002v68c4.39941 2.7002 10.0996 4.2002 17.1992 4.2002c17.5 0 31.7002 -16.9004 31.7002 -37.7998zM257.9 206.4c17.3994 0 31.6992 -17 31.6992 -38.1006
|
314 |
+
c0 -20.8994 -14.2998 -37.7998 -31.6992 -37.7998c-7.10059 0 -12.8008 1.2002 -17.2002 3.7002v68c4.39941 2.7002 10.0996 4.2002 17.2002 4.2002zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352
|
315 |
+
c26.5 0 48 -21.5 48 -48zM185 192.9c41 0 74.2002 35.5996 74.2002 79.5996s-33.2002 79.5996 -74.2002 79.5996c-12 0 -24.0996 -3.19922 -34.5996 -8.7998h-45.7002v-206.3l51.7998 10.0996v50.6006c8.59961 -3.10059 18.0996 -4.7998 28.5 -4.7998zM343.4 167.6
|
316 |
+
c0 44 -33.2002 79.6006 -73.9004 79.6006c-3.2002 0 -6.40039 -0.200195 -9.59961 -0.700195c-3.7002 -12.5 -10.1006 -23.7998 -19.2002 -33.4004c-13.7998 -15 -32.2002 -23.7998 -51.7998 -24.7998v-156.3l51.7998 10.0996v50.6006
|
317 |
+
c8.59961 -3.2002 18.2002 -4.7002 28.7002 -4.7002c40.7998 0 74 35.5996 74 79.5996z" />
|
318 |
+
<glyph glyph-name="pied-piper-alt" unicode="" horiz-adv-x="576"
|
319 |
+
d="M244 202l-27.7002 -5.7002l-1.7002 4.90039c6.7002 0.5 12.7002 3.7002 19.3008 3.7002c3.7998 0 6.89941 -0.900391 10.0996 -2.90039zM379.9 4.09961c9.5 0 28.1992 -45.0996 33 -55.0996c-35.9004 -13.4004 -70.3008 -15.9004 -106 -9.7998l-6.90039 45.0996
|
320 |
+
c15.7998 10.2998 60.9004 19.7998 79.9004 19.7998zM340.8 271c-7.59961 3.5 -63.8994 6.40039 -98.7998 -10c6.2998 11.7998 13.2002 17 25.9004 21.7998c27.2998 10.2998 40.1992 30.5 58.8994 51.1006c11.9004 -8.40039 12 -24.6006 31.6006 -23v-21.8008
|
321 |
+
l6.2998 -0.299805c37.3994 14.4004 74.7002 30.2002 106.6 54.6006c48.2998 36.7998 52.9004 50 81.2998 100l2 2.59961c-0.599609 -14.0996 -6.2998 -27.2998 -12.3994 -39.9004c-30.5 -63.7998 -78.7002 -100.3 -146.8 -116.699
|
322 |
+
c-12.4004 -2.90039 -26.4004 -3.2002 -37.6006 -8.90039c1.40039 -9.7998 13.2002 -18.0996 13.2002 -23c0 -3.40039 -5.5 -7.2002 -7.5 -8.59961c-11.2002 12.8994 -16.0996 19.2998 -22.7002 22.0996zM555.5 448l-0.299805 -1.40039l-0.600586 -0.599609
|
323 |
+
l0.300781 0.900391zM496.3 65.9004c20.1006 -34.2002 43.7002 -54.3008 72.7002 -79.9004c-31 -19.2998 -70.4004 -32.2002 -103.5 -47.2002c-55.2002 46.2998 -23 229.9 -111.5 229.9c-3.5 -0.700195 -2.40039 -0.299805 -4.59961 -1.7002
|
324 |
+
c1.09961 -1.40039 2.59961 -2.90039 3.69922 -4c23.9004 -20.0996 33.4004 -24.4004 34.8008 -58.5996l0.299805 -9.5c0.799805 -21.6006 -5.5 -42.5 -9.7998 -63.5c-25.9004 0.699219 -51.2002 -11 -77.9004 -2.90039c-0.700195 5.90039 -1.09961 30.9004 0.299805 41.0996
|
325 |
+
c1.40039 9.5 33.6006 29.9004 33 43.7002c-5.5 0.600586 -9.2002 -2.59961 -12.3994 -6.89941c-13.3008 -19.5 -47.2002 -41.9004 -71.3008 -41.9004c-16.5996 0 -56.2998 71.5 -76.3994 85.9004c-3.2002 2.2998 -5.2002 5.39941 -7.7998 8.59961
|
326 |
+
c-16.1006 -3.7998 -139.4 -32.2002 -147.4 -32.2002c-6 0 -11.5 4.90039 -11.5 10.9004c0 5.5 3.40039 10.7002 8.90039 11.7998l139.6 30.4004c-9.5 17.1992 12.2998 17.5 21.5 20.0996c3.2002 0.799805 6.2998 4 9.5 4c6.2998 0 11.7998 -8.90039 13.7998 -14.0996
|
327 |
+
c6.2998 1.39941 45.7002 10.5996 49.4004 10.5996c15.2002 0 15.8994 -20.0996 2.89941 -22.7002l-52.2998 -11.5l-0.299805 -4.59961c-0.299805 -10.1006 45.4004 -60.1006 53.4004 -60.1006c18.0996 0 54.8994 41.7002 54.8994 60.1006
|
328 |
+
c0 30.7002 -42.7998 12.5996 -42.7998 33.5996c0 3.5 1.2002 6.60059 2.90039 9.7998l-19.5 5.5c13.0996 13.6006 13.7998 31.7002 10.8994 50.3008c14.7002 2.89941 26.7002 4.59961 41.4004 4.59961c56.8994 0 45.7002 -8.59961 65.5 -54.2998l14.3994 7.2002
|
329 |
+
c-2.2998 -34.2002 -36.1992 -17.5 -35.0996 -31l0.299805 -6c74.7002 2.89941 116.101 -58.6006 150 -115.5zM300.1 19.7998h8.90039l2.90039 -23.7998l-11.8008 -3.40039v27.2002zM231.4 170.2l13.7998 3.5l31.2998 -50.9004l-21 -13.7998zM315.8 15.2998
|
330 |
+
c22.6006 2.5 32.7002 6.2998 59.5 6.2998c0.299805 -1.39941 0.900391 -3.19922 0.900391 -4.59961c0 -7.5 -49.4004 -12.5996 -58.4004 -14.0996z" />
|
331 |
+
<glyph glyph-name="drupal" unicode=""
|
332 |
+
d="M319.5 333.3c13.5 -8.2998 96.5 -67 96.5 -179.3c0 -112 -88.5 -186 -190.2 -186c-102 0 -193.8 80.2998 -193.8 189.5c0 109 85 167.5 100.8 175.8c18.7002 10.1006 32.2002 15.2998 53.5 32.2998c10.5 8.30078 19.2998 20.2002 22 49.5
|
333 |
+
c15.2002 -18.2998 33.5 -39.5 46.5 -48.2998c21.2002 -14 42.5 -19.5 64.7002 -33.5zM322 7.7002c4.2002 4.2002 1.90039 13.0996 -4.2002 8.5c-8.5 -6.2998 -27.5 -14 -54.5 -14c-34.5 0 -51.5 13.2998 -51.5 13.2998c-6.2002 0 -11.2998 -7.2002 -6.5 -12
|
334 |
+
c26.6006 -24.5 96.6006 -15.9004 116.7 4.2002zM267.5 60.2998c-6.5 -2.7002 -28.4004 -16.7998 -22.4004 -25c2.40039 -3.2998 5.2002 -1.2998 12.2002 4.7002c7.2002 5.7998 12 11 26.7002 11c25.2998 0 18.0996 -19.9004 26.5 -15.7002
|
335 |
+
c9.90039 4.90039 -2.09961 20.9004 -6.2002 23.7002c-7.7998 5.09961 -28.0996 4.90039 -36.7998 1.2998zM360 43c39.0996 -3.2998 64.5 106 15.7998 106c-20 0 -60.5 -41.5 -81.7998 -41.7998c-24.7002 -0.5 -59 49 -108.5 48.5
|
336 |
+
c-66.4004 -0.400391 -90.5996 -78.6006 -51.7998 -105.2c57.2002 -38.7002 130.399 42.9004 161.3 42c19.5 -0.700195 49.7998 -48.5 65 -49.5z" />
|
337 |
+
<glyph glyph-name="joomla" unicode=""
|
338 |
+
d="M0.599609 355.9c0 33.2998 26.8008 60.0996 59.8008 60.0996c30 0 54.5 -21.9004 59.1992 -50.2002c32.6006 7.60059 67.1006 -0.599609 96.5 -30l-44.2998 -44.2998c-20.5 20.5 -42.5996 16.2998 -55.3994 3.5c-14.3008 -14.2998 -14.3008 -37.9004 0 -52.2002
|
339 |
+
l99.5 -99.5l-44 -44.2998c-87.7002 87.2002 -49.7002 49.7002 -99.8008 99.7002c-26.7998 26.5 -35 64.7998 -24.7998 98.8994c-26.8994 5.80078 -46.7002 29.7002 -46.7002 58.3008zM130.1 239.5c28.5 28.4004 81.3008 80.7998 99.6006 99.9004
|
340 |
+
c26.5996 26.5996 64.5 35 98.2998 25.0996c4.09961 29.0996 29.2002 51.5996 59.5 51.5996c33 0 59.7998 -26.8994 59.7998 -60.0996c0 -30.2998 -22.7002 -55.4004 -51.8994 -59.5c9.59961 -33.5996 2.2998 -70 -28.9004 -101.2l-44 44.2998
|
341 |
+
c20.5 20.4004 16.2998 42.6006 3.5 55.4004c-14.2998 14.2998 -37.5996 14.2998 -51.9004 0c-10 -10.0996 -89.6992 -89.7998 -99.6992 -99.7998zM396.4 87.2998c29.0996 -4.09961 51.5996 -28.8994 51.5996 -59.0996c0 -33.2998 -26.7998 -60.1006 -59.7998 -60.1006
|
342 |
+
c-29.2002 0 -53.4004 20.7002 -58.9004 48.1006c-34.7002 -10.7998 -75.0996 -2.2002 -102.7 28l44 44.2998c20.4004 -20.5 42.6006 -16.2998 55.4004 -3.5c14.2998 14.2998 14.2998 37.5996 0 51.9004l-99.7002 99.6992l44.2998 44.3008
|
343 |
+
c104.5 -104.4 87.7002 -87.5 99.5 -99.7002c25.4004 -25.4004 34.5 -61.2002 26.3008 -93.9004zM312.1 140.4c-87.2998 -87.3008 -67.3994 -67.7002 -99.5 -99.7002c-25.6992 -25.4004 -61.5 -34.2002 -94.1992 -26c-6.10059 -26.9004 -30 -46.7002 -58.6006 -46.7002
|
344 |
+
c-33 0 -59.7998 26.7998 -59.7998 60.0996c0 28.3008 19.5 52.2002 46.2002 58.2002c-8.5 33.1006 -0.700195 68.1006 29.5 98.2998l44 -44.2998c-20.1006 -20.0996 -16.2998 -42 -3.2002 -55.3994c14.2998 -14.3008 37.5996 -14.3008 51.9004 0
|
345 |
+
c49.2998 49.3994 12.6992 13.3994 99.6992 99.7998z" />
|
346 |
+
<glyph glyph-name="behance" unicode="" horiz-adv-x="576"
|
347 |
+
d="M232 210.8c43.5996 -12.2998 64.7002 -45.2002 64.7002 -89.7002c0 -72 -60.5 -102.899 -124.9 -102.899h-171.8v354.399h167.1c60.7002 0 113.301 -17.1992 113.301 -87.7998c0 -35.7998 -16.6006 -58.7998 -48.4004 -74zM77.9004 312.1v-82.6992h79
|
348 |
+
c27.7998 0 47.5 12.0996 47.5 42.1992c0 32.6006 -25.3008 40.5 -53.4004 40.5h-73.0996zM161.2 78.4004c31.7002 0 57.5996 11.1992 57.5996 47c0 36.2998 -21.7002 50.5996 -56 50.5996h-84.8994v-97.5996h83.2998zM519.7 319.1h-143.7v34.9004h143.7v-34.9004zM576 142.8
|
349 |
+
c0 -4.5 -0.299805 -9 -0.599609 -13.2002h-185.101c0 -41.0996 21.7002 -65.2998 63 -65.2998c21.4004 0 49 11.6006 55.7002 33.5h62.2002c-19.1006 -58.7002 -58.7998 -86.2998 -120.101 -86.2998c-81 0 -131.3 54.7998 -131.3 134.7c0 77 53.1006 135.8 131.3 135.8
|
350 |
+
c80.5 0 124.9 -63.2998 124.9 -139.2zM390.4 174h114.699c-3 34 -20.7998 54.7998 -56.1992 54.7998c-33.8008 0 -56.2002 -21.0996 -58.5 -54.7998z" />
|
351 |
+
<glyph glyph-name="behance-square" unicode=""
|
352 |
+
d="M186.5 155c0 -19.2998 -14 -25.4004 -31.2002 -25.4004h-45.0996v52.9004h46c18.5996 -0.0996094 30.2998 -7.7998 30.2998 -27.5zM178.8 237.3c0 -16.2998 -10.7002 -22.8994 -25.7998 -22.8994h-42.7002v44.7998h39.6006c15.1992 0 28.8994 -4.2002 28.8994 -21.9004z
|
353 |
+
M311.1 214.1c19.2002 0 28.8008 -11.1992 30.5 -29.6992h-62.1992c1.19922 18.2998 13.3994 29.6992 31.6992 29.6992zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM271.7 263h77.7998
|
354 |
+
v18.9004h-77.7998v-18.9004zM228.7 152.7c0 24.0996 -11.4004 44.8994 -35 51.5996c17.2002 8.2002 26.2002 17.7002 26.2002 37c0 38.2002 -28.5 47.5 -61.4004 47.5h-90.5v-192h93.0996c34.9004 0.200195 67.6006 16.9004 67.6006 55.9004zM380 167.5
|
355 |
+
c0 41.0996 -24.0996 75.4004 -67.5996 75.4004c-42.4004 0 -71.1006 -31.8008 -71.1006 -73.6006c0 -43.2998 27.2998 -73 71.1006 -73c33.1992 0 54.6992 14.9004 65.0996 46.7998h-33.7002c-3.7002 -11.8994 -18.5996 -18.0996 -30.2002 -18.0996
|
356 |
+
c-22.3994 0 -34.0996 13.0996 -34.0996 35.2998h100.2c0.0996094 2.2998 0.299805 4.7998 0.299805 7.2002z" />
|
357 |
+
<glyph glyph-name="steam" unicode="" horiz-adv-x="496"
|
358 |
+
d="M496 192c0 -137 -111.2 -248 -248.4 -248c-113.8 0 -209.6 76.2998 -239 180.4l95.2002 -39.3008c6.40039 -32.0996 34.9004 -56.3994 68.9004 -56.3994c39.2002 0 71.8994 32.3994 70.2002 73.5l84.5 60.2002c52.0996 -1.30078 95.7998 40.8994 95.7998 93.5
|
359 |
+
c0 51.5996 -42 93.5 -93.7002 93.5s-93.7002 -42 -93.7002 -93.5v-1.2002l-59.2002 -85.7002c-15.5 0.900391 -30.6992 -3.40039 -43.5 -12.0996l-133.1 55c10.2002 127.699 117.1 228.1 247.6 228.1c137.2 0 248.4 -111 248.4 -248zM155.7 63.7002
|
360 |
+
c19.7998 -8.2002 42.5 1.09961 50.7998 21c8.2998 19.7998 -1.09961 42.5 -20.9004 50.7002l-31.5 13c12.2002 4.59961 26 4.7998 38.9004 -0.600586c13 -5.39941 23.0996 -15.5996 28.5 -28.5996s5.2998 -27.2998 -0.0996094 -40.2998
|
361 |
+
c-11.2002 -26.8008 -42.1006 -39.6006 -69 -28.4004c-10.2119 4.26953 -22.3975 15.8281 -27.2002 25.7998zM329.5 193.6c-34.4004 0 -62.4004 28 -62.4004 62.3008c0 34.2998 28 62.2998 62.4004 62.2998s62.4004 -28 62.4004 -62.2998
|
362 |
+
c0 -34.3008 -27.9004 -62.3008 -62.4004 -62.3008zM329.6 209.2c25.9004 0 46.9004 21 46.9004 46.7998c0 25.9004 -21 46.7998 -46.9004 46.7998c-25.8994 0 -46.8994 -21 -46.8994 -46.7998c0.0996094 -25.7998 21.0996 -46.7998 46.8994 -46.7998z" />
|
363 |
+
<glyph glyph-name="steam-square" unicode=""
|
364 |
+
d="M185.2 91.5c7.7002 18.5 -1 39.7002 -19.6006 47.4004l-29.5 12.1992c11.4004 4.30078 24.3008 4.5 36.4004 -0.5c12.2002 -5.09961 21.5996 -14.5996 26.7002 -26.6992c5 -12.2002 5 -25.6006 -0.100586 -37.7002c-10.5 -25.1006 -39.3994 -37 -64.5996 -26.5
|
365 |
+
c-11.5996 4.7998 -20.4004 13.5996 -25.4004 24.2002l28.5 -11.8008c18.6006 -7.7998 39.9004 0.900391 47.6006 19.4004zM400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v112.8l89.0996 -36.8994
|
366 |
+
c6 -30 32.7002 -52.7002 64.5 -52.7002c36.6006 0 67.3008 30.2998 65.7002 68.7998l79 56.2998c48.7002 -1.2002 89.6006 38.2998 89.6006 87.5c0 48.2002 -39.3008 87.5 -87.6006 87.5s-87.5996 -39.2998 -87.5996 -87.5v-1.09961l-55.4004 -80.2002
|
367 |
+
c-14.5 0.799805 -28.7002 -3.09961 -40.7002 -11.2998l-116.6 48.0996v160.7c0 26.5 21.5 48 48 48h352zM300.3 193.5c-32.2002 0 -58.3994 26.0996 -58.3994 58.2998s26.1992 58.2998 58.3994 58.2998s58.4004 -26.1992 58.4004 -58.2998
|
368 |
+
c0 -32.0996 -26.2002 -58.2998 -58.4004 -58.2998zM300.4 208.1c24.1992 0 43.8994 19.6006 43.8994 43.8008c0 24.1992 -19.5996 43.7998 -43.8994 43.7998c-24.2002 0 -43.9004 -19.6006 -43.9004 -43.7998c0 -24.2002 19.7002 -43.8008 43.9004 -43.8008z" />
|
369 |
+
<glyph glyph-name="spotify" unicode="" horiz-adv-x="496"
|
370 |
+
d="M248 440c136.9 0 248 -111.1 248 -248s-111.1 -248 -248 -248s-248 111.1 -248 248s111.1 248 248 248zM348.7 75.0996c8.09961 0 15.2002 6.30078 15.2002 15.4004s-3.60059 12.5996 -9.7002 16.5c-71.4004 42.7002 -155.101 44.2998 -237 26.2002
|
371 |
+
c-7.5 -1.60059 -13.6006 -6.5 -13.6006 -16.7998c0 -8.10059 6.10059 -15.8008 15.8008 -15.8008c2.89941 0 8 1.60059 11.8994 2.60059c71.7002 14.7002 144.3 13.0996 206.7 -24.5c3.90039 -2.2998 6.5 -3.60059 10.7002 -3.60059zM375.6 140.7
|
372 |
+
c10.9004 0 19.3008 8.7002 19.4004 19.5c0 8.7002 -3.2002 14.8994 -11.2998 19.7002c-49.4004 29.3994 -112.101 45.5 -177 45.5c-41.6006 0 -70 -5.80078 -97.7998 -13.6006c-10.3008 -2.89941 -15.5 -10 -15.5 -20.7002c0 -10.6992 8.69922 -19.3994 19.3994 -19.3994
|
373 |
+
c4.5 0 7.10059 1.2998 11.9004 2.59961c82.8994 22.5 176.1 7.60059 238.6 -29.3994c3.60059 -1.90039 7.10059 -4.2002 12.2998 -4.2002zM406.6 216.9c12.2002 0 23.2002 9.69922 23.2002 23.2998c0 11.8994 -5.09961 18.0996 -12.8994 22.5996
|
374 |
+
c-55.9004 32.6006 -132.4 47.7998 -205.4 47.7998c-42.9004 0 -82.2998 -4.89941 -117.5 -15.1992c-9 -2.60059 -17.4004 -10.3008 -17.4004 -23.9004c0 -13.2998 10.1006 -23.5996 23.3008 -23.5996c4.7998 0 9.2998 1.59961 12.8994 2.59961
|
375 |
+
c82.4004 23 209.7 12.7998 280.9 -29.7002c4.5 -2.59961 7.7002 -3.89941 12.8994 -3.89941z" />
|
376 |
+
<glyph glyph-name="deviantart" unicode="" horiz-adv-x="320"
|
377 |
+
d="M320 354.8l-98.2002 -179.1l7.40039 -9.5h90.7998v-127.7h-160.9l-13.5 -9.2002l-43.6992 -84c-0.300781 0 -8.60059 -8.59961 -9.2002 -9.2002h-92.7002v93.2002l93.2002 179.4l-7.40039 9.2002h-85.7998v127.6h156l13.5 9.2002l43.7002 84
|
378 |
+
c0.299805 0 8.59961 8.59961 9.2002 9.2002h97.5996v-93.1006z" />
|
379 |
+
<glyph glyph-name="soundcloud" unicode="" horiz-adv-x="640"
|
380 |
+
d="M111.4 191.7l5.7998 -65l-5.7998 -68.2998c-0.300781 -2.5 -2.2002 -4.40039 -4.40039 -4.40039s-4.2002 1.90039 -4.2002 4.40039l-5.59961 68.2998l5.59961 65c0 2.2002 1.90039 4.2002 4.2002 4.2002c2.2002 0 4.09961 -2 4.40039 -4.2002zM132.8 237.3
|
381 |
+
c2.5 0 4.7002 -2.2002 4.7002 -5l5.7998 -105.6l-5.7998 -68.2998c0 -2.80078 -2.2002 -5 -4.7002 -5c-2.7998 0 -4.7002 2.19922 -5 5l-5 68.2998l5 105.6c0.299805 2.7998 2.2002 5 5 5zM158.3 261.4c2.7998 0 5.2998 -2.2002 5.2998 -5.30078l5.30078 -130
|
382 |
+
l-5.30078 -67.7998c0 -3.09961 -2.5 -5.2998 -5.2998 -5.2998c-3.09961 0 -5.2998 2.2002 -5.59961 5.2998l-4.40039 67.7998l4.40039 130c0.299805 3.10059 2.5 5.30078 5.59961 5.30078zM7.2002 164.8c1.39941 0 2.2002 -1.09961 2.5 -2.5l5.59961 -35.5996l-5.59961 -35
|
383 |
+
c-0.299805 -1.40039 -1.10059 -2.5 -2.5 -2.5c-1.40039 0 -2.2002 1.09961 -2.5 2.5l-4.7002 35l4.7002 35.5996c0.299805 1.40039 1.09961 2.5 2.5 2.5zM30.7998 186.7c1.40039 0 2.5 -1.10059 2.7998 -2.5l7.2002 -57.5l-7.2002 -56.4004
|
384 |
+
c-0.299805 -1.39941 -1.39941 -2.5 -2.7998 -2.5c-1.39941 0 -2.5 1.10059 -2.5 2.7998l-6.39941 56.1006l6.39941 57.5c0 1.39941 1.10059 2.5 2.5 2.5zM56.0996 198.1c1.7002 0 3.10059 -1.39941 3.10059 -3.2998l6.89941 -68.0996l-6.89941 -65.7998
|
385 |
+
c0 -1.7002 -1.40039 -3.10059 -3.10059 -3.10059c-1.59961 0 -3 1.40039 -3.2998 3.10059l-5.7998 65.7998l5.7998 68.0996c0.200195 1.90039 1.60059 3.2998 3.2998 3.2998zM81.4004 200.3c1.89941 0 3.59961 -1.39941 3.89941 -3.59961l6.40039 -70l-6.40039 -67.7998
|
386 |
+
c-0.299805 -2.2002 -2 -3.60059 -3.89941 -3.60059c-1.90039 0 -3.60059 1.40039 -3.60059 3.60059l-5.7998 67.7998l5.7998 70c0 2.2002 1.7002 3.59961 3.60059 3.59961zM322.8 311.2c2.5 -1.40039 4.10059 -4.2002 4.5 -7.2002l3.90039 -177.5l-3.90039 -64.2002
|
387 |
+
c0 -4.7002 -3.89941 -8.59961 -8.59961 -8.59961s-8.60059 3.89941 -8.90039 8.59961l-1.7002 31.7002l-1.69922 32.5l3.2998 176.7v0.799805c0.200195 2.5 1.39941 5 3.2998 6.7002c1.40039 1.09961 3.40039 1.89941 5.59961 1.89941
|
388 |
+
c1.40039 0 3.10059 -0.599609 4.2002 -1.39941zM296.1 295.9c2.2002 -1.40039 3.60059 -3.90039 3.90039 -6.7002l3.2998 -162.8l-3.09961 -58.6006l-0.299805 -6.7002c0 -2.2998 -0.800781 -4.19922 -2.5 -5.59961c-1.40039 -1.40039 -3.40039 -2.5 -5.60059 -2.5
|
389 |
+
c-2.5 0 -4.7002 1.2002 -6.39941 3.09961c-1.10059 1.40039 -1.7002 3 -1.7002 4.7002v0.299805c-3.10059 65.3008 -3.10059 65.6006 -3.10059 65.6006l2.80078 160.8l0.299805 1.7002c0 2.7998 1.39941 5.2998 3.59961 6.7002
|
390 |
+
c1.2998 0.799805 2.7998 1.39941 4.40039 1.39941c1.59961 0 3 -0.599609 4.39941 -1.39941zM184.7 273.4c3.39941 0 5.89941 -2.80078 6.09961 -6.10059l5 -140.6l-5 -67.2002c-0.299805 -3.2998 -2.7998 -5.7998 -6.09961 -5.7998c-3 0 -5.5 2.5 -5.7998 5.7998
|
391 |
+
l-4.40039 67.2002l4.40039 140.6c0 3.2998 2.69922 6.10059 5.7998 6.10059zM561.4 210.6c43.2998 0 78.5996 -35.2998 78.5 -78.8994c0 -43.2998 -35.3008 -78.2998 -78.6006 -78.2998h-218.3c-4.7002 0.599609 -8.59961 4.19922 -8.59961 9.19922v249.7
|
392 |
+
c0 4.7998 1.69922 7 7.7998 9.2002c15.2998 6.09961 32.5 9.40039 50.2998 9.40039c72.5 0 131.9 -55.6006 138.3 -126.4c9.5 3.90039 19.7998 6.09961 30.6006 6.09961zM264.7 270.9c4.2002 0 7.2002 -3.30078 7.5 -7.80078l3.89941 -136.699l-3.89941 -65.6006
|
393 |
+
c0 -4.2002 -3.2998 -7.5 -7.5 -7.5s-7.5 3.2998 -7.7998 7.5l-3.30078 65.6006l3.30078 136.699c0.299805 4.5 3.59961 7.80078 7.7998 7.80078zM211.1 278.7c3.60059 0 6.40039 -3.10059 6.7002 -6.7002l4.40039 -145.3l-4.40039 -66.9004
|
394 |
+
c-0.299805 -3.59961 -3.09961 -6.39941 -6.7002 -6.39941c-3.2998 0 -6.09961 2.7998 -6.39941 6.39941l-3.90039 66.9004l3.90039 145.3c0 3.59961 3.09961 6.7002 6.39941 6.7002zM237.8 275.3c3.90039 0 6.90039 -3 6.90039 -6.89941l4.2002 -141.7l-4.2002 -66.4004
|
395 |
+
c0 -3.7998 -3.10059 -6.89941 -6.90039 -6.89941s-6.59961 3 -6.89941 6.89941l-3.90039 66.4004l3.90039 141.7c0 3.7998 3 6.89941 6.89941 6.89941z" />
|
396 |
+
<glyph glyph-name="vine" unicode="" horiz-adv-x="384"
|
397 |
+
d="M384 193.3v-52.0996c-18.4004 -4.2002 -36.9004 -6.10059 -52.0996 -6.10059c-36.9004 -77.3994 -103 -143.8 -125.101 -156.199c-14 -7.90039 -27.0996 -8.40039 -42.7002 0.799805c-27.0996 16.2998 -129.899 100.6 -164.1 365.6h74.5
|
398 |
+
c18.7002 -159.1 64.5 -240.7 114.8 -301.8c27.9004 27.9004 54.7998 65.0996 75.6006 106.9c-49.8008 25.2998 -80.1006 80.8994 -80.1006 145.6c0 65.5996 37.7002 115.1 102.2 115.1c114.9 0 106.2 -127.899 81.5996 -181.5c0 0 -46.3994 -9.19922 -63.5 20.5
|
399 |
+
c3.40039 11.3008 8.2002 30.8008 8.2002 48.5c0 31.3008 -11.2998 46.6006 -28.3994 46.6006c-18.2002 0 -30.8008 -17.1006 -30.8008 -50c0.100586 -79.2002 59.4004 -118.7 129.9 -101.9z" />
|
400 |
+
<glyph glyph-name="codepen" unicode="" horiz-adv-x="512"
|
401 |
+
d="M502.285 288.296c6.00098 -3.99902 9.71484 -11.1426 9.71582 -18.2852v-155.999c0 -7.14258 -3.71484 -14.2871 -9.71484 -18.2861l-234 -156.021c-8.06055 -4.95996 -16.584 -4.91504 -24.5713 0l-234 156.021c-6.00098 4 -9.71484 11.1436 -9.71484 18.2861v155.999
|
402 |
+
c0 7.14258 3.71387 14.2861 9.71387 18.2852l234 156c8.06055 4.95996 16.584 4.91504 24.5713 0zM278 384.869v-102.572l95.4287 -63.7148l76.8574 51.4287zM234 384.869l-172.286 -114.858l76.8574 -51.4287l95.4287 63.7148v102.572zM44 228.868v-73.7139
|
403 |
+
l55.1426 36.8564zM234 -0.84668v102.571l-95.4287 63.7158l-76.8574 -51.4297zM256 140.011l77.7148 52l-77.7148 52l-77.7148 -52zM278 -0.84668l172.286 114.857l-76.8574 51.4297l-95.4287 -63.7158v-102.571zM468 155.154v73.7139l-55.1426 -36.8574z" />
|
404 |
+
<glyph glyph-name="jsfiddle" unicode="" horiz-adv-x="576"
|
405 |
+
d="M510.634 210.538c45.6885 -25.334 68.3721 -74.5605 56.832 -122.634c-12.1035 -50.4199 -55.5479 -86.6592 -108.212 -87.293c-84.0303 -1.01172 -168.079 -0.458984 -252.12 -0.480469c-30.3223 -0.00683594 -60.668 -0.492188 -90.959 0.539062
|
406 |
+
c-48.0938 1.63672 -91.7764 35.8643 -105.607 81.4326c-14.1289 46.5508 2.18945 94.623 41.9014 124.615c2.54688 1.92383 4.86914 6.52051 4.51465 9.54492c-3.74609 31.8604 7.14453 57.6709 32.6758 76.4082c26.2822 19.2881 55.2285 21.5879 85.3311 9.16699
|
407 |
+
c2.36621 -0.975586 4.63965 -2.17773 7.82422 -3.68555c16.5215 27.5332 38.1221 48.6523 65.4922 63.9023c92.8594 51.7402 210.954 8.31152 246.85 -91.6455c5.55762 -15.4766 6.74512 -32.6074 9.09668 -49.0947c0.716797 -5.02832 1.6543 -8.15527 6.38086 -10.7764z
|
408 |
+
M531.741 53.6582c39.3135 48.375 22.418 117.668 -35.1426 144.497c-7.43555 3.46582 -9.72559 7.74414 -9.84766 15.8936c-1.87012 125.129 -132.78 187.063 -230.24 132.697c-26.1133 -14.5674 -46.4492 -34.8955 -60.6709 -61.2939
|
409 |
+
c-7.59082 -14.0908 -11.9287 -7.97754 -22.1982 -2.52734c-24.6113 13.0635 -49.0469 12.6406 -72.0332 -3.08301c-21.9678 -15.0244 -31.9102 -36.6201 -26.4199 -62.9805c2.4082 -11.5703 -0.914062 -17.0635 -10.0967 -23.1367
|
410 |
+
c-38.1895 -25.2578 -53.0879 -74.8604 -34.1855 -116.105c18.4355 -40.2295 51.3135 -59.6631 95.1748 -59.9951c0.700195 -0.00488281 163.728 -0.545898 163.728 0.154297c56.8857 0 113.778 -0.551758 170.652 0.229492
|
411 |
+
c28.9375 0.397461 53.0498 13.2178 71.2803 35.6504zM443.952 134.157c-5.84863 -31.1572 -34.6221 -55.0967 -66.666 -55.0957c-16.9531 0.00195312 -32.0586 6.5459 -44.0791 17.7051c-27.6973 25.7139 -71.1406 74.9805 -95.9375 93.3877
|
412 |
+
c-20.0557 14.8877 -41.9893 12.333 -60.2715 -3.78223c-49.9961 -44.0713 15.8594 -121.775 67.0625 -77.1885c4.54883 3.95996 7.84082 9.54297 12.7441 12.8447c8.18457 5.50879 20.7666 0.883789 13.168 -10.6221c-17.3574 -26.2842 -49.3301 -38.1973 -78.8623 -29.3008
|
413 |
+
c-28.8975 8.70312 -48.8408 35.9678 -48.626 70.1787c1.22461 22.4844 12.3633 43.0596 35.4141 55.9648c22.5742 12.6377 46.3682 13.1455 66.9902 -2.47363c50.791 -38.4756 75.5781 -81.7451 107.296 -101.245c24.5586 -15.0996 54.2549 -7.36328 68.8232 17.5059
|
414 |
+
c28.8301 49.209 -34.5918 105.016 -78.8682 63.46c-3.98828 -3.74414 -6.91699 -8.93164 -11.4092 -11.7197c-10.9756 -6.81152 -17.333 4.1123 -12.8096 10.3525c20.7031 28.5537 50.4639 40.4404 83.2715 28.2139c31.4287 -11.7139 49.1074 -44.3662 42.7598 -78.1855z
|
415 |
+
" />
|
416 |
+
<glyph glyph-name="rebel" unicode="" horiz-adv-x="512"
|
417 |
+
d="M256.5 -56c-139.3 0 -247.5 116.2 -243.3 254.1c2.7998 79.2002 43.2002 152.2 116.5 200.4c0.299805 0 1.89941 0.599609 1.09961 -0.799805c-5.7998 -5.5 -111.3 -129.8 -14.0996 -226.4c49.7998 -49.5 90 -2.5 90 -2.5c38.5 50.1006 -0.600586 125.9 -0.600586 125.9
|
418 |
+
c-10 24.8994 -45.6992 40.0996 -45.6992 40.0996l28.7998 31.7998c24.3994 -10.5 43.2002 -38.6992 43.2002 -38.6992c0.799805 29.5996 -21.9004 61.3994 -21.9004 61.3994l44.5996 50.7002l44.3008 -50.0996c-20.5 -28.8008 -21.9004 -62.6006 -21.9004 -62.6006
|
419 |
+
c13.7998 23 43.5 39.2998 43.5 39.2998l28.5 -31.7998c-27.4004 -8.89941 -45.4004 -39.8994 -45.4004 -39.8994c-15.7998 -28.5 -27.0996 -89.4004 0.600586 -127.301c32.3994 -44.5996 87.7002 2.80078 87.7002 2.80078c102.699 91.8994 -10.5 225 -10.5 225
|
420 |
+
c-6.10059 5.5 0.799805 2.7998 0.799805 2.7998c50.0996 -36.5 114.6 -84.4004 116.2 -204.8c2 -145.601 -99.9004 -249.4 -242.4 -249.4z" />
|
421 |
+
<glyph glyph-name="empire" unicode="" horiz-adv-x="496"
|
422 |
+
d="M287.6 393.8c-10.7998 2.2002 -22.0996 3.2998 -33.5 3.60059v18.1992c78.1006 -2.19922 146.101 -44 184.601 -106.6l-15.7998 -9.09961c-6.10059 9.69922 -12.7002 18.7998 -20.2002 27.0996l-18 -15.5c-26 29.5996 -61.4004 50.7002 -101.9 58.4004zM53.4004 125.6
|
423 |
+
c3.89941 -10.7998 8.2998 -21.0996 13.5996 -31.0996l-15.7998 -9.09961c-17.1006 31.5996 -27.1006 68.0996 -27.1006 106.6s9.90039 75 27.1006 106.5l15.7998 -9.09961c-5.2998 -9.7002 -10 -20.2002 -13.5996 -31l22.6992 -7.7002
|
424 |
+
c-6.39941 -18.2998 -9.69922 -38.2002 -9.69922 -58.7002s3.59961 -40.4004 10 -58.7002zM213.1 14l-4.69922 -23.7998c10.7998 -1.90039 22.1992 -3.2998 33.5 -3.60059v-18.2998c-78.1006 2.2998 -146.4 44.2998 -184.9 106.601l16 9.39941
|
425 |
+
c5.7998 -9.7002 12.7002 -18.7998 20.2002 -27.3994l18 15.7998c26.0996 -29.6006 61.5 -50.7002 101.899 -58.7002zM93.2998 327.1c-7.5 -8.2998 -14.0996 -17.5 -20.0996 -27.1992l-15.7998 9.09961c38.5 62.5996 106.5 104.4 184.6 106.6v-18.1992
|
426 |
+
c-11.4004 -0.300781 -22.7002 -1.40039 -33.5 -3.60059l4.7002 -23.7998c-40.5 -7.7002 -75.9004 -28.7998 -101.9 -58.4004zM402.7 56.9004c7.5 8.59961 14.3994 17.6992 20.0996 27.3994l16.1006 -9.39941c-38.5 -62.3008 -106.801 -104.4 -184.9 -106.601v18.2998
|
427 |
+
c11.4004 0.300781 22.7002 1.7002 33.5 3.60059l-4.7002 23.7998c40.5 8 75.9004 29.0996 101.9 58.7002zM496 192c0 -137 -111 -248 -248 -248s-248 111 -248 248s111 248 248 248s248 -111 248 -248zM483.8 192c0 130.1 -105.7 235.8 -235.8 235.8
|
428 |
+
s-235.8 -105.7 -235.8 -235.8s105.7 -235.8 235.8 -235.8s235.8 105.7 235.8 235.8zM444.8 298.6c17.2002 -31.5996 27.1006 -68.0996 27.1006 -106.6s-9.90039 -75 -27.1006 -106.4l-15.7998 9.10059c5.2998 10 9.7002 20.2002 13.5996 31l-23 7.7002
|
429 |
+
c6.40039 18.2998 10 38.1992 10 58.6992s-3.2998 40.4004 -9.69922 58.7002l22.6992 7.7002c-3.59961 10.7998 -8.2998 21.2998 -13.5996 31zM261.8 120.9l13.2998 -66.7002c-8.59961 -1.7002 -17.6992 -2.7998 -27.0996 -2.7998s-18.5 1.09961 -27.0996 2.7998
|
430 |
+
l13.2998 66.7002c-16.2998 3.2998 -30.5 11.5996 -40.7002 23.5l-51.2002 -44.8008c-11.8994 13.6006 -21.2998 29.4004 -27.0996 46.8008l64.2002 22.0996c-2.5 7.40039 -3.90039 15.2002 -3.90039 23.5s1.40039 16 3.90039 23.5l-64.5 22.0996
|
431 |
+
c6.09961 17.5 15.5 33.2002 27.3994 46.8008l51.2002 -44.8008c10.2998 11.9004 24.4004 20.5 40.7002 23.8008l-13.2998 66.3994c8.59961 2 17.6992 2.7998 27.0996 2.7998s18.5 -0.899414 27.0996 -2.7998l-13.2998 -66.3994
|
432 |
+
c16.2998 -3.30078 30.5 -11.9004 40.7002 -23.8008l51.2002 44.8008c11.8994 -13.6006 21.2998 -29.4004 27.3994 -46.8008l-64.5 -22.0996c2.5 -7.40039 3.90039 -15.2002 3.90039 -23.5s-1.40039 -16 -3.90039 -23.5l64.2002 -22.0996
|
433 |
+
c-5.7998 -17.5 -15.2002 -33.2002 -27.0996 -46.8008l-51.2002 44.8008c-10.2998 -11.9004 -24.4004 -20.2002 -40.7002 -23.5z" />
|
434 |
+
<glyph glyph-name="git-square" unicode=""
|
435 |
+
d="M100.59 113.76c48.5703 -3.30957 58.9502 -2.10938 58.9502 -11.9395c0 -20 -65.5498 -20.0605 -65.5498 -1.52051c0.00976562 5.08984 3.29004 9.40039 6.59961 13.46zM128.54 230.4c30.96 0 31.7598 -44.4707 -0.75 -44.4707c-33 0 -31.54 44.4707 0.75 44.4707z
|
436 |
+
M448 368v-352c0 -26.4961 -21.5039 -48 -48 -48h-352c-26.4961 0 -48 21.5039 -48 48v352c0 26.4961 21.5039 48 48 48h352c26.4961 0 48 -21.5039 48 -48zM221 298.69c0 -14.4902 8.37988 -22.8809 22.8604 -22.8809c14.7393 0 23.1299 8.39062 23.1299 22.8809
|
437 |
+
c0 14.4893 -8.37012 22.3096 -23.1104 22.3096c-14.4795 0 -22.8799 -7.83984 -22.8799 -22.3096zM199.18 253h-49.5498c-25 6.5498 -81.5596 4.84961 -81.5596 -46.75c0 -18.7998 9.39941 -32 21.8496 -38.1104c-15.6895 -14.3701 -23.1201 -21.1396 -23.1201 -30.7393
|
438 |
+
c0 -6.87012 2.79004 -13.2207 11.1807 -16.7607c-8.90039 -8.39941 -14 -14.4795 -14 -25.9199c0.0195312 -20.0693 17.5498 -31.7197 63.5391 -31.7197c44.2207 0 69.8701 16.5098 69.8701 45.7305c0 36.6699 -28.2295 35.3193 -94.7695 39.3799l8.37988 13.4297
|
439 |
+
c17 -4.74023 74.1904 -6.23047 74.1904 42.4297c0 11.6904 -4.83008 19.8203 -9.40039 25.6699l23.3799 1.78027zM283.52 143.16l-13 1.78027c-3.81934 0.509766 -4.06934 1 -4.06934 5.08984v105.45h-52.6006l-2.79004 -20.5703c15.75 -5.5498 17 -4.86035 17 -10.1699
|
440 |
+
v-74.7402c0 -5.62012 -0.30957 -4.58008 -17 -6.87012v-20.0596h72.4209zM384 133l-6.87012 22.3701c-40.9297 -15.3701 -37.8496 12.4102 -37.8496 16.7295v60.7207h37.8496v25.4102h-35.8203c-2.86914 0 -2 -2.52051 -2 38.6299h-24.1797
|
441 |
+
c-2.79004 -27.7002 -11.6797 -38.8799 -34 -41.4199v-22.6201c20.4697 0 19.8203 0.849609 19.8203 -2.54004v-66.5703c0 -28.7197 11.4297 -40.9102 41.6699 -40.9102c14.4502 0 30.4502 4.83008 41.3799 10.2002z" />
|
442 |
+
<glyph glyph-name="git" unicode="" horiz-adv-x="512"
|
443 |
+
d="M216.29 289.61l0.0400391 -34.5508l-37.4102 -2.83984c7.27051 -9.35938 15 -22.3701 15 -41.0693c0 -77.8906 -91.4297 -75.4707 -118.7 -67.8906l-13.4297 -21.5498c106.47 -6.5 151.63 -4.33984 151.63 -63c0 -46.7598 -41.04 -73.1797 -111.79 -73.1797
|
444 |
+
c-73.5801 0 -101.63 18.71 -101.63 50.8193c0 18.3008 8.12988 28.04 22.4004 41.4502c-13.4199 5.66992 -17.8906 15.8105 -17.8906 26.8105c0 15.3594 11.9004 26.21 37 49.21c-20 9.76953 -35 30.9102 -35 61c0 82.5498 90.4902 85.2793 130.49 74.79h79.29z
|
445 |
+
M152.87 47.71c0 15.7402 -16.6104 13.8096 -94.3203 19.1104c-5.2998 -6.54004 -10.5693 -13.4004 -10.5693 -21.54c0 -29.6699 104.89 -29.6299 104.89 2.42969zM102.06 182.29c52.0205 0 50.7402 71.1602 1.2002 71.1602c-51.6602 0 -54 -71.1602 -1.2002 -71.1602z
|
446 |
+
M235.36 81.7803v32.0996c26.75 3.66016 27.2393 2 27.2393 11v119.51c0 8.5 -2.0498 7.37988 -27.2393 16.2607l4.46973 32.9199h84.1699v-168.71c0 -6.51074 0.400391 -7.32031 6.50977 -8.14062l20.7305 -2.83984v-32.0996h-115.88zM287.81 326.09
|
447 |
+
c-23.1699 0 -36.5898 13.4297 -36.5898 36.6104c0 23.1797 13.4199 35.7695 36.5898 35.7695c23.5801 0 37 -12.6201 37 -35.7695c0 -23.1504 -13.4199 -36.6104 -37 -36.6104zM512 97.54c-17.4902 -8.53027 -43.0996 -16.2598 -66.2803 -16.2598
|
448 |
+
c-48.3799 0 -66.6699 19.5 -66.6699 65.46v106.51c0 5.41992 1.0498 4.05957 -31.71 4.05957v36.1904c35.7803 4.07031 50 22 54.4697 66.2695h38.6309c0 -65.8291 -1.34082 -61.8096 3.25977 -61.8096h57.2998v-40.6504h-60.5596v-97.1494
|
449 |
+
c0 -6.91992 -4.9209 -51.4102 60.5693 -26.8398z" />
|
450 |
+
<glyph glyph-name="hacker-news" unicode=""
|
451 |
+
d="M0 416h448v-448h-448v448zM21.2002 218.8h-0.200195c0.0996094 0.100586 0.200195 0.299805 0.299805 0.400391c0 -0.100586 0 -0.299805 -0.0996094 -0.400391zM239.2 164.9l80.7998 155.1h-34.7998c-54.7998 -101.2 -48.2998 -98.5996 -60.6006 -125.6
|
452 |
+
c-10.0996 24.3994 -6.7998 27.2998 -59.2998 125.6h-37.2998l79.7998 -153.3v-102.7h31.4004v100.9z" />
|
453 |
+
<glyph glyph-name="tencent-weibo" unicode="" horiz-adv-x="384"
|
454 |
+
d="M72.2998 -47.7998c1.40039 -19.9004 -27.5996 -22.2002 -29.7002 -2.90039c-11.5996 129.9 31.1006 239.5 101.4 313.2c-15.5996 34 9.2002 77.0996 50.5996 77.0996c30.3008 0 55.1006 -24.5996 55.1006 -55.0996c0 -44 -49.5 -70.7998 -86.9004 -45.0996
|
455 |
+
c-65.7002 -71.3008 -101.399 -169.801 -90.5 -287.2zM192 447.9c92 0 166.6 -74.6006 166.6 -166.5c0 -102.301 -93.2998 -185.5 -204 -162.301c-19 4.7002 -12.5 33.2002 6.60059 29.1006c80.7998 -20.7998 167.7 42.2998 167.7 133.1c0 75.5 -61.5 136.9 -136.9 136.9
|
456 |
+
c-101 0 -168.3 -106.601 -122 -199.2c9 -17.9004 -17.5996 -30.7998 -26.2998 -13.4004c-56 108.101 22.3994 242.301 148.3 242.301z" />
|
457 |
+
<glyph glyph-name="qq" unicode=""
|
458 |
+
d="M433.754 27.5547c-11.5264 -1.39258 -44.8604 52.7412 -44.8604 52.7412c0 -31.3447 -16.1357 -72.2471 -51.0508 -101.786c16.8418 -5.19141 54.8428 -19.167 45.8037 -34.4209c-7.31641 -12.3428 -125.511 -7.88086 -159.633 -4.03711
|
459 |
+
c-34.1221 -3.84375 -152.315 -8.30566 -159.632 4.03711c-9.04492 15.25 28.918 29.2139 45.7832 34.415c-34.9199 29.5391 -51.0586 70.4453 -51.0586 101.792c0 0 -33.334 -54.1338 -44.8594 -52.7412c-5.37012 0.650391 -12.4238 29.6445 9.34668 99.7041
|
460 |
+
c10.2617 33.0244 21.9951 60.4785 40.1445 105.779c-3.05566 116.898 45.2441 214.956 160.262 214.962c113.737 -0.00585938 163.156 -96.1328 160.264 -214.963c18.1182 -45.2227 29.9121 -72.8506 40.1445 -105.778c21.7676 -70.0596 14.7158 -99.0527 9.3457 -99.7041z
|
461 |
+
" />
|
462 |
+
<glyph glyph-name="weixin" unicode="" horiz-adv-x="576"
|
463 |
+
d="M385.2 280.4c-92.4004 0 -165.4 -69.1006 -165.3 -154c0 -14.2002 2.19922 -27.9004 6.19922 -40.8008c-6.19922 -0.5 -12.0996 -0.799805 -18.2998 -0.799805c-24.3994 0 -43.7998 4.90039 -68.2002 9.7002l-68 -34.0996l19.3008 58.5996
|
464 |
+
c-48.6006 34.0996 -77.9004 78.2002 -77.9004 131.6c0 92.6006 87.5 165.4 194.7 165.4c95.5996 0 179.7 -58.2998 196.3 -136.7c-6.2002 0.799805 -12.4004 1.10059 -18.7998 1.10059zM280.7 333.3c-14.7002 0 -29.2002 -9.7002 -29.2998 -24.3994
|
465 |
+
c0 -14.5 14.5 -24.2002 29.2998 -24.2002c14.5 0 24.2002 9.7002 24.2002 24.2002c0 14.6992 -9.7002 24.3994 -24.2002 24.3994zM144.3 284.7c14.7998 0 24.4004 9.59961 24.4004 24.2002c0 14.6992 -9.60059 24.3994 -24.4004 24.3994
|
466 |
+
c-14.5 0 -29.2998 -9.59961 -29.2998 -24.3994c0 -14.5 14.7998 -24.2002 29.2998 -24.2002zM563 128.6c0 -43.7998 -29 -82.6992 -68.2002 -112.1l14.7998 -48.5996l-53.3994 29.2998c-19.7002 -4.7998 -39.2998 -9.90039 -58.6006 -9.90039
|
467 |
+
c-92.5996 0 -165.399 63.4004 -165.399 141.3c0 77.9004 72.7002 141.301 165.399 141.301c87.5 0 165.4 -63.4004 165.4 -141.301zM343.9 153.1c14.6992 0 24.3994 9.60059 24.3994 19.6006c0 9.59961 -9.59961 19.2998 -24.3994 19.2998
|
468 |
+
c-9.60059 0 -19.3008 -9.59961 -19.3008 -19.2998c0 -9.90039 9.60059 -19.6006 19.3008 -19.6006zM451 153.1c14.5 0 24.5 9.60059 24.4004 19.6006c0 9.59961 -9.90039 19.2998 -24.4004 19.2998c-9.59961 0 -19.2998 -9.59961 -19.2998 -19.2998
|
469 |
+
c0 -9.90039 9.59961 -19.6006 19.2998 -19.6006z" />
|
470 |
+
<glyph glyph-name="slideshare" unicode="" horiz-adv-x="512"
|
471 |
+
d="M187.7 294.3c34 0 61.7002 -25.7002 61.7002 -57.7002c0 -31.6992 -27.7002 -57.6992 -61.7002 -57.6992s-61.7002 26 -61.7002 57.6992c0 32 27.7002 57.7002 61.7002 57.7002zM331.1 294.3c34.3008 0 61.8008 -25.7002 61.7002 -57.7002
|
472 |
+
c0 -31.6992 -27.3994 -57.6992 -61.7002 -57.6992c-34 0 -61.6992 26 -61.6992 57.6992c0 32 27.6992 57.7002 61.6992 57.7002zM487.7 204.3c15.2002 10.5 25.2002 -4 16.0996 -17.7998c-18.2998 -22.5996 -53.2002 -50.2998 -106.3 -72
|
473 |
+
c56.2998 -191.7 -137.4 -222.3 -134.3 -124c0 0.700195 -0.299805 53.7998 -0.299805 93.5c-4.30078 0.799805 -8.60059 2 -13.7002 3.09961c0 -40 -0.299805 -95.8994 -0.299805 -96.5996c3.09961 -98.2002 -190.601 -67.5996 -134.301 124.1
|
474 |
+
c-53.1992 21.7002 -88 49.4004 -106.3 72c-9.09961 13.7002 0.900391 28.3008 16 17.7002c2 -1.39941 4.2998 -2.89941 6.2998 -4.2998v198.3c0 27.4004 20.6006 49.7002 46 49.7002h359.101c25.3994 0 46 -22.2998 46 -49.7002v-198.3zM457.2 185.1h0.0996094v190.601
|
475 |
+
c0 32.7998 -10.5996 45.7002 -40.8994 45.7002h-317.7c-31.7002 0 -40.6006 -10.8008 -40.6006 -45.7002v-192.4c67.7002 -35.3994 125.7 -29.0996 157.4 -28c13.4004 0.299805 22 -2.2998 27.0996 -7.7002c1.7002 -1.59961 10 -9.39941 20.3008 -17.0996
|
476 |
+
c1.09961 15.7998 10 25.7998 33.6992 24.9004c32.3008 -1.40039 91.7002 -7.7002 160.601 29.6992z" />
|
477 |
+
<glyph glyph-name="twitch" unicode=""
|
478 |
+
d="M40.0996 416h397.9v-274.2l-117 -117h-87l-56.7998 -56.7998h-60.2002v56.7998h-107v314.3zM397.9 161.9v214h-321v-280.9h90.2998v-56.7998l56.7998 56.7998h107zM331 299v-116.9h-40.0996v116.9h40.0996zM224 299v-116.9h-40.0996v116.9h40.0996z" />
|
479 |
+
<glyph glyph-name="yelp" unicode="" horiz-adv-x="384"
|
480 |
+
d="M42.9004 207.68l99.6191 -48.6094c19.2002 -9.40039 16.2002 -37.5107 -4.5 -42.71l-107.52 -26.8105c-1.51074 -0.379883 -4 -0.6875 -5.55762 -0.6875c-11.2676 0 -21.415 9.08887 -22.6523 20.2881c-0.708984 6.18164 -1.28516 16.25 -1.28516 22.4727
|
481 |
+
c0 17.8105 4.60742 45.9658 10.2852 62.8467c2.88574 8.56836 12.5664 15.5215 21.6074 15.5215c2.9082 0 7.38867 -1.03516 10.0029 -2.31152zM86.9004 -31.5703c-5.48535 3.75195 -9.92773 12.1904 -9.92773 18.8359c0 4.8291 2.61914 11.6631 5.84766 15.2539
|
482 |
+
l74.21 82.4004c14.3096 15.8105 40.5098 5.2002 39.8096 -16.0996l-3.89941 -110.82c-0.412109 -12.1484 -10.6123 -22.0078 -22.7676 -22.0078c-1.07129 0 -2.79688 0.146484 -3.85254 0.328125c-23.8691 4.04199 -59.4492 18.4277 -79.4199 32.1094zM232.24 78.3496
|
483 |
+
c-11.2998 18.1104 6.2002 40.4102 26.5098 33.9102l105.42 -34.2598c8.69043 -2.88965 15.7422 -12.667 15.7422 -21.8252c0 -2.8125 -0.963867 -7.16504 -2.15234 -9.71484c-10.418 -21.8799 -34.0322 -52.1689 -52.71 -67.6104
|
484 |
+
c-3.50586 -2.88867 -10.0391 -5.2334 -14.582 -5.2334c-6.99707 0 -15.6963 4.80859 -19.418 10.7334zM380.57 210.58c1.04688 -2.41602 1.93652 -6.5127 1.93652 -9.14551c0 -9.49805 -7.39551 -19.3828 -16.5068 -22.0645l-106.64 -30.5098
|
485 |
+
c-20.5 -5.90039 -37.1006 17.0098 -25.2002 34.71l62 91.9199c3.75 5.55664 12.2354 10.0654 18.9385 10.0654c4.74512 0 11.4932 -2.53809 15.0615 -5.66602c18.166 -16.0361 40.75 -47.0869 50.4102 -69.3096zM62.1104 417.82
|
486 |
+
c29.4697 14.0293 79.793 27.5137 112.33 30.0996c0.503906 0.0410156 1.32422 0.0742188 1.83008 0.0742188c12.5146 0 22.6709 -10.1562 22.6709 -22.6699c0 -0.0566406 -0.000976562 -0.147461 -0.000976562 -0.204102v-208.34
|
487 |
+
c0 -23.2998 -30.9102 -31.6006 -42.6104 -11.4004l-104.12 180.44c-1.68164 2.92188 -3.0459 8.0293 -3.0459 11.4014c0 7.93066 5.7998 17.1592 12.9463 20.5986z" />
|
488 |
+
<glyph glyph-name="paypal" unicode="" horiz-adv-x="384"
|
489 |
+
d="M111.4 152.1c-3.5 -19.1992 -17.4004 -108.699 -21.5 -134c-0.300781 -1.7998 -1 -2.5 -3 -2.5h-74.6006c-7.59961 0 -13.0996 6.60059 -12.0996 13.9004l58.5996 371.9c1.5 9.59961 10.1006 16.8994 20 16.8994c152.3 0 165.101 3.7002 204 -11.3994
|
490 |
+
c60.1006 -23.3008 65.6006 -79.5 44 -140.301c-21.5 -62.5996 -72.5 -89.5 -140.1 -90.2998c-43.4004 -0.700195 -69.5 7 -75.2998 -24.2002zM357.1 296c28.4004 -21.2002 30.3008 -57.7998 23.8008 -92.5996c-16.5 -83.5 -71.9004 -112.301 -142.9 -112.301
|
491 |
+
c-15 0 -24.7002 2.30078 -29.2998 -19.6992c-15.5 -97.4004 -13.7002 -85.9004 -14.4004 -91.3008c-1.7002 -8.59961 -8.7998 -14.8994 -17.3994 -14.8994h-63.5c-7.10059 0 -11.6006 5.7998 -10.6006 12.8994c0 0 4.5 29.3008 27.1006 169.7
|
492 |
+
c0.799805 6.10059 4.7998 9.40039 10.8994 9.40039c54 0 164.601 -9.90039 204.5 103.899c3.7002 11.1006 6.7998 22.2002 8.7998 33.6006c0.5 3.09961 1.2002 2.59961 3 1.2998z" />
|
493 |
+
<glyph glyph-name="google-wallet" unicode=""
|
494 |
+
d="M156.8 321.2c37.6006 -60.6006 64.2002 -113.101 84.2998 -162.5c-8.2998 -33.7998 -18.7998 -66.5 -31.2998 -98.2998c-13.2002 52.2998 -26.5 101.3 -56 148.5c6.5 36.3994 2.2998 73.5996 3 112.3zM109.3 248c5 0 10 -2.5 13 -6.5
|
495 |
+
c43.7998 -59.7998 66.2998 -123.8 82.5 -193.5h-103.5c-20 69.5 -49.5 133 -91.7002 187.3c-4 5.2002 0 12.7002 6.5 12.7002h93.2002zM157.1 336h108.7c74.7998 -103 131.2 -230 143.2 -368h-113.7c-8.2002 133.5 -69.7002 260 -138.2 368zM408.9 404.5
|
496 |
+
c19 -67.5 31.0996 -139 31.0996 -212.6c0 -69.5 -9.5 -142.5 -25.2998 -203c-10.9004 92.5 -42.4004 184.6 -90.6006 270.8c-4.19922 50.5 -13.2998 99.5 -26.5 146c-1.19922 5.2998 2.5 10.2998 7.80078 10.2998h88.2998c7 0 13.3994 -4.7002 15.2002 -11.5z" />
|
497 |
+
<glyph glyph-name="cc-visa" unicode="" horiz-adv-x="576"
|
498 |
+
d="M470.1 216.7c0 0 7.60059 -37.2002 9.30078 -45h-33.4004c3.2998 8.89941 16 43.5 16 43.5c-0.200195 -0.299805 3.2998 9.09961 5.2998 14.8994zM576 368v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480
|
499 |
+
c26.5 0 48 -21.5 48 -48zM152.5 116.8l63.2002 155.2h-42.5l-39.2998 -106l-4.30078 21.5l-14 71.4004c-2.2998 9.89941 -9.39941 12.6992 -18.1992 13.0996h-64.7002l-0.700195 -3.09961c15.7998 -4 29.9004 -9.80078 42.2002 -17.1006l35.7998 -135h42.5zM246.9 116.6
|
500 |
+
l25.1992 155.4h-40.1992l-25.1006 -155.4h40.1006zM386.8 167.4c0.200195 17.6992 -10.5996 31.1992 -33.7002 42.2998c-14.0996 7.09961 -22.6992 11.8994 -22.6992 19.2002c0.199219 6.59961 7.2998 13.3994 23.0996 13.3994
|
501 |
+
c13.0996 0.299805 22.7002 -2.7998 29.9004 -5.89941l3.59961 -1.7002l5.5 33.5996c-7.90039 3.10059 -20.5 6.60059 -36 6.60059c-39.7002 0 -67.5996 -21.2002 -67.7998 -51.4004c-0.299805 -22.2998 20 -34.7002 35.2002 -42.2002
|
502 |
+
c15.5 -7.59961 20.7998 -12.5996 20.7998 -19.2998c-0.200195 -10.4004 -12.6006 -15.2002 -24.1006 -15.2002c-16 0 -24.5996 2.5 -37.6992 8.2998l-5.30078 2.5l-5.59961 -34.8994c9.40039 -4.2998 26.7998 -8.10059 44.7998 -8.2998
|
503 |
+
c42.2002 -0.100586 69.7002 20.7998 70 53zM528 116.6l-32.4004 155.4h-31.0996c-9.59961 0 -16.9004 -2.7998 -21 -12.9004l-59.7002 -142.5h42.2002s6.90039 19.2002 8.40039 23.3008h51.5996c1.2002 -5.5 4.7998 -23.3008 4.7998 -23.3008h37.2002z" />
|
504 |
+
<glyph glyph-name="cc-mastercard" unicode="" horiz-adv-x="576"
|
505 |
+
d="M482.9 37.7002c0 -6.7998 -4.60059 -11.7002 -11.2002 -11.7002c-6.7998 0 -11.2002 5.2002 -11.2002 11.7002s4.40039 11.7002 11.2002 11.7002c6.59961 0 11.2002 -5.2002 11.2002 -11.7002zM172.1 49.4004c6.5 0 10.8008 -5.2002 10.9004 -11.7002
|
506 |
+
c0 -6.7998 -4.40039 -11.7002 -10.9004 -11.7002c-7.09961 0 -11.1992 5.2002 -11.1992 11.7002s4.09961 11.7002 11.1992 11.7002zM289.6 49.7002c5.2002 0 8.7002 -3 9.60059 -8.7002h-19.1006c0.800781 5.2002 4.10059 8.7002 9.5 8.7002zM397.4 49.4004
|
507 |
+
c6.7998 0 11.1992 -5.2002 11.1992 -11.7002c0 -6.7998 -4.39941 -11.7002 -11.1992 -11.7002c-6.80078 0 -10.9004 5.2002 -10.9004 11.7002s4.09961 11.7002 10.9004 11.7002zM503.3 23.2998c0 -0.299805 0.299805 -0.5 0.299805 -1.09961
|
508 |
+
c0 -0.299805 -0.299805 -0.5 -0.299805 -1.10059c-0.299805 -0.299805 -0.299805 -0.5 -0.5 -0.799805c-0.299805 -0.299805 -0.5 -0.5 -1.09961 -0.5c-0.299805 -0.299805 -0.5 -0.299805 -1.10059 -0.299805c-0.299805 0 -0.5 0 -1.09961 0.299805
|
509 |
+
c-0.299805 0 -0.5 0.299805 -0.799805 0.5c-0.299805 0.299805 -0.5 0.5 -0.5 0.799805c-0.299805 0.5 -0.299805 0.800781 -0.299805 1.10059c0 0.5 0 0.799805 0.299805 1.09961c0 0.5 0.299805 0.799805 0.5 1.10059c0.299805 0.299805 0.5 0.299805 0.799805 0.5
|
510 |
+
c0.5 0.299805 0.799805 0.299805 1.09961 0.299805c0.5 0 0.800781 0 1.10059 -0.299805c0.5 -0.300781 0.799805 -0.300781 1.09961 -0.5c0.299805 -0.200195 0.200195 -0.600586 0.5 -1.10059zM501.1 21.9004c0.5 0 0.5 0.299805 0.800781 0.299805
|
511 |
+
c0.299805 0.299805 0.299805 0.5 0.299805 0.799805s0 0.5 -0.299805 0.799805c-0.300781 0 -0.5 0.299805 -1.10059 0.299805h-1.59961v-3.5h0.799805v1.40039h0.299805l1.10059 -1.40039h0.799805zM576 367v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48
|
512 |
+
v352c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48zM64 227.4c0 -76.5 62.0996 -138.5 138.5 -138.5c27.2002 0 53.9004 8.19922 76.5 23.0996c-72.9004 59.2998 -72.4004 171.2 0 230.5c-22.5996 15 -49.2998 23.0996 -76.5 23.0996
|
513 |
+
c-76.4004 0.100586 -138.5 -62 -138.5 -138.199zM288 118.6c70.5 55 70.2002 162.2 0 217.5c-70.2002 -55.2998 -70.5 -162.6 0 -217.5zM145.7 42.2998c0 8.7002 -5.7002 14.4004 -14.7002 14.7002c-4.59961 0 -9.5 -1.40039 -12.7998 -6.5
|
514 |
+
c-2.40039 4.09961 -6.5 6.5 -12.2002 6.5c-3.7998 0 -7.59961 -1.40039 -10.5996 -5.40039v4.40039h-8.2002v-36.7002h8.2002c0 18.9004 -2.5 30.2002 9 30.2002c10.1992 0 8.19922 -10.2002 8.19922 -30.2002h7.90039c0 18.2998 -2.5 30.2002 9 30.2002
|
515 |
+
c10.2002 0 8.2002 -10 8.2002 -30.2002h8.2002v23h-0.200195zM190.6 56h-7.89941v-4.40039c-2.7002 3.30078 -6.5 5.40039 -11.7002 5.40039c-10.2998 0 -18.2002 -8.2002 -18.2002 -19.2998c0 -11.2002 7.90039 -19.2998 18.2002 -19.2998
|
516 |
+
c5.2002 0 9 1.89941 11.7002 5.39941v-4.59961h7.89941v36.7998zM231.1 30.4004c0 15 -22.8994 8.19922 -22.8994 15.1992c0 5.7002 11.8994 4.80078 18.5 1.10059l3.2998 6.5c-9.40039 6.09961 -30.2002 6 -30.2002 -8.2002c0 -14.2998 22.9004 -8.2998 22.9004 -15
|
517 |
+
c0 -6.2998 -13.5 -5.7998 -20.7002 -0.799805l-3.5 -6.2998c11.2002 -7.60059 32.5996 -6 32.5996 7.5zM266.5 21.0996l-2.2002 6.80078c-3.7998 -2.10059 -12.2002 -4.40039 -12.2002 4.09961v16.5996h13.1006v7.40039h-13.1006v11.2002h-8.19922v-11.2002h-7.60059
|
518 |
+
v-7.2998h7.60059v-16.7002c0 -17.5996 17.2998 -14.4004 22.5996 -10.9004zM279.8 34.5h27.5c0 16.2002 -7.39941 22.5996 -17.3994 22.5996c-10.6006 0 -18.2002 -7.89941 -18.2002 -19.2998c0 -20.5 22.5996 -23.8994 33.7998 -14.2002l-3.7998 6
|
519 |
+
c-7.7998 -6.39941 -19.6006 -5.7998 -21.9004 4.90039zM338.9 56c-4.60059 2 -11.6006 1.7998 -15.2002 -4.40039v4.40039h-8.2002v-36.7002h8.2002v20.7002c0 11.5996 9.5 10.0996 12.7998 8.40039zM349.5 37.7002c0 11.3994 11.5996 15.0996 20.7002 8.39941l3.7998 6.5
|
520 |
+
c-11.5996 9.10059 -32.7002 4.10059 -32.7002 -15c0 -19.7998 22.4004 -23.7998 32.7002 -15l-3.7998 6.5c-9.2002 -6.5 -20.7002 -2.59961 -20.7002 8.60059zM416.2 56h-8.2002v-4.40039c-8.2998 11 -29.9004 4.80078 -29.9004 -13.8994
|
521 |
+
c0 -19.2002 22.4004 -24.7002 29.9004 -13.9004v-4.59961h8.2002v36.7998zM449.9 56c-2.40039 1.2002 -11 2.90039 -15.2002 -4.40039v4.40039h-7.90039v-36.7002h7.90039v20.7002c0 11 9 10.2998 12.7998 8.40039zM490.2 70.9004h-7.90039v-19.3008
|
522 |
+
c-8.2002 10.9004 -29.8994 5.10059 -29.8994 -13.8994c0 -19.4004 22.5 -24.6006 29.8994 -13.9004v-4.59961h7.90039v51.7002zM497.8 146v-4.59961h0.799805v4.59961h1.90039v0.799805h-4.59961v-0.799805h1.89941zM504.4 22.2002c0 0.5 0 1.09961 -0.300781 1.59961
|
523 |
+
c-0.299805 0.299805 -0.5 0.799805 -0.799805 1.10059c-0.299805 0.299805 -0.799805 0.5 -1.09961 0.799805c-0.5 0 -1.10059 0.299805 -1.60059 0.299805c-0.299805 0 -0.799805 -0.299805 -1.39941 -0.299805c-0.5 -0.299805 -0.799805 -0.5 -1.10059 -0.799805
|
524 |
+
c-0.5 -0.300781 -0.799805 -0.800781 -0.799805 -1.10059c-0.299805 -0.5 -0.299805 -1.09961 -0.299805 -1.59961c0 -0.299805 0 -0.799805 0.299805 -1.40039c0 -0.299805 0.299805 -0.799805 0.799805 -1.09961c0.300781 -0.299805 0.5 -0.5 1.10059 -0.799805
|
525 |
+
c0.5 -0.300781 1.09961 -0.300781 1.39941 -0.300781c0.5 0 1.10059 0 1.60059 0.300781c0.299805 0.299805 0.799805 0.5 1.09961 0.799805s0.5 0.799805 0.799805 1.09961c0.300781 0.600586 0.300781 1.10059 0.300781 1.40039zM507.6 146.9h-1.39941l-1.60059 -3.5
|
526 |
+
l-1.59961 3.5h-1.40039v-5.40039h0.800781v4.09961l1.59961 -3.5h1.09961l1.40039 3.5v-4.09961h1.09961v5.40039zM512 227.4c0 76.1992 -62.0996 138.3 -138.5 138.3c-27.2002 0 -53.9004 -8.2002 -76.5 -23.1006c72.0996 -59.2998 73.2002 -171.5 0 -230.5
|
527 |
+
c22.5996 -15 49.5 -23.0996 76.5 -23.0996c76.4004 -0.0996094 138.5 61.9004 138.5 138.4z" />
|
528 |
+
<glyph glyph-name="cc-discover" unicode="" horiz-adv-x="576"
|
529 |
+
d="M520.4 251.9c0 -8.40039 -5.5 -12.8008 -15.8008 -12.8008h-4.69922v24.9004h4.89941c10.1006 0 15.6006 -4.2002 15.6006 -12.0996zM528 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480z
|
530 |
+
M483.9 277.1v-82h16v32.8008h2.19922l22.2002 -32.8008h19.6006l-25.8008 34.4004c12.1006 2.5 18.7002 10.5996 18.7002 23.2002c0 28.5 -30.2998 24.3994 -52.8994 24.3994zM428 277v-82h45.2998v13.7998h-29.2998v22.2002h28.2998v13.7998h-28.2998v18.2002h29.2998v14
|
531 |
+
h-45.2998zM359.3 277h-17.5l35 -84.2002h8.60059l35.5 84.2002h-17.5l-22.2002 -55.2002zM303.4 280c-24.6006 0 -44.6006 -19.9004 -44.6006 -44.5996c0 -24.6006 19.9004 -44.6006 44.6006 -44.6006c24.5996 0 44.5996 19.9004 44.5996 44.6006
|
532 |
+
c0 24.5996 -19.9004 44.5996 -44.5996 44.5996zM254.1 273.9c-30.1992 15 -63.2998 -6.80078 -63.2998 -38c0 -32.5 33.6006 -52.5 63.2998 -38.2002v19c-19.2998 -19.2998 -46.7998 -5.7998 -46.7998 19.2002c0 23.6992 26.7002 39.0996 46.7998 19v19zM156.9 207.6
|
533 |
+
c-7.60059 0 -13.8008 3.7002 -17.5 10.8008l-10.3008 -9.90039c17.8008 -26.0996 56.6006 -18.2002 56.6006 11.2998c0 13.1006 -5.40039 19 -23.6006 25.6006c-9.59961 3.39941 -12.2998 5.89941 -12.2998 10.2998c0 8.7002 14.5 14.0996 24.9004 2.5l8.39941 10.7998
|
534 |
+
c-19.0996 17.0996 -49.6992 8.90039 -49.6992 -14.2998c0 -11.2998 5.19922 -17.2002 20.1992 -22.7002c25.7002 -9.09961 14.7002 -24.4004 3.30078 -24.4004zM55.4004 195c30.8994 0 44.0996 22.4004 44.0996 40.9004c0 24.0996 -18 41.0996 -44.0996 41.0996h-23.4004
|
535 |
+
v-82h23.4004zM122.9 195v82h-16v-82h16zM544 15v145c-33.2998 -20.7998 -226.4 -124.4 -416 -160h401c8.2002 0 15 6.7998 15 15zM74.0996 256.4c5.7002 -5 8.90039 -12.6006 8.90039 -20.5c0 -7.90039 -3.2002 -15.5 -8.90039 -20.7002
|
536 |
+
c-4.89941 -4.40039 -11.5996 -6.40039 -21.8994 -6.40039h-4.2002v54.2002h4.2002c10.2998 0 16.7002 -1.7002 21.8994 -6.59961z" />
|
537 |
+
<glyph glyph-name="cc-amex" unicode="" horiz-adv-x="576"
|
538 |
+
d="M325.1 280.2c0.100586 -8 -4.2998 -15.7002 -11.6992 -18.7002c9.5 -3.2998 11 -9.2002 11 -18.4004v-13.5h-16.6006c-0.299805 14.8008 3.60059 25.1006 -14.7998 25.1006h-18v-25.1006h-16.4004v69.3008l39.1006 -0.300781c13.2998 0 27.3994 -2 27.3994 -18.3994z
|
539 |
+
M295.7 268.9c5.7002 0 11 1.2998 11 7.89941c0 6.40039 -5.60059 7.40039 -10.7002 7.40039h-21v-15.2998h20.7002zM279 179.4c15.5996 0 27.9004 -5.40039 27.9004 -22.7002c0 -27.9004 -30.4004 -23.2998 -49.3008 -23.2998l-0.0996094 -23.3008h-32.2002l-20.3994 23
|
540 |
+
l-21.3008 -23h-65.3994l0.0996094 69.3008h66.5l20.5 -22.8008l21 22.8008h52.7002zM175.2 124.7l19 20.2002l-17.9004 20.1992h-41.7002v-12.5h36.3008v-14.0996h-36.3008v-13.7998h40.6006zM241 116.5v55.5l-25.2998 -27.4004zM278.8 147.5
|
541 |
+
c5.90039 0 10.5 2.7998 10.5 9.2002c0 6.09961 -4.59961 8.39941 -10.2002 8.39941h-21.5v-17.5996h21.2002zM247.2 284.2h-38.9004v-12.5h37.7998v-14.1006h-37.7998v-13.7998h38.9004v-14.2998h-55.5v69.2998h55.5v-14.5996zM576 192.6h-0.200195h0.200195zM381.4 160.7
|
542 |
+
c-0.100586 -7.60059 -4.2002 -15.2998 -11.9004 -18.4004c9.2002 -3.2998 11 -9.5 11 -18.3994l-0.0996094 -13.8008h-16.6006l0.100586 11.5c0 11.8008 -3.80078 13.8008 -14.8008 13.8008h-17.5996l-0.0996094 -25.3008h-16.6006l0.100586 69.3008h39.3994
|
543 |
+
c13 0 27.1006 -2.30078 27.1006 -18.7002zM352.2 149.5c5.59961 0 11 1.2998 11 8.2002c0 6.39941 -5.60059 7.39941 -10.7002 7.39941h-21v-15.5996h20.7002zM179.4 229.5h-16.8008v54.2002l-24 -54.2002h-14.5996l-24 54.2002v-54.2002h-33.7998l-6.40039 15.2998h-34.5
|
544 |
+
l-6.39941 -15.2998h-17.9004l29.7002 69.2998h24.5l28.0996 -65.7002v65.7002h27.1006l21.6992 -47l19.7002 47h27.6006v-69.2998zM31.2002 259.2h22.7002l-11.5 27.5996zM508.6 100.3c34.8008 0 54.8008 -2.2002 67.5 6.10059v-90.4004c0 -26.5 -21.5 -48 -48 -48h-480.1
|
545 |
+
c-26.5 0 -48 21.5 -48 48v203.7h26.5996c4.2002 10.0996 2.2002 5.2998 6.40039 15.2998h19.2002c4.2002 -10 2.2002 -5.2002 6.39941 -15.2998h52.9004v11.3994c2.2002 -5 1.09961 -2.5 5.09961 -11.3994h29.5c2.40039 5.5 2.60059 5.7998 5.10059 11.3994v-11.3994h135.5
|
546 |
+
v25.0996c6.39941 0 8 0.100586 9.7998 -0.200195c0 0 -0.200195 -10.8994 0.0996094 -24.7998h66.5v8.90039c7.40039 -5.90039 17.4004 -8.90039 29.7002 -8.90039h26.7998c4.2002 10.1006 2.2002 5.2998 6.40039 15.2998h19c6.5 -15 0.200195 -0.5 6.59961 -15.2998
|
547 |
+
h52.8008v21.9004c11.7998 -19.7002 7.7998 -12.9004 13.1992 -21.9004h41.6006v92h-39.9004v-18.3994c-12.2002 20.1992 -6.2998 10.3994 -11.2002 18.3994h-43.2998v-20.5996c-6.2002 14.5996 -4.59961 10.7998 -8.7998 20.5996h-32.4004
|
548 |
+
c-0.399414 0 -2.2998 -0.200195 -2.2998 0.299805h-27.5996c-12.7998 0 -23.1006 -3.19922 -30.7002 -9.2998v9.2998h-39.9004v-5.2998c-10.7998 6.10059 -20.6992 5.10059 -64.3994 5.2998c-0.100586 0 -11.6006 0.100586 -11.6006 0h-103
|
549 |
+
c-2.5 -6.09961 -6.7998 -16.3994 -12.5996 -30c-2.7998 6 -11 23.8008 -13.9004 30h-46v-21.0996c-7.39941 17.4004 -4.69922 11 -9 21.0996h-39.6992c-3.40039 -7.89941 -13.7002 -32 -23.1006 -53.8994v109.8c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48v-175.4
|
550 |
+
c-37.7002 0.200195 -44 0.900391 -54.2998 -5v5c-45.2998 0 -53.5 1.7002 -64.9004 -5.19922v5.19922h-78.1992v-5.09961c-11.4004 6.5 -21.4004 5.09961 -75.7002 5.09961v-5.59961c-6.2998 3.7002 -14.5 5.59961 -24.2998 5.59961h-58
|
551 |
+
c-3.5 -3.7998 -12.5 -13.6992 -15.7002 -17.1992c-12.7002 14.0996 -10.5 11.5996 -15.5 17.1992h-83.1006v-92.2998h82c3.30078 3.5 12.9004 13.9004 16.1006 17.4004c12.7002 -14.2998 10.2998 -11.7002 15.3994 -17.4004h48.9004
|
552 |
+
c0 14.7002 0.0996094 8.2998 0.0996094 23c11.5 -0.200195 24.3008 0.200195 34.3008 6.2002c0 -13.9004 -0.100586 -17.0996 -0.100586 -29.2002h39.6006c0 18.5 0.0996094 7.40039 0.0996094 25.2998c6.2002 0 7.7002 0 9.40039 -0.0996094
|
553 |
+
c0.0996094 -1.2998 0 0 0 -25.2002c152.8 0 145.899 -1.09961 156.699 4.5v-4.5zM544.9 164.8c-4.60059 0 -9.2002 -0.700195 -9.2002 -6.5c0 -12.2002 28.7998 0.299805 39.2998 -13.5v-25.7998c-4.90039 -7.09961 -14.0996 -8.90039 -22.5 -8.90039h-32l0.0996094 14.8008
|
554 |
+
h32c4.10059 0 8.40039 1.2998 8.40039 6.39941c0 14.6006 -42.7002 -5.59961 -42.7002 27.4004c0 14.0996 11 20.7002 23.7998 20.7002h32.9004v-14.6006h-30.0996zM487.9 125c4.09961 0 8.69922 1 8.7998 6.40039c0 14.8994 -42.7002 -5.60059 -42.7002 27.3994
|
555 |
+
c0 14.1006 10.7002 20.7002 23.5 20.7002h33.2002v-14.5996h-30.4004c-4.2998 0 -9.2002 -0.800781 -9.2002 -6.40039c0 -15.0996 42.9004 6.90039 42.9004 -26.2998c0 -16.4004 -11.4004 -22 -26.2002 -22h-32.2002l0.100586 14.7998h32.2002zM445.7 165.1h-38.5v-12.5
|
556 |
+
h37.7998v-14.0996h-37.9004v-13.7998l38.6006 -0.299805l-0.100586 -14.3008h-55.1992l0.0996094 69.3008h55.2002v-14.3008zM389.4 273.2c0.299805 0.299805 1.69922 1 7.2998 1c1 0 2 -0.100586 3.09961 -0.100586l-7.2998 -16.8994
|
557 |
+
c-2.2998 0 -3.2002 0.399414 -3.40039 0.5c-0.199219 0.200195 -1.09961 1.89941 -1.09961 7.89941c0 5.40039 1.09961 7.40039 1.40039 7.60059zM409.8 283.7h-0.0996094h0.0996094zM393.6 298.9h16.1006v-15.2002c-17.4004 0.299805 -33.1006 4.09961 -33.1006 -19.7002
|
558 |
+
c0 -11.7998 2.80078 -19.9004 16.1006 -19.9004h7.39941l23.5 54.5h24.8008l27.8994 -65.3994v65.3994h25.2998l29.1006 -48.0996v48.0996h16.8994v-69h-23.5996l-31.2002 51.9004v-51.9004h-33.7002l-6.59961 15.3008h-34.2998l-6.40039 -15.3008h-19.2002
|
559 |
+
c-22.7998 0 -33 11.8008 -33 34c0 23.3008 10.5 35.3008 34 35.3008zM435.7 286.8l-11.6006 -27.5996h22.8008zM334.6 298.8h16.9004v-69.2998h-16.9004v69.2998z" />
|
560 |
+
<glyph glyph-name="cc-paypal" unicode="" horiz-adv-x="576"
|
561 |
+
d="M186.3 189.8c0 -12.2002 -9.7002 -21.5 -22 -21.5c-9.2002 0 -16 5.2002 -16 15c0 12.2002 9.5 22 21.7002 22c9.2998 0 16.2998 -5.7002 16.2998 -15.5zM80.5 238.3c11.2998 0 19.7998 -1.5 17.5 -14.8994c-2 -12.7002 -10.5 -14.2002 -21.5 -14.2002l-8.2002 -0.299805
|
562 |
+
l4.2998 26.6992c0.200195 1.7002 1.7002 2.7002 3.2002 2.7002h4.7002zM364.5 238.3c8.5 0 18 -0.5 18.0996 -11.0996c0 -15 -9 -18 -22 -18l-8 -0.299805l4.2002 26.6992c0.200195 1.7002 1.40039 2.7002 3.2002 2.7002h4.5zM576 368v-352c0 -26.5 -21.5 -48 -48 -48h-480
|
563 |
+
c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48zM128.3 232.6c0 21 -16.2002 28 -34.7002 28h-40c-2.5 0 -5 -2 -5.19922 -4.69922l-16.4004 -102.101c-0.299805 -2 1.2002 -4 3.2002 -4h19c2.7002 0 5.2002 2.90039 5.5 5.7002l4.5 26.5996
|
564 |
+
c1 7.2002 13.2002 4.7002 18 4.7002c28.5996 0 46.0996 17 46.0996 45.7998zM212.5 223.8h-19c-3.7998 0 -4 -5.5 -4.2002 -8.2002c-5.7998 8.5 -14.2002 10 -23.7002 10c-24.5 0 -43.1992 -21.5 -43.1992 -45.1992c0 -19.5 12.1992 -32.2002 31.6992 -32.2002
|
565 |
+
c9 0 20.2002 4.89941 26.5 11.8994c-0.5 -1.5 -1 -4.69922 -1 -6.19922c0 -2.30078 1 -4 3.2002 -4h17.2002c2.7002 0 5 2.89941 5.5 5.69922l10.2002 64.3008c0.299805 1.89941 -1.2002 3.89941 -3.2002 3.89941zM253 125.9l63.7002 92.5996c0.5 0.5 0.5 1 0.5 1.7002
|
566 |
+
c0 1.7002 -1.5 3.5 -3.2002 3.5h-19.2002c-1.7002 0 -3.5 -1 -4.5 -2.5l-26.5 -39l-11 37.5c-0.799805 2.2002 -3 4 -5.5 4h-18.7002c-1.69922 0 -3.19922 -1.7998 -3.19922 -3.5c0 -1.2002 19.5 -56.7998 21.1992 -62.1006c-2.69922 -3.7998 -20.5 -28.5996 -20.5 -31.5996
|
567 |
+
c0 -1.7998 1.5 -3.2002 3.2002 -3.2002h19.2002c1.7998 0.100586 3.5 1.10059 4.5 2.60059zM412.3 232.6c0 21 -16.2002 28 -34.7002 28h-39.6992c-2.7002 0 -5.2002 -2 -5.5 -4.69922l-16.2002 -102c-0.200195 -2 1.2998 -4 3.2002 -4h20.5c2 0 3.5 1.5 4 3.19922l4.5 29
|
568 |
+
c1 7.2002 13.1992 4.7002 18 4.7002c28.3994 0 45.8994 17 45.8994 45.7998zM496.5 223.8h-19c-3.7998 0 -4 -5.5 -4.2998 -8.2002c-5.5 8.5 -14 10 -23.7002 10c-24.5 0 -43.2002 -21.5 -43.2002 -45.1992c0 -19.5 12.2002 -32.2002 31.7002 -32.2002
|
569 |
+
c9.2998 0 20.5 4.89941 26.5 11.8994c-0.299805 -1.5 -1 -4.69922 -1 -6.19922c0 -2.30078 1 -4 3.2002 -4h17.2998c2.7002 0 5 2.89941 5.5 5.69922l10.2002 64.3008c0.299805 1.89941 -1.2002 3.89941 -3.2002 3.89941zM544 257.1c0 2 -1.5 3.5 -3.2002 3.5h-18.5
|
570 |
+
c-1.5 0 -3 -1.19922 -3.2002 -2.69922l-16.1992 -104l-0.300781 -0.5c0 -1.80078 1.5 -3.5 3.5 -3.5h16.5c2.5 0 5 2.89941 5.2002 5.69922l16.2002 101.2v0.299805zM454 205.3c9.2998 0 16.2998 -5.7002 16.2002 -15.5c0 -12.2998 -9.7002 -21.5 -21.7002 -21.5
|
571 |
+
c-9.2002 0 -16.2002 5.2998 -16.2002 15c0 12.2998 9.5 22 21.7002 22z" />
|
572 |
+
<glyph glyph-name="cc-stripe" unicode="" horiz-adv-x="576"
|
573 |
+
d="M492.4 227.2c8.69922 0 18 -6.7002 18 -22.7002h-36.7002c0 16 9.7998 22.7002 18.7002 22.7002zM375 224.6c12.9004 0.100586 21.9004 -14.5 21.9004 -33.0996c0 -19.0996 -8.80078 -33.4004 -21.9004 -33.4004c-8.2998 0 -13.2998 3 -16.7998 6.7002l-0.200195 52.7998
|
574 |
+
c3.7002 4.10059 8.7998 7 17 7zM528 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480zM122.2 166.9c0 42.2998 -54.2998 34.6992 -54.2998 50.6992c0 5.5 4.59961 7.7002 12.0996 7.7002
|
575 |
+
c10.7998 0 24.5 -3.2998 35.2998 -9.09961v33.3994c-11.7998 4.7002 -23.5 6.5 -35.2998 6.5c-28.7998 0 -48 -15 -48 -40.1992c0 -39.3008 54 -32.9004 54 -49.9004c0 -6.59961 -5.7002 -8.7002 -13.5996 -8.7002c-11.8008 0 -26.9004 4.90039 -38.9004 11.2998v-33.8994
|
576 |
+
c13.2002 -5.7002 26.5996 -8.10059 38.7998 -8.10059c29.6006 0.200195 49.9004 14.7002 49.9004 40.3008zM191 223.5v30.2998h-26.9004v30.7998l-34.6992 -7.39941l-0.200195 -113.9c0 -21 15.7998 -36.5 36.8994 -36.5c11.6006 0 20.2002 2.10059 24.9004 4.7002v28.9004
|
577 |
+
c-4.5 -1.80078 -27 -8.30078 -27 12.5996v50.5h27zM265 221.1v32.7002h-0.0996094c-4.7002 1.7002 -21.3008 4.7998 -29.6006 -10.5l-2.2002 10.5h-30.6992v-124.5h35.5v84.4004c8.39941 11 22.5996 8.89941 27.0996 7.39941zM309.1 129.3v124.5h-35.6992v-124.5h35.6992z
|
578 |
+
M309.1 272.2v28.8994l-35.6992 -7.59961v-28.9004zM383.2 126.7c25.3994 0.0996094 48.5996 20.5 48.5996 65.5996c0 41.2998 -23.5 63.7998 -48.3994 63.7998c-13.9004 0 -22.9004 -6.59961 -27.8008 -11.0996l-1.7998 8.7998h-31.2998v-165.8l35.5 7.5l0.0996094 40.2002
|
579 |
+
c5.10059 -3.7002 12.7002 -9 25.1006 -9zM543.6 178.2c0.100586 2 0.400391 9.39941 0.400391 12.8994c0 36.4004 -17.5996 65.1006 -51.2998 65.1006c-33.7998 0 -54.2998 -28.7002 -54.2998 -64.9004c0 -42.7998 24.1992 -64.5 58.7998 -64.5
|
580 |
+
c17 0 29.7002 3.90039 39.3994 9.2002v28.5996c-9.69922 -4.89941 -20.7998 -7.89941 -34.8994 -7.89941c-13.7998 0 -26 4.89941 -27.6006 21.5h69.5z" />
|
581 |
+
<glyph glyph-name="lastfm" unicode="" horiz-adv-x="512"
|
582 |
+
d="M225.8 80.9004c0 0 -31.7002 -31.1006 -97.8994 -31.1006c-82.2002 0 -127.9 48.1006 -127.9 137.2c0 92.7002 45.7002 147.2 131.8 147.2c117.7 0 129.3 -66.2002 161.3 -163c14 -42.7998 38.7002 -73.9004 97.9004 -73.9004c39.9004 0 61 8.7998 61 30.5
|
583 |
+
c0 31.9004 -34.9004 35.1006 -79.7998 45.7002c-48.6006 11.7002 -68 36.9004 -68 76.7998c0 64 51.5996 83.9004 104.399 83.9004c59.8008 0 96.2002 -21.7002 100.9 -74.5l-58.5996 -7c-2.30078 25.2002 -17.5 35.7998 -45.7002 35.7998
|
584 |
+
c-25.7998 0 -41.6006 -11.7998 -41.6006 -31.7002c0 -17.5996 7.60059 -28.0996 33.4004 -34c52.2998 -11.5 115 -19.2002 115 -92.0996c0 -58.6006 -49.2998 -80.9004 -122 -80.9004c-101.4 0 -136.6 45.7002 -155.4 102.601
|
585 |
+
c-26.0996 81.5996 -34.3994 134.899 -100.899 134.899c-35.7002 0 -72.1006 -25.7998 -72.1006 -97.8994c0 -56.3008 28.7002 -91.5 69.2002 -91.5c45.7002 0 76.2002 34 76.2002 34z" />
|
586 |
+
<glyph glyph-name="lastfm-square" unicode=""
|
587 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM307.8 103.1c45.4004 0 76.2002 13.9004 76.1006 50.6006c0 45.5 -39.1006 50.3994 -71.8008 57.5
|
588 |
+
c-16.0996 3.7002 -20.8994 10.2998 -20.8994 21.2998c0 12.5 9.89941 19.7998 26 19.7998c17.5996 0 27.0996 -6.59961 28.5996 -22.3994l36.7002 4.39941c-2.90039 33 -25.5996 46.6006 -63 46.6006c-32.9004 0 -65.2002 -12.4004 -65.2002 -52.4004
|
589 |
+
c0 -24.9004 12.1006 -40.7002 42.5 -48c28.1006 -6.59961 49.9004 -8.7002 49.9004 -28.5996c0 -13.6006 -13.2002 -19.1006 -38.1006 -19.1006c-37 0 -52.3994 19.4004 -61.1992 46.2002c-20 60.5 -27.3008 101.9 -100.801 101.9c-53.8994 0 -82.5 -34.1006 -82.5 -92
|
590 |
+
c0 -55.7002 28.6006 -85.8008 79.9004 -85.8008c41.4004 0 61.2002 19.4004 61.2002 19.4004l-11.7002 31.9004s-19 -21.3008 -47.5996 -21.3008c-25.3008 0 -43.3008 22 -43.3008 57.2002c0 45.1006 22.7002 61.2002 45.1006 61.2002c41.5 0 46.7002 -33.2998 63 -84.2998
|
591 |
+
c11.7002 -35.5 33.7002 -64.1006 97.0996 -64.1006z" />
|
592 |
+
<glyph glyph-name="ioxhost" unicode="" horiz-adv-x="640"
|
593 |
+
d="M616 288c13.2998 0 24 -10.7002 24 -24c0 -13.2002 -10.7002 -24 -24 -24h-52.7002c3.10059 -15.5 4.7002 -31.5996 4.7002 -48c0 -137 -111 -248 -248 -248c-102.9 0 -191.2 62.7002 -228.7 152h-67.2998c-13.2998 0 -24 10.7002 -24 24c0 13.2002 10.7002 24 24 24
|
594 |
+
h52.7002c-3.10059 15.5 -4.7002 31.5996 -4.7002 48c0 137 111 248 248 248c102.9 0 191.2 -62.7002 228.7 -152h67.2998zM520 192c0 16.5996 -2 32.5996 -5.7998 48h-298.2c-13.2998 0 -24 10.7002 -24 24c0 13.2002 10.7002 24 24 24h279.5
|
595 |
+
c-33.9004 62 -99.7998 104 -175.5 104c-110.5 0 -200 -89.5 -200 -200c0 -16.5996 2 -32.5996 5.7998 -48h298.2c13.2998 0 24 -10.7002 24 -24c0 -13.2002 -10.7002 -24 -24 -24h-279.5c33.9004 -62 99.7998 -104 175.5 -104c110.5 0 200 89.5 200 200zM216 216h208
|
596 |
+
c13.2998 0 24 -10.7002 24 -24c0 -13.2002 -10.7002 -24 -24 -24h-208c-13.2998 0 -24 10.7002 -24 24c0 13.2002 10.7002 24 24 24z" />
|
597 |
+
<glyph glyph-name="angellist" unicode=""
|
598 |
+
d="M347.1 232.6c48 -11.6992 54.9004 -50.5996 54.9004 -93.6992c0 -114.301 -73.4004 -202.9 -191.4 -202.9c-96.1992 0 -164.6 76.4004 -164.5 148.6c0 37.1006 14.2002 61.7002 51.1006 71.7002c-3.10059 8.2998 -8 20.7998 -8 29.7002
|
599 |
+
c0 23.5 24.8994 52.5996 48.2998 52.5996c6.90039 0 13.7002 -2 20 -4.2998c-12.4004 35.2002 -46.5996 126.7 -46.5996 162c0 28.7998 14.5996 51.7002 45.6992 51.7002c40 0 85.4004 -144 95.1006 -172.5c12.5 31.4004 52.5 163.1 97.0996 163.1
|
600 |
+
c28 0 43.7002 -22.2998 43.7002 -48.8994c0 -30.2002 -33.7002 -124.5 -45.4004 -157.101zM311.7 340l-33.1006 -93.7002l34 -6c8.5 23.4004 47.1006 128.9 47.1006 148c0 7.10059 -2.2998 16 -10.9004 16c-16 0 -33.0996 -52 -37.0996 -64.2998zM142.3 399.7
|
601 |
+
c0 -29.1006 34.6006 -120 45.5 -148.8c7.7002 4.39941 19.7998 2.69922 35.4004 1.39941l-34.6006 100.3c-31.7998 92.8008 -46.2998 59 -46.2998 47.1006zM140 204c-7.7002 0 -20.2998 -13.4004 -20.4004 -21.0996c0 -20.8008 56 -97.7002 76.9004 -97.7002
|
602 |
+
c5.7002 0 10.5996 6.2998 10.5996 11.3994c0 12.8008 -37.7998 107.4 -67.0996 107.4zM324.3 17.7002c55.2998 61.5 49.1006 158.6 31 174.7c-24 21.0996 -106 29.0996 -138.3 29.0996c-17.2998 0 -17.4004 -6.40039 -17.4004 -13.0996
|
603 |
+
c0 -43.7002 92.9004 -39.7002 120.601 -39.7002c11.2002 0 15.7998 -9.90039 16.8994 -21.1006c-7.39941 -7.39941 -17.6992 -11.6992 -27.3994 -15.3994c-9.40039 -3.40039 -19.1006 -7.10059 -27.1006 -13.1006c-22 -16 -43.6992 -43.3994 -43.6992 -71.6992
|
604 |
+
c0 -17.7002 10.5996 -32.9004 10.5996 -50.3008c0 -0.299805 -2 -6.5 -2 -7.39941c-32.5996 2.2998 -40.5996 34.5996 -41.7002 61.7002c-3.39941 -0.900391 -8 -0.600586 -11.7002 -0.600586c5.10059 -17.7998 -11.8994 -42 -38 -42
|
605 |
+
c-37.7998 0 -88 57.2002 -58.2998 86.9004c28.7002 -35.9004 35 -51.4004 51.1006 -51.4004c4 0 11.6992 3.40039 11.6992 8.2998c0 12.8008 -42.8994 73.1006 -54.2998 73.1006c-16.7998 0 -37.7002 -24.9004 -20.5996 -68.2998
|
606 |
+
c22.5996 -55.7002 69.5 -88.3008 128.899 -88.3008c43.4004 0 80.6006 16.6006 109.7 48.6006zM225.7 143.7c3.2002 -8.2998 6.59961 -16.6006 9.39941 -25.1006c6.30078 7.10059 12.9004 13.7002 20.3008 19.1006c-10 2 -20 2.89941 -29.7002 6z" />
|
607 |
+
<glyph glyph-name="buysellads" unicode=""
|
608 |
+
d="M224 297.3l42.9004 -160.7h-85.8008zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM382.7 42.7002l-94.5 298.7h-128.4l-94.5 -298.7h90.7002l111.7 91.5996l24.2002 -91.5996h90.7998z
|
609 |
+
" />
|
610 |
+
<glyph glyph-name="connectdevelop" unicode="" horiz-adv-x="576"
|
611 |
+
d="M550.5 207c6.69629 -1.33887 11.7861 -7.5 11.7881 -14.7324c0 -7.5 -5.3584 -13.6602 -12.3223 -15l-54.9111 -95.3574c0.536133 -1.60742 0.804688 -3.21387 0.804688 -4.82129c0 -7.23145 -5.09082 -13.3926 -12.0547 -14.7314l-51.6963 -90.2686
|
612 |
+
c0.535156 -1.33887 0.802734 -2.67773 0.802734 -4.28516c0 -8.30371 -6.69727 -15.2676 -15.2686 -15.2676c-4.28516 0 -8.30371 1.875 -10.9814 4.82129h-107.144c-2.67871 -3.21484 -6.96484 -5.35742 -11.5176 -5.35742s-8.83887 2.14258 -11.5166 5.35645h-106.875
|
613 |
+
c-2.67969 -3.21484 -6.69727 -5.35742 -11.5186 -5.35742c-8.30371 0 -15.2676 6.69727 -15.2676 15.2676c0 1.875 0.535156 3.75 1.07031 5.35742l-51.6963 89.7324c-6.96484 1.33887 -12.0547 7.5 -12.0547 14.7314c0 1.875 0.268555 3.21387 0.804688 4.82129
|
614 |
+
l-55.1797 95.3574c-6.96484 1.60742 -12.0537 7.76855 -12.0537 15c0 7.5 5.3584 13.6611 12.5898 15l53.3047 92.1436c0 0.536133 -0.268555 1.07227 -0.268555 1.60645c0 6.16113 3.75098 11.251 9.10742 13.6611l55.9824 97.2334
|
615 |
+
c-0.536133 1.33887 -1.07129 3.21387 -1.07129 4.82129c0 8.57129 6.96484 15.2676 15.2676 15.2676c4.82227 0 8.83887 -2.14258 11.7861 -5.625h106.071c2.67871 3.48242 6.69629 5.625 11.5176 5.625s8.83887 -2.14258 11.5176 -5.62402h106.606
|
616 |
+
c2.94727 3.48242 6.96484 5.625 11.7861 5.625c8.30371 0 15.2676 -6.69727 15.2676 -15.2676c0 -1.60742 -0.535156 -3.21484 -1.07031 -4.82129l55.4463 -95.8936c8.03613 -0.267578 14.7324 -6.96484 14.7324 -15.001c0 -2.67871 -0.803711 -5.08984 -1.875 -7.23145z
|
617 |
+
M153.535 -2.73242v75.8037h-43.6602zM153.535 81.1074v50.624l-44.999 -47.4102c0.535156 -1.07227 1.07129 -2.14355 1.33887 -3.21387h43.6602zM153.535 143.518l0.000976562 92.9463l-50.0889 51.9648c-2.41113 -1.60645 -5.08887 -2.41113 -7.76855 -2.67871
|
618 |
+
l-51.9648 -90c0.268555 -1.07227 0.268555 -2.14258 0.268555 -3.48242c0 -1.33887 0 -2.67871 -0.535156 -4.01758l55.7129 -96.4287c1.33887 -0.267578 2.67871 -1.07129 4.01758 -1.60742zM153.535 245.84v72.0527l-43.9277 -15.8037
|
619 |
+
c0 -0.267578 0.267578 -0.803711 0.267578 -1.07227c0 -2.94531 -0.803711 -5.62402 -2.14258 -7.7666zM153.535 326.465v59.7324l-43.6602 -75.5361zM480.054 287.357l-0.267578 0.267578l-98.0361 -101.518l63.75 -67.2324l35.3584 167.143zM291.75 92.8926
|
620 |
+
l-11.25 -11.7852h22.7676zM291.482 104.143l79.2852 82.2324l-83.0352 87.5889l-79.5537 -84.375zM296.839 98.25l16.875 -17.1426h124.02l5.8916 28.125l-67.5 71.25zM410.411 403.607l-117.053 -124.019l83.0342 -87.5889l97.5 101.25
|
621 |
+
c-1.33984 2.14258 -2.14258 4.82129 -2.14258 7.7666v0.536133l-57.8574 100.714c-1.33984 0.268555 -2.41016 0.804688 -3.48145 1.34082zM401.304 405.75h-4.28711l-166.339 -60l57.0547 -60.2676zM277.821 405.75h-103.929l50.8936 -53.5713l148.393 53.5713h-75
|
622 |
+
c-2.67871 -2.67773 -6.16016 -4.28516 -10.1787 -4.28516s-7.50098 1.60742 -10.1787 4.28516zM161.572 400.125v-70.7148l54.9111 19.8213l-51.1611 53.8398c-0.730469 -0.25293 -1.93066 -0.613281 -2.67969 -0.804688zM161.572 320.839v-83.3037l40.9814 -42.0527
|
623 |
+
l79.5537 84.1064l-59.7324 63.2139zM161.572 228.161v-76.0723l36.4277 38.3037zM161.572 140.303v-59.1953h107.678l17.1426 17.6777l-82.7676 85.9814zM168.536 -21.75h1.33887l91.6074 94.8213h-99.9102v-89.7324l1.07031 -1.60645
|
624 |
+
c2.41113 -0.804688 4.28613 -1.875 5.89355 -3.48242zM298.447 -21.75h104.194l-91.6064 94.8213h-38.3037l-91.6074 -94.8213h96.4287c2.68066 2.41016 6.42871 4.28516 10.4473 4.28516s7.76758 -1.875 10.4473 -4.28516zM418.447 -9.96387l17.4121 83.0361h-114.376
|
625 |
+
l89.1953 -91.875c1.07227 0.536133 2.14355 1.07031 3.48242 1.33887zM431.303 12.2676l34.8223 60.8037h-21.9639zM466.125 81.1074c0.267578 1.07129 0.803711 2.14258 1.33887 2.94531l-17.1426 18.2139l-4.55371 -21.1592h20.3574zM532.286 188.518
|
626 |
+
c-0.268555 1.33984 -0.536133 2.41113 -0.536133 3.75c0 1.60742 0.536133 2.94629 0.802734 4.28516l-45.8027 79.2861l-34.5537 -163.928l20.625 -21.9639c1.33887 0.802734 2.67871 1.33887 4.01758 1.87402z" />
|
627 |
+
<glyph glyph-name="dashcube" unicode=""
|
628 |
+
d="M326.6 344l102.2 104v-427c0 -50.5 -40.0996 -85 -91.2002 -85h-227.199c-51.1006 0 -91.2002 34.5 -91.2002 85v229.5c0 50.2002 40.0996 93.5 91.2002 93.5h216.199zM153.9 31.5v-0.0996094h223.8l-51.1006 52.2998v123.5c0 17.7002 -14.2998 32.5 -32 32.5h-140.699
|
629 |
+
c-17.7002 0 -32.4004 -14.7998 -32.4004 -32.5v-142.9c0 -17.7002 14.7002 -32.7998 32.4004 -32.7998z" />
|
630 |
+
<glyph glyph-name="forumbee" unicode=""
|
631 |
+
d="M5.7998 138.3c-3.7998 17 -5.7998 34.2002 -5.7998 51.4004c0 123.3 99.7998 223.3 223.1 223.3c16.6006 0 33.3008 -2 49.3008 -5.5c-123.4 -47 -220.5 -145.5 -266.601 -269.2zM398.7 327.5c-151.101 -44 -269.2 -164.4 -312.3 -315.7
|
632 |
+
c-17.2002 13.4004 -32.7002 30.9004 -45.2002 49c43.3994 149.9 160.1 267.7 309.7 312c18.0996 -12.5996 34.0996 -27.7998 47.7998 -45.2998zM414.5 74.7998c13.0996 -35.2998 24.2002 -73.2998 33.5 -109.8c-36.0996 9.2998 -72 20.5 -107 33.5996
|
633 |
+
c-25.7002 -16 -54.5996 -26.8994 -84.5996 -31.2998c42.5996 79.7002 108.199 147.4 187.6 190.3c-4.09961 -29.0996 -14.2998 -57.6992 -29.5 -82.7998zM444.2 220.3c-113.7 -46.7002 -204.2 -139.399 -250.5 -253.5c-19.6006 2.7002 -38.5 7.60059 -56.6006 15.2002
|
634 |
+
c44.9004 138.5 153.4 249.3 291.301 295.1c7.89941 -18.0996 13.1992 -37.2998 15.7998 -56.7998z" />
|
635 |
+
<glyph glyph-name="leanpub" unicode="" horiz-adv-x="576"
|
636 |
+
d="M386.539 336.515l15.0957 -248.955l-10.9785 0.275391c-36.2324 0.824219 -71.6406 -8.7832 -102.657 -27.9971c-31.0156 19.2139 -66.4238 27.9971 -102.657 27.9971c-45.5635 0 -82.0693 -10.7051 -123.516 -27.7227l31.291 258.288
|
637 |
+
c28.5459 11.8027 61.4834 18.1143 92.2256 18.1143c41.1729 0 73.8359 -13.1748 102.657 -42.5439c27.7227 28.2715 59.0127 41.7217 98.5391 42.5439zM569.07 0c-25.5264 0 -47.4854 5.21484 -70.542 15.6445c-34.3105 15.6455 -69.9932 24.9785 -107.871 24.9785
|
638 |
+
c-38.9775 0 -74.9346 -12.9014 -102.657 -40.623c-27.7227 27.7227 -63.6797 40.623 -102.657 40.623c-37.8779 0 -73.5605 -9.33301 -107.871 -24.9785c-22.2324 -9.88086 -44.7402 -15.6445 -69.1689 -15.6445h-1.37305l42.5449 349.141
|
639 |
+
c39.251 22.2334 87.0117 34.8594 132.301 34.8594c37.0547 0 75.209 -7.68457 106.225 -29.0947c31.0156 21.4102 69.1699 29.0947 106.225 29.0947c45.2891 0 93.0498 -12.626 132.301 -34.8594zM525.702 44.7412l-34.0361 280.246
|
640 |
+
c-30.7422 13.999 -67.248 21.4102 -101.009 21.4102c-38.4287 0 -74.3848 -12.0771 -102.657 -38.7021c-28.2725 26.625 -64.2275 38.7021 -102.657 38.7021c-33.7607 0 -70.2666 -7.41113 -101.009 -21.4102l-34.0361 -280.246
|
641 |
+
c47.2109 19.4863 82.8945 33.4854 135.045 33.4854c37.6045 0 70.8174 -9.60547 102.657 -29.6436c31.8398 20.0381 65.0518 29.6436 102.657 29.6436c52.1504 0 87.834 -13.999 135.045 -33.4854z" />
|
642 |
+
<glyph glyph-name="sellsy" unicode="" horiz-adv-x="640"
|
643 |
+
d="M539.71 210.692c55.1572 -13.4834 94.0742 -63.124 94.0732 -119.509c0 -68.0264 -55.4639 -123.184 -123.185 -123.184h-381.197c-67.7217 0 -123.186 55.1572 -123.185 123.185c0 47.4961 27.8848 91.0098 70.7852 111.234
|
644 |
+
c-2.14453 7.35449 -3.06543 15.0146 -3.06543 22.3691c0 46.2705 37.6914 83.9609 83.9629 83.9609c20.2227 0 39.835 -7.35449 55.1562 -20.5303c18.3867 74.7695 85.8008 127.781 163.021 127.781c92.542 0 167.924 -75.3818 167.924 -167.924
|
645 |
+
c0 -12.5635 -1.22559 -25.127 -4.29004 -37.3838zM199.88 46.4463v110.928c0 8.27344 -7.04688 15.3213 -15.3213 15.3213h-30.9482c-8.27344 0 -15.3213 -7.04785 -15.3213 -15.3213v-110.928c0 -8.27344 7.04688 -15.3213 15.3213 -15.3213h30.9482
|
646 |
+
c8.27344 0 15.3213 7.04688 15.3213 15.3213zM289.357 46.4463v131.458c0 8.27246 -7.04883 15.3203 -15.3223 15.3203h-30.9492c-8.27246 0 -15.3213 -7.04688 -15.3213 -15.3203v-131.458c0 -8.27344 7.04688 -15.3213 15.3213 -15.3213h30.9492
|
647 |
+
c8.27344 0 15.3223 7.04688 15.3223 15.3213zM378.834 46.4463v162.714c0 8.27246 -7.04688 15.3213 -15.3213 15.3213h-30.9482c-8.27441 0 -15.3223 -7.04785 -15.3223 -15.3213v-162.714c0 -8.27344 7.04785 -15.3213 15.3223 -15.3213h30.9482
|
648 |
+
c8.27441 0 15.3213 7.04688 15.3213 15.3213zM465.861 46.4463v224.612c0 8.58008 -7.04785 15.6279 -15.3223 15.6279h-28.4971c-8.27441 0 -15.3213 -7.04883 -15.3213 -15.6279v-224.612c0 -8.27344 7.04688 -15.3213 15.3213 -15.3213h28.4971
|
649 |
+
c8.27441 0 15.3223 7.04688 15.3223 15.3213z" />
|
650 |
+
<glyph glyph-name="shirtsinbulk" unicode=""
|
651 |
+
d="M100 37.7002l4.40039 9.89941l30.5996 -13.3994l-4.40039 -9.90039zM139.4 20.2002l4.39941 9.89941l30.6006 -13.3994l-4.40039 -9.90039zM311.5 34.2002l30.5996 13.3994l4.40039 -9.89941l-30.5996 -13.4004zM179.1 3l4.40039 9.59961l30.2998 -13.3994
|
652 |
+
l-4.39941 -9.90039zM60.4004 55.2002l4.39941 9.89941l30.6006 -13.6992l-4.40039 -9.60059zM271.8 16.7002l30.6006 13.3994l4.39941 -9.89941l-30.5996 -13.4004zM232.5 -0.799805l30.5996 13.3994l4.40039 -9.59961l-30.5996 -13.7002zM350.9 51.4004l30.5996 13.6992
|
653 |
+
l4.40039 -9.89941l-30.6006 -13.4004zM170 401.4v-10.5h-33.5v10.5h33.5zM122.8 401.4l-0.0996094 -10.5h-33.5v10.5h33.5996zM75.5 401.4l0.0996094 -10.5h-33.2998v10.5h33.2002zM217 401.4v-10.5h-33.2002v10.5h33.2002zM311.5 401.4v-10.5h-33.5v10.5h33.5zM358.8 401.4
|
654 |
+
v-10.5h-33.5v10.5h33.5zM264.2 401.4v-10.5h-33.2002v10.5h33.2002zM405.7 401.4v-10.5h-33.2998v10.5h33.2998zM52.7998 96.9004v-33.5h-10.7998v33.5h10.7998zM122.8 312.8l-0.0996094 -10.5h-33.5v10.5h33.5996zM52.7998 302.2v-23h-10.7998v33.5h33.5996v-10.5h-22.7998
|
655 |
+
zM221.7 73.5996c-50.2002 0 -91.2998 40.8008 -91.2998 91.3008c0 50.1992 41.0996 91.2998 91.2998 91.2998c50.5 0 91.2998 -41.1006 91.2998 -91.2998c0 -50.5 -40.7998 -91.3008 -91.2998 -91.3008zM173.5 184.7c0 -44.2998 77.5996 -11.9004 77.5996 -38
|
656 |
+
c0 -13.1006 -24 -14.2998 -32.6992 -14.2998c-12.3008 0 -29.8008 2.69922 -35.9004 14.8994h-0.900391l-9 -18.3994c14.8008 -9.30078 29.1006 -12.2002 47.2002 -12.2002c19.5 0 51 5.7998 51 31.2002c0 48.0996 -78.5 16.2998 -78.5 37.8994
|
657 |
+
c0 13.1006 20.7998 14.9004 29.7998 14.9004c10.8008 0 29.2002 -3.2002 35.6006 -13.1006h0.899414l8.80078 16.9004c-15.1006 6.2002 -27.4004 12 -44.3008 12c-20.0996 0 -49.5996 -6.40039 -49.5996 -31.7998zM52.7998 269.6v-33.5996h-10.7998v33.5996h10.7998z
|
658 |
+
M395.2 63.4004v33.5h10.7998v-33.5h-10.7998zM52.7998 140.1v-33.5h-10.7998v33.5h10.7998zM0 444.3h448v-406l-226.3 -98.5996l-221.7 98.5996v406zM418.8 57.2002h0.100586v270.1h-389.7v-270.1l192.8 -85.7002zM418.8 356.5h0.100586v58.5996h-389.7v-58.5996h389.6z
|
659 |
+
M52.7998 226.4v-33.5h-10.7998v33.5h10.7998zM52.7998 183.2v-33.5h-10.7998v33.5h10.7998zM170 312.8v-10.5h-33.5v10.5h33.5zM395.2 149.7v33.5h10.7998v-33.5h-10.7998zM395.2 192.9v33.5h10.7998v-33.5h-10.7998zM217 312.8v-10.5h-33.2002v10.5h33.2002zM395.2 236
|
660 |
+
v33.5h10.7998v-33.5h-10.7998zM395.2 106.5v33.5h10.7998v-33.5h-10.7998zM264.2 312.8v-10.5h-33.2002v10.5h33.2002zM311.5 312.8v-10.5h-33.5v10.5h33.5zM395.2 279.2l0.0996094 23h-22.7998v10.5h33.5v-33.5h-10.7998zM358.8 312.8v-10.5h-33.5v10.5h33.5z" />
|
661 |
+
<glyph glyph-name="simplybuilt" unicode="" horiz-adv-x="512"
|
662 |
+
d="M481.2 384c14.7002 0 26.5 -11.7998 26.7002 -26.2998v-331.4c0 -14.5 -11.8008 -26.2998 -26.6006 -26.2998h-450.399c-14.8008 0 -26.6006 11.7998 -26.6006 26.2998v331.4c0 14.5 11.7998 26.2998 26.4004 26.2998h106c14.5996 0 26.5996 -11.7998 26.5996 -26.2998
|
663 |
+
v-39.6006h185.3v39.6006c0 14.5 12.1006 26.2998 26.6006 26.2998h106zM149.8 92.2002c36.9004 0 66.6006 29.7002 66.6006 66.3994c0 36.9004 -29.7002 66.6006 -66.6006 66.6006c-36.7002 0 -66.3994 -29.7002 -66.3994 -66.6006
|
664 |
+
c0 -36.6992 29.7998 -66.3994 66.3994 -66.3994zM362.2 92.2002c36.5996 0 66.3994 29.7002 66.3994 66.5996c0 36.7002 -29.7998 66.4004 -66.3994 66.4004c-36.9004 0 -66.6006 -29.7998 -66.6006 -66.4004c0 -36.8994 29.7002 -66.5996 66.6006 -66.5996z" />
|
665 |
+
<glyph glyph-name="skyatlas" unicode="" horiz-adv-x="640"
|
666 |
+
d="M640 118.7c0 -65.9004 -52.5 -114.4 -117.5 -114.4c-165.9 0 -196.6 249.7 -359.7 249.7c-146.899 0 -147.1 -212.2 5.60059 -212.2c42.5 0 90.8994 17.7998 125.3 42.5c5.59961 4.10059 16.8994 16.2998 22.7998 16.2998s10.9004 -5 10.9004 -10.8994
|
667 |
+
c0 -7.7998 -13.1006 -19.1006 -18.7002 -24.1006c-40.9004 -35.5996 -100.3 -61.1992 -154.7 -61.1992c-83.4004 -0.100586 -154 59 -154 144.899c0 85.9004 67.5 149.101 152.8 149.101c185.3 0 222.5 -245.9 361.9 -245.9c99.8994 0 94.7998 139.7 3.39941 139.7
|
668 |
+
c-17.5 0 -35 -11.6006 -46.8994 -11.6006c-8.40039 0 -15.9004 7.2002 -15.9004 15.6006c0 11.5996 5.2998 23.7002 5.2998 36.2998c0 66.5996 -50.8994 114.7 -116.899 114.7c-53.1006 0 -80 -36.9004 -88.7998 -36.9004c-6.2002 0 -11.2002 5 -11.2002 11.2002
|
669 |
+
c0 5.59961 4.09961 10.2998 7.7998 14.4004c25.2998 28.7998 64.7002 43.6992 102.8 43.6992c79.4004 0 139.101 -58.3994 139.101 -137.8c0 -6.89941 -0.300781 -13.7002 -1.2002 -20.5996c11.8994 3.09961 24.0996 4.7002 35.8994 4.7002
|
670 |
+
c60.7002 0 111.9 -45.3008 111.9 -107.2z" />
|
671 |
+
<glyph glyph-name="pinterest-p" unicode="" horiz-adv-x="384"
|
672 |
+
d="M204 441.5c94.2002 0 180 -64.7998 180 -164.1c0 -93.3008 -47.7002 -196.801 -153.9 -196.801c-25.1992 0 -57 12.6006 -69.2998 36c-22.7998 -90.2998 -21 -103.8 -71.3994 -172.8c-5.2002 -1.89941 -3.5 -2.2998 -6.90039 1.5c-1.7998 18.9004 -4.5 37.5 -4.5 56.4004
|
673 |
+
c0 61.2002 28.2002 149.7 42 209.1c-7.5 15.2998 -9.59961 33.9004 -9.59961 50.7002c0 80 93.8994 92 93.8994 25.7998c0 -39 -26.3994 -75.5996 -26.3994 -113.399c0 -25.8008 21.2998 -43.8008 46.1992 -43.8008c69 0 90.3008 99.6006 90.3008 152.7
|
674 |
+
c0 71.1006 -50.4004 109.8 -118.5 109.8c-79.2002 0 -140.4 -57 -140.4 -137.399c0 -38.7002 23.7002 -58.5 23.7002 -67.7998c0 -7.80078 -5.7002 -35.4004 -15.6006 -35.4004c-24 0 -63.5996 40 -63.5996 110.4c0 110.699 101.4 179.1 204 179.1z" />
|
675 |
+
<glyph glyph-name="whatsapp" unicode=""
|
676 |
+
d="M380.9 350.9c41.8994 -42 67.0996 -97.7002 67.0996 -157c0 -122.4 -101.8 -222 -224.1 -222h-0.100586c-37.2002 0 -73.7002 9.2998 -106.1 27l-117.7 -30.9004l31.5 115c-19.4004 33.7002 -29.5996 71.9004 -29.5996 111c0 122.4 99.5996 222 222 222
|
677 |
+
c59.2998 0 115.1 -23.0996 157 -65.0996zM223.9 9.2998c101.699 0 186.6 82.7998 186.6 184.601c0.0996094 49.2998 -21.2998 95.5996 -56.0996 130.5c-34.8008 34.8994 -81.1006 54.0996 -130.4 54.0996c-101.8 0 -184.6 -82.7998 -184.6 -184.5
|
678 |
+
c0 -34.9004 9.69922 -68.7998 28.1992 -98.2002l4.40039 -7l-18.5996 -68.0996l69.7998 18.2998l6.7002 -4c28.2998 -16.7998 60.7998 -25.7002 94 -25.7002zM325.1 147.5c5.5 -2.7002 9.2002 -4.09961 10.5 -6.59961c1.40039 -2.30078 1.40039 -13.4004 -3.19922 -26.4004
|
679 |
+
c-4.60059 -13 -26.7002 -24.7998 -37.4004 -26.4004c-17.5996 -2.59961 -31.4004 -1.2998 -66.5996 13.9004c-55.7002 24.0996 -92 80.0996 -94.8008 83.7998c-2.69922 3.7002 -22.5996 30.1006 -22.5996 57.4004s14.2998 40.7002 19.4004 46.2998
|
680 |
+
c5.09961 5.5 11.0996 6.90039 14.7998 6.90039s7.39941 0 10.5996 -0.200195c3.40039 -0.200195 8 1.2998 12.5 -9.5c4.60059 -11.1006 15.7002 -38.4004 17.1006 -41.2002c1.39941 -2.7998 2.2998 -6 0.5 -9.7002c-10.6006 -21.2002 -22 -20.5 -16.3008 -30.2998
|
681 |
+
c21.5 -36.9004 42.9004 -49.7002 75.5 -66c5.5 -2.7998 8.80078 -2.2998 12 1.40039c3.30078 3.7998 13.9004 16.1992 17.6006 21.7998c3.7002 5.59961 7.39941 4.7002 12.5 2.7998c5.09961 -1.7998 32.3994 -15.2002 37.8994 -18z" />
|
682 |
+
<glyph glyph-name="viacoin" unicode="" horiz-adv-x="384"
|
683 |
+
d="M384 416l-48 -112h48v-48h-68.5l-13.7998 -32h82.2998v-48h-102.8l-89.2002 -208l-89.2002 208h-102.8v48h82.2998l-13.7998 32h-68.5v48h48l-48 112h64l80.7998 -192h94.5l80.7002 192h64zM192 112l27 64h-54z" />
|
684 |
+
<glyph glyph-name="medium" unicode=""
|
685 |
+
d="M0 416h448v-448h-448v448zM372.2 309.9v5h-83.2002l-59.2998 -147.9l-67.4004 148h-87.2998v-5.09961l28.0996 -33.9004c2.80078 -2.5 4.2002 -6.09961 3.80078 -9.7998v-133c0.799805 -4.7998 -0.700195 -9.7002 -4.10059 -13.2002l-31.5996 -38.2998v-5.10059h89.7998
|
686 |
+
v5.10059l-31.5996 38.2998c-3.40039 3.5 -5.10059 8.40039 -4.40039 13.2002v115l78.7002 -171.601h9.09961l67.6006 171.601v-136.9c0 -3.59961 0 -4.2998 -2.40039 -6.7002l-24.2998 -23.5996v-4.90039h118v5.10059l-23.5 23
|
687 |
+
c-2.10059 1.5 -3.10059 4.09961 -2.7002 6.7002v169.3c-0.400391 2.5 0.599609 5.09961 2.7002 6.7002z" />
|
688 |
+
<glyph glyph-name="y-combinator" unicode=""
|
689 |
+
d="M448 416v-448h-448v448h448zM236 160.5l77.5 145.5h-32.7002l-45.7998 -91c-4.7002 -9.2998 -9 -18.2998 -12.7998 -26.7998l-12.2002 26.7998l-45.2002 91h-35l76.7002 -143.8v-94.5h29.5v92.7998z" />
|
690 |
+
<glyph glyph-name="optin-monster" unicode="" horiz-adv-x="576"
|
691 |
+
d="M572.6 26.5996c1 -3.5 1.90039 -7 1.7002 -10.6992c0.799805 -31.6006 -44.2998 -64 -73.5 -65.1006c-17.2998 -0.799805 -34.5996 8.40039 -42.7002 23.5c-113.5 -4.09961 -227 -4.89941 -340.199 0c-8.40039 -15.0996 -25.7002 -24 -43 -23.5
|
692 |
+
c-28.9004 1.10059 -74 33.5 -73.5 65.1006c0.299805 3.7998 0.799805 7.2998 1.89941 10.7998c-5.59961 9.39941 -4.7998 15.2998 5.40039 11.5996c3.2998 5.2002 7 9.5 11.0996 13.7998c-2.5 10.9004 1.2998 14.1006 11.1006 9.2002c4.5 3.2998 10 6.5 15.8994 9.2002
|
693 |
+
c0 15.7998 11.7998 11.2002 17.2998 5.7002c12.5 1.7998 20.2002 -0.700195 26.8008 -5.7002v19.7002c-12.9004 0 -40.6006 11.3994 -45.9004 36.2002c-5 20.7998 2.59961 38.0996 25.0996 47.5996c0.800781 5.90039 8.10059 14 14.9004 15.9004
|
694 |
+
c7.59961 1.89941 12.5 -4.60059 14.0996 -10.3008c7.40039 0 17.8008 -1.5 21.1006 -8.09961c5.39941 0.5 11.0996 1.40039 16.5 1.90039c-2.40039 1.89941 -5.10059 3.5 -8.10059 4.59961c-5.09961 8.90039 -13.7998 11.0996 -24.5996 11.5996
|
695 |
+
c0 0.800781 0 1.60059 0.299805 2.7002c-19.7998 0.5 -44.0996 5.60059 -54.8994 17.7998c-21.3008 23.6006 -15.9004 83.6006 12.1992 103.5c8.40039 5.7002 21.6006 0.800781 22.7002 -9.69922c2.40039 -20.6006 0.400391 -26.8008 26.2002 -25.9004
|
696 |
+
c8.09961 7.7998 16.7998 14.5996 26.5 20c-14.9004 1.2998 -28.9004 -1.59961 -43.7998 -3.7998c12.7002 12.5 23.8994 25.3994 56.7002 42.3994c23.5 11.9004 50 20.8008 76.1992 23.2002c-18.5996 7.90039 -40 11.9004 -59.6992 16.5
|
697 |
+
c76.5 16.2002 174.6 22.1006 244.199 -37.5996c18.1006 -15.4004 32.4004 -36.2002 42.7002 -60c39.7998 -4.90039 36.4004 5.5 38.6006 25.0996c1.09961 10.2998 14.2998 15.4004 22.6992 9.5c14.9004 -10.5 22.2002 -30.7998 24.6006 -48.0996
|
698 |
+
c2.2002 -17.7998 0.299805 -41.2998 -12.4004 -55.1006c-10.7998 -12.1992 -34.2998 -17.5996 -53.7998 -18.0996v-2.7998c-11.0996 -0.200195 -20.2998 -2.40039 -25.7002 -11.6006c-3 -1.09961 -5.7002 -2.69922 -8.39941 -4.59961
|
699 |
+
c5.69922 -0.5 11.3994 -1.40039 16.7998 -1.90039c1.89941 5.60059 12.5996 8.40039 21.0996 8.40039c1.7002 5.40039 6.7998 11.9004 14.1006 10.2998c7.2998 -1.59961 14.0996 -10 14.8994 -15.8994c10.7998 -4.40039 22.1006 -12.2002 25.1006 -25.7002
|
700 |
+
c1.89941 -8.10059 1.69922 -15.1006 0.299805 -21.9004c-5.7002 -25.2002 -33.2998 -36.2002 -45.9004 -36.2002c0 -6.69922 0 -13.1992 -0.299805 -19.6992c8.09961 6 16.4004 7.19922 26.7998 5.69922c6 5.90039 17.6006 9.40039 17.6006 -5.69922
|
701 |
+
c5.59961 -2.7002 11.2998 -6 15.8994 -9.2002c10.1006 5 13.7002 0.5 10.7998 -9.2002c4.10059 -4.2998 8.10059 -8.90039 11.1006 -13.7998c10.0996 3.59961 11 -2.10059 5.39941 -11.6006zM498.8 280.6c17.2998 -6.69922 26.2002 -22.0996 30.2998 -35.6992
|
702 |
+
c1.10059 10.5996 -2.69922 39.5 -13.7998 51.0996c-7.2998 7.2998 -14.0996 5.09961 -14.0996 -0.799805c0 -6.2002 -1.2998 -11.6006 -2.40039 -14.6006zM494.2 273.9c-3.2002 -3.30078 -9.2002 -4.90039 -14.1006 -5.7002c13 -15.7002 17 -41.7002 12.7002 -63
|
703 |
+
c10.7998 2.2002 20.5 6.2998 26.2002 12.2002c1.90039 2.19922 3.7998 4.89941 4.90039 7.59961c-1.10059 21.2998 -10.2002 42.7002 -29.7002 48.9004zM470.1 267.1c-3.69922 0 -8.09961 0 -11.7998 0.300781c7.5 -20.6006 12.4004 -42.7002 14.2998 -64.6006
|
704 |
+
c3.5 0 7.5 0.299805 11.6006 0.799805c5.89941 24.3008 -0.299805 51.6006 -14.1006 63.5zM47.5 245c4.09961 13.5 13 28.9004 30.2998 35.7002c-1 3 -2.39941 8.39941 -2.39941 14.5996c0 5.90039 -7.10059 8.10059 -14.1006 0.799805
|
705 |
+
c-11.3994 -11.5996 -14.8994 -40.5996 -13.7998 -51.0996zM57.2002 217.4c5.7002 -6.2002 15.3994 -10 26.2002 -12.2002c-4.30078 21.3994 -0.300781 47.2998 12.6992 63c-4.89941 0.799805 -10.8994 2.5 -14.0996 5.7002
|
706 |
+
c-19.4004 -6.2002 -28.2998 -27.6006 -29.7002 -48.9004c1.40039 -2.7002 3 -5.40039 4.90039 -7.59961zM105.1 202.8c2.40039 22.2002 9.10059 43.7998 19.8008 63.5c-5.2002 -1.09961 -10 -3 -14.9004 -4.89941l-12.2002 -5.10059v0.299805
|
707 |
+
c-7.2998 -14.0996 -10 -34.3994 -5.39941 -53c4.59961 -0.5 8.59961 -0.799805 12.6992 -0.799805zM289.1 365.5c-41.8994 0 -76.1992 -34.0996 -76.1992 -75.9004c0 -42.1992 34.2998 -76.1992 76.1992 -76.1992c41.9004 0 76.2002 34 76.2002 76.1992
|
708 |
+
c0 41.9004 -34.2998 75.9004 -76.2002 75.9004zM404.7 191.2c-12.9004 0.799805 -26.2002 0.799805 -39.5 1.09961c10 -50.5996 3.2998 -64.7002 16.5 -58.0996c16 8.09961 22.7002 39.2002 23 57zM350.7 192.8c-18.9004 0.299805 -38.1006 0.299805 -57 0v0.299805
|
709 |
+
c-0.299805 -5.19922 0.200195 -38.0996 4.2998 -41.0996c11.0996 -5.40039 39.5 -4.59961 51.0996 -1.09961c5.40039 1.59961 2.40039 37 1.60059 41.8994zM278.3 139c4.60059 2.5 2.40039 45.4004 1.2998 53.7002v0.299805
|
710 |
+
c-19.3994 -0.299805 -38.5996 -0.299805 -57.7998 -0.799805c-1.89941 -9.2002 -4.59961 -48.9004 1.90039 -51.6006c13 -5.69922 41.5996 -5.09961 54.5996 -1.59961zM171.8 190.1c-5.39941 -19.6992 0.299805 -45.0996 22.2002 -54.8994
|
711 |
+
c5.40039 -2.5 8.59961 -2.5 9.7002 4.2998c1.89941 8.7002 2.5 36.7998 4.89941 52.2002c-12.1992 -0.200195 -24.5996 -0.799805 -36.7998 -1.60059zM136.4 158.8c2.39941 -3.7002 1.59961 -9.09961 -8 -12.5c43.7998 -47 92.6992 -85.7002 155.899 -106.5
|
712 |
+
c67.5 19.2002 115.601 60 163.2 107c-11.0996 4.2998 -7.7002 10.2998 -7.2998 11.6006c-8.90039 0.799805 -17.9004 1.89941 -26.5 2.69922c-9.5 -33 -36 -52.8994 -46.7998 -31.5996c-2.7002 5.2002 -3.5 11.7002 -4.60059 16.7998
|
713 |
+
c-3.7998 -8.39941 -13.2998 -8.09961 -24.5996 -8.89941c-13.2002 -1.10059 -31.6006 -1.30078 -44 3c-3 -12.9004 -11.1006 -12.9004 -26.7998 -14.3008c-14.1006 -1.39941 -48.7002 -4.09961 -54.9004 10.8008c-1.09961 -28.7002 -35.0996 -10 -45.0996 7
|
714 |
+
c-3.2002 5.69922 -5.40039 11.3994 -7 17.5996c-7.80078 -0.799805 -15.7002 -1.59961 -23.5 -2.7002zM114.8 -13.7002c0.5 2.5 0.799805 5.2002 0.799805 8.2002c-5.69922 23.2002 -18.5996 49.7002 -33.5 54c-22.3994 6.7002 -68.8994 -23.5 -66.1992 -54.5996
|
715 |
+
c12.6992 -19.5 40 -35.7002 59.1992 -36.5c17.8008 -0.800781 35.9004 11.0996 39.7002 28.8994zM106.1 52.2998c9 -16 15.5 -33.2998 16.7002 -51.8994c33.5 19.3994 69.1006 35.6992 105.9 47c-38.7002 20.5 -68.1006 47.7998 -97.2998 77
|
716 |
+
c-2.10059 -1.30078 -5.10059 -2.40039 -7.80078 -3.5c-1.59961 -4.90039 8.7002 -5.30078 5.40039 -12.4004c-2.09961 -4.09961 -8.59961 -7.59961 -15.0996 -9.2002c-2.10059 -2.7002 -5.10059 -4.89941 -7.80078 -6.5h-0.299805
|
717 |
+
c-0.200195 -13.5 -0.200195 -27 0.299805 -40.5zM443.7 -12.2998c-36.7998 21.2998 -74.1006 41.2998 -115.601 53c-13.7998 -6.2002 -27.8994 -11.2998 -42.1992 -15.4004c-2.10059 -0.799805 -2.10059 -0.799805 -4.30078 0
|
718 |
+
c-11.8994 3.7002 -23.2998 8.10059 -34.8994 13.2002c-40.2002 -11.5996 -77.2998 -29.2002 -112.4 -50.7998h-0.299805v-0.299805c0.299805 0 0.299805 0 0.299805 0.299805c103.2 -4.10059 206.4 -3.5 309.4 0zM454.2 0.0996094c1 14.7002 7.2002 35.8008 16.5 51.7002
|
719 |
+
l-0.299805 -0.299805c0.5 13.7002 0.799805 27.5 0.799805 41.2998c-3 1.7002 -5.7002 4.10059 -8.10059 6.7998c-6.5 1.30078 -12.8994 5.10059 -15.0996 8.90039c-1.90039 4.09961 1.2998 7.59961 5.90039 10.2998c-0.200195 0.5 -0.5 1.60059 -0.5 2.40039
|
720 |
+
c-3 0.799805 -5.40039 1.7998 -7.60059 3.2002c-31.5996 -29.4004 -65.3994 -56.7002 -103.5 -76.7002c38.9004 -11.7002 76 -28.1006 111.9 -47.6006zM560.1 -6.09961c3 31.0996 -43.5 61.3994 -66.1992 54.5c-14.6006 -4.30078 -27.8008 -30.8008 -33.5 -54
|
721 |
+
c0 -23.8008 21.1992 -37.9004 40.5 -37c19.1992 0.799805 46.5 17 59.1992 36.5zM372.9 372.8c-35.7002 39.2002 -81.4004 47.7998 -126 23.5c25.1992 56.2002 122.199 48.6006 126 -23.5zM74.7998 40.9004c14.9004 1.89941 24.6006 -19.2002 18.6006 -30.8008
|
722 |
+
c-4.80078 -9.69922 -23.7002 -24.0996 -35.9004 -27.2998c-16.5 -4.59961 -32.2002 3.2998 -32.2002 14.9004c0 17.7998 33.7998 41.5996 49.5 43.2002zM290.7 217.1c-30.9004 0 -57.6006 25.7002 -50.2998 59.8008c13.1992 -20.7002 46.5 -12 46.5 11.2998
|
723 |
+
c0 10 -7 18.5996 -16.5 21.5996c31.6992 13.7998 72.1992 -8.2002 72.1992 -44.2998c0 -26.7998 -23.2998 -48.4004 -51.8994 -48.4004zM68 -26.0996c-0.5 8.39941 20.2998 23.5 29.2002 25.0996c8.59961 1.59961 12.7002 -11.4004 9.7002 -18.4004
|
724 |
+
c-2.7002 -5.69922 -10.5 -13.5 -17.3008 -16.1992c-9.39941 -3.2002 -21.0996 3 -21.5996 9.5zM501.2 40.9004c15.7002 -1.60059 49.5 -25.4004 49.5 -43.2002c0 -11.7002 -15.7002 -19.5 -32.2002 -14.9004c-12.0996 3.2002 -31.2998 17.6006 -36.2002 27.2998
|
725 |
+
c-5.7002 11.6006 4 32.7002 18.9004 30.8008zM478.8 -1c8.90039 -1.59961 30 -16.7002 29.1006 -25.0996c-0.200195 -6.5 -12.1006 -12.7002 -21.3008 -9.5c-7 2.69922 -14.8994 10.5 -17.2998 16.1992c-2.89941 7.10059 1.10059 20 9.5 18.4004z" />
|
726 |
+
<glyph glyph-name="opencart" unicode="" horiz-adv-x="640"
|
727 |
+
d="M423.3 7.2998c0 -25.2998 -20.2998 -45.5996 -45.5996 -45.5996s-45.7998 20.2998 -45.7998 45.5996s20.5996 45.7998 45.7998 45.7998c25.3994 0 45.5996 -20.5 45.5996 -45.7998zM169.4 53.0996c25.2998 0 45.7998 -20.5 45.7998 -45.7998
|
728 |
+
s-20.5 -45.5996 -45.7998 -45.5996c-25.3008 0 -45.6006 20.3994 -45.6006 45.5996s20.2998 45.7998 45.6006 45.7998zM461.1 323.1c302.2 0 169.5 -67.1992 -17.1992 -233.899c59.1992 102.8 262.5 193.899 -70.8008 188.899c-319.8 -4.69922 -338.699 92.5 -373.1 144.2
|
729 |
+
c81.9004 -86.3994 158.9 -99.2002 461.1 -99.2002z" />
|
730 |
+
<glyph glyph-name="expeditedssl" unicode="" horiz-adv-x="496"
|
731 |
+
d="M248 404.6c117.4 0 212.6 -95.1992 212.6 -212.6s-95.1992 -212.6 -212.6 -212.6s-212.6 95.1992 -212.6 212.6s95.1992 212.6 212.6 212.6zM150.6 271.7h-0.199219v-26.6006c0 -5 3.89941 -8.89941 8.89941 -8.89941h17.7002c5 0 8.90039 3.89941 8.90039 8.89941
|
732 |
+
v26.6006c0 82.0996 124 82.0996 124 0v-26.6006c0 -5 3.89941 -8.89941 8.89941 -8.89941h17.7002c5 0 8.90039 3.89941 8.90039 8.89941v26.6006c0 53.7002 -43.7002 97.3994 -97.4004 97.3994s-97.4004 -43.6992 -97.4004 -97.3994zM389.7 68v141.7
|
733 |
+
c0 9.7002 -8 17.7002 -17.7002 17.7002h-248c-9.7002 0 -17.7002 -8 -17.7002 -17.7002v-141.7c0 -9.7002 8 -17.7002 17.7002 -17.7002h248c9.7002 0 17.7002 8 17.7002 17.7002zM141.7 205.3v-132.899c0 -2.5 -1.90039 -4.40039 -4.40039 -4.40039h-8.89941
|
734 |
+
c-2.5 0 -4.40039 1.90039 -4.40039 4.40039v132.899c0 2.5 1.90039 4.40039 4.40039 4.40039h8.89941c2.5 0 4.40039 -1.90039 4.40039 -4.40039zM283.4 156.6c0 -13 -7.2002 -24.3994 -17.7002 -30.3994v-31.6006c0 -5 -3.90039 -8.89941 -8.90039 -8.89941h-17.7002
|
735 |
+
c-5 0 -8.89941 3.89941 -8.89941 8.89941v31.6006c-10.5 6.09961 -17.7002 17.3994 -17.7002 30.3994c0 19.7002 15.7998 35.4004 35.4004 35.4004c19.5996 0 35.5 -15.7998 35.5 -35.4004zM248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248
|
736 |
+
s111 248 248 248zM248 -38.2998c127 0 230.3 103.3 230.3 230.3s-103.3 230.3 -230.3 230.3s-230.3 -103.3 -230.3 -230.3s103.3 -230.3 230.3 -230.3z" />
|
737 |
+
<glyph glyph-name="cc-jcb" unicode="" horiz-adv-x="576"
|
738 |
+
d="M431.5 203.7v32.2998c41.2002 0 38.5 -0.200195 38.5 -0.200195c7.2998 -1.2998 13.2998 -7.2998 13.2998 -16c0 -8.7998 -6 -14.5 -13.2998 -15.7998c-1.2002 -0.400391 -3.2998 -0.299805 -38.5 -0.299805zM474.3 183.5c7.5 -1.5 13.5 -8.2998 13.5 -17
|
739 |
+
c0 -9 -6 -15.5 -13.5 -17c-2.7998 -0.700195 -3.2002 -0.5 -42.7998 -0.5v35c39.5 0 40 0.200195 42.7998 -0.5zM576 368v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48zM182 255.7h-57
|
740 |
+
c0 -67.1006 10.7002 -109.7 -35.7998 -109.7c-19.5 0 -38.7998 5.7002 -57.2002 14.7998v-28c30 -8.2998 68 -8.2998 68 -8.2998c97.9004 0 82 47.7002 82 131.2zM360.5 251.2c-63.4004 16 -165 14.8994 -165 -59.2998c0 -77.1006 108.2 -73.6006 165 -59.2002v28.2998
|
741 |
+
c-47.5996 -24.7002 -107.5 -22 -107.5 31s59.7998 55.5996 107.5 31.2002v28zM544 161.5c0 18.5 -16.5 30.5 -38 32v0.799805c19.5 2.7002 30.2998 15.5 30.2998 30.2002c0 19 -15.7002 30 -37 31c0 0 6.2998 0.299805 -120.3 0.299805v-127.5h122.7
|
742 |
+
c24.2998 -0.0996094 42.2998 12.9004 42.2998 33.2002z" />
|
743 |
+
<glyph glyph-name="cc-diners-club" unicode="" horiz-adv-x="576"
|
744 |
+
d="M239.7 368.1c97.2002 0 175.8 -78.5996 175.8 -175.8c0 -96.8994 -78.5996 -175.8 -175.8 -175.8c-96.9004 0 -175.8 78.9004 -175.8 175.8c0 97.2002 78.8994 175.8 175.8 175.8zM199.8 88.5v207.9c-41.7002 -16.2002 -71.3994 -56.7002 -71.3994 -104.101
|
745 |
+
c0 -47.3994 29.6992 -87.8994 71.3994 -103.8zM279.6 88.2002c41.7002 16.2002 71.4004 56.7002 71.4004 104.1c0 47.4004 -29.7002 87.9004 -71.4004 104.101v-208.2zM528 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352
|
746 |
+
c0 26.5 21.5 48 48 48h480zM329.7 0c105 0 200.7 85.5 200.7 190.2c0 114.6 -95.7002 193.8 -200.7 193.8h-90.2998c-106.2 0 -193.801 -79.2002 -193.801 -193.8c0 -104.7 87.6006 -190.2 193.801 -190.2h90.2998z" />
|
747 |
+
<glyph glyph-name="creative-commons" unicode="" horiz-adv-x="496"
|
748 |
+
d="M245.83 233.13l-33.2197 -17.2803c-9.43066 19.5801 -25.2402 19.9307 -27.46 19.9307c-22.1309 0 -33.2207 -14.6104 -33.2207 -43.8398c0 -23.5703 9.20996 -43.8408 33.2207 -43.8408c14.4697 0 24.6494 7.09082 30.5693 21.2607l30.5498 -15.5
|
749 |
+
c-6.16992 -11.5107 -25.6895 -38.9805 -65.0996 -38.9805c-22.5996 0 -73.96 10.3203 -73.96 77.0498c0 58.6904 43 77.0605 72.6299 77.0605c30.7197 0.00976562 52.7002 -11.9502 65.9902 -35.8604zM388.88 233.13l-32.7803 -17.2803
|
750 |
+
c-9.5 19.7705 -25.7197 19.9307 -27.8994 19.9307c-22.1406 0 -33.2197 -14.6104 -33.2197 -43.8398c0 -23.5508 9.22949 -43.8408 33.2197 -43.8408c14.4502 0 24.6494 7.09082 30.54 21.2607l31 -15.5c-2.10059 -3.75 -21.3906 -38.9805 -65.0898 -38.9805
|
751 |
+
c-22.6904 0 -73.96 9.87012 -73.96 77.0498c0 58.6699 42.9697 77.0605 72.6299 77.0605c30.71 0.00976562 52.5801 -11.9502 65.5596 -35.8604zM247.56 439.95c141.82 0 248.44 -110.13 248.44 -248c0 -147.13 -118.51 -248 -248.44 -248
|
752 |
+
c-133.96 0 -247.56 109.51 -247.56 248c0 132.939 104.74 248 247.56 248zM248.43 -10.8604c103.16 0 202.83 81.1299 202.84 202.82c0 113.8 -90.2891 203.26 -202.819 203.26c-118.29 0 -203.72 -97.8496 -203.72 -203.27c0 -109.771 91.1592 -202.811 203.699 -202.811z
|
753 |
+
" />
|
754 |
+
<glyph glyph-name="gg" unicode="" horiz-adv-x="512"
|
755 |
+
d="M179.2 217.6l102.399 -102.399l-102.399 -102.4l-179.2 179.2l179.2 179.2l44.7998 -44.7998l-25.5996 -25.6006l-19.2002 19.2002l-128 -128l128 -128l51.5 51.5l-77.1006 76.5zM332.8 371.2l179.2 -179.2l-179.2 -179.2l-44.7998 44.7998l25.5996 25.6006
|
756 |
+
l19.2002 -19.2002l128 128l-128 128l-51.5 -51.5l77.1006 -76.5l-25.6006 -25.5996l-102.399 102.399z" />
|
757 |
+
<glyph glyph-name="gg-circle" unicode="" horiz-adv-x="512"
|
758 |
+
d="M257 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM207.5 65.2002l75 75.2002l-77.2002 77.1992l-24.3994 -24.3994l53.0996 -52.9004l-26.5996 -26.5996l-77.2002 77.2002l77.2002 77.1992l11.0996 -11.0996l24.2002 24.2002
|
759 |
+
l-35.2002 35.3994l-125.7 -125.699zM306.5 67.4004l125.7 125.6l-125.7 125.7l-75 -75l77.2002 -77.2002l24.3994 24.4004l-53.0996 52.8994l26.5 26.5l77.2002 -77.2002l-77.2002 -77.1992l-11.0996 11.0996l-24.1006 -24.4004z" />
|
760 |
+
<glyph glyph-name="tripadvisor" unicode="" horiz-adv-x="576"
|
761 |
+
d="M166.4 167.479c0 -13.2354 -10.7305 -23.9658 -23.9668 -23.9658c-13.2354 0 -23.9658 10.7305 -23.9658 23.9658c0 13.2363 10.7305 23.9668 23.9658 23.9668c13.2363 0 23.9668 -10.7295 23.9668 -23.9668zM431.362 191.435
|
762 |
+
c13.2295 0 23.9551 -10.7246 23.9561 -23.9561c0 -13.2305 -10.7266 -23.9551 -23.9561 -23.9551c-13.2314 0 -23.9561 10.7256 -23.9561 23.9551c0 13.2314 10.7256 23.9561 23.9561 23.9561zM520.75 51.9453c-62.667 -49.1045 -153.276 -38.1094 -202.379 24.5586
|
763 |
+
l-30.9795 -46.3252l-30.6826 45.9395c-48.2773 -60.3906 -135.622 -71.8916 -197.885 -26.0547c-64.0586 47.1572 -77.7588 137.315 -30.6016 201.373c-5.05762 17.1221 -17.7021 42.7236 -28.2227 57.1475l90.2861 0.0498047
|
764 |
+
c48.0039 29.8701 132.851 54.1123 189.389 54.1123c2.11914 0 5.55762 -0.0371094 7.67578 -0.0820312c1.72363 0.0302734 4.52246 0.0556641 6.24609 0.0556641c55.5518 0 138.851 -23.9258 185.936 -53.4043l96.2178 -0.0742188
|
765 |
+
c-10.6191 -14.5371 -23.3213 -40.3643 -28.3516 -57.6494c46.793 -62.7471 34.9639 -151.37 -26.6484 -199.646zM259.366 166.239c-0.00683594 63.5566 -51.5352 115.075 -115.092 115.067c-63.5576 -0.00683594 -115.074 -51.5342 -115.068 -115.092
|
766 |
+
c0.00683594 -63.5566 51.5352 -115.075 115.092 -115.067c63.5127 0.0742188 114.984 51.5381 115.068 115.052v0.0400391zM287.957 176.694c5.43262 73.4395 65.5098 130.884 139.12 133.021c-35.5576 15.374 -95.8555 27.8506 -134.594 27.8506
|
767 |
+
c-1.41699 0 -3.7168 -0.0166016 -5.13379 -0.0380859c-0.953125 0.00878906 -2.50098 0.0166016 -3.45508 0.0166016c-39.2324 0 -100.479 -12.2168 -136.709 -27.2695c74.3447 -1.58203 135.3 -59.4248 140.771 -133.581zM539.663 205.461
|
768 |
+
c-21.9922 59.6338 -88.1621 90.1484 -147.795 68.1572c-59.6338 -21.9922 -90.1484 -88.1621 -68.1572 -147.795v-0.0322266c22.0381 -59.6074 88.1982 -90.0908 147.827 -68.1133c59.6152 22.0039 90.1133 88.1621 68.125 147.783zM213.624 167.486v-0.115234
|
769 |
+
c-0.0566406 -39.3281 -31.9863 -71.1631 -71.3145 -71.1064c-39.3271 0.0576172 -71.1621 31.9863 -71.1055 71.3145s31.9863 71.1631 71.3135 71.1055c39.2598 -0.115234 71.042 -31.9395 71.1064 -71.1982zM189.112 167.486v0.0839844
|
770 |
+
c-0.0517578 25.7832 -20.9941 46.6445 -46.7783 46.5938s-46.6445 -20.9941 -46.5938 -46.7773c0.0507812 -25.7842 20.9941 -46.6445 46.7764 -46.5938c25.7266 0.113281 46.5371 20.9678 46.5957 46.6934zM502.535 167.486
|
771 |
+
c-0.0205078 -39.3281 -31.918 -71.2422 -71.2471 -71.2217c-39.3291 0.0214844 -71.1943 31.918 -71.1729 71.2471c0.0195312 39.3281 31.918 71.1943 71.2471 71.1729c39.29 -0.0654297 71.1211 -31.9082 71.1729 -71.1982zM478.031 167.494
|
772 |
+
c-0.00878906 25.7842 -20.918 46.6787 -46.7021 46.6699s-46.6787 -20.918 -46.6699 -46.7021s20.918 -46.6777 46.7021 -46.6699c25.7646 0.0458984 46.6357 20.9277 46.6699 46.6934v0.00878906z" />
|
773 |
+
<glyph glyph-name="odnoklassniki" unicode="" horiz-adv-x="320"
|
774 |
+
d="M275.1 114c-27.3994 -17.4004 -65.0996 -24.2998 -90 -26.9004l20.9004 -20.5996l76.2998 -76.2998c27.9004 -28.6006 -17.5 -73.2998 -45.7002 -45.7002c-19.0996 19.4004 -47.0996 47.4004 -76.2998 76.5996l-76.2998 -76.5
|
775 |
+
c-28.2002 -27.5 -73.5996 17.6006 -45.4004 45.7002c19.4004 19.4004 47.1006 47.4004 76.3008 76.2998l20.5996 20.6006c-24.5996 2.59961 -62.9004 9.09961 -90.5996 26.8994c-32.6006 21 -46.9004 33.3008 -34.3008 59c7.40039 14.6006 27.7002 26.9004 54.6006 5.7002
|
776 |
+
c0 0 36.2998 -28.8994 94.8994 -28.8994c58.6006 0 94.9004 28.8994 94.9004 28.8994c26.9004 21.1006 47.0996 8.90039 54.5996 -5.7002c12.4004 -25.6992 -1.89941 -38 -34.5 -59.0996zM30.2998 318.3c0 71.7002 58.2998 129.7 129.7 129.7s129.7 -58 129.7 -129.7
|
777 |
+
c0 -71.3994 -58.2998 -129.399 -129.7 -129.399s-129.7 58 -129.7 129.399zM96.2998 318.3c0 -35.0996 28.6006 -63.7002 63.7002 -63.7002s63.7002 28.6006 63.7002 63.7002c0 35.4004 -28.6006 64 -63.7002 64s-63.7002 -28.5996 -63.7002 -64z" />
|
778 |
+
<glyph glyph-name="odnoklassniki-square" unicode=""
|
779 |
+
d="M184.2 270.9c0 22.0996 17.8994 40 39.7998 40s39.7998 -17.9004 39.7998 -40c0 -22 -17.8994 -39.8008 -39.7998 -39.8008s-39.7998 17.9004 -39.7998 39.8008zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352
|
780 |
+
c26.5 0 48 -21.5 48 -48zM142.9 270.9c0 -44.6006 36.3994 -80.9004 81.0996 -80.9004s81.0996 36.2002 81.0996 80.9004c0 44.7998 -36.3994 81.0996 -81.0996 81.0996s-81.0996 -36.2002 -81.0996 -81.0996zM317.4 180.2
|
781 |
+
c-4.60059 9.09961 -17.3008 16.7998 -34.1006 3.59961c0 0 -22.7002 -18 -59.2998 -18s-59.2998 18 -59.2998 18c-16.7998 13.2002 -29.5 5.5 -34.1006 -3.59961c-7.89941 -16.1006 1.10059 -23.7002 21.4004 -37c17.2998 -11.1006 41.2002 -15.2002 56.5996 -16.7998
|
782 |
+
l-12.8994 -12.9004c-18.2002 -18 -35.5 -35.5 -47.7002 -47.7002c-17.5996 -17.5996 10.7002 -45.7998 28.4004 -28.5996l47.6992 47.8994c18.2002 -18.1992 35.7002 -35.6992 47.7002 -47.8994c17.6006 -17.2002 46 10.7002 28.6006 28.5996l-47.7002 47.7002l-13 12.9004
|
783 |
+
c15.5 1.59961 39.0996 5.89941 56.2002 16.7998c20.3994 13.2998 29.2998 21 21.5 37z" />
|
784 |
+
<glyph glyph-name="get-pocket" unicode=""
|
785 |
+
d="M407.6 384c22.7002 0 40.4004 -18.2002 40.4004 -40.5996v-135.2c0 -124.7 -99.7998 -224.2 -223.8 -224.2c-124.5 0 -224.2 99.5 -224.2 224.2v135.2c0 22.0996 18.5 40.5996 40.5996 40.5996h367zM245.6 115.5c111.9 107.5 114.801 105.4 114.801 123.2
|
786 |
+
c0 16.8994 -13.8008 30.7002 -30.7002 30.7002c-16.9004 0 -14.9004 -2.40039 -105.5 -89.3008c-89.1006 85.5 -88.2002 89.3008 -105.2 89.3008c-16.9004 0 -30.7002 -13.8008 -30.7002 -30.7002c0 -18.1006 1.2002 -14.2998 114.9 -123.2
|
787 |
+
c11 -11.0996 30 -11.7998 42.3994 0z" />
|
788 |
+
<glyph glyph-name="wikipedia-w" unicode="" horiz-adv-x="640"
|
789 |
+
d="M640 396.8l-0.299805 -12.2002c-28.1006 -0.799805 -45 -15.7998 -55.7998 -40.2998c-25 -57.7998 -103.301 -240 -155.301 -358.6h-13.5996l-81.9004 193.1c-32.5 -63.5996 -68.2998 -130 -99.1992 -193.1c-0.300781 -0.299805 -15 0 -15 0.299805
|
790 |
+
c-46.9004 109.7 -96.1006 218.6 -143.101 328.6c-11.3994 26.7002 -49.3994 70 -75.5996 69.7002c0 3.10059 -0.299805 10 -0.299805 14.2002h161.899v-13.9004c-19.2002 -1.09961 -52.7998 -13.2998 -43.2998 -34.1992c21.9004 -49.7002 103.6 -240.301 125.6 -288.601
|
791 |
+
c15 29.7002 57.8008 109.2 75.3008 142.8c-13.9004 28.3008 -58.6006 133.9 -72.8008 160c-9.69922 17.8008 -36.0996 19.4004 -55.7998 19.7002v13.9004l142.5 -0.299805v-13.1006c-19.3994 -0.599609 -38.0996 -7.7998 -29.3994 -26.0996
|
792 |
+
c18.8994 -40 30.5996 -68.1006 48.0996 -104.7c5.59961 10.7998 34.7002 69.4004 48.0996 100.8c8.90039 20.6006 -3.89941 28.6006 -38.5996 29.4004c0.299805 3.59961 0 10.2998 0.299805 13.5996c44.4004 0.299805 111.101 0.299805 123.101 0.600586v-13.6006
|
793 |
+
c-22.5 -0.799805 -45.8008 -12.7998 -58.1006 -31.7002l-59.2002 -122.8c6.40039 -16.0996 63.3008 -142.8 69.2002 -156.7l122.4 282.601c-8.60059 23.0996 -36.4004 28.0996 -47.2002 28.2998v13.9004l127.8 -1.10059z" />
|
794 |
+
<glyph glyph-name="safari" unicode="" horiz-adv-x="512"
|
795 |
+
d="M236.9 191.2c0 9.09961 6.59961 17.7002 16.2998 17.7002c8.89941 0 17.3994 -6.40039 17.3994 -16.1006c0 -9.09961 -6.39941 -17.7002 -16.0996 -17.7002c-9 0 -17.5996 6.7002 -17.5996 16.1006zM504 192c0 -137 -111 -248 -248 -248s-248 111 -248 248
|
796 |
+
s111 248 248 248s248 -111 248 -248zM477.4 192c0 122.3 -99.1006 221.4 -221.4 221.4s-221.4 -99.1006 -221.4 -221.4s99.1006 -221.4 221.4 -221.4s221.4 99.1006 221.4 221.4zM404.9 95.4004c0 -3.60059 13 -10.2002 16.2998 -12.2002
|
797 |
+
c-27.4004 -41.5 -69.7998 -71.4004 -117.9 -83.2998l-4.39941 18.5c-0.300781 2.5 -1.90039 2.7998 -4.2002 2.7998c-1.90039 0 -3 -2.7998 -2.7998 -4.2002l4.39941 -18.7998c-13.2998 -2.7998 -26.7998 -4.2002 -40.3994 -4.2002c-36.3008 0 -72 10.2002 -103 29.0996
|
798 |
+
c1.69922 2.80078 12.1992 18 12.1992 20.2002c0 1.90039 -1.69922 3.60059 -3.59961 3.60059c-3.90039 0 -12.2002 -16.6006 -14.7002 -19.9004c-41.7998 27.7002 -72 70.5996 -83.5996 119.6l19.0996 4.2002c2.2002 0.600586 2.7998 2.2002 2.7998 4.2002
|
799 |
+
c0 1.90039 -2.7998 3 -4.39941 2.7998l-18.7002 -4.2998c-2.5 12.7002 -3.90039 25.5 -3.90039 38.5c0 37.0996 10.5 73.5996 30.2002 104.9c2.7998 -1.7002 16.1006 -10.8008 18.2998 -10.8008c1.90039 0 3.60059 1.40039 3.60059 3.30078
|
800 |
+
c0 3.89941 -14.7002 11.2998 -18 13.5996c28.2002 41.2002 71.0996 70.9004 119.8 81.9004l4.2002 -18.5c0.599609 -2.2002 2.2002 -2.80078 4.2002 -2.80078s3 2.80078 2.7998 4.40039l-4.2002 18.2998c12.2002 2.2002 24.5996 3.60059 37.0996 3.60059
|
801 |
+
c37.1006 0 73.3008 -10.5 104.9 -30.2002c-1.90039 -2.7998 -10.7998 -15.7998 -10.7998 -18c0 -1.90039 1.39941 -3.60059 3.2998 -3.60059c3.90039 0 11.2998 14.4004 13.2998 17.7002c41 -27.7002 70.2998 -70 81.7002 -118.2l-15.5 -3.2998
|
802 |
+
c-2.5 -0.599609 -2.7998 -2.2002 -2.7998 -4.39941c0 -1.90039 2.7998 -3 4.2002 -2.80078l15.7998 3.60059c2.5 -12.7002 3.89941 -25.7002 3.89941 -38.7002c0 -36.2998 -10 -72 -28.7998 -102.7c-2.7998 1.40039 -14.3994 9.7002 -16.5996 9.7002
|
803 |
+
c-2.10059 0 -3.7998 -1.7002 -3.7998 -3.59961zM371.7 337.6c-13 -12.1992 -134.2 -123.699 -137.601 -129.5l-96.5996 -160.5c12.7002 11.9004 134.2 124 137.3 129.301z" />
|
804 |
+
<glyph glyph-name="chrome" unicode="" horiz-adv-x="496"
|
805 |
+
d="M131.5 230.5l-76.4004 117.4c47.6006 59.1992 119 91.7998 192 92.0996c42.3008 0.299805 85.5 -10.5 124.801 -33.2002c43.3994 -25.2002 76.3994 -61.3994 97.3994 -103l-205.3 10.7998c-58.0996 3.40039 -113.4 -29.2998 -132.5 -84.0996zM164.4 192
|
806 |
+
c0 46.2998 37.3994 83.5996 83.5996 83.5996s83.5996 -37.3994 83.5996 -83.5996s-37.3994 -83.5996 -83.5996 -83.5996s-83.5996 37.3994 -83.5996 83.5996zM479.3 281.2c43.5 -111.9 0 -241.9 -107.399 -303.9c-43.4004 -25.2002 -91.3008 -35.3994 -137.801 -32.8994
|
807 |
+
l112.101 172.399c31.8994 49 31.2998 112.9 -6.60059 157.2zM133.7 144.4c26.2998 -51.7002 81.8994 -83.3008 139.5 -72.5l-63.7002 -124.801c-118.7 18.2002 -209.5 120.9 -209.5 244.9c0 50.0996 14.9004 96.9004 40.4004 135.9z" />
|
808 |
+
<glyph glyph-name="firefox" unicode="" horiz-adv-x="480"
|
809 |
+
d="M478.1 212.7c1.30078 -7.10059 1.90039 -14.2998 1.90039 -21.6006v-2.7998c-1.40039 -34 -11.5996 -67 -29.5996 -95.8994c-1 -1.5 -1.80078 -2.90039 -2.7002 -4.30078c2.7002 -7.19922 2.59961 -15.0996 -0.400391 -22.1992
|
810 |
+
c-5 -19.4004 -16.5996 -36.4004 -32.8994 -48.1006c-10.8008 -8.7002 -22.7002 -16.2002 -35.3008 -22.0996l-1.89941 -0.900391l-1 -0.5c-1.7002 -0.700195 -3.2998 -1.39941 -4.90039 -2.09961c-2.39941 -5.10059 -5.7998 -9.60059 -9.89941 -13.2998
|
811 |
+
c-2.5 -3.10059 -30.1006 -35 -113.801 -35c-23.5996 0 -47.1992 3.5 -69.7998 10.2998c0.799805 -0.299805 1.60059 -0.700195 2.40039 -1c-2.60059 0.899414 -5.2002 1.7998 -7.7002 2.7002c-19.0996 5.89941 -37.2002 14.5996 -53.7998 25.7998
|
812 |
+
c-40.7002 24.7002 -72.9004 61.2002 -92.2998 104.7c-14.5 31.3994 -21.1006 65.7998 -19.4004 100.3c-2.7998 -8.2998 -5.2002 -16.7002 -7 -25.2998c0 29.1992 5.5 58.0996 16.2002 85.1992c-5.5 -7.89941 -10.2998 -16.2998 -14.2998 -25.0996
|
813 |
+
c5.69922 23.0996 14.6992 45.2002 26.7998 65.5996c3.7002 6.10059 7.89941 11.9004 12.7002 17.1006v0.200195c-0.100586 2.69922 0.0996094 5.5 0.5 8.2998c1.5 16.2998 5.69922 32.2002 12.3994 47.0996l0.299805 0.700195c0.100586 0.299805 0 -1 0 -1.7002
|
814 |
+
s-0.0996094 -1.2998 0 -1c0.600586 2 1.40039 4 2.30078 5.90039c1 2.09961 2.39941 4.09961 3.89941 5.7998c0.100586 0.0996094 0.200195 0.200195 0.299805 0.400391c0.100586 0.199219 -0.399414 -2 -0.5 -3.10059v-0.5c0.600586 1.2002 1.30078 2.40039 2.2002 4.5
|
815 |
+
c2.10059 5.90039 6 11 11.1006 14.5l0.199219 0.100586c-0.299805 -9 1.2002 -17.9004 4.40039 -26.2002v-0.100586c0.299805 -0.399414 0.5 1.30078 0.900391 1.30078c0.0996094 0 0.199219 -0.100586 0.199219 -0.200195
|
816 |
+
c0.900391 -1.7998 1.80078 -3.60059 2.7002 -5.2002c1.2998 -2.2002 2.5 -4.2002 3.7002 -6l0.400391 -0.200195l0.199219 0.100586c2.60059 -4.2002 5.90039 -7.80078 9.7002 -10.9004h-0.200195l0.200195 -0.0996094c18.2998 3.59961 37.2002 2 54.6006 -4.7002
|
817 |
+
l0.0996094 0.0996094c2.09961 2.60059 4.59961 4.90039 7.2998 6.90039c0 -0.900391 -0.0996094 -1.7998 -0.200195 -2.7002c4 5 9.10059 9 15 11.5c-0.399414 -0.700195 -0.5 -1.40039 -0.5 -2.2002c7.40039 4.2998 15.5 7.40039 23.9004 9
|
818 |
+
c1.09961 0 -3.5 -1.7998 -5.09961 -3.09961c3.69922 1.59961 7.69922 2.59961 11.6992 2.7998c6.60059 0.700195 14 -2.09961 12.6006 -2.7002c-2.7998 -1 -5.5 -2.2002 -8.2002 -3.5c-0.799805 -0.700195 3.2002 0.200195 2.40039 -0.5
|
819 |
+
c-14 -9.2002 -24.8008 -22.5996 -30.8008 -38.2998v-0.0996094c2.5 -11 11.4004 -19.3008 22.5 -21.1006c31.5 -3 37.5 -5.59961 38.4004 -9.09961v-1.5c-0.0996094 -1 -0.200195 -1.90039 -0.299805 -2.7998c-1.2002 -6.90039 -4.90039 -13.2002 -10.2002 -17.7002
|
820 |
+
c-1.40039 -1.2998 -2.90039 -2.5 -4.5 -3.5c-1.09961 -0.700195 -6.40039 -2.7998 -12.7998 -5.60059c-7.90039 -3.19922 -15.5 -7.09961 -22.7002 -11.5996c-1.2998 -0.799805 -2.40039 -1.7002 -3.40039 -2.7002c-0.399414 -0.399414 -1.19922 -1.5 -1.19922 -1.5
|
821 |
+
v-0.0996094c0.5 -1.2002 1 -2.40039 1.19922 -3.7002c-1.39941 1.7002 -2.69922 1.09961 -1.89941 -0.5c0.899414 -2.5 1.2998 -5.2002 1.09961 -7.7998c0.200195 -4.7998 -0.700195 -9.60059 -2.59961 -14c-2.10059 1.5 -4.2998 2.89941 -6.60059 4.09961h-0.199219
|
822 |
+
c2.5 -1.59961 4.2998 -3.89941 5.39941 -6.59961c0.700195 -2.2002 -0.299805 -2.7002 -0.299805 -2.7002c-1.40039 2 -3.09961 3.59961 -5.2002 4.7002c-3.09961 1.7998 -8.7998 4.7002 -11.3994 5.7998c-0.300781 -0.200195 -0.5 -0.0996094 -0.800781 -0.200195
|
823 |
+
c0.800781 -1.2998 2.10059 -3.7998 2.10059 -3.7998s-1.7998 1.09961 -4.7998 2.59961c-3.90039 -1.7998 -7.2002 -4.89941 -9.30078 -8.69922c-3.5 -7.7002 -3.09961 -16.7002 1 -24.1006c4 -6 9.10059 -11.2002 15 -15.2002
|
824 |
+
c0.400391 -0.299805 -3.39941 1.10059 -3.09961 0.800781c4.59961 -3.2002 9.40039 -6.10059 14.4004 -8.60059c1.5 -1 -5 1.2002 -3.40039 0.299805c1.40039 -0.899414 2.7998 -1.69922 4.2998 -2.5c22.9004 -12.0996 38.9004 0.400391 56.4004 2.90039
|
825 |
+
c16.7998 3 33.7998 -3.59961 44.2002 -17c6 -8.5 -0.600586 -16.7002 -9 -14h-0.200195c-8.60059 2.90039 -19.1006 -4.2998 -36.6006 -14c-17.2998 -8.2998 -36.8994 -10.5996 -55.5996 -6.59961c-4.7998 0.899414 -9.40039 2.09961 -14 3.69922l-2 0.700195
|
826 |
+
l0.200195 -0.299805c8.7998 -12.2002 19.8994 -22.5 32.7998 -30.2998c8.7002 -4.40039 17.9004 -7.5 27.4004 -9.2998c8 -1.90039 16.1992 -2.80078 24.5 -2.80078c61 -0.0996094 110.6 49.4004 110.6 110.4c0.0996094 15.9004 -3.09961 31.7998 -9.2998 46.5
|
827 |
+
c20.7002 -12.2998 37.5996 -30.2002 48.7998 -51.5c-13.9004 40.5996 -40.2998 56.4004 -64.7002 76.5996c-19.5996 14.8008 -34.7002 34.9004 -43.3994 57.9004c-25.2002 67.7998 33.0996 132.9 33.0996 132.9s-3.59961 -15.1006 27.4004 -44.3008
|
828 |
+
c6.39941 -5.89941 16.7998 -14.5 28.8994 -26.6992c1.7002 9.2998 4.2002 18.3994 7.40039 27.2998c2.5 -14.7002 7.7998 -28.7998 15.3994 -41.6006c11.7002 -16.6992 21.9004 -25.5996 30.7002 -40c1.90039 -2.5 3.7998 -5.19922 5.60059 -7.89941
|
829 |
+
c5.09961 -7.2002 9.5 -14.7998 13.2998 -22.7998c6 -12 10.7998 -24.5 14.5 -37.4004c3 -10.4004 4.89941 -20.9004 5.7998 -31.5996c2.90039 3.89941 4.7002 5.89941 4.7002 5.89941s0.700195 -2.59961 1.39941 -7.09961zM179.1 310.3
|
830 |
+
c-0.5 -1.2002 -0.899414 -2.2998 -1.2998 -3.5c0.400391 1.2002 0.900391 2.40039 1.2998 3.5z" />
|
831 |
+
<glyph glyph-name="opera" unicode="" horiz-adv-x="496"
|
832 |
+
d="M313.9 415.3c-170.2 0 -252.601 -223.8 -147.5 -355.1c36.5 -45.4004 88.5996 -75.6006 147.5 -75.6006c36.2998 0 70.2998 11.1006 99.3994 30.4004c-43.7998 -39.2002 -101.899 -63 -165.3 -63c-3.90039 0 -8 0 -11.9004 0.299805
|
833 |
+
c-131.5 6.10059 -236.1 114.601 -236.1 247.7c0 137 111 248 248 248h0.799805c63.1006 -0.299805 120.7 -24.0996 164.4 -63.0996c-29 19.3994 -63.1006 30.3994 -99.2998 30.3994zM415.7 17.5996c-40.9004 -24.6992 -90.7002 -23.5996 -132 5.80078
|
834 |
+
c56.2002 20.5 97.7002 91.5996 97.7002 176.6c0 84.7002 -41.2002 155.8 -97.4004 176.6c41.7998 29.2002 91.2002 30.3008 132.9 5c105.899 -98.6992 105.5 -265.699 -1.2002 -364z" />
|
835 |
+
<glyph glyph-name="internet-explorer" unicode="" horiz-adv-x="512"
|
836 |
+
d="M483.049 288.294c25.1963 -45.4473 33.2578 -97.5811 26.8516 -141.162h-328.792c0 -100.432 144.31 -136.029 196.818 -47.4355h120.833c-32.5645 -91.7285 -119.689 -146.022 -216.813 -146.022c-35.1367 0 -70.2725 0.143555 -101.695 15.5732
|
837 |
+
c-87.3975 -44.4941 -180.251 -56.5693 -180.251 42.0059c0 45.8066 23.2461 107.096 43.9922 145.022c35.1357 63.7227 81.4121 124.875 135.687 173.168c-43.7061 -18.8604 -91.125 -66.2959 -121.977 -101.158c25.877 112.787 129.466 193.638 237.098 186.457
|
838 |
+
c130.032 59.7939 209.673 34.1445 209.673 -38.5771c0 -27.4326 -10.5684 -63.2959 -21.4238 -87.8711zM64.5586 101.123c-73.001 -152.4 11.5254 -172.244 100.267 -123.304c-46.5635 27.4326 -82.5557 72.1533 -100.267 123.304zM180.536 209.996h207.961
|
839 |
+
c-2 55.1514 -50.5635 94.8711 -103.981 94.8711c-53.7041 0 -101.979 -39.7197 -103.979 -94.8711zM365.072 397.596c46.2764 -18.002 85.9824 -57.2939 112.263 -99.5859c7.1416 18.8604 14.5693 47.8643 14.5693 67.8672c0 32.0049 -22.8525 53.7217 -54.2744 53.7217
|
840 |
+
c-23.9951 0 -51.1328 -11.7158 -72.5576 -22.0029z" />
|
841 |
+
<glyph glyph-name="contao" unicode="" horiz-adv-x="512"
|
842 |
+
d="M45.4004 143c14.3994 -67.0996 26.3994 -129 68.1992 -175h-79.5996c-18.7002 0 -34 15.2002 -34 34v380c0 18.7002 15.2002 34 34 34h57.7002c-13.7998 -12.5996 -26.1006 -27.2002 -36.9004 -43.5996c-45.3994 -70 -27 -146.801 -9.39941 -229.4zM478 416
|
843 |
+
c18.7998 0 34 -15.2002 34 -34v-380.1c0 -18.8008 -15.2998 -34 -34 -34h-52.0996c38.6992 38.3994 60.5996 92.0996 57.3994 163.6l-137.399 -29.5996c-1.7002 -32.5 -12.9004 -63.8008 -57.4004 -73.2002c-24.9004 -5.2998 -45.4004 0.599609 -58.2998 11.7002
|
844 |
+
c-15.7998 13.5 -28.4004 31 -49.5 131.199c-21.4004 100.5 -17 121.601 -8.2002 140.301c7.2998 15.2998 23.7002 29.2998 48.2998 34.5996c44.7998 9.40039 67.7002 -14.9004 82.6006 -43.9004l137.1 29.3008c-13.5 34.5996 -31.2998 62.6992 -52.7002 84.0996h90.2002z
|
845 |
+
" />
|
846 |
+
<glyph glyph-name="500px" unicode=""
|
847 |
+
d="M103.3 103.7c-6.5 14.2002 -6.89941 18.2998 7.40039 23.0996c25.5996 8 8 -9.2002 43.2002 -49.2002h0.299805v93.9004c1.2002 50.2002 44 92.2002 97.7002 92.2002c53.8994 0 97.6992 -43.5 97.6992 -96.7998c0 -63.4004 -60.7998 -113.2 -128.5 -93.3008
|
848 |
+
c-10.5 4.2002 -2.09961 31.7002 8.5 28.6006c53 0 89.4004 10.0996 89.4004 64.3994c0 61 -77.0996 89.6006 -116.9 44.6006c-23.5 -26.4004 -17.5996 -42.1006 -17.5996 -157.601c50.7002 -31 118.3 -22 160.4 20.1006c24.7998 24.7998 38.5 58 38.5 93
|
849 |
+
c0 35.2002 -13.8008 68.2002 -38.8008 93.2998c-24.7998 24.7998 -57.7998 38.5 -93.2998 38.5s-68.7998 -13.7998 -93.5 -38.5c-0.299805 -0.299805 -16 -16.5 -21.2002 -23.9004l-0.5 -0.599609c-3.2998 -4.7002 -6.2998 -9.09961 -20.0996 -6.09961
|
850 |
+
c-6.90039 1.69922 -14.2998 5.7998 -14.2998 11.7998v186.8c0 5 3.89941 10.5 10.5 10.5h241.3c8.2998 0 8.2998 -11.5996 8.2998 -15.0996c0 -3.90039 0 -15.1006 -8.2998 -15.1006h-223.2v-132.899h0.299805c104.2 109.8 282.801 36 282.801 -108.9
|
851 |
+
c0 -178.1 -244.801 -220.3 -310.101 -62.7998zM166.6 364.5c3.80078 18.7998 145.101 50.7998 238.301 -38.2002c8.5 -7.5 -9.5 -22.7998 -14.3008 -22.7998c-6.59961 0 -84.5996 87.9004 -209.399 40.4004c-10 -3.90039 -15.1006 16.3994 -14.6006 20.5996zM393 33.2998
|
852 |
+
c8.09961 8 27.5996 -12.5996 20.7002 -20.3994c-135.601 -135.601 -357.601 -52.1006 -381.601 121.3c-1.5 10.7002 28.9004 15.5 28.9004 3.2998c33 -165 222 -214.1 332 -104.2zM213.6 141.4c0 3.39941 2.30078 4.69922 20.4004 22.5996l-18.2002 18.2002
|
853 |
+
c-5.59961 5.59961 7.40039 17.2998 12.4004 17.2998c3.09961 0 2.89941 -0.700195 21.5 -19.5l17.8994 17.9004c6.10059 6.09961 22.5 -8.90039 16.2002 -15.7002l-18.2002 -18.2002l17.3008 -17.2998c7.7998 -7.7998 -5.30078 -18.2002 -10.7002 -18.2002
|
854 |
+
c-3.2002 0 -2.7002 0.200195 -22.2998 19.5c-19.7002 -19.7002 -18.5 -19.5 -22.3008 -19.5c-2.39941 0 -5.5 1.40039 -8.5 4.40039c-1.19922 1.19922 -5.5 4.5 -5.5 8.5z" />
|
855 |
+
<glyph glyph-name="amazon" unicode=""
|
856 |
+
d="M257.2 285.3c0 39.2998 5.2002 69.2002 -35.5 69.1006c0 0 -37.9004 0 -54.2002 -49.5l-73.5 6.7998c0 49.2998 46.7002 104.3 134.7 104.3c87.7998 0 112.3 -57 112.3 -82.2998v-147.101c0 -27.5 32.2998 -52.7998 32.2998 -52.7998l-56.7998 -56
|
857 |
+
c-9.90039 9.2998 -38.7998 36.6006 -45.2998 46.7998c-45.2002 -70.7998 -183.5 -66.2998 -183.5 43.2002c0 102 120.8 115.7 169.5 117.5zM257.2 198.5v40.5996c-33.7002 -1.09961 -84.2002 -10.5996 -84.2002 -57.7998c0 -50.7998 84.2002 -62.7998 84.2002 17.2002z
|
858 |
+
M393.2 35c-7.7002 -10 -70 -67 -174.5 -67s-184.5 71.5 -209 101c-6.7998 7.7002 1 11.2998 5.5 8.2998c73.2998 -44.5 187.8 -117.8 372.5 -30.2998c7.5 3.7002 13.2998 -2 5.5 -12zM433 32.7998c-6.5 -15.7998 -16 -26.7998 -21.2002 -31
|
859 |
+
c-5.5 -4.5 -9.5 -2.7002 -6.5 3.7998s19.2998 46.5 12.7002 55c-6.5 8.30078 -37 4.30078 -48 3.2002c-10.7998 -1 -13 -2 -14 0.299805c-2.2998 5.7002 21.7002 15.5 37.5 17.5c15.7002 1.80078 41 0.800781 46 -5.69922c3.7002 -5.10059 0 -27.1006 -6.5 -43.1006z" />
|
860 |
+
<glyph glyph-name="houzz" unicode=""
|
861 |
+
d="M275.9 117.3h-104.601v-149.3h-154.3v448h109.5v-104.5l305.1 -85.5996v-257.9h-155.699v149.3z" />
|
862 |
+
<glyph glyph-name="vimeo-v" unicode=""
|
863 |
+
d="M447.8 294.4c-2 -43.6006 -32.3994 -103.301 -91.3994 -179.101c-60.9004 -79.2002 -112.4 -118.8 -154.601 -118.8c-26.0996 0 -48.2002 24.0996 -66.2998 72.2998c-35.2002 129.2 -50.2002 204.9 -79.2998 204.9c-3.40039 0 -15.1006 -7.10059 -35.2002 -21.1006
|
864 |
+
l-21 27.2002c51.5996 45.2998 100.9 95.7002 131.8 98.5c34.9004 3.40039 56.2998 -20.5 64.4004 -71.5c28.7002 -181.5 41.3994 -208.899 93.5996 -126.7c18.7002 29.6006 28.7998 52.1006 30.2002 67.6006c4.7998 45.8994 -35.7998 42.7998 -63.2998 31
|
865 |
+
c22 72.0996 64.0996 107.1 126.2 105.1c45.7998 -1.2002 67.5 -31.0996 64.8994 -89.3994z" />
|
866 |
+
<glyph glyph-name="black-tie" unicode=""
|
867 |
+
d="M0 416h448v-448h-448v448zM316.5 90.7998l-64.5 184l64.4004 86.6006h-184.9l64.5 -86.6006l-64.5 -184l92.5 -88.7002z" />
|
868 |
+
<glyph glyph-name="fonticons" unicode=""
|
869 |
+
d="M0 416h448v-448h-448v448zM187 275.1c11.9004 0 16.5996 -4.2998 16.2998 -23l50.7002 6.10059c0 44.5996 -30.5996 52.7998 -64.7002 52.7998c-50.7998 0 -77.2998 -20.4004 -77.2998 -70v-21h-28v-37.4004h22.2002c2.89941 0 5.7998 0 5.7998 -2.2998v-111.399
|
870 |
+
c0 -5.60059 -1.5 -7.30078 -6.7002 -7.90039l-21.2998 -2v-25.7002h130.7v25.1006l-43.5 4.09961c-5.2002 0.599609 -3.2002 1.5 -3.2002 7.2998v112.9h55.7002l11.0996 37.2998h-67.3994c-2.90039 0 0.599609 2 0.599609 4.40039v23.2998
|
871 |
+
c0 17.5 0.599609 27.3994 19 27.3994zM261.3 33.2998h102.601v25.1006l-15.7002 2.59961c-5.5 0.900391 -2.90039 1.5 -2.90039 7.2998v151.7h-80.2002l-6.69922 -29.5l24.1992 -6.40039c3.80078 -1.19922 6.7002 -3.7998 6.7002 -7.89941v-107.9
|
872 |
+
c0 -5.59961 -2.39941 -6.7002 -7.59961 -7.2998l-20.4004 -2.59961v-25.1006zM342.1 288.8l21.9004 24.2002l-3.5 9.59961h-27.7002l-15.5 28h-9.2998l-15.5 -28h-27.7002l-3.5 -9.59961l21.7998 -24.2002l-9 -33.2002l7.30078 -7.2998l31.1992 16.6006l31.2002 -16.6006
|
873 |
+
l7.2998 7.2998z" />
|
874 |
+
<glyph glyph-name="reddit-alien" unicode="" horiz-adv-x="512"
|
875 |
+
d="M440.3 244.5c55.2998 0 73.7002 -74.0996 23.7998 -99.7002c2.2002 -7.89941 3.10059 -16.7002 3.10059 -25.0996c0 -83.7998 -94.4004 -151.7 -210.8 -151.7c-115.9 0 -210.301 67.9004 -210.301 151.7c0 8.39941 0.800781 16.7998 2.60059 24.7002
|
876 |
+
c-50.9004 25.5 -32.7002 100.1 22.8994 100.1c15 0 28.7002 -6.2002 38.4004 -16.2998c35.7998 24.7002 83.4004 40.5996 136.3 42.7998l30.4004 137.6c1.2998 4.90039 6.09961 8.40039 11 7.10059l97.3994 -21.6006c6.60059 12.7002 19.9004 22 35.3008 22
|
877 |
+
c22.0996 0 39.6992 -18.0996 39.6992 -39.6992c0 -21.6006 -17.6992 -39.7002 -39.6992 -39.7002c-21.6006 0 -39.2002 17.5996 -39.2002 39.2002l-88.2002 19.7998l-27.7002 -124.8c53.2998 -1.7002 101.4 -17.6006 137.101 -42.3008
|
878 |
+
c9.69922 9.7002 22.8994 15.9004 37.8994 15.9004zM129.4 139.1c0 -21.5996 17.6992 -39.2998 39.6992 -39.1992c21.6006 0 39.2002 17.5996 39.2002 39.1992c0 22.1006 -17.5996 39.7002 -39.2002 39.7002c-22.0996 0 -39.6992 -17.7002 -39.6992 -39.7002zM343.7 45.5996
|
879 |
+
c4 3.5 4 9.7002 -0.100586 13.7002c-3.5 3.5 -9.69922 3.5 -13.1992 0c-29 -29 -121.2 -28.5 -149 0c-3.5 3.5 -9.7002 3.5 -13.2002 0c-4 -4 -4 -10.2002 0 -13.7002c36.3994 -36.3994 139.1 -36.3994 175.5 0zM342.9 99.7998c22 0 39.5996 17.7002 39.6992 39.2002
|
880 |
+
c0 22.0996 -17.6992 39.7002 -39.6992 39.7002c-21.6006 0 -39.2002 -17.7002 -39.2002 -39.7002c0 -21.5996 17.5996 -39.2002 39.2002 -39.2002z" />
|
881 |
+
<glyph glyph-name="edge" unicode="" horiz-adv-x="512"
|
882 |
+
d="M25.7139 219.837c0.111328 0.162109 0.230469 0.323242 0.341797 0.485352c-0.0205078 -0.162109 -0.0449219 -0.323242 -0.0644531 -0.485352h-0.277344zM486.286 204.329l0.000976562 -52.0645h-314.073c1.38379 -128.497 191.392 -124.065 272.255 -67.5713v-104.404
|
883 |
+
c-47.3555 -28.5244 -156.774 -53.1709 -240.132 -21.3242c-70.6191 27.1406 -119.913 100.528 -120.743 171.977c-1.10742 92.2188 45.6943 153.422 120.742 188.314c-15.7852 -19.9395 -27.9697 -41.54 -34.3389 -78.9258h175.853
|
884 |
+
c10.2471 104.957 -99.4189 104.957 -99.4189 104.957c-103.302 -3.58984 -177.945 -63.6543 -220.375 -124.966c14.5615 114.465 92.9062 219.955 232.837 219.678c85.0195 0 157.605 -39.8779 198.593 -113.265c21.0469 -37.9404 28.8008 -78.373 28.8008 -122.405z" />
|
885 |
+
<glyph glyph-name="codiepie" unicode="" horiz-adv-x="472"
|
886 |
+
d="M422.5 245.1c30.7002 0 33.5 -53.0996 -0.299805 -53.0996h-10.7998v-44.2998h-26.6006v97.3994h37.7002zM472 95.4004c-42.0996 -91.9004 -121.6 -151.4 -224 -151.4c-137 0 -248 111 -248 248s111 248 248 248c97.4004 0 172.8 -53.7002 218.2 -138.4l-186 -108.8z
|
887 |
+
M433.5 82.9004l-60.2998 30.6992c-27.1006 -44.2998 -70.4004 -71.3994 -122.4 -71.3994c-82.5 0 -149.2 66.7002 -149.2 148.899c0 82.5 66.7002 149.2 149.2 149.2c48.4004 0 88.9004 -23.5 116.9 -63.3994l59.5 34.5996c-40.7002 62.5996 -104.7 100 -179.2 100
|
888 |
+
c-121.2 0 -219.5 -98.2998 -219.5 -219.5s98.2998 -219.5 219.5 -219.5c78.5996 0 146.5 42.0996 185.5 110.4z" />
|
889 |
+
<glyph glyph-name="modx" unicode=""
|
890 |
+
d="M356 206.2l36.7002 -23.7002v-214.5l-133 83.7998zM440 373l-83.2002 -134.3l-153.5 96.5l23 37.7998h213.7zM351 230.2l-249.8 -57.7002l-46 29v214.5zM97 153.8l249.7 57.7002l-125 -200.5h-213.7z" />
|
891 |
+
<glyph glyph-name="fort-awesome" unicode="" horiz-adv-x="512"
|
892 |
+
d="M489.2 160.1c2.59961 0 4.59961 -2 4.5 -4.59961v-219.5h-182.9v96c0 72.5996 -109.7 72.5996 -109.7 0v-96h-182.899v219.5c0 2.59961 2 4.59961 4.59961 4.59961h27.4004c2.59961 0 4.59961 -2 4.59961 -4.59961v-32h36.6006v178.3
|
893 |
+
c0 2.60059 2 4.60059 4.59961 4.60059h27.4004c2.59961 0 4.59961 -2 4.59961 -4.60059v-32h36.2998v32c0 2.60059 2 4.60059 4.60059 4.60059h27.3994c2.60059 0 4.60059 -2 4.60059 -4.60059v-32h36.5996v32c0 6 8 4.60059 11.7002 4.60059v111.699
|
894 |
+
c-5.40039 2.60059 -9.10059 8.30078 -9.10059 14.3008c0 20.7998 31.4004 20.6992 31.4004 0c0 -6 -3.7002 -11.7002 -9.09961 -14.3008v-4.89941c7.69922 1.7998 15.6992 2.89941 23.6992 2.89941c11.7002 0 22.9004 -4.2998 32.6006 -4.2998
|
895 |
+
c8.89941 0 18.8994 4.2998 24 4.2998c2.59961 0 4.59961 -2 4.59961 -4.59961v-60c0 -6.90039 -23.0996 -8 -27.7002 -8c-10.5 0 -20.5 4.2998 -31.3994 4.2998c-8.60059 0 -17.4004 -1.39941 -25.7002 -3.39941v-38c3.7002 0 11.7002 1.39941 11.7002 -4.60059v-32h36.5996
|
896 |
+
v32c0 2.60059 2 4.60059 4.60059 4.60059h27.3994c2.60059 0 4.60059 -2 4.60059 -4.60059v-32h36.5996v32c0 2.60059 2 4.60059 4.59961 4.60059h27.4004c2.59961 0 4.59961 -2 4.59961 -4.60059v-178.3h36.6006v32c0 2.59961 2 4.59961 4.59961 4.59961h27.4004z
|
897 |
+
M201.1 164.6v64c0 2.60059 -2 4.60059 -4.59961 4.60059h-27.4004c-2.59961 0 -4.59961 -2 -4.59961 -4.60059v-64c0 -2.59961 2 -4.59961 4.59961 -4.59961h27.4004c2.59961 0 4.59961 2 4.59961 4.59961zM347.5 164.6v64c0 2.60059 -2 4.60059 -4.59961 4.60059h-27.4004
|
898 |
+
c-2.59961 0 -4.59961 -2 -4.59961 -4.60059v-64c0 -2.59961 2 -4.59961 4.59961 -4.59961h27.4004c2.59961 0 4.59961 2 4.59961 4.59961z" />
|
899 |
+
<glyph glyph-name="usb" unicode="" horiz-adv-x="640"
|
900 |
+
d="M641.5 192c0 -3.09961 -1.7002 -6.09961 -4.5 -7.5l-89.0996 -53.5c-1.40039 -0.799805 -2.80078 -1.40039 -4.5 -1.40039c-1.40039 0 -3.10059 0.300781 -4.5 1.10059c-2.80078 1.7002 -4.5 4.5 -4.5 7.7998v35.5996h-238.7
|
901 |
+
c25.2998 -39.5996 40.5 -106.899 69.5996 -106.899h26.7002v26.7998c0 5 3.90039 8.90039 8.90039 8.90039h89.0996c5 0 8.90039 -3.90039 8.90039 -8.90039v-89.0996c0 -5 -3.90039 -8.90039 -8.90039 -8.90039h-89.0996c-5 0 -8.90039 3.90039 -8.90039 8.90039v26.6992
|
902 |
+
h-26.7002c-75.3994 0 -81.0996 142.5 -124.7 142.5h-100.3c-8.09961 -30.5996 -35.8994 -53.5 -69 -53.5c-39.2998 0.100586 -71.2998 32.1006 -71.2998 71.4004s32 71.2998 71.2998 71.2998c33.1006 0 61 -22.7998 69 -53.5c39.1006 0 43.9004 -9.5 74.6006 60.4004
|
903 |
+
c40.0996 89.0996 58.0996 82.0996 108.899 82.0996c7.5 20.9004 27 35.6006 50.4004 35.6006c29.5 0 53.5 -23.9004 53.5 -53.5c0 -29.6006 -23.9004 -53.5 -53.5 -53.5c-23.4004 0 -42.9004 14.7998 -50.4004 35.5996h-29.7998
|
904 |
+
c-29.0996 0 -44.2998 -67.4004 -69.5996 -106.9h310.1v35.6006c0 3.2998 1.7002 6.09961 4.5 7.7998s6.40039 1.40039 8.90039 -0.299805l89.0996 -53.5c2.7998 -1.10059 4.5 -4.10059 4.5 -7.2002z" />
|
905 |
+
<glyph glyph-name="product-hunt" unicode="" horiz-adv-x="512"
|
906 |
+
d="M326.3 229.2c0 -20.5 -16.7002 -37.2002 -37.2002 -37.2002h-70.2998v74.4004h70.2998c20.5 0 37.2002 -16.7002 37.2002 -37.2002zM504 192c0 -137 -111 -248 -248 -248s-248 111 -248 248s111 248 248 248s248 -111 248 -248zM375.9 229.2
|
907 |
+
c0 47.8994 -38.9004 86.7998 -86.8008 86.7998h-119.899v-248h49.5996v74.4004h70.2998c47.9004 0 86.8008 38.8994 86.8008 86.7998z" />
|
908 |
+
<glyph glyph-name="mixcloud" unicode="" horiz-adv-x="640"
|
909 |
+
d="M424.43 228.271c42.3623 -9.1377 74.4805 -47.0693 74.4805 -92.2002c0 -52.3311 -42.6406 -94.6934 -94.9688 -94.6934h-289.614c-62.5752 0 -113.243 50.668 -113.243 112.966c0 56.7598 42.085 103.554 96.6299 111.582
|
910 |
+
c22.9814 67.5586 86.9395 114.074 159.205 114.074c87.2158 0 159.205 -66.7266 167.511 -151.729zM403.941 83.7412c29.0713 0 52.6064 23.5352 52.6064 52.3301c0 22.1494 -14.1211 40.9766 -33.502 48.4531c-1.38477 -8.58301 -3.59961 -17.166 -6.36914 -25.4727
|
911 |
+
c-8.01367 -25.6484 -49.0898 -14.2266 -40.1465 13.29c4.15332 12.7373 6.36914 26.0264 6.36914 39.5938c0 69.2197 -56.4834 125.702 -125.979 125.702c-49.8379 0 -94.6934 -29.626 -114.628 -73.9258c19.3809 -4.98438 37.3779 -14.9512 52.0527 -29.3486
|
912 |
+
c19.9531 -19.9531 -10.2168 -50.1436 -30.1797 -30.1807c-13.29 13.291 -31.0107 20.7666 -49.8379 20.7666c-39.04 0 -70.8809 -31.5645 -70.8809 -70.6045s31.8408 -70.6035 70.8809 -70.6035h289.614zM639.01 136.071c0 -44.0244 -12.7363 -86.3867 -37.1016 -122.657
|
913 |
+
c-4.15332 -6.0918 -10.7979 -9.41406 -17.7197 -9.41406c-16.3174 0 -27.1279 18.8262 -17.4434 32.9492c19.3809 29.3486 29.9033 63.6816 29.9033 99.1221c0 35.4395 -10.5215 69.7725 -29.9033 98.8447c-15.6553 22.8311 19.3613 47.2402 35.1631 23.5342
|
914 |
+
c24.3662 -35.9932 37.1016 -78.3564 37.1016 -122.379zM568.13 136.071c0 -31.5654 -9.13672 -62.0215 -26.8564 -88.3252c-4.15332 -6.09082 -10.7988 -9.13574 -17.7207 -9.13574c-17.2012 0 -27.0215 18.9785 -17.4424 32.9473
|
915 |
+
c13.0127 19.1045 19.6572 41.2559 19.6572 64.5137c0 22.9805 -6.64453 45.4072 -19.6572 64.5117c-15.7617 22.9863 19.0078 47.0947 35.1631 23.5352c17.7188 -26.0264 26.8564 -56.4834 26.8564 -88.0469z" />
|
916 |
+
<glyph glyph-name="scribd" unicode="" horiz-adv-x="384"
|
917 |
+
d="M42.2998 195.3c-16.0996 19 -24.7002 45.9004 -24.7998 79.9004c0 100.399 75.2002 153.1 167.2 153.1c98.5996 1.60059 156.8 -49 184.3 -70.5996l-50.5 -72.1006l-37.2998 24.6006l26.8994 38.5996c-36.5 24 -79.3994 36.5 -123 35.7998
|
918 |
+
c-50.6992 0.800781 -111.699 -27.1992 -111.699 -76.1992c0 -18.7002 11.1992 -20.7002 28.5996 -15.6006c23.2998 5.2998 41.9004 -0.599609 55.7998 -14c26.4004 -24.2998 23.2002 -67.5996 -0.700195 -91.8994c-29.1992 -29.5 -85.1992 -27.3008 -114.8 8.39941z
|
919 |
+
M360 189.4c33.9004 -40.4004 36.7998 -138.2 -20.2998 -189.601c-39.2002 -33.5996 -82.2002 -44.0996 -133.601 -44.0996c-70.2998 -0.299805 -138.199 25.3994 -190.699 72.2002l-15.4004 13.7998l60.7998 71.7998l35.6006 -27.4004l-33.7002 -39.3994
|
920 |
+
c41.7002 -30.9004 92.2002 -47.5 144.1 -47.2998c61.9004 0 104.7 23.5 121.4 64.3994c0.899414 4.2002 1.39941 8.40039 1.39941 12.7002c0 18.7002 -11.1992 20.7002 -28.5996 15.5996c-23.2998 -5.2998 -42.2002 0.5 -56.2998 14.4004
|
921 |
+
c-12.4004 11.2998 -19.1006 27.5 -18.4004 44.2998c-0.599609 39.2002 32.4004 69.2002 70.5 67.2002c24.2998 0.799805 47.7002 -9.7998 63.2002 -28.5996z" />
|
922 |
+
<glyph glyph-name="bluetooth" unicode=""
|
923 |
+
d="M292.6 276.9l-42.8994 -42.9004l-0.299805 86zM249.4 57.0996l0.199219 86l42.9004 -42.8994zM416 188.6c0 -205.6 -71.9004 -252.6 -185.1 -252.6c-113.2 0 -198.9 47 -198.9 252.6c0 205.601 83.4004 259.4 196.6 259.4c113.2 0 187.4 -53.9004 187.4 -259.4z
|
924 |
+
M257.5 188.6l79.4004 88.6006l-125.101 134.3v-176.9l-73.7998 73.8008l-27 -26.9004l92.7002 -93l-92.7002 -93l26.9004 -26.9004l73.7998 73.8008l2.2998 -170l127.4 127.5z" />
|
925 |
+
<glyph glyph-name="bluetooth-b" unicode="" horiz-adv-x="320"
|
926 |
+
d="M196.48 187.977l97.9111 -103.333l-148.552 -148.644l-2.71484 198.284l-86.1113 -86.1113l-31.4053 31.4053l108.061 108.398l-108.061 108.399l31.4053 31.4053l86.1113 -86.1113v206.33l145.981 -156.69zM237.34 290.973l-50.3145 50.3174l0.337891 -100.295z
|
927 |
+
M187.363 134.96l-0.337891 -100.294l50.3145 50.3164z" />
|
928 |
+
<glyph glyph-name="gitlab" unicode="" horiz-adv-x="512"
|
929 |
+
d="M105.2 423.1c0 0 56.5 -174.8 56.5996 -174.8h-132l56.5 174.8c3.2002 8.90039 15.7998 8.90039 18.9004 0zM0.900391 160.3l28.7998 88l226.2 -294l-247.9 184c-6.7998 5.10059 -9.7002 14 -7.09961 22zM161.7 248.3h188.6l-94.2998 -294zM511.1 160.3
|
930 |
+
c2.5 -8 -0.299805 -16.8994 -7.19922 -22l-247.9 -184l226.3 294zM425.7 423.1l56.5 -174.8h-132l56.5996 174.8c3.2002 8.90039 15.7998 8.90039 18.9004 0z" />
|
931 |
+
<glyph glyph-name="wpbeginner" unicode="" horiz-adv-x="512"
|
932 |
+
d="M462.799 125.626c56.2109 -64.3076 4.16211 -157.626 -91.8545 -157.626c-39.6025 0 -78.8242 17.6865 -100.143 50.04c-6.88672 -0.356445 -22.7021 -0.356445 -29.5898 0c-21.3643 -32.4209 -60.624 -50.04 -100.143 -50.04
|
933 |
+
c-95.4902 0 -148.349 92.9961 -91.8555 157.626c-79.1387 131.851 31.2646 290.374 206.792 290.374c175.632 0 285.87 -158.626 206.793 -290.374zM123.152 208.598h41.5283v58.0752h-41.5283v-58.0752zM340.332 122.526v23.8389
|
934 |
+
c-60.5059 -20.915 -132.355 -9.19824 -187.589 33.9707l0.246094 -24.8965c51.1006 -46.3672 131.746 -57.875 187.343 -32.9131zM189.579 208.598h166.058v58.0752h-166.058v-58.0752z" />
|
935 |
+
<glyph glyph-name="wpforms" unicode=""
|
936 |
+
d="M448 372.8v-361.7c0 -24.2998 -19 -43.1992 -43.2002 -43.1992h-361.6c-23.9004 0.0996094 -43.2002 18.6992 -43.2002 43.2998v361.6c0 24.1006 18.7998 43.2002 43.2002 43.2002h361.7c24 0 43.0996 -18.7998 43.0996 -43.2002zM410.7 11.2002v361.6
|
937 |
+
c0 3 -2.60059 5.7998 -5.7998 5.7998h-9.30078l-110.3 -74.5996l-61.2998 49.9004l-61.2002 -49.9004l-110.3 74.7002h-9.2998c-3.2002 0 -5.7998 -2.7998 -5.7998 -5.7998v-361.7c0 -3 2.59961 -5.7998 5.7998 -5.7998h361.7
|
938 |
+
c3.19922 -0.100586 5.7998 2.69922 5.7998 5.7998zM150.2 262v-37h-73.5v37h73.5zM150.2 187.6v-37.2998h-73.5v37.2998h73.5zM161.3 334.9l54 43.6992h-118.5zM371.3 262v-37h-196v37h196zM371.3 187.6v-37.2998h-196v37.2998h196zM286.7 334.9l64.5 43.6992h-118.4z
|
939 |
+
M371.3 113v-37.2998h-99.3994v37.2998h99.3994z" />
|
940 |
+
<glyph glyph-name="envira" unicode=""
|
941 |
+
d="M0 416c477.6 0 366.6 -317.3 367.1 -366.3l80.9004 -81.7002h-26l-70.4004 71.2002c-39 -4.2002 -124.399 -34.5 -214.399 37c-90.2002 71.5 -85.2002 157.1 -137.2 339.8zM79.7002 370c-49.7002 23.5 -5.2002 -9.2002 -5.2002 -9.2002
|
942 |
+
c45.2002 -31.2002 66 -73.7002 90.2002 -119.899c31.5 -60.2002 79 -139.7 144.2 -167.7c65 -28 34.1992 -12.5 6 8.5c-28.2002 21.2002 -68.2002 87 -91 130.2c-31.7002 60 -61 118.6 -144.2 158.1z" />
|
943 |
+
<glyph glyph-name="glide" unicode=""
|
944 |
+
d="M252.8 299.4c0 -8.80078 -1.59961 -17.7002 -3.39941 -26.4004c-5.80078 -27.7998 -11.6006 -55.7998 -17.3008 -83.5996c-1.39941 -6.30078 -8.2998 -4.90039 -13.6992 -4.90039c-23.8008 0 -30.5 26 -30.5 45.5c0 29.2998 11.1992 68.0996 38.5 83.0996
|
945 |
+
c4.2998 2.5 9.19922 4.2002 14.0996 4.2002c11.4004 0 12.2998 -8.2998 12.2998 -17.8994zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM384 181c0 5.09961 -20.7998 37.7002 -25.5 39.5
|
946 |
+
c-2.2002 0.900391 -7.2002 2.2998 -9.59961 2.2998c-23.1006 0 -38.7002 -10.5 -58.2002 -21.5l-0.5 0.5c4.2998 29.4004 14.5996 57.2002 14.5996 87.4004c0 44.5996 -23.7998 62.7002 -67.5 62.7002c-71.7002 0 -108 -70.8008 -108 -123.5c0 -54.7002 32 -85 86.2998 -85
|
947 |
+
c7.5 0 6.90039 0.599609 6.90039 -2.30078c-10.5 -80.2998 -56.5 -82.8994 -56.5 -58.8994c0 24.3994 28 36.5 28.2998 38c-0.200195 7.59961 -29.2998 17.2002 -36.7002 17.2002c-21.0996 0 -32.6992 -33 -32.6992 -50.6006c0 -32.2998 20.3994 -54.7002 53.2998 -54.7002
|
948 |
+
c48.2002 0 83.3994 49.7002 94.2998 91.7002c9.40039 37.7002 7 39.4004 12.2998 42.1006c20 10.0996 35.7998 16.7998 58.4004 16.7998c11.0996 0 19 -2.2998 36.7002 -5.2002c1.7998 -0.0996094 4.09961 1.7002 4.09961 3.5z" />
|
949 |
+
<glyph glyph-name="glide-g" unicode=""
|
950 |
+
d="M407.1 236.8c7.5 -2.89941 40.9004 -55.3994 40.9004 -63.3994c0 -2.90039 -3.7998 -5.80078 -6.7002 -5.80078c-28.3994 4.7002 -41.0996 8.40039 -58.8994 8.40039c-36.3008 0 -61.6006 -10.7998 -93.8008 -27c-8.5 -4.2998 -4.59961 -7.09961 -19.6992 -67.5996
|
951 |
+
c-17.4004 -67.6006 -74 -145.4 -151.4 -145.4c-52.7002 0 -85.5 36 -85.5 87.9004c0 28.0996 18.5 79.1992 52.4004 79.2998c11.8994 0 58.5996 -15.4004 58.8994 -27.6006c-0.5 -2.39941 -45.5 -21.7998 -45.5 -61c0 -38.5 73.9004 -34.2998 90.7998 94.6006
|
952 |
+
c0 4.7998 1 3.7998 -11 3.7998c-87.2998 0 -138.6 48.7002 -138.6 136.6c0 84.7002 58.2998 198.4 173.4 198.4c70.1992 0 108.399 -29.0996 108.399 -100.6c0 -48.5 -16.5 -93.1006 -23.5 -140.4l0.900391 -0.900391c31.2998 17.7002 56.3994 34.5 93.5 34.5
|
953 |
+
c3.7998 0 11.8994 -2.39941 15.3994 -3.7998zM231.8 321.2c2.90039 13.8994 5.5 28.0996 5.60059 42.3994c0 15.4004 -1.40039 28.7002 -20 28.7002c-7.80078 0 -15.6006 -2.59961 -22.6006 -6.7002c-43.7998 -24.0996 -61.7998 -86.3994 -61.7998 -133.399
|
954 |
+
c0 -31.2998 10.7002 -73.1006 49 -73.1006c8.7002 0 19.7002 -2.39941 22 7.80078c9.2002 44.6992 18.5 89.5996 27.7998 134.3z" />
|
955 |
+
<glyph glyph-name="viadeo" unicode=""
|
956 |
+
d="M276.2 297.5v-0.700195c-17.9004 52.6006 -42.6006 103.4 -70.7998 151.2c43.2998 -29.2002 67 -100 70.7998 -150.5zM308.9 175.8c15.0996 3.10059 29.5 9 42.1992 17c24.5 -58.5996 20.2002 -139.7 -36.3994 -201c-67.7998 -73.8994 -191.9 -74.5996 -259.8 0
|
957 |
+
c-108.801 117.8 -31.6006 313.7 129.899 313.7c21.2998 0 42.6006 -3.5 62.5 -10.7002c-6.89941 -13.3994 -11.7002 -28.2002 -13.3994 -43.2998c-15.4004 6.5 -32.3008 9.59961 -49.1006 9.59961c-78 0 -135.399 -66.6992 -135.399 -142.3
|
958 |
+
c0 -68.7998 45.5996 -126 111.3 -137.399c98.5 38.3994 116.6 188.199 116.6 280c0 11.6992 0 23.6992 -1 35.3994c12.4004 -36.0996 18.9004 -73.8994 18.9004 -112c0 -86.5 -35.1006 -158.399 -109.3 -205.1l-3.80078 -0.299805
|
959 |
+
c80 -1.60059 137.801 61.6992 137.801 139.399c0 19.5 -3.40039 38.7998 -11 57zM418.1 436.3c52 -74 20.9004 -208.6 -58.0996 -208.6c-21.2998 0 -40.2002 11.3994 -55 25.7998c35.0996 19.2998 79.4004 49.2002 99.7002 84.9004
|
960 |
+
c2.39941 4.7998 6.5 13.6992 7.2002 19.1992c-19.9004 -44.6992 -70.8008 -79.6992 -118.2 -90.6992c-7.5 11.6992 -12 24.6992 -12 38.7998c0 16.5 8.2002 38.5 20.5996 50.5c34.5 32.8994 84.7998 13.5996 115.8 80.0996z" />
|
961 |
+
<glyph glyph-name="viadeo-square" unicode=""
|
962 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM280.7 66.7998c35.3994 38.2998 38.0996 89 22.7998 125.601c-7.90039 -4.90039 -16.9004 -8.60059 -26.4004 -10.5
|
963 |
+
c4.80078 -11.4004 6.90039 -23.5 6.90039 -35.7002c0 -48.6006 -36.2002 -88.2002 -86.2002 -87.2002l2.40039 0.200195c46.3994 29.2002 68.2998 74.0996 68.2998 128.2c0 23.7998 -4.09961 47.5 -11.7998 70v0.399414c-2.2998 31.6006 -17.1006 75.7998 -44.2002 94.1006
|
964 |
+
c17.5996 -29.9004 33 -61.6006 44.2002 -94.5c0.599609 -7.30078 0.599609 -14.8008 0.599609 -22.1006c0 -57.3994 -11.3994 -151 -72.8994 -175c-41 7.2002 -69.5 42.9004 -69.5 85.9004c0 47.2002 35.7998 88.8994 84.5996 88.8994c10.5 0 21 -1.89941 30.7002 -6
|
965 |
+
c1.09961 9.5 4.09961 18.7002 8.39941 27.1006c-12.5 4.59961 -25.7998 6.7002 -39.0996 6.7002c-101 0 -149.2 -122.5 -81.2002 -196.101c42.4004 -46.5996 120 -46.2002 162.4 0zM309 214.3c49.4004 0 68.7998 84.1006 36.2998 130.3
|
966 |
+
c-19.3994 -41.5 -50.7998 -29.5 -72.3994 -50c-7.7002 -7.5 -12.9004 -21.2998 -12.9004 -31.5996c0 -8.7998 2.7998 -17 7.5 -24.2998c29.7002 6.89941 61.4004 28.7998 73.9004 56.7002c-0.400391 -3.40039 -3 -9 -4.5 -12c-12.7002 -22.3008 -40.4004 -41 -62.3008 -53
|
967 |
+
c9.30078 -9 21.1006 -16.1006 34.4004 -16.1006z" />
|
968 |
+
<glyph glyph-name="snapchat" unicode="" horiz-adv-x="496"
|
969 |
+
d="M248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM417.5 101.1c2.2002 5.30078 -0.900391 9.80078 -4.90039 10.8008c-46.2998 7.59961 -67.0996 55.0996 -68 57.0996
|
970 |
+
c-0.0996094 0.0996094 -0.0996094 0.200195 -0.199219 0.299805c-2.40039 5 -3 9.2002 -1.60059 12.5c2.60059 6.2998 12.5 9.40039 19 11.5c1.7998 0.600586 3.5 1.10059 4.90039 1.7002c11.5 4.5 17.2998 10.0996 17.2002 16.5996
|
971 |
+
c-0.100586 5.10059 -4.10059 9.60059 -10.4004 11.9004c-4 1.59961 -9.59961 1.90039 -13.5996 0c-5.5 -2.59961 -10.4004 -4 -14.7002 -4.2002c-2.7998 0.100586 -4.60059 0.799805 -5.7002 1.40039c1.40039 24 4.7002 58 -3.7998 77.0996
|
972 |
+
c-16.2998 36.5 -49.6006 54.2998 -84.2998 54.2998c-0.600586 0 -6.10059 -0.0996094 -6.7002 -0.0996094c-14 0 -61.6006 -4 -84.1006 -54.2998c-8.5 -19.1006 -5.19922 -53.2002 -3.7998 -77.1006c-1.09961 -0.599609 -3.2998 -1.39941 -6.59961 -1.39941
|
973 |
+
c-4.5 0 -9.7998 1.39941 -15.7002 4.2002c-7.5 3.5 -20.2998 -1.80078 -21.9004 -10.3008c-1 -4.89941 1.2002 -12.0996 17 -18.2998c6.10059 -2.5 20.6006 -5.2998 24 -13.2002c1.40039 -3.2998 0.900391 -7.5 -1.59961 -12.5
|
974 |
+
c-0.0996094 -0.0996094 -0.200195 -0.199219 -0.200195 -0.299805c-0.899414 -2 -21.7002 -49.5 -68 -57.0996c-3.59961 -0.600586 -6.09961 -3.7998 -5.89941 -7.40039c0.699219 -13.8994 31.6992 -19.2998 45.5 -21.3994c1.39941 -1.90039 2.5 -9.90039 4.2998 -16
|
975 |
+
c0.799805 -2.7002 2.89941 -6 8.2998 -6s13.2998 3.09961 25.7998 3.09961c17.6006 0 23.6006 -4 37.4004 -13.7002c9.89941 -7 27.5 -19.7998 48.5 -18.2002c20.7998 -0.899414 34.7002 7.90039 49.2002 18.2002c13.6992 9.7002 19.7998 13.7002 37.3994 13.7002
|
976 |
+
c13 0 19.6006 -2.90039 25.7998 -2.90039h0.200195c4.40039 0 7 2.2002 8.10059 5.90039c1.7998 6.09961 2.89941 14 4.2998 15.9004c26.7002 4.19922 41.2998 10.0996 44.7998 18.1992z" />
|
977 |
+
<glyph glyph-name="snapchat-ghost" unicode="" horiz-adv-x="512"
|
978 |
+
d="M510.846 55.3271c-5.21094 -12.1572 -27.2383 -21.0889 -67.3594 -27.3184c-2.06445 -2.78613 -3.77539 -14.6855 -6.50781 -23.9561c-1.625 -5.56543 -5.62207 -8.86914 -12.1279 -8.86914l-0.296875 0.00585938c-9.39453 0 -19.2031 4.32227 -38.8516 4.32227
|
979 |
+
c-26.5215 0 -35.6621 -6.04297 -56.2539 -20.5879c-21.832 -15.4375 -42.7715 -28.7637 -74.0273 -27.3984c-31.6455 -2.33398 -58.0244 16.9072 -72.8711 27.4033c-20.7139 14.6436 -29.8281 20.582 -56.2412 20.582c-18.8633 0 -30.7354 -4.71973 -38.8516 -4.71973
|
980 |
+
c-8.07324 0 -11.2129 4.92188 -12.4219 9.04004c-2.70312 9.18848 -4.4043 21.2627 -6.52344 24.1299c-20.6787 3.20898 -67.3096 11.3438 -68.498 32.1504c-0.00878906 0.161133 -0.015625 0.422852 -0.015625 0.583984c0 4.97559 3.98438 9.67285 8.89258 10.4844
|
981 |
+
c69.583 11.4551 100.925 82.9014 102.228 85.9346c0.0742188 0.175781 0.155273 0.34375 0.237305 0.514648c3.71289 7.53711 4.54395 13.8486 2.46289 18.7529c-5.05078 11.8965 -26.8721 16.1641 -36.0537 19.7959c-23.7148 9.36621 -27.0146 20.1279 -25.6113 27.5039
|
982 |
+
c2.43652 12.8359 21.7246 20.7354 33.002 15.4531c8.91895 -4.18066 16.8428 -6.29688 23.5469 -6.29688c5.02148 0 8.21191 1.2041 9.95996 2.1709c-2.04297 35.9365 -7.10156 87.29 5.68652 115.969c33.7734 75.7188 105.356 81.6025 126.478 81.6025
|
983 |
+
c0.943359 0 9.14062 0.0888672 10.1094 0.0888672c52.1484 0 102.255 -26.7803 126.724 -81.6426c12.7764 -28.6504 7.74902 -79.792 5.69434 -116.01c1.58203 -0.87207 4.35742 -1.94141 8.59961 -2.13867c6.39648 0.286133 13.8145 2.38867 22.0693 6.25684
|
984 |
+
c6.08496 2.84668 14.4053 2.46094 20.4795 -0.0576172l0.0292969 -0.00976562c9.47559 -3.38574 15.4385 -10.2158 15.5889 -17.8701c0.183594 -9.74707 -8.52246 -18.165 -25.8779 -25.0186c-2.11816 -0.834961 -4.69434 -1.6543 -7.43457 -2.52441
|
985 |
+
c-9.79688 -3.10645 -24.5996 -7.80566 -28.6152 -17.2715c-2.0791 -4.9043 -1.25684 -11.2109 2.45996 -18.748c0.0869141 -0.167969 0.166016 -0.341797 0.238281 -0.514648c1.30176 -3.03027 32.6152 -74.46 102.23 -85.9346
|
986 |
+
c6.42676 -1.05762 11.1631 -7.87695 7.72461 -15.8584z" />
|
987 |
+
<glyph glyph-name="snapchat-square" unicode=""
|
988 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM393.5 101.1c2.2002 5.30078 -0.900391 9.80078 -4.90039 10.8008c-46.2998 7.59961 -67.0996 55.0996 -68 57.0996
|
989 |
+
c-0.0996094 0.0996094 -0.0996094 0.200195 -0.199219 0.299805c-2.40039 5 -3 9.2002 -1.60059 12.5c2.60059 6.2998 12.5 9.40039 19 11.5c1.7998 0.600586 3.5 1.10059 4.90039 1.7002c11.5 4.5 17.2998 10.0996 17.2002 16.5996
|
990 |
+
c-0.100586 5.10059 -4.10059 9.60059 -10.4004 11.9004c-4 1.59961 -9.59961 1.90039 -13.5996 0c-5.5 -2.59961 -10.4004 -4 -14.7002 -4.2002c-2.7998 0.100586 -4.60059 0.799805 -5.7002 1.40039c1.40039 24 4.7002 58 -3.7998 77.0996
|
991 |
+
c-16.2998 36.5 -49.6006 54.2998 -84.2998 54.2998c-0.600586 0 -6.10059 -0.0996094 -6.7002 -0.0996094c-14 0 -61.6006 -4 -84.1006 -54.2998c-8.5 -19.1006 -5.19922 -53.2002 -3.7998 -77.1006c-1.09961 -0.599609 -3.2998 -1.39941 -6.59961 -1.39941
|
992 |
+
c-4.5 0 -9.7998 1.39941 -15.7002 4.2002c-7.5 3.5 -20.2998 -1.80078 -21.9004 -10.3008c-1 -4.89941 1.2002 -12.0996 17 -18.2998c6.10059 -2.5 20.6006 -5.2998 24 -13.2002c1.40039 -3.2998 0.900391 -7.5 -1.59961 -12.5
|
993 |
+
c-0.0996094 -0.0996094 -0.200195 -0.199219 -0.200195 -0.299805c-0.899414 -2 -21.7002 -49.5 -68 -57.0996c-3.59961 -0.600586 -6.09961 -3.7998 -5.89941 -7.40039c0.699219 -13.8994 31.6992 -19.2998 45.5 -21.3994c1.39941 -1.90039 2.5 -9.90039 4.2998 -16
|
994 |
+
c0.799805 -2.7002 2.89941 -6 8.2998 -6s13.2998 3.09961 25.7998 3.09961c17.6006 0 23.6006 -4 37.4004 -13.7002c9.89941 -7 27.5 -19.7998 48.5 -18.2002c20.7998 -0.899414 34.7002 7.90039 49.2002 18.2002c13.6992 9.7002 19.7998 13.7002 37.3994 13.7002
|
995 |
+
c13 0 19.6006 -2.90039 25.7998 -2.90039h0.200195c4.40039 0 7 2.2002 8.10059 5.90039c1.7998 6.09961 2.89941 14 4.2998 15.9004c26.7002 4.19922 41.2998 10.0996 44.7998 18.1992z" />
|
996 |
+
<glyph glyph-name="pied-piper" unicode=""
|
997 |
+
d="M32 29l-32 -60.2002l0.799805 328c0 65.9004 53.2002 119.2 119.2 119.2h327.2c-93 -28.9004 -189.9 -94.2002 -253.9 -168.6c-70.5996 -81.4004 -110.7 -137.4 -161.3 -218.4zM448 416c0 0 0 -328.8 0.0996094 -328.8c0 -65.9004 -53.2998 -119.2 -119.3 -119.2
|
998 |
+
h-328.399c18.5 25.5 61.6992 54 84.8994 66c35.5 18.0996 76.4004 28.5 105.3 56.2998c42.1006 40.5 47.8008 105 71 158.601c43.6006 100.3 186.4 167.1 186.4 167.1z" />
|
999 |
+
<glyph glyph-name="first-order" unicode=""
|
1000 |
+
d="M12.9004 218.8c0.0996094 0.100586 0.199219 0.299805 0.299805 0.400391c0 -0.100586 0 -0.299805 -0.100586 -0.400391h-0.199219zM224 351.4c7.40039 0 14.5996 -0.5 21.7002 -1.7002l-4 -67.7002l22.2998 64.2998c14.2998 -3.7998 27.7002 -9.5 40 -16.8994
|
1001 |
+
l-29.4004 -61.1006l45.1006 50.9004c11.5 -8.90039 21.7002 -19.2002 30.5996 -30.9004l-50.5996 -45.3994l60.8994 29.6992c7.5 -12.2998 12.9004 -26 16.6006 -40.2998l-64 -22.2998l67.7002 4c1.09961 -7.09961 1.39941 -14.5996 1.39941 -22
|
1002 |
+
s-0.299805 -14.5996 -1.39941 -21.7002l-67.4004 4l64 -22.2998c-3.7002 -14.5996 -9.5 -28 -16.5996 -40.2998l-61.1006 29.3994l50.6006 -45.0996c-8.60059 -11.7998 -18.9004 -22 -30.6006 -30.9004l-44.8994 50.9004l29.3994 -61.2998
|
1003 |
+
c-12.2998 -7.5 -25.7002 -12.9004 -40 -16.9004l-22.5996 65.1006l4 -68.6006c-7.10059 -1.09961 -14.2998 -1.7002 -21.7002 -1.7002c-7.09961 0 -14.5996 0.600586 -21.7002 1.7002l4 68l-22.2998 -64.5996c-14.2998 3.7998 -27.7002 9.5 -40 16.8994l29.5 61.4004
|
1004 |
+
l-44.9004 -50.9004c-11.7998 8.60059 -22 19.2002 -30.8994 30.9004l50.8994 45.0996l-61.0996 -29.6992c-7.2002 12.5996 -12.9004 26 -16.5996 40.2998l64 22.5996l-67.7002 -4c-0.799805 7.10059 -1.40039 14.2998 -1.40039 21.7002s0.5 14.9004 1.40039 22l68 -4
|
1005 |
+
l-64.2998 22.5996c3.69922 14.3008 9.5 27.7002 16.5996 40l61.0996 -29.6992l-50.5996 45.3994c8.90039 11.7998 19.2002 22 30.5996 30.9004l45.1006 -50.9004l-29.4004 61.4004c12.2998 7.2002 25.7002 12.8994 40 16.5996l22 -64l-3.7002 67.4004
|
1006 |
+
c6.80078 1.09961 14.3008 1.7002 21.4004 1.7002zM443.4 320v-256l-219.4 -128l-219.4 128v256l219.4 128zM426.3 309.7l-202.3 117.399l-202.3 -117.399v-235.101l202.3 -117.699l202.3 117.699v235.101zM224 410.9l187.7 -109.4v-218.9l-187.7 -109.5l-187.7 109.5
|
1007 |
+
v218.801zM224 360c-92.2998 0 -166.9 -75.0996 -166.9 -168c0 -92.5996 74.6006 -167.7 166.9 -167.7c92 0 166.9 75.1006 166.9 167.7c0 92.9004 -74.9004 168 -166.9 168z" />
|
1008 |
+
<glyph glyph-name="yoast" unicode=""
|
1009 |
+
d="M91.2998 372h186l-7 -18.9004h-179c-39.7002 0 -71.8994 -31.5996 -71.8994 -70.2998v-205.399c0 -35.4004 24.8994 -70.3008 84 -70.3008v-19.0996h-12.1006c-50.0996 0 -91.2998 40.2002 -91.2998 89.5v205.3c0 49.2998 40.7002 89.2002 91.2998 89.2002zM320.4 428
|
1010 |
+
h66.5c-143.801 -378.1 -145.7 -398.9 -184.7 -439.3c-20.7998 -21.6006 -49.2998 -31.7002 -78.2998 -32.7002v51.0996c49.1992 7.7002 64.5996 49.9004 64.5996 75.3008c0 20.0996 0.599609 12.5996 -82.0996 223.199h61.3994l50.4004 -156.6zM448 286.5v-298.5h-214
|
1011 |
+
c6.59961 9.59961 10.7002 16.2998 12.0996 19.4004h182.5v279.1c0 32.5 -17.0996 51.9004 -48.1992 62.9004l6.69922 17.5996c41.7002 -13.5996 60.9004 -43.0996 60.9004 -80.5z" />
|
1012 |
+
<glyph glyph-name="themeisle" unicode="" horiz-adv-x="512"
|
1013 |
+
d="M208 359.714c0 10 6.28613 21.7139 17.7148 21.7139c11.1426 0 17.7139 -11.7139 17.7139 -21.7139c0 -10.2852 -6.57129 -21.7139 -17.7139 -21.7139c-11.4287 0 -17.7148 11.4287 -17.7148 21.7139zM512 199.714c0 -36.001 -11.4287 -102.286 -36.2861 -129.714
|
1014 |
+
c-22.8574 -24.8584 -87.4277 -61.1426 -120.856 -70.5723l-1.14355 -0.286133v-32.5703c0 -16.2861 -12.5723 -30.5713 -29.1426 -30.5713c-10 0 -19.4297 5.71387 -24.5723 14.2861c-5.42676 -8.57227 -14.8564 -14.2861 -24.8564 -14.2861
|
1015 |
+
s-19.4287 5.71387 -24.8574 14.2861c-5.14258 -8.57227 -14.5713 -14.2861 -24.5703 -14.2861c-10.2861 0 -19.4287 5.71387 -24.8574 14.2861c-5.14355 -8.57227 -14.5713 -14.2861 -24.5713 -14.2861c-18.8574 0 -29.4287 15.7139 -29.4287 32.8574
|
1016 |
+
c-16.2861 -12.2852 -35.7158 -19.4287 -56.5713 -19.4287c-22 0 -43.4287 8.28516 -60.2861 22.8574c10.2852 0.286133 20.5713 2.28613 30.2852 5.71387c-20.8574 5.71387 -39.4277 18.8574 -52 36.2861c21.3701 -4.64551 46.209 -1.67285 67.1426 11.1426
|
1017 |
+
c-22 22 -56.5703 58.8574 -68.5713 87.4287c-5.71387 13.4287 -6.85645 31.4287 -6.85645 45.7139c0 49.7139 20.2861 160 86.2861 160c10.5713 0 18.8564 -4.8584 23.1426 -14.8574c3.0498 4.46289 8.42578 11.374 12 15.4277c2 2.57227 5.71387 5.42969 7.14355 8.28613
|
1018 |
+
c7.99902 12.5713 11.7139 21.1426 21.7139 34c32.2852 41.1445 81.7139 69.4297 134.856 69.4297c6 0 12 -0.285156 17.7148 -1.14355c10.8564 11.7148 26 18.2861 41.7148 18.2861c14.5703 0 29.7139 -6 40 -16.2861c0.856445 -0.857422 1.42773 -2.28613 1.42773 -3.42773
|
1019 |
+
c0 -3.71387 -10.2852 -13.4287 -12.8574 -16.2861c4.28613 -1.42871 15.7148 -6.8584 15.7148 -12c0 -2.85742 -2.85742 -5.14258 -4.57129 -7.14258c31.4287 -27.7148 49.4287 -67.1436 56.2861 -108c4.28613 5.14258 10.2852 8.57129 17.1426 8.57129
|
1020 |
+
c10.5713 0 20.8574 -7.14355 28.5713 -14.001c20.8564 -18.5703 25.7139 -53.1416 25.7139 -79.7139zM188 358.572c0 -18.2861 12.5713 -37.1436 32.2861 -37.1436c19.7139 0 32.2852 18.8574 32.2852 37.1436c0 18 -12.5713 36.8564 -32.2852 36.8564
|
1021 |
+
c-19.7148 0 -32.2861 -18.8574 -32.2861 -36.8564zM237.714 254c0 19.7139 3.71387 39.1426 8.57129 58.2861c-52.0391 -79.5342 -13.5312 -184.571 68.8574 -184.571c21.4287 0 42.5713 7.71387 60 20c2 7.42871 3.71484 14.8574 3.71484 22.5723
|
1022 |
+
c0 14.2861 -6.28613 21.4277 -20.5723 21.4277c-4.57129 0 -9.14355 -0.856445 -13.4287 -1.71387c-63.3438 -12.668 -107.143 -3.66895 -107.143 63.999zM196.572 -0.858398c0 11.1436 -8.8584 20.8574 -20.2861 20.8574c-11.4287 0 -20 -9.71484 -20 -20.8574v-32.5703
|
1023 |
+
c0 -11.1436 8.57129 -21.1426 20 -21.1426c11.4277 0 20.2861 9.71484 20.2861 21.1426v32.5703zM245.715 -0.858398c0 11.1436 -8.57227 20.8574 -20 20.8574c-11.4287 0 -20.2861 -9.71484 -20.2861 -20.8574v-32.5703c0 -11.1436 8.85742 -21.1426 20.2861 -21.1426
|
1024 |
+
c11.4277 0 20 10 20 21.1426v32.5703zM295.428 -0.858398c0 11.1436 -8.85645 20.8574 -20.2852 20.8574s-20.2852 -9.71484 -20.2852 -20.8574v-32.5703c0 -11.1436 8.85645 -21.1426 20.2852 -21.1426s20.2852 9.71484 20.2852 21.1426v32.5703zM345.143 -0.858398
|
1025 |
+
c0 11.1436 -8.85645 20.8574 -20.2852 20.8574s-20.2861 -9.71484 -20.2861 -20.8574v-32.5703c0 -11.1436 8.85742 -21.1426 20.2861 -21.1426s20.2852 10 20.2852 21.1426v32.5703zM421.714 162c-30.8564 -59.1416 -90.2852 -102.572 -158.571 -102.572
|
1026 |
+
c-96.5703 0 -160.57 84.5723 -160.57 176.572c0 16.8574 2 33.4287 6 49.7139c-20 -33.7148 -29.7139 -72.5723 -29.7139 -111.429c0 -60.2861 24.8564 -121.715 71.4287 -160.857c5.14258 9.71387 14.8564 16.2861 26 16.2861c10 0 19.4277 -5.71387 24.5713 -14.2861
|
1027 |
+
c5.42871 8.57129 14.5703 14.2861 24.8574 14.2861c10 0 19.4277 -5.71387 24.5713 -14.2861c5.42871 8.57129 14.8564 14.2861 24.8574 14.2861c10 0 19.4287 -5.71387 24.8574 -14.2861c5.14258 8.57129 14.5713 14.2861 24.5723 14.2861
|
1028 |
+
c10.8564 0 20.8564 -6.57227 25.7139 -16c43.4268 36.2861 68.5693 92 71.4258 148.286zM432.286 261.714c0 53.7139 -34.5713 105.714 -92.5723 105.714c-30.2852 0 -58.5713 -15.1426 -78.8564 -36.8564c-19.9951 -66.3828 -27.4473 -136.571 41.4287 -136.571
|
1029 |
+
c28.8047 0 97.3564 28.5381 84.2861 -36.8574c28.8564 26 45.7139 65.7148 45.7139 104.571z" />
|
1030 |
+
<glyph glyph-name="google-plus" unicode="" horiz-adv-x="496"
|
1031 |
+
d="M248 440c136.9 0 248 -111.1 248 -248s-111.1 -248 -248 -248s-248 111.1 -248 248s111.1 248 248 248zM177.3 68c71.2998 0 118.8 50.4004 118.8 121.2c0 7.09961 -0.599609 13.8994 -1.89941 20.7002h-116.9v-42.6006h70.1006
|
1032 |
+
c-5.2002 -34.2002 -37.5 -53.2998 -70.1006 -53.2998c-43 0 -77.2002 35.5 -77.2002 78.0996c0 42.6006 34.3008 78.1006 77.2002 78.1006c18.1006 0 36.2002 -6.2002 49.4004 -19.1006l33.5996 32.6006c-22.8994 21.2998 -51.7002 32.2998 -83 32.2998
|
1033 |
+
c-68.7998 0 -124 -55.5 -124 -124s55.2002 -124 124 -124zM407.5 174.2h35.2002v35.5h-35.2002v35.5h-35.5v-35.5h-35.5v-35.5h35.5v-35.5h35.5v35.5z" />
|
1034 |
+
<glyph glyph-name="font-awesome" unicode=""
|
1035 |
+
d="M397.8 416c27.5 0 50.2002 -22.7002 50.2002 -50.2002v-347.6c0 -27.5 -22.7002 -50.2002 -50.2002 -50.2002h-347.6c-27.5 0 -50.2002 22.7002 -50.2002 50.2002v347.6c0 27.5 22.7002 50.2002 50.2002 50.2002h347.6zM352.4 131.7h0.0996094v140.3
|
1036 |
+
c0 4.2002 -4.2002 7.7998 -9 7.7998c-6 0 -31.0996 -16.0996 -53.7998 -16.0996c-4.7002 0 -8.90039 0.599609 -13.1006 2.39941c-20.2998 7.7002 -38.1992 13.7002 -60.8994 13.7002c-20.9004 0 -43 -6.5 -61.5 -14.2998
|
1037 |
+
c-1.7998 -1.2002 -3.60059 -1.7998 -5.40039 -2.40039v18.5c8.2998 6 13.1006 15.5 13.1006 26.3008c0 18.5996 -15 33.5 -33.5 33.5c-18.6006 0 -33.5 -15 -33.5 -33.5c0 -10.8008 5.2998 -20.3008 13.0996 -26.3008v-218.6c0 -11.2998 9 -20.2998 20.2998 -20.2998
|
1038 |
+
c8.90039 0 16.7002 5.89941 19.1006 14.2998v1.2002c0.599609 1.2002 0.599609 3 0.599609 4.7998v45.4004c1.2002 0.599609 2.40039 0.599609 3.59961 1.19922c19.7002 8.90039 44.2002 17.3008 67.5 17.3008c32.3008 0 44.8008 -16.7002 71.7002 -16.7002
|
1039 |
+
c19.2002 0 37.1006 6.5 53.7998 13.7002c4.2002 1.7998 7.80078 3.59961 7.80078 7.7998z" />
|
1040 |
+
<glyph glyph-name="linode" unicode=""
|
1041 |
+
d="M437.4 221.7c0.599609 -2 -8.80078 -66.2998 -9.7002 -72.7998c0 -0.900391 -0.5 -1.7002 -1.10059 -2l-54.5996 -43.7002c-1.09961 -0.900391 -2.59961 -0.900391 -3.7002 0l-20.2998 14l-2.2998 -33.4004c0 -0.899414 -0.200195 -1.7002 -1.10059 -2.2998
|
1042 |
+
l-66.8994 -53.4004c-1.10059 -0.899414 -2.90039 -0.899414 -4 0l-28 23.7002l2 -46c0 -0.899414 -0.200195 -1.7002 -1.10059 -2.2998l-83.6992 -66.9004c-0.600586 -0.299805 -1.10059 -0.599609 -1.7002 -0.599609c-0.900391 0.299805 -1.7002 0.299805 -2.2998 0.900391
|
1043 |
+
l-65.1006 69.0996c-1.5 1.40039 -15.5 72 -16.8994 79.0996c-0.300781 1.10059 0.5 2.5 1.39941 3.10059l17.4004 10.5996c-3.40039 3.2002 -26.5 23.4004 -27.1006 26.2998l-20.5996 100.301c-0.299805 1.09961 0.299805 2.5 1.7002 3.39941l26.8994 12.9004
|
1044 |
+
c-4.59961 3.5 -37.6992 27.5 -38.5996 30.8994l-27.4004 133.101c-0.299805 1.7002 0.600586 3.09961 2 3.7002l123.7 38.5996c0.600586 0 1.40039 0 2.2998 -0.299805l90.6006 -43.7002c0.799805 -0.599609 1.7002 -1.7002 1.7002 -2.59961l5.69922 -132.301
|
1045 |
+
c0 -1.19922 -0.599609 -2.2998 -1.69922 -2.89941l-33.7002 -17.4004l36 -24.2998c0.799805 -0.299805 1.39941 -1.40039 1.39941 -2.2998l1.40039 -35.1006l34.5996 21.2002c0.800781 0.600586 2.2002 0.600586 3.10059 0l24 -16l0.899414 31.4004
|
1046 |
+
c0 0.899414 0.5 2 1.40039 2.59961l58.9004 36c1.09961 0.600586 2.19922 0.600586 3.09961 0l70 -38.5996c0.5 -0.600586 1.09961 -1.10059 1.40039 -2zM232.6 216.9l-100.6 -57.2002l14 -96.6006l90.5996 61.2002zM224.9 396.9l-120.9 -46.6006l19.7002 -134.8
|
1047 |
+
l106.6 55.4004zM44 274.9l73.0996 -57.2002l-19.3994 132.899l-79.7002 49.4004zM74.5996 127.1l64.8008 -60.7998l-13.7002 93.4004l-70 58.2998zM98.9004 9.40039l57.6992 -61.2002l-9.69922 67.3994l-61.7002 60.9004zM163.4 -55.0996l78.1992 62.2998l-3.09961 70
|
1048 |
+
l-85.7002 -61.4004zM245.4 60l27.0996 -22.9004l-0.599609 68.3008l-29.4004 22.5996c0 -2.2998 1.2002 -6.2998 -1.09961 -8l-22.3008 -14.9004l24.3008 -20c2.89941 -2.19922 2 -21.6992 2 -25.0996zM339.7 85.4004l4.2002 66.8994l-65.7002 -46.8994l0.599609 -68.6006z
|
1049 |
+
M367.4 111.1l5.7998 66.6006l-64.6006 40.5996l-0.599609 -30l41.2002 -27.2002c0.799805 -0.599609 1.39941 -1.69922 1.09961 -2.59961l-2 -34zM422 150.9l8.5 63.3994l-51.0996 -36.5996l-5.7002 -65.1006z" />
|
1050 |
+
<glyph glyph-name="quora" unicode=""
|
1051 |
+
d="M440.5 61.2998c1.7998 -18 -7.2002 -93.2998 -89 -93.2998c-49.5 0 -75.5 28.7002 -95.2002 62.2998c-117.7 -32.5996 -249 54.9004 -249 189c0 117 98 196.7 197.7 196.7c101.8 0 198.5 -79.2002 198.4 -196.7c0 -65.5 -30.5 -118.8 -74.7002 -153
|
1052 |
+
c14.2002 -21.5996 29 -35.7998 49.5 -35.7998c22.5 0 31.5 17.2998 33 30.7998h29.2998zM297 118.8c11.2998 24.9004 16.7998 58.7002 16.7002 100.5c0 104.2 -32.5 157.7 -108.7 157.7c-75 0 -107.5 -53.5 -107.5 -157.9c0 -103.699 32.5 -156.699 107.5 -156.699
|
1053 |
+
c12 0 22.7002 1.19922 32.7002 4.19922c-15.5 30.5 -33.7002 61.3008 -69.2002 61.3008c-6.7998 0 -13.5996 -1 -19.7998 -4l-12.2002 24.2998c14.7002 12.7998 38.5 22.7998 69 22.7998c47.7998 0 72 -23 91.5 -52.2002z" />
|
1054 |
+
<glyph glyph-name="free-code-camp" unicode="" horiz-adv-x="576"
|
1055 |
+
d="M69.2998 303.5c-41 -68.5 -36.3994 -163 1 -227c22.2002 -38.2002 49.7002 -52.4004 49.7002 -66.5c0 -6.7998 -6 -13 -12.7998 -13c-19.5 0 -99.2002 75.5 -99.2002 197.8c0 111.5 78 186 97.0996 186c6 0 14.9004 -4.7998 14.9004 -11.0996
|
1056 |
+
c0 -12.7002 -28.2998 -28.6006 -50.7002 -66.2002zM265.1 89.7002c-37.1992 13.5996 -65.5 45.8994 -65.2998 86.2002c0 48 57.7002 90.0996 57.7002 136.199c0 16.8008 -10.4004 32.6006 -19.5996 38.2002c-1.90039 1 -4.60059 2.7002 -4.60059 5.10059
|
1057 |
+
c0 9.59961 26.1006 2.7998 36.5 -2.2002c33.6006 -15.9004 40.6006 -40.2998 46.4004 -74.1006c1.39941 -7.89941 4.2998 -33.2998 15.8994 -33.2998c7.5 0 12.3008 5.10059 12.3008 12.2998c0 12.6006 -15.4004 31.2002 -7.2002 31.2002
|
1058 |
+
c6.09961 0 18.5996 -12.7998 22.5 -16.8994c23.3994 -24.9004 32.0996 -49 32.0996 -82.6006c0 -42.2002 -23.3994 -74.7002 -53.0996 -89.7998c-9.2002 -5.7998 -12.1006 0.900391 -12.1006 1.90039c0 7 29.5 23.5996 29.5 56c0 10.5996 -2.69922 22.5 -8.5 31.3994
|
1059 |
+
c-1.69922 2.40039 -7.69922 10.1006 -11.0996 10.1006c-0.700195 0 -0.700195 -0.5 -0.700195 -1.2002c0 -5.7998 3.60059 -11.4004 3.60059 -17.4004c0 -13 -31.9004 -20.2002 -31.9004 6.7998c0 7.10059 0.700195 14.3008 0.700195 21.3008
|
1060 |
+
c0 5.09961 -0.200195 6.5 -2.40039 11.0996c-3.39941 6.5 -14.5 19.7998 -22.5 19.7998c-2.2002 0 -2.89941 0 -2.89941 -2.2002c0 -3.39941 7.69922 -7 7.69922 -19.2998c0 -32.0996 -44.1992 -37.8994 -44.1992 -70c0 -14.3994 1.89941 -26.5 10.0996 -38.5996
|
1061 |
+
c5.09961 -7.5 10.5996 -11.7998 19.0996 -15.2002c2.10059 -0.700195 4.30078 -0.900391 4.30078 -3.59961c0 -6.40039 -7.80078 -3 -12.3008 -1.2002zM470.4 381c21.3994 0 97.5996 -78.9004 97.5 -198.2c0 -104.899 -73.4004 -185.7 -98.8008 -185.7
|
1062 |
+
c-5 0 -13.1992 6.30078 -13.1992 11.4004c0 8.2002 28.2998 34.5996 35.2998 43.5c61 76.7002 64 205.9 -17.6006 291c-5.5 5.7998 -17.5996 16.7002 -17.5996 25.4004c0 6.09961 8.40039 12.5996 14.4004 12.5996zM428.1 57.9004c8.40039 0 11.9004 -7 11.9004 -15.5
|
1063 |
+
c0 -8.90039 -2.5 -16.4004 -11.9004 -16.4004h-261.1c-8.5 0 -15.5 7 -15.5 15.5c0 8.90039 6.09961 16.4004 15.5 16.4004h261.1z" />
|
1064 |
+
<glyph glyph-name="telegram" unicode="" horiz-adv-x="496"
|
1065 |
+
d="M248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM369.8 270.1c3.60059 16.8008 -6.09961 23.5 -17.2002 19.5l-239.1 -92.1992c-16.4004 -6.40039 -16.0996 -15.5 -2.7998 -19.7002l61.2002 -19.1006l142 89.4004
|
1066 |
+
c6.59961 4.40039 12.6992 1.90039 7.69922 -2.5l-114.899 -103.8l-4.40039 -63.1006c6.40039 0 9.2002 2.80078 12.5 6.10059l29.9004 28.7998l62 -45.7002c11.2998 -6.39941 19.3994 -3.09961 22.3994 10.5z" />
|
1067 |
+
<glyph glyph-name="bandcamp" unicode="" horiz-adv-x="496"
|
1068 |
+
d="M248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM296.2 113.9l84.7002 156.1h-181l-84.7002 -156.1h181z" />
|
1069 |
+
<glyph glyph-name="grav" unicode="" horiz-adv-x="512"
|
1070 |
+
d="M301.1 236c4.40039 -4.40039 4.40039 -11.9004 0 -16.2998l-9.69922 -9.7002c-4.40039 -4.7002 -11.9004 -4.7002 -16.6006 0l-10.5 10.5c-4.39941 4.7002 -4.39941 11.9004 0 16.5996l9.7002 9.7002c4.40039 4.40039 11.9004 4.40039 16.5996 0zM270.9 255.7
|
1071 |
+
c-2.7002 -2.7998 -7.40039 -2.7998 -10.5 0c-2.80078 3 -2.80078 7.7002 0 10.5c3 3 7.69922 3 10.5 0c3 -2.7002 3 -7.5 0 -10.5zM244.9 250.4c2.7998 3 7.5 3 10.5 0c2.7998 -2.7002 2.7998 -7.40039 0 -10.2002c-3 -3 -7.7002 -3 -10.5 0c-3 2.7002 -3 7.39941 0 10.2002
|
1072 |
+
zM317.4 263.7c-19.9004 14.3994 -33.8008 43.2002 -11.9004 68.0996c21.5996 24.9004 40.7002 17.2002 59.7998 -0.799805c11.9004 -11.2998 29.2998 -24.9004 17.2002 -48.2002c-12.5 -23.5 -45.0996 -33.2002 -65.0996 -19.0996zM365.1 308.2
|
1073 |
+
c-8.89941 10 -23.2998 -6.90039 -15.5 -16.1006c7.40039 -9 32.1006 -2.39941 15.5 16.1006zM504 192c0 -137 -111 -248 -248 -248s-248 111 -248 248s111 248 248 248s248 -111 248 -248zM437.8 149.4c2.5 16.0996 -20.2002 16.5996 -25.2002 25.6992
|
1074 |
+
c-13.5996 24.1006 -27.6992 36.8008 -54.5 30.4004c11.6006 8 23.5 6.09961 23.5 6.09961c0.300781 6.40039 0 13 -9.39941 24.9004c3.89941 12.5 0.299805 22.4004 0.299805 22.4004c15.5 8.59961 26.7998 24.3994 29.0996 43.1992
|
1075 |
+
c3.60059 31 -18.7998 59.2002 -49.7998 62.8008c-22.0996 2.5 -43.7002 -7.7002 -54.2998 -25.7002c-23.2002 -40.1006 1.40039 -70.9004 22.4004 -81.4004c-14.4004 1.40039 -34.3008 11.9004 -40.1006 34.2998c-6.59961 25.7002 2.7998 49.8008 8.90039 61.4004
|
1076 |
+
c0 0 -4.40039 5.7998 -8 8.90039c0 0 -13.7998 0 -24.6006 -5.30078c11.9004 15.2002 25.2002 14.4004 25.2002 14.4004c0 6.40039 -0.599609 14.9004 -3.59961 21.5996c-5.40039 11 -23.7998 12.9004 -31.7002 -2.7998c0.0996094 0.200195 0.299805 0.400391 0.400391 0.5
|
1077 |
+
c-5 -11.8994 -1.10059 -55.8994 16.8994 -87.2002c-2.5 -1.39941 -9.09961 -6.09961 -13 -10c-21.5996 -9.69922 -56.2002 -60.2998 -56.2002 -60.2998c-28.1992 -10.7998 -77.1992 -50.8994 -70.5996 -79.7002c0.299805 -3 1.40039 -5.5 3 -7.5
|
1078 |
+
c-2.7998 -2.19922 -5.5 -5 -8.2998 -8.2998c-11.9004 -13.7998 -5.2998 -35.2002 17.7002 -24.3994c15.7998 7.19922 29.5996 20.1992 36.2998 30.3994c0 0 -5.5 5 -16.2998 4.40039c27.6992 6.59961 34.2998 9.39941 46.1992 9.09961c8 -3.89941 8 34.2998 8 34.2998
|
1079 |
+
c0 14.7002 -2.19922 31 -11.0996 41.5c12.5 -12.1992 29.0996 -32.6992 28 -60.5996c-0.799805 -18.2998 -15.2002 -23 -15.2002 -23c-9.09961 -16.5996 -43.2002 -65.9004 -30.3994 -106c0 0 -9.7002 14.9004 -10.2002 22.0996
|
1080 |
+
c-17.4004 -19.3994 -46.5 -52.2998 -24.6006 -64.5c26.6006 -14.6992 108.801 88.6006 126.2 142.301c34.6006 20.7998 55.4004 47.2998 63.9004 65c22 -43.5 95.2998 -94.5 101.1 -59z" />
|
1081 |
+
<glyph glyph-name="etsy" unicode="" horiz-adv-x="384"
|
1082 |
+
d="M384 100c-1.75 -10.75 -13.75 -110 -15.5 -132c-117.879 4.29883 -219.895 4.74316 -368.5 0v25.5c45.457 8.94824 60.627 8.01855 61 35.25c1.79297 72.3223 3.52441 244.143 0 322c-1.0293 28.46 -12.1299 26.7646 -61 36v25.5
|
1083 |
+
c73.8857 -2.3584 255.933 -8.55078 362.999 3.75c-3.5 -38.25 -7.75 -126.5 -7.75 -126.5h-23.249c-11.0527 42.835 -18.7588 90.5 -54.75 90.5h-137c-10.25 0 -10.75 -3.5 -10.75 -9.75v-163.75c58 -0.5 88.5 2.5 88.5 2.5c29.7695 0.951172 27.5596 8.50195 40.75 65.251
|
1084 |
+
h25.75c-4.40723 -101.351 -3.91016 -61.8291 -1.75 -160.25h-25.75c-9.15527 40.0859 -9.06543 61.0449 -39.501 61.5c0 0 -21.5 2 -88 2v-139c0 -26 14.25 -38.25 44.25 -38.25h89.251c63.6357 0 66.5645 24.9961 98.751 99.75h22.249v-0.000976562z" />
|
1085 |
+
<glyph glyph-name="imdb" unicode=""
|
1086 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM21.2998 218.8h-0.299805c0.0996094 0.100586 0.200195 0.299805 0.299805 0.400391v-0.400391zM97 128.2v127.8h-33v-127.8h33z
|
1087 |
+
M210.2 128.2v127.8h-43l-7.60059 -59.9004c-2.69922 20 -5.39941 40.1006 -8.69922 59.9004h-42.8008v-127.8h29v84.5l12.2002 -84.5h20.6006l11.5996 86.3994v-86.3994h28.7002zM221.6 128.2c86.1006 -0.100586 75 -6 75 82.5c0 8.09961 0.300781 16.7998 -1.39941 24.3994
|
1088 |
+
c-4.2998 22.5 -31.4004 20.9004 -49 20.9004h-24.6006v-127.8zM382.5 157.4v36c0 17.2998 -0.799805 30.0996 -22.2002 30.0996c-8.89941 0 -14.8994 -2.7002 -20.8994 -9.2002v41.7002h-31.7002v-127.8h29.7998l1.90039 8.09961
|
1089 |
+
c5.69922 -6.7998 11.8994 -9.7998 20.8994 -9.7998c19.7998 0 22.2002 15.2002 22.2002 30.9004zM265 218.1v-49.2998c0 -9.7002 1.90039 -18.7002 -10.2998 -18.3994v83.6992c11.8994 0 10.2998 -6.2998 10.2998 -16zM350.5 192v-32.7002
|
1090 |
+
c0 -5.39941 1.59961 -14.3994 -6.2002 -14.3994c-1.59961 0 -3 0.799805 -3.7998 2.39941c-2.2002 5.10059 -1.09961 44.1006 -1.09961 44.7002c0 3.7998 -1.10059 12.7002 4.89941 12.7002c7.2998 0 6.2002 -7.2998 6.2002 -12.7002z" />
|
1091 |
+
<glyph glyph-name="ravelry" unicode="" horiz-adv-x="512"
|
1092 |
+
d="M407.4 386.5c72.6992 -37.9004 112 -117.2 103.3 -199.5c-1.7002 -16.7002 -4.40039 -36.2002 -9.7998 -52.2002c-22.2002 -65.7002 -52.9004 -108.6 -123.101 -147.7c-6.39941 -4.39941 -13.2998 -8.59961 -20.2002 -10.7998
|
1093 |
+
c-12.5 -4.39941 -26.0996 -5.39941 -40.0996 -3.89941c-5.90039 -0.5 -11.7998 -0.700195 -18 -0.700195c-93.7002 0 -173 64 -196.9 151.399c-0.699219 0 -1.5 0.200195 -2.19922 0.200195c-5.60059 -44.2998 27.0996 -104.1 27.0996 -104.1s2 -3 13.2998 -20.2002
|
1094 |
+
c-62.7998 33.2002 -64.5 131.2 -64.5 131.2c-15 5.59961 -67.2002 23.3994 -76.2998 37.8994c0 0 40.9004 -22.3994 76.2002 -27c-0.200195 0.300781 0.5 7.90039 0.5 7.90039c2.2002 30 12.5 53.4004 23.0996 71.4004c6.90039 33.7998 22.1006 64.2998 43.2998 89.8994
|
1095 |
+
c3.7002 15.2998 9.60059 33.5 19.9004 52.7002c4.40039 8.40039 8.59961 13.7998 19.9004 19c74.8994 35 148.699 43.9004 224.5 4.5zM138.8 284.8c-7.59961 -11.2998 -13.7002 -23.5996 -18.8994 -36.3994c8.09961 8.59961 14.7998 14.1992 18.1992 16.6992
|
1096 |
+
c-0.5 7.40039 0.700195 19.7002 0.700195 19.7002zM107.6 162.9c0.700195 -9.60059 2 -18.9004 4.2002 -28.1006l41.4004 -6.89941c-14.1006 42.0996 -15.7998 90.0996 -15.7998 90.0996c-16.5 -16 -25.4004 -37.9004 -29.8008 -55.0996zM115.5 120.1
|
1097 |
+
c21.4004 -69.6992 81 -122.8 154.1 -134.399c-1 0.299805 -1.69922 0.5 -2.69922 1c0 0 -81 47.5 -108.301 124.3c-9.09961 1.5 -28.2998 5.90039 -43.0996 9.09961zM386 3.90039c63 32 106.6 98 106.8 174c0 107.399 -86.5996 194.5 -193 194.5
|
1098 |
+
c-49.2998 0 -94.0996 -18.7002 -128.3 -49.5c-5.2002 -10.1006 -8.59961 -22.9004 -11.0996 -39.4004c52.5 44.5996 146 33.5 146 33.5c23.3994 -1 20.5996 -21.7002 20.3994 -28.0996c-85.2002 7.19922 -127 -17.2002 -168.399 -52.4004
|
1099 |
+
c0 0 8.09961 -78.7998 26.7998 -110.8c107.8 -4.90039 189.8 53.7002 189.8 53.7002c10.2998 7.39941 19.4004 8.09961 21.4004 -4.7002c1.5 -10.4004 2.19922 -24.4004 -9.60059 -29.7998c-36 -16.8008 -75.5996 -27.3008 -115 -33
|
1100 |
+
c-25.5996 -3.7002 -39.7998 -4.60059 -78 -3.90039c36.4004 -84.7002 127.5 -107.8 127.5 -107.8c28.5 -4.7002 50.2002 -1 64.7002 3.7002z" />
|
1101 |
+
<glyph glyph-name="sellcast" unicode=""
|
1102 |
+
d="M353.4 416c52.0996 0 94.6992 -42.5996 94.6992 -94.5996v-258.801c0 -52 -42.5996 -94.5996 -94.6992 -94.5996h-258.7c-52.1006 0 -94.7002 42.5996 -94.7002 94.7002v258.7c0 52 42.5996 94.5996 94.7002 94.5996h258.7zM303.4 99.5996
|
1103 |
+
c27.8994 48.2002 11.1992 110.5 -37.2002 138.5c-18.6006 10.8008 0.0996094 -0.0996094 -18.5 10.7002c-25 14.4004 -46.2002 -23.2998 -21.6006 -37.5c18 -10.2002 0.800781 -0.399414 18.6006 -10.5996c27.5996 -16 37.2002 -51.7998 21.2998 -79.4004
|
1104 |
+
c-16 -27.5996 -51.7998 -37.2002 -79.4004 -21.2998c-18.5996 10.7998 0.100586 -0.0996094 -18.5 10.7002c-10.2998 6 -23.5996 2.39941 -29.5 -7.90039l-15.6992 -27.2002c-12.6006 -21.7998 19.3994 -53 42.2998 -13.1992c48.2998 -27.7002 110.3 -11 138.2 37.1992z
|
1105 |
+
M325.2 308.4c14.2998 24.7998 -23.4004 46.3994 -37.7002 21.5l-4.7998 -8.40039c-48.2998 27.7002 -110.3 11 -138.2 -37.2002c-27.7998 -48.2998 -11.0996 -110.6 37.0996 -138.399c18.6006 -10.8008 -0.0996094 0.0996094 18.5 -10.7002
|
1106 |
+
c25 -14.4004 46.2002 23.2998 21.6006 37.5c-0.100586 0 -18.6006 10.5996 -18.6006 10.5996c-27.5996 16 -37.2998 51.7998 -21.2998 79.4004c16 27.5996 51.7998 37.2002 79.4004 21.2998c18.5996 -10.7998 -0.100586 0.0996094 18.5 -10.7002
|
1107 |
+
c10.2002 -5.09961 20 -2.89941 26.5 3.60059c2.7002 2.69922 2 2 19 31.5z" />
|
1108 |
+
<glyph glyph-name="superpowers" unicode=""
|
1109 |
+
d="M448 416l-87.2002 -87c39.7002 -38.7002 61.2002 -92.7002 57.7002 -148.2c-5.40039 -93 -76.9004 -167.3 -168.7 -179.8c-83.2998 -11 -166.5 -22 -249.8 -33l86.7998 86.7998c-39.7998 38.7002 -61.0996 92.7002 -57.7998 148.2c5.7002 93.2998 77 167.5 169 180
|
1110 |
+
c83.2002 11 166.7 22 250 33zM368.3 183.7c4.40039 80 -56.7998 146.3 -136.1 151c-78.7002 4.7998 -148.5 -55.2998 -153 -134.5c-4.40039 -80 56.7998 -146.3 136.3 -151c78.7998 -4.7002 148.6 55 152.8 134.5z" />
|
1111 |
+
<glyph glyph-name="wpexplorer" unicode="" horiz-adv-x="512"
|
1112 |
+
d="M512 192c0 -141.2 -114.7 -256 -256 -256c-141.2 0 -256 114.7 -256 256s114.7 256 256 256s256 -114.7 256 -256zM480 192c0 123.2 -100.3 224 -224 224c-123.5 0 -224 -100.5 -224 -224s100.5 -224 224 -224s224 100.5 224 224zM160.9 323.4l86.8994 -37.1006
|
1113 |
+
l-37.0996 -86.8994l-86.9004 37.0996zM270.9 154.3l46.5996 -94h-14.5996l-50 100l-48.9004 -100h-14l51.0996 106.9l-22.2998 9.39941l6 14l68.6006 -29.0996l-6 -14.2998zM259.1 270.6l68.6006 -29.3994l-29.4004 -68.2998l-68.2998 29.0996zM339.4 227.7
|
1114 |
+
l54.5996 -23.1006l-23.4004 -54.2998l-54.2998 23.1006z" />
|
1115 |
+
<glyph glyph-name="meetup" unicode="" horiz-adv-x="512"
|
1116 |
+
d="M99 33.7002c1.09961 -5.7002 -2.2998 -11.1006 -8 -12.2998c-5.40039 -1.10059 -10.9004 2.2998 -12 8c-1.09961 5.39941 2.2998 11.0996 7.7002 12.2998c5.39941 1.2002 11.0996 -2.2998 12.2998 -8zM242.1 -37.7002c6.60059 4.60059 15.5 2.7998 19.7002 -3.7002
|
1117 |
+
c4.60059 -6.59961 2.90039 -15.3994 -3.39941 -20c-6.60059 -4.59961 -15.4004 -2.89941 -20 3.7002c-4.30078 6.60059 -2.60059 15.4004 3.69922 20zM156.1 424.6c-6.2998 -1.5 -12.5 2.5 -13.8994 9.10059c-1.2002 6.2998 2.7998 12.5996 9.09961 14
|
1118 |
+
c6.2998 1.5 12.6006 -2.5 13.7002 -9.10059c1.40039 -6.2998 -2.59961 -12.5996 -8.90039 -14zM34.4004 221.7c10 -7.10059 12.5996 -20.7998 5.69922 -31.2002c-6.89941 -10.2998 -20.5996 -12.7998 -30.5996 -5.7002c-10 6.90039 -12.5996 20.9004 -5.7002 30.9004
|
1119 |
+
c6.90039 10.2998 20.6006 12.8994 30.6006 6zM306.4 392.6c-10.3008 -6.2998 -23.7002 -2.89941 -29.7002 7.40039c-6.2998 10.5996 -2.90039 24.2998 7.39941 30.5996c10.3008 6.30078 23.7002 2.90039 30 -7.69922c6 -10.3008 2.90039 -24 -7.69922 -30.3008zM115.3 334.6
|
1120 |
+
c-7.5 -5.19922 -18 -3.5 -23.0996 4.30078c-5.10059 7.69922 -3.40039 18.2998 4.2998 23.6992c7.40039 5.10059 18 3.40039 23.0996 -4.2998c5.10059 -7.7002 3.40039 -18.2998 -4.2998 -23.7002zM487.6 178.6c7.40039 1.40039 14.8008 -3.5 16.3008 -10.8994
|
1121 |
+
c1.69922 -7.7002 -3.2002 -15.2002 -10.6006 -16.6006c-7.39941 -1.69922 -14.8994 3.2002 -16.2998 10.6006c-1.7002 7.7998 3.2002 15.2002 10.5996 16.8994zM527.3 235.4c1.40039 -5.7002 -2.2998 -11.1006 -7.7002 -12.6006
|
1122 |
+
c-5.69922 -1.09961 -11.1992 2.60059 -12.2998 8c-1.09961 5.7002 2.2998 11.5 8 12.6006c5.40039 1.09961 10.9004 -2.30078 12 -8zM447 309.1c8.2998 6 20 3.80078 25.7002 -4.89941c5.7002 -8.60059 3.7002 -20.2998 -4.60059 -26.2998
|
1123 |
+
c-8.59961 -5.7002 -20.2998 -3.7002 -26 4.89941c-5.69922 8.60059 -3.69922 20.2998 4.90039 26.2998zM440.7 169.7c26.2998 -43.1006 15.0996 -100 -26.2998 -129.101c-17.4004 -12.2998 -37.1006 -17.6992 -56.9004 -17.0996
|
1124 |
+
c-12 -47.0996 -69.4004 -64.5996 -105.1 -32.5996c-1.10059 -0.900391 -2.60059 -1.7002 -3.7002 -2.90039c-39.1006 -27.0996 -92.2998 -17.4004 -119.4 22.2998c-9.7002 14.2998 -14.5996 30.6006 -15.0996 46.9004c-65.4004 10.8994 -90 94 -41.1006 139.7
|
1125 |
+
c-28.2998 46.8994 0.600586 107.399 53.4004 114.899c25.0996 66.2002 107.6 97.6006 163.6 54.2002c67.4004 22.2998 136.301 -29.4004 130.9 -101.1c41.0996 -12.6006 52.7998 -66.9004 19.7002 -95.2002zM370.7 95.4004
|
1126 |
+
c-3.10059 20.5996 -40.9004 4.59961 -43.1006 27.0996c-3.09961 32 43.7002 101.1 40 128c-3.39941 24 -19.3994 29.0996 -33.3994 29.4004c-13.4004 0.299805 -16.9004 -2 -21.4004 -4.60059c-2.89941 -1.7002 -6.59961 -4.89941 -11.7002 0.299805
|
1127 |
+
c-6.2998 6 -11.0996 11.7002 -19.3994 12.9004c-12.2998 2 -17.7002 -2 -26.6006 -9.7002c-3.39941 -2.89941 -12 -12.8994 -20 -9.09961c-3.39941 1.7002 -15.3994 7.7002 -24 11.3994c-16.2998 7.10059 -40 -4.59961 -48.5996 -20
|
1128 |
+
c-12.9004 -22.8994 -38 -113.1 -41.7002 -125.1c-8.59961 -26.5996 10.9004 -48.5996 36.9004 -47.0996c11.0996 0.599609 18.2998 4.59961 25.3994 17.3994c4 7.40039 41.7002 107.7 44.6006 112.601c2 3.39941 8.89941 8 14.5996 5.09961
|
1129 |
+
c5.7002 -3.09961 6.90039 -9.40039 6 -15.0996c-1.09961 -9.7002 -28 -70.9004 -28.8994 -77.7002c-3.40039 -22.9004 26.8994 -26.6006 38.5996 -4c3.7002 7.09961 45.7002 92.5996 49.4004 98.2998c4.2998 6.2998 7.39941 8.2998 11.6992 8
|
1130 |
+
c3.10059 0 8.30078 -0.900391 7.10059 -10.9004c-1.40039 -9.39941 -35.1006 -72.2998 -38.9004 -87.6992c-4.59961 -20.6006 6.60059 -41.4004 24.9004 -50.6006c11.3994 -5.7002 62.5 -15.7002 58.5 11.1006zM376.4 3.09961c10.5996 7.5 24.8994 4.60059 32.2998 -6
|
1131 |
+
c7.09961 -10.5996 4.59961 -25.1992 -6 -32.5996c-10.6006 -7.09961 -24.9004 -4.59961 -32 6c-7.2002 10.5996 -4.60059 25.2002 5.7002 32.5996z" />
|
1132 |
+
<glyph glyph-name="font-awesome-alt" unicode=""
|
1133 |
+
d="M339.3 276.8c5.40039 0 9.5 -3 7.7002 -7.09961v-134.4c0 -4.2002 -3 -6 -7.2002 -7.7998c-15.5996 -7.09961 -33.5 -13.7002 -52 -13.7002c-26.2998 0 -38.2002 16.1006 -69.2998 16.1006c-22.7002 0 -46 -8.30078 -65.7002 -16.7002
|
1134 |
+
c-0.599609 -0.600586 -1.7998 -1.2002 -3 -1.2002v-44.2002c0 -1.7998 0 -3 -0.599609 -4.7998v-1.2998c-2.40039 -7.7002 -9.5 -13.7002 -18.5 -13.7002c-10.7002 0 -19.7002 8.90039 -19.7002 19.7002v212.1c-7.7002 6 -12.5 15.5 -12.5 25.7002
|
1135 |
+
c0 18 14.2998 32.2998 32.2998 32.2998s32.2998 -14.3994 32.2998 -32.2998c0 -10.7998 -4.69922 -19.7002 -12.5 -25.7002v-17.8994c1.2002 0.599609 3 1.19922 4.80078 1.7998c17.8994 7.09961 39.3994 13.7002 59.6992 13.7002
|
1136 |
+
c22.1006 0 39.4004 -5.90039 59.1006 -13.7002c4.09961 -1.7998 8.2998 -2.40039 12.5 -2.40039c22.7002 0 46.5996 15.5 52.5996 15.5zM397.8 416c27.5 0 50.2002 -22.7002 50.2002 -50.2002v-347.6c0 -27.5 -22.7002 -50.2002 -50.2002 -50.2002h-347.6
|
1137 |
+
c-27.5 0 -50.2002 22.7002 -50.2002 50.2002v347.6c0 27.5 22.7002 50.2002 50.2002 50.2002h347.6zM412.1 18.2998v347.601c0 7.69922 -6.5 14.2998 -14.2998 14.2998v-0.100586h-347.6c-7.7002 0 -14.2998 -6.5 -14.2998 -14.2998v-347.5
|
1138 |
+
c0 -7.7002 6.5 -14.2998 14.2998 -14.2998h347.6c7.7002 0 14.2998 6.5 14.2998 14.2998z" />
|
1139 |
+
<glyph glyph-name="accessible-icon" unicode=""
|
1140 |
+
d="M423.9 192.2l-12.9004 -157.3c-3.2998 -40.7002 -63.9004 -35.1006 -60.5996 4.89941l10 122.5l-41.1006 -2.2998c10.1006 -20.7002 15.7998 -43.9004 15.7998 -68.5c0 -41.2002 -16.0996 -78.7002 -42.2998 -106.5l-39.2998 39.2998
|
1141 |
+
c57.9004 63.7002 13.0996 167.2 -74 167.2c-25.9004 0 -49.5 -9.90039 -67.2002 -26l-39.2998 39.2998c22 20.7002 50.0996 35.1006 81.4004 40.2002l75.2998 85.7002l-42.6006 24.7998l-51.5996 -46c-30 -26.7998 -70.5996 18.5 -40.5 45.4004l68 60.6992
|
1142 |
+
c9.7998 8.80078 24.0996 10.2002 35.5 3.60059c0 0 139.3 -80.9004 139.5 -81.1006c16.2002 -10.0996 20.7002 -36 6.09961 -52.5996l-58.3994 -66.5l106.1 5.90039c18.5 1.09961 33.6006 -14.4004 32.1006 -32.7002zM359 346.2
|
1143 |
+
c-28.0996 0 -50.9004 22.7998 -50.9004 50.8994c0 28.1006 22.8008 50.9004 50.9004 50.9004s50.9004 -22.7998 50.9004 -50.9004c0 -28.0996 -22.8008 -50.8994 -50.9004 -50.8994zM179.6 -8.5c20.8008 0 40.1006 6.40039 56.1006 17.2998l39.7002 -39.7002
|
1144 |
+
c-100.7 -78.8994 -251.4 -8.19922 -251.4 122.5c0 36.1006 12.4004 69.4004 33.2002 95.7002l39.7002 -39.7002c-44.7002 -65.5 2.09961 -156.1 82.6992 -156.1z" />
|
1145 |
+
<glyph glyph-name="accusoft" unicode="" horiz-adv-x="640"
|
1146 |
+
d="M322.1 196c-1.69922 -1.59961 -89.5996 -82.5 -90.1992 -83.2998l-92.6006 -33.7998c-4.7998 -2 -7.59961 -3.7002 -7 -8.90039c0.200195 -1.5 0.600586 -22.5996 1 -27.7002c-0.700195 -0.5 -0.0996094 0 -0.599609 -0.599609c0 0 -113.7 -36.6006 -114.5 -36.6006
|
1147 |
+
c-14.1006 -5.09961 -22.7002 -8.2998 -15.7002 1.7002c1.2998 1.7998 234.4 231.601 243.4 240.9c13 13.5 25 15.0996 25 15.0996l51.1992 -65.7998v-1zM482.2 75.9004c-5.7002 6.89941 -232.2 297.1 -239.9 306.6c-13.7002 17.2002 0 16.7998 19.2002 16.9004
|
1148 |
+
c9.7002 0.0996094 106.3 0.599609 116.5 0.599609c24.0996 0.0996094 28.7002 -0.599609 38.4004 -12.7998c2.09961 -2.7002 205.1 -245.8 207.199 -248.3c5.5 -6.7002 15.2002 -19.1006 7.2002 -23.4004c-2.39941 -1.2998 -114.6 -47.7002 -117.8 -48.9004
|
1149 |
+
c-10.0996 -4 -17.5 -6.7998 -30.7998 9.30078zM634.9 74.2998c6 -1.39941 7.09961 -4.2002 1.69922 -8.2002c-2 -1.39941 -123.699 -76.5996 -125.8 -77.7998c-15.0996 -8.7998 -38 -1.59961 -53.5996 1.7002c-7.10059 1.5 -305.3 68.2998 -308 69.0996
|
1150 |
+
c-2.60059 0.900391 -4.40039 1 -4.60059 3.5c-0.299805 4 6 5.60059 11.1006 7.60059c5 1.89941 145.3 52.5996 150.2 54.7002c4.7998 2.09961 11.2998 2.69922 14.3994 2.89941c4.90039 0.299805 59.9004 -8.39941 65.2998 -9.2998l57.1006 -74
|
1151 |
+
c9.7998 -11.4004 20.7002 -21.9004 36.7002 -14.5996c2.5 1.19922 117.5 51.5996 117.5 51.5996c13.3994 -2.5 35.6992 -6.90039 38 -7.2002z" />
|
1152 |
+
<glyph glyph-name="adversal" unicode="" horiz-adv-x="512"
|
1153 |
+
d="M482.1 416c24.5 0 29.9004 -5.59961 29.9004 -30.2002v-388.1c0 -24.5 -5.5 -29.7002 -29.9004 -29.7002h-453.399c-22.9004 0 -28.7002 5.59961 -28.7002 28.9004v390.199c0 23 5.7998 28.9004 28.7002 28.9004h453.399zM178.4 227.7
|
1154 |
+
c9.39941 -7.2002 12.3994 -17.1006 11.2998 -27.2998c-1.7998 -19.1006 -75.7998 -11.4004 -114 -30.9004c-27.2002 -13.9004 -42.7002 -41.7002 -39.6006 -71c6.7002 -64.7002 89.6006 -79.7002 147 -43.2998c4.60059 3.2002 8.30078 4.89941 11.9004 1
|
1155 |
+
c2.09961 -2.60059 2 -4 3.90039 -6.2002c7.2998 -9.59961 38.1992 -14.0996 46.5996 -7.40039c3.09961 2.80078 4.59961 6.30078 2.7002 10.7002c-13.6006 30.5 -6.60059 63 -9.2998 88.7998c0 69.3008 6.39941 111.7 -34.5 128.5
|
1156 |
+
c-41.9004 17.4004 -84.2002 16.6006 -125.301 -4.7998c-16.2998 -9 -53.6992 -52.8994 -24.8994 -64.2998c5.2998 -2.2998 12.7998 -4 22.5 -5.5c8.2002 -1.2002 13.2002 -2.7998 17.5 8.2998c12.0996 32.1006 56.7002 43.6006 84.2002 23.4004zM465.1 5.7002
|
1157 |
+
c0 14.2998 -9.7998 9.89941 -16.5996 9.89941c-132.3 0.400391 -264.5 0.400391 -396.8 0c-6.60059 0 -16.7002 4.80078 -17.1006 -9.09961c-0.399414 -15.5 10.4004 -10.7002 17.8008 -10.7002h394.899c6.7002 0 17.7998 -5.2002 17.7998 9.90039zM468.9 346.2
|
1158 |
+
c0 0.200195 0 0.299805 0.0996094 0.5c0 9.89941 -3.5 15.0996 -13.5996 14.2998c-3.10059 -0.400391 -6.60059 0 -9.7002 0c-26.1006 0 -26 0 -26 -26.2002v-71c-79.2002 45.6006 -124.3 -6.59961 -136.101 -30.5c-16.3994 -32.8994 -21.7998 -66.5996 -15.6992 -100
|
1159 |
+
c16.2998 -92.2998 91 -114.899 144.399 -85.2002c4.60059 2.80078 6.60059 7.5 12.4004 -1.19922c8.59961 -12.7002 23.7002 -5.2002 36.0996 -5.60059c7.40039 0 8.10059 8.2002 8.10059 13.9004v291zM417.4 113.9c-19.5 -47.6006 -72.9004 -43.3008 -90 -5.2002
|
1160 |
+
c-15.1006 33.2998 -15.5 68.2002 0.399414 101.5c16.2998 34.0996 59.7002 35.7002 81.5 4.7998c20.6006 -28.7998 14.9004 -84.5996 8.10059 -101.1zM122.6 78.5996c-7.5 1.30078 -33 3.30078 -33.6992 27.8008c-0.400391 13.8994 7.7998 23 19.7998 25.7998
|
1161 |
+
c24.3994 5.89941 49.2998 9.89941 73.7002 14.7002c8.89941 2 7.39941 -4.40039 7.7998 -9.5c1.39941 -33 -26.1006 -59.2002 -67.6006 -58.8008z" />
|
1162 |
+
<glyph glyph-name="affiliatetheme" unicode="" horiz-adv-x="512"
|
1163 |
+
d="M159.7 210.6c-51.2998 -70.8994 -116.601 -110.8 -145.7 -89.1992c-29.2002 21.6992 -11.2002 96.5996 40.2002 167.5c51.2998 70.8994 116.6 110.8 145.7 89.1992c29.0996 -21.5996 11.0996 -96.5996 -40.2002 -167.5zM510.9 267.9
|
1164 |
+
c0.699219 -8.2002 1.09961 -16.5 1 -25c0 -151.801 -121.601 -274.9 -271.601 -274.9c-82.8994 0 -157.2 37.5996 -207 96.9004c71.2998 19.3994 130.5 68.3994 164.101 133.199c7.69922 -32.5996 24 -58.5996 49 -73.7998c72.5996 -44.0996 190.699 20.2002 264.5 143.601z
|
1165 |
+
" />
|
1166 |
+
<glyph glyph-name="algolia" unicode=""
|
1167 |
+
d="M229.3 265.4c49.2002 0 89.2002 -39.9004 89.2002 -89.2002s-39.9004 -89.2002 -89.2002 -89.2002s-89.2002 39.9004 -89.2002 89.2002s39.9004 89.2002 89.2002 89.2002zM292 208.8c1.2998 0.700195 1.7998 2.40039 1.09961 3.7002
|
1168 |
+
c-12.1992 21.4004 -34.8994 36.0996 -61.0996 37.0996c-1.40039 0.100586 -2.7002 -1.09961 -2.7002 -2.59961v-66.5c0 -1.90039 2 -3.2002 3.7998 -2.2998zM389.1 416c32.5 0 58.9004 -26.4004 58.8008 -58.9004v-330.199c0 -32.5 -26.3008 -58.9004 -58.9004 -58.9004
|
1169 |
+
h-330.1c-32.5 0 -58.9004 26.4004 -58.9004 59v330.1c0 32.5 26.4004 58.9004 58.9004 58.9004h330.199zM186.5 331.3h0.0996094v-15.7998c0 -1.7002 1.7002 -3 3.40039 -2.5c12.7002 3.7002 25.9004 5.5 39.4004 5.5c13 0 25.7998 -1.7002 38.0996 -5.09961
|
1170 |
+
c1.59961 -0.5 3.2998 0.699219 3.2998 2.5v15.3994c0 10.7998 -8.7002 19.5 -19.5 19.5h-45.2998c-10.7998 0 -19.5 -8.7002 -19.5 -19.5zM102.1 294.3c-7.59961 -7.59961 -7.59961 -19.8994 0 -27.3994l7.7002 -7.7002c1.10059 -1.2002 3 -1 4 0.299805
|
1171 |
+
c4.40039 6.09961 9.40039 12 14.7998 17.4004c5.5 5.5 11.4004 10.3994 17.6006 14.8994c1.2998 1 1.39941 2.90039 0.299805 4l-7.7002 7.7002c-7.59961 7.59961 -19.8994 7.59961 -27.5 0zM229.3 49.5c69.9004 0 126.601 56.7998 126.601 126.6
|
1172 |
+
c0 70 -56.6006 126.601 -126.601 126.601c-69.8994 0 -126.6 -56.7002 -126.6 -126.601c0 -69.8994 56.5996 -126.6 126.6 -126.6z" />
|
1173 |
+
<glyph glyph-name="amilia" unicode=""
|
1174 |
+
d="M240.1 416c134.101 0 191.9 -55.7002 192 -136v-296.6c0 -3 -1 -8.10059 -5.09961 -9.10059c-4 -1 -57.2998 -0.700195 -66.5 -0.700195s-56.7998 1 -59.9004 2c-4 0.900391 -6.09961 6.10059 -6.09961 9.10059v25.3994
|
1175 |
+
c-39.5996 -21.3994 -105.5 -42.0996 -153.3 -42.0996c-109.7 0 -124.9 85.7002 -124.9 104s-5.09961 95.5 30.4004 111.8c31.5 13.2002 156.3 36.5 243.7 47.7998v38.5c0 44.7002 -1 73.1006 -58.9004 73.1006c-55.7998 0 -119.8 -25.4004 -152.3 -47.7002
|
1176 |
+
c-6.10059 -4.09961 -16.2002 -4.09961 -20.2998 6.09961c-5.10059 12.2002 -9.10059 34.5 -10.2002 39.6006c-1.90039 10.2002 2.09961 16.2998 7.2002 19.3994c52.6992 38.5 122.3 55.4004 184.199 55.4004zM290.3 68v106.7c-44.7002 -4.10059 -95.5 -20.2998 -119.8 -33.5
|
1177 |
+
c-21.2998 -10.2002 -18.2998 -40.7002 -18.2998 -52.9004c0.0996094 -11.2002 6.2002 -44.7002 59 -44.7002c30.3994 0 57.7002 11.2002 79.0996 24.4004z" />
|
1178 |
+
<glyph glyph-name="angrycreative" unicode="" horiz-adv-x="640"
|
1179 |
+
d="M640 209.8l-3.2002 -28.2002l-34.5 -2.2998l-2 -18.0996l34.5 2.2998l-3.2002 -28.2002l-34.3994 -2.2002l-2.2998 -20.0996l34.3994 2.2002l-3 -26.1006l-64.7002 -4.09961l12.7002 113.2l-47.2998 -115.4l-31.9004 -2l-23.7998 117.8l30.2998 2l13.6006 -79.3994
|
1180 |
+
l31.7002 82.3994zM426.8 76.5l12.7998 120l28.4004 1.90039l-12.9004 -120.101zM162 59.9004l-19.4004 36l-3.5 -37.4004l-28.1992 -1.7002l2.69922 29.1006c-11 -18 -32 -34.3008 -56.8994 -35.8008c-32.7998 -2 -59.7002 20.9004 -56.4004 58.2002
|
1181 |
+
c2.60059 29.2998 26.7002 62.7998 67.5 65.4004c37.7002 2.39941 47.6006 -23.2002 51.2998 -28.7998l2.80078 30.7998l38.8994 2.5c20.1006 1.2998 38.7002 -3.7002 42.5 -23.7002l2.60059 26.5996l64.7998 4.2002l-2.7002 -27.8994l-36.4004 -2.40039l-1.69922 -17.9004
|
1182 |
+
l36.3994 2.30078l-2.7002 -27.9004l-36.3994 -2.2998l-1.90039 -19.9004l36.2998 2.2998l-2.09961 -20.7998l55 117.2l23.7998 1.59961l32.1006 -110.6l8.89941 85.5996l-22.2998 -1.39941l2.90039 27.8994l75 4.90039l-3 -28l-24.3008 -1.59961l-9.69922 -91.9004
|
1183 |
+
l-58 -3.7002l-4.30078 15.6006l-39.3994 -2.5l-8 -16.3008zM117.7 130.1l-26.4004 -1.69922c-6.7002 12.3994 -14.3994 16.5996 -26.2998 15.7998c-19 -1.2002 -33.2998 -17.5 -34.5996 -33.2998c-1.40039 -16 7.2998 -32.5 28.6992 -31.2002
|
1184 |
+
c12.8008 0.799805 21.3008 8.59961 28.9004 18.8994l27 1.7002zM173.8 137.8c1.2002 12.9004 -7.59961 13.6006 -26.0996 12.4004l-2.7002 -28.5c14.2002 0.899414 27.5 2.09961 28.7998 16.0996zM194.9 67l5.7998 60c-5 -13.5 -14.7002 -21.0996 -27.9004 -26.5996z
|
1185 |
+
M330.3 112l-7.89941 37.7998l-15.8008 -39.2998zM160.2 186.6l-4.2998 17.5l-39.6006 -2.59961l-8.09961 -18.2002l-31.9004 -2.09961l57 121.899l23.9004 1.60059l30.7002 -102l9.89941 104.7l27 1.7998l37.7998 -63.6006l6.5 66.6006l28.5 1.89941l-4 -41.1992
|
1186 |
+
c7.40039 13.5 22.9004 44.6992 63.6006 47.5c40.5 2.7998 52.3994 -29.3008 53.3994 -30.3008l3.30078 32l39.2998 2.7002c12.7002 0.900391 27.7998 -0.299805 36.2998 -9.7002l-4.40039 11.9004l32.2002 2.2002l12.9004 -43.2002l23 45.7002l31 2.2002l-43.6006 -78.4004
|
1187 |
+
l-4.7998 -44.2998l-28.3994 -1.90039l4.7998 44.2998l-15.7998 43c1 -22.2998 -9.2002 -40.0996 -32 -49.5996l25.1992 -38.7998l-36.3994 -2.40039l-19.2002 36.7998l-4 -38.2998l-28.4004 -1.89941l3.30078 31.5c-6.7002 -9.30078 -19.7002 -35.4004 -59.6006 -38
|
1188 |
+
c-26.2002 -1.7002 -45.5996 10.2998 -55.3994 39.1992l-4 -40.2998l-25 -1.59961l-37.6006 63.2998l-6.2998 -66.2002zM436.8 268.7c10.2002 0.700195 17.5 2.09961 21.6006 4.2998c4.5 2.40039 7 6.40039 7.59961 12.0996
|
1189 |
+
c0.599609 5.30078 -0.599609 8.80078 -3.40039 10.4004c-3.59961 2.09961 -10.5996 2.7998 -22.8994 2zM327.7 234c5.59961 -5.90039 12.7002 -8.5 21.2998 -7.90039c4.7002 0.300781 9.09961 1.80078 13.2998 4.10059c5.5 3 10.6006 8 15.1006 14.2998l-34.2002 -2.2998
|
1190 |
+
l2.39941 23.8994l63.1006 4.30078l1.2002 12l-31.2002 -2.10059c-4.10059 3.7002 -7.7998 6.60059 -11.1006 8.10059c-4 1.69922 -8.09961 2.7998 -12.1992 2.5c-8 -0.5 -15.3008 -3.60059 -22 -9.2002c-7.7002 -6.40039 -12 -14.5 -12.9004 -24.4004
|
1191 |
+
c-1.09961 -9.59961 1.40039 -17.2998 7.2002 -23.2998zM126.4 225.8l23.7998 1.60059l-8.2998 37.5996z" />
|
1192 |
+
<glyph glyph-name="app-store" unicode="" horiz-adv-x="512"
|
1193 |
+
d="M255.9 327.1l9.09961 15.7002c5.59961 9.7998 18.0996 13.1006 27.9004 7.5c9.7998 -5.59961 13.0996 -18.0996 7.5 -27.8994l-87.5 -151.5h63.2998c20.5 0 32 -24.1006 23.0996 -40.8008h-185.5c-11.2998 0 -20.3994 9.10059 -20.3994 20.4004
|
1194 |
+
s9.09961 20.4004 20.3994 20.4004h52l66.6006 115.399l-20.8008 36.1006c-5.59961 9.7998 -2.2998 22.1992 7.5 27.8994c9.80078 5.60059 22.2002 2.2998 27.9004 -7.5zM177.2 109.1l-19.6006 -34c-5.59961 -9.7998 -18.0996 -13.0996 -27.8994 -7.5
|
1195 |
+
c-9.7998 5.60059 -13.1006 18.1006 -7.5 27.9004l14.5996 25.2002c16.4004 5.09961 29.7998 1.2002 40.4004 -11.6006zM346.1 170.8h53.1006c11.2998 0 20.3994 -9.09961 20.3994 -20.3994c0 -11.3008 -9.09961 -20.4004 -20.3994 -20.4004h-29.5l19.8994 -34.5
|
1196 |
+
c5.60059 -9.7998 2.30078 -22.2002 -7.5 -27.9004c-9.7998 -5.59961 -22.1992 -2.2998 -27.8994 7.5c-33.5 58.1006 -58.7002 101.601 -75.4004 130.601c-17.0996 29.5 -4.89941 59.0996 7.2002 69.0996c13.4004 -23 33.4004 -57.7002 60.0996 -104zM256 440
|
1197 |
+
c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM472 192c0 119.9 -97.2998 216 -216 216c-119.9 0 -216 -97.2998 -216 -216c0 -119.9 97.2998 -216 216 -216c119.9 0 216 97.2998 216 216z" />
|
1198 |
+
<glyph glyph-name="app-store-ios" unicode=""
|
1199 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM127 63.5l19.2998 33.2998c-10.2998 12.5 -23.5 16.2998 -39.5996 11.4004l-14.2998 -24.7002
|
1200 |
+
c-5.5 -9.5 -2.30078 -21.7998 7.2998 -27.2998c9.5 -5.5 21.7998 -2.2998 27.2998 7.2998zM265.9 117.4c8.7998 16.2998 -2.5 40 -22.7002 40h-62.1006l85.8008 148.6c5.5 9.5 2.2998 21.7998 -7.30078 27.2998c-9.5 5.5 -21.7998 2.2998 -27.2998 -7.2998
|
1201 |
+
l-8.89941 -15.4004l-8.90039 15.4004c-5.5 9.5 -17.7002 12.7998 -27.2998 7.2998c-9.5 -5.5 -12.7998 -17.7002 -7.2998 -27.2998l20.5 -35.4004l-65.4004 -113.199h-51c-11 0 -20 -9 -20 -20s9 -20 20 -20h181.9zM364 117.4c11 0 20 8.89941 20 20c0 11 -9 20 -20 20h-52
|
1202 |
+
c-26.2002 45.2998 -45.7998 79.2998 -58.9004 102c-11.8994 -9.80078 -23.7998 -38.8008 -7.09961 -67.8008c16.5 -28.3994 41.0996 -71.1992 74 -128.1c5.5 -9.5 17.7002 -12.7998 27.2998 -7.2998c9.5 5.5 12.7998 17.7002 7.2998 27.2998l-19.5996 33.9004h29z" />
|
1203 |
+
<glyph glyph-name="apper" unicode="" horiz-adv-x="640"
|
1204 |
+
d="M42.0996 208.9c22.2002 0 29 -2.80078 33.5 -14.6006h0.800781v22.9004c0 11.2998 -4.80078 15.3994 -17.9004 15.3994c-11.2998 0 -14.4004 -2.5 -15.0996 -12.7998h-38.6006c0.299805 13.9004 1.5 19.1006 5.7998 24.4004
|
1205 |
+
c7.30078 8.7998 18.9004 11.7998 46.1006 11.7998c33 0 47.0996 -5 53.8994 -18.9004c2 -4.2998 4 -15.5996 4 -23.6992v-76.3008h-38.2998l1.2998 19.1006h-1c-5.2998 -15.6006 -13.5996 -20.4004 -35.5 -20.4004c-30.2998 0 -41.0996 10.1006 -41.0996 37.2998
|
1206 |
+
c0 25.2002 12.2998 35.8008 42.0996 35.8008zM59.2002 160.8c13.0996 0 16.8994 3 16.8994 13.4004c0 9.09961 -4.2998 11.5996 -19.5996 11.5996c-13.0996 0 -17.9004 -3 -17.9004 -12.0996c-0.0996094 -10.4004 3.7002 -12.9004 20.6006 -12.9004zM137 255.7h38.2998
|
1207 |
+
l-1.5 -20.6006h0.799805c9.10059 17.1006 15.9004 20.9004 37.5 20.9004c14.4004 0 24.7002 -3 31.5 -9.09961c9.80078 -8.60059 12.8008 -20.4004 12.8008 -48.1006c0 -30 -3 -43.0996 -12.1006 -52.8994c-6.7998 -7.30078 -16.3994 -10.1006 -33.2002 -10.1006
|
1208 |
+
c-20.3994 0 -29.1992 5.5 -33.7998 21.2002h-0.799805v-70.2998h-39.5v169zM217.9 195c0 27.5 -3.30078 32.5 -20.7002 32.5c-16.9004 0 -20.7002 -5 -20.7002 -28.7002c0 -28 3.5 -33.5 21.2002 -33.5c16.3994 0 20.2002 5.60059 20.2002 29.7002zM275.8 255.7h38.2998
|
1209 |
+
l-1.5 -20.6006h0.800781c9.09961 17.1006 15.8994 20.9004 37.5 20.9004c14.3994 0 24.6992 -3 31.5 -9.09961c9.7998 -8.60059 12.7998 -20.4004 12.7998 -48.1006c0 -30 -3 -43.0996 -12.1006 -52.8994c-6.7998 -7.30078 -16.3994 -10.1006 -33.2998 -10.1006
|
1210 |
+
c-20.3994 0 -29.2002 5.5 -33.7998 21.2002h-0.799805v-70.2998h-39.5v169h0.0996094zM356.7 195c0 27.5 -3.2998 32.5 -20.7002 32.5c-16.9004 0 -20.7002 -5 -20.7002 -28.7002c0 -28 3.5 -33.5 21.2002 -33.5c16.4004 0 20.2002 5.60059 20.2002 29.7002zM410.5 198.8
|
1211 |
+
c0 25.4004 3.2998 37.7998 12.2998 45.7998c8.7998 8.10059 22.2002 11.3008 45.1006 11.3008c42.7998 0 55.6992 -12.8008 55.6992 -55.7002v-11.1006h-75.2998c-0.299805 -2 -0.299805 -4 -0.299805 -4.7998c0 -16.8994 4.5 -21.8994 20.0996 -21.8994
|
1212 |
+
c13.9004 0 17.9004 3 17.9004 13.8994h37.5v-2.2998c0 -9.7998 -2.5 -18.9004 -6.7998 -24.7002c-7.2998 -9.7998 -19.6006 -13.5996 -44.2998 -13.5996c-27.5 0 -41.6006 3.2998 -50.6006 12.2998c-8.5 8.5 -11.2998 21.2998 -11.2998 50.7998zM486.9 210.4
|
1213 |
+
c-0.300781 1.7998 -0.300781 3.2998 -0.300781 3.7998c0 12.2998 -3.2998 14.5996 -19.5996 14.5996c-14.4004 0 -17.0996 -3 -18.0996 -15.0996l-0.300781 -3.2998h38.3008zM542.5 255.7h38.2998l-1.7998 -19.9004h0.700195
|
1214 |
+
c6.7998 14.9004 14.3994 20.2002 29.7002 20.2002c10.7998 0 19.0996 -3.2998 23.3994 -9.2998c5.2998 -7.2998 6.7998 -14.4004 6.7998 -34c0 -1.5 0 -5 0.200195 -9.2998h-35c0.299805 1.7998 0.299805 3.2998 0.299805 4c0 15.3994 -2 19.3994 -10.2998 19.3994
|
1215 |
+
c-6.2998 0 -10.7998 -3.2998 -13.0996 -9.2998c-1 -3 -1 -4.2998 -1 -12.2998v-68h-38.2998v118.5h0.0996094z" />
|
1216 |
+
<glyph glyph-name="asymmetrik" unicode="" horiz-adv-x="576"
|
1217 |
+
d="M517.5 138.8c-13.9004 -14.2998 -30.4004 -27.7002 -48.9004 -39.7998l73.4004 -110.4h-101.6l-45.9004 71.8008c-17.5996 -7.2002 -35.9004 -13.4004 -54.5 -18.7002l32.5996 -53.1006h-135.5l22.8008 37.1006c-23.3008 -2.7002 -46.4004 -3.7002 -68.6006 -2.7002
|
1218 |
+
l-22 -34.4004h-101.6l34.5 51.7002c-45 17.9004 -68.9004 47.9004 -68.4004 83c0.299805 25.7998 14 54.2998 41.7002 82.9004c38.9004 40 96.5 72.5996 161.6 92.8994c-22.2998 -8.09961 -42 -18.5 -62 -30.6992c-31.1992 -16.2002 -58.6992 -35.9004 -79.5 -58.1006
|
1219 |
+
c-57.3994 -61 -46.5 -121.8 19.1006 -151.2l190.2 285.5l150.899 -226.399c13 9.5 24.7998 19.7998 35 30.5996c98 104.2 53.7002 207.9 -98.7998 231.7c-68.2998 10.5996 -146.8 5.7002 -221.3 -14.7998c-60.1006 -10 -118.7 -31.7002 -170.7 -58.2002
|
1220 |
+
c118.1 66.9004 277.9 102.1 406.6 82.4004c110 -16.8008 170.2 -69.5 169.4 -135c-0.400391 -36.1006 -19.7002 -76.1006 -58.5 -116.101zM329.9 58.2998c18.3994 5.2998 36.5 11.7998 53.6992 19.2002l-78.6992 123l-101.9 -159.3
|
1221 |
+
c22.5 -0.700195 45.7998 0.899414 69.2002 4.39941l32.7002 53.3008z" />
|
1222 |
+
<glyph glyph-name="audible" unicode="" horiz-adv-x="640"
|
1223 |
+
d="M640 248.1v-54l-320 -200l-320 199.9v54l320 -200zM445.5 176.1c-70.7998 94.4004 -200.5 110.7 -290.2 36.3008c-2.59961 -2.2002 -5.2002 -4.40039 -7.7002 -6.7002h-0.299805c37.1006 55.7002 100.601 92.3994 172.601 92.3994s135.5 -36.7998 172.699 -92.5996z
|
1224 |
+
M225.4 157.3c21 29.6006 55.5 49 94.3994 49c39.2002 0 73.9004 -19.5996 94.7998 -49.5l-45.3994 -28.3994c-21.2002 29.1992 -52 47.5996 -86.4004 47.5996c-20.8994 0 -40.5 -6.7998 -57.3994 -18.7002zM103.6 286.9c-11.5 -9.10059 -24.2998 -22.1006 -34.1992 -32.6006
|
1225 |
+
c53.8994 82.1006 147 135.601 250.5 135.601c104.899 0 197.199 -54 250.699 -135.7l-48.7998 -30.4004l-0.700195 1c-99.2998 138.5 -285.699 166.4 -417.5 62.1006zM570.6 254.2z" />
|
1226 |
+
<glyph glyph-name="avianex" unicode="" horiz-adv-x="512"
|
1227 |
+
d="M453.1 416c39 0 64.8008 -31.2002 57.8008 -69.7998l-56.7002 -308.5c-7.10059 -38.5 -44.4004 -69.7002 -83.2998 -69.7002h-312c-39 0 -64.8008 31.2002 -57.7002 69.7002l56.5996 308.6c7.10059 38.5 44.4004 69.7002 83.2998 69.7002h312zM394.9 68.7002
|
1228 |
+
l6.2998 7.89941l-94.9004 119.4l-4.5 7.2998c19.7998 14.2002 33.5 24.2998 35.2998 25.6006c7.90039 6.59961 6.30078 20.7998 -2.69922 31.2998c-9.2002 10.7998 -23 14.3994 -30.7002 7.89941c0 0 -14.4004 -13.5996 -33.7998 -32.3994l-4.90039 4.5l-103.1 112.399
|
1229 |
+
l-8.90039 -4.7998l-18.7998 -28.8994l68.7998 -99.8008l20.5 -29.5996c-12 -12.2998 -23.5 -24.4004 -32.7998 -34.9004l-58 31.1006l-15.7002 -15.4004l52.4004 -48.0996l40.5996 -61l17.9004 12.7002l-22.1006 64.1992c12.5 7.60059 27 17.1006 41.7002 27.1006
|
1230 |
+
l115.4 -110z" />
|
1231 |
+
<glyph glyph-name="aws" unicode="" horiz-adv-x="640"
|
1232 |
+
d="M180.41 244.99c-0.719727 -22.6504 10.5996 -32.6807 10.8799 -39.0498c-0.238281 -2.31543 -2.0752 -5.12402 -4.09961 -6.27051l-12.8008 -8.95996c-1.39941 -0.981445 -3.92188 -1.8418 -5.62988 -1.91992c-0.429688 0.0195312 -8.18945 -1.83008 -20.4795 25.6104
|
1233 |
+
c-13.0283 -16.2627 -40.5127 -29.4609 -61.3496 -29.4609c-0.347656 0 -0.913086 0.00488281 -1.26074 0.0107422c-16.2803 -0.890625 -60.4004 9.24023 -58.1299 56.21c-1.58984 38.2803 34.0596 62.0596 70.9297 60.0498
|
1234 |
+
c7.10059 -0.0195312 21.6006 -0.370117 46.9902 -6.26953v15.6191c2.69043 26.46 -14.7002 46.9902 -44.8096 43.9102c-2.40039 -0.00976562 -19.4004 0.5 -45.8408 -10.1094c-7.35938 -3.37988 -8.2998 -2.82031 -10.75 -2.82031
|
1235 |
+
c-7.40918 0 -4.35938 21.4795 -2.93945 24.2002c5.20996 6.39941 35.8604 18.3496 65.9395 18.1797c1.86523 0.165039 4.89844 0.298828 6.77148 0.298828c15.2451 0 37.1611 -7.875 48.9189 -17.5791c9.87305 -11.0439 17.8867 -32.0303 17.8867 -46.8438
|
1236 |
+
c0 -1.52539 -0.0966797 -3.99609 -0.216797 -5.51562zM93.9902 212.6c32.4297 0.470703 46.1602 19.9707 49.29 30.4707c2.45996 10.0498 2.0498 16.4102 2.0498 27.3994c-9.66992 2.32031 -23.5898 4.85059 -39.5605 4.87012
|
1237 |
+
c-15.1494 1.14062 -42.8193 -5.62988 -41.7393 -32.2598c-1.24023 -16.79 11.1201 -31.4004 29.96 -30.4805zM264.91 189.55c-7.86035 -0.719727 -11.5205 4.86035 -12.6797 10.3701l-49.8008 164.65c-0.969727 2.7793 -1.60938 5.64941 -1.91992 8.58008
|
1238 |
+
c-0.0283203 0.189453 -0.0517578 0.5 -0.0517578 0.692383c0 2.18555 1.75195 4.22656 3.91211 4.55762h22.25c8.78027 0.879883 11.6396 -6.03027 12.5498 -10.3701l35.7197 -140.83l33.1602 140.83c0.530273 3.21973 2.94043 11.0693 12.7998 10.2393h17.1602
|
1239 |
+
c2.16992 0.180664 11.1104 0.5 12.6807 -10.3691l33.4199 -142.631l36.8701 142.631c0.479492 2.17969 2.71973 11.3691 12.6797 10.3691h19.7197c0.850586 0.130859 6.15039 0.810547 5.25 -8.5791c-0.429688 -1.85059 3.41016 10.6592 -52.75 -169.9
|
1240 |
+
c-1.14941 -5.50977 -4.82031 -11.0898 -12.6797 -10.3701h-18.6904c-10.9395 -1.15039 -12.5098 9.66016 -12.6797 10.75l-33.1602 137.13l-32.7803 -136.99c-0.15918 -1.08984 -1.72949 -11.8994 -12.6797 -10.75h-18.2998v-0.00976562zM538.39 183.92
|
1241 |
+
c-5.87988 -0.00976562 -33.9199 0.299805 -57.3594 12.29c-4.31152 1.8252 -7.81055 7.10645 -7.81055 11.7891v0.121094v10.75c0 8.4502 6.2002 6.89941 8.83008 5.88965c10.04 -4.05957 16.4805 -7.13965 28.8105 -9.59961
|
1242 |
+
c36.6494 -7.53027 52.7695 2.2998 56.7197 4.47949c13.1504 7.81055 14.1895 25.6807 5.25 34.9502c-10.4805 8.79004 -15.4805 9.12012 -53.1299 21c-4.64062 1.29004 -43.7002 13.6104 -43.79 52.3604c-0.610352 28.2402 25.0498 56.1797 69.5195 55.9502
|
1243 |
+
c12.6699 0.00976562 46.4307 -4.13086 55.5703 -15.6201c1.34961 -2.08984 2.01953 -4.5498 1.91992 -7.04004v-10.1104c0 -4.43945 -1.62012 -6.66016 -4.87012 -6.66016c-7.70996 0.860352 -21.3896 11.1699 -49.1602 10.75
|
1244 |
+
c-6.88965 0.360352 -39.8896 -0.910156 -38.4092 -24.9697c-0.430664 -18.96 26.6094 -26.0703 29.6992 -26.8896c36.46 -10.9707 48.6504 -12.79 63.1201 -29.5801c17.1406 -22.25 7.90039 -48.2998 4.35059 -55.4404
|
1245 |
+
c-19.0801 -37.4902 -68.4199 -34.4395 -69.2607 -34.4199zM578.59 79.0596c-70.0303 -51.7197 -171.689 -79.25 -258.49 -79.25c-0.853516 -0.00488281 -2.23926 -0.00976562 -3.09277 -0.00976562c-99.5195 0 -240.271 54.0918 -314.177 120.74
|
1246 |
+
c-6.53027 5.88965 -0.770508 13.96 7.16992 9.46973c81.1748 -46.4336 222.955 -84.1201 316.473 -84.1201h0.407227c69.4072 0.373047 177.64 22.5713 241.59 49.5508c11.7803 5 21.7705 -7.80078 10.1201 -16.3809zM607.78 112.35
|
1247 |
+
c-8.95996 11.5205 -59.2803 5.38086 -81.8105 2.69043c-6.79004 -0.770508 -7.93945 5.12012 -1.79004 9.46973c40.0703 28.1699 105.88 20.1006 113.44 10.6299c7.5498 -9.46973 -2.0498 -75.4092 -39.5605 -106.909c-5.75977 -4.87012 -11.2695 -2.30078 -8.70996 4.09961
|
1248 |
+
c8.44043 21.25 27.3906 68.4902 18.4307 80.0195z" />
|
1249 |
+
<glyph glyph-name="bimobject" unicode=""
|
1250 |
+
d="M416 416c17.5996 0 32 -14.4004 32 -32v-384c0 -17.5996 -14.4004 -32 -32 -32h-384c-17.5996 0 -32 14.4004 -32 32v384c0 17.5996 14.4004 32 32 32h384zM352 158.6h-0.0996094v35c0 49.4004 -11.4004 82.5 -103.801 82.5h-17.2998
|
1251 |
+
c-30 0 -65.0996 -8.2998 -69.7002 -38.7998h-1.09961v74.7002h-64v-232h64v34.7998h0.900391c8 -23.8994 26.2998 -38.7998 70.3994 -38.7998h16.9004c92.3994 0 103.8 33.2002 103.8 82.5996zM288 187.5v-22.9004c0 -21.6992 -3.40039 -33.7998 -38.4004 -33.7998h-45.2998
|
1252 |
+
c-28.8994 0 -44.0996 6.5 -44.0996 35.7002v19c0 29.2998 15.2002 35.7002 44.0996 35.7002h45.2998c35 0.200195 38.4004 -12 38.4004 -33.7002z" />
|
1253 |
+
<glyph glyph-name="bitcoin" unicode="" horiz-adv-x="512"
|
1254 |
+
d="M504 192c0 -136.967 -111.033 -248 -248 -248s-248 111.033 -248 248s111.033 248 248 248s248 -111.033 248 -248zM362.349 227.33c4.9375 32.999 -20.1904 50.7393 -54.5498 62.5732l11.1465 44.7021l-27.2129 6.78027l-10.8516 -43.5234
|
1255 |
+
c-7.1543 1.78223 -14.502 3.46387 -21.8027 5.12988l10.9287 43.8096l-27.1982 6.78125l-11.1523 -44.6855c-5.92188 1.34863 -11.7354 2.68164 -17.377 4.08398l0.0302734 0.139648l-37.5293 9.37012l-7.23926 -29.0625s20.1914 -4.62695 19.7646 -4.91309
|
1256 |
+
c11.0225 -2.75098 13.0146 -10.0439 12.6807 -15.8242l-12.6963 -50.9258c0.759766 -0.193359 1.74414 -0.472656 2.8291 -0.90625c-0.907227 0.224609 -1.87598 0.472656 -2.87598 0.712891l-17.7959 -71.3379c-1.34961 -3.34863 -4.76758 -8.37012 -12.4717 -6.46484
|
1257 |
+
c0.271484 -0.394531 -19.7793 4.9375 -19.7793 4.9375l-13.5107 -31.1475l35.4141 -8.82617c6.58887 -1.65137 13.0449 -3.37988 19.4004 -5.00684l-11.2617 -45.2129l27.1816 -6.78027l11.1533 44.7324c5.96875 -1.61719 15.6846 -4.13867 21.6865 -5.62695
|
1258 |
+
l-11.1152 -44.5225l27.2139 -6.78125l11.2617 45.1279c46.4043 -8.78125 81.2988 -5.23926 95.9863 36.7266c11.8359 33.79 -0.589844 53.2812 -25.0049 65.9912c17.7803 4.09766 31.1748 15.792 34.7471 39.9492zM300.172 140.151
|
1259 |
+
c-8.41016 -33.79 -65.3076 -15.5234 -83.7549 -10.9434l14.9443 59.8994c18.4453 -4.60352 77.5996 -13.7178 68.8105 -48.9561zM308.589 227.818c-7.67285 -30.7363 -55.0312 -15.1201 -70.3926 -11.292l13.5479 54.3262
|
1260 |
+
c15.3633 -3.82715 64.8359 -10.9727 56.8447 -43.0342z" />
|
1261 |
+
<glyph glyph-name="bity" unicode="" horiz-adv-x="496"
|
1262 |
+
d="M78.4004 380.8c95.3994 89.2002 246.1 91.2002 343.1 -3.7998c14.2998 -14.0996 -6.40039 -37.0996 -22.4004 -21.5c-84.7998 82.4004 -215.8 80.2998 -298.899 3.2002c-16.2998 -15.1006 -36.5 8.2998 -21.7998 22.0996zM177.3 -37.7998
|
1263 |
+
c-128.7 38.2998 -201.899 170.7 -169.8 298.1c5.2998 21 35.2002 12.5 30.2002 -7.09961c-28.2998 -111.3 35.2998 -227.101 147.5 -261c21.3994 -6.40039 11.3994 -35.7002 -7.90039 -30zM325.4 -35.7998c-19.2002 -6.2998 -30 22.7002 -8.80078 29.7002
|
1264 |
+
c106.101 35.5 167.4 145.699 143.2 253.399c-4.89941 21.7002 25.5 27.6006 30 7.90039c28.5 -124.101 -42.5 -250.8 -164.399 -291zM262.5 43.2002c0 -8.2002 -6.59961 -14.7998 -14.7998 -14.7998s-14.7998 6.59961 -14.7998 14.7998l0.199219 71.7998
|
1265 |
+
c0 8.09961 6.60059 14.7998 14.8008 14.7998c8.19922 0 14.7998 -6.59961 14.7998 -14.7998zM333.5 312.2c0 21.7998 32.5 19.5996 32.5 0v-71.6006c0 -69.2998 -60.7002 -90.8994 -118 -90.0996c-57.2998 -0.799805 -118 20.7998 -118 90.0996v71.6006
|
1266 |
+
c0 19.5996 32.5 21.7998 32.5 0c-1.40039 -88.2002 -7 -131.8 85.5 -132.5c90.2002 0.599609 87.5996 41.5996 85.5 132.5z" />
|
1267 |
+
<glyph glyph-name="blackberry" unicode="" horiz-adv-x="512"
|
1268 |
+
d="M166 331.1c0 -23.3994 -16.4004 -49.0996 -72.5 -49.0996h-70.0996l21 88.7998h67.7998c42.0996 0 53.7998 -23.2998 53.7998 -39.7002zM292.2 370.8c42.0996 0 53.7998 -23.2998 53.7002 -39.7002c0 -23.3994 -16.3008 -49.0996 -70.1006 -49.0996h-70.0996
|
1269 |
+
l18.7002 88.7998h67.7998zM88.7998 239.9c42.1006 0 53.7998 -23.4004 53.7998 -39.7002c0 -25.7002 -16.3994 -49.1006 -72.5 -49.1006h-70.0996l21 88.8008h67.7998zM268.9 239.9c42 0 53.6992 -23.4004 53.6992 -39.7002c0 -25.7002 -16.2998 -49.1006 -70.0996 -49.1006
|
1270 |
+
h-70.0996l18.6992 88.8008h67.8008zM458.2 293.7c42.0996 0 53.7998 -23.4004 53.7002 -39.7002c0 -25.7002 -16.3008 -49.0996 -70.1006 -49.0996h-70.0996l18.7002 88.7998h67.7998zM430.2 155.8c42.0996 0 53.7002 -23.3994 53.7002 -39.7002
|
1271 |
+
c0 -25.6992 -14 -49.0996 -70.1006 -49.0996h-70.0996l18.7002 88.7998h67.7998zM240.8 102c42.1006 0 53.7998 -23.4004 53.7002 -39.7002c0 -23.3994 -14 -49.0996 -70.0996 -49.0996h-70.1006l18.7002 88.7998h67.7998z" />
|
1272 |
+
<glyph glyph-name="blogger" unicode=""
|
1273 |
+
d="M162.4 252c4.7998 4.90039 6.19922 5.09961 36.3994 5.09961c27.2002 0 28.1006 -0.0996094 32.1006 -2.09961c5.7998 -2.90039 8.2998 -7 8.2998 -13.5996c0 -5.90039 -2.40039 -10 -7.60059 -13.4004c-2.7998 -1.7998 -4.5 -1.90039 -31.0996 -2.09961
|
1274 |
+
c-16.4004 -0.100586 -29.5 0.199219 -31.5 0.799805c-10.2998 2.89941 -14.0996 17.7002 -6.59961 25.2998zM223.8 157.5c55.4004 0 55.1006 0 60.4004 -4.7002c7.39941 -7 5.89941 -19.2998 -3.10059 -24.3994l-9.19922 -1.5l-47.9004 -0.600586
|
1275 |
+
c-42.2002 -0.5 -54.0996 0.200195 -56.2998 1.2002c-4.40039 1.90039 -8.5 7.2998 -9.2002 12c-0.599609 4.5 1.59961 10.7998 5.09961 13.9004c4.40039 3.89941 6.30078 4.09961 60.2002 4.09961zM447.2 27.4004c-3.5 -28.4004 -23 -50.4004 -51.1006 -57.5
|
1276 |
+
c-7.19922 -1.80078 -9.69922 -1.90039 -172.899 -1.80078c-157.8 0 -165.9 0.100586 -172 1.80078c-8.40039 2.19922 -15.6006 5.5 -22.2998 10c-5.60059 3.7998 -13.9004 11.7998 -17 16.3994c-3.80078 5.60059 -8.2002 15.2998 -10 22
|
1277 |
+
c-1.80078 6.7002 -1.90039 9.40039 -1.90039 173.4c0 163.1 0 166.6 1.7998 173.7c6.2998 24.6992 25.9004 43.5996 51.2002 49.1992c7.2998 1.60059 332.1 1.90039 340 0.300781c21.2002 -4.30078 37.9004 -17.1006 47.5996 -36.4004c7.7002 -15.2998 7 1.5 7.30078 -180.6
|
1278 |
+
c0.199219 -115.801 0 -164.5 -0.700195 -170.5zM361.8 212.6c-1.09961 5 -4.2002 9.60059 -7.7002 11.5c-1.09961 0.600586 -8 1.30078 -15.5 1.7002c-12.3994 0.600586 -13.7998 0.799805 -17.7998 3.10059c-6.2002 3.59961 -7.89941 7.59961 -8 18.2998
|
1279 |
+
c0 20.3994 -8.5 39.3994 -25.2998 56.5c-12 12.2002 -25.2998 20.5 -40.5996 25.0996c-3.60059 1.10059 -11.8008 1.5 -39.2002 1.7998c-42.9004 0.5 -52.5 -0.399414 -67.1006 -6.19922c-27 -10.7002 -46.2998 -33.4004 -53.3994 -62.4004
|
1280 |
+
c-1.2998 -5.40039 -1.60059 -14.2002 -1.90039 -64.2998c-0.399414 -62.7998 0 -72.1006 4 -84.5c9.7002 -30.7002 37.1006 -53.4004 64.6006 -58.4004c9.19922 -1.7002 122.199 -2.09961 133.699 -0.5c20.1006 2.7002 35.9004 10.7998 50.7002 25.9004
|
1281 |
+
c10.7002 10.8994 17.4004 22.7998 21.7998 38.5c3.2002 10.8994 2.90039 88.3994 1.7002 93.8994z" />
|
1282 |
+
<glyph glyph-name="blogger-b" unicode=""
|
1283 |
+
d="M446.6 225.3c2 -8.89941 2.40039 -134.1 -2.5 -151.7c-7.09961 -25.2998 -17.8994 -44.3994 -35.1992 -62.0996c-23.9004 -24.4004 -49.4004 -37.5 -81.9004 -41.9004c-18.7002 -2.5 -201.2 -1.89941 -216 0.800781c-44.5 8 -88.7998 44.6992 -104.4 94.2998
|
1284 |
+
c-6.2998 20.0996 -7 35 -6.39941 136.5c0.5 81 1 95.0996 3.09961 103.899c11.4004 46.8008 42.6006 83.4004 86.1006 100.601c23.5996 9.39941 39 10.7998 108.399 10c44.2002 -0.5 57.4004 -1.10059 63.2998 -2.90039c24.6006 -7.5 46.2002 -20.7998 65.5 -40.5
|
1285 |
+
c27.1006 -27.5996 40.8008 -58.2998 40.9004 -91.2998c0.0996094 -17.2002 2.7998 -23.5996 12.9004 -29.5c6.39941 -3.7002 8.59961 -4.09961 28.6992 -5c12 -0.5 23.2002 -1.7002 25 -2.7002c5.7002 -3.09961 10.7002 -10.5 12.5 -18.5zM124.5 288.9
|
1286 |
+
c-12.2002 -12.3008 -6 -36.1006 10.5996 -40.8008c3.10059 -0.799805 24.3008 -1.39941 50.8008 -1.19922c43 0.199219 45.6992 0.399414 50.2998 3.2998c8.5 5.39941 12.2998 12.0996 12.2998 21.5996c0 10.6006 -4.09961 17.2002 -13.4004 21.9004
|
1287 |
+
c-6.39941 3.2998 -7.89941 3.39941 -51.7998 3.39941c-48.7998 0 -51 -0.299805 -58.7998 -8.19922zM316.3 89.0996c14.4004 8.2002 17 28.1006 4.90039 39.4004c-8.5 7.90039 -8 7.90039 -97.6006 7.7998c-87.0996 -0.0996094 -90.1992 -0.299805 -97.2998 -6.7002
|
1288 |
+
c-5.59961 -5.09961 -9.2998 -15.0996 -8.2002 -22.3994c1.10059 -7.7002 7.80078 -16.2998 14.9004 -19.4004c3.59961 -1.59961 22.7998 -2.7998 90.9004 -2l77.5 0.900391z" />
|
1289 |
+
<glyph glyph-name="buromobelexperte" unicode=""
|
1290 |
+
d="M0 416h128v-128h-128v128zM120 296v112h-112v-112h112zM160 416h128v-128h-128v128zM280 296v112h-112v-112h112zM320 416h128v-128h-128v128zM440 296v112h-112v-112h112zM0 256h128v-128h-128v128zM120 136v112h-112v-112h112zM160 256h128v-128h-128v128zM280 136v112
|
1291 |
+
h-112v-112h112zM320 256h128v-128h-128v128zM440 136v112h-112v-112h112zM0 96h128v-128h-128v128zM120 -24v112h-112v-112h112zM160 96h128v-128h-128v128zM280 -24v112h-112v-112h112zM320 96h128v-128h-128v128z" />
|
1292 |
+
<glyph glyph-name="centercode" unicode="" horiz-adv-x="512"
|
1293 |
+
d="M329.2 179.4c-3.7998 -35.2002 -35.4004 -60.6006 -70.6006 -56.8008c-35.1992 3.80078 -60.5996 35.4004 -56.7998 70.6006s35.4004 60.5996 70.6006 56.7998c35.0996 -3.7998 60.5996 -35.4004 56.7998 -70.5996zM243.4 -55.7002
|
1294 |
+
c-146.7 7.7002 -251.601 138.2 -233.301 279.4c11.2002 86.5996 65.8008 156.899 139.101 192c161 77.0996 349.7 -37.4004 354.7 -216.601c4.09961 -147 -118.4 -262.199 -260.5 -254.8zM423.3 124.3c27.9004 118 -160.5 205.9 -237.2 234.2
|
1295 |
+
c-57.5 -56.2998 -69.0996 -188.6 -33.7998 -344.4c68.7998 -15.7998 169.101 26.4004 271 110.2z" />
|
1296 |
+
<glyph glyph-name="cloudscale" unicode=""
|
1297 |
+
d="M318.1 294c6.2002 6.2998 15.8008 -3.09961 9.5 -9.59961l-75.1992 -88.8008c0.899414 -8.19922 -1.80078 -16.7998 -8.10059 -23.0996c-11.0996 -11 -28.8994 -11 -40 0c-11.0996 11.0996 -11.0996 29 0 40c6.2998 6.2998 14.7998 9 23.1006 8.09961l25.1992 20.4004
|
1298 |
+
c-16.3994 15.2998 -38.3994 24.7002 -62.5996 24.7002c-50.7998 0 -94.5996 -41.4004 -92.5996 -97.4004c-1 6.2998 -1.40039 12.7998 -1.40039 19.4004c0 71.5 57.7998 132.3 129.4 132.3c31.7998 0 60.7998 -14.2998 83.2998 -33.5996zM234.3 182.5
|
1299 |
+
c5.60059 5.5 5.60059 14.5996 0 20.2002c-5.59961 5.59961 -14.5996 5.59961 -20.2002 0c-5.59961 -5.60059 -5.59961 -14.6006 0 -20.2002c5.60059 -5.5 14.6006 -5.5 20.2002 0zM224 416c123.5 0 224 -100.5 224 -224s-100.5 -224 -224 -224s-224 100.5 -224 224
|
1300 |
+
s100.5 224 224 224zM224 32c88.2002 0 160 71.7998 160 160s-71.7998 160 -160 160s-160 -71.7998 -160 -160s71.7998 -160 160 -160z" />
|
1301 |
+
<glyph glyph-name="cloudsmith" unicode="" horiz-adv-x="332"
|
1302 |
+
d="M332.5 28.0996c0 -46.3994 -37.5996 -84.0996 -84 -84.0996s-84 37.7002 -84 84.0996c0 46.4004 37.5996 84 84 84s84 -37.5996 84 -84zM248.5 272c-46.4004 0 -80 -33.5996 -80 -80s-37.5996 -80 -84 -80s-84 33.5996 -84 80s37.5996 88 84 88s76 29.5996 76 76
|
1303 |
+
s41.5996 84 88 84s80 -37.5996 80 -84s-33.5996 -84 -80 -84z" />
|
1304 |
+
<glyph glyph-name="cloudversify" unicode="" horiz-adv-x="616"
|
1305 |
+
d="M148.6 144v-0.0996094h-48.8994c-6.40039 0 -11.7002 5.39941 -11.7002 11.7998v40.3994c0 7.60059 7 11.9004 10.7998 11.9004h46.7998v-6.59961c0 -10.7002 8.80078 -16.7002 19.5 -16.7002h20.2002c10.7998 0 19.5 8.7998 19.5 19.5v20.3994
|
1306 |
+
c0 10.6006 -3.5 19.5 -15.2002 19.5c18.5 15.2002 37.2002 21.4004 45 24.1006c15 56.5 42 92.3994 99.3008 109.7c55.0996 16.5 153.5 3.09961 186.5 -85c73.8994 -22.6006 106.899 -92.6006 92.0996 -155.101c-13 -54.8994 -62.2998 -100.6 -131.5 -99.5
|
1307 |
+
c-49.5996 -51.3994 -135.2 -48.8994 -186.4 -5.59961c-78.5996 -4.2002 -137.8 42.7998 -146 111.3zM376 136c8.7002 -54.0996 59.7002 -65.5 91.7998 -59.2002c39.1006 7.7002 70.5 37.5 79.7002 76.5c5.7998 24.4004 2.40039 50 -9.40039 72l-10.5 19.6006
|
1308 |
+
c1.2002 -22.5 -12.5 -60.6006 -47.5 -76.9004c65.5 67.7002 2.10059 141.2 -67.6992 150.5c-49.8008 6.59961 -83.3008 -13 -114.2 -43.7002c48 -4.7002 87.7002 -26.7998 101.8 -74.7998c-30.0996 49.2998 -103 56.5996 -133.6 40.7998
|
1309 |
+
c-35.5 -18.2002 -60 -54 -57 -93.8994c3.59961 -47.4004 39.5 -67.4004 57.3994 -79.8008c-4.5 21.7002 -4 71.3008 29.2002 92.9004c-36.2998 -60 28.0996 -144.6 135.3 -110.8c-33.5996 14.3994 -66 40.5 -55.2998 86.7998zM128 240h-39.7998
|
1310 |
+
c-8.90039 0 -16.2002 7.2998 -16.2002 16.2002v39.5996c0 8.90039 7.2998 16.2002 16.2002 16.2002h39.7998c8.90039 0 16.2002 -7.2998 16.2002 -16.2002v-39.5996c0 -8.90039 -7.2998 -16.2002 -16.2002 -16.2002zM10.0996 280c-5.59961 0 -10.0996 4.5 -10.0996 10.0996
|
1311 |
+
v27.8008c0 5.59961 4.5 10.0996 10.0996 10.0996h27.7002c5.5 0 10.1006 -4.5 10.1006 -10.0996v-27.8008c0 -5.59961 -4.5 -10.0996 -10.1006 -10.0996h-27.7002zM168 305.3v21.4004c0 5.09961 4.2002 9.2998 9.2998 9.2998h21.4004
|
1312 |
+
c5.09961 0 9.2998 -4.2002 9.2998 -9.2998v-21.4004c0 -5.09961 -4.2002 -9.2998 -9.2998 -9.2998h-21.4004c-5.09961 0 -9.2998 4.2002 -9.2998 9.2998zM56 212.5v-25c0 -6.2998 -5.09961 -11.5 -11.4004 -11.5h-25.1992c-6.30078 0 -11.4004 5.2002 -11.4004 11.5v25
|
1313 |
+
c0 6.2998 5.09961 11.5 11.4004 11.5h25.0996c6.40039 0 11.5 -5.2002 11.5 -11.5z" />
|
1314 |
+
<glyph glyph-name="cpanel" unicode="" horiz-adv-x="640"
|
1315 |
+
d="M210.3 227.8c6.60059 -29.0996 -14.5 -65.2998 -51.7002 -65.2998h-32l6.40039 23.7998c1.7998 6.2002 7.2998 10.7998 14.2998 10.7998h10.2998c12.4004 0 20.8008 11.7002 18.3008 22.6006c-2.10059 9.2002 -9.90039 14.7998 -18.3008 14.7998h-19.7998
|
1316 |
+
l-25.7998 -95.7002c-1.90039 -6.2002 -7.40039 -10.7002 -14.2002 -10.7002l-24.7002 -0.0996094l34.9004 130.1c1.7998 6.40039 7.2002 10.9004 14.2998 10.9004h37c24.1006 0 45.4004 -16.4004 51 -41.2002zM53.7998 199.8c-24.8994 0 -24.7002 -37.3994 0 -37.3994
|
1317 |
+
h11.2998c4.2002 0 7.60059 -3.90039 6.40039 -8.30078l-7.09961 -26.0996h-12.4004c-33.5 0 -59 31.4004 -50.2998 65.2002c7.2998 27 28.2998 41.0996 51.2002 41.0996h40l-6.2002 -23.5996c-1.90039 -6.5 -7.40039 -10.9004 -14.2998 -10.9004h-18.6006zM301.3 234.6
|
1318 |
+
c18.7998 0 33.2998 -17.5996 28.5 -36.7998l-14 -51.7998c-2.7998 -10.5996 -12.2002 -17.7998 -23.3994 -17.7998l-57.5 0.200195c-42.9004 0 -38.5 63.7998 0.699219 63.7998h48.4004l-3.5 -13.2002c-1.90039 -6.2002 -7.40039 -10.7998 -14.2002 -10.7998h-21.5996
|
1319 |
+
c-5.2998 0 -5.2998 -7.90039 0 -7.90039h34.8994c4.60059 0 5.10059 3.90039 5.5 5.2998l8.60059 31.8008c0.299805 1 1.89941 5.2998 -2.10059 5.2998h-57.5c-9.69922 0 -16.5996 8.89941 -14.1992 18.5l3.5 13.3994h77.8994zM633.1 269c4.5 0 7.7002 -4 6.5 -8.2998
|
1320 |
+
l-26.5 -98.2002c-5.09961 -20.7002 -24.1992 -34.5 -44.8994 -34.5l35.5996 133.1c1.2002 4.7002 5.5 7.90039 10.4004 7.90039h18.8994zM396.8 234.3c34.4004 0 59.2998 -32.2998 50.2998 -65.3994l-8.7998 -33.1006c-1.2002 -4.89941 -5.7002 -7.7998 -10.2998 -7.7998
|
1321 |
+
h-19.0996c-4.5 0 -7.60059 4 -6.40039 8.2998l10.5996 40c3.30078 11.6006 -5.59961 23.4004 -18.0996 23.4004h-19.7998l-17.2002 -64c-1.2002 -4.7998 -5.59961 -7.7998 -10.4004 -7.7998h-18.8994c-4.2002 0 -7.60059 3.89941 -6.40039 8.2998l26.2002 98h48.2998
|
1322 |
+
v0.0996094zM495.1 159.7h73.3008l-5.7002 -21c-1.90039 -6.2002 -7.40039 -10.7002 -14.2002 -10.7002h-66.7002c-20 0 -33.2998 19 -28.2998 36.7002l10.7998 40c4.7998 17.5996 20.7002 29.5996 38.6006 29.5996h47.2998c19 0 33.2002 -17.7002 28.2998 -36.7998
|
1323 |
+
l-3.2002 -12c-2.89941 -11 -12.7002 -17.5996 -23.2002 -17.5996h-53.3994l3.5 13c1.59961 6.19922 7.2002 10.7998 14.2002 10.7998h21.5996c2 0 3.2998 1 3.90039 3l0.699219 2.59961c0.700195 2.7002 -1.2998 5.10059 -3.89941 5.10059h-32.9004
|
1324 |
+
c-4.09961 0 -6.89941 -2.10059 -7.7998 -6l-8 -30c-0.900391 -3.30078 1.5 -6.7002 5.09961 -6.7002z" />
|
1325 |
+
<glyph glyph-name="css3-alt" unicode="" horiz-adv-x="384"
|
1326 |
+
d="M0 416h384l-34.9004 -395.8l-157.1 -52.2002l-157.1 52.2002zM313.1 336h-242.199l5.7998 -47.2998h122.899l-6.5 -2.7002l-112.1 -46.7002l3.59961 -46.2998l0.200195 0.0996094v-0.0996094l166.3 -0.5l-3.69922 -61.5996l-54.7002 -15.4004l-52.6006 13.2998
|
1327 |
+
l-3.19922 38.2998h-48.9004l6.40039 -73.8994l98.7998 -29.2002l98.2002 28.7002l12.7998 146.6h-111.5l0.299805 0.100586l115.3 49.2998z" />
|
1328 |
+
<glyph glyph-name="cuttlefish" unicode="" horiz-adv-x="440"
|
1329 |
+
d="M344 142.5c13.7002 -50.9004 41.7002 -93.2998 87 -117.8c-45.2998 -49.6006 -110.5 -80.7002 -183 -80.7002c-137 0 -248 111 -248 248s111 248 248 248c72.5 0 137.7 -31.0996 183 -80.7002c-45.2998 -24.5 -73.2998 -66.8994 -87 -117.8
|
1330 |
+
c-17.5 31.5996 -57.4004 54.5 -96 54.5c-56.5996 0 -104 -47.4004 -104 -104s47.4004 -104 104 -104c38.5996 0 78.5 22.9004 96 54.5z" />
|
1331 |
+
<glyph glyph-name="d-and-d" unicode="" horiz-adv-x="576"
|
1332 |
+
d="M82.5 349.1c-0.599609 17.2002 2 33.8008 12.7002 48.2002c0.299805 -7.39941 1.2002 -14.5 4.2002 -21.5996c5.89941 27.5 19.6992 49.2998 42.2998 65.5c-1.90039 -5.90039 -3.5 -11.7998 -3 -17.7002c8.7002 7.40039 18.7998 17.7998 44.3994 22.7002
|
1333 |
+
c14.7002 2.7998 29.7002 2 42.1006 -1c38.5 -9.2998 61 -34.2998 69.7002 -72.2998c5.2998 -23.1006 0.699219 -45 -8.30078 -66.4004c-5.19922 -12.4004 -12 -24.4004 -20.6992 -35.0996c-2 1.89941 -3.90039 3.7998 -5.80078 5.59961
|
1334 |
+
c-42.7998 40.7998 -26.7998 25.2002 -37.3994 37.4004c-1.10059 1.19922 -1 2.19922 -0.100586 3.59961c8.30078 13.5 11.8008 28.2002 10 44c-1.09961 9.7998 -4.2998 18.9004 -11.2998 26.2002c-14.5 15.2998 -39.2002 15 -53.5 -0.600586
|
1335 |
+
c-11.3994 -12.5 -14.0996 -27.3994 -10.8994 -43.5996c0.199219 -1.2998 0.399414 -2.7002 0 -3.90039c-3.40039 -13.6992 -4.60059 -27.5996 -2.5 -41.5996c0.0996094 -0.5 0.0996094 -1.09961 0.0996094 -1.59961c0 -0.300781 -0.0996094 -0.5 -0.200195 -1.10059
|
1336 |
+
c-21.7998 11 -36 28.2998 -43.2002 52.2002c-8.2998 -17.7998 -11.0996 -35.5 -6.59961 -54.0996c-15.5996 15.1992 -21.2998 34.2998 -22 55.1992zM552.1 225.9c0.5 -0.600586 1.2002 -1 1.7002 -1.40039v-0.5c-15 3.59961 -29.7998 1.7998 -44.5 -1.2998
|
1337 |
+
c-9.2998 -2 -18.2998 -4.7002 -26.7002 -9c-2.89941 -1.5 -5.69922 -3.2998 -8 -4.7002c-5.7998 2.40039 -11.2998 5.5 -17.1992 6.7998c-24.5 5.2998 -45.8008 -1.2002 -62.5 -20c-19.7002 -22.2002 -34.5 -47.5996 -46.7002 -74.5l-1.2002 -2.7002
|
1338 |
+
c-0.0996094 -0.199219 -0.200195 -0.299805 -0.400391 -0.399414c-12.0996 8.2998 -21.5996 20.2998 -36.0996 25.5996c0.299805 0.400391 0.400391 0.900391 0.700195 1.2998c20.5996 28.2002 44.8994 52.5 75.0996 70.4004c16 9.5 33 16.0996 51.5 18.5
|
1339 |
+
c1.7998 0.200195 3.5 0.400391 5.2998 1.09961c-4.39941 0 -8.7998 0.300781 -13.0996 -0.0996094c-21.2002 -1.90039 -40.5 -9.59961 -58.7002 -20.2002c-13.7998 -8 -26.2002 -17.7002 -36.5996 -29.7998c-0.400391 -0.5 -0.600586 -1.09961 -0.900391 -1.7002
|
1340 |
+
c-0.299805 0.299805 -0.700195 0.600586 -1 0.900391c11 30.8994 30.7002 55 57.7002 73.2998c0.200195 -0.200195 0.5 -0.299805 0.700195 -0.5c-1.2002 -1.7002 -2.5 -3.2998 -3.5 -5.09961c-1.7998 -3.30078 -3.7002 -6.5 -5.10059 -10
|
1341 |
+
c-1.7998 -4.30078 1.60059 -8.60059 12 -0.5c18.2002 14.0996 29.6006 26.2998 48.9004 29.5996c0.700195 0.0996094 1.2998 0.299805 1.90039 0.299805h2.5c-1 -0.700195 -1.60059 -1.09961 -2.2002 -1.5c-11.6006 -7.7998 -11.7998 -7.39941 -15 -12
|
1342 |
+
c-2.60059 -3.7002 -0.200195 -8 4.7002 -6.7998c2.59961 0.599609 5.19922 1.2998 7.69922 2.2002c9.40039 3.2998 19 5.7998 29 6.39941c13.9004 0.800781 27.1006 -1.89941 39.9004 -7.09961c15.0996 -6.2002 28.5 -15 40.0996 -26.5996zM316.7 50.4004
|
1343 |
+
c1.5 -1.30078 1.89941 -2.40039 0.899414 -4.2002c-25.2998 -50.2002 -61.0996 -89.1006 -116 -98.7998c-26.7998 -4.7002 -52.8994 -2.7002 -77.8994 8.59961c-18.5 8.2002 -34.6006 19.5996 -47.2002 35.5996c-2 2.60059 -3.7002 5.40039 -5.90039 8.60059
|
1344 |
+
c-0.699219 -7.7998 0.100586 -14.9004 1.5 -21.9004c-0.199219 -0.200195 -0.399414 -0.299805 -0.599609 -0.5c-3.2002 3.40039 -6.59961 6.60059 -9.5 10.2998c-12.2002 15.5 -19.5 33.3008 -24.0996 52.3008c-11.8008 48.2998 -0.5 78.7998 7.7998 101.1
|
1345 |
+
c-8.7002 -4.7998 -16.2002 -10.2998 -23.6006 -16.2002c11.6006 32.7998 31.9004 59.9004 56.1006 84.6006c2.39941 -2.10059 3.2998 -4.7002 3 -7.40039c-0.200195 -1 -5.90039 -38.9004 -5.60059 -44.7002c18.9004 18.9004 40.5 33.2998 64.8008 43.9004
|
1346 |
+
c-7.5 -11.1006 -11 -23.4004 -11.8008 -37.2998c13.4004 12.1992 27.7002 20.0996 46.4004 13.8994c-8.5 -9.09961 -30.7998 -30.5 -38.5996 -64.2998c-5.10059 -21.9004 -3.80078 -43.0996 8.19922 -62.5996c11.2002 -18.3008 27.8008 -27.8008 49.4004 -27.8008
|
1347 |
+
c12.5996 0 23.7998 5 34.0996 11.8008c18.5 12.2998 32.8008 28.5 44 47.5996c1.90039 3.2002 1.10059 2.09961 1.90039 3c19.9004 -16.0996 3.2998 -2.59961 42.7002 -35.5996zM488.7 96.7998c20.2002 -6.59961 35.5 -18.7998 43.7998 -38.8994
|
1348 |
+
c9.2002 -23.1006 2.09961 -49.4004 -17.4004 -66c-16.3994 -14 -35.6992 -19.2002 -57 -17.4004c-0.599609 0 -1.19922 0 -1.89941 -0.299805c15.0996 -10.7002 31.5996 -15.2002 50.8994 -10.6006c-2.19922 -2.39941 -3.89941 -4.69922 -5.89941 -6.5
|
1349 |
+
c-12.2998 -10.8994 -26.9004 -16.8994 -42.9004 -19.7998c-39.5996 -7.2998 -75.5996 12.7998 -85 56.9004c-0.5 2.09961 -0.599609 4.2002 -0.899414 6.39941c-10.8008 -8.19922 -16.4004 -34.0996 -0.700195 -52.2998c-1.60059 0.5 -2.60059 0.700195 -3.60059 1.10059
|
1350 |
+
c-21.2998 8.2998 -34.3994 28.2998 -33.5 51.1992c0.900391 23.2002 4.90039 41 -13 56c-16.5 13.8008 -33 27.4004 -49.5 41.1006c-8.09961 6.7002 -14.7998 14.5 -17 25.0996c-1 4.60059 -1.39941 9.40039 -1.7998 14.1006c-0.5 6.09961 -3.2998 11 -7.89941 14.7998
|
1351 |
+
c-4.5 3.89941 -9.30078 7.39941 -13.8008 11.2002c-8.89941 7.5 -12.2998 18.8994 -7.2998 29.8994c2.7998 -12.8994 9.60059 -18.8994 22.6006 -20.2998c4.39941 -0.5 8.89941 -0.799805 13.2998 -1.5c8.09961 -1.2002 12.7998 -6.09961 14.2998 -14.2002
|
1352 |
+
c0.700195 -3.39941 1.2998 -6.7998 2.2002 -10.2002c1.59961 -5.59961 4.5 -8 10.3994 -8.39941c4.60059 -0.299805 9.30078 -0.5 13.9004 -0.900391c7.59961 -0.599609 14.2002 -3.7998 20.0996 -8.7002c19.4004 -16.1992 39 -32.1992 58.5 -48.2998
|
1353 |
+
c5.7002 -4.7002 12 -8.2002 19.6006 -8.5c16.7002 -0.599609 29 15.2002 24.7998 31.7998c-0.200195 0.700195 -0.400391 1.5 -0.0996094 2.80078c2.39941 -2 4.89941 -3.80078 7 -5.90039c14.0996 -14 18.0996 -39.2998 8.69922 -56.0996
|
1354 |
+
c-2.09961 -3.80078 -5.2998 -7.10059 -8.09961 -10.8008c0.700195 -0.199219 1.7998 -0.5 3 -0.599609c14 -1.40039 27.2002 1 38.9004 9.09961c15.7998 10.9004 18 31.2002 5.39941 45.6006c-4.7002 5.39941 -8.89941 8 -18.7998 12
|
1355 |
+
c6.5 1.2998 19.2002 0.200195 28.7002 -2.90039zM99.4004 268.7c-5.30078 9.2002 -13.2002 15.5996 -22.1006 21.2998c13.7002 0.5 26.6006 -0.200195 39.6006 -3.7002c-7 12.2002 -8.5 24.7002 -5 38.7002c5.2998 -11.9004 13.6992 -20.0996 23.5996 -26.7998
|
1356 |
+
c19.7002 -13.2002 35.7002 -19.6006 46.7002 -30.2002c3.39941 -3.2998 6.2998 -7.09961 9.59961 -10.9004c-0.799805 2.10059 -1.39941 4.10059 -2.2002 6c-5 10.6006 -13 18.6006 -22.5996 25c-1.7998 1.2002 -2.7998 2.5 -3.40039 4.5
|
1357 |
+
c-3.2998 12.5 -3 25.1006 -0.699219 37.6006c1 5.5 2.7998 10.8994 4.5 16.2998c0.799805 2.40039 2.2998 4.59961 4 6.59961c0.599609 -6.89941 0 -25.5 19.5996 -46c10.7998 -11.2998 22.4004 -21.8994 33.9004 -32.6992c9 -8.5 18.2998 -16.7002 25.5 -26.8008
|
1358 |
+
c1.09961 -1.59961 2.19922 -3.2998 3.7998 -4.69922c-5 13 -14.2002 24.0996 -24.2002 33.7998c-9.59961 9.2998 -19.4004 18.3994 -29.2002 27.3994c-3.2998 3 -4.59961 6.7002 -5.09961 10.9004c-1.2002 10.4004 0 20.5996 4.2998 30.2002c0.5 1 1.09961 2 1.90039 3.2998
|
1359 |
+
c0.5 -4.2002 0.599609 -7.90039 1.39941 -11.5996c4.7998 -23.1006 20.4004 -36.3008 49.2998 -63.5c10 -9.40039 19.3008 -19.2002 25.6006 -31.6006c4.7998 -9.2998 7.2998 -19 5.7002 -29.5996c-0.100586 -0.600586 0.5 -1.7002 1.09961 -2
|
1360 |
+
c6.2002 -2.60059 10 -6.90039 9.7002 -14.2998c7.7002 2.59961 12.5 8 16.3994 14.5c4.2002 -20.2002 -9.09961 -50.3008 -27.1992 -58.7002c0.399414 4.5 5 23.3994 -16.5 27.7002c-6.80078 1.2998 -12.8008 1.2998 -22.9004 2.09961c4.7002 9 10.4004 20.5996 0.5 22.4004
|
1361 |
+
c-24.9004 4.59961 -52.7998 -1.90039 -57.7998 -4.60059c8.2002 -0.399414 16.2998 -1 23.5 -3.2998c-2 -6.5 -4 -12.7002 -5.7998 -18.9004c-1.90039 -6.5 2.09961 -14.5996 9.2998 -9.59961c1.2002 0.900391 2.2998 1.90039 3.2998 2.7002
|
1362 |
+
c-3.09961 -17.9004 -2.90039 -15.9004 -2.7998 -18.2998c0.299805 -10.2002 9.5 -7.80078 15.7002 -7.30078c-2.5 -11.7998 -29.5 -27.2998 -45.4004 -25.7998c7 4.7002 12.7002 10.2998 15.9004 17.9004c-6.5 -0.799805 -12.9004 -1.60059 -19.2002 -2.40039
|
1363 |
+
l-0.299805 0.900391c4.69922 3.39941 8 7.7998 10.1992 13.0996c8.7002 21.1006 -3.59961 38 -25 39.9004c-9.09961 0.799805 -17.7998 -0.799805 -25.8994 -5.5c6.2002 15.5996 17.2002 26.5996 32.5996 34.5c-15.2002 4.2998 -8.89941 2.7002 -24.5996 6.2998
|
1364 |
+
c14.5996 9.2998 30.2002 13.2002 46.5 14.5996c-5.2002 3.2002 -48.1006 3.60059 -70.2002 -20.8994c7.90039 -1.40039 15.5 -2.7998 23.2002 -4.2002c-23.7998 -7 -44 -19.7002 -62.4004 -35.5996c1.10059 4.7998 2.7002 9.5 3.2998 14.2998
|
1365 |
+
c0.600586 4.5 0.800781 9.2002 0.100586 13.5996c-1.5 9.40039 -8.90039 15.1006 -19.7002 16.2998c-7.90039 0.900391 -15.5996 -0.0996094 -23.2998 -1.2998c-0.900391 -0.0996094 -1.7002 -0.299805 -2.90039 0c15.7998 14.7998 36 21.7002 53.1006 33.5
|
1366 |
+
c6 4.5 6.7998 8.2002 3 14.9004zM227.8 241.9c3.2998 -16 12.6006 -25.5 23.7998 -24.3008c-4.59961 11.3008 -12.0996 19.5 -23.7998 24.3008z" />
|
1367 |
+
<glyph glyph-name="deploydog" unicode="" horiz-adv-x="512"
|
1368 |
+
d="M382.2 312h51.7002v-239.6h-51.7002v20.6992c-19.7998 -24.7998 -52.7998 -24.0996 -73.7998 -14.6992c-26.2002 11.6992 -44.3008 38.0996 -44.3008 71.7998c0 29.7998 14.8008 57.8994 43.3008 70.7998c20.1992 9.09961 52.6992 10.5996 74.7998 -12.9004v103.9z
|
1369 |
+
M317.5 150.2c0 -18.2002 13.5996 -33.5 33.2002 -33.5c19.7998 0 33.2002 16.3994 33.2002 32.8994c0 17.1006 -13.7002 33.2002 -33.2002 33.2002c-19.6006 0 -33.2002 -16.3994 -33.2002 -32.5996zM188.5 312h51.7002v-239.6h-51.7002v20.6992
|
1370 |
+
c-19.7998 -24.7998 -52.7998 -24.0996 -73.7998 -14.6992c-26.2002 11.6992 -44.2998 38.0996 -44.2998 71.7998c0 29.7998 14.7998 57.8994 43.2998 70.7998c20.2002 9.09961 52.7002 10.5996 74.7998 -12.9004v103.9zM123.8 150.2c0 -18.2002 13.6006 -33.5 33.2002 -33.5
|
1371 |
+
c19.7998 0 33.2002 16.3994 33.2002 32.8994c0 17.1006 -13.7002 33.2002 -33.2002 33.2002c-19.7002 0 -33.2002 -16.3994 -33.2002 -32.5996zM448 352h-384c-17.5996 0 -32 -14.5 -32 -32v-256c0 -17.5996 14.5 -32 32 -32h384c17.5996 0 32 14.5 32 32v256
|
1372 |
+
c0 17.5996 -14.5 32 -32 32zM448 384c35.2002 0 64 -28.7998 64 -64v-256c0 -35.2002 -28.7998 -64 -64 -64h-384c-35.2002 0 -64 28.7998 -64 64v256c0 35.2002 28.7998 64 64 64h384z" />
|
1373 |
+
<glyph glyph-name="deskpro" unicode="" horiz-adv-x="480"
|
1374 |
+
d="M205.9 -64l31.0996 38.4004c12.2998 0.199219 25.5996 1.39941 36.5 6.59961c38.9004 18.5996 38.4004 61.9004 38.2998 63.7998c-0.0996094 5 -0.799805 4.40039 -28.8994 37.4004h79.0996c-0.200195 -50.1006 -7.2998 -68.5 -10.2002 -75.7002
|
1375 |
+
c-9.39941 -23.7002 -43.8994 -62.7998 -95.2002 -69.4004c-8.69922 -1.09961 -32.7998 -1.19922 -50.6992 -1.09961zM406.3 103.7l-119.2 -0.100586l17.4004 31.3008l175.5 -0.300781c-15.2002 -17.2998 -35.0996 -30.8994 -73.7002 -30.8994zM362.7 327.6v-168.3h-73.5
|
1376 |
+
l-32.7002 -55.5h-6.5c-52.2998 0 -58.0996 56.5 -58.2998 58.9004c-1.2002 13.2002 -21.2998 11.5996 -20.1006 -1.7998c1.40039 -15.8008 8.80078 -40 26.4004 -57.1006h-91c-25.5 0 -110.8 26.7998 -107 114v213.3c0 16 9.7002 16.6006 15 16.8008h82
|
1377 |
+
c0.200195 0 0.299805 -0.100586 0.5 -0.100586c4.2998 0.400391 50.0996 2.10059 50.0996 -43.7002c0 -13.2998 20.2002 -13.3994 20.2002 0c0 18.2002 -5.5 32.8008 -15.7998 43.7002h84.2002c108.7 0.400391 126.5 -79.3994 126.5 -120.2zM230.2 271.6l64 -29.2998
|
1378 |
+
c13.2998 45.5 -42.2002 71.7002 -64 29.2998z" />
|
1379 |
+
<glyph glyph-name="digital-ocean" unicode="" horiz-adv-x="512"
|
1380 |
+
d="M87 -33.7998v73.5996h73.7002v-73.5996h-73.7002zM25.4004 101.4h61.5996v-61.6006h-61.5996v61.6006zM491.6 271.1c53.2002 -170.3 -73 -327.1 -235.6 -327.1v95.7998h0.299805v0.299805c101.7 0.200195 180.5 101 141.4 208
|
1381 |
+
c-14.2998 39.6006 -46.1006 71.4004 -85.7998 85.7002c-107.101 38.7998 -208.101 -39.8994 -208.101 -141.7h-95.7998c0 162.2 156.9 288.7 327 235.601c74.2002 -23.2998 133.6 -82.4004 156.6 -156.601zM256.3 40.0996h-0.299805v-0.299805h-95.2998v95.6006h95.5996
|
1382 |
+
v-95.3008z" />
|
1383 |
+
<glyph glyph-name="discord" unicode=""
|
1384 |
+
d="M297.216 204.8c0 -15.6162 -11.5195 -28.416 -26.1123 -28.416c-14.3359 0 -26.1113 12.7998 -26.1113 28.416s11.5195 28.416 26.1113 28.416c14.5928 0 26.1123 -12.7998 26.1123 -28.416zM177.664 233.216c14.5918 0 26.3682 -12.7998 26.1123 -28.416
|
1385 |
+
c0 -15.6162 -11.5205 -28.416 -26.1123 -28.416c-14.3359 0 -26.1123 12.7998 -26.1123 28.416s11.5205 28.416 26.1123 28.416zM448 395.264v-459.264c-64.4941 56.9941 -43.8682 38.1279 -118.784 107.776l13.5684 -47.3604h-290.304
|
1386 |
+
c-28.9287 0 -52.4805 23.5518 -52.4805 52.7363v346.111c0 29.1846 23.5518 52.7363 52.4805 52.7363h343.039c28.9287 0 52.4805 -23.5518 52.4805 -52.7363zM375.04 152.576c0 82.4316 -36.8643 149.248 -36.8643 149.248
|
1387 |
+
c-36.8643 27.6475 -71.9355 26.8799 -71.9355 26.8799l-3.58398 -4.0957c43.5195 -13.3125 63.7441 -32.5127 63.7441 -32.5127c-60.8115 33.3291 -132.244 33.335 -191.232 7.42383c-9.47168 -4.35156 -15.1035 -7.42383 -15.1035 -7.42383
|
1388 |
+
s21.2471 20.2246 67.3271 33.5361l-2.55957 3.07227s-35.0723 0.767578 -71.9355 -26.8799c0 0 -36.8643 -66.8164 -36.8643 -149.248c0 0 21.5039 -37.1201 78.0801 -38.9121c0 0 9.47168 11.5195 17.1514 21.248c-32.5117 9.72754 -44.7998 30.208 -44.7998 30.208
|
1389 |
+
c3.7666 -2.63574 9.97656 -6.05273 10.4961 -6.40039c43.21 -24.1973 104.588 -32.126 159.744 -8.95996c8.95996 3.32812 18.9443 8.19238 29.4395 15.1045c0 0 -12.7998 -20.9922 -46.3359 -30.4639c7.68066 -9.72852 16.8965 -20.7363 16.8965 -20.7363
|
1390 |
+
c56.5762 1.79199 78.3359 38.9121 78.3359 38.9121z" />
|
1391 |
+
<glyph glyph-name="discourse" unicode=""
|
1392 |
+
d="M225.9 416c122.699 0 222.1 -102.3 222.1 -223.9c0 -121.6 -99.4004 -223.899 -222.1 -223.899l-225.801 -0.200195s-0.0996094 224 -0.0996094 227.9c0 121.6 103.3 220.1 225.9 220.1zM224 64c70.7002 0 128 57.2998 128 128s-57.2998 128 -128 128
|
1393 |
+
s-128 -57.2998 -128 -128c0 -22.0996 5.59961 -42.9004 15.4004 -61l-22.9004 -75l81.0996 20.0996c16.5 -7.7998 35 -12.0996 54.4004 -12.0996z" />
|
1394 |
+
<glyph glyph-name="dochub" unicode="" horiz-adv-x="416"
|
1395 |
+
d="M397.9 288h-141.9v140.4zM304 256h96v-126.1c0 -129.301 -70.2998 -193.9 -210.8 -193.9h-189.2v512h189.2c12.2002 0 23.7002 -1.09961 34.5996 -3.2998v-84c-10 1.7002 -21.0996 2.5 -33.0996 2.5h-94.7002v-337.3h94.7002c76.7998 0 113.3 33.2998 113.3 100.1v130z
|
1396 |
+
" />
|
1397 |
+
<glyph glyph-name="docker" unicode="" horiz-adv-x="640"
|
1398 |
+
d="M349.9 211.7h-66.1006v59.3994h66.1006v-59.3994zM349.9 416v-60.7002h-66.1006v60.7002h66.1006zM428.1 271.2v-59.4004h-66.0996v59.4004h66.0996zM271.8 343.3v-60.0996h-66.0996v60.0996h66.0996zM349.9 343.3v-60.0996h-66.1006v60.0996h66.1006zM626.7 243.3
|
1399 |
+
l13.2998 -8.89941c-1.90039 -3.90039 -7 -14.6006 -8.5 -17.1006c-23.7002 -45.2998 -69.9004 -45.5996 -91.2998 -45.2002c-54.5 -131.699 -171 -204.199 -328.4 -204.199c-72.7002 0 -128.3 22.2998 -165.399 66.1992c-38.2002 45.3008 -52.7002 111.301 -44 162.101
|
1400 |
+
h434.699c22.6006 -0.400391 39.7002 6 48.4004 10.7002c-19.7002 30.1992 -14.7002 76 3.7002 103.8l9.2998 14l14 -9.2998c24.4004 -18.8008 37.7998 -39.7002 41.0996 -63.7002c25.5 4.7998 58.7002 1.2998 73.1006 -8.40039zM115.6 271.2h0.100586v-59.4004h-66.1006
|
1401 |
+
v59.4004h66zM193.7 271.2v-59.4004h-66.1006v59.4004h66.1006zM271.8 271.2v-59.4004h-66.0996v59.4004h66.0996zM193.7 343.3v-60.0996h-66.1006v60.0996h66.1006z" />
|
1402 |
+
<glyph glyph-name="draft2digital" unicode="" horiz-adv-x="480"
|
1403 |
+
d="M480 49.9004l-144 -81.9004v64.2002l-336 -0.100586c18.2998 19.1006 84.5 87.8008 161.1 174.801c32.6006 37.1992 78 83.2998 69.7002 127.6c-5.2998 28.2998 -42.2002 50.7998 -83.2998 33.5c-8.59961 -3.59961 -24.5 -17.4004 -26.2998 -24.7002
|
1404 |
+
c28.2998 -4.7002 48 -29.7002 48 -56.7998c0 -31.7002 -25.6006 -57.4004 -57.2998 -57.4004c-37.3008 0 -62.2002 34.1006 -56.7002 67.1006c1.2002 7.89941 5.09961 26.7998 18.2002 47.7002c14.8994 23.8994 45.1992 54.8994 104.3 67.2998
|
1405 |
+
c103.8 21.7002 161.6 -36.6006 166 -41.2002c28.8994 -29.9004 48 -90.7002 12.7998 -153.3c-30 -53.4004 -81 -114.3 -111.8 -149.3h91.2998v64.6992zM369.9 77v-54.4004l47.0996 27.2002zM134.2 286.6c0 12.3008 -10 22.4004 -22.4004 22.4004
|
1406 |
+
c-12.3994 0 -22.3994 -10 -22.3994 -22.4004c0 -12.3994 10 -22.3994 22.3994 -22.3994c12.4004 0 22.4004 10 22.4004 22.3994zM82.5 67.5h114.4c17.5996 19.2002 91.5 100.8 128.5 166.7c36.5996 65.0996 -5.80078 113.3 -5.80078 113.3
|
1407 |
+
c-14.1992 14.9004 -36.8994 36.2002 -82.1992 38.2998c6.7998 -5.5 16.8994 -16.8994 24.2998 -35.7002c11.8994 -30.2998 6.7002 -69.5996 -28.4004 -112.699c-53.0996 -65.2002 -125.2 -142.5 -150.8 -169.9z" />
|
1408 |
+
<glyph glyph-name="dribbble-square" unicode=""
|
1409 |
+
d="M90.2002 219.8c8.89941 42.4004 37.3994 77.7002 75.7002 95.7002c3.59961 -4.90039 28 -38.7998 50.6992 -79c-64 -17 -120.3 -16.7998 -126.399 -16.7002zM314.6 294c-2.5 -3.5 -23 -31.0996 -71.5996 -49.4004c-22.4004 41.1006 -47.2002 74.9004 -51 80
|
1410 |
+
c43.2998 10.5 89 -0.799805 122.6 -30.5996zM140.1 84c14.3008 29.2002 53 66.7998 108.101 85.5996c19.2002 -49.7998 27.2002 -91.5996 29.2002 -103.6c-44 -18.7002 -96.8008 -13.5996 -137.301 18zM238.9 192.2c-49.4004 -13.9004 -94.3008 -53.9004 -116.5 -91.7998
|
1411 |
+
c-21.8008 24.2998 -35.1006 56.2998 -35.1006 91.3994c0 1.40039 0.100586 2.7998 0.100586 4.2002c6 -0.200195 72.1992 -1 140.399 19.4004c3.90039 -7.7002 7.7002 -15.4004 11.1006 -23.2002zM273.8 175.9c42.7998 6.89941 80.5 -4.30078 85.1006 -5.80078
|
1412 |
+
c-6.10059 -38 -27.9004 -70.8994 -58.6006 -91.5996c-1.39941 8.2998 -8.59961 48.2998 -26.5 97.4004zM253.5 224.3c50.5 20.7002 73.4004 50 76.2998 53.9004c19.1006 -23.2002 30.6006 -52.7998 30.9004 -85.1006c-4.5 1 -49.7002 10.1006 -95.2002 4.40039
|
1413 |
+
c-3.7002 9 -7.2002 17 -12 26.7998zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM384 192c0 88.2002 -71.7998 160 -160 160s-160 -71.7998 -160 -160s71.7998 -160 160 -160
|
1414 |
+
s160 71.7998 160 160z" />
|
1415 |
+
<glyph glyph-name="dyalog" unicode="" horiz-adv-x="416"
|
1416 |
+
d="M0 416h171.2c74.5 0 137.7 -24 182.5 -69.5996c40.2002 -40.9004 62.2998 -95.6006 62.2998 -154.301c0 -111.399 -84.0996 -224.1 -244.8 -224.1h-171.2v64h171.2c122.2 0 180.8 84 180.8 160.1c0 79.7002 -67.4004 159.9 -180.8 159.9h-107.2v-55.2002h-64v119.2z" />
|
1417 |
+
<glyph glyph-name="earlybirds" unicode="" horiz-adv-x="480"
|
1418 |
+
d="M313.2 400.5c1.2002 13 21.2998 14 36.5996 8.7002c0.900391 -0.299805 26.2002 -9.7002 19 -15.2002c-27.8994 7.40039 -56.3994 -18.2002 -55.5996 6.5zM112.2 393.6c-7.7998 6.2002 19.8994 16.4004 20.8994 16.7002c16.8008 5.7002 38.9004 4.60059 40.2002 -9.59961
|
1419 |
+
c0.900391 -27.1006 -30.3994 1 -61.0996 -7.10059zM319.4 288c8.7998 0 16 -7.2002 16 -16s-7.2002 -16 -16 -16c-8.80078 0 -16 7.2002 -16 16s7.19922 16 16 16zM159.7 288c8.7998 0 16 -7.2002 16 -16s-7.2002 -16 -16 -16s-16 7.2002 -16 16s7.2002 16 16 16z
|
1420 |
+
M478.2 124.8c-9.90039 -24 -40.7002 -11 -63.9004 1.2002c-13.5 -69.0996 -58.0996 -111.4 -126.3 -124.2c0.299805 -0.899414 -2 0.100586 24 -1c33.5996 -1.39941 63.7998 3.10059 97.4004 8c-19.8008 13.7998 -11.4004 37.1006 -9.80078 38.1006
|
1421 |
+
c1.40039 0.899414 14.7002 -1.7002 21.6006 -11.5c8.59961 12.5 28.3994 14.7998 30.2002 13.5996c1.59961 -1.09961 6.59961 -20.9004 -6.90039 -34.5996c4.7002 0.899414 8.2002 1.59961 9.7998 2.09961c2.60059 0.799805 17.7002 -11.2998 3.10059 -13.2998
|
1422 |
+
c-14.3008 -2.2998 -22.6006 -5.10059 -47.1006 -10.7998c-45.8994 -10.7002 -85.8994 -11.8008 -117.7 -12.8008l1 -11.5996c3.80078 -18.0996 -23.3994 -24.2998 -27.5996 -6.2002c0.799805 -17.8994 -27.0996 -21.7998 -28.4004 1l-0.5 -5.2998
|
1423 |
+
c-0.699219 -18.4004 -28.3994 -17.9004 -28.2998 0.599609c-7.5 -13.5 -28.0996 -6.7998 -26.3994 8.5l1.19922 12.4004c-36.6992 -0.900391 -59.6992 -3.09961 -61.7998 -3.09961c-20.8994 0 -20.8994 31.5996 0 31.5996c2.40039 0 27.7002 -1.2998 63.2002 -2.7998
|
1424 |
+
c-61.0996 15.5 -103.7 55 -114.9 118.2c-25 -12.8008 -57.5 -26.8008 -68.1992 -0.800781c-10.5 25.4004 21.5 42.6006 66.7998 73.4004c0.700195 6.59961 1.59961 13.2998 2.7002 19.7998c-14.4004 19.6006 -11.6006 36.2998 -16.1006 60.4004
|
1425 |
+
c-16.7998 -2.40039 -23.2002 9.09961 -23.5996 23.0996c0.299805 7.2998 2.09961 14.9004 2.39941 15.4004c1.10059 1.7998 10.1006 2 12.7002 2.59961c6 31.7002 50.6006 33.2002 90.9004 34.5c19.7002 21.7998 45.2002 41.5 80.8994 48.2998
|
1426 |
+
c-15.2998 19.4004 -3.39941 39.9004 -2.39941 40.4004c1.7002 0.799805 21.2002 -4.2998 26.2998 -23.2002c5.2002 8.7998 18.2998 11.4004 19.5996 10.7002c1.10059 -0.599609 6.40039 -15 -4.89941 -25.9004c40.2998 -3.5 72.2002 -24.6992 96 -50.6992
|
1427 |
+
c36.0996 -1.5 71.7998 -5.90039 77.0996 -34c2.7002 -0.600586 11.6006 -0.800781 12.7002 -2.60059c0.299805 -0.5 2.09961 -8.09961 2.40039 -15.3994c-0.5 -13.9004 -6.80078 -25.4004 -23.6006 -23.1006c-3.2002 -17.2998 -2.7002 -32.8994 -8.7002 -47.7002
|
1428 |
+
c2.40039 -11.6992 4 -23.7998 4.80078 -36.3994c37 -25.4004 70.2998 -42.5 60.2998 -66.9004zM207.4 288.1c0.899414 44 -37.9004 42.2002 -78.6006 40.3008c-21.7002 -1 -38.8994 -1.90039 -45.5 -13.9004c-11.3994 -20.9004 5.90039 -92.9004 23.2002 -101.2
|
1429 |
+
c9.7998 -4.7002 73.4004 -7.89941 86.2998 7.10059c8.2002 9.39941 15 49.3994 14.6006 67.6992zM259.4 229.8c-4.30078 12.4004 -6 30.1006 -15.3008 32.7002c-2 0.5 -9 0.5 -11 0c-10 -2.7998 -10.7998 -22.0996 -17 -37.2002c15.4004 0 19.3008 -9.7002 23.7002 -9.7002
|
1430 |
+
c4.2998 0 6.2998 11.3008 19.6006 14.2002zM395.1 314.5c-6.59961 12.0996 -24.7998 12.9004 -46.5 13.9004c-40.1992 1.89941 -78.1992 3.7998 -77.2998 -40.3008c-0.5 -18.2998 5 -58.2998 13.2002 -67.7998c13 -14.8994 76.5996 -11.7998 86.2998 -7.09961
|
1431 |
+
c15.7998 7.59961 36.5 78.8994 24.2998 101.3z" />
|
1432 |
+
<glyph glyph-name="erlang" unicode="" horiz-adv-x="640"
|
1433 |
+
d="M87.2002 394.5c-41.5 -50.2002 -65.6006 -116.2 -65.5 -192.9c-0.100586 -86.7998 29 -159.5 78.7002 -212.1h-100.4v405h87.2002zM325.4 384.8c46.1992 -0.0996094 79.5996 -33.5 80.6992 -83.2002h-169.899c4.09961 49.7002 43.2998 83.1006 89.2002 83.2002z
|
1434 |
+
M556.1 394.4h0.300781l-0.100586 0.0996094zM556.4 394.4h83.5996v-405h-80.7998c21.3994 23 40.5 49.8994 57.8994 80.7998l-96.3994 48.2002c-33.9004 -55.1006 -83.4004 -105.801 -151.9 -106.101c-99.7002 0.400391 -138.8 85.6006 -138.6 195.3h372.399
|
1435 |
+
c0.5 12.4004 0.5 18.1006 0 24.1006c2.5 65.2002 -14.7998 120 -46.1992 162.7z" />
|
1436 |
+
<glyph glyph-name="facebook-f" unicode="" horiz-adv-x="320"
|
1437 |
+
d="M279.14 160h-74.6895v-224h-100.17v224h-81.3906v92.6602h81.3906v70.6201c0 80.3398 47.8594 124.72 121.08 124.72c35.0693 0 71.75 -6.25977 71.75 -6.25977v-78.8906h-40.4199c-39.8203 0 -52.2402 -24.71 -52.2402 -50.0596v-60.1299h88.9102z" />
|
1438 |
+
<glyph glyph-name="facebook-messenger" unicode="" horiz-adv-x="512"
|
1439 |
+
d="M256.55 440c140.04 0 247.45 -102.34 247.45 -240.57c0 -175.13 -166.15 -273.229 -319.44 -231.04c-8.96973 2.44043 -9.64941 0.600586 -62.5596 -22.6992c-2.10449 -0.918945 -5.67578 -1.66504 -7.97168 -1.66504c-10.624 0 -19.543 8.61719 -19.9082 19.2344
|
1440 |
+
c-1.41992 46.3701 0.299805 50.7207 -8.0498 58.2305c-48.3604 43.1602 -78.0703 105.64 -78.0703 177.939c0 138.23 108.52 240.57 248.55 240.57zM405.79 254.87c7.0498 11.0801 -6.65039 23.5996 -17.0898 15.6201l-78.4102 -59.3799
|
1441 |
+
c-2.20801 -1.65625 -6.24023 -3 -9 -3s-6.79199 1.34375 -9 3l-58.0596 43.46c-5.48926 4.09961 -15.5049 7.42676 -22.3564 7.42676c-11.3438 0 -25.4805 -7.77637 -31.5537 -17.3574l-73 -115.569c-7.05078 -11.0703 6.64941 -23.6006 17.1094 -15.6699l78.3701 59.4395
|
1442 |
+
c2.20801 1.65625 6.24023 3 9 3s6.79199 -1.34375 9 -3l58.0801 -43.4697c5.48926 -4.09766 15.5039 -7.42285 22.3535 -7.42285c11.3428 0 25.4805 7.77441 31.5566 17.3525z" />
|
1443 |
+
<glyph glyph-name="firstdraft" unicode="" horiz-adv-x="384"
|
1444 |
+
d="M384 256h-64v-128h-128v-128h-192v25.5996h166.4v128h128v128h89.5996v-25.5996zM358.4 217.6h25.5996v-153.6h-128v-128h-192v25.5996h166.4v128h128v128zM384 25.5996v-25.5996h-64v-64h-25.5996v89.5996h89.5996zM0 448h384v-128h-128v-128h-128v-128h-128v384z" />
|
1445 |
+
<glyph glyph-name="fonticons-fi" unicode="" horiz-adv-x="384"
|
1446 |
+
d="M114.4 224h92.3994l-15.2002 -51.2002h-76.3994v-157.8c0 -8 -2.7998 -9.2002 4.39941 -10l59.6006 -5.59961v-34.4004h-179.2v35.2002l29.2002 2.7998c7.2002 0.799805 9.2002 3.2002 9.2002 10.7998v155.8c0 3.2002 -4 3.2002 -8 3.2002h-30.4004v51.2002h38.4004
|
1447 |
+
v28.7998c0 68 36.3994 96 106 96c46.7998 0 88.7998 -11.2002 88.7998 -72.3994l-69.6006 -8.40039c0.400391 25.5996 -6 31.5996 -22.3994 31.5996c-25.2002 0 -26 -13.5996 -26 -37.5996v-32c0 -3.2002 -4.7998 -6 -0.799805 -6zM384 -35h-140.8v34.4004l28 3.59961
|
1448 |
+
c7.2002 0.799805 10.3994 2.40039 10.3994 10v148c0 5.59961 -4 9.2002 -9.19922 10.7998l-33.2002 8.7998l9.2002 40.4004h110v-208c0 -8 -3.60059 -8.7998 4 -10l21.5996 -3.59961v-34.4004zM354 312.2l12.4004 -45.6006l-10 -10l-42.8008 22.8008l-42.7998 -22.8008
|
1449 |
+
l-10 10l12.4004 45.6006l-30 36.3994l4.7998 10h38l21.2002 38.4004h12.7998l21.2002 -38.4004h38l4.7998 -13.1992z" />
|
1450 |
+
<glyph glyph-name="fort-awesome-alt" unicode="" horiz-adv-x="512"
|
1451 |
+
d="M208 210.6c2.09961 0 3.7002 -1.59961 3.7002 -3.69922v-51.7002c0 -2.10059 -1.60059 -3.7002 -3.7002 -3.7002h-22.2002c-2.09961 0 -3.7002 1.59961 -3.7002 3.7002v51.7002c0 2.09961 1.60059 3.69922 3.7002 3.69922h22.2002zM326.2 210.6
|
1452 |
+
c2 0 3.59961 -1.59961 3.7002 -3.69922v-51.7002c0 -2.10059 -1.60059 -3.7002 -3.7002 -3.7002h-22.2002c-2.09961 0 -3.7002 1.59961 -3.7002 3.7002v51.7002c0 2.09961 1.60059 3.69922 3.7002 3.69922h22.2002zM458.2 335.7
|
1453 |
+
c28.8994 -40.7002 45.7998 -90.2002 45.7998 -143.7c0 -2 0 -4 -0.0996094 -6c0 -0.700195 0 -1.2998 -0.100586 -2c0 -1.2998 -0.0996094 -2.7002 -0.200195 -4c0 -0.799805 -0.0996094 -1.5 -0.0996094 -2.2998
|
1454 |
+
c-0.0996094 -1.2002 -0.0996094 -2.40039 -0.200195 -0.700195c-0.0996094 -0.799805 -0.0996094 -1.59961 -0.200195 -2.40039c-0.0996094 -1.19922 -0.199219 -2.39941 -0.299805 -3.5c-0.0996094 -0.799805 -0.200195 -1.59961 -0.200195 -2.39941
|
1455 |
+
c-0.0996094 -1.2002 -0.299805 -2.40039 -0.399414 -3.60059c-0.100586 -0.799805 -0.200195 -1.5 -0.299805 -2.2998c-0.200195 -1.2998 -0.400391 -2.59961 -0.5 -3.89941c-0.100586 -0.600586 -0.200195 -1.30078 -0.300781 -1.90039l-0.899414 -5.7002
|
1456 |
+
c-0.100586 -0.599609 -0.200195 -1.09961 -0.299805 -1.7002c-0.200195 -1.2998 -0.5 -2.69922 -0.800781 -4c-0.199219 -0.799805 -0.299805 -1.59961 -0.5 -2.39941c-0.199219 -1.10059 -0.5 -2.2002 -0.699219 -3.2002
|
1457 |
+
c-0.200195 -0.900391 -0.400391 -1.7002 -0.600586 -2.59961c-0.200195 -1 -0.5 -2 -0.700195 -3c-0.199219 -0.900391 -0.5 -1.80078 -0.699219 -2.7002c-0.300781 -1 -0.5 -1.90039 -0.800781 -2.90039c-0.199219 -0.899414 -0.5 -1.7998 -0.799805 -2.7002
|
1458 |
+
c-0.299805 -0.899414 -0.599609 -1.89941 -0.799805 -2.7998c-0.299805 -0.899414 -0.5 -1.7998 -0.799805 -2.7002c-0.299805 -0.899414 -0.600586 -1.7998 -0.900391 -2.7998c-0.5 -1.59961 -1.09961 -3.2998 -1.7002 -4.89941
|
1459 |
+
c-0.299805 -0.900391 -0.599609 -1.80078 -1 -2.80078c-0.399414 -1 -0.699219 -2 -1.09961 -3c-0.299805 -0.799805 -0.599609 -1.5 -0.900391 -2.2998l-1.19922 -3c-0.300781 -0.700195 -0.600586 -1.5 -0.900391 -2.2002c-0.400391 -1 -0.799805 -2 -1.2998 -3
|
1460 |
+
l-0.900391 -2.09961c-0.399414 -1 -0.899414 -2 -1.39941 -3c-0.300781 -0.700195 -0.600586 -1.2998 -0.900391 -2c-0.5 -1 -1 -2.09961 -1.5 -3.09961c-0.299805 -0.600586 -0.599609 -1.10059 -0.799805 -1.7002c-0.600586 -1.10059 -1.10059 -2.2002 -1.7002 -3.2998
|
1461 |
+
c-0.0996094 -0.200195 -0.200195 -0.300781 -0.299805 -0.5c-2.2002 -4.10059 -4.40039 -8.2002 -6.7998 -12.2002c-0.200195 -0.400391 -0.5 -0.799805 -0.700195 -1.2002c-0.700195 -1.09961 -1.2998 -2.2002 -2 -3.2998
|
1462 |
+
c-0.299805 -0.5 -0.600586 -0.900391 -0.900391 -1.40039c-0.700195 -1.09961 -1.39941 -2.09961 -2 -3.2002c-0.299805 -0.5 -0.599609 -0.899414 -0.899414 -1.39941c-0.700195 -1.10059 -1.40039 -2.10059 -2.10059 -3.2002
|
1463 |
+
c-0.299805 -0.400391 -0.599609 -0.799805 -0.799805 -1.2002c-0.799805 -1.09961 -1.5 -2.2002 -2.2998 -3.2998c-0.200195 -0.200195 -0.299805 -0.5 -0.5 -0.700195c-37.6006 -54.7002 -94.5 -91.3994 -160.101 -102.399
|
1464 |
+
c-0.899414 -0.100586 -1.69922 -0.300781 -2.59961 -0.400391c-1 -0.200195 -2.09961 -0.299805 -3.09961 -0.5c-0.900391 -0.0996094 -1.80078 -0.299805 -2.80078 -0.400391c-1 -0.0996094 -2 -0.299805 -3 -0.399414c-1 -0.100586 -2 -0.200195 -2.89941 -0.299805
|
1465 |
+
c-1 -0.100586 -1.90039 -0.200195 -2.90039 -0.300781c-1 -0.0996094 -2.09961 -0.199219 -3.09961 -0.299805c-0.900391 -0.0996094 -1.7998 -0.200195 -2.7002 -0.200195c-1.09961 -0.0996094 -2.2998 -0.0996094 -3.40039 -0.199219
|
1466 |
+
c-0.799805 0 -1.69922 -0.100586 -2.5 -0.100586c-1.2998 -0.0996094 -2.59961 -0.0996094 -3.89941 -0.0996094c-0.700195 0 -1.40039 -0.100586 -2.10059 -0.100586c-2 0 -4 -0.0996094 -6 -0.0996094s-4 0 -6 0.0996094c-0.699219 0 -1.39941 0 -2.09961 0.100586
|
1467 |
+
c-1.2998 0 -2.59961 0.0996094 -3.90039 0.0996094c-0.799805 0 -1.69922 0.100586 -2.5 0.100586c-1.09961 0.0996094 -2.2998 0.0996094 -3.39941 0.199219c-0.900391 0.100586 -1.7998 0.100586 -2.7002 0.200195c-1 0.100586 -2.09961 0.200195 -3.09961 0.299805
|
1468 |
+
c-1 0.100586 -1.90039 0.200195 -2.90039 0.300781c-1 0.0996094 -2 0.199219 -2.90039 0.299805c-1 0.0996094 -2 0.200195 -3 0.399414c-0.899414 0.100586 -1.7998 0.300781 -2.7998 0.400391s-2.09961 0.299805 -3.09961 0.5
|
1469 |
+
c-0.900391 0.0996094 -1.7002 0.299805 -2.60059 0.400391c-65.5996 10.8994 -122.5 47.6992 -160 99.3994c-0.199219 0.200195 -0.299805 0.5 -0.5 0.700195c-0.799805 1.09961 -1.59961 2.2002 -2.2998 3.2998c-0.299805 0.400391 -0.599609 0.799805 -0.799805 1.2002
|
1470 |
+
c-0.700195 1.09961 -1.40039 2.09961 -2.09961 3.2002c-0.300781 0.5 -0.600586 0.899414 -0.900391 1.39941c-0.700195 1.10059 -1.40039 2.10059 -2 3.2002c-0.299805 0.5 -0.599609 0.900391 -0.900391 1.40039c-0.699219 1.09961 -1.2998 2.2002 -2 3.2998
|
1471 |
+
c-0.199219 0.400391 -0.5 0.799805 -0.699219 1.2002c-2.40039 4 -4.60059 8.09961 -6.80078 12.2002c-0.0996094 0.199219 -0.199219 0.299805 -0.299805 0.5c-0.599609 1.09961 -1.09961 2.19922 -1.7002 3.2998c-0.299805 0.599609 -0.599609 1.09961 -0.799805 1.7002
|
1472 |
+
c-0.5 1 -1 2.09961 -1.5 3.09961c-0.299805 0.700195 -0.599609 1.2998 -0.899414 2c-0.5 1 -0.900391 2 -1.40039 3l-0.900391 2.09961c-0.399414 1 -0.899414 2 -1.2998 3c-0.299805 0.700195 -0.599609 1.5 -0.899414 2.2002l-1.2002 3
|
1473 |
+
c-0.299805 0.799805 -0.600586 1.5 -0.900391 2.2998c-0.399414 1 -0.799805 2 -1.09961 3c-0.299805 0.900391 -0.600586 1.80078 -1 2.80078c-0.600586 1.59961 -1.10059 3.2998 -1.7002 4.89941c-0.299805 0.900391 -0.599609 1.7998 -0.900391 2.7998
|
1474 |
+
c-0.299805 0.900391 -0.5 1.80078 -0.799805 2.7002c-0.299805 0.900391 -0.599609 1.90039 -0.799805 2.7998c-0.299805 0.900391 -0.5 1.80078 -0.799805 2.7002c-0.299805 1 -0.5 1.90039 -0.799805 2.90039c-0.200195 0.899414 -0.5 1.7998 -0.700195 2.7002
|
1475 |
+
c-0.299805 1 -0.5 2 -0.700195 3c-0.200195 0.899414 -0.400391 1.69922 -0.599609 2.59961c-0.200195 1.09961 -0.5 2.2002 -0.700195 3.2002c-0.200195 0.799805 -0.299805 1.59961 -0.5 2.39941c-0.299805 1.30078 -0.5 2.7002 -0.799805 4
|
1476 |
+
c-0.100586 0.600586 -0.200195 1.10059 -0.300781 1.7002l-0.899414 5.7002c-0.100586 0.599609 -0.200195 1.2998 -0.299805 1.90039c-0.200195 1.2998 -0.400391 2.59961 -0.5 3.89941c-0.100586 0.799805 -0.200195 1.5 -0.300781 2.2998
|
1477 |
+
c-0.0996094 1.2002 -0.299805 2.40039 -0.399414 3.60059c-0.100586 0.799805 -0.200195 1.59961 -0.200195 2.39941c-0.0996094 1.2002 -0.200195 2.40039 -0.299805 3.5c-0.100586 0.800781 -0.100586 1.60059 -0.200195 2.40039
|
1478 |
+
c-0.0996094 1.2002 -0.200195 2.40039 -0.200195 3.7002c0 0.799805 -0.0996094 1.5 -0.0996094 2.2998c-0.100586 1.2998 -0.100586 2.7002 -0.200195 4c0 0.700195 0 1.2998 -0.0996094 2c0 2 -0.100586 4 -0.100586 6c0 53.5 16.9004 103 45.7998 143.6
|
1479 |
+
c2.30078 3.2002 4.7002 6.40039 7.10059 9.5c4.89941 6.2002 10.0996 12.3008 15.5996 18c2.7002 2.90039 5.5 5.7002 8.40039 8.40039c2.89941 2.7002 5.7998 5.40039 8.7998 8c4.5 3.90039 9.09961 7.59961 13.9004 11.2002c1.59961 1.2002 3.19922 2.39941 4.7998 3.5
|
1480 |
+
c27.2998 19.5996 59 33.7002 93.2998 40.7998c16.0996 3.2998 32.9004 5 50 5s33.7998 -1.7002 50 -5c34.2998 -7 66 -21.0996 93.5996 -40.7002c1.60059 -1.2002 3.2002 -2.2998 4.80078 -3.5c4.7998 -3.59961 9.39941 -7.2998 13.8994 -11.2002
|
1481 |
+
c12 -10.3994 23 -21.8994 32.7998 -34.3994c2.5 -3.10059 4.80078 -6.2998 7.10059 -9.5zM448 76.5v71.2998c0 2.10059 -1.59961 3.7002 -3.7002 3.7002h-22.2002c-2.09961 0 -3.69922 -1.59961 -3.69922 -3.7002v-25.7998h-29.5v144
|
1482 |
+
c0 2.09961 -1.60059 3.7002 -3.7002 3.7002h-22.1006c-2.09961 0 -3.69922 -1.60059 -3.69922 -3.7002v-25.9004h-29.5v25.9004c0 2.09961 -1.60059 3.7002 -3.7002 3.7002h-22.2002c-2.09961 0 -3.7002 -1.60059 -3.7002 -3.7002v-25.9004h-29.5v25.9004
|
1483 |
+
c0 4.7998 -6.5 3.7002 -9.5 3.7002v30.7002c6.7002 1.59961 13.7998 2.7998 20.7998 2.7998c8.80078 0 16.8008 -3.5 25.4004 -3.5c3.7002 0 22.4004 0.899414 22.4004 6.5v48.3994c0 2.10059 -1.60059 3.7002 -3.7002 3.7002c-4.2002 0 -12.2002 -3.5 -19.4004 -3.5
|
1484 |
+
c-7.89941 0 -16.8994 3.5 -26.2998 3.5c-6.5 0 -12.9004 -0.899414 -19.2002 -2.2998v3.90039c4.40039 2.09961 7.40039 6.69922 7.40039 11.5c0 16.7998 -25.4004 16.7998 -25.4004 0c0 -4.80078 3 -9.5 7.40039 -11.5v-90.2002c-3 0 -9.5 1.09961 -9.5 -3.7002v-25.9004
|
1485 |
+
h-29.5v25.9004c0 2.09961 -1.60059 3.7002 -3.7002 3.7002h-22.2002c-2.09961 0 -3.7002 -1.60059 -3.7002 -3.7002v-25.9004h-29.5v25.9004c0 2.09961 -1.59961 3.7002 -3.69922 3.7002h-22.1006c-2.09961 0 -3.7002 -1.60059 -3.7002 -3.7002v-144h-29.5996v25.7998
|
1486 |
+
c0 2.10059 -1.59961 3.7002 -3.7002 3.7002h-22.0996c-2.10059 0 -3.7002 -1.59961 -3.7002 -3.7002v-71.2998c9.40039 -15.5 20.5996 -29.9004 33.5996 -42.9004c20.6006 -20.5996 44.5 -36.6992 71.2002 -48c13.9004 -5.89941 28.2002 -10.2998 42.9004 -13.1992v75.7998
|
1487 |
+
c0 58.5996 88.5996 58.5996 88.5996 0v-75.7998c14.7002 2.89941 29 7.39941 42.9004 13.1992c26.7002 11.3008 50.5996 27.4004 71.2002 48c13 13 24.1992 27.4004 33.5996 42.9004z" />
|
1488 |
+
<glyph glyph-name="freebsd" unicode=""
|
1489 |
+
d="M303.7 351.8c11.0996 11.1006 115.5 77 139.2 53.2002c23.6992 -23.7002 -42.1006 -128.1 -53.2002 -139.2c-11.1006 -11.0996 -39.4004 -0.899414 -63.1006 22.9004c-23.7998 23.7002 -34.0996 52 -22.8994 63.0996zM109.9 379.9
|
1490 |
+
c-31.6006 -19.4004 -57.9004 -46.5 -76.4004 -78.7002c-20.7998 36.2998 -44.5 89.0996 -27.9004 105.7c16.4004 16.5 68 -6.40039 104.301 -27zM406.7 274c3.2998 5.5 7 11.7998 10.8994 18.7998c17.6006 -31.2998 27.7002 -67.3994 27.7002 -105.8
|
1491 |
+
c0 -119.1 -96.5 -215.6 -215.6 -215.6c-119.101 0 -215.601 96.5996 -215.601 215.6c0 119.1 96.5 215.6 215.601 215.6c35.8994 0 69.7002 -8.7998 99.5 -24.2998c-7.2998 -4 -13.9004 -8 -19.6006 -11.5996c-26 4.7002 -32.8994 -16.4004 -14.8994 -48.7002
|
1492 |
+
c21.7998 -43.0996 89 -90.4004 109.3 -70.0996c5.40039 5.39941 6 14.7998 2.7002 26.0996z" />
|
1493 |
+
<glyph glyph-name="gitkraken" unicode="" horiz-adv-x="592"
|
1494 |
+
d="M565.7 329.9c11.7998 -31.6006 18.2998 -65.7002 18.2998 -101.4c0 -155.1 -122.6 -281.6 -276.3 -287.7v145.8c-8.40039 -0.5 -16.6006 -0.399414 -23.4004 0v-145.899c-153.7 6.2002 -276.3 132.7 -276.3 287.8c0 35.7002 6.5 69.7998 18.2998 101.3
|
1495 |
+
c2.2998 6.2002 9.2998 9.2002 15.2998 6.60059c5.7002 -2.40039 8.5 -8.80078 6.30078 -14.6006c-10.9004 -29 -16.9004 -60.5 -16.9004 -93.2998c0 -134.6 100.4 -245.7 230.2 -262.7v123.7c-7.90039 1.59961 -15.4004 3.7002 -23 6.2002v-104
|
1496 |
+
c-106.7 26 -185.9 122.1 -185.9 236.8c0 91.7998 50.7998 171.8 125.8 213.3c5.80078 3.2002 13 0.900391 15.9004 -5c2.7002 -5.5 0.700195 -12.0996 -4.7002 -15.0996c-67.8994 -37.7002 -113.899 -110.101 -113.899 -193.2c0 -93.4004 57.8994 -173.2 139.8 -205.4
|
1497 |
+
v92.2002c-14.2002 4.5 -24.7998 17.7002 -24.7998 33.5c0 13.1006 6.69922 24.4004 17.2998 30.5c-8.2002 79.6006 -44.5 58.6006 -44.5 83.9004v14.7998c0 38 87.8994 161.7 129.1 164.7c2.60059 0.200195 5.10059 0.200195 7.60059 0
|
1498 |
+
c41.0996 -2.90039 129 -126.7 129 -164.7v-14.7002c0 -25.2998 -36.2002 -4.39941 -44.5 -83.8994c10.5 -6.10059 17.2998 -17.4004 17.2998 -30.5c0 -15.8008 -10.7002 -29 -24.9004 -33.5v-92.2002c81.9004 32.2998 139.8 112.1 139.8 205.399
|
1499 |
+
c0 83.2002 -46 155.601 -113.899 193.2c-5.2998 2.90039 -7.40039 9.60059 -4.7002 15.1006c2.90039 5.89941 10.2002 8.19922 15.9004 5c75 -41.5 125.8 -121.5 125.8 -213.301c0 -114.699 -79.2002 -210.899 -185.9 -236.8v104
|
1500 |
+
c-7.5 -2.59961 -15.0996 -4.7002 -23 -6.2002v-123.699c129.9 17 230.2 128.1 230.2 262.699c0 32.8008 -6 64.3008 -16.9004 93.3008c-2.19922 5.69922 0.600586 12.1992 6.30078 14.5996c6 2.59961 13 -0.5 15.2998 -6.59961zM365.9 172.5
|
1501 |
+
c-13.1006 0 -23.7002 -10.5996 -23.7002 -23.7002c0 -13.2002 10.7002 -23.7002 23.7002 -23.7002c13.0996 0 23.6992 10.6006 23.6992 23.7002c0 13.2002 -10.6992 23.7002 -23.6992 23.7002zM226.1 125.2c13.2002 0 23.7002 10.7002 23.7002 23.7002
|
1502 |
+
c0 13.0996 -10.5996 23.6992 -23.7002 23.6992c-13.1992 0 -23.6992 -10.6992 -23.6992 -23.6992s10.5 -23.7002 23.6992 -23.7002z" />
|
1503 |
+
<glyph glyph-name="gofore" unicode="" horiz-adv-x="400"
|
1504 |
+
d="M324 128.2c54.2998 0 65.7002 -50.1006 67.7002 -77.7002c-46.5 -56.2998 -107.8 -82.5 -171 -82.5c-123.7 0 -220.7 101.5 -220.7 224c0 123.4 98 224 220.7 224c59 0 114.3 -23.2998 156.1 -65.5996l-62.2998 -63.3008c-25 25.4004 -58.2998 39.4004 -93.5996 39.4004
|
1505 |
+
c-73.2002 0 -132.4 -60.2998 -132.4 -134.4c0 -74.1992 59.2002 -134.399 132.4 -134.399c33.5996 0 65.3994 12.7002 89.8994 35.7998v34.7002h13.2002zM311.9 240.7c47.6992 0 88.0996 -35 88.0996 -100.2v-30.5996c-15.5 26.6992 -42.5 41.7998 -76 41.7998h-118.4v89
|
1506 |
+
h106.301z" />
|
1507 |
+
<glyph glyph-name="goodreads" unicode=""
|
1508 |
+
d="M299.9 256.8c5.09961 -37.2998 -4.7002 -79 -35.9004 -100.7c-22.2998 -15.5 -52.7998 -14.0996 -70.7998 -5.69922c-37.1006 17.2998 -49.5 58.5996 -46.7998 97.1992c4.2998 60.9004 40.8994 87.9004 75.2998 87.5c46.8994 0.200195 71.7998 -31.7998 78.2002 -78.2998
|
1509 |
+
zM448 360v-336c0 -30.9004 -25.0996 -56 -56 -56h-336c-30.9004 0 -56 25.0996 -56 56v336c0 30.9004 25.0996 56 56 56h336c30.9004 0 56 -25.0996 56 -56zM330 134.8c0 0 -0.0996094 34 -0.0996094 217.3h-29v-40.2998c-0.800781 -0.299805 -1.2002 0.5 -1.60059 1.2002
|
1510 |
+
c-9.59961 20.7002 -35.8994 46.2998 -76 46c-51.8994 -0.400391 -87.2002 -31.2002 -100.6 -77.7998c-4.2998 -14.9004 -5.7998 -30.1006 -5.5 -45.6006c1.7002 -77.8994 45.0996 -117.8 112.399 -115.199c28.9004 1.09961 54.5 17 69 45.1992
|
1511 |
+
c0.5 1 1.10059 1.90039 1.7002 2.90039c0.200195 -0.0996094 0.400391 -0.0996094 0.600586 -0.200195c0.299805 -3.7998 0.199219 -30.7002 0.0996094 -34.5c-0.200195 -14.7998 -2 -29.5 -7.2002 -43.5c-7.7998 -21 -22.2998 -34.7002 -44.5 -39.5
|
1512 |
+
c-17.7998 -3.89941 -35.5996 -3.7998 -53.2002 1.2002c-21.5 6.09961 -36.5 19 -41.0996 41.7998c-0.299805 1.60059 -1.2998 1.2998 -2.2998 1.2998h-26.7998c0.799805 -10.5996 3.19922 -20.2998 8.5 -29.1992c24.1992 -40.5 82.6992 -48.5 128.199 -37.4004
|
1513 |
+
c49.9004 12.2998 67.3008 54.9004 67.4004 106.3z" />
|
1514 |
+
<glyph glyph-name="goodreads-g" unicode="" horiz-adv-x="384"
|
1515 |
+
d="M42.5996 44.7002h2.80078c12.6992 0 25.5 0 38.1992 -0.100586c1.60059 0 3.10059 0.400391 3.60059 -2.09961c7.09961 -34.9004 30 -54.5996 62.8994 -63.9004c26.9004 -7.59961 54.1006 -7.7998 81.3008 -1.7998c33.7998 7.40039 56 28.2998 68 60.4004
|
1516 |
+
c8 21.5 10.6992 43.7998 11 66.5c0.0996094 5.7998 0.299805 47 -0.200195 52.7998l-0.900391 0.299805c-0.799805 -1.5 -1.7002 -2.89941 -2.5 -4.39941c-22.0996 -43.1006 -61.2998 -67.4004 -105.399 -69.1006c-103 -4 -169.4 57 -172 176.2
|
1517 |
+
c-0.5 23.7002 1.7998 46.9004 8.2998 69.7002c20.5996 71.0996 74.5996 118.2 153.899 118.8c61.3008 0.400391 101.5 -38.7002 116.2 -70.2998c0.5 -1.10059 1.2998 -2.2998 2.40039 -1.90039v61.6006h44.2998c0 -280.301 0.0996094 -332.2 0.0996094 -332.2
|
1518 |
+
c-0.0996094 -78.5 -26.6992 -143.7 -103 -162.2c-69.5 -16.9004 -159 -4.7998 -196 57.2002c-8 13.5 -11.7998 28.2998 -13 44.5zM188.9 411.5c-52.5 0.5 -108.5 -40.7002 -115 -133.8c-4.10059 -59 14.7998 -122.2 71.5 -148.601
|
1519 |
+
c27.5996 -12.8994 74.2998 -15 108.3 8.7002c47.5996 33.2002 62.7002 97 54.7998 154c-9.7002 71.1006 -47.7998 120 -119.6 119.7z" />
|
1520 |
+
<glyph glyph-name="google-drive" unicode="" horiz-adv-x="512"
|
1521 |
+
d="M339 133.1l-163.6 282.9h161.199l163.601 -282.9h-161.2zM201.5 109.5h310.5l-80.5996 -141.5h-310.5zM154.1 380.6l82.9004 -141.399l-156.4 -271.2l-80.5996 141.5z" />
|
1522 |
+
<glyph glyph-name="google-play" unicode="" horiz-adv-x="512"
|
1523 |
+
d="M325.3 213.7l-220.7 221.3l280.801 -161.2zM47 448l256.6 -255.9l-256.6 -256c-13 6.80078 -21.7002 19.2002 -21.7002 35.3008v441.3c0 16.0996 8.7002 28.5 21.7002 35.2998zM472.2 222.4c19.2002 -14.3008 19.2002 -46.5 1.2002 -60.8008l-60.1006 -34.0996
|
1524 |
+
l-65.7002 64.5l65.7002 64.5zM104.6 -51l220.7 221.3l60.1006 -60.0996z" />
|
1525 |
+
<glyph glyph-name="gripfire" unicode="" horiz-adv-x="384"
|
1526 |
+
d="M112.5 146.6c0 -26.8994 16.5996 -47.1992 32.5996 -69.5c22.5 -30.1992 44.2002 -56.8994 44.2002 -86.5c-0.0996094 -14.5 -4.39941 -29.6992 -17.5 -46.3994c0 5.2998 4.7998 12.2002 4.7998 22.2998c0 15.2002 -13 39.9004 -78.0996 86.5996
|
1527 |
+
c-34.2998 29.1006 -66.5 58.5 -66.5 108.301c0 114.699 147.1 176.5 147.1 268.6c0 3.2998 -0.199219 6.7002 -0.599609 10c5.09961 -2.40039 39.0996 -43.2998 39.0996 -90.4004c0 -80.5 -105.1 -129.199 -105.1 -203zM317.8 185.6
|
1528 |
+
c1.5 -8.39941 2.2002 -16.5996 2.2002 -24.5996c0 -51.7998 -29.4004 -97.5 -67.2998 -136.8c-1 -1 -2.2002 -2.40039 -3.2002 -2.40039c-3.59961 0 -35.5 41.6006 -35.5 53.2002c0 0 41.7998 55.7002 41.7998 96.9004c0 10.7998 -2.7002 21.6992 -9.09961 33.3994
|
1529 |
+
c-1.5 -32.2998 -55.7002 -87.7002 -58.1006 -87.7002c-2.69922 0 -17.8994 22 -17.8994 42.1006c0 5.2998 1 10.7002 3.2002 15.7998c2.39941 5.5 56.5996 72 56.5996 116.7c0 6.2002 -1 12 -3.40039 17.0996l-4 7.2002c16.7002 -6.5 82.6006 -64.0996 94.7002 -130.9z" />
|
1530 |
+
<glyph glyph-name="grunt" unicode="" horiz-adv-x="384"
|
1531 |
+
d="M61.2998 258.7c0.5 4.89941 2.7998 10 7 12h0.100586c-4.60059 1.7002 -9.2002 3.09961 -13.5 4.09961c42.1992 10.2002 73.3994 -20.5996 83.0996 -31.7998c16.5996 -19.2002 35.5 -8.7998 35.5 -8.7998c0.299805 -11.1006 -10.2998 -19 -21.0996 -19.5
|
1532 |
+
c1.19922 -15.4004 -13.9004 -32.5 -13.9004 -32.5s5.59961 15 2.7002 25.2998c-0.900391 3.2002 -2 6.09961 -3 8.5c-19.2998 -17.2002 -48 -1.5 -54.9004 6.09961c-9.59961 10.6006 -12.3994 23.8008 -12.7998 34.1006c-1.7998 -3.7998 -3.2998 -9.10059 -4 -16.6006
|
1533 |
+
c0 0 -6.2998 9.10059 -5.2002 19.1006zM89.5996 260.5c-2.89941 -9.09961 -3.39941 -27.7002 6.90039 -35.2998c16.2998 -12.1006 32.2998 -5 38 -1.7002c-7.5 11.2998 -25.4004 26 -44.9004 37zM231.7 214.7c-10.7998 0.399414 -21.4004 8.39941 -21.2002 19.2998
|
1534 |
+
c0 0 18.7998 -10.4004 35.5 8.7998c9.7002 11.2002 40.7998 42 83.0996 31.7998c-4.2998 -0.899414 -8.89941 -2.2998 -13.5 -4.09961h0.100586c4.09961 -1.7998 6.39941 -6.7998 7 -11.7998c1.2002 -10 -5.2002 -19.1006 -5.2002 -19.1006
|
1535 |
+
c-0.599609 7.5 -2.2002 12.8008 -4 16.6006c-0.5 -10.2998 -3.2002 -23.5 -12.7998 -34.1006c-6.7998 -7.59961 -35.5 -23.3994 -54.7998 -6.09961c-1 -2.5 -2.10059 -5.2998 -3 -8.5c-2.90039 -10.2998 2.69922 -25.2998 2.69922 -25.2998s-15.0996 17 -13.8994 32.5z
|
1536 |
+
M294.4 260.5c-19.5 -11 -37.4004 -25.5996 -44.9004 -37c5.7002 -3.40039 21.5996 -10.5 37.9004 1.59961c10.3994 7.7002 10 26.3008 7 35.4004zM160 29.5c4.09961 0 7 -0.900391 8.7998 -2.7002c2.2002 -2.2998 1.5 -5.2998 0.900391 -6.7998
|
1537 |
+
c-1.10059 -2.7002 -5.5 -11.5996 -13 -19.7998c-2.7002 -2.90039 -6.60059 -4.60059 -11 -4.60059c-4.2998 0 -8.7002 1.60059 -11.7998 4.30078c-2.30078 2.09961 -10.2002 9.5 -13.7002 18.5996c-1.2998 3.40039 -1 6.09961 0.899414 8.09961
|
1538 |
+
c1.30078 1.30078 4 2.90039 9.5 2.90039h29.4004zM349.2 130.7c0 0 29.2998 -22.5 21.0996 -70.9004c-5.2998 -29.5 -23.2002 -46 -47 -54.7002c-8.7998 -19.0996 -29.3994 -45.6992 -67.2998 -49.5996c-14.5 -11.7998 -34.5 -19.5 -63.5996 -19.5h-0.200195
|
1539 |
+
c-29.2002 0 -49.2002 7.7002 -63.6006 19.5c-37.8994 3.90039 -58.5 30.5 -67.2998 49.5996c-23.7998 8.60059 -41.7998 25.2002 -47 54.7002c-8.59961 48.2002 20.6006 70.7998 20.6006 70.7998c2.39941 -17.8994 13 -33.8994 24.5996 -43.7998
|
1540 |
+
c3.09961 22.7002 3.7002 55.5 3.7002 62.4004c0 14.7002 -9.5 24.5 -12.2002 26.0996c-2.5 1.5 -5.2998 3 -8.2998 4.60059c-18 9.59961 -40.4004 21.5996 -40.4004 43.6992c0 16.1006 9.2998 23.2002 15.4004 27.8008c0.799805 0.599609 1.5 1.19922 2.2002 1.69922
|
1541 |
+
c2.09961 1.7002 3.69922 3 4.2998 4.40039c4.39941 9.7998 3.59961 34.2002 1.7002 37.5996c-0.600586 0.700195 -16.8008 21 -11.8008 39.2002c2 7.40039 6.90039 13.2998 14.1006 17c5.2998 2.7002 11.7998 4.2002 19.5 4.5c0.0996094 2 0.5 4 0.899414 5.90039
|
1542 |
+
c0.5 2.59961 1.10059 5.2998 0.900391 8.09961c-0.400391 4.7002 -0.799805 9.10059 -2.2002 11.2998c-8.39941 13.3008 -28.7998 17.6006 -29 17.6006l-12.2998 2.39941l8.09961 9.40039c0.200195 0.200195 17.3008 17.5 46.3008 17.5c7.89941 0 16 -1.2998 23.8994 -3.5
|
1543 |
+
c24.2998 -7.7998 42.9004 -30.5 49.4004 -39.2998c2 0.599609 3.89941 1.2002 5.89941 1.7002c-1 26.3994 20.7002 47.3994 28.2002 48.2998c0.5 -4.5 -0.399414 -22.2002 7.2002 -27.6006c2.2002 14.4004 9.59961 30.3008 39.0996 40.7002
|
1544 |
+
c-6.2998 -16.7002 -0.799805 -30.7002 1.80078 -37.2002c20.0996 18.2002 33.6992 15.2002 33.6992 15.2002s-13.1992 -22.7002 -9 -38.5c3.30078 -0.799805 6.5 -1.7002 9.60059 -2.7002c6.5 8.80078 25.2002 31.5 49.3994 39.3008
|
1545 |
+
c8.10059 2.59961 16.2002 3.89941 24.1006 3.89941c29 0 46.2002 -17.2998 46.2998 -17.5l8.09961 -9.5l-12.2998 -2.39941c-0.200195 0 -20.5996 -4.30078 -29 -17.6006c-1.39941 -2.2998 -1.7998 -6.59961 -2.2002 -11.2998
|
1546 |
+
c-0.199219 -2.7998 0.300781 -5.5 0.900391 -8.09961c0.400391 -2 0.799805 -3.90039 0.900391 -5.90039c7.59961 -0.299805 14.1992 -1.7998 19.5 -4.5c7.19922 -3.7002 12.0996 -9.59961 14.0996 -17c4.90039 -18.2998 -11.2002 -38.5996 -11.7998 -39.2002
|
1547 |
+
c-1.90039 -3.39941 -2.7002 -27.7998 1.7002 -37.5996c0.599609 -1.40039 2.19922 -2.7002 4.2998 -4.40039c0.700195 -0.599609 1.39941 -1.09961 2.2002 -1.7002c6.09961 -4.59961 15.3994 -11.5996 15.3994 -27.7998c0 -22.0996 -22.3994 -34.0996 -40.3994 -43.7002
|
1548 |
+
c-2.90039 -1.59961 -5.80078 -3.09961 -8.30078 -4.59961c-2.69922 -1.59961 -12.1992 -11.4004 -12.1992 -26.0996c0 -6.90039 0.599609 -39.7002 3.69922 -62.4004c11.6006 9.90039 22.2002 25.7998 24.6006 43.7002zM305.7 410.3
|
1549 |
+
c-17.7998 -5.7002 -31.6006 -23.0996 -37.7002 -32.2002c1.59961 -0.699219 3.09961 -1.39941 4.7002 -2.19922c2.59961 -1.2002 4.89941 -2.40039 7.09961 -3.7002c2.7002 5.5 8.40039 13.7002 20.7002 22.3994c8.2002 5.80078 18.2002 8.90039 28.7002 8.90039
|
1550 |
+
c3.59961 0 6.7998 -0.400391 9.2002 -0.799805c3.2998 2.09961 6.59961 3.89941 9.69922 5.2998c-4.7998 2 -13.6992 5 -24.6992 5c-6.10059 0 -12.1006 -0.900391 -17.7002 -2.7002zM326.7 392.1c-7.40039 -0.299805 -14 -2.69922 -19.6006 -7
|
1551 |
+
c-8 -6.39941 -12.0996 -17.6992 -13.5 -22.5c4.90039 -4.19922 8.2002 -8.09961 10.5 -11.1992c3.40039 1 7.30078 1.89941 11.5 2.69922c3.30078 4.5 3.90039 10.6006 4.40039 17c0.5 6.2002 1.09961 12.6006 4.40039 17.8008c0.699219 1.09961 1.5 2.19922 2.2998 3.19922
|
1552 |
+
zM45.5996 402.7c2.40039 0.399414 5.60059 0.799805 9 0.899414c10.6006 0 20.5 -3.09961 28.8008 -8.89941c12.3994 -8.7002 18.0996 -17 20.6992 -22.4004c2.2002 1.2002 4.60059 2.5 7.10059 3.7002c1.59961 0.799805 3.2002 1.5 4.7998 2.2002
|
1553 |
+
c-6.09961 8.89941 -19.9004 26.2998 -37.7002 32.0996c-5.7002 1.7998 -11.5996 2.7002 -17.7002 2.7002c-11 0 -19.8994 -3 -24.6992 -5c3.09961 -1.2998 6.39941 -3.09961 9.69922 -5.2998zM90.2998 362.6c-1.39941 4.80078 -5.5 16.1006 -13.5 22.4004
|
1554 |
+
c-5.5 4.40039 -12.0996 6.7002 -19.5 7c0.799805 -1 1.60059 -2.09961 2.2998 -3.2002c3.30078 -5.2002 3.90039 -11.5996 4.40039 -17.7998c0.5 -6.40039 1 -12.5 4.2998 -16.9004c4.2002 -0.799805 8.10059 -1.7998 11.5 -2.69922c2.2002 3.19922 5.60059 7 10.5 11.1992z
|
1555 |
+
M58.0996 188.1c8.7002 -5 18.1006 -16.7998 19 -34.1992c0.900391 -14.7002 -0.899414 -49.9004 -3.39941 -75.9004c12.5 -4.7998 26.7002 -6.40039 39.7002 -6.7998c2 4.09961 3.89941 8.5 5.5 13.0996c0.699219 1.90039 19.5996 51 26.3994 62.2002
|
1556 |
+
c-5.39941 -39 -17.5 -73.7002 -23.5 -89.5996c3.40039 0.399414 7.2998 0.699219 11.7002 0.699219h117c4.40039 0 8.2002 -0.199219 11.7002 -0.699219c-6 15.8994 -18 50.5996 -23.5 89.5996c6.7998 -11.0996 25.7002 -60.2002 26.3994 -62.2002
|
1557 |
+
c1.60059 -4.59961 3.5 -9 5.5 -13.0996c13 0.399414 27.3008 2 39.7002 6.7998c-2.5 26 -4.2998 61.2998 -3.39941 75.9004c1.09961 17.5 10.3994 29.1992 19.0996 34.1992c2.7002 1.5 5.5 3.10059 8.40039 4.60059c14.7998 8 30.1992 16.2998 30.1992 30.5
|
1558 |
+
c0 11.0996 -4.2998 14.5 -8.89941 18.2002l-0.5 0.399414c-0.700195 0.600586 -1.5 1.2002 -2.2002 1.7998c0.900391 -7.19922 1.90039 -13.2998 2.7002 -14.8994c0 0 -12.1006 15 -15.7002 44.2998c-1.40039 11.5 1.09961 34.2002 5.09961 43
|
1559 |
+
c-0.199219 -4.90039 0 -9.7998 0.300781 -14.4004c0.399414 0.900391 0.799805 1.60059 1.2998 2.2002c3.2998 4 11.8994 17.5 9.39941 26.6006c-1 3.39941 -3.19922 6 -6.69922 7.7998c-3.80078 1.89941 -8.80078 2.89941 -15.1006 2.89941
|
1560 |
+
c-12.2998 0 -25.8994 -3.7998 -32.8994 -6c-25.1006 -7.89941 -55.4004 -30.8994 -64.1006 -37.6992c-0.200195 -0.200195 -0.399414 -0.300781 -0.399414 -0.300781l-5.60059 -3.89941l3.5 5.7998c0.200195 0.299805 19.1006 31.4004 53.1006 46.5
|
1561 |
+
c-2 2.90039 -7.40039 8.2002 -21.6006 15.0996c-21.3994 10.5 -46.3994 15.8008 -74.2998 15.8008c-27.7998 0 -52.9004 -5.30078 -74.2998 -15.8008c-14.2002 -7 -19.6006 -12.1992 -21.6006 -15.0996c34.1006 -15.0996 53 -46.2002 53.2002 -46.5l3.5 -5.7998
|
1562 |
+
l-5.59961 3.89941s-0.200195 0.100586 -0.400391 0.300781c-8.7002 6.7998 -39 29.6992 -64.0996 37.6992c-7 2.30078 -20.6006 6 -32.9004 6c-6.2998 0 -11.2998 -1 -15.0996 -2.89941c-3.60059 -1.7998 -5.7998 -4.2998 -6.7002 -7.7998
|
1563 |
+
c-2.40039 -9.10059 6.2002 -22.6006 9.40039 -26.6006c0.5 -0.599609 0.899414 -1.39941 1.2998 -2.2002c0.299805 4.60059 0.5 9.5 0.299805 14.4004c4 -8.7002 6.5 -31.5 5.09961 -43c-3.59961 -29.2998 -15.6992 -44.2998 -15.6992 -44.2998
|
1564 |
+
c0.799805 1.59961 1.7998 7.7002 2.69922 14.8994c-0.799805 -0.599609 -1.5 -1.19922 -2.19922 -1.7998l-0.5 -0.399414c-4.60059 -3.60059 -8.90039 -7.10059 -8.90039 -18.2002c0 -14.2002 15.2998 -22.5 30.2002 -30.5c2.7998 -1.5 5.7002 -3 8.39941 -4.60059z
|
1565 |
+
M34.7998 43.4004c11.9004 -19.7002 35.5 -29.4004 58.2002 -29.5c-4.5 13.2998 -3.09961 24 4.09961 31.7998l1.40039 1.39941c1.7998 2.40039 4.2998 5.80078 7 10c-27.2002 1.10059 -63.5 11 -74.4004 45.4004c-5 -5 -8.39941 -39.0996 3.7002 -59.0996zM80.5 -0.0996094
|
1566 |
+
c6.5 -9.5 16.5 -19.6006 30.9004 -25.5c-4.90039 7.19922 -8.80078 15.0996 -12.3008 23.0996c-6.39941 0.5 -12.5996 1.2998 -18.5996 2.40039zM192 -50.2002c60.5996 0.100586 78.2998 45.9004 84.9004 64.7002c3.59961 10.5 3.2998 18.2998 -0.900391 23.0996
|
1567 |
+
c-2.7998 3.30078 -9.5 7.2002 -24.5996 7.2002h-118.801c-15.0996 0 -21.6992 -3.89941 -24.5996 -7.2002c-4.2998 -4.89941 -4.59961 -12.5996 -0.900391 -23.0996c6.60059 -18.9004 24.3008 -64.5996 84.9004 -64.7002zM272.6 -25.5996
|
1568 |
+
c14.4004 5.89941 24.4004 16 30.9004 25.5c-6 -1.10059 -12.2002 -1.90039 -18.5996 -2.40039c-3.5 -8 -7.40039 -15.9004 -12.3008 -23.0996zM349.2 43.4004c12.2002 19.8994 8.7998 54 3.7998 59c-10.9004 -34.4004 -47.2002 -44.2002 -74.4004 -45.4004
|
1569 |
+
c2.7002 -4.2002 5.2002 -7.59961 7 -10c0.5 -0.5 1 -1 1.40039 -1.5c7.2002 -7.7002 8.59961 -18.5 4.09961 -31.7998c22.5 0.399414 46.1006 10 58.1006 29.7002zM191.9 260.3c-12.7002 0.200195 -27.2002 17.7998 -27.2002 17.7998
|
1570 |
+
c9.89941 -6 18.7998 -8.09961 27.2998 -8.2998c8.5 0.200195 17.4004 2.2998 27.2998 8.2998c0 0 -14.5 -17.6992 -27.2002 -17.7998h-0.199219zM253.6 29.5996c5.40039 -0.0996094 8.10059 -1.69922 9.40039 -3c1.90039 -1.89941 2.2002 -4.59961 0.900391 -7.89941
|
1571 |
+
c-3.5 -8.90039 -11.4004 -16.1006 -13.7002 -18.1006c-3.10059 -2.59961 -7.40039 -4.19922 -11.7998 -4.19922c-4.40039 0 -8.30078 1.59961 -11 4.5c-7.5 8 -12 16.6992 -13 19.2998c-0.600586 1.5 -1.30078 4.39941 0.899414 6.7002
|
1572 |
+
c1.7002 1.7998 4.7002 2.69922 8.90039 2.69922h29.3994z" />
|
1573 |
+
<glyph glyph-name="gulp" unicode="" horiz-adv-x="256"
|
1574 |
+
d="M209.8 56.9004l-14.0996 -24.6006l-4.60059 -80.2002c0 -8.89941 -28.2998 -16.0996 -63.0996 -16.0996s-63.0996 7.2002 -63.0996 16.0996l-5.80078 79.4004l-14.8994 25.4004c41.2002 -17.3008 126 -16.7002 165.6 0zM13.7998 310.2
|
1575 |
+
c30.7002 -17 197.8 -16.9004 228.3 0.200195l-14.7998 -136.801c-4.7998 -4.19922 -11.5996 -10.1992 -16.5996 -14.0996c-1.60059 -1.2002 -6 -4.7002 -8 -4.7002c-1.2998 0 -2.2002 0.5 -2.2002 1.7998c0.0996094 1 3.40039 4.5 5 6.40039
|
1576 |
+
c4.90039 5.7002 13.7998 16 13.7998 23.4004c0 7 -10.7002 14.0996 -25.7002 0.199219c-1.59961 -1.5 -3.09961 -3 -4.5 -4.5c0.400391 1.10059 1.10059 5.10059 1.10059 6.2002c0 2.7998 -1.40039 4 -4.2002 4c-1 0 -1.90039 -0.599609 -2.7002 -1.59961
|
1577 |
+
c-2.59961 -3.10059 -3.89941 -7.5 -5.2998 -11.2998c-0.5 -1.80078 -1.09961 -3.60059 -1.7002 -5.5c-0.399414 -0.200195 -0.700195 -0.300781 -0.899414 -0.600586c-3.80078 -3.89941 -17.7002 -17 -23.1006 -17c-2.2998 0 -1.59961 3.60059 -1 5.7998
|
1578 |
+
c1 3.40039 6.7998 17.7002 8.7002 22.3008c4.59961 11.0996 8 19.7998 13.2002 31.8994c3.89941 9.2002 3.7998 8.60059 4.5 10.5c0.700195 2.10059 0.700195 4.90039 -1 6.2002c-1 0.700195 -2 1.09961 -3.2002 1.09961c-2.40039 0 -4.7998 -1.39941 -6.09961 -4.69922
|
1579 |
+
c-25.5 -64.4004 -25.2002 -63.3008 -26.4004 -68.2002c-2 -1.7002 -4.40039 -3.40039 -6.7998 -4.5c-3.10059 -1.40039 -6.7998 -2.2002 -6.7998 1.2002c0 3.69922 1.39941 8.19922 2.69922 11.6992c2.2002 6.10059 4.90039 11.1006 6.90039 16.7002
|
1580 |
+
c0.900391 2.40039 1.2998 4.7002 -0.400391 6.90039c-0.799805 1 -1.89941 1.5 -3.19922 1.5c-2.60059 0 -4.10059 -2.60059 -5.2002 -5.10059c-0.700195 -1.5 -1.2998 -3.09961 -1.7998 -4.7998c-1.2002 -4 -3.60059 -8.7002 -5.60059 -12.2998
|
1581 |
+
c-2.7998 -5 -6.5 -10.0996 -11.0996 -13.5c-2.2002 -1.59961 -4.5 -2.40039 -6.90039 -2.40039c-3.5 0 -2.39941 5.7002 -1.5 9c2.2002 7.80078 5.5 13.3008 9.2998 20.8008c1.30078 2.69922 2.30078 5.39941 -0.299805 7.19922c-0.5 0.300781 -1 0.5 -1.59961 0.700195
|
1582 |
+
c-3.40039 0.900391 -6 -1.09961 -7.60059 -4.5c-3.09961 -6.2998 -5.39941 -11.7002 -7.09961 -16.2002c-3.2998 -8.89941 -6.90039 -18.2998 -4.59961 -23.7998c1.5 -3.7002 4.5 -5.09961 8.59961 -5.09961c9.7998 0 17.7998 6.7002 22.4004 14.8994
|
1583 |
+
c-4.30078 -19.7998 8.19922 -17.2998 20 -8.09961c0.0996094 -0.400391 0.0996094 -0.799805 0.199219 -1.2002c1.5 -6.7002 8.7002 -6.7002 14.5 -4.09961c3.5 1.59961 8.2002 4.5 14.4004 10.5c0.200195 0.299805 0.799805 1.39941 -0.799805 -2.2998
|
1584 |
+
c-7.2002 -16.2002 -13.5 -28.2002 -15 -34.3008c-0.200195 -0.899414 -0.299805 -1.7998 -0.299805 -2.69922c0 -1.80078 0.399414 -3.10059 1.2998 -3.7002c1.59961 -1.2002 4.2002 -1.2998 6.09961 -0.299805c1.7998 1 3.10059 2.59961 4 4.5
|
1585 |
+
c1 2.19922 0.200195 0.699219 5.2002 14c5 13.3994 2.90039 7.7998 9.09961 22c1.90039 4.2998 4.2002 9.5 8.5 15.5c2.5 3.39941 5.5 7 8.7002 9.69922c5.7002 4.7002 11.7002 5.40039 11.7002 2.5c0 -2.19922 -3.2998 -6.39941 -4.7002 -8.09961
|
1586 |
+
c-5.2998 -6.7002 -14.3994 -16.2998 -14.3994 -21.5c0 -9.5 12 -8 17.3994 -5.7002c7.2998 3.2002 13.9004 9.60059 19.6006 14.7998l-10.9004 -94.5996c-1.90039 -4.90039 -39.0996 -17.0996 -88.2002 -17.0996c-49 0 -86.2002 12.0996 -88.2002 17.0996l-7.59961 79.5996
|
1587 |
+
c2.09961 -1.5 4.2998 -2.39941 7.7002 -2.39941c7.39941 0 16.0996 6.7002 21.5 11.7998c2.2998 2.2002 4.39941 4.40039 6.39941 6.59961c-1 -3 -7.09961 -22 -7.2998 -25.1992c-0.0996094 -1 -0.200195 -4.90039 0.799805 -6.30078
|
1588 |
+
c0.5 -0.799805 1.40039 -1.19922 2.60059 -1.19922c2.89941 0 5.59961 4.69922 6.2998 7.5c0 0 1.7998 6.2998 7.59961 25.7998c6.30078 21.0996 10 24.5 10 34.7002c0 5.59961 -7.2998 6.7998 -9.89941 0l-5.2002 -15.5c-2.2002 -4.5 -8 -11.5 -12.5 -16
|
1589 |
+
c-3.5 -3.5 -10.7998 -10.1006 -15.7998 -10.1006c-2.40039 0 -3.90039 1.40039 -4.90039 3.60059c-2.2998 5.2998 -0.899414 14.2998 0.600586 19.8994c2.59961 9.7002 6.89941 19.4004 12 28.2002c4.19922 7.2998 10.1992 15.7002 17.0996 20.7002
|
1590 |
+
c6.59961 4.7998 12.7998 4.5 16.9004 -2.7998c1.5 -2.7002 3.7998 -7.30078 6.7998 -7.30078c2.5 0 5.7002 2.60059 4.5 9.10059c-0.5 2.5 -4.90039 8.7998 -10.1006 11.7998c-6 3.59961 -12.3994 3.59961 -18.6992 0.900391
|
1591 |
+
c-19.2002 -8.2002 -34.1006 -35.2002 -40 -55.2002zM243.5 318.7c0 -21 -231.2 -21 -231.2 0c0 8.7998 51.7998 15.8994 115.601 15.8994c9 0 17.7998 -0.0996094 26.2998 -0.399414l12.5996 48.7002l61.2998 64.5c1.40039 1.39941 5.80078 0.199219 9.90039 -3.5
|
1592 |
+
c4.09961 -3.7002 6.59961 -7.90039 5.2998 -9.30078l-0.0996094 -0.0996094l-57.2998 -60.5l-10 -40.7002c39.8994 -2.59961 67.5996 -8.09961 67.5996 -14.5996zM174.1 314.1c0 0.800781 -0.899414 1.5 -2.5 2.10059l-0.199219 -0.799805
|
1593 |
+
c0 -1.30078 -5 -2.40039 -11.1006 -2.40039c-6.09961 0 -11.0996 1.09961 -11.0996 2.40039c0 0.0996094 0 0.199219 0.0996094 0.299805l0.200195 0.700195c-1.7998 -0.600586 -3 -1.40039 -3 -2.30078c0 -2.09961 6.2002 -3.69922 13.7002 -3.69922
|
1594 |
+
c7.7002 -0.100586 13.8994 1.59961 13.8994 3.69922z" />
|
1595 |
+
<glyph glyph-name="hacker-news-square" unicode=""
|
1596 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM21.2002 218.8h-0.200195c0.0996094 0.100586 0.200195 0.299805 0.299805 0.400391c0 -0.100586 0 -0.299805 -0.0996094 -0.400391z
|
1597 |
+
M239.2 164.9l80.7998 155.1h-34.7998c-54.7998 -101.2 -48.2998 -98.5996 -60.6006 -125.6c-10.0996 24.3994 -6.7998 27.2998 -59.2998 125.6h-37.2998l79.7998 -153.3v-102.7h31.4004v100.9z" />
|
1598 |
+
<glyph glyph-name="hire-a-helper" unicode="" horiz-adv-x="512"
|
1599 |
+
d="M443.1 448c3.90039 -36.4004 32.5 -65.7998 68.9004 -71.7002v-370.5c-35.4004 -4 -64.9004 -33.3994 -67.9004 -69.7998h-372.199c-5.90039 36.4004 -34.5 63.9004 -71.9004 68.7998v371.5c37.4004 3.90039 67.9004 34.4004 71.9004 71.7002h371.199zM406.1 43.0996
|
1600 |
+
c7.80078 0 5.80078 10.8008 0 10.8008c-10.2998 3.39941 -13.5 3.59961 -21.6992 13.7998c-7.80078 12.8994 -7.90039 44.3994 -7.90039 127.8v101.2c0 22.0996 12.2002 28.2998 28.5996 32.3994c8.90039 2.2002 3.90039 11.8008 -1 11.8008
|
1601 |
+
c-36.5 0 -20.5996 -2 -57.0996 -2c-32.7002 0 -16.5 2 -49.2002 2c-3.2998 0 -8.5 -8.30078 -1 -10.8008c4.90039 -1.59961 27.6006 -3.69922 27.6006 -39.2998c0 -45.5996 0.199219 -55.7998 -1 -68.7998c0 -1.2998 -2.30078 -12.7998 -12.8008 -12.7998h-109.199
|
1602 |
+
c-10.5 0 -12.8008 11.5 -12.8008 12.7998c-1.19922 13 -1 23.2002 -1 68.7998c0 35.6006 22.7002 37.7002 27.6006 39.2998c7.5 2.5 2.2998 10.8008 -1 10.8008c-32.7002 0 -16.5 -2 -49.2002 -2c-36.5 0 -20.5996 2 -57.0996 2c-5 0 -9.80078 -9.60059 -1 -11.8008
|
1603 |
+
c16.3994 -4.09961 28.5996 -10.1992 28.5996 -32.3994v-101.2c0 -83.4004 -0.200195 -114.9 -7.90039 -127.8c-8.19922 -10.2998 -11.5 -10.4004 -21.6992 -13.7998c-5.80078 0 -7.90039 -10.8008 0 -10.8008c36.2998 0 18.7998 2 55.0996 2c35.7998 0 21 -2 56.0996 -2
|
1604 |
+
c6 0 4.90039 8.2002 0 9.80078c-22.7998 7.59961 -22.8994 10.2998 -24.5996 12.7998c-10.4004 15.5996 -5.90039 83 -5.90039 113c0 5.2998 6.40039 12.7998 13.8008 12.7998h111.199c7.40039 0 13.8008 -7.5 13.8008 -12.7998c0 -30 4.5 -97.4004 -5.90039 -113
|
1605 |
+
c-1.7002 -2.60059 -1.7998 -5.2002 -24.5996 -12.7998c-4.90039 -1.60059 -5.90039 -9.80078 0 -9.80078c35.0996 0 20.2998 2 56.0996 2c36.2998 0 18.7998 -2 55.0996 -2z" />
|
1606 |
+
<glyph glyph-name="hotjar" unicode=""
|
1607 |
+
d="M414.9 286.5c30 -53 41.7998 -121.6 26.2998 -180.9c-14.7002 -56.6992 -68.2998 -120.3 -148.8 -145.6c54.5 76.9004 43.8994 200.1 -27.1006 215.5c54.2002 -93.9004 -53.7002 -180.3 -110.8 -93.9004c-2.5 -7.19922 -25.0996 -74.5 4.09961 -129.6
|
1608 |
+
c-61.0996 9.09961 -117.8 33.5 -144.6 93.4004c-35 78.1992 -2.7002 149.8 79 204.899c129.2 87.2998 28.0996 197.7 28.0996 197.7s219.101 -29 293.801 -161.5z" />
|
1609 |
+
<glyph glyph-name="hubspot" unicode="" horiz-adv-x="512"
|
1610 |
+
d="M267.4 236.4l-163.2 114.699c-7.90039 -4.69922 -17 -7.59961 -26.7998 -7.59961c-28.8008 0 -52.2002 23.4004 -52.2002 52.2998c0 28.7998 23.3994 52.2002 52.2002 52.2002c28.8994 0 52.3994 -23.4004 52.3994 -52.2002c0 -4.7998 -0.799805 -9.39941 -2 -13.7998
|
1611 |
+
c51.4004 -39.0996 141.3 -103.9 168.9 -124.8c13.0996 6.89941 27.5 11.5 42.7002 13.5996v61.2002c-17.5 7.40039 -28.2002 23.7998 -28.2002 42.9004c0 26.0996 20.5996 47.8994 46.7002 47.8994c26.0996 0 47 -21.7998 47 -47.8994
|
1612 |
+
c0 -19.1006 -10.7002 -35.5 -28.2002 -42.9004v-61.5996c62.5 -9.5 110.2 -63.5 110.2 -128.7c0 -71.9004 -58.1006 -130.2 -130 -130.2c-29.9004 0 -57.3008 10 -79.3008 26.9004l-50 -50.2002c1.30078 -3.90039 1.90039 -7.90039 1.90039 -12.1006
|
1613 |
+
c0 -10.6992 -4.2002 -20.8994 -11.7998 -28.5c-7.7002 -7.69922 -17.7998 -11.5996 -28.6006 -11.5996c-10.6992 0 -20.8994 4 -28.5 11.5996c-7.59961 7.60059 -11.7998 17.7002 -11.7998 28.5c0 10.8008 4.2002 21 11.7998 28.6006
|
1614 |
+
c7.60059 7.59961 17.7002 11.7998 28.5 11.7998c4.90039 0 9.60059 -0.900391 14 -2.5l49.5 49.7998c-16.2998 21.7002 -26 48.7002 -26 78c0 37.2998 15.7002 70.9004 40.8008 94.6006zM356.9 72.7998c38.0996 0 69 30.9004 69 69c0 38.1006 -30.9004 69 -69 69
|
1615 |
+
c-38.1006 0 -69 -30.8994 -69 -69c0 -38.0996 30.8994 -69 69 -69z" />
|
1616 |
+
<glyph glyph-name="itunes" unicode=""
|
1617 |
+
d="M223.6 367.7c94.5 0 171.2 -76.7002 171.2 -171.3c0 -94.5 -76.5996 -171.2 -171.2 -171.2c-94.5996 0 -171.1 76.7998 -171.1 171.3s76.5 171.2 171.1 171.2zM303 127.7c1.40039 6.2002 0.900391 -3 1 167.6c0 5.7002 -3.2998 9.10059 -9 8.7002
|
1618 |
+
c-1.7998 0 -14.0996 -2.40039 -115.1 -21.4004c-0.900391 0 -4.60059 -1 -6.7002 -2.69922c-2 -1.60059 -3.10059 -3.80078 -3.5 -6.40039c-1.7002 -6.7002 2.39941 -128 -2.60059 -133.7c-2.09961 -2.5 -4.69922 -3.2002 -7.69922 -3.7002
|
1619 |
+
c-17.7002 -3.19922 -29.6006 -4.7998 -38 -12.7998c-14.5 -14.2002 -7 -38.8994 14.3994 -42.8994c8 -1.40039 23.1006 0.599609 31.4004 5.19922c7.2998 3.80078 12.7998 10.6006 14.8994 19.6006c1.7002 7.7002 1.2002 2.39941 1.2002 118.5
|
1620 |
+
c0 5.7002 1.7002 7.2002 6.7002 8.2998c0 0 87.9004 16.4004 91.9004 17.0996c5.69922 1 8.39941 -0.5 8.39941 -6.09961c0 -78.7998 1 -77.2002 -2.2002 -80.7998c-2.09961 -2.5 -4.69922 -3.2002 -7.69922 -3.7002c-17.7002 -3.2002 -29.6006 -4.7998 -38 -12.7998
|
1621 |
+
c-10.6006 -10.4004 -10.4004 -26.7998 1.39941 -36.7998c9.7002 -7.80078 19.7998 -7.2002 31.9004 -5c13.7998 2.59961 24.0996 10.1992 27.2998 23.7998zM345.2 416c56.8994 0 102.8 -45.9004 102.8 -102.8v-242.4c0 -56.8994 -45.7998 -102.8 -102.8 -102.8h-242.4
|
1622 |
+
c-56.8994 0 -102.8 45.9004 -102.8 102.8v242.4c0 56.8994 45.9004 102.8 102.8 102.8h242.4zM223.6 4c106.301 0 192.5 86.2002 192.5 192.5s-86.1992 192.5 -192.5 192.5c-106.3 0 -192.5 -86.2002 -192.5 -192.5s86.2002 -192.5 192.5 -192.5z" />
|
1623 |
+
<glyph glyph-name="itunes-note" unicode="" horiz-adv-x="384"
|
1624 |
+
d="M381.9 59.7998c-6.40039 -27.3994 -27.2002 -42.7998 -55.1006 -48c-24.5 -4.5 -44.8994 -5.59961 -64.5 10.2002c-23.8994 20.0996 -24.2002 53.4004 -2.7002 74.4004c17 16.1992 40.9004 19.5 76.8008 25.7998c6 1.09961 11.1992 2.5 15.5996 7.39941
|
1625 |
+
c6.40039 7.2002 4.40039 4.10059 4.40039 163.2c0 11.2002 -5.5 14.2998 -17 12.2998c-8.2002 -1.39941 -185.7 -34.5996 -185.7 -34.5996c-10.2002 -2.2002 -13.4004 -5.2002 -13.4004 -16.7002c0 -234.7 1.10059 -223.899 -2.5 -239.5
|
1626 |
+
c-4.2002 -18.2002 -15.3994 -31.8994 -30.2002 -39.5c-16.7998 -9.2998 -47.1992 -13.3994 -63.3994 -10.3994c-43.2002 8.09961 -58.4004 58 -29.1006 86.5996c17 16.2002 40.9004 19.5 76.8008 25.7998c6 1.10059 11.1992 2.5 15.5996 7.40039
|
1627 |
+
c10.0996 11.5 1.7998 256.6 5.2002 270.2c0.799805 5.19922 3 9.59961 7.09961 12.8994c4.2002 3.5 11.7998 5.5 13.4004 5.5c204 38.2002 228.899 43.1006 232.399 43.1006c11.5 0.799805 18.1006 -6 18.1006 -17.6006c0.200195 -344.5 1.09961 -326 -1.7998 -338.5z" />
|
1628 |
+
<glyph glyph-name="jenkins" unicode="" horiz-adv-x="512"
|
1629 |
+
d="M487.1 23c1.5 -11.9004 -5.2998 -28.2998 -8.69922 -39.7002c-4.90039 -16.2998 -9.7002 -31.8994 -14.6006 -47.2002h-422c-0.700195 1.90039 -1.39941 4 -2.09961 6c-4.60059 14.2002 -12.6006 31.7002 -14.7002 45.8008
|
1630 |
+
c-3.09961 20.8994 16.5996 22.0996 29.2002 31.0996c19.5 14 34.7998 21.7998 55.8994 34.2998c6.30078 3.7998 25.1006 13.2002 27.3008 17.6006c4.2998 8.69922 -7.30078 20.8994 -10.4004 27.6992c-4.90039 10.7002 -7.5 19.8008 -8.2002 30.4004
|
1631 |
+
c-17.7002 2.7998 -31.0996 13.2998 -39.2002 25.2002c-13.3994 19.7002 -22.6992 56 -11.0996 83.7002c0.900391 2.19922 5.40039 6.5 6.09961 9.7998c1.40039 6.59961 -2.5 15.3994 -2.69922 22.3994c-1.2002 36 6.09961 67 30.2998 77.8008
|
1632 |
+
c9.7998 39.0996 45 52.1992 78.0996 71.5996c12.2998 7.2998 26 11.9004 40.1006 17.0996c50.5 18.7002 128.1 15.1006 170.1 -16.5996c17.7998 -13.5 46.2002 -41.9004 56.4004 -62.5c26.8994 -54.2998 25 -145.1 6.19922 -211.2
|
1633 |
+
c-2.5 -8.89941 -6.19922 -21.8994 -11.2998 -32.5996c-3.59961 -7.40039 -14.7002 -22.2998 -13.2998 -28.9004c1.40039 -6.7998 25.2998 -24.8994 30.4004 -29.8994c9.19922 -8.80078 26.7998 -20.7002 28.1992 -31.9004zM205.9 414.3
|
1634 |
+
c-33.2002 -9.39941 -75.7002 -33.5 -89.3008 -63.3994c10.6006 1.5 17.9004 6.7998 28.3008 7.5c3.89941 0.299805 9.09961 -1.60059 13.5996 -0.5c9 2.2998 16.5996 22.5 23.4004 30c6.59961 7.39941 14.5996 10.5 20 17.1992c3.5 1.7002 8.69922 1.60059 8.89941 6.80078
|
1635 |
+
c-1.5 1.69922 -3.09961 2.89941 -4.89941 2.39941zM101.1 320.7c-14.6992 -16.1006 -11.5996 -46.2998 -9.7998 -67.7998c26.5 16.6992 61.6006 -1.30078 61.2998 -29.6006c12.6006 0.299805 4.7002 15.7998 2.40039 25.7002c-7.5 32.5996 12.5996 67.9004 0.900391 97.5996
|
1636 |
+
c-22.7002 -1.7998 -41.3008 -11 -54.8008 -25.8994zM137.8 120.5c4.90039 -20 15.7002 -46 26.2998 -61.4004c13.6006 -19.3994 40.1006 -22.2998 68.7002 -24.1992c5.10059 11 23.9004 10.0996 36.2002 7.19922c-14.7002 5.80078 -28.4004 19.9004 -39.7002 32.4004
|
1637 |
+
c-13 14.2998 -26.0996 29.7002 -26.7998 48.4004c24.5 -34 44.7998 -63.8008 89.5 -78.8008c33.7998 -11.2998 73.2002 5.2002 99.2002 23.4004c10.7998 7.59961 17.2002 19.5996 24.8994 30.5996c28.7002 41.2002 42 100.101 39.1006 157.101
|
1638 |
+
c-1.2002 23.5 -1.10059 47 -9 62.7998c-8.2998 16.5996 -36.2002 31.2998 -52.5 16.4004c-3 16.0996 13.5996 26.0996 33.0996 20.2998c-13.8994 18 -28.5996 39.5996 -48.2998 50.7002c-34.4004 19.5 -92.7002 34.0996 -129.3 15.7998
|
1639 |
+
c-29.6006 -14.7002 -69.5 -39.1006 -83.1006 -70c12.7002 -29.7998 -3.7998 -57.1006 -4.7998 -87.4004c-0.599609 -16.0996 7.60059 -30.2002 8.2002 -47.7002c-4.40039 -7.19922 -17.7002 -8.09961 -26.9004 -7.59961c-3.09961 15.5 -8.5 32.9004 -24.5 34.7002
|
1640 |
+
c-22.5 2.39941 -39.0996 -16.2998 -40.0996 -35.7998c-1.2002 -23 17.7002 -61 44.4004 -58.4004c10.2998 1.09961 12.7998 11.4004 24.0996 11.2998c6.09961 -12.2002 -9.40039 -16 -11 -24.7002c-0.400391 -2.19922 1.2998 -11 2.2998 -15.0996zM359.8 -3.59961
|
1641 |
+
c-1.59961 -4.40039 0.299805 -10.4004 -0.599609 -16.5c14.8994 -4.2002 31.8994 -6.40039 50.7002 -7c3.69922 4.7998 4.89941 13.7998 4.5 22.7998c-0.600586 10.7998 -3.40039 33.0996 -10.1006 37c-14.0996 8.2002 -39 -16.5 -49.5996 -20.2998
|
1642 |
+
c1.2002 -3.40039 3.09961 -6 3.2002 -10.2002c6.2998 1.5 13.8994 0.5 19.2998 -2.2002c-6.2998 -0.700195 -13.2998 -0.599609 -17.4004 -3.59961zM342.6 16.4004c7.60059 5.5 14.3008 12 22.2002 17.0996c-18.2002 -1.59961 -41 -12.9004 -59 -4.90039
|
1643 |
+
c-0.0996094 -0.899414 -1.2998 -0.599609 -1.5 -1.39941c12.2998 -9.60059 21.5 -11.6006 38.2998 -10.7998zM330.5 -16.7998c26.9004 -8.40039 22.2002 36.7998 -2.7998 20.2002c-0.700195 -8.2002 1.2002 -10.8008 2.7998 -20.2002zM226 9.40039
|
1644 |
+
c0 6.19922 3.59961 12 2.7998 16.3994c-13.7998 2.40039 -31.8994 0.799805 -41.2998 7.2998c-9.59961 -9.69922 26.9004 -23 38.5 -23.6992zM57.7002 -49.0996v-0.100586h180.7c-0.800781 2.5 -1.5 4.90039 -2.2002 7.2002c-4.7998 15.2998 -7.5 26.7002 -8.7002 35.5
|
1645 |
+
c-19.2002 9.2002 -39.7002 18.5 -56.2002 30.2002c-3 2.2002 -23.3994 28.7002 -26.2002 27.5996c-36.8994 -14.5996 -71.3994 -39.7002 -102.199 -63.5c5.59961 -11.7998 10.5 -24.2002 14.7998 -36.8994zM298.3 -54.7998h-0.799805
|
1646 |
+
c0.299805 0.200195 0.5 0.399414 0.799805 0.5v-0.5zM305.8 -49.0996h9.60059c-1 1.5 -2.10059 2.89941 -3.2002 4.2998c-2.10059 -1.5 -4.2998 -2.90039 -6.40039 -4.2998zM320.9 -24.4004c0.0996094 3.60059 0.299805 7.2002 0.399414 10.6006
|
1647 |
+
c-6.5 3.2002 -14 5.5 -23.5 5.89941c6.5 3.30078 15.9004 3.2002 21.7998 7.10059c0.100586 1.5 0.100586 2.89941 0.200195 4.2998c-10.7998 0.900391 -14.7998 5.59961 -21.8994 9.5c-11.6006 6.40039 -29 13.2002 -43.9004 16.0996
|
1648 |
+
c-18.5 3.60059 -16.7998 -25.1992 -16 -42.3994c0.700195 -13.6006 7.7002 -28 10.7998 -37c1.5 -4.2002 1.7998 -8.7002 5.40039 -9.5c6.39941 -1.5 27.3994 6.89941 33.3994 10.2002c12.7002 6.89941 22.5 17.8994 33.3008 25.1992zM374.3 -49.0996l0.600586 12.5996
|
1649 |
+
c-11.2002 -0.700195 -17.5 10.2002 -25.4004 11c-6.90039 0.700195 -12.7002 -7.90039 -21.7002 -4.2002c-2 -2.2002 -3.89941 -4.7002 -6 -6.89941c3.2002 -3.90039 6.10059 -8.10059 8.90039 -12.5h17.3994c0.200195 3.19922 2.80078 5.7998 6.10059 5.7998
|
1650 |
+
s6 -2.60059 6.09961 -5.7998h14zM383 -49.0996h36.2998c-6.7002 10.1992 -20.0996 18.7998 -35.7002 11.5c-0.199219 -3.7002 -0.399414 -7.5 -0.599609 -11.5zM466.4 -12.0996c1.19922 6.19922 4.59961 19.5996 3.7998 25.0996
|
1651 |
+
c-1.40039 9.7998 -14.6006 17.0996 -21.4004 23.0996c-12.3994 11.1006 -20.2002 21 -33.2002 31.4004c-5.19922 -7.7998 -16.5 -13 -20.7998 -19.2998c30.7002 14.8994 36.2998 -55.7998 24.2002 -78.5c1.90039 -6.7998 8.2998 -9.40039 10.9004 -15.5
|
1652 |
+
c-0.700195 -1.10059 -1.30078 -2.2002 -1.90039 -3.2998h27.9004c0.199219 0 0.399414 0 0.599609 -0.100586c4.09961 13.1006 7.59961 25.9004 9.90039 37.1006zM222.2 317.5c5.39941 14.9004 27.2002 34.7002 45 32c7.7002 -1.2002 18 -8.2002 12.2002 -17.7002
|
1653 |
+
c-30.2002 7 -45.2002 -12.5996 -54.4004 -33.0996c-8.09961 2 -4.90039 13.0996 -2.7998 18.7998zM406.3 254.4c8.2002 3.59961 22.4004 0.699219 29.6006 5.2998c-4.2002 11.5 -10.3008 21.3994 -9.30078 37.7002c0.5 0 1 0 1.40039 -0.100586
|
1654 |
+
c6.7998 -14.2002 12.7002 -29.2002 21.4004 -41.7002c-5.7002 -13.5 -43.6006 -25.3994 -43.1006 -1.19922zM309.5 251.7c-6.7998 10.8994 -19 32.5 -14.5 45.2998c6.5 -11.9004 8.59961 -24.4004 17.7998 -33.2998c4.10059 -4 12.2002 -9 8.2002 -20.2002
|
1655 |
+
c-0.900391 -2.7002 -7.7998 -8.59961 -11.7002 -9.7002c-14.3994 -4.2998 -47.8994 -0.899414 -36.5996 17.1006c11.8994 -0.700195 27.8994 -7.80078 36.7998 0.799805zM336.8 181.7c3.7998 -6.60059 1.40039 -18.7002 12.1006 -20.6006
|
1656 |
+
c20.1992 -3.39941 43.5996 12.3008 58.0996 17.8008c9 15.1992 -0.799805 20.6992 -8.90039 30.5c-16.5996 20 -38.7998 44.7998 -38 74.6992c6.7002 4.90039 7.30078 -7.39941 8.2002 -9.69922c8.7002 -20.3008 30.4004 -46.2002 46.2998 -63.5
|
1657 |
+
c3.90039 -4.30078 10.3008 -8.40039 11 -11.2002c2.10059 -8.2002 -5.39941 -18 -4.5 -23.5c-21.6992 -13.9004 -45.7998 -29.1006 -81.3994 -25.6006c-7.40039 6.7002 -10.2998 21.4004 -2.90039 31.1006zM135.5 190.9c-6.7998 3.89941 -8.40039 21 -16.4004 21.3994
|
1658 |
+
c-11.3994 0.700195 -9.2998 -22.2002 -9.2998 -35.5c-7.7998 7.10059 -9.2002 29.1006 -3.5 40.2998c-6.59961 3.2002 -9.5 -3.59961 -13.0996 -5.89941c4.7002 34.0996 49.7998 15.7998 42.2998 -20.2998zM435.1 162.1c-10.0996 -19.1992 -24.3994 -40.3994 -54 -41
|
1659 |
+
c-0.599609 6.2002 -1.09961 15.6006 0 19.4004c22.7002 2.2002 36.6006 13.7002 54 21.5996zM293.2 149.7c18.8994 -9.90039 53.5996 -11 79.2998 -10.2002c1.40039 -5.59961 1.2998 -12.5996 1.40039 -19.4004c-33 -1.7998 -72 6.40039 -80.7002 29.6006zM385.4 103
|
1660 |
+
c-1.7002 -4.2998 -5.30078 -9.2998 -9.80078 -11.0996c-12.0996 -4.90039 -45.5996 -8.7002 -62.3994 0.299805c-10.7002 5.7002 -17.5 18.5 -23.4004 26c-2.7998 3.59961 -16.8994 12.8994 -0.200195 12.8994c13.1006 -32.6992 58 -29 95.8008 -28.0996z" />
|
1661 |
+
<glyph glyph-name="joget" unicode="" horiz-adv-x="496"
|
1662 |
+
d="M378.1 403c116.601 -71.7998 152.9 -224.6 81 -341.2c-71.8994 -116.5 -224.6 -152.8 -341.199 -80.8994c-116.601 71.8994 -152.9 224.6 -81 341.199c46.8994 76 128.1 117.9 211.3 117.9c44.3994 0 89.3994 -11.9004 129.899 -37zM429.9 79.7998
|
1663 |
+
c5.2998 8.7002 9.89941 17.6006 13.8994 26.6006c-32.0996 -1.10059 -157.1 1.5 -208.8 -17.6006c-58.4004 -21.5 -36.9004 -53.3994 -31.2002 -67.0996c3.7998 -9.10059 14.7002 -28.7998 23.7002 -42.4004c6.7998 -0.599609 13.5996 -1 20.4004 -1
|
1664 |
+
c71.5996 0 141.6 36 182 101.5zM229.1 166.1c51 -1.2998 205.4 -4.39941 230.301 -4.89941c11.8994 81.7998 -24.5 166.6 -99.3008 212.7c-100.5 61.8994 -232.1 30.6992 -294 -69.8008c-28.5996 -46.3994 -37.2998 -99.3994 -28.5 -149.1
|
1665 |
+
c11 40.9004 49.7002 131.5 178.301 140.2c50.8994 4 41.5 -19.2002 23.5996 -29.7002c-17.7998 -10.5 -45.7002 -23.7998 -68.9004 -51.2002c-23.1992 -27.3994 3 -46.7998 58.5 -48.2002zM412.9 220.9c22.6992 -6 19.0996 -15.5 19.0996 -15.5l-46.5 -23.4004
|
1666 |
+
l-169.5 -1.59961s33.7998 10.7998 65.2998 31.2998c26 16.8994 49.7002 35.5996 67.5 35.5996c3.7002 0 7.2002 -0.899414 10.4004 -2.7002c18.5 -10.5996 -2.90039 -18.1992 -13.4004 -24.5996s-50.7002 -34.5 -50.7002 -34.5s1.40039 -7.59961 31.1006 8.2002
|
1667 |
+
c29.7002 15.8994 64 33.2002 86.7002 27.2002z" />
|
1668 |
+
<glyph glyph-name="js" unicode=""
|
1669 |
+
d="M0 416h448v-448h-448v448zM243.8 66.5996v143.7h-42.0996v-143.1c0 -21.1006 -8.7998 -26.5 -22.6006 -26.5c-14.5 0 -20.5 9.89941 -27.0996 21.5996l-34.2998 -20.7002c10 -21.0996 29.5 -38.5 63.2002 -38.5c37.2998 0 62.8994 19.9004 62.8994 63.5zM343.4 3.09961
|
1670 |
+
c39.8994 0 69.6992 20.8008 69.6992 58.6006c0 35.2002 -20.0996 50.8994 -55.8994 66.2002l-10.5 4.5c-18.1006 7.89941 -25.9004 13 -25.9004 25.5996c0 10.2002 7.7998 18 20.1006 18c12.0996 0 19.8994 -5.09961 27.0996 -18l32.7998 21
|
1671 |
+
c-13.7998 24.4004 -33 33.7002 -59.7998 33.7002c-37.5 0 -61.5996 -24 -61.5996 -55.6006c0 -34.2998 20.0996 -50.5996 50.5 -63.5l10.5 -4.5c19.2998 -8.5 30.6992 -13.5996 30.6992 -28c0 -12.0996 -11.1992 -20.7998 -28.5996 -20.7998
|
1672 |
+
c-20.7002 0 -32.5 10.9004 -41.5 25.6006l-34.2998 -19.8008c12.2998 -24.3994 37.5996 -43 76.7002 -43z" />
|
1673 |
+
<glyph glyph-name="js-square" unicode=""
|
1674 |
+
d="M400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352zM243.8 66.5996v143.7h-42.0996v-143.1c0 -21.1006 -8.7998 -26.5 -22.6006 -26.5c-14.5 0 -20.5 9.89941 -27.0996 21.5996
|
1675 |
+
l-34.2998 -20.7002c10 -21.0996 29.5 -38.5 63.2002 -38.5c37.2998 0 62.8994 19.9004 62.8994 63.5zM343.4 3.09961c39.8994 0 69.6992 20.8008 69.6992 58.6006c0 35.2002 -20.0996 50.8994 -55.8994 66.2002l-10.5 4.5c-18.1006 7.89941 -25.9004 13 -25.9004 25.5996
|
1676 |
+
c0 10.2002 7.7998 18 20.1006 18c12.0996 0 19.8994 -5.09961 27.0996 -18l32.7998 21c-13.7998 24.4004 -33 33.7002 -59.7998 33.7002c-37.5 0 -61.5996 -24 -61.5996 -55.6006c0 -34.2998 20.0996 -50.5996 50.5 -63.5l10.5 -4.5
|
1677 |
+
c19.2998 -8.5 30.6992 -13.5996 30.6992 -28c0 -12.0996 -11.1992 -20.7998 -28.5996 -20.7998c-20.7002 0 -32.5 10.9004 -41.5 25.6006l-34.2998 -19.8008c12.2998 -24.3994 37.5996 -43 76.7002 -43z" />
|
1678 |
+
<glyph glyph-name="keycdn" unicode="" horiz-adv-x="512"
|
1679 |
+
d="M63.7998 38.7002l60.5 59c32.1006 -42.7998 71.1006 -66 126.601 -67.4004c30.5 -0.700195 60.2998 7 86.3994 22.4004c5.10059 -5.2998 18.5 -19.5 20.9004 -22c-32.2002 -20.7002 -69.6006 -31.1006 -108.101 -30.2002
|
1680 |
+
c-43.2998 1.09961 -84.5996 16.7002 -117.699 44.4004c0.299805 0.599609 -38.2002 -37.5 -38.6006 -37.9004c9.5 -29.7998 -13.0996 -62.4004 -46.2998 -62.4004c-26.7998 0.100586 -47.5 21.7002 -47.5 48.5c0 34.3008 33.0996 56.6006 63.7998 45.6006zM418.7 291.1
|
1681 |
+
c19.0996 -31.2998 29.5996 -67.3994 28.7002 -104c-1.10059 -44.7998 -19 -87.5 -48.6006 -121c0.299805 -0.299805 23.7998 -25.1992 24.1006 -25.5c9.59961 1.30078 19.1992 -2 25.8994 -9.09961c11.2998 -12 10.9004 -30.9004 -1.09961 -42.4004
|
1682 |
+
c-12 -11.2998 -30.9004 -10.8994 -42.4004 1.10059c-6.7002 7 -9.39941 16.7998 -7.59961 26.2998c-24.9004 26.5996 -44.4004 47.2002 -44.4004 47.2002c42.7002 34.0996 63.2998 79.5996 64.4004 124.2c0.700195 28.8994 -7.2002 57.1992 -21.1006 82.1992zM104 394.9
|
1683 |
+
c6.7002 -7 9.40039 -16.8008 7.59961 -26.3008l45.9004 -48.0996c-4.7002 -3.7998 -13.2998 -10.4004 -22.7998 -21.2998c-25.4004 -28.5 -39.6006 -64.7998 -40.7002 -102.9c-0.700195 -28.8994 6.09961 -57.2002 20 -82.3994l-22 -21.5
|
1684 |
+
c-19.2998 31.5996 -28.9004 67.6992 -27.7998 104.699c1 44.6006 18.2998 87.6006 47.5 121.101l-25.2998 26.3994c-9.60059 -1.2998 -19.2002 2 -25.9004 9.10059c-11.2998 12 -10.9004 30.8994 1.09961 42.3994c11.9004 11.2002 30.6006 10.9004 42.4004 -1.19922z
|
1685 |
+
M464.9 440c26 0 47.0996 -22.4004 47.0996 -48.2998c0 -25.9004 -21.0996 -47.7002 -47.0996 -47.7002c-6.30078 -0.0996094 -14 1.09961 -15.9004 1.7998l-62.9004 -59.7002c-32.6992 43.6006 -76.6992 65.9004 -126.899 67.2002
|
1686 |
+
c-30.5 0.700195 -60.2998 -6.7998 -86.2002 -22.3994l-21.0996 22c32.1992 20.7998 69.5996 31.0996 108.1 30.1992c43.2998 -1.09961 84.5996 -16.6992 117.7 -44.5996l41.0996 38.5996c-1.5 4.7002 -2.2002 9.60059 -2.2002 14.5
|
1687 |
+
c-0.0996094 26.7002 22.3008 48.4004 48.3008 48.4004zM256.7 334.6c5.5 0 10.8994 -0.399414 16.3994 -1.09961c78.1006 -9.7998 133.4 -81.0996 123.801 -159.1c-9.80078 -78.1006 -81.1006 -133.4 -159.101 -123.801c-78.0996 9.80078 -133.399 81.1006 -123.8 159.2
|
1688 |
+
c9.2998 72.4004 70.0996 124.601 142.7 124.8zM197.7 215.2c0.599609 -22.7002 12.2002 -41.7998 32.3994 -52.2002l-11 -51.7002h73.7002l-11 51.7002c20.1006 10.9004 32.1006 29 32.4004 52.2002c-0.400391 32.7998 -25.7998 57.5 -58.2998 58.2998
|
1689 |
+
c-32.1006 -0.799805 -57.3008 -24.7998 -58.2002 -58.2998zM256 288z" />
|
1690 |
+
<glyph glyph-name="kickstarter" unicode=""
|
1691 |
+
d="M400 -32h-352c-26.4004 0 -48 21.5996 -48 48v352c0 26.4004 21.5996 48 48 48h352c26.4004 0 48 -21.5996 48 -48v-352c0 -26.4004 -21.5996 -48 -48 -48zM199.6 269.5c0 30.7002 -17.5996 45.0996 -39.6992 45.0996c-25.8008 0 -40 -19.7998 -40 -44.5v-154.8
|
1692 |
+
c0 -25.7998 13.6992 -45.5996 40.5 -45.5996c21.5 0 39.1992 14 39.1992 45.5996v41.7998l60.6006 -75.6992c12.2998 -14.9004 39 -16.8008 55.7998 0c14.5996 15.0996 14.7998 36.7998 4 50.3994l-49.0996 62.7998l40.5 58.7002c9.39941 13.5 9.5 34.5 -5.60059 49.1006
|
1693 |
+
c-16.3994 15.8994 -44.5996 17.2998 -61.3994 -7l-44.8008 -64.7002v38.7998z" />
|
1694 |
+
<glyph glyph-name="kickstarter-k" unicode="" horiz-adv-x="384"
|
1695 |
+
d="M147.3 333.6v-70.5996l82.7998 118.2c31.2002 44.3994 83.3008 41.7998 113.601 12.7998c27.8994 -26.7002 27.7998 -65.0996 10.3994 -89.7998l-74.8994 -107.4l90.7998 -114.8c19.9004 -24.7998 19.5996 -64.5996 -7.40039 -92.2002
|
1696 |
+
c-31.0996 -30.7002 -80.5 -27.2002 -103.199 0l-112.101 138.3v-76.5c0 -57.7998 -32.5996 -83.3994 -72.3994 -83.3994c-49.6006 0 -74.9004 36.0996 -74.9004 83.3994v283c0 45.2002 26.2002 81.4004 73.9004 81.4004c40.8994 0 73.3994 -26.2002 73.3994 -82.4004z" />
|
1697 |
+
<glyph glyph-name="laravel" unicode="" horiz-adv-x="640"
|
1698 |
+
d="M637.5 206.4c4.2998 -4.80078 3.2002 -8.60059 -4.7002 -10.6006c-6.7002 -1.89941 -69.5996 -18.5996 -87.2998 -23.2998c25.7998 -34.5996 75.0996 -100.6 79.2998 -106.8c5.7002 -8.5 0.5 -10.9004 -7.89941 -14.4004c-8.40039 -3.39941 -195.2 -70.5996 -208 -74.5
|
1699 |
+
c-16.3008 -5 -23.7002 -7.5 -34.3008 7.40039c-8 11.0996 -51.0996 88.7002 -72.1992 127c-40 -10.5 -113.2 -29.6006 -134.301 -34.7002c-20.5996 -5 -29.3994 7.40039 -32.7998 15c-3.39941 7.59961 -124.8 269.2 -132.399 287.2c-7.60059 18 0.799805 21.3994 8.39941 22
|
1700 |
+
c7.60059 0.700195 114.5 9.59961 128.5 10.2002c14 0.699219 15.2998 -2.5 21.4004 -11.6006l154.2 -257.5l193.699 46.4004c-10.7998 15.2002 -59.5 84.2998 -64.1992 90.8994c-5.30078 7.40039 0.0996094 10.8008 8.69922 12.3008
|
1701 |
+
c8.60059 1.39941 82.7002 13.8994 89.1006 14.7998c6.2998 0.899414 11.3994 3.09961 21.7002 -9.2998c10.2998 -12.4004 68.8994 -85.7002 73.0996 -90.5zM285.3 134.4c2.2998 0.5 3.7998 1.7998 1.2002 6.09961c-2.40039 4.2998 -144.6 249.7 -144.6 249.7
|
1702 |
+
c-1.30078 2.2002 -0.900391 3 -4.5 2.7998c-3.5 -0.200195 -104.301 -9.2002 -106 -9.2002c-1.7002 0 -1.80078 -2.59961 0 -5.89941c1.7998 -3.30078 130.1 -268 130.8 -270s0.700195 -2.60059 6.5 -1.30078c5.7998 1.30078 114.3 27.3008 116.6 27.8008zM591.3 77
|
1703 |
+
c-1.7002 2.7002 -61.2002 83.4004 -64.0996 88.2002c-3 4.7002 -4.5 3.7002 -9.2002 2.2002l-188.8 -49.1006s58 -100.3 62.3994 -106.8c4.40039 -6.5 7.10059 -6 10.6006 -4.5c3.39941 1.5 181.7 61.5996 187.1 63.5996c5.5 1.90039 3.7002 3.7002 2 6.40039zM603.4 211.1
|
1704 |
+
c4.19922 1 7.39941 2.40039 5.59961 4.7002c-1.90039 2.40039 -50.9004 64.5 -54.5 69.4004c-3.59961 4.89941 -6.09961 4.09961 -9 3.39941c-2.90039 -0.599609 -67.2998 -12.2998 -71.2998 -12.7998s-2.7002 -2.7002 -1.10059 -5l56.7002 -77.7998
|
1705 |
+
s69.4004 17.2002 73.6006 18.0996z" />
|
1706 |
+
<glyph glyph-name="line" unicode=""
|
1707 |
+
d="M272.1 243.8v-71.0996c0 -1.7998 -1.39941 -3.2002 -3.19922 -3.2002h-11.4004c-1.09961 0 -2.09961 0.599609 -2.59961 1.2998l-32.6006 44v-42.2002c0 -1.7998 -1.39941 -3.19922 -3.2002 -3.19922h-11.3994c-1.7998 0 -3.2002 1.39941 -3.2002 3.19922v71.1006
|
1708 |
+
c0 1.7998 1.40039 3.2002 3.2002 3.2002h11.2998c1 0 2.09961 -0.5 2.59961 -1.40039l32.6006 -44v42.2002c0 1.7998 1.39941 3.2002 3.2002 3.2002h11.3994c1.7998 0.0996094 3.2998 -1.40039 3.2998 -3.10059zM190.1 247c1.80078 0 3.2002 -1.5 3.2002 -3.2002v-71.0996
|
1709 |
+
c0 -1.7998 -1.39941 -3.2002 -3.2002 -3.2002h-11.3994c-1.7998 0 -3.2002 1.40039 -3.2002 3.2002v71.0996c0 1.7998 1.40039 3.2002 3.2002 3.2002h11.3994zM162.6 187.4c1.7002 0 3.10059 -1.5 3.10059 -3.2002v-11.4004c0 -1.7998 -1.40039 -3.2002 -3.2002 -3.2002
|
1710 |
+
h-45.7002c-0.899414 0 -1.59961 0.400391 -2.2002 0.900391c-0.599609 0.599609 -0.899414 1.2998 -0.899414 2.2002v71.0996c0 1.7998 1.39941 3.2002 3.2002 3.2002h11.3994c1.7998 0 3.2002 -1.40039 3.2002 -3.2002v-56.3994h31.0996zM332.1 247
|
1711 |
+
c1.7002 0 3.10059 -1.5 3.2002 -3.2002v-11.3994c0 -1.80078 -1.39941 -3.2002 -3.2002 -3.2002h-31.0996v-12h31.0996c1.80078 0 3.2002 -1.40039 3.2002 -3.2002v-11.5c0 -1.7998 -1.39941 -3.2002 -3.2002 -3.2002h-31.0996v-12h31.0996
|
1712 |
+
c1.80078 0 3.2002 -1.39941 3.2002 -3.2002v-11.3994c0 -1.7998 -1.39941 -3.2002 -3.2002 -3.2002h-45.6992c-1.80078 0 -3.2002 1.5 -3.2002 3.2002v71.0996c0 1.7998 1.5 3.2002 3.2002 3.2002h45.6992zM448 334.3v-285.3
|
1713 |
+
c-0.0996094 -44.7998 -36.7998 -81.0996 -81.7002 -81h-285.3c-44.7998 0.0996094 -81.0996 36.9004 -81 81.7002v285.3c0.0996094 44.7998 36.9004 81.0996 81.7002 81h285.3c44.7998 -0.0996094 81.0996 -36.7998 81 -81.7002zM386.4 211.7
|
1714 |
+
c0 73 -73.2002 132.399 -163.101 132.399c-89.8994 0 -163.1 -59.3994 -163.1 -132.399c0 -65.4004 58 -120.2 136.399 -130.601c19.1006 -4.09961 16.9004 -11.0996 12.6006 -36.7998c-0.700195 -4.09961 -3.2998 -16.0996 14.0996 -8.7998
|
1715 |
+
c17.4004 7.2998 93.9004 55.2998 128.2 94.7002c23.5996 26 34.9004 52.2998 34.9004 81.5z" />
|
1716 |
+
<glyph glyph-name="lyft" unicode="" horiz-adv-x="512"
|
1717 |
+
d="M0 366.9h77.7998v-208.7c0 -33.1006 15 -52.7998 27.2002 -61c-12.7002 -11.1006 -51.2002 -20.9004 -80.2002 2.7998c-17 14 -24.7998 37.2998 -24.7998 59v207.9zM485.9 193.4c0 -14.2002 11.5996 -25.9004 26.0996 -25.9004v-76.5
|
1718 |
+
c-56.7002 0 -102.7 46.0996 -102.7 102.7v77.0996c0 34.6006 -52.2002 34.6006 -52.2002 0v-23.2998h38.8008v-76.7998h-38.8008v-6.7002c0 -21.7998 -7.69922 -45 -24.7998 -59c-16.2998 -13.7002 -35.7002 -16.2998 -51.7002 -14v179.2
|
1719 |
+
c0 56.7002 46.1006 102.7 102.7 102.7c49.1006 0 90.2002 -34.4004 100.3 -80.7002h26.1006v-76.7998h-23.7998v-22zM191.6 292.4v0.5h77.1006v-178.2c0 -52.4004 -29.7002 -91.7002 -76.7998 -100.8c-26.1006 -5.10059 -52.5 -2.80078 -77.6006 4.69922v70.3008
|
1720 |
+
c9.7998 -4.2002 29.5 -9.40039 45 -7.80078c20.4004 2 32.7998 11.9004 34.9004 25.3008c0 0 -21.2002 -20.4004 -58.2002 -10.6006c-37 9.90039 -45 40.1006 -45 63.9004v132.7h76.7998v-113c0 -15.4004 23.7998 -15.4004 23.7998 0v113z" />
|
1721 |
+
<glyph glyph-name="magento" unicode=""
|
1722 |
+
d="M445.7 320.1v-256.1l-63.4004 -36.5v255.8l-158.5 91.6006l-158.6 -91.6006l0.399414 -255.899l-63.2998 36.5996v255.9l221.9 128.1zM255.6 27.5v255.9l63.4004 -36.6006v-256l-95.0996 -54.8994l-94.9004 54.8994l-0.0996094 255.9l63.2998 36.5996v-256
|
1723 |
+
l31.7998 -18.2002z" />
|
1724 |
+
<glyph glyph-name="medapps" unicode="" horiz-adv-x="320"
|
1725 |
+
d="M118.3 209.6c3.5 12.5 6.90039 33.6006 13.2002 33.6006c8.2998 -1.7998 9.59961 -23.4004 18.5996 -36.6006c4.60059 23.5 5.30078 85.1006 14.1006 86.7002c9 0.700195 19.7002 -66.5 22 -77.5c9.89941 -4.09961 48.8994 -6.59961 48.8994 -6.59961
|
1726 |
+
c1.90039 -7.2998 -24 -7.60059 -40 -7.7998c-4.59961 -14.8008 -5.39941 -27.7002 -11.3994 -28c-4.7002 -0.200195 -8.2002 28.7998 -17.5 49.5996l-9.40039 -65.5c-4.39941 -13 -15.5 22.5 -21.8994 39.2998c-3.30078 0.100586 -62.4004 1.60059 -47.6006 7.7998zM228 0
|
1727 |
+
h-136c-21.2002 0 -21.2002 32 0 32h136c21.2002 0 21.2002 -32 0 -32zM204 -64h-88c-21.2002 0 -21.2002 32 0 32h88c21.2002 0 21.2002 -32 0 -32zM238.2 77.5c-3.60059 -21.2998 -36 -15.5 -32.6006 5.09961c3.60059 21.2002 5.60059 40.6006 15.3008 58.6006
|
1728 |
+
c32.5996 60.2998 66.0996 95.5 66.0996 151.6c0 67.9004 -57 123.2 -127 123.2s-127 -55.2998 -127 -123.2c0 -56.0996 33.5 -91.2998 66.0996 -151.7c9.7002 -17.8994 11.7002 -36.8994 15.3008 -58.5996c3.5 -20.7998 -29.1006 -26.0996 -32.6006 -5.09961
|
1729 |
+
c-3.2002 19.0996 -5.2002 36.3994 -11.8994 48.8994c-8 14.7002 -16.1006 28.1006 -24 41c-24.6006 40.4004 -45.9004 75.2998 -45.9004 125.5c0 85.6006 71.7998 155.2 160 155.2s160 -69.5996 160 -155.2c0 -50.2998 -21.2998 -85.0996 -45.9004 -125.5
|
1730 |
+
c-7.89941 -12.8994 -16.0996 -26.2998 -24 -41c-6.69922 -12.3994 -8.69922 -29.8994 -11.8994 -48.7998z" />
|
1731 |
+
<glyph glyph-name="medium-m" unicode="" horiz-adv-x="512"
|
1732 |
+
d="M71.5 305.7c0.599609 5.89941 -1.7002 11.7998 -6.09961 15.7998l-45.1006 54.4004v8.09961h140.2l108.4 -237.7l95.2998 237.7h133.7v-8.09961l-38.6006 -37c-3.2998 -2.5 -5 -6.7002 -4.2998 -10.8008v-272c-0.700195 -4.09961 1 -8.2998 4.2998 -10.7998l37.7002 -37
|
1733 |
+
v-8.09961h-189.7v8.09961l39.1006 37.9004c3.7998 3.7998 3.7998 5 3.7998 10.7998v219.8l-108.7 -275.899h-14.7002l-126.399 275.899v-184.899c-1.10059 -7.80078 1.5 -15.6006 7 -21.2002l50.7998 -61.6006v-8.09961h-144v8l50.7998 61.7002
|
1734 |
+
c5.40039 5.59961 7.90039 13.5 6.5 21.2002v213.8z" />
|
1735 |
+
<glyph glyph-name="medrt" unicode="" horiz-adv-x="544"
|
1736 |
+
d="M113.7 192c0 -121.8 83.8994 -222.8 193.5 -241.1c-18.7002 -4.5 -38.2002 -6.90039 -58.2002 -6.90039c-137.6 0 -249 111 -249 248s111.4 248 248.9 248c20.0996 0 39.5996 -2.40039 58.1992 -6.90039c-109.6 -18.2998 -193.399 -119.3 -193.399 -241.1zM411.1 91.7002
|
1737 |
+
c77.7002 55.3994 104.4 155.1 67 233.899c11.2002 -9.89941 21.5 -21.2998 30.5 -34.1992c61.6006 -88.3008 40.8008 -210.301 -46.5 -272.601c-87.2998 -62.2998 -208.1 -41.2002 -269.699 47c-9 12.7998 -16.2002 26.4004 -21.7002 40.5
|
1738 |
+
c60.7998 -62.0996 162.7 -70 240.399 -14.5996zM192.3 335.7c72.5 54.5996 171.601 45.7002 221.601 -19.7998c45.2998 -59.7002 34.3994 -145.601 -22.3008 -201.801c18.5 51.4004 11.3008 111 -24.3994 158c-43 56.5 -114.601 78.3008 -178.9 60.5
|
1739 |
+
c1.2998 1 2.60059 2.10059 4 3.10059zM296 224h40c4.40039 0 8 -3.59961 8 -8v-48c0 -4.40039 -3.59961 -8 -8 -8h-40c-4.40039 0 -8 -3.59961 -8 -8v-40c0 -4.40039 -3.59961 -8 -8 -8h-48c-4.40039 0 -8 3.59961 -8 8v40c0 4.40039 -3.59961 8 -8 8h-40
|
1740 |
+
c-4.40039 0 -8 3.59961 -8 8v48c0 4.40039 3.59961 8 8 8h40c4.40039 0 8 3.59961 8 8v40c0 4.40039 3.59961 8 8 8h48c4.40039 0 8 -3.59961 8 -8v-40c0 -4.40039 3.59961 -8 8 -8z" />
|
1741 |
+
<glyph glyph-name="microsoft" unicode=""
|
1742 |
+
d="M0 416h214.6v-214.6h-214.6v214.6zM233.4 416h214.6v-214.6h-214.6v214.6zM0 182.6h214.6v-214.6h-214.6v214.6zM233.4 182.6h214.6v-214.6h-214.6v214.6z" />
|
1743 |
+
<glyph glyph-name="mix" unicode=""
|
1744 |
+
d="M0 384h448v-204.1c0 -56.6006 -88 -59.9004 -88 0v23.7998c0 56.7998 -82.7002 59 -88 4.2998v-116.1c0 -58 -96 -57.9004 -96 0v175.3c0 56.8994 -80.0996 59.3994 -88 6.5v-238.601c0 -58.0996 -88 -56.1992 -88 0v348.9z" />
|
1745 |
+
<glyph glyph-name="mizuni" unicode="" horiz-adv-x="496"
|
1746 |
+
d="M248 440c137 0 248 -111.1 248 -248c0 -137 -111 -248 -248 -248s-248 111 -248 248c0 136.9 111 248 248 248zM168 88.0996v223.9c0 22.0996 -17.9004 40 -40 40s-40 -17.9004 -40 -40v-272.1c21.2002 20.8994 48.5996 37.5996 80 48.1992zM288 98v214
|
1747 |
+
c0 22.0996 -17.9004 40 -40 40s-40 -17.9004 -40 -40v-214c13 2 26.4004 3.09961 40.2002 3.09961c13.5996 0 26.8994 -1.09961 39.7998 -3.09961zM408 40.2998v271.7c0 22.0996 -17.9004 40 -40 40s-40 -17.9004 -40 -40v-223.7c31.4004 -10.5996 58.7998 -27.2002 80 -48z
|
1748 |
+
" />
|
1749 |
+
<glyph glyph-name="monero" unicode="" horiz-adv-x="496"
|
1750 |
+
d="M352 64h108.4c-43.4004 -71.9004 -122.301 -120 -212.4 -120s-169 48.0996 -212.4 120h108.4v127.8l104 -104.8l104 105v-128zM88 112h-74.7998c-8.60059 25.0996 -13.2002 52 -13.2002 80c0 137 111 248 248 248s248 -111 248 -248c0 -28 -4.7002 -54.9004 -13.2002 -80
|
1751 |
+
h-74.7998v208l-160.6 -159.4l-159.4 159.4v-208z" />
|
1752 |
+
<glyph glyph-name="napster" unicode="" horiz-adv-x="496"
|
1753 |
+
d="M298.3 74.4004c-14.2002 -13.6006 -31.2998 -24.1006 -50.3994 -30.5c-19 6.39941 -36.2002 16.8994 -50.3008 30.5h100.7zM342.3 274c-56.3994 39.7998 -132.1 39.9004 -188.899 -0.0996094c-19.9004 16.7998 -43.6006 29.5 -69.5 36.3994v-161.6
|
1754 |
+
c0 -217.3 328 -219.101 328 0.299805v161.2c-26 -7 -49.6006 -19.2998 -69.6006 -36.2002zM133.5 332.5c6.5 -3.2002 14.0996 -7.40039 20.4004 -11.4004c58.6992 30.5 129.199 30.6006 187.899 0.100586c6.7002 4.2002 13.5 8 20.6006 11.5
|
1755 |
+
c-64.6006 59.8994 -164.5 59.7998 -228.9 -0.200195zM43.7998 354.8c17.5 -0.5 34.2998 -3.09961 50.6006 -7.5c82 91.6006 225.5 91.6006 307.5 0.100586c16.0996 4.39941 32.7998 6.89941 50.0996 7.39941v-69.2002c58.7002 -36.5 58.5 -121.899 -0.200195 -158.199
|
1756 |
+
l-0.299805 -1.7002c-25.9004 -238.8 -381.2 -243.601 -407.6 1.5c-58.5 37.2002 -58.5 121.8 -0.100586 158.3v69.2998zM259.2 96c13.0996 59.2998 33.5 56 113 55.4004c-0.799805 -8.2002 0.0996094 -32.3008 -26.2002 -47.4004c-4.40039 -2.5 -15.2998 -6 -25.5 -6.5
|
1757 |
+
c-25.2998 -1.2002 -61.2998 -1.5 -61.2998 -1.5zM123.7 151.3c79.2998 0.700195 99.7998 4 113 -55.3994c0 0 -36 0.399414 -61.2998 1.5c-10.3008 0.5 -21.1006 4 -25.5 6.5c-26.3008 15.0996 -25.4004 39.1992 -26.2002 47.3994zM292.8 27.9004
|
1758 |
+
c3 -4.90039 3.2002 -8.80078 3.2998 -8.90039c-29.0996 -17.5996 -67.0996 -17.5996 -96.1992 0c0 0 0.899414 5.5 3.69922 9.59961c3.5 5.10059 6.40039 6.60059 6.40039 6.60059c23.7002 -6.90039 51.0996 -7.2998 75.9004 0c0 0 3.69922 -2 6.89941 -7.2998z" />
|
1759 |
+
<glyph glyph-name="node-js" unicode=""
|
1760 |
+
d="M224 -60c-6.7002 0 -13.5 1.7998 -19.4004 5.2002l-61.6992 36.5c-9.2002 5.2002 -4.7002 7 -1.7002 8c12.2998 4.2998 14.7998 5.2002 27.8994 12.7002c1.40039 0.799805 3.2002 0.5 4.60059 -0.400391l47.3994 -28.0996c1.7002 -1 4.10059 -1 5.7002 0l184.7 106.6
|
1761 |
+
c1.7002 1 2.7998 3 2.7998 5v213.2c0 2.09961 -1.09961 4 -2.89941 5.09961l-184.601 106.5c-1.7002 1 -4 1 -5.7002 0l-184.5 -106.6c-1.7998 -1 -2.89941 -3 -2.89941 -5.10059v-213.1c0 -2 1.09961 -4 2.89941 -4.90039l50.6006 -29.1992
|
1762 |
+
c27.5 -13.7002 44.2998 2.39941 44.2998 18.6992v210.4c0 3 2.40039 5.2998 5.40039 5.2998h23.3994c2.90039 0 5.40039 -2.2998 5.40039 -5.2998v-210.5c0 -36.5996 -20 -57.5996 -54.7002 -57.5996c-10.7002 0 -19.0996 0 -42.5 11.5996l-48.4004 27.9004
|
1763 |
+
c-12 6.89941 -19.3994 19.7998 -19.3994 33.6992v213.101c0 13.7998 7.39941 26.7998 19.3994 33.7002l184.5 106.6c11.7002 6.59961 27.2002 6.59961 38.8008 0l184.699 -106.7c12 -6.89941 19.4004 -19.7998 19.4004 -33.7002v-213.1
|
1764 |
+
c0 -13.7998 -7.40039 -26.7002 -19.4004 -33.7002l-184.699 -106.6c-5.90039 -3.40039 -12.6006 -5.2002 -19.4004 -5.2002zM373.1 150.1c0 -40.1992 -33.5996 -63.2998 -92 -63.3994c-80.8994 0 -97.7998 37.0996 -97.7998 68.2002c0 2.89941 2.2998 5.2998 5.2998 5.2998
|
1765 |
+
h23.9004c2.7002 0 4.90039 -1.90039 5.2998 -4.5c3.60059 -24.2998 14.2998 -36.6006 63.2002 -36.6006c38.9004 0 55.5 8.80078 55.5 29.4004c0 11.9004 -4.7002 20.7998 -65.2002 26.7002c-50.5 5 -81.7998 16.2002 -81.7998 56.5996c0 37.2998 31.4004 59.5 84.0996 59.5
|
1766 |
+
c59.2002 0 88.5 -20.5 92.2002 -64.5996c0.100586 -1.5 -0.399414 -3 -1.39941 -4.10059c-1 -1.09961 -2.40039 -1.69922 -3.90039 -1.69922h-24c-2.5 0 -4.7002 1.7998 -5.2002 4.19922c-5.7998 25.6006 -19.7998 33.8008 -57.7002 33.8008
|
1767 |
+
c-42.5 0 -47.3994 -14.8008 -47.3994 -25.9004c0 -13.4004 5.7998 -17.2998 63.2002 -24.9004c56.6992 -7.5 83.6992 -18.0996 83.6992 -58z" />
|
1768 |
+
<glyph glyph-name="npm" unicode="" horiz-adv-x="576"
|
1769 |
+
d="M288 160h-32v64h32v-64zM576 288v-192h-288v-32h-128v32h-160v192h576zM160 256h-128v-128h64v96h32v-96h32v128zM320 256h-128v-160h64v32h64v128zM544 256h-192v-128h64v96h32v-96h32v96h32v-96h32v128z" />
|
1770 |
+
<glyph glyph-name="ns8" unicode="" horiz-adv-x="640"
|
1771 |
+
d="M187.1 288.1h44.9004l-48.5 -160.1h-56.9004l-50.5996 106.5l-31.0996 -106.5h-44.9004l49 160.1h49.4004l54.5 -113.699zM639.6 289c4.60059 -28.5996 -36.0996 -44.7002 -65.6992 -50.5996h-0.100586c17.5 -29.3008 22.1006 -69.3008 3.40039 -105.5
|
1772 |
+
c-26.4004 -51.2002 -86.5 -79.9004 -135.101 -68c-29.3994 7.19922 -51.3994 29 -56.7998 59.5c-0.700195 3.5 -1 7.09961 -1.2002 10.7998c-5.5 -2.7998 -11.8994 -4.2002 -18.5 -4.90039c-15.5996 -1.7002 -21 -2.2998 -160.899 -2.2998l11.5996 39.5h126.8
|
1773 |
+
c9.10059 0 12.2002 3.2002 13.8008 7.40039c1.69922 4.59961 3.39941 10.1992 4.5 14.5996c1.09961 3.90039 0.0996094 6.59961 -7.7002 6.59961h-87.2998c-33.4004 0 -38.2002 9.2002 -32.8008 28.6006c3.2002 11.5 10.8008 37.2002 17.6006 47.0996
|
1774 |
+
c7.09961 10.2002 18.2998 13.7002 30.5996 15c15.6006 1.7002 20.4004 1.2002 160.101 1.2002l-9.7002 -31.5h-133.5c-5.5 0 -11.2002 -0.700195 -13.2998 -7.09961c-1.80078 -5.40039 -2.10059 -6.7002 -3.7002 -12.2002c-1.40039 -5.10059 2.2002 -7.40039 11.5 -7.40039
|
1775 |
+
h87.5996c20.4004 0 31 -6.7998 34 -16.5996c19.9004 21.3994 50.4004 39.5 94.2002 48.2002v0.0996094c-13.4004 42.5 43.9004 66.5996 88.5 58.7998c18.2002 -3.2002 39.2002 -13.2998 42.0996 -31.2998zM530.7 184.3c3.09961 15.7998 -0.5 33.7002 -7.2002 47.7998
|
1776 |
+
c-23.2998 -2.89941 -52.2998 -10.0996 -68.5 -26.8994c-24.4004 -25.2998 -16.7998 -60 14.0996 -64.7998c25 -3.90039 55.7002 14.3994 61.6006 43.8994zM552.5 267.4c10.5996 1.5 23.5 3.5 34.2002 9.59961c14.7998 8.5 10.3994 21 -4.90039 24.4004
|
1777 |
+
c-10.8994 2.39941 -25.0996 -0.5 -31.7998 -7.7002c-7.2998 -7.7998 -1.7002 -20.2998 2.5 -26.2998z" />
|
1778 |
+
<glyph glyph-name="nutritionix" unicode="" horiz-adv-x="400"
|
1779 |
+
d="M88 439.9c0 0 133.4 8.19922 121 -104.4c0 0 19.0996 74.9004 103 40.5996c0 0 -17.7002 -74 -88 -56c0 0 14.5996 54.6006 66.0996 56.6006c0 0 -39.8994 10.2998 -82.0996 -48.7998c0 0 -19.7998 94.5 -93.5996 99.6992c0 0 75.1992 -19.3994 77.5996 -107.5
|
1780 |
+
c0 -0.0996094 -106.4 -7 -104 119.801zM400 124.3c0 -48.5 -9.7002 -95.2998 -32 -132.3c-42.2002 -30.9004 -105 -48 -168 -48c-62.9004 0 -125.8 17.0996 -168 48c-22.2998 37 -32 83.7998 -32 132.3c0 48.4004 17.7002 94.7002 40 131.7
|
1781 |
+
c42.2002 30.9004 97.0996 48.5996 160 48.5996c63 0 117.8 -17.5996 160 -48.5996c22.2998 -37 40 -83.2998 40 -131.7zM120 20c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM120 86.2002c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28
|
1782 |
+
s12.5 -28 28 -28s28 12.5 28 28zM120 152.4c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM192 20c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM192 86.2002c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28
|
1783 |
+
s12.5 -28 28 -28s28 12.5 28 28zM192 152.4c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM264 20c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM264 86.2002c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28
|
1784 |
+
s12.5 -28 28 -28s28 12.5 28 28zM264 152.4c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM336 20c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM336 86.2002c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28
|
1785 |
+
s12.5 -28 28 -28s28 12.5 28 28zM336 152.4c0 15.5 -12.5 28 -28 28s-28 -12.5 -28 -28s12.5 -28 28 -28s28 12.5 28 28zM360 192c-4.7998 22.2998 -7.40039 36.9004 -16 56c-38.7998 19.9004 -90.5 32 -144 32s-105.2 -12.0996 -144 -32
|
1786 |
+
c-8.7998 -19.5 -11.2002 -33.9004 -16 -56c42.2002 7.90039 98.7002 14.7998 160 14.7998s117.8 -6.89941 160 -14.7998z" />
|
1787 |
+
<glyph glyph-name="page4" unicode="" horiz-adv-x="496"
|
1788 |
+
d="M248 -56c-137 0 -248 111 -248 248s111 248 248 248c20.9004 0 41.2998 -2.59961 60.7002 -7.5l-266.4 -376.5h205.7v-112zM248 87.5996h-149.4l149.4 213.601v-213.601zM344 56h111.4c-26.9004 -41 -65.7002 -73.5 -111.4 -92.7002v92.7002zM401.4 194.2v-16.7002
|
1789 |
+
l-21.2002 8.2998zM381.1 139.7c5.90039 0 8.2002 -4.7002 8.2002 -10.6006v-10h-16.2002v7.7002c0 6.60059 1.30078 12.9004 8 12.9004zM496 192c0 -37.2998 -8.2002 -72.7002 -23 -104.4h-129v333.101c89.2998 -37.5 152 -125.8 152 -228.7zM360.4 304.4h68.1992v47.5996
|
1790 |
+
h-13.8994v-32.5996h-13.9004v29.5996h-13.8994v-29.5996h-12.7002v32.5996h-13.9004v-47.5996h0.100586zM428.5 119.1h-26.5v11c0 15.4004 -5.59961 25.2002 -20.9004 25.2002c-15.3994 0 -20.6992 -10.5996 -20.6992 -25.8994v-25.3008h68.1992v15h-0.0996094zM428.5 222.1
|
1791 |
+
l-68.2002 -29.6992v-12.4004l68.2002 -29.5v16.5996l-14.4004 5.7002v26.5l14.4004 5.90039v16.8994zM423.7 290.6h-35.6006v-26.5996h13.9004v12.2002h11c8.59961 -15.7998 1.2998 -35.2998 -18.5996 -35.2998c-22.5 0 -28.3008 25.2998 -15.5 37.6992l-11.6006 10.6006
|
1792 |
+
c-16.2002 -17.5 -12.2002 -63.9004 27.1006 -63.9004c34 0 44.6992 35.9004 29.2998 65.2998z" />
|
1793 |
+
<glyph glyph-name="palfed" unicode="" horiz-adv-x="576"
|
1794 |
+
d="M384.9 254.1c0.0996094 -53.3994 -46.5 -96.1992 -83.3008 -96.1992c-12.5 0 -14.3994 3.39941 -15.0996 6.19922c0.5 39.1006 1.7002 80.4004 3 119.801c40.2002 14.3994 95.4004 17.5996 95.4004 -29.8008zM190.4 181.9
|
1795 |
+
c-0.200195 0.599609 -0.400391 2.09961 -0.600586 4.59961c0 25.5996 37 60.9004 58.5 75.9004c-1.2002 -36.4004 -5.5 -198.101 -1.39941 -242.5c3 -32.3008 26.7998 -32.9004 36.3994 -22.3008c5.90039 6.60059 5.5 15.7002 5.2998 19.1006v0.200195
|
1796 |
+
c-1.7998 25.5996 -2.7998 60.5996 -2.69922 100c60.7998 -14.4004 140.1 60.2998 140.1 138.199c0 71 -63 94.2002 -135.2 72c-2.89941 14.6006 -18.2998 20.1006 -29.5 11.1006c-7.5 -6.2002 -9.5 -15.7998 -10.5 -28.2002c-57.7998 -30.9004 -100.7 -84.5 -100.7 -126.5
|
1797 |
+
c0 -24.9004 15.6006 -43 37.1006 -43c35.0996 0 41 44.0996 14.3994 44.0996c-4.69922 0 -11 -2.69922 -11.1992 -2.69922zM8 266.9c0 38.5996 38.4004 37.3994 38.4004 37.3994h29c15.5 70.1006 120.5 74.2998 120.5 74.2998h28.0996v19.1006
|
1798 |
+
c0 18.3994 21.0996 18.3994 21.0996 18.3994h85.8008c18.3994 0 21.0996 -18.3994 21.0996 -18.3994v-19.1006h28c89.2002 0 112.1 -48.6992 119.4 -74.2998h30.0996c38.5 0 38.4004 -37.3994 38.4004 -37.3994c0 -38.6006 -38.4004 -37.4004 -38.4004 -37.4004h-30
|
1799 |
+
l-22.4004 -217.2c0 -43.8994 -44.6992 -44.2998 -44.6992 -44.2998h-288.9c-44.7002 0 -44.7002 44.2998 -44.7002 44.2998l-22.3994 217.2h-30c-38.5 0 -38.4004 37.4004 -38.4004 37.4004z" />
|
1800 |
+
<glyph glyph-name="patreon" unicode="" horiz-adv-x="512"
|
1801 |
+
d="M512 253.2c0 -101.3 -82.4004 -183.8 -183.8 -183.8c-101.7 0 -184.4 82.3994 -184.4 183.8c0 101.6 82.7002 184.3 184.4 184.3c101.399 0 183.8 -82.7002 183.8 -184.3zM0 -53.5v491h90v-491h-90z" />
|
1802 |
+
<glyph glyph-name="periscope" unicode=""
|
1803 |
+
d="M370 384.4c38.4004 -40.7002 59.5 -94.3008 59.5 -150.801c0 -74.2998 -57.4004 -159.5 -82 -192.6c-8 -10.7998 -79.2998 -105 -120.9 -105c-34 0 -88.7998 56.5 -125.399 104.9c-24.9004 32.8994 -82.7002 117.6 -82.7002 192.699c0 118.2 93.4004 214.4 208.1 214.4
|
1804 |
+
c53.9004 0 104.801 -22.5996 143.4 -63.5996zM226.6 -45.9004c37.3008 0 184.801 167.301 184.7 279.4c0 107.3 -83.8994 196.3 -184.7 196.3c-106.1 0 -190 -88.8994 -190 -196.3c0 -112.1 147.5 -279.4 190 -279.4zM338 241.2c0 -59.1006 -51.0996 -109.7 -110.8 -109.7
|
1805 |
+
c-100.601 0 -150.7 108.2 -92.9004 181.8v-0.399414c0 -24.5 20.1006 -44.4004 44.7998 -44.4004c24.7002 0 44.8008 19.9004 44.8008 44.4004c0 18.1992 -11.1006 33.7998 -26.9004 40.6992c76.5996 19.2002 141 -39.2998 141 -112.399z" />
|
1806 |
+
<glyph glyph-name="phabricator" unicode="" horiz-adv-x="496"
|
1807 |
+
d="M323 185.9c0 0 21.5996 -19.6006 20.9004 -20.7002l-8.10059 -19.7998c-0.5 -1.40039 -29.7002 -0.5 -29.7002 -0.5l-9.09961 -9.10059s1.59961 -31.5 0.200195 -32.0996l-20 -7.5c-1.2998 -0.5 -21.7998 23.2998 -21.7998 23.2998l-13.1006 0.200195
|
1808 |
+
s-19.2998 -24.1006 -20.7002 -23.5l-20.0996 8.2998c-1.40039 0.5 -1.2002 32.2998 -1.2002 32.2998l-9.39941 9.2998s-28.9004 -0.899414 -29.5 0.5l-9.5 20c-0.600586 1.40039 21.0996 21.2002 21.0996 21.2002l-0.0996094 12.9004s-21.6006 19.5996 -21 21
|
1809 |
+
l8.09961 19.7998c0.5 1.2998 29.7002 0.400391 29.7002 0.400391l9.09961 9.09961s-1.59961 28.4004 -0.200195 28.9004l20 8.2998c1.40039 0.599609 21.9004 -20.7998 21.9004 -20.7998l13.0996 -0.200195s19.3008 21.5996 20.7002 21l20.1006 -9.2002
|
1810 |
+
c1.39941 -0.599609 1.19922 -29.0996 1.19922 -29.0996l9.40039 -9.30078s28.9004 0.900391 29.5 -0.5l9.5 -20c0.599609 -1.39941 -21.0996 -21.1992 -21.0996 -21.1992zM278.1 194.6c-0.699219 17 -15.5 30.3008 -32.7998 29.5
|
1811 |
+
c-17.2998 -0.699219 -30.7998 -15.1992 -30.0996 -32.2998c0.700195 -17.0996 15.5 -30.3994 32.7998 -29.5996s30.7998 15.2998 30.0996 32.3994zM479.3 232.5c22.2998 -22.2998 22.2998 -58.7002 0 -81c-67.3994 -67.4004 -44.2998 -44.4004 -95.2998 -95.2998
|
1812 |
+
c-74.4004 -74.5 -194.7 -74.9004 -269.8 -1.60059l-0.100586 -0.0996094c-51 51 -27.5 27.5996 -97.3994 97c-22.2998 22.2998 -22.2998 58.7002 0 81c67.8994 67.4004 44.7998 44.2998 95.7002 95.2998c74.3994 74.4004 194.699 74.9004 269.8 1.60059l0.0996094 0.0996094
|
1813 |
+
zM140.4 84.2002c59.5996 -59.5 156 -59.6006 215.6 -0.100586c59.5996 59.6006 59.5 156.101 0 215.601c-59.5996 59.5 -156.1 59.5996 -215.6 0c-59.6006 -59.5 -59.6006 -156 0 -215.5z" />
|
1814 |
+
<glyph glyph-name="phoenix-framework" unicode="" horiz-adv-x="640"
|
1815 |
+
d="M212.9 103.7c-36.7002 -1.2002 -108.7 29.2998 -127.7 106.399c-8.7002 35.3008 -2.7002 51.8008 -8 86.1006c-8.2002 53.3994 -32.1006 72.2002 -55.9004 76.5c-6.2002 1.09961 -12.3994 1.2998 -18.7002 0.299805
|
1816 |
+
c-0.799805 -0.0996094 -1.59961 -0.200195 -2.39941 -0.200195c-0.100586 0.200195 -0.100586 0.299805 -0.200195 0.5c0.700195 0.600586 1.40039 1.2002 2.2002 1.7998c36.8994 26.9004 92 38.4004 136.3 35c123.6 -9.5 141.3 -156.6 252.5 -173.1
|
1817 |
+
c6.09961 -0.900391 12.2998 -1.09961 18.5 -1.7002c0.700195 -0.0996094 1.40039 -0.0996094 2.5 -0.200195c-2.09961 -2.19922 -21.5996 -11.7998 -36.5 -14.5c-18.4004 -3.39941 -35.7002 -0.0996094 -51.2998 10.3008c-14.5 9.7998 -24.5 23.5 -38.9004 27.3994
|
1818 |
+
c-13 3.60059 -34.0996 1.7002 -35.8994 -19.5996c-1.30078 -15.9004 14.1992 -51.7998 51.7998 -74.6006c40.3994 -24.5 101.399 -26.8994 134.7 -14.7998c0.299805 0.100586 0.699219 0.200195 1.09961 0.299805c0.200195 0.100586 0.400391 0 1 -0.0996094
|
1819 |
+
c-23.5996 -28.4004 -71.2002 -49.9004 -108.2 -45.4004c-50.3994 6.2002 -77.7002 75.9004 -113.7 97.5c-19.0996 11.5 -49.0996 7 -52 -18.5c-1.09961 -10 2.10059 -19 6.40039 -27.5996c24.4004 -48.5996 65.5996 -47 68 -49.5996
|
1820 |
+
c-2.7998 -0.800781 -21.7998 -2.10059 -25.5996 -2.2002zM75.2998 383.1c13.1006 -14.5 34.2002 -7.89941 35.2998 6.80078c-12.3994 -0.700195 -24.5 -2.2002 -36.5996 -4.80078c0.400391 -0.799805 0.400391 -1 1.2998 -2zM272.2 32.5996
|
1821 |
+
c-42.7998 -1.19922 -92 26.7002 -123.5 61.4004c-4.60059 5 -16.7998 20.2002 -18.6006 23.4004l0.400391 0.399414c6.59961 -4.09961 25.7002 -18.5996 54.7998 -27c24.2002 -7 48.1006 -6.2998 71.6006 3.2998c22.6992 9.30078 41 0.5 43.0996 -2.89941
|
1822 |
+
c-18.5 -3.7998 -20.0996 -4.40039 -24 -7.90039c-5.09961 -4.39941 -4.59961 -11.7002 7 -17.2002c26.2002 -12.3994 63 2.80078 97.2002 -25.3994c2.39941 -2 8.09961 -7.7998 10.0996 -10.7002c-0.0996094 -0.200195 -0.299805 -0.299805 -0.399414 -0.5
|
1823 |
+
c-4.80078 1.5 -16.4004 7.5 -40.2002 9.2998c-24.7002 2 -46.2998 -5.2998 -77.5 -6.2002zM447 284.6c16.4004 5.2002 41.2998 13.4004 66.5 3.30078c16.0996 -6.5 26.2002 -18.7002 32.0996 -34.6006c3.5 -9.39941 5.10059 -19.7002 5.10059 -28.7002
|
1824 |
+
c-0.200195 0 -0.400391 0 -0.600586 -0.0996094c-0.199219 0.400391 -0.399414 0.900391 -0.5 1.2998c-5 22 -29.8994 43.7998 -67.5996 29.9004c-50.2002 -18.6006 -130.4 -9.7002 -176.9 48c-0.699219 0.899414 -2.39941 1.7002 -1.2998 3.2002
|
1825 |
+
c0.100586 0.199219 2.10059 -0.600586 3 -1.30078c18.1006 -13.3994 38.2998 -21.8994 60.2998 -26.1992c30.5 -6.10059 54.6006 -2.90039 79.9004 5.19922zM549.7 167.1c-32.4004 -0.199219 -33.7998 -50.0996 -103.601 -64.3994
|
1826 |
+
c-18.1992 -3.7002 -38.6992 -4.60059 -44.8994 -4.2002v0.400391c2.7998 1.5 14.7002 2.59961 29.7002 16.5996c7.89941 7.2998 15.2998 15.0996 22.7998 22.9004c19.5 20.1992 41.3994 42.1992 81.8994 39c23.1006 -1.80078 29.3008 -8.2002 36.1006 -12.7002
|
1827 |
+
c0.299805 -0.200195 0.399414 -0.5 0.700195 -0.900391c-0.5 0 -0.700195 -0.0996094 -0.900391 0c-7 2.7002 -14.2998 3.2998 -21.7998 3.2998zM537.4 191.2c-0.100586 -0.200195 -0.100586 -0.400391 -0.200195 -0.600586c-28.9004 4.40039 -48 7.90039 -68.5 -4
|
1828 |
+
c-17 -9.89941 -31.4004 -20.5 -62 -24.3994c-27.1006 -3.40039 -45.1006 -2.40039 -66.1006 8c-0.299805 0.200195 -0.599609 0.399414 -1 0.599609c0 0.200195 0.100586 0.299805 0.100586 0.5c24.8994 -3.7998 36.3994 -5.09961 55.5 5.7998
|
1829 |
+
c22.2998 12.9004 40.0996 26.6006 71.2998 31c29.5996 4.10059 51.2998 -2.5 70.9004 -16.8994zM268.6 350.7c-0.599609 0.599609 -1.09961 1.2002 -2.09961 2.2998c7.59961 0 29.7002 1.2002 53.4004 -8.40039c19.6992 -8 32.1992 -21 50.1992 -32.8994
|
1830 |
+
c11.1006 -7.2998 23.4004 -9.2998 36.4004 -8.10059c4.2998 0.400391 8.5 1.2002 12.7998 1.7002c0.400391 0.100586 0.900391 0 1.5 -0.299805c-0.599609 -0.400391 -1.2002 -0.900391 -1.7998 -1.2002c-8.09961 -4 -16.7002 -6.2998 -25.5996 -7.09961
|
1831 |
+
c-26.1006 -2.60059 -50.3008 3.7002 -73.4004 15.3994c-19.2998 9.90039 -36.4004 22.9004 -51.4004 38.6006zM640 112.3c-3.5 -3.09961 -22.7002 -11.5996 -42.7002 -5.2998c-12.2998 3.90039 -19.5 14.9004 -31.5996 24.0996
|
1832 |
+
c-10 7.60059 -20.9004 7.90039 -28.1006 8.40039c0.600586 0.799805 0.900391 1.2002 1.2002 1.40039c14.7998 9.19922 30.5 12.1992 47.2998 6.5c12.5 -4.2002 19.2002 -13.5 30.4004 -24.2002c10.7998 -10.4004 21 -9.90039 23.0996 -10.5
|
1833 |
+
c0.100586 0.0996094 0.200195 0 0.400391 -0.400391zM427.5 -24.7002c2.2002 -1.2002 1.59961 -1.5 1.5 -2c-18.5 1.40039 -33.9004 7.60059 -46.7998 22.2002c-21.7998 24.7002 -41.7002 27.9004 -48.6006 29.7002c0.5 0.200195 0.800781 0.399414 1.10059 0.399414
|
1834 |
+
c13.0996 -0.0996094 26.0996 -0.699219 38.8994 -3.89941c25.3008 -6.40039 35 -25.4004 41.6006 -35.2998c3.2002 -4.80078 7.2998 -8.30078 12.2998 -11.1006z" />
|
1835 |
+
<glyph glyph-name="playstation" unicode="" horiz-adv-x="576"
|
1836 |
+
d="M570.9 75.7002c-11.3008 -14.2002 -38.8008 -24.2998 -38.8008 -24.2998l-205.1 -73.6006v54.2998l150.9 53.8008c17.0996 6.09961 19.7998 14.7998 5.7998 19.3994c-13.9004 4.60059 -39.1006 3.2998 -56.2002 -2.89941l-100.5 -35.5v56.3994
|
1837 |
+
c23.2002 7.7998 47.0996 13.6006 75.7002 16.7998c40.8994 4.5 90.8994 -0.599609 130.2 -15.5c44.1992 -14 49.1992 -34.6992 38 -48.8994zM346.5 168.2v139c0 16.2998 -3 31.2998 -18.2998 35.5996c-11.7002 3.7998 -19 -7.09961 -19 -23.3994v-347.9l-93.7998 29.7998
|
1838 |
+
v414.7c39.8994 -7.40039 98 -24.9004 129.199 -35.4004c79.5 -27.2998 106.4 -61.2998 106.4 -137.8c0 -74.5 -46 -102.8 -104.5 -74.5996zM43.2002 37.7998c-45.4004 12.7998 -53 39.5 -32.2998 54.7998c19.0996 14.2002 51.6992 24.9004 51.6992 24.9004l134.5 47.7998
|
1839 |
+
v-54.5l-96.7998 -34.5996c-17.0996 -6.10059 -19.7002 -14.7998 -5.7998 -19.4004c13.9004 -4.59961 39.0996 -3.2998 56.2002 2.90039l46.3994 16.8994v-48.7998c-51.5996 -9.2998 -101.399 -7.2998 -153.899 10z" />
|
1840 |
+
<glyph glyph-name="pushed" unicode="" horiz-adv-x="432"
|
1841 |
+
d="M407 336.1c21.7002 -1.89941 33.7998 -28 17.4004 -44.7998l-235.2 -231.3l-35.2998 -80.7998c-11 -17.2002 -41.2002 -14.2998 -47.7002 7l-105.101 348.3c-4.59961 18.2998 6.30078 33.9004 21.4004 36.5996l271.3 44.4004c17.9004 3.40039 39.1006 -13.5 28.7002 -37
|
1842 |
+
l-14 -33.4004zM297.6 394.4l-189 -31l177.4 -16.3008l16.7998 39.9004c2.2998 4.90039 -0.0996094 8.09961 -5.2002 7.40039zM22.7002 340.1l157.899 -244.3l96.9004 230.7l-248.7 22.7002c-5.09961 0.899414 -9.2002 -4 -6.09961 -9.10059zM136 -8.40039
|
1843 |
+
c0 0 28.2002 64.1006 35.2002 79.1006l-127.7 197.6l83.0996 -275.5c1.5 -4.2998 6.80078 -5.2002 9.40039 -1.2002zM408.8 306.1c3.10059 3.30078 1.40039 7.5 -2.59961 8.60059l-106.4 9.7002l-89.7002 -213.7z" />
|
1844 |
+
<glyph glyph-name="python" unicode=""
|
1845 |
+
d="M439.8 247.5c10.7002 -42.9004 11.2002 -75.0996 0 -108.6c-10.7998 -32.5 -22.2998 -54.2002 -53.3994 -54.2002h-160.2v-13.6006h106.7v-40.6992c0 -30.8008 -26.5 -46.5 -53.4004 -54.3008c-40.5 -11.6992 -73 -9.89941 -106.8 0
|
1846 |
+
c-28.2002 8.30078 -53.4004 25.3008 -53.4004 54.3008v101.8c0 29.2998 24.2002 54.2998 53.4004 54.2998h106.8c35.5996 0 66.7998 31 66.7998 67.7998v47.4004h40.1006c31.0996 0 45.6992 -23.2998 53.3994 -54.2002zM286.2 44c-11 0 -20 -9 -20.1006 -20.2998
|
1847 |
+
c0 -11.2002 9.10059 -20.4004 20.1006 -20.4004c11.0996 0 20.0996 9.10059 20.0996 20.4004c0 11.2002 -9 20.2998 -20.0996 20.2998zM167.8 199.9c-36.2998 0 -66.7998 -31.1006 -66.7998 -66.4004v-48.7998h-36.7002c-31.0996 0 -49.2002 22.5996 -56.7998 54.2002
|
1848 |
+
c-10.2002 42.5 -9.7998 67.8994 0 108.6c8.5 35.5 35.7002 54.2002 66.7998 54.2002h147v13.5996h-106.899v40.7002c0 30.9004 8.19922 47.5996 53.3994 55.5996c32.1006 5.7002 71 6 106.8 0.100586c29 -4.90039 53.4004 -26.6006 53.4004 -55.6006v-101.899
|
1849 |
+
c0 -29.7998 -23.7002 -54.2998 -53.4004 -54.2998h-106.8zM161.1 342.5c11.1006 0 20.1006 9.09961 20.1006 20.2998s-9.10059 20.4004 -20.1006 20.4004c-11.0996 0 -20 -9.10059 -20.0996 -20.4004c0 -11.2002 9 -20.2998 20.0996 -20.2998z" />
|
1850 |
+
<glyph glyph-name="red-river" unicode=""
|
1851 |
+
d="M353.2 416c52.3994 0 94.7998 -42.4004 94.7998 -94.7998v-258.4c0 -52.3994 -42.4004 -94.7998 -94.7998 -94.7998h-258.4c-52.3994 0 -94.7998 42.4004 -94.7998 94.7998v258.4c0 52.3994 42.4004 94.7998 94.7998 94.7998h258.4zM144.9 247.1
|
1852 |
+
c-0.600586 12.4004 11.6992 24.6006 24 24h56.2998c27 0 48.8994 21.9004 48.8994 48.9004h-154.199c-13.2002 0 -23.9004 -10.7002 -23.9004 -23.9004v-154.199c27 0 48.9004 21.8994 48.9004 48.8994v56.2998zM321.2 175.1c27 0 48.8994 21.9004 48.8994 48.9004h-154.199
|
1853 |
+
c-13.2002 0 -23.9004 -10.7002 -23.9004 -23.9004v-154.199c27 0 48.9004 21.8994 48.9004 48.8994v56.2998c-0.600586 12.4004 11.6992 24.6006 24 24h56.2998z" />
|
1854 |
+
<glyph glyph-name="wpressr" unicode="" horiz-adv-x="496"
|
1855 |
+
d="M248 440c136.97 0 248 -111.03 248 -248s-111.03 -248 -248 -248s-248 111.03 -248 248s111.03 248 248 248zM419.33 281.4c2.41016 5.47949 0.459961 8.2793 -5.62012 8.26953c-104.8 0.00976562 -107.69 -0.0302734 -130.78 0.0302734
|
1856 |
+
c-4.31934 0.00976562 -7.10938 -1.82031 -8.83984 -5.78027c-5.70996 -13.0996 -11.5195 -26.1504 -17.2998 -39.21c-2.57031 -5.7998 -1 -8.26953 5.26953 -8.26953c25.2607 0 50.5205 -0.0107422 75.7803 0.0195312
|
1857 |
+
c10.0303 0.00976562 8.54004 -13.6602 -3.89941 -13.6396c-26.4307 0.0498047 -52.8604 0 -79.29 0.0498047c-4.91016 0.00976562 -8.33008 -1.88965 -10.3506 -6.5c-4.2998 -9.83008 -32.1494 -73.0801 -32.1895 -73.1602
|
1858 |
+
c-3.2002 -7.16016 -16.2607 -6.09961 -11.2803 5.33008c8.26953 18.9902 16.6504 37.9297 24.9795 56.8896c2.25 5.11035 -0.0996094 8.74023 -5.65918 8.75c-15.21 0.0205078 -30.4307 -0.0400391 -45.6406 0.0400391
|
1859 |
+
c-3.35938 0.0107422 -5.41016 -1.29004 -6.76953 -4.38965c-31.4307 -71.8701 -29.7803 -67.3203 -30.0098 -67.6904c-3.87012 -6.37012 -14.8604 -3.34961 -10.9502 5.60059c5.66992 13.0098 11.3701 26.0098 17.0898 39c13.5703 30.7793 27.1396 61.5596 40.7402 92.3301
|
1860 |
+
c2.54004 5.75 -0.419922 10.5801 -6.66016 10.5898c-14.2402 0.0302734 -28.4805 -0.0498047 -42.7197 0.0498047c-4.26074 0.0302734 -6.84082 -1.76953 -8.54004 -5.65039c-12.8604 -29.3896 -25.8203 -58.7295 -38.75 -88.0791
|
1861 |
+
c-8.62012 -19.5605 -17.2305 -39.1201 -25.8906 -58.6602c-1.58008 -3.55078 -1.47949 -6.78027 1.20996 -9.73047c11.2207 -12.3096 22.4707 -24.6094 33.6807 -36.9395c2.08984 -2.30078 4.58984 -3.4502 7.71973 -3.4502c45.9395 0.0195312 91.8701 0.00976562 137.81 0
|
1862 |
+
c3.86035 0 6.37988 1.78027 7.91992 5.29004c10.3203 23.5 20.7607 46.9395 30.9502 70.5c2.08984 4.83008 5.21973 6.75 10.3398 6.71973c23.0205 -0.110352 46.0303 -0.0400391 69.0508 -0.0498047c6.0791 0 10.5293 2.72949 12.9697 8.24023
|
1863 |
+
c15.2598 34.4795 30.4502 68.9893 45.6299 103.5z" />
|
1864 |
+
<glyph glyph-name="replyd" unicode=""
|
1865 |
+
d="M320 -32h-192c-70.4004 0 -128 57.5996 -128 128v192c0 70.4004 57.5996 128 128 128h192c70.4004 0 128 -57.5996 128 -128v-192c0 -70.4004 -57.5996 -128 -128 -128zM193.4 174.8c-6.10059 2 -11.6006 3.10059 -16.4004 3.10059
|
1866 |
+
c-7.2002 0 -13.5 -1.90039 -18.9004 -5.60059c-5.39941 -3.7002 -9.59961 -9 -12.7998 -15.7998h-1.09961l-4.2002 18.2998h-28v-138.899h36.0996v89.6992c1.5 5.40039 4.40039 9.80078 8.7002 13.2002c4.2998 3.40039 9.7998 5.10059 16.2002 5.10059
|
1867 |
+
c4.59961 0 9.7998 -1 15.5996 -3.10059zM308.6 71.4004c-3.19922 -2.40039 -7.69922 -4.80078 -13.6992 -7.10059s-12.8008 -3.5 -20.4004 -3.5c-12.2002 0 -21.0996 3 -26.5 8.90039c-5.5 5.89941 -8.5 14.7002 -9 26.3994h83.2998
|
1868 |
+
c0.900391 4.80078 1.60059 9.40039 2.10059 13.9004c0.5 4.40039 0.699219 8.59961 0.699219 12.5c0 10.7002 -1.59961 19.7002 -4.69922 26.9004c-3.2002 7.19922 -7.30078 13 -12.5 17.1992c-5.2002 4.30078 -11.1006 7.30078 -17.8008 9.2002
|
1869 |
+
c-6.69922 1.7998 -13.5 2.7998 -20.5996 2.7998c-21.0996 0 -37.5 -6.09961 -49.2002 -18.2998s-17.5 -30.5 -17.5 -55c0 -22.7998 5.2002 -40.7002 15.6006 -53.7002c10.3994 -13.0996 26.7998 -19.5996 49.1992 -19.5996c10.7002 0 20.9004 1.5 30.4004 4.59961
|
1870 |
+
c9.5 3.10059 17.0996 6.80078 22.5996 11.2002zM286.8 141.7c3.7998 -5.40039 5.2998 -13.1006 4.60059 -23.1006h-51.7002c0.899414 9.40039 3.7002 17 8.2002 22.6006c4.5 5.59961 11.5 8.5 21 8.5c8.19922 0.0996094 14.0996 -2.60059 17.8994 -8zM366.7 139.2
|
1871 |
+
c4.09961 -3.90039 9.39941 -5.7998 16.0996 -5.7998c7 0 12.6006 1.89941 16.7002 5.7998c4.09961 3.89941 6.09961 9.09961 6.09961 15.5996s-2 11.6006 -6.09961 15.4004s-9.59961 5.7002 -16.7002 5.7002c-6.7002 0 -12 -1.90039 -16.0996 -5.7002
|
1872 |
+
c-4.10059 -3.7998 -6.10059 -8.90039 -6.10059 -15.4004s2 -11.7002 6.10059 -15.5996zM366.7 38.7002c4.09961 -3.90039 9.39941 -5.7998 16.0996 -5.7998c7 0 12.6006 1.89941 16.7002 5.7998c4.09961 3.89941 6.09961 9.09961 6.09961 15.5996
|
1873 |
+
s-2 11.6006 -6.09961 15.4004s-9.59961 5.7002 -16.7002 5.7002c-6.7002 0 -12 -1.90039 -16.0996 -5.7002c-4.10059 -3.7998 -6.10059 -8.90039 -6.10059 -15.4004c0 -6.59961 2 -11.7002 6.10059 -15.5996z" />
|
1874 |
+
<glyph glyph-name="resolving" unicode="" horiz-adv-x="496"
|
1875 |
+
d="M281.2 169.8l-197.9 -57.2002l-28.5996 98.6006l188.2 54.0996c52.6992 15.2998 65 8.10059 71.0996 -12.7998l11.2002 -39.2998c5.59961 -19.9004 2 -30.1006 -44 -43.4004zM248.5 440c137 0 248.5 -111.4 247.5 -247.7c0 -136.899 -111.5 -248.3 -248.5 -248.3
|
1876 |
+
c-46 0 -89.5 12.7002 -126.3 34.7002l-23 80.2002l286.8 -37.3008l48.0996 13.3008l-9.69922 34.1992l-220.4 27.1006l92.5996 26.5996c30.2002 8.7002 42 15.7998 61.4004 33.2002c24.5 23 31.7002 45.5 23.5 73.5996l-10.7002 37.8008
|
1877 |
+
c-8.7002 30.1992 -25.0996 49.0996 -61.3994 55.1992c-25.1006 3.5 -44.5 2 -79.3008 -8.19922l-221.899 -63.9004c26 108.8 124.2 189.5 241.3 189.5zM38.2998 59.4004c-24 38.3994 -38.2998 83.2998 -38.2998 131.8z" />
|
1878 |
+
<glyph glyph-name="rocketchat" unicode="" horiz-adv-x="576"
|
1879 |
+
d="M486.41 340.43c119.649 -76.54 119.26 -221 0 -297.14c-77.1201 -50.9199 -179.37 -62.3896 -264.12 -47.1602c-95.5205 -91.1895 -201.72 -49.1602 -222.29 -37c0 0 73.0801 62.1006 61.21 116.49c-45.3896 46.3701 -86.5195 144.57 0 232.77
|
1880 |
+
c11.8701 54.3906 -61.21 116.49 -61.21 116.49c20.7695 12.1201 127.26 54.2803 222.29 -37.3799c84.9404 15.3301 187.19 3.75977 264.12 -47.0703zM294.18 43.7803c126.67 0 229.409 66.2197 229.409 148.22s-102.74 148.43 -229.41 148.43
|
1881 |
+
s-229.41 -66.4297 -229.41 -148.43c0 -35.79 19.4707 -68.5195 52 -94.1299c9.11426 -29.127 3.78125 -62.0234 -15.999 -98.6904c-0.889648 -1.67969 -1.76953 -3.45996 -2.76953 -5.23926c15.0498 1.33594 38.2158 7.93555 51.71 14.7295
|
1882 |
+
c11.0684 6.26562 27.46 18.5361 36.5898 27.3896l19.7705 19.0908c23.6396 -6.27734 62.6758 -11.3721 87.1348 -11.3721c0.269531 0 0.706055 0.000976562 0.974609 0.00195312zM184.119 156.7c-0.133789 -0.00195312 -0.351562 -0.00390625 -0.485352 -0.00390625
|
1883 |
+
c-18.6182 0 -33.9912 15.1084 -34.3145 33.7236c-0.700195 45.3896 67.8301 46.3799 68.5195 1.08984v-0.509766c0.000976562 -0.0888672 0.00195312 -0.232422 0.00195312 -0.321289c0 -18.6152 -15.1074 -33.8467 -33.7217 -33.999v0.0205078zM257.889 190.42
|
1884 |
+
c-0.790039 45.3896 67.7402 46.4805 68.5303 1.19043v-0.610352c0.389648 -45.0801 -67.7402 -45.5703 -68.5303 -0.580078zM401.269 156.7c-0.133789 -0.00195312 -0.350586 -0.00390625 -0.485352 -0.00390625c-18.6182 0 -33.9951 15.1084 -34.3242 33.7236
|
1885 |
+
c-0.69043 45.3896 67.8398 46.3799 68.5303 1.08984v-0.509766c0.000976562 -0.119141 0.00292969 -0.311523 0.00292969 -0.430664c0 -18.6152 -15.1084 -33.7979 -33.7236 -33.8896v0.0205078z" />
|
1886 |
+
<glyph glyph-name="rockrms" unicode="" horiz-adv-x="496"
|
1887 |
+
d="M248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM405.4 20.5l-101.5 118.9s73.5996 0.199219 74.1992 0.199219c29.6006 -1.09961 46.6006 33.3008 27.6006 56.1006l-157.7 185.1c-13.2002 17.2998 -40.0996 18.4004 -54.5 0
|
1888 |
+
l-147.1 -172.5h90l84.2998 98.9004l84.5996 -99.2998h-75.2998c-30.5 0 -44.5 -35.7002 -26.5996 -56.1006l112 -131.3h90z" />
|
1889 |
+
<glyph glyph-name="schlix" unicode=""
|
1890 |
+
d="M350.5 290.3l-54.2002 46.1006l73.4004 39l78.2998 -44.2002zM192 325.9l45.7002 28.1992l34.7002 -34.5996l-55.4004 -29zM126.9 319.3l31.8994 22.1006l17.2002 -28.4004l-36.7002 -22.5zM103.6 231.1l-8.7998 34.8008l29.6006 18.2998l13.0996 -35.2998z
|
1891 |
+
M82.4004 314.8l23.8994 18.1006l8.90039 -24l-26.7002 -18.3008zM59 241.5l-3.59961 28.4004l22.2998 15.5l6.09961 -28.7002zM28.4004 224.9l20.7998 12.7998l3.2998 -33.4004l-22.9004 -12zM1.40039 180l19.1992 10.2002l0.400391 -38.2002l-21 -8.7998zM60.5 120.7
|
1892 |
+
l-28.2998 -8.2998l-1.60059 46.7998l25.1006 10.7002zM99 184.8l-31.0996 -13l-5.2002 40.7998l27.3994 14.4004zM123.2 71l-41.6006 -5.90039l-8.09961 63.5l35.2002 10.8008zM151.7 210.9l21.2002 -57.1006l-46.2002 -13.5996l-13.7002 54.0996zM237.4 -19.5996
|
1893 |
+
l-70.9004 3.2998l-24.2998 95.7998l55.2002 8.59961zM152.5 260.1l42.2002 22.4004l28 -45.9004l-50.7998 -21.2998zM193.5 165.2l61.2998 18.7002l52.7998 -86.6006l-79.7998 -11.2998zM244.9 250.8l67.2998 28.7998l65.5 -65.3994l-88.6006 -26.2002z" />
|
1894 |
+
<glyph glyph-name="searchengin" unicode="" horiz-adv-x="460"
|
1895 |
+
d="M220.6 317.7l-67.1992 -209.3v130.3l-54.7002 -24.2002l54.7002 190.3v-115.3zM137.4 414.4l-1.30078 -4.7002l-15.1992 -52.9004c-40.3008 -15.5 -68.9004 -54.5996 -68.9004 -100.3c0 -52.2998 34.2998 -95.9004 83.4004 -105.5v-53.5996
|
1896 |
+
c-77.9004 10.5 -135.4 78.1992 -135.4 159c0 80.5 59.7998 147.199 137.4 158zM448.8 -32.7998c-11.2002 -11.2002 -23.0996 -12.2998 -28.5996 -10.5c-5.40039 1.7998 -27.1006 19.8994 -60.4004 44.3994c-33.2998 24.6006 -33.5996 35.7002 -43 56.7002
|
1897 |
+
c-9.39941 20.9004 -30.3994 42.6006 -57.5 52.4004l-9.7002 14.7002c-24.6992 -16.9004 -53 -26.9004 -81.2998 -28.7002l2.10059 6.59961l15.8994 49.5c46.5 11.9004 80.9004 54 80.9004 104.2c0 54.5 -38.4004 102.1 -96 107.1v52.1006
|
1898 |
+
c83.2002 -5.10059 148.8 -74.5 148.8 -159.3c0 -33.6006 -11.2002 -64.7002 -29 -90.4004l14.5996 -9.59961c9.80078 -27.1006 31.5 -48 52.4004 -57.4004s32.2002 -9.7002 56.7998 -43c24.6006 -33.2002 42.7002 -54.9004 44.5 -60.2998
|
1899 |
+
c1.7998 -5.40039 0.700195 -17.2998 -10.5 -28.5zM438.9 -14.9004c0 4.40039 -3.60059 8 -8 8c-4.40039 0 -8 -3.59961 -8 -8c0 -4.39941 3.59961 -8 8 -8c4.39941 0 8 3.60059 8 8z" />
|
1900 |
+
<glyph glyph-name="servicestack" unicode="" horiz-adv-x="496"
|
1901 |
+
d="M88 232c81.7002 -10.2002 273.7 -102.3 304 -232h-392c99.5 8.09961 184.5 137 88 232zM120 384c102.8 -15.5 335.3 -167.9 376 -384h-96c-26.2998 126.7 -150.7 216.7 -233.6 250.4c1.2998 49.6992 -14.1006 98 -46.4004 133.6z" />
|
1902 |
+
<glyph glyph-name="sistrix" unicode=""
|
1903 |
+
d="M448 -1l-30.5 -31l-146 148.1c-28.7002 -23.6992 -65.2002 -37.8994 -105 -37.8994c-91.7998 0 -166.5 75.7998 -166.5 168.899c0 93.1006 74.7002 168.9 166.6 168.801c91.8008 0 166.5 -75.8008 166.5 -168.9c0 -37 -11.8994 -71.2998 -31.8994 -99.2002zM166.5 117.2
|
1904 |
+
c70.7002 0 128.1 58.2998 128.1 129.899c0 71.6006 -57.5 129.9 -128.1 129.9s-128.1 -58.2998 -128.1 -129.9c0 -71.5996 57.5 -129.899 128.1 -129.899z" />
|
1905 |
+
<glyph glyph-name="slack-hash" unicode=""
|
1906 |
+
d="M446.2 177.6c6.2002 -19 -3.90039 -39.6992 -22.9004 -45.6992l-45.3994 -15.1006l15.6992 -47c6.10059 -19.0996 -3.89941 -39.7002 -23 -45.8994c-21.2998 -6.10059 -40.0996 6 -46 22.8994l-15.6992 47l-93.6006 -31.2998l15.7002 -47
|
1907 |
+
c6.09961 -19.0996 -3.90039 -39.7002 -23 -45.9004c-21.2998 -6.09961 -40.0996 6 -46 22.9004l-15.7002 47c-45.7002 -15.2002 -50.8994 -17.7998 -57.7002 -16.7998c-14.5 0.599609 -28.5996 10.0996 -33.5996 24.5996c-6.09961 19 4 39.7002 23 45.9004l45.4004 15.0996
|
1908 |
+
l-30.3008 90c-45.6992 -15.2002 -50.8994 -17.7998 -57.6992 -16.7998c-14.5 0.599609 -28.6006 10.0996 -33.6006 24.5996c-6.09961 19.1006 3.90039 39.7002 23 45.9004l45.2998 15l-15.6992 47c-6.10059 19.0996 3.89941 39.7002 23 45.9004
|
1909 |
+
c19.0996 6.19922 39.7998 -3.90039 46 -22.9004l15.6992 -47l93.4004 31.2002l-15.7002 47c-6.09961 19.0996 3.90039 39.7002 23 45.8994c19.1006 6.2002 39.7998 -3.89941 46 -22.8994l15.7002 -47l45.4004 15.0996c19.0996 6.2002 39.7998 -3.89941 46 -22.8994
|
1910 |
+
c6.09961 -19.1006 -3.90039 -39.7002 -23 -45.9004l-45.4004 -15.0996l30.2998 -90l45.4004 15.0996c19.0996 6.2002 39.7998 -3.90039 46 -22.9004zM192.1 130.4l93.5 31.2998l-30.2998 90.2002l-93.5 -31.3008z" />
|
1911 |
+
<glyph glyph-name="speakap" unicode=""
|
1912 |
+
d="M64 56.2197c-79.4102 88.1904 -72 224.36 16.6396 304.141c88.6406 79.7793 224.801 73 304.21 -15.2402c79.4102 -88.2402 72 -224.36 -16.6396 -304.14c-18.7402 -16.8701 64 -43.0908 42 -52.2607c-82.0596 -34.21 -253.91 -35 -346.229 67.5h0.0195312z
|
1913 |
+
M277.31 267.82l38.5 40.8594c-9.60938 8.89062 -32 26.8301 -76.1699 27.6006c-52.3301 0.910156 -95.8594 -28.2998 -96.7695 -80c-0.200195 -11.3301 0.290039 -36.7207 29.4199 -54.8301c34.46 -21.4199 86.5195 -21.5098 86 -52.2598
|
1914 |
+
c-0.370117 -21.2803 -26.4199 -25.8105 -38.5898 -25.6006c-3 0.0498047 -30.2305 0.459961 -47.6104 24.6201l-40 -42.6104c28.1602 -27 59 -32.6191 83.4902 -33.0498c10.2295 -0.179688 96.4199 -0.330078 97.8398 81
|
1915 |
+
c0.280273 15.8105 -2.07031 39.7197 -28.8604 56.5898c-34.3594 21.6406 -85 19.4502 -84.4297 49.75c0.410156 23.25 31 25.3701 37.5303 25.2607c0.429688 0 26.6201 -0.260742 39.6201 -17.3701z" />
|
1916 |
+
<glyph glyph-name="staylinked" unicode="" horiz-adv-x="440"
|
1917 |
+
d="M382.7 155.5l44.2998 -41.2998c3.7002 -3.5 3.2998 -9 -0.700195 -12.2002l-198 -163.9c-9.89941 -7.59961 -17.2998 -0.799805 -17.2998 -0.799805l-208.7 196.101c-3.5 3.5 -3 9 1.2002 12.1992l45.7998 34.9004c4.2002 3.2002 10.4004 3 13.9004 -0.5l151.899 -147.5
|
1918 |
+
c3.7002 -3.5 10 -3.7002 14.2002 -0.400391l93.2002 74c4.09961 3.2002 4.5 8.7002 0.900391 12.2002l-84 81.2998c-3.60059 3.5 -9.90039 3.7002 -14 0.5l-0.100586 -0.0996094c-4.09961 -3.2002 -10.3994 -3 -14 0.5l-68.0996 64.2998
|
1919 |
+
c-3.5 3.5 -3.10059 9 1.09961 12.2002l57.2998 43.5996c4.10059 3.2002 10.3008 3 13.8008 -0.5l170 -167.3zM437.2 238.9c3.7002 -3.5 3.39941 -9 -0.700195 -12.2002l-45.7998 -35.7998c-4.10059 -3.2002 -10.4004 -3 -14.1006 0.5l-160.399 159
|
1920 |
+
c-3.60059 3.5 -9.7998 3.69922 -13.9004 0.5l-92.2002 -71.5c-4.19922 -3.30078 -4.69922 -8.7002 -1.09961 -12.2002l94.5996 -91.7998c3.7002 -3.5 10 -3.60059 14.2002 -0.400391l0.100586 0.0996094c4.19922 3.2002 10.5996 3 14.1992 -0.5l57.1006 -54.3994
|
1921 |
+
c3.7002 -3.5 3.2998 -9 -0.900391 -12.2002l-7.7002 -6l0.300781 -0.299805l-50.2002 -38.7998c-4.2002 -3.30078 -10.6006 -3.10059 -14.2998 0.399414l-171.7 165.101l-42.2998 41.6992c-3.60059 3.5 -3 9 1.19922 12.2002l206.801 162.101
|
1922 |
+
c8.2998 6.59961 14.7998 2.2998 16.2998 1.09961z" />
|
1923 |
+
<glyph glyph-name="steam-symbol" unicode=""
|
1924 |
+
d="M395.5 270.5c0 -33.7998 -27.5 -61 -61 -61c-33.7998 0 -61 27.2998 -61 61s27.2998 61 61 61c33.5 0 61 -27.2002 61 -61zM448 270.3c0 -63 -51 -113.8 -113.7 -113.8l-109.3 -79.7998c-4 -43 -40.5 -76.7998 -84.5 -76.7998c-40.5 0 -74.7002 28.7998 -83 67
|
1925 |
+
l-57.5 23.0996v107.3l97.2002 -39.2998c15.0996 9.2002 32.2002 13.2998 52 11.5l71 101.7c0.5 62.2998 51.5 112.8 114 112.8c62.7998 0 113.8 -51 113.8 -113.7zM203 85c0 34.7002 -27.7998 62.5 -62.5 62.5c-4.5 0 -9 -0.5 -13.5 -1.5l26 -10.5
|
1926 |
+
c25.5 -10.2002 38 -39 27.7002 -64.5c-10.2002 -25.5 -39.2002 -38 -64.7002 -27.5c-10.2002 4 -20.5 8.2998 -30.7002 12.2002c10.5 -19.7002 31.2002 -33.2002 55.2002 -33.2002c34.7002 0 62.5 27.7998 62.5 62.5zM410.5 270.3c0 42 -34.2998 76.2002 -76.2002 76.2002
|
1927 |
+
c-42.2998 0 -76.5 -34.2002 -76.5 -76.2002c0 -42.2002 34.2998 -76.2002 76.5 -76.2002c41.9004 -0.0996094 76.2002 33.9004 76.2002 76.2002z" />
|
1928 |
+
<glyph glyph-name="sticker-mule" unicode="" horiz-adv-x="576"
|
1929 |
+
d="M561.7 248.4c-1.2998 -0.300781 0.299805 0 0 0zM555.5 325.8c20.2002 -50.0996 20.5996 -45.2002 20.5996 -52.8994c0 -7.5 -4.09961 -11 -7.19922 -16.5c-1.5 -3 -4.60059 -7.5 -7.2002 -8c-0.400391 0 -3 -0.5 -13.4004 -2.5c-7.2002 -1 -13.3994 4.5 -14.8994 9.5
|
1930 |
+
c-1.60059 4.69922 2.7998 10.0996 -11.8008 22.8994c-10.2998 10 -21.0996 11.2998 -31.8994 17c-9.7998 5.7002 -11.9004 -1 -18 -8c-18 -22.8994 -34 -46.8994 -52 -69.7998c-11.7998 -15 -24.2002 -30.4004 -33.5 -47.4004
|
1931 |
+
c-3.90039 -6.7998 -9.5 -28.0996 -10.2998 -29.8994c-6.2002 -17.7002 -5.5 -25.7998 -16.5 -68.2998c-3.10059 -10 -5.7002 -21.4004 -8.7002 -32.4004c-2.2002 -6.7998 -7.40039 -49.2998 -0.5 -59.4004c2.09961 -3.5 8.7002 -4.5 11.2998 -8
|
1932 |
+
c0.0996094 -0.0996094 9.59961 -18.1992 9.2998 -20c0 -6.09961 -9.39941 -5.59961 -11.2998 -6.5c-4.7998 -2.89941 -3.7998 -5.89941 -6.40039 -7.39941c-5.89941 -2.90039 -32.0996 -3.2002 -36.5 0.5c-4.09961 3 -2.19922 11.8994 -1.5 15
|
1933 |
+
c2.2002 15 -2.5 7.89941 -9.7998 11.5c-3.09961 1.5 -4.09961 5.5 -4.59961 10c-0.5 1.5 -1 2.5 -1.5 3.5c-1.7002 10.7002 6.7998 33.5996 8.2002 43.3994c4.89941 23.7002 -0.700195 37.2002 1.5 46.9004c3.69922 16.2002 4.09961 3.5 4.09961 29.9004
|
1934 |
+
c-1.40039 25.8994 3.2998 36.8994 0.5 38.8994c-14.7998 0 -64.2998 -10.7002 -112.2 -2c-46.0996 8.90039 -59.3994 29 -65.3994 30.9004c-10.3008 4.5 -23.2002 -0.5 -27.3008 -7c-0.0996094 -0.100586 -35 -70.6006 -39.5996 -87.7998
|
1935 |
+
c-6.2002 -20.5 -0.5 -47.4004 4.09961 -66.8008c0 -0.0996094 4.5 -14.5996 10.3008 -19.5c2.09961 -1.5 5.09961 -2.5 7.19922 -4.5c2.80078 -2.69922 9.40039 -15.1992 9.80078 -16c2.59961 -4.5 3.59961 -8 -1.5 -10.5c-3.60059 -2 -9.30078 -2.5 -14.4004 -2.5
|
1936 |
+
c-2.59961 -0.5 -1.5 -3.5 -3.09961 -5c-2.90039 -2.7998 -20.7002 -6.09961 -29.9004 -2.5c-2.59961 1 -5.7002 3 -6.2002 5c-1.5 4 2.10059 9 -1 12.5c-4.5 2.90039 -13.0996 2 -17 12c-2.2002 5.40039 -2.59961 7.60059 -2.59961 49.4004
|
1937 |
+
c0 9.7002 -5.90039 38.7002 -8.2002 46.9004c-1.5 5.5 -1.5 11.5 0 16c0.299805 0.899414 4.09961 4.59961 4.09961 13c-1 1.5 -4.59961 0.5 -5.09961 1.5c-10.4004 80.5996 -5.90039 79 -7.7002 98.2998c-1.5 16 -10.8994 43.8994 -6.7002 64.2998
|
1938 |
+
c0.5 2.40039 3.40039 21 24.2002 38.9004c31 26.6992 48.4004 38.2998 159 11.5c1.10059 -0.400391 66.2998 -21.1006 110.7 9c15.5 11.2998 28.7998 11.2998 35.5 16c0.0996094 0.0996094 61.7002 52.0996 87 65.2998c47.2002 29.3994 69.9004 16.7002 75.0996 18
|
1939 |
+
c4.7002 1 13.4004 25.7998 17 25.7998c5.5 0 1.60059 -20.2002 3.60059 -25.9004c0.5 -2 3.59961 -5 6.2002 -5c2.2998 0 1.69922 0.800781 10.2998 5c8.39941 5.40039 14.8994 17.6006 20.5996 17c11.7002 -1.59961 -19 -41.5996 -19 -46.8994
|
1940 |
+
c0 -2 0.200195 -0.799805 4.60059 -9.5c2.59961 -5.5 4.59961 -13.5 6.19922 -20c8.30078 -29.7002 5.7002 -14.6006 13.4004 -36.9004z" />
|
1941 |
+
<glyph glyph-name="studiovinari" unicode="" horiz-adv-x="512"
|
1942 |
+
d="M480.3 260.3l4.2002 -28v-28l-25.0996 -44.0996l-39.8008 -78.4004l-56.0996 -67.5l-79.0996 -37.7998l-17.7002 -24.5l-7.7002 -12l-9.59961 -4s17.2998 63.5996 19.3994 63.5996c2.10059 0 20.2998 -0.699219 20.2998 -0.699219l66.7002 38.5996l-92.5 -26.0996
|
1943 |
+
l-55.8994 -36.8008l-22.8008 -28l-6.59961 -1.39941l20.7998 73.5996l6.90039 5.5l20.7002 -12.8994l88.2998 45.1992l56.7998 51.5l14.7998 68.4004l-125.399 -23.2998l15.1992 18.2002l-173.399 53.2998l81.8994 10.5l-166 122.899l114.9 -18.0996l-101.3 108
|
1944 |
+
l252.899 -126.6l-31.5 38l124.4 -74.4004l-143.3 99l18.7002 -38.4004l-49.6006 18.1006l-45.5 84.2998l194.601 -122l-42.9004 55.7998l108 -96.3994l12 8.89941l-21 16.4004l4.2002 37.7998l37.7998 10.4004l29.2002 -24.7002l11.5 -4.2002l-7 -6.2002l8.5 -12
|
1945 |
+
l-13.1006 -7.39941l-10.2998 -20.2002z" />
|
1946 |
+
<glyph glyph-name="supple" unicode="" horiz-adv-x="640"
|
1947 |
+
d="M640 185.5c0 -64.0996 -109 -116.1 -243.5 -116.1c-24.7998 0 -48.5996 1.7998 -71.0996 5c7.69922 -0.400391 15.5 -0.600586 23.3994 -0.600586c134.5 0 243.5 56.9004 243.5 127.101c0 29.3994 -19.0996 56.3994 -51.2002 78
|
1948 |
+
c60 -21.1006 98.9004 -55.1006 98.9004 -93.4004zM47.7002 220.1c0.0996094 -29.3994 19.2998 -56.5 51.5996 -78c-60.2002 21 -99.2002 55 -99.2998 93.3008c-0.0996094 64.0996 108.8 116.3 243.3 116.699c24.7002 0 48.5 -1.69922 71 -4.89941
|
1949 |
+
c-7.7002 0.299805 -15.3994 0.5 -23.2998 0.5c-134.5 -0.299805 -243.4 -57.4004 -243.3 -127.601zM107.9 180.2l8.7998 10.8994s8.7998 -10.0996 20.7002 -10.0996c6.5 0 12.2998 3.5 12.2998 10.0996c0 14.5 -40.2002 13.3008 -40.2002 39.9004
|
1950 |
+
c0 13.9004 12 24.0996 28.5 24.0996c10 0 25.4004 -4.69922 25.4004 -16.7998v-7.89941h-14.2002v3.89941c0 4 -5.60059 6.60059 -11.2998 6.60059c-7.2002 0 -12.5 -3.7002 -12.5 -9.10059c0 -14.5996 40.1992 -11.7002 40.1992 -39.7002
|
1951 |
+
c0 -13.5996 -10.5 -25.0996 -28.3994 -25.0996c-18.7998 0 -29.2998 13.2002 -29.2998 13.2002zM228.7 253.8h15.7002v-55c0 -18.8994 -13.3008 -31.8994 -33.4004 -31.8994c-20.2998 0 -33.7002 13 -33.7002 31.8994v55h15.7998v-54.5
|
1952 |
+
c0 -11.2002 7.10059 -17.7002 17.8008 -17.7002c10.6992 0 17.7998 6.5 17.7998 17.8008v54.3994zM263.1 168.4v72h-7.7998v13.3994h39.1006c16 0 27.1992 -11.2002 27.1992 -27.7998s-11.1992 -28.0996 -27.1992 -28.0996h-15.5v-29.5h-15.8008zM278.9 211.4h12.5996
|
1953 |
+
c8.90039 0 14 5.7998 14 14.6992c0 8.7002 -5 14.4004 -13.7002 14.4004h-12.8994v-29.0996zM335.9 168.4v72h-7.80078v13.3994h39.1006c16 0 27.2002 -11.2002 27.2002 -27.7998s-11.2002 -28.0996 -27.2002 -28.0996h-15.5v-29.5h-15.7998zM351.6 211.4h12.6006
|
1954 |
+
c9 0 14 5.7998 14 14.6992c0 8.7002 -5 14.4004 -13.7002 14.4004h-12.9004v-29.0996zM408.7 176.6h0.0996094v61.2002c0 1.60059 -0.899414 2.60059 -2.59961 2.60059h-5.2002v13.3994h15.4004c5.7998 0 8.19922 -2.5 8.19922 -8.2002v-61.1992
|
1955 |
+
c0 -1.60059 0.900391 -2.60059 2.60059 -2.60059h18.5996c1.60059 0 2.60059 0.900391 2.60059 2.60059v5.19922h14.2998v-13c0 -5.7998 -2.40039 -8.19922 -8.2002 -8.19922h-37.5996c-5.80078 0 -8.2002 2.39941 -8.2002 8.19922zM472.1 176.6h-0.0996094v63.9004h-7.7998
|
1956 |
+
v13.4004h51.5996c5.7002 0 8.2002 -2.5 8.2002 -8.2002v-13h-14.2002v5.2002c0 1.59961 -0.899414 2.59961 -2.59961 2.59961h-19.2002v-22.4004h27.7002v-13.3994h-27.7002v-20.2998c0 -1.60059 0.900391 -2.60059 2.59961 -2.60059h19.7002
|
1957 |
+
c1.60059 0 2.60059 0.900391 2.60059 2.60059v5.19922h14.2998v-13c0 -5.7998 -2.5 -8.19922 -8.2002 -8.19922h-38.7002c-5.7998 0 -8.2002 2.39941 -8.2002 8.19922zM531 252.6h-2.7002v1.2002h7v-1.2002h-2.7002v-5.89941h-1.59961v5.89941zM536.7 253.8h2.39941
|
1958 |
+
l2.10059 -5.09961l2.09961 5.09961h2.2998v-7.09961h-1.5v5.7002l-2.2998 -5.7002h-1.2998l-2.2998 5.7002v-5.7002h-1.5v7.09961z" />
|
1959 |
+
<glyph glyph-name="telegram-plane" unicode=""
|
1960 |
+
d="M446.7 349.4l-67.6006 -318.801c-5.09961 -22.5 -18.3994 -28.0996 -37.2998 -17.5l-103 75.9004l-49.7002 -47.7998c-5.5 -5.5 -10.0996 -10.1006 -20.6992 -10.1006l7.39941 104.9l190.9 172.5c8.2998 7.40039 -1.7998 11.5 -12.9004 4.09961l-236 -148.6
|
1961 |
+
l-101.6 31.7998c-22.1006 6.90039 -22.5 22.1006 4.59961 32.7002l397.4 153.1c18.3994 6.90039 34.5 -4.09961 28.5 -32.1992z" />
|
1962 |
+
<glyph glyph-name="uber" unicode=""
|
1963 |
+
d="M414.1 416c18.7002 0 33.9004 -15.2002 33.8008 -33.9004v-380.199c0 -18.7002 -15.2002 -33.9004 -33.9004 -33.9004h-380.1c-18.7002 0 -33.9004 15.2002 -33.9004 34v380.1c0 18.7002 15.2002 33.9004 33.9004 33.9004h380.199zM237.6 56.9004
|
1964 |
+
c74.6006 7.5 129 74.0996 121.5 148.6c-7 69.4004 -65.3994 122.2 -135.1 122.2s-128.1 -52.7998 -135.1 -122.2h94.3994v20.4004c0 3.7998 3.10059 6.7998 6.7998 6.7998h67.9004c3.7998 0 6.7998 -3.10059 6.7998 -6.7998v-67.9004
|
1965 |
+
c0 -3.7998 -3.09961 -6.7998 -6.7998 -6.7998h-67.9004c-3.7998 0 -6.7998 3.09961 -6.7998 6.7998v20.4004h-94.3994c7.5 -74.6006 74.0996 -129 148.699 -121.5z" />
|
1966 |
+
<glyph glyph-name="uikit" unicode=""
|
1967 |
+
d="M443.9 320v-256l-225.9 -128l-218 128v214.3l87.5996 -45.0996v-117l133.5 -75.5l135.801 75.5v151l-101.101 57.5996l87.6006 53.1006zM308.6 398.9l-87.3994 -53l-86 47.2998l88.5996 54.7998z" />
|
1968 |
+
<glyph glyph-name="uniregistry" unicode="" horiz-adv-x="384"
|
1969 |
+
d="M192 -32c-39.5 0 -76.2002 11.7998 -106.7 32.2002h213.5c-30.5996 -20.4004 -67.2998 -32.2002 -106.8 -32.2002zM102.9 161.1c0 -2.5 0.0996094 -5 0.299805 -7.39941h-103.101c-0.0996094 2.39941 -0.0996094 4.89941 -0.0996094 7.39941v12.4004h102.9v-12.4004z
|
1970 |
+
M123.4 104.1c8.89941 -10.5996 20.0996 -19.0996 33 -24.7998h-138.301c-3.7998 8 -7 16.2998 -9.59961 24.7998h114.9zM105.7 138.8c2 -7.89941 5.2002 -15.3994 9.2002 -22.2998h-109.7c-1.7002 7.2998 -3 14.7002 -3.90039 22.2998h104.4zM102.9 208.1v-17.2998h-102.9
|
1971 |
+
v17.2998h102.9zM102.9 381.3v-4.89941h-102.9v4.89941h102.9zM102.9 416v-2.5h-102.9v2.5h102.9zM102.9 346.7v-7.40039h-102.9v7.40039h102.9zM102.9 242.7v-14.7998h-102.9v14.7998h102.9zM102.9 312v-9.90039h-102.9v9.90039h102.9zM102.9 277.4v-12.4004h-102.9v12.4004
|
1972 |
+
h102.9zM269.1 116.5c4 6.90039 7.10059 14.4004 9.2002 22.2998h104.4c-0.799805 -7.59961 -2.10059 -15 -3.90039 -22.2998h-109.7zM281.1 302.2v9.7998h102.9v-9.7998h-102.9zM281.1 265v12.4004h102.9v-12.4004h-102.9zM281.1 339.3v7.40039h102.9v-7.40039h-102.9z
|
1973 |
+
M281.1 416h102.9v-2.5h-102.9v2.5zM78.0996 5.09961c-11.7998 8.7002 -23.5996 18.7002 -33.1992 29.7002h293.1c-9.5 -11.0996 -20.4004 -21 -32.2002 -29.7002h-227.7zM281.1 376.4v4.89941h102.9v-4.89941h-102.9zM281.1 227.9v14.7998h102.9v-14.7998h-102.9z
|
1974 |
+
M38.7998 42.2998c-6.59961 8.5 -10.5996 17.6006 -15.7998 27.2002h338.9c-5.2002 -9.59961 -11.1006 -18.7002 -17.8008 -27.2002h-305.3zM227.6 79.4004c12.8008 5.59961 24.1006 14.0996 32.9004 24.7998h115c-2.7002 -8.60059 -4.7998 -16.7998 -8.5 -24.7998h-139.4z
|
1975 |
+
M281.1 161.1v12.4004h102.9v-12.4004c0 -2.5 -0.0996094 -4.89941 -0.200195 -7.39941h-103.1c0.299805 2.39941 0.399414 4.89941 0.399414 7.39941zM281.1 190.8v17.2998h102.9v-17.2998h-102.9z" />
|
1976 |
+
<glyph glyph-name="untappd" unicode="" horiz-adv-x="640"
|
1977 |
+
d="M401.3 398.1c-79.7998 -160.1 -84.5996 -152.5 -87.8994 -173.199l-5.2002 -32.8008c-1.90039 -12 -6.60059 -23.5 -13.7002 -33.3994l-148.9 -207.8c-7.59961 -10.6006 -20.3994 -16.2002 -33.3994 -14.6006c-40.2998 5 -77.7998 32.2002 -95.2998 68.5
|
1978 |
+
c-5.7002 11.7998 -4.5 25.7998 3.09961 36.4004l148.9 207.899c7.09961 9.90039 16.3994 18 27.1992 23.7002l29.3008 15.5c18.5 9.7998 9.69922 11.9004 135.6 138.9c1 4.7998 1 7.2998 3.59961 8c3 0.700195 6.60059 1 6.30078 4.59961l-0.400391 4.60059
|
1979 |
+
c-0.200195 1.89941 1.2998 3.59961 3.2002 3.59961c4.5 0.0996094 13.2002 -1.2002 25.5996 -10c12.2998 -8.90039 16.4004 -16.7998 17.7002 -21.0996c0.599609 -1.80078 -0.599609 -3.7002 -2.40039 -4.2002l-4.5 -1.10059
|
1980 |
+
c-3.39941 -0.899414 -2.5 -4.39941 -2.2998 -7.39941c0.100586 -2.7998 -2.2998 -3.60059 -6.5 -6.10059zM230.1 411.6c-3.19922 0.800781 -8.19922 1.2002 -6.7998 5.40039c1.2998 4.2998 5.40039 12.2002 17.7002 21.0996c12.4004 8.90039 21.0996 10.1006 25.5996 10
|
1981 |
+
c4.2002 -0.0996094 3.10059 -4.89941 2.80078 -8.19922c-0.300781 -3.60059 3.2998 -3.80078 6.2998 -4.60059c2.59961 -0.700195 2.59961 -3.2998 3.59961 -8c9.10059 -9.2002 17.6006 -17.8994 25.6006 -26.0996c1.2998 -1.40039 1.19922 -3.5 -0.100586 -4.90039
|
1982 |
+
c-15.8994 -16.3994 -29.2998 -30.5996 -40.5 -42.5996c-1 -1 -2.59961 -0.799805 -3.2998 0.5c-6.90039 13.5 -14.2998 28.0996 -22.2002 44c-4.2998 2.5 -6.59961 3.2998 -6.39941 6c0.199219 3 1.09961 6.5 -2.30078 7.39941zM620 41.2998
|
1983 |
+
c7.7002 -10.7002 8.7998 -24.7002 3.40039 -36.5996c-17.7002 -36.6006 -55.4004 -63.7002 -95.7002 -68.6006c-12.9004 -1.5 -25.5 4.10059 -33.1006 14.7002l-148.899 207.9c-7.10059 9.89941 -11.7998 21.3994 -13.7002 33.3994
|
1984 |
+
c-1.59961 9.80078 -2 19.1006 -0.299805 29.8008c1.89941 12 2.7002 6 49 94.7998c0.700195 1.39941 2.59961 1.59961 3.59961 0.5c16.2998 -18 19.2998 -23 30.5 -28.9004c29.7998 -15.7002 43.2002 -20.5996 56.4004 -39.0996z" />
|
1985 |
+
<glyph glyph-name="ussunnah" unicode="" horiz-adv-x="512"
|
1986 |
+
d="M156.8 162.9l5.7002 -14.4004h-8.2002c-1.2998 3.2002 -3.09961 7.7002 -3.7998 9.5c-2.5 6.2998 -1.09961 8.40039 0 10c1.90039 2.7002 3.2002 4.40039 3.59961 5.2002c0 -2.2002 0.800781 -5.7002 2.7002 -10.2998zM454.1 144.1
|
1987 |
+
c-2.09961 -13.7998 -5.69922 -27.0996 -10.5 -39.6992l43 -23.4004l-44.7998 18.7998c-5.2998 -13.2002 -12 -25.5996 -19.8994 -37.2002l34.1992 -30.1992l-36.7998 26.3994c-8.39941 -11.7998 -18 -22.5996 -28.7002 -32.2998l24.9004 -34.7002l-28.0996 31.7998
|
1988 |
+
c-11 -9.59961 -23.1006 -18 -36.1006 -25.0996l15.7002 -37.2002l-19.2998 35.2998c-13.1006 -6.7998 -27 -12.0996 -41.6006 -15.8994l6.7002 -38.4004l-10.5 37.4004c-14.2998 -3.40039 -29.2002 -5.2998 -44.5 -5.40039l-1.7998 -38.2998l-1.90039 38.4004
|
1989 |
+
c-15.2998 0.0996094 -30.1992 2 -44.5 5.2998l-10.5996 -37.2998l6.7002 38.1992c-14.6006 3.7002 -28.6006 9.10059 -41.7002 15.8008l-19.2002 -35.1006l15.6006 37c-13 7 -25.2002 15.4004 -36.2002 25.1006l-27.9004 -31.6006l24.7002 34.4004
|
1990 |
+
c-10.7002 9.7002 -20.4004 20.5 -28.7998 32.2998l-36.5 -26.2002l33.8994 29.9004c-7.89941 11.5996 -14.5996 24.0996 -20 37.2998l-44.3994 -18.7002l42.5996 23.2002c-4.7998 12.7002 -8.39941 26.0996 -10.5 39.9004l-51 -9l50.2998 14.1992
|
1991 |
+
c-1.09961 8.5 -1.69922 17.1006 -1.69922 25.9004c0 4.7002 0.199219 9.40039 0.5 14.0996l-55.4004 2.90039l56 2.7998c1.2998 13.1006 3.7998 25.7998 7.5 38.1006l-57.0996 16.0996l58.8994 -10.4004c4 12 9.10059 23.5 15.2002 34.4004l-55.0996 30l58.2998 -24.5996
|
1992 |
+
c6.2998 10.5996 13.5 20.3994 21.5996 29.5996l-49.5 43.5996l53.9004 -38.6992c8.09961 8.59961 17 16.5 26.5996 23.5996l-40 55.5996l45.6006 -51.5996c9.5 6.59961 19.6992 12.2998 30.2998 17.2002l-27.2998 64.8994l33.7998 -62.0996
|
1993 |
+
c10.5 4.40039 21.3994 7.90039 32.7002 10.4004l-12.4004 70.6992l19.5 -69.1992c11 2.09961 22.2998 3.19922 33.7998 3.39941l3.7002 72.2002l3.59961 -72.2002c11.5 -0.200195 22.8008 -1.39941 33.8008 -3.5l19.5996 69.2998l-12.4004 -70.6992
|
1994 |
+
c11.3008 -2.60059 22.2002 -6.10059 32.6006 -10.5l33.8994 62.1992l-27.3994 -65.0996c10.5996 -4.90039 20.7002 -10.7002 30.2002 -17.2002l45.7998 51.7998l-40.1006 -55.8994c9.5 -7.10059 18.4004 -15 26.5 -23.6006l54.2002 38.9004l-49.7002 -43.9004
|
1995 |
+
c8 -9.09961 15.2002 -18.8994 21.5 -29.3994l58.7002 24.7002l-55.5 -30.2002c6.10059 -10.9004 11.1006 -22.2998 15.1006 -34.2998l59.2998 10.3994l-57.5 -16.2002c3.7002 -12.1992 6.2002 -24.8994 7.5 -37.8994l56.2998 -2.7002l-56 -2.7998
|
1996 |
+
c0.299805 -4.60059 0.5 -9.2998 0.5 -14.1006c0 -8.69922 -0.599609 -17.2998 -1.59961 -25.7998l50.6992 -14.2998zM432.3 175.1c0 97.5 -79 176.5 -176.5 176.5s-176.5 -79 -176.5 -176.5s79 -176.5 176.5 -176.5s176.5 79 176.5 176.5zM408.3 175.1
|
1997 |
+
c0 -84.2998 -68.2998 -152.6 -152.6 -152.6s-152.601 68.2998 -152.601 152.6c0 84.3008 68.3008 152.601 152.601 152.601s152.6 -68.2998 152.6 -152.601zM195 207c0 -2.09961 1.2998 -3.7998 3.59961 -5.09961c3.30078 -1.90039 6.2002 -4.60059 8.2002 -8.2002
|
1998 |
+
c2.7998 5.7002 4.2998 9.5 4.2998 11.2002c0 2.19922 -1.09961 4.39941 -3.19922 7c-2.10059 2.5 -3.2002 5.19922 -3.30078 7.69922c-6.5 -6.7998 -9.59961 -10.8994 -9.59961 -12.5996zM154.3 226c0 -2.09961 1.2998 -3.7998 3.60059 -5.09961
|
1999 |
+
c3.5 -1.90039 6.19922 -4.60059 8.19922 -8.2002c2.80078 5.7002 4.30078 9.5 4.30078 11.2002c0 2.19922 -1.10059 4.39941 -3.2002 7c-2.10059 2.5 -3.2002 5.19922 -3.2998 7.69922c-6.5 -6.7998 -9.60059 -10.8994 -9.60059 -12.5996zM135.3 226
|
2000 |
+
c0 -2.09961 1.2998 -3.7998 3.60059 -5.09961c3.2998 -1.90039 6.19922 -4.60059 8.19922 -8.2002c2.80078 5.7002 4.30078 9.5 4.30078 11.2002c0 2.19922 -1.10059 4.39941 -3.2002 7c-2.10059 2.5 -3.2002 5.19922 -3.2998 7.69922
|
2001 |
+
c-6.40039 -6.7998 -9.60059 -10.8994 -9.60059 -12.5996zM340.2 138.1c-8.40039 3 -8.7002 6.80078 -8.7002 15.6006v112.3c-8.2002 -12.5 -14.2002 -18.5996 -18 -18.5996c6.2998 -14.4004 9.5 -23.9004 9.5 -28.3008v-64.2998c0 -2.2002 -2.2002 -6.5 -4.7002 -6.5h-18
|
2002 |
+
c-2.7998 7.5 -10.2002 26.9004 -15.2998 40.2998c-2 -2.5 -7.2002 -9.19922 -10.7002 -13.6992c2.40039 -1.60059 4.10059 -3.60059 5.2002 -6.30078c2.59961 -6.69922 6.40039 -16.5 7.90039 -20.1992h-9.2002c-3.90039 10.3994 -9.60059 25.3994 -11.7998 31.0996
|
2003 |
+
c-2 -2.5 -7.2002 -9.2002 -10.7002 -13.7002c2.39941 -1.59961 4.09961 -3.59961 5.2002 -6.2998c0.799805 -2 2.7998 -7.2998 4.2998 -10.9004h-9.2002c-1.5 4.10059 -5.59961 14.6006 -8.40039 22c-2 -2.5 -7.19922 -9.19922 -10.6992 -13.6992
|
2004 |
+
c2.5 -1.60059 4.2998 -3.60059 5.19922 -6.30078c0.200195 -0.599609 0.5 -1.39941 0.600586 -1.69922h-17.7002c-4.59961 13.8994 -11.4004 27.6992 -11.4004 34.0996c0 2.2002 0.300781 5.09961 1.10059 8.2002c-8.7998 -10.7998 -14 -15.9004 -14 -25
|
2005 |
+
c0 -7.5 10.3994 -28.2998 10.3994 -33.2998c0 -1.7002 -0.5 -3.30078 -1.39941 -4.90039c-9.60059 12.7002 -15.5 20.7002 -18.7998 20.7002h-12l-11.2002 28c-3.7998 9.59961 -5.7002 16 -5.7002 18.7998c0 3.7998 0.5 7.7002 1.7002 12.2002
|
2006 |
+
c-1 -1.2998 -3.7002 -4.7002 -5.5 -7.10059c-0.799805 2.10059 -3.10059 7.7002 -4.60059 11.5c-2.09961 -2.5 -7.5 -9.09961 -11.1992 -13.5996c0.899414 -2.2998 3.2998 -8.09961 4.89941 -12.2002c-2.5 -3.2998 -9.09961 -11.7998 -13.5996 -17.7002
|
2007 |
+
c-4 -5.2998 -5.7998 -13.2998 -2.7002 -21.7998c2.5 -6.7002 2 -7.89941 -1.7002 -14.0996h61.7002c5.5 0 14.2998 -14 15.5 -22c13.2002 16 15.4004 19.5996 16.7998 21.5996h107c3.90039 0 7.2002 1.90039 9.90039 5.7998zM360.3 164.7v101.6
|
2008 |
+
c-9 -12.5 -15.8994 -18.5996 -20.7002 -18.5996c7.10059 -14.4004 10.7002 -23.9004 10.7002 -28.2998v-66.3008c0 -17.5 8.60059 -20.3994 24 -20.3994c8.10059 0 12.5 0.799805 13.7002 2.7002c-4.2998 1.59961 -7.59961 2.5 -9.90039 3.2998
|
2009 |
+
c-8.09961 3.2002 -17.7998 7.39941 -17.7998 26z" />
|
2010 |
+
<glyph glyph-name="vaadin" unicode=""
|
2011 |
+
d="M224.5 307.3c1.5 17.6006 4.90039 52.7002 49.7998 52.7002h98.6006c20.6992 0 32.0996 7.7998 32.0996 21.5996v12.3008c0 12.1992 9.2998 22.0996 21.5 22.0996s21.5 -9.90039 21.5 -22.0996v-36.5c0 -42.9004 -21.5 -62 -66.7998 -62h-100.5
|
2012 |
+
c-30.1006 0 -33 -14.7002 -33 -27.1006c0 -1.2998 -0.100586 -2.5 -0.200195 -3.7002c-0.700195 -12.2998 -10.9004 -22.1992 -23.4004 -22.1992s-22.6992 9.7998 -23.3994 22.1992c-0.100586 1.2002 -0.200195 2.40039 -0.200195 3.7002c0 12.2998 -3 27.1006 -33 27.1006
|
2013 |
+
h-100.7c-45.2998 0 -66.7998 19.0996 -66.7998 62v36.5c0 12.1992 9.40039 22.0996 21.5996 22.0996c12.2002 0 21.5 -9.90039 21.5 -22.0996v-12.3008c0 -13.7998 11.4004 -21.5996 32.1006 -21.5996h98.5996c44.7998 0 48.2998 -35.0996 49.7998 -52.7002h0.900391z
|
2014 |
+
M224 -8c-11.5 0 -21.4004 7 -25.7002 16.2998c-1.09961 1.7998 -97.0996 169.5 -98.2002 171.4c-11.8994 19.7002 3.2002 44.2998 27.2002 44.2998c13.9004 0 23.4004 -6.40039 29.7998 -20.2998l66.9004 -117.7l66.9004 117.7c6.5 13.8994 15.8994 20.2998 29.7998 20.2998
|
2015 |
+
c24 0 39.0996 -24.7002 27.2002 -44.2998c-1.10059 -1.7998 -97.1006 -169.601 -98.2002 -171.4c-4.2998 -9.2998 -14.2002 -16.2998 -25.7002 -16.2998z" />
|
2016 |
+
<glyph glyph-name="viber" unicode="" horiz-adv-x="512"
|
2017 |
+
d="M444 398.1c42.2002 -36.6992 65.5996 -117.899 49.7998 -246.5c-15.2002 -124.6 -109.1 -136.6 -125.7 -142c-7.19922 -2.2998 -70.2998 -18.0996 -152.5 -11.1992c-9.09961 -10.5 -21.0996 -24.3008 -29.7998 -33.7002
|
2018 |
+
c-15.8994 -17.1006 -25.7002 -33 -42.2998 -27.7998c-13.7998 4.19922 -13 25.0996 -13 25.0996l0.0996094 51.5996h-0.0996094c-120.1 33.8008 -118.4 158.4 -117 224.9s14.2998 120.2 50.9004 156.8c65.7998 60.4004 200.899 52.2998 200.899 52.2998
|
2019 |
+
c114.601 -0.5 166 -37.7998 178.7 -49.5zM457.9 161c13.2998 107.3 -4.90039 180.5 -40.6006 211.1c-10.7998 9.80078 -57.2002 39 -154.1 39.4004c0 0 -114.7 7.5 -170.4 -43c-31 -30.5996 -41.5 -76.0996 -42.5996 -131.6
|
2020 |
+
c-1.10059 -55.5 -7.10059 -161.601 94.7002 -189.801c-0.100586 0 -0.100586 0 0 0c0 0 -0.400391 -78.7998 -0.400391 -85.6992c-0.0996094 -10.5 5.7002 -11 11 -5.7002c16.2002 16.2998 68.2002 79 68.2002 79c69.7002 -4.5 125.2 9.2998 131.2 11.2002
|
2021 |
+
c14 4.5 90.0996 11.0996 103 115.1zM318.9 241.8c0.399414 -8.59961 -12.5 -9.2002 -12.9004 -0.599609c-1.09961 22 -11.4004 32.7002 -32.5996 33.8994c-8.60059 0.5 -7.80078 13.4004 0.699219 12.9004c27.9004 -1.5 43.4004 -17.5 44.8008 -46.2002zM339.2 230.5
|
2022 |
+
c1 42.4004 -25.5 75.5996 -75.7998 79.2998c-8.5 0.600586 -7.60059 13.5 0.899414 12.9004c58 -4.2002 88.9004 -44.1006 87.7998 -92.5c-0.0996094 -8.60059 -13.0996 -8.2002 -12.8994 0.299805zM386.2 217.1c0.0996094 -8.59961 -12.9004 -8.69922 -12.9004 -0.0996094
|
2023 |
+
c-0.599609 81.5 -54.8994 125.9 -120.8 126.4c-8.5 0.0996094 -8.5 12.8994 0 12.8994c73.7002 -0.5 133 -51.3994 133.7 -139.2zM374.9 119v-0.200195c-10.8008 -19 -31 -40 -51.8008 -33.2998l-0.199219 0.299805c-21.1006 5.90039 -70.8008 31.5 -102.2 56.5
|
2024 |
+
c-16.2002 12.7998 -31 27.9004 -42.4004 42.4004c-10.2998 12.8994 -20.7002 28.2002 -30.7998 46.5996c-21.2998 38.5 -26 55.7002 -26 55.7002c-6.7002 20.7998 14.2002 41 33.2998 51.7998h0.200195c9.2002 4.7998 18 3.2002 23.9004 -3.89941
|
2025 |
+
c0 0 12.3994 -14.8008 17.6992 -22.1006c5 -6.7998 11.7002 -17.7002 15.2002 -23.7998c6.10059 -10.9004 2.2998 -22 -3.7002 -26.5996l-12 -9.60059c-6.09961 -4.89941 -5.2998 -14 -5.2998 -14s17.7998 -67.2998 84.2998 -84.2998c0 0 9.10059 -0.799805 14 5.2998
|
2026 |
+
l9.60059 12c4.59961 6 15.7002 9.7998 26.5996 3.7002c14.7002 -8.2998 33.4004 -21.2002 45.7998 -32.9004c7 -5.69922 8.60059 -14.3994 3.80078 -23.5996z" />
|
2027 |
+
<glyph glyph-name="vimeo" unicode=""
|
2028 |
+
d="M403.2 416c24.7002 0 44.7998 -20.0996 44.7998 -44.7998v-358.4c0 -24.7002 -20.0996 -44.7998 -44.7998 -44.7998h-358.4c-24.7002 0 -44.7998 20.0996 -44.7998 44.7998v358.4c0 24.7002 20.0996 44.7998 44.7998 44.7998h358.4zM377 267.2
|
2029 |
+
c1.90039 42.2002 -13.7998 63.7998 -47.0996 64.7002c-44.9004 1.39941 -75.3008 -23.9004 -91.2002 -76c19.8994 8.5 49.2998 10.7998 45.7998 -22.4004c-1 -11.2002 -8.2998 -27.5 -21.7998 -48.9004c-37.7002 -59.3994 -46.9004 -39.5996 -67.6006 91.6006
|
2030 |
+
c-5.7998 36.8994 -21.2998 54.0996 -46.5 51.7002c-22.2998 -2 -57.8994 -38.4004 -95.1992 -71.2002l15.1992 -19.6006c14.5 10.1006 23 15.2002 25.4004 15.2002c21 0 31.9004 -54.7002 57.4004 -148c13.0996 -34.8994 29 -52.2998 47.8994 -52.2998
|
2031 |
+
c30.4004 0 67.7002 28.5996 111.7 85.7998c42.5996 54.7002 64.5996 97.9004 66 129.4z" />
|
2032 |
+
<glyph glyph-name="vnv" unicode="" horiz-adv-x="640"
|
2033 |
+
d="M104.9 96c-34.1006 0 -46.4004 30.4004 -46.4004 30.4004l-55.9004 111.5s-10.3994 18.0996 10.4004 18.0996h32.7998c10.4004 0 13.2002 -8.7002 18.7998 -18.0996l36.7002 -74.5s5.2002 -13.1006 21.1006 -13.1006c15.8994 0 21.0996 13.1006 21.0996 13.1006
|
2034 |
+
l36.7002 74.5c5.59961 9.5 8.39941 18.0996 18.7998 18.0996h32.7998c20.7998 0 10.4004 -18.0996 10.4004 -18.0996l-55.7998 -111.5s-12.2002 -30.4004 -46.4004 -30.4004h-35.0996zM499.9 96c-34.1006 0 -46.4004 30.4004 -46.4004 30.4004l-55.9004 111.5
|
2035 |
+
s-10.3994 18.0996 10.4004 18.0996h32.7998c10.4004 0 13.2002 -8.7002 18.7998 -18.0996l36.7002 -74.5s5.2002 -13.1006 21.1006 -13.1006c15.8994 0 21.0996 13.1006 21.0996 13.1006l36.7998 74.5c5.60059 9.5 8.40039 18.0996 18.7998 18.0996h32.9004
|
2036 |
+
c20.7998 0 10.4004 -18.0996 10.4004 -18.0996l-55.9004 -111.5s-12.2002 -30.4004 -46.4004 -30.4004h-35.1992zM337.6 256c34.1006 0 46.4004 -30.4004 46.4004 -30.4004l55.9004 -111.5s10.3994 -18.0996 -10.4004 -18.0996h-32.7998
|
2037 |
+
c-10.4004 0 -13.2002 8.7002 -18.7998 18.0996l-36.7002 74.5s-5.2002 13.1006 -21.1006 13.1006c-15.8994 0 -21.0996 -13.1006 -21.0996 -13.1006l-36.7002 -74.5c-5.59961 -9.39941 -8.39941 -18.0996 -18.7998 -18.0996h-32.9004
|
2038 |
+
c-20.7998 0 -10.3994 18.0996 -10.3994 18.0996l55.8994 111.5s12.2002 30.4004 46.4004 30.4004h35.0996z" />
|
2039 |
+
<glyph glyph-name="whatsapp-square" unicode=""
|
2040 |
+
d="M224 325.2c35.2002 0 68.2002 -13.7002 93.2002 -38.7002c24.8994 -24.9004 40.0996 -58 40.0996 -93.2002c0 -72.7002 -60.7002 -131.8 -133.3 -131.8h-0.0996094c-23.7002 0 -46.9004 6.40039 -67.1006 18.4004l-4.7998 2.89941l-49.9004 -13.0996l13.3008 48.5996
|
2041 |
+
l-3.10059 5c-13.2002 20.9004 -20.2002 45.2002 -20.2002 70.1006c0.100586 72.6992 59.2002 131.8 131.9 131.8zM301.5 136.8c3.2998 9.2002 3.2998 17.2002 2.40039 19.1006c-1 1.59961 -3.60059 2.59961 -7.60059 4.59961s-23.5 11.5996 -27.0996 12.9004
|
2042 |
+
c-3.60059 1.2998 -6.2998 2 -8.90039 -2c-2.59961 -3.90039 -10.2002 -12.9004 -12.5 -15.5c-2.2998 -2.7002 -4.59961 -3 -8.59961 -1c-23.2998 11.6992 -38.6006 20.7998 -53.9004 47.0996c-4.09961 7 4 6.40039 11.6006 21.5996
|
2043 |
+
c1.39941 2.60059 0.699219 4.90039 -0.300781 6.90039s-8.89941 21.5 -12.1992 29.4004c-3.2002 7.69922 -6.5 6.69922 -8.90039 6.7998c-2.2998 0.0996094 -5 0.0996094 -7.59961 0.0996094c-2.7002 0 -7 -1 -10.6006 -5c-3.7002 -4 -13.8994 -13.5996 -13.8994 -33.0996
|
2044 |
+
s14.1992 -38.4004 16.1992 -41c2 -2.60059 28 -42.6006 67.7002 -59.7998c25.1006 -10.8008 34.9004 -11.8008 47.5 -9.90039c7.60059 1.09961 23.4004 9.5 26.7002 18.7998zM400 416c26.5 0 48 -21.5 48 -48v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48
|
2045 |
+
v352c0 26.5 21.5 48 48 48h352zM223.9 34.7998c87.3994 0 160.1 71.1006 160.1 158.5c0 42.4004 -18 82.2002 -47.9004 112.2c-30 30 -69.7998 46.5 -112.199 46.5c-87.4004 0 -158.5 -71.0996 -158.601 -158.5c0 -28 7.2998 -55.2998 21.2002 -79.2998l-22.5 -82.2002
|
2046 |
+
l84.0996 22.0996c23.1006 -12.5996 49.2002 -19.2998 75.8008 -19.2998z" />
|
2047 |
+
<glyph glyph-name="whmcs" unicode=""
|
2048 |
+
d="M448 287l-29.0996 -7l-2.2002 -12.0996l20.8994 -18.8008l-10.2998 -20.0996l-28.7998 8.7998l-7.7998 -8.09961l8.7998 -28l-20.4004 -12.1006l-20.6992 21.6006l-11.6006 -3.5l-6.7002 -28.7998l-22.5996 0.299805l-6.7002 28.5l-11.5996 2.89941l-19.4004 -20.3994
|
2049 |
+
l-19.8994 11.5996l8.09961 26.9004l-7.2002 8.59961l-29.5996 -7.5l-10.4004 18.5l20.1006 19.9004l-2.40039 12.0996l-28.7998 7.5l0.299805 21.7002l28.5 7.7998l2.90039 10.4004l-20.7002 21l11 19.0996l28.5 -7.5l8.09961 8.40039l-8.09961 27.7002l19.3994 11
|
2050 |
+
l19.7002 -21l12.1006 3.19922l6.19922 26.4004h22.6006l7 -26.4004l10.7002 -3.19922l21.2998 21l19.0996 -11.6006l-7.5 -28.2002l7.2002 -7.5l29 7.5l10.4004 -19.3994l-20.1006 -20.7002l2.2002 -10.4004l28.5 -8.7998v-21.2998zM328.8 241.8
|
2051 |
+
c31.4004 0 56.7998 25.2998 56.7998 56.7998c0 31.4004 -25.3994 56.8008 -56.7998 56.8008c-31.3994 0 -56.7998 -25.4004 -56.7998 -56.8008c0 -31.3994 25.5 -56.7998 56.7998 -56.7998zM401.1 225.4l46.9004 -14.5v-39.9004l-55.0996 -13.4004l-4.10059 -22.6992
|
2052 |
+
l38.9004 -35.3008l-19.2002 -37.8994l-54 16.7002l-14.5996 -15.2002l16.6992 -52.5l-38.2998 -22.7002l-38.8994 40.5l-21.7002 -6.59961l-12.6006 -54l-42.3994 0.5l-12.6006 53.5996l-21.6992 5.59961l-36.4004 -38.3994l-37.4004 21.7002l15.2002 50.5l-13.7002 16.0996
|
2053 |
+
l-55.5 -14.0996l-19.6992 34.7998l37.8994 37.3994l-4.7998 22.8008l-54 14.0996l0.5 40.9004l53.5 14.6992l5.7002 19.7002l-38.9004 39.4004l20.7002 35.7998l53.5996 -14.0996l15.2002 15.6992l-15.2002 52l36.4004 20.7002l36.7998 -39.3994l22.7002 6.09961l11.5996 52
|
2054 |
+
h42.4004l11.5996 -45.9004l-22.5996 5.90039l-6.2998 1.7002l-3.2998 -5.7002l-11 -19.0996l-3.30078 -5.60059l4.60059 -4.59961l17.2002 -17.4004l-0.300781 -1l-23.7998 -6.5l-6.2002 -1.7002l-0.0996094 -6.39941l-0.200195 -12.9004
|
2055 |
+
c-47.5 -10.3994 -83.2998 -52.7998 -83.2998 -103.5c0 -58.2998 47.2998 -105.7 105.7 -105.7c50.5 0 92.7002 35.4004 103.2 82.8008l13.1992 -0.200195l6.90039 -0.100586l1.59961 6.7002l5.60059 24l1.89941 0.600586l17.1006 -17.8008l4.7002 -4.89941l5.7998 3.39941
|
2056 |
+
l20.3994 12.1006l5.80078 3.5l-2 6.5z" />
|
2057 |
+
<glyph glyph-name="wordpress-simple" unicode="" horiz-adv-x="512"
|
2058 |
+
d="M256 440c136.7 0 248 -111.2 248 -248c0 -136.7 -111.3 -248 -248 -248s-248 111.3 -248 248c0 136.8 111.3 248 248 248zM33 192c0 -88.2002 51.2998 -164.5 125.7 -200.7l-106.4 291.4c-12.3994 -27.7002 -19.2998 -58.4004 -19.2998 -90.7002zM256 -31
|
2059 |
+
c26 0 50.9004 4.5 74 12.5996c-0.599609 1 -1.09961 2 -1.59961 3.10059l-68.5 187.8l-66.9004 -194.4c20 -5.89941 41.0996 -9.09961 63 -9.09961zM286.7 296.5l80.7002 -239.6l22.1992 74.2998c9.7002 30.8994 17 53 17 72.0996c0 27.6006 -9.89941 46.7002 -18.3994 61.5
|
2060 |
+
c-11.2998 18.4004 -21.9004 33.9004 -21.9004 52.2998c0 20.5 15.5 39.6006 37.4004 39.6006c1 0 1.89941 -0.100586 2.89941 -0.200195c-39.6992 36.2998 -92.5996 58.5 -150.6 58.5c-77.9004 0 -146.4 -40 -186.3 -100.5
|
2061 |
+
c5.2998 -0.200195 10.2002 -0.299805 14.3994 -0.299805c23.3008 0 59.4004 2.7998 59.4004 2.7998c12 0.700195 13.4004 -17 1.40039 -18.4004c0 0 -12.1006 -1.39941 -25.5 -2.09961l81.1992 -241.5l48.8008 146.3l-34.7002 95.2002
|
2062 |
+
c-12 0.700195 -23.4004 2.09961 -23.4004 2.09961c-12 0.700195 -10.5996 19.1006 1.40039 18.4004c0 0 36.7998 -2.7998 58.7002 -2.7998c23.2998 0 59.3994 2.7998 59.3994 2.7998c12 0.700195 13.4004 -17 1.40039 -18.4004c0 0 -12.1006 -1.39941 -25.5 -2.09961z
|
2063 |
+
M368.1 -0.700195c66.3008 38.6006 110.9 110.4 110.9 192.7c0 38.7998 -9.90039 75.2002 -27.2998 107c1 -7.09961 1.5 -14.7002 1.5 -22.9004c0 -22.6992 -4.2998 -48.0996 -17 -79.8994z" />
|
2064 |
+
<glyph glyph-name="xbox" unicode="" horiz-adv-x="512"
|
2065 |
+
d="M369.9 129.8c44.2998 -54.2998 64.6992 -98.7998 54.3994 -118.7c-7.89941 -15.0996 -56.7002 -44.5996 -92.5996 -55.8994c-29.6006 -9.2998 -68.4004 -13.2998 -100.4 -10.2002c-38.2002 3.7002 -76.8994 17.4004 -110.1 39
|
2066 |
+
c-27.9004 18.2002 -34.2002 25.7002 -34.2002 40.5996c0 29.9004 32.9004 82.3008 89.2002 142.101c32 33.8994 76.5 73.7002 81.3994 72.5996c9.40039 -2.09961 84.3008 -75.0996 112.301 -109.5zM188.6 304.2c-66.3994 -81.5 -106 -155.4 -120.3 -194.4
|
2067 |
+
c-9.7998 -26.5 -13.7002 -53 -9.5 -64c2.7998 -7.39941 0.200195 -4.7002 -9.2998 9.90039c-23.2002 35.5 -34.9004 70.3994 -40.5 120.899c-1.90039 16.7002 -1.2002 26.3008 4.2002 60.5c6.7998 42.7002 31.0996 92 60.2998 122.4
|
2068 |
+
c12.4004 12.9004 13.5 13.2002 28.7002 8.09961c28.2998 -9.5 56.7002 -36.5 86.3994 -63.3994zM500.2 240.7c4.7002 -22.6006 5.09961 -70.9004 0.799805 -93.4004c-3.59961 -18.5 -11.2002 -42.5 -18.5996 -58.7002c-5.5 -12.1992 -19.3008 -35.7998 -25.4004 -43.5
|
2069 |
+
c-3.09961 -3.89941 -3.09961 -3.89941 -1.40039 4.60059c2.30078 11.2002 -0.599609 31.5996 -7.39941 52.2998c-20.7002 62.9004 -80.5 149 -122.9 202.3c23.2998 21.4004 41 38.2998 64.2998 52.7998c11.8008 7.40039 28.7002 13.9004 36 13.9004
|
2070 |
+
c7.10059 0 57.7002 -50.2998 74.6006 -130.3zM141.3 405c-14.5996 -0.700195 -14 0.0996094 9.40039 11.2002c81.2002 38.2998 170 27.5996 233.899 -11.7002c-13.3994 0.599609 -43.5 5.90039 -107.399 -25.2002c-11.2002 -5.5 -20.9004 -9.7998 -21.6006 -9.7002
|
2071 |
+
c-4.59961 0.900391 -66.5996 37.9004 -114.3 35.4004z" />
|
2072 |
+
<glyph glyph-name="yandex" unicode="" horiz-adv-x="256"
|
2073 |
+
d="M153.1 132.2l-87.3994 -196.2h-63.7002l96 209.8c-45.0996 22.9004 -75.2002 64.4004 -75.2002 141.101c-0.0996094 107.399 68 161.1 148.9 161.1h82.2998v-512h-55.0996v196.2h-45.8008zM198.9 401.5h-29.4004c-44.4004 0 -87.4004 -29.4004 -87.4004 -114.6
|
2074 |
+
c0 -82.3008 39.4004 -108.801 87.4004 -108.801h29.4004v223.4z" />
|
2075 |
+
<glyph glyph-name="yandex-international" unicode="" horiz-adv-x="320"
|
2076 |
+
d="M129.5 -64v166.1l-111 297.9h55.7998l81.7998 -229.7l94.1006 277.7h51.2998l-120.7 -347.8v-164.2h-51.2998z" />
|
2077 |
+
<glyph glyph-name="apple-pay" unicode="" horiz-adv-x="640"
|
2078 |
+
d="M116.9 289.5c-7.5 -8.90039 -19.5 -15.9004 -31.5 -14.9004c-1.5 12 4.39941 24.8008 11.2998 32.6006c7.5 9.09961 20.5996 15.5996 31.2998 16.0996c1.2002 -12.3994 -3.7002 -24.7002 -11.0996 -33.7998zM127.8 272.3c6.7998 -0.5 26.2998 -2.5 38.7998 -21.0996
|
2079 |
+
c-1 -0.799805 -23.1992 -13.5 -22.8994 -40.2998c0.299805 -32 28 -42.6006 28.2998 -42.9004c-0.200195 -0.799805 -4.40039 -15.0996 -14.5 -29.9004c-8.90039 -13 -18 -25.6992 -32.5 -26c-14 -0.199219 -18.7002 8.40039 -34.7998 8.40039
|
2080 |
+
c-16 0 -21.2002 -8.09961 -34.5 -8.59961c-14 -0.5 -24.6006 13.7998 -33.5 26.7998c-18.2002 26.2998 -32.1006 74 -13.2998 106.3c9.09961 16.0996 25.6992 26.2002 43.5996 26.5c13.7998 0.299805 26.4004 -9.09961 34.7998 -9.09961
|
2081 |
+
c8.2002 0 23.1006 10.8994 40.5 9.89941zM228.2 308.5h73.2002c37.6992 0 64.0996 -26 64.0996 -64s-26.7998 -64.2998 -65.0996 -64.2998h-41.9004v-66.6006h-30.2998v194.9zM258.5 283v-77.4004h34.7998c26.4004 0 41.4004 14.2002 41.4004 38.8008
|
2082 |
+
c0 24.5996 -15 38.5996 -41.2998 38.5996h-34.9004zM420.7 112.1c-28.1006 0 -47.7002 16.8008 -47.7998 42c0 25 19 39.4004 54.0996 41.5l37.7998 2.30078v10.7998c0 15.8994 -10.3994 24.5 -28.8994 24.5c-15.2002 0 -26.3008 -7.90039 -28.6006 -19.9004h-27.2998
|
2083 |
+
c0.900391 25.2002 24.7002 43.6006 56.7998 43.6006c34.6006 0 57.1006 -18.2002 57.1006 -46.3008v-97h-28v23.4004h-0.600586c-8 -15.2998 -25.5996 -24.9004 -44.5996 -24.9004zM428.9 135.2c20.5 0 36 13 36 31.2002v11l-33.6006 -2.10059
|
2084 |
+
c-18.8994 -1.09961 -28.7998 -8.2002 -28.7998 -20.5c0 -11.7998 10.2998 -19.5996 26.4004 -19.5996zM531.4 60.5996c-2.30078 0 -9.80078 0.300781 -11.6006 0.700195v23.4004c1.90039 -0.200195 6.5 -0.5 8.90039 -0.5c13.3994 0 20.8994 5.7002 25.5 20.2998
|
2085 |
+
l2.7998 8.59961l-51.2002 141.9h31.6006l35.5996 -115.1h0.599609l35.6006 115.1h30.7998l-53.0996 -149c-12.1006 -34.0996 -26 -45.4004 -55.5 -45.4004z" />
|
2086 |
+
<glyph glyph-name="cc-apple-pay" unicode="" horiz-adv-x="576"
|
2087 |
+
d="M302.2 229.6c0 -17.1992 -10.5 -27.0996 -29 -27.0996h-24.2998v54.2002h24.3994c18.4004 0 28.9004 -9.7998 28.9004 -27.1006zM349.7 167c0 8.59961 6.89941 13.5 20.2002 14.4004l23.5 1.5v-7.7002c0 -12.7998 -10.8008 -21.9004 -25.2002 -21.9004
|
2088 |
+
c-11.2998 0 -18.5 5.40039 -18.5 13.7002zM576 369v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48zM127.8 250.8c8.40039 -0.700195 16.7998 4.2002 22.1006 10.4004
|
2089 |
+
c5.19922 6.39941 8.59961 15 7.69922 23.7002c-7.39941 -0.300781 -16.5996 -4.90039 -21.8994 -11.3008c-4.7998 -5.5 -8.90039 -14.3994 -7.90039 -22.7998zM188.4 176.3c-0.200195 0.200195 -19.6006 7.60059 -19.8008 30c-0.199219 18.7002 15.3008 27.7002 16 28.2002
|
2090 |
+
c-8.7998 13 -22.3994 14.4004 -27.0996 14.7002c-12.2002 0.700195 -22.5996 -6.90039 -28.4004 -6.90039c-5.89941 0 -14.6992 6.60059 -24.2998 6.40039c-12.5 -0.200195 -24.2002 -7.2998 -30.5 -18.6006c-13.0996 -22.5996 -3.39941 -56 9.2998 -74.3994
|
2091 |
+
c6.2002 -9.10059 13.7002 -19.1006 23.5 -18.7002c9.30078 0.400391 13 6 24.2002 6c11.2998 0 14.5 -6 24.2998 -5.90039c10.2002 0.200195 16.5 9.10059 22.8008 18.2002c6.89941 10.4004 9.7998 20.4004 10 21zM323.8 229.7c0 26.5996 -18.5 44.7998 -44.8994 44.7998
|
2092 |
+
h-51.2002v-136.4h21.2002v46.6006h29.2998c26.7998 0 45.5996 18.3994 45.5996 45zM413.8 206c0 19.7002 -15.7998 32.4004 -40 32.4004c-22.5 0 -39.0996 -12.9004 -39.7002 -30.5h19.1006c1.59961 8.39941 9.39941 13.8994 20 13.8994c13 0 20.2002 -6 20.2002 -17.2002
|
2093 |
+
v-7.5l-26.4004 -1.59961c-24.5996 -1.5 -37.9004 -11.5996 -37.9004 -29.0996c0 -17.7002 13.7002 -29.4004 33.4004 -29.4004c13.2998 0 25.5996 6.7002 31.2002 17.4004h0.399414v-16.4004h19.6006v68h0.0996094zM516 237.1h-21.5l-24.9004 -80.5996h-0.399414
|
2094 |
+
l-24.9004 80.5996h-22.2998l35.9004 -99.2998l-1.90039 -6c-3.2002 -10.2002 -8.5 -14.2002 -17.9004 -14.2002c-1.69922 0 -4.89941 0.200195 -6.19922 0.300781v-16.4004c1.19922 -0.400391 6.5 -0.5 8.09961 -0.5c20.7002 0 30.4004 7.90039 38.9004 31.7998z" />
|
2095 |
+
<glyph glyph-name="fly" unicode="" horiz-adv-x="384"
|
2096 |
+
d="M197.8 20.2002c12.9004 -11.7002 33.7002 -33.2998 33.2002 -50.7002c0 -0.799805 -0.0996094 -1.59961 -0.0996094 -2.5c-1.80078 -19.7998 -18.8008 -31.0996 -39.1006 -31c-25 0.0996094 -39.8994 16.7998 -38.7002 35.7998c1 16.2002 20.5 36.7002 32.4004 47.6006
|
2097 |
+
c2.2998 2.09961 2.7002 2.69922 5.59961 3.59961c3.40039 0 3.90039 -0.299805 6.7002 -2.7998zM331.9 380.7c23.8994 -40 27.7998 -73.2998 20.7998 -112.5c-15.2002 -69.9004 -103.601 -166.5 -155.9 -215.7c-1.7002 -1.59961 -1.39941 -1.40039 -3.5 -2.09961
|
2098 |
+
l-3.2998 0.0996094c-1.7002 0.599609 -4.5 3.5 -6.2002 5.09961c-58.7998 57.8008 -148.7 151.601 -155.8 233.801c-1.5 71.3994 29.2998 113.399 82.9004 141.3c9.89941 4.09961 37 17.2998 81.0996 17.2998c22 0.200195 51.0996 -4.5 76.5996 -15.2002
|
2099 |
+
c24.7002 -11.5 47 -26.3994 63.3008 -52.0996zM186.8 96.0996v325.7c-57.8994 -5.5 -72.7002 -89.2002 -69.2998 -136.7c4.09961 -58.2998 41.2998 -137.899 69.2998 -189zM328.7 268c15.7998 54.9004 -10.9004 134.7 -99.7002 153
|
2100 |
+
c38.2002 -25.5996 49.5996 -85.5 48 -131.4c-2 -58.5996 -39.4004 -140 -67.2002 -191.899c41.6006 42.2998 102.5 113.5 118.9 170.3z" />
|
2101 |
+
<glyph glyph-name="node" unicode="" horiz-adv-x="640"
|
2102 |
+
d="M316.3 -4c-2.09961 0 -4.2002 0.599609 -6.09961 1.59961l-19.2002 11.4004c-2.90039 1.59961 -1.5 2.2002 -0.5 2.5c3.7998 1.2998 4.59961 1.59961 8.7002 4c0.399414 0.200195 1 0.0996094 1.39941 -0.0996094l14.8008 -8.80078
|
2103 |
+
c0.5 -0.299805 1.2998 -0.299805 1.7998 0l57.7998 33.4004c0.5 0.299805 0.900391 0.900391 0.900391 1.59961v66.7002c0 0.700195 -0.300781 1.2998 -0.900391 1.60059l-57.7998 33.2998c-0.5 0.299805 -1.2002 0.299805 -1.7998 0l-57.8008 -33.2998
|
2104 |
+
c-0.599609 -0.300781 -0.899414 -1 -0.899414 -1.60059v-66.7002c0 -0.599609 0.399414 -1.19922 0.899414 -1.5l15.8008 -9.09961c8.59961 -4.2998 13.8994 0.799805 13.8994 5.7998v65.9004c0 0.899414 0.700195 1.7002 1.7002 1.7002h7.2998
|
2105 |
+
c0.900391 0 1.7002 -0.700195 1.7002 -1.7002v-65.9004c0 -11.5 -6.2002 -18 -17.0996 -18c-3.30078 0 -6 0 -13.3008 3.60059l-15.1992 8.69922c-3.7002 2.2002 -6.10059 6.2002 -6.10059 10.5v66.7002c0 4.2998 2.2998 8.40039 6.10059 10.5l57.7998 33.4004
|
2106 |
+
c3.7002 2.09961 8.5 2.09961 12.0996 0l57.7998 -33.4004c3.7002 -2.2002 6.10059 -6.2002 6.10059 -10.5v-66.7002c0 -4.2998 -2.2998 -8.39941 -6.10059 -10.5l-57.7998 -33.3994c-1.7002 -1.10059 -3.7998 -1.7002 -6 -1.7002zM363 61.7998
|
2107 |
+
c0 -12.5996 -10.5 -19.7998 -29 -19.7998c-25.2998 0 -30.5996 11.5996 -30.5996 21.2998c0 1 0.799805 1.7002 1.69922 1.7002h7.5c0.900391 0 1.60059 -0.599609 1.7002 -1.40039c1.10059 -7.59961 4.5 -11.3994 19.7998 -11.3994
|
2108 |
+
c12.2002 0 17.4004 2.7002 17.4004 9.2002c0 3.69922 -1.5 6.39941 -20.4004 8.2998c-15.7998 1.59961 -25.5996 5 -25.5996 17.7002c0 11.5996 9.7998 18.5996 26.2998 18.5996c18.5 0 27.6006 -6.40039 28.7998 -20.2002
|
2109 |
+
c0.100586 -0.5 -0.0996094 -0.899414 -0.399414 -1.2998c-0.299805 -0.299805 -0.700195 -0.5 -1.2002 -0.5h-7.5c-0.799805 0 -1.40039 0.5 -1.59961 1.2998c-1.80078 8 -6.2002 10.6006 -18.1006 10.6006c-13.2998 0 -14.7998 -4.60059 -14.7998 -8.10059
|
2110 |
+
c0 -4.2002 1.7998 -5.39941 19.7998 -7.7998c17.7998 -2.40039 26.2002 -5.7002 26.2002 -18.2002zM417.5 111.9c0 -6.10059 -5 -11.1006 -11.0996 -11.1006c-6.10059 0 -11.1006 5 -11.1006 11.1006c0 6.2998 5.2002 11.0996 11.1006 11.0996
|
2111 |
+
c6 0.0996094 11.0996 -4.7998 11.0996 -11.0996zM415.7 111.9c0 5.19922 -4.2002 9.2998 -9.40039 9.2998c-5.09961 0 -9.2998 -4.10059 -9.2998 -9.2998c0 -5.2002 4.2002 -9.40039 9.2998 -9.40039c5.2002 0.0996094 9.40039 4.2998 9.40039 9.40039zM411.2 105.7
|
2112 |
+
h-2.60059c-0.0996094 0.599609 -0.5 3.7998 -0.5 3.89941c-0.199219 0.700195 -0.399414 1.10059 -1.2998 1.10059h-2.2002v-5h-2.39941v12.5h4.2998c1.5 0 4.40039 0 4.40039 -3.2998c0 -2.30078 -1.5 -2.80078 -2.40039 -3.10059
|
2113 |
+
c1.7002 -0.0996094 1.7998 -1.2002 2.09961 -2.7998c0.100586 -1 0.300781 -2.7002 0.600586 -3.2998zM408.4 114.5c0 1.7002 -1.2002 1.7002 -1.80078 1.7002h-2v-3.5h1.90039c1.59961 0 1.90039 1.09961 1.90039 1.7998zM137.3 257l-0.200195 -95
|
2114 |
+
c0 -1.2998 -0.699219 -2.59961 -1.7998 -3.2002c-1.09961 -0.700195 -2.59961 -0.700195 -3.7002 0l-36.3994 20.9004c-2.2998 1.2998 -3.7002 3.7998 -3.7002 6.39941v44.4004c0 2.59961 -1.40039 5.09961 -3.7002 6.40039l-15.5 8.89941
|
2115 |
+
c-1.09961 0.700195 -2.39941 1 -3.7002 1c-1.2998 0 -2.5 -0.299805 -3.69922 -1l-15.5 -8.89941c-2.30078 -1.30078 -3.7002 -3.80078 -3.7002 -6.40039v-44.4004c0 -2.59961 -1.40039 -5 -3.7002 -6.39941l-36.4004 -20.9004
|
2116 |
+
c-1.19922 -0.700195 -2.59961 -0.700195 -3.69922 0c-1.10059 0.700195 -1.80078 1.90039 -1.80078 3.2002l-0.0996094 95c0 2.59961 1.40039 5.09961 3.7002 6.40039l61.2002 35.2998c1.09961 0.599609 2.19922 1 3.39941 1h0.600586
|
2117 |
+
c1.19922 -0.100586 2.39941 -0.400391 3.39941 -1l61.2998 -35.2998c2.30078 -1.30078 3.7002 -3.7002 3.7002 -6.40039zM472.5 360.7v-176.4c0 -2.59961 -1.40039 -5.09961 -3.7002 -6.39941l-61.2998 -35.4004c-2.2998 -1.2998 -5.09961 -1.2998 -7.40039 0
|
2118 |
+
l-61.2998 35.4004c-2.2998 1.2998 -3.7002 3.7998 -3.7002 6.39941v70.7998c0 2.60059 1.40039 5.10059 3.7002 6.40039l61.2998 35.4004c2.30078 1.2998 5.10059 1.2998 7.40039 0l15.2998 -8.80078c1.7002 -1 3.90039 0.300781 3.90039 2.2002v94
|
2119 |
+
c0 2.7998 3 4.60059 5.5 3.2002l36.5 -20.4004c2.2998 -1.19922 3.7998 -3.69922 3.7998 -6.39941zM426.5 231.8c0 0.700195 -0.400391 1.2998 -0.900391 1.60059l-21 12.1992c-0.599609 0.300781 -1.2998 0.300781 -1.89941 0l-21 -12.1992
|
2120 |
+
c-0.600586 -0.300781 -0.900391 -0.900391 -0.900391 -1.60059v-24.2998c0 -0.700195 0.400391 -1.2998 0.900391 -1.59961l21 -12.1006c0.599609 -0.299805 1.2998 -0.299805 1.7998 0l21 12.1006c0.599609 0.299805 0.900391 0.899414 0.900391 1.59961v24.2998h0.0996094
|
2121 |
+
zM636.3 232.5l-36.7002 -21.2998c-2.5 -1.40039 -5.59961 0.399414 -5.59961 3.2002v17.3994c0 1.2998 -0.799805 2.5 -1.90039 3.2002l-19.1992 11.0996c-1.10059 0.700195 -2.60059 0.700195 -3.7002 0l-19.2002 -11.0996
|
2122 |
+
c-1.2002 -0.700195 -1.90039 -1.90039 -1.90039 -3.2002v-22.2002c0 -1.2998 0.700195 -2.5 1.90039 -3.19922l61.7002 -35.4004c2.5 -1.40039 2.5 -5 0 -6.40039l-36.7998 -20.5c-2.30078 -1.2998 -5.10059 -1.2998 -7.30078 0l-60.8994 34.7002
|
2123 |
+
c-2.2998 1.2998 -3.7002 3.7002 -3.7002 6.40039v70.7998c0 2.59961 1.40039 5.09961 3.7002 6.40039l61.2998 35.3994c2.2998 1.2998 5.09961 1.2998 7.40039 0l60.8994 -35.3994c2.2998 -1.30078 3.7002 -3.80078 3.7002 -6.40039v-17.0996
|
2124 |
+
c0 -2.60059 -1.40039 -5.10059 -3.7002 -6.40039zM559 229l11.7998 6.7998c0.400391 0.299805 1 0.299805 1.40039 0l11.7998 -6.7998c0.400391 -0.200195 0.700195 -0.700195 0.700195 -1.2002v-13.5996c0 -0.5 -0.299805 -0.900391 -0.700195 -1.2002l-11.7998 -6.7998
|
2125 |
+
c-0.400391 -0.299805 -1 -0.299805 -1.40039 0l-11.7998 6.7998c-0.400391 0.200195 -0.700195 0.700195 -0.700195 1.2002v13.5996c0 0.5 0.299805 0.900391 0.700195 1.2002zM304.8 185.5c0 -0.599609 -0.0996094 -1.2002 -0.200195 -1.7002
|
2126 |
+
c-0.5 -2 -1.7998 -3.7002 -3.59961 -4.7002l-61 -35.1992c-2.2002 -1.30078 -5 -1.40039 -7.40039 0l-61.1992 35.1992c-2.10059 1.2002 -4 3.60059 -4 6.40039v70.4004c0 2.69922 1.59961 5.09961 3.89941 6.39941l61.1006 35.2002
|
2127 |
+
c2.39941 1.40039 5.2998 1.2002 7.39941 0l61.1006 -35.2002c2.2998 -1.2998 3.89941 -3.7998 3.89941 -6.39941v-70.4004zM230.5 310.4l-0.799805 -0.5h1.09961zM306.7 180.2l-0.400391 0.700195v-0.900391z" />
|
2128 |
+
<glyph glyph-name="osi" unicode="" horiz-adv-x="512"
|
2129 |
+
d="M8 181.56c2.2998 135.801 97.3994 232.441 213.799 248.102c138.8 18.5996 255.601 -75.7998 278 -201.101c21.2998 -118.8 -44 -230 -151.6 -274c-9.2998 -3.7998 -14.4004 -1.69922 -18 7.7002c-17.7998 46.2998 -35.5996 92.6328 -53.3994 138.999
|
2130 |
+
c-3.09961 8.10059 -1 13.2002 7 16.7998c24.2002 11 39.2998 29.4004 43.2998 55.8008c0.469727 3.01562 0.850586 7.94043 0.850586 10.9922c0 36.2061 -29.2764 68.1074 -65.3506 71.207c-39 3.40039 -71.7998 -23.6992 -77.5 -59.6992
|
2131 |
+
c-5.19922 -33 11.1006 -63.7002 41.9004 -77.7002c9.59961 -4.40039 11.5 -8.60059 7.7998 -18.4004c-17.8994 -46.5996 -35.7998 -93.2324 -53.7002 -139.899c-2.59961 -6.90039 -8.2998 -9.30078 -15.5 -6.5c-52.5996 20.2998 -101.399 61 -130.8 119
|
2132 |
+
c-24.8994 49.1992 -25.2002 87.6992 -26.7998 108.699zM28.8994 183.461c0.399414 -6.59961 0.599609 -14.3008 1.2998 -22.1006c6.2998 -71.9004 49.5996 -143.5 131 -183.101c3.2002 -1.5 4.39941 -0.799805 5.59961 2.2998c14.9004 39.1006 29.9004 78.2012 45 117.302
|
2133 |
+
c1.2998 3.2998 0.600586 4.7998 -2.39941 6.69922c-31.6006 19.9004 -47.3008 48.5 -45.6006 86c1 21.6006 9.2998 40.5 23.7998 56.3008c30 32.6992 77 39.7998 115.5 17.5996c25.3174 -14.5977 45.8643 -50.1641 45.8643 -79.3877
|
2134 |
+
c0 -3.05078 -0.296875 -7.98438 -0.664062 -11.0127c-3.59961 -30.5996 -19.2998 -53.8994 -45.7002 -69.7998c-2.69922 -1.59961 -3.5 -2.89941 -2.2998 -6c15.2002 -39.2002 30.2666 -78.4336 45.2002 -117.7c1.2002 -3.09961 2.40039 -3.7998 5.59961 -2.2998
|
2135 |
+
c35.5 16.6006 65.2002 40.2998 88.1006 72c34.7998 48.2002 49.0996 101.9 42.2998 161c-13.7002 117.5 -119.4 214.8 -255.5 198c-106.1 -13 -195.3 -102.5 -197.1 -225.8z" />
|
2136 |
+
<glyph glyph-name="react" unicode="" horiz-adv-x="512"
|
2137 |
+
d="M418.2 270.8c54.3994 -18.7002 93.7998 -48.0996 93.7998 -78.3994c0 -31.7002 -41.7998 -62.6006 -99.5 -81.7002c-3.09961 -1 -6.2002 -2 -9.40039 -2.90039c1.10059 -4.59961 2.10059 -9.09961 3 -13.5c11.4004 -57.5996 2.60059 -104.899 -24.3994 -120.5
|
2138 |
+
c-26.1006 -15.0996 -68.4004 -0.200195 -111.2 36.6006c-4.59961 4 -9.2002 8.09961 -13.5996 12.3994c-3.5 -3.39941 -7 -6.59961 -10.5 -9.7002c-44.2002 -38.6992 -89.6006 -54.6992 -116.601 -39.0996c-26.2002 15.0996 -34.3994 59.0996 -23.8994 114.6
|
2139 |
+
c1.19922 6.10059 2.5 12 4 18c-4.60059 1.30078 -9.10059 2.80078 -13.6006 4.30078c-55.5 19 -96.2998 50.2998 -96.2998 81.5c0 30.1992 38.2998 59.3994 91.7002 77.8994c5.89941 2.10059 12.2002 4.10059 18.5996 5.90039
|
2140 |
+
c-1.39941 5.59961 -2.59961 11.0996 -3.7002 16.7002c-11 56.3994 -3.19922 101.5 23 116.699c27.3008 15.9004 72.9004 -1.09961 118.4 -41.5c2.7998 -2.5 5.59961 -5.09961 8.2998 -7.69922c4 3.89941 8.2002 7.7998 12.5 11.5
|
2141 |
+
c43.4004 37.7998 86.2998 53.5 112.601 38.3994c27.2998 -15.7998 35.3994 -63.7002 23.0996 -123.3c-0.799805 -3.7002 -1.59961 -7.40039 -2.5 -11.0996c5.40039 -1.60059 10.7998 -3.30078 16.2002 -5.10059zM282.9 355.7c-4 -3.5 -7.80078 -7 -11.7002 -10.7002
|
2142 |
+
c15.3994 -16.7002 29.5996 -34.5 42.5996 -53.0996c22.6006 -2 45.1006 -5.60059 67.2998 -10.6006c0.900391 3.2998 1.60059 6.60059 2.30078 10c10.5996 51.5 4.09961 90.7002 -12.8008 100.4c-15.7998 9.09961 -50.5 -3.60059 -87.6992 -36zM167.2 140.5
|
2143 |
+
c-5 8.59961 -9.7002 17.2998 -14.2998 26.0996c-6.40039 -15.1992 -11.9004 -30.0996 -16.3008 -44.5c15.3008 -3.2998 30.8008 -5.7998 46.4004 -7.5c-5.5 8.5 -10.7002 17.2002 -15.7998 25.9004zM136.9 260.8c4.39941 -14.0996 9.69922 -28.7002 16 -43.5996
|
2144 |
+
c4.5 8.7998 9.2998 17.5 14.1992 26c4.90039 8.59961 10.1006 17.0996 15.4004 25.3994c-15.9004 -2 -31.2002 -4.59961 -45.5996 -7.7998zM164.3 191.9c6.7002 -13.8008 13.7998 -27.3008 21.5 -40.6006s15.9004 -26.2998 24.6006 -39
|
2145 |
+
c14.6992 -0.899414 29.8994 -1.39941 45.5996 -1.39941s31.2002 0.5 46.0996 1.59961c8.5 12.7998 16.6006 25.7002 24.2002 39c7.7002 13.4004 14.9004 27 21.6006 40.7998c-6.80078 13.7002 -14 27.2002 -21.7002 40.4004s-15.7998 26.0996 -24.2998 38.7002
|
2146 |
+
c-14.9004 1.09961 -30.3008 1.69922 -45.9004 1.69922s-30.9004 -0.599609 -45.9004 -1.69922c-8.59961 -12.7002 -16.7998 -25.6006 -24.3994 -38.9004c-7.60059 -13.2998 -14.7998 -26.7998 -21.4004 -40.5996zM344.9 140.7c-5 -8.60059 -10.1006 -17.2002 -15.5 -25.6006
|
2147 |
+
c15.7998 1.80078 31.5 4.5 47 8c-4.90039 15.1006 -10.5 29.8008 -16.9004 44.3008c-4.7002 -9 -9.5 -17.9004 -14.5996 -26.7002zM359.3 217.2c6.10059 14.2002 11.5 28.5996 16.1006 43.3994c-14.4004 3.30078 -29.8008 6 -45.9004 8
|
2148 |
+
c5.2998 -8.2998 10.4004 -16.6992 15.2998 -25.1992c5 -8.60059 9.7998 -17.4004 14.5 -26.2002zM256.2 329.7c-10 -10.9004 -20.1006 -22.9004 -29.9004 -35.7998c19.7998 0.899414 39.7002 0.899414 59.5 0c-9.2002 12.3994 -19.0996 24.3994 -29.5996 35.7998zM140.2 391
|
2149 |
+
c-15.7998 -9.09961 -22 -45.5996 -12.6006 -94c1.10059 -5.2002 2.2002 -10.4004 3.5 -15.5c22.2002 4.90039 44.6006 8.40039 67.2002 10.4004c13.1006 18.5996 27.4004 36.3994 42.9004 53.0996c-2.60059 2.40039 -5.10059 4.7998 -7.60059 7
|
2150 |
+
c-39.2998 34.7998 -76.5996 48.7998 -93.3994 39zM115.7 127.4c6.89941 22 15.2002 43.5996 24.7998 64.5c-9.5 20.5996 -17.7002 41.8994 -24.5 63.5996c-5.7998 -1.7002 -11.5996 -3.5 -17.2998 -5.5c-45.6006 -15.9004 -77.2002 -39.2998 -77.2002 -57.5996
|
2151 |
+
c1.90039 -12.1006 8.7002 -22.9004 18.7998 -29.9004c17.5 -13.9004 41.7002 -24.5 63 -31.2002c4.10059 -1.39941 8.2002 -2.7002 12.4004 -3.89941zM232.3 29.4004c3.2002 2.7998 6.40039 5.7998 9.60059 8.89941c-15.5 16.7998 -30 34.7002 -43.2002 53.4004
|
2152 |
+
c-22.9004 1.7002 -45.5 5 -67.9004 9.7998c-1.39941 -5.5 -2.59961 -11.0996 -3.7002 -16.7002c-9 -47.5 -2.39941 -82.7998 13.5 -92c11.4004 -4.5 24.2002 -4 35.3008 1.2998c20.7998 8.2002 39.8994 20.2002 56.3994 35.3008zM256.8 53.7002
|
2153 |
+
c10.5 11.5996 20.4004 23.7002 29.6006 36.3994c-10 -0.5 -20.1006 -0.699219 -30.4004 -0.699219c-10 0 -19.9004 0.199219 -29.5 0.599609c9.90039 -13.0996 20.0996 -25.2998 30.2998 -36.2998zM387.5 23.7002c3.2002 22.2002 2.40039 44.7002 -2.5 66.2998
|
2154 |
+
c-0.799805 4 -1.7002 8.09961 -2.7002 12.2002c-22.5 -5.10059 -45.2998 -8.60059 -68.2002 -10.5c-12.7998 -18.7998 -26.8994 -36.7002 -42.1992 -53.6006c4.2998 -4 8.5 -7.89941 12.6992 -11.5c36.6006 -31.3994 70.5 -43.3994 86.4004 -34.1992
|
2155 |
+
c9.59961 7.69922 15.5996 19.0996 16.5 31.2998zM405.7 131.2c49.8994 16.5 84.7998 41.7998 84.7998 61.3994c0 18.2002 -32.7002 42 -79.2998 58c-4.7998 1.60059 -9.7998 3.2002 -15 4.7002c-6.7998 -21.5 -14.9004 -42.5 -24.5 -62.8994
|
2156 |
+
c9.89941 -20.7002 18.5 -42 25.5 -63.8008c2.89941 0.800781 5.7002 1.7002 8.5 2.60059zM256 146.2c-25.2998 0 -45.7998 20.5 -45.7998 45.7998s20.5 45.7998 45.7998 45.7998s45.7998 -20.5 45.7998 -45.7998s-20.5 -45.7998 -45.7998 -45.7998z" />
|
2157 |
+
<glyph glyph-name="autoprefixer" unicode="" horiz-adv-x="640"
|
2158 |
+
d="M318.4 432l164.1 -480h-77.5l-25.2002 81.4004h-119.5l-25.3994 -81.4004h-77.5zM278.1 90.0996h83.6006l-40.9004 130.4h-1.5zM640 43l-158.5 -9.5l-19.4004 56.5l167.9 -15.5996zM177.9 90l-19.4004 -56.4004l-158.5 9.40039l10 31.2998z" />
|
2159 |
+
<glyph glyph-name="less" unicode="" horiz-adv-x="640"
|
2160 |
+
d="M612.7 229c0 -11 6.7998 -22.5996 27.2998 -23.2998v-27.2998c-20.5 -1 -27.2998 -12.6006 -27.2998 -23.6006c0 -20.3994 3.2002 -32 3.2002 -54.5996c0 -34.2002 -12.7002 -45.2002 -40.5 -45.2002h-20.5v25.2002h6.2998v0.5c13.5996 0 17.2998 4.7002 17.2998 22.5996
|
2161 |
+
c0 17.2998 -1.59961 32.6006 -1.59961 51.5c0 24.2002 7.7998 33.6006 23.5996 37.2998v1.60059c-15.7002 3.7002 -23.5996 13.0996 -23.5996 37.2998c0 18.9004 1.59961 35.2002 1.59961 51.5c0 17.4004 -3.09961 22.0996 -17.2998 22.0996h-6.2998v24.2002h20.5
|
2162 |
+
c27.8994 0 40.5 -11 40.5 -45.2002c0 -22 -3.2002 -34.0996 -3.2002 -54.5996zM507.1 197c20.5 -6.7998 43 -18.9004 43 -47.7998c0 -28.9004 -22.5996 -51 -64.5996 -51c-20 0 -44.0996 9 -59.9004 22.0996l21 30.5c14.2002 -11 27.4004 -16.2998 40.5 -16.2998
|
2163 |
+
c14.2002 0 20.5 5.2002 20.5 13.0996c0 10.5 -15.7998 15.8008 -32.0996 22.1006c-18.9004 7.2998 -41.5 20.5 -41.5 46.2002c0 28.8994 24.2002 49.3994 59.9004 49.3994c24.1992 0 42.0996 -10.5 55.1992 -20.5l-21 -27.7998c-11.5 8.40039 -22 13.0996 -33.5996 13.0996
|
2164 |
+
s-17.9004 -4.69922 -17.9004 -12.5996c0 -10.5 14.7002 -14.2002 30.5 -20.5zM148.2 137.6c1.59961 0 3.09961 0 6.2002 0.800781l5.2998 -34.2002c-5.7002 -2.10059 -13.6006 -3.7002 -23.6006 -3.7002c-32.0996 0 -43.0996 21 -43.0996 53.0996v150.801h-14.0996
|
2165 |
+
c-13.6006 0 -17.3008 -4.80078 -17.3008 -22.1006s1.60059 -32.5996 1.60059 -51.5c0 -24.2002 -7.7998 -33.5996 -23.6006 -37.2998v-1.59961c15.7002 -3.7002 23.6006 -13.1006 23.6006 -37.3008c0 -19.3994 -1.60059 -34.1992 -1.60059 -51.5
|
2166 |
+
c0 -17.2998 4.2002 -22.5996 17.3008 -22.5996h6.2998v-24.2002h-20.5c-27.9004 0 -40.5 11 -40.5 45.2002c0 22.5996 3.2002 34.2002 3.2002 53.5996c0 11 -6.80078 22.6006 -27.3008 23.1006v27.2998c20.5 1 27.3008 12.5996 27.3008 23.5996
|
2167 |
+
c0 19.4004 -3.2002 32 -3.2002 54.6006c0 34.2002 12.5996 45.2002 41 45.2002h74.5996v-178.2c0 -9.90039 4.7002 -13.1006 8.40039 -13.1006zM379.9 197c20.5 -6.7998 43.0996 -18.9004 43 -47.7998c0 -28.9004 -22.6006 -51 -64.6006 -51
|
2168 |
+
c-20 0 -44.0996 9 -59.8994 22.0996l20.5 30.5c14.1992 -11 27.3994 -16.2998 40.5 -16.2998c14.1992 0 20.5 5.2002 20.5 13.0996c0 10.5 -15.8008 15.8008 -32.1006 22.1006c-18.8994 7.2998 -41.5 20.5 -41.5 46.2002c0 28.8994 24.2002 49.3994 59.9004 49.3994
|
2169 |
+
c24.2002 0 42.0996 -10.5 55.2002 -20.5l-21 -27.7998c-11.5 8.40039 -22 13.0996 -33.6006 13.0996c-11.5996 0 -17.8994 -4.69922 -17.8994 -12.5996c0 -10.5 14.6992 -14.2002 31 -20.5zM224.9 265.8c44.0996 0 67.2998 -33.0996 66.6992 -75.7002
|
2170 |
+
c0 -8.39941 -1.09961 -15.6992 -1.59961 -19.3994h-95.2002c4.2002 -24.2002 20.5 -34.2002 41.5 -34.2002c11.6006 0 22.6006 3.2002 34.2002 10l15.7998 -27.7998c-16.2998 -11.1006 -37.2998 -17.9004 -56.2002 -17.9004c-45.0996 0 -79.2998 30.5 -79.2998 82.5
|
2171 |
+
c-1 50.4004 35.7002 82.5 74.1006 82.5zM194.9 199.6h56.7998c0 17.9004 -7.40039 31 -26.2998 31c-14.7002 0 -27.3008 -10 -30.5 -31z" />
|
2172 |
+
<glyph glyph-name="sass" unicode="" horiz-adv-x="640"
|
2173 |
+
d="M301.84 69.0801c-0.299805 -0.599609 -0.599609 -1.08008 0 0zM550.97 156.08c57.9092 0.300781 90.5703 -37.0801 88.9707 -71.0801c-1.10059 -26.9004 -25.6904 -37.9004 -30.29 -38.7002c-3.30078 -0.599609 -5.10059 -0.700195 -5.60059 1.90039
|
2174 |
+
c-0.299805 1.7998 0.900391 2.7002 4.7998 5.09961c3.90039 2.40039 15.6006 10.5 17.7002 25c2.10059 14.5 -8.7998 49.2998 -64.4795 55.7998c-26 3 -46.3906 -0.599609 -62.0898 -7.19922c2.89941 -7.60059 5.09961 -15.5 5.39941 -23.4004
|
2175 |
+
c0.799805 -17.5 -11.29 -30.4004 -23.79 -39.5996c-5.48535 -3.98535 -15.1572 -8.95801 -21.5898 -11.1006c-5.2002 -2.2002 -12.2002 -4.5 -17.0996 -3.5c-10.9004 2.2002 -16.7002 11.7998 -9.30078 33.1006c4 11.5 15.5 29 34.0908 44.0996
|
2176 |
+
c-4.30078 8.7002 -8.99023 17.5996 -11.3906 25.7002c-2.18164 7.00781 -4.95898 18.5664 -6.2002 25.7998c0 0 -15.2998 -31.7197 -35.0898 -60.6201c-1.09961 -1.7002 -2.2998 -3.39941 -3.39941 -5c3.7998 -9 6.89941 -18.5996 7.2998 -28.2002
|
2177 |
+
c0.700195 -17.3994 -6.90039 -30.5996 -19.4004 -39.7998c-5.16211 -3.70605 -14.208 -8.45508 -20.1895 -10.5996c-3.90039 -1.7998 -12 -4.60059 -23.5 -5.40039c-6.29004 -0.5 -12.29 -0.0996094 -15.6904 2.5c-4.59961 3.40039 -5.2002 7.7998 -2.7998 13.7002
|
2178 |
+
c2 5 17.21 22.4004 30 37.5996c3.5 4.2002 6.90039 8.5 9.90039 12.5c-0.0498047 0.0449219 -0.09375 0.134766 -0.100586 0.200195c0 0 2.2998 3 6.10059 8.2002c-4.7002 10.0996 -10.6006 20.5 -13.4004 30c-2.18164 7.00781 -4.95898 18.5664 -6.2002 25.7998
|
2179 |
+
c0 0 -15.4902 -39.7002 -31.6895 -71.5c-12.4902 -24.5996 -20.79 -39.5 -24.5908 -46v-0.299805s-0.5 -0.900391 -1.5 -2.40039c-0.5 -0.799805 -0.699219 -1.19922 -0.699219 -1.19922v0.0996094c-4.20996 -6.2002 -13.6104 -18.2998 -23 -18.2998
|
2180 |
+
c-25.7002 0 -16.3008 52.2002 -16.3008 52.2002s-7.5 -19.3008 -16 -35.9004c-6.88965 -13.5996 -13.0898 -25 -26.8896 -25c-3.90039 0 -10.1904 0.0996094 -15.3896 5c-11.8008 11.2002 -20.9004 39.7002 -19.1006 61.7002c1.5 18.7998 4.40039 31.7998 8.40039 42.5996
|
2181 |
+
c-7.10059 -3.89941 -15.2002 -8.39941 -23.4902 -13.2998c-4.2998 -2.5 -8.59961 -5 -12.7998 -7.5c0.0996094 -0.299805 0.299805 -0.5 0.400391 -0.799805c10.5996 -20.4004 13.3896 -65.2002 -9.60059 -99.5s-65.7803 -55.2002 -107.57 -43.6006
|
2182 |
+
c-13.3896 3.80078 -33.79 31.6006 -16.29 70.4004c15.4902 34.2002 77.3809 66.5996 93.6709 74.7002c1.39941 0.799805 2.89941 1.59961 4.5 2.5c-32.4902 28.3994 -113.671 66.7998 -125.061 125.7c-3.2002 16.5996 4.58984 56.2998 53.2803 101.899
|
2183 |
+
c40.9902 38.2998 97.9697 67.7002 150.66 86.4004c88.4297 31.3994 181.949 12.8994 196.31 -43.5c14.1006 -55.5 -33.9902 -121.8 -95.7695 -145.601c-54.9902 -21.2998 -100.471 -17.8994 -119.17 -11.7998c-21.29 7 -33.79 21 -36.79 28.9004
|
2184 |
+
c-1.2002 3.09961 -3.30078 8.2998 0 10.0996c2 1.10059 2.7998 0.799805 8.09961 -5.09961c5.09961 -5.60059 25.4902 -20.6006 64.2803 -16.2998c101.77 11.3994 163.06 90.5 143.66 133c-13.4902 29.7998 -91.8408 43.1992 -189.841 -5.60059
|
2185 |
+
c-119.569 -59.5996 -126.069 -108.7 -127.069 -127.399c-2.7998 -51.3008 63.2793 -78.3008 99.0693 -116.5c0.5 -0.5 0.900391 -1 1.40039 -1.5c6.7002 3.69922 13.7998 7.59961 20.7002 11.3994c18 9.90039 35.0996 19.2002 43 23.5
|
2186 |
+
c12.5801 18.2998 38.1797 38.5 56.5801 38.5c29.4893 0 19.3896 -42.3994 19.3896 -42.3994s0.599609 2 1.40039 2c0.799805 0 4.09961 5.5 13.1992 2.19922c9.40039 -3.5 7.2002 -10 7.30078 -10.6992c0.0996094 -1.30078 -11 -38.9004 -15.7002 -63.1006
|
2187 |
+
c-2.2002 -11.5 -0.900391 -19.8994 -0.299805 -19.8994c0.899414 0 2.7998 2.89941 4.5 6.09961v0.0996094s1.2998 2.40039 3.5 6.7002c0 0.200195 -0.200195 -0.299805 -0.5 -0.799805c0.199219 0.400391 0.5 0.900391 0.899414 1.7002
|
2188 |
+
c2.60059 5 6.2002 12.3994 10.4004 21.5996c8.18945 18.1006 39.4795 87.7002 42.0801 95.4004c2.59961 7.7002 4 15.7002 5.2998 19.0996c1.2998 3.40039 12.4102 6 25.2998 5.90039c12.8906 -0.100586 14.1904 -5.60059 14.29 -6.7002
|
2189 |
+
c0.100586 -1.09961 -6.2002 -16.4004 -7.59961 -27.2002c-1.40039 -10.7998 -0.100586 -16.2002 1.09961 -25.2998c0.799805 -6 4.5 -13.5 8.90039 -22c13.2998 21.7998 36.79 63.5996 39.0898 75.2998c1.03613 5.38965 3.41016 13.9473 5.2998 19.1006
|
2190 |
+
c1.29004 3.39941 12.3896 6 25.29 5.89941c12.9004 -0.0996094 14.2002 -5.59961 14.2998 -6.7002c0.100586 -1.09961 -6.2002 -16.3994 -7.59961 -27.1992c-1.40039 -10.8008 -0.100586 -16.2002 1.09961 -25.3008c1 -7.7998 7.10059 -18.1992 13 -30.0996
|
2191 |
+
c15.1289 7.45215 41.0938 13.5 57.958 13.5h0.0419922zM121.79 11.3799c19.4004 21.0996 27.3896 47.9199 19.0996 78.3203c-1 -0.600586 -2 -1.10059 -2.89941 -1.7002c0 0 -0.400391 -0.200195 -1.2002 -0.700195c-4.7998 -2.89941 -8.7002 -5.2998 -11.4004 -6.89941
|
2192 |
+
c-11.7998 -7.40039 -29.5898 -19.4004 -43.3896 -32.4004c-22.6904 -21.4199 -27.3896 -51 -15.4902 -57.9199c11.0898 -6.40039 36.8906 1.2002 55.2803 21.2998zM256.15 102.78c4 9.7998 19.6992 53.2998 16.1992 59.2002c-2.59961 4.5 -13.6992 0.899414 -23.79 -10.4004
|
2193 |
+
c-6.2998 -7 -16.8994 -25 -21.8994 -40.0996c-9.90039 -30 -5.60059 -60.5 1.39941 -62.3008c8.2002 -2.09961 21.6904 37.9004 28.0908 53.6006zM367.15 49.7803c7.7998 4.7998 24.96 16.8994 25.0898 34.7998c0 0.599609 -0.100586 1.09961 -0.100586 1.59961
|
2194 |
+
c-3.98926 -5.19922 -7.68945 -9.89941 -10.8896 -13.8994c-5.5 -6.7998 -19.4004 -21.7002 -19.4004 -21.7002s-2 -1.90039 -1.09961 -2.40039c1.2002 -0.699219 3.7002 0.200195 6.40039 1.60059zM452.73 69.2803c9.68945 3.5 25.7998 11.8994 25.8994 34.3994
|
2195 |
+
c-0.0673828 3.06152 -0.918945 7.90039 -1.89941 10.8008c-10.4102 -9.2002 -16.4004 -18.8008 -19 -24.5c-6.7002 -14.6006 -7 -19.3008 -5 -20.7002z" />
|
2196 |
+
<glyph glyph-name="vuejs" unicode=""
|
2197 |
+
d="M356.9 383.7h91.0996l-224 -383.7l-224 383.7h176l48 -88.6006l56 88.6006h76.9004zM55.7002 351.7l168.3 -288.2l168.2 288.2h-53.7998l-114.4 -198.2l-114.5 198.2h-53.7998z" />
|
2198 |
+
<glyph glyph-name="angular" unicode=""
|
2199 |
+
d="M185.7 179.9l38.0996 91.5996l38.1006 -91.5996h-76.2002zM223.8 416l207.8 -74.4004l-31.7998 -275.699l-176 -97.9004l-176 97.9004l-31.7998 275.699zM354 74.2002l-130.2 292.3l-130.1 -292.3h48.7002l26.1992 65.3994h110.601l26.2002 -65.3994h48.5996z" />
|
2200 |
+
<glyph glyph-name="aviato" unicode="" horiz-adv-x="640"
|
2201 |
+
d="M107.2 164.5l-19 41.7998h-52.1006l-19 -41.7998h-17.0996l62.2002 131.4l62.2002 -131.4h-17.2002zM62.2002 262.6l-19.6006 -42.5h39.2002zM174.9 160.2l-62.2002 131.399h17.0996l45.1006 -96l45.0996 96h17zM255.5 164.5v127.1h15.5v-127.1h-15.5zM464.6 280.1
|
2202 |
+
v-115.6h-17.2998v115.6h-41.2002v11.5h99.6006v-11.5h-41.1006zM640 229.2c0 -9.2002 -1.7002 -17.7998 -5.09961 -25.7998c-3.40039 -8 -8.2002 -15.1006 -14.2002 -21.1006s-13.1006 -10.7998 -21.1006 -14.2002c-8 -3.39941 -16.5996 -5.09961 -25.7998 -5.09961
|
2203 |
+
s-17.7998 1.7002 -25.7998 5.09961c-8 3.40039 -15.0996 8.2002 -21.0996 14.2002s-10.8008 13 -14.2002 21.1006c-3.40039 8 -5.10059 16.5996 -5.10059 25.7998s1.7002 17.7998 5.10059 25.7998c3.39941 8 8.2002 15.0996 14.2002 21.0996s13 8.40039 21.0996 11.9004
|
2204 |
+
c8 3.40039 16.5996 5.09961 25.7998 5.09961s17.7998 -1.69922 25.7998 -5.09961s15.1006 -5.7998 21.1006 -11.9004c6 -6 10.7002 -13.0996 14.2002 -21.0996c3.39941 -8 5.09961 -16.5996 5.09961 -25.7998zM624.5 229.2c0 7.2998 -1.2998 14 -3.90039 20.2998
|
2205 |
+
c-2.59961 6.2998 -6.19922 11.7002 -10.7998 16.2998c-4.59961 4.60059 -10 8.2002 -16.2002 10.9004c-6.19922 2.7002 -12.7998 4 -19.7998 4s-13.5996 -1.2998 -19.7998 -4s-11.5996 -6.2998 -16.2002 -10.9004c-4.59961 -4.59961 -8.2002 -10 -10.7998 -16.2998
|
2206 |
+
s-3.90039 -13.0996 -3.90039 -20.2998c0 -7.2998 1.30078 -14 3.90039 -20.2998c2.59961 -6.30078 6.2002 -11.7002 10.7998 -16.3008c4.60059 -4.59961 10 -8.19922 16.2002 -10.8994s12.7998 -4 19.7998 -4s13.6006 1.2998 19.7998 4
|
2207 |
+
c6.2002 2.7002 11.6006 6.2998 16.2002 10.8994c4.60059 4.60059 8.2002 10 10.7998 16.3008c2.60059 6.2998 3.90039 13.0996 3.90039 20.2998zM529.7 132.5c6 -0.900391 10.5 -6 10.7002 -12.2998c0 -6.7998 -5.60059 -12.4004 -12.4004 -12.4004
|
2208 |
+
s-12.4004 5.60059 -12.4004 12.4004c0 6.2002 4.60059 11.2998 10.5 12.2002v5.7998l-80.2998 -9v-5.40039c5.60059 -1.09961 9.90039 -6.09961 9.90039 -12.0996c0 -6.7998 -5.60059 -10.2002 -12.4004 -10.2002s-12.3994 3.40039 -12.3994 10.2002
|
2209 |
+
c0 5.89941 4.19922 11 9.89941 12.0996v4.90039l-28.3994 -3.2002v-23.7002h5.89941v-13.7998h-5.89941v6.59961h-5v-6.59961h-5.90039v13.7998h5.90039v23.2002l-38.3008 -4.2998c-8.09961 -11.5 -19 -13.6006 -19 -13.6006l0.100586 -6.69922l5.09961 -0.200195
|
2210 |
+
l0.100586 -12.1006h-4.10059l-0.0996094 5h-5.2002l-0.0996094 -5h-4.10059l0.100586 12.1006l5.09961 0.200195l0.0996094 6.69922s-10.8994 2.2002 -19 13.6006l-38.2998 4.2998v-23.2002h5.90039v-13.7998h-5.90039v6.59961h-5v-6.59961h-5.89941v13.9004h5.89941
|
2211 |
+
v23.6992l-28.3994 3.2002v-4.89941c5.59961 -1.10059 9.89941 -6.10059 9.89941 -12.1006c0 -6.7998 -5.59961 -10.2002 -12.3994 -10.2002c-6.80078 0 -12.4004 3.40039 -12.4004 10.2002c0 5.90039 4.2002 11 9.90039 12.1006v5.39941l-80.3008 9v-5.7998
|
2212 |
+
c5.90039 -0.900391 10.5 -6 10.5 -12.2002c0 -6.7998 -5.59961 -12.3994 -12.3994 -12.3994s-12.4004 5.59961 -12.4004 12.3994c0 6.2002 4.60059 11.2998 10.5 12.2002v6.2998l-88.8994 10l242.899 -13.5c-0.599609 2.2002 -1.09961 4.60059 -1.39941 7.2002
|
2213 |
+
c-0.300781 2.09961 -0.5 4.2002 -0.600586 6.5l-64.7998 8.09961l64.9004 -1.89941c0 0.399414 0 0.799805 0.0996094 1.09961c2.7998 17.2002 25.5 23.7002 25.5 23.7002l1.09961 26.4004h-23.5996l-19 -41.8008h-17.0996l62.1992 131.4l62.2002 -131.4h-17.0996
|
2214 |
+
l-19 41.8008h-23.7998l1.09961 -26.3008s22.7002 -6.5 25.5 -23.6992c0 -0.400391 0.0996094 -0.700195 0.0996094 -1.10059l64.9004 1.90039l-64.7998 -8.10059c-0.100586 -2.2998 -0.299805 -4.5 -0.600586 -6.5c-0.299805 -2.59961 -0.799805 -5 -1.39941 -7.19922
|
2215 |
+
l242.899 13.3994l-88.8994 -10v-6.2998zM328.9 220.1h17.8994l1.7002 40.3008l1.7002 -40.3008h17.8994l-19.5996 42.5z" />
|
2216 |
+
<glyph glyph-name="ember" unicode="" horiz-adv-x="640"
|
2217 |
+
d="M639.9 193.4c1.09961 -10.8008 -5.30078 -14.3008 -5.30078 -14.3008s-26.5996 -19.5996 -47 -13.6992c-20.3994 5.89941 -21.5 43.1992 -21.5 43.1992h-1.89941l-20.7002 -57.1992s-8.2998 -27.9004 -20.7002 -22.8008
|
2218 |
+
c-12.3994 5.10059 -12.0996 18.6006 -12.0996 18.6006s-19.2998 -21.2998 -54.7998 -18.6006c-31.1006 2.30078 -41.1006 26.7002 -41.1006 26.7002s-20.7998 -14.3994 -79.0996 -25.8994c-26.1006 -2.90039 -44.6006 12.8994 -44.6006 12.8994
|
2219 |
+
c-2.39941 -2.39941 -18 -10.2002 -18 -10.2002s-22.2998 -10.2998 -30.8994 5.30078c-8.60059 15.5996 -3 63.6992 -3 63.6992h-1.60059s-12.8994 -26.2998 -19.5996 -49.8994c-6.7002 -23.6006 -15 -21.2002 -15 -21.2002s-15.2998 -1.40039 -18.7998 11.4004
|
2220 |
+
c-3.5 12.8994 5.59961 59.6992 5.59961 59.6992l-1.2998 -0.299805s-0.799805 1.40039 -12.5996 -23.5996c-20.1006 -48.9004 -24.9004 -50 -36.5 -47.9004c-11.6006 2.10059 -12.1006 16.7002 -12.1006 16.7002l-15.8994 -8.7998s-38.6006 -16.6006 -58.8008 -1.2998
|
2221 |
+
c-13.3994 10.1992 -18 22.1992 -19.5996 29.6992c0 0 -17 1.80078 -28.0996 6.10059c-11.1006 4.2998 0.0996094 18.2998 0.0996094 18.2998s3.5 5.2998 10 0s18.7998 -2.90039 18.7998 -2.90039c1 8.5 2.5 19.7002 7.7998 31.5c11 24.7002 27.6006 33 41.3008 33.3008
|
2222 |
+
c13.6992 0.199219 23.3994 -3.5 31.6992 -15.3008c18.6006 -45.8994 -49.3994 -69.1992 -49.3994 -69.1992s-1.7998 -12.1006 16.7002 -11.8008c18.5996 0.200195 46.7998 20.4004 46.7998 20.4004c1.2998 15.4004 12.0996 63.5 15 70.7002
|
2223 |
+
c2.89941 7.2002 14.2002 5.89941 14.2002 5.89941s8.89941 1.90039 10.5 -7.5c1.69922 -9.39941 -6.40039 -47.5996 -6.40039 -47.5996l1.2998 -1.59961c0.799805 3.69922 20.4004 36.5 20.4004 36.5s11.2998 19.5996 28.5 18.7998s-0.799805 -53.5 -0.799805 -53.5
|
2224 |
+
l1.2998 -1.60059l1.2998 2.40039c2.2002 5.90039 27.7002 44.5996 27.7002 44.5996s9.59961 11.3008 18.5 8.60059c8.7998 -2.60059 9.39941 -6.7002 9.89941 -14.2002s-7 -52.0996 -7 -52.0996s-4.2998 -29.2002 5.40039 -28.7002s20.2002 10.7002 20.2002 10.7002
|
2225 |
+
s7.5 57.5996 12.5996 105.1c5.10059 47.5 27.1006 79.5 27.1006 79.5s6.5 10 23.5 16.7002c11.1992 4 23.3994 1.2998 29.1992 -23.1006c9.5 -41 -23.2998 -87.8994 -36.8994 -105.199c5.89941 5.7998 15.7998 12.0996 27.2002 5.2998
|
2226 |
+
c40.2998 -25.2998 7.2998 -80.9004 7.2998 -80.9004c11.7998 3.7998 33 18 33 18s0.5 6.10059 0.700195 7.5c7.19922 41.2998 32 56.2002 36.5996 59.7002c4.7998 3.59961 47.0996 19.7998 49 -24s-52.9004 -59.0996 -52.9004 -59.0996s4.80078 -12.6006 25 -9.40039
|
2227 |
+
c20.2002 3.2002 43.3008 22.7998 43.3008 22.7998c0.799805 18 12.5996 61 15 67.2002c2.39941 6.2002 17.1992 6.5 18.7998 3c2.2002 -7 0.299805 -37.5996 0.299805 -37.5996l1.59961 0.5c5.90039 17.5 18.3008 31.1992 18.3008 31.1992s9.89941 9.7002 18 7.30078
|
2228 |
+
c8.09961 -2.30078 5.09961 -30.4004 5.09961 -30.4004s-4.2998 -30.7002 9.40039 -32c13.6992 -1.40039 29.2998 10.7002 29.2998 10.7002s9.59961 3.89941 10.7002 -6.7998zM61.9004 188.1c0 0 6.19922 -1.89941 19.8994 7.60059
|
2229 |
+
c13.7002 9.39941 16.4004 24.3994 9.10059 31.3994c-7.2002 6.90039 -28.2002 -7 -29 -39zM334.7 311.9c0 0 -15.9004 -54.5 -16.4004 -70.7002c0 0 44.5 72 40 96.2002c-4.5 24.1992 -23.5996 -25.5 -23.5996 -25.5zM357.5 173.5
|
2230 |
+
c12.5996 33.0996 -3.59961 45.5 -3.59961 45.5s-23.4004 12.9004 -33.3008 -20.2002c-9.89941 -33.0996 -6.39941 -44.8994 -6.39941 -44.8994s30.7002 -13.4004 43.2998 19.5996zM442.1 188.1c0 0 15.7002 -1.09961 26.4004 14.2002s1.2998 25.5 1.2998 25.5
|
2231 |
+
s-8.59961 11.1006 -19.5996 -9.09961c-11.1006 -20.1006 -8.10059 -30.6006 -8.10059 -30.6006z" />
|
2232 |
+
<glyph glyph-name="font-awesome-flag" unicode=""
|
2233 |
+
d="M444.373 88.5762c0 -7.16797 -6.14453 -10.2402 -13.3125 -13.3125c-28.6719 -12.2881 -59.3916 -23.5518 -92.1592 -23.5518c-46.0801 0 -67.584 28.6719 -122.88 28.6719c-39.9365 0 -81.9209 -14.3359 -115.713 -29.6953
|
2234 |
+
c-2.04785 -1.02441 -4.0957 -1.02441 -6.14355 -2.04883v-77.8232c0 -21.4053 -16.1221 -34.8164 -33.792 -34.8164c-19.4561 0 -34.8164 15.3604 -34.8164 34.8164v374.783c-13.3115 10.2402 -22.5273 26.624 -22.5273 45.0566c0 31.7441 25.5996 57.3438 57.3438 57.3438
|
2235 |
+
s57.3438 -25.5996 57.3438 -57.3438c0 -18.4326 -8.19141 -34.8164 -22.5273 -45.0566v-31.7432c4.12402 1.37402 58.7676 28.6719 114.688 28.6719c65.2705 0 97.6758 -27.6484 126.976 -27.6484c38.9121 0 81.9209 27.6484 92.1602 27.6484
|
2236 |
+
c8.19238 0 15.3604 -6.14453 15.3604 -13.3125v-240.64z" />
|
2237 |
+
<glyph glyph-name="gitter" unicode="" horiz-adv-x="384"
|
2238 |
+
d="M66.4004 125.5h-50.4004v322.5h50.4004v-322.5zM166.9 371.9v-435.9h-50.4004v435.9h50.4004zM267.5 371.9v-435.9h-50.4004v435.9h50.4004zM368 372v-247h-50.4004v247h50.4004z" />
|
2239 |
+
<glyph glyph-name="hooli" unicode="" horiz-adv-x="640"
|
2240 |
+
d="M144.5 96v16c12.2998 -6.59961 25.0996 -12.2002 38.2998 -16.7998zM202.2 101.3c29.5 -10.7002 55.3994 -13.5 75.2998 -13.2998c-24.7998 -7 -58.2002 -5.2998 -94.7002 7.2002l19.4004 0.799805v5.2998zM611.1 216.5c-16 0 -28.8994 13 -28.8994 28.9004
|
2241 |
+
c0 15.8994 13 24.5 28.8994 24.5c16 0 28.9004 -8.5 28.9004 -24.5s-13 -28.9004 -28.9004 -28.9004zM582.1 96v110.5h57.9004v-110.5h-57.9004zM508.4 96v168l57.8994 27.2998v-195.3h-57.8994zM477.4 215.4c18.0996 -18.1006 16.6992 -33.8008 16.7998 -52.6006
|
2242 |
+
c0 -18.7002 1.39941 -34.2998 -16.7998 -52.5c-18.1006 -18.2002 -50.4004 -17.0996 -50.4004 -17.0996s-32.2002 -1.10059 -50.4004 17.0996c-18.1992 18.2002 -16.7998 33.7998 -16.7998 52.5s-1.39941 34.4004 16.7998 52.6006
|
2243 |
+
c18.1006 18.1992 50.4004 17.0996 50.4004 17.0996s32.2002 1.09961 50.4004 -17.0996zM437.6 143.5v40.4004c0 8.7998 -7.2998 10.8994 -10.6992 10.8994c-3.40039 0 -10.7002 -2.2002 -10.7002 -10.8994v-40.4004c0 -3.59961 1.7998 -12.5 10.7002 -12.5
|
2244 |
+
c8.89941 0 10.6992 8.90039 10.6992 12.5zM331.4 215.4c18.1992 -18.1006 16.6992 -33.8008 16.6992 -52.3008c0 -18.6992 1.5 -34.2998 -16.6992 -52.5c-18.1006 -18.1992 -50.4004 -17.0996 -50.4004 -17.0996s-32.2002 -1.09961 -50.4004 17.0996
|
2245 |
+
c-18.1992 18.2002 -16.7998 33.8008 -16.7998 52.5c0 15.6006 -0.899414 29.1006 9.2998 43.7002c-16 11.7998 -58 37.4004 -99.8994 58.2998v-54.2998c8 13.7002 22.7002 22 38.5 21.9004c27.2002 0 40.5996 -18.7002 40.5996 -37.4004v-93.8994
|
2246 |
+
c-20.3994 7.5 -39.7002 17.3994 -57.7002 29.5996v48.7002c0 8.09961 -1.5 15 -10.5996 15s-10.7998 -11.2998 -10.7998 -18.2002v-29.7998l-4.5 3.59961c-22.9004 18.9004 -40.2998 35.6006 -53.4004 50.2998v-31c11 -9.7998 23.6006 -20.1992 38.4004 -31.3994
|
2247 |
+
c6.39941 -4.90039 12.8994 -9.40039 19.3994 -13.6006v-28.5996h-57.8994v73.7002c-86.7002 78 -61.7998 110.8 -61.7998 110.8c8.2998 18.2998 42.8994 22.2002 97.2998 0.0996094l22.5 10.6006v-20.7002c29.5996 -14.5996 63.8994 -31.5 102.1 -61.0996
|
2248 |
+
c1.60059 2.09961 3.40039 4.09961 5.2998 6c18.2002 18.1992 50.4004 17.0996 50.4004 17.0996s32.2002 1.09961 50.4004 -17.0996zM65.2002 264l29.2002 13.7002c-26.9004 10.0996 -50.9004 13.5 -64.4004 2.09961c-3.7002 -3.09961 -13.5 -24.5996 35.2002 -79.0996
|
2249 |
+
v63.2998zM291.7 143.5v40.4004c0 8.7998 -7.2998 10.8994 -10.7002 10.8994s-10.7002 -2.2002 -10.7002 -10.8994v-40.4004c0 -3.59961 1.7998 -12.5 10.7002 -12.5s10.7002 8.90039 10.7002 12.5z" />
|
2250 |
+
<glyph glyph-name="strava" unicode="" horiz-adv-x="384"
|
2251 |
+
d="M158.4 448l150.199 -292h-88.5l-61.6992 116.1l-62.2002 -116.1h-89.2002zM308.6 156h67.6006l-111.5 -220l-112.2 220h67.5996l44.6006 -88.2002z" />
|
2252 |
+
<glyph glyph-name="stripe" unicode="" horiz-adv-x="640"
|
2253 |
+
d="M165 303.3l0.0996094 -38.5h33.7002v-37.7998h-33.7002v-63.2002c0 -26.2002 28 -18 33.7002 -15.7002v-33.7998c-5.89941 -3.2002 -16.5996 -5.89941 -31.2002 -5.89941c-26.2998 0 -46.0996 17 -46.0996 43.2998l0.200195 142.399zM254.1 251.7
|
2254 |
+
c10.4004 19.0996 31.1006 15.2002 37.1006 13.0996v-40.7998c-5.7002 1.7998 -23.4004 4.5 -33.9004 -9.2998v-103.101h-44.2998v153.2h38.4004zM346.4 324v-36.2002l-44.6006 -9.5v36.2002zM44.9004 219.7c0 -20 67.8994 -10.5 67.8994 -63.4004
|
2255 |
+
c0 -32 -25.3994 -47.7998 -62.2998 -47.7998c-15.2998 0 -32 3 -48.5 10.0996v40c14.9004 -8.09961 33.9004 -14.1992 48.5996 -14.1992c9.90039 0 17 2.69922 17 10.8994c0 21.2002 -67.5 13.2002 -67.5 62.4004c0 31.3994 24 50.2002 60 50.2002
|
2256 |
+
c14.7002 0 29.4004 -2.30078 44.1006 -8.10059v-41.7998c-13.5 7.2998 -30.7002 11.4004 -44.2002 11.4004c-9.2998 -0.100586 -15.0996 -2.80078 -15.0996 -9.7002zM640 186.4c0 -4.30078 -0.400391 -13.6006 -0.599609 -15.9004h-86.9004
|
2257 |
+
c2 -20.7998 17.2002 -26.9004 34.5 -26.9004c17.5996 0 31.5 3.7002 43.5996 9.80078v-33.4004c-12.0996 -6.7002 -28 -11.5 -49.1992 -11.5c-43.2002 0 -73.5 24.7002 -73.5 78.2002c0 45.2002 25.6992 81.0996 67.8994 81.0996s64.2002 -35.8994 64.2002 -81.3994z
|
2258 |
+
M552.1 203.2h45.9004c0 20 -11.5996 28.3994 -22.5 28.3994c-11.0996 0 -23.4004 -8.39941 -23.4004 -28.3994zM439.2 267.8c31.2002 0 60.5996 -28.0996 60.5 -79.7002c0 -56.3994 -29 -79.5996 -60.7998 -79.5996c-15.5 0 -25 6.5 -31.4004 11.2002l-0.0996094 -50.2002
|
2259 |
+
l-44.4004 -9.40039v204.801h39.0996l2.30078 -11c6.19922 5.69922 17.3994 13.8994 34.7998 13.8994zM428.6 145.3c16.5 0 27.5 17.9004 27.4004 41.7998c0 23.2002 -11.2002 41.4004 -27.4004 41.4004c-10.1992 0 -16.5996 -3.7002 -21.1992 -8.7998l0.299805 -66
|
2260 |
+
c4.2998 -4.60059 10.5 -8.40039 20.8994 -8.40039zM301.9 111.6v153.2h44.5996v-153.2h-44.5996z" />
|
2261 |
+
<glyph glyph-name="stripe-s" unicode="" horiz-adv-x="384"
|
2262 |
+
d="M155.3 293.4c0 -64.2002 218 -33.7002 218 -203.9c0 -102.6 -81.7002 -153.6 -200.3 -153.6c-44.8916 0.101562 -114.78 14.6172 -156 32.3994v128.5c47.9004 -26 108.9 -45.5 156.1 -45.5c31.8008 0 54.7002 8.5 54.7002 34.9004c0 68.0996 -216.8 42.5 -216.8 200.399
|
2263 |
+
c0 101 77.0996 161.4 192.8 161.4c47.2998 0 94.5 -7.2002 141.8 -26.0996v-134.301c-43.3994 23.4004 -98.5 36.7002 -141.899 36.7002c-29.7998 0 -48.4004 -8.59961 -48.4004 -30.8994z" />
|
2264 |
+
<glyph glyph-name="typo3" unicode=""
|
2265 |
+
d="M178.7 369.6c0 -66.3994 83.3994 -264.899 140.6 -264.899c6.90039 0 11.5 0 18.5 2.2998c-49.3994 -79.5 -110.399 -139 -146.7 -139c-77.2998 0 -184.1 234 -184.1 337.5c0 16.2998 3.90039 29.4004 9.2998 37.0996c27 32.4004 106.8 57.9004 176.3 66.4004
|
2266 |
+
c-8.5 -7 -13.8994 -14.7002 -13.8994 -39.4004zM301.5 416c71.7998 0 138.8 -11.5996 138.8 -52.5c0 -82.5996 -52.5 -182.3 -78.7998 -182.3c-47.9004 0 -101.7 132.1 -101.7 198.5c0 30.8994 11.6006 36.2998 41.7002 36.2998z" />
|
2267 |
+
<glyph glyph-name="amazon-pay" unicode="" horiz-adv-x="640"
|
2268 |
+
d="M14 122.7c2.2998 4.2002 5.2002 4.89941 9.7002 2.5c10.3994 -5.60059 20.5996 -11.4004 31.2002 -16.7002c33.6992 -16.8047 90.7744 -37.5469 127.399 -46.2998c17.2734 -4.16797 45.5869 -9.4541 63.2002 -11.7998c22.083 -2.96875 58.0898 -5.37793 80.3721 -5.37793
|
2269 |
+
c4.03809 0 10.5908 0.0800781 14.6279 0.177734c17.4004 0.399414 34.7998 1.7998 52.0996 3.7998c46.7393 5.44824 119.897 24.623 163.301 42.7998c2.89941 1.2002 5.89941 2 9.09961 1.2002c6.7002 -1.7998 9 -9 4.09961 -13.9004
|
2270 |
+
c-2.47168 -2.27246 -6.77246 -5.58789 -9.59961 -7.39941c-30.7002 -21.1006 -64.2002 -36.4004 -99.5996 -47.9004c-20.3311 -6.55176 -53.9756 -14.4365 -75.1006 -17.5996c-14.6006 -2.23633 -38.4346 -4.38672 -53.2002 -4.7998
|
2271 |
+
c-0.694336 -0.0419922 -1.81445 -0.176758 -2.5 -0.300781h-21.0996c-0.685547 0.124023 -1.80469 0.258789 -2.5 0.300781c-3.59961 0.199219 -7.2002 0.299805 -10.7002 0.399414c-13.9971 0.634766 -36.5762 3.00879 -50.3994 5.2998
|
2272 |
+
c-22.7275 3.7041 -58.7471 13.0674 -80.4004 20.9004c-44.8652 16.1797 -110.094 55.1562 -145.6 87c-1.80078 1.59961 -3 3.7998 -4.40039 5.7002v2zM172 382.9c2.7998 0 5.5 0 8.2998 -0.100586c3.2998 -0.5 6.60059 -0.799805 9.7998 -1.5
|
2273 |
+
c21.3008 -4.39941 35.4004 -17.2998 43.9004 -36.8994c6.90039 -15.9004 8.59961 -32.7002 8.09961 -49.8008c-0.399414 -15.3994 -3.2998 -30.1992 -10.2998 -44.0996c-9.2002 -18.4004 -23.3994 -30.9004 -43.7998 -34.9004c-22.5 -4.39941 -43.0996 0.5 -61 15.4004
|
2274 |
+
c-0.5 0.5 -1.09961 1 -2.2002 1.90039v-72.4004c0 -1 0 -2 -0.0996094 -3c-0.299805 -3 -2.10059 -5 -5 -5c-7 -0.0996094 -14.1006 -0.0996094 -21.1006 0c-2.89941 0.0996094 -4.69922 2 -4.89941 5c-0.100586 1 -0.100586 2 -0.100586 3v209.3
|
2275 |
+
c0 6.90039 1.30078 8.2002 8.2002 8.2002h11.5c4.60059 0 6.90039 -2 7.60059 -6.59961c0.5 -2.7002 0.899414 -5.5 1.2998 -8.2002c0.0439453 -0.405273 0.222656 -1.0332 0.399414 -1.40039c2.5 1.90039 4.7002 3.7002 7.10059 5.40039
|
2276 |
+
c9.39941 6.90625 26.4238 13.6709 38 15.0996zM124.6 341c0.100586 -14.0996 0 -28 0 -42.0996c0 -14.1006 0.100586 -28.1006 0 -42.2002c-0.00488281 -0.0703125 -0.00878906 -0.183594 -0.00878906 -0.253906c0 -1.10547 0.765625 -2.46973 1.70898 -3.0459
|
2277 |
+
c11.2002 -7.90039 23.4004 -13.3008 37.4004 -13.9004c20.2002 -0.900391 35.7998 7.2002 42.5996 28.5c3.2002 10 4 20.2002 4 30.5996c0 11.2002 -1 22.3008 -4.89941 33c-6.40039 17.5 -18.6006 24.8008 -33.5 25.9004
|
2278 |
+
c-16.8008 1.2998 -31.9004 -3.7002 -45.6006 -13.2002c-0.945312 -0.556641 -1.71289 -1.90039 -1.71289 -2.99805c0 -0.0830078 0.00585938 -0.21875 0.0126953 -0.301758zM330.3 382.9c4 0 8 0 11.9004 0.0996094c3.59961 -0.5 7.2002 -0.799805 10.7998 -1.2998
|
2279 |
+
c7.7002 -1.10059 15.0996 -3.10059 21.7998 -7.10059c11.6006 -6.89941 17.1006 -17.5 19 -30.3994c0.5 -3.29297 0.905273 -8.66895 0.905273 -12c0 -0.248047 -0.00195312 -0.651367 -0.00488281 -0.900391v-106
|
2280 |
+
c0.00195312 -0.128906 0.00390625 -0.336914 0.00390625 -0.46582c0 -0.645508 -0.046875 -1.69141 -0.104492 -2.33398c-0.0742188 -2.57422 -2.22461 -4.67969 -4.7998 -4.7002c-5.39941 -0.0996094 -10.8994 -0.0996094 -16.2998 0
|
2281 |
+
c-2.90039 0.100586 -4.7998 2.10059 -5.40039 5.2002c-0.699219 3.59961 -1.19922 7.2002 -1.7998 11c-0.481445 -0.245117 -1.19824 -0.737305 -1.59961 -1.09961c-11.7998 -9.7002 -25.2002 -16.1006 -40.2998 -18.4004c-13.1006 -2 -26 -1.2002 -37.9004 5.40039
|
2282 |
+
c-12.4004 6.89941 -19.4004 17.6992 -21.4004 31.6992c-1.5 10.5 -0.799805 20.9004 3.90039 30.7002c6.09961 12.6006 16.5 20.4004 29.4004 24.9004c10.7998 3.7998 22 4.5 33.2998 3.89941c8.95312 -0.556641 23.2891 -2.75195 32 -4.89941
|
2283 |
+
c0.399414 -0.100586 0.799805 0 1.2998 -0.100586c0.0898438 0.381836 0.179688 1.00879 0.200195 1.40039c-0.100586 8.2998 0 16.5996 -0.299805 24.9004c-0.200195 5.89941 -1.60059 11.5996 -5.30078 16.3994c-4.19922 5.5 -10.2998 7.40039 -16.7998 8.40039
|
2284 |
+
c-12.5 1.89941 -24.8994 0.899414 -37.2002 -1.40039c-7.89941 -1.5 -15.6992 -3.7002 -23.5 -5.7002c-4.69922 -1.19922 -6.69922 0.100586 -6.7998 4.90039c-0.0996094 3.2998 0.100586 6.59961 0 9.90039c-0.0996094 3.89941 1.7002 6.5 5.2998 7.69922
|
2285 |
+
c5.90039 2 11.8008 4.2002 17.9004 5.80078c7.86426 1.92188 20.8115 3.75879 28.9004 4.09961c0.899414 0.0996094 1.89941 0.299805 2.89941 0.400391zM365.3 255.2c-0.0996094 4.7002 0.100586 9.2998 0.100586 14.0996s-0.100586 9.5 0 14.2998
|
2286 |
+
c0 1.60059 -0.5 2.40039 -2.10059 2.60059c-8.39941 1.09961 -16.5996 2.7002 -25 3.39941c-1.95117 0.227539 -5.12891 0.412109 -7.09375 0.412109c-4.99316 0 -12.9258 -1.16992 -17.7061 -2.61133c-8 -2.60059 -13.9004 -7.30078 -16.4004 -15.6006
|
2287 |
+
c-0.779297 -2.57422 -1.41211 -6.84766 -1.41211 -9.53809c0 -2.78613 0.677734 -7.2041 1.5127 -9.86133c1.55762 -5.40918 7.11328 -11.3672 12.3994 -13.3008c5.40039 -2.19922 11.1006 -2.39941 16.8008 -1.7998c13.8994 1.40039 26.1992 6.7998 37.3994 14.9004
|
2288 |
+
c0.832031 0.543945 1.50684 1.79199 1.50684 2.78613c0 0.0595703 -0.00292969 0.155273 -0.00683594 0.213867zM625.2 125.8v-17.2998c-0.700195 -3.59961 -1.2998 -7.2998 -2.10059 -10.9004c-4.39941 -20.2998 -11.8994 -39.1992 -24.6992 -55.5996
|
2289 |
+
c-3.27148 -3.9209 -8.96094 -9.92383 -12.7002 -13.4004c-1.1416 -1.04102 -3.29199 -2.16113 -4.7998 -2.5c-2.90039 -0.699219 -4.60059 1.2002 -4.10059 4.10059c0.201172 0.852539 0.649414 2.19629 1 3c5.7998 14.7998 11.7002 29.7002 15.7998 45.0996
|
2290 |
+
c2.10059 7.60059 3.90039 15.2998 3.5 23.2998c-0.199219 5.2002 -2.5 9 -7.59961 10.4004c-3.89746 1.15332 -10.3486 2.36328 -14.4004 2.7002c-11.3994 0.899414 -22.8994 0.200195 -34.2998 -0.900391c-7.7998 -0.799805 -15.5 -1.7002 -23.2998 -2.5
|
2291 |
+
c-0.504883 -0.0576172 -1.32617 -0.103516 -1.83398 -0.103516c-0.100586 0 -0.264648 0.000976562 -0.366211 0.00390625c-1.5 -0.100586 -3.2002 0.299805 -3.59961 1.7998c-0.111328 0.383789 -0.201172 1.01855 -0.201172 1.41797
|
2292 |
+
c0 0.764648 0.314453 1.92188 0.701172 2.58203c0.838867 1.1582 2.49609 2.72656 3.7002 3.5c12.0996 8.2998 25.6992 12.9004 40 15.5996c7.29883 1.34375 19.2461 2.43457 26.668 2.43457c3.46484 0 9.0791 -0.239258 12.5312 -0.53418
|
2293 |
+
c5.92773 -0.371094 15.335 -2.11816 21 -3.90039c4.30078 -1.39941 8.10059 -3.2998 9.10059 -8.2998zM493.1 249c0.300781 -0.700195 0.501953 -1.2998 0.902344 -2.40039c2.59961 7.7002 5.2002 15 7.7002 22.2002l34.7998 100
|
2294 |
+
c0.5 1.40039 1.09961 2.7002 1.59961 4.10059c0.932617 2.87988 4.14648 5.21777 7.17383 5.21777c0.145508 0 0.381836 -0.0078125 0.526367 -0.0185547c6.60059 0 13.2998 0.100586 19.9004 0c2.7998 0 4.09961 -1.59961 3.7002 -4.39941
|
2295 |
+
c-0.277344 -1.56641 -0.994141 -4.03027 -1.60059 -5.5c-23.3662 -59.9336 -46.8994 -119.801 -70.5996 -179.601c-2.1416 -5.27734 -6.2627 -13.5205 -9.2002 -18.3994c-8.7998 -14.9004 -22.4004 -21.7998 -39.5 -21.4004c-4.70801 0.18457 -12.2793 1.08008 -16.9004 2
|
2296 |
+
c-5.39941 0.900391 -7.2998 3.40039 -7.39941 8.90039c-0.100586 3.2666 -0.100586 6.56641 0 9.89941c0.0996094 3.5 1.7998 5 5.2002 4.80078c2.5 -0.200195 5 -0.800781 7.5 -1c1.30664 -0.148438 3.43359 -0.268555 4.74902 -0.268555
|
2297 |
+
c2.98828 0 7.75977 0.612305 10.6504 1.36816c7.2002 1.90039 12.2002 6.7998 15.2002 13.2998c3.40039 7.2998 6 15 9.2998 22.2998c1.90039 4.2002 1.5 7.7002 -0.200195 11.8008c-19.7998 48.5 -39.5 97 -59.1006 145.5
|
2298 |
+
c-0.649414 1.64453 -1.50098 4.37695 -1.90039 6.09961c-0.5 2.5 0.700195 4.5 3.2002 4.5c7.7002 0.0996094 15.2998 0 22.9004 -0.0996094c3.2002 0 5.2998 -1.90039 6.39941 -4.80078c2.10059 -5.59961 4.30078 -11.1992 6.30078 -16.8994
|
2299 |
+
c12.8994 -35.7666 25.7988 -71.5 38.6982 -107.2z" />
|
2300 |
+
<glyph glyph-name="cc-amazon-pay" unicode="" horiz-adv-x="576"
|
2301 |
+
d="M124.7 246.2c0.0996094 11.7998 0 23.5 0 35.2998v35.2998c0 1.2998 0.399414 2 1.39941 2.7002c11.5 8 24.1006 12.0996 38.2002 11.0996c12.5 -0.899414 22.7002 -7 28.1006 -21.6992c3.2998 -8.90039 4.09961 -18.2002 4.09961 -27.7002
|
2302 |
+
c0 -8.7002 -0.700195 -17.2998 -3.40039 -25.6006c-5.69922 -17.7998 -18.6992 -24.6992 -35.6992 -23.8994c-11.7002 0.5 -21.9004 5 -31.4004 11.7002c-0.900391 0.799805 -1.40039 1.59961 -1.2998 2.7998zM279.6 231.6c-5.19922 2 -8.7998 5.7002 -10.3994 11.2002
|
2303 |
+
c-1.7002 5.40039 -1.7002 10.7998 -0.100586 16.2002c2 6.90039 7 10.9004 13.7002 13.0996c6.7998 2.2002 13.7998 2.5 20.7998 1.90039c7 -0.700195 13.9004 -2 20.9004 -2.90039c1.40039 -0.199219 1.7998 -0.799805 1.7998 -2.19922c-0.0996094 -4 0 -8 0 -12
|
2304 |
+
c0 -3.90039 -0.0996094 -7.90039 0 -11.8008c0 -1.19922 -0.399414 -1.89941 -1.2998 -2.5c-9.40039 -6.7998 -19.7002 -11.2998 -31.2998 -12.5c-4.7998 -0.5 -9.5 -0.299805 -14.1006 1.5zM576 368v-352c0 -26.5 -21.5 -48 -48 -48h-480c-26.5 0 -48 21.5 -48 48v352
|
2305 |
+
c0 26.5 21.5 48 48 48h480c26.5 0 48 -21.5 48 -48zM368.5 344.1c0.400391 -1.69922 0.900391 -3.39941 1.59961 -5.09961c16.5 -40.5996 32.9004 -81.2998 49.5 -121.9c1.40039 -3.5 1.7002 -6.39941 0.200195 -9.89941
|
2306 |
+
c-2.7998 -6.2002 -4.89941 -12.6006 -7.7998 -18.7002c-2.59961 -5.5 -6.7002 -9.5 -12.7002 -11.2002c-4.2002 -1.09961 -8.5 -1.2998 -12.8994 -0.899414c-2.10059 0.199219 -4.2002 0.699219 -6.30078 0.799805c-2.7998 0.200195 -4.19922 -1.10059 -4.2998 -4
|
2307 |
+
c-0.0996094 -2.7998 -0.0996094 -5.60059 0 -8.2998c0.100586 -4.60059 1.60059 -6.7002 6.2002 -7.5c4.7002 -0.800781 9.40039 -1.60059 14.2002 -1.7002c14.2998 -0.299805 25.7002 5.39941 33.0996 17.8994c2.90039 4.90039 5.60059 10.1006 7.7002 15.4004
|
2308 |
+
c19.7998 50.0996 39.5 100.3 59.2002 150.5c0.599609 1.5 1.09961 3 1.2998 4.59961c0.400391 2.40039 -0.700195 3.60059 -3.09961 3.7002c-5.60059 0.100586 -11.1006 0 -16.7002 0c-3.10059 0 -5.2998 -1.39941 -6.40039 -4.2998
|
2309 |
+
c-0.399414 -1.09961 -0.899414 -2.2998 -1.2998 -3.40039l-29.0996 -83.6992c-2.10059 -6.10059 -4.2002 -12.1006 -6.5 -18.6006c-0.400391 0.900391 -0.600586 1.40039 -0.800781 1.90039c-10.7998 29.8994 -21.5996 59.8994 -32.3994 89.7998
|
2310 |
+
c-1.7002 4.7002 -3.5 9.5 -5.2998 14.2002c-0.900391 2.5 -2.7002 4 -5.40039 4c-6.40039 0.0996094 -12.7998 0.200195 -19.2002 0.0996094c-2.2002 0 -3.2998 -1.59961 -2.7998 -3.7002zM242.4 242c1.69922 -11.7002 7.59961 -20.7998 18 -26.5996
|
2311 |
+
c9.89941 -5.5 20.6992 -6.2002 31.6992 -4.60059c12.7002 1.90039 23.9004 7.2998 33.8008 15.5c0.399414 0.299805 0.799805 0.600586 1.39941 1c0.5 -3.2002 0.900391 -6.2002 1.5 -9.2002c0.5 -2.59961 2.10059 -4.2998 4.5 -4.39941
|
2312 |
+
c4.60059 -0.100586 9.10059 -0.100586 13.7002 0c2.2998 0.0996094 3.7998 1.59961 4 3.89941c0.0996094 0.800781 0.0996094 1.60059 0.0996094 2.30078v88.7998c0 3.59961 -0.199219 7.2002 -0.699219 10.7998c-1.60059 10.7998 -6.2002 19.7002 -15.9004 25.4004
|
2313 |
+
c-5.59961 3.2998 -11.7998 5 -18.2002 5.89941c-3 0.400391 -6 0.700195 -9.09961 1.10059h-10c-0.799805 -0.100586 -1.60059 -0.300781 -2.5 -0.300781c-8.2002 -0.399414 -16.2998 -1.39941 -24.2002 -3.5c-5.09961 -1.2998 -10 -3.19922 -15 -4.89941
|
2314 |
+
c-3 -1 -4.5 -3.2002 -4.40039 -6.5c0.100586 -2.7998 -0.0996094 -5.60059 0 -8.2998c0.100586 -4.10059 1.80078 -5.2002 5.7002 -4.10059c6.5 1.7002 13.1006 3.5 19.7002 4.7998c10.2998 1.90039 20.7002 2.7002 31.0996 1.2002
|
2315 |
+
c5.40039 -0.799805 10.5 -2.39941 14.1006 -7c3.09961 -4 4.2002 -8.7998 4.39941 -13.7002c0.300781 -6.89941 0.200195 -13.8994 0.300781 -20.7998c0 -0.399414 -0.100586 -0.700195 -0.200195 -1.2002c-0.400391 0 -0.799805 0 -1.10059 0.100586
|
2316 |
+
c-8.7998 2.09961 -17.6992 3.59961 -26.7998 4.09961c-9.5 0.5 -18.8994 -0.0996094 -27.8994 -3.2002c-10.8008 -3.7998 -19.5 -10.2998 -24.6006 -20.7998c-4.09961 -8.2998 -4.59961 -17 -3.39941 -25.7998zM98.7002 341.1v-175.3c0 -0.799805 0 -1.7002 0.0996094 -2.5
|
2317 |
+
c0.200195 -2.5 1.7002 -4.09961 4.10059 -4.2002c5.89941 -0.0996094 11.7998 -0.0996094 17.6992 0c2.5 0 4 1.7002 4.10059 4.10059c0.0996094 0.799805 0.0996094 1.7002 0.0996094 2.5v60.7002c0.900391 -0.700195 1.40039 -1.2002 1.90039 -1.60059
|
2318 |
+
c15 -12.5 32.2002 -16.5996 51.0996 -12.8994c17.1006 3.39941 28.9004 13.8994 36.7002 29.1992c5.7998 11.6006 8.2998 24.1006 8.7002 37c0.5 14.3008 -1 28.4004 -6.7998 41.7002c-7.10059 16.4004 -18.9004 27.2998 -36.7002 30.9004
|
2319 |
+
c-2.7002 0.599609 -5.5 0.799805 -8.2002 1.2002h-7c-1.2002 -0.200195 -2.40039 -0.300781 -3.59961 -0.5c-11.7002 -1.40039 -22.3008 -5.80078 -31.8008 -12.7002c-2 -1.40039 -3.89941 -3 -5.89941 -4.5c-0.100586 0.5 -0.299805 0.799805 -0.400391 1.2002
|
2320 |
+
c-0.399414 2.2998 -0.700195 4.59961 -1.09961 6.89941c-0.600586 3.90039 -2.5 5.5 -6.40039 5.60059h-9.7002c-5.89941 0.0996094 -6.89941 -1 -6.89941 -6.80078zM493.6 109c-2.69922 0.700195 -5.09961 0 -7.59961 -1c-43.9004 -18.4004 -89.5 -30.2002 -136.8 -35.7998
|
2321 |
+
c-14.5 -1.7002 -29.1006 -2.7998 -43.7002 -3.2002c-26.5996 -0.700195 -53.2002 0.799805 -79.5996 4.2998c-17.8008 2.40039 -35.5 5.7002 -53 9.90039c-37 8.89941 -72.7002 21.7002 -106.7 38.7998c-8.7998 4.40039 -17.4004 9.2998 -26.1006 14
|
2322 |
+
c-3.7998 2.09961 -6.19922 1.5 -8.19922 -2.09961v-1.7002c1.19922 -1.60059 2.19922 -3.40039 3.69922 -4.7998c36 -32.2002 76.6006 -56.5 122 -72.9004c21.9004 -7.90039 44.4004 -13.7002 67.3008 -17.5c14 -2.2998 28 -3.7998 42.1992 -4.5
|
2323 |
+
c3 -0.0996094 6 -0.200195 9 -0.400391c0.700195 0 1.40039 -0.199219 2.10059 -0.299805h17.7002c0.699219 0.100586 1.39941 0.299805 2.09961 0.299805c14.9004 0.400391 29.7998 1.80078 44.5996 4c21.4004 3.2002 42.4004 8.10059 62.9004 14.7002
|
2324 |
+
c29.5996 9.60059 57.7002 22.4004 83.4004 40.1006c2.7998 1.89941 5.69922 3.7998 8 6.19922c4.2998 4.40039 2.2998 10.4004 -3.30078 11.9004zM544 136.7c-0.799805 4.2002 -4 5.7998 -7.59961 7c-5.7002 1.89941 -11.6006 2.7998 -17.6006 3.2998
|
2325 |
+
c-11 0.900391 -22 0.400391 -32.7998 -1.59961c-12 -2.2002 -23.4004 -6.10059 -33.5 -13.1006c-1.2002 -0.799805 -2.40039 -1.7998 -3.09961 -3c-0.600586 -0.899414 -0.700195 -2.2998 -0.5 -3.39941c0.299805 -1.30078 1.69922 -1.60059 3 -1.5
|
2326 |
+
c0.599609 0 1.19922 0 1.7998 0.0996094l19.5 2.09961c9.59961 0.900391 19.2002 1.5 28.7998 0.800781c4.09961 -0.300781 8.09961 -1.2002 12 -2.2002c4.2998 -1.10059 6.2002 -4.40039 6.40039 -8.7002c0.299805 -6.7002 -1.2002 -13.0996 -2.90039 -19.5
|
2327 |
+
c-3.5 -12.9004 -8.2998 -25.4004 -13.2998 -37.7998c-0.299805 -0.799805 -0.700195 -1.7002 -0.799805 -2.5c-0.400391 -2.5 1 -4 3.39941 -3.5c1.40039 0.299805 3 1.09961 4 2.09961c3.7002 3.60059 7.5 7.2002 10.6006 11.2002
|
2328 |
+
c10.6992 13.7998 17 29.5996 20.6992 46.5996c0.700195 3 1.2002 6.10059 1.7002 9.10059c0.200195 4.7002 0.200195 9.59961 0.200195 14.5z" />
|
2329 |
+
<glyph glyph-name="ethereum" unicode="" horiz-adv-x="320"
|
2330 |
+
d="M311.9 187.2l-151.9 -92.7998l-152 92.7998l152 260.8zM160 64.5996l152 92.8008l-152 -221.4l-152 221.4z" />
|
2331 |
+
<glyph glyph-name="korvue" unicode="" horiz-adv-x="446"
|
2332 |
+
d="M386.5 414c32.7002 0 59.5 -26.7998 59.5996 -59.5v-327c0 -32.7002 -26.5 -59.5 -59.5 -59.5h-327.1c-32.7002 0 -59.5 26.7998 -59.5 59.4004v327.1c0 32.7002 26.7998 59.5 59.5 59.5h327zM87.0996 327.2v-132h187.5l81.2002 132h-110.899l-61.8008 -116v116h-96z
|
2333 |
+
M248.9 55.0996h118.399l-88.5996 130.801h-191.5v-130.801h96v113.601z" />
|
2334 |
+
<glyph glyph-name="elementor" unicode=""
|
2335 |
+
d="M425.6 416c12.4004 0 22.4004 -10 22.4004 -22.4004v-403.199c0 -12.4004 -10 -22.4004 -22.4004 -22.4004h-403.199c-12.4004 0 -22.4004 10 -22.4004 22.4004v403.199c0 12.4004 10 22.4004 22.4004 22.4004h403.199zM164.3 92.5v199h-39.7998v-199h39.7998z
|
2336 |
+
M323.6 92.5v39.7998h-119.5v-39.7998h119.5zM323.6 172.1v39.8008h-119.5v-39.8008h119.5zM323.6 251.8v39.7998h-119.5v-39.7998h119.5z" />
|
2337 |
+
<glyph glyph-name="youtube-square" unicode=""
|
2338 |
+
d="M186.8 245.9l95.2002 -54.1006l-95.2002 -54.0996v108.2zM448 368v-352c0 -26.5 -21.5 -48 -48 -48h-352c-26.5 0 -48 21.5 -48 48v352c0 26.5 21.5 48 48 48h352c26.5 0 48 -21.5 48 -48zM406 191.7c0 0 0 59.5996 -7.59961 88.2002
|
2339 |
+
c-4.2002 15.7998 -16.5 28.1992 -32.2002 32.3994c-28.2998 7.7002 -142.2 7.7002 -142.2 7.7002s-113.9 0 -142.2 -7.7002c-15.7002 -4.2002 -28 -16.5996 -32.2002 -32.3994c-7.59961 -28.5 -7.59961 -88.2002 -7.59961 -88.2002s0 -59.6006 7.59961 -88.2002
|
2340 |
+
c4.2002 -15.7998 16.5 -27.7002 32.2002 -31.9004c28.2998 -7.59961 142.2 -7.59961 142.2 -7.59961s113.9 0 142.2 7.7002c15.7002 4.2002 28 16.0996 32.2002 31.8994c7.59961 28.5 7.59961 88.1006 7.59961 88.1006z" />
|
2341 |
+
<glyph glyph-name="flipboard" unicode=""
|
2342 |
+
d="M0 416h448v-448h-448v448zM358.4 236.8v89.6006h-268.801v-268.801h89.6006v89.6006h89.5996v89.5996h89.6006z" />
|
2343 |
+
<glyph glyph-name="hips" unicode="" horiz-adv-x="640"
|
2344 |
+
d="M251.6 290.4v-201.801c0 -1.89941 -0.899414 -2.7998 -2.7998 -2.7998h-40.8994c-1.60059 0 -2.7002 1.40039 -2.7002 2.7998v201.801c0 1.39941 1.09961 2.7998 2.7002 2.7998h40.8994c1.90039 0 2.7998 -0.900391 2.7998 -2.7998zM156.5 280
|
2345 |
+
c18.7002 -13.5 28 -31.9004 28 -55.2998v-136.101c0 -1.89941 -0.900391 -2.7998 -2.7002 -2.7998h-27.2998c-9.09961 0 -16.4004 7.2998 -16.4004 16.2998v122.601c0 0.899414 2.7002 27 -45.7998 27c-48.5996 0 -45.7998 -26.2002 -45.7998 -27v-136.101
|
2346 |
+
c0 -1.89941 -0.900391 -2.7998 -2.7998 -2.7998h-41c-1.7998 0 -2.7002 0.900391 -2.7002 2.7998v279.2c0 1.7998 0.900391 2.7002 2.7002 2.7002h40.8994c1.90039 0 2.80078 -0.900391 2.80078 -2.7002v-81.2002c15.1992 7.7002 31.6992 11.5 49.7998 11.4004
|
2347 |
+
c24 -0.0996094 44.2002 -6.2002 60.2998 -18zM634.9 169.9c5.5 -12.6006 6.59961 -25.6006 3.09961 -39.1006c-9.59961 -36.8994 -44.9004 -45.5 -45.5996 -45.7998c-10.5 -3.09961 -23.6006 -4.2998 -36.3008 -4.2998c-16.5996 0 -32.5996 2.7002 -48.1992 8.2002
|
2348 |
+
c-9.7002 3.39941 -14.6006 10.2998 -14.6006 20.6992v34.4004c0 2.09961 2.2998 3.7002 4.40039 2.2998c13.7002 -10.2002 34.0996 -19.0996 58.3994 -19.0996c23.3008 0 32.8008 4.5 36.5 13.5996c3 7.90039 -0.599609 16.1006 -12.1992 21.2002l-53.6006 23.5
|
2349 |
+
c-21.3994 9.40039 -33.7998 24 -37.2002 43.5996c-5.69922 33.7002 22.2002 53.3008 22.7002 53.7002c13.2002 9.60059 32 15.4004 58.5 15.4004c19 0 37.4004 -3.2998 55.1006 -9.90039c1.2998 -0.5 1.89941 -1.2998 1.89941 -2.59961v-44.7002
|
2350 |
+
c0 -2.09961 -2.2998 -3.40039 -4 -2.40039c-39.7002 20.7002 -76.5996 12.3008 -84 6.80078c-6.59961 -4.90039 -6 -12.5 2.60059 -16.1006l57.5996 -25.2998c16.5 -7.09961 28.0996 -18.4004 34.9004 -34.0996zM376.2 298.2c60.3994 0 108.7 -48.2998 108.6 -108.601
|
2351 |
+
c0 -60.1992 -48.2002 -108.699 -108.7 -108.699c-21.8994 0 -41.1992 6.39941 -57.6992 19.0996v-88.7998c0 -1.7998 -0.900391 -2.7002 -2.80078 -2.7002h-40.8994c-2.10059 0 -2.7002 1.90039 -2.7002 2.7002v183.5c0 83.3994 72.5 103.5 104.2 103.5zM376.2 127.3
|
2352 |
+
c34.8994 0 62.2998 27.9004 62.2002 62.2002c0 34.5996 -27.7002 62.2002 -62.2002 62.2002c-34.6006 0 -62.2002 -27.7002 -62.2002 -62.2002c0 -17.2002 6 -31.7998 18.2002 -44c12.0996 -12.0996 26.7998 -18.2002 44 -18.2002zM228.3 375.5
|
2353 |
+
c15.9004 0 28.9004 -12.7002 28.9004 -28.9004c0 -15.7998 -12.7002 -28.8994 -28.9004 -28.8994s-28.8994 13.2998 -28.8994 28.8994c0.0996094 16 13 28.9004 28.8994 28.9004z" />
|
2354 |
+
<glyph glyph-name="php" unicode="" horiz-adv-x="640"
|
2355 |
+
d="M320 343.5c-171.3 0 -303.2 -72.2002 -303.2 -151.5s131.8 -151.5 303.2 -151.5c171.3 0 303.2 72.2002 303.2 151.5s-131.8 151.5 -303.2 151.5zM320 360.3c176.7 0 320 -75.2998 320 -168.3s-143.3 -168.3 -320 -168.3s-320 75.2998 -320 168.3s143.3 168.3 320 168.3z
|
2356 |
+
M218.2 205.5c7.39941 38.4004 -18.4004 34.2998 -56.4004 34.2998l-13.7002 -70.5996c34.3008 0 62.2002 -4.2002 70.1006 36.2998zM97.4004 97.7002l32.6992 168.7h70.7002c21.2002 0 36.7998 -5.5 46.5 -16.7002c18.6006 -21.4004 11.7998 -64.1006 -14.2998 -88.1006
|
2357 |
+
c-23.5996 -22.0996 -49.0996 -19.0996 -90.2002 -19.0996l-8.7002 -44.7998h-36.6992zM283.1 311.3h36.5l-8.69922 -44.7998c31.5 0 60.6992 2.2998 74.7998 -10.7002c14.7998 -13.5996 7.7002 -31 -8.2998 -113.1h-37c15.3994 79.3994 18.2998 86 12.6992 92
|
2358 |
+
c-5.39941 5.7998 -17.6992 4.59961 -47.3994 4.59961l-18.7998 -96.5996h-36.5zM505 205.5c7.40039 38.4004 -18.2002 34.2998 -56.4004 34.2998l-13.6992 -70.5996c33.3994 0 62.0996 -4.7998 70.0996 36.2998zM384.2 97.7002l32.7998 168.7h70.7002
|
2359 |
+
c21.2002 0 36.7998 -5.5 46.5 -16.7002c18.5996 -21.4004 11.7998 -64.1006 -14.2998 -88.1006c-23.1006 -21.5996 -47 -19.0996 -90.2002 -19.0996l-8.7002 -44.7998h-36.7998z" />
|
2360 |
+
<glyph glyph-name="quinscape" unicode="" horiz-adv-x="512"
|
2361 |
+
d="M313.6 -26.5996c4.40039 -4.40039 8.10059 -9 13.3008 -12.5c-18.5029 -5.58008 -49.2031 -10.1074 -68.5283 -10.1074c-0.516602 0 -1.35547 0.00292969 -1.87207 0.00683594c-135 0 -244.5 109.5 -244.5 244.601c0 135.1 109.4 244.6 244.5 244.6
|
2362 |
+
s244.6 -109.5 244.6 -244.6c0 -35.3008 -6.89941 -67.4004 -20.2998 -97.7002c-3 5.7002 -7.2002 10.2002 -11.2002 15.2998c11.2002 93.5 -62.0996 176.6 -157 176.6c-87.2705 0 -158.1 -70.8281 -158.1 -158.1s70.8291 -158.1 158.1 -158.1h1zM313.5 -26.5
|
2363 |
+
l0.400391 -0.0996094zM391.9 142.4c54.7471 0 99.1992 -44.4326 99.1992 -99.1807v-0.0195312c0 -54.7588 -44.4414 -99.2002 -99.1992 -99.2002c-54.7588 0 -99.2002 44.4414 -99.2002 99.2002c0 54.7578 44.4414 99.2002 99.2002 99.2002z" />
|
2364 |
+
<glyph glyph-name="readme" unicode="" horiz-adv-x="576"
|
2365 |
+
d="M528.3 401.5c26.4004 -0.200195 47.7002 -21.7002 47.7002 -48.0996v-245.7c0 -26.5 -21.5 -48 -48 -48h-89.7002c-102.1 0 -132.6 -24.4004 -147.3 -75c-0.799805 -2.7998 -5.2998 -2.7998 -6 0c-14.5996 50.5996 -45.0996 75 -147.3 75h-89.7002
|
2366 |
+
c-26.5 0 -48 21.5 -48 48v245.8c0 26.5 21.5 48 48 48h139.7c48.0996 0 89.7998 -33.2998 100.399 -80.2998c10.5 47 52.3008 80.2998 100.4 80.2998h139.8zM242 136.1h0.0996094v22.9004c0 2 -1.59961 3.5 -3.5 3.5h-160.399c-2 0 -3.5 -1.59961 -3.5 -3.5v-22.9004
|
2367 |
+
c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.60059 3.5 3.5zM242 197h0.0996094v22.9004c0 2 -1.59961 3.5 -3.5 3.5h-160.399c-2 0 -3.5 -1.60059 -3.5 -3.5v-22.9004c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.59961 3.5 3.5zM242 257.9h0.0996094v22.8994
|
2368 |
+
c0 2 -1.59961 3.5 -3.5 3.5h-160.399c-2 0 -3.5 -1.59961 -3.5 -3.5v-22.8994c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.59961 3.5 3.5zM501.3 136.2h0.100586v22.8994c0 2 -1.60059 3.5 -3.5 3.5h-160.4c-2 0 -3.5 -1.59961 -3.5 -3.5v-22.8994
|
2369 |
+
c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.59961 3.5 3.5zM501.3 197.1h0.100586v22.9004c0 2 -1.60059 3.5 -3.5 3.5h-160.4c-2 0 -3.5 -1.59961 -3.5 -3.5v-22.9004c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.60059 3.5 3.5zM501.3 258h0.100586v22.7998
|
2370 |
+
c0 2 -1.60059 3.5 -3.5 3.5h-160.4c-2 0 -3.5 -1.59961 -3.5 -3.5v-22.7998c0 -2 1.59961 -3.5 3.5 -3.5h160.3c2 0 3.5 1.59961 3.5 3.5z" />
|
2371 |
+
<glyph glyph-name="java" unicode="" horiz-adv-x="384"
|
2372 |
+
d="M277.74 135.1c-94.5 -24.8994 -277 -13.2998 -224.5 12.1006c44.5 21.3994 80.5996 19 80.5996 19s-93.0996 -22.1006 -33 -30.1006c25.4004 -3.39941 76 -2.59961 123.101 1.30078c38.5 3.19922 77.1992 10.1992 77.1992 10.1992s-13.5996 -5.7998 -23.3994 -12.5z
|
2373 |
+
M192.34 167.2c-48.5 43.7998 -84.0996 82.2998 -60.2002 118.2c35.1006 52.5 132.2 78.0996 110.7 162.6c0 0 53.1602 -53.2002 -50.5 -135c-83.0996 -65.5996 -19 -103.1 0 -145.8zM306.94 343.4c-111.601 -64.7002 -91 -83.5 -64.1006 -121.301
|
2374 |
+
c28.7998 -40.5 -33.8994 -72.8994 -33.8994 -72.8994s31.1992 25.5996 6.5 54c-83.7002 96.3994 91.5996 140.2 91.5 140.2zM300.84 72.9004c96.1006 49.8994 51.6006 97.8994 20.6006 91.3994c-3.10352 -0.581055 -8.03125 -1.92578 -11 -3
|
2375 |
+
c1.71973 2.44629 5.39258 5.26855 8.19922 6.2998c61.3008 21.6006 108.5 -63.5996 -19.7998 -97.2998c0.649414 0.642578 1.5459 1.80762 2 2.60059zM348 10.5996c53 -23.8994 -115.16 -72 -319.4 -38.7998c-74.8994 12.1006 36.1006 54.5 56.4004 40.2002
|
2376 |
+
c0 0 -6.5 0.400391 -17.7002 -2c-10.7998 -2.2998 -45.0996 -13.4004 -26.7998 -21.2998c50.7998 -22.1006 233.7 -16.7998 291.6 0.700195c30.4004 9.2998 15.9004 21.1992 15.9004 21.1992zM124.44 52c0 0 -19.6006 -11.4004 13.8994 -15.2002
|
2377 |
+
c40.6006 -4.59961 61.2998 -4 106 4.5c7.46094 -4.46777 20.0938 -10.6504 28.2002 -13.7998c-100.2 -42.9004 -226.8 2.5 -148.1 24.5zM304.24 -45.2002c69.7998 13.2002 76.2002 29.7002 76.2002 29.7002c-3.30078 -43.5996 -144.9 -52.7998 -237.101 -46.9004
|
2378 |
+
c-60.5996 3.90039 -72.3994 13.7002 -72.3994 13.6006c57.5 -9.5 154.6 -11.2002 233.3 3.59961zM260.64 95c5.08594 -4.74902 14.5391 -10.4834 21.1006 -12.7998c-121.3 -35.5 -256.3 -2.90039 -169.5 25.8994c0 0 -21.9004 -16.1992 11.5996 -19.6992
|
2379 |
+
c43.2998 -4.5 77.6006 -4.80078 136.8 6.59961z" />
|
2380 |
+
<glyph glyph-name="pied-piper-hat" unicode="" horiz-adv-x="640"
|
2381 |
+
d="M640 423.1c-80.7998 -53.5996 -89.4004 -92.5 -96.4004 -104.399c-6.69922 -12.2002 -11.6992 -60.2998 -23.2998 -83.6006c-11.7002 -23.5996 -54.2002 -42.1992 -66.0996 -50c-11.7002 -7.7998 -28.2998 -38.0996 -41.9004 -64.1992
|
2382 |
+
c-108.1 4.39941 -167.399 -38.8008 -259.2 -93.6006c29.4004 9.7002 43.3008 16.7002 43.3008 16.7002c94.1992 36 139.3 68.2998 281.1 49.2002c1.09961 0 1.90039 -0.600586 2.7998 -0.799805c3.90039 -2.2002 5.2998 -6.90039 3.10059 -10.8008l-53.9004 -95.7998
|
2383 |
+
c-2.5 -4.7002 -7.7998 -7.2002 -13.0996 -6.09961c-126.801 23.7998 -226.9 -17.2998 -318.9 -18.6006c-73.4004 -1.09961 -97.5 33.5 -97.5 35.1006c0 1.09961 0.599609 1.7002 1.7002 1.7002c0 0 38.2998 0 103.1 15.2998c73.6006 140.3 139.2 189.399 210.601 189.399
|
2384 |
+
c0 0 71.6992 0 90.5996 -61.8994c22.7998 39.7002 28.2998 49.2002 28.2998 49.2002c5.2998 9.39941 35 77.1992 86.4004 141.399c51.5 64 90.3994 79.9004 119.3 91.7998z" />
|
2385 |
+
<glyph glyph-name="creative-commons-by" unicode="" horiz-adv-x="496"
|
2386 |
+
d="M314.9 253.6v-101.399h-28.3008v-120.5h-77.0996v120.399h-28.2998v101.5c0 4.40039 1.59961 8.2002 4.59961 11.3008c3.10059 3.09961 6.90039 4.69922 11.2998 4.69922h101.9c4.09961 0 7.7998 -1.59961 11.0996 -4.69922
|
2387 |
+
c3.10059 -3.2002 4.80078 -6.90039 4.80078 -11.3008zM213.4 317.3c0 23.2998 11.5 35 34.5 35s34.5 -11.7002 34.5 -35c0 -23 -11.5 -34.5 -34.5 -34.5s-34.5 11.5 -34.5 34.5zM247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248
|
2388 |
+
c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3z" />
|
2389 |
+
<glyph glyph-name="creative-commons-nc" unicode="" horiz-adv-x="496"
|
2390 |
+
d="M247.6 440c139.801 0 248.4 -107.9 248.4 -248c0 -147.2 -118.5 -248 -248.4 -248c-134.5 0 -247.6 110.8 -247.6 248c0 132.9 104.7 248 247.6 248zM55.7998 258.9c-7.39941 -20.4004 -11.0996 -42.7002 -11.0996 -66.9004c0 -110.9 92.0996 -202.4 203.7 -202.4
|
2391 |
+
c122.399 0 177.199 101.801 178.5 104.101l-93.4004 41.5996c-7.7002 -37.0996 -41.2002 -53 -68.2002 -55.3994v-38.1006h-28.7998v38.2002c-27.5 0.299805 -52.5996 10.2002 -75.2998 29.7002l34.0996 34.5c31.7002 -29.4004 86.4004 -31.7998 86.4004 2.2002
|
2392 |
+
c0 6.19922 -2.2002 11.1992 -6.60059 15.0996c-14.1992 6 -1.7998 0.0996094 -219.3 97.4004zM248.4 395.7c-38.4004 0 -112.4 -8.7002 -170.5 -93l94.7998 -42.5c10 31.2998 40.3994 42.8994 63.7998 44.2998v38.0996h28.7998v-38.0996
|
2393 |
+
c22.7002 -1.2002 43.4004 -8.90039 62 -23l-32.2998 -33.2002c-42.7002 29.9004 -83.5 8 -70 -11.0996c53.4004 -24.1006 43.7998 -19.7998 93 -41.6006l127.1 -56.6992c4.10059 17.3994 6.2002 35.0996 6.2002 53.0996c0 57 -19.7998 105 -59.2998 143.9
|
2394 |
+
c-39.2998 39.8994 -87.2002 59.7998 -143.6 59.7998z" />
|
2395 |
+
<glyph glyph-name="creative-commons-nc-eu" unicode="" horiz-adv-x="496"
|
2396 |
+
d="M247.7 440c140.7 0 248.3 -109 248.3 -248c0 -147.1 -118.1 -248 -248.3 -248c-136 0 -247.7 111.7 -247.7 248c0 131.2 103.6 248 247.7 248zM248.3 -10.7002c122.601 0 177.3 102.2 178.8 104.3l-128.3 56.8008h-90.2998
|
2397 |
+
c9.2002 -39.3008 39.0996 -50.2002 67.2998 -50.2002c19.1006 0 38.6006 6.2002 47.2998 10.7998l10 -46.0996c-14.1992 -7.90039 -38.1992 -15.8008 -64.7998 -15.8008c-57.3994 0 -113.2 34.3008 -124.6 101.301h-27v29.5h22.7998
|
2398 |
+
c0 16.2998 0.400391 13.2998 0.400391 19.5h-23.3008v29.5h4.7002l-65.7002 29.0996c-7.19922 -20.7998 -10.8994 -42.7998 -10.8994 -66c0 -110.2 91.5996 -202.7 203.6 -202.7zM231.6 179.9l-0.5 0.399414l0.900391 -0.399414h-0.400391zM308.8 199.4l136.101 -60.5
|
2399 |
+
c4.19922 16.5996 6.2998 34.1992 6.2998 52.8994c0 113.2 -90 203.4 -203 203.4c-13 0 -106.101 3.2002 -170.7 -93.6006l81.5996 -36.0996c4.10059 7.2002 8.60059 14 13.9004 20.0996c23.7002 26.5 56.9004 42.3008 95.9004 42.3008
|
2400 |
+
c25.2998 0 47.2998 -5.80078 62.2998 -12.4004l-11.6006 -47.2998c-10.7998 4.59961 -27.7998 10 -46.0996 10c-20 0 -38.2002 -6.60059 -51.0996 -22.4004c-3.40039 -3.7998 -6.30078 -8.7998 -8.80078 -14.2998l28.6006 -12.5996h70.2998v-29.5h-3.7002z" />
|
2401 |
+
<glyph glyph-name="creative-commons-nc-jp" unicode="" horiz-adv-x="496"
|
2402 |
+
d="M247.7 440c140.8 0 248.3 -109.2 248.3 -248c0 -147.2 -118.1 -248 -248.3 -248c-135.9 0 -247.7 111.6 -247.7 248c0 131.2 103.6 248 247.7 248zM248.3 -10.7002c118.101 0 173.7 96.1006 175.2 98.2998l-81 36.1006v-35.7002h-64.2002v-56h-61.7002v56h-63.7998
|
2403 |
+
v38.7002h63.7998v18.7002l-5.69922 11.7998h-58.1006v38.5996h27.9004l-127 56.5c-6 -19.0996 -9 -39.2002 -9 -60.2998c0 -110.2 91.5996 -202.7 203.6 -202.7zM335.9 126.6l-54.7002 24.3008l-2.90039 -5.60059v-18.7002h57.6006zM342.4 178l101 -45.0996
|
2404 |
+
c5.19922 18.3994 7.89941 38 7.89941 59c0 113.399 -90.2002 203.399 -203 203.399c-91.0996 0 -145.899 -54 -173.7 -98.0996l81.9004 -36.5l-27.2998 51h65.7998l39.5996 -85.7002l23 -10.2002l43.4004 96h65.7998l-63 -116h38.6006v-17.7998z" />
|
2405 |
+
<glyph glyph-name="creative-commons-nd" unicode="" horiz-adv-x="496"
|
2406 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2407 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM342.4 251v-42.5h-180.301v42.5h180.301zM342.4 171.2v-42.5h-180.301v42.5h180.301z" />
|
2408 |
+
<glyph glyph-name="creative-commons-pd" unicode="" horiz-adv-x="496"
|
2409 |
+
d="M248 440c137 0 248 -111.1 248 -248c0 -137 -111 -248 -248 -248s-248 111 -248 248c0 136.9 111 248 248 248zM248 -9.5c76.0996 0 142.4 42.4004 176.7 104.8c-1.40039 0.299805 12.5 -5.7998 -217.9 96.7998c0.200195 -32 16.1006 -71.8994 53.9004 -71.8994
|
2410 |
+
c18.7002 0 30.7998 10.3994 36.2998 16.7002l36.0996 -43.9004c-25.8994 -22.7998 -56.5 -29.5 -79.3994 -29.5c-46.5 0 -120.4 27.9004 -120.4 126.9c0 11.3994 1.2002 22.3994 3.2998 32.8994l-78.7998 35.1006c-45.5996 -129.9 51 -267.9 190.2 -267.9zM442.2 140.5
|
2411 |
+
c0.200195 -0.200195 0.299805 -0.299805 0.599609 -0.400391c4.40039 16.6006 6.7998 34 6.7998 52c0 111.101 -90.3994 201.5 -201.5 201.5c-70.3994 0 -132.399 -36.2998 -168.5 -91.1992l74.9004 -33.4004c19.7998 31.0996 53.2998 51.5996 100.7 51.5996
|
2412 |
+
c20.0996 0 51 -4.19922 78.0996 -27.5l-40.3994 -41.5996c-19.8008 19.7002 -55.9004 23 -74.7002 -11z" />
|
2413 |
+
<glyph glyph-name="creative-commons-pd-alt" unicode="" horiz-adv-x="496"
|
2414 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 -10.7998c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3
|
2415 |
+
c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8zM316.7 262c21.3994 0 70 -5.2002 70 -68.5996c0 -63.5 -48.6006 -68.6006 -70 -68.6006h-53.2002v137.2h53.2002zM317.5 153.5c24 0 34.5 15.2998 34.5 39.9004
|
2416 |
+
c0 42 -31.2002 39.8994 -35 39.8994l-19.4004 -0.0996094v-79.7002h19.9004zM203.7 262c33.7002 0 50.5 -15.5 50.5 -46.5c0 -9 -3 -46.5 -57.1006 -46.5h-27v-44.2998h-34.5996v137.3h68.2002zM198.8 194.7c27.9004 0 30 41.5996 -0.899414 41.5996h-28.3008v-41.5996
|
2417 |
+
h29.2002z" />
|
2418 |
+
<glyph glyph-name="creative-commons-remix" unicode="" horiz-adv-x="496"
|
2419 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2420 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM410.1 187.6l4.90039 -2.19922v-70c-7.2002 -3.60059 -63.4004 -27.5 -67.2998 -28.8008c-6.5 1.80078 -113.7 46.8008 -137.3 56.2002l-64.2002 -26.5996l-63.2998 27.5v63.7998
|
2421 |
+
l59.2998 24.7998c-0.700195 0.700195 -0.400391 -5 -0.400391 70.4004l67.2998 29.7002l151.9 -62.9004v-61.5996zM339.7 106.1v43.8008h-0.400391v1.7998l-113.8 46.5v-45.2002l113.8 -46.9004v0.400391zM347.2 163.7l39.8994 16.3994l-36.7998 15.5l-39 -16.3994z
|
2422 |
+
M399.5 125.6v43l-44.2998 -18.5996v-43.4004z" />
|
2423 |
+
<glyph glyph-name="creative-commons-sa" unicode="" horiz-adv-x="496"
|
2424 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2425 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM137.7 227c13 83.9004 80.5 95.7002 108.899 95.7002c99.8008 0 127.5 -82.5 127.5 -134.2c0 -63.5996 -41 -132.9 -128.899 -132.9c-38.9004 0 -99.1006 20 -109.4 97h62.5
|
2426 |
+
c1.5 -30.0996 19.6006 -45.1992 54.5 -45.1992c23.2998 0 58 18.1992 58 82.7998c0 82.5 -49.0996 80.5996 -56.7002 80.5996c-33.0996 0 -51.6992 -14.5996 -55.7998 -43.7998h18.2002l-49.2002 -49.2002l-49 49.2002h19.4004z" />
|
2427 |
+
<glyph glyph-name="creative-commons-sampling" unicode="" horiz-adv-x="496"
|
2428 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2429 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM252 342.1c2.7998 0.300781 11.5 -1 11.5 -11.5l6.59961 -107.199l4.90039 59.2998c0 6 4.7002 10.5996 10.5996 10.5996c5.90039 0 10.6006 -4.7002 10.6006 -10.5996
|
2430 |
+
c0 -2.5 -0.5 5.7002 5.7002 -81.5l5.7998 64.2002c0.299805 2.89941 2.89941 9.2998 10.2002 9.2998c3.7998 0 9.89941 -2.2998 10.5996 -8.90039l11.5 -96.5l5.2998 12.7998c1.7998 4.40039 5.2002 6.60059 10.2002 6.60059h58v-21.2998h-50.9004l-18.1992 -44.3008
|
2431 |
+
c-3.90039 -9.89941 -19.5 -9.09961 -20.8008 3.10059l-4 31.8994l-7.5 -92.5996c-0.299805 -3 -3 -9.2998 -10.1992 -9.2998c-3 0 -9.80078 2.09961 -10.6006 9.2998c0 1.90039 0.600586 -5.7998 -6.2002 77.9004l-5.2998 -72.2002
|
2432 |
+
c-1.09961 -4.7998 -4.7998 -9.2998 -10.5996 -9.2998c-2.90039 0 -9.7998 2 -10.6006 9.2998c0 1.89941 0.5 -6.7002 -5.7998 87.7002l-5.7998 -94.8008c0 -6.2998 -3.59961 -12.3994 -10.5996 -12.3994c-5.2002 0 -10.6006 4.09961 -10.6006 12l-5.7998 87.7002
|
2433 |
+
c-5.7998 -92.5 -5.2998 -84 -5.2998 -85.9004c-1.10059 -4.7998 -4.7998 -9.2998 -10.6006 -9.2998c-3 0 -9.7998 2.09961 -10.5996 9.2998c0 0.700195 -0.400391 1.09961 -0.400391 2.59961l-6.19922 88.6006l-4.90039 -56.7002
|
2434 |
+
c-0.700195 -6.5 -6.7002 -9.2998 -10.5996 -9.2998c-5.80078 0 -9.60059 4.09961 -10.6006 8.89941l-11.0996 76.4004c-2 -4 -3.5 -8.40039 -11.1006 -8.40039h-51.3994v21.3008h44.7998l13.7002 27.8994c4.39941 9.90039 18.2002 7.2002 19.8994 -2.7002l3.10059 -20.3994
|
2435 |
+
l8.39941 97.8994c0 6 4.80078 10.6006 10.6006 10.6006c0.5 0 10.5996 0.200195 10.5996 -12.4004l4.90039 -69.0996l6.59961 92.5996c0 10.1006 9.5 10.6006 10.2002 10.6006c0.599609 0 10.5996 -0.700195 10.5996 -10.6006l5.30078 -80.5996l6.19922 97.8994
|
2436 |
+
c0.100586 1.10059 -0.599609 10.3008 9.90039 11.5z" />
|
2437 |
+
<glyph glyph-name="creative-commons-sampling-plus" unicode="" horiz-adv-x="496"
|
2438 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2439 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM355.4 189.7l58.3994 0.299805v-23.2002h-50.5l-18 -43.3994c-4.59961 -11 -20.8994 -8.7002 -22.2998 3.09961l-2.7002 22.2998l-6.7998 -83
|
2440 |
+
c-1.09961 -14.0996 -22 -14.2002 -23.0996 0.100586l-4.90039 64.3994l-4.59961 -58.5996c-1.10059 -14.2998 -22.3008 -14.1006 -23.2002 0.200195l-4.5 71.7998l-4.90039 -80.5c-0.899414 -14.5 -22.2998 -14.5 -23.2002 -0.100586l-4.7998 73.3008l-4.59961 -70.4004
|
2441 |
+
c-0.900391 -14.2998 -22.1006 -14.5 -23.2002 -0.0996094l-5.7002 78.2998l-3.7998 -43.6006c-1.2002 -13.6992 -21.0996 -14.1992 -23.0996 -0.699219l-10.7002 73.0996c-2 -3.90039 -6 -6.40039 -10.4004 -6.40039h-51.2998v23.2002h43.9004l13.1992 27.7002
|
2442 |
+
c4.90039 10.2998 20.3008 8.09961 22 -3.2998l1.80078 -12.2002l7.69922 89.7998c1.2002 14.1006 22.1006 14.1006 23.2002 -0.200195l4.10059 -57l5.2998 80.2002c1 14.4004 22.2998 14.4004 23.2002 0l4.2998 -66.2998l5.09961 83.7002
|
2443 |
+
c0.900391 14.3994 22.2998 14.5 23.2002 0l5.90039 -94.2998l3.5 44.8994c1.09961 14.2002 22.0996 14.2998 23.1992 0l5.2002 -68.7998l4.2998 51.4004c1.10059 13.7998 21.4004 14.2998 23.1006 0.399414l11 -92.7998l4 9.5c1.7002 4.40039 6 7.2002 10.7002 7.2002z
|
2444 |
+
M277.4 184.5c4.09961 0 7.5 3.40039 7.5 7.5c0 4.2002 -3.40039 7.5 -7.5 7.5h-21.9004v21.9004c0 4.19922 -3.40039 7.5 -7.5 7.5s-7.5 -3.40039 -7.5 -7.5v-21.9004h-21.9004c-4.09961 0 -7.5 -3.40039 -7.5 -7.5c0 -4.2002 3.40039 -7.5 7.5 -7.5h21.9004v-21.9004
|
2445 |
+
c0 -4.19922 3.40039 -7.5 7.5 -7.5c4.2002 0 7.5 3.40039 7.5 7.5v21.9004h21.9004z" />
|
2446 |
+
<glyph glyph-name="creative-commons-share" unicode="" horiz-adv-x="496"
|
2447 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2448 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM349.4 262.9c7.7998 0 13.6992 -6.10059 13.6992 -13.7002v-182.5c0 -7.7002 -6.09961 -13.7002 -13.6992 -13.7002h-135.101c-7.7002 0 -13.7002 6 -13.7002 13.7002v54h-54
|
2449 |
+
c-7.7998 0 -13.6992 6 -13.6992 13.7002v182.5c0 8.19922 6.59961 12.6992 12.3994 13.6992h136.4c7.7002 0 13.7002 -6 13.7002 -13.6992v-54h54zM159.9 147.7h40.6992v101.399c0 7.40039 5.80078 12.6006 12 13.7002h55.8008v40.2998h-108.5v-155.399zM336.1 235.8h-108.5
|
2450 |
+
v-155.399h108.5v155.399z" />
|
2451 |
+
<glyph glyph-name="creative-commons-zero" unicode="" horiz-adv-x="496"
|
2452 |
+
d="M247.6 440c141.801 0 248.4 -110.1 248.4 -248c0 -147.1 -118.5 -248 -248.4 -248c-134 0 -247.6 109.5 -247.6 248c0 132.9 104.7 248 247.6 248zM248.4 395.3c-118.2 0 -203.7 -97.8994 -203.7 -203.3c0 -109.8 91.2002 -202.8 203.7 -202.8
|
2453 |
+
c103.199 0 202.8 81.0996 202.8 202.8c0.0996094 113.8 -90.2002 203.3 -202.8 203.3zM248 334.8c81.9004 0 102.5 -77.2998 102.5 -142.8s-20.5996 -142.8 -102.5 -142.8s-102.5 77.2998 -102.5 142.8s20.5996 142.8 102.5 142.8zM248 280.9
|
2454 |
+
c-42.0996 0 -44.0996 -60.1006 -44.0996 -88.9004c0 -9.2998 0.199219 -21.7002 1.89941 -34.4004l54.5 100.2c5.7002 9.7998 2.7998 16.7998 -3.09961 21.9004c-2.7998 0.700195 -5.90039 1.2002 -9.2002 1.2002zM288.8 234.7l-60.8994 -105.2
|
2455 |
+
c-12.5 -18.7002 6.59961 -26.4004 20.0996 -26.4004c42.0996 0 44.0996 60 44.0996 88.9004c0 11.2998 -0.399414 27.2998 -3.2998 42.7002z" />
|
2456 |
+
<glyph glyph-name="ebay" unicode="" horiz-adv-x="640"
|
2457 |
+
d="M606 258.5h34l-99.2002 -194.8h-35.8994l28.5 54.0996l-61.5 116.101c3.09961 -6.60059 4.7998 -14.5 4.7998 -23.8008v-65.5996c0 -9.2998 0.299805 -18.5996 1 -26.7998h-29.7998c-0.800781 6.89941 -1.10059 13.5996 -1.10059 20.2002
|
2458 |
+
c-16.0996 -19.8008 -35.2998 -25.5 -61.8994 -25.5c-39.5 0 -60.6006 20.8994 -60.6006 45c0 3.19922 0.200195 6.19922 0.700195 9c-8.40039 -32.3008 -36.4004 -54.2002 -73.2998 -54.2002c-23.2998 0 -45.1006 8.2998 -58.7002 24.8994
|
2459 |
+
c0 -6.59961 -0.400391 -13.1992 -1.09961 -19.5h-31.5c0.5 10.2002 1.09961 22.8008 1.09961 33.1006v169.5h32.0996v-80.6006c15.7002 18.7002 37.4004 24.2002 58.7002 24.2002c35.7002 0 75.4004 -24.0996 75.4004 -76.2002c0 -5.59961 -0.5 -11 -1.5 -16.1992
|
2460 |
+
c7.09961 24.3994 34.2998 33.5 76.7002 34.3994c13.6992 0.299805 29 0.400391 41.6992 0.400391v3.39941c0 23.4004 -15 33 -41 33c-19.2998 0 -33.5996 -8 -35 -21.7998h-33.6992c3.59961 34.4004 39.6992 43.1006 71.5 43.1006c27.3994 0 51.7998 -7 63.2998 -26
|
2461 |
+
l-10.9004 20.5996h37.5l54.9004 -109.9zM243.7 134.2c29.7998 0 50.2002 21.5 50.2002 53.7998c0 32.4004 -20.4004 53.7998 -50.2002 53.7998c-29.6006 0 -50.2002 -21.3994 -50.2002 -53.7998c0 -32.2998 20.5996 -53.7998 50.2002 -53.7998zM444.6 181.5v3.2998
|
2462 |
+
c-11.7998 0 -26.2998 -0.0996094 -39.3994 -0.599609c-29.1006 -0.900391 -47.2002 -6.2002 -47.2002 -25.2998c0 -12.4004 9.90039 -25.8008 35 -25.8008c33.7002 0 51.5996 18.4004 51.5996 48.4004zM32.7002 179.9c3.5 -58.3008 79.2002 -57.4004 91.2002 -21.6006
|
2463 |
+
h33.0996c-6.40039 -34.3994 -43 -46.0996 -74.4004 -46.0996c-57.1992 0 -82.5 31.5 -82.5 74c0 46.7998 26.2002 77.5996 83 77.5996c45.3008 0 78.4004 -23.7002 78.4004 -75.3994v-8.5h-128.8zM127.7 201.3c-2.2998 54.7002 -87.5 56.6006 -94.4004 0h94.4004z" />
|
2464 |
+
<glyph glyph-name="keybase" unicode=""
|
2465 |
+
d="M195.21 17.2998c0 -9.8252 -7.97461 -17.7998 -17.7998 -17.7998c-9.82617 0 -17.7998 7.97461 -17.7998 17.7998c0 9.82617 7.97363 17.7998 17.7998 17.7998c9.80371 -0.0214844 17.7783 -7.99609 17.7998 -17.7998zM288 35.2002
|
2466 |
+
c9.80371 -0.0224609 17.7783 -7.99609 17.7998 -17.7998c0 -9.82617 -7.97461 -17.8008 -17.7998 -17.8008s-17.7998 7.97461 -17.7998 17.8008c0 9.8252 7.97461 17.7998 17.7998 17.7998zM430.3 71.2002c0 -38.9004 -7.59961 -73.9004 -22.2002 -103h-27.2998
|
2467 |
+
c23.5 38.7002 30.5 94.7998 22.4004 134.3c-16.1006 -29.5 -52.1006 -38.5996 -85.9004 -28.7998c-127.8 37.5 -192.5 -19.7002 -234.6 -50.2998l18.8994 59.2998l-39.8994 -42.2998c3.95605 -21.9639 17.9336 -54.3545 31.2002 -72.3008h-28.79
|
2468 |
+
c-8.1543 13.2822 -18.0996 36.2646 -22.2002 51.3008l-23.7998 -25.2002c0 74.8994 -5.5 147.6 61.5 215.2c16.4688 16.7402 47.4248 37.6621 69.0996 46.6992c-6.7998 13.5 -9.5 29.2002 -7.7998 46l-19.9102 1.2002c-16.918 1.05371 -30.6484 15.666 -30.6484 32.6172
|
2469 |
+
c0 0.492188 0.0214844 1.29102 0.0488281 1.7832v0.0996094l1.59961 26.2002c1.10449 16.7988 15.665 30.5078 32.5 30.5996c1.2998 0 -0.299805 0.100586 28.2002 -1.69922c7.65918 -0.414062 17.873 -5.52148 22.7998 -11.4004c7.11035 10.4004 14.5 20.5 24.6104 34.5
|
2470 |
+
l20.5996 -12.0996c-13.5996 -29 -9.09961 -36.2002 -9 -36.3008c3.90039 0 13.9004 0.5 32.4004 -5.69922c28.8379 -9.54883 52.2422 -41.9512 52.2422 -72.3291c0 -8.61914 -2.75195 -22.0469 -6.14258 -29.9717c19 -6.09961 51.2998 -19.8994 82.4004 -51.7998
|
2471 |
+
c36.5996 -37.5996 57.6992 -87.3994 57.6992 -136.6h-0.00976562zM146 325.9c2.80762 8.47461 8.67578 21.6455 13.0996 29.3994c0.100586 2 2.2002 13.1006 -7.7998 13.7998c-28.5 1.80078 -26.2998 1.60059 -26.7002 1.60059h-0.0429688
|
2472 |
+
c-4.47754 0 -8.31152 -3.62891 -8.55664 -8.10059l-1.59961 -26.1992c-0.00683594 -0.121094 -0.0117188 -0.318359 -0.0117188 -0.439453c0 -4.48633 3.63379 -8.36719 8.11133 -8.66113zM171.8 264.1c4.50488 -7.35938 14.4951 -16.3193 22.2998 -20
|
2473 |
+
c0 21.2002 28.5 41.9004 52.8008 17.5l8.39941 -10.2998c20.7998 18.7998 19.4004 45.2998 12.1006 60.9004c-13.8008 29.0996 -46.9004 32 -54.3008 31.7002c-0.319336 -0.015625 -0.837891 -0.0283203 -1.15723 -0.0283203c-9.09863 0 -19.1973 6.86719 -22.542 15.3281
|
2474 |
+
c-13.6904 -21.2002 -37.1904 -62.5 -17.5908 -95.1006h-0.00976562zM254.7 195.7l-19.7002 -16.1006c-0.900391 -0.738281 -1.63086 -2.2832 -1.63086 -3.44727c0 -0.890625 0.461914 -2.16797 1.03125 -2.85254l8.89941 -10.8994
|
2475 |
+
c0.742188 -0.896484 2.28809 -1.62305 3.45117 -1.62305c0.887695 0 2.16406 0.458008 2.84863 1.02246l19.6006 16l5.5 -6.7998c4.89941 -6 13.7998 1.40039 9 7.2998c-63.6006 78.2998 -41.5 51.1006 -55.2998 68.1006c-4.7002 6 -13.9004 -1.40039 -9 -7.30078
|
2476 |
+
c1.89941 -2.2998 18.3994 -22.5996 19.7998 -24.2998l-9.60059 -7.89941c-4.59961 -3.80078 2.60059 -13.3008 7.40039 -9.40039l9.7002 8zM373.11 170c-16.9004 23.7002 -42.6006 46.7002 -73.4004 60.4004c-6.18359 2.73633 -16.4434 6.58887 -22.9004 8.59961
|
2477 |
+
c-1.64355 -1.83789 -4.51074 -4.61523 -6.39941 -6.2002l31.8994 -39.2002c3.70605 -4.54102 6.71289 -12.9834 6.71289 -18.8447c0 -7.78906 -4.88867 -18.1172 -10.9121 -23.0547c-1.30078 -1.10059 -13.1006 -10.7002 -29 -4.90039
|
2478 |
+
c-2.90039 -2.2998 -10.1006 -9.89941 -22.2002 -9.89941h-0.0419922c-7.46777 0 -17.3496 4.70312 -22.0586 10.5l-8.89941 10.8994c-3.5293 4.33984 -6.39355 12.4014 -6.39355 17.9951c0 2.49121 0.624023 6.43555 1.39355 8.80469
|
2479 |
+
c-3.83398 4.43945 -6.94531 12.8018 -6.94531 18.667c0 3.26172 1.05078 8.33984 2.34473 11.333c-7.19922 1.30078 -26.6992 6.2002 -42.6992 21.4004c-55.8008 -20.7002 -88 -64.4004 -101.301 -91.2002c-14.8994 -30.2002 -18.7998 -60.8994 -19.8994 -90.2002
|
2480 |
+
c8.2002 8.7002 -3.90039 -4.09961 114 120.9l-29.9004 -93.5996c57.7998 31.0996 124 36 197.4 14.3994c23.5996 -6.89941 45.0996 -1.59961 56 13.9004c11.0996 15.5996 8.5 37.7002 -6.7998 59.2998zM128.61 340.9l1 15.5996l15.5996 -1l-1 -15.5996z" />
|
2481 |
+
<glyph glyph-name="mastodon" unicode=""
|
2482 |
+
d="M433 268.89c0 0 0.799805 -71.6992 -9 -121.5c-6.23047 -31.5996 -55.1104 -66.1992 -111.23 -72.8994c-20.0996 -2.40039 -93.1191 -14.2002 -178.75 6.7002v-0.339844c0 -3.75977 0.40332 -9.83496 0.900391 -13.5605c6.62988 -49.5996 49.2197 -52.5996 89.6299 -54
|
2483 |
+
c40.8105 -1.2998 77.1201 10.0996 77.1201 10.0996l1.7002 -36.8994s-28.5098 -15.2998 -79.3203 -18.1006c-28.0098 -1.59961 -62.8193 0.700195 -103.33 11.4004c-112.229 29.7002 -105.63 173.4 -105.63 289.1c0 97.2002 63.7197 125.7 63.7197 125.7
|
2484 |
+
c61.9209 28.4004 227.96 28.7002 290.48 0c0 0 63.71 -28.5 63.71 -125.7zM357.88 143.69c0 122 5.29004 147.71 -18.4199 175.01c-25.71 28.7002 -79.7197 31 -103.83 -6.10059l-11.5996 -19.5l-11.6006 19.5c-24.0098 36.9004 -77.9297 35 -103.83 6.10059
|
2485 |
+
c-23.6094 -27.1006 -18.4092 -52.9004 -18.4092 -175h46.7295v114.2c0 49.6992 64 51.5996 64 -6.90039v-62.5098h46.3301v62.5c0 58.5 64 56.5996 64 6.89941v-114.199h46.6299z" />
|
2486 |
+
<glyph glyph-name="r-project" unicode="" horiz-adv-x="581"
|
2487 |
+
d="M581 221.4c0 -54.8008 -33.9004 -104.301 -88.4004 -139.7l67.4004 -113.7h-112l-40.0996 75.4004c-21.8008 -6.5 -45.1006 -11.2002 -69.4004 -13.9004v-61.5h-99.0996v61.9004c-136.101 16.0996 -239.4 95.6992 -239.4 191.5c0 107.5 130.1 194.6 290.5 194.6
|
2488 |
+
s290.5 -87.0996 290.5 -194.6zM114.2 206.9c0 -52.8008 51.0996 -98.4004 125.2 -119.9v208.3h199s90.5996 -1.59961 90.5996 -87.8994c0 -86.3008 -86.5996 -92.7002 -86.5996 -92.7002s17.5996 -5.2998 27.7998 -10.5c1.7002 -0.799805 4 -2.10059 6.39941 -3.7002
|
2489 |
+
c43.8008 21.4004 70.3008 56.2998 70.3008 106.4c0 92.2998 -90 133 -211.9 133s-220.8 -59.5 -220.8 -133zM339.3 168.6c49.6006 0 87.7998 -8.19922 87.7998 28.3008c0 34.0996 -30 27.2998 -87.7998 27.2998v-55.6006zM338.4 96.0996v-22.0996
|
2490 |
+
c17.5996 0.0996094 34.5 1 50.5996 2.90039c-5.09961 7.5 -13.2002 19.1992 -24 19.1992h-26.5996z" />
|
2491 |
+
<glyph glyph-name="researchgate" unicode=""
|
2492 |
+
d="M0 416h448v-448h-448v448zM262.2 81.5996v7.30078c-10 0 -20 6.89941 -27.2002 14.6992c-12.2002 13.3008 -28.5996 34.7002 -42.2002 58.9004c22.5 5.2998 39.2002 26.4004 39.2002 47.5c0 31.2002 -24.2002 45.5996 -55.9004 45.5996
|
2493 |
+
c-17.7998 0 -45.0996 -1.59961 -70.8994 -0.599609v-8.09961c15.5996 -2.90039 22 -1.30078 22 -23.9004v-109.4c0 -22.5996 -6.5 -21 -22 -23.8994v-8.10059c7.5 0.200195 20.5 0.800781 33.5996 0.800781c12.5 0 28.7002 -0.5 35.6006 -0.800781v8.10059
|
2494 |
+
c-19.8008 2.7002 -25.8008 0.399414 -25.8008 23.8994v46.4004c6.7002 -0.599609 12.5 -0.599609 21.4004 -0.599609c16.9004 -30.3008 33 -53 42.2002 -63.6006c16.7998 -20.2002 43.3994 -17.2002 50 -14.2002zM285.1 216.6c38.7002 0 34 29.4004 34 49.9004h-30.3994
|
2495 |
+
v-10.7002h17.8994c0 -15.8994 -7.39941 -26.7998 -21.5 -26.7998c-11.2998 0 -17.8994 9.90039 -17.8994 23.2998v26.7998c0 12.4004 11.7998 19.7002 19.7002 19.7002c14.1992 0 19.6992 -12.5 19.6992 -12.5l10.7002 7.2002s-5.2002 17.9004 -30.3994 17.9004
|
2496 |
+
c-25.2002 0 -34 -18.2002 -34 -30.4004v-32.2002c0 -16.5 8.89941 -32.2002 32.1992 -32.2002zM168.6 171.9c-9.39941 0 -13.5996 0.299805 -20 0.799805v69.7002c6.40039 0.599609 15 0.599609 22.5 0.599609c23.3008 0 37.2002 -12.2002 37.2002 -34.5
|
2497 |
+
c0 -21.9004 -15 -36.5996 -39.7002 -36.5996z" />
|
2498 |
+
<glyph glyph-name="teamspeak" unicode="" horiz-adv-x="512"
|
2499 |
+
d="M244.2 101.21c-2.40039 -12.5 -10.6006 -20 -22.5 -24.2998c-9.2002 -3.2002 -50.1006 -1.60059 -61.7002 -1c-18 1.2998 -33.2002 8.5 -43.4004 24c-14.5 22.5 -19.5 47.7002 -14.5 73.8994c4.60059 24.5 24.6006 34.7002 46.3008 22.7002
|
2500 |
+
c15.1992 -7.5 42.5 -27.3994 63.3994 -46.5996c20.4004 -18.7002 34.7998 -36.4004 32.4004 -48.7002zM449.2 80.4102c6.7002 -5.41016 11.2002 -22 11.5996 -32.1006c1 -50.3994 -23.8994 -68 -46.5996 -85.3994c-65.1006 -50 -295.101 -16.9004 -145.4 -6.40039
|
2501 |
+
c127.4 9 164.101 96.1006 172.101 121.5c0.647461 1.99023 2.87109 3.60547 4.96387 3.60547c1.04102 0 2.53516 -0.540039 3.33594 -1.20508zM511.2 202.81c0 -17.1992 1.89941 -34.5996 -1 -51.6992c-4 -24.7002 -29.1006 -41.7002 -53.2002 -36.7002
|
2502 |
+
c-7.2002 1.7002 -9.40039 7.2002 -9.40039 14.2002c0 28.0996 0.800781 56.3994 0 84.5996c-1.89941 75.79 -36.1992 132.79 -102.3 169.4c-111 60.3896 -253.2 -7 -277.8 -131.5c-6.09961 -30.4004 -1.7002 -48.3008 -3.7002 -125.801
|
2503 |
+
c-0.299805 -7.19922 -4.2998 -11.1992 -12 -11.5c-30.7998 -1.39941 -51.7998 18.2002 -51.7998 49v20.9004l0.799805 26.4902c2.40039 15.5 10.7002 27 24.9004 34c3.5 1.7998 5.7002 3.5 6.39941 7.7998c6.10059 33.4102 19.5 64 39.3008 91.71
|
2504 |
+
c2.2998 3.09961 4 5.2998 1 9.2998c-3.7002 5.40039 -1 10.2002 3 14.5c28.0996 31.7998 61.8994 55.1006 102 67.4004c96 29.4668 180.1 9.29688 252.3 -60.5098c6.7002 -6.40039 15.5 -12.9004 7 -24.4004c-1.2998 -1.7998 1.09961 -3.5 2.2002 -5
|
2505 |
+
c17.2246 -23.209 35.3242 -65.1367 40.3994 -93.5898c0.900391 -3.7002 3 -5.10059 5.90039 -6.40039c17.3994 -8.7998 25.7002 -23.2998 26 -42.2002zM351.6 71.3096l-51.5996 7.7002c-22.7998 5.90039 -51 32.7002 22.2002 60.7998
|
2506 |
+
c21.5996 8.5 85.7002 37.2002 87.7998 -8c0.900391 -32 -21.9004 -63.2998 -58.4004 -60.5z" />
|
2507 |
+
<glyph glyph-name="first-order-alt" unicode="" horiz-adv-x="496"
|
2508 |
+
d="M248 440c136.97 0 248 -111.03 248 -248s-111.03 -248 -248 -248s-248 111.03 -248 248s111.03 248 248 248zM248 -48.21c132.66 0 240.21 107.55 240.21 240.21s-107.55 240.21 -240.21 240.21s-240.21 -107.55 -240.21 -240.21s107.55 -240.21 240.21 -240.21z
|
2509 |
+
M248 411.71c121.34 0 219.71 -98.3701 219.71 -219.71s-98.3701 -219.71 -219.71 -219.71s-219.71 98.3701 -219.71 219.71s98.3701 219.71 219.71 219.71zM248 -19.5098c116.81 0 211.51 94.7002 211.51 211.51s-94.7002 211.51 -211.51 211.51
|
2510 |
+
s-211.51 -94.6895 -211.51 -211.51s94.7002 -211.51 211.51 -211.51zM434.23 143.47c-3.69141 -14.209 -12.709 -36.0225 -20.1309 -48.6895l-74.1299 35.8799l61.4805 -54.8203c-8.85352 -11.7021 -25.5195 -28.4082 -37.2002 -37.29l-54.7998 61.5703l35.8799 -74.2705
|
2511 |
+
c-12.6445 -7.45215 -34.4307 -16.5156 -48.6299 -20.2295l-27.29 78.4697l4.79004 -82.9297c-8.61035 -1.17969 -17.4004 -1.7998 -26.3301 -1.7998s-17.7197 0.620117 -26.3301 1.7998l4.75977 82.46l-27.1494 -78.0303c-14.2021 3.70996 -35.998 12.7588 -48.6504 20.2002
|
2512 |
+
l35.9297 74.3398l-54.8701 -61.6396c-11.6836 8.87988 -28.3584 25.582 -37.2197 37.2793l61.5898 54.9004l-74.2598 -35.9297c-7.42383 12.667 -16.4463 34.4795 -20.1396 48.6895l77.8398 27.1104l-82.2305 -4.75977c-1.15918 8.56934 -1.7793 17.3193 -1.7793 26.21
|
2513 |
+
c0 9 0.629883 17.8398 1.81934 26.5098l82.3799 -4.76953l-77.9395 27.1592c3.71973 14.208 12.7822 36.0127 20.2295 48.6699l74.2207 -35.9199l-61.5205 54.8604c8.88086 11.6836 25.582 28.3584 37.2803 37.2197l54.7598 -61.5293l-35.8301 74.1699
|
2514 |
+
c12.6562 7.41895 34.4521 16.4375 48.6504 20.1299l26.8701 -77.25l-4.70996 81.6094c8.60938 1.18066 17.3896 1.80078 26.3193 1.80078c8.93066 0 17.71 -0.620117 26.3203 -1.80078l-4.74023 -82.1592l27.0498 77.7598c17.2705 -4.5 33.6006 -11.3506 48.6309 -20.1699
|
2515 |
+
l-35.8203 -74.1201l54.7197 61.4697c11.6924 -8.86133 28.376 -25.54 37.2402 -37.2295l-61.4502 -54.7705l74.1201 35.8604c7.43945 -12.6533 16.4893 -34.4492 20.2002 -48.6504l-77.8105 -27.0996l82.2402 4.75c1.19043 -8.66016 1.82031 -17.5 1.82031 -26.4902
|
2516 |
+
c0 -8.87988 -0.610352 -17.6299 -1.78027 -26.1904l-82.1201 4.75z" />
|
2517 |
+
<glyph glyph-name="fulcrum" unicode="" horiz-adv-x="320"
|
2518 |
+
d="M95.75 283.86l-35.3799 -43.5508l-35.3701 43.5508l35.3799 43.5498zM144.23 448v-211.11l-41.0801 -44.8896l41.0801 -44.8896v-211.11l-20.5107 198.18l-51 57.8203l50.9707 57.8203zM223.9 283.86l35.3799 43.5498l35.3799 -43.5498l-35.3799 -43.5508zM175.42 236.86
|
2519 |
+
v211.14l20.5801 -198.18l51 -57.8203l-51 -57.8203l-20.5801 -198.18v211.11l41.0801 44.8896z" />
|
2520 |
+
<glyph glyph-name="galactic-republic" unicode="" horiz-adv-x="496"
|
2521 |
+
d="M248 -56c-136.75 0 -248 111.25 -248 248s111.25 248 248 248s248 -111.25 248 -248s-111.25 -248 -248 -248zM248 423.47c-127.63 0 -231.47 -103.84 -231.47 -231.47s103.84 -231.47 231.47 -231.47s231.47 103.84 231.47 231.47s-103.84 231.47 -231.47 231.47z
|
2522 |
+
M275.62 401.66c37.6602 -4.91016 72.21 -19.7402 100.96 -41.7998l-17.3896 -17.3604c-20.6758 15.3154 -58.1152 30.7891 -83.5703 34.54v24.6201zM220.25 401.59v-24.54c-30.9697 -4.60938 -59.4502 -16.8301 -83.5195 -34.6699h-0.0800781l-17.2803 17.3604
|
2523 |
+
c28.7197 22.0498 63.2402 36.9102 100.88 41.8496zM232.5 351.42h31v-82.8604c10.0498 -2.0293 19.3701 -6.00977 27.6201 -11.5l58.6699 58.6709l21.9297 -21.9307l-58.6699 -58.6699c5.46973 -8.24023 9.48047 -17.5996 11.5 -27.6201h82.8701v-31h-82.8701
|
2524 |
+
c-2.03027 -10.0195 -6.04004 -19.3096 -11.5 -27.54l58.6699 -58.6895l-21.9297 -21.9307l-58.6699 58.6904c-8.25 -5.49023 -17.5703 -9.52051 -27.6201 -11.5498v-82.9004h-31v82.9004c-8.25781 1.66895 -20.6533 6.80762 -27.6699 11.4697l-58.6201 -58.6201
|
2525 |
+
l-21.9297 21.9297l58.6699 58.6904c-5.45996 8.23047 -9.4502 17.5205 -11.4697 27.54h-82.9004v31h82.9004c2.01953 10.0303 6 19.3896 11.4697 27.6201l-58.6699 58.6699l21.9297 21.9297l58.6201 -58.5898c8.25 5.48047 17.6299 9.38965 27.6699 11.4199v82.8701z
|
2526 |
+
M415.74 320.7c22.0996 -28.7402 36.9795 -63.3398 41.9297 -101.03h-24.6201c-3.7832 25.4902 -19.3154 62.9746 -34.6699 83.6699zM80.1904 320.57l17.3896 -17.3906c-17.8301 -24.0693 -29.9902 -52.5596 -34.5898 -83.5195h-24.6504
|
2527 |
+
c4.94043 37.6494 19.79 72.1895 41.8506 100.91zM38.3398 164.33l24.6504 0.00976562c4.58984 -30.9502 16.7002 -59.4502 34.5098 -83.5195l-17.3604 -17.3906c-22.0498 28.7207 -36.8799 63.2607 -41.7998 100.9zM433.04 164.33h24.6201
|
2528 |
+
c-4.9502 -37.6699 -19.8506 -72.2197 -41.9297 -100.96l-17.3604 17.3604c17.8701 24.0996 30.0596 52.6094 34.6699 83.5996zM136.66 41.6201c24.0703 -17.8604 52.6094 -30.0205 83.5996 -34.6504v-24.6396c-37.6602 4.9502 -72.2295 19.8398 -100.96 41.9297z
|
2529 |
+
M359.19 41.5703h0.0791016l17.3105 -17.3906c-28.75 -22.0596 -63.29 -36.9297 -100.96 -41.8496v24.5703c30.9902 4.58984 59.4795 16.8301 83.5703 34.6699z" />
|
2530 |
+
<glyph glyph-name="galactic-senate" unicode="" horiz-adv-x="512"
|
2531 |
+
d="M249.86 414.52h12.2793v-26.0693c13.5801 -20.6201 23.8604 -108.59 24.4902 -215.351c-11.7402 15.6201 -19.1299 33.3301 -19.1299 48.2402v16.8799c0.0302734 5.32031 -0.75 10.5303 -2.19043 15.6504c-0.649414 2.13965 -1.38965 4.07031 -2.61914 5.82031
|
2532 |
+
c-1.23047 1.73926 -3.44043 3.79004 -6.68066 3.79004c-3.25 0 -5.4502 -2.04004 -6.67969 -3.79004c-1.23047 -1.74023 -1.96973 -3.68066 -2.62012 -5.82031c-1.44043 -5.12012 -2.21973 -10.3301 -2.19043 -15.6504v-16.8799
|
2533 |
+
c0 -14.9102 -7.38965 -32.6201 -19.1299 -48.2402c0.610352 106.761 10.8906 194.73 24.4707 215.351v26.0693zM223.52 266.75c-1.59961 -22.4004 -2.75 -46.5195 -3.47949 -72.0703c-23.2998 -11.2793 -40.7705 -33.1602 -46.3203 -59.5098
|
2534 |
+
c-7.71973 -2.25977 -22.71 -3.91992 -40.4893 -4.21973c-7.51074 3.66016 -16.5 5.85938 -26.1807 6.04004c1.90039 14.9102 5.87012 29.1699 11.6504 42.4199c15.4395 -8.10059 30.9297 -8.66016 35.4697 -0.959961c4.57031 7.74023 -3.58984 21.04 -18.3203 30.6602
|
2535 |
+
c8.68066 11.7695 18.9805 22.2998 30.5605 31.0898c9.50977 -15.5898 23.3594 -24.4404 31.3594 -19.8203c8.05078 4.65039 7.19043 21.1699 -1.70996 37.29c8.76074 3.88965 17.9404 6.92969 27.46 9.08008zM288.48 266.75
|
2536 |
+
c7.82227 -1.75977 20.1201 -5.82812 27.4492 -9.08008c-8.89941 -16.1299 -9.75977 -32.6396 -1.70996 -37.29c8 -4.62012 21.8506 4.23047 31.3604 19.8203c11.5801 -8.79004 21.8799 -19.3203 30.5596 -31.0898c-14.7197 -9.61035 -22.8896 -22.9199 -18.3193 -30.6602
|
2537 |
+
c4.54004 -7.7002 20.0293 -7.14062 35.4697 0.959961c5.79004 -13.25 9.75 -27.5098 11.6504 -42.4199c-9.68066 -0.19043 -18.6709 -2.37988 -26.1807 -6.04004c-17.7793 0.299805 -32.7695 1.95996 -40.4902 4.21973c-5.5498 26.3496 -23.0293 48.2305 -46.3193 59.5098
|
2538 |
+
c-0.719727 25.5508 -1.87988 49.6699 -3.46973 72.0703zM256 258.15c3.23047 0 5.86035 -8.81055 6.08984 -19.9307h0.0498047v-16.8799c0 -41.4199 49.0107 -95.04 93.4902 -95.04c52 0 122.76 1.4502 156.37 -29.1699v-2.50977
|
2539 |
+
c-9.41992 -17.1104 -20.5801 -33.1699 -33.1797 -47.9697c-12.5303 21.0898 -51.5898 40.96 -108.021 41.3496c-45.6797 -1.01953 -79.0195 -20.3301 -90.7598 -40.8701c-0.00976562 -0.00976562 0.00976562 -0.0400391 0 -0.0498047
|
2540 |
+
c-7.66992 -2.13965 -15.8496 -3.23047 -24.04 -3.20996c-8.19043 -0.0205078 -16.3701 1.07031 -24.04 3.20996c-0.00976562 0.00976562 0.00976562 0.0400391 0 0.0498047c-11.7295 20.54 -45.0801 39.8506 -90.7598 40.8701
|
2541 |
+
c-56.4307 -0.400391 -95.5 -20.2598 -108.021 -41.3496c-12.5996 14.7998 -23.7598 30.8496 -33.1797 47.9697v2.50977c33.6201 30.6201 104.37 29.1699 156.37 29.1699c44.4795 0 93.4902 53.6201 93.4902 95.04v16.8799h0.0498047
|
2542 |
+
c0.229492 11.1201 2.85938 19.9307 6.08984 19.9307zM256 161.56c-22.4199 0 -40.5996 -18.1797 -40.5996 -40.5996s18.1797 -40.6504 40.5996 -40.6504s40.5996 18.2305 40.5996 40.6504s-18.1797 40.5996 -40.5996 40.5996zM256 153.92
|
2543 |
+
c18.1904 0 32.96 -14.7695 32.96 -32.96s-14.7695 -32.96 -32.96 -32.96s-32.96 14.7695 -32.96 32.96s14.7695 32.96 32.96 32.96zM256 147.78c-14.8096 0 -26.8203 -12.0107 -26.8203 -26.8203s12.0107 -26.8203 26.8203 -26.8203s26.8203 12.0107 26.8203 26.8203
|
2544 |
+
s-12.0107 26.8203 -26.8203 26.8203zM141.2 81.1104c18.75 -0.419922 35.1895 -4.18066 48.6094 -9.66992c12.5508 -16.0303 29.1602 -30.04 49.5801 -33.0703c0.100586 -0.00976562 0.169922 -0.0302734 0.270508 -0.0498047
|
2545 |
+
c0.0498047 -0.0107422 0.109375 -0.0400391 0.160156 -0.0507812c5.23926 -1.06934 10.6396 -1.59961 16.1895 -1.59961c5.56055 0 10.9502 0.530273 16.1904 1.59961c0.0498047 0.0107422 0.109375 0.0400391 0.160156 0.0507812
|
2546 |
+
c0.0996094 0.00976562 0.179688 0.0292969 0.269531 0.0498047c20.4199 3.04004 37.04 17.04 49.5801 33.0703c13.4199 5.5 29.8496 9.25 48.6104 9.66992c10.1797 -0.0800781 21.5996 -0.360352 30.5 -1.66016c-0.430664 -4.41992 -1.51074 -18.6299 -7.11035 -29.7598
|
2547 |
+
c-9.11035 2.55957 -18.3604 3.89941 -27.6201 3.89941c-41.2803 -0.939453 -71.4795 -34.3496 -78.2598 -74.4697l-0.110352 -4.7002c-10.3994 -1.91992 -21.1797 -2.93945 -32.21 -2.93945c-11.0195 0 -21.8096 1.0293 -32.21 2.93945l-0.109375 4.7002
|
2548 |
+
c-6.78027 40.1201 -36.9805 73.5303 -78.2607 74.4697c-9.25977 0 -18.5098 -1.33984 -27.6201 -3.89941c-5.59961 11.1299 -6.67969 25.3398 -7.10938 29.7598c8.89941 1.2998 20.3096 1.58984 30.5 1.66016z" />
|
2549 |
+
<glyph glyph-name="jedi-order" unicode=""
|
2550 |
+
d="M398.5 74.4004c0 0 26.2998 16.1992 49.9004 77.6992c0 0 -17 -183.3 -222 -185.699h-4.10059c-205.1 2.39941 -222 185.699 -222 185.699c23.2002 -61.5996 49.4004 -77.6992 49.4004 -77.6992c-95.9004 122.1 -17.2002 233.1 -17.2002 233.1
|
2551 |
+
c-45.4004 -85.7002 41.4004 -170.5 41.4004 -170.5c-105 171.6 60.5 271.5 60.5 271.5c-96.9004 -72.5996 10.0996 -190.7 10.0996 -190.7c-85.7998 -158.399 68.5996 -230.1 68.5996 -230.1s0.400391 16.8994 2.2002 85.7002l-34.5 -36.2002l24.2002 47.3994
|
2552 |
+
l-62.5996 9.10059l62.5996 9.09961l-20.2002 55.5l31.4004 -45.8994c2.2998 87.8994 7.89941 305.899 7.89941 306.899v2.40039v-1v1v-2.40039c0.100586 -1.7998 5.7002 -219.2 7.90039 -306.899l31.4004 45.8994l-20.2002 -55.5l62.5996 -9.09961l-62.5996 -9.10059
|
2553 |
+
l24.2002 -47.3994s-30.2002 31.7002 -34.5 36.2002c1.7998 -68.8008 2.19922 -85.7002 2.19922 -85.7002s154.4 71.7002 68.6006 230.1c0 0 107 118 10.0996 190.7c0 0 165.5 -100 60.5 -271.5c0 0 86.7998 84.7002 41.4004 170.5c0 0 78.7002 -111 -17.2002 -233.1z" />
|
2554 |
+
<glyph glyph-name="mandalorian" unicode=""
|
2555 |
+
d="M232.27 -63.8896c-1 3.25977 -1.68945 15.8301 -1.38965 24.5801c0.549805 15.8896 1 24.7197 1.40039 28.7598c0.639648 6.2002 2.87012 20.7197 3.2793 21.3799c0.600586 1 0.400391 27.8701 -0.239258 33.1299c-0.310547 2.58008 -0.629883 11.9004 -0.69043 20.7305
|
2556 |
+
c-0.129883 16.4697 -0.530273 20.1191 -2.72949 24.7598c-1.10059 2.31934 -1.23047 3.83984 -1 11.4297c0.0449219 1.07324 0.0820312 2.81641 0.0820312 3.89062c0 2.43945 -0.189453 6.39062 -0.422852 8.81934c-2 13 -3.45996 27.7002 -3.25 33.9004
|
2557 |
+
s0.430664 7.14941 2.06055 9.66992c3.0498 4.70996 6.50977 14 8.62012 23.2695c2.25977 9.86035 3.87988 17.1807 4.58984 20.7402c0.921875 4.24121 2.90137 10.9834 4.41992 15.0498c2.26953 6.25 2.49023 15.3906 0.370117 15.3906
|
2558 |
+
c-0.299805 0 -1.37988 -1.2207 -2.41016 -2.70996c-1.03027 -1.49023 -4.75977 -4.80078 -8.29004 -7.36035c-8.37012 -6.08008 -11.7002 -9.38965 -12.6602 -12.5801s-1 -7.22949 -0.160156 -7.75977c0.34082 -0.209961 1.29004 -2.40039 2.11035 -4.87988
|
2559 |
+
c0.791992 -2.41602 1.43457 -6.43945 1.43457 -8.98145c0 -1.78223 -0.320312 -4.64062 -0.714844 -6.37891c-0.389648 -1.76953 -1 -5.46973 -1.45996 -8.22949c-0.459961 -2.76074 -1 -6.46094 -1.25 -8.2207c-0.149414 -1.27637 -0.84375 -3.18555 -1.5498 -4.25977
|
2560 |
+
c-1 -1 -1.13965 -0.910156 -2.0498 0.530273c-0.619141 1.24316 -1.26465 3.37109 -1.44043 4.75c-0.25 1.73926 -1.62988 7.10938 -3.08008 11.9297c-3.2793 10.9004 -3.51953 16.1504 -1 21c0.683594 1.19141 1.43164 3.25684 1.66992 4.61035
|
2561 |
+
c0 2.38965 -2.19922 5.31934 -7.40918 9.88965c-7 6.17969 -8.62988 7.91992 -10.2305 11.2998c-1.70996 3.60059 -3.05957 4.06055 -4.54004 1.54004c-1.78027 -3 -2.59961 -9.10938 -3 -22l-0.339844 -12.1895l2 -2.25c3.20996 -3.7002 12.0703 -16.4502 13.7803 -19.8301
|
2562 |
+
c3.41016 -6.74023 4.33984 -11.6904 4.41016 -23.5605c0.0693359 -11.8701 0.949219 -22.75 2 -24.71c0.359375 -0.660156 0.509766 -1.34961 0.339844 -1.51953s0.410156 -2.08984 1.29004 -4.27051c0.871094 -2.41406 1.79395 -6.44629 2.05957 -9
|
2563 |
+
c0.306641 -2.88867 1.07227 -7.53516 1.70996 -10.3701c2.23047 -9.55957 2.77051 -14.0801 2.39062 -20.1396c-0.200195 -3.26953 -0.530273 -11.0703 -0.730469 -17.3203c-1.30957 -41.7598 -1.84961 -58 -2 -61.21c-0.120117 -2 -0.389648 -11.5098 -0.599609 -21.0693
|
2564 |
+
c-0.360352 -16.3008 -1.30078 -27.3701 -2.41992 -28.6504c-0.640625 -0.729492 -8.07031 4.91016 -12.5205 9.49023c-3.75 3.87012 -4 4.79004 -2.83008 9.9502c0.700195 3 2.25977 18.29 3.33008 32.6191c0.360352 4.78027 0.80957 10.5 1 12.7109
|
2565 |
+
c0.830078 9.36914 1.66016 20.3496 2.61035 34.7793c0.55957 8.45996 1.33008 16.4404 1.71973 17.7305s0.889648 9.88965 1.12988 19.1094l0.429688 16.7705l-2.25977 4.2998c-1.71973 3.28027 -4.87012 6.94043 -13.2197 15.3398
|
2566 |
+
c-6 6.07031 -11.8398 12.2998 -12.9102 13.8506l-1.9502 2.80957l0.75 10.9004c1.08984 15.71 1.10059 48.5693 0 59.0596l-0.889648 8.7002l-3.28027 4.51953c-5.85938 8.08008 -5.7998 7.75 -6.21973 33.2705c-0.100586 6.07031 -0.379883 11.5 -0.629883 12.0596
|
2567 |
+
c-0.830078 1.87012 -3.0498 2.66016 -8.54004 3.05078c-8.86035 0.619141 -11 1.89941 -23.8506 14.5498c-6.14941 6 -12.3398 12 -13.75 13.1895c-2.80957 2.41992 -2.79004 2 -0.55957 9.62988l1.34961 4.65039l-1.68945 3c-0.630859 1.17676 -1.79102 3 -2.58984 4.07031
|
2568 |
+
c-1.33008 1.50977 -5.5 10.8896 -6 13.4893c-0.0859375 0.307617 -0.155273 0.816406 -0.155273 1.13574c0 0.868164 0.458984 2.10645 1.02539 2.76465c2.22949 2.86035 3.39941 5.67969 4.44922 10.7305c2.33008 11.1895 7.74023 26.0898 10.6006 29.2197
|
2569 |
+
c3.17969 3.46973 7.7002 1 9.41016 -5c1.33984 -4.79004 1.36914 -9.79004 0.0996094 -18.5498c-0.445312 -3.05176 -0.893555 -8.02832 -1 -11.1104c0 -4 0.19043 -4.69043 2.25 -7.38965c3.33008 -4.37012 7.72949 -7.41016 15.2002 -10.5205
|
2570 |
+
c1.41992 -0.591797 3.53418 -1.86914 4.71973 -2.84961c11.1699 -10.7207 18.6201 -16.1807 22.9502 -16.8506c5.17969 -0.799805 8 -4.54004 10 -13.3896c1.30957 -5.65039 4 -11.1396 5.45996 -11.1396c0.994141 0.203125 2.48633 0.826172 3.33008 1.38965
|
2571 |
+
c2 1.21973 2.25 1.73047 2.25 4.17969c-0.21875 4.96191 -1.11523 12.9541 -2 17.8398c-0.370117 1.66016 -0.780273 4.06055 -0.930664 5.35059c-0.149414 1.29004 -0.609375 3.84961 -1 5.68945c-2.5498 11.1602 -3.64941 15.46 -4.09961 16
|
2572 |
+
c-1.5498 2 -4.08008 10.2002 -4.92969 15.9209c-1.64062 11.1094 -4 14.2295 -12.9102 17.3896c-4.0791 1.50293 -10.0547 5.0332 -13.3398 7.87988c-1.15039 1 -4 3.21973 -6.35059 5.05957c-2.34961 1.84082 -4.40918 3.53027 -4.59961 3.76074
|
2573 |
+
c-0.701172 0.606445 -1.90625 1.50293 -2.69043 2c-6.23926 4.21973 -8.83984 7 -11.2598 12l-2.43945 5l-0.220703 13l-0.219727 13l6.91016 6.5498c3.9502 3.75 8.47949 7.34961 10.5898 8.42969c3.30957 1.69043 4.4502 1.89062 11.3701 2
|
2574 |
+
c8.53027 0.19043 10.1201 0 11.6602 -1.55957c1.54004 -1.56055 1.35938 -6.40039 -0.290039 -8.5c-0.501953 -0.564453 -1.10156 -1.60352 -1.33984 -2.32031c0 -0.580078 -2.61035 -4.91016 -5.41992 -9c-0.879883 -1.80371 -1.94141 -4.85938 -2.37012 -6.82031
|
2575 |
+
c20.4395 -13.3896 21.5498 -3.76953 14.0693 -29l11.3604 -2.51953c3.11035 8.66016 6.46973 17.2598 8.61035 26.2197c0.290039 7.62988 -12 4.19043 -15.4004 8.68066c-2.33008 5.92969 3.12988 14.1797 6.05957 19.1992c1.60059 2.33984 6.62012 4.7002 8.82031 4.15039
|
2576 |
+
c0.879883 -0.219727 4.16016 0.349609 7.37012 1.28027c2.04395 0.641602 5.42676 1.39453 7.5498 1.67969c1.69336 0.183594 4.38184 0.760742 6 1.29004c3.65039 1.11035 4.5 1.16992 6.35059 0.400391c1.56738 -0.539062 4.1748 -1.14844 5.81934 -1.36035
|
2577 |
+
c1.74902 -0.236328 4.43652 -1.0918 6 -1.91016c1.30762 -0.765625 3.54785 -1.73828 5 -2.16992c2.51074 -0.679688 3 -0.570312 7.05078 1.66992l4.34961 2.40039l10.7402 0.389648c10.4395 0.400391 10.8096 0.469727 15.2598 2.67969l4.58008 2.32031l2.45996 -1.42969
|
2578 |
+
c1.75977 -1 3.13965 -2.73047 4.84961 -6c2.36035 -4.51074 2.37988 -4.58008 1.37012 -7.37012c-0.879883 -2.44043 -0.889648 -3.2998 -0.0996094 -6.39062c0.435547 -1.68164 1.37695 -4.3291 2.09961 -5.90918c0.535156 -1.04785 1.12207 -2.83984 1.31055 -4
|
2579 |
+
c0.30957 -4.33008 0 -5.30078 -2.41016 -6.91992c-2.16992 -1.4707 -7 -7.91016 -7 -9.34082c-0.206055 -0.859375 -0.685547 -2.2041 -1.07031 -3c-5 -11.5098 -6.75977 -13.5596 -14.2598 -17c-9.2002 -4.19922 -12.2998 -5.18945 -16.21 -5.18945
|
2580 |
+
c-3.10059 0 -4 -0.25 -4.54004 -1.25977c-0.972656 -1.19629 -2.80566 -2.8584 -4.08984 -3.70996c-1.53223 -1.02344 -3.49512 -3.16504 -4.37988 -4.78027c-0.411133 -1.04004 -1.52734 -2.34375 -2.49023 -2.91016
|
2581 |
+
c-0.78125 -0.321289 -1.87891 -1.08789 -2.4502 -1.70996c-1.83496 -1.61133 -4.9707 -4.02148 -7 -5.37988c-3.33008 -2.33984 -6.87012 -5 -7.87012 -6c-0.560547 -0.604492 -1.62695 -1.36621 -2.37988 -1.7002c-0.697266 -0.314453 -1.65137 -1.05273 -2.12988 -1.65039
|
2582 |
+
c-1.31055 -1.38965 -1.49023 -2.10938 -1.13965 -4.59961c0.255859 -1.65527 0.892578 -4.29004 1.41992 -5.87988c1.31934 -3.7998 1.30957 -7.86035 0 -10.5703c-1.31055 -2.70996 -0.890625 -6.64941 1.34961 -9.58984c2 -2.62988 2.16016 -4.55957 0.709961 -8.83984
|
2583 |
+
c-0.587891 -2.27344 -1.06445 -6.02344 -1.06445 -8.37109c0 -0.148438 0.00195312 -0.390625 0.00488281 -0.539062c0 -4.87988 0.219727 -6.28027 1.45996 -8.37988c1.23926 -2.09961 1.81934 -2.48047 3.23926 -2.32031c2 0.230469 2.30078 1.0498 4.70996 12.1201
|
2584 |
+
c2.18066 10 3.70996 11.9199 13.7607 17.0801c2.93945 1.50977 7.45996 4 10 5.44043c2.54004 1.43945 6.79004 3.68945 9.37012 4.90918c4.99414 2.18652 11.8125 7.41504 15.2197 11.6709c7.10938 8.78906 10 16.2197 12.8496 33.2998
|
2585 |
+
c0.298828 2.31445 1.58008 5.77832 2.86035 7.72949c1.19434 1.86133 2.48828 5.13574 2.88965 7.31055c1 5.2998 2.85059 9.08008 5.58008 11.5098c4.7002 4.17969 6 1.08984 4.58984 -10.8701c-0.459961 -3.86035 -1.09961 -10.3301 -1.43945 -14.3799l-0.610352 -7.36035
|
2586 |
+
l4.4502 -4.08984l4.4502 -4.08984l0.109375 -8.41992c0.0605469 -4.62988 0.470703 -9.53027 0.919922 -10.8896l0.820312 -2.4707l-6.42969 -6.2793c-8.54004 -8.33008 -12.8799 -13.9307 -16.7598 -21.6104c-1.77051 -3.49023 -3.74023 -7.11035 -4.38086 -8
|
2587 |
+
c-2.17969 -3.11035 -6.45996 -13 -8.75977 -20.2598l-2.29004 -7.2207l-7 -6.48926c-3.83008 -3.57031 -8 -7.25 -9.16992 -8.16992c-3.0498 -2.32031 -4.25977 -5.15039 -4.25977 -10c-0.00683594 -0.166992 -0.0126953 -0.438477 -0.0126953 -0.605469
|
2588 |
+
c0 -1.94336 0.717773 -4.9248 1.60254 -6.65527c0.660156 -1.29688 1.59668 -3.45996 2.08984 -4.83008c0.290039 -0.875 0.993164 -2.16992 1.57031 -2.88965c1.40039 -1.58984 1.91992 -16.1201 0.830078 -23.2197c-0.679688 -4.48047 -3.62988 -12 -4.7002 -12
|
2589 |
+
c-1.79004 0 -4.05957 -9.27051 -5.07031 -20.7402c-0.179688 -2 -0.620117 -5.94043 -1 -8.7002s-1 -10 -1.34961 -16.0498c-0.770508 -12.2197 -0.19043 -18.7705 2 -23.1504c3.41016 -6.68945 0.519531 -12.6895 -11 -22.8398l-4 -3.49023l0.0703125 -5.18945
|
2590 |
+
c0.0439453 -2.4834 0.554688 -6.45703 1.13965 -8.87012c4.61035 -16 4.73047 -16.9199 4.37988 -37.1299c-0.459961 -26.4004 -0.259766 -40.2705 0.629883 -44.1504c0.410156 -1.91406 0.893555 -5.05078 1.08008 -7c0.169922 -2 0.660156 -5.33008 1.08008 -7.35938
|
2591 |
+
c0.469727 -2.26074 0.780273 -11 0.790039 -22.7402v-19.0605l-1.80957 -2.62988c-2.70996 -3.91016 -15.1104 -13.54 -15.4902 -12.29zM261.8 -18.7803c-0.179688 0.299805 -0.330078 6.87012 -0.330078 14.5898c0 14.0605 -0.889648 27.54 -2.25977 34.4502
|
2592 |
+
c-0.400391 2 -0.80957 9.7002 -0.900391 17.0605c-0.149414 11.9297 -1.39941 24.3701 -2.63965 26.3799c-0.660156 1.06934 -3 17.6602 -3 21.2998c0 4.23047 1 6 5.28027 9.12988s4.85938 3.13965 5.47949 0.719727c0.280273 -1.09961 1.4502 -5.61914 2.60059 -10
|
2593 |
+
c3.92969 -15.1191 4.13965 -16.2695 4.0498 -21.7393c-0.0996094 -5.78027 -0.129883 -6.12988 -1.74023 -17.7305c-1 -7.07031 -1.16992 -12.3896 -1 -28.4297c0.169922 -19.4004 -0.639648 -35.7305 -2 -41.2705c-0.709961 -2.7793 -2.7998 -5.47949 -3.42969 -4.42969z
|
2594 |
+
M190.8 18.7998c-0.638672 2.95215 -1.41406 7.78613 -1.72949 10.79s-1.09082 7.83789 -1.73047 10.79c-0.433594 1.76758 -0.880859 4.6748 -1 6.49023c-0.30957 3.18945 -0.910156 7.45996 -1.33008 9.47949c-1 4.79004 -3.34961 19.3506 -3.41992 21.0703
|
2595 |
+
c0 0.740234 -0.339844 4.0498 -0.700195 7.36035c-0.669922 6.20996 -0.839844 27.6699 -0.219727 28.29c1 1 6.62988 -2.76074 11.3301 -7.43066l5.28027 -5.25l-0.450195 -6.46973c-0.25 -3.55957 -0.599609 -10.2295 -0.780273 -14.8301
|
2596 |
+
c-0.179688 -4.59961 -0.490234 -9.87012 -0.669922 -11.71s-0.610352 -9.36035 -0.939453 -16.7197c-0.790039 -17.4102 -1.94043 -31.29 -2.65039 -32c-0.101562 -0.107422 -0.302734 -0.193359 -0.450195 -0.193359c-0.208008 0 -0.454102 0.149414 -0.549805 0.333008
|
2597 |
+
h0.00976562zM103.62 285.39c21.0703 -12.79 17.8398 -14.1494 28.4902 -17.6592c13 -4.29004 18.8701 -7.13086 23.1494 -16.8701c-43.6602 -36.1406 -69.0098 -57.8604 -76.71 -70.8604c-31 -52 -6 -101.59 62.75 -87.21c-14.1797 -29.2305 -78 -28.6299 -98.6797 4.90039
|
2598 |
+
c-24.6797 39.9492 -22.0898 118.3 61 187.659v0.0400391zM314.41 106.39c56.6602 -6.87988 82.3203 37.7402 46.54 89.2305c0 0 -26.8701 29.3398 -64.2803 68c3 15.4502 9.49023 32.1201 30.5703 53.8203c89.2002 -63.5107 92 -141.61 92.46 -149.36
|
2599 |
+
c4.2998 -70.6396 -78.7002 -91.1797 -105.29 -61.71v0.0195312z" />
|
2600 |
+
<glyph glyph-name="old-republic" unicode="" horiz-adv-x="496"
|
2601 |
+
d="M235.76 437.77c7.5 0.310547 15 0.280273 22.5 0.0908203c3.61035 -0.140625 7.2002 -0.400391 10.79 -0.730469c4.91992 -0.269531 9.79004 -1.03027 14.6699 -1.62012c2.93066 -0.429688 5.83008 -0.979492 8.75 -1.45996
|
2602 |
+
c7.90039 -1.33008 15.6699 -3.28027 23.3906 -5.39941c12.2393 -3.4707 24.1895 -7.91992 35.7598 -13.21c26.5596 -12.2402 50.9395 -29.21 71.6299 -49.8809c20.0303 -20.0898 36.7197 -43.5498 48.8896 -69.1895c1.12988 -2.58984 2.44043 -5.10059 3.4707 -7.74023
|
2603 |
+
c2.80957 -6.42969 5.38965 -12.9697 7.58008 -19.6299c4.13965 -12.3301 7.33984 -24.9902 9.41992 -37.8301c0.569336 -3.13965 1.04004 -6.2998 1.39941 -9.46973c0.549805 -3.83008 0.94043 -7.69043 1.18066 -11.5605
|
2604 |
+
c0.829102 -8.33984 0.839844 -16.7295 0.769531 -25.0996c-0.0703125 -4.96973 -0.259766 -9.94043 -0.75 -14.8896c-0.240234 -3.38086 -0.509766 -6.76074 -0.979492 -10.1201c-0.390625 -2.7207 -0.630859 -5.45996 -1.11035 -8.16992
|
2605 |
+
c-0.900391 -5.15039 -1.7002 -10.3105 -2.87012 -15.4102c-4.09961 -18.5 -10.2998 -36.5498 -18.5098 -53.6299c-15.7705 -32.8301 -38.8301 -62.1699 -67.1201 -85.1201c-14.3926 -11.7676 -39.8887 -27.3848 -56.9102 -34.8604
|
2606 |
+
c-6.20996 -2.67969 -12.46 -5.25 -18.8701 -7.41016c-3.50977 -1.16016 -7.00977 -2.37988 -10.5703 -3.38965c-6.61914 -1.87988 -13.2891 -3.63965 -20.0391 -5c-4.66016 -0.910156 -9.34082 -1.73047 -14.0303 -2.48047c-5.25 -0.65918 -10.5 -1.43945 -15.79 -1.73926
|
2607 |
+
c-6.69043 -0.660156 -13.4102 -0.839844 -20.1201 -0.810547c-6.82031 -0.0292969 -13.6504 0.120117 -20.4502 0.790039c-3.29004 0.230469 -6.57031 0.5 -9.83008 0.950195c-2.71973 0.389648 -5.45996 0.629883 -8.16992 1.11035
|
2608 |
+
c-4.12012 0.719727 -8.25 1.37012 -12.3496 2.21973c-4.25 0.939453 -8.49023 1.88965 -12.6904 3.01953c-8.62988 2.16992 -17.0801 5.01074 -25.4102 8.13086c-10.4893 4.11914 -20.79 8.75 -30.6396 14.25c-2.13965 1.14941 -4.28027 2.28906 -6.34961 3.56934
|
2609 |
+
c-11.2207 6.58008 -21.8604 14.1006 -31.9199 22.3398c-34.6807 28.4102 -61.4102 66.4307 -76.3506 108.7c-3.08984 8.74023 -5.70996 17.6504 -7.7998 26.6797c-1.48047 6.16016 -2.52051 12.4209 -3.58008 18.6602
|
2610 |
+
c-0.400391 2.35059 -0.610352 4.73047 -0.950195 7.08984c-0.599609 3.96094 -0.75 7.96094 -1.16992 11.9404c-0.799805 9.46973 -0.709961 18.9902 -0.509766 28.4902c0.139648 3.50977 0.339844 7.00977 0.700195 10.5098
|
2611 |
+
c0.30957 3.16992 0.459961 6.37012 0.919922 9.52051c0.410156 2.80957 0.649414 5.64941 1.16016 8.43945c0.699219 3.94043 1.2998 7.90039 2.11914 11.8203c3.43066 16.5195 8.4707 32.7295 15.2607 48.1797c1.14941 2.91992 2.58984 5.71973 3.85938 8.58984
|
2612 |
+
c8.05078 16.71 17.9004 32.5605 29.4902 47.0605c20 25.3799 45.1006 46.6797 73.2705 62.4697c7.5 4.15039 15.1592 8.0498 23.0693 11.3701c15.8203 6.87988 32.4102 11.9502 49.3105 15.3799c3.50977 0.669922 7.04004 1.24023 10.5596 1.84961
|
2613 |
+
c2.62012 0.470703 5.28027 0.700195 7.91016 1.08008c3.53027 0.530273 7.09961 0.680664 10.6504 1.04004c2.45996 0.240234 4.90918 0.360352 7.35938 0.509766zM244.4 413.36c-9.23047 -0.100586 -18.4307 -0.990234 -27.5703 -2.23047
|
2614 |
+
c-7.2998 -1.08008 -14.5303 -2.59961 -21.71 -4.2998c-13.9102 -3.5 -27.4805 -8.33984 -40.46 -14.4199c-10.46 -4.99023 -20.5898 -10.7002 -30.1797 -17.2197c-4.18066 -2.9209 -8.40039 -5.80078 -12.3408 -9.03027
|
2615 |
+
c-5.08008 -3.96973 -9.97949 -8.16992 -14.6797 -12.5898c-2.50977 -2.24023 -4.80957 -4.7002 -7.21973 -7.06055c-28.2207 -28.79 -48.4404 -65.3896 -57.5 -104.689c-2.04004 -8.44043 -3.54004 -17.0205 -4.44043 -25.6504
|
2616 |
+
c-1.09961 -8.88965 -1.43945 -17.8496 -1.41016 -26.7998c0.110352 -7.13965 0.379883 -14.2803 1.2207 -21.3701c0.620117 -7.12012 1.87012 -14.1602 3.19922 -21.1797c1.07031 -4.65039 2.03027 -9.32031 3.33008 -13.9102
|
2617 |
+
c6.29004 -23.3799 16.5 -45.7002 30.0703 -65.75c8.63965 -12.9805 18.7803 -24.9297 29.9805 -35.7705c16.2793 -15.8193 35.0498 -29.04 55.3398 -39.2197c7.2793 -3.51953 14.6602 -6.87012 22.2695 -9.62988c5.04004 -1.75977 10.0605 -3.57031 15.2197 -4.98047
|
2618 |
+
c11.2607 -3.22949 22.7705 -5.59961 34.3906 -7.05957c2.91016 -0.290039 5.80957 -0.610352 8.71973 -0.900391c13.8203 -1.08008 27.7402 -1 41.54 0.430664c4.4502 0.599609 8.91992 0.989258 13.3496 1.7793c3.63086 0.670898 7.28027 1.25 10.8701 2.10059
|
2619 |
+
c4.12988 0.979492 8.28027 1.91016 12.3604 3.07031c26.5 7.33984 51.5801 19.71 73.5801 36.1992c15.7803 11.8203 29.96 25.7607 42.1201 41.2803c3.25977 4.02051 6.16992 8.30957 9.12988 12.5498c3.38965 5.06055 6.58008 10.25 9.59961 15.54
|
2620 |
+
c2.40039 4.44043 4.74023 8.91016 6.9502 13.4502c5.69043 12.0498 10.2803 24.6201 13.75 37.4902c2.58984 10.0098 4.75 20.1602 5.90039 30.4502c1.76953 13.4697 1.93945 27.0996 1.29004 40.6494c-0.290039 3.89062 -0.669922 7.77051 -1 11.6602
|
2621 |
+
c-2.23047 19.0801 -6.79004 37.9102 -13.8203 55.7998c-5.9502 15.1299 -13.5303 29.6299 -22.6104 43.1299c-12.6895 18.8008 -28.2393 35.6807 -45.9697 49.8301c-25.0498 20 -54.4697 34.5498 -85.6504 42.0801c-7.7793 1.92969 -15.6895 3.33984 -23.6299 4.4502
|
2622 |
+
c-3.90918 0.589844 -7.84961 0.820312 -11.7695 1.24023c-7.38965 0.569336 -14.8105 0.719727 -22.2197 0.580078zM139.26 364.47c13.2998 8.89062 28.0801 15.3799 43.2998 20.1807c-3.16992 -1.77051 -6.43945 -3.38086 -9.5293 -5.29004
|
2623 |
+
c-11.21 -6.68066 -21.5205 -14.9004 -30.3799 -24.4902c-6.80078 -7.42969 -12.7607 -15.7305 -17.0107 -24.8896c-3.29004 -6.86035 -5.63965 -14.1904 -6.85938 -21.7109c-0.930664 -4.84961 -1.2998 -9.80957 -1.16992 -14.75
|
2624 |
+
c0.129883 -13.6592 4.43945 -27.0791 11.29 -38.8193c5.91992 -10.2197 13.6299 -19.3301 22.3594 -27.2598c4.85059 -4.36035 10.2402 -8.09082 14.9502 -12.6006c2.25977 -2.18945 4.49023 -4.41992 6.42969 -6.91016c2.62012 -3.30957 4.89062 -6.98926 5.99023 -11.0996
|
2625 |
+
c0.900391 -3.02051 0.660156 -6.2002 0.69043 -9.31055c0.0195312 -4.09961 -0.0400391 -8.19922 0.0292969 -12.2998c0.140625 -3.54004 -0.0195312 -7.08984 0.110352 -10.6299c0.0800781 -2.37988 0.0205078 -4.75977 0.0498047 -7.13965
|
2626 |
+
c0.160156 -5.77051 0.0605469 -11.5303 0.150391 -17.2998c0.109375 -2.91016 0.0195312 -5.82031 0.129883 -8.74023c0.0302734 -1.62988 0.129883 -3.28027 -0.0302734 -4.91016c-0.910156 -0.120117 -1.81934 -0.179688 -2.72949 -0.160156
|
2627 |
+
c-10.9902 0 -21.8799 2.62988 -31.9502 6.92969c-6 2.7002 -11.8105 5.89062 -17.0898 9.83008c-5.75 4.19043 -11.0898 8.95996 -15.79 14.3105c-6.53027 7.24023 -11.9805 15.3896 -16.6201 23.9502c-1.07031 2.0293 -2.24023 4.01953 -3.17969 6.12012
|
2628 |
+
c-1.16016 2.63965 -2.62012 5.13965 -3.66992 7.81934c-4.05078 9.68066 -6.57031 19.9404 -8.08008 30.3105c-0.490234 4.43945 -1.09082 8.87988 -1.2002 13.3496c-0.700195 15.7305 0.839844 31.5498 4.66992 46.8203c2.12012 8.14941 4.76953 16.1797 8.30957 23.8301
|
2629 |
+
c6.32031 14.1992 15.3398 27.1797 26.3008 38.1895c6.2793 6.2002 13.1299 11.8398 20.5293 16.6699zM314.63 384.59c2.74023 -0.740234 5.41016 -1.74023 8.08984 -2.67969c6.36035 -2.33008 12.6807 -4.83984 18.71 -7.95996
|
2630 |
+
c13.1104 -6.44043 25.3105 -14.8105 35.8203 -24.9697c10.2002 -9.9502 18.7402 -21.6006 25.1396 -34.3408c1.28027 -2.75 2.64062 -5.45996 3.81055 -8.25977c6.30957 -15.0996 10 -31.2598 11.2295 -47.5703c0.410156 -4.54004 0.44043 -9.08984 0.450195 -13.6396
|
2631 |
+
c0.0703125 -11.6396 -1.49023 -23.25 -4.2998 -34.5303c-1.96973 -7.26953 -4.34961 -14.4893 -7.86035 -21.1797c-3.17969 -6.63965 -6.67969 -13.1602 -10.8398 -19.2402c-6.93945 -10.4697 -15.5996 -19.8701 -25.8203 -27.2197
|
2632 |
+
c-10.4795 -7.63965 -22.6396 -13.0195 -35.3994 -15.3799c-3.50977 -0.69043 -7.08008 -1.08008 -10.6602 -1.20996c-1.84961 -0.0605469 -3.71973 -0.160156 -5.55957 0.0996094c-0.280273 2.15039 0 4.31055 -0.0107422 6.45996
|
2633 |
+
c-0.0292969 3.73047 0.140625 7.4502 0.100586 11.1699c0.189453 7.02051 0.0195312 14.0508 0.209961 21.0703c0.0292969 2.37988 -0.0302734 4.75977 0.0292969 7.13965c0.170898 5.07031 -0.0390625 10.1406 0.140625 15.21
|
2634 |
+
c0.0996094 2.99023 -0.240234 6.04004 0.509766 8.95996c0.660156 2.5 1.78027 4.86035 3.08984 7.08008c4.45996 7.31055 11.0605 12.96 17.6807 18.2607c5.37988 4.17969 10.4697 8.76953 15.0195 13.8398c7.67969 8.37012 14.1699 17.8799 18.7803 28.2695
|
2635 |
+
c2.5 5.93066 4.51953 12.1006 5.5498 18.46c0.860352 4.37012 1.05957 8.83008 1.00977 13.2705c-0.0195312 7.84961 -1.39941 15.6494 -3.63965 23.1699c-1.75 5.72949 -4.27051 11.1797 -7.08984 16.4502c-3.87012 6.92969 -8.65039 13.3096 -13.96 19.1992
|
2636 |
+
c-9.94043 10.8506 -21.75 19.9404 -34.6006 27.1006c-1.84961 1.01953 -3.83984 1.82031 -5.62988 2.96973zM213.83 326.14c0.979492 1.18066 1.99023 2.33008 3.12012 3.37988c-0.610352 -0.929688 -1.27051 -1.80957 -1.9502 -2.67969
|
2637 |
+
c-3.09961 -3.87988 -5.54004 -8.30957 -7.03027 -13.0596c-0.870117 -3.27051 -1.67969 -6.60059 -1.72949 -10c-0.0703125 -2.52051 -0.0800781 -5.07031 0.319336 -7.57031c1.13086 -7.62988 4.33008 -14.8496 8.77051 -21.1201c2 -2.7002 4.25 -5.26953 6.91992 -7.33008
|
2638 |
+
c1.62012 -1.26953 3.53027 -2.08984 5.33984 -3.0498c3.11035 -1.67969 6.32031 -3.22949 9.07031 -5.47949c2.66992 -2.09082 4.5498 -5.33008 4.39941 -8.79004c-0.00976562 -73.6709 0 -147.341 -0.00976562 -221.021c0 -1.34961 -0.0800781 -2.7002 0.0400391 -4.04004
|
2639 |
+
c0.129883 -1.47949 0.820312 -2.83008 1.46973 -4.14941c0.860352 -1.66016 1.78027 -3.34082 3.18066 -4.62012c0.849609 -0.770508 1.96973 -1.40039 3.14941 -1.24023c1.5 0.200195 2.66016 1.34961 3.4502 2.57031c0.959961 1.50977 1.67969 3.15918 2.28027 4.84961
|
2640 |
+
c0.759766 2.12988 0.439453 4.41992 0.540039 6.62988c0.139648 4.03027 -0.0205078 8.06055 0.139648 12.0898c0.0302734 5.89062 0.0302734 11.7705 0.0605469 17.6602c0.139648 3.62012 0.0292969 7.24023 0.109375 10.8604
|
2641 |
+
c0.150391 4.0293 -0.0195312 8.05957 0.140625 12.0898c0.0292969 5.99023 0.0292969 11.9795 0.0693359 17.9697c0.140625 3.62012 0.0205078 7.24023 0.110352 10.8604c0.139648 3.92969 -0.0205078 7.85938 0.139648 11.7803
|
2642 |
+
c0.0302734 5.98926 0.0302734 11.9795 0.0605469 17.9697c0.160156 3.93945 -0.00976562 7.87988 0.189453 11.8193c0.290039 -1.43945 0.129883 -2.91992 0.220703 -4.37988c0.189453 -3.60938 0.419922 -7.22949 0.759766 -10.8398
|
2643 |
+
c0.320312 -3.43945 0.439453 -6.88965 0.859375 -10.3193c0.370117 -3.10059 0.510742 -6.2207 0.950195 -9.31055c0.570312 -4.08984 0.870117 -8.20996 1.54004 -12.29c1.45996 -9.04004 2.83008 -18.1104 5.08984 -26.9902c1.13086 -4.81934 2.40039 -9.60938 4 -14.2998
|
2644 |
+
c2.54004 -7.89941 5.7207 -15.6699 10.3105 -22.6201c1.72949 -2.63965 3.87012 -4.97949 6.09961 -7.20996c0.270508 -0.25 0.549805 -0.509766 0.879883 -0.709961c0.600586 -0.25 1.31055 0.0703125 1.7002 0.570312c0.709961 0.879883 1.16992 1.93945 1.7002 2.92969
|
2645 |
+
c4.0498 7.7998 8.17969 15.5605 12.3398 23.3105c0.700195 1.30957 1.44043 2.62012 2.56055 3.60938c1.75 1.57031 3.83984 2.69043 5.97949 3.62988c2.87988 1.2207 5.90039 2.19043 9.03027 2.41992c6.58008 0.620117 13.1094 -0.75 19.5596 -1.84961
|
2646 |
+
c3.69043 -0.580078 7.40039 -1.16992 11.1299 -1.41016c3.74023 -0.0996094 7.48047 -0.0498047 11.21 0.280273c8.55078 0.919922 16.9902 2.95996 24.9404 6.25c5.2998 2.24023 10.46 4.83008 15.3096 7.92969c11.46 7.20996 21.46 16.5703 30.04 27.0107
|
2647 |
+
c1.16992 1.41992 2.25 2.89941 3.45996 4.2793c-1.19922 -3.24023 -2.66992 -6.37012 -4.15918 -9.47949c-1.25 -2.90039 -2.84082 -5.61035 -4.27051 -8.41992c-5.16016 -9.62988 -11.0195 -18.9102 -17.75 -27.5205
|
2648 |
+
c-4.03027 -5.20996 -8.53027 -10.0498 -13.3301 -14.5703c-6.63965 -6.0498 -14.0703 -11.3691 -22.4297 -14.7598c-8.20996 -3.37012 -17.3105 -4.62988 -26.0898 -3.29004c-3.56055 0.580078 -7.01074 1.69043 -10.4102 2.87988
|
2649 |
+
c-2.79004 0.970703 -5.39062 2.38086 -8.03027 3.69043c-3.42969 1.70996 -6.63965 3.80957 -9.70996 6.08008c2.70996 -3.06055 5.69043 -5.86035 8.7002 -8.61035c4.26953 -3.75977 8.74023 -7.30957 13.6299 -10.2295c3.98047 -2.4502 8.29004 -4.40039 12.8398 -5.51074
|
2650 |
+
c1.45996 -0.369141 2.95996 -0.459961 4.4502 -0.599609c-1.25 -1.09961 -2.62988 -2.04004 -3.99023 -2.97949c-9.60938 -6.54004 -20.0098 -11.8604 -30.6895 -16.4307c-20.8604 -8.7002 -43.1699 -13.9697 -65.7402 -15.3398
|
2651 |
+
c-4.66016 -0.240234 -9.32031 -0.360352 -13.9805 -0.360352c-4.97949 0.110352 -9.96973 0.130859 -14.9199 0.650391c-11.2002 0.759766 -22.29 2.73047 -33.1699 5.42969c-10.3496 2.70996 -20.5498 6.12012 -30.2998 10.5508
|
2652 |
+
c-8.70996 3.85938 -17.1201 8.41992 -24.9902 13.79c-1.83008 1.30957 -3.74023 2.5293 -5.37012 4.0791c6.60059 1.19043 13.0303 3.39062 18.9902 6.48047c5.74023 2.86035 10.9902 6.66016 15.6299 11.0703c2.24023 2.18945 4.29004 4.58984 6.19043 7.08984
|
2653 |
+
c-3.43066 -2.12988 -6.93066 -4.15039 -10.6201 -5.78027c-4.41016 -2.16016 -9.07031 -3.76953 -13.8105 -5.01953c-5.72949 -1.52051 -11.7393 -1.73047 -17.6094 -1.14062c-8.12988 0.950195 -15.8604 4.27051 -22.5098 8.98047
|
2654 |
+
c-4.32031 2.93945 -8.2207 6.42969 -11.96 10.0596c-9.93066 10.1602 -18.2002 21.8105 -25.6602 33.8604c-3.94043 6.26953 -7.53027 12.75 -11.1201 19.2197c-1.0498 2.04004 -2.15039 4.0498 -3.17969 6.10059c2.84961 -2.9209 5.56934 -5.9707 8.42969 -8.88086
|
2655 |
+
c8.99023 -8.96973 18.5596 -17.4395 29.1602 -24.4795c7.5498 -4.90039 15.6699 -9.23047 24.5596 -11.0303c3.11035 -0.729492 6.32031 -0.469727 9.46973 -0.80957c2.77051 -0.280273 5.56055 -0.200195 8.34082 -0.299805
|
2656 |
+
c5.0498 -0.0605469 10.1094 -0.0400391 15.1592 0.15918c3.65039 0.160156 7.27051 0.660156 10.8906 1.09082c2.06934 0.25 4.10938 0.709961 6.13965 1.19922c3.87988 0.950195 8.11035 0.959961 11.8301 -0.609375c4.75977 -1.85059 8.44043 -5.64062 11.3799 -9.70996
|
2657 |
+
c2.16016 -3.02051 4.06055 -6.2207 5.66016 -9.58008c1.16016 -2.43066 2.45996 -4.79004 3.5498 -7.26074c1 -2.23926 2.15039 -4.41992 3.41992 -6.51953c0.669922 -1.01953 1.40039 -2.15039 2.62012 -2.5498c1.06055 0.75 1.70996 1.91016 2.28027 3.03027
|
2658 |
+
c2.09961 4.15918 3.41992 8.64941 4.88965 13.0498c2.02051 6.58984 3.78027 13.2695 5.19043 20.0195c2.20996 9.25 3.25 18.7197 4.54004 28.1299c0.55957 3.98047 0.830078 7.99023 1.30957 11.9707c0.870117 10.6396 1.90039 21.2695 2.24023 31.9395
|
2659 |
+
c0.0800781 1.86035 0.240234 3.70996 0.25 5.57031c0.00976562 4.34961 0.25 8.68945 0.219727 13.0303c-0.00976562 2.37988 -0.00976562 4.75977 0 7.12988c0.0498047 5.06934 -0.200195 10.1396 -0.219727 15.21c-0.200195 6.60938 -0.709961 13.2002 -1.29004 19.7793
|
2660 |
+
c-0.730469 5.88086 -1.5498 11.7803 -3.12012 17.5107c-2.0498 7.75 -5.58984 15.0293 -9.7998 21.8193c-3.16016 5.07031 -6.79004 9.87988 -11.0898 14.0303c-3.87988 3.86035 -8.58008 7.08008 -13.9404 8.4502c-1.5 0.410156 -3.05957 0.450195 -4.58984 0.639648
|
2661 |
+
c0.0703125 2.99023 0.700195 5.93066 1.25977 8.85059c1.58984 7.70996 3.7998 15.2998 6.76074 22.5996c1.51953 4.03027 3.40918 7.90039 5.38965 11.7197c3.4502 6.56055 7.62012 12.79 12.46 18.46zM245.1 324.44
|
2662 |
+
c0.350586 0.0595703 0.709961 0.119141 1.07031 0.189453c0.19043 -1.79004 0.0898438 -3.58008 0.0996094 -5.37012v-38.1299c-0.00976562 -1.74023 0.130859 -3.49023 -0.149414 -5.21973c-0.360352 0.0302734 -0.709961 0.0498047 -1.06055 0.0498047
|
2663 |
+
c-0.949219 3.75 -1.71973 7.5498 -2.61914 11.3096c-0.380859 1.53027 -0.580078 3.09082 -1.07031 4.59082c-1.7002 0.239258 -3.42969 0.169922 -5.15039 0.199219c-5.05957 0.0107422 -10.1299 0 -15.1895 0.0107422
|
2664 |
+
c-1.66016 0.00976562 -3.32031 -0.0898438 -4.98047 0.0292969c-0.0302734 0.390625 -0.259766 0.910156 0.160156 1.18066c1.28027 0.649414 2.71973 0.879883 4.05957 1.34961c3.43066 1.13965 6.88086 2.16016 10.3105 3.31055
|
2665 |
+
c1.38965 0.479492 2.90039 0.719727 4.16016 1.54004c0.0400391 0.55957 0.0195312 1.12988 -0.0498047 1.67969c-1.23047 0.549805 -2.53027 0.870117 -3.81055 1.28027c-3.12988 1.0293 -6.29004 1.95996 -9.41016 3.01953c-1.79004 0.620117 -3.66992 1 -5.41016 1.79004
|
2666 |
+
c-0.0292969 0.370117 -0.0693359 0.730469 -0.109375 1.08984c5.08984 0.19043 10.2002 -0.0595703 15.2998 0.120117c3.36035 0.129883 6.73047 -0.0800781 10.0898 0.0703125c0.120117 0.389648 0.259766 0.769531 0.370117 1.16016
|
2667 |
+
c1.08008 4.93945 2.33008 9.8291 3.38965 14.75zM251.07 324.64c0.359375 -0.0498047 0.719727 -0.120117 1.08008 -0.199219c0.979492 -3.85059 1.72949 -7.76074 2.70996 -11.6104c0.359375 -1.41992 0.55957 -2.87988 1.0293 -4.27051
|
2668 |
+
c2.53027 -0.179688 5.07031 0.0107422 7.61035 -0.0498047c5.16016 -0.120117 10.3301 -0.120117 15.4902 -0.0693359c0.759766 0.00976562 1.51953 -0.0302734 2.2793 -0.0800781c-0.0390625 -0.360352 -0.0693359 -0.720703 -0.0996094 -1.08008
|
2669 |
+
c-1.82031 -0.830078 -3.78027 -1.25 -5.66992 -1.89062c-3.73047 -1.22949 -7.48047 -2.38965 -11.2197 -3.56934c-0.570312 -0.169922 -1.12012 -0.419922 -1.66992 -0.640625c-0.150391 -0.549805 -0.180664 -1.12012 -0.120117 -1.68945
|
2670 |
+
c0.870117 -0.480469 1.81934 -0.810547 2.76953 -1.08984c4.87988 -1.52051 9.73047 -3.14062 14.6299 -4.60059c0.379883 -0.129883 0.780273 -0.269531 1.12988 -0.490234c0.400391 -0.269531 0.230469 -0.790039 0.150391 -1.17969
|
2671 |
+
c-1.66016 -0.129883 -3.30957 -0.0302734 -4.96973 -0.0400391c-5.16992 -0.00976562 -10.3301 0.00976562 -15.5 -0.00976562c-1.61035 -0.0302734 -3.21973 0.0195312 -4.82031 -0.209961c-0.519531 -1.66992 -0.719727 -3.41992 -1.16992 -5.11035
|
2672 |
+
c-0.94043 -3.56934 -1.51953 -7.24023 -2.54004 -10.7793c-0.360352 -0.0107422 -0.709961 -0.0205078 -1.05957 -0.0605469c-0.290039 1.73047 -0.150391 3.48047 -0.150391 5.21973v38.1299c0.0205078 1.78027 -0.0800781 3.58008 0.110352 5.37012zM65.0498 279.67
|
2673 |
+
c1.12012 2.15039 2.08008 4.40039 3.37012 6.45996c-1.82031 -7.55957 -2.91016 -15.2695 -3.62012 -23c-0.799805 -7.70996 -0.849609 -15.4902 -0.540039 -23.2295c1.0498 -19.9404 5.54004 -39.8301 14.2305 -57.8809c2.99023 -5.98926 6.34961 -11.8291 10.5 -17.1094
|
2674 |
+
c6.12012 -7.46973 12.5293 -14.7598 19.8398 -21.0898c4.7998 -4.10059 9.99023 -7.78027 15.54 -10.8008c3.26953 -1.64941 6.50977 -3.38965 9.93945 -4.67969c5.01074 -2.03027 10.1904 -3.60938 15.4209 -4.93945c3.8291 -0.959961 7.7793 -1.41016 11.5195 -2.70996
|
2675 |
+
c5 -1.57031 9.46973 -4.61035 13.0303 -8.43066c4.92969 -5.22949 8.08984 -11.8701 10.2002 -18.6699c0.989258 -2.89941 1.58984 -5.91016 2.16992 -8.91992c0.149414 -0.75 0.219727 -1.51953 0.15918 -2.29004c-6.5 -2.78027 -13.2598 -5.05957 -20.2598 -6.17969
|
2676 |
+
c-4.10938 -0.780273 -8.29004 -0.990234 -12.46 -1.08008c-10.25 -0.240234 -20.4697 1.75977 -30.1201 5.12012c-3.73926 1.41992 -7.48926 2.84961 -11.0293 4.71973c-8.06055 3.83984 -15.6406 8.7002 -22.46 14.46c-2.9209 2.5498 -5.83008 5.12988 -8.40039 8.03027
|
2677 |
+
c-9.16016 9.83008 -16.2998 21.4102 -21.79 33.6494c-2.38965 5.55078 -4.61035 11.1807 -6.37012 16.96c-1.16992 3.94043 -2.36035 7.89062 -3.25977 11.9102c-0.75 2.94043 -1.21973 5.9502 -1.87012 8.91992c-0.459961 2.14062 -0.69043 4.32031 -1.03027 6.48047
|
2678 |
+
c-0.849609 5.42969 -1.2793 10.9297 -1.33008 16.4297c0.110352 6.18066 0.25 12.3701 1.07031 18.5c0.400391 2.86035 0.669922 5.74023 1.15039 8.60059c0.979492 5.69922 2.13965 11.3691 3.70996 16.9297c3.08984 11.6504 7.47949 22.9502 12.6895 33.8398z
|
2679 |
+
M428.78 286.11c1.09961 -1.66016 1.91016 -3.48047 2.7793 -5.26074c2.10059 -4.44922 4.24023 -8.89941 6.02051 -13.4893c7.61035 -18.7607 12.2998 -38.79 13.04 -59.0508c0.0195312 -1.75977 0.0703125 -3.51953 0.110352 -5.29004
|
2680 |
+
c0.129883 -9.56934 -1.27051 -19.0898 -3.18066 -28.4492c-0.729492 -3.58984 -1.54004 -7.16992 -2.58008 -10.6904c-4.04004 -14.7197 -10 -29 -18.4102 -41.7803c-8.20996 -12.5693 -19.0098 -23.5498 -31.8398 -31.4092
|
2681 |
+
c-5.72949 -3.59082 -11.79 -6.64062 -18.0498 -9.19043c-5.78027 -2.19043 -11.71 -4.03027 -17.7998 -5.11035c-6.40039 -1.0498 -12.9102 -1.51953 -19.4004 -1.22949c-7.91992 0.479492 -15.7793 2.07031 -23.21 4.84961
|
2682 |
+
c-1.93945 0.799805 -3.93945 1.45996 -5.83984 2.33008c-0.209961 1.50977 0.25 2.99023 0.530273 4.45996c1.16016 5.74023 3.03027 11.3604 5.7002 16.5801c2.36914 4.50977 5.51953 8.65039 9.45996 11.9004c2.42969 2.0498 5.23926 3.60938 8.15918 4.83008
|
2683 |
+
c3.58008 1.5 7.4707 1.96973 11.2402 2.83008c7.23047 1.70996 14.3701 3.92969 21.1504 7c10.3496 4.64941 19.71 11.3799 27.6494 19.46c1.59082 1.60938 3.23047 3.17969 4.74023 4.86914c3.37012 3.76074 6.70996 7.57031 9.85059 11.5303
|
2684 |
+
c7.47949 10.0703 12.8193 21.5898 16.71 33.4805c1.58008 5.2998 3.20996 10.5996 4.20996 16.0498c0.629883 2.87012 1.04004 5.78027 1.51953 8.67969c0.870117 6.08984 1.58984 12.2207 1.67969 18.3799c0.120117 6.65039 0.140625 13.3203 -0.529297 19.9404
|
2685 |
+
c-0.730469 7.99023 -1.87012 15.96 -3.70996 23.7803z" />
|
2686 |
+
<glyph glyph-name="phoenix-squadron" unicode="" horiz-adv-x="512"
|
2687 |
+
d="M96 384.62c46.4902 36.1299 105.55 56.0703 164.51 54.5703c29.5801 0.379883 59.1104 -5.37012 86.9102 -15.3301c-24.1299 4.62988 -49 6.33984 -73.3799 2.44922c-42.8701 -5.30957 -83.04 -27.1494 -111.83 -59.1797c5.66992 1 10.7803 3.66992 16 5.86035
|
2688 |
+
c18.1396 7.87012 37.4902 13.2598 57.2305 14.8301c19.7393 2.12988 39.6396 0.429688 59.2793 -1.91992c-14.4199 -2.79004 -29.1201 -4.57031 -43 -9.59082c-34.4297 -11.0693 -65.2695 -33.1592 -86.2998 -62.6299c-13.7998 -19.71 -23.6299 -42.8594 -24.6699 -67.1299
|
2689 |
+
c-0.349609 -16.4902 5.21973 -34.8096 19.8301 -44c7.01465 -4.23926 19.3594 -7.67969 27.5547 -7.67969c2.77539 0 7.23926 0.420898 9.96484 0.939453c15.4502 2.45996 30.0703 8.64062 43.6006 16.3301c11.5195 6.82031 22.6699 14.5508 32 24.25
|
2690 |
+
c3.79004 3.2207 2.53027 8.4502 2.62012 12.79c-2.12012 0.339844 -4.37988 1.11035 -6.30078 -0.299805c-9.47656 -5.19531 -25.5244 -12.0811 -35.8193 -15.3701c-20 -6.16992 -42.1602 -8.45996 -62.1006 -0.779297c12.79 -1.73047 26.0605 -0.310547 37.7402 5.43945
|
2691 |
+
c20.2305 9.71973 36.8105 25.2002 54.4404 38.7705c23.0107 17.7168 62.8379 42.4951 88.8994 55.3096c25.71 12 52.9404 22.7803 81.5703 24.1201c-15.6299 -13.7197 -32.1504 -26.5205 -46.7803 -41.3799c-14.5098 -14 -27.46 -29.5 -40.1094 -45.1807
|
2692 |
+
c-3.52051 -4.59961 -8.9502 -6.93945 -13.5801 -10.1592c-18.8516 -12.6768 -42.0986 -39.6016 -51.8906 -60.1006c-9.33008 -19.6797 -14.5 -41.8496 -11.7695 -63.6494c1.93945 -13.6904 8.70996 -27.5908 20.8994 -34.9102c12.9004 -8 29.0508 -8.07031 43.4805 -5.10059
|
2693 |
+
c32.7998 7.4502 61.4297 28.8906 81 55.8408c20.4404 27.5195 30.5195 62.1992 29.1602 96.3496c-0.520508 7.5 -1.57031 15 -1.66016 22.4902c8 -19.4805 14.8203 -39.71 16.6504 -60.8301c2 -14.2803 0.75 -28.7598 -1.62012 -42.9004
|
2694 |
+
c-1.91016 -11 -5.66992 -21.5098 -7.78027 -32.4297c17.209 19.293 34.833 55.6123 39.3398 81.0703c1.24121 7.8584 2.24902 20.6953 2.24902 28.6514c0 21.957 -7.37305 55.999 -16.459 75.9883c20.7803 -32 32.3398 -69.5801 35.71 -107.48
|
2695 |
+
c0.490234 -12.7295 0.490234 -25.5098 0 -38.2295c-2.37305 -28.7334 -15.6289 -72.5254 -29.5898 -97.75c-26.1201 -47.3398 -68 -85.6299 -117.19 -108c-78.29 -36.2305 -174.68 -31.3203 -248 14.6797c-32.9014 20.1289 -73.8711 64.3281 -91.4492 98.6602
|
2696 |
+
c-12.291 24.2021 -23.6523 65.8301 -25.3604 92.9199v31.3398c3.92969 69.7402 40.8701 135.92 96 178.36zM318 304.29c4.54688 0.770508 11.7148 2.77734 16 4.47949c5 1.77051 9.24023 5.94043 10.3203 11.2207c-8.95996 -4.99023 -17.9805 -9.91992 -26.3203 -15.7002z
|
2697 |
+
" />
|
2698 |
+
<glyph glyph-name="sith" unicode=""
|
2699 |
+
d="M0 416l118.75 -69.71l-11.5195 58.9004l91.0596 -69.8701c8.5 1.50977 17.0996 2.29004 25.71 2.29004s17.21 -0.770508 25.71 -2.29004l91.0596 69.8701l-11.5195 -58.9004l118.75 69.71l-69.71 -118.75l58.8604 11.5195l-69.8408 -91.0293
|
2700 |
+
c3.04004 -17.0098 3.03027 -34.4404 0 -51.4502l69.8408 -91.0303l-58.8604 11.5205l69.71 -118.78l-118.75 69.71l11.5195 -58.8604l-91.0293 69.8408c-17.0098 -3.04004 -34.46 -3.04004 -51.4805 0l-91.0293 -69.8408l11.5195 58.8604l-118.75 -69.71l69.71 118.78
|
2701 |
+
l-58.8604 -11.5205l69.8408 91.0303c-1.25488 7.04492 -2.27246 18.5693 -2.27246 25.7246c0 7.15625 1.01758 18.6807 2.27246 25.7256l-69.8408 91.0293l58.8604 -11.5195zM224 316.22c-31.7998 0 -63.6104 -12.0898 -87.8496 -36.3398
|
2702 |
+
c-48.4902 -48.4902 -48.5 -127.2 0 -175.7c48.5 -48.4893 127.21 -48.5195 175.699 -0.0292969c48.4902 48.4893 48.5 127.199 0 175.699c-24.25 24.25 -56.0498 36.3701 -87.8496 36.3701zM224 279.56c22.4199 0 44.8301 -8.51953 61.9199 -25.6094
|
2703 |
+
c34.1904 -34.1904 34.1797 -89.6904 0 -123.87c-34.1895 -34.1797 -89.6504 -34.1904 -123.84 0c-34.1904 34.1895 -34.1797 89.6895 0 123.87c17.0898 17.0898 39.5 25.6094 61.9199 25.6094z" />
|
2704 |
+
<glyph glyph-name="trade-federation" unicode="" horiz-adv-x="496"
|
2705 |
+
d="M248 439.2c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM248 -43.5996c129.7 0 234.8 105.1 234.8 234.8s-105.1 234.8 -234.8 234.8s-234.8 -105.1 -234.8 -234.8s105.1 -234.8 234.8 -234.8zM403.1 284.9v-0.100586h-145.699
|
2706 |
+
v-34.7998h83.2998v-47h-83.2998v-195.8h-48.8008v196.8h-117.699l-36.7002 46h155.1v81.7002h193.8v-46.7998zM329.8 239.8h-82.8994v56.2002h145v24.4004h-171.801v-80.6006h-143.899l20.0996 -23.8994h123.8v-197.4h26.8008v197.4h82.8994v23.8994zM168.5 308.8l22 9.2998
|
2707 |
+
l-15.7998 -18.0996l15.7002 -18.0996l-22.2002 9.5l-12.2998 -20.5l2.09961 24l-23.2998 5.39941l23.5 5.40039l-2.10059 23.7998zM138.9 328.5l9.5 -10.2002l-13.8008 5.2998l-6.7998 -12.1992l0.799805 14.6992l-13.6992 2.7002l14.2998 3.7998l-1.7002 13.9004
|
2708 |
+
l8 -12.4004l12.7002 5.90039zM304.3 183.3l-9.2998 -10.7998l9.40039 -10.7002l-13.1006 5.5l-7.2998 -12.2002l1.2002 14.2002l-13.9004 3.2002l13.9004 3.2002l-1.2998 14.2002l7.2998 -12.2002zM411.2 260.5l-15 -17.5996l15.0996 -17l-21.2002 8.7998l-11.5 -19.6006
|
2709 |
+
l1.80078 22.9004l-22.2002 4.90039l22.2998 5.39941l-2.2002 22.7002l12 -19.5996zM248 418.1c125.3 0 226.9 -101.6 226.9 -226.899s-101.601 -226.9 -226.9 -226.9s-226.9 101.601 -226.9 226.9s101.601 226.899 226.9 226.899zM342.6 252h-83.1992v30.9004h145.699
|
2710 |
+
v50.6992h-197.8v-81.5996h-157.399l40 -49.9004h116.699v-196.8h52.7002v195.7h83.2998v51zM248 404.8c-94.5996 0 -174.9 -61.5996 -202.9 -146.8h157.4v81.5996h199.1c-38.7998 40.2002 -93.2998 65.2002 -153.6 65.2002zM248 -22.2998c117.9 0 213.5 95.5996 213.4 213.5
|
2711 |
+
c0 51.8994 -18.5 99.5 -49.3008 136.5v-50.7998h-145.6v-19.2002h83.2002v-62.7002h-83.2998v-195.8h-64.6006v196.8h-114.7l-43.7998 56.2998c-5.7998 -19.2998 -8.89941 -39.8994 -8.89941 -61.0996c0 -117.9 95.6992 -213.5 213.6 -213.5zM178.8 173l22.7002 9.2998
|
2712 |
+
l-16.9004 -17.0996l15.8008 -18.7998l-21.5 10.7998l-13 -20.9004l3.69922 23.7998l-23.7998 5.90039l23.7002 3.90039l-1.7002 24.5z" />
|
2713 |
+
<glyph glyph-name="wolf-pack-battalion" unicode="" horiz-adv-x="512"
|
2714 |
+
d="M267.73 -23.5303l-11.4404 -21.1396l-11.4404 21.1104l-10.5596 -15.8408l-5.28027 12.3203l-5.2793 -7v-29.8301c-21.0605 7.91992 -21.1104 66.8604 -25.5107 97.21c-4.62012 31.8799 0.879883 92.8105 -81.3701 149.11c8.88086 23.5996 12 49.4297 2.64062 80.0498
|
2715 |
+
c-27.8701 -3.33008 -53.9404 -10.5801 -63.3398 -54.0996l30.3496 -8.36035c-11.2002 -23.04 -17.0195 -46.7598 -13.2002 -72.1396l27.2705 7l6.16016 -33.4307l18.4697 7l8.7998 -33.4297l19.3496 7l-26.4297 -21.0596l-8.7998 28.1494l-24.6299 -5.28027l-7 35.6309
|
2716 |
+
l-26.3906 -14.5205c-0.25 20.0205 -6.95996 58.0605 8.80078 84.4502l-26.3906 -5.28027c-3.99023 22.0703 2.37988 39.21 7.91992 56.7402l-22.4297 -9.67969c0.44043 25.0693 29.9404 56.79 61.5898 58.5098c20.2197 1.08984 56.7305 25.1602 54.1006 51.8994
|
2717 |
+
c-1.95996 19.8701 -17.4502 42.6201 -43.1104 49.7002c43.9795 -36.5098 9.71973 -67.2998 -5.28027 -73.46c-4.39941 11.4404 -17.54 69.0801 0 130.2c40.4697 -22.8701 89.7002 -65.0996 93.21 -147.86l58.0605 -38.71l3.51953 -93.25l-107.33 59.8203l-7 -7
|
2718 |
+
l17.5801 -3.50977l44 -38.71l15.8398 5.2793l28.1504 -49.2598l3.51953 -119.64l-21.1094 -15.8398l32.5498 -15.8398l32.5498 15.8398l-21.1094 15.8398l3.51953 119.64l28.0996 49.25l15.8408 -5.28027l44 38.7109l17.5898 3.51953l-7 7l-107.3 -59.7695l3.51953 93.25
|
2719 |
+
l58 38.71c3.5498 82.6895 52.8096 124.92 93.2002 147.79c17.54 -61.1201 4.39941 -118.761 0 -130.2c-14.96 6.16016 -49.2803 36.9502 -5.28027 73.46c-25.6602 -7.08008 -41.1104 -29.8301 -43.1104 -49.7002c-2.63965 -26.7305 33.8809 -50.8096 54.1006 -51.9004
|
2720 |
+
c31.6396 -1.70996 61.1396 -33.4297 61.5801 -58.5l-22.4307 9.68066c5.54004 -17.5303 11.9209 -34.6699 7.9209 -56.7402l-26.3906 5.28027c15.7998 -26.3906 9.0498 -64.4502 8.7998 -84.4502l-26.3896 14.5195l-7 -35.6299l-24.5898 5.24023l-8.7998 -28.1504
|
2721 |
+
l-26.3906 21.1104l19.3506 -7l8.7998 33.3896l18.4697 -7l6.16016 33.4307l27.2803 -7.05078c3.7998 25.3809 -2.0498 49.1406 -13.2002 72.1406l30.3496 8.35938c-9.42969 43.5205 -35.4297 50.7305 -63.3398 54.1006
|
2722 |
+
c-9.35938 -30.6201 -6.24023 -56.4404 2.64062 -80.0498c-82.25 -56.3008 -76.75 -117.221 -81.3701 -149.11c-4.40039 -30.3496 -4.4502 -89.29 -25.5107 -97.21v29.9502l-5.2793 7l-5.28027 -12.3203zM346.9 71.4697l-15.8408 10.5303
|
2723 |
+
c7.4707 4.36035 13.7607 8.41992 19.3506 12.3203c-0.600586 -7.2207 -0.270508 -13.8398 -3.50977 -22.8398v-0.0107422zM375.05 120.73c-0.399414 -10.9404 -0.899414 -21.6602 -1.75977 -31.6709c-7.84961 1.86035 -15.5703 3.80078 -21.1104 7
|
2724 |
+
c8.24023 7.94043 15.5508 16.3203 22.8701 24.6807v-0.00976562zM399.68 115.45l-23.75 6.16016c5.62695 7.16797 13.9014 19.3848 18.4707 27.2695c3.22949 -9.21973 5.2793 -20 5.2793 -33.4297zM403.2 196.39c19.4395 -12.8096 27.7998 -33.6592 29.9102 -56.2998
|
2725 |
+
c-12.3203 4.53027 -24.6299 9.31055 -36.9502 10.5605c5.05957 12 6.64941 28.1396 7 45.7393h0.0400391zM401.44 242.13c18.5596 -2.62988 35.1494 -9.18945 45.7598 -28.1494c-14.2197 -4.36035 -24.7803 -5.9707 -44 -14.0801
|
2726 |
+
c0.0800781 13.4092 -0.950195 27.9297 -1.75977 42.2295zM165.68 71.4805c-3.23926 9 -2.91016 15.5791 -3.50977 22.8398c5.58984 -3.90039 11.8799 -7.95996 19.3496 -12.3203zM137.53 120.74c7.31934 -8.36035 14.6299 -16.7402 22.8701 -24.6699
|
2727 |
+
c-5.54004 -3.2002 -13.2607 -5.14062 -21.1104 -7c-0.860352 10.0098 -1.36035 20.7295 -1.75977 31.6699zM112.89 115.46c0 13.4297 2 24.21 5.28027 33.4297c4.56934 -7.88477 12.8438 -20.1016 18.4697 -27.2695zM109.37 196.4h0.0898438
|
2728 |
+
c0.349609 -17.6006 2 -33.7402 7 -45.7402c-12.3701 -1.25 -24.6797 -6.03027 -37 -10.5605c2.11035 22.6406 10.4697 43.4902 29.9102 56.3008zM111.13 242.14c-0.80957 -14.2998 -1.83984 -28.8193 -1.75977 -42.2295c-19.2197 8.10938 -29.7803 9.71973 -44 14.0801
|
2729 |
+
c10.6299 18.9502 27.2295 25.5195 45.7598 28.1494z" />
|
2730 |
+
<glyph glyph-name="hornbill" unicode="" horiz-adv-x="512"
|
2731 |
+
d="M76.3799 77.7002c0.182617 -1.37207 0.331055 -3.6084 0.331055 -4.99219c0 -20.8662 -16.9346 -37.8008 -37.7998 -37.8008s-37.7998 16.9346 -37.7998 37.8008c0 20.8652 16.9346 37.7998 37.7998 37.7998c1.49805 0 3.91602 -0.173828 5.39844 -0.387695
|
2732 |
+
c-78.2793 111.35 52 190.53 52 190.53c-5.85938 -43 -8.23926 -91.1602 -8.23926 -91.1602c-67.3105 -41.4902 0.929688 -64.0605 39.8096 -72.8701c18.6445 -50.7129 77.6279 -91.9023 131.66 -91.9404c1.91992 0 3.76953 0.209961 5.66992 0.280273l0.110352 -18.8604
|
2733 |
+
c-99.2207 -1.38965 -158.7 29.1406 -188.94 51.6006zM184.38 405.4c109.75 73.9395 187.601 -54.0605 187.601 -54.0605c-43.04 5.86035 -91.1807 8.24023 -91.1807 8.24023c-43.0996 70.0098 -65.7998 -6.58008 -73.7998 -44.29
|
2734 |
+
c-48.4805 -19.5557 -87.8545 -77.8545 -87.8896 -130.13c0 -0.910156 0.139648 -1.78027 0.139648 -2.67969l-21.8398 -0.150391c-1.41016 100.43 29.8701 160.09 52.4199 190c-0.842773 -0.0683594 -2.21191 -0.123047 -3.05664 -0.123047
|
2735 |
+
c-20.9482 0 -37.9502 17.001 -37.9502 37.9492c0 20.9492 17.002 37.9502 37.9502 37.9502c13.1934 0 28.5273 -9.65723 34.2266 -21.5566c2.04199 -4.25488 3.7002 -11.5381 3.7002 -16.2578c0 -1.35547 -0.143555 -3.54785 -0.320312 -4.8916zM488.57 271.23
|
2736 |
+
c-4.21777 -2.00879 -11.3906 -3.63867 -16.0615 -3.63867c-0.886719 0 -2.32422 0.0625 -3.20898 0.138672c84.4502 -113.45 -49 -194.61 -49 -194.61c5.87012 43.0303 8.20996 91.1602 8.20996 91.1602c66.6006 40.96 0.640625 63.54 -38.46 72.54
|
2737 |
+
c-19.3633 48.9775 -77.8232 88.7422 -130.49 88.7598c-2.75 0 -5.43945 -0.259766 -8.13965 -0.410156l-0.139648 22.5c93.6094 1.33008 151.72 -25.7998 183.45 -47.7402c-0.226562 1.52539 -0.40918 4.01465 -0.40918 5.55566c0 20.9434 16.9971 37.9404 37.9395 37.9404
|
2738 |
+
c20.9434 0 37.9404 -16.9971 37.9404 -37.9404c0 -13.2236 -9.69043 -28.5703 -21.6309 -34.2549zM374.06 11.7598v-0.0595703c0.0917969 0.000976562 0.239258 0.000976562 0.330078 0.000976562c20.9375 0 37.9297 -16.9922 37.9297 -37.9297
|
2739 |
+
s-16.9922 -37.9297 -37.9297 -37.9297c-13.1963 0 -28.5273 9.66211 -34.2197 21.5684c-1.76367 3.66602 -3.39453 9.93848 -3.63965 14c-111.98 -80.3398 -191.9 51 -191.9 51c43.0703 -5.87988 91.1904 -8.21973 91.1904 -8.21973
|
2740 |
+
c41.3301 -67.1709 63.9199 0.540039 72.7695 39.4893c50.418 18.7646 91.3604 77.6543 91.3906 131.45c0 2.08008 -0.220703 4.08984 -0.300781 6.15039l19.5205 0.139648c1.28027 -89.9697 -23.71 -147.2 -45.1406 -179.66z" />
|
2741 |
+
<glyph glyph-name="mailchimp" unicode=""
|
2742 |
+
d="M330.61 204.48c-2.50977 3.17969 -4.70996 8.31934 -5.9707 14.3193c-2.22949 10.6807 -1.98926 18.4102 4.24023 19.4199c6.23047 1.01074 9.25 -5.45996 11.4805 -16.1299c1.5 -7.17969 1.20996 -13.7803 -0.450195 -17.6094
|
2743 |
+
c-1.27832 0.165039 -3.36133 0.299805 -4.65039 0.299805c-1.28809 0 -3.37207 -0.134766 -4.64941 -0.299805zM277.05 196c-4.45996 1.95996 -10.2598 4.13965 -17.2598 3.7002c-12.5996 -0.770508 -21.75 -7.21973 -22.5996 -3.48047
|
2744 |
+
c-0.400391 1.83984 2.40918 4.87988 5.40918 7.06055c4.5791 3.35254 12.9014 6.07422 18.5762 6.07422c3.45312 0 8.84473 -1.07324 12.0342 -2.39453c8.63965 -3.7002 14.0098 -11.1504 12.1201 -13.0898c-1.08008 -1.12988 -3.81055 0.129883 -8.28027 2.12988z
|
2745 |
+
M268.05 190.87c9.68066 1.14941 16.8604 -4.62988 15.4004 -6.85059c-0.629883 -1.00977 -2.02051 -0.829102 -4.94043 -0.489258c-1.55078 0.239258 -4.08301 0.433594 -5.65234 0.433594c-3.72656 0 -9.58105 -1.06738 -13.0674 -2.38379
|
2746 |
+
c-4.04004 -1.62012 -4.30957 -1.15039 -5.20996 -0.810547c-1.53027 3.57031 4.40039 8.68066 13.4697 10.1006zM322.22 173.77c-3.40039 -6.91016 -17.7002 0.0703125 -14.2998 7c3.40039 6.93066 17.6797 -0.129883 14.2998 -7zM337.88 194.24
|
2747 |
+
c7.69922 -0.149414 7.42969 -16.0605 -0.259766 -15.9307c-7.69043 0.130859 -7.40039 16.0605 0.259766 15.9307zM119.09 115.34c4.0293 0.910156 3.40039 -1.25 3.37012 -0.359375c0.256836 -0.317383 0.46582 -0.904297 0.46582 -1.3125
|
2748 |
+
c0 -0.299805 -0.119141 -0.755859 -0.265625 -1.01758c-3.16016 -7.37012 -20.1904 -7.68066 -21.5801 9c-0.910156 10.8594 9.30957 21.0293 -2.28027 28.6191c-1.77734 1.17773 -4.95117 2.13281 -7.08301 2.13281c-3.84961 0 -8.67285 -2.62207 -10.7666 -5.85254
|
2749 |
+
c-3.2998 -5.16016 -3.11035 -12.2002 -7.37988 -11.6299c-3.7207 0.540039 -3.70996 14.4805 5 24.0801c7.22949 8 25.9492 11.9297 35.0498 -5.54004c8.11035 -15.3896 -8.2002 -27.7695 -3 -35.7695c2.46973 -3.80078 7.14941 -2.66016 8.46973 -2.35059zM418.81 132.41
|
2750 |
+
c6.44043 0 16.5605 -7.5 16.5605 -25.2705c0 -17.7695 -7.37012 -37.9092 -9.11035 -42.3799c-54.3896 -130.279 -264.56 -130.06 -322.29 3c-31.5293 -0.0400391 -64.1699 26.9805 -67.5293 60.3799c-0.256836 2.25195 -0.463867 5.91992 -0.463867 8.18652
|
2751 |
+
c0 7.21289 2.04395 18.5537 4.56348 25.3135l-14.7598 12.5107c-67.5498 57.04 143.72 291.85 211.27 232.93c0.339844 -0.299805 22.9902 -22.5205 23.0498 -22.5703l12.5508 5.33008c59.2695 24.5303 107.359 12.6904 107.42 -26.4697
|
2752 |
+
c0.0292969 -20.3604 -12.9404 -44.1006 -33.7305 -65.6504c26.1699 -24.2998 20.0205 -71.6094 21.5205 -83c7.19922 -2 30.6992 -7.62012 41.0996 -18.54c18.3604 -19.25 5.52051 -39.5801 3.07031 -43.25c4.20996 -11.2998 3.42969 -8.79004 6.7793 -20.5195z
|
2753 |
+
M102.81 84.25c29.4502 -0.680664 38.6309 28.2002 34.0908 57.8398c-9.74023 62.9404 -90.1699 48.9805 -84 -12.3301c2.44922 -24.3594 27.0898 -44.8994 49.9092 -45.5098zM84.2998 198.45c19.3105 51.8096 51.54 99.5498 94.2002 132.399
|
2754 |
+
c31.6504 26.4102 65.7998 45.3506 65.7998 45.3506s-18.3896 21.3193 -23.9395 22.8896c-34.1699 9.23047 -107.94 -41.6494 -155.051 -108.88c-19.0596 -27.21 -46.3096 -75.3604 -33.2998 -100.21c1.58984 -3 10.71 -10.9297 15.5898 -15
|
2755 |
+
c8.18066 11.9102 21.54 20.5 36.7002 23.4502zM323.18 97.2998c2.58984 0.259766 0.560547 -2.53027 0.560547 -2.53027s-27.4004 -12.75 -71 0.740234c1.20996 -10.2295 11.1699 -14.8193 15.9395 -16.6699c31.4004 -12.21 86.6904 -2.58008 128.46 26
|
2756 |
+
c0.850586 0.589844 1.41992 0 0.730469 -1c-28.9697 -41.3496 -128.73 -54.7598 -151.37 -21.3496c-12.0801 17.8301 -0.599609 43.8594 19.5498 41.1494c6.7998 -0.769531 53.7705 -8 100.48 13.6807c27.4893 12.7598 37.8701 26.79 36.3096 38.1602
|
2757 |
+
c-0.447266 3.00293 -2.57031 7.16504 -4.74023 9.28906c-5 4.83008 -12.79 8.60059 -26 12.3105c-4.35938 1.22949 -7.31934 2.00977 -10.5098 3.05957c-5.67969 1.83008 -8.47949 3.33008 -9.10938 14c-0.280273 4.62988 -1.09082 20.9102 -1.38086 27.6299
|
2758 |
+
c-0.519531 11.7607 -1.91992 27.8506 -11.9199 34.4902c-2.37305 1.51953 -6.58691 2.75195 -9.40527 2.75195c-1.1748 0 -3.05371 -0.229492 -4.19434 -0.511719c-5.69043 -0.969727 -9.06055 -4.00977 -13.2598 -7.50977
|
2759 |
+
c-12.4404 -10.3701 -22.9502 -12.0605 -34.6406 -11.5605c-6.98926 0.290039 -14.3994 1.37988 -22.8799 1.87988l-5 0.290039c-19.5801 1 -40.5693 -15.9092 -44.0693 -39.9092c-4.86035 -33.4307 19.3291 -50.7002 26.3291 -60.8301
|
2760 |
+
c0.912109 -1.0918 1.77246 -3.12598 1.9209 -4.54004c0 -1.94043 -1.25 -3.48047 -2.48047 -4.79004c-19.9805 -20.54 -26.3701 -53.1699 -18.8398 -80.3701c0.768555 -2.76562 2.35938 -7.12891 3.5498 -9.74023c17.7002 -41.2598 72.4902 -60.4795 126 -43
|
2761 |
+
c5.81152 1.89844 14.9238 5.74219 20.3398 8.58008c9.78906 4.8418 23.7441 15.2852 31.1504 23.3096c14.2002 14.8408 22.6396 30.9707 25.9297 50.8408c2.81055 18.6191 -7.78027 18.7598 -11.4395 18.0996c-1.13477 6.94531 -4.32422 17.8223 -7.12012 24.2803
|
2762 |
+
c-15.6299 -12.3506 -35.71 -20.9707 -51 -25.3506c-69.4004 -19.9102 -90.1904 6.35059 -96.4004 -13.8096c33.7705 -12.3701 69.5098 -7.07031 69.5098 -7.07031zM171.31 290.5l0.0605469 0.00976562c-0.0947266 -0.115234 -0.171875 -0.331055 -0.171875 -0.481445
|
2763 |
+
c0 -0.418945 0.34082 -0.759766 0.759766 -0.759766c0.124023 0 0.308594 0.0546875 0.412109 0.121094c11.4199 8.30078 64.9502 42.7705 134.5 26.8301c0.860352 -0.189453 1.39941 1.29004 0.639648 1.7207c-11.3398 6.33984 -28.6895 10.6494 -41 10.7393
|
2764 |
+
c-0.404297 0.00976562 -0.732422 0.345703 -0.732422 0.75c0 0.134766 0.0634766 0.332031 0.142578 0.44043c1.84668 2.41602 5.30078 5.88379 7.70996 7.74023c0.166992 0.126953 0.302734 0.401367 0.302734 0.611328c0 0.424805 -0.344727 0.770508 -0.770508 0.770508
|
2765 |
+
c-0.0146484 0 -0.0380859 -0.000976562 -0.0517578 -0.00195312c-17.5205 -1.08008 -37.5107 -9.4707 -49 -17.2998c-0.107422 -0.0751953 -0.300781 -0.136719 -0.431641 -0.136719c-0.414062 0 -0.75 0.335938 -0.75 0.75
|
2766 |
+
c0 0.0498047 0.00976562 0.12793 0.0214844 0.176758c0.899414 4.30957 3.72949 9.98926 5.18945 12.6494c0.0566406 0.0947266 0.102539 0.261719 0.102539 0.37207c0 0.402344 -0.327148 0.729492 -0.730469 0.729492
|
2767 |
+
c-0.110352 0 -0.276367 -0.0449219 -0.37207 -0.101562c-18.4697 -9.4502 -39.0898 -26.2803 -55.8301 -45.6299z" />
|
2768 |
+
<glyph glyph-name="megaport" unicode="" horiz-adv-x="496"
|
2769 |
+
d="M214.5 238.4l33.4004 33.3994l33.3994 -33.3994v-66.4004l-33.2998 -33.2998l-33.5 33.5v66.2002zM248 440c137 0 248 -111 248 -248s-111 -248 -248 -248s-248 111 -248 248s111 248 248 248zM393.1 25.5996h0.100586v87.1006l-59.7002 59.7002v87.5996l-59.5 59.5
|
2770 |
+
v75.5996l-26.0996 19.2002l-26.1006 -19.2002v-75.5996l-59.5 -59.5v-87.9004l-59.5 -59.5v-87l26.1006 -19.1992l26.0996 19.1992v65.5l33.5 33.4004l33.4004 -33.4004v-65.5l26.0996 -19.1992l26.2002 19.1992v65.5l33.3994 33.4004l33.4004 -33.4004v-65.5l26 -19.1992z
|
2771 |
+
" />
|
2772 |
+
<glyph glyph-name="nimblr" unicode="" horiz-adv-x="384"
|
2773 |
+
d="M246.6 148.71c15.5703 0 27.1504 -11.46 27.1504 -27s-11.6201 -27 -27.1504 -27c-15.6992 0 -27.1494 11.5703 -27.1494 27s11.5498 27 27.1494 27zM113 121.75c0 15.6104 11.6797 27 27.1504 27c15.4697 0 27.1494 -11.46 27.1494 -27s-11.4697 -27 -27.1494 -27
|
2774 |
+
c-15.4404 0 -27.1504 11.3096 -27.1504 27zM191.76 289c98.3701 0 177.76 -78.9102 177.76 -176.48c0 -97.5693 -79.6094 -176.52 -177.76 -176.52c-98.1494 0 -177.76 78.8701 -177.76 176.52v335.48l45.25 -227c30.2002 48.2305 97.75 68 132.51 68zM191.76 -19.1201
|
2775 |
+
c73.2402 0 132.51 58.96 132.51 131.64c0 72.6807 -59.2393 131.54 -132.51 131.54c-73.2695 0 -132.51 -58.8994 -132.51 -131.59c0 -72.6895 59.2402 -131.59 132.51 -131.59z" />
|
2776 |
+
<glyph glyph-name="rev" unicode=""
|
2777 |
+
d="M289.67 173.11c0 -36.1943 -29.375 -65.5801 -65.5703 -65.5801c-36.1943 0 -65.5693 29.375 -65.5693 65.5693c0 36.1953 29.375 65.5703 65.5693 65.5703h0.0107422c36.1445 -0.0439453 65.5156 -29.415 65.5596 -65.5596zM429.22 178.16v-210.16h-210.16v0.110352
|
2778 |
+
c-110.939 2.70996 -200.06 93.4092 -200.06 205c0 108.569 84.2998 197.319 191 204.569v38.3203l108.77 -62.7803l-108.77 -62.79v39.1201c-80 -7.16016 -143 -74.5498 -143 -156.43c0 -86.6201 70.4902 -157.12 157.11 -157.12s157.09 70.5 157.09 157.12
|
2779 |
+
c-0.0224609 47.1709 -32.1934 106.235 -71.8105 131.84l45.3799 26.2002c39.8018 -32.8584 73.0977 -101.402 74.3203 -153h0.129883z" />
|
2780 |
+
<glyph glyph-name="shopware" unicode="" horiz-adv-x="512"
|
2781 |
+
d="M403.5 -7.41016c-36.0898 -26.8223 -101.875 -48.5908 -146.841 -48.5908c-0.181641 0 -0.477539 0.000976562 -0.65918 0.000976562c-137.19 0 -248 111 -248 248c0 137.19 111 248 248 248h0.211914c52.3994 0 126.538 -28.4482 165.488 -63.5
|
2782 |
+
c0.643555 -0.585938 1.16602 -1.76855 1.16602 -2.63965c0 -1.9707 -1.59961 -3.56934 -3.57031 -3.56934c-0.125977 0 -0.330078 0.0126953 -0.456055 0.0292969c-15.2227 2.03223 -40.042 3.68164 -55.4004 3.68164
|
2783 |
+
c-0.361328 0 -0.948242 -0.000976562 -1.30957 -0.00195312c-129.36 0 -222.399 -53.4697 -222.399 -155.35c0 -109 92.1299 -145.881 176.829 -178.73c33.6406 -13 65.4004 -25.3604 87 -41.5898c0.788086 -0.592773 1.42676 -1.87402 1.42676 -2.86035
|
2784 |
+
c0 -0.985352 -0.638672 -2.2666 -1.42676 -2.85938zM503 214.91c0.578125 -6.2832 1.04688 -16.5039 1.04688 -22.8135c0 -25.8613 -7.62793 -66.4043 -17.0273 -90.4971c-0.495117 -1.2373 -1.98047 -2.24316 -3.31348 -2.24316
|
2785 |
+
c-0.495117 0 -1.25 0.19043 -1.68652 0.423828c-29.4893 16.3594 -61.6094 28.3398 -92.6797 39.9297c-60.2803 22.4902 -112.34 41.8896 -112.34 84.4902c0 1.45996 -3.87988 53.6299 80.25 53.6299c50.8604 0 92.7197 -17.4805 144.48 -60.4805
|
2786 |
+
c0.625 -0.530273 1.19336 -1.62305 1.26953 -2.43945z" />
|
2787 |
+
<glyph glyph-name="squarespace" unicode="" horiz-adv-x="512"
|
2788 |
+
d="M186.12 104.66l157.22 157.2c38.5703 38.5898 101.13 38.5898 139.72 0c38.5908 -38.5801 38.5908 -101.13 0 -139.721l-119.25 -119.239l-0.0400391 -0.0400391c-19.2891 -19.2705 -50.5498 -19.25 -69.8193 0.0400391l154.149 154.14
|
2789 |
+
c19.29 19.29 19.29 50.5703 0 69.8604s-50.5693 19.29 -69.8594 0l-157.181 -157.181c-9.64941 -9.64941 -25.29 -9.64941 -34.9395 0c-9.65039 9.65039 -9.65039 25.29 0 34.9404zM430.65 209.46c9.63965 -9.63965 9.63965 -25.2803 -0.0107422 -34.9297l-157.199 -157.2
|
2790 |
+
c-38.5801 -38.5703 -101.141 -38.5703 -139.721 0l-0.0195312 0.0195312c-9.64062 9.65039 -9.62988 25.29 0.0195312 34.9307l0.0107422 0.00976562c9.64941 9.63965 25.2793 9.62988 34.9199 -0.00976562l0.0498047 -0.0498047
|
2791 |
+
c19.29 -19.2607 50.5498 -19.2402 69.8193 0.0498047l157.2 157.18c9.64062 9.65039 25.2803 9.65039 34.9307 0zM168.66 122.13c-38.6006 -38.5801 -101.13 -38.5801 -139.73 0.00976562c-38.5801 38.5801 -38.5801 101.13 0 139.721l119.23 119.25l0.0195312 0.0195312
|
2792 |
+
c19.3008 19.2803 50.5703 19.2705 69.8506 -0.0195312l-154.17 -154.17l-0.0302734 -0.0302734c-19.2803 -19.2998 -19.2598 -50.5605 0.0302734 -69.8398l0.00976562 -0.0107422c19.29 -19.29 50.5703 -19.2793 69.8496 0.0107422l157.21 157.18
|
2793 |
+
c9.64062 9.63965 25.2705 9.63965 34.9102 0c9.64062 -9.65039 9.64062 -25.29 0 -34.9404zM81.3301 174.53c-9.64062 9.64941 -9.65039 25.29 0 34.9297l157.189 157.19c38.5908 38.5898 101.131 38.5898 139.721 0c9.64941 -9.64062 9.64941 -25.2803 0 -34.9307
|
2794 |
+
c-9.64062 -9.64941 -25.2803 -9.64941 -34.9307 0l-0.0195312 0.0205078c-19.29 19.2793 -50.5596 19.2695 -69.8398 -0.0205078l-157.21 -157.189c-9.64062 -9.64062 -25.2705 -9.64062 -34.9102 0z" />
|
2795 |
+
<glyph glyph-name="themeco" unicode=""
|
2796 |
+
d="M202.9 439.57c9.89941 5.72949 26 5.81934 35.9492 0.209961l191.15 -107.63c10 -5.60059 18 -19.4404 18 -30.8604v-217.29c0 -11.4404 -8.05957 -25.29 -18 -31l-191.19 -108.74c-9.92969 -5.66016 -26 -5.56934 -35.8496 0.209961l-185.1 108.41
|
2797 |
+
c-9.86035 5.78027 -17.8604 19.7402 -17.8604 31.1201v217.29c0 11.4404 8 25.3604 17.9102 31.0801zM125.5 239.74c-15.9404 0 -31.8896 -0.140625 -47.8301 -0.140625v-101.449h19.1299v29.8496h28.7002c49.71 0 49.5596 71.7402 0 71.7402zM265.64 139.45
|
2798 |
+
l-30.7295 34.6396c37 7.50977 34.7998 65.2305 -10.8701 65.5098c-16.0898 0 -32.1699 0.140625 -48.2598 0.140625v-101.59h19.1299v33.9092h18.4102l29.5596 -33.9092h22.7598v1.2998zM224.05 221.77c23.3398 0 23.2598 -32.46 0 -32.46h-29.1299v32.46h29.1299z
|
2799 |
+
M128.49 223.37c21.1797 0 21.1094 -38.8506 0 -38.8506h-32.3105v38.8408zM321.14 241.62c-68.46 0 -71 -105.8 0 -105.8c69.4805 0.00976562 69.4102 105.8 0 105.8zM321.14 224.23c44.1201 0 44.8008 -70.8604 0 -70.8604c-44.7998 0 -44.4297 70.8604 0 70.8604z" />
|
2800 |
+
<glyph glyph-name="weebly" unicode="" horiz-adv-x="512"
|
2801 |
+
d="M425.09 382.17c50.9102 0 87.5498 -35.1504 86.9199 -83.4697c0 -21.6201 -0.950195 -18.5498 -77.5 -227.2c-22.3799 -60.5703 -67.7695 -69.6699 -92.7402 -69.6699c-39.2393 0 -70.0391 19.46 -85.9297 54.29c-15.8896 -34.5205 -46.7002 -53.9805 -85.9297 -53.9805
|
2802 |
+
c-24.9697 0 -70.3701 8.78027 -92.7402 69.3506c-72.9902 200.21 -77.1699 204.52 -77.1699 233.479c0 43.3105 38.5898 77.2002 87.54 77.2002c40.21 0 73.2803 -25.7295 83.6602 -64.3301c18.4795 58.0498 65.5 64.3301 85.2803 64.3301
|
2803 |
+
c19.4492 0 66.7891 -6.26953 84.9492 -64.3301c10.3799 38.6006 43.7803 64.3301 83.6602 64.3301zM451.43 267.36c3.49023 11.1992 7.29004 19.3701 7.61035 27.2393c0 22.3906 -16.1602 35.71 -38.3301 35.71c-18.6904 0 -31.9902 -11.7998 -36.1104 -29.0498
|
2804 |
+
l-44.0293 -139.819h-0.950195l-44.6602 136.79c-6.01953 19.9697 -16.4697 32.0791 -38.96 32.0791s-32.9404 -12.4092 -38.96 -32.0791l-44.6602 -136.79h-0.950195l-44.0293 139.819c-4.12012 17.25 -17.4199 29.0498 -36.1104 29.0498
|
2805 |
+
c-22.4902 0 -38.3301 -13.0195 -38.3301 -29.3594c0 -10.5898 2.54004 -19.6699 7.91992 -34.5l64.9404 -175.23c7.91016 -21.4795 21.2197 -37.2197 46.2393 -37.2197c23.1201 0 37.0605 12.0996 44.0205 33.5996l39.2803 117.42h0.949219l39.2803 -117.42
|
2806 |
+
c6.65039 -21.4893 20.5898 -33.8994 44.0303 -33.8994c25.0195 0 38.3203 15.7295 46.2402 37.2197z" />
|
2807 |
+
<glyph glyph-name="wix" unicode="" horiz-adv-x="640"
|
2808 |
+
d="M393.38 316.31c0 -13.0293 2.08008 -32.6895 -28.6797 -43.8291c-9.52051 -3.4502 -15.9502 -9.66016 -15.9502 -9.66016c0 31 4.71973 42.2197 17.4004 48.8594c9.75 5.11035 27.2295 4.62988 27.2295 4.62988zM277.58 280.77
|
2809 |
+
c5.47949 26.3408 30.8799 38.3408 55.2998 35.2705l-65.5703 -247.93s-21.6396 -1.56055 -32.46 3.95996c-14.2197 7.25 -20.9893 12.8398 -29.5898 46.5693c-7.66992 30.0703 -29.1494 118.4 -31.1201 124.7c-4.30957 13.8105 -10.6396 14.9404 -15.3994 0
|
2810 |
+
c-2.00977 -6.29004 -23.4502 -94.6299 -31.1201 -124.7c-8.61035 -33.7295 -15.3701 -39.3193 -29.5898 -46.5693c-10.8301 -5.52051 -32.46 -3.95996 -32.46 -3.95996l-65.5703 247.93c23.8604 3 49.7305 -8.5498 55.2803 -35.2705l34.2393 -132.659l28.4805 108.569
|
2811 |
+
c7.76953 32.3506 21.0596 48.5303 48.4297 48.5303c27.6201 0 40.7402 -16.54 48.4307 -48.5303l28.4795 -108.569zM393.36 275.56v-8.97949l0.0195312 0.00976562v-150.27c-0.129883 -30.8301 -3.33008 -37.6807 -17.2598 -44.7803
|
2812 |
+
c-10.8203 -5.52051 -27.3701 -3.42969 -27.3701 -3.42969v152.069c0 21.25 -1.95996 27.9404 13.1797 35.2002c6.19043 2.96973 11.96 5.25 17.9707 8.61035c9.35938 5.22949 13.46 11.5693 13.46 11.5693zM556.8 191.48l82.9902 -123.36s-35.9297 -4.62012 -53.3203 11.21
|
2813 |
+
c-13.9102 12.6602 -23.7393 28.3398 -53.1396 70.7197c-0.5 0.770508 -6.25977 10.5205 -13.0703 0c-34.9297 -50.3496 -41.0195 -60.2598 -52.5098 -70.7197c-17.3799 -15.8301 -53.9502 -11.21 -53.9502 -11.21l82.9697 123.36l-83.1992 123.739
|
2814 |
+
s35.1094 5.98047 52.5 -9.84961c13.3799 -12.1797 24.8896 -30.2402 54.1797 -72.4697c6.82031 -10.54 12.5996 -0.730469 13.0703 0c29.7695 42.9199 40.8799 60.3691 54.1797 72.4697c17.3896 15.8301 52.5 9.84961 52.5 9.84961z" />
|
2815 |
+
<glyph glyph-name="ello" unicode="" horiz-adv-x="496"
|
2816 |
+
d="M248 440c136.97 0 248 -111.03 248 -248s-111.03 -248 -248 -248s-248 111.03 -248 248s111.03 248 248 248zM391.84 154.8c2.48047 7.44043 -2.47949 15.71 -9.91992 17.3604c-7.43945 2.47949 -15.71 -2.48047 -17.3604 -9.91992
|
2817 |
+
c-14.0498 -52.9102 -62 -90.1104 -116.56 -90.1104s-102.51 37.2002 -116.56 90.1104c-1.65039 7.43945 -9.9209 11.5693 -17.3604 9.91992c-7.44043 -1.65039 -11.5703 -9.91992 -9.91992 -17.3604c16.5303 -65.3096 76.0498 -111.6 143.84 -111.6
|
2818 |
+
s127.31 46.29 143.84 111.6z" />
|
2819 |
+
<glyph glyph-name="hackerrank" unicode="" horiz-adv-x="512"
|
2820 |
+
d="M477.5 320c14.5 -25 14.4805 -230.92 -0.00976562 -256s-192.391 -128 -221.33 -128c-28.9404 0 -206.83 102.8 -221.32 128s-14.4102 230.79 0 256s192.351 128 221.32 128s206.84 -103.05 221.34 -128zM316.13 33.7803c3.95996 0 40.4404 35.7793 37.5605 38.6895
|
2821 |
+
c-0.870117 0.839844 -8.82031 1.49023 -17.6904 1.83984c0 32.4004 -3 19.0508 0.679688 210.341c0.0703125 3.65918 -1.04004 5.37988 -4.5 5.37988c-11.0801 0.0693359 -22.1602 0.0195312 -33.2295 -0.0605469c-3.25977 -0.0292969 -4.31055 -1.80957 -4.20996 -5.2002
|
2822 |
+
c1.58984 -48.8994 1.2002 -79.0898 1.2002 -83.6396h-80.2607c0.629883 25.7998 0.209961 79.6396 2.62988 105.39v3.16016c8.87012 0.350586 15.9004 0.970703 16.7705 1.83984c2.90039 2.91016 -34.3203 38.6904 -38.2705 38.6904
|
2823 |
+
c-3.94922 0 -41.4092 -35.7695 -38.4893 -38.6904c0.879883 -0.839844 7.58984 -1.48926 17.2598 -1.83984v-3.16992c3.15039 -128.67 1.07031 -179.229 0.150391 -212.67c-0.130859 -4.58008 1.63965 -6.10938 5.73926 -6.10938
|
2824 |
+
c10.1406 0.0292969 20.2803 -0.0800781 30.4102 -0.0800781c4.16016 -0.0605469 5.96973 1.39941 5.74023 5.93945c-1.83008 36.6797 -1.37012 65.7803 -1.37012 72.8799h79.9297c0 -2.41992 0.44043 -3.84961 0.44043 -5.84961
|
2825 |
+
c-0.350586 -17.7305 -0.94043 -60.0898 -0.94043 -86.3203c-11.29 -0.349609 -16.6797 -0.959961 -17.5498 -1.83008c-2.91016 -2.91992 34 -38.6895 38 -38.6895z" />
|
2826 |
+
<glyph glyph-name="kaggle" unicode="" horiz-adv-x="320"
|
2827 |
+
d="M304.2 -53.5l1.39941 -7.59961c-0.5 -2 -2.5 -3 -6 -3h-66.8994c-4 0 -7.5 1.7998 -10.5 5.2998l-110.5 140.6l-30.7998 -29.2998v-109c0 -5 -2.5 -7.5 -7.5 -7.5h-51.9004c-5 0 -7.5 2.5 -7.5 7.5v497c0 5 2.5 7.5 7.5 7.5h51.9004c5 0 7.5 -2.5 7.5 -7.5v-306
|
2828 |
+
l132.3 133.7c3.5 3.5 7 5.2998 10.5 5.2998h69.2002c7 0 7.89941 -7.7998 5.2998 -10.5l-139.8 -135.3z" />
|
2829 |
+
<glyph glyph-name="markdown" unicode="" horiz-adv-x="640"
|
2830 |
+
d="M593.8 388.9c25.5 0 46.2002 -20.7002 46.2002 -46.1006v-301.6c0.0996094 -25.4004 -20.5996 -46.1006 -46.0996 -46.1006h-547.7c-25.5 0 -46.2002 20.7002 -46.2002 46.2002v301.5c0 25.4004 20.7002 46.1006 46.2002 46.1006h547.6zM338.5 87.4004h-0.200195v209.199
|
2831 |
+
h-61.5l-61.5 -76.8994l-61.5 76.8994h-61.5v-209.199h61.7002v120l61.5 -76.9004l61.5 76.9004v-120h61.5zM473.8 84.2998l92.2002 107.7h-61.5v104.6h-61.5v-104.6h-61.5z" />
|
2832 |
+
<glyph glyph-name="neos" unicode="" horiz-adv-x="512"
|
2833 |
+
d="M415.44 -64h-95.1104l-108.21 154.54v-91.0996l-86.4297 -63.4404h-97.6904v482.18l40.4697 29.8203h108.05l123.74 -176.13v112.68l86.4307 63.4502h97.6895v-461.5zM38.7695 412.73v-460.73l72 52.8799v249.12l215.5 -307.64h84.79l52.3506 38.1699h-78.2705
|
2834 |
+
l-316.14 450.47zM121.31 -53.8799l80 58.7803v101l-79.7598 114.399v-220.939l-72.5498 -53.25h72.3398zM80.6299 437.23l310.601 -442.57h82.3691v442.57h-79.75v-317.561l-222.939 317.561h-90.2803zM311 256.35l72 -102.81v278.53l-72 -53v-122.721z" />
|
2835 |
+
<glyph glyph-name="zhihu" unicode="" horiz-adv-x="640"
|
2836 |
+
d="M170.54 299.87h122.68v-217.55h-49.5293l-42.0107 -26.3701l-7.70996 26.3701l-23.4297 0.00976562v217.54zM268.29 105.94v170.31h-72.8203v-170.31l11.9004 -0.0400391l5.08008 -17.4707l27.8994 17.5107h27.9404zM149.83 200.33
|
2837 |
+
c7.5 0 7.58984 -23.6104 7.58984 -23.6104h-61.6504c-0.879883 -13.1201 -3.50977 -26.6895 -7.86914 -40.6699l14.6191 11.6201c8.73047 -8.75 29.2109 -32.8896 36.79 -41.8096c9.15039 -13.1006 1.24023 -39.9902 1.24023 -39.9902l-53.96 64.9395
|
2838 |
+
c-12.6094 -48.3496 -35.5898 -69.25 -35.5898 -69.25c-10.0898 -8.96973 -30.5098 -15.75 -51 -9.89941c42.8301 33.2197 66.4502 75.2402 70.8496 125.1h-65.5801s3.82031 23.6201 15.5605 23.6201h52.2695c0.480469 6.56055 1.68066 62.9404 1.68066 73.4404h-28.8701
|
2839 |
+
c-2.62988 -7.87012 -3.03027 -8.64062 -5.14062 -14.5303c-11.4697 -21.0303 -30.9492 -21.5703 -36.8398 -22.21c17.4902 34.9795 27.3105 69.2197 30.7002 78.1201c8.2002 21.5693 32.2705 21.5693 32.2705 21.5693c-5.25 -14.0098 -9.63086 -27.5498 -13.1201 -40.6699
|
2840 |
+
h88.5c10.5498 0.25 8.58008 -22.3096 8.58008 -22.3096h-51.1602c0 -21.8701 -0.459961 -46.3604 -2.2002 -73.46h52.3301zM561.85 201.93l-19.2295 14.4307s30.8301 40.0498 36.8301 48.1992c8.72949 10.7402 27.3799 -4.05957 27.3799 -4.05957
|
2841 |
+
s-24.1504 -32.9297 -44.9805 -58.5703zM411.76 261.02l0.00976562 0.0107422c8.99023 -8.25 34.6602 -45.8604 34.6602 -45.8604l-19.46 -13.7295c-1.59961 2.40918 -41.1201 57.4492 -41.1201 57.4492s16.9004 10.3799 25.9102 2.12988zM640 189.65
|
2842 |
+
c0 0 0.950195 -23.79 -8.73047 -23.79h-122.359v-73.3203c0.780273 -28.0303 -15.3301 -45.3096 -44.8906 -45.3096c-9.84961 0 -16.1396 1.75977 -26.0195 6.56934c-12.9805 7.4502 -17.3203 17.8701 -19.3096 21.8398c15.6094 -0.65918 27.6094 -1.91992 41.6895 -1.80957
|
2843 |
+
c13.29 -0.870117 24.4805 7.15039 24.4805 21.1201v70.9199h-107.94c-22.6895 0.540039 -25.5098 22.8496 -25.5098 22.8496h133.47v99.8105c-12.8301 0 -31.6797 -0.830078 -56.5098 -2.43066c-26.46 -0.80957 -35.8398 -2.58984 -49.1504 0.890625
|
2844 |
+
c-8.16016 2.46973 -14.1797 10.7295 -15.7793 19.5498c67.1396 1.55957 232.359 18.0498 232.359 18.0498s20.1006 5.75977 23.1699 4.58008c12.8105 -6.25 0.589844 -33.4395 0.589844 -33.4395c-17.6396 -0.810547 -46.8896 -2.40039 -87.7695 -4.81055
|
2845 |
+
c-10.4297 -0.799805 -18.04 -1.2002 -22.8496 -1.2002v-101c0.149414 0 111.279 0.930664 131.06 0.930664z" />
|
2846 |
+
<glyph glyph-name="alipay" unicode=""
|
2847 |
+
d="M377.74 416c38.6895 0 70.0898 -31.5703 69.9297 -70.2598v-234.41c-48.6104 16.7002 -99.6895 36.04 -148.62 52.7402c23.1406 44.2998 38.3506 90.9199 38.3506 90.9199h-88.7705v31.2402h109.45v19.0098h-109.44v50.4199h-50.9199v-50.4199h-109.439v-19.0098h109.439
|
2848 |
+
v-31.2402h-92.0801v-16.7002h178.2s-9.91992 -30.25 -26.4502 -60.3398c-47.7793 14.71 -91.75 24.96 -127.13 24.96c-84.6396 0 -103.49 -42.4902 -99.5195 -81.5c3.30957 -31.0703 26.4502 -76.3701 97.04 -76.3701c64.4795 0 116.55 37.0303 148.62 81
|
2849 |
+
c61.0098 -28.0996 125.64 -62.8203 171.6 -88.4404c-0.5 -38.5195 -31.7402 -69.5996 -70.2598 -69.5996h-307.48c-38.8496 0 -70.2598 31.4102 -70.2598 70.2598v307.48c0 38.8496 31.4102 70.2598 70.2598 70.2598h307.48zM47.2803 125.05
|
2850 |
+
c-0.990234 17.5205 10.9102 50.5801 78.3594 50.5801c24.96 0 64.8105 -12.7295 109.44 -31.4102c-25.29 -33.2197 -65.7998 -72.8994 -117.87 -72.8994c-59.6797 0 -68.9404 33.5596 -69.9297 53.7295z" />
|
2851 |
+
<glyph glyph-name="the-red-yeti" unicode="" horiz-adv-x="512"
|
2852 |
+
d="M488.23 206.3c2.49805 -3.35254 5.51465 -9.31152 6.76953 -13.2998c3.37793 -9.19922 7.36523 -24.5205 8.90039 -34.2002l-2.5 -0.5l-13 14.2998c-17.9004 -28.0996 -9.90039 -15.3994 -16.7002 -25.0996c0 -124.2 -101.3 -211.5 -223 -211.5
|
2853 |
+
c-61.5 0 -113.9 20.2002 -157.5 60.2002c-64.5 60.8994 -64.9004 125 -64.9004 150.5c-0.5 1.7998 -0.700195 3.5 -1.2002 5.2002l-20.1992 -22.4004c-6.80078 43 25.6992 74.2998 33 80.7002c0.5 1 0.699219 2.2002 1.19922 3.2002l-28.7998 1l-3 3.39941
|
2854 |
+
c8.5 3.5 25.2998 13.2998 40.2998 14.2998c6.30273 12.0684 18.7568 30.123 27.8008 40.3008c1.2998 6.39941 3.2998 14.1992 6.59961 25.7998l-7.59961 -4.7002l-1.7002 1.7002l1.7002 8.39941c8.87207 21.3857 29.7939 51.5811 46.6992 67.4004l-33 14.2998h3.7002
|
2855 |
+
c20.9004 4.90039 33.2002 3.2998 49.2002 0c-2.5 4.10059 -5.40039 10.5 -8.40039 18.9004c-1.16699 3.20996 -2.11426 8.58691 -2.11426 12.0029c0 3.81152 1.1709 9.76855 2.61426 13.2969c8.90039 -7.40039 14.3008 -24.5996 15.2002 -27
|
2856 |
+
c0.700195 3.59961 2.10059 21.2998 33.7002 45.5l1.83008 -0.5l-12 -44.2002c30 17.7002 63 21.9004 97.9004 11.7998c-12.7002 -12.1992 -24.3008 -28.8994 -42.5 -33c7.39941 -2.2998 28.6992 -9.69922 34.1992 -15.1992l-24.7998 7.09961
|
2857 |
+
c6.5 -6 19.6006 -16.4004 25.1006 -25.0996c19.418 -0.893555 50.0615 -6.85254 68.3994 -13.3008l-0.5 0.5c29.4004 14.7002 37.7002 27.3008 74.7998 3c0 -30.1992 -2.2998 -23.3994 3 -29.7998c6.41602 5.42383 17.75 12.8154 25.3008 16.5
|
2858 |
+
c13 6.40039 23.0996 4.7002 30.6992 -5.89941c11.8008 0 17.8008 -15.7002 18.4004 -27c14.7998 -2.90039 2.7002 -30.7002 2.5 -30.7002l-7.09961 -18.2002c7.7998 -7.7998 22.0996 -20.9004 31.6992 -44.7998zM398 336.8c-13.0996 8.90039 -22.7002 11.9004 -28.2998 8.5
|
2859 |
+
c8.09961 -7.2002 13 -14.2998 13.5 -20.7002c1.2002 -7.59961 -2.2002 -14.7998 -10.6006 -21.8994l-4.19922 -3.40039c3.60059 -5.90918 7.36328 -16.2578 8.39941 -23.0996h2.5c-2.09961 13.8994 -2.5 11 0.700195 14.7998c11 -6.40039 14.9004 -14.5 16 -19.9004
|
2860 |
+
c21.7998 10.1006 29.5 12.7002 54.7998 20.9004l-18.2002 -16c11.4004 0 25.6006 0.299805 46.5 -8.40039c7 24.3008 7.10059 20.7002 2.5 20.7002l-4.69922 -11.2998c-1.7002 10.5 -2.90039 18.9004 -3.40039 25.2998c-0.5 6.7002 -3.90039 9.60059 -9.2998 10.1006
|
2861 |
+
c-0.00976562 -0.384766 -0.0175781 -1.00781 -0.0175781 -1.3916c0 -3.87012 0.769531 -10.0566 1.71777 -13.8086l-1.7002 -5.90039c-2.90039 10.6006 -5.90039 20.2002 -9.2998 27.7998c-9.7002 17.7002 -30.2002 -9.19922 -43 -11.2998
|
2862 |
+
c3.72266 -0.207031 9.77051 -0.375977 13.5 -0.375977c3.72852 0 9.77637 0.168945 13.5 0.375977l-22.4004 -5.39941l3.40039 -4.7002c-5.5 0 -16.9004 -0.900391 -22.4004 17.2002zM358.4 346.9l-20.3008 -11.8008c11.3008 -7.59961 20.2002 -18.1992 27.8008 -31.1992
|
2863 |
+
c6.39941 2.89941 10.0996 5.09961 11.7998 7.59961c2.5 2.7998 2.5 4.7002 3 7.09961c0.599609 1.30078 0.799805 2.7002 -3.40039 11.1006c-7.5 11.7998 -16.2002 15.2998 -18.8994 17.2002zM91 304.9c-7.7998 -24.1006 -11.7002 -49.4004 -13.2002 -74.6006l13.2002 -5
|
2864 |
+
l1.2002 27c9.5 -16.3994 11.2002 -23.2998 12.2998 -28.7998c2.7998 2.09961 7.7002 7 22.5996 11.2998l1.2002 -1.7002l-7.59961 -10.5996c10.0996 3.5 19.5 3.5 28.2998 0.5l-10.5996 -8.40039c22.7998 -8.39941 26.5996 -7.59961 38.3994 -26.0996l-11.7998 1.2002
|
2865 |
+
c34.9297 -20.5 66 -47.9004 141.2 -63.2002c15.5996 24.0996 14 21.0996 14 22.9004l0.200195 0.199219l-0.200195 0.200195c-0.700195 1.90039 -14.1006 16.6006 -18.2002 20.7002c7.2998 -1.7998 6 -0.900391 10.7998 -3.7002
|
2866 |
+
c1.7002 -0.899414 -5.39941 5.40039 -21.8994 20.2002c16.5 -6.7002 27.5996 -15.5 33 -27.7998l1.69922 30.7002l-22.3994 17.6992l6.39941 5.90039c-7.2998 0 -31 3.7002 -49.1992 -16l-2.5 0.5c5.89844 12.1807 13.0664 32.7881 16 46
|
2867 |
+
c1.61914 7.72656 2.96289 20.4053 3 28.2998c0 19.5 -4.7002 38.4004 -13.5 56.6006c-6.40039 13.5 -16.5 25.2998 -30 35.3994c-5.4707 4.09961 -14.7441 10.1475 -20.7002 13.5c3 0.700195 1 1.2002 -5.40039 1.2002c-6.39941 0.200195 -13 0.700195 -19.3994 1.2002v-3
|
2868 |
+
c-8.67773 -1.375 -20.0127 -8.18457 -25.3008 -15.2002h-1.19922l-5.40039 -3.40039c-1.2002 2.90039 0 6.30078 4.2002 9.30078l10.5996 11.2998l-3.39941 -0.5l2 3.39941c-2.30078 0.200195 -4.2002 0.5 -6.2002 0.700195l-0.5 1.2002l2.5 1.7002
|
2869 |
+
c2.2002 -0.200195 4.59961 -0.5 7.09961 -0.700195c2.52539 1.3457 6.89746 2.43848 9.75879 2.43848c1.18359 0 3.08301 -0.196289 4.24121 -0.438477l2.5 -1.2002l0.200195 -0.5c6.50488 0.421875 16.9883 1.7207 23.4004 2.90039
|
2870 |
+
c20.6992 2.89941 36.6992 11.2998 48.5 24.7998l-21.1006 0.5c-25.7998 0.5 -49.3994 -5.40039 -71.2998 -18.9004l-2.5 2.5l0.5 4.7002l1.7002 7.10059c1.37695 7.08105 4.24414 18.415 6.39941 25.2998c-1.69922 -0.700195 -4.59961 -4.90039 -9.2998 -11.2998
|
2871 |
+
c-4.7002 -6.40039 -8.39941 -13 -10.0996 -19.4004c-0.905273 -4.24512 -3.54785 -10.6514 -5.90039 -14.2998l-13.5 29l8.40039 -35.7998l-0.5 -1.7002h-0.015625c-4.51953 0 -11.6807 1.12012 -15.9844 2.5c-3.40039 0.700195 -10.6006 1.2002 -20.9004 1.2002
|
2872 |
+
c0.5 0 -0.700195 0 -3.2002 -0.5c5.40039 -1.30078 13.5 -4.2002 24.8008 -8.40039l6.39941 1.2002c-4.2002 -3.40039 -10.8994 -10.1006 -20.2002 -19.4004c-9.39941 -8.89941 -20.1992 -26.0996 -32.5 -50.2002l4.2002 1.2002l10.1006 9.2998l-5.40039 -4.69922
|
2873 |
+
l13 12.2998l-2.5 -3.40039c-5.09961 -7.59961 -8.09961 -12.2998 -9.2998 -15.2002zM367.5 -25.0996c8.2998 40.2998 3.59961 55.1992 -0.700195 89.5c-35.5 -11.8008 -20.2998 -6 -32 -10.8008l10.5 -14.1992l-1.2002 -1.2002c-20.1992 6 -23.1992 10.7998 -27.7998 15
|
2874 |
+
c6 -22.2002 13.9004 -26.4004 29.5 -31.7002c-9.5 -9.59961 -25.3994 4 -34.3994 13l2.5 -23.5996l-4.2002 -3c-5 22.0996 -22 39.0996 -25.2998 39.0996c-44 -13 -79.1006 -5.7998 -113.9 10.5996c-1.59961 -0.399414 -70.5996 -18 -120.5 37.1006
|
2875 |
+
c13.7002 -35 32.2998 -63.7002 71.2998 -82.6006c-4.13574 8.56934 -13.4102 20.4863 -20.7002 26.6006c0 0 0.700195 3.7002 1.2002 10.0996c19.4004 -19.3994 50.7002 -39.5 93.2002 -60.2002c-59.5996 24.5 -59.9004 24.8008 -69.0996 29l16 -20.6992
|
2876 |
+
c-3 -1.30078 -6.7002 -0.5 -10.1006 1.19922c-10.3359 6.03809 -26.1943 17.1484 -35.3994 24.8008c1.89941 -2.2002 80.0996 -98.5 200.899 -74.3008c-43.0996 21.8008 -52.3994 52.4004 -66.5996 73.5l17.7002 -7.59961l-11.8008 23.0996
|
2877 |
+
c20.1006 -27.7998 28.6006 -35 38.4004 -44.2998l-30 16.5c12.5996 -27.0996 33.7002 -47 63.5 -58.7998c2.90039 1.5 9.09961 -1.09961 59 23.9004zM482.8 189.3l8.93066 -12.7998l-12.3008 32.5c10.9004 0 10 -0.0996094 21.2002 -3.40039
|
2878 |
+
c-6.72168 9.44824 -18.8184 23.7842 -27 32l-26.5996 23.1006l1.2002 3l23.5996 2.5c-9.00293 1.98535 -23.7871 3.86719 -33 4.2002l-17.7002 -0.5l-0.5 2.89941l14.7998 13l-41.7998 -20.2002l-12.2998 18.9004l3.40039 -16l-2.5 -1.2002l-5.90039 4.2002h-10.0996
|
2879 |
+
l5.39941 -4.2002v-2l-13.5 -27.7998c-10.0996 -31.2002 -21.8994 -67.9004 -35.3994 -109.7l1.19922 16l-1.19922 -3v-0.5c-6.40039 -16 -13.6006 -29.5 -21.2002 -39.5996l9.2998 21.8994l-46.7002 -20.1992c11.7998 13.5 23.6006 19.3994 34.9004 18.8994
|
2880 |
+
c-71.2002 11.4004 -106.2 41 -110.4 46c3.60059 -6.2002 13.2002 -17.7998 16 -40.0996l-1.7002 -1.2002c-4.2998 15.5996 -16.3994 46.5996 -55.7998 69.5996l23.6006 -2.5c-10.5 12.6006 -36.3008 17.8008 -40.8008 16l-2.5 2.5l8.40039 8.40039l-22.2998 -5.7998
|
2881 |
+
l5.39941 13.5c-8.09961 -4.40039 -4.2998 -2.40039 -17 -8.90039l-1.69922 0.5c0.599609 0.600586 0.899414 -0.700195 -3 9.2998c-0.600586 -11 -0.400391 -8.59961 -1 -11.7998c-1.07324 -0.355469 -2.73145 -1.11719 -3.7002 -1.7002c-40 20.6006 -57.2002 11 -73 5.2002
|
2882 |
+
c36.7998 -6 29.2998 -4 38.3994 -9.2998c-25.7998 -12.2002 -31.8994 -12.5996 -51.3994 -70.0996l22.2695 22.2998l2.5 -16.4004c13.4004 -58 68.7002 -92.5 126.4 -83.3994l-26.1006 22.3994l44.8008 -22.3994l-1.2002 -3c4.59961 -1.7002 9.2998 -3 13.5 -4.2002
|
2883 |
+
c16.4727 -4.87598 43.7852 -8.83203 60.9648 -8.83203c8.94727 0 23.3887 1.08887 32.2354 2.43164l-32.5 21.2002c35.7998 -7 50.6992 -31.4004 56.7998 -39.5996l-7.60059 29l1.2002 2.5l19 -27.9004l-9.2998 26.5996l21.9004 -13.5h1.19922l-3.39941 4.2002
|
2884 |
+
l7.09961 -4.7002l-14.2998 16l1.2002 3l7.59961 -7.09961c4.2998 1.2002 41.4004 10.5 80.9004 40.2998c47.8994 35.4004 68.0996 73.7998 71.5996 79.7002l-3 9.2998zM476.7 260.6l-18.2002 -1.19922l14.2998 -11.8008zM221.9 253.5
|
2885 |
+
c2.69922 -5.09961 5.69922 -12.4004 18.3994 -18.7998c-7.5 -10.9004 -8.2998 -10.5 -20.2002 -16c-7.59961 -7.7002 -13.5 -13.1006 -17.6992 -14.7998l7.09961 13c-4.61914 -1.69336 -12.3604 -3.06641 -17.2793 -3.06641c-2.08789 0 -5.45703 0.25293 -7.52051 0.566406
|
2886 |
+
l-0.5 1.19922c19 2.10059 37.2002 9.40039 46.5 16c-4.10059 4.2002 -7.10059 11.3008 -8.7998 21.9004zM225.6 355.8c4.92578 -2.78809 11.3486 -8.9707 14.3008 -13.7998c14.6992 -24.0996 19.1992 -40.0996 11.2998 -47.7002
|
2887 |
+
c-7.90039 -7.59961 -16.7998 -7.09961 -26.1006 3c-9.2998 10.1006 -13.5 23.7002 -11.7998 39.6006c1.7002 15.8994 5.90039 22.2998 12.2998 18.8994zM220.9 309.5c7.09961 -21.2998 33.3994 -23.0996 26.8994 4.90039c-3.89941 16.5 -8.7998 27.0996 -15.2002 32.5
|
2888 |
+
c-6.59961 5.39941 -10.0996 6.69922 -11.2998 4.19922c-2.5 -2.89941 -3.5 -11.2998 -3 -24.7998c7.5 12.7998 11.6006 5.90039 12.5 4.7002l-0.5 -0.5c-0.799805 -1.7002 -2.59961 -3.09961 1.7002 -6.2002l1.2002 0.5v-4.7002
|
2889 |
+
c-1.7998 -12.5 -6.90039 -12.7998 -12.2998 -10.5996zM175.9 315c-2.09375 0.388672 -4.49707 2.27051 -5.40039 4.2002c-3.5 8.5 0 21.2002 8.09961 21.2002c2 -0.5 3.7002 -1.7002 5.40039 -4.7002c-1.5 -0.400391 -4.7002 -4.7998 0.700195 -5.90039h0.5
|
2890 |
+
c0 -13.7002 -7.7002 -15.0996 -9.2998 -14.7998zM216 365.1l-3.7002 2.40039l-0.5 2.5c18.2998 0 25.7998 -8.7998 28.2998 -14.2998c-6.0459 3.29688 -16.542 5.97266 -23.4297 5.97266c-0.737305 0 -1.93359 -0.0322266 -2.66992 -0.0732422l-0.5 3zM144.2 315.7
|
2891 |
+
c1.59961 -1.60059 0.599609 -0.299805 4.89941 -6.60059c-25.3994 -4.69922 -23.1992 -12.2998 -30 -12.2998c0.300781 0.600586 7.10059 16 23.6006 16l-7.10059 7.60059c9.40039 0.5 15.2002 2.09961 19.9004 -5.90039c0.0175781 6.60938 1.31641 17.1826 2.90039 23.5996
|
2892 |
+
c2 7.60059 3.69922 11.8008 5.39941 13.5c1 1.5 16.2998 15.7002 29 22.4004c2.05469 1.48047 5.77637 2.68262 8.30859 2.68262c1.48438 0 3.81055 -0.44043 5.19141 -0.982422c0.285156 -0.345703 0.515625 -0.989258 0.515625 -1.43652
|
2893 |
+
c0 -0.0732422 -0.00683594 -0.191406 -0.015625 -0.263672l-13 -7.59961c7.60059 -11.8008 10.5 -25.3008 8.7998 -41.3008c-0.932617 -9.45898 -7.5625 -22.1377 -14.7998 -28.2998l2.90039 -4.7002c-30 2.2002 -24.7998 6.80078 -46.5 23.6006zM162.9 334.4
|
2894 |
+
c-1.80078 -7.2002 -2.30078 -16 -3.10059 -26l5.40039 -6.40039l7.09961 -3.40039c2.01465 -0.384766 5.31445 -0.697266 7.36523 -0.697266c1.08887 0 2.85156 0.0888672 3.93457 0.197266c1 1.7002 3.5 4.2002 6.40039 7.60059c5 5.89941 7.90039 13.7998 8.40039 23.0996
|
2895 |
+
c0.0703125 1.18262 0.126953 3.10449 0.126953 4.28906c0 5.92773 -1.40137 15.3408 -3.12695 21.0107c-3 8.10059 -5.90039 11 -10.1006 9.30078c-5.39941 -1.7002 -10.5996 -5.40039 -16 -11.8008c-3 -4.19922 -5.2002 -9.59961 -6.39941 -17.1992zM204.9 278.3
|
2896 |
+
l-3.10059 -6.5c7.10059 4.2002 13.5 7.2002 19.4004 8.40039l7.09961 0.5l11.7998 -7.60059h-2.5c-8.7998 3.7002 -19.3994 1.2002 -30.6992 -7.59961c-0.5 -4.7002 1.69922 -14.7002 5.89941 -29.5l9.2002 0.5c-21.9004 -6.59961 -37.5996 -8.40039 -48.9004 -5.40039
|
2897 |
+
c-24.8994 6.7002 -27.3994 23.6006 -27.5 24.1006c-1.47754 5.69238 -2.67676 15.0869 -2.67676 20.9688c0 3.53418 0.438477 9.23828 0.977539 12.7314c-6.40039 -0.5 -11 -4.2002 -15.2002 -10.6006c-2.90039 5.90039 -5.40039 8.7998 -5.90039 9.2998
|
2898 |
+
c1.5 0.700195 12.2998 7.5 32.5 4.90039l0.5 -2.5l-5.89941 -1.2002c-0.100586 -0.399414 -1.90039 -29.5 18.8994 -24.7998c1.40039 0.299805 1.2998 -0.0996094 36.1006 14.2998z" />
|
2899 |
+
<glyph glyph-name="acquisitions-incorporated" unicode="" horiz-adv-x="384"
|
2900 |
+
d="M357.45 -20.2002c2.2002 -14.2998 4.09961 -28.7002 6.59961 -43.7002h-337.1c-4 0 -6.10059 0.700195 -5.2998 5.7002c2.09961 12.9004 3.5 25.9004 5 38.7998c0.5 4.80078 2.2998 6.80078 7.59961 6.80078c118.1 -1 114.9 -0.300781 121.4 2.39941
|
2901 |
+
c9.39941 4 14.8994 12.9004 14.8994 23.1006c-0.0996094 42.8994 -0.299805 85.8994 -0.200195 128.8c0 3.7998 -1.19922 5.89941 -4.59961 6.7998c-15.7002 3.90039 -31.2998 7.7002 -47.5996 11.7002c-5.30078 -12.2998 -10.4004 -24.4004 -15.7002 -36.7002
|
2902 |
+
c1.7998 -3.2998 28.3994 -2.90039 35.2998 -2.90039v-27.5996h-114.3c1 8.59961 1.7002 16.7998 3.2002 24.9004c0.299805 1.39941 3.59961 3.09961 5.5 3.19922c8.39941 0.400391 16.8994 0.300781 25.3994 0.100586c4 0 5.90039 1.09961 7.60059 5.2002
|
2903 |
+
c16.5996 40.6992 13.5 31.1992 67.2998 161c31.5 76.0996 33 76 32.5996 87.3994c-0.700195 18.6006 -25.3994 22.2998 -37.7002 22.1006c-30 -0.400391 -38.3994 0.5 -101.8 0.5c-7.2002 44.5 -4.2002 32.0996 -6.39941 45.2998c-0.700195 4.2002 1 5.2998 4.59961 5.2998
|
2904 |
+
l339.1 -0.200195c-0.799805 -5.39941 -1.59961 -10.7998 -2.39941 -16.0996c-1.2998 -9.7002 -2.7998 -19.4004 -4 -29.2002c-0.299805 -2.90039 -1.2002 -4.2998 -4.2998 -4.2998c-20.6006 -0.100586 -41.2002 -0.100586 -61.8008 -0.5
|
2905 |
+
c-18.6992 -0.400391 -37.5996 -0.299805 -56.1992 -2c-13.4004 -1.2002 -23.3008 -12.6006 -18.9004 -26.6006c8.59961 -27.0996 27.7002 -69.0996 36.5 -89.1992c65.7002 -154.2 61.4004 -157 84 -158.601c6.59961 -0.5 13.4004 -0.0996094 20.4004 -0.0996094
|
2906 |
+
c1.2998 -9.40039 2.59961 -18 4 -27.5h-116v27c10.3994 0 20.3994 0.0996094 30.3994 -0.100586c3.5 0 5 0.700195 3.40039 4.40039c-4.40039 10.2998 -8.7002 20.5996 -13.2002 30.9004c-1.59961 3.69922 -4.09961 4.7998 -8.40039 3.5
|
2907 |
+
c-12.3994 -3.60059 -24.7998 -6.7002 -37.2998 -9.7002c-4.2998 -1.10059 -6 -2.7998 -5.89941 -7.5c0.799805 -57.5 0.899414 -127.5 1 -129.101c0.399414 -12.5996 8.69922 -21.3994 21 -23.0996c0.899414 -0.200195 12.8994 -2.7998 112.699 -2.59961
|
2908 |
+
c8.30078 0 8.40039 0.0996094 9.60059 -7.60059zM182.55 185.5c2.46484 -0.869141 6.58691 -1.5752 9.2002 -1.5752s6.73535 0.706055 9.2002 1.5752c13 4.2002 26.2998 7.7998 39.3994 11.7002c1.1123 0.512695 2.86035 1.45312 3.90039 2.09961
|
2909 |
+
c-6.7002 17.4004 -13.0996 34.2002 -19.7002 50.9004c-8.89941 22.7002 -17.7002 60.2998 -27 82.7998c-1.5 0.799805 -1.89941 -2.40039 -9.39941 0c-17.1006 -44 -34.1006 -87.7998 -51.3008 -132.1c1.54297 -0.917969 4.1416 -2.2168 5.80078 -2.90039
|
2910 |
+
c13.2998 -4.2998 26.5996 -8.2998 39.8994 -12.5z" />
|
2911 |
+
<glyph glyph-name="critical-role" unicode=""
|
2912 |
+
d="M225.82 448c0.259766 -0.150391 216.569 -124.51 217.12 -124.72c3 -1.18066 3.69922 -3.45996 3.69922 -6.56055c-0.0732422 -83.4463 -0.0732422 -166.899 0 -250.359c0.00976562 -0.124023 0.0175781 -0.326172 0.0175781 -0.450195
|
2913 |
+
c0 -2.06836 -1.52148 -4.45703 -3.39746 -5.33008c-21.3701 -12 -207.859 -118.29 -218.93 -124.58h-3c-79.3301 45.6602 -218.25 125.44 -218.4 125.52c-1.04297 0.491211 -1.89062 1.8252 -1.89062 2.97754c0 0.0732422 0.00488281 0.19043 0.0107422 0.262695
|
2914 |
+
c0 0.870117 0 225.94 -0.0498047 253.101c-0.0078125 0.102539 -0.0136719 0.269531 -0.0136719 0.37207c0 1.78223 1.31836 3.82422 2.94336 4.55762c23.2607 13.0996 209.271 119.21 220.141 125.21h1.75zM215.4 427.58l-0.219727 0.158203
|
2915 |
+
c-64.7471 -36.8604 -129.474 -73.7305 -194.18 -110.61c0 -0.120117 0.0800781 -0.229492 0.129883 -0.349609l30.8604 -11.6406c-7.70996 -6 -8.32031 -6 -10.6504 -5.12988c-0.0996094 0 -24.1699 9.28027 -26.7998 10v-230.43
|
2916 |
+
c0.879883 1.41016 64.0703 110.91 64.1299 111c1.62012 2.82031 3 1.91992 9.12012 1.51953c1.40039 -0.0898438 1.47949 -0.219727 0.780273 -1.41992c-41.1904 -71.3301 -36.4004 -63 -67.4805 -116.939c-0.80957 -1.40039 -0.609375 -1.12988 1.25 -1.12988h186.5
|
2917 |
+
c1.44043 0 1.69043 0.229492 1.7002 1.63965v8.87988c0 1.33984 2.36035 0.810547 -18.3701 1c-7.45996 0.0703125 -14.1396 3.21973 -21.3799 12.7002c-7.37988 9.66016 -14.6201 19.4297 -21.8496 29.21c-2.28027 3.08008 -3.4502 2.37988 -16.7607 2.37988
|
2918 |
+
c-1.75 0 -1.7793 0 -1.75977 -1.82031c0.290039 -26.21 0.150391 -25.2695 1 -32.6592c0.520508 -4.37012 2.16016 -4.2002 9.69043 -4.81055c3.13965 -0.259766 3.87988 -4.08008 0.519531 -4.91992c-1.57031 -0.389648 -31.5996 -0.509766 -33.6699 0.0996094
|
2919 |
+
c-0.982422 0.269531 -1.78027 1.31543 -1.78027 2.33398c0 1.16016 0.931641 2.2334 2.08008 2.39648c3.29004 0.759766 6.16016 -0.80957 6.66016 4.44043c1.2998 13.6592 1.16992 9 1.09961 79.4199c0 10.8193 -0.349609 12.5801 -5.35938 13.5498
|
2920 |
+
c-1.21973 0.240234 -3.54004 0.160156 -4.69043 0.549805c-2.87988 1 -2 4.83984 1.77051 4.84961c33.6699 0 46.0801 1.07031 56.0596 -4.85938c7.74023 -4.61035 12 -11.4805 12.5098 -20.4004c0.880859 -14.5898 -6.50977 -22.3496 -15 -32.5898
|
2921 |
+
c-0.282227 -0.241211 -0.510742 -0.738281 -0.510742 -1.11035c0 -0.371094 0.228516 -0.868164 0.510742 -1.10938c2.60059 -3.25 5 -6.62988 7.70996 -9.83008c27.5605 -33.2305 24.1104 -30.54 41.2803 -33.0605c0.890625 -0.129883 1 0.419922 1 1.15039v11
|
2922 |
+
c0 1 0.320312 1.42969 1.41016 1.25977c2.98633 -0.454102 7.86133 -0.822266 10.8818 -0.822266c3.53223 0 9.2207 0.50293 12.6982 1.12207c1.08008 0.150391 1.5 -0.199219 1.47949 -1.33008c0 -0.109375 0.880859 -26.6895 0.870117 -26.7998
|
2923 |
+
c-0.0498047 -1.51953 0.669922 -1.62012 1.89062 -1.62012h186.71c-27.1533 47.0342 -54.2334 93.9746 -81.2402 140.821c2.25977 0.660156 -0.400391 0 6.69043 1.38965c2 0.390625 2.0498 0.410156 3.10938 -1.43945c7.31055 -12.6396 77.3105 -134 77.3701 -134.061
|
2924 |
+
v230.44c-1.71973 -0.5 -103.3 -38.7197 -105.76 -39.6797c-1.08008 -0.419922 -1.5498 -0.200195 -1.91016 0.879883c-0.629883 1.89941 -1.33984 3.75977 -2.08984 5.62012c-0.320312 0.790039 -0.0898438 1.12988 0.649414 1.38965
|
2925 |
+
c0.100586 0 95.5303 35.8496 103 38.7705c-65.4199 37.5693 -130.56 75 -196 112.6l86.8203 -150.39l-0.280273 -0.330078c-9.56934 0.899414 -10.46 1.59961 -11.7998 3.93945c-1 1.69043 -73.5 127.71 -82 142.16c-9.09961 -14.6699 -83.5596 -146.21 -85.3701 -146.32
|
2926 |
+
c-2.92969 -0.169922 -5.87988 -0.0800781 -9.25 -0.0800781c28.833 49.8271 57.5596 99.4941 86.1797 149.001zM267.331 297.658c1.54688 0.120117 4.02832 0.500977 5.54004 0.849609c1.68945 0.299805 2.53027 -0.200195 2.59961 -1.91992
|
2927 |
+
c0 -0.109375 0.0703125 -19.0596 -0.859375 -20.4502c-0.930664 -1.38965 -1.87988 -1.21973 -2.60059 0.19043c-5 9.68945 6.2207 9.66016 -39.1201 12c-0.699219 0 -1 -0.230469 -1 -0.929688c0 -0.130859 3.7207 -122 3.73047 -122.11
|
2928 |
+
c0 -0.889648 0.519531 -1.2002 1.20996 -1.50977c2.46484 -0.980469 6.3623 -2.79492 8.7002 -4.0498c7.30957 -4.33008 11.3799 -10.8408 12.4102 -19.3105c1.43945 -11.7998 -2.77051 -35.7695 -32.21 -37.1396c-2.75 -0.129883 -28.2607 -1.08008 -34.1406 23.25
|
2929 |
+
c-4.66016 19.2598 8.25977 32.7002 19.8906 36.3994c1.11035 0.202148 2.0127 1.28223 2.0127 2.41113c0 0.0683594 -0.00585938 0.180664 -0.0126953 0.249023c0.0996094 5.62988 3 107.101 3.70996 121.351c0.0498047 1.0791 -0.620117 1.15918 -1.35059 1.14941
|
2930 |
+
c-32.3496 -0.519531 -36.75 0.339844 -40.2197 -8.51953c-2.41992 -6.18066 -4.13965 -1.32031 -3.9502 -0.230469c1.05957 6 2.16309 12 3.31055 18c0.399414 2.11035 1.42969 2.61035 3.42969 1.86035c5.58984 -2.11035 6.71973 -1.7002 37.25 -1.91992
|
2931 |
+
c1.72949 0 1.78027 0.0800781 1.82031 1.84961c0.679688 27.4902 0.579102 22.5898 1 29.5498c0.00976562 0.0878906 0.0185547 0.231445 0.0185547 0.320312c0 0.986328 -0.738281 2.09766 -1.64941 2.48047c-5.59961 2.90918 -8.75 7.5498 -8.89941 13.8691
|
2932 |
+
c-0.350586 14.8105 17.7197 21.6699 27.3799 11.5107c6.83984 -7.19043 5.7998 -18.9102 -2.4502 -24.1504c-1.24316 -0.68457 -2.25195 -2.3916 -2.25195 -3.81055c0 -0.146484 0.0146484 -0.383789 0.0322266 -0.529297c0 -0.589844 -0.110352 4.30957 1 -30.0498
|
2933 |
+
c0 -0.900391 0.429688 -1.12012 1.24023 -1.11035c0.0996094 0 23 0.0898438 34.4697 0.370117zM68.2705 306.298c19.8408 4.50977 32.6807 0.560547 52.4902 -1.68945c2.75977 -0.310547 3.74023 -1.2207 3.62012 -4c-0.209961 -5 -1.16016 -22.3301 -1.24023 -23.1504
|
2934 |
+
c-0.0371094 -0.932617 -0.767578 -1.98145 -1.62988 -2.33984c-4.05957 -1.7002 -3.60938 4.4502 -4 7.29004c-3.12988 22.4297 -73.8701 32.7002 -74.6299 -25.4004c-0.30957 -23.9199 17 -53.6299 54.0801 -50.8799c27.2402 2 19 20.1904 24.8398 20.4697
|
2935 |
+
c0.0996094 0.0136719 0.261719 0.0244141 0.362305 0.0244141c1.50195 0 2.7207 -1.21875 2.7207 -2.71973c0 -0.186523 -0.0371094 -0.483398 -0.0830078 -0.664062c-1.83008 -10.8506 -3.41992 -18.9502 -3.4502 -19.1504
|
2936 |
+
c-1.54004 -9.16992 -86.6992 -22.0898 -93.3496 42.0605c-2.70996 25.8496 10.4404 53.3691 40.2695 60.1494zM148.271 218.628h-19.4893c-0.0576172 -0.00488281 -0.151367 -0.00878906 -0.208984 -0.00878906c-1.04102 0 -2.13867 0.805664 -2.45117 1.79883
|
2937 |
+
c2.37988 3.75 5.88965 -0.919922 5.86035 6.13965c-0.0800781 25.75 0.209961 38 0.229492 40.1006c0 3.41992 -0.530273 4.64941 -3.32031 4.93945c-7 0.720703 -3.10938 3.37012 -1.10938 3.38086c11.8398 0.0996094 22.6201 0.179688 30.0498 -0.720703
|
2938 |
+
c8.76953 -1.06934 16.71 -12.6299 7.92969 -22.6201c-2 -2.25 -4 -4.41992 -6.13965 -6.72949c0.950195 -1.15039 6.89941 -8.82031 17.2803 -19.6797c2.65918 -2.78027 6.14941 -3.51074 9.87988 -3.13086h0.0214844c1.1709 0 2.16016 0.950195 2.20801 2.12012
|
2939 |
+
c0.299805 3.41992 0.259766 -4.72949 0.450195 40.5801c0 5.65039 -0.339844 6.58008 -3.22949 6.83008c-3.9502 0.350586 -4 2.25977 -0.69043 3.37012l19.0898 0.0898438c0.320312 0 4.49023 -0.530273 1 -3.37988c0 -0.0498047 -0.160156 0 -0.240234 0
|
2940 |
+
c-3.60938 -0.259766 -3.93945 -1 -4 -4.62012c-0.269531 -43.9297 0.0703125 -40.2295 0.410156 -42.8203c0.110352 -0.839844 0.270508 -2.22949 5.10059 -2.13965c2.48926 0 3.85938 -3.37012 0 -3.39941c-10.3701 -0.0800781 -20.7402 0 -31.1104 -0.0703125
|
2941 |
+
c-10.6699 0 -13.4697 6.2002 -24.21 20.8203c-1.59961 2.17969 -8.31055 2.35938 -8.2002 0.369141c0.879883 -16.4697 0 -17.7793 4 -17.6699c4.75 0.100586 4.73047 -3.56934 0.830078 -3.5498h0.0595703zM423.271 228.778
|
2942 |
+
c-1.20996 -7.12988 0.170898 -10.3799 -5.2998 -10.3398c-61.5498 0.419922 -47.8193 0.219727 -50.7197 0.30957c-1.02246 0.100586 -2.64844 0.426758 -3.62988 0.730469c-2.53027 0.599609 1.47949 1.22949 -0.379883 5.59961
|
2943 |
+
c-1.43066 3.37012 -2.78027 6.78027 -4.11035 10.1895c-0.210938 0.797852 -1.05078 1.44434 -1.875 1.44434c-0.0351562 0 -0.0908203 -0.00195312 -0.125 -0.00390625c-1.82812 0.0878906 -4.79785 0.15918 -6.62793 0.15918
|
2944 |
+
c-2.19727 0 -5.75879 -0.102539 -7.95215 -0.229492c-0.587891 -0.0771484 -1.31348 -0.551758 -1.62012 -1.05957c-1.58008 -3.62012 -3.06934 -7.29004 -4.50977 -11c-1.26953 -3.23047 7.86035 -1.32031 12.1904 -2.16016c3 -0.570312 4.5293 -3.71973 0.65918 -3.72949
|
2945 |
+
h-26.3691c-2.91992 0 -3.09082 3.14941 -0.740234 3.20996c0.0791016 -0.00390625 0.208008 -0.00683594 0.288086 -0.00683594c2.14648 0 4.66992 1.55762 5.63184 3.47656c1.5 3 2.7998 6 4.11035 9.08984c18.1797 42.1396 17.0596 40.1699 18.4199 41.6104
|
2946 |
+
c0.300781 0.431641 0.973633 0.78125 1.5 0.78125s1.19824 -0.349609 1.5 -0.78125c2.92969 -3.33984 18.3994 -44.71 23.6201 -51.9199c2 -2.7002 5.73926 -2 6.35938 -2c3.61035 -0.130859 4 1.10938 4.12988 4.29004
|
2947 |
+
c0.0898438 1.86914 0.0800781 -1.1709 0.0703125 41.2393c0 4.45996 -2.36035 3.74023 -5.5498 4.27051c-0.259766 0 -2.56055 0.629883 -0.0800781 3.05957c0.209961 0.200195 -0.890625 0.240234 21.7002 0.150391c2.31934 0 5.31934 -2.75 -1.20996 -3.4502
|
2948 |
+
c-0.0322266 0.000976562 -0.0830078 0.00292969 -0.115234 0.00292969c-1.41309 0 -2.55957 -1.14746 -2.55957 -2.56055c0 -0.0751953 0.00683594 -0.197266 0.0146484 -0.272461c-0.0703125 -1.62988 -0.19043 -38.8896 0.290039 -41.21
|
2949 |
+
c0.27832 -1.34668 1.62109 -2.43848 2.99609 -2.43848c0.0644531 0 0.168945 0.00390625 0.233398 0.00878906c13.25 -0.430664 14.9199 -0.44043 16 3.41016c1.66992 5.7793 4.12988 2.51953 3.73047 0.189453zM318.551 164.408
|
2950 |
+
c-4.24023 0 -4.41992 3.38965 -0.609375 3.41016c35.9092 0.160156 28.1094 -0.379883 37.1895 0.649414c1.67969 0.19043 2.37988 -0.239258 2.25 -1.88965c-0.259766 -3.38965 -0.639648 -6.78027 -1 -10.1602c-0.25 -2.16016 -3.2002 -2.61035 -3.39941 0.150391
|
2951 |
+
c-0.380859 5.30957 -2.15039 4.44922 -15.6309 5.08008c-1.58008 0.0693359 -1.63965 0 -1.63965 -1.52051v-16.1299c0 -1.65039 0 -1.59961 1.62012 -1.46973c3.12012 0.25 10.3096 -0.339844 15.6895 1.51953c0.470703 0.160156 3.30078 1.79004 3.07031 -1.75977
|
2952 |
+
c0 -0.209961 -0.759766 -10.3496 -1.17969 -11.3896c-0.530273 -1.29004 -1.87988 -1.51074 -2.58008 -0.320312c-1.16992 2 0 5.08008 -3.70996 5.2998c-15.4199 0.900391 -12.9102 2.5498 -12.9102 -6c0 -12.25 -0.759766 -16.1104 3.88965 -16.2402
|
2953 |
+
c16.6406 -0.479492 14.4004 0 16.4307 5.70996c0.839844 2.37012 3.5 1.77051 3.17969 -0.580078c-0.44043 -3.20996 -0.849609 -6.42969 -1.22949 -9.63965c0 -0.360352 -0.160156 -2.39941 -4.66016 -2.38965c-37.1602 0.0800781 -34.54 0.189453 -35.21 0.30957
|
2954 |
+
c-2.7207 0.509766 -2.2002 3 0.219727 3.4502c1.09961 0.19043 4 -0.540039 4.16016 2.55957c2.43945 56.2207 -0.0703125 51.3408 -3.91016 51.3301zM318.141 273.928c2.45996 -0.609375 3.12988 -1.75977 2.9502 -4.64941
|
2955 |
+
c-0.330078 -5.2998 -0.339844 -9 -0.549805 -9.69043c-0.660156 -2.22949 -3.15039 -2.12012 -3.33984 0.270508c-0.379883 4.80957 -3.0498 7.81934 -7.57031 9.14941c-26.2803 7.73047 -32.8096 -15.46 -27.1699 -30.2197c5.87988 -15.4102 22 -15.9199 28.8604 -13.7803
|
2956 |
+
c5.91992 1.85059 5.87988 6.5 6.91016 7.58008c1.22949 1.2998 2.25 1.83984 3.11914 -1.09961c0 -0.100586 0.570312 -11.8906 -6 -12.75c-1.59961 -0.209961 -19.3799 -3.69043 -32.6797 3.38965c-21 11.1904 -16.7402 35.4697 -6.87988 45.3301
|
2957 |
+
c14 14.0596 39.9102 7.05957 42.3203 6.46973h0.0292969zM289.801 167.858c3.28027 0 3.66016 -3 0.160156 -3.43066c-2.61035 -0.319336 -5 0.419922 -5 -5.45996c0 -2 -0.19043 -29.0498 0.400391 -41.4502c0.109375 -2.28906 1.14941 -3.51953 3.43945 -3.64941
|
2958 |
+
c22 -1.20996 14.9502 1.64941 18.79 6.33984c1.83008 2.24023 2.75977 -0.839844 2.75977 -1.08008c0.350586 -13.6201 -4 -12.3896 -5.18945 -12.3994l-38.1602 0.189453c-1.92969 0.230469 -2.05957 3 -0.419922 3.37988c2 0.480469 4.93945 -0.399414 5.12988 2.7998
|
2959 |
+
c1 15.8701 0.570312 44.6504 0.339844 47.8105c-0.269531 3.76953 -2.7998 3.26953 -5.67969 3.70996c-2.46973 0.379883 -2 3.21973 0.339844 3.21973c1.4502 0.0205078 17.9697 0.0302734 23.0898 0.0205078zM258.171 225.648
|
2960 |
+
c0.0703125 -4.08008 2.86035 -3.45996 6 -3.58008c2.61035 -0.100586 2.53027 -3.41016 -0.0703125 -3.43066c-6.47949 0 -13.6992 0 -21.6094 0.0605469c-3.83984 0 -3.37988 3.34961 0 3.37012c4.49023 0 3.24023 -1.61035 3.41016 45.54
|
2961 |
+
c0 5.08008 -3.27051 3.54004 -4.7207 4.22949c-2.58008 1.23047 -1.35938 3.08984 0.410156 3.15039c1.29004 0 20.1904 0.410156 21.1699 -0.209961c0.980469 -0.620117 1.87012 -1.65039 -0.419922 -2.86035c-1 -0.519531 -3.85938 0.280273 -4.14941 -2.46973
|
2962 |
+
c0 -0.209961 -0.820312 -1.62988 -0.0703125 -43.7998h0.0498047zM221.261 -48.6221c0.408203 -0.273438 1.13867 -0.495117 1.62988 -0.495117c0.492188 0 1.22168 0.22168 1.62988 0.495117c17 9.79004 182 103.57 197.421 112.51
|
2963 |
+
c-0.140625 0.430664 11.2598 0.180664 -181.521 0.270508c-1.21973 0 -1.57031 -0.370117 -1.53027 -1.56055c0 -0.0996094 1.25 -44.5098 1.2207 -50.3799c-0.0791016 -2.17969 -0.688477 -5.63379 -1.36035 -7.70996c-0.549805 -1.83008 0.379883 0.5 -13.5 -32.2295
|
2964 |
+
c-0.730469 -1.7207 -1 -2.20996 -2 0.0800781c-4.19043 10.3398 -8.28027 20.7197 -12.5703 31c-1.12109 2.52441 -2.03125 6.81543 -2.03125 9.57812c0 0.333984 0.0146484 0.876953 0.03125 1.21191c0.160156 2.45996 0.800781 16.1191 1.51074 48c0 1.94922 0 2 -2 2
|
2965 |
+
h-183c2.5791 -1.63086 178.319 -102.57 196 -112.761zM130.361 140.128c0 -2.39941 0.359375 -2.79004 2.75977 -3c11.54 -1.16992 21 -3.74023 25.6396 7.32031c6 14.46 2.66016 34.4102 -12.4795 38.8398c-2 0.589844 -16 2.75977 -15.9404 -1.50977
|
2966 |
+
c0.0498047 -8.04004 0.00976562 -11.6104 0.0205078 -41.6504zM236.111 155.178c0 -2.12988 1.06934 -38.6797 1.08984 -39.1299c0.339844 -9.93945 -25.5801 -5.76953 -25.2305 2.58984c0.0800781 2 1.37012 37.4199 1.10059 39.4307
|
2967 |
+
c-14.1006 -7.44043 -14.4199 -40.21 6.43945 -48.8008c1.88184 -0.816406 5.0752 -1.47949 7.12695 -1.47949c5.53418 0 12.3721 3.83008 15.2637 8.5498c4.90918 7.75977 6.83984 29.4697 -5.43066 39c-0.0966797 -0.0400391 -0.257812 -0.09375 -0.359375 -0.120117
|
2968 |
+
v-0.0400391zM223.831 353.178c-9.83008 0 -9.73047 -14.75 -0.0703125 -14.8701c9.66016 -0.119141 10.1006 14.8809 0.0703125 14.9102v-0.0400391zM143.681 249.348c0 -1.7998 0.410156 -2.39941 2.16992 -2.58008c13.6201 -1.38965 12.5107 11 12.1602 13.3604
|
2969 |
+
c-1.68945 11.2197 -14.3799 10.2002 -14.3496 7.81055c0.0498047 -4.5 -0.0302734 -13.6807 0.0195312 -18.5908zM356.001 242.948l-6.09961 15.8398c-2.16016 -5.48047 -4.16016 -10.5703 -6.23047 -15.8398h12.3301z" />
|
2970 |
+
<glyph glyph-name="d-and-d-beyond" unicode="" horiz-adv-x="640"
|
2971 |
+
d="M313.8 206.5c-9.89941 0 -16 7 -15.7002 7.09961c-4.2998 5.7002 -3 -0.299805 -2.39941 -1.89941c-10.9004 10.2998 -5.2998 25.3994 -5.10059 26c0.700195 1.89941 0 2.2002 -0.599609 1.89941c-1 -0.299805 -2.09961 -1.89941 -2.09961 -1.89941
|
2972 |
+
c0.799805 9.09961 9.2998 14.7002 9.2998 14.7002l0.200195 -0.200195c1 -1.5 -0.400391 -3.2002 -0.600586 -9c1.60059 2.2998 7.90039 6.59961 11.4004 7.89941c-1.10059 -1.5 -2.10059 -3.59961 -2.10059 -6.59961c3.7002 4.2002 7.5 2.59961 8 2.40039
|
2973 |
+
c-12.1992 -11.9004 -7 -26.6006 3.2002 -26.6006c5.7002 0 11.5 6.40039 13.9004 10.7002c2.39941 -2.40039 6.39941 -5.5 7.39941 -6.59961c-3.7998 -7.80078 -11 -17.9004 -24.7998 -17.9004zM366.2 227.6c0 -2.89941 -2.90039 -4.09961 -5.40039 -4.5
|
2974 |
+
c0.700195 1.5 1.7998 5.10059 -0.200195 9c0.700195 -0.0996094 5.60059 -0.5 5.60059 -4.5zM376.5 222.4c-0.400391 -6.5 -6.90039 -11.6006 -14.5996 -10.6006c2 -1.7002 6.59961 -3 9 -1.89941c-3.90039 -6.90039 -23.1006 -7.5 -23.1006 6.39941
|
2975 |
+
c-2.89941 -2.89941 -2.09961 -7.39941 0 -9.2998c-2.2002 0.700195 -5.7998 3.09961 -6.39941 7.40039c-1.30078 10.0996 4.39941 6.5 -10.4004 18.0996c-4.7998 3.7002 -3 6.59961 -4 8.5c-1.09961 2.2002 -7 4.09961 -4.5 8.5
|
2976 |
+
c-0.0996094 -1.59961 1 -2.90039 2.59961 -3.5c1.80078 -0.700195 3.2002 -0.200195 4.80078 -1c1.69922 -1.2002 0.899414 -3.90039 2.19922 -5c1.10059 -0.799805 4.2002 0.299805 6.60059 -1.7998c2.59961 -2 8.2002 -6.7002 10.5996 -8.60059
|
2977 |
+
c4.40039 -3.59961 8.7998 0.400391 7.40039 4.60059c4.5 -2.60059 5 -9.90039 1.2998 -12.5c10.5996 -2.40039 13 10.0996 5 11.3994c7.2998 0.700195 13.5 -4.2998 13.5 -10.6992zM337.1 240.8c4.30078 6.10059 13.3008 15.2998 23.8008 15.7998
|
2978 |
+
c-5.90039 0.800781 -15.1006 -3.19922 -19.7002 -9c0.899414 3.90039 5.09961 10.1006 10.2002 13c0 0 -2.5 -3.19922 -1.40039 -3.69922c1.59961 -0.800781 5.7998 5.69922 11.2002 5.89941c0 0 -4 -2 -3.2002 -3.39941c0.599609 -0.900391 3.2998 1.2998 8 1.2998
|
2979 |
+
c5.7998 0 10.9004 -3.5 13.2998 -6.2002c-4 1.09961 -11.5996 -0.799805 -13.7998 -2.7002c-0.299805 0.200195 -11.7998 9 -22 -15.5c-4.7998 3.7998 -4.40039 3.7002 -6.40039 4.5zM579.6 188.9c37.2002 0 60.4004 -19.6006 60.4004 -48.9004
|
2980 |
+
c0 -28.2002 -17 -48.9004 -59.0996 -48.9004c-20.7002 0 -41.2002 1.30078 -51.6006 2.10059l7.40039 8.2002v77.1992l-7.40039 8.2002c10.2998 0.799805 29.6006 2.10059 50.2998 2.10059zM564.5 113.3c25.4004 -3.2002 46.7998 1.40039 46.7998 27
|
2981 |
+
c0 22.5 -16.7002 29.6006 -46.7998 26.2998v-53.2998zM301.6 267c0.100586 -0.299805 -2.7998 2.2998 -3.2998 7.5c-0.200195 2.2998 0 19.7998 20 18.9004c11.2002 -0.600586 16.7002 -8.30078 16.7002 -16.5c0 -4.30078 -2.2998 -10.1006 -5.5 -13.8008
|
2982 |
+
c-2.2002 2.2002 -5.59961 4.60059 -7.7002 7.80078c3.7998 5.59961 2.2002 14.3994 -4.7002 14.3994c-4.2998 0 -7.7998 -4.5 -6.39941 -9.89941c-0.700195 -2.40039 -1 -5.60059 -0.5 -8c-4.90039 2.59961 -6.5 6 -7.5 9c-1.2998 -2.5 -2.10059 -6 -1.10059 -9.40039z
|
2983 |
+
M301.2 261c0.299805 1.7002 -3.10059 4.59961 -4.7998 5.2002c4.7998 0.200195 7 -0.600586 7 -0.600586c-1.30078 1.7002 -1.60059 4.5 -1 6.7002c2.5 -6.09961 11.6992 -7.09961 13.8994 -12.2002c-0.299805 2.30078 -2.39941 4.7002 -4.7998 6.10059
|
2984 |
+
c-1.2998 3.2002 -0.299805 9.39941 1.2998 11c-0.5 -8.7998 12 -13.7998 14.6006 -20.2002c-1.40039 5.5 -7.40039 9 -10.1006 12.2002c-1 2.09961 -0.200195 5.7998 0.799805 7.09961c-0.5 -9.7002 15.8008 -14.2998 14.1006 -23.8994
|
2985 |
+
c0.899414 -0.400391 2.09961 -1.2002 1.89941 -2.60059c1.30078 0.299805 2.60059 1.7002 2.90039 2.7002c0.700195 -4.5 -1.90039 -9 -4.7998 -10.4004c1.59961 4 -2.7002 5.60059 -6.7002 5.10059c0 0 1.59961 2.2998 1 3.39941
|
2986 |
+
c-0.799805 1.5 -8 0.800781 -11.2002 -0.299805c1.10059 0.100586 3.60059 -0.200195 4.60059 -0.5c-2.10059 -2.89941 -1 -7.09961 1.2998 -4.2002c0 0 -1.10059 -3.5 -0.299805 -4.2998c0.799805 -0.799805 2.59961 -0.200195 2.59961 -0.200195
|
2987 |
+
c-1.2002 -2.69922 -5.2998 -4.59961 -8.2002 -4.59961c1.10059 0.400391 2.7002 2.2998 3 3.40039c-0.799805 -0.5 -2.7002 -0.700195 -3.5 -0.5c6.10059 3 0 13.1992 -7 8.19922c1 2.7002 3.7002 5.30078 5.7998 6.10059c-1.2998 0.5 -2.69922 0.799805 -4.2998 1.09961
|
2988 |
+
c1.7998 1.5 6.2998 2.7998 8.5 2.60059c-3.5 0.799805 -9.89941 -0.300781 -12.7998 -3.7002c0.900391 0 3.2998 -0.5 4.2998 -0.799805c-4 -0.700195 -9.39941 -4.40039 -11 -6.2002c0.299805 2.2002 1 4.2002 0.5 5.59961c-0.799805 2 -3 2.7998 -7.7998 1.7998
|
2989 |
+
c3.2002 3.2002 9.7002 5.10059 10.2002 6.90039zM327.1 253.6c0 0 -0.899414 3 -4.19922 4.30078c0.699219 -2.2002 1.5 -4.30078 4.19922 -4.30078zM366 249.9l0.700195 0.699219c0.5 0.400391 1.59961 0.900391 2.7002 1.40039v-18.4004
|
2990 |
+
c-1.7002 0.800781 -3.5 1.10059 -5.60059 1.10059c-2.39941 0 -5 -0.5 -5 -0.5c-0.5 0.5 -3.59961 2.89941 -5.09961 3.2002c4.09961 -4.30078 0.5 -9.80078 -3 -7.2002v15.7002c0.700195 0.799805 1.2998 1.7998 2.09961 2.59961
|
2991 |
+
c1.7002 2.09961 4.60059 3.40039 7.5 3.40039c1.7998 0 3.60059 -0.400391 4.7002 -1.40039zM79.9004 142.1c22 -6.39941 19.3994 -20.0996 19.3994 -25.1992c0 -7.80078 -3.2002 -13.6006 -9.89941 -17.6006c-12.6006 -7.39941 -24.7002 -5.89941 -86.4004 -5.89941
|
2992 |
+
l8.40039 8.59961v32.2998l-11.4004 14.6006h11.2998v29.5l-8.2998 8.59961h56.0996c12.9004 0 37 -4.40039 37 -25c0 -1.90039 1 -15.2998 -16.1992 -19.9004zM38.5996 169.6v-20.8994c10.6006 0 29.6006 -3.2998 29.6006 8.7998v3
|
2993 |
+
c0 9.90039 -9.60059 9.09961 -29.6006 9.09961zM38.5996 110.4c20.4004 0 32.9004 -1.90039 32.9004 9.2998h-0.200195v4.5c0 11.0996 -20.5 8.7998 -32.7002 8.7998v-22.5996zM139.8 129.7v-15.4004l60.1006 0.200195l-14.1006 -21.2002h-81.2002l7.40039 8.2002v77.0996
|
2994 |
+
l-7.40039 8.2002l73.5 0.200195v-0.200195l14.1006 -21h-52.4004v-14.8994h37.2002l-14.0996 -21.2002v-0.200195zM354.5 189.8c73.7998 0 77.5996 -99.2998 -0.299805 -99.2998c-77.2002 0 -73.6006 99.2998 0.299805 99.2998zM354.2 112.3
|
2995 |
+
c39 0 37 55.2002 0.200195 55.2998c-37.1006 0 -37.6006 -55.2998 -0.200195 -55.2998zM262.9 120.6l0.199219 -19l7.2002 -8.19922h-42.5996l7.7002 8.19922l-0.200195 19.4004l-44.1006 65.7998h44.9004l-6.40039 -7.2002l21 -37.1992h0.300781l20.5 37.1992
|
2996 |
+
l-6.10059 7.2002h41.7002zM234.5 271.9c-9.09961 6.69922 -9.5 14.0996 -9.59961 14.8994c7.2998 -4.2998 9 -4 39.8994 -4c-5.7998 0 24 3.10059 32.2002 -22.8994c-0.400391 0 -8.40039 -4.80078 -10.4004 -7.90039c5.30078 1.90039 8.90039 1.09961 9 1.09961
|
2997 |
+
c-8 -5.09961 -9.59961 -14.7998 -9.59961 -20.5c0.900391 2.10059 2.7002 3.7002 2.7002 3.5c-0.600586 -2.5 -1.40039 -7 -0.799805 -12c-8.60059 -7.09961 -16 -8.59961 -26 -8.59961h-35.1006c0.400391 0.0996094 7.7998 4.5 7.90039 4.59961
|
2998 |
+
c1.89941 1.10059 2.7002 2.2002 2.7002 6.40039v38.7998c0 4.2002 -1.30078 5.2998 -2.90039 6.60059zM256 266.4v-34.6006c4.7002 0 23.0996 -3.39941 23.0996 17.2998c0 20.6006 -18.5 17.3008 -23.0996 17.3008zM484.9 186.8l39.1992 -0.0996094l-7.39941 -8.2998
|
2999 |
+
v-85.2002h-21.2998c-4 12.7002 -44.8008 45 -48.5 55.5996h-0.300781v-47.3994l7.40039 -8.2002h-39l7.2002 8.2998v76.9004l-7.40039 8.5h31.6006c2.89941 -9.40039 39.7998 -36.5 45.1992 -50.9004h0.300781v42.5zM378.2 282.9
|
3000 |
+
c32.7002 -1.60059 33.7998 -29.8008 33.7998 -33.6006c0 -6.7002 -3.2998 -34 -36.7002 -34h-0.299805c3.59961 4.2998 3.5 11.9004 -2.2002 16.2998c1.2002 0 19.7002 -3.19922 19.7002 17.3008c0 20.6992 -18.4004 17.2998 -23.0996 17.2998v-4.2998
|
3001 |
+
c-5.40039 0.799805 -7.40039 -0.300781 -7.5 -0.300781c2.09961 1.80078 4.5 2.60059 6.09961 2.90039c-7.09961 1.59961 -13.5996 -2.40039 -14.5996 -3.5c0.799805 1.7998 2.39941 3.40039 3.5 4.5c-2.30078 -0.799805 -4.30078 -1.90039 -6.10059 -3
|
3002 |
+
c0 5.2002 0.200195 7.5 -2.89941 9.5c-9.10059 6.59961 -9.5 14.2002 -9.60059 14.9004c7.10059 -4.2002 7.7002 -4 39.9004 -4z" />
|
3003 |
+
<glyph glyph-name="dev" unicode=""
|
3004 |
+
d="M120.12 239.71c3.87012 -2.90039 5.82031 -7.25977 5.83008 -13.0596v-69.6504c0 -5.80957 -1.94043 -10.1602 -5.82031 -13.0596c-3.87988 -2.90039 -7.76953 -4.35059 -11.6494 -4.35059h-17.4502v104.47h17.4395c3.87988 0 7.77051 -1.44922 11.6504 -4.34961z
|
3005 |
+
M404.1 416c24.2002 0 43.8408 -19.5898 43.9004 -43.7998v-360.4c-0.0595703 -24.21 -19.6904 -43.7998 -43.9004 -43.7998h-360.199c-24.2002 0 -43.8408 19.5898 -43.9004 43.7998v360.4c0.0595703 24.21 19.7002 43.7998 43.9004 43.7998h360.199zM154.2 156.81
|
3006 |
+
l-0.00976562 70.9307c-0.0107422 18.8193 -11.9307 47.2793 -47.3701 47.2793h-47.3799v-165.46h46.3994c36.75 -0.0595703 48.3604 28.4404 48.3604 47.25zM254.88 245.47l0.00976562 29.5205h-63.1895c-11.1504 -0.280273 -19.9805 -9.54004 -19.71 -20.6904v-125.109
|
3007 |
+
c0.279297 -11.1602 9.55957 -19.9805 20.7197 -19.6904h62.1797v29.5703h-53.29v38.4102h32.5703v29.5693h-32.5703v38.4199h53.2803zM358.52 130.18l38.4609 144.801h-32.5801l-29.5703 -113.721l-29.71 113.721h-32.5703l38.5303 -144.801
|
3008 |
+
c10.5898 -24.6299 34.2402 -30.75 47.4395 0z" />
|
3009 |
+
<glyph glyph-name="fantasy-flight-games" unicode="" horiz-adv-x="512"
|
3010 |
+
d="M256 415.14l223.14 -223.14l-223.14 -223.14l-223.14 223.14zM88.3398 192.17c11.3447 -11.2461 29.7705 -29.4893 41.1299 -40.7197c20.1602 19.8799 40.46 39.8994 61.8506 60.9902c12.0596 -12.5801 24.5195 -25.5703 36.54 -38.1104
|
3011 |
+
c12.0293 11.6895 23.7393 23.0596 35.6895 34.6602c-6.99023 7.4502 -32.1494 32.8301 -35.0898 35.7793c-1.91016 1.9209 -2.29004 3.2207 -0.120117 5.35059c15.5801 15.2295 39.21 17.79 56.9805 5.09961c7.98926 -5.70996 14.2998 -11.6396 48.5098 -43.9502
|
3012 |
+
c10.8203 11.1504 22.2295 22.8506 33.5 34.6904c0.490234 0.520508 0.0996094 2.63965 -0.580078 3.37988c-0.0898438 0.100586 -37.5195 40.6006 -62.1504 59c-33.5801 25.0801 -78.3193 23.0605 -119.77 -18.6895c-84.5703 -85.1807 -94.5303 -95.4805 -96.4902 -97.4805z
|
3013 |
+
M323.16 90.5703c18.8203 18.79 80.3301 80.6396 100.5 101.5c-13.7305 13.4492 -27.1797 26.6299 -40.8604 40.0293c-20.0098 -19.7393 -40.2402 -39.6895 -61.25 -60.4199c-12.3301 12.8301 -24.8799 25.8799 -37.25 38.75
|
3014 |
+
c-1.25977 -0.689453 -1.64941 -0.80957 -1.91016 -1.06934c-10.7295 -10.7705 -21.4199 -21.5801 -32.21 -32.29c-2.22949 -2.20996 -0.519531 -3.35059 0.800781 -4.69043c10.5791 -10.7402 21.1797 -21.4502 31.7695 -32.1797
|
3015 |
+
c3.5498 -3.60059 3.54004 -3.85059 -0.139648 -7.24023c-16.8008 -15.4697 -40.8408 -16.54 -59.3203 -1.7998c-7.62012 6.08008 -11.6602 10.1797 -44.6797 42.0898c-11.5801 -11.8896 -23.3203 -23.9404 -35.3701 -36.3096
|
3016 |
+
c33.5498 -34.7607 50.8496 -53.3408 72.9297 -66.8408c28.9004 -17.6699 71.5 -14.96 106.99 20.4707zM256 448l256 -256l-256 -256l-256 256zM16 192l240 -240l240 240l-240 240z" />
|
3017 |
+
<glyph glyph-name="penny-arcade" unicode="" horiz-adv-x="640"
|
3018 |
+
d="M421.91 283.73c7.33984 -16.2705 2.29004 -5.07031 24.6299 -54.6807l-39.7305 -10.6094c13.7002 59.2295 10.6104 45.8398 15.1006 65.29zM215.82 232.62c32.5 8.99023 41.9492 -37.6396 -0.350586 -47.4297c-14.2002 -3.77051 -6.64941 -1.75 -34.8193 -9.34082
|
3019 |
+
l-4.45996 46.1904c28.3193 7.5498 19.4395 5.17969 39.6299 10.5801zM541.98 258.81c75.7998 -37.9092 98 -76.3193 97.9893 -104.47c2.10059 -78.8496 -183.3 -130.33 -399.89 -84.8301c0.540039 -13 -8.00977 -24.6494 -20.5801 -28.0195
|
3020 |
+
c-125.54 -33.54 -117.35 -31.75 -122.53 -31.7598c-14.3701 -0.0107422 -26.4102 10.8896 -27.7998 25.1992l-4.2998 44.4805c-0.0683594 0.724609 -0.125 1.90332 -0.125 2.63184c0 10.5811 8.01758 22.2461 17.8945 26.0381l-1.73926 17.8799
|
3021 |
+
c-50.2305 28.2598 -80.9004 61.8701 -80.9004 95.3701c0 72.9199 144.26 113.4 309.41 98.3701c2.68945 7.54395 11.1514 15.3438 18.8896 17.4102c96.8701 25.9092 65.3203 17.4795 135.59 36.2295c13.1602 3.50977 26.9307 -2.95996 32.6201 -15.3301zM255.14 149.7
|
3022 |
+
c17.5 4.0498 40.2363 19.1562 50.75 33.7197c21.6006 32.5898 14.1104 105.561 -42.5498 104.43c-16.04 -0.229492 -8.07031 0.890625 -186.22 -46.6494l4.34961 -44.5l20.1201 5.38965l11.1104 -114.64l-20.0205 -5.35059l4.30078 -44.5195l115.31 30.7803
|
3023 |
+
l-4.50977 44.5098l-20.5303 -5.50977l-2.45996 23.5498l48.4404 12.9102zM454.32 133.08l108.55 28.96l-4.2998 44.4795l-20.79 -5.55957l-66.6699 145.47c-70.5801 -18.8301 -42.2305 -11.25 -135.591 -36.2393l4.2002 -44.4805l17.1504 4.55957l-33.0801 -126.47
|
3024 |
+
l-20.9902 -5.58984l4.45996 -44.4297l112.851 30.0693l-4.05078 39.54l-19.1992 -5.12012l4.09961 17.54l57.7598 15.4209l6.61035 -14.6807l-14.9004 -3.97949z" />
|
3025 |
+
<glyph glyph-name="wizards-of-the-coast" unicode="" horiz-adv-x="640"
|
3026 |
+
d="M219.19 102.31c7.44922 5.80078 16.2598 0.680664 21.7295 -7.0791c7.08984 -10.1201 6.24023 -18.1602 -0.259766 -23.04c-7.62012 -6.24023 -17.0898 0.129883 -21.7305 6.5498c-10.8096 15.1299 -1.63965 22.1895 0.260742 23.5693zM555.94 26.3701
|
3027 |
+
c1.30957 4.4502 3.92969 10.21 3.93945 20.1699c0 34.04 -41.6299 64.4102 -100.03 68.0801c-53.1592 3.39941 -120.46 -15.4502 -184.35 -73.8506l-0.790039 0.260742c1.58008 10.4697 -0.780273 16.2295 -3.40039 21.21l0.260742 1.56934
|
3028 |
+
c64.4199 51.3203 134.069 66.5107 188.8 60.4902c61.0098 -6.54004 104.479 -39.54 101.34 -78.0303c-0.790039 -9.68945 -2.88965 -15.71 -4.97949 -19.8994c-1.34082 -1.66992 -1.13086 -1.7002 -0.790039 0zM392.28 207.58
|
3029 |
+
c-0.530273 7.07031 3.13965 11.7803 6.7998 15.46c3.66992 3.91992 14.9297 10.4697 14.9297 10.4697s-1.2998 -26.4502 -2.08984 -29.8496c-1.04004 -3.92969 -4.96973 -6.81055 -10.4697 -6.5498c-4.98047 0.259766 -8.37988 3.39941 -9.16992 10.4697zM342.26 358.68
|
3030 |
+
c147.17 0 275.48 -86.6797 291.21 -196.939c0 0 -3.66992 -1.31055 -9.68945 -4.4502c0 -0.259766 1.0498 -10.7402 0.259766 -16.5c-0.259766 -1.83008 -1.0498 -1.0498 -1.0498 0c-0.270508 5.24023 -1.57031 11.5303 -2.36035 14.9297
|
3031 |
+
c-4.70996 -2.60938 -10.21 -6.54004 -15.9697 -11.7793c0 0 4.70996 -10.21 4.70996 -25.9209c0 -21.21 -8.37988 -32.9893 -16.5 -37.9697l-0.259766 0.520508c9.16992 9.16992 12.5693 21.4795 12.5693 31.9492c0 13.8701 -6.80957 33.25 -14.3994 41.3701
|
3032 |
+
c0 0 4.4502 -8.12012 6.80957 -17.8096c0 0 -21.21 -21.4697 -26.9697 -62.3203c0 0 -3.66992 9.16992 -10.7402 16.2402c0 0 12.0498 -15.4502 12.0498 -38.2305c0 -19.3799 -12.8398 -37.4395 -27.5 -48.1797c-0.989258 0 -0.790039 -0.169922 -0.790039 0.790039
|
3033 |
+
c15.71 12.8301 22.2607 28.0205 22.2607 46.3506c0 38.2295 -49.2305 80.3896 -130.15 80.3896c-96.1104 0 -181.74 -58.1299 -236.99 -128.05l-1.0498 0.259766c-40.3203 120.979 -135.64 185.66 -196.13 202.16c-2.09961 0.519531 -1.83984 0.790039 -0.790039 1.30957
|
3034 |
+
c12.3096 14.4004 136.96 151.88 341.47 151.88zM243.02 69.0596c16.8408 14.5908 4.99023 30.7705 4.71094 31.1602c-4.08008 5.99023 -16.3105 16.8506 -31.1602 5.5c-10.9502 -8.37988 -11.6406 -22.8896 -4.19043 -32.4697
|
3035 |
+
c6.44043 -8.26953 19.5801 -13.1797 30.6396 -4.19043zM245.11 205.49l1.83008 -8.11035l-3.6709 4.4502l-14.1396 -26.71l24.6201 -28.7998l12.5703 6.01953l-11.7803 70.96zM263.7 87.9102c3.41016 2.35938 7.33984 4.97949 9.67969 6.57031l-0.259766 0.259766
|
3036 |
+
c-1.56055 -0.780273 -3.11035 -1.0498 -12.5703 15.9697v0.259766c6.87012 5.16016 8.45996 4.89062 11.5205 5.5l0.259766 0.260742c-1.31055 3.66992 -1.31055 3.66992 -1.83008 5.5h-0.259766c-3.95996 -3.31055 -1.4707 -1.58008 -11.5205 -7.86035h-0.259766
|
3037 |
+
c-1.83008 3.13965 -4.19043 7.33008 -5.75977 9.68945v1.31055c4.4502 3.91992 10.2197 6.7998 12.3096 7.58984c2.87988 1.0498 4.19043 0.520508 5.24023 0.259766l0.259766 0.520508c-1.30957 1.83008 -2.08984 2.87988 -3.39941 4.70996l-0.520508 0.259766
|
3038 |
+
c-9.9502 -5.5 -17.54 -9.9502 -25.3994 -15.71l0.259766 -0.519531c1.30957 0.259766 3.13965 -0.260742 4.4502 -2.62012c15.04 -25.0801 19.5898 -27.5908 17.54 -31.6904zM318.96 120.38v0.25c-1.99023 0 -2.34961 -1.37012 -14.6602 30.6396v0.260742
|
3039 |
+
c4.95996 1.85938 8.78027 4.37988 12.3105 2.62012l0.259766 0.519531l-3.13965 4.98047l-0.520508 0.259766c-2.22949 -0.929688 -20.4697 -8.00977 -27.7598 -12.5703l-0.259766 -0.519531l1.0498 -5.76074h0.519531c1.0498 3.68066 9.7998 7.33008 9.9502 7.33008
|
3040 |
+
l0.259766 -0.259766c12.9404 -29.7598 13.0703 -29.8799 11.7803 -32.4697l0.259766 -0.259766c3.93066 2.09961 6.81055 3.40918 9.9502 4.97949zM363.73 136.88c-0.780273 0.520508 -2.09082 1.31055 -2.63086 3.92969c-1.56934 6.02051 -4.70996 20.1709 -6.2793 26.4502
|
3041 |
+
c-0.530273 1.57031 -0.530273 3.14062 0.519531 4.4502l-0.259766 0.259766c-3.41016 -0.529297 -6.29004 -1.30957 -10.7402 -2.35938v-0.260742c1.57031 -0.529297 2.10059 -2.09961 2.62012 -3.92969l2.62012 -9.42969l-0.259766 -0.259766
|
3042 |
+
c-3.40039 -1.05078 -8.90039 -2.62012 -12.8301 -3.93066h-0.259766c-0.780273 2.10059 -1.83008 5.75977 -3.14062 9.69043l0.259766 4.70996l-0.259766 0.259766c-4.71973 -1.30957 -7.59961 -2.34961 -10.7402 -3.40039v-0.519531
|
3043 |
+
c1.05078 0 2.10059 -1.30957 2.62012 -3.13965c1.0498 -3.40039 8.12012 -24.0908 9.16992 -27.2305c0.790039 -2.09961 0.790039 -3.66992 -0.259766 -4.97949l0.259766 -0.260742c3.14062 1.31055 6.54004 2.87988 10.21 3.93066v0.519531
|
3044 |
+
c-1.0498 0.259766 -2.08984 0.780273 -2.87988 3.13965c-1.0498 3.93066 -3.39941 11.2607 -4.18945 13.8809l0.259766 0.259766c3.92969 1.30957 9.42969 3.13965 12.8301 3.92969l0.259766 -0.259766c0.530273 -2.09961 2.62012 -10.2197 3.66992 -13.6201
|
3045 |
+
l-0.519531 -4.4502l0.259766 -0.259766c4.4502 1.57031 5.5 1.83008 9.69043 2.87988zM395.94 143.69c0.529297 1.8291 1.0498 3.65918 1.5791 6.04004h-0.259766c-2.0293 -4.06055 -15.0898 -5.09082 -16.2402 -4.71094l-0.259766 0.260742
|
3046 |
+
c-0.519531 3.13965 -1.83008 10.4795 -2.08984 12.5693l0.259766 0.260742c8.06055 0.899414 5.40039 1.0293 10.21 0h0.260742c0 3.40918 0.259766 3.66992 0.259766 5.23926h-0.259766c-5.98047 -2.2998 -1.2207 -0.679688 -10.7402 -2.35938l-0.259766 0.259766
|
3047 |
+
c-0.520508 3.40039 -1.31055 8.37988 -1.57031 9.9502l0.259766 0.259766c12.9004 2.41016 15.1006 0.349609 16.2402 -0.790039l0.259766 0.259766c-0.780273 2.36035 -1.0498 3.14062 -1.57031 5.5l-0.259766 0.260742
|
3048 |
+
c-4.71973 -0.260742 -15.71 -1.05078 -24.8799 -2.62012l-0.790039 -0.520508c1.83008 -0.790039 2.36035 -1.83984 2.62012 -3.66992c1.58008 -7.59961 3.41016 -18.3301 4.98047 -26.1895l-0.790039 -4.19043l0.259766 -0.259766
|
3049 |
+
c8.37988 1.83008 17.8096 3.66992 22.5195 4.18945zM406.68 188.2c3.14062 1.56934 7.33008 5.5 7.33008 5.50977c1.95996 -4.58008 0.970703 -2.70996 4.19043 -7.86035c10.1494 -0.459961 8.60938 0.0205078 20.4297 -1.0498l0.790039 4.70996
|
3050 |
+
s-4.18945 0 -5.75977 1.83008c-1.0498 1.31055 -1.31055 3.14062 -1.57031 5.5c0 2.36035 0.270508 16.5 0.790039 20.6904c0.259766 4.18945 2.08984 20.4199 2.08984 23.04c0.260742 2.62012 1.0498 8.91016 0.260742 12.0498
|
3051 |
+
c-4.82031 19.2803 -24.4307 17.8096 -50.0205 16.2402l-5.24023 -16.2402l2.62012 -2.87988c16.5498 16.5498 37.6201 4.56934 29.5898 -5.75977c-5.18945 -6.9209 -19.7393 -8.90039 -28.54 -17.0205c-6.47949 -6.49023 -12.2393 -20.9004 -5.5 -31.6904
|
3052 |
+
c6.12988 -11.0391 17.29 -9.96973 17.54 -9.94922c2.87988 0 6.55078 0.519531 11 2.87988zM443.86 166.99c0 1.83984 0.269531 4.18945 0.269531 5.25l-0.259766 0.519531c-14.3604 8.98047 -26.8604 0.919922 -28.7998 -9.9502
|
3053 |
+
c-2.83984 -16.0898 15.3594 -25.46 25.6602 -18.5898l0.519531 0.520508c0 0.259766 1.30957 4.4502 1.83008 6.2793l-0.259766 0.260742c-6.39062 -9.58008 -23.3203 -6.87012 -20.6904 10.21c1.91016 12.6602 15.3799 16.0801 21.7305 5.5zM449.63 254.72
|
3054 |
+
c0 0 4.96973 -0.790039 4.99023 -3.66016c0 -2.08984 -4.98047 -55.25 -4.98047 -55.25c-0.109375 -1.48926 -0.339844 -6.80957 -7.58984 -6.80957l-0.790039 -4.70996c18.3906 -2.83008 19.3701 -3.04004 36.9199 -7.33008l0.520508 4.70996
|
3055 |
+
c-13.0498 3.91992 -9.74023 7.37012 -4.4502 46.0898c1.09961 0.870117 8.62012 7.14062 20.6904 0.790039l11.2598 11.2598s-9.69043 8.90039 -14.9307 7.33008c-5.23926 -1.30957 -15.4492 -10.7393 -15.4492 -10.7393l1.56934 17.54
|
3056 |
+
c-8.10938 4.0498 -27.0693 7.3291 -27.7598 7.3291v-6.5498zM460.62 140.28c9.42969 -2.35059 16.2402 2.62012 18.8496 11.5195c2.08984 7.60059 -1.56934 16.7598 -10.7393 19.3799c-6.54004 2.10059 -15.7109 -0.779297 -18.8506 -10.21
|
3057 |
+
c-3.39941 -9.68945 2.62012 -18.5996 10.7402 -20.6895zM502.78 130.59c-0.780273 1.31055 -1.04004 2.10059 -0.799805 3.91016c1.22949 27.0098 1.5293 24.6602 1.0498 25.1396c-2.08984 0.790039 -5.5 2.09082 -7.58984 2.87988l-0.520508 -0.259766v-2.08984
|
3058 |
+
c-3.92969 -6.01953 -10.4795 -15.4502 -13.8799 -20.1602l-2.62012 -1.83008v-0.259766c2.08984 -0.259766 4.70996 -1.30957 6.02051 -1.57031v0.260742l0.790039 3.39941c0.789062 1.0498 2.35938 3.66992 3.66992 5.5c0.40918 0 2.25 -0.549805 7.06934 -2.35938
|
3059 |
+
c0.330078 -0.320312 0.330078 0.649414 -0.259766 -7.59082l-1.57031 -1.8291v-0.260742c1.57031 -0.519531 6.28027 -2.35938 8.64062 -2.87988zM498.07 220.41c-13.2207 -21.1504 -9.39062 -51.6006 9.66992 -52.9004c5.75977 -0.259766 9.42969 3.93066 9.68945 3.66992
|
3060 |
+
l-2.08984 -6.80957c8.91016 -4.21973 11.4404 -5.29004 17.8105 -8.63965l1.83008 4.44922c-6.14062 3.51074 -1.29004 11.25 24.6191 84.3203c-6.13965 6.45996 -10.2998 10.0596 -22.5195 20.4297l-1.83008 -3.66992c1.62988 -1.35938 6.79004 -5.00977 4.4502 -11.2598
|
3061 |
+
l-7.58984 -26.1904c-3.28027 12.79 -22.79 14.8701 -34.04 -3.39941zM527.4 141.07l2.35938 3.39941v0.520508c-3.41016 6.83008 -11.9395 7.41992 -14.6602 2.35938c-1.83984 -3.40918 0.260742 -7.06934 1.83008 -9.68945
|
3062 |
+
c1.57031 -2.87988 3.14062 -6.29004 2.08984 -8.37988c-2.31934 -4.62988 -8.94922 -0.680664 -8.37988 4.97949l-0.790039 -0.259766c-2.09961 -4.7998 -1.83008 -4.00977 -1.83008 -4.70996c3.05078 -6.09961 12.8105 -7.12988 15.4502 -0.790039
|
3063 |
+
c1.57031 3.15039 0.520508 6.80957 -1.0498 9.42969c-1.83008 3.40039 -4.18945 6.29004 -2.87988 8.37988c1.51953 2.65039 7.86035 0.470703 7.86035 -5.23926zM548.61 127.71l1.30957 3.91016l-0.259766 0.259766c-2.36035 2.08984 -8.64062 6.54004 -12.3105 8.90039
|
3064 |
+
h-0.259766l-3.13965 -3.40039v-0.259766c4.7998 -0.320312 3.37988 0.149414 6.01953 -1.83008v-0.259766c-2.62012 -4.9707 -6.0293 -11.2607 -9.16992 -17.0205l-2.08984 -1.30957l-0.259766 -0.259766l5.75977 -4.4502l0.259766 0.259766
|
3065 |
+
c-0.259766 0.530273 -0.519531 1.57031 0.790039 3.92969c2.87988 5.77051 6.28027 12.0508 8.64062 16.2402h0.259766c3.54004 -2.57031 2.49023 -1.43945 4.4502 -4.70996zM575.84 171.97l7.85059 10.46s-9.4209 18.8604 -23.04 16.5
|
3066 |
+
c-20.8408 -4.0293 -3.15039 -34.21 -2.09082 -38.2295c4.33008 -15.1299 -16.3193 -12.5605 -13.3496 5.24023l-2.87988 2.08984l-4.98047 -14.4004s11.7803 -11.2598 20.1602 -10.4697c8.12012 0.790039 13.8799 6.29004 13.8799 16.5
|
3067 |
+
c0 8.37988 -7.85938 22.7803 -7.85938 27.7598c0 6.86035 12.2695 4.75977 11.5195 -4.97949c-0.259766 -2.61035 -1.2998 -5.23047 -2.08984 -7.59082zM611.46 182.18c0.780273 -2.35938 1.57031 -1.83008 0.790039 0.270508
|
3068 |
+
c-32.4697 98.9795 -132.76 138.78 -199.8 139.83c-50.54 0.779297 -89.5605 -11.79 -131.98 -35.8799l20.6904 61.0098l-33.7803 -65.7305l-8.89941 20.9502c3.13965 1.04004 6.2793 2.08984 6.2793 2.08984l-2.62012 8.64062s-3.13965 -0.780273 -7.33008 -2.09082
|
3069 |
+
l-12.0498 28.2803l13.6201 -61.0098c-5.12012 2.55957 -19.0996 6.83008 -6.5498 19.3799l-2.62012 11c-6.97949 -2.21973 -13.2295 -3.62012 -32.21 -9.68945l-23.0801 11.5l59.1797 -42.6807l-4.70996 -2.08984l-17.2793 13.8799
|
3070 |
+
c2.23926 -5.13965 3.2998 -12.1699 4.70996 -19.6396l-28.54 -13.0898l-30.1104 36.1396l-17.2803 -9.16992l13.6201 -42.4199l-11.2598 -4.98047l94.2695 29.3301l-3.66992 -10.4697l-0.519531 3.13965l-13.0898 -3.39941l4.97949 -24.6201l-4.4502 -12.3105
|
3071 |
+
l-25.6592 30.6406l-39.8008 -10.21l18.8506 -58.9199c-60.1299 62.3994 -67.7002 66.3994 -61.7998 75.6797c2.09961 2.87988 7.85938 7.07031 7.85938 7.07031l-4.18945 7.06934c-26.7803 -18.3496 -27.8398 -19.1494 -58.4004 -42.6797l4.98047 -6.01953
|
3072 |
+
s8.12012 5.75977 13.6201 5.5c7.81934 -0.350586 1.76953 2.93945 113.659 -98.7305l11.7803 8.37988l-27.7598 93.4805l35.8799 -42.1602l-4.70996 -13.8799l41.9004 88.5098c34.6699 -80.5098 29.1494 -66.9502 32.9893 -78.8203l-33.5195 67.2998l-2.36035 -4.44922
|
3073 |
+
c1.2998 -1.30078 -0.919922 3.05957 22.7803 -59.4404c3.22949 -8.88965 -1.10059 -9.88965 -5.5 -12.8301l2.36035 -4.70996c15.3594 6.79004 22.9395 9.54004 39.0195 14.4004l-1.0498 4.97949c-8.89062 -1.33008 -10.1006 0.169922 -12.0498 4.4502
|
3074 |
+
c-1.05078 2.09961 -14.1504 40.0703 -20.4307 58.6602l-10.21 4.97949l-2.35938 8.12012l61.54 -36.6602l-13.0908 -43.21c12.1904 3.26074 27.0303 6.74023 49.4902 9.9502l-0.259766 26.71l-4.98047 -1.0498c-0.669922 -13.7998 -6.0293 -22.0801 -19.6396 -22.7803
|
3075 |
+
l22.2598 80.3906c-27.6201 -0.450195 -59.2695 -7.19043 -66.7695 -8.90039l3.92969 -16.5l-25.1396 19.6396l91.3896 20.6904l-85.6299 -9.16992c38.4902 22.5195 79.3398 39.0195 132.76 37.9697c131.46 -2.08984 180.95 -99.2402 191.95 -129.62zM203.48 295.57
|
3076 |
+
l2.35938 -8.64062c7.82031 2.61035 10.8604 2.36035 11.2598 2.36035l-9.42969 7.58984c-2.36035 -0.790039 -4.18945 -1.30957 -4.18945 -1.30957zM347.24 257.07l-11.5303 -37.71l-21.7295 17.0195c6.7998 25.5 31.6895 21.29 33.2598 20.6904zM318.43 380.93
|
3077 |
+
c224.94 0 321.83 -143.76 321.57 -227.55c0 -11 -0.269531 -17.5498 -0.790039 -19.6396c-0.259766 -2.10059 -1.0498 -0.790039 -1.0498 0.519531v9.9502c0 106.58 -121.51 223.37 -301.67 223.37c-61.2705 0 -103.69 -12.0498 -110.24 -13.8799l-1.57031 0.259766
|
3078 |
+
c-6.80957 7.58984 -12.8301 9.69043 -21.21 11.7803v0.790039c8.91016 2.34961 56.5605 14.3994 114.96 14.3994zM529.49 211.25c-8.61035 -34.4502 -13.6504 -35.3496 -18.3301 -35.3604c-7.33008 0 -6.81055 9.43066 -6.02051 14.9307
|
3079 |
+
c0.879883 9.72949 7.40039 34.6494 17.0205 33.5195c7.33008 -0.780273 8.63965 -7.33008 7.33008 -13.0898zM467.96 168.3c3.40039 -0.780273 7.84961 -4.4502 5.23047 -14.3896c-2.88086 -11.2598 -8.11035 -11.79 -11.7803 -10.7402
|
3080 |
+
c-5.5 1.31055 -7.85059 7.84961 -6.02051 14.6602c3.14062 11.2598 9.9502 11.2598 12.5703 10.4697zM491 147.35v0.270508c1.0498 1.83008 5.5 8.63965 6.5498 9.9502c-0.269531 -3.66992 -0.790039 -10.2207 -0.790039 -12.0508
|
3081 |
+
c-2.62012 0.780273 -3.92969 1.31055 -5.75977 1.83008z" />
|
3082 |
+
<glyph glyph-name="think-peaks" unicode="" horiz-adv-x="576"
|
3083 |
+
d="M465.4 38.5996l-206.2 353.801l-204.2 -352.101l-32 0.299805l236.2 407.4l206.2 -353.9l55.0996 95l32 -0.299805zM110.1 82.7002l149.601 257.899l235.8 -404.6l-32.5 0.0996094l-203.4 349.101l-117.399 -202.5h-32.1006z" />
|
3084 |
+
<glyph glyph-name="reacteurope" unicode="" horiz-adv-x="576"
|
3085 |
+
d="M250.6 236.26l2 6.7998l-5.69922 4.30078l7.19922 0.0996094l2.30078 6.7998l2.2998 -6.7998l7.09961 -0.0996094l-5.7002 -4.30078l2.10059 -6.7998l-5.7998 4.10059zM314.3 236.26l1.90039 6.7998l-5.7002 4.30078l7.2002 0.0996094l2.2998 6.7998l2.2998 -6.7998
|
3086 |
+
l7.2002 -0.0996094l-5.7002 -4.30078l2.10059 -6.7998l-5.80078 4.10059zM223 185.76c4.90039 0 3.7998 -3.89941 3.7998 -13.7598c0 -10.2998 -6.7002 -14.0996 -16.7998 -14.0996h-0.200195c-10.0996 0 -16.7998 3.69922 -16.7998 14.0996v40.0596
|
3087 |
+
c0 9.90039 6.7002 14.1006 16.7998 14.1006h0.200195c10.0996 0 16.7998 -4.2002 16.7998 -14.1006c0 -8.39941 0.900391 -12.1992 -3.7998 -12.2998h-3.40039c-4.5 0 -3.7998 3.2998 -3.7998 10.5c0 4.7002 -2.2998 6.10059 -5.7998 6.10059
|
3088 |
+
s-5.7998 -1.40039 -5.7998 -6.10059v-36.5996c0 -4.7002 2.2998 -6.10059 5.7998 -6.10059s5.7998 1.40039 5.7998 6.10059c0 8.09961 -1 12.0996 3.7998 12.0996h3.40039zM142.3 168.36c2.5 0 3.7998 -1.30078 3.7998 -3.80078v-2.09961
|
3089 |
+
c0 -2.5 -1.2998 -3.7998 -3.7998 -3.7998h-21.8994c-2.5 0 -3.80078 1.2998 -3.80078 3.7998v59.0996c0 2.5 1.30078 3.90039 3.7002 3.80078h21.7002c2.5 0 3.7998 -1.30078 3.7998 -3.80078v-2.09961c0 -2.5 -1.2998 -3.7998 -3.7998 -3.7998h-14.4004v-18.2998h11.4004
|
3090 |
+
c2.5 0 3.7998 -1.30078 3.7998 -3.80078v-2.09961c0 -2.5 -1.2998 -3.7998 -3.7998 -3.7998h-11.4004v-19.2998h14.7002zM100.3 186.86l8.10059 -23.9004c0.799805 -2.59961 -0.400391 -4.40039 -3.2002 -4.40039h-3.2998
|
3091 |
+
c-0.0820312 -0.00585938 -0.21582 -0.0107422 -0.297852 -0.0107422c-1.81543 0 -3.6084 1.43848 -4.00293 3.21094l-7.39941 23.5h-5.60059v-22.8994c0 -2.5 -1.2998 -3.80078 -3.7998 -3.80078h-3.39941c-2.5 0 -3.80078 1.30078 -3.80078 3.80078v59.0996
|
3092 |
+
c0 2.5 1.30078 3.7998 3.80078 3.7998h13.3994c10.1006 0 16.7998 -4 16.7998 -14.0996v-11.9004c0 -6.39941 -2.69922 -10.3994 -7.2998 -12.3994zM96.5 200.86v8.69922c0 4.80078 -2.5 6.10059 -6.09961 6.10059h-5.80078v-20.9004h5.80078
|
3093 |
+
c3.59961 0 6.09961 1.2998 6.09961 6.10059zM176 222l11.2002 -59.2002c0.5 -2.7002 -0.799805 -4.09961 -3.40039 -4.09961h-3.5c-0.100586 -0.00976562 -0.264648 -0.0185547 -0.366211 -0.0185547c-1.94531 0 -3.61816 1.57617 -3.7334 3.51855l-1.7998 11.2998h-12.2002
|
3094 |
+
l-1.7998 -11.2998c-0.116211 -1.94238 -1.78809 -3.51855 -3.7334 -3.51855c-0.101562 0 -0.265625 0.00878906 -0.367188 0.0185547h-3c-2.5 0 -3.89941 1.39941 -3.39941 4.09961l11 59.2002c0.135742 1.88477 1.78027 3.41504 3.66992 3.41504
|
3095 |
+
c0.0908203 0 0.239258 -0.00683594 0.330078 -0.0146484h6.89941c0.110352 0.0117188 0.290039 0.0205078 0.401367 0.0205078c1.89844 0 3.60059 -1.53223 3.79883 -3.4209zM163.7 182.7h9.39941l-4.69922 29.7002zM253 162.5c0 -2.45996 -1.2998 -3.83984 -3.7998 -3.7998
|
3096 |
+
h-3.40039c-2.5 0 -3.7998 1.2998 -3.7998 3.7998v53.2002h-7.2998c-2.5 0 -3.7998 1.2998 -3.7998 3.7998v2.09961c0 2.5 1.2998 3.80078 3.7998 3.80078h25.7998c2.5 0 3.7998 -1.30078 3.7998 -3.80078v-2.09961c0 -2.5 -1.2998 -3.7998 -3.7998 -3.7998h-7.5v-53.2002z
|
3097 |
+
M501 163.3c0.0449219 0.00390625 0.119141 -0.0322266 0.164062 -0.0322266c1.01562 0 1.84082 -0.824219 1.84082 -1.83984c0 -0.0351562 -0.00292969 -0.0927734 -0.00488281 -0.12793v-0.799805c0.00195312 -0.0273438 0.00292969 -0.0722656 0.00292969 -0.100586
|
3098 |
+
c0 -0.999023 -0.810547 -1.80957 -1.81055 -1.80957c-0.0527344 0 -0.139648 0.00488281 -0.192383 0.00976562h-22.5c-0.0527344 -0.00488281 -0.139648 -0.00976562 -0.192383 -0.00976562c-1 0 -1.81055 0.810547 -1.81055 1.80957
|
3099 |
+
c0 0.0283203 0.000976562 0.0732422 0.00292969 0.100586v63c-0.00878906 0.0625 -0.0166016 0.166016 -0.0166016 0.229492c0 0.893555 0.725586 1.62012 1.62012 1.62012c0.111328 0 0.289062 -0.0224609 0.396484 -0.0498047h22.2002
|
3100 |
+
c0.0644531 0.00878906 0.169922 0.015625 0.235352 0.015625c0.977539 0 1.77051 -0.792969 1.77051 -1.76953c0 -0.0400391 -0.00292969 -0.105469 -0.00585938 -0.145508v-0.800781c0.00195312 -0.03125 0.00292969 -0.0820312 0.00292969 -0.113281
|
3101 |
+
c0 -1.04297 -0.84668 -1.88965 -1.88965 -1.88965c-0.03125 0 -0.0820312 0.000976562 -0.113281 0.00292969h-19.1006v-25.7998h16.1006c0.03125 0.00195312 0.0820312 0.00390625 0.113281 0.00390625c1.04297 0 1.88965 -0.84668 1.88965 -1.89062
|
3102 |
+
c0 -0.03125 -0.000976562 -0.0820312 -0.00292969 -0.113281v-0.799805c0.00195312 -0.03125 0.00292969 -0.0820312 0.00292969 -0.113281c0 -1.04297 -0.84668 -1.88965 -1.88965 -1.88965c-0.03125 0 -0.0820312 0.000976562 -0.113281 0.00292969h-16.1006v-26.7002
|
3103 |
+
h19.4004zM407.9 226.2c10.0996 0 15.2998 -4.74023 15.2998 -14.1006v-40.0996c0 -9.2998 -5.2002 -14.0996 -15.2998 -14.0996h-0.800781c-10.0996 0 -15.2998 4.7998 -15.2998 14.0996v40.0996c0 9.40039 5.2002 14.1006 15.2998 14.1006h0.800781zM418.1 173.8v36.6006
|
3104 |
+
c0 7.89941 -3 11.0996 -10.5 11.0996s-10.5 -3.2002 -10.5 -11.0996v-36.6006c0 -8 3 -11.0996 10.5 -11.0996s10.4004 3.09961 10.5 11.0996zM371.6 188.3l10.6006 -27.2998c0.5 -1.2998 -0.100586 -2.2998 -1.5 -2.2998h-1.5
|
3105 |
+
c-0.0351562 -0.00195312 -0.0927734 -0.00390625 -0.128906 -0.00390625c-0.886719 0 -1.85938 0.673828 -2.1709 1.50391l-10.4004 27.2002h-11.5996v-26.9004c0.00390625 -0.0458984 0.0078125 -0.12207 0.0078125 -0.167969
|
3106 |
+
c0 -0.960938 -0.779297 -1.74023 -1.74023 -1.74023c-0.0458984 0 -0.12207 0.00390625 -0.167969 0.0078125h-1.2002c-0.0527344 -0.00488281 -0.139648 -0.00976562 -0.192383 -0.00976562c-0.999023 0 -1.81055 0.810547 -1.81055 1.80957
|
3107 |
+
c0 0.0283203 0.00195312 0.0732422 0.00292969 0.100586v63c-0.000976562 0.0273438 -0.00292969 0.0722656 -0.00292969 0.100586c0 0.999023 0.811523 1.80957 1.81055 1.80957c0.0527344 0 0.139648 -0.00488281 0.192383 -0.00976562h13.7002
|
3108 |
+
c10.0996 0 15.2998 -4.7002 15.2998 -14.1006v-9.7002c0 -7.19922 -3.09961 -11.6992 -9.2002 -13.2998zM365.2 192.2c7.5 0 10.5 3.16016 10.5 11v6.39941c0 8 -3 11.1006 -10.5 11.1006h-10.2002v-28.5h10.2002zM451.1 225.3c10.1006 0 15.3008 -4.7002 15.3008 -14.0996
|
3109 |
+
v-10.5c0 -9.2998 -5.2002 -14.1006 -15.3008 -14.1006h-10.5996v-26.0996c0.00488281 -0.0458984 0.0078125 -0.12207 0.0078125 -0.167969c0 -0.960938 -0.779297 -1.74023 -1.73926 -1.74023c-0.046875 0 -0.12207 0.00390625 -0.168945 0.0078125h-1.19922
|
3110 |
+
c-0.0537109 -0.00488281 -0.139648 -0.00976562 -0.193359 -0.00976562c-0.999023 0 -1.80957 0.810547 -1.80957 1.80957c0 0.0283203 0.000976562 0.0732422 0.00292969 0.100586v63c-0.00976562 0.0625 -0.0166016 0.166016 -0.0166016 0.229492
|
3111 |
+
c0 0.893555 0.725586 1.62012 1.62012 1.62012c0.111328 0 0.288086 -0.0224609 0.396484 -0.0498047h13.6992zM461.3 202.5v7.09961c0 7.90039 -3 11.1006 -10.5 11h-10.2002v-29.1992h10.2002c7.5 0 10.5 3.19922 10.5 11.0996zM259.5 140l7.09961 -0.0996094
|
3112 |
+
l-5.69922 -4.30078l2.09961 -6.7998l-5.7998 4.10059l-5.7998 -4.10059l2.09961 6.7998l-5.7002 4.30078l7.10059 0.0996094l2.2998 6.7998zM487.1 276.1c122.301 -46.0996 118.401 -132.54 -33.8984 -176.34c13.3994 -49.7002 18.0996 -101.899 0.0996094 -133.8
|
3113 |
+
c-3.7998 -6.7002 -16.7998 -27.7002 -47.5996 -27.7002c-41.5 0 -110.2 41.6006 -182.101 142c-42.7998 3.5 -72.1992 10.1006 -84.5996 13c-20.5 -82.2998 -6.7998 -125.3 15.5 -137.899c1.2002 -0.700195 38.4004 -27.2002 120.9 52.7998
|
3114 |
+
c3.39941 -3.5 6.79883 -6.90039 10.1982 -10.2002c-63.0996 -61.2002 -110.199 -71 -138.199 -55.2002c-32.4004 18.2998 -42.8008 72 -22.3008 153.9c-18.8994 5 -121.6 33.2002 -122.1 92.7998c-0.400391 40.9004 49.7998 74.7002 120.3 95
|
3115 |
+
c-13.3994 49.5996 -18.2002 101.8 -0.0996094 133.8c3.7998 6.74023 16.7998 27.7402 47.5996 27.7402c41.6006 0 110.3 -41.6396 182.2 -142.14c23.6113 -1.88379 61.5127 -7.70801 84.5996 -13c20.5 82 6.90039 125.1 -15.5 137.8
|
3116 |
+
c-1.2998 0.700195 -38.3994 27.2002 -120.899 -52.7998c-3.40039 3.5 -6.80078 6.89941 -10.2002 10.1992c52.2998 50.9404 103.7 74.6006 138.2 55.2402c33.8994 -19.2002 41.8994 -75.8994 22.2998 -153.899c9.98535 -2.61523 25.9346 -7.67773 35.5996 -11.3008z
|
3117 |
+
M135.901 411.16c-23.1006 -40.7998 1 -121.562 1.19922 -122.961c22.9912 5.78516 60.8018 12.3262 84.4004 14.5996c12.7793 18.6787 35.4922 47.4404 50.7002 64.2002c3.39941 -3.33301 6.7998 -6.74609 10.2002 -10.2393
|
3118 |
+
c-12.5371 -13.7451 -31.4434 -37.2207 -42.2002 -52.3994c14.8213 1.11914 38.9141 2.02734 53.7783 2.02734c11.082 0 29.0566 -0.504883 40.1211 -1.12793c-64.5 86.6006 -126.5 126.2 -163.3 126.2c-23 0 -32 -15.2002 -34.8994 -20.2998zM440.701 -27.1406
|
3119 |
+
c3.2998 6 21.5 38.5996 -1.2002 123c-4.09961 -1.10059 -37.0996 -9.90039 -84.4004 -14.6006c-12.7578 -18.6943 -35.4717 -47.4551 -50.6992 -64.2002c-3.40039 3.2998 -6.80078 6.7002 -10.2002 10.2002c12.5371 13.7461 31.4424 37.2207 42.2002 52.4004
|
3120 |
+
c-14.7715 -1.14258 -38.7842 -2.06934 -53.5996 -2.06934c-11.1328 0 -29.1875 0.524414 -40.3008 1.16895c64.5996 -86.7998 126.6 -126.2 163.3 -126.2c23.1006 0 32 15.2002 34.9004 20.3008zM449.801 111.459c25.6006 7.2998 85.9004 27.4004 105.7 62.5
|
3121 |
+
c1.40039 2.5 33.5 50.5 -72.5996 90.4004c-9.36914 3.51562 -24.8252 8.44336 -34.5 11c-3.60059 -12.9004 -7.90039 -26.1006 -12.8008 -39.5c-3.15723 -0.430664 -7.14453 -2.93945 -8.89941 -5.60059l-0.100586 0.100586
|
3122 |
+
c-1.6416 1.55762 -4.68848 3.48438 -6.7998 4.2998c5.7002 15 10.6006 29.7998 14.6006 44.2002c-7.2002 1.69922 -31.8008 7.59961 -72.2002 11.6992c16.7002 -24.5 27.8994 -44.0996 34.2998 -55.5c-3.50781 -1.14648 -8.16699 -4.46094 -10.4004 -7.39941
|
3123 |
+
c-13.5996 16.3994 -11 19.8994 -42.5 64.5c-13.752 0.96582 -36.1016 1.75 -49.8877 1.75c-17.2871 0 -45.292 -1.23145 -62.5117 -2.75c-16.9004 -25 -28.2998 -45.2002 -34.7998 -56.9004c-3.49707 -1.49023 -8.06738 -5.25391 -10.2002 -8.39941
|
3124 |
+
c-0.914062 2.88965 -3.78125 6.47363 -6.40039 8c6.10059 11.3994 16.9004 31 32.7998 55.2998c-39.5996 -4.60059 -65 -11.2002 -72 -13c4.30078 -14.1006 9.40039 -28.6006 15.2002 -43.2998c-0.71582 -0.522461 -1.74609 -1.50781 -2.2998 -2.2002
|
3125 |
+
c-1.5 1.89941 -4 5.2998 -14.4004 5.2998c-4.69922 12.2998 -8.7998 24.5 -12.3994 36.4004c-138.8 -40.3604 -158.4 -121.36 1.5 -164c3.59961 12.8994 7.7998 26 12.7002 39.3994c0.269531 -0.0146484 0.708008 -0.0273438 0.978516 -0.0273438
|
3126 |
+
c1.68359 0 4.33594 0.460938 5.9209 1.02734c3 -1.2002 5.2002 -1 8.40039 -1c-5.5 -14.5996 -10.2002 -28.8994 -14.1006 -42.8994c19.7119 -4.56055 52.0576 -9.80176 72.2002 -11.7002c-16.2998 23.8994 -27.5 43.3994 -33.7998 54.5996
|
3127 |
+
c8.7002 0 10.7002 1.60059 12.5996 3.2002c0.794922 -0.480469 2.13965 -1.15234 3 -1.5c15.3008 -26.7002 28.9004 -46.5996 36.8008 -57.7998c13.751 -0.96582 36.1006 -1.75 49.8857 -1.75c17.2871 0 45.2939 1.23145 62.5137 2.75
|
3128 |
+
c16.5 24.2998 27.7002 44 33.9004 55.2002c7.2998 0 9.7998 3 10.8994 4.19922c1.5332 -1.11426 4.2207 -2.54785 6 -3.19922c-15 -28 -28.6992 -48.9004 -32.1992 -54.2002c20.1172 2.22656 52.373 8.05078 72 13c-4.10059 13.7998 -9 27.8994 -14.7002 42.2002
|
3129 |
+
c1.65723 0.743164 4.07617 2.35645 5.39941 3.59961l0.100586 0.0996094c2.07227 -3.14648 6.8125 -5.7002 10.5811 -5.7002c0.0322266 0 0.0859375 0 0.119141 0.000976562c4.69922 -12.3008 8.7998 -24.5 12.3994 -36.4004zM335.401 225.459
|
3130 |
+
c0.0556641 0.00585938 0.145508 0.0107422 0.201172 0.0107422c1.05566 0 1.95117 -0.856445 1.99805 -1.91113v-51.5c0 -9.5 -5 -14.0996 -15.0996 -14.0996h-0.400391c-10.0996 0 -15.0996 4.5 -15.0996 14.0996v51.5
|
3131 |
+
c-0.00195312 0.0283203 -0.00292969 0.0732422 -0.00292969 0.100586c0 0.999023 0.810547 1.81055 1.81055 1.81055c0.0527344 0 0.139648 -0.00488281 0.192383 -0.0107422h1.2002c0.0615234 0.00878906 0.162109 0.0146484 0.224609 0.0146484
|
3132 |
+
c0.933594 0 1.69043 -0.756836 1.69043 -1.68945c0 -0.0625 -0.00683594 -0.163086 -0.015625 -0.225586v-49.7998c0 -8 2.60059 -11.0996 10.1006 -11.0996s10.0996 3.2002 10.0996 11.0996v49.7998c-0.00390625 0.046875 -0.0078125 0.12207 -0.0078125 0.168945
|
3133 |
+
c0 0.959961 0.779297 1.73926 1.74023 1.73926c0.0458984 0 0.121094 -0.00292969 0.167969 -0.0078125h1.2002zM321.701 139.999l7.09961 -0.0996094l-5.7002 -4.30078l2.10059 -6.7998l-5.7998 4.10059l-5.80078 -4.10059l2.10059 6.7998l-5.7002 4.30078
|
3134 |
+
l7.09961 0.0996094l2.30078 6.7998zM290.601 132.599l7.10059 -0.0996094l-5.7002 -4.2998l2.09961 -6.7998l-5.7998 4.09961l-5.7998 -4.09961l2.09961 6.7998l-5.69922 4.2998l7.09961 0.0996094l2.2998 6.80078zM295.701 163.399
|
3135 |
+
c0.0507812 0.00488281 0.133789 -0.03125 0.185547 -0.03125c1.00977 0 1.83008 -0.819336 1.83008 -1.83008c0 -0.0664062 -0.00683594 -0.172852 -0.015625 -0.239258v-0.799805c0.00292969 -0.0400391 0.00585938 -0.105469 0.00585938 -0.145508
|
3136 |
+
c0 -0.977539 -0.792969 -1.77051 -1.77051 -1.77051c-0.0654297 0 -0.170898 0.00683594 -0.235352 0.015625h-22.5c-0.0537109 -0.00488281 -0.139648 -0.00976562 -0.193359 -0.00976562c-0.999023 0 -1.80957 0.810547 -1.80957 1.80957
|
3137 |
+
c0 0.0283203 0.000976562 0.0732422 0.00292969 0.100586v63c-0.00195312 0.0273438 -0.00292969 0.0722656 -0.00292969 0.100586c0 0.999023 0.810547 1.80957 1.80957 1.80957c0.0537109 0 0.139648 -0.00488281 0.193359 -0.00976562h22.2002
|
3138 |
+
c0.0644531 0.00878906 0.169922 0.015625 0.235352 0.015625c0.977539 0 1.77051 -0.792969 1.77051 -1.77051c0 -0.0400391 -0.00292969 -0.105469 -0.00585938 -0.145508v-0.799805c0.00195312 -0.03125 0.00292969 -0.0820312 0.00292969 -0.113281
|
3139 |
+
c0 -1.04395 -0.84668 -1.89062 -1.88965 -1.89062c-0.03125 0 -0.0820312 0.00195312 -0.113281 0.00390625h-19.1006v-25.7998h16.1006c0.03125 0.00195312 0.0820312 0.00292969 0.113281 0.00292969c1.04297 0 1.88965 -0.84668 1.88965 -1.88965
|
3140 |
+
c0 -0.03125 -0.000976562 -0.0820312 -0.00292969 -0.113281v-0.800781c0.00195312 -0.03125 0.00292969 -0.0820312 0.00292969 -0.113281c0 -1.04297 -0.84668 -1.88965 -1.88965 -1.88965c-0.03125 0 -0.0820312 0.000976562 -0.113281 0.00292969h-16.1006v-26.6992
|
3141 |
+
h19.4004zM288.301 262.799l2.2998 -6.7998l7.10059 -0.0996094l-5.7002 -4.30078l2.09961 -6.7998l-5.7998 4.10059l-5.7998 -4.10059l2.09961 6.7998l-5.69922 4.30078l7.09961 0.0996094z" />
|
3142 |
+
<glyph glyph-name="adobe" unicode="" horiz-adv-x="512"
|
3143 |
+
d="M315.5 384h170.9v-384zM196.5 384l-170.9 -384v384h170.9zM256 241.9l107.5 -241.9h-73l-30.7002 76.7998h-78.7002z" />
|
3144 |
+
<glyph glyph-name="artstation" unicode="" horiz-adv-x="512"
|
3145 |
+
d="M2 70.5996h315.1l59.2002 -102.6h-285.399h-0.0146484c-17.4814 0 -38.0381 12.6787 -45.8857 28.2998zM501.8 98c19 -29.4004 -0.0996094 -55.9004 -2 -59.0996l-40.7002 -70.5l-257.3 447.6h88.4004h0.0117188c17.0596 0 37.3936 -12.2305 45.3877 -27.2998zM275 143.5
|
3146 |
+
h-231l115.5 200z" />
|
3147 |
+
<glyph glyph-name="atlassian" unicode="" horiz-adv-x="512"
|
3148 |
+
d="M152.2 211.6c66.2998 -70.7998 89.0996 -189.3 51.2002 -267.1c-2.40039 -5.2002 -7.60059 -8.5 -13.4004 -8.40039h-175c-11 0 -18.4004 11.7002 -13.4004 21.7002l125.801 251c5.09961 10.5 17.0996 11 24.7998 2.7998zM244.4 439.9
|
3149 |
+
c6.7998 10.8994 20.2998 10.6992 25.5996 0.0996094c5.90039 -11.7002 240.4 -482.3 240.4 -482.3c5 -9.90039 -2.2002 -21.7002 -13.4004 -21.7002h-174.2c-5.7002 0 -10.8994 3.2998 -13.3994 8.40039c-73.5 146.899 -187.301 302.1 -65 495.5z" />
|
3150 |
+
<glyph glyph-name="canadian-maple-leaf" unicode="" horiz-adv-x="512"
|
3151 |
+
d="M383.8 96.2998c-5 -5 -10 -7.5 -5 -22.5s10 -35.0996 10 -35.0996s-95.2002 20.0996 -105.2 22.5996c-8.89941 0.900391 -18.3994 -2.39941 -18.3994 -12.5c0 -10.0996 5.7998 -112.8 5.7998 -112.8h-30s5.7998 102.8 5.7998 112.8s-9.59961 13.4004 -18.2998 12.5
|
3152 |
+
c-10.0996 -2.5 -105.3 -22.5996 -105.3 -22.5996s5 20.0996 10.0996 35.0996c4.90039 15 0 17.5 -5.09961 22.5c-2.60059 2.5 -105.2 92.4004 -105.2 92.4004l17.5 7.59961c10 4.90039 7.40039 11.4004 5 17.4004c-2.5 7.59961 -20.0996 67.2998 -20.0996 67.2998
|
3153 |
+
s47.5996 -10 57.6992 -12.5c7.5 -2.40039 10 2.5 12.5 7.5s15 32.2998 15 32.2998s52.6006 -59.7998 55.1006 -62.2998c10.0996 -7.5 20.0996 0 17.5996 10c0 10 -27.5996 129.6 -27.5996 129.6s30.0996 -17.3994 40.0996 -22.3994c7.60059 -5 12.6006 -5 17.6006 5
|
3154 |
+
c5 7.5 42.5 79.7998 42.5 79.7998s37.5996 -72.2998 42.6992 -79.7998c5 -10 10.1006 -10 17.6006 -5c10 5 40.0996 22.3994 40.0996 22.3994s-27.5996 -119.6 -27.5996 -129.6c-2.5 -10 7.59961 -17.5 17.5996 -10c2.5 2.40039 55.1006 62.2998 55.1006 62.2998
|
3155 |
+
s12.5 -27.3994 15 -32.3994s5 -9.90039 12.5 -7.5c10 2.5 57.6992 12.5 57.6992 12.5s-17.6992 -59.7002 -20.0996 -67.3008c-2.40039 -5.89941 -5 -12.5 5 -17.3994l17.5 -7.5s-102.7 -89.9004 -105.2 -92.4004z" />
|
3156 |
+
<glyph glyph-name="centos" unicode=""
|
3157 |
+
d="M289.6 350.5l31.6006 -31.7002l-76.2998 -76.5v108.2h44.6992zM127.2 318.8l31.5996 31.7002h44.7002v-108.2zM168.7 360.4l55.5 55.5996l55.5 -55.5996h-44.7002v-127.9l-10.7998 -10.7998l-10.7998 10.7998v127.9h-44.7002zM194.9 192.3l-10.8008 -10.7998h-128.6
|
3158 |
+
v-44.7998l-55.5 55.5996l55.5 55.6006v-44.8008h128.6zM274.2 213l76.2998 76.5l31.5996 -31.7002v-44.7998h-107.899zM447.5 192.3l-55.5 -55.5996v44.7998h-127.7l-10.7998 10.7998l10.7998 10.7998h127.7v44.8008zM65.4004 271.8v78.7002h79.3994l-31.5996 -31.7002
|
3159 |
+
l90.2998 -90.5v-15.2998h-15.2998l-90.2998 90.5zM382.1 350.5v-78.7002l-31.5996 31.7002l-90.2998 -90.5h-15.2998v15.2998l90.2998 90.5l-31.6006 31.7002h78.5zM203.5 34.0996v-0.0996094h-44.7002l-31.5996 31.7002l76.2998 76.5v-108.101zM65.4004 213v44.7998
|
3160 |
+
l32.5 31.7002l76.2998 -76.5h-108.8zM382.1 112.8v-78.7002h-78.5l31.6006 31.7002l-90.2998 90.5v15.2998h15.2998l90.2998 -90.5zM382.1 171.6v-44.7998l-31.5996 -31.7002l-76.2998 76.5h107.899zM321.2 65.7998l-31.6006 -31.5996h-44.6992v108.1zM97.9004 95.0996
|
3161 |
+
l-32.5 31.7002v44.7998h108.8zM279.7 24.2002l-55.5 -55.6006l-55.5 55.6006h44.7002v127.899l10.7998 10.8008l10.7998 -10.8008v-127.899h44.7002zM113.2 65.7998l31.5996 -31.7002h-79.3994v78.7002l32.5 -31.7002l90.2998 90.5h15.2998v-15.2998z" />
|
3162 |
+
<glyph glyph-name="confluence" unicode="" horiz-adv-x="512"
|
3163 |
+
d="M2.2998 35.7998c42.2998 66.9004 125.2 233.2 373.101 112.601c39.6992 -19.1006 83.6992 -39.9004 105.899 -50.3008c8 -3.69922 11.7002 -13.1992 8.10059 -21.2998l-50.4004 -114.1c-0.0996094 -0.100586 -0.0996094 -0.299805 -0.200195 -0.400391
|
3164 |
+
c-3.89941 -8.09961 -13.5996 -11.5996 -21.7002 -7.7002c-200.399 95.2002 -213.8 111.5 -280.899 -0.699219c0 0 -0.100586 -0.100586 -0.100586 -0.200195c-4.69922 -7.7002 -14.6992 -10 -22.3994 -5.2998l-105.9 65.1992c-7.59961 4.7002 -10 14.6006 -5.5 22.2002z
|
3165 |
+
M509.7 347.9c-42.6006 -67.5 -125.4 -232.9 -373.4 -112.9c-39.7002 19.2002 -83.7998 40 -106 50.4004c-8 3.69922 -11.7002 13.1992 -8.09961 21.2998l50.5 114.1c0.0996094 0.100586 0.0996094 0.299805 0.200195 0.400391
|
3166 |
+
c3.89941 8.09961 13.5996 11.5996 21.6992 7.7002c199.5 -94.7002 213.301 -111.7 280.601 0.899414c0.200195 0.400391 0.399414 0.700195 0.599609 1c5 7.5 15.1006 9.40039 22.6006 4.40039l105.8 -65.1006c7.59961 -4.69922 10 -14.5996 5.5 -22.1992z" />
|
3167 |
+
<glyph glyph-name="dhl" unicode="" horiz-adv-x="640"
|
3168 |
+
d="M238 146.8l22.2998 30.2002h58.7002l-22.2998 -30.2002h-58.7002zM0 165.1h86.5l-4.7002 -6.39941h-81.7998v6.39941zM172.9 177h68.1992c-5.69922 -7.7998 -24.0996 -30.2998 -57.1992 -30.2998h-100.101l41.1006 55.7998h51c5.59961 0 5.59961 -2.2002 2.7998 -5.90039
|
3169 |
+
c-2.7998 -3.69922 -7.60059 -10.2998 -10.4004 -14.0996c-1.39941 -1.90039 -4.09961 -5.5 4.60059 -5.5zM490.4 183.9h-62.2002l39.2998 53.3994h62.2002zM95.2998 177l-4.7002 -6.40039h-90.5996v6.40039h95.2998zM206.3 203.6
|
3170 |
+
c2.7998 3.7002 2.90039 5.90039 -2.7002 5.90039h-111.399l20.3994 27.7998h117.9c29.9004 0 37.5996 -23.5996 29.2002 -35c-6.2002 -8.39941 -13.5 -18.3994 -13.5 -18.3994h-45.6006c-8.69922 0 -6 3.5 -4.59961 5.5c2.7998 3.7998 7.5 10.3994 10.2998 14.1992zM0 146.8
|
3171 |
+
v6.40039h77.7998l-4.7002 -6.40039h-73.0996zM323 146.8c0 0 22.2002 30.2002 22.2998 30.2002h58.7002l-22.2998 -30.2002h-58.7002zM545 146.7l4.7002 6.39941h90.2998v-6.39941h-95zM567.3 177h72.7002v-6.40039h-77.4004zM553.8 158.7l4.7002 6.39941h81.5v-6.39941
|
3172 |
+
h-86.2002zM389.6 237.3h58.7002l-39.2998 -53.3994h-143.6l39.2998 53.3994h58.7002l-22.5 -30.5996h26.1992zM423.1 177h133.4l-22.2998 -30.2998h-94.2998c-24.1006 0 -30.6006 11.5996 -23.2002 21.5996c2.09961 2.7998 6.39941 8.7002 6.39941 8.7002z" />
|
3173 |
+
<glyph glyph-name="diaspora" unicode="" horiz-adv-x="512"
|
3174 |
+
d="M251.64 93.4502c-1.39941 0 -88 -119.9 -88.6992 -119.9c-0.700195 0 -86.6006 60.4502 -86.9404 61.2002s86.5996 125.7 86.5996 127.4c0 2.19922 -129.6 44 -137.6 47.0996c-1.2998 0.5 31.4004 101.8 31.7002 102.1c0.599609 0.700195 144.399 -47 145.5 -47
|
3175 |
+
c0.399414 0 0.899414 0.600586 1 1.30078c0.399414 2 1 148.6 1.7002 149.6c0.799805 1.2002 104.5 0.700195 105.1 0.299805c1.5 -1 3.5 -156.1 6.09961 -156.1c1.40039 0 138.7 47 139.301 46.2998c0.799805 -0.900391 31.8994 -102.2 31.5 -102.6
|
3176 |
+
c-0.900391 -0.900391 -140.2 -47.1006 -140.601 -48.8008c-0.299805 -1.39941 82.7998 -122.1 82.5 -122.899s-85.5 -63.5 -86.2998 -63.5c-1 0.200195 -89 125.5 -90.9004 125.5h0.0400391z" />
|
3177 |
+
<glyph glyph-name="fedex" unicode="" horiz-adv-x="640"
|
3178 |
+
d="M586 163.5l54 -60.5h-64.4004l-22.2998 25l-22.0996 -25h-212.2v11.9004h-0.5c-7.90039 -11.7002 -20.7998 -18.6006 -34.9004 -18.6006c-32.6992 0 -56.3994 26.4004 -60.0996 56.9004h-85.5c0 -23.5 31.0996 -35.5 45.7998 -14.6006h42
|
3179 |
+
c-27.5996 -67.6992 -130.2 -49.3994 -130.2 23.7002c0 6.40039 0.800781 12.5 2.30078 18.2002h-48.9004v-77.5h-49v184.4h109v-41.1006h-60v-26.2002h54.7998v-24.1992c24.5 43.5996 103.9 45.3994 121.9 -14c7.5 25.5 28.8994 44.8994 57.2998 44.8994
|
3180 |
+
c13.9004 0 25.7998 -3.7998 35.4004 -14.7998h0.5v75.5h151.199v-48.0996h-56.0996v-16h118.7l22.5 -24.8008l21.7002 24.8008h62.3994zM139.3 180.1h46.5c-4.7998 25.6006 -40.3994 26.3008 -46.5 0zM292.7 131.2c34.5 0 32.5996 62.7998 0 62.7998
|
3181 |
+
c-34 0 -34.6006 -62.7998 0 -62.7998zM460.5 112.1v29.6006h-56.0996v44.7002h56.0996v28.0996h-55.5v33.9004h56.0996v30.1992h-95v-166.5h94.4004zM414.6 151.9h56.1006v-45.6006l50.7002 57l-50.7002 57v-44h-56.1006v-24.3994zM553.2 141.6l26.2998 -29.5h40.5
|
3182 |
+
l-46 51.4004l45.4004 51h-38.5l-25.6006 -29.2998l-26.5996 29.2998h-39.7002l45.5996 -51.2002l-45.5996 -51.2002h38.0996z" />
|
3183 |
+
<glyph glyph-name="fedora" unicode=""
|
3184 |
+
d="M225 416c123.7 -0.299805 223.7 -100.9 223.4 -224.6c-0.300781 -123.7 -100.9 -223.7 -224.601 -223.4l-170.2 0.400391v0c-29.5879 0 -53.6006 24.0127 -53.6006 53.5996c0 0.0830078 0.000976562 0.216797 0.000976562 0.299805l0.400391 170.3
|
3185 |
+
c0.399414 123.7 100.899 223.7 224.6 223.4zM394.8 258.8c-0.0771484 6.26953 -1.33203 16.3047 -2.7998 22.4004l-55.2002 56.0996v-1.59961c0 -5.10059 -1.5 -9.60059 -3.7998 -14.2998zM331 353.7c1.65332 -2.31348 3.53516 -6.43555 4.2002 -9.2002l54.2998 -54.5996
|
3186 |
+
c-8.27539 24.8252 -34.4834 53.4082 -58.5 63.7998zM118.1 200.8c-4.54785 -0.369141 -11.8057 -1.66895 -16.1992 -2.89941l8.5 -8.5c1.68457 3.44336 5.13477 8.55078 7.69922 11.3994zM97 196.6c-3.91211 -1.08984 -10.0498 -3.41895 -13.7002 -5.19922l27 -27.2002
|
3187 |
+
c-1.30469 3.32617 -2.37988 8.92676 -2.39941 12.5l0.899414 8zM78.7998 189.2c-3.21484 -1.79492 -8.23242 -5.02051 -11.2002 -7.2002l35.3008 -35.9004c3.70801 1.84668 10.0254 3.95215 14.0996 4.7002zM63.5996 179.4
|
3188 |
+
c-3.06738 -2.29395 -7.5918 -6.50488 -10.0996 -9.40039l34.9004 -34.5996c2.66113 2.6377 7.36523 6.44629 10.5 8.5zM50.2998 167.1c-2.89941 -3.2998 -5.7998 -6.69922 -8.59961 -10.5l35.7998 -35.8994c1.74121 3.40527 5.19141 8.5127 7.7002 11.3994zM39.2998 152.8
|
3189 |
+
c-2.07715 -3.18457 -5.0791 -8.56055 -6.7002 -12l39.5 -39.7998c0.306641 4.3584 1.91895 11.168 3.60059 15.2002zM30.5 136.5c-1.7998 -4.90039 -3.2998 -9.59961 -4.7002 -14.5l52.7002 -53.5c-3.42578 6.82812 -6.42773 18.5654 -6.7002 26.2002zM22.5996 93.5
|
3190 |
+
c0.0380859 -6.14551 1.33789 -15.957 2.90039 -21.9004l55.4004 -55.6992v1.09961c0.0341797 4.18848 1.64746 10.5947 3.59961 14.2998zM27.9004 62.7998c8.29785 -24.8047 34.5059 -53.3867 58.5 -63.7998c-1.61816 2.33008 -3.5 6.45117 -4.2002 9.2002zM22.5996 99.7998
|
3191 |
+
l64.4004 -64.2002c2.30469 2.8877 6.74023 6.78613 9.90039 8.7002l-72.2002 72.5c-1.08105 -4.62988 -2.02148 -12.2461 -2.10059 -17zM275.9 151.6c32.5996 -0.0996094 32.6992 49.2002 0.199219 49.4004l-33.5996 0.0996094
|
3192 |
+
c-4.91309 0.0224609 -8.90039 4.02734 -8.90039 8.94043v0.0595703l0.100586 47c0.0996094 40.5 38.5996 60.8008 66 54.9004c15.3994 -3.90039 30.2998 8.40039 30.2998 23.9004c0 12.0996 -8.7002 22.1992 -19.9004 24
|
3193 |
+
c-5.39062 1.26953 -14.2617 2.30078 -19.8008 2.30078c-0.110352 0 -0.289062 -0.000976562 -0.398438 -0.000976562c-0.116211 0 -0.304688 0.000976562 -0.420898 0.000976562c-57.96 0 -105.081 -47.041 -105.18 -105.001l-0.0996094 -56l-42.6006 0.0996094
|
3194 |
+
c-32.5996 0.100586 -32.6992 -49.2002 -0.0996094 -49.2998l33.5996 -0.0996094c4.40039 0 8.90039 -4.5 8.90039 -9l-0.0996094 -47c-0.00585938 -30.8574 -25.0537 -55.9004 -55.9102 -55.9004h-0.19043c-9.39941 0 -9.39941 1.59961 -15.7002 1.59961
|
3195 |
+
c-13.3691 -0.208008 -24.3457 -11.2295 -24.5 -24.5996c0 -15.5 14.2002 -24.2002 19.9004 -24.2002c61.2998 -12.8994 125.5 33.6006 125.7 102.9l0.0996094 56zM299.4 151.9c4.50781 0.442383 11.7207 1.74219 16.0996 2.89941l-8.5 8.5
|
3196 |
+
c-1.48047 -3.55762 -4.88477 -8.66504 -7.59961 -11.3994zM320.4 156.1c3.9248 1.09082 10.0625 3.46484 13.6992 5.30078l-27 27.1992c1.30566 -3.32617 2.38086 -8.92578 2.40039 -12.5l-0.900391 -8.09961zM338.4 163.5c4 2.2002 8.09961 4.7002 11.8994 7.2002
|
3197 |
+
l-36.2002 35.8994c-4.09961 -2.2998 -8.7998 -3.59961 -13.6992 -4.69922zM353.9 173.3c2.92188 2.33301 7.44727 6.36426 10.0996 9l-34.9004 35c-2.63672 -2.66797 -7.34082 -6.47656 -10.5 -8.5zM367.1 185.6c2.52539 2.77441 6.37793 7.47852 8.60059 10.5
|
3198 |
+
l-35.7998 35.9004c-1.78125 -3.37891 -5.23047 -8.48633 -7.7002 -11.4004zM378.1 199.9c2.10938 3.16602 5.11133 8.54199 6.7002 12l-39.5 39.7998c-0.305664 -4.3584 -1.91895 -11.168 -3.59961 -15.2002zM391.6 230.8l-53.0996 53.4004
|
3199 |
+
c3.69434 -6.76172 6.875 -18.499 7.09961 -26.2002l41.3008 -41.5c1.50879 3.87695 3.61426 10.2832 4.69922 14.2998zM392.6 236.4c1.05957 4.52246 2.08984 11.959 2.30078 16.5996l-64.3008 64.7002c-2.18359 -3.12988 -6.61816 -7.25098 -9.89941 -9.2002z" />
|
3200 |
+
<glyph glyph-name="figma" unicode="" horiz-adv-x="384"
|
3201 |
+
d="M277 277.3h-85.4004v-256c-0.0273438 -47.085 -38.2637 -85.2998 -85.3496 -85.2998c-47.1133 0 -85.3496 38.2363 -85.3496 85.3496s38.2363 85.3506 85.3496 85.3506h0.0498047c-47.1133 0 -85.3496 38.2363 -85.3496 85.3496s38.2363 85.3506 85.3496 85.3506
|
3202 |
+
c-47.085
|