WC Vendors - Version 1.8.7

Version Description

No Upgrade required at this time.

Release Info

Developer	digitalchild
Plugin	WC Vendors
Version	1.8.7
Comparing to
See all releases

Code changes from version 1.8.6 to 1.8.7

Files changed (131) hide show

assets/css/wcv-frontend.css +45 -45
changelog.txt +13 -0
class-wc-vendors.php +1 -1
classes/admin/class-admin-users.php +3 -1
classes/admin/class-vendor-reports.php +1 -1
classes/admin/emails/class-wc-notify-vendor.php +1 -1
classes/admin/settings/assets/js/wcvendors-media.js +50 -0
classes/admin/settings/classes/sf-class-sanitize.php +17 -0
classes/admin/settings/classes/sf-class-settings.php +14 -0
classes/admin/settings/sf-options.php +1 -1
classes/class-commission.php +30 -2
classes/class-vendors.php +4 -2
classes/front/class-vendor-cart.php +1 -1
classes/front/class-vendor-shop.php +6 -4
languages/default.pot +55 -44
readme.txt +2 -2
templates/emails/notify-vendor-shipped.php +7 -1
templates/emails/vendor-new-order.php +7 -1
trunk/assets/css/admin-orders.css +7 -0
trunk/assets/css/wcv-frontend.css +545 -0
trunk/assets/images/icons/truck.png +0 -0
trunk/assets/js/front-orders.js +8 -0
trunk/assets/js/wcv-admin-quick-edit.js +34 -0
trunk/changelog.txt +412 -0
trunk/class-wc-vendors.php +373 -0
trunk/classes/admin/class-admin-page.php +597 -0
trunk/classes/admin/class-admin-reports.php +549 -0
trunk/classes/admin/class-admin-users.php +493 -0
trunk/classes/admin/class-product-meta.php +267 -0
trunk/classes/admin/class-vendor-admin-dashboard.php +634 -0
trunk/classes/admin/class-vendor-applicants.php +103 -0
trunk/classes/admin/class-vendor-reports.php +121 -0
trunk/classes/admin/emails/class-emails.php +151 -0
trunk/classes/admin/emails/class-wc-approve-vendor.php +165 -0
trunk/classes/admin/emails/class-wc-notify-admin.php +176 -0
trunk/classes/admin/emails/class-wc-notify-shipped.php +198 -0
trunk/classes/admin/emails/class-wc-notify-vendor.php +293 -0
trunk/classes/admin/settings/README.md +126 -0
trunk/classes/admin/settings/assets/css/sf-styles.css +167 -0
trunk/classes/admin/settings/assets/img/tip.png +0 -0
trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js +126 -0
trunk/classes/admin/settings/assets/js/js.iml +10 -0
trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css +87 -0
trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif +0 -0
trunk/classes/admin/settings/assets/js/select2/select2.css +704 -0
trunk/classes/admin/settings/assets/js/select2/select2.js +3541 -0
trunk/classes/admin/settings/assets/js/select2/select2.min.js +23 -0
trunk/classes/admin/settings/assets/js/select2/select2.png +0 -0
trunk/classes/admin/settings/assets/js/select2/select2x2.png +0 -0
trunk/classes/admin/settings/assets/js/sf-jquery.js +23 -0
trunk/classes/admin/settings/assets/js/wcvendors-media.js +50 -0
trunk/classes/admin/settings/classes/sf-class-format-options.php +347 -0
trunk/classes/admin/settings/classes/sf-class-sanitize.php +177 -0
trunk/classes/admin/settings/classes/sf-class-settings.php +929 -0
trunk/classes/admin/settings/sf-options.php +353 -0
trunk/classes/admin/views/html-vendor-settings-page.php +76 -0
trunk/classes/class-commission.php +431 -0
trunk/classes/class-cron.php +165 -0
trunk/classes/class-install.php +246 -0
trunk/classes/class-queries.php +280 -0
trunk/classes/class-shipping.php +322 -0
trunk/classes/class-vendors.php +462 -0
trunk/classes/front/class-vendor-cart.php +64 -0
trunk/classes/front/class-vendor-shop.php +292 -0
trunk/classes/front/dashboard/class-vendor-dashboard.php +462 -0
trunk/classes/front/orders/class-export-csv.php +99 -0
trunk/classes/front/orders/class-orders.php +259 -0
trunk/classes/front/orders/class-submit-comment.php +81 -0
trunk/classes/front/signup/class-vendor-signup.php +148 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/index.php +0 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/paypalap.png +0 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/index.php +0 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/ChangeLog.txt +33 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/LICENSE.txt +41 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/README.md +57 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/build.xml +24 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/cert_key.pem +31 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/sdk_config.ini +26 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/IPPCredential.php +53 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAPIService.php +62 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAuthenticationManager.php +91 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPBaseService.php +88 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCertificateCredential.php +72 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConfigManager.php +124 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConnectionManager.php +48 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCredentialManager.php +117 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPHttpConnection.php +184 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPLoggingManager.php +84 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPObjectTransformer.php +33 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPSignatureCredential.php +49 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPUtils.php +274 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/AuthUtil.php +83 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/PPAuth.php +1077 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/cacert.pem +171 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConfigurationException.php +9 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConnectionException.php +20 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPInvalidCredentialException.php +22 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPMissingCredentialException.php +22 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPTransformerException.php +20 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePayments.php +5797 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePaymentsService.php +314 -0
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/index.php +0 -0
trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php +555 -0
trunk/classes/gateways/PayPal_Masspay/api/ChangeLog.txt +48 -0
trunk/classes/gateways/PayPal_Masspay/api/LICENSE.txt +41 -0
trunk/classes/gateways/PayPal_Masspay/api/README.md +60 -0
trunk/classes/gateways/PayPal_Masspay/api/build.xml +24 -0
trunk/classes/gateways/PayPal_Masspay/api/config/sdk-cert.pem +41 -0
trunk/classes/gateways/PayPal_Masspay/api/config/sdk_config.ini +39 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/IPPCredential.php +53 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPAPIService.php +62 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPAuthenticationManager.php +99 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPBaseService.php +88 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPCertificateCredential.php +77 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPConfigManager.php +121 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPConnectionManager.php +48 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPCredentialManager.php +119 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPHttpConnection.php +184 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPLoggingManager.php +84 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPObjectTransformer.php +33 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPSignatureCredential.php +56 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/PPUtils.php +284 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/auth/AuthUtil.php +83 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/auth/PPAuth.php +1057 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/cacert.pem +171 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPConfigurationException.php +9 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPConnectionException.php +20 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPInvalidCredentialException.php +22 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPMissingCredentialException.php +22 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPTransformerException.php +20 -0
trunk/classes/gateways/PayPal_Masspay/api/lib/services/PayPalAPIInterfaceService/PayPalAPIInterfaceService.php +3037 -0

assets/css/wcv-frontend.css CHANGED Viewed

	@@ -38,7 +38,7 @@ clearfix {
38	box-sizing: border-box;
39	}
40
41	- .btn {
42	display: inline-block;
43	*display: inline;
44	*zoom: 1;
	@@ -76,21 +76,21 @@ clearfix {
76	box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
77	}
78
79	- .btn:hover, .btn:active, .btn.active, .btn.disabled, .btn[disabled] {
80	color: #333333;
81	background-color: #e6e6e6;
82	*background-color: #d9d9d9;
83	}
84
85	- .btn:active, .btn.active {
86	background-color: #cccccc \9;
87	}
88
89	- .btn:first-child {
90	*margin-left: 0;
91	}
92
93	- .btn:hover {
94	color: #333333;
95	text-decoration: none;
96	background-color: #e6e6e6;
	@@ -102,13 +102,13 @@ clearfix {
102	transition: background-position 0.1s linear;
103	}
104
105	- .btn:focus {
106	outline: thin dotted #333;
107	outline: 5px auto -webkit-focus-ring-color;
108	outline-offset: -2px;
109	}
110
111	- .btn.active, .btn:active {
112	background-color: #e6e6e6;
113	background-color: #d9d9d9 \9;
114	background-image: none;
	@@ -118,7 +118,7 @@ clearfix {
118	box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
119	}
120
121	- .btn.disabled, .btn[disabled] {
122	cursor: default;
123	background-color: #e6e6e6;
124	background-image: none;
	@@ -129,7 +129,7 @@ clearfix {
129	box-shadow: none;
130	}
131
132	- .btn-large {
133	padding: 9px 14px;
134	font-size: 16px;
135	line-height: normal;
	@@ -138,27 +138,27 @@ clearfix {
138	border-radius: 5px;
139	}
140
141	- .btn-large [class^="icon-"] {
142	margin-top: 2px;
143	}
144
145	- .btn-small {
146	padding: 3px 9px;
147	font-size: 12px;
148	line-height: 18px;
149	}
150
151	- .btn-small [class^="icon-"] {
152	margin-top: 0;
153	}
154
155	- .btn-mini {
156	padding: 2px 6px;
157	font-size: 11px;
158	line-height: 17px;
159	}
160
161	- .btn-block {
162	display: block;
163	width: 100%;
164	padding-left: 0;
	@@ -168,24 +168,24 @@ clearfix {
168	box-sizing: border-box;
169	}
170
171	- .btn-block + .btn-block {
172	margin-top: 5px;
173	}
174
175	- input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="button"].btn-block {
176	width: 100%;
177	}
178
179	- .btn-primary.active, .btn-warning.active, .btn-danger.active, .btn-success.active, .btn-info.active, .btn-inverse.active {
180	color: rgba(255, 255, 255, 0.75);
181	}
182
183	- .btn {
184	border-color: #c5c5c5;
185	border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
186	}
187
188	- .btn-primary {
189	color: #ffffff;
190	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
191	background-color: #006dcc;
	@@ -202,17 +202,17 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
202	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
203	}
204
205	- .btn-primary:hover, .btn-primary:active, .btn-primary.active, .btn-primary.disabled, .btn-primary[disabled] {
206	color: #ffffff;
207	background-color: #0044cc;
208	*background-color: #003bb3;
209	}
210
211	- .btn-primary:active, .btn-primary.active {
212	background-color: #003399 \9;
213	}
214
215	- .btn-warning {
216	color: #ffffff;
217	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
218	background-color: #faa732;
	@@ -229,17 +229,17 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
229	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
230	}
231
232	- .btn-warning:hover, .btn-warning:active, .btn-warning.active, .btn-warning.disabled, .btn-warning[disabled] {
233	color: #ffffff;
234	background-color: #f89406;
235	*background-color: #df8505;
236	}
237
238	- .btn-warning:active, .btn-warning.active {
239	background-color: #c67605 \9;
240	}
241
242	- .btn-danger {
243	color: #ffffff;
244	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
245	background-color: #da4f49;
	@@ -256,17 +256,17 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
256	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
257	}
258
259	- .btn-danger:hover, .btn-danger:active, .btn-danger.active, .btn-danger.disabled, .btn-danger[disabled] {
260	color: #ffffff;
261	background-color: #bd362f;
262	*background-color: #a9302a;
263	}
264
265	- .btn-danger:active, .btn-danger.active {
266	background-color: #942a25 \9;
267	}
268
269	- .btn-success {
270	color: #ffffff;
271	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
272	background-color: #5bb75b;
	@@ -283,17 +283,17 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
283	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
284	}
285
286	- .btn-success:hover, .btn-success:active, .btn-success.active, .btn-success.disabled, .btn-success[disabled] {
287	color: #ffffff;
288	background-color: #51a351;
289	*background-color: #499249;
290	}
291
292	- .btn-success:active, .btn-success.active {
293	background-color: #408140 \9;
294	}
295
296	- .btn-info {
297	color: #ffffff;
298	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
299	background-color: #49afcd;
	@@ -310,17 +310,17 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
310	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
311	}
312
313	- .btn-info:hover, .btn-info:active, .btn-info.active, .btn-info.disabled, .btn-info[disabled] {
314	color: #ffffff;
315	background-color: #2f96b4;
316	*background-color: #2a85a0;
317	}
318
319	- .btn-info:active, .btn-info.active {
320	background-color: #24748c \9;
321	}
322
323	- .btn-inverse {
324	color: #ffffff;
325	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
326	background-color: #363636;
	@@ -337,42 +337,42 @@ input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="butto
337	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
338	}
339
340	- .btn-inverse:hover, .btn-inverse:active, .btn-inverse.active, .btn-inverse.disabled, .btn-inverse[disabled] {
341	color: #ffffff;
342	background-color: #222222;
343	*background-color: #151515;
344	}
345
346	- .btn-inverse:active, .btn-inverse.active {
347	background-color: #080808 \9;
348	}
349
350	- button.btn, input[type="submit"].btn {
351	*padding-top: 3px;
352	*padding-bottom: 3px;
353	}
354
355	- button.btn::-moz-focus-inner, input[type="submit"].btn::-moz-focus-inner {
356	padding: 0;
357	border: 0;
358	}
359
360	- button.btn.btn-large, input[type="submit"].btn.btn-large {
361	*padding-top: 7px;
362	*padding-bottom: 7px;
363	}
364
365	- button.btn.btn-small, input[type="submit"].btn.btn-small {
366	*padding-top: 3px;
367	*padding-bottom: 3px;
368	}
369
370	- button.btn.btn-mini, input[type="submit"].btn.btn-mini {
371	*padding-top: 1px;
372	*padding-bottom: 1px;
373	}
374
375	- .btn-link, .btn-link:active, .btn-link[disabled] {
376	background-color: transparent;
377	background-image: none;
378	-webkit-box-shadow: none;
	@@ -380,7 +380,7 @@ button.btn.btn-mini, input[type="submit"].btn.btn-mini {
380	box-shadow: none;
381	}
382
383	- .btn-link {
384	border-color: transparent;
385	cursor: pointer;
386	color: #0088cc;
	@@ -389,13 +389,13 @@ button.btn.btn-mini, input[type="submit"].btn.btn-mini {
389	border-radius: 0;
390	}
391
392	- .btn-link:hover {
393	color: #005580;
394	text-decoration: underline;
395	background-color: transparent;
396	}
397
398	- .btn-link[disabled]:hover {
399	color: #333333;
400	text-decoration: none;
401	}


38	box-sizing: border-box;
39	}
40
41	+ .wcv-btn {
42	display: inline-block;
43	*display: inline;
44	*zoom: 1;

76	box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
77	}
78
79	+ .wcv-btn:hover, .wcv-btn:active, .wcv-btn.active, .wcv-btn.disabled, .wcv-btn[disabled] {
80	color: #333333;
81	background-color: #e6e6e6;
82	*background-color: #d9d9d9;
83	}
84
85	+ .wcv-btn:active, .wcv-btn.active {
86	background-color: #cccccc \9;
87	}
88
89	+ .wcv-btn:first-child {
90	*margin-left: 0;
91	}
92
93	+ .wcv-btn:hover {
94	color: #333333;
95	text-decoration: none;
96	background-color: #e6e6e6;

102	transition: background-position 0.1s linear;
103	}
104
105	+ .wcv-btn:focus {
106	outline: thin dotted #333;
107	outline: 5px auto -webkit-focus-ring-color;
108	outline-offset: -2px;
109	}
110
111	+ .wcv-btn.active, .wcv-btn:active {
112	background-color: #e6e6e6;
113	background-color: #d9d9d9 \9;
114	background-image: none;

118	box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
119	}
120
121	+ .wcv-btn.disabled, .wcv-btn[disabled] {
122	cursor: default;
123	background-color: #e6e6e6;
124	background-image: none;

129	box-shadow: none;
130	}
131
132	+ .wcv-btn-large {
133	padding: 9px 14px;
134	font-size: 16px;
135	line-height: normal;

138	border-radius: 5px;
139	}
140
141	+ .wcv-btn-large [class^="icon-"] {
142	margin-top: 2px;
143	}
144
145	+ .wcv-btn-small {
146	padding: 3px 9px;
147	font-size: 12px;
148	line-height: 18px;
149	}
150
151	+ .wcv-btn-small [class^="icon-"] {
152	margin-top: 0;
153	}
154
155	+ .wcv-btn-mini {
156	padding: 2px 6px;
157	font-size: 11px;
158	line-height: 17px;
159	}
160
161	+ .wcv-btn-block {
162	display: block;
163	width: 100%;
164	padding-left: 0;

168	box-sizing: border-box;
169	}
170
171	+ .wcv-btn-block + .wcv-btn-block {
172	margin-top: 5px;
173	}
174
175	+ input[type="submit"].wcv-btn-block, input[type="reset"].wcv-btn-block, input[type="button"].wcv-btn-block {
176	width: 100%;
177	}
178
179	+ .wcv-btn-primary.active, .wcv-btn-warning.active, .wcv-btn-danger.active, .wcv-btn-success.active, .wcv-btn-info.active, .wcv-btn-inverse.active {
180	color: rgba(255, 255, 255, 0.75);
181	}
182
183	+ .wcv-btn {
184	border-color: #c5c5c5;
185	border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
186	}
187
188	+ .wcv-btn-primary {
189	color: #ffffff;
190	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
191	background-color: #006dcc;

202	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
203	}
204
205	+ .wcv-btn-primary:hover, .wcv-btn-primary:active, .wcv-btn-primary.active, .wcv-btn-primary.disabled, .wcv-btn-primary[disabled] {
206	color: #ffffff;
207	background-color: #0044cc;
208	*background-color: #003bb3;
209	}
210
211	+ .wcv-btn-primary:active, .wcv-btn-primary.active {
212	background-color: #003399 \9;
213	}
214
215	+ .wcv-btn-warning {
216	color: #ffffff;
217	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
218	background-color: #faa732;

229	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
230	}
231
232	+ .wcv-btn-warning:hover, .wcv-btn-warning:active, .wcv-btn-warning.active, .wcv-btn-warning.disabled, .wcv-btn-warning[disabled] {
233	color: #ffffff;
234	background-color: #f89406;
235	*background-color: #df8505;
236	}
237
238	+ .wcv-btn-warning:active, .wcv-btn-warning.active {
239	background-color: #c67605 \9;
240	}
241
242	+ .wcv-btn-danger {
243	color: #ffffff;
244	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
245	background-color: #da4f49;

256	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
257	}
258
259	+ .wcv-btn-danger:hover, .wcv-btn-danger:active, .wcv-btn-danger.active, .wcv-btn-danger.disabled, .wcv-btn-danger[disabled] {
260	color: #ffffff;
261	background-color: #bd362f;
262	*background-color: #a9302a;
263	}
264
265	+ .wcv-btn-danger:active, .wcv-btn-danger.active {
266	background-color: #942a25 \9;
267	}
268
269	+ .wcv-btn-success {
270	color: #ffffff;
271	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
272	background-color: #5bb75b;

283	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
284	}
285
286	+ .wcv-btn-success:hover, .wcv-btn-success:active, .wcv-btn-success.active, .wcv-btn-success.disabled, .wcv-btn-success[disabled] {
287	color: #ffffff;
288	background-color: #51a351;
289	*background-color: #499249;
290	}
291
292	+ .wcv-btn-success:active, .wcv-btn-success.active {
293	background-color: #408140 \9;
294	}
295
296	+ .wcv-btn-info {
297	color: #ffffff;
298	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
299	background-color: #49afcd;

310	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
311	}
312
313	+ .wcv-btn-info:hover, .wcv-btn-info:active, .wcv-btn-info.active, .wcv-btn-info.disabled, .wcv-btn-info[disabled] {
314	color: #ffffff;
315	background-color: #2f96b4;
316	*background-color: #2a85a0;
317	}
318
319	+ .wcv-btn-info:active, .wcv-btn-info.active {
320	background-color: #24748c \9;
321	}
322
323	+ .wcv-btn-inverse {
324	color: #ffffff;
325	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
326	background-color: #363636;

337	filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
338	}
339
340	+ .wcv-btn-inverse:hover, .wcv-btn-inverse:active, .wcv-btn-inverse.active, .wcv-btn-inverse.disabled, .wcv-btn-inverse[disabled] {
341	color: #ffffff;
342	background-color: #222222;
343	*background-color: #151515;
344	}
345
346	+ .wcv-btn-inverse:active, .wcv-btn-inverse.active {
347	background-color: #080808 \9;
348	}
349
350	+ button.wcv-btn, input[type="submit"].wcv-btn {
351	*padding-top: 3px;
352	*padding-bottom: 3px;
353	}
354
355	+ button.wcv-btn::-moz-focus-inner, input[type="submit"].wcv-btn::-moz-focus-inner {
356	padding: 0;
357	border: 0;
358	}
359
360	+ button.wcv-btn.wcv-btn-large, input[type="submit"].wcv-btn.wcv-btn-large {
361	*padding-top: 7px;
362	*padding-bottom: 7px;
363	}
364
365	+ button.wcv-btn.wcv-btn-small, input[type="submit"].wcv-btn.wcv-btn-small {
366	*padding-top: 3px;
367	*padding-bottom: 3px;
368	}
369
370	+ button.wcv-btn.wcv-btn-mini, input[type="submit"].wcv-btn.wcv-btn-mini {
371	*padding-top: 1px;
372	*padding-bottom: 1px;
373	}
374
375	+ .wcv-btn-link, .wcv-btn-link:active, .wcv-btn-link[disabled] {
376	background-color: transparent;
377	background-image: none;
378	-webkit-box-shadow: none;

380	box-shadow: none;
381	}
382
383	+ .wcv-btn-link {
384	border-color: transparent;
385	cursor: pointer;
386	color: #0088cc;

389	border-radius: 0;
390	}
391
392	+ .wcv-btn-link:hover {
393	color: #005580;
394	text-decoration: underline;
395	background-color: transparent;
396	}
397
398	+ .wcv-btn-link[disabled]:hover {
399	color: #333333;
400	text-decoration: none;
401	}

changelog.txt CHANGED Viewed

@@ -1,5 +1,18 @@
             Changelog for WC Vendors
             Version 1.8.6
             * Fixed: Critical issue with paypal loading classes incorrectly


1	Changelog for WC Vendors
2
3	+ Version 1.8.7
4	+
5	+ * Added: New qty argument to commission calculations
6	+ * Added: Image uploader settings type
7	+ * Added: New commission function for payment gateways
8	+ * Fixed: Prefixed all btn css classes to stop theme collision
9	+ * Fixed: Sold By:Name spaces issue #256
10	+ * Fixed: Show extended fields for vendor and pending vendor roles
11	+ * Fixed: Check if product is taxable
12	+ * Fixed: Depreciated function calls in email templates
13	+ * Fixed: Commission giving tax on none taxable items #251
14	+ * Fixed: Sold by label issues with WC 2.5 #250
15	+
16	Version 1.8.6
17
18	* Fixed: Critical issue with paypal loading classes incorrectly

class-wc-vendors.php CHANGED Viewed

	@@ -7,7 +7,7 @@
7	* Author: WC Vendors
8	* Author URI: https://www.wcvendors.com
9	*
10	- * Version: 1.8.6
11	* Requires at least: 4.0.0
12	* Tested up to: 4.4.1
13	*


7	* Author: WC Vendors
8	* Author URI: https://www.wcvendors.com
9	*
10	+ * Version: 1.8.7
11	* Requires at least: 4.0.0
12	* Tested up to: 4.4.1
13	*

classes/admin/class-admin-users.php CHANGED Viewed

	@@ -391,7 +391,9 @@ class WCV_Admin_Users
391	public function show_extra_profile_fields( $user )
392	{
393
394	- if ( ! WCV_Vendors::is_vendor( $user->ID ) ) { ~~return; }~~


395
396	?>
397	<h3><?php _e( 'WC Vendors', 'wcvendors' ); ?></h3>


391	public function show_extra_profile_fields( $user )
392	{
393
394	+ if ( ! WCV_Vendors::is_vendor( $user->ID ) && ! WCV_Vendors::is_pending( $user->ID ) ) {
395	+ return;
396	+ }
397
398	?>
399	<h3><?php _e( 'WC Vendors', 'wcvendors' ); ?></h3>

classes/admin/class-vendor-reports.php CHANGED Viewed

	@@ -88,7 +88,7 @@ class WCV_Vendor_Reports
88	continue;
89	} else {
90	if ( !empty( $order->line_total ) ) {
91	- $orders[ $key ]->line_total = WCV_Commission::calculate_commission( $order->line_total, $order->product_id, $order );
92	}
93	}
94


88	continue;
89	} else {
90	if ( !empty( $order->line_total ) ) {
91	+ $orders[ $key ]->line_total = WCV_Commission::calculate_commission( $order->line_total, $order->product_id, $order, $order->qty );
92	}
93	}
94

classes/admin/emails/class-wc-notify-vendor.php CHANGED Viewed

	@@ -191,7 +191,7 @@ class WC_Email_Notify_Vendor extends WC_Email
191	unset( $items[ $key ] );
192	continue;
193	} else {
194	- $commission_due = WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product[ 'product_id' ], $order );
195
196	$items[ $key ][ 'line_subtotal' ] = $commission_due;
197	$items[ $key ][ 'line_total' ] = $commission_due;


191	unset( $items[ $key ] );
192	continue;
193	} else {
194	+ $commission_due = WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product[ 'product_id' ], $order, $product[ 'qty' ] );
195
196	$items[ $key ][ 'line_subtotal' ] = $commission_due;
197	$items[ $key ][ 'line_total' ] = $commission_due;

classes/admin/settings/assets/js/wcvendors-media.js ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ jQuery( function( $ ){
2	+
3	+ // Iterate over all instances of the uploader on the page
4	+ $('.wcv-img-id').each( function () {
5	+
6	+ var id = $('.wcv-img-id').data( 'id' );
7	+
8	+ // Handle Add banner
9	+ $( '#wcv-add-' + id ).on( 'click', function(e) {
10	+ e.preventDefault();
11	+ file_uploader( id );
12	+ return false;
13	+ });
14	+
15	+ });
16	+
17	+ function file_uploader( id )
18	+ {
19	+
20	+ var media_uploader, json;
21	+
22	+ if (undefined !== media_uploader ) {
23	+ media_uploader.open();
24	+ return;
25	+ }
26	+
27	+ media_uploader = wp.media({
28	+ title: $( '#wcv-add-' + id ).data('window_title'),
29	+ button: {
30	+ text: $( '#wcv-add-' + id ).data('save_button'),
31	+ },
32	+ multiple: false // Set to true to allow multiple files to be selected
33	+ });
34	+
35	+ media_uploader.on( 'select' , function(){
36	+
37	+ json = media_uploader.state().get('selection').first().toJSON();
38	+
39	+ if ( 0 > $.trim( json.url.length ) ) {
40	+ return;
41	+ }
42	+
43	+ $( '.wcv-image-container-' + id ).prop( 'src', json.sizes.full.url );
44	+ $( '#' + id ).val( json.sizes.full.url );
45	+
46	+ });
47	+
48	+ media_uploader.open();
49	+ }
50	+ });

classes/admin/settings/classes/sf-class-sanitize.php CHANGED Viewed

	@@ -27,6 +27,7 @@ if ( !class_exists( 'SF_Sanitize' ) ) {
27	add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
28	add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
29	add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );

30	add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
31	}
32
	@@ -154,6 +155,22 @@ if ( !class_exists( 'SF_Sanitize' ) ) {
154	}
155
156
















157	}
158
159


27	add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
28	add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
29	add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
30	+ add_filter( 'geczy_sanitize_image', array( 'SF_Sanitize', 'sanitize_image_url' ), 10, 2 );
31	add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
32	}
33

155	}
156
157
158	+
159	+ /**
160	+ * Image uploader
161	+ *
162	+ * @param url $input
163	+ *
164	+ * @return int
165	+ */
166	+ public static function sanitize_image_url( $input, $option ) {
167	+
168	+ $output = $input;
169	+ return $output;
170	+
171	+ }
172	+
173	+
174	}
175
176

classes/admin/settings/classes/sf-class-settings.php CHANGED Viewed

	@@ -196,6 +196,7 @@ if ( !class_exists( 'SF_Settings_API' ) ) {
196	if (is_admin() \|\| $pagenow === 'wc_prd_vendor') {
197	wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
198	wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );

199	wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
200	wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
201	wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );
	@@ -221,6 +222,7 @@ if ( !class_exists( 'SF_Settings_API' ) ) {
221
222	wp_enqueue_script( 'bootstrap-tooltip' );
223	wp_enqueue_script( 'select2' );

224	wp_enqueue_script( 'sf-scripts' );
225
226	wp_enqueue_style( 'wp-color-picker' );
	@@ -825,6 +827,18 @@ if ( !class_exists( 'SF_Settings_API' ) ) {
825	echo $description;
826	break;
827












828	default :
829	do_action( $this->id . '_options_type_' . $type, $setting );
830	break;


196	if (is_admin() \|\| $pagenow === 'wc_prd_vendor') {
197	wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
198	wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );
199	+ wp_register_script( 'wcvendors-media', $this->assets_url . 'js/wcvendors-media.js', array( 'jquery' ), '1.0' );
200	wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
201	wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
202	wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );

222
223	wp_enqueue_script( 'bootstrap-tooltip' );
224	wp_enqueue_script( 'select2' );
225	+ wp_enqueue_script( 'wcvendors-media' );
226	wp_enqueue_script( 'sf-scripts' );
227
228	wp_enqueue_style( 'wp-color-picker' );

827	echo $description;
828	break;
829
830	+ case 'image':
831	+
832	+ if ( empty ( $value ) ) $value = $std;
833	+
834	+ ?>
835	+ <img class="wcv-image-container-<?php echo $id; ?>" src="<?php echo $value; ?>" alt="" style="max-width:100%;" />
836	+ <br />
837	+ <input id="wcv-add-<?php echo $id; ?>" type="button" class="<?php echo $class; ?>" value="<?php echo sprintf( __( 'Update %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-id="<?php echo $id; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), $title ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wcvendors' ), strtolower( $title ) ); ?>" />
838	+ <input type="hidden" name="<?php echo $name; ?>" id="<?php echo $id; ?>" value="<?php echo $value; ?>">
839	+ <?php
840	+ break;
841	+
842	default :
843	do_action( $this->id . '_options_type_' . $type, $setting );
844	break;

classes/admin/settings/sf-options.php CHANGED Viewed

	@@ -104,7 +104,7 @@ $options[ ] = array(
104	'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
105	'id' => 'sold_by_label',
106	'type' => 'text',
107	- 'std' => __( 'Sold By: ', 'wcvendors' ),
108	);
109
110	$options[ ] = array(


104	'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
105	'id' => 'sold_by_label',
106	'type' => 'text',
107	+ 'std' => __( 'Sold By', 'wcvendors' ),
108	);
109
110	$options[ ] = array(

classes/class-commission.php CHANGED Viewed

@@ -293,13 +293,13 @@ class WCV_Commission
+            	 *
             	 * @return float
             	 */
-            -
            	public static function calculate_commission( $product_price, $product_id, $order )
+            	{
             		$commission_rate = WCV_Commission::get_commission_rate( $product_id );
             		$commission      = $product_price * ( $commission_rate / 100 );
             		$commission      = round( $commission, 2 );
-            -
            		return apply_filters( 'wcv_commission_rate', $commission, $product_id, $product_price, $order );
+            	}
@@ -400,4 +400,32 @@ class WCV_Commission
+            	}
+            }


293	*
294	* @return float
295	*/
296	+ public static function calculate_commission( $product_price, $product_id, $order, $qty )
297	{
298	$commission_rate = WCV_Commission::get_commission_rate( $product_id );
299	$commission = $product_price * ( $commission_rate / 100 );
300	$commission = round( $commission, 2 );
301
302	+ return apply_filters( 'wcv_commission_rate', $commission, $product_id, $product_price, $order, $qty );
303	}
304
305

400	}
401
402
403	+ /**
404	+ * Set commission to 'paid' for a specifc vendor
405	+ *
406	+ *
407	+ * @access public
408	+ *
409	+ * @param int $vendor_id the vendor id
410	+ * @param int $product_id the product id
411	+ * @param int $order_id the order id
412	+ *
413	+ * @return bool.
414	+ */
415	+ public static function set_vendor_product_commission_paid( $vendor_id, $product_id, $order_id )
416	+ {
417	+ global $wpdb;
418	+
419	+ $table_name = $wpdb->prefix . "pv_commission";
420	+
421	+ if ( is_array( $vendors ) )
422	+ $vendors = implode( ',', $vendors );
423	+
424	+ $query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id = $vendor_id AND order_id = $order_id AND product_id = $product_id";
425	+ $result = $wpdb->query( $query );
426	+
427	+ return $result;
428	+ }
429	+
430	+
431	}

classes/class-vendors.php CHANGED Viewed

	@@ -93,7 +93,7 @@ class WCV_Vendors
93	$give_tax_override = get_user_meta( $author, 'wcv_give_vendor_tax', true );
94	$give_shipping_override = get_user_meta( $author, 'wcv_give_vendor_shipping', true );
95	$is_vendor = WCV_Vendors::is_vendor( $author );
96	- $commission = $is_vendor ? WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product_id, $order ) : 0;
97	$tax = !empty( $product[ 'line_tax' ] ) ? (float) $product[ 'line_tax' ] : 0;
98
99	// Check if shipping is enabled
	@@ -104,9 +104,11 @@ class WCV_Vendors
104	$shipping = $shipping_costs['amount'];
105	$shipping_tax = $shipping_costs['tax'];
106	}


107
108	// Add line item tax and shipping taxes together
109	- $total_tax = (float) $tax + (float) $shipping_tax;
110
111	// Tax override on a per vendor basis
112	if ( $give_tax_override ) $give_tax = true;


93	$give_tax_override = get_user_meta( $author, 'wcv_give_vendor_tax', true );
94	$give_shipping_override = get_user_meta( $author, 'wcv_give_vendor_shipping', true );
95	$is_vendor = WCV_Vendors::is_vendor( $author );
96	+ $commission = $is_vendor ? WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product_id, $order, $product[ 'qty' ] ) : 0;
97	$tax = !empty( $product[ 'line_tax' ] ) ? (float) $product[ 'line_tax' ] : 0;
98
99	// Check if shipping is enabled

104	$shipping = $shipping_costs['amount'];
105	$shipping_tax = $shipping_costs['tax'];
106	}
107	+
108	+ $_product = new WC_Product( $product['product_id'] );
109
110	// Add line item tax and shipping taxes together
111	+ $total_tax = ( $_product->is_taxable() ) ? (float) $tax + (float) $shipping_tax : 0;
112
113	// Tax override on a per vendor basis
114	if ( $give_tax_override ) $give_tax = true;

classes/front/class-vendor-cart.php CHANGED Viewed

	@@ -58,7 +58,7 @@ class WCV_Vendor_Cart
58	? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
59	: get_bloginfo( 'name' );
60
61	- echo apply_filters('wcvendors_cart_sold_by_meta', $sold_by_label ) . $sold_by . '<br/>';
62	}
63
64	}


58	? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
59	: get_bloginfo( 'name' );
60
61	+ echo apply_filters('wcvendors_cart_sold_by_meta', $sold_by_label ) .' '. $sold_by . '<br/>';
62	}
63
64	}

classes/front/class-vendor-shop.php CHANGED Viewed

	@@ -180,7 +180,7 @@ class WCV_Vendor_Shop
180	$sold_by = WCV_Vendors::is_vendor( $vendor_id )
181	? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
182	: get_bloginfo( 'name' );
183	- echo '<small class="wcvendors_sold_by_in_loop">' . apply_filters('wcvendors_sold_by_in_loop', $sold_by_label ). $sold_by . ' </small> <br />';
184	}
185
186
	@@ -282,9 +282,11 @@ class WCV_Vendor_Shop
282	*
283	*/
284	public static function add_vendor_to_order_item_meta( $item_id, $cart_item) {
285	- $vendor_id = $cart_item[ 'data' ]->post->post_author;
286	- $~~sold_by~~ = ~~WCV_Vendors::is_vendor~~( ~~$vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo(~~ '~~name~~' );
287	- ~~wc_add_order_item_meta~~( $~~item_id,~~ ~~apply_filters(~~ ~~'wcvendors_sold_by_in_email',~~ __(~~'Sold~~ by : ', '~~wcvendors~~') )~~, $sold_by)~~;


288	}
289
290	}


180	$sold_by = WCV_Vendors::is_vendor( $vendor_id )
181	? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
182	: get_bloginfo( 'name' );
183	+ echo '<small class="wcvendors_sold_by_in_loop">' . apply_filters('wcvendors_sold_by_in_loop', $sold_by_label ).' '. $sold_by . '</small> <br />';
184	}
185
186

282	*
283	*/
284	public static function add_vendor_to_order_item_meta( $item_id, $cart_item) {
285	+ $vendor_id = $cart_item[ 'data' ]->post->post_author;
286	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
287	+ $sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
288	+
289	+ wc_add_order_item_meta( $item_id, apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
290	}
291
292	}

languages/default.pot CHANGED Viewed

	@@ -2,7 +2,7 @@
2	msgid ""
3	msgstr ""
4	"Project-Id-Version: WC Vendors\n"
5	- "POT-Creation-Date: 2016-01-25 15:08+1000\n"
6	"PO-Revision-Date: 2015-04-24 09:29+1000\n"
7	"Last-Translator: \n"
8	"Language-Team: WC Vendors <support@wcvendors.com>\n"
	@@ -25,7 +25,7 @@ msgid ""
25	msgstr ""
26
27	#: ../class-wc-vendors.php:81 ../classes/admin/class-admin-reports.php:41
28	- #: ../classes/admin/class-admin-users.php:~~397~~
29	msgid "WC Vendors"
30	msgstr ""
31
	@@ -319,54 +319,54 @@ msgstr ""
319	msgid "No commissions found."
320	msgstr ""
321
322	- #: ../classes/admin/class-admin-users.php:~~407~~
323	msgid "Enable HTML for the shop description"
324	msgstr ""
325
326	- #: ../classes/admin/class-admin-users.php:~~413~~
327	msgid "Shop name"
328	msgstr ""
329
330	- #: ../classes/admin/class-admin-users.php:~~420~~
331	msgid "PayPal E-mail"
332	msgstr ""
333
334	- #: ../classes/admin/class-admin-users.php:~~421~~
335	msgid "required"
336	msgstr ""
337
338	- #: ../classes/admin/class-admin-users.php:~~428~~
339	msgid "Commission rate"
340	msgstr ""
341
342	- #: ../classes/admin/class-admin-users.php:~~429~~
343	#: ../classes/admin/class-product-meta.php:174
344	msgid "Leave blank for default"
345	msgstr ""
346
347	- #: ../classes/admin/class-admin-users.php:~~435~~
348	msgid "Give Tax"
349	msgstr ""
350
351	- #: ../classes/admin/class-admin-users.php:~~440~~
352	msgid "Tax override for vendor"
353	msgstr ""
354
355	- #: ../classes/admin/class-admin-users.php:~~446~~
356	msgid "Give Shipping"
357	msgstr ""
358
359	- #: ../classes/admin/class-admin-users.php:~~451~~
360	msgid "Shipping override for vendor"
361	msgstr ""
362
363	- #: ../classes/admin/class-admin-users.php:~~457~~
364	#: ../classes/admin/views/html-vendor-settings-page.php:30
365	#: ../templates/dashboard/settings/seller-info.php:3
366	msgid "Seller info"
367	msgstr ""
368
369	- #: ../classes/admin/class-admin-users.php:~~462~~
370	msgid "Shop description"
371	msgstr ""
372
	@@ -393,7 +393,7 @@ msgid "That shop name is already taken. Your shop name must be unique."
393	msgstr ""
394
395	#: ../classes/admin/class-vendor-admin-dashboard.php:87
396	- #: ../classes/admin/settings/classes/sf-class-settings.php:~~366~~
397	#: ../classes/front/dashboard/class-vendor-dashboard.php:133
398	msgid "Settings saved."
399	msgstr ""
	@@ -499,7 +499,7 @@ msgstr ""
499	#: ../classes/admin/emails/class-wc-approve-vendor.php:123
500	#: ../classes/admin/emails/class-wc-notify-admin.php:134
501	#: ../classes/admin/emails/class-wc-notify-shipped.php:163
502	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~256~~
503	#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
504	msgid "Enable/Disable"
505	msgstr ""
	@@ -507,7 +507,7 @@ msgstr ""
507	#: ../classes/admin/emails/class-wc-approve-vendor.php:125
508	#: ../classes/admin/emails/class-wc-notify-admin.php:136
509	#: ../classes/admin/emails/class-wc-notify-shipped.php:165
510	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~258~~
511	msgid "Enable this email notification"
512	msgstr ""
513
	@@ -527,14 +527,14 @@ msgstr ""
527	#: ../classes/admin/emails/class-wc-approve-vendor.php:136
528	#: ../classes/admin/emails/class-wc-notify-admin.php:147
529	#: ../classes/admin/emails/class-wc-notify-shipped.php:169
530	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~262~~
531	msgid "Subject"
532	msgstr ""
533
534	#: ../classes/admin/emails/class-wc-approve-vendor.php:138
535	#: ../classes/admin/emails/class-wc-notify-admin.php:149
536	#: ../classes/admin/emails/class-wc-notify-shipped.php:171
537	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~264~~
538	#, php-format
539	msgid ""
540	"This controls the email subject line. Leave blank to use the default "
	@@ -544,14 +544,14 @@ msgstr ""
544	#: ../classes/admin/emails/class-wc-approve-vendor.php:143
545	#: ../classes/admin/emails/class-wc-notify-admin.php:154
546	#: ../classes/admin/emails/class-wc-notify-shipped.php:176
547	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~269~~
548	msgid "Email Heading"
549	msgstr ""
550
551	#: ../classes/admin/emails/class-wc-approve-vendor.php:145
552	#: ../classes/admin/emails/class-wc-notify-admin.php:156
553	#: ../classes/admin/emails/class-wc-notify-shipped.php:178
554	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~271~~
555	#, php-format
556	msgid ""
557	"This controls the main heading contained within the email notification. "
	@@ -561,35 +561,35 @@ msgstr ""
561	#: ../classes/admin/emails/class-wc-approve-vendor.php:150
562	#: ../classes/admin/emails/class-wc-notify-admin.php:161
563	#: ../classes/admin/emails/class-wc-notify-shipped.php:183
564	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~276~~
565	msgid "Email type"
566	msgstr ""
567
568	#: ../classes/admin/emails/class-wc-approve-vendor.php:152
569	#: ../classes/admin/emails/class-wc-notify-admin.php:163
570	#: ../classes/admin/emails/class-wc-notify-shipped.php:185
571	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~278~~
572	msgid "Choose which format of email to send."
573	msgstr ""
574
575	#: ../classes/admin/emails/class-wc-approve-vendor.php:156
576	#: ../classes/admin/emails/class-wc-notify-admin.php:167
577	#: ../classes/admin/emails/class-wc-notify-shipped.php:189
578	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~282~~
579	msgid "Plain text"
580	msgstr ""
581
582	#: ../classes/admin/emails/class-wc-approve-vendor.php:157
583	#: ../classes/admin/emails/class-wc-notify-admin.php:168
584	#: ../classes/admin/emails/class-wc-notify-shipped.php:190
585	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~283~~
586	msgid "HTML"
587	msgstr ""
588
589	#: ../classes/admin/emails/class-wc-approve-vendor.php:158
590	#: ../classes/admin/emails/class-wc-notify-admin.php:169
591	#: ../classes/admin/emails/class-wc-notify-shipped.php:191
592	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~284~~
593	msgid "Multipart"
594	msgstr ""
595
	@@ -647,20 +647,20 @@ msgstr ""
647	msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
648	msgstr ""
649
650	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~111~~
651	msgid "Commission Subtotal:"
652	msgstr ""
653
654	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~117~~
655	msgid "Tax Subtotal:"
656	msgstr ""
657
658	- #: ../classes/admin/emails/class-wc-notify-vendor.php:~~125~~
659	msgid "Shipping Subtotal:"
660	msgstr ""
661
662	#: ../classes/admin/settings/classes/sf-class-format-options.php:211
663	- #: ../classes/admin/settings/classes/sf-class-settings.php:~~778~~
664	msgid "Select a page..."
665	msgstr ""
666
	@@ -669,19 +669,34 @@ msgstr ""
669	msgid "Settings"
670	msgstr ""
671
672	- #: ../classes/admin/settings/classes/sf-class-settings.php:~~300~~
673	msgid "Could not load settings at: "
674	msgstr ""
675
676	- #: ../classes/admin/settings/classes/sf-class-settings.php:~~300~~
677	msgid "Error - WP Settings Framework"
678	msgstr ""
679
680	- #: ../classes/admin/settings/classes/sf-class-settings.php:~~482~~
681	#, php-format
682	msgid "Save %s changes"
683	msgstr ""
684















685	#: ../classes/admin/settings/sf-options.php:5
686	msgid "General options"
687	msgstr ""
	@@ -831,7 +846,7 @@ msgid "The sold by label used on the site and emails."
831	msgstr ""
832
833	#: ../classes/admin/settings/sf-options.php:107
834	- msgid "Sold By: "
835	msgstr ""
836
837	#: ../classes/admin/settings/sf-options.php:111
	@@ -1255,10 +1270,6 @@ msgstr ""
1255	msgid "Vendor Dashboard"
1256	msgstr ""
1257
1258	- #: ../classes/front/class-vendor-shop.php:287
1259	- msgid "Sold by"
1260	- msgstr ""
1261	-
1262	#: ../classes/front/dashboard/class-vendor-dashboard.php:48
1263	msgid "Order marked shipped."
1264	msgstr ""
	@@ -1717,18 +1728,18 @@ msgstr ""
1717	msgid "Price"
1718	msgstr ""
1719
1720	- #: ../templates/emails/notify-vendor-shipped.php:50
1721	- #: ../templates/emails/vendor-new-order.php:50
1722	msgid "Customer details"
1723	msgstr ""
1724
1725	- #: ../templates/emails/notify-vendor-shipped.php:53
1726	- #: ../templates/emails/vendor-new-order.php:53
1727	msgid "Email:"
1728	msgstr ""
1729
1730	- #: ../templates/emails/notify-vendor-shipped.php:56
1731	- #: ../templates/emails/vendor-new-order.php:56
1732	msgid "Tel:"
1733	msgstr ""
1734


2	msgid ""
3	msgstr ""
4	"Project-Id-Version: WC Vendors\n"
5	+ "POT-Creation-Date: 2016-03-14 16:10+1000\n"
6	"PO-Revision-Date: 2015-04-24 09:29+1000\n"
7	"Last-Translator: \n"
8	"Language-Team: WC Vendors <support@wcvendors.com>\n"

25	msgstr ""
26
27	#: ../class-wc-vendors.php:81 ../classes/admin/class-admin-reports.php:41
28	+ #: ../classes/admin/class-admin-users.php:399
29	msgid "WC Vendors"
30	msgstr ""
31

319	msgid "No commissions found."
320	msgstr ""
321
322	+ #: ../classes/admin/class-admin-users.php:409
323	msgid "Enable HTML for the shop description"
324	msgstr ""
325
326	+ #: ../classes/admin/class-admin-users.php:415
327	msgid "Shop name"
328	msgstr ""
329
330	+ #: ../classes/admin/class-admin-users.php:422
331	msgid "PayPal E-mail"
332	msgstr ""
333
334	+ #: ../classes/admin/class-admin-users.php:423
335	msgid "required"
336	msgstr ""
337
338	+ #: ../classes/admin/class-admin-users.php:430
339	msgid "Commission rate"
340	msgstr ""
341
342	+ #: ../classes/admin/class-admin-users.php:431
343	#: ../classes/admin/class-product-meta.php:174
344	msgid "Leave blank for default"
345	msgstr ""
346
347	+ #: ../classes/admin/class-admin-users.php:437
348	msgid "Give Tax"
349	msgstr ""
350
351	+ #: ../classes/admin/class-admin-users.php:442
352	msgid "Tax override for vendor"
353	msgstr ""
354
355	+ #: ../classes/admin/class-admin-users.php:448
356	msgid "Give Shipping"
357	msgstr ""
358
359	+ #: ../classes/admin/class-admin-users.php:453
360	msgid "Shipping override for vendor"
361	msgstr ""
362
363	+ #: ../classes/admin/class-admin-users.php:459
364	#: ../classes/admin/views/html-vendor-settings-page.php:30
365	#: ../templates/dashboard/settings/seller-info.php:3
366	msgid "Seller info"
367	msgstr ""
368
369	+ #: ../classes/admin/class-admin-users.php:464
370	msgid "Shop description"
371	msgstr ""
372

393	msgstr ""
394
395	#: ../classes/admin/class-vendor-admin-dashboard.php:87
396	+ #: ../classes/admin/settings/classes/sf-class-settings.php:368
397	#: ../classes/front/dashboard/class-vendor-dashboard.php:133
398	msgid "Settings saved."
399	msgstr ""

499	#: ../classes/admin/emails/class-wc-approve-vendor.php:123
500	#: ../classes/admin/emails/class-wc-notify-admin.php:134
501	#: ../classes/admin/emails/class-wc-notify-shipped.php:163
502	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:258
503	#: ../classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php:62
504	msgid "Enable/Disable"
505	msgstr ""

507	#: ../classes/admin/emails/class-wc-approve-vendor.php:125
508	#: ../classes/admin/emails/class-wc-notify-admin.php:136
509	#: ../classes/admin/emails/class-wc-notify-shipped.php:165
510	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:260
511	msgid "Enable this email notification"
512	msgstr ""
513

527	#: ../classes/admin/emails/class-wc-approve-vendor.php:136
528	#: ../classes/admin/emails/class-wc-notify-admin.php:147
529	#: ../classes/admin/emails/class-wc-notify-shipped.php:169
530	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:264
531	msgid "Subject"
532	msgstr ""
533
534	#: ../classes/admin/emails/class-wc-approve-vendor.php:138
535	#: ../classes/admin/emails/class-wc-notify-admin.php:149
536	#: ../classes/admin/emails/class-wc-notify-shipped.php:171
537	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:266
538	#, php-format
539	msgid ""
540	"This controls the email subject line. Leave blank to use the default "

544	#: ../classes/admin/emails/class-wc-approve-vendor.php:143
545	#: ../classes/admin/emails/class-wc-notify-admin.php:154
546	#: ../classes/admin/emails/class-wc-notify-shipped.php:176
547	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:271
548	msgid "Email Heading"
549	msgstr ""
550
551	#: ../classes/admin/emails/class-wc-approve-vendor.php:145
552	#: ../classes/admin/emails/class-wc-notify-admin.php:156
553	#: ../classes/admin/emails/class-wc-notify-shipped.php:178
554	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:273
555	#, php-format
556	msgid ""
557	"This controls the main heading contained within the email notification. "

561	#: ../classes/admin/emails/class-wc-approve-vendor.php:150
562	#: ../classes/admin/emails/class-wc-notify-admin.php:161
563	#: ../classes/admin/emails/class-wc-notify-shipped.php:183
564	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:278
565	msgid "Email type"
566	msgstr ""
567
568	#: ../classes/admin/emails/class-wc-approve-vendor.php:152
569	#: ../classes/admin/emails/class-wc-notify-admin.php:163
570	#: ../classes/admin/emails/class-wc-notify-shipped.php:185
571	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:280
572	msgid "Choose which format of email to send."
573	msgstr ""
574
575	#: ../classes/admin/emails/class-wc-approve-vendor.php:156
576	#: ../classes/admin/emails/class-wc-notify-admin.php:167
577	#: ../classes/admin/emails/class-wc-notify-shipped.php:189
578	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:284
579	msgid "Plain text"
580	msgstr ""
581
582	#: ../classes/admin/emails/class-wc-approve-vendor.php:157
583	#: ../classes/admin/emails/class-wc-notify-admin.php:168
584	#: ../classes/admin/emails/class-wc-notify-shipped.php:190
585	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:285
586	msgid "HTML"
587	msgstr ""
588
589	#: ../classes/admin/emails/class-wc-approve-vendor.php:158
590	#: ../classes/admin/emails/class-wc-notify-admin.php:169
591	#: ../classes/admin/emails/class-wc-notify-shipped.php:191
592	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:286
593	msgid "Multipart"
594	msgstr ""
595

647	msgid "[{blogname}] New customer order ({order_number}) - {order_date}"
648	msgstr ""
649
650	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:113
651	msgid "Commission Subtotal:"
652	msgstr ""
653
654	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:119
655	msgid "Tax Subtotal:"
656	msgstr ""
657
658	+ #: ../classes/admin/emails/class-wc-notify-vendor.php:127
659	msgid "Shipping Subtotal:"
660	msgstr ""
661
662	#: ../classes/admin/settings/classes/sf-class-format-options.php:211
663	+ #: ../classes/admin/settings/classes/sf-class-settings.php:780
664	msgid "Select a page..."
665	msgstr ""
666

669	msgid "Settings"
670	msgstr ""
671
672	+ #: ../classes/admin/settings/classes/sf-class-settings.php:302
673	msgid "Could not load settings at: "
674	msgstr ""
675
676	+ #: ../classes/admin/settings/classes/sf-class-settings.php:302
677	msgid "Error - WP Settings Framework"
678	msgstr ""
679
680	+ #: ../classes/admin/settings/classes/sf-class-settings.php:484
681	#, php-format
682	msgid "Save %s changes"
683	msgstr ""
684
685	+ #: ../classes/admin/settings/classes/sf-class-settings.php:837
686	+ #, php-format
687	+ msgid "Update %s"
688	+ msgstr ""
689	+
690	+ #: ../classes/admin/settings/classes/sf-class-settings.php:837
691	+ #, php-format
692	+ msgid "Add %s"
693	+ msgstr ""
694	+
695	+ #: ../classes/admin/settings/classes/sf-class-settings.php:837
696	+ #, php-format
697	+ msgid "Upload an image for the %s"
698	+ msgstr ""
699	+
700	#: ../classes/admin/settings/sf-options.php:5
701	msgid "General options"
702	msgstr ""

846	msgstr ""
847
848	#: ../classes/admin/settings/sf-options.php:107
849	+ msgid "Sold By"
850	msgstr ""
851
852	#: ../classes/admin/settings/sf-options.php:111

1270	msgid "Vendor Dashboard"
1271	msgstr ""
1272




1273	#: ../classes/front/dashboard/class-vendor-dashboard.php:48
1274	msgid "Order marked shipped."
1275	msgstr ""

1728	msgid "Price"
1729	msgstr ""
1730
1731	+ #: ../templates/emails/notify-vendor-shipped.php:56
1732	+ #: ../templates/emails/vendor-new-order.php:56
1733	msgid "Customer details"
1734	msgstr ""
1735
1736	+ #: ../templates/emails/notify-vendor-shipped.php:59
1737	+ #: ../templates/emails/vendor-new-order.php:59
1738	msgid "Email:"
1739	msgstr ""
1740
1741	+ #: ../templates/emails/notify-vendor-shipped.php:62
1742	+ #: ../templates/emails/vendor-new-order.php:62
1743	msgid "Tel:"
1744	msgstr ""
1745

readme.txt CHANGED Viewed

	@@ -5,8 +5,8 @@ Donate link: http://www.wcvendors.com/
5	Author URI: http://www.wcvendors.com/
6	Plugin URI: http://www.wcvendors.com/
7	Requires at least: 4.0
8	- Tested up to: 4.4.1
9	- Stable tag: 1.8.6
10	License: GPLv2 or later
11
12	The free multi-vendor plugin for WooCommerce. Now you can allow anyone to open a store on your site!


5	Author URI: http://www.wcvendors.com/
6	Plugin URI: http://www.wcvendors.com/
7	Requires at least: 4.0
8	+ Tested up to: 4.4.2
9	+ Stable tag: 1.8.7
10	License: GPLv2 or later
11
12	The free multi-vendor plugin for WooCommerce. Now you can allow anyone to open a store on your site!

templates/emails/notify-vendor-shipped.php CHANGED Viewed

	@@ -25,7 +25,13 @@ if ( ! defined( 'ABSPATH' ) ) exit; // Exit if accessed directly ?>
25	</tr>
26	</thead>
27	<tbody>
28	- <?php echo $order->email_order_items_table( ~~false, true ); ?>~~






29	</tbody>
30	<tfoot>
31	<?php


25	</tr>
26	</thead>
27	<tbody>
28	+ <?php echo $order->email_order_items_table( array(
29	+ 'show_sku' => false,
30	+ 'show_image' => false,
31	+ 'image_size' => array( 32, 32 ),
32	+ 'plain_text' => false,
33	+ 'sent_to_admin' => false
34	+ ) ); ?>
35	</tbody>
36	<tfoot>
37	<?php

templates/emails/vendor-new-order.php CHANGED Viewed

	@@ -25,7 +25,13 @@ if ( ! defined( 'ABSPATH' ) ) exit; // Exit if accessed directly ?>
25	</tr>
26	</thead>
27	<tbody>
28	- <?php echo $order->email_order_items_table( ~~false, true ); ?>~~






29	</tbody>
30	<tfoot>
31	<?php


25	</tr>
26	</thead>
27	<tbody>
28	+ <?php echo $order->email_order_items_table( array(
29	+ 'show_sku' => false,
30	+ 'show_image' => false,
31	+ 'image_size' => array( 32, 32 ),
32	+ 'plain_text' => false,
33	+ 'sent_to_admin' => false
34	+ ) ); ?>
35	</tbody>
36	<tfoot>
37	<?php

trunk/assets/css/admin-orders.css ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ .wp-list-table .column-order_id { width: 10%; }
2	+ .wp-list-table .column-customer { width: 15%; }
3	+ .wp-list-table .column-product { width: 35%; }
4	+ .wp-list-table .column-total { width: 10%;}
5	+ /.wp-list-table .column-comments { width: 27.5%;}/
6	+ .wp-list-table .column-date { width: 15%;}
7	+ .wp-list-table .column-status { width: 15%;}

trunk/assets/css/wcv-frontend.css ADDED Viewed

	@@ -0,0 +1,545 @@


1	+ /*!
2	+ * Bootstrap v2.1.1
3	+ *
4	+ * Copyright 2012 Twitter, Inc
5	+ * Licensed under the Apache License v2.0
6	+ * http://www.apache.org/licenses/LICENSE-2.0
7	+ *
8	+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
9	+ */
10	+ clearfix {
11	+ *zoom: 1;
12	+ }
13	+
14	+ .clearfix:before, .clearfix:after {
15	+ display: table;
16	+ content: "";
17	+ line-height: 0;
18	+ }
19	+
20	+ .clearfix:after {
21	+ clear: both;
22	+ }
23	+
24	+ .hide-text {
25	+ font: 0/0 a;
26	+ color: transparent;
27	+ text-shadow: none;
28	+ background-color: transparent;
29	+ border: 0;
30	+ }
31	+
32	+ .input-block-level {
33	+ display: block;
34	+ width: 100%;
35	+ min-height: 30px;
36	+ -webkit-box-sizing: border-box;
37	+ -moz-box-sizing: border-box;
38	+ box-sizing: border-box;
39	+ }
40	+
41	+ .wcv-btn {
42	+ display: inline-block;
43	+ *display: inline;
44	+ *zoom: 1;
45	+ padding: 4px 14px;
46	+ margin-bottom: 0;
47	+ font-size: 14px;
48	+ line-height: 20px;
49	+ *line-height: 20px;
50	+ text-align: center;
51	+ vertical-align: middle;
52	+ cursor: pointer;
53	+ color: #333333;
54	+ text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
55	+ background-color: #f5f5f5;
56	+ background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
57	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
58	+ background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
59	+ background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
60	+ background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
61	+ background-repeat: repeat-x;
62	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe6e6e6', GradientType=0);
63	+ border-color: #e6e6e6 #e6e6e6 #bfbfbf;
64	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
65	+ *background-color: #e6e6e6;
66	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
67	+ border: 1px solid #bbbbbb;
68	+ *border: 0;
69	+ border-bottom-color: #a2a2a2;
70	+ -webkit-border-radius: 4px;
71	+ -moz-border-radius: 4px;
72	+ border-radius: 4px;
73	+ *margin-left: .3em;
74	+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
75	+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
76	+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
77	+ }
78	+
79	+ .wcv-btn:hover, .wcv-btn:active, .wcv-btn.active, .wcv-btn.disabled, .wcv-btn[disabled] {
80	+ color: #333333;
81	+ background-color: #e6e6e6;
82	+ *background-color: #d9d9d9;
83	+ }
84	+
85	+ .wcv-btn:active, .wcv-btn.active {
86	+ background-color: #cccccc \9;
87	+ }
88	+
89	+ .wcv-btn:first-child {
90	+ *margin-left: 0;
91	+ }
92	+
93	+ .wcv-btn:hover {
94	+ color: #333333;
95	+ text-decoration: none;
96	+ background-color: #e6e6e6;
97	+ *background-color: #d9d9d9;
98	+ background-position: 0 -15px;
99	+ -webkit-transition: background-position 0.1s linear;
100	+ -moz-transition: background-position 0.1s linear;
101	+ -o-transition: background-position 0.1s linear;
102	+ transition: background-position 0.1s linear;
103	+ }
104	+
105	+ .wcv-btn:focus {
106	+ outline: thin dotted #333;
107	+ outline: 5px auto -webkit-focus-ring-color;
108	+ outline-offset: -2px;
109	+ }
110	+
111	+ .wcv-btn.active, .wcv-btn:active {
112	+ background-color: #e6e6e6;
113	+ background-color: #d9d9d9 \9;
114	+ background-image: none;
115	+ outline: 0;
116	+ -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
117	+ -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
118	+ box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
119	+ }
120	+
121	+ .wcv-btn.disabled, .wcv-btn[disabled] {
122	+ cursor: default;
123	+ background-color: #e6e6e6;
124	+ background-image: none;
125	+ opacity: 0.65;
126	+ filter: alpha(opacity=65);
127	+ -webkit-box-shadow: none;
128	+ -moz-box-shadow: none;
129	+ box-shadow: none;
130	+ }
131	+
132	+ .wcv-btn-large {
133	+ padding: 9px 14px;
134	+ font-size: 16px;
135	+ line-height: normal;
136	+ -webkit-border-radius: 5px;
137	+ -moz-border-radius: 5px;
138	+ border-radius: 5px;
139	+ }
140	+
141	+ .wcv-btn-large [class^="icon-"] {
142	+ margin-top: 2px;
143	+ }
144	+
145	+ .wcv-btn-small {
146	+ padding: 3px 9px;
147	+ font-size: 12px;
148	+ line-height: 18px;
149	+ }
150	+
151	+ .wcv-btn-small [class^="icon-"] {
152	+ margin-top: 0;
153	+ }
154	+
155	+ .wcv-btn-mini {
156	+ padding: 2px 6px;
157	+ font-size: 11px;
158	+ line-height: 17px;
159	+ }
160	+
161	+ .wcv-btn-block {
162	+ display: block;
163	+ width: 100%;
164	+ padding-left: 0;
165	+ padding-right: 0;
166	+ -webkit-box-sizing: border-box;
167	+ -moz-box-sizing: border-box;
168	+ box-sizing: border-box;
169	+ }
170	+
171	+ .wcv-btn-block + .wcv-btn-block {
172	+ margin-top: 5px;
173	+ }
174	+
175	+ input[type="submit"].wcv-btn-block, input[type="reset"].wcv-btn-block, input[type="button"].wcv-btn-block {
176	+ width: 100%;
177	+ }
178	+
179	+ .wcv-btn-primary.active, .wcv-btn-warning.active, .wcv-btn-danger.active, .wcv-btn-success.active, .wcv-btn-info.active, .wcv-btn-inverse.active {
180	+ color: rgba(255, 255, 255, 0.75);
181	+ }
182	+
183	+ .wcv-btn {
184	+ border-color: #c5c5c5;
185	+ border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
186	+ }
187	+
188	+ .wcv-btn-primary {
189	+ color: #ffffff;
190	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
191	+ background-color: #006dcc;
192	+ background-image: -moz-linear-gradient(top, #0088cc, #0044cc);
193	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0044cc));
194	+ background-image: -webkit-linear-gradient(top, #0088cc, #0044cc);
195	+ background-image: -o-linear-gradient(top, #0088cc, #0044cc);
196	+ background-image: linear-gradient(to bottom, #0088cc, #0044cc);
197	+ background-repeat: repeat-x;
198	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);
199	+ border-color: #0044cc #0044cc #002a80;
200	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
201	+ *background-color: #0044cc;
202	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
203	+ }
204	+
205	+ .wcv-btn-primary:hover, .wcv-btn-primary:active, .wcv-btn-primary.active, .wcv-btn-primary.disabled, .wcv-btn-primary[disabled] {
206	+ color: #ffffff;
207	+ background-color: #0044cc;
208	+ *background-color: #003bb3;
209	+ }
210	+
211	+ .wcv-btn-primary:active, .wcv-btn-primary.active {
212	+ background-color: #003399 \9;
213	+ }
214	+
215	+ .wcv-btn-warning {
216	+ color: #ffffff;
217	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
218	+ background-color: #faa732;
219	+ background-image: -moz-linear-gradient(top, #fbb450, #f89406);
220	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
221	+ background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
222	+ background-image: -o-linear-gradient(top, #fbb450, #f89406);
223	+ background-image: linear-gradient(to bottom, #fbb450, #f89406);
224	+ background-repeat: repeat-x;
225	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffbb450', endColorstr='#fff89406', GradientType=0);
226	+ border-color: #f89406 #f89406 #ad6704;
227	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
228	+ *background-color: #f89406;
229	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
230	+ }
231	+
232	+ .wcv-btn-warning:hover, .wcv-btn-warning:active, .wcv-btn-warning.active, .wcv-btn-warning.disabled, .wcv-btn-warning[disabled] {
233	+ color: #ffffff;
234	+ background-color: #f89406;
235	+ *background-color: #df8505;
236	+ }
237	+
238	+ .wcv-btn-warning:active, .wcv-btn-warning.active {
239	+ background-color: #c67605 \9;
240	+ }
241	+
242	+ .wcv-btn-danger {
243	+ color: #ffffff;
244	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
245	+ background-color: #da4f49;
246	+ background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f);
247	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));
248	+ background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f);
249	+ background-image: -o-linear-gradient(top, #ee5f5b, #bd362f);
250	+ background-image: linear-gradient(to bottom, #ee5f5b, #bd362f);
251	+ background-repeat: repeat-x;
252	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffee5f5b', endColorstr='#ffbd362f', GradientType=0);
253	+ border-color: #bd362f #bd362f #802420;
254	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
255	+ *background-color: #bd362f;
256	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
257	+ }
258	+
259	+ .wcv-btn-danger:hover, .wcv-btn-danger:active, .wcv-btn-danger.active, .wcv-btn-danger.disabled, .wcv-btn-danger[disabled] {
260	+ color: #ffffff;
261	+ background-color: #bd362f;
262	+ *background-color: #a9302a;
263	+ }
264	+
265	+ .wcv-btn-danger:active, .wcv-btn-danger.active {
266	+ background-color: #942a25 \9;
267	+ }
268	+
269	+ .wcv-btn-success {
270	+ color: #ffffff;
271	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
272	+ background-color: #5bb75b;
273	+ background-image: -moz-linear-gradient(top, #62c462, #51a351);
274	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));
275	+ background-image: -webkit-linear-gradient(top, #62c462, #51a351);
276	+ background-image: -o-linear-gradient(top, #62c462, #51a351);
277	+ background-image: linear-gradient(to bottom, #62c462, #51a351);
278	+ background-repeat: repeat-x;
279	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff62c462', endColorstr='#ff51a351', GradientType=0);
280	+ border-color: #51a351 #51a351 #387038;
281	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
282	+ *background-color: #51a351;
283	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
284	+ }
285	+
286	+ .wcv-btn-success:hover, .wcv-btn-success:active, .wcv-btn-success.active, .wcv-btn-success.disabled, .wcv-btn-success[disabled] {
287	+ color: #ffffff;
288	+ background-color: #51a351;
289	+ *background-color: #499249;
290	+ }
291	+
292	+ .wcv-btn-success:active, .wcv-btn-success.active {
293	+ background-color: #408140 \9;
294	+ }
295	+
296	+ .wcv-btn-info {
297	+ color: #ffffff;
298	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
299	+ background-color: #49afcd;
300	+ background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4);
301	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));
302	+ background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4);
303	+ background-image: -o-linear-gradient(top, #5bc0de, #2f96b4);
304	+ background-image: linear-gradient(to bottom, #5bc0de, #2f96b4);
305	+ background-repeat: repeat-x;
306	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2f96b4', GradientType=0);
307	+ border-color: #2f96b4 #2f96b4 #1f6377;
308	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
309	+ *background-color: #2f96b4;
310	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
311	+ }
312	+
313	+ .wcv-btn-info:hover, .wcv-btn-info:active, .wcv-btn-info.active, .wcv-btn-info.disabled, .wcv-btn-info[disabled] {
314	+ color: #ffffff;
315	+ background-color: #2f96b4;
316	+ *background-color: #2a85a0;
317	+ }
318	+
319	+ .wcv-btn-info:active, .wcv-btn-info.active {
320	+ background-color: #24748c \9;
321	+ }
322	+
323	+ .wcv-btn-inverse {
324	+ color: #ffffff;
325	+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
326	+ background-color: #363636;
327	+ background-image: -moz-linear-gradient(top, #444444, #222222);
328	+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#444444), to(#222222));
329	+ background-image: -webkit-linear-gradient(top, #444444, #222222);
330	+ background-image: -o-linear-gradient(top, #444444, #222222);
331	+ background-image: linear-gradient(to bottom, #444444, #222222);
332	+ background-repeat: repeat-x;
333	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff444444', endColorstr='#ff222222', GradientType=0);
334	+ border-color: #222222 #222222 #000000;
335	+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
336	+ *background-color: #222222;
337	+ filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
338	+ }
339	+
340	+ .wcv-btn-inverse:hover, .wcv-btn-inverse:active, .wcv-btn-inverse.active, .wcv-btn-inverse.disabled, .wcv-btn-inverse[disabled] {
341	+ color: #ffffff;
342	+ background-color: #222222;
343	+ *background-color: #151515;
344	+ }
345	+
346	+ .wcv-btn-inverse:active, .wcv-btn-inverse.active {
347	+ background-color: #080808 \9;
348	+ }
349	+
350	+ button.wcv-btn, input[type="submit"].wcv-btn {
351	+ *padding-top: 3px;
352	+ *padding-bottom: 3px;
353	+ }
354	+
355	+ button.wcv-btn::-moz-focus-inner, input[type="submit"].wcv-btn::-moz-focus-inner {
356	+ padding: 0;
357	+ border: 0;
358	+ }
359	+
360	+ button.wcv-btn.wcv-btn-large, input[type="submit"].wcv-btn.wcv-btn-large {
361	+ *padding-top: 7px;
362	+ *padding-bottom: 7px;
363	+ }
364	+
365	+ button.wcv-btn.wcv-btn-small, input[type="submit"].wcv-btn.wcv-btn-small {
366	+ *padding-top: 3px;
367	+ *padding-bottom: 3px;
368	+ }
369	+
370	+ button.wcv-btn.wcv-btn-mini, input[type="submit"].wcv-btn.wcv-btn-mini {
371	+ *padding-top: 1px;
372	+ *padding-bottom: 1px;
373	+ }
374	+
375	+ .wcv-btn-link, .wcv-btn-link:active, .wcv-btn-link[disabled] {
376	+ background-color: transparent;
377	+ background-image: none;
378	+ -webkit-box-shadow: none;
379	+ -moz-box-shadow: none;
380	+ box-shadow: none;
381	+ }
382	+
383	+ .wcv-btn-link {
384	+ border-color: transparent;
385	+ cursor: pointer;
386	+ color: #0088cc;
387	+ -webkit-border-radius: 0;
388	+ -moz-border-radius: 0;
389	+ border-radius: 0;
390	+ }
391	+
392	+ .wcv-btn-link:hover {
393	+ color: #005580;
394	+ text-decoration: underline;
395	+ background-color: transparent;
396	+ }
397	+
398	+ .wcv-btn-link[disabled]:hover {
399	+ color: #333333;
400	+ text-decoration: none;
401	+ }
402	+
403	+ table {
404	+ max-width: 100%;
405	+ background-color: transparent;
406	+ border-collapse: collapse;
407	+ border-spacing: 0;
408	+ }
409	+
410	+ .table {
411	+ width: 100%;
412	+ margin-bottom: 20px;
413	+ }
414	+
415	+ .table th, .table td {
416	+ padding: 8px;
417	+ line-height: 20px;
418	+ text-align: left;
419	+ vertical-align: top;
420	+ border-top: 1px solid #dddddd;
421	+ }
422	+
423	+ .table th {
424	+ font-weight: bold;
425	+ }
426	+
427	+ .table thead th {
428	+ vertical-align: bottom;
429	+ }
430	+
431	+ .table caption + thead tr:first-child th, .table caption + thead tr:first-child td, .table colgroup + thead tr:first-child th, .table colgroup + thead tr:first-child td, .table thead:first-child tr:first-child th, .table thead:first-child tr:first-child td {
432	+ border-top: 0;
433	+ }
434	+
435	+ .table tbody + tbody {
436	+ border-top: 2px solid #dddddd;
437	+ }
438	+
439	+ .table-condensed th, .table-condensed td {
440	+ padding: 4px 5px;
441	+ }
442	+
443	+ .table-bordered {
444	+ border: 1px solid #dddddd;
445	+ border-collapse: separate;
446	+ *border-collapse: collapse;
447	+ border-left: 0;
448	+ -webkit-border-radius: 4px;
449	+ -moz-border-radius: 4px;
450	+ border-radius: 4px;
451	+ }
452	+
453	+ .table-bordered th, .table-bordered td {
454	+ border-left: 1px solid #dddddd;
455	+ }
456	+
457	+ .table-bordered caption + thead tr:first-child th, .table-bordered caption + tbody tr:first-child th, .table-bordered caption + tbody tr:first-child td, .table-bordered colgroup + thead tr:first-child th, .table-bordered colgroup + tbody tr:first-child th, .table-bordered colgroup + tbody tr:first-child td, .table-bordered thead:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child td {
458	+ border-top: 0;
459	+ }
460	+
461	+ .table-bordered thead:first-child tr:first-child th:first-child, .table-bordered tbody:first-child tr:first-child td:first-child {
462	+ -webkit-border-top-left-radius: 4px;
463	+ border-top-left-radius: 4px;
464	+ -moz-border-radius-topleft: 4px;
465	+ }
466	+
467	+ .table-bordered thead:first-child tr:first-child th:last-child, .table-bordered tbody:first-child tr:first-child td:last-child {
468	+ -webkit-border-top-right-radius: 4px;
469	+ border-top-right-radius: 4px;
470	+ -moz-border-radius-topright: 4px;
471	+ }
472	+
473	+ .table-bordered thead:last-child tr:last-child th:first-child, .table-bordered tbody:last-child tr:last-child td:first-child, .table-bordered tfoot:last-child tr:last-child td:first-child {
474	+ -webkit-border-radius: 0 0 0 4px;
475	+ -moz-border-radius: 0 0 0 4px;
476	+ border-radius: 0 0 0 4px;
477	+ -webkit-border-bottom-left-radius: 4px;
478	+ border-bottom-left-radius: 4px;
479	+ -moz-border-radius-bottomleft: 4px;
480	+ }
481	+
482	+ .table-bordered thead:last-child tr:last-child th:last-child, .table-bordered tbody:last-child tr:last-child td:last-child, .table-bordered tfoot:last-child tr:last-child td:last-child {
483	+ -webkit-border-bottom-right-radius: 4px;
484	+ border-bottom-right-radius: 4px;
485	+ -moz-border-radius-bottomright: 4px;
486	+ }
487	+
488	+ .table-bordered caption + thead tr:first-child th:first-child, .table-bordered caption + tbody tr:first-child td:first-child, .table-bordered colgroup + thead tr:first-child th:first-child, .table-bordered colgroup + tbody tr:first-child td:first-child {
489	+ -webkit-border-top-left-radius: 4px;
490	+ border-top-left-radius: 4px;
491	+ -moz-border-radius-topleft: 4px;
492	+ }
493	+
494	+ .table-bordered caption + thead tr:first-child th:last-child, .table-bordered caption + tbody tr:first-child td:last-child, .table-bordered colgroup + thead tr:first-child th:last-child, .table-bordered colgroup + tbody tr:first-child td:last-child {
495	+ -webkit-border-top-right-radius: 4px;
496	+ border-top-right-radius: 4px;
497	+ -moz-border-radius-topleft: 4px;
498	+ }
499	+
500	+ .table-striped tbody tr:nth-child(odd) td, .table-striped tbody tr:nth-child(odd) th {
501	+ background-color: #f9f9f9;
502	+ }
503	+
504	+ .table-hover tbody tr:hover td, .table-hover tbody tr:hover th {
505	+ background-color: #f5f5f5;
506	+ }
507	+
508	+ table [class=span], .row-fluid table [class=span] {
509	+ display: table-cell;
510	+ float: none;
511	+ margin-left: 0;
512	+ }
513	+
514	+ .table tbody tr.success td {
515	+ background-color: #dff0d8;
516	+ }
517	+
518	+ .table tbody tr.error td {
519	+ background-color: #f2dede;
520	+ }
521	+
522	+ .table tbody tr.warning td {
523	+ background-color: #fcf8e3;
524	+ }
525	+
526	+ .table tbody tr.info td {
527	+ background-color: #d9edf7;
528	+ }
529	+
530	+ .table-hover tbody tr.success:hover td {
531	+ background-color: #d0e9c6;
532	+ }
533	+
534	+ .table-hover tbody tr.error:hover td {
535	+ background-color: #ebcccc;
536	+ }
537	+
538	+ .table-hover tbody tr.warning:hover td {
539	+ background-color: #faf2cc;
540	+ }
541	+
542	+ .table-hover tbody tr.info:hover td {
543	+ background-color: #c4e3f3;
544	+ }
545	+ .hidden { display: none; }

trunk/assets/images/icons/truck.png ADDED Viewed

Binary file

trunk/assets/js/front-orders.js ADDED Viewed

	@@ -0,0 +1,8 @@


1	+ jQuery(function () {
2	+ jQuery('div.order-comments, div.order-tracking').hide();
3	+
4	+ jQuery('a.order-comments-link, a.order-tracking-link').on('click', function (e) {
5	+ e.preventDefault();
6	+ jQuery(this).next('div').slideToggle();
7	+ });
8	+ });

trunk/assets/js/wcv-admin-quick-edit.js ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ jQuery(function(){
2	+ jQuery('#the-list').on('click', '.editinline', function(){
3	+
4	+ if (jQuery('.inline-edit-author').length && jQuery('.inline-edit-author-new').length) {
5	+ jQuery('.inline-edit-author').hide();
6	+ jQuery('.inline-edit-author').attr('class', 'inline-edit-author-old');
7	+ jQuery('select[name=post_author]').attr('name', 'post_author-old');
8	+ jQuery('.inline-edit-author-new').attr('class', 'inline-edit-author');
9	+ jQuery('select[name=post_author-new]').attr('name', 'post_author');
10	+ }
11	+
12	+ inlineEditPost.revert();
13	+
14	+ var post_id = jQuery(this).closest('tr').attr('id');
15	+
16	+ post_id = post_id.replace("post-", "");
17	+
18	+ var wcv_inline_data = jQuery('#vendor_' + post_id),
19	+ wc_inline_data = jQuery('#woocommerce_inline_' + post_id );
20	+
21	+ var vendor = wcv_inline_data.find("#_vendor").text();
22	+
23	+ jQuery('select[name="post_author"] option[value="' + vendor + '"]', '.inline-edit-row').attr('selected', 'selected');
24	+
25	+ var product_type = wc_inline_data.find('.product_type').val();
26	+
27	+ if (product_type=='simple' \|\| product_type=='external') {
28	+ jQuery('.vendor', '.inline-edit-row').show();
29	+ } else {
30	+ jQuery('.vendor', '.inline-edit-row').hide();
31	+ }
32	+
33	+ });
34	+ });

trunk/changelog.txt ADDED Viewed

	@@ -0,0 +1,412 @@


1	+ Changelog for WC Vendors
2	+
3	+ Version 1.8.7
4	+
5	+ * Added: New qty argument to commission calculations
6	+ * Added: Image uploader settings type
7	+ * Added: New commission function for payment gateways
8	+ * Fixed: Prefixed all btn css classes to stop theme collision
9	+ * Fixed: Sold By:Name spaces issue #256
10	+ * Fixed: Show extended fields for vendor and pending vendor roles
11	+ * Fixed: Check if product is taxable
12	+ * Fixed: Depreciated function calls in email templates
13	+ * Fixed: Commission giving tax on none taxable items #251
14	+ * Fixed: Sold by label issues with WC 2.5 #250
15	+
16	+ Version 1.8.6
17	+
18	+ * Fixed: Critical issue with paypal loading classes incorrectly
19	+
20	+ Version 1.8.5
21	+
22	+ * Fixed: Issue with PayPal on some sites - Rolled back issue #247
23	+ * Fixed: Reverted ticket #216 for email conflicts
24	+ * Added: New KnowledgeBase URL
25	+
26	+ Version 1.8.4
27	+
28	+ * Added: Removed fields from users that aren't vendors
29	+ * Added: actions to hook into approve/deny vendor
30	+ * Added: Ability to integrate with any order status for emails #216
31	+ * Added: Terms & Conditions Opens in New Tab #246
32	+ * Updated: Added trigger for on-hold to processing/completed for Notify Vendor Email #238
33	+ * Updated: Settings page helper text and clarifications
34	+ * Fixed: Sold by formatting issue #248
35	+ * Fixed: wp_redirect caches with W3 Total Cache #237
36	+ * Fixed: Bug in single page settings generator
37	+ * Fixed: Category title missing bug #213
38	+ * Fixed: Undefined index for non vendor users
39	+ * Merge: pull request #247 from archonic/hotfix/oauth-class-exists
40	+
41	+
42	+ Version 1.8.3
43	+
44	+ * Fixed: Fatal Error on activation Merge pull request #235 from oleggen/patch-1
45	+ * Added: Seller info label option
46	+
47	+ Version 1.8.2
48	+
49	+ * Added: Sold By label option
50	+ * Added: New Vendor Commission Totals Report #234
51	+ * Fixed: Added 'Shipped' if marked as shipped #233 can be found on WooCommerce > Reports > WC Vendors > Commission Totals
52	+ * Fixed: Renamed internal function to stop theme and plugin clash
53	+
54	+ Version 1.8.1
55	+
56	+ * Added: New options updated action for settings
57	+ * Added: New plugin activation hook for testing woocommerce active
58	+ * Added: vendor id to get shipping due filter
59	+ * Added: Warning on settings page if user registration in WooCommerce is not enabled
60	+ * Added: Russian Translations thanks Natalia
61	+
62	+ Version 1.8.0
63	+
64	+ * Fixed: Mark $0.00 commissions as paid instead of due #205
65	+ * Fixed: Email trigger should be filter not action - Thanks ontiuk #215
66	+ * Updated: Read me with link to Pro and Updated Language List
67	+ * Added: Portuguese Language (Thanks Renato) #212
68	+ * Remove Forced HTTP Protocol on Sent IPN URL #207 from GoTeamScotch
69	+
70	+ Version 1.7.9
71	+
72	+ * Fixed: woocommerce filter and action issues on product edit page
73	+
74	+ Version 1.7.8
75	+
76	+ * Fixed: Vendors can not register #193
77	+ * Fixed: Variation product image upload #194
78	+ * Added: Order actions thanks GoTeamScotch
79	+ * Updated: New item meta in WC 2.4+
80	+ * Updated: WooCommerce Shipment Tracking v1.2.7+
81	+ * Fixed: Paypal Logging thanks to GoTeamScotch
82	+ * Updated: Templates now fully translatable #195
83	+ * Fixed: Translations not loading bug
84	+ * Fixed: vendors not defined error
85	+ * Updated: Base translation files
86	+
87	+ Version 1.7.7
88	+
89	+ * Fixed: Terms and conditions processing #182
90	+ * Added: filter to order note for overrides
91	+ * Added: Order note for marked shipped #187
92	+ * Fixed: order retrieval for wp-admin orders table for vendors
93	+ * Fixed: pagination bug #179
94	+ * Updated: styles for orders table in admin for vendors
95	+ * Fixed: Vendor displaying issue #180
96	+ * Updated: Admin Commission Report Column Names #183
97	+ * Updated: Admin Commissions Page now shows times a product has sold in total #184
98	+
99	+ Version 1.7.6
100	+
101	+ * Added: Stock notifications go to vendors #114
102	+ * Fixed: Instant Pay bug #174
103	+ * Fixed: wcv_vendorslist paging #178
104	+ * Added: Vendor display name now translatable
105	+ * Depreciated: Dashboard vendor reports
106	+ * Added: Chinese Language files thanks to SundayLau
107	+ * Fixed: Added support for WPML #177
108	+ * Update: default pot language file
109	+
110	+ Version 1.7.5
111	+
112	+ * Merged: Check product post type in vendor dashboard thanks simplementNat
113	+ * Updated: Base language file
114	+ * Updated: Compatibility for Shipment Tracking for v1.3.5 #167
115	+ * Fixed: Shipping taxes
116	+ * Fixed: Pending Products for Vendors #168
117	+ * Added: Vendor shipping override #171
118	+ * Added: Give Tax Per Vendor Override #56
119	+ * Added: Hide duplicate product option
120	+ * Fixed: Email firing for pending status only
121	+ * Updated: Unified vendor-main/mini-header variables
122	+ * Fixed: Email template paths to woocommerce paths
123	+ * Merged: Updated Brazilian Portuguese thanks carlosramosweb
124	+ * Added: Seller Info to header #161
125	+ * Updated: Spanish Translations #160
126	+ * Updated: Brazilian Portuguese Language #156
127	+
128	+ Version 1.7.4
129	+
130	+ * Added: Mark shipped filter #157
131	+ * Fixed: Added Tax total to vendor email #146
132	+ * Updated: Location of email templates in theme to wc-vendors/emails
133	+ * Added: User email to Vendor Display Options #158
134	+ * Fixed: Mass Pay Now Bug #159
135	+ * Fixed: Mark as shipped for downloadable product #40
136	+ * Added: Brazilian Portuguese language #156
137	+ * Updated: Default Language file
138	+ * Fixed: Translation issue for query test #155
139	+ * Updated: Template base for emails
140	+ * Fixed: Vendor email and renamed template #135
141	+ * Fixed: Better CSV Output #63
142	+ * Fixed: Made PayPal optional on Vendor Dashboard Shop Settings #144
143	+ * Update: fixed return query var
144	+ * Fixed: Test for product post types #149
145	+ * Fixed: 2.1 Depreciated return call
146	+ * Fixed: PHP Strict static call in commissions class
147	+ * Merged: Is Vendor checks all user roles #147 thanks crabilld
148	+
149	+ Version 1.7.3
150	+
151	+ * Fixed: Paypal AP IPN url issue
152	+
153	+ Version 1.7.2
154	+
155	+ * Added: Filters for seller tab #141
156	+ * Fixed: URI Too Large Error #143
157	+ * Fixed: Give tax to vendors #142
158	+ * Updated: Spanish Translations #140
159	+ * Added: Persian Translation #139
160	+
161	+ Version 1.7.1
162	+
163	+ * Fixed: Invalid argument on new orders dashboard page #138
164	+ * Updated: Base translation file
165	+
166	+ Version 1.7.0
167	+
168	+ * Fixed: add_query_arg/remove_query_arg XSS issue
169	+ * Fixed: Hide Notice not working for admin settings
170	+ * Added: Shop Settings page in WordPress dashboard
171	+ * Added: Orders page in WordPress dashboard
172	+
173	+ Version 1.6.2
174	+
175	+ * Added: Option to change sold by vendor name #106
176	+ * Fixed: Error notice in vendor dashboard #133
177	+ * Fixed: Pagination in commissions admin screen #68
178	+ * Added: Support for WooCommerce Order Status Manager
179	+ * Fixed: Updated media filter method for vendors #132
180	+ * Fixed: Commission not logged for variations #131
181	+
182	+ Version 1.6.1
183	+
184	+ * Fixed: Support for Per Product Shipping 2.2.x #126
185	+ * Added: Filter to change commission label in vendor email #127
186	+
187	+ Version 1.6.0
188	+
189	+ * Added: Admin notices for vendor page slug & permalinks
190	+ * Fixed: Plugin row meta links
191	+ * Added: Upgrade notice
192	+ * Fixed: Rounding issue #120
193	+ * Fixed: Paypal https host check depreciated call
194	+ * Added: show_products attribute #107
195	+ * Updated: Text in denied template to make more sense when registration disabled #123
196	+ * Updated: wcv_vendorslist shortcode now shows 3 column output #123
197	+ * Fixed: Index issue #122
198	+ * Updated: New plugin and template directory structure - IMPORTANT READ KB
199	+
200	+ Version 1.5.0
201	+
202	+ * Added: Spanish translation thanks Mauricio
203	+ * Added: French translation thanks JP
204	+ * Added: CSS class for sold by (classes same as filters in those files)
205	+ * Fixed: Paypal return URL
206	+ * Added: Vendor Dashboard UI Improvements
207	+ * Added: WC Vendors Test Gateway
208	+ * Updated: ToolTips to be more helpful
209	+ * Added: Admin option for not giving shipping cost to vendor
210	+ * Fixed: Disable notify admin
211	+ * Fixed: Mark as shipped/unshipped
212	+ * Fixed: Duplicate column name
213	+
214	+ Version 1.4.5
215	+
216	+ * Updated: select2 3.5.2 for settings api
217	+ * Fixed: Replaced Chosen with Select2 #102
218	+ * Fixed: Table Rate Shipping issue #103
219	+ * Fixed: Featured column issue #100
220	+ * Updated: Filter call for report
221	+ * Fixed: Call to depreciated function #98
222	+
223	+ Version 1.4.4
224	+
225	+ * Fixed: Hardcoded table in wcv_vendorslist shortcode
226	+
227	+ Version 1.4.3
228	+
229	+ * Fixed: Placeholder on Product Reports
230	+
231	+ Version 1.4.2
232	+
233	+ * Added: Commission status sort to commissions page
234	+ * Fixed: Recent Commissions limit of 20 now works on selected date range
235	+ * Fixed: Report By product in WC2.3
236	+ * Fixed: Vendor Report date selector in wp-admin
237	+ * Fixed: Tracking plugin Order Meta
238	+ * Added: New filter wcvendors_dashboard_google_maps_link
239	+ * Fixed: Formatting error for Google maps link
240	+ * Added: New actions in vendor-dashboard wcvendors_vendor_unship, wcvendors_vendor_ship (thanks Nathan H)
241	+
242	+ Version 1.4.1
243	+
244	+ * Fixed: Language file loading issue
245	+ * Fixed: Static function calls in commision class for php 5.6
246	+ * Fixed: Static call in Vendor Cart
247	+ * Added: New language files for de_AT, de_DE (thanks to theHubi), it_IT (thanks to Nicole)
248	+ * Added: New actions for main and mini headers (before and after see KB)
249	+
250	+ Version 1.4.0
251	+
252	+ * Added: product category + vendor shortcode [wcv_product_category category="category" vendor="vendorname"]
253	+ * Added: Tracking number support via WooThemes Shipment Tracking plugin
254	+ * Added: Google Maps for delivery address on front end
255	+ * Fixed: woocommerce_wp_text_input via merged pull request from svenl77
256	+ * Added: Vendor List shortcode [wcv_vendorlist] + template for styling see KB for full details
257	+ * Fixed: Report not showing Commission by Product
258	+ * Fixed: Paths in language files
259	+
260	+ Version 1.3.1
261	+
262	+ * Fixed: Sold by in invoices
263	+
264	+ Version 1.3.0
265	+
266	+ * Added: show vendor on all emails #29
267	+ * Fixed: Critical issue #58
268	+ * Added: Vendor header templates #65
269	+ * Added: Vendor to QuickEdit #12
270	+ * Fixed: Updating notices to use 2.1 Notice API #62
271	+ * Added: wcvendors_registration_checkbox filter to denied.php template view
272	+ * Added: wcvendors_vendor_registration_checkbox filter to filter "Apply to become a vendor?" at registration.
273	+ * Added: wcvendors_vendor_registration_checkbox to filter "Apply to become a vendor?"
274	+
275	+ Version 1.2.0
276	+
277	+ * Added new filters to change sold by text see Knowledge base for details
278	+ * Added sold by to product loop for archive-product.php, see knowledge base on how to disable or change this
279	+ * Added new option to hide "Featured product" from vendors
280	+ * Added Sold By Filter as per #3
281	+ * Removing unused tag filter
282	+ * Updated default.pot
283	+ * Fixing attribute bug #48 - Thanks to gcskye
284	+ * Removing legacy translations
285	+ * Fixed Orders view errors
286	+ * Fixing call to incorrect method #45
287	+
288	+ Version 1.1.5
289	+
290	+ * Fixed orders view to remove incorrect call to woocommerce print messages
291	+
292	+ Version 1.1.4
293	+
294	+ * Fixed called to incorrect notice method
295	+ * Moved methods into parent class See #41
296	+ * PHP Strict updates
297	+ * Deprecated Class due to PHP strict issues
298	+ * fixing static call
299	+ * Tidying up and comments.
300	+ * Renaming class to new standard
301	+ * Removing deprecated wc methods.
302	+ * Fixing incorrect method call
303	+ * Problem with undefined variable.
304	+ * fixing static call issues
305	+ * fixing static call problems
306	+ * Fixing more strict issues
307	+ * fixing encoding issue
308	+ * Fixing tax rounding issue #37
309	+ * Fixing deprecated calls #42
310	+ * Fixing strict standards
311	+ * Fixing constant reference #36
312	+ * Fixed reference to old plugin name
313	+ * Fixing strict errors #27
314	+ * New Default POT translations #26
315	+ * Fixing translation strings #26
316	+ * Updated description
317	+ * Fix link to paypal adaptive payments #25
318	+ * Fixing issue #22
319	+ * Remove support for woo commerce 2.1 and below
320	+ * Class rename
321	+ * Fixed incorrect table name see #35
322	+ * Fixed Class description
323	+ * Added label on vendor email shipping line see #22
324	+ * Fix issue #23 Notify vendor email problem
325	+ * Fixing Issue #28 & removing WC2.0 support
326	+ * Strict Standards in WCV_Vendors #32
327	+ * Fixing Issue #31 PHP Strict Issues
328	+ * Fixing Issue #30 PHP Strict Standards
329	+ * Change Log added for release changes
330	+ * WC Version Requirement changed
331	+ * Updating author to include wc after modifications
332	+ * Rename class
333	+ * Fixing up link to documentation
334	+ * Updated Readme
335	+
336	+ Version 1.1.3
337	+
338	+ * Fixing table names for compatibility
339	+ * Rename class
340	+ * Fixing Fatal error #18
341	+ * Fatal error fixed, version bump
342	+ * Fixing Class call
343	+ * Fixing all references to incorrect class name
344	+ * Commission and report fixes
345	+ * Fixing spelling
346	+ * Update readme.txt
347	+ * Fixing author
348	+ * Version bump
349	+ * Check if shipping is enabled
350	+ * Comment for future reference
351	+
352	+ Version 1.1.1
353	+
354	+ * Start of adding woocomerce short codes enhanced
355	+ * Shortcodes class
356	+ * Removing temp file
357	+ * Adding short code support
358	+ * Version Bump
359	+ * PHP Strict Issue #5
360	+ * Fatal Error: Class 'PV_Commission' #14
361	+ * Fixing references to PV_Vendors
362	+ * Renamed filters and actions
363	+ * Rename Reports Submenu #15
364	+ * "Mark Shipped" Icon #16
365	+ * Version increased after bug fixes
366	+
367	+ Version 1.0.2
368	+
369	+ * Fix up admin settings notices
370	+ * Renamed shortcodes
371	+ * Version bump for short code rename
372	+
373	+
374	+ Version 1.0.1
375	+
376	+ * Initial Commit
377	+ * First commit - no modifications to existing plugin
378	+ * Updating README
379	+ * Update README.md
380	+ * Features added
381	+ * Updated Details of plugin
382	+ * Fixing up formatting
383	+ * More fixes.
384	+ * Updating readme
385	+ * Updating more details
386	+ * Update denied.php
387	+ * Added mac file ignore
388	+ * updated read me
389	+ * Plugin Rename
390	+ * Plugin rename
391	+ * Rename plugin
392	+ * Rename plugin
393	+ * more updates
394	+ * Plugin Updater removed
395	+ * Updating text domain
396	+ * Basic rename complete
397	+ * Replacement includes classes
398	+ * text domain updates
399	+ * text domain updates
400	+ * new change log for new fork
401	+ * Rename main class
402	+ * renaming constants
403	+ * updated constants
404	+ * plugin constant
405	+ * Renaming queries class
406	+ * constants updated
407	+ * rename vendor shop class
408	+ * rename vendor cart class
409	+ * Renaming classes
410	+ * Author updates
411	+ * Class renaming
412	+ * Version bump

trunk/class-wc-vendors.php ADDED Viewed

	@@ -0,0 +1,373 @@


1	+ <?php
2	+
3	+ /**
4	+ * Plugin Name: WC Vendors
5	+ * Plugin URI: https://www.wcvendors.com
6	+ * Description: Allow vendors to sell their own products and receive a commission for each sale.
7	+ * Author: WC Vendors
8	+ * Author URI: https://www.wcvendors.com
9	+ *
10	+ * Version: 1.8.7
11	+ * Requires at least: 4.0.0
12	+ * Tested up to: 4.4.1
13	+ *
14	+ * Text Domain: wcvendors
15	+ * Domain Path: /languages/
16	+ *
17	+ * @category Plugin
18	+ * @copyright Copyright © 2012 Matt Gates
19	+ * @copyright Copyright © 2016 WC Vendors
20	+ * @author Matt Gates, WC Vendors
21	+ * @package WCVendors
22	+ */
23	+
24	+
25	+ /**
26	+ * Plugin activation hook
27	+ */
28	+ function wcvendors_activate() {
29	+
30	+ /**
31	+ * Requires woocommerce to be installed and active
32	+ */
33	+ if ( !class_exists( 'WooCommerce' ) ) {
34	+ deactivate_plugins( plugin_basename( __FILE__ ) );
35	+ wp_die( __( 'WC Vendors requires WooCommerce to run. Please install WooCommerce and activate before attempting to activate again.', 'wcvendors' ) );
36	+ }
37	+ } // wcvendors_activate()
38	+
39	+ register_activation_hook( __FILE__, 'wcvendors_activate' );
40	+
41	+
42	+ /**
43	+ * Required functions
44	+ */
45	+ require_once trailingslashit( dirname( __FILE__ ) ) . 'classes/includes/class-functions.php';
46	+
47	+ /**
48	+ * Check if WooCommerce is active
49	+ */
50	+ if ( wcv_is_woocommerce_activated() ) {
51	+
52	+ /* Define an absolute path to our plugin directory. */
53	+ if ( !defined( 'wcv_plugin_dir' ) ) define( 'wcv_plugin_dir', trailingslashit( dirname( __FILE__ ) ) . '/' );
54	+ if ( !defined( 'wcv_assets_url' ) ) define( 'wcv_assets_url', trailingslashit( plugins_url( 'assets', __FILE__ ) ) );
55	+ if ( !defined( 'wcv_plugin_base' ) ) define( 'wcv_plugin_base', plugin_basename( __FILE__ ) );
56	+ if ( !defined( 'wcv_plugin_dir_path' ) ) define( 'wcv_plugin_dir_path', untrailingslashit( plugin_dir_path( __FILE__ ) ) );
57	+
58	+ /**
59	+ * Main Product Vendor class
60	+ *
61	+ * @package WCVendors
62	+ */
63	+ class WC_Vendors
64	+ {
65	+
66	+ /**
67	+ * @var
68	+ */
69	+ public static $pv_options;
70	+ public static $id = 'wc_prd_vendor';
71	+
72	+ /**
73	+ * Constructor.
74	+ */
75	+ public function __construct()
76	+ {
77	+
78	+ // Load text domain
79	+ add_action( 'plugins_loaded', array( $this, 'load_il8n' ) );
80	+
81	+ $this->title = __( 'WC Vendors', 'wcvendors' );
82	+
83	+ // Install & upgrade
84	+ add_action( 'admin_init', array( $this, 'check_install' ) );
85	+ add_action( 'admin_init', array( $this, 'maybe_flush_permalinks' ), 99 );
86	+ add_action( 'admin_init', array( $this, 'wcv_required_ignore_notices' ) );
87	+ add_action( 'admin_notices', array( $this, 'wcv_required_admin_notice') );
88	+
89	+
90	+ add_action( 'plugins_loaded', array( $this, 'load_settings' ) );
91	+ add_action( 'plugins_loaded', array( $this, 'include_gateways' ) );
92	+ add_action( 'plugins_loaded', array( $this, 'include_core' ) );
93	+ add_action( 'current_screen', array( $this, 'include_assets' ) );
94	+
95	+ add_filter( 'plugin_row_meta', array($this, 'plugin_row_meta'), 10, 2 );
96	+ add_action( self::$id . '_options_updated', array( $this, 'option_updates' ), 10, 2 );
97	+
98	+ // Start a PHP session, if not yet started
99	+ /* this line will initialize session to early and for each page
100	+ if ( !session_id() ) session_start();*/
101	+ }
102	+
103	+
104	+ /**
105	+ *
106	+ */
107	+ public function invalid_wc_version()
108	+ {
109	+ echo '<div class="error"><p>' . __( '<b>WC Vendors is disabled</b>. WC Vendors requires a minimum of WooCommerce v2.4.0.', 'wcvendors' ) . '</p></div>';
110	+ }
111	+
112	+
113	+ /**
114	+ * Check whether install has ran before or not
115	+ *
116	+ * Run install if it hasn't.
117	+ *
118	+ * @return unknown
119	+ */
120	+ public function check_install()
121	+ {
122	+ global $woocommerce;
123	+
124	+ // WC 2.0.1 is required
125	+ if ( version_compare( $woocommerce->version, '2.4', '<' ) ) {
126	+ add_action( 'admin_notices', array( $this, 'invalid_wc_version' ) );
127	+ deactivate_plugins( plugin_basename( __FILE__ ) );
128	+ return false;
129	+ }
130	+
131	+ require_once wcv_plugin_dir . 'classes/class-install.php';
132	+
133	+ $this->load_settings();
134	+ $install = new WCV_Install;
135	+ $install->init();
136	+ }
137	+
138	+
139	+ /**
140	+ * Set static $pv_options to hold options class
141	+ */
142	+ public function load_settings()
143	+ {
144	+ if ( empty( self::$pv_options ) ) {
145	+ require_once wcv_plugin_dir . 'classes/admin/settings/classes/sf-class-settings.php';
146	+ self::$pv_options = new SF_Settings_API( self::$id, $this->title, 'woocommerce', __FILE__ );
147	+ self::$pv_options->load_options( wcv_plugin_dir . 'classes/admin/settings/sf-options.php' );
148	+ }
149	+ }
150	+
151	+ public function load_il8n() {
152	+
153	+ $domain = 'wcvendors';
154	+
155	+ $locale = apply_filters( 'plugin_locale', get_locale(), $domain );
156	+
157	+ //Place your custom translations into wp-content/languages/wc-vendors to be upgrade safe
158	+ load_textdomain($domain, WP_LANG_DIR.'/wc-vendors/'.$domain.'-'.$locale.'.mo');
159	+
160	+ load_plugin_textdomain( 'wcvendors', false, dirname( plugin_basename( __FILE__ ) ) . '/languages/' );
161	+
162	+ }
163	+
164	+
165	+ /**
166	+ * Include core files
167	+ */
168	+ public function include_core()
169	+ {
170	+ require_once wcv_plugin_dir . 'classes/class-queries.php';
171	+ require_once wcv_plugin_dir . 'classes/class-vendors.php';
172	+ require_once wcv_plugin_dir . 'classes/class-cron.php';
173	+ require_once wcv_plugin_dir . 'classes/class-commission.php';
174	+ require_once wcv_plugin_dir . 'classes/class-shipping.php';
175	+ require_once wcv_plugin_dir . 'classes/front/class-vendor-cart.php';
176	+ require_once wcv_plugin_dir . 'classes/front/dashboard/class-vendor-dashboard.php';
177	+ require_once wcv_plugin_dir . 'classes/front/class-vendor-shop.php';
178	+ require_once wcv_plugin_dir . 'classes/front/signup/class-vendor-signup.php';
179	+ require_once wcv_plugin_dir . 'classes/front/orders/class-orders.php';
180	+ require_once wcv_plugin_dir . 'classes/admin/emails/class-emails.php';
181	+ require_once wcv_plugin_dir . 'classes/admin/class-product-meta.php';
182	+ require_once wcv_plugin_dir . 'classes/admin/class-vendor-applicants.php';
183	+ require_once wcv_plugin_dir . 'classes/admin/class-vendor-reports.php';
184	+ require_once wcv_plugin_dir . 'classes/admin/class-admin-reports.php';
185	+ require_once wcv_plugin_dir . 'classes/admin/class-admin-users.php';
186	+ require_once wcv_plugin_dir . 'classes/admin/class-admin-page.php';
187	+ require_once wcv_plugin_dir . 'classes/admin/class-vendor-admin-dashboard.php';
188	+ require_once wcv_plugin_dir . 'classes/includes/class-wcv-shortcodes.php';
189	+
190	+
191	+ if ( !function_exists( 'woocommerce_wp_text_input' ) && !is_admin() ) {
192	+ include_once(WC()->plugin_path() . '/includes/admin/wc-meta-box-functions.php');
193	+ }
194	+
195	+ new WCV_Vendor_Shop;
196	+ new WCV_Vendor_Cart;
197	+ new WCV_Commission;
198	+ new WCV_Shipping;
199	+ new WCV_Cron;
200	+ new WCV_Orders;
201	+ new WCV_Vendor_Dashboard;
202	+ new WCV_Product_Meta;
203	+ new WCV_Vendor_Reports;
204	+ new WCV_Admin_Setup;
205	+ new WCV_Vendor_Admin_Dashboard;
206	+ new WCV_Admin_Reports;
207	+ new WCV_Vendor_Applicants;
208	+ new WCV_Admin_Users;
209	+ new WCV_Emails;
210	+ new WCV_Vendor_Signup;
211	+ new WCV_Shortcodes;
212	+ }
213	+
214	+ /**
215	+ * Load plugin assets
216	+ */
217	+ public function include_assets(){
218	+
219	+ $screen = get_current_screen();
220	+
221	+ if ( in_array( $screen->id, array( 'edit-product' ) ) ) {
222	+ wp_enqueue_script( 'wcv_quick-edit', wcv_assets_url. 'js/wcv-admin-quick-edit.js', array('jquery') );
223	+ }
224	+
225	+ }
226	+
227	+
228	+ /**
229	+ * Include payment gateways
230	+ */
231	+ public function include_gateways()
232	+ {
233	+ require_once wcv_plugin_dir . 'classes/gateways/PayPal_AdvPayments/paypal_ap.php';
234	+ require_once wcv_plugin_dir . 'classes/gateways/PayPal_Masspay/class-paypal-masspay.php';
235	+ require_once wcv_plugin_dir . 'classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php';
236	+ }
237	+
238	+
239	+ /**
240	+ * Do an action when options are updated
241	+ *
242	+ * @param array $options
243	+ * @param unknown $tabname
244	+ */
245	+ public function option_updates( $options, $tabname )
246	+ {
247	+ // Change the vendor role capabilities
248	+ if ( $tabname == sanitize_title(__( 'Capabilities', 'wcvendors' )) ) {
249	+ $can_add = $options[ 'can_submit_products' ];
250	+ $can_edit = $options[ 'can_edit_published_products' ];
251	+ $can_submit_live = $options[ 'can_submit_live_products' ];
252	+ $can_view_reports = $options[ 'can_view_backend_reports' ];
253	+
254	+ $args = array(
255	+ 'assign_product_terms' => $can_add,
256	+ 'edit_products' => $can_add \|\| $can_edit,
257	+ 'edit_published_products' => $can_edit,
258	+ 'delete_published_products' => $can_edit,
259	+ 'delete_products' => $can_edit,
260	+ 'manage_product' => $can_add,
261	+ 'publish_products' => $can_submit_live,
262	+ 'read' => true,
263	+ 'read_products' => $can_edit \|\| $can_add,
264	+ 'upload_files' => true,
265	+ 'import' => true,
266	+ 'view_woocommerce_reports' => false,
267	+ );
268	+
269	+ remove_role( 'vendor' );
270	+
271	+ add_role( 'vendor', __('Vendor', 'wcvendors'), $args );
272	+ } // Update permalinks
273	+ else if ( $tabname == sanitize_title(__( 'General', 'wcvendors' ) )) {
274	+ $old_permalink = WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' );
275	+ $new_permalink = $options[ 'vendor_shop_permalink' ];
276	+
277	+ if ( $old_permalink != $new_permalink ) {
278	+ update_option( WC_Vendors::$id . '_flush_rules', true );
279	+ }
280	+ }
281	+
282	+ do_action( 'wcvendors_option_updates', $options, $tabname );
283	+
284	+ }
285	+
286	+
287	+ /**
288	+ * If the settings are updated and the vendor page link has changed update permalinks
289	+ * @access public
290	+ *
291	+ */
292	+ public function maybe_flush_permalinks()
293	+ {
294	+ if ( get_option( WC_Vendors::$id . '_flush_rules' ) ) {
295	+ flush_rewrite_rules();
296	+ update_option( WC_Vendors::$id . '_flush_rules', false );
297	+ }
298	+ }
299	+
300	+ /**
301	+ * Add links to plugin page to our external help site.
302	+ * @param $links - links array from action
303	+ * @param $file - file reference for this plugin
304	+ * @access public
305	+ *
306	+ */
307	+ public static function plugin_row_meta( $links, $file ) {
308	+ if ( $file == wcv_plugin_base ) {
309	+
310	+ $row_meta = array(
311	+ 'docs' => '<a href="http://www.wcvendors.com/kb/" target="_blank">'.__( 'Documentation/KB', 'wcvendors' ).'</a>',
312	+ 'help' => '<a href="http://www.wcvendors.com/help/" target="_blank">'.__( 'Help Forums', 'wcvendors').'</a>',
313	+ 'support' => '<a href="http://www.wcvendors.com/contact-us/" target="_blank">'.__( 'Paid Support', 'wcvendors' ).'</a>'
314	+ );
315	+
316	+ return array_merge( $links, $row_meta );
317	+ }
318	+
319	+ return (array) $links;
320	+ }
321	+
322	+ /**
323	+ * Add admin notices to ensure users are saving the settings correctly
324	+ * @access public
325	+ *
326	+ */
327	+ public function wcv_required_admin_notice(){
328	+ global $current_user;
329	+
330	+ if ( current_user_can( 'manage_options' ) ) {
331	+ $current_user_id = $current_user->ID;
332	+
333	+ if ( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) == null && ! get_user_meta( $current_user_id, 'wcv_shop_ignore_notice' ) ) {
334	+ echo '<div class="updated">
335	+ <p>'.sprintf (__('WC Vendors requires the Vendor shop page value be set <a href="%s">click here to set it.</a> \| <a href="%s">Hide Notice</a>','wcvendors'), 'admin.php?page=wc_prd_vendor', esc_url( add_query_arg( 'wcv_shop_ignore_notice', '0' ) ) ).'</p>
336	+ </div>';
337	+ }
338	+
339	+ $general_tab = ( isset( $_GET['tab'] ) && 'general' == $_GET['tab'] ) \|\| !isset( $_GET['tab'] ) ? true : false;
340	+
341	+ if ( isset( $_GET['page'] ) && 'wc_prd_vendor' == $_GET['page'] && isset( $_GET[ 'settings-updated' ] ) && $general_tab == true && ! get_user_meta( $current_user_id, 'wcv_pl_ignore_notice' ) ) {
342	+ echo '<div class="updated">
343	+ <p>'.sprintf (__('You must save your permalinks once you have modified your vendor page. <a href="%s">click here to save</a>. \| <a href="%s">Hide Notice</a>','wcvendors'), 'options-permalink.php', esc_url( add_query_arg( 'wcv_pl_ignore_notice', '0' ) ) ).'</p>
344	+ </div>';
345	+ }
346	+ }
347	+ }
348	+
349	+ /**
350	+ * Add user meta to remember ignore notices
351	+ * @access public
352	+ *
353	+ */
354	+ public function wcv_required_ignore_notices(){
355	+ global $current_user;
356	+ $current_user_id = $current_user->ID;
357	+
358	+ /* If user clicks to ignore the notice, add that to their user meta */
359	+ if ( isset( $_GET[ 'wcv_shop_ignore_notice' ] ) && '0' == $_GET[ 'wcv_shop_ignore_notice' ] ) {
360	+ add_user_meta( $current_user_id, 'wcv_shop_ignore_notice', 'true', true);
361	+ }
362	+ if ( isset($_GET['wcv_pl_ignore_notice']) && '0' == $_GET['wcv_pl_ignore_notice'] ) {
363	+ add_user_meta( $current_user_id, 'wcv_pl_ignore_notice', 'true' , true);
364	+ }
365	+ }
366	+
367	+
368	+ }
369	+
370	+
371	+ new WC_Vendors;
372	+
373	+ }

trunk/classes/admin/class-admin-page.php ADDED Viewed

	@@ -0,0 +1,597 @@


1	+ <?php
2	+
3	+ class WCV_Admin_Setup
4	+ {
5	+ /**
6	+ * WC > Referrals menu
7	+ */
8	+
9	+ public function __construct()
10	+ {
11	+ add_filter( 'set-screen-option', array( 'WCV_Admin_Setup', 'set_table_option' ), 10, 3 );
12	+ add_action( 'admin_menu', array( 'WCV_Admin_Setup', 'menu' ) );
13	+
14	+ add_action( 'woocommerce_admin_order_data_after_shipping_address', array( $this, 'add_vendor_details' ), 10, 2 );
15	+ add_action( 'woocommerce_admin_order_actions_end', array( $this, 'append_actions' ), 10, 1 );
16	+ }
17	+
18	+
19	+ public function add_vendor_details( $order )
20	+ {
21	+ $actions = $this->append_actions( $order, true );
22	+
23	+ if (empty( $actions['wc_pv_shipped']['name'] )) {
24	+ return;
25	+ }
26	+
27	+ echo '<h4>' . __('Vendors shipped', 'wcvendors') . '</h4><br/>';
28	+ echo $actions['wc_pv_shipped']['name'];
29	+ }
30	+
31	+ public function append_actions( $order, $order_page = false )
32	+ {
33	+ global $woocommerce;
34	+
35	+ $authors = WCV_Vendors::get_vendors_from_order( $order );
36	+ $authors = $authors ? array_keys( $authors ) : array();
37	+ if ( empty( $authors ) ) return false;
38	+
39	+ $shipped = (array) get_post_meta( $order->id, 'wc_pv_shipped', true );
40	+ $string = '</br></br>';
41	+
42	+ foreach ($authors as $author ) {
43	+ $string .= in_array( $author, $shipped ) ? '✔ ' : '✕ ';
44	+ $string .= WCV_Vendors::get_vendor_shop_name( $author );
45	+ $string .= '</br>';
46	+ }
47	+
48	+ $response = array(
49	+ 'url' => '#',
50	+ 'name' => __('Vendors Shipped', 'wcvendors') . $string,
51	+ 'action' => 'wc_pv_shipped',
52	+ 'image_url' => wcv_assets_url . '/images/icons/truck.png',
53	+ );
54	+
55	+ if ( ! $order_page ) {
56	+ printf( '<a class="button tips %s" href="%s" data-tip="%s"><img style="width:16px;height:16px;" src="%s"></a>', $response['action'], $response['url'], $response['name'], $response['image_url'] );
57	+ } else {
58	+ echo $response['name'];
59	+ }
60	+
61	+ return $response;
62	+ }
63	+
64	+
65	+ /**
66	+ *
67	+ */
68	+ public static function menu()
69	+ {
70	+ $hook = add_submenu_page(
71	+ 'woocommerce',
72	+ __( 'Commission', 'wcvendors' ), __( 'Commission', 'wcvendors' ),
73	+ 'manage_woocommerce',
74	+ 'pv_admin_commissions',
75	+ array( 'WCV_Admin_Setup', 'commissions_page' )
76	+ );
77	+
78	+ add_action( "load-$hook", array( 'WCV_Admin_Setup', 'add_options' ) );
79	+ }
80	+
81	+
82	+ /**
83	+ *
84	+ *
85	+ * @param unknown $status
86	+ * @param unknown $option
87	+ * @param unknown $value
88	+ *
89	+ * @return unknown
90	+ */
91	+ public static function set_table_option( $status, $option, $value )
92	+ {
93	+ if ( $option == 'commission_per_page' ) {
94	+ return $value;
95	+ }
96	+ }
97	+
98	+
99	+ /**
100	+ *
101	+ */
102	+ public static function add_options()
103	+ {
104	+ global $PV_Admin_Page;
105	+
106	+ $args = array(
107	+ 'label' => 'Rows',
108	+ 'default' => 10,
109	+ 'option' => 'commission_per_page'
110	+ );
111	+ add_screen_option( 'per_page', $args );
112	+
113	+ $PV_Admin_Page = new WCV_Admin_Page();
114	+
115	+ }
116	+
117	+
118	+ /**
119	+ * HTML setup for the WC > Commission page
120	+ */
121	+ public static function commissions_page()
122	+ {
123	+ global $woocommerce, $PV_Admin_Page;
124	+
125	+ $PV_Admin_Page->prepare_items();
126	+
127	+ ?>
128	+
129	+ <div class="wrap">
130	+
131	+ <div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
132	+ <h2><?php _e( 'Commission', 'wcvendors' ); ?></h2>
133	+
134	+ <form id="posts-filter" method="get">
135	+
136	+ <input type="hidden" name="page" value="pv_admin_commissions"/>
137	+ <?php $PV_Admin_Page->display() ?>
138	+
139	+ </form>
140	+ <div id="ajax-response"></div>
141	+ <br class="clear"/>
142	+ </div>
143	+ <?php
144	+ }
145	+
146	+
147	+ }
148	+
149	+
150	+ if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
151	+
152	+ /**
153	+ * WC_Simple_Referral_Admin class.
154	+ *
155	+ * @extends WP_List_Table
156	+ */
157	+ class WCV_Admin_Page extends WP_List_Table
158	+ {
159	+
160	+ public $index;
161	+
162	+
163	+ /**
164	+ * __construct function.
165	+ *
166	+ * @access public
167	+ */
168	+ function __construct()
169	+ {
170	+ global $status, $page;
171	+
172	+ $this->index = 0;
173	+
174	+ //Set parent defaults
175	+ parent::__construct( array(
176	+ 'singular' => 'commission',
177	+ 'plural' => 'commissions',
178	+ 'ajax' => false
179	+ ) );
180	+ }
181	+
182	+
183	+ /**
184	+ * column_default function.
185	+ *
186	+ * @access public
187	+ *
188	+ * @param unknown $item
189	+ * @param mixed $column_name
190	+ *
191	+ * @return unknown
192	+ */
193	+ function column_default( $item, $column_name )
194	+ {
195	+ global $wpdb;
196	+
197	+ switch ( $column_name ) {
198	+ case 'id' :
199	+ return $item->id;
200	+ case 'vendor_id' :
201	+ $user = get_userdata( $item->vendor_id );
202	+ return '<a href="' . admin_url( 'user-edit.php?user_id=' . $item->vendor_id ) . '">' . WCV_Vendors::get_vendor_shop_name( $item->vendor_id ) . '</a>';
203	+ case 'total_due' :
204	+ return woocommerce_price( $item->total_due + $item->total_shipping + $item->tax );
205	+ case 'product_id' :
206	+ $parent = get_post_ancestors( $item->product_id );
207	+ $product_id = $parent ? $parent[ 0 ] : $item->product_id;
208	+ $wcv_total_sales = get_post_meta( $product_id, 'total_sales', true );
209	+ return '<a href="' . admin_url( 'post.php?post=' . $product_id . '&action=edit' ) . '">' . get_the_title( $item->product_id ) . '</a> (<span title="' . get_the_title( $item->product_id ) .' has sold ' . $wcv_total_sales . ' times total.">' . $wcv_total_sales . '</span>)';
210	+ case 'order_id' :
211	+ return '<a href="' . admin_url( 'post.php?post=' . $item->order_id . '&action=edit' ) . '">' . $item->order_id . '</a>';
212	+ case 'status' :
213	+ return $item->status;
214	+ case 'time' :
215	+ return date_i18n( get_option( 'date_format' ), strtotime( $item->time ) );
216	+ }
217	+ }
218	+
219	+
220	+ /**
221	+ * column_cb function.
222	+ *
223	+ * @access public
224	+ *
225	+ * @param mixed $item
226	+ *
227	+ * @return unknown
228	+ */
229	+ function column_cb( $item )
230	+ {
231	+ return sprintf(
232	+ '<input type="checkbox" name="%1$s[]" value="%2$s" />',
233	+ /$1%s/
234	+ 'id',
235	+ /$2%s/
236	+ $item->id
237	+ );
238	+ }
239	+
240	+
241	+ /**
242	+ * get_columns function.
243	+ *
244	+ * @access public
245	+ * @return unknown
246	+ */
247	+ function get_columns()
248	+ {
249	+ $columns = array(
250	+ 'cb' => '<input type="checkbox" />',
251	+ 'product_id' => __( 'Product', 'wcvendors' ),
252	+ 'order_id' => __( 'Order ID', 'wcvendors' ),
253	+ 'vendor_id' => __( 'Vendor', 'wcvendors' ),
254	+ 'total_due' => __( 'Total', 'wcvendors' ),
255	+ 'status' => __( 'Status', 'wcvendors' ),
256	+ 'time' => __( 'Date', 'wcvendors' ),
257	+ );
258	+
259	+ return $columns;
260	+ }
261	+
262	+
263	+ /**
264	+ * get_sortable_columns function.
265	+ *
266	+ * @access public
267	+ * @return unknown
268	+ */
269	+ function get_sortable_columns()
270	+ {
271	+ $sortable_columns = array(
272	+ 'time' => array( 'time', true ),
273	+ 'product_id' => array( 'product_id', false ),
274	+ 'order_id' => array( 'order_id', false ),
275	+ 'total_due' => array( 'total_due', false ),
276	+ 'status' => array( 'status', false ),
277	+ 'vendor_id' => array( 'vendor_id', false ),
278	+ 'status' => array( 'status', false ),
279	+ );
280	+
281	+ return $sortable_columns;
282	+ }
283	+
284	+
285	+ /**
286	+ * Get bulk actions
287	+ *
288	+ * @return unknown
289	+ */
290	+ function get_bulk_actions()
291	+ {
292	+ $actions = array(
293	+ 'mark_paid' => __( 'Mark paid', 'wcvendors' ),
294	+ 'mark_due' => __( 'Mark due', 'wcvendors' ),
295	+ 'mark_reversed' => __( 'Mark reversed', 'wcvendors' ),
296	+ // 'delete' => __('Delete', 'wcvendors'),
297	+ );
298	+
299	+ return $actions;
300	+ }
301	+
302	+
303	+ /**
304	+ *
305	+ */
306	+ function extra_tablenav( $which )
307	+ {
308	+ if ( $which == 'top' ) {
309	+ ?>
310	+ <div class="alignleft actions"><?php
311	+ $this->months_dropdown( 'commission' );
312	+ submit_button( __( 'Filter' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
313	+ ?></div>
314	+ <div class="alignleft actions"><?php
315	+ $this->status_dropdown( 'commission' );
316	+ submit_button( __( 'Filter' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
317	+ ?></div>
318	+ <?php
319	+ }
320	+ }
321	+
322	+
323	+ /**
324	+ * Display a monthly dropdown for filtering items
325	+ *
326	+ * @since 3.1.0
327	+ * @access protected
328	+ *
329	+ * @param unknown $post_type
330	+ */
331	+ function months_dropdown( $post_type )
332	+ {
333	+ global $wpdb, $wp_locale;
334	+
335	+ $table_name = $wpdb->prefix . "pv_commission";
336	+
337	+ $months = $wpdb->get_results( "
338	+ SELECT DISTINCT YEAR( time ) AS year, MONTH( time ) AS month
339	+ FROM $table_name
340	+ ORDER BY time DESC
341	+ " );
342	+
343	+ $month_count = count( $months );
344	+
345	+ if ( !$month_count \|\| ( 1 == $month_count && 0 == $months[ 0 ]->month ) )
346	+ return;
347	+
348	+ $m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
349	+ ?>
350	+ <select name="m" id="filter-by-date">
351	+ <option<?php selected( $m, 0 ); ?> value='0'><?php _e( 'Show all dates' ); ?></option>
352	+ <?php
353	+ foreach ( $months as $arc_row ) {
354	+ if ( 0 == $arc_row->year )
355	+ continue;
356	+
357	+ $month = zeroise( $arc_row->month, 2 );
358	+ $year = $arc_row->year;
359	+
360	+ printf( "<option %s value='%s'>%s</option>\n",
361	+ selected( $m, $year . $month, false ),
362	+ esc_attr( $arc_row->year . $month ),
363	+ /* translators: 1: month name, 2: 4-digit year */
364	+ sprintf( __( '%1$s %2$d' ), $wp_locale->get_month( $month ), $year )
365	+ );
366	+ }
367	+ ?>
368	+ </select>
369	+
370	+ <?php
371	+ }
372	+
373	+ /**
374	+ * Display a status dropdown for filtering items
375	+ *
376	+ * @since 3.1.0
377	+ * @access protected
378	+ *
379	+ * @param unknown $post_type
380	+ */
381	+ function status_dropdown( $post_type )
382	+ {
383	+ $com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
384	+ ?>
385	+ <select name="com_status">
386	+ <option<?php selected( $com_status, '' ); ?> value=''><?php _e( 'Show all Statuses', 'wcvendors' ); ?></option>
387	+ <option<?php selected( $com_status, 'due' ); ?> value="due">Due</option>
388	+ <option<?php selected( $com_status, 'paid' ); ?> value="paid">Paid</option>
389	+ <option<?php selected( $com_status, 'reversed' ); ?> value="reversed">Reversed</option>
390	+ </select>
391	+ <?php
392	+ }
393	+
394	+
395	+ /**
396	+ * Process bulk actions
397	+ *
398	+ * @return unknown
399	+ */
400	+ function process_bulk_action()
401	+ {
402	+ if ( !isset( $_GET[ 'id' ] ) ) return;
403	+
404	+ $items = array_map( 'intval', $_GET[ 'id' ] );
405	+ $ids = implode( ',', $items );
406	+
407	+ switch ( $this->current_action() ) {
408	+ case 'mark_paid':
409	+ $result = $this->mark_paid( $ids );
410	+
411	+ if ( $result )
412	+ echo '<div class="updated"><p>' . __( 'Commission marked paid.', 'wcvendors' ) . '</p></div>';
413	+ break;
414	+
415	+ case 'mark_due':
416	+ $result = $this->mark_due( $ids );
417	+
418	+ if ( $result )
419	+ echo '<div class="updated"><p>' . __( 'Commission marked due.', 'wcvendors' ) . '</p></div>';
420	+ break;
421	+
422	+ case 'mark_reversed':
423	+ $result = $this->mark_reversed( $ids );
424	+
425	+ if ( $result )
426	+ echo '<div class="updated"><p>' . __( 'Commission marked reversed.', 'wcvendors' ) . '</p></div>';
427	+ break;
428	+
429	+ default:
430	+ // code...
431	+ break;
432	+ }
433	+
434	+ }
435	+
436	+
437	+ /**
438	+ *
439	+ *
440	+ * @param unknown $ids (optional)
441	+ *
442	+ * @return unknown
443	+ */
444	+ public function mark_paid( $ids = array() )
445	+ {
446	+ global $wpdb;
447	+
448	+ $table_name = $wpdb->prefix . "pv_commission";
449	+
450	+ $query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE id IN ($ids) AND `status` = 'due'";
451	+ $result = $wpdb->query( $query );
452	+
453	+ return $result;
454	+ }
455	+
456	+
457	+ /**
458	+ *
459	+ *
460	+ * @param unknown $ids (optional)
461	+ *
462	+ * @return unknown
463	+ */
464	+ public function mark_reversed( $ids = array() )
465	+ {
466	+ global $wpdb;
467	+
468	+ $table_name = $wpdb->prefix . "pv_commission";
469	+
470	+ $query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE id IN ($ids) AND `status` = 'due'";
471	+ $result = $wpdb->query( $query );
472	+
473	+ return $result;
474	+ }
475	+
476	+
477	+ /**
478	+ *
479	+ *
480	+ * @param unknown $ids (optional)
481	+ *
482	+ * @return unknown
483	+ */
484	+ public function mark_due( $ids = array() )
485	+ {
486	+ global $wpdb;
487	+
488	+ $table_name = $wpdb->prefix . "pv_commission";
489	+
490	+ $query = "UPDATE `{$table_name}` SET `status` = 'due' WHERE id IN ($ids)";
491	+ $result = $wpdb->query( $query );
492	+
493	+ return $result;
494	+ }
495	+
496	+
497	+ /**
498	+ * prepare_items function.
499	+ *
500	+ * @access public
501	+ */
502	+ function prepare_items()
503	+ {
504	+ global $wpdb;
505	+
506	+ $_SERVER['REQUEST_URI'] = remove_query_arg( '_wp_http_referer', $_SERVER['REQUEST_URI'] );
507	+
508	+ $per_page = $this->get_items_per_page( 'commission_per_page', 10 );
509	+ $current_page = $this->get_pagenum();
510	+
511	+ $orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
512	+ $order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
513	+ $com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
514	+ $status_sql = '';
515	+ $time_sql = '';
516	+
517	+ /**
518	+ * Init column headers
519	+ */
520	+ $this->_column_headers = $this->get_column_info();
521	+
522	+
523	+ /**
524	+ * Process bulk actions
525	+ */
526	+ $this->process_bulk_action();
527	+
528	+ /**
529	+ * Get items
530	+ */
531	+ $sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
532	+
533	+ if ( !empty( $_GET[ 'm' ] ) ) {
534	+
535	+ $year = substr( $_GET[ 'm' ], 0, 4 );
536	+ $month = substr( $_GET[ 'm' ], 4, 2 );
537	+
538	+ $time_sql = "
539	+ WHERE MONTH(`time`) = '$month'
540	+ AND YEAR(`time`) = '$year'
541	+ ";
542	+
543	+ $sql .= $time_sql;
544	+ }
545	+
546	+ if ( !empty( $_GET[ 'com_status' ] ) ) {
547	+
548	+ if ( $time_sql == '' ) {
549	+ $status_sql = "
550	+ WHERE status = '$com_status'
551	+ ";
552	+ } else {
553	+ $status_sql = "
554	+ AND status = '$com_status'
555	+ ";
556	+ }
557	+
558	+ $sql .= $status_sql;
559	+ }
560	+
561	+ $max = $wpdb->get_var( $sql );
562	+
563	+ $sql = "
564	+ SELECT * FROM {$wpdb->prefix}pv_commission
565	+ ";
566	+
567	+ if ( !empty( $_GET[ 'm' ] ) ) {
568	+ $sql .= $time_sql;
569	+ }
570	+
571	+ if ( !empty( $_GET['com_status'] ) ) {
572	+ $sql .= $status_sql;
573	+ }
574	+
575	+ $offset = ( $current_page - 1 ) * $per_page;
576	+
577	+
578	+ $sql .= "
579	+ ORDER BY `{$orderby}` {$order}
580	+ LIMIT {$offset}, {$per_page}
581	+ ";
582	+
583	+ // $this->items = $wpdb->get_results( $wpdb->prepare( $sql, ( $current_page - 1 ) * $per_page, $per_page ) );
584	+ $this->items = $wpdb->get_results( $sql );
585	+
586	+ /**
587	+ * Pagination
588	+ */
589	+ $this->set_pagination_args( array(
590	+ 'total_items' => $max,
591	+ 'per_page' => $per_page,
592	+ 'total_pages' => ceil( $max / $per_page )
593	+ ) );
594	+ }
595	+
596	+
597	+ }

trunk/classes/admin/class-admin-reports.php ADDED Viewed

	@@ -0,0 +1,549 @@


1	+ <?php
2	+ /**
3	+ * WCV_Admin_Reports class.
4	+ *
5	+ * Shows reports related to software in the woocommerce backend
6	+ *
7	+ * @author Matt Gates <http://mgates.me>
8	+ * @package
9	+ */
10	+
11	+
12	+ class WCV_Admin_Reports
13	+ {
14	+
15	+
16	+ /**
17	+ * __construct function.
18	+ *
19	+ * @access public
20	+ * @return void
21	+ *
22	+ * @param bool $debug (optional) (default: false)
23	+ */
24	+ function __construct( $debug = false )
25	+ {
26	+ add_filter( 'woocommerce_admin_reports', array( $this, 'reports_tab' ) );
27	+ }
28	+
29	+ /**
30	+ * reports_tab function.
31	+ *
32	+ * @access public
33	+ *
34	+ * @param unknown $reports
35	+ *
36	+ * @return void
37	+ */
38	+ function reports_tab( $reports )
39	+ {
40	+ $reports[ 'vendors' ] = array(
41	+ 'title' => __( 'WC Vendors', 'wcvendors' ),
42	+ 'charts' => array(
43	+ array(
44	+ 'title' => __( 'Overview', 'wcvendors' ),
45	+ 'description' => '',
46	+ 'hide_title' => true,
47	+ 'function' => array( $this, 'sales' ),
48	+ ),
49	+ array(
50	+ 'title' => __( 'Commission by vendor', 'wcvendors' ),
51	+ 'description' => '',
52	+ 'hide_title' => true,
53	+ 'function' => array( $this, 'commission' ),
54	+ ),
55	+ array(
56	+ 'title' => __( 'Commission by product', 'wcvendors' ),
57	+ 'description' => '',
58	+ 'hide_title' => true,
59	+ 'function' => array( $this, 'commission' ),
60	+ ),
61	+ array(
62	+ 'title' => __( 'Commission Totals', 'wcvendors' ),
63	+ 'description' => __( 'Commission totals for all vendors includes shipping and taxes. By default no date range is used and all due commissions are returned. Use the date range to filter.', 'wcvendors' ),
64	+ 'hide_title' => true,
65	+ 'function' => array( $this, 'commission_totals' ),
66	+ ),
67	+ ),
68	+ );
69	+
70	+ return $reports;
71	+ }
72	+
73	+ public function products()
74	+ {
75	+ # code...
76	+ }
77	+
78	+
79	+ /**
80	+ *
81	+ */
82	+ function sales()
83	+ {
84	+ global $start_date, $end_date, $woocommerce, $wpdb;
85	+
86	+ $start_date = !empty( $_POST[ 'start_date' ] ) ? $_POST[ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
87	+ $end_date = !empty( $_POST[ 'end_date' ] ) ? $_POST[ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
88	+
89	+ if ( !empty( $_POST[ 'start_date' ] ) ) {
90	+ $start_date = strtotime( $_POST[ 'start_date' ] );
91	+ }
92	+
93	+ if ( !empty( $_POST[ 'end_date' ] ) ) {
94	+ $end_date = strtotime( $_POST[ 'end_date' ] );
95	+ }
96	+
97	+ $after = date( 'Y-m-d', $start_date );
98	+ $before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
99	+
100	+ $commission_due = $wpdb->get_var( "
101	+ SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'due'
102	+ AND time >= '" . $after . "'
103	+ AND time <= '" . $before . "'
104	+ " );
105	+
106	+ $reversed = $wpdb->get_var( "
107	+ SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'reversed'
108	+ AND time >= '" . $after . "'
109	+ AND time <= '" . $before . "'
110	+ " );
111	+
112	+ $paid = $wpdb->get_var( "
113	+ SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'paid'
114	+ AND time >= '" . $after . "'
115	+ AND time <= '" . $before . "'
116	+ " );
117	+
118	+ ?>
119	+
120	+ <form method="post" action="">
121	+ <p><label for="from"><?php _e( 'From:', 'wcvendors' ); ?></label>
122	+ <input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $start_date ) ); ?>" name="start_date" class="range_datepicker from" id="from" />
123	+ <label for="to"><?php _e( 'To:', 'wcvendors' ); ?></label>
124	+ <input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $end_date ) ); ?>" name="end_date" class="range_datepicker to" id="to" />
125	+ <input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/></p>
126	+ </form>
127	+
128	+ <div id="poststuff" class="woocommerce-reports-wrap">
129	+ <div class="woocommerce-reports-sidebar">
130	+ <div class="postbox">
131	+ <h3><span><?php _e( 'Total paid in range', 'wcvendors' ); ?></span></h3>
132	+
133	+ <div class="inside">
134	+ <p class="stat"><?php if ( $paid > 0 ) echo woocommerce_price( $paid ); else _e( 'n/a', 'wcvendors' ); ?></p>
135	+ </div>
136	+ </div>
137	+ <div class="postbox">
138	+ <h3><span><?php _e( 'Total due in range', 'wcvendors' ); ?></span></h3>
139	+
140	+ <div class="inside">
141	+ <p class="stat"><?php if ( $commission_due > 0 ) echo woocommerce_price( $commission_due ); else _e( 'n/a', 'wcvendors' ); ?></p>
142	+ </div>
143	+ </div>
144	+ <div class="postbox">
145	+ <h3><span><?php _e( 'Total reversed in range', 'wcvendors' ); ?></span></h3>
146	+
147	+ <div class="inside">
148	+ <p class="stat"><?php if ( $reversed > 0 ) echo woocommerce_price( $reversed ); else _e( 'n/a', 'wcvendors' ); ?></p>
149	+ </div>
150	+ </div>
151	+ </div>
152	+
153	+ <div class="woocommerce-reports-main">
154	+ <div class="postbox">
155	+ <h3><span><?php _e( 'Recent Commission', 'wcvendors' ); ?></span></h3>
156	+
157	+ <div>
158	+ <?php
159	+ $commission = $wpdb->get_results( "
160	+ SELECT * FROM {$wpdb->prefix}pv_commission
161	+ WHERE time >= '" . $after . "'
162	+ AND time <= '" . $before . "'
163	+ ORDER BY time DESC
164	+ " );
165	+
166	+ if ( sizeof( $commission ) > 0 ) {
167	+
168	+ ?>
169	+ <div class="woocommerce_order_items_wrapper">
170	+ <table id="commission-table" class="woocommerce_order_items" cellspacing="0">
171	+ <thead>
172	+ <tr>
173	+ <th><?php _e( 'Order', 'wcvendors' ) ?></th>
174	+ <th><?php _e( 'Product', 'wcvendors' ) ?></th>
175	+ <th><?php _e( 'Vendor', 'wcvendors' ) ?></th>
176	+ <th><?php _e( 'Total', 'wcvendors' ) ?></th>
177	+ <th><?php _e( 'Date & Time', 'wcvendors' ) ?></th>
178	+ <th><?php _e( 'Status', 'wcvendors' ) ?></th>
179	+ </tr>
180	+ </thead>
181	+ <tbody>
182	+ <?php $i = 1;
183	+ foreach ( $commission as $row ) : $i++ ?>
184	+ <tr<?php if ( $i % 2 == 1 ) echo ' class="alternate"' ?>>
185	+ <td><?php if ( $row->order_id ) : ?><a
186	+ href="<?php echo admin_url( 'post.php?post=' . $row->order_id . '&action=edit' ); ?>"><?php echo $row->order_id; ?></a><?php else : _e( 'N/A', 'wcvendors' ); endif; ?>
187	+ </td>
188	+ <td><?php echo get_the_title( $row->product_id ); ?></td>
189	+ <td><?php echo WCV_Vendors::get_vendor_shop_name( $row->vendor_id ); ?></td>
190	+ <td><?php echo woocommerce_price( $row->total_due + $row->total_shipping + $row->tax ) ?></td>
191	+ <td><?php echo date( __( 'D j M Y \a\t h:ia', 'wcvendors' ), strtotime( $row->time ) ) ?></td>
192	+ <td><?php echo $row->status ?></td>
193	+ </tr>
194	+ <?php endforeach; ?>
195	+ </tbody>
196	+ </table>
197	+ </div>
198	+ <?php
199	+ } else {
200	+ ?><p><?php _e( 'No commission yet', 'wcvendors' ) ?></p><?php
201	+ }
202	+ ?>
203	+ </div>
204	+ </div>
205	+ </div>
206	+ </div>
207	+ <?php
208	+
209	+ }
210	+
211	+
212	+ /**
213	+ *
214	+ */
215	+ function commission()
216	+ {
217	+ global $start_date, $end_date, $woocommerce, $wpdb;
218	+
219	+ $latest_woo = version_compare( $woocommerce->version, '2.3', '>' );
220	+
221	+ $first_year = $wpdb->get_var( "SELECT time FROM {$wpdb->prefix}pv_commission ORDER BY time ASC LIMIT 1;" );
222	+ $first_year = $first_year ? date( 'Y', strtotime( $first_year ) ) : date( 'Y' );
223	+ $current_year = isset( $_POST[ 'show_year' ] ) ? $_POST[ 'show_year' ] : date( 'Y', current_time( 'timestamp' ) );
224	+ $start_date = strtotime( $current_year . '0101' );
225	+
226	+ $vendors = get_users( array( 'role' => 'vendor' ) );
227	+ $vendors = apply_filters( 'pv_commission_vendors_list', $vendors );
228	+ $selected_vendor = !empty( $_POST[ 'show_vendor' ] ) ? (int) $_POST[ 'show_vendor' ] : false;
229	+ $products = !empty( $_POST[ 'product_ids' ] ) ? (array) $_POST[ 'product_ids' ] : array();
230	+
231	+ ?>
232	+
233	+ <form method="post" action="" class="report_filters">
234	+ <label for="show_year"><?php _e( 'Show:', 'wcvendors' ); ?></label>
235	+ <select name="show_year" id="show_year">
236	+ <?php
237	+ for ( $i = $first_year; $i <= date( 'Y' ); $i++ )
238	+ printf( '<option value="%s" %s>%s</option>', $i, selected( $current_year, $i, false ), $i );
239	+ ?>
240	+ </select>
241	+ <?php if ( $_GET[ 'report' ] == 2 ) {
242	+ if ($latest_woo) { ?>
243	+ <input type="hidden" class="wc-product-search" style="width:203px;" name="product_ids[]" data-placeholder="<?php _e( 'Search for a product…', 'woocommerce' ); ?>" data-action="woocommerce_json_search_products_and_variations" />
244	+ <?php } else { ?>
245	+ <select id="product_ids" name="product_ids[]" class="ajax_chosen_select_products" multiple="multiple"
246	+ data-placeholder="<?php _e( 'Type in a product name to start searching...', 'wcvendors' ); ?>"
247	+ style="width: 400px;"></select>
248	+ <script type="text/javascript">
249	+ jQuery(function () {
250	+
251	+ // Ajax Chosen Product Selectors
252	+ jQuery("select.ajax_chosen_select_products").ajaxChosen({
253	+ method: 'GET',
254	+ url: '<?php echo admin_url('admin-ajax.php'); ?>',
255	+ dataType: 'json',
256	+ afterTypeDelay: 100,
257	+ data: {
258	+ action: 'woocommerce_json_search_products',
259	+ security: '<?php echo wp_create_nonce("search-products"); ?>'
260	+ }
261	+ }, function (data) {
262	+
263	+ var terms = {};
264	+
265	+ jQuery.each(data, function (i, val) {
266	+ terms[i] = val;
267	+ });
268	+
269	+ return terms;
270	+ });
271	+
272	+ });
273	+ </script>
274	+
275	+ <?php }
276	+ } else { ?>
277	+ <select class="chosen_select" id="show_vendor" name="show_vendor" style="width: 300px;"
278	+ data-placeholder="<?php _e( 'Select a vendor…', 'wcvendors' ); ?>">
279	+ <option></option>
280	+ <?php foreach ( $vendors as $key => $vendor ) printf( '<option value="%s" %s>%s</option>', $vendor->ID, selected( $selected_vendor, $vendor->ID, false ), $vendor->display_name ); ?>
281	+ </select>
282	+ <?php } ?>
283	+ <input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/>
284	+ </form>
285	+
286	+ <?php
287	+
288	+ if ( !empty( $selected_vendor ) \|\| !empty( $products ) ) {
289	+
290	+ foreach ($products as $key => $product_id) {
291	+ $_product = get_product($product_id);
292	+ $childs = $_product->get_children();
293	+ $products = array_merge($childs, $products);
294	+ }
295	+
296	+ $commissions = array();
297	+ $filter = !empty( $selected_vendor ) ? (" WHERE vendor_id = " . $selected_vendor) : (" WHERE product_id IN ( " . implode( ', ', $products ) ." )");
298	+
299	+ $sql = "SELECT
300	+ SUM(total_due + total_shipping + tax) as total,
301	+ SUM(total_due) as commission,
302	+ SUM(total_shipping) as shipping,
303	+ SUM(tax) as tax
304	+ FROM {$wpdb->prefix}pv_commission
305	+ ";
306	+
307	+ $paid_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission " . $filter . " AND status = 'paid'";
308	+ $reversed_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission" . $filter . " AND status = 'reversed'";
309	+ $date_sql = " AND date_format(`time`,'%%Y%%m') = %d";
310	+
311	+ for ( $count = 0; $count < 12; $count++ ) {
312	+ $time = strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' );
313	+ if ( $time > current_time( 'timestamp' ) ) continue;
314	+
315	+ $month = date( 'Ym', strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' ) );
316	+
317	+ $fetch_results = $wpdb->prepare( $sql . $filter . $date_sql, $month );
318	+
319	+ $results = $wpdb->get_results( $fetch_results );
320	+ if ( !empty( $results[ 0 ] ) ) {
321	+ extract( get_object_vars( $results[ 0 ] ) );
322	+ }
323	+
324	+ $paid = $wpdb->get_var( $wpdb->prepare( $paid_sql . $date_sql, $month ) );
325	+ $reversed = $wpdb->get_var( $wpdb->prepare( $reversed_sql . $date_sql, $month ) );
326	+
327	+ $commissions[ date( 'M', strtotime( $month . '01' ) ) ] = array(
328	+ 'commission' => $commission,
329	+ 'tax' => $tax,
330	+ 'shipping' => $shipping,
331	+ 'reversed' => $reversed,
332	+ 'paid' => $paid,
333	+ 'total' => $total - $reversed - $paid,
334	+ );
335	+
336	+ }
337	+
338	+ ?>
339	+
340	+ <div class="woocommerce-reports-main">
341	+ <table class="widefat">
342	+ <thead>
343	+ <tr>
344	+ <th><?php _e( 'Month', 'wcvendors' ); ?></th>
345	+ <th class="total_row"><?php _e( 'Commission Totals', 'wcvendors' ); ?></th>
346	+ <th class="total_row"><?php _e( 'Tax', 'wcvendors' ); ?></th>
347	+ <th class="total_row"><?php _e( 'Shipping', 'wcvendors' ); ?></th>
348	+ <th class="total_row"><?php _e( 'Reversed', 'wcvendors' ); ?></th>
349	+ <th class="total_row"><?php _e( 'Paid', 'wcvendors' ); ?></th>
350	+ <th class="total_row"><?php _e( 'Due', 'wcvendors' ); ?></th>
351	+ </tr>
352	+ </thead>
353	+ <tfoot>
354	+ <tr>
355	+ <?php
356	+ $total = array(
357	+ 'commission' => 0,
358	+ 'tax' => 0,
359	+ 'shipping' => 0,
360	+ 'reversed' => 0,
361	+ 'paid' => 0,
362	+ 'total' => 0,
363	+ );
364	+
365	+ foreach ( $commissions as $month => $commission ) {
366	+ $total[ 'commission' ] += $commission[ 'commission' ];
367	+ $total[ 'tax' ] += $commission[ 'tax' ];
368	+ $total[ 'shipping' ] += $commission[ 'shipping' ];
369	+ $total[ 'reversed' ] += $commission[ 'reversed' ];
370	+ $total[ 'paid' ] += $commission[ 'paid' ];
371	+ $total[ 'total' ] += $commission[ 'total' ];
372	+ }
373	+
374	+ echo '<td>' . __( 'Total', 'wcvendors' ) . '</td>';
375	+
376	+ foreach ( $total as $value ) {
377	+ echo '<td class="total_row">' . woocommerce_price( $value ) . '</td>';
378	+ }
379	+ ?>
380	+ </tr>
381	+ </tfoot>
382	+ <tbody>
383	+ <?php
384	+ foreach ( $commissions as $month => $commission ) {
385	+ $alt = ( isset( $alt ) && $alt == 'alt' ) ? '' : 'alt';
386	+
387	+ echo '<tr class="' . $alt . '"><td>' . $month . '</td>';
388	+
389	+ foreach ( $commission as $value ) {
390	+ echo '<td class="total_row">' . woocommerce_price( $value ) . '</td>';
391	+ }
392	+
393	+ echo '</tr>';
394	+ }
395	+ ?>
396	+ </tbody>
397	+ </table>
398	+ </div>
399	+
400	+ <?php } ?>
401	+ <?php
402	+
403	+ }
404	+
405	+
406	+ /**
407	+ * Commission Totals for vendors reports
408	+ *
409	+ * @since 1.8.4
410	+ */
411	+ function commission_totals(){
412	+
413	+ global $wpdb;
414	+
415	+ $total_start_date = !empty( $_POST[ 'total_start_date' ] ) ? $_POST[ 'total_start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
416	+ $total_end_date = !empty( $_POST[ 'total_end_date' ] ) ? $_POST[ 'total_end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
417	+ $commission_status = !empty( $_POST[ 'commission_status' ] ) ? $_POST[ 'commission_status' ] : 'due';
418	+ $date_sql = ( !empty( $_POST[ 'total_start_date' ] ) && !empty( $_POST[ 'total_end_date' ] ) ) ? " time >= '$total_start_date' AND time <= '$total_end_date' AND" : "";
419	+
420	+ $status_sql = " status='$commission_status'";
421	+
422	+ $sql = "SELECT vendor_id, total_due, total_shipping, tax, status FROM {$wpdb->prefix}pv_commission WHERE";
423	+
424	+ $commissions = $wpdb->get_results( $sql . $date_sql . $status_sql );
425	+
426	+ if ( !empty( $_POST[ 'total_start_date' ] ) ) {
427	+ $total_start_date = strtotime( $_POST[ 'total_start_date' ] );
428	+ }
429	+
430	+ if ( !empty( $_POST[ 'total_end_date' ] ) ) {
431	+ $total_end_date = strtotime( $_POST[ 'total_end_date' ] );
432	+ }
433	+
434	+ $totals = $this->calculate_totals( $commissions );
435	+
436	+ ?><form method="post" action="">
437	+ <p><label for="from"><?php _e( 'From:', 'wcvendors' ); ?></label>
438	+ <input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_start_date ) ); ?>" name="total_start_date" class="range_datepicker from" id="from" />
439	+ <label for="to"><?php _e( 'To:', 'wcvendors' ); ?></label>
440	+ <input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_end_date ) ); ?>" name="total_end_date" class="range_datepicker to" id="to" />
441	+
442	+ <select name="commission_status">
443	+ <option value="due"><?php _e( 'Due', 'wcvendors' ); ?></option>
444	+ <option value="paid"><?php _e( 'Paid', 'wcvendors' ); ?></option>
445	+ <option value="reversed"><?php _e( 'Reversed', 'wcvendors' ); ?></option>
446	+ </select>
447	+
448	+ <input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/></p>
449	+ </form>
450	+
451	+ <div class="woocommerce-reports-main">
452	+ <table class="widefat">
453	+ <thead>
454	+ <tr>
455	+ <th class="total_row"><?php _e( 'Vendor', 'wcvendors' ); ?></th>
456	+ <th class="total_row"><?php _e( 'Tax Total', 'wcvendors' ); ?></th>
457	+ <th class="total_row"><?php _e( 'Shipping Total', 'wcvendors' ); ?></th>
458	+ <th class="total_row"><?php _e( 'Status', 'wcvendors' ); ?></th>
459	+ <th class="total_row"><?php _e( 'Commission Total', 'wcvendors' ); ?></th>
460	+ </tr>
461	+ </thead>
462	+ <tbody>
463	+ <?php
464	+
465	+ if ( !empty( $commissions ) ){
466	+
467	+ foreach ( $totals as $totals ) {
468	+
469	+ echo '<tr>';
470	+ echo '<td>' . $totals[ 'user_login' ]. '</td>';
471	+ echo '<td>' . woocommerce_price( $totals[ 'tax' ] ). '</td>';
472	+ echo '<td>' . woocommerce_price( $totals[ 'total_shipping' ] ). '</td>';
473	+ echo '<td>' . $totals[ 'status' ] . '</td>';
474	+ echo '<td>' . woocommerce_price( $totals[ 'total_due' ] ). '</td>';
475	+ echo '</tr>';
476	+
477	+ }
478	+
479	+ } else {
480	+ echo '<tr>';
481	+ echo '<td colspan="5">'. __( 'No commissions found.', 'wcvendors' ) . '</td>';
482	+ echo '</tr>';
483	+
484	+ }
485	+ ?>
486	+ </tbody>
487	+ </table>
488	+
489	+ <?php
490	+
491	+
492	+ } // commission_totals()
493	+
494	+ /**
495	+ * Calculate the totals of the commissions return an array with vendor id as the key with the totals
496	+ *
497	+ * @param array $commissions total commissions array
498	+ * @return array $totals calculated totals
499	+ */
500	+ function calculate_totals( $commissions ){
501	+
502	+ $totals = array();
503	+
504	+ $vendors = get_users( array( 'role' => 'vendor', 'fields' => array( 'ID', 'user_login' ) ) );
505	+ $vendor_names = wp_list_pluck( $vendors, 'user_login', 'ID' );
506	+
507	+ foreach ($commissions as $commission ) {
508	+
509	+ if ( array_key_exists( $commission->vendor_id, $totals ) ){
510	+
511	+ $totals[ $commission->vendor_id ][ 'total_due' ] += $commission->total_due + $commission->tax + $commission->total_shipping;
512	+ $totals[ $commission->vendor_id ][ 'tax' ] += $commission->tax;
513	+ $totals[ $commission->vendor_id ][ 'total_shipping' ] += $commission->total_shipping;
514	+
515	+ } else {
516	+
517	+ if ( array_key_exists( $commission->vendor_id, $vendor_names) ){
518	+
519	+ $temp_array = array(
520	+ 'user_login' => $vendor_names[ $commission->vendor_id ],
521	+ 'total_due' => $commission->total_due,
522	+ 'tax' => $commission->tax,
523	+ 'total_shipping' => $commission->total_shipping,
524	+ 'status' => $commission->status,
525	+ );
526	+
527	+ $totals[ $commission->vendor_id ] = $temp_array ;
528	+
529	+ }
530	+
531	+ }
532	+
533	+ }
534	+
535	+ usort( $totals, function( $a, $b ) {
536	+ if ($a['user_login'] < $b['user_login']) {
537	+ return -1;
538	+ } else if ($a['user_login'] > $b['user_login']) {
539	+ return 1;
540	+ } else {
541	+ return 0;
542	+ }
543	+ });
544	+
545	+ return $totals;
546	+
547	+ } // calculate_totals()
548	+
549	+ }

trunk/classes/admin/class-admin-users.php ADDED Viewed

	@@ -0,0 +1,493 @@


1	+ <?php
2	+
3	+ /**
4	+ * WP-Admin users page
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package WC_Vendors
8	+ */
9	+
10	+
11	+ class WCV_Admin_Users
12	+ {
13	+
14	+
15	+ /**
16	+ * Constructor
17	+ */
18	+ function __construct()
19	+ {
20	+ if ( !is_admin() ) return;
21	+
22	+ add_action( 'edit_user_profile', array( $this, 'show_extra_profile_fields' ) );
23	+ add_action( 'edit_user_profile_update', array( $this, 'save_extra_profile_fields' ) );
24	+
25	+ add_filter( 'add_menu_classes', array( $this, 'show_pending_number' ) );
26	+
27	+ // Disabling non-vendor related items on the admin screens
28	+ if ( WCV_Vendors::is_vendor( get_current_user_id() ) ) {
29	+ add_filter( 'woocommerce_csv_product_role', array( $this, 'csv_import_suite_compatibility' ) );
30	+ add_filter( 'woocommerce_csv_product_export_args', array( $this, 'csv_import_suite_compatibility_export' ) );
31	+
32	+ // Admin page lockdown
33	+ remove_action( 'admin_init', 'woocommerce_prevent_admin_access' );
34	+ add_action( 'admin_init', array( $this, 'prevent_admin_access' ) );
35	+
36	+ add_filter( 'woocommerce_prevent_admin_access', array( $this, 'deny_admin_access' ) );
37	+
38	+ // WC > Product page fixes
39	+ add_action( 'load-post-new.php', array( $this, 'confirm_access_to_add' ) );
40	+ add_action( 'load-edit.php', array( $this, 'edit_nonvendors' ) );
41	+ add_filter( 'views_edit-product', array( $this, 'hide_nonvendor_links' ) );
42	+
43	+ // Filter user attachments so they only see their own attachements
44	+ add_action( 'ajax_query_attachments_args', array( $this, 'show_user_attachment_ajax' ) );
45	+ add_filter( 'parse_query', array( $this, 'show_user_attachment_page' ) );
46	+
47	+ add_action( 'admin_menu', array( $this, 'remove_menu_page' ), 99 );
48	+ add_action( 'add_meta_boxes', array( $this, 'remove_meta_boxes' ), 99 );
49	+ add_filter( 'product_type_selector', array( $this, 'filter_product_types' ), 99, 2 );
50	+ add_filter( 'product_type_options', array( $this, 'filter_product_type_options' ), 99 );
51	+
52	+ add_filter( 'woocommerce_duplicate_product_capability', array( $this, 'add_duplicate_capability' ) );
53	+
54	+ // WC > Product featured
55	+ $product_misc = (array) WC_Vendors::$pv_options->get_option( 'hide_product_misc' );
56	+
57	+ if ( isset( $product_misc['featured'] ) ) {
58	+ add_filter( 'manage_product_posts_columns', array($this, 'manage_product_columns'), 99);
59	+ }
60	+ // WC > Product Hide duplicate
61	+ if ( isset( $product_misc['duplicate'] ) ) {
62	+ add_filter( 'post_row_actions', array( $this, 'remove_dupe_link' ), 99, 2 );
63	+ }
64	+ }
65	+
66	+ }
67	+
68	+ public function confirm_access_to_add()
69	+ {
70	+ if ( empty( $_GET['post_type'] ) \|\| $_GET['post_type'] != 'product' ) {
71	+ return;
72	+ }
73	+
74	+ $can_submit = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
75	+ if ( !$can_submit ) {
76	+ wp_die( 'You are not allowed to submit products.' );
77	+ }
78	+ }
79	+
80	+ // public function get_terms_filter( $terms, $tax, $args )
81	+ // {
82	+ // if ( $tax[0] != 'product_type' \|\| ( $tax[0] == 'product_type' && ! empty( $args['include'] ) ) ) {
83	+ // return $terms;
84	+ // }
85	+
86	+ // $products = WCV_Vendors::get_vendor_products( get_current_user_id() );
87	+ // $ids = array();
88	+ // foreach ( $products as $product ) {
89	+ // $ids[ ] = ( $product->ID );
90	+ // $product = get_product( $product )->product_type;
91	+ // var_dump($product);exit;
92	+ // }
93	+
94	+ // $args['include'] = $ids;
95	+
96	+ // var_dump($terms);exit;
97	+
98	+ // $terms = get_terms( $tax[0], $args);
99	+
100	+
101	+ // return $terms;
102	+ // }
103	+
104	+ public function csv_import_suite_compatibility( $capability )
105	+ {
106	+ return 'manage_product';
107	+ }
108	+
109	+ public function csv_import_suite_compatibility_export( $args )
110	+ {
111	+ $args[ 'author' ] = get_current_user_id();
112	+
113	+ return $args;
114	+ }
115	+
116	+ public function add_duplicate_capability( $capability )
117	+ {
118	+ return 'manage_product';
119	+ }
120	+
121	+
122	+ /**
123	+ *
124	+ *
125	+ * @param unknown $menu
126	+ *
127	+ * @return unknown
128	+ */
129	+ public function show_pending_number( $menu )
130	+ {
131	+
132	+ $args = array(
133	+ 'post_type' => 'product',
134	+ 'author' => get_current_user_id(),
135	+ 'post_status' => 'pending'
136	+ );
137	+
138	+ if (!WCV_Vendors::is_vendor( get_current_user_id() ) ) unset( $args['author'] );
139	+
140	+ $pending_posts = get_posts( $args );
141	+
142	+ $pending_count = is_array( $pending_posts ) ? count( $pending_posts ) : 0;
143	+
144	+ $menu_str = 'edit.php?post_type=product';
145	+
146	+ foreach ( $menu as $menu_key => $menu_data ) {
147	+
148	+ if ( $menu_str != $menu_data[ 2 ] ) continue;
149	+
150	+ if ($pending_count > 0 ) {
151	+ $menu[ $menu_key ][ 0 ] .= " <span class='update-plugins counting-$pending_count'><span class='plugin-count'>" . number_format_i18n( $pending_count ) . '</span></span>';
152	+ }
153	+ }
154	+
155	+ return $menu;
156	+ }
157	+
158	+
159	+ /**
160	+ *
161	+ *
162	+ * @param unknown $types
163	+ * @param unknown $product_type
164	+ *
165	+ * @return unknown
166	+ */
167	+ function filter_product_types( $types, $product_type )
168	+ {
169	+ $product_panel = (array) WC_Vendors::$pv_options->get_option( 'hide_product_panel' );
170	+ $product_misc = (array) WC_Vendors::$pv_options->get_option( 'hide_product_misc' );
171	+ $product_types = (array) WC_Vendors::$pv_options->get_option( 'hide_product_types' );
172	+ $css = WC_Vendors::$pv_options->get_option( 'product_page_css' );
173	+ $count = 0;
174	+
175	+ foreach ( $product_panel as $key => $value ) {
176	+ if ( $value ) $css .= sprintf( '.%s_tab{display:none !important;}', $key );
177	+ }
178	+
179	+ if ( !empty( $product_misc[ 'taxes' ] ) ) {
180	+ $css .= '.form-field._tax_status_field, .form-field._tax_class_field{display:none !important;}';
181	+ }
182	+
183	+ unset( $product_misc[ 'taxes' ] );
184	+
185	+ foreach ( $product_misc as $key => $value ) {
186	+ if ( $value ) $css .= sprintf( '._%s_field{display:none !important;}', $key );
187	+ }
188	+
189	+ foreach ( $product_types as $value ) {
190	+ if ( !$value ) $count++;
191	+ }
192	+
193	+ if ( $count === 1 ) {
194	+ $css .= '#product-type{display:none !important;}';
195	+ }
196	+
197	+ echo '<style>';
198	+ echo $css;
199	+ echo '</style>';
200	+
201	+ foreach ( $types as $key => $value ) {
202	+ if ( !empty( $product_types[ $key ] ) ) {
203	+ unset( $types[ $key ] );
204	+ }
205	+ }
206	+
207	+ return $types;
208	+ }
209	+
210	+
211	+ /**
212	+ *
213	+ *
214	+ * @param unknown $types
215	+ *
216	+ * @return unknown
217	+ */
218	+ function filter_product_type_options( $types )
219	+ {
220	+ $product_options = WC_Vendors::$pv_options->get_option( 'hide_product_type_options' );
221	+
222	+ if ( !$product_options ) return $types;
223	+
224	+ foreach ( $types as $key => $value ) {
225	+ if ( !empty( $product_options[ $key ] ) ) {
226	+ unset( $types[ $key ] );
227	+ }
228	+ }
229	+
230	+ return $types;
231	+ }
232	+
233	+
234	+ /**
235	+ * Show attachments only belonging to vendor
236	+ *
237	+ * @param object $query
238	+ */
239	+ function show_user_attachment_ajax ( $query ) {
240	+
241	+ $user_id = get_current_user_id();
242	+ if ( $user_id ) {
243	+ $query['author'] = $user_id;
244	+ }
245	+ return $query;
246	+ }
247	+
248	+ /**
249	+ * Show attachments only belonging to vendor
250	+ *
251	+ * @param object $query
252	+ */
253	+ function show_user_attachment_page ( $query ) {
254	+
255	+ global $current_user, $pagenow;
256	+
257	+ if ( !is_a( $current_user, 'WP_User') )
258	+ return;
259	+
260	+ if ( 'upload.php' != $pagenow && 'media-upload.php' != $pagenow)
261	+ return;
262	+
263	+ if ( !current_user_can('delete_pages') )
264	+ $query->set('author', $current_user->ID );
265	+
266	+ return;
267	+ }
268	+
269	+ /**
270	+ * Allow vendors to access admin when disabled
271	+ */
272	+ public function prevent_admin_access()
273	+ {
274	+ $permitted_user = ( current_user_can( 'edit_posts' ) \|\| current_user_can( 'manage_woocommerce' ) \|\| current_user_can( 'vendor' ) );
275	+
276	+ if ( get_option( 'woocommerce_lock_down_admin' ) == 'yes' && !is_ajax() && !$permitted_user ) {
277	+ wp_safe_redirect( get_permalink( woocommerce_get_page_id( 'myaccount' ) ) );
278	+ exit;
279	+ }
280	+ }
281	+
282	+ public function deny_admin_access()
283	+ {
284	+ return false;
285	+ }
286	+
287	+
288	+ /**
289	+ * Request when load-edit.php
290	+ */
291	+ public function edit_nonvendors()
292	+ {
293	+ add_action( 'request', array( $this, 'hide_nonvendor_products' ) );
294	+ }
295	+
296	+
297	+ /**
298	+ * Hide links that don't matter anymore from vendors
299	+ *
300	+ * @param array $views
301	+ *
302	+ * @return array
303	+ */
304	+ public function hide_nonvendor_links( $views )
305	+ {
306	+ return array();
307	+ }
308	+
309	+
310	+ /**
311	+ * Hide products that don't belong to the vendor
312	+ *
313	+ * @param array $query_vars
314	+ *
315	+ * @return array
316	+ */
317	+ public function hide_nonvendor_products( $query_vars )
318	+ {
319	+ if (array_key_exists('post_type', $query_vars) && ($query_vars['post_type'] == 'product')) {
320	+ $query_vars[ 'author' ] = get_current_user_id();
321	+ }
322	+
323	+ return $query_vars;
324	+ }
325	+
326	+
327	+ /**
328	+ * Remove the media library menu
329	+ */
330	+ public function remove_menu_page()
331	+ {
332	+ global $pagenow, $woocommerce;
333	+
334	+ remove_menu_page( 'index.php' ); /* Hides Dashboard menu */
335	+ remove_menu_page( 'separator1' ); /* Hides separator under Dashboard menu*/
336	+ remove_all_actions( 'admin_notices' );
337	+
338	+ if ( $pagenow == 'index.php' ) {
339	+ wp_redirect( admin_url( 'profile.php' ) );
340	+ }
341	+ }
342	+
343	+
344	+ /**
345	+ *
346	+ */
347	+ public function remove_meta_boxes()
348	+ {
349	+ remove_meta_box( 'postcustom', 'product', 'normal' );
350	+ remove_meta_box( 'wpseo_meta', 'product', 'normal' );
351	+ remove_meta_box( 'expirationdatediv', 'product', 'side' );
352	+ }
353	+
354	+
355	+ /**
356	+ * Update the vendor PayPal email
357	+ *
358	+ * @param int $vendor_id
359	+ *
360	+ * @return bool
361	+ */
362	+ public function save_extra_profile_fields( $vendor_id )
363	+ {
364	+ if ( !current_user_can( 'edit_user', $vendor_id ) ) return false;
365	+
366	+ if ( ! WCV_Vendors::is_vendor( $vendor_id ) ) { return; }
367	+
368	+ $users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
369	+ if ( empty( $users ) \|\| $users[ 0 ]->ID == $vendor_id ) {
370	+ update_user_meta( $vendor_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
371	+ update_user_meta( $vendor_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
372	+ }
373	+
374	+ update_user_meta( $vendor_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
375	+ update_user_meta( $vendor_id, 'pv_shop_html_enabled', isset( $_POST[ 'pv_shop_html_enabled' ] ) );
376	+ update_user_meta( $vendor_id, 'pv_custom_commission_rate', $_POST[ 'pv_custom_commission_rate' ] );
377	+ update_user_meta( $vendor_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
378	+ update_user_meta( $vendor_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
379	+ update_user_meta( $vendor_id, 'wcv_give_vendor_tax', isset( $_POST[ 'wcv_give_vendor_tax' ] ) );
380	+ update_user_meta( $vendor_id, 'wcv_give_vendor_shipping', isset( $_POST[ 'wcv_give_vendor_shipping' ] ) );
381	+
382	+ do_action( 'wcvendors_update_admin_user', $vendor_id );
383	+ }
384	+
385	+
386	+ /**
387	+ * Show the PayPal field and commision due table
388	+ *
389	+ * @param unknown $user
390	+ */
391	+ public function show_extra_profile_fields( $user )
392	+ {
393	+
394	+ if ( ! WCV_Vendors::is_vendor( $user->ID ) && ! WCV_Vendors::is_pending( $user->ID ) ) {
395	+ return;
396	+ }
397	+
398	+ ?>
399	+ <h3><?php _e( 'WC Vendors', 'wcvendors' ); ?></h3>
400	+ <table class="form-table">
401	+ <tbody>
402	+ <?php do_action( 'wcvendors_admin_before_shop_html', $user ); ?>
403	+ <tr>
404	+ <th scope="row">Shop HTML</th>
405	+ <td>
406	+ <label for="pv_shop_html_enabled">
407	+ <input name="pv_shop_html_enabled" type="checkbox"
408	+ id="pv_shop_html_enabled" <?php checked( true, get_user_meta( $user->ID, 'pv_shop_html_enabled', true ), $echo = true ) ?>/>
409	+ <?php _e( 'Enable HTML for the shop description', 'wcvendors' ); ?>
410	+ </label>
411	+ </td>
412	+ </tr>
413	+ <?php do_action( 'wcvendors_admin_after_shop_html', $user ); ?>
414	+ <tr>
415	+ <th><label for="pv_shop_name"><?php _e( 'Shop name', 'wcvendors' ); ?></label></th>
416	+ <td><input type="text" name="pv_shop_name" id="pv_shop_name"
417	+ value="<?php echo get_user_meta( $user->ID, 'pv_shop_name', true ); ?>" class="regular-text">
418	+ </td>
419	+ </tr>
420	+ <?php do_action( 'wcvendors_admin_after_shop_name', $user ); ?>
421	+ <tr>
422	+ <th><label for="pv_paypal"><?php _e( 'PayPal E-mail', 'wcvendors' ); ?> <span
423	+ class="description">(<?php _e( 'required', 'wcvendors' ); ?>)</span></label></th>
424	+ <td><input type="email" name="pv_paypal" id="pv_paypal"
425	+ value="<?php echo get_user_meta( $user->ID, 'pv_paypal', true ); ?>" class="regular-text">
426	+ </td>
427	+ </tr>
428	+ <?php do_action( 'wcvendors_admin_after_paypal', $user ); ?>
429	+ <tr>
430	+ <th><label for="pv_custom_commission_rate"><?php _e( 'Commission rate', 'wcvendors' ); ?> (%)</label></th>
431	+ <td><input type="number" step="0.01" max="100" min="0" name="pv_custom_commission_rate" placeholder="<?php _e( 'Leave blank for default', 'wcvendors' ); ?>" id="pv_custom_commission_rate"
432	+ value="<?php echo get_user_meta( $user->ID, 'pv_custom_commission_rate', true ); ?>" class="regular-text">
433	+ </td>
434	+ </tr>
435	+ <?php do_action( 'wcvendors_admin_after_commission_due', $user ); ?>
436	+ <tr>
437	+ <th><label for="wcv_give_vendor_tax"><?php _e( 'Give Tax', 'wcvendors' ); ?> (%)</label></th>
438	+ <td>
439	+ <label for="wcv_give_vendor_tax">
440	+ <input name="wcv_give_vendor_tax" type="checkbox"
441	+ id="wcv_give_vendor_tax" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_tax', true ), $echo = true ) ?>/>
442	+ <?php _e( 'Tax override for vendor', 'wcvendors' ); ?>
443	+ </label>
444	+ </td>
445	+ </tr>
446	+ <?php do_action( 'wcvendors_admin_after_give_tax', $user ); ?>
447	+ <tr>
448	+ <th><label for="wcv_give_vendor_shipping"><?php _e( 'Give Shipping', 'wcvendors' ); ?> (%)</label></th>
449	+ <td>
450	+ <label for="wcv_give_vendor_shipping">
451	+ <input name="wcv_give_vendor_shipping" type="checkbox"
452	+ id="wcv_give_vendor_shipping" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_shipping', true ), $echo = true ) ?>/>
453	+ <?php _e( 'Shipping override for vendor', 'wcvendors' ); ?>
454	+ </label>
455	+ </td>
456	+ </tr>
457	+ <?php do_action( 'wcvendors_admin_after_give_shipping', $user ); ?>
458	+ <tr>
459	+ <th><label for="pv_seller_info"><?php _e( 'Seller info', 'wcvendors' ); ?></label></th>
460	+ <td><?php wp_editor( get_user_meta( $user->ID, 'pv_seller_info', true ), 'pv_seller_info' ); ?></td>
461	+ </tr>
462	+ <?php do_action( 'wcvendors_admin_after_seller_info', $user ); ?>
463	+ <tr>
464	+ <th><label for="pv_shop_description"><?php _e( 'Shop description', 'wcvendors' ); ?></label>
465	+ </th>
466	+ <td><?php wp_editor( get_user_meta( $user->ID, 'pv_shop_description', true ), 'pv_shop_description' ); ?></td>
467	+ </tr>
468	+ <?php do_action( 'wcvendors_admin_after_shop_description', $user ); ?>
469	+ </tbody>
470	+ </table>
471	+ <?php
472	+ }
473	+
474	+ /*
475	+ Remove featured check box from the product listing
476	+ */
477	+ public function manage_product_columns( $columns ){
478	+ global $woocommerce;
479	+ unset($columns['featured']);
480	+ return $columns;
481	+ }
482	+
483	+
484	+ /**
485	+ * Hide the duplicate product link by removing it from the row actions
486	+ */
487	+ public function remove_dupe_link( $actions, $post ) {
488	+ unset($actions['duplicate']);
489	+ return $actions;
490	+ }
491	+
492	+
493	+ }

trunk/classes/admin/class-product-meta.php ADDED Viewed

	@@ -0,0 +1,267 @@


1	+ <?php
2	+
3	+ /**
4	+ * Product meta configurations
5	+ *
6	+ * @package ProductVendor
7	+ */
8	+
9	+
10	+ class WCV_Product_Meta
11	+ {
12	+
13	+
14	+ /**
15	+ * Constructor
16	+ */
17	+ function __construct()
18	+ {
19	+ if ( !current_user_can( 'manage_woocommerce' ) ) return;
20	+
21	+ // Allow products to have authors
22	+ add_post_type_support( 'product', 'author' );
23	+
24	+ add_action( 'add_meta_boxes', array( $this, 'change_author_meta_box_title' ) );
25	+ add_action( 'wp_dropdown_users', array( $this, 'author_vendor_roles' ), 0, 1 );
26	+ if ( apply_filters( 'wcv_product_commission_tab', true ) ) {
27	+ add_action( 'woocommerce_product_write_panel_tabs', array( $this, 'add_tab' ) );
28	+ add_action( 'woocommerce_product_write_panels', array( $this, 'add_panel' ) );
29	+ add_action( 'woocommerce_process_product_meta', array( $this, 'save_panel' ) );
30	+ }
31	+
32	+ add_action( 'woocommerce_product_quick_edit_end', array($this, 'display_vendor_dd_quick_edit') );
33	+ add_action( 'woocommerce_product_quick_edit_save', array($this, 'save_vendor_quick_edit'), 2, 99 );
34	+ add_action( 'manage_product_posts_custom_column', array($this, 'display_vendor_column'), 2, 99 );
35	+ add_filter( 'manage_product_posts_columns', array($this, 'vendor_column_quickedit') );
36	+
37	+ }
38	+
39	+
40	+ /**
41	+ * Change the "Author" metabox to "Vendor"
42	+ */
43	+ public function change_author_meta_box_title()
44	+ {
45	+ global $wp_meta_boxes;
46	+ $wp_meta_boxes[ 'product' ][ 'normal' ][ 'core' ][ 'authordiv' ][ 'title' ] = __( 'Vendor', 'wcvendors' );;
47	+ }
48	+
49	+
50	+ /**
51	+ * Override the authors selectbox with +vendor roles
52	+ *
53	+ * @param html $output
54	+ *
55	+ * @return html
56	+ */
57	+ public function author_vendor_roles( $output )
58	+ {
59	+ global $post;
60	+
61	+ if ( empty( $post ) ) return $output;
62	+
63	+ // Return if this isn't a WooCommerce product post type
64	+ if ( $post->post_type != 'product' ) return $output;
65	+
66	+ // Return if this isn't the vendor author override dropdown
67	+ if ( !strpos( $output, 'post_author_override' ) ) return $output;
68	+
69	+ $args = array(
70	+ 'selected' => $post->post_author,
71	+ 'id' => 'post_author_override',
72	+ );
73	+
74	+ $output = $this->vendor_selectbox( $args );
75	+
76	+ return $output;
77	+ }
78	+
79	+
80	+ /**
81	+ * Create a selectbox to display vendor & administrator roles
82	+ *
83	+ * @param array $args
84	+ *
85	+ * @return html
86	+ */
87	+ public function vendor_selectbox( $args )
88	+ {
89	+ $default_args = array(
90	+ 'placeholder',
91	+ 'id',
92	+ 'class',
93	+ );
94	+
95	+ foreach ( $default_args as $key ) {
96	+ if ( !is_array( $key ) && empty( $args[ $key ] ) ) $args[ $key ] = '';
97	+ else if ( is_array( $key ) ) foreach ( $key as $val ) $args[ $key ][ $val ] = esc_attr( $args[ $key ][ $val ] );
98	+ }
99	+ extract( $args );
100	+
101	+ $roles = array( 'vendor', 'administrator' );
102	+ $user_args = array( 'fields' => array( 'ID', 'user_login' ) );
103	+
104	+ $output = "<select style='width:200px;' name='$id' id='$id' class='$class' data-placeholder='$placeholder'>\n";
105	+ $output .= "\t<option value=''></option>\n";
106	+
107	+ foreach ( $roles as $role ) {
108	+
109	+ $new_args = $user_args;
110	+ $new_args[ 'role' ] = $role;
111	+ $users = get_users( $new_args );
112	+
113	+ if ( empty( $users ) ) continue;
114	+ foreach ( (array) $users as $user ) {
115	+ $select = selected( $user->ID, $selected, false );
116	+ $output .= "\t<option value='$user->ID' $select>$user->user_login</option>\n";
117	+ }
118	+
119	+ }
120	+ $output .= "</select>";
121	+
122	+ // Convert this selectbox with select2
123	+ $output .= '
124	+ <script type="text/javascript">jQuery(function() { jQuery("#' . $id . '").select2().focus(); } );</script>';
125	+
126	+ return $output;
127	+ }
128	+
129	+
130	+ /**
131	+ * Save commission rate of a product
132	+ *
133	+ * @param int $post_id
134	+ */
135	+ public function save_panel( $post_id )
136	+ {
137	+ if ( isset( $_POST[ 'pv_commission_rate' ] ) ) {
138	+ update_post_meta( $post_id, 'pv_commission_rate', is_numeric( $_POST[ 'pv_commission_rate' ] ) ? (float) $_POST[ 'pv_commission_rate' ] : false );
139	+ }
140	+
141	+ }
142	+
143	+
144	+ /**
145	+ * Add the Commission tab to a product
146	+ */
147	+ public function add_tab()
148	+ {
149	+ ?>
150	+ <li class="commission_tab">
151	+ <a href="#commission"><?php _e( 'Commission', 'wcvendors' ) ?></a>
152	+ </li> <?php
153	+ }
154	+
155	+
156	+ /**
157	+ * Add the Commission panel to a product
158	+ */
159	+ public function add_panel()
160	+ {
161	+ global $post; ?>
162	+
163	+ <div id="commission" class="panel woocommerce_options_panel">
164	+ <fieldset>
165	+
166	+ <p class='form-field commission_rate_field'>
167	+ <label for='pv_commission_rate'><?php _e( 'Commission', 'wcvendors' ); ?> (%)</label>
168	+ <input type='number' id='pv_commission_rate'
169	+ name='pv_commission_rate'
170	+ class='short'
171	+ max="100"
172	+ min="0"
173	+ step='any'
174	+ placeholder='<?php _e( 'Leave blank for default', 'wcvendors' ); ?>'
175	+ value="<?php echo get_post_meta( $post->ID, 'pv_commission_rate', true ); ?>"/>
176	+ </p>
177	+
178	+ </fieldset>
179	+ </div> <?php
180	+
181	+ }
182	+
183	+ /*
184	+ * Rename the Authors column to Vendor on products page
185	+ */
186	+ public function vendor_column_quickedit($posts_columns) {
187	+ $posts_columns['author'] = __( 'Vendor', 'wcvendors' );
188	+
189	+ return $posts_columns;
190	+ }
191	+
192	+ /*
193	+ * Display the vendor drop down on the quick edit screen
194	+ */
195	+ public function display_vendor_dd_quick_edit() {
196	+
197	+ global $post;
198	+ $selected = $post->post_author;
199	+
200	+ $roles = array( 'vendor', 'administrator' );
201	+ $user_args = array( 'fields' => array( 'ID', 'display_name' ) );
202	+
203	+ $output = "<select style='width:200px;' name='post_author-new' class='select'>\n";
204	+
205	+ foreach ( $roles as $role ) {
206	+
207	+ $new_args = $user_args;
208	+ $new_args[ 'role' ] = $role;
209	+ $users = get_users( $new_args );
210	+
211	+ if ( empty( $users ) ) continue;
212	+ foreach ( (array) $users as $user ) {
213	+ $select = selected( $user->ID, $selected, false );
214	+ $output .= "\t<option value='$user->ID' $select>$user->display_name</option>\n";
215	+ }
216	+
217	+ }
218	+ $output .= "</select>";
219	+
220	+ ?>
221	+ <br class="clear" />
222	+ <label class="inline-edit-author-new">
223	+ <span class="title"><?php _e('Vendor', 'wcvendors' ); ?></span>
224	+ <?php echo $output; ?>
225	+ </label>
226	+ <?php
227	+ }
228	+
229	+
230	+ /*
231	+ * Save the vendor on the quick edit screen
232	+ */
233	+ public function save_vendor_quick_edit( $product ) {
234	+
235	+ if ( $product->is_type('simple') \|\| $product->is_type('external') ) {
236	+ if ( isset( $_REQUEST['_vendor'] ) ) {
237	+ $vendor = wc_clean($_REQUEST['_vendor']);
238	+ $product->post->post_author = $vendor;
239	+ }
240	+ }
241	+ return $product;
242	+ }
243	+
244	+ /*
245	+ * Display hidden column data for js
246	+ */
247	+ public function display_vendor_column( $column, $post_id ){
248	+
249	+ $vendor = get_post_field( 'post_author', $post_id );
250	+
251	+ switch ( $column ) {
252	+ case 'name' :
253	+
254	+ ?>
255	+ <div class="hidden vendor" id="vendor_<?php echo $post_id; ?>">
256	+ <div id="post_author"><?php echo $vendor; ?></div>
257	+ </div>
258	+ <?php
259	+
260	+ break;
261	+
262	+ default :
263	+ break;
264	+ }
265	+
266	+ }
267	+ }

trunk/classes/admin/class-vendor-admin-dashboard.php ADDED Viewed

	@@ -0,0 +1,634 @@


1	+ <?php
2	+ /**
3	+ * WC Vendor Admin Dashboard - Vendor WP-Admin Dashboard Pages
4	+ *
5	+ * @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
6	+ * @package WCVendors
7	+ */
8	+
9	+ Class WCV_Vendor_Admin_Dashboard {
10	+
11	+ function __construct(){
12	+ // Add Shop Settings page
13	+ add_action( 'admin_menu', array( $this, 'vendor_dashboard_pages') );
14	+ // Hook into init for form processing
15	+ add_action( 'init', array( $this, 'save_shop_settings' ) );
16	+ add_action( 'admin_head', array( $this, 'admin_enqueue_order_style') );
17	+ }
18	+
19	+ function vendor_dashboard_pages(){
20	+ add_menu_page( __('Shop Settings', 'wcvendors'), __('Shop Settings', 'wcvendors'), 'manage_product', 'wcv-vendor-shopsettings', array( $this, 'settings_page' ) );
21	+ $hook = add_menu_page( __( 'Orders', 'wcvendors' ), __( 'Orders', 'wcvendors' ), 'manage_product', 'wcv-vendor-orders', array( 'WCV_Vendor_Admin_Dashboard', 'orders_page' ) );
22	+ add_action( "load-$hook", array( 'WCV_Vendor_Admin_Dashboard', 'add_options' ) );
23	+ }
24	+
25	+ function settings_page() {
26	+ $user_id = get_current_user_id();
27	+ $paypal_address = true;
28	+ $shop_description = true;
29	+ $description = get_user_meta( $user_id, 'pv_shop_description', true );
30	+ $seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
31	+ $has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
32	+ $shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
33	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
34	+ include('views/html-vendor-settings-page.php');
35	+ }
36	+
37	+ function admin_enqueue_order_style() {
38	+ add_thickbox();
39	+ wp_enqueue_style( 'admin_order_styles', wcv_assets_url . 'css/admin-orders.css' );
40	+ }
41	+
42	+ /**
43	+ * Save shop settings
44	+ */
45	+ public function save_shop_settings()
46	+ {
47	+ $user_id = get_current_user_id();
48	+ $error = false;
49	+ $error_msg = '';
50	+
51	+ if (isset ( $_POST[ 'wc-vendors-nonce' ] ) ) {
52	+
53	+ if ( !wp_verify_nonce( $_POST[ 'wc-vendors-nonce' ], 'save-shop-settings-admin' ) ) {
54	+ return false;
55	+ }
56	+
57	+ if ( !is_email( $_POST[ 'pv_paypal' ] ) ) {
58	+ $error_msg .= __( 'Your PayPal address is not a valid email address.', 'wcvendors' );
59	+ $error = true;
60	+ } else {
61	+ update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
62	+ }
63	+
64	+ if ( !empty( $_POST[ 'pv_shop_name' ] ) ) {
65	+ $users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
66	+ if ( !empty( $users ) && $users[ 0 ]->ID != $user_id ) {
67	+ $error_msg .= __( 'That shop name is already taken. Your shop name must be unique.', 'wcvendors' );
68	+ $error = true;
69	+ } else {
70	+ update_user_meta( $user_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
71	+ update_user_meta( $user_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
72	+ }
73	+ }
74	+
75	+ if ( isset( $_POST[ 'pv_shop_description' ] ) ) {
76	+ update_user_meta( $user_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
77	+ }
78	+
79	+ if ( isset( $_POST[ 'pv_seller_info' ] ) ) {
80	+ update_user_meta( $user_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
81	+ }
82	+
83	+ do_action( 'wcvendors_shop_settings_admin_saved', $user_id );
84	+
85	+ if ( ! $error ) {
86	+ echo '<div class="updated"><p>';
87	+ echo __( 'Settings saved.', 'wcvendors' );
88	+ echo '</p></div>';
89	+ } else {
90	+ echo '<div class="error"><p>';
91	+ echo $error_msg;
92	+ echo '</p></div>';
93	+ }
94	+ }
95	+ }
96	+
97	+ /**
98	+ *
99	+ *
100	+ * @param unknown $status
101	+ * @param unknown $option
102	+ * @param unknown $value
103	+ *
104	+ * @return unknown
105	+ */
106	+ public static function set_table_option( $status, $option, $value )
107	+ {
108	+ if ( $option == 'orders_per_page' ) {
109	+ return $value;
110	+ }
111	+ }
112	+
113	+
114	+ /**
115	+ *
116	+ */
117	+ public static function add_options()
118	+ {
119	+ global $WCV_Vendor_Order_Page;
120	+
121	+ $args = array(
122	+ 'label' => 'Rows',
123	+ 'default' => 10,
124	+ 'option' => 'orders_per_page'
125	+ );
126	+ add_screen_option( 'per_page', $args );
127	+
128	+ $WCV_Vendor_Order_Page = new WCV_Vendor_Order_Page();
129	+
130	+ }
131	+
132	+
133	+ /**
134	+ * HTML setup for the Orders Page
135	+ */
136	+ public static function orders_page()
137	+ {
138	+ global $woocommerce, $WCV_Vendor_Order_Page;
139	+
140	+ $WCV_Vendor_Order_Page->prepare_items();
141	+
142	+ ?>
143	+ <div class="wrap">
144	+
145	+ <div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
146	+ <h2><?php _e( 'Orders', 'wcvendors' ); ?></h2>
147	+
148	+ <form id="posts-filter" method="get">
149	+
150	+ <input type="hidden" name="page" value="wcv-vendor-orders"/>
151	+ <?php $WCV_Vendor_Order_Page->display() ?>
152	+
153	+ </form>
154	+ <div id="ajax-response"></div>
155	+ <br class="clear"/>
156	+ </div>
157	+
158	+ <?php }
159	+
160	+ } // End WCV_Vendor_Admin_Dashboard
161	+
162	+ if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
163	+
164	+ /**
165	+ * WCV Vendor Order Page
166	+ *
167	+ * @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
168	+ * @package WCVendors
169	+ * @extends WP_List_Table
170	+ */
171	+ class WCV_Vendor_Order_Page extends WP_List_Table
172	+ {
173	+
174	+ public $index;
175	+
176	+ /**
177	+ * can_view_comments
178	+ *
179	+ * @since 1.0.0
180	+ * @access public
181	+ * @var string $can_view_comments permission check for view comments
182	+ */
183	+ public $can_view_comments;
184	+
185	+
186	+ /**
187	+ * can_add_comments
188	+ *
189	+ * @since 1.0.0
190	+ * @access public
191	+ * @var string $can_add_comments permission check for add comments
192	+ */
193	+ public $can_add_comments;
194	+
195	+
196	+ /**
197	+ * __construct function.
198	+ *
199	+ * @access public
200	+ */
201	+ function __construct()
202	+ {
203	+ global $status, $page;
204	+
205	+ $this->index = 0;
206	+
207	+ //Set parent defaults
208	+ parent::__construct( array(
209	+ 'singular' => 'order',
210	+ 'plural' => 'orders',
211	+ 'ajax' => false
212	+ ) );
213	+
214	+ $this->can_view_comments = WC_Vendors::$pv_options->get_option( 'can_view_order_comments' );
215	+ $this->can_add_comments = WC_Vendors::$pv_options->get_option( 'can_submit_order_comments' );
216	+ }
217	+
218	+
219	+ /**
220	+ * column_default function.
221	+ *
222	+ * @access public
223	+ *
224	+ * @param unknown $item
225	+ * @param mixed $column_name
226	+ *
227	+ * @return unknown
228	+ */
229	+ function column_default( $item, $column_name )
230	+ {
231	+ global $wpdb;
232	+
233	+ switch ( $column_name ) {
234	+ case 'order_id' :
235	+ return $item->order_id;
236	+ case 'customer' :
237	+ return $item->customer;
238	+ case 'products' :
239	+ return $item->products;
240	+ case 'total' :
241	+ return $item->total;
242	+ // case 'comments' :
243	+ // return $item->comments;
244	+ case 'date' :
245	+ return $item->date;
246	+ case 'status' :
247	+ return $item->status;
248	+ }
249	+ }
250	+
251	+
252	+ /**
253	+ * column_cb function.
254	+ *
255	+ * @access public
256	+ *
257	+ * @param mixed $item
258	+ *
259	+ * @return unknown
260	+ */
261	+ function column_cb( $item )
262	+ {
263	+ return sprintf(
264	+ '<input type="checkbox" name="%1$s[]" value="%2$s" />',
265	+ /$1%s/
266	+ 'order_id',
267	+ /$2%s/
268	+ $item->order_id
269	+ );
270	+ }
271	+
272	+
273	+ /**
274	+ * get_columns function.
275	+ *
276	+ * @access public
277	+ * @return unknown
278	+ */
279	+ function get_columns()
280	+ {
281	+ $columns = array(
282	+ 'cb' => '<input type="checkbox" />',
283	+ 'order_id' => __( 'Order ID', 'wcvendors' ),
284	+ 'customer' => __( 'Customer', 'wcvendors' ),
285	+ 'products' => __( 'Products', 'wcvendors' ),
286	+ 'total' => __( 'Total', 'wcvendors' ),
287	+ // 'comments' => __( 'Comments to Customer', 'wcvendors' ),
288	+ 'date' => __( 'Date', 'wcvendors' ),
289	+ 'status' => __( 'Shipped', 'wcvendors' ),
290	+ );
291	+
292	+ if ( !$this->can_view_comments ) unset( $columns['comments'] );
293	+
294	+ return $columns;
295	+ }
296	+
297	+
298	+ /**
299	+ * get_sortable_columns function.
300	+ *
301	+ * @access public
302	+ * @return unknown
303	+ */
304	+ function get_sortable_columns()
305	+ {
306	+ $sortable_columns = array(
307	+ 'order_id' => array( 'order_id', false ),
308	+ 'total' => array( 'total', false ),
309	+ 'status' => array( 'status', false ),
310	+ );
311	+
312	+ return $sortable_columns;
313	+ }
314	+
315	+
316	+ /**
317	+ * Get bulk actions
318	+ *
319	+ * @return unknown
320	+ */
321	+ function get_bulk_actions()
322	+ {
323	+ $actions = array(
324	+ 'mark_shipped' => apply_filters( 'wcvendors_mark_shipped_label', __( 'Mark shipped', 'wcvendors' ) ),
325	+ );
326	+
327	+ return $actions;
328	+ }
329	+
330	+
331	+ /**
332	+ * Process bulk actions
333	+ *
334	+ * @return unknown
335	+ */
336	+ function process_bulk_action()
337	+ {
338	+ if ( !isset( $_GET[ 'order_id' ] ) ) return;
339	+
340	+ if (is_array( $_GET[ 'order_id' ] ) ) {
341	+
342	+ $items = array_map( 'intval', $_GET[ 'order_id' ] );
343	+ switch ( $this->current_action() ) {
344	+ case 'mark_shipped':
345	+
346	+ $result = $this->mark_shipped( $items );
347	+
348	+ if ( $result )
349	+ echo '<div class="updated"><p>' . __( 'Orders marked shipped.', 'wcvendors' ) . '</p></div>';
350	+ break;
351	+
352	+ default:
353	+ // code...
354	+ break;
355	+ }
356	+
357	+ } else {
358	+
359	+ if ( !isset( $_GET[ 'action' ] ) ) return;
360	+ }
361	+
362	+
363	+ }
364	+
365	+
366	+ /**
367	+ * Mark orders as shipped
368	+ *
369	+ * @param unknown $ids (optional)
370	+ *
371	+ * @return unknown
372	+ */
373	+ public function mark_shipped( $ids = array() )
374	+ {
375	+ global $woocommerce;
376	+
377	+ $user_id = get_current_user_id();
378	+
379	+ if ( !empty( $ids ) ) {
380	+ foreach ($ids as $order_id ) {
381	+ $shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
382	+ if( !in_array($user_id, $shippers)) {
383	+ $shippers[] = $user_id;
384	+ $mails = $woocommerce->mailer()->get_emails();
385	+ if ( !empty( $mails ) ) {
386	+ $mails[ 'WC_Email_Notify_Shipped' ]->trigger( $order_id, $user_id );
387	+ }
388	+ do_action('wcvendors_vendor_ship', $order_id, $user_id);
389	+ }
390	+ update_post_meta( $order_id, 'wc_pv_shipped', $shippers );
391	+ }
392	+ return true;
393	+ }
394	+ return false;
395	+ }
396	+
397	+
398	+
399	+ /**
400	+ * Get Orders to display in admin
401	+ *
402	+ * @return $orders
403	+ */
404	+ function get_orders() {
405	+
406	+ $user_id = get_current_user_id();
407	+
408	+ $orders = array();
409	+
410	+ $vendor_products = $this->get_vendor_products( $user_id );
411	+
412	+ $products = array();
413	+
414	+ foreach ($vendor_products as $_product) {
415	+ $products[] = $_product->ID;
416	+ }
417	+
418	+ $_orders = $this->get_orders_for_vendor_products( $products );
419	+
420	+ $model_id = 0;
421	+
422	+ if (!empty( $_orders ) ) {
423	+ foreach ( $_orders as $order ) {
424	+
425	+ $order = new WC_Order( $order->order_id );
426	+ $valid_items = WCV_Queries::get_products_for_order( $order->id );
427	+ $valid = array();
428	+
429	+ $items = $order->get_items();
430	+
431	+ foreach ($items as $key => $value) {
432	+ if ( in_array($value['variation_id'], $valid_items) \|\| in_array($value['product_id'], $valid_items)) {
433	+ $valid[] = $value;
434	+ }
435	+ }
436	+
437	+ $products = '';
438	+
439	+ foreach ($valid as $key => $item) {
440	+ $item_meta = new WC_Order_Item_Meta( $item[ 'item_meta' ] );
441	+ // $item_meta = $item_meta->display( false, true );
442	+ $item_meta = $item_meta->get_formatted( );
443	+ $products .= '<strong>'. $item['qty'] . ' x ' . $item['name'] . '</strong><br />';
444	+ foreach ($item_meta as $key => $meta) {
445	+ // Remove the sold by meta key for display
446	+ if (strtolower($key) != 'sold by' ) $products .= $meta[ 'label' ] .' : ' . $meta[ 'value' ]. '<br />';
447	+ }
448	+ }
449	+
450	+ $shippers = (array) get_post_meta( $order->id, 'wc_pv_shipped', true );
451	+ $shipped = in_array($user_id, $shippers) ? 'Yes' : 'No' ;
452	+
453	+ $sum = WCV_Queries::sum_for_orders( array( $order->id ), array('vendor_id' =>get_current_user_id() ) );
454	+ $total = $sum[0]->line_total;
455	+
456	+ $comment_output = '';
457	+
458	+ // Need to fix how form is submitted for adding comments if at all possible.
459	+
460	+ if ( $this->can_view_comments) {
461	+
462	+ $order_notes = $order->get_customer_order_notes();
463	+
464	+ $comment_output .= '<a href="#TB_inline?width=600&height=550&inlineId=order-comment-window-'.$model_id.'" class="thickbox">';
465	+ $comment_output .= sprintf( __( 'Comments (%s)', 'wcvendors' ), count( $order_notes ) );
466	+ $comment_output .= '</a>';
467	+ $comment_output .= '<div id="order-comment-window-'.$model_id.'" style="display:none;">';
468	+ $comment_output .= '<h3>'.__('Comments to Customer', 'wcvendors' ). '</h3>';
469	+
470	+ if ( !empty( $order_notes ) ) {
471	+
472	+ foreach ($order_notes as $order_note) {
473	+ $last_added = human_time_diff( strtotime( $order_note->comment_date_gmt ), current_time( 'timestamp', 1 ) );
474	+ $comment_output .= '<p>';
475	+ $comment_output .= $order_note->comment_content;
476	+ $comment_output .= '<br />';
477	+ $comment_output .= sprintf(__( 'added %s ago', 'wcvendors' ), $last_added );
478	+ $comment_output .= '<br />';
479	+ $comment_output .= '</p>';
480	+ }
481	+
482	+ } else {
483	+ $comment_output .= '<p>'.__('No comments currently to customer.', 'wcvendors' ). '</p>';
484	+ }
485	+
486	+ if ( $this->can_add_comments ) {
487	+ $comment_output .= wp_nonce_field( 'add-comment' );
488	+ $comment_output .= '
489	+ <textarea name="comment_text" style="width:97%"></textarea>
490	+ <input type="hidden" name="order_id" value="'. $order->id .'">
491	+ <input type="hidden" name="action" value="add_comment">
492	+ <input class="btn btn-large btn-block" type="submit" name="submit_comment" value="'.__( 'Add comment', 'wcvendors' ).'">';
493	+ }
494	+
495	+ $comment_output .= '</div>';
496	+
497	+ }
498	+
499	+ $order_items = array();
500	+ $order_items[ 'order_id' ] = $order->id;
501	+ $order_items[ 'customer' ] = $order->get_formatted_shipping_address();
502	+ $order_items[ 'products' ] = $products;
503	+ $order_items[ 'total' ] = woocommerce_price( $total );
504	+ $order_items[ 'date' ] = date_i18n( wc_date_format(), strtotime( $order->order_date ) );
505	+ // $order_items[ 'comments' ] = $comment_output;
506	+ $order_items[ 'status' ] = $shipped;
507	+
508	+ $orders[] = (object) $order_items;
509	+
510	+ $model_id++;
511	+ }
512	+ }
513	+ return $orders;
514	+
515	+ }
516	+
517	+
518	+ /**
519	+ * Get the vendor products sold
520	+ *
521	+ * @param $user_id - the user_id to get the products of
522	+ *
523	+ * @return unknown
524	+ */
525	+ public function get_vendor_products( $user_id )
526	+ {
527	+ global $wpdb;
528	+
529	+ $vendor_products = array();
530	+ $sql = '';
531	+
532	+ $sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} AND status != 'reversed' GROUP BY product_id";
533	+
534	+ $results = $wpdb->get_results( $sql );
535	+
536	+ foreach ( $results as $value ) {
537	+ $ids[ ] = $value->product_id;
538	+ }
539	+
540	+ if ( !empty( $ids ) ) {
541	+ $vendor_products = get_posts(
542	+ array(
543	+ 'numberposts' => -1,
544	+ 'orderby' => 'post_date',
545	+ 'post_type' => array( 'product', 'product_variation' ),
546	+ 'order' => 'DESC',
547	+ 'include' => $ids
548	+ )
549	+ );
550	+ }
551	+
552	+ return $vendor_products;
553	+ }
554	+
555	+
556	+ /**
557	+ * All orders for a specific product
558	+ *
559	+ * @param array $product_ids
560	+ * @param array $args (optional)
561	+ *
562	+ * @return object
563	+ */
564	+ public function get_orders_for_vendor_products( array $product_ids, array $args = array() )
565	+ {
566	+ global $wpdb;
567	+
568	+ if ( empty( $product_ids ) ) return false;
569	+
570	+ $defaults = array(
571	+ 'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
572	+ );
573	+
574	+ $args = wp_parse_args( $args, $defaults );
575	+
576	+
577	+ $sql = "
578	+ SELECT order_id
579	+ FROM {$wpdb->prefix}pv_commission as order_items
580	+ WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
581	+ AND status != 'reversed'
582	+ ";
583	+
584	+ if ( !empty( $args[ 'vendor_id' ] ) ) {
585	+ $sql .= "
586	+ AND vendor_id = {$args['vendor_id']}
587	+ ";
588	+ }
589	+
590	+ $sql .= "
591	+ GROUP BY order_id
592	+ ORDER BY time DESC
593	+ ";
594	+
595	+ $orders = $wpdb->get_results( $sql );
596	+
597	+ return $orders;
598	+ }
599	+
600	+
601	+
602	+ /**
603	+ * prepare_items function.
604	+ *
605	+ * @access public
606	+ */
607	+ function prepare_items()
608	+ {
609	+
610	+
611	+ /**
612	+ * Init column headers
613	+ */
614	+ $this->_column_headers = $this->get_column_info();
615	+
616	+
617	+ /**
618	+ * Process bulk actions
619	+ */
620	+ $this->process_bulk_action();
621	+
622	+ /**
623	+ * Get items
624	+ */
625	+
626	+ $this->items = $this->get_orders();
627	+
628	+ /**
629	+ * Pagination
630	+ */
631	+ }
632	+
633	+
634	+ }

trunk/classes/admin/class-vendor-applicants.php ADDED Viewed

	@@ -0,0 +1,103 @@


1	+ <?php
2	+
3	+ /**
4	+ *
5	+ */
6	+ class WCV_Vendor_Applicants
7	+ {
8	+
9	+ function __construct()
10	+ {
11	+ add_filter( 'user_row_actions', array( $this, 'user_row_actions' ), 10, 2 );
12	+ add_filter( 'load-users.php', array( $this, 'user_row_actions_commit' ) );
13	+ }
14	+
15	+ /**
16	+ *
17	+ *
18	+ * @param unknown $actions
19	+ * @param unknown $user_object
20	+ *
21	+ * @return unknown
22	+ */
23	+ function user_row_actions( $actions, $user_object )
24	+ {
25	+ if ( !empty( $_GET[ 'role' ] ) && $_GET[ 'role' ] == 'pending_vendor' ) {
26	+ $actions[ 'approve_vendor' ] = "<a href='?role=pending_vendor&action=approve_vendor&user_id=" . $user_object->ID . "'>" . __( 'Approve', 'cgc_ub' ) . "</a>";
27	+ $actions[ 'deny_vendor' ] = "<a href='?role=pending_vendor&action=deny_vendor&user_id=" . $user_object->ID . "'>" . __( 'Deny', 'cgc_ub' ) . "</a>";
28	+ }
29	+
30	+ return $actions;
31	+ }
32	+
33	+
34	+ /**
35	+ *
36	+ */
37	+ public function user_row_actions_commit()
38	+ {
39	+ if ( !empty( $_GET[ 'action' ] ) && !empty( $_GET[ 'user_id' ] ) ) {
40	+
41	+ $wp_user_object = new WP_User( (int) $_GET[ 'user_id' ] );
42	+
43	+ switch ( $_GET[ 'action' ] ) {
44	+ case 'approve_vendor':
45	+ $role = 'vendor';
46	+ add_action( 'admin_notices', array( $this, 'approved' ) );
47	+ do_action( 'wcvendors_approve_vendor', $wp_user_object );
48	+ break;
49	+
50	+ case 'deny_vendor':
51	+ $role = 'subscriber';
52	+ add_action( 'admin_notices', array( $this, 'denied' ) );
53	+ do_action( 'wcvendors_deny_vendor', $wp_user_object );
54	+ break;
55	+
56	+ default:
57	+ // code...
58	+ break;
59	+ }
60	+
61	+ $wp_user_object->set_role( $role );
62	+
63	+ }
64	+ }
65	+
66	+
67	+ /**
68	+ *
69	+ */
70	+ public function denied()
71	+ {
72	+ echo '<div class="updated">';
73	+ echo '<p>' . __( 'Vendor has been <b>denied</b>.', 'wcvendors' ) . '</p>';
74	+ echo '</div>';
75	+ }
76	+
77	+
78	+ /**
79	+ *
80	+ */
81	+ public function approved()
82	+ {
83	+ echo '<div class="updated">';
84	+ echo '<p>' . __( 'Vendor has been <b>approved</b>.', 'wcvendors' ) . '</p>';
85	+ echo '</div>';
86	+ }
87	+
88	+
89	+ /**
90	+ *
91	+ *
92	+ * @param unknown $values
93	+ *
94	+ * @return unknown
95	+ */
96	+ public function show_pending_vendors_link( $values )
97	+ {
98	+ $values[ 'pending_vendors' ] = '<a href="?role=asd">' . __( 'Pending Vendors', 'wcvendors' ) . ' <span class="count">(3)</span></a>';
99	+
100	+ return $values;
101	+ }
102	+
103	+ }

trunk/classes/admin/class-vendor-reports.php ADDED Viewed

	@@ -0,0 +1,121 @@


1	+ <?php
2	+
3	+ /**
4	+ * Report views
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Vendor_Reports
12	+ {
13	+
14	+
15	+ /**
16	+ * Constructor
17	+ */
18	+ function __construct()
19	+ {
20	+ $this->vendor_id = !current_user_can( 'manage_woocommerce' ) ? wp_get_current_user()->ID : '';
21	+ if ( !empty ( $this->vendor_id ) ) {
22	+ add_filter( 'woocommerce_reports_charts', array( $this, 'filter_tabs' ), 99 );
23	+ add_filter( 'woocommerce_json_search_found_products', array( $this, 'filter_products_json' ) );
24	+ add_filter( 'woocommerce_reports_product_sales_order_items', array( $this, 'filter_products' ) );
25	+ add_filter( 'woocommerce_reports_top_sellers_order_items', array( $this, 'filter_products' ) );
26	+ add_filter( 'woocommerce_reports_top_earners_order_items', array( $this, 'filter_products' ) );
27	+ }
28	+
29	+ }
30	+
31	+ /**
32	+ * Show only reports that are useful to a vendor
33	+ *
34	+ * @param array $tabs
35	+ *
36	+ * @return array
37	+ */
38	+ public function filter_tabs( $tabs )
39	+ {
40	+ global $woocommerce;
41	+
42	+ $remove = array(
43	+ 'woocommerce_sales_overview',
44	+ 'woocommerce_daily_sales',
45	+ 'woocommerce_monthly_sales',
46	+ 'woocommerce_monthly_taxes',
47	+ 'woocommerce_category_sales',
48	+ 'woocommerce_coupon_sales',
49	+ );
50	+
51	+ $reports = $tabs[ 'orders' ][ 'reports' ];
52	+
53	+ foreach ( $reports as $key => $chart ) {
54	+ if ( $key == 'coupon_usage' ) {
55	+ unset( $tabs[ 'orders' ][ 'reports' ][ $key ] );
56	+ }
57	+ }
58	+
59	+ // These are admin tabs
60	+ $return = array(
61	+ 'orders' => $tabs[ 'orders' ]
62	+ );
63	+
64	+ return $return;
65	+ }
66	+
67	+
68	+ /**
69	+ * Filter products based on current vendor
70	+ *
71	+ * @param unknown $orders
72	+ *
73	+ * @return unknown
74	+ */
75	+ public function filter_products( $orders )
76	+ {
77	+ $products = WCV_Vendors::get_vendor_products( $this->vendor_id );
78	+
79	+ $ids = array();
80	+ foreach ( $products as $product ) {
81	+ $ids[ ] = ( $product->ID );
82	+ }
83	+
84	+ foreach ( $orders as $key => $order ) {
85	+
86	+ if ( !in_array( $order->product_id, $ids ) ) {
87	+ unset( $orders[ $key ] );
88	+ continue;
89	+ } else {
90	+ if ( !empty( $order->line_total ) ) {
91	+ $orders[ $key ]->line_total = WCV_Commission::calculate_commission( $order->line_total, $order->product_id, $order, $order->qty );
92	+ }
93	+ }
94	+
95	+ }
96	+
97	+ return $orders;
98	+ }
99	+
100	+
101	+ /**
102	+ *
103	+ *
104	+ * @param unknown $products
105	+ *
106	+ * @return unknown
107	+ */
108	+ public function filter_products_json( $products )
109	+ {
110	+ $vendor_products = WCV_Vendors::get_vendor_products( $this->vendor_id );
111	+
112	+ $ids = array();
113	+ foreach ( $vendor_products as $vendor_product ) {
114	+ $ids[ $vendor_product->ID ] = $vendor_product->post_title;
115	+ }
116	+
117	+ return array_intersect_key( $products, $ids );
118	+ }
119	+
120	+
121	+ }

trunk/classes/admin/emails/class-emails.php ADDED Viewed

	@@ -0,0 +1,151 @@


1	+ <?php
2	+
3	+ if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
4	+
5	+ /**
6	+ *
7	+ *
8	+ * @author Matt Gates <http://mgates.me>
9	+ * @package
10	+ */
11	+
12	+
13	+ class WCV_Emails
14	+ {
15	+
16	+
17	+ /**
18	+ *
19	+ */
20	+ function __construct()
21	+ {
22	+ add_filter( 'woocommerce_email_classes', array( $this, 'check_items' ) );
23	+ add_filter( 'woocommerce_resend_order_emails_available', array( $this, 'order_action' ) );
24	+ add_filter( 'woocommerce_order_product_title', array( 'WCV_Emails', 'show_vendor_in_email' ), 10, 2 );
25	+ add_action( 'set_user_role', array( $this, 'application_status_email' ), 10, 2 );
26	+ add_action( 'transition_post_status', array( $this, 'trigger_new_product' ), 10, 3 );
27	+
28	+ add_filter( 'woocommerce_email_recipient_low_stock', array( $this, 'vendor_stock_email'), 10, 2 );
29	+ add_filter( 'woocommerce_email_recipient_no_stock', array( $this, 'vendor_stock_email'), 10, 2 );
30	+ add_filter( 'woocommerce_email_recipient_backorder', array( $this, 'vendor_stock_email'), 10, 2 );
31	+ }
32	+
33	+ public function trigger_new_product( $from, $to, $post )
34	+ {
35	+ global $woocommerce;
36	+
37	+ if ( $from != $to && $post->post_status == 'pending' && WCV_Vendors::is_vendor( $post->post_author ) ) {
38	+ $mails = $woocommerce->mailer()->get_emails();
39	+ if ( !empty( $mails ) ) {
40	+ $mails[ 'WC_Email_Notify_Admin' ]->trigger( $post->post_id, $post );
41	+ }
42	+ }
43	+ }
44	+
45	+
46	+ /**
47	+ *
48	+ *
49	+ * @param unknown $user_id
50	+ * @param unknown $role
51	+ */
52	+ function application_status_email( $user_id, $role )
53	+ {
54	+ global $woocommerce;
55	+
56	+ if ( !empty( $_POST[ 'apply_for_vendor' ] ) \|\| ( !empty( $_GET[ 'action' ] ) && ( $_GET[ 'action' ] == 'approve_vendor' \|\| $_GET[ 'action' ] == 'deny_vendor' ) ) ) {
57	+
58	+ if ( $role == 'pending_vendor' ) {
59	+ $status = __( 'pending', 'wcvendors' );
60	+ } else if ( $role == 'vendor' ) {
61	+ $status = __( 'approved', 'wcvendors' );
62	+ } else if ( !empty( $_GET[ 'action' ] ) && $_GET[ 'action' ] == 'deny_vendor' ) {
63	+ $status = __( 'denied', 'wcvendors' );
64	+ }
65	+
66	+ $mails = $woocommerce->mailer()->get_emails();
67	+
68	+ if ( isset( $status ) && !empty( $mails ) ) {
69	+ $mails[ 'WC_Email_Approve_Vendor' ]->trigger( $user_id, $status );
70	+ }
71	+ }
72	+ }
73	+
74	+
75	+ /**
76	+ *
77	+ *
78	+ * @param unknown $name
79	+ * @param unknown $_product
80	+ *
81	+ * @return unknown
82	+ */
83	+ function show_vendor_in_email( $name, $_product )
84	+ {
85	+ $product = get_post( $_product->id );
86	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
87	+ $sold_by = WCV_Vendors::is_vendor( $product->post_author )
88	+ ? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $product->post_author ), WCV_Vendors::get_vendor_sold_by( $product->post_author ) )
89	+ : get_bloginfo( 'name' );
90	+
91	+ $name .= '<small class="wcvendors_sold_by_in_email"><br />' . apply_filters('wcvendors_sold_by_in_email', $sold_by_label ). $sold_by . '</small><br />';
92	+
93	+ return $name;
94	+ }
95	+
96	+
97	+ /**
98	+ *
99	+ *
100	+ * @param unknown $available_emails
101	+ *
102	+ * @return unknown
103	+ */
104	+ public function order_action( $available_emails )
105	+ {
106	+ $available_emails[ ] = 'vendor_new_order';
107	+
108	+ return $available_emails;
109	+ }
110	+
111	+
112	+ /**
113	+ *
114	+ *
115	+ * @param unknown $emails
116	+ *
117	+ * @return unknown
118	+ */
119	+ public function check_items( $emails )
120	+ {
121	+ require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-admin.php';
122	+ require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-vendor.php';
123	+ require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-approve-vendor.php';
124	+ require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-shipped.php';
125	+
126	+ $emails[ 'WC_Email_Notify_Vendor' ] = new WC_Email_Notify_Vendor();
127	+ $emails[ 'WC_Email_Approve_Vendor' ] = new WC_Email_Approve_Vendor();
128	+ $emails[ 'WC_Email_Notify_Admin' ] = new WC_Email_Notify_Admin();
129	+ $emails[ 'WC_Email_Notify_Shipped' ] = new WC_Email_Notify_Shipped();
130	+
131	+ return $emails;
132	+ }
133	+
134	+ /**
135	+ * Add the vendor email to the low stock emails.
136	+ *
137	+ */
138	+ public function vendor_stock_email( $emails, $product ) {
139	+
140	+ if ( WCV_Vendors::is_vendor( $product->post->post_author ) ) {
141	+ $vendor_data = get_userdata( $product->post->post_author );
142	+ $vendor_email = $vendor_data->user_email;
143	+ $emails .= ','.$vendor_email;
144	+ }
145	+
146	+ return $emails;
147	+
148	+ }
149	+
150	+
151	+ }

trunk/classes/admin/emails/class-wc-approve-vendor.php ADDED Viewed

	@@ -0,0 +1,165 @@


1	+ <?php
2	+
3	+ if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
4	+
5	+ /**
6	+ * New Order Email
7	+ *
8	+ * An email sent to the admin when a new order is received/paid for.
9	+ *
10	+ * @class WC_Email_Approve_Vendor
11	+ * @version 2.0.0
12	+ * @extends WC_Email
13	+ * @author WooThemes
14	+ * @package WooCommerce/Classes/Emails
15	+ */
16	+
17	+
18	+ class WC_Email_Approve_Vendor extends WC_Email
19	+ {
20	+
21	+
22	+ /**
23	+ * Constructor
24	+ */
25	+ function __construct()
26	+ {
27	+ $this->id = 'vendor_application';
28	+ $this->title = __( 'Vendor Application', 'wcvendors' );
29	+ $this->description = __( 'Vendor application will either be approved, denied, or pending.', 'wcvendors' );
30	+
31	+ $this->heading = __( 'Application {status}', 'wcvendors' );
32	+ $this->subject = __( '[{blogname}] Your vendor application has been {status}', 'wcvendors' );
33	+
34	+ $this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
35	+ $this->template_html = 'application-status.php';
36	+ $this->template_plain = 'application-status.php';
37	+
38	+ // Call parent constuctor
39	+ parent::__construct();
40	+
41	+ // Other settings
42	+ $this->recipient = $this->get_option( 'recipient' );
43	+
44	+ if ( !$this->recipient )
45	+ $this->recipient = get_option( 'admin_email' );
46	+ }
47	+
48	+ /**
49	+ * trigger function.
50	+ *
51	+ * @access public
52	+ * @return void
53	+ *
54	+ * @param unknown $order_id
55	+ */
56	+ function trigger( $user_id, $status )
57	+ {
58	+ if ( !$this->is_enabled() ) return;
59	+
60	+ $this->find[ ] = '{status}';
61	+ $this->replace[ ] = $status;
62	+
63	+ $this->status = $status;
64	+
65	+ $this->user = get_userdata( $user_id );
66	+ $user_email = $this->user->user_email;
67	+
68	+ $this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
69	+
70	+ if ( $status == __( 'pending', 'wcvendors' ) ) {
71	+ $this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
72	+ }
73	+ }
74	+
75	+ /**
76	+ * get_content_html function.
77	+ *
78	+ * @access public
79	+ * @return string
80	+ */
81	+ function get_content_html()
82	+ {
83	+ ob_start();
84	+ wc_get_template( $this->template_html, array(
85	+ 'status' => $this->status,
86	+ 'user' => $this->user,
87	+ 'email_heading' => $this->get_heading()
88	+ ), 'woocommerce/emails', $this->template_base );
89	+
90	+ return ob_get_clean();
91	+ }
92	+
93	+
94	+ /**
95	+ * get_content_plain function.
96	+ *
97	+ * @access public
98	+ * @return string
99	+ */
100	+ function get_content_plain()
101	+ {
102	+ ob_start();
103	+ wc_get_template( $this->template_plain, array(
104	+ 'status' => $this->status,
105	+ 'user' => $this->user,
106	+ 'email_heading' => $this->get_heading()
107	+ ), 'woocommerce/emails', $this->template_base );
108	+
109	+ return ob_get_clean();
110	+ }
111	+
112	+
113	+ /**
114	+ * Initialise Settings Form Fields
115	+ *
116	+ * @access public
117	+ * @return void
118	+ */
119	+ function init_form_fields()
120	+ {
121	+ $this->form_fields = array(
122	+ 'enabled' => array(
123	+ 'title' => __( 'Enable/Disable', 'wcvendors' ),
124	+ 'type' => 'checkbox',
125	+ 'label' => __( 'Enable this email notification', 'wcvendors' ),
126	+ 'default' => 'yes'
127	+ ),
128	+ 'recipient' => array(
129	+ 'title' => __( 'Recipient(s)', 'woocommerce' ),
130	+ 'type' => 'text',
131	+ 'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'wcvendors' ), esc_attr( get_option( 'admin_email' ) ) ),
132	+ 'placeholder' => '',
133	+ 'default' => ''
134	+ ),
135	+ 'subject' => array(
136	+ 'title' => __( 'Subject', 'wcvendors' ),
137	+ 'type' => 'text',
138	+ 'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
139	+ 'placeholder' => '',
140	+ 'default' => ''
141	+ ),
142	+ 'heading' => array(
143	+ 'title' => __( 'Email Heading', 'wcvendors' ),
144	+ 'type' => 'text',
145	+ 'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
146	+ 'placeholder' => '',
147	+ 'default' => ''
148	+ ),
149	+ 'email_type' => array(
150	+ 'title' => __( 'Email type', 'wcvendors' ),
151	+ 'type' => 'select',
152	+ 'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
153	+ 'default' => 'html',
154	+ 'class' => 'email_type',
155	+ 'options' => array(
156	+ 'plain' => __( 'Plain text', 'wcvendors' ),
157	+ 'html' => __( 'HTML', 'wcvendors' ),
158	+ 'multipart' => __( 'Multipart', 'wcvendors' ),
159	+ )
160	+ )
161	+ );
162	+ }
163	+
164	+
165	+ }

trunk/classes/admin/emails/class-wc-notify-admin.php ADDED Viewed

	@@ -0,0 +1,176 @@


1	+ <?php
2	+
3	+ if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
4	+
5	+ /**
6	+ * New Order Email
7	+ *
8	+ * An email sent to the admin when a new product is created.
9	+ *
10	+ * @class WC_Email_Notify_Admin
11	+ * @version 2.0.0
12	+ * @extends WC_Email
13	+ * @author WooThemes
14	+ * @package WooCommerce/Classes/Emails
15	+ */
16	+
17	+
18	+ class WC_Email_Notify_Admin extends WC_Email
19	+ {
20	+
21	+
22	+ /**
23	+ * Constructor
24	+ */
25	+ function __construct()
26	+ {
27	+ $this->id = 'admin_new_vendor_product';
28	+ $this->title = __( 'New Vendor Product', 'wcvendors' );
29	+ $this->description = __( 'New order emails are sent when a new product is submitted by a vendor', 'wcvendors' );
30	+
31	+ $this->heading = __( 'New product submitted: {product_name}', 'wcvendors' );
32	+ $this->subject = __( '[{blogname}] New product submitted by {vendor_name} - {product_name}', 'wcvendors' );
33	+
34	+ $this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
35	+ $this->template_html = 'new-product.php';
36	+ $this->template_plain = 'new-product.php';
37	+
38	+ // Triggers for this email
39	+ add_action( 'pending_product', array( $this, 'trigger' ), 10, 2 );
40	+ add_action( 'pending_product_variation', array( $this, 'trigger' ), 10, 2 );
41	+
42	+ // Call parent constuctor
43	+ parent::__construct();
44	+
45	+ // Other settings
46	+ $this->recipient = $this->get_option( 'recipient' );
47	+
48	+ if ( !$this->recipient )
49	+ $this->recipient = get_option( 'admin_email' );
50	+ }
51	+
52	+
53	+ /**
54	+ * trigger function.
55	+ *
56	+ * @access public
57	+ * @return void
58	+ *
59	+ * @param unknown $order_id
60	+ */
61	+ function trigger( $id, $post )
62	+ {
63	+
64	+ // Ensure that the post author is a vendor
65	+ if ( !WCV_Vendors::is_vendor( $post->post_author ) ) {
66	+ return;
67	+ }
68	+
69	+ if ( !$this->is_enabled() ) return;
70	+
71	+ $this->find[ ] = '{product_name}';
72	+ $this->product_name = $post->post_title;
73	+ $this->replace[ ] = $this->product_name;
74	+
75	+ $this->find[ ] = '{vendor_name}';
76	+ $this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
77	+ $this->replace[ ] = $this->vendor_name;
78	+
79	+ $this->post_id = $post->ID;
80	+
81	+ $this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
82	+ }
83	+
84	+ /**
85	+ * get_content_html function.
86	+ *
87	+ * @access public
88	+ * @return string
89	+ */
90	+ function get_content_html()
91	+ {
92	+ ob_start();
93	+ wc_get_template( $this->template_html, array(
94	+ 'product_name' => $this->product_name,
95	+ 'vendor_name' => $this->vendor_name,
96	+ 'post_id' => $this->post_id,
97	+ 'email_heading' => $this->get_heading()
98	+ ), 'woocommerce/emails', $this->template_base );
99	+
100	+ return ob_get_clean();
101	+ }
102	+
103	+
104	+ /**
105	+ * get_content_plain function.
106	+ *
107	+ * @access public
108	+ * @return string
109	+ */
110	+ function get_content_plain()
111	+ {
112	+ ob_start();
113	+ wc_get_template( $this->template_plain, array(
114	+ 'product_name' => $this->product_name,
115	+ 'vendor_name' => $this->vendor_name,
116	+ 'post_id' => $this->post_id,
117	+ 'email_heading' => $this->get_heading()
118	+ ), 'woocommerce/emails', $this->template_base );
119	+
120	+ return ob_get_clean();
121	+ }
122	+
123	+
124	+ /**
125	+ * Initialise Settings Form Fields
126	+ *
127	+ * @access public
128	+ * @return void
129	+ */
130	+ function init_form_fields()
131	+ {
132	+ $this->form_fields = array(
133	+ 'enabled' => array(
134	+ 'title' => __( 'Enable/Disable', 'wcvendors' ),
135	+ 'type' => 'checkbox',
136	+ 'label' => __( 'Enable this email notification', 'wcvendors' ),
137	+ 'default' => 'yes'
138	+ ),
139	+ 'recipient' => array(
140	+ 'title' => __( 'Recipient(s)', 'woocommerce' ),
141	+ 'type' => 'text',
142	+ 'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'woocommerce' ), esc_attr( get_option( 'admin_email' ) ) ),
143	+ 'placeholder' => '',
144	+ 'default' => ''
145	+ ),
146	+ 'subject' => array(
147	+ 'title' => __( 'Subject', 'wcvendors' ),
148	+ 'type' => 'text',
149	+ 'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
150	+ 'placeholder' => '',
151	+ 'default' => ''
152	+ ),
153	+ 'heading' => array(
154	+ 'title' => __( 'Email Heading', 'wcvendors' ),
155	+ 'type' => 'text',
156	+ 'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
157	+ 'placeholder' => '',
158	+ 'default' => ''
159	+ ),
160	+ 'email_type' => array(
161	+ 'title' => __( 'Email type', 'wcvendors' ),
162	+ 'type' => 'select',
163	+ 'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
164	+ 'default' => 'html',
165	+ 'class' => 'email_type',
166	+ 'options' => array(
167	+ 'plain' => __( 'Plain text', 'wcvendors' ),
168	+ 'html' => __( 'HTML', 'wcvendors' ),
169	+ 'multipart' => __( 'Multipart', 'wcvendors' ),
170	+ )
171	+ )
172	+ );
173	+ }
174	+
175	+
176	+ }

trunk/classes/admin/emails/class-wc-notify-shipped.php ADDED Viewed

	@@ -0,0 +1,198 @@


1	+ <?php
2	+
3	+ if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
4	+
5	+ /**
6	+ * New Order Email
7	+ *
8	+ * An email sent to the admin when a new product is created.
9	+ *
10	+ * @class WC_Email_Notify_Shipped
11	+ * @version 2.0.0
12	+ * @extends WC_Email
13	+ * @author WooThemes
14	+ * @package WooCommerce/Classes/Emails
15	+ */
16	+
17	+
18	+ class WC_Email_Notify_Shipped extends WC_Email
19	+ {
20	+
21	+
22	+ /**
23	+ * Constructor
24	+ */
25	+ function __construct()
26	+ {
27	+ $this->id = 'vendor_notify_shipped';
28	+ $this->title = __( 'Vendor has shipped', 'wcvendors' );
29	+ $this->description = __( 'An email is sent when a vendor has marked one of their orders as shipped.', 'wcvendors' );
30	+
31	+ $this->heading = __( 'Your order has been shipped', 'wcvendors' );
32	+ $this->subject = __( '[{blogname}] Your order has been shipped ({order_number}) - {order_date}', 'wcvendors' );
33	+
34	+ $this->template_html = 'notify-vendor-shipped.php';
35	+ $this->template_plain = 'notify-vendor-shipped.php';
36	+ $this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
37	+
38	+ // Call parent constuctor
39	+ parent::__construct();
40	+ }
41	+
42	+
43	+ /**
44	+ * trigger function.
45	+ *
46	+ * @access public
47	+ * @return void
48	+ *
49	+ * @param unknown $order_id
50	+ */
51	+ function trigger( $order_id, $vendor_id )
52	+ {
53	+ $this->object = new WC_Order( $order_id );
54	+ $this->current_vendor = $vendor_id;
55	+
56	+ $this->find[ ] = '{order_date}';
57	+ $this->replace[ ] = date_i18n( woocommerce_date_format(), strtotime( $this->object->order_date ) );
58	+
59	+ $this->find[ ] = '{order_number}';
60	+ $this->replace[ ] = $this->object->get_order_number();
61	+
62	+ if ( !$this->is_enabled() ) return;
63	+
64	+ add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
65	+ add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
66	+ $this->send( $this->object->billing_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
67	+ remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
68	+ remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
69	+ }
70	+
71	+
72	+ /**
73	+ *
74	+ *
75	+ * @param unknown $items
76	+ * @param unknown $order
77	+ *
78	+ * @return unknown
79	+ */
80	+ public function check_items( $items, $order )
81	+ {
82	+ foreach ( $items as $key => $product ) {
83	+
84	+ if ( empty( $product[ 'product_id' ] ) ) {
85	+ unset( $items[ $key ] );
86	+ continue;
87	+ }
88	+
89	+ $author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
90	+
91	+ if ( $this->current_vendor != $author ) {
92	+ unset( $items[ $key ] );
93	+ continue;
94	+ }
95	+
96	+ }
97	+
98	+ return $items;
99	+ }
100	+
101	+ /**
102	+ *
103	+ *
104	+ * @param unknown $total_rows
105	+ * @param unknown $order
106	+ *
107	+ * @return unknown
108	+ */
109	+ public function check_order_totals( $total_rows, $order )
110	+ {
111	+ $return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
112	+ $return[ 'cart_subtotal' ][ 'label' ] = __( 'Subtotal:', 'wcvendors' );
113	+
114	+ return $return;
115	+ }
116	+
117	+ /**
118	+ * get_content_html function.
119	+ *
120	+ * @access public
121	+ * @return string
122	+ */
123	+ function get_content_html()
124	+ {
125	+ ob_start();
126	+ wc_get_template( $this->template_html, array(
127	+ 'order' => $this->object,
128	+ 'email_heading' => $this->get_heading()
129	+ ), 'woocommerce/emails', $this->template_base );
130	+
131	+ return ob_get_clean();
132	+ }
133	+
134	+
135	+ /**
136	+ * get_content_plain function.
137	+ *
138	+ * @access public
139	+ * @return string
140	+ */
141	+ function get_content_plain()
142	+ {
143	+ ob_start();
144	+ wc_get_template( $this->template_plain, array(
145	+ 'order' => $this->object,
146	+ 'email_heading' => $this->get_heading()
147	+ ), 'woocommerce/emails', $this->template_base );
148	+
149	+ return ob_get_clean();
150	+ }
151	+
152	+
153	+ /**
154	+ * Initialise Settings Form Fields
155	+ *
156	+ * @access public
157	+ * @return void
158	+ */
159	+ function init_form_fields()
160	+ {
161	+ $this->form_fields = array(
162	+ 'enabled' => array(
163	+ 'title' => __( 'Enable/Disable', 'wcvendors' ),
164	+ 'type' => 'checkbox',
165	+ 'label' => __( 'Enable this email notification', 'wcvendors' ),
166	+ 'default' => 'yes'
167	+ ),
168	+ 'subject' => array(
169	+ 'title' => __( 'Subject', 'wcvendors' ),
170	+ 'type' => 'text',
171	+ 'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
172	+ 'placeholder' => '',
173	+ 'default' => ''
174	+ ),
175	+ 'heading' => array(
176	+ 'title' => __( 'Email Heading', 'wcvendors' ),
177	+ 'type' => 'text',
178	+ 'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
179	+ 'placeholder' => '',
180	+ 'default' => ''
181	+ ),
182	+ 'email_type' => array(
183	+ 'title' => __( 'Email type', 'wcvendors' ),
184	+ 'type' => 'select',
185	+ 'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
186	+ 'default' => 'html',
187	+ 'class' => 'email_type',
188	+ 'options' => array(
189	+ 'plain' => __( 'Plain text', 'wcvendors' ),
190	+ 'html' => __( 'HTML', 'wcvendors' ),
191	+ 'multipart' => __( 'Multipart', 'wcvendors' ),
192	+ )
193	+ )
194	+ );
195	+ }
196	+
197	+
198	+ }

trunk/classes/admin/emails/class-wc-notify-vendor.php ADDED Viewed

	@@ -0,0 +1,293 @@


1	+ <?php
2	+
3	+ if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
4	+
5	+ /**
6	+ * New Order Email
7	+ *
8	+ * An email sent to the vendor when a new order is received/paid for.
9	+ *
10	+ * @class WC_Email_Notify_Vendor
11	+ * @version 2.0.0
12	+ * @extends WC_Email
13	+ * @author WooThemes
14	+ * @package WooCommerce/Classes/Emails
15	+ */
16	+
17	+
18	+ class WC_Email_Notify_Vendor extends WC_Email
19	+ {
20	+
21	+ /**
22	+ * Constructor
23	+ */
24	+ function __construct()
25	+ {
26	+ $this->id = 'vendor_new_order';
27	+ $this->title = __( 'Notify vendors', 'wcvendors' );
28	+ $this->description = __( 'New order emails are sent when an order is received/paid by a customer.', 'wcvendors' );
29	+
30	+ $this->heading = __( 'New customer order', 'wcvendors' );
31	+ $this->subject = __( '[{blogname}] New customer order ({order_number}) - {order_date}', 'wcvendors' );
32	+
33	+ $this->template_html = 'vendor-new-order.php';
34	+ $this->template_plain = 'vendor-new-order.php';
35	+ $this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
36	+
37	+ // #216 is broken. Code below is from that. The filter is probably the culprit.
38	+ //$completed_statuses = apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ); // #216
39	+ //foreach ( $completed_statuses as $status ) {
40	+ //add_action( 'woocommerce_order_status_pending_to_{$status}_notification', array( $this, 'trigger' ) );
41	+ //add_action( 'woocommerce_order_status_failed_to_{$status}_notification', array( $this, 'trigger' ) );
42	+ //add_action( 'woocommerce_order_status_on-hold_to_{$status}_notification', array( $this, 'trigger' ) );
43	+ //}
44	+ // end #216
45	+
46	+ // Triggers for this email
47	+ add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ) );
48	+ add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ) );
49	+ add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ) );
50	+ add_action( 'woocommerce_order_status_failed_to_completed_notification', array( $this, 'trigger' ) );
51	+ add_action( 'woocommerce_order_status_on-hold_to_processing_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
52	+ add_action( 'woocommerce_order_status_on-hold_to_completed_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
53	+ $this->recipient = get_option( 'admin_email' );
54	+
55	+ // Call parent constuctor
56	+ parent::__construct();
57	+
58	+ }
59	+
60	+
61	+ /**
62	+ * trigger function.
63	+ *
64	+ * @access public
65	+ * @return void
66	+ *
67	+ * @param unknown $order_id
68	+ */
69	+ function trigger( $order_id )
70	+ {
71	+ global $woocommerce;
72	+
73	+ if ( $order_id ) {
74	+ $this->object = new WC_Order( $order_id );
75	+
76	+ $this->find[ ] = '{order_date}';
77	+ $this->replace[ ] = date_i18n( woocommerce_date_format(), strtotime( $this->object->order_date ) );
78	+
79	+ $this->find[ ] = '{order_number}';
80	+ $this->replace[ ] = $this->object->get_order_number();
81	+
82	+ }
83	+
84	+ if ( !$this->is_enabled() ) return;
85	+
86	+ $vendors = $this->get_vendors( $this->object );
87	+
88	+ if ( empty( $vendors ) ) return;
89	+
90	+ add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
91	+ add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
92	+ foreach ( $vendors as $user_id => $user_email ) {
93	+ $this->current_vendor = $user_id;
94	+ $this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
95	+ }
96	+ remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
97	+ remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
98	+
99	+ }
100	+
101	+
102	+ /**
103	+ *
104	+ *
105	+ * @param unknown $total_rows
106	+ * @param unknown $order
107	+ *
108	+ * @return unknown
109	+ */
110	+ function check_order_totals( $total_rows, $order )
111	+ {
112	+
113	+ $commission_label = apply_filters('wcv_notify_vendor_commission_label', __( 'Commission Subtotal:', 'wcvendors' ) ) ;
114	+ $return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
115	+ $return[ 'cart_subtotal' ][ 'label' ] = $commission_label;
116	+
117	+ if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
118	+ $return['tax_subtotal'] = array( 'label' => '', 'value' => '');
119	+ $return[ 'tax_subtotal']['label'] = apply_filters('wcv_notify_vendor_tax_label', __( 'Tax Subtotal:', 'wcvendors' ) ) ;
120	+ }
121	+
122	+ $dues = WCV_Vendors::get_vendor_dues_from_order( $order );
123	+
124	+ foreach ( $dues as $due ) {
125	+ if ( $this->current_vendor == $due['vendor_id'] ) {
126	+ if (!empty($return[ 'shipping' ])) $return[ 'shipping' ] = $total_rows[ 'shipping' ];
127	+ $return[ 'shipping' ]['label'] = __( 'Shipping Subtotal:', 'wcvendors' );
128	+ $return[ 'shipping' ][ 'value' ] = woocommerce_price( $due['shipping'] );
129	+ if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
130	+ $return[ 'tax_subtotal']['value'] += $due['tax'];
131	+ }
132	+ break;
133	+ }
134	+ }
135	+ // Format tax price
136	+ if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
137	+ $return[ 'tax_subtotal']['value'] = woocommerce_price( $return[ 'tax_subtotal']['value'] );
138	+ }
139	+
140	+ return $return;
141	+ }
142	+
143	+
144	+ /**
145	+ *
146	+ *
147	+ * @param unknown $order
148	+ *
149	+ * @return unknown
150	+ */
151	+ public function get_vendors( $order )
152	+ {
153	+ $items = $order->get_items();
154	+ $vendors = array();
155	+
156	+ foreach ( $items as $key => $product ) {
157	+
158	+ if ( empty( $product[ 'product_id' ] ) ) continue;
159	+ $author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
160	+
161	+ // Only store the vendor authors
162	+ if ( !WCV_Vendors::is_vendor( $author ) ) {
163	+ unset( $items[ $key ] );
164	+ continue;
165	+ }
166	+
167	+ $vendors[ $author ] = get_userdata( $author )->user_email;
168	+ }
169	+
170	+ return $vendors;
171	+ }
172	+
173	+ /**
174	+ *
175	+ *
176	+ * @param unknown $items
177	+ * @param unknown $order
178	+ *
179	+ * @return unknown
180	+ */
181	+ function check_items( $items, $order )
182	+ {
183	+ foreach ( $items as $key => $product ) {
184	+
185	+ // If this is a line item
186	+ if ($product['type'] == 'line_item') {
187	+
188	+ $author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
189	+
190	+ if ( $this->current_vendor != $author) {
191	+ unset( $items[ $key ] );
192	+ continue;
193	+ } else {
194	+ $commission_due = WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product[ 'product_id' ], $order, $product[ 'qty' ] );
195	+
196	+ $items[ $key ][ 'line_subtotal' ] = $commission_due;
197	+ $items[ $key ][ 'line_total' ] = $commission_due;
198	+ // Don't display tax if give tax is not enabled.
199	+ // if ( !WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
200	+ // unset($items[ $key ][ 'line_tax' ]) ;
201	+ // }
202	+ }
203	+ }
204	+
205	+ }
206	+
207	+
208	+ return $items;
209	+ }
210	+
211	+
212	+ /**
213	+ * get_content_html function.
214	+ *
215	+ * @access public
216	+ * @return string
217	+ */
218	+ function get_content_html()
219	+ {
220	+ ob_start();
221	+ wc_get_template( $this->template_html, array(
222	+ 'order' => $this->object,
223	+ 'email_heading' => $this->get_heading()
224	+ ), 'woocommerce/emails', $this->template_base );
225	+
226	+ return ob_get_clean();
227	+ }
228	+
229	+
230	+ /**
231	+ * get_content_plain function.
232	+ *
233	+ * @access public
234	+ * @return string
235	+ */
236	+ function get_content_plain()
237	+ {
238	+ ob_start();
239	+ wc_get_template( $this->template_plain, array(
240	+ 'order' => $this->object,
241	+ 'email_heading' => $this->get_heading()
242	+ ), 'woocommerce/emails', $this->template_base );
243	+
244	+ return ob_get_clean();
245	+ }
246	+
247	+
248	+ /**
249	+ * Initialise Settings Form Fields
250	+ *
251	+ * @access public
252	+ * @return void
253	+ */
254	+ function init_form_fields()
255	+ {
256	+ $this->form_fields = array(
257	+ 'enabled' => array(
258	+ 'title' => __( 'Enable/Disable', 'wcvendors' ),
259	+ 'type' => 'checkbox',
260	+ 'label' => __( 'Enable this email notification', 'wcvendors' ),
261	+ 'default' => 'yes'
262	+ ),
263	+ 'subject' => array(
264	+ 'title' => __( 'Subject', 'wcvendors' ),
265	+ 'type' => 'text',
266	+ 'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
267	+ 'placeholder' => '',
268	+ 'default' => ''
269	+ ),
270	+ 'heading' => array(
271	+ 'title' => __( 'Email Heading', 'wcvendors' ),
272	+ 'type' => 'text',
273	+ 'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
274	+ 'placeholder' => '',
275	+ 'default' => ''
276	+ ),
277	+ 'email_type' => array(
278	+ 'title' => __( 'Email type', 'wcvendors' ),
279	+ 'type' => 'select',
280	+ 'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
281	+ 'default' => 'html',
282	+ 'class' => 'email_type',
283	+ 'options' => array(
284	+ 'plain' => __( 'Plain text', 'wcvendors' ),
285	+ 'html' => __( 'HTML', 'wcvendors' ),
286	+ 'multipart' => __( 'Multipart', 'wcvendors' ),
287	+ )
288	+ )
289	+ );
290	+ }
291	+
292	+
293	+ }

trunk/classes/admin/settings/README.md ADDED Viewed

	@@ -0,0 +1,126 @@


1	+ WP Simple Settings Framework
2	+ ================================
3	+
4	+ A minimalistic framework for Wordpress Settings API.
5	+
6	+ Quick start
7	+ ------------
8	+
9	+ * [Download the latest release](https://github.com/Geczy/WP-Simple-Settings-Framework/zipball/master) (zip)
10	+
11	+ * Or, clone the repo, `git clone git://github.com/Geczy/WP-Simple-Settings-Framework.git`
12	+
13	+ Installation
14	+ ------------
15	+ 1. Include the framework in your Wordpress plugin by using:
16	+
17	+ ```php
18	+ <?php
19	+ add_action( 'init', 'sf_load_settings' );
20	+ function sf_load_settings() {
21	+ require 'classes/sf-class-settings.php';
22	+ $settings_framework = new SF_Settings_API($id = 'my_plugin_name', $title = 'My Plugin Title', $menu = 'plugins.php', __FILE__);
23	+ }
24	+ ```
25	+
26	+ Optionally, you might want to make `$settings_framework` a global variable so that you can use the [helper functions](#helpers).
27	+
28	+ 2. Open `sf-options.php` to begin configuring your options.
29	+
30	+ Features
31	+ ------------
32	+
33	+ ### Automatic settings page
34	+ Don't want it under the Plugins tab like in the screenshot? No problem, you can choose where you want it!
35	+
36	+ You can also change "Simple Settings" submenu to be anything you'd like.
37	+
38	+ ![settings page example](http://i.imgur.com/aEGUD.png)
39	+
40	+ ---
41	+
42	+ ### Tooltips
43	+ ![tooltips example](http://i.imgur.com/Z3Pnk.png)
44	+
45	+ Optional tooltips using [Twitter Bootstrap](http://twitter.github.com/bootstrap/javascript.html#tooltips)!
46	+
47	+ ---
48	+
49	+ ### Select box replacement
50	+ ![select box replacement](http://i.imgur.com/ikOXH.png)
51	+
52	+ Utilizing [Select2](http://ivaynberg.github.com/select2/) to display select boxes. It's pretty cool!
53	+
54	+ ---
55	+
56	+ ### Multiple tabs
57	+ ![multiple tabs example](http://i.imgur.com/OUM4i.png)
58	+
59	+ Create multiple tabs for your options.
60	+
61	+ ---
62	+
63	+ ### Input types
64	+
65	+ * Text
66	+ * Number
67	+ * Textarea
68	+ * Checkbox
69	+ * Radio
70	+ * Select
71	+ * WP Pages
72	+
73	+ Helpers
74	+ ------------
75	+
76	+ Update or add a new option
77	+
78	+ ```php
79	+ <?php
80	+ $settings_framework->update_option('your_option', 'new_value');
81	+ ```
82	+
83	+ Get an existing option's value
84	+
85	+ ```php
86	+ <?php
87	+ $settings_framework->get_option('your_option');
88	+ ```
89	+
90	+ Example configuration
91	+ ------------
92	+
93	+ Check out the [example config](https://github.com/Geczy/WP-Simple-Settings-Framework/blob/master/sf-options.php) for an idea of how to use every input type.
94	+
95	+ Here's an example of one type, though:
96	+
97	+ ```php
98	+ <?php
99	+ $options[] = array(
100	+ 'name' => __( 'Name', 'geczy' ),
101	+ 'desc' => __( 'Please tell me who you are.', 'geczy' ),
102	+ 'id' => 'text_sample',
103	+ 'type' => 'text',
104	+ );
105	+ ```
106	+
107	+
108	+ Bug tracker
109	+ -----------
110	+
111	+ Have a bug? Please create an issue here on GitHub!
112	+
113	+ https://github.com/Geczy/WP-Simple-Settings-Framework/issues/
114	+
115	+ Copyright and License
116	+ ---------------------
117	+
118	+ Copyright 2012 Matthew Gates
119	+
120	+ Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
121	+
122	+ * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
123	+ * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
124	+ * Neither the names of the copyright holders nor the names of the contributors may be used to endorse or promote products derived from this software without specific prior written permission.
125	+
126	+ http://www.opensource.org/licenses/bsd-license.php

trunk/classes/admin/settings/assets/css/sf-styles.css ADDED Viewed

	@@ -0,0 +1,167 @@


1	+ a.sf-tips {
2	+ height: 16px;
3	+ width: 16px;
4	+ margin-top: 0.2em;
5	+ float: right;
6	+ background: url(../img/tip.png) no-repeat top left;
7	+ }
8	+
9	+ /*!
10	+ * Bootstrap v2.3.1 [Styles for Tooltips]
11	+ *
12	+ * Copyright 2012 Twitter, Inc
13	+ * Licensed under the Apache License v2.0
14	+ * http://www.apache.org/licenses/LICENSE-2.0
15	+ *
16	+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
17	+ */
18	+ .clearfix {
19	+ *zoom: 1;
20	+ }
21	+
22	+ .clearfix:before, .clearfix:after {
23	+ display: table;
24	+ content: "";
25	+ line-height: 0;
26	+ }
27	+
28	+ .clearfix:after {
29	+ clear: both;
30	+ }
31	+
32	+ .hide-text {
33	+ font: 0/0 a;
34	+ color: transparent;
35	+ text-shadow: none;
36	+ background-color: transparent;
37	+ border: 0;
38	+ }
39	+
40	+ .input-block-level {
41	+ display: block;
42	+ width: 100%;
43	+ min-height: 30px;
44	+ -webkit-box-sizing: border-box;
45	+ -moz-box-sizing: border-box;
46	+ box-sizing: border-box;
47	+ }
48	+
49	+ /* Tooltips */
50	+ .tooltip {
51	+ text-shadow: none;
52	+ }
53	+
54	+ .tooltip {
55	+ position: absolute;
56	+ z-index: 1030;
57	+ display: block;
58	+ visibility: visible;
59	+ font-size: 11px;
60	+ line-height: 1.4;
61	+ opacity: 0;
62	+ filter: alpha(opacity=0);
63	+ }
64	+
65	+ .tooltip.in {
66	+ opacity: 0.8;
67	+ filter: alpha(opacity=80);
68	+ }
69	+
70	+ .tooltip.top {
71	+ margin-top: -3px;
72	+ padding: 5px 0;
73	+ }
74	+
75	+ .tooltip.right {
76	+ margin-left: 3px;
77	+ padding: 0 5px;
78	+ }
79	+
80	+ .tooltip.bottom {
81	+ margin-top: 3px;
82	+ padding: 5px 0;
83	+ }
84	+
85	+ .tooltip.left {
86	+ margin-left: -3px;
87	+ padding: 0 5px;
88	+ }
89	+
90	+ .tooltip-inner {
91	+ max-width: 200px;
92	+ padding: 8px;
93	+ color: #ffffff;
94	+ text-align: center;
95	+ text-decoration: none;
96	+ background-color: #000000;
97	+ -webkit-border-radius: 4px;
98	+ -moz-border-radius: 4px;
99	+ border-radius: 4px;
100	+ }
101	+
102	+ .tooltip-arrow {
103	+ position: absolute;
104	+ width: 0;
105	+ height: 0;
106	+ border-color: transparent;
107	+ border-style: solid;
108	+ }
109	+
110	+ .tooltip.top .tooltip-arrow {
111	+ bottom: 0;
112	+ left: 50%;
113	+ margin-left: -5px;
114	+ border-width: 5px 5px 0;
115	+ border-top-color: #000000;
116	+ }
117	+
118	+ .tooltip.right .tooltip-arrow {
119	+ top: 50%;
120	+ left: 0;
121	+ margin-top: -5px;
122	+ border-width: 5px 5px 5px 0;
123	+ border-right-color: #000000;
124	+ }
125	+
126	+ .tooltip.left .tooltip-arrow {
127	+ top: 50%;
128	+ right: 0;
129	+ margin-top: -5px;
130	+ border-width: 5px 0 5px 5px;
131	+ border-left-color: #000000;
132	+ }
133	+
134	+ .tooltip.bottom .tooltip-arrow {
135	+ top: 0;
136	+ left: 50%;
137	+ margin-left: -5px;
138	+ border-width: 0 5px 5px;
139	+ border-bottom-color: #000000;
140	+ }
141	+
142	+ /* Animation */
143	+ .fade {
144	+ opacity: 0;
145	+ -webkit-transition: opacity 0.15s linear;
146	+ -moz-transition: opacity 0.15s linear;
147	+ -o-transition: opacity 0.15s linear;
148	+ transition: opacity 0.15s linear;
149	+ }
150	+
151	+ .fade.in {
152	+ opacity: 1;
153	+ }
154	+
155	+ .collapse {
156	+ position: relative;
157	+ height: 0;
158	+ overflow: hidden;
159	+ -webkit-transition: height 0.35s ease;
160	+ -moz-transition: height 0.35s ease;
161	+ -o-transition: height 0.35s ease;
162	+ transition: height 0.35s ease;
163	+ }
164	+
165	+ .collapse.in {
166	+ height: auto;
167	+ }

trunk/classes/admin/settings/assets/img/tip.png ADDED Viewed

Binary file

trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js ADDED Viewed

	@@ -0,0 +1,126 @@


1	+ /**
2	+ * Bootstrap.js by @fat & @mdo
3	+ * plugins: bootstrap-transition.js, bootstrap-tooltip.js
4	+ * 2.3.1
5	+ * Copyright 2012 Twitter, Inc.
6	+ * http://www.apache.org/licenses/LICENSE-2.0.txt
7	+ */
8	+ !function (a) {
9	+ a(function () {
10	+ a.support.transition = function () {
11	+ var a = function () {
12	+ var a = document.createElement("bootstrap"), b = {WebkitTransition: "webkitTransitionEnd", MozTransition: "transitionend", OTransition: "oTransitionEnd otransitionend", transition: "transitionend"}, c;
13	+ for (c in b)if (a.style[c] !== undefined)return b[c]
14	+ }();
15	+ return a && {end: a}
16	+ }()
17	+ })
18	+ }(window.jQuery), !function (a) {
19	+ var b = function (a, b) {
20	+ this.init("tooltip", a, b)
21	+ };
22	+ b.prototype = {constructor: b, init: function (b, c, d) {
23	+ var e, f, g, h, i;
24	+ this.type = b, this.$element = a(c), this.options = this.getOptions(d), this.enabled = !0, g = this.options.trigger.split(" ");
25	+ for (i = g.length; i--;)h = g[i], h == "click" ? this.$element.on("click." + this.type, this.options.selector, a.proxy(this.toggle, this)) : h != "manual" && (e = h == "hover" ? "mouseenter" : "focus", f = h == "hover" ? "mouseleave" : "blur", this.$element.on(e + "." + this.type, this.options.selector, a.proxy(this.enter, this)), this.$element.on(f + "." + this.type, this.options.selector, a.proxy(this.leave, this)));
26	+ this.options.selector ? this._options = a.extend({}, this.options, {trigger: "manual", selector: ""}) : this.fixTitle()
27	+ }, getOptions: function (b) {
28	+ return b = a.extend({}, a.fn[this.type].defaults, this.$element.data(), b), b.delay && typeof b.delay == "number" && (b.delay = {show: b.delay, hide: b.delay}), b
29	+ }, enter: function (b) {
30	+ var c = a.fn[this.type].defaults, d = {}, e;
31	+ this._options && a.each(this._options, function (a, b) {
32	+ c[a] != b && (d[a] = b)
33	+ }, this), e = a(b.currentTarget)[this.type](d).data(this.type);
34	+ if (!e.options.delay \|\| !e.options.delay.show)return e.show();
35	+ clearTimeout(this.timeout), e.hoverState = "in", this.timeout = setTimeout(function () {
36	+ e.hoverState == "in" && e.show()
37	+ }, e.options.delay.show)
38	+ }, leave: function (b) {
39	+ var c = a(b.currentTarget)[this.type](this._options).data(this.type);
40	+ this.timeout && clearTimeout(this.timeout);
41	+ if (!c.options.delay \|\| !c.options.delay.hide)return c.hide();
42	+ c.hoverState = "out", this.timeout = setTimeout(function () {
43	+ c.hoverState == "out" && c.hide()
44	+ }, c.options.delay.hide)
45	+ }, show: function () {
46	+ var b, c, d, e, f, g, h = a.Event("show");
47	+ if (this.hasContent() && this.enabled) {
48	+ this.$element.trigger(h);
49	+ if (h.isDefaultPrevented())return;
50	+ b = this.tip(), this.setContent(), this.options.animation && b.addClass("fade"), f = typeof this.options.placement == "function" ? this.options.placement.call(this, b[0], this.$element[0]) : this.options.placement, b.detach().css({top: 0, left: 0, display: "block"}), this.options.container ? b.appendTo(this.options.container) : b.insertAfter(this.$element), c = this.getPosition(), d = b[0].offsetWidth, e = b[0].offsetHeight;
51	+ switch (f) {
52	+ case"bottom":
53	+ g = {top: c.top + c.height, left: c.left + c.width / 2 - d / 2};
54	+ break;
55	+ case"top":
56	+ g = {top: c.top - e, left: c.left + c.width / 2 - d / 2};
57	+ break;
58	+ case"left":
59	+ g = {top: c.top + c.height / 2 - e / 2, left: c.left - d};
60	+ break;
61	+ case"right":
62	+ g = {top: c.top + c.height / 2 - e / 2, left: c.left + c.width}
63	+ }
64	+ this.applyPlacement(g, f), this.$element.trigger("shown")
65	+ }
66	+ }, applyPlacement: function (a, b) {
67	+ var c = this.tip(), d = c[0].offsetWidth, e = c[0].offsetHeight, f, g, h, i;
68	+ c.offset(a).addClass(b).addClass("in"), f = c[0].offsetWidth, g = c[0].offsetHeight, b == "top" && g != e && (a.top = a.top + e - g, i = !0), b == "bottom" \|\| b == "top" ? (h = 0, a.left < 0 && (h = a.left * -2, a.left = 0, c.offset(a), f = c[0].offsetWidth, g = c[0].offsetHeight), this.replaceArrow(h - d + f, f, "left")) : this.replaceArrow(g - e, g, "top"), i && c.offset(a)
69	+ }, replaceArrow: function (a, b, c) {
70	+ this.arrow().css(c, a ? 50 * (1 - a / b) + "%" : "")
71	+ }, setContent: function () {
72	+ var a = this.tip(), b = this.getTitle();
73	+ a.find(".tooltip-inner")[this.options.html ? "html" : "text"](b), a.removeClass("fade in top bottom left right")
74	+ }, hide: function () {
75	+ function e() {
76	+ var b = setTimeout(function () {
77	+ c.off(a.support.transition.end).detach()
78	+ }, 500);
79	+ c.one(a.support.transition.end, function () {
80	+ clearTimeout(b), c.detach()
81	+ })
82	+ }
83	+
84	+ var b = this, c = this.tip(), d = a.Event("hide");
85	+ this.$element.trigger(d);
86	+ if (d.isDefaultPrevented())return;
87	+ return c.removeClass("in"), a.support.transition && this.$tip.hasClass("fade") ? e() : c.detach(), this.$element.trigger("hidden"), this
88	+ }, fixTitle: function () {
89	+ var a = this.$element;
90	+ (a.attr("title") \|\| typeof a.attr("data-original-title") != "string") && a.attr("data-original-title", a.attr("title") \|\| "").attr("title", "")
91	+ }, hasContent: function () {
92	+ return this.getTitle()
93	+ }, getPosition: function () {
94	+ var b = this.$element[0];
95	+ return a.extend({}, typeof b.getBoundingClientRect == "function" ? b.getBoundingClientRect() : {width: b.offsetWidth, height: b.offsetHeight}, this.$element.offset())
96	+ }, getTitle: function () {
97	+ var a, b = this.$element, c = this.options;
98	+ return a = b.attr("data-original-title") \|\| (typeof c.title == "function" ? c.title.call(b[0]) : c.title), a
99	+ }, tip: function () {
100	+ return this.$tip = this.$tip \|\| a(this.options.template)
101	+ }, arrow: function () {
102	+ return this.$arrow = this.$arrow \|\| this.tip().find(".tooltip-arrow")
103	+ }, validate: function () {
104	+ this.$element[0].parentNode \|\| (this.hide(), this.$element = null, this.options = null)
105	+ }, enable: function () {
106	+ this.enabled = !0
107	+ }, disable: function () {
108	+ this.enabled = !1
109	+ }, toggleEnabled: function () {
110	+ this.enabled = !this.enabled
111	+ }, toggle: function (b) {
112	+ var c = b ? a(b.currentTarget)[this.type](this._options).data(this.type) : this;
113	+ c.tip().hasClass("in") ? c.hide() : c.show()
114	+ }, destroy: function () {
115	+ this.hide().$element.off("." + this.type).removeData(this.type)
116	+ }};
117	+ var c = a.fn.tooltip;
118	+ a.fn.tooltip = function (c) {
119	+ return this.each(function () {
120	+ var d = a(this), e = d.data("tooltip"), f = typeof c == "object" && c;
121	+ e \|\| d.data("tooltip", e = new b(this, f)), typeof c == "string" && e[c]()
122	+ })
123	+ }, a.fn.tooltip.Constructor = b, a.fn.tooltip.defaults = {animation: !0, placement: "top", selector: !1, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>', trigger: "hover focus", title: "", delay: 0, html: !1, container: !1}, a.fn.tooltip.noConflict = function () {
124	+ return a.fn.tooltip = c, this
125	+ }
126	+ }(window.jQuery)

trunk/classes/admin/settings/assets/js/js.iml ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <module type="WEB_MODULE" version="4">
3	+ <component name="NewModuleRootManager" inherit-compiler-output="true">
4	+ <exclude-output />
5	+ <content url="file://$MODULE_DIR$" />
6	+ <orderEntry type="inheritedJdk" />
7	+ <orderEntry type="sourceFolder" forTests="false" />
8	+ </component>
9	+ </module>
10	+

trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css ADDED Viewed

	@@ -0,0 +1,87 @@


1	+ .form-control .select2-choice {
2	+ border: 0;
3	+ border-radius: 2px;
4	+ }
5	+
6	+ .form-control .select2-choice .select2-arrow {
7	+ border-radius: 0 2px 2px 0;
8	+ }
9	+
10	+ .form-control.select2-container {
11	+ height: auto !important;
12	+ padding: 0;
13	+ }
14	+
15	+ .form-control.select2-container.select2-dropdown-open {
16	+ border-color: #5897FB;
17	+ border-radius: 3px 3px 0 0;
18	+ }
19	+
20	+ .form-control .select2-container.select2-dropdown-open .select2-choices {
21	+ border-radius: 3px 3px 0 0;
22	+ }
23	+
24	+ .form-control.select2-container .select2-choices {
25	+ border: 0 !important;
26	+ border-radius: 3px;
27	+ }
28	+
29	+ .control-group.warning .select2-container .select2-choice,
30	+ .control-group.warning .select2-container .select2-choices,
31	+ .control-group.warning .select2-container-active .select2-choice,
32	+ .control-group.warning .select2-container-active .select2-choices,
33	+ .control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
34	+ .control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
35	+ .control-group.warning .select2-container-multi.select2-container-active .select2-choices {
36	+ border: 1px solid #C09853 !important;
37	+ }
38	+
39	+ .control-group.warning .select2-container .select2-choice div {
40	+ border-left: 1px solid #C09853 !important;
41	+ background: #FCF8E3 !important;
42	+ }
43	+
44	+ .control-group.error .select2-container .select2-choice,
45	+ .control-group.error .select2-container .select2-choices,
46	+ .control-group.error .select2-container-active .select2-choice,
47	+ .control-group.error .select2-container-active .select2-choices,
48	+ .control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
49	+ .control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
50	+ .control-group.error .select2-container-multi.select2-container-active .select2-choices {
51	+ border: 1px solid #B94A48 !important;
52	+ }
53	+
54	+ .control-group.error .select2-container .select2-choice div {
55	+ border-left: 1px solid #B94A48 !important;
56	+ background: #F2DEDE !important;
57	+ }
58	+
59	+ .control-group.info .select2-container .select2-choice,
60	+ .control-group.info .select2-container .select2-choices,
61	+ .control-group.info .select2-container-active .select2-choice,
62	+ .control-group.info .select2-container-active .select2-choices,
63	+ .control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
64	+ .control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
65	+ .control-group.info .select2-container-multi.select2-container-active .select2-choices {
66	+ border: 1px solid #3A87AD !important;
67	+ }
68	+
69	+ .control-group.info .select2-container .select2-choice div {
70	+ border-left: 1px solid #3A87AD !important;
71	+ background: #D9EDF7 !important;
72	+ }
73	+
74	+ .control-group.success .select2-container .select2-choice,
75	+ .control-group.success .select2-container .select2-choices,
76	+ .control-group.success .select2-container-active .select2-choice,
77	+ .control-group.success .select2-container-active .select2-choices,
78	+ .control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
79	+ .control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
80	+ .control-group.success .select2-container-multi.select2-container-active .select2-choices {
81	+ border: 1px solid #468847 !important;
82	+ }
83	+
84	+ .control-group.success .select2-container .select2-choice div {
85	+ border-left: 1px solid #468847 !important;
86	+ background: #DFF0D8 !important;
87	+ }

trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif ADDED Viewed

Binary file

trunk/classes/admin/settings/assets/js/select2/select2.css ADDED Viewed

	@@ -0,0 +1,704 @@


1	+ /*
2	+ Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
3	+ */
4	+ .select2-container {
5	+ margin: 0;
6	+ position: relative;
7	+ display: inline-block;
8	+ /* inline-block for ie7 */
9	+ zoom: 1;
10	+ *display: inline;
11	+ vertical-align: middle;
12	+ }
13	+
14	+ .select2-container,
15	+ .select2-drop,
16	+ .select2-search,
17	+ .select2-search input {
18	+ /*
19	+ Force border-box so that % widths fit the parent
20	+ container without overlap because of margin/padding.
21	+ More Info : http://www.quirksmode.org/css/box.html
22	+ */
23	+ -webkit-box-sizing: border-box; /* webkit */
24	+ -moz-box-sizing: border-box; /* firefox */
25	+ box-sizing: border-box; /* css3 */
26	+ }
27	+
28	+ .select2-container .select2-choice {
29	+ display: block;
30	+ height: 26px;
31	+ padding: 0 0 0 8px;
32	+ overflow: hidden;
33	+ position: relative;
34	+
35	+ border: 1px solid #aaa;
36	+ white-space: nowrap;
37	+ line-height: 26px;
38	+ color: #444;
39	+ text-decoration: none;
40	+
41	+ border-radius: 4px;
42	+
43	+ background-clip: padding-box;
44	+
45	+ -webkit-touch-callout: none;
46	+ -webkit-user-select: none;
47	+ -moz-user-select: none;
48	+ -ms-user-select: none;
49	+ user-select: none;
50	+
51	+ background-color: #fff;
52	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
53	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
54	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
55	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
56	+ background-image: linear-gradient(to top, #eee 0%, #fff 50%);
57	+ }
58	+
59	+ html[dir="rtl"] .select2-container .select2-choice {
60	+ padding: 0 8px 0 0;
61	+ }
62	+
63	+ .select2-container.select2-drop-above .select2-choice {
64	+ border-bottom-color: #aaa;
65	+
66	+ border-radius: 0 0 4px 4px;
67	+
68	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
69	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
70	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
71	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
72	+ background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
73	+ }
74	+
75	+ .select2-container.select2-allowclear .select2-choice .select2-chosen {
76	+ margin-right: 42px;
77	+ }
78	+
79	+ .select2-container .select2-choice > .select2-chosen {
80	+ margin-right: 26px;
81	+ display: block;
82	+ overflow: hidden;
83	+
84	+ white-space: nowrap;
85	+
86	+ text-overflow: ellipsis;
87	+ float: none;
88	+ width: auto;
89	+ }
90	+
91	+ html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
92	+ margin-left: 26px;
93	+ margin-right: 0;
94	+ }
95	+
96	+ .select2-container .select2-choice abbr {
97	+ display: none;
98	+ width: 12px;
99	+ height: 12px;
100	+ position: absolute;
101	+ right: 24px;
102	+ top: 8px;
103	+
104	+ font-size: 1px;
105	+ text-decoration: none;
106	+
107	+ border: 0;
108	+ background: url('select2.png') right top no-repeat;
109	+ cursor: pointer;
110	+ outline: 0;
111	+ }
112	+
113	+ .select2-container.select2-allowclear .select2-choice abbr {
114	+ display: inline-block;
115	+ }
116	+
117	+ .select2-container .select2-choice abbr:hover {
118	+ background-position: right -11px;
119	+ cursor: pointer;
120	+ }
121	+
122	+ .select2-drop-mask {
123	+ border: 0;
124	+ margin: 0;
125	+ padding: 0;
126	+ position: fixed;
127	+ left: 0;
128	+ top: 0;
129	+ min-height: 100%;
130	+ min-width: 100%;
131	+ height: auto;
132	+ width: auto;
133	+ opacity: 0;
134	+ z-index: 9998;
135	+ /* styles required for IE to work */
136	+ background-color: #fff;
137	+ filter: alpha(opacity=0);
138	+ }
139	+
140	+ .select2-drop {
141	+ width: 100%;
142	+ margin-top: -1px;
143	+ position: absolute;
144	+ z-index: 9999;
145	+ top: 100%;
146	+
147	+ background: #fff;
148	+ color: #000;
149	+ border: 1px solid #aaa;
150	+ border-top: 0;
151	+
152	+ border-radius: 0 0 4px 4px;
153	+
154	+ -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
155	+ box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
156	+ }
157	+
158	+ .select2-drop.select2-drop-above {
159	+ margin-top: 1px;
160	+ border-top: 1px solid #aaa;
161	+ border-bottom: 0;
162	+
163	+ border-radius: 4px 4px 0 0;
164	+
165	+ -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
166	+ box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
167	+ }
168	+
169	+ .select2-drop-active {
170	+ border: 1px solid #5897fb;
171	+ border-top: none;
172	+ }
173	+
174	+ .select2-drop.select2-drop-above.select2-drop-active {
175	+ border-top: 1px solid #5897fb;
176	+ }
177	+
178	+ .select2-drop-auto-width {
179	+ border-top: 1px solid #aaa;
180	+ width: auto;
181	+ }
182	+
183	+ .select2-drop-auto-width .select2-search {
184	+ padding-top: 4px;
185	+ }
186	+
187	+ .select2-container .select2-choice .select2-arrow {
188	+ display: inline-block;
189	+ width: 18px;
190	+ height: 100%;
191	+ position: absolute;
192	+ right: 0;
193	+ top: 0;
194	+
195	+ border-left: 1px solid #aaa;
196	+ border-radius: 0 4px 4px 0;
197	+
198	+ background-clip: padding-box;
199	+
200	+ background: #ccc;
201	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
202	+ background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
203	+ background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
204	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
205	+ background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
206	+ }
207	+
208	+ html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
209	+ left: 0;
210	+ right: auto;
211	+
212	+ border-left: none;
213	+ border-right: 1px solid #aaa;
214	+ border-radius: 4px 0 0 4px;
215	+ }
216	+
217	+ .select2-container .select2-choice .select2-arrow b {
218	+ display: block;
219	+ width: 100%;
220	+ height: 100%;
221	+ background: url('select2.png') no-repeat 0 1px;
222	+ }
223	+
224	+ html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
225	+ background-position: 2px 1px;
226	+ }
227	+
228	+ .select2-search {
229	+ display: inline-block;
230	+ width: 100%;
231	+ min-height: 26px;
232	+ margin: 0;
233	+ padding-left: 4px;
234	+ padding-right: 4px;
235	+
236	+ position: relative;
237	+ z-index: 10000;
238	+
239	+ white-space: nowrap;
240	+ }
241	+
242	+ .select2-search input {
243	+ width: 100%;
244	+ height: auto !important;
245	+ min-height: 26px;
246	+ padding: 4px 20px 4px 5px;
247	+ margin: 0;
248	+
249	+ outline: 0;
250	+ font-family: sans-serif;
251	+ font-size: 1em;
252	+
253	+ border: 1px solid #aaa;
254	+ border-radius: 0;
255	+
256	+ -webkit-box-shadow: none;
257	+ box-shadow: none;
258	+
259	+ background: #fff url('select2.png') no-repeat 100% -22px;
260	+ background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
261	+ background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
262	+ background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
263	+ background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
264	+ }
265	+
266	+ html[dir="rtl"] .select2-search input {
267	+ padding: 4px 5px 4px 20px;
268	+
269	+ background: #fff url('select2.png') no-repeat -37px -22px;
270	+ background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
271	+ background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
272	+ background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
273	+ background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
274	+ }
275	+
276	+ .select2-drop.select2-drop-above .select2-search input {
277	+ margin-top: 4px;
278	+ }
279	+
280	+ .select2-search input.select2-active {
281	+ background: #fff url('select2-spinner.gif') no-repeat 100%;
282	+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
283	+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
284	+ background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
285	+ background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
286	+ }
287	+
288	+ .select2-container-active .select2-choice,
289	+ .select2-container-active .select2-choices {
290	+ border: 1px solid #5897fb;
291	+ outline: none;
292	+
293	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
294	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
295	+ }
296	+
297	+ .select2-dropdown-open .select2-choice {
298	+ border-bottom-color: transparent;
299	+ -webkit-box-shadow: 0 1px 0 #fff inset;
300	+ box-shadow: 0 1px 0 #fff inset;
301	+
302	+ border-bottom-left-radius: 0;
303	+ border-bottom-right-radius: 0;
304	+
305	+ background-color: #eee;
306	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
307	+ background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
308	+ background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
309	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
310	+ background-image: linear-gradient(to top, #fff 0%, #eee 50%);
311	+ }
312	+
313	+ .select2-dropdown-open.select2-drop-above .select2-choice,
314	+ .select2-dropdown-open.select2-drop-above .select2-choices {
315	+ border: 1px solid #5897fb;
316	+ border-top-color: transparent;
317	+
318	+ background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
319	+ background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
320	+ background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
321	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
322	+ background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
323	+ }
324	+
325	+ .select2-dropdown-open .select2-choice .select2-arrow {
326	+ background: transparent;
327	+ border-left: none;
328	+ filter: none;
329	+ }
330	+ html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
331	+ border-right: none;
332	+ }
333	+
334	+ .select2-dropdown-open .select2-choice .select2-arrow b {
335	+ background-position: -18px 1px;
336	+ }
337	+
338	+ html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
339	+ background-position: -16px 1px;
340	+ }
341	+
342	+ .select2-hidden-accessible {
343	+ border: 0;
344	+ clip: rect(0 0 0 0);
345	+ height: 1px;
346	+ margin: -1px;
347	+ overflow: hidden;
348	+ padding: 0;
349	+ position: absolute;
350	+ width: 1px;
351	+ }
352	+
353	+ /* results */
354	+ .select2-results {
355	+ max-height: 200px;
356	+ padding: 0 0 0 4px;
357	+ margin: 4px 4px 4px 0;
358	+ position: relative;
359	+ overflow-x: hidden;
360	+ overflow-y: auto;
361	+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
362	+ }
363	+
364	+ html[dir="rtl"] .select2-results {
365	+ padding: 0 4px 0 0;
366	+ margin: 4px 0 4px 4px;
367	+ }
368	+
369	+ .select2-results ul.select2-result-sub {
370	+ margin: 0;
371	+ padding-left: 0;
372	+ }
373	+
374	+ .select2-results li {
375	+ list-style: none;
376	+ display: list-item;
377	+ background-image: none;
378	+ }
379	+
380	+ .select2-results li.select2-result-with-children > .select2-result-label {
381	+ font-weight: bold;
382	+ }
383	+
384	+ .select2-results .select2-result-label {
385	+ padding: 3px 7px 4px;
386	+ margin: 0;
387	+ cursor: pointer;
388	+
389	+ min-height: 1em;
390	+
391	+ -webkit-touch-callout: none;
392	+ -webkit-user-select: none;
393	+ -moz-user-select: none;
394	+ -ms-user-select: none;
395	+ user-select: none;
396	+ }
397	+
398	+ .select2-results-dept-1 .select2-result-label { padding-left: 20px }
399	+ .select2-results-dept-2 .select2-result-label { padding-left: 40px }
400	+ .select2-results-dept-3 .select2-result-label { padding-left: 60px }
401	+ .select2-results-dept-4 .select2-result-label { padding-left: 80px }
402	+ .select2-results-dept-5 .select2-result-label { padding-left: 100px }
403	+ .select2-results-dept-6 .select2-result-label { padding-left: 110px }
404	+ .select2-results-dept-7 .select2-result-label { padding-left: 120px }
405	+
406	+ .select2-results .select2-highlighted {
407	+ background: #3875d7;
408	+ color: #fff;
409	+ }
410	+
411	+ .select2-results li em {
412	+ background: #feffde;
413	+ font-style: normal;
414	+ }
415	+
416	+ .select2-results .select2-highlighted em {
417	+ background: transparent;
418	+ }
419	+
420	+ .select2-results .select2-highlighted ul {
421	+ background: #fff;
422	+ color: #000;
423	+ }
424	+
425	+ .select2-results .select2-no-results,
426	+ .select2-results .select2-searching,
427	+ .select2-results .select2-ajax-error,
428	+ .select2-results .select2-selection-limit {
429	+ background: #f4f4f4;
430	+ display: list-item;
431	+ padding-left: 5px;
432	+ }
433	+
434	+ /*
435	+ disabled look for disabled choices in the results dropdown
436	+ */
437	+ .select2-results .select2-disabled.select2-highlighted {
438	+ color: #666;
439	+ background: #f4f4f4;
440	+ display: list-item;
441	+ cursor: default;
442	+ }
443	+ .select2-results .select2-disabled {
444	+ background: #f4f4f4;
445	+ display: list-item;
446	+ cursor: default;
447	+ }
448	+
449	+ .select2-results .select2-selected {
450	+ display: none;
451	+ }
452	+
453	+ .select2-more-results.select2-active {
454	+ background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
455	+ }
456	+
457	+ .select2-results .select2-ajax-error {
458	+ background: rgba(255, 50, 50, .2);
459	+ }
460	+
461	+ .select2-more-results {
462	+ background: #f4f4f4;
463	+ display: list-item;
464	+ }
465	+
466	+ /* disabled styles */
467	+
468	+ .select2-container.select2-container-disabled .select2-choice {
469	+ background-color: #f4f4f4;
470	+ background-image: none;
471	+ border: 1px solid #ddd;
472	+ cursor: default;
473	+ }
474	+
475	+ .select2-container.select2-container-disabled .select2-choice .select2-arrow {
476	+ background-color: #f4f4f4;
477	+ background-image: none;
478	+ border-left: 0;
479	+ }
480	+
481	+ .select2-container.select2-container-disabled .select2-choice abbr {
482	+ display: none;
483	+ }
484	+
485	+
486	+ /* multiselect */
487	+
488	+ .select2-container-multi .select2-choices {
489	+ height: auto !important;
490	+ height: 1%;
491	+ margin: 0;
492	+ padding: 0 5px 0 0;
493	+ position: relative;
494	+
495	+ border: 1px solid #aaa;
496	+ cursor: text;
497	+ overflow: hidden;
498	+
499	+ background-color: #fff;
500	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
501	+ background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
502	+ background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
503	+ background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
504	+ }
505	+
506	+ html[dir="rtl"] .select2-container-multi .select2-choices {
507	+ padding: 0 0 0 5px;
508	+ }
509	+
510	+ .select2-locked {
511	+ padding: 3px 5px 3px 5px !important;
512	+ }
513	+
514	+ .select2-container-multi .select2-choices {
515	+ min-height: 26px;
516	+ }
517	+
518	+ .select2-container-multi.select2-container-active .select2-choices {
519	+ border: 1px solid #5897fb;
520	+ outline: none;
521	+
522	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
523	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
524	+ }
525	+ .select2-container-multi .select2-choices li {
526	+ float: left;
527	+ list-style: none;
528	+ }
529	+ html[dir="rtl"] .select2-container-multi .select2-choices li
530	+ {
531	+ float: right;
532	+ }
533	+ .select2-container-multi .select2-choices .select2-search-field {
534	+ margin: 0;
535	+ padding: 0;
536	+ white-space: nowrap;
537	+ }
538	+
539	+ .select2-container-multi .select2-choices .select2-search-field input {
540	+ padding: 5px;
541	+ margin: 1px 0;
542	+
543	+ font-family: sans-serif;
544	+ font-size: 100%;
545	+ color: #666;
546	+ outline: 0;
547	+ border: 0;
548	+ -webkit-box-shadow: none;
549	+ box-shadow: none;
550	+ background: transparent !important;
551	+ }
552	+
553	+ .select2-container-multi .select2-choices .select2-search-field input.select2-active {
554	+ background: #fff url('select2-spinner.gif') no-repeat 100% !important;
555	+ }
556	+
557	+ .select2-default {
558	+ color: #999 !important;
559	+ }
560	+
561	+ .select2-container-multi .select2-choices .select2-search-choice {
562	+ padding: 3px 5px 3px 18px;
563	+ margin: 3px 0 3px 5px;
564	+ position: relative;
565	+
566	+ line-height: 13px;
567	+ color: #333;
568	+ cursor: default;
569	+ border: 1px solid #aaaaaa;
570	+
571	+ border-radius: 3px;
572	+
573	+ -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
574	+ box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
575	+
576	+ background-clip: padding-box;
577	+
578	+ -webkit-touch-callout: none;
579	+ -webkit-user-select: none;
580	+ -moz-user-select: none;
581	+ -ms-user-select: none;
582	+ user-select: none;
583	+
584	+ background-color: #e4e4e4;
585	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
586	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
587	+ background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
588	+ background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
589	+ background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
590	+ }
591	+ html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
592	+ {
593	+ margin: 3px 5px 3px 0;
594	+ padding: 3px 18px 3px 5px;
595	+ }
596	+ .select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
597	+ cursor: default;
598	+ }
599	+ .select2-container-multi .select2-choices .select2-search-choice-focus {
600	+ background: #d4d4d4;
601	+ }
602	+
603	+ .select2-search-choice-close {
604	+ display: block;
605	+ width: 12px;
606	+ height: 13px;
607	+ position: absolute;
608	+ right: 3px;
609	+ top: 4px;
610	+
611	+ font-size: 1px;
612	+ outline: none;
613	+ background: url('select2.png') right top no-repeat;
614	+ }
615	+ html[dir="rtl"] .select2-search-choice-close {
616	+ right: auto;
617	+ left: 3px;
618	+ }
619	+
620	+ .select2-container-multi .select2-search-choice-close {
621	+ left: 3px;
622	+ }
623	+
624	+ html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
625	+ left: auto;
626	+ right: 2px;
627	+ }
628	+
629	+ .select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
630	+ background-position: right -11px;
631	+ }
632	+ .select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
633	+ background-position: right -11px;
634	+ }
635	+
636	+ /* disabled styles */
637	+ .select2-container-multi.select2-container-disabled .select2-choices {
638	+ background-color: #f4f4f4;
639	+ background-image: none;
640	+ border: 1px solid #ddd;
641	+ cursor: default;
642	+ }
643	+
644	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
645	+ padding: 3px 5px 3px 5px;
646	+ border: 1px solid #ddd;
647	+ background-image: none;
648	+ background-color: #f4f4f4;
649	+ }
650	+
651	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
652	+ background: none;
653	+ }
654	+ /* end multiselect */
655	+
656	+
657	+ .select2-result-selectable .select2-match,
658	+ .select2-result-unselectable .select2-match {
659	+ text-decoration: underline;
660	+ }
661	+
662	+ .select2-offscreen, .select2-offscreen:focus {
663	+ clip: rect(0 0 0 0) !important;
664	+ width: 1px !important;
665	+ height: 1px !important;
666	+ border: 0 !important;
667	+ margin: 0 !important;
668	+ padding: 0 !important;
669	+ overflow: hidden !important;
670	+ position: absolute !important;
671	+ outline: 0 !important;
672	+ left: 0px !important;
673	+ top: 0px !important;
674	+ }
675	+
676	+ .select2-display-none {
677	+ display: none;
678	+ }
679	+
680	+ .select2-measure-scrollbar {
681	+ position: absolute;
682	+ top: -10000px;
683	+ left: -10000px;
684	+ width: 100px;
685	+ height: 100px;
686	+ overflow: scroll;
687	+ }
688	+
689	+ /* Retina-ize icons */
690	+
691	+ @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
692	+ .select2-search input,
693	+ .select2-search-choice-close,
694	+ .select2-container .select2-choice abbr,
695	+ .select2-container .select2-choice .select2-arrow b {
696	+ background-image: url('select2x2.png') !important;
697	+ background-repeat: no-repeat !important;
698	+ background-size: 60px 40px !important;
699	+ }
700	+
701	+ .select2-search input {
702	+ background-position: 100% -21px !important;
703	+ }
704	+ }

trunk/classes/admin/settings/assets/js/select2/select2.js ADDED Viewed

	@@ -0,0 +1,3541 @@


1	+ /*
2	+ Copyright 2012 Igor Vaynberg
3	+
4	+ Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
5	+
6	+ This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
7	+ General Public License version 2 (the "GPL License"). You may choose either license to govern your
8	+ use of this software only upon the condition that you accept all of the terms of either the Apache
9	+ License or the GPL License.
10	+
11	+ You may obtain a copy of the Apache License and the GPL License at:
12	+
13	+ http://www.apache.org/licenses/LICENSE-2.0
14	+ http://www.gnu.org/licenses/gpl-2.0.html
15	+
16	+ Unless required by applicable law or agreed to in writing, software distributed under the
17	+ Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
18	+ CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
19	+ the specific language governing permissions and limitations under the Apache License and the GPL License.
20	+ */
21	+ (function ($) {
22	+ if(typeof $.fn.each2 == "undefined") {
23	+ $.extend($.fn, {
24	+ /*
25	+ * 4-10 times faster .each replacement
26	+ * use it carefully, as it overrides jQuery context of element on each iteration
27	+ */
28	+ each2 : function (c) {
29	+ var j = $([0]), i = -1, l = this.length;
30	+ while (
31	+ ++i < l
32	+ && (j.context = j[0] = this[i])
33	+ && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
34	+ );
35	+ return this;
36	+ }
37	+ });
38	+ }
39	+ })(jQuery);
40	+
41	+ (function ($, undefined) {
42	+ "use strict";
43	+ /global document, window, jQuery, console /
44	+
45	+ if (window.Select2 !== undefined) {
46	+ return;
47	+ }
48	+
49	+ var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
50	+ lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
51	+
52	+ KEY = {
53	+ TAB: 9,
54	+ ENTER: 13,
55	+ ESC: 27,
56	+ SPACE: 32,
57	+ LEFT: 37,
58	+ UP: 38,
59	+ RIGHT: 39,
60	+ DOWN: 40,
61	+ SHIFT: 16,
62	+ CTRL: 17,
63	+ ALT: 18,
64	+ PAGE_UP: 33,
65	+ PAGE_DOWN: 34,
66	+ HOME: 36,
67	+ END: 35,
68	+ BACKSPACE: 8,
69	+ DELETE: 46,
70	+ isArrow: function (k) {
71	+ k = k.which ? k.which : k;
72	+ switch (k) {
73	+ case KEY.LEFT:
74	+ case KEY.RIGHT:
75	+ case KEY.UP:
76	+ case KEY.DOWN:
77	+ return true;
78	+ }
79	+ return false;
80	+ },
81	+ isControl: function (e) {
82	+ var k = e.which;
83	+ switch (k) {
84	+ case KEY.SHIFT:
85	+ case KEY.CTRL:
86	+ case KEY.ALT:
87	+ return true;
88	+ }
89	+
90	+ if (e.metaKey) return true;
91	+
92	+ return false;
93	+ },
94	+ isFunctionKey: function (k) {
95	+ k = k.which ? k.which : k;
96	+ return k >= 112 && k <= 123;
97	+ }
98	+ },
99	+ MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
100	+
101	+ DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
102	+
103	+ $document = $(document);
104	+
105	+ nextUid=(function() { var counter=1; return function() { return counter++; }; }());
106	+
107	+
108	+ function reinsertElement(element) {
109	+ var placeholder = $(document.createTextNode(''));
110	+
111	+ element.before(placeholder);
112	+ placeholder.before(element);
113	+ placeholder.remove();
114	+ }
115	+
116	+ function stripDiacritics(str) {
117	+ // Used 'uni range + named function' from http://jsperf.com/diacritics/18
118	+ function match(a) {
119	+ return DIACRITICS[a] \|\| a;
120	+ }
121	+
122	+ return str.replace(/[^\u0000-\u007E]/g, match);
123	+ }
124	+
125	+ function indexOf(value, array) {
126	+ var i = 0, l = array.length;
127	+ for (; i < l; i = i + 1) {
128	+ if (equal(value, array[i])) return i;
129	+ }
130	+ return -1;
131	+ }
132	+
133	+ function measureScrollbar () {
134	+ var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
135	+ $template.appendTo(document.body);
136	+
137	+ var dim = {
138	+ width: $template.width() - $template[0].clientWidth,
139	+ height: $template.height() - $template[0].clientHeight
140	+ };
141	+ $template.remove();
142	+
143	+ return dim;
144	+ }
145	+
146	+ /**
147	+ * Compares equality of a and b
148	+ * @param a
149	+ * @param b
150	+ */
151	+ function equal(a, b) {
152	+ if (a === b) return true;
153	+ if (a === undefined \|\| b === undefined) return false;
154	+ if (a === null \|\| b === null) return false;
155	+ // Check whether 'a' or 'b' is a string (primitive or object).
156	+ // The concatenation of an empty string (+'') converts its argument to a string's primitive.
157	+ if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
158	+ if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
159	+ return false;
160	+ }
161	+
162	+ /**
163	+ * Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
164	+ * strings
165	+ * @param string
166	+ * @param separator
167	+ */
168	+ function splitVal(string, separator, transform) {
169	+ var val, i, l;
170	+ if (string === null \|\| string.length < 1) return [];
171	+ val = string.split(separator);
172	+ for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
173	+ return val;
174	+ }
175	+
176	+ function getSideBorderPadding(element) {
177	+ return element.outerWidth(false) - element.width();
178	+ }
179	+
180	+ function installKeyUpChangeEvent(element) {
181	+ var key="keyup-change-value";
182	+ element.on("keydown", function () {
183	+ if ($.data(element, key) === undefined) {
184	+ $.data(element, key, element.val());
185	+ }
186	+ });
187	+ element.on("keyup", function () {
188	+ var val= $.data(element, key);
189	+ if (val !== undefined && element.val() !== val) {
190	+ $.removeData(element, key);
191	+ element.trigger("keyup-change");
192	+ }
193	+ });
194	+ }
195	+
196	+
197	+ /**
198	+ * filters mouse events so an event is fired only if the mouse moved.
199	+ *
200	+ * filters out mouse events that occur when mouse is stationary but
201	+ * the elements under the pointer are scrolled.
202	+ */
203	+ function installFilteredMouseMove(element) {
204	+ element.on("mousemove", function (e) {
205	+ var lastpos = lastMousePosition;
206	+ if (lastpos === undefined \|\| lastpos.x !== e.pageX \|\| lastpos.y !== e.pageY) {
207	+ $(e.target).trigger("mousemove-filtered", e);
208	+ }
209	+ });
210	+ }
211	+
212	+ /**
213	+ * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
214	+ * within the last quietMillis milliseconds.
215	+ *
216	+ * @param quietMillis number of milliseconds to wait before invoking fn
217	+ * @param fn function to be debounced
218	+ * @param ctx object to be used as this reference within fn
219	+ * @return debounced version of fn
220	+ */
221	+ function debounce(quietMillis, fn, ctx) {
222	+ ctx = ctx \|\| undefined;
223	+ var timeout;
224	+ return function () {
225	+ var args = arguments;
226	+ window.clearTimeout(timeout);
227	+ timeout = window.setTimeout(function() {
228	+ fn.apply(ctx, args);
229	+ }, quietMillis);
230	+ };
231	+ }
232	+
233	+ function installDebouncedScroll(threshold, element) {
234	+ var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
235	+ element.on("scroll", function (e) {
236	+ if (indexOf(e.target, element.get()) >= 0) notify(e);
237	+ });
238	+ }
239	+
240	+ function focus($el) {
241	+ if ($el[0] === document.activeElement) return;
242	+
243	+ /* set the focus in a 0 timeout - that way the focus is set after the processing
244	+ of the current event has finished - which seems like the only reliable way
245	+ to set focus */
246	+ window.setTimeout(function() {
247	+ var el=$el[0], pos=$el.val().length, range;
248	+
249	+ $el.focus();
250	+
251	+ /* make sure el received focus so we do not error out when trying to manipulate the caret.
252	+ sometimes modals or others listeners may steal it after its set */
253	+ var isVisible = (el.offsetWidth > 0 \|\| el.offsetHeight > 0);
254	+ if (isVisible && el === document.activeElement) {
255	+
256	+ /* after the focus is set move the caret to the end, necessary when we val()
257	+ just before setting focus */
258	+ if(el.setSelectionRange)
259	+ {
260	+ el.setSelectionRange(pos, pos);
261	+ }
262	+ else if (el.createTextRange) {
263	+ range = el.createTextRange();
264	+ range.collapse(false);
265	+ range.select();
266	+ }
267	+ }
268	+ }, 0);
269	+ }
270	+
271	+ function getCursorInfo(el) {
272	+ el = $(el)[0];
273	+ var offset = 0;
274	+ var length = 0;
275	+ if ('selectionStart' in el) {
276	+ offset = el.selectionStart;
277	+ length = el.selectionEnd - offset;
278	+ } else if ('selection' in document) {
279	+ el.focus();
280	+ var sel = document.selection.createRange();
281	+ length = document.selection.createRange().text.length;
282	+ sel.moveStart('character', -el.value.length);
283	+ offset = sel.text.length - length;
284	+ }
285	+ return { offset: offset, length: length };
286	+ }
287	+
288	+ function killEvent(event) {
289	+ event.preventDefault();
290	+ event.stopPropagation();
291	+ }
292	+ function killEventImmediately(event) {
293	+ event.preventDefault();
294	+ event.stopImmediatePropagation();
295	+ }
296	+
297	+ function measureTextWidth(e) {
298	+ if (!sizer){
299	+ var style = e[0].currentStyle \|\| window.getComputedStyle(e[0], null);
300	+ sizer = $(document.createElement("div")).css({
301	+ position: "absolute",
302	+ left: "-10000px",
303	+ top: "-10000px",
304	+ display: "none",
305	+ fontSize: style.fontSize,
306	+ fontFamily: style.fontFamily,
307	+ fontStyle: style.fontStyle,
308	+ fontWeight: style.fontWeight,
309	+ letterSpacing: style.letterSpacing,
310	+ textTransform: style.textTransform,
311	+ whiteSpace: "nowrap"
312	+ });
313	+ sizer.attr("class","select2-sizer");
314	+ $(document.body).append(sizer);
315	+ }
316	+ sizer.text(e.val());
317	+ return sizer.width();
318	+ }
319	+
320	+ function syncCssClasses(dest, src, adapter) {
321	+ var classes, replacements = [], adapted;
322	+
323	+ classes = $.trim(dest.attr("class"));
324	+
325	+ if (classes) {
326	+ classes = '' + classes; // for IE which returns object
327	+
328	+ $(classes.split(/\s+/)).each2(function() {
329	+ if (this.indexOf("select2-") === 0) {
330	+ replacements.push(this);
331	+ }
332	+ });
333	+ }
334	+
335	+ classes = $.trim(src.attr("class"));
336	+
337	+ if (classes) {
338	+ classes = '' + classes; // for IE which returns object
339	+
340	+ $(classes.split(/\s+/)).each2(function() {
341	+ if (this.indexOf("select2-") !== 0) {
342	+ adapted = adapter(this);
343	+
344	+ if (adapted) {
345	+ replacements.push(adapted);
346	+ }
347	+ }
348	+ });
349	+ }
350	+
351	+ dest.attr("class", replacements.join(" "));
352	+ }
353	+
354	+
355	+ function markMatch(text, term, markup, escapeMarkup) {
356	+ var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
357	+ tl=term.length;
358	+
359	+ if (match<0) {
360	+ markup.push(escapeMarkup(text));
361	+ return;
362	+ }
363	+
364	+ markup.push(escapeMarkup(text.substring(0, match)));
365	+ markup.push("<span class='select2-match'>");
366	+ markup.push(escapeMarkup(text.substring(match, match + tl)));
367	+ markup.push("</span>");
368	+ markup.push(escapeMarkup(text.substring(match + tl, text.length)));
369	+ }
370	+
371	+ function defaultEscapeMarkup(markup) {
372	+ var replace_map = {
373	+ '\\': '\',
374	+ '&': '&',
375	+ '<': '<',
376	+ '>': '>',
377	+ '"': '"',
378	+ "'": ''',
379	+ "/": '/'
380	+ };
381	+
382	+ return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
383	+ return replace_map[match];
384	+ });
385	+ }
386	+
387	+ /**
388	+ * Produces an ajax-based query function
389	+ *
390	+ * @param options object containing configuration parameters
391	+ * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
392	+ * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
393	+ * @param options.url url for the data
394	+ * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
395	+ * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
396	+ * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
397	+ * @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
398	+ * The expected format is an object containing the following keys:
399	+ * results array of objects that will be used as choices
400	+ * more (optional) boolean indicating whether there are more results available
401	+ * Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
402	+ */
403	+ function ajax(options) {
404	+ var timeout, // current scheduled but not yet executed request
405	+ handler = null,
406	+ quietMillis = options.quietMillis \|\| 100,
407	+ ajaxUrl = options.url,
408	+ self = this;
409	+
410	+ return function (query) {
411	+ window.clearTimeout(timeout);
412	+ timeout = window.setTimeout(function () {
413	+ var data = options.data, // ajax data function
414	+ url = ajaxUrl, // ajax url string or function
415	+ transport = options.transport \|\| $.fn.select2.ajaxDefaults.transport,
416	+ // deprecated - to be removed in 4.0 - use params instead
417	+ deprecated = {
418	+ type: options.type \|\| 'GET', // set type of request (GET or POST)
419	+ cache: options.cache \|\| false,
420	+ jsonpCallback: options.jsonpCallback\|\|undefined,
421	+ dataType: options.dataType\|\|"json"
422	+ },
423	+ params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
424	+
425	+ data = data ? data.call(self, query.term, query.page, query.context) : null;
426	+ url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
427	+
428	+ if (handler && typeof handler.abort === "function") { handler.abort(); }
429	+
430	+ if (options.params) {
431	+ if ($.isFunction(options.params)) {
432	+ $.extend(params, options.params.call(self));
433	+ } else {
434	+ $.extend(params, options.params);
435	+ }
436	+ }
437	+
438	+ $.extend(params, {
439	+ url: url,
440	+ dataType: options.dataType,
441	+ data: data,
442	+ success: function (data) {
443	+ // TODO - replace query.page with query so users have access to term, page, etc.
444	+ // added query as third paramter to keep backwards compatibility
445	+ var results = options.results(data, query.page, query);
446	+ query.callback(results);
447	+ },
448	+ error: function(jqXHR, textStatus, errorThrown){
449	+ var results = {
450	+ hasError: true,
451	+ jqXHR: jqXHR,
452	+ textStatus: textStatus,
453	+ errorThrown: errorThrown
454	+ };
455	+
456	+ query.callback(results);
457	+ }
458	+ });
459	+ handler = transport.call(self, params);
460	+ }, quietMillis);
461	+ };
462	+ }
463	+
464	+ /**
465	+ * Produces a query function that works with a local array
466	+ *
467	+ * @param options object containing configuration parameters. The options parameter can either be an array or an
468	+ * object.
469	+ *
470	+ * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
471	+ *
472	+ * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
473	+ * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
474	+ * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
475	+ * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
476	+ * the text.
477	+ */
478	+ function local(options) {
479	+ var data = options, // data elements
480	+ dataText,
481	+ tmp,
482	+ text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
483	+
484	+ if ($.isArray(data)) {
485	+ tmp = data;
486	+ data = { results: tmp };
487	+ }
488	+
489	+ if ($.isFunction(data) === false) {
490	+ tmp = data;
491	+ data = function() { return tmp; };
492	+ }
493	+
494	+ var dataItem = data();
495	+ if (dataItem.text) {
496	+ text = dataItem.text;
497	+ // if text is not a function we assume it to be a key name
498	+ if (!$.isFunction(text)) {
499	+ dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
500	+ text = function (item) { return item[dataText]; };
501	+ }
502	+ }
503	+
504	+ return function (query) {
505	+ var t = query.term, filtered = { results: [] }, process;
506	+ if (t === "") {
507	+ query.callback(data());
508	+ return;
509	+ }
510	+
511	+ process = function(datum, collection) {
512	+ var group, attr;
513	+ datum = datum[0];
514	+ if (datum.children) {
515	+ group = {};
516	+ for (attr in datum) {
517	+ if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
518	+ }
519	+ group.children=[];
520	+ $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
521	+ if (group.children.length \|\| query.matcher(t, text(group), datum)) {
522	+ collection.push(group);
523	+ }
524	+ } else {
525	+ if (query.matcher(t, text(datum), datum)) {
526	+ collection.push(datum);
527	+ }
528	+ }
529	+ };
530	+
531	+ $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
532	+ query.callback(filtered);
533	+ };
534	+ }
535	+
536	+ // TODO javadoc
537	+ function tags(data) {
538	+ var isFunc = $.isFunction(data);
539	+ return function (query) {
540	+ var t = query.term, filtered = {results: []};
541	+ var result = isFunc ? data(query) : data;
542	+ if ($.isArray(result)) {
543	+ $(result).each(function () {
544	+ var isObject = this.text !== undefined,
545	+ text = isObject ? this.text : this;
546	+ if (t === "" \|\| query.matcher(t, text)) {
547	+ filtered.results.push(isObject ? this : {id: this, text: this});
548	+ }
549	+ });
550	+ query.callback(filtered);
551	+ }
552	+ };
553	+ }
554	+
555	+ /**
556	+ * Checks if the formatter function should be used.
557	+ *
558	+ * Throws an error if it is not a function. Returns true if it should be used,
559	+ * false if no formatting should be performed.
560	+ *
561	+ * @param formatter
562	+ */
563	+ function checkFormatter(formatter, formatterName) {
564	+ if ($.isFunction(formatter)) return true;
565	+ if (!formatter) return false;
566	+ if (typeof(formatter) === 'string') return true;
567	+ throw new Error(formatterName +" must be a string, function, or falsy value");
568	+ }
569	+
570	+ /**
571	+ * Returns a given value
572	+ * If given a function, returns its output
573	+ *
574	+ * @param val string\|function
575	+ * @param context value of "this" to be passed to function
576	+ * @returns {*}
577	+ */
578	+ function evaluate(val, context) {
579	+ if ($.isFunction(val)) {
580	+ var args = Array.prototype.slice.call(arguments, 2);
581	+ return val.apply(context, args);
582	+ }
583	+ return val;
584	+ }
585	+
586	+ function countResults(results) {
587	+ var count = 0;
588	+ $.each(results, function(i, item) {
589	+ if (item.children) {
590	+ count += countResults(item.children);
591	+ } else {
592	+ count++;
593	+ }
594	+ });
595	+ return count;
596	+ }
597	+
598	+ /**
599	+ * Default tokenizer. This function uses breaks the input on substring match of any string from the
600	+ * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
601	+ * two options have to be defined in order for the tokenizer to work.
602	+ *
603	+ * @param input text user has typed so far or pasted into the search field
604	+ * @param selection currently selected choices
605	+ * @param selectCallback function(choice) callback tho add the choice to selection
606	+ * @param opts select2's opts
607	+ * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
608	+ */
609	+ function defaultTokenizer(input, selection, selectCallback, opts) {
610	+ var original = input, // store the original so we can compare and know if we need to tell the search to update its text
611	+ dupe = false, // check for whether a token we extracted represents a duplicate selected choice
612	+ token, // token
613	+ index, // position at which the separator was found
614	+ i, l, // looping variables
615	+ separator; // the matched separator
616	+
617	+ if (!opts.createSearchChoice \|\| !opts.tokenSeparators \|\| opts.tokenSeparators.length < 1) return undefined;
618	+
619	+ while (true) {
620	+ index = -1;
621	+
622	+ for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
623	+ separator = opts.tokenSeparators[i];
624	+ index = input.indexOf(separator);
625	+ if (index >= 0) break;
626	+ }
627	+
628	+ if (index < 0) break; // did not find any token separator in the input string, bail
629	+
630	+ token = input.substring(0, index);
631	+ input = input.substring(index + separator.length);
632	+
633	+ if (token.length > 0) {
634	+ token = opts.createSearchChoice.call(this, token, selection);
635	+ if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
636	+ dupe = false;
637	+ for (i = 0, l = selection.length; i < l; i++) {
638	+ if (equal(opts.id(token), opts.id(selection[i]))) {
639	+ dupe = true; break;
640	+ }
641	+ }
642	+
643	+ if (!dupe) selectCallback(token);
644	+ }
645	+ }
646	+ }
647	+
648	+ if (original!==input) return input;
649	+ }
650	+
651	+ function cleanupJQueryElements() {
652	+ var self = this;
653	+
654	+ $.each(arguments, function (i, element) {
655	+ self[element].remove();
656	+ self[element] = null;
657	+ });
658	+ }
659	+
660	+ /**
661	+ * Creates a new class
662	+ *
663	+ * @param superClass
664	+ * @param methods
665	+ */
666	+ function clazz(SuperClass, methods) {
667	+ var constructor = function () {};
668	+ constructor.prototype = new SuperClass;
669	+ constructor.prototype.constructor = constructor;
670	+ constructor.prototype.parent = SuperClass.prototype;
671	+ constructor.prototype = $.extend(constructor.prototype, methods);
672	+ return constructor;
673	+ }
674	+
675	+ AbstractSelect2 = clazz(Object, {
676	+
677	+ // abstract
678	+ bind: function (func) {
679	+ var self = this;
680	+ return function () {
681	+ func.apply(self, arguments);
682	+ };
683	+ },
684	+
685	+ // abstract
686	+ init: function (opts) {
687	+ var results, search, resultsSelector = ".select2-results";
688	+
689	+ // prepare options
690	+ this.opts = opts = this.prepareOpts(opts);
691	+
692	+ this.id=opts.id;
693	+
694	+ // destroy if called on an existing component
695	+ if (opts.element.data("select2") !== undefined &&
696	+ opts.element.data("select2") !== null) {
697	+ opts.element.data("select2").destroy();
698	+ }
699	+
700	+ this.container = this.createContainer();
701	+
702	+ this.liveRegion = $('.select2-hidden-accessible');
703	+ if (this.liveRegion.length == 0) {
704	+ this.liveRegion = $("<span>", {
705	+ role: "status",
706	+ "aria-live": "polite"
707	+ })
708	+ .addClass("select2-hidden-accessible")
709	+ .appendTo(document.body);
710	+ }
711	+
712	+ this.containerId="s2id_"+(opts.element.attr("id") \|\| "autogen"+nextUid());
713	+ this.containerEventName= this.containerId
714	+ .replace(/([.])/g, '_')
715	+ .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]=>\\|])/g, '\\$1');
716	+ this.container.attr("id", this.containerId);
717	+
718	+ this.container.attr("title", opts.element.attr("title"));
719	+
720	+ this.body = $(document.body);
721	+
722	+ syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
723	+
724	+ this.container.attr("style", opts.element.attr("style"));
725	+ this.container.css(evaluate(opts.containerCss, this.opts.element));
726	+ this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
727	+
728	+ this.elementTabIndex = this.opts.element.attr("tabindex");
729	+
730	+ // swap container for the element
731	+ this.opts.element
732	+ .data("select2", this)
733	+ .attr("tabindex", "-1")
734	+ .before(this.container)
735	+ .on("click.select2", killEvent); // do not leak click events
736	+
737	+ this.container.data("select2", this);
738	+
739	+ this.dropdown = this.container.find(".select2-drop");
740	+
741	+ syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
742	+
743	+ this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
744	+ this.dropdown.data("select2", this);
745	+ this.dropdown.on("click", killEvent);
746	+
747	+ this.results = results = this.container.find(resultsSelector);
748	+ this.search = search = this.container.find("input.select2-input");
749	+
750	+ this.queryCount = 0;
751	+ this.resultsPage = 0;
752	+ this.context = null;
753	+
754	+ // initialize the container
755	+ this.initContainer();
756	+
757	+ this.container.on("click", killEvent);
758	+
759	+ installFilteredMouseMove(this.results);
760	+
761	+ this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
762	+ this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
763	+ this._touchEvent = true;
764	+ this.highlightUnderEvent(event);
765	+ }));
766	+ this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
767	+ this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
768	+
769	+ // Waiting for a click event on touch devices to select option and hide dropdown
770	+ // otherwise click will be triggered on an underlying element
771	+ this.dropdown.on('click', this.bind(function (event) {
772	+ if (this._touchEvent) {
773	+ this._touchEvent = false;
774	+ this.selectHighlighted();
775	+ }
776	+ }));
777	+
778	+ installDebouncedScroll(80, this.results);
779	+ this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
780	+
781	+ // do not propagate change event from the search field out of the component
782	+ $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
783	+ $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
784	+
785	+ // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
786	+ if ($.fn.mousewheel) {
787	+ results.mousewheel(function (e, delta, deltaX, deltaY) {
788	+ var top = results.scrollTop();
789	+ if (deltaY > 0 && top - deltaY <= 0) {
790	+ results.scrollTop(0);
791	+ killEvent(e);
792	+ } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
793	+ results.scrollTop(results.get(0).scrollHeight - results.height());
794	+ killEvent(e);
795	+ }
796	+ });
797	+ }
798	+
799	+ installKeyUpChangeEvent(search);
800	+ search.on("keyup-change input paste", this.bind(this.updateResults));
801	+ search.on("focus", function () { search.addClass("select2-focused"); });
802	+ search.on("blur", function () { search.removeClass("select2-focused");});
803	+
804	+ this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
805	+ if ($(e.target).closest(".select2-result-selectable").length > 0) {
806	+ this.highlightUnderEvent(e);
807	+ this.selectHighlighted(e);
808	+ }
809	+ }));
810	+
811	+ // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
812	+ // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
813	+ // dom it will trigger the popup close, which is not what we want
814	+ // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
815	+ this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
816	+
817	+ this.nextSearchTerm = undefined;
818	+
819	+ if ($.isFunction(this.opts.initSelection)) {
820	+ // initialize selection based on the current value of the source element
821	+ this.initSelection();
822	+
823	+ // if the user has provided a function that can set selection based on the value of the source element
824	+ // we monitor the change event on the element and trigger it, allowing for two way synchronization
825	+ this.monitorSource();
826	+ }
827	+
828	+ if (opts.maximumInputLength !== null) {
829	+ this.search.attr("maxlength", opts.maximumInputLength);
830	+ }
831	+
832	+ var disabled = opts.element.prop("disabled");
833	+ if (disabled === undefined) disabled = false;
834	+ this.enable(!disabled);
835	+
836	+ var readonly = opts.element.prop("readonly");
837	+ if (readonly === undefined) readonly = false;
838	+ this.readonly(readonly);
839	+
840	+ // Calculate size of scrollbar
841	+ scrollBarDimensions = scrollBarDimensions \|\| measureScrollbar();
842	+
843	+ this.autofocus = opts.element.prop("autofocus");
844	+ opts.element.prop("autofocus", false);
845	+ if (this.autofocus) this.focus();
846	+
847	+ this.search.attr("placeholder", opts.searchInputPlaceholder);
848	+ },
849	+
850	+ // abstract
851	+ destroy: function () {
852	+ var element=this.opts.element, select2 = element.data("select2"), self = this;
853	+
854	+ this.close();
855	+
856	+ if (element.length && element[0].detachEvent && self._sync) {
857	+ element.each(function () {
858	+ if (self._sync) {
859	+ this.detachEvent("onpropertychange", self._sync);
860	+ }
861	+ });
862	+ }
863	+ if (this.propertyObserver) {
864	+ this.propertyObserver.disconnect();
865	+ this.propertyObserver = null;
866	+ }
867	+ this._sync = null;
868	+
869	+ if (select2 !== undefined) {
870	+ select2.container.remove();
871	+ select2.liveRegion.remove();
872	+ select2.dropdown.remove();
873	+ element
874	+ .show()
875	+ .removeData("select2")
876	+ .off(".select2")
877	+ .prop("autofocus", this.autofocus \|\| false);
878	+ if (this.elementTabIndex) {
879	+ element.attr({tabindex: this.elementTabIndex});
880	+ } else {
881	+ element.removeAttr("tabindex");
882	+ }
883	+ element.show();
884	+ }
885	+
886	+ cleanupJQueryElements.call(this,
887	+ "container",
888	+ "liveRegion",
889	+ "dropdown",
890	+ "results",
891	+ "search"
892	+ );
893	+ },
894	+
895	+ // abstract
896	+ optionToData: function(element) {
897	+ if (element.is("option")) {
898	+ return {
899	+ id:element.prop("value"),
900	+ text:element.text(),
901	+ element: element.get(),
902	+ css: element.attr("class"),
903	+ disabled: element.prop("disabled"),
904	+ locked: equal(element.attr("locked"), "locked") \|\| equal(element.data("locked"), true)
905	+ };
906	+ } else if (element.is("optgroup")) {
907	+ return {
908	+ text:element.attr("label"),
909	+ children:[],
910	+ element: element.get(),
911	+ css: element.attr("class")
912	+ };
913	+ }
914	+ },
915	+
916	+ // abstract
917	+ prepareOpts: function (opts) {
918	+ var element, select, idKey, ajaxUrl, self = this;
919	+
920	+ element = opts.element;
921	+
922	+ if (element.get(0).tagName.toLowerCase() === "select") {
923	+ this.select = select = opts.element;
924	+ }
925	+
926	+ if (select) {
927	+ // these options are not allowed when attached to a select because they are picked up off the element itself
928	+ $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
929	+ if (this in opts) {
930	+ throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
931	+ }
932	+ });
933	+ }
934	+
935	+ opts = $.extend({}, {
936	+ populateResults: function(container, results, query) {
937	+ var populate, id=this.opts.id, liveRegion=this.liveRegion;
938	+
939	+ populate=function(results, container, depth) {
940	+
941	+ var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
942	+
943	+ results = opts.sortResults(results, container, query);
944	+
945	+ // collect the created nodes for bulk append
946	+ var nodes = [];
947	+ for (i = 0, l = results.length; i < l; i = i + 1) {
948	+
949	+ result=results[i];
950	+
951	+ disabled = (result.disabled === true);
952	+ selectable = (!disabled) && (id(result) !== undefined);
953	+
954	+ compound=result.children && result.children.length > 0;
955	+
956	+ node=$("<li></li>");
957	+ node.addClass("select2-results-dept-"+depth);
958	+ node.addClass("select2-result");
959	+ node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
960	+ if (disabled) { node.addClass("select2-disabled"); }
961	+ if (compound) { node.addClass("select2-result-with-children"); }
962	+ node.addClass(self.opts.formatResultCssClass(result));
963	+ node.attr("role", "presentation");
964	+
965	+ label=$(document.createElement("div"));
966	+ label.addClass("select2-result-label");
967	+ label.attr("id", "select2-result-label-" + nextUid());
968	+ label.attr("role", "option");
969	+
970	+ formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
971	+ if (formatted!==undefined) {
972	+ label.html(formatted);
973	+ node.append(label);
974	+ }
975	+
976	+
977	+ if (compound) {
978	+
979	+ innerContainer=$("<ul></ul>");
980	+ innerContainer.addClass("select2-result-sub");
981	+ populate(result.children, innerContainer, depth+1);
982	+ node.append(innerContainer);
983	+ }
984	+
985	+ node.data("select2-data", result);
986	+ nodes.push(node[0]);
987	+ }
988	+
989	+ // bulk append the created nodes
990	+ container.append(nodes);
991	+ liveRegion.text(opts.formatMatches(results.length));
992	+ };
993	+
994	+ populate(results, container, 0);
995	+ }
996	+ }, $.fn.select2.defaults, opts);
997	+
998	+ if (typeof(opts.id) !== "function") {
999	+ idKey = opts.id;
1000	+ opts.id = function (e) { return e[idKey]; };
1001	+ }
1002	+
1003	+ if ($.isArray(opts.element.data("select2Tags"))) {
1004	+ if ("tags" in opts) {
1005	+ throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
1006	+ }
1007	+ opts.tags=opts.element.data("select2Tags");
1008	+ }
1009	+
1010	+ if (select) {
1011	+ opts.query = this.bind(function (query) {
1012	+ var data = { results: [], more: false },
1013	+ term = query.term,
1014	+ children, placeholderOption, process;
1015	+
1016	+ process=function(element, collection) {
1017	+ var group;
1018	+ if (element.is("option")) {
1019	+ if (query.matcher(term, element.text(), element)) {
1020	+ collection.push(self.optionToData(element));
1021	+ }
1022	+ } else if (element.is("optgroup")) {
1023	+ group=self.optionToData(element);
1024	+ element.children().each2(function(i, elm) { process(elm, group.children); });
1025	+ if (group.children.length>0) {
1026	+ collection.push(group);
1027	+ }
1028	+ }
1029	+ };
1030	+
1031	+ children=element.children();
1032	+
1033	+ // ignore the placeholder option if there is one
1034	+ if (this.getPlaceholder() !== undefined && children.length > 0) {
1035	+ placeholderOption = this.getPlaceholderOption();
1036	+ if (placeholderOption) {
1037	+ children=children.not(placeholderOption);
1038	+ }
1039	+ }
1040	+
1041	+ children.each2(function(i, elm) { process(elm, data.results); });
1042	+
1043	+ query.callback(data);
1044	+ });
1045	+ // this is needed because inside val() we construct choices from options and their id is hardcoded
1046	+ opts.id=function(e) { return e.id; };
1047	+ } else {
1048	+ if (!("query" in opts)) {
1049	+
1050	+ if ("ajax" in opts) {
1051	+ ajaxUrl = opts.element.data("ajax-url");
1052	+ if (ajaxUrl && ajaxUrl.length > 0) {
1053	+ opts.ajax.url = ajaxUrl;
1054	+ }
1055	+ opts.query = ajax.call(opts.element, opts.ajax);
1056	+ } else if ("data" in opts) {
1057	+ opts.query = local(opts.data);
1058	+ } else if ("tags" in opts) {
1059	+ opts.query = tags(opts.tags);
1060	+ if (opts.createSearchChoice === undefined) {
1061	+ opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
1062	+ }
1063	+ if (opts.initSelection === undefined) {
1064	+ opts.initSelection = function (element, callback) {
1065	+ var data = [];
1066	+ $(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
1067	+ var obj = { id: this, text: this },
1068	+ tags = opts.tags;
1069	+ if ($.isFunction(tags)) tags=tags();
1070	+ $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
1071	+ data.push(obj);
1072	+ });
1073	+
1074	+ callback(data);
1075	+ };
1076	+ }
1077	+ }
1078	+ }
1079	+ }
1080	+ if (typeof(opts.query) !== "function") {
1081	+ throw "query function not defined for Select2 " + opts.element.attr("id");
1082	+ }
1083	+
1084	+ if (opts.createSearchChoicePosition === 'top') {
1085	+ opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
1086	+ }
1087	+ else if (opts.createSearchChoicePosition === 'bottom') {
1088	+ opts.createSearchChoicePosition = function(list, item) { list.push(item); };
1089	+ }
1090	+ else if (typeof(opts.createSearchChoicePosition) !== "function") {
1091	+ throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
1092	+ }
1093	+
1094	+ return opts;
1095	+ },
1096	+
1097	+ /**
1098	+ * Monitor the original element for changes and update select2 accordingly
1099	+ */
1100	+ // abstract
1101	+ monitorSource: function () {
1102	+ var el = this.opts.element, observer, self = this;
1103	+
1104	+ el.on("change.select2", this.bind(function (e) {
1105	+ if (this.opts.element.data("select2-change-triggered") !== true) {
1106	+ this.initSelection();
1107	+ }
1108	+ }));
1109	+
1110	+ this._sync = this.bind(function () {
1111	+
1112	+ // sync enabled state
1113	+ var disabled = el.prop("disabled");
1114	+ if (disabled === undefined) disabled = false;
1115	+ this.enable(!disabled);
1116	+
1117	+ var readonly = el.prop("readonly");
1118	+ if (readonly === undefined) readonly = false;
1119	+ this.readonly(readonly);
1120	+
1121	+ if (this.container) {
1122	+ syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
1123	+ this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
1124	+ }
1125	+
1126	+ if (this.dropdown) {
1127	+ syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
1128	+ this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
1129	+ }
1130	+
1131	+ });
1132	+
1133	+ // IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
1134	+ if (el.length && el[0].attachEvent) {
1135	+ el.each(function() {
1136	+ this.attachEvent("onpropertychange", self._sync);
1137	+ });
1138	+ }
1139	+
1140	+ // safari, chrome, firefox, IE11
1141	+ observer = window.MutationObserver \|\| window.WebKitMutationObserver\|\| window.MozMutationObserver;
1142	+ if (observer !== undefined) {
1143	+ if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
1144	+ this.propertyObserver = new observer(function (mutations) {
1145	+ $.each(mutations, self._sync);
1146	+ });
1147	+ this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
1148	+ }
1149	+ },
1150	+
1151	+ // abstract
1152	+ triggerSelect: function(data) {
1153	+ var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
1154	+ this.opts.element.trigger(evt);
1155	+ return !evt.isDefaultPrevented();
1156	+ },
1157	+
1158	+ /**
1159	+ * Triggers the change event on the source element
1160	+ */
1161	+ // abstract
1162	+ triggerChange: function (details) {
1163	+
1164	+ details = details \|\| {};
1165	+ details= $.extend({}, details, { type: "change", val: this.val() });
1166	+ // prevents recursive triggering
1167	+ this.opts.element.data("select2-change-triggered", true);
1168	+ this.opts.element.trigger(details);
1169	+ this.opts.element.data("select2-change-triggered", false);
1170	+
1171	+ // some validation frameworks ignore the change event and listen instead to keyup, click for selects
1172	+ // so here we trigger the click event manually
1173	+ this.opts.element.click();
1174	+
1175	+ // ValidationEngine ignores the change event and listens instead to blur
1176	+ // so here we trigger the blur event manually if so desired
1177	+ if (this.opts.blurOnChange)
1178	+ this.opts.element.blur();
1179	+ },
1180	+
1181	+ //abstract
1182	+ isInterfaceEnabled: function()
1183	+ {
1184	+ return this.enabledInterface === true;
1185	+ },
1186	+
1187	+ // abstract
1188	+ enableInterface: function() {
1189	+ var enabled = this._enabled && !this._readonly,
1190	+ disabled = !enabled;
1191	+
1192	+ if (enabled === this.enabledInterface) return false;
1193	+
1194	+ this.container.toggleClass("select2-container-disabled", disabled);
1195	+ this.close();
1196	+ this.enabledInterface = enabled;
1197	+
1198	+ return true;
1199	+ },
1200	+
1201	+ // abstract
1202	+ enable: function(enabled) {
1203	+ if (enabled === undefined) enabled = true;
1204	+ if (this._enabled === enabled) return;
1205	+ this._enabled = enabled;
1206	+
1207	+ this.opts.element.prop("disabled", !enabled);
1208	+ this.enableInterface();
1209	+ },
1210	+
1211	+ // abstract
1212	+ disable: function() {
1213	+ this.enable(false);
1214	+ },
1215	+
1216	+ // abstract
1217	+ readonly: function(enabled) {
1218	+ if (enabled === undefined) enabled = false;
1219	+ if (this._readonly === enabled) return;
1220	+ this._readonly = enabled;
1221	+
1222	+ this.opts.element.prop("readonly", enabled);
1223	+ this.enableInterface();
1224	+ },
1225	+
1226	+ // abstract
1227	+ opened: function () {
1228	+ return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
1229	+ },
1230	+
1231	+ // abstract
1232	+ positionDropdown: function() {
1233	+ var $dropdown = this.dropdown,
1234	+ container = this.container,
1235	+ offset = container.offset(),
1236	+ height = container.outerHeight(false),
1237	+ width = container.outerWidth(false),
1238	+ dropHeight = $dropdown.outerHeight(false),
1239	+ $window = $(window),
1240	+ windowWidth = $window.width(),
1241	+ windowHeight = $window.height(),
1242	+ viewPortRight = $window.scrollLeft() + windowWidth,
1243	+ viewportBottom = $window.scrollTop() + windowHeight,
1244	+ dropTop = offset.top + height,
1245	+ dropLeft = offset.left,
1246	+ enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
1247	+ enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
1248	+ dropWidth = $dropdown.outerWidth(false),
1249	+ enoughRoomOnRight = function() {
1250	+ return dropLeft + dropWidth <= viewPortRight;
1251	+ },
1252	+ enoughRoomOnLeft = function() {
1253	+ return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
1254	+ },
1255	+ aboveNow = $dropdown.hasClass("select2-drop-above"),
1256	+ bodyOffset,
1257	+ above,
1258	+ changeDirection,
1259	+ css,
1260	+ resultsListNode;
1261	+
1262	+ // always prefer the current above/below alignment, unless there is not enough room
1263	+ if (aboveNow) {
1264	+ above = true;
1265	+ if (!enoughRoomAbove && enoughRoomBelow) {
1266	+ changeDirection = true;
1267	+ above = false;
1268	+ }
1269	+ } else {
1270	+ above = false;
1271	+ if (!enoughRoomBelow && enoughRoomAbove) {
1272	+ changeDirection = true;
1273	+ above = true;
1274	+ }
1275	+ }
1276	+
1277	+ //if we are changing direction we need to get positions when dropdown is hidden;
1278	+ if (changeDirection) {
1279	+ $dropdown.hide();
1280	+ offset = this.container.offset();
1281	+ height = this.container.outerHeight(false);
1282	+ width = this.container.outerWidth(false);
1283	+ dropHeight = $dropdown.outerHeight(false);
1284	+ viewPortRight = $window.scrollLeft() + windowWidth;
1285	+ viewportBottom = $window.scrollTop() + windowHeight;
1286	+ dropTop = offset.top + height;
1287	+ dropLeft = offset.left;
1288	+ dropWidth = $dropdown.outerWidth(false);
1289	+ $dropdown.show();
1290	+
1291	+ // fix so the cursor does not move to the left within the search-textbox in IE
1292	+ this.focusSearch();
1293	+ }
1294	+
1295	+ if (this.opts.dropdownAutoWidth) {
1296	+ resultsListNode = $('.select2-results', $dropdown)[0];
1297	+ $dropdown.addClass('select2-drop-auto-width');
1298	+ $dropdown.css('width', '');
1299	+ // Add scrollbar width to dropdown if vertical scrollbar is present
1300	+ dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
1301	+ dropWidth > width ? width = dropWidth : dropWidth = width;
1302	+ dropHeight = $dropdown.outerHeight(false);
1303	+ }
1304	+ else {
1305	+ this.container.removeClass('select2-drop-auto-width');
1306	+ }
1307	+
1308	+ //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
1309	+ //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
1310	+
1311	+ // fix positioning when body has an offset and is not position: static
1312	+ if (this.body.css('position') !== 'static') {
1313	+ bodyOffset = this.body.offset();
1314	+ dropTop -= bodyOffset.top;
1315	+ dropLeft -= bodyOffset.left;
1316	+ }
1317	+
1318	+ if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
1319	+ dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
1320	+ }
1321	+
1322	+ css = {
1323	+ left: dropLeft,
1324	+ width: width
1325	+ };
1326	+
1327	+ if (above) {
1328	+ css.top = offset.top - dropHeight;
1329	+ css.bottom = 'auto';
1330	+ this.container.addClass("select2-drop-above");
1331	+ $dropdown.addClass("select2-drop-above");
1332	+ }
1333	+ else {
1334	+ css.top = dropTop;
1335	+ css.bottom = 'auto';
1336	+ this.container.removeClass("select2-drop-above");
1337	+ $dropdown.removeClass("select2-drop-above");
1338	+ }
1339	+ css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
1340	+
1341	+ $dropdown.css(css);
1342	+ },
1343	+
1344	+ // abstract
1345	+ shouldOpen: function() {
1346	+ var event;
1347	+
1348	+ if (this.opened()) return false;
1349	+
1350	+ if (this._enabled === false \|\| this._readonly === true) return false;
1351	+
1352	+ event = $.Event("select2-opening");
1353	+ this.opts.element.trigger(event);
1354	+ return !event.isDefaultPrevented();
1355	+ },
1356	+
1357	+ // abstract
1358	+ clearDropdownAlignmentPreference: function() {
1359	+ // clear the classes used to figure out the preference of where the dropdown should be opened
1360	+ this.container.removeClass("select2-drop-above");
1361	+ this.dropdown.removeClass("select2-drop-above");
1362	+ },
1363	+
1364	+ /**
1365	+ * Opens the dropdown
1366	+ *
1367	+ * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
1368	+ * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
1369	+ */
1370	+ // abstract
1371	+ open: function () {
1372	+
1373	+ if (!this.shouldOpen()) return false;
1374	+
1375	+ this.opening();
1376	+
1377	+ // Only bind the document mousemove when the dropdown is visible
1378	+ $document.on("mousemove.select2Event", function (e) {
1379	+ lastMousePosition.x = e.pageX;
1380	+ lastMousePosition.y = e.pageY;
1381	+ });
1382	+
1383	+ return true;
1384	+ },
1385	+
1386	+ /**
1387	+ * Performs the opening of the dropdown
1388	+ */
1389	+ // abstract
1390	+ opening: function() {
1391	+ var cid = this.containerEventName,
1392	+ scroll = "scroll." + cid,
1393	+ resize = "resize."+cid,
1394	+ orient = "orientationchange."+cid,
1395	+ mask;
1396	+
1397	+ this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
1398	+
1399	+ this.clearDropdownAlignmentPreference();
1400	+
1401	+ if(this.dropdown[0] !== this.body.children().last()[0]) {
1402	+ this.dropdown.detach().appendTo(this.body);
1403	+ }
1404	+
1405	+ // create the dropdown mask if doesn't already exist
1406	+ mask = $("#select2-drop-mask");
1407	+ if (mask.length === 0) {
1408	+ mask = $(document.createElement("div"));
1409	+ mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
1410	+ mask.hide();
1411	+ mask.appendTo(this.body);
1412	+ mask.on("mousedown touchstart click", function (e) {
1413	+ // Prevent IE from generating a click event on the body
1414	+ reinsertElement(mask);
1415	+
1416	+ var dropdown = $("#select2-drop"), self;
1417	+ if (dropdown.length > 0) {
1418	+ self=dropdown.data("select2");
1419	+ if (self.opts.selectOnBlur) {
1420	+ self.selectHighlighted({noFocus: true});
1421	+ }
1422	+ self.close();
1423	+ e.preventDefault();
1424	+ e.stopPropagation();
1425	+ }
1426	+ });
1427	+ }
1428	+
1429	+ // ensure the mask is always right before the dropdown
1430	+ if (this.dropdown.prev()[0] !== mask[0]) {
1431	+ this.dropdown.before(mask);
1432	+ }
1433	+
1434	+ // move the global id to the correct dropdown
1435	+ $("#select2-drop").removeAttr("id");
1436	+ this.dropdown.attr("id", "select2-drop");
1437	+
1438	+ // show the elements
1439	+ mask.show();
1440	+
1441	+ this.positionDropdown();
1442	+ this.dropdown.show();
1443	+ this.positionDropdown();
1444	+
1445	+ this.dropdown.addClass("select2-drop-active");
1446	+
1447	+ // attach listeners to events that can change the position of the container and thus require
1448	+ // the position of the dropdown to be updated as well so it does not come unglued from the container
1449	+ var that = this;
1450	+ this.container.parents().add(window).each(function () {
1451	+ $(this).on(resize+" "+scroll+" "+orient, function (e) {
1452	+ if (that.opened()) that.positionDropdown();
1453	+ });
1454	+ });
1455	+
1456	+
1457	+ },
1458	+
1459	+ // abstract
1460	+ close: function () {
1461	+ if (!this.opened()) return;
1462	+
1463	+ var cid = this.containerEventName,
1464	+ scroll = "scroll." + cid,
1465	+ resize = "resize."+cid,
1466	+ orient = "orientationchange."+cid;
1467	+
1468	+ // unbind event listeners
1469	+ this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
1470	+
1471	+ this.clearDropdownAlignmentPreference();
1472	+
1473	+ $("#select2-drop-mask").hide();
1474	+ this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
1475	+ this.dropdown.hide();
1476	+ this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
1477	+ this.results.empty();
1478	+
1479	+ // Now that the dropdown is closed, unbind the global document mousemove event
1480	+ $document.off("mousemove.select2Event");
1481	+
1482	+ this.clearSearch();
1483	+ this.search.removeClass("select2-active");
1484	+ this.opts.element.trigger($.Event("select2-close"));
1485	+ },
1486	+
1487	+ /**
1488	+ * Opens control, sets input value, and updates results.
1489	+ */
1490	+ // abstract
1491	+ externalSearch: function (term) {
1492	+ this.open();
1493	+ this.search.val(term);
1494	+ this.updateResults(false);
1495	+ },
1496	+
1497	+ // abstract
1498	+ clearSearch: function () {
1499	+
1500	+ },
1501	+
1502	+ //abstract
1503	+ getMaximumSelectionSize: function() {
1504	+ return evaluate(this.opts.maximumSelectionSize, this.opts.element);
1505	+ },
1506	+
1507	+ // abstract
1508	+ ensureHighlightVisible: function () {
1509	+ var results = this.results, children, index, child, hb, rb, y, more, topOffset;
1510	+
1511	+ index = this.highlight();
1512	+
1513	+ if (index < 0) return;
1514	+
1515	+ if (index == 0) {
1516	+
1517	+ // if the first element is highlighted scroll all the way to the top,
1518	+ // that way any unselectable headers above it will also be scrolled
1519	+ // into view
1520	+
1521	+ results.scrollTop(0);
1522	+ return;
1523	+ }
1524	+
1525	+ children = this.findHighlightableChoices().find('.select2-result-label');
1526	+
1527	+ child = $(children[index]);
1528	+
1529	+ topOffset = (child.offset() \|\| {}).top \|\| 0;
1530	+
1531	+ hb = topOffset + child.outerHeight(true);
1532	+
1533	+ // if this is the last child lets also make sure select2-more-results is visible
1534	+ if (index === children.length - 1) {
1535	+ more = results.find("li.select2-more-results");
1536	+ if (more.length > 0) {
1537	+ hb = more.offset().top + more.outerHeight(true);
1538	+ }
1539	+ }
1540	+
1541	+ rb = results.offset().top + results.outerHeight(false);
1542	+ if (hb > rb) {
1543	+ results.scrollTop(results.scrollTop() + (hb - rb));
1544	+ }
1545	+ y = topOffset - results.offset().top;
1546	+
1547	+ // make sure the top of the element is visible
1548	+ if (y < 0 && child.css('display') != 'none' ) {
1549	+ results.scrollTop(results.scrollTop() + y); // y is negative
1550	+ }
1551	+ },
1552	+
1553	+ // abstract
1554	+ findHighlightableChoices: function() {
1555	+ return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
1556	+ },
1557	+
1558	+ // abstract
1559	+ moveHighlight: function (delta) {
1560	+ var choices = this.findHighlightableChoices(),
1561	+ index = this.highlight();
1562	+
1563	+ while (index > -1 && index < choices.length) {
1564	+ index += delta;
1565	+ var choice = $(choices[index]);
1566	+ if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
1567	+ this.highlight(index);
1568	+ break;
1569	+ }
1570	+ }
1571	+ },
1572	+
1573	+ // abstract
1574	+ highlight: function (index) {
1575	+ var choices = this.findHighlightableChoices(),
1576	+ choice,
1577	+ data;
1578	+
1579	+ if (arguments.length === 0) {
1580	+ return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
1581	+ }
1582	+
1583	+ if (index >= choices.length) index = choices.length - 1;
1584	+ if (index < 0) index = 0;
1585	+
1586	+ this.removeHighlight();
1587	+
1588	+ choice = $(choices[index]);
1589	+ choice.addClass("select2-highlighted");
1590	+
1591	+ // ensure assistive technology can determine the active choice
1592	+ this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
1593	+
1594	+ this.ensureHighlightVisible();
1595	+
1596	+ this.liveRegion.text(choice.text());
1597	+
1598	+ data = choice.data("select2-data");
1599	+ if (data) {
1600	+ this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
1601	+ }
1602	+ },
1603	+
1604	+ removeHighlight: function() {
1605	+ this.results.find(".select2-highlighted").removeClass("select2-highlighted");
1606	+ },
1607	+
1608	+ touchMoved: function() {
1609	+ this._touchMoved = true;
1610	+ },
1611	+
1612	+ clearTouchMoved: function() {
1613	+ this._touchMoved = false;
1614	+ },
1615	+
1616	+ // abstract
1617	+ countSelectableResults: function() {
1618	+ return this.findHighlightableChoices().length;
1619	+ },
1620	+
1621	+ // abstract
1622	+ highlightUnderEvent: function (event) {
1623	+ var el = $(event.target).closest(".select2-result-selectable");
1624	+ if (el.length > 0 && !el.is(".select2-highlighted")) {
1625	+ var choices = this.findHighlightableChoices();
1626	+ this.highlight(choices.index(el));
1627	+ } else if (el.length == 0) {
1628	+ // if we are over an unselectable item remove all highlights
1629	+ this.removeHighlight();
1630	+ }
1631	+ },
1632	+
1633	+ // abstract
1634	+ loadMoreIfNeeded: function () {
1635	+ var results = this.results,
1636	+ more = results.find("li.select2-more-results"),
1637	+ below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
1638	+ page = this.resultsPage + 1,
1639	+ self=this,
1640	+ term=this.search.val(),
1641	+ context=this.context;
1642	+
1643	+ if (more.length === 0) return;
1644	+ below = more.offset().top - results.offset().top - results.height();
1645	+
1646	+ if (below <= this.opts.loadMorePadding) {
1647	+ more.addClass("select2-active");
1648	+ this.opts.query({
1649	+ element: this.opts.element,
1650	+ term: term,
1651	+ page: page,
1652	+ context: context,
1653	+ matcher: this.opts.matcher,
1654	+ callback: this.bind(function (data) {
1655	+
1656	+ // ignore a response if the select2 has been closed before it was received
1657	+ if (!self.opened()) return;
1658	+
1659	+
1660	+ self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
1661	+ self.postprocessResults(data, false, false);
1662	+
1663	+ if (data.more===true) {
1664	+ more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
1665	+ window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
1666	+ } else {
1667	+ more.remove();
1668	+ }
1669	+ self.positionDropdown();
1670	+ self.resultsPage = page;
1671	+ self.context = data.context;
1672	+ this.opts.element.trigger({ type: "select2-loaded", items: data });
1673	+ })});
1674	+ }
1675	+ },
1676	+
1677	+ /**
1678	+ * Default tokenizer function which does nothing
1679	+ */
1680	+ tokenize: function() {
1681	+
1682	+ },
1683	+
1684	+ /**
1685	+ * @param initial whether or not this is the call to this method right after the dropdown has been opened
1686	+ */
1687	+ // abstract
1688	+ updateResults: function (initial) {
1689	+ var search = this.search,
1690	+ results = this.results,
1691	+ opts = this.opts,
1692	+ data,
1693	+ self = this,
1694	+ input,
1695	+ term = search.val(),
1696	+ lastTerm = $.data(this.container, "select2-last-term"),
1697	+ // sequence number used to drop out-of-order responses
1698	+ queryNumber;
1699	+
1700	+ // prevent duplicate queries against the same term
1701	+ if (initial !== true && lastTerm && equal(term, lastTerm)) return;
1702	+
1703	+ $.data(this.container, "select2-last-term", term);
1704	+
1705	+ // if the search is currently hidden we do not alter the results
1706	+ if (initial !== true && (this.showSearchInput === false \|\| !this.opened())) {
1707	+ return;
1708	+ }
1709	+
1710	+ function postRender() {
1711	+ search.removeClass("select2-active");
1712	+ self.positionDropdown();
1713	+ if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
1714	+ self.liveRegion.text(results.text());
1715	+ }
1716	+ else {
1717	+ self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
1718	+ }
1719	+ }
1720	+
1721	+ function render(html) {
1722	+ results.html(html);
1723	+ postRender();
1724	+ }
1725	+
1726	+ queryNumber = ++this.queryCount;
1727	+
1728	+ var maxSelSize = this.getMaximumSelectionSize();
1729	+ if (maxSelSize >=1) {
1730	+ data = this.data();
1731	+ if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
1732	+ render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
1733	+ return;
1734	+ }
1735	+ }
1736	+
1737	+ if (search.val().length < opts.minimumInputLength) {
1738	+ if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
1739	+ render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
1740	+ } else {
1741	+ render("");
1742	+ }
1743	+ if (initial && this.showSearch) this.showSearch(true);
1744	+ return;
1745	+ }
1746	+
1747	+ if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
1748	+ if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
1749	+ render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
1750	+ } else {
1751	+ render("");
1752	+ }
1753	+ return;
1754	+ }
1755	+
1756	+ if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
1757	+ render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
1758	+ }
1759	+
1760	+ search.addClass("select2-active");
1761	+
1762	+ this.removeHighlight();
1763	+
1764	+ // give the tokenizer a chance to pre-process the input
1765	+ input = this.tokenize();
1766	+ if (input != undefined && input != null) {
1767	+ search.val(input);
1768	+ }
1769	+
1770	+ this.resultsPage = 1;
1771	+
1772	+ opts.query({
1773	+ element: opts.element,
1774	+ term: search.val(),
1775	+ page: this.resultsPage,
1776	+ context: null,
1777	+ matcher: opts.matcher,
1778	+ callback: this.bind(function (data) {
1779	+ var def; // default choice
1780	+
1781	+ // ignore old responses
1782	+ if (queryNumber != this.queryCount) {
1783	+ return;
1784	+ }
1785	+
1786	+ // ignore a response if the select2 has been closed before it was received
1787	+ if (!this.opened()) {
1788	+ this.search.removeClass("select2-active");
1789	+ return;
1790	+ }
1791	+
1792	+ // handle ajax error
1793	+ if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
1794	+ render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
1795	+ return;
1796	+ }
1797	+
1798	+ // save context, if any
1799	+ this.context = (data.context===undefined) ? null : data.context;
1800	+ // create a default choice and prepend it to the list
1801	+ if (this.opts.createSearchChoice && search.val() !== "") {
1802	+ def = this.opts.createSearchChoice.call(self, search.val(), data.results);
1803	+ if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
1804	+ if ($(data.results).filter(
1805	+ function () {
1806	+ return equal(self.id(this), self.id(def));
1807	+ }).length === 0) {
1808	+ this.opts.createSearchChoicePosition(data.results, def);
1809	+ }
1810	+ }
1811	+ }
1812	+
1813	+ if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
1814	+ render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
1815	+ return;
1816	+ }
1817	+
1818	+ results.empty();
1819	+ self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
1820	+
1821	+ if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
1822	+ results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
1823	+ window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
1824	+ }
1825	+
1826	+ this.postprocessResults(data, initial);
1827	+
1828	+ postRender();
1829	+
1830	+ this.opts.element.trigger({ type: "select2-loaded", items: data });
1831	+ })});
1832	+ },
1833	+
1834	+ // abstract
1835	+ cancel: function () {
1836	+ this.close();
1837	+ },
1838	+
1839	+ // abstract
1840	+ blur: function () {
1841	+ // if selectOnBlur == true, select the currently highlighted option
1842	+ if (this.opts.selectOnBlur)
1843	+ this.selectHighlighted({noFocus: true});
1844	+
1845	+ this.close();
1846	+ this.container.removeClass("select2-container-active");
1847	+ // synonymous to .is(':focus'), which is available in jquery >= 1.6
1848	+ if (this.search[0] === document.activeElement) { this.search.blur(); }
1849	+ this.clearSearch();
1850	+ this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
1851	+ },
1852	+
1853	+ // abstract
1854	+ focusSearch: function () {
1855	+ focus(this.search);
1856	+ },
1857	+
1858	+ // abstract
1859	+ selectHighlighted: function (options) {
1860	+ if (this._touchMoved) {
1861	+ this.clearTouchMoved();
1862	+ return;
1863	+ }
1864	+ var index=this.highlight(),
1865	+ highlighted=this.results.find(".select2-highlighted"),
1866	+ data = highlighted.closest('.select2-result').data("select2-data");
1867	+
1868	+ if (data) {
1869	+ this.highlight(index);
1870	+ this.onSelect(data, options);
1871	+ } else if (options && options.noFocus) {
1872	+ this.close();
1873	+ }
1874	+ },
1875	+
1876	+ // abstract
1877	+ getPlaceholder: function () {
1878	+ var placeholderOption;
1879	+ return this.opts.element.attr("placeholder") \|\|
1880	+ this.opts.element.attr("data-placeholder") \|\| // jquery 1.4 compat
1881	+ this.opts.element.data("placeholder") \|\|
1882	+ this.opts.placeholder \|\|
1883	+ ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
1884	+ },
1885	+
1886	+ // abstract
1887	+ getPlaceholderOption: function() {
1888	+ if (this.select) {
1889	+ var firstOption = this.select.children('option').first();
1890	+ if (this.opts.placeholderOption !== undefined ) {
1891	+ //Determine the placeholder option based on the specified placeholderOption setting
1892	+ return (this.opts.placeholderOption === "first" && firstOption) \|\|
1893	+ (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
1894	+ } else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
1895	+ //No explicit placeholder option specified, use the first if it's blank
1896	+ return firstOption;
1897	+ }
1898	+ }
1899	+ },
1900	+
1901	+ /**
1902	+ * Get the desired width for the container element. This is
1903	+ * derived first from option `width` passed to select2, then
1904	+ * the inline 'style' on the original element, and finally
1905	+ * falls back to the jQuery calculated element width.
1906	+ */
1907	+ // abstract
1908	+ initContainerWidth: function () {
1909	+ function resolveContainerWidth() {
1910	+ var style, attrs, matches, i, l, attr;
1911	+
1912	+ if (this.opts.width === "off") {
1913	+ return null;
1914	+ } else if (this.opts.width === "element"){
1915	+ return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
1916	+ } else if (this.opts.width === "copy" \|\| this.opts.width === "resolve") {
1917	+ // check if there is inline style on the element that contains width
1918	+ style = this.opts.element.attr('style');
1919	+ if (style !== undefined) {
1920	+ attrs = style.split(';');
1921	+ for (i = 0, l = attrs.length; i < l; i = i + 1) {
1922	+ attr = attrs[i].replace(/\s/g, '');
1923	+ matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px\|em\|ex\|%\|in\|cm\|mm\|pt\|pc))/i);
1924	+ if (matches !== null && matches.length >= 1)
1925	+ return matches[1];
1926	+ }
1927	+ }
1928	+
1929	+ if (this.opts.width === "resolve") {
1930	+ // next check if css('width') can resolve a width that is percent based, this is sometimes possible
1931	+ // when attached to input type=hidden or elements hidden via css
1932	+ style = this.opts.element.css('width');
1933	+ if (style.indexOf("%") > 0) return style;
1934	+
1935	+ // finally, fallback on the calculated width of the element
1936	+ return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
1937	+ }
1938	+
1939	+ return null;
1940	+ } else if ($.isFunction(this.opts.width)) {
1941	+ return this.opts.width();
1942	+ } else {
1943	+ return this.opts.width;
1944	+ }
1945	+ };
1946	+
1947	+ var width = resolveContainerWidth.call(this);
1948	+ if (width !== null) {
1949	+ this.container.css("width", width);
1950	+ }
1951	+ }
1952	+ });
1953	+
1954	+ SingleSelect2 = clazz(AbstractSelect2, {
1955	+
1956	+ // single
1957	+
1958	+ createContainer: function () {
1959	+ var container = $(document.createElement("div")).attr({
1960	+ "class": "select2-container"
1961	+ }).html([
1962	+ "<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
1963	+ " <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
1964	+ " <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
1965	+ "</a>",
1966	+ "<label for='' class='select2-offscreen'></label>",
1967	+ "<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
1968	+ "<div class='select2-drop select2-display-none'>",
1969	+ " <div class='select2-search'>",
1970	+ " <label for='' class='select2-offscreen'></label>",
1971	+ " <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
1972	+ " aria-autocomplete='list' />",
1973	+ " </div>",
1974	+ " <ul class='select2-results' role='listbox'>",
1975	+ " </ul>",
1976	+ "</div>"].join(""));
1977	+ return container;
1978	+ },
1979	+
1980	+ // single
1981	+ enableInterface: function() {
1982	+ if (this.parent.enableInterface.apply(this, arguments)) {
1983	+ this.focusser.prop("disabled", !this.isInterfaceEnabled());
1984	+ }
1985	+ },
1986	+
1987	+ // single
1988	+ opening: function () {
1989	+ var el, range, len;
1990	+
1991	+ if (this.opts.minimumResultsForSearch >= 0) {
1992	+ this.showSearch(true);
1993	+ }
1994	+
1995	+ this.parent.opening.apply(this, arguments);
1996	+
1997	+ if (this.showSearchInput !== false) {
1998	+ // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
1999	+ // all other browsers handle this just fine
2000	+
2001	+ this.search.val(this.focusser.val());
2002	+ }
2003	+ if (this.opts.shouldFocusInput(this)) {
2004	+ this.search.focus();
2005	+ // move the cursor to the end after focussing, otherwise it will be at the beginning and
2006	+ // new text will appear before focusser.val()
2007	+ el = this.search.get(0);
2008	+ if (el.createTextRange) {
2009	+ range = el.createTextRange();
2010	+ range.collapse(false);
2011	+ range.select();
2012	+ } else if (el.setSelectionRange) {
2013	+ len = this.search.val().length;
2014	+ el.setSelectionRange(len, len);
2015	+ }
2016	+ }
2017	+
2018	+ // initializes search's value with nextSearchTerm (if defined by user)
2019	+ // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
2020	+ if(this.search.val() === "") {
2021	+ if(this.nextSearchTerm != undefined){
2022	+ this.search.val(this.nextSearchTerm);
2023	+ this.search.select();
2024	+ }
2025	+ }
2026	+
2027	+ this.focusser.prop("disabled", true).val("");
2028	+ this.updateResults(true);
2029	+ this.opts.element.trigger($.Event("select2-open"));
2030	+ },
2031	+
2032	+ // single
2033	+ close: function () {
2034	+ if (!this.opened()) return;
2035	+ this.parent.close.apply(this, arguments);
2036	+
2037	+ this.focusser.prop("disabled", false);
2038	+
2039	+ if (this.opts.shouldFocusInput(this)) {
2040	+ this.focusser.focus();
2041	+ }
2042	+ },
2043	+
2044	+ // single
2045	+ focus: function () {
2046	+ if (this.opened()) {
2047	+ this.close();
2048	+ } else {
2049	+ this.focusser.prop("disabled", false);
2050	+ if (this.opts.shouldFocusInput(this)) {
2051	+ this.focusser.focus();
2052	+ }
2053	+ }
2054	+ },
2055	+
2056	+ // single
2057	+ isFocused: function () {
2058	+ return this.container.hasClass("select2-container-active");
2059	+ },
2060	+
2061	+ // single
2062	+ cancel: function () {
2063	+ this.parent.cancel.apply(this, arguments);
2064	+ this.focusser.prop("disabled", false);
2065	+
2066	+ if (this.opts.shouldFocusInput(this)) {
2067	+ this.focusser.focus();
2068	+ }
2069	+ },
2070	+
2071	+ // single
2072	+ destroy: function() {
2073	+ $("label[for='" + this.focusser.attr('id') + "']")
2074	+ .attr('for', this.opts.element.attr("id"));
2075	+ this.parent.destroy.apply(this, arguments);
2076	+
2077	+ cleanupJQueryElements.call(this,
2078	+ "selection",
2079	+ "focusser"
2080	+ );
2081	+ },
2082	+
2083	+ // single
2084	+ initContainer: function () {
2085	+
2086	+ var selection,
2087	+ container = this.container,
2088	+ dropdown = this.dropdown,
2089	+ idSuffix = nextUid(),
2090	+ elementLabel;
2091	+
2092	+ if (this.opts.minimumResultsForSearch < 0) {
2093	+ this.showSearch(false);
2094	+ } else {
2095	+ this.showSearch(true);
2096	+ }
2097	+
2098	+ this.selection = selection = container.find(".select2-choice");
2099	+
2100	+ this.focusser = container.find(".select2-focusser");
2101	+
2102	+ // add aria associations
2103	+ selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
2104	+ this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
2105	+ this.results.attr("id", "select2-results-"+idSuffix);
2106	+ this.search.attr("aria-owns", "select2-results-"+idSuffix);
2107	+
2108	+ // rewrite labels from original element to focusser
2109	+ this.focusser.attr("id", "s2id_autogen"+idSuffix);
2110	+
2111	+ elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
2112	+ this.opts.element.focus(this.bind(function () { this.focus(); }));
2113	+
2114	+ this.focusser.prev()
2115	+ .text(elementLabel.text())
2116	+ .attr('for', this.focusser.attr('id'));
2117	+
2118	+ // Ensure the original element retains an accessible name
2119	+ var originalTitle = this.opts.element.attr("title");
2120	+ this.opts.element.attr("title", (originalTitle \|\| elementLabel.text()));
2121	+
2122	+ this.focusser.attr("tabindex", this.elementTabIndex);
2123	+
2124	+ // write label for search field using the label from the focusser element
2125	+ this.search.attr("id", this.focusser.attr('id') + '_search');
2126	+
2127	+ this.search.prev()
2128	+ .text($("label[for='" + this.focusser.attr('id') + "']").text())
2129	+ .attr('for', this.search.attr('id'));
2130	+
2131	+ this.search.on("keydown", this.bind(function (e) {
2132	+ if (!this.isInterfaceEnabled()) return;
2133	+
2134	+ // filter 229 keyCodes (input method editor is processing key input)
2135	+ if (229 == e.keyCode) return;
2136	+
2137	+ if (e.which === KEY.PAGE_UP \|\| e.which === KEY.PAGE_DOWN) {
2138	+ // prevent the page from scrolling
2139	+ killEvent(e);
2140	+ return;
2141	+ }
2142	+
2143	+ switch (e.which) {
2144	+ case KEY.UP:
2145	+ case KEY.DOWN:
2146	+ this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
2147	+ killEvent(e);
2148	+ return;
2149	+ case KEY.ENTER:
2150	+ this.selectHighlighted();
2151	+ killEvent(e);
2152	+ return;
2153	+ case KEY.TAB:
2154	+ this.selectHighlighted({noFocus: true});
2155	+ return;
2156	+ case KEY.ESC:
2157	+ this.cancel(e);
2158	+ killEvent(e);
2159	+ return;
2160	+ }
2161	+ }));
2162	+
2163	+ this.search.on("blur", this.bind(function(e) {
2164	+ // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
2165	+ // without this the search field loses focus which is annoying
2166	+ if (document.activeElement === this.body.get(0)) {
2167	+ window.setTimeout(this.bind(function() {
2168	+ if (this.opened()) {
2169	+ this.search.focus();
2170	+ }
2171	+ }), 0);
2172	+ }
2173	+ }));
2174	+
2175	+ this.focusser.on("keydown", this.bind(function (e) {
2176	+ if (!this.isInterfaceEnabled()) return;
2177	+
2178	+ if (e.which === KEY.TAB \|\| KEY.isControl(e) \|\| KEY.isFunctionKey(e) \|\| e.which === KEY.ESC) {
2179	+ return;
2180	+ }
2181	+
2182	+ if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
2183	+ killEvent(e);
2184	+ return;
2185	+ }
2186	+
2187	+ if (e.which == KEY.DOWN \|\| e.which == KEY.UP
2188	+ \|\| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
2189	+
2190	+ if (e.altKey \|\| e.ctrlKey \|\| e.shiftKey \|\| e.metaKey) return;
2191	+
2192	+ this.open();
2193	+ killEvent(e);
2194	+ return;
2195	+ }
2196	+
2197	+ if (e.which == KEY.DELETE \|\| e.which == KEY.BACKSPACE) {
2198	+ if (this.opts.allowClear) {
2199	+ this.clear();
2200	+ }
2201	+ killEvent(e);
2202	+ return;
2203	+ }
2204	+ }));
2205	+
2206	+
2207	+ installKeyUpChangeEvent(this.focusser);
2208	+ this.focusser.on("keyup-change input", this.bind(function(e) {
2209	+ if (this.opts.minimumResultsForSearch >= 0) {
2210	+ e.stopPropagation();
2211	+ if (this.opened()) return;
2212	+ this.open();
2213	+ }
2214	+ }));
2215	+
2216	+ selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
2217	+ if (!this.isInterfaceEnabled()) {
2218	+ return;
2219	+ }
2220	+
2221	+ this.clear();
2222	+ killEventImmediately(e);
2223	+ this.close();
2224	+
2225	+ if (this.selection) {
2226	+ this.selection.focus();
2227	+ }
2228	+ }));
2229	+
2230	+ selection.on("mousedown touchstart", this.bind(function (e) {
2231	+ // Prevent IE from generating a click event on the body
2232	+ reinsertElement(selection);
2233	+
2234	+ if (!this.container.hasClass("select2-container-active")) {
2235	+ this.opts.element.trigger($.Event("select2-focus"));
2236	+ }
2237	+
2238	+ if (this.opened()) {
2239	+ this.close();
2240	+ } else if (this.isInterfaceEnabled()) {
2241	+ this.open();
2242	+ }
2243	+
2244	+ killEvent(e);
2245	+ }));
2246	+
2247	+ dropdown.on("mousedown touchstart", this.bind(function() {
2248	+ if (this.opts.shouldFocusInput(this)) {
2249	+ this.search.focus();
2250	+ }
2251	+ }));
2252	+
2253	+ selection.on("focus", this.bind(function(e) {
2254	+ killEvent(e);
2255	+ }));
2256	+
2257	+ this.focusser.on("focus", this.bind(function(){
2258	+ if (!this.container.hasClass("select2-container-active")) {
2259	+ this.opts.element.trigger($.Event("select2-focus"));
2260	+ }
2261	+ this.container.addClass("select2-container-active");
2262	+ })).on("blur", this.bind(function() {
2263	+ if (!this.opened()) {
2264	+ this.container.removeClass("select2-container-active");
2265	+ this.opts.element.trigger($.Event("select2-blur"));
2266	+ }
2267	+ }));
2268	+ this.search.on("focus", this.bind(function(){
2269	+ if (!this.container.hasClass("select2-container-active")) {
2270	+ this.opts.element.trigger($.Event("select2-focus"));
2271	+ }
2272	+ this.container.addClass("select2-container-active");
2273	+ }));
2274	+
2275	+ this.initContainerWidth();
2276	+ this.opts.element.hide();
2277	+ this.setPlaceholder();
2278	+
2279	+ },
2280	+
2281	+ // single
2282	+ clear: function(triggerChange) {
2283	+ var data=this.selection.data("select2-data");
2284	+ if (data) { // guard against queued quick consecutive clicks
2285	+ var evt = $.Event("select2-clearing");
2286	+ this.opts.element.trigger(evt);
2287	+ if (evt.isDefaultPrevented()) {
2288	+ return;
2289	+ }
2290	+ var placeholderOption = this.getPlaceholderOption();
2291	+ this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
2292	+ this.selection.find(".select2-chosen").empty();
2293	+ this.selection.removeData("select2-data");
2294	+ this.setPlaceholder();
2295	+
2296	+ if (triggerChange !== false){
2297	+ this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
2298	+ this.triggerChange({removed:data});
2299	+ }
2300	+ }
2301	+ },
2302	+
2303	+ /**
2304	+ * Sets selection based on source element's value
2305	+ */
2306	+ // single
2307	+ initSelection: function () {
2308	+ var selected;
2309	+ if (this.isPlaceholderOptionSelected()) {
2310	+ this.updateSelection(null);
2311	+ this.close();
2312	+ this.setPlaceholder();
2313	+ } else {
2314	+ var self = this;
2315	+ this.opts.initSelection.call(null, this.opts.element, function(selected){
2316	+ if (selected !== undefined && selected !== null) {
2317	+ self.updateSelection(selected);
2318	+ self.close();
2319	+ self.setPlaceholder();
2320	+ self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
2321	+ }
2322	+ });
2323	+ }
2324	+ },
2325	+
2326	+ isPlaceholderOptionSelected: function() {
2327	+ var placeholderOption;
2328	+ if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
2329	+ return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
2330	+ \|\| (this.opts.element.val() === "")
2331	+ \|\| (this.opts.element.val() === undefined)
2332	+ \|\| (this.opts.element.val() === null);
2333	+ },
2334	+
2335	+ // single
2336	+ prepareOpts: function () {
2337	+ var opts = this.parent.prepareOpts.apply(this, arguments),
2338	+ self=this;
2339	+
2340	+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
2341	+ // install the selection initializer
2342	+ opts.initSelection = function (element, callback) {
2343	+ var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
2344	+ // a single select box always has a value, no need to null check 'selected'
2345	+ callback(self.optionToData(selected));
2346	+ };
2347	+ } else if ("data" in opts) {
2348	+ // install default initSelection when applied to hidden input and data is local
2349	+ opts.initSelection = opts.initSelection \|\| function (element, callback) {
2350	+ var id = element.val();
2351	+ //search in data by id, storing the actual matching item
2352	+ var match = null;
2353	+ opts.query({
2354	+ matcher: function(term, text, el){
2355	+ var is_match = equal(id, opts.id(el));
2356	+ if (is_match) {
2357	+ match = el;
2358	+ }
2359	+ return is_match;
2360	+ },
2361	+ callback: !$.isFunction(callback) ? $.noop : function() {
2362	+ callback(match);
2363	+ }
2364	+ });
2365	+ };
2366	+ }
2367	+
2368	+ return opts;
2369	+ },
2370	+
2371	+ // single
2372	+ getPlaceholder: function() {
2373	+ // if a placeholder is specified on a single select without a valid placeholder option ignore it
2374	+ if (this.select) {
2375	+ if (this.getPlaceholderOption() === undefined) {
2376	+ return undefined;
2377	+ }
2378	+ }
2379	+
2380	+ return this.parent.getPlaceholder.apply(this, arguments);
2381	+ },
2382	+
2383	+ // single
2384	+ setPlaceholder: function () {
2385	+ var placeholder = this.getPlaceholder();
2386	+
2387	+ if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
2388	+
2389	+ // check for a placeholder option if attached to a select
2390	+ if (this.select && this.getPlaceholderOption() === undefined) return;
2391	+
2392	+ this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
2393	+
2394	+ this.selection.addClass("select2-default");
2395	+
2396	+ this.container.removeClass("select2-allowclear");
2397	+ }
2398	+ },
2399	+
2400	+ // single
2401	+ postprocessResults: function (data, initial, noHighlightUpdate) {
2402	+ var selected = 0, self = this, showSearchInput = true;
2403	+
2404	+ // find the selected element in the result list
2405	+
2406	+ this.findHighlightableChoices().each2(function (i, elm) {
2407	+ if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
2408	+ selected = i;
2409	+ return false;
2410	+ }
2411	+ });
2412	+
2413	+ // and highlight it
2414	+ if (noHighlightUpdate !== false) {
2415	+ if (initial === true && selected >= 0) {
2416	+ this.highlight(selected);
2417	+ } else {
2418	+ this.highlight(0);
2419	+ }
2420	+ }
2421	+
2422	+ // hide the search box if this is the first we got the results and there are enough of them for search
2423	+
2424	+ if (initial === true) {
2425	+ var min = this.opts.minimumResultsForSearch;
2426	+ if (min >= 0) {
2427	+ this.showSearch(countResults(data.results) >= min);
2428	+ }
2429	+ }
2430	+ },
2431	+
2432	+ // single
2433	+ showSearch: function(showSearchInput) {
2434	+ if (this.showSearchInput === showSearchInput) return;
2435	+
2436	+ this.showSearchInput = showSearchInput;
2437	+
2438	+ this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
2439	+ this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
2440	+ //add "select2-with-searchbox" to the container if search box is shown
2441	+ $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
2442	+ },
2443	+
2444	+ // single
2445	+ onSelect: function (data, options) {
2446	+
2447	+ if (!this.triggerSelect(data)) { return; }
2448	+
2449	+ var old = this.opts.element.val(),
2450	+ oldData = this.data();
2451	+
2452	+ this.opts.element.val(this.id(data));
2453	+ this.updateSelection(data);
2454	+
2455	+ this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
2456	+
2457	+ this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
2458	+ this.close();
2459	+
2460	+ if ((!options \|\| !options.noFocus) && this.opts.shouldFocusInput(this)) {
2461	+ this.focusser.focus();
2462	+ }
2463	+
2464	+ if (!equal(old, this.id(data))) {
2465	+ this.triggerChange({ added: data, removed: oldData });
2466	+ }
2467	+ },
2468	+
2469	+ // single
2470	+ updateSelection: function (data) {
2471	+
2472	+ var container=this.selection.find(".select2-chosen"), formatted, cssClass;
2473	+
2474	+ this.selection.data("select2-data", data);
2475	+
2476	+ container.empty();
2477	+ if (data !== null) {
2478	+ formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
2479	+ }
2480	+ if (formatted !== undefined) {
2481	+ container.append(formatted);
2482	+ }
2483	+ cssClass=this.opts.formatSelectionCssClass(data, container);
2484	+ if (cssClass !== undefined) {
2485	+ container.addClass(cssClass);
2486	+ }
2487	+
2488	+ this.selection.removeClass("select2-default");
2489	+
2490	+ if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
2491	+ this.container.addClass("select2-allowclear");
2492	+ }
2493	+ },
2494	+
2495	+ // single
2496	+ val: function () {
2497	+ var val,
2498	+ triggerChange = false,
2499	+ data = null,
2500	+ self = this,
2501	+ oldData = this.data();
2502	+
2503	+ if (arguments.length === 0) {
2504	+ return this.opts.element.val();
2505	+ }
2506	+
2507	+ val = arguments[0];
2508	+
2509	+ if (arguments.length > 1) {
2510	+ triggerChange = arguments[1];
2511	+ }
2512	+
2513	+ if (this.select) {
2514	+ this.select
2515	+ .val(val)
2516	+ .find("option").filter(function() { return this.selected }).each2(function (i, elm) {
2517	+ data = self.optionToData(elm);
2518	+ return false;
2519	+ });
2520	+ this.updateSelection(data);
2521	+ this.setPlaceholder();
2522	+ if (triggerChange) {
2523	+ this.triggerChange({added: data, removed:oldData});
2524	+ }
2525	+ } else {
2526	+ // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
2527	+ if (!val && val !== 0) {
2528	+ this.clear(triggerChange);
2529	+ return;
2530	+ }
2531	+ if (this.opts.initSelection === undefined) {
2532	+ throw new Error("cannot call val() if initSelection() is not defined");
2533	+ }
2534	+ this.opts.element.val(val);
2535	+ this.opts.initSelection(this.opts.element, function(data){
2536	+ self.opts.element.val(!data ? "" : self.id(data));
2537	+ self.updateSelection(data);
2538	+ self.setPlaceholder();
2539	+ if (triggerChange) {
2540	+ self.triggerChange({added: data, removed:oldData});
2541	+ }
2542	+ });
2543	+ }
2544	+ },
2545	+
2546	+ // single
2547	+ clearSearch: function () {
2548	+ this.search.val("");
2549	+ this.focusser.val("");
2550	+ },
2551	+
2552	+ // single
2553	+ data: function(value) {
2554	+ var data,
2555	+ triggerChange = false;
2556	+
2557	+ if (arguments.length === 0) {
2558	+ data = this.selection.data("select2-data");
2559	+ if (data == undefined) data = null;
2560	+ return data;
2561	+ } else {
2562	+ if (arguments.length > 1) {
2563	+ triggerChange = arguments[1];
2564	+ }
2565	+ if (!value) {
2566	+ this.clear(triggerChange);
2567	+ } else {
2568	+ data = this.data();
2569	+ this.opts.element.val(!value ? "" : this.id(value));
2570	+ this.updateSelection(value);
2571	+ if (triggerChange) {
2572	+ this.triggerChange({added: value, removed:data});
2573	+ }
2574	+ }
2575	+ }
2576	+ }
2577	+ });
2578	+
2579	+ MultiSelect2 = clazz(AbstractSelect2, {
2580	+
2581	+ // multi
2582	+ createContainer: function () {
2583	+ var container = $(document.createElement("div")).attr({
2584	+ "class": "select2-container select2-container-multi"
2585	+ }).html([
2586	+ "<ul class='select2-choices'>",
2587	+ " <li class='select2-search-field'>",
2588	+ " <label for='' class='select2-offscreen'></label>",
2589	+ " <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
2590	+ " </li>",
2591	+ "</ul>",
2592	+ "<div class='select2-drop select2-drop-multi select2-display-none'>",
2593	+ " <ul class='select2-results'>",
2594	+ " </ul>",
2595	+ "</div>"].join(""));
2596	+ return container;
2597	+ },
2598	+
2599	+ // multi
2600	+ prepareOpts: function () {
2601	+ var opts = this.parent.prepareOpts.apply(this, arguments),
2602	+ self=this;
2603	+
2604	+ // TODO validate placeholder is a string if specified
2605	+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
2606	+ // install the selection initializer
2607	+ opts.initSelection = function (element, callback) {
2608	+
2609	+ var data = [];
2610	+
2611	+ element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
2612	+ data.push(self.optionToData(elm));
2613	+ });
2614	+ callback(data);
2615	+ };
2616	+ } else if ("data" in opts) {
2617	+ // install default initSelection when applied to hidden input and data is local
2618	+ opts.initSelection = opts.initSelection \|\| function (element, callback) {
2619	+ var ids = splitVal(element.val(), opts.separator, opts.transformVal);
2620	+ //search in data by array of ids, storing matching items in a list
2621	+ var matches = [];
2622	+ opts.query({
2623	+ matcher: function(term, text, el){
2624	+ var is_match = $.grep(ids, function(id) {
2625	+ return equal(id, opts.id(el));
2626	+ }).length;
2627	+ if (is_match) {
2628	+ matches.push(el);
2629	+ }
2630	+ return is_match;
2631	+ },
2632	+ callback: !$.isFunction(callback) ? $.noop : function() {
2633	+ // reorder matches based on the order they appear in the ids array because right now
2634	+ // they are in the order in which they appear in data array
2635	+ var ordered = [];
2636	+ for (var i = 0; i < ids.length; i++) {
2637	+ var id = ids[i];
2638	+ for (var j = 0; j < matches.length; j++) {
2639	+ var match = matches[j];
2640	+ if (equal(id, opts.id(match))) {
2641	+ ordered.push(match);
2642	+ matches.splice(j, 1);
2643	+ break;
2644	+ }
2645	+ }
2646	+ }
2647	+ callback(ordered);
2648	+ }
2649	+ });
2650	+ };
2651	+ }
2652	+
2653	+ return opts;
2654	+ },
2655	+
2656	+ // multi
2657	+ selectChoice: function (choice) {
2658	+
2659	+ var selected = this.container.find(".select2-search-choice-focus");
2660	+ if (selected.length && choice && choice[0] == selected[0]) {
2661	+
2662	+ } else {
2663	+ if (selected.length) {
2664	+ this.opts.element.trigger("choice-deselected", selected);
2665	+ }
2666	+ selected.removeClass("select2-search-choice-focus");
2667	+ if (choice && choice.length) {
2668	+ this.close();
2669	+ choice.addClass("select2-search-choice-focus");
2670	+ this.opts.element.trigger("choice-selected", choice);
2671	+ }
2672	+ }
2673	+ },
2674	+
2675	+ // multi
2676	+ destroy: function() {
2677	+ $("label[for='" + this.search.attr('id') + "']")
2678	+ .attr('for', this.opts.element.attr("id"));
2679	+ this.parent.destroy.apply(this, arguments);
2680	+
2681	+ cleanupJQueryElements.call(this,
2682	+ "searchContainer",
2683	+ "selection"
2684	+ );
2685	+ },
2686	+
2687	+ // multi
2688	+ initContainer: function () {
2689	+
2690	+ var selector = ".select2-choices", selection;
2691	+
2692	+ this.searchContainer = this.container.find(".select2-search-field");
2693	+ this.selection = selection = this.container.find(selector);
2694	+
2695	+ var _this = this;
2696	+ this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
2697	+ _this.search[0].focus();
2698	+ _this.selectChoice($(this));
2699	+ });
2700	+
2701	+ // rewrite labels from original element to focusser
2702	+ this.search.attr("id", "s2id_autogen"+nextUid());
2703	+
2704	+ this.search.prev()
2705	+ .text($("label[for='" + this.opts.element.attr("id") + "']").text())
2706	+ .attr('for', this.search.attr('id'));
2707	+ this.opts.element.focus(this.bind(function () { this.focus(); }));
2708	+
2709	+ this.search.on("input paste", this.bind(function() {
2710	+ if (this.search.attr('placeholder') && this.search.val().length == 0) return;
2711	+ if (!this.isInterfaceEnabled()) return;
2712	+ if (!this.opened()) {
2713	+ this.open();
2714	+ }
2715	+ }));
2716	+
2717	+ this.search.attr("tabindex", this.elementTabIndex);
2718	+
2719	+ this.keydowns = 0;
2720	+ this.search.on("keydown", this.bind(function (e) {
2721	+ if (!this.isInterfaceEnabled()) return;
2722	+
2723	+ ++this.keydowns;
2724	+ var selected = selection.find(".select2-search-choice-focus");
2725	+ var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
2726	+ var next = selected.next(".select2-search-choice:not(.select2-locked)");
2727	+ var pos = getCursorInfo(this.search);
2728	+
2729	+ if (selected.length &&
2730	+ (e.which == KEY.LEFT \|\| e.which == KEY.RIGHT \|\| e.which == KEY.BACKSPACE \|\| e.which == KEY.DELETE \|\| e.which == KEY.ENTER)) {
2731	+ var selectedChoice = selected;
2732	+ if (e.which == KEY.LEFT && prev.length) {
2733	+ selectedChoice = prev;
2734	+ }
2735	+ else if (e.which == KEY.RIGHT) {
2736	+ selectedChoice = next.length ? next : null;
2737	+ }
2738	+ else if (e.which === KEY.BACKSPACE) {
2739	+ if (this.unselect(selected.first())) {
2740	+ this.search.width(10);
2741	+ selectedChoice = prev.length ? prev : next;
2742	+ }
2743	+ } else if (e.which == KEY.DELETE) {
2744	+ if (this.unselect(selected.first())) {
2745	+ this.search.width(10);
2746	+ selectedChoice = next.length ? next : null;
2747	+ }
2748	+ } else if (e.which == KEY.ENTER) {
2749	+ selectedChoice = null;
2750	+ }
2751	+
2752	+ this.selectChoice(selectedChoice);
2753	+ killEvent(e);
2754	+ if (!selectedChoice \|\| !selectedChoice.length) {
2755	+ this.open();
2756	+ }
2757	+ return;
2758	+ } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
2759	+ \|\| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
2760	+
2761	+ this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
2762	+ killEvent(e);
2763	+ return;
2764	+ } else {
2765	+ this.selectChoice(null);
2766	+ }
2767	+
2768	+ if (this.opened()) {
2769	+ switch (e.which) {
2770	+ case KEY.UP:
2771	+ case KEY.DOWN:
2772	+ this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
2773	+ killEvent(e);
2774	+ return;
2775	+ case KEY.ENTER:
2776	+ this.selectHighlighted();
2777	+ killEvent(e);
2778	+ return;
2779	+ case KEY.TAB:
2780	+ this.selectHighlighted({noFocus:true});
2781	+ this.close();
2782	+ return;
2783	+ case KEY.ESC:
2784	+ this.cancel(e);
2785	+ killEvent(e);
2786	+ return;
2787	+ }
2788	+ }
2789	+
2790	+ if (e.which === KEY.TAB \|\| KEY.isControl(e) \|\| KEY.isFunctionKey(e)
2791	+ \|\| e.which === KEY.BACKSPACE \|\| e.which === KEY.ESC) {
2792	+ return;
2793	+ }
2794	+
2795	+ if (e.which === KEY.ENTER) {
2796	+ if (this.opts.openOnEnter === false) {
2797	+ return;
2798	+ } else if (e.altKey \|\| e.ctrlKey \|\| e.shiftKey \|\| e.metaKey) {
2799	+ return;
2800	+ }
2801	+ }
2802	+
2803	+ this.open();
2804	+
2805	+ if (e.which === KEY.PAGE_UP \|\| e.which === KEY.PAGE_DOWN) {
2806	+ // prevent the page from scrolling
2807	+ killEvent(e);
2808	+ }
2809	+
2810	+ if (e.which === KEY.ENTER) {
2811	+ // prevent form from being submitted
2812	+ killEvent(e);
2813	+ }
2814	+
2815	+ }));
2816	+
2817	+ this.search.on("keyup", this.bind(function (e) {
2818	+ this.keydowns = 0;
2819	+ this.resizeSearch();
2820	+ })
2821	+ );
2822	+
2823	+ this.search.on("blur", this.bind(function(e) {
2824	+ this.container.removeClass("select2-container-active");
2825	+ this.search.removeClass("select2-focused");
2826	+ this.selectChoice(null);
2827	+ if (!this.opened()) this.clearSearch();
2828	+ e.stopImmediatePropagation();
2829	+ this.opts.element.trigger($.Event("select2-blur"));
2830	+ }));
2831	+
2832	+ this.container.on("click", selector, this.bind(function (e) {
2833	+ if (!this.isInterfaceEnabled()) return;
2834	+ if ($(e.target).closest(".select2-search-choice").length > 0) {
2835	+ // clicked inside a select2 search choice, do not open
2836	+ return;
2837	+ }
2838	+ this.selectChoice(null);
2839	+ this.clearPlaceholder();
2840	+ if (!this.container.hasClass("select2-container-active")) {
2841	+ this.opts.element.trigger($.Event("select2-focus"));
2842	+ }
2843	+ this.open();
2844	+ this.focusSearch();
2845	+ e.preventDefault();
2846	+ }));
2847	+
2848	+ this.container.on("focus", selector, this.bind(function () {
2849	+ if (!this.isInterfaceEnabled()) return;
2850	+ if (!this.container.hasClass("select2-container-active")) {
2851	+ this.opts.element.trigger($.Event("select2-focus"));
2852	+ }
2853	+ this.container.addClass("select2-container-active");
2854	+ this.dropdown.addClass("select2-drop-active");
2855	+ this.clearPlaceholder();
2856	+ }));
2857	+
2858	+ this.initContainerWidth();
2859	+ this.opts.element.hide();
2860	+
2861	+ // set the placeholder if necessary
2862	+ this.clearSearch();
2863	+ },
2864	+
2865	+ // multi
2866	+ enableInterface: function() {
2867	+ if (this.parent.enableInterface.apply(this, arguments)) {
2868	+ this.search.prop("disabled", !this.isInterfaceEnabled());
2869	+ }
2870	+ },
2871	+
2872	+ // multi
2873	+ initSelection: function () {
2874	+ var data;
2875	+ if (this.opts.element.val() === "" && this.opts.element.text() === "") {
2876	+ this.updateSelection([]);
2877	+ this.close();
2878	+ // set the placeholder if necessary
2879	+ this.clearSearch();
2880	+ }
2881	+ if (this.select \|\| this.opts.element.val() !== "") {
2882	+ var self = this;
2883	+ this.opts.initSelection.call(null, this.opts.element, function(data){
2884	+ if (data !== undefined && data !== null) {
2885	+ self.updateSelection(data);
2886	+ self.close();
2887	+ // set the placeholder if necessary
2888	+ self.clearSearch();
2889	+ }
2890	+ });
2891	+ }
2892	+ },
2893	+
2894	+ // multi
2895	+ clearSearch: function () {
2896	+ var placeholder = this.getPlaceholder(),
2897	+ maxWidth = this.getMaxSearchWidth();
2898	+
2899	+ if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
2900	+ this.search.val(placeholder).addClass("select2-default");
2901	+ // stretch the search box to full width of the container so as much of the placeholder is visible as possible
2902	+ // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
2903	+ this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
2904	+ } else {
2905	+ this.search.val("").width(10);
2906	+ }
2907	+ },
2908	+
2909	+ // multi
2910	+ clearPlaceholder: function () {
2911	+ if (this.search.hasClass("select2-default")) {
2912	+ this.search.val("").removeClass("select2-default");
2913	+ }
2914	+ },
2915	+
2916	+ // multi
2917	+ opening: function () {
2918	+ this.clearPlaceholder(); // should be done before super so placeholder is not used to search
2919	+ this.resizeSearch();
2920	+
2921	+ this.parent.opening.apply(this, arguments);
2922	+
2923	+ this.focusSearch();
2924	+
2925	+ // initializes search's value with nextSearchTerm (if defined by user)
2926	+ // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
2927	+ if(this.search.val() === "") {
2928	+ if(this.nextSearchTerm != undefined){
2929	+ this.search.val(this.nextSearchTerm);
2930	+ this.search.select();
2931	+ }
2932	+ }
2933	+
2934	+ this.updateResults(true);
2935	+ if (this.opts.shouldFocusInput(this)) {
2936	+ this.search.focus();
2937	+ }
2938	+ this.opts.element.trigger($.Event("select2-open"));
2939	+ },
2940	+
2941	+ // multi
2942	+ close: function () {
2943	+ if (!this.opened()) return;
2944	+ this.parent.close.apply(this, arguments);
2945	+ },
2946	+
2947	+ // multi
2948	+ focus: function () {
2949	+ this.close();
2950	+ this.search.focus();
2951	+ },
2952	+
2953	+ // multi
2954	+ isFocused: function () {
2955	+ return this.search.hasClass("select2-focused");
2956	+ },
2957	+
2958	+ // multi
2959	+ updateSelection: function (data) {
2960	+ var ids = [], filtered = [], self = this;
2961	+
2962	+ // filter out duplicates
2963	+ $(data).each(function () {
2964	+ if (indexOf(self.id(this), ids) < 0) {
2965	+ ids.push(self.id(this));
2966	+ filtered.push(this);
2967	+ }
2968	+ });
2969	+ data = filtered;
2970	+
2971	+ this.selection.find(".select2-search-choice").remove();
2972	+ $(data).each(function () {
2973	+ self.addSelectedChoice(this);
2974	+ });
2975	+ self.postprocessResults();
2976	+ },
2977	+
2978	+ // multi
2979	+ tokenize: function() {
2980	+ var input = this.search.val();
2981	+ input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
2982	+ if (input != null && input != undefined) {
2983	+ this.search.val(input);
2984	+ if (input.length > 0) {
2985	+ this.open();
2986	+ }
2987	+ }
2988	+
2989	+ },
2990	+
2991	+ // multi
2992	+ onSelect: function (data, options) {
2993	+
2994	+ if (!this.triggerSelect(data) \|\| data.text === "") { return; }
2995	+
2996	+ this.addSelectedChoice(data);
2997	+
2998	+ this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
2999	+
3000	+ // keep track of the search's value before it gets cleared
3001	+ this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
3002	+
3003	+ this.clearSearch();
3004	+ this.updateResults();
3005	+
3006	+ if (this.select \|\| !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
3007	+
3008	+ if (this.opts.closeOnSelect) {
3009	+ this.close();
3010	+ this.search.width(10);
3011	+ } else {
3012	+ if (this.countSelectableResults()>0) {
3013	+ this.search.width(10);
3014	+ this.resizeSearch();
3015	+ if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
3016	+ // if we reached max selection size repaint the results so choices
3017	+ // are replaced with the max selection reached message
3018	+ this.updateResults(true);
3019	+ } else {
3020	+ // initializes search's value with nextSearchTerm and update search result
3021	+ if(this.nextSearchTerm != undefined){
3022	+ this.search.val(this.nextSearchTerm);
3023	+ this.updateResults();
3024	+ this.search.select();
3025	+ }
3026	+ }
3027	+ this.positionDropdown();
3028	+ } else {
3029	+ // if nothing left to select close
3030	+ this.close();
3031	+ this.search.width(10);
3032	+ }
3033	+ }
3034	+
3035	+ // since its not possible to select an element that has already been
3036	+ // added we do not need to check if this is a new element before firing change
3037	+ this.triggerChange({ added: data });
3038	+
3039	+ if (!options \|\| !options.noFocus)
3040	+ this.focusSearch();
3041	+ },
3042	+
3043	+ // multi
3044	+ cancel: function () {
3045	+ this.close();
3046	+ this.focusSearch();
3047	+ },
3048	+
3049	+ addSelectedChoice: function (data) {
3050	+ var enableChoice = !data.locked,
3051	+ enabledItem = $(
3052	+ "<li class='select2-search-choice'>" +
3053	+ " <div></div>" +
3054	+ " <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
3055	+ "</li>"),
3056	+ disabledItem = $(
3057	+ "<li class='select2-search-choice select2-locked'>" +
3058	+ "<div></div>" +
3059	+ "</li>");
3060	+ var choice = enableChoice ? enabledItem : disabledItem,
3061	+ id = this.id(data),
3062	+ val = this.getVal(),
3063	+ formatted,
3064	+ cssClass;
3065	+
3066	+ formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
3067	+ if (formatted != undefined) {
3068	+ choice.find("div").replaceWith($("<div></div>").html(formatted));
3069	+ }
3070	+ cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
3071	+ if (cssClass != undefined) {
3072	+ choice.addClass(cssClass);
3073	+ }
3074	+
3075	+ if(enableChoice){
3076	+ choice.find(".select2-search-choice-close")
3077	+ .on("mousedown", killEvent)
3078	+ .on("click dblclick", this.bind(function (e) {
3079	+ if (!this.isInterfaceEnabled()) return;
3080	+
3081	+ this.unselect($(e.target));
3082	+ this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
3083	+ killEvent(e);
3084	+ this.close();
3085	+ this.focusSearch();
3086	+ })).on("focus", this.bind(function () {
3087	+ if (!this.isInterfaceEnabled()) return;
3088	+ this.container.addClass("select2-container-active");
3089	+ this.dropdown.addClass("select2-drop-active");
3090	+ }));
3091	+ }
3092	+
3093	+ choice.data("select2-data", data);
3094	+ choice.insertBefore(this.searchContainer);
3095	+
3096	+ val.push(id);
3097	+ this.setVal(val);
3098	+ },
3099	+
3100	+ // multi
3101	+ unselect: function (selected) {
3102	+ var val = this.getVal(),
3103	+ data,
3104	+ index;
3105	+ selected = selected.closest(".select2-search-choice");
3106	+
3107	+ if (selected.length === 0) {
3108	+ throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
3109	+ }
3110	+
3111	+ data = selected.data("select2-data");
3112	+
3113	+ if (!data) {
3114	+ // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
3115	+ // and invoked on an element already removed
3116	+ return;
3117	+ }
3118	+
3119	+ var evt = $.Event("select2-removing");
3120	+ evt.val = this.id(data);
3121	+ evt.choice = data;
3122	+ this.opts.element.trigger(evt);
3123	+
3124	+ if (evt.isDefaultPrevented()) {
3125	+ return false;
3126	+ }
3127	+
3128	+ while((index = indexOf(this.id(data), val)) >= 0) {
3129	+ val.splice(index, 1);
3130	+ this.setVal(val);
3131	+ if (this.select) this.postprocessResults();
3132	+ }
3133	+
3134	+ selected.remove();
3135	+
3136	+ this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
3137	+ this.triggerChange({ removed: data });
3138	+
3139	+ return true;
3140	+ },
3141	+
3142	+ // multi
3143	+ postprocessResults: function (data, initial, noHighlightUpdate) {
3144	+ var val = this.getVal(),
3145	+ choices = this.results.find(".select2-result"),
3146	+ compound = this.results.find(".select2-result-with-children"),
3147	+ self = this;
3148	+
3149	+ choices.each2(function (i, choice) {
3150	+ var id = self.id(choice.data("select2-data"));
3151	+ if (indexOf(id, val) >= 0) {
3152	+ choice.addClass("select2-selected");
3153	+ // mark all children of the selected parent as selected
3154	+ choice.find(".select2-result-selectable").addClass("select2-selected");
3155	+ }
3156	+ });
3157	+
3158	+ compound.each2(function(i, choice) {
3159	+ // hide an optgroup if it doesn't have any selectable children
3160	+ if (!choice.is('.select2-result-selectable')
3161	+ && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
3162	+ choice.addClass("select2-selected");
3163	+ }
3164	+ });
3165	+
3166	+ if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
3167	+ self.highlight(0);
3168	+ }
3169	+
3170	+ //If all results are chosen render formatNoMatches
3171	+ if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
3172	+ if(!data \|\| data && !data.more && this.results.find(".select2-no-results").length === 0) {
3173	+ if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
3174	+ this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
3175	+ }
3176	+ }
3177	+ }
3178	+
3179	+ },
3180	+
3181	+ // multi
3182	+ getMaxSearchWidth: function() {
3183	+ return this.selection.width() - getSideBorderPadding(this.search);
3184	+ },
3185	+
3186	+ // multi
3187	+ resizeSearch: function () {
3188	+ var minimumWidth, left, maxWidth, containerLeft, searchWidth,
3189	+ sideBorderPadding = getSideBorderPadding(this.search);
3190	+
3191	+ minimumWidth = measureTextWidth(this.search) + 10;
3192	+
3193	+ left = this.search.offset().left;
3194	+
3195	+ maxWidth = this.selection.width();
3196	+ containerLeft = this.selection.offset().left;
3197	+
3198	+ searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
3199	+
3200	+ if (searchWidth < minimumWidth) {
3201	+ searchWidth = maxWidth - sideBorderPadding;
3202	+ }
3203	+
3204	+ if (searchWidth < 40) {
3205	+ searchWidth = maxWidth - sideBorderPadding;
3206	+ }
3207	+
3208	+ if (searchWidth <= 0) {
3209	+ searchWidth = minimumWidth;
3210	+ }
3211	+
3212	+ this.search.width(Math.floor(searchWidth));
3213	+ },
3214	+
3215	+ // multi
3216	+ getVal: function () {
3217	+ var val;
3218	+ if (this.select) {
3219	+ val = this.select.val();
3220	+ return val === null ? [] : val;
3221	+ } else {
3222	+ val = this.opts.element.val();
3223	+ return splitVal(val, this.opts.separator, this.opts.transformVal);
3224	+ }
3225	+ },
3226	+
3227	+ // multi
3228	+ setVal: function (val) {
3229	+ var unique;
3230	+ if (this.select) {
3231	+ this.select.val(val);
3232	+ } else {
3233	+ unique = [];
3234	+ // filter out duplicates
3235	+ $(val).each(function () {
3236	+ if (indexOf(this, unique) < 0) unique.push(this);
3237	+ });
3238	+ this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
3239	+ }
3240	+ },
3241	+
3242	+ // multi
3243	+ buildChangeDetails: function (old, current) {
3244	+ var current = current.slice(0),
3245	+ old = old.slice(0);
3246	+
3247	+ // remove intersection from each array
3248	+ for (var i = 0; i < current.length; i++) {
3249	+ for (var j = 0; j < old.length; j++) {
3250	+ if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
3251	+ current.splice(i, 1);
3252	+ if(i>0){
3253	+ i--;
3254	+ }
3255	+ old.splice(j, 1);
3256	+ j--;
3257	+ }
3258	+ }
3259	+ }
3260	+
3261	+ return {added: current, removed: old};
3262	+ },
3263	+
3264	+
3265	+ // multi
3266	+ val: function (val, triggerChange) {
3267	+ var oldData, self=this;
3268	+
3269	+ if (arguments.length === 0) {
3270	+ return this.getVal();
3271	+ }
3272	+
3273	+ oldData=this.data();
3274	+ if (!oldData.length) oldData=[];
3275	+
3276	+ // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
3277	+ if (!val && val !== 0) {
3278	+ this.opts.element.val("");
3279	+ this.updateSelection([]);
3280	+ this.clearSearch();
3281	+ if (triggerChange) {
3282	+ this.triggerChange({added: this.data(), removed: oldData});
3283	+ }
3284	+ return;
3285	+ }
3286	+
3287	+ // val is a list of ids
3288	+ this.setVal(val);
3289	+
3290	+ if (this.select) {
3291	+ this.opts.initSelection(this.select, this.bind(this.updateSelection));
3292	+ if (triggerChange) {
3293	+ this.triggerChange(this.buildChangeDetails(oldData, this.data()));
3294	+ }
3295	+ } else {
3296	+ if (this.opts.initSelection === undefined) {
3297	+ throw new Error("val() cannot be called if initSelection() is not defined");
3298	+ }
3299	+
3300	+ this.opts.initSelection(this.opts.element, function(data){
3301	+ var ids=$.map(data, self.id);
3302	+ self.setVal(ids);
3303	+ self.updateSelection(data);
3304	+ self.clearSearch();
3305	+ if (triggerChange) {
3306	+ self.triggerChange(self.buildChangeDetails(oldData, self.data()));
3307	+ }
3308	+ });
3309	+ }
3310	+ this.clearSearch();
3311	+ },
3312	+
3313	+ // multi
3314	+ onSortStart: function() {
3315	+ if (this.select) {
3316	+ throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
3317	+ }
3318	+
3319	+ // collapse search field into 0 width so its container can be collapsed as well
3320	+ this.search.width(0);
3321	+ // hide the container
3322	+ this.searchContainer.hide();
3323	+ },
3324	+
3325	+ // multi
3326	+ onSortEnd:function() {
3327	+
3328	+ var val=[], self=this;
3329	+
3330	+ // show search and move it to the end of the list
3331	+ this.searchContainer.show();
3332	+ // make sure the search container is the last item in the list
3333	+ this.searchContainer.appendTo(this.searchContainer.parent());
3334	+ // since we collapsed the width in dragStarted, we resize it here
3335	+ this.resizeSearch();
3336	+
3337	+ // update selection
3338	+ this.selection.find(".select2-search-choice").each(function() {
3339	+ val.push(self.opts.id($(this).data("select2-data")));
3340	+ });
3341	+ this.setVal(val);
3342	+ this.triggerChange();
3343	+ },
3344	+
3345	+ // multi
3346	+ data: function(values, triggerChange) {
3347	+ var self=this, ids, old;
3348	+ if (arguments.length === 0) {
3349	+ return this.selection
3350	+ .children(".select2-search-choice")
3351	+ .map(function() { return $(this).data("select2-data"); })
3352	+ .get();
3353	+ } else {
3354	+ old = this.data();
3355	+ if (!values) { values = []; }
3356	+ ids = $.map(values, function(e) { return self.opts.id(e); });
3357	+ this.setVal(ids);
3358	+ this.updateSelection(values);
3359	+ this.clearSearch();
3360	+ if (triggerChange) {
3361	+ this.triggerChange(this.buildChangeDetails(old, this.data()));
3362	+ }
3363	+ }
3364	+ }
3365	+ });
3366	+
3367	+ $.fn.select2 = function () {
3368	+
3369	+ var args = Array.prototype.slice.call(arguments, 0),
3370	+ opts,
3371	+ select2,
3372	+ method, value, multiple,
3373	+ allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
3374	+ valueMethods = ["opened", "isFocused", "container", "dropdown"],
3375	+ propertyMethods = ["val", "data"],
3376	+ methodsMap = { search: "externalSearch" };
3377	+
3378	+ this.each(function () {
3379	+ if (args.length === 0 \|\| typeof(args[0]) === "object") {
3380	+ opts = args.length === 0 ? {} : $.extend({}, args[0]);
3381	+ opts.element = $(this);
3382	+
3383	+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
3384	+ multiple = opts.element.prop("multiple");
3385	+ } else {
3386	+ multiple = opts.multiple \|\| false;
3387	+ if ("tags" in opts) {opts.multiple = multiple = true;}
3388	+ }
3389	+
3390	+ select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
3391	+ select2.init(opts);
3392	+ } else if (typeof(args[0]) === "string") {
3393	+
3394	+ if (indexOf(args[0], allowedMethods) < 0) {
3395	+ throw "Unknown method: " + args[0];
3396	+ }
3397	+
3398	+ value = undefined;
3399	+ select2 = $(this).data("select2");
3400	+ if (select2 === undefined) return;
3401	+
3402	+ method=args[0];
3403	+
3404	+ if (method === "container") {
3405	+ value = select2.container;
3406	+ } else if (method === "dropdown") {
3407	+ value = select2.dropdown;
3408	+ } else {
3409	+ if (methodsMap[method]) method = methodsMap[method];
3410	+
3411	+ value = select2[method].apply(select2, args.slice(1));
3412	+ }
3413	+ if (indexOf(args[0], valueMethods) >= 0
3414	+ \|\| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
3415	+ return false; // abort the iteration, ready to return first matched value
3416	+ }
3417	+ } else {
3418	+ throw "Invalid arguments to select2 plugin: " + args;
3419	+ }
3420	+ });
3421	+ return (value === undefined) ? this : value;
3422	+ };
3423	+
3424	+ // plugin defaults, accessible to users
3425	+ $.fn.select2.defaults = {
3426	+ width: "copy",
3427	+ loadMorePadding: 0,
3428	+ closeOnSelect: true,
3429	+ openOnEnter: true,
3430	+ containerCss: {},
3431	+ dropdownCss: {},
3432	+ containerCssClass: "",
3433	+ dropdownCssClass: "",
3434	+ formatResult: function(result, container, query, escapeMarkup) {
3435	+ var markup=[];
3436	+ markMatch(this.text(result), query.term, markup, escapeMarkup);
3437	+ return markup.join("");
3438	+ },
3439	+ transformVal: function(val) {
3440	+ return $.trim(val);
3441	+ },
3442	+ formatSelection: function (data, container, escapeMarkup) {
3443	+ return data ? escapeMarkup(this.text(data)) : undefined;
3444	+ },
3445	+ sortResults: function (results, container, query) {
3446	+ return results;
3447	+ },
3448	+ formatResultCssClass: function(data) {return data.css;},
3449	+ formatSelectionCssClass: function(data, container) {return undefined;},
3450	+ minimumResultsForSearch: 0,
3451	+ minimumInputLength: 0,
3452	+ maximumInputLength: null,
3453	+ maximumSelectionSize: 0,
3454	+ id: function (e) { return e == undefined ? null : e.id; },
3455	+ text: function (e) {
3456	+ if (e && this.data && this.data.text) {
3457	+ if ($.isFunction(this.data.text)) {
3458	+ return this.data.text(e);
3459	+ } else {
3460	+ return e[this.data.text];
3461	+ }
3462	+ } else {
3463	+ return e.text;
3464	+ }
3465	+ },
3466	+ matcher: function(term, text) {
3467	+ return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
3468	+ },
3469	+ separator: ",",
3470	+ tokenSeparators: [],
3471	+ tokenizer: defaultTokenizer,
3472	+ escapeMarkup: defaultEscapeMarkup,
3473	+ blurOnChange: false,
3474	+ selectOnBlur: false,
3475	+ adaptContainerCssClass: function(c) { return c; },
3476	+ adaptDropdownCssClass: function(c) { return null; },
3477	+ nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
3478	+ searchInputPlaceholder: '',
3479	+ createSearchChoicePosition: 'top',
3480	+ shouldFocusInput: function (instance) {
3481	+ // Attempt to detect touch devices
3482	+ var supportsTouchEvents = (('ontouchstart' in window) \|\|
3483	+ (navigator.msMaxTouchPoints > 0));
3484	+
3485	+ // Only devices which support touch events should be special cased
3486	+ if (!supportsTouchEvents) {
3487	+ return true;
3488	+ }
3489	+
3490	+ // Never focus the input if search is disabled
3491	+ if (instance.opts.minimumResultsForSearch < 0) {
3492	+ return false;
3493	+ }
3494	+
3495	+ return true;
3496	+ }
3497	+ };
3498	+
3499	+ $.fn.select2.locales = [];
3500	+
3501	+ $.fn.select2.locales['en'] = {
3502	+ formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
3503	+ formatNoMatches: function () { return "No matches found"; },
3504	+ formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
3505	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
3506	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
3507	+ formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
3508	+ formatLoadMore: function (pageNumber) { return "Loading more results…"; },
3509	+ formatSearching: function () { return "Searching…"; }
3510	+ };
3511	+
3512	+ $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
3513	+
3514	+ $.fn.select2.ajaxDefaults = {
3515	+ transport: $.ajax,
3516	+ params: {
3517	+ type: "GET",
3518	+ cache: false,
3519	+ dataType: "json"
3520	+ }
3521	+ };
3522	+
3523	+ // exports
3524	+ window.Select2 = {
3525	+ query: {
3526	+ ajax: ajax,
3527	+ local: local,
3528	+ tags: tags
3529	+ }, util: {
3530	+ debounce: debounce,
3531	+ markMatch: markMatch,
3532	+ escapeMarkup: defaultEscapeMarkup,
3533	+ stripDiacritics: stripDiacritics
3534	+ }, "class": {
3535	+ "abstract": AbstractSelect2,
3536	+ "single": SingleSelect2,
3537	+ "multi": MultiSelect2
3538	+ }
3539	+ };
3540	+
3541	+ }(jQuery));

trunk/classes/admin/settings/assets/js/select2/select2.min.js ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ /*
2	+ Copyright 2014 Igor Vaynberg
3	+
4	+ Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
5	+
6	+ This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
7	+ General Public License version 2 (the "GPL License"). You may choose either license to govern your
8	+ use of this software only upon the condition that you accept all of the terms of either the Apache
9	+ License or the GPL License.
10	+
11	+ You may obtain a copy of the Apache License and the GPL License at:
12	+
13	+ http://www.apache.org/licenses/LICENSE-2.0
14	+ http://www.gnu.org/licenses/gpl-2.0.html
15	+
16	+ Unless required by applicable law or agreed to in writing, software distributed under the Apache License
17	+ or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
18	+ either express or implied. See the Apache License and the GPL License for the specific language governing
19	+ permissions and limitations under the Apache License and the GPL License.
20	+ */
21	+ !function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]\|\|a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b\|\|c===b?!1:null===a\|\|null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a\|\|a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b\|\|d.x!==c.pageX\|\|d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d\|\|b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0\|\|b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle\|\|window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis\|\|100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport\|\|a.fn.select2.ajaxDefaults.transport,k={type:c.type\|\|"GET",cache:c.cache\|\|!1,jsonpCallback:c.jsonpCallback\|\|b,dataType:c.dataType\|\|"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)\|\|(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length\|\|b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f\|\|e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice\|\|!e.tokenSeparators\|\|e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g\|\|d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")\|\|"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]=>\\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j\|\|q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus\|\|!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")\|\|r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c\|\|("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver\|\|window.WebKitMutationObserver\|\|window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b\|\|{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1\|\|this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()\|\|{}).top\|\|0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
22	+ var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0\|\|!k\|\|!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0\|\|this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")\|\|this.opts.element.attr("data-placeholder")\|\|this.opts.element.data("placeholder")\|\|this.opts.placeholder\|\|((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c\|\|"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width\|\|"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px\|em\|ex\|%\|in\|cm\|mm\|pt\|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h\|\|g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP\|\|a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN\|\|a.which==k.UP\|\|a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE\|\|a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()\|\|(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")\|\|""===this.opts.element.val()\|\|this.opts.element.val()===b\|\|null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus\|\|!this.opts.shouldFocusInput(this)\|\|this.focusser.focus(),r(c,this.id(a))\|\|this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]\|\|(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length\|\|this.isInterfaceEnabled()&&(this.opened()\|\|this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT\|\|a.which==k.RIGHT\|\|a.which==k.BACKSPACE\|\|a.which==k.DELETE\|\|a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length\|\|this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns\|\|a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return}this.open(),(a.which===k.PAGE_UP\|\|a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()\|\|this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0\|\|(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select\|\|""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select\|\|!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus\|\|this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")\|\|0!==b.find(".select2-result-selectable:not(.select2-selected)").length\|\|b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a\|\|a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length\|\|(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b\|\|(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length\|\|"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple\|\|!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0\|\|p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
23	+ },matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window\|\|navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);

trunk/classes/admin/settings/assets/js/select2/select2.png ADDED Viewed

Binary file

trunk/classes/admin/settings/assets/js/select2/select2x2.png ADDED Viewed

Binary file

trunk/classes/admin/settings/assets/js/sf-jquery.js ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ jQuery(document).ready(function () {
2	+
3	+ jQuery(".sf-tips").tooltip({ animation: true, html: true, delay: { show: 300, hide: 100 } });
4	+
5	+
6	+ //This if statement checks if the color picker widget exists within jQuery UI
7	+ //If it does exist then we initialize the WordPress color picker on our text input field
8	+ if (typeof jQuery.wp === 'object' && typeof jQuery.wp.wpColorPicker === 'function') {
9	+ jQuery('.colorpick').wpColorPicker();
10	+ } else {
11	+ // Color picker
12	+ jQuery('.colorpick').each(function () {
13	+ jQuery('.colorpickdiv', jQuery(this).parent()).farbtastic(this);
14	+ jQuery(this).click(function () {
15	+ if (jQuery(this).val() == "") jQuery(this).val('#');
16	+ jQuery('.colorpickdiv', jQuery(this).parent()).show();
17	+ });
18	+ });
19	+ jQuery(document).mousedown(function () {
20	+ jQuery('.colorpickdiv').hide();
21	+ });
22	+ }
23	+ });

trunk/classes/admin/settings/assets/js/wcvendors-media.js ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ jQuery( function( $ ){
2	+
3	+ // Iterate over all instances of the uploader on the page
4	+ $('.wcv-img-id').each( function () {
5	+
6	+ var id = $('.wcv-img-id').data( 'id' );
7	+
8	+ // Handle Add banner
9	+ $( '#wcv-add-' + id ).on( 'click', function(e) {
10	+ e.preventDefault();
11	+ file_uploader( id );
12	+ return false;
13	+ });
14	+
15	+ });
16	+
17	+ function file_uploader( id )
18	+ {
19	+
20	+ var media_uploader, json;
21	+
22	+ if (undefined !== media_uploader ) {
23	+ media_uploader.open();
24	+ return;
25	+ }
26	+
27	+ media_uploader = wp.media({
28	+ title: $( '#wcv-add-' + id ).data('window_title'),
29	+ button: {
30	+ text: $( '#wcv-add-' + id ).data('save_button'),
31	+ },
32	+ multiple: false // Set to true to allow multiple files to be selected
33	+ });
34	+
35	+ media_uploader.on( 'select' , function(){
36	+
37	+ json = media_uploader.state().get('selection').first().toJSON();
38	+
39	+ if ( 0 > $.trim( json.url.length ) ) {
40	+ return;
41	+ }
42	+
43	+ $( '.wcv-image-container-' + id ).prop( 'src', json.sizes.full.url );
44	+ $( '#' + id ).val( json.sizes.full.url );
45	+
46	+ });
47	+
48	+ media_uploader.open();
49	+ }
50	+ });

trunk/classes/admin/settings/classes/sf-class-format-options.php ADDED Viewed

	@@ -0,0 +1,347 @@


1	+ <?php
2	+
3	+ /**
4	+ * Format an options array into HTML
5	+ * This class has been deprecated
6	+ *
7	+ * @author Matt Gates <http://mgates.me>
8	+ * @package WordPress
9	+ */
10	+
11	+
12	+ if ( !class_exists( 'SF_Format_Options' ) ) {
13	+
14	+ class SF_Format_Options extends SF_Settings_API
15	+ {
16	+
17	+ /**
18	+ * Format an option array into HTML
19	+ *
20	+ *
21	+ * @access public
22	+ *
23	+ * @param unknown $setting
24	+ *
25	+ * @return string HTML.
26	+ */
27	+ public function settings_options_format( $setting )
28	+ {
29	+ if ( empty( $setting ) ) return false;
30	+
31	+ $defaults = apply_filters( $this->id . '_options_defaults', array(
32	+ 'name' => '',
33	+ 'desc' => '',
34	+ 'placeholder' => '',
35	+ 'class' => '',
36	+ 'tip' => '',
37	+ 'id' => '',
38	+ 'css' => '',
39	+ 'type' => 'text',
40	+ 'std' => '',
41	+ 'select2' => false,
42	+ 'multiple' => false,
43	+ 'options' => array(),
44	+ 'restrict' => array(),
45	+ 'settings' => array()
46	+ ) );
47	+
48	+ // Each to it's own variable for slim-ness' sakes.
49	+ $setting = shortcode_atts( $defaults, $setting );
50	+
51	+ $restrict_defaults = array(
52	+ 'min' => 0,
53	+ 'max' => '',
54	+ 'step' => 'any',
55	+ );
56	+
57	+ $setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
58	+
59	+ $setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
60	+ $setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
61	+ $setting[ 'value' ] = SF_Format_Options::sanitize_value( $setting[ 'value' ], $setting );
62	+
63	+ $setting[ 'title' ] = $setting[ 'name' ];
64	+ $setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
65	+
66	+ $setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
67	+ $setting[ 'tip' ] = SF_Format_Options::get_formatted_tip( $setting[ 'tip' ] );
68	+
69	+ $header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
70	+
71	+ extract( $setting );
72	+
73	+ $description = $desc && !$grouped && $type != 'checkbox'
74	+ ? '<br /><small>' . $desc . '</small>'
75	+ : '<label for="' . $id . '"> ' . $desc . '</label>';
76	+
77	+ $description = ( ( in_array( $type, $header_types ) \|\| $type == 'radio' ) && !empty( $desc ) )
78	+ ? '<p>' . $desc . '</p>'
79	+ : $description;
80	+
81	+ ?>
82	+
83	+ <?php if ( !in_array( $type, $header_types ) ) : ?>
84	+ <!-- Header of the option. -->
85	+ <tr valign="top">
86	+ <th scope="row"<?php echo $grouped; ?>>
87	+
88	+ <?php echo $tip; ?>
89	+
90	+ <?php if ( !$grouped ) : ?>
91	+ <label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
92	+ <?php endif; ?>
93	+
94	+ </th>
95	+ <td <?php echo $grouped; ?> >
96	+ <?php endif; ?>
97	+
98	+ <?php foreach ( $header_types as $header ) :
99	+ if ( $type != $header ) continue; ?>
100	+ <tr>
101	+ <th scope="col" colspan="2">
102	+ <h3 class="title"><?php echo $title; ?></h3>
103	+ <?php echo $description; ?>
104	+ </th>
105	+ </tr>
106	+ <?php endforeach; ?>
107	+
108	+ <?php switch ( $type ) :
109	+
110	+ case 'text' :
111	+ case 'color' :
112	+ case 'number' :
113	+ if ( $type == 'color' ) {
114	+ $type = 'text';
115	+ $class .= ' colorpick';
116	+ $description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
117	+ }
118	+ ?>
119	+ <input name="<?php echo $name; ?>"
120	+ id="<?php echo $id; ?>"
121	+ type="<?php echo $type; ?>"
122	+
123	+ <?php if ( $type == 'number' ): ?>
124	+ min="<?php echo $restrict[ 'min' ]; ?>"
125	+ max="<?php echo $restrict[ 'max' ]; ?>"
126	+ step="<?php echo $restrict[ 'step' ]; ?>"
127	+ <?php endif; ?>
128	+
129	+ class="regular-text <?php echo $class; ?>"
130	+ style="<?php echo $css; ?>"
131	+ placeholder="<?php echo $placeholder; ?>"
132	+ value="<?php echo $value !== false ? $value : $std; ?>"
133	+ />
134	+ <?php echo $description;
135	+ break;
136	+
137	+ case 'checkbox':
138	+
139	+ $selected = ( $value !== false ) ? $value : $std;
140	+
141	+ if ( $multiple ) :
142	+
143	+ foreach ( $options as $key => $desc ) : ?>
144	+
145	+ <input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
146	+ id="<?php echo $id . '_' . $key; ?>"
147	+ type="checkbox"
148	+ class="<?php echo $class; ?>"
149	+ style="<?php echo $css; ?>"
150	+ value="<?php echo $key; ?>"
151	+ <?php self::checked( $value, $key ); ?>
152	+ />
153	+ <label for="<?php echo $id . '_' . $key; ?>">
154	+ <?php echo $desc; ?>
155	+ </label>
156	+ <br/>
157	+ <?php
158	+
159	+ endforeach;
160	+
161	+ else : ?>
162	+
163	+ <input name="<?php echo $name; ?>"
164	+ id="<?php echo $id ?>"
165	+ type="checkbox"
166	+ class="<?php echo $class; ?>"
167	+ style="<?php echo $css; ?>"
168	+ <?php checked( $selected, 1 ); ?>
169	+ />
170	+ <?php echo $description;
171	+ endif;
172	+ break;
173	+
174	+ case 'radio':
175	+
176	+ $selected = ( $value !== false ) ? $value : $std;
177	+
178	+ foreach ( $options as $key => $val ) : ?>
179	+ <label class="radio">
180	+ <input type="radio"
181	+ name="<?php echo $name; ?>"
182	+ id="<?php echo $key; ?>"
183	+ value="<?php echo $key; ?>"
184	+ class="<?php echo $class; ?>"
185	+ <?php checked( $selected, $key ); ?>
186	+ />
187	+ <?php echo $val; ?>
188	+ </label><br/>
189	+ <?php endforeach;
190	+ echo $description;
191	+ break;
192	+
193	+ case 'single_select_page':
194	+
195	+ $selected = ( $value !== false ) ? $value : $std;
196	+
197	+ $args = array(
198	+ 'name' => $name,
199	+ 'id' => $id,
200	+ 'sort_order' => 'ASC',
201	+ 'echo' => 0,
202	+ 'selected' => $selected
203	+ );
204	+
205	+ echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
206	+
207	+ echo $description;
208	+
209	+ if ( $select2 ) : ?>
210	+ <script type="text/javascript">jQuery(function () {
211	+ jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'geczy' ); ?>", width: '350px' });
212	+ });</script>
213	+ <?php endif;
214	+
215	+ break;
216	+
217	+ case 'select':
218	+
219	+ $selected = ( $value !== false ) ? $value : $std;
220	+ $options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
221	+
222	+ <select id="<?php echo $id; ?>"
223	+ class="<?php echo $class; ?>"
224	+ style="<?php echo $css; ?>"
225	+ name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
226	+ <?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
227	+
228	+ <?php foreach ( $options as $key => $val ) : ?>
229	+ <option
230	+ value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
231	+ <?php endforeach; ?>
232	+ </select>
233	+
234	+ <?php echo $description;
235	+
236	+ if ( $select2 ) : ?>
237	+ <script type="text/javascript">jQuery(function () {
238	+ jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
239	+ });</script>
240	+ <?php endif;
241	+
242	+ break;
243	+
244	+ case 'textarea':
245	+ ?>
246	+ <textarea name="<?php echo $name; ?>"
247	+ id="<?php echo $id; ?>"
248	+ class="large-text <?php echo $class; ?>"
249	+ style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
250	+ placeholder="<?php echo $placeholder; ?>"
251	+ rows="3"
252	+ ><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
253	+ <?php echo $description;
254	+ break;
255	+
256	+ case 'wysiwyg':
257	+ wp_editor( $value, $id, array( 'textarea_name' => $name ) );
258	+ echo $description;
259	+ break;
260	+
261	+ default :
262	+ do_action( $this->id . '_options_type_' . $type, $setting );
263	+ break;
264	+
265	+ endswitch;
266	+
267	+ /* Footer of the option. */
268	+ if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
269	+
270	+ }
271	+
272	+
273	+ /**
274	+ *
275	+ *
276	+ * @param unknown $haystack
277	+ * @param unknown $current
278	+ */
279	+ private function selected( $haystack, $current )
280	+ {
281	+
282	+ if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
283	+ $current = $haystack = 1;
284	+ }
285	+
286	+ selected( $haystack, $current );
287	+ }
288	+
289	+
290	+ /**
291	+ *
292	+ *
293	+ * @param unknown $haystack
294	+ * @param unknown $current
295	+ */
296	+ private function checked( $haystack, $current )
297	+ {
298	+
299	+ if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
300	+ $current = $haystack = 1;
301	+ }
302	+
303	+ checked( $haystack, $current );
304	+ }
305	+
306	+
307	+ /**
308	+ * Format a tooltip given a string
309	+ *
310	+ * @param string $tip
311	+ *
312	+ * @return string
313	+ */
314	+ private function get_formatted_tip( $tip )
315	+ {
316	+ return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
317	+ }
318	+
319	+
320	+ /**
321	+ *
322	+ *
323	+ * @param unknown $value
324	+ * @param unknown $setting
325	+ *
326	+ * @return unknown
327	+ */
328	+ private function sanitize_value( $value, $setting )
329	+ {
330	+ if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
331	+ if ( is_array( $value ) ) {
332	+ foreach ( $value as $key => $output ) {
333	+ $value[ $key ] = esc_attr( $output );
334	+ }
335	+ } else {
336	+ $value = esc_attr( $value );
337	+ }
338	+ }
339	+
340	+ return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
341	+ }
342	+
343	+
344	+ }
345	+
346	+
347	+ }

trunk/classes/admin/settings/classes/sf-class-sanitize.php ADDED Viewed

	@@ -0,0 +1,177 @@


1	+ <?php
2	+
3	+ /**
4	+ * Sanitize filters
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package WordPress
8	+ */
9	+
10	+
11	+ if ( !class_exists( 'SF_Sanitize' ) ) {
12	+
13	+ class SF_Sanitize
14	+ {
15	+
16	+
17	+ /**
18	+ * Hooks
19	+ */
20	+ function __construct()
21	+ {
22	+ add_filter( 'geczy_sanitize_color', 'sanitize_text_field' );
23	+ add_filter( 'geczy_sanitize_text', 'sanitize_text_field' );
24	+ add_filter( 'geczy_sanitize_number', array( 'SF_Sanitize', 'sanitize_number_field' ) );
25	+ add_filter( 'geczy_sanitize_textarea', array( 'SF_Sanitize', 'sanitize_textarea' ) );
26	+ add_filter( 'geczy_sanitize_wysiwyg', array( 'SF_Sanitize', 'sanitize_wysiwyg' ) );
27	+ add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
28	+ add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
29	+ add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
30	+ add_filter( 'geczy_sanitize_image', array( 'SF_Sanitize', 'sanitize_image_url' ), 10, 2 );
31	+ add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
32	+ }
33	+
34	+
35	+ /**
36	+ * Numeric sanitization
37	+ *
38	+ * @param int $input
39	+ *
40	+ * @return int
41	+ */
42	+ public static function sanitize_number_field( $input )
43	+ {
44	+ $output = is_numeric( $input ) ? (float) $input : false;
45	+
46	+ return $input;
47	+ }
48	+
49	+
50	+ /**
51	+ * Textarea sanitization
52	+ *
53	+ * @param string $input
54	+ *
55	+ * @return string
56	+ */
57	+ public static function sanitize_textarea( $input )
58	+ {
59	+ global $allowedposttags;
60	+ $output = wp_kses( $input, $allowedposttags );
61	+
62	+ return $output;
63	+ }
64	+
65	+
66	+ /**
67	+ * WYSIWYG sanitization
68	+ *
69	+ * @param string $input
70	+ *
71	+ * @return string
72	+ */
73	+ public static function sanitize_wysiwyg( $input )
74	+ {
75	+ return $input;
76	+ }
77	+
78	+
79	+ /**
80	+ * Checkbox sanitization
81	+ *
82	+ * @param int $input
83	+ * @param unknown $option
84	+ *
85	+ * @return int
86	+ */
87	+ public static function sanitize_checkbox( $input, $option )
88	+ {
89	+ if ( !empty( $option[ 'multiple' ] ) ) {
90	+
91	+ $defaults = array_keys( $option[ 'options' ] );
92	+
93	+ foreach ( $defaults as $value ) {
94	+
95	+ if ( !is_array( $input ) ) {
96	+ $output[ $value ] = 0;
97	+ } else {
98	+ $output[ $value ] = in_array( $value, $input ) ? 1 : 0;
99	+ }
100	+
101	+ }
102	+
103	+ $output = serialize( $output );
104	+ } else {
105	+ $output = $input ? 1 : 0;
106	+ }
107	+
108	+ return $output;
109	+ }
110	+
111	+
112	+ /**
113	+ * Array sanitization
114	+ *
115	+ * @param unknown $input
116	+ * @param array $option
117	+ *
118	+ * @return bool
119	+ */
120	+ public static function sanitize_enum( $input, $option )
121	+ {
122	+ $output = $input;
123	+
124	+ $sfs = new SF_Sanitize();
125	+
126	+ if ( is_array( $input ) ) {
127	+ foreach ( $input as $value ) {
128	+ if ( !$sfs->sanitize_enum( $value, $option ) ) {
129	+ $output = false;
130	+ break;
131	+ }
132	+ }
133	+ $output = $output ? serialize( $output ) : $output;
134	+ } else {
135	+ $output = array_key_exists( $input, $option[ 'options' ] ) ? $input : false;
136	+ }
137	+
138	+ return $output;
139	+ }
140	+
141	+
142	+ /**
143	+ * Select box for pages sanitize
144	+ *
145	+ * @param int $input
146	+ * @param int $option
147	+ *
148	+ * @return int
149	+ */
150	+ public static function sanitize_select_pages( $input, $option )
151	+ {
152	+ $output = get_page( $input ) ? (int) $input : 0;
153	+
154	+ return $output;
155	+ }
156	+
157	+
158	+
159	+ /**
160	+ * Image uploader
161	+ *
162	+ * @param url $input
163	+ *
164	+ * @return int
165	+ */
166	+ public static function sanitize_image_url( $input, $option ) {
167	+
168	+ $output = $input;
169	+ return $output;
170	+
171	+ }
172	+
173	+
174	+ }
175	+
176	+
177	+ }

trunk/classes/admin/settings/classes/sf-class-settings.php ADDED Viewed

	@@ -0,0 +1,929 @@


1	+ <?php
2	+
3	+ /**
4	+ * WP-Simple-Settings-Framework
5	+ *
6	+ * Copyright (c) 2012 Matt Gates.
7	+ * All rights reserved.
8	+ *
9	+ * Redistribution and use in source and binary forms, with or without
10	+ * modification, are permitted provided that the following conditions
11	+ * are met:
12	+ *
13	+ * * Redistributions of source code must retain the above copyright
14	+ * notice, this list of conditions and the following disclaimer.
15	+ *
16	+ * * Redistributions in binary form must reproduce the above copyright
17	+ * notice, this list of conditions and the following disclaimer in
18	+ * the documentation and/or other materials provided with the
19	+ * distribution.
20	+ *
21	+ * * Neither the names of the copyright holders nor the names of the
22	+ * contributors may be used to endorse or promote products derived
23	+ * from this software without specific prior written permission.
24	+ *
25	+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
26	+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
27	+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
28	+ * FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
29	+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
30	+ * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
31	+ * BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
32	+ * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
33	+ * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
34	+ * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
35	+ * ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
36	+ * POSSIBILITY OF SUCH DAMAGE.
37	+ *
38	+ * @subpackage WP-Simple-Settings-Framework
39	+ * @copyright 2012 Matt Gates.
40	+ * @license http://www.opensource.org/licenses/bsd-license.php BSD License
41	+ * @link http://mgates.me
42	+ * @version 1.1
43	+ * @author Matt Gates <info@mgates.me>
44	+ * @package WordPress
45	+ */
46	+
47	+
48	+ if ( !class_exists( 'SF_Settings_API' ) ) {
49	+
50	+ class SF_Settings_API
51	+ {
52	+
53	+ private $data = array();
54	+
55	+ /**
56	+ * Init
57	+ *
58	+ * @param string $id
59	+ * @param string $title
60	+ * @param string $menu (optional)
61	+ * @param string $file
62	+ */
63	+ public function __construct( $id, $title, $menu = '', $file )
64	+ {
65	+ $this->assets_url = trailingslashit( plugins_url( 'assets/', dirname( __FILE__ ) ) );
66	+ $this->id = $id;
67	+ $this->title = $title;
68	+ $this->menu = empty( $menu ) ? 'plugins.php' : $menu;
69	+
70	+ $this->file = $file;
71	+
72	+ $this->includes();
73	+ $this->actions();
74	+ }
75	+
76	+
77	+ // ==================================================================
78	+ //
79	+ // Getter and setter.
80	+ //
81	+ // ------------------------------------------------------------------
82	+
83	+ /**
84	+ * Setter
85	+ *
86	+ * @param unknown $name
87	+ * @param unknown $value
88	+ */
89	+ public function __set( $name, $value )
90	+ {
91	+ if ( isset ( $this->data[ $name ] ) && is_array( $this->data[ $name ] ) ) {
92	+ $this->data[ $name ] = array_merge( $this->data[ $name ], $value );
93	+ } else {
94	+ $this->data[ $name ] = $value;
95	+ }
96	+ }
97	+
98	+
99	+ /**
100	+ * Getter
101	+ *
102	+ * @param unknown $name
103	+ *
104	+ * @return unknown
105	+ */
106	+ public function __get( $name )
107	+ {
108	+ if ( array_key_exists( $name, $this->data ) ) {
109	+ return $this->data[ $name ];
110	+ }
111	+
112	+ return null;
113	+ }
114	+
115	+
116	+ /**
117	+ * Isset
118	+ *
119	+ * @param unknown $name
120	+ *
121	+ * @return unknown
122	+ */
123	+ public function __isset( $name )
124	+ {
125	+ return isset( $this->data[ $name ] );
126	+ }
127	+
128	+
129	+ /**
130	+ * Unset
131	+ *
132	+ * @param unknown $name
133	+ */
134	+ public function __unset( $name )
135	+ {
136	+ unset( $this->data[ $name ] );
137	+ }
138	+
139	+
140	+ /**
141	+ * Add a "Settings" link to the plugins.php page
142	+ *
143	+ * @param array $links
144	+ * @param array $file
145	+ *
146	+ * @return array
147	+ */
148	+ public function add_settings_link( $links, $file )
149	+ {
150	+ $this_plugin = plugin_basename( $this->file );
151	+ $page = strpos( $this->menu, '.php' ) ? $this->menu : 'admin.php';
152	+ if ( $file == $this_plugin ) {
153	+ $settings_link = '<a href="' . $page . '?page=' . $this->id . '">' . __( 'Settings', 'geczy' ) . '</a>';
154	+ array_unshift( $links, $settings_link );
155	+ }
156	+
157	+ return $links;
158	+ }
159	+
160	+
161	+ // ==================================================================
162	+ //
163	+ // Begin initialization.
164	+ //
165	+ // ------------------------------------------------------------------
166	+
167	+ /**
168	+ * Core files
169	+ */
170	+ private function includes()
171	+ {
172	+ require_once dirname( __FILE__ ) . '/sf-class-sanitize.php';
173	+ require_once dirname( __FILE__ ) . '/sf-class-format-options.php';
174	+ new SF_Sanitize;
175	+ }
176	+
177	+
178	+ /**
179	+ * Hooks
180	+ */
181	+ private function actions()
182	+ {
183	+ add_action( 'admin_enqueue_scripts', array( &$this, 'admin_enqueue_scripts' ) );
184	+ add_action( 'admin_init', array( &$this, 'register_options' ) );
185	+ add_action( 'admin_menu', array( &$this, 'create_menu' ) );
186	+ add_filter( 'plugin_action_links', array( &$this, 'add_settings_link' ), 10, 2 );
187	+ }
188	+
189	+
190	+ /**
191	+ * Admin scripts and styles
192	+ */
193	+ public function admin_enqueue_scripts()
194	+ {
195	+ global $pagenow;
196	+ if (is_admin() \|\| $pagenow === 'wc_prd_vendor') {
197	+ wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
198	+ wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );
199	+ wp_register_script( 'wcvendors-media', $this->assets_url . 'js/wcvendors-media.js', array( 'jquery' ), '1.0' );
200	+ wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
201	+ wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
202	+ wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );
203	+ }
204	+ }
205	+
206	+
207	+ /**
208	+ * Admin scripts and styles
209	+ */
210	+ public function admin_print_scripts()
211	+ {
212	+ global $wp_version;
213	+
214	+ //Check wp version and load appropriate scripts for colorpicker.
215	+ if ( 3.5 <= $wp_version ) {
216	+ wp_enqueue_style( 'wp-color-picker' );
217	+ wp_enqueue_script( 'wp-color-picker' );
218	+ } else {
219	+ wp_enqueue_style( 'farbtastic' );
220	+ wp_enqueue_script( 'farbtastic' );
221	+ }
222	+
223	+ wp_enqueue_script( 'bootstrap-tooltip' );
224	+ wp_enqueue_script( 'select2' );
225	+ wp_enqueue_script( 'wcvendors-media' );
226	+ wp_enqueue_script( 'sf-scripts' );
227	+
228	+ wp_enqueue_style( 'wp-color-picker' );
229	+ wp_enqueue_style( 'select2' );
230	+ wp_enqueue_style( 'sf-styles' );
231	+ }
232	+
233	+
234	+ /**
235	+ * Register setting
236	+ */
237	+ public function register_options()
238	+ {
239	+ register_setting( $this->id . '_options_nonce', $this->id . '_options', array( &$this, 'validate_options' ) );
240	+ }
241	+
242	+
243	+ /**
244	+ * Create menu
245	+ */
246	+ public function create_menu()
247	+ {
248	+ $page = add_submenu_page( $this->menu, $this->title, $this->title, apply_filters( $this->id . '_manage_options', 'manage_options' ), $this->id, array( &$this, 'init_settings_page' ) );
249	+ add_action( 'admin_print_scripts-' . $page, array( &$this, 'admin_print_scripts' ) );
250	+ }
251	+
252	+
253	+ /**
254	+ * Parse options into tabbed organization
255	+ *
256	+ * @return array
257	+ */
258	+ private function parse_options()
259	+ {
260	+ $options = $this->options;
261	+
262	+ foreach ( $options as $option ) {
263	+
264	+ if ( $option[ 'type' ] == 'heading' ) {
265	+ $tab_name = sanitize_title( $option[ 'name' ] );
266	+ $this->tab_headers = array( $tab_name => $option[ 'name' ] );
267	+
268	+ continue;
269	+ }
270	+
271	+ $option[ 'tab' ] = $tab_name;
272	+ $tabs[ $tab_name ][ ] = $option;
273	+
274	+ }
275	+
276	+ $this->tabs = $tabs;
277	+
278	+ return $tabs;
279	+ }
280	+
281	+
282	+ /**
283	+ * Load the options array from a file
284	+ *
285	+ * @param string $option_file
286	+ */
287	+ public function load_options( $option_file )
288	+ {
289	+ if ( !empty( $this->options ) ) return;
290	+
291	+ if ( file_exists( $option_file ) ) {
292	+ require $option_file;
293	+ $this->options = apply_filters( $this->id . '_options', $options );
294	+ $this->parse_options();
295	+
296	+ $this->current_options = $this->get_current_options();
297	+
298	+ /* If the option has no saved data, load the defaults. */
299	+ /* @TODO: Can prob add this to the activation hook. */
300	+ $this->set_defaults( $this->current_options );
301	+ } else {
302	+ wp_die( __( 'Could not load settings at: ', 'geczy' ) . '<br/><code>' . $option_file . '</code>', __( 'Error - WP Settings Framework', 'geczy' ) );
303	+ }
304	+ }
305	+
306	+
307	+ /**
308	+ *
309	+ *
310	+ * @return unknown
311	+ */
312	+ public function get_current_options()
313	+ {
314	+ if ( !empty( $this->current_options ) )
315	+ return $this->current_options;
316	+
317	+ $options = get_option( $this->id . '_options' );
318	+
319	+ if ( $options ) {
320	+ $options = array_map( 'maybe_unserialize', $options );
321	+ }
322	+
323	+ return $options;
324	+ }
325	+
326	+
327	+ /**
328	+ * Sanitize and validate post fields
329	+ *
330	+ * @param unknown $input
331	+ *
332	+ * @return unknown
333	+ */
334	+ public function validate_options( $input )
335	+ {
336	+ if ( !isset( $_POST[ 'update' ] ) )
337	+ return $this->get_defaults();
338	+
339	+ $clean = $this->current_options;
340	+ $tabname = $_POST[ 'currentTab' ];
341	+
342	+ foreach ( $this->tabs[ $tabname ] as $option ) :
343	+
344	+ if ( !isset( $option[ 'id' ] ) )
345	+ continue;
346	+
347	+ if ( !isset( $option[ 'type' ] ) )
348	+ continue;
349	+
350	+ if ( $option[ 'type' ] == 'select' ) {
351	+ $option[ 'options' ] = apply_filters( $this->id . '_select_options', $option[ 'options' ], $option );
352	+ }
353	+
354	+ $id = sanitize_text_field( strtolower( $option[ 'id' ] ) );
355	+
356	+ // Set checkbox to false if it wasn't sent in the $_POST
357	+ if ( 'checkbox' == $option[ 'type' ] && !isset( $input[ $id ] ) )
358	+ $input[ $id ] = 0;
359	+
360	+ // For a value to be submitted to database it must pass through a sanitization filter
361	+ if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
362	+ $clean[ $id ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $input[ $id ], $option );
363	+ }
364	+
365	+ endforeach;
366	+
367	+ do_action( $this->id . '_options_updated', $clean, $tabname );
368	+ add_settings_error( $this->id, 'save_options', __( 'Settings saved.', 'geczy' ), 'updated' );
369	+
370	+ return apply_filters( $this->id . '_options_on_update', $clean, $tabname );
371	+ }
372	+
373	+
374	+ /**
375	+ * Create default options
376	+ *
377	+ * @param unknown $current_options (optional)
378	+ */
379	+ private function set_defaults( $current_options = array() )
380	+ {
381	+ $options = $this->get_defaults( $current_options );
382	+ if ( $options ) {
383	+ update_option( $this->id . '_options', $options );
384	+ }
385	+ }
386	+
387	+
388	+ /**
389	+ * Retrieve default options
390	+ *
391	+ * @param unknown $currents (optional)
392	+ *
393	+ * @return array
394	+ */
395	+ private function get_defaults( $currents = array() )
396	+ {
397	+ $output = array();
398	+ $config = $this->options;
399	+ $flag = false;
400	+
401	+ if ( $currents ) {
402	+ foreach ( $config as $value ) {
403	+ if ( !isset( $value[ 'id' ] ) \|\| !isset( $value[ 'std' ] ) \|\| !isset( $value[ 'type' ] ) )
404	+ continue;
405	+
406	+ if ( !isset( $currents[ $value[ 'id' ] ] ) ) {
407	+ $flag = true;
408	+ }
409	+ }
410	+ }
411	+
412	+ foreach ( $config as $option ) {
413	+ if ( !isset( $option[ 'id' ] ) \|\| !isset( $option[ 'std' ] ) \|\| !isset( $option[ 'type' ] ) )
414	+ continue;
415	+
416	+ if ( $currents && isset( $currents[ $option[ 'id' ] ] ) ) {
417	+ $output[ $option[ 'id' ] ] = $currents[ $option[ 'id' ] ];
418	+ } else if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
419	+ $output[ $option[ 'id' ] ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $option[ 'std' ], $option );
420	+ }
421	+ }
422	+
423	+ if ( $currents ) {
424	+ $output = array_merge( $currents, $output );
425	+ }
426	+
427	+ return !$flag && $currents ? array() : $output;
428	+ }
429	+
430	+
431	+ /**
432	+ * HTML header
433	+ */
434	+ private function template_header()
435	+ {
436	+ ?>
437	+ <div class="wrap">
438	+ <?php screen_icon(); ?><h2><?php echo $this->title; ?></h2>
439	+
440	+ <h2 class="nav-tab-wrapper">
441	+ <?php echo $this->display_tabs(); ?>
442	+ </h2><?php
443	+
444	+ if ( !empty ( $_REQUEST[ 'settings-updated' ] ) )
445	+ settings_errors();
446	+
447	+ }
448	+
449	+
450	+ /**
451	+ * HTML body
452	+ *
453	+ * @return unknown
454	+ */
455	+ private function template_body()
456	+ {
457	+
458	+ if ( empty( $this->options ) ) return false;
459	+
460	+
461	+ $options = $this->options;
462	+ $tabs = $this->get_tabs();
463	+ $tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
464	+
465	+ $options = apply_filters( $this->id . '_options_tab-' . $tabname, $this->tabs[ $tabname ] ); ?>
466	+
467	+ <form method="post" action="options.php">
468	+ <?php settings_fields( $this->id . '_options_nonce' ); ?>
469	+ <table class="form-table">
470	+
471	+ <?php
472	+ foreach ( $options as $value ) :
473	+ $this->settings_options_format( $value );
474	+ endforeach;
475	+
476	+ do_action( $this->id . '_options_tab-' . $tabname );
477	+ ?>
478	+
479	+ </table>
480	+
481	+ <p class="submit">
482	+ <input type="hidden" name="currentTab" value="<?php echo $tabname; ?>">
483	+ <input type="submit" name="update" class="button-primary"
484	+ value="<?php echo sprintf( __( 'Save %s changes', 'geczy' ), $this->tab_headers[ $tabname ] ); ?>"/>
485	+ </p>
486	+ </form> <?php
487	+
488	+ }
489	+
490	+
491	+ /**
492	+ * HTML footer
493	+ */
494	+ private function template_footer()
495	+ {
496	+ echo '</div>';
497	+ }
498	+
499	+
500	+ /**
501	+ * Create the settings page
502	+ */
503	+ public function init_settings_page()
504	+ {
505	+
506	+ $this->template_header();
507	+ $this->template_body();
508	+ $this->template_footer();
509	+
510	+ }
511	+
512	+
513	+ /**
514	+ * Retrieve tabs
515	+ *
516	+ * @return array
517	+ */
518	+ private function get_tabs()
519	+ {
520	+ $tabs = array();
521	+ foreach ( $this->options as $option ) {
522	+
523	+ if ( $option[ 'type' ] != 'heading' )
524	+ continue;
525	+
526	+ $option[ 'slug' ] = sanitize_title( $option[ 'name' ] );
527	+ unset( $option[ 'type' ] );
528	+
529	+ $tabs[ ] = $option;
530	+ }
531	+
532	+ return $tabs;
533	+ }
534	+
535	+
536	+ /**
537	+ * Heading for navigation
538	+ *
539	+ * @return string
540	+ */
541	+ private function display_tabs()
542	+ {
543	+ $tabs = $this->get_tabs();
544	+ $tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
545	+ $menu = '';
546	+
547	+ foreach ( $tabs as $tab ) {
548	+ $class = $tabname == $tab[ 'slug' ] ? 'nav-tab-active' : '';
549	+
550	+ $fields = array(
551	+ 'page' => $this->id,
552	+ 'tab' => $tab[ 'slug' ],
553	+ );
554	+
555	+ $query = http_build_query( array_merge( $_GET, $fields ) );
556	+ $menu .= sprintf( '<a id="%s-tab" class="nav-tab %s" title="%s" href="?%s">%s</a>', $tab[ 'slug' ], $class, $tab[ 'name' ], $query, esc_html( $tab[ 'name' ] ) );
557	+ }
558	+
559	+ return $menu;
560	+ }
561	+
562	+
563	+ /**
564	+ * Update an option
565	+ *
566	+ * @param string $name
567	+ * @param string $value
568	+ *
569	+ * @return bool
570	+ */
571	+ public function update_option( $name, $value )
572	+ {
573	+ // Overwrite the key/value pair
574	+ $this->current_options = array( $name => $value ) + (array) $this->current_options;
575	+
576	+ return update_option( $this->id . '_options', $this->current_options );
577	+ }
578	+
579	+
580	+ /**
581	+ * Get an option
582	+ *
583	+ * @param string $name
584	+ * @param string $default (optional)
585	+ *
586	+ * @return bool
587	+ */
588	+ public function get_option( $name, $default = false )
589	+ {
590	+ return isset( $this->current_options[ $name ] ) ? maybe_unserialize( $this->current_options[ $name ] ) : $default;
591	+ }
592	+
593	+
594	+ public function settings_options_format( $setting )
595	+ {
596	+ if ( empty( $setting ) ) return false;
597	+
598	+ $defaults = apply_filters( $this->id . '_options_defaults', array(
599	+ 'name' => '',
600	+ 'desc' => '',
601	+ 'placeholder' => '',
602	+ 'class' => '',
603	+ 'tip' => '',
604	+ 'id' => '',
605	+ 'css' => '',
606	+ 'type' => 'text',
607	+ 'std' => '',
608	+ 'select2' => false,
609	+ 'multiple' => false,
610	+ 'options' => array(),
611	+ 'restrict' => array(),
612	+ 'settings' => array()
613	+ ) );
614	+
615	+ // Each to it's own variable for slim-ness' sakes.
616	+ $setting = shortcode_atts( $defaults, $setting );
617	+
618	+ $restrict_defaults = array(
619	+ 'min' => 0,
620	+ 'max' => '',
621	+ 'step' => 'any',
622	+ );
623	+
624	+ $setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
625	+
626	+ $setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
627	+ $setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
628	+ $setting[ 'value' ] = $this->sanitize_value( $setting[ 'value' ], $setting );
629	+
630	+ $setting[ 'title' ] = $setting[ 'name' ];
631	+ $setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
632	+
633	+ $setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
634	+ $setting[ 'tip' ] = $this->get_formatted_tip( $setting[ 'tip' ] );
635	+
636	+ $header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
637	+
638	+ extract( $setting );
639	+
640	+ $description = $desc && !$grouped && $type != 'checkbox'
641	+ ? '<br /><small>' . $desc . '</small>'
642	+ : '<label for="' . $id . '"> ' . $desc . '</label>';
643	+
644	+ $description = ( ( in_array( $type, $header_types ) \|\| $type == 'radio' ) && !empty( $desc ) )
645	+ ? '<p>' . $desc . '</p>'
646	+ : $description;
647	+
648	+ ?>
649	+
650	+ <?php if ( !in_array( $type, $header_types ) ) : ?>
651	+ <!-- Header of the option. -->
652	+ <tr valign="top">
653	+ <th scope="row"<?php echo $grouped; ?>>
654	+
655	+ <?php echo $tip; ?>
656	+
657	+ <?php if ( !$grouped ) : ?>
658	+ <label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
659	+ <?php endif; ?>
660	+
661	+ </th>
662	+ <td <?php echo $grouped; ?> >
663	+ <?php endif; ?>
664	+
665	+ <?php foreach ( $header_types as $header ) :
666	+ if ( $type != $header ) continue; ?>
667	+ <tr>
668	+ <th scope="col" colspan="2">
669	+ <h3 class="title"><?php echo $title; ?></h3>
670	+ <?php echo $description; ?>
671	+ </th>
672	+ </tr>
673	+ <?php endforeach; ?>
674	+
675	+ <?php switch ( $type ) :
676	+
677	+ case 'text' :
678	+ case 'color' :
679	+ case 'number' :
680	+ if ( $type == 'color' ) {
681	+ $type = 'text';
682	+ $class .= ' colorpick';
683	+ $description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
684	+ }
685	+ ?>
686	+ <input name="<?php echo $name; ?>"
687	+ id="<?php echo $id; ?>"
688	+ type="<?php echo $type; ?>"
689	+
690	+ <?php if ( $type == 'number' ): ?>
691	+ min="<?php echo $restrict[ 'min' ]; ?>"
692	+ max="<?php echo $restrict[ 'max' ]; ?>"
693	+ step="<?php echo $restrict[ 'step' ]; ?>"
694	+ <?php endif; ?>
695	+
696	+ class="regular-text <?php echo $class; ?>"
697	+ style="<?php echo $css; ?>"
698	+ placeholder="<?php echo $placeholder; ?>"
699	+ value="<?php echo $value !== false ? $value : $std; ?>"
700	+ />
701	+ <?php echo $description;
702	+ break;
703	+
704	+ case 'checkbox':
705	+
706	+ $selected = ( $value !== false ) ? $value : $std;
707	+
708	+ if ( $multiple ) :
709	+
710	+ foreach ( $options as $key => $desc ) : ?>
711	+
712	+ <input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
713	+ id="<?php echo $id . '_' . $key; ?>"
714	+ type="checkbox"
715	+ class="<?php echo $class; ?>"
716	+ style="<?php echo $css; ?>"
717	+ value="<?php echo $key; ?>"
718	+ <?php @checked( $selected[$key], 1 ); ?>
719	+ />
720	+ <label for="<?php echo $id . '_' . $key; ?>">
721	+ <?php echo $desc; ?>
722	+ </label>
723	+ <br/>
724	+ <?php
725	+
726	+ endforeach;
727	+
728	+ else : ?>
729	+
730	+ <input name="<?php echo $name; ?>"
731	+ id="<?php echo $id ?>"
732	+ type="checkbox"
733	+ class="<?php echo $class; ?>"
734	+ style="<?php echo $css; ?>"
735	+ <?php checked( $selected, 1 ); ?>
736	+ />
737	+ <?php echo $description;
738	+ endif;
739	+ break;
740	+
741	+ case 'radio':
742	+
743	+ $selected = ( $value !== false ) ? $value : $std;
744	+
745	+ foreach ( $options as $key => $val ) : ?>
746	+ <label class="radio">
747	+ <input type="radio"
748	+ name="<?php echo $name; ?>"
749	+ id="<?php echo $key; ?>"
750	+ value="<?php echo $key; ?>"
751	+ class="<?php echo $class; ?>"
752	+ <?php checked( $selected, $key ); ?>
753	+ />
754	+ <?php echo $val; ?>
755	+ </label><br/>
756	+ <?php endforeach;
757	+ echo $description;
758	+ break;
759	+
760	+ case 'single_select_page':
761	+
762	+ $selected = ( $value !== false ) ? $value : $std;
763	+
764	+ if ( $value == 0 ) $selected = $std;
765	+
766	+ $args = array(
767	+ 'name' => $name,
768	+ 'id' => $id,
769	+ 'sort_order' => 'ASC',
770	+ 'echo' => 0,
771	+ 'selected' => $selected
772	+ );
773	+
774	+ echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
775	+
776	+ echo $description;
777	+
778	+ if ( $select2 ) : ?>
779	+ <script type="text/javascript">jQuery(function () {
780	+ jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'geczy' ); ?>", width: '350px' });
781	+ });</script>
782	+ <?php endif;
783	+
784	+ break;
785	+
786	+ case 'select':
787	+
788	+ $selected = ( $value !== false ) ? $value : $std;
789	+ $options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
790	+
791	+ <select id="<?php echo $id; ?>"
792	+ class="<?php echo $class; ?>"
793	+ style="<?php echo $css; ?>"
794	+ name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
795	+ <?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
796	+
797	+ <?php foreach ( $options as $key => $val ) : ?>
798	+ <option
799	+ value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
800	+ <?php endforeach; ?>
801	+ </select>
802	+
803	+ <?php echo $description;
804	+
805	+ if ( $select2 ) : ?>
806	+ <script type="text/javascript">jQuery(function () {
807	+ jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
808	+ });</script>
809	+ <?php endif;
810	+
811	+ break;
812	+
813	+ case 'textarea':
814	+ ?>
815	+ <textarea name="<?php echo $name; ?>"
816	+ id="<?php echo $id; ?>"
817	+ class="large-text <?php echo $class; ?>"
818	+ style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
819	+ placeholder="<?php echo $placeholder; ?>"
820	+ rows="3"
821	+ ><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
822	+ <?php echo $description;
823	+ break;
824	+
825	+ case 'wysiwyg':
826	+ wp_editor( $value, $id, array( 'textarea_name' => $name ) );
827	+ echo $description;
828	+ break;
829	+
830	+ case 'image':
831	+
832	+ if ( empty ( $value ) ) $value = $std;
833	+
834	+ ?>
835	+ <img class="wcv-image-container-<?php echo $id; ?>" src="<?php echo $value; ?>" alt="" style="max-width:100%;" />
836	+ <br />
837	+ <input id="wcv-add-<?php echo $id; ?>" type="button" class="<?php echo $class; ?>" value="<?php echo sprintf( __( 'Update %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-id="<?php echo $id; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), $title ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wcvendors' ), strtolower( $title ) ); ?>" />
838	+ <input type="hidden" name="<?php echo $name; ?>" id="<?php echo $id; ?>" value="<?php echo $value; ?>">
839	+ <?php
840	+ break;
841	+
842	+ default :
843	+ do_action( $this->id . '_options_type_' . $type, $setting );
844	+ break;
845	+
846	+ endswitch;
847	+
848	+ /* Footer of the option. */
849	+ if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
850	+
851	+ }
852	+
853	+
854	+ /**
855	+ *
856	+ *
857	+ * @param unknown $haystack
858	+ * @param unknown $current
859	+ */
860	+ private function selected( $haystack, $current )
861	+ {
862	+
863	+ if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
864	+ $current = $haystack = 1;
865	+ }
866	+
867	+ selected( $haystack, $current );
868	+ }
869	+
870	+
871	+ /**
872	+ *
873	+ *
874	+ * @param unknown $haystack
875	+ * @param unknown $current
876	+ */
877	+ private function checked( $haystack, $current )
878	+ {
879	+
880	+ if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
881	+ $current = $haystack = 1;
882	+ }
883	+
884	+ checked( $haystack, $current );
885	+ }
886	+
887	+
888	+ /**
889	+ * Format a tooltip given a string
890	+ *
891	+ * @param string $tip
892	+ *
893	+ * @return string
894	+ */
895	+ private function get_formatted_tip( $tip )
896	+ {
897	+ return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
898	+ }
899	+
900	+
901	+ /**
902	+ *
903	+ *
904	+ * @param unknown $value
905	+ * @param unknown $setting
906	+ *
907	+ * @return unknown
908	+ */
909	+ private function sanitize_value( $value, $setting )
910	+ {
911	+ if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
912	+ if ( is_array( $value ) ) {
913	+ foreach ( $value as $key => $output ) {
914	+ $value[ $key ] = esc_attr( $output );
915	+ }
916	+ } else {
917	+ $value = esc_attr( $value );
918	+ }
919	+ }
920	+
921	+ return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
922	+ }
923	+
924	+
925	+
926	+ }
927	+
928	+
929	+ }

trunk/classes/admin/settings/sf-options.php ADDED Viewed

	@@ -0,0 +1,353 @@


1	+ <?php
2	+ $options = array();
3	+
4	+ $options[ ] = array( 'name' => __( 'General', 'wcvendors' ), 'type' => 'heading' );
5	+ $options[ ] = array( 'name' => __( 'General options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
6	+
7	+ $options[ ] = array(
8	+ 'name' => __( 'Default commission (%)', 'wcvendors' ),
9	+ 'desc' => __( 'The default rate you pay each vendor for a product sale. <br>You can also give vendors their own individual commission rates by editing the vendors user account.<br>Also, you can edit an individual products commission to override both of these settings on a per product basis.', 'wcvendors' ),
10	+ 'id' => 'default_commission',
11	+ 'css' => 'width:70px;',
12	+ 'type' => 'number',
13	+ 'restrict' => array(
14	+ 'min' => 0,
15	+ 'max' => 100
16	+ )
17	+ );
18	+
19	+ /* Customize registration message depending on if they have registration enabled on the my account page */
20	+ $registration_message = __( 'Allow users or guests to apply to become a vendor', 'wcvendors' );
21	+ if ( get_option( 'woocommerce_enable_myaccount_registration' ) === 'no' ) {
22	+ $registration_message = __( 'Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:</strong> You MUST "<strong>Enable registration on the "My Account" page</strong>" in your <strong>WooCommerce > Settings > Accounts</strong> page for this option to work. Currently, you have registration disabled.', 'wcvendors' );
23	+ }
24	+
25	+ $options[ ] = array(
26	+ 'name' => __( 'Registration', 'wcvendors' ),
27	+ 'desc' => __( 'Allow users or guests to apply to become a vendor', 'wcvendors' ),
28	+ 'tip' => __( 'This will show a checkbox on the My Account page\'s registration form asking if the user would like to apply to be a vendor. Also, on the Vendor Dashboard, users can still apply to become a vendor even if this is disabled.', 'wcvendors' ),
29	+ 'id' => 'show_vendor_registration',
30	+ 'type' => 'checkbox',
31	+ 'std' => true,
32	+ );
33	+
34	+ $options[ ] = array(
35	+ 'desc' => __( 'Approve vendor applications manually', 'wcvendors' ),
36	+ 'tip' => __( 'With this unchecked, all vendor applications are automatically accepted. Otherwise, you must approve each manually.', 'wcvendors' ),
37	+ 'id' => 'manual_vendor_registration',
38	+ 'type' => 'checkbox',
39	+ 'std' => true,
40	+ );
41	+
42	+ $options[ ] = array(
43	+ 'name' => __( 'Taxes', 'wcvendors' ),
44	+ 'desc' => __( 'Give vendors any tax collected per-product', 'wcvendors' ),
45	+ 'tip' => __( 'The tax collected on a vendor\'s product will be given in its entirety', 'wcvendors' ),
46	+ 'id' => 'give_tax',
47	+ 'type' => 'checkbox',
48	+ 'std' => false,
49	+ );
50	+
51	+ $options[ ] = array(
52	+ 'name' => __( 'Shipping', 'wcvendors' ),
53	+ 'desc' => __( 'Give vendors any shipping collected per-product', 'wcvendors' ),
54	+ 'tip' => __( 'WC Vendors Free - Give vendors shipping if using Per Product Shipping gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. No other shipping module is compatible with this option.', 'wcvendors' ),
55	+ 'id' => 'give_shipping',
56	+ 'type' => 'checkbox',
57	+ 'std' => true,
58	+ );
59	+
60	+ $options[ ] = array( 'name' => __( 'Shop options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
61	+
62	+ $options[ ] = array(
63	+ 'name' => __( 'Shop HTML', 'wcvendors' ),
64	+ 'desc' => __( 'Enable HTML for a vendor\'s shop description by default. You can enable or disable this per vendor by editing the vendors user account.', 'wcvendors' ),
65	+ 'id' => 'shop_html_enabled',
66	+ 'type' => 'checkbox',
67	+ 'std' => true,
68	+ );
69	+
70	+ $options[ ] = array(
71	+ 'name' => __( 'Vendor Shop Page', 'wcvendors' ),
72	+ 'desc' => __( 'Enter one word for the URI. If you enter "<strong>vendors</strong>" your vendors store will be <code>yourdomain.com/vendors/store-name/</code>', 'wcvendors' ),
73	+ 'id' => 'vendor_shop_permalink',
74	+ 'type' => 'text',
75	+ 'std' => 'vendors/',
76	+ );
77	+
78	+ $options[ ] = array(
79	+ 'name' => __( 'Shop Headers', 'wcvendors' ),
80	+ 'desc' => __( 'Enable vendor shop headers', 'wcvendors' ),
81	+ 'tip' => __( 'This will override the HTML Shop description output on product-archive pages. In order to customize the shop headers visit wcvendors.com and read the article in the Knowledgebase titled Changing the Vendor Templates.', 'wcvendors' ),
82	+ 'id' => 'shop_headers_enabled',
83	+ 'type' => 'checkbox',
84	+ 'std' => false,
85	+ );
86	+
87	+ $options[ ] = array(
88	+ 'name' => __( 'Vendor Display Name', 'wcvendors' ),
89	+ 'desc' => __( 'Select what will be displayed for the sold by text throughout the store.', 'wcvendors' ),
90	+ 'id' => 'vendor_display_name',
91	+ 'type' => 'select',
92	+ 'options' => array(
93	+ 'display_name' => __( 'Display Name', 'wcvendors'),
94	+ 'shop_name' => __( 'Shop Name', 'wcvendors'),
95	+ 'user_login' => __( 'User Login', 'wcvendors'),
96	+ 'user_email' => __( 'User Email', 'wcvendors'),
97	+ ),
98	+ 'std' => 'shop_name'
99	+
100	+ );
101	+
102	+ $options[ ] = array(
103	+ 'name' => __( 'Sold By Label', 'wcvendors' ),
104	+ 'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
105	+ 'id' => 'sold_by_label',
106	+ 'type' => 'text',
107	+ 'std' => __( 'Sold By', 'wcvendors' ),
108	+ );
109	+
110	+ $options[ ] = array(
111	+ 'name' => __( 'Seller Info Label', 'wcvendors' ),
112	+ 'desc' => __( 'The seller info tab title on the single product page.', 'wcvendors' ),
113	+ 'id' => 'seller_info_label',
114	+ 'type' => 'text',
115	+ 'std' => __( 'Seller Info', 'wcvendors' ),
116	+ );
117	+
118	+ $options[ ] = array( 'name' => __( 'Products', 'wcvendors' ), 'type' => 'heading' );
119	+ $options[ ] = array( 'name' => __( 'Product Add Page', 'wcvendors' ), 'type' => 'title', 'desc' => __( 'Configure what to hide from all vendors when adding a product', 'wcvendors' ) );
120	+
121	+ $options[ ] = array(
122	+ 'name' => __( 'Left side panel', 'wcvendors' ),
123	+ 'desc' => __( 'CHECKING these boxes will HIDE these areas of the add product page for vendors', 'wcvendors' ),
124	+ 'id' => 'hide_product_panel',
125	+ 'options' => array(
126	+ 'inventory' => __( 'Inventory', 'wcvendors' ),
127	+ 'shipping' => __( 'Shipping', 'wcvendors' ),
128	+ 'linked_product' => __( 'Linked Products', 'wcvendors' ),
129	+ 'attribute' => __( 'Attributes', 'wcvendors' ),
130	+ 'advanced' => __( 'Advanced', 'wcvendors' ),
131	+ ),
132	+ 'type' => 'checkbox',
133	+ 'multiple' => true,
134	+ );
135	+
136	+ $options[ ] = array(
137	+ 'name' => __( 'Types', 'wcvendors' ),
138	+ 'desc' => __( 'CHECKING these boxes will HIDE these product types from the vendor', 'wcvendors' ),
139	+ 'id' => 'hide_product_types',
140	+ 'options' => array(
141	+ 'simple' => __( 'Simple', 'wcvendors' ),
142	+ 'variable' => __( 'Variable', 'wcvendors' ),
143	+ 'grouped' => __( 'Grouped', 'wcvendors' ),
144	+ 'external' => __( 'External / affiliate', 'wcvendors' ),
145	+ ),
146	+ 'type' => 'checkbox',
147	+ 'multiple' => true,
148	+ );
149	+
150	+ $options[ ] = array(
151	+ 'name' => __( 'Type options', 'wcvendors' ),
152	+ 'desc' => __( 'CHECKING these boxes will HIDE these product options from the vendor', 'wcvendors' ),
153	+ 'id' => 'hide_product_type_options',
154	+ 'options' => array(
155	+ 'virtual' => __( 'Virtual', 'wcvendors' ),
156	+ 'downloadable' => __( 'Downloadable', 'wcvendors' ),
157	+ ),
158	+ 'type' => 'checkbox',
159	+ 'multiple' => true,
160	+ );
161	+
162	+ $options[ ] = array(
163	+ 'name' => __( 'Miscellaneous', 'wcvendors' ),
164	+ 'id' => 'hide_product_misc',
165	+ 'options' => array(
166	+ 'taxes' => __( 'Taxes', 'wcvendors' ),
167	+ 'sku' => __( 'SKU', 'wcvendors' ),
168	+ 'featured' => __( 'Featured', 'wcvendors' ),
169	+ 'duplicate' => __( 'Duplicate Product', 'wcvendors' ),
170	+ ),
171	+ 'type' => 'checkbox',
172	+ 'multiple' => true,
173	+ );
174	+
175	+ $options[ ] = array(
176	+ 'name' => __( 'Stylesheet', 'wcvendors' ),
177	+ 'desc' => __( 'You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors.', 'wcvendors' ),
178	+ 'id' => 'product_page_css',
179	+ 'type' => 'textarea',
180	+ );
181	+
182	+
183	+ $options[ ] = array( 'name' => __( 'Capabilities', 'wcvendors' ), 'type' => 'heading', 'id' => 'capabilities' );
184	+ $options[ ] = array( 'name' => __( 'Permissions', 'wcvendors' ), 'id' => 'permissions', 'type' => 'title', 'desc' => __( 'General permissions used around the shop', 'wcvendors' ) );
185	+
186	+ $options[ ] = array(
187	+ 'name' => __( 'Orders', 'wcvendors' ),
188	+ 'desc' => __( 'View orders', 'wcvendors' ),
189	+ 'tip' => __( 'Show customer details such as email, address, name, etc, for each order', 'wcvendors' ),
190	+ 'id' => 'can_show_orders',
191	+ 'type' => 'checkbox',
192	+ 'std' => true,
193	+ );
194	+
195	+ $options[ ] = array(
196	+ 'desc' => __( 'View comments', 'wcvendors' ),
197	+ 'tip' => __( 'View all vendor comments for an order on the frontend', 'wcvendors' ),
198	+ 'id' => 'can_view_order_comments',
199	+ 'type' => 'checkbox',
200	+ 'std' => true,
201	+ );
202	+
203	+ $options[ ] = array(
204	+ 'desc' => __( 'Submit comments', 'wcvendors' ),
205	+ 'tip' => __( 'Submit comments for an order on the frontend. Eg, tracking ID for a product', 'wcvendors' ),
206	+ 'id' => 'can_submit_order_comments',
207	+ 'type' => 'checkbox',
208	+ 'std' => true,
209	+ );
210	+
211	+ $options[ ] = array(
212	+ 'desc' => __( 'View email addresses', 'wcvendors' ),
213	+ 'tip' => __( 'While viewing order details on the frontend, you can disable or enable email addresses', 'wcvendors' ),
214	+ 'id' => 'can_view_order_emails',
215	+ 'type' => 'checkbox',
216	+ 'std' => true,
217	+ );
218	+
219	+ $options[ ] = array(
220	+ 'desc' => __( 'Export a CSV file of orders for a product', 'wcvendors' ),
221	+ 'tip' => __( 'Vendors could export orders for a product on the frontend', 'wcvendors' ),
222	+ 'id' => 'can_export_csv',
223	+ 'type' => 'checkbox',
224	+ 'std' => true,
225	+ );
226	+
227	+ $options[ ] = array(
228	+ 'name' => __( 'Reports', 'wcvendors' ),
229	+ 'desc' => __( '<strike>View backend sales reports</strike>. <strong>Depreciated</strong>', 'wcvendors' ),
230	+ 'tip' => __( 'This option has been removed and will no longer function. It will be completely removed in future versions. Vendors should use their Vendor Dashboard for reports as all identical functionality is already there. ', 'wcvendors' ),
231	+ 'id' => 'can_view_backend_reports',
232	+ 'type' => 'checkbox',
233	+ 'std' => false,
234	+ );
235	+
236	+ $options[ ] = array(
237	+ 'desc' => __( 'View Frontend sales reports', 'wcvendors' ),
238	+ 'tip' => __( 'Sales table on the frontend on the Vendor Dashboard page. The table will only display sales data that pertain to their products, and only for orders that are processing or completed.', 'wcvendors' ),
239	+ 'id' => 'can_view_frontend_reports',
240	+ 'type' => 'checkbox',
241	+ 'std' => true,
242	+ );
243	+
244	+ $options[ ] = array(
245	+ 'name' => __( 'Products', 'wcvendors' ),
246	+ 'desc' => __( 'Submit products', 'wcvendors' ),
247	+ 'tip' => __( 'Check to allow vendors to list new products. Admin must approve new products by editing the product, and clicking Publish.', 'wcvendors' ),
248	+ 'id' => 'can_submit_products',
249	+ 'type' => 'checkbox',
250	+ 'std' => true,
251	+ );
252	+
253	+ $options[ ] = array(
254	+ 'desc' => __( 'Edit live products', 'wcvendors' ),
255	+ 'tip' => __( 'Vendors could edit an approved product after it has already gone live. There is no approval or review after editing a live product. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
256	+ 'id' => 'can_edit_published_products',
257	+ 'type' => 'checkbox',
258	+ 'std' => false,
259	+ );
260	+
261	+ $options[ ] = array(
262	+ 'desc' => __( 'Submit products live without requiring approval', 'wcvendors' ),
263	+ 'tip' => __( 'Vendors can submit products without review or approval from a shop admin. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
264	+ 'id' => 'can_submit_live_products',
265	+ 'type' => 'checkbox',
266	+ 'std' => false,
267	+ );
268	+
269	+ $options[ ] = array( 'name' => __( 'Pages', 'wcvendors' ), 'type' => 'heading' );
270	+ $options[ ] = array( 'name' => __( 'Page configuration', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
271	+
272	+ $options[ ] = array(
273	+ 'name' => __( 'Vendor dashboard', 'wcvendors' ),
274	+ 'desc' => __( 'Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will break your site. If you upgrade to Pro, keep this page unchanged as both Pro Dashboard and this Dashboard page must be set.', 'wcvendors' ),
275	+ 'id' => 'vendor_dashboard_page',
276	+ 'type' => 'single_select_page',
277	+ 'select2' => true,
278	+ );
279	+
280	+ $options[ ] = array(
281	+ 'name' => __( 'Shop settings', 'wcvendors' ),
282	+ 'desc' => __( 'Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor can configure. By default, Vendor Dashboard > Shop Settings should have this shortcode.', 'wcvendors' ),
283	+ 'id' => 'shop_settings_page',
284	+ 'type' => 'single_select_page',
285	+ 'select2' => true,
286	+ );
287	+
288	+ $options[ ] = array(
289	+ 'name' => __( 'Orders page', 'wcvendors' ),
290	+ 'desc' => __( 'Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By default, Vendor Dashboard > Orders should have the shortcode.', 'wcvendors' ),
291	+ 'id' => 'orders_page',
292	+ 'type' => 'single_select_page',
293	+ 'select2' => true,
294	+ );
295	+
296	+ $options[ ] = array(
297	+ 'name' => __( 'Vendor terms', 'wcvendors' ),
298	+ 'desc' => __( 'These terms are shown to a user when submitting an application to become a vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor must accept terms in order to register, if set.', 'wcvendors' ),
299	+ 'id' => 'terms_to_apply_page',
300	+ 'type' => 'single_select_page',
301	+ 'select2' => true,
302	+ );
303	+
304	+ $total_due = 0;
305	+ if ( !empty( $_GET[ 'tab' ] ) && $_GET[ 'tab' ] == __( 'payments', 'wcvendors' ) ) {
306	+ global $wpdb;
307	+
308	+ $table_name = $wpdb->prefix . "pv_commission";
309	+ $query = "SELECT sum(total_due + total_shipping + tax) as total
310	+ FROM `{$table_name}`
311	+ WHERE status = %s";
312	+ $results = $wpdb->get_results( $wpdb->prepare( $query, 'due' ) );
313	+
314	+ $total_due = array_shift( $results )->total;
315	+ }
316	+ $options[ ] = array( 'name' => __( 'Payments', 'wcvendors' ), 'type' => 'heading' );
317	+ $options[ ] = array(
318	+ 'name' => __( 'PayPal Adaptive Payments Scheduling', 'wcvendors' ), 'type' => 'title', 'desc' =>
319	+ sprintf( __( 'Total commission currently due: %s. <a href="%s">View details</a>.', 'wcvendors' ), !function_exists( 'woocommerce_price' ) ? $total_due : woocommerce_price( $total_due ), '?page=pv_admin_commissions' ) .
320	+ '<br/><br/>' . sprintf( __( 'Make sure you update your PayPal Adaptive Payments settings <a href="%s">here</a>. <br><br>To instantly pay with Adaptive Payments you must activate the paypalap gateway in your Checkout settings. <br><a href="https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/" target="top">PayPal AP Application Help</a>. <br><br>Another gateway that offers instant payments to vendors that also accepts credit cards directly on your checkout page is Stripe. <br><a href="https://www.wcvendors.com/product/stripe-commissions-gateway/" target="top">Stripe Commissions & Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="https://www.wcvendors.com/product/wc-vendors-pro/" target="top">WC Vendors Pro</a>.', 'wcvendors' ), 'admin.php?page=wc-settings&tab=checkout&section=wc_paypalap' )
321	+ );
322	+
323	+ $options[ ] = array(
324	+ 'name' => __( 'Instant pay', 'wcvendors' ),
325	+ 'desc' => __( 'Instantly pay vendors their commission when an order is made, and if a vendor has a valid PayPal email added on their Shop Settings page.', 'wcvendors' ),
326	+ 'tip' => __( 'For this to work, customers must checkout with the PayPal Adaptive Payments gateway. Using any other gateways will not pay vendors instantly', 'wcvendors' ),
327	+ 'id' => 'instapay',
328	+ 'type' => 'checkbox',
329	+ 'std' => true,
330	+ );
331	+
332	+ $options[ ] = array(
333	+ 'name' => __( 'Payment schedule', 'wcvendors' ),
334	+ 'desc' => __( 'Note: Schedule will only work if instant pay is unchecked', 'wcvendors' ),
335	+ 'id' => 'schedule',
336	+ 'type' => 'radio',
337	+ 'std' => 'manual',
338	+ 'options' => array(
339	+ 'weekly' => __( 'Weekly', 'wcvendors' ),
340	+ 'biweekly' => __( 'Biweekly', 'wcvendors' ),
341	+ 'monthly' => __( 'Monthly', 'wcvendors' ),
342	+ 'manual' => __( 'Manual', 'wcvendors' ),
343	+ 'now' => '<span style="color:green;"><strong>' . __( 'Now', 'wcvendors' ) . '</strong></span>',
344	+ )
345	+ );
346	+
347	+ $options[ ] = array(
348	+ 'name' => __( 'Email notification', 'wcvendors' ),
349	+ 'desc' => __( 'Send the WooCommerce admin an email each time a payment has been made via the payment schedule options above', 'wcvendors' ),
350	+ 'id' => 'mail_mass_pay_results',
351	+ 'type' => 'checkbox',
352	+ 'std' => true,
353	+ );

trunk/classes/admin/views/html-vendor-settings-page.php ADDED Viewed

	@@ -0,0 +1,76 @@


1	+ <div class="wrap">
2	+ <h2>Shop Settings</h2>
3	+ <table class="form-table">
4	+
5	+ <form method="post">
6	+ <?php do_action( 'wcvendors_settings_before_paypal' );
7	+
8	+ if ( $paypal_address !== 'false' ) { ?>
9	+
10	+ <tr>
11	+ <th><?php _e( 'PayPal Address', 'wcvendors' ); ?></th>
12	+ <td><input type="email" name="pv_paypal" id="pv_paypal" placeholder="some@email.com"
13	+ value="<?php echo get_user_meta( $user_id, 'pv_paypal', true ); ?>"/>
14	+ <p class="description">
15	+ <?php _e( 'Your PayPal address is used to send you your commission.', 'wcvendors' ); ?><br/>
16	+ </p>
17	+ </td>
18	+ </tr>
19	+ <?php } ?>
20	+ <?php do_action( 'wcvendors_settings_after_paypal' ); ?>
21	+ <tr>
22	+ <th><?php _e( 'Shop Name', 'wcvendors' ); ?></th>
23	+ <td><input type="text" name="pv_shop_name" id="pv_shop_name" placeholder="Your shop name" value="<?php echo get_user_meta( $user_id, 'pv_shop_name', true ); ?>"/>
24	+ <p class="description"><?php _e( 'Your shop name is public and must be unique.', 'wcvendors' ); ?></p>
25	+ </td>
26	+ </tr>
27	+ <?php do_action( 'wcvendors_settings_after_shop_name' ); ?>
28	+
29	+ <tr>
30	+ <th><?php echo apply_filters( 'wcvendors_seller_info_label', __( 'Seller info', 'wcvendors' ) ); ?></th>
31	+ <td><?php
32	+
33	+ if ( $global_html \|\| $has_html ) {
34	+ $old_post = $GLOBALS[ 'post' ];
35	+ $GLOBALS[ 'post' ] = 0;
36	+ wp_editor( $seller_info, 'pv_seller_info' );
37	+ $GLOBALS[ 'post' ] = $old_post;
38	+ } else {
39	+ ?><textarea class="large-text" rows="10" id="pv_seller_info_unhtml" style="width:95%"
40	+ name="pv_seller_info"><?php echo $seller_info; ?></textarea><?php
41	+ }
42	+ ?>
43	+ <p class="description"><?php _e( 'This is displayed on each of your products.', 'wcvendors' ); ?></p>
44	+ </td>
45	+ </tr>
46	+ <?php do_action( 'wcvendors_settings_after_seller_info' ); ?>
47	+ <?php if ( $shop_description !== 'false' ) { ?>
48	+ <tr>
49	+ <th><?php _e( 'Shop Description', 'wcvendors' ); ?></th>
50	+ <td><?php
51	+
52	+ if ( $global_html \|\| $has_html ) {
53	+ $old_post = $GLOBALS[ 'post' ];
54	+ $GLOBALS[ 'post' ] = 0;
55	+ wp_editor( $description, 'pv_shop_description' );
56	+ $GLOBALS[ 'post' ] = $old_post;
57	+ } else {
58	+ ?><textarea class="large-text" rows="10" id="pv_shop_description_unhtml" style="width:95%" name="pv_shop_description"><?php echo $description; ?></textarea><?php
59	+ }
60	+ ?>
61	+ <p class="description"><?php printf( __( 'This is displayed on your <a href="%s">shop page</a>.', 'wcvendors' ), $shop_page ); ?></p>
62	+ </td>
63	+ </tr>
64	+
65	+ <?php do_action( 'wcvendors_settings_after_shop_description' ); ?>
66	+ <?php } ?>
67	+ <?php wp_nonce_field( 'save-shop-settings-admin', 'wc-vendors-nonce' ); ?>
68	+ <tr>
69	+ <td colspa="2">
70	+ <input type="submit" class="button button-primary" name="vendor_application_submit" value="<?php _e( 'Save Shop Settings', 'wcvendors' ); ?>"/>
71	+ </td>
72	+ </tr>
73	+ </form>
74	+ </table>
75	+ </div>
76	+

trunk/classes/class-commission.php ADDED Viewed

	@@ -0,0 +1,431 @@


1	+ <?php
2	+
3	+ /**
4	+ * Commission functions
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Commission
12	+ {
13	+
14	+
15	+ /**
16	+ * Constructor
17	+ */
18	+ function __construct()
19	+ {
20	+ $this->completed_statuses = apply_filters( 'wcvendors_completed_statuses', array(
21	+ 'completed',
22	+ 'processing',
23	+ ) );
24	+
25	+ $this->reverse_statuses = apply_filters( 'wcvendors_reversed_statuses', array(
26	+ 'pending',
27	+ 'refunded',
28	+ 'cancelled',
29	+ 'failed',
30	+ ) );
31	+
32	+ $this->check_order_reverse();
33	+ $this->check_order_complete();
34	+ }
35	+
36	+
37	+ /**
38	+ * Run actions when an order is reversed
39	+ */
40	+ public function check_order_reverse()
41	+ {
42	+ foreach ( $this->completed_statuses as $completed ) {
43	+ foreach ( $this->reverse_statuses as $reversed ) {
44	+ add_action( "woocommerce_order_status_{$completed}_to_{$reversed}", array( 'WCV_Commission', 'reverse_due_commission' ) );
45	+ }
46	+ }
47	+ }
48	+
49	+
50	+ /**
51	+ * Runs only on a manual order update by a human
52	+ */
53	+ public function check_order_complete()
54	+ {
55	+ foreach ( $this->completed_statuses as $completed ) {
56	+ add_action( 'woocommerce_order_status_' . $completed, array( 'WCV_Commission', 'log_commission_due' ) );
57	+ }
58	+ }
59	+
60	+
61	+ /**
62	+ * Reverse commission for an entire order
63	+ *
64	+ * Only runs if the order has been logged in pv_commission table
65	+ *
66	+ * @param int $order_id
67	+ *
68	+ * @return unknown
69	+ */
70	+ public function reverse_due_commission( $order_id )
71	+ {
72	+ global $wpdb;
73	+
74	+ // Check if this order exists
75	+ $count = WCV_Commission::count_commission_by_order( $order_id );
76	+ if ( !$count ) return false;
77	+
78	+ // Deduct this amount from the vendor's total due
79	+ $results = WCV_Commission::sum_total_due_for_order( $order_id );
80	+ $ids = implode( ',', $results[ 'ids' ] );
81	+ $table_name = $wpdb->prefix . "pv_commission";
82	+
83	+ $query = "UPDATE `{$table_name}` SET `status` = '%s' WHERE id IN ({$ids})";
84	+ $results = $wpdb->query( $wpdb->prepare( $query, 'reversed' ) );
85	+
86	+ return $results;
87	+ }
88	+
89	+
90	+ /**
91	+ * Store all commission due for an order
92	+ *
93	+ * @return bool
94	+ *
95	+ * @param int $order_id
96	+ */
97	+ public static function log_commission_due( $order_id )
98	+ {
99	+ global $woocommerce;
100	+
101	+ $order = new WC_Order( $order_id );
102	+ $dues = WCV_Vendors::get_vendor_dues_from_order( $order, false );
103	+
104	+ foreach ( $dues as $vendor_id => $details ) {
105	+
106	+ // Only process vendor commission
107	+ if ( !WCV_Vendors::is_vendor( $vendor_id ) ) continue;
108	+
109	+ // See if they currently have an amount due
110	+ $due = WCV_Vendors::count_due_by_vendor( $vendor_id, $order_id );
111	+ if ( $due > 0 ) continue;
112	+
113	+ // Get the dues in an easy format for inserting to our table
114	+ $insert_due = array();
115	+
116	+ foreach ( $details as $key => $detail ) {
117	+ $product_id = $detail['product_id'];
118	+
119	+ $insert_due[ $product_id ] = array(
120	+ 'order_id' => $order_id,
121	+ 'vendor_id' => $vendor_id,
122	+ 'product_id' => $product_id,
123	+ 'total_due' => !empty( $insert_due[ $product_id ][ 'total_due' ] ) ? ( $detail[ 'commission' ] + $insert_due[ $product_id ][ 'total_due' ] ) : $detail[ 'commission' ],
124	+ 'total_shipping' => !empty( $insert_due[ $product_id ][ 'total_shipping' ] ) ? ( $detail[ 'shipping' ] + $insert_due[ $product_id ][ 'total_shipping' ] ) : $detail[ 'shipping' ],
125	+ 'tax' => !empty( $insert_due[ $product_id ][ 'tax' ] ) ? ( $detail[ 'tax' ] + $insert_due[ $product_id ][ 'tax' ] ) : $detail[ 'tax' ],
126	+ 'qty' => !empty( $insert_due[ $product_id ][ 'qty' ] ) ? ( $detail[ 'qty' ] + $insert_due[ $product_id ][ 'qty' ] ) : $detail[ 'qty' ],
127	+ 'time' => $order->order_date,
128	+ );
129	+ }
130	+
131	+ if ( !empty( $insert_due ) ) {
132	+ WCV_Commission::insert_new_commission( array_values( $insert_due ) );
133	+ }
134	+ }
135	+
136	+ }
137	+
138	+
139	+ /**
140	+ * Add up the totals for an order for each vendor
141	+ *
142	+ * @param int $order_id
143	+ *
144	+ * @return array
145	+ */
146	+ public function sum_total_due_for_order( $order_id )
147	+ {
148	+ global $wpdb;
149	+
150	+ $table_name = $wpdb->prefix . "pv_commission";
151	+ $query = "SELECT `id`, `total_due`, `total_shipping`, `tax`, `vendor_id`
152	+ FROM `{$table_name}`
153	+ WHERE `order_id` = %d
154	+ AND `status` = %s";
155	+
156	+ $results = $wpdb->get_results( $wpdb->prepare( $query, $order_id, 'due' ) );
157	+
158	+ foreach ( $results as $commission ) {
159	+ $commission_ids[ ] = $commission->id;
160	+
161	+ $pay[ $commission->vendor_id ] = !empty( $pay[ $commission->vendor_id ] )
162	+ ? ( $pay[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) )
163	+ : ( $commission->total_due + $commission->total_shipping + $commission->tax );
164	+ }
165	+
166	+ $return = array(
167	+ 'vendors' => $pay,
168	+ 'ids' => $commission_ids,
169	+ );
170	+
171	+ return $return;
172	+ }
173	+
174	+
175	+ /**
176	+ * Return all commission outstanding with a 'due' status
177	+ *
178	+ * @return object
179	+ */
180	+ public static function get_all_due()
181	+ {
182	+ global $wpdb;
183	+
184	+ $table_name = $wpdb->prefix . "pv_commission";
185	+ $query = "SELECT id, vendor_id, total_due
186	+ FROM `{$table_name}`
187	+ WHERE status = %s";
188	+ $results = $wpdb->get_results( $wpdb->prepare( $query, 'due' ) );
189	+
190	+ return $results;
191	+ }
192	+
193	+
194	+ /**
195	+ * Check if this order has commission logged already
196	+ *
197	+ * @param int $order_id
198	+ *
199	+ * @return int
200	+ */
201	+ public static function count_commission_by_order( $order_id )
202	+ {
203	+ global $wpdb;
204	+ $table_name = $wpdb->prefix . "pv_commission";
205	+
206	+ if ( is_array( $order_id ) )
207	+ $order_id = implode( ',', $order_id );
208	+
209	+ $query = "SELECT COUNT(order_id) AS order_count
210	+ FROM {$table_name}
211	+ WHERE order_id IN ($order_id)
212	+ AND status <> %s";
213	+ $count = $wpdb->get_var( $wpdb->prepare( $query, 'reversed' ) );
214	+
215	+ return $count;
216	+ }
217	+
218	+ /**
219	+ * Check the commission status for the order
220	+ *
221	+ * @param array $order
222	+ * @param string $status
223	+ *
224	+ * @return int
225	+ */
226	+ public static function check_commission_status( $order, $status ) {
227	+
228	+ global $wpdb;
229	+
230	+ $table_name = $wpdb->prefix . "pv_commission";
231	+
232	+ $order_id = $order[ 'order_id' ];
233	+ $vendor_id = $order[ 'vendor_id' ];
234	+ $product_id = $order[ 'product_id' ];
235	+
236	+ $query = "SELECT count(order_id) AS order_count
237	+ FROM {$table_name}
238	+ WHERE order_id = {$order_id}
239	+ AND vendor_id = {$vendor_id}
240	+ AND product_id = {$product_id}
241	+ AND status = %s
242	+ ";
243	+
244	+ return $wpdb->get_var( $wpdb->prepare( $query , $status ) );
245	+
246	+ }
247	+
248	+
249	+ /**
250	+ * Product's commission rate in percentage form
251	+ *
252	+ * Eg: 50 for 50%
253	+ *
254	+ * @param int $product_id
255	+ *
256	+ * @return float
257	+ */
258	+ public static function get_commission_rate( $product_id )
259	+ {
260	+
261	+ $commission = 0;
262	+
263	+ $parent = get_post_ancestors( $product_id );
264	+ if ( $parent ) $product_id = $parent[ 0 ];
265	+
266	+ $vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
267	+
268	+ $product_commission = get_post_meta( $product_id, 'pv_commission_rate', true );
269	+ $vendor_commission = WCV_Vendors::get_default_commission( $vendor_id );
270	+ $default_commission = WC_Vendors::$pv_options->get_option( 'default_commission' );
271	+
272	+ if ( $product_commission != '' && $product_commission !== false ) {
273	+ $commission = $product_commission;
274	+ }
275	+
276	+ else if ( $vendor_commission != '' && $vendor_commission !== false ) {
277	+ $commission = $vendor_commission;
278	+ }
279	+
280	+ else if ( $default_commission != '' && $default_commission !== false ) {
281	+ $commission = $default_commission;
282	+ }
283	+
284	+ return apply_filters( 'wcv_commission_rate_percent', $commission, $product_id );
285	+ }
286	+
287	+
288	+ /**
289	+ * Commission due for a product based on a rate and price
290	+ *
291	+ * @param float $product_price
292	+ * @param unknown $product_id
293	+ *
294	+ * @return float
295	+ */
296	+ public static function calculate_commission( $product_price, $product_id, $order, $qty )
297	+ {
298	+ $commission_rate = WCV_Commission::get_commission_rate( $product_id );
299	+ $commission = $product_price * ( $commission_rate / 100 );
300	+ $commission = round( $commission, 2 );
301	+
302	+ return apply_filters( 'wcv_commission_rate', $commission, $product_id, $product_price, $order, $qty );
303	+ }
304	+
305	+
306	+ /**
307	+ * Log commission to the pv_commission table
308	+ *
309	+ * Will either update or insert to the database
310	+ *
311	+ * @param array $orders
312	+ *
313	+ * @return unknown
314	+ */
315	+ public static function insert_new_commission( $orders = array() )
316	+ {
317	+ global $wpdb;
318	+
319	+ if ( empty( $orders ) ) return false;
320	+
321	+ $table = $wpdb->prefix . "pv_commission";
322	+
323	+ // Insert the time and default status 'due'
324	+ foreach ( $orders as $key => $order ) {
325	+ $orders[ $key ][ 'time' ] = $order['time'];
326	+ $orders[ $key ][ 'status' ] = ( $order['total_due'] == 0 ) ? 'paid' : 'due';
327	+ }
328	+
329	+ foreach ( $orders as $key => $order ) {
330	+ $where = array(
331	+ 'order_id' => $order[ 'order_id' ],
332	+ 'product_id' => $order[ 'product_id' ],
333	+ 'vendor_id' => $order[ 'vendor_id' ],
334	+ 'qty' => $order[ 'qty' ],
335	+ );
336	+ // Is the commission already paid?
337	+ $count = WCV_Commission::check_commission_status( $order, 'paid' );
338	+
339	+ if ( $count == 0 ) {
340	+ $update = $wpdb->update( $table, $order, $where );
341	+ if ( !$update ) $insert = $wpdb->insert( $table, $order );
342	+ }
343	+
344	+ }
345	+
346	+ do_action( 'wcv_commissions_inserted', $orders );
347	+ }
348	+
349	+
350	+ /**
351	+ * Set commission to 'paid' for an entire order
352	+ *
353	+ *
354	+ * @access public
355	+ *
356	+ * @param mixed $order_id An array of Order IDs or an int.
357	+ * @param unknown $column_ids (optional)
358	+ *
359	+ * @return bool.
360	+ */
361	+ public static function set_order_commission_paid( $order_id, $column_ids = false )
362	+ {
363	+ global $wpdb;
364	+
365	+ $table_name = $wpdb->prefix . "pv_commission";
366	+
367	+ if ( is_array( $order_id ) )
368	+ $order_id = implode( ',', $order_id );
369	+
370	+ $query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE order_id IN ($order_id)";
371	+ $result = $wpdb->query( $query );
372	+
373	+ return $result;
374	+ }
375	+
376	+
377	+ /**
378	+ * Set commission to 'paid' for an entire order
379	+ *
380	+ *
381	+ * @access public
382	+ *
383	+ * @param mixed $order_id An array of Order IDs or an int.
384	+ *
385	+ * @return bool.
386	+ */
387	+ public static function set_vendor_commission_paid( $vendors )
388	+ {
389	+ global $wpdb;
390	+
391	+ $table_name = $wpdb->prefix . "pv_commission";
392	+
393	+ if ( is_array( $vendors ) )
394	+ $vendors = implode( ',', $vendors );
395	+
396	+ $query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id IN ($vendors)";
397	+ $result = $wpdb->query( $query );
398	+
399	+ return $result;
400	+ }
401	+
402	+
403	+ /**
404	+ * Set commission to 'paid' for a specifc vendor
405	+ *
406	+ *
407	+ * @access public
408	+ *
409	+ * @param int $vendor_id the vendor id
410	+ * @param int $product_id the product id
411	+ * @param int $order_id the order id
412	+ *
413	+ * @return bool.
414	+ */
415	+ public static function set_vendor_product_commission_paid( $vendor_id, $product_id, $order_id )
416	+ {
417	+ global $wpdb;
418	+
419	+ $table_name = $wpdb->prefix . "pv_commission";
420	+
421	+ if ( is_array( $vendors ) )
422	+ $vendors = implode( ',', $vendors );
423	+
424	+ $query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id = $vendor_id AND order_id = $order_id AND product_id = $product_id";
425	+ $result = $wpdb->query( $query );
426	+
427	+ return $result;
428	+ }
429	+
430	+
431	+ }

trunk/classes/class-cron.php ADDED Viewed

	@@ -0,0 +1,165 @@


1	+ <?php
2	+ /**
3	+ * Cron class
4	+ *
5	+ * @package WC_Vendors
6	+ */
7	+
8	+
9	+ class WCV_Cron
10	+ {
11	+
12	+
13	+ /**
14	+ * Constructor
15	+ */
16	+ function __construct()
17	+ {
18	+ add_filter( 'cron_schedules', array( 'WCV_Cron', 'custom_cron_intervals' ) );
19	+ add_action( WC_Vendors::$id . '_options_updated', array( 'WCV_Cron', 'check_schedule' ) );
20	+ add_filter( WC_Vendors::$id . '_options_on_update', array( 'WCV_Cron', 'check_schedule_now' ) );
21	+ }
22	+
23	+
24	+ /**
25	+ * Re-add cron schedule when the settings have been updated
26	+ *
27	+ * @param array
28	+ * @param unknown $options
29	+ */
30	+ public static function check_schedule( $options )
31	+ {
32	+ $old_interval = wp_get_schedule( 'pv_schedule_mass_payments' );
33	+ $new_interval = $options[ 'schedule' ];
34	+ $instapay = $options[ 'instapay' ];
35	+
36	+ /**
37	+ * 1. The user actually changed the schedule
38	+ * 2. Instapay is turned off
39	+ * 3. Manual was not selected
40	+ */
41	+ if ( ( $old_interval != $new_interval ) && !$instapay && $new_interval != 'manual' ) {
42	+ WCV_Cron::remove_cron_schedule( $options );
43	+ WCV_Cron::schedule_cron( $new_interval );
44	+ }
45	+
46	+ if ( $new_interval == 'manual' \|\| $instapay ) {
47	+ WCV_Cron::remove_cron_schedule( $options );
48	+ }
49	+
50	+ }
51	+
52	+
53	+ /**
54	+ * Check if the user chose "Now" on the Schedule settings
55	+ *
56	+ * @param array $options
57	+ *
58	+ * @return array
59	+ */
60	+ public static function check_schedule_now( $options )
61	+ {
62	+ $old_schedule = WC_Vendors::$pv_options->get_option( 'schedule' );
63	+ $new_schedule = $options[ 'schedule' ];
64	+
65	+ if ( $new_schedule == 'now' ) {
66	+ $return = WCV_Cron::pay_now();
67	+ $options[ 'schedule' ] = $old_schedule;
68	+ WCV_Cron::schedule_cron( $old_schedule );
69	+ add_settings_error( WC_Vendors::$pv_options->id, 'save_options', $return[ 'message' ], $return[ 'status' ] );
70	+ }
71	+
72	+ return $options;
73	+ }
74	+
75	+
76	+ /**
77	+ * Pay all outstanding commission using Paypal Mass Pay
78	+ *
79	+ * @return array
80	+ */
81	+ public static function pay_now()
82	+ {
83	+ $mass_pay = new WCV_Mass_Pay;
84	+ $mass_pay = $mass_pay->do_payments();
85	+
86	+ $message = !empty( $mass_pay[ 'total' ] )
87	+ ? $mass_pay[ 'msg' ] . '<br/>' . sprintf( __( 'Payment total: %s', 'wcvendors' ), woocommerce_price( $mass_pay[ 'total' ] ) )
88	+ : $mass_pay[ 'msg' ];
89	+
90	+ return array(
91	+ 'message' => $message,
92	+ 'status' => $mass_pay[ 'status' ]
93	+ );
94	+ }
95	+
96	+
97	+ /**
98	+ * Remove the mass payments schedule
99	+ *
100	+ * @return bool
101	+ */
102	+ private static function remove_cron_schedule()
103	+ {
104	+ $timestamp = wp_next_scheduled( 'pv_schedule_mass_payments' );
105	+
106	+ return wp_unschedule_event( $timestamp, 'pv_schedule_mass_payments' );
107	+ }
108	+
109	+
110	+ /**
111	+ * Schedule a cron event on a specified interval
112	+ *
113	+ * @param string $interval
114	+ *
115	+ * @return bool
116	+ */
117	+ public static function schedule_cron( $interval )
118	+ {
119	+ // Scheduled event
120	+ add_action( 'pv_schedule_mass_payments', array( 'WCV_Cron', 'pay_now' ) );
121	+
122	+ // Schedule the event
123	+ if ( !wp_next_scheduled( 'pv_schedule_mass_payments' ) ) {
124	+ wp_schedule_event( time(), $interval, 'pv_schedule_mass_payments' );
125	+
126	+ return true;
127	+ }
128	+
129	+ return false;
130	+ }
131	+
132	+
133	+ /**
134	+ * Add new schedule intervals to WP
135	+ *
136	+ * Weekly
137	+ * Biweekly
138	+ * Monthly
139	+ *
140	+ * @param array $schedules
141	+ *
142	+ * @return array
143	+ */
144	+ public static function custom_cron_intervals( $schedules )
145	+ {
146	+ $schedules[ 'weekly' ] = array(
147	+ 'interval' => 604800,
148	+ 'display' => __( 'Once Weekly' )
149	+ );
150	+
151	+ $schedules[ 'biweekly' ] = array(
152	+ 'interval' => 1209600,
153	+ 'display' => __( 'Once every two weeks' )
154	+ );
155	+
156	+ $schedules[ 'monthly' ] = array(
157	+ 'interval' => 2635200,
158	+ 'display' => __( 'Once a month' )
159	+ );
160	+
161	+ return $schedules;
162	+ }
163	+
164	+
165	+ }

trunk/classes/class-install.php ADDED Viewed

	@@ -0,0 +1,246 @@


1	+ <?php
2	+ /**
3	+ * Install class on activation.
4	+ *
5	+ * @author Matt Gates <http://mgates.me>
6	+ * @package ProductVendor
7	+ */
8	+
9	+
10	+ class WCV_Install
11	+ {
12	+
13	+ /**
14	+ * Checks if install is requierd
15	+ *
16	+ * @return unknown
17	+ */
18	+ public function init()
19	+ {
20	+ $db_version = WC_Vendors::$pv_options->get_option( 'db_version' );
21	+
22	+ // Initial Install
23	+ if ( version_compare( $db_version, '1.0', '<' ) ) {
24	+ $this->install_wcvendor();
25	+ WC_Vendors::$pv_options->update_option( 'db_version', '1.5.0' );
26	+ }
27	+
28	+ }
29	+
30	+
31	+ /**
32	+ * Grouped functions for installing the WC Vendor plugin
33	+ */
34	+ private function install_wcvendor()
35	+ {
36	+ // Clear the cron
37	+ wp_clear_scheduled_hook( 'pv_schedule_mass_payments' );
38	+
39	+ // Add the vendors role
40	+ $this->add_new_roles();
41	+
42	+ // Create tables
43	+ $this->create_new_tables();
44	+
45	+ // Create the Orders page if it doesn't exist
46	+ $orders_page = WC_Vendors::$pv_options->get_option( 'orders_page' );
47	+ if ( empty( $orders_page ) ) $this->create_new_pages();
48	+ }
49	+
50	+
51	+ /**
52	+ * Add the new Vendor role
53	+ *
54	+ * @return bool
55	+ */
56	+ private function add_new_roles()
57	+ {
58	+ remove_role( 'pending_vendor' );
59	+ add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
60	+ 'read' => true,
61	+ 'edit_posts' => false,
62	+ 'delete_posts' => false
63	+ ) );
64	+
65	+ remove_role( 'vendor' );
66	+ add_role( 'vendor', __('Vendor', 'wcvendors') , array(
67	+ 'assign_product_terms' => true,
68	+ 'edit_products' => true,
69	+ 'edit_product' => true,
70	+ 'edit_published_products' => false,
71	+ 'manage_product' => true,
72	+ 'publish_products' => false,
73	+ 'read' => true,
74	+ 'upload_files' => true,
75	+ 'view_woocommerce_reports' => true,
76	+ ) );
77	+ }
78	+
79	+
80	+ /**
81	+ * Create the pv_commission table
82	+ */
83	+ private function create_new_tables()
84	+ {
85	+ global $wpdb;
86	+
87	+ $table_name = $wpdb->prefix . "pv_commission";
88	+ require_once ABSPATH . 'wp-admin/includes/upgrade.php';
89	+
90	+ $sql = "CREATE TABLE $table_name (
91	+ id bigint(20) NOT NULL AUTO_INCREMENT,
92	+ product_id bigint(20) NOT NULL,
93	+ order_id bigint(20) NOT NULL,
94	+ vendor_id bigint(20) NOT NULL,
95	+ total_due decimal(20,2) NOT NULL,
96	+ qty BIGINT( 20 ) NOT NULL,
97	+ total_shipping decimal(20,2) NOT NULL,
98	+ tax decimal(20,2) NOT NULL,
99	+ status varchar(20) NOT NULL DEFAULT 'due',
100	+ time datetime DEFAULT '0000-00-00 00:00:00' NOT NULL,
101	+ UNIQUE KEY id (id)
102	+ );";
103	+ dbDelta( $sql );
104	+ }
105	+
106	+
107	+ /**
108	+ * Create a page
109	+ *
110	+ * @access public
111	+ * @return void
112	+ *
113	+ * @param mixed $slug Slug for the new page
114	+ * @param mixed $option Option name to store the page's ID
115	+ * @param string $page_title (optional) (default: '') Title for the new page
116	+ * @param string $page_content (optional) (default: '') Content for the new page
117	+ * @param int $post_parent (optional) (default: 0) Parent for the new page
118	+ */
119	+ function create_page( $slug, $page_title = '', $page_content = '', $post_parent = 0 )
120	+ {
121	+ global $wpdb;
122	+
123	+ $page_id = WC_Vendors::$pv_options->get_option( $slug . '_page' );
124	+
125	+ if ( $page_id > 0 && get_post( $page_id ) ) {
126	+ return $page_id;
127	+ }
128	+
129	+ $page_found = $wpdb->get_var( $wpdb->prepare( "SELECT ID FROM " . $wpdb->posts . " WHERE post_name = %s LIMIT 1;", $slug ) );
130	+ if ( $page_found ) {
131	+ if ( !$page_id ) {
132	+ WC_Vendors::$pv_options->update_option( $slug . '_page', $page_found );
133	+
134	+ return $page_found;
135	+ }
136	+
137	+ return $page_id;
138	+ }
139	+
140	+ $page_data = array(
141	+ 'post_status' => 'publish',
142	+ 'post_type' => 'page',
143	+ 'post_author' => 1,
144	+ 'post_name' => $slug,
145	+ 'post_title' => $page_title,
146	+ 'post_content' => $page_content,
147	+ 'post_parent' => $post_parent,
148	+ 'comment_status' => 'closed'
149	+ );
150	+
151	+ $page_id = wp_insert_post( $page_data );
152	+ WC_Vendors::$pv_options->update_option( $slug . '_page', $page_id );
153	+
154	+ return $page_id;
155	+ }
156	+
157	+
158	+ /**
159	+ * Create the Orders page for the frontend
160	+ */
161	+ private function create_new_pages()
162	+ {
163	+ global $wpdb;
164	+
165	+ $vendor_page_id = $this->create_page( 'vendor_dashboard', __( 'Vendor Dashboard', 'wcvendors' ), '[wcv_vendor_dashboard]' );
166	+ $this->create_page( 'orders', __( 'Orders', 'wcvendors' ), '[wcv_orders]', $vendor_page_id );
167	+ $this->create_page( 'shop_settings', __( 'Shop Settings', 'wcvendors' ), '[wcv_shop_settings]', $vendor_page_id );
168	+ }
169	+
170	+
171	+ /**
172	+ * Depreciated
173	+ *
174	+ * @param unknown $version
175	+ */
176	+ public function update_to( $version )
177	+ {
178	+ global $wpdb;
179	+
180	+ $table_name = $wpdb->prefix . "pv_commission";
181	+
182	+ switch ( $version ) {
183	+
184	+ case '1.3.2':
185	+
186	+ $sql = "ALTER TABLE `{$table_name}` ADD `qty` BIGINT( 20 ) NOT NULL AFTER `total_due`";
187	+ $wpdb->query( $sql );
188	+
189	+ $sql = "SELECT * FROM `{$table_name}`";
190	+ $results = $wpdb->get_results( $sql );
191	+ foreach ( $results as $key => $value ) {
192	+
193	+ $order = new WC_Order( $value->order_id );
194	+
195	+ foreach ( $order->get_items() as $o_key => $o_value ) {
196	+
197	+ if ( $value->product_id == $o_value[ 'product_id' ] \|\| ( !empty( $o_value[ 'variation_id' ] ) && $value->product_id == $o_value[ 'variation_id' ] ) ) {
198	+ $wpdb->update(
199	+ $table_name,
200	+ array( 'qty' => $o_value[ 'qty' ] ),
201	+ array( 'id' => $value->id ),
202	+ array( '%d' ),
203	+ array( '%d' )
204	+ );
205	+ }
206	+ }
207	+
208	+ }
209	+
210	+ break;
211	+
212	+ case '1.4.0':
213	+
214	+ add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
215	+ 'read' => true,
216	+ 'edit_posts' => false,
217	+ 'delete_posts' => false
218	+ ) );
219	+
220	+ $this->create_new_pages();
221	+
222	+ break;
223	+
224	+ case '1.4.2':
225	+
226	+ $sql = "ALTER TABLE `{$table_name}` ADD `total_shipping` decimal(20,2) NOT NULL AFTER `total_due`";
227	+ $wpdb->query( $sql );
228	+
229	+ case '1.4.3':
230	+
231	+ $sql = "ALTER TABLE `{$table_name}` ADD `tax` decimal(20,2) NOT NULL AFTER `total_shipping`";
232	+ $wpdb->query( $sql );
233	+
234	+ case '1.4.5':
235	+
236	+ // Flush rules to fix the /page/2/ issue on vendor shop pages
237	+ update_option( WC_Vendors::$id . '_flush_rules', true );
238	+
239	+ default:
240	+ // code...
241	+ break;
242	+ }
243	+ }
244	+
245	+
246	+ }

trunk/classes/class-queries.php ADDED Viewed

	@@ -0,0 +1,280 @@


1	+ <?php
2	+
3	+ class WCV_Queries
4	+ {
5	+
6	+ /**
7	+ *
8	+ *
9	+ * @param unknown $user_id
10	+ *
11	+ * @return unknown
12	+ */
13	+
14	+
15	+ public static function get_commission_products( $user_id )
16	+ {
17	+ global $wpdb;
18	+
19	+ $dates = WCV_Queries::orders_within_range();
20	+ $vendor_products = array();
21	+ $sql = '';
22	+
23	+ $sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} ";
24	+
25	+ if ( !empty( $dates ) ) {
26	+ $sql .= "AND time >= '" . $dates[ 'after' ] . "' AND time <= '" . $dates[ 'before' ] . "'";
27	+ }
28	+
29	+ $sql .= " AND status != 'reversed' GROUP BY product_id";
30	+
31	+ $results = $wpdb->get_results( $sql );
32	+
33	+ foreach ( $results as $value ) {
34	+ $ids[ ] = $value->product_id;
35	+ }
36	+
37	+ if ( !empty( $ids ) ) {
38	+ $vendor_products = get_posts( array(
39	+ 'numberposts' => -1,
40	+ 'orderby' => 'post_date',
41	+ 'post_type' => array( 'product', 'product_variation' ),
42	+ 'order' => 'DESC',
43	+ 'include' => $ids
44	+ )
45	+ );
46	+ }
47	+
48	+ return $vendor_products;
49	+ }
50	+
51	+ /**
52	+ *
53	+ *
54	+ * @param unknown $order_id
55	+ *
56	+ * @return unknown
57	+ */
58	+
59	+
60	+ public static function get_products_for_order( $order_id )
61	+ {
62	+ global $wpdb;
63	+
64	+ $vendor_products = array();
65	+
66	+ $results = $wpdb->get_results( "
67	+ SELECT product_id
68	+ FROM {$wpdb->prefix}pv_commission
69	+ WHERE order_id = {$order_id}
70	+ AND status != 'reversed'
71	+ AND vendor_id = " . get_current_user_id() . "
72	+ GROUP BY product_id" );
73	+
74	+ foreach ( $results as $value ) {
75	+ $ids[ ] = $value->product_id;
76	+ }
77	+
78	+ return $ids;
79	+ }
80	+
81	+
82	+ /**
83	+ * All orders for a specific product
84	+ *
85	+ * @param array $product_ids
86	+ * @param array $args (optional)
87	+ *
88	+ * @return object
89	+ */
90	+ public static function get_orders_for_products( array $product_ids, array $args = array() )
91	+ {
92	+ global $wpdb;
93	+
94	+ if ( empty( $product_ids ) ) return false;
95	+
96	+ $dates = WCV_Queries::orders_within_range();
97	+
98	+ $defaults = array(
99	+ 'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
100	+ 'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
101	+ );
102	+
103	+ $args = wp_parse_args( $args, $defaults );
104	+
105	+
106	+ $sql = "
107	+ SELECT order_id
108	+ FROM {$wpdb->prefix}pv_commission as order_items
109	+ WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
110	+ AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
111	+ AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
112	+ AND status != 'reversed'
113	+ ";
114	+
115	+ if ( !empty( $args[ 'vendor_id' ] ) ) {
116	+ $sql .= "
117	+ AND vendor_id = {$args['vendor_id']}
118	+ ";
119	+ }
120	+
121	+ $sql .= "
122	+ GROUP BY order_id
123	+ ORDER BY time DESC
124	+ ";
125	+
126	+ $orders = $wpdb->get_results( $sql );
127	+
128	+ return $orders;
129	+ }
130	+
131	+
132	+ /**
133	+ * Sum of orders for a specific product
134	+ *
135	+ * @param array $product_ids
136	+ * @param array $args (optional)
137	+ *
138	+ * @return object
139	+ */
140	+ public static function sum_orders_for_products( array $product_ids, array $args = array() )
141	+ {
142	+ global $wpdb;
143	+
144	+ $dates = WCV_Queries::orders_within_range();
145	+
146	+ $defaults = array(
147	+ 'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
148	+ 'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
149	+ );
150	+
151	+ foreach ( $product_ids as $id ) {
152	+ $posts = get_posts( array(
153	+ 'numberposts' => -1,
154	+ 'post_type' => 'product_variation',
155	+ 'post_parent' => $id,
156	+ )
157	+ );
158	+
159	+ if ( !empty( $posts ) ) {
160	+ foreach ( $posts as $post ) {
161	+ $product_ids[ ] = $post->ID;
162	+ }
163	+ }
164	+ }
165	+
166	+ $args = wp_parse_args( $args, $defaults );
167	+
168	+ $sql = "
169	+ SELECT COUNT(order_id) as total_orders,
170	+ SUM(total_due + total_shipping + tax) as line_total,
171	+ SUM(qty) as qty,
172	+ product_id
173	+
174	+ FROM {$wpdb->prefix}pv_commission
175	+
176	+ WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
177	+ AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
178	+ AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
179	+ AND status != 'reversed'
180	+ ";
181	+
182	+ if ( !empty( $args[ 'vendor_id' ] ) ) {
183	+ $sql .= "
184	+ AND vendor_id = {$args['vendor_id']}
185	+ ";
186	+ }
187	+
188	+ $sql .= "
189	+ GROUP BY product_id
190	+ ORDER BY time DESC;
191	+ ";
192	+
193	+ $orders = $wpdb->get_results( $sql );
194	+
195	+ return $orders;
196	+ }
197	+
198	+
199	+ /**
200	+ * Sum of orders for a specific order
201	+ *
202	+ * @param array $order_ids
203	+ * @param array $args (optional)
204	+ *
205	+ * @return object
206	+ */
207	+ public static function sum_for_orders( array $order_ids, array $args = array() )
208	+ {
209	+ global $wpdb;
210	+
211	+ $dates = WCV_Queries::orders_within_range();
212	+
213	+ $defaults = array(
214	+ 'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
215	+ 'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
216	+ );
217	+
218	+ $args = wp_parse_args( $args, $defaults );
219	+
220	+ $sql = "
221	+ SELECT COUNT(order_id) as total_orders,
222	+ SUM(total_due + total_shipping + tax) as line_total,
223	+ SUM(qty) as qty,
224	+ product_id
225	+
226	+ FROM {$wpdb->prefix}pv_commission
227	+
228	+ WHERE order_id IN ('" . implode( "','", $order_ids ) . "')
229	+ AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
230	+ AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
231	+ AND status != 'reversed'
232	+ ";
233	+
234	+ if ( !empty( $args[ 'vendor_id' ] ) ) {
235	+ $sql .= "
236	+ AND vendor_id = {$args['vendor_id']}
237	+ ";
238	+ }
239	+
240	+ $sql .= "
241	+ GROUP BY order_id
242	+ ORDER BY time DESC;
243	+ ";
244	+
245	+ $orders = $wpdb->get_results( $sql );
246	+
247	+ return $orders;
248	+ }
249	+
250	+
251	+ /**
252	+ * Orders for range filter function
253	+ *
254	+ * @return array
255	+ */
256	+ public static function orders_within_range()
257	+ {
258	+ global $start_date, $end_date;
259	+
260	+ $start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
261	+ $end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
262	+
263	+ if ( !empty( $_POST[ 'start_date' ] ) ) {
264	+ $start_date = strtotime( $_POST[ 'start_date' ] );
265	+ $_SESSION[ 'PV_Session' ][ 'start_date' ] = $start_date;
266	+ }
267	+
268	+ if ( !empty( $_POST[ 'end_date' ] ) ) {
269	+ $end_date = strtotime( $_POST[ 'end_date' ] );
270	+ $_SESSION[ 'PV_Session' ][ 'end_date' ] = $end_date;
271	+ }
272	+
273	+ $after = date( 'Y-m-d', $start_date );
274	+ $before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
275	+
276	+ return array( 'after' => $after, 'before' => $before );
277	+ }
278	+
279	+
280	+ }

trunk/classes/class-shipping.php ADDED Viewed

	@@ -0,0 +1,322 @@


1	+ <?php
2	+
3	+ /**
4	+ * Shipping functions
5	+ *
6	+ * @author Matt Gates <http://mgates.me>, WC Vendors <http://wcvendors.com>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Shipping
12	+ {
13	+ public static $trs2_shipping_rates;
14	+ public static $trs2_shipping_calc_type;
15	+ public static $pps_shipping_costs = array();
16	+
17	+
18	+ /**
19	+ * Constructor
20	+ */
21	+ function __construct()
22	+ {
23	+ // Table Rate Shipping 2 by WooThemes
24	+ if ( function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) {
25	+ // add_action( 'wp', array( $this, 'trs2_clear_transients' ) );
26	+ add_action( 'woocommerce_checkout_update_order_meta', array( 'WCV_Shipping', 'trs2_add_shipping_data' ), 1, 2 );
27	+ add_action( 'wc_trs2_matched_rates', array( 'WCV_Shipping', 'trs2_store_shipping_data' ), 10, 3 );
28	+ }
29	+ }
30	+
31	+
32	+ /**
33	+ *
34	+ *
35	+ * @param unknown $order_id
36	+ * @param unknown $product
37	+ * @param unknown $author
38	+ *
39	+ * @return unknown
40	+ */
41	+ public static function get_shipping_due( $order_id, $product, $author )
42	+ {
43	+ global $woocommerce;
44	+
45	+ $shipping_costs = array( 'amount' => 0, 'tax' => 0);
46	+ $shipping_due = 0;
47	+ $method = '';
48	+ $_product = get_product( $product[ 'product_id' ] );
49	+ $order = wc_get_order( $order_id );
50	+
51	+ if ( $_product && $_product->needs_shipping() && !$_product->is_downloadable() ) {
52	+
53	+ // Get Shipping methods.
54	+ $shipping_methods = $order->get_shipping_methods();
55	+
56	+ // TODO: Currently this only allows one shipping method per order, this definitely needs changing
57	+ foreach ($shipping_methods as $shipping_method) {
58	+ $method = $shipping_method['method_id'];
59	+ break;
60	+ }
61	+
62	+ // Table Rate Shipping 2
63	+ if ( strstr( $method, 'table_rate' ) !== false ) {
64	+ // $shipping_due = WCV_Shipping::trs2_get_due( $order_id, $product[ 'product_id' ] );
65	+
66	+ // Per Product Shipping 2
67	+ } else if ( ( class_exists('WC_Shipping_Per_Product_Init') \|\| function_exists( 'woocommerce_per_product_shipping' ) ) && $method == 'per_product' ) {
68	+ $shipping_costs = WCV_Shipping::pps_get_due( $order_id, $product );
69	+
70	+ // Local Delivery
71	+ } else if ( $method == 'local_delivery' ) {
72	+ $local_delivery = get_option( 'woocommerce_local_delivery_settings' );
73	+
74	+ if ( $local_delivery[ 'type' ] == 'product' ) {
75	+
76	+ $shipping_costs['amount'] = $product[ 'qty' ] * $local_delivery[ 'fee' ];
77	+ $shipping_costs['tax'] = WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order );
78	+ }
79	+
80	+ // International Delivery
81	+ } else if ( $method == 'international_delivery' ) {
82	+
83	+ $int_delivery = get_option( 'woocommerce_international_delivery_settings' );
84	+
85	+ if ( $int_delivery[ 'type' ] == 'item' ) {
86	+ $WC_Shipping_International_Delivery = new WC_Shipping_International_Delivery();
87	+ $fee = $WC_Shipping_International_Delivery->get_fee( $int_delivery[ 'fee' ], $_product->get_price() );
88	+ $shipping_costs['amount'] = ( $int_delivery[ 'cost' ] + $fee ) * $product[ 'qty' ];
89	+ $shipping_costs['tax'] = ( 'taxable' === $int_delivery[ 'tax_status' ] ) ? WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order ) : 0;
90	+ }
91	+
92	+ }
93	+ }
94	+
95	+ $shipping_costs = apply_filters( 'wcvendors_shipping_due', $shipping_costs, $order_id, $product, $author );
96	+
97	+ return $shipping_costs;
98	+ }
99	+
100	+
101	+ /**
102	+ *
103	+ *
104	+ * @param unknown $order_id
105	+ * @param unknown $product
106	+ *
107	+ * @return array
108	+ */
109	+ public static function pps_get_due( $order_id, $product )
110	+ {
111	+ global $woocommerce;
112	+
113	+ $item_shipping_cost = 0;
114	+ $shipping_costs = array();
115	+
116	+ $settings = get_option( 'woocommerce_per_product_settings' );
117	+ $taxable = $settings['tax_status'];
118	+
119	+ $order = new WC_Order( $order_id );
120	+ $package[ 'destination' ][ 'country' ] = $order->shipping_country;
121	+ $package[ 'destination' ][ 'state' ] = $order->shipping_state;
122	+ $package[ 'destination' ][ 'postcode' ] = $order->shipping_postcode;
123	+ $product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
124	+
125	+ if ( !empty( $product['variation_id'] ) ) {
126	+ $rule = woocommerce_per_product_shipping_get_matching_rule( $product['variation_id'], $package );
127	+ }
128	+
129	+ if ( empty( $rule ) ) {
130	+ $rule = woocommerce_per_product_shipping_get_matching_rule( $product['product_id'], $package );
131	+ }
132	+
133	+ if ( !empty( $rule ) ) {
134	+ $item_shipping_cost += $rule->rule_item_cost * $product[ 'qty' ];
135	+
136	+ if ( !empty(self::$pps_shipping_costs[$order_id]) && ! in_array( $rule->rule_id, self::$pps_shipping_costs[$order_id] ) ) {
137	+ $item_shipping_cost += $rule->rule_cost;
138	+ } else if ( empty( self::$pps_shipping_costs[$order_id] ) ) {
139	+ $item_shipping_cost += $rule->rule_cost;
140	+ }
141	+
142	+ self::$pps_shipping_costs[$order_id][] = $rule->rule_id;
143	+ }
144	+
145	+ $shipping_costs['amount'] = $item_shipping_cost;
146	+ $shipping_costs['tax'] = ('taxable' === $taxable ) ? WCV_Shipping::calculate_shipping_tax( $item_shipping_cost, $order ) : 0;
147	+
148	+ // return $item_shipping_cost;
149	+ return $shipping_costs;
150	+ }
151	+
152	+ public static function calculate_shipping_tax( $shipping_amount, $order ) {
153	+
154	+ $tax_based_on = get_option( 'woocommerce_tax_based_on' );
155	+ $wc_tax_enabled = get_option( 'woocommerce_calc_taxes' );
156	+
157	+ // if taxes aren't enabled don't calculate them
158	+ if ( 'no' === $wc_tax_enabled ) return 0;
159	+
160	+ if ( 'base' === $tax_based_on ) {
161	+
162	+ $default = wc_get_base_location();
163	+ $country = $default['country'];
164	+ $state = $default['state'];
165	+ $postcode = '';
166	+ $city = '';
167	+
168	+ } elseif ( 'billing' === $tax_based_on ) {
169	+
170	+ $country = $order->billing_country;
171	+ $state = $order->billing_state;
172	+ $postcode = $order->billing_postcode;
173	+ $city = $order->billing_city;
174	+
175	+ } else {
176	+
177	+ $country = $order->shipping_country;
178	+ $state = $order->shipping_state;
179	+ $postcode = $order->shipping_postcode;
180	+ $city = $order->shipping_city;
181	+
182	+ }
183	+
184	+ // Now calculate shipping tax
185	+ $matched_tax_rates = array();
186	+
187	+ $tax_rates = WC_Tax::find_rates( array(
188	+ 'country' => $country,
189	+ 'state' => $state,
190	+ 'postcode' => $postcode,
191	+ 'city' => $city,
192	+ 'tax_class' => ''
193	+ ) );
194	+
195	+
196	+ if ( $tax_rates ) {
197	+ foreach ( $tax_rates as $key => $rate ) {
198	+ if ( isset( $rate['shipping'] ) && 'yes' === $rate['shipping'] ) {
199	+ $matched_tax_rates[ $key ] = $rate;
200	+ }
201	+ }
202	+ }
203	+
204	+ $shipping_taxes = WC_Tax::calc_shipping_tax( $shipping_amount, $matched_tax_rates );
205	+ $shipping_tax_total = WC_Tax::round( array_sum( $shipping_taxes ) );
206	+
207	+ return $shipping_tax_total;
208	+
209	+ }
210	+
211	+
212	+ /**
213	+ *
214	+ */
215	+ public function trs2_clear_transients()
216	+ {
217	+ global $woocommerce;
218	+
219	+ if ( is_checkout() ) {
220	+ wc_delete_product_transients();
221	+ }
222	+ }
223	+
224	+
225	+ /**
226	+ *
227	+ *
228	+ * @param unknown $order_id
229	+ * @param unknown $product_id
230	+ *
231	+ * @return unknown
232	+ */
233	+ public function trs2_get_due( $order_id, $product_id )
234	+ {
235	+ if ( !function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) return;
236	+
237	+ $shipping_due = 0;
238	+
239	+ WCV_Shipping::trs2_retrieve_shipping_data( $order_id );
240	+ if ( !empty( WCV_Shipping::$trs2_shipping_calc_type ) ) {
241	+
242	+ $ship_id = ( WCV_Shipping::$trs2_shipping_calc_type == 'class' ) ? get_product( $product_id )->get_shipping_class_id() : $product_id;
243	+
244	+ if ( !empty( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] ) ) {
245	+ $shipping_due = WCV_Shipping::$trs2_shipping_rates[ $ship_id ];
246	+ unset( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] );
247	+ }
248	+ }
249	+
250	+ return $shipping_due;
251	+ }
252	+
253	+
254	+ /**
255	+ *
256	+ *
257	+ * @param unknown $order_id
258	+ */
259	+ public function trs2_retrieve_shipping_data( $order_id )
260	+ {
261	+ global $woocommerce;
262	+
263	+ if ( !empty( WCV_Shipping::$trs2_shipping_rates ) ) return;
264	+
265	+ WCV_Shipping::$trs2_shipping_rates = array_filter( (array) get_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', true ) );
266	+ WCV_Shipping::$trs2_shipping_calc_type = get_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', true );
267	+ }
268	+
269	+
270	+ /**
271	+ *
272	+ *
273	+ * @param unknown $type
274	+ * @param unknown $rates
275	+ * @param unknown $per_item
276	+ */
277	+ public function trs2_store_shipping_data( $type, $rates, $per_item )
278	+ {
279	+ global $woocommerce;
280	+
281	+ $types = (array) $woocommerce->session->trs2_shipping_class_type;
282	+ $types[ ] = $type;
283	+ $woocommerce->session->trs2_shipping_class_type = $types;
284	+
285	+ $items = (array) $woocommerce->session->trs2_shipping_rates;
286	+ $items[ ] = $per_item;
287	+ $woocommerce->session->trs2_shipping_rates = $items;
288	+ }
289	+
290	+
291	+ /**
292	+ *
293	+ *
294	+ * @param unknown $order_id
295	+ * @param unknown $post
296	+ *
297	+ * @return unknown
298	+ */
299	+ public function trs2_add_shipping_data( $order_id, $post )
300	+ {
301	+ global $woocommerce;
302	+
303	+ if ( empty( $woocommerce->session->trs2_shipping_rates ) ) {
304	+ return false;
305	+ }
306	+
307	+ $order = new WC_Order( $order_id );
308	+
309	+ foreach ( $woocommerce->session->trs2_shipping_rates as $key => $shipping_rates ) {
310	+
311	+ if ( is_array( $shipping_rates ) && array_sum( $shipping_rates ) == $order->order_shipping ) {
312	+ $shipping_calc_type = $woocommerce->session->trs2_shipping_class_type[ $key ];
313	+ update_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', $shipping_rates );
314	+ update_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', $shipping_calc_type );
315	+
316	+ break;
317	+ }
318	+ }
319	+
320	+ unset( $woocommerce->session->trs2_shipping_rates, $woocommerce->session->trs2_shipping_class_type );
321	+ }
322	+ }

trunk/classes/class-vendors.php ADDED Viewed

	@@ -0,0 +1,462 @@


1	+ <?php
2	+
3	+ /**
4	+ * Vendor functions
5	+ *
6	+ * @author Matt Gates <http://mgates.me>, WC Vendors <http://wcvendors.com>
7	+ * @package WCVendors
8	+ */
9	+
10	+
11	+ class WCV_Vendors
12	+ {
13	+
14	+ /**
15	+ * Retrieve all products for a vendor
16	+ *
17	+ * @param int $vendor_id
18	+ *
19	+ * @return object
20	+ */
21	+ public static function get_vendor_products( $vendor_id )
22	+ {
23	+ $args = array(
24	+ 'numberposts' => -1,
25	+ 'post_type' => 'product',
26	+ 'author' => $vendor_id,
27	+ 'post_status' => 'publish',
28	+ );
29	+
30	+ $args = apply_filters( 'pv_get_vendor_products_args', $args );
31	+
32	+ return get_posts( $args );
33	+ }
34	+
35	+ public static function get_default_commission( $vendor_id )
36	+ {
37	+ return get_user_meta( $vendor_id, 'pv_custom_commission_rate', true );
38	+ }
39	+
40	+
41	+ /**
42	+ * Vendor IDs and PayPal addresses from an order
43	+ *
44	+ * @param object $order
45	+ * @param unknown $items (optional)
46	+ *
47	+ * @return array
48	+ */
49	+ public static function get_vendors_from_order( $order, $items = false )
50	+ {
51	+ if ( !$order ) return;
52	+ if ( !$items ) $items = $order->get_items();
53	+
54	+ $vendors = array();
55	+ foreach ( $items as $key => $product ) {
56	+
57	+ $author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
58	+
59	+ // Only store the vendor authors
60	+ if ( !WCV_Vendors::is_vendor( $author ) ) continue;
61	+
62	+ $vendors[ $author ] = the_author_meta( 'author_paypal', $author );
63	+ }
64	+
65	+ return apply_filters( 'pv_vendors_from_order', $vendors, $order );
66	+ }
67	+
68	+
69	+ /**
70	+ *
71	+ *
72	+ * @param unknown $order
73	+ * @param unknown $group (optional)
74	+ *
75	+ * @return unknown
76	+ */
77	+ public static function get_vendor_dues_from_order( $order, $group = true )
78	+ {
79	+ global $woocommerce;
80	+
81	+ $give_tax = WC_Vendors::$pv_options->get_option( 'give_tax' );
82	+ $give_shipping = WC_Vendors::$pv_options->get_option( 'give_shipping' );
83	+ $receiver = array();
84	+ $shipping_given = 0;
85	+ $tax_given = 0;
86	+
87	+ WCV_Shipping::$pps_shipping_costs = array();
88	+
89	+ foreach ( $order->get_items() as $key => $product ) {
90	+
91	+ $product_id = !empty( $product[ 'variation_id' ] ) ? $product[ 'variation_id' ] : $product[ 'product_id' ];
92	+ $author = WCV_Vendors::get_vendor_from_product( $product_id );
93	+ $give_tax_override = get_user_meta( $author, 'wcv_give_vendor_tax', true );
94	+ $give_shipping_override = get_user_meta( $author, 'wcv_give_vendor_shipping', true );
95	+ $is_vendor = WCV_Vendors::is_vendor( $author );
96	+ $commission = $is_vendor ? WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product_id, $order, $product[ 'qty' ] ) : 0;
97	+ $tax = !empty( $product[ 'line_tax' ] ) ? (float) $product[ 'line_tax' ] : 0;
98	+
99	+ // Check if shipping is enabled
100	+ if ( get_option('woocommerce_calc_shipping') === 'no' ) {
101	+ $shipping = 0; $shipping_tax = 0;
102	+ } else {
103	+ $shipping_costs = WCV_Shipping::get_shipping_due( $order->id, $product, $author );
104	+ $shipping = $shipping_costs['amount'];
105	+ $shipping_tax = $shipping_costs['tax'];
106	+ }
107	+
108	+ $_product = new WC_Product( $product['product_id'] );
109	+
110	+ // Add line item tax and shipping taxes together
111	+ $total_tax = ( $_product->is_taxable() ) ? (float) $tax + (float) $shipping_tax : 0;
112	+
113	+ // Tax override on a per vendor basis
114	+ if ( $give_tax_override ) $give_tax = true;
115	+ // Shipping override
116	+ if ( $give_shipping_override ) $give_shipping = true;
117	+
118	+ if ( $is_vendor ) {
119	+
120	+ $shipping_given += $give_shipping ? $shipping : 0;
121	+ $tax_given += $give_tax ? $total_tax : 0;
122	+
123	+ $give = 0;
124	+ $give += !empty( $receiver[ $author ][ 'total' ] ) ? $receiver[ $author ][ 'total' ] : 0;
125	+ $give += $give_shipping ? $shipping : 0;
126	+ $give += $commission;
127	+ $give += $give_tax ? $total_tax : 0;
128	+
129	+ if ( $group ) {
130	+
131	+ $receiver[ $author ] = array(
132	+ 'vendor_id' => (int) $author,
133	+ 'commission' => !empty( $receiver[ $author ][ 'commission' ] ) ? $receiver[ $author ][ 'commission' ] + $commission : $commission,
134	+ 'shipping' => $give_shipping ? ( !empty( $receiver[ $author ][ 'shipping' ] ) ? $receiver[ $author ][ 'shipping' ] + $shipping : $shipping) : 0,
135	+ 'tax' => $give_tax ? ( !empty( $receiver[ $author ][ 'tax' ] ) ? $receiver[ $author ][ 'tax' ] + $total_tax : $total_tax ) : 0,
136	+ 'qty' => !empty( $receiver[ $author ][ 'qty' ] ) ? $receiver[ $author ][ 'qty' ] + $product[ 'qty' ] : $product[ 'qty' ],
137	+ 'total' => $give,
138	+ );
139	+
140	+ } else {
141	+
142	+ $receiver[ $author ][ $key ] = array(
143	+ 'vendor_id' => (int) $author,
144	+ 'product_id' => $product_id,
145	+ 'commission' => $commission,
146	+ 'shipping' => $give_shipping ? $shipping : 0,
147	+ 'tax' => $give_tax ? $total_tax : 0,
148	+ 'qty' => $product[ 'qty' ],
149	+ 'total' => ($give_shipping ? $shipping : 0) + $commission + ( $give_tax ? $total_tax : 0 ),
150	+ );
151	+
152	+ }
153	+
154	+ }
155	+
156	+ $admin_comm = $product[ 'line_subtotal' ] - $commission;
157	+
158	+ if ( $group ) {
159	+ $receiver[ 1 ] = array(
160	+ 'vendor_id' => 1,
161	+ 'qty' => !empty( $receiver[ 1 ][ 'qty' ] ) ? $receiver[ 1 ][ 'qty' ] + $product[ 'qty' ] : $product[ 'qty' ],
162	+ 'commission' => !empty( $receiver[ 1 ][ 'commission' ] ) ? $receiver[ 1 ][ 'commission' ] + $admin_comm : $admin_comm,
163	+ 'total' => !empty( $receiver[ 1 ] ) ? $receiver[ 1 ][ 'total' ] + $admin_comm : $admin_comm,
164	+ );
165	+ } else {
166	+ $receiver[ 1 ][ $key ] = array(
167	+ 'vendor_id' => 1,
168	+ 'product_id' => $product_id,
169	+ 'commission' => $admin_comm,
170	+ 'shipping' => 0,
171	+ 'tax' => 0,
172	+ 'qty' => $product[ 'qty' ],
173	+ 'total' => $admin_comm,
174	+ );
175	+ }
176	+
177	+ }
178	+
179	+ // Add remainders on end to admin
180	+ $discount = $order->get_total_discount();
181	+ $shipping = ( $order->order_shipping - $shipping_given );
182	+ $tax = round(( $order->order_tax + $order->order_shipping_tax ) - $tax_given, 2);
183	+ $total = ( $tax + $shipping ) - $discount;
184	+
185	+ if ( $group ) {
186	+ $receiver[ 1 ][ 'commission' ] = $receiver[ 1 ][ 'commission' ] - $discount;
187	+ $receiver[ 1 ][ 'shipping' ] = $shipping;
188	+ $receiver[ 1 ][ 'tax' ] = $tax;
189	+ $receiver[ 1 ][ 'total' ] += $total;
190	+ } else {
191	+ $receiver[ 1 ][ $key ][ 'commission' ] = $receiver[ 1 ][ $key ][ 'commission' ] - $discount;
192	+ $receiver[ 1 ][ $key ][ 'shipping' ] = ( $order->order_shipping - $shipping_given );
193	+ $receiver[ 1 ][ $key ][ 'tax' ] = $tax;
194	+ $receiver[ 1 ][ $key ][ 'total' ] += $total;
195	+ }
196	+
197	+ // Reset the array keys
198	+ // $receivers = array_values( $receiver );
199	+
200	+ return $receiver;
201	+ }
202	+
203	+
204	+ /**
205	+ * Return the PayPal address for a vendor
206	+ *
207	+ * If no PayPal is set, it returns the vendor's email
208	+ *
209	+ * @param int $vendor_id
210	+ *
211	+ * @return string
212	+ */
213	+ public static function get_vendor_paypal( $vendor_id )
214	+ {
215	+ $paypal = get_user_meta( $vendor_id, $meta_key = 'pv_paypal', true );
216	+ $paypal = !empty( $paypal ) ? $paypal : get_the_author_meta( 'user_email', $vendor_id, false );
217	+
218	+ return $paypal;
219	+ }
220	+
221	+
222	+ /**
223	+ * Check if a vendor has an amount due for an order already
224	+ *
225	+ * @param int $vendor_id
226	+ * @param int $order_id
227	+ *
228	+ * @return int
229	+ */
230	+ public static function count_due_by_vendor( $vendor_id, $order_id )
231	+ {
232	+ global $wpdb;
233	+
234	+ $table_name = $wpdb->prefix . "pv_commission";
235	+
236	+ $query = "SELECT COUNT(*)
237	+ FROM {$table_name}
238	+ WHERE vendor_id = %s
239	+ AND order_id = %s
240	+ AND status = %s";
241	+ $count = $wpdb->get_var( $wpdb->prepare( $query, $vendor_id, $order_id, 'due' ) );
242	+
243	+ return $count;
244	+ }
245	+
246	+
247	+ /**
248	+ * All commission due for a specific vendor
249	+ *
250	+ * @param int $vendor_id
251	+ *
252	+ * @return int
253	+ */
254	+ public static function get_due_orders_by_vendor( $vendor_id )
255	+ {
256	+ global $wpdb;
257	+
258	+ $table_name = $wpdb->prefix . "pv_commission";
259	+
260	+ $query = "SELECT *
261	+ FROM {$table_name}
262	+ WHERE vendor_id = %s
263	+ AND status = %s";
264	+ $results = $wpdb->get_results( $wpdb->prepare( $query, $vendor_id, 'due' ) );
265	+
266	+ return $results;
267	+ }
268	+
269	+
270	+ /**
271	+ *
272	+ *
273	+ * @param unknown $product_id
274	+ *
275	+ * @return unknown
276	+ */
277	+ public static function get_vendor_from_product( $product_id )
278	+ {
279	+ // Make sure we are returning an author for products or product variations only
280	+ if ( 'product' === get_post_type( $product_id ) \|\| 'product_variation' === get_post_type( $product_id ) ) {
281	+ $parent = get_post_ancestors( $product_id );
282	+ if ( $parent ) $product_id = $parent[ 0 ];
283	+
284	+ $post = get_post( $product_id );
285	+ $author = $post ? $post->post_author : 1;
286	+ $author = apply_filters( 'pv_product_author', $author, $product_id );
287	+ } else {
288	+ $author = -1;
289	+ }
290	+ return $author;
291	+ }
292	+
293	+
294	+ /**
295	+ * Checks whether the ID provided is vendor capable or not
296	+ *
297	+ * @param int $user_id
298	+ *
299	+ * @return bool
300	+ */
301	+ public static function is_vendor( $user_id )
302	+ {
303	+ $user = get_userdata( $user_id );
304	+
305	+ if (is_object($user)) {
306	+ $is_vendor = is_array( $user->roles ) ? in_array( 'vendor', $user->roles ) : false;
307	+ } else {
308	+ $is_vendor = false;
309	+ }
310	+
311	+ return apply_filters( 'pv_is_vendor', $is_vendor, $user_id );
312	+ }
313	+
314	+
315	+ /**
316	+ * Grabs the vendor ID whether a username or an int is provided
317	+ * and returns the vendor_id if it's actually a vendor
318	+ *
319	+ * @param unknown $input
320	+ *
321	+ * @return unknown
322	+ */
323	+ public static function get_vendor_id( $input )
324	+ {
325	+ if ( empty( $input ) ) {
326	+ return false;
327	+ }
328	+
329	+ $users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $input ) ) );
330	+
331	+ if ( !empty( $users ) && count( $users ) == 1 ) {
332	+ $vendor = $users[ 0 ];
333	+ } else {
334	+ $int_vendor = is_numeric( $input );
335	+ $vendor = !empty( $int_vendor ) ? get_userdata( $input ) : get_user_by( 'login', $input );
336	+ }
337	+
338	+ if ( $vendor ) {
339	+ $vendor_id = $vendor->ID;
340	+ if ( self::is_vendor( $vendor_id ) ) {
341	+ return $vendor_id;
342	+ }
343	+ }
344	+
345	+ return false;
346	+ }
347	+
348	+
349	+ /**
350	+ * Retrieve the shop page for a specific vendor
351	+ *
352	+ * @param unknown $vendor_id
353	+ *
354	+ * @return string
355	+ */
356	+ public static function get_vendor_shop_page( $vendor_id )
357	+ {
358	+ $vendor_id = self::get_vendor_id( $vendor_id );
359	+ if ( !$vendor_id ) return;
360	+
361	+ $slug = get_user_meta( $vendor_id, 'pv_shop_slug', true );
362	+ $vendor = !$slug ? get_userdata( $vendor_id )->user_login : $slug;
363	+
364	+ if ( get_option( 'permalink_structure' ) ) {
365	+ $permalink = trailingslashit( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) );
366	+
367	+ return trailingslashit( home_url( sprintf( '/%s%s', $permalink, $vendor ) ) );
368	+ } else {
369	+ return esc_url( add_query_arg( array( 'vendor_shop' => $vendor ), get_post_type_archive_link( 'product' ) ) );
370	+ }
371	+ }
372	+
373	+
374	+ /**
375	+ * Retrieve the shop name for a specific vendor
376	+ *
377	+ * @param unknown $vendor_id
378	+ *
379	+ * @return string
380	+ */
381	+ public static function get_vendor_shop_name( $vendor_id )
382	+ {
383	+ $vendor_id = self::get_vendor_id( $vendor_id );
384	+ $name = $vendor_id ? get_user_meta( $vendor_id, 'pv_shop_name', true ) : false;
385	+ $shop_name = !$name ? get_userdata( $vendor_id )->user_login : $name;
386	+
387	+ return $shop_name;
388	+ }
389	+
390	+
391	+ /**
392	+ *
393	+ *
394	+ * @param unknown $user_id
395	+ *
396	+ * @return unknown
397	+ */
398	+ public static function is_pending( $user_id )
399	+ {
400	+ $user = get_userdata( $user_id );
401	+
402	+ $role = !empty( $user->roles ) ? array_shift( $user->roles ) : false;
403	+ $is_pending = ( $role == 'pending_vendor' );
404	+
405	+ return $is_pending;
406	+ }
407	+
408	+ /*
409	+ * Is this a vendor product ?
410	+ * @param uknown $role
411	+ */
412	+ public static function is_vendor_product($role) {
413	+ return ($role === 'Vendor') ? true : false;
414	+ }
415	+
416	+ /*
417	+ * Is this the vendors shop archive page ?
418	+ */
419	+ public static function is_vendor_page() {
420	+
421	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
422	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
423	+
424	+ return $vendor_id ? true : false;
425	+
426	+ }
427	+
428	+ /*
429	+ * Is this a vendor single product page ?
430	+ */
431	+ public static function is_vendor_product_page($vendor_id) {
432	+
433	+ $vendor_product = WCV_Vendors::is_vendor_product( wcv_get_user_role($vendor_id) );
434	+ return $vendor_product ? true : false;
435	+
436	+ }
437	+
438	+ public static function get_vendor_sold_by( $vendor_id ){
439	+
440	+ $vendor_display_name = WC_Vendors::$pv_options->get_option( 'vendor_display_name' );
441	+ $vendor = get_userdata( $vendor_id );
442	+
443	+ switch ($vendor_display_name) {
444	+ case 'display_name':
445	+ $display_name = $vendor->display_name;
446	+ break;
447	+ case 'user_login':
448	+ $display_name = $vendor->user_login;
449	+ break;
450	+ case 'user_email':
451	+ $display_name = $vendor->user_email;
452	+ break;
453	+
454	+ default:
455	+ $display_name = WCV_Vendors::get_vendor_shop_name( $vendor_id );
456	+ break;
457	+ }
458	+
459	+ return $display_name;
460	+ }
461	+
462	+ }

trunk/classes/front/class-vendor-cart.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ /**
4	+ *
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package
8	+ */
9	+
10	+
11	+ class WCV_Vendor_Cart
12	+ {
13	+
14	+
15	+ /**
16	+ *
17	+ */
18	+ function __construct()
19	+ {
20	+ add_filter( 'woocommerce_get_item_data', array( 'WCV_Vendor_Cart', 'sold_by' ), 10, 2 );
21	+ add_action( 'woocommerce_product_meta_start', array( 'WCV_Vendor_Cart', 'sold_by_meta' ), 10, 2 );
22	+ }
23	+
24	+
25	+ /**
26	+ * Sold by in cart item
27	+ *
28	+ * @param unknown $values
29	+ * @param unknown $cart_item
30	+ *
31	+ * @return unknown
32	+ */
33	+ public static function sold_by( $values, $cart_item )
34	+ {
35	+ $vendor_id = $cart_item[ 'data' ]->post->post_author;
36	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
37	+ $sold_by = WCV_Vendors::is_vendor( $vendor_id )
38	+ ? sprintf( '<a href="%s" target="_TOP">%s </a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
39	+ : get_bloginfo( 'name' );
40	+
41	+ $values[ ] = array(
42	+ 'name' => apply_filters('wcvendors_cart_sold_by', $sold_by_label ),
43	+ 'display' => $sold_by,
44	+ );
45	+
46	+ return $values;
47	+ }
48	+
49	+
50	+ /**
51	+ * Single product meta
52	+ */
53	+ public static function sold_by_meta()
54	+ {
55	+ $vendor_id = get_the_author_meta( 'ID' );
56	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
57	+ $sold_by = WCV_Vendors::is_vendor( $vendor_id )
58	+ ? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
59	+ : get_bloginfo( 'name' );
60	+
61	+ echo apply_filters('wcvendors_cart_sold_by_meta', $sold_by_label ) .' '. $sold_by . '<br/>';
62	+ }
63	+
64	+ }

trunk/classes/front/class-vendor-shop.php ADDED Viewed

	@@ -0,0 +1,292 @@


1	+ <?php
2	+
3	+ /**
4	+ * Shop functions for each vendor.
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Vendor_Shop
12	+ {
13	+
14	+ public static $seller_info;
15	+
16	+ /**
17	+ * init
18	+ */
19	+ function __construct()
20	+ {
21	+
22	+ add_filter( 'product_enquiry_send_to', array( 'WCV_Vendor_Shop', 'product_enquiry_compatibility' ), 10, 2 );
23	+
24	+ add_action( 'woocommerce_product_query', array( $this, 'vendor_shop_query' ), 10, 2 );
25	+ add_filter( 'init', array( $this, 'add_rewrite_rules' ), 0 );
26	+
27	+ add_action( 'woocommerce_before_main_content', array( 'WCV_Vendor_Shop', 'shop_description' ), 30 );
28	+ add_filter( 'woocommerce_product_tabs', array( 'WCV_Vendor_Shop', 'seller_info_tab' ) );
29	+ add_filter( 'post_type_archive_link', array( 'WCV_Vendor_Shop', 'change_archive_link' ) );
30	+
31	+ // Add sold by to product loop before add to cart
32	+ add_action( 'woocommerce_after_shop_loop_item', array('WCV_Vendor_Shop', 'template_loop_sold_by'), 9 );
33	+
34	+ // Remove Page Title if on Vendor Shop
35	+ add_filter ( 'woocommerce_show_page_title', array('WCV_Vendor_Shop', 'remove_vendor_title') );
36	+
37	+ // Show vendor on all sales related invoices
38	+ add_action( 'woocommerce_add_order_item_meta', array('WCV_Vendor_Shop', 'add_vendor_to_order_item_meta'), 10, 2 );
39	+
40	+ // Add a vendor header
41	+ if (WC_Vendors::$pv_options->get_option( 'shop_headers_enabled' ) ) {
42	+ add_action( 'woocommerce_before_main_content', array('WCV_Vendor_Shop', 'vendor_main_header'), 20 );
43	+ add_action( 'woocommerce_before_single_product', array('WCV_Vendor_Shop', 'vendor_mini_header'));
44	+ }
45	+
46	+ }
47	+
48	+ public static function change_archive_link( $link )
49	+ {
50	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
51	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
52	+
53	+ return !$vendor_id ? $link : WCV_Vendors::get_vendor_shop_page( $vendor_id );
54	+ }
55	+
56	+ public static function vendor_shop_query( $q, $that )
57	+ {
58	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
59	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
60	+
61	+ if ( !$vendor_id ) return;
62	+ add_filter( 'woocommerce_page_title', array( 'WCV_Vendor_Shop', 'page_title' ) );
63	+
64	+ $q->set( 'author', $vendor_id );
65	+ }
66	+
67	+ public static function product_enquiry_compatibility( $send_to, $product_id )
68	+ {
69	+ $author_id = get_post( $product_id )->post_author;
70	+ if ( WCV_Vendors::is_vendor( $author_id ) ) {
71	+ $send_to = get_userdata( $author_id )->user_email;
72	+ }
73	+
74	+ return $send_to;
75	+ }
76	+
77	+
78	+ /**
79	+ *
80	+ *
81	+ * @param unknown $tabs
82	+ *
83	+ * @return unknown
84	+ */
85	+ public static function seller_info_tab( $tabs )
86	+ {
87	+ global $post;
88	+
89	+ if ( WCV_Vendors::is_vendor( $post->post_author ) ) {
90	+
91	+ $seller_info = get_user_meta( $post->post_author, 'pv_seller_info', true );
92	+ $has_html = get_user_meta( $post->post_author, 'pv_shop_html_enabled', true );
93	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
94	+
95	+ $seller_info_label = WC_Vendors::$pv_options->get_option( 'seller_info_label' );
96	+
97	+ if ( !empty( $seller_info ) ) {
98	+
99	+ $seller_info = do_shortcode( $seller_info );
100	+ self::$seller_info = '<div class="pv_seller_info">';
101	+ self::$seller_info .= apply_filters('wcv_before_seller_info_tab', '');
102	+ self::$seller_info .= ( $global_html \|\| $has_html ) ? wpautop( wptexturize( wp_kses_post( $seller_info ) ) ) : sanitize_text_field( $seller_info );
103	+ self::$seller_info .= apply_filters('wcv_after_seller_info_tab', '');
104	+ self::$seller_info .= '</div>';
105	+
106	+ $tabs[ 'seller_info' ] = array(
107	+ 'title' => apply_filters( 'wcvendors_seller_info_label', $seller_info_label ),
108	+ 'priority' => 50,
109	+ 'callback' => array( 'WCV_Vendor_Shop', 'seller_info_tab_panel' ),
110	+ );
111	+ }
112	+ }
113	+
114	+ return $tabs;
115	+ }
116	+
117	+
118	+ /**
119	+ *
120	+ */
121	+ public static function seller_info_tab_panel()
122	+ {
123	+ echo self::$seller_info;
124	+ }
125	+
126	+
127	+ /**
128	+ * Show the description a vendor sets when viewing products by that vendor
129	+ */
130	+ public static function shop_description()
131	+ {
132	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
133	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
134	+
135	+ if ( $vendor_id ) {
136	+ $has_html = get_user_meta( $vendor_id, 'pv_shop_html_enabled', true );
137	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
138	+ $description = do_shortcode( get_user_meta( $vendor_id, 'pv_shop_description', true ) );
139	+
140	+ echo '<div class="pv_shop_description">';
141	+ echo ( $global_html \|\| $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
142	+ echo '</div>';
143	+ }
144	+ }
145	+
146	+ /**
147	+ *
148	+ */
149	+ public static function add_rewrite_rules()
150	+ {
151	+ $permalink = untrailingslashit( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) );
152	+
153	+ // Remove beginning slash
154	+ if ( substr( $permalink, 0, 1 ) == '/' ) {
155	+ $permalink = substr( $permalink, 1, strlen( $permalink ) );
156	+ }
157	+
158	+ add_rewrite_tag( '%vendor_shop%', '([^&]+)' );
159	+
160	+ add_rewrite_rule( $permalink . '/([^/]*)/page/([0-9]+)', 'index.php?post_type=product&vendor_shop=$matches[1]&paged=$matches[2]', 'top' );
161	+ add_rewrite_rule( $permalink . '/([^/]*)', 'index.php?post_type=product&vendor_shop=$matches[1]', 'top' );
162	+ }
163	+
164	+
165	+ public static function page_title( $page_title = "" )
166	+ {
167	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
168	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
169	+
170	+ return $vendor_id ? WCV_Vendors::get_vendor_shop_name( $vendor_id ) : $page_title;
171	+ }
172	+
173	+
174	+ /*
175	+ Adding sold by to product loop
176	+ */
177	+ public static function template_loop_sold_by($product_id) {
178	+ $vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
179	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
180	+ $sold_by = WCV_Vendors::is_vendor( $vendor_id )
181	+ ? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
182	+ : get_bloginfo( 'name' );
183	+ echo '<small class="wcvendors_sold_by_in_loop">' . apply_filters('wcvendors_sold_by_in_loop', $sold_by_label ).' '. $sold_by . '</small> <br />';
184	+ }
185	+
186	+
187	+ /*
188	+ * Remove the Page title from Archive-Product while on a vendor Page
189	+ */
190	+ public static function remove_vendor_title( $b ) {
191	+ if ( WCV_Vendors::is_vendor_page() ) {
192	+ return false;
193	+ }
194	+ return $b;
195	+ }
196	+
197	+ /*
198	+ * Display a vendor header at the top of the vendors product archive page
199	+ */
200	+ public static function vendor_main_header() {
201	+
202	+ // Remove the basic shop description from the loop
203	+ remove_action( 'woocommerce_before_main_content', array('WCV_Vendor_Shop', 'shop_description' ), 30);
204	+
205	+ if (WCV_Vendors::is_vendor_page()) {
206	+ $vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
207	+ $vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
208	+ $shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
209	+
210	+ // Shop description
211	+ $has_html = get_user_meta( $vendor_id, 'pv_shop_html_enabled', true );
212	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
213	+ $description = do_shortcode( get_user_meta( $vendor_id, 'pv_shop_description', true ) );
214	+ $shop_description = ( $global_html \|\| $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
215	+ $seller_info = ( $global_html \|\| $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
216	+ $vendor = get_userdata( $vendor_id );
217	+ $vendor_email = $vendor->user_email;
218	+ $vendor_login = $vendor->user_login;
219	+
220	+
221	+ do_action('wcv_before_main_header', $vendor_id);
222	+
223	+ wc_get_template( 'vendor-main-header.php', array(
224	+ 'vendor' => $vendor,
225	+ 'vendor_id' => $vendor_id,
226	+ 'shop_name' => $shop_name,
227	+ 'shop_description' => $shop_description,
228	+ 'seller_info' => $seller_info,
229	+ 'vendor_email' => $vendor_email,
230	+ 'vendor_login' => $vendor_login,
231	+ ), 'wc-vendors/front/', wcv_plugin_dir . 'templates/front/' );
232	+
233	+ do_action('wcv_after_main_header', $vendor_id);
234	+
235	+ }
236	+ }
237	+
238	+
239	+ /*
240	+ * Display a vendor header at the top of the single-product page
241	+ */
242	+ public static function vendor_mini_header() {
243	+
244	+ global $product;
245	+
246	+ if (WCV_Vendors::is_vendor_product_page($product->post->post_author)) {
247	+
248	+ $vendor = get_userdata( $product->post->post_author );
249	+ $vendor_id = $product->post->post_author;
250	+ $vendor_shop_link = site_url( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) .'/' .$vendor->pv_shop_slug );
251	+ $shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
252	+ $has_html = $vendor->pv_shop_html_enabled;
253	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
254	+ $description = do_shortcode( $vendor->pv_shop_description );
255	+ $shop_description = ( $global_html \|\| $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
256	+ $seller_info = ( $global_html \|\| $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
257	+ $vendor_email = $vendor->user_email;
258	+ $vendor_login = $vendor->user_login;
259	+
260	+ do_action('wcv_before_mini_header', $vendor->ID);
261	+
262	+ wc_get_template( 'vendor-mini-header.php', array(
263	+ 'vendor' => $vendor,
264	+ 'vendor_id' => $vendor_id,
265	+ 'vendor_shop_link' => $vendor_shop_link,
266	+ 'shop_name' => $vendor->pv_shop_name,
267	+ 'shop_description' => $shop_description,
268	+ 'seller_info' => $seller_info,
269	+ 'shop_name' => $shop_name,
270	+ 'vendor_email' => $vendor_email,
271	+ 'vendor_login' => $vendor_login,
272	+ ), 'wc-vendors/front/', wcv_plugin_dir . 'templates/front/' );
273	+
274	+ do_action('wcv_after_mini_header', $vendor->ID);
275	+
276	+ }
277	+ }
278	+
279	+ /*
280	+ * Add Vendor to Order item Meta
281	+ * Thanks to Asbjoern Andersen for the code
282	+ *
283	+ */
284	+ public static function add_vendor_to_order_item_meta( $item_id, $cart_item) {
285	+ $vendor_id = $cart_item[ 'data' ]->post->post_author;
286	+ $sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
287	+ $sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
288	+
289	+ wc_add_order_item_meta( $item_id, apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
290	+ }
291	+
292	+ }

trunk/classes/front/dashboard/class-vendor-dashboard.php ADDED Viewed

	@@ -0,0 +1,462 @@


1	+ <?php
2	+
3	+ /**
4	+ * WCV Vendor Dashboard
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @author Jamie Madden <http://wcvendors.com>
8	+ * @package WCVendors
9	+ */
10	+
11	+
12	+ class WCV_Vendor_Dashboard
13	+ {
14	+
15	+
16	+ /**
17	+ * __construct()
18	+ */
19	+ function __construct()
20	+ {
21	+ add_shortcode( 'wcv_shop_settings', array( $this, 'display_vendor_settings' ) );
22	+ add_shortcode( 'wcv_vendor_dashboard', array( $this, 'display_vendor_products' ) );
23	+
24	+ add_action( 'template_redirect', array( $this, 'check_access' ) );
25	+ add_action( 'init', array( $this, 'save_vendor_settings' ) );
26	+ }
27	+
28	+ public function save_vendor_settings()
29	+ {
30	+ global $woocommerce;
31	+
32	+ $user_id = get_current_user_id();
33	+
34	+ if ( !empty( $_GET['wc_pv_mark_shipped'] ) ) {
35	+ $shop_name = WCV_Vendors::get_vendor_shop_name( $user_id );
36	+ $order_id = $_GET['wc_pv_mark_shipped'];
37	+ $shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
38	+ $order = new WC_Order( $order_id );
39	+
40	+ // If not in the shippers array mark as shipped otherwise do nothing.
41	+ if( !in_array($user_id, $shippers)) {
42	+ $shippers[] = $user_id;
43	+ $mails = $woocommerce->mailer()->get_emails();
44	+ if ( !empty( $mails ) ) {
45	+ $mails[ 'WC_Email_Notify_Shipped' ]->trigger( $order_id, $user_id );
46	+ }
47	+ do_action('wcvendors_vendor_ship', $order_id, $user_id);
48	+ wc_add_notice( __( 'Order marked shipped.', 'wcvendors' ), 'success' );
49	+ $order->add_order_note( apply_filters( 'wcvendors_vendor_shipped_note', __( $shop_name . ' has marked as shipped. ', 'wcvendors') ), $user_id ) ;
50	+ } elseif ( false != ( $key = array_search( $user_id, $shippers) ) ) {
51	+ unset( $shippers[$key] ); // Remove user from the shippers array
52	+ }
53	+
54	+ update_post_meta( $order_id, 'wc_pv_shipped', $shippers );
55	+ return;
56	+ }
57	+
58	+ if ( isset( $_POST[ 'update_tracking' ] ) ) {
59	+ $order_id = (int) $_POST[ 'order_id' ];
60	+ $product_id = (int) $_POST[ 'product_id' ];
61	+
62	+ $tracking_provider = woocommerce_clean( $_POST[ 'tracking_provider' ] );
63	+ $custom_tracking_provider = woocommerce_clean( $_POST[ 'custom_tracking_provider_name' ] );
64	+ $custom_tracking_link = woocommerce_clean( $_POST[ 'custom_tracking_url' ] );
65	+ $tracking_number = woocommerce_clean( $_POST[ 'tracking_number' ] );
66	+ $date_shipped = woocommerce_clean( strtotime( $_POST[ 'date_shipped' ] ) );
67	+
68	+ $order = new WC_Order( $order_id );
69	+ $products = $order->get_items();
70	+ foreach ( $products as $key => $value ) {
71	+ if ( $value[ 'product_id' ] == $product_id \|\| $value[ 'variation_id' ] == $product_id ) {
72	+ $order_item_id = $key;
73	+ break;
74	+ }
75	+ }
76	+ if ( $order_item_id ) {
77	+ woocommerce_delete_order_item_meta( $order_item_id, __( 'Tracking number', 'wcvendors' ) );
78	+ woocommerce_add_order_item_meta( $order_item_id, __( 'Tracking number', 'wcvendors' ), $tracking_number );
79	+
80	+ $message = __( 'Success. Your tracking number has been updated.', 'wcvendors' );
81	+ wc_add_notice( $message, 'success' );
82	+
83	+ // Update order data
84	+ update_post_meta( $order_id, '_tracking_provider', $tracking_provider );
85	+ update_post_meta( $order_id, '_custom_tracking_provider', $custom_tracking_provider );
86	+ update_post_meta( $order_id, '_tracking_number', $tracking_number );
87	+ update_post_meta( $order_id, '_custom_tracking_link', $custom_tracking_link );
88	+ update_post_meta( $order_id, '_date_shipped', $date_shipped );
89	+ }
90	+
91	+ }
92	+
93	+ if ( empty( $_POST[ 'vendor_application_submit' ] ) ) {
94	+ return false;
95	+ }
96	+
97	+ if (isset ( $_POST[ 'wc-product-vendor-nonce' ] ) ) {
98	+
99	+ if ( !wp_verify_nonce( $_POST[ 'wc-product-vendor-nonce' ], 'save-shop-settings' ) ) {
100	+ return false;
101	+ }
102	+
103	+
104	+ if ( isset( $_POST[ 'pv_paypal' ] ) ) {
105	+ if ( !is_email( $_POST[ 'pv_paypal' ] ) ) {
106	+ wc_add_notice( __( 'Your PayPal address is not a valid email address.', 'wcvendors' ), 'error' );
107	+ } else {
108	+ update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
109	+ }
110	+ }
111	+
112	+ if ( !empty( $_POST[ 'pv_shop_name' ] ) ) {
113	+ $users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
114	+ if ( !empty( $users ) && $users[ 0 ]->ID != $user_id ) {
115	+ wc_add_notice( __( 'That shop name is already taken. Your shop name must be unique.', 'wcvendors' ), 'error' );
116	+ } else {
117	+ update_user_meta( $user_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
118	+ update_user_meta( $user_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
119	+ }
120	+ }
121	+
122	+ if ( isset( $_POST[ 'pv_shop_description' ] ) ) {
123	+ update_user_meta( $user_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
124	+ }
125	+
126	+ if ( isset( $_POST[ 'pv_seller_info' ] ) ) {
127	+ update_user_meta( $user_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
128	+ }
129	+
130	+ do_action( 'wcvendors_shop_settings_saved', $user_id );
131	+
132	+ if ( !wc_notice_count() ) {
133	+ wc_add_notice( __( 'Settings saved.', 'wcvendors' ), 'success' );
134	+ }
135	+ }
136	+ }
137	+
138	+
139	+ /**
140	+ *
141	+ */
142	+ public function check_access()
143	+ {
144	+ $vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
145	+ $shop_settings_page = WC_Vendors::$pv_options->get_option( 'shop_settings_page' );
146	+
147	+ if ( is_page( $vendor_dashboard_page ) \|\| is_page( $shop_settings_page ) ) {
148	+ if ( !is_user_logged_in() ) {
149	+ wp_redirect( get_permalink( woocommerce_get_page_id( 'myaccount' ) ), 303 );
150	+ exit;
151	+ }
152	+ // user is logged, start session only if it's vendor dashboard
153	+ if ( !session_id() ) session_start();
154	+ }
155	+ }
156	+
157	+
158	+ /**
159	+ * [wcv_vendor_dashboard] shortcode
160	+ *
161	+ * @param array $atts
162	+ *
163	+ * @return unknown
164	+ */
165	+ public function display_vendor_products( $atts )
166	+ {
167	+ global $start_date, $end_date;
168	+
169	+ $start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
170	+ $end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
171	+
172	+ $can_view_orders = WC_Vendors::$pv_options->get_option( 'can_show_orders' );
173	+ $settings_page = get_permalink( WC_Vendors::$pv_options->get_option( 'shop_settings_page' ) );
174	+ $can_submit = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
175	+ $submit_link = ( $can_submit ) ? admin_url( 'post-new.php?post_type=product' ) : '';
176	+ $edit_link = ( $can_submit ) ? admin_url( 'edit.php?post_type=product' ) : '';
177	+
178	+ if ( !$this->can_view_vendor_page() ) {
179	+ return false;
180	+ }
181	+
182	+ extract( shortcode_atts( array(
183	+ 'user_id' => get_current_user_id(),
184	+ 'datepicker' => true,
185	+ ), $atts ) );
186	+
187	+ $vendor_products = WCV_Queries::get_commission_products( $user_id );
188	+ $products = array();
189	+ foreach ($vendor_products as $_product) {
190	+ $products[] = $_product->ID;
191	+ }
192	+
193	+ $vendor_summary = $this->format_product_details( $vendor_products );
194	+ $order_summary = WCV_Queries::get_orders_for_products( $products );
195	+ $shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
196	+
197	+ wp_enqueue_style( 'wcv_frontend_style', wcv_assets_url . 'css/wcv-frontend.css' );
198	+
199	+ $providers = array();
200	+ $provider_array = array();
201	+
202	+ // WC Shipment Tracking Providers
203	+ if ( class_exists( 'WC_Shipment_Tracking' ) ) {
204	+ $WC_Shipment_Tracking = new WC_Shipment_Tracking();
205	+ $providers = (method_exists($WC_Shipment_Tracking, 'get_providers')) ? $WC_Shipment_Tracking->get_providers() : $WC_Shipment_Tracking->providers;
206	+ $provider_array = array();
207	+ foreach ( $providers as $all_providers ) {
208	+ foreach ( $all_providers as $provider => $format ) {
209	+ $provider_array[sanitize_title( $provider )] = urlencode( $format );
210	+ }
211	+ }
212	+ }
213	+
214	+ ob_start();
215	+ do_action( 'wcvendors_before_dashboard' );
216	+
217	+ wc_print_notices();
218	+ wc_get_template( 'links.php', array(
219	+ 'shop_page' => urldecode($shop_page),
220	+ 'settings_page' => $settings_page,
221	+ 'can_submit' => $can_submit,
222	+ 'submit_link' => $submit_link,
223	+ 'edit_link' => $edit_link,
224	+ ), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
225	+
226	+ if ( $can_view_sales = WC_Vendors::$pv_options->get_option( 'can_view_frontend_reports' ) ) {
227	+
228	+ wc_get_template( 'reports.php', array(
229	+ 'start_date' => $start_date,
230	+ 'end_date' => $end_date,
231	+ 'vendor_products' => $vendor_products,
232	+ 'vendor_summary' => $vendor_summary,
233	+ 'datepicker' => $datepicker,
234	+ 'can_view_orders' => $can_view_orders,
235	+ ), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
236	+ }
237	+
238	+ wc_get_template( 'orders.php', array(
239	+ 'start_date' => $start_date,
240	+ 'end_date' => $end_date,
241	+ 'vendor_products' => $vendor_products,
242	+ 'order_summary' => $order_summary,
243	+ 'datepicker' => $datepicker,
244	+ 'providers' => $providers,
245	+ 'provider_array' => $provider_array,
246	+ 'can_view_orders' => $can_view_orders,
247	+ ), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
248	+ do_action( 'wcvendors_after_dashboard' );
249	+
250	+
251	+ if ( function_exists( 'wc_enqueue_js' ) ) {
252	+ wc_enqueue_js( WCV_Vendor_dashboard::wc_st_js( $provider_array ) );
253	+ } else {
254	+ $woocommerce->add_inline_js( $js );
255	+ }
256	+
257	+ return ob_get_clean();
258	+ }
259	+
260	+
261	+ /**
262	+ * [pv_recent_vendor_sales] shortcode
263	+ *
264	+ * @param array $atts
265	+ *
266	+ * @return unknown
267	+ */
268	+ public function display_vendor_settings( $atts )
269	+ {
270	+ global $woocommerce;
271	+
272	+ if ( !$this->can_view_vendor_page() ) {
273	+ return false;
274	+ }
275	+
276	+ extract( shortcode_atts( array(
277	+ 'user_id' => get_current_user_id(),
278	+ 'paypal_address' => true,
279	+ 'shop_description' => true,
280	+ ), $atts ) );
281	+
282	+ $description = get_user_meta( $user_id, 'pv_shop_description', true );
283	+ $seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
284	+ $has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
285	+ $shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
286	+ $global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
287	+
288	+ ob_start();
289	+ wc_get_template( 'settings.php', array(
290	+ 'description' => $description,
291	+ 'global_html' => $global_html,
292	+ 'has_html' => $has_html,
293	+ 'paypal_address' => $paypal_address,
294	+ 'seller_info' => $seller_info,
295	+ 'shop_description' => $shop_description,
296	+ 'shop_page' => $shop_page,
297	+ 'user_id' => $user_id,
298	+ ), 'wc-vendors/dashboard/settings/', wcv_plugin_dir . 'templates/dashboard/settings/' );
299	+
300	+ return ob_get_clean();
301	+ }
302	+
303	+
304	+ /**
305	+ *
306	+ *
307	+ * @return unknown
308	+ */
309	+ public static function can_view_vendor_page()
310	+ {
311	+ if ( !is_user_logged_in() ) {
312	+
313	+ return false;
314	+
315	+ } else if ( !WCV_Vendors::is_vendor( get_current_user_id() ) ) {
316	+
317	+ wc_get_template( 'denied.php', array(), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
318	+
319	+ return false;
320	+
321	+ }
322	+
323	+ return true;
324	+ }
325	+
326	+
327	+ /**
328	+ * Format products for easier displaying
329	+ *
330	+ * @param object $products
331	+ *
332	+ * @return array
333	+ */
334	+ public function format_product_details( $products )
335	+ {
336	+ if ( empty( $products ) ) return false;
337	+
338	+ $orders_page = get_permalink( WC_Vendors::$pv_options->get_option( 'orders_page' ) );
339	+ $default_commission = WC_Vendors::$pv_options->get_option( 'default_commission' );
340	+ $total_qty = $total_cost = 0;
341	+ $data = array(
342	+ 'products' => array(),
343	+ 'total_qty' => '',
344	+ 'total_cost' => '',
345	+ );
346	+
347	+ foreach ( $products as $product )
348	+ $ids[ ] = $product->ID;
349	+
350	+ $orders = WCV_Queries::sum_orders_for_products( $ids, array( 'vendor_id' => get_current_user_id() ) );
351	+
352	+ if ( $orders )
353	+ foreach ( $orders as $order_item ) {
354	+ if ( $order_item->qty < 1 ) continue;
355	+
356	+ $commission_rate = WCV_Commission::get_commission_rate( $order_item->product_id );
357	+ $_product = get_product( $order_item->product_id );
358	+ $id = !empty($_product->parent->id) ? $_product->parent->id : $order_item->product_id;
359	+
360	+ $data[ 'products' ][$id] = array(
361	+ 'id' => $id,
362	+ 'title' => $_product->get_title(),
363	+ 'qty' => !empty($data[ 'products' ][$id]) ? $data[ 'products' ][$id]['qty'] + $order_item->qty : $order_item->qty,
364	+ 'cost' => !empty($data[ 'products' ][$id]) ? $data[ 'products' ][$id]['cost'] + $order_item->line_total : $order_item->line_total,
365	+ 'view_orders_url' => esc_url( add_query_arg( 'orders_for_product', $id, $orders_page ) ),
366	+ 'commission_rate' => $commission_rate,
367	+ );
368	+
369	+ $total_qty += $order_item->qty;
370	+ $total_cost += $order_item->line_total;
371	+
372	+ }
373	+
374	+ $data[ 'total_qty' ] = $total_qty;
375	+ $data[ 'total_cost' ] = $total_cost;
376	+
377	+ // Sort by product title
378	+ if ( !empty( $data[ 'products' ] ) )
379	+ usort( $data[ 'products' ], array( $this, 'sort_by_title' ) );
380	+
381	+ return $data;
382	+ }
383	+
384	+
385	+ /**
386	+ * Sort an array by 'title'
387	+ *
388	+ * @param array $a
389	+ * @param array $b
390	+ *
391	+ * @return array
392	+ */
393	+ private function sort_by_title( array $a, array $b )
394	+ {
395	+ return strcasecmp( $a[ 'title' ], $b[ 'title' ] );
396	+ }
397	+
398	+ /**
399	+ * Load the javascript for the WC Shipment Tracking form
400	+ */
401	+ public static function wc_st_js( $provider_array ) {
402	+ $js = "
403	+ jQuery(function() {
404	+
405	+ var providers = jQuery.parseJSON( '" . json_encode( $provider_array ) . "' );
406	+
407	+ jQuery('#tracking_number').prop('readonly',true);
408	+ jQuery('#date_shipped').prop('readonly',true);
409	+
410	+ function updatelink( tracking, provider ) {
411	+
412	+ var postcode = '32';
413	+ postcode = encodeURIComponent(postcode);
414	+
415	+ link = providers[provider];
416	+ link = link.replace('%251%24s', tracking);
417	+ link = link.replace('%252%24s', postcode);
418	+ link = decodeURIComponent(link);
419	+ return link;
420	+ }
421	+
422	+ jQuery('.tracking_provider, #tracking_number').unbind().change(function(){
423	+
424	+ var form = jQuery(this).parent().parent().attr('id');
425	+
426	+ var tracking = jQuery('#' + form + ' input#tracking_number').val();
427	+ var provider = jQuery('#' + form + ' #tracking_provider').val();
428	+
429	+ if ( providers[ provider ]) {
430	+ link = updatelink(tracking, provider);
431	+ jQuery('#' + form + ' #tracking_number').prop('readonly',false);
432	+ jQuery('#' + form + ' #date_shipped').prop('readonly',false);
433	+ jQuery('#' + form + ' .custom_tracking_url_field, #' + form + ' .custom_tracking_provider_name_field').hide();
434	+ } else {
435	+ jQuery('#' + form + ' .custom_tracking_url_field, #' + form + ' .custom_tracking_provider_name_field').show();
436	+ link = jQuery('#' + form + ' input#custom_tracking_link').val();
437	+ }
438	+
439	+ if (link) {
440	+ jQuery('#' + form + ' p.preview_tracking_link a').attr('href', link);
441	+ jQuery('#' + form + ' p.preview_tracking_link').show();
442	+ } else {
443	+ jQuery('#' + form + ' p.preview_tracking_link').hide();
444	+ }
445	+
446	+ });
447	+
448	+ jQuery('#custom_tracking_provider_name').unbind().click(function(){
449	+
450	+ var form = jQuery(this).parent().parent().attr('id');
451	+
452	+ jQuery('#' + form + ' #tracking_number').prop('readonly',false);
453	+ jQuery('#' + form + ' #date_shipped').prop('readonly',false);
454	+
455	+ });
456	+
457	+ });
458	+ ";
459	+
460	+ return $js;
461	+ }
462	+ }

trunk/classes/front/orders/class-export-csv.php ADDED Viewed

	@@ -0,0 +1,99 @@


1	+ <?php
2	+
3	+ class WCV_Export_CSV
4	+ {
5	+
6	+ /**
7	+ * Sort the data for CSV output first
8	+ *
9	+ * @param int $product_id
10	+ * @param array $headers
11	+ * @param array $body
12	+ * @param array $items
13	+ */
14	+
15	+
16	+ public static function output_csv( $product_id, $headers, $body, $items )
17	+ {
18	+
19	+ $headers[ 'quantity' ] = __( 'Quantity', 'wcvendors' );
20	+ $new_body = array();
21	+
22	+ foreach ( $body as $i => $order ) {
23	+
24	+ // Remove comments
25	+ unset( $body[ $i ][ 'comments' ] );
26	+
27	+ // Remove all numeric keys in each order (these are the meta values we are redoing into new lines)
28	+ foreach ( $order as $key => $col ) {
29	+ if ( is_int( $key ) ) unset( $order[ $key ] );
30	+ }
31	+
32	+ // New order row
33	+ $new_row = $body[ $i ];
34	+ // Remove order to redo
35	+ unset( $body[ $i ] );
36	+
37	+ foreach ( $items[ $i ][ 'items' ] as $item ) {
38	+
39	+ $item_meta = new WC_Order_Item_Meta( $item[ 'item_meta' ] );
40	+ $item_meta_options = $item_meta->get_formatted();
41	+ // $item_meta = $item_meta->display( true, true );
42	+
43	+ $new_row_with_meta = $new_row;
44	+
45	+ if ( sizeof( $item_meta_options ) > 0 ) {
46	+
47	+ $new_row_with_meta[] = $item[ 'qty' ];
48	+
49	+ foreach ( $item_meta_options as $item_meta_option ) {
50	+ if (!array_key_exists( $item_meta_option[ 'label' ], $headers ) ) $headers[$item_meta_option[ 'label' ]] = $item_meta_option[ 'label' ];
51	+ $new_row_with_meta[] = $item_meta_option['value'];
52	+ }
53	+
54	+ } else {
55	+ $new_row_with_meta[] = $item[ 'qty' ];
56	+ }
57	+
58	+ $new_body[] = $new_row_with_meta;
59	+ }
60	+ }
61	+
62	+ $headers = apply_filters( 'wcvendors_csv_headers', $headers, $product_id, $items );
63	+ $body = apply_filters( 'wcvendors_csv_body', $new_body, $product_id, $items );
64	+
65	+ WCV_Export_CSV::download( $headers, $body, $product_id );
66	+ }
67	+
68	+
69	+ /**
70	+ * Send the CSV to the browser for download
71	+ *
72	+ * @param array $headers
73	+ * @param array $body
74	+ * @param string $filename
75	+ */
76	+ public static function download( $headers, $body, $filename )
77	+ {
78	+ // Clear browser output before this point
79	+ if (ob_get_contents()) ob_end_clean();
80	+
81	+ // Output headers so that the file is downloaded rather than displayed
82	+ header( 'Content-Type: text/csv; charset=utf-8' );
83	+ header( 'Content-Disposition: attachment; filename=orders_for_' . $filename . '.csv' );
84	+
85	+ // Create a file pointer connected to the output stream
86	+ $output = fopen( 'php://output', 'w' );
87	+
88	+ // Output the column headings
89	+ fputcsv( $output, $headers );
90	+
91	+ // Body
92	+ foreach ( $body as $data )
93	+ fputcsv( $output, $data );
94	+
95	+ die();
96	+ }
97	+
98	+
99	+ }

trunk/classes/front/orders/class-orders.php ADDED Viewed

	@@ -0,0 +1,259 @@


1	+ <?php
2	+
3	+ /**
4	+ * My account views
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Orders
12	+ {
13	+
14	+
15	+ /**
16	+ * __construct()
17	+ */
18	+ function __construct()
19	+ {
20	+ $this->can_view_orders = WC_Vendors::$pv_options->get_option( 'can_show_orders' );
21	+ $this->can_export_csv = WC_Vendors::$pv_options->get_option( 'can_export_csv' );
22	+ $this->can_view_emails = WC_Vendors::$pv_options->get_option( 'can_view_order_emails' );
23	+
24	+ add_action( 'template_redirect', array( $this, 'check_access' ) );
25	+ add_action( 'wp', array( $this, 'display_shortcodes' ) );
26	+ }
27	+
28	+
29	+ /**
30	+ *
31	+ */
32	+ public function check_access()
33	+ {
34	+ if ( is_page( WC_Vendors::$pv_options->get_option( 'orders_page' ) ) && !is_user_logged_in() ) {
35	+ wp_redirect( get_permalink( woocommerce_get_page_id( 'myaccount' ) ), 303 );
36	+ exit;
37	+ }
38	+ }
39	+
40	+
41	+ /**
42	+ *
43	+ */
44	+ public function display_shortcodes()
45	+ {
46	+ if ( is_page( WC_Vendors::$pv_options->get_option( 'orders_page' ) ) && $this->can_view_orders ) {
47	+
48	+ wp_enqueue_script( 'jquery' );
49	+
50	+ $this->product_id = !empty( $_GET[ 'orders_for_product' ] ) ? (int) $_GET[ 'orders_for_product' ] : false;
51	+ $products = array( $this->product_id );
52	+
53	+ $_product = get_product( $this->product_id );
54	+ $children = $_product->get_children();
55	+ if ( !empty( $children ) ) {
56	+ $products = array_merge($products, $children);
57	+ $products = array_unique($products);
58	+ }
59	+
60	+ $this->orders = WCV_Queries::get_orders_for_products( $products, array( 'vendor_id' => get_current_user_id() ) );
61	+
62	+ add_action( 'init', array( $this, 'verify_order_access' ) );
63	+ add_shortcode( 'wcv_orders', array( $this, 'display_product_orders' ) );
64	+
65	+ if ( $this->can_export_csv && !empty( $_POST[ 'export_orders' ] ) ) {
66	+ $this->download_csv();
67	+ }
68	+
69	+ }
70	+
71	+ }
72	+
73	+
74	+ /**
75	+ *
76	+ *
77	+ * @return unknown
78	+ */
79	+ public function download_csv()
80	+ {
81	+ if ( !$this->orders ) return false;
82	+
83	+ extract( WCV_Orders::format_order_details( $this->orders, $this->product_id ) );
84	+ $headers = WCV_Orders::get_headers();
85	+
86	+ // Export the CSV
87	+ require_once wcv_plugin_dir . 'classes/front/orders/class-export-csv.php';
88	+ WCV_Export_CSV::output_csv( $this->product_id, $headers, $body, $items );
89	+ }
90	+
91	+
92	+ /**
93	+ * Use views to display the Orders page
94	+ *
95	+ * @return html
96	+ */
97	+ public function display_product_orders()
98	+ {
99	+ if ( !WCV_Vendors::is_vendor( get_current_user_id() ) ) {
100	+ ob_start();
101	+ wc_get_template( 'denied.php', array(), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
102	+
103	+ return ob_get_clean();
104	+ }
105	+
106	+ if ( empty( $_GET[ 'orders_for_product' ] ) ) {
107	+ return __( 'You haven\'t selected a product\'s orders to view! Please go back to the Vendor Dashboard and click Show Orders on the product you\'d like to view.', 'wcvendors' );
108	+ }
109	+
110	+ if ( !$this->orders ) {
111	+ return __( 'No orders.', 'wcvendors' );;
112	+ }
113	+
114	+ if ( !empty( $_POST[ 'submit_comment' ] ) ) {
115	+ require_once wcv_plugin_dir . 'classes/front/orders/class-submit-comment.php';
116	+ WCV_Submit_Comment::new_comment( $this->orders );
117	+ }
118	+
119	+ if ( isset( $_POST[ 'mark_shipped' ] ) ) {
120	+ $order_id = (int) $_POST[ 'order_id' ];
121	+ $product_id = (int) $_POST[ 'product_id' ];
122	+ exit;
123	+ }
124	+
125	+ $headers = WCV_Orders::get_headers();
126	+ $all = WCV_Orders::format_order_details( $this->orders, $this->product_id );
127	+
128	+ wp_enqueue_style( 'pv_frontend_style', wcv_assets_url . 'css/wcv-frontend.css' );
129	+ wp_enqueue_script( 'pv_frontend_script', wcv_assets_url . 'js/front-orders.js' );
130	+
131	+ $providers = array();
132	+ $provider_array = array();
133	+
134	+ // WC Shipment Tracking Providers
135	+ if ( class_exists( 'WC_Shipment_Tracking' ) ) {
136	+ $WC_Shipment_Tracking = new WC_Shipment_Tracking();
137	+ $providers = (method_exists($WC_Shipment_Tracking, 'get_providers')) ? $WC_Shipment_Tracking->get_providers() : $WC_Shipment_Tracking->providers;
138	+ $provider_array = array();
139	+ foreach ( $providers as $all_providers ) {
140	+ foreach ( $all_providers as $provider => $format ) {
141	+ $provider_array[sanitize_title( $provider )] = urlencode( $format );
142	+ }
143	+ }
144	+ }
145	+
146	+ ob_start();
147	+ // Show the Export CSV button
148	+ if ( $this->can_export_csv ) {
149	+ wc_get_template( 'csv-export.php', array(), 'wc-vendors/orders/', wcv_plugin_dir . 'templates/orders/' );
150	+ }
151	+
152	+ wc_get_template( 'orders.php', array(
153	+ 'headers' => $headers,
154	+ 'body' => $all[ 'body' ],
155	+ 'items' => $all[ 'items' ],
156	+ 'product_id' => $all[ 'product_id' ],
157	+ 'providers' => $providers,
158	+ 'provider_array' => $provider_array,
159	+ ), 'wc-vendors/orders/', wcv_plugin_dir . 'templates/orders/' );
160	+
161	+ return ob_get_clean();
162	+ }
163	+
164	+
165	+ /**
166	+ * Headers for the Orders page
167	+ *
168	+ * @return array
169	+ */
170	+ public function get_headers()
171	+ {
172	+ $headers = array(
173	+ 'order' => __( 'Order', 'wcvendors' ),
174	+ 'product' => __( 'Product Title', 'wcvendors' ),
175	+ 'name' => __( 'Full name', 'wcvendors' ),
176	+ 'address' => __( 'Address', 'wcvendors' ),
177	+ 'city' => __( 'City', 'wcvendors' ),
178	+ 'state' => __( 'State', 'wcvendors' ),
179	+ 'zip' => __( 'Zip', 'wcvendors' ),
180	+ 'email' => __( 'Email address', 'wcvendors' ),
181	+ 'date' => __( 'Date', 'wcvendors' ),
182	+ );
183	+
184	+ if ( !$this->can_view_emails ) {
185	+ unset( $headers[ 'email' ] );
186	+ }
187	+
188	+ return $headers;
189	+ }
190	+
191	+
192	+ /**
193	+ * Format the orders with just the products we want
194	+ *
195	+ * @param object $orders
196	+ * @param int $product_id
197	+ *
198	+ * @return array
199	+ */
200	+ public function format_order_details( $orders, $product_id )
201	+ {
202	+ $body = $items = array();
203	+ $product = get_product( $product_id )->get_title();
204	+
205	+ foreach ( $orders as $i => $order ) {
206	+ $i = $order->order_id;
207	+ $order = new WC_Order ( $i );
208	+ $body[ $i ] = array(
209	+ 'order_number' => $order->get_order_number(),
210	+ 'product' => $product,
211	+ 'name' => $order->shipping_first_name . ' ' . $order->shipping_last_name,
212	+ 'address' => $order->shipping_address_1,
213	+ 'city' => $order->shipping_city,
214	+ 'state' => $order->shipping_state,
215	+ 'zip' => $order->shipping_postcode,
216	+ 'email' => $order->billing_email,
217	+ 'date' => $order->order_date,
218	+ 'comments' => wptexturize( $order->customer_note ),
219	+ );
220	+
221	+ if ( !$this->can_view_emails ) {
222	+ unset( $body[ $i ][ 'email' ] );
223	+ }
224	+
225	+ $items[ $i ][ 'total_qty' ] = 0;
226	+ foreach ( $order->get_items() as $line_id => $item ) {
227	+
228	+ if ( $item[ 'product_id' ] != $product_id && $item[ 'variation_id' ] != $product_id ) continue;
229	+
230	+ $items[ $i ][ 'items' ][ ] = $item;
231	+ $items[ $i ][ 'total_qty' ] += $item[ 'qty' ];
232	+ }
233	+
234	+ }
235	+
236	+ return array( 'body' => $body, 'items' => $items, 'product_id' => $product_id );
237	+ }
238	+
239	+
240	+ /**
241	+ * Verify the current user can view orders for a product
242	+ *
243	+ * @param int $product_id
244	+ */
245	+ public function verify_order_access()
246	+ {
247	+ if ( !is_user_logged_in() \|\| empty( $this->product_id ) ) {
248	+ wp_safe_redirect( apply_filters( 'woocommerce_get_myaccount_page_id', get_permalink( woocommerce_get_page_id( 'myaccount' ) ) ) );
249	+ exit;
250	+ }
251	+
252	+ $product = get_post( $this->product_id );
253	+ if ( empty ( $product ) \|\| $product->post_type != 'product' \|\| get_current_user_id() != $product->post_author ) {
254	+ wp_safe_redirect( apply_filters( 'woocommerce_get_myaccount_page_id', get_permalink( woocommerce_get_page_id( 'myaccount' ) ) ) );
255	+ exit;
256	+ }
257	+ }
258	+
259	+ }

trunk/classes/front/orders/class-submit-comment.php ADDED Viewed

	@@ -0,0 +1,81 @@


1	+ <?php
2	+
3	+ class WCV_Submit_Comment
4	+ {
5	+
6	+ /**
7	+ * Submit a comment for an order
8	+ *
9	+ * @param object $orders
10	+ *
11	+ * @return unknown
12	+ */
13	+ public static function new_comment( $orders )
14	+ {
15	+ global $woocommerce;
16	+
17	+ $user = wp_get_current_user();
18	+ $user = $user->ID;
19	+
20	+ // Security
21	+ if ( !wp_verify_nonce( $_POST[ '_wpnonce' ], 'add-comment' ) ) return false;
22	+
23	+ // Check if this product belongs to the vendor submitting the comment
24	+ $product_id = (int) $_POST[ 'product_id' ];
25	+ $author = WCV_Vendors::get_vendor_from_product( $product_id );
26	+ if ( $author != $user ) return false;
27	+
28	+ // Find the order belonging to this comment
29	+ foreach ( $orders as $order ) {
30	+ if ( $order->order_id == $_POST[ 'order_id' ] ) {
31	+ $found_order = $order;
32	+ break;
33	+ }
34	+ }
35	+
36	+ // No order was found
37	+ if ( empty( $found_order ) ) return false;
38	+
39	+ // Don't submit empty comments
40	+ if ( empty( $_POST[ 'comment_text' ] ) ) {
41	+ wc_add_notice( __( 'You\'ve left the comment field empty!', 'wcvendors' ), 'error' );
42	+
43	+ return false;
44	+ }
45	+
46	+ // Only submit if the order has the product belonging to this vendor
47	+ $found_order = new WC_Order ( $found_order->order_id );
48	+ $valid_order = false;
49	+ foreach ( $found_order->get_items() as $item ) {
50	+ if ( $item[ 'product_id' ] == $product_id ) {
51	+ $valid_order = true;
52	+ break;
53	+ }
54	+ }
55	+
56	+ if ( $valid_order ) {
57	+ $comment = esc_textarea( $_POST[ 'comment_text' ] );
58	+
59	+ add_filter( 'woocommerce_new_order_note_data', array( __CLASS__, 'filter_comment' ), 10, 2 );
60	+ $found_order->add_order_note( $comment, 1 );
61	+ remove_filter( 'woocommerce_new_order_note_data', array( __CLASS__, 'filter_comment' ), 10, 2 );
62	+
63	+ wc_add_notice( __( 'Success. The customer has been notified of your comment.', 'wcvendors' ), 'success' );
64	+ }
65	+
66	+ }
67	+
68	+ public static function filter_comment( $commentdata, $order )
69	+ {
70	+ $user_id = get_current_user_id();
71	+
72	+ $commentdata[ 'user_id' ] = $user_id;
73	+ $commentdata[ 'comment_author' ] = WCV_Vendors::get_vendor_shop_name( $user_id );
74	+ $commentdata[ 'comment_author_url' ] = WCV_Vendors::get_vendor_shop_page( $user_id );
75	+ $commentdata[ 'comment_author_email' ] = wp_get_current_user()->user_email;
76	+
77	+ return $commentdata;
78	+ }
79	+
80	+
81	+ }

trunk/classes/front/signup/class-vendor-signup.php ADDED Viewed

	@@ -0,0 +1,148 @@


1	+ <?php
2	+
3	+ /**
4	+ * Signup form for applying as a vendor
5	+ *
6	+ * @author Matt Gates <http://mgates.me>
7	+ * @package ProductVendor
8	+ */
9	+
10	+
11	+ class WCV_Vendor_Signup
12	+ {
13	+
14	+
15	+ /**
16	+ * __construct()
17	+ */
18	+ function __construct()
19	+ {
20	+ if ( !WC_Vendors::$pv_options->get_option( 'show_vendor_registration' ) ) return;
21	+
22	+ $this->terms_page = WC_Vendors::$pv_options->get_option( 'terms_to_apply_page' );
23	+
24	+ add_action( 'register_form', array( $this, 'vendor_option' ) );
25	+ add_action( 'woocommerce_created_customer', array( $this, 'save_pending' ), 10, 2 );
26	+ // add_action( 'register_post', array( $this, 'apply_form' ), 10 );
27	+ add_action( 'template_redirect', array( $this, 'apply_form_dashboard' ), 10 );
28	+ add_action( 'woocommerce_register_post', array( $this, 'validate_vendor_registration' ), 10, 3 );
29	+ }
30	+
31	+
32	+ /**
33	+ *
34	+ */
35	+ public function vendor_option()
36	+ {
37	+ ?>
38	+ <div class="clear"></div>
39	+
40	+ <p class="form-row">
41	+ <input class="input-checkbox"
42	+ id="apply_for_vendor" <?php checked( isset( $_POST[ 'apply_for_vendor' ] ), true ) ?> type="checkbox"
43	+ name="apply_for_vendor" value="1"/>
44	+ <label for="apply_for_vendor"
45	+ class="checkbox"><?php echo apply_filters('wcvendors_vendor_registration_checkbox', __( 'Apply to become a vendor? ', 'wcvendors' )); ?></label>
46	+ </p>
47	+
48	+ <?php if ( $this->terms_page ) { ?>
49	+ <p class="form-row agree-to-terms-container" style="display:none">
50	+ <input class="input-checkbox"
51	+ id="agree_to_terms" <?php checked( isset( $_POST[ 'agree_to_terms' ] ), true ) ?> type="checkbox"
52	+ name="agree_to_terms" value="1"/>
53	+ <label for="agree_to_terms"
54	+ class="checkbox"><?php printf( __( 'I have read and accepted the <a target="top" href="%s">terms and conditions</a>', 'wcvendors' ), get_permalink( $this->terms_page ) ); ?></label>
55	+ </p>
56	+
57	+ <script type="text/javascript">
58	+ jQuery(function () {
59	+ if (jQuery('#apply_for_vendor').is(':checked')) {
60	+ jQuery('.agree-to-terms-container').show();
61	+ }
62	+
63	+ jQuery('#apply_for_vendor').on('click', function () {
64	+ jQuery('.agree-to-terms-container').slideToggle();
65	+ });
66	+ })
67	+ </script>
68	+ <?php } ?>
69	+
70	+ <div class="clear"></div>
71	+ <?php
72	+ }
73	+
74	+
75	+ /**
76	+ *
77	+ *
78	+ * @param unknown $user_id
79	+ */
80	+ public function save_pending( $user_id )
81	+ {
82	+
83	+ if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
84	+
85	+ wc_clear_notices();
86	+
87	+ if ( user_can( $user_id, 'manage_options' ) ) {
88	+ wc_add_notice( __( 'Application denied. You are an administrator.', 'wcvendors' ), 'error' );
89	+ } else {
90	+ wc_add_notice( __( 'Your application has been submitted.', 'wcvendors' ), 'notice' );
91	+
92	+ $manual = WC_Vendors::$pv_options->get_option( 'manual_vendor_registration' );
93	+ $role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
94	+
95	+ $wp_user_object = new WP_User( $user_id );
96	+ $wp_user_object->set_role( $role );
97	+
98	+ do_action( 'wcvendors_application_submited', $user_id );
99	+
100	+ add_filter( 'woocommerce_registration_redirect', array( $this, 'redirect_to_vendor_dash' ) );
101	+ }
102	+ }
103	+ }
104	+
105	+ public function redirect_to_vendor_dash( $redirect )
106	+ {
107	+ $vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
108	+
109	+ return apply_filters( 'wcvendors_signup_redirect', get_permalink( $vendor_dashboard_page ) );
110	+ }
111	+
112	+
113	+ /**
114	+ *
115	+ *
116	+ * @return unknown
117	+ */
118	+ public function apply_form_dashboard()
119	+ {
120	+ if ( !isset( $_POST[ 'apply_for_vendor' ] ) ) return false;
121	+
122	+ $vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
123	+ $page_id = get_queried_object_id();
124	+
125	+ if ( $page_id == $vendor_dashboard_page ) {
126	+ if ( $this->terms_page ) {
127	+ if ( isset( $_POST[ 'agree_to_terms' ] ) ) {
128	+ self::save_pending( get_current_user_id() );
129	+ } else {
130	+ wc_add_notice( __( 'You must accept the terms and conditions to become a vendor.', 'wcvendors' ), 'error' );
131	+ }
132	+ } else {
133	+ self::save_pending( get_current_user_id() );
134	+ }
135	+ }
136	+ }
137	+
138	+ public function validate_vendor_registration( $username, $email, $validation_errors ) {
139	+
140	+ if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
141	+ if ( $this->terms_page && !isset( $_POST[ 'agree_to_terms' ] ) ) {
142	+ $validation_errors->add( 'agree_to_terms_error', __( 'You must accept the terms and conditions to become a vendor.', 'wcvendors' ) );
143	+ }
144	+ }
145	+ }
146	+
147	+
148	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/index.php ADDED Viewed

File without changes

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/paypalap.png ADDED Viewed

Binary file

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/index.php ADDED Viewed

File without changes

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/ChangeLog.txt ADDED Viewed

	@@ -0,0 +1,33 @@


1	+
2	+ Version 1.2.95 - September 28, 2012
3	+
4	+ - Sender details (eg:email,phno) serialization bug fixed(https://github.com/paypal/SDKs/issues/30)
5	+ - Bug fixed for 'PPLoggingManager.php' to pickup configuration entries.(https://github.com/paypal/SDKs/issues/28)
6	+ - Updated SDK sample
7	+
8	+ --------------------------------------------------------------------------------------------------
9	+
10	+
11	+ Version 1.1.93 - August 13, 2012
12	+
13	+ - SDK refreshed to Release 1.8.1. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#AdaptivePaymentsAPI
14	+ - SDK Core - Deserialization Logic Change
15	+ --------------------------------------------------------------------------------------------------
16	+
17	+
18	+ Version 1.0.92 - July 30, 2012
19	+
20	+ - Stable release
21	+ -------------------------------------------------------------------------------------------------
22	+ Version 0.7.92 - July 17, 2012
23	+ - wsdl update version 0.7.92
24	+ ------------------------------------------
25	+
26	+ Version 0.6.88 - Apr 17, 2012
27	+ ----------------------------------------
28	+ - Fix to get SDK working with Permissions API token
29	+ - wsdl update version 88.0
30	+
31	+ Version 0.6.86 - Feb 27, 2012
32	+ ----------------------------------------
33	+ - Initial release

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/LICENSE.txt ADDED Viewed

	@@ -0,0 +1,41 @@


1	+ PAYPAL, INC.
2	+
3	+ SDK LICENSE
4	+
5	+ NOTICE TO USER: PayPal, Inc. is providing the Software and Documentation for use under the terms of this Agreement. Any use, reproduction, modification or distribution of the Software or Documentation, or any derivatives or portions hereof, constitutes your acceptance of this Agreement.
6	+
7	+ As used in this Agreement, "PayPal" means PayPal, Inc. "Software" means the software code accompanying this agreement. "Documentation" means the documents, specifications and all other items accompanying this Agreement other than the Software.
8	+
9	+ 1. LICENSE GRANT Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, prepare derivative works from, publicly display, publicly perform, distribute and sublicense the Software for any purpose, provided the copyright notice below appears in a conspicuous location within the source code of the distributed Software and this license is distributed in the supporting documentation of the Software you distribute. Furthermore, you must comply with all third party licenses in order to use the third party software contained in the Software.
10	+
11	+ Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, publicly display, publicly perform, distribute and sublicense the Documentation for any purpose. You may not modify the Documentation.
12	+
13	+ No title to the intellectual property in the Software or Documentation is transferred to you under the terms of this Agreement. You do not acquire any rights to the Software or the Documentation except as expressly set forth in this Agreement.
14	+
15	+ If you choose to distribute the Software in a commercial product, you do so with the understanding that you agree to defend, indemnify and hold harmless PayPal and its suppliers against any losses, damages and costs arising from the claims, lawsuits or other legal actions arising out of such distribution. You may distribute the Software in object code form under your own license, provided that your license agreement:
16	+
17	+ (a) complies with the terms and conditions of this license agreement;
18	+
19	+ (b) effectively disclaims all warranties and conditions, express or implied, on behalf of PayPal;
20	+
21	+ (c) effectively excludes all liability for damages on behalf of PayPal;
22	+
23	+ (d) states that any provisions that differ from this Agreement are offered by you alone and not PayPal; and
24	+
25	+ (e) states that the Software is available from you or PayPal and informs licensees how to obtain it in a reasonable manner on or through a medium customarily used for software exchange.
26	+
27	+ 2. DISCLAIMER OF WARRANTY
28	+ PAYPAL LICENSES THE SOFTWARE AND DOCUMENTATION TO YOU ONLY ON AN "AS IS" BASIS WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY WARRANTIES OR CONDITIONS OF TITLE, NON-INFRINGEMENT, MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE. PAYPAL MAKES NO WARRANTY THAT THE SOFTWARE OR DOCUMENTATION WILL BE ERROR-FREE. Each user of the Software or Documentation is solely responsible for determining the appropriateness of using and distributing the Software and Documentation and assumes all risks associated with its exercise of rights under this Agreement, including but not limited to the risks and costs of program errors, compliance with applicable laws, damage to or loss of data, programs, or equipment, and unavailability or interruption of operations. Use of the Software and Documentation is made with the understanding that PayPal will not provide you with any technical or customer support or maintenance. Some states or jurisdictions do not allow the exclusion of implied warranties or limitations on how long an implied warranty may last, so the above limitations may not apply to you. To the extent permissible, any implied warranties are limited to ninety (90) days.
29	+
30	+
31	+ 3. LIMITATION OF LIABILITY
32	+ PAYPAL AND ITS SUPPLIERS SHALL NOT BE LIABLE FOR LOSS OR DAMAGE ARISING OUT OF THIS AGREEMENT OR FROM THE USE OF THE SOFTWARE OR DOCUMENTATION. IN NO EVENT WILL PAYPAL OR ITS SUPPLIERS BE LIABLE TO YOU OR ANY THIRD PARTY FOR ANY DIRECT, INDIRECT, CONSEQUENTIAL, INCIDENTAL, OR SPECIAL DAMAGES INCLUDING LOST PROFITS, LOST SAVINGS, COSTS, FEES, OR EXPENSES OF ANY KIND ARISING OUT OF ANY PROVISION OF THIS AGREEMENT OR THE USE OR THE INABILITY TO USE THE SOFTWARE OR DOCUMENTATION, HOWEVER CAUSED AND UNDER ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY OR TORT INCLUDING NEGLIGENCE OR OTHERWISE), EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. PAYPAL'S AGGREGATE LIABILITY AND THAT OF ITS SUPPLIERS UNDER OR IN CONNECTION WITH THIS AGREEMENT SHALL BE LIMITED TO THE AMOUNT PAID BY YOU FOR THE SOFTWARE AND DOCUMENTATION.
33	+
34	+ 4. TRADEMARK USAGE
35	+ PayPal is a trademark PayPal, Inc. in the United States and other countries. Such trademarks may not be used to endorse or promote any product unless expressly permitted under separate agreement with PayPal.
36	+
37	+ 5. TERM
38	+ Your rights under this Agreement shall terminate if you fail to comply with any of the material terms or conditions of this Agreement and do not cure such failure in a reasonable period of time after becoming aware of such noncompliance. If all your rights under this Agreement terminate, you agree to cease use and distribution of the Software and Documentation as soon as reasonably practicable.
39	+
40	+ 6. GOVERNING LAW AND JURISDICTION. This Agreement is governed by the statutes and laws of the State of California, without regard to the conflicts of law principles thereof. If any part of this Agreement is found void and unenforceable, it will not affect the validity of the balance of the Agreement, which shall remain valid and enforceable according to its terms. Any dispute arising out of or related to this Agreement shall be brought in the courts of Santa Clara County, California, USA.
41	+

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/README.md ADDED Viewed

	@@ -0,0 +1,57 @@


1	+
2	+ PayPal PHP Adaptive Payments SDK
3	+ ===============================
4	+
5	+ Prerequisites
6	+ -------------
7	+
8	+ PayPal's PHP Adaptive Payments SDK requires
9	+
10	+ * PHP 5.2 and above with curl extension enabled
11	+
12	+
13	+ Using the SDK
14	+ -------------
15	+
16	+ To use the SDK,
17	+
18	+ * Copy the config and lib folders into your project.
19	+ * Make sure that the lib folder in your project is available in PHP's include path
20	+ * Include the services\AdaptivePayments\AdaptivePaymentsService.php file in your code.
21	+ * Create a service wrapper object
22	+ * Create a request object as per your project's needs. All the API request and response classes are available in services\AdaptivePayments\AdaptivePaymentsService.php
23	+ * Invoke the appropriate method on the request object.
24	+
25	+ For example,
26	+
27	+ require_once('services/AdaptivePayments/AdaptivePaymentsService.php');
28	+ require_once('PPLoggingManager.php');
29	+
30	+ $payRequest = new PayRequest($requestEnvelope, $_POST['actionType'], $_POST['cancelUrl'], $_POST['currencyCode'], $receiverList, $_POST['returnUrl']);
31	+ // Add optional params
32	+ if($_POST["feesPayer"] != "") {
33	+ $payRequest->feesPayer = $_POST["feesPayer"];
34	+ }
35	+ ......
36	+
37	+ $service = new AdaptivePaymentsService();
38	+ $response = $service->Pay($payRequest);
39	+
40	+ $ack = strtoupper($response->responseEnvelope->ack);
41	+
42	+ if($ack == 'SUCCESS') {
43	+ // Success
44	+ }
45	+
46	+
47	+
48	+ SDK Configuration
49	+ -----------------
50	+
51	+ replace the API credential in config/sdk_config.ini . You can use the configuration file to configure
52	+
53	+ * (Multiple) API account credentials.
54	+ * Service endpoint and other HTTP connection parameters
55	+
56	+
57	+ Please refer to the sample config file provided with this bundle.

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/build.xml ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <project name="PayPal_PHP_SDK" default="build">
3	+
4	+
5	+ <condition property="PHPUNIT_PATH" value="phpunit.bat" else="phpunit">
6	+ <os family="windows"/>
7	+ </condition>
8	+
9	+ <target name="clean">
10	+ <delete dir="${basedir}/build"/>
11	+ </target>
12	+
13	+
14	+ <target name="phpunit">
15	+ <mkdir dir="tests/reports/"/>
16	+ <exec dir="${basedir}" executable="${PHPUNIT_PATH}" failonerror="true">
17	+ <arg
18	+ line="--testdox --include-path lib --log-junit tests\reports\phpunit.xml tests"/>
19	+ </exec>
20	+ </target>
21	+
22	+
23	+ <target name="build" depends="clean, phpunit"/>
24	+ </project>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/cert_key.pem ADDED Viewed

	@@ -0,0 +1,31 @@


1	+ -----BEGIN RSA PRIVATE KEY-----
2	+ MIICXgIBAAKBgQCaGw566OIaeIsrp2tyzfwUtwapk2aPgL9N8oOoPmTmA/bqhqF8
3	+ 2X43EB2zZF1HY35kPp3L5rZSjqraEZz5j7W4DkXMS286wLnaoh02sVWbbXlLcZ/v
4	+ sAQzNgi1s2raOWonkcbAIAyhjVoGQjpuCn7y9YNgQfpZkgrh/R5ig8obQwIDAQAB
5	+ AoGBAI/YrZ2BAHzhBFdNQXi6WZEkfu2PD27oKKojs006YIhsLvEflmGpyqyvOGoZ
6	+ RxC6CGKeKEEKLCnHzicbxcEVqfKfOxrXkym3ldqBaYubL1OU62biDRtZZdIpG3TE
7	+ gBDRtU8gPQv1ykqY9KqdeORy8vu0lW9Zx9/4ccW126HLt/kxAkEAzF9NKltIc+gu
8	+ S79lzerE8qngiUSc/ccb1ssLj4v4Lf90HNeJ4oSQEikuN32GjPVrUpQYpC4fjcET
9	+ KmqE7k1V3wJBAMEJB3VRToeTQKhWet8JQPkcfES3B+l7NCauUcysSI5XZ9kVflLu
10	+ c5vzznMooRpcNtjJwDmkcnW0lhIQH/DKvx0CQQCWHJXoO54vDGYc2xuisQMyHha/
11	+ nHcXbA0FqqP2Lt/+oTifCq3LhITx4e+BcKDInmbTA9ZJmVsx2pQCPrUe+AzPAkA/
12	+ OU7ZDPVUkFU4DYMW8/f033CQLQaJYVH2bVfbWn41KMmZn2GNlg4FgTgYHbGOaa+J
13	+ F6M+/e6DQM96QQ/FFRK9AkEApx1r0di+W2ibrTANnk6QjQbva9JyOztI+Avg86X5
14	+ swB44tEsRImOTNsE6nfE/215AxjgI1vdn6uU4P8GIKfxnw==
15	+ -----END RSA PRIVATE KEY-----
16	+ -----BEGIN CERTIFICATE-----
17	+ MIICiDCCAfGgAwIBAgIDD/WUMA0GCSqGSIb3DQEBBQUAMIGfMQswCQYDVQQGEwJV
18	+ UzETMBEGA1UECBMKQ2FsaWZvcm5pYTERMA8GA1UEBxMIU2FuIEpvc2UxFTATBgNV
19	+ BAoTDFBheVBhbCwgSW5jLjEWMBQGA1UECxQNc2FuZGJveF9jZXJ0czEbMBkGA1UE
20	+ AxQSc2FuZGJveF9jYW1lcmNoYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwu
21	+ Y29tMB4XDTExMDUwMjA1MDQ0NFoXDTIxMDQyOTA1MDQ0NFowYzElMCMGA1UEAxQc
22	+ Y2VydHVzZXJfYml6X2FwaTEucGF5cGFsLmNvbTEPMA0GA1UEChMGQm9uem9wMQ8w
23	+ DQYDVQQHEwZBdXN0aW4xCzAJBgNVBAgTAlRYMQswCQYDVQQGEwJVUzCBnzANBgkq
24	+ hkiG9w0BAQEFAAOBjQAwgYkCgYEAmhsOeujiGniLK6drcs38FLcGqZNmj4C/TfKD
25	+ qD5k5gP26oahfNl+NxAds2RdR2N+ZD6dy+a2Uo6q2hGc+Y+1uA5FzEtvOsC52qId
26	+ NrFVm215S3Gf77AEMzYItbNq2jlqJ5HGwCAMoY1aBkI6bgp+8vWDYEH6WZIK4f0e
27	+ YoPKG0MCAwEAAaMNMAswCQYDVR0TBAIwADANBgkqhkiG9w0BAQUFAAOBgQBj6xWw
28	+ AumLzSodCWyocPcyKSooNa7wgJKzaVrf0Kxz2QBesKpsfe9UN3Dj04016FIUbkRI
29	+ 4qLJIkKHyeQRU9hvJ78tU7OeykDEVqlHAEE/Z4c5EIs6l9x60VqOpAjnaqX/9Jty
30	+ jXhqpINjolTh6D5jq8y4FX5krKqIYBCNDHM+cQ==
31	+ -----END CERTIFICATE-----

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/sdk_config.ini ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ ;Account credentials
2	+ [Account]
3	+ acct1.UserName = jb-us-seller_api1.paypal.com
4	+ acct1.Password = WX4WTU3S8MY44S7F
5	+ acct1.Signature = AFcWxV21C7fd0v3bYYYRCpSSRl31A7yDhhsPUU2XhtMoZXsWHFxu-RWy
6	+ acct1.AppId = APP-80W284485P519543T
7	+
8	+ ;Connection Information
9	+ [Http]
10	+ http.ConnectionTimeOut = 30
11	+ http.Retry = 5
12	+ ;http.Proxy
13	+
14	+ ;Service Configuration
15	+ [Service]
16	+ ; NOTE: Do not change the service binding configuration.
17	+ service.Binding = NV
18	+ service.EndPoint = "https://svcs.sandbox.paypal.com/"
19	+ service.RedirectURL = "https://www.sandbox.paypal.com/webscr&cmd="
20	+ service.DevCentralURL = "https://developer.paypal.com"
21	+
22	+ ;Logging Information
23	+ [Log]
24	+ log.FileName = PayPal.log
25	+ log.LogLevel = INFO
26	+ log.LogEnabled = true

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/IPPCredential.php ADDED Viewed

	@@ -0,0 +1,53 @@


1	+ <?php
2	+
3	+ /**
4	+ * Base class that represents API credentials
5	+ */
6	+ abstract class IPPCredential
7	+ {
8	+ /**
9	+ * Application Id that uniquely identifies the application
10	+ * The application Id is issued by PayPal.
11	+ * Test application Ids are available for the sandbox environment
12	+ * @var string
13	+ */
14	+ protected $applicationId;
15	+
16	+ /**
17	+ * API username
18	+ * @var string
19	+ */
20	+ protected $userName;
21	+
22	+ /**
23	+ * API password
24	+ * @var string
25	+ */
26	+ protected $password;
27	+
28	+ protected abstract function validate();
29	+
30	+ public function __construct( $userName, $password, $applicationId )
31	+ {
32	+ $this->userName = $userName;
33	+ $this->password = $password;
34	+ $this->applicationId = $applicationId;
35	+ }
36	+
37	+ public function getApplicationId()
38	+ {
39	+ return $this->applicationId;
40	+ }
41	+
42	+ public function getUserName()
43	+ {
44	+ return $this->userName;
45	+ }
46	+
47	+ public function getPassword()
48	+ {
49	+ return $this->password;
50	+ }
51	+ }
52	+
53	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAPIService.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+ require_once 'PPCredentialManager.php';
3	+ require_once 'PPConnectionManager.php';
4	+ require_once 'PPObjectTransformer.php';
5	+ require_once 'PPLoggingManager.php';
6	+ require_once 'PPUtils.php';
7	+ require_once 'PPAuthenticationManager.php';
8	+
9	+ class PPAPIService
10	+ {
11	+ public $endpoint;
12	+ public $serviceName;
13	+ private $logger;
14	+
15	+ public function __construct( $serviceName = "" )
16	+ {
17	+ $this->serviceName = $serviceName;
18	+ $config = PPConfigManager::getInstance();
19	+ $this->endpoint = $config->get( 'service.EndPoint' );
20	+ $this->logger = new PPLoggingManager( __CLASS__ );
21	+ }
22	+
23	+ public function setServiceName( $serviceName )
24	+ {
25	+ $this->serviceName = $serviceName;
26	+ }
27	+
28	+
29	+ public function makeRequest( $apiMethod, $params, $apiUsername = null, $accessToken = null, $tokenSecret = null )
30	+ {
31	+
32	+ $authentication = new PPAuthenticationManager();
33	+ $connectionMgr = PPConnectionManager::getInstance();
34	+ $connection = $connectionMgr->getConnection();
35	+
36	+ $credMgr = PPCredentialManager::getInstance();
37	+ // $apiUsernam is optional, if null the default account in congif file is taken
38	+ $apIPPCredential = $credMgr->getCredentialObject( $apiUsername );
39	+ $config = PPConfigManager::getInstance();
40	+ if ( $config->get( 'service.Binding' ) == 'SOAP' ) {
41	+ $url = $this->endpoint;
42	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
43	+ $headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
44	+ } else {
45	+ $headers = null;
46	+ }
47	+ $params = $authentication->appendSoapHeader( $params, $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
48	+ } else {
49	+ $url = $this->endpoint . $this->serviceName . '/' . $apiMethod;
50	+ $headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
51	+ }
52	+
53	+
54	+ $this->logger->info( "Request: $params" );
55	+ $response = $connection->execute( $url, $params, $headers );
56	+ $this->logger->info( "Response: $response" );
57	+
58	+ return $response;
59	+ }
60	+
61	+
62	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAuthenticationManager.php ADDED Viewed

	@@ -0,0 +1,91 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'PPSignatureCredential.php';
5	+ require_once 'PPCertificateCredential.php';
6	+ require_once 'exceptions/PPInvalidCredentialException.php';
7	+ require_once 'auth/PPAuth.php';
8	+
9	+ class PPAuthenticationManager
10	+ {
11	+ public function getPayPalHeaders( $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
12	+ {
13	+ $config = PPConfigManager::getInstance();
14	+
15	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
16	+ $headers_arr[ ] = "X-PAYPAL-AUTHORIZATION: " . $this->generateAuthString( $apiCred, $accessToken, $tokenSecret, $url );
17	+ //$headers_arr[] = "CLIENT-AUTH: No cert";
18	+ } // Add headers required for service authentication
19	+ else if ( $apiCred instanceof PPSignatureCredential ) {
20	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
21	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
22	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-SIGNATURE: " . $apiCred->getSignature();
23	+ } else if ( $apiCred instanceof PPCertificateCredential ) {
24	+
25	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
26	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
27	+ $connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
28	+ }
29	+
30	+ // Add other headers
31	+ $headers_arr[ ] = "X-PAYPAL-APPLICATION-ID: " . $apiCred->getApplicationId();
32	+ $headers_arr[ ] = "X-PAYPAL-REQUEST-DATA-FORMAT: " . $config->get( 'service.Binding' );
33	+ $headers_arr[ ] = "X-PAYPAL-RESPONSE-DATA-FORMAT: " . $config->get( 'service.Binding' );
34	+ $headers_arr[ ] = "X-PAYPAL-DEVICE-IPADDRESS: " . PPUtils::getLocalIPAddress();
35	+ $headers_arr[ ] = "X-PAYPAL-REQUEST-SOURCE: " . PPUtils::getRequestSource();
36	+
37	+ return $headers_arr;
38	+ }
39	+
40	+ public function appendSoapHeader( $payLoad, $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
41	+ {
42	+ $soapHeader = "<soapenv:Envelope xmlns:soapenv=\"http://schemas.xmlsoap.org/soap/envelope/\" xmlns:urn=\"urn:ebay:api:PayPalAPI\" xmlns:ebl=\"urn:ebay:apis:eBLBaseComponents\" xmlns:cc=\"urn:ebay:apis:CoreComponentTypes\" xmlns:ed=\"urn:ebay:apis:EnhancedDataTypes\">";
43	+
44	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
45	+ $soapHeader .= "<soapenv:Header>";
46	+ $soapHeader .= "<urn:RequesterCredentials/>";
47	+ $soapHeader .= "</soapenv:Header>";
48	+ } else if ( $apiCred instanceof PPSignatureCredential ) {
49	+ $soapHeader .= "<soapenv:Header>";
50	+ $soapHeader .= "<urn:RequesterCredentials>";
51	+ $soapHeader .= "<ebl:Credentials>";
52	+ $soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
53	+ $soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
54	+ $soapHeader .= "<ebl:Signature>" . $apiCred->getSignature() . "</ebl:Signature>";
55	+ $soapHeader .= "</ebl:Credentials>";
56	+ $soapHeader .= "</urn:RequesterCredentials>";
57	+ $soapHeader .= "</soapenv:Header>";
58	+ } else if ( $apiCred instanceof PPCertificateCredential ) {
59	+ $soapHeader .= "<soapenv:Header>";
60	+ $soapHeader .= "<urn:RequesterCredentials>";
61	+ $soapHeader .= "<ebl:Credentials>";
62	+ $soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
63	+ $soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
64	+ $soapHeader .= "</ebl:Credentials>";
65	+ $soapHeader .= "</urn:RequesterCredentials>";
66	+ $soapHeader .= "</soapenv:Header>";
67	+ $connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
68	+ }
69	+ $soapHeader .= "<soapenv:Body>";
70	+ $soapHeader .= $payLoad;
71	+ $soapHeader .= "</soapenv:Body>";
72	+ $soapHeader .= "</soapenv:Envelope>";
73	+
74	+ return $soapHeader;
75	+
76	+ }
77	+
78	+ private function generateAuthString( $apiCred, $accessToken, $tokenSecret, $endpoint )
79	+ {
80	+ $key = $apiCred->getUserName();
81	+ $secret = $apiCred->getPassword();
82	+ $auth = new AuthSignature();
83	+ $response = $auth->genSign( $key, $secret, $accessToken, $tokenSecret, 'POST', $endpoint );
84	+ $authString = "token=" . $accessToken . ",signature=" . $response[ 'oauth_signature' ] . ",timestamp=" . $response[ 'oauth_timestamp' ];
85	+
86	+ return $authString;
87	+ }
88	+
89	+ }
90	+
91	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPBaseService.php ADDED Viewed

	@@ -0,0 +1,88 @@


1	+ <?php
2	+ require_once 'PPAPIService.php';
3	+
4	+
5	+ class PPBaseService
6	+ {
7	+
8	+ private $serviceName;
9	+
10	+ /*
11	+ * Setters and getters for Third party authentication (Permission Services)
12	+ */
13	+ protected $accessToken;
14	+ protected $tokenSecret;
15	+ protected $lastRequest;
16	+ protected $lastResponse;
17	+
18	+ public function getLastRequest()
19	+ {
20	+ return $this->lastRequest;
21	+ }
22	+
23	+ public function setLastRequest( $lastRqst )
24	+ {
25	+ $this->lastRequest = $lastRqst;
26	+ }
27	+
28	+ public function getLastResponse()
29	+ {
30	+ return $this->lastResponse;
31	+ }
32	+
33	+ public function setLastResponse( $lastRspns )
34	+ {
35	+ $this->lastResponse = $lastRspns;
36	+ }
37	+
38	+ public function getAccessToken()
39	+ {
40	+ return $this->accessToken;
41	+ }
42	+
43	+ public function setAccessToken( $accessToken )
44	+ {
45	+ $this->accessToken = $accessToken;
46	+ }
47	+
48	+ public function getTokenSecret()
49	+ {
50	+ return $this->tokenSecret;
51	+ }
52	+
53	+ public function setTokenSecret( $tokenSecret )
54	+ {
55	+ $this->tokenSecret = $tokenSecret;
56	+ }
57	+
58	+ public function __construct( $serviceName )
59	+ {
60	+ $this->serviceName = $serviceName;
61	+ }
62	+
63	+ public function getServiceName()
64	+ {
65	+ return $this->serviceName;
66	+ }
67	+
68	+ public function call( $method, $requestObject, $apiUsername = null )
69	+ {
70	+ $params = $this->marshall( $requestObject );
71	+ $service = new PPAPIService();
72	+ $service->setServiceName( $this->serviceName );
73	+
74	+ $this->lastRequest = $params;
75	+ $this->lastResponse = $service->makeRequest( $method, $params, $apiUsername, $this->accessToken, $this->tokenSecret );
76	+
77	+ return $this->lastResponse;
78	+ }
79	+
80	+ private function marshall( $object )
81	+ {
82	+ $transformer = new PPObjectTransformer();
83	+
84	+ return $transformer->toString( $object );
85	+ }
86	+ }
87	+
88	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCertificateCredential.php ADDED Viewed

	@@ -0,0 +1,72 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'exceptions/PPMissingCredentialException.php';
5	+
6	+ class PPCertificateCredential extends IPPCredential
7	+ {
8	+
9	+ private $certificatePath;
10	+
11	+ private $passPhrase;
12	+
13	+ public function __construct( $userName, $password, $certPath, $appId, $passPhrase )
14	+ {
15	+ parent::__construct( $userName, $password, $appId );
16	+ $this->certificatePath = $certPath;
17	+ $this->passPhrase = $passPhrase;
18	+ $this->validate();
19	+ }
20	+
21	+ public function validate()
22	+ {
23	+
24	+ if ( $this->userName == null \|\| $this->userName == "" ) {
25	+ throw new PPMissingCredentialException( "username cannot be empty" );
26	+ }
27	+ if ( $this->password == null \|\| $this->password == "" ) {
28	+ throw new PPMissingCredentialException( "password cannot be empty" );
29	+ }
30	+ if ( $this->certificatePath == null \|\| $this->certificatePath == "" ) {
31	+ throw new PPMissingCredentialException( "certificate cannot be empty" );
32	+ }
33	+ if ( $this->passPhrase == null \|\| $this->passPhrase == "" ) {
34	+ throw new PPMissingCredentialException( "passphrase cannot be empty" );
35	+ }
36	+ if ( $this->applicationId == null \|\| $this->applicationId == "" ) {
37	+ throw new PPMissingCredentialException( "applicationId cannot be empty" );
38	+ }
39	+ }
40	+
41	+ public function getUserName()
42	+ {
43	+ return $this->userName;
44	+ }
45	+
46	+ public function getPassword()
47	+ {
48	+ return $this->password;
49	+ }
50	+
51	+ public function getCertificatePath()
52	+ {
53	+ if ( realpath( $this->certificatePath ) ) {
54	+ return realpath( $this->certificatePath );
55	+ } else {
56	+ return realpath( dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".." . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . $this->certificatePath );
57	+ }
58	+ }
59	+
60	+ public function getPassPhrase()
61	+ {
62	+ return $this->passPhrase;
63	+ }
64	+
65	+ public function getApplicationId()
66	+ {
67	+ return $this->applicationId;
68	+ }
69	+
70	+ }
71	+
72	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConfigManager.php ADDED Viewed

	@@ -0,0 +1,124 @@


1	+ <?php
2	+ /**
3	+ * PPConfigManager loads the SDK configuration file and
4	+ * hands out appropriate config params to other classes
5	+ */
6	+ require_once 'exceptions/PPConfigurationException.php';
7	+
8	+ class PPConfigManager
9	+ {
10	+
11	+ private $config;
12	+ /**
13	+ *
14	+ *
15	+ * @var PPConfigManager
16	+ */
17	+ private static $instance;
18	+
19	+ private function __construct()
20	+ {
21	+ $configFile = dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".."
22	+ . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . "sdk_config.ini";
23	+ $this->load( $configFile );
24	+ }
25	+
26	+ // create singleton object for PPConfigManager
27	+ public static function getInstance()
28	+ {
29	+ if ( !isset( self::$instance ) ) {
30	+ self::$instance = new PPConfigManager();
31	+ }
32	+
33	+ return self::$instance;
34	+ }
35	+
36	+ //used to load the file
37	+ private function load( $fileName )
38	+ {
39	+ if ( class_exists( 'Woocommerce' ) ) {
40	+ global $woocommerce;
41	+ $gateways = $woocommerce->payment_gateways->payment_gateways();
42	+ $settings = $gateways[ 'paypalap' ]->settings;
43	+
44	+ $mode = $settings[ 'sandbox_enabled' ];
45	+
46	+ $this->config = array(
47	+ 'acct1.UserName' => $mode == 'yes' ? $settings[ 'username' ] : $settings[ 'username_live' ],
48	+ 'acct1.Password' => $mode == 'yes' ? $settings[ 'password' ] : $settings[ 'password_live' ],
49	+ 'acct1.Signature' => $mode == 'yes' ? $settings[ 'signature' ] : $settings[ 'signature_live' ],
50	+ 'acct1.AppId' => $mode == 'yes' ? 'APP-80W284485P519543T' : $settings[ 'app_id' ],
51	+
52	+ 'service.Binding' => 'NV',
53	+ 'service.EndPoint' => $mode == 'yes' ? 'https://svcs.sandbox.paypal.com/' : 'https://svcs.paypal.com/',
54	+ 'service.RedirectURL' => $mode == 'yes' ? 'https://sandbox.paypal.com/webscr&cmd=' : 'https://paypal.com/webscr&cmd=',
55	+ 'service.DevCentralURL' => 'https://developer.paypal.com',
56	+ 'http.ConnectionTimeOut' => '30',
57	+ 'http.Retry' => '5',
58	+ 'log.FileName' => 'PayPal.log',
59	+ 'log.LogLevel' => 'INFO',
60	+ 'log.LogEnabled' => $settings[ 'logging_enabled' ] == 'yes' ? 'true' : 'false',
61	+ );
62	+ } else {
63	+ $this->config = @parse_ini_file( $fileName );
64	+ }
65	+
66	+ if ( $this->config == null \|\| count( $this->config ) == 0 ) {
67	+ throw new PPConfigurationException( "Config file $fileName not found", "303" );
68	+ }
69	+ }
70	+
71	+ /**
72	+ * simple getter for configuration params
73	+ * If an exact match for key is not found,
74	+ * does a "contains" search on the key
75	+ */
76	+ public function get( $searchKey )
77	+ {
78	+
79	+ if ( array_key_exists( $searchKey, $this->config ) ) {
80	+ return $this->config[ $searchKey ];
81	+ } else {
82	+ $arr = array();
83	+ foreach ( $this->config as $k => $v ) {
84	+ if ( strstr( $k, $searchKey ) ) {
85	+ $arr[ $k ] = $v;
86	+ }
87	+ }
88	+
89	+ return $arr;
90	+ }
91	+
92	+ }
93	+
94	+ /**
95	+ * Utility method for handling account configuration
96	+ * return config key corresponding to the API userId passed in
97	+ *
98	+ * If $userId is null, returns config keys corresponding to
99	+ * all configured accounts
100	+ */
101	+ public function getIniPrefix( $userId = null )
102	+ {
103	+
104	+ if ( $userId == null ) {
105	+ $arr = array();
106	+ foreach ( $this->config as $key => $value ) {
107	+ $pos = strpos( $key, '.' );
108	+ if ( strstr( $key, "acct" ) ) {
109	+ $arr[ ] = substr( $key, 0, $pos );
110	+ }
111	+ }
112	+
113	+ return array_unique( $arr );
114	+ } else {
115	+ $iniPrefix = array_search( $userId, $this->config );
116	+ $pos = strpos( $iniPrefix, '.' );
117	+ $acct = substr( $iniPrefix, 0, $pos );
118	+
119	+ return $acct;
120	+ }
121	+ }
122	+ }
123	+
124	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConnectionManager.php ADDED Viewed

	@@ -0,0 +1,48 @@


1	+ <?php
2	+ require_once 'PPHttpConnection.php';
3	+ require_once 'PPConfigManager.php';
4	+ class PPConnectionManager
5	+ {
6	+ /**
7	+ * reference to singleton instance
8	+ * @var PPConnectionManager
9	+ */
10	+ private static $instance;
11	+
12	+ private function __construct()
13	+ {
14	+ }
15	+
16	+ public static function getInstance()
17	+ {
18	+ if ( self::$instance == null ) {
19	+ self::$instance = new PPConnectionManager();
20	+ }
21	+
22	+ return self::$instance;
23	+ }
24	+
25	+ /**
26	+ * This function returns a new PPHttpConnection object
27	+ */
28	+ public function getConnection()
29	+ {
30	+
31	+ $connection = new PPHttpConnection();
32	+
33	+ $configMgr = PPConfigManager::getInstance();
34	+ if ( ( $configMgr->get( "http.ConnectionTimeOut" ) ) ) {
35	+ $connection->setHttpTimeout( $configMgr->get( "http.ConnectionTimeOut" ) );
36	+ }
37	+ if ( $configMgr->get( "http.Proxy" ) ) {
38	+ $connection->setHttpProxy( $configMgr->get( "http.Proxy" ) );
39	+ }
40	+ if ( $configMgr->get( "http.Retry" ) ) {
41	+ $retry = $configMgr->get( "http.Retry" );
42	+ $connection->setHttpRetry( $retry );
43	+ }
44	+
45	+ return $connection;
46	+ }
47	+
48	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCredentialManager.php ADDED Viewed

	@@ -0,0 +1,117 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'PPSignatureCredential.php';
5	+ require_once 'PPCertificateCredential.php';
6	+ require_once 'exceptions/PPInvalidCredentialException.php';
7	+
8	+ class PPCredentialManager
9	+ {
10	+
11	+ private static $instance;
12	+ //hashmap to contain credentials for accounts.
13	+ private $credentialHashmap = array();
14	+ /**
15	+ * Contains the API username of the default account to use
16	+ * when authenticating API calls.
17	+ * @var string
18	+ */
19	+ private $defaultAccountName;
20	+
21	+ /*
22	+ * Constructor initialize credential for multiple accounts specified in property file.
23	+ */
24	+ private function __construct()
25	+ {
26	+ try {
27	+ $this->initCredential();
28	+ } catch ( Exception $e ) {
29	+ $this->credentialHashmap = array();
30	+ throw $e;
31	+ }
32	+ }
33	+
34	+ /*
35	+ * Create singleton instance for this class.
36	+ */
37	+ public static function getInstance()
38	+ {
39	+ if ( !isset( self::$instance ) ) {
40	+ self::$instance = new PPCredentialManager();
41	+ }
42	+
43	+ return self::$instance;
44	+ }
45	+
46	+ /*
47	+ * Load credentials for multiple accounts, with priority given to Signature credential.
48	+ */
49	+ private function initCredential()
50	+ {
51	+ $configMgr = PPConfigManager::getInstance();
52	+ $suffix = 1;
53	+ $prefix = "acct";
54	+
55	+ $credArr = $configMgr->get( $prefix );
56	+ $arrayPartKeys = $configMgr->getIniPrefix();
57	+ if ( count( $arrayPartKeys ) == 0 )
58	+ throw new MissingCredentialException( "No valid API accounts have been configured" );
59	+
60	+ while ( in_array( $prefix . $suffix, $arrayPartKeys ) ) {
61	+
62	+ if ( isset( $credArr[ $prefix . $suffix . ".Signature" ] )
63	+ && $credArr[ $prefix . $suffix . ".Signature" ] != null && $credArr[ $prefix . $suffix . ".Signature" ] != ""
64	+ ) {
65	+
66	+ $userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
67	+ $password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
68	+ $signature = isset( $credArr[ $prefix . $suffix . '.Signature' ] ) ? $credArr[ $prefix . $suffix . '.Signature' ] : "";
69	+ $appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
70	+ $this->credentialHashmap[ $userName ] = new PPSignatureCredential( $userName, $password, $signature, $appId );
71	+
72	+ } elseif ( isset( $credArr[ $prefix . $suffix . ".CertPath" ] )
73	+ && $credArr[ $prefix . $suffix . ".CertPath" ] != null && $credArr[ $prefix . $suffix . ".CertPath" ] != ""
74	+ ) {
75	+
76	+ $userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
77	+ $password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
78	+ $passPhrase = isset( $credArr[ $prefix . $suffix . '.CertKey' ] ) ? $credArr[ $prefix . $suffix . '.CertKey' ] : "";
79	+ $certPath = isset( $credArr[ $prefix . $suffix . '.CertPath' ] ) ? $credArr[ $prefix . $suffix . '.CertPath' ] : "";
80	+ $appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
81	+ $this->credentialHashmap[ $userName ] = new PPCertificateCredential( $userName, $password, $certPath, $appId, $passPhrase );
82	+
83	+ }
84	+ if ( $this->defaultAccountName == null )
85	+ $this->defaultAccountName = $credArr[ $prefix . $suffix . '.UserName' ];
86	+ $suffix++;
87	+ }
88	+
89	+ }
90	+
91	+ /*
92	+ * Obtain Credential Object based on UserId provided.
93	+ */
94	+ public function getCredentialObject( $userId = null )
95	+ {
96	+
97	+ if ( $userId == null )
98	+ $credObj = $this->credentialHashmap[ $this->defaultAccountName ];
99	+ else if ( array_key_exists( $userId, $this->credentialHashmap ) )
100	+ $credObj = $this->credentialHashmap[ $userId ];
101	+
102	+ if ( empty( $credObj ) ) {
103	+ throw new PPInvalidCredentialException( "Invalid userId $userId" );
104	+ }
105	+
106	+ return $credObj;
107	+ }
108	+
109	+
110	+ public function __clone()
111	+ {
112	+ trigger_error( 'Clone is not allowed.', E_USER_ERROR );
113	+ }
114	+
115	+ }
116	+
117	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPHttpConnection.php ADDED Viewed

	@@ -0,0 +1,184 @@


1	+ <?php
2	+
3	+ require_once 'exceptions/PPConnectionException.php';
4	+ require_once 'exceptions/PPConfigurationException.php';
5	+ require_once 'PPLoggingManager.php';
6	+ /**
7	+ * A wrapper class based on the curl extension.
8	+ * Requires the PHP curl module to be enabled.
9	+ * See for full requirements the PHP manual: http://php.net/curl
10	+ */
11	+
12	+
13	+ class PPHttpConnection
14	+ {
15	+
16	+ const HTTP_GET = 'GET';
17	+ const HTTP_POST = 'POST';
18	+
19	+ /**
20	+ * curl options to be set for the request
21	+ */
22	+ private $curlOpt = array();
23	+
24	+ /**
25	+ * Number of times a retry must be attempted on getting an HTTP error
26	+ * @var integer
27	+ */
28	+ private $retry;
29	+
30	+ /**
31	+ * HTTP status codes for which a retry must be attempted
32	+ */
33	+ private static $retryCodes = array( '401', '403', '404', );
34	+
35	+ private $logger;
36	+
37	+
38	+ /**
39	+ * Some default options for curl
40	+ * These are typically overridden by PPConnectionManager
41	+ */
42	+ public static $DEFAULT_CURL_OPTS = array(
43	+ CURLOPT_CONNECTTIMEOUT => 10,
44	+ CURLOPT_RETURNTRANSFER => true,
45	+ CURLOPT_TIMEOUT => 60, // maximum number of seconds to allow cURL functions to execute
46	+ CURLOPT_USERAGENT => 'PayPal-PHP-SDK',
47	+ CURLOPT_POST => 1,
48	+ CURLOPT_HTTPHEADER => array(),
49	+ CURLOPT_SSL_VERIFYHOST => 2,
50	+ CURLOPT_SSL_VERIFYPEER => 2
51	+ );
52	+
53	+ public function __construct()
54	+ {
55	+ if ( !function_exists( "curl_init" ) ) {
56	+ throw new PPConfigurationException( "Curl module is not available on this system" );
57	+ }
58	+ $this->curlOpt = self::$DEFAULT_CURL_OPTS;
59	+ $this->logger = new PPLoggingManager( __CLASS__ );
60	+ }
61	+
62	+ /**
63	+ * Set ssl parameters for certificate based client authentication
64	+ *
65	+ * @param string $certPath - path to client certificate file (PEM formatted file)
66	+ */
67	+ public function setSSLCert( $certPath, $passPhrase )
68	+ {
69	+ $this->curlOpt[ CURLOPT_SSLCERT ] = realpath( $certPath );
70	+ $this->curlOpt[ CURLOPT_SSLCERTPASSWD ] = $passPhrase;
71	+ }
72	+
73	+ /**
74	+ * Set connection timeout in seconds
75	+ *
76	+ * @param integer $timeout
77	+ */
78	+ public function setHttpTimeout( $timeout )
79	+ {
80	+ $this->curlOpt[ CURLOPT_CONNECTTIMEOUT ] = $timeout;
81	+ }
82	+
83	+ /**
84	+ * Set HTTP proxy information
85	+ *
86	+ * @param string $proxy
87	+ *
88	+ * @throws PPConfigurationException
89	+ */
90	+ public function setHttpProxy( $proxy )
91	+ {
92	+ $urlParts = parse_url( $proxy );
93	+ if ( $urlParts == false \|\| !array_key_exists( "host", $urlParts ) )
94	+ throw new PPConfigurationException( "Invalid proxy configuration " . $proxy );
95	+
96	+ $this->curlOpt[ CURLOPT_PROXY ] = $urlParts[ "host" ];
97	+ if ( isset( $urlParts[ "port" ] ) )
98	+ $this->curlOpt[ CURLOPT_PROXY ] .= ":" . $urlParts[ "port" ];
99	+ if ( isset( $urlParts[ "user" ] ) )
100	+ $this->curlOpt[ URLOPT_PROXYUSERPWD ] = $urlParts[ "user" ] . ":" . $urlParts[ "pass" ];
101	+ }
102	+
103	+ public function setHttpHeaders( $headers )
104	+ {
105	+ $this->curlOpt[ CURLOPT_HTTPHEADER ] = $headers;
106	+ }
107	+
108	+ /**
109	+ * @param integer $retry
110	+ */
111	+ public function setHttpRetry( $retry )
112	+ {
113	+ $this->retry = $retry;
114	+ }
115	+
116	+ /**
117	+ * Executes an HTTP request
118	+ *
119	+ * @param string $url
120	+ * @param string $params query string OR POST content as a string
121	+ * @param array $headers array of HTTP headers to be added to existing headers
122	+ * @param string $method HTTP method (GET, POST etc) defaults to POST
123	+ *
124	+ * @throws PPConnectionException
125	+ */
126	+ public function execute( $url, $params, $headers = null, $method = null )
127	+ {
128	+
129	+ $ch = curl_init( $url );
130	+
131	+ $this->curlOpt[ CURLOPT_POSTFIELDS ] = $params;
132	+ $this->curlOpt[ CURLOPT_URL ] = $url;
133	+ $this->curlOpt[ CURLOPT_HEADER ] = false;
134	+ if ( isset( $headers ) ) {
135	+ $this->curlOpt[ CURLOPT_HTTPHEADER ] = array_merge( $this->curlOpt[ CURLOPT_HTTPHEADER ], $headers );
136	+ }
137	+ foreach ( $this->curlOpt[ CURLOPT_HTTPHEADER ] as $header ) {
138	+ //TODO: Strip out credentials when logging.
139	+ $this->logger->info( "Adding header $header" );
140	+ }
141	+ if ( isset( $method ) ) {
142	+ $this->curlOpt[ CURLOPT_CUSTOMREQUEST ] = $method;
143	+ }
144	+
145	+ // curl_setopt_array available only in PHP 5 >= 5.1.3
146	+ curl_setopt_array( $ch, $this->curlOpt );
147	+
148	+ $result = curl_exec( $ch );
149	+
150	+ if ( curl_errno( $ch ) == 60 ) {
151	+ $this->logger->info( "Invalid or no certificate authority found, retrying using bundled CA certs" );
152	+ curl_setopt( $ch, CURLOPT_CAINFO,
153	+ dirname( __FILE__ ) . '/cacert.pem' );
154	+ $result = curl_exec( $ch );
155	+ }
156	+ $httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
157	+ $retries = 0;
158	+ if ( in_array( $httpStatus, self::$retryCodes ) && isset( $this->retry ) ) {
159	+ $this->logger->info( "Got $httpStatus response from server. Retrying" );
160	+
161	+ do {
162	+ $result = curl_exec( $ch );
163	+ $httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
164	+
165	+ } while ( in_array( $httpStatus, self::$retryCodes ) && ++$retries < $this->retry );
166	+
167	+
168	+ }
169	+ if ( curl_errno( $ch ) ) {
170	+ $ex = new PPConnectionException( $url, curl_error( $ch ), curl_errno( $ch ) );
171	+ curl_close( $ch );
172	+ throw $ex;
173	+ }
174	+
175	+ curl_close( $ch );
176	+
177	+ if ( in_array( $httpStatus, self::$retryCodes ) ) {
178	+ throw new PPConnectionException( $url, "Retried " . $retries . " times, Http Response code " . $httpStatus );
179	+ }
180	+
181	+ return $result;
182	+ }
183	+
184	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPLoggingManager.php ADDED Viewed

	@@ -0,0 +1,84 @@


1	+ <?php
2	+
3	+ /**
4	+ * Simple Logging Manager.
5	+ * This does an error_log for now
6	+ * Potential frameworks to use are PEAR logger, log4php from Apache
7	+ */
8	+
9	+ class PPLoggingLevel
10	+ {
11	+
12	+ // FINE Logging Level
13	+ const FINE = 3;
14	+
15	+ // INFO Logging Level
16	+ const INFO = 2;
17	+
18	+ // WARN Logging Level
19	+ const WARN = 1;
20	+
21	+ // ERROR Logging Level
22	+ const ERROR = 0;
23	+ }
24	+
25	+ class PPLoggingManager
26	+ {
27	+
28	+ // Default Logging Level
29	+ const DEFAULT_LOGGING_LEVEL = 0;
30	+
31	+ // Logger name
32	+ private $loggerName;
33	+
34	+ // Log enabled
35	+ private $isLoggingEnabled;
36	+
37	+ // Configured logging level
38	+ private $loggingLevel;
39	+
40	+ // Configured logging file
41	+ private $loggerFile;
42	+
43	+ public function __construct( $loggerName )
44	+ {
45	+ $this->loggerName = $loggerName;
46	+ $config = PPConfigManager::getInstance();
47	+ $this->loggerFile = ( $config->get( 'log.FileName' ) ) ? $config->get( 'log.FileName' ) : ini_get( 'error_log' );
48	+ $loggingEnabled = $config->get( 'log.LogEnabled' );
49	+ $this->isLoggingEnabled = ( isset( $loggingEnabled ) ) ? $loggingEnabled : false;
50	+ $loggingLevel = strtoupper( $config->get( 'log.LogLevel' ) );
51	+ $this->loggingLevel = ( isset( $loggingLevel ) && defined( "PPLoggingLevel::$loggingLevel" ) ) ? constant( "PPLoggingLevel::$loggingLevel" ) : PPLoggingManager::DEFAULT_LOGGING_LEVEL;
52	+
53	+ }
54	+
55	+ public function log( $message, $level = PPLoggingLevel::INFO )
56	+ {
57	+ if ( $this->isLoggingEnabled && ( $level <= $this->loggingLevel ) ) {
58	+ error_log( $this->loggerName . ": $message\n" );
59	+ }
60	+ }
61	+
62	+ public function error( $message )
63	+ {
64	+ $this->log( $message, PPLoggingLevel::ERROR );
65	+ }
66	+
67	+ public function warning( $message )
68	+ {
69	+ $this->log( $message, PPLoggingLevel::WARN );
70	+ }
71	+
72	+ public function info( $message )
73	+ {
74	+ $this->log( $message, PPLoggingLevel::INFO );
75	+ }
76	+
77	+ public function fine( $message )
78	+ {
79	+ $this->log( $message, PPLoggingLevel::FINE );
80	+ }
81	+
82	+ }
83	+
84	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPObjectTransformer.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * Utility class for transforming PHP objects into
4	+ * appropriate service payload type and vice versa
5	+ */
6	+ class PPObjectTransformer
7	+ {
8	+
9	+ public function toString( $object )
10	+ {
11	+
12	+ if ( $object == null ) {
13	+ throw new PPTransformerException( "Empty object" );
14	+ }
15	+
16	+ $confManager = PPConfigManager::getInstance();
17	+ switch ( strtoupper( $confManager->get( "service.Binding" ) ) ) {
18	+ case 'SOAP':
19	+ return $object->toXMLString();
20	+
21	+ case 'XML':
22	+ case 'JSON':
23	+ return "";
24	+ case 'NVP':
25	+ default:
26	+ return $object->toNVPString();
27	+ }
28	+ }
29	+
30	+
31	+ }
32	+
33	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPSignatureCredential.php ADDED Viewed

	@@ -0,0 +1,49 @@


1	+ <?php
2	+
3	+ require_once 'exceptions/PPMissingCredentialException.php';
4	+ require_once 'IPPCredential.php';
5	+ require_once 'PPConfigManager.php';
6	+
7	+ /**
8	+ * API signature based credentials
9	+ */
10	+ class PPSignatureCredential extends IPPCredential
11	+ {
12	+
13	+ /**
14	+ * API Signature
15	+ * @var string
16	+ */
17	+ private $signature;
18	+
19	+ public function __construct( $userName, $password, $signature, $appId )
20	+ {
21	+ parent::__construct( $userName, $password, $appId );
22	+ $this->signature = $signature;
23	+ $this->validate();
24	+ }
25	+
26	+ public function validate()
27	+ {
28	+
29	+ if ( $this->userName == null \|\| $this->userName == "" ) {
30	+ throw new PPMissingCredentialException( "username cannot be empty" );
31	+ }
32	+ if ( $this->password == null \|\| $this->password == "" ) {
33	+ throw new PPMissingCredentialException( "password cannot be empty" );
34	+ }
35	+ if ( $this->signature == null \|\| $this->signature == "" ) {
36	+ throw new PPMissingCredentialException( "signature cannot be empty" );
37	+ }
38	+ if ( $this->applicationId == null \|\| $this->applicationId == "" ) {
39	+ throw new PPMissingCredentialException( "applicationId cannot be empty" );
40	+ }
41	+ }
42	+
43	+ public function getSignature()
44	+ {
45	+ return $this->signature;
46	+ }
47	+ }
48	+
49	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPUtils.php ADDED Viewed

	@@ -0,0 +1,274 @@


1	+ <?php
2	+ class PPUtils
3	+ {
4	+
5	+ const SDK_VERSION = "1.2.95";
6	+ const SDK_NAME = "sdk-adaptivepayments-php ";
7	+
8	+ /**
9	+ *
10	+ * Convert a Name Value Pair (NVP) formatted string into
11	+ * an associative array taking care to urldecode array values
12	+ *
13	+ * @param string $nvpString
14	+ */
15	+ public static function nvpToMap( $nvpString )
16	+ {
17	+
18	+ $ret = array();
19	+ $params = explode( "&", $nvpString );
20	+ foreach ( $params as $p ) {
21	+ list( $k, $v ) = explode( "=", $p );
22	+ $ret[ $k ] = urldecode( $v );
23	+ }
24	+
25	+ return $ret;
26	+ }
27	+
28	+ /**
29	+ * Returns true if the array contains a key like $key
30	+ *
31	+ * @param array $map
32	+ * @param regex $key
33	+ */
34	+ public static function array_match_key( $map, $key )
35	+ {
36	+ $key = str_replace( "(", "\(", $key );
37	+ $key = str_replace( ")", "\)", $key );
38	+ $key = str_replace( ".", "\.", $key );
39	+ $pattern = "/$key*/";
40	+ foreach ( $map as $k => $v ) {
41	+ preg_match( $pattern, $k, $matches );
42	+ if ( count( $matches ) > 0 )
43	+ return true;
44	+ }
45	+
46	+ return false;
47	+ }
48	+
49	+ /**
50	+ *
51	+ * Get the local IP address. The client address is a required
52	+ * request parameter for some API calls
53	+ */
54	+ public static function getLocalIPAddress()
55	+ {
56	+
57	+ if ( array_key_exists( "SERVER_ADDR", $_SERVER ) ) {
58	+ // SERVER_ADDR is available only if we are running the CGI SAPI
59	+ return $_SERVER[ 'SERVER_ADDR' ];
60	+ } else if ( function_exists( "gethostname" ) ) {
61	+ // gethostname is available only in PHP >= v5.3
62	+ return gethostbyname( gethostname() );
63	+ } else {
64	+ // fallback if nothing works
65	+ return "127.0.0.1";
66	+ }
67	+ }
68	+
69	+ /**
70	+ *
71	+ * Compute the value that needs to sent for the PAYPAL_REQUEST_SOURCE
72	+ * parameter when making API calls
73	+ */
74	+ public static function getRequestSource()
75	+ {
76	+ return str_replace( " ", "_", self::SDK_NAME ) . self::SDK_VERSION;
77	+ }
78	+
79	+ public static function xmlToArray( $xmlInput )
80	+ {
81	+
82	+ $xml = simplexml_load_string( $xmlInput );
83	+
84	+ $ns = $xml->getNamespaces( true );
85	+
86	+ $soap = $xml->children( $ns[ 'SOAP-ENV' ] );
87	+ $getChild = $soap->Body->children();
88	+
89	+ $ret = PPUtils::convertXmlObjToArr( $getChild, $array = array() );
90	+
91	+ return $ret;
92	+ }
93	+
94	+ /*foreach ($ret as $arry)
95	+ {
96	+ if (isset($arry['children']) && is_array($arry['children'])&& ($arry['children'])!=null) {
97	+ foreach ($arry['children'] as $novel)
98	+ {
99	+
100	+ }
101	+ }
102	+ else if ($arry['name'] != null)
103	+ {
104	+ $a = $arry['name'] ;
105	+ $b= $arry['text'];
106	+ if (isset($arry['attribute']))
107	+ {
108	+ $c = $arry['attribute'];
109	+ }
110	+ }
111	+
112	+
113	+ }*/
114	+
115	+ /*public function xml2array ( $xmlObject, $out = array () )
116	+ {
117	+ foreach ( (array) $xmlObject as $index => $node )
118	+ {
119	+ $out[$index] = ( is_object ( $node ) ) ? PPUtils::xml2array ( $node ) : $node;
120	+ }
121	+ return $out;
122	+ }*/
123	+
124	+
125	+ function convertXmlObjToArr( $obj, &$arr )
126	+ {
127	+ $children = $obj->children();
128	+ foreach ( $children as $elementName => $node ) {
129	+ $nextIdx = count( $arr );
130	+ $arr[ $nextIdx ] = array();
131	+ $arr[ $nextIdx ][ 'name' ] = strtolower( (string) $elementName );
132	+ $arr[ $nextIdx ][ 'attributes' ] = array();
133	+ $attributes = $node->attributes();
134	+ foreach ( $attributes as $attributeName => $attributeValue ) {
135	+ $attribName = strtolower( trim( (string) $attributeName ) );
136	+ $attribVal = trim( (string) $attributeValue );
137	+ $arr[ $nextIdx ][ 'attributes' ][ $attribName ] = $attribVal;
138	+ }
139	+ $text = (string) $node;
140	+ $text = trim( $text );
141	+ if ( strlen( $text ) > 0 ) {
142	+ $arr[ $nextIdx ][ 'text' ] = $text;
143	+ }
144	+ $arr[ $nextIdx ][ 'children' ] = array();
145	+ PPutils::convertXmlObjToArr( $node, $arr[ $nextIdx ][ 'children' ] );
146	+ }
147	+
148	+ return $arr;
149	+ }
150	+
151	+ }
152	+
153	+ /**
154	+ * @class xml2array
155	+ */
156	+
157	+
158	+ /**
159	+ * XMLToArray Generator Class
160	+ * @author : MA Razzaque Rupom <rupom_315@yahoo.com>, <rupom.bd@gmail.com>
161	+ * Moderator, phpResource (LINK1http://groups.yahoo.com/group/phpresource/LINK1)
162	+ * URL: LINK2http://www.rupom.infoLINK2
163	+ * @version : 1.0
164	+ * @date 06/05/2006
165	+ * Purpose : Creating Hierarchical Array from XML Data
166	+ * Released : Under GPL
167	+ */
168	+
169	+ class XmlToArray
170	+ {
171	+
172	+ var $xml = '';
173	+
174	+ /**
175	+ * Default Constructor
176	+ *
177	+ * @param $xml = xml data
178	+ *
179	+ * @return none
180	+ */
181	+
182	+ function XmlToArray( $xml )
183	+ {
184	+ $this->xml = $xml;
185	+ }
186	+
187	+ /**
188	+ * _struct_to_array($values, &$i)
189	+ *
190	+ * This is adds the contents of the return xml into the array for easier processing.
191	+ * Recursive, Static
192	+ *
193	+ * @access private
194	+ *
195	+ * @param array $values this is the xml data in an array
196	+ * @param int $i this is the current location in the array
197	+ *
198	+ * @return Array
199	+ */
200	+
201	+ function _struct_to_array( $values, &$i )
202	+ {
203	+ $child = array();
204	+ if ( isset( $values[ $i ][ 'value' ] ) ) array_push( $child, $values[ $i ][ 'value' ] );
205	+
206	+ while ( $i++ < count( $values ) ) {
207	+ switch ( $values[ $i ][ 'type' ] ) {
208	+ case 'cdata':
209	+ array_push( $child, $values[ $i ][ 'value' ] );
210	+ break;
211	+
212	+ case 'complete':
213	+ $name = $values[ $i ][ 'tag' ];
214	+ if ( !empty( $name ) ) {
215	+ $child[ $name ] = ( $values[ $i ][ 'value' ] ) ? ( $values[ $i ][ 'value' ] ) : '';
216	+ if ( isset( $values[ $i ][ 'attributes' ] ) ) {
217	+ $child[ $name ] = $values[ $i ][ 'attributes' ];
218	+ }
219	+ }
220	+ break;
221	+
222	+ case 'open':
223	+ $name = $values[ $i ][ 'tag' ];
224	+ $size = isset( $child[ $name ] ) ? sizeof( $child[ $name ] ) : 0;
225	+ $child[ $name ][ $size ] = $this->_struct_to_array( $values, $i );
226	+ break;
227	+
228	+ case 'close':
229	+ return $child;
230	+ break;
231	+ }
232	+ }
233	+
234	+ return $child;
235	+ }
236	+
237	+ //_struct_to_array
238	+
239	+ /**
240	+ * createArray($data)
241	+ *
242	+ * This is adds the contents of the return xml into the array for easier processing.
243	+ *
244	+ * @access public
245	+ *
246	+ * @param string $data this is the string of the xml data
247	+ *
248	+ * @return Array
249	+ */
250	+ function createArray()
251	+ {
252	+ $xml = $this->xml;
253	+ $values = array();
254	+ $index = array();
255	+ $array = array();
256	+ $parser = xml_parser_create();
257	+ xml_parser_set_option( $parser, XML_OPTION_SKIP_WHITE, 1 );
258	+ xml_parser_set_option( $parser, XML_OPTION_CASE_FOLDING, 0 );
259	+ xml_parse_into_struct( $parser, $xml, $values, $index );
260	+ xml_parser_free( $parser );
261	+ $i = 0;
262	+ $name = $values[ $i ][ 'tag' ];
263	+ $array[ $name ] = isset( $values[ $i ][ 'attributes' ] ) ? $values[ $i ][ 'attributes' ] : '';
264	+ $array[ $name ] = $this->_struct_to_array( $values, $i );
265	+
266	+ return $array;
267	+ }
268	+ //createArray
269	+
270	+
271	+ }
272	+
273	+ //XmlToArray
274	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/AuthUtil.php ADDED Viewed

	@@ -0,0 +1,83 @@


1	+ <?php //vim: foldmethod=marker
2	+
3	+ class MockOAuthDataStore extends OAuthDataStore
4	+ { /{{{/
5	+ private $consumer;
6	+ private $request_token;
7	+ private $access_token;
8	+ private $nonce;
9	+
10	+ function __construct()
11	+ { /{{{/
12	+ $this->consumer = new OAuthConsumer( "key", "secret", null );
13	+ $this->request_token = new OAuthToken( "requestkey", "requestsecret", 1 );
14	+ $this->access_token = new OAuthToken( "accesskey", "accesssecret", 1 );
15	+ $this->nonce = "nonce";
16	+ }
17	+
18	+ /}}}/
19	+
20	+ function lookup_consumer( $consumer_key )
21	+ { /{{{/
22	+ if ( $consumer_key == $this->consumer->key ) return $this->consumer;
23	+
24	+ return null;
25	+ }
26	+
27	+ /}}}/
28	+
29	+ function lookup_token( $consumer, $token_type, $token )
30	+ { /{{{/
31	+ $token_attrib = $token_type . "_token";
32	+ if ( $consumer->key == $this->consumer->key
33	+ && $token == $this->$token_attrib->key
34	+ ) {
35	+ return $this->$token_attrib;
36	+ }
37	+
38	+ return null;
39	+ }
40	+
41	+ /}}}/
42	+
43	+ function lookup_nonce( $consumer, $token, $nonce, $timestamp )
44	+ { /{{{/
45	+ if ( $consumer->key == $this->consumer->key
46	+ && ( ( $token && $token->key == $this->request_token->key )
47	+ \|\| ( $token && $token->key == $this->access_token->key ) )
48	+ && $nonce == $this->nonce
49	+ ) {
50	+ return $this->nonce;
51	+ }
52	+
53	+ return null;
54	+ }
55	+
56	+ /}}}/
57	+
58	+ function new_request_token( $consumer, $callback = null )
59	+ { /{{{/
60	+ if ( $consumer->key == $this->consumer->key ) {
61	+ return $this->request_token;
62	+ }
63	+
64	+ return null;
65	+ }
66	+
67	+ /}}}/
68	+
69	+ function new_access_token( $token, $consumer, $verifier = null )
70	+ { /{{{/
71	+ if ( $consumer->key == $this->consumer->key
72	+ && $token->key == $this->request_token->key
73	+ ) {
74	+ return $this->access_token;
75	+ }
76	+
77	+ return null;
78	+ }
79	+ /}}}/
80	+ }
81	+
82	+ /}}}/
83	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/PPAuth.php ADDED Viewed

	@@ -0,0 +1,1077 @@


1	+ <?php
2	+ //PayPal specific modification ends
3	+ /* Generic exception class
4	+ */
5	+ if ( !class_exists( 'OAuthException' ) ) {
6	+ class OAuthException extends Exception
7	+ {
8	+ // pass
9	+ }
10	+ }
11	+
12	+ if ( !class_exists( 'OAuthConsumer' ) ) {
13	+ class OAuthConsumer
14	+ {
15	+ public $key;
16	+ public $secret;
17	+
18	+ function __construct( $key, $secret, $callback_url = null )
19	+ {
20	+ $this->key = $key;
21	+ $this->secret = $secret;
22	+ $this->callback_url = $callback_url;
23	+ }
24	+
25	+ function __toString()
26	+ {
27	+ return "OAuthConsumer[key=$this->key,secret=$this->secret]";
28	+ }
29	+ }
30	+ }
31	+
32	+ if ( !class_exists( 'OAuthToken' ) ) {
33	+ class OAuthToken
34	+ {
35	+ // access tokens and request tokens
36	+ public $key;
37	+ public $secret;
38	+
39	+ /**
40	+ * key = the token
41	+ * secret = the token secret
42	+ */
43	+ function __construct( $key, $secret )
44	+ {
45	+ $this->key = $key;
46	+ $this->secret = $secret;
47	+ }
48	+
49	+ /**
50	+ * generates the basic string serialization of a token that a server
51	+ * would respond to request_token and access_token calls with
52	+ */
53	+ function to_string()
54	+ {
55	+ return "oauth_token=" .
56	+ OAuthUtil::urlencode_rfc3986( $this->key ) .
57	+ "&oauth_token_secret=" .
58	+ OAuthUtil::urlencode_rfc3986( $this->secret );
59	+ }
60	+
61	+ function __toString()
62	+ {
63	+ return $this->to_string();
64	+ }
65	+ }
66	+ }
67	+
68	+ /**
69	+ * A class for implementing a Signature Method
70	+ * See section 9 ("Signing Requests") in the spec
71	+ */
72	+ if ( !class_exists( 'OAuthSignatureMethod' ) ) {
73	+ abstract class OAuthSignatureMethod
74	+ {
75	+ /**
76	+ * Needs to return the name of the Signature Method (ie HMAC-SHA1)
77	+ * @return string
78	+ */
79	+ abstract public function get_name();
80	+
81	+ /**
82	+ * Build up the signature
83	+ * NOTE: The output of this function MUST NOT be urlencoded.
84	+ * the encoding is handled in OAuthRequest when the final
85	+ * request is serialized
86	+ *
87	+ * @param OAuthRequest $request
88	+ * @param OAuthConsumer $consumer
89	+ * @param OAuthToken $token
90	+ *
91	+ * @return string
92	+ */
93	+ abstract public function build_signature( $request, $consumer, $token );
94	+
95	+ /**
96	+ * Verifies that a given signature is correct
97	+ *
98	+ * @param OAuthRequest $request
99	+ * @param OAuthConsumer $consumer
100	+ * @param OAuthToken $token
101	+ * @param string $signature
102	+ *
103	+ * @return bool
104	+ */
105	+ public function check_signature( $request, $consumer, $token, $signature )
106	+ {
107	+ $built = $this->build_signature( $request, $consumer, $token );
108	+
109	+ return $built == $signature;
110	+ }
111	+ }
112	+ }
113	+
114	+ /**
115	+ * The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
116	+ * where the Signature Base String is the text and the key is the concatenated values (each first
117	+ * encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
118	+ * character (ASCII code 38) even if empty.
119	+ * - Chapter 9.2 ("HMAC-SHA1")
120	+ */
121	+ if ( !class_exists( 'OAuthSignatureMethod_HMAC_SHA1' ) ) {
122	+ class OAuthSignatureMethod_HMAC_SHA1 extends OAuthSignatureMethod
123	+ {
124	+ function get_name()
125	+ {
126	+ return "HMAC-SHA1";
127	+ }
128	+
129	+ public function build_signature( $request, $consumer, $token )
130	+ {
131	+ $base_string = $request->get_signature_base_string();
132	+ $base_string = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $base_string ); //convert base string to lowercase
133	+ $request->base_string = $base_string;
134	+
135	+ $key_parts = array(
136	+ $consumer->secret,
137	+ ( $token ) ? $token->secret : ""
138	+ );
139	+
140	+ $key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
141	+ $key = implode( '&', $key_parts );
142	+ $key = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $key ); //convert to lowercase
143	+ return base64_encode( hash_hmac( 'sha1', $base_string, $key, true ) );
144	+ }
145	+ }
146	+ }
147	+ /**
148	+ * The PLAINTEXT method does not provide any security protection and SHOULD only be used
149	+ * over a secure channel such as HTTPS. It does not use the Signature Base String.
150	+ * - Chapter 9.4 ("PLAINTEXT")
151	+ */
152	+ if ( !class_exists( 'OAuthSignatureMethod_PLAINTEXT' ) ) {
153	+ class OAuthSignatureMethod_PLAINTEXT extends OAuthSignatureMethod
154	+ {
155	+ public function get_name()
156	+ {
157	+ return "PLAINTEXT";
158	+ }
159	+
160	+ /**
161	+ * oauth_signature is set to the concatenated encoded values of the Consumer Secret and
162	+ * Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
163	+ * empty. The result MUST be encoded again.
164	+ * - Chapter 9.4.1 ("Generating Signatures")
165	+ *
166	+ * Please note that the second encoding MUST NOT happen in the SignatureMethod, as
167	+ * OAuthRequest handles this!
168	+ */
169	+ public function build_signature( $request, $consumer, $token )
170	+ {
171	+ $key_parts = array(
172	+ $consumer->secret,
173	+ ( $token ) ? $token->secret : ""
174	+ );
175	+
176	+ $key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
177	+ $key = implode( '&', $key_parts );
178	+ $request->base_string = $key;
179	+
180	+ return $key;
181	+ }
182	+ }
183	+ }
184	+ /**
185	+ * The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
186	+ * [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
187	+ * EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
188	+ * verified way to the Service Provider, in a manner which is beyond the scope of this
189	+ * specification.
190	+ * - Chapter 9.3 ("RSA-SHA1")
191	+ */
192	+ if ( !class_exists( 'OAuthSignatureMethod_RSA_SHA1' ) ) {
193	+ abstract class OAuthSignatureMethod_RSA_SHA1 extends OAuthSignatureMethod
194	+ {
195	+ public function get_name()
196	+ {
197	+ return "RSA-SHA1";
198	+ }
199	+
200	+ // Up to the SP to implement this lookup of keys. Possible ideas are:
201	+ // (1) do a lookup in a table of trusted certs keyed off of consumer
202	+ // (2) fetch via http using a url provided by the requester
203	+ // (3) some sort of specific discovery code based on request
204	+ //
205	+ // Either way should return a string representation of the certificate
206	+ protected abstract function fetch_public_cert( &$request );
207	+
208	+ // Up to the SP to implement this lookup of keys. Possible ideas are:
209	+ // (1) do a lookup in a table of trusted certs keyed off of consumer
210	+ //
211	+ // Either way should return a string representation of the certificate
212	+ protected abstract function fetch_private_cert( &$request );
213	+
214	+ public function build_signature( $request, $consumer, $token )
215	+ {
216	+ $base_string = $request->get_signature_base_string();
217	+ $request->base_string = $base_string;
218	+
219	+ // Fetch the private key cert based on the request
220	+ $cert = $this->fetch_private_cert( $request );
221	+
222	+ // Pull the private key ID from the certificate
223	+ $privatekeyid = openssl_get_privatekey( $cert );
224	+
225	+ // Sign using the key
226	+ $ok = openssl_sign( $base_string, $signature, $privatekeyid );
227	+
228	+ // Release the key resource
229	+ openssl_free_key( $privatekeyid );
230	+
231	+ return base64_encode( $signature );
232	+ }
233	+
234	+ public function check_signature( $request, $consumer, $token, $signature )
235	+ {
236	+ $decoded_sig = base64_decode( $signature );
237	+
238	+ $base_string = $request->get_signature_base_string();
239	+
240	+ // Fetch the public key cert based on the request
241	+ $cert = $this->fetch_public_cert( $request );
242	+
243	+ // Pull the public key ID from the certificate
244	+ $publickeyid = openssl_get_publickey( $cert );
245	+
246	+ // Check the computed signature against the one passed in the query
247	+ $ok = openssl_verify( $base_string, $decoded_sig, $publickeyid );
248	+
249	+ // Release the key resource
250	+ openssl_free_key( $publickeyid );
251	+
252	+ return $ok == 1;
253	+ }
254	+ }
255	+ }
256	+
257	+ if ( !class_exists( 'OAuthRequest' ) ) {
258	+ class OAuthRequest
259	+ {
260	+ public $parameters;
261	+ protected $http_method;
262	+ protected $http_url;
263	+ // for debug purposes
264	+ public $base_string;
265	+ public static $version = '1.0';
266	+ public static $POST_INPUT = 'php://input';
267	+
268	+ function __construct( $http_method, $http_url, $parameters = null )
269	+ {
270	+ $parameters = ( $parameters ) ? $parameters : array();
271	+ $parameters = array_merge( OAuthUtil::parse_parameters( parse_url( $http_url, PHP_URL_QUERY ) ), $parameters );
272	+ $this->parameters = $parameters;
273	+ $this->http_method = $http_method;
274	+ $this->http_url = $http_url;
275	+ }
276	+
277	+
278	+ /**
279	+ * attempt to build up a request from what was passed to the server
280	+ */
281	+ public static function from_request( $http_method = null, $http_url = null, $parameters = null )
282	+ {
283	+ $scheme = ( !isset( $_SERVER[ 'HTTPS' ] ) \|\| $_SERVER[ 'HTTPS' ] != "on" )
284	+ ? 'http'
285	+ : 'https';
286	+ $http_url = ( $http_url ) ? $http_url : $scheme .
287	+ '://' . $_SERVER[ 'HTTP_HOST' ] .
288	+ ':' .
289	+ $_SERVER[ 'SERVER_PORT' ] .
290	+ $_SERVER[ 'REQUEST_URI' ];
291	+ $http_method = ( $http_method ) ? $http_method : $_SERVER[ 'REQUEST_METHOD' ];
292	+
293	+ // We weren't handed any parameters, so let's find the ones relevant to
294	+ // this request.
295	+ // If you run XML-RPC or similar you should use this to provide your own
296	+ // parsed parameter-list
297	+ if ( !$parameters ) {
298	+ // Find request headers
299	+ $request_headers = OAuthUtil::get_headers();
300	+
301	+ // Parse the query-string to find GET parameters
302	+ $parameters = OAuthUtil::parse_parameters( $_SERVER[ 'QUERY_STRING' ] );
303	+
304	+ // It's a POST request of the proper content-type, so parse POST
305	+ // parameters and add those overriding any duplicates from GET
306	+ if ( $http_method == "POST"
307	+ && isset( $request_headers[ 'Content-Type' ] )
308	+ && strstr( $request_headers[ 'Content-Type' ],
309	+ 'application/x-www-form-urlencoded' )
310	+ ) {
311	+ $post_data = OAuthUtil::parse_parameters(
312	+ file_get_contents( self::$POST_INPUT )
313	+ );
314	+ $parameters = array_merge( $parameters, $post_data );
315	+ }
316	+
317	+ // We have a Authorization-header with OAuth data. Parse the header
318	+ // and add those overriding any duplicates from GET or POST
319	+ if ( isset( $request_headers[ 'Authorization' ] ) && substr( $request_headers[ 'Authorization' ], 0, 6 ) == 'OAuth ' ) {
320	+ $header_parameters = OAuthUtil::split_header(
321	+ $request_headers[ 'Authorization' ]
322	+ );
323	+ $parameters = array_merge( $parameters, $header_parameters );
324	+ }
325	+
326	+ }
327	+
328	+ return new OAuthRequest( $http_method, $http_url, $parameters );
329	+ }
330	+
331	+ /**
332	+ * pretty much a helper function to set up the request
333	+ */
334	+ public static function from_consumer_and_token( $consumer, $token, $http_method, $http_url, $parameters = null )
335	+ {
336	+ $parameters = ( $parameters ) ? $parameters : array();
337	+ $defaults = array(
338	+ "oauth_version" => OAuthRequest::$version,
339	+ // "oauth_nonce" => OAuthRequest::generate_nonce(),
340	+ "oauth_timestamp" => OAuthRequest::generate_timestamp(),
341	+
342	+ "oauth_consumer_key" => $consumer->key
343	+ );
344	+ if ( $token )
345	+ $defaults[ 'oauth_token' ] = $token->key;
346	+
347	+ $parameters = array_merge( $defaults, $parameters );
348	+ ksort( $parameters );
349	+
350	+ return new OAuthRequest( $http_method, $http_url, $parameters );
351	+ }
352	+
353	+ public function set_parameter( $name, $value, $allow_duplicates = true )
354	+ {
355	+ if ( $allow_duplicates && isset( $this->parameters[ $name ] ) ) {
356	+ // We have already added parameter(s) with this name, so add to the list
357	+ if ( is_scalar( $this->parameters[ $name ] ) ) {
358	+ // This is the first duplicate, so transform scalar (string)
359	+ // into an array so we can add the duplicates
360	+ $this->parameters[ $name ] = array( $this->parameters[ $name ] );
361	+ }
362	+
363	+ $this->parameters[ $name ][ ] = $value;
364	+ } else {
365	+ $this->parameters[ $name ] = $value;
366	+ }
367	+ }
368	+
369	+ public function get_parameter( $name )
370	+ {
371	+ return isset( $this->parameters[ $name ] ) ? $this->parameters[ $name ] : null;
372	+ }
373	+
374	+ public function get_parameters()
375	+ {
376	+ return $this->parameters;
377	+ }
378	+
379	+ public function unset_parameter( $name )
380	+ {
381	+ unset( $this->parameters[ $name ] );
382	+ }
383	+
384	+ /**
385	+ * The request parameters, sorted and concatenated into a normalized string.
386	+ * @return string
387	+ */
388	+ public function get_signable_parameters()
389	+ {
390	+ // Grab all parameters
391	+ $params = $this->parameters;
392	+ ksort( $params );
393	+ // Remove oauth_signature if present
394	+ // Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
395	+ if ( isset( $params[ 'oauth_signature' ] ) ) {
396	+ unset( $params[ 'oauth_signature' ] );
397	+ }
398	+ foreach ( $params as $key => $value ) {
399	+ $res[ ] = $key . "=" . $value;
400	+ }
401	+
402	+ return implode( '&', $res );
403	+ //return OAuthUtil::build_http_query($params);
404	+ }
405	+
406	+ /**
407	+ * Returns the base string of this request
408	+ *
409	+ * The base string defined as the method, the url
410	+ * and the parameters (normalized), each urlencoded
411	+ * and the concated with &.
412	+ */
413	+ public function get_signature_base_string()
414	+ {
415	+ $parts = array(
416	+ $this->get_normalized_http_method(),
417	+ $this->get_normalized_http_url(),
418	+ $this->get_signable_parameters()
419	+ );
420	+
421	+ $parts = OAuthUtil::urlencode_rfc3986( $parts );
422	+
423	+ return implode( '&', $parts );
424	+ }
425	+
426	+ /**
427	+ * just uppercases the http method
428	+ */
429	+ public function get_normalized_http_method()
430	+ {
431	+ return strtoupper( $this->http_method );
432	+ }
433	+
434	+ /**
435	+ * parses the url and rebuilds it to be
436	+ * scheme://host/path
437	+ */
438	+ public function get_normalized_http_url()
439	+ {
440	+ $parts = parse_url( $this->http_url );
441	+
442	+ $scheme = ( isset( $parts[ 'scheme' ] ) ) ? $parts[ 'scheme' ] : 'http';
443	+ $port = ( isset( $parts[ 'port' ] ) ) ? $parts[ 'port' ] : ( ( $scheme == 'https' ) ? '443' : '80' );
444	+ $host = ( isset( $parts[ 'host' ] ) ) ? $parts[ 'host' ] : '';
445	+ $path = ( isset( $parts[ 'path' ] ) ) ? $parts[ 'path' ] : '';
446	+
447	+ if ( ( $scheme == 'https' && $port != '443' )
448	+ \|\| ( $scheme == 'http' && $port != '80' )
449	+ ) {
450	+ $host = "$host:$port";
451	+ }
452	+
453	+ return "$scheme://$host$path";
454	+ }
455	+
456	+ /**
457	+ * builds a url usable for a GET request
458	+ */
459	+ public function to_url()
460	+ {
461	+ $post_data = $this->to_postdata();
462	+ $out = $this->get_normalized_http_url();
463	+ if ( $post_data ) {
464	+ $out .= '?' . $post_data;
465	+ }
466	+
467	+ return $out;
468	+ }
469	+
470	+ /**
471	+ * builds the data one would send in a POST request
472	+ */
473	+ public function to_postdata()
474	+ {
475	+ return OAuthUtil::build_http_query( $this->parameters );
476	+ }
477	+
478	+ /**
479	+ * builds the Authorization: header
480	+ */
481	+ public function to_header( $realm = null )
482	+ {
483	+ $first = true;
484	+ if ( $realm ) {
485	+ $out = 'Authorization: OAuth realm="' . OAuthUtil::urlencode_rfc3986( $realm ) . '"';
486	+ $first = false;
487	+ } else
488	+ $out = 'Authorization: OAuth';
489	+
490	+ $total = array();
491	+ foreach ( $this->parameters as $k => $v ) {
492	+ if ( substr( $k, 0, 5 ) != "oauth" ) continue;
493	+ if ( is_array( $v ) ) {
494	+ throw new OAuthException( 'Arrays not supported in headers' );
495	+ }
496	+ $out .= ( $first ) ? ' ' : ',';
497	+ $out .= OAuthUtil::urlencode_rfc3986( $k ) .
498	+ '="' .
499	+ OAuthUtil::urlencode_rfc3986( $v ) .
500	+ '"';
501	+ $first = false;
502	+ }
503	+
504	+ return $out;
505	+ }
506	+
507	+ public function __toString()
508	+ {
509	+ return $this->to_url();
510	+ }
511	+
512	+
513	+ public function sign_request( $signature_method, $consumer, $token )
514	+ {
515	+
516	+ $empty = false;
517	+ $msg = array();
518	+ if ( $token->key == null ) {
519	+ $msg[ ] = 'Token key';
520	+ }
521	+ if ( $token->secret == null ) {
522	+ $msg[ ] = 'Token secret';
523	+ }
524	+ if ( $consumer->key == null ) {
525	+
526	+ $msg[ ] = 'Consumer key';
527	+ }
528	+ if ( $consumer->secret == null ) {
529	+
530	+ $msg[ ] = 'Consumer secret';
531	+ }
532	+ if ( $this->http_url == null ) {
533	+
534	+ $msg[ ] = 'Endpoint';
535	+ }
536	+ if ( $this->http_method == null ) {
537	+
538	+ $msg[ ] = 'HTTP method';
539	+ }
540	+ if ( count( $msg ) ) {
541	+ throw new OAuthException( 'Enter valid ' . implode( ',', $msg ) );
542	+ }
543	+ $this->set_parameter(
544	+ "oauth_signature_method",
545	+ $signature_method->get_name(),
546	+ false );
547	+
548	+ $signature = $this->build_signature( $signature_method, $consumer, $token );
549	+ $this->set_parameter( "oauth_signature", $signature, false );
550	+
551	+ }
552	+
553	+ public function build_signature( $signature_method, $consumer, $token )
554	+ {
555	+ $signature = $signature_method->build_signature( $this, $consumer, $token );
556	+
557	+ return $signature;
558	+ }
559	+
560	+ /**
561	+ * util function: current timestamp
562	+ */
563	+ private static function generate_timestamp()
564	+ {
565	+ return time();
566	+ }
567	+
568	+ /**
569	+ * util function: current nonce
570	+ */
571	+ private static function generate_nonce()
572	+ {
573	+ $mt = microtime();
574	+ $rand = mt_rand();
575	+
576	+ return md5( $mt . $rand ); // md5s look nicer than numbers
577	+ }
578	+ }
579	+ }
580	+
581	+ if ( !class_exists( 'OAuthServer' ) ) {
582	+ class OAuthServer
583	+ {
584	+ protected $timestamp_threshold = 300; // in seconds, five minutes
585	+ protected $version = '1.0'; // hi blaine
586	+ protected $signature_methods = array();
587	+
588	+ protected $data_store;
589	+
590	+ function __construct( $data_store )
591	+ {
592	+ $this->data_store = $data_store;
593	+ }
594	+
595	+ public function add_signature_method( $signature_method )
596	+ {
597	+ $this->signature_methods[ $signature_method->get_name() ] =
598	+ $signature_method;
599	+ }
600	+
601	+ // high level functions
602	+
603	+ /**
604	+ * process a request_token request
605	+ * returns the request token on success
606	+ */
607	+ public function fetch_request_token( &$request )
608	+ {
609	+ $this->get_version( $request );
610	+
611	+ $consumer = $this->get_consumer( $request );
612	+
613	+ // no token required for the initial token request
614	+ $token = null;
615	+
616	+ $this->check_signature( $request, $consumer, $token );
617	+
618	+ // Rev A change
619	+ $callback = $request->get_parameter( 'oauth_callback' );
620	+ $new_token = $this->data_store->new_request_token( $consumer, $callback );
621	+
622	+ return $new_token;
623	+ }
624	+
625	+ /**
626	+ * process an access_token request
627	+ * returns the access token on success
628	+ */
629	+ public function fetch_access_token( &$request )
630	+ {
631	+ $this->get_version( $request );
632	+
633	+ $consumer = $this->get_consumer( $request );
634	+
635	+ // requires authorized request token
636	+ $token = $this->get_token( $request, $consumer, "request" );
637	+
638	+ $this->check_signature( $request, $consumer, $token );
639	+
640	+ // Rev A change
641	+ $verifier = $request->get_parameter( 'oauth_verifier' );
642	+ $new_token = $this->data_store->new_access_token( $token, $consumer, $verifier );
643	+
644	+ return $new_token;
645	+ }
646	+
647	+ /**
648	+ * verify an api call, checks all the parameters
649	+ */
650	+ public function verify_request( &$request )
651	+ {
652	+ $this->get_version( $request );
653	+ $consumer = $this->get_consumer( $request );
654	+ $token = $this->get_token( $request, $consumer, "access" );
655	+ $this->check_signature( $request, $consumer, $token );
656	+
657	+ return array( $consumer, $token );
658	+ }
659	+
660	+ // Internals from here
661	+ /**
662	+ * version 1
663	+ */
664	+ private function get_version( &$request )
665	+ {
666	+ $version = $request->get_parameter( "oauth_version" );
667	+ if ( !$version ) {
668	+ // Service Providers MUST assume the protocol version to be 1.0 if this parameter is not present.
669	+ // Chapter 7.0 ("Accessing Protected Ressources")
670	+ $version = '1.0';
671	+ }
672	+ if ( $version !== $this->version ) {
673	+ throw new OAuthException( "OAuth version '$version' not supported" );
674	+ }
675	+
676	+ return $version;
677	+ }
678	+
679	+ /**
680	+ * figure out the signature with some defaults
681	+ */
682	+ private function get_signature_method( $request )
683	+ {
684	+ $signature_method = $request instanceof OAuthRequest
685	+ ? $request->get_parameter( "oauth_signature_method" )
686	+ : null;
687	+
688	+ if ( !$signature_method ) {
689	+ // According to chapter 7 ("Accessing Protected Ressources") the signature-method
690	+ // parameter is required, and we can't just fallback to PLAINTEXT
691	+ throw new OAuthException( 'No signature method parameter. This parameter is required' );
692	+ }
693	+
694	+ if ( !in_array( $signature_method,
695	+ array_keys( $this->signature_methods ) )
696	+ ) {
697	+ throw new OAuthException(
698	+ "Signature method '$signature_method' not supported " .
699	+ "try one of the following: " .
700	+ implode( ", ", array_keys( $this->signature_methods ) )
701	+ );
702	+ }
703	+
704	+ return $this->signature_methods[ $signature_method ];
705	+ }
706	+
707	+ /**
708	+ * try to find the consumer for the provided request's consumer key
709	+ */
710	+ private function get_consumer( $request )
711	+ {
712	+ $consumer_key = $request instanceof OAuthRequest
713	+ ? $request->get_parameter( "oauth_consumer_key" )
714	+ : null;
715	+
716	+ if ( !$consumer_key ) {
717	+ throw new OAuthException( "Invalid consumer key" );
718	+ }
719	+
720	+ $consumer = $this->data_store->lookup_consumer( $consumer_key );
721	+ if ( !$consumer ) {
722	+ throw new OAuthException( "Invalid consumer" );
723	+ }
724	+
725	+ return $consumer;
726	+ }
727	+
728	+ /**
729	+ * try to find the token for the provided request's token key
730	+ */
731	+ private function get_token( $request, $consumer, $token_type = "access" )
732	+ {
733	+ $token_field = $request instanceof OAuthRequest
734	+ ? $request->get_parameter( 'oauth_token' )
735	+ : null;
736	+
737	+ $token = $this->data_store->lookup_token(
738	+ $consumer, $token_type, $token_field
739	+ );
740	+ if ( !$token ) {
741	+ throw new OAuthException( "Invalid $token_type token: $token_field" );
742	+ }
743	+
744	+ return $token;
745	+ }
746	+
747	+ /**
748	+ * all-in-one function to check the signature on a request
749	+ * should guess the signature method appropriately
750	+ */
751	+ private function check_signature( $request, $consumer, $token )
752	+ {
753	+ // this should probably be in a different method
754	+ $timestamp = $request instanceof OAuthRequest
755	+ ? $request->get_parameter( 'oauth_timestamp' )
756	+ : null;
757	+ $nonce = $request instanceof OAuthRequest
758	+ ? $request->get_parameter( 'oauth_nonce' )
759	+ : null;
760	+
761	+ $this->check_timestamp( $timestamp );
762	+ $this->check_nonce( $consumer, $token, $nonce, $timestamp );
763	+
764	+ $signature_method = $this->get_signature_method( $request );
765	+
766	+ $signature = $request->get_parameter( 'oauth_signature' );
767	+ $valid_sig = $signature_method->check_signature(
768	+ $request,
769	+ $consumer,
770	+ $token,
771	+ $signature
772	+ );
773	+
774	+ if ( !$valid_sig ) {
775	+ throw new OAuthException( "Invalid signature" );
776	+ }
777	+ }
778	+
779	+ /**
780	+ * check that the timestamp is new enough
781	+ */
782	+ private function check_timestamp( $timestamp )
783	+ {
784	+ if ( !$timestamp )
785	+ throw new OAuthException(
786	+ 'Missing timestamp parameter. The parameter is required'
787	+ );
788	+
789	+ // verify that timestamp is recentish
790	+ $now = time();
791	+ if ( abs( $now - $timestamp ) > $this->timestamp_threshold ) {
792	+ throw new OAuthException(
793	+ "Expired timestamp, yours $timestamp, ours $now"
794	+ );
795	+ }
796	+ }
797	+
798	+ /**
799	+ * check that the nonce is not repeated
800	+ */
801	+ private function check_nonce( $consumer, $token, $nonce, $timestamp )
802	+ {
803	+ if ( !$nonce )
804	+ throw new OAuthException(
805	+ 'Missing nonce parameter. The parameter is required'
806	+ );
807	+
808	+ // verify that the nonce is uniqueish
809	+ $found = $this->data_store->lookup_nonce(
810	+ $consumer,
811	+ $token,
812	+ $nonce,
813	+ $timestamp
814	+ );
815	+ if ( $found ) {
816	+ throw new OAuthException( "Nonce already used: $nonce" );
817	+ }
818	+ }
819	+
820	+ }
821	+ }
822	+
823	+ // if ( !class_exists( 'OAuthDataStore' ) ) { // If you experience clashes with other OAuthDataStore classes, uncommenting this line and the closing curly brace
824	+ // at the end of the class declaration MAY help you.
825	+ class OAuthDataStore
826	+ {
827	+ function lookup_consumer( $consumer_key )
828	+ {
829	+ // implement me
830	+ }
831	+
832	+ function lookup_token( $consumer, $token_type, $token )
833	+ {
834	+ // implement me
835	+ }
836	+
837	+ function lookup_nonce( $consumer, $token, $nonce, $timestamp )
838	+ {
839	+ // implement me
840	+ }
841	+
842	+ function new_request_token( $consumer, $callback = null )
843	+ {
844	+ // return a new token attached to this consumer
845	+ }
846	+
847	+ function new_access_token( $token, $consumer, $verifier = null )
848	+ {
849	+ // return a new access token attached to this consumer
850	+ // for the user associated with this token if the request token
851	+ // is authorized
852	+ // should also invalidate the request token
853	+ }
854	+
855	+ }
856	+ // } // This is the curly brace to uncomment
857	+
858	+ if ( !class_exists( 'OAuthUtil' ) ) {
859	+ class OAuthUtil
860	+ {
861	+ public static function urlencode_rfc3986( $input )
862	+ {
863	+ if ( is_array( $input ) ) {
864	+ return array_map( array( 'OAuthUtil', 'urlencode_rfc3986' ), $input );
865	+ } else if ( is_scalar( $input ) ) {
866	+ $tmp1 = str_replace( '%7E', '~', rawurlencode( $input ) );
867	+ $tmp2 = str_replace( ".", "%2E", $tmp1 );
868	+ $tmp3 = str_replace( "*", "%2A", $tmp2 );
869	+ $tmp4 = str_replace( '+', ' ', $tmp3 );
870	+ $tmp = str_replace( "-", "%2D", $tmp4 );
871	+
872	+ return $tmp;
873	+ /*$tmp1=str_replace('%7E', '~', rawurlencode($input));
874	+ $tmp2= str_replace(".","%2E",$tmp1);
875	+
876	+
877	+ return $tmp;*/
878	+ } else {
879	+ return '';
880	+ }
881	+ }
882	+
883	+ public static function parseQueryString( $str )
884	+ {
885	+ $op = array();
886	+ $pairs = explode( "&", $str );
887	+ foreach ( $pairs as $pair ) {
888	+ list( $k, $v ) = array_map( "urldecode", explode( "=", $pair ) );
889	+ $op[ $k ] = $v;
890	+ }
891	+
892	+ return $op;
893	+ }
894	+
895	+ //parses string to associative array -modified for PayPal Signature
896	+
897	+
898	+ // This decode function isn't taking into consideration the above
899	+ // modifications to the encoding process. However, this method doesn't
900	+ // seem to be used anywhere so leaving it as is.
901	+ public static function urldecode_rfc3986( $string )
902	+ {
903	+ return urldecode( $string );
904	+ }
905	+
906	+ // Utility function for turning the Authorization: header into
907	+ // parameters, has to do some unescaping
908	+ // Can filter out any non-oauth parameters if needed (default behaviour)
909	+ // May 28th, 2010 - method updated to tjerk.meesters for a speed improvement.
910	+ // see http://code.google.com/p/oauth/issues/detail?id=163
911	+ public static function split_header( $header, $only_allow_oauth_parameters = true )
912	+ {
913	+ $params = array();
914	+ if ( preg_match_all( '/(' . ( $only_allow_oauth_parameters ? 'oauth_' : '' ) . '[a-z_-])=(:?"([^"])"\|([^,]*))/', $header, $matches ) ) {
915	+ foreach ( $matches[ 1 ] as $i => $h ) {
916	+ $params[ $h ] = OAuthUtil::urldecode_rfc3986( empty( $matches[ 3 ][ $i ] ) ? $matches[ 4 ][ $i ] : $matches[ 3 ][ $i ] );
917	+ }
918	+ if ( isset( $params[ 'realm' ] ) ) {
919	+ unset( $params[ 'realm' ] );
920	+ }
921	+ }
922	+
923	+ return $params;
924	+ }
925	+
926	+ // helper to try to sort out headers for people who aren't running apache
927	+ public static function get_headers()
928	+ {
929	+ if ( function_exists( 'apache_request_headers' ) ) {
930	+ // we need this to get the actual Authorization: header
931	+ // because apache tends to tell us it doesn't exist
932	+ $headers = apache_request_headers();
933	+
934	+ // sanitize the output of apache_request_headers because
935	+ // we always want the keys to be Cased-Like-This and arh()
936	+ // returns the headers in the same case as they are in the
937	+ // request
938	+ $out = array();
939	+ foreach ( $headers AS $key => $value ) {
940	+ $key = str_replace(
941	+ " ",
942	+ "-",
943	+ ucwords( strtolower( str_replace( "-", " ", $key ) ) )
944	+ );
945	+ $out[ $key ] = $value;
946	+ }
947	+ } else {
948	+ // otherwise we don't have apache and are just going to have to hope
949	+ // that $_SERVER actually contains what we need
950	+ $out = array();
951	+ if ( isset( $_SERVER[ 'CONTENT_TYPE' ] ) )
952	+ $out[ 'Content-Type' ] = $_SERVER[ 'CONTENT_TYPE' ];
953	+ if ( isset( $_ENV[ 'CONTENT_TYPE' ] ) )
954	+ $out[ 'Content-Type' ] = $_ENV[ 'CONTENT_TYPE' ];
955	+
956	+ foreach ( $_SERVER as $key => $value ) {
957	+ if ( substr( $key, 0, 5 ) == "HTTP_" ) {
958	+ // this is chaos, basically it is just there to capitalize the first
959	+ // letter of every word that is not an initial HTTP and strip HTTP
960	+ // code from przemek
961	+ $key = str_replace(
962	+ " ",
963	+ "-",
964	+ ucwords( strtolower( str_replace( "_", " ", substr( $key, 5 ) ) ) )
965	+ );
966	+ $out[ $key ] = $value;
967	+ }
968	+ }
969	+ }
970	+
971	+ return $out;
972	+ }
973	+
974	+ // This function takes a input like a=b&a=c&d=e and returns the parsed
975	+ // parameters like this
976	+ // array('a' => array('b','c'), 'd' => 'e')
977	+ public static function parse_parameters( $input )
978	+ {
979	+ if ( !isset( $input ) \|\| !$input ) return array();
980	+
981	+ $pairs = explode( '&', $input );
982	+
983	+ $parsed_parameters = array();
984	+ foreach ( $pairs as $pair ) {
985	+ $split = explode( '=', $pair, 2 );
986	+ $parameter = OAuthUtil::urldecode_rfc3986( $split[ 0 ] );
987	+ $value = isset( $split[ 1 ] ) ? OAuthUtil::urldecode_rfc3986( $split[ 1 ] ) : '';
988	+
989	+ if ( isset( $parsed_parameters[ $parameter ] ) ) {
990	+ // We have already recieved parameter(s) with this name, so add to the list
991	+ // of parameters with this name
992	+
993	+ if ( is_scalar( $parsed_parameters[ $parameter ] ) ) {
994	+ // This is the first duplicate, so transform scalar (string) into an array
995	+ // so we can add the duplicates
996	+ $parsed_parameters[ $parameter ] = array( $parsed_parameters[ $parameter ] );
997	+ }
998	+
999	+ $parsed_parameters[ $parameter ][ ] = $value;
1000	+ } else {
1001	+ $parsed_parameters[ $parameter ] = $value;
1002	+ }
1003	+ }
1004	+
1005	+ return $parsed_parameters;
1006	+ }
1007	+
1008	+ public static function build_http_query( $params )
1009	+ {
1010	+ if ( !$params ) return '';
1011	+
1012	+ // Urlencode both keys and values
1013	+ $keys = OAuthUtil::urlencode_rfc3986( array_keys( $params ) );
1014	+ $values = OAuthUtil::urlencode_rfc3986( array_values( $params ) );
1015	+ $params = array_combine( $keys, $values );
1016	+
1017	+ // Parameters are sorted by name, using lexicographical byte value ordering.
1018	+ // Ref: Spec: 9.1.1 (1)
1019	+ uksort( $params, 'strcmp' );
1020	+
1021	+ $pairs = array();
1022	+ foreach ( $params as $parameter => $value ) {
1023	+ if ( is_array( $value ) ) {
1024	+ // If two or more parameters share the same name, they are sorted by their value
1025	+ // Ref: Spec: 9.1.1 (1)
1026	+ // June 12th, 2010 - changed to sort because of issue 164 by hidetaka
1027	+ sort( $value, SORT_STRING );
1028	+ foreach ( $value as $duplicate_value ) {
1029	+ $pairs[ ] = $parameter . '=' . $duplicate_value;
1030	+ }
1031	+ } else {
1032	+ $pairs[ ] = $parameter . '=' . $value;
1033	+ }
1034	+ }
1035	+
1036	+ // For each parameter, the name is separated from the corresponding value by an '=' character (ASCII code 61)
1037	+ // Each name-value pair is separated by an '&' character (ASCII code 38)
1038	+ return implode( '&', $pairs );
1039	+ }
1040	+ }
1041	+ }
1042	+ //PayPal specific modification starts
1043	+ //Method to be called for generating signature
1044	+ require_once( "AuthUtil.php" );
1045	+ class AuthSignature
1046	+ {
1047	+
1048	+ public function genSign( $key, $secret, $token, $tokenSecret, $httpMethod, $endpoint )
1049	+ {
1050	+
1051	+
1052	+ $authServer = new OAuthServer( new MockOAuthDataStore() );
1053	+ $hmac_method = new OAuthSignatureMethod_HMAC_SHA1();
1054	+ $authServer->add_signature_method( $hmac_method );
1055	+
1056	+ $sig_method = $hmac_method;
1057	+ $authConsumer = new OAuthConsumer( $key, $secret, null );
1058	+ $authToken = null;
1059	+ $authToken = new OAuthToken( $token, $tokenSecret );
1060	+
1061	+ //$params is the query param array which is required only in the httpMethod is "GET"
1062	+
1063	+ $params = array();
1064	+ //set the Query parameters to $params if httpMethod is "GET"
1065	+
1066	+ $acc_req = OAuthRequest::from_consumer_and_token( $authConsumer, $authToken, $httpMethod, $endpoint, $params );
1067	+
1068	+ $acc_req->sign_request( $sig_method, $authConsumer, $authToken );
1069	+ $response = OAuthutil::parseQueryString( $acc_req );
1070	+
1071	+ return $response;
1072	+
1073	+ }
1074	+ }
1075	+
1076	+
1077	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/cacert.pem ADDED Viewed

	@@ -0,0 +1,171 @@


1	+ Verisign Class 3 Public Primary Certification Authority
2	+ =======================================================
3	+ -----BEGIN CERTIFICATE-----
4	+ MIICPDCCAaUCEHC65B0Q2Sk0tjjKewPMur8wDQYJKoZIhvcNAQECBQAwXzELMAkGA1UEBhMCVVMx
5	+ FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
6	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMTIzNTk1OVow
7	+ XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
8	+ IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
9	+ A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
10	+ f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
11	+ hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBAgUAA4GBALtMEivPLCYA
12	+ TxQT3ab7/AoRhIzzKBxnki98tsX63/Dolbwdj2wsqFHMc9ikwFPwTtYmwHYBV4GSXiHx0bH/59Ah
13	+ WM1pF+NEHJwZRDmJXNycAA9WjQKZ7aKQRUzkuxCkPfAyAw7xzvjoyVGM5mKf5p/AfbdynMk2Omuf
14	+ Tqj/ZA1k
15	+ -----END CERTIFICATE-----
16	+
17	+ Verisign Class 3 Public Primary Certification Authority - G2
18	+ ============================================================
19	+ -----BEGIN CERTIFICATE-----
20	+ MIIDAjCCAmsCEH3Z/gfPqB63EHln+6eJNMYwDQYJKoZIhvcNAQEFBQAwgcExCzAJBgNVBAYTAlVT
21	+ MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
22	+ eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
23	+ biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
24	+ dCBOZXR3b3JrMB4XDTk4MDUxODAwMDAwMFoXDTI4MDgwMTIzNTk1OVowgcExCzAJBgNVBAYTAlVT
25	+ MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
26	+ eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
27	+ biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
28	+ dCBOZXR3b3JrMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDMXtERXVxp0KvTuWpMmR9ZmDCO
29	+ FoUgRm1HP9SFIIThbbP4pO0M8RcPO/mn+SXXwc+EY/J8Y8+iR/LGWzOOZEAEaMGAuWQcRXfH2G71
30	+ lSk8UOg013gfqLptQ5GVj0VXXn7F+8qkBOvqlzdUMG+7AUcyM83cV5tkaWH4mx0ciU9cZwIDAQAB
31	+ MA0GCSqGSIb3DQEBBQUAA4GBAFFNzb5cy5gZnBWyATl4Lk0PZ3BwmcYQWpSkU01UbSuvDV1Ai2TT
32	+ 1+7eVmGSX6bEHRBhNtMsJzzoKQm5EWR0zLVznxxIqbxhAe7iF6YM40AIOw7n60RzKprxaZLvcRTD
33	+ Oaxxp5EJb+RxBrO6WVcmeQD2+A2iMzAo1KpYoJ2daZH9
34	+ -----END CERTIFICATE-----
35	+
36	+
37	+ Verisign Class 3 Public Primary Certification Authority - G3
38	+ ============================================================
39	+ -----BEGIN CERTIFICATE-----
40	+ MIIEGjCCAwICEQCbfgZJoz5iudXukEhxKe9XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
41	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
42	+ cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
43	+ IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
44	+ dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
45	+ CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
46	+ dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
47	+ cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkg
48	+ Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
49	+ ggEBAMu6nFL8eB8aHm8bN3O9+MlrlBIwT/A2R/XQkQr1F8ilYcEWQE37imGQ5XYgwREGfassbqb1
50	+ EUGO+i2tKmFZpGcmTNDovFJbcCAEWNF6yaRpvIMXZK0Fi7zQWM6NjPXr8EJJC52XJ2cybuGukxUc
51	+ cLwgTS8Y3pKI6GyFVxEa6X7jJhFUokWWVYPKMIno3Nij7SqAP395ZVc+FSBmCC+Vk7+qRy+oRpfw
52	+ EuL+wgorUeZ25rdGt+INpsyow0xZVYnm6FNcHOqd8GIWC6fJXwzw3sJ2zq/3avL6QaaiMxTJ5Xpj
53	+ 055iN9WFZZ4O5lMkdBteHRJTW8cs54NJOxWuimi5V5cCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
54	+ ERSWwauSCPc/L8my/uRan2Te2yFPhpk0djZX3dAVL8WtfxUfN2JzPtTnX84XA9s1+ivbrmAJXx5f
55	+ j267Cz3qWhMeDGBvtcC1IyIuBwvLqXTLR7sdwdela8wv0kL9Sd2nic9TutoAWii/gt/4uhMdUIaC
56	+ /Y4wjylGsB49Ndo4YhYYSq3mtlFs3q9i6wHQHiT+eo8SGhJouPtmmRQURVyu565pF4ErWjfJXir0
57	+ xuKhXFSbplQAz/DxwceYMBo7Nhbbo27q/a2ywtrvAkcTisDxszGtTxzhT5yvDwyd93gN2PQ1VoDa
58	+ t20Xj50egWTh/sVFuq1ruQp6Tk9LhO5L8X3dEQ==
59	+ -----END CERTIFICATE-----
60	+
61	+ Verisign Class 4 Public Primary Certification Authority - G3
62	+ ============================================================
63	+ -----BEGIN CERTIFICATE-----
64	+ MIIEGjCCAwICEQDsoKeLbnVqAc/EfMwvlF7XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
65	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
66	+ cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
67	+ IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
68	+ dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
69	+ CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
70	+ dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
71	+ cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkg
72	+ Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
73	+ ggEBAK3LpRFpxlmr8Y+1GQ9Wzsy1HyDkniYlS+BzZYlZ3tCD5PUPtbut8XzoIfzk6AzufEUiGXaS
74	+ tBO3IFsJ+mGuqPKljYXCKtbeZjbSmwL0qJJgfJxptI8kHtCGUvYynEFYHiK9zUVilQhu0GbdU6LM
75	+ 8BDcVHOLBKFGMzNcF0C5nk3T875Vg+ixiY5afJqWIpA7iCXy0lOIAgwLePLmNxdLMEYH5IBtptiW
76	+ Lugs+BGzOA1mppvqySNb247i8xOOGlktqgLw7KSHZtzBP/XYufTsgsbSPZUd5cBPhMnZo0QoBmrX
77	+ Razwa2rvTl/4EYIeOGM0ZlDUPpNz+jDDZq3/ky2X7wMCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
78	+ j/ola09b5KROJ1WrIhVZPMq1CtRK26vdoV9TxaBXOcLORyu+OshWv8LZJxA6sQU8wHcxuzrTBXtt
79	+ mhwwjIDLk5Mqg6sFUYICABFna/OIYUdfA5PVWw3g8dShMjWFsjrbsIKr0csKvE+MW8VLADsfKoKm
80	+ fjaF3H48ZwC15DtS4KjrXRX5xm3wrR0OhbepmnMUWluPQSjA1egtTaRezarZ7c7c2NU8Qh0XwRJd
81	+ RTjDOPP8hS6DRkiy1yBfkjaP53kPmF6Z6PDQpLv1U70qzlmwr25/bLvSHgCwIe34QWKCudiyxLtG
82	+ UPMxxY8BqHTr9Xgn2uf3ZkPznoM+IKrDNWCRzg==
83	+ -----END CERTIFICATE-----
84	+ VeriSign Class 3 Public Primary Certification Authority - G5
85	+ ============================================================
86	+ -----BEGIN CERTIFICATE-----
87	+ MIIE0zCCA7ugAwIBAgIQGNrRniZ96LtKIVjNzGs7SjANBgkqhkiG9w0BAQUFADCByjELMAkGA1UE
88	+ BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
89	+ ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
90	+ IHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRp
91	+ ZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwHhcNMDYxMTA4MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCB
92	+ yjELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2ln
93	+ biBUcnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBh
94	+ dXRob3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmlt
95	+ YXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
96	+ ggEKAoIBAQCvJAgIKXo1nmAMqudLO07cfLw8RRy7K+D+KQL5VwijZIUVJ/XxrcgxiV0i6CqqpkKz
97	+ j/i5Vbext0uz/o9+B1fs70PbZmIVYc9gDaTY3vjgw2IIPVQT60nKWVSFJuUrjxuf6/WhkcIzSdhD
98	+ Y2pSS9KP6HBRTdGJaXvHcPaz3BJ023tdS1bTlr8Vd6Gw9KIl8q8ckmcY5fQGBO+QueQA5N06tRn/
99	+ Arr0PO7gi+s3i+z016zy9vA9r911kTMZHRxAy3QkGSGT2RT+rCpSx4/VBEnkjWNHiDxpg8v+R70r
100	+ fk/Fla4OndTRQ8Bnc+MUCH7lP59zuDMKz10/NIeWiu5T6CUVAgMBAAGjgbIwga8wDwYDVR0TAQH/
101	+ BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2Uv
102	+ Z2lmMCEwHzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVy
103	+ aXNpZ24uY29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFH/TZafC3ey78DAJ80M5+gKvMzEzMA0GCSqG
104	+ SIb3DQEBBQUAA4IBAQCTJEowX2LP2BqYLz3q3JktvXf2pXkiOOzEp6B4Eq1iDkVwZMXnl2YtmAl+
105	+ X6/WzChl8gGqCBpH3vn5fJJaCGkgDdk+bW48DW7Y5gaRQBi5+MHt39tBquCWIMnNZBU4gcmU7qKE
106	+ KQsTb47bDN0lAtukixlE0kF6BWlKWE9gyn6CagsCqiUXObXbf+eEZSqVir2G3l6BFoMtEMze/aiC
107	+ Km0oHw0LxOXnGiYZ4fQRbxC1lfznQgUy286dUV4otp6F01vvpX1FQHKOtw5rDgb7MzVIcbidJ4vE
108	+ ZV8NhnacRHr2lVz2XTIIM6RUthg/aFzyQkqFOFSDX9HoLPKsEdao7WNq
109	+ -----END CERTIFICATE-----
110	+ VeriSign Universal Root Certification Authority
111	+ ===============================================
112	+ -----BEGIN CERTIFICATE-----
113	+ MIIEuTCCA6GgAwIBAgIQQBrEZCGzEyEDDrvkEhrFHTANBgkqhkiG9w0BAQsFADCBvTELMAkGA1UE
114	+ BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
115	+ ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwOCBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
116	+ IHVzZSBvbmx5MTgwNgYDVQQDEy9WZXJpU2lnbiBVbml2ZXJzYWwgUm9vdCBDZXJ0aWZpY2F0aW9u
117	+ IEF1dGhvcml0eTAeFw0wODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIG9MQswCQYDVQQGEwJV
118	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
119	+ cmsxOjA4BgNVBAsTMShjKSAyMDA4IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
120	+ IG9ubHkxODA2BgNVBAMTL1ZlcmlTaWduIFVuaXZlcnNhbCBSb290IENlcnRpZmljYXRpb24gQXV0
121	+ aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAx2E3XrEBNNti1xWb/1hajCMj
122	+ 1mCOkdeQmIN65lgZOIzF9uVkhbSicfvtvbnazU0AtMgtc6XHaXGVHzk8skQHnOgO+k1KxCHfKWGP
123	+ MiJhgsWHH26MfF8WIFFE0XBPV+rjHOPMee5Y2A7Cs0WTwCznmhcrewA3ekEzeOEz4vMQGn+HLL72
124	+ 9fdC4uW/h2KJXwBL38Xd5HVEMkE6HnFuacsLdUYI0crSK5XQz/u5QGtkjFdN/BMReYTtXlT2NJ8I
125	+ AfMQJQYXStrxHXpma5hgZqTZ79IugvHw7wnqRMkVauIDbjPTrJ9VAMf2CGqUuV/c4DPxhGD5WycR
126	+ tPwW8rtWaoAljQIDAQABo4GyMIGvMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMG0G
127	+ CCsGAQUFBwEMBGEwX6FdoFswWTBXMFUWCWltYWdlL2dpZjAhMB8wBwYFKw4DAhoEFI/l0xqGrI2O
128	+ a8PPgGrUSBgsexkuMCUWI2h0dHA6Ly9sb2dvLnZlcmlzaWduLmNvbS92c2xvZ28uZ2lmMB0GA1Ud
129	+ DgQWBBS2d/ppSEefUxLVwuoHMnYH0ZcHGTANBgkqhkiG9w0BAQsFAAOCAQEASvj4sAPmLGd75JR3
130	+ Y8xuTPl9Dg3cyLk1uXBPY/ok+myDjEedO2Pzmvl2MpWRsXe8rJq+seQxIcaBlVZaDrHC1LGmWazx
131	+ Y8u4TB1ZkErvkBYoH1quEPuBUDgMbMzxPcP1Y+Oz4yHJJDnp/RVmRvQbEdBNc6N9Rvk97ahfYtTx
132	+ P/jgdFcrGJ2BtMQo2pSXpXDrrB2+BxHw1dvd5Yzw1TKwg+ZX4o+/vqGqvz0dtdQ46tewXDpPaj+P
133	+ wGZsY6rp2aQW9IHRlRQOfc2VNNnSj3BzgXucfr2YYdhFh5iQxeuGMMY1v/D/w1WIg0vvBZIGcfK4
134	+ mJO37M2CYfE45k+XmCpajQ==
135	+ -----END CERTIFICATE-----
136	+
137	+ VeriSign Class 3 Public Primary Certification Authority - G4
138	+ ============================================================
139	+ -----BEGIN CERTIFICATE-----
140	+ MIIDhDCCAwqgAwIBAgIQL4D+I4wOIg9IZxIokYesszAKBggqhkjOPQQDAzCByjELMAkGA1UEBhMC
141	+ VVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBOZXR3
142	+ b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVz
143	+ ZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRpZmlj
144	+ YXRpb24gQXV0aG9yaXR5IC0gRzQwHhcNMDcxMTA1MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCByjEL
145	+ MAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBU
146	+ cnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRo
147	+ b3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5
148	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzQwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAASnVnp8
149	+ Utpkmw4tXNherJI9/gHmGUo9FANL+mAnINmDiWn6VMaaGF5VKmTeBvaNSjutEDxlPZCIBIngMGGz
150	+ rl0Bp3vefLK+ymVhAIau2o970ImtTR1ZmkGxvEeA3J5iw/mjgbIwga8wDwYDVR0TAQH/BAUwAwEB
151	+ /zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2UvZ2lmMCEw
152	+ HzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVyaXNpZ24u
153	+ Y29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFLMWkf3upm7ktS5Jj4d4gYDs5bG1MAoGCCqGSM49BAMD
154	+ A2gAMGUCMGYhDBgmYFo4e1ZC4Kf8NoRRkSAsdk1DPcQdhCPQrNZ8NQbOzWm9kA3bbEhCHQ6qQgIx
155	+ AJw9SDkjOVgaFRJZap7v1VmyHVIsmXHNxynfGyphe3HR3vPA5Q06Sqotp9iGKt0uEA==
156	+ -----END CERTIFICATE-----
157	+ Verisign Class 3 Public Primary Certification Authority
158	+ =======================================================
159	+ -----BEGIN CERTIFICATE-----
160	+ MIICPDCCAaUCEDyRMcsf9tAbDpq40ES/Er4wDQYJKoZIhvcNAQEFBQAwXzELMAkGA1UEBhMCVVMx
161	+ FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
162	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMjIzNTk1OVow
163	+ XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
164	+ IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
165	+ A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
166	+ f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
167	+ hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBBQUAA4GBABByUqkFFBky
168	+ CEHwxWsKzH4PIRnN5GfcX6kb5sroc50i2JhucwNhkcV8sEVAbkSdjbCxlnRhLQ2pRdKkkirWmnWX
169	+ bj9T/UWZYB2oK0z5XqcJ2HUw19JlYD1n1khVdWk/kfVIC0dpImmClr7JyDiGSnoscxlIaU5rfGW/
170	+ D/xwzoiQ
171	+ -----END CERTIFICATE-----

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConfigurationException.php ADDED Viewed

	@@ -0,0 +1,9 @@


1	+ <?php
2	+ class PPConfigurationException extends Exception
3	+ {
4	+
5	+ public function __construct( $message = null, $code = 0 )
6	+ {
7	+ parent::__construct( $message, $code );
8	+ }
9	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConnectionException.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ class PPConnectionException extends Exception
3	+ {
4	+ /**
5	+ * The url that was being connected to when the exception occured
6	+ * @var string
7	+ */
8	+ private $url;
9	+
10	+ public function __construct( $url, $message, $code = 0 )
11	+ {
12	+ parent::__construct( $message, $code );
13	+ $this->url = $url;
14	+ }
15	+
16	+ public function getUrl()
17	+ {
18	+ return $this->url;
19	+ }
20	+ }

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPInvalidCredentialException.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+
3	+
4	+ class PPInvalidCredentialException extends Exception
5	+ {
6	+
7	+ public function __construct( $message = null, $code = 0 )
8	+ {
9	+ parent::__construct( $message, $code );
10	+ }
11	+
12	+ public function errorMessage()
13	+ {
14	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
15	+ . ': <b>' . $this->getMessage() . '</b>';
16	+
17	+ return $errorMsg;
18	+ }
19	+
20	+ }
21	+
22	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPMissingCredentialException.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+
3	+
4	+ class PPMissingCredentialException extends Exception
5	+ {
6	+
7	+ public function __construct( $message = null, $code = 0 )
8	+ {
9	+ parent::__construct( $message, $code );
10	+ }
11	+
12	+ public function errorMessage()
13	+ {
14	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
15	+ . ': <b>' . $this->getMessage() . '</b>';
16	+
17	+ return $errorMsg;
18	+ }
19	+
20	+ }
21	+
22	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPTransformerException.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ class PPTransformerException extends Exception
3	+ {
4	+
5	+ public function __construct( $message = null, $code = 0 )
6	+ {
7	+ parent::__construct( $message, $code );
8	+ }
9	+
10	+ public function errorMessage()
11	+ {
12	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
13	+ . ': <b>' . $this->getMessage() . '</b>';
14	+
15	+ return $errorMsg;
16	+ }
17	+
18	+ }
19	+
20	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePayments.php ADDED Viewed

	@@ -0,0 +1,5797 @@


1	+ <?php
2	+ /**
3	+ * Stub objects for AdaptivePayments
4	+ * Auto generated code
5	+ *
6	+ */
7	+ require_once( 'PPUtils.php' );
8	+ /**
9	+ *
10	+ */
11	+ class AccountIdentifier
12	+ {
13	+
14	+ /**
15	+ *
16	+ * @access public
17	+ * @var string
18	+ */
19	+ public $email;
20	+
21	+ /**
22	+ *
23	+ * @access public
24	+ * @var PhoneNumberType
25	+ */
26	+ public $phone;
27	+
28	+
29	+ public function toNVPString( $prefix = '' )
30	+ {
31	+ $str = '';
32	+ $delim = '';
33	+ if ( $this->email != null ) {
34	+ $str .= $delim . $prefix . 'email=' . urlencode( $this->email );
35	+ $delim = '&';
36	+ }
37	+ if ( $this->phone != null ) {
38	+ $newPrefix = $prefix . 'phone.';
39	+ $str .= $delim . call_user_func( array( $this->phone, 'toNVPString' ), $newPrefix );
40	+ $delim = '&';
41	+ }
42	+
43	+ return $str;
44	+ }
45	+
46	+ public function init( $map = null, $prefix = '' )
47	+ {
48	+ if ( $map != null ) {
49	+ $mapKeyName = $prefix . 'email';
50	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
51	+ $this->email = $map[ $mapKeyName ];
52	+ }
53	+ if ( PPUtils::array_match_key( $map, $prefix . "phone." ) ) {
54	+ $newPrefix = $prefix . "phone.";
55	+ $this->phone = new PhoneNumberType();
56	+ $this->phone->init( $map, $newPrefix );
57	+ }
58	+
59	+ }
60	+ }
61	+ }
62	+
63	+
64	+ /**
65	+ *
66	+ */
67	+ class BaseAddress
68	+ {
69	+
70	+ /**
71	+ *
72	+ * @access public
73	+ * @var string
74	+ */
75	+ public $line1;
76	+
77	+ /**
78	+ *
79	+ * @access public
80	+ * @var string
81	+ */
82	+ public $line2;
83	+
84	+ /**
85	+ *
86	+ * @access public
87	+ * @var string
88	+ */
89	+ public $city;
90	+
91	+ /**
92	+ *
93	+ * @access public
94	+ * @var string
95	+ */
96	+ public $state;
97	+
98	+ /**
99	+ *
100	+ * @access public
101	+ * @var string
102	+ */
103	+ public $postalCode;
104	+
105	+ /**
106	+ *
107	+ * @access public
108	+ * @var string
109	+ */
110	+ public $countryCode;
111	+
112	+ /**
113	+ *
114	+ * @access public
115	+ * @var string
116	+ */
117	+ public $type;
118	+
119	+
120	+ public function init( $map = null, $prefix = '' )
121	+ {
122	+ if ( $map != null ) {
123	+ $mapKeyName = $prefix . 'line1';
124	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
125	+ $this->line1 = $map[ $mapKeyName ];
126	+ }
127	+ $mapKeyName = $prefix . 'line2';
128	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
129	+ $this->line2 = $map[ $mapKeyName ];
130	+ }
131	+ $mapKeyName = $prefix . 'city';
132	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
133	+ $this->city = $map[ $mapKeyName ];
134	+ }
135	+ $mapKeyName = $prefix . 'state';
136	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
137	+ $this->state = $map[ $mapKeyName ];
138	+ }
139	+ $mapKeyName = $prefix . 'postalCode';
140	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
141	+ $this->postalCode = $map[ $mapKeyName ];
142	+ }
143	+ $mapKeyName = $prefix . 'countryCode';
144	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
145	+ $this->countryCode = $map[ $mapKeyName ];
146	+ }
147	+ $mapKeyName = $prefix . 'type';
148	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
149	+ $this->type = $map[ $mapKeyName ];
150	+ }
151	+
152	+ }
153	+ }
154	+ }
155	+
156	+
157	+ /**
158	+ * Details about the end user of the application invoking this
159	+ * service.
160	+ */
161	+ class ClientDetailsType
162	+ {
163	+
164	+ /**
165	+ *
166	+ * @access public
167	+ * @var string
168	+ */
169	+ public $ipAddress;
170	+
171	+ /**
172	+ *
173	+ * @access public
174	+ * @var string
175	+ */
176	+ public $deviceId;
177	+
178	+ /**
179	+ *
180	+ * @access public
181	+ * @var string
182	+ */
183	+ public $applicationId;
184	+
185	+ /**
186	+ *
187	+ * @access public
188	+ * @var string
189	+ */
190	+ public $model;
191	+
192	+ /**
193	+ *
194	+ * @access public
195	+ * @var string
196	+ */
197	+ public $geoLocation;
198	+
199	+ /**
200	+ *
201	+ * @access public
202	+ * @var string
203	+ */
204	+ public $customerType;
205	+
206	+ /**
207	+ *
208	+ * @access public
209	+ * @var string
210	+ */
211	+ public $partnerName;
212	+
213	+ /**
214	+ *
215	+ * @access public
216	+ * @var string
217	+ */
218	+ public $customerId;
219	+
220	+
221	+ public function toNVPString( $prefix = '' )
222	+ {
223	+ $str = '';
224	+ $delim = '';
225	+ if ( $this->ipAddress != null ) {
226	+ $str .= $delim . $prefix . 'ipAddress=' . urlencode( $this->ipAddress );
227	+ $delim = '&';
228	+ }
229	+ if ( $this->deviceId != null ) {
230	+ $str .= $delim . $prefix . 'deviceId=' . urlencode( $this->deviceId );
231	+ $delim = '&';
232	+ }
233	+ if ( $this->applicationId != null ) {
234	+ $str .= $delim . $prefix . 'applicationId=' . urlencode( $this->applicationId );
235	+ $delim = '&';
236	+ }
237	+ if ( $this->model != null ) {
238	+ $str .= $delim . $prefix . 'model=' . urlencode( $this->model );
239	+ $delim = '&';
240	+ }
241	+ if ( $this->geoLocation != null ) {
242	+ $str .= $delim . $prefix . 'geoLocation=' . urlencode( $this->geoLocation );
243	+ $delim = '&';
244	+ }
245	+ if ( $this->customerType != null ) {
246	+ $str .= $delim . $prefix . 'customerType=' . urlencode( $this->customerType );
247	+ $delim = '&';
248	+ }
249	+ if ( $this->partnerName != null ) {
250	+ $str .= $delim . $prefix . 'partnerName=' . urlencode( $this->partnerName );
251	+ $delim = '&';
252	+ }
253	+ if ( $this->customerId != null ) {
254	+ $str .= $delim . $prefix . 'customerId=' . urlencode( $this->customerId );
255	+ $delim = '&';
256	+ }
257	+
258	+ return $str;
259	+ }
260	+
261	+ }
262	+
263	+
264	+ /**
265	+ *
266	+ */
267	+ class CurrencyType
268	+ {
269	+
270	+ /**
271	+ *
272	+ * @access public
273	+ * @var string
274	+ */
275	+ public $code;
276	+
277	+ /**
278	+ *
279	+ * @access public
280	+ * @var double
281	+ */
282	+ public $amount;
283	+
284	+ /**
285	+ * Constructor with arguments
286	+ */
287	+ public function __construct( $code = null, $amount = null )
288	+ {
289	+ $this->code = $code;
290	+ $this->amount = $amount;
291	+ }
292	+
293	+
294	+ public function toNVPString( $prefix = '' )
295	+ {
296	+ $str = '';
297	+ $delim = '';
298	+ if ( $this->code != null ) {
299	+ $str .= $delim . $prefix . 'code=' . urlencode( $this->code );
300	+ $delim = '&';
301	+ }
302	+ if ( $this->amount != null ) {
303	+ $str .= $delim . $prefix . 'amount=' . urlencode( $this->amount );
304	+ $delim = '&';
305	+ }
306	+
307	+ return $str;
308	+ }
309	+
310	+ public function init( $map = null, $prefix = '' )
311	+ {
312	+ if ( $map != null ) {
313	+ $mapKeyName = $prefix . 'code';
314	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
315	+ $this->code = $map[ $mapKeyName ];
316	+ }
317	+ $mapKeyName = $prefix . 'amount';
318	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
319	+ $this->amount = $map[ $mapKeyName ];
320	+ }
321	+
322	+ }
323	+ }
324	+ }
325	+
326	+
327	+ /**
328	+ * This type contains the detailed error information resulting
329	+ * from the service operation.
330	+ */
331	+ class ErrorData
332	+ {
333	+
334	+ /**
335	+ *
336	+ * @access public
337	+ * @var integer
338	+ */
339	+ public $errorId;
340	+
341	+ /**
342	+ *
343	+ * @access public
344	+ * @var string
345	+ */
346	+ public $domain;
347	+
348	+ /**
349	+ *
350	+ * @access public
351	+ * @var string
352	+ */
353	+ public $subdomain;
354	+
355	+ /**
356	+ *
357	+ * @access public
358	+ * @var ErrorSeverity
359	+ */
360	+ public $severity;
361	+
362	+ /**
363	+ *
364	+ * @access public
365	+ * @var ErrorCategory
366	+ */
367	+ public $category;
368	+
369	+ /**
370	+ *
371	+ * @access public
372	+ * @var string
373	+ */
374	+ public $message;
375	+
376	+ /**
377	+ *
378	+ * @access public
379	+ * @var string
380	+ */
381	+ public $exceptionId;
382	+
383	+ /**
384	+ *
385	+ * @array
386	+ * @access public
387	+ * @var ErrorParameter
388	+ */
389	+ public $parameter;
390	+
391	+
392	+ public function init( $map = null, $prefix = '' )
393	+ {
394	+ if ( $map != null ) {
395	+ $mapKeyName = $prefix . 'errorId';
396	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
397	+ $this->errorId = $map[ $mapKeyName ];
398	+ }
399	+ $mapKeyName = $prefix . 'domain';
400	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
401	+ $this->domain = $map[ $mapKeyName ];
402	+ }
403	+ $mapKeyName = $prefix . 'subdomain';
404	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
405	+ $this->subdomain = $map[ $mapKeyName ];
406	+ }
407	+ $mapKeyName = $prefix . 'severity';
408	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
409	+ $this->severity = $map[ $mapKeyName ];
410	+ }
411	+ $mapKeyName = $prefix . 'category';
412	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
413	+ $this->category = $map[ $mapKeyName ];
414	+ }
415	+ $mapKeyName = $prefix . 'message';
416	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
417	+ $this->message = $map[ $mapKeyName ];
418	+ }
419	+ $mapKeyName = $prefix . 'exceptionId';
420	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
421	+ $this->exceptionId = $map[ $mapKeyName ];
422	+ }
423	+ $i = 0;
424	+ while ( true ) {
425	+ if ( PPUtils::array_match_key( $map, $prefix . "parameter($i)" ) ) {
426	+ $newPrefix = $prefix . "parameter($i).";
427	+ $this->parameter[ $i ] = new ErrorParameter();
428	+ $this->parameter[ $i ]->init( $map, $newPrefix );
429	+ } else {
430	+ break;
431	+ }
432	+ $i++;
433	+ }
434	+
435	+ }
436	+ }
437	+ }
438	+
439	+
440	+ /**
441	+ *
442	+ */
443	+ class ErrorParameter
444	+ {
445	+
446	+ /**
447	+ *
448	+ * @access public
449	+ * @var string
450	+ */
451	+ public $name;
452	+
453	+ /**
454	+ *
455	+ * @access public
456	+ * @var string
457	+ */
458	+ public $value;
459	+
460	+
461	+ public function init( $map = null, $prefix = '' )
462	+ {
463	+ if ( $map != null ) {
464	+ $mapKeyName = $prefix . 'name';
465	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
466	+ $this->name = $map[ $mapKeyName ];
467	+ }
468	+ $mapKeyName = $prefix . 'value';
469	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
470	+ $this->value = $map[ $mapKeyName ];
471	+ }
472	+
473	+ }
474	+ }
475	+ }
476	+
477	+
478	+ /**
479	+ * This specifies a fault, encapsulating error data, with
480	+ * specific error codes.
481	+ */
482	+ class FaultMessage
483	+ {
484	+
485	+ /**
486	+ *
487	+ * @access public
488	+ * @var ResponseEnvelope
489	+ */
490	+ public $responseEnvelope;
491	+
492	+ /**
493	+ *
494	+ * @array
495	+ * @access public
496	+ * @var ErrorData
497	+ */
498	+ public $error;
499	+
500	+
501	+ public function init( $map = null, $prefix = '' )
502	+ {
503	+ if ( $map != null ) {
504	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
505	+ $newPrefix = $prefix . "responseEnvelope.";
506	+ $this->responseEnvelope = new ResponseEnvelope();
507	+ $this->responseEnvelope->init( $map, $newPrefix );
508	+ }
509	+ $i = 0;
510	+ while ( true ) {
511	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
512	+ $newPrefix = $prefix . "error($i).";
513	+ $this->error[ $i ] = new ErrorData();
514	+ $this->error[ $i ]->init( $map, $newPrefix );
515	+ } else {
516	+ break;
517	+ }
518	+ $i++;
519	+ }
520	+
521	+ }
522	+ }
523	+ }
524	+
525	+
526	+ /**
527	+ *
528	+ */
529	+ class PhoneNumberType
530	+ {
531	+
532	+ /**
533	+ *
534	+ * @access public
535	+ * @var string
536	+ */
537	+ public $countryCode;
538	+
539	+ /**
540	+ *
541	+ * @access public
542	+ * @var string
543	+ */
544	+ public $phoneNumber;
545	+
546	+ /**
547	+ *
548	+ * @access public
549	+ * @var string
550	+ */
551	+ public $extension;
552	+
553	+ /**
554	+ * Constructor with arguments
555	+ */
556	+ public function __construct( $countryCode = null, $phoneNumber = null )
557	+ {
558	+ $this->countryCode = $countryCode;
559	+ $this->phoneNumber = $phoneNumber;
560	+ }
561	+
562	+
563	+ public function toNVPString( $prefix = '' )
564	+ {
565	+ $str = '';
566	+ $delim = '';
567	+ if ( $this->countryCode != null ) {
568	+ $str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
569	+ $delim = '&';
570	+ }
571	+ if ( $this->phoneNumber != null ) {
572	+ $str .= $delim . $prefix . 'phoneNumber=' . urlencode( $this->phoneNumber );
573	+ $delim = '&';
574	+ }
575	+ if ( $this->extension != null ) {
576	+ $str .= $delim . $prefix . 'extension=' . urlencode( $this->extension );
577	+ $delim = '&';
578	+ }
579	+
580	+ return $str;
581	+ }
582	+
583	+ public function init( $map = null, $prefix = '' )
584	+ {
585	+ if ( $map != null ) {
586	+ $mapKeyName = $prefix . 'countryCode';
587	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
588	+ $this->countryCode = $map[ $mapKeyName ];
589	+ }
590	+ $mapKeyName = $prefix . 'phoneNumber';
591	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
592	+ $this->phoneNumber = $map[ $mapKeyName ];
593	+ }
594	+ $mapKeyName = $prefix . 'extension';
595	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
596	+ $this->extension = $map[ $mapKeyName ];
597	+ }
598	+
599	+ }
600	+ }
601	+ }
602	+
603	+
604	+ /**
605	+ * This specifies the list of parameters with every request to
606	+ * the service.
607	+ */
608	+ class RequestEnvelope
609	+ {
610	+
611	+ /**
612	+ * This specifies the required detail level that is needed by a
613	+ * client application pertaining to a particular data component
614	+ * (e.g., Item, Transaction, etc.). The detail level is
615	+ * specified in the DetailLevelCodeType which has all the
616	+ * enumerated values of the detail level for each component.
617	+ * @access public
618	+ * @var DetailLevelCode
619	+ */
620	+ public $detailLevel;
621	+
622	+ /**
623	+ * This should be the standard RFC 3066 language identification
624	+ * tag, e.g., en_US.
625	+ * @access public
626	+ * @var string
627	+ */
628	+ public $errorLanguage;
629	+
630	+ /**
631	+ * Constructor with arguments
632	+ */
633	+ public function __construct( $errorLanguage = null )
634	+ {
635	+ $this->errorLanguage = $errorLanguage;
636	+ }
637	+
638	+
639	+ public function toNVPString( $prefix = '' )
640	+ {
641	+ $str = '';
642	+ $delim = '';
643	+ if ( $this->detailLevel != null ) {
644	+ $str .= $delim . $prefix . 'detailLevel=' . urlencode( $this->detailLevel );
645	+ $delim = '&';
646	+ }
647	+ if ( $this->errorLanguage != null ) {
648	+ $str .= $delim . $prefix . 'errorLanguage=' . urlencode( $this->errorLanguage );
649	+ $delim = '&';
650	+ }
651	+
652	+ return $str;
653	+ }
654	+
655	+ }
656	+
657	+
658	+ /**
659	+ * This specifies a list of parameters with every response from
660	+ * a service.
661	+ */
662	+ class ResponseEnvelope
663	+ {
664	+
665	+ /**
666	+ *
667	+ * @access public
668	+ * @var dateTime
669	+ */
670	+ public $timestamp;
671	+
672	+ /**
673	+ * Application level acknowledgment code.
674	+ * @access public
675	+ * @var AckCode
676	+ */
677	+ public $ack;
678	+
679	+ /**
680	+ *
681	+ * @access public
682	+ * @var string
683	+ */
684	+ public $correlationId;
685	+
686	+ /**
687	+ *
688	+ * @access public
689	+ * @var string
690	+ */
691	+ public $build;
692	+
693	+
694	+ public function init( $map = null, $prefix = '' )
695	+ {
696	+ if ( $map != null ) {
697	+ $mapKeyName = $prefix . 'timestamp';
698	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
699	+ $this->timestamp = $map[ $mapKeyName ];
700	+ }
701	+ $mapKeyName = $prefix . 'ack';
702	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
703	+ $this->ack = $map[ $mapKeyName ];
704	+ }
705	+ $mapKeyName = $prefix . 'correlationId';
706	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
707	+ $this->correlationId = $map[ $mapKeyName ];
708	+ }
709	+ $mapKeyName = $prefix . 'build';
710	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
711	+ $this->build = $map[ $mapKeyName ];
712	+ }
713	+
714	+ }
715	+ }
716	+ }
717	+
718	+
719	+ /**
720	+ *
721	+ */
722	+ class Address
723	+ {
724	+
725	+ /**
726	+ *
727	+ * @access public
728	+ * @var string
729	+ */
730	+ public $addresseeName;
731	+
732	+ /**
733	+ *
734	+ * @access public
735	+ * @var BaseAddress
736	+ */
737	+ public $baseAddress;
738	+
739	+ /**
740	+ *
741	+ * @access public
742	+ * @var string
743	+ */
744	+ public $addressId;
745	+
746	+
747	+ public function init( $map = null, $prefix = '' )
748	+ {
749	+ if ( $map != null ) {
750	+ $mapKeyName = $prefix . 'addresseeName';
751	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
752	+ $this->addresseeName = $map[ $mapKeyName ];
753	+ }
754	+ if ( PPUtils::array_match_key( $map, $prefix . "baseAddress." ) ) {
755	+ $newPrefix = $prefix . "baseAddress.";
756	+ $this->baseAddress = new BaseAddress();
757	+ $this->baseAddress->init( $map, $newPrefix );
758	+ }
759	+ $mapKeyName = $prefix . 'addressId';
760	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
761	+ $this->addressId = $map[ $mapKeyName ];
762	+ }
763	+
764	+ }
765	+ }
766	+ }
767	+
768	+
769	+ /**
770	+ *
771	+ */
772	+ class AddressList
773	+ {
774	+
775	+ /**
776	+ *
777	+ * @array
778	+ * @access public
779	+ * @var Address
780	+ */
781	+ public $address;
782	+
783	+
784	+ public function init( $map = null, $prefix = '' )
785	+ {
786	+ if ( $map != null ) {
787	+ $i = 0;
788	+ while ( true ) {
789	+ if ( PPUtils::array_match_key( $map, $prefix . "address($i)" ) ) {
790	+ $newPrefix = $prefix . "address($i).";
791	+ $this->address[ $i ] = new Address();
792	+ $this->address[ $i ]->init( $map, $newPrefix );
793	+ } else {
794	+ break;
795	+ }
796	+ $i++;
797	+ }
798	+
799	+ }
800	+ }
801	+ }
802	+
803	+
804	+ /**
805	+ * A list of ISO currency codes.
806	+ */
807	+ class CurrencyCodeList
808	+ {
809	+
810	+ /**
811	+ *
812	+ * @array
813	+ * @access public
814	+ * @var string
815	+ */
816	+ public $currencyCode;
817	+
818	+ /**
819	+ * Constructor with arguments
820	+ */
821	+ public function __construct( $currencyCode = null )
822	+ {
823	+ $this->currencyCode = $currencyCode;
824	+ }
825	+
826	+
827	+ public function toNVPString( $prefix = '' )
828	+ {
829	+ $str = '';
830	+ $delim = '';
831	+ for ( $i = 0; $i < count( $this->currencyCode ); $i++ ) {
832	+ $str .= $delim . $prefix . "currencyCode($i)=" . urlencode( $this->currencyCode[ $i ] );
833	+ $delim = '&';
834	+ }
835	+
836	+ return $str;
837	+ }
838	+
839	+ }
840	+
841	+
842	+ /**
843	+ * A list of estimated currency conversions for a base
844	+ * currency.
845	+ */
846	+ class CurrencyConversionList
847	+ {
848	+
849	+ /**
850	+ *
851	+ * @access public
852	+ * @var CurrencyType
853	+ */
854	+ public $baseAmount;
855	+
856	+ /**
857	+ *
858	+ * @access public
859	+ * @var CurrencyList
860	+ */
861	+ public $currencyList;
862	+
863	+
864	+ public function init( $map = null, $prefix = '' )
865	+ {
866	+ if ( $map != null ) {
867	+ if ( PPUtils::array_match_key( $map, $prefix . "baseAmount." ) ) {
868	+ $newPrefix = $prefix . "baseAmount.";
869	+ $this->baseAmount = new CurrencyType();
870	+ $this->baseAmount->init( $map, $newPrefix );
871	+ }
872	+ if ( PPUtils::array_match_key( $map, $prefix . "currencyList." ) ) {
873	+ $newPrefix = $prefix . "currencyList.";
874	+ $this->currencyList = new CurrencyList();
875	+ $this->currencyList->init( $map, $newPrefix );
876	+ }
877	+
878	+ }
879	+ }
880	+ }
881	+
882	+
883	+ /**
884	+ * A table that contains a list of estimated currency
885	+ * conversions for a base currency in each row.
886	+ */
887	+ class CurrencyConversionTable
888	+ {
889	+
890	+ /**
891	+ *
892	+ * @array
893	+ * @access public
894	+ * @var CurrencyConversionList
895	+ */
896	+ public $currencyConversionList;
897	+
898	+
899	+ public function init( $map = null, $prefix = '' )
900	+ {
901	+ if ( $map != null ) {
902	+ $i = 0;
903	+ while ( true ) {
904	+ if ( PPUtils::array_match_key( $map, $prefix . "currencyConversionList($i)" ) ) {
905	+ $newPrefix = $prefix . "currencyConversionList($i).";
906	+ $this->currencyConversionList[ $i ] = new CurrencyConversionList();
907	+ $this->currencyConversionList[ $i ]->init( $map, $newPrefix );
908	+ } else {
909	+ break;
910	+ }
911	+ $i++;
912	+ }
913	+
914	+ }
915	+ }
916	+ }
917	+
918	+
919	+ /**
920	+ * A list of ISO currencies.
921	+ */
922	+ class CurrencyList
923	+ {
924	+
925	+ /**
926	+ *
927	+ * @array
928	+ * @access public
929	+ * @var CurrencyType
930	+ */
931	+ public $currency;
932	+
933	+ /**
934	+ * Constructor with arguments
935	+ */
936	+ public function __construct( $currency = null )
937	+ {
938	+ $this->currency = $currency;
939	+ }
940	+
941	+
942	+ public function toNVPString( $prefix = '' )
943	+ {
944	+ $str = '';
945	+ $delim = '';
946	+ for ( $i = 0; $i < count( $this->currency ); $i++ ) {
947	+ $newPrefix = $prefix . "currency($i).";
948	+ $str .= $delim . call_user_func( array( $this->currency[ $i ], 'toNVPString' ), $newPrefix );
949	+ $delim = '&';
950	+ }
951	+
952	+ return $str;
953	+ }
954	+
955	+ public function init( $map = null, $prefix = '' )
956	+ {
957	+ if ( $map != null ) {
958	+ $i = 0;
959	+ while ( true ) {
960	+ if ( PPUtils::array_match_key( $map, $prefix . "currency($i)" ) ) {
961	+ $newPrefix = $prefix . "currency($i).";
962	+ $this->currency[ $i ] = new CurrencyType();
963	+ $this->currency[ $i ]->init( $map, $newPrefix );
964	+ } else {
965	+ break;
966	+ }
967	+ $i++;
968	+ }
969	+
970	+ }
971	+ }
972	+ }
973	+
974	+
975	+ /**
976	+ * Customizable options that a client application can specify
977	+ * for display purposes.
978	+ */
979	+ class DisplayOptions
980	+ {
981	+
982	+ /**
983	+ *
984	+ * @access public
985	+ * @var string
986	+ */
987	+ public $emailHeaderImageUrl;
988	+
989	+ /**
990	+ *
991	+ * @access public
992	+ * @var string
993	+ */
994	+ public $emailMarketingImageUrl;
995	+
996	+ /**
997	+ *
998	+ * @access public
999	+ * @var string
1000	+ */
1001	+ public $headerImageUrl;
1002	+
1003	+ /**
1004	+ *
1005	+ * @access public
1006	+ * @var string
1007	+ */
1008	+ public $businessName;
1009	+
1010	+
1011	+ public function toNVPString( $prefix = '' )
1012	+ {
1013	+ $str = '';
1014	+ $delim = '';
1015	+ if ( $this->emailHeaderImageUrl != null ) {
1016	+ $str .= $delim . $prefix . 'emailHeaderImageUrl=' . urlencode( $this->emailHeaderImageUrl );
1017	+ $delim = '&';
1018	+ }
1019	+ if ( $this->emailMarketingImageUrl != null ) {
1020	+ $str .= $delim . $prefix . 'emailMarketingImageUrl=' . urlencode( $this->emailMarketingImageUrl );
1021	+ $delim = '&';
1022	+ }
1023	+ if ( $this->headerImageUrl != null ) {
1024	+ $str .= $delim . $prefix . 'headerImageUrl=' . urlencode( $this->headerImageUrl );
1025	+ $delim = '&';
1026	+ }
1027	+ if ( $this->businessName != null ) {
1028	+ $str .= $delim . $prefix . 'businessName=' . urlencode( $this->businessName );
1029	+ $delim = '&';
1030	+ }
1031	+
1032	+ return $str;
1033	+ }
1034	+
1035	+ public function init( $map = null, $prefix = '' )
1036	+ {
1037	+ if ( $map != null ) {
1038	+ $mapKeyName = $prefix . 'emailHeaderImageUrl';
1039	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1040	+ $this->emailHeaderImageUrl = $map[ $mapKeyName ];
1041	+ }
1042	+ $mapKeyName = $prefix . 'emailMarketingImageUrl';
1043	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1044	+ $this->emailMarketingImageUrl = $map[ $mapKeyName ];
1045	+ }
1046	+ $mapKeyName = $prefix . 'headerImageUrl';
1047	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1048	+ $this->headerImageUrl = $map[ $mapKeyName ];
1049	+ }
1050	+ $mapKeyName = $prefix . 'businessName';
1051	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1052	+ $this->businessName = $map[ $mapKeyName ];
1053	+ }
1054	+
1055	+ }
1056	+ }
1057	+ }
1058	+
1059	+
1060	+ /**
1061	+ *
1062	+ */
1063	+ class ErrorList
1064	+ {
1065	+
1066	+ /**
1067	+ *
1068	+ * @array
1069	+ * @access public
1070	+ * @var ErrorData
1071	+ */
1072	+ public $error;
1073	+
1074	+
1075	+ public function init( $map = null, $prefix = '' )
1076	+ {
1077	+ if ( $map != null ) {
1078	+ $i = 0;
1079	+ while ( true ) {
1080	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
1081	+ $newPrefix = $prefix . "error($i).";
1082	+ $this->error[ $i ] = new ErrorData();
1083	+ $this->error[ $i ]->init( $map, $newPrefix );
1084	+ } else {
1085	+ break;
1086	+ }
1087	+ $i++;
1088	+ }
1089	+
1090	+ }
1091	+ }
1092	+ }
1093	+
1094	+
1095	+ /**
1096	+ *
1097	+ */
1098	+ class FundingConstraint
1099	+ {
1100	+
1101	+ /**
1102	+ *
1103	+ * @access public
1104	+ * @var FundingTypeList
1105	+ */
1106	+ public $allowedFundingType;
1107	+
1108	+
1109	+ public function toNVPString( $prefix = '' )
1110	+ {
1111	+ $str = '';
1112	+ $delim = '';
1113	+ if ( $this->allowedFundingType != null ) {
1114	+ $newPrefix = $prefix . 'allowedFundingType.';
1115	+ $str .= $delim . call_user_func( array( $this->allowedFundingType, 'toNVPString' ), $newPrefix );
1116	+ $delim = '&';
1117	+ }
1118	+
1119	+ return $str;
1120	+ }
1121	+
1122	+ public function init( $map = null, $prefix = '' )
1123	+ {
1124	+ if ( $map != null ) {
1125	+ if ( PPUtils::array_match_key( $map, $prefix . "allowedFundingType." ) ) {
1126	+ $newPrefix = $prefix . "allowedFundingType.";
1127	+ $this->allowedFundingType = new FundingTypeList();
1128	+ $this->allowedFundingType->init( $map, $newPrefix );
1129	+ }
1130	+
1131	+ }
1132	+ }
1133	+ }
1134	+
1135	+
1136	+ /**
1137	+ * FundingTypeInfo represents one allowed funding type.
1138	+ */
1139	+ class FundingTypeInfo
1140	+ {
1141	+
1142	+ /**
1143	+ *
1144	+ * @access public
1145	+ * @var string
1146	+ */
1147	+ public $fundingType;
1148	+
1149	+ /**
1150	+ * Constructor with arguments
1151	+ */
1152	+ public function __construct( $fundingType = null )
1153	+ {
1154	+ $this->fundingType = $fundingType;
1155	+ }
1156	+
1157	+
1158	+ public function toNVPString( $prefix = '' )
1159	+ {
1160	+ $str = '';
1161	+ $delim = '';
1162	+ if ( $this->fundingType != null ) {
1163	+ $str .= $delim . $prefix . 'fundingType=' . urlencode( $this->fundingType );
1164	+ $delim = '&';
1165	+ }
1166	+
1167	+ return $str;
1168	+ }
1169	+
1170	+ public function init( $map = null, $prefix = '' )
1171	+ {
1172	+ if ( $map != null ) {
1173	+ $mapKeyName = $prefix . 'fundingType';
1174	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1175	+ $this->fundingType = $map[ $mapKeyName ];
1176	+ }
1177	+
1178	+ }
1179	+ }
1180	+ }
1181	+
1182	+
1183	+ /**
1184	+ *
1185	+ */
1186	+ class FundingTypeList
1187	+ {
1188	+
1189	+ /**
1190	+ *
1191	+ * @array
1192	+ * @access public
1193	+ * @var FundingTypeInfo
1194	+ */
1195	+ public $fundingTypeInfo;
1196	+
1197	+ /**
1198	+ * Constructor with arguments
1199	+ */
1200	+ public function __construct( $fundingTypeInfo = null )
1201	+ {
1202	+ $this->fundingTypeInfo = $fundingTypeInfo;
1203	+ }
1204	+
1205	+
1206	+ public function toNVPString( $prefix = '' )
1207	+ {
1208	+ $str = '';
1209	+ $delim = '';
1210	+ for ( $i = 0; $i < count( $this->fundingTypeInfo ); $i++ ) {
1211	+ $newPrefix = $prefix . "fundingTypeInfo($i).";
1212	+ $str .= $delim . call_user_func( array( $this->fundingTypeInfo[ $i ], 'toNVPString' ), $newPrefix );
1213	+ $delim = '&';
1214	+ }
1215	+
1216	+ return $str;
1217	+ }
1218	+
1219	+ public function init( $map = null, $prefix = '' )
1220	+ {
1221	+ if ( $map != null ) {
1222	+ $i = 0;
1223	+ while ( true ) {
1224	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingTypeInfo($i)" ) ) {
1225	+ $newPrefix = $prefix . "fundingTypeInfo($i).";
1226	+ $this->fundingTypeInfo[ $i ] = new FundingTypeInfo();
1227	+ $this->fundingTypeInfo[ $i ]->init( $map, $newPrefix );
1228	+ } else {
1229	+ break;
1230	+ }
1231	+ $i++;
1232	+ }
1233	+
1234	+ }
1235	+ }
1236	+ }
1237	+
1238	+
1239	+ /**
1240	+ * Describes the conversion between 2 currencies.
1241	+ */
1242	+ class CurrencyConversion
1243	+ {
1244	+
1245	+ /**
1246	+ *
1247	+ * @access public
1248	+ * @var CurrencyType
1249	+ */
1250	+ public $from;
1251	+
1252	+ /**
1253	+ *
1254	+ * @access public
1255	+ * @var CurrencyType
1256	+ */
1257	+ public $to;
1258	+
1259	+ /**
1260	+ *
1261	+ * @access public
1262	+ * @var double
1263	+ */
1264	+ public $exchangeRate;
1265	+
1266	+
1267	+ public function init( $map = null, $prefix = '' )
1268	+ {
1269	+ if ( $map != null ) {
1270	+ if ( PPUtils::array_match_key( $map, $prefix . "from." ) ) {
1271	+ $newPrefix = $prefix . "from.";
1272	+ $this->from = new CurrencyType();
1273	+ $this->from->init( $map, $newPrefix );
1274	+ }
1275	+ if ( PPUtils::array_match_key( $map, $prefix . "to." ) ) {
1276	+ $newPrefix = $prefix . "to.";
1277	+ $this->to = new CurrencyType();
1278	+ $this->to->init( $map, $newPrefix );
1279	+ }
1280	+ $mapKeyName = $prefix . 'exchangeRate';
1281	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1282	+ $this->exchangeRate = $map[ $mapKeyName ];
1283	+ }
1284	+
1285	+ }
1286	+ }
1287	+ }
1288	+
1289	+
1290	+ /**
1291	+ * Funding source information.
1292	+ */
1293	+ class FundingSource
1294	+ {
1295	+
1296	+ /**
1297	+ *
1298	+ * @access public
1299	+ * @var string
1300	+ */
1301	+ public $lastFourOfAccountNumber;
1302	+
1303	+ /**
1304	+ *
1305	+ * @access public
1306	+ * @var string
1307	+ */
1308	+ public $type;
1309	+
1310	+ /**
1311	+ *
1312	+ * @access public
1313	+ * @var string
1314	+ */
1315	+ public $displayName;
1316	+
1317	+ /**
1318	+ *
1319	+ * @access public
1320	+ * @var string
1321	+ */
1322	+ public $fundingSourceId;
1323	+
1324	+ /**
1325	+ *
1326	+ * @access public
1327	+ * @var boolean
1328	+ */
1329	+ public $allowed;
1330	+
1331	+
1332	+ public function init( $map = null, $prefix = '' )
1333	+ {
1334	+ if ( $map != null ) {
1335	+ $mapKeyName = $prefix . 'lastFourOfAccountNumber';
1336	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1337	+ $this->lastFourOfAccountNumber = $map[ $mapKeyName ];
1338	+ }
1339	+ $mapKeyName = $prefix . 'type';
1340	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1341	+ $this->type = $map[ $mapKeyName ];
1342	+ }
1343	+ $mapKeyName = $prefix . 'displayName';
1344	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1345	+ $this->displayName = $map[ $mapKeyName ];
1346	+ }
1347	+ $mapKeyName = $prefix . 'fundingSourceId';
1348	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1349	+ $this->fundingSourceId = $map[ $mapKeyName ];
1350	+ }
1351	+ $mapKeyName = $prefix . 'allowed';
1352	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1353	+ $this->allowed = $map[ $mapKeyName ];
1354	+ }
1355	+
1356	+ }
1357	+ }
1358	+ }
1359	+
1360	+
1361	+ /**
1362	+ * Amount to be charged to a particular funding source.
1363	+ */
1364	+ class FundingPlanCharge
1365	+ {
1366	+
1367	+ /**
1368	+ *
1369	+ * @access public
1370	+ * @var CurrencyType
1371	+ */
1372	+ public $charge;
1373	+
1374	+ /**
1375	+ *
1376	+ * @access public
1377	+ * @var FundingSource
1378	+ */
1379	+ public $fundingSource;
1380	+
1381	+
1382	+ public function init( $map = null, $prefix = '' )
1383	+ {
1384	+ if ( $map != null ) {
1385	+ if ( PPUtils::array_match_key( $map, $prefix . "charge." ) ) {
1386	+ $newPrefix = $prefix . "charge.";
1387	+ $this->charge = new CurrencyType();
1388	+ $this->charge->init( $map, $newPrefix );
1389	+ }
1390	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingSource." ) ) {
1391	+ $newPrefix = $prefix . "fundingSource.";
1392	+ $this->fundingSource = new FundingSource();
1393	+ $this->fundingSource->init( $map, $newPrefix );
1394	+ }
1395	+
1396	+ }
1397	+ }
1398	+ }
1399	+
1400	+
1401	+ /**
1402	+ * FundingPlan describes the funding sources to be used for a
1403	+ * specific payment.
1404	+ */
1405	+ class FundingPlan
1406	+ {
1407	+
1408	+ /**
1409	+ *
1410	+ * @access public
1411	+ * @var string
1412	+ */
1413	+ public $fundingPlanId;
1414	+
1415	+ /**
1416	+ *
1417	+ * @access public
1418	+ * @var CurrencyType
1419	+ */
1420	+ public $fundingAmount;
1421	+
1422	+ /**
1423	+ *
1424	+ * @access public
1425	+ * @var FundingSource
1426	+ */
1427	+ public $backupFundingSource;
1428	+
1429	+ /**
1430	+ *
1431	+ * @access public
1432	+ * @var CurrencyType
1433	+ */
1434	+ public $senderFees;
1435	+
1436	+ /**
1437	+ *
1438	+ * @access public
1439	+ * @var CurrencyConversion
1440	+ */
1441	+ public $currencyConversion;
1442	+
1443	+ /**
1444	+ *
1445	+ * @array
1446	+ * @access public
1447	+ * @var FundingPlanCharge
1448	+ */
1449	+ public $charge;
1450	+
1451	+
1452	+ public function init( $map = null, $prefix = '' )
1453	+ {
1454	+ if ( $map != null ) {
1455	+ $mapKeyName = $prefix . 'fundingPlanId';
1456	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1457	+ $this->fundingPlanId = $map[ $mapKeyName ];
1458	+ }
1459	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingAmount." ) ) {
1460	+ $newPrefix = $prefix . "fundingAmount.";
1461	+ $this->fundingAmount = new CurrencyType();
1462	+ $this->fundingAmount->init( $map, $newPrefix );
1463	+ }
1464	+ if ( PPUtils::array_match_key( $map, $prefix . "backupFundingSource." ) ) {
1465	+ $newPrefix = $prefix . "backupFundingSource.";
1466	+ $this->backupFundingSource = new FundingSource();
1467	+ $this->backupFundingSource->init( $map, $newPrefix );
1468	+ }
1469	+ if ( PPUtils::array_match_key( $map, $prefix . "senderFees." ) ) {
1470	+ $newPrefix = $prefix . "senderFees.";
1471	+ $this->senderFees = new CurrencyType();
1472	+ $this->senderFees->init( $map, $newPrefix );
1473	+ }
1474	+ if ( PPUtils::array_match_key( $map, $prefix . "currencyConversion." ) ) {
1475	+ $newPrefix = $prefix . "currencyConversion.";
1476	+ $this->currencyConversion = new CurrencyConversion();
1477	+ $this->currencyConversion->init( $map, $newPrefix );
1478	+ }
1479	+ $i = 0;
1480	+ while ( true ) {
1481	+ if ( PPUtils::array_match_key( $map, $prefix . "charge($i)" ) ) {
1482	+ $newPrefix = $prefix . "charge($i).";
1483	+ $this->charge[ $i ] = new FundingPlanCharge();
1484	+ $this->charge[ $i ]->init( $map, $newPrefix );
1485	+ } else {
1486	+ break;
1487	+ }
1488	+ $i++;
1489	+ }
1490	+
1491	+ }
1492	+ }
1493	+ }
1494	+
1495	+
1496	+ /**
1497	+ * Details about the party that initiated this payment. The API
1498	+ * user is making this payment on behalf of the initiator. The
1499	+ * initiator can simply be an institution or a customer of the
1500	+ * institution.
1501	+ */
1502	+ class InitiatingEntity
1503	+ {
1504	+
1505	+ /**
1506	+ *
1507	+ * @access public
1508	+ * @var InstitutionCustomer
1509	+ */
1510	+ public $institutionCustomer;
1511	+
1512	+
1513	+ public function toNVPString( $prefix = '' )
1514	+ {
1515	+ $str = '';
1516	+ $delim = '';
1517	+ if ( $this->institutionCustomer != null ) {
1518	+ $newPrefix = $prefix . 'institutionCustomer.';
1519	+ $str .= $delim . call_user_func( array( $this->institutionCustomer, 'toNVPString' ), $newPrefix );
1520	+ $delim = '&';
1521	+ }
1522	+
1523	+ return $str;
1524	+ }
1525	+
1526	+ public function init( $map = null, $prefix = '' )
1527	+ {
1528	+ if ( $map != null ) {
1529	+ if ( PPUtils::array_match_key( $map, $prefix . "institutionCustomer." ) ) {
1530	+ $newPrefix = $prefix . "institutionCustomer.";
1531	+ $this->institutionCustomer = new InstitutionCustomer();
1532	+ $this->institutionCustomer->init( $map, $newPrefix );
1533	+ }
1534	+
1535	+ }
1536	+ }
1537	+ }
1538	+
1539	+
1540	+ /**
1541	+ * The customer of the initiating institution
1542	+ */
1543	+ class InstitutionCustomer
1544	+ {
1545	+
1546	+ /**
1547	+ * The unique identifier as assigned to the institution.
1548	+ * @access public
1549	+ * @var string
1550	+ */
1551	+ public $institutionId;
1552	+
1553	+ /**
1554	+ * The first (given) name of the end consumer as known by the
1555	+ * institution.
1556	+ * @access public
1557	+ * @var string
1558	+ */
1559	+ public $firstName;
1560	+
1561	+ /**
1562	+ * The last (family) name of the end consumer as known by the
1563	+ * institution.
1564	+ * @access public
1565	+ * @var string
1566	+ */
1567	+ public $lastName;
1568	+
1569	+ /**
1570	+ * The full name of the end consumer as known by the
1571	+ * institution.
1572	+ * @access public
1573	+ * @var string
1574	+ */
1575	+ public $displayName;
1576	+
1577	+ /**
1578	+ * The unique identifier as assigned to the end consumer by the
1579	+ * institution.
1580	+ * @access public
1581	+ * @var string
1582	+ */
1583	+ public $institutionCustomerId;
1584	+
1585	+ /**
1586	+ * The two-character ISO country code of the home country of
1587	+ * the end consumer
1588	+ * @access public
1589	+ * @var string
1590	+ */
1591	+ public $countryCode;
1592	+
1593	+ /**
1594	+ *
1595	+ * @access public
1596	+ * @var string
1597	+ */
1598	+ public $email;
1599	+
1600	+ /**
1601	+ * Constructor with arguments
1602	+ */
1603	+ public function __construct( $institutionId = null, $firstName = null, $lastName = null, $displayName = null, $institutionCustomerId = null, $countryCode = null )
1604	+ {
1605	+ $this->institutionId = $institutionId;
1606	+ $this->firstName = $firstName;
1607	+ $this->lastName = $lastName;
1608	+ $this->displayName = $displayName;
1609	+ $this->institutionCustomerId = $institutionCustomerId;
1610	+ $this->countryCode = $countryCode;
1611	+ }
1612	+
1613	+
1614	+ public function toNVPString( $prefix = '' )
1615	+ {
1616	+ $str = '';
1617	+ $delim = '';
1618	+ if ( $this->institutionId != null ) {
1619	+ $str .= $delim . $prefix . 'institutionId=' . urlencode( $this->institutionId );
1620	+ $delim = '&';
1621	+ }
1622	+ if ( $this->firstName != null ) {
1623	+ $str .= $delim . $prefix . 'firstName=' . urlencode( $this->firstName );
1624	+ $delim = '&';
1625	+ }
1626	+ if ( $this->lastName != null ) {
1627	+ $str .= $delim . $prefix . 'lastName=' . urlencode( $this->lastName );
1628	+ $delim = '&';
1629	+ }
1630	+ if ( $this->displayName != null ) {
1631	+ $str .= $delim . $prefix . 'displayName=' . urlencode( $this->displayName );
1632	+ $delim = '&';
1633	+ }
1634	+ if ( $this->institutionCustomerId != null ) {
1635	+ $str .= $delim . $prefix . 'institutionCustomerId=' . urlencode( $this->institutionCustomerId );
1636	+ $delim = '&';
1637	+ }
1638	+ if ( $this->countryCode != null ) {
1639	+ $str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
1640	+ $delim = '&';
1641	+ }
1642	+ if ( $this->email != null ) {
1643	+ $str .= $delim . $prefix . 'email=' . urlencode( $this->email );
1644	+ $delim = '&';
1645	+ }
1646	+
1647	+ return $str;
1648	+ }
1649	+
1650	+ public function init( $map = null, $prefix = '' )
1651	+ {
1652	+ if ( $map != null ) {
1653	+ $mapKeyName = $prefix . 'institutionId';
1654	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1655	+ $this->institutionId = $map[ $mapKeyName ];
1656	+ }
1657	+ $mapKeyName = $prefix . 'firstName';
1658	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1659	+ $this->firstName = $map[ $mapKeyName ];
1660	+ }
1661	+ $mapKeyName = $prefix . 'lastName';
1662	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1663	+ $this->lastName = $map[ $mapKeyName ];
1664	+ }
1665	+ $mapKeyName = $prefix . 'displayName';
1666	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1667	+ $this->displayName = $map[ $mapKeyName ];
1668	+ }
1669	+ $mapKeyName = $prefix . 'institutionCustomerId';
1670	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1671	+ $this->institutionCustomerId = $map[ $mapKeyName ];
1672	+ }
1673	+ $mapKeyName = $prefix . 'countryCode';
1674	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1675	+ $this->countryCode = $map[ $mapKeyName ];
1676	+ }
1677	+ $mapKeyName = $prefix . 'email';
1678	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1679	+ $this->email = $map[ $mapKeyName ];
1680	+ }
1681	+
1682	+ }
1683	+ }
1684	+ }
1685	+
1686	+
1687	+ /**
1688	+ * Describes an individual item for an invoice.
1689	+ */
1690	+ class InvoiceItem
1691	+ {
1692	+
1693	+ /**
1694	+ *
1695	+ * @access public
1696	+ * @var string
1697	+ */
1698	+ public $name;
1699	+
1700	+ /**
1701	+ *
1702	+ * @access public
1703	+ * @var string
1704	+ */
1705	+ public $identifier;
1706	+
1707	+ /**
1708	+ *
1709	+ * @access public
1710	+ * @var double
1711	+ */
1712	+ public $price;
1713	+
1714	+ /**
1715	+ *
1716	+ * @access public
1717	+ * @var double
1718	+ */
1719	+ public $itemPrice;
1720	+
1721	+ /**
1722	+ *
1723	+ * @access public
1724	+ * @var integer
1725	+ */
1726	+ public $itemCount;
1727	+
1728	+
1729	+ public function toNVPString( $prefix = '' )
1730	+ {
1731	+ $str = '';
1732	+ $delim = '';
1733	+ if ( $this->name != null ) {
1734	+ $str .= $delim . $prefix . 'name=' . urlencode( $this->name );
1735	+ $delim = '&';
1736	+ }
1737	+ if ( $this->identifier != null ) {
1738	+ $str .= $delim . $prefix . 'identifier=' . urlencode( $this->identifier );
1739	+ $delim = '&';
1740	+ }
1741	+ if ( $this->price != null ) {
1742	+ $str .= $delim . $prefix . 'price=' . urlencode( $this->price );
1743	+ $delim = '&';
1744	+ }
1745	+ if ( $this->itemPrice != null ) {
1746	+ $str .= $delim . $prefix . 'itemPrice=' . urlencode( $this->itemPrice );
1747	+ $delim = '&';
1748	+ }
1749	+ if ( $this->itemCount != null ) {
1750	+ $str .= $delim . $prefix . 'itemCount=' . urlencode( $this->itemCount );
1751	+ $delim = '&';
1752	+ }
1753	+
1754	+ return $str;
1755	+ }
1756	+
1757	+ public function init( $map = null, $prefix = '' )
1758	+ {
1759	+ if ( $map != null ) {
1760	+ $mapKeyName = $prefix . 'name';
1761	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1762	+ $this->name = $map[ $mapKeyName ];
1763	+ }
1764	+ $mapKeyName = $prefix . 'identifier';
1765	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1766	+ $this->identifier = $map[ $mapKeyName ];
1767	+ }
1768	+ $mapKeyName = $prefix . 'price';
1769	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1770	+ $this->price = $map[ $mapKeyName ];
1771	+ }
1772	+ $mapKeyName = $prefix . 'itemPrice';
1773	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1774	+ $this->itemPrice = $map[ $mapKeyName ];
1775	+ }
1776	+ $mapKeyName = $prefix . 'itemCount';
1777	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1778	+ $this->itemCount = $map[ $mapKeyName ];
1779	+ }
1780	+
1781	+ }
1782	+ }
1783	+ }
1784	+
1785	+
1786	+ /**
1787	+ * Describes a payment for a particular receiver (merchant),
1788	+ * contains list of additional per item details.
1789	+ */
1790	+ class InvoiceData
1791	+ {
1792	+
1793	+ /**
1794	+ *
1795	+ * @array
1796	+ * @access public
1797	+ * @var InvoiceItem
1798	+ */
1799	+ public $item;
1800	+
1801	+ /**
1802	+ *
1803	+ * @access public
1804	+ * @var double
1805	+ */
1806	+ public $totalTax;
1807	+
1808	+ /**
1809	+ *
1810	+ * @access public
1811	+ * @var double
1812	+ */
1813	+ public $totalShipping;
1814	+
1815	+
1816	+ public function toNVPString( $prefix = '' )
1817	+ {
1818	+ $str = '';
1819	+ $delim = '';
1820	+ for ( $i = 0; $i < count( $this->item ); $i++ ) {
1821	+ $newPrefix = $prefix . "item($i).";
1822	+ $str .= $delim . call_user_func( array( $this->item[ $i ], 'toNVPString' ), $newPrefix );
1823	+ $delim = '&';
1824	+ }
1825	+ if ( $this->totalTax != null ) {
1826	+ $str .= $delim . $prefix . 'totalTax=' . urlencode( $this->totalTax );
1827	+ $delim = '&';
1828	+ }
1829	+ if ( $this->totalShipping != null ) {
1830	+ $str .= $delim . $prefix . 'totalShipping=' . urlencode( $this->totalShipping );
1831	+ $delim = '&';
1832	+ }
1833	+
1834	+ return $str;
1835	+ }
1836	+
1837	+ public function init( $map = null, $prefix = '' )
1838	+ {
1839	+ if ( $map != null ) {
1840	+ $i = 0;
1841	+ while ( true ) {
1842	+ if ( PPUtils::array_match_key( $map, $prefix . "item($i)" ) ) {
1843	+ $newPrefix = $prefix . "item($i).";
1844	+ $this->item[ $i ] = new InvoiceItem();
1845	+ $this->item[ $i ]->init( $map, $newPrefix );
1846	+ } else {
1847	+ break;
1848	+ }
1849	+ $i++;
1850	+ }
1851	+ $mapKeyName = $prefix . 'totalTax';
1852	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1853	+ $this->totalTax = $map[ $mapKeyName ];
1854	+ }
1855	+ $mapKeyName = $prefix . 'totalShipping';
1856	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
1857	+ $this->totalShipping = $map[ $mapKeyName ];
1858	+ }
1859	+
1860	+ }
1861	+ }
1862	+ }
1863	+
1864	+
1865	+ /**
1866	+ * The error that resulted from an attempt to make a payment to
1867	+ * a receiver.
1868	+ */
1869	+ class PayError
1870	+ {
1871	+
1872	+ /**
1873	+ *
1874	+ * @access public
1875	+ * @var Receiver
1876	+ */
1877	+ public $receiver;
1878	+
1879	+ /**
1880	+ *
1881	+ * @access public
1882	+ * @var ErrorData
1883	+ */
1884	+ public $error;
1885	+
1886	+
1887	+ public function init( $map = null, $prefix = '' )
1888	+ {
1889	+ if ( $map != null ) {
1890	+ if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
1891	+ $newPrefix = $prefix . "receiver.";
1892	+ $this->receiver = new Receiver();
1893	+ $this->receiver->init( $map, $newPrefix );
1894	+ }
1895	+ if ( PPUtils::array_match_key( $map, $prefix . "error." ) ) {
1896	+ $newPrefix = $prefix . "error.";
1897	+ $this->error = new ErrorData();
1898	+ $this->error->init( $map, $newPrefix );
1899	+ }
1900	+
1901	+ }
1902	+ }
1903	+ }
1904	+
1905	+
1906	+ /**
1907	+ *
1908	+ */
1909	+ class PayErrorList
1910	+ {
1911	+
1912	+ /**
1913	+ *
1914	+ * @array
1915	+ * @access public
1916	+ * @var PayError
1917	+ */
1918	+ public $payError;
1919	+
1920	+
1921	+ public function init( $map = null, $prefix = '' )
1922	+ {
1923	+ if ( $map != null ) {
1924	+ $i = 0;
1925	+ while ( true ) {
1926	+ if ( PPUtils::array_match_key( $map, $prefix . "payError($i)" ) ) {
1927	+ $newPrefix = $prefix . "payError($i).";
1928	+ $this->payError[ $i ] = new PayError();
1929	+ $this->payError[ $i ]->init( $map, $newPrefix );
1930	+ } else {
1931	+ break;
1932	+ }
1933	+ $i++;
1934	+ }
1935	+
1936	+ }
1937	+ }
1938	+ }
1939	+
1940	+
1941	+ /**
1942	+ * PaymentInfo represents the payment attempt made to a
1943	+ * Receiver of a PayRequest. If the execution of the payment
1944	+ * has not yet completed, there will not be any transaction
1945	+ * details.
1946	+ */
1947	+ class PaymentInfo
1948	+ {
1949	+
1950	+ /**
1951	+ *
1952	+ * @access public
1953	+ * @var string
1954	+ */
1955	+ public $transactionId;
1956	+
1957	+ /**
1958	+ *
1959	+ * @access public
1960	+ * @var string
1961	+ */
1962	+ public $transactionStatus;
1963	+
1964	+ /**
1965	+ *
1966	+ * @access public
1967	+ * @var Receiver
1968	+ */
1969	+ public $receiver;
1970	+
1971	+ /**
1972	+ *
1973	+ * @access public
1974	+ * @var double
1975	+ */
1976	+ public $refundedAmount;
1977	+
1978	+ /**
1979	+ *
1980	+ * @access public
1981	+ * @var boolean
1982	+ */
1983	+ public $pendingRefund;
1984	+
1985	+ /**
1986	+ *
1987	+ * @access public
1988	+ * @var string
1989	+ */
1990	+ public $senderTransactionId;
1991	+
1992	+ /**
1993	+ *
1994	+ * @access public
1995	+ * @var string
1996	+ */
1997	+ public $senderTransactionStatus;
1998	+
1999	+ /**
2000	+ *
2001	+ * @access public
2002	+ * @var string
2003	+ */
2004	+ public $pendingReason;
2005	+
2006	+
2007	+ public function init( $map = null, $prefix = '' )
2008	+ {
2009	+ if ( $map != null ) {
2010	+ $mapKeyName = $prefix . 'transactionId';
2011	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2012	+ $this->transactionId = $map[ $mapKeyName ];
2013	+ }
2014	+ $mapKeyName = $prefix . 'transactionStatus';
2015	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2016	+ $this->transactionStatus = $map[ $mapKeyName ];
2017	+ }
2018	+ if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
2019	+ $newPrefix = $prefix . "receiver.";
2020	+ $this->receiver = new Receiver();
2021	+ $this->receiver->init( $map, $newPrefix );
2022	+ }
2023	+ $mapKeyName = $prefix . 'refundedAmount';
2024	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2025	+ $this->refundedAmount = $map[ $mapKeyName ];
2026	+ }
2027	+ $mapKeyName = $prefix . 'pendingRefund';
2028	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2029	+ $this->pendingRefund = $map[ $mapKeyName ];
2030	+ }
2031	+ $mapKeyName = $prefix . 'senderTransactionId';
2032	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2033	+ $this->senderTransactionId = $map[ $mapKeyName ];
2034	+ }
2035	+ $mapKeyName = $prefix . 'senderTransactionStatus';
2036	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2037	+ $this->senderTransactionStatus = $map[ $mapKeyName ];
2038	+ }
2039	+ $mapKeyName = $prefix . 'pendingReason';
2040	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2041	+ $this->pendingReason = $map[ $mapKeyName ];
2042	+ }
2043	+
2044	+ }
2045	+ }
2046	+ }
2047	+
2048	+
2049	+ /**
2050	+ *
2051	+ */
2052	+ class PaymentInfoList
2053	+ {
2054	+
2055	+ /**
2056	+ *
2057	+ * @array
2058	+ * @access public
2059	+ * @var PaymentInfo
2060	+ */
2061	+ public $paymentInfo;
2062	+
2063	+
2064	+ public function init( $map = null, $prefix = '' )
2065	+ {
2066	+ if ( $map != null ) {
2067	+ $i = 0;
2068	+ while ( true ) {
2069	+ if ( PPUtils::array_match_key( $map, $prefix . "paymentInfo($i)" ) ) {
2070	+ $newPrefix = $prefix . "paymentInfo($i).";
2071	+ $this->paymentInfo[ $i ] = new PaymentInfo();
2072	+ $this->paymentInfo[ $i ]->init( $map, $newPrefix );
2073	+ } else {
2074	+ break;
2075	+ }
2076	+ $i++;
2077	+ }
2078	+
2079	+ }
2080	+ }
2081	+ }
2082	+
2083	+
2084	+ /**
2085	+ * Receiver is the party where funds are transferred to. A
2086	+ * primary receiver receives a payment directly from the sender
2087	+ * in a chained split payment. A primary receiver should not be
2088	+ * specified when making a single or parallel split payment.
2089	+ */
2090	+ class Receiver
2091	+ {
2092	+
2093	+ /**
2094	+ *
2095	+ * @access public
2096	+ * @var double
2097	+ */
2098	+ public $amount;
2099	+
2100	+ /**
2101	+ *
2102	+ * @access public
2103	+ * @var string
2104	+ */
2105	+ public $email;
2106	+
2107	+ /**
2108	+ *
2109	+ * @access public
2110	+ * @var PhoneNumberType
2111	+ */
2112	+ public $phone;
2113	+
2114	+ /**
2115	+ *
2116	+ * @access public
2117	+ * @var boolean
2118	+ */
2119	+ public $primary;
2120	+
2121	+ /**
2122	+ *
2123	+ * @access public
2124	+ * @var string
2125	+ */
2126	+ public $invoiceId;
2127	+
2128	+ /**
2129	+ *
2130	+ * @access public
2131	+ * @var string
2132	+ */
2133	+ public $paymentType;
2134	+
2135	+ /**
2136	+ *
2137	+ * @access public
2138	+ * @var string
2139	+ */
2140	+ public $paymentSubType;
2141	+
2142	+ /**
2143	+ * Constructor with arguments
2144	+ */
2145	+ public function __construct( $amount = null )
2146	+ {
2147	+ $this->amount = $amount;
2148	+ }
2149	+
2150	+
2151	+ public function toNVPString( $prefix = '' )
2152	+ {
2153	+ $str = '';
2154	+ $delim = '';
2155	+ if ( $this->amount != null ) {
2156	+ $str .= $delim . $prefix . 'amount=' . urlencode( $this->amount );
2157	+ $delim = '&';
2158	+ }
2159	+ if ( $this->email != null ) {
2160	+ $str .= $delim . $prefix . 'email=' . urlencode( $this->email );
2161	+ $delim = '&';
2162	+ }
2163	+ if ( $this->phone != null ) {
2164	+ $newPrefix = $prefix . 'phone.';
2165	+ $str .= $delim . call_user_func( array( $this->phone, 'toNVPString' ), $newPrefix );
2166	+ $delim = '&';
2167	+ }
2168	+ if ( $this->primary != null ) {
2169	+ $str .= $delim . $prefix . 'primary=' . urlencode( $this->primary );
2170	+ $delim = '&';
2171	+ }
2172	+ if ( $this->invoiceId != null ) {
2173	+ $str .= $delim . $prefix . 'invoiceId=' . urlencode( $this->invoiceId );
2174	+ $delim = '&';
2175	+ }
2176	+ if ( $this->paymentType != null ) {
2177	+ $str .= $delim . $prefix . 'paymentType=' . urlencode( $this->paymentType );
2178	+ $delim = '&';
2179	+ }
2180	+ if ( $this->paymentSubType != null ) {
2181	+ $str .= $delim . $prefix . 'paymentSubType=' . urlencode( $this->paymentSubType );
2182	+ $delim = '&';
2183	+ }
2184	+
2185	+ return $str;
2186	+ }
2187	+
2188	+ public function init( $map = null, $prefix = '' )
2189	+ {
2190	+ if ( $map != null ) {
2191	+ $mapKeyName = $prefix . 'amount';
2192	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2193	+ $this->amount = $map[ $mapKeyName ];
2194	+ }
2195	+ $mapKeyName = $prefix . 'email';
2196	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2197	+ $this->email = $map[ $mapKeyName ];
2198	+ }
2199	+ if ( PPUtils::array_match_key( $map, $prefix . "phone." ) ) {
2200	+ $newPrefix = $prefix . "phone.";
2201	+ $this->phone = new PhoneNumberType();
2202	+ $this->phone->init( $map, $newPrefix );
2203	+ }
2204	+ $mapKeyName = $prefix . 'primary';
2205	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2206	+ $this->primary = $map[ $mapKeyName ];
2207	+ }
2208	+ $mapKeyName = $prefix . 'invoiceId';
2209	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2210	+ $this->invoiceId = $map[ $mapKeyName ];
2211	+ }
2212	+ $mapKeyName = $prefix . 'paymentType';
2213	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2214	+ $this->paymentType = $map[ $mapKeyName ];
2215	+ }
2216	+ $mapKeyName = $prefix . 'paymentSubType';
2217	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2218	+ $this->paymentSubType = $map[ $mapKeyName ];
2219	+ }
2220	+
2221	+ }
2222	+ }
2223	+ }
2224	+
2225	+
2226	+ /**
2227	+ *
2228	+ */
2229	+ class ReceiverList
2230	+ {
2231	+
2232	+ /**
2233	+ *
2234	+ * @array
2235	+ * @access public
2236	+ * @var Receiver
2237	+ */
2238	+ public $receiver;
2239	+
2240	+ /**
2241	+ * Constructor with arguments
2242	+ */
2243	+ public function __construct( $receiver = null )
2244	+ {
2245	+ $this->receiver = $receiver;
2246	+ }
2247	+
2248	+
2249	+ public function toNVPString( $prefix = '' )
2250	+ {
2251	+ $str = '';
2252	+ $delim = '';
2253	+ for ( $i = 0; $i < count( $this->receiver ); $i++ ) {
2254	+ $newPrefix = $prefix . "receiver($i).";
2255	+ $str .= $delim . call_user_func( array( $this->receiver[ $i ], 'toNVPString' ), $newPrefix );
2256	+ $delim = '&';
2257	+ }
2258	+
2259	+ return $str;
2260	+ }
2261	+
2262	+ }
2263	+
2264	+
2265	+ /**
2266	+ * The sender identifier type contains information to identify
2267	+ * a PayPal account.
2268	+ */
2269	+ class ReceiverIdentifier extends AccountIdentifier
2270	+ {
2271	+
2272	+
2273	+ public function toNVPString( $prefix = '' )
2274	+ {
2275	+ $str = parent::toNVPString( $prefix );
2276	+ if ( strlen( $str ) > 0 ) {
2277	+ $delim = '&';
2278	+ } else {
2279	+ $delim = '';
2280	+ }
2281	+
2282	+ return $str;
2283	+ }
2284	+
2285	+ public function init( $map = null, $prefix = '' )
2286	+ {
2287	+ if ( $map != null ) {
2288	+
2289	+ }
2290	+ }
2291	+ }
2292	+
2293	+
2294	+ /**
2295	+ * Options that apply to the receiver of a payment, allows
2296	+ * setting additional details for payment using invoice.
2297	+ */
2298	+ class ReceiverOptions
2299	+ {
2300	+
2301	+ /**
2302	+ *
2303	+ * @access public
2304	+ * @var string
2305	+ */
2306	+ public $description;
2307	+
2308	+ /**
2309	+ *
2310	+ * @access public
2311	+ * @var string
2312	+ */
2313	+ public $customId;
2314	+
2315	+ /**
2316	+ *
2317	+ * @access public
2318	+ * @var InvoiceData
2319	+ */
2320	+ public $invoiceData;
2321	+
2322	+ /**
2323	+ *
2324	+ * @access public
2325	+ * @var ReceiverIdentifier
2326	+ */
2327	+ public $receiver;
2328	+
2329	+ /**
2330	+ *
2331	+ * @access public
2332	+ * @var string
2333	+ */
2334	+ public $referrerCode;
2335	+
2336	+ /**
2337	+ * Constructor with arguments
2338	+ */
2339	+ public function __construct( $receiver = null )
2340	+ {
2341	+ $this->receiver = $receiver;
2342	+ }
2343	+
2344	+
2345	+ public function toNVPString( $prefix = '' )
2346	+ {
2347	+ $str = '';
2348	+ $delim = '';
2349	+ if ( $this->description != null ) {
2350	+ $str .= $delim . $prefix . 'description=' . urlencode( $this->description );
2351	+ $delim = '&';
2352	+ }
2353	+ if ( $this->customId != null ) {
2354	+ $str .= $delim . $prefix . 'customId=' . urlencode( $this->customId );
2355	+ $delim = '&';
2356	+ }
2357	+ if ( $this->invoiceData != null ) {
2358	+ $newPrefix = $prefix . 'invoiceData.';
2359	+ $str .= $delim . call_user_func( array( $this->invoiceData, 'toNVPString' ), $newPrefix );
2360	+ $delim = '&';
2361	+ }
2362	+ if ( $this->receiver != null ) {
2363	+ $newPrefix = $prefix . 'receiver.';
2364	+ $str .= $delim . call_user_func( array( $this->receiver, 'toNVPString' ), $newPrefix );
2365	+ $delim = '&';
2366	+ }
2367	+ if ( $this->referrerCode != null ) {
2368	+ $str .= $delim . $prefix . 'referrerCode=' . urlencode( $this->referrerCode );
2369	+ $delim = '&';
2370	+ }
2371	+
2372	+ return $str;
2373	+ }
2374	+
2375	+ public function init( $map = null, $prefix = '' )
2376	+ {
2377	+ if ( $map != null ) {
2378	+ $mapKeyName = $prefix . 'description';
2379	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2380	+ $this->description = $map[ $mapKeyName ];
2381	+ }
2382	+ $mapKeyName = $prefix . 'customId';
2383	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2384	+ $this->customId = $map[ $mapKeyName ];
2385	+ }
2386	+ if ( PPUtils::array_match_key( $map, $prefix . "invoiceData." ) ) {
2387	+ $newPrefix = $prefix . "invoiceData.";
2388	+ $this->invoiceData = new InvoiceData();
2389	+ $this->invoiceData->init( $map, $newPrefix );
2390	+ }
2391	+ if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
2392	+ $newPrefix = $prefix . "receiver.";
2393	+ $this->receiver = new ReceiverIdentifier();
2394	+ $this->receiver->init( $map, $newPrefix );
2395	+ }
2396	+ $mapKeyName = $prefix . 'referrerCode';
2397	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2398	+ $this->referrerCode = $map[ $mapKeyName ];
2399	+ }
2400	+
2401	+ }
2402	+ }
2403	+ }
2404	+
2405	+
2406	+ /**
2407	+ * RefundInfo represents the refund attempt made to a Receiver
2408	+ * of a PayRequest.
2409	+ */
2410	+ class RefundInfo
2411	+ {
2412	+
2413	+ /**
2414	+ *
2415	+ * @access public
2416	+ * @var Receiver
2417	+ */
2418	+ public $receiver;
2419	+
2420	+ /**
2421	+ *
2422	+ * @access public
2423	+ * @var string
2424	+ */
2425	+ public $refundStatus;
2426	+
2427	+ /**
2428	+ *
2429	+ * @access public
2430	+ * @var double
2431	+ */
2432	+ public $refundNetAmount;
2433	+
2434	+ /**
2435	+ *
2436	+ * @access public
2437	+ * @var double
2438	+ */
2439	+ public $refundFeeAmount;
2440	+
2441	+ /**
2442	+ *
2443	+ * @access public
2444	+ * @var double
2445	+ */
2446	+ public $refundGrossAmount;
2447	+
2448	+ /**
2449	+ *
2450	+ * @access public
2451	+ * @var double
2452	+ */
2453	+ public $totalOfAllRefunds;
2454	+
2455	+ /**
2456	+ *
2457	+ * @access public
2458	+ * @var boolean
2459	+ */
2460	+ public $refundHasBecomeFull;
2461	+
2462	+ /**
2463	+ *
2464	+ * @access public
2465	+ * @var string
2466	+ */
2467	+ public $encryptedRefundTransactionId;
2468	+
2469	+ /**
2470	+ *
2471	+ * @access public
2472	+ * @var string
2473	+ */
2474	+ public $refundTransactionStatus;
2475	+
2476	+ /**
2477	+ *
2478	+ * @access public
2479	+ * @var ErrorList
2480	+ */
2481	+ public $errorList;
2482	+
2483	+
2484	+ public function init( $map = null, $prefix = '' )
2485	+ {
2486	+ if ( $map != null ) {
2487	+ if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
2488	+ $newPrefix = $prefix . "receiver.";
2489	+ $this->receiver = new Receiver();
2490	+ $this->receiver->init( $map, $newPrefix );
2491	+ }
2492	+ $mapKeyName = $prefix . 'refundStatus';
2493	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2494	+ $this->refundStatus = $map[ $mapKeyName ];
2495	+ }
2496	+ $mapKeyName = $prefix . 'refundNetAmount';
2497	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2498	+ $this->refundNetAmount = $map[ $mapKeyName ];
2499	+ }
2500	+ $mapKeyName = $prefix . 'refundFeeAmount';
2501	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2502	+ $this->refundFeeAmount = $map[ $mapKeyName ];
2503	+ }
2504	+ $mapKeyName = $prefix . 'refundGrossAmount';
2505	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2506	+ $this->refundGrossAmount = $map[ $mapKeyName ];
2507	+ }
2508	+ $mapKeyName = $prefix . 'totalOfAllRefunds';
2509	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2510	+ $this->totalOfAllRefunds = $map[ $mapKeyName ];
2511	+ }
2512	+ $mapKeyName = $prefix . 'refundHasBecomeFull';
2513	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2514	+ $this->refundHasBecomeFull = $map[ $mapKeyName ];
2515	+ }
2516	+ $mapKeyName = $prefix . 'encryptedRefundTransactionId';
2517	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2518	+ $this->encryptedRefundTransactionId = $map[ $mapKeyName ];
2519	+ }
2520	+ $mapKeyName = $prefix . 'refundTransactionStatus';
2521	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2522	+ $this->refundTransactionStatus = $map[ $mapKeyName ];
2523	+ }
2524	+ if ( PPUtils::array_match_key( $map, $prefix . "errorList." ) ) {
2525	+ $newPrefix = $prefix . "errorList.";
2526	+ $this->errorList = new ErrorList();
2527	+ $this->errorList->init( $map, $newPrefix );
2528	+ }
2529	+
2530	+ }
2531	+ }
2532	+ }
2533	+
2534	+
2535	+ /**
2536	+ *
2537	+ */
2538	+ class RefundInfoList
2539	+ {
2540	+
2541	+ /**
2542	+ *
2543	+ * @array
2544	+ * @access public
2545	+ * @var RefundInfo
2546	+ */
2547	+ public $refundInfo;
2548	+
2549	+
2550	+ public function init( $map = null, $prefix = '' )
2551	+ {
2552	+ if ( $map != null ) {
2553	+ $i = 0;
2554	+ while ( true ) {
2555	+ if ( PPUtils::array_match_key( $map, $prefix . "refundInfo($i)" ) ) {
2556	+ $newPrefix = $prefix . "refundInfo($i).";
2557	+ $this->refundInfo[ $i ] = new RefundInfo();
2558	+ $this->refundInfo[ $i ]->init( $map, $newPrefix );
2559	+ } else {
2560	+ break;
2561	+ }
2562	+ $i++;
2563	+ }
2564	+
2565	+ }
2566	+ }
2567	+ }
2568	+
2569	+
2570	+ /**
2571	+ * Options that apply to the sender of a payment.
2572	+ */
2573	+ class SenderOptions
2574	+ {
2575	+
2576	+ /**
2577	+ * Require the user to select a shipping address during the web
2578	+ * flow.
2579	+ * @access public
2580	+ * @var boolean
2581	+ */
2582	+ public $requireShippingAddressSelection;
2583	+
2584	+ /**
2585	+ *
2586	+ * @access public
2587	+ * @var string
2588	+ */
2589	+ public $referrerCode;
2590	+
2591	+
2592	+ public function toNVPString( $prefix = '' )
2593	+ {
2594	+ $str = '';
2595	+ $delim = '';
2596	+ if ( $this->requireShippingAddressSelection != null ) {
2597	+ $str .= $delim . $prefix . 'requireShippingAddressSelection=' . urlencode( $this->requireShippingAddressSelection );
2598	+ $delim = '&';
2599	+ }
2600	+ if ( $this->referrerCode != null ) {
2601	+ $str .= $delim . $prefix . 'referrerCode=' . urlencode( $this->referrerCode );
2602	+ $delim = '&';
2603	+ }
2604	+
2605	+ return $str;
2606	+ }
2607	+
2608	+ public function init( $map = null, $prefix = '' )
2609	+ {
2610	+ if ( $map != null ) {
2611	+ $mapKeyName = $prefix . 'requireShippingAddressSelection';
2612	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2613	+ $this->requireShippingAddressSelection = $map[ $mapKeyName ];
2614	+ }
2615	+ $mapKeyName = $prefix . 'referrerCode';
2616	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2617	+ $this->referrerCode = $map[ $mapKeyName ];
2618	+ }
2619	+
2620	+ }
2621	+ }
2622	+ }
2623	+
2624	+
2625	+ /**
2626	+ * Details about the payer's tax info passed in by the merchant
2627	+ * or partner.
2628	+ */
2629	+ class TaxIdDetails
2630	+ {
2631	+
2632	+ /**
2633	+ * Tax id of the merchant/business.
2634	+ * @access public
2635	+ * @var string
2636	+ */
2637	+ public $taxId;
2638	+
2639	+ /**
2640	+ * Tax type of the Tax Id.
2641	+ * @access public
2642	+ * @var string
2643	+ */
2644	+ public $taxIdType;
2645	+
2646	+
2647	+ public function toNVPString( $prefix = '' )
2648	+ {
2649	+ $str = '';
2650	+ $delim = '';
2651	+ if ( $this->taxId != null ) {
2652	+ $str .= $delim . $prefix . 'taxId=' . urlencode( $this->taxId );
2653	+ $delim = '&';
2654	+ }
2655	+ if ( $this->taxIdType != null ) {
2656	+ $str .= $delim . $prefix . 'taxIdType=' . urlencode( $this->taxIdType );
2657	+ $delim = '&';
2658	+ }
2659	+
2660	+ return $str;
2661	+ }
2662	+
2663	+ public function init( $map = null, $prefix = '' )
2664	+ {
2665	+ if ( $map != null ) {
2666	+ $mapKeyName = $prefix . 'taxId';
2667	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2668	+ $this->taxId = $map[ $mapKeyName ];
2669	+ }
2670	+ $mapKeyName = $prefix . 'taxIdType';
2671	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2672	+ $this->taxIdType = $map[ $mapKeyName ];
2673	+ }
2674	+
2675	+ }
2676	+ }
2677	+ }
2678	+
2679	+
2680	+ /**
2681	+ * The sender identifier type contains information to identify
2682	+ * a PayPal account.
2683	+ */
2684	+ class SenderIdentifier extends AccountIdentifier
2685	+ {
2686	+
2687	+ /**
2688	+ *
2689	+ * @access public
2690	+ * @var boolean
2691	+ */
2692	+ public $useCredentials;
2693	+
2694	+ /**
2695	+ *
2696	+ * @access public
2697	+ * @var TaxIdDetails
2698	+ */
2699	+ public $taxIdDetails;
2700	+
2701	+
2702	+ public function toNVPString( $prefix = '' )
2703	+ {
2704	+ $str = parent::toNVPString( $prefix );
2705	+ if ( strlen( $str ) > 0 ) {
2706	+ $delim = '&';
2707	+ } else {
2708	+ $delim = '';
2709	+ }
2710	+ if ( $this->useCredentials != null ) {
2711	+ $str .= $delim . $prefix . 'useCredentials=' . urlencode( $this->useCredentials );
2712	+ $delim = '&';
2713	+ }
2714	+ if ( $this->taxIdDetails != null ) {
2715	+ $newPrefix = $prefix . 'taxIdDetails.';
2716	+ $str .= $delim . call_user_func( array( $this->taxIdDetails, 'toNVPString' ), $newPrefix );
2717	+ $delim = '&';
2718	+ }
2719	+
2720	+ return $str;
2721	+ }
2722	+
2723	+ public function init( $map = null, $prefix = '' )
2724	+ {
2725	+ if ( $map != null ) {
2726	+ $mapKeyName = $prefix . 'useCredentials';
2727	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2728	+ $this->useCredentials = $map[ $mapKeyName ];
2729	+ }
2730	+ if ( PPUtils::array_match_key( $map, $prefix . "taxIdDetails." ) ) {
2731	+ $newPrefix = $prefix . "taxIdDetails.";
2732	+ $this->taxIdDetails = new TaxIdDetails();
2733	+ $this->taxIdDetails->init( $map, $newPrefix );
2734	+ }
2735	+
2736	+ }
2737	+ }
2738	+ }
2739	+
2740	+
2741	+ /**
2742	+ *
2743	+ */
2744	+ class UserLimit
2745	+ {
2746	+
2747	+ /**
2748	+ *
2749	+ * @access public
2750	+ * @var string
2751	+ */
2752	+ public $limitType;
2753	+
2754	+ /**
2755	+ *
2756	+ * @access public
2757	+ * @var CurrencyType
2758	+ */
2759	+ public $limitAmount;
2760	+
2761	+
2762	+ public function init( $map = null, $prefix = '' )
2763	+ {
2764	+ if ( $map != null ) {
2765	+ $mapKeyName = $prefix . 'limitType';
2766	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2767	+ $this->limitType = $map[ $mapKeyName ];
2768	+ }
2769	+ if ( PPUtils::array_match_key( $map, $prefix . "limitAmount." ) ) {
2770	+ $newPrefix = $prefix . "limitAmount.";
2771	+ $this->limitAmount = new CurrencyType();
2772	+ $this->limitAmount->init( $map, $newPrefix );
2773	+ }
2774	+
2775	+ }
2776	+ }
2777	+ }
2778	+
2779	+
2780	+ /**
2781	+ * This type contains the detailed warning information
2782	+ * resulting from the service operation.
2783	+ */
2784	+ class WarningData
2785	+ {
2786	+
2787	+ /**
2788	+ *
2789	+ * @access public
2790	+ * @var integer
2791	+ */
2792	+ public $warningId;
2793	+
2794	+ /**
2795	+ *
2796	+ * @access public
2797	+ * @var string
2798	+ */
2799	+ public $message;
2800	+
2801	+
2802	+ public function init( $map = null, $prefix = '' )
2803	+ {
2804	+ if ( $map != null ) {
2805	+ $mapKeyName = $prefix . 'warningId';
2806	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2807	+ $this->warningId = $map[ $mapKeyName ];
2808	+ }
2809	+ $mapKeyName = $prefix . 'message';
2810	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
2811	+ $this->message = $map[ $mapKeyName ];
2812	+ }
2813	+
2814	+ }
2815	+ }
2816	+ }
2817	+
2818	+
2819	+ /**
2820	+ *
2821	+ */
2822	+ class WarningDataList
2823	+ {
2824	+
2825	+ /**
2826	+ *
2827	+ * @array
2828	+ * @access public
2829	+ * @var WarningData
2830	+ */
2831	+ public $warningData;
2832	+
2833	+
2834	+ public function init( $map = null, $prefix = '' )
2835	+ {
2836	+ if ( $map != null ) {
2837	+ $i = 0;
2838	+ while ( true ) {
2839	+ if ( PPUtils::array_match_key( $map, $prefix . "warningData($i)" ) ) {
2840	+ $newPrefix = $prefix . "warningData($i).";
2841	+ $this->warningData[ $i ] = new WarningData();
2842	+ $this->warningData[ $i ]->init( $map, $newPrefix );
2843	+ } else {
2844	+ break;
2845	+ }
2846	+ $i++;
2847	+ }
2848	+
2849	+ }
2850	+ }
2851	+ }
2852	+
2853	+
2854	+ /**
2855	+ * The request to cancel a Preapproval.
2856	+ */
2857	+ class CancelPreapprovalRequest
2858	+ {
2859	+
2860	+ /**
2861	+ *
2862	+ * @access public
2863	+ * @var RequestEnvelope
2864	+ */
2865	+ public $requestEnvelope;
2866	+
2867	+ /**
2868	+ *
2869	+ * @access public
2870	+ * @var string
2871	+ */
2872	+ public $preapprovalKey;
2873	+
2874	+ /**
2875	+ * Constructor with arguments
2876	+ */
2877	+ public function __construct( $requestEnvelope = null, $preapprovalKey = null )
2878	+ {
2879	+ $this->requestEnvelope = $requestEnvelope;
2880	+ $this->preapprovalKey = $preapprovalKey;
2881	+ }
2882	+
2883	+
2884	+ public function toNVPString( $prefix = '' )
2885	+ {
2886	+ $str = '';
2887	+ $delim = '';
2888	+ if ( $this->requestEnvelope != null ) {
2889	+ $newPrefix = $prefix . 'requestEnvelope.';
2890	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
2891	+ $delim = '&';
2892	+ }
2893	+ if ( $this->preapprovalKey != null ) {
2894	+ $str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
2895	+ $delim = '&';
2896	+ }
2897	+
2898	+ return $str;
2899	+ }
2900	+
2901	+ }
2902	+
2903	+
2904	+ /**
2905	+ * The result of the CancelPreapprovalRequest.
2906	+ */
2907	+ class CancelPreapprovalResponse
2908	+ {
2909	+
2910	+ /**
2911	+ *
2912	+ * @access public
2913	+ * @var ResponseEnvelope
2914	+ */
2915	+ public $responseEnvelope;
2916	+
2917	+ /**
2918	+ *
2919	+ * @array
2920	+ * @access public
2921	+ * @var ErrorData
2922	+ */
2923	+ public $error;
2924	+
2925	+
2926	+ public function init( $map = null, $prefix = '' )
2927	+ {
2928	+ if ( $map != null ) {
2929	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
2930	+ $newPrefix = $prefix . "responseEnvelope.";
2931	+ $this->responseEnvelope = new ResponseEnvelope();
2932	+ $this->responseEnvelope->init( $map, $newPrefix );
2933	+ }
2934	+ $i = 0;
2935	+ while ( true ) {
2936	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
2937	+ $newPrefix = $prefix . "error($i).";
2938	+ $this->error[ $i ] = new ErrorData();
2939	+ $this->error[ $i ]->init( $map, $newPrefix );
2940	+ } else {
2941	+ break;
2942	+ }
2943	+ $i++;
2944	+ }
2945	+
2946	+ }
2947	+ }
2948	+ }
2949	+
2950	+
2951	+ /**
2952	+ * The request to confirm a Preapproval.
2953	+ */
2954	+ class ConfirmPreapprovalRequest
2955	+ {
2956	+
2957	+ /**
2958	+ *
2959	+ * @access public
2960	+ * @var RequestEnvelope
2961	+ */
2962	+ public $requestEnvelope;
2963	+
2964	+ /**
2965	+ *
2966	+ * @access public
2967	+ * @var string
2968	+ */
2969	+ public $preapprovalKey;
2970	+
2971	+ /**
2972	+ *
2973	+ * @access public
2974	+ * @var string
2975	+ */
2976	+ public $fundingSourceId;
2977	+
2978	+ /**
2979	+ *
2980	+ * @access public
2981	+ * @var string
2982	+ */
2983	+ public $pin;
2984	+
2985	+ /**
2986	+ * Constructor with arguments
2987	+ */
2988	+ public function __construct( $requestEnvelope = null, $preapprovalKey = null )
2989	+ {
2990	+ $this->requestEnvelope = $requestEnvelope;
2991	+ $this->preapprovalKey = $preapprovalKey;
2992	+ }
2993	+
2994	+
2995	+ public function toNVPString( $prefix = '' )
2996	+ {
2997	+ $str = '';
2998	+ $delim = '';
2999	+ if ( $this->requestEnvelope != null ) {
3000	+ $newPrefix = $prefix . 'requestEnvelope.';
3001	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3002	+ $delim = '&';
3003	+ }
3004	+ if ( $this->preapprovalKey != null ) {
3005	+ $str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
3006	+ $delim = '&';
3007	+ }
3008	+ if ( $this->fundingSourceId != null ) {
3009	+ $str .= $delim . $prefix . 'fundingSourceId=' . urlencode( $this->fundingSourceId );
3010	+ $delim = '&';
3011	+ }
3012	+ if ( $this->pin != null ) {
3013	+ $str .= $delim . $prefix . 'pin=' . urlencode( $this->pin );
3014	+ $delim = '&';
3015	+ }
3016	+
3017	+ return $str;
3018	+ }
3019	+
3020	+ }
3021	+
3022	+
3023	+ /**
3024	+ * The result of the ConfirmPreapprovalRequest.
3025	+ */
3026	+ class ConfirmPreapprovalResponse
3027	+ {
3028	+
3029	+ /**
3030	+ *
3031	+ * @access public
3032	+ * @var ResponseEnvelope
3033	+ */
3034	+ public $responseEnvelope;
3035	+
3036	+ /**
3037	+ *
3038	+ * @array
3039	+ * @access public
3040	+ * @var ErrorData
3041	+ */
3042	+ public $error;
3043	+
3044	+
3045	+ public function init( $map = null, $prefix = '' )
3046	+ {
3047	+ if ( $map != null ) {
3048	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3049	+ $newPrefix = $prefix . "responseEnvelope.";
3050	+ $this->responseEnvelope = new ResponseEnvelope();
3051	+ $this->responseEnvelope->init( $map, $newPrefix );
3052	+ }
3053	+ $i = 0;
3054	+ while ( true ) {
3055	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3056	+ $newPrefix = $prefix . "error($i).";
3057	+ $this->error[ $i ] = new ErrorData();
3058	+ $this->error[ $i ]->init( $map, $newPrefix );
3059	+ } else {
3060	+ break;
3061	+ }
3062	+ $i++;
3063	+ }
3064	+
3065	+ }
3066	+ }
3067	+ }
3068	+
3069	+
3070	+ /**
3071	+ * A request to convert one or more currencies into their
3072	+ * estimated values in other currencies.
3073	+ */
3074	+ class ConvertCurrencyRequest
3075	+ {
3076	+
3077	+ /**
3078	+ *
3079	+ * @access public
3080	+ * @var RequestEnvelope
3081	+ */
3082	+ public $requestEnvelope;
3083	+
3084	+ /**
3085	+ *
3086	+ * @access public
3087	+ * @var CurrencyList
3088	+ */
3089	+ public $baseAmountList;
3090	+
3091	+ /**
3092	+ *
3093	+ * @access public
3094	+ * @var CurrencyCodeList
3095	+ */
3096	+ public $convertToCurrencyList;
3097	+
3098	+ /**
3099	+ * The two-character ISO country code where fx suppposed to
3100	+ * happen
3101	+ * @access public
3102	+ * @var string
3103	+ */
3104	+ public $countryCode;
3105	+
3106	+ /**
3107	+ *
3108	+ * @access public
3109	+ * @var string
3110	+ */
3111	+ public $conversionType;
3112	+
3113	+ /**
3114	+ * Constructor with arguments
3115	+ */
3116	+ public function __construct( $requestEnvelope = null, $baseAmountList = null, $convertToCurrencyList = null )
3117	+ {
3118	+ $this->requestEnvelope = $requestEnvelope;
3119	+ $this->baseAmountList = $baseAmountList;
3120	+ $this->convertToCurrencyList = $convertToCurrencyList;
3121	+ }
3122	+
3123	+
3124	+ public function toNVPString( $prefix = '' )
3125	+ {
3126	+ $str = '';
3127	+ $delim = '';
3128	+ if ( $this->requestEnvelope != null ) {
3129	+ $newPrefix = $prefix . 'requestEnvelope.';
3130	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3131	+ $delim = '&';
3132	+ }
3133	+ if ( $this->baseAmountList != null ) {
3134	+ $newPrefix = $prefix . 'baseAmountList.';
3135	+ $str .= $delim . call_user_func( array( $this->baseAmountList, 'toNVPString' ), $newPrefix );
3136	+ $delim = '&';
3137	+ }
3138	+ if ( $this->convertToCurrencyList != null ) {
3139	+ $newPrefix = $prefix . 'convertToCurrencyList.';
3140	+ $str .= $delim . call_user_func( array( $this->convertToCurrencyList, 'toNVPString' ), $newPrefix );
3141	+ $delim = '&';
3142	+ }
3143	+ if ( $this->countryCode != null ) {
3144	+ $str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
3145	+ $delim = '&';
3146	+ }
3147	+ if ( $this->conversionType != null ) {
3148	+ $str .= $delim . $prefix . 'conversionType=' . urlencode( $this->conversionType );
3149	+ $delim = '&';
3150	+ }
3151	+
3152	+ return $str;
3153	+ }
3154	+
3155	+ }
3156	+
3157	+
3158	+ /**
3159	+ * A response that contains a table of estimated converted
3160	+ * currencies based on the Convert Currency Request.
3161	+ */
3162	+ class ConvertCurrencyResponse
3163	+ {
3164	+
3165	+ /**
3166	+ *
3167	+ * @access public
3168	+ * @var ResponseEnvelope
3169	+ */
3170	+ public $responseEnvelope;
3171	+
3172	+ /**
3173	+ *
3174	+ * @access public
3175	+ * @var CurrencyConversionTable
3176	+ */
3177	+ public $estimatedAmountTable;
3178	+
3179	+ /**
3180	+ *
3181	+ * @array
3182	+ * @access public
3183	+ * @var ErrorData
3184	+ */
3185	+ public $error;
3186	+
3187	+
3188	+ public function init( $map = null, $prefix = '' )
3189	+ {
3190	+ if ( $map != null ) {
3191	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3192	+ $newPrefix = $prefix . "responseEnvelope.";
3193	+ $this->responseEnvelope = new ResponseEnvelope();
3194	+ $this->responseEnvelope->init( $map, $newPrefix );
3195	+ }
3196	+ if ( PPUtils::array_match_key( $map, $prefix . "estimatedAmountTable." ) ) {
3197	+ $newPrefix = $prefix . "estimatedAmountTable.";
3198	+ $this->estimatedAmountTable = new CurrencyConversionTable();
3199	+ $this->estimatedAmountTable->init( $map, $newPrefix );
3200	+ }
3201	+ $i = 0;
3202	+ while ( true ) {
3203	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3204	+ $newPrefix = $prefix . "error($i).";
3205	+ $this->error[ $i ] = new ErrorData();
3206	+ $this->error[ $i ]->init( $map, $newPrefix );
3207	+ } else {
3208	+ break;
3209	+ }
3210	+ $i++;
3211	+ }
3212	+
3213	+ }
3214	+ }
3215	+ }
3216	+
3217	+
3218	+ /**
3219	+ * The request to execute the payment request.
3220	+ */
3221	+ class ExecutePaymentRequest
3222	+ {
3223	+
3224	+ /**
3225	+ *
3226	+ * @access public
3227	+ * @var RequestEnvelope
3228	+ */
3229	+ public $requestEnvelope;
3230	+
3231	+ /**
3232	+ *
3233	+ * @access public
3234	+ * @var string
3235	+ */
3236	+ public $payKey;
3237	+
3238	+ /**
3239	+ * Describes the action that is performed by this API
3240	+ * @access public
3241	+ * @var string
3242	+ */
3243	+ public $actionType;
3244	+
3245	+ /**
3246	+ *
3247	+ * @access public
3248	+ * @var string
3249	+ */
3250	+ public $fundingPlanId;
3251	+
3252	+ /**
3253	+ * Constructor with arguments
3254	+ */
3255	+ public function __construct( $requestEnvelope = null, $payKey = null )
3256	+ {
3257	+ $this->requestEnvelope = $requestEnvelope;
3258	+ $this->payKey = $payKey;
3259	+ }
3260	+
3261	+
3262	+ public function toNVPString( $prefix = '' )
3263	+ {
3264	+ $str = '';
3265	+ $delim = '';
3266	+ if ( $this->requestEnvelope != null ) {
3267	+ $newPrefix = $prefix . 'requestEnvelope.';
3268	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3269	+ $delim = '&';
3270	+ }
3271	+ if ( $this->payKey != null ) {
3272	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
3273	+ $delim = '&';
3274	+ }
3275	+ if ( $this->actionType != null ) {
3276	+ $str .= $delim . $prefix . 'actionType=' . urlencode( $this->actionType );
3277	+ $delim = '&';
3278	+ }
3279	+ if ( $this->fundingPlanId != null ) {
3280	+ $str .= $delim . $prefix . 'fundingPlanId=' . urlencode( $this->fundingPlanId );
3281	+ $delim = '&';
3282	+ }
3283	+
3284	+ return $str;
3285	+ }
3286	+
3287	+ }
3288	+
3289	+
3290	+ /**
3291	+ * The result of a payment execution.
3292	+ */
3293	+ class ExecutePaymentResponse
3294	+ {
3295	+
3296	+ /**
3297	+ *
3298	+ * @access public
3299	+ * @var ResponseEnvelope
3300	+ */
3301	+ public $responseEnvelope;
3302	+
3303	+ /**
3304	+ *
3305	+ * @access public
3306	+ * @var string
3307	+ */
3308	+ public $paymentExecStatus;
3309	+
3310	+ /**
3311	+ *
3312	+ * @access public
3313	+ * @var PayErrorList
3314	+ */
3315	+ public $payErrorList;
3316	+
3317	+ /**
3318	+ *
3319	+ * @array
3320	+ * @access public
3321	+ * @var ErrorData
3322	+ */
3323	+ public $error;
3324	+
3325	+
3326	+ public function init( $map = null, $prefix = '' )
3327	+ {
3328	+ if ( $map != null ) {
3329	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3330	+ $newPrefix = $prefix . "responseEnvelope.";
3331	+ $this->responseEnvelope = new ResponseEnvelope();
3332	+ $this->responseEnvelope->init( $map, $newPrefix );
3333	+ }
3334	+ $mapKeyName = $prefix . 'paymentExecStatus';
3335	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3336	+ $this->paymentExecStatus = $map[ $mapKeyName ];
3337	+ }
3338	+ if ( PPUtils::array_match_key( $map, $prefix . "payErrorList." ) ) {
3339	+ $newPrefix = $prefix . "payErrorList.";
3340	+ $this->payErrorList = new PayErrorList();
3341	+ $this->payErrorList->init( $map, $newPrefix );
3342	+ }
3343	+ $i = 0;
3344	+ while ( true ) {
3345	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3346	+ $newPrefix = $prefix . "error($i).";
3347	+ $this->error[ $i ] = new ErrorData();
3348	+ $this->error[ $i ]->init( $map, $newPrefix );
3349	+ } else {
3350	+ break;
3351	+ }
3352	+ $i++;
3353	+ }
3354	+
3355	+ }
3356	+ }
3357	+ }
3358	+
3359	+
3360	+ /**
3361	+ * The request to get the allowed funding sources available for
3362	+ * a preapproval.
3363	+ */
3364	+ class GetAllowedFundingSourcesRequest
3365	+ {
3366	+
3367	+ /**
3368	+ *
3369	+ * @access public
3370	+ * @var RequestEnvelope
3371	+ */
3372	+ public $requestEnvelope;
3373	+
3374	+ /**
3375	+ *
3376	+ * @access public
3377	+ * @var string
3378	+ */
3379	+ public $key;
3380	+
3381	+ /**
3382	+ * Constructor with arguments
3383	+ */
3384	+ public function __construct( $requestEnvelope = null, $key = null )
3385	+ {
3386	+ $this->requestEnvelope = $requestEnvelope;
3387	+ $this->key = $key;
3388	+ }
3389	+
3390	+
3391	+ public function toNVPString( $prefix = '' )
3392	+ {
3393	+ $str = '';
3394	+ $delim = '';
3395	+ if ( $this->requestEnvelope != null ) {
3396	+ $newPrefix = $prefix . 'requestEnvelope.';
3397	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3398	+ $delim = '&';
3399	+ }
3400	+ if ( $this->key != null ) {
3401	+ $str .= $delim . $prefix . 'key=' . urlencode( $this->key );
3402	+ $delim = '&';
3403	+ }
3404	+
3405	+ return $str;
3406	+ }
3407	+
3408	+ }
3409	+
3410	+
3411	+ /**
3412	+ * The response to get the backup funding sources available for
3413	+ * a preapproval.
3414	+ */
3415	+ class GetAllowedFundingSourcesResponse
3416	+ {
3417	+
3418	+ /**
3419	+ *
3420	+ * @access public
3421	+ * @var ResponseEnvelope
3422	+ */
3423	+ public $responseEnvelope;
3424	+
3425	+ /**
3426	+ *
3427	+ * @array
3428	+ * @access public
3429	+ * @var FundingSource
3430	+ */
3431	+ public $fundingSource;
3432	+
3433	+ /**
3434	+ *
3435	+ * @array
3436	+ * @access public
3437	+ * @var ErrorData
3438	+ */
3439	+ public $error;
3440	+
3441	+
3442	+ public function init( $map = null, $prefix = '' )
3443	+ {
3444	+ if ( $map != null ) {
3445	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3446	+ $newPrefix = $prefix . "responseEnvelope.";
3447	+ $this->responseEnvelope = new ResponseEnvelope();
3448	+ $this->responseEnvelope->init( $map, $newPrefix );
3449	+ }
3450	+ $i = 0;
3451	+ while ( true ) {
3452	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingSource($i)" ) ) {
3453	+ $newPrefix = $prefix . "fundingSource($i).";
3454	+ $this->fundingSource[ $i ] = new FundingSource();
3455	+ $this->fundingSource[ $i ]->init( $map, $newPrefix );
3456	+ } else {
3457	+ break;
3458	+ }
3459	+ $i++;
3460	+ }
3461	+ $i = 0;
3462	+ while ( true ) {
3463	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3464	+ $newPrefix = $prefix . "error($i).";
3465	+ $this->error[ $i ] = new ErrorData();
3466	+ $this->error[ $i ]->init( $map, $newPrefix );
3467	+ } else {
3468	+ break;
3469	+ }
3470	+ $i++;
3471	+ }
3472	+
3473	+ }
3474	+ }
3475	+ }
3476	+
3477	+
3478	+ /**
3479	+ * The request to get the options of a payment request.
3480	+ */
3481	+ class GetPaymentOptionsRequest
3482	+ {
3483	+
3484	+ /**
3485	+ *
3486	+ * @access public
3487	+ * @var RequestEnvelope
3488	+ */
3489	+ public $requestEnvelope;
3490	+
3491	+ /**
3492	+ *
3493	+ * @access public
3494	+ * @var string
3495	+ */
3496	+ public $payKey;
3497	+
3498	+ /**
3499	+ * Constructor with arguments
3500	+ */
3501	+ public function __construct( $requestEnvelope = null, $payKey = null )
3502	+ {
3503	+ $this->requestEnvelope = $requestEnvelope;
3504	+ $this->payKey = $payKey;
3505	+ }
3506	+
3507	+
3508	+ public function toNVPString( $prefix = '' )
3509	+ {
3510	+ $str = '';
3511	+ $delim = '';
3512	+ if ( $this->requestEnvelope != null ) {
3513	+ $newPrefix = $prefix . 'requestEnvelope.';
3514	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3515	+ $delim = '&';
3516	+ }
3517	+ if ( $this->payKey != null ) {
3518	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
3519	+ $delim = '&';
3520	+ }
3521	+
3522	+ return $str;
3523	+ }
3524	+
3525	+ }
3526	+
3527	+
3528	+ /**
3529	+ * The response message for the GetPaymentOption request
3530	+ */
3531	+ class GetPaymentOptionsResponse
3532	+ {
3533	+
3534	+ /**
3535	+ *
3536	+ * @access public
3537	+ * @var ResponseEnvelope
3538	+ */
3539	+ public $responseEnvelope;
3540	+
3541	+ /**
3542	+ *
3543	+ * @access public
3544	+ * @var InitiatingEntity
3545	+ */
3546	+ public $initiatingEntity;
3547	+
3548	+ /**
3549	+ *
3550	+ * @access public
3551	+ * @var DisplayOptions
3552	+ */
3553	+ public $displayOptions;
3554	+
3555	+ /**
3556	+ *
3557	+ * @access public
3558	+ * @var string
3559	+ */
3560	+ public $shippingAddressId;
3561	+
3562	+ /**
3563	+ *
3564	+ * @access public
3565	+ * @var SenderOptions
3566	+ */
3567	+ public $senderOptions;
3568	+
3569	+ /**
3570	+ *
3571	+ * @array
3572	+ * @access public
3573	+ * @var ReceiverOptions
3574	+ */
3575	+ public $receiverOptions;
3576	+
3577	+ /**
3578	+ *
3579	+ * @array
3580	+ * @access public
3581	+ * @var ErrorData
3582	+ */
3583	+ public $error;
3584	+
3585	+
3586	+ public function init( $map = null, $prefix = '' )
3587	+ {
3588	+ if ( $map != null ) {
3589	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3590	+ $newPrefix = $prefix . "responseEnvelope.";
3591	+ $this->responseEnvelope = new ResponseEnvelope();
3592	+ $this->responseEnvelope->init( $map, $newPrefix );
3593	+ }
3594	+ if ( PPUtils::array_match_key( $map, $prefix . "initiatingEntity." ) ) {
3595	+ $newPrefix = $prefix . "initiatingEntity.";
3596	+ $this->initiatingEntity = new InitiatingEntity();
3597	+ $this->initiatingEntity->init( $map, $newPrefix );
3598	+ }
3599	+ if ( PPUtils::array_match_key( $map, $prefix . "displayOptions." ) ) {
3600	+ $newPrefix = $prefix . "displayOptions.";
3601	+ $this->displayOptions = new DisplayOptions();
3602	+ $this->displayOptions->init( $map, $newPrefix );
3603	+ }
3604	+ $mapKeyName = $prefix . 'shippingAddressId';
3605	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3606	+ $this->shippingAddressId = $map[ $mapKeyName ];
3607	+ }
3608	+ if ( PPUtils::array_match_key( $map, $prefix . "senderOptions." ) ) {
3609	+ $newPrefix = $prefix . "senderOptions.";
3610	+ $this->senderOptions = new SenderOptions();
3611	+ $this->senderOptions->init( $map, $newPrefix );
3612	+ }
3613	+ $i = 0;
3614	+ while ( true ) {
3615	+ if ( PPUtils::array_match_key( $map, $prefix . "receiverOptions($i)" ) ) {
3616	+ $newPrefix = $prefix . "receiverOptions($i).";
3617	+ $this->receiverOptions[ $i ] = new ReceiverOptions();
3618	+ $this->receiverOptions[ $i ]->init( $map, $newPrefix );
3619	+ } else {
3620	+ break;
3621	+ }
3622	+ $i++;
3623	+ }
3624	+ $i = 0;
3625	+ while ( true ) {
3626	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3627	+ $newPrefix = $prefix . "error($i).";
3628	+ $this->error[ $i ] = new ErrorData();
3629	+ $this->error[ $i ]->init( $map, $newPrefix );
3630	+ } else {
3631	+ break;
3632	+ }
3633	+ $i++;
3634	+ }
3635	+
3636	+ }
3637	+ }
3638	+ }
3639	+
3640	+
3641	+ /**
3642	+ * The request to look up the details of a PayRequest. The
3643	+ * PaymentDetailsRequest can be made with either a payKey,
3644	+ * trackingId, or a transactionId of the PayRequest.
3645	+ */
3646	+ class PaymentDetailsRequest
3647	+ {
3648	+
3649	+ /**
3650	+ *
3651	+ * @access public
3652	+ * @var RequestEnvelope
3653	+ */
3654	+ public $requestEnvelope;
3655	+
3656	+ /**
3657	+ *
3658	+ * @access public
3659	+ * @var string
3660	+ */
3661	+ public $payKey;
3662	+
3663	+ /**
3664	+ *
3665	+ * @access public
3666	+ * @var string
3667	+ */
3668	+ public $transactionId;
3669	+
3670	+ /**
3671	+ *
3672	+ * @access public
3673	+ * @var string
3674	+ */
3675	+ public $trackingId;
3676	+
3677	+ /**
3678	+ * Constructor with arguments
3679	+ */
3680	+ public function __construct( $requestEnvelope = null )
3681	+ {
3682	+ $this->requestEnvelope = $requestEnvelope;
3683	+ }
3684	+
3685	+
3686	+ public function toNVPString( $prefix = '' )
3687	+ {
3688	+ $str = '';
3689	+ $delim = '';
3690	+ if ( $this->requestEnvelope != null ) {
3691	+ $newPrefix = $prefix . 'requestEnvelope.';
3692	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
3693	+ $delim = '&';
3694	+ }
3695	+ if ( $this->payKey != null ) {
3696	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
3697	+ $delim = '&';
3698	+ }
3699	+ if ( $this->transactionId != null ) {
3700	+ $str .= $delim . $prefix . 'transactionId=' . urlencode( $this->transactionId );
3701	+ $delim = '&';
3702	+ }
3703	+ if ( $this->trackingId != null ) {
3704	+ $str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
3705	+ $delim = '&';
3706	+ }
3707	+
3708	+ return $str;
3709	+ }
3710	+
3711	+ }
3712	+
3713	+
3714	+ /**
3715	+ * The details of the PayRequest as specified in the Pay
3716	+ * operation.
3717	+ */
3718	+ class PaymentDetailsResponse
3719	+ {
3720	+
3721	+ /**
3722	+ *
3723	+ * @access public
3724	+ * @var ResponseEnvelope
3725	+ */
3726	+ public $responseEnvelope;
3727	+
3728	+ /**
3729	+ *
3730	+ * @access public
3731	+ * @var string
3732	+ */
3733	+ public $cancelUrl;
3734	+
3735	+ /**
3736	+ *
3737	+ * @access public
3738	+ * @var string
3739	+ */
3740	+ public $currencyCode;
3741	+
3742	+ /**
3743	+ *
3744	+ * @access public
3745	+ * @var string
3746	+ */
3747	+ public $ipnNotificationUrl;
3748	+
3749	+ /**
3750	+ *
3751	+ * @access public
3752	+ * @var string
3753	+ */
3754	+ public $memo;
3755	+
3756	+ /**
3757	+ *
3758	+ * @access public
3759	+ * @var PaymentInfoList
3760	+ */
3761	+ public $paymentInfoList;
3762	+
3763	+ /**
3764	+ *
3765	+ * @access public
3766	+ * @var string
3767	+ */
3768	+ public $returnUrl;
3769	+
3770	+ /**
3771	+ *
3772	+ * @access public
3773	+ * @var string
3774	+ */
3775	+ public $senderEmail;
3776	+
3777	+ /**
3778	+ *
3779	+ * @access public
3780	+ * @var string
3781	+ */
3782	+ public $status;
3783	+
3784	+ /**
3785	+ *
3786	+ * @access public
3787	+ * @var string
3788	+ */
3789	+ public $trackingId;
3790	+
3791	+ /**
3792	+ *
3793	+ * @access public
3794	+ * @var string
3795	+ */
3796	+ public $payKey;
3797	+
3798	+ /**
3799	+ *
3800	+ * @access public
3801	+ * @var string
3802	+ */
3803	+ public $actionType;
3804	+
3805	+ /**
3806	+ *
3807	+ * @access public
3808	+ * @var string
3809	+ */
3810	+ public $feesPayer;
3811	+
3812	+ /**
3813	+ *
3814	+ * @access public
3815	+ * @var boolean
3816	+ */
3817	+ public $reverseAllParallelPaymentsOnError;
3818	+
3819	+ /**
3820	+ *
3821	+ * @access public
3822	+ * @var string
3823	+ */
3824	+ public $preapprovalKey;
3825	+
3826	+ /**
3827	+ *
3828	+ * @access public
3829	+ * @var FundingConstraint
3830	+ */
3831	+ public $fundingConstraint;
3832	+
3833	+ /**
3834	+ *
3835	+ * @access public
3836	+ * @var SenderIdentifier
3837	+ */
3838	+ public $sender;
3839	+
3840	+ /**
3841	+ *
3842	+ * @array
3843	+ * @access public
3844	+ * @var ErrorData
3845	+ */
3846	+ public $error;
3847	+
3848	+
3849	+ public function init( $map = null, $prefix = '' )
3850	+ {
3851	+ if ( $map != null ) {
3852	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
3853	+ $newPrefix = $prefix . "responseEnvelope.";
3854	+ $this->responseEnvelope = new ResponseEnvelope();
3855	+ $this->responseEnvelope->init( $map, $newPrefix );
3856	+ }
3857	+ $mapKeyName = $prefix . 'cancelUrl';
3858	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3859	+ $this->cancelUrl = $map[ $mapKeyName ];
3860	+ }
3861	+ $mapKeyName = $prefix . 'currencyCode';
3862	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3863	+ $this->currencyCode = $map[ $mapKeyName ];
3864	+ }
3865	+ $mapKeyName = $prefix . 'ipnNotificationUrl';
3866	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3867	+ $this->ipnNotificationUrl = $map[ $mapKeyName ];
3868	+ }
3869	+ $mapKeyName = $prefix . 'memo';
3870	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3871	+ $this->memo = $map[ $mapKeyName ];
3872	+ }
3873	+ if ( PPUtils::array_match_key( $map, $prefix . "paymentInfoList." ) ) {
3874	+ $newPrefix = $prefix . "paymentInfoList.";
3875	+ $this->paymentInfoList = new PaymentInfoList();
3876	+ $this->paymentInfoList->init( $map, $newPrefix );
3877	+ }
3878	+ $mapKeyName = $prefix . 'returnUrl';
3879	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3880	+ $this->returnUrl = $map[ $mapKeyName ];
3881	+ }
3882	+ $mapKeyName = $prefix . 'senderEmail';
3883	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3884	+ $this->senderEmail = $map[ $mapKeyName ];
3885	+ }
3886	+ $mapKeyName = $prefix . 'status';
3887	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3888	+ $this->status = $map[ $mapKeyName ];
3889	+ }
3890	+ $mapKeyName = $prefix . 'trackingId';
3891	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3892	+ $this->trackingId = $map[ $mapKeyName ];
3893	+ }
3894	+ $mapKeyName = $prefix . 'payKey';
3895	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3896	+ $this->payKey = $map[ $mapKeyName ];
3897	+ }
3898	+ $mapKeyName = $prefix . 'actionType';
3899	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3900	+ $this->actionType = $map[ $mapKeyName ];
3901	+ }
3902	+ $mapKeyName = $prefix . 'feesPayer';
3903	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3904	+ $this->feesPayer = $map[ $mapKeyName ];
3905	+ }
3906	+ $mapKeyName = $prefix . 'reverseAllParallelPaymentsOnError';
3907	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3908	+ $this->reverseAllParallelPaymentsOnError = $map[ $mapKeyName ];
3909	+ }
3910	+ $mapKeyName = $prefix . 'preapprovalKey';
3911	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
3912	+ $this->preapprovalKey = $map[ $mapKeyName ];
3913	+ }
3914	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingConstraint." ) ) {
3915	+ $newPrefix = $prefix . "fundingConstraint.";
3916	+ $this->fundingConstraint = new FundingConstraint();
3917	+ $this->fundingConstraint->init( $map, $newPrefix );
3918	+ }
3919	+ if ( PPUtils::array_match_key( $map, $prefix . "sender." ) ) {
3920	+ $newPrefix = $prefix . "sender.";
3921	+ $this->sender = new SenderIdentifier();
3922	+ $this->sender->init( $map, $newPrefix );
3923	+ }
3924	+ $i = 0;
3925	+ while ( true ) {
3926	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
3927	+ $newPrefix = $prefix . "error($i).";
3928	+ $this->error[ $i ] = new ErrorData();
3929	+ $this->error[ $i ]->init( $map, $newPrefix );
3930	+ } else {
3931	+ break;
3932	+ }
3933	+ $i++;
3934	+ }
3935	+
3936	+ }
3937	+ }
3938	+ }
3939	+
3940	+
3941	+ /**
3942	+ * The PayRequest contains the payment instructions to make
3943	+ * from sender to receivers.
3944	+ */
3945	+ class PayRequest
3946	+ {
3947	+
3948	+ /**
3949	+ *
3950	+ * @access public
3951	+ * @var RequestEnvelope
3952	+ */
3953	+ public $requestEnvelope;
3954	+
3955	+ /**
3956	+ *
3957	+ * @access public
3958	+ * @var ClientDetailsType
3959	+ */
3960	+ public $clientDetails;
3961	+
3962	+ /**
3963	+ *
3964	+ * @access public
3965	+ * @var string
3966	+ */
3967	+ public $actionType;
3968	+
3969	+ /**
3970	+ *
3971	+ * @access public
3972	+ * @var string
3973	+ */
3974	+ public $cancelUrl;
3975	+
3976	+ /**
3977	+ *
3978	+ * @access public
3979	+ * @var string
3980	+ */
3981	+ public $currencyCode;
3982	+
3983	+ /**
3984	+ *
3985	+ * @access public
3986	+ * @var string
3987	+ */
3988	+ public $feesPayer;
3989	+
3990	+ /**
3991	+ *
3992	+ * @access public
3993	+ * @var string
3994	+ */
3995	+ public $ipnNotificationUrl;
3996	+
3997	+ /**
3998	+ *
3999	+ * @access public
4000	+ * @var string
4001	+ */
4002	+ public $memo;
4003	+
4004	+ /**
4005	+ *
4006	+ * @access public
4007	+ * @var string
4008	+ */
4009	+ public $pin;
4010	+
4011	+ /**
4012	+ *
4013	+ * @access public
4014	+ * @var string
4015	+ */
4016	+ public $preapprovalKey;
4017	+
4018	+ /**
4019	+ *
4020	+ * @access public
4021	+ * @var ReceiverList
4022	+ */
4023	+ public $receiverList;
4024	+
4025	+ /**
4026	+ *
4027	+ * @access public
4028	+ * @var boolean
4029	+ */
4030	+ public $reverseAllParallelPaymentsOnError;
4031	+
4032	+ /**
4033	+ *
4034	+ * @access public
4035	+ * @var string
4036	+ */
4037	+ public $senderEmail;
4038	+
4039	+ /**
4040	+ *
4041	+ * @access public
4042	+ * @var string
4043	+ */
4044	+ public $returnUrl;
4045	+
4046	+ /**
4047	+ *
4048	+ * @access public
4049	+ * @var string
4050	+ */
4051	+ public $trackingId;
4052	+
4053	+ /**
4054	+ *
4055	+ * @access public
4056	+ * @var FundingConstraint
4057	+ */
4058	+ public $fundingConstraint;
4059	+
4060	+ /**
4061	+ *
4062	+ * @access public
4063	+ * @var SenderIdentifier
4064	+ */
4065	+ public $sender;
4066	+
4067	+ /**
4068	+ * Constructor with arguments
4069	+ */
4070	+ public function __construct( $requestEnvelope = null, $actionType = null, $cancelUrl = null, $currencyCode = null, $receiverList = null, $returnUrl = null )
4071	+ {
4072	+ $this->requestEnvelope = $requestEnvelope;
4073	+ $this->actionType = $actionType;
4074	+ $this->cancelUrl = $cancelUrl;
4075	+ $this->currencyCode = $currencyCode;
4076	+ $this->receiverList = $receiverList;
4077	+ $this->returnUrl = $returnUrl;
4078	+ }
4079	+
4080	+
4081	+ public function toNVPString( $prefix = '' )
4082	+ {
4083	+ $str = '';
4084	+ $delim = '';
4085	+ if ( $this->requestEnvelope != null ) {
4086	+ $newPrefix = $prefix . 'requestEnvelope.';
4087	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
4088	+ $delim = '&';
4089	+ }
4090	+ if ( $this->clientDetails != null ) {
4091	+ $newPrefix = $prefix . 'clientDetails.';
4092	+ $str .= $delim . call_user_func( array( $this->clientDetails, 'toNVPString' ), $newPrefix );
4093	+ $delim = '&';
4094	+ }
4095	+ if ( $this->actionType != null ) {
4096	+ $str .= $delim . $prefix . 'actionType=' . urlencode( $this->actionType );
4097	+ $delim = '&';
4098	+ }
4099	+ if ( $this->cancelUrl != null ) {
4100	+ $str .= $delim . $prefix . 'cancelUrl=' . urlencode( $this->cancelUrl );
4101	+ $delim = '&';
4102	+ }
4103	+ if ( $this->currencyCode != null ) {
4104	+ $str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
4105	+ $delim = '&';
4106	+ }
4107	+ if ( $this->feesPayer != null ) {
4108	+ $str .= $delim . $prefix . 'feesPayer=' . urlencode( $this->feesPayer );
4109	+ $delim = '&';
4110	+ }
4111	+ if ( $this->ipnNotificationUrl != null ) {
4112	+ $str .= $delim . $prefix . 'ipnNotificationUrl=' . urlencode( $this->ipnNotificationUrl );
4113	+ $delim = '&';
4114	+ }
4115	+ if ( $this->memo != null ) {
4116	+ $str .= $delim . $prefix . 'memo=' . urlencode( $this->memo );
4117	+ $delim = '&';
4118	+ }
4119	+ if ( $this->pin != null ) {
4120	+ $str .= $delim . $prefix . 'pin=' . urlencode( $this->pin );
4121	+ $delim = '&';
4122	+ }
4123	+ if ( $this->preapprovalKey != null ) {
4124	+ $str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
4125	+ $delim = '&';
4126	+ }
4127	+ if ( $this->receiverList != null ) {
4128	+ $newPrefix = $prefix . 'receiverList.';
4129	+ $str .= $delim . call_user_func( array( $this->receiverList, 'toNVPString' ), $newPrefix );
4130	+ $delim = '&';
4131	+ }
4132	+ if ( $this->reverseAllParallelPaymentsOnError != null ) {
4133	+ $str .= $delim . $prefix . 'reverseAllParallelPaymentsOnError=' . urlencode( $this->reverseAllParallelPaymentsOnError );
4134	+ $delim = '&';
4135	+ }
4136	+ if ( $this->senderEmail != null ) {
4137	+ $str .= $delim . $prefix . 'senderEmail=' . urlencode( $this->senderEmail );
4138	+ $delim = '&';
4139	+ }
4140	+ if ( $this->returnUrl != null ) {
4141	+ $str .= $delim . $prefix . 'returnUrl=' . urlencode( $this->returnUrl );
4142	+ $delim = '&';
4143	+ }
4144	+ if ( $this->trackingId != null ) {
4145	+ $str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
4146	+ $delim = '&';
4147	+ }
4148	+ if ( $this->fundingConstraint != null ) {
4149	+ $newPrefix = $prefix . 'fundingConstraint.';
4150	+ $str .= $delim . call_user_func( array( $this->fundingConstraint, 'toNVPString' ), $newPrefix );
4151	+ $delim = '&';
4152	+ }
4153	+ if ( $this->sender != null ) {
4154	+ $newPrefix = $prefix . 'sender.';
4155	+ $str .= $delim . call_user_func( array( $this->sender, 'toNVPString' ), $newPrefix );
4156	+ $delim = '&';
4157	+ }
4158	+
4159	+ return $str;
4160	+ }
4161	+
4162	+ }
4163	+
4164	+
4165	+ /**
4166	+ * The PayResponse contains the result of the Pay operation.
4167	+ * The payKey and execution status of the request should always
4168	+ * be provided.
4169	+ */
4170	+ class PayResponse
4171	+ {
4172	+
4173	+ /**
4174	+ *
4175	+ * @access public
4176	+ * @var ResponseEnvelope
4177	+ */
4178	+ public $responseEnvelope;
4179	+
4180	+ /**
4181	+ *
4182	+ * @access public
4183	+ * @var string
4184	+ */
4185	+ public $payKey;
4186	+
4187	+ /**
4188	+ *
4189	+ * @access public
4190	+ * @var string
4191	+ */
4192	+ public $paymentExecStatus;
4193	+
4194	+ /**
4195	+ *
4196	+ * @access public
4197	+ * @var PayErrorList
4198	+ */
4199	+ public $payErrorList;
4200	+
4201	+ /**
4202	+ *
4203	+ * @access public
4204	+ * @var FundingPlan
4205	+ */
4206	+ public $defaultFundingPlan;
4207	+
4208	+ /**
4209	+ *
4210	+ * @array
4211	+ * @access public
4212	+ * @var ErrorData
4213	+ */
4214	+ public $error;
4215	+
4216	+
4217	+ public function init( $map = null, $prefix = '' )
4218	+ {
4219	+ if ( $map != null ) {
4220	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
4221	+ $newPrefix = $prefix . "responseEnvelope.";
4222	+ $this->responseEnvelope = new ResponseEnvelope();
4223	+ $this->responseEnvelope->init( $map, $newPrefix );
4224	+ }
4225	+ $mapKeyName = $prefix . 'payKey';
4226	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4227	+ $this->payKey = $map[ $mapKeyName ];
4228	+ }
4229	+ $mapKeyName = $prefix . 'paymentExecStatus';
4230	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4231	+ $this->paymentExecStatus = $map[ $mapKeyName ];
4232	+ }
4233	+ if ( PPUtils::array_match_key( $map, $prefix . "payErrorList." ) ) {
4234	+ $newPrefix = $prefix . "payErrorList.";
4235	+ $this->payErrorList = new PayErrorList();
4236	+ $this->payErrorList->init( $map, $newPrefix );
4237	+ }
4238	+ if ( PPUtils::array_match_key( $map, $prefix . "defaultFundingPlan." ) ) {
4239	+ $newPrefix = $prefix . "defaultFundingPlan.";
4240	+ $this->defaultFundingPlan = new FundingPlan();
4241	+ $this->defaultFundingPlan->init( $map, $newPrefix );
4242	+ }
4243	+ $i = 0;
4244	+ while ( true ) {
4245	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
4246	+ $newPrefix = $prefix . "error($i).";
4247	+ $this->error[ $i ] = new ErrorData();
4248	+ $this->error[ $i ]->init( $map, $newPrefix );
4249	+ } else {
4250	+ break;
4251	+ }
4252	+ $i++;
4253	+ }
4254	+
4255	+ }
4256	+ }
4257	+ }
4258	+
4259	+
4260	+ /**
4261	+ * The request to look up the details of a Preapproval.
4262	+ */
4263	+ class PreapprovalDetailsRequest
4264	+ {
4265	+
4266	+ /**
4267	+ *
4268	+ * @access public
4269	+ * @var RequestEnvelope
4270	+ */
4271	+ public $requestEnvelope;
4272	+
4273	+ /**
4274	+ *
4275	+ * @access public
4276	+ * @var string
4277	+ */
4278	+ public $preapprovalKey;
4279	+
4280	+ /**
4281	+ *
4282	+ * @access public
4283	+ * @var boolean
4284	+ */
4285	+ public $getBillingAddress;
4286	+
4287	+ /**
4288	+ * Constructor with arguments
4289	+ */
4290	+ public function __construct( $requestEnvelope = null, $preapprovalKey = null )
4291	+ {
4292	+ $this->requestEnvelope = $requestEnvelope;
4293	+ $this->preapprovalKey = $preapprovalKey;
4294	+ }
4295	+
4296	+
4297	+ public function toNVPString( $prefix = '' )
4298	+ {
4299	+ $str = '';
4300	+ $delim = '';
4301	+ if ( $this->requestEnvelope != null ) {
4302	+ $newPrefix = $prefix . 'requestEnvelope.';
4303	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
4304	+ $delim = '&';
4305	+ }
4306	+ if ( $this->preapprovalKey != null ) {
4307	+ $str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
4308	+ $delim = '&';
4309	+ }
4310	+ if ( $this->getBillingAddress != null ) {
4311	+ $str .= $delim . $prefix . 'getBillingAddress=' . urlencode( $this->getBillingAddress );
4312	+ $delim = '&';
4313	+ }
4314	+
4315	+ return $str;
4316	+ }
4317	+
4318	+ }
4319	+
4320	+
4321	+ /**
4322	+ * The details of the Preapproval as specified in the
4323	+ * Preapproval operation.
4324	+ */
4325	+ class PreapprovalDetailsResponse
4326	+ {
4327	+
4328	+ /**
4329	+ *
4330	+ * @access public
4331	+ * @var ResponseEnvelope
4332	+ */
4333	+ public $responseEnvelope;
4334	+
4335	+ /**
4336	+ *
4337	+ * @access public
4338	+ * @var boolean
4339	+ */
4340	+ public $approved;
4341	+
4342	+ /**
4343	+ *
4344	+ * @access public
4345	+ * @var string
4346	+ */
4347	+ public $cancelUrl;
4348	+
4349	+ /**
4350	+ *
4351	+ * @access public
4352	+ * @var integer
4353	+ */
4354	+ public $curPayments;
4355	+
4356	+ /**
4357	+ *
4358	+ * @access public
4359	+ * @var double
4360	+ */
4361	+ public $curPaymentsAmount;
4362	+
4363	+ /**
4364	+ *
4365	+ * @access public
4366	+ * @var integer
4367	+ */
4368	+ public $curPeriodAttempts;
4369	+
4370	+ /**
4371	+ *
4372	+ * @access public
4373	+ * @var dateTime
4374	+ */
4375	+ public $curPeriodEndingDate;
4376	+
4377	+ /**
4378	+ *
4379	+ * @access public
4380	+ * @var string
4381	+ */
4382	+ public $currencyCode;
4383	+
4384	+ /**
4385	+ *
4386	+ * @access public
4387	+ * @var integer
4388	+ */
4389	+ public $dateOfMonth;
4390	+
4391	+ /**
4392	+ *
4393	+ * @access public
4394	+ * @var DayOfWeek
4395	+ */
4396	+ public $dayOfWeek;
4397	+
4398	+ /**
4399	+ *
4400	+ * @access public
4401	+ * @var dateTime
4402	+ */
4403	+ public $endingDate;
4404	+
4405	+ /**
4406	+ *
4407	+ * @access public
4408	+ * @var double
4409	+ */
4410	+ public $maxAmountPerPayment;
4411	+
4412	+ /**
4413	+ *
4414	+ * @access public
4415	+ * @var integer
4416	+ */
4417	+ public $maxNumberOfPayments;
4418	+
4419	+ /**
4420	+ *
4421	+ * @access public
4422	+ * @var integer
4423	+ */
4424	+ public $maxNumberOfPaymentsPerPeriod;
4425	+
4426	+ /**
4427	+ *
4428	+ * @access public
4429	+ * @var double
4430	+ */
4431	+ public $maxTotalAmountOfAllPayments;
4432	+
4433	+ /**
4434	+ *
4435	+ * @access public
4436	+ * @var string
4437	+ */
4438	+ public $paymentPeriod;
4439	+
4440	+ /**
4441	+ *
4442	+ * @access public
4443	+ * @var string
4444	+ */
4445	+ public $pinType;
4446	+
4447	+ /**
4448	+ *
4449	+ * @access public
4450	+ * @var string
4451	+ */
4452	+ public $returnUrl;
4453	+
4454	+ /**
4455	+ *
4456	+ * @access public
4457	+ * @var string
4458	+ */
4459	+ public $senderEmail;
4460	+
4461	+ /**
4462	+ *
4463	+ * @access public
4464	+ * @var string
4465	+ */
4466	+ public $memo;
4467	+
4468	+ /**
4469	+ *
4470	+ * @access public
4471	+ * @var dateTime
4472	+ */
4473	+ public $startingDate;
4474	+
4475	+ /**
4476	+ *
4477	+ * @access public
4478	+ * @var string
4479	+ */
4480	+ public $status;
4481	+
4482	+ /**
4483	+ *
4484	+ * @access public
4485	+ * @var string
4486	+ */
4487	+ public $ipnNotificationUrl;
4488	+
4489	+ /**
4490	+ *
4491	+ * @access public
4492	+ * @var AddressList
4493	+ */
4494	+ public $addressList;
4495	+
4496	+ /**
4497	+ *
4498	+ * @access public
4499	+ * @var string
4500	+ */
4501	+ public $feesPayer;
4502	+
4503	+ /**
4504	+ *
4505	+ * @access public
4506	+ * @var boolean
4507	+ */
4508	+ public $displayMaxTotalAmount;
4509	+
4510	+ /**
4511	+ *
4512	+ * @array
4513	+ * @access public
4514	+ * @var ErrorData
4515	+ */
4516	+ public $error;
4517	+
4518	+
4519	+ public function init( $map = null, $prefix = '' )
4520	+ {
4521	+ if ( $map != null ) {
4522	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
4523	+ $newPrefix = $prefix . "responseEnvelope.";
4524	+ $this->responseEnvelope = new ResponseEnvelope();
4525	+ $this->responseEnvelope->init( $map, $newPrefix );
4526	+ }
4527	+ $mapKeyName = $prefix . 'approved';
4528	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4529	+ $this->approved = $map[ $mapKeyName ];
4530	+ }
4531	+ $mapKeyName = $prefix . 'cancelUrl';
4532	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4533	+ $this->cancelUrl = $map[ $mapKeyName ];
4534	+ }
4535	+ $mapKeyName = $prefix . 'curPayments';
4536	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4537	+ $this->curPayments = $map[ $mapKeyName ];
4538	+ }
4539	+ $mapKeyName = $prefix . 'curPaymentsAmount';
4540	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4541	+ $this->curPaymentsAmount = $map[ $mapKeyName ];
4542	+ }
4543	+ $mapKeyName = $prefix . 'curPeriodAttempts';
4544	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4545	+ $this->curPeriodAttempts = $map[ $mapKeyName ];
4546	+ }
4547	+ $mapKeyName = $prefix . 'curPeriodEndingDate';
4548	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4549	+ $this->curPeriodEndingDate = $map[ $mapKeyName ];
4550	+ }
4551	+ $mapKeyName = $prefix . 'currencyCode';
4552	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4553	+ $this->currencyCode = $map[ $mapKeyName ];
4554	+ }
4555	+ $mapKeyName = $prefix . 'dateOfMonth';
4556	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4557	+ $this->dateOfMonth = $map[ $mapKeyName ];
4558	+ }
4559	+ $mapKeyName = $prefix . 'dayOfWeek';
4560	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4561	+ $this->dayOfWeek = $map[ $mapKeyName ];
4562	+ }
4563	+ $mapKeyName = $prefix . 'endingDate';
4564	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4565	+ $this->endingDate = $map[ $mapKeyName ];
4566	+ }
4567	+ $mapKeyName = $prefix . 'maxAmountPerPayment';
4568	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4569	+ $this->maxAmountPerPayment = $map[ $mapKeyName ];
4570	+ }
4571	+ $mapKeyName = $prefix . 'maxNumberOfPayments';
4572	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4573	+ $this->maxNumberOfPayments = $map[ $mapKeyName ];
4574	+ }
4575	+ $mapKeyName = $prefix . 'maxNumberOfPaymentsPerPeriod';
4576	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4577	+ $this->maxNumberOfPaymentsPerPeriod = $map[ $mapKeyName ];
4578	+ }
4579	+ $mapKeyName = $prefix . 'maxTotalAmountOfAllPayments';
4580	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4581	+ $this->maxTotalAmountOfAllPayments = $map[ $mapKeyName ];
4582	+ }
4583	+ $mapKeyName = $prefix . 'paymentPeriod';
4584	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4585	+ $this->paymentPeriod = $map[ $mapKeyName ];
4586	+ }
4587	+ $mapKeyName = $prefix . 'pinType';
4588	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4589	+ $this->pinType = $map[ $mapKeyName ];
4590	+ }
4591	+ $mapKeyName = $prefix . 'returnUrl';
4592	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4593	+ $this->returnUrl = $map[ $mapKeyName ];
4594	+ }
4595	+ $mapKeyName = $prefix . 'senderEmail';
4596	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4597	+ $this->senderEmail = $map[ $mapKeyName ];
4598	+ }
4599	+ $mapKeyName = $prefix . 'memo';
4600	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4601	+ $this->memo = $map[ $mapKeyName ];
4602	+ }
4603	+ $mapKeyName = $prefix . 'startingDate';
4604	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4605	+ $this->startingDate = $map[ $mapKeyName ];
4606	+ }
4607	+ $mapKeyName = $prefix . 'status';
4608	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4609	+ $this->status = $map[ $mapKeyName ];
4610	+ }
4611	+ $mapKeyName = $prefix . 'ipnNotificationUrl';
4612	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4613	+ $this->ipnNotificationUrl = $map[ $mapKeyName ];
4614	+ }
4615	+ if ( PPUtils::array_match_key( $map, $prefix . "addressList." ) ) {
4616	+ $newPrefix = $prefix . "addressList.";
4617	+ $this->addressList = new AddressList();
4618	+ $this->addressList->init( $map, $newPrefix );
4619	+ }
4620	+ $mapKeyName = $prefix . 'feesPayer';
4621	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4622	+ $this->feesPayer = $map[ $mapKeyName ];
4623	+ }
4624	+ $mapKeyName = $prefix . 'displayMaxTotalAmount';
4625	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4626	+ $this->displayMaxTotalAmount = $map[ $mapKeyName ];
4627	+ }
4628	+ $i = 0;
4629	+ while ( true ) {
4630	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
4631	+ $newPrefix = $prefix . "error($i).";
4632	+ $this->error[ $i ] = new ErrorData();
4633	+ $this->error[ $i ]->init( $map, $newPrefix );
4634	+ } else {
4635	+ break;
4636	+ }
4637	+ $i++;
4638	+ }
4639	+
4640	+ }
4641	+ }
4642	+ }
4643	+
4644	+
4645	+ /**
4646	+ * A request to create a Preapproval. A Preapproval is an
4647	+ * agreement between a Paypal account holder (the sender) and
4648	+ * the API caller (the service invoker) to make payment(s) on
4649	+ * the the sender's behalf with various limitations defined.
4650	+ */
4651	+ class PreapprovalRequest
4652	+ {
4653	+
4654	+ /**
4655	+ *
4656	+ * @access public
4657	+ * @var RequestEnvelope
4658	+ */
4659	+ public $requestEnvelope;
4660	+
4661	+ /**
4662	+ *
4663	+ * @access public
4664	+ * @var ClientDetailsType
4665	+ */
4666	+ public $clientDetails;
4667	+
4668	+ /**
4669	+ *
4670	+ * @access public
4671	+ * @var string
4672	+ */
4673	+ public $cancelUrl;
4674	+
4675	+ /**
4676	+ *
4677	+ * @access public
4678	+ * @var string
4679	+ */
4680	+ public $currencyCode;
4681	+
4682	+ /**
4683	+ *
4684	+ * @access public
4685	+ * @var integer
4686	+ */
4687	+ public $dateOfMonth;
4688	+
4689	+ /**
4690	+ *
4691	+ * @access public
4692	+ * @var DayOfWeek
4693	+ */
4694	+ public $dayOfWeek;
4695	+
4696	+ /**
4697	+ *
4698	+ * @access public
4699	+ * @var dateTime
4700	+ */
4701	+ public $endingDate;
4702	+
4703	+ /**
4704	+ *
4705	+ * @access public
4706	+ * @var double
4707	+ */
4708	+ public $maxAmountPerPayment;
4709	+
4710	+ /**
4711	+ *
4712	+ * @access public
4713	+ * @var integer
4714	+ */
4715	+ public $maxNumberOfPayments;
4716	+
4717	+ /**
4718	+ *
4719	+ * @access public
4720	+ * @var integer
4721	+ */
4722	+ public $maxNumberOfPaymentsPerPeriod;
4723	+
4724	+ /**
4725	+ *
4726	+ * @access public
4727	+ * @var double
4728	+ */
4729	+ public $maxTotalAmountOfAllPayments;
4730	+
4731	+ /**
4732	+ *
4733	+ * @access public
4734	+ * @var string
4735	+ */
4736	+ public $paymentPeriod;
4737	+
4738	+ /**
4739	+ *
4740	+ * @access public
4741	+ * @var string
4742	+ */
4743	+ public $returnUrl;
4744	+
4745	+ /**
4746	+ *
4747	+ * @access public
4748	+ * @var string
4749	+ */
4750	+ public $memo;
4751	+
4752	+ /**
4753	+ *
4754	+ * @access public
4755	+ * @var string
4756	+ */
4757	+ public $ipnNotificationUrl;
4758	+
4759	+ /**
4760	+ *
4761	+ * @access public
4762	+ * @var string
4763	+ */
4764	+ public $senderEmail;
4765	+
4766	+ /**
4767	+ *
4768	+ * @access public
4769	+ * @var dateTime
4770	+ */
4771	+ public $startingDate;
4772	+
4773	+ /**
4774	+ *
4775	+ * @access public
4776	+ * @var string
4777	+ */
4778	+ public $pinType;
4779	+
4780	+ /**
4781	+ *
4782	+ * @access public
4783	+ * @var string
4784	+ */
4785	+ public $feesPayer;
4786	+
4787	+ /**
4788	+ *
4789	+ * @access public
4790	+ * @var boolean
4791	+ */
4792	+ public $displayMaxTotalAmount;
4793	+
4794	+ /**
4795	+ * Constructor with arguments
4796	+ */
4797	+ public function __construct( $requestEnvelope = null, $cancelUrl = null, $currencyCode = null, $returnUrl = null, $startingDate = null )
4798	+ {
4799	+ $this->requestEnvelope = $requestEnvelope;
4800	+ $this->cancelUrl = $cancelUrl;
4801	+ $this->currencyCode = $currencyCode;
4802	+ $this->returnUrl = $returnUrl;
4803	+ $this->startingDate = $startingDate;
4804	+ }
4805	+
4806	+
4807	+ public function toNVPString( $prefix = '' )
4808	+ {
4809	+ $str = '';
4810	+ $delim = '';
4811	+ if ( $this->requestEnvelope != null ) {
4812	+ $newPrefix = $prefix . 'requestEnvelope.';
4813	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
4814	+ $delim = '&';
4815	+ }
4816	+ if ( $this->clientDetails != null ) {
4817	+ $newPrefix = $prefix . 'clientDetails.';
4818	+ $str .= $delim . call_user_func( array( $this->clientDetails, 'toNVPString' ), $newPrefix );
4819	+ $delim = '&';
4820	+ }
4821	+ if ( $this->cancelUrl != null ) {
4822	+ $str .= $delim . $prefix . 'cancelUrl=' . urlencode( $this->cancelUrl );
4823	+ $delim = '&';
4824	+ }
4825	+ if ( $this->currencyCode != null ) {
4826	+ $str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
4827	+ $delim = '&';
4828	+ }
4829	+ if ( $this->dateOfMonth != null ) {
4830	+ $str .= $delim . $prefix . 'dateOfMonth=' . urlencode( $this->dateOfMonth );
4831	+ $delim = '&';
4832	+ }
4833	+ if ( $this->dayOfWeek != null ) {
4834	+ $str .= $delim . $prefix . 'dayOfWeek=' . urlencode( $this->dayOfWeek );
4835	+ $delim = '&';
4836	+ }
4837	+ if ( $this->endingDate != null ) {
4838	+ $str .= $delim . $prefix . 'endingDate=' . urlencode( $this->endingDate );
4839	+ $delim = '&';
4840	+ }
4841	+ if ( $this->maxAmountPerPayment != null ) {
4842	+ $str .= $delim . $prefix . 'maxAmountPerPayment=' . urlencode( $this->maxAmountPerPayment );
4843	+ $delim = '&';
4844	+ }
4845	+ if ( $this->maxNumberOfPayments != null ) {
4846	+ $str .= $delim . $prefix . 'maxNumberOfPayments=' . urlencode( $this->maxNumberOfPayments );
4847	+ $delim = '&';
4848	+ }
4849	+ if ( $this->maxNumberOfPaymentsPerPeriod != null ) {
4850	+ $str .= $delim . $prefix . 'maxNumberOfPaymentsPerPeriod=' . urlencode( $this->maxNumberOfPaymentsPerPeriod );
4851	+ $delim = '&';
4852	+ }
4853	+ if ( $this->maxTotalAmountOfAllPayments != null ) {
4854	+ $str .= $delim . $prefix . 'maxTotalAmountOfAllPayments=' . urlencode( $this->maxTotalAmountOfAllPayments );
4855	+ $delim = '&';
4856	+ }
4857	+ if ( $this->paymentPeriod != null ) {
4858	+ $str .= $delim . $prefix . 'paymentPeriod=' . urlencode( $this->paymentPeriod );
4859	+ $delim = '&';
4860	+ }
4861	+ if ( $this->returnUrl != null ) {
4862	+ $str .= $delim . $prefix . 'returnUrl=' . urlencode( $this->returnUrl );
4863	+ $delim = '&';
4864	+ }
4865	+ if ( $this->memo != null ) {
4866	+ $str .= $delim . $prefix . 'memo=' . urlencode( $this->memo );
4867	+ $delim = '&';
4868	+ }
4869	+ if ( $this->ipnNotificationUrl != null ) {
4870	+ $str .= $delim . $prefix . 'ipnNotificationUrl=' . urlencode( $this->ipnNotificationUrl );
4871	+ $delim = '&';
4872	+ }
4873	+ if ( $this->senderEmail != null ) {
4874	+ $str .= $delim . $prefix . 'senderEmail=' . urlencode( $this->senderEmail );
4875	+ $delim = '&';
4876	+ }
4877	+ if ( $this->startingDate != null ) {
4878	+ $str .= $delim . $prefix . 'startingDate=' . urlencode( $this->startingDate );
4879	+ $delim = '&';
4880	+ }
4881	+ if ( $this->pinType != null ) {
4882	+ $str .= $delim . $prefix . 'pinType=' . urlencode( $this->pinType );
4883	+ $delim = '&';
4884	+ }
4885	+ if ( $this->feesPayer != null ) {
4886	+ $str .= $delim . $prefix . 'feesPayer=' . urlencode( $this->feesPayer );
4887	+ $delim = '&';
4888	+ }
4889	+ if ( $this->displayMaxTotalAmount != null ) {
4890	+ $str .= $delim . $prefix . 'displayMaxTotalAmount=' . urlencode( $this->displayMaxTotalAmount );
4891	+ $delim = '&';
4892	+ }
4893	+
4894	+ return $str;
4895	+ }
4896	+
4897	+ }
4898	+
4899	+
4900	+ /**
4901	+ * The result of the PreapprovalRequest is a preapprovalKey.
4902	+ */
4903	+ class PreapprovalResponse
4904	+ {
4905	+
4906	+ /**
4907	+ *
4908	+ * @access public
4909	+ * @var ResponseEnvelope
4910	+ */
4911	+ public $responseEnvelope;
4912	+
4913	+ /**
4914	+ *
4915	+ * @access public
4916	+ * @var string
4917	+ */
4918	+ public $preapprovalKey;
4919	+
4920	+ /**
4921	+ *
4922	+ * @array
4923	+ * @access public
4924	+ * @var ErrorData
4925	+ */
4926	+ public $error;
4927	+
4928	+
4929	+ public function init( $map = null, $prefix = '' )
4930	+ {
4931	+ if ( $map != null ) {
4932	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
4933	+ $newPrefix = $prefix . "responseEnvelope.";
4934	+ $this->responseEnvelope = new ResponseEnvelope();
4935	+ $this->responseEnvelope->init( $map, $newPrefix );
4936	+ }
4937	+ $mapKeyName = $prefix . 'preapprovalKey';
4938	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
4939	+ $this->preapprovalKey = $map[ $mapKeyName ];
4940	+ }
4941	+ $i = 0;
4942	+ while ( true ) {
4943	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
4944	+ $newPrefix = $prefix . "error($i).";
4945	+ $this->error[ $i ] = new ErrorData();
4946	+ $this->error[ $i ]->init( $map, $newPrefix );
4947	+ } else {
4948	+ break;
4949	+ }
4950	+ $i++;
4951	+ }
4952	+
4953	+ }
4954	+ }
4955	+ }
4956	+
4957	+
4958	+ /**
4959	+ * A request to make a refund based on various criteria. A
4960	+ * refund can be made against the entire payKey, an individual
4961	+ * transaction belonging to a payKey, a tracking id, or a
4962	+ * specific receiver of a payKey.
4963	+ */
4964	+ class RefundRequest
4965	+ {
4966	+
4967	+ /**
4968	+ *
4969	+ * @access public
4970	+ * @var RequestEnvelope
4971	+ */
4972	+ public $requestEnvelope;
4973	+
4974	+ /**
4975	+ *
4976	+ * @access public
4977	+ * @var string
4978	+ */
4979	+ public $currencyCode;
4980	+
4981	+ /**
4982	+ *
4983	+ * @access public
4984	+ * @var string
4985	+ */
4986	+ public $payKey;
4987	+
4988	+ /**
4989	+ *
4990	+ * @access public
4991	+ * @var string
4992	+ */
4993	+ public $transactionId;
4994	+
4995	+ /**
4996	+ *
4997	+ * @access public
4998	+ * @var string
4999	+ */
5000	+ public $trackingId;
5001	+
5002	+ /**
5003	+ *
5004	+ * @access public
5005	+ * @var ReceiverList
5006	+ */
5007	+ public $receiverList;
5008	+
5009	+ /**
5010	+ * Constructor with arguments
5011	+ */
5012	+ public function __construct( $requestEnvelope = null )
5013	+ {
5014	+ $this->requestEnvelope = $requestEnvelope;
5015	+ }
5016	+
5017	+
5018	+ public function toNVPString( $prefix = '' )
5019	+ {
5020	+ $str = '';
5021	+ $delim = '';
5022	+ if ( $this->requestEnvelope != null ) {
5023	+ $newPrefix = $prefix . 'requestEnvelope.';
5024	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5025	+ $delim = '&';
5026	+ }
5027	+ if ( $this->currencyCode != null ) {
5028	+ $str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
5029	+ $delim = '&';
5030	+ }
5031	+ if ( $this->payKey != null ) {
5032	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
5033	+ $delim = '&';
5034	+ }
5035	+ if ( $this->transactionId != null ) {
5036	+ $str .= $delim . $prefix . 'transactionId=' . urlencode( $this->transactionId );
5037	+ $delim = '&';
5038	+ }
5039	+ if ( $this->trackingId != null ) {
5040	+ $str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
5041	+ $delim = '&';
5042	+ }
5043	+ if ( $this->receiverList != null ) {
5044	+ $newPrefix = $prefix . 'receiverList.';
5045	+ $str .= $delim . call_user_func( array( $this->receiverList, 'toNVPString' ), $newPrefix );
5046	+ $delim = '&';
5047	+ }
5048	+
5049	+ return $str;
5050	+ }
5051	+
5052	+ }
5053	+
5054	+
5055	+ /**
5056	+ * The result of a Refund request.
5057	+ */
5058	+ class RefundResponse
5059	+ {
5060	+
5061	+ /**
5062	+ *
5063	+ * @access public
5064	+ * @var ResponseEnvelope
5065	+ */
5066	+ public $responseEnvelope;
5067	+
5068	+ /**
5069	+ *
5070	+ * @access public
5071	+ * @var string
5072	+ */
5073	+ public $currencyCode;
5074	+
5075	+ /**
5076	+ *
5077	+ * @access public
5078	+ * @var RefundInfoList
5079	+ */
5080	+ public $refundInfoList;
5081	+
5082	+ /**
5083	+ *
5084	+ * @array
5085	+ * @access public
5086	+ * @var ErrorData
5087	+ */
5088	+ public $error;
5089	+
5090	+
5091	+ public function init( $map = null, $prefix = '' )
5092	+ {
5093	+ if ( $map != null ) {
5094	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5095	+ $newPrefix = $prefix . "responseEnvelope.";
5096	+ $this->responseEnvelope = new ResponseEnvelope();
5097	+ $this->responseEnvelope->init( $map, $newPrefix );
5098	+ }
5099	+ $mapKeyName = $prefix . 'currencyCode';
5100	+ if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
5101	+ $this->currencyCode = $map[ $mapKeyName ];
5102	+ }
5103	+ if ( PPUtils::array_match_key( $map, $prefix . "refundInfoList." ) ) {
5104	+ $newPrefix = $prefix . "refundInfoList.";
5105	+ $this->refundInfoList = new RefundInfoList();
5106	+ $this->refundInfoList->init( $map, $newPrefix );
5107	+ }
5108	+ $i = 0;
5109	+ while ( true ) {
5110	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5111	+ $newPrefix = $prefix . "error($i).";
5112	+ $this->error[ $i ] = new ErrorData();
5113	+ $this->error[ $i ]->init( $map, $newPrefix );
5114	+ } else {
5115	+ break;
5116	+ }
5117	+ $i++;
5118	+ }
5119	+
5120	+ }
5121	+ }
5122	+ }
5123	+
5124	+
5125	+ /**
5126	+ * The request to set the options of a payment request.
5127	+ */
5128	+ class SetPaymentOptionsRequest
5129	+ {
5130	+
5131	+ /**
5132	+ *
5133	+ * @access public
5134	+ * @var RequestEnvelope
5135	+ */
5136	+ public $requestEnvelope;
5137	+
5138	+ /**
5139	+ *
5140	+ * @access public
5141	+ * @var string
5142	+ */
5143	+ public $payKey;
5144	+
5145	+ /**
5146	+ *
5147	+ * @access public
5148	+ * @var InitiatingEntity
5149	+ */
5150	+ public $initiatingEntity;
5151	+
5152	+ /**
5153	+ *
5154	+ * @access public
5155	+ * @var DisplayOptions
5156	+ */
5157	+ public $displayOptions;
5158	+
5159	+ /**
5160	+ *
5161	+ * @access public
5162	+ * @var string
5163	+ */
5164	+ public $shippingAddressId;
5165	+
5166	+ /**
5167	+ *
5168	+ * @access public
5169	+ * @var SenderOptions
5170	+ */
5171	+ public $senderOptions;
5172	+
5173	+ /**
5174	+ *
5175	+ * @array
5176	+ * @access public
5177	+ * @var ReceiverOptions
5178	+ */
5179	+ public $receiverOptions;
5180	+
5181	+ /**
5182	+ * Constructor with arguments
5183	+ */
5184	+ public function __construct( $requestEnvelope = null, $payKey = null )
5185	+ {
5186	+ $this->requestEnvelope = $requestEnvelope;
5187	+ $this->payKey = $payKey;
5188	+ }
5189	+
5190	+
5191	+ public function toNVPString( $prefix = '' )
5192	+ {
5193	+ $str = '';
5194	+ $delim = '';
5195	+ if ( $this->requestEnvelope != null ) {
5196	+ $newPrefix = $prefix . 'requestEnvelope.';
5197	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5198	+ $delim = '&';
5199	+ }
5200	+ if ( $this->payKey != null ) {
5201	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
5202	+ $delim = '&';
5203	+ }
5204	+ if ( $this->initiatingEntity != null ) {
5205	+ $newPrefix = $prefix . 'initiatingEntity.';
5206	+ $str .= $delim . call_user_func( array( $this->initiatingEntity, 'toNVPString' ), $newPrefix );
5207	+ $delim = '&';
5208	+ }
5209	+ if ( $this->displayOptions != null ) {
5210	+ $newPrefix = $prefix . 'displayOptions.';
5211	+ $str .= $delim . call_user_func( array( $this->displayOptions, 'toNVPString' ), $newPrefix );
5212	+ $delim = '&';
5213	+ }
5214	+ if ( $this->shippingAddressId != null ) {
5215	+ $str .= $delim . $prefix . 'shippingAddressId=' . urlencode( $this->shippingAddressId );
5216	+ $delim = '&';
5217	+ }
5218	+ if ( $this->senderOptions != null ) {
5219	+ $newPrefix = $prefix . 'senderOptions.';
5220	+ $str .= $delim . call_user_func( array( $this->senderOptions, 'toNVPString' ), $newPrefix );
5221	+ $delim = '&';
5222	+ }
5223	+ for ( $i = 0; $i < count( $this->receiverOptions ); $i++ ) {
5224	+ $newPrefix = $prefix . "receiverOptions($i).";
5225	+ $str .= $delim . call_user_func( array( $this->receiverOptions[ $i ], 'toNVPString' ), $newPrefix );
5226	+ $delim = '&';
5227	+ }
5228	+
5229	+ return $str;
5230	+ }
5231	+
5232	+ }
5233	+
5234	+
5235	+ /**
5236	+ * The response message for the SetPaymentOption request
5237	+ */
5238	+ class SetPaymentOptionsResponse
5239	+ {
5240	+
5241	+ /**
5242	+ *
5243	+ * @access public
5244	+ * @var ResponseEnvelope
5245	+ */
5246	+ public $responseEnvelope;
5247	+
5248	+ /**
5249	+ *
5250	+ * @array
5251	+ * @access public
5252	+ * @var ErrorData
5253	+ */
5254	+ public $error;
5255	+
5256	+
5257	+ public function init( $map = null, $prefix = '' )
5258	+ {
5259	+ if ( $map != null ) {
5260	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5261	+ $newPrefix = $prefix . "responseEnvelope.";
5262	+ $this->responseEnvelope = new ResponseEnvelope();
5263	+ $this->responseEnvelope->init( $map, $newPrefix );
5264	+ }
5265	+ $i = 0;
5266	+ while ( true ) {
5267	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5268	+ $newPrefix = $prefix . "error($i).";
5269	+ $this->error[ $i ] = new ErrorData();
5270	+ $this->error[ $i ]->init( $map, $newPrefix );
5271	+ } else {
5272	+ break;
5273	+ }
5274	+ $i++;
5275	+ }
5276	+
5277	+ }
5278	+ }
5279	+ }
5280	+
5281	+
5282	+ /**
5283	+ * The request to get the funding plans available for a
5284	+ * payment.
5285	+ */
5286	+ class GetFundingPlansRequest
5287	+ {
5288	+
5289	+ /**
5290	+ *
5291	+ * @access public
5292	+ * @var RequestEnvelope
5293	+ */
5294	+ public $requestEnvelope;
5295	+
5296	+ /**
5297	+ *
5298	+ * @access public
5299	+ * @var string
5300	+ */
5301	+ public $payKey;
5302	+
5303	+ /**
5304	+ * Constructor with arguments
5305	+ */
5306	+ public function __construct( $requestEnvelope = null, $payKey = null )
5307	+ {
5308	+ $this->requestEnvelope = $requestEnvelope;
5309	+ $this->payKey = $payKey;
5310	+ }
5311	+
5312	+
5313	+ public function toNVPString( $prefix = '' )
5314	+ {
5315	+ $str = '';
5316	+ $delim = '';
5317	+ if ( $this->requestEnvelope != null ) {
5318	+ $newPrefix = $prefix . 'requestEnvelope.';
5319	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5320	+ $delim = '&';
5321	+ }
5322	+ if ( $this->payKey != null ) {
5323	+ $str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
5324	+ $delim = '&';
5325	+ }
5326	+
5327	+ return $str;
5328	+ }
5329	+
5330	+ }
5331	+
5332	+
5333	+ /**
5334	+ * The response to get the funding plans available for a
5335	+ * payment.
5336	+ */
5337	+ class GetFundingPlansResponse
5338	+ {
5339	+
5340	+ /**
5341	+ *
5342	+ * @access public
5343	+ * @var ResponseEnvelope
5344	+ */
5345	+ public $responseEnvelope;
5346	+
5347	+ /**
5348	+ *
5349	+ * @array
5350	+ * @access public
5351	+ * @var FundingPlan
5352	+ */
5353	+ public $fundingPlan;
5354	+
5355	+ /**
5356	+ *
5357	+ * @array
5358	+ * @access public
5359	+ * @var ErrorData
5360	+ */
5361	+ public $error;
5362	+
5363	+
5364	+ public function init( $map = null, $prefix = '' )
5365	+ {
5366	+ if ( $map != null ) {
5367	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5368	+ $newPrefix = $prefix . "responseEnvelope.";
5369	+ $this->responseEnvelope = new ResponseEnvelope();
5370	+ $this->responseEnvelope->init( $map, $newPrefix );
5371	+ }
5372	+ $i = 0;
5373	+ while ( true ) {
5374	+ if ( PPUtils::array_match_key( $map, $prefix . "fundingPlan($i)" ) ) {
5375	+ $newPrefix = $prefix . "fundingPlan($i).";
5376	+ $this->fundingPlan[ $i ] = new FundingPlan();
5377	+ $this->fundingPlan[ $i ]->init( $map, $newPrefix );
5378	+ } else {
5379	+ break;
5380	+ }
5381	+ $i++;
5382	+ }
5383	+ $i = 0;
5384	+ while ( true ) {
5385	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5386	+ $newPrefix = $prefix . "error($i).";
5387	+ $this->error[ $i ] = new ErrorData();
5388	+ $this->error[ $i ]->init( $map, $newPrefix );
5389	+ } else {
5390	+ break;
5391	+ }
5392	+ $i++;
5393	+ }
5394	+
5395	+ }
5396	+ }
5397	+ }
5398	+
5399	+
5400	+ /**
5401	+ * The request to get the addresses available for a payment.
5402	+ */
5403	+ class GetAvailableShippingAddressesRequest
5404	+ {
5405	+
5406	+ /**
5407	+ *
5408	+ * @access public
5409	+ * @var RequestEnvelope
5410	+ */
5411	+ public $requestEnvelope;
5412	+
5413	+ /**
5414	+ * The key for which to provide the available addresses. Key
5415	+ * can be an AdaptivePayments key such as payKey or
5416	+ * preapprovalKey
5417	+ * @access public
5418	+ * @var string
5419	+ */
5420	+ public $key;
5421	+
5422	+ /**
5423	+ * Constructor with arguments
5424	+ */
5425	+ public function __construct( $requestEnvelope = null, $key = null )
5426	+ {
5427	+ $this->requestEnvelope = $requestEnvelope;
5428	+ $this->key = $key;
5429	+ }
5430	+
5431	+
5432	+ public function toNVPString( $prefix = '' )
5433	+ {
5434	+ $str = '';
5435	+ $delim = '';
5436	+ if ( $this->requestEnvelope != null ) {
5437	+ $newPrefix = $prefix . 'requestEnvelope.';
5438	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5439	+ $delim = '&';
5440	+ }
5441	+ if ( $this->key != null ) {
5442	+ $str .= $delim . $prefix . 'key=' . urlencode( $this->key );
5443	+ $delim = '&';
5444	+ }
5445	+
5446	+ return $str;
5447	+ }
5448	+
5449	+ }
5450	+
5451	+
5452	+ /**
5453	+ * The response to get the shipping addresses available for a
5454	+ * payment.
5455	+ */
5456	+ class GetAvailableShippingAddressesResponse
5457	+ {
5458	+
5459	+ /**
5460	+ *
5461	+ * @access public
5462	+ * @var ResponseEnvelope
5463	+ */
5464	+ public $responseEnvelope;
5465	+
5466	+ /**
5467	+ *
5468	+ * @array
5469	+ * @access public
5470	+ * @var Address
5471	+ */
5472	+ public $availableAddress;
5473	+
5474	+ /**
5475	+ *
5476	+ * @array
5477	+ * @access public
5478	+ * @var ErrorData
5479	+ */
5480	+ public $error;
5481	+
5482	+
5483	+ public function init( $map = null, $prefix = '' )
5484	+ {
5485	+ if ( $map != null ) {
5486	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5487	+ $newPrefix = $prefix . "responseEnvelope.";
5488	+ $this->responseEnvelope = new ResponseEnvelope();
5489	+ $this->responseEnvelope->init( $map, $newPrefix );
5490	+ }
5491	+ $i = 0;
5492	+ while ( true ) {
5493	+ if ( PPUtils::array_match_key( $map, $prefix . "availableAddress($i)" ) ) {
5494	+ $newPrefix = $prefix . "availableAddress($i).";
5495	+ $this->availableAddress[ $i ] = new Address();
5496	+ $this->availableAddress[ $i ]->init( $map, $newPrefix );
5497	+ } else {
5498	+ break;
5499	+ }
5500	+ $i++;
5501	+ }
5502	+ $i = 0;
5503	+ while ( true ) {
5504	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5505	+ $newPrefix = $prefix . "error($i).";
5506	+ $this->error[ $i ] = new ErrorData();
5507	+ $this->error[ $i ]->init( $map, $newPrefix );
5508	+ } else {
5509	+ break;
5510	+ }
5511	+ $i++;
5512	+ }
5513	+
5514	+ }
5515	+ }
5516	+ }
5517	+
5518	+
5519	+ /**
5520	+ * The request to get the addresses available for a payment.
5521	+ */
5522	+ class GetShippingAddressesRequest
5523	+ {
5524	+
5525	+ /**
5526	+ *
5527	+ * @access public
5528	+ * @var RequestEnvelope
5529	+ */
5530	+ public $requestEnvelope;
5531	+
5532	+ /**
5533	+ * The key for which to provide the available addresses. Key
5534	+ * can be an AdaptivePayments key such as payKey or
5535	+ * preapprovalKey
5536	+ * @access public
5537	+ * @var string
5538	+ */
5539	+ public $key;
5540	+
5541	+ /**
5542	+ * Constructor with arguments
5543	+ */
5544	+ public function __construct( $requestEnvelope = null, $key = null )
5545	+ {
5546	+ $this->requestEnvelope = $requestEnvelope;
5547	+ $this->key = $key;
5548	+ }
5549	+
5550	+
5551	+ public function toNVPString( $prefix = '' )
5552	+ {
5553	+ $str = '';
5554	+ $delim = '';
5555	+ if ( $this->requestEnvelope != null ) {
5556	+ $newPrefix = $prefix . 'requestEnvelope.';
5557	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5558	+ $delim = '&';
5559	+ }
5560	+ if ( $this->key != null ) {
5561	+ $str .= $delim . $prefix . 'key=' . urlencode( $this->key );
5562	+ $delim = '&';
5563	+ }
5564	+
5565	+ return $str;
5566	+ }
5567	+
5568	+ }
5569	+
5570	+
5571	+ /**
5572	+ * The response to get the shipping addresses available for a
5573	+ * payment.
5574	+ */
5575	+ class GetShippingAddressesResponse
5576	+ {
5577	+
5578	+ /**
5579	+ *
5580	+ * @access public
5581	+ * @var ResponseEnvelope
5582	+ */
5583	+ public $responseEnvelope;
5584	+
5585	+ /**
5586	+ *
5587	+ * @access public
5588	+ * @var Address
5589	+ */
5590	+ public $selectedAddress;
5591	+
5592	+ /**
5593	+ *
5594	+ * @array
5595	+ * @access public
5596	+ * @var ErrorData
5597	+ */
5598	+ public $error;
5599	+
5600	+
5601	+ public function init( $map = null, $prefix = '' )
5602	+ {
5603	+ if ( $map != null ) {
5604	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5605	+ $newPrefix = $prefix . "responseEnvelope.";
5606	+ $this->responseEnvelope = new ResponseEnvelope();
5607	+ $this->responseEnvelope->init( $map, $newPrefix );
5608	+ }
5609	+ if ( PPUtils::array_match_key( $map, $prefix . "selectedAddress." ) ) {
5610	+ $newPrefix = $prefix . "selectedAddress.";
5611	+ $this->selectedAddress = new Address();
5612	+ $this->selectedAddress->init( $map, $newPrefix );
5613	+ }
5614	+ $i = 0;
5615	+ while ( true ) {
5616	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5617	+ $newPrefix = $prefix . "error($i).";
5618	+ $this->error[ $i ] = new ErrorData();
5619	+ $this->error[ $i ]->init( $map, $newPrefix );
5620	+ } else {
5621	+ break;
5622	+ }
5623	+ $i++;
5624	+ }
5625	+
5626	+ }
5627	+ }
5628	+ }
5629	+
5630	+
5631	+ /**
5632	+ * The request to get the remaining limits for a user
5633	+ */
5634	+ class GetUserLimitsRequest
5635	+ {
5636	+
5637	+ /**
5638	+ *
5639	+ * @access public
5640	+ * @var RequestEnvelope
5641	+ */
5642	+ public $requestEnvelope;
5643	+
5644	+ /**
5645	+ * The account identifier for the user
5646	+ * @access public
5647	+ * @var AccountIdentifier
5648	+ */
5649	+ public $user;
5650	+
5651	+ /**
5652	+ *
5653	+ * @access public
5654	+ * @var string
5655	+ */
5656	+ public $country;
5657	+
5658	+ /**
5659	+ *
5660	+ * @access public
5661	+ * @var string
5662	+ */
5663	+ public $currencyCode;
5664	+
5665	+ /**
5666	+ * List of limit types
5667	+ * @array
5668	+ * @access public
5669	+ * @var string
5670	+ */
5671	+ public $limitType;
5672	+
5673	+ /**
5674	+ * Constructor with arguments
5675	+ */
5676	+ public function __construct( $requestEnvelope = null, $user = null, $country = null, $currencyCode = null, $limitType = null )
5677	+ {
5678	+ $this->requestEnvelope = $requestEnvelope;
5679	+ $this->user = $user;
5680	+ $this->country = $country;
5681	+ $this->currencyCode = $currencyCode;
5682	+ $this->limitType = $limitType;
5683	+ }
5684	+
5685	+
5686	+ public function toNVPString( $prefix = '' )
5687	+ {
5688	+ $str = '';
5689	+ $delim = '';
5690	+ if ( $this->requestEnvelope != null ) {
5691	+ $newPrefix = $prefix . 'requestEnvelope.';
5692	+ $str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
5693	+ $delim = '&';
5694	+ }
5695	+ if ( $this->user != null ) {
5696	+ $newPrefix = $prefix . 'user.';
5697	+ $str .= $delim . call_user_func( array( $this->user, 'toNVPString' ), $newPrefix );
5698	+ $delim = '&';
5699	+ }
5700	+ if ( $this->country != null ) {
5701	+ $str .= $delim . $prefix . 'country=' . urlencode( $this->country );
5702	+ $delim = '&';
5703	+ }
5704	+ if ( $this->currencyCode != null ) {
5705	+ $str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
5706	+ $delim = '&';
5707	+ }
5708	+ for ( $i = 0; $i < count( $this->limitType ); $i++ ) {
5709	+ $str .= $delim . $prefix . "limitType($i)=" . urlencode( $this->limitType[ $i ] );
5710	+ $delim = '&';
5711	+ }
5712	+
5713	+ return $str;
5714	+ }
5715	+
5716	+ }
5717	+
5718	+
5719	+ /**
5720	+ * A response that contains a list of remaining limits
5721	+ */
5722	+ class GetUserLimitsResponse
5723	+ {
5724	+
5725	+ /**
5726	+ *
5727	+ * @access public
5728	+ * @var ResponseEnvelope
5729	+ */
5730	+ public $responseEnvelope;
5731	+
5732	+ /**
5733	+ *
5734	+ * @array
5735	+ * @access public
5736	+ * @var UserLimit
5737	+ */
5738	+ public $userLimit;
5739	+
5740	+ /**
5741	+ *
5742	+ * @access public
5743	+ * @var WarningDataList
5744	+ */
5745	+ public $warningDataList;
5746	+
5747	+ /**
5748	+ *
5749	+ * @array
5750	+ * @access public
5751	+ * @var ErrorData
5752	+ */
5753	+ public $error;
5754	+
5755	+
5756	+ public function init( $map = null, $prefix = '' )
5757	+ {
5758	+ if ( $map != null ) {
5759	+ if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
5760	+ $newPrefix = $prefix . "responseEnvelope.";
5761	+ $this->responseEnvelope = new ResponseEnvelope();
5762	+ $this->responseEnvelope->init( $map, $newPrefix );
5763	+ }
5764	+ $i = 0;
5765	+ while ( true ) {
5766	+ if ( PPUtils::array_match_key( $map, $prefix . "userLimit($i)" ) ) {
5767	+ $newPrefix = $prefix . "userLimit($i).";
5768	+ $this->userLimit[ $i ] = new UserLimit();
5769	+ $this->userLimit[ $i ]->init( $map, $newPrefix );
5770	+ } else {
5771	+ break;
5772	+ }
5773	+ $i++;
5774	+ }
5775	+ if ( PPUtils::array_match_key( $map, $prefix . "warningDataList." ) ) {
5776	+ $newPrefix = $prefix . "warningDataList.";
5777	+ $this->warningDataList = new WarningDataList();
5778	+ $this->warningDataList->init( $map, $newPrefix );
5779	+ }
5780	+ $i = 0;
5781	+ while ( true ) {
5782	+ if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
5783	+ $newPrefix = $prefix . "error($i).";
5784	+ $this->error[ $i ] = new ErrorData();
5785	+ $this->error[ $i ]->init( $map, $newPrefix );
5786	+ } else {
5787	+ break;
5788	+ }
5789	+ $i++;
5790	+ }
5791	+
5792	+ }
5793	+ }
5794	+ }
5795	+
5796	+
5797	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePaymentsService.php ADDED Viewed

	@@ -0,0 +1,314 @@


1	+ <?php
2	+ require_once( 'PPBaseService.php' );
3	+ require_once( 'AdaptivePayments.php' );
4	+ require_once( 'PPUtils.php' );
5	+
6	+
7	+ /**
8	+ * AUTO GENERATED code for AdaptivePayments
9	+ */
10	+ class AdaptivePaymentsService extends PPBaseService
11	+ {
12	+
13	+ // Service Version
14	+ private static $SERVICE_VERSION = "1.8.1";
15	+
16	+ // Service Name
17	+ private static $SERVICE_NAME = "AdaptivePayments";
18	+
19	+ public function __construct()
20	+ {
21	+ parent::__construct( 'AdaptivePayments' );
22	+ }
23	+
24	+
25	+ /**
26	+ * Service Call: CancelPreapproval
27	+ *
28	+ * @param CancelPreapprovalRequest $cancelPreapprovalRequest
29	+ *
30	+ * @return CancelPreapprovalResponse
31	+ * @throws APIException
32	+ */
33	+ public function CancelPreapproval( $cancelPreapprovalRequest, $apiUsername = null )
34	+ {
35	+ $ret = new CancelPreapprovalResponse();
36	+ $resp = $this->call( "CancelPreapproval", $cancelPreapprovalRequest, $apiUsername );
37	+ $ret->init( PPUtils::nvpToMap( $resp ) );
38	+
39	+ return $ret;
40	+ }
41	+
42	+
43	+ /**
44	+ * Service Call: ConfirmPreapproval
45	+ *
46	+ * @param ConfirmPreapprovalRequest $confirmPreapprovalRequest
47	+ *
48	+ * @return ConfirmPreapprovalResponse
49	+ * @throws APIException
50	+ */
51	+ public function ConfirmPreapproval( $confirmPreapprovalRequest, $apiUsername = null )
52	+ {
53	+ $ret = new ConfirmPreapprovalResponse();
54	+ $resp = $this->call( "ConfirmPreapproval", $confirmPreapprovalRequest, $apiUsername );
55	+ $ret->init( PPUtils::nvpToMap( $resp ) );
56	+
57	+ return $ret;
58	+ }
59	+
60	+
61	+ /**
62	+ * Service Call: ConvertCurrency
63	+ *
64	+ * @param ConvertCurrencyRequest $convertCurrencyRequest
65	+ *
66	+ * @return ConvertCurrencyResponse
67	+ * @throws APIException
68	+ */
69	+ public function ConvertCurrency( $convertCurrencyRequest, $apiUsername = null )
70	+ {
71	+ $ret = new ConvertCurrencyResponse();
72	+ $resp = $this->call( "ConvertCurrency", $convertCurrencyRequest, $apiUsername );
73	+ $ret->init( PPUtils::nvpToMap( $resp ) );
74	+
75	+ return $ret;
76	+ }
77	+
78	+
79	+ /**
80	+ * Service Call: ExecutePayment
81	+ *
82	+ * @param ExecutePaymentRequest $executePaymentRequest
83	+ *
84	+ * @return ExecutePaymentResponse
85	+ * @throws APIException
86	+ */
87	+ public function ExecutePayment( $executePaymentRequest, $apiUsername = null )
88	+ {
89	+ $ret = new ExecutePaymentResponse();
90	+ $resp = $this->call( "ExecutePayment", $executePaymentRequest, $apiUsername );
91	+ $ret->init( PPUtils::nvpToMap( $resp ) );
92	+
93	+ return $ret;
94	+ }
95	+
96	+
97	+ /**
98	+ * Service Call: GetAllowedFundingSources
99	+ *
100	+ * @param GetAllowedFundingSourcesRequest $getAllowedFundingSourcesRequest
101	+ *
102	+ * @return GetAllowedFundingSourcesResponse
103	+ * @throws APIException
104	+ */
105	+ public function GetAllowedFundingSources( $getAllowedFundingSourcesRequest, $apiUsername = null )
106	+ {
107	+ $ret = new GetAllowedFundingSourcesResponse();
108	+ $resp = $this->call( "GetAllowedFundingSources", $getAllowedFundingSourcesRequest, $apiUsername );
109	+ $ret->init( PPUtils::nvpToMap( $resp ) );
110	+
111	+ return $ret;
112	+ }
113	+
114	+
115	+ /**
116	+ * Service Call: GetPaymentOptions
117	+ *
118	+ * @param GetPaymentOptionsRequest $getPaymentOptionsRequest
119	+ *
120	+ * @return GetPaymentOptionsResponse
121	+ * @throws APIException
122	+ */
123	+ public function GetPaymentOptions( $getPaymentOptionsRequest, $apiUsername = null )
124	+ {
125	+ $ret = new GetPaymentOptionsResponse();
126	+ $resp = $this->call( "GetPaymentOptions", $getPaymentOptionsRequest, $apiUsername );
127	+ $ret->init( PPUtils::nvpToMap( $resp ) );
128	+
129	+ return $ret;
130	+ }
131	+
132	+
133	+ /**
134	+ * Service Call: PaymentDetails
135	+ *
136	+ * @param PaymentDetailsRequest $paymentDetailsRequest
137	+ *
138	+ * @return PaymentDetailsResponse
139	+ * @throws APIException
140	+ */
141	+ public function PaymentDetails( $paymentDetailsRequest, $apiUsername = null )
142	+ {
143	+ $ret = new PaymentDetailsResponse();
144	+ $resp = $this->call( "PaymentDetails", $paymentDetailsRequest, $apiUsername );
145	+ $ret->init( PPUtils::nvpToMap( $resp ) );
146	+
147	+ return $ret;
148	+ }
149	+
150	+
151	+ /**
152	+ * Service Call: Pay
153	+ *
154	+ * @param PayRequest $payRequest
155	+ *
156	+ * @return PayResponse
157	+ * @throws APIException
158	+ */
159	+ public function Pay( $payRequest, $apiUsername = null )
160	+ {
161	+ $ret = new PayResponse();
162	+ $resp = $this->call( "Pay", $payRequest, $apiUsername );
163	+ $ret->init( PPUtils::nvpToMap( $resp ) );
164	+
165	+ return $ret;
166	+ }
167	+
168	+
169	+ /**
170	+ * Service Call: PreapprovalDetails
171	+ *
172	+ * @param PreapprovalDetailsRequest $preapprovalDetailsRequest
173	+ *
174	+ * @return PreapprovalDetailsResponse
175	+ * @throws APIException
176	+ */
177	+ public function PreapprovalDetails( $preapprovalDetailsRequest, $apiUsername = null )
178	+ {
179	+ $ret = new PreapprovalDetailsResponse();
180	+ $resp = $this->call( "PreapprovalDetails", $preapprovalDetailsRequest, $apiUsername );
181	+ $ret->init( PPUtils::nvpToMap( $resp ) );
182	+
183	+ return $ret;
184	+ }
185	+
186	+
187	+ /**
188	+ * Service Call: Preapproval
189	+ *
190	+ * @param PreapprovalRequest $preapprovalRequest
191	+ *
192	+ * @return PreapprovalResponse
193	+ * @throws APIException
194	+ */
195	+ public function Preapproval( $preapprovalRequest, $apiUsername = null )
196	+ {
197	+ $ret = new PreapprovalResponse();
198	+ $resp = $this->call( "Preapproval", $preapprovalRequest, $apiUsername );
199	+ $ret->init( PPUtils::nvpToMap( $resp ) );
200	+
201	+ return $ret;
202	+ }
203	+
204	+
205	+ /**
206	+ * Service Call: Refund
207	+ *
208	+ * @param RefundRequest $refundRequest
209	+ *
210	+ * @return RefundResponse
211	+ * @throws APIException
212	+ */
213	+ public function Refund( $refundRequest, $apiUsername = null )
214	+ {
215	+ $ret = new RefundResponse();
216	+ $resp = $this->call( "Refund", $refundRequest, $apiUsername );
217	+ $ret->init( PPUtils::nvpToMap( $resp ) );
218	+
219	+ return $ret;
220	+ }
221	+
222	+
223	+ /**
224	+ * Service Call: SetPaymentOptions
225	+ *
226	+ * @param SetPaymentOptionsRequest $setPaymentOptionsRequest
227	+ *
228	+ * @return SetPaymentOptionsResponse
229	+ * @throws APIException
230	+ */
231	+ public function SetPaymentOptions( $setPaymentOptionsRequest, $apiUsername = null )
232	+ {
233	+ $ret = new SetPaymentOptionsResponse();
234	+ $resp = $this->call( "SetPaymentOptions", $setPaymentOptionsRequest, $apiUsername );
235	+ $ret->init( PPUtils::nvpToMap( $resp ) );
236	+
237	+ return $ret;
238	+ }
239	+
240	+
241	+ /**
242	+ * Service Call: GetFundingPlans
243	+ *
244	+ * @param GetFundingPlansRequest $getFundingPlansRequest
245	+ *
246	+ * @return GetFundingPlansResponse
247	+ * @throws APIException
248	+ */
249	+ public function GetFundingPlans( $getFundingPlansRequest, $apiUsername = null )
250	+ {
251	+ $ret = new GetFundingPlansResponse();
252	+ $resp = $this->call( "GetFundingPlans", $getFundingPlansRequest, $apiUsername );
253	+ $ret->init( PPUtils::nvpToMap( $resp ) );
254	+
255	+ return $ret;
256	+ }
257	+
258	+
259	+ /**
260	+ * Service Call: GetAvailableShippingAddresses
261	+ *
262	+ * @param GetAvailableShippingAddressesRequest $getAvailableShippingAddressesRequest
263	+ *
264	+ * @return GetAvailableShippingAddressesResponse
265	+ * @throws APIException
266	+ */
267	+ public function GetAvailableShippingAddresses( $getAvailableShippingAddressesRequest, $apiUsername = null )
268	+ {
269	+ $ret = new GetAvailableShippingAddressesResponse();
270	+ $resp = $this->call( "GetAvailableShippingAddresses", $getAvailableShippingAddressesRequest, $apiUsername );
271	+ $ret->init( PPUtils::nvpToMap( $resp ) );
272	+
273	+ return $ret;
274	+ }
275	+
276	+
277	+ /**
278	+ * Service Call: GetShippingAddresses
279	+ *
280	+ * @param GetShippingAddressesRequest $getShippingAddressesRequest
281	+ *
282	+ * @return GetShippingAddressesResponse
283	+ * @throws APIException
284	+ */
285	+ public function GetShippingAddresses( $getShippingAddressesRequest, $apiUsername = null )
286	+ {
287	+ $ret = new GetShippingAddressesResponse();
288	+ $resp = $this->call( "GetShippingAddresses", $getShippingAddressesRequest, $apiUsername );
289	+ $ret->init( PPUtils::nvpToMap( $resp ) );
290	+
291	+ return $ret;
292	+ }
293	+
294	+
295	+ /**
296	+ * Service Call: GetUserLimits
297	+ *
298	+ * @param GetUserLimitsRequest $getUserLimitsRequest
299	+ *
300	+ * @return GetUserLimitsResponse
301	+ * @throws APIException
302	+ */
303	+ public function GetUserLimits( $getUserLimitsRequest, $apiUsername = null )
304	+ {
305	+ $ret = new GetUserLimitsResponse();
306	+ $resp = $this->call( "GetUserLimits", $getUserLimitsRequest, $apiUsername );
307	+ $ret->init( PPUtils::nvpToMap( $resp ) );
308	+
309	+ return $ret;
310	+ }
311	+
312	+ }
313	+
314	+ ?>

trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/index.php ADDED Viewed

File without changes

trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php ADDED Viewed

	@@ -0,0 +1,555 @@


1	+ <?php
2	+
3	+ if ( !class_exists( 'WC_Payment_Gateway' ) ) return false;
4	+
5	+ /**
6	+ * Add the gateway to WooCommerce
7	+ *
8	+ * @access public
9	+ *
10	+ * @param array $methods
11	+ *
12	+ * @return array
13	+ */
14	+
15	+
16	+ function add_paypal_ap_gateway( $methods )
17	+ {
18	+ $methods[ ] = 'WC_PaypalAP';
19	+
20	+ return $methods;
21	+ }
22	+
23	+
24	+ add_filter( 'woocommerce_payment_gateways', 'add_paypal_ap_gateway' );
25	+
26	+ class WC_PaypalAP extends WC_Payment_Gateway
27	+ {
28	+
29	+ public static $pluginDir;
30	+
31	+ /**
32	+ *
33	+ */
34	+ public function __construct()
35	+ {
36	+ global $woocommerce;
37	+
38	+ self::$pluginDir = trailingslashit( dirname( __FILE__ ) ) . 'PayPal_AP/';
39	+
40	+ /* Standard WooCommerce Configuration */
41	+ $this->id = 'paypalap';
42	+ $this->icon = plugin_dir_url( __FILE__ ) . 'PayPal_AP/assets/icons/paypalap.png';
43	+ $this->method_title = __( 'PayPal Adaptive Payments', 'wcvendors' );
44	+ $this->has_fields = false;
45	+
46	+ // Load the settings
47	+ $this->init_form_fields();
48	+ $this->init_settings();
49	+
50	+ $this->enabled = $this->settings[ 'enabled' ];
51	+ $this->title = $this->settings[ 'title' ];
52	+ $this->description = $this->settings[ 'description' ];
53	+
54	+ $this->currency = get_option( 'woocommerce_currency' );
55	+
56	+ /* PayPal Adaptive Payments Configuration. */
57	+ $this->sandbox = $this->settings[ 'sandbox_enabled' ];
58	+ $this->main_paypal = $this->sandbox == 'yes' ? $this->settings[ 'main_paypal' ] : $this->settings[ 'main_paypal_live' ];
59	+ $this->instapay = WC_Vendors::$pv_options->get_option( 'instapay' );
60	+ $this->give_tax = WC_Vendors::$pv_options->get_option( 'give_tax' );
61	+
62	+ add_action( 'woocommerce_update_options_payment_gateways_' . $this->id, array( $this, 'process_admin_options' ) );
63	+
64	+ // Payment listener/API hook
65	+ add_action( 'woocommerce_api_wc_paypalap', array( $this, 'paypal_ap_ipn' ) );
66	+
67	+ $this->debug_me = false;
68	+ }
69	+
70	+
71	+ /**
72	+ *
73	+ *
74	+ * @return unknown
75	+ */
76	+ public function is_available()
77	+ {
78	+ return ( $this->is_valid_currency() && $this->enabled == 'yes' );
79	+ }
80	+
81	+
82	+ /**
83	+ *
84	+ *
85	+ * @return unknown
86	+ */
87	+ public function is_valid_currency()
88	+ {
89	+ return in_array( get_woocommerce_currency(), array( 'AUD', 'BRL', 'CAD', 'MXN', 'NZD', 'HKD', 'SGD', 'USD', 'EUR', 'JPY', 'TRY', 'NOK', 'CZK', 'DKK', 'HUF', 'ILS', 'MYR', 'PHP', 'PLN', 'SEK', 'CHF', 'TWD', 'THB', 'GBP', 'RMB' ) );
90	+ }
91	+
92	+
93	+ /**
94	+ *
95	+ */
96	+ public function include_paypal_sdk()
97	+ {
98	+ $path = self::$pluginDir . 'classes/adaptivepayments-sdk/lib';
99	+ set_include_path( get_include_path() . PATH_SEPARATOR . $path );
100	+ require_once 'services/AdaptivePayments/AdaptivePaymentsService.php';
101	+ }
102	+
103	+
104	+ /**
105	+ *
106	+ *
107	+ * @return unknown
108	+ */
109	+ public function paypal_ap_ipn()
110	+ {
111	+ if ( empty( $_GET[ 'paypal_chain_ipn' ] ) \|\| empty( $_GET[ 'order_id' ] ) ) return false;
112	+
113	+ $order_id = (int) $_GET[ 'order_id' ];
114	+
115	+ $order = new WC_Order( $order_id );
116	+ if ( !$order ) return false;
117	+
118	+ if ( $_POST[ 'status' ] !== 'COMPLETED' ) {
119	+ $order->update_status( 'failed', sprintf( __( 'Something went wrong. Response from PayPal invalidated this order. Status: %s.', 'wcvendors' ), $_POST[ 'status' ] ) );
120	+ exit;
121	+ }
122	+
123	+ $order->payment_complete();
124	+ $order->add_order_note( __( 'IPN payment completed', 'wcvendors' ) );
125	+
126	+ if ( $this->instapay ) {
127	+ WCV_Commission::set_order_commission_paid( $order_id );
128	+ }
129	+ exit;
130	+ }
131	+
132	+
133	+ /**
134	+ * Initialise Gateway Settings Form Fields
135	+ *
136	+ * @access public
137	+ * @return void
138	+ */
139	+ function init_form_fields()
140	+ {
141	+
142	+ $this->form_fields = array();
143	+
144	+ // List each option in order of appearance with details
145	+ $this->form_fields[ 'enabled' ] = array(
146	+ 'title' => __( 'Enable PayPal Adaptive Payments', 'wcvendors' ),
147	+ 'default' => 'no',
148	+ 'type' => 'checkbox',
149	+ );
150	+
151	+ $this->form_fields[ 'title' ] = array(
152	+ 'title' => __( 'Method Title', 'wcvendors' ),
153	+ 'description' => __( 'This controls the title which the user sees during checkout.', 'wcvendors' ),
154	+ 'default' => __( 'PayPal', 'wcvendors' ),
155	+ 'type' => 'text'
156	+ );
157	+
158	+ $this->form_fields[ 'description' ] = array(
159	+ 'title' => __( 'Description', 'wcvendors' ),
160	+ 'description' => __( 'This controls the description which the user sees during checkout.', 'wcvendors' ),
161	+ 'default' => __( "Pay via PayPal!", 'wcvendors' ),
162	+ 'type' => 'textarea'
163	+ );
164	+
165	+ // ==================================================================
166	+ //
167	+ // Credentials
168	+ //
169	+ // ------------------------------------------------------------------
170	+
171	+ $this->form_fields[ ] = array(
172	+ 'title' => __( 'Live Credentials', 'wcvendors' ),
173	+ 'type' => 'title',
174	+ 'description' => sprintf( __( 'You must have an <a href="%s">Application ID</a> to process live transactions. You do not need one for testing in Sandbox mode.', 'wcvendors' )
175	+ , 'https://developer.paypal.com/webapps/developer/docs/classic/lifecycle/goingLive/' )
176	+ );
177	+
178	+ $this->form_fields[ 'main_paypal_live' ] = array(
179	+ 'title' => __( 'PayPal Email', 'wcvendors' ),
180	+ 'description' => __( 'The email address main payments should go to.', 'wcvendors' ),
181	+ 'type' => 'text'
182	+ );
183	+
184	+ $this->form_fields[ 'username_live' ] = array(
185	+ 'title' => __( 'API Username', 'wcvendors' ),
186	+ 'type' => 'text'
187	+ );
188	+
189	+ $this->form_fields[ 'password_live' ] = array(
190	+ 'title' => __( 'API Password', 'wcvendors' ),
191	+ 'type' => 'text'
192	+ );
193	+
194	+ $this->form_fields[ 'signature_live' ] = array(
195	+ 'title' => __( 'API Signature', 'wcvendors' ),
196	+ 'type' => 'text'
197	+ );
198	+
199	+ $this->form_fields[ 'app_id' ] = array(
200	+ 'title' => __( 'Application ID', 'wcvendors' ),
201	+ 'type' => 'text',
202	+ 'description' => __( 'Only required when doing live transactions.', 'wcvendors' ),
203	+ );
204	+
205	+ $this->form_fields[ ] = array(
206	+ 'title' => __( 'Sandbox Credentials', 'wcvendors' ),
207	+ 'type' => 'title',
208	+ 'description' => sprintf( __( 'You can signup for a sandbox developer account <a href="%s">here</a>. You need a developer account if you want to enable Sandbox mode for testing.', 'wcvendors' )
209	+ , 'https://developer.paypal.com/' )
210	+ );
211	+
212	+ $this->form_fields[ 'main_paypal' ] = array(
213	+ 'title' => __( 'PayPal Email', 'wcvendors' ),
214	+ 'description' => __( 'The email address main payments should go to.', 'wcvendors' ),
215	+ 'type' => 'text'
216	+ );
217	+
218	+ $this->form_fields[ 'username' ] = array(
219	+ 'title' => __( 'API Username', 'wcvendors' ),
220	+ 'type' => 'text'
221	+ );
222	+
223	+ $this->form_fields[ 'password' ] = array(
224	+ 'title' => __( 'API Password', 'wcvendors' ),
225	+ 'type' => 'text'
226	+ );
227	+
228	+ $this->form_fields[ 'signature' ] = array(
229	+ 'title' => __( 'API Signature', 'wcvendors' ),
230	+ 'type' => 'text'
231	+ );
232	+
233	+ // ==================================================================
234	+ //
235	+ // Misc. Settings
236	+ //
237	+ // ------------------------------------------------------------------
238	+
239	+ $this->form_fields[ ] = array(
240	+ 'title' => __( 'Misc. Settings', 'wcvendors' ),
241	+ 'type' => 'title',
242	+ );
243	+
244	+ $this->form_fields[ 'sandbox_enabled' ] = array(
245	+ 'title' => __( 'Enable PayPal Sandbox mode', 'wcvendors' ),
246	+ 'default' => 'yes',
247	+ 'type' => 'checkbox',
248	+ );
249	+
250	+ $this->form_fields[ 'logging_enabled' ] = array(
251	+ 'title' => __( 'Enable logging', 'wcvendors' ),
252	+ 'default' => 'no',
253	+ 'type' => 'checkbox',
254	+ );
255	+
256	+ }
257	+
258	+
259	+ /**
260	+ * Admin Panel Options
261	+ *
262	+ * @access public
263	+ * @return void
264	+ */
265	+ function admin_options()
266	+ {
267	+ ?>
268	+ <h3><?php echo $this->method_title; ?></h3>
269	+ <p><?php _e( 'The PayPal Adaptive Payments gateway can instantly pay your vendors their due commission (if enabled). Also used to mass pay vendors on a schedule / manual method (if enabled).', 'wcvendors' ); ?></p>
270	+ <table class="form-table">
271	+
272	+ <?php if ( $this->is_valid_currency() ) :
273	+
274	+ // Generate the HTML For the settings form.
275	+ $this->generate_settings_html();
276	+
277	+ else : ?>
278	+
279	+ <div class="inline error"><p>
280	+ <strong><?php _e( 'Gateway Disabled', 'wcvendors' ); ?></strong>: <?php printf( __( '%s does not support your store currency.', 'wcvendors' ), $this->method_title ); ?>
281	+ </p></div>
282	+
283	+ <?php endif; ?>
284	+
285	+ </table>
286	+ <?php
287	+ }
288	+
289	+
290	+ /**
291	+ *
292	+ *
293	+ * @param unknown $order
294	+ *
295	+ * @return unknown
296	+ */
297	+ private function get_receivers( $order )
298	+ {
299	+ $response = array();
300	+
301	+ // Process the payment and split as required
302	+ if ( $this->instapay ) {
303	+
304	+ $receivers = WCV_Vendors::get_vendor_dues_from_order( $order );
305	+ $i = 0;
306	+
307	+ foreach ( $receivers as $author => $values ) {
308	+ if ( empty( $values[ 'total' ] ) ) continue;
309	+
310	+ $response[ $i ] = new Receiver();
311	+ $response[ $i ]->email = $values[ 'vendor_id' ] == 1 ? $this->main_paypal : WCV_Vendors::get_vendor_paypal( $values[ 'vendor_id' ] );
312	+ $response[ $i ]->amount = round( $values[ 'total' ], 2);
313	+ $response[ $i ]->primary = false;
314	+ $response[ $i ]->invoiceId = $order->id;
315	+ $i++;
316	+ }
317	+
318	+ } else {
319	+ // Send all monies to the site admin
320	+ $single_receiver = new Receiver();
321	+ $single_receiver->email = $this->main_paypal;
322	+ $single_receiver->amount = $order->get_total();
323	+ $single_receiver->primary = false;
324	+ $single_receiver->invoiceId = $order->id;
325	+ // Set a single reciever for the transaction
326	+ $response[] = $single_receiver;
327	+ }
328	+
329	+ if ( $this->debug_me ) {
330	+ var_dump( $response );
331	+ }
332	+
333	+ return $response;
334	+ }
335	+
336	+
337	+ /**
338	+ *
339	+ *
340	+ * @param unknown $order_id
341	+ *
342	+ * @return unknown
343	+ */
344	+ public function paypalap_check_form( $order_id )
345	+ {
346	+ global $woocommerce;
347	+
348	+ $this->include_paypal_sdk();
349	+ $this->logger = new PPLoggingManager( 'Pay' );
350	+ $order = new WC_Order( $order_id );
351	+
352	+ $receivers = $this->get_receivers( $order );
353	+ $receiverList = new ReceiverList( $receivers );
354	+
355	+ $actionType = 'CREATE';
356	+ $cancelUrl = $order->get_cancel_order_url();
357	+ $currencyCode = get_woocommerce_currency();
358	+ $returnUrl = esc_url( add_query_arg( 'key', $order->order_key, add_query_arg( 'order-received', $order->id, $order->get_checkout_order_received_url() ) ) );
359	+
360	+ $payRequest = new PayRequest( new RequestEnvelope( "en_US" ), $actionType, $cancelUrl, $currencyCode, $receiverList, $returnUrl );
361	+
362	+ // ==================================================================
363	+ //
364	+ // Optional params
365	+ //
366	+ // ------------------------------------------------------------------
367	+
368	+ $payRequest->feesPayer = 'EACHRECEIVER';
369	+
370	+ $args = array(
371	+ 'wc-api' => 'WC_PayPalAP',
372	+ 'paypal_chain_ipn' => '1',
373	+ 'order_id' => $order_id,
374	+ );
375	+
376	+ $payRequest->ipnNotificationUrl = add_query_arg( $args, home_url( '/' ) );
377	+ $payRequest->memo = !empty( $order->customer_note ) ? $order->customer_note : '';
378	+ $payRequest->reverseAllParallelPaymentsOnError = true;
379	+
380	+ $service = new AdaptivePaymentsService();
381	+ try {
382	+ $response = $service->Pay( $payRequest );
383	+ } catch ( Exception $ex ) {
384	+ wc_add_notice( sprintf( __( 'Error: %s', 'wcvendors' ), $ex->getMessage() ), 'error' );
385	+
386	+ return false;
387	+ }
388	+
389	+ $this->logger->log( "Received payResponse:" );
390	+ $ack = strtoupper( $response->responseEnvelope->ack );
391	+
392	+ if ( $ack != 'SUCCESS' ) {
393	+ $order->update_status( 'cancelled', sprintf( __( 'Error ID: %s. %s', 'wcvendors' ), $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ) );
394	+ wc_add_notice( sprintf( __( 'Error ID: %s. %s', 'wcvendors' ), $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'error' );
395	+
396	+ return false;
397	+ }
398	+
399	+ return $response->payKey;
400	+ }
401	+
402	+
403	+ /**
404	+ *
405	+ *
406	+ * @param unknown $order
407	+ * @param unknown $author_email
408	+ * @param unknown $setPaymentOptionsRequest
409	+ * @param unknown $is_admin (optional)
410	+ *
411	+ * @return unknown
412	+ */
413	+ public function set_vendor_items( $order, $setPaymentOptionsRequest )
414	+ {
415	+ $receivers = WCV_Vendors::get_vendor_dues_from_order( $order, false );
416	+ $receivers_two = WCV_Vendors::get_vendor_dues_from_order( $order );
417	+
418	+ foreach ( $receivers as $products ) {
419	+ $invoice_items = array();
420	+ $shipping_given = $tax_given = 0;
421	+
422	+ foreach ( $products as $key => $product ) {
423	+
424	+ $product_id = $product[ 'product_id' ];
425	+ $shipping_given += $product[ 'shipping' ];
426	+ $tax_given += $product[ 'tax' ];
427	+
428	+ if ( !empty( $product[ 'commission' ] ) ) {
429	+ $item = new InvoiceItem();
430	+ $item->name = get_the_title( $product_id );
431	+ $item->identifier = $product_id;
432	+ $item->price = $product[ 'commission' ];
433	+ $item->itemPrice = round( $product[ 'commission' ] / $product[ 'qty' ], 2 );
434	+ $item->itemCount = $product[ 'qty' ];
435	+ $invoice_items[ ] = $item;
436	+ }
437	+ }
438	+
439	+ if ( empty( $invoice_items ) ) {
440	+ continue;
441	+ }
442	+
443	+ $receiverOptions = new ReceiverOptions();
444	+ $setPaymentOptionsRequest->receiverOptions[ ] = $receiverOptions;
445	+
446	+ // Set the current vendor
447	+ $receiverId = new ReceiverIdentifier();
448	+ $receiverId->email = $product[ 'vendor_id' ] == 1 ? $this->main_paypal : WCV_Vendors::get_vendor_paypal( $product[ 'vendor_id' ] );
449	+
450	+ $receiverOptions->receiver = $receiverId;
451	+ $receiverOptions->invoiceData = new InvoiceData();
452	+ $receiverOptions->invoiceData->item = $invoice_items;
453	+ $receiverOptions->invoiceData->totalTax = number_format( $receivers_two[$product['vendor_id']]['tax'], 2 );
454	+ $receiverOptions->invoiceData->totalShipping = number_format( $receivers_two[$product['vendor_id']]['shipping'], 2 );
455	+ }
456	+
457	+ return $setPaymentOptionsRequest;
458	+ }
459	+
460	+
461	+ /**
462	+ *
463	+ *
464	+ * @param unknown $pay_key
465	+ * @param unknown $order_id
466	+ *
467	+ * @return unknown
468	+ */
469	+ public function set_paypal_author_specifics( $pay_key, $order_id )
470	+ {
471	+ global $woocommerce;
472	+
473	+ $this->include_paypal_sdk();
474	+ $order = new WC_Order( $order_id );
475	+
476	+ // Create request
477	+ $setPaymentOptionsRequest = new SetPaymentOptionsRequest( new RequestEnvelope( "en_US" ) );
478	+ $setPaymentOptionsRequest->payKey = $pay_key;
479	+
480	+ if ( $this->instapay ) {
481	+ $setPaymentOptionsRequest = $this->set_vendor_items( $order, $setPaymentOptionsRequest );
482	+ }
483	+
484	+ if ( $this->debug_me ) {
485	+ foreach ( $setPaymentOptionsRequest->receiverOptions as $k ) {
486	+ var_dump( $k->invoiceData );
487	+ }
488	+ exit;
489	+ }
490	+
491	+ $setPaymentOptionsRequest->senderOptions = new SenderOptions();
492	+ $setPaymentOptionsRequest->senderOptions->requireShippingAddressSelection = true;
493	+
494	+ $service = new AdaptivePaymentsService();
495	+ try {
496	+ $response = $service->SetPaymentOptions( $setPaymentOptionsRequest );
497	+ } catch ( Exception $ex ) {
498	+ wc_add_notice( sprintf( __( 'Error: %s', 'wcvendors' ), $ex->getMessage() ), 'error' );
499	+
500	+ return false;
501	+ }
502	+
503	+ $this->logger->error( "Received SetPaymentOptionsResponse:" );
504	+ $ack = strtoupper( $response->responseEnvelope->ack );
505	+ if ( $ack != "SUCCESS" ) {
506	+ $order->update_status( 'cancelled', __( sprintf( 'Error ID: %s. %s', $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'wcvendors' ) );
507	+ wc_add_notice( sprintf( 'Error ID: %s. %s', $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'error' );
508	+
509	+ return false;
510	+ }
511	+
512	+ return true;
513	+ }
514	+
515	+
516	+ /**
517	+ * Payment fields
518	+ */
519	+ function payment_fields()
520	+ {
521	+ if ( $description = $this->settings[ 'description' ] ) echo wpautop( wptexturize( $this->description ) );
522	+ }
523	+
524	+
525	+ /**
526	+ * Process the payment and return the result
527	+ *
528	+ * @param unknown $order_id
529	+ *
530	+ * @return unknown
531	+ */
532	+ function process_payment( $order_id )
533	+ {
534	+ global $woocommerce;
535	+
536	+ $order = new WC_Order( $order_id );
537	+ $pay_key = $this->paypalap_check_form( $order_id );
538	+
539	+ if ( !empty( $woocommerce->errors ) ) return false;
540	+
541	+ if ( $this->instapay ) {
542	+ $this->set_paypal_author_specifics( $pay_key, $order_id );
543	+ if ( !empty( $woocommerce->errors ) ) return false;
544	+ }
545	+
546	+ $paypal_redirect_url = $this->sandbox == 'yes' ? 'https://www.sandbox.paypal.com/webscr&cmd=' : 'https://www.paypal.com/webscr&cmd=';
547	+ $pay_url = $paypal_redirect_url . '_ap-payment&paykey=' . $pay_key;
548	+
549	+ return array(
550	+ 'result' => 'success',
551	+ 'redirect' => $pay_url,
552	+ );
553	+
554	+ }
555	+ }

trunk/classes/gateways/PayPal_Masspay/api/ChangeLog.txt ADDED Viewed

	@@ -0,0 +1,48 @@


1	+
2	+ Version 1.2.95 - September 28, 2012
3	+
4	+ - SDK refreshed to Release 95. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#MerchantAPI
5	+ - SDK now supports third party permission by subject header. Configure subject header
6	+ in the configuration file, this is basically third party merchant email address who has
7	+ given permission to you to call api on their behalf.
8	+ - Bug fixed for Page styling attributes (eg: cpp-header**) serialization. (https://github.com/paypal/SDKs/issues/31)
9	+ - Bug fixed for 'convertToXML' method for not escaping xml element correctly.(https://github.com/paypal/SDKs/issues/17)
10	+ - PayPal Endpoint is corrected in config file.(https://github.com/paypal/SDKs/issues/22)
11	+ - Bug fixed for BasicAmountType serialization without currencyID attribute.(https://github.com/paypal/SDKs/issues/23)
12	+ - Bug fixed for 'PPLoggingManager.php' to pickup configuration entries.(https://github.com/paypal/SDKs/issues/28)
13	+ - Updated SDK sample
14	+ --------------------------------------------------------------------------------------------------
15	+
16	+
17	+ Version 1.1.93 - August 14, 2012
18	+
19	+ - SDK refreshed to Release 93. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#MerchantAPI
20	+ - SDK Core - Deserialization Logic Change
21	+ --------------------------------------------------------------------------------------------------
22	+
23	+
24	+ Version 1.0.92 - July 30, 2012
25	+
26	+ - Stable release
27	+ -------------------------------------------------------------------------------------------------
28	+ Version 0.7.92 - July 17, 2012
29	+
30	+ - wsdl update version 0.7.92
31	+ --------------------------------------------------------------------------------------------------
32	+
33	+ Version 0.7.90 - 11-June-2012
34	+
35	+ - SDK upgrade to latest WSDL release (90.0)
36	+ --------------------------------------------------------------------------------------------------
37	+
38	+ Version 0.7.88 - 17-Apr-2012
39	+
40	+ - Fix to get SDK working with Permissions API token
41	+
42	+ --------------------------------------------------------------------------------------------------
43	+
44	+ Version 0.6.88 - 27-Feb-2012
45	+
46	+ - Initial release
47	+
48	+ --------------------------------------------------------------------------------------------------

trunk/classes/gateways/PayPal_Masspay/api/LICENSE.txt ADDED Viewed

	@@ -0,0 +1,41 @@


1	+ PAYPAL, INC.
2	+
3	+ SDK LICENSE
4	+
5	+ NOTICE TO USER: PayPal, Inc. is providing the Software and Documentation for use under the terms of this Agreement. Any use, reproduction, modification or distribution of the Software or Documentation, or any derivatives or portions hereof, constitutes your acceptance of this Agreement.
6	+
7	+ As used in this Agreement, "PayPal" means PayPal, Inc. "Software" means the software code accompanying this agreement. "Documentation" means the documents, specifications and all other items accompanying this Agreement other than the Software.
8	+
9	+ 1. LICENSE GRANT Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, prepare derivative works from, publicly display, publicly perform, distribute and sublicense the Software for any purpose, provided the copyright notice below appears in a conspicuous location within the source code of the distributed Software and this license is distributed in the supporting documentation of the Software you distribute. Furthermore, you must comply with all third party licenses in order to use the third party software contained in the Software.
10	+
11	+ Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, publicly display, publicly perform, distribute and sublicense the Documentation for any purpose. You may not modify the Documentation.
12	+
13	+ No title to the intellectual property in the Software or Documentation is transferred to you under the terms of this Agreement. You do not acquire any rights to the Software or the Documentation except as expressly set forth in this Agreement.
14	+
15	+ If you choose to distribute the Software in a commercial product, you do so with the understanding that you agree to defend, indemnify and hold harmless PayPal and its suppliers against any losses, damages and costs arising from the claims, lawsuits or other legal actions arising out of such distribution. You may distribute the Software in object code form under your own license, provided that your license agreement:
16	+
17	+ (a) complies with the terms and conditions of this license agreement;
18	+
19	+ (b) effectively disclaims all warranties and conditions, express or implied, on behalf of PayPal;
20	+
21	+ (c) effectively excludes all liability for damages on behalf of PayPal;
22	+
23	+ (d) states that any provisions that differ from this Agreement are offered by you alone and not PayPal; and
24	+
25	+ (e) states that the Software is available from you or PayPal and informs licensees how to obtain it in a reasonable manner on or through a medium customarily used for software exchange.
26	+
27	+ 2. DISCLAIMER OF WARRANTY
28	+ PAYPAL LICENSES THE SOFTWARE AND DOCUMENTATION TO YOU ONLY ON AN "AS IS" BASIS WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY WARRANTIES OR CONDITIONS OF TITLE, NON-INFRINGEMENT, MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE. PAYPAL MAKES NO WARRANTY THAT THE SOFTWARE OR DOCUMENTATION WILL BE ERROR-FREE. Each user of the Software or Documentation is solely responsible for determining the appropriateness of using and distributing the Software and Documentation and assumes all risks associated with its exercise of rights under this Agreement, including but not limited to the risks and costs of program errors, compliance with applicable laws, damage to or loss of data, programs, or equipment, and unavailability or interruption of operations. Use of the Software and Documentation is made with the understanding that PayPal will not provide you with any technical or customer support or maintenance. Some states or jurisdictions do not allow the exclusion of implied warranties or limitations on how long an implied warranty may last, so the above limitations may not apply to you. To the extent permissible, any implied warranties are limited to ninety (90) days.
29	+
30	+
31	+ 3. LIMITATION OF LIABILITY
32	+ PAYPAL AND ITS SUPPLIERS SHALL NOT BE LIABLE FOR LOSS OR DAMAGE ARISING OUT OF THIS AGREEMENT OR FROM THE USE OF THE SOFTWARE OR DOCUMENTATION. IN NO EVENT WILL PAYPAL OR ITS SUPPLIERS BE LIABLE TO YOU OR ANY THIRD PARTY FOR ANY DIRECT, INDIRECT, CONSEQUENTIAL, INCIDENTAL, OR SPECIAL DAMAGES INCLUDING LOST PROFITS, LOST SAVINGS, COSTS, FEES, OR EXPENSES OF ANY KIND ARISING OUT OF ANY PROVISION OF THIS AGREEMENT OR THE USE OR THE INABILITY TO USE THE SOFTWARE OR DOCUMENTATION, HOWEVER CAUSED AND UNDER ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY OR TORT INCLUDING NEGLIGENCE OR OTHERWISE), EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. PAYPAL'S AGGREGATE LIABILITY AND THAT OF ITS SUPPLIERS UNDER OR IN CONNECTION WITH THIS AGREEMENT SHALL BE LIMITED TO THE AMOUNT PAID BY YOU FOR THE SOFTWARE AND DOCUMENTATION.
33	+
34	+ 4. TRADEMARK USAGE
35	+ PayPal is a trademark PayPal, Inc. in the United States and other countries. Such trademarks may not be used to endorse or promote any product unless expressly permitted under separate agreement with PayPal.
36	+
37	+ 5. TERM
38	+ Your rights under this Agreement shall terminate if you fail to comply with any of the material terms or conditions of this Agreement and do not cure such failure in a reasonable period of time after becoming aware of such noncompliance. If all your rights under this Agreement terminate, you agree to cease use and distribution of the Software and Documentation as soon as reasonably practicable.
39	+
40	+ 6. GOVERNING LAW AND JURISDICTION. This Agreement is governed by the statutes and laws of the State of California, without regard to the conflicts of law principles thereof. If any part of this Agreement is found void and unenforceable, it will not affect the validity of the balance of the Agreement, which shall remain valid and enforceable according to its terms. Any dispute arising out of or related to this Agreement shall be brought in the courts of Santa Clara County, California, USA.
41	+

trunk/classes/gateways/PayPal_Masspay/api/README.md ADDED Viewed

	@@ -0,0 +1,60 @@


1	+
2	+ PayPal PHP Merchant SDK
3	+ ===============================
4	+
5	+ Prerequisites
6	+ -------------
7	+
8	+ PayPal's PHP Merchant SDK requires
9	+
10	+ * PHP 5.2 and above with curl extension enabled
11	+
12	+
13	+ Using the SDK
14	+ -------------
15	+
16	+ To use the SDK,
17	+
18	+ * Copy the config and lib folders into your project.
19	+ * Make sure that the lib folder in your project is available in PHP's include path
20	+ * Include the services\PayPalAPIInterfaceService\PayPalAPIInterfaceServiceService.php file in your code.
21	+ * Create a service wrapper object
22	+ * Create a request object as per your project's needs. All the API request and response classes are available in services\PayPalAPIInterfaceService\PayPalAPIInterfaceServiceService.php
23	+ * Invoke the appropriate method on the request object.
24	+
25	+
26	+ For example,
27	+
28	+ require_once('services/PayPalAPIInterfaceService/PayPalAPIInterfaceServiceService.php'); require_once('PPLoggingManager.php');
29	+
30	+ $itemAmount = new BasicAmountType();
31	+ $itemAmount->currencyID = $_REQUEST['currencyCode'];
32	+ $itemAmount->value = $_REQUEST['itemAmount'];
33	+ $setECReqType = new SetExpressCheckoutRequestType();
34	+ $setECReqType->SetExpressCheckoutRequestDetails = $setECReqDetails;
35	+ $setECReqType->Version = '86.0';
36	+ $setECReq = new SetExpressCheckoutReq();
37	+ $setECReq->SetExpressCheckoutRequest = $setECReqType;
38	+ ......
39	+
40	+ $paypalService = new PayPalAPIInterfaceServiceService();
41	+ $setECResponse = $paypalService->SetExpressCheckout($setECReq);
42	+
43	+ $ack = strtoupper($setECResponse->Ack);
44	+
45	+ if($ack == 'SUCCESS') {
46	+ // Success
47	+ }
48	+
49	+
50	+
51	+ SDK Configuration
52	+ -----------------
53	+
54	+ replace the API credential in config/sdk_config.ini . You can use the configuration file to configure
55	+
56	+ * (Multiple) API account credentials.
57	+ * Service endpoint and other HTTP connection parameters
58	+
59	+
60	+ Please refer to the sample config file provided with this bundle.

trunk/classes/gateways/PayPal_Masspay/api/build.xml ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <project name="PayPal_PHP_SDK" default="build">
3	+
4	+
5	+ <condition property="PHPUNIT_PATH" value="phpunit.bat" else="phpunit">
6	+ <os family="windows"/>
7	+ </condition>
8	+
9	+ <target name="clean">
10	+ <delete dir="${basedir}/build"/>
11	+ </target>
12	+
13	+
14	+ <target name="phpunit">
15	+ <mkdir dir="tests/reports/"/>
16	+ <exec dir="${basedir}" executable="${PHPUNIT_PATH}" failonerror="true">
17	+ <arg
18	+ line="--testdox --include-path lib --log-junit tests\reports\phpunit.xml tests"/>
19	+ </exec>
20	+ </target>
21	+
22	+
23	+ <target name="build" depends="clean, phpunit"/>
24	+ </project>

trunk/classes/gateways/PayPal_Masspay/api/config/sdk-cert.pem ADDED Viewed

	@@ -0,0 +1,41 @@


1	+ Bag Attributes
2	+ localKeyID: E4 F0 42 FE 24 52 DD 61 B0 4A EE 64 74 62 6B 2F 6E 3B 31 7B
3	+ subject=/CN=certuser_biz_api1.paypal.com/O=Bonzop/L=Austin/ST=TX/C=US
4	+ issuer=/C=US/ST=California/L=San Jose/O=PayPal, Inc./OU=sandbox_certs/CN=sandbox_camerchapi/emailAddress=re@paypal.com
5	+ -----BEGIN CERTIFICATE-----
6	+ MIICiDCCAfGgAwIBAgIDD/WUMA0GCSqGSIb3DQEBBQUAMIGfMQswCQYDVQQGEwJV
7	+ UzETMBEGA1UECBMKQ2FsaWZvcm5pYTERMA8GA1UEBxMIU2FuIEpvc2UxFTATBgNV
8	+ BAoTDFBheVBhbCwgSW5jLjEWMBQGA1UECxQNc2FuZGJveF9jZXJ0czEbMBkGA1UE
9	+ AxQSc2FuZGJveF9jYW1lcmNoYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwu
10	+ Y29tMB4XDTExMDUwMjA1MDQ0NFoXDTIxMDQyOTA1MDQ0NFowYzElMCMGA1UEAxQc
11	+ Y2VydHVzZXJfYml6X2FwaTEucGF5cGFsLmNvbTEPMA0GA1UEChMGQm9uem9wMQ8w
12	+ DQYDVQQHEwZBdXN0aW4xCzAJBgNVBAgTAlRYMQswCQYDVQQGEwJVUzCBnzANBgkq
13	+ hkiG9w0BAQEFAAOBjQAwgYkCgYEAmhsOeujiGniLK6drcs38FLcGqZNmj4C/TfKD
14	+ qD5k5gP26oahfNl+NxAds2RdR2N+ZD6dy+a2Uo6q2hGc+Y+1uA5FzEtvOsC52qId
15	+ NrFVm215S3Gf77AEMzYItbNq2jlqJ5HGwCAMoY1aBkI6bgp+8vWDYEH6WZIK4f0e
16	+ YoPKG0MCAwEAAaMNMAswCQYDVR0TBAIwADANBgkqhkiG9w0BAQUFAAOBgQBj6xWw
17	+ AumLzSodCWyocPcyKSooNa7wgJKzaVrf0Kxz2QBesKpsfe9UN3Dj04016FIUbkRI
18	+ 4qLJIkKHyeQRU9hvJ78tU7OeykDEVqlHAEE/Z4c5EIs6l9x60VqOpAjnaqX/9Jty
19	+ jXhqpINjolTh6D5jq8y4FX5krKqIYBCNDHM+cQ==
20	+ -----END CERTIFICATE-----
21	+ Bag Attributes
22	+ localKeyID: E4 F0 42 FE 24 52 DD 61 B0 4A EE 64 74 62 6B 2F 6E 3B 31 7B
23	+ Key Attributes: <No Attributes>
24	+ -----BEGIN RSA PRIVATE KEY-----
25	+ Proc-Type: 4,ENCRYPTED
26	+ DEK-Info: DES-EDE3-CBC,18E53CC94575411A
27	+
28	+ Dbkm1iUDbpaY3abg08u1NKnzdd0tZwArMQKpRJ4zaVbm4qYkwAEvmKWGCemP0hwM
29	+ iA0EeLgbSbYbgXi+3Ba1Hm5kf5p5MbGqylgUNBVzKV+OtuPgZPnHclyHoJwRf8NU
30	+ e+wwRIDB/6ZpXt69t3poxmYR0MfhrgSm/YdBDRLJbBE8I51vTELmCRC2SN/5ebo+
31	+ TCNtGyf/upKBf0XfM8sY5SvffwSA1uaOLh0FwtYq0vQViFayPfmyBBDirVZqAFMt
32	+ DOuX2JaYUj9s9qVuwQIqHThJLhTqU/0eZjkYXy22F2ER8fNG77LQ5+SMevngWXjt
33	+ afErYBJYcSc1V/MX39126vaYL/AzLTBXHkSmJ0w+nCs+4ifVv9dJTb8W6W10ZWk6
34	+ HQrSuIhLbgbPg0J5LagYymCWjkl3UseJSFsUdH2EkQA4uBwKX4aJzH4n44H2sCk0
35	+ UCzDSGC6jWr7VOTpOk5+NHi/pqZhvpNn2Tg+jZt/kqKAa08di9jTP0eZbS4+bb6S
36	+ 9FtpOLWXKz/JZVLmA5v2o1L9kqvFoMsgvito4oK/j5jPGat22xTpoBnSom3+QsfB
37	+ ViOStyAh9MqGqsTh+YcNNUbv5dJ4IpmUAki64Cx4j90wFkpbUpoeT3l/0Gbuwnpy
38	+ Ugw97/qHVGlFAhrXDr72TqI2+YXFfxklyCLMNnsBvrM55NZcgxsH7UWp0hCNXq/j
39	+ FQNduuw6CAqfosj5aKjDRIll1MN0631yxkGxhsHiMQNMOCMe6+OwDs5gdF+Wvc4j
40	+ HlSAq1H0v3iZRcWs1qdf9eKMAc1k5T9TPHlcEgwv9zMWSGqvxizwNQ==
41	+ -----END RSA PRIVATE KEY-----

trunk/classes/gateways/PayPal_Masspay/api/config/sdk_config.ini ADDED Viewed

	@@ -0,0 +1,39 @@


1	+ ;Account credentials
2	+ [Account]
3	+ acct1.UserName = jb-us-seller_api1.paypal.com
4	+ acct1.Password = WX4WTU3S8MY44S7F
5	+ acct1.Signature = AFcWxV21C7fd0v3bYYYRCpSSRl31A7yDhhsPUU2XhtMoZXsWHFxu-RWy
6	+ acct1.AppId = APP-80W284485P519543T
7	+ # Subject is optinal, only required in case of third party permission
8	+ acct1.Subject =
9	+
10	+ ; Certificate Credentials Test Account
11	+ acct2.UserName = certuser_biz_api1.paypal.com
12	+ acct2.Password = D6JNKKULHN3G5B8A
13	+ ; Certificate path relative to config folder or absolute path in file system
14	+ acct2.CertPath = sdk-cert.pem
15	+ acct2.CertKey = password ; Password given when generating .PEM file from a .p12 file
16	+ acct2.AppId = APP-80W284485P519543T
17	+ # Subject is optinal, only required in case of third party permission
18	+ acct2.Subject =
19	+
20	+ ;Connection Information
21	+ [Http]
22	+ http.ConnectionTimeOut = 30
23	+ http.Retry = 5
24	+ ;http.Proxy
25	+
26	+ ;Service Configuration
27	+ [Service]
28	+ ; NOTE: Do not change the service binding configuration.
29	+ service.Binding = SOAP
30	+ service.EndPoint = "https://api-3t.sandbox.paypal.com/2.0/" ; Endpoint for 3-token credentials
31	+ ; Uncomment this line if you are using certificate credentials
32	+ ;service.EndPoint = "https://api.sandbox.paypal.com/2.0/"
33	+ service.RedirectURL = "https://www.sandbox.paypal.com/webscr&cmd="
34	+
35	+ ;Logging Information
36	+ [Log]
37	+ log.FileName = ../PayPal.log
38	+ log.LogLevel = INFO
39	+ log.LogEnabled = true

trunk/classes/gateways/PayPal_Masspay/api/lib/IPPCredential.php ADDED Viewed

	@@ -0,0 +1,53 @@


1	+ <?php
2	+
3	+ /**
4	+ * Base class that represents API credentials
5	+ */
6	+ abstract class IPPCredential
7	+ {
8	+ /**
9	+ * Application Id that uniquely identifies the application
10	+ * The application Id is issued by PayPal.
11	+ * Test application Ids are available for the sandbox environment
12	+ * @var string
13	+ */
14	+ protected $applicationId;
15	+
16	+ /**
17	+ * API username
18	+ * @var string
19	+ */
20	+ protected $userName;
21	+
22	+ /**
23	+ * API password
24	+ * @var string
25	+ */
26	+ protected $password;
27	+
28	+ protected abstract function validate();
29	+
30	+ public function __construct( $userName, $password, $applicationId )
31	+ {
32	+ $this->userName = $userName;
33	+ $this->password = $password;
34	+ $this->applicationId = $applicationId;
35	+ }
36	+
37	+ public function getApplicationId()
38	+ {
39	+ return $this->applicationId;
40	+ }
41	+
42	+ public function getUserName()
43	+ {
44	+ return $this->userName;
45	+ }
46	+
47	+ public function getPassword()
48	+ {
49	+ return $this->password;
50	+ }
51	+ }
52	+
53	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPAPIService.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+ require_once 'PPCredentialManager.php';
3	+ require_once 'PPConnectionManager.php';
4	+ require_once 'PPObjectTransformer.php';
5	+ require_once 'PPLoggingManager.php';
6	+ require_once 'PPUtils.php';
7	+ require_once 'PPAuthenticationManager.php';
8	+
9	+ class PPAPIService
10	+ {
11	+ public $endpoint;
12	+ public $serviceName;
13	+ private $logger;
14	+
15	+ public function __construct( $serviceName = "" )
16	+ {
17	+ $this->serviceName = $serviceName;
18	+ $config = PPConfigManager::getInstance();
19	+ $this->endpoint = $config->get( 'service.EndPoint' );
20	+ $this->logger = new PPLoggingManager( __CLASS__ );
21	+ }
22	+
23	+ public function setServiceName( $serviceName )
24	+ {
25	+ $this->serviceName = $serviceName;
26	+ }
27	+
28	+
29	+ public function makeRequest( $apiMethod, $params, $apiUsername = null, $accessToken = null, $tokenSecret = null )
30	+ {
31	+
32	+ $authentication = new PPAuthenticationManager();
33	+ $connectionMgr = PPConnectionManager::getInstance();
34	+ $connection = $connectionMgr->getConnection();
35	+
36	+ $credMgr = PPCredentialManager::getInstance();
37	+ // $apiUsernam is optional, if null the default account in congif file is taken
38	+ $apIPPCredential = $credMgr->getCredentialObject( $apiUsername );
39	+ $config = PPConfigManager::getInstance();
40	+ if ( $config->get( 'service.Binding' ) == 'SOAP' ) {
41	+ $url = $this->endpoint;
42	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
43	+ $headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
44	+ } else {
45	+ $headers = null;
46	+ }
47	+ $params = $authentication->appendSoapHeader( $params, $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
48	+ } else {
49	+ $url = $this->endpoint . $this->serviceName . '/' . $apiMethod;
50	+ $headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
51	+ }
52	+
53	+
54	+ $this->logger->info( "Request: $params" );
55	+ $response = $connection->execute( $url, $params, $headers );
56	+ $this->logger->info( "Response: $response" );
57	+
58	+ return $response;
59	+ }
60	+
61	+
62	+ }

trunk/classes/gateways/PayPal_Masspay/api/lib/PPAuthenticationManager.php ADDED Viewed

	@@ -0,0 +1,99 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'PPSignatureCredential.php';
5	+ require_once 'PPCertificateCredential.php';
6	+ require_once 'exceptions/PPInvalidCredentialException.php';
7	+ require_once 'auth/PPAuth.php';
8	+
9	+ class PPAuthenticationManager
10	+ {
11	+ public function getPayPalHeaders( $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
12	+ {
13	+ $config = PPConfigManager::getInstance();
14	+
15	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
16	+ $headers_arr[ ] = "X-PP-AUTHORIZATION: " . $this->generateAuthString( $apiCred, $accessToken, $tokenSecret, $url );
17	+ //$headers_arr[] = "CLIENT-AUTH: No cert";
18	+ } // Add headers required for service authentication
19	+ else if ( $apiCred instanceof PPSignatureCredential ) {
20	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
21	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
22	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-SIGNATURE: " . $apiCred->getSignature();
23	+ } else if ( $apiCred instanceof PPCertificateCredential ) {
24	+
25	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
26	+ $headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
27	+ $connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
28	+ }
29	+
30	+ // Add other headers
31	+ $headers_arr[ ] = "X-PAYPAL-APPLICATION-ID: " . $apiCred->getApplicationId();
32	+ $headers_arr[ ] = "X-PAYPAL-REQUEST-DATA-FORMAT: " . $config->get( 'service.Binding' );
33	+ $headers_arr[ ] = "X-PAYPAL-RESPONSE-DATA-FORMAT: " . $config->get( 'service.Binding' );
34	+ $headers_arr[ ] = "X-PAYPAL-DEVICE-IPADDRESS: " . PPUtils::getLocalIPAddress();
35	+ $headers_arr[ ] = "X-PAYPAL-REQUEST-SOURCE: " . PPUtils::getRequestSource();
36	+
37	+ return $headers_arr;
38	+ }
39	+
40	+ public function appendSoapHeader( $payLoad, $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
41	+ {
42	+ $soapHeader = "<soapenv:Envelope xmlns:soapenv=\"http://schemas.xmlsoap.org/soap/envelope/\" xmlns:urn=\"urn:ebay:api:PayPalAPI\" xmlns:ebl=\"urn:ebay:apis:eBLBaseComponents\" xmlns:cc=\"urn:ebay:apis:CoreComponentTypes\" xmlns:ed=\"urn:ebay:apis:EnhancedDataTypes\">";
43	+
44	+ if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
45	+ $soapHeader .= "<soapenv:Header>";
46	+ $soapHeader .= "<urn:RequesterCredentials/>";
47	+ $soapHeader .= "</soapenv:Header>";
48	+ } else if ( $apiCred instanceof PPSignatureCredential ) {
49	+ $soapHeader .= "<soapenv:Header>";
50	+ $soapHeader .= "<urn:RequesterCredentials>";
51	+ $soapHeader .= "<ebl:Credentials>";
52	+ $soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
53	+ $soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
54	+ $soapHeader .= "<ebl:Signature>" . $apiCred->getSignature() . "</ebl:Signature>";
55	+ $subject = $apiCred->getSubject();
56	+ if ( isset( $subject ) && $subject != "" ) {
57	+ $soapHeader .= "<ebl:Subject>" . $apiCred->getSubject() . "</ebl:Subject>";
58	+ }
59	+ $soapHeader .= "</ebl:Credentials>";
60	+ $soapHeader .= "</urn:RequesterCredentials>";
61	+ $soapHeader .= "</soapenv:Header>";
62	+ } else if ( $apiCred instanceof PPCertificateCredential ) {
63	+ $soapHeader .= "<soapenv:Header>";
64	+ $soapHeader .= "<urn:RequesterCredentials>";
65	+ $soapHeader .= "<ebl:Credentials>";
66	+ $soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
67	+ $soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
68	+ $subject = $apiCred->getSubject();
69	+ if ( isset( $subject ) && $subject != "" ) {
70	+ $soapHeader .= "<ebl:Subject>" . $apiCred->getSubject() . "</ebl:Subject>";
71	+ }
72	+ $soapHeader .= "</ebl:Credentials>";
73	+ $soapHeader .= "</urn:RequesterCredentials>";
74	+ $soapHeader .= "</soapenv:Header>";
75	+ $connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
76	+ }
77	+ $soapHeader .= "<soapenv:Body>";
78	+ $soapHeader .= $payLoad;
79	+ $soapHeader .= "</soapenv:Body>";
80	+ $soapHeader .= "</soapenv:Envelope>";
81	+
82	+ return $soapHeader;
83	+
84	+ }
85	+
86	+ private function generateAuthString( $apiCred, $accessToken, $tokenSecret, $endpoint )
87	+ {
88	+ $key = $apiCred->getUserName();
89	+ $secret = $apiCred->getPassword();
90	+ $auth = new AuthSignature();
91	+ $response = $auth->genSign( $key, $secret, $accessToken, $tokenSecret, 'POST', $endpoint );
92	+ $authString = "token=" . $accessToken . ",signature=" . $response[ 'oauth_signature' ] . ",timestamp=" . $response[ 'oauth_timestamp' ];
93	+
94	+ return $authString;
95	+ }
96	+
97	+ }
98	+
99	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPBaseService.php ADDED Viewed

	@@ -0,0 +1,88 @@


1	+ <?php
2	+ require_once 'PPAPIService.php';
3	+
4	+
5	+ class PPBaseService
6	+ {
7	+
8	+ private $serviceName;
9	+
10	+ /*
11	+ * Setters and getters for Third party authentication (Permission Services)
12	+ */
13	+ protected $accessToken;
14	+ protected $tokenSecret;
15	+ protected $lastRequest;
16	+ protected $lastResponse;
17	+
18	+ public function getLastRequest()
19	+ {
20	+ return $this->lastRequest;
21	+ }
22	+
23	+ public function setLastRequest( $lastRqst )
24	+ {
25	+ $this->lastRequest = $lastRqst;
26	+ }
27	+
28	+ public function getLastResponse()
29	+ {
30	+ return $this->lastResponse;
31	+ }
32	+
33	+ public function setLastResponse( $lastRspns )
34	+ {
35	+ $this->lastResponse = $lastRspns;
36	+ }
37	+
38	+ public function getAccessToken()
39	+ {
40	+ return $this->accessToken;
41	+ }
42	+
43	+ public function setAccessToken( $accessToken )
44	+ {
45	+ $this->accessToken = $accessToken;
46	+ }
47	+
48	+ public function getTokenSecret()
49	+ {
50	+ return $this->tokenSecret;
51	+ }
52	+
53	+ public function setTokenSecret( $tokenSecret )
54	+ {
55	+ $this->tokenSecret = $tokenSecret;
56	+ }
57	+
58	+ public function __construct( $serviceName )
59	+ {
60	+ $this->serviceName = $serviceName;
61	+ }
62	+
63	+ public function getServiceName()
64	+ {
65	+ return $this->serviceName;
66	+ }
67	+
68	+ public function call( $method, $requestObject, $apiUsername = null )
69	+ {
70	+ $params = $this->marshall( $requestObject );
71	+ $service = new PPAPIService();
72	+ $service->setServiceName( $this->serviceName );
73	+
74	+ $this->lastRequest = $params;
75	+ $this->lastResponse = $service->makeRequest( $method, $params, $apiUsername, $this->accessToken, $this->tokenSecret );
76	+
77	+ return $this->lastResponse;
78	+ }
79	+
80	+ private function marshall( $object )
81	+ {
82	+ $transformer = new PPObjectTransformer();
83	+
84	+ return $transformer->toString( $object );
85	+ }
86	+ }
87	+
88	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPCertificateCredential.php ADDED Viewed

	@@ -0,0 +1,77 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'exceptions/PPMissingCredentialException.php';
5	+
6	+ class PPCertificateCredential extends IPPCredential
7	+ {
8	+
9	+ private $certificatePath;
10	+ private $passPhrase;
11	+ private $subject;
12	+
13	+ public function __construct( $userName, $password, $certPath, $appId, $passPhrase, $subject )
14	+ {
15	+ parent::__construct( $userName, $password, $appId );
16	+ $this->certificatePath = $certPath;
17	+ $this->passPhrase = $passPhrase;
18	+ $this->subject = $subject;
19	+ $this->validate();
20	+ }
21	+
22	+ public function validate()
23	+ {
24	+
25	+ if ( $this->userName == null \|\| $this->userName == "" ) {
26	+ throw new PPMissingCredentialException( "username cannot be empty" );
27	+ }
28	+ if ( $this->password == null \|\| $this->password == "" ) {
29	+ throw new PPMissingCredentialException( "password cannot be empty" );
30	+ }
31	+ if ( $this->certificatePath == null \|\| $this->certificatePath == "" ) {
32	+ throw new PPMissingCredentialException( "certificate cannot be empty" );
33	+ }
34	+ if ( $this->passPhrase == null \|\| $this->passPhrase == "" ) {
35	+ throw new PPMissingCredentialException( "passphrase cannot be empty" );
36	+ }
37	+ if ( $this->applicationId == null \|\| $this->applicationId == "" ) {
38	+ throw new PPMissingCredentialException( "applicationId cannot be empty" );
39	+ }
40	+ }
41	+
42	+ public function getUserName()
43	+ {
44	+ return $this->userName;
45	+ }
46	+
47	+ public function getPassword()
48	+ {
49	+ return $this->password;
50	+ }
51	+
52	+ public function getCertificatePath()
53	+ {
54	+ if ( realpath( $this->certificatePath ) ) {
55	+ return realpath( $this->certificatePath );
56	+ } else {
57	+ return realpath( dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".." . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . $this->certificatePath );
58	+ }
59	+ }
60	+
61	+ public function getPassPhrase()
62	+ {
63	+ return $this->passPhrase;
64	+ }
65	+
66	+ public function getApplicationId()
67	+ {
68	+ return $this->applicationId;
69	+ }
70	+
71	+ public function getSubject()
72	+ {
73	+ return $this->subject;
74	+ }
75	+ }
76	+
77	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPConfigManager.php ADDED Viewed

	@@ -0,0 +1,121 @@


1	+ <?php
2	+ /**
3	+ * PPConfigManager loads the SDK configuration file and
4	+ * hands out appropriate config params to other classes
5	+ */
6	+ require_once 'exceptions/PPConfigurationException.php';
7	+
8	+ class PPConfigManager
9	+ {
10	+
11	+ private $config;
12	+ /**
13	+ * @var PPConfigManager
14	+ */
15	+ private static $instance;
16	+
17	+ private function __construct()
18	+ {
19	+ $configFile = dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".."
20	+ . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . "sdk_config.ini";
21	+ $this->load( $configFile );
22	+ }
23	+
24	+ // create singleton object for PPConfigManager
25	+ public static function getInstance()
26	+ {
27	+ if ( !isset( self::$instance ) ) {
28	+ self::$instance = new PPConfigManager();
29	+ }
30	+
31	+ return self::$instance;
32	+ }
33	+
34	+ //used to load the file
35	+ private function load( $fileName )
36	+ {
37	+ if ( class_exists( 'Woocommerce' ) ) {
38	+ global $woocommerce;
39	+ $gateways = $woocommerce->payment_gateways->payment_gateways();
40	+ $settings = $gateways[ 'paypalap' ]->settings;
41	+ $mode = $settings[ 'sandbox_enabled' ];
42	+
43	+ $this->config = array(
44	+ 'acct1.UserName' => $mode == 'yes' ? $settings[ 'username' ] : $settings[ 'username_live' ],
45	+ 'acct1.Password' => $mode == 'yes' ? $settings[ 'password' ] : $settings[ 'password_live' ],
46	+ 'acct1.Signature' => $mode == 'yes' ? $settings[ 'signature' ] : $settings[ 'signature_live' ],
47	+ 'acct1.AppId' => $mode == 'yes' ? 'APP-80W284485P519543T' : $settings[ 'app_id' ],
48	+
49	+ 'service.Binding' => 'SOAP',
50	+ 'service.EndPoint' => $mode == 'yes' ? 'https://api-3t.sandbox.paypal.com/2.0/' : 'https://api-3t.paypal.com/2.0/',
51	+ 'service.RedirectURL' => $mode == 'yes' ? 'https://sandbox.paypal.com/webscr&cmd=' : 'https://paypal.com/webscr&cmd=',
52	+ 'service.DevCentralURL' => 'https://developer.paypal.com',
53	+ 'http.ConnectionTimeOut' => '10',
54	+ 'http.Retry' => '5',
55	+ 'log.FileName' => 'PayPal.log',
56	+ 'log.LogLevel' => 'INFO',
57	+ 'log.LogEnabled' => $settings[ 'logging_enabled' ] == 'yes' ? 'true' : 'false',
58	+ );
59	+ } else {
60	+ $this->config = @parse_ini_file( $fileName );
61	+ }
62	+
63	+ if ( $this->config == null \|\| count( $this->config ) == 0 ) {
64	+ throw new PPConfigurationException( "Config file $fileName not found", "303" );
65	+ }
66	+ }
67	+
68	+ /**
69	+ * simple getter for configuration params
70	+ * If an exact match for key is not found,
71	+ * does a "contains" search on the key
72	+ */
73	+ public function get( $searchKey )
74	+ {
75	+
76	+ if ( array_key_exists( $searchKey, $this->config ) ) {
77	+ return $this->config[ $searchKey ];
78	+ } else {
79	+ $arr = array();
80	+ foreach ( $this->config as $k => $v ) {
81	+ if ( strstr( $k, $searchKey ) ) {
82	+ $arr[ $k ] = $v;
83	+ }
84	+ }
85	+
86	+ return $arr;
87	+ }
88	+
89	+ }
90	+
91	+ /**
92	+ * Utility method for handling account configuration
93	+ * return config key corresponding to the API userId passed in
94	+ *
95	+ * If $userId is null, returns config keys corresponding to
96	+ * all configured accounts
97	+ */
98	+ public function getIniPrefix( $userId = null )
99	+ {
100	+
101	+ if ( $userId == null ) {
102	+ $arr = array();
103	+ foreach ( $this->config as $key => $value ) {
104	+ $pos = strpos( $key, '.' );
105	+ if ( strstr( $key, "acct" ) ) {
106	+ $arr[ ] = substr( $key, 0, $pos );
107	+ }
108	+ }
109	+
110	+ return array_unique( $arr );
111	+ } else {
112	+ $iniPrefix = array_search( $userId, $this->config );
113	+ $pos = strpos( $iniPrefix, '.' );
114	+ $acct = substr( $iniPrefix, 0, $pos );
115	+
116	+ return $acct;
117	+ }
118	+ }
119	+ }
120	+
121	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPConnectionManager.php ADDED Viewed

	@@ -0,0 +1,48 @@


1	+ <?php
2	+ require_once 'PPHttpConnection.php';
3	+ require_once 'PPConfigManager.php';
4	+ class PPConnectionManager
5	+ {
6	+ /**
7	+ * reference to singleton instance
8	+ * @var PPConnectionManager
9	+ */
10	+ private static $instance;
11	+
12	+ private function __construct()
13	+ {
14	+ }
15	+
16	+ public static function getInstance()
17	+ {
18	+ if ( self::$instance == null ) {
19	+ self::$instance = new PPConnectionManager();
20	+ }
21	+
22	+ return self::$instance;
23	+ }
24	+
25	+ /**
26	+ * This function returns a new PPHttpConnection object
27	+ */
28	+ public function getConnection()
29	+ {
30	+
31	+ $connection = new PPHttpConnection();
32	+
33	+ $configMgr = PPConfigManager::getInstance();
34	+ if ( ( $configMgr->get( "http.ConnectionTimeOut" ) ) ) {
35	+ $connection->setHttpTimeout( $configMgr->get( "http.ConnectionTimeOut" ) );
36	+ }
37	+ if ( $configMgr->get( "http.Proxy" ) ) {
38	+ $connection->setHttpProxy( $configMgr->get( "http.Proxy" ) );
39	+ }
40	+ if ( $configMgr->get( "http.Retry" ) ) {
41	+ $retry = $configMgr->get( "http.Retry" );
42	+ $connection->setHttpRetry( $retry );
43	+ }
44	+
45	+ return $connection;
46	+ }
47	+
48	+ }

trunk/classes/gateways/PayPal_Masspay/api/lib/PPCredentialManager.php ADDED Viewed

	@@ -0,0 +1,119 @@


1	+ <?php
2	+ require_once 'IPPCredential.php';
3	+ require_once 'PPConfigManager.php';
4	+ require_once 'PPSignatureCredential.php';
5	+ require_once 'PPCertificateCredential.php';
6	+ require_once 'exceptions/PPInvalidCredentialException.php';
7	+
8	+ class PPCredentialManager
9	+ {
10	+
11	+ private static $instance;
12	+ //hashmap to contain credentials for accounts.
13	+ private $credentialHashmap = array();
14	+ /**
15	+ * Contains the API username of the default account to use
16	+ * when authenticating API calls.
17	+ * @var string
18	+ */
19	+ private $defaultAccountName;
20	+
21	+ /*
22	+ * Constructor initialize credential for multiple accounts specified in property file.
23	+ */
24	+ private function __construct()
25	+ {
26	+ try {
27	+ $this->initCredential();
28	+ } catch ( Exception $e ) {
29	+ $this->credentialHashmap = array();
30	+ throw $e;
31	+ }
32	+ }
33	+
34	+ /*
35	+ * Create singleton instance for this class.
36	+ */
37	+ public static function getInstance()
38	+ {
39	+ if ( !isset( self::$instance ) ) {
40	+ self::$instance = new PPCredentialManager();
41	+ }
42	+
43	+ return self::$instance;
44	+ }
45	+
46	+ /*
47	+ * Load credentials for multiple accounts, with priority given to Signature credential.
48	+ */
49	+ private function initCredential()
50	+ {
51	+ $configMgr = PPConfigManager::getInstance();
52	+ $suffix = 1;
53	+ $prefix = "acct";
54	+
55	+ $credArr = $configMgr->get( $prefix );
56	+ $arrayPartKeys = $configMgr->getIniPrefix();
57	+ if ( count( $arrayPartKeys ) == 0 )
58	+ throw new MissingCredentialException( "No valid API accounts have been configured" );
59	+
60	+ while ( in_array( $prefix . $suffix, $arrayPartKeys ) ) {
61	+
62	+ if ( isset( $credArr[ $prefix . $suffix . ".Signature" ] )
63	+ && $credArr[ $prefix . $suffix . ".Signature" ] != null && $credArr[ $prefix . $suffix . ".Signature" ] != ""
64	+ ) {
65	+
66	+ $userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
67	+ $password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
68	+ $signature = isset( $credArr[ $prefix . $suffix . '.Signature' ] ) ? $credArr[ $prefix . $suffix . '.Signature' ] : "";
69	+ $appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
70	+ $subject = isset( $credArr[ $prefix . $suffix . '.Subject' ] ) ? $credArr[ $prefix . $suffix . '.Subject' ] : "";
71	+ $this->credentialHashmap[ $userName ] = new PPSignatureCredential( $userName, $password, $signature, $appId, $subject );
72	+
73	+ } elseif ( isset( $credArr[ $prefix . $suffix . ".CertPath" ] )
74	+ && $credArr[ $prefix . $suffix . ".CertPath" ] != null && $credArr[ $prefix . $suffix . ".CertPath" ] != ""
75	+ ) {
76	+
77	+ $userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
78	+ $password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
79	+ $passPhrase = isset( $credArr[ $prefix . $suffix . '.CertKey' ] ) ? $credArr[ $prefix . $suffix . '.CertKey' ] : "";
80	+ $certPath = isset( $credArr[ $prefix . $suffix . '.CertPath' ] ) ? $credArr[ $prefix . $suffix . '.CertPath' ] : "";
81	+ $appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
82	+ $subject = isset( $credArr[ $prefix . $suffix . '.Subject' ] ) ? $credArr[ $prefix . $suffix . '.Subject' ] : "";
83	+ $this->credentialHashmap[ $userName ] = new PPCertificateCredential( $userName, $password, $certPath, $appId, $passPhrase, $subject );
84	+
85	+ }
86	+ if ( $this->defaultAccountName == null )
87	+ $this->defaultAccountName = $credArr[ $prefix . $suffix . '.UserName' ];
88	+ $suffix++;
89	+ }
90	+
91	+ }
92	+
93	+ /*
94	+ * Obtain Credential Object based on UserId provided.
95	+ */
96	+ public function getCredentialObject( $userId = null )
97	+ {
98	+
99	+ if ( $userId == null )
100	+ $credObj = $this->credentialHashmap[ $this->defaultAccountName ];
101	+ else if ( array_key_exists( $userId, $this->credentialHashmap ) )
102	+ $credObj = $this->credentialHashmap[ $userId ];
103	+
104	+ if ( empty( $credObj ) ) {
105	+ throw new PPInvalidCredentialException( "Invalid userId $userId" );
106	+ }
107	+
108	+ return $credObj;
109	+ }
110	+
111	+
112	+ public function __clone()
113	+ {
114	+ trigger_error( 'Clone is not allowed.', E_USER_ERROR );
115	+ }
116	+
117	+ }
118	+
119	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPHttpConnection.php ADDED Viewed

	@@ -0,0 +1,184 @@


1	+ <?php
2	+
3	+ require_once 'exceptions/PPConnectionException.php';
4	+ require_once 'exceptions/PPConfigurationException.php';
5	+ require_once 'PPLoggingManager.php';
6	+ /**
7	+ * A wrapper class based on the curl extension.
8	+ * Requires the PHP curl module to be enabled.
9	+ * See for full requirements the PHP manual: http://php.net/curl
10	+ */
11	+
12	+
13	+ class PPHttpConnection
14	+ {
15	+
16	+ const HTTP_GET = 'GET';
17	+ const HTTP_POST = 'POST';
18	+
19	+ /**
20	+ * curl options to be set for the request
21	+ */
22	+ private $curlOpt = array();
23	+
24	+ /**
25	+ * Number of times a retry must be attempted on getting an HTTP error
26	+ * @var integer
27	+ */
28	+ private $retry;
29	+
30	+ /**
31	+ * HTTP status codes for which a retry must be attempted
32	+ */
33	+ private static $retryCodes = array( '401', '403', '404', );
34	+
35	+ private $logger;
36	+
37	+
38	+ /**
39	+ * Some default options for curl
40	+ * These are typically overridden by PPConnectionManager
41	+ */
42	+ public static $DEFAULT_CURL_OPTS = array(
43	+ CURLOPT_CONNECTTIMEOUT => 10,
44	+ CURLOPT_RETURNTRANSFER => true,
45	+ CURLOPT_TIMEOUT => 60, // maximum number of seconds to allow cURL functions to execute
46	+ CURLOPT_USERAGENT => 'PayPal-PHP-SDK',
47	+ CURLOPT_POST => 1,
48	+ CURLOPT_HTTPHEADER => array(),
49	+ CURLOPT_SSL_VERIFYHOST => 1,
50	+ CURLOPT_SSL_VERIFYPEER => 2
51	+ );
52	+
53	+ public function __construct()
54	+ {
55	+ if ( !function_exists( "curl_init" ) ) {
56	+ throw new PPConfigurationException( "Curl module is not available on this system" );
57	+ }
58	+ $this->curlOpt = self::$DEFAULT_CURL_OPTS;
59	+ $this->logger = new PPLoggingManager( __CLASS__ );
60	+ }
61	+
62	+ /**
63	+ * Set ssl parameters for certificate based client authentication
64	+ *
65	+ * @param string $certPath - path to client certificate file (PEM formatted file)
66	+ */
67	+ public function setSSLCert( $certPath, $passPhrase )
68	+ {
69	+ $this->curlOpt[ CURLOPT_SSLCERT ] = realpath( $certPath );
70	+ $this->curlOpt[ CURLOPT_SSLCERTPASSWD ] = $passPhrase;
71	+ }
72	+
73	+ /**
74	+ * Set connection timeout in seconds
75	+ *
76	+ * @param integer $timeout
77	+ */
78	+ public function setHttpTimeout( $timeout )
79	+ {
80	+ $this->curlOpt[ CURLOPT_CONNECTTIMEOUT ] = $timeout;
81	+ }
82	+
83	+ /**
84	+ * Set HTTP proxy information
85	+ *
86	+ * @param string $proxy
87	+ *
88	+ * @throws PPConfigurationException
89	+ */
90	+ public function setHttpProxy( $proxy )
91	+ {
92	+ $urlParts = parse_url( $proxy );
93	+ if ( $urlParts == false \|\| !array_key_exists( "host", $urlParts ) )
94	+ throw new PPConfigurationException( "Invalid proxy configuration " . $proxy );
95	+
96	+ $this->curlOpt[ CURLOPT_PROXY ] = $urlParts[ "host" ];
97	+ if ( isset( $urlParts[ "port" ] ) )
98	+ $this->curlOpt[ CURLOPT_PROXY ] .= ":" . $urlParts[ "port" ];
99	+ if ( isset( $urlParts[ "user" ] ) )
100	+ $this->curlOpt[ URLOPT_PROXYUSERPWD ] = $urlParts[ "user" ] . ":" . $urlParts[ "pass" ];
101	+ }
102	+
103	+ public function setHttpHeaders( $headers )
104	+ {
105	+ $this->curlOpt[ CURLOPT_HTTPHEADER ] = $headers;
106	+ }
107	+
108	+ /**
109	+ * @param integer $retry
110	+ */
111	+ public function setHttpRetry( $retry )
112	+ {
113	+ $this->retry = $retry;
114	+ }
115	+
116	+ /**
117	+ * Executes an HTTP request
118	+ *
119	+ * @param string $url
120	+ * @param string $params query string OR POST content as a string
121	+ * @param array $headers array of HTTP headers to be added to existing headers
122	+ * @param string $method HTTP method (GET, POST etc) defaults to POST
123	+ *
124	+ * @throws PPConnectionException
125	+ */
126	+ public function execute( $url, $params, $headers = null, $method = null )
127	+ {
128	+
129	+ $ch = curl_init( $url );
130	+
131	+ $this->curlOpt[ CURLOPT_POSTFIELDS ] = $params;
132	+ $this->curlOpt[ CURLOPT_URL ] = $url;
133	+ $this->curlOpt[ CURLOPT_HEADER ] = false;
134	+ if ( isset( $headers ) ) {
135	+ $this->curlOpt[ CURLOPT_HTTPHEADER ] = array_merge( $this->curlOpt[ CURLOPT_HTTPHEADER ], $headers );
136	+ }
137	+ foreach ( $this->curlOpt[ CURLOPT_HTTPHEADER ] as $header ) {
138	+ //TODO: Strip out credentials when logging.
139	+ $this->logger->info( "Adding header $header" );
140	+ }
141	+ if ( isset( $method ) ) {
142	+ $this->curlOpt[ CURLOPT_CUSTOMREQUEST ] = $method;
143	+ }
144	+
145	+ // curl_setopt_array available only in PHP 5 >= 5.1.3
146	+ curl_setopt_array( $ch, $this->curlOpt );
147	+
148	+ $result = curl_exec( $ch );
149	+
150	+ if ( curl_errno( $ch ) == 60 ) {
151	+ $this->logger->info( "Invalid or no certificate authority found, retrying using bundled CA certs" );
152	+ curl_setopt( $ch, CURLOPT_CAINFO,
153	+ dirname( __FILE__ ) . '/cacert.pem' );
154	+ $result = curl_exec( $ch );
155	+ }
156	+ $httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
157	+ $retries = 0;
158	+ if ( in_array( $httpStatus, self::$retryCodes ) && isset( $this->retry ) ) {
159	+ $this->logger->info( "Got $httpStatus response from server. Retrying" );
160	+
161	+ do {
162	+ $result = curl_exec( $ch );
163	+ $httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
164	+
165	+ } while ( in_array( $httpStatus, self::$retryCodes ) && ++$retries < $this->retry );
166	+
167	+
168	+ }
169	+ if ( curl_errno( $ch ) ) {
170	+ $ex = new PPConnectionException( $url, curl_error( $ch ), curl_errno( $ch ) );
171	+ curl_close( $ch );
172	+ throw $ex;
173	+ }
174	+
175	+ curl_close( $ch );
176	+
177	+ if ( in_array( $httpStatus, self::$retryCodes ) ) {
178	+ throw new PPConnectionException( $url, "Retried " . $retries . " times, Http Response code " . $httpStatus );
179	+ }
180	+
181	+ return $result;
182	+ }
183	+
184	+ }

trunk/classes/gateways/PayPal_Masspay/api/lib/PPLoggingManager.php ADDED Viewed

	@@ -0,0 +1,84 @@


1	+ <?php
2	+
3	+ /**
4	+ * Simple Logging Manager.
5	+ * This does an error_log for now
6	+ * Potential frameworks to use are PEAR logger, log4php from Apache
7	+ */
8	+
9	+ class PPLoggingLevel
10	+ {
11	+
12	+ // FINE Logging Level
13	+ const FINE = 3;
14	+
15	+ // INFO Logging Level
16	+ const INFO = 2;
17	+
18	+ // WARN Logging Level
19	+ const WARN = 1;
20	+
21	+ // ERROR Logging Level
22	+ const ERROR = 0;
23	+ }
24	+
25	+ class PPLoggingManager
26	+ {
27	+
28	+ // Default Logging Level
29	+ const DEFAULT_LOGGING_LEVEL = 0;
30	+
31	+ // Logger name
32	+ private $loggerName;
33	+
34	+ // Log enabled
35	+ private $isLoggingEnabled;
36	+
37	+ // Configured logging level
38	+ private $loggingLevel;
39	+
40	+ // Configured logging file
41	+ private $loggerFile;
42	+
43	+ public function __construct( $loggerName )
44	+ {
45	+ $this->loggerName = $loggerName;
46	+ $config = PPConfigManager::getInstance();
47	+ $this->loggerFile = ( $config->get( 'log.FileName' ) ) ? $config->get( 'log.FileName' ) : ini_get( 'error_log' );
48	+ $loggingEnabled = $config->get( 'log.LogEnabled' );
49	+ $this->isLoggingEnabled = ( isset( $loggingEnabled ) ) ? $loggingEnabled : false;
50	+ $loggingLevel = strtoupper( $config->get( 'log.LogLevel' ) );
51	+ $this->loggingLevel = ( isset( $loggingLevel ) && defined( "PPLoggingLevel::$loggingLevel" ) ) ? constant( "PPLoggingLevel::$loggingLevel" ) : PPLoggingManager::DEFAULT_LOGGING_LEVEL;
52	+
53	+ }
54	+
55	+ public function log( $message, $level = PPLoggingLevel::INFO )
56	+ {
57	+ if ( $this->isLoggingEnabled && ( $level <= $this->loggingLevel ) ) {
58	+ error_log( $this->loggerName . ": $message\n", 3, $this->loggerFile );
59	+ }
60	+ }
61	+
62	+ public function error( $message )
63	+ {
64	+ $this->log( $message, PPLoggingLevel::ERROR );
65	+ }
66	+
67	+ public function warning( $message )
68	+ {
69	+ $this->log( $message, PPLoggingLevel::WARN );
70	+ }
71	+
72	+ public function info( $message )
73	+ {
74	+ $this->log( $message, PPLoggingLevel::INFO );
75	+ }
76	+
77	+ public function fine( $message )
78	+ {
79	+ $this->log( $message, PPLoggingLevel::FINE );
80	+ }
81	+
82	+ }
83	+
84	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPObjectTransformer.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * Utility class for transforming PHP objects into
4	+ * appropriate service payload type and vice versa
5	+ */
6	+ class PPObjectTransformer
7	+ {
8	+
9	+ public function toString( $object )
10	+ {
11	+
12	+ if ( $object == null ) {
13	+ throw new PPTransformerException( "Empty object" );
14	+ }
15	+
16	+ $confManager = PPConfigManager::getInstance();
17	+ switch ( strtoupper( $confManager->get( "service.Binding" ) ) ) {
18	+ case 'SOAP':
19	+ return $object->toXMLString();
20	+
21	+ case 'XML':
22	+ case 'JSON':
23	+ return "";
24	+ case 'NVP':
25	+ default:
26	+ return $object->toNVPString();
27	+ }
28	+ }
29	+
30	+
31	+ }
32	+
33	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPSignatureCredential.php ADDED Viewed

	@@ -0,0 +1,56 @@


1	+ <?php
2	+
3	+ require_once 'exceptions/PPMissingCredentialException.php';
4	+ require_once 'IPPCredential.php';
5	+ require_once 'PPConfigManager.php';
6	+
7	+ /**
8	+ * API signature based credentials
9	+ */
10	+ class PPSignatureCredential extends IPPCredential
11	+ {
12	+
13	+ /**
14	+ * API Signature
15	+ * @var string
16	+ */
17	+ private $signature;
18	+ private $subject;
19	+
20	+ public function __construct( $userName, $password, $signature, $appId, $subject )
21	+ {
22	+ parent::__construct( $userName, $password, $appId );
23	+ $this->signature = $signature;
24	+ $this->subject = $subject;
25	+ $this->validate();
26	+ }
27	+
28	+ public function validate()
29	+ {
30	+
31	+ if ( $this->userName == null \|\| $this->userName == "" ) {
32	+ throw new PPMissingCredentialException( "username cannot be empty" );
33	+ }
34	+ if ( $this->password == null \|\| $this->password == "" ) {
35	+ throw new PPMissingCredentialException( "password cannot be empty" );
36	+ }
37	+ if ( $this->signature == null \|\| $this->signature == "" ) {
38	+ throw new PPMissingCredentialException( "signature cannot be empty" );
39	+ }
40	+ if ( $this->applicationId == null \|\| $this->applicationId == "" ) {
41	+ throw new PPMissingCredentialException( "applicationId cannot be empty" );
42	+ }
43	+ }
44	+
45	+ public function getSignature()
46	+ {
47	+ return $this->signature;
48	+ }
49	+
50	+ public function getSubject()
51	+ {
52	+ return $this->subject;
53	+ }
54	+ }
55	+
56	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/PPUtils.php ADDED Viewed

	@@ -0,0 +1,284 @@


1	+ <?php
2	+ class PPUtils
3	+ {
4	+
5	+ const SDK_VERSION = "1.2.95";
6	+ const SDK_NAME = "sdk-merchant-php ";
7	+
8	+ /**
9	+ *
10	+ * Convert a Name Value Pair (NVP) formatted string into
11	+ * an associative array taking care to urldecode array values
12	+ *
13	+ * @param string $nvpString
14	+ */
15	+ public static function nvpToMap( $nvpString )
16	+ {
17	+
18	+ $ret = array();
19	+ $params = explode( "&", $nvpString );
20	+ foreach ( $params as $p ) {
21	+ list( $k, $v ) = explode( "=", $p );
22	+ $ret[ $k ] = urldecode( $v );
23	+ }
24	+
25	+ return $ret;
26	+ }
27	+
28	+ /**
29	+ * Returns true if the array contains a key like $key
30	+ *
31	+ * @param array $map
32	+ * @param regex $key
33	+ */
34	+ public static function array_match_key( $map, $key )
35	+ {
36	+ $key = str_replace( "(", "\(", $key );
37	+ $key = str_replace( ")", "\)", $key );
38	+ $key = str_replace( ".", "\.", $key );
39	+ $pattern = "/$key*/";
40	+ foreach ( $map as $k => $v ) {
41	+ preg_match( $pattern, $k, $matches );
42	+ if ( count( $matches ) > 0 )
43	+ return true;
44	+ }
45	+
46	+ return false;
47	+ }
48	+
49	+ /**
50	+ *
51	+ * Get the local IP address. The client address is a required
52	+ * request parameter for some API calls
53	+ */
54	+ public static function getLocalIPAddress()
55	+ {
56	+
57	+ if ( array_key_exists( "SERVER_ADDR", $_SERVER ) ) {
58	+ // SERVER_ADDR is available only if we are running the CGI SAPI
59	+ return $_SERVER[ 'SERVER_ADDR' ];
60	+ } else if ( function_exists( "gethostname" ) ) {
61	+ // gethostname is available only in PHP >= v5.3
62	+ return gethostbyname( gethostname() );
63	+ } else {
64	+ // fallback if nothing works
65	+ return "127.0.0.1";
66	+ }
67	+ }
68	+
69	+ /**
70	+ *
71	+ * Compute the value that needs to sent for the PAYPAL_REQUEST_SOURCE
72	+ * parameter when making API calls
73	+ */
74	+ public static function getRequestSource()
75	+ {
76	+ return str_replace( " ", "-", self::SDK_NAME ) . self::SDK_VERSION;
77	+ }
78	+
79	+ public static function xmlToArray( $xmlInput )
80	+ {
81	+
82	+ $xml = simplexml_load_string( $xmlInput );
83	+
84	+ $ns = $xml->getNamespaces( true );
85	+
86	+ $soap = $xml->children( $ns[ 'SOAP-ENV' ] );
87	+ $getChild = $soap->Body->children();
88	+
89	+ $ret = PPUtils::convertXmlObjToArr( $getChild, $array = array() );
90	+
91	+ return $ret;
92	+ }
93	+
94	+ /*foreach ($ret as $arry)
95	+ {
96	+ if (isset($arry['children']) && is_array($arry['children'])&& ($arry['children'])!=null) {
97	+ foreach ($arry['children'] as $novel)
98	+ {
99	+
100	+ }
101	+ }
102	+ else if ($arry['name'] != null)
103	+ {
104	+ $a = $arry['name'] ;
105	+ $b= $arry['text'];
106	+ if (isset($arry['attribute']))
107	+ {
108	+ $c = $arry['attribute'];
109	+ }
110	+ }
111	+
112	+
113	+ }*/
114	+
115	+ /*public function xml2array ( $xmlObject, $out = array () )
116	+ {
117	+ foreach ( (array) $xmlObject as $index => $node )
118	+ {
119	+ $out[$index] = ( is_object ( $node ) ) ? PPUtils::xml2array ( $node ) : $node;
120	+ }
121	+ return $out;
122	+ }*/
123	+
124	+
125	+ function convertXmlObjToArr( $obj, &$arr )
126	+ {
127	+ $children = $obj->children();
128	+ foreach ( $children as $elementName => $node ) {
129	+ $nextIdx = count( $arr );
130	+ $arr[ $nextIdx ] = array();
131	+ $arr[ $nextIdx ][ 'name' ] = strtolower( (string) $elementName );
132	+ $arr[ $nextIdx ][ 'attributes' ] = array();
133	+ $attributes = $node->attributes();
134	+ foreach ( $attributes as $attributeName => $attributeValue ) {
135	+ $attribName = strtolower( trim( (string) $attributeName ) );
136	+ $attribVal = trim( (string) $attributeValue );
137	+ $arr[ $nextIdx ][ 'attributes' ][ $attribName ] = $attribVal;
138	+ }
139	+ $text = (string) $node;
140	+ $text = trim( $text );
141	+ if ( strlen( $text ) > 0 ) {
142	+ $arr[ $nextIdx ][ 'text' ] = $text;
143	+ }
144	+ $arr[ $nextIdx ][ 'children' ] = array();
145	+ PPutils::convertXmlObjToArr( $node, $arr[ $nextIdx ][ 'children' ] );
146	+ }
147	+
148	+ return $arr;
149	+ }
150	+
151	+ /**
152	+ * Escapes invalid xml characters
153	+ *
154	+ * @param $textContent = xml data to be escaped
155	+ */
156	+ public static function escapeInvalidXmlCharsRegex( $textContent )
157	+ {
158	+ return htmlspecialchars( $textContent, ( 1 \| 2 ), 'UTF-8', false );
159	+ }
160	+
161	+ }
162	+
163	+ /**
164	+ * @class xml2array
165	+ */
166	+
167	+
168	+ /**
169	+ * XMLToArray Generator Class
170	+ * @author : MA Razzaque Rupom <rupom_315@yahoo.com>, <rupom.bd@gmail.com>
171	+ * Moderator, phpResource (LINK1http://groups.yahoo.com/group/phpresource/LINK1)
172	+ * URL: LINK2http://www.rupom.infoLINK2
173	+ * @version : 1.0
174	+ * @date 06/05/2006
175	+ * Purpose : Creating Hierarchical Array from XML Data
176	+ * Released : Under GPL
177	+ */
178	+
179	+ class XmlToArray
180	+ {
181	+
182	+ var $xml = '';
183	+
184	+ /**
185	+ * Default Constructor
186	+ *
187	+ * @param $xml = xml data
188	+ *
189	+ * @return none
190	+ */
191	+
192	+ function XmlToArray( $xml )
193	+ {
194	+ $this->xml = $xml;
195	+ }
196	+
197	+ /**
198	+ * _struct_to_array($values, &$i)
199	+ *
200	+ * This is adds the contents of the return xml into the array for easier processing.
201	+ * Recursive, Static
202	+ *
203	+ * @access private
204	+ *
205	+ * @param array $values this is the xml data in an array
206	+ * @param int $i this is the current location in the array
207	+ *
208	+ * @return Array
209	+ */
210	+
211	+ function _struct_to_array( $values, &$i )
212	+ {
213	+ $child = array();
214	+ if ( isset( $values[ $i ][ 'value' ] ) ) array_push( $child, $values[ $i ][ 'value' ] );
215	+
216	+ while ( $i++ < count( $values ) ) {
217	+ switch ( $values[ $i ][ 'type' ] ) {
218	+ case 'cdata':
219	+ array_push( $child, $values[ $i ][ 'value' ] );
220	+ break;
221	+
222	+ case 'complete':
223	+ $name = $values[ $i ][ 'tag' ];
224	+ if ( !empty( $name ) ) {
225	+ $child[ $name ] = ( $values[ $i ][ 'value' ] ) ? ( $values[ $i ][ 'value' ] ) : '';
226	+ if ( isset( $values[ $i ][ 'attributes' ] ) ) {
227	+ $child[ $name ] = $values[ $i ][ 'attributes' ];
228	+ }
229	+ }
230	+ break;
231	+
232	+ case 'open':
233	+ $name = $values[ $i ][ 'tag' ];
234	+ $size = isset( $child[ $name ] ) ? sizeof( $child[ $name ] ) : 0;
235	+ $child[ $name ][ $size ] = $this->_struct_to_array( $values, $i );
236	+ break;
237	+
238	+ case 'close':
239	+ return $child;
240	+ break;
241	+ }
242	+ }
243	+
244	+ return $child;
245	+ }
246	+
247	+ //_struct_to_array
248	+
249	+ /**
250	+ * createArray($data)
251	+ *
252	+ * This is adds the contents of the return xml into the array for easier processing.
253	+ *
254	+ * @access public
255	+ *
256	+ * @param string $data this is the string of the xml data
257	+ *
258	+ * @return Array
259	+ */
260	+ function createArray()
261	+ {
262	+ $xml = $this->xml;
263	+ $values = array();
264	+ $index = array();
265	+ $array = array();
266	+ $parser = xml_parser_create();
267	+ xml_parser_set_option( $parser, XML_OPTION_SKIP_WHITE, 1 );
268	+ xml_parser_set_option( $parser, XML_OPTION_CASE_FOLDING, 0 );
269	+ xml_parse_into_struct( $parser, $xml, $values, $index );
270	+ xml_parser_free( $parser );
271	+ $i = 0;
272	+ $name = $values[ $i ][ 'tag' ];
273	+ $array[ $name ] = isset( $values[ $i ][ 'attributes' ] ) ? $values[ $i ][ 'attributes' ] : '';
274	+ $array[ $name ] = $this->_struct_to_array( $values, $i );
275	+
276	+ return $array;
277	+ }
278	+ //createArray
279	+
280	+
281	+ }
282	+
283	+ //XmlToArray
284	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/auth/AuthUtil.php ADDED Viewed

	@@ -0,0 +1,83 @@


1	+ <?php //vim: foldmethod=marker
2	+
3	+ class MockOAuthDataStore extends OAuthDataStore
4	+ { /{{{/
5	+ private $consumer;
6	+ private $request_token;
7	+ private $access_token;
8	+ private $nonce;
9	+
10	+ function __construct()
11	+ { /{{{/
12	+ $this->consumer = new OAuthConsumer( "key", "secret", null );
13	+ $this->request_token = new OAuthToken( "requestkey", "requestsecret", 1 );
14	+ $this->access_token = new OAuthToken( "accesskey", "accesssecret", 1 );
15	+ $this->nonce = "nonce";
16	+ }
17	+
18	+ /}}}/
19	+
20	+ function lookup_consumer( $consumer_key )
21	+ { /{{{/
22	+ if ( $consumer_key == $this->consumer->key ) return $this->consumer;
23	+
24	+ return null;
25	+ }
26	+
27	+ /}}}/
28	+
29	+ function lookup_token( $consumer, $token_type, $token )
30	+ { /{{{/
31	+ $token_attrib = $token_type . "_token";
32	+ if ( $consumer->key == $this->consumer->key
33	+ && $token == $this->$token_attrib->key
34	+ ) {
35	+ return $this->$token_attrib;
36	+ }
37	+
38	+ return null;
39	+ }
40	+
41	+ /}}}/
42	+
43	+ function lookup_nonce( $consumer, $token, $nonce, $timestamp )
44	+ { /{{{/
45	+ if ( $consumer->key == $this->consumer->key
46	+ && ( ( $token && $token->key == $this->request_token->key )
47	+ \|\| ( $token && $token->key == $this->access_token->key ) )
48	+ && $nonce == $this->nonce
49	+ ) {
50	+ return $this->nonce;
51	+ }
52	+
53	+ return null;
54	+ }
55	+
56	+ /}}}/
57	+
58	+ function new_request_token( $consumer, $callback = null )
59	+ { /{{{/
60	+ if ( $consumer->key == $this->consumer->key ) {
61	+ return $this->request_token;
62	+ }
63	+
64	+ return null;
65	+ }
66	+
67	+ /}}}/
68	+
69	+ function new_access_token( $token, $consumer, $verifier = null )
70	+ { /{{{/
71	+ if ( $consumer->key == $this->consumer->key
72	+ && $token->key == $this->request_token->key
73	+ ) {
74	+ return $this->access_token;
75	+ }
76	+
77	+ return null;
78	+ }
79	+ /}}}/
80	+ }
81	+
82	+ /}}}/
83	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/auth/PPAuth.php ADDED Viewed

	@@ -0,0 +1,1057 @@


1	+ <?php
2	+ //PayPal specific modification starts
3	+ //Method to be called for generating signature
4	+ require_once( "AuthUtil.php" );
5	+ class AuthSignature
6	+ {
7	+
8	+ public function genSign( $key, $secret, $token, $tokenSecret, $httpMethod, $endpoint )
9	+ {
10	+
11	+
12	+ $authServer = new OAuthServer( new MockOAuthDataStore() );
13	+ $hmac_method = new OAuthSignatureMethod_HMAC_SHA1();
14	+ $authServer->add_signature_method( $hmac_method );
15	+
16	+ $sig_method = $hmac_method;
17	+ $authConsumer = new OAuthConsumer( $key, $secret, null );
18	+ $authToken = null;
19	+ $authToken = new OAuthToken( $token, $tokenSecret );
20	+
21	+ //$params is the query param array which is required only in the httpMethod is "GET"
22	+
23	+ $params = array();
24	+ //set the Query parameters to $params if httpMethod is "GET"
25	+
26	+ $acc_req = OAuthRequest::from_consumer_and_token( $authConsumer, $authToken, $httpMethod, $endpoint, $params );
27	+
28	+ $acc_req->sign_request( $sig_method, $authConsumer, $authToken );
29	+ $response = OAuthutil::parseQueryString( $acc_req );
30	+
31	+ return $response;
32	+
33	+ }
34	+ }
35	+
36	+ //PayPal specific modification ends
37	+ /* Generic exception class
38	+ */
39	+ class OAuthException extends Exception
40	+ {
41	+ // pass
42	+ }
43	+
44	+ class OAuthConsumer
45	+ {
46	+ public $key;
47	+ public $secret;
48	+
49	+ function __construct( $key, $secret, $callback_url = null )
50	+ {
51	+ $this->key = $key;
52	+ $this->secret = $secret;
53	+ $this->callback_url = $callback_url;
54	+ }
55	+
56	+ function __toString()
57	+ {
58	+ return "OAuthConsumer[key=$this->key,secret=$this->secret]";
59	+ }
60	+ }
61	+
62	+ class OAuthToken
63	+ {
64	+ // access tokens and request tokens
65	+ public $key;
66	+ public $secret;
67	+
68	+ /**
69	+ * key = the token
70	+ * secret = the token secret
71	+ */
72	+ function __construct( $key, $secret )
73	+ {
74	+ $this->key = $key;
75	+ $this->secret = $secret;
76	+ }
77	+
78	+ /**
79	+ * generates the basic string serialization of a token that a server
80	+ * would respond to request_token and access_token calls with
81	+ */
82	+ function to_string()
83	+ {
84	+ return "oauth_token=" .
85	+ OAuthUtil::urlencode_rfc3986( $this->key ) .
86	+ "&oauth_token_secret=" .
87	+ OAuthUtil::urlencode_rfc3986( $this->secret );
88	+ }
89	+
90	+ function __toString()
91	+ {
92	+ return $this->to_string();
93	+ }
94	+ }
95	+
96	+ /**
97	+ * A class for implementing a Signature Method
98	+ * See section 9 ("Signing Requests") in the spec
99	+ */
100	+ abstract class OAuthSignatureMethod
101	+ {
102	+ /**
103	+ * Needs to return the name of the Signature Method (ie HMAC-SHA1)
104	+ * @return string
105	+ */
106	+ abstract public function get_name();
107	+
108	+ /**
109	+ * Build up the signature
110	+ * NOTE: The output of this function MUST NOT be urlencoded.
111	+ * the encoding is handled in OAuthRequest when the final
112	+ * request is serialized
113	+ *
114	+ * @param OAuthRequest $request
115	+ * @param OAuthConsumer $consumer
116	+ * @param OAuthToken $token
117	+ *
118	+ * @return string
119	+ */
120	+ abstract public function build_signature( $request, $consumer, $token );
121	+
122	+ /**
123	+ * Verifies that a given signature is correct
124	+ *
125	+ * @param OAuthRequest $request
126	+ * @param OAuthConsumer $consumer
127	+ * @param OAuthToken $token
128	+ * @param string $signature
129	+ *
130	+ * @return bool
131	+ */
132	+ public function check_signature( $request, $consumer, $token, $signature )
133	+ {
134	+ $built = $this->build_signature( $request, $consumer, $token );
135	+
136	+ return $built == $signature;
137	+ }
138	+ }
139	+
140	+ /**
141	+ * The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
142	+ * where the Signature Base String is the text and the key is the concatenated values (each first
143	+ * encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
144	+ * character (ASCII code 38) even if empty.
145	+ * - Chapter 9.2 ("HMAC-SHA1")
146	+ */
147	+ class OAuthSignatureMethod_HMAC_SHA1 extends OAuthSignatureMethod
148	+ {
149	+ function get_name()
150	+ {
151	+ return "HMAC-SHA1";
152	+ }
153	+
154	+ public function build_signature( $request, $consumer, $token )
155	+ {
156	+ $base_string = $request->get_signature_base_string();
157	+ $base_string = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $base_string ); //convert base string to lowercase
158	+ $request->base_string = $base_string;
159	+
160	+ $key_parts = array(
161	+ $consumer->secret,
162	+ ( $token ) ? $token->secret : ""
163	+ );
164	+
165	+ $key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
166	+ $key = implode( '&', $key_parts );
167	+ $key = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $key ); //convert to lowercase
168	+ return base64_encode( hash_hmac( 'sha1', $base_string, $key, true ) );
169	+ }
170	+ }
171	+
172	+ /**
173	+ * The PLAINTEXT method does not provide any security protection and SHOULD only be used
174	+ * over a secure channel such as HTTPS. It does not use the Signature Base String.
175	+ * - Chapter 9.4 ("PLAINTEXT")
176	+ */
177	+ if ( !class_exists( 'OAuthSignatureMethod_PLAINTEXT' ) ) {
178	+ class OAuthSignatureMethod_PLAINTEXT extends OAuthSignatureMethod
179	+ {
180	+ public function get_name()
181	+ {
182	+ return "PLAINTEXT";
183	+ }
184	+
185	+ /**
186	+ * oauth_signature is set to the concatenated encoded values of the Consumer Secret and
187	+ * Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
188	+ * empty. The result MUST be encoded again.
189	+ * - Chapter 9.4.1 ("Generating Signatures")
190	+ *
191	+ * Please note that the second encoding MUST NOT happen in the SignatureMethod, as
192	+ * OAuthRequest handles this!
193	+ */
194	+ public function build_signature( $request, $consumer, $token )
195	+ {
196	+ $key_parts = array(
197	+ $consumer->secret,
198	+ ( $token ) ? $token->secret : ""
199	+ );
200	+
201	+ $key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
202	+ $key = implode( '&', $key_parts );
203	+ $request->base_string = $key;
204	+
205	+ return $key;
206	+ }
207	+ }
208	+ }
209	+ /**
210	+ * The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
211	+ * [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
212	+ * EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
213	+ * verified way to the Service Provider, in a manner which is beyond the scope of this
214	+ * specification.
215	+ * - Chapter 9.3 ("RSA-SHA1")
216	+ */
217	+ abstract class OAuthSignatureMethod_RSA_SHA1 extends OAuthSignatureMethod
218	+ {
219	+ public function get_name()
220	+ {
221	+ return "RSA-SHA1";
222	+ }
223	+
224	+ // Up to the SP to implement this lookup of keys. Possible ideas are:
225	+ // (1) do a lookup in a table of trusted certs keyed off of consumer
226	+ // (2) fetch via http using a url provided by the requester
227	+ // (3) some sort of specific discovery code based on request
228	+ //
229	+ // Either way should return a string representation of the certificate
230	+ protected abstract function fetch_public_cert( &$request );
231	+
232	+ // Up to the SP to implement this lookup of keys. Possible ideas are:
233	+ // (1) do a lookup in a table of trusted certs keyed off of consumer
234	+ //
235	+ // Either way should return a string representation of the certificate
236	+ protected abstract function fetch_private_cert( &$request );
237	+
238	+ public function build_signature( $request, $consumer, $token )
239	+ {
240	+ $base_string = $request->get_signature_base_string();
241	+ $request->base_string = $base_string;
242	+
243	+ // Fetch the private key cert based on the request
244	+ $cert = $this->fetch_private_cert( $request );
245	+
246	+ // Pull the private key ID from the certificate
247	+ $privatekeyid = openssl_get_privatekey( $cert );
248	+
249	+ // Sign using the key
250	+ $ok = openssl_sign( $base_string, $signature, $privatekeyid );
251	+
252	+ // Release the key resource
253	+ openssl_free_key( $privatekeyid );
254	+
255	+ return base64_encode( $signature );
256	+ }
257	+
258	+ public function check_signature( $request, $consumer, $token, $signature )
259	+ {
260	+ $decoded_sig = base64_decode( $signature );
261	+
262	+ $base_string = $request->get_signature_base_string();
263	+
264	+ // Fetch the public key cert based on the request
265	+ $cert = $this->fetch_public_cert( $request );
266	+
267	+ // Pull the public key ID from the certificate
268	+ $publickeyid = openssl_get_publickey( $cert );
269	+
270	+ // Check the computed signature against the one passed in the query
271	+ $ok = openssl_verify( $base_string, $decoded_sig, $publickeyid );
272	+
273	+ // Release the key resource
274	+ openssl_free_key( $publickeyid );
275	+
276	+ return $ok == 1;
277	+ }
278	+ }
279	+
280	+ class OAuthRequest
281	+ {
282	+ public $parameters;
283	+ protected $http_method;
284	+ protected $http_url;
285	+ // for debug purposes
286	+ public $base_string;
287	+ public static $version = '1.0';
288	+ public static $POST_INPUT = 'php://input';
289	+
290	+ function __construct( $http_method, $http_url, $parameters = null )
291	+ {
292	+ $parameters = ( $parameters ) ? $parameters : array();
293	+ $parameters = array_merge( OAuthUtil::parse_parameters( parse_url( $http_url, PHP_URL_QUERY ) ), $parameters );
294	+ $this->parameters = $parameters;
295	+ $this->http_method = $http_method;
296	+ $this->http_url = $http_url;
297	+ }
298	+
299	+
300	+ /**
301	+ * attempt to build up a request from what was passed to the server
302	+ */
303	+ public static function from_request( $http_method = null, $http_url = null, $parameters = null )
304	+ {
305	+ $scheme = ( !isset( $_SERVER[ 'HTTPS' ] ) \|\| $_SERVER[ 'HTTPS' ] != "on" )
306	+ ? 'http'
307	+ : 'https';
308	+ $http_url = ( $http_url ) ? $http_url : $scheme .
309	+ '://' . $_SERVER[ 'HTTP_HOST' ] .
310	+ ':' .
311	+ $_SERVER[ 'SERVER_PORT' ] .
312	+ $_SERVER[ 'REQUEST_URI' ];
313	+ $http_method = ( $http_method ) ? $http_method : $_SERVER[ 'REQUEST_METHOD' ];
314	+
315	+ // We weren't handed any parameters, so let's find the ones relevant to
316	+ // this request.
317	+ // If you run XML-RPC or similar you should use this to provide your own
318	+ // parsed parameter-list
319	+ if ( !$parameters ) {
320	+ // Find request headers
321	+ $request_headers = OAuthUtil::get_headers();
322	+
323	+ // Parse the query-string to find GET parameters
324	+ $parameters = OAuthUtil::parse_parameters( $_SERVER[ 'QUERY_STRING' ] );
325	+
326	+ // It's a POST request of the proper content-type, so parse POST
327	+ // parameters and add those overriding any duplicates from GET
328	+ if ( $http_method == "POST"
329	+ && isset( $request_headers[ 'Content-Type' ] )
330	+ && strstr( $request_headers[ 'Content-Type' ],
331	+ 'application/x-www-form-urlencoded' )
332	+ ) {
333	+ $post_data = OAuthUtil::parse_parameters(
334	+ file_get_contents( self::$POST_INPUT )
335	+ );
336	+ $parameters = array_merge( $parameters, $post_data );
337	+ }
338	+
339	+ // We have a Authorization-header with OAuth data. Parse the header
340	+ // and add those overriding any duplicates from GET or POST
341	+ if ( isset( $request_headers[ 'Authorization' ] ) && substr( $request_headers[ 'Authorization' ], 0, 6 ) == 'OAuth ' ) {
342	+ $header_parameters = OAuthUtil::split_header(
343	+ $request_headers[ 'Authorization' ]
344	+ );
345	+ $parameters = array_merge( $parameters, $header_parameters );
346	+ }
347	+
348	+ }
349	+
350	+ return new OAuthRequest( $http_method, $http_url, $parameters );
351	+ }
352	+
353	+ /**
354	+ * pretty much a helper function to set up the request
355	+ */
356	+ public static function from_consumer_and_token( $consumer, $token, $http_method, $http_url, $parameters = null )
357	+ {
358	+ $parameters = ( $parameters ) ? $parameters : array();
359	+ $defaults = array(
360	+ "oauth_version" => OAuthRequest::$version,
361	+ // "oauth_nonce" => OAuthRequest::generate_nonce(),
362	+ "oauth_timestamp" => OAuthRequest::generate_timestamp(),
363	+
364	+ "oauth_consumer_key" => $consumer->key
365	+ );
366	+ if ( $token )
367	+ $defaults[ 'oauth_token' ] = $token->key;
368	+
369	+ $parameters = array_merge( $defaults, $parameters );
370	+ ksort( $parameters );
371	+
372	+ return new OAuthRequest( $http_method, $http_url, $parameters );
373	+ }
374	+
375	+ public function set_parameter( $name, $value, $allow_duplicates = true )
376	+ {
377	+ if ( $allow_duplicates && isset( $this->parameters[ $name ] ) ) {
378	+ // We have already added parameter(s) with this name, so add to the list
379	+ if ( is_scalar( $this->parameters[ $name ] ) ) {
380	+ // This is the first duplicate, so transform scalar (string)
381	+ // into an array so we can add the duplicates
382	+ $this->parameters[ $name ] = array( $this->parameters[ $name ] );
383	+ }
384	+
385	+ $this->parameters[ $name ][ ] = $value;
386	+ } else {
387	+ $this->parameters[ $name ] = $value;
388	+ }
389	+ }
390	+
391	+ public function get_parameter( $name )
392	+ {
393	+ return isset( $this->parameters[ $name ] ) ? $this->parameters[ $name ] : null;
394	+ }
395	+
396	+ public function get_parameters()
397	+ {
398	+ return $this->parameters;
399	+ }
400	+
401	+ public function unset_parameter( $name )
402	+ {
403	+ unset( $this->parameters[ $name ] );
404	+ }
405	+
406	+ /**
407	+ * The request parameters, sorted and concatenated into a normalized string.
408	+ * @return string
409	+ */
410	+ public function get_signable_parameters()
411	+ {
412	+ // Grab all parameters
413	+ $params = $this->parameters;
414	+ ksort( $params );
415	+ // Remove oauth_signature if present
416	+ // Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
417	+ if ( isset( $params[ 'oauth_signature' ] ) ) {
418	+ unset( $params[ 'oauth_signature' ] );
419	+ }
420	+ foreach ( $params as $key => $value ) {
421	+ $res[ ] = $key . "=" . $value;
422	+ }
423	+
424	+ return implode( '&', $res );
425	+ //return OAuthUtil::build_http_query($params);
426	+ }
427	+
428	+ /**
429	+ * Returns the base string of this request
430	+ *
431	+ * The base string defined as the method, the url
432	+ * and the parameters (normalized), each urlencoded
433	+ * and the concated with &.
434	+ */
435	+ public function get_signature_base_string()
436	+ {
437	+ $parts = array(
438	+ $this->get_normalized_http_method(),
439	+ $this->get_normalized_http_url(),
440	+ $this->get_signable_parameters()
441	+ );
442	+
443	+ $parts = OAuthUtil::urlencode_rfc3986( $parts );
444	+
445	+ return implode( '&', $parts );
446	+ }
447	+
448	+ /**
449	+ * just uppercases the http method
450	+ */
451	+ public function get_normalized_http_method()
452	+ {
453	+ return strtoupper( $this->http_method );
454	+ }
455	+
456	+ /**
457	+ * parses the url and rebuilds it to be
458	+ * scheme://host/path
459	+ */
460	+ public function get_normalized_http_url()
461	+ {
462	+ $parts = parse_url( $this->http_url );
463	+
464	+ $scheme = ( isset( $parts[ 'scheme' ] ) ) ? $parts[ 'scheme' ] : 'http';
465	+ $port = ( isset( $parts[ 'port' ] ) ) ? $parts[ 'port' ] : ( ( $scheme == 'https' ) ? '443' : '80' );
466	+ $host = ( isset( $parts[ 'host' ] ) ) ? $parts[ 'host' ] : '';
467	+ $path = ( isset( $parts[ 'path' ] ) ) ? $parts[ 'path' ] : '';
468	+
469	+ if ( ( $scheme == 'https' && $port != '443' )
470	+ \|\| ( $scheme == 'http' && $port != '80' )
471	+ ) {
472	+ $host = "$host:$port";
473	+ }
474	+
475	+ return "$scheme://$host$path";
476	+ }
477	+
478	+ /**
479	+ * builds a url usable for a GET request
480	+ */
481	+ public function to_url()
482	+ {
483	+ $post_data = $this->to_postdata();
484	+ $out = $this->get_normalized_http_url();
485	+ if ( $post_data ) {
486	+ $out .= '?' . $post_data;
487	+ }
488	+
489	+ return $out;
490	+ }
491	+
492	+ /**
493	+ * builds the data one would send in a POST request
494	+ */
495	+ public function to_postdata()
496	+ {
497	+ return OAuthUtil::build_http_query( $this->parameters );
498	+ }
499	+
500	+ /**
501	+ * builds the Authorization: header
502	+ */
503	+ public function to_header( $realm = null )
504	+ {
505	+ $first = true;
506	+ if ( $realm ) {
507	+ $out = 'Authorization: OAuth realm="' . OAuthUtil::urlencode_rfc3986( $realm ) . '"';
508	+ $first = false;
509	+ } else
510	+ $out = 'Authorization: OAuth';
511	+
512	+ $total = array();
513	+ foreach ( $this->parameters as $k => $v ) {
514	+ if ( substr( $k, 0, 5 ) != "oauth" ) continue;
515	+ if ( is_array( $v ) ) {
516	+ throw new OAuthException( 'Arrays not supported in headers' );
517	+ }
518	+ $out .= ( $first ) ? ' ' : ',';
519	+ $out .= OAuthUtil::urlencode_rfc3986( $k ) .
520	+ '="' .
521	+ OAuthUtil::urlencode_rfc3986( $v ) .
522	+ '"';
523	+ $first = false;
524	+ }
525	+
526	+ return $out;
527	+ }
528	+
529	+ public function __toString()
530	+ {
531	+ return $this->to_url();
532	+ }
533	+
534	+
535	+ public function sign_request( $signature_method, $consumer, $token )
536	+ {
537	+
538	+ $empty = false;
539	+ $msg = array();
540	+ if ( $token->key == null ) {
541	+ $msg[ ] = 'Token key';
542	+ }
543	+ if ( $token->secret == null ) {
544	+ $msg[ ] = 'Token secret';
545	+ }
546	+ if ( $consumer->key == null ) {
547	+
548	+ $msg[ ] = 'Consumer key';
549	+ }
550	+ if ( $consumer->secret == null ) {
551	+
552	+ $msg[ ] = 'Consumer secret';
553	+ }
554	+ if ( $this->http_url == null ) {
555	+
556	+ $msg[ ] = 'Endpoint';
557	+ }
558	+ if ( $this->http_method == null ) {
559	+
560	+ $msg[ ] = 'HTTP method';
561	+ }
562	+ if ( count( $msg ) ) {
563	+ throw new OAuthException( 'Enter valid ' . implode( ',', $msg ) );
564	+ }
565	+ $this->set_parameter(
566	+ "oauth_signature_method",
567	+ $signature_method->get_name(),
568	+ false );
569	+
570	+ $signature = $this->build_signature( $signature_method, $consumer, $token );
571	+ $this->set_parameter( "oauth_signature", $signature, false );
572	+
573	+ }
574	+
575	+ public function build_signature( $signature_method, $consumer, $token )
576	+ {
577	+ $signature = $signature_method->build_signature( $this, $consumer, $token );
578	+
579	+ return $signature;
580	+ }
581	+
582	+ /**
583	+ * util function: current timestamp
584	+ */
585	+ private static function generate_timestamp()
586	+ {
587	+ return time();
588	+ }
589	+
590	+ /**
591	+ * util function: current nonce
592	+ */
593	+ private static function generate_nonce()
594	+ {
595	+ $mt = microtime();
596	+ $rand = mt_rand();
597	+
598	+ return md5( $mt . $rand ); // md5s look nicer than numbers
599	+ }
600	+ }
601	+
602	+ class OAuthServer
603	+ {
604	+ protected $timestamp_threshold = 300; // in seconds, five minutes
605	+ protected $version = '1.0'; // hi blaine
606	+ protected $signature_methods = array();
607	+
608	+ protected $data_store;
609	+
610	+ function __construct( $data_store )
611	+ {
612	+ $this->data_store = $data_store;
613	+ }
614	+
615	+ public function add_signature_method( $signature_method )
616	+ {
617	+ $this->signature_methods[ $signature_method->get_name() ] =
618	+ $signature_method;
619	+ }
620	+
621	+ // high level functions
622	+
623	+ /**
624	+ * process a request_token request
625	+ * returns the request token on success
626	+ */
627	+ public function fetch_request_token( &$request )
628	+ {
629	+ $this->get_version( $request );
630	+
631	+ $consumer = $this->get_consumer( $request );
632	+
633	+ // no token required for the initial token request
634	+ $token = null;
635	+
636	+ $this->check_signature( $request, $consumer, $token );
637	+
638	+ // Rev A change
639	+ $callback = $request->get_parameter( 'oauth_callback' );
640	+ $new_token = $this->data_store->new_request_token( $consumer, $callback );
641	+
642	+ return $new_token;
643	+ }
644	+
645	+ /**
646	+ * process an access_token request
647	+ * returns the access token on success
648	+ */
649	+ public function fetch_access_token( &$request )
650	+ {
651	+ $this->get_version( $request );
652	+
653	+ $consumer = $this->get_consumer( $request );
654	+
655	+ // requires authorized request token
656	+ $token = $this->get_token( $request, $consumer, "request" );
657	+
658	+ $this->check_signature( $request, $consumer, $token );
659	+
660	+ // Rev A change
661	+ $verifier = $request->get_parameter( 'oauth_verifier' );
662	+ $new_token = $this->data_store->new_access_token( $token, $consumer, $verifier );
663	+
664	+ return $new_token;
665	+ }
666	+
667	+ /**
668	+ * verify an api call, checks all the parameters
669	+ */
670	+ public function verify_request( &$request )
671	+ {
672	+ $this->get_version( $request );
673	+ $consumer = $this->get_consumer( $request );
674	+ $token = $this->get_token( $request, $consumer, "access" );
675	+ $this->check_signature( $request, $consumer, $token );
676	+
677	+ return array( $consumer, $token );
678	+ }
679	+
680	+ // Internals from here
681	+ /**
682	+ * version 1
683	+ */
684	+ private function get_version( &$request )
685	+ {
686	+ $version = $request->get_parameter( "oauth_version" );
687	+ if ( !$version ) {
688	+ // Service Providers MUST assume the protocol version to be 1.0 if this parameter is not present.
689	+ // Chapter 7.0 ("Accessing Protected Ressources")
690	+ $version = '1.0';
691	+ }
692	+ if ( $version !== $this->version ) {
693	+ throw new OAuthException( "OAuth version '$version' not supported" );
694	+ }
695	+
696	+ return $version;
697	+ }
698	+
699	+ /**
700	+ * figure out the signature with some defaults
701	+ */
702	+ private function get_signature_method( $request )
703	+ {
704	+ $signature_method = $request instanceof OAuthRequest
705	+ ? $request->get_parameter( "oauth_signature_method" )
706	+ : null;
707	+
708	+ if ( !$signature_method ) {
709	+ // According to chapter 7 ("Accessing Protected Ressources") the signature-method
710	+ // parameter is required, and we can't just fallback to PLAINTEXT
711	+ throw new OAuthException( 'No signature method parameter. This parameter is required' );
712	+ }
713	+
714	+ if ( !in_array( $signature_method,
715	+ array_keys( $this->signature_methods ) )
716	+ ) {
717	+ throw new OAuthException(
718	+ "Signature method '$signature_method' not supported " .
719	+ "try one of the following: " .
720	+ implode( ", ", array_keys( $this->signature_methods ) )
721	+ );
722	+ }
723	+
724	+ return $this->signature_methods[ $signature_method ];
725	+ }
726	+
727	+ /**
728	+ * try to find the consumer for the provided request's consumer key
729	+ */
730	+ private function get_consumer( $request )
731	+ {
732	+ $consumer_key = $request instanceof OAuthRequest
733	+ ? $request->get_parameter( "oauth_consumer_key" )
734	+ : null;
735	+
736	+ if ( !$consumer_key ) {
737	+ throw new OAuthException( "Invalid consumer key" );
738	+ }
739	+
740	+ $consumer = $this->data_store->lookup_consumer( $consumer_key );
741	+ if ( !$consumer ) {
742	+ throw new OAuthException( "Invalid consumer" );
743	+ }
744	+
745	+ return $consumer;
746	+ }
747	+
748	+ /**
749	+ * try to find the token for the provided request's token key
750	+ */
751	+ private function get_token( $request, $consumer, $token_type = "access" )
752	+ {
753	+ $token_field = $request instanceof OAuthRequest
754	+ ? $request->get_parameter( 'oauth_token' )
755	+ : null;
756	+
757	+ $token = $this->data_store->lookup_token(
758	+ $consumer, $token_type, $token_field
759	+ );
760	+ if ( !$token ) {
761	+ throw new OAuthException( "Invalid $token_type token: $token_field" );
762	+ }
763	+
764	+ return $token;
765	+ }
766	+
767	+ /**
768	+ * all-in-one function to check the signature on a request
769	+ * should guess the signature method appropriately
770	+ */
771	+ private function check_signature( $request, $consumer, $token )
772	+ {
773	+ // this should probably be in a different method
774	+ $timestamp = $request instanceof OAuthRequest
775	+ ? $request->get_parameter( 'oauth_timestamp' )
776	+ : null;
777	+ $nonce = $request instanceof OAuthRequest
778	+ ? $request->get_parameter( 'oauth_nonce' )
779	+ : null;
780	+
781	+ $this->check_timestamp( $timestamp );
782	+ $this->check_nonce( $consumer, $token, $nonce, $timestamp );
783	+
784	+ $signature_method = $this->get_signature_method( $request );
785	+
786	+ $signature = $request->get_parameter( 'oauth_signature' );
787	+ $valid_sig = $signature_method->check_signature(
788	+ $request,
789	+ $consumer,
790	+ $token,
791	+ $signature
792	+ );
793	+
794	+ if ( !$valid_sig ) {
795	+ throw new OAuthException( "Invalid signature" );
796	+ }
797	+ }
798	+
799	+ /**
800	+ * check that the timestamp is new enough
801	+ */
802	+ private function check_timestamp( $timestamp )
803	+ {
804	+ if ( !$timestamp )
805	+ throw new OAuthException(
806	+ 'Missing timestamp parameter. The parameter is required'
807	+ );
808	+
809	+ // verify that timestamp is recentish
810	+ $now = time();
811	+ if ( abs( $now - $timestamp ) > $this->timestamp_threshold ) {
812	+ throw new OAuthException(
813	+ "Expired timestamp, yours $timestamp, ours $now"
814	+ );
815	+ }
816	+ }
817	+
818	+ /**
819	+ * check that the nonce is not repeated
820	+ */
821	+ private function check_nonce( $consumer, $token, $nonce, $timestamp )
822	+ {
823	+ if ( !$nonce )
824	+ throw new OAuthException(
825	+ 'Missing nonce parameter. The parameter is required'
826	+ );
827	+
828	+ // verify that the nonce is uniqueish
829	+ $found = $this->data_store->lookup_nonce(
830	+ $consumer,
831	+ $token,
832	+ $nonce,
833	+ $timestamp
834	+ );
835	+ if ( $found ) {
836	+ throw new OAuthException( "Nonce already used: $nonce" );
837	+ }
838	+ }
839	+
840	+ }
841	+
842	+ class OAuthDataStore
843	+ {
844	+ function lookup_consumer( $consumer_key )
845	+ {
846	+ // implement me
847	+ }
848	+
849	+ function lookup_token( $consumer, $token_type, $token )
850	+ {
851	+ // implement me
852	+ }
853	+
854	+ function lookup_nonce( $consumer, $token, $nonce, $timestamp )
855	+ {
856	+ // implement me
857	+ }
858	+
859	+ function new_request_token( $consumer, $callback = null )
860	+ {
861	+ // return a new token attached to this consumer
862	+ }
863	+
864	+ function new_access_token( $token, $consumer, $verifier = null )
865	+ {
866	+ // return a new access token attached to this consumer
867	+ // for the user associated with this token if the request token
868	+ // is authorized
869	+ // should also invalidate the request token
870	+ }
871	+
872	+ }
873	+
874	+ class OAuthUtil
875	+ {
876	+ public static function urlencode_rfc3986( $input )
877	+ {
878	+ if ( is_array( $input ) ) {
879	+ return array_map( array( 'OAuthUtil', 'urlencode_rfc3986' ), $input );
880	+ } else if ( is_scalar( $input ) ) {
881	+ $tmp1 = str_replace( '%7E', '~', rawurlencode( $input ) );
882	+ $tmp2 = str_replace( ".", "%2E", $tmp1 );
883	+ $tmp3 = str_replace( "*", "%2A", $tmp2 );
884	+ $tmp4 = str_replace( '+', ' ', $tmp3 );
885	+ $tmp = str_replace( "-", "%2D", $tmp4 );
886	+
887	+ return $tmp;
888	+ /*$tmp1=str_replace('%7E', '~', rawurlencode($input));
889	+ $tmp2= str_replace(".","%2E",$tmp1);
890	+
891	+
892	+ return $tmp;*/
893	+ } else {
894	+ return '';
895	+ }
896	+ }
897	+
898	+ public static function parseQueryString( $str )
899	+ {
900	+ $op = array();
901	+ $pairs = explode( "&", $str );
902	+ foreach ( $pairs as $pair ) {
903	+ list( $k, $v ) = array_map( "urldecode", explode( "=", $pair ) );
904	+ $op[ $k ] = $v;
905	+ }
906	+
907	+ return $op;
908	+ }
909	+
910	+ //parses string to associative array -modified for PayPal Signature
911	+
912	+
913	+ // This decode function isn't taking into consideration the above
914	+ // modifications to the encoding process. However, this method doesn't
915	+ // seem to be used anywhere so leaving it as is.
916	+ public static function urldecode_rfc3986( $string )
917	+ {
918	+ return urldecode( $string );
919	+ }
920	+
921	+ // Utility function for turning the Authorization: header into
922	+ // parameters, has to do some unescaping
923	+ // Can filter out any non-oauth parameters if needed (default behaviour)
924	+ // May 28th, 2010 - method updated to tjerk.meesters for a speed improvement.
925	+ // see http://code.google.com/p/oauth/issues/detail?id=163
926	+ public static function split_header( $header, $only_allow_oauth_parameters = true )
927	+ {
928	+ $params = array();
929	+ if ( preg_match_all( '/(' . ( $only_allow_oauth_parameters ? 'oauth_' : '' ) . '[a-z_-])=(:?"([^"])"\|([^,]*))/', $header, $matches ) ) {
930	+ foreach ( $matches[ 1 ] as $i => $h ) {
931	+ $params[ $h ] = OAuthUtil::urldecode_rfc3986( empty( $matches[ 3 ][ $i ] ) ? $matches[ 4 ][ $i ] : $matches[ 3 ][ $i ] );
932	+ }
933	+ if ( isset( $params[ 'realm' ] ) ) {
934	+ unset( $params[ 'realm' ] );
935	+ }
936	+ }
937	+
938	+ return $params;
939	+ }
940	+
941	+ // helper to try to sort out headers for people who aren't running apache
942	+ public static function get_headers()
943	+ {
944	+ if ( function_exists( 'apache_request_headers' ) ) {
945	+ // we need this to get the actual Authorization: header
946	+ // because apache tends to tell us it doesn't exist
947	+ $headers = apache_request_headers();
948	+
949	+ // sanitize the output of apache_request_headers because
950	+ // we always want the keys to be Cased-Like-This and arh()
951	+ // returns the headers in the same case as they are in the
952	+ // request
953	+ $out = array();
954	+ foreach ( $headers AS $key => $value ) {
955	+ $key = str_replace(
956	+ " ",
957	+ "-",
958	+ ucwords( strtolower( str_replace( "-", " ", $key ) ) )
959	+ );
960	+ $out[ $key ] = $value;
961	+ }
962	+ } else {
963	+ // otherwise we don't have apache and are just going to have to hope
964	+ // that $_SERVER actually contains what we need
965	+ $out = array();
966	+ if ( isset( $_SERVER[ 'CONTENT_TYPE' ] ) )
967	+ $out[ 'Content-Type' ] = $_SERVER[ 'CONTENT_TYPE' ];
968	+ if ( isset( $_ENV[ 'CONTENT_TYPE' ] ) )
969	+ $out[ 'Content-Type' ] = $_ENV[ 'CONTENT_TYPE' ];
970	+
971	+ foreach ( $_SERVER as $key => $value ) {
972	+ if ( substr( $key, 0, 5 ) == "HTTP_" ) {
973	+ // this is chaos, basically it is just there to capitalize the first
974	+ // letter of every word that is not an initial HTTP and strip HTTP
975	+ // code from przemek
976	+ $key = str_replace(
977	+ " ",
978	+ "-",
979	+ ucwords( strtolower( str_replace( "_", " ", substr( $key, 5 ) ) ) )
980	+ );
981	+ $out[ $key ] = $value;
982	+ }
983	+ }
984	+ }
985	+
986	+ return $out;
987	+ }
988	+
989	+ // This function takes a input like a=b&a=c&d=e and returns the parsed
990	+ // parameters like this
991	+ // array('a' => array('b','c'), 'd' => 'e')
992	+ public static function parse_parameters( $input )
993	+ {
994	+ if ( !isset( $input ) \|\| !$input ) return array();
995	+
996	+ $pairs = explode( '&', $input );
997	+
998	+ $parsed_parameters = array();
999	+ foreach ( $pairs as $pair ) {
1000	+ $split = explode( '=', $pair, 2 );
1001	+ $parameter = OAuthUtil::urldecode_rfc3986( $split[ 0 ] );
1002	+ $value = isset( $split[ 1 ] ) ? OAuthUtil::urldecode_rfc3986( $split[ 1 ] ) : '';
1003	+
1004	+ if ( isset( $parsed_parameters[ $parameter ] ) ) {
1005	+ // We have already recieved parameter(s) with this name, so add to the list
1006	+ // of parameters with this name
1007	+
1008	+ if ( is_scalar( $parsed_parameters[ $parameter ] ) ) {
1009	+ // This is the first duplicate, so transform scalar (string) into an array
1010	+ // so we can add the duplicates
1011	+ $parsed_parameters[ $parameter ] = array( $parsed_parameters[ $parameter ] );
1012	+ }
1013	+
1014	+ $parsed_parameters[ $parameter ][ ] = $value;
1015	+ } else {
1016	+ $parsed_parameters[ $parameter ] = $value;
1017	+ }
1018	+ }
1019	+
1020	+ return $parsed_parameters;
1021	+ }
1022	+
1023	+ public static function build_http_query( $params )
1024	+ {
1025	+ if ( !$params ) return '';
1026	+
1027	+ // Urlencode both keys and values
1028	+ $keys = OAuthUtil::urlencode_rfc3986( array_keys( $params ) );
1029	+ $values = OAuthUtil::urlencode_rfc3986( array_values( $params ) );
1030	+ $params = array_combine( $keys, $values );
1031	+
1032	+ // Parameters are sorted by name, using lexicographical byte value ordering.
1033	+ // Ref: Spec: 9.1.1 (1)
1034	+ uksort( $params, 'strcmp' );
1035	+
1036	+ $pairs = array();
1037	+ foreach ( $params as $parameter => $value ) {
1038	+ if ( is_array( $value ) ) {
1039	+ // If two or more parameters share the same name, they are sorted by their value
1040	+ // Ref: Spec: 9.1.1 (1)
1041	+ // June 12th, 2010 - changed to sort because of issue 164 by hidetaka
1042	+ sort( $value, SORT_STRING );
1043	+ foreach ( $value as $duplicate_value ) {
1044	+ $pairs[ ] = $parameter . '=' . $duplicate_value;
1045	+ }
1046	+ } else {
1047	+ $pairs[ ] = $parameter . '=' . $value;
1048	+ }
1049	+ }
1050	+
1051	+ // For each parameter, the name is separated from the corresponding value by an '=' character (ASCII code 61)
1052	+ // Each name-value pair is separated by an '&' character (ASCII code 38)
1053	+ return implode( '&', $pairs );
1054	+ }
1055	+ }
1056	+
1057	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/cacert.pem ADDED Viewed

	@@ -0,0 +1,171 @@


1	+ Verisign Class 3 Public Primary Certification Authority
2	+ =======================================================
3	+ -----BEGIN CERTIFICATE-----
4	+ MIICPDCCAaUCEHC65B0Q2Sk0tjjKewPMur8wDQYJKoZIhvcNAQECBQAwXzELMAkGA1UEBhMCVVMx
5	+ FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
6	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMTIzNTk1OVow
7	+ XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
8	+ IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
9	+ A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
10	+ f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
11	+ hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBAgUAA4GBALtMEivPLCYA
12	+ TxQT3ab7/AoRhIzzKBxnki98tsX63/Dolbwdj2wsqFHMc9ikwFPwTtYmwHYBV4GSXiHx0bH/59Ah
13	+ WM1pF+NEHJwZRDmJXNycAA9WjQKZ7aKQRUzkuxCkPfAyAw7xzvjoyVGM5mKf5p/AfbdynMk2Omuf
14	+ Tqj/ZA1k
15	+ -----END CERTIFICATE-----
16	+
17	+ Verisign Class 3 Public Primary Certification Authority - G2
18	+ ============================================================
19	+ -----BEGIN CERTIFICATE-----
20	+ MIIDAjCCAmsCEH3Z/gfPqB63EHln+6eJNMYwDQYJKoZIhvcNAQEFBQAwgcExCzAJBgNVBAYTAlVT
21	+ MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
22	+ eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
23	+ biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
24	+ dCBOZXR3b3JrMB4XDTk4MDUxODAwMDAwMFoXDTI4MDgwMTIzNTk1OVowgcExCzAJBgNVBAYTAlVT
25	+ MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
26	+ eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
27	+ biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
28	+ dCBOZXR3b3JrMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDMXtERXVxp0KvTuWpMmR9ZmDCO
29	+ FoUgRm1HP9SFIIThbbP4pO0M8RcPO/mn+SXXwc+EY/J8Y8+iR/LGWzOOZEAEaMGAuWQcRXfH2G71
30	+ lSk8UOg013gfqLptQ5GVj0VXXn7F+8qkBOvqlzdUMG+7AUcyM83cV5tkaWH4mx0ciU9cZwIDAQAB
31	+ MA0GCSqGSIb3DQEBBQUAA4GBAFFNzb5cy5gZnBWyATl4Lk0PZ3BwmcYQWpSkU01UbSuvDV1Ai2TT
32	+ 1+7eVmGSX6bEHRBhNtMsJzzoKQm5EWR0zLVznxxIqbxhAe7iF6YM40AIOw7n60RzKprxaZLvcRTD
33	+ Oaxxp5EJb+RxBrO6WVcmeQD2+A2iMzAo1KpYoJ2daZH9
34	+ -----END CERTIFICATE-----
35	+
36	+
37	+ Verisign Class 3 Public Primary Certification Authority - G3
38	+ ============================================================
39	+ -----BEGIN CERTIFICATE-----
40	+ MIIEGjCCAwICEQCbfgZJoz5iudXukEhxKe9XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
41	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
42	+ cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
43	+ IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
44	+ dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
45	+ CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
46	+ dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
47	+ cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkg
48	+ Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
49	+ ggEBAMu6nFL8eB8aHm8bN3O9+MlrlBIwT/A2R/XQkQr1F8ilYcEWQE37imGQ5XYgwREGfassbqb1
50	+ EUGO+i2tKmFZpGcmTNDovFJbcCAEWNF6yaRpvIMXZK0Fi7zQWM6NjPXr8EJJC52XJ2cybuGukxUc
51	+ cLwgTS8Y3pKI6GyFVxEa6X7jJhFUokWWVYPKMIno3Nij7SqAP395ZVc+FSBmCC+Vk7+qRy+oRpfw
52	+ EuL+wgorUeZ25rdGt+INpsyow0xZVYnm6FNcHOqd8GIWC6fJXwzw3sJ2zq/3avL6QaaiMxTJ5Xpj
53	+ 055iN9WFZZ4O5lMkdBteHRJTW8cs54NJOxWuimi5V5cCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
54	+ ERSWwauSCPc/L8my/uRan2Te2yFPhpk0djZX3dAVL8WtfxUfN2JzPtTnX84XA9s1+ivbrmAJXx5f
55	+ j267Cz3qWhMeDGBvtcC1IyIuBwvLqXTLR7sdwdela8wv0kL9Sd2nic9TutoAWii/gt/4uhMdUIaC
56	+ /Y4wjylGsB49Ndo4YhYYSq3mtlFs3q9i6wHQHiT+eo8SGhJouPtmmRQURVyu565pF4ErWjfJXir0
57	+ xuKhXFSbplQAz/DxwceYMBo7Nhbbo27q/a2ywtrvAkcTisDxszGtTxzhT5yvDwyd93gN2PQ1VoDa
58	+ t20Xj50egWTh/sVFuq1ruQp6Tk9LhO5L8X3dEQ==
59	+ -----END CERTIFICATE-----
60	+
61	+ Verisign Class 4 Public Primary Certification Authority - G3
62	+ ============================================================
63	+ -----BEGIN CERTIFICATE-----
64	+ MIIEGjCCAwICEQDsoKeLbnVqAc/EfMwvlF7XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
65	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
66	+ cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
67	+ IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
68	+ dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
69	+ CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
70	+ dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
71	+ cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkg
72	+ Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
73	+ ggEBAK3LpRFpxlmr8Y+1GQ9Wzsy1HyDkniYlS+BzZYlZ3tCD5PUPtbut8XzoIfzk6AzufEUiGXaS
74	+ tBO3IFsJ+mGuqPKljYXCKtbeZjbSmwL0qJJgfJxptI8kHtCGUvYynEFYHiK9zUVilQhu0GbdU6LM
75	+ 8BDcVHOLBKFGMzNcF0C5nk3T875Vg+ixiY5afJqWIpA7iCXy0lOIAgwLePLmNxdLMEYH5IBtptiW
76	+ Lugs+BGzOA1mppvqySNb247i8xOOGlktqgLw7KSHZtzBP/XYufTsgsbSPZUd5cBPhMnZo0QoBmrX
77	+ Razwa2rvTl/4EYIeOGM0ZlDUPpNz+jDDZq3/ky2X7wMCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
78	+ j/ola09b5KROJ1WrIhVZPMq1CtRK26vdoV9TxaBXOcLORyu+OshWv8LZJxA6sQU8wHcxuzrTBXtt
79	+ mhwwjIDLk5Mqg6sFUYICABFna/OIYUdfA5PVWw3g8dShMjWFsjrbsIKr0csKvE+MW8VLADsfKoKm
80	+ fjaF3H48ZwC15DtS4KjrXRX5xm3wrR0OhbepmnMUWluPQSjA1egtTaRezarZ7c7c2NU8Qh0XwRJd
81	+ RTjDOPP8hS6DRkiy1yBfkjaP53kPmF6Z6PDQpLv1U70qzlmwr25/bLvSHgCwIe34QWKCudiyxLtG
82	+ UPMxxY8BqHTr9Xgn2uf3ZkPznoM+IKrDNWCRzg==
83	+ -----END CERTIFICATE-----
84	+ VeriSign Class 3 Public Primary Certification Authority - G5
85	+ ============================================================
86	+ -----BEGIN CERTIFICATE-----
87	+ MIIE0zCCA7ugAwIBAgIQGNrRniZ96LtKIVjNzGs7SjANBgkqhkiG9w0BAQUFADCByjELMAkGA1UE
88	+ BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
89	+ ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
90	+ IHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRp
91	+ ZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwHhcNMDYxMTA4MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCB
92	+ yjELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2ln
93	+ biBUcnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBh
94	+ dXRob3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmlt
95	+ YXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
96	+ ggEKAoIBAQCvJAgIKXo1nmAMqudLO07cfLw8RRy7K+D+KQL5VwijZIUVJ/XxrcgxiV0i6CqqpkKz
97	+ j/i5Vbext0uz/o9+B1fs70PbZmIVYc9gDaTY3vjgw2IIPVQT60nKWVSFJuUrjxuf6/WhkcIzSdhD
98	+ Y2pSS9KP6HBRTdGJaXvHcPaz3BJ023tdS1bTlr8Vd6Gw9KIl8q8ckmcY5fQGBO+QueQA5N06tRn/
99	+ Arr0PO7gi+s3i+z016zy9vA9r911kTMZHRxAy3QkGSGT2RT+rCpSx4/VBEnkjWNHiDxpg8v+R70r
100	+ fk/Fla4OndTRQ8Bnc+MUCH7lP59zuDMKz10/NIeWiu5T6CUVAgMBAAGjgbIwga8wDwYDVR0TAQH/
101	+ BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2Uv
102	+ Z2lmMCEwHzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVy
103	+ aXNpZ24uY29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFH/TZafC3ey78DAJ80M5+gKvMzEzMA0GCSqG
104	+ SIb3DQEBBQUAA4IBAQCTJEowX2LP2BqYLz3q3JktvXf2pXkiOOzEp6B4Eq1iDkVwZMXnl2YtmAl+
105	+ X6/WzChl8gGqCBpH3vn5fJJaCGkgDdk+bW48DW7Y5gaRQBi5+MHt39tBquCWIMnNZBU4gcmU7qKE
106	+ KQsTb47bDN0lAtukixlE0kF6BWlKWE9gyn6CagsCqiUXObXbf+eEZSqVir2G3l6BFoMtEMze/aiC
107	+ Km0oHw0LxOXnGiYZ4fQRbxC1lfznQgUy286dUV4otp6F01vvpX1FQHKOtw5rDgb7MzVIcbidJ4vE
108	+ ZV8NhnacRHr2lVz2XTIIM6RUthg/aFzyQkqFOFSDX9HoLPKsEdao7WNq
109	+ -----END CERTIFICATE-----
110	+ VeriSign Universal Root Certification Authority
111	+ ===============================================
112	+ -----BEGIN CERTIFICATE-----
113	+ MIIEuTCCA6GgAwIBAgIQQBrEZCGzEyEDDrvkEhrFHTANBgkqhkiG9w0BAQsFADCBvTELMAkGA1UE
114	+ BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
115	+ ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwOCBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
116	+ IHVzZSBvbmx5MTgwNgYDVQQDEy9WZXJpU2lnbiBVbml2ZXJzYWwgUm9vdCBDZXJ0aWZpY2F0aW9u
117	+ IEF1dGhvcml0eTAeFw0wODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIG9MQswCQYDVQQGEwJV
118	+ UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
119	+ cmsxOjA4BgNVBAsTMShjKSAyMDA4IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
120	+ IG9ubHkxODA2BgNVBAMTL1ZlcmlTaWduIFVuaXZlcnNhbCBSb290IENlcnRpZmljYXRpb24gQXV0
121	+ aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAx2E3XrEBNNti1xWb/1hajCMj
122	+ 1mCOkdeQmIN65lgZOIzF9uVkhbSicfvtvbnazU0AtMgtc6XHaXGVHzk8skQHnOgO+k1KxCHfKWGP
123	+ MiJhgsWHH26MfF8WIFFE0XBPV+rjHOPMee5Y2A7Cs0WTwCznmhcrewA3ekEzeOEz4vMQGn+HLL72
124	+ 9fdC4uW/h2KJXwBL38Xd5HVEMkE6HnFuacsLdUYI0crSK5XQz/u5QGtkjFdN/BMReYTtXlT2NJ8I
125	+ AfMQJQYXStrxHXpma5hgZqTZ79IugvHw7wnqRMkVauIDbjPTrJ9VAMf2CGqUuV/c4DPxhGD5WycR
126	+ tPwW8rtWaoAljQIDAQABo4GyMIGvMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMG0G
127	+ CCsGAQUFBwEMBGEwX6FdoFswWTBXMFUWCWltYWdlL2dpZjAhMB8wBwYFKw4DAhoEFI/l0xqGrI2O
128	+ a8PPgGrUSBgsexkuMCUWI2h0dHA6Ly9sb2dvLnZlcmlzaWduLmNvbS92c2xvZ28uZ2lmMB0GA1Ud
129	+ DgQWBBS2d/ppSEefUxLVwuoHMnYH0ZcHGTANBgkqhkiG9w0BAQsFAAOCAQEASvj4sAPmLGd75JR3
130	+ Y8xuTPl9Dg3cyLk1uXBPY/ok+myDjEedO2Pzmvl2MpWRsXe8rJq+seQxIcaBlVZaDrHC1LGmWazx
131	+ Y8u4TB1ZkErvkBYoH1quEPuBUDgMbMzxPcP1Y+Oz4yHJJDnp/RVmRvQbEdBNc6N9Rvk97ahfYtTx
132	+ P/jgdFcrGJ2BtMQo2pSXpXDrrB2+BxHw1dvd5Yzw1TKwg+ZX4o+/vqGqvz0dtdQ46tewXDpPaj+P
133	+ wGZsY6rp2aQW9IHRlRQOfc2VNNnSj3BzgXucfr2YYdhFh5iQxeuGMMY1v/D/w1WIg0vvBZIGcfK4
134	+ mJO37M2CYfE45k+XmCpajQ==
135	+ -----END CERTIFICATE-----
136	+
137	+ VeriSign Class 3 Public Primary Certification Authority - G4
138	+ ============================================================
139	+ -----BEGIN CERTIFICATE-----
140	+ MIIDhDCCAwqgAwIBAgIQL4D+I4wOIg9IZxIokYesszAKBggqhkjOPQQDAzCByjELMAkGA1UEBhMC
141	+ VVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBOZXR3
142	+ b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVz
143	+ ZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRpZmlj
144	+ YXRpb24gQXV0aG9yaXR5IC0gRzQwHhcNMDcxMTA1MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCByjEL
145	+ MAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBU
146	+ cnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRo
147	+ b3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5
148	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzQwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAASnVnp8
149	+ Utpkmw4tXNherJI9/gHmGUo9FANL+mAnINmDiWn6VMaaGF5VKmTeBvaNSjutEDxlPZCIBIngMGGz
150	+ rl0Bp3vefLK+ymVhAIau2o970ImtTR1ZmkGxvEeA3J5iw/mjgbIwga8wDwYDVR0TAQH/BAUwAwEB
151	+ /zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2UvZ2lmMCEw
152	+ HzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVyaXNpZ24u
153	+ Y29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFLMWkf3upm7ktS5Jj4d4gYDs5bG1MAoGCCqGSM49BAMD
154	+ A2gAMGUCMGYhDBgmYFo4e1ZC4Kf8NoRRkSAsdk1DPcQdhCPQrNZ8NQbOzWm9kA3bbEhCHQ6qQgIx
155	+ AJw9SDkjOVgaFRJZap7v1VmyHVIsmXHNxynfGyphe3HR3vPA5Q06Sqotp9iGKt0uEA==
156	+ -----END CERTIFICATE-----
157	+ Verisign Class 3 Public Primary Certification Authority
158	+ =======================================================
159	+ -----BEGIN CERTIFICATE-----
160	+ MIICPDCCAaUCEDyRMcsf9tAbDpq40ES/Er4wDQYJKoZIhvcNAQEFBQAwXzELMAkGA1UEBhMCVVMx
161	+ FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
162	+ IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMjIzNTk1OVow
163	+ XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
164	+ IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
165	+ A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
166	+ f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
167	+ hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBBQUAA4GBABByUqkFFBky
168	+ CEHwxWsKzH4PIRnN5GfcX6kb5sroc50i2JhucwNhkcV8sEVAbkSdjbCxlnRhLQ2pRdKkkirWmnWX
169	+ bj9T/UWZYB2oK0z5XqcJ2HUw19JlYD1n1khVdWk/kfVIC0dpImmClr7JyDiGSnoscxlIaU5rfGW/
170	+ D/xwzoiQ
171	+ -----END CERTIFICATE-----

trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPConfigurationException.php ADDED Viewed

	@@ -0,0 +1,9 @@


1	+ <?php
2	+ class PPConfigurationException extends Exception
3	+ {
4	+
5	+ public function __construct( $message = null, $code = 0 )
6	+ {
7	+ parent::__construct( $message, $code );
8	+ }
9	+ }

trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPConnectionException.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ class PPConnectionException extends Exception
3	+ {
4	+ /**
5	+ * The url that was being connected to when the exception occured
6	+ * @var string
7	+ */
8	+ private $url;
9	+
10	+ public function __construct( $url, $message, $code = 0 )
11	+ {
12	+ parent::__construct( $message, $code );
13	+ $this->url = $url;
14	+ }
15	+
16	+ public function getUrl()
17	+ {
18	+ return $this->url;
19	+ }
20	+ }

trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPInvalidCredentialException.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+
3	+
4	+ class PPInvalidCredentialException extends Exception
5	+ {
6	+
7	+ public function __construct( $message = null, $code = 0 )
8	+ {
9	+ parent::__construct( $message, $code );
10	+ }
11	+
12	+ public function errorMessage()
13	+ {
14	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
15	+ . ': <b>' . $this->getMessage() . '</b>';
16	+
17	+ return $errorMsg;
18	+ }
19	+
20	+ }
21	+
22	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPMissingCredentialException.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+
3	+
4	+ class PPMissingCredentialException extends Exception
5	+ {
6	+
7	+ public function __construct( $message = null, $code = 0 )
8	+ {
9	+ parent::__construct( $message, $code );
10	+ }
11	+
12	+ public function errorMessage()
13	+ {
14	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
15	+ . ': <b>' . $this->getMessage() . '</b>';
16	+
17	+ return $errorMsg;
18	+ }
19	+
20	+ }
21	+
22	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/exceptions/PPTransformerException.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ class PPTransformerException extends Exception
3	+ {
4	+
5	+ public function __construct( $message = null, $code = 0 )
6	+ {
7	+ parent::__construct( $message, $code );
8	+ }
9	+
10	+ public function errorMessage()
11	+ {
12	+ $errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
13	+ . ': <b>' . $this->getMessage() . '</b>';
14	+
15	+ return $errorMsg;
16	+ }
17	+
18	+ }
19	+
20	+ ?>

trunk/classes/gateways/PayPal_Masspay/api/lib/services/PayPalAPIInterfaceService/PayPalAPIInterfaceService.php ADDED Viewed

	@@ -0,0 +1,23178 @@


1	+ <?php
2	+ /**
3	+ * Stub objects for PayPalAPIInterfaceService
4	+ * Auto generated code
5	+ *
6	+ */
7	+ require_once( 'PPUtils.php' );
8	+ /**
9	+ * On requests, you must set the currencyID attribute to one of
10	+ * the three-character currency codes for any of the supported
11	+ * PayPal currencies. Limitations: Must not exceed $10,000 USD
12	+ * in any currency. No currency symbol. Decimal separator must
13	+ * be a period (.), and the thousands separator must be a comma
14	+ * (,).
15	+ */
16	+ class BasicAmountType
17	+ {
18	+
19	+ /**
20	+ *
21	+ * @access public
22	+ * @var CurrencyCodeType
23	+ */
24	+ public $currencyID;
25	+
26	+ /**
27	+ *
28	+ * @access public
29	+ * @var string
30	+ */
31	+ public $value;
32	+
33	+ /**
34	+ * Constructor with arguments
35	+ */
36	+ public function __construct( $currencyID = null, $value = null )
37	+ {
38	+ $this->currencyID = $currencyID;
39	+ $this->value = $value;
40	+ }
41	+
42	+
43	+ public function toXMLString()
44	+ {
45	+ $str = '';
46	+ $str .= $this->getAttributeAsXml();
47	+ $str .= '>';
48	+ if ( $this->value != null ) {
49	+ $str .= PPUtils::escapeInvalidXmlCharsRegex( $this->value );
50	+ }
51	+
52	+ return $str;
53	+ }
54	+
55	+
56	+ private function getAttributeAsXml()
57	+ {
58	+ $str = '';
59	+ if ( $this->currencyID != null ) {
60	+ $str .= ' currencyID = "' . PPUtils::escapeInvalidXmlCharsRegex( $this->currencyID ) . '"';
61	+ }
62	+
63	+ return $str;
64	+ }
65	+
66	+ public function init( $arr = null )
67	+ {
68	+ if ( $arr != null ) {
69	+ foreach ( $arr as $arry ) {
70	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'currencyid' ) {
71	+ $this->currencyID = $arry[ "text" ];
72	+ }
73	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'value' ) {
74	+ $this->value = $arry[ "text" ];
75	+ }
76	+ }
77	+ }
78	+ }
79	+ }
80	+
81	+
82	+ /**
83	+ *
84	+ */
85	+ class MeasureType
86	+ {
87	+
88	+ /**
89	+ *
90	+ * @access public
91	+ * @var string
92	+ */
93	+ public $unit;
94	+
95	+ /**
96	+ *
97	+ * @access public
98	+ * @var double
99	+ */
100	+ public $value;
101	+
102	+ /**
103	+ * Constructor with arguments
104	+ */
105	+ public function __construct( $unit = null, $value = null )
106	+ {
107	+ $this->unit = $unit;
108	+ $this->value = $value;
109	+ }
110	+
111	+
112	+ public function toXMLString()
113	+ {
114	+ $str = '';
115	+ $str .= $this->getAttributeAsXml();
116	+ $str .= '>';
117	+ if ( $this->value != null ) {
118	+ $str .= PPUtils::escapeInvalidXmlCharsRegex( $this->value );
119	+ }
120	+
121	+ return $str;
122	+ }
123	+
124	+
125	+ private function getAttributeAsXml()
126	+ {
127	+ $str = '';
128	+ if ( $this->unit != null ) {
129	+ $str .= ' unit = "' . PPUtils::escapeInvalidXmlCharsRegex( $this->unit ) . '"';
130	+ }
131	+
132	+ return $str;
133	+ }
134	+
135	+ public function init( $arr = null )
136	+ {
137	+ if ( $arr != null ) {
138	+ foreach ( $arr as $arry ) {
139	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'unit' ) {
140	+ $this->unit = $arry[ "text" ];
141	+ }
142	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'value' ) {
143	+ $this->value = $arry[ "text" ];
144	+ }
145	+ }
146	+ }
147	+ }
148	+ }
149	+
150	+
151	+ /**
152	+ * Value of the application-specific error parameter.
153	+ */
154	+ class ErrorParameterType
155	+ {
156	+
157	+ /**
158	+ * Value of the application-specific error parameter.
159	+ * @access public
160	+ * @var string
161	+ */
162	+ public $Value;
163	+
164	+
165	+ public function init( $arr = null )
166	+ {
167	+ if ( $arr != null ) {
168	+ foreach ( $arr as $arry ) {
169	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'value' ) {
170	+ $this->Value = $arry[ "text" ];
171	+ }
172	+ }
173	+ }
174	+ }
175	+ }
176	+
177	+
178	+ /**
179	+ * Error code can be used by a receiving application to
180	+ * debugging a response message. These codes will need to be
181	+ * uniquely defined for each application.
182	+ */
183	+ class ErrorType
184	+ {
185	+
186	+ /**
187	+ *
188	+ * @access public
189	+ * @var string
190	+ */
191	+ public $ShortMessage;
192	+
193	+ /**
194	+ *
195	+ * @access public
196	+ * @var string
197	+ */
198	+ public $LongMessage;
199	+
200	+ /**
201	+ * Error code can be used by a receiving application to
202	+ * debugging a response message. These codes will need to be
203	+ * uniquely defined for each application.
204	+ * @access public
205	+ * @var string
206	+ */
207	+ public $ErrorCode;
208	+
209	+ /**
210	+ * SeverityCode indicates whether the error is an application
211	+ * level error or if it is informational error, i.e., warning.
212	+ *
213	+ * @access public
214	+ * @var SeverityCodeType
215	+ */
216	+ public $SeverityCode;
217	+
218	+ /**
219	+ * This optional element may carry additional
220	+ * application-specific error variables that indicate specific
221	+ * information about the error condition particularly in the
222	+ * cases where there are multiple instances of the ErrorType
223	+ * which require additional context.
224	+ * @array
225	+ * @access public
226	+ * @var ErrorParameterType
227	+ */
228	+ public $ErrorParameters;
229	+
230	+
231	+ public function init( $arr = null )
232	+ {
233	+ if ( $arr != null ) {
234	+ foreach ( $arr as $arry ) {
235	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'shortmessage' ) {
236	+ $this->ShortMessage = $arry[ "text" ];
237	+ }
238	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'longmessage' ) {
239	+ $this->LongMessage = $arry[ "text" ];
240	+ }
241	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'errorcode' ) {
242	+ $this->ErrorCode = $arry[ "text" ];
243	+ }
244	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'severitycode' ) {
245	+ $this->SeverityCode = $arry[ "text" ];
246	+ }
247	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) ) {
248	+ $i = 0;
249	+ while ( true ) {
250	+ if ( $arry[ "name" ] == "errorparameters[$i]" ) {
251	+ $this->ErrorParameters[ $i ] = new ErrorParameterType();
252	+ $this->ErrorParameters[ $i ]->init( $arry[ "children" ] );
253	+ } else {
254	+ break;
255	+ }
256	+ $i++;
257	+ }
258	+ }
259	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) && ( $arry[ "name" ] == "errorparameters" ) ) {
260	+ $this->ErrorParameters = new ErrorParameterType();
261	+ $this->ErrorParameters->init( $arry[ "children" ] );
262	+ }
263	+ }
264	+ }
265	+ }
266	+ }
267	+
268	+
269	+ /**
270	+ * Base type definition of request payload that can carry any
271	+ * type of payload content with optional versioning information
272	+ * and detail level requirements.
273	+ */
274	+ class AbstractRequestType
275	+ {
276	+
277	+ /**
278	+ * This specifies the required detail level that is needed by a
279	+ * client application pertaining to a particular data component
280	+ * (e.g., Item, Transaction, etc.). The detail level is
281	+ * specified in the DetailLevelCodeType which has all the
282	+ * enumerated values of the detail level for each component.
283	+ * @array
284	+ * @access public
285	+ * @var DetailLevelCodeType
286	+ */
287	+ public $DetailLevel;
288	+
289	+ /**
290	+ * This should be the standard RFC 3066 language identification
291	+ * tag, e.g., en_US.
292	+ * @access public
293	+ * @var string
294	+ */
295	+ public $ErrorLanguage;
296	+
297	+ /**
298	+ * This refers to the version of the request payload schema.
299	+ * @access public
300	+ * @var string
301	+ */
302	+ public $Version;
303	+
304	+
305	+ public function toXMLString()
306	+ {
307	+ $str = '';
308	+ if ( $this->DetailLevel != null ) {
309	+ for ( $i = 0; $i < count( $this->DetailLevel ); $i++ ) {
310	+ $str .= '<ebl:DetailLevel>' . PPUtils::escapeInvalidXmlCharsRegex( $this->DetailLevel[ $i ] ) . '</ebl:DetailLevel>';
311	+ }
312	+ }
313	+ if ( $this->ErrorLanguage != null ) {
314	+ $str .= '<ebl:ErrorLanguage>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ErrorLanguage ) . '</ebl:ErrorLanguage>';
315	+ }
316	+ if ( $this->Version != null ) {
317	+ $str .= '<ebl:Version>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Version ) . '</ebl:Version>';
318	+ }
319	+
320	+ return $str;
321	+ }
322	+
323	+
324	+ }
325	+
326	+
327	+ /**
328	+ * Base type definition of a response payload that can carry
329	+ * any type of payload content with following optional
330	+ * elements: - timestamp of response message, - application
331	+ * level acknowledgement, and - application-level errors and
332	+ * warnings.
333	+ */
334	+ class AbstractResponseType
335	+ {
336	+
337	+ /**
338	+ * This value represents the date and time (GMT) when the
339	+ * response was generated by a service provider (as a result of
340	+ * processing of a request).
341	+ * @access public
342	+ * @var dateTime
343	+ */
344	+ public $Timestamp;
345	+
346	+ /**
347	+ * Application level acknowledgement code.
348	+ * @access public
349	+ * @var AckCodeType
350	+ */
351	+ public $Ack;
352	+
353	+ /**
354	+ * CorrelationID may be used optionally with an application
355	+ * level acknowledgement.
356	+ * @access public
357	+ * @var string
358	+ */
359	+ public $CorrelationID;
360	+
361	+ /**
362	+ *
363	+ * @array
364	+ * @access public
365	+ * @var ErrorType
366	+ */
367	+ public $Errors;
368	+
369	+ /**
370	+ * This refers to the version of the response payload schema.
371	+ * @access public
372	+ * @var string
373	+ */
374	+ public $Version;
375	+
376	+ /**
377	+ * This refers to the specific software build that was used in
378	+ * the deployment for processing the request and generating the
379	+ * response.
380	+ * @access public
381	+ * @var string
382	+ */
383	+ public $Build;
384	+
385	+
386	+ public function init( $arr = null )
387	+ {
388	+ if ( $arr != null ) {
389	+ foreach ( $arr as $arry ) {
390	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'timestamp' ) {
391	+ $this->Timestamp = $arry[ "text" ];
392	+ }
393	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'ack' ) {
394	+ $this->Ack = $arry[ "text" ];
395	+ }
396	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'correlationid' ) {
397	+ $this->CorrelationID = $arry[ "text" ];
398	+ }
399	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) ) {
400	+ $i = 0;
401	+ while ( true ) {
402	+ if ( $arry[ "name" ] == "errors[$i]" ) {
403	+ $this->Errors[ $i ] = new ErrorType();
404	+ $this->Errors[ $i ]->init( $arry[ "children" ] );
405	+ } else {
406	+ break;
407	+ }
408	+ $i++;
409	+ }
410	+ }
411	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) && ( $arry[ "name" ] == "errors" ) ) {
412	+ $this->Errors = new ErrorType();
413	+ $this->Errors->init( $arry[ "children" ] );
414	+ }
415	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'version' ) {
416	+ $this->Version = $arry[ "text" ];
417	+ }
418	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'build' ) {
419	+ $this->Build = $arry[ "text" ];
420	+ }
421	+ }
422	+ }
423	+ }
424	+ }
425	+
426	+
427	+ /**
428	+ * Country code associated with this phone number.
429	+ */
430	+ class PhoneNumberType
431	+ {
432	+
433	+ /**
434	+ * Country code associated with this phone number.
435	+ * @access public
436	+ * @var string
437	+ */
438	+ public $CountryCode;
439	+
440	+ /**
441	+ * Phone number associated with this phone.
442	+ * @access public
443	+ * @var string
444	+ */
445	+ public $PhoneNumber;
446	+
447	+ /**
448	+ * Extension associated with this phone number.
449	+ * @access public
450	+ * @var string
451	+ */
452	+ public $Extension;
453	+
454	+
455	+ public function toXMLString()
456	+ {
457	+ $str = '';
458	+ if ( $this->CountryCode != null ) {
459	+ $str .= '<ebl:CountryCode>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CountryCode ) . '</ebl:CountryCode>';
460	+ }
461	+ if ( $this->PhoneNumber != null ) {
462	+ $str .= '<ebl:PhoneNumber>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PhoneNumber ) . '</ebl:PhoneNumber>';
463	+ }
464	+ if ( $this->Extension != null ) {
465	+ $str .= '<ebl:Extension>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Extension ) . '</ebl:Extension>';
466	+ }
467	+
468	+ return $str;
469	+ }
470	+
471	+
472	+ }
473	+
474	+
475	+ /**
476	+ * Person's name associated with this address. Character length
477	+ * and limitations: 32 single-byte alphanumeric characters
478	+ */
479	+ class AddressType
480	+ {
481	+
482	+ /**
483	+ * Person's name associated with this address. Character length
484	+ * and limitations: 32 single-byte alphanumeric characters
485	+ * @access public
486	+ * @var string
487	+ */
488	+ public $Name;
489	+
490	+ /**
491	+ * First street address. Character length and limitations: 300
492	+ * single-byte alphanumeric characters
493	+ * @access public
494	+ * @var string
495	+ */
496	+ public $Street1;
497	+
498	+ /**
499	+ * Second street address. Character length and limitations: 300
500	+ * single-byte alphanumeric characters
501	+ * @access public
502	+ * @var string
503	+ */
504	+ public $Street2;
505	+
506	+ /**
507	+ * Name of city. Character length and limitations: 120
508	+ * single-byte alphanumeric characters
509	+ * @access public
510	+ * @var string
511	+ */
512	+ public $CityName;
513	+
514	+ /**
515	+ * State or province. Character length and limitations: 120
516	+ * single-byte alphanumeric characters For Canada and the USA,
517	+ * StateOrProvince must be the standard 2-character
518	+ * abbreviation of a state or province. Canadian Provinces
519	+ * Alberta AB British_Columbia BC Manitoba MB New_Brunswick NB
520	+ * Newfoundland NF Northwest_Territories NT Nova_Scotia NS
521	+ * Nunavut NU Ontario ON Prince_Edward_Island PE Quebec QC
522	+ * Saskatchewan SK Yukon YK United States Alabama AL Alaska AK
523	+ * American_Samoa AS Arizona AZ Arkansas AR California CA
524	+ * Colorado CO Connecticut CT Delaware DE District_Of_Columbia
525	+ * DC Federated_States_Of_Micronesia FM Florida FL Georgia GA
526	+ * Guam GU Hawaii HI Idaho ID Illinois IL Indiana IN Iowa IA
527	+ * Kansas KS Kentucky KY Louisiana LA Maine ME Marshall_Islands
528	+ * MH Maryland MD Massachusetts MA Michigan MI Minnesota MN
529	+ * Mississippi MS Missouri MO Montana MT Nebraska NE Nevada NV
530	+ * New_Hampshire NH New_Jersey NJ New_Mexico NM New_York NY
531	+ * North_Carolina NC North_Dakota ND Northern_Mariana_Islands
532	+ * MP Ohio OH Oklahoma OK Oregon OR Palau PW Pennsylvania PA
533	+ * Puerto_Rico PR Rhode_Island RI South_Carolina SC
534	+ * South_Dakota SD Tennessee TN Texas TX Utah UT Vermont VT
535	+ * Virgin_Islands VI Virginia VA Washington WA West_Virginia WV
536	+ * Wisconsin WI Wyoming WY Armed_Forces_Americas AA
537	+ * Armed_Forces AE Armed_Forces_Pacific AP
538	+ * @access public
539	+ * @var string
540	+ */
541	+ public $StateOrProvince;
542	+
543	+ /**
544	+ * ISO 3166 standard country code Character limit: Two
545	+ * single-byte characters.
546	+ * @access public
547	+ * @var CountryCodeType
548	+ */
549	+ public $Country;
550	+
551	+ /**
552	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
553	+ * DoExpressCheckoutPayment, DoDirectPayment,
554	+ * CreateRecurringPaymentsProfile or
555	+ * UpdateRecurringPaymentsProfile. This element should only be
556	+ * used in response elements and typically should not be used
557	+ * in creating request messages which specify the name of a
558	+ * country using the Country element (which refers to a
559	+ * 2-letter country code).
560	+ * @access public
561	+ * @var string
562	+ */
563	+ public $CountryName;
564	+
565	+ /**
566	+ * Telephone number associated with this address
567	+ * @access public
568	+ * @var string
569	+ */
570	+ public $Phone;
571	+
572	+ /**
573	+ *
574	+ * @access public
575	+ * @var string
576	+ */
577	+ public $PostalCode;
578	+
579	+ /**
580	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
581	+ * DoExpressCheckoutPayment, DoDirectPayment,
582	+ * CreateRecurringPaymentsProfile, or
583	+ * UpdateRecurringPaymentsProfile.
584	+ * @access public
585	+ * @var string
586	+ */
587	+ public $AddressID;
588	+
589	+ /**
590	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
591	+ * DoExpressCheckoutPayment, DoDirectPayment,
592	+ * CreateRecurringPaymentsProfile or
593	+ * UpdateRecurringPaymentsProfile.
594	+ * @access public
595	+ * @var AddressOwnerCodeType
596	+ */
597	+ public $AddressOwner;
598	+
599	+ /**
600	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
601	+ * DoExpressCheckoutPayment, DoDirectPayment,
602	+ * CreateRecurringPaymentsProfile or
603	+ * UpdateRecurringPaymentsProfile.
604	+ * @access public
605	+ * @var string
606	+ */
607	+ public $ExternalAddressID;
608	+
609	+ /**
610	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
611	+ * DoExpressCheckoutPayment, DoDirectPayment,
612	+ * CreateRecurringPaymentsProfile or
613	+ * UpdateRecurringPaymentsProfile. Only applicable to
614	+ * SellerPaymentAddress today. Seller's international name that
615	+ * is associated with the payment address.
616	+ * @access public
617	+ * @var string
618	+ */
619	+ public $InternationalName;
620	+
621	+ /**
622	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
623	+ * DoExpressCheckoutPayment, DoDirectPayment,
624	+ * CreateRecurringPaymentsProfile or
625	+ * UpdateRecurringPaymentsProfile. Only applicable to
626	+ * SellerPaymentAddress today. International state and city for
627	+ * the seller's payment address.
628	+ * @access public
629	+ * @var string
630	+ */
631	+ public $InternationalStateAndCity;
632	+
633	+ /**
634	+ * IMPORTANT: Do not set this element for SetExpressCheckout,
635	+ * DoExpressCheckoutPayment, DoDirectPayment,
636	+ * CreateRecurringPaymentsProfile or
637	+ * UpdateRecurringPaymentsProfile. Only applicable to
638	+ * SellerPaymentAddress today. Seller's international street
639	+ * address that is associated with the payment address.
640	+ * @access public
641	+ * @var string
642	+ */
643	+ public $InternationalStreet;
644	+
645	+ /**
646	+ * Status of the address on file with PayPal. IMPORTANT: Do not
647	+ * set this element for SetExpressCheckout,
648	+ * DoExpressCheckoutPayment, DoDirectPayment,
649	+ * CreateRecurringPaymentsProfile or
650	+ * UpdateRecurringPaymentsProfile.
651	+ * @access public
652	+ * @var AddressStatusCodeType
653	+ */
654	+ public $AddressStatus;
655	+
656	+
657	+ public function toXMLString()
658	+ {
659	+ $str = '';
660	+ if ( $this->Name != null ) {
661	+ $str .= '<ebl:Name>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Name ) . '</ebl:Name>';
662	+ }
663	+ if ( $this->Street1 != null ) {
664	+ $str .= '<ebl:Street1>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Street1 ) . '</ebl:Street1>';
665	+ }
666	+ if ( $this->Street2 != null ) {
667	+ $str .= '<ebl:Street2>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Street2 ) . '</ebl:Street2>';
668	+ }
669	+ if ( $this->CityName != null ) {
670	+ $str .= '<ebl:CityName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CityName ) . '</ebl:CityName>';
671	+ }
672	+ if ( $this->StateOrProvince != null ) {
673	+ $str .= '<ebl:StateOrProvince>' . PPUtils::escapeInvalidXmlCharsRegex( $this->StateOrProvince ) . '</ebl:StateOrProvince>';
674	+ }
675	+ if ( $this->Country != null ) {
676	+ $str .= '<ebl:Country>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Country ) . '</ebl:Country>';
677	+ }
678	+ if ( $this->CountryName != null ) {
679	+ $str .= '<ebl:CountryName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CountryName ) . '</ebl:CountryName>';
680	+ }
681	+ if ( $this->Phone != null ) {
682	+ $str .= '<ebl:Phone>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Phone ) . '</ebl:Phone>';
683	+ }
684	+ if ( $this->PostalCode != null ) {
685	+ $str .= '<ebl:PostalCode>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PostalCode ) . '</ebl:PostalCode>';
686	+ }
687	+ if ( $this->AddressID != null ) {
688	+ $str .= '<ebl:AddressID>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AddressID ) . '</ebl:AddressID>';
689	+ }
690	+ if ( $this->AddressOwner != null ) {
691	+ $str .= '<ebl:AddressOwner>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AddressOwner ) . '</ebl:AddressOwner>';
692	+ }
693	+ if ( $this->ExternalAddressID != null ) {
694	+ $str .= '<ebl:ExternalAddressID>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ExternalAddressID ) . '</ebl:ExternalAddressID>';
695	+ }
696	+ if ( $this->InternationalName != null ) {
697	+ $str .= '<ebl:InternationalName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->InternationalName ) . '</ebl:InternationalName>';
698	+ }
699	+ if ( $this->InternationalStateAndCity != null ) {
700	+ $str .= '<ebl:InternationalStateAndCity>' . PPUtils::escapeInvalidXmlCharsRegex( $this->InternationalStateAndCity ) . '</ebl:InternationalStateAndCity>';
701	+ }
702	+ if ( $this->InternationalStreet != null ) {
703	+ $str .= '<ebl:InternationalStreet>' . PPUtils::escapeInvalidXmlCharsRegex( $this->InternationalStreet ) . '</ebl:InternationalStreet>';
704	+ }
705	+ if ( $this->AddressStatus != null ) {
706	+ $str .= '<ebl:AddressStatus>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AddressStatus ) . '</ebl:AddressStatus>';
707	+ }
708	+
709	+ return $str;
710	+ }
711	+
712	+
713	+ public function init( $arr = null )
714	+ {
715	+ if ( $arr != null ) {
716	+ foreach ( $arr as $arry ) {
717	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'name' ) {
718	+ $this->Name = $arry[ "text" ];
719	+ }
720	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'street1' ) {
721	+ $this->Street1 = $arry[ "text" ];
722	+ }
723	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'street2' ) {
724	+ $this->Street2 = $arry[ "text" ];
725	+ }
726	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'cityname' ) {
727	+ $this->CityName = $arry[ "text" ];
728	+ }
729	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'stateorprovince' ) {
730	+ $this->StateOrProvince = $arry[ "text" ];
731	+ }
732	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'country' ) {
733	+ $this->Country = $arry[ "text" ];
734	+ }
735	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'countryname' ) {
736	+ $this->CountryName = $arry[ "text" ];
737	+ }
738	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'phone' ) {
739	+ $this->Phone = $arry[ "text" ];
740	+ }
741	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'postalcode' ) {
742	+ $this->PostalCode = $arry[ "text" ];
743	+ }
744	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'addressid' ) {
745	+ $this->AddressID = $arry[ "text" ];
746	+ }
747	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'addressowner' ) {
748	+ $this->AddressOwner = $arry[ "text" ];
749	+ }
750	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'externaladdressid' ) {
751	+ $this->ExternalAddressID = $arry[ "text" ];
752	+ }
753	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'internationalname' ) {
754	+ $this->InternationalName = $arry[ "text" ];
755	+ }
756	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'internationalstateandcity' ) {
757	+ $this->InternationalStateAndCity = $arry[ "text" ];
758	+ }
759	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'internationalstreet' ) {
760	+ $this->InternationalStreet = $arry[ "text" ];
761	+ }
762	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'addressstatus' ) {
763	+ $this->AddressStatus = $arry[ "text" ];
764	+ }
765	+ }
766	+ }
767	+ }
768	+ }
769	+
770	+
771	+ /**
772	+ *
773	+ */
774	+ class PersonNameType
775	+ {
776	+
777	+ /**
778	+ *
779	+ * @access public
780	+ * @var string
781	+ */
782	+ public $Salutation;
783	+
784	+ /**
785	+ *
786	+ * @access public
787	+ * @var string
788	+ */
789	+ public $FirstName;
790	+
791	+ /**
792	+ *
793	+ * @access public
794	+ * @var string
795	+ */
796	+ public $MiddleName;
797	+
798	+ /**
799	+ *
800	+ * @access public
801	+ * @var string
802	+ */
803	+ public $LastName;
804	+
805	+ /**
806	+ *
807	+ * @access public
808	+ * @var string
809	+ */
810	+ public $Suffix;
811	+
812	+
813	+ public function toXMLString()
814	+ {
815	+ $str = '';
816	+ if ( $this->Salutation != null ) {
817	+ $str .= '<ebl:Salutation>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Salutation ) . '</ebl:Salutation>';
818	+ }
819	+ if ( $this->FirstName != null ) {
820	+ $str .= '<ebl:FirstName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->FirstName ) . '</ebl:FirstName>';
821	+ }
822	+ if ( $this->MiddleName != null ) {
823	+ $str .= '<ebl:MiddleName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->MiddleName ) . '</ebl:MiddleName>';
824	+ }
825	+ if ( $this->LastName != null ) {
826	+ $str .= '<ebl:LastName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->LastName ) . '</ebl:LastName>';
827	+ }
828	+ if ( $this->Suffix != null ) {
829	+ $str .= '<ebl:Suffix>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Suffix ) . '</ebl:Suffix>';
830	+ }
831	+
832	+ return $str;
833	+ }
834	+
835	+
836	+ public function init( $arr = null )
837	+ {
838	+ if ( $arr != null ) {
839	+ foreach ( $arr as $arry ) {
840	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'salutation' ) {
841	+ $this->Salutation = $arry[ "text" ];
842	+ }
843	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'firstname' ) {
844	+ $this->FirstName = $arry[ "text" ];
845	+ }
846	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'middlename' ) {
847	+ $this->MiddleName = $arry[ "text" ];
848	+ }
849	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'lastname' ) {
850	+ $this->LastName = $arry[ "text" ];
851	+ }
852	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'suffix' ) {
853	+ $this->Suffix = $arry[ "text" ];
854	+ }
855	+ }
856	+ }
857	+ }
858	+ }
859	+
860	+
861	+ /**
862	+ *
863	+ */
864	+ class IncentiveAppliedToType
865	+ {
866	+
867	+ /**
868	+ *
869	+ * @access public
870	+ * @var string
871	+ */
872	+ public $BucketId;
873	+
874	+ /**
875	+ *
876	+ * @access public
877	+ * @var string
878	+ */
879	+ public $ItemId;
880	+
881	+ /**
882	+ *
883	+ * @access public
884	+ * @var BasicAmountType
885	+ */
886	+ public $IncentiveAmount;
887	+
888	+ /**
889	+ *
890	+ * @access public
891	+ * @var string
892	+ */
893	+ public $SubType;
894	+
895	+
896	+ public function init( $arr = null )
897	+ {
898	+ if ( $arr != null ) {
899	+ foreach ( $arr as $arry ) {
900	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'bucketid' ) {
901	+ $this->BucketId = $arry[ "text" ];
902	+ }
903	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'itemid' ) {
904	+ $this->ItemId = $arry[ "text" ];
905	+ }
906	+
907	+
908	+ if ( is_array( $arry[ "attributes" ] ) && ( $arry[ "attributes" ] ) != null ) {
909	+ if ( $arry[ "name" ] == 'incentiveamount' ) {
910	+ $tmp = array();
911	+ $atr = array();
912	+ foreach ( $arry[ "attributes" ] as $key => $val ) {
913	+ $atr[ 0 ][ "name" ] = $key;
914	+ $atr[ 0 ][ "text" ] = $val;
915	+ }
916	+ $atr[ 1 ][ "name" ] = "value";
917	+ $atr[ 1 ][ "text" ] = $arry[ "text" ];
918	+ $this->IncentiveAmount = new BasicAmountType();
919	+ $this->IncentiveAmount->init( $atr );
920	+ }
921	+
922	+ }
923	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'subtype' ) {
924	+ $this->SubType = $arry[ "text" ];
925	+ }
926	+ }
927	+ }
928	+ }
929	+ }
930	+
931	+
932	+ /**
933	+ *
934	+ */
935	+ class IncentiveDetailType
936	+ {
937	+
938	+ /**
939	+ *
940	+ * @access public
941	+ * @var string
942	+ */
943	+ public $RedemptionCode;
944	+
945	+ /**
946	+ *
947	+ * @access public
948	+ * @var string
949	+ */
950	+ public $DisplayCode;
951	+
952	+ /**
953	+ *
954	+ * @access public
955	+ * @var string
956	+ */
957	+ public $ProgramId;
958	+
959	+ /**
960	+ *
961	+ * @access public
962	+ * @var IncentiveTypeCodeType
963	+ */
964	+ public $IncentiveType;
965	+
966	+ /**
967	+ *
968	+ * @access public
969	+ * @var string
970	+ */
971	+ public $IncentiveDescription;
972	+
973	+ /**
974	+ *
975	+ * @array
976	+ * @access public
977	+ * @var IncentiveAppliedToType
978	+ */
979	+ public $AppliedTo;
980	+
981	+ /**
982	+ *
983	+ * @access public
984	+ * @var string
985	+ */
986	+ public $Status;
987	+
988	+ /**
989	+ *
990	+ * @access public
991	+ * @var string
992	+ */
993	+ public $ErrorCode;
994	+
995	+
996	+ public function init( $arr = null )
997	+ {
998	+ if ( $arr != null ) {
999	+ foreach ( $arr as $arry ) {
1000	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'redemptioncode' ) {
1001	+ $this->RedemptionCode = $arry[ "text" ];
1002	+ }
1003	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'displaycode' ) {
1004	+ $this->DisplayCode = $arry[ "text" ];
1005	+ }
1006	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'programid' ) {
1007	+ $this->ProgramId = $arry[ "text" ];
1008	+ }
1009	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'incentivetype' ) {
1010	+ $this->IncentiveType = $arry[ "text" ];
1011	+ }
1012	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'incentivedescription' ) {
1013	+ $this->IncentiveDescription = $arry[ "text" ];
1014	+ }
1015	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) ) {
1016	+ $i = 0;
1017	+ while ( true ) {
1018	+ if ( $arry[ "name" ] == "appliedto[$i]" ) {
1019	+ $this->AppliedTo[ $i ] = new IncentiveAppliedToType();
1020	+ $this->AppliedTo[ $i ]->init( $arry[ "children" ] );
1021	+ } else {
1022	+ break;
1023	+ }
1024	+ $i++;
1025	+ }
1026	+ }
1027	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) && ( $arry[ "name" ] == "appliedto" ) ) {
1028	+ $this->AppliedTo = new IncentiveAppliedToType();
1029	+ $this->AppliedTo->init( $arry[ "children" ] );
1030	+ }
1031	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'status' ) {
1032	+ $this->Status = $arry[ "text" ];
1033	+ }
1034	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'errorcode' ) {
1035	+ $this->ErrorCode = $arry[ "text" ];
1036	+ }
1037	+ }
1038	+ }
1039	+ }
1040	+ }
1041	+
1042	+
1043	+ /**
1044	+ *
1045	+ */
1046	+ class IncentiveItemType
1047	+ {
1048	+
1049	+ /**
1050	+ *
1051	+ * @access public
1052	+ * @var string
1053	+ */
1054	+ public $ItemId;
1055	+
1056	+ /**
1057	+ *
1058	+ * @access public
1059	+ * @var dateTime
1060	+ */
1061	+ public $PurchaseTime;
1062	+
1063	+ /**
1064	+ *
1065	+ * @access public
1066	+ * @var string
1067	+ */
1068	+ public $ItemCategoryList;
1069	+
1070	+ /**
1071	+ *
1072	+ * @access public
1073	+ * @var BasicAmountType
1074	+ */
1075	+ public $ItemPrice;
1076	+
1077	+ /**
1078	+ *
1079	+ * @access public
1080	+ * @var integer
1081	+ */
1082	+ public $ItemQuantity;
1083	+
1084	+
1085	+ public function toXMLString()
1086	+ {
1087	+ $str = '';
1088	+ if ( $this->ItemId != null ) {
1089	+ $str .= '<ebl:ItemId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ItemId ) . '</ebl:ItemId>';
1090	+ }
1091	+ if ( $this->PurchaseTime != null ) {
1092	+ $str .= '<ebl:PurchaseTime>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PurchaseTime ) . '</ebl:PurchaseTime>';
1093	+ }
1094	+ if ( $this->ItemCategoryList != null ) {
1095	+ $str .= '<ebl:ItemCategoryList>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ItemCategoryList ) . '</ebl:ItemCategoryList>';
1096	+ }
1097	+ if ( $this->ItemPrice != null ) {
1098	+ $str .= '<ebl:ItemPrice';
1099	+ $str .= $this->ItemPrice->toXMLString();
1100	+ $str .= '</ebl:ItemPrice>';
1101	+ }
1102	+ if ( $this->ItemQuantity != null ) {
1103	+ $str .= '<ebl:ItemQuantity>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ItemQuantity ) . '</ebl:ItemQuantity>';
1104	+ }
1105	+
1106	+ return $str;
1107	+ }
1108	+
1109	+
1110	+ }
1111	+
1112	+
1113	+ /**
1114	+ *
1115	+ */
1116	+ class IncentiveBucketType
1117	+ {
1118	+
1119	+ /**
1120	+ *
1121	+ * @array
1122	+ * @access public
1123	+ * @var IncentiveItemType
1124	+ */
1125	+ public $Items;
1126	+
1127	+ /**
1128	+ *
1129	+ * @access public
1130	+ * @var string
1131	+ */
1132	+ public $BucketId;
1133	+
1134	+ /**
1135	+ *
1136	+ * @access public
1137	+ * @var string
1138	+ */
1139	+ public $SellerId;
1140	+
1141	+ /**
1142	+ *
1143	+ * @access public
1144	+ * @var string
1145	+ */
1146	+ public $ExternalSellerId;
1147	+
1148	+ /**
1149	+ *
1150	+ * @access public
1151	+ * @var BasicAmountType
1152	+ */
1153	+ public $BucketSubtotalAmt;
1154	+
1155	+ /**
1156	+ *
1157	+ * @access public
1158	+ * @var BasicAmountType
1159	+ */
1160	+ public $BucketShippingAmt;
1161	+
1162	+ /**
1163	+ *
1164	+ * @access public
1165	+ * @var BasicAmountType
1166	+ */
1167	+ public $BucketInsuranceAmt;
1168	+
1169	+ /**
1170	+ *
1171	+ * @access public
1172	+ * @var BasicAmountType
1173	+ */
1174	+ public $BucketSalesTaxAmt;
1175	+
1176	+ /**
1177	+ *
1178	+ * @access public
1179	+ * @var BasicAmountType
1180	+ */
1181	+ public $BucketTotalAmt;
1182	+
1183	+
1184	+ public function toXMLString()
1185	+ {
1186	+ $str = '';
1187	+ if ( $this->Items != null ) {
1188	+ for ( $i = 0; $i < count( $this->Items ); $i++ ) {
1189	+ $str .= '<ebl:Items>';
1190	+ $str .= $this->Items[ $i ]->toXMLString();
1191	+ $str .= '</ebl:Items>';
1192	+ }
1193	+ }
1194	+ if ( $this->BucketId != null ) {
1195	+ $str .= '<ebl:BucketId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BucketId ) . '</ebl:BucketId>';
1196	+ }
1197	+ if ( $this->SellerId != null ) {
1198	+ $str .= '<ebl:SellerId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SellerId ) . '</ebl:SellerId>';
1199	+ }
1200	+ if ( $this->ExternalSellerId != null ) {
1201	+ $str .= '<ebl:ExternalSellerId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ExternalSellerId ) . '</ebl:ExternalSellerId>';
1202	+ }
1203	+ if ( $this->BucketSubtotalAmt != null ) {
1204	+ $str .= '<ebl:BucketSubtotalAmt';
1205	+ $str .= $this->BucketSubtotalAmt->toXMLString();
1206	+ $str .= '</ebl:BucketSubtotalAmt>';
1207	+ }
1208	+ if ( $this->BucketShippingAmt != null ) {
1209	+ $str .= '<ebl:BucketShippingAmt';
1210	+ $str .= $this->BucketShippingAmt->toXMLString();
1211	+ $str .= '</ebl:BucketShippingAmt>';
1212	+ }
1213	+ if ( $this->BucketInsuranceAmt != null ) {
1214	+ $str .= '<ebl:BucketInsuranceAmt';
1215	+ $str .= $this->BucketInsuranceAmt->toXMLString();
1216	+ $str .= '</ebl:BucketInsuranceAmt>';
1217	+ }
1218	+ if ( $this->BucketSalesTaxAmt != null ) {
1219	+ $str .= '<ebl:BucketSalesTaxAmt';
1220	+ $str .= $this->BucketSalesTaxAmt->toXMLString();
1221	+ $str .= '</ebl:BucketSalesTaxAmt>';
1222	+ }
1223	+ if ( $this->BucketTotalAmt != null ) {
1224	+ $str .= '<ebl:BucketTotalAmt';
1225	+ $str .= $this->BucketTotalAmt->toXMLString();
1226	+ $str .= '</ebl:BucketTotalAmt>';
1227	+ }
1228	+
1229	+ return $str;
1230	+ }
1231	+
1232	+
1233	+ }
1234	+
1235	+
1236	+ /**
1237	+ *
1238	+ */
1239	+ class IncentiveRequestDetailsType
1240	+ {
1241	+
1242	+ /**
1243	+ *
1244	+ * @access public
1245	+ * @var string
1246	+ */
1247	+ public $RequestId;
1248	+
1249	+ /**
1250	+ *
1251	+ * @access public
1252	+ * @var IncentiveRequestCodeType
1253	+ */
1254	+ public $RequestType;
1255	+
1256	+ /**
1257	+ *
1258	+ * @access public
1259	+ * @var IncentiveRequestDetailLevelCodeType
1260	+ */
1261	+ public $RequestDetailLevel;
1262	+
1263	+
1264	+ public function toXMLString()
1265	+ {
1266	+ $str = '';
1267	+ if ( $this->RequestId != null ) {
1268	+ $str .= '<ebl:RequestId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->RequestId ) . '</ebl:RequestId>';
1269	+ }
1270	+ if ( $this->RequestType != null ) {
1271	+ $str .= '<ebl:RequestType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->RequestType ) . '</ebl:RequestType>';
1272	+ }
1273	+ if ( $this->RequestDetailLevel != null ) {
1274	+ $str .= '<ebl:RequestDetailLevel>' . PPUtils::escapeInvalidXmlCharsRegex( $this->RequestDetailLevel ) . '</ebl:RequestDetailLevel>';
1275	+ }
1276	+
1277	+ return $str;
1278	+ }
1279	+
1280	+
1281	+ }
1282	+
1283	+
1284	+ /**
1285	+ *
1286	+ */
1287	+ class GetIncentiveEvaluationRequestDetailsType
1288	+ {
1289	+
1290	+ /**
1291	+ *
1292	+ * @access public
1293	+ * @var string
1294	+ */
1295	+ public $ExternalBuyerId;
1296	+
1297	+ /**
1298	+ *
1299	+ * @array
1300	+ * @access public
1301	+ * @var string
1302	+ */
1303	+ public $IncentiveCodes;
1304	+
1305	+ /**
1306	+ *
1307	+ * @array
1308	+ * @access public
1309	+ * @var IncentiveApplyIndicationType
1310	+ */
1311	+ public $ApplyIndication;
1312	+
1313	+ /**
1314	+ *
1315	+ * @array
1316	+ * @access public
1317	+ * @var IncentiveBucketType
1318	+ */
1319	+ public $Buckets;
1320	+
1321	+ /**
1322	+ *
1323	+ * @access public
1324	+ * @var BasicAmountType
1325	+ */
1326	+ public $CartTotalAmt;
1327	+
1328	+ /**
1329	+ *
1330	+ * @access public
1331	+ * @var IncentiveRequestDetailsType
1332	+ */
1333	+ public $RequestDetails;
1334	+
1335	+
1336	+ public function toXMLString()
1337	+ {
1338	+ $str = '';
1339	+ if ( $this->ExternalBuyerId != null ) {
1340	+ $str .= '<ebl:ExternalBuyerId>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ExternalBuyerId ) . '</ebl:ExternalBuyerId>';
1341	+ }
1342	+ if ( $this->IncentiveCodes != null ) {
1343	+ for ( $i = 0; $i < count( $this->IncentiveCodes ); $i++ ) {
1344	+ $str .= '<ebl:IncentiveCodes>' . PPUtils::escapeInvalidXmlCharsRegex( $this->IncentiveCodes[ $i ] ) . '</ebl:IncentiveCodes>';
1345	+ }
1346	+ }
1347	+ if ( $this->ApplyIndication != null ) {
1348	+ for ( $i = 0; $i < count( $this->ApplyIndication ); $i++ ) {
1349	+ $str .= '<ebl:ApplyIndication>';
1350	+ $str .= $this->ApplyIndication[ $i ]->toXMLString();
1351	+ $str .= '</ebl:ApplyIndication>';
1352	+ }
1353	+ }
1354	+ if ( $this->Buckets != null ) {
1355	+ for ( $i = 0; $i < count( $this->Buckets ); $i++ ) {
1356	+ $str .= '<ebl:Buckets>';
1357	+ $str .= $this->Buckets[ $i ]->toXMLString();
1358	+ $str .= '</ebl:Buckets>';
1359	+ }
1360	+ }
1361	+ if ( $this->CartTotalAmt != null ) {
1362	+ $str .= '<ebl:CartTotalAmt';
1363	+ $str .= $this->CartTotalAmt->toXMLString();
1364	+ $str .= '</ebl:CartTotalAmt>';
1365	+ }
1366	+ if ( $this->RequestDetails != null ) {
1367	+ $str .= '<ebl:RequestDetails>';
1368	+ $str .= $this->RequestDetails->toXMLString();
1369	+ $str .= '</ebl:RequestDetails>';
1370	+ }
1371	+
1372	+ return $str;
1373	+ }
1374	+
1375	+
1376	+ }
1377	+
1378	+
1379	+ /**
1380	+ *
1381	+ */
1382	+ class GetIncentiveEvaluationResponseDetailsType
1383	+ {
1384	+
1385	+ /**
1386	+ *
1387	+ * @array
1388	+ * @access public
1389	+ * @var IncentiveDetailType
1390	+ */
1391	+ public $IncentiveDetails;
1392	+
1393	+ /**
1394	+ *
1395	+ * @access public
1396	+ * @var string
1397	+ */
1398	+ public $RequestId;
1399	+
1400	+
1401	+ public function init( $arr = null )
1402	+ {
1403	+ if ( $arr != null ) {
1404	+ foreach ( $arr as $arry ) {
1405	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) ) {
1406	+ $i = 0;
1407	+ while ( true ) {
1408	+ if ( $arry[ "name" ] == "incentivedetails[$i]" ) {
1409	+ $this->IncentiveDetails[ $i ] = new IncentiveDetailType();
1410	+ $this->IncentiveDetails[ $i ]->init( $arry[ "children" ] );
1411	+ } else {
1412	+ break;
1413	+ }
1414	+ $i++;
1415	+ }
1416	+ }
1417	+ if ( is_array( $arry[ "children" ] ) && ( ( $arry[ "children" ] ) != null ) && ( $arry[ "name" ] == "incentivedetails" ) ) {
1418	+ $this->IncentiveDetails = new IncentiveDetailType();
1419	+ $this->IncentiveDetails->init( $arry[ "children" ] );
1420	+ }
1421	+ if ( $arry != null && isset( $arry[ 'text' ] ) && $arry[ 'name' ] == 'requestid' ) {
1422	+ $this->RequestId = $arry[ "text" ];
1423	+ }
1424	+ }
1425	+ }
1426	+ }
1427	+ }
1428	+
1429	+
1430	+ /**
1431	+ * The total cost of the order to the customer. If shipping
1432	+ * cost and tax charges are known, include them in OrderTotal;
1433	+ * if not, OrderTotal should be the current sub-total of the
1434	+ * order. You must set the currencyID attribute to one of the
1435	+ * three-character currency codes for any of the supported
1436	+ * PayPal currencies. Limitations: Must not exceed $10,000 USD
1437	+ * in any currency. No currency symbol. Decimal separator must
1438	+ * be a period (.), and the thousands separator must be a comma
1439	+ * (,).
1440	+ */
1441	+ class SetExpressCheckoutRequestDetailsType
1442	+ {
1443	+
1444	+ /**
1445	+ * The total cost of the order to the customer. If shipping
1446	+ * cost and tax charges are known, include them in OrderTotal;
1447	+ * if not, OrderTotal should be the current sub-total of the
1448	+ * order. You must set the currencyID attribute to one of the
1449	+ * three-character currency codes for any of the supported
1450	+ * PayPal currencies. Limitations: Must not exceed $10,000 USD
1451	+ * in any currency. No currency symbol. Decimal separator must
1452	+ * be a period (.), and the thousands separator must be a comma
1453	+ * (,).
1454	+ * @access public
1455	+ * @var BasicAmountType
1456	+ */
1457	+ public $OrderTotal;
1458	+
1459	+ /**
1460	+ * URL to which the customer's browser is returned after
1461	+ * choosing to pay with PayPal. PayPal recommends that the
1462	+ * value of ReturnURL be the final review page on which the
1463	+ * customer confirms the order and payment. Required Character
1464	+ * length and limitations: no limit.
1465	+ * @access public
1466	+ * @var string
1467	+ */
1468	+ public $ReturnURL;
1469	+
1470	+ /**
1471	+ * URL to which the customer is returned if he does not approve
1472	+ * the use of PayPal to pay you. PayPal recommends that the
1473	+ * value of CancelURL be the original page on which the
1474	+ * customer chose to pay with PayPal. Required Character length
1475	+ * and limitations: no limit
1476	+ * @access public
1477	+ * @var string
1478	+ */
1479	+ public $CancelURL;
1480	+
1481	+ /**
1482	+ * Tracking URL for ebay. Required Character length and
1483	+ * limitations: no limit
1484	+ * @access public
1485	+ * @var string
1486	+ */
1487	+ public $TrackingImageURL;
1488	+
1489	+ /**
1490	+ * URL to which the customer's browser is returned after paying
1491	+ * with giropay online. Optional Character length and
1492	+ * limitations: no limit.
1493	+ * @access public
1494	+ * @var string
1495	+ */
1496	+ public $giropaySuccessURL;
1497	+
1498	+ /**
1499	+ * URL to which the customer's browser is returned after fail
1500	+ * to pay with giropay online. Optional Character length and
1501	+ * limitations: no limit.
1502	+ * @access public
1503	+ * @var string
1504	+ */
1505	+ public $giropayCancelURL;
1506	+
1507	+ /**
1508	+ * URL to which the customer's browser can be returned in the
1509	+ * mEFT done page. Optional Character length and limitations:
1510	+ * no limit.
1511	+ * @access public
1512	+ * @var string
1513	+ */
1514	+ public $BanktxnPendingURL;
1515	+
1516	+ /**
1517	+ * On your first invocation of SetExpressCheckoutRequest, the
1518	+ * value of this token is returned by
1519	+ * SetExpressCheckoutResponse. Optional Include this element
1520	+ * and its value only if you want to modify an existing
1521	+ * checkout session with another invocation of
1522	+ * SetExpressCheckoutRequest; for example, if you want the
1523	+ * customer to edit his shipping address on PayPal. Character
1524	+ * length and limitations: 20 single-byte characters
1525	+ * @access public
1526	+ * @var string
1527	+ */
1528	+ public $Token;
1529	+
1530	+ /**
1531	+ * The expected maximum total amount of the complete order,
1532	+ * including shipping cost and tax charges. Optional You must
1533	+ * set the currencyID attribute to one of the three-character
1534	+ * currency codes for any of the supported PayPal currencies.
1535	+ * Limitations: Must not exceed $10,000 USD in any currency. No
1536	+ * currency symbol. Decimal separator must be a period (.), and
1537	+ * the thousands separator must be a comma (,).
1538	+ * @access public
1539	+ * @var BasicAmountType
1540	+ */
1541	+ public $MaxAmount;
1542	+
1543	+ /**
1544	+ * Description of items the customer is purchasing. Optional
1545	+ * Character length and limitations: 127 single-byte
1546	+ * alphanumeric characters
1547	+ * @access public
1548	+ * @var string
1549	+ */
1550	+ public $OrderDescription;
1551	+
1552	+ /**
1553	+ * A free-form field for your own use, such as a tracking
1554	+ * number or other value you want PayPal to return on
1555	+ * GetExpressCheckoutDetailsResponse and
1556	+ * DoExpressCheckoutPaymentResponse. Optional Character length
1557	+ * and limitations: 256 single-byte alphanumeric characters
1558	+ * @access public
1559	+ * @var string
1560	+ */
1561	+ public $Custom;
1562	+
1563	+ /**
1564	+ * Your own unique invoice or tracking number. PayPal returns
1565	+ * this value to you on DoExpressCheckoutPaymentResponse.
1566	+ * Optional Character length and limitations: 127 single-byte
1567	+ * alphanumeric characters
1568	+ * @access public
1569	+ * @var string
1570	+ */
1571	+ public $InvoiceID;
1572	+
1573	+ /**
1574	+ * The value 1 indicates that you require that the customer's
1575	+ * shipping address on file with PayPal be a confirmed address.
1576	+ * Any value other than 1 indicates that the customer's
1577	+ * shipping address on file with PayPal need NOT be a confirmed
1578	+ * address. Setting this element overrides the setting you have
1579	+ * specified in the recipient's Merchant Account Profile.
1580	+ * Optional Character length and limitations: One single-byte
1581	+ * numeric character.
1582	+ * @access public
1583	+ * @var string
1584	+ */
1585	+ public $ReqConfirmShipping;
1586	+
1587	+ /**
1588	+ * The value 1 indicates that you require that the customer's
1589	+ * billing address on file. Setting this element overrides the
1590	+ * setting you have specified in Admin. Optional Character
1591	+ * length and limitations: One single-byte numeric character.
1592	+ * @access public
1593	+ * @var string
1594	+ */
1595	+ public $ReqBillingAddress;
1596	+
1597	+ /**
1598	+ * The billing address for the buyer. Optional If you include
1599	+ * the BillingAddress element, the AddressType elements are
1600	+ * required: Name Street1 CityName CountryCode Do not set set
1601	+ * the CountryName element.
1602	+ * @access public
1603	+ * @var AddressType
1604	+ */
1605	+ public $BillingAddress;
1606	+
1607	+ /**
1608	+ * The value 1 indicates that on the PayPal pages, no shipping
1609	+ * address fields should be displayed whatsoever. Optional
1610	+ * Character length and limitations: Four single-byte numeric
1611	+ * characters.
1612	+ * @access public
1613	+ * @var string
1614	+ */
1615	+ public $NoShipping;
1616	+
1617	+ /**
1618	+ * The value 1 indicates that the PayPal pages should display
1619	+ * the shipping address set by you in the Address element on
1620	+ * this SetExpressCheckoutRequest, not the shipping address on
1621	+ * file with PayPal for this customer. Displaying the PayPal
1622	+ * street address on file does not allow the customer to edit
1623	+ * that address. Optional Character length and limitations:
1624	+ * Four single-byte numeric characters.
1625	+ * @access public
1626	+ * @var string
1627	+ */
1628	+ public $AddressOverride;
1629	+
1630	+ /**
1631	+ * Locale of pages displayed by PayPal during Express Checkout.
1632	+ * Optional Character length and limitations: Five single-byte
1633	+ * alphabetic characters, upper- or lowercase. Allowable
1634	+ * values: AU or en_AUDE or de_DEFR or fr_FRGB or en_GBIT or
1635	+ * it_ITJP or ja_JPUS or en_US
1636	+ * @access public
1637	+ * @var string
1638	+ */
1639	+ public $LocaleCode;
1640	+
1641	+ /**
1642	+ * Sets the Custom Payment Page Style for payment pages
1643	+ * associated with this button/link. PageStyle corresponds to
1644	+ * the HTML variable page_style for customizing payment pages.
1645	+ * The value is the same as the Page Style Name you chose when
1646	+ * adding or editing the page style from the Profile subtab of
1647	+ * the My Account tab of your PayPal account. Optional
1648	+ * Character length and limitations: 30 single-byte alphabetic
1649	+ * characters.
1650	+ * @access public
1651	+ * @var string
1652	+ */
1653	+ public $PageStyle;
1654	+
1655	+ /**
1656	+ * A URL for the image you want to appear at the top left of
1657	+ * the payment page. The image has a maximum size of 750 pixels
1658	+ * wide by 90 pixels high. PayPal recommends that you provide
1659	+ * an image that is stored on a secure (https) server. Optional
1660	+ * Character length and limitations: 127
1661	+ * @access public
1662	+ * @var string
1663	+ */
1664	+ public $cppheaderimage;
1665	+
1666	+ /**
1667	+ * Sets the border color around the header of the payment page.
1668	+ * The border is a 2-pixel perimeter around the header space,
1669	+ * which is 750 pixels wide by 90 pixels high. Optional
1670	+ * Character length and limitations: Six character HTML
1671	+ * hexadecimal color code in ASCII
1672	+ * @access public
1673	+ * @var string
1674	+ */
1675	+ public $cppheaderbordercolor;
1676	+
1677	+ /**
1678	+ * Sets the background color for the header of the payment
1679	+ * page. Optional Character length and limitation: Six
1680	+ * character HTML hexadecimal color code in ASCII
1681	+ * @access public
1682	+ * @var string
1683	+ */
1684	+ public $cppheaderbackcolor;
1685	+
1686	+ /**
1687	+ * Sets the background color for the payment page. Optional
1688	+ * Character length and limitation: Six character HTML
1689	+ * hexadecimal color code in ASCII
1690	+ * @access public
1691	+ * @var string
1692	+ */
1693	+ public $cpppayflowcolor;
1694	+
1695	+ /**
1696	+ * Sets the cart gradient color for the Mini Cart on 1X flow.
1697	+ * Optional Character length and limitation: Six character HTML
1698	+ * hexadecimal color code in ASCII
1699	+ * @access public
1700	+ * @var string
1701	+ */
1702	+ public $cppcartbordercolor;
1703	+
1704	+ /**
1705	+ * A URL for the image you want to appear above the mini-cart.
1706	+ * The image has a maximum size of 190 pixels wide by 60 pixels
1707	+ * high. PayPal recommends that you provide an image that is
1708	+ * stored on a secure (https) server. Optional Character length
1709	+ * and limitations: 127
1710	+ * @access public
1711	+ * @var string
1712	+ */
1713	+ public $cpplogoimage;
1714	+
1715	+ /**
1716	+ * Customer's shipping address. Optional If you include a
1717	+ * shipping address and set the AddressOverride element on the
1718	+ * request, PayPal returns this same address in
1719	+ * GetExpressCheckoutDetailsResponse.
1720	+ * @access public
1721	+ * @var AddressType
1722	+ */
1723	+ public $Address;
1724	+
1725	+ /**
1726	+ * How you want to obtain payment. Required Authorization
1727	+ * indicates that this payment is a basic authorization subject
1728	+ * to settlement with PayPal Authorization and Capture. Order
1729	+ * indicates that this payment is is an order authorization
1730	+ * subject to settlement with PayPal Authorization and Capture.
1731	+ * Sale indicates that this is a final sale for which you are
1732	+ * requesting payment. IMPORTANT: You cannot set PaymentAction
1733	+ * to Sale or Order on SetExpressCheckoutRequest and then
1734	+ * change PaymentAction to Authorization on the final Express
1735	+ * Checkout API, DoExpressCheckoutPaymentRequest. Character
1736	+ * length and limit: Up to 13 single-byte alphabetic characters
1737	+ * @access public
1738	+ * @var PaymentActionCodeType
1739	+ */
1740	+ public $PaymentAction;
1741	+
1742	+ /**
1743	+ * This will indicate which flow you are choosing
1744	+ * (expresschecheckout or expresscheckout optional) Optional
1745	+ * None Sole indicates that you are in the ExpressO flow Mark
1746	+ * indicates that you are in the old express flow.
1747	+ * @access public
1748	+ * @var SolutionTypeType
1749	+ */
1750	+ public $SolutionType;
1751	+
1752	+ /**
1753	+ * This indicates Which page to display for ExpressO (Billing
1754	+ * or Login) Optional None Billing indicates that you are not a
1755	+ * paypal account holder Login indicates that you are a paypal
1756	+ * account holder
1757	+ * @access public
1758	+ * @var LandingPageType
1759	+ */
1760	+ public $LandingPage;
1761	+
1762	+ /**
1763	+ * Email address of the buyer as entered during checkout.
1764	+ * PayPal uses this value to pre-fill the PayPal membership
1765	+ * sign-up portion of the PayPal login page. Optional Character
1766	+ * length and limit: 127 single-byte alphanumeric characters
1767	+ * @access public
1768	+ * @var string
1769	+ */
1770	+ public $BuyerEmail;
1771	+
1772	+ /**
1773	+ *
1774	+ * @access public
1775	+ * @var ChannelType
1776	+ */
1777	+ public $ChannelType;
1778	+
1779	+ /**
1780	+ *
1781	+ * @array
1782	+ * @access public
1783	+ * @var BillingAgreementDetailsType
1784	+ */
1785	+ public $BillingAgreementDetails;
1786	+
1787	+ /**
1788	+ * Promo Code Optional List of promo codes supplied by
1789	+ * merchant. These promo codes enable the Merchant Services
1790	+ * Promotion Financing feature.
1791	+ * @array
1792	+ * @access public
1793	+ * @var string
1794	+ */
1795	+ public $PromoCodes;
1796	+
1797	+ /**
1798	+ * Default Funding option for PayLater Checkout button.
1799	+ * @access public
1800	+ * @var string
1801	+ */
1802	+ public $PayPalCheckOutBtnType;
1803	+
1804	+ /**
1805	+ *
1806	+ * @access public
1807	+ * @var ProductCategoryType
1808	+ */
1809	+ public $ProductCategory;
1810	+
1811	+ /**
1812	+ *
1813	+ * @access public
1814	+ * @var ShippingServiceCodeType
1815	+ */
1816	+ public $ShippingMethod;
1817	+
1818	+ /**
1819	+ * Date and time (in GMT in the format yyyy-MM-ddTHH:mm:ssZ) at
1820	+ * which address was changed by the user.
1821	+ * @access public
1822	+ * @var dateTime
1823	+ */
1824	+ public $ProfileAddressChangeDate;
1825	+
1826	+ /**
1827	+ * The value 1 indicates that the customer may enter a note to
1828	+ * the merchant on the PayPal page during checkout. The note is
1829	+ * returned in the GetExpressCheckoutDetails response and the
1830	+ * DoExpressCheckoutPayment response. Optional Character length
1831	+ * and limitations: One single-byte numeric character.
1832	+ * Allowable values: 0,1
1833	+ * @access public
1834	+ * @var string
1835	+ */
1836	+ public $AllowNote;
1837	+
1838	+ /**
1839	+ * Funding source preferences.
1840	+ * @access public
1841	+ * @var FundingSourceDetailsType
1842	+ */
1843	+ public $FundingSourceDetails;
1844	+
1845	+ /**
1846	+ * The label that needs to be displayed on the cancel links in
1847	+ * the PayPal hosted checkout pages. Optional Character length
1848	+ * and limit: 127 single-byte alphanumeric characters
1849	+ * @access public
1850	+ * @var string
1851	+ */
1852	+ public $BrandName;
1853	+
1854	+ /**
1855	+ * URL for PayPal to use to retrieve shipping, handling,
1856	+ * insurance, and tax details from your website. Optional
1857	+ * Character length and limitations: 2048 characters.
1858	+ * @access public
1859	+ * @var string
1860	+ */
1861	+ public $CallbackURL;
1862	+
1863	+ /**
1864	+ * Enhanced data for different industry segments. Optional
1865	+ * @access public
1866	+ * @var EnhancedCheckoutDataType
1867	+ */
1868	+ public $EnhancedCheckoutData;
1869	+
1870	+ /**
1871	+ * List of other payment methods the user can pay with.
1872	+ * Optional Refer to the OtherPaymentMethodDetailsType for more
1873	+ * details.
1874	+ * @array
1875	+ * @access public
1876	+ * @var OtherPaymentMethodDetailsType
1877	+ */
1878	+ public $OtherPaymentMethods;
1879	+
1880	+ /**
1881	+ * Details about the buyer's account. Optional Refer to the
1882	+ * BuyerDetailsType for more details.
1883	+ * @access public
1884	+ * @var BuyerDetailsType
1885	+ */
1886	+ public $BuyerDetails;
1887	+
1888	+ /**
1889	+ * Information about the payment.
1890	+ * @array
1891	+ * @access public
1892	+ * @var PaymentDetailsType
1893	+ */
1894	+ public $PaymentDetails;
1895	+
1896	+ /**
1897	+ * List of Fall Back Shipping options provided by merchant.
1898	+ * @array
1899	+ * @access public
1900	+ * @var ShippingOptionType
1901	+ */
1902	+ public $FlatRateShippingOptions;
1903	+
1904	+ /**
1905	+ * Information about the call back timeout override.
1906	+ * @access public
1907	+ * @var string
1908	+ */
1909	+ public $CallbackTimeout;
1910	+
1911	+ /**
1912	+ * Information about the call back version.
1913	+ * @access public
1914	+ * @var string
1915	+ */
1916	+ public $CallbackVersion;
1917	+
1918	+ /**
1919	+ * Information about the Customer service number.
1920	+ * @access public
1921	+ * @var string
1922	+ */
1923	+ public $CustomerServiceNumber;
1924	+
1925	+ /**
1926	+ * Information about the Gift message enable.
1927	+ * @access public
1928	+ * @var string
1929	+ */
1930	+ public $GiftMessageEnable;
1931	+
1932	+ /**
1933	+ * Information about the Gift receipt enable.
1934	+ * @access public
1935	+ * @var string
1936	+ */
1937	+ public $GiftReceiptEnable;
1938	+
1939	+ /**
1940	+ * Information about the Gift Wrap enable.
1941	+ * @access public
1942	+ * @var string
1943	+ */
1944	+ public $GiftWrapEnable;
1945	+
1946	+ /**
1947	+ * Information about the Gift Wrap name.
1948	+ * @access public
1949	+ * @var string
1950	+ */
1951	+ public $GiftWrapName;
1952	+
1953	+ /**
1954	+ * Information about the Gift Wrap amount.
1955	+ * @access public
1956	+ * @var BasicAmountType
1957	+ */
1958	+ public $GiftWrapAmount;
1959	+
1960	+ /**
1961	+ * Information about the Buyer email option enable .
1962	+ * @access public
1963	+ * @var string
1964	+ */
1965	+ public $BuyerEmailOptInEnable;
1966	+
1967	+ /**
1968	+ * Information about the survey enable.
1969	+ * @access public
1970	+ * @var string
1971	+ */
1972	+ public $SurveyEnable;
1973	+
1974	+ /**
1975	+ * Information about the survey question.
1976	+ * @access public
1977	+ * @var string
1978	+ */
1979	+ public $SurveyQuestion;
1980	+
1981	+ /**
1982	+ * Information about the survey choices for survey question.
1983	+ * @array
1984	+ * @access public
1985	+ * @var string
1986	+ */
1987	+ public $SurveyChoice;
1988	+
1989	+ /**
1990	+ *
1991	+ * @access public
1992	+ * @var TotalType
1993	+ */
1994	+ public $TotalType;
1995	+
1996	+ /**
1997	+ * Any message the seller would like to be displayed in the
1998	+ * Mini Cart for UX.
1999	+ * @access public
2000	+ * @var string
2001	+ */
2002	+ public $NoteToBuyer;
2003	+
2004	+ /**
2005	+ * Incentive Code Optional List of incentive codes supplied by
2006	+ * ebay/merchant.
2007	+ * @array
2008	+ * @access public
2009	+ * @var IncentiveInfoType
2010	+ */
2011	+ public $Incentives;
2012	+
2013	+ /**
2014	+ * Merchant specified flag which indicates whether to return
2015	+ * Funding Instrument Details in DoEC or not. Optional
2016	+ * @access public
2017	+ * @var string
2018	+ */
2019	+ public $ReqInstrumentDetails;
2020	+
2021	+ /**
2022	+ * This element contains information that allows the merchant
2023	+ * to request to opt into external remember me on behalf of the
2024	+ * buyer or to request login bypass using external remember me.
2025	+ * Note the opt-in details are silently ignored if the
2026	+ * ExternalRememberMeID is present.
2027	+ * @access public
2028	+ * @var ExternalRememberMeOptInDetailsType
2029	+ */
2030	+ public $ExternalRememberMeOptInDetails;
2031	+
2032	+ /**
2033	+ * An optional set of values related to flow-specific details.
2034	+ * @access public
2035	+ * @var FlowControlDetailsType
2036	+ */
2037	+ public $FlowControlDetails;
2038	+
2039	+ /**
2040	+ * An optional set of values related to display-specific
2041	+ * details.
2042	+ * @access public
2043	+ * @var DisplayControlDetailsType
2044	+ */
2045	+ public $DisplayControlDetails;
2046	+
2047	+ /**
2048	+ * An optional set of values related to tracking for external
2049	+ * partner.
2050	+ * @access public
2051	+ * @var ExternalPartnerTrackingDetailsType
2052	+ */
2053	+ public $ExternalPartnerTrackingDetails;
2054	+
2055	+ /**
2056	+ * Optional element that defines relationship between buckets
2057	+ * @array
2058	+ * @access public
2059	+ * @var CoupledBucketsType
2060	+ */
2061	+ public $CoupledBuckets;
2062	+
2063	+
2064	+ public function toXMLString()
2065	+ {
2066	+ $str = '';
2067	+ if ( $this->OrderTotal != null ) {
2068	+ $str .= '<ebl:OrderTotal';
2069	+ $str .= $this->OrderTotal->toXMLString();
2070	+ $str .= '</ebl:OrderTotal>';
2071	+ }
2072	+ if ( $this->ReturnURL != null ) {
2073	+ $str .= '<ebl:ReturnURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ReturnURL ) . '</ebl:ReturnURL>';
2074	+ }
2075	+ if ( $this->CancelURL != null ) {
2076	+ $str .= '<ebl:CancelURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CancelURL ) . '</ebl:CancelURL>';
2077	+ }
2078	+ if ( $this->TrackingImageURL != null ) {
2079	+ $str .= '<ebl:TrackingImageURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->TrackingImageURL ) . '</ebl:TrackingImageURL>';
2080	+ }
2081	+ if ( $this->giropaySuccessURL != null ) {
2082	+ $str .= '<ebl:giropaySuccessURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->giropaySuccessURL ) . '</ebl:giropaySuccessURL>';
2083	+ }
2084	+ if ( $this->giropayCancelURL != null ) {
2085	+ $str .= '<ebl:giropayCancelURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->giropayCancelURL ) . '</ebl:giropayCancelURL>';
2086	+ }
2087	+ if ( $this->BanktxnPendingURL != null ) {
2088	+ $str .= '<ebl:BanktxnPendingURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BanktxnPendingURL ) . '</ebl:BanktxnPendingURL>';
2089	+ }
2090	+ if ( $this->Token != null ) {
2091	+ $str .= '<ebl:Token>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Token ) . '</ebl:Token>';
2092	+ }
2093	+ if ( $this->MaxAmount != null ) {
2094	+ $str .= '<ebl:MaxAmount';
2095	+ $str .= $this->MaxAmount->toXMLString();
2096	+ $str .= '</ebl:MaxAmount>';
2097	+ }
2098	+ if ( $this->OrderDescription != null ) {
2099	+ $str .= '<ebl:OrderDescription>' . PPUtils::escapeInvalidXmlCharsRegex( $this->OrderDescription ) . '</ebl:OrderDescription>';
2100	+ }
2101	+ if ( $this->Custom != null ) {
2102	+ $str .= '<ebl:Custom>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Custom ) . '</ebl:Custom>';
2103	+ }
2104	+ if ( $this->InvoiceID != null ) {
2105	+ $str .= '<ebl:InvoiceID>' . PPUtils::escapeInvalidXmlCharsRegex( $this->InvoiceID ) . '</ebl:InvoiceID>';
2106	+ }
2107	+ if ( $this->ReqConfirmShipping != null ) {
2108	+ $str .= '<ebl:ReqConfirmShipping>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ReqConfirmShipping ) . '</ebl:ReqConfirmShipping>';
2109	+ }
2110	+ if ( $this->ReqBillingAddress != null ) {
2111	+ $str .= '<ebl:ReqBillingAddress>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ReqBillingAddress ) . '</ebl:ReqBillingAddress>';
2112	+ }
2113	+ if ( $this->BillingAddress != null ) {
2114	+ $str .= '<ebl:BillingAddress>';
2115	+ $str .= $this->BillingAddress->toXMLString();
2116	+ $str .= '</ebl:BillingAddress>';
2117	+ }
2118	+ if ( $this->NoShipping != null ) {
2119	+ $str .= '<ebl:NoShipping>' . PPUtils::escapeInvalidXmlCharsRegex( $this->NoShipping ) . '</ebl:NoShipping>';
2120	+ }
2121	+ if ( $this->AddressOverride != null ) {
2122	+ $str .= '<ebl:AddressOverride>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AddressOverride ) . '</ebl:AddressOverride>';
2123	+ }
2124	+ if ( $this->LocaleCode != null ) {
2125	+ $str .= '<ebl:LocaleCode>' . PPUtils::escapeInvalidXmlCharsRegex( $this->LocaleCode ) . '</ebl:LocaleCode>';
2126	+ }
2127	+ if ( $this->PageStyle != null ) {
2128	+ $str .= '<ebl:PageStyle>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PageStyle ) . '</ebl:PageStyle>';
2129	+ }
2130	+ if ( $this->cppheaderimage != null ) {
2131	+ $str .= '<ebl:cpp-header-image>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cppheaderimage ) . '</ebl:cpp-header-image>';
2132	+ }
2133	+ if ( $this->cppheaderbordercolor != null ) {
2134	+ $str .= '<ebl:cpp-header-border-color>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cppheaderbordercolor ) . '</ebl:cpp-header-border-color>';
2135	+ }
2136	+ if ( $this->cppheaderbackcolor != null ) {
2137	+ $str .= '<ebl:cpp-header-back-color>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cppheaderbackcolor ) . '</ebl:cpp-header-back-color>';
2138	+ }
2139	+ if ( $this->cpppayflowcolor != null ) {
2140	+ $str .= '<ebl:cpp-payflow-color>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cpppayflowcolor ) . '</ebl:cpp-payflow-color>';
2141	+ }
2142	+ if ( $this->cppcartbordercolor != null ) {
2143	+ $str .= '<ebl:cpp-cart-border-color>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cppcartbordercolor ) . '</ebl:cpp-cart-border-color>';
2144	+ }
2145	+ if ( $this->cpplogoimage != null ) {
2146	+ $str .= '<ebl:cpp-logo-image>' . PPUtils::escapeInvalidXmlCharsRegex( $this->cpplogoimage ) . '</ebl:cpp-logo-image>';
2147	+ }
2148	+ if ( $this->Address != null ) {
2149	+ $str .= '<ebl:Address>';
2150	+ $str .= $this->Address->toXMLString();
2151	+ $str .= '</ebl:Address>';
2152	+ }
2153	+ if ( $this->PaymentAction != null ) {
2154	+ $str .= '<ebl:PaymentAction>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PaymentAction ) . '</ebl:PaymentAction>';
2155	+ }
2156	+ if ( $this->SolutionType != null ) {
2157	+ $str .= '<ebl:SolutionType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SolutionType ) . '</ebl:SolutionType>';
2158	+ }
2159	+ if ( $this->LandingPage != null ) {
2160	+ $str .= '<ebl:LandingPage>' . PPUtils::escapeInvalidXmlCharsRegex( $this->LandingPage ) . '</ebl:LandingPage>';
2161	+ }
2162	+ if ( $this->BuyerEmail != null ) {
2163	+ $str .= '<ebl:BuyerEmail>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BuyerEmail ) . '</ebl:BuyerEmail>';
2164	+ }
2165	+ if ( $this->ChannelType != null ) {
2166	+ $str .= '<ebl:ChannelType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ChannelType ) . '</ebl:ChannelType>';
2167	+ }
2168	+ if ( $this->BillingAgreementDetails != null ) {
2169	+ for ( $i = 0; $i < count( $this->BillingAgreementDetails ); $i++ ) {
2170	+ $str .= '<ebl:BillingAgreementDetails>';
2171	+ $str .= $this->BillingAgreementDetails[ $i ]->toXMLString();
2172	+ $str .= '</ebl:BillingAgreementDetails>';
2173	+ }
2174	+ }
2175	+ if ( $this->PromoCodes != null ) {
2176	+ for ( $i = 0; $i < count( $this->PromoCodes ); $i++ ) {
2177	+ $str .= '<ebl:PromoCodes>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PromoCodes[ $i ] ) . '</ebl:PromoCodes>';
2178	+ }
2179	+ }
2180	+ if ( $this->PayPalCheckOutBtnType != null ) {
2181	+ $str .= '<ebl:PayPalCheckOutBtnType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PayPalCheckOutBtnType ) . '</ebl:PayPalCheckOutBtnType>';
2182	+ }
2183	+ if ( $this->ProductCategory != null ) {
2184	+ $str .= '<ebl:ProductCategory>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ProductCategory ) . '</ebl:ProductCategory>';
2185	+ }
2186	+ if ( $this->ShippingMethod != null ) {
2187	+ $str .= '<ebl:ShippingMethod>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ShippingMethod ) . '</ebl:ShippingMethod>';
2188	+ }
2189	+ if ( $this->ProfileAddressChangeDate != null ) {
2190	+ $str .= '<ebl:ProfileAddressChangeDate>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ProfileAddressChangeDate ) . '</ebl:ProfileAddressChangeDate>';
2191	+ }
2192	+ if ( $this->AllowNote != null ) {
2193	+ $str .= '<ebl:AllowNote>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AllowNote ) . '</ebl:AllowNote>';
2194	+ }
2195	+ if ( $this->FundingSourceDetails != null ) {
2196	+ $str .= '<ebl:FundingSourceDetails>';
2197	+ $str .= $this->FundingSourceDetails->toXMLString();
2198	+ $str .= '</ebl:FundingSourceDetails>';
2199	+ }
2200	+ if ( $this->BrandName != null ) {
2201	+ $str .= '<ebl:BrandName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BrandName ) . '</ebl:BrandName>';
2202	+ }
2203	+ if ( $this->CallbackURL != null ) {
2204	+ $str .= '<ebl:CallbackURL>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CallbackURL ) . '</ebl:CallbackURL>';
2205	+ }
2206	+ if ( $this->EnhancedCheckoutData != null ) {
2207	+ $str .= '<ebl:EnhancedCheckoutData>';
2208	+ $str .= $this->EnhancedCheckoutData->toXMLString();
2209	+ $str .= '</ebl:EnhancedCheckoutData>';
2210	+ }
2211	+ if ( $this->OtherPaymentMethods != null ) {
2212	+ for ( $i = 0; $i < count( $this->OtherPaymentMethods ); $i++ ) {
2213	+ $str .= '<ebl:OtherPaymentMethods>';
2214	+ $str .= $this->OtherPaymentMethods[ $i ]->toXMLString();
2215	+ $str .= '</ebl:OtherPaymentMethods>';
2216	+ }
2217	+ }
2218	+ if ( $this->BuyerDetails != null ) {
2219	+ $str .= '<ebl:BuyerDetails>';
2220	+ $str .= $this->BuyerDetails->toXMLString();
2221	+ $str .= '</ebl:BuyerDetails>';
2222	+ }
2223	+ if ( $this->PaymentDetails != null ) {
2224	+ for ( $i = 0; $i < count( $this->PaymentDetails ); $i++ ) {
2225	+ $str .= '<ebl:PaymentDetails>';
2226	+ $str .= $this->PaymentDetails[ $i ]->toXMLString();
2227	+ $str .= '</ebl:PaymentDetails>';
2228	+ }
2229	+ }
2230	+ if ( $this->FlatRateShippingOptions != null ) {
2231	+ for ( $i = 0; $i < count( $this->FlatRateShippingOptions ); $i++ ) {
2232	+ $str .= '<ebl:FlatRateShippingOptions>';
2233	+ $str .= $this->FlatRateShippingOptions[ $i ]->toXMLString();
2234	+ $str .= '</ebl:FlatRateShippingOptions>';
2235	+ }
2236	+ }
2237	+ if ( $this->CallbackTimeout != null ) {
2238	+ $str .= '<ebl:CallbackTimeout>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CallbackTimeout ) . '</ebl:CallbackTimeout>';
2239	+ }
2240	+ if ( $this->CallbackVersion != null ) {
2241	+ $str .= '<ebl:CallbackVersion>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CallbackVersion ) . '</ebl:CallbackVersion>';
2242	+ }
2243	+ if ( $this->CustomerServiceNumber != null ) {
2244	+ $str .= '<ebl:CustomerServiceNumber>' . PPUtils::escapeInvalidXmlCharsRegex( $this->CustomerServiceNumber ) . '</ebl:CustomerServiceNumber>';
2245	+ }
2246	+ if ( $this->GiftMessageEnable != null ) {
2247	+ $str .= '<ebl:GiftMessageEnable>' . PPUtils::escapeInvalidXmlCharsRegex( $this->GiftMessageEnable ) . '</ebl:GiftMessageEnable>';
2248	+ }
2249	+ if ( $this->GiftReceiptEnable != null ) {
2250	+ $str .= '<ebl:GiftReceiptEnable>' . PPUtils::escapeInvalidXmlCharsRegex( $this->GiftReceiptEnable ) . '</ebl:GiftReceiptEnable>';
2251	+ }
2252	+ if ( $this->GiftWrapEnable != null ) {
2253	+ $str .= '<ebl:GiftWrapEnable>' . PPUtils::escapeInvalidXmlCharsRegex( $this->GiftWrapEnable ) . '</ebl:GiftWrapEnable>';
2254	+ }
2255	+ if ( $this->GiftWrapName != null ) {
2256	+ $str .= '<ebl:GiftWrapName>' . PPUtils::escapeInvalidXmlCharsRegex( $this->GiftWrapName ) . '</ebl:GiftWrapName>';
2257	+ }
2258	+ if ( $this->GiftWrapAmount != null ) {
2259	+ $str .= '<ebl:GiftWrapAmount';
2260	+ $str .= $this->GiftWrapAmount->toXMLString();
2261	+ $str .= '</ebl:GiftWrapAmount>';
2262	+ }
2263	+ if ( $this->BuyerEmailOptInEnable != null ) {
2264	+ $str .= '<ebl:BuyerEmailOptInEnable>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BuyerEmailOptInEnable ) . '</ebl:BuyerEmailOptInEnable>';
2265	+ }
2266	+ if ( $this->SurveyEnable != null ) {
2267	+ $str .= '<ebl:SurveyEnable>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SurveyEnable ) . '</ebl:SurveyEnable>';
2268	+ }
2269	+ if ( $this->SurveyQuestion != null ) {
2270	+ $str .= '<ebl:SurveyQuestion>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SurveyQuestion ) . '</ebl:SurveyQuestion>';
2271	+ }
2272	+ if ( $this->SurveyChoice != null ) {
2273	+ for ( $i = 0; $i < count( $this->SurveyChoice ); $i++ ) {
2274	+ $str .= '<ebl:SurveyChoice>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SurveyChoice[ $i ] ) . '</ebl:SurveyChoice>';
2275	+ }
2276	+ }
2277	+ if ( $this->TotalType != null ) {
2278	+ $str .= '<ebl:TotalType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->TotalType ) . '</ebl:TotalType>';
2279	+ }
2280	+ if ( $this->NoteToBuyer != null ) {
2281	+ $str .= '<ebl:NoteToBuyer>' . PPUtils::escapeInvalidXmlCharsRegex( $this->NoteToBuyer ) . '</ebl:NoteToBuyer>';
2282	+ }
2283	+ if ( $this->Incentives != null ) {
2284	+ for ( $i = 0; $i < count( $this->Incentives ); $i++ ) {
2285	+ $str .= '<ebl:Incentives>';
2286	+ $str .= $this->Incentives[ $i ]->toXMLString();
2287	+ $str .= '</ebl:Incentives>';
2288	+ }
2289	+ }
2290	+ if ( $this->ReqInstrumentDetails != null ) {
2291	+ $str .= '<ebl:ReqInstrumentDetails>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ReqInstrumentDetails ) . '</ebl:ReqInstrumentDetails>';
2292	+ }
2293	+ if ( $this->ExternalRememberMeOptInDetails != null ) {
2294	+ $str .= '<ebl:ExternalRememberMeOptInDetails>';
2295	+ $str .= $this->ExternalRememberMeOptInDetails->toXMLString();
2296	+ $str .= '</ebl:ExternalRememberMeOptInDetails>';
2297	+ }
2298	+ if ( $this->FlowControlDetails != null ) {
2299	+ $str .= '<ebl:FlowControlDetails>';
2300	+ $str .= $this->FlowControlDetails->toXMLString();
2301	+ $str .= '</ebl:FlowControlDetails>';
2302	+ }
2303	+ if ( $this->DisplayControlDetails != null ) {
2304	+ $str .= '<ebl:DisplayControlDetails>';
2305	+ $str .= $this->DisplayControlDetails->toXMLString();
2306	+ $str .= '</ebl:DisplayControlDetails>';
2307	+ }
2308	+ if ( $this->ExternalPartnerTrackingDetails != null ) {
2309	+ $str .= '<ebl:ExternalPartnerTrackingDetails>';
2310	+ $str .= $this->ExternalPartnerTrackingDetails->toXMLString();
2311	+ $str .= '</ebl:ExternalPartnerTrackingDetails>';
2312	+ }
2313	+ if ( $this->CoupledBuckets != null ) {
2314	+ for ( $i = 0; $i < count( $this->CoupledBuckets ); $i++ ) {
2315	+ $str .= '<ebl:CoupledBuckets>';
2316	+ $str .= $this->CoupledBuckets[ $i ]->toXMLString();
2317	+ $str .= '</ebl:CoupledBuckets>';
2318	+ }
2319	+ }
2320	+
2321	+ return $str;
2322	+ }
2323	+
2324	+
2325	+ }
2326	+
2327	+
2328	+ /**
2329	+ * On your first invocation of
2330	+ * ExecuteCheckoutOperationsRequest, the value of this token is
2331	+ * returned by ExecuteCheckoutOperationsResponse. Optional
2332	+ * Include this element and its value only if you want to
2333	+ * modify an existing checkout session with another invocation
2334	+ * of ExecuteCheckoutOperationsRequest; for example, if you
2335	+ * want the customer to edit his shipping address on PayPal.
2336	+ * Character length and limitations: 20 single-byte characters
2337	+ */
2338	+ class ExecuteCheckoutOperationsRequestDetailsType
2339	+ {
2340	+
2341	+ /**
2342	+ * On your first invocation of
2343	+ * ExecuteCheckoutOperationsRequest, the value of this token is
2344	+ * returned by ExecuteCheckoutOperationsResponse. Optional
2345	+ * Include this element and its value only if you want to
2346	+ * modify an existing checkout session with another invocation
2347	+ * of ExecuteCheckoutOperationsRequest; for example, if you
2348	+ * want the customer to edit his shipping address on PayPal.
2349	+ * Character length and limitations: 20 single-byte characters
2350	+ * @access public
2351	+ * @var string
2352	+ */
2353	+ public $Token;
2354	+
2355	+ /**
2356	+ * All the Data required to initiate the checkout session is
2357	+ * passed in this element.
2358	+ * @access public
2359	+ * @var SetDataRequestType
2360	+ */
2361	+ public $SetDataRequest;
2362	+
2363	+ /**
2364	+ * If auto authorization is required, this should be passed in
2365	+ * with IsRequested set to yes.
2366	+ * @access public
2367	+ * @var AuthorizationRequestType
2368	+ */
2369	+ public $AuthorizationRequest;
2370	+
2371	+ /**
2372	+ * Constructor with arguments
2373	+ */
2374	+ public function __construct( $SetDataRequest = null )
2375	+ {
2376	+ $this->SetDataRequest = $SetDataRequest;
2377	+ }
2378	+
2379	+
2380	+ public function toXMLString()
2381	+ {
2382	+ $str = '';
2383	+ if ( $this->Token != null ) {
2384	+ $str .= '<ebl:Token>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Token ) . '</ebl:Token>';
2385	+ }
2386	+ if ( $this->SetDataRequest != null ) {
2387	+ $str .= '<ebl:SetDataRequest>';
2388	+ $str .= $this->SetDataRequest->toXMLString();
2389	+ $str .= '</ebl:SetDataRequest>';
2390	+ }
2391	+ if ( $this->AuthorizationRequest != null ) {
2392	+ $str .= '<ebl:AuthorizationRequest>';
2393	+ $str .= $this->AuthorizationRequest->toXMLString();
2394	+ $str .= '</ebl:AuthorizationRequest>';
2395	+ }
2396	+
2397	+ return $str;
2398	+ }
2399	+
2400	+
2401	+ }
2402	+
2403	+
2404	+ /**
2405	+ * Details about Billing Agreements requested to be created.
2406	+ */
2407	+ class SetDataRequestType
2408	+ {
2409	+
2410	+ /**
2411	+ * Details about Billing Agreements requested to be created.
2412	+ * @array
2413	+ * @access public
2414	+ * @var BillingApprovalDetailsType
2415	+ */
2416	+ public $BillingApprovalDetails;
2417	+
2418	+ /**
2419	+ * Only needed if Auto Authorization is requested. The
2420	+ * authentication session token will be passed in here.
2421	+ * @access public
2422	+ * @var BuyerDetailType
2423	+ */
2424	+ public $BuyerDetail;
2425	+
2426	+ /**
2427	+ * Requests for specific buyer information like Billing Address
2428	+ * to be returned through GetExpressCheckoutDetails should be
2429	+ * specified under this.
2430	+ * @access public
2431	+ * @var InfoSharingDirectivesType
2432	+ */
2433	+ public $InfoSharingDirectives;
2434	+
2435	+
2436	+ public function toXMLString()
2437	+ {
2438	+ $str = '';
2439	+ if ( $this->BillingApprovalDetails != null ) {
2440	+ for ( $i = 0; $i < count( $this->BillingApprovalDetails ); $i++ ) {
2441	+ $str .= '<ebl:BillingApprovalDetails>';
2442	+ $str .= $this->BillingApprovalDetails[ $i ]->toXMLString();
2443	+ $str .= '</ebl:BillingApprovalDetails>';
2444	+ }
2445	+ }
2446	+ if ( $this->BuyerDetail != null ) {
2447	+ $str .= '<ebl:BuyerDetail>';
2448	+ $str .= $this->BuyerDetail->toXMLString();
2449	+ $str .= '</ebl:BuyerDetail>';
2450	+ }
2451	+ if ( $this->InfoSharingDirectives != null ) {
2452	+ $str .= '<ebl:InfoSharingDirectives>';
2453	+ $str .= $this->InfoSharingDirectives->toXMLString();
2454	+ $str .= '</ebl:InfoSharingDirectives>';
2455	+ }
2456	+
2457	+ return $str;
2458	+ }
2459	+
2460	+
2461	+ }
2462	+
2463	+
2464	+ /**
2465	+ *
2466	+ */
2467	+ class AuthorizationRequestType
2468	+ {
2469	+
2470	+ /**
2471	+ *
2472	+ * @access public
2473	+ * @var boolean
2474	+ */
2475	+ public $IsRequested;
2476	+
2477	+ /**
2478	+ * Constructor with arguments
2479	+ */
2480	+ public function __construct( $IsRequested = null )
2481	+ {
2482	+ $this->IsRequested = $IsRequested;
2483	+ }
2484	+
2485	+
2486	+ public function toXMLString()
2487	+ {
2488	+ $str = '';
2489	+ if ( $this->IsRequested != null ) {
2490	+ $str .= '<ebl:IsRequested>' . PPUtils::escapeInvalidXmlCharsRegex( $this->IsRequested ) . '</ebl:IsRequested>';
2491	+ }
2492	+
2493	+ return $str;
2494	+ }
2495	+
2496	+
2497	+ }
2498	+
2499	+
2500	+ /**
2501	+ * The Type of Approval requested - Billing Agreement or
2502	+ * Profile
2503	+ */
2504	+ class BillingApprovalDetailsType
2505	+ {
2506	+
2507	+ /**
2508	+ * The Type of Approval requested - Billing Agreement or
2509	+ * Profile
2510	+ * @access public
2511	+ * @var ApprovalTypeType
2512	+ */
2513	+ public $ApprovalType;
2514	+
2515	+ /**
2516	+ * The Approval subtype - Must be MerchantInitiatedBilling for
2517	+ * BillingAgreement ApprovalType
2518	+ * @access public
2519	+ * @var ApprovalSubTypeType
2520	+ */
2521	+ public $ApprovalSubType;
2522	+
2523	+ /**
2524	+ * Description about the Order
2525	+ * @access public
2526	+ * @var OrderDetailsType
2527	+ */
2528	+ public $OrderDetails;
2529	+
2530	+ /**
2531	+ * Directives about the type of payment
2532	+ * @access public
2533	+ * @var PaymentDirectivesType
2534	+ */
2535	+ public $PaymentDirectives;
2536	+
2537	+ /**
2538	+ * Client may pass in its identification of this Billing
2539	+ * Agreement. It used for the client's tracking purposes.
2540	+ * @access public
2541	+ * @var string
2542	+ */
2543	+ public $Custom;
2544	+
2545	+ /**
2546	+ * Constructor with arguments
2547	+ */
2548	+ public function __construct( $ApprovalType = null )
2549	+ {
2550	+ $this->ApprovalType = $ApprovalType;
2551	+ }
2552	+
2553	+
2554	+ public function toXMLString()
2555	+ {
2556	+ $str = '';
2557	+ if ( $this->ApprovalType != null ) {
2558	+ $str .= '<ebl:ApprovalType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ApprovalType ) . '</ebl:ApprovalType>';
2559	+ }
2560	+ if ( $this->ApprovalSubType != null ) {
2561	+ $str .= '<ebl:ApprovalSubType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ApprovalSubType ) . '</ebl:ApprovalSubType>';
2562	+ }
2563	+ if ( $this->OrderDetails != null ) {
2564	+ $str .= '<ebl:OrderDetails>';
2565	+ $str .= $this->OrderDetails->toXMLString();
2566	+ $str .= '</ebl:OrderDetails>';
2567	+ }
2568	+ if ( $this->PaymentDirectives != null ) {
2569	+ $str .= '<ebl:PaymentDirectives>';
2570	+ $str .= $this->PaymentDirectives->toXMLString();
2571	+ $str .= '</ebl:PaymentDirectives>';
2572	+ }
2573	+ if ( $this->Custom != null ) {
2574	+ $str .= '<ebl:Custom>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Custom ) . '</ebl:Custom>';
2575	+ }
2576	+
2577	+ return $str;
2578	+ }
2579	+
2580	+
2581	+ }
2582	+
2583	+
2584	+ /**
2585	+ * If Billing Address should be returned in
2586	+ * GetExpressCheckoutDetails response, this parameter should be
2587	+ * set to yes here
2588	+ */
2589	+ class InfoSharingDirectivesType
2590	+ {
2591	+
2592	+ /**
2593	+ * If Billing Address should be returned in
2594	+ * GetExpressCheckoutDetails response, this parameter should be
2595	+ * set to yes here
2596	+ * @access public
2597	+ * @var string
2598	+ */
2599	+ public $ReqBillingAddress;
2600	+
2601	+
2602	+ public function toXMLString()
2603	+ {
2604	+ $str = '';
2605	+ if ( $this->ReqBillingAddress != null ) {
2606	+ $str .= '<ebl:ReqBillingAddress>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ReqBillingAddress ) . '</ebl:ReqBillingAddress>';
2607	+ }
2608	+
2609	+ return $str;
2610	+ }
2611	+
2612	+
2613	+ }
2614	+
2615	+
2616	+ /**
2617	+ * Description of the Order.
2618	+ */
2619	+ class OrderDetailsType
2620	+ {
2621	+
2622	+ /**
2623	+ * Description of the Order.
2624	+ * @access public
2625	+ * @var string
2626	+ */
2627	+ public $Description;
2628	+
2629	+ /**
2630	+ * Expected maximum amount that the merchant may pull using
2631	+ * DoReferenceTransaction
2632	+ * @access public
2633	+ * @var BasicAmountType
2634	+ */
2635	+ public $MaxAmount;
2636	+
2637	+
2638	+ public function toXMLString()
2639	+ {
2640	+ $str = '';
2641	+ if ( $this->Description != null ) {
2642	+ $str .= '<ebl:Description>' . PPUtils::escapeInvalidXmlCharsRegex( $this->Description ) . '</ebl:Description>';
2643	+ }
2644	+ if ( $this->MaxAmount != null ) {
2645	+ $str .= '<ebl:MaxAmount';
2646	+ $str .= $this->MaxAmount->toXMLString();
2647	+ $str .= '</ebl:MaxAmount>';
2648	+ }
2649	+
2650	+ return $str;
2651	+ }
2652	+
2653	+
2654	+ }
2655	+
2656	+
2657	+ /**
2658	+ * Type of the Payment is it Instant or Echeck or Any.
2659	+ */
2660	+ class PaymentDirectivesType
2661	+ {
2662	+
2663	+ /**
2664	+ * Type of the Payment is it Instant or Echeck or Any.
2665	+ * @access public
2666	+ * @var MerchantPullPaymentCodeType
2667	+ */
2668	+ public $PaymentType;
2669	+
2670	+
2671	+ public function toXMLString()
2672	+ {
2673	+ $str = '';
2674	+ if ( $this->PaymentType != null ) {
2675	+ $str .= '<ebl:PaymentType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PaymentType ) . '</ebl:PaymentType>';
2676	+ }
2677	+
2678	+ return $str;
2679	+ }
2680	+
2681	+
2682	+ }
2683	+
2684	+
2685	+ /**
2686	+ * Information that is used to indentify the Buyer. This is
2687	+ * used for auto authorization. Mandatory if Authorization is
2688	+ * requested.
2689	+ */
2690	+ class BuyerDetailType
2691	+ {
2692	+
2693	+ /**
2694	+ * Information that is used to indentify the Buyer. This is
2695	+ * used for auto authorization. Mandatory if Authorization is
2696	+ * requested.
2697	+ * @access public
2698	+ * @var IdentificationInfoType
2699	+ */
2700	+ public $IdentificationInfo;
2701	+
2702	+
2703	+ public function toXMLString()
2704	+ {
2705	+ $str = '';
2706	+ if ( $this->IdentificationInfo != null ) {
2707	+ $str .= '<ebl:IdentificationInfo>';
2708	+ $str .= $this->IdentificationInfo->toXMLString();
2709	+ $str .= '</ebl:IdentificationInfo>';
2710	+ }
2711	+
2712	+ return $str;
2713	+ }
2714	+
2715	+
2716	+ }
2717	+
2718	+
2719	+ /**
2720	+ * Mobile specific buyer identification.
2721	+ */
2722	+ class IdentificationInfoType
2723	+ {
2724	+
2725	+ /**
2726	+ * Mobile specific buyer identification.
2727	+ * @access public
2728	+ * @var MobileIDInfoType
2729	+ */
2730	+ public $MobileIDInfo;
2731	+
2732	+ /**
2733	+ * Contains login bypass information.
2734	+ * @access public
2735	+ * @var RememberMeIDInfoType
2736	+ */
2737	+ public $RememberMeIDInfo;
2738	+
2739	+ /**
2740	+ * Identity Access Token.
2741	+ * @access public
2742	+ * @var IdentityTokenInfoType
2743	+ */
2744	+ public $IdentityTokenInfo;
2745	+
2746	+
2747	+ public function toXMLString()
2748	+ {
2749	+ $str = '';
2750	+ if ( $this->MobileIDInfo != null ) {
2751	+ $str .= '<ebl:MobileIDInfo>';
2752	+ $str .= $this->MobileIDInfo->toXMLString();
2753	+ $str .= '</ebl:MobileIDInfo>';
2754	+ }
2755	+ if ( $this->RememberMeIDInfo != null ) {
2756	+ $str .= '<ebl:RememberMeIDInfo>';
2757	+ $str .= $this->RememberMeIDInfo->toXMLString();
2758	+ $str .= '</ebl:RememberMeIDInfo>';
2759	+ }
2760	+ if ( $this->IdentityTokenInfo != null ) {
2761	+ $str .= '<ebl:IdentityTokenInfo>';
2762	+ $str .= $this->IdentityTokenInfo->toXMLString();
2763	+ $str .= '</ebl:IdentityTokenInfo>';
2764	+ }
2765	+
2766	+ return $str;
2767	+ }
2768	+
2769	+
2770	+ }
2771	+
2772	+
2773	+ /**
2774	+ * The Session token returned during buyer authentication.
2775	+ */
2776	+ class MobileIDInfoType
2777	+ {
2778	+
2779	+ /**
2780	+ * The Session token returned during buyer authentication.
2781	+ * @access public
2782	+ * @var string
2783	+ */
2784	+ public $SessionToken;
2785	+
2786	+
2787	+ public function toXMLString()
2788	+ {
2789	+ $str = '';
2790	+ if ( $this->SessionToken != null ) {
2791	+ $str .= '<ebl:SessionToken>' . PPUtils::escapeInvalidXmlCharsRegex( $this->SessionToken ) . '</ebl:SessionToken>';
2792	+ }
2793	+
2794	+ return $str;
2795	+ }
2796	+
2797	+
2798	+ }
2799	+
2800	+
2801	+ /**
2802	+ * External remember-me ID returned by
2803	+ * GetExpressCheckoutDetails on successful opt-in. The
2804	+ * ExternalRememberMeID is a 17-character alphanumeric
2805	+ * (encrypted) string that identifies the buyer's remembered
2806	+ * login with a merchant and has meaning only to the merchant.
2807	+ * If present, requests that the web flow attempt bypass of
2808	+ * login.
2809	+ */
2810	+ class RememberMeIDInfoType
2811	+ {
2812	+
2813	+ /**
2814	+ * External remember-me ID returned by
2815	+ * GetExpressCheckoutDetails on successful opt-in. The
2816	+ * ExternalRememberMeID is a 17-character alphanumeric
2817	+ * (encrypted) string that identifies the buyer's remembered
2818	+ * login with a merchant and has meaning only to the merchant.
2819	+ * If present, requests that the web flow attempt bypass of
2820	+ * login.
2821	+ * @access public
2822	+ * @var string
2823	+ */
2824	+ public $ExternalRememberMeID;
2825	+
2826	+
2827	+ public function toXMLString()
2828	+ {
2829	+ $str = '';
2830	+ if ( $this->ExternalRememberMeID != null ) {
2831	+ $str .= '<ebl:ExternalRememberMeID>' . PPUtils::escapeInvalidXmlCharsRegex( $this->ExternalRememberMeID ) . '</ebl:ExternalRememberMeID>';
2832	+ }
2833	+
2834	+ return $str;
2835	+ }
2836	+
2837	+
2838	+ }
2839	+
2840	+
2841	+ /**
2842	+ * Identity Access token from merchant
2843	+ */
2844	+ class IdentityTokenInfoType
2845	+ {
2846	+
2847	+ /**
2848	+ * Identity Access token from merchant
2849	+ * @access public
2850	+ * @var string
2851	+ */
2852	+ public $AccessToken;
2853	+
2854	+ /**
2855	+ * Constructor with arguments
2856	+ */
2857	+ public function __construct( $AccessToken = null )
2858	+ {
2859	+ $this->AccessToken = $AccessToken;
2860	+ }
2861	+
2862	+
2863	+ public function toXMLString()
2864	+ {
2865	+ $str = '';
2866	+ if ( $this->AccessToken != null ) {
2867	+ $str .= '<ebl:AccessToken>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AccessToken ) . '</ebl:AccessToken>';
2868	+ }
2869	+
2870	+ return $str;
2871	+ }
2872	+
2873	+
2874	+ }
2875	+
2876	+
2877	+ /**
2878	+ * Allowable values: 0,1 The value 1 indicates that the
2879	+ * customer can accept push funding, and 0 means they cannot.
2880	+ * Optional Character length and limitations: One single-byte
2881	+ * numeric character.
2882	+ */
2883	+ class FundingSourceDetailsType
2884	+ {
2885	+
2886	+ /**
2887	+ * Allowable values: 0,1 The value 1 indicates that the
2888	+ * customer can accept push funding, and 0 means they cannot.
2889	+ * Optional Character length and limitations: One single-byte
2890	+ * numeric character.
2891	+ * @access public
2892	+ * @var string
2893	+ */
2894	+ public $AllowPushFunding;
2895	+
2896	+ /**
2897	+ * Allowable values: ELV, CreditCard, ChinaUnionPay, BML This
2898	+ * element could be used to specify the perered funding option
2899	+ * for a guest users. It has effect only if LandingPage element
2900	+ * is set to Billing. Otherwise it will be ignored.
2901	+ * @access public
2902	+ * @var UserSelectedFundingSourceType
2903	+ */
2904	+ public $UserSelectedFundingSource;
2905	+
2906	+
2907	+ public function toXMLString()
2908	+ {
2909	+ $str = '';
2910	+ if ( $this->AllowPushFunding != null ) {
2911	+ $str .= '<ebl:AllowPushFunding>' . PPUtils::escapeInvalidXmlCharsRegex( $this->AllowPushFunding ) . '</ebl:AllowPushFunding>';
2912	+ }
2913	+ if ( $this->UserSelectedFundingSource != null ) {
2914	+ $str .= '<ebl:UserSelectedFundingSource>' . PPUtils::escapeInvalidXmlCharsRegex( $this->UserSelectedFundingSource ) . '</ebl:UserSelectedFundingSource>';
2915	+ }
2916	+
2917	+ return $str;
2918	+ }
2919	+
2920	+
2921	+ }
2922	+
2923	+
2924	+ /**
2925	+ *
2926	+ */
2927	+ class BillingAgreementDetailsType
2928	+ {
2929	+
2930	+ /**
2931	+ *
2932	+ * @access public
2933	+ * @var BillingCodeType
2934	+ */
2935	+ public $BillingType;
2936	+
2937	+ /**
2938	+ * Only needed for AutoBill billinng type.
2939	+ * @access public
2940	+ * @var string
2941	+ */
2942	+ public $BillingAgreementDescription;
2943	+
2944	+ /**
2945	+ *
2946	+ * @access public
2947	+ * @var MerchantPullPaymentCodeType
2948	+ */
2949	+ public $PaymentType;
2950	+
2951	+ /**
2952	+ * Custom annotation field for your exclusive use.
2953	+ * @access public
2954	+ * @var string
2955	+ */
2956	+ public $BillingAgreementCustom;
2957	+
2958	+ /**
2959	+ * Constructor with arguments
2960	+ */
2961	+ public function __construct( $BillingType = null )
2962	+ {
2963	+ $this->BillingType = $BillingType;
2964	+ }
2965	+
2966	+
2967	+ public function toXMLString()
2968	+ {
2969	+ $str = '';
2970	+ if ( $this->BillingType != null ) {
2971	+ $str .= '<ebl:BillingType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BillingType ) . '</ebl:BillingType>';
2972	+ }
2973	+ if ( $this->BillingAgreementDescription != null ) {
2974	+ $str .= '<ebl:BillingAgreementDescription>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BillingAgreementDescription ) . '</ebl:BillingAgreementDescription>';
2975	+ }
2976	+ if ( $this->PaymentType != null ) {
2977	+ $str .= '<ebl:PaymentType>' . PPUtils::escapeInvalidXmlCharsRegex( $this->PaymentType ) . '</ebl:PaymentType>';
2978	+ }
2979	+ if ( $this->BillingAgreementCustom != null ) {
2980	+ $str .= '<ebl:BillingAgreementCustom>' . PPUtils::escapeInvalidXmlCharsRegex( $this->BillingAgreementCustom ) . '</ebl:BillingAgreementCustom>';
2981	+ }
2982	+
2983	+ return $str;
2984	+ }
2985	+
2986	+
2987	+ }
2988	+
2989	+
2990	+ /**
2991	+ * The timestamped token value that was returned by
2992	+ * SetExpressCheckoutResponse and passed on
2993	+ * GetExpressCheckoutDetailsRequest. Character length and
2994	+ * limitations: 20 single-byte characters
2995	+ */
2996	+ class GetExpressCheckoutDetailsResponseDetailsType
2997	+ {
2998	+
2999	+ /**
3000	+ * The timestamped token value that was returned by
3001	+ * SetExpressCheckoutResponse and passed on
3002	+ * GetExpressCheckoutDetailsRequest. Character length and
3003	+ * limitations: 20 single-byte characters
3004	+ * @access public
3005	+ * @var string
3006	+ */
3007	+ public $Token;
3008	+
3009	+ /**
3010	+ * Information about the payer
3011	+ * @access public
3012	+ * @var PayerInfoType
3013	+ */
3014	+ public $PayerInfo;
3015	+
3016	+ /**
3017	+ * A free-form field for your own use, as set by you in the
3018	+ * Custom element of SetExpressCheckoutRequest. Character
3019	+ * length and limitations: 256 single-byte alphanumeric
3020	+ * characters
3021	+ * @access public
3022	+ * @var string
3023	+ */
3024	+ public $Custom;
3025	+
3026	+ /**
3027	+ * Your own invoice or tracking number, as set by you in the
3028	+ * InvoiceID element of SetExpressCheckoutRequest. Character
3029	+ * length and limitations: 127 single-byte alphanumeric
3030	+ * characters
3031	+ * @access public
3032	+ * @var string
3033	+ */
3034	+ public $InvoiceID;
3035	+
3036	+ /**
3037	+