Version Description
No Upgrade required at this time.
Download this release
Release Info
| Developer | digitalchild |
| Plugin |  WC Vendors |
| Version | 1.9.11 |
| Comparing to | |
| See all releases | |
Code changes from version 1.9.10 to 1.9.11
- changelog.txt +6 -0
- class-wc-vendors.php +2 -2
- classes/class-shipping.php +2 -2
- classes/class-vendors.php +1 -1
- classes/front/class-vendor-cart.php +1 -1
- classes/front/class-vendor-shop.php +1 -1
- classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php +4 -1
- languages/default.pot +32 -28
- readme.txt +7 -1
- trunk/assets/css/admin-orders.css +7 -0
- trunk/assets/css/select2.min.css +1 -0
- trunk/assets/css/wcv-frontend.css +545 -0
- trunk/assets/images/icons/truck.png +0 -0
- trunk/assets/js/front-orders.js +8 -0
- trunk/assets/js/select2.min.js +3 -0
- trunk/assets/js/wcv-admin-quick-edit.js +34 -0
- trunk/assets/js/wcv-commissions.js +11 -0
- trunk/changelog.txt +582 -0
- trunk/class-wc-vendors.php +419 -0
- trunk/classes/admin/class-admin-page.php +826 -0
- trunk/classes/admin/class-admin-reports.php +549 -0
- trunk/classes/admin/class-admin-users.php +478 -0
- trunk/classes/admin/class-product-meta.php +267 -0
- trunk/classes/admin/class-vendor-admin-dashboard.php +691 -0
- trunk/classes/admin/class-vendor-applicants.php +103 -0
- trunk/classes/admin/class-vendor-reports.php +121 -0
- trunk/classes/admin/emails/class-emails.php +151 -0
- trunk/classes/admin/emails/class-wc-approve-vendor.php +165 -0
- trunk/classes/admin/emails/class-wc-notify-admin.php +176 -0
- trunk/classes/admin/emails/class-wc-notify-shipped.php +201 -0
- trunk/classes/admin/emails/class-wc-notify-vendor.php +352 -0
- trunk/classes/admin/settings/README.md +126 -0
- trunk/classes/admin/settings/assets/css/sf-styles.css +167 -0
- trunk/classes/admin/settings/assets/img/tip.png +0 -0
- trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js +126 -0
- trunk/classes/admin/settings/assets/js/js.iml +10 -0
- trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css +87 -0
- trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif +0 -0
- trunk/classes/admin/settings/assets/js/select2/select2.css +704 -0
- trunk/classes/admin/settings/assets/js/select2/select2.js +3541 -0
- trunk/classes/admin/settings/assets/js/select2/select2.min.js +23 -0
- trunk/classes/admin/settings/assets/js/select2/select2.png +0 -0
- trunk/classes/admin/settings/assets/js/select2/select2x2.png +0 -0
- trunk/classes/admin/settings/assets/js/sf-jquery.js +23 -0
- trunk/classes/admin/settings/assets/js/wcvendors-media.js +52 -0
- trunk/classes/admin/settings/classes/sf-class-format-options.php +347 -0
- trunk/classes/admin/settings/classes/sf-class-sanitize.php +199 -0
- trunk/classes/admin/settings/classes/sf-class-settings.php +978 -0
- trunk/classes/admin/settings/sf-options.php +363 -0
- trunk/classes/admin/views/html-vendor-settings-page.php +76 -0
- trunk/classes/class-commission.php +537 -0
- trunk/classes/class-cron.php +171 -0
- trunk/classes/class-install.php +286 -0
- trunk/classes/class-queries.php +284 -0
- trunk/classes/class-shipping.php +331 -0
- trunk/classes/class-vendor-order.php +71 -0
- trunk/classes/class-vendor-post-types.php +52 -0
- trunk/classes/class-vendors.php +675 -0
- trunk/classes/front/class-vendor-cart.php +70 -0
- trunk/classes/front/class-vendor-shop.php +352 -0
- trunk/classes/front/dashboard/class-vendor-dashboard.php +515 -0
- trunk/classes/front/orders/class-export-csv.php +98 -0
- trunk/classes/front/orders/class-orders.php +362 -0
- trunk/classes/front/orders/class-submit-comment.php +81 -0
- trunk/classes/front/signup/class-vendor-signup.php +174 -0
- trunk/classes/front/signup/views/html-vendor-signup.php +68 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/index.php +0 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/paypalap.png +0 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/index.php +0 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/ChangeLog.txt +33 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/LICENSE.txt +41 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/README.md +57 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/build.xml +24 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/cert_key.pem +31 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/sdk_config.ini +26 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/IPPCredential.php +53 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAPIService.php +62 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAuthenticationManager.php +91 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPBaseService.php +88 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCertificateCredential.php +72 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConfigManager.php +124 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConnectionManager.php +48 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCredentialManager.php +117 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPHttpConnection.php +184 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPLoggingManager.php +84 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPObjectTransformer.php +33 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPSignatureCredential.php +49 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPUtils.php +274 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/AuthUtil.php +83 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/PPAuth.php +1077 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/cacert.pem +171 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConfigurationException.php +9 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConnectionException.php +20 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPInvalidCredentialException.php +22 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPMissingCredentialException.php +22 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPTransformerException.php +20 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePayments.php +5797 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePaymentsService.php +314 -0
- trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/index.php +0 -0
- trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php +562 -0
- trunk/classes/gateways/PayPal_Masspay/api/ChangeLog.txt +48 -0
- trunk/classes/gateways/PayPal_Masspay/api/LICENSE.txt +41 -0
- trunk/classes/gateways/PayPal_Masspay/api/README.md +60 -0
- trunk/classes/gateways/PayPal_Masspay/api/build.xml +24 -0
- trunk/classes/gateways/PayPal_Masspay/api/config/sdk-cert.pem +41 -0
- trunk/classes/gateways/PayPal_Masspay/api/config/sdk_config.ini +39 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/IPPCredential.php +53 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPAPIService.php +62 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPAuthenticationManager.php +99 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPBaseService.php +88 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPCertificateCredential.php +77 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPConfigManager.php +121 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPConnectionManager.php +48 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPCredentialManager.php +119 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPHttpConnection.php +184 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPLoggingManager.php +84 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPObjectTransformer.php +33 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPSignatureCredential.php +56 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/PPUtils.php +284 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/auth/AuthUtil.php +83 -0
- trunk/classes/gateways/PayPal_Masspay/api/lib/auth/PPAuth.php +580 -0
changelog.txt
CHANGED
|
@@ -1,5 +1,11 @@
|
|
| 1 |
Changelog for WC Vendors
|
| 2 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3 |
Version 1.9.10
|
| 4 |
|
| 5 |
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
| 1 |
Changelog for WC Vendors
|
| 2 |
|
| 3 |
+
Version 1.9.11
|
| 4 |
+
|
| 5 |
+
* Fixed: Correct product id being parsed to shipping function
|
| 6 |
+
* Fixed: Payment method notice due to direct access to object property
|
| 7 |
+
* Fixed: Sold by incorrectly showing in cart for variations
|
| 8 |
+
|
| 9 |
Version 1.9.10
|
| 10 |
|
| 11 |
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
class-wc-vendors.php
CHANGED
|
@@ -8,7 +8,7 @@
|
|
| 8 |
* Author URI: https://www.wcvendors.com
|
| 9 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 10 |
*
|
| 11 |
-
* Version: 1.9.
|
| 12 |
* Requires at least: 4.4.0
|
| 13 |
* Tested up to: 4.7.1
|
| 14 |
*
|
|
@@ -72,7 +72,7 @@ if ( wcv_is_woocommerce_activated() ) {
|
|
| 72 |
if ( !defined( 'wcv_plugin_dir_path' ) ) define( 'wcv_plugin_dir_path', untrailingslashit( plugin_dir_path( __FILE__ ) ) );
|
| 73 |
|
| 74 |
|
| 75 |
-
define('WCV_VERSION', '1.9.
|
| 76 |
|
| 77 |
/**
|
| 78 |
* Main Product Vendor class
|
| 8 |
* Author URI: https://www.wcvendors.com
|
| 9 |
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 10 |
*
|
| 11 |
+
* Version: 1.9.11
|
| 12 |
* Requires at least: 4.4.0
|
| 13 |
* Tested up to: 4.7.1
|
| 14 |
*
|
| 72 |
if ( !defined( 'wcv_plugin_dir_path' ) ) define( 'wcv_plugin_dir_path', untrailingslashit( plugin_dir_path( __FILE__ ) ) );
|
| 73 |
|
| 74 |
|
| 75 |
+
define('WCV_VERSION', '1.9.11' );
|
| 76 |
|
| 77 |
/**
|
| 78 |
* Main Product Vendor class
|
classes/class-shipping.php
CHANGED
|
@@ -37,7 +37,7 @@ class WCV_Shipping
|
|
| 37 |
*
|
| 38 |
* @return unknown
|
| 39 |
*/
|
| 40 |
-
public static function get_shipping_due( $order_id, $product, $author )
|
| 41 |
{
|
| 42 |
global $woocommerce;
|
| 43 |
|
|
@@ -87,7 +87,7 @@ class WCV_Shipping
|
|
| 87 |
}
|
| 88 |
}
|
| 89 |
|
| 90 |
-
$shipping_costs = apply_filters( 'wcvendors_shipping_due', $shipping_costs, $order_id, $product, $author );
|
| 91 |
|
| 92 |
return $shipping_costs;
|
| 93 |
}
|
| 37 |
*
|
| 38 |
* @return unknown
|
| 39 |
*/
|
| 40 |
+
public static function get_shipping_due( $order_id, $product, $author, $product_id = 0 )
|
| 41 |
{
|
| 42 |
global $woocommerce;
|
| 43 |
|
| 87 |
}
|
| 88 |
}
|
| 89 |
|
| 90 |
+
$shipping_costs = apply_filters( 'wcvendors_shipping_due', $shipping_costs, $order_id, $product, $author, $product_id );
|
| 91 |
|
| 92 |
return $shipping_costs;
|
| 93 |
}
|
classes/class-vendors.php
CHANGED
|
@@ -109,7 +109,7 @@ class WCV_Vendors
|
|
| 109 |
if ( get_option('woocommerce_calc_shipping') === 'no' ) {
|
| 110 |
$shipping = 0; $shipping_tax = 0;
|
| 111 |
} else {
|
| 112 |
-
$shipping_costs = WCV_Shipping::get_shipping_due( $order_id, $product, $author );
|
| 113 |
$shipping = $shipping_costs['amount'];
|
| 114 |
$shipping_tax = $shipping_costs['tax'];
|
| 115 |
}
|
| 109 |
if ( get_option('woocommerce_calc_shipping') === 'no' ) {
|
| 110 |
$shipping = 0; $shipping_tax = 0;
|
| 111 |
} else {
|
| 112 |
+
$shipping_costs = WCV_Shipping::get_shipping_due( $order_id, $product, $author, $product_id );
|
| 113 |
$shipping = $shipping_costs['amount'];
|
| 114 |
$shipping_tax = $shipping_costs['tax'];
|
| 115 |
}
|
classes/front/class-vendor-cart.php
CHANGED
|
@@ -36,7 +36,7 @@ class WCV_Vendor_Cart
|
|
| 36 |
*/
|
| 37 |
public static function sold_by( $values, $cart_item ){
|
| 38 |
|
| 39 |
-
$product_id = $cart_item['
|
| 40 |
$post = get_post( $product_id );
|
| 41 |
$vendor_id = $post->post_author;
|
| 42 |
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 36 |
*/
|
| 37 |
public static function sold_by( $values, $cart_item ){
|
| 38 |
|
| 39 |
+
$product_id = $cart_item[ 'product_id'];
|
| 40 |
$post = get_post( $product_id );
|
| 41 |
$vendor_id = $post->post_author;
|
| 42 |
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
classes/front/class-vendor-shop.php
CHANGED
|
@@ -320,7 +320,7 @@ class WCV_Vendor_Shop
|
|
| 320 |
|
| 321 |
$cart = WC()->cart->get_cart();
|
| 322 |
$cart_item = $cart[ $cart_item_key ];
|
| 323 |
-
$product_id = $cart_item['
|
| 324 |
$post = get_post( $product_id );
|
| 325 |
$vendor_id = $post->post_author;
|
| 326 |
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 320 |
|
| 321 |
$cart = WC()->cart->get_cart();
|
| 322 |
$cart_item = $cart[ $cart_item_key ];
|
| 323 |
+
$product_id = $cart_item[ 'product_id'];
|
| 324 |
$post = get_post( $product_id );
|
| 325 |
$vendor_id = $post->post_author;
|
| 326 |
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php
CHANGED
|
@@ -105,7 +105,10 @@ class WC_Gateway_WCV_Gateway_Test extends WC_Payment_Gateway {
|
|
| 105 |
* @param bool $plain_text
|
| 106 |
*/
|
| 107 |
public function email_instructions( $order, $sent_to_admin, $plain_text = false ) {
|
| 108 |
-
|
|
|
|
|
|
|
|
|
|
| 109 |
echo wpautop( wptexturize( $this->instructions ) ) . PHP_EOL;
|
| 110 |
}
|
| 111 |
}
|
| 105 |
* @param bool $plain_text
|
| 106 |
*/
|
| 107 |
public function email_instructions( $order, $sent_to_admin, $plain_text = false ) {
|
| 108 |
+
|
| 109 |
+
$payment_method = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->payment_method : $order->get_payment_method();
|
| 110 |
+
|
| 111 |
+
if ( $this->instructions && ! $sent_to_admin && 'wcvendors_test_gateway' === $payment_method && $order->has_status( 'processing' ) ) {
|
| 112 |
echo wpautop( wptexturize( $this->instructions ) ) . PHP_EOL;
|
| 113 |
}
|
| 114 |
}
|
languages/default.pot
CHANGED
|
@@ -108,7 +108,7 @@ msgstr ""
|
|
| 108 |
msgid "Product"
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
-
#: classes/admin/class-admin-page.php:415, classes/admin/class-vendor-admin-dashboard.php:
|
| 112 |
msgid "Order ID"
|
| 113 |
msgstr ""
|
| 114 |
|
|
@@ -120,7 +120,7 @@ msgstr ""
|
|
| 120 |
msgid "Tax"
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
-
#: classes/admin/class-admin-page.php:420, classes/admin/class-admin-reports.php:179, classes/admin/class-admin-reports.php:377, classes/admin/class-vendor-admin-dashboard.php:
|
| 124 |
msgid "Total"
|
| 125 |
msgstr ""
|
| 126 |
|
|
@@ -128,7 +128,7 @@ msgstr ""
|
|
| 128 |
msgid "Status"
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
-
#: classes/admin/class-admin-page.php:422, classes/admin/class-vendor-admin-dashboard.php:
|
| 132 |
msgid "Date"
|
| 133 |
msgstr ""
|
| 134 |
|
|
@@ -336,7 +336,7 @@ msgstr ""
|
|
| 336 |
msgid "Shop Settings"
|
| 337 |
msgstr ""
|
| 338 |
|
| 339 |
-
#: classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:
|
| 340 |
msgid "Orders"
|
| 341 |
msgstr ""
|
| 342 |
|
|
@@ -348,51 +348,51 @@ msgstr ""
|
|
| 348 |
msgid "That shop name is already taken. Your shop name must be unique."
|
| 349 |
msgstr ""
|
| 350 |
|
| 351 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 352 |
msgid "Settings saved."
|
| 353 |
msgstr ""
|
| 354 |
|
| 355 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 356 |
msgid "order"
|
| 357 |
msgstr ""
|
| 358 |
|
| 359 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 360 |
msgid "orders"
|
| 361 |
msgstr ""
|
| 362 |
|
| 363 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 364 |
msgid "Customer"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 368 |
msgid "Products"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 372 |
msgid "Comments to Customer"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 376 |
msgid "Shipped"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 380 |
msgid "Mark shipped"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 384 |
msgid "Orders marked shipped."
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 388 |
msgid "You are not allowed to modify this order."
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 392 |
msgid "Yes"
|
| 393 |
msgstr ""
|
| 394 |
|
| 395 |
-
#: classes/admin/class-vendor-admin-dashboard.php:
|
| 396 |
msgid "No"
|
| 397 |
msgstr ""
|
| 398 |
|
|
@@ -436,11 +436,11 @@ msgstr ""
|
|
| 436 |
msgid "[{blogname}] Your vendor application has been {status}"
|
| 437 |
msgstr ""
|
| 438 |
|
| 439 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:123, classes/admin/emails/class-wc-notify-admin.php:134, classes/admin/emails/class-wc-notify-shipped.php:
|
| 440 |
msgid "Enable/Disable"
|
| 441 |
msgstr ""
|
| 442 |
|
| 443 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:125, classes/admin/emails/class-wc-notify-admin.php:136, classes/admin/emails/class-wc-notify-shipped.php:
|
| 444 |
msgid "Enable this email notification"
|
| 445 |
msgstr ""
|
| 446 |
|
|
@@ -448,39 +448,39 @@ msgstr ""
|
|
| 448 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 449 |
msgstr ""
|
| 450 |
|
| 451 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:136, classes/admin/emails/class-wc-notify-admin.php:147, classes/admin/emails/class-wc-notify-shipped.php:
|
| 452 |
msgid "Subject"
|
| 453 |
msgstr ""
|
| 454 |
|
| 455 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:138, classes/admin/emails/class-wc-notify-admin.php:149, classes/admin/emails/class-wc-notify-shipped.php:
|
| 456 |
msgid "This controls the email subject line. Leave blank to use the default subject: <code>%s</code>."
|
| 457 |
msgstr ""
|
| 458 |
|
| 459 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:143, classes/admin/emails/class-wc-notify-admin.php:154, classes/admin/emails/class-wc-notify-shipped.php:
|
| 460 |
msgid "Email Heading"
|
| 461 |
msgstr ""
|
| 462 |
|
| 463 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:145, classes/admin/emails/class-wc-notify-admin.php:156, classes/admin/emails/class-wc-notify-shipped.php:
|
| 464 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 465 |
msgstr ""
|
| 466 |
|
| 467 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:150, classes/admin/emails/class-wc-notify-admin.php:161, classes/admin/emails/class-wc-notify-shipped.php:
|
| 468 |
msgid "Email type"
|
| 469 |
msgstr ""
|
| 470 |
|
| 471 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:152, classes/admin/emails/class-wc-notify-admin.php:163, classes/admin/emails/class-wc-notify-shipped.php:
|
| 472 |
msgid "Choose which format of email to send."
|
| 473 |
msgstr ""
|
| 474 |
|
| 475 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:156, classes/admin/emails/class-wc-notify-admin.php:167, classes/admin/emails/class-wc-notify-shipped.php:
|
| 476 |
msgid "Plain text"
|
| 477 |
msgstr ""
|
| 478 |
|
| 479 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:157, classes/admin/emails/class-wc-notify-admin.php:168, classes/admin/emails/class-wc-notify-shipped.php:
|
| 480 |
msgid "HTML"
|
| 481 |
msgstr ""
|
| 482 |
|
| 483 |
-
#: classes/admin/emails/class-wc-approve-vendor.php:158, classes/admin/emails/class-wc-notify-admin.php:169, classes/admin/emails/class-wc-notify-shipped.php:
|
| 484 |
msgid "Multipart"
|
| 485 |
msgstr ""
|
| 486 |
|
|
@@ -516,7 +516,7 @@ msgstr ""
|
|
| 516 |
msgid "[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 517 |
msgstr ""
|
| 518 |
|
| 519 |
-
#: classes/admin/emails/class-wc-notify-shipped.php:
|
| 520 |
msgid "Subtotal:"
|
| 521 |
msgstr ""
|
| 522 |
|
|
@@ -1168,6 +1168,10 @@ msgstr ""
|
|
| 1168 |
msgid "I have read and accepted the <a target=\"top\" href=\"%s\">terms and conditions</a>"
|
| 1169 |
msgstr ""
|
| 1170 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1171 |
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1172 |
msgid "PayPal Adaptive Payments"
|
| 1173 |
msgstr ""
|
| 108 |
msgid "Product"
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
+
#: classes/admin/class-admin-page.php:415, classes/admin/class-vendor-admin-dashboard.php:319
|
| 112 |
msgid "Order ID"
|
| 113 |
msgstr ""
|
| 114 |
|
| 120 |
msgid "Tax"
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
+
#: classes/admin/class-admin-page.php:420, classes/admin/class-admin-reports.php:179, classes/admin/class-admin-reports.php:377, classes/admin/class-vendor-admin-dashboard.php:322, templates/dashboard/orders.php:46
|
| 124 |
msgid "Total"
|
| 125 |
msgstr ""
|
| 126 |
|
| 128 |
msgid "Status"
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
+
#: classes/admin/class-admin-page.php:422, classes/admin/class-vendor-admin-dashboard.php:324, classes/front/orders/class-orders.php:257, templates/dashboard/orders.php:47
|
| 132 |
msgid "Date"
|
| 133 |
msgstr ""
|
| 134 |
|
| 336 |
msgid "Shop Settings"
|
| 337 |
msgstr ""
|
| 338 |
|
| 339 |
+
#: classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:23, classes/admin/class-vendor-admin-dashboard.php:180, classes/admin/settings/sf-options.php:196, classes/class-install.php:206, templates/dashboard/orders.php:35
|
| 340 |
msgid "Orders"
|
| 341 |
msgstr ""
|
| 342 |
|
| 348 |
msgid "That shop name is already taken. Your shop name must be unique."
|
| 349 |
msgstr ""
|
| 350 |
|
| 351 |
+
#: classes/admin/class-vendor-admin-dashboard.php:112, classes/admin/settings/classes/sf-class-settings.php:371, classes/front/dashboard/class-vendor-dashboard.php:139
|
| 352 |
msgid "Settings saved."
|
| 353 |
msgstr ""
|
| 354 |
|
| 355 |
+
#: classes/admin/class-vendor-admin-dashboard.php:243
|
| 356 |
msgid "order"
|
| 357 |
msgstr ""
|
| 358 |
|
| 359 |
+
#: classes/admin/class-vendor-admin-dashboard.php:244
|
| 360 |
msgid "orders"
|
| 361 |
msgstr ""
|
| 362 |
|
| 363 |
+
#: classes/admin/class-vendor-admin-dashboard.php:320
|
| 364 |
msgid "Customer"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
+
#: classes/admin/class-vendor-admin-dashboard.php:321, classes/admin/settings/sf-options.php:127, classes/admin/settings/sf-options.php:254
|
| 368 |
msgid "Products"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
+
#: classes/admin/class-vendor-admin-dashboard.php:323
|
| 372 |
msgid "Comments to Customer"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
+
#: classes/admin/class-vendor-admin-dashboard.php:325, templates/dashboard/orders.php:106
|
| 376 |
msgid "Shipped"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
+
#: classes/admin/class-vendor-admin-dashboard.php:361, templates/dashboard/orders.php:99
|
| 380 |
msgid "Mark shipped"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
+
#: classes/admin/class-vendor-admin-dashboard.php:386
|
| 384 |
msgid "Orders marked shipped."
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
+
#: classes/admin/class-vendor-admin-dashboard.php:422, classes/front/dashboard/class-vendor-dashboard.php:40
|
| 388 |
msgid "You are not allowed to modify this order."
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
+
#: classes/admin/class-vendor-admin-dashboard.php:544
|
| 392 |
msgid "Yes"
|
| 393 |
msgstr ""
|
| 394 |
|
| 395 |
+
#: classes/admin/class-vendor-admin-dashboard.php:544
|
| 396 |
msgid "No"
|
| 397 |
msgstr ""
|
| 398 |
|
| 436 |
msgid "[{blogname}] Your vendor application has been {status}"
|
| 437 |
msgstr ""
|
| 438 |
|
| 439 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:123, classes/admin/emails/class-wc-notify-admin.php:134, classes/admin/emails/class-wc-notify-shipped.php:166, classes/admin/emails/class-wc-notify-vendor.php:265
|
| 440 |
msgid "Enable/Disable"
|
| 441 |
msgstr ""
|
| 442 |
|
| 443 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:125, classes/admin/emails/class-wc-notify-admin.php:136, classes/admin/emails/class-wc-notify-shipped.php:168, classes/admin/emails/class-wc-notify-vendor.php:267
|
| 444 |
msgid "Enable this email notification"
|
| 445 |
msgstr ""
|
| 446 |
|
| 448 |
msgid "Enter recipients (comma separated) for this email. Defaults to <code>%s</code>."
|
| 449 |
msgstr ""
|
| 450 |
|
| 451 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:136, classes/admin/emails/class-wc-notify-admin.php:147, classes/admin/emails/class-wc-notify-shipped.php:172, classes/admin/emails/class-wc-notify-vendor.php:271
|
| 452 |
msgid "Subject"
|
| 453 |
msgstr ""
|
| 454 |
|
| 455 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:138, classes/admin/emails/class-wc-notify-admin.php:149, classes/admin/emails/class-wc-notify-shipped.php:174, classes/admin/emails/class-wc-notify-vendor.php:273
|
| 456 |
msgid "This controls the email subject line. Leave blank to use the default subject: <code>%s</code>."
|
| 457 |
msgstr ""
|
| 458 |
|
| 459 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:143, classes/admin/emails/class-wc-notify-admin.php:154, classes/admin/emails/class-wc-notify-shipped.php:179, classes/admin/emails/class-wc-notify-vendor.php:278
|
| 460 |
msgid "Email Heading"
|
| 461 |
msgstr ""
|
| 462 |
|
| 463 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:145, classes/admin/emails/class-wc-notify-admin.php:156, classes/admin/emails/class-wc-notify-shipped.php:181, classes/admin/emails/class-wc-notify-vendor.php:280
|
| 464 |
msgid "This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>."
|
| 465 |
msgstr ""
|
| 466 |
|
| 467 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:150, classes/admin/emails/class-wc-notify-admin.php:161, classes/admin/emails/class-wc-notify-shipped.php:186, classes/admin/emails/class-wc-notify-vendor.php:291
|
| 468 |
msgid "Email type"
|
| 469 |
msgstr ""
|
| 470 |
|
| 471 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:152, classes/admin/emails/class-wc-notify-admin.php:163, classes/admin/emails/class-wc-notify-shipped.php:188, classes/admin/emails/class-wc-notify-vendor.php:293
|
| 472 |
msgid "Choose which format of email to send."
|
| 473 |
msgstr ""
|
| 474 |
|
| 475 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:156, classes/admin/emails/class-wc-notify-admin.php:167, classes/admin/emails/class-wc-notify-shipped.php:192, classes/admin/emails/class-wc-notify-vendor.php:297
|
| 476 |
msgid "Plain text"
|
| 477 |
msgstr ""
|
| 478 |
|
| 479 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:157, classes/admin/emails/class-wc-notify-admin.php:168, classes/admin/emails/class-wc-notify-shipped.php:193, classes/admin/emails/class-wc-notify-vendor.php:298
|
| 480 |
msgid "HTML"
|
| 481 |
msgstr ""
|
| 482 |
|
| 483 |
+
#: classes/admin/emails/class-wc-approve-vendor.php:158, classes/admin/emails/class-wc-notify-admin.php:169, classes/admin/emails/class-wc-notify-shipped.php:194, classes/admin/emails/class-wc-notify-vendor.php:299
|
| 484 |
msgid "Multipart"
|
| 485 |
msgstr ""
|
| 486 |
|
| 516 |
msgid "[{blogname}] Your order has been shipped ({order_number}) - {order_date}"
|
| 517 |
msgstr ""
|
| 518 |
|
| 519 |
+
#: classes/admin/emails/class-wc-notify-shipped.php:115
|
| 520 |
msgid "Subtotal:"
|
| 521 |
msgstr ""
|
| 522 |
|
| 1168 |
msgid "I have read and accepted the <a target=\"top\" href=\"%s\">terms and conditions</a>"
|
| 1169 |
msgstr ""
|
| 1170 |
|
| 1171 |
+
#: classes/front/signup/views/html-vendor-signup.php:44
|
| 1172 |
+
msgid "Please agree to the terms and conditions"
|
| 1173 |
+
msgstr ""
|
| 1174 |
+
|
| 1175 |
#: classes/gateways/PayPal_AdvPayments/paypal_ap.php:43
|
| 1176 |
msgid "PayPal Adaptive Payments"
|
| 1177 |
msgstr ""
|
readme.txt
CHANGED
|
@@ -6,7 +6,7 @@ Author URI: http://www.wcvendors.com/
|
|
| 6 |
Plugin URI: http://www.wcvendors.com/
|
| 7 |
Requires at least: 4.4.0
|
| 8 |
Tested up to: 4.7.1
|
| 9 |
-
Stable tag: 1.9.
|
| 10 |
License: GPLv2 or later
|
| 11 |
|
| 12 |
The free marketplace plugin for WooCommerce. Now you can allow anyone to open a store on your site!
|
|
@@ -122,6 +122,12 @@ No Upgrade required at this time.
|
|
| 122 |
|
| 123 |
== Changelog ==
|
| 124 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 125 |
= Version 1.9.10 - 10th April 2017 =
|
| 126 |
|
| 127 |
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
| 6 |
Plugin URI: http://www.wcvendors.com/
|
| 7 |
Requires at least: 4.4.0
|
| 8 |
Tested up to: 4.7.1
|
| 9 |
+
Stable tag: 1.9.11
|
| 10 |
License: GPLv2 or later
|
| 11 |
|
| 12 |
The free marketplace plugin for WooCommerce. Now you can allow anyone to open a store on your site!
|
| 122 |
|
| 123 |
== Changelog ==
|
| 124 |
|
| 125 |
+
= Version 1.9.11 - 25th Aprl 2017 =
|
| 126 |
+
|
| 127 |
+
* Fixed: Correct product id being parsed to shipping function
|
| 128 |
+
* Fixed: Payment method notice due to direct access to object property
|
| 129 |
+
* Fixed: Sold by incorrectly showing in cart for variations
|
| 130 |
+
|
| 131 |
= Version 1.9.10 - 10th April 2017 =
|
| 132 |
|
| 133 |
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
trunk/assets/css/admin-orders.css
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.wp-list-table .column-order_id { width: 10%; }
|
| 2 |
+
.wp-list-table .column-customer { width: 15%; }
|
| 3 |
+
.wp-list-table .column-product { width: 35%; }
|
| 4 |
+
.wp-list-table .column-total { width: 10%;}
|
| 5 |
+
/*.wp-list-table .column-comments { width: 27.5%;}*/
|
| 6 |
+
.wp-list-table .column-date { width: 15%;}
|
| 7 |
+
.wp-list-table .column-status { width: 15%;}
|
trunk/assets/css/select2.min.css
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;height:1px !important;margin:-1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__placeholder{color:#999;margin-top:5px;float:left}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb}
|
trunk/assets/css/wcv-frontend.css
ADDED
|
@@ -0,0 +1,545 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
* Bootstrap v2.1.1
|
| 3 |
+
*
|
| 4 |
+
* Copyright 2012 Twitter, Inc
|
| 5 |
+
* Licensed under the Apache License v2.0
|
| 6 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 7 |
+
*
|
| 8 |
+
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 9 |
+
*/
|
| 10 |
+
clearfix {
|
| 11 |
+
*zoom: 1;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.clearfix:before, .clearfix:after {
|
| 15 |
+
display: table;
|
| 16 |
+
content: "";
|
| 17 |
+
line-height: 0;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
.clearfix:after {
|
| 21 |
+
clear: both;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
.hide-text {
|
| 25 |
+
font: 0/0 a;
|
| 26 |
+
color: transparent;
|
| 27 |
+
text-shadow: none;
|
| 28 |
+
background-color: transparent;
|
| 29 |
+
border: 0;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
.input-block-level {
|
| 33 |
+
display: block;
|
| 34 |
+
width: 100%;
|
| 35 |
+
min-height: 30px;
|
| 36 |
+
-webkit-box-sizing: border-box;
|
| 37 |
+
-moz-box-sizing: border-box;
|
| 38 |
+
box-sizing: border-box;
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
.wcv-btn {
|
| 42 |
+
display: inline-block;
|
| 43 |
+
*display: inline;
|
| 44 |
+
*zoom: 1;
|
| 45 |
+
padding: 4px 14px;
|
| 46 |
+
margin-bottom: 0;
|
| 47 |
+
font-size: 14px;
|
| 48 |
+
line-height: 20px;
|
| 49 |
+
*line-height: 20px;
|
| 50 |
+
text-align: center;
|
| 51 |
+
vertical-align: middle;
|
| 52 |
+
cursor: pointer;
|
| 53 |
+
color: #333333;
|
| 54 |
+
text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
|
| 55 |
+
background-color: #f5f5f5;
|
| 56 |
+
background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
|
| 57 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
|
| 58 |
+
background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
|
| 59 |
+
background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
|
| 60 |
+
background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
|
| 61 |
+
background-repeat: repeat-x;
|
| 62 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe6e6e6', GradientType=0);
|
| 63 |
+
border-color: #e6e6e6 #e6e6e6 #bfbfbf;
|
| 64 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 65 |
+
*background-color: #e6e6e6;
|
| 66 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 67 |
+
border: 1px solid #bbbbbb;
|
| 68 |
+
*border: 0;
|
| 69 |
+
border-bottom-color: #a2a2a2;
|
| 70 |
+
-webkit-border-radius: 4px;
|
| 71 |
+
-moz-border-radius: 4px;
|
| 72 |
+
border-radius: 4px;
|
| 73 |
+
*margin-left: .3em;
|
| 74 |
+
-webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 75 |
+
-moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 76 |
+
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
.wcv-btn:hover, .wcv-btn:active, .wcv-btn.active, .wcv-btn.disabled, .wcv-btn[disabled] {
|
| 80 |
+
color: #333333;
|
| 81 |
+
background-color: #e6e6e6;
|
| 82 |
+
*background-color: #d9d9d9;
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
.wcv-btn:active, .wcv-btn.active {
|
| 86 |
+
background-color: #cccccc \9;
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
.wcv-btn:first-child {
|
| 90 |
+
*margin-left: 0;
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
.wcv-btn:hover {
|
| 94 |
+
color: #333333;
|
| 95 |
+
text-decoration: none;
|
| 96 |
+
background-color: #e6e6e6;
|
| 97 |
+
*background-color: #d9d9d9;
|
| 98 |
+
background-position: 0 -15px;
|
| 99 |
+
-webkit-transition: background-position 0.1s linear;
|
| 100 |
+
-moz-transition: background-position 0.1s linear;
|
| 101 |
+
-o-transition: background-position 0.1s linear;
|
| 102 |
+
transition: background-position 0.1s linear;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
.wcv-btn:focus {
|
| 106 |
+
outline: thin dotted #333;
|
| 107 |
+
outline: 5px auto -webkit-focus-ring-color;
|
| 108 |
+
outline-offset: -2px;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
.wcv-btn.active, .wcv-btn:active {
|
| 112 |
+
background-color: #e6e6e6;
|
| 113 |
+
background-color: #d9d9d9 \9;
|
| 114 |
+
background-image: none;
|
| 115 |
+
outline: 0;
|
| 116 |
+
-webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 117 |
+
-moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 118 |
+
box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
.wcv-btn.disabled, .wcv-btn[disabled] {
|
| 122 |
+
cursor: default;
|
| 123 |
+
background-color: #e6e6e6;
|
| 124 |
+
background-image: none;
|
| 125 |
+
opacity: 0.65;
|
| 126 |
+
filter: alpha(opacity=65);
|
| 127 |
+
-webkit-box-shadow: none;
|
| 128 |
+
-moz-box-shadow: none;
|
| 129 |
+
box-shadow: none;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
.wcv-btn-large {
|
| 133 |
+
padding: 9px 14px;
|
| 134 |
+
font-size: 16px;
|
| 135 |
+
line-height: normal;
|
| 136 |
+
-webkit-border-radius: 5px;
|
| 137 |
+
-moz-border-radius: 5px;
|
| 138 |
+
border-radius: 5px;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
.wcv-btn-large [class^="icon-"] {
|
| 142 |
+
margin-top: 2px;
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
.wcv-btn-small {
|
| 146 |
+
padding: 3px 9px;
|
| 147 |
+
font-size: 12px;
|
| 148 |
+
line-height: 18px;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
.wcv-btn-small [class^="icon-"] {
|
| 152 |
+
margin-top: 0;
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
.wcv-btn-mini {
|
| 156 |
+
padding: 2px 6px;
|
| 157 |
+
font-size: 11px;
|
| 158 |
+
line-height: 17px;
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
.wcv-btn-block {
|
| 162 |
+
display: block;
|
| 163 |
+
width: 100%;
|
| 164 |
+
padding-left: 0;
|
| 165 |
+
padding-right: 0;
|
| 166 |
+
-webkit-box-sizing: border-box;
|
| 167 |
+
-moz-box-sizing: border-box;
|
| 168 |
+
box-sizing: border-box;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
.wcv-btn-block + .wcv-btn-block {
|
| 172 |
+
margin-top: 5px;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
input[type="submit"].wcv-btn-block, input[type="reset"].wcv-btn-block, input[type="button"].wcv-btn-block {
|
| 176 |
+
width: 100%;
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
.wcv-btn-primary.active, .wcv-btn-warning.active, .wcv-btn-danger.active, .wcv-btn-success.active, .wcv-btn-info.active, .wcv-btn-inverse.active {
|
| 180 |
+
color: rgba(255, 255, 255, 0.75);
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
.wcv-btn {
|
| 184 |
+
border-color: #c5c5c5;
|
| 185 |
+
border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
.wcv-btn-primary {
|
| 189 |
+
color: #ffffff;
|
| 190 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 191 |
+
background-color: #006dcc;
|
| 192 |
+
background-image: -moz-linear-gradient(top, #0088cc, #0044cc);
|
| 193 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0044cc));
|
| 194 |
+
background-image: -webkit-linear-gradient(top, #0088cc, #0044cc);
|
| 195 |
+
background-image: -o-linear-gradient(top, #0088cc, #0044cc);
|
| 196 |
+
background-image: linear-gradient(to bottom, #0088cc, #0044cc);
|
| 197 |
+
background-repeat: repeat-x;
|
| 198 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);
|
| 199 |
+
border-color: #0044cc #0044cc #002a80;
|
| 200 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 201 |
+
*background-color: #0044cc;
|
| 202 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 203 |
+
}
|
| 204 |
+
|
| 205 |
+
.wcv-btn-primary:hover, .wcv-btn-primary:active, .wcv-btn-primary.active, .wcv-btn-primary.disabled, .wcv-btn-primary[disabled] {
|
| 206 |
+
color: #ffffff;
|
| 207 |
+
background-color: #0044cc;
|
| 208 |
+
*background-color: #003bb3;
|
| 209 |
+
}
|
| 210 |
+
|
| 211 |
+
.wcv-btn-primary:active, .wcv-btn-primary.active {
|
| 212 |
+
background-color: #003399 \9;
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
.wcv-btn-warning {
|
| 216 |
+
color: #ffffff;
|
| 217 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 218 |
+
background-color: #faa732;
|
| 219 |
+
background-image: -moz-linear-gradient(top, #fbb450, #f89406);
|
| 220 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
|
| 221 |
+
background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
|
| 222 |
+
background-image: -o-linear-gradient(top, #fbb450, #f89406);
|
| 223 |
+
background-image: linear-gradient(to bottom, #fbb450, #f89406);
|
| 224 |
+
background-repeat: repeat-x;
|
| 225 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffbb450', endColorstr='#fff89406', GradientType=0);
|
| 226 |
+
border-color: #f89406 #f89406 #ad6704;
|
| 227 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 228 |
+
*background-color: #f89406;
|
| 229 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
.wcv-btn-warning:hover, .wcv-btn-warning:active, .wcv-btn-warning.active, .wcv-btn-warning.disabled, .wcv-btn-warning[disabled] {
|
| 233 |
+
color: #ffffff;
|
| 234 |
+
background-color: #f89406;
|
| 235 |
+
*background-color: #df8505;
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
.wcv-btn-warning:active, .wcv-btn-warning.active {
|
| 239 |
+
background-color: #c67605 \9;
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
.wcv-btn-danger {
|
| 243 |
+
color: #ffffff;
|
| 244 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 245 |
+
background-color: #da4f49;
|
| 246 |
+
background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f);
|
| 247 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));
|
| 248 |
+
background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f);
|
| 249 |
+
background-image: -o-linear-gradient(top, #ee5f5b, #bd362f);
|
| 250 |
+
background-image: linear-gradient(to bottom, #ee5f5b, #bd362f);
|
| 251 |
+
background-repeat: repeat-x;
|
| 252 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffee5f5b', endColorstr='#ffbd362f', GradientType=0);
|
| 253 |
+
border-color: #bd362f #bd362f #802420;
|
| 254 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 255 |
+
*background-color: #bd362f;
|
| 256 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 257 |
+
}
|
| 258 |
+
|
| 259 |
+
.wcv-btn-danger:hover, .wcv-btn-danger:active, .wcv-btn-danger.active, .wcv-btn-danger.disabled, .wcv-btn-danger[disabled] {
|
| 260 |
+
color: #ffffff;
|
| 261 |
+
background-color: #bd362f;
|
| 262 |
+
*background-color: #a9302a;
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
.wcv-btn-danger:active, .wcv-btn-danger.active {
|
| 266 |
+
background-color: #942a25 \9;
|
| 267 |
+
}
|
| 268 |
+
|
| 269 |
+
.wcv-btn-success {
|
| 270 |
+
color: #ffffff;
|
| 271 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 272 |
+
background-color: #5bb75b;
|
| 273 |
+
background-image: -moz-linear-gradient(top, #62c462, #51a351);
|
| 274 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));
|
| 275 |
+
background-image: -webkit-linear-gradient(top, #62c462, #51a351);
|
| 276 |
+
background-image: -o-linear-gradient(top, #62c462, #51a351);
|
| 277 |
+
background-image: linear-gradient(to bottom, #62c462, #51a351);
|
| 278 |
+
background-repeat: repeat-x;
|
| 279 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff62c462', endColorstr='#ff51a351', GradientType=0);
|
| 280 |
+
border-color: #51a351 #51a351 #387038;
|
| 281 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 282 |
+
*background-color: #51a351;
|
| 283 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
.wcv-btn-success:hover, .wcv-btn-success:active, .wcv-btn-success.active, .wcv-btn-success.disabled, .wcv-btn-success[disabled] {
|
| 287 |
+
color: #ffffff;
|
| 288 |
+
background-color: #51a351;
|
| 289 |
+
*background-color: #499249;
|
| 290 |
+
}
|
| 291 |
+
|
| 292 |
+
.wcv-btn-success:active, .wcv-btn-success.active {
|
| 293 |
+
background-color: #408140 \9;
|
| 294 |
+
}
|
| 295 |
+
|
| 296 |
+
.wcv-btn-info {
|
| 297 |
+
color: #ffffff;
|
| 298 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 299 |
+
background-color: #49afcd;
|
| 300 |
+
background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4);
|
| 301 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));
|
| 302 |
+
background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4);
|
| 303 |
+
background-image: -o-linear-gradient(top, #5bc0de, #2f96b4);
|
| 304 |
+
background-image: linear-gradient(to bottom, #5bc0de, #2f96b4);
|
| 305 |
+
background-repeat: repeat-x;
|
| 306 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2f96b4', GradientType=0);
|
| 307 |
+
border-color: #2f96b4 #2f96b4 #1f6377;
|
| 308 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 309 |
+
*background-color: #2f96b4;
|
| 310 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
.wcv-btn-info:hover, .wcv-btn-info:active, .wcv-btn-info.active, .wcv-btn-info.disabled, .wcv-btn-info[disabled] {
|
| 314 |
+
color: #ffffff;
|
| 315 |
+
background-color: #2f96b4;
|
| 316 |
+
*background-color: #2a85a0;
|
| 317 |
+
}
|
| 318 |
+
|
| 319 |
+
.wcv-btn-info:active, .wcv-btn-info.active {
|
| 320 |
+
background-color: #24748c \9;
|
| 321 |
+
}
|
| 322 |
+
|
| 323 |
+
.wcv-btn-inverse {
|
| 324 |
+
color: #ffffff;
|
| 325 |
+
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
|
| 326 |
+
background-color: #363636;
|
| 327 |
+
background-image: -moz-linear-gradient(top, #444444, #222222);
|
| 328 |
+
background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#444444), to(#222222));
|
| 329 |
+
background-image: -webkit-linear-gradient(top, #444444, #222222);
|
| 330 |
+
background-image: -o-linear-gradient(top, #444444, #222222);
|
| 331 |
+
background-image: linear-gradient(to bottom, #444444, #222222);
|
| 332 |
+
background-repeat: repeat-x;
|
| 333 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff444444', endColorstr='#ff222222', GradientType=0);
|
| 334 |
+
border-color: #222222 #222222 #000000;
|
| 335 |
+
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
|
| 336 |
+
*background-color: #222222;
|
| 337 |
+
filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
|
| 338 |
+
}
|
| 339 |
+
|
| 340 |
+
.wcv-btn-inverse:hover, .wcv-btn-inverse:active, .wcv-btn-inverse.active, .wcv-btn-inverse.disabled, .wcv-btn-inverse[disabled] {
|
| 341 |
+
color: #ffffff;
|
| 342 |
+
background-color: #222222;
|
| 343 |
+
*background-color: #151515;
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
.wcv-btn-inverse:active, .wcv-btn-inverse.active {
|
| 347 |
+
background-color: #080808 \9;
|
| 348 |
+
}
|
| 349 |
+
|
| 350 |
+
button.wcv-btn, input[type="submit"].wcv-btn {
|
| 351 |
+
*padding-top: 3px;
|
| 352 |
+
*padding-bottom: 3px;
|
| 353 |
+
}
|
| 354 |
+
|
| 355 |
+
button.wcv-btn::-moz-focus-inner, input[type="submit"].wcv-btn::-moz-focus-inner {
|
| 356 |
+
padding: 0;
|
| 357 |
+
border: 0;
|
| 358 |
+
}
|
| 359 |
+
|
| 360 |
+
button.wcv-btn.wcv-btn-large, input[type="submit"].wcv-btn.wcv-btn-large {
|
| 361 |
+
*padding-top: 7px;
|
| 362 |
+
*padding-bottom: 7px;
|
| 363 |
+
}
|
| 364 |
+
|
| 365 |
+
button.wcv-btn.wcv-btn-small, input[type="submit"].wcv-btn.wcv-btn-small {
|
| 366 |
+
*padding-top: 3px;
|
| 367 |
+
*padding-bottom: 3px;
|
| 368 |
+
}
|
| 369 |
+
|
| 370 |
+
button.wcv-btn.wcv-btn-mini, input[type="submit"].wcv-btn.wcv-btn-mini {
|
| 371 |
+
*padding-top: 1px;
|
| 372 |
+
*padding-bottom: 1px;
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
.wcv-btn-link, .wcv-btn-link:active, .wcv-btn-link[disabled] {
|
| 376 |
+
background-color: transparent;
|
| 377 |
+
background-image: none;
|
| 378 |
+
-webkit-box-shadow: none;
|
| 379 |
+
-moz-box-shadow: none;
|
| 380 |
+
box-shadow: none;
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
.wcv-btn-link {
|
| 384 |
+
border-color: transparent;
|
| 385 |
+
cursor: pointer;
|
| 386 |
+
color: #0088cc;
|
| 387 |
+
-webkit-border-radius: 0;
|
| 388 |
+
-moz-border-radius: 0;
|
| 389 |
+
border-radius: 0;
|
| 390 |
+
}
|
| 391 |
+
|
| 392 |
+
.wcv-btn-link:hover {
|
| 393 |
+
color: #005580;
|
| 394 |
+
text-decoration: underline;
|
| 395 |
+
background-color: transparent;
|
| 396 |
+
}
|
| 397 |
+
|
| 398 |
+
.wcv-btn-link[disabled]:hover {
|
| 399 |
+
color: #333333;
|
| 400 |
+
text-decoration: none;
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
table {
|
| 404 |
+
max-width: 100%;
|
| 405 |
+
background-color: transparent;
|
| 406 |
+
border-collapse: collapse;
|
| 407 |
+
border-spacing: 0;
|
| 408 |
+
}
|
| 409 |
+
|
| 410 |
+
.table {
|
| 411 |
+
width: 100%;
|
| 412 |
+
margin-bottom: 20px;
|
| 413 |
+
}
|
| 414 |
+
|
| 415 |
+
.table th, .table td {
|
| 416 |
+
padding: 8px;
|
| 417 |
+
line-height: 20px;
|
| 418 |
+
text-align: left;
|
| 419 |
+
vertical-align: top;
|
| 420 |
+
border-top: 1px solid #dddddd;
|
| 421 |
+
}
|
| 422 |
+
|
| 423 |
+
.table th {
|
| 424 |
+
font-weight: bold;
|
| 425 |
+
}
|
| 426 |
+
|
| 427 |
+
.table thead th {
|
| 428 |
+
vertical-align: bottom;
|
| 429 |
+
}
|
| 430 |
+
|
| 431 |
+
.table caption + thead tr:first-child th, .table caption + thead tr:first-child td, .table colgroup + thead tr:first-child th, .table colgroup + thead tr:first-child td, .table thead:first-child tr:first-child th, .table thead:first-child tr:first-child td {
|
| 432 |
+
border-top: 0;
|
| 433 |
+
}
|
| 434 |
+
|
| 435 |
+
.table tbody + tbody {
|
| 436 |
+
border-top: 2px solid #dddddd;
|
| 437 |
+
}
|
| 438 |
+
|
| 439 |
+
.table-condensed th, .table-condensed td {
|
| 440 |
+
padding: 4px 5px;
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
.table-bordered {
|
| 444 |
+
border: 1px solid #dddddd;
|
| 445 |
+
border-collapse: separate;
|
| 446 |
+
*border-collapse: collapse;
|
| 447 |
+
border-left: 0;
|
| 448 |
+
-webkit-border-radius: 4px;
|
| 449 |
+
-moz-border-radius: 4px;
|
| 450 |
+
border-radius: 4px;
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
.table-bordered th, .table-bordered td {
|
| 454 |
+
border-left: 1px solid #dddddd;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
.table-bordered caption + thead tr:first-child th, .table-bordered caption + tbody tr:first-child th, .table-bordered caption + tbody tr:first-child td, .table-bordered colgroup + thead tr:first-child th, .table-bordered colgroup + tbody tr:first-child th, .table-bordered colgroup + tbody tr:first-child td, .table-bordered thead:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child td {
|
| 458 |
+
border-top: 0;
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
.table-bordered thead:first-child tr:first-child th:first-child, .table-bordered tbody:first-child tr:first-child td:first-child {
|
| 462 |
+
-webkit-border-top-left-radius: 4px;
|
| 463 |
+
border-top-left-radius: 4px;
|
| 464 |
+
-moz-border-radius-topleft: 4px;
|
| 465 |
+
}
|
| 466 |
+
|
| 467 |
+
.table-bordered thead:first-child tr:first-child th:last-child, .table-bordered tbody:first-child tr:first-child td:last-child {
|
| 468 |
+
-webkit-border-top-right-radius: 4px;
|
| 469 |
+
border-top-right-radius: 4px;
|
| 470 |
+
-moz-border-radius-topright: 4px;
|
| 471 |
+
}
|
| 472 |
+
|
| 473 |
+
.table-bordered thead:last-child tr:last-child th:first-child, .table-bordered tbody:last-child tr:last-child td:first-child, .table-bordered tfoot:last-child tr:last-child td:first-child {
|
| 474 |
+
-webkit-border-radius: 0 0 0 4px;
|
| 475 |
+
-moz-border-radius: 0 0 0 4px;
|
| 476 |
+
border-radius: 0 0 0 4px;
|
| 477 |
+
-webkit-border-bottom-left-radius: 4px;
|
| 478 |
+
border-bottom-left-radius: 4px;
|
| 479 |
+
-moz-border-radius-bottomleft: 4px;
|
| 480 |
+
}
|
| 481 |
+
|
| 482 |
+
.table-bordered thead:last-child tr:last-child th:last-child, .table-bordered tbody:last-child tr:last-child td:last-child, .table-bordered tfoot:last-child tr:last-child td:last-child {
|
| 483 |
+
-webkit-border-bottom-right-radius: 4px;
|
| 484 |
+
border-bottom-right-radius: 4px;
|
| 485 |
+
-moz-border-radius-bottomright: 4px;
|
| 486 |
+
}
|
| 487 |
+
|
| 488 |
+
.table-bordered caption + thead tr:first-child th:first-child, .table-bordered caption + tbody tr:first-child td:first-child, .table-bordered colgroup + thead tr:first-child th:first-child, .table-bordered colgroup + tbody tr:first-child td:first-child {
|
| 489 |
+
-webkit-border-top-left-radius: 4px;
|
| 490 |
+
border-top-left-radius: 4px;
|
| 491 |
+
-moz-border-radius-topleft: 4px;
|
| 492 |
+
}
|
| 493 |
+
|
| 494 |
+
.table-bordered caption + thead tr:first-child th:last-child, .table-bordered caption + tbody tr:first-child td:last-child, .table-bordered colgroup + thead tr:first-child th:last-child, .table-bordered colgroup + tbody tr:first-child td:last-child {
|
| 495 |
+
-webkit-border-top-right-radius: 4px;
|
| 496 |
+
border-top-right-radius: 4px;
|
| 497 |
+
-moz-border-radius-topleft: 4px;
|
| 498 |
+
}
|
| 499 |
+
|
| 500 |
+
.table-striped tbody tr:nth-child(odd) td, .table-striped tbody tr:nth-child(odd) th {
|
| 501 |
+
background-color: #f9f9f9;
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
.table-hover tbody tr:hover td, .table-hover tbody tr:hover th {
|
| 505 |
+
background-color: #f5f5f5;
|
| 506 |
+
}
|
| 507 |
+
|
| 508 |
+
table [class*=span], .row-fluid table [class*=span] {
|
| 509 |
+
display: table-cell;
|
| 510 |
+
float: none;
|
| 511 |
+
margin-left: 0;
|
| 512 |
+
}
|
| 513 |
+
|
| 514 |
+
.table tbody tr.success td {
|
| 515 |
+
background-color: #dff0d8;
|
| 516 |
+
}
|
| 517 |
+
|
| 518 |
+
.table tbody tr.error td {
|
| 519 |
+
background-color: #f2dede;
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
.table tbody tr.warning td {
|
| 523 |
+
background-color: #fcf8e3;
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
.table tbody tr.info td {
|
| 527 |
+
background-color: #d9edf7;
|
| 528 |
+
}
|
| 529 |
+
|
| 530 |
+
.table-hover tbody tr.success:hover td {
|
| 531 |
+
background-color: #d0e9c6;
|
| 532 |
+
}
|
| 533 |
+
|
| 534 |
+
.table-hover tbody tr.error:hover td {
|
| 535 |
+
background-color: #ebcccc;
|
| 536 |
+
}
|
| 537 |
+
|
| 538 |
+
.table-hover tbody tr.warning:hover td {
|
| 539 |
+
background-color: #faf2cc;
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
.table-hover tbody tr.info:hover td {
|
| 543 |
+
background-color: #c4e3f3;
|
| 544 |
+
}
|
| 545 |
+
.hidden { display: none; }
|
trunk/assets/images/icons/truck.png
ADDED
|
Binary file
|
trunk/assets/js/front-orders.js
ADDED
|
@@ -0,0 +1,8 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(function () {
|
| 2 |
+
jQuery('div.order-comments, div.order-tracking').hide();
|
| 3 |
+
|
| 4 |
+
jQuery('a.order-comments-link, a.order-tracking-link').on('click', function (e) {
|
| 5 |
+
e.preventDefault();
|
| 6 |
+
jQuery(this).next('div').slideToggle();
|
| 7 |
+
});
|
| 8 |
+
});
|
trunk/assets/js/select2.min.js
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a("object"==typeof exports?require("jquery"):jQuery)}(function(a){var b=function(){if(a&&a.fn&&a.fn.select2&&a.fn.select2.amd)var b=a.fn.select2.amd;var b;return function(){if(!b||!b.requirejs){b?c=b:b={};var a,c,d;!function(b){function e(a,b){return u.call(a,b)}function f(a,b){var c,d,e,f,g,h,i,j,k,l,m,n=b&&b.split("/"),o=s.map,p=o&&o["*"]||{};if(a&&"."===a.charAt(0))if(b){for(a=a.split("/"),g=a.length-1,s.nodeIdCompat&&w.test(a[g])&&(a[g]=a[g].replace(w,"")),a=n.slice(0,n.length-1).concat(a),k=0;k<a.length;k+=1)if(m=a[k],"."===m)a.splice(k,1),k-=1;else if(".."===m){if(1===k&&(".."===a[2]||".."===a[0]))break;k>0&&(a.splice(k-1,2),k-=2)}a=a.join("/")}else 0===a.indexOf("./")&&(a=a.substring(2));if((n||p)&&o){for(c=a.split("/"),k=c.length;k>0;k-=1){if(d=c.slice(0,k).join("/"),n)for(l=n.length;l>0;l-=1)if(e=o[n.slice(0,l).join("/")],e&&(e=e[d])){f=e,h=k;break}if(f)break;!i&&p&&p[d]&&(i=p[d],j=k)}!f&&i&&(f=i,h=j),f&&(c.splice(0,h,f),a=c.join("/"))}return a}function g(a,c){return function(){var d=v.call(arguments,0);return"string"!=typeof d[0]&&1===d.length&&d.push(null),n.apply(b,d.concat([a,c]))}}function h(a){return function(b){return f(b,a)}}function i(a){return function(b){q[a]=b}}function j(a){if(e(r,a)){var c=r[a];delete r[a],t[a]=!0,m.apply(b,c)}if(!e(q,a)&&!e(t,a))throw new Error("No "+a);return q[a]}function k(a){var b,c=a?a.indexOf("!"):-1;return c>-1&&(b=a.substring(0,c),a=a.substring(c+1,a.length)),[b,a]}function l(a){return function(){return s&&s.config&&s.config[a]||{}}}var m,n,o,p,q={},r={},s={},t={},u=Object.prototype.hasOwnProperty,v=[].slice,w=/\.js$/;o=function(a,b){var c,d=k(a),e=d[0];return a=d[1],e&&(e=f(e,b),c=j(e)),e?a=c&&c.normalize?c.normalize(a,h(b)):f(a,b):(a=f(a,b),d=k(a),e=d[0],a=d[1],e&&(c=j(e))),{f:e?e+"!"+a:a,n:a,pr:e,p:c}},p={require:function(a){return g(a)},exports:function(a){var b=q[a];return"undefined"!=typeof b?b:q[a]={}},module:function(a){return{id:a,uri:"",exports:q[a],config:l(a)}}},m=function(a,c,d,f){var h,k,l,m,n,s,u=[],v=typeof d;if(f=f||a,"undefined"===v||"function"===v){for(c=!c.length&&d.length?["require","exports","module"]:c,n=0;n<c.length;n+=1)if(m=o(c[n],f),k=m.f,"require"===k)u[n]=p.require(a);else if("exports"===k)u[n]=p.exports(a),s=!0;else if("module"===k)h=u[n]=p.module(a);else if(e(q,k)||e(r,k)||e(t,k))u[n]=j(k);else{if(!m.p)throw new Error(a+" missing "+k);m.p.load(m.n,g(f,!0),i(k),{}),u[n]=q[k]}l=d?d.apply(q[a],u):void 0,a&&(h&&h.exports!==b&&h.exports!==q[a]?q[a]=h.exports:l===b&&s||(q[a]=l))}else a&&(q[a]=d)},a=c=n=function(a,c,d,e,f){if("string"==typeof a)return p[a]?p[a](c):j(o(a,c).f);if(!a.splice){if(s=a,s.deps&&n(s.deps,s.callback),!c)return;c.splice?(a=c,c=d,d=null):a=b}return c=c||function(){},"function"==typeof d&&(d=e,e=f),e?m(b,a,c,d):setTimeout(function(){m(b,a,c,d)},4),n},n.config=function(a){return n(a)},a._defined=q,d=function(a,b,c){if("string"!=typeof a)throw new Error("See almond README: incorrect module build, no module name");b.splice||(c=b,b=[]),e(q,a)||e(r,a)||(r[a]=[a,b,c])},d.amd={jQuery:!0}}(),b.requirejs=a,b.require=c,b.define=d}}(),b.define("almond",function(){}),b.define("jquery",[],function(){var b=a||$;return null==b&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),b}),b.define("select2/utils",["jquery"],function(a){function b(a){var b=a.prototype,c=[];for(var d in b){var e=b[d];"function"==typeof e&&"constructor"!==d&&c.push(d)}return c}var c={};c.Extend=function(a,b){function c(){this.constructor=a}var d={}.hasOwnProperty;for(var e in b)d.call(b,e)&&(a[e]=b[e]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a},c.Decorate=function(a,c){function d(){var b=Array.prototype.unshift,d=c.prototype.constructor.length,e=a.prototype.constructor;d>0&&(b.call(arguments,a.prototype.constructor),e=c.prototype.constructor),e.apply(this,arguments)}function e(){this.constructor=d}var f=b(c),g=b(a);c.displayName=a.displayName,d.prototype=new e;for(var h=0;h<g.length;h++){var i=g[h];d.prototype[i]=a.prototype[i]}for(var j=(function(a){var b=function(){};a in d.prototype&&(b=d.prototype[a]);var e=c.prototype[a];return function(){var a=Array.prototype.unshift;return a.call(arguments,b),e.apply(this,arguments)}}),k=0;k<f.length;k++){var l=f[k];d.prototype[l]=j(l)}return d};var d=function(){this.listeners={}};return d.prototype.on=function(a,b){this.listeners=this.listeners||{},a in this.listeners?this.listeners[a].push(b):this.listeners[a]=[b]},d.prototype.trigger=function(a){var b=Array.prototype.slice,c=b.call(arguments,1);this.listeners=this.listeners||{},null==c&&(c=[]),0===c.length&&c.push({}),c[0]._type=a,a in this.listeners&&this.invoke(this.listeners[a],b.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},d.prototype.invoke=function(a,b){for(var c=0,d=a.length;d>c;c++)a[c].apply(this,b)},c.Observable=d,c.generateChars=function(a){for(var b="",c=0;a>c;c++){var d=Math.floor(36*Math.random());b+=d.toString(36)}return b},c.bind=function(a,b){return function(){a.apply(b,arguments)}},c._convertData=function(a){for(var b in a){var c=b.split("-"),d=a;if(1!==c.length){for(var e=0;e<c.length;e++){var f=c[e];f=f.substring(0,1).toLowerCase()+f.substring(1),f in d||(d[f]={}),e==c.length-1&&(d[f]=a[b]),d=d[f]}delete a[b]}}return a},c.hasScroll=function(b,c){var d=a(c),e=c.style.overflowX,f=c.style.overflowY;return e!==f||"hidden"!==f&&"visible"!==f?"scroll"===e||"scroll"===f?!0:d.innerHeight()<c.scrollHeight||d.innerWidth()<c.scrollWidth:!1},c.escapeMarkup=function(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return"string"!=typeof a?a:String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})},c.appendMany=function(b,c){if("1.7"===a.fn.jquery.substr(0,3)){var d=a();a.map(c,function(a){d=d.add(a)}),c=d}b.append(c)},c}),b.define("select2/results",["jquery","./utils"],function(a,b){function c(a,b,d){this.$element=a,this.data=d,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<ul class="select2-results__options" role="tree"></ul>');return this.options.get("multiple")&&b.attr("aria-multiselectable","true"),this.$results=b,b},c.prototype.clear=function(){this.$results.empty()},c.prototype.displayMessage=function(b){var c=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var d=a('<li role="treeitem" aria-live="assertive" class="select2-results__option"></li>'),e=this.options.get("translations").get(b.message);d.append(c(e(b.args))),d[0].className+=" select2-results__message",this.$results.append(d)},c.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},c.prototype.append=function(a){this.hideLoading();var b=[];if(null==a.results||0===a.results.length)return void(0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"}));a.results=this.sort(a.results);for(var c=0;c<a.results.length;c++){var d=a.results[c],e=this.option(d);b.push(e)}this.$results.append(b)},c.prototype.position=function(a,b){var c=b.find(".select2-results");c.append(a)},c.prototype.sort=function(a){var b=this.options.get("sorter");return b(a)},c.prototype.highlightFirstItem=function(){var a=this.$results.find(".select2-results__option[aria-selected]"),b=a.filter("[aria-selected=true]");b.length>0?b.first().trigger("mouseenter"):a.first().trigger("mouseenter"),this.ensureHighlightVisible()},c.prototype.setClasses=function(){var b=this;this.data.current(function(c){var d=a.map(c,function(a){return a.id.toString()}),e=b.$results.find(".select2-results__option[aria-selected]");e.each(function(){var b=a(this),c=a.data(this,"data"),e=""+c.id;null!=c.element&&c.element.selected||null==c.element&&a.inArray(e,d)>-1?b.attr("aria-selected","true"):b.attr("aria-selected","false")})})},c.prototype.showLoading=function(a){this.hideLoading();var b=this.options.get("translations").get("searching"),c={disabled:!0,loading:!0,text:b(a)},d=this.option(c);d.className+=" loading-results",this.$results.prepend(d)},c.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},c.prototype.option=function(b){var c=document.createElement("li");c.className="select2-results__option";var d={role:"treeitem","aria-selected":"false"};b.disabled&&(delete d["aria-selected"],d["aria-disabled"]="true"),null==b.id&&delete d["aria-selected"],null!=b._resultId&&(c.id=b._resultId),b.title&&(c.title=b.title),b.children&&(d.role="group",d["aria-label"]=b.text,delete d["aria-selected"]);for(var e in d){var f=d[e];c.setAttribute(e,f)}if(b.children){var g=a(c),h=document.createElement("strong");h.className="select2-results__group";a(h);this.template(b,h);for(var i=[],j=0;j<b.children.length;j++){var k=b.children[j],l=this.option(k);i.push(l)}var m=a("<ul></ul>",{"class":"select2-results__options select2-results__options--nested"});m.append(i),g.append(h),g.append(m)}else this.template(b,c);return a.data(c,"data",b),c},c.prototype.bind=function(b,c){var d=this,e=b.id+"-results";this.$results.attr("id",e),b.on("results:all",function(a){d.clear(),d.append(a.data),b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("results:append",function(a){d.append(a.data),b.isOpen()&&d.setClasses()}),b.on("query",function(a){d.hideMessages(),d.showLoading(a)}),b.on("select",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("unselect",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("open",function(){d.$results.attr("aria-expanded","true"),d.$results.attr("aria-hidden","false"),d.setClasses(),d.ensureHighlightVisible()}),b.on("close",function(){d.$results.attr("aria-expanded","false"),d.$results.attr("aria-hidden","true"),d.$results.removeAttr("aria-activedescendant")}),b.on("results:toggle",function(){var a=d.getHighlightedResults();0!==a.length&&a.trigger("mouseup")}),b.on("results:select",function(){var a=d.getHighlightedResults();if(0!==a.length){var b=a.data("data");"true"==a.attr("aria-selected")?d.trigger("close",{}):d.trigger("select",{data:b})}}),b.on("results:previous",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a);if(0!==c){var e=c-1;0===a.length&&(e=0);var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top,h=f.offset().top,i=d.$results.scrollTop()+(h-g);0===e?d.$results.scrollTop(0):0>h-g&&d.$results.scrollTop(i)}}),b.on("results:next",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a),e=c+1;if(!(e>=b.length)){var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top+d.$results.outerHeight(!1),h=f.offset().top+f.outerHeight(!1),i=d.$results.scrollTop()+h-g;0===e?d.$results.scrollTop(0):h>g&&d.$results.scrollTop(i)}}),b.on("results:focus",function(a){a.element.addClass("select2-results__option--highlighted")}),b.on("results:message",function(a){d.displayMessage(a)}),a.fn.mousewheel&&this.$results.on("mousewheel",function(a){var b=d.$results.scrollTop(),c=d.$results.get(0).scrollHeight-b+a.deltaY,e=a.deltaY>0&&b-a.deltaY<=0,f=a.deltaY<0&&c<=d.$results.height();e?(d.$results.scrollTop(0),a.preventDefault(),a.stopPropagation()):f&&(d.$results.scrollTop(d.$results.get(0).scrollHeight-d.$results.height()),a.preventDefault(),a.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(b){var c=a(this),e=c.data("data");return"true"===c.attr("aria-selected")?void(d.options.get("multiple")?d.trigger("unselect",{originalEvent:b,data:e}):d.trigger("close",{})):void d.trigger("select",{originalEvent:b,data:e})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(b){var c=a(this).data("data");d.getHighlightedResults().removeClass("select2-results__option--highlighted"),d.trigger("results:focus",{data:c,element:a(this)})})},c.prototype.getHighlightedResults=function(){var a=this.$results.find(".select2-results__option--highlighted");return a},c.prototype.destroy=function(){this.$results.remove()},c.prototype.ensureHighlightVisible=function(){var a=this.getHighlightedResults();if(0!==a.length){var b=this.$results.find("[aria-selected]"),c=b.index(a),d=this.$results.offset().top,e=a.offset().top,f=this.$results.scrollTop()+(e-d),g=e-d;f-=2*a.outerHeight(!1),2>=c?this.$results.scrollTop(0):(g>this.$results.outerHeight()||0>g)&&this.$results.scrollTop(f)}},c.prototype.template=function(b,c){var d=this.options.get("templateResult"),e=this.options.get("escapeMarkup"),f=d(b,c);null==f?c.style.display="none":"string"==typeof f?c.innerHTML=e(f):a(c).append(f)},c}),b.define("select2/keys",[],function(){var a={BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46};return a}),b.define("select2/selection/base",["jquery","../utils","../keys"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,b.Observable),d.prototype.render=function(){var b=a('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=this.$element.data("old-tabindex")?this._tabindex=this.$element.data("old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),b.attr("title",this.$element.attr("title")),b.attr("tabindex",this._tabindex),this.$selection=b,b},d.prototype.bind=function(a,b){var d=this,e=(a.id+"-container",a.id+"-results");this.container=a,this.$selection.on("focus",function(a){d.trigger("focus",a)}),this.$selection.on("blur",function(a){d._handleBlur(a)}),this.$selection.on("keydown",function(a){d.trigger("keypress",a),a.which===c.SPACE&&a.preventDefault()}),a.on("results:focus",function(a){d.$selection.attr("aria-activedescendant",a.data._resultId)}),a.on("selection:update",function(a){d.update(a.data)}),a.on("open",function(){d.$selection.attr("aria-expanded","true"),d.$selection.attr("aria-owns",e),d._attachCloseHandler(a)}),a.on("close",function(){d.$selection.attr("aria-expanded","false"),d.$selection.removeAttr("aria-activedescendant"),d.$selection.removeAttr("aria-owns"),d.$selection.focus(),d._detachCloseHandler(a)}),a.on("enable",function(){d.$selection.attr("tabindex",d._tabindex)}),a.on("disable",function(){d.$selection.attr("tabindex","-1")})},d.prototype._handleBlur=function(b){var c=this;window.setTimeout(function(){document.activeElement==c.$selection[0]||a.contains(c.$selection[0],document.activeElement)||c.trigger("blur",b)},1)},d.prototype._attachCloseHandler=function(b){a(document.body).on("mousedown.select2."+b.id,function(b){var c=a(b.target),d=c.closest(".select2"),e=a(".select2.select2-container--open");e.each(function(){var b=a(this);if(this!=d[0]){var c=b.data("element");c.select2("close")}})})},d.prototype._detachCloseHandler=function(b){a(document.body).off("mousedown.select2."+b.id)},d.prototype.position=function(a,b){var c=b.find(".selection");c.append(a)},d.prototype.destroy=function(){this._detachCloseHandler(this.container)},d.prototype.update=function(a){throw new Error("The `update` method must be defined in child classes.")},d}),b.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(a,b,c,d){function e(){e.__super__.constructor.apply(this,arguments)}return c.Extend(e,b),e.prototype.render=function(){var a=e.__super__.render.call(this);return a.addClass("select2-selection--single"),a.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),a},e.prototype.bind=function(a,b){var c=this;e.__super__.bind.apply(this,arguments);var d=a.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",d),this.$selection.attr("aria-labelledby",d),this.$selection.on("mousedown",function(a){1===a.which&&c.trigger("toggle",{originalEvent:a})}),this.$selection.on("focus",function(a){}),this.$selection.on("blur",function(a){}),a.on("focus",function(b){a.isOpen()||c.$selection.focus()}),a.on("selection:update",function(a){c.update(a.data)})},e.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},e.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},e.prototype.selectionContainer=function(){return a("<span></span>")},e.prototype.update=function(a){if(0===a.length)return void this.clear();var b=a[0],c=this.$selection.find(".select2-selection__rendered"),d=this.display(b,c);c.empty().append(d),c.prop("title",b.title||b.text)},e}),b.define("select2/selection/multiple",["jquery","./base","../utils"],function(a,b,c){function d(a,b){d.__super__.constructor.apply(this,arguments)}return c.Extend(d,b),d.prototype.render=function(){var a=d.__super__.render.call(this);return a.addClass("select2-selection--multiple"),a.html('<ul class="select2-selection__rendered"></ul>'),a},d.prototype.bind=function(b,c){var e=this;d.__super__.bind.apply(this,arguments),this.$selection.on("click",function(a){e.trigger("toggle",{originalEvent:a})}),this.$selection.on("click",".select2-selection__choice__remove",function(b){if(!e.options.get("disabled")){var c=a(this),d=c.parent(),f=d.data("data");e.trigger("unselect",{originalEvent:b,data:f})}})},d.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},d.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},d.prototype.selectionContainer=function(){var b=a('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>');return b},d.prototype.update=function(a){if(this.clear(),0!==a.length){for(var b=[],d=0;d<a.length;d++){var e=a[d],f=this.selectionContainer(),g=this.display(e,f);f.append(g),f.prop("title",e.title||e.text),f.data("data",e),b.push(f)}var h=this.$selection.find(".select2-selection__rendered");c.appendMany(h,b)}},d}),b.define("select2/selection/placeholder",["../utils"],function(a){function b(a,b,c){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c)}return b.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},b.prototype.createPlaceholder=function(a,b){var c=this.selectionContainer();return c.html(this.display(b)),c.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),c},b.prototype.update=function(a,b){var c=1==b.length&&b[0].id!=this.placeholder.id,d=b.length>1;if(d||c)return a.call(this,b);this.clear();var e=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(e)},b}),b.define("select2/selection/allowClear",["jquery","../keys"],function(a,b){function c(){}return c.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(a){d._handleClear(a)}),b.on("keypress",function(a){d._handleKeyboardClear(a,b)})},c.prototype._handleClear=function(a,b){if(!this.options.get("disabled")){var c=this.$selection.find(".select2-selection__clear");if(0!==c.length){b.stopPropagation();for(var d=c.data("data"),e=0;e<d.length;e++){var f={data:d[e]};if(this.trigger("unselect",f),f.prevented)return}this.$element.val(this.placeholder.id).trigger("change"),this.trigger("toggle",{})}}},c.prototype._handleKeyboardClear=function(a,c,d){d.isOpen()||(c.which==b.DELETE||c.which==b.BACKSPACE)&&this._handleClear(c)},c.prototype.update=function(b,c){if(b.call(this,c),!(this.$selection.find(".select2-selection__placeholder").length>0||0===c.length)){var d=a('<span class="select2-selection__clear">×</span>');d.data("data",c),this.$selection.find(".select2-selection__rendered").prepend(d)}},c}),b.define("select2/selection/search",["jquery","../utils","../keys"],function(a,b,c){function d(a,b,c){a.call(this,b,c)}return d.prototype.render=function(b){var c=a('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" aria-autocomplete="list" /></li>');this.$searchContainer=c,this.$search=c.find("input");var d=b.call(this);return this._transferTabIndex(),d},d.prototype.bind=function(a,b,d){var e=this;a.call(this,b,d),b.on("open",function(){e.$search.trigger("focus")}),b.on("close",function(){e.$search.val(""),e.$search.removeAttr("aria-activedescendant"),e.$search.trigger("focus")}),b.on("enable",function(){e.$search.prop("disabled",!1),e._transferTabIndex()}),b.on("disable",function(){e.$search.prop("disabled",!0)}),b.on("focus",function(a){e.$search.trigger("focus")}),b.on("results:focus",function(a){e.$search.attr("aria-activedescendant",a.id)}),this.$selection.on("focusin",".select2-search--inline",function(a){e.trigger("focus",a)}),this.$selection.on("focusout",".select2-search--inline",function(a){e._handleBlur(a)}),this.$selection.on("keydown",".select2-search--inline",function(a){a.stopPropagation(),e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented();var b=a.which;if(b===c.BACKSPACE&&""===e.$search.val()){var d=e.$searchContainer.prev(".select2-selection__choice");if(d.length>0){var f=d.data("data");e.searchRemoveChoice(f),a.preventDefault()}}});var f=document.documentMode,g=f&&11>=f;this.$selection.on("input.searchcheck",".select2-search--inline",function(a){return g?void e.$selection.off("input.search input.searchcheck"):void e.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(a){if(g&&"input"===a.type)return void e.$selection.off("input.search input.searchcheck");var b=a.which;b!=c.SHIFT&&b!=c.CTRL&&b!=c.ALT&&b!=c.TAB&&e.handleSearch(a)})},d.prototype._transferTabIndex=function(a){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},d.prototype.createPlaceholder=function(a,b){this.$search.attr("placeholder",b.text)},d.prototype.update=function(a,b){var c=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),a.call(this,b),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),c&&this.$search.focus()},d.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var a=this.$search.val();this.trigger("query",{term:a})}this._keyUpPrevented=!1},d.prototype.searchRemoveChoice=function(a,b){this.trigger("unselect",{data:b}),this.$search.val(b.text),this.handleSearch()},d.prototype.resizeSearch=function(){this.$search.css("width","25px");var a="";if(""!==this.$search.attr("placeholder"))a=this.$selection.find(".select2-selection__rendered").innerWidth();else{var b=this.$search.val().length+1;a=.75*b+"em"}this.$search.css("width",a)},d}),b.define("select2/selection/eventRelay",["jquery"],function(a){function b(){}return b.prototype.bind=function(b,c,d){var e=this,f=["open","opening","close","closing","select","selecting","unselect","unselecting"],g=["opening","closing","selecting","unselecting"];b.call(this,c,d),c.on("*",function(b,c){if(-1!==a.inArray(b,f)){c=c||{};var d=a.Event("select2:"+b,{params:c});e.$element.trigger(d),-1!==a.inArray(b,g)&&(c.prevented=d.isDefaultPrevented())}})},b}),b.define("select2/translation",["jquery","require"],function(a,b){function c(a){this.dict=a||{}}return c.prototype.all=function(){return this.dict},c.prototype.get=function(a){return this.dict[a]},c.prototype.extend=function(b){this.dict=a.extend({},b.all(),this.dict)},c._cache={},c.loadPath=function(a){if(!(a in c._cache)){var d=b(a);c._cache[a]=d}return new c(c._cache[a])},c}),b.define("select2/diacritics",[],function(){var a={"Ⓐ":"A","Ａ":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","Ｂ":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","Ｃ":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","Ｄ":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","Ｅ":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","Ｆ":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","Ｇ":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","Ｈ":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","Ｉ":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","Ｊ":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","Ｋ":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","Ｌ":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","Ｍ":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","Ｎ":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","Ｏ":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","Ｐ":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Ｑ":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","Ｒ":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","Ｓ":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","Ｔ":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","Ｕ":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","Ｖ":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","Ｗ":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","Ｘ":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Ｙ":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Ｚ":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","ａ":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","ｂ":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","ｃ":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","ｄ":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","ｅ":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","ｆ":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","ｇ":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","ｈ":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","ｉ":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","ｊ":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","ｋ":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","ｌ":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","ｍ":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","ｎ":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","ｏ":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","ｐ":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","ｑ":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","ｒ":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","ｓ":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","ｔ":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","ｕ":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","ｖ":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","ｗ":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","ｘ":"x","ẋ":"x","ẍ":"x","ⓨ":"y","ｙ":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","ｚ":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ω":"ω","ς":"σ"};return a}),b.define("select2/data/base",["../utils"],function(a){function b(a,c){b.__super__.constructor.call(this)}return a.Extend(b,a.Observable),b.prototype.current=function(a){throw new Error("The `current` method must be defined in child classes.")},b.prototype.query=function(a,b){throw new Error("The `query` method must be defined in child classes.")},b.prototype.bind=function(a,b){},b.prototype.destroy=function(){},b.prototype.generateResultId=function(b,c){var d=b.id+"-result-";return d+=a.generateChars(4),d+=null!=c.id?"-"+c.id.toString():"-"+a.generateChars(4)},b}),b.define("select2/data/select",["./base","../utils","jquery"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,a),d.prototype.current=function(a){var b=[],d=this;this.$element.find(":selected").each(function(){var a=c(this),e=d.item(a);b.push(e)}),a(b)},d.prototype.select=function(a){var b=this;if(a.selected=!0,c(a.element).is("option"))return a.element.selected=!0,void this.$element.trigger("change");
|
| 2 |
+
if(this.$element.prop("multiple"))this.current(function(d){var e=[];a=[a],a.push.apply(a,d);for(var f=0;f<a.length;f++){var g=a[f].id;-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")});else{var d=a.id;this.$element.val(d),this.$element.trigger("change")}},d.prototype.unselect=function(a){var b=this;if(this.$element.prop("multiple"))return a.selected=!1,c(a.element).is("option")?(a.element.selected=!1,void this.$element.trigger("change")):void this.current(function(d){for(var e=[],f=0;f<d.length;f++){var g=d[f].id;g!==a.id&&-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")})},d.prototype.bind=function(a,b){var c=this;this.container=a,a.on("select",function(a){c.select(a.data)}),a.on("unselect",function(a){c.unselect(a.data)})},d.prototype.destroy=function(){this.$element.find("*").each(function(){c.removeData(this,"data")})},d.prototype.query=function(a,b){var d=[],e=this,f=this.$element.children();f.each(function(){var b=c(this);if(b.is("option")||b.is("optgroup")){var f=e.item(b),g=e.matches(a,f);null!==g&&d.push(g)}}),b({results:d})},d.prototype.addOptions=function(a){b.appendMany(this.$element,a)},d.prototype.option=function(a){var b;a.children?(b=document.createElement("optgroup"),b.label=a.text):(b=document.createElement("option"),void 0!==b.textContent?b.textContent=a.text:b.innerText=a.text),a.id&&(b.value=a.id),a.disabled&&(b.disabled=!0),a.selected&&(b.selected=!0),a.title&&(b.title=a.title);var d=c(b),e=this._normalizeItem(a);return e.element=b,c.data(b,"data",e),d},d.prototype.item=function(a){var b={};if(b=c.data(a[0],"data"),null!=b)return b;if(a.is("option"))b={id:a.val(),text:a.text(),disabled:a.prop("disabled"),selected:a.prop("selected"),title:a.prop("title")};else if(a.is("optgroup")){b={text:a.prop("label"),children:[],title:a.prop("title")};for(var d=a.children("option"),e=[],f=0;f<d.length;f++){var g=c(d[f]),h=this.item(g);e.push(h)}b.children=e}return b=this._normalizeItem(b),b.element=a[0],c.data(a[0],"data",b),b},d.prototype._normalizeItem=function(a){c.isPlainObject(a)||(a={id:a,text:a}),a=c.extend({},{text:""},a);var b={selected:!1,disabled:!1};return null!=a.id&&(a.id=a.id.toString()),null!=a.text&&(a.text=a.text.toString()),null==a._resultId&&a.id&&null!=this.container&&(a._resultId=this.generateResultId(this.container,a)),c.extend({},b,a)},d.prototype.matches=function(a,b){var c=this.options.get("matcher");return c(a,b)},d}),b.define("select2/data/array",["./select","../utils","jquery"],function(a,b,c){function d(a,b){var c=b.get("data")||[];d.__super__.constructor.call(this,a,b),this.addOptions(this.convertToOptions(c))}return b.Extend(d,a),d.prototype.select=function(a){var b=this.$element.find("option").filter(function(b,c){return c.value==a.id.toString()});0===b.length&&(b=this.option(a),this.addOptions(b)),d.__super__.select.call(this,a)},d.prototype.convertToOptions=function(a){function d(a){return function(){return c(this).val()==a.id}}for(var e=this,f=this.$element.find("option"),g=f.map(function(){return e.item(c(this)).id}).get(),h=[],i=0;i<a.length;i++){var j=this._normalizeItem(a[i]);if(c.inArray(j.id,g)>=0){var k=f.filter(d(j)),l=this.item(k),m=c.extend(!0,{},j,l),n=this.option(m);k.replaceWith(n)}else{var o=this.option(j);if(j.children){var p=this.convertToOptions(j.children);b.appendMany(o,p)}h.push(o)}}return h},d}),b.define("select2/data/ajax",["./array","../utils","jquery"],function(a,b,c){function d(a,b){this.ajaxOptions=this._applyDefaults(b.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),d.__super__.constructor.call(this,a,b)}return b.Extend(d,a),d.prototype._applyDefaults=function(a){var b={data:function(a){return c.extend({},a,{q:a.term})},transport:function(a,b,d){var e=c.ajax(a);return e.then(b),e.fail(d),e}};return c.extend({},b,a,!0)},d.prototype.processResults=function(a){return a},d.prototype.query=function(a,b){function d(){var d=f.transport(f,function(d){var f=e.processResults(d,a);e.options.get("debug")&&window.console&&console.error&&(f&&f.results&&c.isArray(f.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),b(f)},function(){d.status&&"0"===d.status||e.trigger("results:message",{message:"errorLoading"})});e._request=d}var e=this;null!=this._request&&(c.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var f=c.extend({type:"GET"},this.ajaxOptions);"function"==typeof f.url&&(f.url=f.url.call(this.$element,a)),"function"==typeof f.data&&(f.data=f.data.call(this.$element,a)),this.ajaxOptions.delay&&null!=a.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(d,this.ajaxOptions.delay)):d()},d}),b.define("select2/data/tags",["jquery"],function(a){function b(b,c,d){var e=d.get("tags"),f=d.get("createTag");void 0!==f&&(this.createTag=f);var g=d.get("insertTag");if(void 0!==g&&(this.insertTag=g),b.call(this,c,d),a.isArray(e))for(var h=0;h<e.length;h++){var i=e[h],j=this._normalizeItem(i),k=this.option(j);this.$element.append(k)}}return b.prototype.query=function(a,b,c){function d(a,f){for(var g=a.results,h=0;h<g.length;h++){var i=g[h],j=null!=i.children&&!d({results:i.children},!0),k=i.text===b.term;if(k||j)return f?!1:(a.data=g,void c(a))}if(f)return!0;var l=e.createTag(b);if(null!=l){var m=e.option(l);m.attr("data-select2-tag",!0),e.addOptions([m]),e.insertTag(g,l)}a.results=g,c(a)}var e=this;return this._removeOldTags(),null==b.term||null!=b.page?void a.call(this,b,c):void a.call(this,b,d)},b.prototype.createTag=function(b,c){var d=a.trim(c.term);return""===d?null:{id:d,text:d}},b.prototype.insertTag=function(a,b,c){b.unshift(c)},b.prototype._removeOldTags=function(b){var c=(this._lastTag,this.$element.find("option[data-select2-tag]"));c.each(function(){this.selected||a(this).remove()})},b}),b.define("select2/data/tokenizer",["jquery"],function(a){function b(a,b,c){var d=c.get("tokenizer");void 0!==d&&(this.tokenizer=d),a.call(this,b,c)}return b.prototype.bind=function(a,b,c){a.call(this,b,c),this.$search=b.dropdown.$search||b.selection.$search||c.find(".select2-search__field")},b.prototype.query=function(b,c,d){function e(b){var c=g._normalizeItem(b),d=g.$element.find("option").filter(function(){return a(this).val()===c.id});if(!d.length){var e=g.option(c);e.attr("data-select2-tag",!0),g._removeOldTags(),g.addOptions([e])}f(c)}function f(a){g.trigger("select",{data:a})}var g=this;c.term=c.term||"";var h=this.tokenizer(c,this.options,e);h.term!==c.term&&(this.$search.length&&(this.$search.val(h.term),this.$search.focus()),c.term=h.term),b.call(this,c,d)},b.prototype.tokenizer=function(b,c,d,e){for(var f=d.get("tokenSeparators")||[],g=c.term,h=0,i=this.createTag||function(a){return{id:a.term,text:a.term}};h<g.length;){var j=g[h];if(-1!==a.inArray(j,f)){var k=g.substr(0,h),l=a.extend({},c,{term:k}),m=i(l);null!=m?(e(m),g=g.substr(h+1)||"",h=0):h++}else h++}return{term:g}},b}),b.define("select2/data/minimumInputLength",[],function(){function a(a,b,c){this.minimumInputLength=c.get("minimumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",b.term.length<this.minimumInputLength?void this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumInputLength",[],function(){function a(a,b,c){this.maximumInputLength=c.get("maximumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",this.maximumInputLength>0&&b.term.length>this.maximumInputLength?void this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumSelectionLength",[],function(){function a(a,b,c){this.maximumSelectionLength=c.get("maximumSelectionLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){var d=this;this.current(function(e){var f=null!=e?e.length:0;return d.maximumSelectionLength>0&&f>=d.maximumSelectionLength?void d.trigger("results:message",{message:"maximumSelected",args:{maximum:d.maximumSelectionLength}}):void a.call(d,b,c)})},a}),b.define("select2/dropdown",["jquery","./utils"],function(a,b){function c(a,b){this.$element=a,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<span class="select2-dropdown"><span class="select2-results"></span></span>');return b.attr("dir",this.options.get("dir")),this.$dropdown=b,b},c.prototype.bind=function(){},c.prototype.position=function(a,b){},c.prototype.destroy=function(){this.$dropdown.remove()},c}),b.define("select2/dropdown/search",["jquery","../utils"],function(a,b){function c(){}return c.prototype.render=function(b){var c=b.call(this),d=a('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" /></span>');return this.$searchContainer=d,this.$search=d.find("input"),c.prepend(d),c},c.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),this.$search.on("keydown",function(a){e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented()}),this.$search.on("input",function(b){a(this).off("keyup")}),this.$search.on("keyup input",function(a){e.handleSearch(a)}),c.on("open",function(){e.$search.attr("tabindex",0),e.$search.focus(),window.setTimeout(function(){e.$search.focus()},0)}),c.on("close",function(){e.$search.attr("tabindex",-1),e.$search.val("")}),c.on("focus",function(){c.isOpen()&&e.$search.focus()}),c.on("results:all",function(a){if(null==a.query.term||""===a.query.term){var b=e.showSearch(a);b?e.$searchContainer.removeClass("select2-search--hide"):e.$searchContainer.addClass("select2-search--hide")}})},c.prototype.handleSearch=function(a){if(!this._keyUpPrevented){var b=this.$search.val();this.trigger("query",{term:b})}this._keyUpPrevented=!1},c.prototype.showSearch=function(a,b){return!0},c}),b.define("select2/dropdown/hidePlaceholder",[],function(){function a(a,b,c,d){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c,d)}return a.prototype.append=function(a,b){b.results=this.removePlaceholder(b.results),a.call(this,b)},a.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},a.prototype.removePlaceholder=function(a,b){for(var c=b.slice(0),d=b.length-1;d>=0;d--){var e=b[d];this.placeholder.id===e.id&&c.splice(d,1)}return c},a}),b.define("select2/dropdown/infiniteScroll",["jquery"],function(a){function b(a,b,c,d){this.lastParams={},a.call(this,b,c,d),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return b.prototype.append=function(a,b){this.$loadingMore.remove(),this.loading=!1,a.call(this,b),this.showLoadingMore(b)&&this.$results.append(this.$loadingMore)},b.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),c.on("query",function(a){e.lastParams=a,e.loading=!0}),c.on("query:append",function(a){e.lastParams=a,e.loading=!0}),this.$results.on("scroll",function(){var b=a.contains(document.documentElement,e.$loadingMore[0]);if(!e.loading&&b){var c=e.$results.offset().top+e.$results.outerHeight(!1),d=e.$loadingMore.offset().top+e.$loadingMore.outerHeight(!1);c+50>=d&&e.loadMore()}})},b.prototype.loadMore=function(){this.loading=!0;var b=a.extend({},{page:1},this.lastParams);b.page++,this.trigger("query:append",b)},b.prototype.showLoadingMore=function(a,b){return b.pagination&&b.pagination.more},b.prototype.createLoadingMore=function(){var b=a('<li class="select2-results__option select2-results__option--load-more"role="treeitem" aria-disabled="true"></li>'),c=this.options.get("translations").get("loadingMore");return b.html(c(this.lastParams)),b},b}),b.define("select2/dropdown/attachBody",["jquery","../utils"],function(a,b){function c(b,c,d){this.$dropdownParent=d.get("dropdownParent")||a(document.body),b.call(this,c,d)}return c.prototype.bind=function(a,b,c){var d=this,e=!1;a.call(this,b,c),b.on("open",function(){d._showDropdown(),d._attachPositioningHandler(b),e||(e=!0,b.on("results:all",function(){d._positionDropdown(),d._resizeDropdown()}),b.on("results:append",function(){d._positionDropdown(),d._resizeDropdown()}))}),b.on("close",function(){d._hideDropdown(),d._detachPositioningHandler(b)}),this.$dropdownContainer.on("mousedown",function(a){a.stopPropagation()})},c.prototype.destroy=function(a){a.call(this),this.$dropdownContainer.remove()},c.prototype.position=function(a,b,c){b.attr("class",c.attr("class")),b.removeClass("select2"),b.addClass("select2-container--open"),b.css({position:"absolute",top:-999999}),this.$container=c},c.prototype.render=function(b){var c=a("<span></span>"),d=b.call(this);return c.append(d),this.$dropdownContainer=c,c},c.prototype._hideDropdown=function(a){this.$dropdownContainer.detach()},c.prototype._attachPositioningHandler=function(c,d){var e=this,f="scroll.select2."+d.id,g="resize.select2."+d.id,h="orientationchange.select2."+d.id,i=this.$container.parents().filter(b.hasScroll);i.each(function(){a(this).data("select2-scroll-position",{x:a(this).scrollLeft(),y:a(this).scrollTop()})}),i.on(f,function(b){var c=a(this).data("select2-scroll-position");a(this).scrollTop(c.y)}),a(window).on(f+" "+g+" "+h,function(a){e._positionDropdown(),e._resizeDropdown()})},c.prototype._detachPositioningHandler=function(c,d){var e="scroll.select2."+d.id,f="resize.select2."+d.id,g="orientationchange.select2."+d.id,h=this.$container.parents().filter(b.hasScroll);h.off(e),a(window).off(e+" "+f+" "+g)},c.prototype._positionDropdown=function(){var b=a(window),c=this.$dropdown.hasClass("select2-dropdown--above"),d=this.$dropdown.hasClass("select2-dropdown--below"),e=null,f=this.$container.offset();f.bottom=f.top+this.$container.outerHeight(!1);var g={height:this.$container.outerHeight(!1)};g.top=f.top,g.bottom=f.top+g.height;var h={height:this.$dropdown.outerHeight(!1)},i={top:b.scrollTop(),bottom:b.scrollTop()+b.height()},j=i.top<f.top-h.height,k=i.bottom>f.bottom+h.height,l={left:f.left,top:g.bottom},m=this.$dropdownParent;"static"===m.css("position")&&(m=m.offsetParent());var n=m.offset();l.top-=n.top,l.left-=n.left,c||d||(e="below"),k||!j||c?!j&&k&&c&&(e="below"):e="above",("above"==e||c&&"below"!==e)&&(l.top=g.top-n.top-h.height),null!=e&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+e),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+e)),this.$dropdownContainer.css(l)},c.prototype._resizeDropdown=function(){var a={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(a.minWidth=a.width,a.position="relative",a.width="auto"),this.$dropdown.css(a)},c.prototype._showDropdown=function(a){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},c}),b.define("select2/dropdown/minimumResultsForSearch",[],function(){function a(b){for(var c=0,d=0;d<b.length;d++){var e=b[d];e.children?c+=a(e.children):c++}return c}function b(a,b,c,d){this.minimumResultsForSearch=c.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),a.call(this,b,c,d)}return b.prototype.showSearch=function(b,c){return a(c.data.results)<this.minimumResultsForSearch?!1:b.call(this,c)},b}),b.define("select2/dropdown/selectOnClose",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("close",function(a){d._handleSelectOnClose(a)})},a.prototype._handleSelectOnClose=function(a,b){if(b&&null!=b.originalSelect2Event){var c=b.originalSelect2Event;if("select"===c._type||"unselect"===c._type)return}var d=this.getHighlightedResults();if(!(d.length<1)){var e=d.data("data");null!=e.element&&e.element.selected||null==e.element&&e.selected||this.trigger("select",{data:e})}},a}),b.define("select2/dropdown/closeOnSelect",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("select",function(a){d._selectTriggered(a)}),b.on("unselect",function(a){d._selectTriggered(a)})},a.prototype._selectTriggered=function(a,b){var c=b.originalEvent;c&&c.ctrlKey||this.trigger("close",{originalEvent:c,originalSelect2Event:b})},a}),b.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(a){var b=a.input.length-a.maximum,c="Please delete "+b+" character";return 1!=b&&(c+="s"),c},inputTooShort:function(a){var b=a.minimum-a.input.length,c="Please enter "+b+" or more characters";return c},loadingMore:function(){return"Loading more results…"},maximumSelected:function(a){var b="You can only select "+a.maximum+" item";return 1!=a.maximum&&(b+="s"),b},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),b.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(a,b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C){function D(){this.reset()}D.prototype.apply=function(l){if(l=a.extend(!0,{},this.defaults,l),null==l.dataAdapter){if(null!=l.ajax?l.dataAdapter=o:null!=l.data?l.dataAdapter=n:l.dataAdapter=m,l.minimumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,r)),l.maximumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,s)),l.maximumSelectionLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,t)),l.tags&&(l.dataAdapter=j.Decorate(l.dataAdapter,p)),(null!=l.tokenSeparators||null!=l.tokenizer)&&(l.dataAdapter=j.Decorate(l.dataAdapter,q)),null!=l.query){var C=b(l.amdBase+"compat/query");l.dataAdapter=j.Decorate(l.dataAdapter,C)}if(null!=l.initSelection){var D=b(l.amdBase+"compat/initSelection");l.dataAdapter=j.Decorate(l.dataAdapter,D)}}if(null==l.resultsAdapter&&(l.resultsAdapter=c,null!=l.ajax&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,x)),null!=l.placeholder&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,w)),l.selectOnClose&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,A))),null==l.dropdownAdapter){if(l.multiple)l.dropdownAdapter=u;else{var E=j.Decorate(u,v);l.dropdownAdapter=E}if(0!==l.minimumResultsForSearch&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,z)),l.closeOnSelect&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,B)),null!=l.dropdownCssClass||null!=l.dropdownCss||null!=l.adaptDropdownCssClass){var F=b(l.amdBase+"compat/dropdownCss");l.dropdownAdapter=j.Decorate(l.dropdownAdapter,F)}l.dropdownAdapter=j.Decorate(l.dropdownAdapter,y)}if(null==l.selectionAdapter){if(l.multiple?l.selectionAdapter=e:l.selectionAdapter=d,null!=l.placeholder&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,f)),l.allowClear&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,g)),l.multiple&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,h)),null!=l.containerCssClass||null!=l.containerCss||null!=l.adaptContainerCssClass){var G=b(l.amdBase+"compat/containerCss");l.selectionAdapter=j.Decorate(l.selectionAdapter,G)}l.selectionAdapter=j.Decorate(l.selectionAdapter,i)}if("string"==typeof l.language)if(l.language.indexOf("-")>0){var H=l.language.split("-"),I=H[0];l.language=[l.language,I]}else l.language=[l.language];if(a.isArray(l.language)){var J=new k;l.language.push("en");for(var K=l.language,L=0;L<K.length;L++){var M=K[L],N={};try{N=k.loadPath(M)}catch(O){try{M=this.defaults.amdLanguageBase+M,N=k.loadPath(M)}catch(P){l.debug&&window.console&&console.warn&&console.warn('Select2: The language file for "'+M+'" could not be automatically loaded. A fallback will be used instead.');continue}}J.extend(N)}l.translations=J}else{var Q=k.loadPath(this.defaults.amdLanguageBase+"en"),R=new k(l.language);R.extend(Q),l.translations=R}return l},D.prototype.reset=function(){function b(a){function b(a){return l[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function c(d,e){if(""===a.trim(d.term))return e;if(e.children&&e.children.length>0){for(var f=a.extend(!0,{},e),g=e.children.length-1;g>=0;g--){var h=e.children[g],i=c(d,h);null==i&&f.children.splice(g,1)}return f.children.length>0?f:c(d,f)}var j=b(e.text).toUpperCase(),k=b(d.term).toUpperCase();return j.indexOf(k)>-1?e:null}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:j.escapeMarkup,language:C,matcher:c,minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,sorter:function(a){return a},templateResult:function(a){return a.text},templateSelection:function(a){return a.text},theme:"default",width:"resolve"}},D.prototype.set=function(b,c){var d=a.camelCase(b),e={};e[d]=c;var f=j._convertData(e);a.extend(this.defaults,f)};var E=new D;return E}),b.define("select2/options",["require","jquery","./defaults","./utils"],function(a,b,c,d){function e(b,e){if(this.options=b,null!=e&&this.fromElement(e),this.options=c.apply(this.options),e&&e.is("input")){var f=a(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=d.Decorate(this.options.dataAdapter,f)}}return e.prototype.fromElement=function(a){var c=["select2"];null==this.options.multiple&&(this.options.multiple=a.prop("multiple")),null==this.options.disabled&&(this.options.disabled=a.prop("disabled")),null==this.options.language&&(a.prop("lang")?this.options.language=a.prop("lang").toLowerCase():a.closest("[lang]").prop("lang")&&(this.options.language=a.closest("[lang]").prop("lang"))),null==this.options.dir&&(a.prop("dir")?this.options.dir=a.prop("dir"):a.closest("[dir]").prop("dir")?this.options.dir=a.closest("[dir]").prop("dir"):this.options.dir="ltr"),a.prop("disabled",this.options.disabled),a.prop("multiple",this.options.multiple),a.data("select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),a.data("data",a.data("select2Tags")),a.data("tags",!0)),a.data("ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),a.attr("ajax--url",a.data("ajaxUrl")),a.data("ajax--url",a.data("ajaxUrl")));var e={};e=b.fn.jquery&&"1."==b.fn.jquery.substr(0,2)&&a[0].dataset?b.extend(!0,{},a[0].dataset,a.data()):a.data();var f=b.extend(!0,{},e);f=d._convertData(f);for(var g in f)b.inArray(g,c)>-1||(b.isPlainObject(this.options[g])?b.extend(this.options[g],f[g]):this.options[g]=f[g]);return this},e.prototype.get=function(a){return this.options[a]},e.prototype.set=function(a,b){this.options[a]=b},e}),b.define("select2/core",["jquery","./options","./utils","./keys"],function(a,b,c,d){var e=function(a,c){null!=a.data("select2")&&a.data("select2").destroy(),this.$element=a,this.id=this._generateId(a),c=c||{},this.options=new b(c,a),e.__super__.constructor.call(this);var d=a.attr("tabindex")||0;a.data("old-tabindex",d),a.attr("tabindex","-1");var f=this.options.get("dataAdapter");this.dataAdapter=new f(a,this.options);var g=this.render();this._placeContainer(g);var h=this.options.get("selectionAdapter");this.selection=new h(a,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,g);var i=this.options.get("dropdownAdapter");this.dropdown=new i(a,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,g);var j=this.options.get("resultsAdapter");this.results=new j(a,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var k=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(a){k.trigger("selection:update",{data:a})}),a.addClass("select2-hidden-accessible"),a.attr("aria-hidden","true"),this._syncAttributes(),a.data("select2",this)};return c.Extend(e,c.Observable),e.prototype._generateId=function(a){var b="";return b=null!=a.attr("id")?a.attr("id"):null!=a.attr("name")?a.attr("name")+"-"+c.generateChars(2):c.generateChars(4),b=b.replace(/(:|\.|\[|\]|,)/g,""),b="select2-"+b},e.prototype._placeContainer=function(a){a.insertAfter(this.$element);var b=this._resolveWidth(this.$element,this.options.get("width"));null!=b&&a.css("width",b)},e.prototype._resolveWidth=function(a,b){var c=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==b){var d=this._resolveWidth(a,"style");return null!=d?d:this._resolveWidth(a,"element")}if("element"==b){var e=a.outerWidth(!1);return 0>=e?"auto":e+"px"}if("style"==b){var f=a.attr("style");if("string"!=typeof f)return null;for(var g=f.split(";"),h=0,i=g.length;i>h;h+=1){var j=g[h].replace(/\s/g,""),k=j.match(c);if(null!==k&&k.length>=1)return k[1]}return null}return b},e.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},e.prototype._registerDomEvents=function(){var b=this;this.$element.on("change.select2",function(){b.dataAdapter.current(function(a){b.trigger("selection:update",{data:a})})}),this.$element.on("focus.select2",function(a){b.trigger("focus",a)}),this._syncA=c.bind(this._syncAttributes,this),this._syncS=c.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=d?(this._observer=new d(function(c){a.each(c,b._syncA),a.each(c,b._syncS)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",b._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",b._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",b._syncS,!1))},e.prototype._registerDataEvents=function(){var a=this;this.dataAdapter.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerSelectionEvents=function(){var b=this,c=["toggle","focus"];this.selection.on("toggle",function(){b.toggleDropdown()}),this.selection.on("focus",function(a){b.focus(a)}),this.selection.on("*",function(d,e){-1===a.inArray(d,c)&&b.trigger(d,e)})},e.prototype._registerDropdownEvents=function(){var a=this;this.dropdown.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerResultsEvents=function(){var a=this;this.results.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerEvents=function(){var a=this;this.on("open",function(){a.$container.addClass("select2-container--open")}),this.on("close",function(){a.$container.removeClass("select2-container--open")}),this.on("enable",function(){a.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){a.$container.addClass("select2-container--disabled")}),this.on("blur",function(){a.$container.removeClass("select2-container--focus")}),this.on("query",function(b){a.isOpen()||a.trigger("open",{}),this.dataAdapter.query(b,function(c){a.trigger("results:all",{data:c,query:b})})}),this.on("query:append",function(b){this.dataAdapter.query(b,function(c){a.trigger("results:append",{data:c,query:b})})}),this.on("keypress",function(b){var c=b.which;a.isOpen()?c===d.ESC||c===d.TAB||c===d.UP&&b.altKey?(a.close(),b.preventDefault()):c===d.ENTER?(a.trigger("results:select",{}),b.preventDefault()):c===d.SPACE&&b.ctrlKey?(a.trigger("results:toggle",{}),b.preventDefault()):c===d.UP?(a.trigger("results:previous",{}),b.preventDefault()):c===d.DOWN&&(a.trigger("results:next",{}),b.preventDefault()):(c===d.ENTER||c===d.SPACE||c===d.DOWN&&b.altKey)&&(a.open(),b.preventDefault())})},e.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.options.get("disabled")?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},e.prototype._syncSubtree=function(a,b){var c=!1,d=this;if(!a||!a.target||"OPTION"===a.target.nodeName||"OPTGROUP"===a.target.nodeName){if(b)if(b.addedNodes&&b.addedNodes.length>0)for(var e=0;e<b.addedNodes.length;e++){var f=b.addedNodes[e];f.selected&&(c=!0)}else b.removedNodes&&b.removedNodes.length>0&&(c=!0);else c=!0;c&&this.dataAdapter.current(function(a){d.trigger("selection:update",{data:a})})}},e.prototype.trigger=function(a,b){var c=e.__super__.trigger,d={open:"opening",close:"closing",select:"selecting",unselect:"unselecting"};if(void 0===b&&(b={}),a in d){var f=d[a],g={prevented:!1,name:a,args:b};if(c.call(this,f,g),g.prevented)return void(b.prevented=!0)}c.call(this,a,b)},e.prototype.toggleDropdown=function(){this.options.get("disabled")||(this.isOpen()?this.close():this.open())},e.prototype.open=function(){this.isOpen()||this.trigger("query",{})},e.prototype.close=function(){this.isOpen()&&this.trigger("close",{})},e.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},e.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},e.prototype.focus=function(a){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},e.prototype.enable=function(a){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),(null==a||0===a.length)&&(a=[!0]);var b=!a[0];this.$element.prop("disabled",b)},e.prototype.data=function(){this.options.get("debug")&&arguments.length>0&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var a=[];return this.dataAdapter.current(function(b){a=b}),a},e.prototype.val=function(b){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==b||0===b.length)return this.$element.val();var c=b[0];a.isArray(c)&&(c=a.map(c,function(a){return a.toString()})),this.$element.val(c).trigger("change")},e.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",this.$element.data("old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null;
|
| 3 |
+
},e.prototype.render=function(){var b=a('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return b.attr("dir",this.options.get("dir")),this.$container=b,this.$container.addClass("select2-container--"+this.options.get("theme")),b.data("element",this.$element),b},e}),b.define("jquery-mousewheel",["jquery"],function(a){return a}),b.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults"],function(a,b,c,d){if(null==a.fn.select2){var e=["open","close","destroy"];a.fn.select2=function(b){if(b=b||{},"object"==typeof b)return this.each(function(){var d=a.extend(!0,{},b);new c(a(this),d)}),this;if("string"==typeof b){var d,f=Array.prototype.slice.call(arguments,1);return this.each(function(){var c=a(this).data("select2");null==c&&window.console&&console.error&&console.error("The select2('"+b+"') method was called on an element that is not using Select2."),d=c[b].apply(c,f)}),a.inArray(b,e)>-1?this:d}throw new Error("Invalid arguments for Select2: "+b)}}return null==a.fn.select2.defaults&&(a.fn.select2.defaults=d),c}),{define:b.define,require:b.require}}(),c=b.require("jquery.select2");return a.fn.select2.amd=b,c});
|
trunk/assets/js/wcv-admin-quick-edit.js
ADDED
|
@@ -0,0 +1,34 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(function(){
|
| 2 |
+
jQuery('#the-list').on('click', '.editinline', function(){
|
| 3 |
+
|
| 4 |
+
if (jQuery('.inline-edit-author').length && jQuery('.inline-edit-author-new').length) {
|
| 5 |
+
jQuery('.inline-edit-author').hide();
|
| 6 |
+
jQuery('.inline-edit-author').attr('class', 'inline-edit-author-old');
|
| 7 |
+
jQuery('select[name=post_author]').attr('name', 'post_author-old');
|
| 8 |
+
jQuery('.inline-edit-author-new').attr('class', 'inline-edit-author');
|
| 9 |
+
jQuery('select[name=post_author-new]').attr('name', 'post_author');
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
inlineEditPost.revert();
|
| 13 |
+
|
| 14 |
+
var post_id = jQuery(this).closest('tr').attr('id');
|
| 15 |
+
|
| 16 |
+
post_id = post_id.replace("post-", "");
|
| 17 |
+
|
| 18 |
+
var wcv_inline_data = jQuery('#vendor_' + post_id),
|
| 19 |
+
wc_inline_data = jQuery('#woocommerce_inline_' + post_id );
|
| 20 |
+
|
| 21 |
+
var vendor = wcv_inline_data.find("#_vendor").text();
|
| 22 |
+
|
| 23 |
+
jQuery('select[name="post_author"] option[value="' + vendor + '"]', '.inline-edit-row').attr('selected', 'selected');
|
| 24 |
+
|
| 25 |
+
var product_type = wc_inline_data.find('.product_type').val();
|
| 26 |
+
|
| 27 |
+
if (product_type=='simple' || product_type=='external') {
|
| 28 |
+
jQuery('.vendor', '.inline-edit-row').show();
|
| 29 |
+
} else {
|
| 30 |
+
jQuery('.vendor', '.inline-edit-row').hide();
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
});
|
| 34 |
+
});
|
trunk/assets/js/wcv-commissions.js
ADDED
|
@@ -0,0 +1,11 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
// global variable
|
| 2 |
+
jQuery(function(){
|
| 3 |
+
|
| 4 |
+
jQuery('.select2').select2(
|
| 5 |
+
{
|
| 6 |
+
placeholder: wcv_commissions_select.placeholder,
|
| 7 |
+
allowClear: wcv_commissions_select.allowclear
|
| 8 |
+
}
|
| 9 |
+
);
|
| 10 |
+
|
| 11 |
+
});
|
trunk/changelog.txt
ADDED
|
@@ -0,0 +1,582 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Changelog for WC Vendors
|
| 2 |
+
|
| 3 |
+
Version 1.9.11
|
| 4 |
+
|
| 5 |
+
* Fixed: Correct product id being parsed to shipping function
|
| 6 |
+
* Fixed: Payment method notice due to direct access to object property
|
| 7 |
+
* Fixed: Sold by incorrectly showing in cart for variations
|
| 8 |
+
|
| 9 |
+
Version 1.9.10
|
| 10 |
+
|
| 11 |
+
* Fixed: Terms & Conditions Checkbox is not functioning normally #348
|
| 12 |
+
* Fixed: Apply to Become a Vendor Checkbox is Missing with WC 3.0 + WC Vendors 1.9.9 #349
|
| 13 |
+
* Fixed: New product title formatting is showing product #350
|
| 14 |
+
* Fixed: Incorrect use of wpdb->prepare
|
| 15 |
+
* Fixed: Mark shipped filter not providing parameters correctly
|
| 16 |
+
* Fixed: Incorrect reference to billing email in notification email
|
| 17 |
+
* Updated: Removed Sales reports from backend
|
| 18 |
+
|
| 19 |
+
Version 1.9.9
|
| 20 |
+
|
| 21 |
+
* Added: Filters to vendor admin dashboard class for custom columns #339
|
| 22 |
+
* Added: Vendor shop name to the <title> tag on products archive page
|
| 23 |
+
* Updated Woocommerce 2.7 compatibility
|
| 24 |
+
* Updated: i18n text domain loading for proper translations #341
|
| 25 |
+
* Fixed: Class logger when called via includes files
|
| 26 |
+
* Fixed: Bug in how admin notices are displayed when saving shop settings
|
| 27 |
+
* Fixed: 2.7 compatibility bugs
|
| 28 |
+
* Fixed: Commissions Subtotal showing Full Product Price in vendor email #330
|
| 29 |
+
* Fixed: Capabilities Fix for Resetting Roles #329
|
| 30 |
+
* Fixed: HTML title attribute doesn't change for store pages #328
|
| 31 |
+
* Fixed: Login form not displayed if get variable set
|
| 32 |
+
* Fixed: Depreciated action in product edit screen
|
| 33 |
+
|
| 34 |
+
Templates Updated:
|
| 35 |
+
templates/emails/vendor-new-order.php
|
| 36 |
+
templates/emails/notify-vendor-shipped.php
|
| 37 |
+
templates/order/orders.php
|
| 38 |
+
|
| 39 |
+
Version 1.9.8
|
| 40 |
+
|
| 41 |
+
* Fixed: Paypal adaptive payments url changes
|
| 42 |
+
* Added: Store Vendor ID in vendor child order #326
|
| 43 |
+
* Added: 100% Japanese translations thanks to Shohei Tanaka
|
| 44 |
+
|
| 45 |
+
Version 1.9.7
|
| 46 |
+
|
| 47 |
+
* Fixed: Capabilities Fix for Resetting Roles #329
|
| 48 |
+
|
| 49 |
+
Version 1.9.6
|
| 50 |
+
|
| 51 |
+
* Added: Commission Query Functions #321
|
| 52 |
+
* Added: Template for sold by in shop loop #324
|
| 53 |
+
* Merged: Extended commissions management #319 from MounirHamani
|
| 54 |
+
* Updated: Brazilian Portuguese translation
|
| 55 |
+
* Template Added:
|
| 56 |
+
templates/front/vendor-sold-by.php
|
| 57 |
+
|
| 58 |
+
Version 1.9.5
|
| 59 |
+
|
| 60 |
+
* Added: Automated language file builds
|
| 61 |
+
* Added: Vendors can now delete media in the media uploader
|
| 62 |
+
* Updated: Commissions table in backend now shows cost breakdowns
|
| 63 |
+
* Fixed: Removed legacy code for unsupported shipping methods
|
| 64 |
+
* Fixed: Rounding issue with 100% commission and coupons in pro
|
| 65 |
+
|
| 66 |
+
Version 1.9.4
|
| 67 |
+
|
| 68 |
+
* Added: Filter to add delayed payment possibility #309
|
| 69 |
+
* Added: WPML support configuration file
|
| 70 |
+
* Updated: Brazilian translation files thanks Luis!
|
| 71 |
+
* Fixed: Using "date_i18n" instead of just "date" #316 from CasperBraske
|
| 72 |
+
* Fixed: Geczy text domain in the settings file #314
|
| 73 |
+
* Fixed: Commissions lock on one vendor after some actions are made #311
|
| 74 |
+
* Fixed: Vendor dashboard Orders Export link is dead #306
|
| 75 |
+
* Fixed: Vendor sorting in commissions - no option to NOT choose a vendor #305
|
| 76 |
+
* Fixed: vendor order admin product metadata loading #298 from mikko-niemikorpi
|
| 77 |
+
* Fixed: Commission status translatable in reports thanks CasperBraske
|
| 78 |
+
* Fixed: Translatable strings thanks CasperBraske
|
| 79 |
+
* Fixed: Issues with translation strings
|
| 80 |
+
* Fixed: Incorrect variable reference
|
| 81 |
+
* Fixed: bp_setup_current_user was called incorrectly
|
| 82 |
+
* Fixed: Display of variations on main dashboard
|
| 83 |
+
* Fixed: Trying to get property of non-object
|
| 84 |
+
* Fixed: Variation data styles in order display in wp-admin
|
| 85 |
+
* Fixed: Save user meta fields when pending vendor
|
| 86 |
+
* Fixed: Incorrect url string format in french translation
|
| 87 |
+
* Templates Updated:
|
| 88 |
+
templates/dashboard/orders.php
|
| 89 |
+
|
| 90 |
+
Version 1.9.3
|
| 91 |
+
|
| 92 |
+
* Fixed: Only load asset on orders page in admin
|
| 93 |
+
* Fixed: Not showing orders on vendor dashboard for new installations
|
| 94 |
+
* Updated: Persian translations thanks to Alireza
|
| 95 |
+
|
| 96 |
+
Version 1.9.2
|
| 97 |
+
|
| 98 |
+
* Added: Reverse commission when order emptied from trash #277
|
| 99 |
+
* Added: Daily Payout option for PayPal Cron #297
|
| 100 |
+
* Added: Vendor select2 on the commissions page #284
|
| 101 |
+
* Added: Button to reset vendor roles & WC Vendors settings to WooCoomerce system status tools page #230
|
| 102 |
+
* Added: Dutch Translation, thanks @jjclinton
|
| 103 |
+
* Added: Date filter for order queries
|
| 104 |
+
* Added: Turkish translations thanks Hakan
|
| 105 |
+
* Added: $wc_vendors object variable
|
| 106 |
+
* Added: Action to fire after dashboard links (wcvendors_after_links)
|
| 107 |
+
* Added: Body css classes to set pages
|
| 108 |
+
* Updated: Support for woo commerce minimum and readme
|
| 109 |
+
* Fixed: Mark commission reversed bulk action on commissions table
|
| 110 |
+
* Fixed: No longer have to save permalink settings when updating WC Vendors options
|
| 111 |
+
* Fixed: Orders page not set on fresh install
|
| 112 |
+
* Fixed: Property of non object #300
|
| 113 |
+
* Fixed: Translation for Mark Shipped #296
|
| 114 |
+
* Fixed: Too many redirect loops if pages not set #290
|
| 115 |
+
* Fixed: Non-Object Notice in install #289
|
| 116 |
+
* Fixed: Rounding error with 100% commission thanks Brett!
|
| 117 |
+
* Fixed: text domain for email templates
|
| 118 |
+
* Fixed: Don't start session if user isn't logged
|
| 119 |
+
* Fixed: Session error on log out if session doesn't exist
|
| 120 |
+
* Fixed: Settings image selector bug
|
| 121 |
+
* Merged pull request #302 from NicolasBernier - Completed French Translations, Thanks!
|
| 122 |
+
* Merged: pull request #293 from stodorovic/fix_init_sessions
|
| 123 |
+
|
| 124 |
+
Version 1.9.1
|
| 125 |
+
|
| 126 |
+
* Added: GitHub Plugin URI for afragen/github-updater #282 thanks Agoruh
|
| 127 |
+
* Added: Edit and View page settings options
|
| 128 |
+
* Fixed: Missing Argument WCV_Admin_Users::filter_product_types() #288
|
| 129 |
+
* Fixed: Critical: PHP Fatal error: Call to a member function get_children() #287
|
| 130 |
+
* Fixed: Date range session data is not working #285
|
| 131 |
+
* Fixed HTML escaped characters in PaypalAP Cancel and Return URLs: #286 thanks Nicolas
|
| 132 |
+
* Fixed: Post type check to trigger_new_product() function #276
|
| 133 |
+
* Fixed: Updated to notices instead of wordpress errors
|
| 134 |
+
* Fixed: Product attribute fetch and returning HTML #283 thanks Mikko
|
| 135 |
+
* Fixed: Vendor Mark Shipped Security Fix #280 thanks Agoruh
|
| 136 |
+
* Fixed: Missing argument in Vendors Class
|
| 137 |
+
* Fixed: Rounded product commission to avoid error 589023 when submitting to PayPal #275 thanks Nicolas
|
| 138 |
+
|
| 139 |
+
Version 1.9.0
|
| 140 |
+
|
| 141 |
+
* Added: Support for WooCommerce 2.6
|
| 142 |
+
* Added: Vendor roles filter wcvendors_vendor_roles
|
| 143 |
+
* Added: Product and Vendor id's to sold_by filters
|
| 144 |
+
* Added: Vendor Signup Filters #269
|
| 145 |
+
* Added: Notify Vendors Email - Add Product SKU, if set #263
|
| 146 |
+
* Added: New Option: Notify Vendors show Purchase Price or Commissions #253
|
| 147 |
+
* Added: Option to disable sold by #236
|
| 148 |
+
* Added: Initial sub order management code #196 thanks Spreeuw
|
| 149 |
+
* Fixed: Sold by meta removal
|
| 150 |
+
* Fixed: Sequential Orders Support Commissions table #270
|
| 151 |
+
* Fixed: Notify Vendors Email Customizer Not Working #240
|
| 152 |
+
* Fixed: Commissions Total Report a-z sorting #239
|
| 153 |
+
* Fixed: need to agree to terms for this to process correctly
|
| 154 |
+
* Fixed: save pending vendor for login screen
|
| 155 |
+
* Fixed: Notify Vendors Email in WC 2.5+ #265
|
| 156 |
+
* Fixed: Order table layout
|
| 157 |
+
* Fixed: Orders screen for vendors in admin #231
|
| 158 |
+
* Fixed: product management in WC 2.6
|
| 159 |
+
* Fixed: Duplicate application emails firing in free and pro
|
| 160 |
+
* Fixed: Commission display issue in notify vendor email
|
| 161 |
+
* Fixed: New ítem meta compatability with WC 2.5 and above
|
| 162 |
+
|
| 163 |
+
Version 1.8.9
|
| 164 |
+
|
| 165 |
+
* Fixed: Commission Totals Report Inaccurate #267
|
| 166 |
+
* Added: Swedish Translation Thanks Arvid!
|
| 167 |
+
|
| 168 |
+
Version 1.8.8
|
| 169 |
+
|
| 170 |
+
* Fixed: Undefined variable error in commission class
|
| 171 |
+
* Fixed: Pagination bug in wcv_vendorslist shortcode
|
| 172 |
+
|
| 173 |
+
Version 1.8.7
|
| 174 |
+
|
| 175 |
+
* Added: New qty argument to commission calculations
|
| 176 |
+
* Added: Image uploader settings type
|
| 177 |
+
* Added: New commission function for payment gateways
|
| 178 |
+
* Fixed: Prefixed all btn css classes to stop theme collision
|
| 179 |
+
* Fixed: Sold By:Name spaces issue #256
|
| 180 |
+
* Fixed: Show extended fields for vendor and pending vendor roles
|
| 181 |
+
* Fixed: Check if product is taxable
|
| 182 |
+
* Fixed: Depreciated function calls in email templates
|
| 183 |
+
* Fixed: Commission giving tax on none taxable items #251
|
| 184 |
+
* Fixed: Sold by label issues with WC 2.5 #250
|
| 185 |
+
|
| 186 |
+
Version 1.8.6
|
| 187 |
+
|
| 188 |
+
* Fixed: Critical issue with paypal loading classes incorrectly
|
| 189 |
+
|
| 190 |
+
Version 1.8.5
|
| 191 |
+
|
| 192 |
+
* Fixed: Issue with PayPal on some sites - Rolled back issue #247
|
| 193 |
+
* Fixed: Reverted ticket #216 for email conflicts
|
| 194 |
+
* Added: New KnowledgeBase URL
|
| 195 |
+
|
| 196 |
+
Version 1.8.4
|
| 197 |
+
|
| 198 |
+
* Added: Removed fields from users that aren't vendors
|
| 199 |
+
* Added: actions to hook into approve/deny vendor
|
| 200 |
+
* Added: Ability to integrate with any order status for emails #216
|
| 201 |
+
* Added: Terms & Conditions Opens in New Tab #246
|
| 202 |
+
* Updated: Added trigger for on-hold to processing/completed for Notify Vendor Email #238
|
| 203 |
+
* Updated: Settings page helper text and clarifications
|
| 204 |
+
* Fixed: Sold by formatting issue #248
|
| 205 |
+
* Fixed: wp_redirect caches with W3 Total Cache #237
|
| 206 |
+
* Fixed: Bug in single page settings generator
|
| 207 |
+
* Fixed: Category title missing bug #213
|
| 208 |
+
* Fixed: Undefined index for non vendor users
|
| 209 |
+
* Merge: pull request #247 from archonic/hotfix/oauth-class-exists
|
| 210 |
+
|
| 211 |
+
|
| 212 |
+
Version 1.8.3
|
| 213 |
+
|
| 214 |
+
* Fixed: Fatal Error on activation Merge pull request #235 from oleggen/patch-1
|
| 215 |
+
* Added: Seller info label option
|
| 216 |
+
|
| 217 |
+
Version 1.8.2
|
| 218 |
+
|
| 219 |
+
* Added: Sold By label option
|
| 220 |
+
* Added: New Vendor Commission Totals Report #234
|
| 221 |
+
* Fixed: Added 'Shipped' if marked as shipped #233 can be found on WooCommerce > Reports > WC Vendors > Commission Totals
|
| 222 |
+
* Fixed: Renamed internal function to stop theme and plugin clash
|
| 223 |
+
|
| 224 |
+
Version 1.8.1
|
| 225 |
+
|
| 226 |
+
* Added: New options updated action for settings
|
| 227 |
+
* Added: New plugin activation hook for testing woocommerce active
|
| 228 |
+
* Added: vendor id to get shipping due filter
|
| 229 |
+
* Added: Warning on settings page if user registration in WooCommerce is not enabled
|
| 230 |
+
* Added: Russian Translations thanks Natalia
|
| 231 |
+
|
| 232 |
+
Version 1.8.0
|
| 233 |
+
|
| 234 |
+
* Fixed: Mark $0.00 commissions as paid instead of due #205
|
| 235 |
+
* Fixed: Email trigger should be filter not action - Thanks ontiuk #215
|
| 236 |
+
* Updated: Read me with link to Pro and Updated Language List
|
| 237 |
+
* Added: Portuguese Language (Thanks Renato) #212
|
| 238 |
+
* Remove Forced HTTP Protocol on Sent IPN URL #207 from GoTeamScotch
|
| 239 |
+
|
| 240 |
+
Version 1.7.9
|
| 241 |
+
|
| 242 |
+
* Fixed: woocommerce filter and action issues on product edit page
|
| 243 |
+
|
| 244 |
+
Version 1.7.8
|
| 245 |
+
|
| 246 |
+
* Fixed: Vendors can not register #193
|
| 247 |
+
* Fixed: Variation product image upload #194
|
| 248 |
+
* Added: Order actions thanks GoTeamScotch
|
| 249 |
+
* Updated: New item meta in WC 2.4+
|
| 250 |
+
* Updated: WooCommerce Shipment Tracking v1.2.7+
|
| 251 |
+
* Fixed: Paypal Logging thanks to GoTeamScotch
|
| 252 |
+
* Updated: Templates now fully translatable #195
|
| 253 |
+
* Fixed: Translations not loading bug
|
| 254 |
+
* Fixed: vendors not defined error
|
| 255 |
+
* Updated: Base translation files
|
| 256 |
+
|
| 257 |
+
Version 1.7.7
|
| 258 |
+
|
| 259 |
+
* Fixed: Terms and conditions processing #182
|
| 260 |
+
* Added: filter to order note for overrides
|
| 261 |
+
* Added: Order note for marked shipped #187
|
| 262 |
+
* Fixed: order retrieval for wp-admin orders table for vendors
|
| 263 |
+
* Fixed: pagination bug #179
|
| 264 |
+
* Updated: styles for orders table in admin for vendors
|
| 265 |
+
* Fixed: Vendor displaying issue #180
|
| 266 |
+
* Updated: Admin Commission Report Column Names #183
|
| 267 |
+
* Updated: Admin Commissions Page now shows times a product has sold in total #184
|
| 268 |
+
|
| 269 |
+
Version 1.7.6
|
| 270 |
+
|
| 271 |
+
* Added: Stock notifications go to vendors #114
|
| 272 |
+
* Fixed: Instant Pay bug #174
|
| 273 |
+
* Fixed: wcv_vendorslist paging #178
|
| 274 |
+
* Added: Vendor display name now translatable
|
| 275 |
+
* Depreciated: Dashboard vendor reports
|
| 276 |
+
* Added: Chinese Language files thanks to SundayLau
|
| 277 |
+
* Fixed: Added support for WPML #177
|
| 278 |
+
* Update: default pot language file
|
| 279 |
+
|
| 280 |
+
Version 1.7.5
|
| 281 |
+
|
| 282 |
+
* Merged: Check product post type in vendor dashboard thanks simplementNat
|
| 283 |
+
* Updated: Base language file
|
| 284 |
+
* Updated: Compatibility for Shipment Tracking for v1.3.5 #167
|
| 285 |
+
* Fixed: Shipping taxes
|
| 286 |
+
* Fixed: Pending Products for Vendors #168
|
| 287 |
+
* Added: Vendor shipping override #171
|
| 288 |
+
* Added: Give Tax Per Vendor Override #56
|
| 289 |
+
* Added: Hide duplicate product option
|
| 290 |
+
* Fixed: Email firing for pending status only
|
| 291 |
+
* Updated: Unified vendor-main/mini-header variables
|
| 292 |
+
* Fixed: Email template paths to woocommerce paths
|
| 293 |
+
* Merged: Updated Brazilian Portuguese thanks carlosramosweb
|
| 294 |
+
* Added: Seller Info to header #161
|
| 295 |
+
* Updated: Spanish Translations #160
|
| 296 |
+
* Updated: Brazilian Portuguese Language #156
|
| 297 |
+
|
| 298 |
+
Version 1.7.4
|
| 299 |
+
|
| 300 |
+
* Added: Mark shipped filter #157
|
| 301 |
+
* Fixed: Added Tax total to vendor email #146
|
| 302 |
+
* Updated: Location of email templates in theme to wc-vendors/emails
|
| 303 |
+
* Added: User email to Vendor Display Options #158
|
| 304 |
+
* Fixed: Mass Pay Now Bug #159
|
| 305 |
+
* Fixed: Mark as shipped for downloadable product #40
|
| 306 |
+
* Added: Brazilian Portuguese language #156
|
| 307 |
+
* Updated: Default Language file
|
| 308 |
+
* Fixed: Translation issue for query test #155
|
| 309 |
+
* Updated: Template base for emails
|
| 310 |
+
* Fixed: Vendor email and renamed template #135
|
| 311 |
+
* Fixed: Better CSV Output #63
|
| 312 |
+
* Fixed: Made PayPal optional on Vendor Dashboard Shop Settings #144
|
| 313 |
+
* Update: fixed return query var
|
| 314 |
+
* Fixed: Test for product post types #149
|
| 315 |
+
* Fixed: 2.1 Depreciated return call
|
| 316 |
+
* Fixed: PHP Strict static call in commissions class
|
| 317 |
+
* Merged: Is Vendor checks all user roles #147 thanks crabilld
|
| 318 |
+
|
| 319 |
+
Version 1.7.3
|
| 320 |
+
|
| 321 |
+
* Fixed: Paypal AP IPN url issue
|
| 322 |
+
|
| 323 |
+
Version 1.7.2
|
| 324 |
+
|
| 325 |
+
* Added: Filters for seller tab #141
|
| 326 |
+
* Fixed: URI Too Large Error #143
|
| 327 |
+
* Fixed: Give tax to vendors #142
|
| 328 |
+
* Updated: Spanish Translations #140
|
| 329 |
+
* Added: Persian Translation #139
|
| 330 |
+
|
| 331 |
+
Version 1.7.1
|
| 332 |
+
|
| 333 |
+
* Fixed: Invalid argument on new orders dashboard page #138
|
| 334 |
+
* Updated: Base translation file
|
| 335 |
+
|
| 336 |
+
Version 1.7.0
|
| 337 |
+
|
| 338 |
+
* Fixed: add_query_arg/remove_query_arg XSS issue
|
| 339 |
+
* Fixed: Hide Notice not working for admin settings
|
| 340 |
+
* Added: Shop Settings page in WordPress dashboard
|
| 341 |
+
* Added: Orders page in WordPress dashboard
|
| 342 |
+
|
| 343 |
+
Version 1.6.2
|
| 344 |
+
|
| 345 |
+
* Added: Option to change sold by vendor name #106
|
| 346 |
+
* Fixed: Error notice in vendor dashboard #133
|
| 347 |
+
* Fixed: Pagination in commissions admin screen #68
|
| 348 |
+
* Added: Support for WooCommerce Order Status Manager
|
| 349 |
+
* Fixed: Updated media filter method for vendors #132
|
| 350 |
+
* Fixed: Commission not logged for variations #131
|
| 351 |
+
|
| 352 |
+
Version 1.6.1
|
| 353 |
+
|
| 354 |
+
* Fixed: Support for Per Product Shipping 2.2.x #126
|
| 355 |
+
* Added: Filter to change commission label in vendor email #127
|
| 356 |
+
|
| 357 |
+
Version 1.6.0
|
| 358 |
+
|
| 359 |
+
* Added: Admin notices for vendor page slug & permalinks
|
| 360 |
+
* Fixed: Plugin row meta links
|
| 361 |
+
* Added: Upgrade notice
|
| 362 |
+
* Fixed: Rounding issue #120
|
| 363 |
+
* Fixed: Paypal https host check depreciated call
|
| 364 |
+
* Added: show_products attribute #107
|
| 365 |
+
* Updated: Text in denied template to make more sense when registration disabled #123
|
| 366 |
+
* Updated: wcv_vendorslist shortcode now shows 3 column output #123
|
| 367 |
+
* Fixed: Index issue #122
|
| 368 |
+
* Updated: New plugin and template directory structure - IMPORTANT READ KB
|
| 369 |
+
|
| 370 |
+
Version 1.5.0
|
| 371 |
+
|
| 372 |
+
* Added: Spanish translation thanks Mauricio
|
| 373 |
+
* Added: French translation thanks JP
|
| 374 |
+
* Added: CSS class for sold by (classes same as filters in those files)
|
| 375 |
+
* Fixed: Paypal return URL
|
| 376 |
+
* Added: Vendor Dashboard UI Improvements
|
| 377 |
+
* Added: WC Vendors Test Gateway
|
| 378 |
+
* Updated: ToolTips to be more helpful
|
| 379 |
+
* Added: Admin option for not giving shipping cost to vendor
|
| 380 |
+
* Fixed: Disable notify admin
|
| 381 |
+
* Fixed: Mark as shipped/unshipped
|
| 382 |
+
* Fixed: Duplicate column name
|
| 383 |
+
|
| 384 |
+
Version 1.4.5
|
| 385 |
+
|
| 386 |
+
* Updated: select2 3.5.2 for settings api
|
| 387 |
+
* Fixed: Replaced Chosen with Select2 #102
|
| 388 |
+
* Fixed: Table Rate Shipping issue #103
|
| 389 |
+
* Fixed: Featured column issue #100
|
| 390 |
+
* Updated: Filter call for report
|
| 391 |
+
* Fixed: Call to depreciated function #98
|
| 392 |
+
|
| 393 |
+
Version 1.4.4
|
| 394 |
+
|
| 395 |
+
* Fixed: Hardcoded table in wcv_vendorslist shortcode
|
| 396 |
+
|
| 397 |
+
Version 1.4.3
|
| 398 |
+
|
| 399 |
+
* Fixed: Placeholder on Product Reports
|
| 400 |
+
|
| 401 |
+
Version 1.4.2
|
| 402 |
+
|
| 403 |
+
* Added: Commission status sort to commissions page
|
| 404 |
+
* Fixed: Recent Commissions limit of 20 now works on selected date range
|
| 405 |
+
* Fixed: Report By product in WC2.3
|
| 406 |
+
* Fixed: Vendor Report date selector in wp-admin
|
| 407 |
+
* Fixed: Tracking plugin Order Meta
|
| 408 |
+
* Added: New filter wcvendors_dashboard_google_maps_link
|
| 409 |
+
* Fixed: Formatting error for Google maps link
|
| 410 |
+
* Added: New actions in vendor-dashboard wcvendors_vendor_unship, wcvendors_vendor_ship (thanks Nathan H)
|
| 411 |
+
|
| 412 |
+
Version 1.4.1
|
| 413 |
+
|
| 414 |
+
* Fixed: Language file loading issue
|
| 415 |
+
* Fixed: Static function calls in commision class for php 5.6
|
| 416 |
+
* Fixed: Static call in Vendor Cart
|
| 417 |
+
* Added: New language files for de_AT, de_DE (thanks to theHubi), it_IT (thanks to Nicole)
|
| 418 |
+
* Added: New actions for main and mini headers (before and after see KB)
|
| 419 |
+
|
| 420 |
+
Version 1.4.0
|
| 421 |
+
|
| 422 |
+
* Added: product category + vendor shortcode [wcv_product_category category="category" vendor="vendorname"]
|
| 423 |
+
* Added: Tracking number support via WooThemes Shipment Tracking plugin
|
| 424 |
+
* Added: Google Maps for delivery address on front end
|
| 425 |
+
* Fixed: woocommerce_wp_text_input via merged pull request from svenl77
|
| 426 |
+
* Added: Vendor List shortcode [wcv_vendorlist] + template for styling see KB for full details
|
| 427 |
+
* Fixed: Report not showing Commission by Product
|
| 428 |
+
* Fixed: Paths in language files
|
| 429 |
+
|
| 430 |
+
Version 1.3.1
|
| 431 |
+
|
| 432 |
+
* Fixed: Sold by in invoices
|
| 433 |
+
|
| 434 |
+
Version 1.3.0
|
| 435 |
+
|
| 436 |
+
* Added: show vendor on all emails #29
|
| 437 |
+
* Fixed: Critical issue #58
|
| 438 |
+
* Added: Vendor header templates #65
|
| 439 |
+
* Added: Vendor to QuickEdit #12
|
| 440 |
+
* Fixed: Updating notices to use 2.1 Notice API #62
|
| 441 |
+
* Added: wcvendors_registration_checkbox filter to denied.php template view
|
| 442 |
+
* Added: wcvendors_vendor_registration_checkbox filter to filter "Apply to become a vendor?" at registration.
|
| 443 |
+
* Added: wcvendors_vendor_registration_checkbox to filter "Apply to become a vendor?"
|
| 444 |
+
|
| 445 |
+
Version 1.2.0
|
| 446 |
+
|
| 447 |
+
* Added new filters to change sold by text see Knowledge base for details
|
| 448 |
+
* Added sold by to product loop for archive-product.php, see knowledge base on how to disable or change this
|
| 449 |
+
* Added new option to hide "Featured product" from vendors
|
| 450 |
+
* Added Sold By Filter as per #3
|
| 451 |
+
* Removing unused tag filter
|
| 452 |
+
* Updated default.pot
|
| 453 |
+
* Fixing attribute bug #48 - Thanks to gcskye
|
| 454 |
+
* Removing legacy translations
|
| 455 |
+
* Fixed Orders view errors
|
| 456 |
+
* Fixing call to incorrect method #45
|
| 457 |
+
|
| 458 |
+
Version 1.1.5
|
| 459 |
+
|
| 460 |
+
* Fixed orders view to remove incorrect call to woocommerce print messages
|
| 461 |
+
|
| 462 |
+
Version 1.1.4
|
| 463 |
+
|
| 464 |
+
* Fixed called to incorrect notice method
|
| 465 |
+
* Moved methods into parent class See #41
|
| 466 |
+
* PHP Strict updates
|
| 467 |
+
* Deprecated Class due to PHP strict issues
|
| 468 |
+
* fixing static call
|
| 469 |
+
* Tidying up and comments.
|
| 470 |
+
* Renaming class to new standard
|
| 471 |
+
* Removing deprecated wc methods.
|
| 472 |
+
* Fixing incorrect method call
|
| 473 |
+
* Problem with undefined variable.
|
| 474 |
+
* fixing static call issues
|
| 475 |
+
* fixing static call problems
|
| 476 |
+
* Fixing more strict issues
|
| 477 |
+
* fixing encoding issue
|
| 478 |
+
* Fixing tax rounding issue #37
|
| 479 |
+
* Fixing deprecated calls #42
|
| 480 |
+
* Fixing strict standards
|
| 481 |
+
* Fixing constant reference #36
|
| 482 |
+
* Fixed reference to old plugin name
|
| 483 |
+
* Fixing strict errors #27
|
| 484 |
+
* New Default POT translations #26
|
| 485 |
+
* Fixing translation strings #26
|
| 486 |
+
* Updated description
|
| 487 |
+
* Fix link to paypal adaptive payments #25
|
| 488 |
+
* Fixing issue #22
|
| 489 |
+
* Remove support for woo commerce 2.1 and below
|
| 490 |
+
* Class rename
|
| 491 |
+
* Fixed incorrect table name see #35
|
| 492 |
+
* Fixed Class description
|
| 493 |
+
* Added label on vendor email shipping line see #22
|
| 494 |
+
* Fix issue #23 Notify vendor email problem
|
| 495 |
+
* Fixing Issue #28 & removing WC2.0 support
|
| 496 |
+
* Strict Standards in WCV_Vendors #32
|
| 497 |
+
* Fixing Issue #31 PHP Strict Issues
|
| 498 |
+
* Fixing Issue #30 PHP Strict Standards
|
| 499 |
+
* Change Log added for release changes
|
| 500 |
+
* WC Version Requirement changed
|
| 501 |
+
* Updating author to include wc after modifications
|
| 502 |
+
* Rename class
|
| 503 |
+
* Fixing up link to documentation
|
| 504 |
+
* Updated Readme
|
| 505 |
+
|
| 506 |
+
Version 1.1.3
|
| 507 |
+
|
| 508 |
+
* Fixing table names for compatibility
|
| 509 |
+
* Rename class
|
| 510 |
+
* Fixing Fatal error #18
|
| 511 |
+
* Fatal error fixed, version bump
|
| 512 |
+
* Fixing Class call
|
| 513 |
+
* Fixing all references to incorrect class name
|
| 514 |
+
* Commission and report fixes
|
| 515 |
+
* Fixing spelling
|
| 516 |
+
* Update readme.txt
|
| 517 |
+
* Fixing author
|
| 518 |
+
* Version bump
|
| 519 |
+
* Check if shipping is enabled
|
| 520 |
+
* Comment for future reference
|
| 521 |
+
|
| 522 |
+
Version 1.1.1
|
| 523 |
+
|
| 524 |
+
* Start of adding woocomerce short codes enhanced
|
| 525 |
+
* Shortcodes class
|
| 526 |
+
* Removing temp file
|
| 527 |
+
* Adding short code support
|
| 528 |
+
* Version Bump
|
| 529 |
+
* PHP Strict Issue #5
|
| 530 |
+
* Fatal Error: Class 'PV_Commission' #14
|
| 531 |
+
* Fixing references to PV_Vendors
|
| 532 |
+
* Renamed filters and actions
|
| 533 |
+
* Rename Reports Submenu #15
|
| 534 |
+
* "Mark Shipped" Icon #16
|
| 535 |
+
* Version increased after bug fixes
|
| 536 |
+
|
| 537 |
+
Version 1.0.2
|
| 538 |
+
|
| 539 |
+
* Fix up admin settings notices
|
| 540 |
+
* Renamed shortcodes
|
| 541 |
+
* Version bump for short code rename
|
| 542 |
+
|
| 543 |
+
|
| 544 |
+
Version 1.0.1
|
| 545 |
+
|
| 546 |
+
* Initial Commit
|
| 547 |
+
* First commit - no modifications to existing plugin
|
| 548 |
+
* Updating README
|
| 549 |
+
* Update README.md
|
| 550 |
+
* Features added
|
| 551 |
+
* Updated Details of plugin
|
| 552 |
+
* Fixing up formatting
|
| 553 |
+
* More fixes.
|
| 554 |
+
* Updating readme
|
| 555 |
+
* Updating more details
|
| 556 |
+
* Update denied.php
|
| 557 |
+
* Added mac file ignore
|
| 558 |
+
* updated read me
|
| 559 |
+
* Plugin Rename
|
| 560 |
+
* Plugin rename
|
| 561 |
+
* Rename plugin
|
| 562 |
+
* Rename plugin
|
| 563 |
+
* more updates
|
| 564 |
+
* Plugin Updater removed
|
| 565 |
+
* Updating text domain
|
| 566 |
+
* Basic rename complete
|
| 567 |
+
* Replacement includes classes
|
| 568 |
+
* text domain updates
|
| 569 |
+
* text domain updates
|
| 570 |
+
* new change log for new fork
|
| 571 |
+
* Rename main class
|
| 572 |
+
* renaming constants
|
| 573 |
+
* updated constants
|
| 574 |
+
* plugin constant
|
| 575 |
+
* Renaming queries class
|
| 576 |
+
* constants updated
|
| 577 |
+
* rename vendor shop class
|
| 578 |
+
* rename vendor cart class
|
| 579 |
+
* Renaming classes
|
| 580 |
+
* Author updates
|
| 581 |
+
* Class renaming
|
| 582 |
+
* Version bump
|
trunk/class-wc-vendors.php
ADDED
|
@@ -0,0 +1,419 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Plugin Name: WC Vendors
|
| 5 |
+
* Plugin URI: https://www.wcvendors.com
|
| 6 |
+
* Description: Allow vendors to sell their own products and receive a commission for each sale.
|
| 7 |
+
* Author: WC Vendors
|
| 8 |
+
* Author URI: https://www.wcvendors.com
|
| 9 |
+
* GitHub Plugin URI: https://github.com/wcvendors/wcvendors
|
| 10 |
+
*
|
| 11 |
+
* Version: 1.9.11
|
| 12 |
+
* Requires at least: 4.4.0
|
| 13 |
+
* Tested up to: 4.7.1
|
| 14 |
+
*
|
| 15 |
+
* Text Domain: wcvendors
|
| 16 |
+
* Domain Path: /languages/
|
| 17 |
+
*
|
| 18 |
+
* @category Plugin
|
| 19 |
+
* @copyright Copyright © 2012 Matt Gates
|
| 20 |
+
* @copyright Copyright © 2017 WC Vendors
|
| 21 |
+
* @author Matt Gates, WC Vendors
|
| 22 |
+
* @package WCVendors
|
| 23 |
+
* @license GPL2
|
| 24 |
+
|
| 25 |
+
WC Vendors is free software: you can redistribute it and/or modify
|
| 26 |
+
it under the terms of the GNU General Public License as published by
|
| 27 |
+
the Free Software Foundation, either version 2 of the License, or
|
| 28 |
+
any later version.
|
| 29 |
+
|
| 30 |
+
WC Vendors is distributed in the hope that it will be useful,
|
| 31 |
+
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 32 |
+
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 33 |
+
GNU General Public License for more details.
|
| 34 |
+
|
| 35 |
+
You should have received a copy of the GNU General Public License
|
| 36 |
+
along with WC Vendors. If not, see http://www.gnu.org/licenses/gpl-2.0.txt.
|
| 37 |
+
|
| 38 |
+
*/
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
/**
|
| 42 |
+
* Plugin activation hook
|
| 43 |
+
*/
|
| 44 |
+
function wcvendors_activate() {
|
| 45 |
+
|
| 46 |
+
/**
|
| 47 |
+
* Requires woocommerce to be installed and active
|
| 48 |
+
*/
|
| 49 |
+
if ( !class_exists( 'WooCommerce' ) ) {
|
| 50 |
+
deactivate_plugins( plugin_basename( __FILE__ ) );
|
| 51 |
+
wp_die( __( 'WC Vendors requires WooCommerce to run. Please install WooCommerce and activate before attempting to activate again.', 'wcvendors' ) );
|
| 52 |
+
}
|
| 53 |
+
} // wcvendors_activate()
|
| 54 |
+
|
| 55 |
+
register_activation_hook( __FILE__, 'wcvendors_activate' );
|
| 56 |
+
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* Required functions
|
| 60 |
+
*/
|
| 61 |
+
require_once trailingslashit( dirname( __FILE__ ) ) . 'classes/includes/class-functions.php';
|
| 62 |
+
|
| 63 |
+
/**
|
| 64 |
+
* Check if WooCommerce is active
|
| 65 |
+
*/
|
| 66 |
+
if ( wcv_is_woocommerce_activated() ) {
|
| 67 |
+
|
| 68 |
+
/* Define an absolute path to our plugin directory. */
|
| 69 |
+
if ( !defined( 'wcv_plugin_dir' ) ) define( 'wcv_plugin_dir', trailingslashit( dirname( __FILE__ ) ) . '/' );
|
| 70 |
+
if ( !defined( 'wcv_assets_url' ) ) define( 'wcv_assets_url', trailingslashit( plugins_url( 'assets', __FILE__ ) ) );
|
| 71 |
+
if ( !defined( 'wcv_plugin_base' ) ) define( 'wcv_plugin_base', plugin_basename( __FILE__ ) );
|
| 72 |
+
if ( !defined( 'wcv_plugin_dir_path' ) ) define( 'wcv_plugin_dir_path', untrailingslashit( plugin_dir_path( __FILE__ ) ) );
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
define('WCV_VERSION', '1.9.11' );
|
| 76 |
+
|
| 77 |
+
/**
|
| 78 |
+
* Main Product Vendor class
|
| 79 |
+
*
|
| 80 |
+
* @package WCVendors
|
| 81 |
+
*/
|
| 82 |
+
class WC_Vendors
|
| 83 |
+
{
|
| 84 |
+
|
| 85 |
+
/**
|
| 86 |
+
* @var
|
| 87 |
+
*/
|
| 88 |
+
public static $pv_options;
|
| 89 |
+
public static $id = 'wc_prd_vendor';
|
| 90 |
+
|
| 91 |
+
/**
|
| 92 |
+
* Constructor.
|
| 93 |
+
*/
|
| 94 |
+
public function __construct()
|
| 95 |
+
{
|
| 96 |
+
|
| 97 |
+
// Load text domain
|
| 98 |
+
add_action( 'plugins_loaded', array( $this, 'load_il8n' ) );
|
| 99 |
+
|
| 100 |
+
$this->title = __( 'WC Vendors', 'wcvendors' );
|
| 101 |
+
|
| 102 |
+
// Install & upgrade
|
| 103 |
+
add_action( 'admin_init', array( $this, 'check_install' ) );
|
| 104 |
+
add_action( 'admin_init', array( $this, 'maybe_flush_permalinks' ), 99 );
|
| 105 |
+
add_action( 'admin_init', array( $this, 'wcv_required_ignore_notices' ) );
|
| 106 |
+
|
| 107 |
+
add_action( 'plugins_loaded', array( $this, 'load_settings' ) );
|
| 108 |
+
add_action( 'plugins_loaded', array( $this, 'include_gateways' ) );
|
| 109 |
+
add_action( 'plugins_loaded', array( $this, 'include_core' ) );
|
| 110 |
+
add_action( 'init', array( $this, 'include_init' ) );
|
| 111 |
+
add_action( 'current_screen', array( $this, 'include_assets' ) );
|
| 112 |
+
|
| 113 |
+
add_filter( 'plugin_row_meta', array($this, 'plugin_row_meta'), 10, 2 );
|
| 114 |
+
add_action( self::$id . '_options_updated', array( $this, 'option_updates' ), 10, 2 );
|
| 115 |
+
|
| 116 |
+
// Start a PHP session, if not yet started then destroy if logged in or out
|
| 117 |
+
add_action( 'init', array( $this, 'init_session'), 1 );
|
| 118 |
+
add_action( 'wp_logout', array( $this, 'destroy_session') );
|
| 119 |
+
add_action( 'wp_login', array( $this, 'destroy_session') );
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
|
| 123 |
+
/**
|
| 124 |
+
*
|
| 125 |
+
*/
|
| 126 |
+
public function invalid_wc_version()
|
| 127 |
+
{
|
| 128 |
+
echo '<div class="error"><p>' . __( '<b>WC Vendors is inactive</b>. WC Vendors requires a minimum of WooCommerce v2.7.0.', 'wcvendors' ) . '</p></div>';
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
/**
|
| 132 |
+
* Start the session
|
| 133 |
+
*/
|
| 134 |
+
public function init_session(){
|
| 135 |
+
|
| 136 |
+
if ( !session_id() && is_user_logged_in() ) {
|
| 137 |
+
session_start();
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
} //init_session()
|
| 141 |
+
|
| 142 |
+
public function destroy_session(){
|
| 143 |
+
|
| 144 |
+
if ( session_id() ) {
|
| 145 |
+
session_destroy();
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
} // destroy_session()
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
/**
|
| 152 |
+
* Check whether install has ran before or not
|
| 153 |
+
*
|
| 154 |
+
* Run install if it hasn't.
|
| 155 |
+
*
|
| 156 |
+
* @return unknown
|
| 157 |
+
*/
|
| 158 |
+
public function check_install()
|
| 159 |
+
{
|
| 160 |
+
global $woocommerce;
|
| 161 |
+
|
| 162 |
+
if ( version_compare( WC_VERSION, '2.6', '<' ) ) {
|
| 163 |
+
add_action( 'admin_notices', array( $this, 'invalid_wc_version' ) );
|
| 164 |
+
deactivate_plugins( plugin_basename( __FILE__ ) );
|
| 165 |
+
return false;
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
require_once wcv_plugin_dir . 'classes/class-install.php';
|
| 169 |
+
|
| 170 |
+
$this->load_settings();
|
| 171 |
+
$install = new WCV_Install;
|
| 172 |
+
$install->init();
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
/**
|
| 177 |
+
* Set static $pv_options to hold options class
|
| 178 |
+
*/
|
| 179 |
+
public function load_settings()
|
| 180 |
+
{
|
| 181 |
+
if ( empty( self::$pv_options ) ) {
|
| 182 |
+
require_once wcv_plugin_dir . 'classes/admin/settings/classes/sf-class-settings.php';
|
| 183 |
+
self::$pv_options = new SF_Settings_API( self::$id, $this->title, 'woocommerce', __FILE__ );
|
| 184 |
+
self::$pv_options->load_options( wcv_plugin_dir . 'classes/admin/settings/sf-options.php' );
|
| 185 |
+
}
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
public function load_il8n() {
|
| 189 |
+
|
| 190 |
+
$locale = apply_filters( 'plugin_locale', get_locale(), 'wcvendors' );
|
| 191 |
+
|
| 192 |
+
//Place your custom translations into wp-content/languages/wc-vendors to be upgrade safe
|
| 193 |
+
load_textdomain( 'wcvendors', WP_LANG_DIR.'/wc-vendors/wcvendors-'.$locale.'.mo');
|
| 194 |
+
|
| 195 |
+
load_plugin_textdomain( 'wcvendors', false, dirname( plugin_basename( __FILE__ ) ) . '/languages/' );
|
| 196 |
+
|
| 197 |
+
}
|
| 198 |
+
|
| 199 |
+
|
| 200 |
+
/**
|
| 201 |
+
* Include core files
|
| 202 |
+
*/
|
| 203 |
+
public function include_core()
|
| 204 |
+
{
|
| 205 |
+
require_once wcv_plugin_dir . 'classes/class-queries.php';
|
| 206 |
+
require_once wcv_plugin_dir . 'classes/class-vendors.php';
|
| 207 |
+
require_once wcv_plugin_dir . 'classes/class-cron.php';
|
| 208 |
+
require_once wcv_plugin_dir . 'classes/class-commission.php';
|
| 209 |
+
require_once wcv_plugin_dir . 'classes/class-shipping.php';
|
| 210 |
+
require_once wcv_plugin_dir . 'classes/class-vendor-order.php';
|
| 211 |
+
require_once wcv_plugin_dir . 'classes/class-vendor-post-types.php';
|
| 212 |
+
require_once wcv_plugin_dir . 'classes/front/class-vendor-cart.php';
|
| 213 |
+
require_once wcv_plugin_dir . 'classes/front/dashboard/class-vendor-dashboard.php';
|
| 214 |
+
require_once wcv_plugin_dir . 'classes/front/class-vendor-shop.php';
|
| 215 |
+
require_once wcv_plugin_dir . 'classes/front/signup/class-vendor-signup.php';
|
| 216 |
+
require_once wcv_plugin_dir . 'classes/front/orders/class-orders.php';
|
| 217 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-emails.php';
|
| 218 |
+
require_once wcv_plugin_dir . 'classes/admin/class-product-meta.php';
|
| 219 |
+
require_once wcv_plugin_dir . 'classes/admin/class-vendor-applicants.php';
|
| 220 |
+
require_once wcv_plugin_dir . 'classes/admin/class-vendor-reports.php';
|
| 221 |
+
require_once wcv_plugin_dir . 'classes/admin/class-admin-reports.php';
|
| 222 |
+
require_once wcv_plugin_dir . 'classes/admin/class-admin-users.php';
|
| 223 |
+
require_once wcv_plugin_dir . 'classes/admin/class-admin-page.php';
|
| 224 |
+
require_once wcv_plugin_dir . 'classes/admin/class-vendor-admin-dashboard.php';
|
| 225 |
+
require_once wcv_plugin_dir . 'classes/includes/class-wcv-shortcodes.php';
|
| 226 |
+
|
| 227 |
+
|
| 228 |
+
if ( !function_exists( 'woocommerce_wp_text_input' ) && !is_admin() ) {
|
| 229 |
+
include_once(WC()->plugin_path() . '/includes/admin/wc-meta-box-functions.php');
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
new WCV_Vendors;
|
| 233 |
+
new WCV_Vendor_Shop;
|
| 234 |
+
new WCV_Vendor_Cart;
|
| 235 |
+
new WCV_Commission;
|
| 236 |
+
new WCV_Shipping;
|
| 237 |
+
new WCV_Cron;
|
| 238 |
+
new WCV_Orders;
|
| 239 |
+
new WCV_Vendor_Dashboard;
|
| 240 |
+
new WCV_Admin_Setup;
|
| 241 |
+
new WCV_Vendor_Admin_Dashboard;
|
| 242 |
+
new WCV_Admin_Reports;
|
| 243 |
+
new WCV_Vendor_Applicants;
|
| 244 |
+
new WCV_Emails;
|
| 245 |
+
new WCV_Vendor_Signup;
|
| 246 |
+
new WCV_Shortcodes;
|
| 247 |
+
}
|
| 248 |
+
|
| 249 |
+
|
| 250 |
+
/**
|
| 251 |
+
* These need to be initlized later in loading to fix interaction with other plugins that call current_user_can at the right time.
|
| 252 |
+
*
|
| 253 |
+
* @since 1.9.4
|
| 254 |
+
* @access public
|
| 255 |
+
*/
|
| 256 |
+
public function include_init(){
|
| 257 |
+
|
| 258 |
+
new WCV_Vendor_Reports;
|
| 259 |
+
new WCV_Product_Meta;
|
| 260 |
+
new WCV_Admin_Users;
|
| 261 |
+
|
| 262 |
+
} // include_init()
|
| 263 |
+
|
| 264 |
+
/**
|
| 265 |
+
* Load plugin assets
|
| 266 |
+
*/
|
| 267 |
+
public function include_assets(){
|
| 268 |
+
|
| 269 |
+
$screen = get_current_screen();
|
| 270 |
+
|
| 271 |
+
if ( in_array( $screen->id, array( 'edit-product' ) ) ) {
|
| 272 |
+
wp_enqueue_script( 'wcv_quick-edit', wcv_assets_url. 'js/wcv-admin-quick-edit.js', array('jquery') );
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
+
}
|
| 276 |
+
|
| 277 |
+
|
| 278 |
+
/**
|
| 279 |
+
* Include payment gateways
|
| 280 |
+
*/
|
| 281 |
+
public function include_gateways()
|
| 282 |
+
{
|
| 283 |
+
require_once wcv_plugin_dir . 'classes/gateways/PayPal_AdvPayments/paypal_ap.php';
|
| 284 |
+
require_once wcv_plugin_dir . 'classes/gateways/PayPal_Masspay/class-paypal-masspay.php';
|
| 285 |
+
require_once wcv_plugin_dir . 'classes/gateways/WCV_Gateway_Test/class-wcv-gateway-test.php';
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
|
| 289 |
+
/**
|
| 290 |
+
* Do an action when options are updated
|
| 291 |
+
*
|
| 292 |
+
* @param array $options
|
| 293 |
+
* @param unknown $tabname
|
| 294 |
+
*/
|
| 295 |
+
public function option_updates( $options, $tabname )
|
| 296 |
+
{
|
| 297 |
+
// Change the vendor role capabilities
|
| 298 |
+
if ( $tabname == sanitize_title(__( 'Capabilities', 'wcvendors' )) ) {
|
| 299 |
+
$can_add = $options[ 'can_submit_products' ];
|
| 300 |
+
$can_edit = $options[ 'can_edit_published_products' ];
|
| 301 |
+
$can_submit_live = $options[ 'can_submit_live_products' ];
|
| 302 |
+
$can_view_reports = $options[ 'can_view_backend_reports' ];
|
| 303 |
+
|
| 304 |
+
$args = array(
|
| 305 |
+
'assign_product_terms' => $can_add,
|
| 306 |
+
'edit_products' => $can_add || $can_edit,
|
| 307 |
+
'edit_published_products' => $can_edit,
|
| 308 |
+
'delete_published_products' => $can_edit,
|
| 309 |
+
'delete_products' => $can_edit,
|
| 310 |
+
'manage_product' => $can_add,
|
| 311 |
+
'publish_products' => $can_submit_live,
|
| 312 |
+
'read' => true,
|
| 313 |
+
'read_products' => $can_edit || $can_add,
|
| 314 |
+
'upload_files' => true,
|
| 315 |
+
'import' => true,
|
| 316 |
+
'view_woocommerce_reports' => false,
|
| 317 |
+
);
|
| 318 |
+
|
| 319 |
+
remove_role( 'vendor' );
|
| 320 |
+
|
| 321 |
+
add_role( 'vendor', __('Vendor', 'wcvendors'), $args );
|
| 322 |
+
} // Update permalinks
|
| 323 |
+
else if ( $tabname == sanitize_title(__( 'General', 'wcvendors' ) )) {
|
| 324 |
+
$old_permalink = WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' );
|
| 325 |
+
$new_permalink = $options[ 'vendor_shop_permalink' ];
|
| 326 |
+
|
| 327 |
+
if ( $old_permalink != $new_permalink ) {
|
| 328 |
+
update_option( WC_Vendors::$id . '_flush_rules', true );
|
| 329 |
+
}
|
| 330 |
+
}
|
| 331 |
+
|
| 332 |
+
do_action( 'wcvendors_option_updates', $options, $tabname );
|
| 333 |
+
|
| 334 |
+
}
|
| 335 |
+
|
| 336 |
+
|
| 337 |
+
/**
|
| 338 |
+
* If the settings are updated and the vendor page link has changed update permalinks
|
| 339 |
+
* @access public
|
| 340 |
+
*
|
| 341 |
+
*/
|
| 342 |
+
public function maybe_flush_permalinks()
|
| 343 |
+
{
|
| 344 |
+
if ( get_option( WC_Vendors::$id . '_flush_rules' ) ) {
|
| 345 |
+
flush_rewrite_rules();
|
| 346 |
+
update_option( WC_Vendors::$id . '_flush_rules', false );
|
| 347 |
+
}
|
| 348 |
+
}
|
| 349 |
+
|
| 350 |
+
/**
|
| 351 |
+
* Add links to plugin page to our external help site.
|
| 352 |
+
* @param $links - links array from action
|
| 353 |
+
* @param $file - file reference for this plugin
|
| 354 |
+
* @access public
|
| 355 |
+
*
|
| 356 |
+
*/
|
| 357 |
+
public static function plugin_row_meta( $links, $file ) {
|
| 358 |
+
if ( $file == wcv_plugin_base ) {
|
| 359 |
+
|
| 360 |
+
$row_meta = array(
|
| 361 |
+
'docs' => '<a href="http://www.wcvendors.com/kb/" target="_blank">'.__( 'Documentation/KB', 'wcvendors' ).'</a>',
|
| 362 |
+
'help' => '<a href="http://www.wcvendors.com/help/" target="_blank">'.__( 'Help Forums', 'wcvendors').'</a>',
|
| 363 |
+
'support' => '<a href="http://www.wcvendors.com/contact-us/" target="_blank">'.__( 'Paid Support', 'wcvendors' ).'</a>'
|
| 364 |
+
);
|
| 365 |
+
|
| 366 |
+
return array_merge( $links, $row_meta );
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
return (array) $links;
|
| 370 |
+
}
|
| 371 |
+
|
| 372 |
+
/**
|
| 373 |
+
* Add user meta to remember ignore notices
|
| 374 |
+
* @access public
|
| 375 |
+
*
|
| 376 |
+
*/
|
| 377 |
+
public function wcv_required_ignore_notices(){
|
| 378 |
+
global $current_user;
|
| 379 |
+
$current_user_id = $current_user->ID;
|
| 380 |
+
|
| 381 |
+
/* If user clicks to ignore the notice, add that to their user meta */
|
| 382 |
+
if ( isset( $_GET[ 'wcv_shop_ignore_notice' ] ) && '0' == $_GET[ 'wcv_shop_ignore_notice' ] ) {
|
| 383 |
+
add_user_meta( $current_user_id, 'wcv_shop_ignore_notice', 'true', true);
|
| 384 |
+
}
|
| 385 |
+
if ( isset($_GET['wcv_pl_ignore_notice']) && '0' == $_GET['wcv_pl_ignore_notice'] ) {
|
| 386 |
+
add_user_meta( $current_user_id, 'wcv_pl_ignore_notice', 'true' , true);
|
| 387 |
+
}
|
| 388 |
+
|
| 389 |
+
}
|
| 390 |
+
|
| 391 |
+
/**
|
| 392 |
+
* Class logger so that we can keep our debug and logging information cleaner
|
| 393 |
+
*
|
| 394 |
+
* @since 1.4.0
|
| 395 |
+
* @access public
|
| 396 |
+
*
|
| 397 |
+
* @param mixed - $data the data to go to the error log could be string, array or object
|
| 398 |
+
*/
|
| 399 |
+
public static function log( $data = '' ){
|
| 400 |
+
|
| 401 |
+
$trace = debug_backtrace( false, 2 );
|
| 402 |
+
$path_info = pathinfo( $trace[ 0 ][ 'file' ] );
|
| 403 |
+
|
| 404 |
+
// Only display the class file if there is actually a class file
|
| 405 |
+
$caller = ( isset( $trace[ 1 ] ) ) ? array_key_exists( 'class', $trace[ 1 ] ) ? $trace[ 1 ][ 'class' ] : $path_info[ 'basename' ] : '';
|
| 406 |
+
|
| 407 |
+
if ( is_array( $data ) || is_object( $data ) ) {
|
| 408 |
+
error_log( $caller . ' : ' . print_r( $data, true ) );
|
| 409 |
+
} else {
|
| 410 |
+
error_log( $caller . ' : ' . $data );
|
| 411 |
+
}
|
| 412 |
+
|
| 413 |
+
} // log()
|
| 414 |
+
|
| 415 |
+
}
|
| 416 |
+
|
| 417 |
+
$wc_vendors = new WC_Vendors;
|
| 418 |
+
|
| 419 |
+
}
|
trunk/classes/admin/class-admin-page.php
ADDED
|
@@ -0,0 +1,826 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class WCV_Admin_Setup
|
| 4 |
+
{
|
| 5 |
+
/**
|
| 6 |
+
* WC > Referrals menu
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
public function __construct()
|
| 10 |
+
{
|
| 11 |
+
add_filter( 'set-screen-option', array( 'WCV_Admin_Setup', 'set_table_option' ), 10, 3 );
|
| 12 |
+
add_action( 'admin_menu', array( 'WCV_Admin_Setup', 'menu' ) );
|
| 13 |
+
|
| 14 |
+
add_action( 'woocommerce_admin_order_data_after_shipping_address', array( $this, 'add_vendor_details' ), 10, 2 );
|
| 15 |
+
add_action( 'woocommerce_admin_order_actions_end', array( $this, 'append_actions' ), 10, 1 );
|
| 16 |
+
|
| 17 |
+
add_filter( 'woocommerce_debug_tools', array( $this, 'wcvendors_tools' ) );
|
| 18 |
+
|
| 19 |
+
add_action( 'admin_head', array( $this, 'commission_table_header_styles' ) );
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
|
| 23 |
+
public function add_vendor_details( $order )
|
| 24 |
+
{
|
| 25 |
+
$actions = $this->append_actions( $order, true );
|
| 26 |
+
|
| 27 |
+
if (empty( $actions['wc_pv_shipped']['name'] )) {
|
| 28 |
+
return;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
echo '<h4>' . __('Vendors shipped', 'wcvendors') . '</h4><br/>';
|
| 32 |
+
echo $actions['wc_pv_shipped']['name'];
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
public function append_actions( $order, $order_page = false )
|
| 36 |
+
{
|
| 37 |
+
global $woocommerce;
|
| 38 |
+
|
| 39 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 40 |
+
|
| 41 |
+
$authors = WCV_Vendors::get_vendors_from_order( $order );
|
| 42 |
+
$authors = $authors ? array_keys( $authors ) : array();
|
| 43 |
+
if ( empty( $authors ) ) return false;
|
| 44 |
+
|
| 45 |
+
$shipped = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 46 |
+
$string = '</br></br>';
|
| 47 |
+
|
| 48 |
+
foreach ($authors as $author ) {
|
| 49 |
+
$string .= in_array( $author, $shipped ) ? '✔ ' : '✕ ';
|
| 50 |
+
$string .= WCV_Vendors::get_vendor_shop_name( $author );
|
| 51 |
+
$string .= '</br>';
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
$response = array(
|
| 55 |
+
'url' => '#',
|
| 56 |
+
'name' => __('Vendors Shipped', 'wcvendors') . $string,
|
| 57 |
+
'action' => 'wc_pv_shipped',
|
| 58 |
+
'image_url' => wcv_assets_url . '/images/icons/truck.png',
|
| 59 |
+
);
|
| 60 |
+
|
| 61 |
+
if ( ! $order_page ) {
|
| 62 |
+
printf( '<a class="button tips %s" href="%s" data-tip="%s"><img style="width:16px;height:16px;" src="%s"></a>', $response['action'], $response['url'], $response['name'], $response['image_url'] );
|
| 63 |
+
} else {
|
| 64 |
+
echo $response['name'];
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
return $response;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
/**
|
| 72 |
+
* Add the commissions sub menu
|
| 73 |
+
*
|
| 74 |
+
* @since 1.0.0
|
| 75 |
+
* @access public
|
| 76 |
+
*
|
| 77 |
+
*/
|
| 78 |
+
public static function menu()
|
| 79 |
+
{
|
| 80 |
+
$hook = add_submenu_page(
|
| 81 |
+
'woocommerce',
|
| 82 |
+
__( 'Commission', 'wcvendors' ), __( 'Commission', 'wcvendors' ),
|
| 83 |
+
'manage_woocommerce',
|
| 84 |
+
'pv_admin_commissions',
|
| 85 |
+
array( 'WCV_Admin_Setup', 'commissions_page' )
|
| 86 |
+
);
|
| 87 |
+
|
| 88 |
+
add_action( "load-$hook", array( 'WCV_Admin_Setup', 'add_options' ) );
|
| 89 |
+
|
| 90 |
+
add_action( "admin_print_styles-$hook", array( 'WCV_Admin_Setup', 'commission_enqueue_style' ) );
|
| 91 |
+
add_action( "admin_print_scripts-$hook", array( 'WCV_Admin_Setup', 'commission_my_enqueue_script' ) );
|
| 92 |
+
|
| 93 |
+
|
| 94 |
+
|
| 95 |
+
} // menu()
|
| 96 |
+
|
| 97 |
+
|
| 98 |
+
/**
|
| 99 |
+
* Add tools to the woocommerce status tools page
|
| 100 |
+
*
|
| 101 |
+
* @since 1.9.2
|
| 102 |
+
* @access public
|
| 103 |
+
*/
|
| 104 |
+
public function wcvendors_tools( $tools ){
|
| 105 |
+
|
| 106 |
+
$tools[ 'reset_wcvendor_roles' ] = array(
|
| 107 |
+
'name' => __( 'Reset WC Vendors roles ', 'wcvendors' ),
|
| 108 |
+
'button' => __( 'Reset WC Vendor Roles', 'wcvendors' ),
|
| 109 |
+
'desc' => __( 'This will reset the wcvendors roles ( vendor & pending_vendor ), back to the default capabilities.', 'wcvendors' ),
|
| 110 |
+
'callback' => array( 'WCV_Admin_Setup', 'reset_vendor_roles' )
|
| 111 |
+
);
|
| 112 |
+
|
| 113 |
+
$tools[ 'reset_wcvendors' ] = array(
|
| 114 |
+
'name' => __( 'Reset WC Vendors ', 'wcvendors' ),
|
| 115 |
+
'button' => __( 'Reset WC Vendors Settings', 'wcvendors' ),
|
| 116 |
+
'desc' => __( 'This will reset wcvendors back to defaults. This DELETES ALL YOUR Settings.', 'wcvendors' ),
|
| 117 |
+
'callback' => array( 'WCV_Admin_Setup', 'reset_wcvendors' )
|
| 118 |
+
);
|
| 119 |
+
|
| 120 |
+
return $tools;
|
| 121 |
+
|
| 122 |
+
} // wcvendors_tools()
|
| 123 |
+
|
| 124 |
+
/**
|
| 125 |
+
* Reset the vendor roles
|
| 126 |
+
*
|
| 127 |
+
* @since 1.9.2
|
| 128 |
+
* @access public
|
| 129 |
+
*/
|
| 130 |
+
public static function reset_vendor_roles(){
|
| 131 |
+
|
| 132 |
+
$can_add = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
|
| 133 |
+
$can_edit = WC_Vendors::$pv_options->get_option( 'can_edit_published_products' );
|
| 134 |
+
$can_submit_live = WC_Vendors::$pv_options->get_option( 'can_submit_live_products' );
|
| 135 |
+
$can_view_reports = WC_Vendors::$pv_options->get_option( 'can_view_backend_reports' );
|
| 136 |
+
|
| 137 |
+
$args = array(
|
| 138 |
+
'assign_product_terms' => $can_add,
|
| 139 |
+
'edit_products' => $can_add || $can_edit,
|
| 140 |
+
'edit_published_products' => $can_edit,
|
| 141 |
+
'delete_published_products' => $can_edit,
|
| 142 |
+
'delete_products' => $can_edit,
|
| 143 |
+
'manage_product' => $can_add,
|
| 144 |
+
'publish_products' => $can_submit_live,
|
| 145 |
+
'read' => true,
|
| 146 |
+
'read_products' => $can_edit || $can_add,
|
| 147 |
+
'upload_files' => true,
|
| 148 |
+
'import' => true,
|
| 149 |
+
'view_woocommerce_reports' => false,
|
| 150 |
+
);
|
| 151 |
+
|
| 152 |
+
remove_role( 'vendor' );
|
| 153 |
+
add_role( 'vendor', __('Vendor', 'wcvendors'), $args );
|
| 154 |
+
|
| 155 |
+
remove_role( 'pending_vendor');
|
| 156 |
+
add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
|
| 157 |
+
'read' => true,
|
| 158 |
+
'edit_posts' => false,
|
| 159 |
+
'delete_posts' => true
|
| 160 |
+
) );
|
| 161 |
+
|
| 162 |
+
echo '<div class="updated inline"><p>' . __( 'WC Vendor roles successfully reset.', 'wcvendors' ) . '</p></div>';
|
| 163 |
+
|
| 164 |
+
} // reset_vendor_roles()
|
| 165 |
+
|
| 166 |
+
|
| 167 |
+
/**
|
| 168 |
+
* Reset wcvendors
|
| 169 |
+
*
|
| 170 |
+
* @since 1.9.2
|
| 171 |
+
* @access public
|
| 172 |
+
*/
|
| 173 |
+
public static function reset_wcvendors(){
|
| 174 |
+
|
| 175 |
+
delete_option( WC_Vendors::$id . '_options' );
|
| 176 |
+
echo '<div class="updated inline"><p>' . __( 'WC Vendors was successfully reset. All settings have been reset.', 'wcvendors' ) . '</p></div>';
|
| 177 |
+
|
| 178 |
+
} // reset_wcvendors()
|
| 179 |
+
|
| 180 |
+
|
| 181 |
+
public static function commission_enqueue_style(){
|
| 182 |
+
|
| 183 |
+
wp_enqueue_style( 'commissions_select2_css', wcv_assets_url . 'css/select2.min.css' );
|
| 184 |
+
|
| 185 |
+
} //commission_enqueue_style()
|
| 186 |
+
|
| 187 |
+
public static function commission_my_enqueue_script(){
|
| 188 |
+
|
| 189 |
+
$select2_args = apply_filters( 'wcvendors_select2_commission_args', array(
|
| 190 |
+
'placeholder' => __( 'Select a Vendor', 'wcvendors' ),
|
| 191 |
+
'allowclear' => true,
|
| 192 |
+
) );
|
| 193 |
+
|
| 194 |
+
wp_enqueue_script( 'commissions_select2_styles_js', wcv_assets_url. 'js/select2.min.js', array('jquery') );
|
| 195 |
+
|
| 196 |
+
wp_register_script( 'commissions_select2_load_js', wcv_assets_url. 'js/wcv-commissions.js', array('jquery') );
|
| 197 |
+
wp_localize_script( 'commissions_select2_load_js', 'wcv_commissions_select', $select2_args );
|
| 198 |
+
wp_enqueue_script( 'commissions_select2_load_js' );
|
| 199 |
+
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
+
/**
|
| 203 |
+
* Load styles for the commissions table page
|
| 204 |
+
*/
|
| 205 |
+
public function commission_table_header_styles() {
|
| 206 |
+
|
| 207 |
+
$page = ( isset( $_GET[ 'page' ] ) ) ? esc_attr( $_GET[ 'page' ] ) : false;
|
| 208 |
+
|
| 209 |
+
// Only load the styles on the license table page
|
| 210 |
+
|
| 211 |
+
if ( 'pv_admin_commissions' !== $page ) return;
|
| 212 |
+
|
| 213 |
+
echo '<style type="text/css">';
|
| 214 |
+
echo '.wp-list-table .column-product_id { width: 20%; }';
|
| 215 |
+
echo '.wp-list-table .column-vendor_id { width: 15%; }';
|
| 216 |
+
echo '.wp-list-table .column-order_id { width: 8%; }';
|
| 217 |
+
echo '.wp-list-table .column-total_due { width: 10%;}';
|
| 218 |
+
echo '.wp-list-table .column-total_shipping { width: 10%;}';
|
| 219 |
+
echo '.wp-list-table .column-tax { width: 10%;}';
|
| 220 |
+
echo '.wp-list-table .column-totals { width: 10%;}';
|
| 221 |
+
echo '.wp-list-table .column-status { width: 5%;}';
|
| 222 |
+
echo '.wp-list-table .column-time { width: 10%;}';
|
| 223 |
+
echo '</style>';
|
| 224 |
+
|
| 225 |
+
} //table_header_styles()
|
| 226 |
+
|
| 227 |
+
/**
|
| 228 |
+
*
|
| 229 |
+
*
|
| 230 |
+
* @param unknown $status
|
| 231 |
+
* @param unknown $option
|
| 232 |
+
* @param unknown $value
|
| 233 |
+
*
|
| 234 |
+
* @return unknown
|
| 235 |
+
*/
|
| 236 |
+
public static function set_table_option( $status, $option, $value )
|
| 237 |
+
{
|
| 238 |
+
if ( $option == 'commission_per_page' ) {
|
| 239 |
+
return $value;
|
| 240 |
+
}
|
| 241 |
+
}
|
| 242 |
+
|
| 243 |
+
|
| 244 |
+
/**
|
| 245 |
+
*
|
| 246 |
+
*/
|
| 247 |
+
public static function add_options()
|
| 248 |
+
{
|
| 249 |
+
global $PV_Admin_Page;
|
| 250 |
+
|
| 251 |
+
$args = array(
|
| 252 |
+
'label' => 'Rows',
|
| 253 |
+
'default' => 10,
|
| 254 |
+
'option' => 'commission_per_page'
|
| 255 |
+
);
|
| 256 |
+
add_screen_option( 'per_page', $args );
|
| 257 |
+
|
| 258 |
+
$PV_Admin_Page = new WCV_Admin_Page();
|
| 259 |
+
|
| 260 |
+
}
|
| 261 |
+
|
| 262 |
+
|
| 263 |
+
/**
|
| 264 |
+
* HTML setup for the WC > Commission page
|
| 265 |
+
*/
|
| 266 |
+
public static function commissions_page()
|
| 267 |
+
{
|
| 268 |
+
global $woocommerce, $PV_Admin_Page;
|
| 269 |
+
|
| 270 |
+
|
| 271 |
+
|
| 272 |
+
?>
|
| 273 |
+
|
| 274 |
+
<div class="wrap">
|
| 275 |
+
|
| 276 |
+
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 277 |
+
<h2><?php _e( 'Commission', 'wcvendors' ); ?></h2>
|
| 278 |
+
|
| 279 |
+
<form id="posts-filter" method="get">
|
| 280 |
+
|
| 281 |
+
<?php
|
| 282 |
+
$page = filter_input( INPUT_GET, 'page', FILTER_SANITIZE_STRIPPED );
|
| 283 |
+
$paged = filter_input( INPUT_GET, 'paged', FILTER_SANITIZE_NUMBER_INT );
|
| 284 |
+
|
| 285 |
+
printf( '<input type="hidden" name="page" value="%s" />', $page );
|
| 286 |
+
printf( '<input type="hidden" name="paged" value="%d" />', $paged );
|
| 287 |
+
?>
|
| 288 |
+
|
| 289 |
+
<input type="hidden" name="page" value="pv_admin_commissions"/>
|
| 290 |
+
|
| 291 |
+
<?php $PV_Admin_Page->prepare_items(); ?>
|
| 292 |
+
<?php $PV_Admin_Page->display() ?>
|
| 293 |
+
|
| 294 |
+
</form>
|
| 295 |
+
<div id="ajax-response"></div>
|
| 296 |
+
<br class="clear"/>
|
| 297 |
+
</div>
|
| 298 |
+
<?php
|
| 299 |
+
}
|
| 300 |
+
|
| 301 |
+
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
|
| 305 |
+
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 306 |
+
|
| 307 |
+
/**
|
| 308 |
+
* WC_Simple_Referral_Admin class.
|
| 309 |
+
*
|
| 310 |
+
* @extends WP_List_Table
|
| 311 |
+
*/
|
| 312 |
+
class WCV_Admin_Page extends WP_List_Table
|
| 313 |
+
{
|
| 314 |
+
|
| 315 |
+
public $index;
|
| 316 |
+
|
| 317 |
+
|
| 318 |
+
/**
|
| 319 |
+
* __construct function.
|
| 320 |
+
*
|
| 321 |
+
* @access public
|
| 322 |
+
*/
|
| 323 |
+
function __construct()
|
| 324 |
+
{
|
| 325 |
+
global $status, $page;
|
| 326 |
+
|
| 327 |
+
$this->index = 0;
|
| 328 |
+
|
| 329 |
+
//Set parent defaults
|
| 330 |
+
parent::__construct( array(
|
| 331 |
+
'singular' => 'commission',
|
| 332 |
+
'plural' => 'commissions',
|
| 333 |
+
'ajax' => false
|
| 334 |
+
) );
|
| 335 |
+
}
|
| 336 |
+
|
| 337 |
+
|
| 338 |
+
/**
|
| 339 |
+
* column_default function.
|
| 340 |
+
*
|
| 341 |
+
* @access public
|
| 342 |
+
*
|
| 343 |
+
* @param unknown $item
|
| 344 |
+
* @param mixed $column_name
|
| 345 |
+
*
|
| 346 |
+
* @return unknown
|
| 347 |
+
*/
|
| 348 |
+
function column_default( $item, $column_name )
|
| 349 |
+
{
|
| 350 |
+
global $wpdb;
|
| 351 |
+
|
| 352 |
+
switch ( $column_name ) {
|
| 353 |
+
case 'id' :
|
| 354 |
+
return $item->id;
|
| 355 |
+
case 'vendor_id' :
|
| 356 |
+
$user = get_userdata( $item->vendor_id );
|
| 357 |
+
return '<a href="' . admin_url( 'user-edit.php?user_id=' . $item->vendor_id ) . '">' . WCV_Vendors::get_vendor_shop_name( $item->vendor_id ) . '</a>';
|
| 358 |
+
case 'total_due' :
|
| 359 |
+
return wc_price( $item->total_due );
|
| 360 |
+
case 'total_shipping':
|
| 361 |
+
return wc_price($item->total_shipping );
|
| 362 |
+
case 'tax':
|
| 363 |
+
return wc_price( $item->tax );
|
| 364 |
+
case 'totals' :
|
| 365 |
+
$totals = ( wc_tax_enabled() ) ? $item->total_due + $item->total_shipping + $item->tax : $item->total_due + $item->total_shipping;
|
| 366 |
+
return wc_price( $totals );
|
| 367 |
+
case 'product_id' :
|
| 368 |
+
$parent = get_post_ancestors( $item->product_id );
|
| 369 |
+
$product_id = $parent ? $parent[ 0 ] : $item->product_id;
|
| 370 |
+
$wcv_total_sales = get_post_meta( $product_id, 'total_sales', true );
|
| 371 |
+
return '<a href="' . admin_url( 'post.php?post=' . $product_id . '&action=edit' ) . '">' . get_the_title( $item->product_id ) . '</a> (<span title="' . get_the_title( $item->product_id ) .' has sold ' . $wcv_total_sales . ' times total.">' . $wcv_total_sales . '</span>)';
|
| 372 |
+
case 'order_id' :
|
| 373 |
+
$order = new WC_Order( $item->order_id );
|
| 374 |
+
return '<a href="' . admin_url( 'post.php?post=' . $item->order_id . '&action=edit' ) . '">' . $order->get_order_number() . '</a>';
|
| 375 |
+
case 'status' :
|
| 376 |
+
return $item->status;
|
| 377 |
+
case 'time' :
|
| 378 |
+
return date_i18n( get_option( 'date_format' ), strtotime( $item->time ) );
|
| 379 |
+
}
|
| 380 |
+
}
|
| 381 |
+
|
| 382 |
+
|
| 383 |
+
/**
|
| 384 |
+
* column_cb function.
|
| 385 |
+
*
|
| 386 |
+
* @access public
|
| 387 |
+
*
|
| 388 |
+
* @param mixed $item
|
| 389 |
+
*
|
| 390 |
+
* @return unknown
|
| 391 |
+
*/
|
| 392 |
+
function column_cb( $item )
|
| 393 |
+
{
|
| 394 |
+
return sprintf(
|
| 395 |
+
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 396 |
+
/*$1%s*/
|
| 397 |
+
'id',
|
| 398 |
+
/*$2%s*/
|
| 399 |
+
$item->id
|
| 400 |
+
);
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
|
| 404 |
+
/**
|
| 405 |
+
* get_columns function.
|
| 406 |
+
*
|
| 407 |
+
* @access public
|
| 408 |
+
* @return unknown
|
| 409 |
+
*/
|
| 410 |
+
function get_columns()
|
| 411 |
+
{
|
| 412 |
+
$columns = array(
|
| 413 |
+
'cb' => '<input type="checkbox" />',
|
| 414 |
+
'product_id' => __( 'Product', 'wcvendors' ),
|
| 415 |
+
'order_id' => __( 'Order ID', 'wcvendors' ),
|
| 416 |
+
'vendor_id' => __( 'Vendor', 'wcvendors' ),
|
| 417 |
+
'total_due' => __( 'Commission', 'wcvendors' ),
|
| 418 |
+
'total_shipping' => __( 'Shipping', 'wcvendors' ),
|
| 419 |
+
'tax' => __( 'Tax', 'wcvendors' ),
|
| 420 |
+
'totals' => __( 'Total', 'wcvendors' ),
|
| 421 |
+
'status' => __( 'Status', 'wcvendors' ),
|
| 422 |
+
'time' => __( 'Date', 'wcvendors' ),
|
| 423 |
+
);
|
| 424 |
+
|
| 425 |
+
if ( ! wc_tax_enabled() ) unset( $columns[ 'tax'] );
|
| 426 |
+
|
| 427 |
+
return $columns;
|
| 428 |
+
}
|
| 429 |
+
|
| 430 |
+
|
| 431 |
+
/**
|
| 432 |
+
* get_sortable_columns function.
|
| 433 |
+
*
|
| 434 |
+
* @access public
|
| 435 |
+
* @return unknown
|
| 436 |
+
*/
|
| 437 |
+
function get_sortable_columns()
|
| 438 |
+
{
|
| 439 |
+
$sortable_columns = array(
|
| 440 |
+
'time' => array( 'time', true ),
|
| 441 |
+
'product_id' => array( 'product_id', false ),
|
| 442 |
+
'order_id' => array( 'order_id', false ),
|
| 443 |
+
'total_due' => array( 'total_due', false ),
|
| 444 |
+
'total_shipping' => array( 'total_shipping', false ),
|
| 445 |
+
'tax' => array( 'tax', false ),
|
| 446 |
+
'totals' => array( 'totals', false ),
|
| 447 |
+
'status' => array( 'status', false ),
|
| 448 |
+
'vendor_id' => array( 'vendor_id', false ),
|
| 449 |
+
'status' => array( 'status', false ),
|
| 450 |
+
);
|
| 451 |
+
|
| 452 |
+
if ( ! wc_tax_enabled() ) unset( $sortable_columns[ 'tax'] );
|
| 453 |
+
|
| 454 |
+
return $sortable_columns;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
|
| 458 |
+
/**
|
| 459 |
+
* Get bulk actions
|
| 460 |
+
*
|
| 461 |
+
* @return unknown
|
| 462 |
+
*/
|
| 463 |
+
function get_bulk_actions()
|
| 464 |
+
{
|
| 465 |
+
$actions = array(
|
| 466 |
+
'mark_paid' => __( 'Mark paid', 'wcvendors' ),
|
| 467 |
+
'mark_due' => __( 'Mark due', 'wcvendors' ),
|
| 468 |
+
'mark_reversed' => __( 'Mark reversed', 'wcvendors' ),
|
| 469 |
+
// 'delete' => __('Delete', 'wcvendors'),
|
| 470 |
+
);
|
| 471 |
+
|
| 472 |
+
$actions = apply_filters('wcv_edit_bulk_actions', $actions);
|
| 473 |
+
|
| 474 |
+
return $actions;
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
|
| 478 |
+
/**
|
| 479 |
+
*
|
| 480 |
+
*/
|
| 481 |
+
function extra_tablenav( $which )
|
| 482 |
+
{
|
| 483 |
+
if ( $which == 'top' ) {
|
| 484 |
+
?><div class="alignleft actions" style="width: 70%;">
|
| 485 |
+
<?php
|
| 486 |
+
// Months drop down
|
| 487 |
+
$this->months_dropdown( 'commission' );
|
| 488 |
+
|
| 489 |
+
// commission status drop down
|
| 490 |
+
$this->status_dropdown( 'commission' );
|
| 491 |
+
|
| 492 |
+
// Vendor drop down
|
| 493 |
+
$this->vendor_dropdown( 'commission' );
|
| 494 |
+
|
| 495 |
+
submit_button( __( 'Filter' ), false, false, false, array( 'id' => "post-query-submit", 'name' => 'do-filter' ) );
|
| 496 |
+
?></div>
|
| 497 |
+
<?php
|
| 498 |
+
}
|
| 499 |
+
}
|
| 500 |
+
|
| 501 |
+
|
| 502 |
+
/**
|
| 503 |
+
* Display a monthly dropdown for filtering items
|
| 504 |
+
*
|
| 505 |
+
* @since 3.1.0
|
| 506 |
+
* @access protected
|
| 507 |
+
*
|
| 508 |
+
* @param unknown $post_type
|
| 509 |
+
*/
|
| 510 |
+
function months_dropdown( $post_type )
|
| 511 |
+
{
|
| 512 |
+
global $wpdb, $wp_locale;
|
| 513 |
+
|
| 514 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 515 |
+
|
| 516 |
+
$months = $wpdb->get_results( "
|
| 517 |
+
SELECT DISTINCT YEAR( time ) AS year, MONTH( time ) AS month
|
| 518 |
+
FROM $table_name
|
| 519 |
+
ORDER BY time DESC
|
| 520 |
+
" );
|
| 521 |
+
|
| 522 |
+
$month_count = count( $months );
|
| 523 |
+
|
| 524 |
+
if ( !$month_count || ( 1 == $month_count && 0 == $months[ 0 ]->month ) )
|
| 525 |
+
return;
|
| 526 |
+
|
| 527 |
+
$m = isset( $_GET[ 'm' ] ) ? (int) $_GET[ 'm' ] : 0;
|
| 528 |
+
?>
|
| 529 |
+
<select name="m" id="filter-by-date">
|
| 530 |
+
<option<?php selected( $m, 0 ); ?> value='0'><?php _e( 'Show all dates', 'wcvendors' ); ?></option>
|
| 531 |
+
<?php
|
| 532 |
+
foreach ( $months as $arc_row ) {
|
| 533 |
+
if ( 0 == $arc_row->year )
|
| 534 |
+
continue;
|
| 535 |
+
|
| 536 |
+
$month = zeroise( $arc_row->month, 2 );
|
| 537 |
+
$year = $arc_row->year;
|
| 538 |
+
|
| 539 |
+
printf( "<option %s value='%s'>%s</option>\n",
|
| 540 |
+
selected( $m, $year . $month, false ),
|
| 541 |
+
esc_attr( $arc_row->year . $month ),
|
| 542 |
+
/* translators: 1: month name, 2: 4-digit year */
|
| 543 |
+
sprintf( __( '%1$s %2$d' ), $wp_locale->get_month( $month ), $year )
|
| 544 |
+
);
|
| 545 |
+
}
|
| 546 |
+
?>
|
| 547 |
+
</select>
|
| 548 |
+
|
| 549 |
+
<?php
|
| 550 |
+
}
|
| 551 |
+
|
| 552 |
+
/**
|
| 553 |
+
* Display a status dropdown for filtering items
|
| 554 |
+
*
|
| 555 |
+
* @since 3.1.0
|
| 556 |
+
* @access protected
|
| 557 |
+
*
|
| 558 |
+
* @param unknown $post_type
|
| 559 |
+
*/
|
| 560 |
+
function status_dropdown( $post_type )
|
| 561 |
+
{
|
| 562 |
+
$com_status = isset( $_GET[ 'com_status' ] ) ? $_GET[ 'com_status' ] : '';
|
| 563 |
+
?>
|
| 564 |
+
<select name="com_status">
|
| 565 |
+
<option<?php selected( $com_status, '' ); ?> value=''><?php _e( 'Show all Statuses', 'wcvendors' ); ?></option>
|
| 566 |
+
<option<?php selected( $com_status, 'due' ); ?> value="due"><?php _e( 'Due', 'wcvendors' ); ?></option>
|
| 567 |
+
<option<?php selected( $com_status, 'paid' ); ?> value="paid"><?php _e( 'Paid', 'wcvendors' ); ?></option>
|
| 568 |
+
<option<?php selected( $com_status, 'reversed' ); ?> value="reversed"><?php _e( 'Reversed', 'wcvendors' ); ?></option>
|
| 569 |
+
</select>
|
| 570 |
+
<?php
|
| 571 |
+
}
|
| 572 |
+
|
| 573 |
+
/**
|
| 574 |
+
* Display a vendor dropdown for filtering commissions
|
| 575 |
+
*
|
| 576 |
+
* @since 1.9.2
|
| 577 |
+
* @access public
|
| 578 |
+
*
|
| 579 |
+
* @param unknown $post_type
|
| 580 |
+
*/
|
| 581 |
+
public function vendor_dropdown( $post_type ){
|
| 582 |
+
|
| 583 |
+
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 584 |
+
$vendor_id = isset( $_GET[ 'vendor_id' ] ) ? $_GET[ 'vendor_id' ] : '';
|
| 585 |
+
$new_args = $user_args;
|
| 586 |
+
$new_args[ 'role' ] = 'vendor';
|
| 587 |
+
$users = get_users( $new_args );
|
| 588 |
+
|
| 589 |
+
// Generate the drop down
|
| 590 |
+
$output = '<select style="width: 30%;" name="vendor_id" id="vendor_id" class="select2">';
|
| 591 |
+
$output .= "<option></option>";
|
| 592 |
+
foreach ( (array) $users as $user ) {
|
| 593 |
+
$select = selected( $user->ID, $vendor_id, false );
|
| 594 |
+
$output .= "<option value='$user->ID' $select>$user->display_name</option>";
|
| 595 |
+
}
|
| 596 |
+
$output .= '</select>';
|
| 597 |
+
|
| 598 |
+
echo $output;
|
| 599 |
+
|
| 600 |
+
} // vendor_dropdown()
|
| 601 |
+
|
| 602 |
+
|
| 603 |
+
|
| 604 |
+
/**
|
| 605 |
+
* Process bulk actions
|
| 606 |
+
*
|
| 607 |
+
* @return unknown
|
| 608 |
+
*/
|
| 609 |
+
function process_bulk_action()
|
| 610 |
+
{
|
| 611 |
+
if ( !isset( $_GET[ 'id' ] ) ) return;
|
| 612 |
+
|
| 613 |
+
$items = array_map( 'intval', $_GET[ 'id' ] );
|
| 614 |
+
$ids = implode( ',', $items );
|
| 615 |
+
|
| 616 |
+
switch ( $this->current_action() ) {
|
| 617 |
+
case 'mark_paid':
|
| 618 |
+
$result = $this->mark_paid( $ids );
|
| 619 |
+
|
| 620 |
+
if ( $result )
|
| 621 |
+
echo '<div class="updated"><p>' . __( 'Commission marked paid.', 'wcvendors' ) . '</p></div>';
|
| 622 |
+
break;
|
| 623 |
+
|
| 624 |
+
case 'mark_due':
|
| 625 |
+
$result = $this->mark_due( $ids );
|
| 626 |
+
|
| 627 |
+
if ( $result )
|
| 628 |
+
echo '<div class="updated"><p>' . __( 'Commission marked due.', 'wcvendors' ) . '</p></div>';
|
| 629 |
+
break;
|
| 630 |
+
|
| 631 |
+
case 'mark_reversed':
|
| 632 |
+
$result = $this->mark_reversed( $ids );
|
| 633 |
+
|
| 634 |
+
if ( $result )
|
| 635 |
+
echo '<div class="updated"><p>' . __( 'Commission marked reversed.', 'wcvendors' ) . '</p></div>';
|
| 636 |
+
break;
|
| 637 |
+
|
| 638 |
+
default:
|
| 639 |
+
// code...
|
| 640 |
+
do_action('wcv_edit_process_bulk_actions', $this->current_action(), $ids);
|
| 641 |
+
break;
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
}
|
| 645 |
+
|
| 646 |
+
|
| 647 |
+
/**
|
| 648 |
+
*
|
| 649 |
+
*
|
| 650 |
+
* @param unknown $ids (optional)
|
| 651 |
+
*
|
| 652 |
+
* @return unknown
|
| 653 |
+
*/
|
| 654 |
+
public function mark_paid( $ids = array() )
|
| 655 |
+
{
|
| 656 |
+
global $wpdb;
|
| 657 |
+
|
| 658 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 659 |
+
|
| 660 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE id IN ($ids) AND `status` = 'due'";
|
| 661 |
+
$result = $wpdb->query( $query );
|
| 662 |
+
|
| 663 |
+
return $result;
|
| 664 |
+
}
|
| 665 |
+
|
| 666 |
+
|
| 667 |
+
/**
|
| 668 |
+
*
|
| 669 |
+
*
|
| 670 |
+
* @param unknown $ids (optional)
|
| 671 |
+
*
|
| 672 |
+
* @return unknown
|
| 673 |
+
*/
|
| 674 |
+
public function mark_reversed( $ids = array() )
|
| 675 |
+
{
|
| 676 |
+
global $wpdb;
|
| 677 |
+
|
| 678 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 679 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'reversed' WHERE id IN ($ids)";
|
| 680 |
+
$result = $wpdb->query( $query );
|
| 681 |
+
|
| 682 |
+
return $result;
|
| 683 |
+
|
| 684 |
+
}
|
| 685 |
+
|
| 686 |
+
|
| 687 |
+
/**
|
| 688 |
+
*
|
| 689 |
+
*
|
| 690 |
+
* @param unknown $ids (optional)
|
| 691 |
+
*
|
| 692 |
+
* @return unknown
|
| 693 |
+
*/
|
| 694 |
+
public function mark_due( $ids = array() )
|
| 695 |
+
{
|
| 696 |
+
global $wpdb;
|
| 697 |
+
|
| 698 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 699 |
+
|
| 700 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'due' WHERE id IN ($ids)";
|
| 701 |
+
$result = $wpdb->query( $query );
|
| 702 |
+
|
| 703 |
+
return $result;
|
| 704 |
+
}
|
| 705 |
+
|
| 706 |
+
|
| 707 |
+
/**
|
| 708 |
+
* prepare_items function.
|
| 709 |
+
*
|
| 710 |
+
* @access public
|
| 711 |
+
*/
|
| 712 |
+
function prepare_items()
|
| 713 |
+
{
|
| 714 |
+
global $wpdb;
|
| 715 |
+
|
| 716 |
+
$_SERVER['REQUEST_URI'] = remove_query_arg( '_wp_http_referer', $_SERVER['REQUEST_URI'] );
|
| 717 |
+
|
| 718 |
+
$per_page = $this->get_items_per_page( 'commission_per_page', 10 );
|
| 719 |
+
$current_page = $this->get_pagenum();
|
| 720 |
+
|
| 721 |
+
$orderby = !empty( $_REQUEST[ 'orderby' ] ) ? esc_attr( $_REQUEST[ 'orderby' ] ) : 'time';
|
| 722 |
+
$order = ( !empty( $_REQUEST[ 'order' ] ) && $_REQUEST[ 'order' ] == 'asc' ) ? 'ASC' : 'DESC';
|
| 723 |
+
$com_status = !empty( $_REQUEST[ 'com_status' ] ) ? esc_attr( $_REQUEST[ 'com_status' ] ) : '';
|
| 724 |
+
$vendor_id = !empty( $_REQUEST[ 'vendor_id' ] ) ? esc_attr( $_REQUEST[ 'vendor_id' ] ) : '';
|
| 725 |
+
$status_sql = '';
|
| 726 |
+
$time_sql = '';
|
| 727 |
+
|
| 728 |
+
/**
|
| 729 |
+
* Init column headers
|
| 730 |
+
*/
|
| 731 |
+
$this->_column_headers = $this->get_column_info();
|
| 732 |
+
|
| 733 |
+
/**
|
| 734 |
+
* Process bulk actions
|
| 735 |
+
*/
|
| 736 |
+
$this->process_bulk_action();
|
| 737 |
+
|
| 738 |
+
/**
|
| 739 |
+
* Get items
|
| 740 |
+
*/
|
| 741 |
+
$sql = "SELECT COUNT(id) FROM {$wpdb->prefix}pv_commission";
|
| 742 |
+
|
| 743 |
+
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 744 |
+
|
| 745 |
+
$year = substr( $_GET[ 'm' ], 0, 4 );
|
| 746 |
+
$month = substr( $_GET[ 'm' ], 4, 2 );
|
| 747 |
+
|
| 748 |
+
$time_sql = "
|
| 749 |
+
WHERE MONTH(`time`) = '$month'
|
| 750 |
+
AND YEAR(`time`) = '$year'
|
| 751 |
+
";
|
| 752 |
+
|
| 753 |
+
$sql .= $time_sql;
|
| 754 |
+
}
|
| 755 |
+
|
| 756 |
+
if ( !empty( $_GET[ 'com_status' ] ) ) {
|
| 757 |
+
|
| 758 |
+
if ( $time_sql == '' ) {
|
| 759 |
+
$status_sql = "
|
| 760 |
+
WHERE status = '$com_status'
|
| 761 |
+
";
|
| 762 |
+
} else {
|
| 763 |
+
$status_sql = "
|
| 764 |
+
AND status = '$com_status'
|
| 765 |
+
";
|
| 766 |
+
}
|
| 767 |
+
|
| 768 |
+
$sql .= $status_sql;
|
| 769 |
+
}
|
| 770 |
+
|
| 771 |
+
|
| 772 |
+
if ( !empty( $_GET[ 'vendor_id' ] ) ) {
|
| 773 |
+
|
| 774 |
+
if ( $time_sql == '' || $status_sql == '' ) {
|
| 775 |
+
$vendor_sql = "
|
| 776 |
+
WHERE vendor_id = '$vendor_id'
|
| 777 |
+
";
|
| 778 |
+
} else {
|
| 779 |
+
$vendor_sql = "
|
| 780 |
+
AND vendor_id = '$vendor_id'
|
| 781 |
+
";
|
| 782 |
+
}
|
| 783 |
+
|
| 784 |
+
$sql .= $vendor_sql;
|
| 785 |
+
}
|
| 786 |
+
|
| 787 |
+
$max = $wpdb->get_var( $sql );
|
| 788 |
+
|
| 789 |
+
$sql = "
|
| 790 |
+
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 791 |
+
";
|
| 792 |
+
|
| 793 |
+
if ( !empty( $_GET[ 'm' ] ) ) {
|
| 794 |
+
$sql .= $time_sql;
|
| 795 |
+
}
|
| 796 |
+
|
| 797 |
+
if ( !empty( $_GET['com_status'] ) ) {
|
| 798 |
+
$sql .= $status_sql;
|
| 799 |
+
}
|
| 800 |
+
|
| 801 |
+
if ( !empty( $_GET['vendor_id'] ) ) {
|
| 802 |
+
$sql .= $vendor_sql;
|
| 803 |
+
}
|
| 804 |
+
|
| 805 |
+
$offset = ( $current_page - 1 ) * $per_page;
|
| 806 |
+
|
| 807 |
+
$sql .= "
|
| 808 |
+
ORDER BY `{$orderby}` {$order}
|
| 809 |
+
LIMIT {$offset}, {$per_page}
|
| 810 |
+
";
|
| 811 |
+
|
| 812 |
+
// $this->items = $wpdb->get_results( $wpdb->prepare( $sql, ( $current_page - 1 ) * $per_page, $per_page ) );
|
| 813 |
+
$this->items = $wpdb->get_results( $sql );
|
| 814 |
+
|
| 815 |
+
/**
|
| 816 |
+
* Pagination
|
| 817 |
+
*/
|
| 818 |
+
$this->set_pagination_args( array(
|
| 819 |
+
'total_items' => $max,
|
| 820 |
+
'per_page' => $per_page,
|
| 821 |
+
'total_pages' => ceil( $max / $per_page )
|
| 822 |
+
) );
|
| 823 |
+
}
|
| 824 |
+
|
| 825 |
+
|
| 826 |
+
}
|
trunk/classes/admin/class-admin-reports.php
ADDED
|
@@ -0,0 +1,549 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* WCV_Admin_Reports class.
|
| 4 |
+
*
|
| 5 |
+
* Shows reports related to software in the woocommerce backend
|
| 6 |
+
*
|
| 7 |
+
* @author Matt Gates <http://mgates.me>
|
| 8 |
+
* @package
|
| 9 |
+
*/
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
class WCV_Admin_Reports
|
| 13 |
+
{
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* __construct function.
|
| 18 |
+
*
|
| 19 |
+
* @access public
|
| 20 |
+
* @return void
|
| 21 |
+
*
|
| 22 |
+
* @param bool $debug (optional) (default: false)
|
| 23 |
+
*/
|
| 24 |
+
function __construct( $debug = false )
|
| 25 |
+
{
|
| 26 |
+
add_filter( 'woocommerce_admin_reports', array( $this, 'reports_tab' ) );
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
/**
|
| 30 |
+
* reports_tab function.
|
| 31 |
+
*
|
| 32 |
+
* @access public
|
| 33 |
+
*
|
| 34 |
+
* @param unknown $reports
|
| 35 |
+
*
|
| 36 |
+
* @return void
|
| 37 |
+
*/
|
| 38 |
+
function reports_tab( $reports )
|
| 39 |
+
{
|
| 40 |
+
$reports[ 'vendors' ] = array(
|
| 41 |
+
'title' => __( 'WC Vendors', 'wcvendors' ),
|
| 42 |
+
'charts' => array(
|
| 43 |
+
array(
|
| 44 |
+
'title' => __( 'Overview', 'wcvendors' ),
|
| 45 |
+
'description' => '',
|
| 46 |
+
'hide_title' => true,
|
| 47 |
+
'function' => array( $this, 'sales' ),
|
| 48 |
+
),
|
| 49 |
+
array(
|
| 50 |
+
'title' => __( 'Commission by vendor', 'wcvendors' ),
|
| 51 |
+
'description' => '',
|
| 52 |
+
'hide_title' => true,
|
| 53 |
+
'function' => array( $this, 'commission' ),
|
| 54 |
+
),
|
| 55 |
+
array(
|
| 56 |
+
'title' => __( 'Commission by product', 'wcvendors' ),
|
| 57 |
+
'description' => '',
|
| 58 |
+
'hide_title' => true,
|
| 59 |
+
'function' => array( $this, 'commission' ),
|
| 60 |
+
),
|
| 61 |
+
array(
|
| 62 |
+
'title' => __( 'Commission Totals', 'wcvendors' ),
|
| 63 |
+
'description' => __( 'Commission totals for all vendors includes shipping and taxes. By default no date range is used and all due commissions are returned. Use the date range to filter.', 'wcvendors' ),
|
| 64 |
+
'hide_title' => true,
|
| 65 |
+
'function' => array( $this, 'commission_totals' ),
|
| 66 |
+
),
|
| 67 |
+
),
|
| 68 |
+
);
|
| 69 |
+
|
| 70 |
+
return $reports;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
public function products()
|
| 74 |
+
{
|
| 75 |
+
# code...
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
|
| 79 |
+
/**
|
| 80 |
+
*
|
| 81 |
+
*/
|
| 82 |
+
function sales()
|
| 83 |
+
{
|
| 84 |
+
|
| 85 |
+
global $start_date, $end_date, $woocommerce, $wpdb;
|
| 86 |
+
|
| 87 |
+
$commission_status_labels = WCV_Commission::commission_status();
|
| 88 |
+
|
| 89 |
+
$start_date = !empty( $_POST[ 'start_date' ] ) ? $_POST[ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 90 |
+
$end_date = !empty( $_POST[ 'end_date' ] ) ? $_POST[ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 91 |
+
|
| 92 |
+
if ( !empty( $_POST[ 'start_date' ] ) ) {
|
| 93 |
+
$start_date = strtotime( $_POST[ 'start_date' ] );
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
if ( !empty( $_POST[ 'end_date' ] ) ) {
|
| 97 |
+
$end_date = strtotime( $_POST[ 'end_date' ] );
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
$after = date( 'Y-m-d', $start_date );
|
| 101 |
+
$before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
|
| 102 |
+
|
| 103 |
+
$commission_due = $wpdb->get_var( "
|
| 104 |
+
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'due'
|
| 105 |
+
AND time >= '" . $after . "'
|
| 106 |
+
AND time <= '" . $before . "'
|
| 107 |
+
" );
|
| 108 |
+
|
| 109 |
+
$reversed = $wpdb->get_var( "
|
| 110 |
+
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'reversed'
|
| 111 |
+
AND time >= '" . $after . "'
|
| 112 |
+
AND time <= '" . $before . "'
|
| 113 |
+
" );
|
| 114 |
+
|
| 115 |
+
$paid = $wpdb->get_var( "
|
| 116 |
+
SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission WHERE status = 'paid'
|
| 117 |
+
AND time >= '" . $after . "'
|
| 118 |
+
AND time <= '" . $before . "'
|
| 119 |
+
" );
|
| 120 |
+
|
| 121 |
+
?>
|
| 122 |
+
|
| 123 |
+
<form method="post" action="">
|
| 124 |
+
<p><label for="from"><?php _e( 'From:', 'wcvendors' ); ?></label>
|
| 125 |
+
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $start_date ) ); ?>" name="start_date" class="range_datepicker from" id="from" />
|
| 126 |
+
<label for="to"><?php _e( 'To:', 'wcvendors' ); ?></label>
|
| 127 |
+
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $end_date ) ); ?>" name="end_date" class="range_datepicker to" id="to" />
|
| 128 |
+
<input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/></p>
|
| 129 |
+
</form>
|
| 130 |
+
|
| 131 |
+
<div id="poststuff" class="woocommerce-reports-wrap">
|
| 132 |
+
<div class="woocommerce-reports-sidebar">
|
| 133 |
+
<div class="postbox">
|
| 134 |
+
<h3><span><?php _e( 'Total paid in range', 'wcvendors' ); ?></span></h3>
|
| 135 |
+
|
| 136 |
+
<div class="inside">
|
| 137 |
+
<p class="stat"><?php if ( $paid > 0 ) echo wc_price( $paid ); else _e( 'n/a', 'wcvendors' ); ?></p>
|
| 138 |
+
</div>
|
| 139 |
+
</div>
|
| 140 |
+
<div class="postbox">
|
| 141 |
+
<h3><span><?php _e( 'Total due in range', 'wcvendors' ); ?></span></h3>
|
| 142 |
+
|
| 143 |
+
<div class="inside">
|
| 144 |
+
<p class="stat"><?php if ( $commission_due > 0 ) echo wc_price( $commission_due ); else _e( 'n/a', 'wcvendors' ); ?></p>
|
| 145 |
+
</div>
|
| 146 |
+
</div>
|
| 147 |
+
<div class="postbox">
|
| 148 |
+
<h3><span><?php _e( 'Total reversed in range', 'wcvendors' ); ?></span></h3>
|
| 149 |
+
|
| 150 |
+
<div class="inside">
|
| 151 |
+
<p class="stat"><?php if ( $reversed > 0 ) echo wc_price( $reversed ); else _e( 'n/a', 'wcvendors' ); ?></p>
|
| 152 |
+
</div>
|
| 153 |
+
</div>
|
| 154 |
+
</div>
|
| 155 |
+
|
| 156 |
+
<div class="woocommerce-reports-main">
|
| 157 |
+
<div class="postbox">
|
| 158 |
+
<h3><span><?php _e( 'Recent Commission', 'wcvendors' ); ?></span></h3>
|
| 159 |
+
|
| 160 |
+
<div>
|
| 161 |
+
<?php
|
| 162 |
+
$commission = $wpdb->get_results( "
|
| 163 |
+
SELECT * FROM {$wpdb->prefix}pv_commission
|
| 164 |
+
WHERE time >= '" . $after . "'
|
| 165 |
+
AND time <= '" . $before . "'
|
| 166 |
+
ORDER BY time DESC
|
| 167 |
+
" );
|
| 168 |
+
|
| 169 |
+
if ( sizeof( $commission ) > 0 ) {
|
| 170 |
+
|
| 171 |
+
?>
|
| 172 |
+
<div class="woocommerce_order_items_wrapper">
|
| 173 |
+
<table id="commission-table" class="woocommerce_order_items" cellspacing="0">
|
| 174 |
+
<thead>
|
| 175 |
+
<tr>
|
| 176 |
+
<th><?php _e( 'Order', 'wcvendors' ) ?></th>
|
| 177 |
+
<th><?php _e( 'Product', 'wcvendors' ) ?></th>
|
| 178 |
+
<th><?php _e( 'Vendor', 'wcvendors' ) ?></th>
|
| 179 |
+
<th><?php _e( 'Total', 'wcvendors' ) ?></th>
|
| 180 |
+
<th><?php _e( 'Date & Time', 'wcvendors' ) ?></th>
|
| 181 |
+
<th><?php _e( 'Status', 'wcvendors' ) ?></th>
|
| 182 |
+
</tr>
|
| 183 |
+
</thead>
|
| 184 |
+
<tbody>
|
| 185 |
+
<?php $i = 1;
|
| 186 |
+
foreach ( $commission as $row ) : $i++ ?>
|
| 187 |
+
<tr<?php if ( $i % 2 == 1 ) echo ' class="alternate"' ?>>
|
| 188 |
+
<td><?php if ( $row->order_id ) : ?><a
|
| 189 |
+
href="<?php echo admin_url( 'post.php?post=' . $row->order_id . '&action=edit' ); ?>"><?php echo $row->order_id; ?></a><?php else : _e( 'N/A', 'wcvendors' ); endif; ?>
|
| 190 |
+
</td>
|
| 191 |
+
<td><?php echo get_the_title( $row->product_id ); ?></td>
|
| 192 |
+
<td><?php echo WCV_Vendors::get_vendor_shop_name( $row->vendor_id ); ?></td>
|
| 193 |
+
<td><?php echo wc_price( $row->total_due + $row->total_shipping + $row->tax ) ?></td>
|
| 194 |
+
<td><?php echo date_i18n( __( 'D j M Y \a\t h:ia', 'wcvendors' ), strtotime( $row->time ) ) ?></td>
|
| 195 |
+
<td><?php echo $commission_status_labels[ $row->status ]; ?></td>
|
| 196 |
+
</tr>
|
| 197 |
+
<?php endforeach; ?>
|
| 198 |
+
</tbody>
|
| 199 |
+
</table>
|
| 200 |
+
</div>
|
| 201 |
+
<?php
|
| 202 |
+
} else {
|
| 203 |
+
?><p><?php _e( 'No commission yet', 'wcvendors' ) ?></p><?php
|
| 204 |
+
}
|
| 205 |
+
?>
|
| 206 |
+
</div>
|
| 207 |
+
</div>
|
| 208 |
+
</div>
|
| 209 |
+
</div>
|
| 210 |
+
<?php
|
| 211 |
+
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
|
| 215 |
+
/**
|
| 216 |
+
*
|
| 217 |
+
*/
|
| 218 |
+
function commission()
|
| 219 |
+
{
|
| 220 |
+
global $start_date, $end_date, $woocommerce, $wpdb;
|
| 221 |
+
|
| 222 |
+
$latest_woo = version_compare( $woocommerce->version, '2.3', '>' );
|
| 223 |
+
|
| 224 |
+
$first_year = $wpdb->get_var( "SELECT time FROM {$wpdb->prefix}pv_commission ORDER BY time ASC LIMIT 1;" );
|
| 225 |
+
$first_year = $first_year ? date( 'Y', strtotime( $first_year ) ) : date( 'Y' );
|
| 226 |
+
$current_year = isset( $_POST[ 'show_year' ] ) ? $_POST[ 'show_year' ] : date( 'Y', current_time( 'timestamp' ) );
|
| 227 |
+
$start_date = strtotime( $current_year . '0101' );
|
| 228 |
+
|
| 229 |
+
$vendors = get_users( array( 'role' => 'vendor' ) );
|
| 230 |
+
$vendors = apply_filters( 'pv_commission_vendors_list', $vendors );
|
| 231 |
+
$selected_vendor = !empty( $_POST[ 'show_vendor' ] ) ? (int) $_POST[ 'show_vendor' ] : false;
|
| 232 |
+
$products = !empty( $_POST[ 'product_ids' ] ) ? (array) $_POST[ 'product_ids' ] : array();
|
| 233 |
+
|
| 234 |
+
?>
|
| 235 |
+
|
| 236 |
+
<form method="post" action="" class="report_filters">
|
| 237 |
+
<label for="show_year"><?php _e( 'Show:', 'wcvendors' ); ?></label>
|
| 238 |
+
<select name="show_year" id="show_year">
|
| 239 |
+
<?php
|
| 240 |
+
for ( $i = $first_year; $i <= date( 'Y' ); $i++ )
|
| 241 |
+
printf( '<option value="%s" %s>%s</option>', $i, selected( $current_year, $i, false ), $i );
|
| 242 |
+
?>
|
| 243 |
+
</select>
|
| 244 |
+
<?php if ( $_GET[ 'report' ] == 2 ) {
|
| 245 |
+
if ($latest_woo) { ?>
|
| 246 |
+
<input type="hidden" class="wc-product-search" style="width:203px;" name="product_ids[]" data-placeholder="<?php _e( 'Search for a product…', 'woocommerce' ); ?>" data-action="woocommerce_json_search_products_and_variations" />
|
| 247 |
+
<?php } else { ?>
|
| 248 |
+
<select id="product_ids" name="product_ids[]" class="ajax_chosen_select_products" multiple="multiple"
|
| 249 |
+
data-placeholder="<?php _e( 'Type in a product name to start searching...', 'wcvendors' ); ?>"
|
| 250 |
+
style="width: 400px;"></select>
|
| 251 |
+
<script type="text/javascript">
|
| 252 |
+
jQuery(function () {
|
| 253 |
+
|
| 254 |
+
// Ajax Chosen Product Selectors
|
| 255 |
+
jQuery("select.ajax_chosen_select_products").ajaxChosen({
|
| 256 |
+
method: 'GET',
|
| 257 |
+
url: '<?php echo admin_url('admin-ajax.php'); ?>',
|
| 258 |
+
dataType: 'json',
|
| 259 |
+
afterTypeDelay: 100,
|
| 260 |
+
data: {
|
| 261 |
+
action: 'woocommerce_json_search_products',
|
| 262 |
+
security: '<?php echo wp_create_nonce("search-products"); ?>'
|
| 263 |
+
}
|
| 264 |
+
}, function (data) {
|
| 265 |
+
|
| 266 |
+
var terms = {};
|
| 267 |
+
|
| 268 |
+
jQuery.each(data, function (i, val) {
|
| 269 |
+
terms[i] = val;
|
| 270 |
+
});
|
| 271 |
+
|
| 272 |
+
return terms;
|
| 273 |
+
});
|
| 274 |
+
|
| 275 |
+
});
|
| 276 |
+
</script>
|
| 277 |
+
|
| 278 |
+
<?php }
|
| 279 |
+
} else { ?>
|
| 280 |
+
<select class="chosen_select" id="show_vendor" name="show_vendor" style="width: 300px;"
|
| 281 |
+
data-placeholder="<?php _e( 'Select a vendor…', 'wcvendors' ); ?>">
|
| 282 |
+
<option></option>
|
| 283 |
+
<?php foreach ( $vendors as $key => $vendor ) printf( '<option value="%s" %s>%s</option>', $vendor->ID, selected( $selected_vendor, $vendor->ID, false ), $vendor->display_name ); ?>
|
| 284 |
+
</select>
|
| 285 |
+
<?php } ?>
|
| 286 |
+
<input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/>
|
| 287 |
+
</form>
|
| 288 |
+
|
| 289 |
+
<?php
|
| 290 |
+
|
| 291 |
+
if ( !empty( $selected_vendor ) || !empty( $products ) ) {
|
| 292 |
+
|
| 293 |
+
foreach ($products as $key => $product_id) {
|
| 294 |
+
$_product = wc_get_product($product_id);
|
| 295 |
+
$childs = $_product->get_children();
|
| 296 |
+
$products = array_merge($childs, $products);
|
| 297 |
+
}
|
| 298 |
+
|
| 299 |
+
$commissions = array();
|
| 300 |
+
$filter = !empty( $selected_vendor ) ? (" WHERE vendor_id = " . $selected_vendor) : (" WHERE product_id IN ( " . implode( ', ', $products ) ." )");
|
| 301 |
+
|
| 302 |
+
$sql = "SELECT
|
| 303 |
+
SUM(total_due + total_shipping + tax) as total,
|
| 304 |
+
SUM(total_due) as commission,
|
| 305 |
+
SUM(total_shipping) as shipping,
|
| 306 |
+
SUM(tax) as tax
|
| 307 |
+
FROM {$wpdb->prefix}pv_commission
|
| 308 |
+
";
|
| 309 |
+
|
| 310 |
+
$paid_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission " . $filter . " AND status = 'paid'";
|
| 311 |
+
$reversed_sql = "SELECT SUM(total_due + total_shipping + tax) FROM {$wpdb->prefix}pv_commission" . $filter . " AND status = 'reversed'";
|
| 312 |
+
$date_sql = " AND date_format(`time`,'%%Y%%m') = %d";
|
| 313 |
+
|
| 314 |
+
for ( $count = 0; $count < 12; $count++ ) {
|
| 315 |
+
$time = strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' );
|
| 316 |
+
if ( $time > current_time( 'timestamp' ) ) continue;
|
| 317 |
+
|
| 318 |
+
$month = date( 'Ym', strtotime( date( 'Ym', strtotime( '+ ' . $count . ' MONTH', $start_date ) ) . '01' ) );
|
| 319 |
+
|
| 320 |
+
$fetch_results = $wpdb->prepare( $sql . $filter . $date_sql, $month );
|
| 321 |
+
|
| 322 |
+
$results = $wpdb->get_results( $fetch_results );
|
| 323 |
+
if ( !empty( $results[ 0 ] ) ) {
|
| 324 |
+
extract( get_object_vars( $results[ 0 ] ) );
|
| 325 |
+
}
|
| 326 |
+
|
| 327 |
+
$paid = $wpdb->get_var( $wpdb->prepare( $paid_sql . $date_sql, $month ) );
|
| 328 |
+
$reversed = $wpdb->get_var( $wpdb->prepare( $reversed_sql . $date_sql, $month ) );
|
| 329 |
+
|
| 330 |
+
$commissions[ date( 'M', strtotime( $month . '01' ) ) ] = array(
|
| 331 |
+
'commission' => $commission,
|
| 332 |
+
'tax' => $tax,
|
| 333 |
+
'shipping' => $shipping,
|
| 334 |
+
'reversed' => $reversed,
|
| 335 |
+
'paid' => $paid,
|
| 336 |
+
'total' => $total - $reversed - $paid,
|
| 337 |
+
);
|
| 338 |
+
|
| 339 |
+
}
|
| 340 |
+
|
| 341 |
+
?>
|
| 342 |
+
|
| 343 |
+
<div class="woocommerce-reports-main">
|
| 344 |
+
<table class="widefat">
|
| 345 |
+
<thead>
|
| 346 |
+
<tr>
|
| 347 |
+
<th><?php _e( 'Month', 'wcvendors' ); ?></th>
|
| 348 |
+
<th class="total_row"><?php _e( 'Commission Totals', 'wcvendors' ); ?></th>
|
| 349 |
+
<th class="total_row"><?php _e( 'Tax', 'wcvendors' ); ?></th>
|
| 350 |
+
<th class="total_row"><?php _e( 'Shipping', 'wcvendors' ); ?></th>
|
| 351 |
+
<th class="total_row"><?php _e( 'Reversed', 'wcvendors' ); ?></th>
|
| 352 |
+
<th class="total_row"><?php _e( 'Paid', 'wcvendors' ); ?></th>
|
| 353 |
+
<th class="total_row"><?php _e( 'Due', 'wcvendors' ); ?></th>
|
| 354 |
+
</tr>
|
| 355 |
+
</thead>
|
| 356 |
+
<tfoot>
|
| 357 |
+
<tr>
|
| 358 |
+
<?php
|
| 359 |
+
$total = array(
|
| 360 |
+
'commission' => 0,
|
| 361 |
+
'tax' => 0,
|
| 362 |
+
'shipping' => 0,
|
| 363 |
+
'reversed' => 0,
|
| 364 |
+
'paid' => 0,
|
| 365 |
+
'total' => 0,
|
| 366 |
+
);
|
| 367 |
+
|
| 368 |
+
foreach ( $commissions as $month => $commission ) {
|
| 369 |
+
$total[ 'commission' ] += $commission[ 'commission' ];
|
| 370 |
+
$total[ 'tax' ] += $commission[ 'tax' ];
|
| 371 |
+
$total[ 'shipping' ] += $commission[ 'shipping' ];
|
| 372 |
+
$total[ 'reversed' ] += $commission[ 'reversed' ];
|
| 373 |
+
$total[ 'paid' ] += $commission[ 'paid' ];
|
| 374 |
+
$total[ 'total' ] += $commission[ 'total' ];
|
| 375 |
+
}
|
| 376 |
+
|
| 377 |
+
echo '<td>' . __( 'Total', 'wcvendors' ) . '</td>';
|
| 378 |
+
|
| 379 |
+
foreach ( $total as $value ) {
|
| 380 |
+
echo '<td class="total_row">' . wc_price( $value ) . '</td>';
|
| 381 |
+
}
|
| 382 |
+
?>
|
| 383 |
+
</tr>
|
| 384 |
+
</tfoot>
|
| 385 |
+
<tbody>
|
| 386 |
+
<?php
|
| 387 |
+
foreach ( $commissions as $month => $commission ) {
|
| 388 |
+
$alt = ( isset( $alt ) && $alt == 'alt' ) ? '' : 'alt';
|
| 389 |
+
|
| 390 |
+
echo '<tr class="' . $alt . '"><td>' . $month . '</td>';
|
| 391 |
+
|
| 392 |
+
foreach ( $commission as $value ) {
|
| 393 |
+
echo '<td class="total_row">' . wc_price( $value ) . '</td>';
|
| 394 |
+
}
|
| 395 |
+
|
| 396 |
+
echo '</tr>';
|
| 397 |
+
}
|
| 398 |
+
?>
|
| 399 |
+
</tbody>
|
| 400 |
+
</table>
|
| 401 |
+
</div>
|
| 402 |
+
|
| 403 |
+
<?php } ?>
|
| 404 |
+
<?php
|
| 405 |
+
|
| 406 |
+
}
|
| 407 |
+
|
| 408 |
+
|
| 409 |
+
/**
|
| 410 |
+
* Commission Totals for vendors reports
|
| 411 |
+
*
|
| 412 |
+
* @since 1.8.4
|
| 413 |
+
*/
|
| 414 |
+
function commission_totals(){
|
| 415 |
+
|
| 416 |
+
global $wpdb;
|
| 417 |
+
|
| 418 |
+
$total_start_date = !empty( $_POST[ 'total_start_date' ] ) ? $_POST[ 'total_start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 419 |
+
$total_end_date = !empty( $_POST[ 'total_end_date' ] ) ? $_POST[ 'total_end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 420 |
+
$commission_status = !empty( $_POST[ 'commission_status' ] ) ? $_POST[ 'commission_status' ] : 'due';
|
| 421 |
+
$date_sql = ( !empty( $_POST[ 'total_start_date' ] ) && !empty( $_POST[ 'total_end_date' ] ) ) ? " time BETWEEN '$total_start_date 00:00:00' AND '$total_end_date 23:59:59' AND" : "";
|
| 422 |
+
|
| 423 |
+
$status_sql = " status='$commission_status'";
|
| 424 |
+
|
| 425 |
+
$sql = "SELECT vendor_id, total_due, total_shipping, tax, status FROM {$wpdb->prefix}pv_commission WHERE";
|
| 426 |
+
|
| 427 |
+
$commissions = $wpdb->get_results( $sql . $date_sql . $status_sql );
|
| 428 |
+
|
| 429 |
+
if ( !empty( $_POST[ 'total_start_date' ] ) ) {
|
| 430 |
+
$total_start_date = strtotime( $_POST[ 'total_start_date' ] );
|
| 431 |
+
}
|
| 432 |
+
|
| 433 |
+
if ( !empty( $_POST[ 'total_end_date' ] ) ) {
|
| 434 |
+
$total_end_date = strtotime( $_POST[ 'total_end_date' ] );
|
| 435 |
+
}
|
| 436 |
+
|
| 437 |
+
$totals = $this->calculate_totals( $commissions );
|
| 438 |
+
|
| 439 |
+
?><form method="post" action="">
|
| 440 |
+
<p><label for="from"><?php _e( 'From:', 'wcvendors' ); ?></label>
|
| 441 |
+
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_start_date ) ); ?>" name="total_start_date" class="range_datepicker from" id="from" />
|
| 442 |
+
<label for="to"><?php _e( 'To:', 'wcvendors' ); ?></label>
|
| 443 |
+
<input type="text" size="9" placeholder="yyyy-mm-dd" value="<?php echo esc_attr( date( 'Y-m-d', $total_end_date ) ); ?>" name="total_end_date" class="range_datepicker to" id="to" />
|
| 444 |
+
|
| 445 |
+
<select name="commission_status">
|
| 446 |
+
<option value="due"><?php _e( 'Due', 'wcvendors' ); ?></option>
|
| 447 |
+
<option value="paid"><?php _e( 'Paid', 'wcvendors' ); ?></option>
|
| 448 |
+
<option value="reversed"><?php _e( 'Reversed', 'wcvendors' ); ?></option>
|
| 449 |
+
</select>
|
| 450 |
+
|
| 451 |
+
<input type="submit" class="button" value="<?php _e( 'Show', 'wcvendors' ); ?>"/>
|
| 452 |
+
|
| 453 |
+
<?php do_action( 'wcvendors_after_commission_reports', $commissions ); ?>
|
| 454 |
+
</p>
|
| 455 |
+
</form>
|
| 456 |
+
|
| 457 |
+
<div class="woocommerce-reports-main">
|
| 458 |
+
<table class="widefat">
|
| 459 |
+
<thead>
|
| 460 |
+
<tr>
|
| 461 |
+
<th class="total_row"><?php _e( 'Vendor', 'wcvendors' ); ?></th>
|
| 462 |
+
<th class="total_row"><?php _e( 'Tax Total', 'wcvendors' ); ?></th>
|
| 463 |
+
<th class="total_row"><?php _e( 'Shipping Total', 'wcvendors' ); ?></th>
|
| 464 |
+
<th class="total_row"><?php _e( 'Status', 'wcvendors' ); ?></th>
|
| 465 |
+
<th class="total_row"><?php _e( 'Commission Total', 'wcvendors' ); ?></th>
|
| 466 |
+
</tr>
|
| 467 |
+
</thead>
|
| 468 |
+
<tbody>
|
| 469 |
+
<?php
|
| 470 |
+
|
| 471 |
+
if ( !empty( $commissions ) ){
|
| 472 |
+
|
| 473 |
+
foreach ( $totals as $totals ) {
|
| 474 |
+
|
| 475 |
+
echo '<tr>';
|
| 476 |
+
echo '<td>' . $totals[ 'user_login' ]. '</td>';
|
| 477 |
+
echo '<td>' . wc_price( $totals[ 'tax' ] ). '</td>';
|
| 478 |
+
echo '<td>' . wc_price( $totals[ 'total_shipping' ] ). '</td>';
|
| 479 |
+
echo '<td>' . $totals[ 'status' ] . '</td>';
|
| 480 |
+
echo '<td>' . wc_price( $totals[ 'total_due' ] ). '</td>';
|
| 481 |
+
echo '</tr>';
|
| 482 |
+
|
| 483 |
+
}
|
| 484 |
+
|
| 485 |
+
} else {
|
| 486 |
+
echo '<tr>';
|
| 487 |
+
echo '<td colspan="5">'. __( 'No commissions found.', 'wcvendors' ) . '</td>';
|
| 488 |
+
echo '</tr>';
|
| 489 |
+
|
| 490 |
+
}
|
| 491 |
+
?>
|
| 492 |
+
</tbody>
|
| 493 |
+
</table>
|
| 494 |
+
|
| 495 |
+
<?php
|
| 496 |
+
|
| 497 |
+
|
| 498 |
+
} // commission_totals()
|
| 499 |
+
|
| 500 |
+
/**
|
| 501 |
+
* Calculate the totals of the commissions return an array with vendor id as the key with the totals
|
| 502 |
+
*
|
| 503 |
+
* @param array $commissions total commissions array
|
| 504 |
+
* @return array $totals calculated totals
|
| 505 |
+
*/
|
| 506 |
+
function calculate_totals( $commissions ){
|
| 507 |
+
|
| 508 |
+
$totals = array();
|
| 509 |
+
|
| 510 |
+
$vendors = get_users( array( 'role' => 'vendor', 'fields' => array( 'ID', 'user_login' ) ) );
|
| 511 |
+
$vendor_names = wp_list_pluck( $vendors, 'user_login', 'ID' );
|
| 512 |
+
|
| 513 |
+
foreach ($commissions as $commission ) {
|
| 514 |
+
|
| 515 |
+
if ( array_key_exists( $commission->vendor_id, $totals ) ){
|
| 516 |
+
|
| 517 |
+
$totals[ $commission->vendor_id ][ 'total_due' ] += $commission->total_due + $commission->tax + $commission->total_shipping;
|
| 518 |
+
$totals[ $commission->vendor_id ][ 'tax' ] += $commission->tax;
|
| 519 |
+
$totals[ $commission->vendor_id ][ 'total_shipping' ] += $commission->total_shipping;
|
| 520 |
+
|
| 521 |
+
} else {
|
| 522 |
+
|
| 523 |
+
if ( array_key_exists( $commission->vendor_id, $vendor_names) ){
|
| 524 |
+
|
| 525 |
+
$temp_array = array(
|
| 526 |
+
'user_login' => $vendor_names[ $commission->vendor_id ],
|
| 527 |
+
'total_due' => $commission->total_due,
|
| 528 |
+
'tax' => $commission->tax,
|
| 529 |
+
'total_shipping' => $commission->total_shipping,
|
| 530 |
+
'status' => $commission->status,
|
| 531 |
+
);
|
| 532 |
+
|
| 533 |
+
$totals[ $commission->vendor_id ] = $temp_array ;
|
| 534 |
+
|
| 535 |
+
}
|
| 536 |
+
|
| 537 |
+
}
|
| 538 |
+
|
| 539 |
+
}
|
| 540 |
+
|
| 541 |
+
usort( $totals, function( $a, $b ) {
|
| 542 |
+
return strcmp( strtolower( $a[ 'user_login' ] ), strtolower( $b[ 'user_login' ] ) );
|
| 543 |
+
});
|
| 544 |
+
|
| 545 |
+
return $totals;
|
| 546 |
+
|
| 547 |
+
} // calculate_totals()
|
| 548 |
+
|
| 549 |
+
}
|
trunk/classes/admin/class-admin-users.php
ADDED
|
@@ -0,0 +1,478 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* WP-Admin users page
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package WC_Vendors
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Admin_Users
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Constructor
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
if ( !is_admin() ) return;
|
| 21 |
+
|
| 22 |
+
add_action( 'edit_user_profile', array( $this, 'show_extra_profile_fields' ) );
|
| 23 |
+
add_action( 'edit_user_profile_update', array( $this, 'save_extra_profile_fields' ) );
|
| 24 |
+
|
| 25 |
+
add_filter( 'add_menu_classes', array( $this, 'show_pending_number' ) );
|
| 26 |
+
|
| 27 |
+
// Disabling non-vendor related items on the admin screens
|
| 28 |
+
if ( WCV_Vendors::is_vendor( get_current_user_id() ) ) {
|
| 29 |
+
add_filter( 'woocommerce_csv_product_role', array( $this, 'csv_import_suite_compatibility' ) );
|
| 30 |
+
add_filter( 'woocommerce_csv_product_export_args', array( $this, 'csv_import_suite_compatibility_export' ) );
|
| 31 |
+
|
| 32 |
+
// Admin page lockdown
|
| 33 |
+
remove_action( 'admin_init', 'woocommerce_prevent_admin_access' );
|
| 34 |
+
add_action( 'admin_init', array( $this, 'prevent_admin_access' ) );
|
| 35 |
+
|
| 36 |
+
add_filter( 'woocommerce_prevent_admin_access', array( $this, 'deny_admin_access' ) );
|
| 37 |
+
|
| 38 |
+
// WC > Product page fixes
|
| 39 |
+
add_action( 'load-post-new.php', array( $this, 'confirm_access_to_add' ) );
|
| 40 |
+
add_action( 'load-edit.php', array( $this, 'edit_nonvendors' ) );
|
| 41 |
+
add_filter( 'views_edit-product', array( $this, 'hide_nonvendor_links' ) );
|
| 42 |
+
|
| 43 |
+
// Filter user attachments so they only see their own attachements
|
| 44 |
+
add_action( 'ajax_query_attachments_args', array( $this, 'show_user_attachment_ajax' ) );
|
| 45 |
+
add_filter( 'parse_query', array( $this, 'show_user_attachment_page' ) );
|
| 46 |
+
|
| 47 |
+
add_action( 'admin_menu', array( $this, 'remove_menu_page' ), 99 );
|
| 48 |
+
add_action( 'add_meta_boxes', array( $this, 'remove_meta_boxes' ), 99 );
|
| 49 |
+
add_filter( 'product_type_selector', array( $this, 'filter_product_types' ), 99 );
|
| 50 |
+
add_filter( 'product_type_options', array( $this, 'filter_product_type_options' ), 99 );
|
| 51 |
+
add_filter( 'woocommerce_product_data_tabs', array( $this, 'filter_product_data_tabs' ), 99, 2 );
|
| 52 |
+
|
| 53 |
+
add_filter( 'woocommerce_duplicate_product_capability', array( $this, 'add_duplicate_capability' ) );
|
| 54 |
+
|
| 55 |
+
// WC > Product featured
|
| 56 |
+
$product_misc = (array) WC_Vendors::$pv_options->get_option( 'hide_product_misc' );
|
| 57 |
+
|
| 58 |
+
if ( isset( $product_misc['featured'] ) ) {
|
| 59 |
+
add_filter( 'manage_product_posts_columns', array($this, 'manage_product_columns'), 99);
|
| 60 |
+
}
|
| 61 |
+
// WC > Product Hide duplicate
|
| 62 |
+
if ( isset( $product_misc['duplicate'] ) ) {
|
| 63 |
+
add_filter( 'post_row_actions', array( $this, 'remove_dupe_link' ), 99, 2 );
|
| 64 |
+
}
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
public function confirm_access_to_add()
|
| 70 |
+
{
|
| 71 |
+
if ( empty( $_GET['post_type'] ) || $_GET['post_type'] != 'product' ) {
|
| 72 |
+
return;
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
$can_submit = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
|
| 76 |
+
if ( !$can_submit ) {
|
| 77 |
+
wp_die( 'You are not allowed to submit products.' );
|
| 78 |
+
}
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
public function csv_import_suite_compatibility( $capability )
|
| 82 |
+
{
|
| 83 |
+
return 'manage_product';
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
public function csv_import_suite_compatibility_export( $args )
|
| 87 |
+
{
|
| 88 |
+
$args[ 'author' ] = get_current_user_id();
|
| 89 |
+
|
| 90 |
+
return $args;
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
public function add_duplicate_capability( $capability )
|
| 94 |
+
{
|
| 95 |
+
return 'manage_product';
|
| 96 |
+
}
|
| 97 |
+
|
| 98 |
+
|
| 99 |
+
/**
|
| 100 |
+
*
|
| 101 |
+
*
|
| 102 |
+
* @param unknown $menu
|
| 103 |
+
*
|
| 104 |
+
* @return unknown
|
| 105 |
+
*/
|
| 106 |
+
public function show_pending_number( $menu )
|
| 107 |
+
{
|
| 108 |
+
|
| 109 |
+
$args = array(
|
| 110 |
+
'post_type' => 'product',
|
| 111 |
+
'author' => get_current_user_id(),
|
| 112 |
+
'post_status' => 'pending'
|
| 113 |
+
);
|
| 114 |
+
|
| 115 |
+
if (!WCV_Vendors::is_vendor( get_current_user_id() ) ) unset( $args['author'] );
|
| 116 |
+
|
| 117 |
+
$pending_posts = get_posts( $args );
|
| 118 |
+
|
| 119 |
+
$pending_count = is_array( $pending_posts ) ? count( $pending_posts ) : 0;
|
| 120 |
+
|
| 121 |
+
$menu_str = 'edit.php?post_type=product';
|
| 122 |
+
|
| 123 |
+
foreach ( $menu as $menu_key => $menu_data ) {
|
| 124 |
+
|
| 125 |
+
if ( $menu_str != $menu_data[ 2 ] ) continue;
|
| 126 |
+
|
| 127 |
+
if ($pending_count > 0 ) {
|
| 128 |
+
$menu[ $menu_key ][ 0 ] .= " <span class='update-plugins counting-$pending_count'><span class='plugin-count'>" . number_format_i18n( $pending_count ) . '</span></span>';
|
| 129 |
+
}
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
return $menu;
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
/**
|
| 136 |
+
*
|
| 137 |
+
*
|
| 138 |
+
* @param unknown $types
|
| 139 |
+
* @param unknown $product_type
|
| 140 |
+
*
|
| 141 |
+
* @return unknown
|
| 142 |
+
*/
|
| 143 |
+
function filter_product_types( $types )
|
| 144 |
+
{
|
| 145 |
+
|
| 146 |
+
$product_types = (array) WC_Vendors::$pv_options->get_option( 'hide_product_types' );
|
| 147 |
+
$product_misc = (array) WC_Vendors::$pv_options->get_option( 'hide_product_misc' );
|
| 148 |
+
$css = WC_Vendors::$pv_options->get_option( 'product_page_css' );
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
if ( !empty( $product_misc[ 'taxes' ] ) ) {
|
| 152 |
+
$css .= '.form-field._tax_status_field, .form-field._tax_class_field{display:none !important;}';
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
unset( $product_misc[ 'taxes' ] );
|
| 156 |
+
|
| 157 |
+
foreach ( $product_misc as $key => $value ) {
|
| 158 |
+
if ( $value ) $css .= sprintf( '._%s_field{display:none !important;}', $key );
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
echo '<style>';
|
| 162 |
+
echo $css;
|
| 163 |
+
echo '</style>';
|
| 164 |
+
|
| 165 |
+
foreach ( $types as $key => $value ) {
|
| 166 |
+
if ( !empty( $product_types[ $key ] ) ) {
|
| 167 |
+
unset( $types[ $key ] );
|
| 168 |
+
}
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
return $types;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
/**
|
| 175 |
+
* Filter the product meta tabs in wp-admin
|
| 176 |
+
* @since 1.9.0
|
| 177 |
+
*/
|
| 178 |
+
function filter_product_data_tabs( $tabs ){
|
| 179 |
+
|
| 180 |
+
$product_panel = (array) WC_Vendors::$pv_options->get_option( 'hide_product_panel' );
|
| 181 |
+
|
| 182 |
+
if ( !$product_panel ) return $tabs;
|
| 183 |
+
|
| 184 |
+
foreach ( $tabs as $key => $value ){
|
| 185 |
+
if ( !empty( $product_panel[ $key ] ) ) {
|
| 186 |
+
unset( $tabs[ $key ] );
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
return $tabs;
|
| 192 |
+
|
| 193 |
+
} // filter_product_data_tabs()
|
| 194 |
+
|
| 195 |
+
|
| 196 |
+
/**
|
| 197 |
+
*
|
| 198 |
+
*
|
| 199 |
+
* @param unknown $types
|
| 200 |
+
*
|
| 201 |
+
* @return unknown
|
| 202 |
+
*/
|
| 203 |
+
function filter_product_type_options( $types )
|
| 204 |
+
{
|
| 205 |
+
$product_options = WC_Vendors::$pv_options->get_option( 'hide_product_type_options' );
|
| 206 |
+
|
| 207 |
+
if ( !$product_options ) return $types;
|
| 208 |
+
|
| 209 |
+
foreach ( $types as $key => $value ) {
|
| 210 |
+
if ( !empty( $product_options[ $key ] ) ) {
|
| 211 |
+
unset( $types[ $key ] );
|
| 212 |
+
}
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
return $types;
|
| 216 |
+
}
|
| 217 |
+
|
| 218 |
+
|
| 219 |
+
/**
|
| 220 |
+
* Show attachments only belonging to vendor
|
| 221 |
+
*
|
| 222 |
+
* @param object $query
|
| 223 |
+
*/
|
| 224 |
+
function show_user_attachment_ajax ( $query ) {
|
| 225 |
+
|
| 226 |
+
$user_id = get_current_user_id();
|
| 227 |
+
if ( $user_id ) {
|
| 228 |
+
$query['author'] = $user_id;
|
| 229 |
+
}
|
| 230 |
+
return $query;
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
/**
|
| 234 |
+
* Show attachments only belonging to vendor
|
| 235 |
+
*
|
| 236 |
+
* @param object $query
|
| 237 |
+
*/
|
| 238 |
+
function show_user_attachment_page ( $query ) {
|
| 239 |
+
|
| 240 |
+
global $current_user, $pagenow;
|
| 241 |
+
|
| 242 |
+
if ( !is_a( $current_user, 'WP_User') )
|
| 243 |
+
return;
|
| 244 |
+
|
| 245 |
+
if ( 'upload.php' != $pagenow && 'media-upload.php' != $pagenow)
|
| 246 |
+
return;
|
| 247 |
+
|
| 248 |
+
if ( !current_user_can('delete_pages') )
|
| 249 |
+
$query->set('author', $current_user->ID );
|
| 250 |
+
|
| 251 |
+
return;
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
/**
|
| 255 |
+
* Allow vendors to access admin when disabled
|
| 256 |
+
*/
|
| 257 |
+
public function prevent_admin_access()
|
| 258 |
+
{
|
| 259 |
+
$permitted_user = ( current_user_can( 'edit_posts' ) || current_user_can( 'manage_woocommerce' ) || current_user_can( 'vendor' ) );
|
| 260 |
+
|
| 261 |
+
if ( get_option( 'woocommerce_lock_down_admin' ) == 'yes' && !is_ajax() && !$permitted_user ) {
|
| 262 |
+
wp_safe_redirect( get_permalink( woocommerce_get_page_id( 'myaccount' ) ) );
|
| 263 |
+
exit;
|
| 264 |
+
}
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
public function deny_admin_access()
|
| 268 |
+
{
|
| 269 |
+
return false;
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
/**
|
| 274 |
+
* Request when load-edit.php
|
| 275 |
+
*/
|
| 276 |
+
public function edit_nonvendors()
|
| 277 |
+
{
|
| 278 |
+
add_action( 'request', array( $this, 'hide_nonvendor_products' ) );
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
|
| 282 |
+
/**
|
| 283 |
+
* Hide links that don't matter anymore from vendors
|
| 284 |
+
*
|
| 285 |
+
* @param array $views
|
| 286 |
+
*
|
| 287 |
+
* @return array
|
| 288 |
+
*/
|
| 289 |
+
public function hide_nonvendor_links( $views )
|
| 290 |
+
{
|
| 291 |
+
return array();
|
| 292 |
+
}
|
| 293 |
+
|
| 294 |
+
|
| 295 |
+
/**
|
| 296 |
+
* Hide products that don't belong to the vendor
|
| 297 |
+
*
|
| 298 |
+
* @param array $query_vars
|
| 299 |
+
*
|
| 300 |
+
* @return array
|
| 301 |
+
*/
|
| 302 |
+
public function hide_nonvendor_products( $query_vars )
|
| 303 |
+
{
|
| 304 |
+
if (array_key_exists('post_type', $query_vars) && ($query_vars['post_type'] == 'product')) {
|
| 305 |
+
$query_vars[ 'author' ] = get_current_user_id();
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
return $query_vars;
|
| 309 |
+
}
|
| 310 |
+
|
| 311 |
+
|
| 312 |
+
/**
|
| 313 |
+
* Remove the media library menu
|
| 314 |
+
*/
|
| 315 |
+
public function remove_menu_page()
|
| 316 |
+
{
|
| 317 |
+
global $pagenow, $woocommerce;
|
| 318 |
+
|
| 319 |
+
remove_menu_page( 'index.php' ); /* Hides Dashboard menu */
|
| 320 |
+
remove_menu_page( 'separator1' ); /* Hides separator under Dashboard menu*/
|
| 321 |
+
remove_all_actions( 'admin_notices' );
|
| 322 |
+
|
| 323 |
+
if ( $pagenow == 'index.php' ) {
|
| 324 |
+
wp_redirect( admin_url( 'profile.php' ) );
|
| 325 |
+
}
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
|
| 329 |
+
/**
|
| 330 |
+
*
|
| 331 |
+
*/
|
| 332 |
+
public function remove_meta_boxes()
|
| 333 |
+
{
|
| 334 |
+
remove_meta_box( 'postcustom', 'product', 'normal' );
|
| 335 |
+
remove_meta_box( 'wpseo_meta', 'product', 'normal' );
|
| 336 |
+
remove_meta_box( 'expirationdatediv', 'product', 'side' );
|
| 337 |
+
}
|
| 338 |
+
|
| 339 |
+
|
| 340 |
+
/**
|
| 341 |
+
* Update the vendor PayPal email
|
| 342 |
+
*
|
| 343 |
+
* @param int $vendor_id
|
| 344 |
+
*
|
| 345 |
+
* @return bool
|
| 346 |
+
*/
|
| 347 |
+
public function save_extra_profile_fields( $vendor_id )
|
| 348 |
+
{
|
| 349 |
+
if ( !current_user_can( 'edit_user', $vendor_id ) ) return false;
|
| 350 |
+
|
| 351 |
+
if ( ! WCV_Vendors::is_pending( $vendor_id ) && ! WCV_Vendors::is_vendor( $vendor_id ) ) { return; }
|
| 352 |
+
|
| 353 |
+
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
|
| 354 |
+
if ( empty( $users ) || $users[ 0 ]->ID == $vendor_id ) {
|
| 355 |
+
update_user_meta( $vendor_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
|
| 356 |
+
update_user_meta( $vendor_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
|
| 357 |
+
}
|
| 358 |
+
|
| 359 |
+
update_user_meta( $vendor_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 360 |
+
update_user_meta( $vendor_id, 'pv_shop_html_enabled', isset( $_POST[ 'pv_shop_html_enabled' ] ) );
|
| 361 |
+
update_user_meta( $vendor_id, 'pv_custom_commission_rate', $_POST[ 'pv_custom_commission_rate' ] );
|
| 362 |
+
update_user_meta( $vendor_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
|
| 363 |
+
update_user_meta( $vendor_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
|
| 364 |
+
update_user_meta( $vendor_id, 'wcv_give_vendor_tax', isset( $_POST[ 'wcv_give_vendor_tax' ] ) );
|
| 365 |
+
update_user_meta( $vendor_id, 'wcv_give_vendor_shipping', isset( $_POST[ 'wcv_give_vendor_shipping' ] ) );
|
| 366 |
+
|
| 367 |
+
do_action( 'wcvendors_update_admin_user', $vendor_id );
|
| 368 |
+
}
|
| 369 |
+
|
| 370 |
+
|
| 371 |
+
/**
|
| 372 |
+
* Show the PayPal field and commision due table
|
| 373 |
+
*
|
| 374 |
+
* @param unknown $user
|
| 375 |
+
*/
|
| 376 |
+
public function show_extra_profile_fields( $user )
|
| 377 |
+
{
|
| 378 |
+
|
| 379 |
+
if ( ! WCV_Vendors::is_vendor( $user->ID ) && ! WCV_Vendors::is_pending( $user->ID ) ) {
|
| 380 |
+
return;
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
?>
|
| 384 |
+
<h3><?php _e( 'WC Vendors', 'wcvendors' ); ?></h3>
|
| 385 |
+
<table class="form-table">
|
| 386 |
+
<tbody>
|
| 387 |
+
<?php do_action( 'wcvendors_admin_before_shop_html', $user ); ?>
|
| 388 |
+
<tr>
|
| 389 |
+
<th scope="row">Shop HTML</th>
|
| 390 |
+
<td>
|
| 391 |
+
<label for="pv_shop_html_enabled">
|
| 392 |
+
<input name="pv_shop_html_enabled" type="checkbox"
|
| 393 |
+
id="pv_shop_html_enabled" <?php checked( true, get_user_meta( $user->ID, 'pv_shop_html_enabled', true ), $echo = true ) ?>/>
|
| 394 |
+
<?php _e( 'Enable HTML for the shop description', 'wcvendors' ); ?>
|
| 395 |
+
</label>
|
| 396 |
+
</td>
|
| 397 |
+
</tr>
|
| 398 |
+
<?php do_action( 'wcvendors_admin_after_shop_html', $user ); ?>
|
| 399 |
+
<tr>
|
| 400 |
+
<th><label for="pv_shop_name"><?php _e( 'Shop name', 'wcvendors' ); ?></label></th>
|
| 401 |
+
<td><input type="text" name="pv_shop_name" id="pv_shop_name"
|
| 402 |
+
value="<?php echo get_user_meta( $user->ID, 'pv_shop_name', true ); ?>" class="regular-text">
|
| 403 |
+
</td>
|
| 404 |
+
</tr>
|
| 405 |
+
<?php do_action( 'wcvendors_admin_after_shop_name', $user ); ?>
|
| 406 |
+
<tr>
|
| 407 |
+
<th><label for="pv_paypal"><?php _e( 'PayPal E-mail', 'wcvendors' ); ?> <span
|
| 408 |
+
class="description">(<?php _e( 'required', 'wcvendors' ); ?>)</span></label></th>
|
| 409 |
+
<td><input type="email" name="pv_paypal" id="pv_paypal"
|
| 410 |
+
value="<?php echo get_user_meta( $user->ID, 'pv_paypal', true ); ?>" class="regular-text">
|
| 411 |
+
</td>
|
| 412 |
+
</tr>
|
| 413 |
+
<?php do_action( 'wcvendors_admin_after_paypal', $user ); ?>
|
| 414 |
+
<tr>
|
| 415 |
+
<th><label for="pv_custom_commission_rate"><?php _e( 'Commission rate', 'wcvendors' ); ?> (%)</label></th>
|
| 416 |
+
<td><input type="number" step="0.01" max="100" min="0" name="pv_custom_commission_rate" placeholder="<?php _e( 'Leave blank for default', 'wcvendors' ); ?>" id="pv_custom_commission_rate"
|
| 417 |
+
value="<?php echo get_user_meta( $user->ID, 'pv_custom_commission_rate', true ); ?>" class="regular-text">
|
| 418 |
+
</td>
|
| 419 |
+
</tr>
|
| 420 |
+
<?php do_action( 'wcvendors_admin_after_commission_due', $user ); ?>
|
| 421 |
+
<tr>
|
| 422 |
+
<th><label for="wcv_give_vendor_tax"><?php _e( 'Give Tax', 'wcvendors' ); ?> (%)</label></th>
|
| 423 |
+
<td>
|
| 424 |
+
<label for="wcv_give_vendor_tax">
|
| 425 |
+
<input name="wcv_give_vendor_tax" type="checkbox"
|
| 426 |
+
id="wcv_give_vendor_tax" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_tax', true ), $echo = true ) ?>/>
|
| 427 |
+
<?php _e( 'Tax override for vendor', 'wcvendors' ); ?>
|
| 428 |
+
</label>
|
| 429 |
+
</td>
|
| 430 |
+
</tr>
|
| 431 |
+
<?php do_action( 'wcvendors_admin_after_give_tax', $user ); ?>
|
| 432 |
+
<tr>
|
| 433 |
+
<th><label for="wcv_give_vendor_shipping"><?php _e( 'Give Shipping', 'wcvendors' ); ?> (%)</label></th>
|
| 434 |
+
<td>
|
| 435 |
+
<label for="wcv_give_vendor_shipping">
|
| 436 |
+
<input name="wcv_give_vendor_shipping" type="checkbox"
|
| 437 |
+
id="wcv_give_vendor_shipping" <?php checked( true, get_user_meta( $user->ID, 'wcv_give_vendor_shipping', true ), $echo = true ) ?>/>
|
| 438 |
+
<?php _e( 'Shipping override for vendor', 'wcvendors' ); ?>
|
| 439 |
+
</label>
|
| 440 |
+
</td>
|
| 441 |
+
</tr>
|
| 442 |
+
<?php do_action( 'wcvendors_admin_after_give_shipping', $user ); ?>
|
| 443 |
+
<tr>
|
| 444 |
+
<th><label for="pv_seller_info"><?php _e( 'Seller info', 'wcvendors' ); ?></label></th>
|
| 445 |
+
<td><?php wp_editor( get_user_meta( $user->ID, 'pv_seller_info', true ), 'pv_seller_info' ); ?></td>
|
| 446 |
+
</tr>
|
| 447 |
+
<?php do_action( 'wcvendors_admin_after_seller_info', $user ); ?>
|
| 448 |
+
<tr>
|
| 449 |
+
<th><label for="pv_shop_description"><?php _e( 'Shop description', 'wcvendors' ); ?></label>
|
| 450 |
+
</th>
|
| 451 |
+
<td><?php wp_editor( get_user_meta( $user->ID, 'pv_shop_description', true ), 'pv_shop_description' ); ?></td>
|
| 452 |
+
</tr>
|
| 453 |
+
<?php do_action( 'wcvendors_admin_after_shop_description', $user ); ?>
|
| 454 |
+
</tbody>
|
| 455 |
+
</table>
|
| 456 |
+
<?php
|
| 457 |
+
}
|
| 458 |
+
|
| 459 |
+
/*
|
| 460 |
+
Remove featured check box from the product listing
|
| 461 |
+
*/
|
| 462 |
+
public function manage_product_columns( $columns ){
|
| 463 |
+
global $woocommerce;
|
| 464 |
+
unset($columns['featured']);
|
| 465 |
+
return $columns;
|
| 466 |
+
}
|
| 467 |
+
|
| 468 |
+
|
| 469 |
+
/**
|
| 470 |
+
* Hide the duplicate product link by removing it from the row actions
|
| 471 |
+
*/
|
| 472 |
+
public function remove_dupe_link( $actions, $post ) {
|
| 473 |
+
unset($actions['duplicate']);
|
| 474 |
+
return $actions;
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
|
| 478 |
+
}
|
trunk/classes/admin/class-product-meta.php
ADDED
|
@@ -0,0 +1,267 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Product meta configurations
|
| 5 |
+
*
|
| 6 |
+
* @package ProductVendor
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
|
| 10 |
+
class WCV_Product_Meta
|
| 11 |
+
{
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* Constructor
|
| 16 |
+
*/
|
| 17 |
+
function __construct()
|
| 18 |
+
{
|
| 19 |
+
if ( !current_user_can( 'manage_woocommerce' ) ) return;
|
| 20 |
+
|
| 21 |
+
// Allow products to have authors
|
| 22 |
+
add_post_type_support( 'product', 'author' );
|
| 23 |
+
|
| 24 |
+
add_action( 'add_meta_boxes', array( $this, 'change_author_meta_box_title' ) );
|
| 25 |
+
add_action( 'wp_dropdown_users', array( $this, 'author_vendor_roles' ), 0, 1 );
|
| 26 |
+
if ( apply_filters( 'wcv_product_commission_tab', true ) ) {
|
| 27 |
+
add_action( 'woocommerce_product_write_panel_tabs', array( $this, 'add_tab' ) );
|
| 28 |
+
add_action( 'woocommerce_product_data_panels', array( $this, 'add_panel' ) );
|
| 29 |
+
add_action( 'woocommerce_process_product_meta', array( $this, 'save_panel' ) );
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
add_action( 'woocommerce_product_quick_edit_end', array($this, 'display_vendor_dd_quick_edit') );
|
| 33 |
+
add_action( 'woocommerce_product_quick_edit_save', array($this, 'save_vendor_quick_edit'), 2, 99 );
|
| 34 |
+
add_action( 'manage_product_posts_custom_column', array($this, 'display_vendor_column'), 2, 99 );
|
| 35 |
+
add_filter( 'manage_product_posts_columns', array($this, 'vendor_column_quickedit') );
|
| 36 |
+
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
/**
|
| 41 |
+
* Change the "Author" metabox to "Vendor"
|
| 42 |
+
*/
|
| 43 |
+
public function change_author_meta_box_title()
|
| 44 |
+
{
|
| 45 |
+
global $wp_meta_boxes;
|
| 46 |
+
$wp_meta_boxes[ 'product' ][ 'normal' ][ 'core' ][ 'authordiv' ][ 'title' ] = __( 'Vendor', 'wcvendors' );;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Override the authors selectbox with +vendor roles
|
| 52 |
+
*
|
| 53 |
+
* @param html $output
|
| 54 |
+
*
|
| 55 |
+
* @return html
|
| 56 |
+
*/
|
| 57 |
+
public function author_vendor_roles( $output )
|
| 58 |
+
{
|
| 59 |
+
global $post;
|
| 60 |
+
|
| 61 |
+
if ( empty( $post ) ) return $output;
|
| 62 |
+
|
| 63 |
+
// Return if this isn't a WooCommerce product post type
|
| 64 |
+
if ( $post->post_type != 'product' ) return $output;
|
| 65 |
+
|
| 66 |
+
// Return if this isn't the vendor author override dropdown
|
| 67 |
+
if ( !strpos( $output, 'post_author_override' ) ) return $output;
|
| 68 |
+
|
| 69 |
+
$args = array(
|
| 70 |
+
'selected' => $post->post_author,
|
| 71 |
+
'id' => 'post_author_override',
|
| 72 |
+
);
|
| 73 |
+
|
| 74 |
+
$output = $this->vendor_selectbox( $args );
|
| 75 |
+
|
| 76 |
+
return $output;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* Create a selectbox to display vendor & administrator roles
|
| 82 |
+
*
|
| 83 |
+
* @param array $args
|
| 84 |
+
*
|
| 85 |
+
* @return html
|
| 86 |
+
*/
|
| 87 |
+
public function vendor_selectbox( $args )
|
| 88 |
+
{
|
| 89 |
+
$default_args = array(
|
| 90 |
+
'placeholder',
|
| 91 |
+
'id',
|
| 92 |
+
'class',
|
| 93 |
+
);
|
| 94 |
+
|
| 95 |
+
foreach ( $default_args as $key ) {
|
| 96 |
+
if ( !is_array( $key ) && empty( $args[ $key ] ) ) $args[ $key ] = '';
|
| 97 |
+
else if ( is_array( $key ) ) foreach ( $key as $val ) $args[ $key ][ $val ] = esc_attr( $args[ $key ][ $val ] );
|
| 98 |
+
}
|
| 99 |
+
extract( $args );
|
| 100 |
+
|
| 101 |
+
$roles = array( 'vendor', 'administrator' );
|
| 102 |
+
$user_args = array( 'fields' => array( 'ID', 'user_login' ) );
|
| 103 |
+
|
| 104 |
+
$output = "<select style='width:200px;' name='$id' id='$id' class='$class' data-placeholder='$placeholder'>\n";
|
| 105 |
+
$output .= "\t<option value=''></option>\n";
|
| 106 |
+
|
| 107 |
+
foreach ( $roles as $role ) {
|
| 108 |
+
|
| 109 |
+
$new_args = $user_args;
|
| 110 |
+
$new_args[ 'role' ] = $role;
|
| 111 |
+
$users = get_users( $new_args );
|
| 112 |
+
|
| 113 |
+
if ( empty( $users ) ) continue;
|
| 114 |
+
foreach ( (array) $users as $user ) {
|
| 115 |
+
$select = selected( $user->ID, $selected, false );
|
| 116 |
+
$output .= "\t<option value='$user->ID' $select>$user->user_login</option>\n";
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
}
|
| 120 |
+
$output .= "</select>";
|
| 121 |
+
|
| 122 |
+
// Convert this selectbox with select2
|
| 123 |
+
$output .= '
|
| 124 |
+
<script type="text/javascript">jQuery(function() { jQuery("#' . $id . '").select2().focus(); } );</script>';
|
| 125 |
+
|
| 126 |
+
return $output;
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
|
| 130 |
+
/**
|
| 131 |
+
* Save commission rate of a product
|
| 132 |
+
*
|
| 133 |
+
* @param int $post_id
|
| 134 |
+
*/
|
| 135 |
+
public function save_panel( $post_id )
|
| 136 |
+
{
|
| 137 |
+
if ( isset( $_POST[ 'pv_commission_rate' ] ) ) {
|
| 138 |
+
update_post_meta( $post_id, 'pv_commission_rate', is_numeric( $_POST[ 'pv_commission_rate' ] ) ? (float) $_POST[ 'pv_commission_rate' ] : false );
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
|
| 144 |
+
/**
|
| 145 |
+
* Add the Commission tab to a product
|
| 146 |
+
*/
|
| 147 |
+
public function add_tab()
|
| 148 |
+
{
|
| 149 |
+
?>
|
| 150 |
+
<li class="commission_tab">
|
| 151 |
+
<a href="#commission"><?php _e( 'Commission', 'wcvendors' ) ?></a>
|
| 152 |
+
</li> <?php
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
|
| 156 |
+
/**
|
| 157 |
+
* Add the Commission panel to a product
|
| 158 |
+
*/
|
| 159 |
+
public function add_panel()
|
| 160 |
+
{
|
| 161 |
+
global $post; ?>
|
| 162 |
+
|
| 163 |
+
<div id="commission" class="panel woocommerce_options_panel">
|
| 164 |
+
<fieldset>
|
| 165 |
+
|
| 166 |
+
<p class='form-field commission_rate_field'>
|
| 167 |
+
<label for='pv_commission_rate'><?php _e( 'Commission', 'wcvendors' ); ?> (%)</label>
|
| 168 |
+
<input type='number' id='pv_commission_rate'
|
| 169 |
+
name='pv_commission_rate'
|
| 170 |
+
class='short'
|
| 171 |
+
max="100"
|
| 172 |
+
min="0"
|
| 173 |
+
step='any'
|
| 174 |
+
placeholder='<?php _e( 'Leave blank for default', 'wcvendors' ); ?>'
|
| 175 |
+
value="<?php echo get_post_meta( $post->ID, 'pv_commission_rate', true ); ?>"/>
|
| 176 |
+
</p>
|
| 177 |
+
|
| 178 |
+
</fieldset>
|
| 179 |
+
</div> <?php
|
| 180 |
+
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
/*
|
| 184 |
+
* Rename the Authors column to Vendor on products page
|
| 185 |
+
*/
|
| 186 |
+
public function vendor_column_quickedit($posts_columns) {
|
| 187 |
+
$posts_columns['author'] = __( 'Vendor', 'wcvendors' );
|
| 188 |
+
|
| 189 |
+
return $posts_columns;
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
/*
|
| 193 |
+
* Display the vendor drop down on the quick edit screen
|
| 194 |
+
*/
|
| 195 |
+
public function display_vendor_dd_quick_edit() {
|
| 196 |
+
|
| 197 |
+
global $post;
|
| 198 |
+
$selected = $post->post_author;
|
| 199 |
+
|
| 200 |
+
$roles = array( 'vendor', 'administrator' );
|
| 201 |
+
$user_args = array( 'fields' => array( 'ID', 'display_name' ) );
|
| 202 |
+
|
| 203 |
+
$output = "<select style='width:200px;' name='post_author-new' class='select'>\n";
|
| 204 |
+
|
| 205 |
+
foreach ( $roles as $role ) {
|
| 206 |
+
|
| 207 |
+
$new_args = $user_args;
|
| 208 |
+
$new_args[ 'role' ] = $role;
|
| 209 |
+
$users = get_users( $new_args );
|
| 210 |
+
|
| 211 |
+
if ( empty( $users ) ) continue;
|
| 212 |
+
foreach ( (array) $users as $user ) {
|
| 213 |
+
$select = selected( $user->ID, $selected, false );
|
| 214 |
+
$output .= "\t<option value='$user->ID' $select>$user->display_name</option>\n";
|
| 215 |
+
}
|
| 216 |
+
|
| 217 |
+
}
|
| 218 |
+
$output .= "</select>";
|
| 219 |
+
|
| 220 |
+
?>
|
| 221 |
+
<br class="clear" />
|
| 222 |
+
<label class="inline-edit-author-new">
|
| 223 |
+
<span class="title"><?php _e('Vendor', 'wcvendors' ); ?></span>
|
| 224 |
+
<?php echo $output; ?>
|
| 225 |
+
</label>
|
| 226 |
+
<?php
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
|
| 230 |
+
/*
|
| 231 |
+
* Save the vendor on the quick edit screen
|
| 232 |
+
*/
|
| 233 |
+
public function save_vendor_quick_edit( $product ) {
|
| 234 |
+
|
| 235 |
+
if ( $product->is_type('simple') || $product->is_type('external') ) {
|
| 236 |
+
if ( isset( $_REQUEST['_vendor'] ) ) {
|
| 237 |
+
$vendor = wc_clean($_REQUEST['_vendor']);
|
| 238 |
+
$product->post->post_author = $vendor;
|
| 239 |
+
}
|
| 240 |
+
}
|
| 241 |
+
return $product;
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
/*
|
| 245 |
+
* Display hidden column data for js
|
| 246 |
+
*/
|
| 247 |
+
public function display_vendor_column( $column, $post_id ){
|
| 248 |
+
|
| 249 |
+
$vendor = get_post_field( 'post_author', $post_id );
|
| 250 |
+
|
| 251 |
+
switch ( $column ) {
|
| 252 |
+
case 'name' :
|
| 253 |
+
|
| 254 |
+
?>
|
| 255 |
+
<div class="hidden vendor" id="vendor_<?php echo $post_id; ?>">
|
| 256 |
+
<div id="post_author"><?php echo $vendor; ?></div>
|
| 257 |
+
</div>
|
| 258 |
+
<?php
|
| 259 |
+
|
| 260 |
+
break;
|
| 261 |
+
|
| 262 |
+
default :
|
| 263 |
+
break;
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
}
|
| 267 |
+
}
|
trunk/classes/admin/class-vendor-admin-dashboard.php
ADDED
|
@@ -0,0 +1,691 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* WC Vendor Admin Dashboard - Vendor WP-Admin Dashboard Pages
|
| 4 |
+
*
|
| 5 |
+
* @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
|
| 6 |
+
* @package WCVendors
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
Class WCV_Vendor_Admin_Dashboard {
|
| 10 |
+
|
| 11 |
+
public $dashboard_error_msg;
|
| 12 |
+
|
| 13 |
+
function __construct(){
|
| 14 |
+
// Add Shop Settings page
|
| 15 |
+
add_action( 'admin_menu', array( $this, 'vendor_dashboard_pages') );
|
| 16 |
+
// Hook into init for form processing
|
| 17 |
+
add_action( 'admin_init', array( $this, 'save_shop_settings' ) );
|
| 18 |
+
add_action( 'admin_head', array( $this, 'admin_enqueue_order_style') );
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
function vendor_dashboard_pages(){
|
| 22 |
+
add_menu_page( __('Shop Settings', 'wcvendors'), __('Shop Settings', 'wcvendors'), 'manage_product', 'wcv-vendor-shopsettings', array( $this, 'settings_page' ) );
|
| 23 |
+
$hook = add_menu_page( __( 'Orders', 'wcvendors' ), __( 'Orders', 'wcvendors' ), 'manage_product', 'wcv-vendor-orders', array( 'WCV_Vendor_Admin_Dashboard', 'orders_page' ) );
|
| 24 |
+
add_action( "load-$hook", array( 'WCV_Vendor_Admin_Dashboard', 'add_options' ) );
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
function settings_page() {
|
| 28 |
+
$user_id = get_current_user_id();
|
| 29 |
+
$paypal_address = true;
|
| 30 |
+
$shop_description = true;
|
| 31 |
+
$description = get_user_meta( $user_id, 'pv_shop_description', true );
|
| 32 |
+
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 33 |
+
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 34 |
+
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 35 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 36 |
+
include('views/html-vendor-settings-page.php');
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
function admin_enqueue_order_style() {
|
| 40 |
+
|
| 41 |
+
$screen = get_current_screen();
|
| 42 |
+
$screen_id = $screen->id;
|
| 43 |
+
|
| 44 |
+
if ( 'wcv-vendor-orders' === $screen_id ){
|
| 45 |
+
|
| 46 |
+
add_thickbox();
|
| 47 |
+
wp_enqueue_style( 'admin_order_styles', wcv_assets_url . 'css/admin-orders.css' );
|
| 48 |
+
}
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Save shop settings
|
| 53 |
+
*/
|
| 54 |
+
public function save_shop_settings()
|
| 55 |
+
{
|
| 56 |
+
$user_id = get_current_user_id();
|
| 57 |
+
$error = false;
|
| 58 |
+
$error_msg = '';
|
| 59 |
+
|
| 60 |
+
if (isset ( $_POST[ 'wc-vendors-nonce' ] ) ) {
|
| 61 |
+
|
| 62 |
+
if ( !wp_verify_nonce( $_POST[ 'wc-vendors-nonce' ], 'save-shop-settings-admin' ) ) {
|
| 63 |
+
return false;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
if ( !is_email( $_POST[ 'pv_paypal' ] ) ) {
|
| 67 |
+
$error_msg .= __( 'Your PayPal address is not a valid email address.', 'wcvendors' );
|
| 68 |
+
$error = true;
|
| 69 |
+
} else {
|
| 70 |
+
update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
if ( !empty( $_POST[ 'pv_shop_name' ] ) ) {
|
| 74 |
+
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
|
| 75 |
+
if ( !empty( $users ) && $users[ 0 ]->ID != $user_id ) {
|
| 76 |
+
$error_msg .= __( 'That shop name is already taken. Your shop name must be unique.', 'wcvendors' );
|
| 77 |
+
$error = true;
|
| 78 |
+
} else {
|
| 79 |
+
update_user_meta( $user_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
|
| 80 |
+
update_user_meta( $user_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
|
| 81 |
+
}
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
if ( isset( $_POST[ 'pv_shop_description' ] ) ) {
|
| 85 |
+
update_user_meta( $user_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
if ( isset( $_POST[ 'pv_seller_info' ] ) ) {
|
| 89 |
+
update_user_meta( $user_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
do_action( 'wcvendors_shop_settings_admin_saved', $user_id );
|
| 93 |
+
|
| 94 |
+
if ( ! $error ) {
|
| 95 |
+
add_action( 'admin_notices', array( $this, 'add_admin_notice_success' ) );
|
| 96 |
+
} else {
|
| 97 |
+
$this->dashboard_error_msg = $error_msg;
|
| 98 |
+
add_action( 'admin_notices', array( $this, 'add_admin_notice_error' ) );
|
| 99 |
+
}
|
| 100 |
+
}
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
/**
|
| 104 |
+
* Output a sucessful message after saving the shop settings
|
| 105 |
+
*
|
| 106 |
+
* @since 1.9.9
|
| 107 |
+
* @access public
|
| 108 |
+
*/
|
| 109 |
+
public function add_admin_notice_success( ){
|
| 110 |
+
|
| 111 |
+
echo '<div class="updated"><p>';
|
| 112 |
+
echo __( 'Settings saved.', 'wcvendors' );
|
| 113 |
+
echo '</p></div>';
|
| 114 |
+
|
| 115 |
+
} // add_admin_notice_success()
|
| 116 |
+
|
| 117 |
+
/**
|
| 118 |
+
* Output an error message
|
| 119 |
+
*
|
| 120 |
+
* @since 1.9.9
|
| 121 |
+
* @access public
|
| 122 |
+
*/
|
| 123 |
+
public function add_admin_notice_error( ){
|
| 124 |
+
|
| 125 |
+
echo '<div class="error"><p>';
|
| 126 |
+
echo $this->dashboard_error_msg;
|
| 127 |
+
echo '</p></div>';
|
| 128 |
+
|
| 129 |
+
} // add_admin_notice_error()
|
| 130 |
+
|
| 131 |
+
/**
|
| 132 |
+
*
|
| 133 |
+
*
|
| 134 |
+
* @param unknown $status
|
| 135 |
+
* @param unknown $option
|
| 136 |
+
* @param unknown $value
|
| 137 |
+
*
|
| 138 |
+
* @return unknown
|
| 139 |
+
*/
|
| 140 |
+
public static function set_table_option( $status, $option, $value )
|
| 141 |
+
{
|
| 142 |
+
if ( $option == 'orders_per_page' ) {
|
| 143 |
+
return $value;
|
| 144 |
+
}
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
|
| 148 |
+
/**
|
| 149 |
+
*
|
| 150 |
+
*/
|
| 151 |
+
public static function add_options()
|
| 152 |
+
{
|
| 153 |
+
global $WCV_Vendor_Order_Page;
|
| 154 |
+
|
| 155 |
+
$args = array(
|
| 156 |
+
'label' => 'Rows',
|
| 157 |
+
'default' => 10,
|
| 158 |
+
'option' => 'orders_per_page'
|
| 159 |
+
);
|
| 160 |
+
add_screen_option( 'per_page', $args );
|
| 161 |
+
|
| 162 |
+
$WCV_Vendor_Order_Page = new WCV_Vendor_Order_Page();
|
| 163 |
+
|
| 164 |
+
}
|
| 165 |
+
|
| 166 |
+
|
| 167 |
+
/**
|
| 168 |
+
* HTML setup for the Orders Page
|
| 169 |
+
*/
|
| 170 |
+
public static function orders_page()
|
| 171 |
+
{
|
| 172 |
+
global $woocommerce, $WCV_Vendor_Order_Page;
|
| 173 |
+
|
| 174 |
+
$WCV_Vendor_Order_Page->prepare_items();
|
| 175 |
+
|
| 176 |
+
?>
|
| 177 |
+
<div class="wrap">
|
| 178 |
+
|
| 179 |
+
<div id="icon-woocommerce" class="icon32 icon32-woocommerce-reports"><br/></div>
|
| 180 |
+
<h2><?php _e( 'Orders', 'wcvendors' ); ?></h2>
|
| 181 |
+
|
| 182 |
+
<form id="posts-filter" method="get">
|
| 183 |
+
|
| 184 |
+
<input type="hidden" name="page" value="wcv-vendor-orders"/>
|
| 185 |
+
<?php $WCV_Vendor_Order_Page->display() ?>
|
| 186 |
+
|
| 187 |
+
</form>
|
| 188 |
+
<div id="ajax-response"></div>
|
| 189 |
+
<br class="clear"/>
|
| 190 |
+
</div>
|
| 191 |
+
|
| 192 |
+
<?php }
|
| 193 |
+
|
| 194 |
+
} // End WCV_Vendor_Admin_Dashboard
|
| 195 |
+
|
| 196 |
+
if ( !class_exists( 'WP_List_Table' ) ) require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php';
|
| 197 |
+
|
| 198 |
+
/**
|
| 199 |
+
* WCV Vendor Order Page
|
| 200 |
+
*
|
| 201 |
+
* @author Jamie Madden <http://wcvendors.com / https://github.com/digitalchild>
|
| 202 |
+
* @package WCVendors
|
| 203 |
+
* @extends WP_List_Table
|
| 204 |
+
*/
|
| 205 |
+
class WCV_Vendor_Order_Page extends WP_List_Table
|
| 206 |
+
{
|
| 207 |
+
|
| 208 |
+
public $index;
|
| 209 |
+
|
| 210 |
+
/**
|
| 211 |
+
* can_view_comments
|
| 212 |
+
*
|
| 213 |
+
* @since 1.0.0
|
| 214 |
+
* @access public
|
| 215 |
+
* @var string $can_view_comments permission check for view comments
|
| 216 |
+
*/
|
| 217 |
+
public $can_view_comments;
|
| 218 |
+
|
| 219 |
+
|
| 220 |
+
/**
|
| 221 |
+
* can_add_comments
|
| 222 |
+
*
|
| 223 |
+
* @since 1.0.0
|
| 224 |
+
* @access public
|
| 225 |
+
* @var string $can_add_comments permission check for add comments
|
| 226 |
+
*/
|
| 227 |
+
public $can_add_comments;
|
| 228 |
+
|
| 229 |
+
|
| 230 |
+
/**
|
| 231 |
+
* __construct function.
|
| 232 |
+
*
|
| 233 |
+
* @access public
|
| 234 |
+
*/
|
| 235 |
+
function __construct()
|
| 236 |
+
{
|
| 237 |
+
global $status, $page;
|
| 238 |
+
|
| 239 |
+
$this->index = 0;
|
| 240 |
+
|
| 241 |
+
//Set parent defaults
|
| 242 |
+
parent::__construct( array(
|
| 243 |
+
'singular' => __( 'order', 'wcvendors' ),
|
| 244 |
+
'plural' => __( 'orders', 'wcvendors' ),
|
| 245 |
+
'ajax' => false
|
| 246 |
+
) );
|
| 247 |
+
|
| 248 |
+
$this->can_view_comments = WC_Vendors::$pv_options->get_option( 'can_view_order_comments' );
|
| 249 |
+
$this->can_add_comments = WC_Vendors::$pv_options->get_option( 'can_submit_order_comments' );
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
|
| 253 |
+
/**
|
| 254 |
+
* column_default function.
|
| 255 |
+
*
|
| 256 |
+
* @access public
|
| 257 |
+
*
|
| 258 |
+
* @param unknown $item
|
| 259 |
+
* @param mixed $column_name
|
| 260 |
+
*
|
| 261 |
+
* @return unknown
|
| 262 |
+
*/
|
| 263 |
+
function column_default( $item, $column_name )
|
| 264 |
+
{
|
| 265 |
+
global $wpdb;
|
| 266 |
+
|
| 267 |
+
switch ( $column_name ) {
|
| 268 |
+
case 'order_id' :
|
| 269 |
+
return $item->order_id;
|
| 270 |
+
case 'customer' :
|
| 271 |
+
return $item->customer;
|
| 272 |
+
case 'products' :
|
| 273 |
+
return $item->products;
|
| 274 |
+
case 'total' :
|
| 275 |
+
return $item->total;
|
| 276 |
+
// case 'comments' :
|
| 277 |
+
// return $item->comments;
|
| 278 |
+
case 'date' :
|
| 279 |
+
return $item->date;
|
| 280 |
+
case 'status' :
|
| 281 |
+
return $item->status;
|
| 282 |
+
default:
|
| 283 |
+
return apply_filters( 'wcvendors_vendor_order_page_column_default', '', $item, $column_name );
|
| 284 |
+
}
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
+
|
| 288 |
+
/**
|
| 289 |
+
* column_cb function.
|
| 290 |
+
*
|
| 291 |
+
* @access public
|
| 292 |
+
*
|
| 293 |
+
* @param mixed $item
|
| 294 |
+
*
|
| 295 |
+
* @return unknown
|
| 296 |
+
*/
|
| 297 |
+
function column_cb( $item )
|
| 298 |
+
{
|
| 299 |
+
return sprintf(
|
| 300 |
+
'<input type="checkbox" name="%1$s[]" value="%2$s" />',
|
| 301 |
+
/*$1%s*/
|
| 302 |
+
'order_id',
|
| 303 |
+
/*$2%s*/
|
| 304 |
+
$item->order_id
|
| 305 |
+
);
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
|
| 309 |
+
/**
|
| 310 |
+
* get_columns function.
|
| 311 |
+
*
|
| 312 |
+
* @access public
|
| 313 |
+
* @return unknown
|
| 314 |
+
*/
|
| 315 |
+
function get_columns()
|
| 316 |
+
{
|
| 317 |
+
$columns = array(
|
| 318 |
+
'cb' => '<input type="checkbox" />',
|
| 319 |
+
'order_id' => __( 'Order ID', 'wcvendors' ),
|
| 320 |
+
'customer' => __( 'Customer', 'wcvendors' ),
|
| 321 |
+
'products' => __( 'Products', 'wcvendors' ),
|
| 322 |
+
'total' => __( 'Total', 'wcvendors' ),
|
| 323 |
+
// 'comments' => __( 'Comments to Customer', 'wcvendors' ),
|
| 324 |
+
'date' => __( 'Date', 'wcvendors' ),
|
| 325 |
+
'status' => __( 'Shipped', 'wcvendors' ),
|
| 326 |
+
);
|
| 327 |
+
|
| 328 |
+
if ( !$this->can_view_comments ) unset( $columns['comments'] );
|
| 329 |
+
|
| 330 |
+
return apply_filters( 'wcvendors_vendor_order_page_get_columns', $columns );
|
| 331 |
+
|
| 332 |
+
}
|
| 333 |
+
|
| 334 |
+
|
| 335 |
+
/**
|
| 336 |
+
* get_sortable_columns function.
|
| 337 |
+
*
|
| 338 |
+
* @access public
|
| 339 |
+
* @return unknown
|
| 340 |
+
*/
|
| 341 |
+
function get_sortable_columns()
|
| 342 |
+
{
|
| 343 |
+
$sortable_columns = array(
|
| 344 |
+
'order_id' => array( 'order_id', false ),
|
| 345 |
+
'total' => array( 'total', false ),
|
| 346 |
+
'status' => array( 'status', false ),
|
| 347 |
+
);
|
| 348 |
+
|
| 349 |
+
return $sortable_columns;
|
| 350 |
+
}
|
| 351 |
+
|
| 352 |
+
|
| 353 |
+
/**
|
| 354 |
+
* Get bulk actions
|
| 355 |
+
*
|
| 356 |
+
* @return unknown
|
| 357 |
+
*/
|
| 358 |
+
function get_bulk_actions()
|
| 359 |
+
{
|
| 360 |
+
$actions = array(
|
| 361 |
+
'mark_shipped' => apply_filters( 'wcvendors_mark_shipped_label', __( 'Mark shipped', 'wcvendors' ) ),
|
| 362 |
+
);
|
| 363 |
+
|
| 364 |
+
return $actions;
|
| 365 |
+
}
|
| 366 |
+
|
| 367 |
+
|
| 368 |
+
/**
|
| 369 |
+
* Process bulk actions
|
| 370 |
+
*
|
| 371 |
+
* @return unknown
|
| 372 |
+
*/
|
| 373 |
+
function process_bulk_action()
|
| 374 |
+
{
|
| 375 |
+
if ( !isset( $_GET[ 'order_id' ] ) ) return;
|
| 376 |
+
|
| 377 |
+
if (is_array( $_GET[ 'order_id' ] ) ) {
|
| 378 |
+
|
| 379 |
+
$items = array_map( 'intval', $_GET[ 'order_id' ] );
|
| 380 |
+
switch ( $this->current_action() ) {
|
| 381 |
+
case 'mark_shipped':
|
| 382 |
+
|
| 383 |
+
$result = $this->mark_shipped( $items );
|
| 384 |
+
|
| 385 |
+
if ( $result )
|
| 386 |
+
echo '<div class="updated"><p>' . __( 'Orders marked shipped.', 'wcvendors' ) . '</p></div>';
|
| 387 |
+
break;
|
| 388 |
+
|
| 389 |
+
default:
|
| 390 |
+
// code...
|
| 391 |
+
break;
|
| 392 |
+
}
|
| 393 |
+
|
| 394 |
+
} else {
|
| 395 |
+
|
| 396 |
+
if ( !isset( $_GET[ 'action' ] ) ) return;
|
| 397 |
+
}
|
| 398 |
+
|
| 399 |
+
|
| 400 |
+
}
|
| 401 |
+
|
| 402 |
+
|
| 403 |
+
/**
|
| 404 |
+
* Mark orders as shipped
|
| 405 |
+
*
|
| 406 |
+
* @param unknown $ids (optional)
|
| 407 |
+
*
|
| 408 |
+
* @return unknown
|
| 409 |
+
*/
|
| 410 |
+
public function mark_shipped( $ids = array() )
|
| 411 |
+
{
|
| 412 |
+
global $woocommerce;
|
| 413 |
+
|
| 414 |
+
$user_id = get_current_user_id();
|
| 415 |
+
|
| 416 |
+
if ( !empty( $ids ) ) {
|
| 417 |
+
foreach ($ids as $order_id ) {
|
| 418 |
+
$order = wc_get_order( $order_id );
|
| 419 |
+
$vendors = WCV_Vendors::get_vendors_from_order( $order );
|
| 420 |
+
$vendor_ids = array_keys( $vendors );
|
| 421 |
+
if ( !in_array( $user_id, $vendor_ids ) ) {
|
| 422 |
+
wp_die( __( 'You are not allowed to modify this order.', 'wcvendors' ) );
|
| 423 |
+
}
|
| 424 |
+
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 425 |
+
if( !in_array($user_id, $shippers)) {
|
| 426 |
+
$shippers[] = $user_id;
|
| 427 |
+
$mails = $woocommerce->mailer()->get_emails();
|
| 428 |
+
if ( !empty( $mails ) ) {
|
| 429 |
+
$mails[ 'WC_Email_Notify_Shipped' ]->trigger( $order_id, $user_id );
|
| 430 |
+
}
|
| 431 |
+
do_action('wcvendors_vendor_ship', $order_id, $user_id);
|
| 432 |
+
}
|
| 433 |
+
update_post_meta( $order_id, 'wc_pv_shipped', $shippers );
|
| 434 |
+
}
|
| 435 |
+
return true;
|
| 436 |
+
}
|
| 437 |
+
return false;
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
|
| 441 |
+
|
| 442 |
+
/**
|
| 443 |
+
* Get Orders to display in admin
|
| 444 |
+
*
|
| 445 |
+
* @return $orders
|
| 446 |
+
*/
|
| 447 |
+
function get_orders() {
|
| 448 |
+
|
| 449 |
+
$user_id = get_current_user_id();
|
| 450 |
+
|
| 451 |
+
$orders = array();
|
| 452 |
+
|
| 453 |
+
$vendor_products = $this->get_vendor_products( $user_id );
|
| 454 |
+
|
| 455 |
+
$products = array();
|
| 456 |
+
|
| 457 |
+
foreach ( $vendor_products as $_product ) {
|
| 458 |
+
|
| 459 |
+
$products[] = $_product->ID;
|
| 460 |
+
}
|
| 461 |
+
|
| 462 |
+
$_orders = $this->get_orders_for_vendor_products( $products );
|
| 463 |
+
|
| 464 |
+
$model_id = 0;
|
| 465 |
+
|
| 466 |
+
if ( !empty( $_orders ) ) {
|
| 467 |
+
|
| 468 |
+
foreach ( $_orders as $order ) {
|
| 469 |
+
|
| 470 |
+
$order = new WC_Order( $order->order_id );
|
| 471 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 472 |
+
$valid_items = WCV_Queries::get_products_for_order( $order_id );
|
| 473 |
+
$valid = array();
|
| 474 |
+
|
| 475 |
+
$items = $order->get_items();
|
| 476 |
+
|
| 477 |
+
foreach ( $items as $order_item_id => $item) {
|
| 478 |
+
if ( in_array( $item[ 'variation_id' ], $valid_items) || in_array( $item[ 'product_id' ], $valid_items ) ) {
|
| 479 |
+
$valid[ $order_item_id ] = $item;
|
| 480 |
+
}
|
| 481 |
+
}
|
| 482 |
+
|
| 483 |
+
$products = '';
|
| 484 |
+
|
| 485 |
+
foreach ( $valid as $order_item_id => $item ) {
|
| 486 |
+
|
| 487 |
+
$wc_product = new WC_Product( $item['product_id'] );
|
| 488 |
+
|
| 489 |
+
$products .= '<strong>'. $item['qty'] . ' x ' . $item['name'] . '</strong><br />';
|
| 490 |
+
|
| 491 |
+
if ( version_compare( WC_VERSION, '2.7', '<' ) ) {
|
| 492 |
+
$metadata = $order->has_meta( $order_item_id );
|
| 493 |
+
} else {
|
| 494 |
+
$_item = $order->get_item( $order_item_id );
|
| 495 |
+
$meta_data = $_item->get_meta_data();
|
| 496 |
+
}
|
| 497 |
+
|
| 498 |
+
if ( !empty( $metadata ) ) {
|
| 499 |
+
|
| 500 |
+
$products .= '<table cellspacing="0" class="wcv_display_meta">';
|
| 501 |
+
|
| 502 |
+
foreach ( $metadata as $meta ) {
|
| 503 |
+
|
| 504 |
+
// Skip hidden core fields
|
| 505 |
+
if ( in_array( $meta['meta_key'], apply_filters( 'woocommerce_hidden_order_itemmeta', array(
|
| 506 |
+
'_qty',
|
| 507 |
+
'_tax_class',
|
| 508 |
+
'_product_id',
|
| 509 |
+
'_variation_id',
|
| 510 |
+
'_line_subtotal',
|
| 511 |
+
'_line_subtotal_tax',
|
| 512 |
+
'_line_total',
|
| 513 |
+
'_line_tax',
|
| 514 |
+
'_vendor_order_item_id',
|
| 515 |
+
'_vendor_commission',
|
| 516 |
+
WC_Vendors::$pv_options->get_option( 'sold_by_label' ),
|
| 517 |
+
) ) ) ) {
|
| 518 |
+
continue;
|
| 519 |
+
}
|
| 520 |
+
|
| 521 |
+
// Skip serialised meta
|
| 522 |
+
if ( is_serialized( $meta['meta_value'] ) ) {
|
| 523 |
+
continue;
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
// Get attribute data
|
| 527 |
+
if ( taxonomy_exists( wc_sanitize_taxonomy_name( $meta['meta_key'] ) ) ) {
|
| 528 |
+
$term = get_term_by( 'slug', $meta['meta_value'], wc_sanitize_taxonomy_name( $meta['meta_key'] ) );
|
| 529 |
+
$meta['meta_key'] = wc_attribute_label( wc_sanitize_taxonomy_name( $meta['meta_key'] ) );
|
| 530 |
+
$meta['meta_value'] = isset( $term->name ) ? $term->name : $meta['meta_value'];
|
| 531 |
+
} else {
|
| 532 |
+
$meta['meta_key'] = apply_filters( 'woocommerce_attribute_label', wc_attribute_label( $meta['meta_key'], $wc_product ), $meta['meta_key'] );
|
| 533 |
+
}
|
| 534 |
+
|
| 535 |
+
$products .= '<tr><th>' . wp_kses_post( rawurldecode( $meta['meta_key'] ) ) . ':</th><td>' . rawurldecode( $meta['meta_value'] ) . '</td></tr>';
|
| 536 |
+
}
|
| 537 |
+
$products .= '</table>';
|
| 538 |
+
}
|
| 539 |
+
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 543 |
+
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 544 |
+
$shipped = in_array($user_id, $shippers) ? __( 'Yes', 'wcvendors' ) : __( 'No', 'wcvendors' ) ;
|
| 545 |
+
|
| 546 |
+
$sum = WCV_Queries::sum_for_orders( array( $order_id ), array('vendor_id' =>get_current_user_id() ), false );
|
| 547 |
+
$sum = reset( $sum );
|
| 548 |
+
|
| 549 |
+
WC_Vendors::log( $sum );
|
| 550 |
+
|
| 551 |
+
$total = $sum->line_total;
|
| 552 |
+
|
| 553 |
+
$comment_output = '';
|
| 554 |
+
|
| 555 |
+
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_date : $order->get_date_created();
|
| 556 |
+
|
| 557 |
+
$order_items = array();
|
| 558 |
+
$order_items[ 'order_id' ] = $order_id;
|
| 559 |
+
$order_items[ 'customer' ] = $order->get_formatted_shipping_address();
|
| 560 |
+
$order_items[ 'products' ] = $products;
|
| 561 |
+
$order_items[ 'total' ] = wc_price( $total );
|
| 562 |
+
$order_items[ 'date' ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 563 |
+
$order_items[ 'status' ] = $shipped;
|
| 564 |
+
|
| 565 |
+
$orders[] = (object) $order_items;
|
| 566 |
+
|
| 567 |
+
$model_id++;
|
| 568 |
+
}
|
| 569 |
+
}
|
| 570 |
+
return $orders;
|
| 571 |
+
|
| 572 |
+
}
|
| 573 |
+
|
| 574 |
+
|
| 575 |
+
/**
|
| 576 |
+
* Get the vendor products sold
|
| 577 |
+
*
|
| 578 |
+
* @param $user_id - the user_id to get the products of
|
| 579 |
+
*
|
| 580 |
+
* @return unknown
|
| 581 |
+
*/
|
| 582 |
+
public function get_vendor_products( $user_id )
|
| 583 |
+
{
|
| 584 |
+
global $wpdb;
|
| 585 |
+
|
| 586 |
+
$vendor_products = array();
|
| 587 |
+
$sql = '';
|
| 588 |
+
|
| 589 |
+
$sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} AND status != 'reversed' GROUP BY product_id";
|
| 590 |
+
|
| 591 |
+
$results = $wpdb->get_results( $sql );
|
| 592 |
+
|
| 593 |
+
foreach ( $results as $value ) {
|
| 594 |
+
$ids[ ] = $value->product_id;
|
| 595 |
+
}
|
| 596 |
+
|
| 597 |
+
if ( !empty( $ids ) ) {
|
| 598 |
+
$vendor_products = get_posts(
|
| 599 |
+
array(
|
| 600 |
+
'numberposts' => -1,
|
| 601 |
+
'orderby' => 'post_date',
|
| 602 |
+
'post_type' => array( 'product', 'product_variation' ),
|
| 603 |
+
'order' => 'DESC',
|
| 604 |
+
'include' => $ids
|
| 605 |
+
)
|
| 606 |
+
);
|
| 607 |
+
}
|
| 608 |
+
|
| 609 |
+
return $vendor_products;
|
| 610 |
+
}
|
| 611 |
+
|
| 612 |
+
|
| 613 |
+
/**
|
| 614 |
+
* All orders for a specific product
|
| 615 |
+
*
|
| 616 |
+
* @param array $product_ids
|
| 617 |
+
* @param array $args (optional)
|
| 618 |
+
*
|
| 619 |
+
* @return object
|
| 620 |
+
*/
|
| 621 |
+
public function get_orders_for_vendor_products( array $product_ids, array $args = array() )
|
| 622 |
+
{
|
| 623 |
+
global $wpdb;
|
| 624 |
+
|
| 625 |
+
if ( empty( $product_ids ) ) return false;
|
| 626 |
+
|
| 627 |
+
$defaults = array(
|
| 628 |
+
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 629 |
+
);
|
| 630 |
+
|
| 631 |
+
$args = wp_parse_args( $args, $defaults );
|
| 632 |
+
|
| 633 |
+
|
| 634 |
+
$sql = "
|
| 635 |
+
SELECT order_id
|
| 636 |
+
FROM {$wpdb->prefix}pv_commission as order_items
|
| 637 |
+
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 638 |
+
AND status != 'reversed'
|
| 639 |
+
";
|
| 640 |
+
|
| 641 |
+
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 642 |
+
$sql .= "
|
| 643 |
+
AND vendor_id = {$args['vendor_id']}
|
| 644 |
+
";
|
| 645 |
+
}
|
| 646 |
+
|
| 647 |
+
$sql .= "
|
| 648 |
+
GROUP BY order_id
|
| 649 |
+
ORDER BY time DESC
|
| 650 |
+
";
|
| 651 |
+
|
| 652 |
+
$orders = $wpdb->get_results( $sql );
|
| 653 |
+
|
| 654 |
+
return $orders;
|
| 655 |
+
}
|
| 656 |
+
|
| 657 |
+
|
| 658 |
+
|
| 659 |
+
/**
|
| 660 |
+
* prepare_items function.
|
| 661 |
+
*
|
| 662 |
+
* @access public
|
| 663 |
+
*/
|
| 664 |
+
function prepare_items()
|
| 665 |
+
{
|
| 666 |
+
|
| 667 |
+
|
| 668 |
+
/**
|
| 669 |
+
* Init column headers
|
| 670 |
+
*/
|
| 671 |
+
$this->_column_headers = $this->get_column_info();
|
| 672 |
+
|
| 673 |
+
|
| 674 |
+
/**
|
| 675 |
+
* Process bulk actions
|
| 676 |
+
*/
|
| 677 |
+
$this->process_bulk_action();
|
| 678 |
+
|
| 679 |
+
/**
|
| 680 |
+
* Get items
|
| 681 |
+
*/
|
| 682 |
+
|
| 683 |
+
$this->items = $this->get_orders();
|
| 684 |
+
|
| 685 |
+
/**
|
| 686 |
+
* Pagination
|
| 687 |
+
*/
|
| 688 |
+
}
|
| 689 |
+
|
| 690 |
+
|
| 691 |
+
}
|
trunk/classes/admin/class-vendor-applicants.php
ADDED
|
@@ -0,0 +1,103 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
*
|
| 5 |
+
*/
|
| 6 |
+
class WCV_Vendor_Applicants
|
| 7 |
+
{
|
| 8 |
+
|
| 9 |
+
function __construct()
|
| 10 |
+
{
|
| 11 |
+
add_filter( 'user_row_actions', array( $this, 'user_row_actions' ), 10, 2 );
|
| 12 |
+
add_filter( 'load-users.php', array( $this, 'user_row_actions_commit' ) );
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
*
|
| 17 |
+
*
|
| 18 |
+
* @param unknown $actions
|
| 19 |
+
* @param unknown $user_object
|
| 20 |
+
*
|
| 21 |
+
* @return unknown
|
| 22 |
+
*/
|
| 23 |
+
function user_row_actions( $actions, $user_object )
|
| 24 |
+
{
|
| 25 |
+
if ( !empty( $_GET[ 'role' ] ) && $_GET[ 'role' ] == 'pending_vendor' ) {
|
| 26 |
+
$actions[ 'approve_vendor' ] = "<a href='?role=pending_vendor&action=approve_vendor&user_id=" . $user_object->ID . "'>" . __( 'Approve', 'cgc_ub' ) . "</a>";
|
| 27 |
+
$actions[ 'deny_vendor' ] = "<a href='?role=pending_vendor&action=deny_vendor&user_id=" . $user_object->ID . "'>" . __( 'Deny', 'cgc_ub' ) . "</a>";
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
return $actions;
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
/**
|
| 35 |
+
*
|
| 36 |
+
*/
|
| 37 |
+
public function user_row_actions_commit()
|
| 38 |
+
{
|
| 39 |
+
if ( !empty( $_GET[ 'action' ] ) && !empty( $_GET[ 'user_id' ] ) ) {
|
| 40 |
+
|
| 41 |
+
$wp_user_object = new WP_User( (int) $_GET[ 'user_id' ] );
|
| 42 |
+
|
| 43 |
+
switch ( $_GET[ 'action' ] ) {
|
| 44 |
+
case 'approve_vendor':
|
| 45 |
+
$role = 'vendor';
|
| 46 |
+
add_action( 'admin_notices', array( $this, 'approved' ) );
|
| 47 |
+
do_action( 'wcvendors_approve_vendor', $wp_user_object );
|
| 48 |
+
break;
|
| 49 |
+
|
| 50 |
+
case 'deny_vendor':
|
| 51 |
+
$role = 'subscriber';
|
| 52 |
+
add_action( 'admin_notices', array( $this, 'denied' ) );
|
| 53 |
+
do_action( 'wcvendors_deny_vendor', $wp_user_object );
|
| 54 |
+
break;
|
| 55 |
+
|
| 56 |
+
default:
|
| 57 |
+
// code...
|
| 58 |
+
break;
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
$wp_user_object->set_role( $role );
|
| 62 |
+
|
| 63 |
+
}
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
|
| 67 |
+
/**
|
| 68 |
+
*
|
| 69 |
+
*/
|
| 70 |
+
public function denied()
|
| 71 |
+
{
|
| 72 |
+
echo '<div class="updated">';
|
| 73 |
+
echo '<p>' . __( 'Vendor has been <b>denied</b>.', 'wcvendors' ) . '</p>';
|
| 74 |
+
echo '</div>';
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
|
| 78 |
+
/**
|
| 79 |
+
*
|
| 80 |
+
*/
|
| 81 |
+
public function approved()
|
| 82 |
+
{
|
| 83 |
+
echo '<div class="updated">';
|
| 84 |
+
echo '<p>' . __( 'Vendor has been <b>approved</b>.', 'wcvendors' ) . '</p>';
|
| 85 |
+
echo '</div>';
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
|
| 89 |
+
/**
|
| 90 |
+
*
|
| 91 |
+
*
|
| 92 |
+
* @param unknown $values
|
| 93 |
+
*
|
| 94 |
+
* @return unknown
|
| 95 |
+
*/
|
| 96 |
+
public function show_pending_vendors_link( $values )
|
| 97 |
+
{
|
| 98 |
+
$values[ 'pending_vendors' ] = '<a href="?role=asd">' . __( 'Pending Vendors', 'wcvendors' ) . ' <span class="count">(3)</span></a>';
|
| 99 |
+
|
| 100 |
+
return $values;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
}
|
trunk/classes/admin/class-vendor-reports.php
ADDED
|
@@ -0,0 +1,121 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Report views
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Vendor_Reports
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Constructor
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
$this->vendor_id = !current_user_can( 'manage_woocommerce' ) ? wp_get_current_user()->ID : '';
|
| 21 |
+
if ( !empty ( $this->vendor_id ) ) {
|
| 22 |
+
add_filter( 'woocommerce_reports_charts', array( $this, 'filter_tabs' ), 99 );
|
| 23 |
+
add_filter( 'woocommerce_json_search_found_products', array( $this, 'filter_products_json' ) );
|
| 24 |
+
add_filter( 'woocommerce_reports_product_sales_order_items', array( $this, 'filter_products' ) );
|
| 25 |
+
add_filter( 'woocommerce_reports_top_sellers_order_items', array( $this, 'filter_products' ) );
|
| 26 |
+
add_filter( 'woocommerce_reports_top_earners_order_items', array( $this, 'filter_products' ) );
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
* Show only reports that are useful to a vendor
|
| 33 |
+
*
|
| 34 |
+
* @param array $tabs
|
| 35 |
+
*
|
| 36 |
+
* @return array
|
| 37 |
+
*/
|
| 38 |
+
public function filter_tabs( $tabs )
|
| 39 |
+
{
|
| 40 |
+
global $woocommerce;
|
| 41 |
+
|
| 42 |
+
$remove = array(
|
| 43 |
+
'woocommerce_sales_overview',
|
| 44 |
+
'woocommerce_daily_sales',
|
| 45 |
+
'woocommerce_monthly_sales',
|
| 46 |
+
'woocommerce_monthly_taxes',
|
| 47 |
+
'woocommerce_category_sales',
|
| 48 |
+
'woocommerce_coupon_sales',
|
| 49 |
+
);
|
| 50 |
+
|
| 51 |
+
$reports = $tabs[ 'orders' ][ 'reports' ];
|
| 52 |
+
|
| 53 |
+
foreach ( $reports as $key => $chart ) {
|
| 54 |
+
if ( $key == 'coupon_usage' ) {
|
| 55 |
+
unset( $tabs[ 'orders' ][ 'reports' ][ $key ] );
|
| 56 |
+
}
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
// These are admin tabs
|
| 60 |
+
$return = array(
|
| 61 |
+
'orders' => $tabs[ 'orders' ]
|
| 62 |
+
);
|
| 63 |
+
|
| 64 |
+
return $return;
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* Filter products based on current vendor
|
| 70 |
+
*
|
| 71 |
+
* @param unknown $orders
|
| 72 |
+
*
|
| 73 |
+
* @return unknown
|
| 74 |
+
*/
|
| 75 |
+
public function filter_products( $orders )
|
| 76 |
+
{
|
| 77 |
+
$products = WCV_Vendors::get_vendor_products( $this->vendor_id );
|
| 78 |
+
|
| 79 |
+
$ids = array();
|
| 80 |
+
foreach ( $products as $product ) {
|
| 81 |
+
$ids[ ] = ( $product->ID );
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
foreach ( $orders as $key => $order ) {
|
| 85 |
+
|
| 86 |
+
if ( !in_array( $order->product_id, $ids ) ) {
|
| 87 |
+
unset( $orders[ $key ] );
|
| 88 |
+
continue;
|
| 89 |
+
} else {
|
| 90 |
+
if ( !empty( $order->line_total ) ) {
|
| 91 |
+
$orders[ $key ]->line_total = WCV_Commission::calculate_commission( $order->line_total, $order->product_id, $order, $order->qty );
|
| 92 |
+
}
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
return $orders;
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
|
| 101 |
+
/**
|
| 102 |
+
*
|
| 103 |
+
*
|
| 104 |
+
* @param unknown $products
|
| 105 |
+
*
|
| 106 |
+
* @return unknown
|
| 107 |
+
*/
|
| 108 |
+
public function filter_products_json( $products )
|
| 109 |
+
{
|
| 110 |
+
$vendor_products = WCV_Vendors::get_vendor_products( $this->vendor_id );
|
| 111 |
+
|
| 112 |
+
$ids = array();
|
| 113 |
+
foreach ( $vendor_products as $vendor_product ) {
|
| 114 |
+
$ids[ $vendor_product->ID ] = $vendor_product->post_title;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
return array_intersect_key( $products, $ids );
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
}
|
trunk/classes/admin/emails/class-emails.php
ADDED
|
@@ -0,0 +1,151 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
*
|
| 7 |
+
*
|
| 8 |
+
* @author Matt Gates <http://mgates.me>
|
| 9 |
+
* @package
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
class WCV_Emails
|
| 14 |
+
{
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
*
|
| 19 |
+
*/
|
| 20 |
+
function __construct()
|
| 21 |
+
{
|
| 22 |
+
add_filter( 'woocommerce_email_classes', array( $this, 'check_items' ) );
|
| 23 |
+
add_filter( 'woocommerce_resend_order_emails_available', array( $this, 'order_action' ) );
|
| 24 |
+
add_filter( 'woocommerce_order_product_title', array( 'WCV_Emails', 'show_vendor_in_email' ), 10, 2 );
|
| 25 |
+
add_action( 'set_user_role', array( $this, 'application_status_email' ), 10, 2 );
|
| 26 |
+
add_action( 'transition_post_status', array( $this, 'trigger_new_product' ), 10, 3 );
|
| 27 |
+
|
| 28 |
+
add_filter( 'woocommerce_email_recipient_low_stock', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 29 |
+
add_filter( 'woocommerce_email_recipient_no_stock', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 30 |
+
add_filter( 'woocommerce_email_recipient_backorder', array( $this, 'vendor_stock_email'), 10, 2 );
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
public function trigger_new_product( $from, $to, $post )
|
| 34 |
+
{
|
| 35 |
+
global $woocommerce;
|
| 36 |
+
|
| 37 |
+
if ( $from != $to && $post->post_status == 'pending' && WCV_Vendors::is_vendor( $post->post_author ) && $post->post_type == 'product' ) {
|
| 38 |
+
$mails = $woocommerce->mailer()->get_emails();
|
| 39 |
+
if ( !empty( $mails ) ) {
|
| 40 |
+
$mails[ 'WC_Email_Notify_Admin' ]->trigger( $post->post_id, $post );
|
| 41 |
+
}
|
| 42 |
+
}
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
|
| 46 |
+
/**
|
| 47 |
+
*
|
| 48 |
+
*
|
| 49 |
+
* @param unknown $user_id
|
| 50 |
+
* @param unknown $role
|
| 51 |
+
*/
|
| 52 |
+
function application_status_email( $user_id, $role )
|
| 53 |
+
{
|
| 54 |
+
global $woocommerce;
|
| 55 |
+
|
| 56 |
+
if ( !empty( $_POST[ 'apply_for_vendor' ] ) || ( !empty( $_GET[ 'action' ] ) && ( $_GET[ 'action' ] == 'approve_vendor' || $_GET[ 'action' ] == 'deny_vendor' ) ) ) {
|
| 57 |
+
|
| 58 |
+
if ( $role == 'pending_vendor' ) {
|
| 59 |
+
$status = __( 'pending', 'wcvendors' );
|
| 60 |
+
} else if ( $role == 'vendor' ) {
|
| 61 |
+
$status = __( 'approved', 'wcvendors' );
|
| 62 |
+
} else if ( !empty( $_GET[ 'action' ] ) && $_GET[ 'action' ] == 'deny_vendor' ) {
|
| 63 |
+
$status = __( 'denied', 'wcvendors' );
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
$mails = $woocommerce->mailer()->get_emails();
|
| 67 |
+
|
| 68 |
+
if ( isset( $status ) && !empty( $mails ) ) {
|
| 69 |
+
$mails[ 'WC_Email_Approve_Vendor' ]->trigger( $user_id, $status );
|
| 70 |
+
}
|
| 71 |
+
}
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
/**
|
| 76 |
+
*
|
| 77 |
+
*
|
| 78 |
+
* @param unknown $name
|
| 79 |
+
* @param unknown $_product
|
| 80 |
+
*
|
| 81 |
+
* @return unknown
|
| 82 |
+
*/
|
| 83 |
+
function show_vendor_in_email( $name, $_product )
|
| 84 |
+
{
|
| 85 |
+
$product = get_post( $_product->get_id() );
|
| 86 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 87 |
+
$sold_by = WCV_Vendors::is_vendor( $product->post_author )
|
| 88 |
+
? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $product->post_author ), WCV_Vendors::get_vendor_sold_by( $product->post_author ) )
|
| 89 |
+
: get_bloginfo( 'name' );
|
| 90 |
+
|
| 91 |
+
$name .= '<small class="wcvendors_sold_by_in_email"><br />' . apply_filters('wcvendors_sold_by_in_email', $sold_by_label, $_product->get_id(), $product->post_author ). $sold_by . '</small><br />';
|
| 92 |
+
|
| 93 |
+
return $name;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
*
|
| 99 |
+
*
|
| 100 |
+
* @param unknown $available_emails
|
| 101 |
+
*
|
| 102 |
+
* @return unknown
|
| 103 |
+
*/
|
| 104 |
+
public function order_action( $available_emails )
|
| 105 |
+
{
|
| 106 |
+
$available_emails[ ] = 'vendor_new_order';
|
| 107 |
+
|
| 108 |
+
return $available_emails;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
/**
|
| 113 |
+
*
|
| 114 |
+
*
|
| 115 |
+
* @param unknown $emails
|
| 116 |
+
*
|
| 117 |
+
* @return unknown
|
| 118 |
+
*/
|
| 119 |
+
public function check_items( $emails )
|
| 120 |
+
{
|
| 121 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-admin.php';
|
| 122 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-vendor.php';
|
| 123 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-approve-vendor.php';
|
| 124 |
+
require_once wcv_plugin_dir . 'classes/admin/emails/class-wc-notify-shipped.php';
|
| 125 |
+
|
| 126 |
+
$emails[ 'WC_Email_Notify_Vendor' ] = new WC_Email_Notify_Vendor();
|
| 127 |
+
$emails[ 'WC_Email_Approve_Vendor' ] = new WC_Email_Approve_Vendor();
|
| 128 |
+
$emails[ 'WC_Email_Notify_Admin' ] = new WC_Email_Notify_Admin();
|
| 129 |
+
$emails[ 'WC_Email_Notify_Shipped' ] = new WC_Email_Notify_Shipped();
|
| 130 |
+
|
| 131 |
+
return $emails;
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
/**
|
| 135 |
+
* Add the vendor email to the low stock emails.
|
| 136 |
+
*
|
| 137 |
+
*/
|
| 138 |
+
public function vendor_stock_email( $emails, $product ) {
|
| 139 |
+
|
| 140 |
+
if ( WCV_Vendors::is_vendor( $product->post->post_author ) ) {
|
| 141 |
+
$vendor_data = get_userdata( $product->post->post_author );
|
| 142 |
+
$vendor_email = $vendor_data->user_email;
|
| 143 |
+
$emails .= ','.$vendor_email;
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
return $emails;
|
| 147 |
+
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
}
|
trunk/classes/admin/emails/class-wc-approve-vendor.php
ADDED
|
@@ -0,0 +1,165 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* New Order Email
|
| 7 |
+
*
|
| 8 |
+
* An email sent to the admin when a new order is received/paid for.
|
| 9 |
+
*
|
| 10 |
+
* @class WC_Email_Approve_Vendor
|
| 11 |
+
* @version 2.0.0
|
| 12 |
+
* @extends WC_Email
|
| 13 |
+
* @author WooThemes
|
| 14 |
+
* @package WooCommerce/Classes/Emails
|
| 15 |
+
*/
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
class WC_Email_Approve_Vendor extends WC_Email
|
| 19 |
+
{
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Constructor
|
| 24 |
+
*/
|
| 25 |
+
function __construct()
|
| 26 |
+
{
|
| 27 |
+
$this->id = 'vendor_application';
|
| 28 |
+
$this->title = __( 'Vendor Application', 'wcvendors' );
|
| 29 |
+
$this->description = __( 'Vendor application will either be approved, denied, or pending.', 'wcvendors' );
|
| 30 |
+
|
| 31 |
+
$this->heading = __( 'Application {status}', 'wcvendors' );
|
| 32 |
+
$this->subject = __( '[{blogname}] Your vendor application has been {status}', 'wcvendors' );
|
| 33 |
+
|
| 34 |
+
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 35 |
+
$this->template_html = 'application-status.php';
|
| 36 |
+
$this->template_plain = 'application-status.php';
|
| 37 |
+
|
| 38 |
+
// Call parent constuctor
|
| 39 |
+
parent::__construct();
|
| 40 |
+
|
| 41 |
+
// Other settings
|
| 42 |
+
$this->recipient = $this->get_option( 'recipient' );
|
| 43 |
+
|
| 44 |
+
if ( !$this->recipient )
|
| 45 |
+
$this->recipient = get_option( 'admin_email' );
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
/**
|
| 49 |
+
* trigger function.
|
| 50 |
+
*
|
| 51 |
+
* @access public
|
| 52 |
+
* @return void
|
| 53 |
+
*
|
| 54 |
+
* @param unknown $order_id
|
| 55 |
+
*/
|
| 56 |
+
function trigger( $user_id, $status )
|
| 57 |
+
{
|
| 58 |
+
if ( !$this->is_enabled() ) return;
|
| 59 |
+
|
| 60 |
+
$this->find[ ] = '{status}';
|
| 61 |
+
$this->replace[ ] = $status;
|
| 62 |
+
|
| 63 |
+
$this->status = $status;
|
| 64 |
+
|
| 65 |
+
$this->user = get_userdata( $user_id );
|
| 66 |
+
$user_email = $this->user->user_email;
|
| 67 |
+
|
| 68 |
+
$this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 69 |
+
|
| 70 |
+
if ( $status == __( 'pending', 'wcvendors' ) ) {
|
| 71 |
+
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
/**
|
| 76 |
+
* get_content_html function.
|
| 77 |
+
*
|
| 78 |
+
* @access public
|
| 79 |
+
* @return string
|
| 80 |
+
*/
|
| 81 |
+
function get_content_html()
|
| 82 |
+
{
|
| 83 |
+
ob_start();
|
| 84 |
+
wc_get_template( $this->template_html, array(
|
| 85 |
+
'status' => $this->status,
|
| 86 |
+
'user' => $this->user,
|
| 87 |
+
'email_heading' => $this->get_heading()
|
| 88 |
+
), 'woocommerce', $this->template_base );
|
| 89 |
+
|
| 90 |
+
return ob_get_clean();
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
|
| 94 |
+
/**
|
| 95 |
+
* get_content_plain function.
|
| 96 |
+
*
|
| 97 |
+
* @access public
|
| 98 |
+
* @return string
|
| 99 |
+
*/
|
| 100 |
+
function get_content_plain()
|
| 101 |
+
{
|
| 102 |
+
ob_start();
|
| 103 |
+
wc_get_template( $this->template_plain, array(
|
| 104 |
+
'status' => $this->status,
|
| 105 |
+
'user' => $this->user,
|
| 106 |
+
'email_heading' => $this->get_heading()
|
| 107 |
+
), 'woocommerce', $this->template_base );
|
| 108 |
+
|
| 109 |
+
return ob_get_clean();
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
/**
|
| 114 |
+
* Initialise Settings Form Fields
|
| 115 |
+
*
|
| 116 |
+
* @access public
|
| 117 |
+
* @return void
|
| 118 |
+
*/
|
| 119 |
+
function init_form_fields()
|
| 120 |
+
{
|
| 121 |
+
$this->form_fields = array(
|
| 122 |
+
'enabled' => array(
|
| 123 |
+
'title' => __( 'Enable/Disable', 'wcvendors' ),
|
| 124 |
+
'type' => 'checkbox',
|
| 125 |
+
'label' => __( 'Enable this email notification', 'wcvendors' ),
|
| 126 |
+
'default' => 'yes'
|
| 127 |
+
),
|
| 128 |
+
'recipient' => array(
|
| 129 |
+
'title' => __( 'Recipient(s)', 'woocommerce' ),
|
| 130 |
+
'type' => 'text',
|
| 131 |
+
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'wcvendors' ), esc_attr( get_option( 'admin_email' ) ) ),
|
| 132 |
+
'placeholder' => '',
|
| 133 |
+
'default' => ''
|
| 134 |
+
),
|
| 135 |
+
'subject' => array(
|
| 136 |
+
'title' => __( 'Subject', 'wcvendors' ),
|
| 137 |
+
'type' => 'text',
|
| 138 |
+
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
|
| 139 |
+
'placeholder' => '',
|
| 140 |
+
'default' => ''
|
| 141 |
+
),
|
| 142 |
+
'heading' => array(
|
| 143 |
+
'title' => __( 'Email Heading', 'wcvendors' ),
|
| 144 |
+
'type' => 'text',
|
| 145 |
+
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
|
| 146 |
+
'placeholder' => '',
|
| 147 |
+
'default' => ''
|
| 148 |
+
),
|
| 149 |
+
'email_type' => array(
|
| 150 |
+
'title' => __( 'Email type', 'wcvendors' ),
|
| 151 |
+
'type' => 'select',
|
| 152 |
+
'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
|
| 153 |
+
'default' => 'html',
|
| 154 |
+
'class' => 'email_type',
|
| 155 |
+
'options' => array(
|
| 156 |
+
'plain' => __( 'Plain text', 'wcvendors' ),
|
| 157 |
+
'html' => __( 'HTML', 'wcvendors' ),
|
| 158 |
+
'multipart' => __( 'Multipart', 'wcvendors' ),
|
| 159 |
+
)
|
| 160 |
+
)
|
| 161 |
+
);
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
|
| 165 |
+
}
|
trunk/classes/admin/emails/class-wc-notify-admin.php
ADDED
|
@@ -0,0 +1,176 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* New Order Email
|
| 7 |
+
*
|
| 8 |
+
* An email sent to the admin when a new product is created.
|
| 9 |
+
*
|
| 10 |
+
* @class WC_Email_Notify_Admin
|
| 11 |
+
* @version 2.0.0
|
| 12 |
+
* @extends WC_Email
|
| 13 |
+
* @author WooThemes
|
| 14 |
+
* @package WooCommerce/Classes/Emails
|
| 15 |
+
*/
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
class WC_Email_Notify_Admin extends WC_Email
|
| 19 |
+
{
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Constructor
|
| 24 |
+
*/
|
| 25 |
+
function __construct()
|
| 26 |
+
{
|
| 27 |
+
$this->id = 'admin_new_vendor_product';
|
| 28 |
+
$this->title = __( 'New Vendor Product', 'wcvendors' );
|
| 29 |
+
$this->description = __( 'New order emails are sent when a new product is submitted by a vendor', 'wcvendors' );
|
| 30 |
+
|
| 31 |
+
$this->heading = __( 'New product submitted: {product_name}', 'wcvendors' );
|
| 32 |
+
$this->subject = __( '[{blogname}] New product submitted by {vendor_name} - {product_name}', 'wcvendors' );
|
| 33 |
+
|
| 34 |
+
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 35 |
+
$this->template_html = 'new-product.php';
|
| 36 |
+
$this->template_plain = 'new-product.php';
|
| 37 |
+
|
| 38 |
+
// Triggers for this email
|
| 39 |
+
add_action( 'pending_product', array( $this, 'trigger' ), 10, 2 );
|
| 40 |
+
add_action( 'pending_product_variation', array( $this, 'trigger' ), 10, 2 );
|
| 41 |
+
|
| 42 |
+
// Call parent constuctor
|
| 43 |
+
parent::__construct();
|
| 44 |
+
|
| 45 |
+
// Other settings
|
| 46 |
+
$this->recipient = $this->get_option( 'recipient' );
|
| 47 |
+
|
| 48 |
+
if ( !$this->recipient )
|
| 49 |
+
$this->recipient = get_option( 'admin_email' );
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
|
| 53 |
+
/**
|
| 54 |
+
* trigger function.
|
| 55 |
+
*
|
| 56 |
+
* @access public
|
| 57 |
+
* @return void
|
| 58 |
+
*
|
| 59 |
+
* @param unknown $order_id
|
| 60 |
+
*/
|
| 61 |
+
function trigger( $id, $post )
|
| 62 |
+
{
|
| 63 |
+
|
| 64 |
+
// Ensure that the post author is a vendor
|
| 65 |
+
if ( !WCV_Vendors::is_vendor( $post->post_author ) ) {
|
| 66 |
+
return;
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
if ( !$this->is_enabled() ) return;
|
| 70 |
+
|
| 71 |
+
$this->find[ ] = '{product_name}';
|
| 72 |
+
$this->product_name = $post->post_title;
|
| 73 |
+
$this->replace[ ] = $this->product_name;
|
| 74 |
+
|
| 75 |
+
$this->find[ ] = '{vendor_name}';
|
| 76 |
+
$this->vendor_name = WCV_Vendors::get_vendor_shop_name( $post->post_author );
|
| 77 |
+
$this->replace[ ] = $this->vendor_name;
|
| 78 |
+
|
| 79 |
+
$this->post_id = $post->ID;
|
| 80 |
+
|
| 81 |
+
$this->send( $this->get_recipient(), $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
/**
|
| 85 |
+
* get_content_html function.
|
| 86 |
+
*
|
| 87 |
+
* @access public
|
| 88 |
+
* @return string
|
| 89 |
+
*/
|
| 90 |
+
function get_content_html()
|
| 91 |
+
{
|
| 92 |
+
ob_start();
|
| 93 |
+
wc_get_template( $this->template_html, array(
|
| 94 |
+
'product_name' => $this->product_name,
|
| 95 |
+
'vendor_name' => $this->vendor_name,
|
| 96 |
+
'post_id' => $this->post_id,
|
| 97 |
+
'email_heading' => $this->get_heading()
|
| 98 |
+
), 'woocommerce', $this->template_base );
|
| 99 |
+
|
| 100 |
+
return ob_get_clean();
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
|
| 104 |
+
/**
|
| 105 |
+
* get_content_plain function.
|
| 106 |
+
*
|
| 107 |
+
* @access public
|
| 108 |
+
* @return string
|
| 109 |
+
*/
|
| 110 |
+
function get_content_plain()
|
| 111 |
+
{
|
| 112 |
+
ob_start();
|
| 113 |
+
wc_get_template( $this->template_plain, array(
|
| 114 |
+
'product_name' => $this->product_name,
|
| 115 |
+
'vendor_name' => $this->vendor_name,
|
| 116 |
+
'post_id' => $this->post_id,
|
| 117 |
+
'email_heading' => $this->get_heading()
|
| 118 |
+
), 'woocommerce', $this->template_base );
|
| 119 |
+
|
| 120 |
+
return ob_get_clean();
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
|
| 124 |
+
/**
|
| 125 |
+
* Initialise Settings Form Fields
|
| 126 |
+
*
|
| 127 |
+
* @access public
|
| 128 |
+
* @return void
|
| 129 |
+
*/
|
| 130 |
+
function init_form_fields()
|
| 131 |
+
{
|
| 132 |
+
$this->form_fields = array(
|
| 133 |
+
'enabled' => array(
|
| 134 |
+
'title' => __( 'Enable/Disable', 'wcvendors' ),
|
| 135 |
+
'type' => 'checkbox',
|
| 136 |
+
'label' => __( 'Enable this email notification', 'wcvendors' ),
|
| 137 |
+
'default' => 'yes'
|
| 138 |
+
),
|
| 139 |
+
'recipient' => array(
|
| 140 |
+
'title' => __( 'Recipient(s)', 'woocommerce' ),
|
| 141 |
+
'type' => 'text',
|
| 142 |
+
'description' => sprintf( __( 'Enter recipients (comma separated) for this email. Defaults to <code>%s</code>.', 'woocommerce' ), esc_attr( get_option( 'admin_email' ) ) ),
|
| 143 |
+
'placeholder' => '',
|
| 144 |
+
'default' => ''
|
| 145 |
+
),
|
| 146 |
+
'subject' => array(
|
| 147 |
+
'title' => __( 'Subject', 'wcvendors' ),
|
| 148 |
+
'type' => 'text',
|
| 149 |
+
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
|
| 150 |
+
'placeholder' => '',
|
| 151 |
+
'default' => ''
|
| 152 |
+
),
|
| 153 |
+
'heading' => array(
|
| 154 |
+
'title' => __( 'Email Heading', 'wcvendors' ),
|
| 155 |
+
'type' => 'text',
|
| 156 |
+
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
|
| 157 |
+
'placeholder' => '',
|
| 158 |
+
'default' => ''
|
| 159 |
+
),
|
| 160 |
+
'email_type' => array(
|
| 161 |
+
'title' => __( 'Email type', 'wcvendors' ),
|
| 162 |
+
'type' => 'select',
|
| 163 |
+
'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
|
| 164 |
+
'default' => 'html',
|
| 165 |
+
'class' => 'email_type',
|
| 166 |
+
'options' => array(
|
| 167 |
+
'plain' => __( 'Plain text', 'wcvendors' ),
|
| 168 |
+
'html' => __( 'HTML', 'wcvendors' ),
|
| 169 |
+
'multipart' => __( 'Multipart', 'wcvendors' ),
|
| 170 |
+
)
|
| 171 |
+
)
|
| 172 |
+
);
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
}
|
trunk/classes/admin/emails/class-wc-notify-shipped.php
ADDED
|
@@ -0,0 +1,201 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* New Order Email
|
| 7 |
+
*
|
| 8 |
+
* An email sent to the admin when a new product is created.
|
| 9 |
+
*
|
| 10 |
+
* @class WC_Email_Notify_Shipped
|
| 11 |
+
* @version 2.0.0
|
| 12 |
+
* @extends WC_Email
|
| 13 |
+
* @author WooThemes
|
| 14 |
+
* @package WooCommerce/Classes/Emails
|
| 15 |
+
*/
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
class WC_Email_Notify_Shipped extends WC_Email
|
| 19 |
+
{
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Constructor
|
| 24 |
+
*/
|
| 25 |
+
function __construct()
|
| 26 |
+
{
|
| 27 |
+
$this->id = 'vendor_notify_shipped';
|
| 28 |
+
$this->title = __( 'Vendor has shipped', 'wcvendors' );
|
| 29 |
+
$this->description = __( 'An email is sent when a vendor has marked one of their orders as shipped.', 'wcvendors' );
|
| 30 |
+
|
| 31 |
+
$this->heading = __( 'Your order has been shipped', 'wcvendors' );
|
| 32 |
+
$this->subject = __( '[{blogname}] Your order has been shipped ({order_number}) - {order_date}', 'wcvendors' );
|
| 33 |
+
|
| 34 |
+
$this->template_html = 'notify-vendor-shipped.php';
|
| 35 |
+
$this->template_plain = 'notify-vendor-shipped.php';
|
| 36 |
+
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 37 |
+
|
| 38 |
+
// Call parent constuctor
|
| 39 |
+
parent::__construct();
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
|
| 43 |
+
/**
|
| 44 |
+
* trigger function.
|
| 45 |
+
*
|
| 46 |
+
* @access public
|
| 47 |
+
* @return void
|
| 48 |
+
*
|
| 49 |
+
* @param unknown $order_id
|
| 50 |
+
*/
|
| 51 |
+
function trigger( $order_id, $vendor_id )
|
| 52 |
+
{
|
| 53 |
+
$this->object = new WC_Order( $order_id );
|
| 54 |
+
$this->current_vendor = $vendor_id;
|
| 55 |
+
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $this->object->order_date : $this->object->get_date_created();
|
| 56 |
+
|
| 57 |
+
$this->find[ ] = '{order_date}';
|
| 58 |
+
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 59 |
+
|
| 60 |
+
$this->find[ ] = '{order_number}';
|
| 61 |
+
$this->replace[ ] = $this->object->get_order_number();
|
| 62 |
+
|
| 63 |
+
$billing_email = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $this->object->billing_email : $this->object->get_billing_email();
|
| 64 |
+
|
| 65 |
+
if ( !$this->is_enabled() ) return;
|
| 66 |
+
|
| 67 |
+
add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 68 |
+
add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 69 |
+
$this->send( $billing_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 70 |
+
remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 71 |
+
remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
/**
|
| 76 |
+
*
|
| 77 |
+
*
|
| 78 |
+
* @param unknown $items
|
| 79 |
+
* @param unknown $order
|
| 80 |
+
*
|
| 81 |
+
* @return unknown
|
| 82 |
+
*/
|
| 83 |
+
public function check_items( $items, $order )
|
| 84 |
+
{
|
| 85 |
+
foreach ( $items as $key => $product ) {
|
| 86 |
+
|
| 87 |
+
if ( empty( $product[ 'product_id' ] ) ) {
|
| 88 |
+
unset( $items[ $key ] );
|
| 89 |
+
continue;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 93 |
+
|
| 94 |
+
if ( $this->current_vendor != $author ) {
|
| 95 |
+
unset( $items[ $key ] );
|
| 96 |
+
continue;
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
return $items;
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
/**
|
| 105 |
+
*
|
| 106 |
+
*
|
| 107 |
+
* @param unknown $total_rows
|
| 108 |
+
* @param unknown $order
|
| 109 |
+
*
|
| 110 |
+
* @return unknown
|
| 111 |
+
*/
|
| 112 |
+
public function check_order_totals( $total_rows, $order )
|
| 113 |
+
{
|
| 114 |
+
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 115 |
+
$return[ 'cart_subtotal' ][ 'label' ] = __( 'Subtotal:', 'wcvendors' );
|
| 116 |
+
|
| 117 |
+
return $return;
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
/**
|
| 121 |
+
* get_content_html function.
|
| 122 |
+
*
|
| 123 |
+
* @access public
|
| 124 |
+
* @return string
|
| 125 |
+
*/
|
| 126 |
+
function get_content_html()
|
| 127 |
+
{
|
| 128 |
+
ob_start();
|
| 129 |
+
wc_get_template( $this->template_html, array(
|
| 130 |
+
'order' => $this->object,
|
| 131 |
+
'email_heading' => $this->get_heading()
|
| 132 |
+
), 'woocommerce', $this->template_base );
|
| 133 |
+
|
| 134 |
+
return ob_get_clean();
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
/**
|
| 139 |
+
* get_content_plain function.
|
| 140 |
+
*
|
| 141 |
+
* @access public
|
| 142 |
+
* @return string
|
| 143 |
+
*/
|
| 144 |
+
function get_content_plain()
|
| 145 |
+
{
|
| 146 |
+
ob_start();
|
| 147 |
+
wc_get_template( $this->template_plain, array(
|
| 148 |
+
'order' => $this->object,
|
| 149 |
+
'email_heading' => $this->get_heading()
|
| 150 |
+
), 'woocommerce', $this->template_base );
|
| 151 |
+
|
| 152 |
+
return ob_get_clean();
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
|
| 156 |
+
/**
|
| 157 |
+
* Initialise Settings Form Fields
|
| 158 |
+
*
|
| 159 |
+
* @access public
|
| 160 |
+
* @return void
|
| 161 |
+
*/
|
| 162 |
+
function init_form_fields()
|
| 163 |
+
{
|
| 164 |
+
$this->form_fields = array(
|
| 165 |
+
'enabled' => array(
|
| 166 |
+
'title' => __( 'Enable/Disable', 'wcvendors' ),
|
| 167 |
+
'type' => 'checkbox',
|
| 168 |
+
'label' => __( 'Enable this email notification', 'wcvendors' ),
|
| 169 |
+
'default' => 'yes'
|
| 170 |
+
),
|
| 171 |
+
'subject' => array(
|
| 172 |
+
'title' => __( 'Subject', 'wcvendors' ),
|
| 173 |
+
'type' => 'text',
|
| 174 |
+
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
|
| 175 |
+
'placeholder' => '',
|
| 176 |
+
'default' => ''
|
| 177 |
+
),
|
| 178 |
+
'heading' => array(
|
| 179 |
+
'title' => __( 'Email Heading', 'wcvendors' ),
|
| 180 |
+
'type' => 'text',
|
| 181 |
+
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
|
| 182 |
+
'placeholder' => '',
|
| 183 |
+
'default' => ''
|
| 184 |
+
),
|
| 185 |
+
'email_type' => array(
|
| 186 |
+
'title' => __( 'Email type', 'wcvendors' ),
|
| 187 |
+
'type' => 'select',
|
| 188 |
+
'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
|
| 189 |
+
'default' => 'html',
|
| 190 |
+
'class' => 'email_type',
|
| 191 |
+
'options' => array(
|
| 192 |
+
'plain' => __( 'Plain text', 'wcvendors' ),
|
| 193 |
+
'html' => __( 'HTML', 'wcvendors' ),
|
| 194 |
+
'multipart' => __( 'Multipart', 'wcvendors' ),
|
| 195 |
+
)
|
| 196 |
+
)
|
| 197 |
+
);
|
| 198 |
+
}
|
| 199 |
+
|
| 200 |
+
|
| 201 |
+
}
|
trunk/classes/admin/emails/class-wc-notify-vendor.php
ADDED
|
@@ -0,0 +1,352 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !defined( 'ABSPATH' ) ) exit; // Exit if accessed directly
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* New Order Email
|
| 7 |
+
*
|
| 8 |
+
* An email sent to the vendor when a new order is received/paid for.
|
| 9 |
+
*
|
| 10 |
+
* @class WC_Email_Notify_Vendor
|
| 11 |
+
* @version 2.0.0
|
| 12 |
+
* @extends WC_Email
|
| 13 |
+
* @author WooThemes
|
| 14 |
+
* @package WooCommerce/Classes/Emails
|
| 15 |
+
*/
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
class WC_Email_Notify_Vendor extends WC_Email
|
| 19 |
+
{
|
| 20 |
+
|
| 21 |
+
/**
|
| 22 |
+
* Constructor
|
| 23 |
+
*/
|
| 24 |
+
function __construct()
|
| 25 |
+
{
|
| 26 |
+
$this->id = 'vendor_new_order';
|
| 27 |
+
$this->title = __( 'Notify vendors', 'wcvendors' );
|
| 28 |
+
$this->description = __( 'New order emails are sent when an order is received/paid by a customer.', 'wcvendors' );
|
| 29 |
+
|
| 30 |
+
$this->heading = __( 'New customer order', 'wcvendors' );
|
| 31 |
+
$this->subject = __( '[{blogname}] New customer order ({order_number}) - {order_date}', 'wcvendors' );
|
| 32 |
+
|
| 33 |
+
$this->template_html = 'vendor-new-order.php';
|
| 34 |
+
$this->template_plain = 'vendor-new-order.php';
|
| 35 |
+
$this->template_base = dirname( dirname( dirname( dirname( __FILE__ ) ) ) ) . '/templates/emails/';
|
| 36 |
+
|
| 37 |
+
// Triggers for this email
|
| 38 |
+
add_action( 'woocommerce_order_status_pending_to_processing_notification', array( $this, 'trigger' ) );
|
| 39 |
+
add_action( 'woocommerce_order_status_pending_to_completed_notification', array( $this, 'trigger' ) );
|
| 40 |
+
add_action( 'woocommerce_order_status_failed_to_processing_notification', array( $this, 'trigger' ) );
|
| 41 |
+
add_action( 'woocommerce_order_status_failed_to_completed_notification', array( $this, 'trigger' ) );
|
| 42 |
+
add_action( 'woocommerce_order_status_on-hold_to_processing_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
|
| 43 |
+
add_action( 'woocommerce_order_status_on-hold_to_completed_notification', array( $this, 'trigger' ) ); // Added in 1.8.4
|
| 44 |
+
|
| 45 |
+
// Call parent constuctor
|
| 46 |
+
parent::__construct();
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* trigger function.
|
| 52 |
+
*
|
| 53 |
+
* @access public
|
| 54 |
+
* @return void
|
| 55 |
+
*
|
| 56 |
+
* @param unknown $order_id
|
| 57 |
+
*/
|
| 58 |
+
function trigger( $order_id )
|
| 59 |
+
{
|
| 60 |
+
global $woocommerce;
|
| 61 |
+
|
| 62 |
+
if ( $order_id ) {
|
| 63 |
+
$this->object = new WC_Order( $order_id );
|
| 64 |
+
|
| 65 |
+
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $this->object->order_date : $this->object->get_date_created();
|
| 66 |
+
|
| 67 |
+
$this->find[ ] = '{order_date}';
|
| 68 |
+
$this->replace[ ] = date_i18n( wc_date_format(), strtotime( $order_date ) );
|
| 69 |
+
|
| 70 |
+
$this->find[ ] = '{order_number}';
|
| 71 |
+
$this->replace[ ] = $this->object->get_order_number();
|
| 72 |
+
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
if ( !$this->is_enabled() ) return;
|
| 76 |
+
|
| 77 |
+
$vendors = $this->get_vendors( $this->object );
|
| 78 |
+
|
| 79 |
+
if ( empty( $vendors ) ) return;
|
| 80 |
+
|
| 81 |
+
add_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 82 |
+
add_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 83 |
+
add_filter( 'woocommerce_order_formatted_line_subtotal', array( $this, 'check_order_formatted_line_subtotal' ), 10, 3 );
|
| 84 |
+
add_filter( 'woocommerce_order_subtotal_to_display', array( $this, 'check_order_subtotal_to_display'), 10, 3 );
|
| 85 |
+
foreach ( $vendors as $user_id => $user_email ) {
|
| 86 |
+
$this->current_vendor = $user_id;
|
| 87 |
+
$this->send( $user_email, $this->get_subject(), $this->get_content(), $this->get_headers(), $this->get_attachments() );
|
| 88 |
+
}
|
| 89 |
+
remove_filter( 'woocommerce_get_order_item_totals', array( $this, 'check_order_totals' ), 10, 2 );
|
| 90 |
+
remove_filter( 'woocommerce_order_get_items', array( $this, 'check_items' ), 10, 2 );
|
| 91 |
+
remove_filter( 'woocommerce_order_formatted_line_subtotal', array( $this, 'check_order_formatted_line_subtotal' ), 10, 3 );
|
| 92 |
+
remove_filter( 'woocommerce_order_subtotal_to_display', array( $this, 'check_order_subtotal_to_display'), 10, 3 );
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
/**
|
| 97 |
+
*
|
| 98 |
+
*
|
| 99 |
+
* @param unknown $total_rows
|
| 100 |
+
* @param unknown $order
|
| 101 |
+
*
|
| 102 |
+
* @return unknown
|
| 103 |
+
*/
|
| 104 |
+
function check_order_totals( $total_rows, $order )
|
| 105 |
+
{
|
| 106 |
+
|
| 107 |
+
$commission_label = apply_filters('wcv_notify_vendor_commission_label', __( 'Commission Subtotal:', 'wcvendors' ) ) ;
|
| 108 |
+
$return[ 'cart_subtotal' ] = $total_rows[ 'cart_subtotal' ];
|
| 109 |
+
$return[ 'cart_subtotal' ][ 'label' ] = $commission_label;
|
| 110 |
+
|
| 111 |
+
if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
|
| 112 |
+
$return[ 'tax_subtotal'] = array( 'label' => '', 'value' => '');
|
| 113 |
+
$return[ 'tax_subtotal']['label'] = apply_filters('wcv_notify_vendor_tax_label', __( 'Tax Subtotal:', 'wcvendors' ) ) ;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
$dues = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 117 |
+
|
| 118 |
+
foreach ( $dues as $due ) {
|
| 119 |
+
if ( $this->current_vendor == $due['vendor_id'] ) {
|
| 120 |
+
if (!empty($return[ 'shipping' ])) $return[ 'shipping' ] = $total_rows[ 'shipping' ];
|
| 121 |
+
$return[ 'shipping' ]['label'] = __( 'Shipping Subtotal:', 'wcvendors' );
|
| 122 |
+
$return[ 'shipping' ][ 'value' ] = wc_price( $due['shipping'] );
|
| 123 |
+
if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
|
| 124 |
+
$return[ 'tax_subtotal']['value'] += $due['tax'];
|
| 125 |
+
}
|
| 126 |
+
break;
|
| 127 |
+
}
|
| 128 |
+
}
|
| 129 |
+
// Format tax price
|
| 130 |
+
if ( WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
|
| 131 |
+
$return[ 'tax_subtotal']['value'] = wc_price( $return[ 'tax_subtotal'] ['value'] );
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
return $return;
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
/**
|
| 139 |
+
*
|
| 140 |
+
*
|
| 141 |
+
* @param unknown $order
|
| 142 |
+
*
|
| 143 |
+
* @return unknown
|
| 144 |
+
*/
|
| 145 |
+
public function get_vendors( $order )
|
| 146 |
+
{
|
| 147 |
+
$items = $order->get_items();
|
| 148 |
+
$vendors = array();
|
| 149 |
+
|
| 150 |
+
foreach ( $items as $key => $product ) {
|
| 151 |
+
|
| 152 |
+
if ( empty( $product[ 'product_id' ] ) ) continue;
|
| 153 |
+
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 154 |
+
|
| 155 |
+
// Only store the vendor authors
|
| 156 |
+
if ( !WCV_Vendors::is_vendor( $author ) ) {
|
| 157 |
+
unset( $items[ $key ] );
|
| 158 |
+
continue;
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
$vendors[ $author ] = get_userdata( $author )->user_email;
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
return $vendors;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
/**
|
| 168 |
+
*
|
| 169 |
+
*
|
| 170 |
+
* @param unknown $items
|
| 171 |
+
* @param unknown $order
|
| 172 |
+
*
|
| 173 |
+
* @return unknown
|
| 174 |
+
*/
|
| 175 |
+
function check_items( $items, $order )
|
| 176 |
+
{
|
| 177 |
+
|
| 178 |
+
$settings = get_option( 'woocommerce_vendor_new_order_settings' );
|
| 179 |
+
|
| 180 |
+
if ( empty( $settings ) ) $settings = $this->get_default_settings();
|
| 181 |
+
|
| 182 |
+
foreach ( $items as $key => $product ) {
|
| 183 |
+
|
| 184 |
+
// If this is a line item
|
| 185 |
+
if ( $product['type'] == 'line_item' ) {
|
| 186 |
+
|
| 187 |
+
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 188 |
+
|
| 189 |
+
if ( $this->current_vendor != $author) {
|
| 190 |
+
unset( $items[ $key ] );
|
| 191 |
+
continue;
|
| 192 |
+
} else {
|
| 193 |
+
|
| 194 |
+
// If display commission is ticked show this otherwise show the full price.
|
| 195 |
+
if ( 'yes' == $settings[ 'commission_display' ] ){
|
| 196 |
+
|
| 197 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 198 |
+
|
| 199 |
+
$commission_due = WCV_Commission::get_commission_due( $order_id, $product[ 'product_id' ], $author );
|
| 200 |
+
|
| 201 |
+
$items[ $key ][ 'line_subtotal' ] = $commission_due;
|
| 202 |
+
$items[ $key ][ 'line_total' ] = $commission_due;
|
| 203 |
+
|
| 204 |
+
// Don't display tax if give tax is not enabled.
|
| 205 |
+
if ( !WC_Vendors::$pv_options->get_option( 'give_tax' ) ) {
|
| 206 |
+
unset($items[ $key ][ 'line_tax' ]) ;
|
| 207 |
+
}
|
| 208 |
+
}
|
| 209 |
+
}
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
return $items;
|
| 215 |
+
|
| 216 |
+
} // check_items()
|
| 217 |
+
|
| 218 |
+
|
| 219 |
+
/**
|
| 220 |
+
* get_content_html function.
|
| 221 |
+
*
|
| 222 |
+
* @access public
|
| 223 |
+
* @return string
|
| 224 |
+
*/
|
| 225 |
+
function get_content_html()
|
| 226 |
+
{
|
| 227 |
+
ob_start();
|
| 228 |
+
wc_get_template( $this->template_html, array(
|
| 229 |
+
'order' => $this->object,
|
| 230 |
+
'email_heading' => $this->get_heading()
|
| 231 |
+
), 'woocommerce', $this->template_base );
|
| 232 |
+
|
| 233 |
+
return ob_get_clean();
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
|
| 237 |
+
/**
|
| 238 |
+
* get_content_plain function.
|
| 239 |
+
*
|
| 240 |
+
* @access public
|
| 241 |
+
* @return string
|
| 242 |
+
*/
|
| 243 |
+
function get_content_plain()
|
| 244 |
+
{
|
| 245 |
+
ob_start();
|
| 246 |
+
wc_get_template( $this->template_plain, array(
|
| 247 |
+
'order' => $this->object,
|
| 248 |
+
'email_heading' => $this->get_heading()
|
| 249 |
+
), 'woocommerce', $this->template_base );
|
| 250 |
+
|
| 251 |
+
return ob_get_clean();
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
|
| 255 |
+
/**
|
| 256 |
+
* Initialise Settings Form Fields
|
| 257 |
+
*
|
| 258 |
+
* @access public
|
| 259 |
+
* @return void
|
| 260 |
+
*/
|
| 261 |
+
function init_form_fields()
|
| 262 |
+
{
|
| 263 |
+
$this->form_fields = array(
|
| 264 |
+
'enabled' => array(
|
| 265 |
+
'title' => __( 'Enable/Disable', 'wcvendors' ),
|
| 266 |
+
'type' => 'checkbox',
|
| 267 |
+
'label' => __( 'Enable this email notification', 'wcvendors' ),
|
| 268 |
+
'default' => 'yes'
|
| 269 |
+
),
|
| 270 |
+
'subject' => array(
|
| 271 |
+
'title' => __( 'Subject', 'wcvendors' ),
|
| 272 |
+
'type' => 'text',
|
| 273 |
+
'description' => sprintf( __( 'This controls the email subject line. Leave blank to use the default subject: <code>%s</code>.', 'wcvendors' ), $this->subject ),
|
| 274 |
+
'placeholder' => '',
|
| 275 |
+
'default' => ''
|
| 276 |
+
),
|
| 277 |
+
'heading' => array(
|
| 278 |
+
'title' => __( 'Email Heading', 'wcvendors' ),
|
| 279 |
+
'type' => 'text',
|
| 280 |
+
'description' => sprintf( __( 'This controls the main heading contained within the email notification. Leave blank to use the default heading: <code>%s</code>.', 'wcvendors' ), $this->heading ),
|
| 281 |
+
'placeholder' => '',
|
| 282 |
+
'default' => ''
|
| 283 |
+
),
|
| 284 |
+
'commission_display' => array(
|
| 285 |
+
'title' => __( 'Product Totals', 'wcvendors' ),
|
| 286 |
+
'type' => 'checkbox',
|
| 287 |
+
'label' => __( 'Show the commission due/paid as the product totals instead of the product prices.', 'wcvendors' ),
|
| 288 |
+
'default' => 'yes'
|
| 289 |
+
),
|
| 290 |
+
'email_type' => array(
|
| 291 |
+
'title' => __( 'Email type', 'wcvendors' ),
|
| 292 |
+
'type' => 'select',
|
| 293 |
+
'description' => __( 'Choose which format of email to send.', 'wcvendors' ),
|
| 294 |
+
'default' => 'html',
|
| 295 |
+
'class' => 'email_type',
|
| 296 |
+
'options' => array(
|
| 297 |
+
'plain' => __( 'Plain text', 'wcvendors' ),
|
| 298 |
+
'html' => __( 'HTML', 'wcvendors' ),
|
| 299 |
+
'multipart' => __( 'Multipart', 'wcvendors' ),
|
| 300 |
+
)
|
| 301 |
+
)
|
| 302 |
+
);
|
| 303 |
+
}
|
| 304 |
+
|
| 305 |
+
|
| 306 |
+
/**
|
| 307 |
+
* check the order line item sub total to ensure that the tax is shown correctly on the vendor emails
|
| 308 |
+
*/
|
| 309 |
+
function check_order_formatted_line_subtotal( $subtotal, $item, $order ){
|
| 310 |
+
|
| 311 |
+
$order_currency = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->get_order_currency() : $order->get_currency();
|
| 312 |
+
|
| 313 |
+
$subtotal = wc_price( $order->get_line_subtotal( $item ), array( 'currency' => $order_currency ) );
|
| 314 |
+
|
| 315 |
+
return $subtotal;
|
| 316 |
+
|
| 317 |
+
} // check_order_formatted_line_subtotal()
|
| 318 |
+
|
| 319 |
+
|
| 320 |
+
function check_order_subtotal_to_display( $subtotal, $compound, $order ){
|
| 321 |
+
|
| 322 |
+
$new_subtotal = 0;
|
| 323 |
+
|
| 324 |
+
foreach ( $order->get_items() as $key => $product ) {
|
| 325 |
+
$new_subtotal += $product[ 'line_subtotal' ];
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
return wc_price( $new_subtotal );
|
| 329 |
+
|
| 330 |
+
|
| 331 |
+
} // check_order_subtotal_to_display()
|
| 332 |
+
|
| 333 |
+
/**
|
| 334 |
+
* Get the default settings for this email if not already set.
|
| 335 |
+
*
|
| 336 |
+
* @since 1.9.9
|
| 337 |
+
*
|
| 338 |
+
*/
|
| 339 |
+
public function get_default_settings(){
|
| 340 |
+
|
| 341 |
+
$settings = array();
|
| 342 |
+
|
| 343 |
+
foreach ( $this->form_fields as $key => $field ) {
|
| 344 |
+
$settings[ $key ] = $field[ 'default' ];
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
return $settings;
|
| 348 |
+
|
| 349 |
+
} // get_default_settings()
|
| 350 |
+
|
| 351 |
+
|
| 352 |
+
}
|
trunk/classes/admin/settings/README.md
ADDED
|
@@ -0,0 +1,126 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
WP Simple Settings Framework
|
| 2 |
+
================================
|
| 3 |
+
|
| 4 |
+
A minimalistic framework for Wordpress Settings API.
|
| 5 |
+
|
| 6 |
+
Quick start
|
| 7 |
+
------------
|
| 8 |
+
|
| 9 |
+
* [Download the latest release](https://github.com/Geczy/WP-Simple-Settings-Framework/zipball/master) (zip)
|
| 10 |
+
|
| 11 |
+
* Or, clone the repo, `git clone git://github.com/Geczy/WP-Simple-Settings-Framework.git`
|
| 12 |
+
|
| 13 |
+
Installation
|
| 14 |
+
------------
|
| 15 |
+
1. Include the framework in your Wordpress plugin by using:
|
| 16 |
+
|
| 17 |
+
```php
|
| 18 |
+
<?php
|
| 19 |
+
add_action( 'init', 'sf_load_settings' );
|
| 20 |
+
function sf_load_settings() {
|
| 21 |
+
require 'classes/sf-class-settings.php';
|
| 22 |
+
$settings_framework = new SF_Settings_API($id = 'my_plugin_name', $title = 'My Plugin Title', $menu = 'plugins.php', __FILE__);
|
| 23 |
+
}
|
| 24 |
+
```
|
| 25 |
+
|
| 26 |
+
Optionally, you might want to make `$settings_framework` a global variable so that you can use the [helper functions](#helpers).
|
| 27 |
+
|
| 28 |
+
2. Open `sf-options.php` to begin configuring your options.
|
| 29 |
+
|
| 30 |
+
Features
|
| 31 |
+
------------
|
| 32 |
+
|
| 33 |
+
### Automatic settings page
|
| 34 |
+
Don't want it under the Plugins tab like in the screenshot? No problem, you can choose where you want it!
|
| 35 |
+
|
| 36 |
+
You can also change "Simple Settings" submenu to be anything you'd like.
|
| 37 |
+
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
---
|
| 41 |
+
|
| 42 |
+
### Tooltips
|
| 43 |
+
|
| 44 |
+
|
| 45 |
+
Optional tooltips using [Twitter Bootstrap](http://twitter.github.com/bootstrap/javascript.html#tooltips)!
|
| 46 |
+
|
| 47 |
+
---
|
| 48 |
+
|
| 49 |
+
### Select box replacement
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
Utilizing [Select2](http://ivaynberg.github.com/select2/) to display select boxes. It's pretty cool!
|
| 53 |
+
|
| 54 |
+
---
|
| 55 |
+
|
| 56 |
+
### Multiple tabs
|
| 57 |
+
|
| 58 |
+
|
| 59 |
+
Create multiple tabs for your options.
|
| 60 |
+
|
| 61 |
+
---
|
| 62 |
+
|
| 63 |
+
### Input types
|
| 64 |
+
|
| 65 |
+
* Text
|
| 66 |
+
* Number
|
| 67 |
+
* Textarea
|
| 68 |
+
* Checkbox
|
| 69 |
+
* Radio
|
| 70 |
+
* Select
|
| 71 |
+
* WP Pages
|
| 72 |
+
|
| 73 |
+
Helpers
|
| 74 |
+
------------
|
| 75 |
+
|
| 76 |
+
Update or add a new option
|
| 77 |
+
|
| 78 |
+
```php
|
| 79 |
+
<?php
|
| 80 |
+
$settings_framework->update_option('your_option', 'new_value');
|
| 81 |
+
```
|
| 82 |
+
|
| 83 |
+
Get an existing option's value
|
| 84 |
+
|
| 85 |
+
```php
|
| 86 |
+
<?php
|
| 87 |
+
$settings_framework->get_option('your_option');
|
| 88 |
+
```
|
| 89 |
+
|
| 90 |
+
Example configuration
|
| 91 |
+
------------
|
| 92 |
+
|
| 93 |
+
Check out the [example config](https://github.com/Geczy/WP-Simple-Settings-Framework/blob/master/sf-options.php) for an idea of how to use every input type.
|
| 94 |
+
|
| 95 |
+
Here's an example of one type, though:
|
| 96 |
+
|
| 97 |
+
```php
|
| 98 |
+
<?php
|
| 99 |
+
$options[] = array(
|
| 100 |
+
'name' => __( 'Name', 'geczy' ),
|
| 101 |
+
'desc' => __( 'Please tell me who you are.', 'geczy' ),
|
| 102 |
+
'id' => 'text_sample',
|
| 103 |
+
'type' => 'text',
|
| 104 |
+
);
|
| 105 |
+
```
|
| 106 |
+
|
| 107 |
+
|
| 108 |
+
Bug tracker
|
| 109 |
+
-----------
|
| 110 |
+
|
| 111 |
+
Have a bug? Please create an issue here on GitHub!
|
| 112 |
+
|
| 113 |
+
https://github.com/Geczy/WP-Simple-Settings-Framework/issues/
|
| 114 |
+
|
| 115 |
+
Copyright and License
|
| 116 |
+
---------------------
|
| 117 |
+
|
| 118 |
+
Copyright 2012 Matthew Gates
|
| 119 |
+
|
| 120 |
+
Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
|
| 121 |
+
|
| 122 |
+
* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
|
| 123 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
|
| 124 |
+
* Neither the names of the copyright holders nor the names of the contributors may be used to endorse or promote products derived from this software without specific prior written permission.
|
| 125 |
+
|
| 126 |
+
http://www.opensource.org/licenses/bsd-license.php
|
trunk/classes/admin/settings/assets/css/sf-styles.css
ADDED
|
@@ -0,0 +1,167 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
a.sf-tips {
|
| 2 |
+
height: 16px;
|
| 3 |
+
width: 16px;
|
| 4 |
+
margin-top: 0.2em;
|
| 5 |
+
float: right;
|
| 6 |
+
background: url(../img/tip.png) no-repeat top left;
|
| 7 |
+
}
|
| 8 |
+
|
| 9 |
+
/*!
|
| 10 |
+
* Bootstrap v2.3.1 [Styles for Tooltips]
|
| 11 |
+
*
|
| 12 |
+
* Copyright 2012 Twitter, Inc
|
| 13 |
+
* Licensed under the Apache License v2.0
|
| 14 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 15 |
+
*
|
| 16 |
+
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 17 |
+
*/
|
| 18 |
+
.clearfix {
|
| 19 |
+
*zoom: 1;
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
.clearfix:before, .clearfix:after {
|
| 23 |
+
display: table;
|
| 24 |
+
content: "";
|
| 25 |
+
line-height: 0;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.clearfix:after {
|
| 29 |
+
clear: both;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
.hide-text {
|
| 33 |
+
font: 0/0 a;
|
| 34 |
+
color: transparent;
|
| 35 |
+
text-shadow: none;
|
| 36 |
+
background-color: transparent;
|
| 37 |
+
border: 0;
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
.input-block-level {
|
| 41 |
+
display: block;
|
| 42 |
+
width: 100%;
|
| 43 |
+
min-height: 30px;
|
| 44 |
+
-webkit-box-sizing: border-box;
|
| 45 |
+
-moz-box-sizing: border-box;
|
| 46 |
+
box-sizing: border-box;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
/* Tooltips */
|
| 50 |
+
.tooltip {
|
| 51 |
+
text-shadow: none;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
.tooltip {
|
| 55 |
+
position: absolute;
|
| 56 |
+
z-index: 1030;
|
| 57 |
+
display: block;
|
| 58 |
+
visibility: visible;
|
| 59 |
+
font-size: 11px;
|
| 60 |
+
line-height: 1.4;
|
| 61 |
+
opacity: 0;
|
| 62 |
+
filter: alpha(opacity=0);
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
.tooltip.in {
|
| 66 |
+
opacity: 0.8;
|
| 67 |
+
filter: alpha(opacity=80);
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
.tooltip.top {
|
| 71 |
+
margin-top: -3px;
|
| 72 |
+
padding: 5px 0;
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
.tooltip.right {
|
| 76 |
+
margin-left: 3px;
|
| 77 |
+
padding: 0 5px;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
.tooltip.bottom {
|
| 81 |
+
margin-top: 3px;
|
| 82 |
+
padding: 5px 0;
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
.tooltip.left {
|
| 86 |
+
margin-left: -3px;
|
| 87 |
+
padding: 0 5px;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
.tooltip-inner {
|
| 91 |
+
max-width: 200px;
|
| 92 |
+
padding: 8px;
|
| 93 |
+
color: #ffffff;
|
| 94 |
+
text-align: center;
|
| 95 |
+
text-decoration: none;
|
| 96 |
+
background-color: #000000;
|
| 97 |
+
-webkit-border-radius: 4px;
|
| 98 |
+
-moz-border-radius: 4px;
|
| 99 |
+
border-radius: 4px;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
.tooltip-arrow {
|
| 103 |
+
position: absolute;
|
| 104 |
+
width: 0;
|
| 105 |
+
height: 0;
|
| 106 |
+
border-color: transparent;
|
| 107 |
+
border-style: solid;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
.tooltip.top .tooltip-arrow {
|
| 111 |
+
bottom: 0;
|
| 112 |
+
left: 50%;
|
| 113 |
+
margin-left: -5px;
|
| 114 |
+
border-width: 5px 5px 0;
|
| 115 |
+
border-top-color: #000000;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
.tooltip.right .tooltip-arrow {
|
| 119 |
+
top: 50%;
|
| 120 |
+
left: 0;
|
| 121 |
+
margin-top: -5px;
|
| 122 |
+
border-width: 5px 5px 5px 0;
|
| 123 |
+
border-right-color: #000000;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
.tooltip.left .tooltip-arrow {
|
| 127 |
+
top: 50%;
|
| 128 |
+
right: 0;
|
| 129 |
+
margin-top: -5px;
|
| 130 |
+
border-width: 5px 0 5px 5px;
|
| 131 |
+
border-left-color: #000000;
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
.tooltip.bottom .tooltip-arrow {
|
| 135 |
+
top: 0;
|
| 136 |
+
left: 50%;
|
| 137 |
+
margin-left: -5px;
|
| 138 |
+
border-width: 0 5px 5px;
|
| 139 |
+
border-bottom-color: #000000;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
/* Animation */
|
| 143 |
+
.fade {
|
| 144 |
+
opacity: 0;
|
| 145 |
+
-webkit-transition: opacity 0.15s linear;
|
| 146 |
+
-moz-transition: opacity 0.15s linear;
|
| 147 |
+
-o-transition: opacity 0.15s linear;
|
| 148 |
+
transition: opacity 0.15s linear;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
.fade.in {
|
| 152 |
+
opacity: 1;
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
.collapse {
|
| 156 |
+
position: relative;
|
| 157 |
+
height: 0;
|
| 158 |
+
overflow: hidden;
|
| 159 |
+
-webkit-transition: height 0.35s ease;
|
| 160 |
+
-moz-transition: height 0.35s ease;
|
| 161 |
+
-o-transition: height 0.35s ease;
|
| 162 |
+
transition: height 0.35s ease;
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
.collapse.in {
|
| 166 |
+
height: auto;
|
| 167 |
+
}
|
trunk/classes/admin/settings/assets/img/tip.png
ADDED
|
Binary file
|
trunk/classes/admin/settings/assets/js/bootstrap-tooltip.js
ADDED
|
@@ -0,0 +1,126 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Bootstrap.js by @fat & @mdo
|
| 3 |
+
* plugins: bootstrap-transition.js, bootstrap-tooltip.js
|
| 4 |
+
* 2.3.1
|
| 5 |
+
* Copyright 2012 Twitter, Inc.
|
| 6 |
+
* http://www.apache.org/licenses/LICENSE-2.0.txt
|
| 7 |
+
*/
|
| 8 |
+
!function (a) {
|
| 9 |
+
a(function () {
|
| 10 |
+
a.support.transition = function () {
|
| 11 |
+
var a = function () {
|
| 12 |
+
var a = document.createElement("bootstrap"), b = {WebkitTransition: "webkitTransitionEnd", MozTransition: "transitionend", OTransition: "oTransitionEnd otransitionend", transition: "transitionend"}, c;
|
| 13 |
+
for (c in b)if (a.style[c] !== undefined)return b[c]
|
| 14 |
+
}();
|
| 15 |
+
return a && {end: a}
|
| 16 |
+
}()
|
| 17 |
+
})
|
| 18 |
+
}(window.jQuery), !function (a) {
|
| 19 |
+
var b = function (a, b) {
|
| 20 |
+
this.init("tooltip", a, b)
|
| 21 |
+
};
|
| 22 |
+
b.prototype = {constructor: b, init: function (b, c, d) {
|
| 23 |
+
var e, f, g, h, i;
|
| 24 |
+
this.type = b, this.$element = a(c), this.options = this.getOptions(d), this.enabled = !0, g = this.options.trigger.split(" ");
|
| 25 |
+
for (i = g.length; i--;)h = g[i], h == "click" ? this.$element.on("click." + this.type, this.options.selector, a.proxy(this.toggle, this)) : h != "manual" && (e = h == "hover" ? "mouseenter" : "focus", f = h == "hover" ? "mouseleave" : "blur", this.$element.on(e + "." + this.type, this.options.selector, a.proxy(this.enter, this)), this.$element.on(f + "." + this.type, this.options.selector, a.proxy(this.leave, this)));
|
| 26 |
+
this.options.selector ? this._options = a.extend({}, this.options, {trigger: "manual", selector: ""}) : this.fixTitle()
|
| 27 |
+
}, getOptions: function (b) {
|
| 28 |
+
return b = a.extend({}, a.fn[this.type].defaults, this.$element.data(), b), b.delay && typeof b.delay == "number" && (b.delay = {show: b.delay, hide: b.delay}), b
|
| 29 |
+
}, enter: function (b) {
|
| 30 |
+
var c = a.fn[this.type].defaults, d = {}, e;
|
| 31 |
+
this._options && a.each(this._options, function (a, b) {
|
| 32 |
+
c[a] != b && (d[a] = b)
|
| 33 |
+
}, this), e = a(b.currentTarget)[this.type](d).data(this.type);
|
| 34 |
+
if (!e.options.delay || !e.options.delay.show)return e.show();
|
| 35 |
+
clearTimeout(this.timeout), e.hoverState = "in", this.timeout = setTimeout(function () {
|
| 36 |
+
e.hoverState == "in" && e.show()
|
| 37 |
+
}, e.options.delay.show)
|
| 38 |
+
}, leave: function (b) {
|
| 39 |
+
var c = a(b.currentTarget)[this.type](this._options).data(this.type);
|
| 40 |
+
this.timeout && clearTimeout(this.timeout);
|
| 41 |
+
if (!c.options.delay || !c.options.delay.hide)return c.hide();
|
| 42 |
+
c.hoverState = "out", this.timeout = setTimeout(function () {
|
| 43 |
+
c.hoverState == "out" && c.hide()
|
| 44 |
+
}, c.options.delay.hide)
|
| 45 |
+
}, show: function () {
|
| 46 |
+
var b, c, d, e, f, g, h = a.Event("show");
|
| 47 |
+
if (this.hasContent() && this.enabled) {
|
| 48 |
+
this.$element.trigger(h);
|
| 49 |
+
if (h.isDefaultPrevented())return;
|
| 50 |
+
b = this.tip(), this.setContent(), this.options.animation && b.addClass("fade"), f = typeof this.options.placement == "function" ? this.options.placement.call(this, b[0], this.$element[0]) : this.options.placement, b.detach().css({top: 0, left: 0, display: "block"}), this.options.container ? b.appendTo(this.options.container) : b.insertAfter(this.$element), c = this.getPosition(), d = b[0].offsetWidth, e = b[0].offsetHeight;
|
| 51 |
+
switch (f) {
|
| 52 |
+
case"bottom":
|
| 53 |
+
g = {top: c.top + c.height, left: c.left + c.width / 2 - d / 2};
|
| 54 |
+
break;
|
| 55 |
+
case"top":
|
| 56 |
+
g = {top: c.top - e, left: c.left + c.width / 2 - d / 2};
|
| 57 |
+
break;
|
| 58 |
+
case"left":
|
| 59 |
+
g = {top: c.top + c.height / 2 - e / 2, left: c.left - d};
|
| 60 |
+
break;
|
| 61 |
+
case"right":
|
| 62 |
+
g = {top: c.top + c.height / 2 - e / 2, left: c.left + c.width}
|
| 63 |
+
}
|
| 64 |
+
this.applyPlacement(g, f), this.$element.trigger("shown")
|
| 65 |
+
}
|
| 66 |
+
}, applyPlacement: function (a, b) {
|
| 67 |
+
var c = this.tip(), d = c[0].offsetWidth, e = c[0].offsetHeight, f, g, h, i;
|
| 68 |
+
c.offset(a).addClass(b).addClass("in"), f = c[0].offsetWidth, g = c[0].offsetHeight, b == "top" && g != e && (a.top = a.top + e - g, i = !0), b == "bottom" || b == "top" ? (h = 0, a.left < 0 && (h = a.left * -2, a.left = 0, c.offset(a), f = c[0].offsetWidth, g = c[0].offsetHeight), this.replaceArrow(h - d + f, f, "left")) : this.replaceArrow(g - e, g, "top"), i && c.offset(a)
|
| 69 |
+
}, replaceArrow: function (a, b, c) {
|
| 70 |
+
this.arrow().css(c, a ? 50 * (1 - a / b) + "%" : "")
|
| 71 |
+
}, setContent: function () {
|
| 72 |
+
var a = this.tip(), b = this.getTitle();
|
| 73 |
+
a.find(".tooltip-inner")[this.options.html ? "html" : "text"](b), a.removeClass("fade in top bottom left right")
|
| 74 |
+
}, hide: function () {
|
| 75 |
+
function e() {
|
| 76 |
+
var b = setTimeout(function () {
|
| 77 |
+
c.off(a.support.transition.end).detach()
|
| 78 |
+
}, 500);
|
| 79 |
+
c.one(a.support.transition.end, function () {
|
| 80 |
+
clearTimeout(b), c.detach()
|
| 81 |
+
})
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
var b = this, c = this.tip(), d = a.Event("hide");
|
| 85 |
+
this.$element.trigger(d);
|
| 86 |
+
if (d.isDefaultPrevented())return;
|
| 87 |
+
return c.removeClass("in"), a.support.transition && this.$tip.hasClass("fade") ? e() : c.detach(), this.$element.trigger("hidden"), this
|
| 88 |
+
}, fixTitle: function () {
|
| 89 |
+
var a = this.$element;
|
| 90 |
+
(a.attr("title") || typeof a.attr("data-original-title") != "string") && a.attr("data-original-title", a.attr("title") || "").attr("title", "")
|
| 91 |
+
}, hasContent: function () {
|
| 92 |
+
return this.getTitle()
|
| 93 |
+
}, getPosition: function () {
|
| 94 |
+
var b = this.$element[0];
|
| 95 |
+
return a.extend({}, typeof b.getBoundingClientRect == "function" ? b.getBoundingClientRect() : {width: b.offsetWidth, height: b.offsetHeight}, this.$element.offset())
|
| 96 |
+
}, getTitle: function () {
|
| 97 |
+
var a, b = this.$element, c = this.options;
|
| 98 |
+
return a = b.attr("data-original-title") || (typeof c.title == "function" ? c.title.call(b[0]) : c.title), a
|
| 99 |
+
}, tip: function () {
|
| 100 |
+
return this.$tip = this.$tip || a(this.options.template)
|
| 101 |
+
}, arrow: function () {
|
| 102 |
+
return this.$arrow = this.$arrow || this.tip().find(".tooltip-arrow")
|
| 103 |
+
}, validate: function () {
|
| 104 |
+
this.$element[0].parentNode || (this.hide(), this.$element = null, this.options = null)
|
| 105 |
+
}, enable: function () {
|
| 106 |
+
this.enabled = !0
|
| 107 |
+
}, disable: function () {
|
| 108 |
+
this.enabled = !1
|
| 109 |
+
}, toggleEnabled: function () {
|
| 110 |
+
this.enabled = !this.enabled
|
| 111 |
+
}, toggle: function (b) {
|
| 112 |
+
var c = b ? a(b.currentTarget)[this.type](this._options).data(this.type) : this;
|
| 113 |
+
c.tip().hasClass("in") ? c.hide() : c.show()
|
| 114 |
+
}, destroy: function () {
|
| 115 |
+
this.hide().$element.off("." + this.type).removeData(this.type)
|
| 116 |
+
}};
|
| 117 |
+
var c = a.fn.tooltip;
|
| 118 |
+
a.fn.tooltip = function (c) {
|
| 119 |
+
return this.each(function () {
|
| 120 |
+
var d = a(this), e = d.data("tooltip"), f = typeof c == "object" && c;
|
| 121 |
+
e || d.data("tooltip", e = new b(this, f)), typeof c == "string" && e[c]()
|
| 122 |
+
})
|
| 123 |
+
}, a.fn.tooltip.Constructor = b, a.fn.tooltip.defaults = {animation: !0, placement: "top", selector: !1, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>', trigger: "hover focus", title: "", delay: 0, html: !1, container: !1}, a.fn.tooltip.noConflict = function () {
|
| 124 |
+
return a.fn.tooltip = c, this
|
| 125 |
+
}
|
| 126 |
+
}(window.jQuery)
|
trunk/classes/admin/settings/assets/js/js.iml
ADDED
|
@@ -0,0 +1,10 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
+
<module type="WEB_MODULE" version="4">
|
| 3 |
+
<component name="NewModuleRootManager" inherit-compiler-output="true">
|
| 4 |
+
<exclude-output />
|
| 5 |
+
<content url="file://$MODULE_DIR$" />
|
| 6 |
+
<orderEntry type="inheritedJdk" />
|
| 7 |
+
<orderEntry type="sourceFolder" forTests="false" />
|
| 8 |
+
</component>
|
| 9 |
+
</module>
|
| 10 |
+
|
trunk/classes/admin/settings/assets/js/select2/select2-bootstrap.css
ADDED
|
@@ -0,0 +1,87 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.form-control .select2-choice {
|
| 2 |
+
border: 0;
|
| 3 |
+
border-radius: 2px;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
.form-control .select2-choice .select2-arrow {
|
| 7 |
+
border-radius: 0 2px 2px 0;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
.form-control.select2-container {
|
| 11 |
+
height: auto !important;
|
| 12 |
+
padding: 0;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
+
border-color: #5897FB;
|
| 17 |
+
border-radius: 3px 3px 0 0;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
+
border-radius: 3px 3px 0 0;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
.form-control.select2-container .select2-choices {
|
| 25 |
+
border: 0 !important;
|
| 26 |
+
border-radius: 3px;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.control-group.warning .select2-container .select2-choice,
|
| 30 |
+
.control-group.warning .select2-container .select2-choices,
|
| 31 |
+
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
+
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
+
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
+
border: 1px solid #C09853 !important;
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
+
border-left: 1px solid #C09853 !important;
|
| 41 |
+
background: #FCF8E3 !important;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
.control-group.error .select2-container .select2-choice,
|
| 45 |
+
.control-group.error .select2-container .select2-choices,
|
| 46 |
+
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
+
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
+
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
+
border: 1px solid #B94A48 !important;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
.control-group.error .select2-container .select2-choice div {
|
| 55 |
+
border-left: 1px solid #B94A48 !important;
|
| 56 |
+
background: #F2DEDE !important;
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
.control-group.info .select2-container .select2-choice,
|
| 60 |
+
.control-group.info .select2-container .select2-choices,
|
| 61 |
+
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
+
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
+
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
+
border: 1px solid #3A87AD !important;
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.control-group.info .select2-container .select2-choice div {
|
| 70 |
+
border-left: 1px solid #3A87AD !important;
|
| 71 |
+
background: #D9EDF7 !important;
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
.control-group.success .select2-container .select2-choice,
|
| 75 |
+
.control-group.success .select2-container .select2-choices,
|
| 76 |
+
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
+
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
+
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
+
border: 1px solid #468847 !important;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
.control-group.success .select2-container .select2-choice div {
|
| 85 |
+
border-left: 1px solid #468847 !important;
|
| 86 |
+
background: #DFF0D8 !important;
|
| 87 |
+
}
|
trunk/classes/admin/settings/assets/js/select2/select2-spinner.gif
ADDED
|
Binary file
|
trunk/classes/admin/settings/assets/js/select2/select2.css
ADDED
|
@@ -0,0 +1,704 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
+
*/
|
| 4 |
+
.select2-container {
|
| 5 |
+
margin: 0;
|
| 6 |
+
position: relative;
|
| 7 |
+
display: inline-block;
|
| 8 |
+
/* inline-block for ie7 */
|
| 9 |
+
zoom: 1;
|
| 10 |
+
*display: inline;
|
| 11 |
+
vertical-align: middle;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.select2-container,
|
| 15 |
+
.select2-drop,
|
| 16 |
+
.select2-search,
|
| 17 |
+
.select2-search input {
|
| 18 |
+
/*
|
| 19 |
+
Force border-box so that % widths fit the parent
|
| 20 |
+
container without overlap because of margin/padding.
|
| 21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
+
*/
|
| 23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
+
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
+
box-sizing: border-box; /* css3 */
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.select2-container .select2-choice {
|
| 29 |
+
display: block;
|
| 30 |
+
height: 26px;
|
| 31 |
+
padding: 0 0 0 8px;
|
| 32 |
+
overflow: hidden;
|
| 33 |
+
position: relative;
|
| 34 |
+
|
| 35 |
+
border: 1px solid #aaa;
|
| 36 |
+
white-space: nowrap;
|
| 37 |
+
line-height: 26px;
|
| 38 |
+
color: #444;
|
| 39 |
+
text-decoration: none;
|
| 40 |
+
|
| 41 |
+
border-radius: 4px;
|
| 42 |
+
|
| 43 |
+
background-clip: padding-box;
|
| 44 |
+
|
| 45 |
+
-webkit-touch-callout: none;
|
| 46 |
+
-webkit-user-select: none;
|
| 47 |
+
-moz-user-select: none;
|
| 48 |
+
-ms-user-select: none;
|
| 49 |
+
user-select: none;
|
| 50 |
+
|
| 51 |
+
background-color: #fff;
|
| 52 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
+
padding: 0 8px 0 0;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
+
border-bottom-color: #aaa;
|
| 65 |
+
|
| 66 |
+
border-radius: 0 0 4px 4px;
|
| 67 |
+
|
| 68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
+
margin-right: 42px;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
+
margin-right: 26px;
|
| 81 |
+
display: block;
|
| 82 |
+
overflow: hidden;
|
| 83 |
+
|
| 84 |
+
white-space: nowrap;
|
| 85 |
+
|
| 86 |
+
text-overflow: ellipsis;
|
| 87 |
+
float: none;
|
| 88 |
+
width: auto;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
+
margin-left: 26px;
|
| 93 |
+
margin-right: 0;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
.select2-container .select2-choice abbr {
|
| 97 |
+
display: none;
|
| 98 |
+
width: 12px;
|
| 99 |
+
height: 12px;
|
| 100 |
+
position: absolute;
|
| 101 |
+
right: 24px;
|
| 102 |
+
top: 8px;
|
| 103 |
+
|
| 104 |
+
font-size: 1px;
|
| 105 |
+
text-decoration: none;
|
| 106 |
+
|
| 107 |
+
border: 0;
|
| 108 |
+
background: url('select2.png') right top no-repeat;
|
| 109 |
+
cursor: pointer;
|
| 110 |
+
outline: 0;
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
+
display: inline-block;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
.select2-container .select2-choice abbr:hover {
|
| 118 |
+
background-position: right -11px;
|
| 119 |
+
cursor: pointer;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
.select2-drop-mask {
|
| 123 |
+
border: 0;
|
| 124 |
+
margin: 0;
|
| 125 |
+
padding: 0;
|
| 126 |
+
position: fixed;
|
| 127 |
+
left: 0;
|
| 128 |
+
top: 0;
|
| 129 |
+
min-height: 100%;
|
| 130 |
+
min-width: 100%;
|
| 131 |
+
height: auto;
|
| 132 |
+
width: auto;
|
| 133 |
+
opacity: 0;
|
| 134 |
+
z-index: 9998;
|
| 135 |
+
/* styles required for IE to work */
|
| 136 |
+
background-color: #fff;
|
| 137 |
+
filter: alpha(opacity=0);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
.select2-drop {
|
| 141 |
+
width: 100%;
|
| 142 |
+
margin-top: -1px;
|
| 143 |
+
position: absolute;
|
| 144 |
+
z-index: 9999;
|
| 145 |
+
top: 100%;
|
| 146 |
+
|
| 147 |
+
background: #fff;
|
| 148 |
+
color: #000;
|
| 149 |
+
border: 1px solid #aaa;
|
| 150 |
+
border-top: 0;
|
| 151 |
+
|
| 152 |
+
border-radius: 0 0 4px 4px;
|
| 153 |
+
|
| 154 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
.select2-drop.select2-drop-above {
|
| 159 |
+
margin-top: 1px;
|
| 160 |
+
border-top: 1px solid #aaa;
|
| 161 |
+
border-bottom: 0;
|
| 162 |
+
|
| 163 |
+
border-radius: 4px 4px 0 0;
|
| 164 |
+
|
| 165 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
.select2-drop-active {
|
| 170 |
+
border: 1px solid #5897fb;
|
| 171 |
+
border-top: none;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
+
border-top: 1px solid #5897fb;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
.select2-drop-auto-width {
|
| 179 |
+
border-top: 1px solid #aaa;
|
| 180 |
+
width: auto;
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
.select2-drop-auto-width .select2-search {
|
| 184 |
+
padding-top: 4px;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
.select2-container .select2-choice .select2-arrow {
|
| 188 |
+
display: inline-block;
|
| 189 |
+
width: 18px;
|
| 190 |
+
height: 100%;
|
| 191 |
+
position: absolute;
|
| 192 |
+
right: 0;
|
| 193 |
+
top: 0;
|
| 194 |
+
|
| 195 |
+
border-left: 1px solid #aaa;
|
| 196 |
+
border-radius: 0 4px 4px 0;
|
| 197 |
+
|
| 198 |
+
background-clip: padding-box;
|
| 199 |
+
|
| 200 |
+
background: #ccc;
|
| 201 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
+
left: 0;
|
| 210 |
+
right: auto;
|
| 211 |
+
|
| 212 |
+
border-left: none;
|
| 213 |
+
border-right: 1px solid #aaa;
|
| 214 |
+
border-radius: 4px 0 0 4px;
|
| 215 |
+
}
|
| 216 |
+
|
| 217 |
+
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
+
display: block;
|
| 219 |
+
width: 100%;
|
| 220 |
+
height: 100%;
|
| 221 |
+
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
+
background-position: 2px 1px;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
.select2-search {
|
| 229 |
+
display: inline-block;
|
| 230 |
+
width: 100%;
|
| 231 |
+
min-height: 26px;
|
| 232 |
+
margin: 0;
|
| 233 |
+
padding-left: 4px;
|
| 234 |
+
padding-right: 4px;
|
| 235 |
+
|
| 236 |
+
position: relative;
|
| 237 |
+
z-index: 10000;
|
| 238 |
+
|
| 239 |
+
white-space: nowrap;
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
.select2-search input {
|
| 243 |
+
width: 100%;
|
| 244 |
+
height: auto !important;
|
| 245 |
+
min-height: 26px;
|
| 246 |
+
padding: 4px 20px 4px 5px;
|
| 247 |
+
margin: 0;
|
| 248 |
+
|
| 249 |
+
outline: 0;
|
| 250 |
+
font-family: sans-serif;
|
| 251 |
+
font-size: 1em;
|
| 252 |
+
|
| 253 |
+
border: 1px solid #aaa;
|
| 254 |
+
border-radius: 0;
|
| 255 |
+
|
| 256 |
+
-webkit-box-shadow: none;
|
| 257 |
+
box-shadow: none;
|
| 258 |
+
|
| 259 |
+
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
+
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
html[dir="rtl"] .select2-search input {
|
| 267 |
+
padding: 4px 5px 4px 20px;
|
| 268 |
+
|
| 269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
+
}
|
| 275 |
+
|
| 276 |
+
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
+
margin-top: 4px;
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
.select2-search input.select2-active {
|
| 281 |
+
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
+
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
.select2-container-active .select2-choice,
|
| 289 |
+
.select2-container-active .select2-choices {
|
| 290 |
+
border: 1px solid #5897fb;
|
| 291 |
+
outline: none;
|
| 292 |
+
|
| 293 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
.select2-dropdown-open .select2-choice {
|
| 298 |
+
border-bottom-color: transparent;
|
| 299 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
+
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
+
|
| 302 |
+
border-bottom-left-radius: 0;
|
| 303 |
+
border-bottom-right-radius: 0;
|
| 304 |
+
|
| 305 |
+
background-color: #eee;
|
| 306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
+
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
+
border: 1px solid #5897fb;
|
| 316 |
+
border-top-color: transparent;
|
| 317 |
+
|
| 318 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
+
}
|
| 324 |
+
|
| 325 |
+
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
+
background: transparent;
|
| 327 |
+
border-left: none;
|
| 328 |
+
filter: none;
|
| 329 |
+
}
|
| 330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
+
border-right: none;
|
| 332 |
+
}
|
| 333 |
+
|
| 334 |
+
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
+
background-position: -18px 1px;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
+
background-position: -16px 1px;
|
| 340 |
+
}
|
| 341 |
+
|
| 342 |
+
.select2-hidden-accessible {
|
| 343 |
+
border: 0;
|
| 344 |
+
clip: rect(0 0 0 0);
|
| 345 |
+
height: 1px;
|
| 346 |
+
margin: -1px;
|
| 347 |
+
overflow: hidden;
|
| 348 |
+
padding: 0;
|
| 349 |
+
position: absolute;
|
| 350 |
+
width: 1px;
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
+
/* results */
|
| 354 |
+
.select2-results {
|
| 355 |
+
max-height: 200px;
|
| 356 |
+
padding: 0 0 0 4px;
|
| 357 |
+
margin: 4px 4px 4px 0;
|
| 358 |
+
position: relative;
|
| 359 |
+
overflow-x: hidden;
|
| 360 |
+
overflow-y: auto;
|
| 361 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
html[dir="rtl"] .select2-results {
|
| 365 |
+
padding: 0 4px 0 0;
|
| 366 |
+
margin: 4px 0 4px 4px;
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
.select2-results ul.select2-result-sub {
|
| 370 |
+
margin: 0;
|
| 371 |
+
padding-left: 0;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
.select2-results li {
|
| 375 |
+
list-style: none;
|
| 376 |
+
display: list-item;
|
| 377 |
+
background-image: none;
|
| 378 |
+
}
|
| 379 |
+
|
| 380 |
+
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
+
font-weight: bold;
|
| 382 |
+
}
|
| 383 |
+
|
| 384 |
+
.select2-results .select2-result-label {
|
| 385 |
+
padding: 3px 7px 4px;
|
| 386 |
+
margin: 0;
|
| 387 |
+
cursor: pointer;
|
| 388 |
+
|
| 389 |
+
min-height: 1em;
|
| 390 |
+
|
| 391 |
+
-webkit-touch-callout: none;
|
| 392 |
+
-webkit-user-select: none;
|
| 393 |
+
-moz-user-select: none;
|
| 394 |
+
-ms-user-select: none;
|
| 395 |
+
user-select: none;
|
| 396 |
+
}
|
| 397 |
+
|
| 398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
+
|
| 406 |
+
.select2-results .select2-highlighted {
|
| 407 |
+
background: #3875d7;
|
| 408 |
+
color: #fff;
|
| 409 |
+
}
|
| 410 |
+
|
| 411 |
+
.select2-results li em {
|
| 412 |
+
background: #feffde;
|
| 413 |
+
font-style: normal;
|
| 414 |
+
}
|
| 415 |
+
|
| 416 |
+
.select2-results .select2-highlighted em {
|
| 417 |
+
background: transparent;
|
| 418 |
+
}
|
| 419 |
+
|
| 420 |
+
.select2-results .select2-highlighted ul {
|
| 421 |
+
background: #fff;
|
| 422 |
+
color: #000;
|
| 423 |
+
}
|
| 424 |
+
|
| 425 |
+
.select2-results .select2-no-results,
|
| 426 |
+
.select2-results .select2-searching,
|
| 427 |
+
.select2-results .select2-ajax-error,
|
| 428 |
+
.select2-results .select2-selection-limit {
|
| 429 |
+
background: #f4f4f4;
|
| 430 |
+
display: list-item;
|
| 431 |
+
padding-left: 5px;
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
/*
|
| 435 |
+
disabled look for disabled choices in the results dropdown
|
| 436 |
+
*/
|
| 437 |
+
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
+
color: #666;
|
| 439 |
+
background: #f4f4f4;
|
| 440 |
+
display: list-item;
|
| 441 |
+
cursor: default;
|
| 442 |
+
}
|
| 443 |
+
.select2-results .select2-disabled {
|
| 444 |
+
background: #f4f4f4;
|
| 445 |
+
display: list-item;
|
| 446 |
+
cursor: default;
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
.select2-results .select2-selected {
|
| 450 |
+
display: none;
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
.select2-more-results.select2-active {
|
| 454 |
+
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
.select2-results .select2-ajax-error {
|
| 458 |
+
background: rgba(255, 50, 50, .2);
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
.select2-more-results {
|
| 462 |
+
background: #f4f4f4;
|
| 463 |
+
display: list-item;
|
| 464 |
+
}
|
| 465 |
+
|
| 466 |
+
/* disabled styles */
|
| 467 |
+
|
| 468 |
+
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
+
background-color: #f4f4f4;
|
| 470 |
+
background-image: none;
|
| 471 |
+
border: 1px solid #ddd;
|
| 472 |
+
cursor: default;
|
| 473 |
+
}
|
| 474 |
+
|
| 475 |
+
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
+
background-color: #f4f4f4;
|
| 477 |
+
background-image: none;
|
| 478 |
+
border-left: 0;
|
| 479 |
+
}
|
| 480 |
+
|
| 481 |
+
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
+
display: none;
|
| 483 |
+
}
|
| 484 |
+
|
| 485 |
+
|
| 486 |
+
/* multiselect */
|
| 487 |
+
|
| 488 |
+
.select2-container-multi .select2-choices {
|
| 489 |
+
height: auto !important;
|
| 490 |
+
height: 1%;
|
| 491 |
+
margin: 0;
|
| 492 |
+
padding: 0 5px 0 0;
|
| 493 |
+
position: relative;
|
| 494 |
+
|
| 495 |
+
border: 1px solid #aaa;
|
| 496 |
+
cursor: text;
|
| 497 |
+
overflow: hidden;
|
| 498 |
+
|
| 499 |
+
background-color: #fff;
|
| 500 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
+
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
+
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
+
}
|
| 505 |
+
|
| 506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
+
padding: 0 0 0 5px;
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
.select2-locked {
|
| 511 |
+
padding: 3px 5px 3px 5px !important;
|
| 512 |
+
}
|
| 513 |
+
|
| 514 |
+
.select2-container-multi .select2-choices {
|
| 515 |
+
min-height: 26px;
|
| 516 |
+
}
|
| 517 |
+
|
| 518 |
+
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
+
border: 1px solid #5897fb;
|
| 520 |
+
outline: none;
|
| 521 |
+
|
| 522 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
+
}
|
| 525 |
+
.select2-container-multi .select2-choices li {
|
| 526 |
+
float: left;
|
| 527 |
+
list-style: none;
|
| 528 |
+
}
|
| 529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
+
{
|
| 531 |
+
float: right;
|
| 532 |
+
}
|
| 533 |
+
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
+
margin: 0;
|
| 535 |
+
padding: 0;
|
| 536 |
+
white-space: nowrap;
|
| 537 |
+
}
|
| 538 |
+
|
| 539 |
+
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
+
padding: 5px;
|
| 541 |
+
margin: 1px 0;
|
| 542 |
+
|
| 543 |
+
font-family: sans-serif;
|
| 544 |
+
font-size: 100%;
|
| 545 |
+
color: #666;
|
| 546 |
+
outline: 0;
|
| 547 |
+
border: 0;
|
| 548 |
+
-webkit-box-shadow: none;
|
| 549 |
+
box-shadow: none;
|
| 550 |
+
background: transparent !important;
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
+
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
+
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
+
}
|
| 556 |
+
|
| 557 |
+
.select2-default {
|
| 558 |
+
color: #999 !important;
|
| 559 |
+
}
|
| 560 |
+
|
| 561 |
+
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
+
padding: 3px 5px 3px 18px;
|
| 563 |
+
margin: 3px 0 3px 5px;
|
| 564 |
+
position: relative;
|
| 565 |
+
|
| 566 |
+
line-height: 13px;
|
| 567 |
+
color: #333;
|
| 568 |
+
cursor: default;
|
| 569 |
+
border: 1px solid #aaaaaa;
|
| 570 |
+
|
| 571 |
+
border-radius: 3px;
|
| 572 |
+
|
| 573 |
+
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
+
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
+
|
| 576 |
+
background-clip: padding-box;
|
| 577 |
+
|
| 578 |
+
-webkit-touch-callout: none;
|
| 579 |
+
-webkit-user-select: none;
|
| 580 |
+
-moz-user-select: none;
|
| 581 |
+
-ms-user-select: none;
|
| 582 |
+
user-select: none;
|
| 583 |
+
|
| 584 |
+
background-color: #e4e4e4;
|
| 585 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
+
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
+
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
+
}
|
| 591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
+
{
|
| 593 |
+
margin: 3px 5px 3px 0;
|
| 594 |
+
padding: 3px 18px 3px 5px;
|
| 595 |
+
}
|
| 596 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
+
cursor: default;
|
| 598 |
+
}
|
| 599 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
+
background: #d4d4d4;
|
| 601 |
+
}
|
| 602 |
+
|
| 603 |
+
.select2-search-choice-close {
|
| 604 |
+
display: block;
|
| 605 |
+
width: 12px;
|
| 606 |
+
height: 13px;
|
| 607 |
+
position: absolute;
|
| 608 |
+
right: 3px;
|
| 609 |
+
top: 4px;
|
| 610 |
+
|
| 611 |
+
font-size: 1px;
|
| 612 |
+
outline: none;
|
| 613 |
+
background: url('select2.png') right top no-repeat;
|
| 614 |
+
}
|
| 615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
+
right: auto;
|
| 617 |
+
left: 3px;
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
.select2-container-multi .select2-search-choice-close {
|
| 621 |
+
left: 3px;
|
| 622 |
+
}
|
| 623 |
+
|
| 624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
+
left: auto;
|
| 626 |
+
right: 2px;
|
| 627 |
+
}
|
| 628 |
+
|
| 629 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
+
background-position: right -11px;
|
| 631 |
+
}
|
| 632 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
+
background-position: right -11px;
|
| 634 |
+
}
|
| 635 |
+
|
| 636 |
+
/* disabled styles */
|
| 637 |
+
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
+
background-color: #f4f4f4;
|
| 639 |
+
background-image: none;
|
| 640 |
+
border: 1px solid #ddd;
|
| 641 |
+
cursor: default;
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
+
padding: 3px 5px 3px 5px;
|
| 646 |
+
border: 1px solid #ddd;
|
| 647 |
+
background-image: none;
|
| 648 |
+
background-color: #f4f4f4;
|
| 649 |
+
}
|
| 650 |
+
|
| 651 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
+
background: none;
|
| 653 |
+
}
|
| 654 |
+
/* end multiselect */
|
| 655 |
+
|
| 656 |
+
|
| 657 |
+
.select2-result-selectable .select2-match,
|
| 658 |
+
.select2-result-unselectable .select2-match {
|
| 659 |
+
text-decoration: underline;
|
| 660 |
+
}
|
| 661 |
+
|
| 662 |
+
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
+
clip: rect(0 0 0 0) !important;
|
| 664 |
+
width: 1px !important;
|
| 665 |
+
height: 1px !important;
|
| 666 |
+
border: 0 !important;
|
| 667 |
+
margin: 0 !important;
|
| 668 |
+
padding: 0 !important;
|
| 669 |
+
overflow: hidden !important;
|
| 670 |
+
position: absolute !important;
|
| 671 |
+
outline: 0 !important;
|
| 672 |
+
left: 0px !important;
|
| 673 |
+
top: 0px !important;
|
| 674 |
+
}
|
| 675 |
+
|
| 676 |
+
.select2-display-none {
|
| 677 |
+
display: none;
|
| 678 |
+
}
|
| 679 |
+
|
| 680 |
+
.select2-measure-scrollbar {
|
| 681 |
+
position: absolute;
|
| 682 |
+
top: -10000px;
|
| 683 |
+
left: -10000px;
|
| 684 |
+
width: 100px;
|
| 685 |
+
height: 100px;
|
| 686 |
+
overflow: scroll;
|
| 687 |
+
}
|
| 688 |
+
|
| 689 |
+
/* Retina-ize icons */
|
| 690 |
+
|
| 691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
+
.select2-search input,
|
| 693 |
+
.select2-search-choice-close,
|
| 694 |
+
.select2-container .select2-choice abbr,
|
| 695 |
+
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
+
background-image: url('select2x2.png') !important;
|
| 697 |
+
background-repeat: no-repeat !important;
|
| 698 |
+
background-size: 60px 40px !important;
|
| 699 |
+
}
|
| 700 |
+
|
| 701 |
+
.select2-search input {
|
| 702 |
+
background-position: 100% -21px !important;
|
| 703 |
+
}
|
| 704 |
+
}
|
trunk/classes/admin/settings/assets/js/select2/select2.js
ADDED
|
@@ -0,0 +1,3541 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2012 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
+
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
(function ($) {
|
| 22 |
+
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
+
$.extend($.fn, {
|
| 24 |
+
/*
|
| 25 |
+
* 4-10 times faster .each replacement
|
| 26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
+
*/
|
| 28 |
+
each2 : function (c) {
|
| 29 |
+
var j = $([0]), i = -1, l = this.length;
|
| 30 |
+
while (
|
| 31 |
+
++i < l
|
| 32 |
+
&& (j.context = j[0] = this[i])
|
| 33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
+
);
|
| 35 |
+
return this;
|
| 36 |
+
}
|
| 37 |
+
});
|
| 38 |
+
}
|
| 39 |
+
})(jQuery);
|
| 40 |
+
|
| 41 |
+
(function ($, undefined) {
|
| 42 |
+
"use strict";
|
| 43 |
+
/*global document, window, jQuery, console */
|
| 44 |
+
|
| 45 |
+
if (window.Select2 !== undefined) {
|
| 46 |
+
return;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
+
|
| 52 |
+
KEY = {
|
| 53 |
+
TAB: 9,
|
| 54 |
+
ENTER: 13,
|
| 55 |
+
ESC: 27,
|
| 56 |
+
SPACE: 32,
|
| 57 |
+
LEFT: 37,
|
| 58 |
+
UP: 38,
|
| 59 |
+
RIGHT: 39,
|
| 60 |
+
DOWN: 40,
|
| 61 |
+
SHIFT: 16,
|
| 62 |
+
CTRL: 17,
|
| 63 |
+
ALT: 18,
|
| 64 |
+
PAGE_UP: 33,
|
| 65 |
+
PAGE_DOWN: 34,
|
| 66 |
+
HOME: 36,
|
| 67 |
+
END: 35,
|
| 68 |
+
BACKSPACE: 8,
|
| 69 |
+
DELETE: 46,
|
| 70 |
+
isArrow: function (k) {
|
| 71 |
+
k = k.which ? k.which : k;
|
| 72 |
+
switch (k) {
|
| 73 |
+
case KEY.LEFT:
|
| 74 |
+
case KEY.RIGHT:
|
| 75 |
+
case KEY.UP:
|
| 76 |
+
case KEY.DOWN:
|
| 77 |
+
return true;
|
| 78 |
+
}
|
| 79 |
+
return false;
|
| 80 |
+
},
|
| 81 |
+
isControl: function (e) {
|
| 82 |
+
var k = e.which;
|
| 83 |
+
switch (k) {
|
| 84 |
+
case KEY.SHIFT:
|
| 85 |
+
case KEY.CTRL:
|
| 86 |
+
case KEY.ALT:
|
| 87 |
+
return true;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
if (e.metaKey) return true;
|
| 91 |
+
|
| 92 |
+
return false;
|
| 93 |
+
},
|
| 94 |
+
isFunctionKey: function (k) {
|
| 95 |
+
k = k.which ? k.which : k;
|
| 96 |
+
return k >= 112 && k <= 123;
|
| 97 |
+
}
|
| 98 |
+
},
|
| 99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
+
|
| 101 |
+
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
+
|
| 103 |
+
$document = $(document);
|
| 104 |
+
|
| 105 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
+
|
| 107 |
+
|
| 108 |
+
function reinsertElement(element) {
|
| 109 |
+
var placeholder = $(document.createTextNode(''));
|
| 110 |
+
|
| 111 |
+
element.before(placeholder);
|
| 112 |
+
placeholder.before(element);
|
| 113 |
+
placeholder.remove();
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
function stripDiacritics(str) {
|
| 117 |
+
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
+
function match(a) {
|
| 119 |
+
return DIACRITICS[a] || a;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
function indexOf(value, array) {
|
| 126 |
+
var i = 0, l = array.length;
|
| 127 |
+
for (; i < l; i = i + 1) {
|
| 128 |
+
if (equal(value, array[i])) return i;
|
| 129 |
+
}
|
| 130 |
+
return -1;
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
function measureScrollbar () {
|
| 134 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
+
$template.appendTo(document.body);
|
| 136 |
+
|
| 137 |
+
var dim = {
|
| 138 |
+
width: $template.width() - $template[0].clientWidth,
|
| 139 |
+
height: $template.height() - $template[0].clientHeight
|
| 140 |
+
};
|
| 141 |
+
$template.remove();
|
| 142 |
+
|
| 143 |
+
return dim;
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
/**
|
| 147 |
+
* Compares equality of a and b
|
| 148 |
+
* @param a
|
| 149 |
+
* @param b
|
| 150 |
+
*/
|
| 151 |
+
function equal(a, b) {
|
| 152 |
+
if (a === b) return true;
|
| 153 |
+
if (a === undefined || b === undefined) return false;
|
| 154 |
+
if (a === null || b === null) return false;
|
| 155 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
+
return false;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
/**
|
| 163 |
+
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
| 164 |
+
* strings
|
| 165 |
+
* @param string
|
| 166 |
+
* @param separator
|
| 167 |
+
*/
|
| 168 |
+
function splitVal(string, separator, transform) {
|
| 169 |
+
var val, i, l;
|
| 170 |
+
if (string === null || string.length < 1) return [];
|
| 171 |
+
val = string.split(separator);
|
| 172 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
| 173 |
+
return val;
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
function getSideBorderPadding(element) {
|
| 177 |
+
return element.outerWidth(false) - element.width();
|
| 178 |
+
}
|
| 179 |
+
|
| 180 |
+
function installKeyUpChangeEvent(element) {
|
| 181 |
+
var key="keyup-change-value";
|
| 182 |
+
element.on("keydown", function () {
|
| 183 |
+
if ($.data(element, key) === undefined) {
|
| 184 |
+
$.data(element, key, element.val());
|
| 185 |
+
}
|
| 186 |
+
});
|
| 187 |
+
element.on("keyup", function () {
|
| 188 |
+
var val= $.data(element, key);
|
| 189 |
+
if (val !== undefined && element.val() !== val) {
|
| 190 |
+
$.removeData(element, key);
|
| 191 |
+
element.trigger("keyup-change");
|
| 192 |
+
}
|
| 193 |
+
});
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
|
| 197 |
+
/**
|
| 198 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
+
*
|
| 200 |
+
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
+
* the elements under the pointer are scrolled.
|
| 202 |
+
*/
|
| 203 |
+
function installFilteredMouseMove(element) {
|
| 204 |
+
element.on("mousemove", function (e) {
|
| 205 |
+
var lastpos = lastMousePosition;
|
| 206 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
+
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
+
}
|
| 209 |
+
});
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
/**
|
| 213 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
+
* within the last quietMillis milliseconds.
|
| 215 |
+
*
|
| 216 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
+
* @param fn function to be debounced
|
| 218 |
+
* @param ctx object to be used as this reference within fn
|
| 219 |
+
* @return debounced version of fn
|
| 220 |
+
*/
|
| 221 |
+
function debounce(quietMillis, fn, ctx) {
|
| 222 |
+
ctx = ctx || undefined;
|
| 223 |
+
var timeout;
|
| 224 |
+
return function () {
|
| 225 |
+
var args = arguments;
|
| 226 |
+
window.clearTimeout(timeout);
|
| 227 |
+
timeout = window.setTimeout(function() {
|
| 228 |
+
fn.apply(ctx, args);
|
| 229 |
+
}, quietMillis);
|
| 230 |
+
};
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
function installDebouncedScroll(threshold, element) {
|
| 234 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
+
element.on("scroll", function (e) {
|
| 236 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
+
});
|
| 238 |
+
}
|
| 239 |
+
|
| 240 |
+
function focus($el) {
|
| 241 |
+
if ($el[0] === document.activeElement) return;
|
| 242 |
+
|
| 243 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
+
of the current event has finished - which seems like the only reliable way
|
| 245 |
+
to set focus */
|
| 246 |
+
window.setTimeout(function() {
|
| 247 |
+
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
+
|
| 249 |
+
$el.focus();
|
| 250 |
+
|
| 251 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
+
sometimes modals or others listeners may steal it after its set */
|
| 253 |
+
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
+
if (isVisible && el === document.activeElement) {
|
| 255 |
+
|
| 256 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
+
just before setting focus */
|
| 258 |
+
if(el.setSelectionRange)
|
| 259 |
+
{
|
| 260 |
+
el.setSelectionRange(pos, pos);
|
| 261 |
+
}
|
| 262 |
+
else if (el.createTextRange) {
|
| 263 |
+
range = el.createTextRange();
|
| 264 |
+
range.collapse(false);
|
| 265 |
+
range.select();
|
| 266 |
+
}
|
| 267 |
+
}
|
| 268 |
+
}, 0);
|
| 269 |
+
}
|
| 270 |
+
|
| 271 |
+
function getCursorInfo(el) {
|
| 272 |
+
el = $(el)[0];
|
| 273 |
+
var offset = 0;
|
| 274 |
+
var length = 0;
|
| 275 |
+
if ('selectionStart' in el) {
|
| 276 |
+
offset = el.selectionStart;
|
| 277 |
+
length = el.selectionEnd - offset;
|
| 278 |
+
} else if ('selection' in document) {
|
| 279 |
+
el.focus();
|
| 280 |
+
var sel = document.selection.createRange();
|
| 281 |
+
length = document.selection.createRange().text.length;
|
| 282 |
+
sel.moveStart('character', -el.value.length);
|
| 283 |
+
offset = sel.text.length - length;
|
| 284 |
+
}
|
| 285 |
+
return { offset: offset, length: length };
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
function killEvent(event) {
|
| 289 |
+
event.preventDefault();
|
| 290 |
+
event.stopPropagation();
|
| 291 |
+
}
|
| 292 |
+
function killEventImmediately(event) {
|
| 293 |
+
event.preventDefault();
|
| 294 |
+
event.stopImmediatePropagation();
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
function measureTextWidth(e) {
|
| 298 |
+
if (!sizer){
|
| 299 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
+
sizer = $(document.createElement("div")).css({
|
| 301 |
+
position: "absolute",
|
| 302 |
+
left: "-10000px",
|
| 303 |
+
top: "-10000px",
|
| 304 |
+
display: "none",
|
| 305 |
+
fontSize: style.fontSize,
|
| 306 |
+
fontFamily: style.fontFamily,
|
| 307 |
+
fontStyle: style.fontStyle,
|
| 308 |
+
fontWeight: style.fontWeight,
|
| 309 |
+
letterSpacing: style.letterSpacing,
|
| 310 |
+
textTransform: style.textTransform,
|
| 311 |
+
whiteSpace: "nowrap"
|
| 312 |
+
});
|
| 313 |
+
sizer.attr("class","select2-sizer");
|
| 314 |
+
$(document.body).append(sizer);
|
| 315 |
+
}
|
| 316 |
+
sizer.text(e.val());
|
| 317 |
+
return sizer.width();
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
function syncCssClasses(dest, src, adapter) {
|
| 321 |
+
var classes, replacements = [], adapted;
|
| 322 |
+
|
| 323 |
+
classes = $.trim(dest.attr("class"));
|
| 324 |
+
|
| 325 |
+
if (classes) {
|
| 326 |
+
classes = '' + classes; // for IE which returns object
|
| 327 |
+
|
| 328 |
+
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
+
if (this.indexOf("select2-") === 0) {
|
| 330 |
+
replacements.push(this);
|
| 331 |
+
}
|
| 332 |
+
});
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
classes = $.trim(src.attr("class"));
|
| 336 |
+
|
| 337 |
+
if (classes) {
|
| 338 |
+
classes = '' + classes; // for IE which returns object
|
| 339 |
+
|
| 340 |
+
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
+
if (this.indexOf("select2-") !== 0) {
|
| 342 |
+
adapted = adapter(this);
|
| 343 |
+
|
| 344 |
+
if (adapted) {
|
| 345 |
+
replacements.push(adapted);
|
| 346 |
+
}
|
| 347 |
+
}
|
| 348 |
+
});
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
dest.attr("class", replacements.join(" "));
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
|
| 355 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
+
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
+
tl=term.length;
|
| 358 |
+
|
| 359 |
+
if (match<0) {
|
| 360 |
+
markup.push(escapeMarkup(text));
|
| 361 |
+
return;
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
+
markup.push("<span class='select2-match'>");
|
| 366 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
+
markup.push("</span>");
|
| 368 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
+
}
|
| 370 |
+
|
| 371 |
+
function defaultEscapeMarkup(markup) {
|
| 372 |
+
var replace_map = {
|
| 373 |
+
'\\': '\',
|
| 374 |
+
'&': '&',
|
| 375 |
+
'<': '<',
|
| 376 |
+
'>': '>',
|
| 377 |
+
'"': '"',
|
| 378 |
+
"'": ''',
|
| 379 |
+
"/": '/'
|
| 380 |
+
};
|
| 381 |
+
|
| 382 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
+
return replace_map[match];
|
| 384 |
+
});
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
/**
|
| 388 |
+
* Produces an ajax-based query function
|
| 389 |
+
*
|
| 390 |
+
* @param options object containing configuration parameters
|
| 391 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
+
* @param options.url url for the data
|
| 394 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
+
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
+
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
+
* The expected format is an object containing the following keys:
|
| 399 |
+
* results array of objects that will be used as choices
|
| 400 |
+
* more (optional) boolean indicating whether there are more results available
|
| 401 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
+
*/
|
| 403 |
+
function ajax(options) {
|
| 404 |
+
var timeout, // current scheduled but not yet executed request
|
| 405 |
+
handler = null,
|
| 406 |
+
quietMillis = options.quietMillis || 100,
|
| 407 |
+
ajaxUrl = options.url,
|
| 408 |
+
self = this;
|
| 409 |
+
|
| 410 |
+
return function (query) {
|
| 411 |
+
window.clearTimeout(timeout);
|
| 412 |
+
timeout = window.setTimeout(function () {
|
| 413 |
+
var data = options.data, // ajax data function
|
| 414 |
+
url = ajaxUrl, // ajax url string or function
|
| 415 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
+
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
+
deprecated = {
|
| 418 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
+
cache: options.cache || false,
|
| 420 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
+
dataType: options.dataType||"json"
|
| 422 |
+
},
|
| 423 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
+
|
| 425 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
+
|
| 428 |
+
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
+
|
| 430 |
+
if (options.params) {
|
| 431 |
+
if ($.isFunction(options.params)) {
|
| 432 |
+
$.extend(params, options.params.call(self));
|
| 433 |
+
} else {
|
| 434 |
+
$.extend(params, options.params);
|
| 435 |
+
}
|
| 436 |
+
}
|
| 437 |
+
|
| 438 |
+
$.extend(params, {
|
| 439 |
+
url: url,
|
| 440 |
+
dataType: options.dataType,
|
| 441 |
+
data: data,
|
| 442 |
+
success: function (data) {
|
| 443 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
+
// added query as third paramter to keep backwards compatibility
|
| 445 |
+
var results = options.results(data, query.page, query);
|
| 446 |
+
query.callback(results);
|
| 447 |
+
},
|
| 448 |
+
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
+
var results = {
|
| 450 |
+
hasError: true,
|
| 451 |
+
jqXHR: jqXHR,
|
| 452 |
+
textStatus: textStatus,
|
| 453 |
+
errorThrown: errorThrown
|
| 454 |
+
};
|
| 455 |
+
|
| 456 |
+
query.callback(results);
|
| 457 |
+
}
|
| 458 |
+
});
|
| 459 |
+
handler = transport.call(self, params);
|
| 460 |
+
}, quietMillis);
|
| 461 |
+
};
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
/**
|
| 465 |
+
* Produces a query function that works with a local array
|
| 466 |
+
*
|
| 467 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
+
* object.
|
| 469 |
+
*
|
| 470 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
+
*
|
| 472 |
+
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
+
* the text.
|
| 477 |
+
*/
|
| 478 |
+
function local(options) {
|
| 479 |
+
var data = options, // data elements
|
| 480 |
+
dataText,
|
| 481 |
+
tmp,
|
| 482 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
+
|
| 484 |
+
if ($.isArray(data)) {
|
| 485 |
+
tmp = data;
|
| 486 |
+
data = { results: tmp };
|
| 487 |
+
}
|
| 488 |
+
|
| 489 |
+
if ($.isFunction(data) === false) {
|
| 490 |
+
tmp = data;
|
| 491 |
+
data = function() { return tmp; };
|
| 492 |
+
}
|
| 493 |
+
|
| 494 |
+
var dataItem = data();
|
| 495 |
+
if (dataItem.text) {
|
| 496 |
+
text = dataItem.text;
|
| 497 |
+
// if text is not a function we assume it to be a key name
|
| 498 |
+
if (!$.isFunction(text)) {
|
| 499 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
+
text = function (item) { return item[dataText]; };
|
| 501 |
+
}
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
return function (query) {
|
| 505 |
+
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
+
if (t === "") {
|
| 507 |
+
query.callback(data());
|
| 508 |
+
return;
|
| 509 |
+
}
|
| 510 |
+
|
| 511 |
+
process = function(datum, collection) {
|
| 512 |
+
var group, attr;
|
| 513 |
+
datum = datum[0];
|
| 514 |
+
if (datum.children) {
|
| 515 |
+
group = {};
|
| 516 |
+
for (attr in datum) {
|
| 517 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
+
}
|
| 519 |
+
group.children=[];
|
| 520 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
+
collection.push(group);
|
| 523 |
+
}
|
| 524 |
+
} else {
|
| 525 |
+
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
+
collection.push(datum);
|
| 527 |
+
}
|
| 528 |
+
}
|
| 529 |
+
};
|
| 530 |
+
|
| 531 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
+
query.callback(filtered);
|
| 533 |
+
};
|
| 534 |
+
}
|
| 535 |
+
|
| 536 |
+
// TODO javadoc
|
| 537 |
+
function tags(data) {
|
| 538 |
+
var isFunc = $.isFunction(data);
|
| 539 |
+
return function (query) {
|
| 540 |
+
var t = query.term, filtered = {results: []};
|
| 541 |
+
var result = isFunc ? data(query) : data;
|
| 542 |
+
if ($.isArray(result)) {
|
| 543 |
+
$(result).each(function () {
|
| 544 |
+
var isObject = this.text !== undefined,
|
| 545 |
+
text = isObject ? this.text : this;
|
| 546 |
+
if (t === "" || query.matcher(t, text)) {
|
| 547 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
+
}
|
| 549 |
+
});
|
| 550 |
+
query.callback(filtered);
|
| 551 |
+
}
|
| 552 |
+
};
|
| 553 |
+
}
|
| 554 |
+
|
| 555 |
+
/**
|
| 556 |
+
* Checks if the formatter function should be used.
|
| 557 |
+
*
|
| 558 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
+
* false if no formatting should be performed.
|
| 560 |
+
*
|
| 561 |
+
* @param formatter
|
| 562 |
+
*/
|
| 563 |
+
function checkFormatter(formatter, formatterName) {
|
| 564 |
+
if ($.isFunction(formatter)) return true;
|
| 565 |
+
if (!formatter) return false;
|
| 566 |
+
if (typeof(formatter) === 'string') return true;
|
| 567 |
+
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
+
}
|
| 569 |
+
|
| 570 |
+
/**
|
| 571 |
+
* Returns a given value
|
| 572 |
+
* If given a function, returns its output
|
| 573 |
+
*
|
| 574 |
+
* @param val string|function
|
| 575 |
+
* @param context value of "this" to be passed to function
|
| 576 |
+
* @returns {*}
|
| 577 |
+
*/
|
| 578 |
+
function evaluate(val, context) {
|
| 579 |
+
if ($.isFunction(val)) {
|
| 580 |
+
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
+
return val.apply(context, args);
|
| 582 |
+
}
|
| 583 |
+
return val;
|
| 584 |
+
}
|
| 585 |
+
|
| 586 |
+
function countResults(results) {
|
| 587 |
+
var count = 0;
|
| 588 |
+
$.each(results, function(i, item) {
|
| 589 |
+
if (item.children) {
|
| 590 |
+
count += countResults(item.children);
|
| 591 |
+
} else {
|
| 592 |
+
count++;
|
| 593 |
+
}
|
| 594 |
+
});
|
| 595 |
+
return count;
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
/**
|
| 599 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
+
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
+
*
|
| 603 |
+
* @param input text user has typed so far or pasted into the search field
|
| 604 |
+
* @param selection currently selected choices
|
| 605 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
+
* @param opts select2's opts
|
| 607 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
+
*/
|
| 609 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
+
token, // token
|
| 613 |
+
index, // position at which the separator was found
|
| 614 |
+
i, l, // looping variables
|
| 615 |
+
separator; // the matched separator
|
| 616 |
+
|
| 617 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
+
|
| 619 |
+
while (true) {
|
| 620 |
+
index = -1;
|
| 621 |
+
|
| 622 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
+
separator = opts.tokenSeparators[i];
|
| 624 |
+
index = input.indexOf(separator);
|
| 625 |
+
if (index >= 0) break;
|
| 626 |
+
}
|
| 627 |
+
|
| 628 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
+
|
| 630 |
+
token = input.substring(0, index);
|
| 631 |
+
input = input.substring(index + separator.length);
|
| 632 |
+
|
| 633 |
+
if (token.length > 0) {
|
| 634 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
+
dupe = false;
|
| 637 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
+
dupe = true; break;
|
| 640 |
+
}
|
| 641 |
+
}
|
| 642 |
+
|
| 643 |
+
if (!dupe) selectCallback(token);
|
| 644 |
+
}
|
| 645 |
+
}
|
| 646 |
+
}
|
| 647 |
+
|
| 648 |
+
if (original!==input) return input;
|
| 649 |
+
}
|
| 650 |
+
|
| 651 |
+
function cleanupJQueryElements() {
|
| 652 |
+
var self = this;
|
| 653 |
+
|
| 654 |
+
$.each(arguments, function (i, element) {
|
| 655 |
+
self[element].remove();
|
| 656 |
+
self[element] = null;
|
| 657 |
+
});
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
/**
|
| 661 |
+
* Creates a new class
|
| 662 |
+
*
|
| 663 |
+
* @param superClass
|
| 664 |
+
* @param methods
|
| 665 |
+
*/
|
| 666 |
+
function clazz(SuperClass, methods) {
|
| 667 |
+
var constructor = function () {};
|
| 668 |
+
constructor.prototype = new SuperClass;
|
| 669 |
+
constructor.prototype.constructor = constructor;
|
| 670 |
+
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
+
return constructor;
|
| 673 |
+
}
|
| 674 |
+
|
| 675 |
+
AbstractSelect2 = clazz(Object, {
|
| 676 |
+
|
| 677 |
+
// abstract
|
| 678 |
+
bind: function (func) {
|
| 679 |
+
var self = this;
|
| 680 |
+
return function () {
|
| 681 |
+
func.apply(self, arguments);
|
| 682 |
+
};
|
| 683 |
+
},
|
| 684 |
+
|
| 685 |
+
// abstract
|
| 686 |
+
init: function (opts) {
|
| 687 |
+
var results, search, resultsSelector = ".select2-results";
|
| 688 |
+
|
| 689 |
+
// prepare options
|
| 690 |
+
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
+
|
| 692 |
+
this.id=opts.id;
|
| 693 |
+
|
| 694 |
+
// destroy if called on an existing component
|
| 695 |
+
if (opts.element.data("select2") !== undefined &&
|
| 696 |
+
opts.element.data("select2") !== null) {
|
| 697 |
+
opts.element.data("select2").destroy();
|
| 698 |
+
}
|
| 699 |
+
|
| 700 |
+
this.container = this.createContainer();
|
| 701 |
+
|
| 702 |
+
this.liveRegion = $('.select2-hidden-accessible');
|
| 703 |
+
if (this.liveRegion.length == 0) {
|
| 704 |
+
this.liveRegion = $("<span>", {
|
| 705 |
+
role: "status",
|
| 706 |
+
"aria-live": "polite"
|
| 707 |
+
})
|
| 708 |
+
.addClass("select2-hidden-accessible")
|
| 709 |
+
.appendTo(document.body);
|
| 710 |
+
}
|
| 711 |
+
|
| 712 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 713 |
+
this.containerEventName= this.containerId
|
| 714 |
+
.replace(/([.])/g, '_')
|
| 715 |
+
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 716 |
+
this.container.attr("id", this.containerId);
|
| 717 |
+
|
| 718 |
+
this.container.attr("title", opts.element.attr("title"));
|
| 719 |
+
|
| 720 |
+
this.body = $(document.body);
|
| 721 |
+
|
| 722 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 723 |
+
|
| 724 |
+
this.container.attr("style", opts.element.attr("style"));
|
| 725 |
+
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 726 |
+
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 727 |
+
|
| 728 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 729 |
+
|
| 730 |
+
// swap container for the element
|
| 731 |
+
this.opts.element
|
| 732 |
+
.data("select2", this)
|
| 733 |
+
.attr("tabindex", "-1")
|
| 734 |
+
.before(this.container)
|
| 735 |
+
.on("click.select2", killEvent); // do not leak click events
|
| 736 |
+
|
| 737 |
+
this.container.data("select2", this);
|
| 738 |
+
|
| 739 |
+
this.dropdown = this.container.find(".select2-drop");
|
| 740 |
+
|
| 741 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 742 |
+
|
| 743 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 744 |
+
this.dropdown.data("select2", this);
|
| 745 |
+
this.dropdown.on("click", killEvent);
|
| 746 |
+
|
| 747 |
+
this.results = results = this.container.find(resultsSelector);
|
| 748 |
+
this.search = search = this.container.find("input.select2-input");
|
| 749 |
+
|
| 750 |
+
this.queryCount = 0;
|
| 751 |
+
this.resultsPage = 0;
|
| 752 |
+
this.context = null;
|
| 753 |
+
|
| 754 |
+
// initialize the container
|
| 755 |
+
this.initContainer();
|
| 756 |
+
|
| 757 |
+
this.container.on("click", killEvent);
|
| 758 |
+
|
| 759 |
+
installFilteredMouseMove(this.results);
|
| 760 |
+
|
| 761 |
+
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 762 |
+
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 763 |
+
this._touchEvent = true;
|
| 764 |
+
this.highlightUnderEvent(event);
|
| 765 |
+
}));
|
| 766 |
+
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 767 |
+
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 768 |
+
|
| 769 |
+
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 770 |
+
// otherwise click will be triggered on an underlying element
|
| 771 |
+
this.dropdown.on('click', this.bind(function (event) {
|
| 772 |
+
if (this._touchEvent) {
|
| 773 |
+
this._touchEvent = false;
|
| 774 |
+
this.selectHighlighted();
|
| 775 |
+
}
|
| 776 |
+
}));
|
| 777 |
+
|
| 778 |
+
installDebouncedScroll(80, this.results);
|
| 779 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 780 |
+
|
| 781 |
+
// do not propagate change event from the search field out of the component
|
| 782 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 783 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 784 |
+
|
| 785 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 786 |
+
if ($.fn.mousewheel) {
|
| 787 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 788 |
+
var top = results.scrollTop();
|
| 789 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
| 790 |
+
results.scrollTop(0);
|
| 791 |
+
killEvent(e);
|
| 792 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 793 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 794 |
+
killEvent(e);
|
| 795 |
+
}
|
| 796 |
+
});
|
| 797 |
+
}
|
| 798 |
+
|
| 799 |
+
installKeyUpChangeEvent(search);
|
| 800 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 801 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 802 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 803 |
+
|
| 804 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 805 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 806 |
+
this.highlightUnderEvent(e);
|
| 807 |
+
this.selectHighlighted(e);
|
| 808 |
+
}
|
| 809 |
+
}));
|
| 810 |
+
|
| 811 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 812 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 813 |
+
// dom it will trigger the popup close, which is not what we want
|
| 814 |
+
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 815 |
+
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 816 |
+
|
| 817 |
+
this.nextSearchTerm = undefined;
|
| 818 |
+
|
| 819 |
+
if ($.isFunction(this.opts.initSelection)) {
|
| 820 |
+
// initialize selection based on the current value of the source element
|
| 821 |
+
this.initSelection();
|
| 822 |
+
|
| 823 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
| 824 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 825 |
+
this.monitorSource();
|
| 826 |
+
}
|
| 827 |
+
|
| 828 |
+
if (opts.maximumInputLength !== null) {
|
| 829 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
| 830 |
+
}
|
| 831 |
+
|
| 832 |
+
var disabled = opts.element.prop("disabled");
|
| 833 |
+
if (disabled === undefined) disabled = false;
|
| 834 |
+
this.enable(!disabled);
|
| 835 |
+
|
| 836 |
+
var readonly = opts.element.prop("readonly");
|
| 837 |
+
if (readonly === undefined) readonly = false;
|
| 838 |
+
this.readonly(readonly);
|
| 839 |
+
|
| 840 |
+
// Calculate size of scrollbar
|
| 841 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 842 |
+
|
| 843 |
+
this.autofocus = opts.element.prop("autofocus");
|
| 844 |
+
opts.element.prop("autofocus", false);
|
| 845 |
+
if (this.autofocus) this.focus();
|
| 846 |
+
|
| 847 |
+
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 848 |
+
},
|
| 849 |
+
|
| 850 |
+
// abstract
|
| 851 |
+
destroy: function () {
|
| 852 |
+
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 853 |
+
|
| 854 |
+
this.close();
|
| 855 |
+
|
| 856 |
+
if (element.length && element[0].detachEvent && self._sync) {
|
| 857 |
+
element.each(function () {
|
| 858 |
+
if (self._sync) {
|
| 859 |
+
this.detachEvent("onpropertychange", self._sync);
|
| 860 |
+
}
|
| 861 |
+
});
|
| 862 |
+
}
|
| 863 |
+
if (this.propertyObserver) {
|
| 864 |
+
this.propertyObserver.disconnect();
|
| 865 |
+
this.propertyObserver = null;
|
| 866 |
+
}
|
| 867 |
+
this._sync = null;
|
| 868 |
+
|
| 869 |
+
if (select2 !== undefined) {
|
| 870 |
+
select2.container.remove();
|
| 871 |
+
select2.liveRegion.remove();
|
| 872 |
+
select2.dropdown.remove();
|
| 873 |
+
element
|
| 874 |
+
.show()
|
| 875 |
+
.removeData("select2")
|
| 876 |
+
.off(".select2")
|
| 877 |
+
.prop("autofocus", this.autofocus || false);
|
| 878 |
+
if (this.elementTabIndex) {
|
| 879 |
+
element.attr({tabindex: this.elementTabIndex});
|
| 880 |
+
} else {
|
| 881 |
+
element.removeAttr("tabindex");
|
| 882 |
+
}
|
| 883 |
+
element.show();
|
| 884 |
+
}
|
| 885 |
+
|
| 886 |
+
cleanupJQueryElements.call(this,
|
| 887 |
+
"container",
|
| 888 |
+
"liveRegion",
|
| 889 |
+
"dropdown",
|
| 890 |
+
"results",
|
| 891 |
+
"search"
|
| 892 |
+
);
|
| 893 |
+
},
|
| 894 |
+
|
| 895 |
+
// abstract
|
| 896 |
+
optionToData: function(element) {
|
| 897 |
+
if (element.is("option")) {
|
| 898 |
+
return {
|
| 899 |
+
id:element.prop("value"),
|
| 900 |
+
text:element.text(),
|
| 901 |
+
element: element.get(),
|
| 902 |
+
css: element.attr("class"),
|
| 903 |
+
disabled: element.prop("disabled"),
|
| 904 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 905 |
+
};
|
| 906 |
+
} else if (element.is("optgroup")) {
|
| 907 |
+
return {
|
| 908 |
+
text:element.attr("label"),
|
| 909 |
+
children:[],
|
| 910 |
+
element: element.get(),
|
| 911 |
+
css: element.attr("class")
|
| 912 |
+
};
|
| 913 |
+
}
|
| 914 |
+
},
|
| 915 |
+
|
| 916 |
+
// abstract
|
| 917 |
+
prepareOpts: function (opts) {
|
| 918 |
+
var element, select, idKey, ajaxUrl, self = this;
|
| 919 |
+
|
| 920 |
+
element = opts.element;
|
| 921 |
+
|
| 922 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 923 |
+
this.select = select = opts.element;
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
if (select) {
|
| 927 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 928 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 929 |
+
if (this in opts) {
|
| 930 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 931 |
+
}
|
| 932 |
+
});
|
| 933 |
+
}
|
| 934 |
+
|
| 935 |
+
opts = $.extend({}, {
|
| 936 |
+
populateResults: function(container, results, query) {
|
| 937 |
+
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 938 |
+
|
| 939 |
+
populate=function(results, container, depth) {
|
| 940 |
+
|
| 941 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 942 |
+
|
| 943 |
+
results = opts.sortResults(results, container, query);
|
| 944 |
+
|
| 945 |
+
// collect the created nodes for bulk append
|
| 946 |
+
var nodes = [];
|
| 947 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 948 |
+
|
| 949 |
+
result=results[i];
|
| 950 |
+
|
| 951 |
+
disabled = (result.disabled === true);
|
| 952 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
| 953 |
+
|
| 954 |
+
compound=result.children && result.children.length > 0;
|
| 955 |
+
|
| 956 |
+
node=$("<li></li>");
|
| 957 |
+
node.addClass("select2-results-dept-"+depth);
|
| 958 |
+
node.addClass("select2-result");
|
| 959 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 960 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
| 961 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
| 962 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
| 963 |
+
node.attr("role", "presentation");
|
| 964 |
+
|
| 965 |
+
label=$(document.createElement("div"));
|
| 966 |
+
label.addClass("select2-result-label");
|
| 967 |
+
label.attr("id", "select2-result-label-" + nextUid());
|
| 968 |
+
label.attr("role", "option");
|
| 969 |
+
|
| 970 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 971 |
+
if (formatted!==undefined) {
|
| 972 |
+
label.html(formatted);
|
| 973 |
+
node.append(label);
|
| 974 |
+
}
|
| 975 |
+
|
| 976 |
+
|
| 977 |
+
if (compound) {
|
| 978 |
+
|
| 979 |
+
innerContainer=$("<ul></ul>");
|
| 980 |
+
innerContainer.addClass("select2-result-sub");
|
| 981 |
+
populate(result.children, innerContainer, depth+1);
|
| 982 |
+
node.append(innerContainer);
|
| 983 |
+
}
|
| 984 |
+
|
| 985 |
+
node.data("select2-data", result);
|
| 986 |
+
nodes.push(node[0]);
|
| 987 |
+
}
|
| 988 |
+
|
| 989 |
+
// bulk append the created nodes
|
| 990 |
+
container.append(nodes);
|
| 991 |
+
liveRegion.text(opts.formatMatches(results.length));
|
| 992 |
+
};
|
| 993 |
+
|
| 994 |
+
populate(results, container, 0);
|
| 995 |
+
}
|
| 996 |
+
}, $.fn.select2.defaults, opts);
|
| 997 |
+
|
| 998 |
+
if (typeof(opts.id) !== "function") {
|
| 999 |
+
idKey = opts.id;
|
| 1000 |
+
opts.id = function (e) { return e[idKey]; };
|
| 1001 |
+
}
|
| 1002 |
+
|
| 1003 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 1004 |
+
if ("tags" in opts) {
|
| 1005 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1006 |
+
}
|
| 1007 |
+
opts.tags=opts.element.data("select2Tags");
|
| 1008 |
+
}
|
| 1009 |
+
|
| 1010 |
+
if (select) {
|
| 1011 |
+
opts.query = this.bind(function (query) {
|
| 1012 |
+
var data = { results: [], more: false },
|
| 1013 |
+
term = query.term,
|
| 1014 |
+
children, placeholderOption, process;
|
| 1015 |
+
|
| 1016 |
+
process=function(element, collection) {
|
| 1017 |
+
var group;
|
| 1018 |
+
if (element.is("option")) {
|
| 1019 |
+
if (query.matcher(term, element.text(), element)) {
|
| 1020 |
+
collection.push(self.optionToData(element));
|
| 1021 |
+
}
|
| 1022 |
+
} else if (element.is("optgroup")) {
|
| 1023 |
+
group=self.optionToData(element);
|
| 1024 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1025 |
+
if (group.children.length>0) {
|
| 1026 |
+
collection.push(group);
|
| 1027 |
+
}
|
| 1028 |
+
}
|
| 1029 |
+
};
|
| 1030 |
+
|
| 1031 |
+
children=element.children();
|
| 1032 |
+
|
| 1033 |
+
// ignore the placeholder option if there is one
|
| 1034 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1035 |
+
placeholderOption = this.getPlaceholderOption();
|
| 1036 |
+
if (placeholderOption) {
|
| 1037 |
+
children=children.not(placeholderOption);
|
| 1038 |
+
}
|
| 1039 |
+
}
|
| 1040 |
+
|
| 1041 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1042 |
+
|
| 1043 |
+
query.callback(data);
|
| 1044 |
+
});
|
| 1045 |
+
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1046 |
+
opts.id=function(e) { return e.id; };
|
| 1047 |
+
} else {
|
| 1048 |
+
if (!("query" in opts)) {
|
| 1049 |
+
|
| 1050 |
+
if ("ajax" in opts) {
|
| 1051 |
+
ajaxUrl = opts.element.data("ajax-url");
|
| 1052 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1053 |
+
opts.ajax.url = ajaxUrl;
|
| 1054 |
+
}
|
| 1055 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1056 |
+
} else if ("data" in opts) {
|
| 1057 |
+
opts.query = local(opts.data);
|
| 1058 |
+
} else if ("tags" in opts) {
|
| 1059 |
+
opts.query = tags(opts.tags);
|
| 1060 |
+
if (opts.createSearchChoice === undefined) {
|
| 1061 |
+
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1062 |
+
}
|
| 1063 |
+
if (opts.initSelection === undefined) {
|
| 1064 |
+
opts.initSelection = function (element, callback) {
|
| 1065 |
+
var data = [];
|
| 1066 |
+
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
| 1067 |
+
var obj = { id: this, text: this },
|
| 1068 |
+
tags = opts.tags;
|
| 1069 |
+
if ($.isFunction(tags)) tags=tags();
|
| 1070 |
+
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1071 |
+
data.push(obj);
|
| 1072 |
+
});
|
| 1073 |
+
|
| 1074 |
+
callback(data);
|
| 1075 |
+
};
|
| 1076 |
+
}
|
| 1077 |
+
}
|
| 1078 |
+
}
|
| 1079 |
+
}
|
| 1080 |
+
if (typeof(opts.query) !== "function") {
|
| 1081 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1082 |
+
}
|
| 1083 |
+
|
| 1084 |
+
if (opts.createSearchChoicePosition === 'top') {
|
| 1085 |
+
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1086 |
+
}
|
| 1087 |
+
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1088 |
+
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1089 |
+
}
|
| 1090 |
+
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1091 |
+
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1092 |
+
}
|
| 1093 |
+
|
| 1094 |
+
return opts;
|
| 1095 |
+
},
|
| 1096 |
+
|
| 1097 |
+
/**
|
| 1098 |
+
* Monitor the original element for changes and update select2 accordingly
|
| 1099 |
+
*/
|
| 1100 |
+
// abstract
|
| 1101 |
+
monitorSource: function () {
|
| 1102 |
+
var el = this.opts.element, observer, self = this;
|
| 1103 |
+
|
| 1104 |
+
el.on("change.select2", this.bind(function (e) {
|
| 1105 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1106 |
+
this.initSelection();
|
| 1107 |
+
}
|
| 1108 |
+
}));
|
| 1109 |
+
|
| 1110 |
+
this._sync = this.bind(function () {
|
| 1111 |
+
|
| 1112 |
+
// sync enabled state
|
| 1113 |
+
var disabled = el.prop("disabled");
|
| 1114 |
+
if (disabled === undefined) disabled = false;
|
| 1115 |
+
this.enable(!disabled);
|
| 1116 |
+
|
| 1117 |
+
var readonly = el.prop("readonly");
|
| 1118 |
+
if (readonly === undefined) readonly = false;
|
| 1119 |
+
this.readonly(readonly);
|
| 1120 |
+
|
| 1121 |
+
if (this.container) {
|
| 1122 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1123 |
+
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1124 |
+
}
|
| 1125 |
+
|
| 1126 |
+
if (this.dropdown) {
|
| 1127 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1128 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1129 |
+
}
|
| 1130 |
+
|
| 1131 |
+
});
|
| 1132 |
+
|
| 1133 |
+
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1134 |
+
if (el.length && el[0].attachEvent) {
|
| 1135 |
+
el.each(function() {
|
| 1136 |
+
this.attachEvent("onpropertychange", self._sync);
|
| 1137 |
+
});
|
| 1138 |
+
}
|
| 1139 |
+
|
| 1140 |
+
// safari, chrome, firefox, IE11
|
| 1141 |
+
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1142 |
+
if (observer !== undefined) {
|
| 1143 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1144 |
+
this.propertyObserver = new observer(function (mutations) {
|
| 1145 |
+
$.each(mutations, self._sync);
|
| 1146 |
+
});
|
| 1147 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1148 |
+
}
|
| 1149 |
+
},
|
| 1150 |
+
|
| 1151 |
+
// abstract
|
| 1152 |
+
triggerSelect: function(data) {
|
| 1153 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1154 |
+
this.opts.element.trigger(evt);
|
| 1155 |
+
return !evt.isDefaultPrevented();
|
| 1156 |
+
},
|
| 1157 |
+
|
| 1158 |
+
/**
|
| 1159 |
+
* Triggers the change event on the source element
|
| 1160 |
+
*/
|
| 1161 |
+
// abstract
|
| 1162 |
+
triggerChange: function (details) {
|
| 1163 |
+
|
| 1164 |
+
details = details || {};
|
| 1165 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1166 |
+
// prevents recursive triggering
|
| 1167 |
+
this.opts.element.data("select2-change-triggered", true);
|
| 1168 |
+
this.opts.element.trigger(details);
|
| 1169 |
+
this.opts.element.data("select2-change-triggered", false);
|
| 1170 |
+
|
| 1171 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1172 |
+
// so here we trigger the click event manually
|
| 1173 |
+
this.opts.element.click();
|
| 1174 |
+
|
| 1175 |
+
// ValidationEngine ignores the change event and listens instead to blur
|
| 1176 |
+
// so here we trigger the blur event manually if so desired
|
| 1177 |
+
if (this.opts.blurOnChange)
|
| 1178 |
+
this.opts.element.blur();
|
| 1179 |
+
},
|
| 1180 |
+
|
| 1181 |
+
//abstract
|
| 1182 |
+
isInterfaceEnabled: function()
|
| 1183 |
+
{
|
| 1184 |
+
return this.enabledInterface === true;
|
| 1185 |
+
},
|
| 1186 |
+
|
| 1187 |
+
// abstract
|
| 1188 |
+
enableInterface: function() {
|
| 1189 |
+
var enabled = this._enabled && !this._readonly,
|
| 1190 |
+
disabled = !enabled;
|
| 1191 |
+
|
| 1192 |
+
if (enabled === this.enabledInterface) return false;
|
| 1193 |
+
|
| 1194 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1195 |
+
this.close();
|
| 1196 |
+
this.enabledInterface = enabled;
|
| 1197 |
+
|
| 1198 |
+
return true;
|
| 1199 |
+
},
|
| 1200 |
+
|
| 1201 |
+
// abstract
|
| 1202 |
+
enable: function(enabled) {
|
| 1203 |
+
if (enabled === undefined) enabled = true;
|
| 1204 |
+
if (this._enabled === enabled) return;
|
| 1205 |
+
this._enabled = enabled;
|
| 1206 |
+
|
| 1207 |
+
this.opts.element.prop("disabled", !enabled);
|
| 1208 |
+
this.enableInterface();
|
| 1209 |
+
},
|
| 1210 |
+
|
| 1211 |
+
// abstract
|
| 1212 |
+
disable: function() {
|
| 1213 |
+
this.enable(false);
|
| 1214 |
+
},
|
| 1215 |
+
|
| 1216 |
+
// abstract
|
| 1217 |
+
readonly: function(enabled) {
|
| 1218 |
+
if (enabled === undefined) enabled = false;
|
| 1219 |
+
if (this._readonly === enabled) return;
|
| 1220 |
+
this._readonly = enabled;
|
| 1221 |
+
|
| 1222 |
+
this.opts.element.prop("readonly", enabled);
|
| 1223 |
+
this.enableInterface();
|
| 1224 |
+
},
|
| 1225 |
+
|
| 1226 |
+
// abstract
|
| 1227 |
+
opened: function () {
|
| 1228 |
+
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1229 |
+
},
|
| 1230 |
+
|
| 1231 |
+
// abstract
|
| 1232 |
+
positionDropdown: function() {
|
| 1233 |
+
var $dropdown = this.dropdown,
|
| 1234 |
+
container = this.container,
|
| 1235 |
+
offset = container.offset(),
|
| 1236 |
+
height = container.outerHeight(false),
|
| 1237 |
+
width = container.outerWidth(false),
|
| 1238 |
+
dropHeight = $dropdown.outerHeight(false),
|
| 1239 |
+
$window = $(window),
|
| 1240 |
+
windowWidth = $window.width(),
|
| 1241 |
+
windowHeight = $window.height(),
|
| 1242 |
+
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1243 |
+
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1244 |
+
dropTop = offset.top + height,
|
| 1245 |
+
dropLeft = offset.left,
|
| 1246 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1247 |
+
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1248 |
+
dropWidth = $dropdown.outerWidth(false),
|
| 1249 |
+
enoughRoomOnRight = function() {
|
| 1250 |
+
return dropLeft + dropWidth <= viewPortRight;
|
| 1251 |
+
},
|
| 1252 |
+
enoughRoomOnLeft = function() {
|
| 1253 |
+
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
| 1254 |
+
},
|
| 1255 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1256 |
+
bodyOffset,
|
| 1257 |
+
above,
|
| 1258 |
+
changeDirection,
|
| 1259 |
+
css,
|
| 1260 |
+
resultsListNode;
|
| 1261 |
+
|
| 1262 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
| 1263 |
+
if (aboveNow) {
|
| 1264 |
+
above = true;
|
| 1265 |
+
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1266 |
+
changeDirection = true;
|
| 1267 |
+
above = false;
|
| 1268 |
+
}
|
| 1269 |
+
} else {
|
| 1270 |
+
above = false;
|
| 1271 |
+
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1272 |
+
changeDirection = true;
|
| 1273 |
+
above = true;
|
| 1274 |
+
}
|
| 1275 |
+
}
|
| 1276 |
+
|
| 1277 |
+
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1278 |
+
if (changeDirection) {
|
| 1279 |
+
$dropdown.hide();
|
| 1280 |
+
offset = this.container.offset();
|
| 1281 |
+
height = this.container.outerHeight(false);
|
| 1282 |
+
width = this.container.outerWidth(false);
|
| 1283 |
+
dropHeight = $dropdown.outerHeight(false);
|
| 1284 |
+
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1285 |
+
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1286 |
+
dropTop = offset.top + height;
|
| 1287 |
+
dropLeft = offset.left;
|
| 1288 |
+
dropWidth = $dropdown.outerWidth(false);
|
| 1289 |
+
$dropdown.show();
|
| 1290 |
+
|
| 1291 |
+
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1292 |
+
this.focusSearch();
|
| 1293 |
+
}
|
| 1294 |
+
|
| 1295 |
+
if (this.opts.dropdownAutoWidth) {
|
| 1296 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1297 |
+
$dropdown.addClass('select2-drop-auto-width');
|
| 1298 |
+
$dropdown.css('width', '');
|
| 1299 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1300 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1301 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1302 |
+
dropHeight = $dropdown.outerHeight(false);
|
| 1303 |
+
}
|
| 1304 |
+
else {
|
| 1305 |
+
this.container.removeClass('select2-drop-auto-width');
|
| 1306 |
+
}
|
| 1307 |
+
|
| 1308 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1309 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1310 |
+
|
| 1311 |
+
// fix positioning when body has an offset and is not position: static
|
| 1312 |
+
if (this.body.css('position') !== 'static') {
|
| 1313 |
+
bodyOffset = this.body.offset();
|
| 1314 |
+
dropTop -= bodyOffset.top;
|
| 1315 |
+
dropLeft -= bodyOffset.left;
|
| 1316 |
+
}
|
| 1317 |
+
|
| 1318 |
+
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
| 1319 |
+
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1320 |
+
}
|
| 1321 |
+
|
| 1322 |
+
css = {
|
| 1323 |
+
left: dropLeft,
|
| 1324 |
+
width: width
|
| 1325 |
+
};
|
| 1326 |
+
|
| 1327 |
+
if (above) {
|
| 1328 |
+
css.top = offset.top - dropHeight;
|
| 1329 |
+
css.bottom = 'auto';
|
| 1330 |
+
this.container.addClass("select2-drop-above");
|
| 1331 |
+
$dropdown.addClass("select2-drop-above");
|
| 1332 |
+
}
|
| 1333 |
+
else {
|
| 1334 |
+
css.top = dropTop;
|
| 1335 |
+
css.bottom = 'auto';
|
| 1336 |
+
this.container.removeClass("select2-drop-above");
|
| 1337 |
+
$dropdown.removeClass("select2-drop-above");
|
| 1338 |
+
}
|
| 1339 |
+
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1340 |
+
|
| 1341 |
+
$dropdown.css(css);
|
| 1342 |
+
},
|
| 1343 |
+
|
| 1344 |
+
// abstract
|
| 1345 |
+
shouldOpen: function() {
|
| 1346 |
+
var event;
|
| 1347 |
+
|
| 1348 |
+
if (this.opened()) return false;
|
| 1349 |
+
|
| 1350 |
+
if (this._enabled === false || this._readonly === true) return false;
|
| 1351 |
+
|
| 1352 |
+
event = $.Event("select2-opening");
|
| 1353 |
+
this.opts.element.trigger(event);
|
| 1354 |
+
return !event.isDefaultPrevented();
|
| 1355 |
+
},
|
| 1356 |
+
|
| 1357 |
+
// abstract
|
| 1358 |
+
clearDropdownAlignmentPreference: function() {
|
| 1359 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1360 |
+
this.container.removeClass("select2-drop-above");
|
| 1361 |
+
this.dropdown.removeClass("select2-drop-above");
|
| 1362 |
+
},
|
| 1363 |
+
|
| 1364 |
+
/**
|
| 1365 |
+
* Opens the dropdown
|
| 1366 |
+
*
|
| 1367 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1368 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1369 |
+
*/
|
| 1370 |
+
// abstract
|
| 1371 |
+
open: function () {
|
| 1372 |
+
|
| 1373 |
+
if (!this.shouldOpen()) return false;
|
| 1374 |
+
|
| 1375 |
+
this.opening();
|
| 1376 |
+
|
| 1377 |
+
// Only bind the document mousemove when the dropdown is visible
|
| 1378 |
+
$document.on("mousemove.select2Event", function (e) {
|
| 1379 |
+
lastMousePosition.x = e.pageX;
|
| 1380 |
+
lastMousePosition.y = e.pageY;
|
| 1381 |
+
});
|
| 1382 |
+
|
| 1383 |
+
return true;
|
| 1384 |
+
},
|
| 1385 |
+
|
| 1386 |
+
/**
|
| 1387 |
+
* Performs the opening of the dropdown
|
| 1388 |
+
*/
|
| 1389 |
+
// abstract
|
| 1390 |
+
opening: function() {
|
| 1391 |
+
var cid = this.containerEventName,
|
| 1392 |
+
scroll = "scroll." + cid,
|
| 1393 |
+
resize = "resize."+cid,
|
| 1394 |
+
orient = "orientationchange."+cid,
|
| 1395 |
+
mask;
|
| 1396 |
+
|
| 1397 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1398 |
+
|
| 1399 |
+
this.clearDropdownAlignmentPreference();
|
| 1400 |
+
|
| 1401 |
+
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1402 |
+
this.dropdown.detach().appendTo(this.body);
|
| 1403 |
+
}
|
| 1404 |
+
|
| 1405 |
+
// create the dropdown mask if doesn't already exist
|
| 1406 |
+
mask = $("#select2-drop-mask");
|
| 1407 |
+
if (mask.length === 0) {
|
| 1408 |
+
mask = $(document.createElement("div"));
|
| 1409 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1410 |
+
mask.hide();
|
| 1411 |
+
mask.appendTo(this.body);
|
| 1412 |
+
mask.on("mousedown touchstart click", function (e) {
|
| 1413 |
+
// Prevent IE from generating a click event on the body
|
| 1414 |
+
reinsertElement(mask);
|
| 1415 |
+
|
| 1416 |
+
var dropdown = $("#select2-drop"), self;
|
| 1417 |
+
if (dropdown.length > 0) {
|
| 1418 |
+
self=dropdown.data("select2");
|
| 1419 |
+
if (self.opts.selectOnBlur) {
|
| 1420 |
+
self.selectHighlighted({noFocus: true});
|
| 1421 |
+
}
|
| 1422 |
+
self.close();
|
| 1423 |
+
e.preventDefault();
|
| 1424 |
+
e.stopPropagation();
|
| 1425 |
+
}
|
| 1426 |
+
});
|
| 1427 |
+
}
|
| 1428 |
+
|
| 1429 |
+
// ensure the mask is always right before the dropdown
|
| 1430 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1431 |
+
this.dropdown.before(mask);
|
| 1432 |
+
}
|
| 1433 |
+
|
| 1434 |
+
// move the global id to the correct dropdown
|
| 1435 |
+
$("#select2-drop").removeAttr("id");
|
| 1436 |
+
this.dropdown.attr("id", "select2-drop");
|
| 1437 |
+
|
| 1438 |
+
// show the elements
|
| 1439 |
+
mask.show();
|
| 1440 |
+
|
| 1441 |
+
this.positionDropdown();
|
| 1442 |
+
this.dropdown.show();
|
| 1443 |
+
this.positionDropdown();
|
| 1444 |
+
|
| 1445 |
+
this.dropdown.addClass("select2-drop-active");
|
| 1446 |
+
|
| 1447 |
+
// attach listeners to events that can change the position of the container and thus require
|
| 1448 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1449 |
+
var that = this;
|
| 1450 |
+
this.container.parents().add(window).each(function () {
|
| 1451 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1452 |
+
if (that.opened()) that.positionDropdown();
|
| 1453 |
+
});
|
| 1454 |
+
});
|
| 1455 |
+
|
| 1456 |
+
|
| 1457 |
+
},
|
| 1458 |
+
|
| 1459 |
+
// abstract
|
| 1460 |
+
close: function () {
|
| 1461 |
+
if (!this.opened()) return;
|
| 1462 |
+
|
| 1463 |
+
var cid = this.containerEventName,
|
| 1464 |
+
scroll = "scroll." + cid,
|
| 1465 |
+
resize = "resize."+cid,
|
| 1466 |
+
orient = "orientationchange."+cid;
|
| 1467 |
+
|
| 1468 |
+
// unbind event listeners
|
| 1469 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1470 |
+
|
| 1471 |
+
this.clearDropdownAlignmentPreference();
|
| 1472 |
+
|
| 1473 |
+
$("#select2-drop-mask").hide();
|
| 1474 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1475 |
+
this.dropdown.hide();
|
| 1476 |
+
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1477 |
+
this.results.empty();
|
| 1478 |
+
|
| 1479 |
+
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1480 |
+
$document.off("mousemove.select2Event");
|
| 1481 |
+
|
| 1482 |
+
this.clearSearch();
|
| 1483 |
+
this.search.removeClass("select2-active");
|
| 1484 |
+
this.opts.element.trigger($.Event("select2-close"));
|
| 1485 |
+
},
|
| 1486 |
+
|
| 1487 |
+
/**
|
| 1488 |
+
* Opens control, sets input value, and updates results.
|
| 1489 |
+
*/
|
| 1490 |
+
// abstract
|
| 1491 |
+
externalSearch: function (term) {
|
| 1492 |
+
this.open();
|
| 1493 |
+
this.search.val(term);
|
| 1494 |
+
this.updateResults(false);
|
| 1495 |
+
},
|
| 1496 |
+
|
| 1497 |
+
// abstract
|
| 1498 |
+
clearSearch: function () {
|
| 1499 |
+
|
| 1500 |
+
},
|
| 1501 |
+
|
| 1502 |
+
//abstract
|
| 1503 |
+
getMaximumSelectionSize: function() {
|
| 1504 |
+
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1505 |
+
},
|
| 1506 |
+
|
| 1507 |
+
// abstract
|
| 1508 |
+
ensureHighlightVisible: function () {
|
| 1509 |
+
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1510 |
+
|
| 1511 |
+
index = this.highlight();
|
| 1512 |
+
|
| 1513 |
+
if (index < 0) return;
|
| 1514 |
+
|
| 1515 |
+
if (index == 0) {
|
| 1516 |
+
|
| 1517 |
+
// if the first element is highlighted scroll all the way to the top,
|
| 1518 |
+
// that way any unselectable headers above it will also be scrolled
|
| 1519 |
+
// into view
|
| 1520 |
+
|
| 1521 |
+
results.scrollTop(0);
|
| 1522 |
+
return;
|
| 1523 |
+
}
|
| 1524 |
+
|
| 1525 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1526 |
+
|
| 1527 |
+
child = $(children[index]);
|
| 1528 |
+
|
| 1529 |
+
topOffset = (child.offset() || {}).top || 0;
|
| 1530 |
+
|
| 1531 |
+
hb = topOffset + child.outerHeight(true);
|
| 1532 |
+
|
| 1533 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
| 1534 |
+
if (index === children.length - 1) {
|
| 1535 |
+
more = results.find("li.select2-more-results");
|
| 1536 |
+
if (more.length > 0) {
|
| 1537 |
+
hb = more.offset().top + more.outerHeight(true);
|
| 1538 |
+
}
|
| 1539 |
+
}
|
| 1540 |
+
|
| 1541 |
+
rb = results.offset().top + results.outerHeight(false);
|
| 1542 |
+
if (hb > rb) {
|
| 1543 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1544 |
+
}
|
| 1545 |
+
y = topOffset - results.offset().top;
|
| 1546 |
+
|
| 1547 |
+
// make sure the top of the element is visible
|
| 1548 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
| 1549 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1550 |
+
}
|
| 1551 |
+
},
|
| 1552 |
+
|
| 1553 |
+
// abstract
|
| 1554 |
+
findHighlightableChoices: function() {
|
| 1555 |
+
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1556 |
+
},
|
| 1557 |
+
|
| 1558 |
+
// abstract
|
| 1559 |
+
moveHighlight: function (delta) {
|
| 1560 |
+
var choices = this.findHighlightableChoices(),
|
| 1561 |
+
index = this.highlight();
|
| 1562 |
+
|
| 1563 |
+
while (index > -1 && index < choices.length) {
|
| 1564 |
+
index += delta;
|
| 1565 |
+
var choice = $(choices[index]);
|
| 1566 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1567 |
+
this.highlight(index);
|
| 1568 |
+
break;
|
| 1569 |
+
}
|
| 1570 |
+
}
|
| 1571 |
+
},
|
| 1572 |
+
|
| 1573 |
+
// abstract
|
| 1574 |
+
highlight: function (index) {
|
| 1575 |
+
var choices = this.findHighlightableChoices(),
|
| 1576 |
+
choice,
|
| 1577 |
+
data;
|
| 1578 |
+
|
| 1579 |
+
if (arguments.length === 0) {
|
| 1580 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1581 |
+
}
|
| 1582 |
+
|
| 1583 |
+
if (index >= choices.length) index = choices.length - 1;
|
| 1584 |
+
if (index < 0) index = 0;
|
| 1585 |
+
|
| 1586 |
+
this.removeHighlight();
|
| 1587 |
+
|
| 1588 |
+
choice = $(choices[index]);
|
| 1589 |
+
choice.addClass("select2-highlighted");
|
| 1590 |
+
|
| 1591 |
+
// ensure assistive technology can determine the active choice
|
| 1592 |
+
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1593 |
+
|
| 1594 |
+
this.ensureHighlightVisible();
|
| 1595 |
+
|
| 1596 |
+
this.liveRegion.text(choice.text());
|
| 1597 |
+
|
| 1598 |
+
data = choice.data("select2-data");
|
| 1599 |
+
if (data) {
|
| 1600 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1601 |
+
}
|
| 1602 |
+
},
|
| 1603 |
+
|
| 1604 |
+
removeHighlight: function() {
|
| 1605 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1606 |
+
},
|
| 1607 |
+
|
| 1608 |
+
touchMoved: function() {
|
| 1609 |
+
this._touchMoved = true;
|
| 1610 |
+
},
|
| 1611 |
+
|
| 1612 |
+
clearTouchMoved: function() {
|
| 1613 |
+
this._touchMoved = false;
|
| 1614 |
+
},
|
| 1615 |
+
|
| 1616 |
+
// abstract
|
| 1617 |
+
countSelectableResults: function() {
|
| 1618 |
+
return this.findHighlightableChoices().length;
|
| 1619 |
+
},
|
| 1620 |
+
|
| 1621 |
+
// abstract
|
| 1622 |
+
highlightUnderEvent: function (event) {
|
| 1623 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
| 1624 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1625 |
+
var choices = this.findHighlightableChoices();
|
| 1626 |
+
this.highlight(choices.index(el));
|
| 1627 |
+
} else if (el.length == 0) {
|
| 1628 |
+
// if we are over an unselectable item remove all highlights
|
| 1629 |
+
this.removeHighlight();
|
| 1630 |
+
}
|
| 1631 |
+
},
|
| 1632 |
+
|
| 1633 |
+
// abstract
|
| 1634 |
+
loadMoreIfNeeded: function () {
|
| 1635 |
+
var results = this.results,
|
| 1636 |
+
more = results.find("li.select2-more-results"),
|
| 1637 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1638 |
+
page = this.resultsPage + 1,
|
| 1639 |
+
self=this,
|
| 1640 |
+
term=this.search.val(),
|
| 1641 |
+
context=this.context;
|
| 1642 |
+
|
| 1643 |
+
if (more.length === 0) return;
|
| 1644 |
+
below = more.offset().top - results.offset().top - results.height();
|
| 1645 |
+
|
| 1646 |
+
if (below <= this.opts.loadMorePadding) {
|
| 1647 |
+
more.addClass("select2-active");
|
| 1648 |
+
this.opts.query({
|
| 1649 |
+
element: this.opts.element,
|
| 1650 |
+
term: term,
|
| 1651 |
+
page: page,
|
| 1652 |
+
context: context,
|
| 1653 |
+
matcher: this.opts.matcher,
|
| 1654 |
+
callback: this.bind(function (data) {
|
| 1655 |
+
|
| 1656 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1657 |
+
if (!self.opened()) return;
|
| 1658 |
+
|
| 1659 |
+
|
| 1660 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1661 |
+
self.postprocessResults(data, false, false);
|
| 1662 |
+
|
| 1663 |
+
if (data.more===true) {
|
| 1664 |
+
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
| 1665 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1666 |
+
} else {
|
| 1667 |
+
more.remove();
|
| 1668 |
+
}
|
| 1669 |
+
self.positionDropdown();
|
| 1670 |
+
self.resultsPage = page;
|
| 1671 |
+
self.context = data.context;
|
| 1672 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1673 |
+
})});
|
| 1674 |
+
}
|
| 1675 |
+
},
|
| 1676 |
+
|
| 1677 |
+
/**
|
| 1678 |
+
* Default tokenizer function which does nothing
|
| 1679 |
+
*/
|
| 1680 |
+
tokenize: function() {
|
| 1681 |
+
|
| 1682 |
+
},
|
| 1683 |
+
|
| 1684 |
+
/**
|
| 1685 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1686 |
+
*/
|
| 1687 |
+
// abstract
|
| 1688 |
+
updateResults: function (initial) {
|
| 1689 |
+
var search = this.search,
|
| 1690 |
+
results = this.results,
|
| 1691 |
+
opts = this.opts,
|
| 1692 |
+
data,
|
| 1693 |
+
self = this,
|
| 1694 |
+
input,
|
| 1695 |
+
term = search.val(),
|
| 1696 |
+
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1697 |
+
// sequence number used to drop out-of-order responses
|
| 1698 |
+
queryNumber;
|
| 1699 |
+
|
| 1700 |
+
// prevent duplicate queries against the same term
|
| 1701 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1702 |
+
|
| 1703 |
+
$.data(this.container, "select2-last-term", term);
|
| 1704 |
+
|
| 1705 |
+
// if the search is currently hidden we do not alter the results
|
| 1706 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1707 |
+
return;
|
| 1708 |
+
}
|
| 1709 |
+
|
| 1710 |
+
function postRender() {
|
| 1711 |
+
search.removeClass("select2-active");
|
| 1712 |
+
self.positionDropdown();
|
| 1713 |
+
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1714 |
+
self.liveRegion.text(results.text());
|
| 1715 |
+
}
|
| 1716 |
+
else {
|
| 1717 |
+
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
| 1718 |
+
}
|
| 1719 |
+
}
|
| 1720 |
+
|
| 1721 |
+
function render(html) {
|
| 1722 |
+
results.html(html);
|
| 1723 |
+
postRender();
|
| 1724 |
+
}
|
| 1725 |
+
|
| 1726 |
+
queryNumber = ++this.queryCount;
|
| 1727 |
+
|
| 1728 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
| 1729 |
+
if (maxSelSize >=1) {
|
| 1730 |
+
data = this.data();
|
| 1731 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1732 |
+
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1733 |
+
return;
|
| 1734 |
+
}
|
| 1735 |
+
}
|
| 1736 |
+
|
| 1737 |
+
if (search.val().length < opts.minimumInputLength) {
|
| 1738 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1739 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1740 |
+
} else {
|
| 1741 |
+
render("");
|
| 1742 |
+
}
|
| 1743 |
+
if (initial && this.showSearch) this.showSearch(true);
|
| 1744 |
+
return;
|
| 1745 |
+
}
|
| 1746 |
+
|
| 1747 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1748 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1749 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1750 |
+
} else {
|
| 1751 |
+
render("");
|
| 1752 |
+
}
|
| 1753 |
+
return;
|
| 1754 |
+
}
|
| 1755 |
+
|
| 1756 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1757 |
+
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1758 |
+
}
|
| 1759 |
+
|
| 1760 |
+
search.addClass("select2-active");
|
| 1761 |
+
|
| 1762 |
+
this.removeHighlight();
|
| 1763 |
+
|
| 1764 |
+
// give the tokenizer a chance to pre-process the input
|
| 1765 |
+
input = this.tokenize();
|
| 1766 |
+
if (input != undefined && input != null) {
|
| 1767 |
+
search.val(input);
|
| 1768 |
+
}
|
| 1769 |
+
|
| 1770 |
+
this.resultsPage = 1;
|
| 1771 |
+
|
| 1772 |
+
opts.query({
|
| 1773 |
+
element: opts.element,
|
| 1774 |
+
term: search.val(),
|
| 1775 |
+
page: this.resultsPage,
|
| 1776 |
+
context: null,
|
| 1777 |
+
matcher: opts.matcher,
|
| 1778 |
+
callback: this.bind(function (data) {
|
| 1779 |
+
var def; // default choice
|
| 1780 |
+
|
| 1781 |
+
// ignore old responses
|
| 1782 |
+
if (queryNumber != this.queryCount) {
|
| 1783 |
+
return;
|
| 1784 |
+
}
|
| 1785 |
+
|
| 1786 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1787 |
+
if (!this.opened()) {
|
| 1788 |
+
this.search.removeClass("select2-active");
|
| 1789 |
+
return;
|
| 1790 |
+
}
|
| 1791 |
+
|
| 1792 |
+
// handle ajax error
|
| 1793 |
+
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1794 |
+
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1795 |
+
return;
|
| 1796 |
+
}
|
| 1797 |
+
|
| 1798 |
+
// save context, if any
|
| 1799 |
+
this.context = (data.context===undefined) ? null : data.context;
|
| 1800 |
+
// create a default choice and prepend it to the list
|
| 1801 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1802 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1803 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1804 |
+
if ($(data.results).filter(
|
| 1805 |
+
function () {
|
| 1806 |
+
return equal(self.id(this), self.id(def));
|
| 1807 |
+
}).length === 0) {
|
| 1808 |
+
this.opts.createSearchChoicePosition(data.results, def);
|
| 1809 |
+
}
|
| 1810 |
+
}
|
| 1811 |
+
}
|
| 1812 |
+
|
| 1813 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1814 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1815 |
+
return;
|
| 1816 |
+
}
|
| 1817 |
+
|
| 1818 |
+
results.empty();
|
| 1819 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1820 |
+
|
| 1821 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1822 |
+
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1823 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1824 |
+
}
|
| 1825 |
+
|
| 1826 |
+
this.postprocessResults(data, initial);
|
| 1827 |
+
|
| 1828 |
+
postRender();
|
| 1829 |
+
|
| 1830 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1831 |
+
})});
|
| 1832 |
+
},
|
| 1833 |
+
|
| 1834 |
+
// abstract
|
| 1835 |
+
cancel: function () {
|
| 1836 |
+
this.close();
|
| 1837 |
+
},
|
| 1838 |
+
|
| 1839 |
+
// abstract
|
| 1840 |
+
blur: function () {
|
| 1841 |
+
// if selectOnBlur == true, select the currently highlighted option
|
| 1842 |
+
if (this.opts.selectOnBlur)
|
| 1843 |
+
this.selectHighlighted({noFocus: true});
|
| 1844 |
+
|
| 1845 |
+
this.close();
|
| 1846 |
+
this.container.removeClass("select2-container-active");
|
| 1847 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1848 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1849 |
+
this.clearSearch();
|
| 1850 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1851 |
+
},
|
| 1852 |
+
|
| 1853 |
+
// abstract
|
| 1854 |
+
focusSearch: function () {
|
| 1855 |
+
focus(this.search);
|
| 1856 |
+
},
|
| 1857 |
+
|
| 1858 |
+
// abstract
|
| 1859 |
+
selectHighlighted: function (options) {
|
| 1860 |
+
if (this._touchMoved) {
|
| 1861 |
+
this.clearTouchMoved();
|
| 1862 |
+
return;
|
| 1863 |
+
}
|
| 1864 |
+
var index=this.highlight(),
|
| 1865 |
+
highlighted=this.results.find(".select2-highlighted"),
|
| 1866 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1867 |
+
|
| 1868 |
+
if (data) {
|
| 1869 |
+
this.highlight(index);
|
| 1870 |
+
this.onSelect(data, options);
|
| 1871 |
+
} else if (options && options.noFocus) {
|
| 1872 |
+
this.close();
|
| 1873 |
+
}
|
| 1874 |
+
},
|
| 1875 |
+
|
| 1876 |
+
// abstract
|
| 1877 |
+
getPlaceholder: function () {
|
| 1878 |
+
var placeholderOption;
|
| 1879 |
+
return this.opts.element.attr("placeholder") ||
|
| 1880 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1881 |
+
this.opts.element.data("placeholder") ||
|
| 1882 |
+
this.opts.placeholder ||
|
| 1883 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1884 |
+
},
|
| 1885 |
+
|
| 1886 |
+
// abstract
|
| 1887 |
+
getPlaceholderOption: function() {
|
| 1888 |
+
if (this.select) {
|
| 1889 |
+
var firstOption = this.select.children('option').first();
|
| 1890 |
+
if (this.opts.placeholderOption !== undefined ) {
|
| 1891 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1892 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1893 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1894 |
+
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1895 |
+
//No explicit placeholder option specified, use the first if it's blank
|
| 1896 |
+
return firstOption;
|
| 1897 |
+
}
|
| 1898 |
+
}
|
| 1899 |
+
},
|
| 1900 |
+
|
| 1901 |
+
/**
|
| 1902 |
+
* Get the desired width for the container element. This is
|
| 1903 |
+
* derived first from option `width` passed to select2, then
|
| 1904 |
+
* the inline 'style' on the original element, and finally
|
| 1905 |
+
* falls back to the jQuery calculated element width.
|
| 1906 |
+
*/
|
| 1907 |
+
// abstract
|
| 1908 |
+
initContainerWidth: function () {
|
| 1909 |
+
function resolveContainerWidth() {
|
| 1910 |
+
var style, attrs, matches, i, l, attr;
|
| 1911 |
+
|
| 1912 |
+
if (this.opts.width === "off") {
|
| 1913 |
+
return null;
|
| 1914 |
+
} else if (this.opts.width === "element"){
|
| 1915 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1916 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1917 |
+
// check if there is inline style on the element that contains width
|
| 1918 |
+
style = this.opts.element.attr('style');
|
| 1919 |
+
if (style !== undefined) {
|
| 1920 |
+
attrs = style.split(';');
|
| 1921 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1922 |
+
attr = attrs[i].replace(/\s/g, '');
|
| 1923 |
+
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1924 |
+
if (matches !== null && matches.length >= 1)
|
| 1925 |
+
return matches[1];
|
| 1926 |
+
}
|
| 1927 |
+
}
|
| 1928 |
+
|
| 1929 |
+
if (this.opts.width === "resolve") {
|
| 1930 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1931 |
+
// when attached to input type=hidden or elements hidden via css
|
| 1932 |
+
style = this.opts.element.css('width');
|
| 1933 |
+
if (style.indexOf("%") > 0) return style;
|
| 1934 |
+
|
| 1935 |
+
// finally, fallback on the calculated width of the element
|
| 1936 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1937 |
+
}
|
| 1938 |
+
|
| 1939 |
+
return null;
|
| 1940 |
+
} else if ($.isFunction(this.opts.width)) {
|
| 1941 |
+
return this.opts.width();
|
| 1942 |
+
} else {
|
| 1943 |
+
return this.opts.width;
|
| 1944 |
+
}
|
| 1945 |
+
};
|
| 1946 |
+
|
| 1947 |
+
var width = resolveContainerWidth.call(this);
|
| 1948 |
+
if (width !== null) {
|
| 1949 |
+
this.container.css("width", width);
|
| 1950 |
+
}
|
| 1951 |
+
}
|
| 1952 |
+
});
|
| 1953 |
+
|
| 1954 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1955 |
+
|
| 1956 |
+
// single
|
| 1957 |
+
|
| 1958 |
+
createContainer: function () {
|
| 1959 |
+
var container = $(document.createElement("div")).attr({
|
| 1960 |
+
"class": "select2-container"
|
| 1961 |
+
}).html([
|
| 1962 |
+
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1963 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1964 |
+
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1965 |
+
"</a>",
|
| 1966 |
+
"<label for='' class='select2-offscreen'></label>",
|
| 1967 |
+
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1968 |
+
"<div class='select2-drop select2-display-none'>",
|
| 1969 |
+
" <div class='select2-search'>",
|
| 1970 |
+
" <label for='' class='select2-offscreen'></label>",
|
| 1971 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1972 |
+
" aria-autocomplete='list' />",
|
| 1973 |
+
" </div>",
|
| 1974 |
+
" <ul class='select2-results' role='listbox'>",
|
| 1975 |
+
" </ul>",
|
| 1976 |
+
"</div>"].join(""));
|
| 1977 |
+
return container;
|
| 1978 |
+
},
|
| 1979 |
+
|
| 1980 |
+
// single
|
| 1981 |
+
enableInterface: function() {
|
| 1982 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1983 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1984 |
+
}
|
| 1985 |
+
},
|
| 1986 |
+
|
| 1987 |
+
// single
|
| 1988 |
+
opening: function () {
|
| 1989 |
+
var el, range, len;
|
| 1990 |
+
|
| 1991 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1992 |
+
this.showSearch(true);
|
| 1993 |
+
}
|
| 1994 |
+
|
| 1995 |
+
this.parent.opening.apply(this, arguments);
|
| 1996 |
+
|
| 1997 |
+
if (this.showSearchInput !== false) {
|
| 1998 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1999 |
+
// all other browsers handle this just fine
|
| 2000 |
+
|
| 2001 |
+
this.search.val(this.focusser.val());
|
| 2002 |
+
}
|
| 2003 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2004 |
+
this.search.focus();
|
| 2005 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 2006 |
+
// new text will appear *before* focusser.val()
|
| 2007 |
+
el = this.search.get(0);
|
| 2008 |
+
if (el.createTextRange) {
|
| 2009 |
+
range = el.createTextRange();
|
| 2010 |
+
range.collapse(false);
|
| 2011 |
+
range.select();
|
| 2012 |
+
} else if (el.setSelectionRange) {
|
| 2013 |
+
len = this.search.val().length;
|
| 2014 |
+
el.setSelectionRange(len, len);
|
| 2015 |
+
}
|
| 2016 |
+
}
|
| 2017 |
+
|
| 2018 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2019 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2020 |
+
if(this.search.val() === "") {
|
| 2021 |
+
if(this.nextSearchTerm != undefined){
|
| 2022 |
+
this.search.val(this.nextSearchTerm);
|
| 2023 |
+
this.search.select();
|
| 2024 |
+
}
|
| 2025 |
+
}
|
| 2026 |
+
|
| 2027 |
+
this.focusser.prop("disabled", true).val("");
|
| 2028 |
+
this.updateResults(true);
|
| 2029 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 2030 |
+
},
|
| 2031 |
+
|
| 2032 |
+
// single
|
| 2033 |
+
close: function () {
|
| 2034 |
+
if (!this.opened()) return;
|
| 2035 |
+
this.parent.close.apply(this, arguments);
|
| 2036 |
+
|
| 2037 |
+
this.focusser.prop("disabled", false);
|
| 2038 |
+
|
| 2039 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2040 |
+
this.focusser.focus();
|
| 2041 |
+
}
|
| 2042 |
+
},
|
| 2043 |
+
|
| 2044 |
+
// single
|
| 2045 |
+
focus: function () {
|
| 2046 |
+
if (this.opened()) {
|
| 2047 |
+
this.close();
|
| 2048 |
+
} else {
|
| 2049 |
+
this.focusser.prop("disabled", false);
|
| 2050 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2051 |
+
this.focusser.focus();
|
| 2052 |
+
}
|
| 2053 |
+
}
|
| 2054 |
+
},
|
| 2055 |
+
|
| 2056 |
+
// single
|
| 2057 |
+
isFocused: function () {
|
| 2058 |
+
return this.container.hasClass("select2-container-active");
|
| 2059 |
+
},
|
| 2060 |
+
|
| 2061 |
+
// single
|
| 2062 |
+
cancel: function () {
|
| 2063 |
+
this.parent.cancel.apply(this, arguments);
|
| 2064 |
+
this.focusser.prop("disabled", false);
|
| 2065 |
+
|
| 2066 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2067 |
+
this.focusser.focus();
|
| 2068 |
+
}
|
| 2069 |
+
},
|
| 2070 |
+
|
| 2071 |
+
// single
|
| 2072 |
+
destroy: function() {
|
| 2073 |
+
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2074 |
+
.attr('for', this.opts.element.attr("id"));
|
| 2075 |
+
this.parent.destroy.apply(this, arguments);
|
| 2076 |
+
|
| 2077 |
+
cleanupJQueryElements.call(this,
|
| 2078 |
+
"selection",
|
| 2079 |
+
"focusser"
|
| 2080 |
+
);
|
| 2081 |
+
},
|
| 2082 |
+
|
| 2083 |
+
// single
|
| 2084 |
+
initContainer: function () {
|
| 2085 |
+
|
| 2086 |
+
var selection,
|
| 2087 |
+
container = this.container,
|
| 2088 |
+
dropdown = this.dropdown,
|
| 2089 |
+
idSuffix = nextUid(),
|
| 2090 |
+
elementLabel;
|
| 2091 |
+
|
| 2092 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
| 2093 |
+
this.showSearch(false);
|
| 2094 |
+
} else {
|
| 2095 |
+
this.showSearch(true);
|
| 2096 |
+
}
|
| 2097 |
+
|
| 2098 |
+
this.selection = selection = container.find(".select2-choice");
|
| 2099 |
+
|
| 2100 |
+
this.focusser = container.find(".select2-focusser");
|
| 2101 |
+
|
| 2102 |
+
// add aria associations
|
| 2103 |
+
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2104 |
+
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2105 |
+
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2106 |
+
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2107 |
+
|
| 2108 |
+
// rewrite labels from original element to focusser
|
| 2109 |
+
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2110 |
+
|
| 2111 |
+
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2112 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2113 |
+
|
| 2114 |
+
this.focusser.prev()
|
| 2115 |
+
.text(elementLabel.text())
|
| 2116 |
+
.attr('for', this.focusser.attr('id'));
|
| 2117 |
+
|
| 2118 |
+
// Ensure the original element retains an accessible name
|
| 2119 |
+
var originalTitle = this.opts.element.attr("title");
|
| 2120 |
+
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2121 |
+
|
| 2122 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2123 |
+
|
| 2124 |
+
// write label for search field using the label from the focusser element
|
| 2125 |
+
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2126 |
+
|
| 2127 |
+
this.search.prev()
|
| 2128 |
+
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2129 |
+
.attr('for', this.search.attr('id'));
|
| 2130 |
+
|
| 2131 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 2132 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2133 |
+
|
| 2134 |
+
// filter 229 keyCodes (input method editor is processing key input)
|
| 2135 |
+
if (229 == e.keyCode) return;
|
| 2136 |
+
|
| 2137 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2138 |
+
// prevent the page from scrolling
|
| 2139 |
+
killEvent(e);
|
| 2140 |
+
return;
|
| 2141 |
+
}
|
| 2142 |
+
|
| 2143 |
+
switch (e.which) {
|
| 2144 |
+
case KEY.UP:
|
| 2145 |
+
case KEY.DOWN:
|
| 2146 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2147 |
+
killEvent(e);
|
| 2148 |
+
return;
|
| 2149 |
+
case KEY.ENTER:
|
| 2150 |
+
this.selectHighlighted();
|
| 2151 |
+
killEvent(e);
|
| 2152 |
+
return;
|
| 2153 |
+
case KEY.TAB:
|
| 2154 |
+
this.selectHighlighted({noFocus: true});
|
| 2155 |
+
return;
|
| 2156 |
+
case KEY.ESC:
|
| 2157 |
+
this.cancel(e);
|
| 2158 |
+
killEvent(e);
|
| 2159 |
+
return;
|
| 2160 |
+
}
|
| 2161 |
+
}));
|
| 2162 |
+
|
| 2163 |
+
this.search.on("blur", this.bind(function(e) {
|
| 2164 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2165 |
+
// without this the search field loses focus which is annoying
|
| 2166 |
+
if (document.activeElement === this.body.get(0)) {
|
| 2167 |
+
window.setTimeout(this.bind(function() {
|
| 2168 |
+
if (this.opened()) {
|
| 2169 |
+
this.search.focus();
|
| 2170 |
+
}
|
| 2171 |
+
}), 0);
|
| 2172 |
+
}
|
| 2173 |
+
}));
|
| 2174 |
+
|
| 2175 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
| 2176 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2177 |
+
|
| 2178 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2179 |
+
return;
|
| 2180 |
+
}
|
| 2181 |
+
|
| 2182 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2183 |
+
killEvent(e);
|
| 2184 |
+
return;
|
| 2185 |
+
}
|
| 2186 |
+
|
| 2187 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2188 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2189 |
+
|
| 2190 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2191 |
+
|
| 2192 |
+
this.open();
|
| 2193 |
+
killEvent(e);
|
| 2194 |
+
return;
|
| 2195 |
+
}
|
| 2196 |
+
|
| 2197 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2198 |
+
if (this.opts.allowClear) {
|
| 2199 |
+
this.clear();
|
| 2200 |
+
}
|
| 2201 |
+
killEvent(e);
|
| 2202 |
+
return;
|
| 2203 |
+
}
|
| 2204 |
+
}));
|
| 2205 |
+
|
| 2206 |
+
|
| 2207 |
+
installKeyUpChangeEvent(this.focusser);
|
| 2208 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2209 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2210 |
+
e.stopPropagation();
|
| 2211 |
+
if (this.opened()) return;
|
| 2212 |
+
this.open();
|
| 2213 |
+
}
|
| 2214 |
+
}));
|
| 2215 |
+
|
| 2216 |
+
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2217 |
+
if (!this.isInterfaceEnabled()) {
|
| 2218 |
+
return;
|
| 2219 |
+
}
|
| 2220 |
+
|
| 2221 |
+
this.clear();
|
| 2222 |
+
killEventImmediately(e);
|
| 2223 |
+
this.close();
|
| 2224 |
+
|
| 2225 |
+
if (this.selection) {
|
| 2226 |
+
this.selection.focus();
|
| 2227 |
+
}
|
| 2228 |
+
}));
|
| 2229 |
+
|
| 2230 |
+
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2231 |
+
// Prevent IE from generating a click event on the body
|
| 2232 |
+
reinsertElement(selection);
|
| 2233 |
+
|
| 2234 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2235 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2236 |
+
}
|
| 2237 |
+
|
| 2238 |
+
if (this.opened()) {
|
| 2239 |
+
this.close();
|
| 2240 |
+
} else if (this.isInterfaceEnabled()) {
|
| 2241 |
+
this.open();
|
| 2242 |
+
}
|
| 2243 |
+
|
| 2244 |
+
killEvent(e);
|
| 2245 |
+
}));
|
| 2246 |
+
|
| 2247 |
+
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2248 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2249 |
+
this.search.focus();
|
| 2250 |
+
}
|
| 2251 |
+
}));
|
| 2252 |
+
|
| 2253 |
+
selection.on("focus", this.bind(function(e) {
|
| 2254 |
+
killEvent(e);
|
| 2255 |
+
}));
|
| 2256 |
+
|
| 2257 |
+
this.focusser.on("focus", this.bind(function(){
|
| 2258 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2259 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2260 |
+
}
|
| 2261 |
+
this.container.addClass("select2-container-active");
|
| 2262 |
+
})).on("blur", this.bind(function() {
|
| 2263 |
+
if (!this.opened()) {
|
| 2264 |
+
this.container.removeClass("select2-container-active");
|
| 2265 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 2266 |
+
}
|
| 2267 |
+
}));
|
| 2268 |
+
this.search.on("focus", this.bind(function(){
|
| 2269 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2270 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2271 |
+
}
|
| 2272 |
+
this.container.addClass("select2-container-active");
|
| 2273 |
+
}));
|
| 2274 |
+
|
| 2275 |
+
this.initContainerWidth();
|
| 2276 |
+
this.opts.element.hide();
|
| 2277 |
+
this.setPlaceholder();
|
| 2278 |
+
|
| 2279 |
+
},
|
| 2280 |
+
|
| 2281 |
+
// single
|
| 2282 |
+
clear: function(triggerChange) {
|
| 2283 |
+
var data=this.selection.data("select2-data");
|
| 2284 |
+
if (data) { // guard against queued quick consecutive clicks
|
| 2285 |
+
var evt = $.Event("select2-clearing");
|
| 2286 |
+
this.opts.element.trigger(evt);
|
| 2287 |
+
if (evt.isDefaultPrevented()) {
|
| 2288 |
+
return;
|
| 2289 |
+
}
|
| 2290 |
+
var placeholderOption = this.getPlaceholderOption();
|
| 2291 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2292 |
+
this.selection.find(".select2-chosen").empty();
|
| 2293 |
+
this.selection.removeData("select2-data");
|
| 2294 |
+
this.setPlaceholder();
|
| 2295 |
+
|
| 2296 |
+
if (triggerChange !== false){
|
| 2297 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2298 |
+
this.triggerChange({removed:data});
|
| 2299 |
+
}
|
| 2300 |
+
}
|
| 2301 |
+
},
|
| 2302 |
+
|
| 2303 |
+
/**
|
| 2304 |
+
* Sets selection based on source element's value
|
| 2305 |
+
*/
|
| 2306 |
+
// single
|
| 2307 |
+
initSelection: function () {
|
| 2308 |
+
var selected;
|
| 2309 |
+
if (this.isPlaceholderOptionSelected()) {
|
| 2310 |
+
this.updateSelection(null);
|
| 2311 |
+
this.close();
|
| 2312 |
+
this.setPlaceholder();
|
| 2313 |
+
} else {
|
| 2314 |
+
var self = this;
|
| 2315 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2316 |
+
if (selected !== undefined && selected !== null) {
|
| 2317 |
+
self.updateSelection(selected);
|
| 2318 |
+
self.close();
|
| 2319 |
+
self.setPlaceholder();
|
| 2320 |
+
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2321 |
+
}
|
| 2322 |
+
});
|
| 2323 |
+
}
|
| 2324 |
+
},
|
| 2325 |
+
|
| 2326 |
+
isPlaceholderOptionSelected: function() {
|
| 2327 |
+
var placeholderOption;
|
| 2328 |
+
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2329 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2330 |
+
|| (this.opts.element.val() === "")
|
| 2331 |
+
|| (this.opts.element.val() === undefined)
|
| 2332 |
+
|| (this.opts.element.val() === null);
|
| 2333 |
+
},
|
| 2334 |
+
|
| 2335 |
+
// single
|
| 2336 |
+
prepareOpts: function () {
|
| 2337 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2338 |
+
self=this;
|
| 2339 |
+
|
| 2340 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2341 |
+
// install the selection initializer
|
| 2342 |
+
opts.initSelection = function (element, callback) {
|
| 2343 |
+
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2344 |
+
// a single select box always has a value, no need to null check 'selected'
|
| 2345 |
+
callback(self.optionToData(selected));
|
| 2346 |
+
};
|
| 2347 |
+
} else if ("data" in opts) {
|
| 2348 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2349 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2350 |
+
var id = element.val();
|
| 2351 |
+
//search in data by id, storing the actual matching item
|
| 2352 |
+
var match = null;
|
| 2353 |
+
opts.query({
|
| 2354 |
+
matcher: function(term, text, el){
|
| 2355 |
+
var is_match = equal(id, opts.id(el));
|
| 2356 |
+
if (is_match) {
|
| 2357 |
+
match = el;
|
| 2358 |
+
}
|
| 2359 |
+
return is_match;
|
| 2360 |
+
},
|
| 2361 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2362 |
+
callback(match);
|
| 2363 |
+
}
|
| 2364 |
+
});
|
| 2365 |
+
};
|
| 2366 |
+
}
|
| 2367 |
+
|
| 2368 |
+
return opts;
|
| 2369 |
+
},
|
| 2370 |
+
|
| 2371 |
+
// single
|
| 2372 |
+
getPlaceholder: function() {
|
| 2373 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2374 |
+
if (this.select) {
|
| 2375 |
+
if (this.getPlaceholderOption() === undefined) {
|
| 2376 |
+
return undefined;
|
| 2377 |
+
}
|
| 2378 |
+
}
|
| 2379 |
+
|
| 2380 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2381 |
+
},
|
| 2382 |
+
|
| 2383 |
+
// single
|
| 2384 |
+
setPlaceholder: function () {
|
| 2385 |
+
var placeholder = this.getPlaceholder();
|
| 2386 |
+
|
| 2387 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2388 |
+
|
| 2389 |
+
// check for a placeholder option if attached to a select
|
| 2390 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2391 |
+
|
| 2392 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2393 |
+
|
| 2394 |
+
this.selection.addClass("select2-default");
|
| 2395 |
+
|
| 2396 |
+
this.container.removeClass("select2-allowclear");
|
| 2397 |
+
}
|
| 2398 |
+
},
|
| 2399 |
+
|
| 2400 |
+
// single
|
| 2401 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2402 |
+
var selected = 0, self = this, showSearchInput = true;
|
| 2403 |
+
|
| 2404 |
+
// find the selected element in the result list
|
| 2405 |
+
|
| 2406 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2407 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2408 |
+
selected = i;
|
| 2409 |
+
return false;
|
| 2410 |
+
}
|
| 2411 |
+
});
|
| 2412 |
+
|
| 2413 |
+
// and highlight it
|
| 2414 |
+
if (noHighlightUpdate !== false) {
|
| 2415 |
+
if (initial === true && selected >= 0) {
|
| 2416 |
+
this.highlight(selected);
|
| 2417 |
+
} else {
|
| 2418 |
+
this.highlight(0);
|
| 2419 |
+
}
|
| 2420 |
+
}
|
| 2421 |
+
|
| 2422 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2423 |
+
|
| 2424 |
+
if (initial === true) {
|
| 2425 |
+
var min = this.opts.minimumResultsForSearch;
|
| 2426 |
+
if (min >= 0) {
|
| 2427 |
+
this.showSearch(countResults(data.results) >= min);
|
| 2428 |
+
}
|
| 2429 |
+
}
|
| 2430 |
+
},
|
| 2431 |
+
|
| 2432 |
+
// single
|
| 2433 |
+
showSearch: function(showSearchInput) {
|
| 2434 |
+
if (this.showSearchInput === showSearchInput) return;
|
| 2435 |
+
|
| 2436 |
+
this.showSearchInput = showSearchInput;
|
| 2437 |
+
|
| 2438 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2439 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2440 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
| 2441 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2442 |
+
},
|
| 2443 |
+
|
| 2444 |
+
// single
|
| 2445 |
+
onSelect: function (data, options) {
|
| 2446 |
+
|
| 2447 |
+
if (!this.triggerSelect(data)) { return; }
|
| 2448 |
+
|
| 2449 |
+
var old = this.opts.element.val(),
|
| 2450 |
+
oldData = this.data();
|
| 2451 |
+
|
| 2452 |
+
this.opts.element.val(this.id(data));
|
| 2453 |
+
this.updateSelection(data);
|
| 2454 |
+
|
| 2455 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2456 |
+
|
| 2457 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2458 |
+
this.close();
|
| 2459 |
+
|
| 2460 |
+
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2461 |
+
this.focusser.focus();
|
| 2462 |
+
}
|
| 2463 |
+
|
| 2464 |
+
if (!equal(old, this.id(data))) {
|
| 2465 |
+
this.triggerChange({ added: data, removed: oldData });
|
| 2466 |
+
}
|
| 2467 |
+
},
|
| 2468 |
+
|
| 2469 |
+
// single
|
| 2470 |
+
updateSelection: function (data) {
|
| 2471 |
+
|
| 2472 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2473 |
+
|
| 2474 |
+
this.selection.data("select2-data", data);
|
| 2475 |
+
|
| 2476 |
+
container.empty();
|
| 2477 |
+
if (data !== null) {
|
| 2478 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2479 |
+
}
|
| 2480 |
+
if (formatted !== undefined) {
|
| 2481 |
+
container.append(formatted);
|
| 2482 |
+
}
|
| 2483 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2484 |
+
if (cssClass !== undefined) {
|
| 2485 |
+
container.addClass(cssClass);
|
| 2486 |
+
}
|
| 2487 |
+
|
| 2488 |
+
this.selection.removeClass("select2-default");
|
| 2489 |
+
|
| 2490 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2491 |
+
this.container.addClass("select2-allowclear");
|
| 2492 |
+
}
|
| 2493 |
+
},
|
| 2494 |
+
|
| 2495 |
+
// single
|
| 2496 |
+
val: function () {
|
| 2497 |
+
var val,
|
| 2498 |
+
triggerChange = false,
|
| 2499 |
+
data = null,
|
| 2500 |
+
self = this,
|
| 2501 |
+
oldData = this.data();
|
| 2502 |
+
|
| 2503 |
+
if (arguments.length === 0) {
|
| 2504 |
+
return this.opts.element.val();
|
| 2505 |
+
}
|
| 2506 |
+
|
| 2507 |
+
val = arguments[0];
|
| 2508 |
+
|
| 2509 |
+
if (arguments.length > 1) {
|
| 2510 |
+
triggerChange = arguments[1];
|
| 2511 |
+
}
|
| 2512 |
+
|
| 2513 |
+
if (this.select) {
|
| 2514 |
+
this.select
|
| 2515 |
+
.val(val)
|
| 2516 |
+
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2517 |
+
data = self.optionToData(elm);
|
| 2518 |
+
return false;
|
| 2519 |
+
});
|
| 2520 |
+
this.updateSelection(data);
|
| 2521 |
+
this.setPlaceholder();
|
| 2522 |
+
if (triggerChange) {
|
| 2523 |
+
this.triggerChange({added: data, removed:oldData});
|
| 2524 |
+
}
|
| 2525 |
+
} else {
|
| 2526 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2527 |
+
if (!val && val !== 0) {
|
| 2528 |
+
this.clear(triggerChange);
|
| 2529 |
+
return;
|
| 2530 |
+
}
|
| 2531 |
+
if (this.opts.initSelection === undefined) {
|
| 2532 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2533 |
+
}
|
| 2534 |
+
this.opts.element.val(val);
|
| 2535 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 2536 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
| 2537 |
+
self.updateSelection(data);
|
| 2538 |
+
self.setPlaceholder();
|
| 2539 |
+
if (triggerChange) {
|
| 2540 |
+
self.triggerChange({added: data, removed:oldData});
|
| 2541 |
+
}
|
| 2542 |
+
});
|
| 2543 |
+
}
|
| 2544 |
+
},
|
| 2545 |
+
|
| 2546 |
+
// single
|
| 2547 |
+
clearSearch: function () {
|
| 2548 |
+
this.search.val("");
|
| 2549 |
+
this.focusser.val("");
|
| 2550 |
+
},
|
| 2551 |
+
|
| 2552 |
+
// single
|
| 2553 |
+
data: function(value) {
|
| 2554 |
+
var data,
|
| 2555 |
+
triggerChange = false;
|
| 2556 |
+
|
| 2557 |
+
if (arguments.length === 0) {
|
| 2558 |
+
data = this.selection.data("select2-data");
|
| 2559 |
+
if (data == undefined) data = null;
|
| 2560 |
+
return data;
|
| 2561 |
+
} else {
|
| 2562 |
+
if (arguments.length > 1) {
|
| 2563 |
+
triggerChange = arguments[1];
|
| 2564 |
+
}
|
| 2565 |
+
if (!value) {
|
| 2566 |
+
this.clear(triggerChange);
|
| 2567 |
+
} else {
|
| 2568 |
+
data = this.data();
|
| 2569 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
| 2570 |
+
this.updateSelection(value);
|
| 2571 |
+
if (triggerChange) {
|
| 2572 |
+
this.triggerChange({added: value, removed:data});
|
| 2573 |
+
}
|
| 2574 |
+
}
|
| 2575 |
+
}
|
| 2576 |
+
}
|
| 2577 |
+
});
|
| 2578 |
+
|
| 2579 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2580 |
+
|
| 2581 |
+
// multi
|
| 2582 |
+
createContainer: function () {
|
| 2583 |
+
var container = $(document.createElement("div")).attr({
|
| 2584 |
+
"class": "select2-container select2-container-multi"
|
| 2585 |
+
}).html([
|
| 2586 |
+
"<ul class='select2-choices'>",
|
| 2587 |
+
" <li class='select2-search-field'>",
|
| 2588 |
+
" <label for='' class='select2-offscreen'></label>",
|
| 2589 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2590 |
+
" </li>",
|
| 2591 |
+
"</ul>",
|
| 2592 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2593 |
+
" <ul class='select2-results'>",
|
| 2594 |
+
" </ul>",
|
| 2595 |
+
"</div>"].join(""));
|
| 2596 |
+
return container;
|
| 2597 |
+
},
|
| 2598 |
+
|
| 2599 |
+
// multi
|
| 2600 |
+
prepareOpts: function () {
|
| 2601 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2602 |
+
self=this;
|
| 2603 |
+
|
| 2604 |
+
// TODO validate placeholder is a string if specified
|
| 2605 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2606 |
+
// install the selection initializer
|
| 2607 |
+
opts.initSelection = function (element, callback) {
|
| 2608 |
+
|
| 2609 |
+
var data = [];
|
| 2610 |
+
|
| 2611 |
+
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2612 |
+
data.push(self.optionToData(elm));
|
| 2613 |
+
});
|
| 2614 |
+
callback(data);
|
| 2615 |
+
};
|
| 2616 |
+
} else if ("data" in opts) {
|
| 2617 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2618 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2619 |
+
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
| 2620 |
+
//search in data by array of ids, storing matching items in a list
|
| 2621 |
+
var matches = [];
|
| 2622 |
+
opts.query({
|
| 2623 |
+
matcher: function(term, text, el){
|
| 2624 |
+
var is_match = $.grep(ids, function(id) {
|
| 2625 |
+
return equal(id, opts.id(el));
|
| 2626 |
+
}).length;
|
| 2627 |
+
if (is_match) {
|
| 2628 |
+
matches.push(el);
|
| 2629 |
+
}
|
| 2630 |
+
return is_match;
|
| 2631 |
+
},
|
| 2632 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2633 |
+
// reorder matches based on the order they appear in the ids array because right now
|
| 2634 |
+
// they are in the order in which they appear in data array
|
| 2635 |
+
var ordered = [];
|
| 2636 |
+
for (var i = 0; i < ids.length; i++) {
|
| 2637 |
+
var id = ids[i];
|
| 2638 |
+
for (var j = 0; j < matches.length; j++) {
|
| 2639 |
+
var match = matches[j];
|
| 2640 |
+
if (equal(id, opts.id(match))) {
|
| 2641 |
+
ordered.push(match);
|
| 2642 |
+
matches.splice(j, 1);
|
| 2643 |
+
break;
|
| 2644 |
+
}
|
| 2645 |
+
}
|
| 2646 |
+
}
|
| 2647 |
+
callback(ordered);
|
| 2648 |
+
}
|
| 2649 |
+
});
|
| 2650 |
+
};
|
| 2651 |
+
}
|
| 2652 |
+
|
| 2653 |
+
return opts;
|
| 2654 |
+
},
|
| 2655 |
+
|
| 2656 |
+
// multi
|
| 2657 |
+
selectChoice: function (choice) {
|
| 2658 |
+
|
| 2659 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
| 2660 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2661 |
+
|
| 2662 |
+
} else {
|
| 2663 |
+
if (selected.length) {
|
| 2664 |
+
this.opts.element.trigger("choice-deselected", selected);
|
| 2665 |
+
}
|
| 2666 |
+
selected.removeClass("select2-search-choice-focus");
|
| 2667 |
+
if (choice && choice.length) {
|
| 2668 |
+
this.close();
|
| 2669 |
+
choice.addClass("select2-search-choice-focus");
|
| 2670 |
+
this.opts.element.trigger("choice-selected", choice);
|
| 2671 |
+
}
|
| 2672 |
+
}
|
| 2673 |
+
},
|
| 2674 |
+
|
| 2675 |
+
// multi
|
| 2676 |
+
destroy: function() {
|
| 2677 |
+
$("label[for='" + this.search.attr('id') + "']")
|
| 2678 |
+
.attr('for', this.opts.element.attr("id"));
|
| 2679 |
+
this.parent.destroy.apply(this, arguments);
|
| 2680 |
+
|
| 2681 |
+
cleanupJQueryElements.call(this,
|
| 2682 |
+
"searchContainer",
|
| 2683 |
+
"selection"
|
| 2684 |
+
);
|
| 2685 |
+
},
|
| 2686 |
+
|
| 2687 |
+
// multi
|
| 2688 |
+
initContainer: function () {
|
| 2689 |
+
|
| 2690 |
+
var selector = ".select2-choices", selection;
|
| 2691 |
+
|
| 2692 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
| 2693 |
+
this.selection = selection = this.container.find(selector);
|
| 2694 |
+
|
| 2695 |
+
var _this = this;
|
| 2696 |
+
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
| 2697 |
+
_this.search[0].focus();
|
| 2698 |
+
_this.selectChoice($(this));
|
| 2699 |
+
});
|
| 2700 |
+
|
| 2701 |
+
// rewrite labels from original element to focusser
|
| 2702 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2703 |
+
|
| 2704 |
+
this.search.prev()
|
| 2705 |
+
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2706 |
+
.attr('for', this.search.attr('id'));
|
| 2707 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2708 |
+
|
| 2709 |
+
this.search.on("input paste", this.bind(function() {
|
| 2710 |
+
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2711 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2712 |
+
if (!this.opened()) {
|
| 2713 |
+
this.open();
|
| 2714 |
+
}
|
| 2715 |
+
}));
|
| 2716 |
+
|
| 2717 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
| 2718 |
+
|
| 2719 |
+
this.keydowns = 0;
|
| 2720 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 2721 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2722 |
+
|
| 2723 |
+
++this.keydowns;
|
| 2724 |
+
var selected = selection.find(".select2-search-choice-focus");
|
| 2725 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2726 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2727 |
+
var pos = getCursorInfo(this.search);
|
| 2728 |
+
|
| 2729 |
+
if (selected.length &&
|
| 2730 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2731 |
+
var selectedChoice = selected;
|
| 2732 |
+
if (e.which == KEY.LEFT && prev.length) {
|
| 2733 |
+
selectedChoice = prev;
|
| 2734 |
+
}
|
| 2735 |
+
else if (e.which == KEY.RIGHT) {
|
| 2736 |
+
selectedChoice = next.length ? next : null;
|
| 2737 |
+
}
|
| 2738 |
+
else if (e.which === KEY.BACKSPACE) {
|
| 2739 |
+
if (this.unselect(selected.first())) {
|
| 2740 |
+
this.search.width(10);
|
| 2741 |
+
selectedChoice = prev.length ? prev : next;
|
| 2742 |
+
}
|
| 2743 |
+
} else if (e.which == KEY.DELETE) {
|
| 2744 |
+
if (this.unselect(selected.first())) {
|
| 2745 |
+
this.search.width(10);
|
| 2746 |
+
selectedChoice = next.length ? next : null;
|
| 2747 |
+
}
|
| 2748 |
+
} else if (e.which == KEY.ENTER) {
|
| 2749 |
+
selectedChoice = null;
|
| 2750 |
+
}
|
| 2751 |
+
|
| 2752 |
+
this.selectChoice(selectedChoice);
|
| 2753 |
+
killEvent(e);
|
| 2754 |
+
if (!selectedChoice || !selectedChoice.length) {
|
| 2755 |
+
this.open();
|
| 2756 |
+
}
|
| 2757 |
+
return;
|
| 2758 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2759 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2760 |
+
|
| 2761 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2762 |
+
killEvent(e);
|
| 2763 |
+
return;
|
| 2764 |
+
} else {
|
| 2765 |
+
this.selectChoice(null);
|
| 2766 |
+
}
|
| 2767 |
+
|
| 2768 |
+
if (this.opened()) {
|
| 2769 |
+
switch (e.which) {
|
| 2770 |
+
case KEY.UP:
|
| 2771 |
+
case KEY.DOWN:
|
| 2772 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2773 |
+
killEvent(e);
|
| 2774 |
+
return;
|
| 2775 |
+
case KEY.ENTER:
|
| 2776 |
+
this.selectHighlighted();
|
| 2777 |
+
killEvent(e);
|
| 2778 |
+
return;
|
| 2779 |
+
case KEY.TAB:
|
| 2780 |
+
this.selectHighlighted({noFocus:true});
|
| 2781 |
+
this.close();
|
| 2782 |
+
return;
|
| 2783 |
+
case KEY.ESC:
|
| 2784 |
+
this.cancel(e);
|
| 2785 |
+
killEvent(e);
|
| 2786 |
+
return;
|
| 2787 |
+
}
|
| 2788 |
+
}
|
| 2789 |
+
|
| 2790 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2791 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2792 |
+
return;
|
| 2793 |
+
}
|
| 2794 |
+
|
| 2795 |
+
if (e.which === KEY.ENTER) {
|
| 2796 |
+
if (this.opts.openOnEnter === false) {
|
| 2797 |
+
return;
|
| 2798 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2799 |
+
return;
|
| 2800 |
+
}
|
| 2801 |
+
}
|
| 2802 |
+
|
| 2803 |
+
this.open();
|
| 2804 |
+
|
| 2805 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2806 |
+
// prevent the page from scrolling
|
| 2807 |
+
killEvent(e);
|
| 2808 |
+
}
|
| 2809 |
+
|
| 2810 |
+
if (e.which === KEY.ENTER) {
|
| 2811 |
+
// prevent form from being submitted
|
| 2812 |
+
killEvent(e);
|
| 2813 |
+
}
|
| 2814 |
+
|
| 2815 |
+
}));
|
| 2816 |
+
|
| 2817 |
+
this.search.on("keyup", this.bind(function (e) {
|
| 2818 |
+
this.keydowns = 0;
|
| 2819 |
+
this.resizeSearch();
|
| 2820 |
+
})
|
| 2821 |
+
);
|
| 2822 |
+
|
| 2823 |
+
this.search.on("blur", this.bind(function(e) {
|
| 2824 |
+
this.container.removeClass("select2-container-active");
|
| 2825 |
+
this.search.removeClass("select2-focused");
|
| 2826 |
+
this.selectChoice(null);
|
| 2827 |
+
if (!this.opened()) this.clearSearch();
|
| 2828 |
+
e.stopImmediatePropagation();
|
| 2829 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 2830 |
+
}));
|
| 2831 |
+
|
| 2832 |
+
this.container.on("click", selector, this.bind(function (e) {
|
| 2833 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2834 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2835 |
+
// clicked inside a select2 search choice, do not open
|
| 2836 |
+
return;
|
| 2837 |
+
}
|
| 2838 |
+
this.selectChoice(null);
|
| 2839 |
+
this.clearPlaceholder();
|
| 2840 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2841 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2842 |
+
}
|
| 2843 |
+
this.open();
|
| 2844 |
+
this.focusSearch();
|
| 2845 |
+
e.preventDefault();
|
| 2846 |
+
}));
|
| 2847 |
+
|
| 2848 |
+
this.container.on("focus", selector, this.bind(function () {
|
| 2849 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2850 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2851 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2852 |
+
}
|
| 2853 |
+
this.container.addClass("select2-container-active");
|
| 2854 |
+
this.dropdown.addClass("select2-drop-active");
|
| 2855 |
+
this.clearPlaceholder();
|
| 2856 |
+
}));
|
| 2857 |
+
|
| 2858 |
+
this.initContainerWidth();
|
| 2859 |
+
this.opts.element.hide();
|
| 2860 |
+
|
| 2861 |
+
// set the placeholder if necessary
|
| 2862 |
+
this.clearSearch();
|
| 2863 |
+
},
|
| 2864 |
+
|
| 2865 |
+
// multi
|
| 2866 |
+
enableInterface: function() {
|
| 2867 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2868 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2869 |
+
}
|
| 2870 |
+
},
|
| 2871 |
+
|
| 2872 |
+
// multi
|
| 2873 |
+
initSelection: function () {
|
| 2874 |
+
var data;
|
| 2875 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2876 |
+
this.updateSelection([]);
|
| 2877 |
+
this.close();
|
| 2878 |
+
// set the placeholder if necessary
|
| 2879 |
+
this.clearSearch();
|
| 2880 |
+
}
|
| 2881 |
+
if (this.select || this.opts.element.val() !== "") {
|
| 2882 |
+
var self = this;
|
| 2883 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2884 |
+
if (data !== undefined && data !== null) {
|
| 2885 |
+
self.updateSelection(data);
|
| 2886 |
+
self.close();
|
| 2887 |
+
// set the placeholder if necessary
|
| 2888 |
+
self.clearSearch();
|
| 2889 |
+
}
|
| 2890 |
+
});
|
| 2891 |
+
}
|
| 2892 |
+
},
|
| 2893 |
+
|
| 2894 |
+
// multi
|
| 2895 |
+
clearSearch: function () {
|
| 2896 |
+
var placeholder = this.getPlaceholder(),
|
| 2897 |
+
maxWidth = this.getMaxSearchWidth();
|
| 2898 |
+
|
| 2899 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2900 |
+
this.search.val(placeholder).addClass("select2-default");
|
| 2901 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2902 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2903 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2904 |
+
} else {
|
| 2905 |
+
this.search.val("").width(10);
|
| 2906 |
+
}
|
| 2907 |
+
},
|
| 2908 |
+
|
| 2909 |
+
// multi
|
| 2910 |
+
clearPlaceholder: function () {
|
| 2911 |
+
if (this.search.hasClass("select2-default")) {
|
| 2912 |
+
this.search.val("").removeClass("select2-default");
|
| 2913 |
+
}
|
| 2914 |
+
},
|
| 2915 |
+
|
| 2916 |
+
// multi
|
| 2917 |
+
opening: function () {
|
| 2918 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2919 |
+
this.resizeSearch();
|
| 2920 |
+
|
| 2921 |
+
this.parent.opening.apply(this, arguments);
|
| 2922 |
+
|
| 2923 |
+
this.focusSearch();
|
| 2924 |
+
|
| 2925 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2926 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2927 |
+
if(this.search.val() === "") {
|
| 2928 |
+
if(this.nextSearchTerm != undefined){
|
| 2929 |
+
this.search.val(this.nextSearchTerm);
|
| 2930 |
+
this.search.select();
|
| 2931 |
+
}
|
| 2932 |
+
}
|
| 2933 |
+
|
| 2934 |
+
this.updateResults(true);
|
| 2935 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2936 |
+
this.search.focus();
|
| 2937 |
+
}
|
| 2938 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 2939 |
+
},
|
| 2940 |
+
|
| 2941 |
+
// multi
|
| 2942 |
+
close: function () {
|
| 2943 |
+
if (!this.opened()) return;
|
| 2944 |
+
this.parent.close.apply(this, arguments);
|
| 2945 |
+
},
|
| 2946 |
+
|
| 2947 |
+
// multi
|
| 2948 |
+
focus: function () {
|
| 2949 |
+
this.close();
|
| 2950 |
+
this.search.focus();
|
| 2951 |
+
},
|
| 2952 |
+
|
| 2953 |
+
// multi
|
| 2954 |
+
isFocused: function () {
|
| 2955 |
+
return this.search.hasClass("select2-focused");
|
| 2956 |
+
},
|
| 2957 |
+
|
| 2958 |
+
// multi
|
| 2959 |
+
updateSelection: function (data) {
|
| 2960 |
+
var ids = [], filtered = [], self = this;
|
| 2961 |
+
|
| 2962 |
+
// filter out duplicates
|
| 2963 |
+
$(data).each(function () {
|
| 2964 |
+
if (indexOf(self.id(this), ids) < 0) {
|
| 2965 |
+
ids.push(self.id(this));
|
| 2966 |
+
filtered.push(this);
|
| 2967 |
+
}
|
| 2968 |
+
});
|
| 2969 |
+
data = filtered;
|
| 2970 |
+
|
| 2971 |
+
this.selection.find(".select2-search-choice").remove();
|
| 2972 |
+
$(data).each(function () {
|
| 2973 |
+
self.addSelectedChoice(this);
|
| 2974 |
+
});
|
| 2975 |
+
self.postprocessResults();
|
| 2976 |
+
},
|
| 2977 |
+
|
| 2978 |
+
// multi
|
| 2979 |
+
tokenize: function() {
|
| 2980 |
+
var input = this.search.val();
|
| 2981 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2982 |
+
if (input != null && input != undefined) {
|
| 2983 |
+
this.search.val(input);
|
| 2984 |
+
if (input.length > 0) {
|
| 2985 |
+
this.open();
|
| 2986 |
+
}
|
| 2987 |
+
}
|
| 2988 |
+
|
| 2989 |
+
},
|
| 2990 |
+
|
| 2991 |
+
// multi
|
| 2992 |
+
onSelect: function (data, options) {
|
| 2993 |
+
|
| 2994 |
+
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2995 |
+
|
| 2996 |
+
this.addSelectedChoice(data);
|
| 2997 |
+
|
| 2998 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2999 |
+
|
| 3000 |
+
// keep track of the search's value before it gets cleared
|
| 3001 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 3002 |
+
|
| 3003 |
+
this.clearSearch();
|
| 3004 |
+
this.updateResults();
|
| 3005 |
+
|
| 3006 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 3007 |
+
|
| 3008 |
+
if (this.opts.closeOnSelect) {
|
| 3009 |
+
this.close();
|
| 3010 |
+
this.search.width(10);
|
| 3011 |
+
} else {
|
| 3012 |
+
if (this.countSelectableResults()>0) {
|
| 3013 |
+
this.search.width(10);
|
| 3014 |
+
this.resizeSearch();
|
| 3015 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 3016 |
+
// if we reached max selection size repaint the results so choices
|
| 3017 |
+
// are replaced with the max selection reached message
|
| 3018 |
+
this.updateResults(true);
|
| 3019 |
+
} else {
|
| 3020 |
+
// initializes search's value with nextSearchTerm and update search result
|
| 3021 |
+
if(this.nextSearchTerm != undefined){
|
| 3022 |
+
this.search.val(this.nextSearchTerm);
|
| 3023 |
+
this.updateResults();
|
| 3024 |
+
this.search.select();
|
| 3025 |
+
}
|
| 3026 |
+
}
|
| 3027 |
+
this.positionDropdown();
|
| 3028 |
+
} else {
|
| 3029 |
+
// if nothing left to select close
|
| 3030 |
+
this.close();
|
| 3031 |
+
this.search.width(10);
|
| 3032 |
+
}
|
| 3033 |
+
}
|
| 3034 |
+
|
| 3035 |
+
// since its not possible to select an element that has already been
|
| 3036 |
+
// added we do not need to check if this is a new element before firing change
|
| 3037 |
+
this.triggerChange({ added: data });
|
| 3038 |
+
|
| 3039 |
+
if (!options || !options.noFocus)
|
| 3040 |
+
this.focusSearch();
|
| 3041 |
+
},
|
| 3042 |
+
|
| 3043 |
+
// multi
|
| 3044 |
+
cancel: function () {
|
| 3045 |
+
this.close();
|
| 3046 |
+
this.focusSearch();
|
| 3047 |
+
},
|
| 3048 |
+
|
| 3049 |
+
addSelectedChoice: function (data) {
|
| 3050 |
+
var enableChoice = !data.locked,
|
| 3051 |
+
enabledItem = $(
|
| 3052 |
+
"<li class='select2-search-choice'>" +
|
| 3053 |
+
" <div></div>" +
|
| 3054 |
+
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3055 |
+
"</li>"),
|
| 3056 |
+
disabledItem = $(
|
| 3057 |
+
"<li class='select2-search-choice select2-locked'>" +
|
| 3058 |
+
"<div></div>" +
|
| 3059 |
+
"</li>");
|
| 3060 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3061 |
+
id = this.id(data),
|
| 3062 |
+
val = this.getVal(),
|
| 3063 |
+
formatted,
|
| 3064 |
+
cssClass;
|
| 3065 |
+
|
| 3066 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3067 |
+
if (formatted != undefined) {
|
| 3068 |
+
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
| 3069 |
+
}
|
| 3070 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3071 |
+
if (cssClass != undefined) {
|
| 3072 |
+
choice.addClass(cssClass);
|
| 3073 |
+
}
|
| 3074 |
+
|
| 3075 |
+
if(enableChoice){
|
| 3076 |
+
choice.find(".select2-search-choice-close")
|
| 3077 |
+
.on("mousedown", killEvent)
|
| 3078 |
+
.on("click dblclick", this.bind(function (e) {
|
| 3079 |
+
if (!this.isInterfaceEnabled()) return;
|
| 3080 |
+
|
| 3081 |
+
this.unselect($(e.target));
|
| 3082 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3083 |
+
killEvent(e);
|
| 3084 |
+
this.close();
|
| 3085 |
+
this.focusSearch();
|
| 3086 |
+
})).on("focus", this.bind(function () {
|
| 3087 |
+
if (!this.isInterfaceEnabled()) return;
|
| 3088 |
+
this.container.addClass("select2-container-active");
|
| 3089 |
+
this.dropdown.addClass("select2-drop-active");
|
| 3090 |
+
}));
|
| 3091 |
+
}
|
| 3092 |
+
|
| 3093 |
+
choice.data("select2-data", data);
|
| 3094 |
+
choice.insertBefore(this.searchContainer);
|
| 3095 |
+
|
| 3096 |
+
val.push(id);
|
| 3097 |
+
this.setVal(val);
|
| 3098 |
+
},
|
| 3099 |
+
|
| 3100 |
+
// multi
|
| 3101 |
+
unselect: function (selected) {
|
| 3102 |
+
var val = this.getVal(),
|
| 3103 |
+
data,
|
| 3104 |
+
index;
|
| 3105 |
+
selected = selected.closest(".select2-search-choice");
|
| 3106 |
+
|
| 3107 |
+
if (selected.length === 0) {
|
| 3108 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3109 |
+
}
|
| 3110 |
+
|
| 3111 |
+
data = selected.data("select2-data");
|
| 3112 |
+
|
| 3113 |
+
if (!data) {
|
| 3114 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3115 |
+
// and invoked on an element already removed
|
| 3116 |
+
return;
|
| 3117 |
+
}
|
| 3118 |
+
|
| 3119 |
+
var evt = $.Event("select2-removing");
|
| 3120 |
+
evt.val = this.id(data);
|
| 3121 |
+
evt.choice = data;
|
| 3122 |
+
this.opts.element.trigger(evt);
|
| 3123 |
+
|
| 3124 |
+
if (evt.isDefaultPrevented()) {
|
| 3125 |
+
return false;
|
| 3126 |
+
}
|
| 3127 |
+
|
| 3128 |
+
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3129 |
+
val.splice(index, 1);
|
| 3130 |
+
this.setVal(val);
|
| 3131 |
+
if (this.select) this.postprocessResults();
|
| 3132 |
+
}
|
| 3133 |
+
|
| 3134 |
+
selected.remove();
|
| 3135 |
+
|
| 3136 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3137 |
+
this.triggerChange({ removed: data });
|
| 3138 |
+
|
| 3139 |
+
return true;
|
| 3140 |
+
},
|
| 3141 |
+
|
| 3142 |
+
// multi
|
| 3143 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3144 |
+
var val = this.getVal(),
|
| 3145 |
+
choices = this.results.find(".select2-result"),
|
| 3146 |
+
compound = this.results.find(".select2-result-with-children"),
|
| 3147 |
+
self = this;
|
| 3148 |
+
|
| 3149 |
+
choices.each2(function (i, choice) {
|
| 3150 |
+
var id = self.id(choice.data("select2-data"));
|
| 3151 |
+
if (indexOf(id, val) >= 0) {
|
| 3152 |
+
choice.addClass("select2-selected");
|
| 3153 |
+
// mark all children of the selected parent as selected
|
| 3154 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3155 |
+
}
|
| 3156 |
+
});
|
| 3157 |
+
|
| 3158 |
+
compound.each2(function(i, choice) {
|
| 3159 |
+
// hide an optgroup if it doesn't have any selectable children
|
| 3160 |
+
if (!choice.is('.select2-result-selectable')
|
| 3161 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3162 |
+
choice.addClass("select2-selected");
|
| 3163 |
+
}
|
| 3164 |
+
});
|
| 3165 |
+
|
| 3166 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
| 3167 |
+
self.highlight(0);
|
| 3168 |
+
}
|
| 3169 |
+
|
| 3170 |
+
//If all results are chosen render formatNoMatches
|
| 3171 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3172 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3173 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3174 |
+
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3175 |
+
}
|
| 3176 |
+
}
|
| 3177 |
+
}
|
| 3178 |
+
|
| 3179 |
+
},
|
| 3180 |
+
|
| 3181 |
+
// multi
|
| 3182 |
+
getMaxSearchWidth: function() {
|
| 3183 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3184 |
+
},
|
| 3185 |
+
|
| 3186 |
+
// multi
|
| 3187 |
+
resizeSearch: function () {
|
| 3188 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3189 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3190 |
+
|
| 3191 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3192 |
+
|
| 3193 |
+
left = this.search.offset().left;
|
| 3194 |
+
|
| 3195 |
+
maxWidth = this.selection.width();
|
| 3196 |
+
containerLeft = this.selection.offset().left;
|
| 3197 |
+
|
| 3198 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3199 |
+
|
| 3200 |
+
if (searchWidth < minimumWidth) {
|
| 3201 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 3202 |
+
}
|
| 3203 |
+
|
| 3204 |
+
if (searchWidth < 40) {
|
| 3205 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 3206 |
+
}
|
| 3207 |
+
|
| 3208 |
+
if (searchWidth <= 0) {
|
| 3209 |
+
searchWidth = minimumWidth;
|
| 3210 |
+
}
|
| 3211 |
+
|
| 3212 |
+
this.search.width(Math.floor(searchWidth));
|
| 3213 |
+
},
|
| 3214 |
+
|
| 3215 |
+
// multi
|
| 3216 |
+
getVal: function () {
|
| 3217 |
+
var val;
|
| 3218 |
+
if (this.select) {
|
| 3219 |
+
val = this.select.val();
|
| 3220 |
+
return val === null ? [] : val;
|
| 3221 |
+
} else {
|
| 3222 |
+
val = this.opts.element.val();
|
| 3223 |
+
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
| 3224 |
+
}
|
| 3225 |
+
},
|
| 3226 |
+
|
| 3227 |
+
// multi
|
| 3228 |
+
setVal: function (val) {
|
| 3229 |
+
var unique;
|
| 3230 |
+
if (this.select) {
|
| 3231 |
+
this.select.val(val);
|
| 3232 |
+
} else {
|
| 3233 |
+
unique = [];
|
| 3234 |
+
// filter out duplicates
|
| 3235 |
+
$(val).each(function () {
|
| 3236 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3237 |
+
});
|
| 3238 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3239 |
+
}
|
| 3240 |
+
},
|
| 3241 |
+
|
| 3242 |
+
// multi
|
| 3243 |
+
buildChangeDetails: function (old, current) {
|
| 3244 |
+
var current = current.slice(0),
|
| 3245 |
+
old = old.slice(0);
|
| 3246 |
+
|
| 3247 |
+
// remove intersection from each array
|
| 3248 |
+
for (var i = 0; i < current.length; i++) {
|
| 3249 |
+
for (var j = 0; j < old.length; j++) {
|
| 3250 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3251 |
+
current.splice(i, 1);
|
| 3252 |
+
if(i>0){
|
| 3253 |
+
i--;
|
| 3254 |
+
}
|
| 3255 |
+
old.splice(j, 1);
|
| 3256 |
+
j--;
|
| 3257 |
+
}
|
| 3258 |
+
}
|
| 3259 |
+
}
|
| 3260 |
+
|
| 3261 |
+
return {added: current, removed: old};
|
| 3262 |
+
},
|
| 3263 |
+
|
| 3264 |
+
|
| 3265 |
+
// multi
|
| 3266 |
+
val: function (val, triggerChange) {
|
| 3267 |
+
var oldData, self=this;
|
| 3268 |
+
|
| 3269 |
+
if (arguments.length === 0) {
|
| 3270 |
+
return this.getVal();
|
| 3271 |
+
}
|
| 3272 |
+
|
| 3273 |
+
oldData=this.data();
|
| 3274 |
+
if (!oldData.length) oldData=[];
|
| 3275 |
+
|
| 3276 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3277 |
+
if (!val && val !== 0) {
|
| 3278 |
+
this.opts.element.val("");
|
| 3279 |
+
this.updateSelection([]);
|
| 3280 |
+
this.clearSearch();
|
| 3281 |
+
if (triggerChange) {
|
| 3282 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
| 3283 |
+
}
|
| 3284 |
+
return;
|
| 3285 |
+
}
|
| 3286 |
+
|
| 3287 |
+
// val is a list of ids
|
| 3288 |
+
this.setVal(val);
|
| 3289 |
+
|
| 3290 |
+
if (this.select) {
|
| 3291 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3292 |
+
if (triggerChange) {
|
| 3293 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3294 |
+
}
|
| 3295 |
+
} else {
|
| 3296 |
+
if (this.opts.initSelection === undefined) {
|
| 3297 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3298 |
+
}
|
| 3299 |
+
|
| 3300 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 3301 |
+
var ids=$.map(data, self.id);
|
| 3302 |
+
self.setVal(ids);
|
| 3303 |
+
self.updateSelection(data);
|
| 3304 |
+
self.clearSearch();
|
| 3305 |
+
if (triggerChange) {
|
| 3306 |
+
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3307 |
+
}
|
| 3308 |
+
});
|
| 3309 |
+
}
|
| 3310 |
+
this.clearSearch();
|
| 3311 |
+
},
|
| 3312 |
+
|
| 3313 |
+
// multi
|
| 3314 |
+
onSortStart: function() {
|
| 3315 |
+
if (this.select) {
|
| 3316 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3317 |
+
}
|
| 3318 |
+
|
| 3319 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
| 3320 |
+
this.search.width(0);
|
| 3321 |
+
// hide the container
|
| 3322 |
+
this.searchContainer.hide();
|
| 3323 |
+
},
|
| 3324 |
+
|
| 3325 |
+
// multi
|
| 3326 |
+
onSortEnd:function() {
|
| 3327 |
+
|
| 3328 |
+
var val=[], self=this;
|
| 3329 |
+
|
| 3330 |
+
// show search and move it to the end of the list
|
| 3331 |
+
this.searchContainer.show();
|
| 3332 |
+
// make sure the search container is the last item in the list
|
| 3333 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3334 |
+
// since we collapsed the width in dragStarted, we resize it here
|
| 3335 |
+
this.resizeSearch();
|
| 3336 |
+
|
| 3337 |
+
// update selection
|
| 3338 |
+
this.selection.find(".select2-search-choice").each(function() {
|
| 3339 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
| 3340 |
+
});
|
| 3341 |
+
this.setVal(val);
|
| 3342 |
+
this.triggerChange();
|
| 3343 |
+
},
|
| 3344 |
+
|
| 3345 |
+
// multi
|
| 3346 |
+
data: function(values, triggerChange) {
|
| 3347 |
+
var self=this, ids, old;
|
| 3348 |
+
if (arguments.length === 0) {
|
| 3349 |
+
return this.selection
|
| 3350 |
+
.children(".select2-search-choice")
|
| 3351 |
+
.map(function() { return $(this).data("select2-data"); })
|
| 3352 |
+
.get();
|
| 3353 |
+
} else {
|
| 3354 |
+
old = this.data();
|
| 3355 |
+
if (!values) { values = []; }
|
| 3356 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3357 |
+
this.setVal(ids);
|
| 3358 |
+
this.updateSelection(values);
|
| 3359 |
+
this.clearSearch();
|
| 3360 |
+
if (triggerChange) {
|
| 3361 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3362 |
+
}
|
| 3363 |
+
}
|
| 3364 |
+
}
|
| 3365 |
+
});
|
| 3366 |
+
|
| 3367 |
+
$.fn.select2 = function () {
|
| 3368 |
+
|
| 3369 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
| 3370 |
+
opts,
|
| 3371 |
+
select2,
|
| 3372 |
+
method, value, multiple,
|
| 3373 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3374 |
+
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3375 |
+
propertyMethods = ["val", "data"],
|
| 3376 |
+
methodsMap = { search: "externalSearch" };
|
| 3377 |
+
|
| 3378 |
+
this.each(function () {
|
| 3379 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3380 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3381 |
+
opts.element = $(this);
|
| 3382 |
+
|
| 3383 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3384 |
+
multiple = opts.element.prop("multiple");
|
| 3385 |
+
} else {
|
| 3386 |
+
multiple = opts.multiple || false;
|
| 3387 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3388 |
+
}
|
| 3389 |
+
|
| 3390 |
+
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3391 |
+
select2.init(opts);
|
| 3392 |
+
} else if (typeof(args[0]) === "string") {
|
| 3393 |
+
|
| 3394 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3395 |
+
throw "Unknown method: " + args[0];
|
| 3396 |
+
}
|
| 3397 |
+
|
| 3398 |
+
value = undefined;
|
| 3399 |
+
select2 = $(this).data("select2");
|
| 3400 |
+
if (select2 === undefined) return;
|
| 3401 |
+
|
| 3402 |
+
method=args[0];
|
| 3403 |
+
|
| 3404 |
+
if (method === "container") {
|
| 3405 |
+
value = select2.container;
|
| 3406 |
+
} else if (method === "dropdown") {
|
| 3407 |
+
value = select2.dropdown;
|
| 3408 |
+
} else {
|
| 3409 |
+
if (methodsMap[method]) method = methodsMap[method];
|
| 3410 |
+
|
| 3411 |
+
value = select2[method].apply(select2, args.slice(1));
|
| 3412 |
+
}
|
| 3413 |
+
if (indexOf(args[0], valueMethods) >= 0
|
| 3414 |
+
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3415 |
+
return false; // abort the iteration, ready to return first matched value
|
| 3416 |
+
}
|
| 3417 |
+
} else {
|
| 3418 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
| 3419 |
+
}
|
| 3420 |
+
});
|
| 3421 |
+
return (value === undefined) ? this : value;
|
| 3422 |
+
};
|
| 3423 |
+
|
| 3424 |
+
// plugin defaults, accessible to users
|
| 3425 |
+
$.fn.select2.defaults = {
|
| 3426 |
+
width: "copy",
|
| 3427 |
+
loadMorePadding: 0,
|
| 3428 |
+
closeOnSelect: true,
|
| 3429 |
+
openOnEnter: true,
|
| 3430 |
+
containerCss: {},
|
| 3431 |
+
dropdownCss: {},
|
| 3432 |
+
containerCssClass: "",
|
| 3433 |
+
dropdownCssClass: "",
|
| 3434 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
| 3435 |
+
var markup=[];
|
| 3436 |
+
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
| 3437 |
+
return markup.join("");
|
| 3438 |
+
},
|
| 3439 |
+
transformVal: function(val) {
|
| 3440 |
+
return $.trim(val);
|
| 3441 |
+
},
|
| 3442 |
+
formatSelection: function (data, container, escapeMarkup) {
|
| 3443 |
+
return data ? escapeMarkup(this.text(data)) : undefined;
|
| 3444 |
+
},
|
| 3445 |
+
sortResults: function (results, container, query) {
|
| 3446 |
+
return results;
|
| 3447 |
+
},
|
| 3448 |
+
formatResultCssClass: function(data) {return data.css;},
|
| 3449 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3450 |
+
minimumResultsForSearch: 0,
|
| 3451 |
+
minimumInputLength: 0,
|
| 3452 |
+
maximumInputLength: null,
|
| 3453 |
+
maximumSelectionSize: 0,
|
| 3454 |
+
id: function (e) { return e == undefined ? null : e.id; },
|
| 3455 |
+
text: function (e) {
|
| 3456 |
+
if (e && this.data && this.data.text) {
|
| 3457 |
+
if ($.isFunction(this.data.text)) {
|
| 3458 |
+
return this.data.text(e);
|
| 3459 |
+
} else {
|
| 3460 |
+
return e[this.data.text];
|
| 3461 |
+
}
|
| 3462 |
+
} else {
|
| 3463 |
+
return e.text;
|
| 3464 |
+
}
|
| 3465 |
+
},
|
| 3466 |
+
matcher: function(term, text) {
|
| 3467 |
+
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3468 |
+
},
|
| 3469 |
+
separator: ",",
|
| 3470 |
+
tokenSeparators: [],
|
| 3471 |
+
tokenizer: defaultTokenizer,
|
| 3472 |
+
escapeMarkup: defaultEscapeMarkup,
|
| 3473 |
+
blurOnChange: false,
|
| 3474 |
+
selectOnBlur: false,
|
| 3475 |
+
adaptContainerCssClass: function(c) { return c; },
|
| 3476 |
+
adaptDropdownCssClass: function(c) { return null; },
|
| 3477 |
+
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3478 |
+
searchInputPlaceholder: '',
|
| 3479 |
+
createSearchChoicePosition: 'top',
|
| 3480 |
+
shouldFocusInput: function (instance) {
|
| 3481 |
+
// Attempt to detect touch devices
|
| 3482 |
+
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3483 |
+
(navigator.msMaxTouchPoints > 0));
|
| 3484 |
+
|
| 3485 |
+
// Only devices which support touch events should be special cased
|
| 3486 |
+
if (!supportsTouchEvents) {
|
| 3487 |
+
return true;
|
| 3488 |
+
}
|
| 3489 |
+
|
| 3490 |
+
// Never focus the input if search is disabled
|
| 3491 |
+
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3492 |
+
return false;
|
| 3493 |
+
}
|
| 3494 |
+
|
| 3495 |
+
return true;
|
| 3496 |
+
}
|
| 3497 |
+
};
|
| 3498 |
+
|
| 3499 |
+
$.fn.select2.locales = [];
|
| 3500 |
+
|
| 3501 |
+
$.fn.select2.locales['en'] = {
|
| 3502 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3503 |
+
formatNoMatches: function () { return "No matches found"; },
|
| 3504 |
+
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3505 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3506 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3507 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3508 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3509 |
+
formatSearching: function () { return "Searching…"; }
|
| 3510 |
+
};
|
| 3511 |
+
|
| 3512 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3513 |
+
|
| 3514 |
+
$.fn.select2.ajaxDefaults = {
|
| 3515 |
+
transport: $.ajax,
|
| 3516 |
+
params: {
|
| 3517 |
+
type: "GET",
|
| 3518 |
+
cache: false,
|
| 3519 |
+
dataType: "json"
|
| 3520 |
+
}
|
| 3521 |
+
};
|
| 3522 |
+
|
| 3523 |
+
// exports
|
| 3524 |
+
window.Select2 = {
|
| 3525 |
+
query: {
|
| 3526 |
+
ajax: ajax,
|
| 3527 |
+
local: local,
|
| 3528 |
+
tags: tags
|
| 3529 |
+
}, util: {
|
| 3530 |
+
debounce: debounce,
|
| 3531 |
+
markMatch: markMatch,
|
| 3532 |
+
escapeMarkup: defaultEscapeMarkup,
|
| 3533 |
+
stripDiacritics: stripDiacritics
|
| 3534 |
+
}, "class": {
|
| 3535 |
+
"abstract": AbstractSelect2,
|
| 3536 |
+
"single": SingleSelect2,
|
| 3537 |
+
"multi": MultiSelect2
|
| 3538 |
+
}
|
| 3539 |
+
};
|
| 3540 |
+
|
| 3541 |
+
}(jQuery));
|
trunk/classes/admin/settings/assets/js/select2/select2.min.js
ADDED
|
@@ -0,0 +1,23 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2014 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
+
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
+
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
trunk/classes/admin/settings/assets/js/select2/select2.png
ADDED
|
Binary file
|
trunk/classes/admin/settings/assets/js/select2/select2x2.png
ADDED
|
Binary file
|
trunk/classes/admin/settings/assets/js/sf-jquery.js
ADDED
|
@@ -0,0 +1,23 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(document).ready(function () {
|
| 2 |
+
|
| 3 |
+
jQuery(".sf-tips").tooltip({ animation: true, html: true, delay: { show: 300, hide: 100 } });
|
| 4 |
+
|
| 5 |
+
|
| 6 |
+
//This if statement checks if the color picker widget exists within jQuery UI
|
| 7 |
+
//If it does exist then we initialize the WordPress color picker on our text input field
|
| 8 |
+
if (typeof jQuery.wp === 'object' && typeof jQuery.wp.wpColorPicker === 'function') {
|
| 9 |
+
jQuery('.colorpick').wpColorPicker();
|
| 10 |
+
} else {
|
| 11 |
+
// Color picker
|
| 12 |
+
jQuery('.colorpick').each(function () {
|
| 13 |
+
jQuery('.colorpickdiv', jQuery(this).parent()).farbtastic(this);
|
| 14 |
+
jQuery(this).click(function () {
|
| 15 |
+
if (jQuery(this).val() == "") jQuery(this).val('#');
|
| 16 |
+
jQuery('.colorpickdiv', jQuery(this).parent()).show();
|
| 17 |
+
});
|
| 18 |
+
});
|
| 19 |
+
jQuery(document).mousedown(function () {
|
| 20 |
+
jQuery('.colorpickdiv').hide();
|
| 21 |
+
});
|
| 22 |
+
}
|
| 23 |
+
});
|
trunk/classes/admin/settings/assets/js/wcvendors-media.js
ADDED
|
@@ -0,0 +1,52 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery( function( $ ){
|
| 2 |
+
|
| 3 |
+
var id;
|
| 4 |
+
|
| 5 |
+
// Iterate over all instances of the uploader on the page
|
| 6 |
+
$('.wcv-img-id').each( function () {
|
| 7 |
+
|
| 8 |
+
id = $( this ).data( 'id' );
|
| 9 |
+
|
| 10 |
+
// Handle Add banner
|
| 11 |
+
$( '#wcv-add-' + id ).on( 'click', function(e) {
|
| 12 |
+
e.preventDefault();
|
| 13 |
+
file_uploader( id );
|
| 14 |
+
return false;
|
| 15 |
+
});
|
| 16 |
+
|
| 17 |
+
});
|
| 18 |
+
|
| 19 |
+
function file_uploader( id )
|
| 20 |
+
{
|
| 21 |
+
|
| 22 |
+
var media_uploader, json;
|
| 23 |
+
|
| 24 |
+
if (undefined !== media_uploader ) {
|
| 25 |
+
media_uploader.open();
|
| 26 |
+
return;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
media_uploader = wp.media({
|
| 30 |
+
title: $( '#wcv-add-' + id ).data('window_title'),
|
| 31 |
+
button: {
|
| 32 |
+
text: $( '#wcv-add-' + id ).data('save_button'),
|
| 33 |
+
},
|
| 34 |
+
multiple: false // Set to true to allow multiple files to be selected
|
| 35 |
+
});
|
| 36 |
+
|
| 37 |
+
media_uploader.on( 'select' , function(){
|
| 38 |
+
|
| 39 |
+
json = media_uploader.state().get('selection').first().toJSON();
|
| 40 |
+
|
| 41 |
+
if ( 0 > $.trim( json.url.length ) ) {
|
| 42 |
+
return;
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
$( '.wcv-image-container-' + id ).prop( 'src', json.sizes.full.url );
|
| 46 |
+
$( '#' + id ).val( json.sizes.full.url );
|
| 47 |
+
|
| 48 |
+
});
|
| 49 |
+
|
| 50 |
+
media_uploader.open();
|
| 51 |
+
}
|
| 52 |
+
});
|
trunk/classes/admin/settings/classes/sf-class-format-options.php
ADDED
|
@@ -0,0 +1,347 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Format an options array into HTML
|
| 5 |
+
* This class has been deprecated
|
| 6 |
+
*
|
| 7 |
+
* @author Matt Gates <http://mgates.me>
|
| 8 |
+
* @package WordPress
|
| 9 |
+
*/
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
if ( !class_exists( 'SF_Format_Options' ) ) {
|
| 13 |
+
|
| 14 |
+
class SF_Format_Options extends SF_Settings_API
|
| 15 |
+
{
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* Format an option array into HTML
|
| 19 |
+
*
|
| 20 |
+
*
|
| 21 |
+
* @access public
|
| 22 |
+
*
|
| 23 |
+
* @param unknown $setting
|
| 24 |
+
*
|
| 25 |
+
* @return string HTML.
|
| 26 |
+
*/
|
| 27 |
+
public function settings_options_format( $setting )
|
| 28 |
+
{
|
| 29 |
+
if ( empty( $setting ) ) return false;
|
| 30 |
+
|
| 31 |
+
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 32 |
+
'name' => '',
|
| 33 |
+
'desc' => '',
|
| 34 |
+
'placeholder' => '',
|
| 35 |
+
'class' => '',
|
| 36 |
+
'tip' => '',
|
| 37 |
+
'id' => '',
|
| 38 |
+
'css' => '',
|
| 39 |
+
'type' => 'text',
|
| 40 |
+
'std' => '',
|
| 41 |
+
'select2' => false,
|
| 42 |
+
'multiple' => false,
|
| 43 |
+
'options' => array(),
|
| 44 |
+
'restrict' => array(),
|
| 45 |
+
'settings' => array()
|
| 46 |
+
) );
|
| 47 |
+
|
| 48 |
+
// Each to it's own variable for slim-ness' sakes.
|
| 49 |
+
$setting = shortcode_atts( $defaults, $setting );
|
| 50 |
+
|
| 51 |
+
$restrict_defaults = array(
|
| 52 |
+
'min' => 0,
|
| 53 |
+
'max' => '',
|
| 54 |
+
'step' => 'any',
|
| 55 |
+
);
|
| 56 |
+
|
| 57 |
+
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 58 |
+
|
| 59 |
+
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 60 |
+
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 61 |
+
$setting[ 'value' ] = SF_Format_Options::sanitize_value( $setting[ 'value' ], $setting );
|
| 62 |
+
|
| 63 |
+
$setting[ 'title' ] = $setting[ 'name' ];
|
| 64 |
+
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 65 |
+
|
| 66 |
+
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 67 |
+
$setting[ 'tip' ] = SF_Format_Options::get_formatted_tip( $setting[ 'tip' ] );
|
| 68 |
+
|
| 69 |
+
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 70 |
+
|
| 71 |
+
extract( $setting );
|
| 72 |
+
|
| 73 |
+
$description = $desc && !$grouped && $type != 'checkbox'
|
| 74 |
+
? '<br /><small>' . $desc . '</small>'
|
| 75 |
+
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 76 |
+
|
| 77 |
+
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 78 |
+
? '<p>' . $desc . '</p>'
|
| 79 |
+
: $description;
|
| 80 |
+
|
| 81 |
+
?>
|
| 82 |
+
|
| 83 |
+
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 84 |
+
<!-- Header of the option. -->
|
| 85 |
+
<tr valign="top">
|
| 86 |
+
<th scope="row"<?php echo $grouped; ?>>
|
| 87 |
+
|
| 88 |
+
<?php echo $tip; ?>
|
| 89 |
+
|
| 90 |
+
<?php if ( !$grouped ) : ?>
|
| 91 |
+
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 92 |
+
<?php endif; ?>
|
| 93 |
+
|
| 94 |
+
</th>
|
| 95 |
+
<td <?php echo $grouped; ?> >
|
| 96 |
+
<?php endif; ?>
|
| 97 |
+
|
| 98 |
+
<?php foreach ( $header_types as $header ) :
|
| 99 |
+
if ( $type != $header ) continue; ?>
|
| 100 |
+
<tr>
|
| 101 |
+
<th scope="col" colspan="2">
|
| 102 |
+
<h3 class="title"><?php echo $title; ?></h3>
|
| 103 |
+
<?php echo $description; ?>
|
| 104 |
+
</th>
|
| 105 |
+
</tr>
|
| 106 |
+
<?php endforeach; ?>
|
| 107 |
+
|
| 108 |
+
<?php switch ( $type ) :
|
| 109 |
+
|
| 110 |
+
case 'text' :
|
| 111 |
+
case 'color' :
|
| 112 |
+
case 'number' :
|
| 113 |
+
if ( $type == 'color' ) {
|
| 114 |
+
$type = 'text';
|
| 115 |
+
$class .= ' colorpick';
|
| 116 |
+
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 117 |
+
}
|
| 118 |
+
?>
|
| 119 |
+
<input name="<?php echo $name; ?>"
|
| 120 |
+
id="<?php echo $id; ?>"
|
| 121 |
+
type="<?php echo $type; ?>"
|
| 122 |
+
|
| 123 |
+
<?php if ( $type == 'number' ): ?>
|
| 124 |
+
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 125 |
+
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 126 |
+
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 127 |
+
<?php endif; ?>
|
| 128 |
+
|
| 129 |
+
class="regular-text <?php echo $class; ?>"
|
| 130 |
+
style="<?php echo $css; ?>"
|
| 131 |
+
placeholder="<?php echo $placeholder; ?>"
|
| 132 |
+
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 133 |
+
/>
|
| 134 |
+
<?php echo $description;
|
| 135 |
+
break;
|
| 136 |
+
|
| 137 |
+
case 'checkbox':
|
| 138 |
+
|
| 139 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 140 |
+
|
| 141 |
+
if ( $multiple ) :
|
| 142 |
+
|
| 143 |
+
foreach ( $options as $key => $desc ) : ?>
|
| 144 |
+
|
| 145 |
+
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 146 |
+
id="<?php echo $id . '_' . $key; ?>"
|
| 147 |
+
type="checkbox"
|
| 148 |
+
class="<?php echo $class; ?>"
|
| 149 |
+
style="<?php echo $css; ?>"
|
| 150 |
+
value="<?php echo $key; ?>"
|
| 151 |
+
<?php self::checked( $value, $key ); ?>
|
| 152 |
+
/>
|
| 153 |
+
<label for="<?php echo $id . '_' . $key; ?>">
|
| 154 |
+
<?php echo $desc; ?>
|
| 155 |
+
</label>
|
| 156 |
+
<br/>
|
| 157 |
+
<?php
|
| 158 |
+
|
| 159 |
+
endforeach;
|
| 160 |
+
|
| 161 |
+
else : ?>
|
| 162 |
+
|
| 163 |
+
<input name="<?php echo $name; ?>"
|
| 164 |
+
id="<?php echo $id ?>"
|
| 165 |
+
type="checkbox"
|
| 166 |
+
class="<?php echo $class; ?>"
|
| 167 |
+
style="<?php echo $css; ?>"
|
| 168 |
+
<?php checked( $selected, 1 ); ?>
|
| 169 |
+
/>
|
| 170 |
+
<?php echo $description;
|
| 171 |
+
endif;
|
| 172 |
+
break;
|
| 173 |
+
|
| 174 |
+
case 'radio':
|
| 175 |
+
|
| 176 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 177 |
+
|
| 178 |
+
foreach ( $options as $key => $val ) : ?>
|
| 179 |
+
<label class="radio">
|
| 180 |
+
<input type="radio"
|
| 181 |
+
name="<?php echo $name; ?>"
|
| 182 |
+
id="<?php echo $key; ?>"
|
| 183 |
+
value="<?php echo $key; ?>"
|
| 184 |
+
class="<?php echo $class; ?>"
|
| 185 |
+
<?php checked( $selected, $key ); ?>
|
| 186 |
+
/>
|
| 187 |
+
<?php echo $val; ?>
|
| 188 |
+
</label><br/>
|
| 189 |
+
<?php endforeach;
|
| 190 |
+
echo $description;
|
| 191 |
+
break;
|
| 192 |
+
|
| 193 |
+
case 'single_select_page':
|
| 194 |
+
|
| 195 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 196 |
+
|
| 197 |
+
$args = array(
|
| 198 |
+
'name' => $name,
|
| 199 |
+
'id' => $id,
|
| 200 |
+
'sort_order' => 'ASC',
|
| 201 |
+
'echo' => 0,
|
| 202 |
+
'selected' => $selected
|
| 203 |
+
);
|
| 204 |
+
|
| 205 |
+
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 206 |
+
|
| 207 |
+
echo $description;
|
| 208 |
+
|
| 209 |
+
if ( $select2 ) : ?>
|
| 210 |
+
<script type="text/javascript">jQuery(function () {
|
| 211 |
+
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px' });
|
| 212 |
+
});</script>
|
| 213 |
+
<?php endif;
|
| 214 |
+
|
| 215 |
+
break;
|
| 216 |
+
|
| 217 |
+
case 'select':
|
| 218 |
+
|
| 219 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 220 |
+
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 221 |
+
|
| 222 |
+
<select id="<?php echo $id; ?>"
|
| 223 |
+
class="<?php echo $class; ?>"
|
| 224 |
+
style="<?php echo $css; ?>"
|
| 225 |
+
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 226 |
+
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 227 |
+
|
| 228 |
+
<?php foreach ( $options as $key => $val ) : ?>
|
| 229 |
+
<option
|
| 230 |
+
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 231 |
+
<?php endforeach; ?>
|
| 232 |
+
</select>
|
| 233 |
+
|
| 234 |
+
<?php echo $description;
|
| 235 |
+
|
| 236 |
+
if ( $select2 ) : ?>
|
| 237 |
+
<script type="text/javascript">jQuery(function () {
|
| 238 |
+
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 239 |
+
});</script>
|
| 240 |
+
<?php endif;
|
| 241 |
+
|
| 242 |
+
break;
|
| 243 |
+
|
| 244 |
+
case 'textarea':
|
| 245 |
+
?>
|
| 246 |
+
<textarea name="<?php echo $name; ?>"
|
| 247 |
+
id="<?php echo $id; ?>"
|
| 248 |
+
class="large-text <?php echo $class; ?>"
|
| 249 |
+
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 250 |
+
placeholder="<?php echo $placeholder; ?>"
|
| 251 |
+
rows="3"
|
| 252 |
+
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 253 |
+
<?php echo $description;
|
| 254 |
+
break;
|
| 255 |
+
|
| 256 |
+
case 'wysiwyg':
|
| 257 |
+
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 258 |
+
echo $description;
|
| 259 |
+
break;
|
| 260 |
+
|
| 261 |
+
default :
|
| 262 |
+
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 263 |
+
break;
|
| 264 |
+
|
| 265 |
+
endswitch;
|
| 266 |
+
|
| 267 |
+
/* Footer of the option. */
|
| 268 |
+
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 269 |
+
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
/**
|
| 274 |
+
*
|
| 275 |
+
*
|
| 276 |
+
* @param unknown $haystack
|
| 277 |
+
* @param unknown $current
|
| 278 |
+
*/
|
| 279 |
+
private function selected( $haystack, $current )
|
| 280 |
+
{
|
| 281 |
+
|
| 282 |
+
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 283 |
+
$current = $haystack = 1;
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
selected( $haystack, $current );
|
| 287 |
+
}
|
| 288 |
+
|
| 289 |
+
|
| 290 |
+
/**
|
| 291 |
+
*
|
| 292 |
+
*
|
| 293 |
+
* @param unknown $haystack
|
| 294 |
+
* @param unknown $current
|
| 295 |
+
*/
|
| 296 |
+
private function checked( $haystack, $current )
|
| 297 |
+
{
|
| 298 |
+
|
| 299 |
+
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 300 |
+
$current = $haystack = 1;
|
| 301 |
+
}
|
| 302 |
+
|
| 303 |
+
checked( $haystack, $current );
|
| 304 |
+
}
|
| 305 |
+
|
| 306 |
+
|
| 307 |
+
/**
|
| 308 |
+
* Format a tooltip given a string
|
| 309 |
+
*
|
| 310 |
+
* @param string $tip
|
| 311 |
+
*
|
| 312 |
+
* @return string
|
| 313 |
+
*/
|
| 314 |
+
private function get_formatted_tip( $tip )
|
| 315 |
+
{
|
| 316 |
+
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 317 |
+
}
|
| 318 |
+
|
| 319 |
+
|
| 320 |
+
/**
|
| 321 |
+
*
|
| 322 |
+
*
|
| 323 |
+
* @param unknown $value
|
| 324 |
+
* @param unknown $setting
|
| 325 |
+
*
|
| 326 |
+
* @return unknown
|
| 327 |
+
*/
|
| 328 |
+
private function sanitize_value( $value, $setting )
|
| 329 |
+
{
|
| 330 |
+
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 331 |
+
if ( is_array( $value ) ) {
|
| 332 |
+
foreach ( $value as $key => $output ) {
|
| 333 |
+
$value[ $key ] = esc_attr( $output );
|
| 334 |
+
}
|
| 335 |
+
} else {
|
| 336 |
+
$value = esc_attr( $value );
|
| 337 |
+
}
|
| 338 |
+
}
|
| 339 |
+
|
| 340 |
+
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
|
| 347 |
+
}
|
trunk/classes/admin/settings/classes/sf-class-sanitize.php
ADDED
|
@@ -0,0 +1,199 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Sanitize filters
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package WordPress
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
if ( !class_exists( 'SF_Sanitize' ) ) {
|
| 12 |
+
|
| 13 |
+
class SF_Sanitize
|
| 14 |
+
{
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* Hooks
|
| 19 |
+
*/
|
| 20 |
+
function __construct()
|
| 21 |
+
{
|
| 22 |
+
add_filter( 'geczy_sanitize_color', 'sanitize_text_field' );
|
| 23 |
+
add_filter( 'geczy_sanitize_text', 'sanitize_text_field' );
|
| 24 |
+
add_filter( 'geczy_sanitize_number', array( 'SF_Sanitize', 'sanitize_number_field' ) );
|
| 25 |
+
add_filter( 'geczy_sanitize_textarea', array( 'SF_Sanitize', 'sanitize_textarea' ) );
|
| 26 |
+
add_filter( 'geczy_sanitize_wysiwyg', array( 'SF_Sanitize', 'sanitize_wysiwyg' ) );
|
| 27 |
+
add_filter( 'geczy_sanitize_checkbox', array( 'SF_Sanitize', 'sanitize_checkbox' ), 10, 2 );
|
| 28 |
+
add_filter( 'geczy_sanitize_radio', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 29 |
+
add_filter( 'geczy_sanitize_select', array( 'SF_Sanitize', 'sanitize_enum' ), 10, 2 );
|
| 30 |
+
add_filter( 'geczy_sanitize_image', array( 'SF_Sanitize', 'sanitize_image_url' ), 10, 2 );
|
| 31 |
+
add_filter( 'geczy_sanitize_single_select_page', array( 'SF_Sanitize', 'sanitize_select_pages' ), 10, 2 );
|
| 32 |
+
add_filter( 'geczy_sanitize_multi_select_page', array( 'SF_Sanitize', 'sanitize_multi_pages' ), 10, 2 );
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* Numeric sanitization
|
| 38 |
+
*
|
| 39 |
+
* @param int $input
|
| 40 |
+
*
|
| 41 |
+
* @return int
|
| 42 |
+
*/
|
| 43 |
+
public static function sanitize_number_field( $input )
|
| 44 |
+
{
|
| 45 |
+
$output = is_numeric( $input ) ? (float) $input : false;
|
| 46 |
+
|
| 47 |
+
return $input;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Textarea sanitization
|
| 53 |
+
*
|
| 54 |
+
* @param string $input
|
| 55 |
+
*
|
| 56 |
+
* @return string
|
| 57 |
+
*/
|
| 58 |
+
public static function sanitize_textarea( $input )
|
| 59 |
+
{
|
| 60 |
+
global $allowedposttags;
|
| 61 |
+
$output = wp_kses( $input, $allowedposttags );
|
| 62 |
+
|
| 63 |
+
return $output;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
|
| 67 |
+
/**
|
| 68 |
+
* WYSIWYG sanitization
|
| 69 |
+
*
|
| 70 |
+
* @param string $input
|
| 71 |
+
*
|
| 72 |
+
* @return string
|
| 73 |
+
*/
|
| 74 |
+
public static function sanitize_wysiwyg( $input )
|
| 75 |
+
{
|
| 76 |
+
return $input;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* Checkbox sanitization
|
| 82 |
+
*
|
| 83 |
+
* @param int $input
|
| 84 |
+
* @param unknown $option
|
| 85 |
+
*
|
| 86 |
+
* @return int
|
| 87 |
+
*/
|
| 88 |
+
public static function sanitize_checkbox( $input, $option )
|
| 89 |
+
{
|
| 90 |
+
if ( !empty( $option[ 'multiple' ] ) ) {
|
| 91 |
+
|
| 92 |
+
$defaults = array_keys( $option[ 'options' ] );
|
| 93 |
+
|
| 94 |
+
foreach ( $defaults as $value ) {
|
| 95 |
+
|
| 96 |
+
if ( !is_array( $input ) ) {
|
| 97 |
+
$output[ $value ] = 0;
|
| 98 |
+
} else {
|
| 99 |
+
$output[ $value ] = in_array( $value, $input ) ? 1 : 0;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
$output = serialize( $output );
|
| 105 |
+
} else {
|
| 106 |
+
$output = $input ? 1 : 0;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
return $output;
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
/**
|
| 114 |
+
* Array sanitization
|
| 115 |
+
*
|
| 116 |
+
* @param unknown $input
|
| 117 |
+
* @param array $option
|
| 118 |
+
*
|
| 119 |
+
* @return bool
|
| 120 |
+
*/
|
| 121 |
+
public static function sanitize_enum( $input, $option )
|
| 122 |
+
{
|
| 123 |
+
$output = $input;
|
| 124 |
+
|
| 125 |
+
$sfs = new SF_Sanitize();
|
| 126 |
+
|
| 127 |
+
if ( is_array( $input ) ) {
|
| 128 |
+
foreach ( $input as $value ) {
|
| 129 |
+
if ( !$sfs->sanitize_enum( $value, $option ) ) {
|
| 130 |
+
$output = false;
|
| 131 |
+
break;
|
| 132 |
+
}
|
| 133 |
+
}
|
| 134 |
+
$output = $output ? serialize( $output ) : $output;
|
| 135 |
+
} else {
|
| 136 |
+
$output = array_key_exists( $input, $option[ 'options' ] ) ? $input : false;
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
return $output;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
|
| 143 |
+
/**
|
| 144 |
+
* Select box for pages sanitize
|
| 145 |
+
*
|
| 146 |
+
* @param int $input
|
| 147 |
+
* @param int $option
|
| 148 |
+
*
|
| 149 |
+
* @return int
|
| 150 |
+
*/
|
| 151 |
+
public static function sanitize_select_pages( $input, $option )
|
| 152 |
+
{
|
| 153 |
+
$output = get_page( $input ) ? (int) $input : 0;
|
| 154 |
+
|
| 155 |
+
return $output;
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
/**
|
| 159 |
+
* Select box for pages sanitize
|
| 160 |
+
*
|
| 161 |
+
* @param int $input
|
| 162 |
+
* @param int $option
|
| 163 |
+
*
|
| 164 |
+
* @return int
|
| 165 |
+
*/
|
| 166 |
+
public static function sanitize_multi_pages( $input, $option )
|
| 167 |
+
{
|
| 168 |
+
|
| 169 |
+
foreach ( $input as $value ){
|
| 170 |
+
$output[ $value ] = get_page( $value ) ? (int) $value : 0;
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
// $output = serialize( $output );
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
return $output;
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
|
| 180 |
+
|
| 181 |
+
/**
|
| 182 |
+
* Image uploader
|
| 183 |
+
*
|
| 184 |
+
* @param url $input
|
| 185 |
+
*
|
| 186 |
+
* @return int
|
| 187 |
+
*/
|
| 188 |
+
public static function sanitize_image_url( $input, $option ) {
|
| 189 |
+
|
| 190 |
+
$output = $input;
|
| 191 |
+
return $output;
|
| 192 |
+
|
| 193 |
+
}
|
| 194 |
+
|
| 195 |
+
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
|
| 199 |
+
}
|
trunk/classes/admin/settings/classes/sf-class-settings.php
ADDED
|
@@ -0,0 +1,978 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* WP-Simple-Settings-Framework
|
| 5 |
+
*
|
| 6 |
+
* Copyright (c) 2012 Matt Gates.
|
| 7 |
+
* All rights reserved.
|
| 8 |
+
*
|
| 9 |
+
* Redistribution and use in source and binary forms, with or without
|
| 10 |
+
* modification, are permitted provided that the following conditions
|
| 11 |
+
* are met:
|
| 12 |
+
*
|
| 13 |
+
* * Redistributions of source code must retain the above copyright
|
| 14 |
+
* notice, this list of conditions and the following disclaimer.
|
| 15 |
+
*
|
| 16 |
+
* * Redistributions in binary form must reproduce the above copyright
|
| 17 |
+
* notice, this list of conditions and the following disclaimer in
|
| 18 |
+
* the documentation and/or other materials provided with the
|
| 19 |
+
* distribution.
|
| 20 |
+
*
|
| 21 |
+
* * Neither the names of the copyright holders nor the names of the
|
| 22 |
+
* contributors may be used to endorse or promote products derived
|
| 23 |
+
* from this software without specific prior written permission.
|
| 24 |
+
*
|
| 25 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
| 26 |
+
* "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
| 27 |
+
* LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
|
| 28 |
+
* FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
| 29 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
|
| 30 |
+
* INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
|
| 31 |
+
* BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
|
| 32 |
+
* LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
|
| 33 |
+
* CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
|
| 34 |
+
* LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
|
| 35 |
+
* ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
|
| 36 |
+
* POSSIBILITY OF SUCH DAMAGE.
|
| 37 |
+
*
|
| 38 |
+
* @subpackage WP-Simple-Settings-Framework
|
| 39 |
+
* @copyright 2012 Matt Gates.
|
| 40 |
+
* @license http://www.opensource.org/licenses/bsd-license.php BSD License
|
| 41 |
+
* @link http://mgates.me
|
| 42 |
+
* @version 1.1
|
| 43 |
+
* @author Matt Gates <info@mgates.me>
|
| 44 |
+
* @package WordPress
|
| 45 |
+
*/
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
if ( !class_exists( 'SF_Settings_API' ) ) {
|
| 49 |
+
|
| 50 |
+
class SF_Settings_API
|
| 51 |
+
{
|
| 52 |
+
|
| 53 |
+
private $data = array();
|
| 54 |
+
|
| 55 |
+
/**
|
| 56 |
+
* Init
|
| 57 |
+
*
|
| 58 |
+
* @param string $id
|
| 59 |
+
* @param string $title
|
| 60 |
+
* @param string $menu (optional)
|
| 61 |
+
* @param string $file
|
| 62 |
+
*/
|
| 63 |
+
public function __construct( $id, $title, $menu = '', $file )
|
| 64 |
+
{
|
| 65 |
+
$this->assets_url = trailingslashit( plugins_url( 'assets/', dirname( __FILE__ ) ) );
|
| 66 |
+
$this->id = $id;
|
| 67 |
+
$this->title = $title;
|
| 68 |
+
$this->menu = empty( $menu ) ? 'plugins.php' : $menu;
|
| 69 |
+
|
| 70 |
+
$this->file = $file;
|
| 71 |
+
|
| 72 |
+
$this->includes();
|
| 73 |
+
$this->actions();
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
// ==================================================================
|
| 78 |
+
//
|
| 79 |
+
// Getter and setter.
|
| 80 |
+
//
|
| 81 |
+
// ------------------------------------------------------------------
|
| 82 |
+
|
| 83 |
+
/**
|
| 84 |
+
* Setter
|
| 85 |
+
*
|
| 86 |
+
* @param unknown $name
|
| 87 |
+
* @param unknown $value
|
| 88 |
+
*/
|
| 89 |
+
public function __set( $name, $value )
|
| 90 |
+
{
|
| 91 |
+
if ( isset ( $this->data[ $name ] ) && is_array( $this->data[ $name ] ) ) {
|
| 92 |
+
$this->data[ $name ] = array_merge( $this->data[ $name ], $value );
|
| 93 |
+
} else {
|
| 94 |
+
$this->data[ $name ] = $value;
|
| 95 |
+
}
|
| 96 |
+
}
|
| 97 |
+
|
| 98 |
+
|
| 99 |
+
/**
|
| 100 |
+
* Getter
|
| 101 |
+
*
|
| 102 |
+
* @param unknown $name
|
| 103 |
+
*
|
| 104 |
+
* @return unknown
|
| 105 |
+
*/
|
| 106 |
+
public function __get( $name )
|
| 107 |
+
{
|
| 108 |
+
if ( array_key_exists( $name, $this->data ) ) {
|
| 109 |
+
return $this->data[ $name ];
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
return null;
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
|
| 116 |
+
/**
|
| 117 |
+
* Isset
|
| 118 |
+
*
|
| 119 |
+
* @param unknown $name
|
| 120 |
+
*
|
| 121 |
+
* @return unknown
|
| 122 |
+
*/
|
| 123 |
+
public function __isset( $name )
|
| 124 |
+
{
|
| 125 |
+
return isset( $this->data[ $name ] );
|
| 126 |
+
}
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
/**
|
| 130 |
+
* Unset
|
| 131 |
+
*
|
| 132 |
+
* @param unknown $name
|
| 133 |
+
*/
|
| 134 |
+
public function __unset( $name )
|
| 135 |
+
{
|
| 136 |
+
unset( $this->data[ $name ] );
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
/**
|
| 141 |
+
* Add a "Settings" link to the plugins.php page
|
| 142 |
+
*
|
| 143 |
+
* @param array $links
|
| 144 |
+
* @param array $file
|
| 145 |
+
*
|
| 146 |
+
* @return array
|
| 147 |
+
*/
|
| 148 |
+
public function add_settings_link( $links, $file )
|
| 149 |
+
{
|
| 150 |
+
$this_plugin = plugin_basename( $this->file );
|
| 151 |
+
$page = strpos( $this->menu, '.php' ) ? $this->menu : 'admin.php';
|
| 152 |
+
if ( $file == $this_plugin ) {
|
| 153 |
+
$settings_link = '<a href="' . $page . '?page=' . $this->id . '">' . __( 'Settings', 'wcvendors' ) . '</a>';
|
| 154 |
+
array_unshift( $links, $settings_link );
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
return $links;
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
|
| 161 |
+
// ==================================================================
|
| 162 |
+
//
|
| 163 |
+
// Begin initialization.
|
| 164 |
+
//
|
| 165 |
+
// ------------------------------------------------------------------
|
| 166 |
+
|
| 167 |
+
/**
|
| 168 |
+
* Core files
|
| 169 |
+
*/
|
| 170 |
+
private function includes()
|
| 171 |
+
{
|
| 172 |
+
require_once dirname( __FILE__ ) . '/sf-class-sanitize.php';
|
| 173 |
+
require_once dirname( __FILE__ ) . '/sf-class-format-options.php';
|
| 174 |
+
new SF_Sanitize;
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
/**
|
| 179 |
+
* Hooks
|
| 180 |
+
*/
|
| 181 |
+
private function actions()
|
| 182 |
+
{
|
| 183 |
+
add_action( 'admin_enqueue_scripts', array( &$this, 'admin_enqueue_scripts' ) );
|
| 184 |
+
add_action( 'admin_init', array( &$this, 'register_options' ) );
|
| 185 |
+
add_action( 'admin_menu', array( &$this, 'create_menu' ) );
|
| 186 |
+
add_filter( 'plugin_action_links', array( &$this, 'add_settings_link' ), 10, 2 );
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
|
| 190 |
+
/**
|
| 191 |
+
* Admin scripts and styles
|
| 192 |
+
*/
|
| 193 |
+
public function admin_enqueue_scripts()
|
| 194 |
+
{
|
| 195 |
+
|
| 196 |
+
$screen = get_current_screen();
|
| 197 |
+
$screen_id = $screen->id;
|
| 198 |
+
|
| 199 |
+
if ( $screen_id === 'woocommerce_page_wc_prd_vendor') {
|
| 200 |
+
wp_register_script( 'bootstrap-tooltip', $this->assets_url . 'js/bootstrap-tooltip.js', array( 'jquery' ), '1.0' );
|
| 201 |
+
wp_register_script( 'select2', $this->assets_url . 'js/select2/select2.min.js', array( 'jquery' ), '3.5.2' );
|
| 202 |
+
wp_register_script( 'wcvendors-media', $this->assets_url . 'js/wcvendors-media.js', array( 'jquery' ), '1.0' );
|
| 203 |
+
wp_register_script( 'sf-scripts', $this->assets_url . 'js/sf-jquery.js', array( 'jquery' ), '1.0' );
|
| 204 |
+
wp_register_style( 'select2', $this->assets_url . 'js/select2/select2.css' );
|
| 205 |
+
wp_register_style( 'sf-styles', $this->assets_url . 'css/sf-styles.css' );
|
| 206 |
+
}
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
|
| 210 |
+
/**
|
| 211 |
+
* Admin scripts and styles
|
| 212 |
+
*/
|
| 213 |
+
public function admin_print_scripts()
|
| 214 |
+
{
|
| 215 |
+
global $wp_version;
|
| 216 |
+
|
| 217 |
+
//Check wp version and load appropriate scripts for colorpicker.
|
| 218 |
+
if ( 3.5 <= $wp_version ) {
|
| 219 |
+
wp_enqueue_style( 'wp-color-picker' );
|
| 220 |
+
wp_enqueue_script( 'wp-color-picker' );
|
| 221 |
+
} else {
|
| 222 |
+
wp_enqueue_style( 'farbtastic' );
|
| 223 |
+
wp_enqueue_script( 'farbtastic' );
|
| 224 |
+
}
|
| 225 |
+
|
| 226 |
+
wp_enqueue_script( 'bootstrap-tooltip' );
|
| 227 |
+
wp_enqueue_script( 'select2' );
|
| 228 |
+
wp_enqueue_script( 'wcvendors-media' );
|
| 229 |
+
wp_enqueue_script( 'sf-scripts' );
|
| 230 |
+
|
| 231 |
+
wp_enqueue_style( 'wp-color-picker' );
|
| 232 |
+
wp_enqueue_style( 'select2' );
|
| 233 |
+
wp_enqueue_style( 'sf-styles' );
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
|
| 237 |
+
/**
|
| 238 |
+
* Register setting
|
| 239 |
+
*/
|
| 240 |
+
public function register_options()
|
| 241 |
+
{
|
| 242 |
+
register_setting( $this->id . '_options_nonce', $this->id . '_options', array( &$this, 'validate_options' ) );
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
|
| 246 |
+
/**
|
| 247 |
+
* Create menu
|
| 248 |
+
*/
|
| 249 |
+
public function create_menu()
|
| 250 |
+
{
|
| 251 |
+
$page = add_submenu_page( $this->menu, $this->title, $this->title, apply_filters( $this->id . '_manage_options', 'manage_options' ), $this->id, array( &$this, 'init_settings_page' ) );
|
| 252 |
+
add_action( 'admin_print_scripts-' . $page, array( &$this, 'admin_print_scripts' ) );
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
|
| 256 |
+
/**
|
| 257 |
+
* Parse options into tabbed organization
|
| 258 |
+
*
|
| 259 |
+
* @return array
|
| 260 |
+
*/
|
| 261 |
+
private function parse_options()
|
| 262 |
+
{
|
| 263 |
+
$options = $this->options;
|
| 264 |
+
|
| 265 |
+
foreach ( $options as $option ) {
|
| 266 |
+
|
| 267 |
+
if ( $option[ 'type' ] == 'heading' ) {
|
| 268 |
+
$tab_name = sanitize_title( $option[ 'name' ] );
|
| 269 |
+
$this->tab_headers = array( $tab_name => $option[ 'name' ] );
|
| 270 |
+
|
| 271 |
+
continue;
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
$option[ 'tab' ] = $tab_name;
|
| 275 |
+
$tabs[ $tab_name ][ ] = $option;
|
| 276 |
+
|
| 277 |
+
}
|
| 278 |
+
|
| 279 |
+
$this->tabs = $tabs;
|
| 280 |
+
|
| 281 |
+
return $tabs;
|
| 282 |
+
}
|
| 283 |
+
|
| 284 |
+
|
| 285 |
+
/**
|
| 286 |
+
* Load the options array from a file
|
| 287 |
+
*
|
| 288 |
+
* @param string $option_file
|
| 289 |
+
*/
|
| 290 |
+
public function load_options( $option_file )
|
| 291 |
+
{
|
| 292 |
+
if ( !empty( $this->options ) ) return;
|
| 293 |
+
|
| 294 |
+
if ( file_exists( $option_file ) ) {
|
| 295 |
+
require $option_file;
|
| 296 |
+
$this->options = apply_filters( $this->id . '_options', $options );
|
| 297 |
+
$this->parse_options();
|
| 298 |
+
|
| 299 |
+
$this->current_options = $this->get_current_options();
|
| 300 |
+
|
| 301 |
+
/* If the option has no saved data, load the defaults. */
|
| 302 |
+
/* @TODO: Can prob add this to the activation hook. */
|
| 303 |
+
$this->set_defaults( $this->current_options );
|
| 304 |
+
} else {
|
| 305 |
+
wp_die( __( 'Could not load settings at: ', 'wcvendors' ) . '<br/><code>' . $option_file . '</code>', __( 'Error - WP Settings Framework', 'wcvendors' ) );
|
| 306 |
+
}
|
| 307 |
+
}
|
| 308 |
+
|
| 309 |
+
|
| 310 |
+
/**
|
| 311 |
+
*
|
| 312 |
+
*
|
| 313 |
+
* @return unknown
|
| 314 |
+
*/
|
| 315 |
+
public function get_current_options()
|
| 316 |
+
{
|
| 317 |
+
if ( !empty( $this->current_options ) )
|
| 318 |
+
return $this->current_options;
|
| 319 |
+
|
| 320 |
+
$options = get_option( $this->id . '_options' );
|
| 321 |
+
|
| 322 |
+
if ( $options ) {
|
| 323 |
+
$options = array_map( 'maybe_unserialize', $options );
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
return $options;
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
|
| 330 |
+
/**
|
| 331 |
+
* Sanitize and validate post fields
|
| 332 |
+
*
|
| 333 |
+
* @param unknown $input
|
| 334 |
+
*
|
| 335 |
+
* @return unknown
|
| 336 |
+
*/
|
| 337 |
+
public function validate_options( $input )
|
| 338 |
+
{
|
| 339 |
+
if ( !isset( $_POST[ 'update' ] ) )
|
| 340 |
+
return $this->get_defaults();
|
| 341 |
+
|
| 342 |
+
$clean = $this->current_options;
|
| 343 |
+
$tabname = $_POST[ 'currentTab' ];
|
| 344 |
+
|
| 345 |
+
foreach ( $this->tabs[ $tabname ] as $option ) :
|
| 346 |
+
|
| 347 |
+
if ( !isset( $option[ 'id' ] ) )
|
| 348 |
+
continue;
|
| 349 |
+
|
| 350 |
+
if ( !isset( $option[ 'type' ] ) )
|
| 351 |
+
continue;
|
| 352 |
+
|
| 353 |
+
if ( $option[ 'type' ] == 'select' ) {
|
| 354 |
+
$option[ 'options' ] = apply_filters( $this->id . '_select_options', $option[ 'options' ], $option );
|
| 355 |
+
}
|
| 356 |
+
|
| 357 |
+
$id = sanitize_text_field( strtolower( $option[ 'id' ] ) );
|
| 358 |
+
|
| 359 |
+
// Set checkbox to false if it wasn't sent in the $_POST
|
| 360 |
+
if ( 'checkbox' == $option[ 'type' ] && !isset( $input[ $id ] ) )
|
| 361 |
+
$input[ $id ] = 0;
|
| 362 |
+
|
| 363 |
+
// For a value to be submitted to database it must pass through a sanitization filter
|
| 364 |
+
if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 365 |
+
$clean[ $id ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $input[ $id ], $option );
|
| 366 |
+
}
|
| 367 |
+
|
| 368 |
+
endforeach;
|
| 369 |
+
|
| 370 |
+
do_action( $this->id . '_options_updated', $clean, $tabname );
|
| 371 |
+
add_settings_error( $this->id, 'save_options', __( 'Settings saved.', 'wcvendors' ), 'updated' );
|
| 372 |
+
|
| 373 |
+
update_option( WC_Vendors::$id . '_flush_rules', true );
|
| 374 |
+
|
| 375 |
+
return apply_filters( $this->id . '_options_on_update', $clean, $tabname );
|
| 376 |
+
}
|
| 377 |
+
|
| 378 |
+
|
| 379 |
+
/**
|
| 380 |
+
* Create default options
|
| 381 |
+
*
|
| 382 |
+
* @param unknown $current_options (optional)
|
| 383 |
+
*/
|
| 384 |
+
private function set_defaults( $current_options = array() )
|
| 385 |
+
{
|
| 386 |
+
$options = $this->get_defaults( $current_options );
|
| 387 |
+
if ( $options ) {
|
| 388 |
+
update_option( $this->id . '_options', $options );
|
| 389 |
+
}
|
| 390 |
+
}
|
| 391 |
+
|
| 392 |
+
|
| 393 |
+
/**
|
| 394 |
+
* Retrieve default options
|
| 395 |
+
*
|
| 396 |
+
* @param unknown $currents (optional)
|
| 397 |
+
*
|
| 398 |
+
* @return array
|
| 399 |
+
*/
|
| 400 |
+
private function get_defaults( $currents = array() )
|
| 401 |
+
{
|
| 402 |
+
$output = array();
|
| 403 |
+
$config = $this->options;
|
| 404 |
+
$flag = false;
|
| 405 |
+
|
| 406 |
+
if ( $currents ) {
|
| 407 |
+
foreach ( $config as $value ) {
|
| 408 |
+
if ( !isset( $value[ 'id' ] ) || !isset( $value[ 'std' ] ) || !isset( $value[ 'type' ] ) )
|
| 409 |
+
continue;
|
| 410 |
+
|
| 411 |
+
if ( !isset( $currents[ $value[ 'id' ] ] ) ) {
|
| 412 |
+
$flag = true;
|
| 413 |
+
}
|
| 414 |
+
}
|
| 415 |
+
}
|
| 416 |
+
|
| 417 |
+
foreach ( $config as $option ) {
|
| 418 |
+
if ( !isset( $option[ 'id' ] ) || !isset( $option[ 'std' ] ) || !isset( $option[ 'type' ] ) )
|
| 419 |
+
continue;
|
| 420 |
+
|
| 421 |
+
if ( $currents && isset( $currents[ $option[ 'id' ] ] ) ) {
|
| 422 |
+
$output[ $option[ 'id' ] ] = $currents[ $option[ 'id' ] ];
|
| 423 |
+
} else if ( has_filter( 'geczy_sanitize_' . $option[ 'type' ] ) ) {
|
| 424 |
+
$output[ $option[ 'id' ] ] = apply_filters( 'geczy_sanitize_' . $option[ 'type' ], $option[ 'std' ], $option );
|
| 425 |
+
}
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
if ( $currents ) {
|
| 429 |
+
$output = array_merge( $currents, $output );
|
| 430 |
+
}
|
| 431 |
+
|
| 432 |
+
return !$flag && $currents ? array() : $output;
|
| 433 |
+
}
|
| 434 |
+
|
| 435 |
+
|
| 436 |
+
/**
|
| 437 |
+
* HTML header
|
| 438 |
+
*/
|
| 439 |
+
private function template_header()
|
| 440 |
+
{
|
| 441 |
+
?>
|
| 442 |
+
<div class="wrap">
|
| 443 |
+
<?php screen_icon(); ?><h2><?php echo $this->title; ?></h2>
|
| 444 |
+
|
| 445 |
+
<h2 class="nav-tab-wrapper">
|
| 446 |
+
<?php echo $this->display_tabs(); ?>
|
| 447 |
+
</h2><?php
|
| 448 |
+
|
| 449 |
+
if ( !empty ( $_REQUEST[ 'settings-updated' ] ) )
|
| 450 |
+
settings_errors();
|
| 451 |
+
|
| 452 |
+
}
|
| 453 |
+
|
| 454 |
+
|
| 455 |
+
/**
|
| 456 |
+
* HTML body
|
| 457 |
+
*
|
| 458 |
+
* @return unknown
|
| 459 |
+
*/
|
| 460 |
+
private function template_body()
|
| 461 |
+
{
|
| 462 |
+
|
| 463 |
+
if ( empty( $this->options ) ) return false;
|
| 464 |
+
|
| 465 |
+
|
| 466 |
+
$options = $this->options;
|
| 467 |
+
$tabs = $this->get_tabs();
|
| 468 |
+
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 469 |
+
|
| 470 |
+
$options = apply_filters( $this->id . '_options_tab-' . $tabname, $this->tabs[ $tabname ] ); ?>
|
| 471 |
+
|
| 472 |
+
<form method="post" action="options.php">
|
| 473 |
+
<?php settings_fields( $this->id . '_options_nonce' ); ?>
|
| 474 |
+
<table class="form-table">
|
| 475 |
+
|
| 476 |
+
<?php
|
| 477 |
+
foreach ( $options as $value ) :
|
| 478 |
+
$this->settings_options_format( $value );
|
| 479 |
+
endforeach;
|
| 480 |
+
|
| 481 |
+
do_action( $this->id . '_options_tab-' . $tabname );
|
| 482 |
+
?>
|
| 483 |
+
|
| 484 |
+
</table>
|
| 485 |
+
|
| 486 |
+
<p class="submit">
|
| 487 |
+
<input type="hidden" name="currentTab" value="<?php echo $tabname; ?>">
|
| 488 |
+
<input type="submit" name="update" class="button-primary"
|
| 489 |
+
value="<?php echo sprintf( __( 'Save %s changes', 'wcvendors' ), $this->tab_headers[ $tabname ] ); ?>"/>
|
| 490 |
+
</p>
|
| 491 |
+
</form> <?php
|
| 492 |
+
|
| 493 |
+
}
|
| 494 |
+
|
| 495 |
+
|
| 496 |
+
/**
|
| 497 |
+
* HTML footer
|
| 498 |
+
*/
|
| 499 |
+
private function template_footer()
|
| 500 |
+
{
|
| 501 |
+
|
| 502 |
+
$message = apply_filters( 'wcvendors_footer_msg', __( 'Please help with a <a href="https://wordpress.org/support/view/plugin-reviews/wc-vendors?rate=5#postform" target="top">High Five!</a> | <a href="https://www.wcvendors.com/product/wc-vendors-pro/" target="top">WC Vendors Pro</a> | <a href="https://www.wcvendors.com/product/stripe-commissions-gateway/" target="top">Stripe Commissions & Gateway</a> | <a href="https://www.wcvendors.com/kb/" target="top">KnowledgeBase</a> | <a href="https://www.wcvendors.com/help/" target="top">Help Forums</a>', 'wcvendors' ) );
|
| 503 |
+
|
| 504 |
+
echo '<div><p>' . $message . '</a></p>';
|
| 505 |
+
echo '</div>';
|
| 506 |
+
|
| 507 |
+
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
|
| 511 |
+
/**
|
| 512 |
+
* Create the settings page
|
| 513 |
+
*/
|
| 514 |
+
public function init_settings_page()
|
| 515 |
+
{
|
| 516 |
+
|
| 517 |
+
$this->template_header();
|
| 518 |
+
$this->template_body();
|
| 519 |
+
$this->template_footer();
|
| 520 |
+
|
| 521 |
+
}
|
| 522 |
+
|
| 523 |
+
|
| 524 |
+
/**
|
| 525 |
+
* Retrieve tabs
|
| 526 |
+
*
|
| 527 |
+
* @return array
|
| 528 |
+
*/
|
| 529 |
+
private function get_tabs()
|
| 530 |
+
{
|
| 531 |
+
$tabs = array();
|
| 532 |
+
foreach ( $this->options as $option ) {
|
| 533 |
+
|
| 534 |
+
if ( $option[ 'type' ] != 'heading' )
|
| 535 |
+
continue;
|
| 536 |
+
|
| 537 |
+
$option[ 'slug' ] = sanitize_title( $option[ 'name' ] );
|
| 538 |
+
unset( $option[ 'type' ] );
|
| 539 |
+
|
| 540 |
+
$tabs[ ] = $option;
|
| 541 |
+
}
|
| 542 |
+
|
| 543 |
+
return $tabs;
|
| 544 |
+
}
|
| 545 |
+
|
| 546 |
+
|
| 547 |
+
/**
|
| 548 |
+
* Heading for navigation
|
| 549 |
+
*
|
| 550 |
+
* @return string
|
| 551 |
+
*/
|
| 552 |
+
private function display_tabs()
|
| 553 |
+
{
|
| 554 |
+
$tabs = $this->get_tabs();
|
| 555 |
+
$tabname = !empty ( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : $tabs[ 0 ][ 'slug' ];
|
| 556 |
+
$menu = '';
|
| 557 |
+
|
| 558 |
+
foreach ( $tabs as $tab ) {
|
| 559 |
+
$class = $tabname == $tab[ 'slug' ] ? 'nav-tab-active' : '';
|
| 560 |
+
|
| 561 |
+
$fields = array(
|
| 562 |
+
'page' => $this->id,
|
| 563 |
+
'tab' => $tab[ 'slug' ],
|
| 564 |
+
);
|
| 565 |
+
|
| 566 |
+
$query = http_build_query( array_merge( $_GET, $fields ) );
|
| 567 |
+
$menu .= sprintf( '<a id="%s-tab" class="nav-tab %s" title="%s" href="?%s">%s</a>', $tab[ 'slug' ], $class, $tab[ 'name' ], $query, esc_html( $tab[ 'name' ] ) );
|
| 568 |
+
}
|
| 569 |
+
|
| 570 |
+
return $menu;
|
| 571 |
+
}
|
| 572 |
+
|
| 573 |
+
|
| 574 |
+
/**
|
| 575 |
+
* Update an option
|
| 576 |
+
*
|
| 577 |
+
* @param string $name
|
| 578 |
+
* @param string $value
|
| 579 |
+
*
|
| 580 |
+
* @return bool
|
| 581 |
+
*/
|
| 582 |
+
public function update_option( $name, $value )
|
| 583 |
+
{
|
| 584 |
+
// Overwrite the key/value pair
|
| 585 |
+
$this->current_options = array( $name => $value ) + (array) $this->current_options;
|
| 586 |
+
|
| 587 |
+
return update_option( $this->id . '_options', $this->current_options );
|
| 588 |
+
}
|
| 589 |
+
|
| 590 |
+
|
| 591 |
+
/**
|
| 592 |
+
* Get an option
|
| 593 |
+
*
|
| 594 |
+
* @param string $name
|
| 595 |
+
* @param string $default (optional)
|
| 596 |
+
*
|
| 597 |
+
* @return bool
|
| 598 |
+
*/
|
| 599 |
+
public function get_option( $name, $default = false )
|
| 600 |
+
{
|
| 601 |
+
return isset( $this->current_options[ $name ] ) ? maybe_unserialize( $this->current_options[ $name ] ) : $default;
|
| 602 |
+
}
|
| 603 |
+
|
| 604 |
+
|
| 605 |
+
public function settings_options_format( $setting )
|
| 606 |
+
{
|
| 607 |
+
if ( empty( $setting ) ) return false;
|
| 608 |
+
|
| 609 |
+
$defaults = apply_filters( $this->id . '_options_defaults', array(
|
| 610 |
+
'name' => '',
|
| 611 |
+
'desc' => '',
|
| 612 |
+
'placeholder' => '',
|
| 613 |
+
'class' => '',
|
| 614 |
+
'tip' => '',
|
| 615 |
+
'id' => '',
|
| 616 |
+
'css' => '',
|
| 617 |
+
'type' => 'text',
|
| 618 |
+
'std' => '',
|
| 619 |
+
'select2' => false,
|
| 620 |
+
'multiple' => false,
|
| 621 |
+
'options' => array(),
|
| 622 |
+
'restrict' => array(),
|
| 623 |
+
'settings' => array()
|
| 624 |
+
) );
|
| 625 |
+
|
| 626 |
+
// Each to it's own variable for slim-ness' sakes.
|
| 627 |
+
$setting = shortcode_atts( $defaults, $setting );
|
| 628 |
+
|
| 629 |
+
$restrict_defaults = array(
|
| 630 |
+
'min' => 0,
|
| 631 |
+
'max' => '',
|
| 632 |
+
'step' => 'any',
|
| 633 |
+
);
|
| 634 |
+
|
| 635 |
+
$setting[ 'restrict' ] = shortcode_atts( $restrict_defaults, $setting[ 'restrict' ] );
|
| 636 |
+
|
| 637 |
+
$setting[ 'value' ] = $this->get_option( $setting[ 'id' ] );
|
| 638 |
+
$setting[ 'value' ] = $setting[ 'value' ] !== false ? maybe_unserialize( $setting[ 'value' ] ) : false;
|
| 639 |
+
$setting[ 'value' ] = $this->sanitize_value( $setting[ 'value' ], $setting );
|
| 640 |
+
|
| 641 |
+
$setting[ 'title' ] = $setting[ 'name' ];
|
| 642 |
+
$setting[ 'name' ] = $this->id . "_options[{$setting['id']}]";
|
| 643 |
+
|
| 644 |
+
$setting[ 'grouped' ] = !$setting[ 'title' ] ? ' style="padding-top:0px;"' : '';
|
| 645 |
+
$setting[ 'tip' ] = $this->get_formatted_tip( $setting[ 'tip' ] );
|
| 646 |
+
|
| 647 |
+
$header_types = apply_filters( $this->id . '_options_header_types', array( 'heading', 'title' ) );
|
| 648 |
+
|
| 649 |
+
extract( $setting );
|
| 650 |
+
|
| 651 |
+
$description = $desc && !$grouped && $type != 'checkbox'
|
| 652 |
+
? '<br /><small>' . $desc . '</small>'
|
| 653 |
+
: '<label for="' . $id . '"> ' . $desc . '</label>';
|
| 654 |
+
|
| 655 |
+
$description = ( ( in_array( $type, $header_types ) || $type == 'radio' ) && !empty( $desc ) )
|
| 656 |
+
? '<p>' . $desc . '</p>'
|
| 657 |
+
: $description;
|
| 658 |
+
|
| 659 |
+
?>
|
| 660 |
+
|
| 661 |
+
<?php if ( !in_array( $type, $header_types ) ) : ?>
|
| 662 |
+
<!-- Header of the option. -->
|
| 663 |
+
<tr valign="top">
|
| 664 |
+
<th scope="row"<?php echo $grouped; ?>>
|
| 665 |
+
|
| 666 |
+
<?php echo $tip; ?>
|
| 667 |
+
|
| 668 |
+
<?php if ( !$grouped ) : ?>
|
| 669 |
+
<label for="<?php echo $name; ?>" class="description"><?php echo $title; ?></label>
|
| 670 |
+
<?php endif; ?>
|
| 671 |
+
|
| 672 |
+
</th>
|
| 673 |
+
<td <?php echo $grouped; ?> >
|
| 674 |
+
<?php endif; ?>
|
| 675 |
+
|
| 676 |
+
<?php foreach ( $header_types as $header ) :
|
| 677 |
+
if ( $type != $header ) continue; ?>
|
| 678 |
+
<tr>
|
| 679 |
+
<th scope="col" colspan="2">
|
| 680 |
+
<h3 class="title"><?php echo $title; ?></h3>
|
| 681 |
+
<?php echo $description; ?>
|
| 682 |
+
</th>
|
| 683 |
+
</tr>
|
| 684 |
+
<?php endforeach; ?>
|
| 685 |
+
|
| 686 |
+
<?php switch ( $type ) :
|
| 687 |
+
|
| 688 |
+
case 'text' :
|
| 689 |
+
case 'color' :
|
| 690 |
+
case 'number' :
|
| 691 |
+
if ( $type == 'color' ) {
|
| 692 |
+
$type = 'text';
|
| 693 |
+
$class .= ' colorpick';
|
| 694 |
+
$description .= '<div id="colorPickerDiv_' . $id . '" class="colorpickdiv" style="z-index: 100;background:#eee;border:1px solid #ccc;position:absolute;display:none;"></div>';
|
| 695 |
+
}
|
| 696 |
+
?>
|
| 697 |
+
<input name="<?php echo $name; ?>"
|
| 698 |
+
id="<?php echo $id; ?>"
|
| 699 |
+
type="<?php echo $type; ?>"
|
| 700 |
+
|
| 701 |
+
<?php if ( $type == 'number' ): ?>
|
| 702 |
+
min="<?php echo $restrict[ 'min' ]; ?>"
|
| 703 |
+
max="<?php echo $restrict[ 'max' ]; ?>"
|
| 704 |
+
step="<?php echo $restrict[ 'step' ]; ?>"
|
| 705 |
+
<?php endif; ?>
|
| 706 |
+
|
| 707 |
+
class="regular-text <?php echo $class; ?>"
|
| 708 |
+
style="<?php echo $css; ?>"
|
| 709 |
+
placeholder="<?php echo $placeholder; ?>"
|
| 710 |
+
value="<?php echo $value !== false ? $value : $std; ?>"
|
| 711 |
+
/>
|
| 712 |
+
<?php echo $description;
|
| 713 |
+
break;
|
| 714 |
+
|
| 715 |
+
case 'checkbox':
|
| 716 |
+
|
| 717 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 718 |
+
|
| 719 |
+
if ( $multiple ) :
|
| 720 |
+
|
| 721 |
+
foreach ( $options as $key => $desc ) : ?>
|
| 722 |
+
|
| 723 |
+
<input name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 724 |
+
id="<?php echo $id . '_' . $key; ?>"
|
| 725 |
+
type="checkbox"
|
| 726 |
+
class="<?php echo $class; ?>"
|
| 727 |
+
style="<?php echo $css; ?>"
|
| 728 |
+
value="<?php echo $key; ?>"
|
| 729 |
+
<?php @checked( $selected[$key], 1 ); ?>
|
| 730 |
+
/>
|
| 731 |
+
<label for="<?php echo $id . '_' . $key; ?>">
|
| 732 |
+
<?php echo $desc; ?>
|
| 733 |
+
</label>
|
| 734 |
+
<br/>
|
| 735 |
+
<?php
|
| 736 |
+
|
| 737 |
+
endforeach;
|
| 738 |
+
|
| 739 |
+
else : ?>
|
| 740 |
+
|
| 741 |
+
<input name="<?php echo $name; ?>"
|
| 742 |
+
id="<?php echo $id ?>"
|
| 743 |
+
type="checkbox"
|
| 744 |
+
class="<?php echo $class; ?>"
|
| 745 |
+
style="<?php echo $css; ?>"
|
| 746 |
+
<?php checked( $selected, 1 ); ?>
|
| 747 |
+
/>
|
| 748 |
+
<?php echo $description;
|
| 749 |
+
endif;
|
| 750 |
+
break;
|
| 751 |
+
|
| 752 |
+
case 'radio':
|
| 753 |
+
|
| 754 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 755 |
+
|
| 756 |
+
foreach ( $options as $key => $val ) : ?>
|
| 757 |
+
<label class="radio">
|
| 758 |
+
<input type="radio"
|
| 759 |
+
name="<?php echo $name; ?>"
|
| 760 |
+
id="<?php echo $key; ?>"
|
| 761 |
+
value="<?php echo $key; ?>"
|
| 762 |
+
class="<?php echo $class; ?>"
|
| 763 |
+
<?php checked( $selected, $key ); ?>
|
| 764 |
+
/>
|
| 765 |
+
<?php echo $val; ?>
|
| 766 |
+
</label><br/>
|
| 767 |
+
<?php endforeach;
|
| 768 |
+
echo $description;
|
| 769 |
+
break;
|
| 770 |
+
|
| 771 |
+
case 'single_select_page':
|
| 772 |
+
|
| 773 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 774 |
+
|
| 775 |
+
if ( $value == 0 ) $selected = $std;
|
| 776 |
+
|
| 777 |
+
$args = array(
|
| 778 |
+
'name' => $name,
|
| 779 |
+
'id' => $id,
|
| 780 |
+
'sort_order' => 'ASC',
|
| 781 |
+
'echo' => 0,
|
| 782 |
+
'selected' => $selected
|
| 783 |
+
);
|
| 784 |
+
|
| 785 |
+
echo str_replace( "'>", "'><option></option>", wp_dropdown_pages( $args ) );
|
| 786 |
+
|
| 787 |
+
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 788 |
+
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 789 |
+
|
| 790 |
+
echo $description;
|
| 791 |
+
|
| 792 |
+
if ( $select2 ) : ?>
|
| 793 |
+
<script type="text/javascript">jQuery(function () {
|
| 794 |
+
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 795 |
+
});</script>
|
| 796 |
+
<?php endif;
|
| 797 |
+
|
| 798 |
+
break;
|
| 799 |
+
|
| 800 |
+
case 'multi_select_page':
|
| 801 |
+
|
| 802 |
+
// TODO get this working with multiple page selection
|
| 803 |
+
|
| 804 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 805 |
+
$selected = implode( ',', array_keys( $selected ) );
|
| 806 |
+
|
| 807 |
+
if ( $value == 0 ) $selected = $std;
|
| 808 |
+
|
| 809 |
+
$name = $name . '[]';
|
| 810 |
+
|
| 811 |
+
$args = array(
|
| 812 |
+
'name' => $name,
|
| 813 |
+
'id' => $id,
|
| 814 |
+
'sort_order' => 'ASC',
|
| 815 |
+
'echo' => 0,
|
| 816 |
+
'selected' => $selected
|
| 817 |
+
);
|
| 818 |
+
|
| 819 |
+
echo str_replace( "'>", "' multiple=\"multiple\"><option></option>", wp_dropdown_pages( $args ) );
|
| 820 |
+
|
| 821 |
+
echo '<a href="post.php?post='.$selected.'&action=edit" class="button">'.__( 'Edit Page', 'wcvendors' ).'</a>';
|
| 822 |
+
echo '<a href="'.get_permalink( $selected ). '" class="button">'.__( 'View Page', 'wcvendors' ).'</a>';
|
| 823 |
+
|
| 824 |
+
echo $description;
|
| 825 |
+
|
| 826 |
+
if ( $select2 ) : ?>
|
| 827 |
+
<script type="text/javascript">jQuery(function () {
|
| 828 |
+
jQuery("#<?php echo $id; ?>").select2({ allowClear: true, placeholder: "<?php _e( 'Select a page...', 'wcvendors' ); ?>", width: '350px', allowMultiple: true });
|
| 829 |
+
});</script>
|
| 830 |
+
<?php endif;
|
| 831 |
+
|
| 832 |
+
break;
|
| 833 |
+
|
| 834 |
+
|
| 835 |
+
case 'select':
|
| 836 |
+
|
| 837 |
+
$selected = ( $value !== false ) ? $value : $std;
|
| 838 |
+
$options = apply_filters( $this->id . '_select_options', $options, $setting ); ?>
|
| 839 |
+
|
| 840 |
+
<select id="<?php echo $id; ?>"
|
| 841 |
+
class="<?php echo $class; ?>"
|
| 842 |
+
style="<?php echo $css; ?>"
|
| 843 |
+
name="<?php echo $name; ?><?php echo $multiple ? '[]' : ''; ?>"
|
| 844 |
+
<?php echo $multiple ? 'multiple="multiple"' : ''; ?>>
|
| 845 |
+
|
| 846 |
+
<?php foreach ( $options as $key => $val ) : ?>
|
| 847 |
+
<option
|
| 848 |
+
value="<?php echo $key; ?>" <?php self::selected( $selected, $key ); ?>><?php echo $val; ?></option>
|
| 849 |
+
<?php endforeach; ?>
|
| 850 |
+
</select>
|
| 851 |
+
|
| 852 |
+
<?php echo $description;
|
| 853 |
+
|
| 854 |
+
if ( $select2 ) : ?>
|
| 855 |
+
<script type="text/javascript">jQuery(function () {
|
| 856 |
+
jQuery("#<?php echo $id; ?>").select2({ width: '350px' });
|
| 857 |
+
});</script>
|
| 858 |
+
<?php endif;
|
| 859 |
+
|
| 860 |
+
break;
|
| 861 |
+
|
| 862 |
+
case 'textarea':
|
| 863 |
+
?>
|
| 864 |
+
<textarea name="<?php echo $name; ?>"
|
| 865 |
+
id="<?php echo $id; ?>"
|
| 866 |
+
class="large-text <?php echo $class; ?>"
|
| 867 |
+
style="<?php if ( $css ) echo $css; else echo 'width:300px;'; ?>"
|
| 868 |
+
placeholder="<?php echo $placeholder; ?>"
|
| 869 |
+
rows="3"
|
| 870 |
+
><?php echo ( $value !== false ) ? $value : $std; ?></textarea>
|
| 871 |
+
<?php echo $description;
|
| 872 |
+
break;
|
| 873 |
+
|
| 874 |
+
case 'wysiwyg':
|
| 875 |
+
wp_editor( $value, $id, array( 'textarea_name' => $name ) );
|
| 876 |
+
echo $description;
|
| 877 |
+
break;
|
| 878 |
+
|
| 879 |
+
case 'image':
|
| 880 |
+
|
| 881 |
+
if ( empty ( $value ) ) $value = $std;
|
| 882 |
+
|
| 883 |
+
?>
|
| 884 |
+
<img class="wcv-image-container-<?php echo $id; ?>" src="<?php echo $value; ?>" alt="" style="max-width:100%;" />
|
| 885 |
+
<br />
|
| 886 |
+
<input id="wcv-add-<?php echo $id; ?>" type="button" class="<?php echo $class; ?>" value="<?php echo sprintf( __( 'Update %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-id="<?php echo $id; ?>" data-save_button="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), $title ); ?>" data-window_title="<?php echo sprintf( __( 'Add %s', 'wcvendors' ), strtolower( $title ) ); ?>" data-upload_notice="<?php echo sprintf( __( 'Upload an image for the %s', 'wcvendors' ), strtolower( $title ) ); ?>" />
|
| 887 |
+
<input type="hidden" name="<?php echo $name; ?>" id="<?php echo $id; ?>" value="<?php echo $value; ?>">
|
| 888 |
+
<?php
|
| 889 |
+
break;
|
| 890 |
+
|
| 891 |
+
default :
|
| 892 |
+
do_action( $this->id . '_options_type_' . $type, $setting );
|
| 893 |
+
break;
|
| 894 |
+
|
| 895 |
+
endswitch;
|
| 896 |
+
|
| 897 |
+
/* Footer of the option. */
|
| 898 |
+
if ( !in_array( $type, $header_types ) ) echo '</td></tr>';
|
| 899 |
+
|
| 900 |
+
}
|
| 901 |
+
|
| 902 |
+
|
| 903 |
+
/**
|
| 904 |
+
*
|
| 905 |
+
*
|
| 906 |
+
* @param unknown $haystack
|
| 907 |
+
* @param unknown $current
|
| 908 |
+
*/
|
| 909 |
+
private function selected( $haystack, $current )
|
| 910 |
+
{
|
| 911 |
+
|
| 912 |
+
if ( is_array( $haystack ) && in_array( $current, $haystack ) ) {
|
| 913 |
+
$current = $haystack = 1;
|
| 914 |
+
}
|
| 915 |
+
|
| 916 |
+
selected( $haystack, $current );
|
| 917 |
+
}
|
| 918 |
+
|
| 919 |
+
|
| 920 |
+
/**
|
| 921 |
+
*
|
| 922 |
+
*
|
| 923 |
+
* @param unknown $haystack
|
| 924 |
+
* @param unknown $current
|
| 925 |
+
*/
|
| 926 |
+
private function checked( $haystack, $current )
|
| 927 |
+
{
|
| 928 |
+
|
| 929 |
+
if ( is_array( $haystack ) && !empty( $haystack[ $current ] ) ) {
|
| 930 |
+
$current = $haystack = 1;
|
| 931 |
+
}
|
| 932 |
+
|
| 933 |
+
checked( $haystack, $current );
|
| 934 |
+
}
|
| 935 |
+
|
| 936 |
+
|
| 937 |
+
/**
|
| 938 |
+
* Format a tooltip given a string
|
| 939 |
+
*
|
| 940 |
+
* @param string $tip
|
| 941 |
+
*
|
| 942 |
+
* @return string
|
| 943 |
+
*/
|
| 944 |
+
private function get_formatted_tip( $tip )
|
| 945 |
+
{
|
| 946 |
+
return $tip ? sprintf( '<a href="#" title="%s" class="sf-tips" tabindex="99"></a>', $tip ) : '';
|
| 947 |
+
}
|
| 948 |
+
|
| 949 |
+
|
| 950 |
+
/**
|
| 951 |
+
*
|
| 952 |
+
*
|
| 953 |
+
* @param unknown $value
|
| 954 |
+
* @param unknown $setting
|
| 955 |
+
*
|
| 956 |
+
* @return unknown
|
| 957 |
+
*/
|
| 958 |
+
private function sanitize_value( $value, $setting )
|
| 959 |
+
{
|
| 960 |
+
if ( $value !== false && $setting[ 'type' ] != 'wysiwyg' ) {
|
| 961 |
+
if ( is_array( $value ) ) {
|
| 962 |
+
foreach ( $value as $key => $output ) {
|
| 963 |
+
$value[ $key ] = esc_attr( $output );
|
| 964 |
+
}
|
| 965 |
+
} else {
|
| 966 |
+
$value = esc_attr( $value );
|
| 967 |
+
}
|
| 968 |
+
}
|
| 969 |
+
|
| 970 |
+
return apply_filters( $this->id . '_options_sanitize_value', $value, $setting );
|
| 971 |
+
}
|
| 972 |
+
|
| 973 |
+
|
| 974 |
+
|
| 975 |
+
}
|
| 976 |
+
|
| 977 |
+
|
| 978 |
+
}
|
trunk/classes/admin/settings/sf-options.php
ADDED
|
@@ -0,0 +1,363 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
$options = array();
|
| 3 |
+
|
| 4 |
+
$options[ ] = array( 'name' => __( 'General', 'wcvendors' ), 'type' => 'heading' );
|
| 5 |
+
$options[ ] = array( 'name' => __( 'General options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 6 |
+
|
| 7 |
+
$options[ ] = array(
|
| 8 |
+
'name' => __( 'Default commission (%)', 'wcvendors' ),
|
| 9 |
+
'desc' => __( 'The default rate you pay each vendor for a product sale. <br>You can also give vendors their own individual commission rates by editing the vendors user account.<br>Also, you can edit an individual products commission to override both of these settings on a per product basis.', 'wcvendors' ),
|
| 10 |
+
'id' => 'default_commission',
|
| 11 |
+
'css' => 'width:70px;',
|
| 12 |
+
'type' => 'number',
|
| 13 |
+
'restrict' => array(
|
| 14 |
+
'min' => 0,
|
| 15 |
+
'max' => 100
|
| 16 |
+
)
|
| 17 |
+
);
|
| 18 |
+
|
| 19 |
+
/* Customize registration message depending on if they have registration enabled on the my account page */
|
| 20 |
+
$registration_message = __( 'Allow users or guests to apply to become a vendor', 'wcvendors' );
|
| 21 |
+
if ( get_option( 'woocommerce_enable_myaccount_registration' ) === 'no' ) {
|
| 22 |
+
$registration_message = __( 'Allow users or guests to apply to become a vendor. <br><br><strong>WARNING:</strong> You MUST "<strong>Enable registration on the "My Account" page</strong>" in your <strong>WooCommerce > Settings > Accounts</strong> page for this option to work. Currently, you have registration disabled.', 'wcvendors' );
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
$options[ ] = array(
|
| 26 |
+
'name' => __( 'Registration', 'wcvendors' ),
|
| 27 |
+
'desc' => __( 'Allow users or guests to apply to become a vendor', 'wcvendors' ),
|
| 28 |
+
'tip' => __( 'This will show a checkbox on the My Account page\'s registration form asking if the user would like to apply to be a vendor. Also, on the Vendor Dashboard, users can still apply to become a vendor even if this is disabled.', 'wcvendors' ),
|
| 29 |
+
'id' => 'show_vendor_registration',
|
| 30 |
+
'type' => 'checkbox',
|
| 31 |
+
'std' => true,
|
| 32 |
+
);
|
| 33 |
+
|
| 34 |
+
$options[ ] = array(
|
| 35 |
+
'desc' => __( 'Approve vendor applications manually', 'wcvendors' ),
|
| 36 |
+
'tip' => __( 'With this unchecked, all vendor applications are automatically accepted. Otherwise, you must approve each manually.', 'wcvendors' ),
|
| 37 |
+
'id' => 'manual_vendor_registration',
|
| 38 |
+
'type' => 'checkbox',
|
| 39 |
+
'std' => true,
|
| 40 |
+
);
|
| 41 |
+
|
| 42 |
+
$options[ ] = array(
|
| 43 |
+
'name' => __( 'Taxes', 'wcvendors' ),
|
| 44 |
+
'desc' => __( 'Give vendors any tax collected per-product', 'wcvendors' ),
|
| 45 |
+
'tip' => __( 'The tax collected on a vendor\'s product will be given in its entirety', 'wcvendors' ),
|
| 46 |
+
'id' => 'give_tax',
|
| 47 |
+
'type' => 'checkbox',
|
| 48 |
+
'std' => false,
|
| 49 |
+
);
|
| 50 |
+
|
| 51 |
+
$options[ ] = array(
|
| 52 |
+
'name' => __( 'Shipping', 'wcvendors' ),
|
| 53 |
+
'desc' => __( 'Give vendors any shipping collected per-product', 'wcvendors' ),
|
| 54 |
+
'tip' => __( 'WC Vendors Free - Give vendors shipping if using Per Product Shipping gateway. WC Vendors Pro - Give vendors shipping when using Vendor Shipping. No other shipping module is compatible with this option.', 'wcvendors' ),
|
| 55 |
+
'id' => 'give_shipping',
|
| 56 |
+
'type' => 'checkbox',
|
| 57 |
+
'std' => true,
|
| 58 |
+
);
|
| 59 |
+
|
| 60 |
+
$options[ ] = array( 'name' => __( 'Shop options', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 61 |
+
|
| 62 |
+
$options[ ] = array(
|
| 63 |
+
'name' => __( 'Shop HTML', 'wcvendors' ),
|
| 64 |
+
'desc' => __( 'Enable HTML for a vendor\'s shop description by default. You can enable or disable this per vendor by editing the vendors user account.', 'wcvendors' ),
|
| 65 |
+
'id' => 'shop_html_enabled',
|
| 66 |
+
'type' => 'checkbox',
|
| 67 |
+
'std' => true,
|
| 68 |
+
);
|
| 69 |
+
|
| 70 |
+
$options[ ] = array(
|
| 71 |
+
'name' => __( 'Vendor Shop Page', 'wcvendors' ),
|
| 72 |
+
'desc' => __( 'Enter one word for the URI. If you enter "<strong>vendors</strong>" your vendors store will be <code>yourdomain.com/vendors/store-name/</code>', 'wcvendors' ),
|
| 73 |
+
'id' => 'vendor_shop_permalink',
|
| 74 |
+
'type' => 'text',
|
| 75 |
+
'std' => 'vendors/',
|
| 76 |
+
);
|
| 77 |
+
|
| 78 |
+
$options[ ] = array(
|
| 79 |
+
'name' => __( 'Shop Headers', 'wcvendors' ),
|
| 80 |
+
'desc' => __( 'Enable vendor shop headers', 'wcvendors' ),
|
| 81 |
+
'tip' => __( 'This will override the HTML Shop description output on product-archive pages. In order to customize the shop headers visit wcvendors.com and read the article in the Knowledgebase titled Changing the Vendor Templates.', 'wcvendors' ),
|
| 82 |
+
'id' => 'shop_headers_enabled',
|
| 83 |
+
'type' => 'checkbox',
|
| 84 |
+
'std' => false,
|
| 85 |
+
);
|
| 86 |
+
|
| 87 |
+
$options[ ] = array(
|
| 88 |
+
'name' => __( 'Vendor Display Name', 'wcvendors' ),
|
| 89 |
+
'desc' => __( 'Select what will be displayed for the sold by text throughout the store.', 'wcvendors' ),
|
| 90 |
+
'id' => 'vendor_display_name',
|
| 91 |
+
'type' => 'select',
|
| 92 |
+
'options' => array(
|
| 93 |
+
'display_name' => __( 'Display Name', 'wcvendors'),
|
| 94 |
+
'shop_name' => __( 'Shop Name', 'wcvendors'),
|
| 95 |
+
'user_login' => __( 'User Login', 'wcvendors'),
|
| 96 |
+
'user_email' => __( 'User Email', 'wcvendors'),
|
| 97 |
+
),
|
| 98 |
+
'std' => 'shop_name'
|
| 99 |
+
|
| 100 |
+
);
|
| 101 |
+
|
| 102 |
+
$options[ ] = array(
|
| 103 |
+
'name' => __( 'Sold By', 'wcvendors' ),
|
| 104 |
+
'desc' => __( 'Enable sold by labels', 'wcvendors' ),
|
| 105 |
+
'tip' => __( 'This will enable or disable the sold by labels.', 'wcvendors' ),
|
| 106 |
+
'id' => 'sold_by',
|
| 107 |
+
'type' => 'checkbox',
|
| 108 |
+
'std' => true,
|
| 109 |
+
);
|
| 110 |
+
|
| 111 |
+
$options[ ] = array(
|
| 112 |
+
'name' => __( 'Sold By Label', 'wcvendors' ),
|
| 113 |
+
'desc' => __( 'The sold by label used on the site and emails.', 'wcvendors' ),
|
| 114 |
+
'id' => 'sold_by_label',
|
| 115 |
+
'type' => 'text',
|
| 116 |
+
'std' => __( 'Sold By', 'wcvendors' ),
|
| 117 |
+
);
|
| 118 |
+
|
| 119 |
+
$options[ ] = array(
|
| 120 |
+
'name' => __( 'Seller Info Label', 'wcvendors' ),
|
| 121 |
+
'desc' => __( 'The seller info tab title on the single product page.', 'wcvendors' ),
|
| 122 |
+
'id' => 'seller_info_label',
|
| 123 |
+
'type' => 'text',
|
| 124 |
+
'std' => __( 'Seller Info', 'wcvendors' ),
|
| 125 |
+
);
|
| 126 |
+
|
| 127 |
+
$options[ ] = array( 'name' => __( 'Products', 'wcvendors' ), 'type' => 'heading' );
|
| 128 |
+
$options[ ] = array( 'name' => __( 'Product Add Page', 'wcvendors' ), 'type' => 'title', 'desc' => __( 'Configure what to hide from all vendors when adding a product', 'wcvendors' ) );
|
| 129 |
+
|
| 130 |
+
$options[ ] = array(
|
| 131 |
+
'name' => __( 'Left side panel', 'wcvendors' ),
|
| 132 |
+
'desc' => __( 'CHECKING these boxes will **HIDE** these areas of the add product page for vendors', 'wcvendors' ),
|
| 133 |
+
'id' => 'hide_product_panel',
|
| 134 |
+
'options' => array(
|
| 135 |
+
'inventory' => __( 'Inventory', 'wcvendors' ),
|
| 136 |
+
'shipping' => __( 'Shipping', 'wcvendors' ),
|
| 137 |
+
'linked_product' => __( 'Linked Products', 'wcvendors' ),
|
| 138 |
+
'attribute' => __( 'Attributes', 'wcvendors' ),
|
| 139 |
+
'advanced' => __( 'Advanced', 'wcvendors' ),
|
| 140 |
+
),
|
| 141 |
+
'type' => 'checkbox',
|
| 142 |
+
'multiple' => true,
|
| 143 |
+
);
|
| 144 |
+
|
| 145 |
+
$options[ ] = array(
|
| 146 |
+
'name' => __( 'Types', 'wcvendors' ),
|
| 147 |
+
'desc' => __( 'CHECKING these boxes will HIDE these product types from the vendor', 'wcvendors' ),
|
| 148 |
+
'id' => 'hide_product_types',
|
| 149 |
+
'options' => array(
|
| 150 |
+
'simple' => __( 'Simple', 'wcvendors' ),
|
| 151 |
+
'variable' => __( 'Variable', 'wcvendors' ),
|
| 152 |
+
'grouped' => __( 'Grouped', 'wcvendors' ),
|
| 153 |
+
'external' => __( 'External / affiliate', 'wcvendors' ),
|
| 154 |
+
),
|
| 155 |
+
'type' => 'checkbox',
|
| 156 |
+
'multiple' => true,
|
| 157 |
+
);
|
| 158 |
+
|
| 159 |
+
$options[ ] = array(
|
| 160 |
+
'name' => __( 'Type options', 'wcvendors' ),
|
| 161 |
+
'desc' => __( 'CHECKING these boxes will **HIDE** these product options from the vendor', 'wcvendors' ),
|
| 162 |
+
'id' => 'hide_product_type_options',
|
| 163 |
+
'options' => array(
|
| 164 |
+
'virtual' => __( 'Virtual', 'wcvendors' ),
|
| 165 |
+
'downloadable' => __( 'Downloadable', 'wcvendors' ),
|
| 166 |
+
),
|
| 167 |
+
'type' => 'checkbox',
|
| 168 |
+
'multiple' => true,
|
| 169 |
+
);
|
| 170 |
+
|
| 171 |
+
$options[ ] = array(
|
| 172 |
+
'name' => __( 'Miscellaneous', 'wcvendors' ),
|
| 173 |
+
'id' => 'hide_product_misc',
|
| 174 |
+
'options' => array(
|
| 175 |
+
'taxes' => __( 'Taxes', 'wcvendors' ),
|
| 176 |
+
'sku' => __( 'SKU', 'wcvendors' ),
|
| 177 |
+
'featured' => __( 'Featured', 'wcvendors' ),
|
| 178 |
+
'duplicate' => __( 'Duplicate Product', 'wcvendors' ),
|
| 179 |
+
),
|
| 180 |
+
'type' => 'checkbox',
|
| 181 |
+
'multiple' => true,
|
| 182 |
+
);
|
| 183 |
+
|
| 184 |
+
$options[ ] = array(
|
| 185 |
+
'name' => __( 'Stylesheet', 'wcvendors' ),
|
| 186 |
+
'desc' => __( 'You can add CSS in this textarea, which will be loaded on the product add/edit page for vendors.', 'wcvendors' ),
|
| 187 |
+
'id' => 'product_page_css',
|
| 188 |
+
'type' => 'textarea',
|
| 189 |
+
);
|
| 190 |
+
|
| 191 |
+
|
| 192 |
+
$options[ ] = array( 'name' => __( 'Capabilities', 'wcvendors' ), 'type' => 'heading', 'id' => 'capabilities' );
|
| 193 |
+
$options[ ] = array( 'name' => __( 'Permissions', 'wcvendors' ), 'id' => 'permissions', 'type' => 'title', 'desc' => __( 'General permissions used around the shop', 'wcvendors' ) );
|
| 194 |
+
|
| 195 |
+
$options[ ] = array(
|
| 196 |
+
'name' => __( 'Orders', 'wcvendors' ),
|
| 197 |
+
'desc' => __( 'View orders', 'wcvendors' ),
|
| 198 |
+
'tip' => __( 'Show customer details such as email, address, name, etc, for each order', 'wcvendors' ),
|
| 199 |
+
'id' => 'can_show_orders',
|
| 200 |
+
'type' => 'checkbox',
|
| 201 |
+
'std' => true,
|
| 202 |
+
);
|
| 203 |
+
|
| 204 |
+
$options[ ] = array(
|
| 205 |
+
'desc' => __( 'View comments', 'wcvendors' ),
|
| 206 |
+
'tip' => __( 'View all vendor comments for an order on the frontend', 'wcvendors' ),
|
| 207 |
+
'id' => 'can_view_order_comments',
|
| 208 |
+
'type' => 'checkbox',
|
| 209 |
+
'std' => true,
|
| 210 |
+
);
|
| 211 |
+
|
| 212 |
+
$options[ ] = array(
|
| 213 |
+
'desc' => __( 'Submit comments', 'wcvendors' ),
|
| 214 |
+
'tip' => __( 'Submit comments for an order on the frontend. Eg, tracking ID for a product', 'wcvendors' ),
|
| 215 |
+
'id' => 'can_submit_order_comments',
|
| 216 |
+
'type' => 'checkbox',
|
| 217 |
+
'std' => true,
|
| 218 |
+
);
|
| 219 |
+
|
| 220 |
+
$options[ ] = array(
|
| 221 |
+
'desc' => __( 'View email addresses', 'wcvendors' ),
|
| 222 |
+
'tip' => __( 'While viewing order details on the frontend, you can disable or enable email addresses', 'wcvendors' ),
|
| 223 |
+
'id' => 'can_view_order_emails',
|
| 224 |
+
'type' => 'checkbox',
|
| 225 |
+
'std' => true,
|
| 226 |
+
);
|
| 227 |
+
|
| 228 |
+
$options[ ] = array(
|
| 229 |
+
'desc' => __( 'Export a CSV file of orders for a product', 'wcvendors' ),
|
| 230 |
+
'tip' => __( 'Vendors could export orders for a product on the frontend', 'wcvendors' ),
|
| 231 |
+
'id' => 'can_export_csv',
|
| 232 |
+
'type' => 'checkbox',
|
| 233 |
+
'std' => true,
|
| 234 |
+
);
|
| 235 |
+
|
| 236 |
+
$options[ ] = array(
|
| 237 |
+
'name' => __( 'Reports', 'wcvendors' ),
|
| 238 |
+
'desc' => __( '<strike>View backend sales reports</strike>. <strong>Depreciated</strong>', 'wcvendors' ),
|
| 239 |
+
'tip' => __( 'This option has been removed and will no longer function. It will be completely removed in future versions. Vendors should use their Vendor Dashboard for reports as all identical functionality is already there. ', 'wcvendors' ),
|
| 240 |
+
'id' => 'can_view_backend_reports',
|
| 241 |
+
'type' => 'checkbox',
|
| 242 |
+
'std' => false,
|
| 243 |
+
);
|
| 244 |
+
|
| 245 |
+
$options[ ] = array(
|
| 246 |
+
'desc' => __( 'View Frontend sales reports', 'wcvendors' ),
|
| 247 |
+
'tip' => __( 'Sales table on the frontend on the Vendor Dashboard page. The table will only display sales data that pertain to their products, and only for orders that are processing or completed.', 'wcvendors' ),
|
| 248 |
+
'id' => 'can_view_frontend_reports',
|
| 249 |
+
'type' => 'checkbox',
|
| 250 |
+
'std' => true,
|
| 251 |
+
);
|
| 252 |
+
|
| 253 |
+
$options[ ] = array(
|
| 254 |
+
'name' => __( 'Products', 'wcvendors' ),
|
| 255 |
+
'desc' => __( 'Submit products', 'wcvendors' ),
|
| 256 |
+
'tip' => __( 'Check to allow vendors to list new products. Admin must approve new products by editing the product, and clicking Publish.', 'wcvendors' ),
|
| 257 |
+
'id' => 'can_submit_products',
|
| 258 |
+
'type' => 'checkbox',
|
| 259 |
+
'std' => true,
|
| 260 |
+
);
|
| 261 |
+
|
| 262 |
+
$options[ ] = array(
|
| 263 |
+
'desc' => __( 'Edit live products', 'wcvendors' ),
|
| 264 |
+
'tip' => __( 'Vendors could edit an approved product after it has already gone live. There is no approval or review after editing a live product. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 265 |
+
'id' => 'can_edit_published_products',
|
| 266 |
+
'type' => 'checkbox',
|
| 267 |
+
'std' => false,
|
| 268 |
+
);
|
| 269 |
+
|
| 270 |
+
$options[ ] = array(
|
| 271 |
+
'desc' => __( 'Submit products live without requiring approval', 'wcvendors' ),
|
| 272 |
+
'tip' => __( 'Vendors can submit products without review or approval from a shop admin. This could be dangerous with malicious vendors, so take caution.', 'wcvendors' ),
|
| 273 |
+
'id' => 'can_submit_live_products',
|
| 274 |
+
'type' => 'checkbox',
|
| 275 |
+
'std' => false,
|
| 276 |
+
);
|
| 277 |
+
|
| 278 |
+
$options[ ] = array( 'name' => __( 'Pages', 'wcvendors' ), 'type' => 'heading' );
|
| 279 |
+
$options[ ] = array( 'name' => __( 'Page configuration', 'wcvendors' ), 'type' => 'title', 'desc' => '' );
|
| 280 |
+
|
| 281 |
+
$options[ ] = array(
|
| 282 |
+
'name' => __( 'Vendor dashboard', 'wcvendors' ),
|
| 283 |
+
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_vendor_dashboard]</code><br/>. If this page is not set, you will break your site. If you upgrade to Pro, keep this page unchanged as both Pro Dashboard and this Dashboard page must be set.', 'wcvendors' ),
|
| 284 |
+
'id' => 'vendor_dashboard_page',
|
| 285 |
+
'type' => 'single_select_page',
|
| 286 |
+
'select2' => true,
|
| 287 |
+
);
|
| 288 |
+
|
| 289 |
+
$options[ ] = array(
|
| 290 |
+
'name' => __( 'Shop settings', 'wcvendors' ),
|
| 291 |
+
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_shop_settings]</code><br/>These are the shop settings a vendor can configure. By default, Vendor Dashboard > Shop Settings should have this shortcode.', 'wcvendors' ),
|
| 292 |
+
'id' => 'shop_settings_page',
|
| 293 |
+
'type' => 'single_select_page',
|
| 294 |
+
'select2' => true,
|
| 295 |
+
);
|
| 296 |
+
|
| 297 |
+
$options[ ] = array(
|
| 298 |
+
'name' => __( 'Orders page', 'wcvendors' ),
|
| 299 |
+
'desc' => __( 'Choose the page that has the shortcode <code>[wcv_orders]</code><br/>By default, Vendor Dashboard > Orders should have the shortcode.', 'wcvendors' ),
|
| 300 |
+
'id' => 'product_orders_page',
|
| 301 |
+
'type' => 'single_select_page',
|
| 302 |
+
'select2' => true,
|
| 303 |
+
);
|
| 304 |
+
|
| 305 |
+
$options[ ] = array(
|
| 306 |
+
'name' => __( 'Vendor terms', 'wcvendors' ),
|
| 307 |
+
'desc' => __( 'These terms are shown to a user when submitting an application to become a vendor.<br/>If left blank, no terms will be shown to the applicant. Vendor must accept terms in order to register, if set.', 'wcvendors' ),
|
| 308 |
+
'id' => 'terms_to_apply_page',
|
| 309 |
+
'type' => 'single_select_page',
|
| 310 |
+
'select2' => true,
|
| 311 |
+
);
|
| 312 |
+
|
| 313 |
+
$total_due = 0;
|
| 314 |
+
if ( !empty( $_GET[ 'tab' ] ) && $_GET[ 'tab' ] == __( 'payments', 'wcvendors' ) ) {
|
| 315 |
+
global $wpdb;
|
| 316 |
+
|
| 317 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 318 |
+
$query = "SELECT sum(total_due + total_shipping + tax) as total
|
| 319 |
+
FROM `{$table_name}`
|
| 320 |
+
WHERE status = %s";
|
| 321 |
+
$results = $wpdb->get_results( $wpdb->prepare( $query, 'due' ) );
|
| 322 |
+
|
| 323 |
+
$total_due = array_shift( $results )->total;
|
| 324 |
+
}
|
| 325 |
+
$options[ ] = array( 'name' => __( 'Payments', 'wcvendors' ), 'type' => 'heading' );
|
| 326 |
+
$options[ ] = array(
|
| 327 |
+
'name' => __( 'PayPal Adaptive Payments Scheduling', 'wcvendors' ), 'type' => 'title', 'desc' =>
|
| 328 |
+
sprintf( __( 'Total commission currently due: %s. <a href="%s">View details</a>.', 'wcvendors' ), !function_exists( 'wc_price' ) ? $total_due : wc_price( $total_due ), '?page=pv_admin_commissions' ) .
|
| 329 |
+
'<br/><br/>' . sprintf( __( 'Make sure you update your PayPal Adaptive Payments settings <a href="%s">here</a>. <br><br>To instantly pay with Adaptive Payments you must activate the PayPal AP gateway in your Checkout settings. <br><a href="https://www.wcvendors.com/kb/configuring-paypal-adaptive-payments/" target="top">PayPal AP Application Help</a>. <br><br>Another gateway that offers instant payments to vendors that also accepts credit cards directly on your checkout page is Stripe. <br><a href="https://www.wcvendors.com/product/stripe-commissions-gateway/" target="top">Stripe Commissions & Gateway plugin</a> is $49 and specifically coded for WC Vendors and <a href="https://www.wcvendors.com/product/wc-vendors-pro/" target="top">WC Vendors Pro</a>.', 'wcvendors' ), 'admin.php?page=wc-settings&tab=checkout§ion=wc_paypalap' )
|
| 330 |
+
);
|
| 331 |
+
|
| 332 |
+
$options[ ] = array(
|
| 333 |
+
'name' => __( 'Instant pay', 'wcvendors' ),
|
| 334 |
+
'desc' => __( 'Instantly pay vendors their commission when an order is made, and if a vendor has a valid PayPal email added on their Shop Settings page.', 'wcvendors' ),
|
| 335 |
+
'tip' => __( 'For this to work, customers must checkout with the PayPal Adaptive Payments gateway. Using any other gateways will not pay vendors instantly', 'wcvendors' ),
|
| 336 |
+
'id' => 'instapay',
|
| 337 |
+
'type' => 'checkbox',
|
| 338 |
+
'std' => true,
|
| 339 |
+
);
|
| 340 |
+
|
| 341 |
+
$options[ ] = array(
|
| 342 |
+
'name' => __( 'Payment schedule', 'wcvendors' ),
|
| 343 |
+
'desc' => __( 'Note: Schedule will only work if instant pay is unchecked', 'wcvendors' ),
|
| 344 |
+
'id' => 'schedule',
|
| 345 |
+
'type' => 'radio',
|
| 346 |
+
'std' => 'manual',
|
| 347 |
+
'options' => array(
|
| 348 |
+
'daily' => __( 'Daily', 'wcvendors' ),
|
| 349 |
+
'weekly' => __( 'Weekly', 'wcvendors' ),
|
| 350 |
+
'biweekly' => __( 'Biweekly', 'wcvendors' ),
|
| 351 |
+
'monthly' => __( 'Monthly', 'wcvendors' ),
|
| 352 |
+
'manual' => __( 'Manual', 'wcvendors' ),
|
| 353 |
+
'now' => '<span style="color:green;"><strong>' . __( 'Now', 'wcvendors' ) . '</strong></span>',
|
| 354 |
+
)
|
| 355 |
+
);
|
| 356 |
+
|
| 357 |
+
$options[ ] = array(
|
| 358 |
+
'name' => __( 'Email notification', 'wcvendors' ),
|
| 359 |
+
'desc' => __( 'Send the WooCommerce admin an email each time a payment has been made via the payment schedule options above', 'wcvendors' ),
|
| 360 |
+
'id' => 'mail_mass_pay_results',
|
| 361 |
+
'type' => 'checkbox',
|
| 362 |
+
'std' => true,
|
| 363 |
+
);
|
trunk/classes/admin/views/html-vendor-settings-page.php
ADDED
|
@@ -0,0 +1,76 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="wrap">
|
| 2 |
+
<h2>Shop Settings</h2>
|
| 3 |
+
<table class="form-table">
|
| 4 |
+
|
| 5 |
+
<form method="post">
|
| 6 |
+
<?php do_action( 'wcvendors_settings_before_paypal' );
|
| 7 |
+
|
| 8 |
+
if ( $paypal_address !== 'false' ) { ?>
|
| 9 |
+
|
| 10 |
+
<tr>
|
| 11 |
+
<th><?php _e( 'PayPal Address', 'wcvendors' ); ?></th>
|
| 12 |
+
<td><input type="email" name="pv_paypal" id="pv_paypal" placeholder="some@email.com"
|
| 13 |
+
value="<?php echo get_user_meta( $user_id, 'pv_paypal', true ); ?>"/>
|
| 14 |
+
<p class="description">
|
| 15 |
+
<?php _e( 'Your PayPal address is used to send you your commission.', 'wcvendors' ); ?><br/>
|
| 16 |
+
</p>
|
| 17 |
+
</td>
|
| 18 |
+
</tr>
|
| 19 |
+
<?php } ?>
|
| 20 |
+
<?php do_action( 'wcvendors_settings_after_paypal' ); ?>
|
| 21 |
+
<tr>
|
| 22 |
+
<th><?php _e( 'Shop Name', 'wcvendors' ); ?></th>
|
| 23 |
+
<td><input type="text" name="pv_shop_name" id="pv_shop_name" placeholder="Your shop name" value="<?php echo get_user_meta( $user_id, 'pv_shop_name', true ); ?>"/>
|
| 24 |
+
<p class="description"><?php _e( 'Your shop name is public and must be unique.', 'wcvendors' ); ?></p>
|
| 25 |
+
</td>
|
| 26 |
+
</tr>
|
| 27 |
+
<?php do_action( 'wcvendors_settings_after_shop_name' ); ?>
|
| 28 |
+
|
| 29 |
+
<tr>
|
| 30 |
+
<th><?php echo apply_filters( 'wcvendors_seller_info_label', __( 'Seller info', 'wcvendors' ) ); ?></th>
|
| 31 |
+
<td><?php
|
| 32 |
+
|
| 33 |
+
if ( $global_html || $has_html ) {
|
| 34 |
+
$old_post = $GLOBALS[ 'post' ];
|
| 35 |
+
$GLOBALS[ 'post' ] = 0;
|
| 36 |
+
wp_editor( $seller_info, 'pv_seller_info' );
|
| 37 |
+
$GLOBALS[ 'post' ] = $old_post;
|
| 38 |
+
} else {
|
| 39 |
+
?><textarea class="large-text" rows="10" id="pv_seller_info_unhtml" style="width:95%"
|
| 40 |
+
name="pv_seller_info"><?php echo $seller_info; ?></textarea><?php
|
| 41 |
+
}
|
| 42 |
+
?>
|
| 43 |
+
<p class="description"><?php _e( 'This is displayed on each of your products.', 'wcvendors' ); ?></p>
|
| 44 |
+
</td>
|
| 45 |
+
</tr>
|
| 46 |
+
<?php do_action( 'wcvendors_settings_after_seller_info' ); ?>
|
| 47 |
+
<?php if ( $shop_description !== 'false' ) { ?>
|
| 48 |
+
<tr>
|
| 49 |
+
<th><?php _e( 'Shop Description', 'wcvendors' ); ?></th>
|
| 50 |
+
<td><?php
|
| 51 |
+
|
| 52 |
+
if ( $global_html || $has_html ) {
|
| 53 |
+
$old_post = $GLOBALS[ 'post' ];
|
| 54 |
+
$GLOBALS[ 'post' ] = 0;
|
| 55 |
+
wp_editor( $description, 'pv_shop_description' );
|
| 56 |
+
$GLOBALS[ 'post' ] = $old_post;
|
| 57 |
+
} else {
|
| 58 |
+
?><textarea class="large-text" rows="10" id="pv_shop_description_unhtml" style="width:95%" name="pv_shop_description"><?php echo $description; ?></textarea><?php
|
| 59 |
+
}
|
| 60 |
+
?>
|
| 61 |
+
<p class="description"><?php printf( __( 'This is displayed on your <a href="%s">shop page</a>.', 'wcvendors' ), $shop_page ); ?></p>
|
| 62 |
+
</td>
|
| 63 |
+
</tr>
|
| 64 |
+
|
| 65 |
+
<?php do_action( 'wcvendors_settings_after_shop_description' ); ?>
|
| 66 |
+
<?php } ?>
|
| 67 |
+
<?php wp_nonce_field( 'save-shop-settings-admin', 'wc-vendors-nonce' ); ?>
|
| 68 |
+
<tr>
|
| 69 |
+
<td colspa="2">
|
| 70 |
+
<input type="submit" class="button button-primary" name="vendor_application_submit" value="<?php _e( 'Save Shop Settings', 'wcvendors' ); ?>"/>
|
| 71 |
+
</td>
|
| 72 |
+
</tr>
|
| 73 |
+
</form>
|
| 74 |
+
</table>
|
| 75 |
+
</div>
|
| 76 |
+
|
trunk/classes/class-commission.php
ADDED
|
@@ -0,0 +1,537 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Commission functions
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Commission
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Constructor
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
$this->completed_statuses = apply_filters( 'wcvendors_completed_statuses', array(
|
| 21 |
+
'completed',
|
| 22 |
+
'processing',
|
| 23 |
+
) );
|
| 24 |
+
|
| 25 |
+
$this->reverse_statuses = apply_filters( 'wcvendors_reversed_statuses', array(
|
| 26 |
+
'pending',
|
| 27 |
+
'refunded',
|
| 28 |
+
'cancelled',
|
| 29 |
+
'failed',
|
| 30 |
+
) );
|
| 31 |
+
|
| 32 |
+
$this->check_order_reverse();
|
| 33 |
+
$this->check_order_complete();
|
| 34 |
+
|
| 35 |
+
// Reverse the commission if the order is deleted
|
| 36 |
+
add_action( 'delete_post', array( $this, 'commissions_table_sync' ), 10 );
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
|
| 40 |
+
/**
|
| 41 |
+
* Run actions when an order is reversed
|
| 42 |
+
*/
|
| 43 |
+
public function check_order_reverse()
|
| 44 |
+
{
|
| 45 |
+
foreach ( $this->completed_statuses as $completed ) {
|
| 46 |
+
foreach ( $this->reverse_statuses as $reversed ) {
|
| 47 |
+
add_action( "woocommerce_order_status_{$completed}_to_{$reversed}", array( 'WCV_Commission', 'reverse_due_commission' ) );
|
| 48 |
+
}
|
| 49 |
+
}
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
|
| 53 |
+
/**
|
| 54 |
+
* Runs only on a manual order update by a human
|
| 55 |
+
*/
|
| 56 |
+
public function check_order_complete()
|
| 57 |
+
{
|
| 58 |
+
foreach ( $this->completed_statuses as $completed ) {
|
| 59 |
+
add_action( 'woocommerce_order_status_' . $completed, array( 'WCV_Commission', 'log_commission_due' ) );
|
| 60 |
+
}
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
public static function commission_status(){
|
| 64 |
+
|
| 65 |
+
return apply_filters( 'wcvendors_commission_status', array(
|
| 66 |
+
'due' => __( 'Due', 'wcvendors' ),
|
| 67 |
+
'paid' => __( 'Paid', 'wcvendors' ),
|
| 68 |
+
'reversed' => __( 'Reversed', 'wcvendors' )
|
| 69 |
+
)
|
| 70 |
+
);
|
| 71 |
+
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
|
| 75 |
+
/**
|
| 76 |
+
* Reverse commission for an entire order
|
| 77 |
+
*
|
| 78 |
+
* Only runs if the order has been logged in pv_commission table
|
| 79 |
+
*
|
| 80 |
+
* @param int $order_id
|
| 81 |
+
*
|
| 82 |
+
* @return unknown
|
| 83 |
+
*/
|
| 84 |
+
public function reverse_due_commission( $order_id )
|
| 85 |
+
{
|
| 86 |
+
global $wpdb;
|
| 87 |
+
|
| 88 |
+
// Check if this order exists
|
| 89 |
+
$count = WCV_Commission::count_commission_by_order( $order_id );
|
| 90 |
+
if ( !$count ) return false;
|
| 91 |
+
|
| 92 |
+
// Deduct this amount from the vendor's total due
|
| 93 |
+
$results = WCV_Commission::sum_total_due_for_order( $order_id );
|
| 94 |
+
$ids = implode( ',', $results[ 'ids' ] );
|
| 95 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 96 |
+
|
| 97 |
+
$query = "UPDATE `{$table_name}` SET `status` = '%s' WHERE id IN ({$ids})";
|
| 98 |
+
$results = $wpdb->query( $wpdb->prepare( $query, 'reversed' ) );
|
| 99 |
+
|
| 100 |
+
return $results;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
|
| 104 |
+
/**
|
| 105 |
+
* Store all commission due for an order
|
| 106 |
+
*
|
| 107 |
+
* @return bool
|
| 108 |
+
*
|
| 109 |
+
* @param int $order_id
|
| 110 |
+
*/
|
| 111 |
+
public static function log_commission_due( $order_id )
|
| 112 |
+
{
|
| 113 |
+
global $woocommerce;
|
| 114 |
+
|
| 115 |
+
$order = new WC_Order( $order_id );
|
| 116 |
+
$dues = WCV_Vendors::get_vendor_dues_from_order( $order, false );
|
| 117 |
+
|
| 118 |
+
foreach ( $dues as $vendor_id => $details ) {
|
| 119 |
+
|
| 120 |
+
// Only process vendor commission
|
| 121 |
+
if ( !WCV_Vendors::is_vendor( $vendor_id ) ) continue;
|
| 122 |
+
|
| 123 |
+
// See if they currently have an amount due
|
| 124 |
+
$due = WCV_Vendors::count_due_by_vendor( $vendor_id, $order_id );
|
| 125 |
+
if ( $due > 0 ) continue;
|
| 126 |
+
|
| 127 |
+
// Get the dues in an easy format for inserting to our table
|
| 128 |
+
$insert_due = array();
|
| 129 |
+
|
| 130 |
+
foreach ( $details as $key => $detail ) {
|
| 131 |
+
|
| 132 |
+
$product_id = $detail['product_id'];
|
| 133 |
+
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_date : $order->get_date_created();
|
| 134 |
+
|
| 135 |
+
$insert_due[ $product_id ] = array(
|
| 136 |
+
'order_id' => $order_id,
|
| 137 |
+
'vendor_id' => $vendor_id,
|
| 138 |
+
'product_id' => $product_id,
|
| 139 |
+
'total_due' => !empty( $insert_due[ $product_id ][ 'total_due' ] ) ? ( $detail[ 'commission' ] + $insert_due[ $product_id ][ 'total_due' ] ) : $detail[ 'commission' ],
|
| 140 |
+
'total_shipping' => !empty( $insert_due[ $product_id ][ 'total_shipping' ] ) ? ( $detail[ 'shipping' ] + $insert_due[ $product_id ][ 'total_shipping' ] ) : $detail[ 'shipping' ],
|
| 141 |
+
'tax' => !empty( $insert_due[ $product_id ][ 'tax' ] ) ? ( $detail[ 'tax' ] + $insert_due[ $product_id ][ 'tax' ] ) : $detail[ 'tax' ],
|
| 142 |
+
'qty' => !empty( $insert_due[ $product_id ][ 'qty' ] ) ? ( $detail[ 'qty' ] + $insert_due[ $product_id ][ 'qty' ] ) : $detail[ 'qty' ],
|
| 143 |
+
'time' => date( 'Y-m-d H:i:s', strtotime( $order_date ) ),
|
| 144 |
+
);
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
if ( !empty( $insert_due ) ) {
|
| 148 |
+
WCV_Commission::insert_new_commission( array_values( $insert_due ) );
|
| 149 |
+
}
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
}
|
| 153 |
+
|
| 154 |
+
|
| 155 |
+
/**
|
| 156 |
+
* Add up the totals for an order for each vendor
|
| 157 |
+
*
|
| 158 |
+
* @param int $order_id
|
| 159 |
+
*
|
| 160 |
+
* @return array
|
| 161 |
+
*/
|
| 162 |
+
public function sum_total_due_for_order( $order_id, $status = 'due' )
|
| 163 |
+
{
|
| 164 |
+
global $wpdb;
|
| 165 |
+
|
| 166 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 167 |
+
$query = "SELECT `id`, `total_due`, `total_shipping`, `tax`, `vendor_id`
|
| 168 |
+
FROM `{$table_name}`
|
| 169 |
+
WHERE `order_id` = %d
|
| 170 |
+
AND `status` = %s";
|
| 171 |
+
|
| 172 |
+
$results = $wpdb->get_results( $wpdb->prepare( $query, $order_id, 'due' ) );
|
| 173 |
+
|
| 174 |
+
foreach ( $results as $commission ) {
|
| 175 |
+
$commission_ids[ ] = $commission->id;
|
| 176 |
+
|
| 177 |
+
$pay[ $commission->vendor_id ] = !empty( $pay[ $commission->vendor_id ] )
|
| 178 |
+
? ( $pay[ $commission->vendor_id ] + ( $commission->total_due + $commission->total_shipping + $commission->tax ) )
|
| 179 |
+
: ( $commission->total_due + $commission->total_shipping + $commission->tax );
|
| 180 |
+
}
|
| 181 |
+
|
| 182 |
+
$return = array(
|
| 183 |
+
'vendors' => $pay,
|
| 184 |
+
'ids' => $commission_ids,
|
| 185 |
+
);
|
| 186 |
+
|
| 187 |
+
return $return;
|
| 188 |
+
}
|
| 189 |
+
|
| 190 |
+
|
| 191 |
+
/**
|
| 192 |
+
* Return all commission outstanding with a 'due' status
|
| 193 |
+
*
|
| 194 |
+
* @return object
|
| 195 |
+
*/
|
| 196 |
+
public static function get_all_due()
|
| 197 |
+
{
|
| 198 |
+
global $wpdb;
|
| 199 |
+
|
| 200 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 201 |
+
$where = $wpdb->prepare( 'WHERE status = %s', 'due' );
|
| 202 |
+
$where = apply_filters( 'wcvendors_commission_all_due_where', $where );
|
| 203 |
+
$query = "SELECT id, vendor_id, total_due FROM `{$table_name}` $where";
|
| 204 |
+
$query = apply_filters( 'wcvendors_commission_all_due_sql', $query );
|
| 205 |
+
$results = $wpdb->get_results( $query );
|
| 206 |
+
|
| 207 |
+
return $results;
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
/**
|
| 212 |
+
* Check if this order has commission logged already
|
| 213 |
+
*
|
| 214 |
+
* @param int $order_id
|
| 215 |
+
*
|
| 216 |
+
* @return int
|
| 217 |
+
*/
|
| 218 |
+
public static function count_commission_by_order( $order_id )
|
| 219 |
+
{
|
| 220 |
+
global $wpdb;
|
| 221 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 222 |
+
|
| 223 |
+
if ( is_array( $order_id ) )
|
| 224 |
+
$order_id = implode( ',', $order_id );
|
| 225 |
+
|
| 226 |
+
$query = "SELECT COUNT(order_id) AS order_count
|
| 227 |
+
FROM {$table_name}
|
| 228 |
+
WHERE order_id IN ($order_id)
|
| 229 |
+
AND status <> %s";
|
| 230 |
+
$count = $wpdb->get_var( $wpdb->prepare( $query, 'reversed' ) );
|
| 231 |
+
|
| 232 |
+
return $count;
|
| 233 |
+
}
|
| 234 |
+
|
| 235 |
+
/**
|
| 236 |
+
* Check the commission status for the order
|
| 237 |
+
*
|
| 238 |
+
* @param array $order
|
| 239 |
+
* @param string $status
|
| 240 |
+
*
|
| 241 |
+
* @return int
|
| 242 |
+
*/
|
| 243 |
+
public static function check_commission_status( $order, $status ) {
|
| 244 |
+
|
| 245 |
+
global $wpdb;
|
| 246 |
+
|
| 247 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 248 |
+
|
| 249 |
+
$order_id = $order[ 'order_id' ];
|
| 250 |
+
$vendor_id = $order[ 'vendor_id' ];
|
| 251 |
+
$product_id = $order[ 'product_id' ];
|
| 252 |
+
|
| 253 |
+
$query = "SELECT count(order_id) AS order_count
|
| 254 |
+
FROM {$table_name}
|
| 255 |
+
WHERE order_id = {$order_id}
|
| 256 |
+
AND vendor_id = {$vendor_id}
|
| 257 |
+
AND product_id = {$product_id}
|
| 258 |
+
AND status = %s
|
| 259 |
+
";
|
| 260 |
+
|
| 261 |
+
return $wpdb->get_var( $wpdb->prepare( $query , $status ) );
|
| 262 |
+
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
|
| 266 |
+
/**
|
| 267 |
+
* Product's commission rate in percentage form
|
| 268 |
+
*
|
| 269 |
+
* Eg: 50 for 50%
|
| 270 |
+
*
|
| 271 |
+
* @param int $product_id
|
| 272 |
+
*
|
| 273 |
+
* @return float
|
| 274 |
+
*/
|
| 275 |
+
public static function get_commission_rate( $product_id )
|
| 276 |
+
{
|
| 277 |
+
|
| 278 |
+
$commission = 0;
|
| 279 |
+
|
| 280 |
+
$parent = get_post_ancestors( $product_id );
|
| 281 |
+
if ( $parent ) $product_id = $parent[ 0 ];
|
| 282 |
+
|
| 283 |
+
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 284 |
+
|
| 285 |
+
$product_commission = get_post_meta( $product_id, 'pv_commission_rate', true );
|
| 286 |
+
$vendor_commission = WCV_Vendors::get_default_commission( $vendor_id );
|
| 287 |
+
$default_commission = WC_Vendors::$pv_options->get_option( 'default_commission' );
|
| 288 |
+
|
| 289 |
+
if ( $product_commission != '' && $product_commission !== false ) {
|
| 290 |
+
$commission = $product_commission;
|
| 291 |
+
}
|
| 292 |
+
|
| 293 |
+
else if ( $vendor_commission != '' && $vendor_commission !== false ) {
|
| 294 |
+
$commission = $vendor_commission;
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
else if ( $default_commission != '' && $default_commission !== false ) {
|
| 298 |
+
$commission = $default_commission;
|
| 299 |
+
}
|
| 300 |
+
|
| 301 |
+
return apply_filters( 'wcv_commission_rate_percent', $commission, $product_id );
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
|
| 305 |
+
/**
|
| 306 |
+
* Commission due for a product based on a rate and price
|
| 307 |
+
*
|
| 308 |
+
* @param float $product_price
|
| 309 |
+
* @param unknown $product_id
|
| 310 |
+
*
|
| 311 |
+
* @return float
|
| 312 |
+
*/
|
| 313 |
+
public static function calculate_commission( $product_price, $product_id, $order, $qty )
|
| 314 |
+
{
|
| 315 |
+
$commission_rate = WCV_Commission::get_commission_rate( $product_id );
|
| 316 |
+
$commission = $product_price * ( $commission_rate / 100 );
|
| 317 |
+
$commission = round( $commission, 2 );
|
| 318 |
+
|
| 319 |
+
return apply_filters( 'wcv_commission_rate', $commission, $product_id, $product_price, $order, $qty );
|
| 320 |
+
}
|
| 321 |
+
|
| 322 |
+
|
| 323 |
+
/**
|
| 324 |
+
* Log commission to the pv_commission table
|
| 325 |
+
*
|
| 326 |
+
* Will either update or insert to the database
|
| 327 |
+
*
|
| 328 |
+
* @param array $orders
|
| 329 |
+
*
|
| 330 |
+
* @return unknown
|
| 331 |
+
*/
|
| 332 |
+
public static function insert_new_commission( $orders = array() )
|
| 333 |
+
{
|
| 334 |
+
global $wpdb;
|
| 335 |
+
|
| 336 |
+
if ( empty( $orders ) ) return false;
|
| 337 |
+
|
| 338 |
+
$table = $wpdb->prefix . "pv_commission";
|
| 339 |
+
|
| 340 |
+
// Insert the time and default status 'due'
|
| 341 |
+
foreach ( $orders as $key => $order ) {
|
| 342 |
+
$orders[ $key ][ 'time' ] = $order['time'];
|
| 343 |
+
$orders[ $key ][ 'status' ] = ( $order['total_due'] == 0 ) ? 'paid' : 'due';
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
foreach ( $orders as $key => $order ) {
|
| 347 |
+
$where = array(
|
| 348 |
+
'order_id' => $order[ 'order_id' ],
|
| 349 |
+
'product_id' => $order[ 'product_id' ],
|
| 350 |
+
'vendor_id' => $order[ 'vendor_id' ],
|
| 351 |
+
'qty' => $order[ 'qty' ],
|
| 352 |
+
);
|
| 353 |
+
// Is the commission already paid?
|
| 354 |
+
$count = WCV_Commission::check_commission_status( $order, 'paid' );
|
| 355 |
+
|
| 356 |
+
if ( $count == 0 ) {
|
| 357 |
+
$update = $wpdb->update( $table, $order, $where );
|
| 358 |
+
if ( !$update ) $insert = $wpdb->insert( $table, $order );
|
| 359 |
+
}
|
| 360 |
+
|
| 361 |
+
}
|
| 362 |
+
|
| 363 |
+
do_action( 'wcv_commissions_inserted', $orders );
|
| 364 |
+
}
|
| 365 |
+
|
| 366 |
+
|
| 367 |
+
/**
|
| 368 |
+
* Set commission to 'paid' for an entire order
|
| 369 |
+
*
|
| 370 |
+
*
|
| 371 |
+
* @access public
|
| 372 |
+
*
|
| 373 |
+
* @param mixed $order_id An array of Order IDs or an int.
|
| 374 |
+
* @param unknown $column_ids (optional)
|
| 375 |
+
*
|
| 376 |
+
* @return bool.
|
| 377 |
+
*/
|
| 378 |
+
public static function set_order_commission_paid( $order_id, $column_ids = false )
|
| 379 |
+
{
|
| 380 |
+
global $wpdb;
|
| 381 |
+
|
| 382 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 383 |
+
|
| 384 |
+
if ( is_array( $order_id ) )
|
| 385 |
+
$order_id = implode( ',', $order_id );
|
| 386 |
+
|
| 387 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE order_id IN ($order_id)";
|
| 388 |
+
$result = $wpdb->query( $query );
|
| 389 |
+
|
| 390 |
+
return $result;
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
|
| 394 |
+
/**
|
| 395 |
+
* Set commission to 'paid' for an entire order
|
| 396 |
+
*
|
| 397 |
+
*
|
| 398 |
+
* @access public
|
| 399 |
+
*
|
| 400 |
+
* @param mixed $order_id An array of Order IDs or an int.
|
| 401 |
+
*
|
| 402 |
+
* @return bool.
|
| 403 |
+
*/
|
| 404 |
+
public static function set_vendor_commission_paid( $vendors )
|
| 405 |
+
{
|
| 406 |
+
global $wpdb;
|
| 407 |
+
|
| 408 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 409 |
+
|
| 410 |
+
if ( is_array( $vendors ) )
|
| 411 |
+
$vendors = implode( ',', $vendors );
|
| 412 |
+
|
| 413 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id IN ($vendors)";
|
| 414 |
+
$result = $wpdb->query( $query );
|
| 415 |
+
|
| 416 |
+
return $result;
|
| 417 |
+
}
|
| 418 |
+
|
| 419 |
+
|
| 420 |
+
/**
|
| 421 |
+
* Set commission to 'paid' for a specifc vendor
|
| 422 |
+
*
|
| 423 |
+
*
|
| 424 |
+
* @access public
|
| 425 |
+
*
|
| 426 |
+
* @param int $vendor_id the vendor id
|
| 427 |
+
* @param int $product_id the product id
|
| 428 |
+
* @param int $order_id the order id
|
| 429 |
+
*
|
| 430 |
+
* @return bool.
|
| 431 |
+
*/
|
| 432 |
+
public static function set_vendor_product_commission_paid( $vendor_id, $product_id, $order_id )
|
| 433 |
+
{
|
| 434 |
+
global $wpdb;
|
| 435 |
+
|
| 436 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 437 |
+
|
| 438 |
+
$query = "UPDATE `{$table_name}` SET `status` = 'paid' WHERE vendor_id = $vendor_id AND order_id = $order_id AND product_id = $product_id";
|
| 439 |
+
$result = $wpdb->query( $query );
|
| 440 |
+
|
| 441 |
+
return $result;
|
| 442 |
+
}
|
| 443 |
+
|
| 444 |
+
/**
|
| 445 |
+
* If an order is deleted reverse the commissions rows
|
| 446 |
+
*
|
| 447 |
+
* @since 1.9.2
|
| 448 |
+
* @access public
|
| 449 |
+
* @param int $order_id the order id
|
| 450 |
+
*
|
| 451 |
+
* @return bool.
|
| 452 |
+
*/
|
| 453 |
+
public function commissions_table_sync( $order_id ){
|
| 454 |
+
|
| 455 |
+
global $wpdb;
|
| 456 |
+
|
| 457 |
+
// Check if this order exists in the commissions table
|
| 458 |
+
$count = WCV_Commission::count_commission_by_order( $order_id );
|
| 459 |
+
if ( !$count ) return false;
|
| 460 |
+
|
| 461 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 462 |
+
|
| 463 |
+
$query = "UPDATE `{$table_name}` SET `status` = '%s' WHERE order_id = '%d'";
|
| 464 |
+
$results = $wpdb->query( $wpdb->prepare( $query, 'reversed', $order_id ) );
|
| 465 |
+
|
| 466 |
+
|
| 467 |
+
} // commissions_table_sync()
|
| 468 |
+
|
| 469 |
+
|
| 470 |
+
/**
|
| 471 |
+
* Get the commission total for a specific vendor.
|
| 472 |
+
*
|
| 473 |
+
* @since 1.9.6
|
| 474 |
+
* @access public
|
| 475 |
+
* @param int $vendor_id the vendor id to search for
|
| 476 |
+
* @param string $status the status to look for
|
| 477 |
+
* @return object $totals as an object
|
| 478 |
+
*/
|
| 479 |
+
public static function commissions_now( $vendor_id, $status = 'due', $inc_shipping = false, $inc_tax = false ){
|
| 480 |
+
|
| 481 |
+
global $wpdb;
|
| 482 |
+
|
| 483 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 484 |
+
|
| 485 |
+
$sql = "SELECT sum( `total_due` ) as total_due";
|
| 486 |
+
|
| 487 |
+
if ( $inc_shipping ) $sql .= ", sum( `total_shipping` ) as total_shipping";
|
| 488 |
+
if ( $inc_tax ) $sql .= ", sum( `tax` ) as total_tax ";
|
| 489 |
+
|
| 490 |
+
$sql .= "
|
| 491 |
+
FROM `{$table_name}`
|
| 492 |
+
WHERE vendor_id = {$vendor_id}
|
| 493 |
+
AND status = '{$status}'
|
| 494 |
+
";
|
| 495 |
+
|
| 496 |
+
$results = $wpdb->get_row( $sql );
|
| 497 |
+
|
| 498 |
+
$commissions_now = array_filter( get_object_vars( $results ) );
|
| 499 |
+
|
| 500 |
+
if ( empty( $commissions_now ) ) $results = false;
|
| 501 |
+
|
| 502 |
+
return $results;
|
| 503 |
+
|
| 504 |
+
} // commissions_now()
|
| 505 |
+
|
| 506 |
+
|
| 507 |
+
/**
|
| 508 |
+
* Get the commission for a specific order, product and vendor
|
| 509 |
+
*
|
| 510 |
+
* @since 1.9.9
|
| 511 |
+
* @access public
|
| 512 |
+
* @param int $order_id the order id to search for
|
| 513 |
+
* @param int $product_id the product id to search for
|
| 514 |
+
* @param int $vendor_id the vendor id to search for
|
| 515 |
+
*/
|
| 516 |
+
public static function get_commission_due( $order_id, $product_id, $vendor_id ){
|
| 517 |
+
|
| 518 |
+
global $wpdb;
|
| 519 |
+
|
| 520 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 521 |
+
|
| 522 |
+
$sql = "SELECT total_due";
|
| 523 |
+
|
| 524 |
+
$sql .= "
|
| 525 |
+
FROM `{$table_name}`
|
| 526 |
+
WHERE vendor_id = {$vendor_id}
|
| 527 |
+
AND product_id = '{$product_id}'
|
| 528 |
+
AND order_id = '{$order_id}'
|
| 529 |
+
";
|
| 530 |
+
|
| 531 |
+
$commission_due = $wpdb->get_var( $sql );
|
| 532 |
+
|
| 533 |
+
return $commission_due;
|
| 534 |
+
|
| 535 |
+
} // get_commission_due()
|
| 536 |
+
|
| 537 |
+
}
|
trunk/classes/class-cron.php
ADDED
|
@@ -0,0 +1,171 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Cron class
|
| 4 |
+
*
|
| 5 |
+
* @package WC_Vendors
|
| 6 |
+
*/
|
| 7 |
+
|
| 8 |
+
|
| 9 |
+
class WCV_Cron
|
| 10 |
+
{
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* Constructor
|
| 15 |
+
*/
|
| 16 |
+
function __construct()
|
| 17 |
+
{
|
| 18 |
+
add_filter( 'cron_schedules', array( 'WCV_Cron', 'custom_cron_intervals' ) );
|
| 19 |
+
add_action( WC_Vendors::$id . '_options_updated', array( 'WCV_Cron', 'check_schedule' ) );
|
| 20 |
+
add_filter( WC_Vendors::$id . '_options_on_update', array( 'WCV_Cron', 'check_schedule_now' ) );
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Re-add cron schedule when the settings have been updated
|
| 26 |
+
*
|
| 27 |
+
* @param array
|
| 28 |
+
* @param unknown $options
|
| 29 |
+
*/
|
| 30 |
+
public static function check_schedule( $options )
|
| 31 |
+
{
|
| 32 |
+
$old_interval = wp_get_schedule( 'pv_schedule_mass_payments' );
|
| 33 |
+
$new_interval = $options[ 'schedule' ];
|
| 34 |
+
$instapay = $options[ 'instapay' ];
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* 1. The user actually changed the schedule
|
| 38 |
+
* 2. Instapay is turned off
|
| 39 |
+
* 3. Manual was not selected
|
| 40 |
+
*/
|
| 41 |
+
if ( ( $old_interval != $new_interval ) && !$instapay && $new_interval != 'manual' ) {
|
| 42 |
+
WCV_Cron::remove_cron_schedule( $options );
|
| 43 |
+
WCV_Cron::schedule_cron( $new_interval );
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if ( $new_interval == 'manual' || $instapay ) {
|
| 47 |
+
WCV_Cron::remove_cron_schedule( $options );
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
|
| 53 |
+
/**
|
| 54 |
+
* Check if the user chose "Now" on the Schedule settings
|
| 55 |
+
*
|
| 56 |
+
* @param array $options
|
| 57 |
+
*
|
| 58 |
+
* @return array
|
| 59 |
+
*/
|
| 60 |
+
public static function check_schedule_now( $options )
|
| 61 |
+
{
|
| 62 |
+
$old_schedule = WC_Vendors::$pv_options->get_option( 'schedule' );
|
| 63 |
+
$new_schedule = $options[ 'schedule' ];
|
| 64 |
+
|
| 65 |
+
if ( $new_schedule == 'now' ) {
|
| 66 |
+
$return = WCV_Cron::pay_now();
|
| 67 |
+
$options[ 'schedule' ] = $old_schedule;
|
| 68 |
+
WCV_Cron::schedule_cron( $old_schedule );
|
| 69 |
+
add_settings_error( WC_Vendors::$pv_options->id, 'save_options', $return[ 'message' ], $return[ 'status' ] );
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
return $options;
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
|
| 76 |
+
/**
|
| 77 |
+
* Pay all outstanding commission using Paypal Mass Pay
|
| 78 |
+
*
|
| 79 |
+
* @return array
|
| 80 |
+
*/
|
| 81 |
+
public static function pay_now()
|
| 82 |
+
{
|
| 83 |
+
$mass_pay = new WCV_Mass_Pay;
|
| 84 |
+
$mass_pay = $mass_pay->do_payments();
|
| 85 |
+
|
| 86 |
+
$message = !empty( $mass_pay[ 'total' ] )
|
| 87 |
+
? $mass_pay[ 'msg' ] . '<br/>' . sprintf( __( 'Payment total: %s', 'wcvendors' ), wc_price( $mass_pay[ 'total' ] ) )
|
| 88 |
+
: $mass_pay[ 'msg' ];
|
| 89 |
+
|
| 90 |
+
return array(
|
| 91 |
+
'message' => $message,
|
| 92 |
+
'status' => $mass_pay[ 'status' ]
|
| 93 |
+
);
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
* Remove the mass payments schedule
|
| 99 |
+
*
|
| 100 |
+
* @return bool
|
| 101 |
+
*/
|
| 102 |
+
private static function remove_cron_schedule()
|
| 103 |
+
{
|
| 104 |
+
$timestamp = wp_next_scheduled( 'pv_schedule_mass_payments' );
|
| 105 |
+
|
| 106 |
+
return wp_unschedule_event( $timestamp, 'pv_schedule_mass_payments' );
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Schedule a cron event on a specified interval
|
| 112 |
+
*
|
| 113 |
+
* @param string $interval
|
| 114 |
+
*
|
| 115 |
+
* @return bool
|
| 116 |
+
*/
|
| 117 |
+
public static function schedule_cron( $interval )
|
| 118 |
+
{
|
| 119 |
+
// Scheduled event
|
| 120 |
+
add_action( 'pv_schedule_mass_payments', array( 'WCV_Cron', 'pay_now' ) );
|
| 121 |
+
|
| 122 |
+
// Schedule the event
|
| 123 |
+
if ( !wp_next_scheduled( 'pv_schedule_mass_payments' ) ) {
|
| 124 |
+
wp_schedule_event( time(), $interval, 'pv_schedule_mass_payments' );
|
| 125 |
+
|
| 126 |
+
return true;
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
return false;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
/**
|
| 134 |
+
* Add new schedule intervals to WP
|
| 135 |
+
*
|
| 136 |
+
* Weekly
|
| 137 |
+
* Biweekly
|
| 138 |
+
* Monthly
|
| 139 |
+
*
|
| 140 |
+
* @param array $schedules
|
| 141 |
+
*
|
| 142 |
+
* @return array
|
| 143 |
+
*/
|
| 144 |
+
public static function custom_cron_intervals( $schedules )
|
| 145 |
+
{
|
| 146 |
+
|
| 147 |
+
$schedules[ 'daily' ] = array(
|
| 148 |
+
'interval' => 86400,
|
| 149 |
+
'display' => __( 'Once Daily' )
|
| 150 |
+
);
|
| 151 |
+
|
| 152 |
+
$schedules[ 'weekly' ] = array(
|
| 153 |
+
'interval' => 604800,
|
| 154 |
+
'display' => __( 'Once Weekly' )
|
| 155 |
+
);
|
| 156 |
+
|
| 157 |
+
$schedules[ 'biweekly' ] = array(
|
| 158 |
+
'interval' => 1209600,
|
| 159 |
+
'display' => __( 'Once every two weeks' )
|
| 160 |
+
);
|
| 161 |
+
|
| 162 |
+
$schedules[ 'monthly' ] = array(
|
| 163 |
+
'interval' => 2635200,
|
| 164 |
+
'display' => __( 'Once a month' )
|
| 165 |
+
);
|
| 166 |
+
|
| 167 |
+
return $schedules;
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
|
| 171 |
+
}
|
trunk/classes/class-install.php
ADDED
|
@@ -0,0 +1,286 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Install class on activation.
|
| 4 |
+
*
|
| 5 |
+
* @author Matt Gates <http://mgates.me>
|
| 6 |
+
* @package ProductVendor
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
|
| 10 |
+
class WCV_Install
|
| 11 |
+
{
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* Checks if install is requierd
|
| 15 |
+
*
|
| 16 |
+
* @return unknown
|
| 17 |
+
*/
|
| 18 |
+
public function init()
|
| 19 |
+
{
|
| 20 |
+
$db_version = WC_Vendors::$pv_options->get_option( 'db_version' );
|
| 21 |
+
|
| 22 |
+
// Initial Install
|
| 23 |
+
if ( version_compare( $db_version, '1.0', '<' ) ) {
|
| 24 |
+
|
| 25 |
+
$this->install_wcvendor();
|
| 26 |
+
WC_Vendors::$pv_options->update_option( 'db_version', '1.5.0' );
|
| 27 |
+
|
| 28 |
+
} else if ( version_compare( $db_version, '1.9.0', '<' ) ) {
|
| 29 |
+
|
| 30 |
+
$orders_page = get_post( WC_Vendors::$pv_options->get_option( 'orders_page' ) );
|
| 31 |
+
|
| 32 |
+
// Only update the page slug for orders if it is called orders
|
| 33 |
+
// This is due to WC 2.6 api changes
|
| 34 |
+
if ( is_object( $orders_page ) ) {
|
| 35 |
+
|
| 36 |
+
if ( $orders_page && $orders_page->post_name === 'orders' ){
|
| 37 |
+
|
| 38 |
+
wp_update_post(
|
| 39 |
+
array (
|
| 40 |
+
'ID' => $orders_page->ID,
|
| 41 |
+
'post_name' => 'product_orders'
|
| 42 |
+
)
|
| 43 |
+
);
|
| 44 |
+
|
| 45 |
+
WC_Vendors::$pv_options->update_option( 'db_version', '1.9.0' );
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
} else if ( version_compare( $db_version, '1.9.1', '<' ) ) {
|
| 50 |
+
remove_role( 'vendor' );
|
| 51 |
+
add_role( 'vendor', __('Vendor', 'wcvendors') , array(
|
| 52 |
+
'assign_product_terms' => true,
|
| 53 |
+
'edit_products' => true,
|
| 54 |
+
'edit_product' => true,
|
| 55 |
+
'edit_published_products' => false,
|
| 56 |
+
'manage_product' => true,
|
| 57 |
+
'publish_products' => false,
|
| 58 |
+
'delete_posts' => true,
|
| 59 |
+
'read' => true,
|
| 60 |
+
'upload_files' => true,
|
| 61 |
+
'view_woocommerce_reports' => false,
|
| 62 |
+
) );
|
| 63 |
+
|
| 64 |
+
WC_Vendors::$pv_options->update_option( 'db_version', '1.9.1' );
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
} // init()
|
| 68 |
+
|
| 69 |
+
|
| 70 |
+
/**
|
| 71 |
+
* Grouped functions for installing the WC Vendor plugin
|
| 72 |
+
*/
|
| 73 |
+
private function install_wcvendor()
|
| 74 |
+
{
|
| 75 |
+
// Clear the cron
|
| 76 |
+
wp_clear_scheduled_hook( 'pv_schedule_mass_payments' );
|
| 77 |
+
|
| 78 |
+
// Add the vendors role
|
| 79 |
+
$this->add_new_roles();
|
| 80 |
+
|
| 81 |
+
// Create tables
|
| 82 |
+
$this->create_new_tables();
|
| 83 |
+
|
| 84 |
+
// Create the Orders page if it doesn't exist
|
| 85 |
+
$orders_page = WC_Vendors::$pv_options->get_option( 'orders_page' );
|
| 86 |
+
if ( empty( $orders_page ) ) $this->create_new_pages();
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
/**
|
| 91 |
+
* Add the new Vendor role
|
| 92 |
+
*
|
| 93 |
+
* @return bool
|
| 94 |
+
*/
|
| 95 |
+
private function add_new_roles()
|
| 96 |
+
{
|
| 97 |
+
remove_role( 'pending_vendor' );
|
| 98 |
+
add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
|
| 99 |
+
'read' => true,
|
| 100 |
+
'edit_posts' => false,
|
| 101 |
+
'delete_posts' => false
|
| 102 |
+
) );
|
| 103 |
+
|
| 104 |
+
remove_role( 'vendor' );
|
| 105 |
+
add_role( 'vendor', __('Vendor', 'wcvendors') , array(
|
| 106 |
+
'assign_product_terms' => true,
|
| 107 |
+
'edit_products' => true,
|
| 108 |
+
'edit_product' => true,
|
| 109 |
+
'edit_published_products' => false,
|
| 110 |
+
'manage_product' => true,
|
| 111 |
+
'publish_products' => false,
|
| 112 |
+
'delete_posts' => true,
|
| 113 |
+
'read' => true,
|
| 114 |
+
'upload_files' => true,
|
| 115 |
+
'view_woocommerce_reports' => false,
|
| 116 |
+
) );
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
/**
|
| 121 |
+
* Create the pv_commission table
|
| 122 |
+
*/
|
| 123 |
+
private function create_new_tables()
|
| 124 |
+
{
|
| 125 |
+
global $wpdb;
|
| 126 |
+
|
| 127 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 128 |
+
require_once ABSPATH . 'wp-admin/includes/upgrade.php';
|
| 129 |
+
|
| 130 |
+
$sql = "CREATE TABLE $table_name (
|
| 131 |
+
id bigint(20) NOT NULL AUTO_INCREMENT,
|
| 132 |
+
product_id bigint(20) NOT NULL,
|
| 133 |
+
order_id bigint(20) NOT NULL,
|
| 134 |
+
vendor_id bigint(20) NOT NULL,
|
| 135 |
+
total_due decimal(20,2) NOT NULL,
|
| 136 |
+
qty BIGINT( 20 ) NOT NULL,
|
| 137 |
+
total_shipping decimal(20,2) NOT NULL,
|
| 138 |
+
tax decimal(20,2) NOT NULL,
|
| 139 |
+
status varchar(20) NOT NULL DEFAULT 'due',
|
| 140 |
+
time datetime DEFAULT '0000-00-00 00:00:00' NOT NULL,
|
| 141 |
+
UNIQUE KEY id (id)
|
| 142 |
+
);";
|
| 143 |
+
dbDelta( $sql );
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
|
| 147 |
+
/**
|
| 148 |
+
* Create a page
|
| 149 |
+
*
|
| 150 |
+
* @access public
|
| 151 |
+
* @return void
|
| 152 |
+
*
|
| 153 |
+
* @param mixed $slug Slug for the new page
|
| 154 |
+
* @param mixed $option Option name to store the page's ID
|
| 155 |
+
* @param string $page_title (optional) (default: '') Title for the new page
|
| 156 |
+
* @param string $page_content (optional) (default: '') Content for the new page
|
| 157 |
+
* @param int $post_parent (optional) (default: 0) Parent for the new page
|
| 158 |
+
*/
|
| 159 |
+
function create_page( $slug, $page_title = '', $page_content = '', $post_parent = 0 )
|
| 160 |
+
{
|
| 161 |
+
global $wpdb;
|
| 162 |
+
|
| 163 |
+
$page_id = WC_Vendors::$pv_options->get_option( $slug . '_page' );
|
| 164 |
+
|
| 165 |
+
if ( $page_id > 0 && get_post( $page_id ) ) {
|
| 166 |
+
return $page_id;
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
$page_found = $wpdb->get_var( $wpdb->prepare( "SELECT ID FROM " . $wpdb->posts . " WHERE post_name = %s LIMIT 1;", $slug ) );
|
| 170 |
+
if ( $page_found ) {
|
| 171 |
+
if ( !$page_id ) {
|
| 172 |
+
WC_Vendors::$pv_options->update_option( $slug . '_page', $page_found );
|
| 173 |
+
|
| 174 |
+
return $page_found;
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
return $page_id;
|
| 178 |
+
}
|
| 179 |
+
|
| 180 |
+
$page_data = array(
|
| 181 |
+
'post_status' => 'publish',
|
| 182 |
+
'post_type' => 'page',
|
| 183 |
+
'post_author' => 1,
|
| 184 |
+
'post_name' => $slug,
|
| 185 |
+
'post_title' => $page_title,
|
| 186 |
+
'post_content' => $page_content,
|
| 187 |
+
'post_parent' => $post_parent,
|
| 188 |
+
'comment_status' => 'closed'
|
| 189 |
+
);
|
| 190 |
+
|
| 191 |
+
$page_id = wp_insert_post( $page_data );
|
| 192 |
+
WC_Vendors::$pv_options->update_option( $slug . '_page', $page_id );
|
| 193 |
+
|
| 194 |
+
return $page_id;
|
| 195 |
+
}
|
| 196 |
+
|
| 197 |
+
|
| 198 |
+
/**
|
| 199 |
+
* Create the Orders page for the frontend
|
| 200 |
+
*/
|
| 201 |
+
private function create_new_pages()
|
| 202 |
+
{
|
| 203 |
+
global $wpdb;
|
| 204 |
+
|
| 205 |
+
$vendor_page_id = $this->create_page( 'vendor_dashboard', __( 'Vendor Dashboard', 'wcvendors' ), '[wcv_vendor_dashboard]' );
|
| 206 |
+
$this->create_page( 'product_orders', __( 'Orders', 'wcvendors' ), '[wcv_orders]', $vendor_page_id );
|
| 207 |
+
$this->create_page( 'shop_settings', __( 'Shop Settings', 'wcvendors' ), '[wcv_shop_settings]', $vendor_page_id );
|
| 208 |
+
}
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
/**
|
| 212 |
+
* Depreciated
|
| 213 |
+
*
|
| 214 |
+
* @param unknown $version
|
| 215 |
+
*/
|
| 216 |
+
public function update_to( $version )
|
| 217 |
+
{
|
| 218 |
+
global $wpdb;
|
| 219 |
+
|
| 220 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 221 |
+
|
| 222 |
+
switch ( $version ) {
|
| 223 |
+
|
| 224 |
+
case '1.3.2':
|
| 225 |
+
|
| 226 |
+
$sql = "ALTER TABLE `{$table_name}` ADD `qty` BIGINT( 20 ) NOT NULL AFTER `total_due`";
|
| 227 |
+
$wpdb->query( $sql );
|
| 228 |
+
|
| 229 |
+
$sql = "SELECT * FROM `{$table_name}`";
|
| 230 |
+
$results = $wpdb->get_results( $sql );
|
| 231 |
+
foreach ( $results as $key => $value ) {
|
| 232 |
+
|
| 233 |
+
$order = new WC_Order( $value->order_id );
|
| 234 |
+
|
| 235 |
+
foreach ( $order->get_items() as $o_key => $o_value ) {
|
| 236 |
+
|
| 237 |
+
if ( $value->product_id == $o_value[ 'product_id' ] || ( !empty( $o_value[ 'variation_id' ] ) && $value->product_id == $o_value[ 'variation_id' ] ) ) {
|
| 238 |
+
$wpdb->update(
|
| 239 |
+
$table_name,
|
| 240 |
+
array( 'qty' => $o_value[ 'qty' ] ),
|
| 241 |
+
array( 'id' => $value->id ),
|
| 242 |
+
array( '%d' ),
|
| 243 |
+
array( '%d' )
|
| 244 |
+
);
|
| 245 |
+
}
|
| 246 |
+
}
|
| 247 |
+
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
break;
|
| 251 |
+
|
| 252 |
+
case '1.4.0':
|
| 253 |
+
|
| 254 |
+
add_role( 'pending_vendor', __( 'Pending Vendor', 'wcvendors' ), array(
|
| 255 |
+
'read' => true,
|
| 256 |
+
'edit_posts' => false,
|
| 257 |
+
'delete_posts' => false
|
| 258 |
+
) );
|
| 259 |
+
|
| 260 |
+
$this->create_new_pages();
|
| 261 |
+
|
| 262 |
+
break;
|
| 263 |
+
|
| 264 |
+
case '1.4.2':
|
| 265 |
+
|
| 266 |
+
$sql = "ALTER TABLE `{$table_name}` ADD `total_shipping` decimal(20,2) NOT NULL AFTER `total_due`";
|
| 267 |
+
$wpdb->query( $sql );
|
| 268 |
+
|
| 269 |
+
case '1.4.3':
|
| 270 |
+
|
| 271 |
+
$sql = "ALTER TABLE `{$table_name}` ADD `tax` decimal(20,2) NOT NULL AFTER `total_shipping`";
|
| 272 |
+
$wpdb->query( $sql );
|
| 273 |
+
|
| 274 |
+
case '1.4.5':
|
| 275 |
+
|
| 276 |
+
// Flush rules to fix the /page/2/ issue on vendor shop pages
|
| 277 |
+
update_option( WC_Vendors::$id . '_flush_rules', true );
|
| 278 |
+
|
| 279 |
+
default:
|
| 280 |
+
// code...
|
| 281 |
+
break;
|
| 282 |
+
}
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
|
| 286 |
+
}
|
trunk/classes/class-queries.php
ADDED
|
@@ -0,0 +1,284 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class WCV_Queries
|
| 4 |
+
{
|
| 5 |
+
|
| 6 |
+
/**
|
| 7 |
+
*
|
| 8 |
+
*
|
| 9 |
+
* @param unknown $user_id
|
| 10 |
+
*
|
| 11 |
+
* @return unknown
|
| 12 |
+
*/
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
public static function get_commission_products( $user_id )
|
| 16 |
+
{
|
| 17 |
+
global $wpdb;
|
| 18 |
+
|
| 19 |
+
$dates = WCV_Queries::orders_within_range();
|
| 20 |
+
$vendor_products = array();
|
| 21 |
+
$sql = '';
|
| 22 |
+
|
| 23 |
+
$sql .= "SELECT product_id FROM {$wpdb->prefix}pv_commission WHERE vendor_id = {$user_id} ";
|
| 24 |
+
|
| 25 |
+
if ( !empty( $dates ) ) {
|
| 26 |
+
$sql .= "AND time >= '" . $dates[ 'after' ] . "' AND time <= '" . $dates[ 'before' ] . "'";
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
$sql .= " AND status != 'reversed' GROUP BY product_id";
|
| 30 |
+
|
| 31 |
+
$results = $wpdb->get_results( $sql );
|
| 32 |
+
|
| 33 |
+
foreach ( $results as $value ) {
|
| 34 |
+
$ids[ ] = $value->product_id;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
if ( !empty( $ids ) ) {
|
| 38 |
+
$vendor_products = get_posts( array(
|
| 39 |
+
'numberposts' => -1,
|
| 40 |
+
'orderby' => 'post_date',
|
| 41 |
+
'post_type' => array( 'product', 'product_variation' ),
|
| 42 |
+
'order' => 'DESC',
|
| 43 |
+
'include' => $ids
|
| 44 |
+
)
|
| 45 |
+
);
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
return $vendor_products;
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
*
|
| 53 |
+
*
|
| 54 |
+
* @param unknown $order_id
|
| 55 |
+
*
|
| 56 |
+
* @return unknown
|
| 57 |
+
*/
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
public static function get_products_for_order( $order_id )
|
| 61 |
+
{
|
| 62 |
+
global $wpdb;
|
| 63 |
+
|
| 64 |
+
$vendor_products = array();
|
| 65 |
+
|
| 66 |
+
$results = $wpdb->get_results( "
|
| 67 |
+
SELECT product_id
|
| 68 |
+
FROM {$wpdb->prefix}pv_commission
|
| 69 |
+
WHERE order_id = {$order_id}
|
| 70 |
+
AND status != 'reversed'
|
| 71 |
+
AND vendor_id = " . get_current_user_id() . "
|
| 72 |
+
GROUP BY product_id" );
|
| 73 |
+
|
| 74 |
+
foreach ( $results as $value ) {
|
| 75 |
+
$ids[ ] = $value->product_id;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
return $ids;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
|
| 82 |
+
/**
|
| 83 |
+
* All orders for a specific product
|
| 84 |
+
*
|
| 85 |
+
* @param array $product_ids
|
| 86 |
+
* @param array $args (optional)
|
| 87 |
+
*
|
| 88 |
+
* @return object
|
| 89 |
+
*/
|
| 90 |
+
public static function get_orders_for_products( array $product_ids, array $args = array() )
|
| 91 |
+
{
|
| 92 |
+
global $wpdb;
|
| 93 |
+
|
| 94 |
+
if ( empty( $product_ids ) ) return false;
|
| 95 |
+
|
| 96 |
+
$dates = WCV_Queries::orders_within_range();
|
| 97 |
+
|
| 98 |
+
$defaults = array(
|
| 99 |
+
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 100 |
+
'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
|
| 101 |
+
);
|
| 102 |
+
|
| 103 |
+
$args = wp_parse_args( $args, $defaults );
|
| 104 |
+
|
| 105 |
+
|
| 106 |
+
$sql = "
|
| 107 |
+
SELECT order_id
|
| 108 |
+
FROM {$wpdb->prefix}pv_commission as order_items
|
| 109 |
+
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 110 |
+
AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
|
| 111 |
+
AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
|
| 112 |
+
AND status != 'reversed'
|
| 113 |
+
";
|
| 114 |
+
|
| 115 |
+
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 116 |
+
$sql .= "
|
| 117 |
+
AND vendor_id = {$args['vendor_id']}
|
| 118 |
+
";
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
$sql .= "
|
| 122 |
+
GROUP BY order_id
|
| 123 |
+
ORDER BY time DESC
|
| 124 |
+
";
|
| 125 |
+
|
| 126 |
+
$orders = $wpdb->get_results( $sql );
|
| 127 |
+
|
| 128 |
+
return $orders;
|
| 129 |
+
}
|
| 130 |
+
|
| 131 |
+
|
| 132 |
+
/**
|
| 133 |
+
* Sum of orders for a specific product
|
| 134 |
+
*
|
| 135 |
+
* @param array $product_ids
|
| 136 |
+
* @param array $args (optional)
|
| 137 |
+
*
|
| 138 |
+
* @return object
|
| 139 |
+
*/
|
| 140 |
+
public static function sum_orders_for_products( array $product_ids, array $args = array() )
|
| 141 |
+
{
|
| 142 |
+
global $wpdb;
|
| 143 |
+
|
| 144 |
+
$dates = WCV_Queries::orders_within_range();
|
| 145 |
+
|
| 146 |
+
$defaults = array(
|
| 147 |
+
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 148 |
+
'dates' => array( 'before' => $dates[ 'before' ], 'after' => $dates[ 'after' ] ),
|
| 149 |
+
);
|
| 150 |
+
|
| 151 |
+
foreach ( $product_ids as $id ) {
|
| 152 |
+
$posts = get_posts( array(
|
| 153 |
+
'numberposts' => -1,
|
| 154 |
+
'post_type' => 'product_variation',
|
| 155 |
+
'post_parent' => $id,
|
| 156 |
+
)
|
| 157 |
+
);
|
| 158 |
+
|
| 159 |
+
if ( !empty( $posts ) ) {
|
| 160 |
+
foreach ( $posts as $post ) {
|
| 161 |
+
$product_ids[ ] = $post->ID;
|
| 162 |
+
}
|
| 163 |
+
}
|
| 164 |
+
}
|
| 165 |
+
|
| 166 |
+
$args = wp_parse_args( $args, $defaults );
|
| 167 |
+
|
| 168 |
+
$sql = "
|
| 169 |
+
SELECT COUNT(order_id) as total_orders,
|
| 170 |
+
SUM(total_due + total_shipping + tax) as line_total,
|
| 171 |
+
SUM(qty) as qty,
|
| 172 |
+
product_id
|
| 173 |
+
|
| 174 |
+
FROM {$wpdb->prefix}pv_commission
|
| 175 |
+
|
| 176 |
+
WHERE product_id IN ('" . implode( "','", $product_ids ) . "')
|
| 177 |
+
AND time >= '" . $args[ 'dates' ][ 'after' ] . "'
|
| 178 |
+
AND time <= '" . $args[ 'dates' ][ 'before' ] . "'
|
| 179 |
+
AND status != 'reversed'
|
| 180 |
+
";
|
| 181 |
+
|
| 182 |
+
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 183 |
+
$sql .= "
|
| 184 |
+
AND vendor_id = {$args['vendor_id']}
|
| 185 |
+
";
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
$sql .= "
|
| 189 |
+
GROUP BY product_id
|
| 190 |
+
ORDER BY time DESC;
|
| 191 |
+
";
|
| 192 |
+
|
| 193 |
+
$orders = $wpdb->get_results( $sql );
|
| 194 |
+
|
| 195 |
+
return $orders;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
|
| 199 |
+
/**
|
| 200 |
+
* Sum of orders for a specific order
|
| 201 |
+
*
|
| 202 |
+
* @param array $order_ids
|
| 203 |
+
* @param array $args (optional)
|
| 204 |
+
*
|
| 205 |
+
* @return object
|
| 206 |
+
*/
|
| 207 |
+
public static function sum_for_orders( array $order_ids, array $args = array(), $date_range = true )
|
| 208 |
+
{
|
| 209 |
+
global $wpdb;
|
| 210 |
+
|
| 211 |
+
$dates = ( $date_range ) ? WCV_Queries::orders_within_range() : array();
|
| 212 |
+
|
| 213 |
+
$defaults = array(
|
| 214 |
+
'status' => apply_filters( 'wcvendors_completed_statuses', array( 'completed', 'processing' ) ),
|
| 215 |
+
);
|
| 216 |
+
|
| 217 |
+
$args = wp_parse_args( $args, $defaults );
|
| 218 |
+
|
| 219 |
+
$sql = "
|
| 220 |
+
SELECT COUNT(order_id) as total_orders,
|
| 221 |
+
SUM(total_due + total_shipping + tax) as line_total,
|
| 222 |
+
SUM(qty) as qty,
|
| 223 |
+
product_id
|
| 224 |
+
|
| 225 |
+
FROM {$wpdb->prefix}pv_commission
|
| 226 |
+
|
| 227 |
+
WHERE order_id IN ('" . implode( "','", $order_ids ) . "')
|
| 228 |
+
AND status != 'reversed'
|
| 229 |
+
";
|
| 230 |
+
|
| 231 |
+
if ( !empty ( $dates ) ){
|
| 232 |
+
$sql .= "
|
| 233 |
+
AND time >= '" . $dates[ 'after' ] . "'
|
| 234 |
+
AND time <= '" . $dates[ 'before' ] . "'
|
| 235 |
+
";
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
if ( !empty( $args[ 'vendor_id' ] ) ) {
|
| 239 |
+
$sql .= "
|
| 240 |
+
AND vendor_id = {$args['vendor_id']}
|
| 241 |
+
";
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
$sql .= "
|
| 245 |
+
GROUP BY order_id
|
| 246 |
+
ORDER BY time DESC;
|
| 247 |
+
";
|
| 248 |
+
|
| 249 |
+
$orders = $wpdb->get_results( $sql );
|
| 250 |
+
|
| 251 |
+
return $orders;
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
|
| 255 |
+
/**
|
| 256 |
+
* Orders for range filter function
|
| 257 |
+
*
|
| 258 |
+
* @return array
|
| 259 |
+
*/
|
| 260 |
+
public static function orders_within_range()
|
| 261 |
+
{
|
| 262 |
+
global $start_date, $end_date;
|
| 263 |
+
|
| 264 |
+
$start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 265 |
+
$end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 266 |
+
|
| 267 |
+
if ( !empty( $_POST[ 'start_date' ] ) ) {
|
| 268 |
+
$start_date = strtotime( $_POST[ 'start_date' ] );
|
| 269 |
+
$_SESSION[ 'PV_Session' ][ 'start_date' ] = $start_date;
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
if ( !empty( $_POST[ 'end_date' ] ) ) {
|
| 273 |
+
$end_date = strtotime( $_POST[ 'end_date' ] );
|
| 274 |
+
$_SESSION[ 'PV_Session' ][ 'end_date' ] = $end_date;
|
| 275 |
+
}
|
| 276 |
+
|
| 277 |
+
$after = date( 'Y-m-d', $start_date );
|
| 278 |
+
$before = date( 'Y-m-d', strtotime( '+1 day', $end_date ) );
|
| 279 |
+
|
| 280 |
+
return apply_filters( 'wcvendors_orders_date_range', array( 'after' => $after, 'before' => $before ) );
|
| 281 |
+
}
|
| 282 |
+
|
| 283 |
+
|
| 284 |
+
}
|
trunk/classes/class-shipping.php
ADDED
|
@@ -0,0 +1,331 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Shipping functions
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>, WC Vendors <http://wcvendors.com>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Shipping
|
| 12 |
+
{
|
| 13 |
+
public static $trs2_shipping_rates;
|
| 14 |
+
public static $trs2_shipping_calc_type;
|
| 15 |
+
public static $pps_shipping_costs = array();
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
/**
|
| 19 |
+
* Constructor
|
| 20 |
+
*/
|
| 21 |
+
function __construct()
|
| 22 |
+
{
|
| 23 |
+
// Table Rate Shipping 2 by WooThemes
|
| 24 |
+
if ( function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) {
|
| 25 |
+
// add_action( 'wp', array( $this, 'trs2_clear_transients' ) );
|
| 26 |
+
add_action( 'woocommerce_checkout_update_order_meta', array( 'WCV_Shipping', 'trs2_add_shipping_data' ), 1, 2 );
|
| 27 |
+
add_action( 'wc_trs2_matched_rates', array( 'WCV_Shipping', 'trs2_store_shipping_data' ), 10, 3 );
|
| 28 |
+
}
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
*
|
| 33 |
+
*
|
| 34 |
+
* @param unknown $order_id
|
| 35 |
+
* @param unknown $product
|
| 36 |
+
* @param unknown $author
|
| 37 |
+
*
|
| 38 |
+
* @return unknown
|
| 39 |
+
*/
|
| 40 |
+
public static function get_shipping_due( $order_id, $product, $author, $product_id = 0 )
|
| 41 |
+
{
|
| 42 |
+
global $woocommerce;
|
| 43 |
+
|
| 44 |
+
$shipping_costs = array( 'amount' => 0, 'tax' => 0);
|
| 45 |
+
$shipping_due = 0;
|
| 46 |
+
$method = '';
|
| 47 |
+
$_product = wc_get_product( $product[ 'product_id' ] );
|
| 48 |
+
$order = wc_get_order( $order_id );
|
| 49 |
+
|
| 50 |
+
if ( $_product && $_product->needs_shipping() && !$_product->is_downloadable() ) {
|
| 51 |
+
|
| 52 |
+
// Get Shipping methods.
|
| 53 |
+
$shipping_methods = $order->get_shipping_methods();
|
| 54 |
+
|
| 55 |
+
// TODO: Currently this only allows one shipping method per order, this definitely needs changing
|
| 56 |
+
foreach ($shipping_methods as $shipping_method) {
|
| 57 |
+
$method = $shipping_method['method_id'];
|
| 58 |
+
break;
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
// Per Product Shipping
|
| 62 |
+
if ( ( class_exists('WC_Shipping_Per_Product_Init') || function_exists( 'woocommerce_per_product_shipping' ) ) && $method == 'per_product' ) {
|
| 63 |
+
$shipping_costs = WCV_Shipping::pps_get_due( $order_id, $product );
|
| 64 |
+
|
| 65 |
+
// Local Delivery
|
| 66 |
+
} else if ( $method == 'local_delivery' ) {
|
| 67 |
+
$local_delivery = get_option( 'woocommerce_local_delivery_settings' );
|
| 68 |
+
|
| 69 |
+
if ( $local_delivery[ 'type' ] == 'product' ) {
|
| 70 |
+
|
| 71 |
+
$shipping_costs['amount'] = $product[ 'qty' ] * $local_delivery[ 'fee' ];
|
| 72 |
+
$shipping_costs['tax'] = WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order );
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
// International Delivery
|
| 76 |
+
} else if ( $method == 'international_delivery' ) {
|
| 77 |
+
|
| 78 |
+
$int_delivery = get_option( 'woocommerce_international_delivery_settings' );
|
| 79 |
+
|
| 80 |
+
if ( $int_delivery[ 'type' ] == 'item' ) {
|
| 81 |
+
$WC_Shipping_International_Delivery = new WC_Shipping_International_Delivery();
|
| 82 |
+
$fee = $WC_Shipping_International_Delivery->get_fee( $int_delivery[ 'fee' ], $_product->get_price() );
|
| 83 |
+
$shipping_costs['amount'] = ( $int_delivery[ 'cost' ] + $fee ) * $product[ 'qty' ];
|
| 84 |
+
$shipping_costs['tax'] = ( 'taxable' === $int_delivery[ 'tax_status' ] ) ? WCV_Shipping::calculate_shipping_tax( $shipping_costs['amount'], $order ) : 0;
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
}
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
$shipping_costs = apply_filters( 'wcvendors_shipping_due', $shipping_costs, $order_id, $product, $author, $product_id );
|
| 91 |
+
|
| 92 |
+
return $shipping_costs;
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
/**
|
| 97 |
+
*
|
| 98 |
+
*
|
| 99 |
+
* @param unknown $order_id
|
| 100 |
+
* @param unknown $product
|
| 101 |
+
*
|
| 102 |
+
* @return array
|
| 103 |
+
*/
|
| 104 |
+
public static function pps_get_due( $order_id, $product )
|
| 105 |
+
{
|
| 106 |
+
global $woocommerce;
|
| 107 |
+
|
| 108 |
+
$item_shipping_cost = 0;
|
| 109 |
+
$shipping_costs = array();
|
| 110 |
+
|
| 111 |
+
$settings = get_option( 'woocommerce_per_product_settings' );
|
| 112 |
+
$taxable = $settings['tax_status'];
|
| 113 |
+
|
| 114 |
+
$order = new WC_Order( $order_id );
|
| 115 |
+
|
| 116 |
+
$shipping_country = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_country : $order->get_shipping_country();
|
| 117 |
+
$shipping_state = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_state : $order->get_shipping_state();
|
| 118 |
+
$shipping_postcode = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_postcode : $order->get_shipping_postcode();
|
| 119 |
+
|
| 120 |
+
$package[ 'destination' ][ 'country' ] = $shipping_country;
|
| 121 |
+
$package[ 'destination' ][ 'state' ] = $shipping_state;
|
| 122 |
+
$package[ 'destination' ][ 'postcode' ] = $shipping_postcode;
|
| 123 |
+
$product_id = !empty( $product['variation_id'] ) ? $product['variation_id'] : $product['product_id'];
|
| 124 |
+
|
| 125 |
+
if ( !empty( $product['variation_id'] ) ) {
|
| 126 |
+
$rule = woocommerce_per_product_shipping_get_matching_rule( $product['variation_id'], $package );
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
if ( empty( $rule ) ) {
|
| 130 |
+
$rule = woocommerce_per_product_shipping_get_matching_rule( $product['product_id'], $package );
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
if ( !empty( $rule ) ) {
|
| 134 |
+
$item_shipping_cost += $rule->rule_item_cost * $product[ 'qty' ];
|
| 135 |
+
|
| 136 |
+
if ( !empty(self::$pps_shipping_costs[$order_id]) && ! in_array( $rule->rule_id, self::$pps_shipping_costs[$order_id] ) ) {
|
| 137 |
+
$item_shipping_cost += $rule->rule_cost;
|
| 138 |
+
} else if ( empty( self::$pps_shipping_costs[$order_id] ) ) {
|
| 139 |
+
$item_shipping_cost += $rule->rule_cost;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
self::$pps_shipping_costs[$order_id][] = $rule->rule_id;
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
$shipping_costs['amount'] = $item_shipping_cost;
|
| 146 |
+
$shipping_costs['tax'] = ('taxable' === $taxable ) ? WCV_Shipping::calculate_shipping_tax( $item_shipping_cost, $order ) : 0;
|
| 147 |
+
|
| 148 |
+
// return $item_shipping_cost;
|
| 149 |
+
return $shipping_costs;
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
public static function calculate_shipping_tax( $shipping_amount, $order ) {
|
| 153 |
+
|
| 154 |
+
$tax_based_on = get_option( 'woocommerce_tax_based_on' );
|
| 155 |
+
$wc_tax_enabled = get_option( 'woocommerce_calc_taxes' );
|
| 156 |
+
|
| 157 |
+
$shipping_city = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_city : $order->get_shipping_city();
|
| 158 |
+
$shipping_country = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_country : $order->get_shipping_country();
|
| 159 |
+
$shipping_state = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_state : $order->get_shipping_state();
|
| 160 |
+
$shipping_postcode = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_postcode : $order->get_shipping_postcode();
|
| 161 |
+
$billing_city = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_city : $order->get_billing_city();
|
| 162 |
+
$billing_country = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_country : $order->get_billing_country();
|
| 163 |
+
$billing_state = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_state : $order->get_billing_state();
|
| 164 |
+
$billing_postcode = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_postcode : $order->get_billing_postcode();
|
| 165 |
+
|
| 166 |
+
// if taxes aren't enabled don't calculate them
|
| 167 |
+
if ( 'no' === $wc_tax_enabled ) return 0;
|
| 168 |
+
|
| 169 |
+
if ( 'base' === $tax_based_on ) {
|
| 170 |
+
|
| 171 |
+
$default = wc_get_base_location();
|
| 172 |
+
$country = $default['country'];
|
| 173 |
+
$state = $default['state'];
|
| 174 |
+
$postcode = '';
|
| 175 |
+
$city = '';
|
| 176 |
+
|
| 177 |
+
} elseif ( 'billing' === $tax_based_on ) {
|
| 178 |
+
|
| 179 |
+
$country = $billing_country;
|
| 180 |
+
$state = $billing_state;
|
| 181 |
+
$postcode = $billing_postcode;
|
| 182 |
+
$city = $billing_city;
|
| 183 |
+
|
| 184 |
+
} else {
|
| 185 |
+
|
| 186 |
+
$country = $shipping_country;
|
| 187 |
+
$state = $shipping_state;
|
| 188 |
+
$postcode = $shipping_postcode;
|
| 189 |
+
$city = $shipping_city;
|
| 190 |
+
|
| 191 |
+
}
|
| 192 |
+
|
| 193 |
+
// Now calculate shipping tax
|
| 194 |
+
$matched_tax_rates = array();
|
| 195 |
+
|
| 196 |
+
$tax_rates = WC_Tax::find_rates( array(
|
| 197 |
+
'country' => $country,
|
| 198 |
+
'state' => $state,
|
| 199 |
+
'postcode' => $postcode,
|
| 200 |
+
'city' => $city,
|
| 201 |
+
'tax_class' => ''
|
| 202 |
+
) );
|
| 203 |
+
|
| 204 |
+
|
| 205 |
+
if ( $tax_rates ) {
|
| 206 |
+
foreach ( $tax_rates as $key => $rate ) {
|
| 207 |
+
if ( isset( $rate['shipping'] ) && 'yes' === $rate['shipping'] ) {
|
| 208 |
+
$matched_tax_rates[ $key ] = $rate;
|
| 209 |
+
}
|
| 210 |
+
}
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
$shipping_taxes = WC_Tax::calc_shipping_tax( $shipping_amount, $matched_tax_rates );
|
| 214 |
+
$shipping_tax_total = WC_Tax::round( array_sum( $shipping_taxes ) );
|
| 215 |
+
|
| 216 |
+
return $shipping_tax_total;
|
| 217 |
+
|
| 218 |
+
}
|
| 219 |
+
|
| 220 |
+
|
| 221 |
+
/**
|
| 222 |
+
*
|
| 223 |
+
*/
|
| 224 |
+
public function trs2_clear_transients()
|
| 225 |
+
{
|
| 226 |
+
global $woocommerce;
|
| 227 |
+
|
| 228 |
+
if ( is_checkout() ) {
|
| 229 |
+
wc_delete_product_transients();
|
| 230 |
+
}
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
|
| 234 |
+
/**
|
| 235 |
+
*
|
| 236 |
+
*
|
| 237 |
+
* @param unknown $order_id
|
| 238 |
+
* @param unknown $product_id
|
| 239 |
+
*
|
| 240 |
+
* @return unknown
|
| 241 |
+
*/
|
| 242 |
+
public function trs2_get_due( $order_id, $product_id )
|
| 243 |
+
{
|
| 244 |
+
if ( !function_exists( 'woocommerce_get_shipping_method_table_rate' ) ) return;
|
| 245 |
+
|
| 246 |
+
$shipping_due = 0;
|
| 247 |
+
|
| 248 |
+
WCV_Shipping::trs2_retrieve_shipping_data( $order_id );
|
| 249 |
+
if ( !empty( WCV_Shipping::$trs2_shipping_calc_type ) ) {
|
| 250 |
+
|
| 251 |
+
$ship_id = ( WCV_Shipping::$trs2_shipping_calc_type == 'class' ) ? get_product( $product_id )->get_shipping_class_id() : $product_id;
|
| 252 |
+
|
| 253 |
+
if ( !empty( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] ) ) {
|
| 254 |
+
$shipping_due = WCV_Shipping::$trs2_shipping_rates[ $ship_id ];
|
| 255 |
+
unset( WCV_Shipping::$trs2_shipping_rates[ $ship_id ] );
|
| 256 |
+
}
|
| 257 |
+
}
|
| 258 |
+
|
| 259 |
+
return $shipping_due;
|
| 260 |
+
}
|
| 261 |
+
|
| 262 |
+
|
| 263 |
+
/**
|
| 264 |
+
*
|
| 265 |
+
*
|
| 266 |
+
* @param unknown $order_id
|
| 267 |
+
*/
|
| 268 |
+
public function trs2_retrieve_shipping_data( $order_id )
|
| 269 |
+
{
|
| 270 |
+
global $woocommerce;
|
| 271 |
+
|
| 272 |
+
if ( !empty( WCV_Shipping::$trs2_shipping_rates ) ) return;
|
| 273 |
+
|
| 274 |
+
WCV_Shipping::$trs2_shipping_rates = array_filter( (array) get_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', true ) );
|
| 275 |
+
WCV_Shipping::$trs2_shipping_calc_type = get_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', true );
|
| 276 |
+
}
|
| 277 |
+
|
| 278 |
+
|
| 279 |
+
/**
|
| 280 |
+
*
|
| 281 |
+
*
|
| 282 |
+
* @param unknown $type
|
| 283 |
+
* @param unknown $rates
|
| 284 |
+
* @param unknown $per_item
|
| 285 |
+
*/
|
| 286 |
+
public function trs2_store_shipping_data( $type, $rates, $per_item )
|
| 287 |
+
{
|
| 288 |
+
global $woocommerce;
|
| 289 |
+
|
| 290 |
+
$types = (array) $woocommerce->session->trs2_shipping_class_type;
|
| 291 |
+
$types[ ] = $type;
|
| 292 |
+
$woocommerce->session->trs2_shipping_class_type = $types;
|
| 293 |
+
|
| 294 |
+
$items = (array) $woocommerce->session->trs2_shipping_rates;
|
| 295 |
+
$items[ ] = $per_item;
|
| 296 |
+
$woocommerce->session->trs2_shipping_rates = $items;
|
| 297 |
+
}
|
| 298 |
+
|
| 299 |
+
|
| 300 |
+
/**
|
| 301 |
+
*
|
| 302 |
+
*
|
| 303 |
+
* @param unknown $order_id
|
| 304 |
+
* @param unknown $post
|
| 305 |
+
*
|
| 306 |
+
* @return unknown
|
| 307 |
+
*/
|
| 308 |
+
public function trs2_add_shipping_data( $order_id, $post )
|
| 309 |
+
{
|
| 310 |
+
global $woocommerce;
|
| 311 |
+
|
| 312 |
+
if ( empty( $woocommerce->session->trs2_shipping_rates ) ) {
|
| 313 |
+
return false;
|
| 314 |
+
}
|
| 315 |
+
|
| 316 |
+
$order = new WC_Order( $order_id );
|
| 317 |
+
|
| 318 |
+
foreach ( $woocommerce->session->trs2_shipping_rates as $key => $shipping_rates ) {
|
| 319 |
+
|
| 320 |
+
if ( is_array( $shipping_rates ) && array_sum( $shipping_rates ) == $order->order_shipping ) {
|
| 321 |
+
$shipping_calc_type = $woocommerce->session->trs2_shipping_class_type[ $key ];
|
| 322 |
+
update_post_meta( $order_id, '_wcvendors_trs2_shipping_rates', $shipping_rates );
|
| 323 |
+
update_post_meta( $order_id, '_wcvendors_trs2_shipping_calc_type', $shipping_calc_type );
|
| 324 |
+
|
| 325 |
+
break;
|
| 326 |
+
}
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
unset( $woocommerce->session->trs2_shipping_rates, $woocommerce->session->trs2_shipping_class_type );
|
| 330 |
+
}
|
| 331 |
+
}
|
trunk/classes/class-vendor-order.php
ADDED
|
@@ -0,0 +1,71 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Order vendor_order
|
| 4 |
+
*
|
| 5 |
+
* @class WC_Order_Vendor
|
| 6 |
+
*/
|
| 7 |
+
class WC_Order_Vendor extends WC_Order {
|
| 8 |
+
|
| 9 |
+
/** @public string Order type */
|
| 10 |
+
public $order_type = 'vendor_order';
|
| 11 |
+
|
| 12 |
+
/** @var string Date */
|
| 13 |
+
public $date;
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Init/load the vendor_order object. Called from the constructor.
|
| 17 |
+
*
|
| 18 |
+
* @param string|int|object|WC_Order_Vendor $vendor_order Vendor Order to init
|
| 19 |
+
* @uses WP_POST
|
| 20 |
+
*/
|
| 21 |
+
protected function init( $vendor_order ) {
|
| 22 |
+
if ( is_numeric( $vendor_order ) ) {
|
| 23 |
+
$this->id = absint( $vendor_order );
|
| 24 |
+
$this->post = get_post( $vendor_order );
|
| 25 |
+
$this->get_vendor_order( $this->id );
|
| 26 |
+
} elseif ( $vendor_order instanceof WC_Order_Vendor ) {
|
| 27 |
+
$this->id = absint( $vendor_order->id );
|
| 28 |
+
$this->post = $vendor_order->post;
|
| 29 |
+
$this->get_vendor_order( $this->id );
|
| 30 |
+
} elseif ( isset( $vendor_order->ID ) ) {
|
| 31 |
+
$this->id = absint( $vendor_order->ID );
|
| 32 |
+
$this->post = $vendor_order;
|
| 33 |
+
$this->get_vendor_order( $this->id );
|
| 34 |
+
}
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
/**
|
| 38 |
+
* Gets an vendor_order from the database
|
| 39 |
+
*
|
| 40 |
+
* @since 2.2
|
| 41 |
+
* @param int $id
|
| 42 |
+
* @return bool
|
| 43 |
+
*/
|
| 44 |
+
public function get_vendor_order( $id = 0 ) {
|
| 45 |
+
if ( ! $id ) {
|
| 46 |
+
return false;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
if ( $result = get_post( $id ) ) {
|
| 50 |
+
$this->populate( $result );
|
| 51 |
+
|
| 52 |
+
return true;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
return false;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* Populates a vendor_order from the loaded post data
|
| 60 |
+
*
|
| 61 |
+
* @param mixed $result
|
| 62 |
+
*/
|
| 63 |
+
public function populate( $result ) {
|
| 64 |
+
// Standard post data
|
| 65 |
+
$this->id = $result->ID;
|
| 66 |
+
$this->date = $result->post_date;
|
| 67 |
+
$this->modified_date = $result->post_modified;
|
| 68 |
+
$this->reason = $result->post_excerpt;
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
}
|
trunk/classes/class-vendor-post-types.php
ADDED
|
@@ -0,0 +1,52 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Post Types
|
| 4 |
+
*
|
| 5 |
+
* Registers post types and taxonomies
|
| 6 |
+
*
|
| 7 |
+
* @class WCV_Post_types
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
if ( ! defined( 'ABSPATH' ) ) {
|
| 11 |
+
exit;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* WCV_Post_types Class
|
| 16 |
+
*/
|
| 17 |
+
class WCV_Post_types {
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* Hook in methods.
|
| 21 |
+
*/
|
| 22 |
+
public static function init() {
|
| 23 |
+
add_action( 'woocommerce_register_post_type', array( __CLASS__, 'register_shop_order_vendor' ) );
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
/**
|
| 27 |
+
* Register vendor order type
|
| 28 |
+
*/
|
| 29 |
+
public static function register_shop_order_vendor() {
|
| 30 |
+
wc_register_order_type(
|
| 31 |
+
'shop_order_vendor',
|
| 32 |
+
apply_filters( 'woocommerce_register_post_type_shop_order_vendor',
|
| 33 |
+
array(
|
| 34 |
+
'label' => __( 'Vendor Orders', 'woocommerce' ),
|
| 35 |
+
'capability_type' => 'shop_order',
|
| 36 |
+
'public' => false,
|
| 37 |
+
'hierarchical' => false,
|
| 38 |
+
'supports' => false,
|
| 39 |
+
'exclude_from_orders_screen' => false,
|
| 40 |
+
'add_order_meta_boxes' => false,
|
| 41 |
+
'exclude_from_order_count' => true,
|
| 42 |
+
'exclude_from_order_views' => false,
|
| 43 |
+
'exclude_from_order_reports' => false,
|
| 44 |
+
'exclude_from_order_sales_reports' => true,
|
| 45 |
+
'class_name' => 'WC_Order_Vendor'
|
| 46 |
+
)
|
| 47 |
+
)
|
| 48 |
+
);
|
| 49 |
+
}
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
WCV_Post_types::init();
|
trunk/classes/class-vendors.php
ADDED
|
@@ -0,0 +1,675 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Vendor functions
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>, WC Vendors <http://wcvendors.com>
|
| 7 |
+
* @package WCVendors
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Vendors
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* Constructor
|
| 16 |
+
*/
|
| 17 |
+
function __construct()
|
| 18 |
+
{
|
| 19 |
+
add_action( 'woocommerce_checkout_order_processed', array( __CLASS__, 'create_child_orders' ), 10, 1 );
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* Retrieve all products for a vendor
|
| 24 |
+
*
|
| 25 |
+
* @param int $vendor_id
|
| 26 |
+
*
|
| 27 |
+
* @return object
|
| 28 |
+
*/
|
| 29 |
+
public static function get_vendor_products( $vendor_id )
|
| 30 |
+
{
|
| 31 |
+
$args = array(
|
| 32 |
+
'numberposts' => -1,
|
| 33 |
+
'post_type' => 'product',
|
| 34 |
+
'author' => $vendor_id,
|
| 35 |
+
'post_status' => 'publish',
|
| 36 |
+
);
|
| 37 |
+
|
| 38 |
+
$args = apply_filters( 'pv_get_vendor_products_args', $args );
|
| 39 |
+
|
| 40 |
+
return get_posts( $args );
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
public static function get_default_commission( $vendor_id )
|
| 44 |
+
{
|
| 45 |
+
return get_user_meta( $vendor_id, 'pv_custom_commission_rate', true );
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
|
| 49 |
+
/**
|
| 50 |
+
* Vendor IDs and PayPal addresses from an order
|
| 51 |
+
*
|
| 52 |
+
* @param object $order
|
| 53 |
+
* @param unknown $items (optional)
|
| 54 |
+
*
|
| 55 |
+
* @return array
|
| 56 |
+
*/
|
| 57 |
+
public static function get_vendors_from_order( $order, $items = false )
|
| 58 |
+
{
|
| 59 |
+
if ( !$order ) return;
|
| 60 |
+
if ( !$items ) $items = $order->get_items();
|
| 61 |
+
|
| 62 |
+
$vendors = array();
|
| 63 |
+
foreach ( $items as $key => $product ) {
|
| 64 |
+
|
| 65 |
+
$author = WCV_Vendors::get_vendor_from_product( $product[ 'product_id' ] );
|
| 66 |
+
|
| 67 |
+
// Only store the vendor authors
|
| 68 |
+
if ( !WCV_Vendors::is_vendor( $author ) ) continue;
|
| 69 |
+
|
| 70 |
+
$vendors[ $author ] = the_author_meta( 'author_paypal', $author );
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
return apply_filters( 'pv_vendors_from_order', $vendors, $order );
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
/**
|
| 78 |
+
*
|
| 79 |
+
*
|
| 80 |
+
* @param unknown $order
|
| 81 |
+
* @param unknown $group (optional)
|
| 82 |
+
*
|
| 83 |
+
* @return unknown
|
| 84 |
+
*/
|
| 85 |
+
public static function get_vendor_dues_from_order( $order, $group = true )
|
| 86 |
+
{
|
| 87 |
+
global $woocommerce;
|
| 88 |
+
|
| 89 |
+
$give_tax = WC_Vendors::$pv_options->get_option( 'give_tax' );
|
| 90 |
+
$give_shipping = WC_Vendors::$pv_options->get_option( 'give_shipping' );
|
| 91 |
+
$receiver = array();
|
| 92 |
+
$shipping_given = 0;
|
| 93 |
+
$tax_given = 0;
|
| 94 |
+
|
| 95 |
+
WCV_Shipping::$pps_shipping_costs = array();
|
| 96 |
+
|
| 97 |
+
foreach ( $order->get_items() as $key => $product ) {
|
| 98 |
+
|
| 99 |
+
$product_id = !empty( $product[ 'variation_id' ] ) ? $product[ 'variation_id' ] : $product[ 'product_id' ];
|
| 100 |
+
$author = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 101 |
+
$give_tax_override = get_user_meta( $author, 'wcv_give_vendor_tax', true );
|
| 102 |
+
$give_shipping_override = get_user_meta( $author, 'wcv_give_vendor_shipping', true );
|
| 103 |
+
$is_vendor = WCV_Vendors::is_vendor( $author );
|
| 104 |
+
$commission = $is_vendor ? WCV_Commission::calculate_commission( $product[ 'line_subtotal' ], $product_id, $order, $product[ 'qty' ] ) : 0;
|
| 105 |
+
$tax = !empty( $product[ 'line_tax' ] ) ? (float) $product[ 'line_tax' ] : 0;
|
| 106 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 107 |
+
|
| 108 |
+
// Check if shipping is enabled
|
| 109 |
+
if ( get_option('woocommerce_calc_shipping') === 'no' ) {
|
| 110 |
+
$shipping = 0; $shipping_tax = 0;
|
| 111 |
+
} else {
|
| 112 |
+
$shipping_costs = WCV_Shipping::get_shipping_due( $order_id, $product, $author, $product_id );
|
| 113 |
+
$shipping = $shipping_costs['amount'];
|
| 114 |
+
$shipping_tax = $shipping_costs['tax'];
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
$_product = new WC_Product( $product['product_id'] );
|
| 118 |
+
|
| 119 |
+
// Add line item tax and shipping taxes together
|
| 120 |
+
$total_tax = ( $_product->is_taxable() ) ? (float) $tax + (float) $shipping_tax : 0;
|
| 121 |
+
|
| 122 |
+
// Tax override on a per vendor basis
|
| 123 |
+
if ( $give_tax_override ) $give_tax = true;
|
| 124 |
+
// Shipping override
|
| 125 |
+
if ( $give_shipping_override ) $give_shipping = true;
|
| 126 |
+
|
| 127 |
+
if ( $is_vendor ) {
|
| 128 |
+
|
| 129 |
+
$shipping_given += $give_shipping ? $shipping : 0;
|
| 130 |
+
$tax_given += $give_tax ? $total_tax : 0;
|
| 131 |
+
|
| 132 |
+
$give = 0;
|
| 133 |
+
$give += !empty( $receiver[ $author ][ 'total' ] ) ? $receiver[ $author ][ 'total' ] : 0;
|
| 134 |
+
$give += $give_shipping ? $shipping : 0;
|
| 135 |
+
$give += $commission;
|
| 136 |
+
$give += $give_tax ? $total_tax : 0;
|
| 137 |
+
|
| 138 |
+
if ( $group ) {
|
| 139 |
+
|
| 140 |
+
$receiver[ $author ] = array(
|
| 141 |
+
'vendor_id' => (int) $author,
|
| 142 |
+
'commission' => !empty( $receiver[ $author ][ 'commission' ] ) ? $receiver[ $author ][ 'commission' ] + $commission : $commission,
|
| 143 |
+
'shipping' => $give_shipping ? ( !empty( $receiver[ $author ][ 'shipping' ] ) ? $receiver[ $author ][ 'shipping' ] + $shipping : $shipping) : 0,
|
| 144 |
+
'tax' => $give_tax ? ( !empty( $receiver[ $author ][ 'tax' ] ) ? $receiver[ $author ][ 'tax' ] + $total_tax : $total_tax ) : 0,
|
| 145 |
+
'qty' => !empty( $receiver[ $author ][ 'qty' ] ) ? $receiver[ $author ][ 'qty' ] + $product[ 'qty' ] : $product[ 'qty' ],
|
| 146 |
+
'total' => $give,
|
| 147 |
+
);
|
| 148 |
+
|
| 149 |
+
} else {
|
| 150 |
+
|
| 151 |
+
$receiver[ $author ][ $key ] = array(
|
| 152 |
+
'vendor_id' => (int) $author,
|
| 153 |
+
'product_id' => $product_id,
|
| 154 |
+
'commission' => $commission,
|
| 155 |
+
'shipping' => $give_shipping ? $shipping : 0,
|
| 156 |
+
'tax' => $give_tax ? $total_tax : 0,
|
| 157 |
+
'qty' => $product[ 'qty' ],
|
| 158 |
+
'total' => ($give_shipping ? $shipping : 0) + $commission + ( $give_tax ? $total_tax : 0 ),
|
| 159 |
+
);
|
| 160 |
+
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
$admin_comm = $product[ 'line_subtotal' ] - $commission;
|
| 166 |
+
|
| 167 |
+
if ( $group ) {
|
| 168 |
+
$receiver[ 1 ] = array(
|
| 169 |
+
'vendor_id' => 1,
|
| 170 |
+
'qty' => !empty( $receiver[ 1 ][ 'qty' ] ) ? $receiver[ 1 ][ 'qty' ] + $product[ 'qty' ] : $product[ 'qty' ],
|
| 171 |
+
'commission' => !empty( $receiver[ 1 ][ 'commission' ] ) ? $receiver[ 1 ][ 'commission' ] + $admin_comm : $admin_comm,
|
| 172 |
+
'total' => !empty( $receiver[ 1 ] ) ? $receiver[ 1 ][ 'total' ] + $admin_comm : $admin_comm,
|
| 173 |
+
);
|
| 174 |
+
} else {
|
| 175 |
+
$receiver[ 1 ][ $key ] = array(
|
| 176 |
+
'vendor_id' => 1,
|
| 177 |
+
'product_id' => $product_id,
|
| 178 |
+
'commission' => $admin_comm,
|
| 179 |
+
'shipping' => 0,
|
| 180 |
+
'tax' => 0,
|
| 181 |
+
'qty' => $product[ 'qty' ],
|
| 182 |
+
'total' => $admin_comm,
|
| 183 |
+
);
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
// Add remainders on end to admin
|
| 189 |
+
$discount = $order->get_total_discount();
|
| 190 |
+
$shipping = round( ( $order->get_total_shipping() - $shipping_given ), 2 );
|
| 191 |
+
$tax = round(( $order->get_total_tax() + $order->get_shipping_tax() ) - $tax_given, 2);
|
| 192 |
+
$total = ( $tax + $shipping ) - $discount;
|
| 193 |
+
|
| 194 |
+
if ( $group ) {
|
| 195 |
+
$r_total = round( $receiver[ 1 ][ 'total' ], 2 ) ;
|
| 196 |
+
$receiver[ 1 ][ 'commission' ] = round( $receiver[ 1 ][ 'commission' ], 2 ) - round( $discount, 2 );
|
| 197 |
+
$receiver[ 1 ][ 'shipping' ] = $shipping;
|
| 198 |
+
$receiver[ 1 ][ 'tax' ] = $tax;
|
| 199 |
+
$receiver[ 1 ][ 'total' ] = $r_total + round( $total, 2 );
|
| 200 |
+
} else {
|
| 201 |
+
$r_total = round( $receiver[ 1 ][ $key ][ 'total' ], 2 );
|
| 202 |
+
$receiver[ 1 ][ $key ][ 'commission' ] = round( $receiver[ 1 ][ $key ][ 'commission' ], 2 ) - round( $discount, 2 );
|
| 203 |
+
$receiver[ 1 ][ $key ][ 'shipping' ] = ( $order->get_total_shipping() - $shipping_given );
|
| 204 |
+
$receiver[ 1 ][ $key ][ 'tax' ] = $tax;
|
| 205 |
+
$receiver[ 1 ][ $key ][ 'total' ] = $r_total + round( $total, 2 );
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
// Reset the array keys
|
| 209 |
+
// $receivers = array_values( $receiver );
|
| 210 |
+
|
| 211 |
+
return $receiver;
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
|
| 215 |
+
/**
|
| 216 |
+
* Return the PayPal address for a vendor
|
| 217 |
+
*
|
| 218 |
+
* If no PayPal is set, it returns the vendor's email
|
| 219 |
+
*
|
| 220 |
+
* @param int $vendor_id
|
| 221 |
+
*
|
| 222 |
+
* @return string
|
| 223 |
+
*/
|
| 224 |
+
public static function get_vendor_paypal( $vendor_id )
|
| 225 |
+
{
|
| 226 |
+
$paypal = get_user_meta( $vendor_id, $meta_key = 'pv_paypal', true );
|
| 227 |
+
$paypal = !empty( $paypal ) ? $paypal : get_the_author_meta( 'user_email', $vendor_id, false );
|
| 228 |
+
|
| 229 |
+
return $paypal;
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
|
| 233 |
+
/**
|
| 234 |
+
* Check if a vendor has an amount due for an order already
|
| 235 |
+
*
|
| 236 |
+
* @param int $vendor_id
|
| 237 |
+
* @param int $order_id
|
| 238 |
+
*
|
| 239 |
+
* @return int
|
| 240 |
+
*/
|
| 241 |
+
public static function count_due_by_vendor( $vendor_id, $order_id )
|
| 242 |
+
{
|
| 243 |
+
global $wpdb;
|
| 244 |
+
|
| 245 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 246 |
+
|
| 247 |
+
$query = "SELECT COUNT(*)
|
| 248 |
+
FROM {$table_name}
|
| 249 |
+
WHERE vendor_id = %s
|
| 250 |
+
AND order_id = %s
|
| 251 |
+
AND status = %s";
|
| 252 |
+
$count = $wpdb->get_var( $wpdb->prepare( $query, $vendor_id, $order_id, 'due' ) );
|
| 253 |
+
|
| 254 |
+
return $count;
|
| 255 |
+
}
|
| 256 |
+
|
| 257 |
+
|
| 258 |
+
/**
|
| 259 |
+
* All commission due for a specific vendor
|
| 260 |
+
*
|
| 261 |
+
* @param int $vendor_id
|
| 262 |
+
*
|
| 263 |
+
* @return int
|
| 264 |
+
*/
|
| 265 |
+
public static function get_due_orders_by_vendor( $vendor_id )
|
| 266 |
+
{
|
| 267 |
+
global $wpdb;
|
| 268 |
+
|
| 269 |
+
$table_name = $wpdb->prefix . "pv_commission";
|
| 270 |
+
|
| 271 |
+
$query = "SELECT *
|
| 272 |
+
FROM {$table_name}
|
| 273 |
+
WHERE vendor_id = %s
|
| 274 |
+
AND status = %s";
|
| 275 |
+
$results = $wpdb->get_results( $wpdb->prepare( $query, $vendor_id, 'due' ) );
|
| 276 |
+
|
| 277 |
+
return $results;
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
|
| 281 |
+
/**
|
| 282 |
+
*
|
| 283 |
+
*
|
| 284 |
+
* @param unknown $product_id
|
| 285 |
+
*
|
| 286 |
+
* @return unknown
|
| 287 |
+
*/
|
| 288 |
+
public static function get_vendor_from_product( $product_id )
|
| 289 |
+
{
|
| 290 |
+
// Make sure we are returning an author for products or product variations only
|
| 291 |
+
if ( 'product' === get_post_type( $product_id ) || 'product_variation' === get_post_type( $product_id ) ) {
|
| 292 |
+
$parent = get_post_ancestors( $product_id );
|
| 293 |
+
if ( $parent ) $product_id = $parent[ 0 ];
|
| 294 |
+
|
| 295 |
+
$post = get_post( $product_id );
|
| 296 |
+
$author = $post ? $post->post_author : 1;
|
| 297 |
+
$author = apply_filters( 'pv_product_author', $author, $product_id );
|
| 298 |
+
} else {
|
| 299 |
+
$author = -1;
|
| 300 |
+
}
|
| 301 |
+
return $author;
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
|
| 305 |
+
/**
|
| 306 |
+
* Checks whether the ID provided is vendor capable or not
|
| 307 |
+
*
|
| 308 |
+
* @param int $user_id
|
| 309 |
+
*
|
| 310 |
+
* @return bool
|
| 311 |
+
*/
|
| 312 |
+
public static function is_vendor( $user_id )
|
| 313 |
+
{
|
| 314 |
+
$user = get_userdata( $user_id );
|
| 315 |
+
|
| 316 |
+
$vendor_roles = apply_filters( 'wcvendors_vendor_roles', array( 'vendor') );
|
| 317 |
+
|
| 318 |
+
if (is_object($user)) {
|
| 319 |
+
|
| 320 |
+
foreach ($vendor_roles as $role ) {
|
| 321 |
+
$is_vendor = is_array( $user->roles ) ? in_array( $role , $user->roles ) : false;
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
} else {
|
| 325 |
+
$is_vendor = false;
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
return apply_filters( 'pv_is_vendor', $is_vendor, $user_id );
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* Grabs the vendor ID whether a username or an int is provided
|
| 334 |
+
* and returns the vendor_id if it's actually a vendor
|
| 335 |
+
*
|
| 336 |
+
* @param unknown $input
|
| 337 |
+
*
|
| 338 |
+
* @return unknown
|
| 339 |
+
*/
|
| 340 |
+
public static function get_vendor_id( $input )
|
| 341 |
+
{
|
| 342 |
+
if ( empty( $input ) ) {
|
| 343 |
+
return false;
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $input ) ) );
|
| 347 |
+
|
| 348 |
+
if ( !empty( $users ) && count( $users ) == 1 ) {
|
| 349 |
+
$vendor = $users[ 0 ];
|
| 350 |
+
} else {
|
| 351 |
+
$int_vendor = is_numeric( $input );
|
| 352 |
+
$vendor = !empty( $int_vendor ) ? get_userdata( $input ) : get_user_by( 'login', $input );
|
| 353 |
+
}
|
| 354 |
+
|
| 355 |
+
if ( $vendor ) {
|
| 356 |
+
$vendor_id = $vendor->ID;
|
| 357 |
+
if ( self::is_vendor( $vendor_id ) ) {
|
| 358 |
+
return $vendor_id;
|
| 359 |
+
}
|
| 360 |
+
}
|
| 361 |
+
|
| 362 |
+
return false;
|
| 363 |
+
}
|
| 364 |
+
|
| 365 |
+
|
| 366 |
+
/**
|
| 367 |
+
* Retrieve the shop page for a specific vendor
|
| 368 |
+
*
|
| 369 |
+
* @param unknown $vendor_id
|
| 370 |
+
*
|
| 371 |
+
* @return string
|
| 372 |
+
*/
|
| 373 |
+
public static function get_vendor_shop_page( $vendor_id )
|
| 374 |
+
{
|
| 375 |
+
$vendor_id = self::get_vendor_id( $vendor_id );
|
| 376 |
+
if ( !$vendor_id ) return;
|
| 377 |
+
|
| 378 |
+
$slug = get_user_meta( $vendor_id, 'pv_shop_slug', true );
|
| 379 |
+
$vendor = !$slug ? get_userdata( $vendor_id )->user_login : $slug;
|
| 380 |
+
|
| 381 |
+
if ( get_option( 'permalink_structure' ) ) {
|
| 382 |
+
$permalink = trailingslashit( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) );
|
| 383 |
+
|
| 384 |
+
return trailingslashit( home_url( sprintf( '/%s%s', $permalink, $vendor ) ) );
|
| 385 |
+
} else {
|
| 386 |
+
return esc_url( add_query_arg( array( 'vendor_shop' => $vendor ), get_post_type_archive_link( 'product' ) ) );
|
| 387 |
+
}
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
|
| 391 |
+
/**
|
| 392 |
+
* Retrieve the shop name for a specific vendor
|
| 393 |
+
*
|
| 394 |
+
* @param unknown $vendor_id
|
| 395 |
+
*
|
| 396 |
+
* @return string
|
| 397 |
+
*/
|
| 398 |
+
public static function get_vendor_shop_name( $vendor_id )
|
| 399 |
+
{
|
| 400 |
+
$vendor_id = self::get_vendor_id( $vendor_id );
|
| 401 |
+
$name = $vendor_id ? get_user_meta( $vendor_id, 'pv_shop_name', true ) : false;
|
| 402 |
+
$shop_name = !$name ? get_userdata( $vendor_id )->user_login : $name;
|
| 403 |
+
|
| 404 |
+
return $shop_name;
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
*
|
| 410 |
+
*
|
| 411 |
+
* @param unknown $user_id
|
| 412 |
+
*
|
| 413 |
+
* @return unknown
|
| 414 |
+
*/
|
| 415 |
+
public static function is_pending( $user_id )
|
| 416 |
+
{
|
| 417 |
+
$user = get_userdata( $user_id );
|
| 418 |
+
|
| 419 |
+
$role = !empty( $user->roles ) ? array_shift( $user->roles ) : false;
|
| 420 |
+
$is_pending = ( $role == 'pending_vendor' );
|
| 421 |
+
|
| 422 |
+
return $is_pending;
|
| 423 |
+
}
|
| 424 |
+
|
| 425 |
+
/*
|
| 426 |
+
* Is this a vendor product ?
|
| 427 |
+
* @param uknown $role
|
| 428 |
+
*/
|
| 429 |
+
public static function is_vendor_product($role) {
|
| 430 |
+
return ($role === 'Vendor') ? true : false;
|
| 431 |
+
}
|
| 432 |
+
|
| 433 |
+
/*
|
| 434 |
+
* Is this the vendors shop archive page ?
|
| 435 |
+
*/
|
| 436 |
+
public static function is_vendor_page() {
|
| 437 |
+
|
| 438 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 439 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 440 |
+
|
| 441 |
+
return $vendor_id ? true : false;
|
| 442 |
+
|
| 443 |
+
} // is_vendor_page()
|
| 444 |
+
|
| 445 |
+
/*
|
| 446 |
+
* Is this a vendor single product page ?
|
| 447 |
+
*/
|
| 448 |
+
public static function is_vendor_product_page($vendor_id) {
|
| 449 |
+
|
| 450 |
+
$vendor_product = WCV_Vendors::is_vendor_product( wcv_get_user_role($vendor_id) );
|
| 451 |
+
return $vendor_product ? true : false;
|
| 452 |
+
|
| 453 |
+
} // is_vendor_product_page()
|
| 454 |
+
|
| 455 |
+
public static function get_vendor_sold_by( $vendor_id ){
|
| 456 |
+
|
| 457 |
+
$vendor_display_name = WC_Vendors::$pv_options->get_option( 'vendor_display_name' );
|
| 458 |
+
$vendor = get_userdata( $vendor_id );
|
| 459 |
+
|
| 460 |
+
switch ($vendor_display_name) {
|
| 461 |
+
case 'display_name':
|
| 462 |
+
$display_name = $vendor->display_name;
|
| 463 |
+
break;
|
| 464 |
+
case 'user_login':
|
| 465 |
+
$display_name = $vendor->user_login;
|
| 466 |
+
break;
|
| 467 |
+
case 'user_email':
|
| 468 |
+
$display_name = $vendor->user_email;
|
| 469 |
+
break;
|
| 470 |
+
|
| 471 |
+
default:
|
| 472 |
+
$display_name = WCV_Vendors::get_vendor_shop_name( $vendor_id );
|
| 473 |
+
break;
|
| 474 |
+
}
|
| 475 |
+
|
| 476 |
+
return $display_name;
|
| 477 |
+
|
| 478 |
+
} // get_vendor_sold_by()
|
| 479 |
+
|
| 480 |
+
/**
|
| 481 |
+
* Split order into vendor orders (when applicable) after checkout
|
| 482 |
+
*
|
| 483 |
+
* @since
|
| 484 |
+
* @param int $order_id
|
| 485 |
+
* @return void
|
| 486 |
+
*/
|
| 487 |
+
public static function create_child_orders ( $order_id ) {
|
| 488 |
+
$order = wc_get_order( $order_id );
|
| 489 |
+
$items = $order->get_items();
|
| 490 |
+
$vendor_items = array();
|
| 491 |
+
|
| 492 |
+
foreach ($items as $item_id => $item) {
|
| 493 |
+
if ( isset($item['product_id']) && $item['product_id'] !== 0 ) {
|
| 494 |
+
// check if product is from vendor
|
| 495 |
+
$product_author = get_post_field( 'post_author', $item['product_id'] );
|
| 496 |
+
if (WCV_Vendors::is_vendor( $product_author ) ) {
|
| 497 |
+
$vendor_items[ $product_author ][ $item_id ] = array (
|
| 498 |
+
'item_id' => $item_id,
|
| 499 |
+
'qty' => $item['qty'],
|
| 500 |
+
'total' => $item['line_total'],
|
| 501 |
+
'subtotal' => $item['line_subtotal'],
|
| 502 |
+
'tax' => $item['line_tax'],
|
| 503 |
+
'subtotal_tax' => $item['line_subtotal_tax'],
|
| 504 |
+
'tax_data' => maybe_unserialize( $item['line_tax_data'] ),
|
| 505 |
+
'commission' => WCV_Commission::calculate_commission( $item['line_subtotal'], $item['product_id'], $order, $item['qty'] ),
|
| 506 |
+
);
|
| 507 |
+
}
|
| 508 |
+
}
|
| 509 |
+
}
|
| 510 |
+
|
| 511 |
+
foreach ($vendor_items as $vendor_id => $items) {
|
| 512 |
+
if (!empty($items)) {
|
| 513 |
+
$vendor_order = WCV_Vendors::create_vendor_order( array(
|
| 514 |
+
'order_id' => $order_id,
|
| 515 |
+
'vendor_id' => $vendor_id,
|
| 516 |
+
'line_items' => $items
|
| 517 |
+
) );
|
| 518 |
+
}
|
| 519 |
+
}
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
/**
|
| 523 |
+
* Create a new vendor order programmatically
|
| 524 |
+
*
|
| 525 |
+
* Returns a new vendor_order object on success which can then be used to add additional data.
|
| 526 |
+
*
|
| 527 |
+
* @since
|
| 528 |
+
* @param array $args
|
| 529 |
+
* @return WC_Order_Vendor|WP_Error
|
| 530 |
+
*/
|
| 531 |
+
public static function create_vendor_order( $args = array() ) {
|
| 532 |
+
$default_args = array(
|
| 533 |
+
'vendor_id' => null,
|
| 534 |
+
'order_id' => 0,
|
| 535 |
+
'vendor_order_id' => 0,
|
| 536 |
+
'line_items' => array(),
|
| 537 |
+
'date' => current_time( 'mysql', 0 )
|
| 538 |
+
);
|
| 539 |
+
|
| 540 |
+
$args = wp_parse_args( $args, $default_args );
|
| 541 |
+
$vendor_order_data = array();
|
| 542 |
+
|
| 543 |
+
if ( $args['vendor_order_id'] > 0 ) {
|
| 544 |
+
$updating = true;
|
| 545 |
+
$vendor_order_data['ID'] = $args['vendor_order_id'];
|
| 546 |
+
} else {
|
| 547 |
+
$updating = false;
|
| 548 |
+
$vendor_order_data['post_type'] = 'shop_order_vendor';
|
| 549 |
+
$vendor_order_data['post_status'] = 'wc-completed';
|
| 550 |
+
$vendor_order_data['ping_status'] = 'closed';
|
| 551 |
+
$vendor_order_data['post_author'] = get_current_user_id();
|
| 552 |
+
$vendor_order_data['post_password'] = uniqid( 'vendor_' ); // password = 20 char max! (uniqid = 13)
|
| 553 |
+
$vendor_order_data['post_parent'] = absint( $args['order_id'] );
|
| 554 |
+
$vendor_order_data['post_title'] = sprintf( __( 'Vendor Order – %s', 'woocommerce' ), strftime( _x( '%b %d, %Y @ %I:%M %p', 'Order date parsed by strftime', 'woocommerce' ) ) );
|
| 555 |
+
$vendor_order_data['post_date'] = $args['date'];
|
| 556 |
+
}
|
| 557 |
+
|
| 558 |
+
if ( $updating ) {
|
| 559 |
+
$vendor_order_id = wp_update_post( $vendor_order_data );
|
| 560 |
+
} else {
|
| 561 |
+
$vendor_order_id = wp_insert_post( apply_filters( 'woocommerce_new_vendor_order_data', $vendor_order_data ), true );
|
| 562 |
+
}
|
| 563 |
+
|
| 564 |
+
if ( is_wp_error( $vendor_order_id ) ) {
|
| 565 |
+
return $vendor_order_id;
|
| 566 |
+
}
|
| 567 |
+
|
| 568 |
+
if ( ! $updating ) {
|
| 569 |
+
// Store vendor ID
|
| 570 |
+
update_post_meta( $vendor_order_id, '_vendor_id', $args['vendor_id'] );
|
| 571 |
+
|
| 572 |
+
// Get vendor order object
|
| 573 |
+
$vendor_order = wc_get_order( $vendor_order_id );
|
| 574 |
+
$order = wc_get_order( $args['order_id'] );
|
| 575 |
+
|
| 576 |
+
$order_currency = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->get_order_currency() : $order->get_currency();
|
| 577 |
+
|
| 578 |
+
// Order currency is the same used for the parent order
|
| 579 |
+
update_post_meta( $vendor_order_id, '_order_currency', $order_currency );
|
| 580 |
+
|
| 581 |
+
if ( sizeof( $args['line_items'] ) > 0 ) {
|
| 582 |
+
$order_items = $order->get_items( array( 'line_item', 'fee', 'shipping' ) );
|
| 583 |
+
|
| 584 |
+
foreach ( $args['line_items'] as $vendor_order_item_id => $vendor_order_item ) {
|
| 585 |
+
if ( isset( $order_items[ $vendor_order_item_id ] ) ) {
|
| 586 |
+
if ( empty( $vendor_order_item['qty'] ) && empty( $vendor_order_item['total'] ) && empty( $vendor_order_item['tax'] ) ) {
|
| 587 |
+
continue;
|
| 588 |
+
}
|
| 589 |
+
|
| 590 |
+
// Prevents errors when the order has no taxes
|
| 591 |
+
if ( ! isset( $vendor_order_item['tax'] ) ) {
|
| 592 |
+
$vendor_order_item['tax'] = array();
|
| 593 |
+
}
|
| 594 |
+
|
| 595 |
+
switch ( $order_items[ $vendor_order_item_id ]['type'] ) {
|
| 596 |
+
case 'line_item' :
|
| 597 |
+
$line_item_args = array(
|
| 598 |
+
'totals' => array(
|
| 599 |
+
'subtotal' => $vendor_order_item['subtotal'],
|
| 600 |
+
'total' => $vendor_order_item['total'],
|
| 601 |
+
'subtotal_tax' => $vendor_order_item['subtotal_tax'],
|
| 602 |
+
'tax' => $vendor_order_item['tax'],
|
| 603 |
+
'tax_data' => $vendor_order_item['tax_data'],
|
| 604 |
+
)
|
| 605 |
+
);
|
| 606 |
+
$new_item_id = $vendor_order->add_product( $order->get_product_from_item( $order_items[ $vendor_order_item_id ] ), isset( $vendor_order_item['qty'] ) ? $vendor_order_item['qty'] : 0, $line_item_args );
|
| 607 |
+
wc_add_order_item_meta( $new_item_id, '_vendor_order_item_id', $vendor_order_item_id );
|
| 608 |
+
wc_add_order_item_meta( $new_item_id, '_vendor_commission', $vendor_order_item['commission'] );
|
| 609 |
+
break;
|
| 610 |
+
case 'shipping' :
|
| 611 |
+
$shipping = new stdClass();
|
| 612 |
+
$shipping->label = $order_items[ $vendor_order_item_id ]['name'];
|
| 613 |
+
$shipping->id = $order_items[ $vendor_order_item_id ]['method_id'];
|
| 614 |
+
$shipping->cost = $vendor_order_item['total'];
|
| 615 |
+
$shipping->taxes = $vendor_order_item['tax'];
|
| 616 |
+
|
| 617 |
+
$new_item_id = $vendor_order->add_shipping( $shipping );
|
| 618 |
+
wc_add_order_item_meta( $new_item_id, '_vendor_order_item_id', $vendor_order_item_id );
|
| 619 |
+
break;
|
| 620 |
+
case 'fee' :
|
| 621 |
+
$fee = new stdClass();
|
| 622 |
+
$fee->name = $order_items[ $vendor_order_item_id ]['name'];
|
| 623 |
+
$fee->tax_class = $order_items[ $vendor_order_item_id ]['tax_class'];
|
| 624 |
+
$fee->taxable = $fee->tax_class !== '0';
|
| 625 |
+
$fee->amount = $vendor_order_item['total'];
|
| 626 |
+
$fee->tax = array_sum( $vendor_order_item['tax'] );
|
| 627 |
+
$fee->tax_data = $vendor_order_item['tax'];
|
| 628 |
+
|
| 629 |
+
$new_item_id = $vendor_order->add_fee( $fee );
|
| 630 |
+
wc_add_order_item_meta( $new_item_id, '_vendor_order_item_id', $vendor_order_item_id );
|
| 631 |
+
break;
|
| 632 |
+
}
|
| 633 |
+
}
|
| 634 |
+
}
|
| 635 |
+
$vendor_order->update_taxes();
|
| 636 |
+
}
|
| 637 |
+
|
| 638 |
+
$vendor_order->calculate_totals( false );
|
| 639 |
+
|
| 640 |
+
do_action( 'woocommerce_vendor_order_created', $vendor_order_id, $args );
|
| 641 |
+
}
|
| 642 |
+
|
| 643 |
+
// Clear transients
|
| 644 |
+
wc_delete_shop_order_transients( $args['order_id'] );
|
| 645 |
+
|
| 646 |
+
return new WC_Order_Vendor( $vendor_order_id );
|
| 647 |
+
}
|
| 648 |
+
|
| 649 |
+
|
| 650 |
+
/**
|
| 651 |
+
* Get vendor orders
|
| 652 |
+
*
|
| 653 |
+
* @return array
|
| 654 |
+
*/
|
| 655 |
+
public static function get_vendor_orders( $order_id ) {
|
| 656 |
+
$vendor_orders = array();
|
| 657 |
+
$vendor_order_ids = get_posts(
|
| 658 |
+
array(
|
| 659 |
+
'post_type' => 'shop_order_vendor',
|
| 660 |
+
'post_parent' => $order_id,
|
| 661 |
+
'posts_per_page' => -1,
|
| 662 |
+
'post_status' => 'any',
|
| 663 |
+
'fields' => 'ids'
|
| 664 |
+
)
|
| 665 |
+
);
|
| 666 |
+
|
| 667 |
+
foreach ( $vendor_order_ids as $vendor_order_id ) {
|
| 668 |
+
$vendor_orders[] = new WC_Order_Vendor( $vendor_order_id );
|
| 669 |
+
}
|
| 670 |
+
|
| 671 |
+
return $vendor_orders;
|
| 672 |
+
|
| 673 |
+
} // get_vendor_orders()
|
| 674 |
+
|
| 675 |
+
} // WCV_Vendors
|
trunk/classes/front/class-vendor-cart.php
ADDED
|
@@ -0,0 +1,70 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
*
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Vendor_Cart
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
*
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
|
| 21 |
+
if ( WC_Vendors::$pv_options->get_option( 'sold_by' ) ) {
|
| 22 |
+
add_filter( 'woocommerce_get_item_data', array( 'WCV_Vendor_Cart', 'sold_by' ), 10, 2 );
|
| 23 |
+
add_action( 'woocommerce_product_meta_start', array( 'WCV_Vendor_Cart', 'sold_by_meta' ), 10, 2 );
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
/**
|
| 30 |
+
* Sold by in cart item
|
| 31 |
+
*
|
| 32 |
+
* @param unknown $values
|
| 33 |
+
* @param unknown $cart_item
|
| 34 |
+
*
|
| 35 |
+
* @return unknown
|
| 36 |
+
*/
|
| 37 |
+
public static function sold_by( $values, $cart_item ){
|
| 38 |
+
|
| 39 |
+
$product_id = $cart_item[ 'product_id'];
|
| 40 |
+
$post = get_post( $product_id );
|
| 41 |
+
$vendor_id = $post->post_author;
|
| 42 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 43 |
+
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 44 |
+
? sprintf( '<a href="%s" target="_TOP">%s </a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 45 |
+
: get_bloginfo( 'name' );
|
| 46 |
+
|
| 47 |
+
$values[ ] = array(
|
| 48 |
+
'name' => apply_filters( 'wcvendors_cart_sold_by', $sold_by_label, $product_id, $vendor_id ),
|
| 49 |
+
'display' => $sold_by,
|
| 50 |
+
);
|
| 51 |
+
|
| 52 |
+
return $values;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
|
| 56 |
+
/**
|
| 57 |
+
* Single product meta
|
| 58 |
+
*/
|
| 59 |
+
public static function sold_by_meta()
|
| 60 |
+
{
|
| 61 |
+
$vendor_id = get_the_author_meta( 'ID' );
|
| 62 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 63 |
+
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 64 |
+
? sprintf( '<a href="%s" class="wcvendors_cart_sold_by_meta">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 65 |
+
: get_bloginfo( 'name' );
|
| 66 |
+
|
| 67 |
+
echo apply_filters('wcvendors_cart_sold_by_meta', $sold_by_label, get_the_ID(), $vendor_id ) .' '. $sold_by . '<br/>';
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
}
|
trunk/classes/front/class-vendor-shop.php
ADDED
|
@@ -0,0 +1,352 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Shop functions for each vendor.
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Vendor_Shop
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
public static $seller_info;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* init
|
| 18 |
+
*/
|
| 19 |
+
function __construct()
|
| 20 |
+
{
|
| 21 |
+
|
| 22 |
+
add_filter( 'product_enquiry_send_to', array( 'WCV_Vendor_Shop', 'product_enquiry_compatibility' ), 10, 2 );
|
| 23 |
+
|
| 24 |
+
add_action( 'woocommerce_product_query', array( $this, 'vendor_shop_query' ), 10, 2 );
|
| 25 |
+
add_filter( 'init', array( $this, 'add_rewrite_rules' ), 0 );
|
| 26 |
+
|
| 27 |
+
add_action( 'woocommerce_before_main_content', array( 'WCV_Vendor_Shop', 'shop_description' ), 30 );
|
| 28 |
+
add_filter( 'woocommerce_product_tabs', array( 'WCV_Vendor_Shop', 'seller_info_tab' ) );
|
| 29 |
+
add_filter( 'post_type_archive_link', array( 'WCV_Vendor_Shop', 'change_archive_link' ) );
|
| 30 |
+
|
| 31 |
+
// Add sold by to product loop before add to cart
|
| 32 |
+
if ( WC_Vendors::$pv_options->get_option( 'sold_by' ) ) {
|
| 33 |
+
add_action( 'woocommerce_after_shop_loop_item', array('WCV_Vendor_Shop', 'template_loop_sold_by'), 9 );
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
// Remove Page Title if on Vendor Shop
|
| 37 |
+
add_filter ( 'woocommerce_show_page_title', array( 'WCV_Vendor_Shop', 'remove_vendor_title' ) );
|
| 38 |
+
|
| 39 |
+
// Show vendor on all sales related invoices
|
| 40 |
+
if ( version_compare( WC_VERSION, '2.7', '<' ) ) {
|
| 41 |
+
|
| 42 |
+
add_action( 'woocommerce_add_order_item_meta', array( $this, 'add_vendor_to_order_item_meta_legacy' ), 50, 2 );
|
| 43 |
+
|
| 44 |
+
} else {
|
| 45 |
+
|
| 46 |
+
add_action( 'woocommerce_checkout_create_order_line_item', array( $this, 'add_vendor_to_order_item_meta' ), 50, 3 ); }
|
| 47 |
+
|
| 48 |
+
// Add a vendor header
|
| 49 |
+
if (WC_Vendors::$pv_options->get_option( 'shop_headers_enabled' ) ) {
|
| 50 |
+
add_action( 'woocommerce_before_main_content', array('WCV_Vendor_Shop', 'vendor_main_header'), 20 );
|
| 51 |
+
add_action( 'woocommerce_before_single_product', array('WCV_Vendor_Shop', 'vendor_mini_header'));
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
add_filter( 'document_title_parts', array( $this, 'vendor_page_title' ) );
|
| 55 |
+
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
public static function change_archive_link( $link )
|
| 59 |
+
{
|
| 60 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 61 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 62 |
+
|
| 63 |
+
return !$vendor_id ? $link : WCV_Vendors::get_vendor_shop_page( $vendor_id );
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
public static function vendor_shop_query( $q, $that )
|
| 67 |
+
{
|
| 68 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 69 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 70 |
+
|
| 71 |
+
if ( !$vendor_id ) return;
|
| 72 |
+
add_filter( 'woocommerce_page_title', array( 'WCV_Vendor_Shop', 'page_title' ) );
|
| 73 |
+
|
| 74 |
+
$q->set( 'author', $vendor_id );
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
public static function product_enquiry_compatibility( $send_to, $product_id )
|
| 78 |
+
{
|
| 79 |
+
$author_id = get_post( $product_id )->post_author;
|
| 80 |
+
if ( WCV_Vendors::is_vendor( $author_id ) ) {
|
| 81 |
+
$send_to = get_userdata( $author_id )->user_email;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
return $send_to;
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
|
| 88 |
+
/**
|
| 89 |
+
*
|
| 90 |
+
*
|
| 91 |
+
* @param unknown $tabs
|
| 92 |
+
*
|
| 93 |
+
* @return unknown
|
| 94 |
+
*/
|
| 95 |
+
public static function seller_info_tab( $tabs )
|
| 96 |
+
{
|
| 97 |
+
global $post;
|
| 98 |
+
|
| 99 |
+
if ( WCV_Vendors::is_vendor( $post->post_author ) ) {
|
| 100 |
+
|
| 101 |
+
$seller_info = get_user_meta( $post->post_author, 'pv_seller_info', true );
|
| 102 |
+
$has_html = get_user_meta( $post->post_author, 'pv_shop_html_enabled', true );
|
| 103 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 104 |
+
|
| 105 |
+
$seller_info_label = WC_Vendors::$pv_options->get_option( 'seller_info_label' );
|
| 106 |
+
|
| 107 |
+
if ( !empty( $seller_info ) ) {
|
| 108 |
+
|
| 109 |
+
$seller_info = do_shortcode( $seller_info );
|
| 110 |
+
self::$seller_info = '<div class="pv_seller_info">';
|
| 111 |
+
self::$seller_info .= apply_filters('wcv_before_seller_info_tab', '');
|
| 112 |
+
self::$seller_info .= ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $seller_info ) ) ) : sanitize_text_field( $seller_info );
|
| 113 |
+
self::$seller_info .= apply_filters('wcv_after_seller_info_tab', '');
|
| 114 |
+
self::$seller_info .= '</div>';
|
| 115 |
+
|
| 116 |
+
$tabs[ 'seller_info' ] = array(
|
| 117 |
+
'title' => apply_filters( 'wcvendors_seller_info_label', $seller_info_label ),
|
| 118 |
+
'priority' => 50,
|
| 119 |
+
'callback' => array( 'WCV_Vendor_Shop', 'seller_info_tab_panel' ),
|
| 120 |
+
);
|
| 121 |
+
}
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
return $tabs;
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
|
| 128 |
+
/**
|
| 129 |
+
*
|
| 130 |
+
*/
|
| 131 |
+
public static function seller_info_tab_panel()
|
| 132 |
+
{
|
| 133 |
+
echo self::$seller_info;
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
|
| 137 |
+
/**
|
| 138 |
+
* Show the description a vendor sets when viewing products by that vendor
|
| 139 |
+
*/
|
| 140 |
+
public static function shop_description()
|
| 141 |
+
{
|
| 142 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 143 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 144 |
+
|
| 145 |
+
if ( $vendor_id ) {
|
| 146 |
+
$has_html = get_user_meta( $vendor_id, 'pv_shop_html_enabled', true );
|
| 147 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 148 |
+
$description = do_shortcode( get_user_meta( $vendor_id, 'pv_shop_description', true ) );
|
| 149 |
+
|
| 150 |
+
echo '<div class="pv_shop_description">';
|
| 151 |
+
echo ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
|
| 152 |
+
echo '</div>';
|
| 153 |
+
}
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
/**
|
| 157 |
+
*
|
| 158 |
+
*/
|
| 159 |
+
public static function add_rewrite_rules()
|
| 160 |
+
{
|
| 161 |
+
$permalink = untrailingslashit( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) );
|
| 162 |
+
|
| 163 |
+
// Remove beginning slash
|
| 164 |
+
if ( substr( $permalink, 0, 1 ) == '/' ) {
|
| 165 |
+
$permalink = substr( $permalink, 1, strlen( $permalink ) );
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
add_rewrite_tag( '%vendor_shop%', '([^&]+)' );
|
| 169 |
+
|
| 170 |
+
add_rewrite_rule( $permalink . '/([^/]*)/page/([0-9]+)', 'index.php?post_type=product&vendor_shop=$matches[1]&paged=$matches[2]', 'top' );
|
| 171 |
+
add_rewrite_rule( $permalink . '/([^/]*)', 'index.php?post_type=product&vendor_shop=$matches[1]', 'top' );
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
public static function page_title( $page_title = "" )
|
| 176 |
+
{
|
| 177 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 178 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 179 |
+
|
| 180 |
+
return $vendor_id ? WCV_Vendors::get_vendor_shop_name( $vendor_id ) : $page_title;
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
|
| 184 |
+
/*
|
| 185 |
+
Adding sold by to product loop
|
| 186 |
+
*/
|
| 187 |
+
public static function template_loop_sold_by($product_id) {
|
| 188 |
+
$vendor_id = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 189 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 190 |
+
$sold_by = WCV_Vendors::is_vendor( $vendor_id )
|
| 191 |
+
? sprintf( '<a href="%s">%s</a>', WCV_Vendors::get_vendor_shop_page( $vendor_id ), WCV_Vendors::get_vendor_sold_by( $vendor_id ) )
|
| 192 |
+
: get_bloginfo( 'name' );
|
| 193 |
+
|
| 194 |
+
wc_get_template( 'vendor-sold-by.php', array(
|
| 195 |
+
'vendor_id' => $vendor_id,
|
| 196 |
+
'sold_by_label' => $sold_by_label,
|
| 197 |
+
'sold_by' => $sold_by,
|
| 198 |
+
|
| 199 |
+
), 'wc-vendors/front/', wcv_plugin_dir . 'templates/front/' );
|
| 200 |
+
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
|
| 204 |
+
/*
|
| 205 |
+
* Remove the Page title from Archive-Product while on a vendor Page
|
| 206 |
+
*/
|
| 207 |
+
public static function remove_vendor_title( $b ) {
|
| 208 |
+
|
| 209 |
+
if ( WCV_Vendors::is_vendor_page() ) {
|
| 210 |
+
return false;
|
| 211 |
+
}
|
| 212 |
+
return $b;
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
/*
|
| 216 |
+
* Display a vendor header at the top of the vendors product archive page
|
| 217 |
+
*/
|
| 218 |
+
public static function vendor_main_header() {
|
| 219 |
+
|
| 220 |
+
// Remove the basic shop description from the loop
|
| 221 |
+
remove_action( 'woocommerce_before_main_content', array('WCV_Vendor_Shop', 'shop_description' ), 30);
|
| 222 |
+
|
| 223 |
+
if (WCV_Vendors::is_vendor_page()) {
|
| 224 |
+
$vendor_shop = urldecode( get_query_var( 'vendor_shop' ) );
|
| 225 |
+
$vendor_id = WCV_Vendors::get_vendor_id( $vendor_shop );
|
| 226 |
+
$shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
|
| 227 |
+
|
| 228 |
+
// Shop description
|
| 229 |
+
$has_html = get_user_meta( $vendor_id, 'pv_shop_html_enabled', true );
|
| 230 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 231 |
+
$description = do_shortcode( get_user_meta( $vendor_id, 'pv_shop_description', true ) );
|
| 232 |
+
$shop_description = ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
|
| 233 |
+
$seller_info = ( $global_html || $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
|
| 234 |
+
$vendor = get_userdata( $vendor_id );
|
| 235 |
+
$vendor_email = $vendor->user_email;
|
| 236 |
+
$vendor_login = $vendor->user_login;
|
| 237 |
+
|
| 238 |
+
|
| 239 |
+
do_action('wcv_before_main_header', $vendor_id);
|
| 240 |
+
|
| 241 |
+
wc_get_template( 'vendor-main-header.php', array(
|
| 242 |
+
'vendor' => $vendor,
|
| 243 |
+
'vendor_id' => $vendor_id,
|
| 244 |
+
'shop_name' => $shop_name,
|
| 245 |
+
'shop_description' => $shop_description,
|
| 246 |
+
'seller_info' => $seller_info,
|
| 247 |
+
'vendor_email' => $vendor_email,
|
| 248 |
+
'vendor_login' => $vendor_login,
|
| 249 |
+
), 'wc-vendors/front/', wcv_plugin_dir . 'templates/front/' );
|
| 250 |
+
|
| 251 |
+
do_action('wcv_after_main_header', $vendor_id);
|
| 252 |
+
|
| 253 |
+
}
|
| 254 |
+
}
|
| 255 |
+
|
| 256 |
+
|
| 257 |
+
/*
|
| 258 |
+
* Display a vendor header at the top of the single-product page
|
| 259 |
+
*/
|
| 260 |
+
public static function vendor_mini_header() {
|
| 261 |
+
|
| 262 |
+
global $product;
|
| 263 |
+
|
| 264 |
+
if ( WCV_Vendors::is_vendor_product_page($product->post->post_author)) {
|
| 265 |
+
|
| 266 |
+
$vendor = get_userdata( $product->post->post_author );
|
| 267 |
+
$vendor_id = $product->post->post_author;
|
| 268 |
+
$vendor_shop_link = site_url( WC_Vendors::$pv_options->get_option( 'vendor_shop_permalink' ) .'/' .$vendor->pv_shop_slug );
|
| 269 |
+
$shop_name = get_user_meta( $vendor_id, 'pv_shop_name', true );
|
| 270 |
+
$has_html = $vendor->pv_shop_html_enabled;
|
| 271 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 272 |
+
$description = do_shortcode( $vendor->pv_shop_description );
|
| 273 |
+
$shop_description = ( $global_html || $has_html ) ? wpautop( wptexturize( wp_kses_post( $description ) ) ) : sanitize_text_field( $description );
|
| 274 |
+
$seller_info = ( $global_html || $has_html ) ? wpautop( get_user_meta( $vendor_id, 'pv_seller_info', true ) ) : sanitize_text_field( get_user_meta( $vendor_id, 'pv_seller_info', true ) );
|
| 275 |
+
$vendor_email = $vendor->user_email;
|
| 276 |
+
$vendor_login = $vendor->user_login;
|
| 277 |
+
|
| 278 |
+
do_action('wcv_before_mini_header', $vendor->ID);
|
| 279 |
+
|
| 280 |
+
wc_get_template( 'vendor-mini-header.php', array(
|
| 281 |
+
'vendor' => $vendor,
|
| 282 |
+
'vendor_id' => $vendor_id,
|
| 283 |
+
'vendor_shop_link' => $vendor_shop_link,
|
| 284 |
+
'shop_name' => $vendor->pv_shop_name,
|
| 285 |
+
'shop_description' => $shop_description,
|
| 286 |
+
'seller_info' => $seller_info,
|
| 287 |
+
'shop_name' => $shop_name,
|
| 288 |
+
'vendor_email' => $vendor_email,
|
| 289 |
+
'vendor_login' => $vendor_login,
|
| 290 |
+
), 'wc-vendors/front/', wcv_plugin_dir . 'templates/front/' );
|
| 291 |
+
|
| 292 |
+
do_action('wcv_after_mini_header', $vendor->ID);
|
| 293 |
+
|
| 294 |
+
}
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
/*
|
| 298 |
+
* Add Vendor to Order item Meta legacy
|
| 299 |
+
* Thanks to Asbjoern Andersen for the code
|
| 300 |
+
*
|
| 301 |
+
* @depreciated
|
| 302 |
+
*/
|
| 303 |
+
public static function add_vendor_to_order_item_meta_legacy( $item_id, $cart_item) {
|
| 304 |
+
|
| 305 |
+
$vendor_id = $cart_item[ 'data' ]->post->post_author;
|
| 306 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 307 |
+
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
|
| 308 |
+
|
| 309 |
+
wc_add_order_item_meta( $item_id, apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
|
| 310 |
+
}
|
| 311 |
+
|
| 312 |
+
|
| 313 |
+
/**
|
| 314 |
+
* Add vendor to order item meta WC2.7 and above
|
| 315 |
+
*
|
| 316 |
+
* @since 1.9.9
|
| 317 |
+
* @access public
|
| 318 |
+
*/
|
| 319 |
+
public function add_vendor_to_order_item_meta( $item, $cart_item_key, $values ) {
|
| 320 |
+
|
| 321 |
+
$cart = WC()->cart->get_cart();
|
| 322 |
+
$cart_item = $cart[ $cart_item_key ];
|
| 323 |
+
$product_id = $cart_item[ 'product_id'];
|
| 324 |
+
$post = get_post( $product_id );
|
| 325 |
+
$vendor_id = $post->post_author;
|
| 326 |
+
$sold_by_label = WC_Vendors::$pv_options->get_option( 'sold_by_label' );
|
| 327 |
+
$sold_by = WCV_Vendors::is_vendor( $vendor_id ) ? sprintf( WCV_Vendors::get_vendor_sold_by( $vendor_id ) ): get_bloginfo( 'name' );
|
| 328 |
+
|
| 329 |
+
$item->add_meta_data( apply_filters( 'wcvendors_sold_by_in_email', $sold_by_label ), $sold_by );
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
} // add_vendor_to_order_item_meta()
|
| 333 |
+
|
| 334 |
+
|
| 335 |
+
/**
|
| 336 |
+
* Add the Vendor shop name to the <title> tag on archive and single product page
|
| 337 |
+
*
|
| 338 |
+
* @since 1.9.9
|
| 339 |
+
*/
|
| 340 |
+
public function vendor_page_title( $title ){
|
| 341 |
+
|
| 342 |
+
if ( WCV_Vendors::is_vendor_page() ) {
|
| 343 |
+
|
| 344 |
+
$title[ 'title' ] = self::page_title();
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
return $title;
|
| 348 |
+
|
| 349 |
+
} // vendor_page_title
|
| 350 |
+
|
| 351 |
+
|
| 352 |
+
}
|
trunk/classes/front/dashboard/class-vendor-dashboard.php
ADDED
|
@@ -0,0 +1,515 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* WCV Vendor Dashboard
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @author Jamie Madden <http://wcvendors.com>
|
| 8 |
+
* @package WCVendors
|
| 9 |
+
*/
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
class WCV_Vendor_Dashboard
|
| 13 |
+
{
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* __construct()
|
| 18 |
+
*/
|
| 19 |
+
function __construct()
|
| 20 |
+
{
|
| 21 |
+
add_shortcode( 'wcv_shop_settings', array( $this, 'display_vendor_settings' ) );
|
| 22 |
+
add_shortcode( 'wcv_vendor_dashboard', array( $this, 'display_vendor_products' ) );
|
| 23 |
+
|
| 24 |
+
add_action( 'template_redirect', array( $this, 'check_access' ) );
|
| 25 |
+
add_action( 'init', array( $this, 'save_vendor_settings' ) );
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
public function save_vendor_settings()
|
| 29 |
+
{
|
| 30 |
+
global $woocommerce;
|
| 31 |
+
|
| 32 |
+
$user_id = get_current_user_id();
|
| 33 |
+
|
| 34 |
+
if ( !empty( $_GET['wc_pv_mark_shipped'] ) ) {
|
| 35 |
+
$order_id = $_GET['wc_pv_mark_shipped'];
|
| 36 |
+
$order = wc_get_order( $order_id );
|
| 37 |
+
$vendors = WCV_Vendors::get_vendors_from_order( $order );
|
| 38 |
+
$vendor_ids = array_keys( $vendors );
|
| 39 |
+
if ( !in_array( $user_id, $vendor_ids ) ) {
|
| 40 |
+
wc_add_notice( __( 'You are not allowed to modify this order.', 'wcvendors' ) );
|
| 41 |
+
return null;
|
| 42 |
+
}
|
| 43 |
+
$shippers = (array) get_post_meta( $order_id, 'wc_pv_shipped', true );
|
| 44 |
+
|
| 45 |
+
// If not in the shippers array mark as shipped otherwise do nothing.
|
| 46 |
+
if( !in_array($user_id, $shippers)) {
|
| 47 |
+
$shippers[] = $user_id;
|
| 48 |
+
$mails = $woocommerce->mailer()->get_emails();
|
| 49 |
+
if ( !empty( $mails ) ) {
|
| 50 |
+
$mails[ 'WC_Email_Notify_Shipped' ]->trigger( $order_id, $user_id );
|
| 51 |
+
}
|
| 52 |
+
do_action('wcvendors_vendor_ship', $order_id, $user_id);
|
| 53 |
+
wc_add_notice( __( 'Order marked shipped.', 'wcvendors' ), 'success' );
|
| 54 |
+
$shop_name = WCV_Vendors::get_vendor_shop_name( $user_id );
|
| 55 |
+
$order->add_order_note( apply_filters( 'wcvendors_vendor_shipped_note', sprintf( __( '%s has marked as shipped. ', 'wcvendors'), $shop_name ) , $user_id, $shop_name ) );
|
| 56 |
+
} elseif ( false != ( $key = array_search( $user_id, $shippers) ) ) {
|
| 57 |
+
unset( $shippers[$key] ); // Remove user from the shippers array
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
update_post_meta( $order_id, 'wc_pv_shipped', $shippers );
|
| 61 |
+
return;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
if ( isset( $_POST[ 'update_tracking' ] ) ) {
|
| 65 |
+
$order_id = (int) $_POST[ 'order_id' ];
|
| 66 |
+
$product_id = (int) $_POST[ 'product_id' ];
|
| 67 |
+
|
| 68 |
+
$tracking_provider = wc_clean( $_POST[ 'tracking_provider' ] );
|
| 69 |
+
$custom_tracking_provider = wc_clean( $_POST[ 'custom_tracking_provider_name' ] );
|
| 70 |
+
$custom_tracking_link = wc_clean( $_POST[ 'custom_tracking_url' ] );
|
| 71 |
+
$tracking_number = wc_clean( $_POST[ 'tracking_number' ] );
|
| 72 |
+
$date_shipped = wc_clean( strtotime( $_POST[ 'date_shipped' ] ) );
|
| 73 |
+
|
| 74 |
+
$order = new WC_Order( $order_id );
|
| 75 |
+
$products = $order->get_items();
|
| 76 |
+
foreach ( $products as $key => $value ) {
|
| 77 |
+
if ( $value[ 'product_id' ] == $product_id || $value[ 'variation_id' ] == $product_id ) {
|
| 78 |
+
$order_item_id = $key;
|
| 79 |
+
break;
|
| 80 |
+
}
|
| 81 |
+
}
|
| 82 |
+
if ( $order_item_id ) {
|
| 83 |
+
wc_delete_order_item_meta( $order_item_id, __( 'Tracking number', 'wcvendors' ) );
|
| 84 |
+
wc_add_order_item_meta( $order_item_id, __( 'Tracking number', 'wcvendors' ), $tracking_number );
|
| 85 |
+
|
| 86 |
+
$message = __( 'Success. Your tracking number has been updated.', 'wcvendors' );
|
| 87 |
+
wc_add_notice( $message, 'success' );
|
| 88 |
+
|
| 89 |
+
// Update order data
|
| 90 |
+
update_post_meta( $order_id, '_tracking_provider', $tracking_provider );
|
| 91 |
+
update_post_meta( $order_id, '_custom_tracking_provider', $custom_tracking_provider );
|
| 92 |
+
update_post_meta( $order_id, '_tracking_number', $tracking_number );
|
| 93 |
+
update_post_meta( $order_id, '_custom_tracking_link', $custom_tracking_link );
|
| 94 |
+
update_post_meta( $order_id, '_date_shipped', $date_shipped );
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
if ( empty( $_POST[ 'vendor_application_submit' ] ) ) {
|
| 100 |
+
return false;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
if (isset ( $_POST[ 'wc-product-vendor-nonce' ] ) ) {
|
| 104 |
+
|
| 105 |
+
if ( !wp_verify_nonce( $_POST[ 'wc-product-vendor-nonce' ], 'save-shop-settings' ) ) {
|
| 106 |
+
return false;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
if ( isset( $_POST[ 'pv_paypal' ] ) ) {
|
| 111 |
+
if ( !is_email( $_POST[ 'pv_paypal' ] ) ) {
|
| 112 |
+
wc_add_notice( __( 'Your PayPal address is not a valid email address.', 'wcvendors' ), 'error' );
|
| 113 |
+
} else {
|
| 114 |
+
update_user_meta( $user_id, 'pv_paypal', $_POST[ 'pv_paypal' ] );
|
| 115 |
+
}
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
if ( !empty( $_POST[ 'pv_shop_name' ] ) ) {
|
| 119 |
+
$users = get_users( array( 'meta_key' => 'pv_shop_slug', 'meta_value' => sanitize_title( $_POST[ 'pv_shop_name' ] ) ) );
|
| 120 |
+
if ( !empty( $users ) && $users[ 0 ]->ID != $user_id ) {
|
| 121 |
+
wc_add_notice( __( 'That shop name is already taken. Your shop name must be unique.', 'wcvendors' ), 'error' );
|
| 122 |
+
} else {
|
| 123 |
+
update_user_meta( $user_id, 'pv_shop_name', $_POST[ 'pv_shop_name' ] );
|
| 124 |
+
update_user_meta( $user_id, 'pv_shop_slug', sanitize_title( $_POST[ 'pv_shop_name' ] ) );
|
| 125 |
+
}
|
| 126 |
+
}
|
| 127 |
+
|
| 128 |
+
if ( isset( $_POST[ 'pv_shop_description' ] ) ) {
|
| 129 |
+
update_user_meta( $user_id, 'pv_shop_description', $_POST[ 'pv_shop_description' ] );
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
if ( isset( $_POST[ 'pv_seller_info' ] ) ) {
|
| 133 |
+
update_user_meta( $user_id, 'pv_seller_info', $_POST[ 'pv_seller_info' ] );
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
do_action( 'wcvendors_shop_settings_saved', $user_id );
|
| 137 |
+
|
| 138 |
+
if ( !wc_notice_count() ) {
|
| 139 |
+
wc_add_notice( __( 'Settings saved.', 'wcvendors' ), 'success' );
|
| 140 |
+
}
|
| 141 |
+
}
|
| 142 |
+
}
|
| 143 |
+
|
| 144 |
+
|
| 145 |
+
/**
|
| 146 |
+
*
|
| 147 |
+
*/
|
| 148 |
+
public function check_access()
|
| 149 |
+
{
|
| 150 |
+
$vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
|
| 151 |
+
$shop_settings_page = WC_Vendors::$pv_options->get_option( 'shop_settings_page' );
|
| 152 |
+
|
| 153 |
+
if ( $vendor_dashboard_page && is_page( $vendor_dashboard_page ) || $shop_settings_page && is_page( $shop_settings_page ) ) {
|
| 154 |
+
if ( !is_user_logged_in() ) {
|
| 155 |
+
wp_redirect( get_permalink( wc_get_page_id( 'myaccount' ) ), 303 );
|
| 156 |
+
exit;
|
| 157 |
+
}
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
} //check_access()
|
| 161 |
+
|
| 162 |
+
|
| 163 |
+
/**
|
| 164 |
+
* [wcv_vendor_dashboard] shortcode
|
| 165 |
+
*
|
| 166 |
+
* @param array $atts
|
| 167 |
+
*
|
| 168 |
+
* @return unknown
|
| 169 |
+
*/
|
| 170 |
+
public function display_vendor_products( $atts )
|
| 171 |
+
{
|
| 172 |
+
global $start_date, $end_date;
|
| 173 |
+
|
| 174 |
+
$start_date = !empty( $_SESSION[ 'PV_Session' ][ 'start_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'start_date' ] : strtotime( date( 'Ymd', strtotime( date( 'Ym', current_time( 'timestamp' ) ) . '01' ) ) );
|
| 175 |
+
$end_date = !empty( $_SESSION[ 'PV_Session' ][ 'end_date' ] ) ? $_SESSION[ 'PV_Session' ][ 'end_date' ] : strtotime( date( 'Ymd', current_time( 'timestamp' ) ) );
|
| 176 |
+
|
| 177 |
+
$can_view_orders = WC_Vendors::$pv_options->get_option( 'can_show_orders' );
|
| 178 |
+
$settings_page = get_permalink( WC_Vendors::$pv_options->get_option( 'shop_settings_page' ) );
|
| 179 |
+
$can_submit = WC_Vendors::$pv_options->get_option( 'can_submit_products' );
|
| 180 |
+
$submit_link = ( $can_submit ) ? admin_url( 'post-new.php?post_type=product' ) : '';
|
| 181 |
+
$edit_link = ( $can_submit ) ? admin_url( 'edit.php?post_type=product' ) : '';
|
| 182 |
+
|
| 183 |
+
if ( !$this->can_view_vendor_page() ) {
|
| 184 |
+
return false;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
extract( shortcode_atts( array(
|
| 188 |
+
'user_id' => get_current_user_id(),
|
| 189 |
+
'datepicker' => true,
|
| 190 |
+
), $atts ) );
|
| 191 |
+
|
| 192 |
+
$vendor_products = WCV_Queries::get_commission_products( $user_id );
|
| 193 |
+
$products = array();
|
| 194 |
+
foreach ($vendor_products as $_product) {
|
| 195 |
+
$products[] = $_product->ID;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
$vendor_summary = $this->format_product_details( $vendor_products );
|
| 199 |
+
$order_summary = WCV_Queries::get_orders_for_products( $products );
|
| 200 |
+
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 201 |
+
|
| 202 |
+
wp_enqueue_style( 'wcv_frontend_style', wcv_assets_url . 'css/wcv-frontend.css' );
|
| 203 |
+
|
| 204 |
+
$providers = array();
|
| 205 |
+
$provider_array = array();
|
| 206 |
+
|
| 207 |
+
// WC Shipment Tracking Providers
|
| 208 |
+
if ( class_exists( 'WC_Shipment_Tracking' ) ) {
|
| 209 |
+
$WC_Shipment_Tracking = new WC_Shipment_Tracking();
|
| 210 |
+
$providers = (method_exists($WC_Shipment_Tracking, 'get_providers')) ? $WC_Shipment_Tracking->get_providers() : $WC_Shipment_Tracking->providers;
|
| 211 |
+
$provider_array = array();
|
| 212 |
+
foreach ( $providers as $all_providers ) {
|
| 213 |
+
foreach ( $all_providers as $provider => $format ) {
|
| 214 |
+
$provider_array[sanitize_title( $provider )] = urlencode( $format );
|
| 215 |
+
}
|
| 216 |
+
}
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
ob_start();
|
| 220 |
+
do_action( 'wcvendors_before_dashboard' );
|
| 221 |
+
|
| 222 |
+
wc_print_notices();
|
| 223 |
+
wc_get_template( 'links.php', array(
|
| 224 |
+
'shop_page' => urldecode($shop_page),
|
| 225 |
+
'settings_page' => $settings_page,
|
| 226 |
+
'can_submit' => $can_submit,
|
| 227 |
+
'submit_link' => $submit_link,
|
| 228 |
+
'edit_link' => $edit_link,
|
| 229 |
+
), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 230 |
+
|
| 231 |
+
if ( $can_view_sales = WC_Vendors::$pv_options->get_option( 'can_view_frontend_reports' ) ) {
|
| 232 |
+
|
| 233 |
+
wc_get_template( 'reports.php', array(
|
| 234 |
+
'start_date' => $start_date,
|
| 235 |
+
'end_date' => $end_date,
|
| 236 |
+
'vendor_products' => $vendor_products,
|
| 237 |
+
'vendor_summary' => $vendor_summary,
|
| 238 |
+
'datepicker' => $datepicker,
|
| 239 |
+
'can_view_orders' => $can_view_orders,
|
| 240 |
+
), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 241 |
+
}
|
| 242 |
+
|
| 243 |
+
wc_get_template( 'orders.php', array(
|
| 244 |
+
'start_date' => $start_date,
|
| 245 |
+
'end_date' => $end_date,
|
| 246 |
+
'vendor_products' => $vendor_products,
|
| 247 |
+
'order_summary' => $order_summary,
|
| 248 |
+
'datepicker' => $datepicker,
|
| 249 |
+
'providers' => $providers,
|
| 250 |
+
'provider_array' => $provider_array,
|
| 251 |
+
'can_view_orders' => $can_view_orders,
|
| 252 |
+
), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 253 |
+
do_action( 'wcvendors_after_dashboard' );
|
| 254 |
+
|
| 255 |
+
|
| 256 |
+
if ( function_exists( 'wc_enqueue_js' ) ) {
|
| 257 |
+
wc_enqueue_js( WCV_Vendor_dashboard::wc_st_js( $provider_array ) );
|
| 258 |
+
} else {
|
| 259 |
+
$woocommerce->add_inline_js( $js );
|
| 260 |
+
}
|
| 261 |
+
|
| 262 |
+
return ob_get_clean();
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
|
| 266 |
+
/**
|
| 267 |
+
* [pv_recent_vendor_sales] shortcode
|
| 268 |
+
*
|
| 269 |
+
* @param array $atts
|
| 270 |
+
*
|
| 271 |
+
* @return unknown
|
| 272 |
+
*/
|
| 273 |
+
public function display_vendor_settings( $atts )
|
| 274 |
+
{
|
| 275 |
+
global $woocommerce;
|
| 276 |
+
|
| 277 |
+
if ( !$this->can_view_vendor_page() ) {
|
| 278 |
+
return false;
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
extract( shortcode_atts( array(
|
| 282 |
+
'user_id' => get_current_user_id(),
|
| 283 |
+
'paypal_address' => true,
|
| 284 |
+
'shop_description' => true,
|
| 285 |
+
), $atts ) );
|
| 286 |
+
|
| 287 |
+
$description = get_user_meta( $user_id, 'pv_shop_description', true );
|
| 288 |
+
$seller_info = get_user_meta( $user_id, 'pv_seller_info', true );
|
| 289 |
+
$has_html = get_user_meta( $user_id, 'pv_shop_html_enabled', true );
|
| 290 |
+
$shop_page = WCV_Vendors::get_vendor_shop_page( wp_get_current_user()->user_login );
|
| 291 |
+
$global_html = WC_Vendors::$pv_options->get_option( 'shop_html_enabled' );
|
| 292 |
+
|
| 293 |
+
ob_start();
|
| 294 |
+
wc_get_template( 'settings.php', array(
|
| 295 |
+
'description' => $description,
|
| 296 |
+
'global_html' => $global_html,
|
| 297 |
+
'has_html' => $has_html,
|
| 298 |
+
'paypal_address' => $paypal_address,
|
| 299 |
+
'seller_info' => $seller_info,
|
| 300 |
+
'shop_description' => $shop_description,
|
| 301 |
+
'shop_page' => $shop_page,
|
| 302 |
+
'user_id' => $user_id,
|
| 303 |
+
), 'wc-vendors/dashboard/settings/', wcv_plugin_dir . 'templates/dashboard/settings/' );
|
| 304 |
+
|
| 305 |
+
return ob_get_clean();
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
|
| 309 |
+
/**
|
| 310 |
+
*
|
| 311 |
+
*
|
| 312 |
+
* @return unknown
|
| 313 |
+
*/
|
| 314 |
+
public static function can_view_vendor_page()
|
| 315 |
+
{
|
| 316 |
+
if ( !is_user_logged_in() ) {
|
| 317 |
+
|
| 318 |
+
return false;
|
| 319 |
+
|
| 320 |
+
} else if ( !WCV_Vendors::is_vendor( get_current_user_id() ) ) {
|
| 321 |
+
|
| 322 |
+
wc_get_template( 'denied.php', array(), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 323 |
+
|
| 324 |
+
return false;
|
| 325 |
+
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
return true;
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
|
| 332 |
+
/**
|
| 333 |
+
* Format products for easier displaying
|
| 334 |
+
*
|
| 335 |
+
* @param object $products
|
| 336 |
+
*
|
| 337 |
+
* @return array
|
| 338 |
+
*/
|
| 339 |
+
public function format_product_details( $products )
|
| 340 |
+
{
|
| 341 |
+
if ( empty( $products ) ) return false;
|
| 342 |
+
|
| 343 |
+
// This is required to support existing installations after WC 2.6
|
| 344 |
+
$orders_page_id = (string) WC_Vendors::$pv_options->get_option( 'orders_page' );
|
| 345 |
+
$orders_page_id = ( strlen( $orders_page_id ) > 0 ) ? $orders_page_id : WC_Vendors::$pv_options->get_option( 'product_orders_page' );
|
| 346 |
+
$orders_page = get_permalink( $orders_page_id );
|
| 347 |
+
$default_commission = WC_Vendors::$pv_options->get_option( 'default_commission' );
|
| 348 |
+
$total_qty = $total_cost = 0;
|
| 349 |
+
$data = array(
|
| 350 |
+
'products' => array(),
|
| 351 |
+
'total_qty' => '',
|
| 352 |
+
'total_cost' => '',
|
| 353 |
+
);
|
| 354 |
+
|
| 355 |
+
foreach ( $products as $product )
|
| 356 |
+
$ids[ ] = $product->ID;
|
| 357 |
+
|
| 358 |
+
$orders = WCV_Queries::sum_orders_for_products( $ids, array( 'vendor_id' => get_current_user_id() ) );
|
| 359 |
+
|
| 360 |
+
if ( $orders )
|
| 361 |
+
foreach ( $orders as $order_item ) {
|
| 362 |
+
if ( $order_item->qty < 1 ) continue;
|
| 363 |
+
|
| 364 |
+
$commission_rate = WCV_Commission::get_commission_rate( $order_item->product_id );
|
| 365 |
+
$_product = wc_get_product( $order_item->product_id );
|
| 366 |
+
$parent_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $_product->parent->id : $_product->get_parent_id();
|
| 367 |
+
$id = !empty( $parent_id ) ?$parent_id : $order_item->product_id;
|
| 368 |
+
|
| 369 |
+
$data[ 'products' ][$id] = array(
|
| 370 |
+
'id' => $id,
|
| 371 |
+
'title' => $_product->get_title(),
|
| 372 |
+
'qty' => !empty($data[ 'products' ][$id]) ? $data[ 'products' ][$id]['qty'] + $order_item->qty : $order_item->qty,
|
| 373 |
+
'cost' => !empty($data[ 'products' ][$id]) ? $data[ 'products' ][$id]['cost'] + $order_item->line_total : $order_item->line_total,
|
| 374 |
+
'view_orders_url' => esc_url( add_query_arg( 'orders_for_product', $id, $orders_page ) ),
|
| 375 |
+
'commission_rate' => $commission_rate,
|
| 376 |
+
);
|
| 377 |
+
|
| 378 |
+
$total_qty += $order_item->qty;
|
| 379 |
+
$total_cost += $order_item->line_total;
|
| 380 |
+
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
$data[ 'total_qty' ] = $total_qty;
|
| 384 |
+
$data[ 'total_cost' ] = $total_cost;
|
| 385 |
+
|
| 386 |
+
// Sort by product title
|
| 387 |
+
if ( !empty( $data[ 'products' ] ) )
|
| 388 |
+
usort( $data[ 'products' ], array( $this, 'sort_by_title' ) );
|
| 389 |
+
|
| 390 |
+
return $data;
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
|
| 394 |
+
/**
|
| 395 |
+
* Sort an array by 'title'
|
| 396 |
+
*
|
| 397 |
+
* @param array $a
|
| 398 |
+
* @param array $b
|
| 399 |
+
*
|
| 400 |
+
* @return array
|
| 401 |
+
*/
|
| 402 |
+
private function sort_by_title( array $a, array $b )
|
| 403 |
+
{
|
| 404 |
+
return strcasecmp( $a[ 'title' ], $b[ 'title' ] );
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
/**
|
| 408 |
+
* Load the javascript for the WC Shipment Tracking form
|
| 409 |
+
*/
|
| 410 |
+
public static function wc_st_js( $provider_array ) {
|
| 411 |
+
$js = "
|
| 412 |
+
jQuery(function() {
|
| 413 |
+
|
| 414 |
+
var providers = jQuery.parseJSON( '" . json_encode( $provider_array ) . "' );
|
| 415 |
+
|
| 416 |
+
jQuery('#tracking_number').prop('readonly',true);
|
| 417 |
+
jQuery('#date_shipped').prop('readonly',true);
|
| 418 |
+
|
| 419 |
+
function updatelink( tracking, provider ) {
|
| 420 |
+
|
| 421 |
+
var postcode = '32';
|
| 422 |
+
postcode = encodeURIComponent(postcode);
|
| 423 |
+
|
| 424 |
+
link = providers[provider];
|
| 425 |
+
link = link.replace('%251%24s', tracking);
|
| 426 |
+
link = link.replace('%252%24s', postcode);
|
| 427 |
+
link = decodeURIComponent(link);
|
| 428 |
+
return link;
|
| 429 |
+
}
|
| 430 |
+
|
| 431 |
+
jQuery('.tracking_provider, #tracking_number').unbind().change(function(){
|
| 432 |
+
|
| 433 |
+
var form = jQuery(this).parent().parent().attr('id');
|
| 434 |
+
|
| 435 |
+
var tracking = jQuery('#' + form + ' input#tracking_number').val();
|
| 436 |
+
var provider = jQuery('#' + form + ' #tracking_provider').val();
|
| 437 |
+
|
| 438 |
+
if ( providers[ provider ]) {
|
| 439 |
+
link = updatelink(tracking, provider);
|
| 440 |
+
jQuery('#' + form + ' #tracking_number').prop('readonly',false);
|
| 441 |
+
jQuery('#' + form + ' #date_shipped').prop('readonly',false);
|
| 442 |
+
jQuery('#' + form + ' .custom_tracking_url_field, #' + form + ' .custom_tracking_provider_name_field').hide();
|
| 443 |
+
} else {
|
| 444 |
+
jQuery('#' + form + ' .custom_tracking_url_field, #' + form + ' .custom_tracking_provider_name_field').show();
|
| 445 |
+
link = jQuery('#' + form + ' input#custom_tracking_link').val();
|
| 446 |
+
}
|
| 447 |
+
|
| 448 |
+
if (link) {
|
| 449 |
+
jQuery('#' + form + ' p.preview_tracking_link a').attr('href', link);
|
| 450 |
+
jQuery('#' + form + ' p.preview_tracking_link').show();
|
| 451 |
+
} else {
|
| 452 |
+
jQuery('#' + form + ' p.preview_tracking_link').hide();
|
| 453 |
+
}
|
| 454 |
+
|
| 455 |
+
});
|
| 456 |
+
|
| 457 |
+
jQuery('#custom_tracking_provider_name').unbind().click(function(){
|
| 458 |
+
|
| 459 |
+
var form = jQuery(this).parent().parent().attr('id');
|
| 460 |
+
|
| 461 |
+
jQuery('#' + form + ' #tracking_number').prop('readonly',false);
|
| 462 |
+
jQuery('#' + form + ' #date_shipped').prop('readonly',false);
|
| 463 |
+
|
| 464 |
+
});
|
| 465 |
+
|
| 466 |
+
});
|
| 467 |
+
";
|
| 468 |
+
|
| 469 |
+
return $js;
|
| 470 |
+
} // wc_st_js()
|
| 471 |
+
|
| 472 |
+
|
| 473 |
+
/**
|
| 474 |
+
* Add custom wcvendors pro css classes
|
| 475 |
+
*
|
| 476 |
+
* @since 1.0.0
|
| 477 |
+
* @access public
|
| 478 |
+
*
|
| 479 |
+
* @param array $classes - body css classes
|
| 480 |
+
* @return array $classes - body css classes
|
| 481 |
+
*/
|
| 482 |
+
public function body_class( $classes ){
|
| 483 |
+
|
| 484 |
+
$dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
|
| 485 |
+
|
| 486 |
+
// This is required to support existing installations after WC 2.6
|
| 487 |
+
$orders_page_id = WC_Vendors::$pv_options->get_option( 'orders_page' );
|
| 488 |
+
$orders_page_id = isset( $orders_page_id ) ? $orders_page_id : WC_Vendors::$pv_options->get_option( 'product_orders_page' );
|
| 489 |
+
|
| 490 |
+
$orders_page = $orders_page_id;
|
| 491 |
+
$shop_settings = WC_Vendors::$pv_options->get_option( 'shop_settings_page' );
|
| 492 |
+
$terms_page = WC_Vendors::$pv_options->get_option( 'terms_to_apply_page' );
|
| 493 |
+
|
| 494 |
+
if ( is_page( $dashboard_page ) ){
|
| 495 |
+
$classes[] = 'wcvendors wcv-vendor-dashboard-page';
|
| 496 |
+
}
|
| 497 |
+
|
| 498 |
+
if ( is_page( $orders_page ) ){
|
| 499 |
+
$classes[] = 'wcvendors wcv-orders-page';
|
| 500 |
+
}
|
| 501 |
+
|
| 502 |
+
if ( is_page( $shop_settings ) ){
|
| 503 |
+
$classes[] = 'wcvendors wcv-shop-settings-page';
|
| 504 |
+
}
|
| 505 |
+
|
| 506 |
+
if ( is_page( $terms_page ) ){
|
| 507 |
+
$classes[] = 'wcvendors wcv-terms-page';
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
|
| 511 |
+
return $classes;
|
| 512 |
+
|
| 513 |
+
|
| 514 |
+
} // body_class()
|
| 515 |
+
}
|
trunk/classes/front/orders/class-export-csv.php
ADDED
|
@@ -0,0 +1,98 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class WCV_Export_CSV
|
| 4 |
+
{
|
| 5 |
+
|
| 6 |
+
/**
|
| 7 |
+
* Sort the data for CSV output first
|
| 8 |
+
*
|
| 9 |
+
* @param int $product_id
|
| 10 |
+
* @param array $headers
|
| 11 |
+
* @param array $body
|
| 12 |
+
* @param array $items
|
| 13 |
+
*/
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
public static function output_csv( $product_id, $headers, $body, $items )
|
| 17 |
+
{
|
| 18 |
+
|
| 19 |
+
$headers[ 'quantity' ] = __( 'Quantity', 'wcvendors' );
|
| 20 |
+
$headers[ 'item_meta' ] = __( 'Item Meta', 'wcvendors' );
|
| 21 |
+
|
| 22 |
+
$new_body = array();
|
| 23 |
+
|
| 24 |
+
foreach ( $body as $i => $order ) {
|
| 25 |
+
|
| 26 |
+
// Remove comments
|
| 27 |
+
unset( $body[ $i ][ 'comments' ] );
|
| 28 |
+
|
| 29 |
+
// Remove all numeric keys in each order (these are the meta values we are redoing into new lines)
|
| 30 |
+
foreach ( $order as $key => $col ) {
|
| 31 |
+
if ( is_int( $key ) ) unset( $order[ $key ] );
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
// New order row
|
| 35 |
+
$new_row = $body[ $i ];
|
| 36 |
+
// Remove order to redo
|
| 37 |
+
unset( $body[ $i ] );
|
| 38 |
+
|
| 39 |
+
$order = new WC_Order( $i );
|
| 40 |
+
|
| 41 |
+
foreach ( $items[ $i ][ 'items' ] as $item ) {
|
| 42 |
+
|
| 43 |
+
$product_id = !empty( $item['variation_id'] ) ? $item['variation_id'] : $item['product_id'];
|
| 44 |
+
|
| 45 |
+
$_product = $order->get_product_from_item( $item );
|
| 46 |
+
|
| 47 |
+
$new_row_with_meta = $new_row;
|
| 48 |
+
|
| 49 |
+
// Add the qty row
|
| 50 |
+
$new_row_with_meta[] = $item[ 'qty' ];
|
| 51 |
+
// Add the new item meta row
|
| 52 |
+
|
| 53 |
+
$variation_detail = !empty( $item['variation_id'] ) ? WCV_Orders::get_variation_data( $item[ 'variation_id' ] ) : '';
|
| 54 |
+
|
| 55 |
+
$new_row_with_meta[] = $variation_detail;
|
| 56 |
+
$new_row_with_meta['product'] = $item[ 'name' ];
|
| 57 |
+
$new_body[] = $new_row_with_meta;
|
| 58 |
+
}
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
$headers = apply_filters( 'wcvendors_csv_headers', $headers, $product_id, $items );
|
| 62 |
+
$body = apply_filters( 'wcvendors_csv_body', $new_body, $product_id, $items );
|
| 63 |
+
|
| 64 |
+
WCV_Export_CSV::download( $headers, $body, $product_id );
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* Send the CSV to the browser for download
|
| 70 |
+
*
|
| 71 |
+
* @param array $headers
|
| 72 |
+
* @param array $body
|
| 73 |
+
* @param string $filename
|
| 74 |
+
*/
|
| 75 |
+
public static function download( $headers, $body, $filename )
|
| 76 |
+
{
|
| 77 |
+
// Clear browser output before this point
|
| 78 |
+
if (ob_get_contents()) ob_end_clean();
|
| 79 |
+
|
| 80 |
+
// Output headers so that the file is downloaded rather than displayed
|
| 81 |
+
header( 'Content-Type: text/csv; charset=utf-8' );
|
| 82 |
+
header( 'Content-Disposition: attachment; filename=orders_for_' . $filename . '.csv' );
|
| 83 |
+
|
| 84 |
+
// Create a file pointer connected to the output stream
|
| 85 |
+
$output = fopen( 'php://output', 'w' );
|
| 86 |
+
|
| 87 |
+
// Output the column headings
|
| 88 |
+
fputcsv( $output, $headers );
|
| 89 |
+
|
| 90 |
+
// Body
|
| 91 |
+
foreach ( $body as $data )
|
| 92 |
+
fputcsv( $output, $data );
|
| 93 |
+
|
| 94 |
+
die();
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
|
| 98 |
+
}
|
trunk/classes/front/orders/class-orders.php
ADDED
|
@@ -0,0 +1,362 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* My account views
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Orders
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* __construct()
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
$this->can_view_orders = WC_Vendors::$pv_options->get_option( 'can_show_orders' );
|
| 21 |
+
$this->can_export_csv = WC_Vendors::$pv_options->get_option( 'can_export_csv' );
|
| 22 |
+
$this->can_view_emails = WC_Vendors::$pv_options->get_option( 'can_view_order_emails' );
|
| 23 |
+
|
| 24 |
+
add_action( 'template_redirect', array( $this, 'check_access' ) );
|
| 25 |
+
add_action( 'template_redirect', array( $this, 'process_export_orders' ) );
|
| 26 |
+
// add_action( 'template_redirect', array( $this, 'display_product_orders' ) );
|
| 27 |
+
// add_action( 'wp', array( $this, 'display_shortcodes' ) );
|
| 28 |
+
add_shortcode( 'wcv_orders', array( $this, 'display_product_orders' ) );
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
*
|
| 34 |
+
*/
|
| 35 |
+
public function check_access()
|
| 36 |
+
{
|
| 37 |
+
|
| 38 |
+
// This is required to support existing installations after WC 2.6
|
| 39 |
+
$orders_page_id = WC_Vendors::$pv_options->get_option( 'orders_page' );
|
| 40 |
+
$orders_page_id = isset( $orders_page_id ) ? $orders_page_id : WC_Vendors::$pv_options->get_option( 'product_orders_page' );
|
| 41 |
+
|
| 42 |
+
$orders_page = $orders_page_id;
|
| 43 |
+
// Only if the orders page is set should we check access
|
| 44 |
+
if ( $orders_page && is_page( $orders_page ) && !is_user_logged_in() ) {
|
| 45 |
+
wp_redirect( get_permalink( wc_get_page_id( 'myaccount' ) ), 303 );
|
| 46 |
+
exit;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
} // check_access()
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
/**
|
| 53 |
+
* DEPRICATED
|
| 54 |
+
*/
|
| 55 |
+
public function display_shortcodes()
|
| 56 |
+
{
|
| 57 |
+
|
| 58 |
+
if ( is_page( WC_Vendors::$pv_options->get_option( 'orders_page' ) ) && $this->can_view_orders ) {
|
| 59 |
+
|
| 60 |
+
wp_enqueue_script( 'jquery' );
|
| 61 |
+
|
| 62 |
+
$this->product_id = !empty( $_GET[ 'orders_for_product' ] ) ? (int) $_GET[ 'orders_for_product' ] : false;
|
| 63 |
+
|
| 64 |
+
$products = array( $this->product_id );
|
| 65 |
+
|
| 66 |
+
$_product = wc_get_product( $this->product_id );
|
| 67 |
+
|
| 68 |
+
if ( is_object( $_product ) ) {
|
| 69 |
+
|
| 70 |
+
$children = $_product->get_children();
|
| 71 |
+
|
| 72 |
+
if ( !empty( $children ) ) {
|
| 73 |
+
$products = array_merge($products, $children);
|
| 74 |
+
$products = array_unique($products);
|
| 75 |
+
}
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
$this->orders = WCV_Queries::get_orders_for_products( $products, array( 'vendor_id' => get_current_user_id() ) );
|
| 79 |
+
|
| 80 |
+
add_action( 'init', array( $this, 'verify_order_access' ) );
|
| 81 |
+
add_shortcode( 'wcv_orders', array( $this, 'display_product_orders' ) );
|
| 82 |
+
|
| 83 |
+
if ( $this->can_export_csv && !empty( $_POST[ 'export_orders' ] ) ) {
|
| 84 |
+
$this->download_csv();
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
/**
|
| 92 |
+
* Processs export orders csv request
|
| 93 |
+
*
|
| 94 |
+
* @since 1.9.4
|
| 95 |
+
*/
|
| 96 |
+
public function process_export_orders( ){
|
| 97 |
+
|
| 98 |
+
if ( empty( $_GET[ 'orders_for_product' ] ) ) {
|
| 99 |
+
|
| 100 |
+
return __( 'You haven\'t selected a product\'s orders to view! Please go back to the Vendor Dashboard and click Show Orders on the product you\'d like to view.', 'wcvendors' );
|
| 101 |
+
|
| 102 |
+
} else {
|
| 103 |
+
$this->product_id = !empty( $_GET[ 'orders_for_product' ] ) ? (int) $_GET[ 'orders_for_product' ] : false;
|
| 104 |
+
|
| 105 |
+
$products = array( $this->product_id );
|
| 106 |
+
|
| 107 |
+
$_product = wc_get_product( $this->product_id );
|
| 108 |
+
|
| 109 |
+
if ( is_object( $_product ) ) {
|
| 110 |
+
|
| 111 |
+
$children = $_product->get_children();
|
| 112 |
+
|
| 113 |
+
if ( !empty( $children ) ) {
|
| 114 |
+
$products = array_merge($products, $children);
|
| 115 |
+
$products = array_unique($products);
|
| 116 |
+
}
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
$this->orders = WCV_Queries::get_orders_for_products( $products, array( 'vendor_id' => get_current_user_id() ) );
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
if ( !$this->orders ) {
|
| 123 |
+
return __( 'No orders.', 'wcvendors' );
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
if ( $this->can_export_csv && !empty( $_POST[ 'export_orders' ] ) ) {
|
| 127 |
+
$this->download_csv();
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
} // process_export_orders()
|
| 131 |
+
|
| 132 |
+
/**
|
| 133 |
+
*
|
| 134 |
+
*
|
| 135 |
+
* @return unknown
|
| 136 |
+
*/
|
| 137 |
+
public function download_csv()
|
| 138 |
+
{
|
| 139 |
+
if ( !$this->orders ) return false;
|
| 140 |
+
|
| 141 |
+
extract( WCV_Orders::format_order_details( $this->orders, $this->product_id ) );
|
| 142 |
+
$headers = WCV_Orders::get_headers();
|
| 143 |
+
|
| 144 |
+
// Export the CSV
|
| 145 |
+
require_once wcv_plugin_dir . 'classes/front/orders/class-export-csv.php';
|
| 146 |
+
WCV_Export_CSV::output_csv( $this->product_id, $headers, $body, $items );
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
|
| 150 |
+
/**
|
| 151 |
+
* Use views to display the Orders page
|
| 152 |
+
*
|
| 153 |
+
* @return html
|
| 154 |
+
*/
|
| 155 |
+
public function display_product_orders()
|
| 156 |
+
{
|
| 157 |
+
|
| 158 |
+
if ( !WCV_Vendors::is_vendor( get_current_user_id() ) ) {
|
| 159 |
+
ob_start();
|
| 160 |
+
wc_get_template( 'denied.php', array(), 'wc-vendors/dashboard/', wcv_plugin_dir . 'templates/dashboard/' );
|
| 161 |
+
return ob_get_clean();
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
if ( empty( $_GET[ 'orders_for_product' ] ) ) {
|
| 165 |
+
|
| 166 |
+
return __( 'You haven\'t selected a product\'s orders to view! Please go back to the Vendor Dashboard and click Show Orders on the product you\'d like to view.', 'wcvendors' );
|
| 167 |
+
|
| 168 |
+
} else {
|
| 169 |
+
$this->product_id = !empty( $_GET[ 'orders_for_product' ] ) ? (int) $_GET[ 'orders_for_product' ] : false;
|
| 170 |
+
|
| 171 |
+
$products = array( $this->product_id );
|
| 172 |
+
|
| 173 |
+
$_product = wc_get_product( $this->product_id );
|
| 174 |
+
|
| 175 |
+
if ( is_object( $_product ) ) {
|
| 176 |
+
|
| 177 |
+
$children = $_product->get_children();
|
| 178 |
+
|
| 179 |
+
if ( !empty( $children ) ) {
|
| 180 |
+
$products = array_merge($products, $children);
|
| 181 |
+
$products = array_unique($products);
|
| 182 |
+
}
|
| 183 |
+
}
|
| 184 |
+
|
| 185 |
+
$this->orders = WCV_Queries::get_orders_for_products( $products, array( 'vendor_id' => get_current_user_id() ) );
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
if ( !$this->orders ) {
|
| 189 |
+
return __( 'No orders.', 'wcvendors' );
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
if ( !empty( $_POST[ 'submit_comment' ] ) ) {
|
| 193 |
+
require_once wcv_plugin_dir . 'classes/front/orders/class-submit-comment.php';
|
| 194 |
+
WCV_Submit_Comment::new_comment( $this->orders );
|
| 195 |
+
}
|
| 196 |
+
|
| 197 |
+
if ( isset( $_POST[ 'mark_shipped' ] ) ) {
|
| 198 |
+
$order_id = (int) $_POST[ 'order_id' ];
|
| 199 |
+
$product_id = (int) $_POST[ 'product_id' ];
|
| 200 |
+
exit;
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
$headers = WCV_Orders::get_headers();
|
| 204 |
+
$all = WCV_Orders::format_order_details( $this->orders, $this->product_id );
|
| 205 |
+
|
| 206 |
+
wp_enqueue_style( 'pv_frontend_style', wcv_assets_url . 'css/wcv-frontend.css' );
|
| 207 |
+
wp_enqueue_script( 'pv_frontend_script', wcv_assets_url . 'js/front-orders.js' );
|
| 208 |
+
|
| 209 |
+
$providers = array();
|
| 210 |
+
$provider_array = array();
|
| 211 |
+
|
| 212 |
+
// WC Shipment Tracking Providers
|
| 213 |
+
if ( class_exists( 'WC_Shipment_Tracking' ) ) {
|
| 214 |
+
$WC_Shipment_Tracking = new WC_Shipment_Tracking();
|
| 215 |
+
$providers = (method_exists($WC_Shipment_Tracking, 'get_providers')) ? $WC_Shipment_Tracking->get_providers() : $WC_Shipment_Tracking->providers;
|
| 216 |
+
$provider_array = array();
|
| 217 |
+
foreach ( $providers as $all_providers ) {
|
| 218 |
+
foreach ( $all_providers as $provider => $format ) {
|
| 219 |
+
$provider_array[sanitize_title( $provider )] = urlencode( $format );
|
| 220 |
+
}
|
| 221 |
+
}
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
// Show the Export CSV button
|
| 225 |
+
if ( $this->can_export_csv ) {
|
| 226 |
+
wc_get_template( 'csv-export.php', array(), 'wc-vendors/orders/', wcv_plugin_dir . 'templates/orders/' );
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
wc_get_template( 'orders.php', array(
|
| 230 |
+
'headers' => $headers,
|
| 231 |
+
'body' => $all[ 'body' ],
|
| 232 |
+
'items' => $all[ 'items' ],
|
| 233 |
+
'product_id' => $all[ 'product_id' ],
|
| 234 |
+
'providers' => $providers,
|
| 235 |
+
'provider_array' => $provider_array,
|
| 236 |
+
), 'wc-vendors/orders/', wcv_plugin_dir . 'templates/orders/' );
|
| 237 |
+
|
| 238 |
+
} // display_product_orders()
|
| 239 |
+
|
| 240 |
+
|
| 241 |
+
/**
|
| 242 |
+
* Headers for the Orders page
|
| 243 |
+
*
|
| 244 |
+
* @return array
|
| 245 |
+
*/
|
| 246 |
+
public function get_headers()
|
| 247 |
+
{
|
| 248 |
+
$headers = array(
|
| 249 |
+
'order' => __( 'Order', 'wcvendors' ),
|
| 250 |
+
'product' => __( 'Product Title', 'wcvendors' ),
|
| 251 |
+
'name' => __( 'Full name', 'wcvendors' ),
|
| 252 |
+
'address' => __( 'Address', 'wcvendors' ),
|
| 253 |
+
'city' => __( 'City', 'wcvendors' ),
|
| 254 |
+
'state' => __( 'State', 'wcvendors' ),
|
| 255 |
+
'zip' => __( 'Zip', 'wcvendors' ),
|
| 256 |
+
'email' => __( 'Email address', 'wcvendors' ),
|
| 257 |
+
'date' => __( 'Date', 'wcvendors' ),
|
| 258 |
+
);
|
| 259 |
+
|
| 260 |
+
if ( !$this->can_view_emails ) {
|
| 261 |
+
unset( $headers[ 'email' ] );
|
| 262 |
+
}
|
| 263 |
+
|
| 264 |
+
return $headers;
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
|
| 268 |
+
/**
|
| 269 |
+
* Format the orders with just the products we want
|
| 270 |
+
*
|
| 271 |
+
* @param object $orders
|
| 272 |
+
* @param int $product_id
|
| 273 |
+
*
|
| 274 |
+
* @return array
|
| 275 |
+
*/
|
| 276 |
+
public function format_order_details( $orders, $product_id )
|
| 277 |
+
{
|
| 278 |
+
$body = $items = array();
|
| 279 |
+
$product = wc_get_product( $product_id )->get_title();
|
| 280 |
+
|
| 281 |
+
foreach ( $orders as $i => $order ) {
|
| 282 |
+
$i = $order->order_id;
|
| 283 |
+
$order = new WC_Order ( $i );
|
| 284 |
+
$order_date = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_date : $order->get_date_created();
|
| 285 |
+
|
| 286 |
+
$shipping_first_name = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_first_name : $order->get_shipping_first_name();
|
| 287 |
+
$shipping_last_name = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_last_name : $order->get_shipping_last_name();
|
| 288 |
+
$shipping_address_1 = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_address_1 : $order->get_shipping_address_1();
|
| 289 |
+
$shipping_city = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_city : $order->get_shipping_city();
|
| 290 |
+
$shipping_country = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_country : $order->get_shipping_country();
|
| 291 |
+
$shipping_state = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_state : $order->get_shipping_state();
|
| 292 |
+
$shipping_postcode = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->shipping_postcode : $order->get_shipping_postcode();
|
| 293 |
+
$billing_email = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->billing_email : $order->get_billing_email();
|
| 294 |
+
$customer_note = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->customer_note : $order->get_customer_note();
|
| 295 |
+
|
| 296 |
+
$body[ $i ] = array(
|
| 297 |
+
'order_number' => $order->get_order_number(),
|
| 298 |
+
'product' => $product,
|
| 299 |
+
'name' => $shipping_first_name . ' ' . $shipping_last_name,
|
| 300 |
+
'address' => $shipping_address_1,
|
| 301 |
+
'city' => $shipping_city,
|
| 302 |
+
'state' => $shipping_state,
|
| 303 |
+
'zip' => $shipping_postcode,
|
| 304 |
+
'email' => $billing_email,
|
| 305 |
+
'date' => date_i18n( wc_date_format(), strtotime( $order_date ) ),
|
| 306 |
+
'comments' => wptexturize( $customer_note ),
|
| 307 |
+
);
|
| 308 |
+
|
| 309 |
+
if ( !$this->can_view_emails ) {
|
| 310 |
+
unset( $body[ $i ][ 'email' ] );
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
$items[ $i ][ 'total_qty' ] = 0;
|
| 314 |
+
foreach ( $order->get_items() as $line_id => $item ) {
|
| 315 |
+
|
| 316 |
+
if ( $item[ 'product_id' ] != $product_id && $item[ 'variation_id' ] != $product_id ) continue;
|
| 317 |
+
|
| 318 |
+
$items[ $i ][ 'items' ][ ] = $item;
|
| 319 |
+
$items[ $i ][ 'total_qty' ] += $item[ 'qty' ];
|
| 320 |
+
}
|
| 321 |
+
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
return array( 'body' => $body, 'items' => $items, 'product_id' => $product_id );
|
| 325 |
+
}
|
| 326 |
+
|
| 327 |
+
|
| 328 |
+
/**
|
| 329 |
+
* Verify the current user can view orders for a product
|
| 330 |
+
*
|
| 331 |
+
* @param int $product_id
|
| 332 |
+
*/
|
| 333 |
+
public function verify_order_access()
|
| 334 |
+
{
|
| 335 |
+
if ( !is_user_logged_in() || empty( $this->product_id ) ) {
|
| 336 |
+
wp_safe_redirect( apply_filters( 'woocommerce_get_myaccount_page_id', get_permalink( woocommerce_get_page_id( 'myaccount' ) ) ) );
|
| 337 |
+
exit;
|
| 338 |
+
}
|
| 339 |
+
|
| 340 |
+
$product = get_post( $this->product_id );
|
| 341 |
+
if ( empty ( $product ) || $product->post_type != 'product' || get_current_user_id() != $product->post_author ) {
|
| 342 |
+
wp_safe_redirect( apply_filters( 'woocommerce_get_myaccount_page_id', get_permalink( woocommerce_get_page_id( 'myaccount' ) ) ) );
|
| 343 |
+
exit;
|
| 344 |
+
}
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
/**
|
| 348 |
+
* Get the variation data for a product
|
| 349 |
+
*
|
| 350 |
+
* @since 1.9.4
|
| 351 |
+
* @return string variation_data
|
| 352 |
+
*/
|
| 353 |
+
public static function get_variation_data( $item_id ){
|
| 354 |
+
|
| 355 |
+
$_var_product = new WC_Product_Variation( $item_id );
|
| 356 |
+
$variation_data = $_var_product->get_variation_attributes();
|
| 357 |
+
$variation_detail = wc_get_formatted_variation( $variation_data, true );
|
| 358 |
+
return $variation_detail;
|
| 359 |
+
|
| 360 |
+
} // get_variation_data()
|
| 361 |
+
|
| 362 |
+
}
|
trunk/classes/front/orders/class-submit-comment.php
ADDED
|
@@ -0,0 +1,81 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class WCV_Submit_Comment
|
| 4 |
+
{
|
| 5 |
+
|
| 6 |
+
/**
|
| 7 |
+
* Submit a comment for an order
|
| 8 |
+
*
|
| 9 |
+
* @param object $orders
|
| 10 |
+
*
|
| 11 |
+
* @return unknown
|
| 12 |
+
*/
|
| 13 |
+
public static function new_comment( $orders )
|
| 14 |
+
{
|
| 15 |
+
global $woocommerce;
|
| 16 |
+
|
| 17 |
+
$user = wp_get_current_user();
|
| 18 |
+
$user = $user->ID;
|
| 19 |
+
|
| 20 |
+
// Security
|
| 21 |
+
if ( !wp_verify_nonce( $_POST[ '_wpnonce' ], 'add-comment' ) ) return false;
|
| 22 |
+
|
| 23 |
+
// Check if this product belongs to the vendor submitting the comment
|
| 24 |
+
$product_id = (int) $_POST[ 'product_id' ];
|
| 25 |
+
$author = WCV_Vendors::get_vendor_from_product( $product_id );
|
| 26 |
+
if ( $author != $user ) return false;
|
| 27 |
+
|
| 28 |
+
// Find the order belonging to this comment
|
| 29 |
+
foreach ( $orders as $order ) {
|
| 30 |
+
if ( $order->order_id == $_POST[ 'order_id' ] ) {
|
| 31 |
+
$found_order = $order;
|
| 32 |
+
break;
|
| 33 |
+
}
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
// No order was found
|
| 37 |
+
if ( empty( $found_order ) ) return false;
|
| 38 |
+
|
| 39 |
+
// Don't submit empty comments
|
| 40 |
+
if ( empty( $_POST[ 'comment_text' ] ) ) {
|
| 41 |
+
wc_add_notice( __( 'You\'ve left the comment field empty!', 'wcvendors' ), 'error' );
|
| 42 |
+
|
| 43 |
+
return false;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
// Only submit if the order has the product belonging to this vendor
|
| 47 |
+
$found_order = new WC_Order ( $found_order->order_id );
|
| 48 |
+
$valid_order = false;
|
| 49 |
+
foreach ( $found_order->get_items() as $item ) {
|
| 50 |
+
if ( $item[ 'product_id' ] == $product_id ) {
|
| 51 |
+
$valid_order = true;
|
| 52 |
+
break;
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
if ( $valid_order ) {
|
| 57 |
+
$comment = esc_textarea( $_POST[ 'comment_text' ] );
|
| 58 |
+
|
| 59 |
+
add_filter( 'woocommerce_new_order_note_data', array( __CLASS__, 'filter_comment' ), 10, 2 );
|
| 60 |
+
$found_order->add_order_note( $comment, 1 );
|
| 61 |
+
remove_filter( 'woocommerce_new_order_note_data', array( __CLASS__, 'filter_comment' ), 10, 2 );
|
| 62 |
+
|
| 63 |
+
wc_add_notice( __( 'Success. The customer has been notified of your comment.', 'wcvendors' ), 'success' );
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
public static function filter_comment( $commentdata, $order )
|
| 69 |
+
{
|
| 70 |
+
$user_id = get_current_user_id();
|
| 71 |
+
|
| 72 |
+
$commentdata[ 'user_id' ] = $user_id;
|
| 73 |
+
$commentdata[ 'comment_author' ] = WCV_Vendors::get_vendor_shop_name( $user_id );
|
| 74 |
+
$commentdata[ 'comment_author_url' ] = WCV_Vendors::get_vendor_shop_page( $user_id );
|
| 75 |
+
$commentdata[ 'comment_author_email' ] = wp_get_current_user()->user_email;
|
| 76 |
+
|
| 77 |
+
return $commentdata;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
|
| 81 |
+
}
|
trunk/classes/front/signup/class-vendor-signup.php
ADDED
|
@@ -0,0 +1,174 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Signup form for applying as a vendor
|
| 5 |
+
*
|
| 6 |
+
* @author Matt Gates <http://mgates.me>
|
| 7 |
+
* @package ProductVendor
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
class WCV_Vendor_Signup
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* __construct()
|
| 17 |
+
*/
|
| 18 |
+
function __construct()
|
| 19 |
+
{
|
| 20 |
+
if ( !WC_Vendors::$pv_options->get_option( 'show_vendor_registration' ) ) return;
|
| 21 |
+
|
| 22 |
+
$this->terms_page = WC_Vendors::$pv_options->get_option( 'terms_to_apply_page' );
|
| 23 |
+
|
| 24 |
+
add_action( 'woocommerce_register_form', array( $this, 'vendor_option' ) );
|
| 25 |
+
// add_action( 'login_form', array( $this, 'login_apply_vendor_option' ) );
|
| 26 |
+
|
| 27 |
+
if ( ! class_exists( 'WCVendors_Pro' ) ) {
|
| 28 |
+
add_action( 'woocommerce_created_customer', array( $this, 'save_pending' ), 10, 2 );
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
add_action( 'template_redirect', array( $this, 'apply_form_dashboard' ), 10 );
|
| 32 |
+
add_action( 'woocommerce_register_post', array( $this, 'validate_vendor_registration' ), 10, 3 );
|
| 33 |
+
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
*
|
| 38 |
+
*/
|
| 39 |
+
public function vendor_option()
|
| 40 |
+
{
|
| 41 |
+
include_once('views/html-vendor-signup.php');
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
|
| 45 |
+
/**
|
| 46 |
+
* Show apply to be vendor on the wp-login screen
|
| 47 |
+
*
|
| 48 |
+
* @since 1.9.0
|
| 49 |
+
* @version 1.0.0
|
| 50 |
+
*/
|
| 51 |
+
public function login_apply_vendor_option(){
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
} // login_apply_vendor_option
|
| 56 |
+
|
| 57 |
+
/**
|
| 58 |
+
*
|
| 59 |
+
*
|
| 60 |
+
* @param unknown $user_id
|
| 61 |
+
*/
|
| 62 |
+
public function save_pending( $user_id )
|
| 63 |
+
{
|
| 64 |
+
|
| 65 |
+
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 66 |
+
|
| 67 |
+
wc_clear_notices();
|
| 68 |
+
|
| 69 |
+
if ( user_can( $user_id, 'manage_options' ) ) {
|
| 70 |
+
wc_add_notice( apply_filters( 'wcvendors_application_denied_msg', __( 'Application denied. You are an administrator.', 'wcvendors' ) ), 'error' );
|
| 71 |
+
} else {
|
| 72 |
+
wc_add_notice( apply_filters( 'wcvendors_application_submitted_msg', __( 'Your application has been submitted.', 'wcvendors' ) ), 'notice' );
|
| 73 |
+
|
| 74 |
+
$manual = WC_Vendors::$pv_options->get_option( 'manual_vendor_registration' );
|
| 75 |
+
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 76 |
+
|
| 77 |
+
$wp_user_object = new WP_User( $user_id );
|
| 78 |
+
$wp_user_object->set_role( $role );
|
| 79 |
+
|
| 80 |
+
do_action( 'wcvendors_application_submited', $user_id );
|
| 81 |
+
|
| 82 |
+
add_filter( 'woocommerce_registration_redirect', array( $this, 'redirect_to_vendor_dash' ) );
|
| 83 |
+
}
|
| 84 |
+
}
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
|
| 88 |
+
/**
|
| 89 |
+
* Save the pending vendor from the login screen
|
| 90 |
+
*
|
| 91 |
+
* @since 1.9.0
|
| 92 |
+
* @version 1.0.0
|
| 93 |
+
*/
|
| 94 |
+
public function login_save_pending( $user_id ){
|
| 95 |
+
|
| 96 |
+
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 97 |
+
|
| 98 |
+
$manual = WC_Vendors::$pv_options->get_option( 'manual_vendor_registration' );
|
| 99 |
+
$role = apply_filters( 'wcvendors_pending_role', ( $manual ? 'pending_vendor' : 'vendor' ) );
|
| 100 |
+
|
| 101 |
+
$wp_user_object = new WP_User( $user_id );
|
| 102 |
+
$wp_user_object->set_role( $role );
|
| 103 |
+
|
| 104 |
+
do_action( 'wcvendors_application_submited', $user_id );
|
| 105 |
+
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
} // login_save_pending()
|
| 109 |
+
|
| 110 |
+
/**
|
| 111 |
+
* Login authentication check code for vendors
|
| 112 |
+
*/
|
| 113 |
+
public function login_vendor_check( $user, $password ){
|
| 114 |
+
|
| 115 |
+
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 116 |
+
|
| 117 |
+
if ( $this->terms_page && ! isset( $_POST[ 'agree_to_terms' ] ) ) {
|
| 118 |
+
$error = new WP_Error();
|
| 119 |
+
$error->add( 'no_terms', apply_filters( 'wcvendors_agree_to_terms_error', __( 'You must accept the terms and conditions to become a vendor.', 'wcvendors' ) ) );
|
| 120 |
+
return $error;
|
| 121 |
+
} else {
|
| 122 |
+
return $user;
|
| 123 |
+
}
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
return $user;
|
| 127 |
+
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
|
| 131 |
+
public function redirect_to_vendor_dash( $redirect )
|
| 132 |
+
{
|
| 133 |
+
$vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
|
| 134 |
+
|
| 135 |
+
return apply_filters( 'wcvendors_signup_redirect', get_permalink( $vendor_dashboard_page ) );
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
|
| 139 |
+
/**
|
| 140 |
+
*
|
| 141 |
+
*
|
| 142 |
+
* @return unknown
|
| 143 |
+
*/
|
| 144 |
+
public function apply_form_dashboard()
|
| 145 |
+
{
|
| 146 |
+
if ( !isset( $_POST[ 'apply_for_vendor' ] ) ) return false;
|
| 147 |
+
|
| 148 |
+
$vendor_dashboard_page = WC_Vendors::$pv_options->get_option( 'vendor_dashboard_page' );
|
| 149 |
+
$page_id = get_queried_object_id();
|
| 150 |
+
|
| 151 |
+
if ( $page_id == $vendor_dashboard_page ) {
|
| 152 |
+
if ( $this->terms_page ) {
|
| 153 |
+
if ( isset( $_POST[ 'agree_to_terms' ] ) ) {
|
| 154 |
+
self::save_pending( get_current_user_id() );
|
| 155 |
+
} else {
|
| 156 |
+
wc_add_notice( apply_filters( 'wcvendors_agree_to_terms_error', __( 'You must accept the terms and conditions to become a vendor.', 'wcvendors' ), 'error' ) );
|
| 157 |
+
}
|
| 158 |
+
} else {
|
| 159 |
+
self::save_pending( get_current_user_id() );
|
| 160 |
+
}
|
| 161 |
+
}
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
public function validate_vendor_registration( $username, $email, $validation_errors ) {
|
| 165 |
+
|
| 166 |
+
if ( isset( $_POST[ 'apply_for_vendor' ] ) ) {
|
| 167 |
+
if ( $this->terms_page && !isset( $_POST[ 'agree_to_terms' ] ) ) {
|
| 168 |
+
$validation_errors->add( 'agree_to_terms_error', apply_filters( 'wcvendors_agree_to_terms_error', __( 'You must accept the terms and conditions to become a vendor.', 'wcvendors' ) ) );
|
| 169 |
+
}
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
|
| 174 |
+
}
|
trunk/classes/front/signup/views/html-vendor-signup.php
ADDED
|
@@ -0,0 +1,68 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Vendor Signup
|
| 5 |
+
*
|
| 6 |
+
* This file is used to output the vendor signup options on the wordpress login form.
|
| 7 |
+
*
|
| 8 |
+
* @link http://www.wcvendors.com
|
| 9 |
+
* @since 1.9.0
|
| 10 |
+
*
|
| 11 |
+
* @package WCVendors
|
| 12 |
+
* @subpackage WCVendors/classes/front/signup/views
|
| 13 |
+
*/
|
| 14 |
+
?>
|
| 15 |
+
|
| 16 |
+
<?php do_action( 'wcvendors_login_apply_for_vendor_before' ); ?>
|
| 17 |
+
|
| 18 |
+
<p class="forgetmenot">
|
| 19 |
+
<label for="apply_for_vendor">
|
| 20 |
+
<input class="input-checkbox" id="apply_for_vendor" <?php checked( isset( $_POST[ 'apply_for_vendor' ] ), true ) ?> type="checkbox" name="apply_for_vendor" value="1"/>
|
| 21 |
+
<?php echo apply_filters('wcvendors_vendor_registration_checkbox', __( 'Apply to become a vendor? ', 'wcvendors' )); ?>
|
| 22 |
+
</label>
|
| 23 |
+
|
| 24 |
+
</p>
|
| 25 |
+
|
| 26 |
+
<?php do_action( 'wcvendors_login_apply_for_vendor_after' ); ?>
|
| 27 |
+
|
| 28 |
+
<?php if ( $this->terms_page ) : ?>
|
| 29 |
+
|
| 30 |
+
<?php do_action( 'wcvendors_login_agree_to_terms_before' ); ?>
|
| 31 |
+
|
| 32 |
+
<p class="forgetmenot agree-to-terms-container" style="display:none;">
|
| 33 |
+
<label for="agree_to_terms">
|
| 34 |
+
<input class="input-checkbox" id="agree_to_terms" <?php checked( isset( $_POST[ 'agree_to_terms' ] ), true ); ?> type="checkbox" name="agree_to_terms" value="1"/>
|
| 35 |
+
<?php apply_filters( 'wcvendors_vendor_registration_terms', printf( __( 'I have read and accepted the <a target="top" href="%s">terms and conditions</a>', 'wcvendors' ), get_permalink( $this->terms_page ) ) ); ?>
|
| 36 |
+
</label>
|
| 37 |
+
</p>
|
| 38 |
+
|
| 39 |
+
<?php do_action( 'wcvendors_login_agree_to_terms_after' ); ?>
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
<script type="text/javascript">
|
| 43 |
+
|
| 44 |
+
var error_message = "<?php _e( 'Please agree to the terms and conditions', 'wcvendors'); ?>";
|
| 45 |
+
|
| 46 |
+
jQuery( function( $ ){
|
| 47 |
+
|
| 48 |
+
$( "#apply_for_vendor" ).change( function() {
|
| 49 |
+
if ( this.checked ) {
|
| 50 |
+
$('.agree-to-terms-container').show();
|
| 51 |
+
} else {
|
| 52 |
+
$('.agree-to-terms-container').hide();
|
| 53 |
+
}
|
| 54 |
+
});
|
| 55 |
+
|
| 56 |
+
$( 'form.register').on( 'submit', function ( e ){
|
| 57 |
+
if ( $('#agree_to_terms').is(':visible') && ! $('#agree_to_terms').is(':checked') ) {
|
| 58 |
+
alert( error_message );
|
| 59 |
+
e.preventDefault();
|
| 60 |
+
}
|
| 61 |
+
} );
|
| 62 |
+
|
| 63 |
+
});
|
| 64 |
+
</script>
|
| 65 |
+
|
| 66 |
+
<?php endif; ?>
|
| 67 |
+
|
| 68 |
+
<div class="clear"></div>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/index.php
ADDED
|
File without changes
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/icons/paypalap.png
ADDED
|
Binary file
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/assets/index.php
ADDED
|
File without changes
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/ChangeLog.txt
ADDED
|
@@ -0,0 +1,33 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
Version 1.2.95 - September 28, 2012
|
| 3 |
+
|
| 4 |
+
- Sender details (eg:email,phno) serialization bug fixed(https://github.com/paypal/SDKs/issues/30)
|
| 5 |
+
- Bug fixed for 'PPLoggingManager.php' to pickup configuration entries.(https://github.com/paypal/SDKs/issues/28)
|
| 6 |
+
- Updated SDK sample
|
| 7 |
+
|
| 8 |
+
--------------------------------------------------------------------------------------------------
|
| 9 |
+
|
| 10 |
+
|
| 11 |
+
Version 1.1.93 - August 13, 2012
|
| 12 |
+
|
| 13 |
+
- SDK refreshed to Release 1.8.1. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#AdaptivePaymentsAPI
|
| 14 |
+
- SDK Core - Deserialization Logic Change
|
| 15 |
+
--------------------------------------------------------------------------------------------------
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
Version 1.0.92 - July 30, 2012
|
| 19 |
+
|
| 20 |
+
- Stable release
|
| 21 |
+
-------------------------------------------------------------------------------------------------
|
| 22 |
+
Version 0.7.92 - July 17, 2012
|
| 23 |
+
- wsdl update version 0.7.92
|
| 24 |
+
------------------------------------------
|
| 25 |
+
|
| 26 |
+
Version 0.6.88 - Apr 17, 2012
|
| 27 |
+
----------------------------------------
|
| 28 |
+
- Fix to get SDK working with Permissions API token
|
| 29 |
+
- wsdl update version 88.0
|
| 30 |
+
|
| 31 |
+
Version 0.6.86 - Feb 27, 2012
|
| 32 |
+
----------------------------------------
|
| 33 |
+
- Initial release
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/LICENSE.txt
ADDED
|
@@ -0,0 +1,41 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
PAYPAL, INC.
|
| 2 |
+
|
| 3 |
+
SDK LICENSE
|
| 4 |
+
|
| 5 |
+
NOTICE TO USER: PayPal, Inc. is providing the Software and Documentation for use under the terms of this Agreement. Any use, reproduction, modification or distribution of the Software or Documentation, or any derivatives or portions hereof, constitutes your acceptance of this Agreement.
|
| 6 |
+
|
| 7 |
+
As used in this Agreement, "PayPal" means PayPal, Inc. "Software" means the software code accompanying this agreement. "Documentation" means the documents, specifications and all other items accompanying this Agreement other than the Software.
|
| 8 |
+
|
| 9 |
+
1. LICENSE GRANT Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, prepare derivative works from, publicly display, publicly perform, distribute and sublicense the Software for any purpose, provided the copyright notice below appears in a conspicuous location within the source code of the distributed Software and this license is distributed in the supporting documentation of the Software you distribute. Furthermore, you must comply with all third party licenses in order to use the third party software contained in the Software.
|
| 10 |
+
|
| 11 |
+
Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, publicly display, publicly perform, distribute and sublicense the Documentation for any purpose. You may not modify the Documentation.
|
| 12 |
+
|
| 13 |
+
No title to the intellectual property in the Software or Documentation is transferred to you under the terms of this Agreement. You do not acquire any rights to the Software or the Documentation except as expressly set forth in this Agreement.
|
| 14 |
+
|
| 15 |
+
If you choose to distribute the Software in a commercial product, you do so with the understanding that you agree to defend, indemnify and hold harmless PayPal and its suppliers against any losses, damages and costs arising from the claims, lawsuits or other legal actions arising out of such distribution. You may distribute the Software in object code form under your own license, provided that your license agreement:
|
| 16 |
+
|
| 17 |
+
(a) complies with the terms and conditions of this license agreement;
|
| 18 |
+
|
| 19 |
+
(b) effectively disclaims all warranties and conditions, express or implied, on behalf of PayPal;
|
| 20 |
+
|
| 21 |
+
(c) effectively excludes all liability for damages on behalf of PayPal;
|
| 22 |
+
|
| 23 |
+
(d) states that any provisions that differ from this Agreement are offered by you alone and not PayPal; and
|
| 24 |
+
|
| 25 |
+
(e) states that the Software is available from you or PayPal and informs licensees how to obtain it in a reasonable manner on or through a medium customarily used for software exchange.
|
| 26 |
+
|
| 27 |
+
2. DISCLAIMER OF WARRANTY
|
| 28 |
+
PAYPAL LICENSES THE SOFTWARE AND DOCUMENTATION TO YOU ONLY ON AN "AS IS" BASIS WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY WARRANTIES OR CONDITIONS OF TITLE, NON-INFRINGEMENT, MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE. PAYPAL MAKES NO WARRANTY THAT THE SOFTWARE OR DOCUMENTATION WILL BE ERROR-FREE. Each user of the Software or Documentation is solely responsible for determining the appropriateness of using and distributing the Software and Documentation and assumes all risks associated with its exercise of rights under this Agreement, including but not limited to the risks and costs of program errors, compliance with applicable laws, damage to or loss of data, programs, or equipment, and unavailability or interruption of operations. Use of the Software and Documentation is made with the understanding that PayPal will not provide you with any technical or customer support or maintenance. Some states or jurisdictions do not allow the exclusion of implied warranties or limitations on how long an implied warranty may last, so the above limitations may not apply to you. To the extent permissible, any implied warranties are limited to ninety (90) days.
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
3. LIMITATION OF LIABILITY
|
| 32 |
+
PAYPAL AND ITS SUPPLIERS SHALL NOT BE LIABLE FOR LOSS OR DAMAGE ARISING OUT OF THIS AGREEMENT OR FROM THE USE OF THE SOFTWARE OR DOCUMENTATION. IN NO EVENT WILL PAYPAL OR ITS SUPPLIERS BE LIABLE TO YOU OR ANY THIRD PARTY FOR ANY DIRECT, INDIRECT, CONSEQUENTIAL, INCIDENTAL, OR SPECIAL DAMAGES INCLUDING LOST PROFITS, LOST SAVINGS, COSTS, FEES, OR EXPENSES OF ANY KIND ARISING OUT OF ANY PROVISION OF THIS AGREEMENT OR THE USE OR THE INABILITY TO USE THE SOFTWARE OR DOCUMENTATION, HOWEVER CAUSED AND UNDER ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY OR TORT INCLUDING NEGLIGENCE OR OTHERWISE), EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. PAYPAL'S AGGREGATE LIABILITY AND THAT OF ITS SUPPLIERS UNDER OR IN CONNECTION WITH THIS AGREEMENT SHALL BE LIMITED TO THE AMOUNT PAID BY YOU FOR THE SOFTWARE AND DOCUMENTATION.
|
| 33 |
+
|
| 34 |
+
4. TRADEMARK USAGE
|
| 35 |
+
PayPal is a trademark PayPal, Inc. in the United States and other countries. Such trademarks may not be used to endorse or promote any product unless expressly permitted under separate agreement with PayPal.
|
| 36 |
+
|
| 37 |
+
5. TERM
|
| 38 |
+
Your rights under this Agreement shall terminate if you fail to comply with any of the material terms or conditions of this Agreement and do not cure such failure in a reasonable period of time after becoming aware of such noncompliance. If all your rights under this Agreement terminate, you agree to cease use and distribution of the Software and Documentation as soon as reasonably practicable.
|
| 39 |
+
|
| 40 |
+
6. GOVERNING LAW AND JURISDICTION. This Agreement is governed by the statutes and laws of the State of California, without regard to the conflicts of law principles thereof. If any part of this Agreement is found void and unenforceable, it will not affect the validity of the balance of the Agreement, which shall remain valid and enforceable according to its terms. Any dispute arising out of or related to this Agreement shall be brought in the courts of Santa Clara County, California, USA.
|
| 41 |
+
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/README.md
ADDED
|
@@ -0,0 +1,57 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
PayPal PHP Adaptive Payments SDK
|
| 3 |
+
===============================
|
| 4 |
+
|
| 5 |
+
Prerequisites
|
| 6 |
+
-------------
|
| 7 |
+
|
| 8 |
+
PayPal's PHP Adaptive Payments SDK requires
|
| 9 |
+
|
| 10 |
+
* PHP 5.2 and above with curl extension enabled
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
Using the SDK
|
| 14 |
+
-------------
|
| 15 |
+
|
| 16 |
+
To use the SDK,
|
| 17 |
+
|
| 18 |
+
* Copy the config and lib folders into your project.
|
| 19 |
+
* Make sure that the lib folder in your project is available in PHP's include path
|
| 20 |
+
* Include the services\AdaptivePayments\AdaptivePaymentsService.php file in your code.
|
| 21 |
+
* Create a service wrapper object
|
| 22 |
+
* Create a request object as per your project's needs. All the API request and response classes are available in services\AdaptivePayments\AdaptivePaymentsService.php
|
| 23 |
+
* Invoke the appropriate method on the request object.
|
| 24 |
+
|
| 25 |
+
For example,
|
| 26 |
+
|
| 27 |
+
require_once('services/AdaptivePayments/AdaptivePaymentsService.php');
|
| 28 |
+
require_once('PPLoggingManager.php');
|
| 29 |
+
|
| 30 |
+
$payRequest = new PayRequest($requestEnvelope, $_POST['actionType'], $_POST['cancelUrl'], $_POST['currencyCode'], $receiverList, $_POST['returnUrl']);
|
| 31 |
+
// Add optional params
|
| 32 |
+
if($_POST["feesPayer"] != "") {
|
| 33 |
+
$payRequest->feesPayer = $_POST["feesPayer"];
|
| 34 |
+
}
|
| 35 |
+
......
|
| 36 |
+
|
| 37 |
+
$service = new AdaptivePaymentsService();
|
| 38 |
+
$response = $service->Pay($payRequest);
|
| 39 |
+
|
| 40 |
+
$ack = strtoupper($response->responseEnvelope->ack);
|
| 41 |
+
|
| 42 |
+
if($ack == 'SUCCESS') {
|
| 43 |
+
// Success
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
SDK Configuration
|
| 49 |
+
-----------------
|
| 50 |
+
|
| 51 |
+
replace the API credential in config/sdk_config.ini . You can use the configuration file to configure
|
| 52 |
+
|
| 53 |
+
* (Multiple) API account credentials.
|
| 54 |
+
* Service endpoint and other HTTP connection parameters
|
| 55 |
+
|
| 56 |
+
|
| 57 |
+
Please refer to the sample config file provided with this bundle.
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/build.xml
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
+
<project name="PayPal_PHP_SDK" default="build">
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
<condition property="PHPUNIT_PATH" value="phpunit.bat" else="phpunit">
|
| 6 |
+
<os family="windows"/>
|
| 7 |
+
</condition>
|
| 8 |
+
|
| 9 |
+
<target name="clean">
|
| 10 |
+
<delete dir="${basedir}/build"/>
|
| 11 |
+
</target>
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
<target name="phpunit">
|
| 15 |
+
<mkdir dir="tests/reports/"/>
|
| 16 |
+
<exec dir="${basedir}" executable="${PHPUNIT_PATH}" failonerror="true">
|
| 17 |
+
<arg
|
| 18 |
+
line="--testdox --include-path lib --log-junit tests\reports\phpunit.xml tests"/>
|
| 19 |
+
</exec>
|
| 20 |
+
</target>
|
| 21 |
+
|
| 22 |
+
|
| 23 |
+
<target name="build" depends="clean, phpunit"/>
|
| 24 |
+
</project>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/cert_key.pem
ADDED
|
@@ -0,0 +1,31 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
-----BEGIN RSA PRIVATE KEY-----
|
| 2 |
+
MIICXgIBAAKBgQCaGw566OIaeIsrp2tyzfwUtwapk2aPgL9N8oOoPmTmA/bqhqF8
|
| 3 |
+
2X43EB2zZF1HY35kPp3L5rZSjqraEZz5j7W4DkXMS286wLnaoh02sVWbbXlLcZ/v
|
| 4 |
+
sAQzNgi1s2raOWonkcbAIAyhjVoGQjpuCn7y9YNgQfpZkgrh/R5ig8obQwIDAQAB
|
| 5 |
+
AoGBAI/YrZ2BAHzhBFdNQXi6WZEkfu2PD27oKKojs006YIhsLvEflmGpyqyvOGoZ
|
| 6 |
+
RxC6CGKeKEEKLCnHzicbxcEVqfKfOxrXkym3ldqBaYubL1OU62biDRtZZdIpG3TE
|
| 7 |
+
gBDRtU8gPQv1ykqY9KqdeORy8vu0lW9Zx9/4ccW126HLt/kxAkEAzF9NKltIc+gu
|
| 8 |
+
S79lzerE8qngiUSc/ccb1ssLj4v4Lf90HNeJ4oSQEikuN32GjPVrUpQYpC4fjcET
|
| 9 |
+
KmqE7k1V3wJBAMEJB3VRToeTQKhWet8JQPkcfES3B+l7NCauUcysSI5XZ9kVflLu
|
| 10 |
+
c5vzznMooRpcNtjJwDmkcnW0lhIQH/DKvx0CQQCWHJXoO54vDGYc2xuisQMyHha/
|
| 11 |
+
nHcXbA0FqqP2Lt/+oTifCq3LhITx4e+BcKDInmbTA9ZJmVsx2pQCPrUe+AzPAkA/
|
| 12 |
+
OU7ZDPVUkFU4DYMW8/f033CQLQaJYVH2bVfbWn41KMmZn2GNlg4FgTgYHbGOaa+J
|
| 13 |
+
F6M+/e6DQM96QQ/FFRK9AkEApx1r0di+W2ibrTANnk6QjQbva9JyOztI+Avg86X5
|
| 14 |
+
swB44tEsRImOTNsE6nfE/215AxjgI1vdn6uU4P8GIKfxnw==
|
| 15 |
+
-----END RSA PRIVATE KEY-----
|
| 16 |
+
-----BEGIN CERTIFICATE-----
|
| 17 |
+
MIICiDCCAfGgAwIBAgIDD/WUMA0GCSqGSIb3DQEBBQUAMIGfMQswCQYDVQQGEwJV
|
| 18 |
+
UzETMBEGA1UECBMKQ2FsaWZvcm5pYTERMA8GA1UEBxMIU2FuIEpvc2UxFTATBgNV
|
| 19 |
+
BAoTDFBheVBhbCwgSW5jLjEWMBQGA1UECxQNc2FuZGJveF9jZXJ0czEbMBkGA1UE
|
| 20 |
+
AxQSc2FuZGJveF9jYW1lcmNoYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwu
|
| 21 |
+
Y29tMB4XDTExMDUwMjA1MDQ0NFoXDTIxMDQyOTA1MDQ0NFowYzElMCMGA1UEAxQc
|
| 22 |
+
Y2VydHVzZXJfYml6X2FwaTEucGF5cGFsLmNvbTEPMA0GA1UEChMGQm9uem9wMQ8w
|
| 23 |
+
DQYDVQQHEwZBdXN0aW4xCzAJBgNVBAgTAlRYMQswCQYDVQQGEwJVUzCBnzANBgkq
|
| 24 |
+
hkiG9w0BAQEFAAOBjQAwgYkCgYEAmhsOeujiGniLK6drcs38FLcGqZNmj4C/TfKD
|
| 25 |
+
qD5k5gP26oahfNl+NxAds2RdR2N+ZD6dy+a2Uo6q2hGc+Y+1uA5FzEtvOsC52qId
|
| 26 |
+
NrFVm215S3Gf77AEMzYItbNq2jlqJ5HGwCAMoY1aBkI6bgp+8vWDYEH6WZIK4f0e
|
| 27 |
+
YoPKG0MCAwEAAaMNMAswCQYDVR0TBAIwADANBgkqhkiG9w0BAQUFAAOBgQBj6xWw
|
| 28 |
+
AumLzSodCWyocPcyKSooNa7wgJKzaVrf0Kxz2QBesKpsfe9UN3Dj04016FIUbkRI
|
| 29 |
+
4qLJIkKHyeQRU9hvJ78tU7OeykDEVqlHAEE/Z4c5EIs6l9x60VqOpAjnaqX/9Jty
|
| 30 |
+
jXhqpINjolTh6D5jq8y4FX5krKqIYBCNDHM+cQ==
|
| 31 |
+
-----END CERTIFICATE-----
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/config/sdk_config.ini
ADDED
|
@@ -0,0 +1,26 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
;Account credentials
|
| 2 |
+
[Account]
|
| 3 |
+
acct1.UserName = jb-us-seller_api1.paypal.com
|
| 4 |
+
acct1.Password = WX4WTU3S8MY44S7F
|
| 5 |
+
acct1.Signature = AFcWxV21C7fd0v3bYYYRCpSSRl31A7yDhhsPUU2XhtMoZXsWHFxu-RWy
|
| 6 |
+
acct1.AppId = APP-80W284485P519543T
|
| 7 |
+
|
| 8 |
+
;Connection Information
|
| 9 |
+
[Http]
|
| 10 |
+
http.ConnectionTimeOut = 30
|
| 11 |
+
http.Retry = 5
|
| 12 |
+
;http.Proxy
|
| 13 |
+
|
| 14 |
+
;Service Configuration
|
| 15 |
+
[Service]
|
| 16 |
+
; NOTE: Do not change the service binding configuration.
|
| 17 |
+
service.Binding = NV
|
| 18 |
+
service.EndPoint = "https://svcs.sandbox.paypal.com/"
|
| 19 |
+
service.RedirectURL = "https://www.sandbox.paypal.com/webscr&cmd="
|
| 20 |
+
service.DevCentralURL = "https://developer.paypal.com"
|
| 21 |
+
|
| 22 |
+
;Logging Information
|
| 23 |
+
[Log]
|
| 24 |
+
log.FileName = PayPal.log
|
| 25 |
+
log.LogLevel = INFO
|
| 26 |
+
log.LogEnabled = true
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/IPPCredential.php
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Base class that represents API credentials
|
| 5 |
+
*/
|
| 6 |
+
abstract class IPPCredential
|
| 7 |
+
{
|
| 8 |
+
/**
|
| 9 |
+
* Application Id that uniquely identifies the application
|
| 10 |
+
* The application Id is issued by PayPal.
|
| 11 |
+
* Test application Ids are available for the sandbox environment
|
| 12 |
+
* @var string
|
| 13 |
+
*/
|
| 14 |
+
protected $applicationId;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* API username
|
| 18 |
+
* @var string
|
| 19 |
+
*/
|
| 20 |
+
protected $userName;
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* API password
|
| 24 |
+
* @var string
|
| 25 |
+
*/
|
| 26 |
+
protected $password;
|
| 27 |
+
|
| 28 |
+
protected abstract function validate();
|
| 29 |
+
|
| 30 |
+
public function __construct( $userName, $password, $applicationId )
|
| 31 |
+
{
|
| 32 |
+
$this->userName = $userName;
|
| 33 |
+
$this->password = $password;
|
| 34 |
+
$this->applicationId = $applicationId;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
public function getApplicationId()
|
| 38 |
+
{
|
| 39 |
+
return $this->applicationId;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
public function getUserName()
|
| 43 |
+
{
|
| 44 |
+
return $this->userName;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
public function getPassword()
|
| 48 |
+
{
|
| 49 |
+
return $this->password;
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAPIService.php
ADDED
|
@@ -0,0 +1,62 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPCredentialManager.php';
|
| 3 |
+
require_once 'PPConnectionManager.php';
|
| 4 |
+
require_once 'PPObjectTransformer.php';
|
| 5 |
+
require_once 'PPLoggingManager.php';
|
| 6 |
+
require_once 'PPUtils.php';
|
| 7 |
+
require_once 'PPAuthenticationManager.php';
|
| 8 |
+
|
| 9 |
+
class PPAPIService
|
| 10 |
+
{
|
| 11 |
+
public $endpoint;
|
| 12 |
+
public $serviceName;
|
| 13 |
+
private $logger;
|
| 14 |
+
|
| 15 |
+
public function __construct( $serviceName = "" )
|
| 16 |
+
{
|
| 17 |
+
$this->serviceName = $serviceName;
|
| 18 |
+
$config = PPConfigManager::getInstance();
|
| 19 |
+
$this->endpoint = $config->get( 'service.EndPoint' );
|
| 20 |
+
$this->logger = new PPLoggingManager( __CLASS__ );
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
public function setServiceName( $serviceName )
|
| 24 |
+
{
|
| 25 |
+
$this->serviceName = $serviceName;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
public function makeRequest( $apiMethod, $params, $apiUsername = null, $accessToken = null, $tokenSecret = null )
|
| 30 |
+
{
|
| 31 |
+
|
| 32 |
+
$authentication = new PPAuthenticationManager();
|
| 33 |
+
$connectionMgr = PPConnectionManager::getInstance();
|
| 34 |
+
$connection = $connectionMgr->getConnection();
|
| 35 |
+
|
| 36 |
+
$credMgr = PPCredentialManager::getInstance();
|
| 37 |
+
// $apiUsernam is optional, if null the default account in congif file is taken
|
| 38 |
+
$apIPPCredential = $credMgr->getCredentialObject( $apiUsername );
|
| 39 |
+
$config = PPConfigManager::getInstance();
|
| 40 |
+
if ( $config->get( 'service.Binding' ) == 'SOAP' ) {
|
| 41 |
+
$url = $this->endpoint;
|
| 42 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 43 |
+
$headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 44 |
+
} else {
|
| 45 |
+
$headers = null;
|
| 46 |
+
}
|
| 47 |
+
$params = $authentication->appendSoapHeader( $params, $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 48 |
+
} else {
|
| 49 |
+
$url = $this->endpoint . $this->serviceName . '/' . $apiMethod;
|
| 50 |
+
$headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
$this->logger->info( "Request: $params" );
|
| 55 |
+
$response = $connection->execute( $url, $params, $headers );
|
| 56 |
+
$this->logger->info( "Response: $response" );
|
| 57 |
+
|
| 58 |
+
return $response;
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
}
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPAuthenticationManager.php
ADDED
|
@@ -0,0 +1,91 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'PPSignatureCredential.php';
|
| 5 |
+
require_once 'PPCertificateCredential.php';
|
| 6 |
+
require_once 'exceptions/PPInvalidCredentialException.php';
|
| 7 |
+
require_once 'auth/PPAuth.php';
|
| 8 |
+
|
| 9 |
+
class PPAuthenticationManager
|
| 10 |
+
{
|
| 11 |
+
public function getPayPalHeaders( $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
|
| 12 |
+
{
|
| 13 |
+
$config = PPConfigManager::getInstance();
|
| 14 |
+
|
| 15 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 16 |
+
$headers_arr[ ] = "X-PAYPAL-AUTHORIZATION: " . $this->generateAuthString( $apiCred, $accessToken, $tokenSecret, $url );
|
| 17 |
+
//$headers_arr[] = "CLIENT-AUTH: No cert";
|
| 18 |
+
} // Add headers required for service authentication
|
| 19 |
+
else if ( $apiCred instanceof PPSignatureCredential ) {
|
| 20 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
|
| 21 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
|
| 22 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-SIGNATURE: " . $apiCred->getSignature();
|
| 23 |
+
} else if ( $apiCred instanceof PPCertificateCredential ) {
|
| 24 |
+
|
| 25 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
|
| 26 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
|
| 27 |
+
$connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
// Add other headers
|
| 31 |
+
$headers_arr[ ] = "X-PAYPAL-APPLICATION-ID: " . $apiCred->getApplicationId();
|
| 32 |
+
$headers_arr[ ] = "X-PAYPAL-REQUEST-DATA-FORMAT: " . $config->get( 'service.Binding' );
|
| 33 |
+
$headers_arr[ ] = "X-PAYPAL-RESPONSE-DATA-FORMAT: " . $config->get( 'service.Binding' );
|
| 34 |
+
$headers_arr[ ] = "X-PAYPAL-DEVICE-IPADDRESS: " . PPUtils::getLocalIPAddress();
|
| 35 |
+
$headers_arr[ ] = "X-PAYPAL-REQUEST-SOURCE: " . PPUtils::getRequestSource();
|
| 36 |
+
|
| 37 |
+
return $headers_arr;
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
public function appendSoapHeader( $payLoad, $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
|
| 41 |
+
{
|
| 42 |
+
$soapHeader = "<soapenv:Envelope xmlns:soapenv=\"http://schemas.xmlsoap.org/soap/envelope/\" xmlns:urn=\"urn:ebay:api:PayPalAPI\" xmlns:ebl=\"urn:ebay:apis:eBLBaseComponents\" xmlns:cc=\"urn:ebay:apis:CoreComponentTypes\" xmlns:ed=\"urn:ebay:apis:EnhancedDataTypes\">";
|
| 43 |
+
|
| 44 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 45 |
+
$soapHeader .= "<soapenv:Header>";
|
| 46 |
+
$soapHeader .= "<urn:RequesterCredentials/>";
|
| 47 |
+
$soapHeader .= "</soapenv:Header>";
|
| 48 |
+
} else if ( $apiCred instanceof PPSignatureCredential ) {
|
| 49 |
+
$soapHeader .= "<soapenv:Header>";
|
| 50 |
+
$soapHeader .= "<urn:RequesterCredentials>";
|
| 51 |
+
$soapHeader .= "<ebl:Credentials>";
|
| 52 |
+
$soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
|
| 53 |
+
$soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
|
| 54 |
+
$soapHeader .= "<ebl:Signature>" . $apiCred->getSignature() . "</ebl:Signature>";
|
| 55 |
+
$soapHeader .= "</ebl:Credentials>";
|
| 56 |
+
$soapHeader .= "</urn:RequesterCredentials>";
|
| 57 |
+
$soapHeader .= "</soapenv:Header>";
|
| 58 |
+
} else if ( $apiCred instanceof PPCertificateCredential ) {
|
| 59 |
+
$soapHeader .= "<soapenv:Header>";
|
| 60 |
+
$soapHeader .= "<urn:RequesterCredentials>";
|
| 61 |
+
$soapHeader .= "<ebl:Credentials>";
|
| 62 |
+
$soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
|
| 63 |
+
$soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
|
| 64 |
+
$soapHeader .= "</ebl:Credentials>";
|
| 65 |
+
$soapHeader .= "</urn:RequesterCredentials>";
|
| 66 |
+
$soapHeader .= "</soapenv:Header>";
|
| 67 |
+
$connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
|
| 68 |
+
}
|
| 69 |
+
$soapHeader .= "<soapenv:Body>";
|
| 70 |
+
$soapHeader .= $payLoad;
|
| 71 |
+
$soapHeader .= "</soapenv:Body>";
|
| 72 |
+
$soapHeader .= "</soapenv:Envelope>";
|
| 73 |
+
|
| 74 |
+
return $soapHeader;
|
| 75 |
+
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
private function generateAuthString( $apiCred, $accessToken, $tokenSecret, $endpoint )
|
| 79 |
+
{
|
| 80 |
+
$key = $apiCred->getUserName();
|
| 81 |
+
$secret = $apiCred->getPassword();
|
| 82 |
+
$auth = new AuthSignature();
|
| 83 |
+
$response = $auth->genSign( $key, $secret, $accessToken, $tokenSecret, 'POST', $endpoint );
|
| 84 |
+
$authString = "token=" . $accessToken . ",signature=" . $response[ 'oauth_signature' ] . ",timestamp=" . $response[ 'oauth_timestamp' ];
|
| 85 |
+
|
| 86 |
+
return $authString;
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPBaseService.php
ADDED
|
@@ -0,0 +1,88 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPAPIService.php';
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
class PPBaseService
|
| 6 |
+
{
|
| 7 |
+
|
| 8 |
+
private $serviceName;
|
| 9 |
+
|
| 10 |
+
/*
|
| 11 |
+
* Setters and getters for Third party authentication (Permission Services)
|
| 12 |
+
*/
|
| 13 |
+
protected $accessToken;
|
| 14 |
+
protected $tokenSecret;
|
| 15 |
+
protected $lastRequest;
|
| 16 |
+
protected $lastResponse;
|
| 17 |
+
|
| 18 |
+
public function getLastRequest()
|
| 19 |
+
{
|
| 20 |
+
return $this->lastRequest;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
public function setLastRequest( $lastRqst )
|
| 24 |
+
{
|
| 25 |
+
$this->lastRequest = $lastRqst;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
public function getLastResponse()
|
| 29 |
+
{
|
| 30 |
+
return $this->lastResponse;
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
public function setLastResponse( $lastRspns )
|
| 34 |
+
{
|
| 35 |
+
$this->lastResponse = $lastRspns;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
public function getAccessToken()
|
| 39 |
+
{
|
| 40 |
+
return $this->accessToken;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
public function setAccessToken( $accessToken )
|
| 44 |
+
{
|
| 45 |
+
$this->accessToken = $accessToken;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
public function getTokenSecret()
|
| 49 |
+
{
|
| 50 |
+
return $this->tokenSecret;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
public function setTokenSecret( $tokenSecret )
|
| 54 |
+
{
|
| 55 |
+
$this->tokenSecret = $tokenSecret;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
public function __construct( $serviceName )
|
| 59 |
+
{
|
| 60 |
+
$this->serviceName = $serviceName;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
public function getServiceName()
|
| 64 |
+
{
|
| 65 |
+
return $this->serviceName;
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
public function call( $method, $requestObject, $apiUsername = null )
|
| 69 |
+
{
|
| 70 |
+
$params = $this->marshall( $requestObject );
|
| 71 |
+
$service = new PPAPIService();
|
| 72 |
+
$service->setServiceName( $this->serviceName );
|
| 73 |
+
|
| 74 |
+
$this->lastRequest = $params;
|
| 75 |
+
$this->lastResponse = $service->makeRequest( $method, $params, $apiUsername, $this->accessToken, $this->tokenSecret );
|
| 76 |
+
|
| 77 |
+
return $this->lastResponse;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
private function marshall( $object )
|
| 81 |
+
{
|
| 82 |
+
$transformer = new PPObjectTransformer();
|
| 83 |
+
|
| 84 |
+
return $transformer->toString( $object );
|
| 85 |
+
}
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCertificateCredential.php
ADDED
|
@@ -0,0 +1,72 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'exceptions/PPMissingCredentialException.php';
|
| 5 |
+
|
| 6 |
+
class PPCertificateCredential extends IPPCredential
|
| 7 |
+
{
|
| 8 |
+
|
| 9 |
+
private $certificatePath;
|
| 10 |
+
|
| 11 |
+
private $passPhrase;
|
| 12 |
+
|
| 13 |
+
public function __construct( $userName, $password, $certPath, $appId, $passPhrase )
|
| 14 |
+
{
|
| 15 |
+
parent::__construct( $userName, $password, $appId );
|
| 16 |
+
$this->certificatePath = $certPath;
|
| 17 |
+
$this->passPhrase = $passPhrase;
|
| 18 |
+
$this->validate();
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
public function validate()
|
| 22 |
+
{
|
| 23 |
+
|
| 24 |
+
if ( $this->userName == null || $this->userName == "" ) {
|
| 25 |
+
throw new PPMissingCredentialException( "username cannot be empty" );
|
| 26 |
+
}
|
| 27 |
+
if ( $this->password == null || $this->password == "" ) {
|
| 28 |
+
throw new PPMissingCredentialException( "password cannot be empty" );
|
| 29 |
+
}
|
| 30 |
+
if ( $this->certificatePath == null || $this->certificatePath == "" ) {
|
| 31 |
+
throw new PPMissingCredentialException( "certificate cannot be empty" );
|
| 32 |
+
}
|
| 33 |
+
if ( $this->passPhrase == null || $this->passPhrase == "" ) {
|
| 34 |
+
throw new PPMissingCredentialException( "passphrase cannot be empty" );
|
| 35 |
+
}
|
| 36 |
+
if ( $this->applicationId == null || $this->applicationId == "" ) {
|
| 37 |
+
throw new PPMissingCredentialException( "applicationId cannot be empty" );
|
| 38 |
+
}
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
public function getUserName()
|
| 42 |
+
{
|
| 43 |
+
return $this->userName;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
public function getPassword()
|
| 47 |
+
{
|
| 48 |
+
return $this->password;
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
public function getCertificatePath()
|
| 52 |
+
{
|
| 53 |
+
if ( realpath( $this->certificatePath ) ) {
|
| 54 |
+
return realpath( $this->certificatePath );
|
| 55 |
+
} else {
|
| 56 |
+
return realpath( dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".." . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . $this->certificatePath );
|
| 57 |
+
}
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
public function getPassPhrase()
|
| 61 |
+
{
|
| 62 |
+
return $this->passPhrase;
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
public function getApplicationId()
|
| 66 |
+
{
|
| 67 |
+
return $this->applicationId;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConfigManager.php
ADDED
|
@@ -0,0 +1,124 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* PPConfigManager loads the SDK configuration file and
|
| 4 |
+
* hands out appropriate config params to other classes
|
| 5 |
+
*/
|
| 6 |
+
require_once 'exceptions/PPConfigurationException.php';
|
| 7 |
+
|
| 8 |
+
class PPConfigManager
|
| 9 |
+
{
|
| 10 |
+
|
| 11 |
+
private $config;
|
| 12 |
+
/**
|
| 13 |
+
*
|
| 14 |
+
*
|
| 15 |
+
* @var PPConfigManager
|
| 16 |
+
*/
|
| 17 |
+
private static $instance;
|
| 18 |
+
|
| 19 |
+
private function __construct()
|
| 20 |
+
{
|
| 21 |
+
$configFile = dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".."
|
| 22 |
+
. DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . "sdk_config.ini";
|
| 23 |
+
$this->load( $configFile );
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
// create singleton object for PPConfigManager
|
| 27 |
+
public static function getInstance()
|
| 28 |
+
{
|
| 29 |
+
if ( !isset( self::$instance ) ) {
|
| 30 |
+
self::$instance = new PPConfigManager();
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
return self::$instance;
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
//used to load the file
|
| 37 |
+
private function load( $fileName )
|
| 38 |
+
{
|
| 39 |
+
if ( class_exists( 'Woocommerce' ) ) {
|
| 40 |
+
global $woocommerce;
|
| 41 |
+
$gateways = $woocommerce->payment_gateways->payment_gateways();
|
| 42 |
+
$settings = $gateways[ 'paypalap' ]->settings;
|
| 43 |
+
|
| 44 |
+
$mode = $settings[ 'sandbox_enabled' ];
|
| 45 |
+
|
| 46 |
+
$this->config = array(
|
| 47 |
+
'acct1.UserName' => $mode == 'yes' ? $settings[ 'username' ] : $settings[ 'username_live' ],
|
| 48 |
+
'acct1.Password' => $mode == 'yes' ? $settings[ 'password' ] : $settings[ 'password_live' ],
|
| 49 |
+
'acct1.Signature' => $mode == 'yes' ? $settings[ 'signature' ] : $settings[ 'signature_live' ],
|
| 50 |
+
'acct1.AppId' => $mode == 'yes' ? 'APP-80W284485P519543T' : $settings[ 'app_id' ],
|
| 51 |
+
|
| 52 |
+
'service.Binding' => 'NV',
|
| 53 |
+
'service.EndPoint' => $mode == 'yes' ? 'https://svcs.sandbox.paypal.com/' : 'https://svcs.paypal.com/',
|
| 54 |
+
'service.RedirectURL' => $mode == 'yes' ? 'https://sandbox.paypal.com/webscr&cmd=' : 'https://paypal.com/webscr&cmd=',
|
| 55 |
+
'service.DevCentralURL' => 'https://developer.paypal.com',
|
| 56 |
+
'http.ConnectionTimeOut' => '30',
|
| 57 |
+
'http.Retry' => '5',
|
| 58 |
+
'log.FileName' => 'PayPal.log',
|
| 59 |
+
'log.LogLevel' => 'INFO',
|
| 60 |
+
'log.LogEnabled' => $settings[ 'logging_enabled' ] == 'yes' ? 'true' : 'false',
|
| 61 |
+
);
|
| 62 |
+
} else {
|
| 63 |
+
$this->config = @parse_ini_file( $fileName );
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
if ( $this->config == null || count( $this->config ) == 0 ) {
|
| 67 |
+
throw new PPConfigurationException( "Config file $fileName not found", "303" );
|
| 68 |
+
}
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
/**
|
| 72 |
+
* simple getter for configuration params
|
| 73 |
+
* If an exact match for key is not found,
|
| 74 |
+
* does a "contains" search on the key
|
| 75 |
+
*/
|
| 76 |
+
public function get( $searchKey )
|
| 77 |
+
{
|
| 78 |
+
|
| 79 |
+
if ( array_key_exists( $searchKey, $this->config ) ) {
|
| 80 |
+
return $this->config[ $searchKey ];
|
| 81 |
+
} else {
|
| 82 |
+
$arr = array();
|
| 83 |
+
foreach ( $this->config as $k => $v ) {
|
| 84 |
+
if ( strstr( $k, $searchKey ) ) {
|
| 85 |
+
$arr[ $k ] = $v;
|
| 86 |
+
}
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
return $arr;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
/**
|
| 95 |
+
* Utility method for handling account configuration
|
| 96 |
+
* return config key corresponding to the API userId passed in
|
| 97 |
+
*
|
| 98 |
+
* If $userId is null, returns config keys corresponding to
|
| 99 |
+
* all configured accounts
|
| 100 |
+
*/
|
| 101 |
+
public function getIniPrefix( $userId = null )
|
| 102 |
+
{
|
| 103 |
+
|
| 104 |
+
if ( $userId == null ) {
|
| 105 |
+
$arr = array();
|
| 106 |
+
foreach ( $this->config as $key => $value ) {
|
| 107 |
+
$pos = strpos( $key, '.' );
|
| 108 |
+
if ( strstr( $key, "acct" ) ) {
|
| 109 |
+
$arr[ ] = substr( $key, 0, $pos );
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
return array_unique( $arr );
|
| 114 |
+
} else {
|
| 115 |
+
$iniPrefix = array_search( $userId, $this->config );
|
| 116 |
+
$pos = strpos( $iniPrefix, '.' );
|
| 117 |
+
$acct = substr( $iniPrefix, 0, $pos );
|
| 118 |
+
|
| 119 |
+
return $acct;
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
}
|
| 123 |
+
|
| 124 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPConnectionManager.php
ADDED
|
@@ -0,0 +1,48 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPHttpConnection.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
class PPConnectionManager
|
| 5 |
+
{
|
| 6 |
+
/**
|
| 7 |
+
* reference to singleton instance
|
| 8 |
+
* @var PPConnectionManager
|
| 9 |
+
*/
|
| 10 |
+
private static $instance;
|
| 11 |
+
|
| 12 |
+
private function __construct()
|
| 13 |
+
{
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
public static function getInstance()
|
| 17 |
+
{
|
| 18 |
+
if ( self::$instance == null ) {
|
| 19 |
+
self::$instance = new PPConnectionManager();
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
return self::$instance;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
/**
|
| 26 |
+
* This function returns a new PPHttpConnection object
|
| 27 |
+
*/
|
| 28 |
+
public function getConnection()
|
| 29 |
+
{
|
| 30 |
+
|
| 31 |
+
$connection = new PPHttpConnection();
|
| 32 |
+
|
| 33 |
+
$configMgr = PPConfigManager::getInstance();
|
| 34 |
+
if ( ( $configMgr->get( "http.ConnectionTimeOut" ) ) ) {
|
| 35 |
+
$connection->setHttpTimeout( $configMgr->get( "http.ConnectionTimeOut" ) );
|
| 36 |
+
}
|
| 37 |
+
if ( $configMgr->get( "http.Proxy" ) ) {
|
| 38 |
+
$connection->setHttpProxy( $configMgr->get( "http.Proxy" ) );
|
| 39 |
+
}
|
| 40 |
+
if ( $configMgr->get( "http.Retry" ) ) {
|
| 41 |
+
$retry = $configMgr->get( "http.Retry" );
|
| 42 |
+
$connection->setHttpRetry( $retry );
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
return $connection;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
}
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPCredentialManager.php
ADDED
|
@@ -0,0 +1,117 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'PPSignatureCredential.php';
|
| 5 |
+
require_once 'PPCertificateCredential.php';
|
| 6 |
+
require_once 'exceptions/PPInvalidCredentialException.php';
|
| 7 |
+
|
| 8 |
+
class PPCredentialManager
|
| 9 |
+
{
|
| 10 |
+
|
| 11 |
+
private static $instance;
|
| 12 |
+
//hashmap to contain credentials for accounts.
|
| 13 |
+
private $credentialHashmap = array();
|
| 14 |
+
/**
|
| 15 |
+
* Contains the API username of the default account to use
|
| 16 |
+
* when authenticating API calls.
|
| 17 |
+
* @var string
|
| 18 |
+
*/
|
| 19 |
+
private $defaultAccountName;
|
| 20 |
+
|
| 21 |
+
/*
|
| 22 |
+
* Constructor initialize credential for multiple accounts specified in property file.
|
| 23 |
+
*/
|
| 24 |
+
private function __construct()
|
| 25 |
+
{
|
| 26 |
+
try {
|
| 27 |
+
$this->initCredential();
|
| 28 |
+
} catch ( Exception $e ) {
|
| 29 |
+
$this->credentialHashmap = array();
|
| 30 |
+
throw $e;
|
| 31 |
+
}
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
/*
|
| 35 |
+
* Create singleton instance for this class.
|
| 36 |
+
*/
|
| 37 |
+
public static function getInstance()
|
| 38 |
+
{
|
| 39 |
+
if ( !isset( self::$instance ) ) {
|
| 40 |
+
self::$instance = new PPCredentialManager();
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
return self::$instance;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
/*
|
| 47 |
+
* Load credentials for multiple accounts, with priority given to Signature credential.
|
| 48 |
+
*/
|
| 49 |
+
private function initCredential()
|
| 50 |
+
{
|
| 51 |
+
$configMgr = PPConfigManager::getInstance();
|
| 52 |
+
$suffix = 1;
|
| 53 |
+
$prefix = "acct";
|
| 54 |
+
|
| 55 |
+
$credArr = $configMgr->get( $prefix );
|
| 56 |
+
$arrayPartKeys = $configMgr->getIniPrefix();
|
| 57 |
+
if ( count( $arrayPartKeys ) == 0 )
|
| 58 |
+
throw new MissingCredentialException( "No valid API accounts have been configured" );
|
| 59 |
+
|
| 60 |
+
while ( in_array( $prefix . $suffix, $arrayPartKeys ) ) {
|
| 61 |
+
|
| 62 |
+
if ( isset( $credArr[ $prefix . $suffix . ".Signature" ] )
|
| 63 |
+
&& $credArr[ $prefix . $suffix . ".Signature" ] != null && $credArr[ $prefix . $suffix . ".Signature" ] != ""
|
| 64 |
+
) {
|
| 65 |
+
|
| 66 |
+
$userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
|
| 67 |
+
$password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
|
| 68 |
+
$signature = isset( $credArr[ $prefix . $suffix . '.Signature' ] ) ? $credArr[ $prefix . $suffix . '.Signature' ] : "";
|
| 69 |
+
$appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
|
| 70 |
+
$this->credentialHashmap[ $userName ] = new PPSignatureCredential( $userName, $password, $signature, $appId );
|
| 71 |
+
|
| 72 |
+
} elseif ( isset( $credArr[ $prefix . $suffix . ".CertPath" ] )
|
| 73 |
+
&& $credArr[ $prefix . $suffix . ".CertPath" ] != null && $credArr[ $prefix . $suffix . ".CertPath" ] != ""
|
| 74 |
+
) {
|
| 75 |
+
|
| 76 |
+
$userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
|
| 77 |
+
$password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
|
| 78 |
+
$passPhrase = isset( $credArr[ $prefix . $suffix . '.CertKey' ] ) ? $credArr[ $prefix . $suffix . '.CertKey' ] : "";
|
| 79 |
+
$certPath = isset( $credArr[ $prefix . $suffix . '.CertPath' ] ) ? $credArr[ $prefix . $suffix . '.CertPath' ] : "";
|
| 80 |
+
$appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
|
| 81 |
+
$this->credentialHashmap[ $userName ] = new PPCertificateCredential( $userName, $password, $certPath, $appId, $passPhrase );
|
| 82 |
+
|
| 83 |
+
}
|
| 84 |
+
if ( $this->defaultAccountName == null )
|
| 85 |
+
$this->defaultAccountName = $credArr[ $prefix . $suffix . '.UserName' ];
|
| 86 |
+
$suffix++;
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
/*
|
| 92 |
+
* Obtain Credential Object based on UserId provided.
|
| 93 |
+
*/
|
| 94 |
+
public function getCredentialObject( $userId = null )
|
| 95 |
+
{
|
| 96 |
+
|
| 97 |
+
if ( $userId == null )
|
| 98 |
+
$credObj = $this->credentialHashmap[ $this->defaultAccountName ];
|
| 99 |
+
else if ( array_key_exists( $userId, $this->credentialHashmap ) )
|
| 100 |
+
$credObj = $this->credentialHashmap[ $userId ];
|
| 101 |
+
|
| 102 |
+
if ( empty( $credObj ) ) {
|
| 103 |
+
throw new PPInvalidCredentialException( "Invalid userId $userId" );
|
| 104 |
+
}
|
| 105 |
+
|
| 106 |
+
return $credObj;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
|
| 110 |
+
public function __clone()
|
| 111 |
+
{
|
| 112 |
+
trigger_error( 'Clone is not allowed.', E_USER_ERROR );
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPHttpConnection.php
ADDED
|
@@ -0,0 +1,184 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
require_once 'exceptions/PPConnectionException.php';
|
| 4 |
+
require_once 'exceptions/PPConfigurationException.php';
|
| 5 |
+
require_once 'PPLoggingManager.php';
|
| 6 |
+
/**
|
| 7 |
+
* A wrapper class based on the curl extension.
|
| 8 |
+
* Requires the PHP curl module to be enabled.
|
| 9 |
+
* See for full requirements the PHP manual: http://php.net/curl
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
class PPHttpConnection
|
| 14 |
+
{
|
| 15 |
+
|
| 16 |
+
const HTTP_GET = 'GET';
|
| 17 |
+
const HTTP_POST = 'POST';
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* curl options to be set for the request
|
| 21 |
+
*/
|
| 22 |
+
private $curlOpt = array();
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Number of times a retry must be attempted on getting an HTTP error
|
| 26 |
+
* @var integer
|
| 27 |
+
*/
|
| 28 |
+
private $retry;
|
| 29 |
+
|
| 30 |
+
/**
|
| 31 |
+
* HTTP status codes for which a retry must be attempted
|
| 32 |
+
*/
|
| 33 |
+
private static $retryCodes = array( '401', '403', '404', );
|
| 34 |
+
|
| 35 |
+
private $logger;
|
| 36 |
+
|
| 37 |
+
|
| 38 |
+
/**
|
| 39 |
+
* Some default options for curl
|
| 40 |
+
* These are typically overridden by PPConnectionManager
|
| 41 |
+
*/
|
| 42 |
+
public static $DEFAULT_CURL_OPTS = array(
|
| 43 |
+
CURLOPT_CONNECTTIMEOUT => 10,
|
| 44 |
+
CURLOPT_RETURNTRANSFER => true,
|
| 45 |
+
CURLOPT_TIMEOUT => 60, // maximum number of seconds to allow cURL functions to execute
|
| 46 |
+
CURLOPT_USERAGENT => 'PayPal-PHP-SDK',
|
| 47 |
+
CURLOPT_POST => 1,
|
| 48 |
+
CURLOPT_HTTPHEADER => array(),
|
| 49 |
+
CURLOPT_SSL_VERIFYHOST => 2,
|
| 50 |
+
CURLOPT_SSL_VERIFYPEER => 2
|
| 51 |
+
);
|
| 52 |
+
|
| 53 |
+
public function __construct()
|
| 54 |
+
{
|
| 55 |
+
if ( !function_exists( "curl_init" ) ) {
|
| 56 |
+
throw new PPConfigurationException( "Curl module is not available on this system" );
|
| 57 |
+
}
|
| 58 |
+
$this->curlOpt = self::$DEFAULT_CURL_OPTS;
|
| 59 |
+
$this->logger = new PPLoggingManager( __CLASS__ );
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
/**
|
| 63 |
+
* Set ssl parameters for certificate based client authentication
|
| 64 |
+
*
|
| 65 |
+
* @param string $certPath - path to client certificate file (PEM formatted file)
|
| 66 |
+
*/
|
| 67 |
+
public function setSSLCert( $certPath, $passPhrase )
|
| 68 |
+
{
|
| 69 |
+
$this->curlOpt[ CURLOPT_SSLCERT ] = realpath( $certPath );
|
| 70 |
+
$this->curlOpt[ CURLOPT_SSLCERTPASSWD ] = $passPhrase;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
/**
|
| 74 |
+
* Set connection timeout in seconds
|
| 75 |
+
*
|
| 76 |
+
* @param integer $timeout
|
| 77 |
+
*/
|
| 78 |
+
public function setHttpTimeout( $timeout )
|
| 79 |
+
{
|
| 80 |
+
$this->curlOpt[ CURLOPT_CONNECTTIMEOUT ] = $timeout;
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
/**
|
| 84 |
+
* Set HTTP proxy information
|
| 85 |
+
*
|
| 86 |
+
* @param string $proxy
|
| 87 |
+
*
|
| 88 |
+
* @throws PPConfigurationException
|
| 89 |
+
*/
|
| 90 |
+
public function setHttpProxy( $proxy )
|
| 91 |
+
{
|
| 92 |
+
$urlParts = parse_url( $proxy );
|
| 93 |
+
if ( $urlParts == false || !array_key_exists( "host", $urlParts ) )
|
| 94 |
+
throw new PPConfigurationException( "Invalid proxy configuration " . $proxy );
|
| 95 |
+
|
| 96 |
+
$this->curlOpt[ CURLOPT_PROXY ] = $urlParts[ "host" ];
|
| 97 |
+
if ( isset( $urlParts[ "port" ] ) )
|
| 98 |
+
$this->curlOpt[ CURLOPT_PROXY ] .= ":" . $urlParts[ "port" ];
|
| 99 |
+
if ( isset( $urlParts[ "user" ] ) )
|
| 100 |
+
$this->curlOpt[ URLOPT_PROXYUSERPWD ] = $urlParts[ "user" ] . ":" . $urlParts[ "pass" ];
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
public function setHttpHeaders( $headers )
|
| 104 |
+
{
|
| 105 |
+
$this->curlOpt[ CURLOPT_HTTPHEADER ] = $headers;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
/**
|
| 109 |
+
* @param integer $retry
|
| 110 |
+
*/
|
| 111 |
+
public function setHttpRetry( $retry )
|
| 112 |
+
{
|
| 113 |
+
$this->retry = $retry;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
/**
|
| 117 |
+
* Executes an HTTP request
|
| 118 |
+
*
|
| 119 |
+
* @param string $url
|
| 120 |
+
* @param string $params query string OR POST content as a string
|
| 121 |
+
* @param array $headers array of HTTP headers to be added to existing headers
|
| 122 |
+
* @param string $method HTTP method (GET, POST etc) defaults to POST
|
| 123 |
+
*
|
| 124 |
+
* @throws PPConnectionException
|
| 125 |
+
*/
|
| 126 |
+
public function execute( $url, $params, $headers = null, $method = null )
|
| 127 |
+
{
|
| 128 |
+
|
| 129 |
+
$ch = curl_init( $url );
|
| 130 |
+
|
| 131 |
+
$this->curlOpt[ CURLOPT_POSTFIELDS ] = $params;
|
| 132 |
+
$this->curlOpt[ CURLOPT_URL ] = $url;
|
| 133 |
+
$this->curlOpt[ CURLOPT_HEADER ] = false;
|
| 134 |
+
if ( isset( $headers ) ) {
|
| 135 |
+
$this->curlOpt[ CURLOPT_HTTPHEADER ] = array_merge( $this->curlOpt[ CURLOPT_HTTPHEADER ], $headers );
|
| 136 |
+
}
|
| 137 |
+
foreach ( $this->curlOpt[ CURLOPT_HTTPHEADER ] as $header ) {
|
| 138 |
+
//TODO: Strip out credentials when logging.
|
| 139 |
+
$this->logger->info( "Adding header $header" );
|
| 140 |
+
}
|
| 141 |
+
if ( isset( $method ) ) {
|
| 142 |
+
$this->curlOpt[ CURLOPT_CUSTOMREQUEST ] = $method;
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
// curl_setopt_array available only in PHP 5 >= 5.1.3
|
| 146 |
+
curl_setopt_array( $ch, $this->curlOpt );
|
| 147 |
+
|
| 148 |
+
$result = curl_exec( $ch );
|
| 149 |
+
|
| 150 |
+
if ( curl_errno( $ch ) == 60 ) {
|
| 151 |
+
$this->logger->info( "Invalid or no certificate authority found, retrying using bundled CA certs" );
|
| 152 |
+
curl_setopt( $ch, CURLOPT_CAINFO,
|
| 153 |
+
dirname( __FILE__ ) . '/cacert.pem' );
|
| 154 |
+
$result = curl_exec( $ch );
|
| 155 |
+
}
|
| 156 |
+
$httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
|
| 157 |
+
$retries = 0;
|
| 158 |
+
if ( in_array( $httpStatus, self::$retryCodes ) && isset( $this->retry ) ) {
|
| 159 |
+
$this->logger->info( "Got $httpStatus response from server. Retrying" );
|
| 160 |
+
|
| 161 |
+
do {
|
| 162 |
+
$result = curl_exec( $ch );
|
| 163 |
+
$httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
|
| 164 |
+
|
| 165 |
+
} while ( in_array( $httpStatus, self::$retryCodes ) && ++$retries < $this->retry );
|
| 166 |
+
|
| 167 |
+
|
| 168 |
+
}
|
| 169 |
+
if ( curl_errno( $ch ) ) {
|
| 170 |
+
$ex = new PPConnectionException( $url, curl_error( $ch ), curl_errno( $ch ) );
|
| 171 |
+
curl_close( $ch );
|
| 172 |
+
throw $ex;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
curl_close( $ch );
|
| 176 |
+
|
| 177 |
+
if ( in_array( $httpStatus, self::$retryCodes ) ) {
|
| 178 |
+
throw new PPConnectionException( $url, "Retried " . $retries . " times, Http Response code " . $httpStatus );
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
return $result;
|
| 182 |
+
}
|
| 183 |
+
|
| 184 |
+
}
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPLoggingManager.php
ADDED
|
@@ -0,0 +1,84 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Simple Logging Manager.
|
| 5 |
+
* This does an error_log for now
|
| 6 |
+
* Potential frameworks to use are PEAR logger, log4php from Apache
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
class PPLoggingLevel
|
| 10 |
+
{
|
| 11 |
+
|
| 12 |
+
// FINE Logging Level
|
| 13 |
+
const FINE = 3;
|
| 14 |
+
|
| 15 |
+
// INFO Logging Level
|
| 16 |
+
const INFO = 2;
|
| 17 |
+
|
| 18 |
+
// WARN Logging Level
|
| 19 |
+
const WARN = 1;
|
| 20 |
+
|
| 21 |
+
// ERROR Logging Level
|
| 22 |
+
const ERROR = 0;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
class PPLoggingManager
|
| 26 |
+
{
|
| 27 |
+
|
| 28 |
+
// Default Logging Level
|
| 29 |
+
const DEFAULT_LOGGING_LEVEL = 0;
|
| 30 |
+
|
| 31 |
+
// Logger name
|
| 32 |
+
private $loggerName;
|
| 33 |
+
|
| 34 |
+
// Log enabled
|
| 35 |
+
private $isLoggingEnabled;
|
| 36 |
+
|
| 37 |
+
// Configured logging level
|
| 38 |
+
private $loggingLevel;
|
| 39 |
+
|
| 40 |
+
// Configured logging file
|
| 41 |
+
private $loggerFile;
|
| 42 |
+
|
| 43 |
+
public function __construct( $loggerName )
|
| 44 |
+
{
|
| 45 |
+
$this->loggerName = $loggerName;
|
| 46 |
+
$config = PPConfigManager::getInstance();
|
| 47 |
+
$this->loggerFile = ( $config->get( 'log.FileName' ) ) ? $config->get( 'log.FileName' ) : ini_get( 'error_log' );
|
| 48 |
+
$loggingEnabled = $config->get( 'log.LogEnabled' );
|
| 49 |
+
$this->isLoggingEnabled = ( isset( $loggingEnabled ) ) ? $loggingEnabled : false;
|
| 50 |
+
$loggingLevel = strtoupper( $config->get( 'log.LogLevel' ) );
|
| 51 |
+
$this->loggingLevel = ( isset( $loggingLevel ) && defined( "PPLoggingLevel::$loggingLevel" ) ) ? constant( "PPLoggingLevel::$loggingLevel" ) : PPLoggingManager::DEFAULT_LOGGING_LEVEL;
|
| 52 |
+
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
public function log( $message, $level = PPLoggingLevel::INFO )
|
| 56 |
+
{
|
| 57 |
+
if ( $this->isLoggingEnabled && ( $level <= $this->loggingLevel ) ) {
|
| 58 |
+
error_log( $this->loggerName . ": $message\n" );
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
public function error( $message )
|
| 63 |
+
{
|
| 64 |
+
$this->log( $message, PPLoggingLevel::ERROR );
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
public function warning( $message )
|
| 68 |
+
{
|
| 69 |
+
$this->log( $message, PPLoggingLevel::WARN );
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
public function info( $message )
|
| 73 |
+
{
|
| 74 |
+
$this->log( $message, PPLoggingLevel::INFO );
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
public function fine( $message )
|
| 78 |
+
{
|
| 79 |
+
$this->log( $message, PPLoggingLevel::FINE );
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPObjectTransformer.php
ADDED
|
@@ -0,0 +1,33 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Utility class for transforming PHP objects into
|
| 4 |
+
* appropriate service payload type and vice versa
|
| 5 |
+
*/
|
| 6 |
+
class PPObjectTransformer
|
| 7 |
+
{
|
| 8 |
+
|
| 9 |
+
public function toString( $object )
|
| 10 |
+
{
|
| 11 |
+
|
| 12 |
+
if ( $object == null ) {
|
| 13 |
+
throw new PPTransformerException( "Empty object" );
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
$confManager = PPConfigManager::getInstance();
|
| 17 |
+
switch ( strtoupper( $confManager->get( "service.Binding" ) ) ) {
|
| 18 |
+
case 'SOAP':
|
| 19 |
+
return $object->toXMLString();
|
| 20 |
+
|
| 21 |
+
case 'XML':
|
| 22 |
+
case 'JSON':
|
| 23 |
+
return "";
|
| 24 |
+
case 'NVP':
|
| 25 |
+
default:
|
| 26 |
+
return $object->toNVPString();
|
| 27 |
+
}
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPSignatureCredential.php
ADDED
|
@@ -0,0 +1,49 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
require_once 'exceptions/PPMissingCredentialException.php';
|
| 4 |
+
require_once 'IPPCredential.php';
|
| 5 |
+
require_once 'PPConfigManager.php';
|
| 6 |
+
|
| 7 |
+
/**
|
| 8 |
+
* API signature based credentials
|
| 9 |
+
*/
|
| 10 |
+
class PPSignatureCredential extends IPPCredential
|
| 11 |
+
{
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* API Signature
|
| 15 |
+
* @var string
|
| 16 |
+
*/
|
| 17 |
+
private $signature;
|
| 18 |
+
|
| 19 |
+
public function __construct( $userName, $password, $signature, $appId )
|
| 20 |
+
{
|
| 21 |
+
parent::__construct( $userName, $password, $appId );
|
| 22 |
+
$this->signature = $signature;
|
| 23 |
+
$this->validate();
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
public function validate()
|
| 27 |
+
{
|
| 28 |
+
|
| 29 |
+
if ( $this->userName == null || $this->userName == "" ) {
|
| 30 |
+
throw new PPMissingCredentialException( "username cannot be empty" );
|
| 31 |
+
}
|
| 32 |
+
if ( $this->password == null || $this->password == "" ) {
|
| 33 |
+
throw new PPMissingCredentialException( "password cannot be empty" );
|
| 34 |
+
}
|
| 35 |
+
if ( $this->signature == null || $this->signature == "" ) {
|
| 36 |
+
throw new PPMissingCredentialException( "signature cannot be empty" );
|
| 37 |
+
}
|
| 38 |
+
if ( $this->applicationId == null || $this->applicationId == "" ) {
|
| 39 |
+
throw new PPMissingCredentialException( "applicationId cannot be empty" );
|
| 40 |
+
}
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
public function getSignature()
|
| 44 |
+
{
|
| 45 |
+
return $this->signature;
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/PPUtils.php
ADDED
|
@@ -0,0 +1,274 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class PPUtils
|
| 3 |
+
{
|
| 4 |
+
|
| 5 |
+
const SDK_VERSION = "1.2.95";
|
| 6 |
+
const SDK_NAME = "sdk-adaptivepayments-php ";
|
| 7 |
+
|
| 8 |
+
/**
|
| 9 |
+
*
|
| 10 |
+
* Convert a Name Value Pair (NVP) formatted string into
|
| 11 |
+
* an associative array taking care to urldecode array values
|
| 12 |
+
*
|
| 13 |
+
* @param string $nvpString
|
| 14 |
+
*/
|
| 15 |
+
public static function nvpToMap( $nvpString )
|
| 16 |
+
{
|
| 17 |
+
|
| 18 |
+
$ret = array();
|
| 19 |
+
$params = explode( "&", $nvpString );
|
| 20 |
+
foreach ( $params as $p ) {
|
| 21 |
+
list( $k, $v ) = explode( "=", $p );
|
| 22 |
+
$ret[ $k ] = urldecode( $v );
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
return $ret;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
/**
|
| 29 |
+
* Returns true if the array contains a key like $key
|
| 30 |
+
*
|
| 31 |
+
* @param array $map
|
| 32 |
+
* @param regex $key
|
| 33 |
+
*/
|
| 34 |
+
public static function array_match_key( $map, $key )
|
| 35 |
+
{
|
| 36 |
+
$key = str_replace( "(", "\(", $key );
|
| 37 |
+
$key = str_replace( ")", "\)", $key );
|
| 38 |
+
$key = str_replace( ".", "\.", $key );
|
| 39 |
+
$pattern = "/$key*/";
|
| 40 |
+
foreach ( $map as $k => $v ) {
|
| 41 |
+
preg_match( $pattern, $k, $matches );
|
| 42 |
+
if ( count( $matches ) > 0 )
|
| 43 |
+
return true;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
return false;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
/**
|
| 50 |
+
*
|
| 51 |
+
* Get the local IP address. The client address is a required
|
| 52 |
+
* request parameter for some API calls
|
| 53 |
+
*/
|
| 54 |
+
public static function getLocalIPAddress()
|
| 55 |
+
{
|
| 56 |
+
|
| 57 |
+
if ( array_key_exists( "SERVER_ADDR", $_SERVER ) ) {
|
| 58 |
+
// SERVER_ADDR is available only if we are running the CGI SAPI
|
| 59 |
+
return $_SERVER[ 'SERVER_ADDR' ];
|
| 60 |
+
} else if ( function_exists( "gethostname" ) ) {
|
| 61 |
+
// gethostname is available only in PHP >= v5.3
|
| 62 |
+
return gethostbyname( gethostname() );
|
| 63 |
+
} else {
|
| 64 |
+
// fallback if nothing works
|
| 65 |
+
return "127.0.0.1";
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
*
|
| 71 |
+
* Compute the value that needs to sent for the PAYPAL_REQUEST_SOURCE
|
| 72 |
+
* parameter when making API calls
|
| 73 |
+
*/
|
| 74 |
+
public static function getRequestSource()
|
| 75 |
+
{
|
| 76 |
+
return str_replace( " ", "_", self::SDK_NAME ) . self::SDK_VERSION;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
public static function xmlToArray( $xmlInput )
|
| 80 |
+
{
|
| 81 |
+
|
| 82 |
+
$xml = simplexml_load_string( $xmlInput );
|
| 83 |
+
|
| 84 |
+
$ns = $xml->getNamespaces( true );
|
| 85 |
+
|
| 86 |
+
$soap = $xml->children( $ns[ 'SOAP-ENV' ] );
|
| 87 |
+
$getChild = $soap->Body->children();
|
| 88 |
+
|
| 89 |
+
$ret = PPUtils::convertXmlObjToArr( $getChild, $array = array() );
|
| 90 |
+
|
| 91 |
+
return $ret;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
/*foreach ($ret as $arry)
|
| 95 |
+
{
|
| 96 |
+
if (isset($arry['children']) && is_array($arry['children'])&& ($arry['children'])!=null) {
|
| 97 |
+
foreach ($arry['children'] as $novel)
|
| 98 |
+
{
|
| 99 |
+
|
| 100 |
+
}
|
| 101 |
+
}
|
| 102 |
+
else if ($arry['name'] != null)
|
| 103 |
+
{
|
| 104 |
+
$a = $arry['name'] ;
|
| 105 |
+
$b= $arry['text'];
|
| 106 |
+
if (isset($arry['attribute']))
|
| 107 |
+
{
|
| 108 |
+
$c = $arry['attribute'];
|
| 109 |
+
}
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
}*/
|
| 114 |
+
|
| 115 |
+
/*public function xml2array ( $xmlObject, $out = array () )
|
| 116 |
+
{
|
| 117 |
+
foreach ( (array) $xmlObject as $index => $node )
|
| 118 |
+
{
|
| 119 |
+
$out[$index] = ( is_object ( $node ) ) ? PPUtils::xml2array ( $node ) : $node;
|
| 120 |
+
}
|
| 121 |
+
return $out;
|
| 122 |
+
}*/
|
| 123 |
+
|
| 124 |
+
|
| 125 |
+
function convertXmlObjToArr( $obj, &$arr )
|
| 126 |
+
{
|
| 127 |
+
$children = $obj->children();
|
| 128 |
+
foreach ( $children as $elementName => $node ) {
|
| 129 |
+
$nextIdx = count( $arr );
|
| 130 |
+
$arr[ $nextIdx ] = array();
|
| 131 |
+
$arr[ $nextIdx ][ 'name' ] = strtolower( (string) $elementName );
|
| 132 |
+
$arr[ $nextIdx ][ 'attributes' ] = array();
|
| 133 |
+
$attributes = $node->attributes();
|
| 134 |
+
foreach ( $attributes as $attributeName => $attributeValue ) {
|
| 135 |
+
$attribName = strtolower( trim( (string) $attributeName ) );
|
| 136 |
+
$attribVal = trim( (string) $attributeValue );
|
| 137 |
+
$arr[ $nextIdx ][ 'attributes' ][ $attribName ] = $attribVal;
|
| 138 |
+
}
|
| 139 |
+
$text = (string) $node;
|
| 140 |
+
$text = trim( $text );
|
| 141 |
+
if ( strlen( $text ) > 0 ) {
|
| 142 |
+
$arr[ $nextIdx ][ 'text' ] = $text;
|
| 143 |
+
}
|
| 144 |
+
$arr[ $nextIdx ][ 'children' ] = array();
|
| 145 |
+
PPutils::convertXmlObjToArr( $node, $arr[ $nextIdx ][ 'children' ] );
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
return $arr;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
/**
|
| 154 |
+
* @class xml2array
|
| 155 |
+
*/
|
| 156 |
+
|
| 157 |
+
|
| 158 |
+
/**
|
| 159 |
+
* XMLToArray Generator Class
|
| 160 |
+
* @author : MA Razzaque Rupom <rupom_315@yahoo.com>, <rupom.bd@gmail.com>
|
| 161 |
+
* Moderator, phpResource (LINK1http://groups.yahoo.com/group/phpresource/LINK1)
|
| 162 |
+
* URL: LINK2http://www.rupom.infoLINK2
|
| 163 |
+
* @version : 1.0
|
| 164 |
+
* @date 06/05/2006
|
| 165 |
+
* Purpose : Creating Hierarchical Array from XML Data
|
| 166 |
+
* Released : Under GPL
|
| 167 |
+
*/
|
| 168 |
+
|
| 169 |
+
// class XmlToArray
|
| 170 |
+
// {
|
| 171 |
+
|
| 172 |
+
// var $xml = '';
|
| 173 |
+
|
| 174 |
+
// /**
|
| 175 |
+
// * Default Constructor
|
| 176 |
+
// *
|
| 177 |
+
// * @param $xml = xml data
|
| 178 |
+
// *
|
| 179 |
+
// * @return none
|
| 180 |
+
// */
|
| 181 |
+
|
| 182 |
+
// function XmlToArray( $xml )
|
| 183 |
+
// {
|
| 184 |
+
// $this->xml = $xml;
|
| 185 |
+
// }
|
| 186 |
+
|
| 187 |
+
// /**
|
| 188 |
+
// * _struct_to_array($values, &$i)
|
| 189 |
+
// *
|
| 190 |
+
// * This is adds the contents of the return xml into the array for easier processing.
|
| 191 |
+
// * Recursive, Static
|
| 192 |
+
// *
|
| 193 |
+
// * @access private
|
| 194 |
+
// *
|
| 195 |
+
// * @param array $values this is the xml data in an array
|
| 196 |
+
// * @param int $i this is the current location in the array
|
| 197 |
+
// *
|
| 198 |
+
// * @return Array
|
| 199 |
+
// */
|
| 200 |
+
|
| 201 |
+
// function _struct_to_array( $values, &$i )
|
| 202 |
+
// {
|
| 203 |
+
// $child = array();
|
| 204 |
+
// if ( isset( $values[ $i ][ 'value' ] ) ) array_push( $child, $values[ $i ][ 'value' ] );
|
| 205 |
+
|
| 206 |
+
// while ( $i++ < count( $values ) ) {
|
| 207 |
+
// switch ( $values[ $i ][ 'type' ] ) {
|
| 208 |
+
// case 'cdata':
|
| 209 |
+
// array_push( $child, $values[ $i ][ 'value' ] );
|
| 210 |
+
// break;
|
| 211 |
+
|
| 212 |
+
// case 'complete':
|
| 213 |
+
// $name = $values[ $i ][ 'tag' ];
|
| 214 |
+
// if ( !empty( $name ) ) {
|
| 215 |
+
// $child[ $name ] = ( $values[ $i ][ 'value' ] ) ? ( $values[ $i ][ 'value' ] ) : '';
|
| 216 |
+
// if ( isset( $values[ $i ][ 'attributes' ] ) ) {
|
| 217 |
+
// $child[ $name ] = $values[ $i ][ 'attributes' ];
|
| 218 |
+
// }
|
| 219 |
+
// }
|
| 220 |
+
// break;
|
| 221 |
+
|
| 222 |
+
// case 'open':
|
| 223 |
+
// $name = $values[ $i ][ 'tag' ];
|
| 224 |
+
// $size = isset( $child[ $name ] ) ? sizeof( $child[ $name ] ) : 0;
|
| 225 |
+
// $child[ $name ][ $size ] = $this->_struct_to_array( $values, $i );
|
| 226 |
+
// break;
|
| 227 |
+
|
| 228 |
+
// case 'close':
|
| 229 |
+
// return $child;
|
| 230 |
+
// break;
|
| 231 |
+
// }
|
| 232 |
+
// }
|
| 233 |
+
|
| 234 |
+
// return $child;
|
| 235 |
+
// }
|
| 236 |
+
|
| 237 |
+
// //_struct_to_array
|
| 238 |
+
|
| 239 |
+
// /**
|
| 240 |
+
// * createArray($data)
|
| 241 |
+
// *
|
| 242 |
+
// * This is adds the contents of the return xml into the array for easier processing.
|
| 243 |
+
// *
|
| 244 |
+
// * @access public
|
| 245 |
+
// *
|
| 246 |
+
// * @param string $data this is the string of the xml data
|
| 247 |
+
// *
|
| 248 |
+
// * @return Array
|
| 249 |
+
// */
|
| 250 |
+
// function createArray()
|
| 251 |
+
// {
|
| 252 |
+
// $xml = $this->xml;
|
| 253 |
+
// $values = array();
|
| 254 |
+
// $index = array();
|
| 255 |
+
// $array = array();
|
| 256 |
+
// $parser = xml_parser_create();
|
| 257 |
+
// xml_parser_set_option( $parser, XML_OPTION_SKIP_WHITE, 1 );
|
| 258 |
+
// xml_parser_set_option( $parser, XML_OPTION_CASE_FOLDING, 0 );
|
| 259 |
+
// xml_parse_into_struct( $parser, $xml, $values, $index );
|
| 260 |
+
// xml_parser_free( $parser );
|
| 261 |
+
// $i = 0;
|
| 262 |
+
// $name = $values[ $i ][ 'tag' ];
|
| 263 |
+
// $array[ $name ] = isset( $values[ $i ][ 'attributes' ] ) ? $values[ $i ][ 'attributes' ] : '';
|
| 264 |
+
// $array[ $name ] = $this->_struct_to_array( $values, $i );
|
| 265 |
+
|
| 266 |
+
// return $array;
|
| 267 |
+
// }
|
| 268 |
+
// //createArray
|
| 269 |
+
|
| 270 |
+
|
| 271 |
+
// }
|
| 272 |
+
|
| 273 |
+
//XmlToArray
|
| 274 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/AuthUtil.php
ADDED
|
@@ -0,0 +1,83 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php //vim: foldmethod=marker
|
| 2 |
+
|
| 3 |
+
class MockOAuthDataStore extends OAuthDataStore
|
| 4 |
+
{ /*{{{*/
|
| 5 |
+
private $consumer;
|
| 6 |
+
private $request_token;
|
| 7 |
+
private $access_token;
|
| 8 |
+
private $nonce;
|
| 9 |
+
|
| 10 |
+
function __construct()
|
| 11 |
+
{ /*{{{*/
|
| 12 |
+
$this->consumer = new OAuthConsumer( "key", "secret", null );
|
| 13 |
+
$this->request_token = new OAuthToken( "requestkey", "requestsecret", 1 );
|
| 14 |
+
$this->access_token = new OAuthToken( "accesskey", "accesssecret", 1 );
|
| 15 |
+
$this->nonce = "nonce";
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
/*}}}*/
|
| 19 |
+
|
| 20 |
+
function lookup_consumer( $consumer_key )
|
| 21 |
+
{ /*{{{*/
|
| 22 |
+
if ( $consumer_key == $this->consumer->key ) return $this->consumer;
|
| 23 |
+
|
| 24 |
+
return null;
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/*}}}*/
|
| 28 |
+
|
| 29 |
+
function lookup_token( $consumer, $token_type, $token )
|
| 30 |
+
{ /*{{{*/
|
| 31 |
+
$token_attrib = $token_type . "_token";
|
| 32 |
+
if ( $consumer->key == $this->consumer->key
|
| 33 |
+
&& $token == $this->$token_attrib->key
|
| 34 |
+
) {
|
| 35 |
+
return $this->$token_attrib;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
return null;
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
/*}}}*/
|
| 42 |
+
|
| 43 |
+
function lookup_nonce( $consumer, $token, $nonce, $timestamp )
|
| 44 |
+
{ /*{{{*/
|
| 45 |
+
if ( $consumer->key == $this->consumer->key
|
| 46 |
+
&& ( ( $token && $token->key == $this->request_token->key )
|
| 47 |
+
|| ( $token && $token->key == $this->access_token->key ) )
|
| 48 |
+
&& $nonce == $this->nonce
|
| 49 |
+
) {
|
| 50 |
+
return $this->nonce;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
return null;
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
/*}}}*/
|
| 57 |
+
|
| 58 |
+
function new_request_token( $consumer, $callback = null )
|
| 59 |
+
{ /*{{{*/
|
| 60 |
+
if ( $consumer->key == $this->consumer->key ) {
|
| 61 |
+
return $this->request_token;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
return null;
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
/*}}}*/
|
| 68 |
+
|
| 69 |
+
function new_access_token( $token, $consumer, $verifier = null )
|
| 70 |
+
{ /*{{{*/
|
| 71 |
+
if ( $consumer->key == $this->consumer->key
|
| 72 |
+
&& $token->key == $this->request_token->key
|
| 73 |
+
) {
|
| 74 |
+
return $this->access_token;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
return null;
|
| 78 |
+
}
|
| 79 |
+
/*}}}*/
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
/*}}}*/
|
| 83 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/auth/PPAuth.php
ADDED
|
@@ -0,0 +1,1077 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
//PayPal specific modification ends
|
| 3 |
+
/* Generic exception class
|
| 4 |
+
*/
|
| 5 |
+
if ( !class_exists( 'OAuthException' ) ) {
|
| 6 |
+
class OAuthException extends Exception
|
| 7 |
+
{
|
| 8 |
+
// pass
|
| 9 |
+
}
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
if ( !class_exists( 'OAuthConsumer' ) ) {
|
| 13 |
+
class OAuthConsumer
|
| 14 |
+
{
|
| 15 |
+
public $key;
|
| 16 |
+
public $secret;
|
| 17 |
+
|
| 18 |
+
function __construct( $key, $secret, $callback_url = null )
|
| 19 |
+
{
|
| 20 |
+
$this->key = $key;
|
| 21 |
+
$this->secret = $secret;
|
| 22 |
+
$this->callback_url = $callback_url;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
function __toString()
|
| 26 |
+
{
|
| 27 |
+
return "OAuthConsumer[key=$this->key,secret=$this->secret]";
|
| 28 |
+
}
|
| 29 |
+
}
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
if ( !class_exists( 'OAuthToken' ) ) {
|
| 33 |
+
class OAuthToken
|
| 34 |
+
{
|
| 35 |
+
// access tokens and request tokens
|
| 36 |
+
public $key;
|
| 37 |
+
public $secret;
|
| 38 |
+
|
| 39 |
+
/**
|
| 40 |
+
* key = the token
|
| 41 |
+
* secret = the token secret
|
| 42 |
+
*/
|
| 43 |
+
function __construct( $key, $secret )
|
| 44 |
+
{
|
| 45 |
+
$this->key = $key;
|
| 46 |
+
$this->secret = $secret;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
/**
|
| 50 |
+
* generates the basic string serialization of a token that a server
|
| 51 |
+
* would respond to request_token and access_token calls with
|
| 52 |
+
*/
|
| 53 |
+
function to_string()
|
| 54 |
+
{
|
| 55 |
+
return "oauth_token=" .
|
| 56 |
+
OAuthUtil::urlencode_rfc3986( $this->key ) .
|
| 57 |
+
"&oauth_token_secret=" .
|
| 58 |
+
OAuthUtil::urlencode_rfc3986( $this->secret );
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
function __toString()
|
| 62 |
+
{
|
| 63 |
+
return $this->to_string();
|
| 64 |
+
}
|
| 65 |
+
}
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* A class for implementing a Signature Method
|
| 70 |
+
* See section 9 ("Signing Requests") in the spec
|
| 71 |
+
*/
|
| 72 |
+
if ( !class_exists( 'OAuthSignatureMethod' ) ) {
|
| 73 |
+
abstract class OAuthSignatureMethod
|
| 74 |
+
{
|
| 75 |
+
/**
|
| 76 |
+
* Needs to return the name of the Signature Method (ie HMAC-SHA1)
|
| 77 |
+
* @return string
|
| 78 |
+
*/
|
| 79 |
+
abstract public function get_name();
|
| 80 |
+
|
| 81 |
+
/**
|
| 82 |
+
* Build up the signature
|
| 83 |
+
* NOTE: The output of this function MUST NOT be urlencoded.
|
| 84 |
+
* the encoding is handled in OAuthRequest when the final
|
| 85 |
+
* request is serialized
|
| 86 |
+
*
|
| 87 |
+
* @param OAuthRequest $request
|
| 88 |
+
* @param OAuthConsumer $consumer
|
| 89 |
+
* @param OAuthToken $token
|
| 90 |
+
*
|
| 91 |
+
* @return string
|
| 92 |
+
*/
|
| 93 |
+
abstract public function build_signature( $request, $consumer, $token );
|
| 94 |
+
|
| 95 |
+
/**
|
| 96 |
+
* Verifies that a given signature is correct
|
| 97 |
+
*
|
| 98 |
+
* @param OAuthRequest $request
|
| 99 |
+
* @param OAuthConsumer $consumer
|
| 100 |
+
* @param OAuthToken $token
|
| 101 |
+
* @param string $signature
|
| 102 |
+
*
|
| 103 |
+
* @return bool
|
| 104 |
+
*/
|
| 105 |
+
public function check_signature( $request, $consumer, $token, $signature )
|
| 106 |
+
{
|
| 107 |
+
$built = $this->build_signature( $request, $consumer, $token );
|
| 108 |
+
|
| 109 |
+
return $built == $signature;
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
/**
|
| 115 |
+
* The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
|
| 116 |
+
* where the Signature Base String is the text and the key is the concatenated values (each first
|
| 117 |
+
* encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
|
| 118 |
+
* character (ASCII code 38) even if empty.
|
| 119 |
+
* - Chapter 9.2 ("HMAC-SHA1")
|
| 120 |
+
*/
|
| 121 |
+
if ( !class_exists( 'OAuthSignatureMethod_HMAC_SHA1' ) ) {
|
| 122 |
+
class OAuthSignatureMethod_HMAC_SHA1 extends OAuthSignatureMethod
|
| 123 |
+
{
|
| 124 |
+
function get_name()
|
| 125 |
+
{
|
| 126 |
+
return "HMAC-SHA1";
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
public function build_signature( $request, $consumer, $token )
|
| 130 |
+
{
|
| 131 |
+
$base_string = $request->get_signature_base_string();
|
| 132 |
+
$base_string = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $base_string ); //convert base string to lowercase
|
| 133 |
+
$request->base_string = $base_string;
|
| 134 |
+
|
| 135 |
+
$key_parts = array(
|
| 136 |
+
$consumer->secret,
|
| 137 |
+
( $token ) ? $token->secret : ""
|
| 138 |
+
);
|
| 139 |
+
|
| 140 |
+
$key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
|
| 141 |
+
$key = implode( '&', $key_parts );
|
| 142 |
+
$key = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $key ); //convert to lowercase
|
| 143 |
+
return base64_encode( hash_hmac( 'sha1', $base_string, $key, true ) );
|
| 144 |
+
}
|
| 145 |
+
}
|
| 146 |
+
}
|
| 147 |
+
/**
|
| 148 |
+
* The PLAINTEXT method does not provide any security protection and SHOULD only be used
|
| 149 |
+
* over a secure channel such as HTTPS. It does not use the Signature Base String.
|
| 150 |
+
* - Chapter 9.4 ("PLAINTEXT")
|
| 151 |
+
*/
|
| 152 |
+
if ( !class_exists( 'OAuthSignatureMethod_PLAINTEXT' ) ) {
|
| 153 |
+
class OAuthSignatureMethod_PLAINTEXT extends OAuthSignatureMethod
|
| 154 |
+
{
|
| 155 |
+
public function get_name()
|
| 156 |
+
{
|
| 157 |
+
return "PLAINTEXT";
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
/**
|
| 161 |
+
* oauth_signature is set to the concatenated encoded values of the Consumer Secret and
|
| 162 |
+
* Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
|
| 163 |
+
* empty. The result MUST be encoded again.
|
| 164 |
+
* - Chapter 9.4.1 ("Generating Signatures")
|
| 165 |
+
*
|
| 166 |
+
* Please note that the second encoding MUST NOT happen in the SignatureMethod, as
|
| 167 |
+
* OAuthRequest handles this!
|
| 168 |
+
*/
|
| 169 |
+
public function build_signature( $request, $consumer, $token )
|
| 170 |
+
{
|
| 171 |
+
$key_parts = array(
|
| 172 |
+
$consumer->secret,
|
| 173 |
+
( $token ) ? $token->secret : ""
|
| 174 |
+
);
|
| 175 |
+
|
| 176 |
+
$key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
|
| 177 |
+
$key = implode( '&', $key_parts );
|
| 178 |
+
$request->base_string = $key;
|
| 179 |
+
|
| 180 |
+
return $key;
|
| 181 |
+
}
|
| 182 |
+
}
|
| 183 |
+
}
|
| 184 |
+
/**
|
| 185 |
+
* The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
|
| 186 |
+
* [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
|
| 187 |
+
* EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
|
| 188 |
+
* verified way to the Service Provider, in a manner which is beyond the scope of this
|
| 189 |
+
* specification.
|
| 190 |
+
* - Chapter 9.3 ("RSA-SHA1")
|
| 191 |
+
*/
|
| 192 |
+
if ( !class_exists( 'OAuthSignatureMethod_RSA_SHA1' ) ) {
|
| 193 |
+
abstract class OAuthSignatureMethod_RSA_SHA1 extends OAuthSignatureMethod
|
| 194 |
+
{
|
| 195 |
+
public function get_name()
|
| 196 |
+
{
|
| 197 |
+
return "RSA-SHA1";
|
| 198 |
+
}
|
| 199 |
+
|
| 200 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 201 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 202 |
+
// (2) fetch via http using a url provided by the requester
|
| 203 |
+
// (3) some sort of specific discovery code based on request
|
| 204 |
+
//
|
| 205 |
+
// Either way should return a string representation of the certificate
|
| 206 |
+
protected abstract function fetch_public_cert( &$request );
|
| 207 |
+
|
| 208 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 209 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 210 |
+
//
|
| 211 |
+
// Either way should return a string representation of the certificate
|
| 212 |
+
protected abstract function fetch_private_cert( &$request );
|
| 213 |
+
|
| 214 |
+
public function build_signature( $request, $consumer, $token )
|
| 215 |
+
{
|
| 216 |
+
$base_string = $request->get_signature_base_string();
|
| 217 |
+
$request->base_string = $base_string;
|
| 218 |
+
|
| 219 |
+
// Fetch the private key cert based on the request
|
| 220 |
+
$cert = $this->fetch_private_cert( $request );
|
| 221 |
+
|
| 222 |
+
// Pull the private key ID from the certificate
|
| 223 |
+
$privatekeyid = openssl_get_privatekey( $cert );
|
| 224 |
+
|
| 225 |
+
// Sign using the key
|
| 226 |
+
$ok = openssl_sign( $base_string, $signature, $privatekeyid );
|
| 227 |
+
|
| 228 |
+
// Release the key resource
|
| 229 |
+
openssl_free_key( $privatekeyid );
|
| 230 |
+
|
| 231 |
+
return base64_encode( $signature );
|
| 232 |
+
}
|
| 233 |
+
|
| 234 |
+
public function check_signature( $request, $consumer, $token, $signature )
|
| 235 |
+
{
|
| 236 |
+
$decoded_sig = base64_decode( $signature );
|
| 237 |
+
|
| 238 |
+
$base_string = $request->get_signature_base_string();
|
| 239 |
+
|
| 240 |
+
// Fetch the public key cert based on the request
|
| 241 |
+
$cert = $this->fetch_public_cert( $request );
|
| 242 |
+
|
| 243 |
+
// Pull the public key ID from the certificate
|
| 244 |
+
$publickeyid = openssl_get_publickey( $cert );
|
| 245 |
+
|
| 246 |
+
// Check the computed signature against the one passed in the query
|
| 247 |
+
$ok = openssl_verify( $base_string, $decoded_sig, $publickeyid );
|
| 248 |
+
|
| 249 |
+
// Release the key resource
|
| 250 |
+
openssl_free_key( $publickeyid );
|
| 251 |
+
|
| 252 |
+
return $ok == 1;
|
| 253 |
+
}
|
| 254 |
+
}
|
| 255 |
+
}
|
| 256 |
+
|
| 257 |
+
if ( !class_exists( 'OAuthRequest' ) ) {
|
| 258 |
+
class OAuthRequest
|
| 259 |
+
{
|
| 260 |
+
public $parameters;
|
| 261 |
+
protected $http_method;
|
| 262 |
+
protected $http_url;
|
| 263 |
+
// for debug purposes
|
| 264 |
+
public $base_string;
|
| 265 |
+
public static $version = '1.0';
|
| 266 |
+
public static $POST_INPUT = 'php://input';
|
| 267 |
+
|
| 268 |
+
function __construct( $http_method, $http_url, $parameters = null )
|
| 269 |
+
{
|
| 270 |
+
$parameters = ( $parameters ) ? $parameters : array();
|
| 271 |
+
$parameters = array_merge( OAuthUtil::parse_parameters( parse_url( $http_url, PHP_URL_QUERY ) ), $parameters );
|
| 272 |
+
$this->parameters = $parameters;
|
| 273 |
+
$this->http_method = $http_method;
|
| 274 |
+
$this->http_url = $http_url;
|
| 275 |
+
}
|
| 276 |
+
|
| 277 |
+
|
| 278 |
+
/**
|
| 279 |
+
* attempt to build up a request from what was passed to the server
|
| 280 |
+
*/
|
| 281 |
+
public static function from_request( $http_method = null, $http_url = null, $parameters = null )
|
| 282 |
+
{
|
| 283 |
+
$scheme = ( !isset( $_SERVER[ 'HTTPS' ] ) || $_SERVER[ 'HTTPS' ] != "on" )
|
| 284 |
+
? 'http'
|
| 285 |
+
: 'https';
|
| 286 |
+
$http_url = ( $http_url ) ? $http_url : $scheme .
|
| 287 |
+
'://' . $_SERVER[ 'HTTP_HOST' ] .
|
| 288 |
+
':' .
|
| 289 |
+
$_SERVER[ 'SERVER_PORT' ] .
|
| 290 |
+
$_SERVER[ 'REQUEST_URI' ];
|
| 291 |
+
$http_method = ( $http_method ) ? $http_method : $_SERVER[ 'REQUEST_METHOD' ];
|
| 292 |
+
|
| 293 |
+
// We weren't handed any parameters, so let's find the ones relevant to
|
| 294 |
+
// this request.
|
| 295 |
+
// If you run XML-RPC or similar you should use this to provide your own
|
| 296 |
+
// parsed parameter-list
|
| 297 |
+
if ( !$parameters ) {
|
| 298 |
+
// Find request headers
|
| 299 |
+
$request_headers = OAuthUtil::get_headers();
|
| 300 |
+
|
| 301 |
+
// Parse the query-string to find GET parameters
|
| 302 |
+
$parameters = OAuthUtil::parse_parameters( $_SERVER[ 'QUERY_STRING' ] );
|
| 303 |
+
|
| 304 |
+
// It's a POST request of the proper content-type, so parse POST
|
| 305 |
+
// parameters and add those overriding any duplicates from GET
|
| 306 |
+
if ( $http_method == "POST"
|
| 307 |
+
&& isset( $request_headers[ 'Content-Type' ] )
|
| 308 |
+
&& strstr( $request_headers[ 'Content-Type' ],
|
| 309 |
+
'application/x-www-form-urlencoded' )
|
| 310 |
+
) {
|
| 311 |
+
$post_data = OAuthUtil::parse_parameters(
|
| 312 |
+
file_get_contents( self::$POST_INPUT )
|
| 313 |
+
);
|
| 314 |
+
$parameters = array_merge( $parameters, $post_data );
|
| 315 |
+
}
|
| 316 |
+
|
| 317 |
+
// We have a Authorization-header with OAuth data. Parse the header
|
| 318 |
+
// and add those overriding any duplicates from GET or POST
|
| 319 |
+
if ( isset( $request_headers[ 'Authorization' ] ) && substr( $request_headers[ 'Authorization' ], 0, 6 ) == 'OAuth ' ) {
|
| 320 |
+
$header_parameters = OAuthUtil::split_header(
|
| 321 |
+
$request_headers[ 'Authorization' ]
|
| 322 |
+
);
|
| 323 |
+
$parameters = array_merge( $parameters, $header_parameters );
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
return new OAuthRequest( $http_method, $http_url, $parameters );
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
/**
|
| 332 |
+
* pretty much a helper function to set up the request
|
| 333 |
+
*/
|
| 334 |
+
public static function from_consumer_and_token( $consumer, $token, $http_method, $http_url, $parameters = null )
|
| 335 |
+
{
|
| 336 |
+
$parameters = ( $parameters ) ? $parameters : array();
|
| 337 |
+
$defaults = array(
|
| 338 |
+
"oauth_version" => OAuthRequest::$version,
|
| 339 |
+
// "oauth_nonce" => OAuthRequest::generate_nonce(),
|
| 340 |
+
"oauth_timestamp" => OAuthRequest::generate_timestamp(),
|
| 341 |
+
|
| 342 |
+
"oauth_consumer_key" => $consumer->key
|
| 343 |
+
);
|
| 344 |
+
if ( $token )
|
| 345 |
+
$defaults[ 'oauth_token' ] = $token->key;
|
| 346 |
+
|
| 347 |
+
$parameters = array_merge( $defaults, $parameters );
|
| 348 |
+
ksort( $parameters );
|
| 349 |
+
|
| 350 |
+
return new OAuthRequest( $http_method, $http_url, $parameters );
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
+
public function set_parameter( $name, $value, $allow_duplicates = true )
|
| 354 |
+
{
|
| 355 |
+
if ( $allow_duplicates && isset( $this->parameters[ $name ] ) ) {
|
| 356 |
+
// We have already added parameter(s) with this name, so add to the list
|
| 357 |
+
if ( is_scalar( $this->parameters[ $name ] ) ) {
|
| 358 |
+
// This is the first duplicate, so transform scalar (string)
|
| 359 |
+
// into an array so we can add the duplicates
|
| 360 |
+
$this->parameters[ $name ] = array( $this->parameters[ $name ] );
|
| 361 |
+
}
|
| 362 |
+
|
| 363 |
+
$this->parameters[ $name ][ ] = $value;
|
| 364 |
+
} else {
|
| 365 |
+
$this->parameters[ $name ] = $value;
|
| 366 |
+
}
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
public function get_parameter( $name )
|
| 370 |
+
{
|
| 371 |
+
return isset( $this->parameters[ $name ] ) ? $this->parameters[ $name ] : null;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
public function get_parameters()
|
| 375 |
+
{
|
| 376 |
+
return $this->parameters;
|
| 377 |
+
}
|
| 378 |
+
|
| 379 |
+
public function unset_parameter( $name )
|
| 380 |
+
{
|
| 381 |
+
unset( $this->parameters[ $name ] );
|
| 382 |
+
}
|
| 383 |
+
|
| 384 |
+
/**
|
| 385 |
+
* The request parameters, sorted and concatenated into a normalized string.
|
| 386 |
+
* @return string
|
| 387 |
+
*/
|
| 388 |
+
public function get_signable_parameters()
|
| 389 |
+
{
|
| 390 |
+
// Grab all parameters
|
| 391 |
+
$params = $this->parameters;
|
| 392 |
+
ksort( $params );
|
| 393 |
+
// Remove oauth_signature if present
|
| 394 |
+
// Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
|
| 395 |
+
if ( isset( $params[ 'oauth_signature' ] ) ) {
|
| 396 |
+
unset( $params[ 'oauth_signature' ] );
|
| 397 |
+
}
|
| 398 |
+
foreach ( $params as $key => $value ) {
|
| 399 |
+
$res[ ] = $key . "=" . $value;
|
| 400 |
+
}
|
| 401 |
+
|
| 402 |
+
return implode( '&', $res );
|
| 403 |
+
//return OAuthUtil::build_http_query($params);
|
| 404 |
+
}
|
| 405 |
+
|
| 406 |
+
/**
|
| 407 |
+
* Returns the base string of this request
|
| 408 |
+
*
|
| 409 |
+
* The base string defined as the method, the url
|
| 410 |
+
* and the parameters (normalized), each urlencoded
|
| 411 |
+
* and the concated with &.
|
| 412 |
+
*/
|
| 413 |
+
public function get_signature_base_string()
|
| 414 |
+
{
|
| 415 |
+
$parts = array(
|
| 416 |
+
$this->get_normalized_http_method(),
|
| 417 |
+
$this->get_normalized_http_url(),
|
| 418 |
+
$this->get_signable_parameters()
|
| 419 |
+
);
|
| 420 |
+
|
| 421 |
+
$parts = OAuthUtil::urlencode_rfc3986( $parts );
|
| 422 |
+
|
| 423 |
+
return implode( '&', $parts );
|
| 424 |
+
}
|
| 425 |
+
|
| 426 |
+
/**
|
| 427 |
+
* just uppercases the http method
|
| 428 |
+
*/
|
| 429 |
+
public function get_normalized_http_method()
|
| 430 |
+
{
|
| 431 |
+
return strtoupper( $this->http_method );
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
/**
|
| 435 |
+
* parses the url and rebuilds it to be
|
| 436 |
+
* scheme://host/path
|
| 437 |
+
*/
|
| 438 |
+
public function get_normalized_http_url()
|
| 439 |
+
{
|
| 440 |
+
$parts = parse_url( $this->http_url );
|
| 441 |
+
|
| 442 |
+
$scheme = ( isset( $parts[ 'scheme' ] ) ) ? $parts[ 'scheme' ] : 'http';
|
| 443 |
+
$port = ( isset( $parts[ 'port' ] ) ) ? $parts[ 'port' ] : ( ( $scheme == 'https' ) ? '443' : '80' );
|
| 444 |
+
$host = ( isset( $parts[ 'host' ] ) ) ? $parts[ 'host' ] : '';
|
| 445 |
+
$path = ( isset( $parts[ 'path' ] ) ) ? $parts[ 'path' ] : '';
|
| 446 |
+
|
| 447 |
+
if ( ( $scheme == 'https' && $port != '443' )
|
| 448 |
+
|| ( $scheme == 'http' && $port != '80' )
|
| 449 |
+
) {
|
| 450 |
+
$host = "$host:$port";
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
return "$scheme://$host$path";
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
/**
|
| 457 |
+
* builds a url usable for a GET request
|
| 458 |
+
*/
|
| 459 |
+
public function to_url()
|
| 460 |
+
{
|
| 461 |
+
$post_data = $this->to_postdata();
|
| 462 |
+
$out = $this->get_normalized_http_url();
|
| 463 |
+
if ( $post_data ) {
|
| 464 |
+
$out .= '?' . $post_data;
|
| 465 |
+
}
|
| 466 |
+
|
| 467 |
+
return $out;
|
| 468 |
+
}
|
| 469 |
+
|
| 470 |
+
/**
|
| 471 |
+
* builds the data one would send in a POST request
|
| 472 |
+
*/
|
| 473 |
+
public function to_postdata()
|
| 474 |
+
{
|
| 475 |
+
return OAuthUtil::build_http_query( $this->parameters );
|
| 476 |
+
}
|
| 477 |
+
|
| 478 |
+
/**
|
| 479 |
+
* builds the Authorization: header
|
| 480 |
+
*/
|
| 481 |
+
public function to_header( $realm = null )
|
| 482 |
+
{
|
| 483 |
+
$first = true;
|
| 484 |
+
if ( $realm ) {
|
| 485 |
+
$out = 'Authorization: OAuth realm="' . OAuthUtil::urlencode_rfc3986( $realm ) . '"';
|
| 486 |
+
$first = false;
|
| 487 |
+
} else
|
| 488 |
+
$out = 'Authorization: OAuth';
|
| 489 |
+
|
| 490 |
+
$total = array();
|
| 491 |
+
foreach ( $this->parameters as $k => $v ) {
|
| 492 |
+
if ( substr( $k, 0, 5 ) != "oauth" ) continue;
|
| 493 |
+
if ( is_array( $v ) ) {
|
| 494 |
+
throw new OAuthException( 'Arrays not supported in headers' );
|
| 495 |
+
}
|
| 496 |
+
$out .= ( $first ) ? ' ' : ',';
|
| 497 |
+
$out .= OAuthUtil::urlencode_rfc3986( $k ) .
|
| 498 |
+
'="' .
|
| 499 |
+
OAuthUtil::urlencode_rfc3986( $v ) .
|
| 500 |
+
'"';
|
| 501 |
+
$first = false;
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
return $out;
|
| 505 |
+
}
|
| 506 |
+
|
| 507 |
+
public function __toString()
|
| 508 |
+
{
|
| 509 |
+
return $this->to_url();
|
| 510 |
+
}
|
| 511 |
+
|
| 512 |
+
|
| 513 |
+
public function sign_request( $signature_method, $consumer, $token )
|
| 514 |
+
{
|
| 515 |
+
|
| 516 |
+
$empty = false;
|
| 517 |
+
$msg = array();
|
| 518 |
+
if ( $token->key == null ) {
|
| 519 |
+
$msg[ ] = 'Token key';
|
| 520 |
+
}
|
| 521 |
+
if ( $token->secret == null ) {
|
| 522 |
+
$msg[ ] = 'Token secret';
|
| 523 |
+
}
|
| 524 |
+
if ( $consumer->key == null ) {
|
| 525 |
+
|
| 526 |
+
$msg[ ] = 'Consumer key';
|
| 527 |
+
}
|
| 528 |
+
if ( $consumer->secret == null ) {
|
| 529 |
+
|
| 530 |
+
$msg[ ] = 'Consumer secret';
|
| 531 |
+
}
|
| 532 |
+
if ( $this->http_url == null ) {
|
| 533 |
+
|
| 534 |
+
$msg[ ] = 'Endpoint';
|
| 535 |
+
}
|
| 536 |
+
if ( $this->http_method == null ) {
|
| 537 |
+
|
| 538 |
+
$msg[ ] = 'HTTP method';
|
| 539 |
+
}
|
| 540 |
+
if ( count( $msg ) ) {
|
| 541 |
+
throw new OAuthException( 'Enter valid ' . implode( ',', $msg ) );
|
| 542 |
+
}
|
| 543 |
+
$this->set_parameter(
|
| 544 |
+
"oauth_signature_method",
|
| 545 |
+
$signature_method->get_name(),
|
| 546 |
+
false );
|
| 547 |
+
|
| 548 |
+
$signature = $this->build_signature( $signature_method, $consumer, $token );
|
| 549 |
+
$this->set_parameter( "oauth_signature", $signature, false );
|
| 550 |
+
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
+
public function build_signature( $signature_method, $consumer, $token )
|
| 554 |
+
{
|
| 555 |
+
$signature = $signature_method->build_signature( $this, $consumer, $token );
|
| 556 |
+
|
| 557 |
+
return $signature;
|
| 558 |
+
}
|
| 559 |
+
|
| 560 |
+
/**
|
| 561 |
+
* util function: current timestamp
|
| 562 |
+
*/
|
| 563 |
+
private static function generate_timestamp()
|
| 564 |
+
{
|
| 565 |
+
return time();
|
| 566 |
+
}
|
| 567 |
+
|
| 568 |
+
/**
|
| 569 |
+
* util function: current nonce
|
| 570 |
+
*/
|
| 571 |
+
private static function generate_nonce()
|
| 572 |
+
{
|
| 573 |
+
$mt = microtime();
|
| 574 |
+
$rand = mt_rand();
|
| 575 |
+
|
| 576 |
+
return md5( $mt . $rand ); // md5s look nicer than numbers
|
| 577 |
+
}
|
| 578 |
+
}
|
| 579 |
+
}
|
| 580 |
+
|
| 581 |
+
if ( !class_exists( 'OAuthServer' ) ) {
|
| 582 |
+
class OAuthServer
|
| 583 |
+
{
|
| 584 |
+
protected $timestamp_threshold = 300; // in seconds, five minutes
|
| 585 |
+
protected $version = '1.0'; // hi blaine
|
| 586 |
+
protected $signature_methods = array();
|
| 587 |
+
|
| 588 |
+
protected $data_store;
|
| 589 |
+
|
| 590 |
+
function __construct( $data_store )
|
| 591 |
+
{
|
| 592 |
+
$this->data_store = $data_store;
|
| 593 |
+
}
|
| 594 |
+
|
| 595 |
+
public function add_signature_method( $signature_method )
|
| 596 |
+
{
|
| 597 |
+
$this->signature_methods[ $signature_method->get_name() ] =
|
| 598 |
+
$signature_method;
|
| 599 |
+
}
|
| 600 |
+
|
| 601 |
+
// high level functions
|
| 602 |
+
|
| 603 |
+
/**
|
| 604 |
+
* process a request_token request
|
| 605 |
+
* returns the request token on success
|
| 606 |
+
*/
|
| 607 |
+
public function fetch_request_token( &$request )
|
| 608 |
+
{
|
| 609 |
+
$this->get_version( $request );
|
| 610 |
+
|
| 611 |
+
$consumer = $this->get_consumer( $request );
|
| 612 |
+
|
| 613 |
+
// no token required for the initial token request
|
| 614 |
+
$token = null;
|
| 615 |
+
|
| 616 |
+
$this->check_signature( $request, $consumer, $token );
|
| 617 |
+
|
| 618 |
+
// Rev A change
|
| 619 |
+
$callback = $request->get_parameter( 'oauth_callback' );
|
| 620 |
+
$new_token = $this->data_store->new_request_token( $consumer, $callback );
|
| 621 |
+
|
| 622 |
+
return $new_token;
|
| 623 |
+
}
|
| 624 |
+
|
| 625 |
+
/**
|
| 626 |
+
* process an access_token request
|
| 627 |
+
* returns the access token on success
|
| 628 |
+
*/
|
| 629 |
+
public function fetch_access_token( &$request )
|
| 630 |
+
{
|
| 631 |
+
$this->get_version( $request );
|
| 632 |
+
|
| 633 |
+
$consumer = $this->get_consumer( $request );
|
| 634 |
+
|
| 635 |
+
// requires authorized request token
|
| 636 |
+
$token = $this->get_token( $request, $consumer, "request" );
|
| 637 |
+
|
| 638 |
+
$this->check_signature( $request, $consumer, $token );
|
| 639 |
+
|
| 640 |
+
// Rev A change
|
| 641 |
+
$verifier = $request->get_parameter( 'oauth_verifier' );
|
| 642 |
+
$new_token = $this->data_store->new_access_token( $token, $consumer, $verifier );
|
| 643 |
+
|
| 644 |
+
return $new_token;
|
| 645 |
+
}
|
| 646 |
+
|
| 647 |
+
/**
|
| 648 |
+
* verify an api call, checks all the parameters
|
| 649 |
+
*/
|
| 650 |
+
public function verify_request( &$request )
|
| 651 |
+
{
|
| 652 |
+
$this->get_version( $request );
|
| 653 |
+
$consumer = $this->get_consumer( $request );
|
| 654 |
+
$token = $this->get_token( $request, $consumer, "access" );
|
| 655 |
+
$this->check_signature( $request, $consumer, $token );
|
| 656 |
+
|
| 657 |
+
return array( $consumer, $token );
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
// Internals from here
|
| 661 |
+
/**
|
| 662 |
+
* version 1
|
| 663 |
+
*/
|
| 664 |
+
private function get_version( &$request )
|
| 665 |
+
{
|
| 666 |
+
$version = $request->get_parameter( "oauth_version" );
|
| 667 |
+
if ( !$version ) {
|
| 668 |
+
// Service Providers MUST assume the protocol version to be 1.0 if this parameter is not present.
|
| 669 |
+
// Chapter 7.0 ("Accessing Protected Ressources")
|
| 670 |
+
$version = '1.0';
|
| 671 |
+
}
|
| 672 |
+
if ( $version !== $this->version ) {
|
| 673 |
+
throw new OAuthException( "OAuth version '$version' not supported" );
|
| 674 |
+
}
|
| 675 |
+
|
| 676 |
+
return $version;
|
| 677 |
+
}
|
| 678 |
+
|
| 679 |
+
/**
|
| 680 |
+
* figure out the signature with some defaults
|
| 681 |
+
*/
|
| 682 |
+
private function get_signature_method( $request )
|
| 683 |
+
{
|
| 684 |
+
$signature_method = $request instanceof OAuthRequest
|
| 685 |
+
? $request->get_parameter( "oauth_signature_method" )
|
| 686 |
+
: null;
|
| 687 |
+
|
| 688 |
+
if ( !$signature_method ) {
|
| 689 |
+
// According to chapter 7 ("Accessing Protected Ressources") the signature-method
|
| 690 |
+
// parameter is required, and we can't just fallback to PLAINTEXT
|
| 691 |
+
throw new OAuthException( 'No signature method parameter. This parameter is required' );
|
| 692 |
+
}
|
| 693 |
+
|
| 694 |
+
if ( !in_array( $signature_method,
|
| 695 |
+
array_keys( $this->signature_methods ) )
|
| 696 |
+
) {
|
| 697 |
+
throw new OAuthException(
|
| 698 |
+
"Signature method '$signature_method' not supported " .
|
| 699 |
+
"try one of the following: " .
|
| 700 |
+
implode( ", ", array_keys( $this->signature_methods ) )
|
| 701 |
+
);
|
| 702 |
+
}
|
| 703 |
+
|
| 704 |
+
return $this->signature_methods[ $signature_method ];
|
| 705 |
+
}
|
| 706 |
+
|
| 707 |
+
/**
|
| 708 |
+
* try to find the consumer for the provided request's consumer key
|
| 709 |
+
*/
|
| 710 |
+
private function get_consumer( $request )
|
| 711 |
+
{
|
| 712 |
+
$consumer_key = $request instanceof OAuthRequest
|
| 713 |
+
? $request->get_parameter( "oauth_consumer_key" )
|
| 714 |
+
: null;
|
| 715 |
+
|
| 716 |
+
if ( !$consumer_key ) {
|
| 717 |
+
throw new OAuthException( "Invalid consumer key" );
|
| 718 |
+
}
|
| 719 |
+
|
| 720 |
+
$consumer = $this->data_store->lookup_consumer( $consumer_key );
|
| 721 |
+
if ( !$consumer ) {
|
| 722 |
+
throw new OAuthException( "Invalid consumer" );
|
| 723 |
+
}
|
| 724 |
+
|
| 725 |
+
return $consumer;
|
| 726 |
+
}
|
| 727 |
+
|
| 728 |
+
/**
|
| 729 |
+
* try to find the token for the provided request's token key
|
| 730 |
+
*/
|
| 731 |
+
private function get_token( $request, $consumer, $token_type = "access" )
|
| 732 |
+
{
|
| 733 |
+
$token_field = $request instanceof OAuthRequest
|
| 734 |
+
? $request->get_parameter( 'oauth_token' )
|
| 735 |
+
: null;
|
| 736 |
+
|
| 737 |
+
$token = $this->data_store->lookup_token(
|
| 738 |
+
$consumer, $token_type, $token_field
|
| 739 |
+
);
|
| 740 |
+
if ( !$token ) {
|
| 741 |
+
throw new OAuthException( "Invalid $token_type token: $token_field" );
|
| 742 |
+
}
|
| 743 |
+
|
| 744 |
+
return $token;
|
| 745 |
+
}
|
| 746 |
+
|
| 747 |
+
/**
|
| 748 |
+
* all-in-one function to check the signature on a request
|
| 749 |
+
* should guess the signature method appropriately
|
| 750 |
+
*/
|
| 751 |
+
private function check_signature( $request, $consumer, $token )
|
| 752 |
+
{
|
| 753 |
+
// this should probably be in a different method
|
| 754 |
+
$timestamp = $request instanceof OAuthRequest
|
| 755 |
+
? $request->get_parameter( 'oauth_timestamp' )
|
| 756 |
+
: null;
|
| 757 |
+
$nonce = $request instanceof OAuthRequest
|
| 758 |
+
? $request->get_parameter( 'oauth_nonce' )
|
| 759 |
+
: null;
|
| 760 |
+
|
| 761 |
+
$this->check_timestamp( $timestamp );
|
| 762 |
+
$this->check_nonce( $consumer, $token, $nonce, $timestamp );
|
| 763 |
+
|
| 764 |
+
$signature_method = $this->get_signature_method( $request );
|
| 765 |
+
|
| 766 |
+
$signature = $request->get_parameter( 'oauth_signature' );
|
| 767 |
+
$valid_sig = $signature_method->check_signature(
|
| 768 |
+
$request,
|
| 769 |
+
$consumer,
|
| 770 |
+
$token,
|
| 771 |
+
$signature
|
| 772 |
+
);
|
| 773 |
+
|
| 774 |
+
if ( !$valid_sig ) {
|
| 775 |
+
throw new OAuthException( "Invalid signature" );
|
| 776 |
+
}
|
| 777 |
+
}
|
| 778 |
+
|
| 779 |
+
/**
|
| 780 |
+
* check that the timestamp is new enough
|
| 781 |
+
*/
|
| 782 |
+
private function check_timestamp( $timestamp )
|
| 783 |
+
{
|
| 784 |
+
if ( !$timestamp )
|
| 785 |
+
throw new OAuthException(
|
| 786 |
+
'Missing timestamp parameter. The parameter is required'
|
| 787 |
+
);
|
| 788 |
+
|
| 789 |
+
// verify that timestamp is recentish
|
| 790 |
+
$now = time();
|
| 791 |
+
if ( abs( $now - $timestamp ) > $this->timestamp_threshold ) {
|
| 792 |
+
throw new OAuthException(
|
| 793 |
+
"Expired timestamp, yours $timestamp, ours $now"
|
| 794 |
+
);
|
| 795 |
+
}
|
| 796 |
+
}
|
| 797 |
+
|
| 798 |
+
/**
|
| 799 |
+
* check that the nonce is not repeated
|
| 800 |
+
*/
|
| 801 |
+
private function check_nonce( $consumer, $token, $nonce, $timestamp )
|
| 802 |
+
{
|
| 803 |
+
if ( !$nonce )
|
| 804 |
+
throw new OAuthException(
|
| 805 |
+
'Missing nonce parameter. The parameter is required'
|
| 806 |
+
);
|
| 807 |
+
|
| 808 |
+
// verify that the nonce is uniqueish
|
| 809 |
+
$found = $this->data_store->lookup_nonce(
|
| 810 |
+
$consumer,
|
| 811 |
+
$token,
|
| 812 |
+
$nonce,
|
| 813 |
+
$timestamp
|
| 814 |
+
);
|
| 815 |
+
if ( $found ) {
|
| 816 |
+
throw new OAuthException( "Nonce already used: $nonce" );
|
| 817 |
+
}
|
| 818 |
+
}
|
| 819 |
+
|
| 820 |
+
}
|
| 821 |
+
}
|
| 822 |
+
|
| 823 |
+
// if ( !class_exists( 'OAuthDataStore' ) ) { // If you experience clashes with other OAuthDataStore classes, uncommenting this line and the closing curly brace
|
| 824 |
+
// at the end of the class declaration MAY help you.
|
| 825 |
+
class OAuthDataStore
|
| 826 |
+
{
|
| 827 |
+
function lookup_consumer( $consumer_key )
|
| 828 |
+
{
|
| 829 |
+
// implement me
|
| 830 |
+
}
|
| 831 |
+
|
| 832 |
+
function lookup_token( $consumer, $token_type, $token )
|
| 833 |
+
{
|
| 834 |
+
// implement me
|
| 835 |
+
}
|
| 836 |
+
|
| 837 |
+
function lookup_nonce( $consumer, $token, $nonce, $timestamp )
|
| 838 |
+
{
|
| 839 |
+
// implement me
|
| 840 |
+
}
|
| 841 |
+
|
| 842 |
+
function new_request_token( $consumer, $callback = null )
|
| 843 |
+
{
|
| 844 |
+
// return a new token attached to this consumer
|
| 845 |
+
}
|
| 846 |
+
|
| 847 |
+
function new_access_token( $token, $consumer, $verifier = null )
|
| 848 |
+
{
|
| 849 |
+
// return a new access token attached to this consumer
|
| 850 |
+
// for the user associated with this token if the request token
|
| 851 |
+
// is authorized
|
| 852 |
+
// should also invalidate the request token
|
| 853 |
+
}
|
| 854 |
+
|
| 855 |
+
}
|
| 856 |
+
// } // This is the curly brace to uncomment
|
| 857 |
+
|
| 858 |
+
if ( !class_exists( 'OAuthUtil' ) ) {
|
| 859 |
+
class OAuthUtil
|
| 860 |
+
{
|
| 861 |
+
public static function urlencode_rfc3986( $input )
|
| 862 |
+
{
|
| 863 |
+
if ( is_array( $input ) ) {
|
| 864 |
+
return array_map( array( 'OAuthUtil', 'urlencode_rfc3986' ), $input );
|
| 865 |
+
} else if ( is_scalar( $input ) ) {
|
| 866 |
+
$tmp1 = str_replace( '%7E', '~', rawurlencode( $input ) );
|
| 867 |
+
$tmp2 = str_replace( ".", "%2E", $tmp1 );
|
| 868 |
+
$tmp3 = str_replace( "*", "%2A", $tmp2 );
|
| 869 |
+
$tmp4 = str_replace( '+', ' ', $tmp3 );
|
| 870 |
+
$tmp = str_replace( "-", "%2D", $tmp4 );
|
| 871 |
+
|
| 872 |
+
return $tmp;
|
| 873 |
+
/*$tmp1=str_replace('%7E', '~', rawurlencode($input));
|
| 874 |
+
$tmp2= str_replace(".","%2E",$tmp1);
|
| 875 |
+
|
| 876 |
+
|
| 877 |
+
return $tmp;*/
|
| 878 |
+
} else {
|
| 879 |
+
return '';
|
| 880 |
+
}
|
| 881 |
+
}
|
| 882 |
+
|
| 883 |
+
public static function parseQueryString( $str )
|
| 884 |
+
{
|
| 885 |
+
$op = array();
|
| 886 |
+
$pairs = explode( "&", $str );
|
| 887 |
+
foreach ( $pairs as $pair ) {
|
| 888 |
+
list( $k, $v ) = array_map( "urldecode", explode( "=", $pair ) );
|
| 889 |
+
$op[ $k ] = $v;
|
| 890 |
+
}
|
| 891 |
+
|
| 892 |
+
return $op;
|
| 893 |
+
}
|
| 894 |
+
|
| 895 |
+
//parses string to associative array -modified for PayPal Signature
|
| 896 |
+
|
| 897 |
+
|
| 898 |
+
// This decode function isn't taking into consideration the above
|
| 899 |
+
// modifications to the encoding process. However, this method doesn't
|
| 900 |
+
// seem to be used anywhere so leaving it as is.
|
| 901 |
+
public static function urldecode_rfc3986( $string )
|
| 902 |
+
{
|
| 903 |
+
return urldecode( $string );
|
| 904 |
+
}
|
| 905 |
+
|
| 906 |
+
// Utility function for turning the Authorization: header into
|
| 907 |
+
// parameters, has to do some unescaping
|
| 908 |
+
// Can filter out any non-oauth parameters if needed (default behaviour)
|
| 909 |
+
// May 28th, 2010 - method updated to tjerk.meesters for a speed improvement.
|
| 910 |
+
// see http://code.google.com/p/oauth/issues/detail?id=163
|
| 911 |
+
public static function split_header( $header, $only_allow_oauth_parameters = true )
|
| 912 |
+
{
|
| 913 |
+
$params = array();
|
| 914 |
+
if ( preg_match_all( '/(' . ( $only_allow_oauth_parameters ? 'oauth_' : '' ) . '[a-z_-]*)=(:?"([^"]*)"|([^,]*))/', $header, $matches ) ) {
|
| 915 |
+
foreach ( $matches[ 1 ] as $i => $h ) {
|
| 916 |
+
$params[ $h ] = OAuthUtil::urldecode_rfc3986( empty( $matches[ 3 ][ $i ] ) ? $matches[ 4 ][ $i ] : $matches[ 3 ][ $i ] );
|
| 917 |
+
}
|
| 918 |
+
if ( isset( $params[ 'realm' ] ) ) {
|
| 919 |
+
unset( $params[ 'realm' ] );
|
| 920 |
+
}
|
| 921 |
+
}
|
| 922 |
+
|
| 923 |
+
return $params;
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
// helper to try to sort out headers for people who aren't running apache
|
| 927 |
+
public static function get_headers()
|
| 928 |
+
{
|
| 929 |
+
if ( function_exists( 'apache_request_headers' ) ) {
|
| 930 |
+
// we need this to get the actual Authorization: header
|
| 931 |
+
// because apache tends to tell us it doesn't exist
|
| 932 |
+
$headers = apache_request_headers();
|
| 933 |
+
|
| 934 |
+
// sanitize the output of apache_request_headers because
|
| 935 |
+
// we always want the keys to be Cased-Like-This and arh()
|
| 936 |
+
// returns the headers in the same case as they are in the
|
| 937 |
+
// request
|
| 938 |
+
$out = array();
|
| 939 |
+
foreach ( $headers AS $key => $value ) {
|
| 940 |
+
$key = str_replace(
|
| 941 |
+
" ",
|
| 942 |
+
"-",
|
| 943 |
+
ucwords( strtolower( str_replace( "-", " ", $key ) ) )
|
| 944 |
+
);
|
| 945 |
+
$out[ $key ] = $value;
|
| 946 |
+
}
|
| 947 |
+
} else {
|
| 948 |
+
// otherwise we don't have apache and are just going to have to hope
|
| 949 |
+
// that $_SERVER actually contains what we need
|
| 950 |
+
$out = array();
|
| 951 |
+
if ( isset( $_SERVER[ 'CONTENT_TYPE' ] ) )
|
| 952 |
+
$out[ 'Content-Type' ] = $_SERVER[ 'CONTENT_TYPE' ];
|
| 953 |
+
if ( isset( $_ENV[ 'CONTENT_TYPE' ] ) )
|
| 954 |
+
$out[ 'Content-Type' ] = $_ENV[ 'CONTENT_TYPE' ];
|
| 955 |
+
|
| 956 |
+
foreach ( $_SERVER as $key => $value ) {
|
| 957 |
+
if ( substr( $key, 0, 5 ) == "HTTP_" ) {
|
| 958 |
+
// this is chaos, basically it is just there to capitalize the first
|
| 959 |
+
// letter of every word that is not an initial HTTP and strip HTTP
|
| 960 |
+
// code from przemek
|
| 961 |
+
$key = str_replace(
|
| 962 |
+
" ",
|
| 963 |
+
"-",
|
| 964 |
+
ucwords( strtolower( str_replace( "_", " ", substr( $key, 5 ) ) ) )
|
| 965 |
+
);
|
| 966 |
+
$out[ $key ] = $value;
|
| 967 |
+
}
|
| 968 |
+
}
|
| 969 |
+
}
|
| 970 |
+
|
| 971 |
+
return $out;
|
| 972 |
+
}
|
| 973 |
+
|
| 974 |
+
// This function takes a input like a=b&a=c&d=e and returns the parsed
|
| 975 |
+
// parameters like this
|
| 976 |
+
// array('a' => array('b','c'), 'd' => 'e')
|
| 977 |
+
public static function parse_parameters( $input )
|
| 978 |
+
{
|
| 979 |
+
if ( !isset( $input ) || !$input ) return array();
|
| 980 |
+
|
| 981 |
+
$pairs = explode( '&', $input );
|
| 982 |
+
|
| 983 |
+
$parsed_parameters = array();
|
| 984 |
+
foreach ( $pairs as $pair ) {
|
| 985 |
+
$split = explode( '=', $pair, 2 );
|
| 986 |
+
$parameter = OAuthUtil::urldecode_rfc3986( $split[ 0 ] );
|
| 987 |
+
$value = isset( $split[ 1 ] ) ? OAuthUtil::urldecode_rfc3986( $split[ 1 ] ) : '';
|
| 988 |
+
|
| 989 |
+
if ( isset( $parsed_parameters[ $parameter ] ) ) {
|
| 990 |
+
// We have already recieved parameter(s) with this name, so add to the list
|
| 991 |
+
// of parameters with this name
|
| 992 |
+
|
| 993 |
+
if ( is_scalar( $parsed_parameters[ $parameter ] ) ) {
|
| 994 |
+
// This is the first duplicate, so transform scalar (string) into an array
|
| 995 |
+
// so we can add the duplicates
|
| 996 |
+
$parsed_parameters[ $parameter ] = array( $parsed_parameters[ $parameter ] );
|
| 997 |
+
}
|
| 998 |
+
|
| 999 |
+
$parsed_parameters[ $parameter ][ ] = $value;
|
| 1000 |
+
} else {
|
| 1001 |
+
$parsed_parameters[ $parameter ] = $value;
|
| 1002 |
+
}
|
| 1003 |
+
}
|
| 1004 |
+
|
| 1005 |
+
return $parsed_parameters;
|
| 1006 |
+
}
|
| 1007 |
+
|
| 1008 |
+
public static function build_http_query( $params )
|
| 1009 |
+
{
|
| 1010 |
+
if ( !$params ) return '';
|
| 1011 |
+
|
| 1012 |
+
// Urlencode both keys and values
|
| 1013 |
+
$keys = OAuthUtil::urlencode_rfc3986( array_keys( $params ) );
|
| 1014 |
+
$values = OAuthUtil::urlencode_rfc3986( array_values( $params ) );
|
| 1015 |
+
$params = array_combine( $keys, $values );
|
| 1016 |
+
|
| 1017 |
+
// Parameters are sorted by name, using lexicographical byte value ordering.
|
| 1018 |
+
// Ref: Spec: 9.1.1 (1)
|
| 1019 |
+
uksort( $params, 'strcmp' );
|
| 1020 |
+
|
| 1021 |
+
$pairs = array();
|
| 1022 |
+
foreach ( $params as $parameter => $value ) {
|
| 1023 |
+
if ( is_array( $value ) ) {
|
| 1024 |
+
// If two or more parameters share the same name, they are sorted by their value
|
| 1025 |
+
// Ref: Spec: 9.1.1 (1)
|
| 1026 |
+
// June 12th, 2010 - changed to sort because of issue 164 by hidetaka
|
| 1027 |
+
sort( $value, SORT_STRING );
|
| 1028 |
+
foreach ( $value as $duplicate_value ) {
|
| 1029 |
+
$pairs[ ] = $parameter . '=' . $duplicate_value;
|
| 1030 |
+
}
|
| 1031 |
+
} else {
|
| 1032 |
+
$pairs[ ] = $parameter . '=' . $value;
|
| 1033 |
+
}
|
| 1034 |
+
}
|
| 1035 |
+
|
| 1036 |
+
// For each parameter, the name is separated from the corresponding value by an '=' character (ASCII code 61)
|
| 1037 |
+
// Each name-value pair is separated by an '&' character (ASCII code 38)
|
| 1038 |
+
return implode( '&', $pairs );
|
| 1039 |
+
}
|
| 1040 |
+
}
|
| 1041 |
+
}
|
| 1042 |
+
//PayPal specific modification starts
|
| 1043 |
+
//Method to be called for generating signature
|
| 1044 |
+
require_once( "AuthUtil.php" );
|
| 1045 |
+
class AuthSignature
|
| 1046 |
+
{
|
| 1047 |
+
|
| 1048 |
+
public function genSign( $key, $secret, $token, $tokenSecret, $httpMethod, $endpoint )
|
| 1049 |
+
{
|
| 1050 |
+
|
| 1051 |
+
|
| 1052 |
+
$authServer = new OAuthServer( new MockOAuthDataStore() );
|
| 1053 |
+
$hmac_method = new OAuthSignatureMethod_HMAC_SHA1();
|
| 1054 |
+
$authServer->add_signature_method( $hmac_method );
|
| 1055 |
+
|
| 1056 |
+
$sig_method = $hmac_method;
|
| 1057 |
+
$authConsumer = new OAuthConsumer( $key, $secret, null );
|
| 1058 |
+
$authToken = null;
|
| 1059 |
+
$authToken = new OAuthToken( $token, $tokenSecret );
|
| 1060 |
+
|
| 1061 |
+
//$params is the query param array which is required only in the httpMethod is "GET"
|
| 1062 |
+
|
| 1063 |
+
$params = array();
|
| 1064 |
+
//set the Query parameters to $params if httpMethod is "GET"
|
| 1065 |
+
|
| 1066 |
+
$acc_req = OAuthRequest::from_consumer_and_token( $authConsumer, $authToken, $httpMethod, $endpoint, $params );
|
| 1067 |
+
|
| 1068 |
+
$acc_req->sign_request( $sig_method, $authConsumer, $authToken );
|
| 1069 |
+
$response = OAuthutil::parseQueryString( $acc_req );
|
| 1070 |
+
|
| 1071 |
+
return $response;
|
| 1072 |
+
|
| 1073 |
+
}
|
| 1074 |
+
}
|
| 1075 |
+
|
| 1076 |
+
|
| 1077 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/cacert.pem
ADDED
|
@@ -0,0 +1,171 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Verisign Class 3 Public Primary Certification Authority
|
| 2 |
+
=======================================================
|
| 3 |
+
-----BEGIN CERTIFICATE-----
|
| 4 |
+
MIICPDCCAaUCEHC65B0Q2Sk0tjjKewPMur8wDQYJKoZIhvcNAQECBQAwXzELMAkGA1UEBhMCVVMx
|
| 5 |
+
FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
|
| 6 |
+
IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMTIzNTk1OVow
|
| 7 |
+
XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
|
| 8 |
+
IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
|
| 9 |
+
A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
|
| 10 |
+
f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
|
| 11 |
+
hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBAgUAA4GBALtMEivPLCYA
|
| 12 |
+
TxQT3ab7/AoRhIzzKBxnki98tsX63/Dolbwdj2wsqFHMc9ikwFPwTtYmwHYBV4GSXiHx0bH/59Ah
|
| 13 |
+
WM1pF+NEHJwZRDmJXNycAA9WjQKZ7aKQRUzkuxCkPfAyAw7xzvjoyVGM5mKf5p/AfbdynMk2Omuf
|
| 14 |
+
Tqj/ZA1k
|
| 15 |
+
-----END CERTIFICATE-----
|
| 16 |
+
|
| 17 |
+
Verisign Class 3 Public Primary Certification Authority - G2
|
| 18 |
+
============================================================
|
| 19 |
+
-----BEGIN CERTIFICATE-----
|
| 20 |
+
MIIDAjCCAmsCEH3Z/gfPqB63EHln+6eJNMYwDQYJKoZIhvcNAQEFBQAwgcExCzAJBgNVBAYTAlVT
|
| 21 |
+
MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
|
| 22 |
+
eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
|
| 23 |
+
biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
|
| 24 |
+
dCBOZXR3b3JrMB4XDTk4MDUxODAwMDAwMFoXDTI4MDgwMTIzNTk1OVowgcExCzAJBgNVBAYTAlVT
|
| 25 |
+
MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
|
| 26 |
+
eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
|
| 27 |
+
biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
|
| 28 |
+
dCBOZXR3b3JrMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDMXtERXVxp0KvTuWpMmR9ZmDCO
|
| 29 |
+
FoUgRm1HP9SFIIThbbP4pO0M8RcPO/mn+SXXwc+EY/J8Y8+iR/LGWzOOZEAEaMGAuWQcRXfH2G71
|
| 30 |
+
lSk8UOg013gfqLptQ5GVj0VXXn7F+8qkBOvqlzdUMG+7AUcyM83cV5tkaWH4mx0ciU9cZwIDAQAB
|
| 31 |
+
MA0GCSqGSIb3DQEBBQUAA4GBAFFNzb5cy5gZnBWyATl4Lk0PZ3BwmcYQWpSkU01UbSuvDV1Ai2TT
|
| 32 |
+
1+7eVmGSX6bEHRBhNtMsJzzoKQm5EWR0zLVznxxIqbxhAe7iF6YM40AIOw7n60RzKprxaZLvcRTD
|
| 33 |
+
Oaxxp5EJb+RxBrO6WVcmeQD2+A2iMzAo1KpYoJ2daZH9
|
| 34 |
+
-----END CERTIFICATE-----
|
| 35 |
+
|
| 36 |
+
|
| 37 |
+
Verisign Class 3 Public Primary Certification Authority - G3
|
| 38 |
+
============================================================
|
| 39 |
+
-----BEGIN CERTIFICATE-----
|
| 40 |
+
MIIEGjCCAwICEQCbfgZJoz5iudXukEhxKe9XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
|
| 41 |
+
UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
|
| 42 |
+
cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
|
| 43 |
+
IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
|
| 44 |
+
dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
|
| 45 |
+
CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
|
| 46 |
+
dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
|
| 47 |
+
cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkg
|
| 48 |
+
Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
|
| 49 |
+
ggEBAMu6nFL8eB8aHm8bN3O9+MlrlBIwT/A2R/XQkQr1F8ilYcEWQE37imGQ5XYgwREGfassbqb1
|
| 50 |
+
EUGO+i2tKmFZpGcmTNDovFJbcCAEWNF6yaRpvIMXZK0Fi7zQWM6NjPXr8EJJC52XJ2cybuGukxUc
|
| 51 |
+
cLwgTS8Y3pKI6GyFVxEa6X7jJhFUokWWVYPKMIno3Nij7SqAP395ZVc+FSBmCC+Vk7+qRy+oRpfw
|
| 52 |
+
EuL+wgorUeZ25rdGt+INpsyow0xZVYnm6FNcHOqd8GIWC6fJXwzw3sJ2zq/3avL6QaaiMxTJ5Xpj
|
| 53 |
+
055iN9WFZZ4O5lMkdBteHRJTW8cs54NJOxWuimi5V5cCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
|
| 54 |
+
ERSWwauSCPc/L8my/uRan2Te2yFPhpk0djZX3dAVL8WtfxUfN2JzPtTnX84XA9s1+ivbrmAJXx5f
|
| 55 |
+
j267Cz3qWhMeDGBvtcC1IyIuBwvLqXTLR7sdwdela8wv0kL9Sd2nic9TutoAWii/gt/4uhMdUIaC
|
| 56 |
+
/Y4wjylGsB49Ndo4YhYYSq3mtlFs3q9i6wHQHiT+eo8SGhJouPtmmRQURVyu565pF4ErWjfJXir0
|
| 57 |
+
xuKhXFSbplQAz/DxwceYMBo7Nhbbo27q/a2ywtrvAkcTisDxszGtTxzhT5yvDwyd93gN2PQ1VoDa
|
| 58 |
+
t20Xj50egWTh/sVFuq1ruQp6Tk9LhO5L8X3dEQ==
|
| 59 |
+
-----END CERTIFICATE-----
|
| 60 |
+
|
| 61 |
+
Verisign Class 4 Public Primary Certification Authority - G3
|
| 62 |
+
============================================================
|
| 63 |
+
-----BEGIN CERTIFICATE-----
|
| 64 |
+
MIIEGjCCAwICEQDsoKeLbnVqAc/EfMwvlF7XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
|
| 65 |
+
UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
|
| 66 |
+
cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
|
| 67 |
+
IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
|
| 68 |
+
dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
|
| 69 |
+
CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
|
| 70 |
+
dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
|
| 71 |
+
cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkg
|
| 72 |
+
Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
|
| 73 |
+
ggEBAK3LpRFpxlmr8Y+1GQ9Wzsy1HyDkniYlS+BzZYlZ3tCD5PUPtbut8XzoIfzk6AzufEUiGXaS
|
| 74 |
+
tBO3IFsJ+mGuqPKljYXCKtbeZjbSmwL0qJJgfJxptI8kHtCGUvYynEFYHiK9zUVilQhu0GbdU6LM
|
| 75 |
+
8BDcVHOLBKFGMzNcF0C5nk3T875Vg+ixiY5afJqWIpA7iCXy0lOIAgwLePLmNxdLMEYH5IBtptiW
|
| 76 |
+
Lugs+BGzOA1mppvqySNb247i8xOOGlktqgLw7KSHZtzBP/XYufTsgsbSPZUd5cBPhMnZo0QoBmrX
|
| 77 |
+
Razwa2rvTl/4EYIeOGM0ZlDUPpNz+jDDZq3/ky2X7wMCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
|
| 78 |
+
j/ola09b5KROJ1WrIhVZPMq1CtRK26vdoV9TxaBXOcLORyu+OshWv8LZJxA6sQU8wHcxuzrTBXtt
|
| 79 |
+
mhwwjIDLk5Mqg6sFUYICABFna/OIYUdfA5PVWw3g8dShMjWFsjrbsIKr0csKvE+MW8VLADsfKoKm
|
| 80 |
+
fjaF3H48ZwC15DtS4KjrXRX5xm3wrR0OhbepmnMUWluPQSjA1egtTaRezarZ7c7c2NU8Qh0XwRJd
|
| 81 |
+
RTjDOPP8hS6DRkiy1yBfkjaP53kPmF6Z6PDQpLv1U70qzlmwr25/bLvSHgCwIe34QWKCudiyxLtG
|
| 82 |
+
UPMxxY8BqHTr9Xgn2uf3ZkPznoM+IKrDNWCRzg==
|
| 83 |
+
-----END CERTIFICATE-----
|
| 84 |
+
VeriSign Class 3 Public Primary Certification Authority - G5
|
| 85 |
+
============================================================
|
| 86 |
+
-----BEGIN CERTIFICATE-----
|
| 87 |
+
MIIE0zCCA7ugAwIBAgIQGNrRniZ96LtKIVjNzGs7SjANBgkqhkiG9w0BAQUFADCByjELMAkGA1UE
|
| 88 |
+
BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
|
| 89 |
+
ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
|
| 90 |
+
IHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRp
|
| 91 |
+
ZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwHhcNMDYxMTA4MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCB
|
| 92 |
+
yjELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2ln
|
| 93 |
+
biBUcnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBh
|
| 94 |
+
dXRob3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmlt
|
| 95 |
+
YXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
|
| 96 |
+
ggEKAoIBAQCvJAgIKXo1nmAMqudLO07cfLw8RRy7K+D+KQL5VwijZIUVJ/XxrcgxiV0i6CqqpkKz
|
| 97 |
+
j/i5Vbext0uz/o9+B1fs70PbZmIVYc9gDaTY3vjgw2IIPVQT60nKWVSFJuUrjxuf6/WhkcIzSdhD
|
| 98 |
+
Y2pSS9KP6HBRTdGJaXvHcPaz3BJ023tdS1bTlr8Vd6Gw9KIl8q8ckmcY5fQGBO+QueQA5N06tRn/
|
| 99 |
+
Arr0PO7gi+s3i+z016zy9vA9r911kTMZHRxAy3QkGSGT2RT+rCpSx4/VBEnkjWNHiDxpg8v+R70r
|
| 100 |
+
fk/Fla4OndTRQ8Bnc+MUCH7lP59zuDMKz10/NIeWiu5T6CUVAgMBAAGjgbIwga8wDwYDVR0TAQH/
|
| 101 |
+
BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2Uv
|
| 102 |
+
Z2lmMCEwHzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVy
|
| 103 |
+
aXNpZ24uY29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFH/TZafC3ey78DAJ80M5+gKvMzEzMA0GCSqG
|
| 104 |
+
SIb3DQEBBQUAA4IBAQCTJEowX2LP2BqYLz3q3JktvXf2pXkiOOzEp6B4Eq1iDkVwZMXnl2YtmAl+
|
| 105 |
+
X6/WzChl8gGqCBpH3vn5fJJaCGkgDdk+bW48DW7Y5gaRQBi5+MHt39tBquCWIMnNZBU4gcmU7qKE
|
| 106 |
+
KQsTb47bDN0lAtukixlE0kF6BWlKWE9gyn6CagsCqiUXObXbf+eEZSqVir2G3l6BFoMtEMze/aiC
|
| 107 |
+
Km0oHw0LxOXnGiYZ4fQRbxC1lfznQgUy286dUV4otp6F01vvpX1FQHKOtw5rDgb7MzVIcbidJ4vE
|
| 108 |
+
ZV8NhnacRHr2lVz2XTIIM6RUthg/aFzyQkqFOFSDX9HoLPKsEdao7WNq
|
| 109 |
+
-----END CERTIFICATE-----
|
| 110 |
+
VeriSign Universal Root Certification Authority
|
| 111 |
+
===============================================
|
| 112 |
+
-----BEGIN CERTIFICATE-----
|
| 113 |
+
MIIEuTCCA6GgAwIBAgIQQBrEZCGzEyEDDrvkEhrFHTANBgkqhkiG9w0BAQsFADCBvTELMAkGA1UE
|
| 114 |
+
BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
|
| 115 |
+
ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwOCBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
|
| 116 |
+
IHVzZSBvbmx5MTgwNgYDVQQDEy9WZXJpU2lnbiBVbml2ZXJzYWwgUm9vdCBDZXJ0aWZpY2F0aW9u
|
| 117 |
+
IEF1dGhvcml0eTAeFw0wODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIG9MQswCQYDVQQGEwJV
|
| 118 |
+
UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
|
| 119 |
+
cmsxOjA4BgNVBAsTMShjKSAyMDA4IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
|
| 120 |
+
IG9ubHkxODA2BgNVBAMTL1ZlcmlTaWduIFVuaXZlcnNhbCBSb290IENlcnRpZmljYXRpb24gQXV0
|
| 121 |
+
aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAx2E3XrEBNNti1xWb/1hajCMj
|
| 122 |
+
1mCOkdeQmIN65lgZOIzF9uVkhbSicfvtvbnazU0AtMgtc6XHaXGVHzk8skQHnOgO+k1KxCHfKWGP
|
| 123 |
+
MiJhgsWHH26MfF8WIFFE0XBPV+rjHOPMee5Y2A7Cs0WTwCznmhcrewA3ekEzeOEz4vMQGn+HLL72
|
| 124 |
+
9fdC4uW/h2KJXwBL38Xd5HVEMkE6HnFuacsLdUYI0crSK5XQz/u5QGtkjFdN/BMReYTtXlT2NJ8I
|
| 125 |
+
AfMQJQYXStrxHXpma5hgZqTZ79IugvHw7wnqRMkVauIDbjPTrJ9VAMf2CGqUuV/c4DPxhGD5WycR
|
| 126 |
+
tPwW8rtWaoAljQIDAQABo4GyMIGvMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMG0G
|
| 127 |
+
CCsGAQUFBwEMBGEwX6FdoFswWTBXMFUWCWltYWdlL2dpZjAhMB8wBwYFKw4DAhoEFI/l0xqGrI2O
|
| 128 |
+
a8PPgGrUSBgsexkuMCUWI2h0dHA6Ly9sb2dvLnZlcmlzaWduLmNvbS92c2xvZ28uZ2lmMB0GA1Ud
|
| 129 |
+
DgQWBBS2d/ppSEefUxLVwuoHMnYH0ZcHGTANBgkqhkiG9w0BAQsFAAOCAQEASvj4sAPmLGd75JR3
|
| 130 |
+
Y8xuTPl9Dg3cyLk1uXBPY/ok+myDjEedO2Pzmvl2MpWRsXe8rJq+seQxIcaBlVZaDrHC1LGmWazx
|
| 131 |
+
Y8u4TB1ZkErvkBYoH1quEPuBUDgMbMzxPcP1Y+Oz4yHJJDnp/RVmRvQbEdBNc6N9Rvk97ahfYtTx
|
| 132 |
+
P/jgdFcrGJ2BtMQo2pSXpXDrrB2+BxHw1dvd5Yzw1TKwg+ZX4o+/vqGqvz0dtdQ46tewXDpPaj+P
|
| 133 |
+
wGZsY6rp2aQW9IHRlRQOfc2VNNnSj3BzgXucfr2YYdhFh5iQxeuGMMY1v/D/w1WIg0vvBZIGcfK4
|
| 134 |
+
mJO37M2CYfE45k+XmCpajQ==
|
| 135 |
+
-----END CERTIFICATE-----
|
| 136 |
+
|
| 137 |
+
VeriSign Class 3 Public Primary Certification Authority - G4
|
| 138 |
+
============================================================
|
| 139 |
+
-----BEGIN CERTIFICATE-----
|
| 140 |
+
MIIDhDCCAwqgAwIBAgIQL4D+I4wOIg9IZxIokYesszAKBggqhkjOPQQDAzCByjELMAkGA1UEBhMC
|
| 141 |
+
VVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBOZXR3
|
| 142 |
+
b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVz
|
| 143 |
+
ZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRpZmlj
|
| 144 |
+
YXRpb24gQXV0aG9yaXR5IC0gRzQwHhcNMDcxMTA1MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCByjEL
|
| 145 |
+
MAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBU
|
| 146 |
+
cnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRo
|
| 147 |
+
b3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5
|
| 148 |
+
IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzQwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAASnVnp8
|
| 149 |
+
Utpkmw4tXNherJI9/gHmGUo9FANL+mAnINmDiWn6VMaaGF5VKmTeBvaNSjutEDxlPZCIBIngMGGz
|
| 150 |
+
rl0Bp3vefLK+ymVhAIau2o970ImtTR1ZmkGxvEeA3J5iw/mjgbIwga8wDwYDVR0TAQH/BAUwAwEB
|
| 151 |
+
/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2UvZ2lmMCEw
|
| 152 |
+
HzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVyaXNpZ24u
|
| 153 |
+
Y29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFLMWkf3upm7ktS5Jj4d4gYDs5bG1MAoGCCqGSM49BAMD
|
| 154 |
+
A2gAMGUCMGYhDBgmYFo4e1ZC4Kf8NoRRkSAsdk1DPcQdhCPQrNZ8NQbOzWm9kA3bbEhCHQ6qQgIx
|
| 155 |
+
AJw9SDkjOVgaFRJZap7v1VmyHVIsmXHNxynfGyphe3HR3vPA5Q06Sqotp9iGKt0uEA==
|
| 156 |
+
-----END CERTIFICATE-----
|
| 157 |
+
Verisign Class 3 Public Primary Certification Authority
|
| 158 |
+
=======================================================
|
| 159 |
+
-----BEGIN CERTIFICATE-----
|
| 160 |
+
MIICPDCCAaUCEDyRMcsf9tAbDpq40ES/Er4wDQYJKoZIhvcNAQEFBQAwXzELMAkGA1UEBhMCVVMx
|
| 161 |
+
FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
|
| 162 |
+
IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMjIzNTk1OVow
|
| 163 |
+
XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
|
| 164 |
+
IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
|
| 165 |
+
A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
|
| 166 |
+
f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
|
| 167 |
+
hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBBQUAA4GBABByUqkFFBky
|
| 168 |
+
CEHwxWsKzH4PIRnN5GfcX6kb5sroc50i2JhucwNhkcV8sEVAbkSdjbCxlnRhLQ2pRdKkkirWmnWX
|
| 169 |
+
bj9T/UWZYB2oK0z5XqcJ2HUw19JlYD1n1khVdWk/kfVIC0dpImmClr7JyDiGSnoscxlIaU5rfGW/
|
| 170 |
+
D/xwzoiQ
|
| 171 |
+
-----END CERTIFICATE-----
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConfigurationException.php
ADDED
|
@@ -0,0 +1,9 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class PPConfigurationException extends Exception
|
| 3 |
+
{
|
| 4 |
+
|
| 5 |
+
public function __construct( $message = null, $code = 0 )
|
| 6 |
+
{
|
| 7 |
+
parent::__construct( $message, $code );
|
| 8 |
+
}
|
| 9 |
+
}
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPConnectionException.php
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class PPConnectionException extends Exception
|
| 3 |
+
{
|
| 4 |
+
/**
|
| 5 |
+
* The url that was being connected to when the exception occured
|
| 6 |
+
* @var string
|
| 7 |
+
*/
|
| 8 |
+
private $url;
|
| 9 |
+
|
| 10 |
+
public function __construct( $url, $message, $code = 0 )
|
| 11 |
+
{
|
| 12 |
+
parent::__construct( $message, $code );
|
| 13 |
+
$this->url = $url;
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
public function getUrl()
|
| 17 |
+
{
|
| 18 |
+
return $this->url;
|
| 19 |
+
}
|
| 20 |
+
}
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPInvalidCredentialException.php
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
|
| 4 |
+
class PPInvalidCredentialException extends Exception
|
| 5 |
+
{
|
| 6 |
+
|
| 7 |
+
public function __construct( $message = null, $code = 0 )
|
| 8 |
+
{
|
| 9 |
+
parent::__construct( $message, $code );
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
public function errorMessage()
|
| 13 |
+
{
|
| 14 |
+
$errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
|
| 15 |
+
. ': <b>' . $this->getMessage() . '</b>';
|
| 16 |
+
|
| 17 |
+
return $errorMsg;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPMissingCredentialException.php
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
|
| 4 |
+
class PPMissingCredentialException extends Exception
|
| 5 |
+
{
|
| 6 |
+
|
| 7 |
+
public function __construct( $message = null, $code = 0 )
|
| 8 |
+
{
|
| 9 |
+
parent::__construct( $message, $code );
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
public function errorMessage()
|
| 13 |
+
{
|
| 14 |
+
$errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
|
| 15 |
+
. ': <b>' . $this->getMessage() . '</b>';
|
| 16 |
+
|
| 17 |
+
return $errorMsg;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/exceptions/PPTransformerException.php
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class PPTransformerException extends Exception
|
| 3 |
+
{
|
| 4 |
+
|
| 5 |
+
public function __construct( $message = null, $code = 0 )
|
| 6 |
+
{
|
| 7 |
+
parent::__construct( $message, $code );
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
public function errorMessage()
|
| 11 |
+
{
|
| 12 |
+
$errorMsg = 'Error on line ' . $this->getLine() . ' in ' . $this->getFile()
|
| 13 |
+
. ': <b>' . $this->getMessage() . '</b>';
|
| 14 |
+
|
| 15 |
+
return $errorMsg;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePayments.php
ADDED
|
@@ -0,0 +1,5797 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Stub objects for AdaptivePayments
|
| 4 |
+
* Auto generated code
|
| 5 |
+
*
|
| 6 |
+
*/
|
| 7 |
+
require_once( 'PPUtils.php' );
|
| 8 |
+
/**
|
| 9 |
+
*
|
| 10 |
+
*/
|
| 11 |
+
class AccountIdentifier
|
| 12 |
+
{
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
*
|
| 16 |
+
* @access public
|
| 17 |
+
* @var string
|
| 18 |
+
*/
|
| 19 |
+
public $email;
|
| 20 |
+
|
| 21 |
+
/**
|
| 22 |
+
*
|
| 23 |
+
* @access public
|
| 24 |
+
* @var PhoneNumberType
|
| 25 |
+
*/
|
| 26 |
+
public $phone;
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
public function toNVPString( $prefix = '' )
|
| 30 |
+
{
|
| 31 |
+
$str = '';
|
| 32 |
+
$delim = '';
|
| 33 |
+
if ( $this->email != null ) {
|
| 34 |
+
$str .= $delim . $prefix . 'email=' . urlencode( $this->email );
|
| 35 |
+
$delim = '&';
|
| 36 |
+
}
|
| 37 |
+
if ( $this->phone != null ) {
|
| 38 |
+
$newPrefix = $prefix . 'phone.';
|
| 39 |
+
$str .= $delim . call_user_func( array( $this->phone, 'toNVPString' ), $newPrefix );
|
| 40 |
+
$delim = '&';
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
return $str;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
public function init( $map = null, $prefix = '' )
|
| 47 |
+
{
|
| 48 |
+
if ( $map != null ) {
|
| 49 |
+
$mapKeyName = $prefix . 'email';
|
| 50 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 51 |
+
$this->email = $map[ $mapKeyName ];
|
| 52 |
+
}
|
| 53 |
+
if ( PPUtils::array_match_key( $map, $prefix . "phone." ) ) {
|
| 54 |
+
$newPrefix = $prefix . "phone.";
|
| 55 |
+
$this->phone = new PhoneNumberType();
|
| 56 |
+
$this->phone->init( $map, $newPrefix );
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
*
|
| 66 |
+
*/
|
| 67 |
+
class BaseAddress
|
| 68 |
+
{
|
| 69 |
+
|
| 70 |
+
/**
|
| 71 |
+
*
|
| 72 |
+
* @access public
|
| 73 |
+
* @var string
|
| 74 |
+
*/
|
| 75 |
+
public $line1;
|
| 76 |
+
|
| 77 |
+
/**
|
| 78 |
+
*
|
| 79 |
+
* @access public
|
| 80 |
+
* @var string
|
| 81 |
+
*/
|
| 82 |
+
public $line2;
|
| 83 |
+
|
| 84 |
+
/**
|
| 85 |
+
*
|
| 86 |
+
* @access public
|
| 87 |
+
* @var string
|
| 88 |
+
*/
|
| 89 |
+
public $city;
|
| 90 |
+
|
| 91 |
+
/**
|
| 92 |
+
*
|
| 93 |
+
* @access public
|
| 94 |
+
* @var string
|
| 95 |
+
*/
|
| 96 |
+
public $state;
|
| 97 |
+
|
| 98 |
+
/**
|
| 99 |
+
*
|
| 100 |
+
* @access public
|
| 101 |
+
* @var string
|
| 102 |
+
*/
|
| 103 |
+
public $postalCode;
|
| 104 |
+
|
| 105 |
+
/**
|
| 106 |
+
*
|
| 107 |
+
* @access public
|
| 108 |
+
* @var string
|
| 109 |
+
*/
|
| 110 |
+
public $countryCode;
|
| 111 |
+
|
| 112 |
+
/**
|
| 113 |
+
*
|
| 114 |
+
* @access public
|
| 115 |
+
* @var string
|
| 116 |
+
*/
|
| 117 |
+
public $type;
|
| 118 |
+
|
| 119 |
+
|
| 120 |
+
public function init( $map = null, $prefix = '' )
|
| 121 |
+
{
|
| 122 |
+
if ( $map != null ) {
|
| 123 |
+
$mapKeyName = $prefix . 'line1';
|
| 124 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 125 |
+
$this->line1 = $map[ $mapKeyName ];
|
| 126 |
+
}
|
| 127 |
+
$mapKeyName = $prefix . 'line2';
|
| 128 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 129 |
+
$this->line2 = $map[ $mapKeyName ];
|
| 130 |
+
}
|
| 131 |
+
$mapKeyName = $prefix . 'city';
|
| 132 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 133 |
+
$this->city = $map[ $mapKeyName ];
|
| 134 |
+
}
|
| 135 |
+
$mapKeyName = $prefix . 'state';
|
| 136 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 137 |
+
$this->state = $map[ $mapKeyName ];
|
| 138 |
+
}
|
| 139 |
+
$mapKeyName = $prefix . 'postalCode';
|
| 140 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 141 |
+
$this->postalCode = $map[ $mapKeyName ];
|
| 142 |
+
}
|
| 143 |
+
$mapKeyName = $prefix . 'countryCode';
|
| 144 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 145 |
+
$this->countryCode = $map[ $mapKeyName ];
|
| 146 |
+
}
|
| 147 |
+
$mapKeyName = $prefix . 'type';
|
| 148 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 149 |
+
$this->type = $map[ $mapKeyName ];
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
}
|
| 153 |
+
}
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
|
| 157 |
+
/**
|
| 158 |
+
* Details about the end user of the application invoking this
|
| 159 |
+
* service.
|
| 160 |
+
*/
|
| 161 |
+
class ClientDetailsType
|
| 162 |
+
{
|
| 163 |
+
|
| 164 |
+
/**
|
| 165 |
+
*
|
| 166 |
+
* @access public
|
| 167 |
+
* @var string
|
| 168 |
+
*/
|
| 169 |
+
public $ipAddress;
|
| 170 |
+
|
| 171 |
+
/**
|
| 172 |
+
*
|
| 173 |
+
* @access public
|
| 174 |
+
* @var string
|
| 175 |
+
*/
|
| 176 |
+
public $deviceId;
|
| 177 |
+
|
| 178 |
+
/**
|
| 179 |
+
*
|
| 180 |
+
* @access public
|
| 181 |
+
* @var string
|
| 182 |
+
*/
|
| 183 |
+
public $applicationId;
|
| 184 |
+
|
| 185 |
+
/**
|
| 186 |
+
*
|
| 187 |
+
* @access public
|
| 188 |
+
* @var string
|
| 189 |
+
*/
|
| 190 |
+
public $model;
|
| 191 |
+
|
| 192 |
+
/**
|
| 193 |
+
*
|
| 194 |
+
* @access public
|
| 195 |
+
* @var string
|
| 196 |
+
*/
|
| 197 |
+
public $geoLocation;
|
| 198 |
+
|
| 199 |
+
/**
|
| 200 |
+
*
|
| 201 |
+
* @access public
|
| 202 |
+
* @var string
|
| 203 |
+
*/
|
| 204 |
+
public $customerType;
|
| 205 |
+
|
| 206 |
+
/**
|
| 207 |
+
*
|
| 208 |
+
* @access public
|
| 209 |
+
* @var string
|
| 210 |
+
*/
|
| 211 |
+
public $partnerName;
|
| 212 |
+
|
| 213 |
+
/**
|
| 214 |
+
*
|
| 215 |
+
* @access public
|
| 216 |
+
* @var string
|
| 217 |
+
*/
|
| 218 |
+
public $customerId;
|
| 219 |
+
|
| 220 |
+
|
| 221 |
+
public function toNVPString( $prefix = '' )
|
| 222 |
+
{
|
| 223 |
+
$str = '';
|
| 224 |
+
$delim = '';
|
| 225 |
+
if ( $this->ipAddress != null ) {
|
| 226 |
+
$str .= $delim . $prefix . 'ipAddress=' . urlencode( $this->ipAddress );
|
| 227 |
+
$delim = '&';
|
| 228 |
+
}
|
| 229 |
+
if ( $this->deviceId != null ) {
|
| 230 |
+
$str .= $delim . $prefix . 'deviceId=' . urlencode( $this->deviceId );
|
| 231 |
+
$delim = '&';
|
| 232 |
+
}
|
| 233 |
+
if ( $this->applicationId != null ) {
|
| 234 |
+
$str .= $delim . $prefix . 'applicationId=' . urlencode( $this->applicationId );
|
| 235 |
+
$delim = '&';
|
| 236 |
+
}
|
| 237 |
+
if ( $this->model != null ) {
|
| 238 |
+
$str .= $delim . $prefix . 'model=' . urlencode( $this->model );
|
| 239 |
+
$delim = '&';
|
| 240 |
+
}
|
| 241 |
+
if ( $this->geoLocation != null ) {
|
| 242 |
+
$str .= $delim . $prefix . 'geoLocation=' . urlencode( $this->geoLocation );
|
| 243 |
+
$delim = '&';
|
| 244 |
+
}
|
| 245 |
+
if ( $this->customerType != null ) {
|
| 246 |
+
$str .= $delim . $prefix . 'customerType=' . urlencode( $this->customerType );
|
| 247 |
+
$delim = '&';
|
| 248 |
+
}
|
| 249 |
+
if ( $this->partnerName != null ) {
|
| 250 |
+
$str .= $delim . $prefix . 'partnerName=' . urlencode( $this->partnerName );
|
| 251 |
+
$delim = '&';
|
| 252 |
+
}
|
| 253 |
+
if ( $this->customerId != null ) {
|
| 254 |
+
$str .= $delim . $prefix . 'customerId=' . urlencode( $this->customerId );
|
| 255 |
+
$delim = '&';
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
return $str;
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
}
|
| 262 |
+
|
| 263 |
+
|
| 264 |
+
/**
|
| 265 |
+
*
|
| 266 |
+
*/
|
| 267 |
+
class CurrencyType
|
| 268 |
+
{
|
| 269 |
+
|
| 270 |
+
/**
|
| 271 |
+
*
|
| 272 |
+
* @access public
|
| 273 |
+
* @var string
|
| 274 |
+
*/
|
| 275 |
+
public $code;
|
| 276 |
+
|
| 277 |
+
/**
|
| 278 |
+
*
|
| 279 |
+
* @access public
|
| 280 |
+
* @var double
|
| 281 |
+
*/
|
| 282 |
+
public $amount;
|
| 283 |
+
|
| 284 |
+
/**
|
| 285 |
+
* Constructor with arguments
|
| 286 |
+
*/
|
| 287 |
+
public function __construct( $code = null, $amount = null )
|
| 288 |
+
{
|
| 289 |
+
$this->code = $code;
|
| 290 |
+
$this->amount = $amount;
|
| 291 |
+
}
|
| 292 |
+
|
| 293 |
+
|
| 294 |
+
public function toNVPString( $prefix = '' )
|
| 295 |
+
{
|
| 296 |
+
$str = '';
|
| 297 |
+
$delim = '';
|
| 298 |
+
if ( $this->code != null ) {
|
| 299 |
+
$str .= $delim . $prefix . 'code=' . urlencode( $this->code );
|
| 300 |
+
$delim = '&';
|
| 301 |
+
}
|
| 302 |
+
if ( $this->amount != null ) {
|
| 303 |
+
$str .= $delim . $prefix . 'amount=' . urlencode( $this->amount );
|
| 304 |
+
$delim = '&';
|
| 305 |
+
}
|
| 306 |
+
|
| 307 |
+
return $str;
|
| 308 |
+
}
|
| 309 |
+
|
| 310 |
+
public function init( $map = null, $prefix = '' )
|
| 311 |
+
{
|
| 312 |
+
if ( $map != null ) {
|
| 313 |
+
$mapKeyName = $prefix . 'code';
|
| 314 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 315 |
+
$this->code = $map[ $mapKeyName ];
|
| 316 |
+
}
|
| 317 |
+
$mapKeyName = $prefix . 'amount';
|
| 318 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 319 |
+
$this->amount = $map[ $mapKeyName ];
|
| 320 |
+
}
|
| 321 |
+
|
| 322 |
+
}
|
| 323 |
+
}
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
|
| 327 |
+
/**
|
| 328 |
+
* This type contains the detailed error information resulting
|
| 329 |
+
* from the service operation.
|
| 330 |
+
*/
|
| 331 |
+
class ErrorData
|
| 332 |
+
{
|
| 333 |
+
|
| 334 |
+
/**
|
| 335 |
+
*
|
| 336 |
+
* @access public
|
| 337 |
+
* @var integer
|
| 338 |
+
*/
|
| 339 |
+
public $errorId;
|
| 340 |
+
|
| 341 |
+
/**
|
| 342 |
+
*
|
| 343 |
+
* @access public
|
| 344 |
+
* @var string
|
| 345 |
+
*/
|
| 346 |
+
public $domain;
|
| 347 |
+
|
| 348 |
+
/**
|
| 349 |
+
*
|
| 350 |
+
* @access public
|
| 351 |
+
* @var string
|
| 352 |
+
*/
|
| 353 |
+
public $subdomain;
|
| 354 |
+
|
| 355 |
+
/**
|
| 356 |
+
*
|
| 357 |
+
* @access public
|
| 358 |
+
* @var ErrorSeverity
|
| 359 |
+
*/
|
| 360 |
+
public $severity;
|
| 361 |
+
|
| 362 |
+
/**
|
| 363 |
+
*
|
| 364 |
+
* @access public
|
| 365 |
+
* @var ErrorCategory
|
| 366 |
+
*/
|
| 367 |
+
public $category;
|
| 368 |
+
|
| 369 |
+
/**
|
| 370 |
+
*
|
| 371 |
+
* @access public
|
| 372 |
+
* @var string
|
| 373 |
+
*/
|
| 374 |
+
public $message;
|
| 375 |
+
|
| 376 |
+
/**
|
| 377 |
+
*
|
| 378 |
+
* @access public
|
| 379 |
+
* @var string
|
| 380 |
+
*/
|
| 381 |
+
public $exceptionId;
|
| 382 |
+
|
| 383 |
+
/**
|
| 384 |
+
*
|
| 385 |
+
* @array
|
| 386 |
+
* @access public
|
| 387 |
+
* @var ErrorParameter
|
| 388 |
+
*/
|
| 389 |
+
public $parameter;
|
| 390 |
+
|
| 391 |
+
|
| 392 |
+
public function init( $map = null, $prefix = '' )
|
| 393 |
+
{
|
| 394 |
+
if ( $map != null ) {
|
| 395 |
+
$mapKeyName = $prefix . 'errorId';
|
| 396 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 397 |
+
$this->errorId = $map[ $mapKeyName ];
|
| 398 |
+
}
|
| 399 |
+
$mapKeyName = $prefix . 'domain';
|
| 400 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 401 |
+
$this->domain = $map[ $mapKeyName ];
|
| 402 |
+
}
|
| 403 |
+
$mapKeyName = $prefix . 'subdomain';
|
| 404 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 405 |
+
$this->subdomain = $map[ $mapKeyName ];
|
| 406 |
+
}
|
| 407 |
+
$mapKeyName = $prefix . 'severity';
|
| 408 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 409 |
+
$this->severity = $map[ $mapKeyName ];
|
| 410 |
+
}
|
| 411 |
+
$mapKeyName = $prefix . 'category';
|
| 412 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 413 |
+
$this->category = $map[ $mapKeyName ];
|
| 414 |
+
}
|
| 415 |
+
$mapKeyName = $prefix . 'message';
|
| 416 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 417 |
+
$this->message = $map[ $mapKeyName ];
|
| 418 |
+
}
|
| 419 |
+
$mapKeyName = $prefix . 'exceptionId';
|
| 420 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 421 |
+
$this->exceptionId = $map[ $mapKeyName ];
|
| 422 |
+
}
|
| 423 |
+
$i = 0;
|
| 424 |
+
while ( true ) {
|
| 425 |
+
if ( PPUtils::array_match_key( $map, $prefix . "parameter($i)" ) ) {
|
| 426 |
+
$newPrefix = $prefix . "parameter($i).";
|
| 427 |
+
$this->parameter[ $i ] = new ErrorParameter();
|
| 428 |
+
$this->parameter[ $i ]->init( $map, $newPrefix );
|
| 429 |
+
} else {
|
| 430 |
+
break;
|
| 431 |
+
}
|
| 432 |
+
$i++;
|
| 433 |
+
}
|
| 434 |
+
|
| 435 |
+
}
|
| 436 |
+
}
|
| 437 |
+
}
|
| 438 |
+
|
| 439 |
+
|
| 440 |
+
/**
|
| 441 |
+
*
|
| 442 |
+
*/
|
| 443 |
+
class ErrorParameter
|
| 444 |
+
{
|
| 445 |
+
|
| 446 |
+
/**
|
| 447 |
+
*
|
| 448 |
+
* @access public
|
| 449 |
+
* @var string
|
| 450 |
+
*/
|
| 451 |
+
public $name;
|
| 452 |
+
|
| 453 |
+
/**
|
| 454 |
+
*
|
| 455 |
+
* @access public
|
| 456 |
+
* @var string
|
| 457 |
+
*/
|
| 458 |
+
public $value;
|
| 459 |
+
|
| 460 |
+
|
| 461 |
+
public function init( $map = null, $prefix = '' )
|
| 462 |
+
{
|
| 463 |
+
if ( $map != null ) {
|
| 464 |
+
$mapKeyName = $prefix . 'name';
|
| 465 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 466 |
+
$this->name = $map[ $mapKeyName ];
|
| 467 |
+
}
|
| 468 |
+
$mapKeyName = $prefix . 'value';
|
| 469 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 470 |
+
$this->value = $map[ $mapKeyName ];
|
| 471 |
+
}
|
| 472 |
+
|
| 473 |
+
}
|
| 474 |
+
}
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
|
| 478 |
+
/**
|
| 479 |
+
* This specifies a fault, encapsulating error data, with
|
| 480 |
+
* specific error codes.
|
| 481 |
+
*/
|
| 482 |
+
class FaultMessage
|
| 483 |
+
{
|
| 484 |
+
|
| 485 |
+
/**
|
| 486 |
+
*
|
| 487 |
+
* @access public
|
| 488 |
+
* @var ResponseEnvelope
|
| 489 |
+
*/
|
| 490 |
+
public $responseEnvelope;
|
| 491 |
+
|
| 492 |
+
/**
|
| 493 |
+
*
|
| 494 |
+
* @array
|
| 495 |
+
* @access public
|
| 496 |
+
* @var ErrorData
|
| 497 |
+
*/
|
| 498 |
+
public $error;
|
| 499 |
+
|
| 500 |
+
|
| 501 |
+
public function init( $map = null, $prefix = '' )
|
| 502 |
+
{
|
| 503 |
+
if ( $map != null ) {
|
| 504 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 505 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 506 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 507 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 508 |
+
}
|
| 509 |
+
$i = 0;
|
| 510 |
+
while ( true ) {
|
| 511 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 512 |
+
$newPrefix = $prefix . "error($i).";
|
| 513 |
+
$this->error[ $i ] = new ErrorData();
|
| 514 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 515 |
+
} else {
|
| 516 |
+
break;
|
| 517 |
+
}
|
| 518 |
+
$i++;
|
| 519 |
+
}
|
| 520 |
+
|
| 521 |
+
}
|
| 522 |
+
}
|
| 523 |
+
}
|
| 524 |
+
|
| 525 |
+
|
| 526 |
+
/**
|
| 527 |
+
*
|
| 528 |
+
*/
|
| 529 |
+
class PhoneNumberType
|
| 530 |
+
{
|
| 531 |
+
|
| 532 |
+
/**
|
| 533 |
+
*
|
| 534 |
+
* @access public
|
| 535 |
+
* @var string
|
| 536 |
+
*/
|
| 537 |
+
public $countryCode;
|
| 538 |
+
|
| 539 |
+
/**
|
| 540 |
+
*
|
| 541 |
+
* @access public
|
| 542 |
+
* @var string
|
| 543 |
+
*/
|
| 544 |
+
public $phoneNumber;
|
| 545 |
+
|
| 546 |
+
/**
|
| 547 |
+
*
|
| 548 |
+
* @access public
|
| 549 |
+
* @var string
|
| 550 |
+
*/
|
| 551 |
+
public $extension;
|
| 552 |
+
|
| 553 |
+
/**
|
| 554 |
+
* Constructor with arguments
|
| 555 |
+
*/
|
| 556 |
+
public function __construct( $countryCode = null, $phoneNumber = null )
|
| 557 |
+
{
|
| 558 |
+
$this->countryCode = $countryCode;
|
| 559 |
+
$this->phoneNumber = $phoneNumber;
|
| 560 |
+
}
|
| 561 |
+
|
| 562 |
+
|
| 563 |
+
public function toNVPString( $prefix = '' )
|
| 564 |
+
{
|
| 565 |
+
$str = '';
|
| 566 |
+
$delim = '';
|
| 567 |
+
if ( $this->countryCode != null ) {
|
| 568 |
+
$str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
|
| 569 |
+
$delim = '&';
|
| 570 |
+
}
|
| 571 |
+
if ( $this->phoneNumber != null ) {
|
| 572 |
+
$str .= $delim . $prefix . 'phoneNumber=' . urlencode( $this->phoneNumber );
|
| 573 |
+
$delim = '&';
|
| 574 |
+
}
|
| 575 |
+
if ( $this->extension != null ) {
|
| 576 |
+
$str .= $delim . $prefix . 'extension=' . urlencode( $this->extension );
|
| 577 |
+
$delim = '&';
|
| 578 |
+
}
|
| 579 |
+
|
| 580 |
+
return $str;
|
| 581 |
+
}
|
| 582 |
+
|
| 583 |
+
public function init( $map = null, $prefix = '' )
|
| 584 |
+
{
|
| 585 |
+
if ( $map != null ) {
|
| 586 |
+
$mapKeyName = $prefix . 'countryCode';
|
| 587 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 588 |
+
$this->countryCode = $map[ $mapKeyName ];
|
| 589 |
+
}
|
| 590 |
+
$mapKeyName = $prefix . 'phoneNumber';
|
| 591 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 592 |
+
$this->phoneNumber = $map[ $mapKeyName ];
|
| 593 |
+
}
|
| 594 |
+
$mapKeyName = $prefix . 'extension';
|
| 595 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 596 |
+
$this->extension = $map[ $mapKeyName ];
|
| 597 |
+
}
|
| 598 |
+
|
| 599 |
+
}
|
| 600 |
+
}
|
| 601 |
+
}
|
| 602 |
+
|
| 603 |
+
|
| 604 |
+
/**
|
| 605 |
+
* This specifies the list of parameters with every request to
|
| 606 |
+
* the service.
|
| 607 |
+
*/
|
| 608 |
+
class RequestEnvelope
|
| 609 |
+
{
|
| 610 |
+
|
| 611 |
+
/**
|
| 612 |
+
* This specifies the required detail level that is needed by a
|
| 613 |
+
* client application pertaining to a particular data component
|
| 614 |
+
* (e.g., Item, Transaction, etc.). The detail level is
|
| 615 |
+
* specified in the DetailLevelCodeType which has all the
|
| 616 |
+
* enumerated values of the detail level for each component.
|
| 617 |
+
* @access public
|
| 618 |
+
* @var DetailLevelCode
|
| 619 |
+
*/
|
| 620 |
+
public $detailLevel;
|
| 621 |
+
|
| 622 |
+
/**
|
| 623 |
+
* This should be the standard RFC 3066 language identification
|
| 624 |
+
* tag, e.g., en_US.
|
| 625 |
+
* @access public
|
| 626 |
+
* @var string
|
| 627 |
+
*/
|
| 628 |
+
public $errorLanguage;
|
| 629 |
+
|
| 630 |
+
/**
|
| 631 |
+
* Constructor with arguments
|
| 632 |
+
*/
|
| 633 |
+
public function __construct( $errorLanguage = null )
|
| 634 |
+
{
|
| 635 |
+
$this->errorLanguage = $errorLanguage;
|
| 636 |
+
}
|
| 637 |
+
|
| 638 |
+
|
| 639 |
+
public function toNVPString( $prefix = '' )
|
| 640 |
+
{
|
| 641 |
+
$str = '';
|
| 642 |
+
$delim = '';
|
| 643 |
+
if ( $this->detailLevel != null ) {
|
| 644 |
+
$str .= $delim . $prefix . 'detailLevel=' . urlencode( $this->detailLevel );
|
| 645 |
+
$delim = '&';
|
| 646 |
+
}
|
| 647 |
+
if ( $this->errorLanguage != null ) {
|
| 648 |
+
$str .= $delim . $prefix . 'errorLanguage=' . urlencode( $this->errorLanguage );
|
| 649 |
+
$delim = '&';
|
| 650 |
+
}
|
| 651 |
+
|
| 652 |
+
return $str;
|
| 653 |
+
}
|
| 654 |
+
|
| 655 |
+
}
|
| 656 |
+
|
| 657 |
+
|
| 658 |
+
/**
|
| 659 |
+
* This specifies a list of parameters with every response from
|
| 660 |
+
* a service.
|
| 661 |
+
*/
|
| 662 |
+
class ResponseEnvelope
|
| 663 |
+
{
|
| 664 |
+
|
| 665 |
+
/**
|
| 666 |
+
*
|
| 667 |
+
* @access public
|
| 668 |
+
* @var dateTime
|
| 669 |
+
*/
|
| 670 |
+
public $timestamp;
|
| 671 |
+
|
| 672 |
+
/**
|
| 673 |
+
* Application level acknowledgment code.
|
| 674 |
+
* @access public
|
| 675 |
+
* @var AckCode
|
| 676 |
+
*/
|
| 677 |
+
public $ack;
|
| 678 |
+
|
| 679 |
+
/**
|
| 680 |
+
*
|
| 681 |
+
* @access public
|
| 682 |
+
* @var string
|
| 683 |
+
*/
|
| 684 |
+
public $correlationId;
|
| 685 |
+
|
| 686 |
+
/**
|
| 687 |
+
*
|
| 688 |
+
* @access public
|
| 689 |
+
* @var string
|
| 690 |
+
*/
|
| 691 |
+
public $build;
|
| 692 |
+
|
| 693 |
+
|
| 694 |
+
public function init( $map = null, $prefix = '' )
|
| 695 |
+
{
|
| 696 |
+
if ( $map != null ) {
|
| 697 |
+
$mapKeyName = $prefix . 'timestamp';
|
| 698 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 699 |
+
$this->timestamp = $map[ $mapKeyName ];
|
| 700 |
+
}
|
| 701 |
+
$mapKeyName = $prefix . 'ack';
|
| 702 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 703 |
+
$this->ack = $map[ $mapKeyName ];
|
| 704 |
+
}
|
| 705 |
+
$mapKeyName = $prefix . 'correlationId';
|
| 706 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 707 |
+
$this->correlationId = $map[ $mapKeyName ];
|
| 708 |
+
}
|
| 709 |
+
$mapKeyName = $prefix . 'build';
|
| 710 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 711 |
+
$this->build = $map[ $mapKeyName ];
|
| 712 |
+
}
|
| 713 |
+
|
| 714 |
+
}
|
| 715 |
+
}
|
| 716 |
+
}
|
| 717 |
+
|
| 718 |
+
|
| 719 |
+
/**
|
| 720 |
+
*
|
| 721 |
+
*/
|
| 722 |
+
class Address
|
| 723 |
+
{
|
| 724 |
+
|
| 725 |
+
/**
|
| 726 |
+
*
|
| 727 |
+
* @access public
|
| 728 |
+
* @var string
|
| 729 |
+
*/
|
| 730 |
+
public $addresseeName;
|
| 731 |
+
|
| 732 |
+
/**
|
| 733 |
+
*
|
| 734 |
+
* @access public
|
| 735 |
+
* @var BaseAddress
|
| 736 |
+
*/
|
| 737 |
+
public $baseAddress;
|
| 738 |
+
|
| 739 |
+
/**
|
| 740 |
+
*
|
| 741 |
+
* @access public
|
| 742 |
+
* @var string
|
| 743 |
+
*/
|
| 744 |
+
public $addressId;
|
| 745 |
+
|
| 746 |
+
|
| 747 |
+
public function init( $map = null, $prefix = '' )
|
| 748 |
+
{
|
| 749 |
+
if ( $map != null ) {
|
| 750 |
+
$mapKeyName = $prefix . 'addresseeName';
|
| 751 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 752 |
+
$this->addresseeName = $map[ $mapKeyName ];
|
| 753 |
+
}
|
| 754 |
+
if ( PPUtils::array_match_key( $map, $prefix . "baseAddress." ) ) {
|
| 755 |
+
$newPrefix = $prefix . "baseAddress.";
|
| 756 |
+
$this->baseAddress = new BaseAddress();
|
| 757 |
+
$this->baseAddress->init( $map, $newPrefix );
|
| 758 |
+
}
|
| 759 |
+
$mapKeyName = $prefix . 'addressId';
|
| 760 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 761 |
+
$this->addressId = $map[ $mapKeyName ];
|
| 762 |
+
}
|
| 763 |
+
|
| 764 |
+
}
|
| 765 |
+
}
|
| 766 |
+
}
|
| 767 |
+
|
| 768 |
+
|
| 769 |
+
/**
|
| 770 |
+
*
|
| 771 |
+
*/
|
| 772 |
+
class AddressList
|
| 773 |
+
{
|
| 774 |
+
|
| 775 |
+
/**
|
| 776 |
+
*
|
| 777 |
+
* @array
|
| 778 |
+
* @access public
|
| 779 |
+
* @var Address
|
| 780 |
+
*/
|
| 781 |
+
public $address;
|
| 782 |
+
|
| 783 |
+
|
| 784 |
+
public function init( $map = null, $prefix = '' )
|
| 785 |
+
{
|
| 786 |
+
if ( $map != null ) {
|
| 787 |
+
$i = 0;
|
| 788 |
+
while ( true ) {
|
| 789 |
+
if ( PPUtils::array_match_key( $map, $prefix . "address($i)" ) ) {
|
| 790 |
+
$newPrefix = $prefix . "address($i).";
|
| 791 |
+
$this->address[ $i ] = new Address();
|
| 792 |
+
$this->address[ $i ]->init( $map, $newPrefix );
|
| 793 |
+
} else {
|
| 794 |
+
break;
|
| 795 |
+
}
|
| 796 |
+
$i++;
|
| 797 |
+
}
|
| 798 |
+
|
| 799 |
+
}
|
| 800 |
+
}
|
| 801 |
+
}
|
| 802 |
+
|
| 803 |
+
|
| 804 |
+
/**
|
| 805 |
+
* A list of ISO currency codes.
|
| 806 |
+
*/
|
| 807 |
+
class CurrencyCodeList
|
| 808 |
+
{
|
| 809 |
+
|
| 810 |
+
/**
|
| 811 |
+
*
|
| 812 |
+
* @array
|
| 813 |
+
* @access public
|
| 814 |
+
* @var string
|
| 815 |
+
*/
|
| 816 |
+
public $currencyCode;
|
| 817 |
+
|
| 818 |
+
/**
|
| 819 |
+
* Constructor with arguments
|
| 820 |
+
*/
|
| 821 |
+
public function __construct( $currencyCode = null )
|
| 822 |
+
{
|
| 823 |
+
$this->currencyCode = $currencyCode;
|
| 824 |
+
}
|
| 825 |
+
|
| 826 |
+
|
| 827 |
+
public function toNVPString( $prefix = '' )
|
| 828 |
+
{
|
| 829 |
+
$str = '';
|
| 830 |
+
$delim = '';
|
| 831 |
+
for ( $i = 0; $i < count( $this->currencyCode ); $i++ ) {
|
| 832 |
+
$str .= $delim . $prefix . "currencyCode($i)=" . urlencode( $this->currencyCode[ $i ] );
|
| 833 |
+
$delim = '&';
|
| 834 |
+
}
|
| 835 |
+
|
| 836 |
+
return $str;
|
| 837 |
+
}
|
| 838 |
+
|
| 839 |
+
}
|
| 840 |
+
|
| 841 |
+
|
| 842 |
+
/**
|
| 843 |
+
* A list of estimated currency conversions for a base
|
| 844 |
+
* currency.
|
| 845 |
+
*/
|
| 846 |
+
class CurrencyConversionList
|
| 847 |
+
{
|
| 848 |
+
|
| 849 |
+
/**
|
| 850 |
+
*
|
| 851 |
+
* @access public
|
| 852 |
+
* @var CurrencyType
|
| 853 |
+
*/
|
| 854 |
+
public $baseAmount;
|
| 855 |
+
|
| 856 |
+
/**
|
| 857 |
+
*
|
| 858 |
+
* @access public
|
| 859 |
+
* @var CurrencyList
|
| 860 |
+
*/
|
| 861 |
+
public $currencyList;
|
| 862 |
+
|
| 863 |
+
|
| 864 |
+
public function init( $map = null, $prefix = '' )
|
| 865 |
+
{
|
| 866 |
+
if ( $map != null ) {
|
| 867 |
+
if ( PPUtils::array_match_key( $map, $prefix . "baseAmount." ) ) {
|
| 868 |
+
$newPrefix = $prefix . "baseAmount.";
|
| 869 |
+
$this->baseAmount = new CurrencyType();
|
| 870 |
+
$this->baseAmount->init( $map, $newPrefix );
|
| 871 |
+
}
|
| 872 |
+
if ( PPUtils::array_match_key( $map, $prefix . "currencyList." ) ) {
|
| 873 |
+
$newPrefix = $prefix . "currencyList.";
|
| 874 |
+
$this->currencyList = new CurrencyList();
|
| 875 |
+
$this->currencyList->init( $map, $newPrefix );
|
| 876 |
+
}
|
| 877 |
+
|
| 878 |
+
}
|
| 879 |
+
}
|
| 880 |
+
}
|
| 881 |
+
|
| 882 |
+
|
| 883 |
+
/**
|
| 884 |
+
* A table that contains a list of estimated currency
|
| 885 |
+
* conversions for a base currency in each row.
|
| 886 |
+
*/
|
| 887 |
+
class CurrencyConversionTable
|
| 888 |
+
{
|
| 889 |
+
|
| 890 |
+
/**
|
| 891 |
+
*
|
| 892 |
+
* @array
|
| 893 |
+
* @access public
|
| 894 |
+
* @var CurrencyConversionList
|
| 895 |
+
*/
|
| 896 |
+
public $currencyConversionList;
|
| 897 |
+
|
| 898 |
+
|
| 899 |
+
public function init( $map = null, $prefix = '' )
|
| 900 |
+
{
|
| 901 |
+
if ( $map != null ) {
|
| 902 |
+
$i = 0;
|
| 903 |
+
while ( true ) {
|
| 904 |
+
if ( PPUtils::array_match_key( $map, $prefix . "currencyConversionList($i)" ) ) {
|
| 905 |
+
$newPrefix = $prefix . "currencyConversionList($i).";
|
| 906 |
+
$this->currencyConversionList[ $i ] = new CurrencyConversionList();
|
| 907 |
+
$this->currencyConversionList[ $i ]->init( $map, $newPrefix );
|
| 908 |
+
} else {
|
| 909 |
+
break;
|
| 910 |
+
}
|
| 911 |
+
$i++;
|
| 912 |
+
}
|
| 913 |
+
|
| 914 |
+
}
|
| 915 |
+
}
|
| 916 |
+
}
|
| 917 |
+
|
| 918 |
+
|
| 919 |
+
/**
|
| 920 |
+
* A list of ISO currencies.
|
| 921 |
+
*/
|
| 922 |
+
class CurrencyList
|
| 923 |
+
{
|
| 924 |
+
|
| 925 |
+
/**
|
| 926 |
+
*
|
| 927 |
+
* @array
|
| 928 |
+
* @access public
|
| 929 |
+
* @var CurrencyType
|
| 930 |
+
*/
|
| 931 |
+
public $currency;
|
| 932 |
+
|
| 933 |
+
/**
|
| 934 |
+
* Constructor with arguments
|
| 935 |
+
*/
|
| 936 |
+
public function __construct( $currency = null )
|
| 937 |
+
{
|
| 938 |
+
$this->currency = $currency;
|
| 939 |
+
}
|
| 940 |
+
|
| 941 |
+
|
| 942 |
+
public function toNVPString( $prefix = '' )
|
| 943 |
+
{
|
| 944 |
+
$str = '';
|
| 945 |
+
$delim = '';
|
| 946 |
+
for ( $i = 0; $i < count( $this->currency ); $i++ ) {
|
| 947 |
+
$newPrefix = $prefix . "currency($i).";
|
| 948 |
+
$str .= $delim . call_user_func( array( $this->currency[ $i ], 'toNVPString' ), $newPrefix );
|
| 949 |
+
$delim = '&';
|
| 950 |
+
}
|
| 951 |
+
|
| 952 |
+
return $str;
|
| 953 |
+
}
|
| 954 |
+
|
| 955 |
+
public function init( $map = null, $prefix = '' )
|
| 956 |
+
{
|
| 957 |
+
if ( $map != null ) {
|
| 958 |
+
$i = 0;
|
| 959 |
+
while ( true ) {
|
| 960 |
+
if ( PPUtils::array_match_key( $map, $prefix . "currency($i)" ) ) {
|
| 961 |
+
$newPrefix = $prefix . "currency($i).";
|
| 962 |
+
$this->currency[ $i ] = new CurrencyType();
|
| 963 |
+
$this->currency[ $i ]->init( $map, $newPrefix );
|
| 964 |
+
} else {
|
| 965 |
+
break;
|
| 966 |
+
}
|
| 967 |
+
$i++;
|
| 968 |
+
}
|
| 969 |
+
|
| 970 |
+
}
|
| 971 |
+
}
|
| 972 |
+
}
|
| 973 |
+
|
| 974 |
+
|
| 975 |
+
/**
|
| 976 |
+
* Customizable options that a client application can specify
|
| 977 |
+
* for display purposes.
|
| 978 |
+
*/
|
| 979 |
+
class DisplayOptions
|
| 980 |
+
{
|
| 981 |
+
|
| 982 |
+
/**
|
| 983 |
+
*
|
| 984 |
+
* @access public
|
| 985 |
+
* @var string
|
| 986 |
+
*/
|
| 987 |
+
public $emailHeaderImageUrl;
|
| 988 |
+
|
| 989 |
+
/**
|
| 990 |
+
*
|
| 991 |
+
* @access public
|
| 992 |
+
* @var string
|
| 993 |
+
*/
|
| 994 |
+
public $emailMarketingImageUrl;
|
| 995 |
+
|
| 996 |
+
/**
|
| 997 |
+
*
|
| 998 |
+
* @access public
|
| 999 |
+
* @var string
|
| 1000 |
+
*/
|
| 1001 |
+
public $headerImageUrl;
|
| 1002 |
+
|
| 1003 |
+
/**
|
| 1004 |
+
*
|
| 1005 |
+
* @access public
|
| 1006 |
+
* @var string
|
| 1007 |
+
*/
|
| 1008 |
+
public $businessName;
|
| 1009 |
+
|
| 1010 |
+
|
| 1011 |
+
public function toNVPString( $prefix = '' )
|
| 1012 |
+
{
|
| 1013 |
+
$str = '';
|
| 1014 |
+
$delim = '';
|
| 1015 |
+
if ( $this->emailHeaderImageUrl != null ) {
|
| 1016 |
+
$str .= $delim . $prefix . 'emailHeaderImageUrl=' . urlencode( $this->emailHeaderImageUrl );
|
| 1017 |
+
$delim = '&';
|
| 1018 |
+
}
|
| 1019 |
+
if ( $this->emailMarketingImageUrl != null ) {
|
| 1020 |
+
$str .= $delim . $prefix . 'emailMarketingImageUrl=' . urlencode( $this->emailMarketingImageUrl );
|
| 1021 |
+
$delim = '&';
|
| 1022 |
+
}
|
| 1023 |
+
if ( $this->headerImageUrl != null ) {
|
| 1024 |
+
$str .= $delim . $prefix . 'headerImageUrl=' . urlencode( $this->headerImageUrl );
|
| 1025 |
+
$delim = '&';
|
| 1026 |
+
}
|
| 1027 |
+
if ( $this->businessName != null ) {
|
| 1028 |
+
$str .= $delim . $prefix . 'businessName=' . urlencode( $this->businessName );
|
| 1029 |
+
$delim = '&';
|
| 1030 |
+
}
|
| 1031 |
+
|
| 1032 |
+
return $str;
|
| 1033 |
+
}
|
| 1034 |
+
|
| 1035 |
+
public function init( $map = null, $prefix = '' )
|
| 1036 |
+
{
|
| 1037 |
+
if ( $map != null ) {
|
| 1038 |
+
$mapKeyName = $prefix . 'emailHeaderImageUrl';
|
| 1039 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1040 |
+
$this->emailHeaderImageUrl = $map[ $mapKeyName ];
|
| 1041 |
+
}
|
| 1042 |
+
$mapKeyName = $prefix . 'emailMarketingImageUrl';
|
| 1043 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1044 |
+
$this->emailMarketingImageUrl = $map[ $mapKeyName ];
|
| 1045 |
+
}
|
| 1046 |
+
$mapKeyName = $prefix . 'headerImageUrl';
|
| 1047 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1048 |
+
$this->headerImageUrl = $map[ $mapKeyName ];
|
| 1049 |
+
}
|
| 1050 |
+
$mapKeyName = $prefix . 'businessName';
|
| 1051 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1052 |
+
$this->businessName = $map[ $mapKeyName ];
|
| 1053 |
+
}
|
| 1054 |
+
|
| 1055 |
+
}
|
| 1056 |
+
}
|
| 1057 |
+
}
|
| 1058 |
+
|
| 1059 |
+
|
| 1060 |
+
/**
|
| 1061 |
+
*
|
| 1062 |
+
*/
|
| 1063 |
+
class ErrorList
|
| 1064 |
+
{
|
| 1065 |
+
|
| 1066 |
+
/**
|
| 1067 |
+
*
|
| 1068 |
+
* @array
|
| 1069 |
+
* @access public
|
| 1070 |
+
* @var ErrorData
|
| 1071 |
+
*/
|
| 1072 |
+
public $error;
|
| 1073 |
+
|
| 1074 |
+
|
| 1075 |
+
public function init( $map = null, $prefix = '' )
|
| 1076 |
+
{
|
| 1077 |
+
if ( $map != null ) {
|
| 1078 |
+
$i = 0;
|
| 1079 |
+
while ( true ) {
|
| 1080 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 1081 |
+
$newPrefix = $prefix . "error($i).";
|
| 1082 |
+
$this->error[ $i ] = new ErrorData();
|
| 1083 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 1084 |
+
} else {
|
| 1085 |
+
break;
|
| 1086 |
+
}
|
| 1087 |
+
$i++;
|
| 1088 |
+
}
|
| 1089 |
+
|
| 1090 |
+
}
|
| 1091 |
+
}
|
| 1092 |
+
}
|
| 1093 |
+
|
| 1094 |
+
|
| 1095 |
+
/**
|
| 1096 |
+
*
|
| 1097 |
+
*/
|
| 1098 |
+
class FundingConstraint
|
| 1099 |
+
{
|
| 1100 |
+
|
| 1101 |
+
/**
|
| 1102 |
+
*
|
| 1103 |
+
* @access public
|
| 1104 |
+
* @var FundingTypeList
|
| 1105 |
+
*/
|
| 1106 |
+
public $allowedFundingType;
|
| 1107 |
+
|
| 1108 |
+
|
| 1109 |
+
public function toNVPString( $prefix = '' )
|
| 1110 |
+
{
|
| 1111 |
+
$str = '';
|
| 1112 |
+
$delim = '';
|
| 1113 |
+
if ( $this->allowedFundingType != null ) {
|
| 1114 |
+
$newPrefix = $prefix . 'allowedFundingType.';
|
| 1115 |
+
$str .= $delim . call_user_func( array( $this->allowedFundingType, 'toNVPString' ), $newPrefix );
|
| 1116 |
+
$delim = '&';
|
| 1117 |
+
}
|
| 1118 |
+
|
| 1119 |
+
return $str;
|
| 1120 |
+
}
|
| 1121 |
+
|
| 1122 |
+
public function init( $map = null, $prefix = '' )
|
| 1123 |
+
{
|
| 1124 |
+
if ( $map != null ) {
|
| 1125 |
+
if ( PPUtils::array_match_key( $map, $prefix . "allowedFundingType." ) ) {
|
| 1126 |
+
$newPrefix = $prefix . "allowedFundingType.";
|
| 1127 |
+
$this->allowedFundingType = new FundingTypeList();
|
| 1128 |
+
$this->allowedFundingType->init( $map, $newPrefix );
|
| 1129 |
+
}
|
| 1130 |
+
|
| 1131 |
+
}
|
| 1132 |
+
}
|
| 1133 |
+
}
|
| 1134 |
+
|
| 1135 |
+
|
| 1136 |
+
/**
|
| 1137 |
+
* FundingTypeInfo represents one allowed funding type.
|
| 1138 |
+
*/
|
| 1139 |
+
class FundingTypeInfo
|
| 1140 |
+
{
|
| 1141 |
+
|
| 1142 |
+
/**
|
| 1143 |
+
*
|
| 1144 |
+
* @access public
|
| 1145 |
+
* @var string
|
| 1146 |
+
*/
|
| 1147 |
+
public $fundingType;
|
| 1148 |
+
|
| 1149 |
+
/**
|
| 1150 |
+
* Constructor with arguments
|
| 1151 |
+
*/
|
| 1152 |
+
public function __construct( $fundingType = null )
|
| 1153 |
+
{
|
| 1154 |
+
$this->fundingType = $fundingType;
|
| 1155 |
+
}
|
| 1156 |
+
|
| 1157 |
+
|
| 1158 |
+
public function toNVPString( $prefix = '' )
|
| 1159 |
+
{
|
| 1160 |
+
$str = '';
|
| 1161 |
+
$delim = '';
|
| 1162 |
+
if ( $this->fundingType != null ) {
|
| 1163 |
+
$str .= $delim . $prefix . 'fundingType=' . urlencode( $this->fundingType );
|
| 1164 |
+
$delim = '&';
|
| 1165 |
+
}
|
| 1166 |
+
|
| 1167 |
+
return $str;
|
| 1168 |
+
}
|
| 1169 |
+
|
| 1170 |
+
public function init( $map = null, $prefix = '' )
|
| 1171 |
+
{
|
| 1172 |
+
if ( $map != null ) {
|
| 1173 |
+
$mapKeyName = $prefix . 'fundingType';
|
| 1174 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1175 |
+
$this->fundingType = $map[ $mapKeyName ];
|
| 1176 |
+
}
|
| 1177 |
+
|
| 1178 |
+
}
|
| 1179 |
+
}
|
| 1180 |
+
}
|
| 1181 |
+
|
| 1182 |
+
|
| 1183 |
+
/**
|
| 1184 |
+
*
|
| 1185 |
+
*/
|
| 1186 |
+
class FundingTypeList
|
| 1187 |
+
{
|
| 1188 |
+
|
| 1189 |
+
/**
|
| 1190 |
+
*
|
| 1191 |
+
* @array
|
| 1192 |
+
* @access public
|
| 1193 |
+
* @var FundingTypeInfo
|
| 1194 |
+
*/
|
| 1195 |
+
public $fundingTypeInfo;
|
| 1196 |
+
|
| 1197 |
+
/**
|
| 1198 |
+
* Constructor with arguments
|
| 1199 |
+
*/
|
| 1200 |
+
public function __construct( $fundingTypeInfo = null )
|
| 1201 |
+
{
|
| 1202 |
+
$this->fundingTypeInfo = $fundingTypeInfo;
|
| 1203 |
+
}
|
| 1204 |
+
|
| 1205 |
+
|
| 1206 |
+
public function toNVPString( $prefix = '' )
|
| 1207 |
+
{
|
| 1208 |
+
$str = '';
|
| 1209 |
+
$delim = '';
|
| 1210 |
+
for ( $i = 0; $i < count( $this->fundingTypeInfo ); $i++ ) {
|
| 1211 |
+
$newPrefix = $prefix . "fundingTypeInfo($i).";
|
| 1212 |
+
$str .= $delim . call_user_func( array( $this->fundingTypeInfo[ $i ], 'toNVPString' ), $newPrefix );
|
| 1213 |
+
$delim = '&';
|
| 1214 |
+
}
|
| 1215 |
+
|
| 1216 |
+
return $str;
|
| 1217 |
+
}
|
| 1218 |
+
|
| 1219 |
+
public function init( $map = null, $prefix = '' )
|
| 1220 |
+
{
|
| 1221 |
+
if ( $map != null ) {
|
| 1222 |
+
$i = 0;
|
| 1223 |
+
while ( true ) {
|
| 1224 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingTypeInfo($i)" ) ) {
|
| 1225 |
+
$newPrefix = $prefix . "fundingTypeInfo($i).";
|
| 1226 |
+
$this->fundingTypeInfo[ $i ] = new FundingTypeInfo();
|
| 1227 |
+
$this->fundingTypeInfo[ $i ]->init( $map, $newPrefix );
|
| 1228 |
+
} else {
|
| 1229 |
+
break;
|
| 1230 |
+
}
|
| 1231 |
+
$i++;
|
| 1232 |
+
}
|
| 1233 |
+
|
| 1234 |
+
}
|
| 1235 |
+
}
|
| 1236 |
+
}
|
| 1237 |
+
|
| 1238 |
+
|
| 1239 |
+
/**
|
| 1240 |
+
* Describes the conversion between 2 currencies.
|
| 1241 |
+
*/
|
| 1242 |
+
class CurrencyConversion
|
| 1243 |
+
{
|
| 1244 |
+
|
| 1245 |
+
/**
|
| 1246 |
+
*
|
| 1247 |
+
* @access public
|
| 1248 |
+
* @var CurrencyType
|
| 1249 |
+
*/
|
| 1250 |
+
public $from;
|
| 1251 |
+
|
| 1252 |
+
/**
|
| 1253 |
+
*
|
| 1254 |
+
* @access public
|
| 1255 |
+
* @var CurrencyType
|
| 1256 |
+
*/
|
| 1257 |
+
public $to;
|
| 1258 |
+
|
| 1259 |
+
/**
|
| 1260 |
+
*
|
| 1261 |
+
* @access public
|
| 1262 |
+
* @var double
|
| 1263 |
+
*/
|
| 1264 |
+
public $exchangeRate;
|
| 1265 |
+
|
| 1266 |
+
|
| 1267 |
+
public function init( $map = null, $prefix = '' )
|
| 1268 |
+
{
|
| 1269 |
+
if ( $map != null ) {
|
| 1270 |
+
if ( PPUtils::array_match_key( $map, $prefix . "from." ) ) {
|
| 1271 |
+
$newPrefix = $prefix . "from.";
|
| 1272 |
+
$this->from = new CurrencyType();
|
| 1273 |
+
$this->from->init( $map, $newPrefix );
|
| 1274 |
+
}
|
| 1275 |
+
if ( PPUtils::array_match_key( $map, $prefix . "to." ) ) {
|
| 1276 |
+
$newPrefix = $prefix . "to.";
|
| 1277 |
+
$this->to = new CurrencyType();
|
| 1278 |
+
$this->to->init( $map, $newPrefix );
|
| 1279 |
+
}
|
| 1280 |
+
$mapKeyName = $prefix . 'exchangeRate';
|
| 1281 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1282 |
+
$this->exchangeRate = $map[ $mapKeyName ];
|
| 1283 |
+
}
|
| 1284 |
+
|
| 1285 |
+
}
|
| 1286 |
+
}
|
| 1287 |
+
}
|
| 1288 |
+
|
| 1289 |
+
|
| 1290 |
+
/**
|
| 1291 |
+
* Funding source information.
|
| 1292 |
+
*/
|
| 1293 |
+
class FundingSource
|
| 1294 |
+
{
|
| 1295 |
+
|
| 1296 |
+
/**
|
| 1297 |
+
*
|
| 1298 |
+
* @access public
|
| 1299 |
+
* @var string
|
| 1300 |
+
*/
|
| 1301 |
+
public $lastFourOfAccountNumber;
|
| 1302 |
+
|
| 1303 |
+
/**
|
| 1304 |
+
*
|
| 1305 |
+
* @access public
|
| 1306 |
+
* @var string
|
| 1307 |
+
*/
|
| 1308 |
+
public $type;
|
| 1309 |
+
|
| 1310 |
+
/**
|
| 1311 |
+
*
|
| 1312 |
+
* @access public
|
| 1313 |
+
* @var string
|
| 1314 |
+
*/
|
| 1315 |
+
public $displayName;
|
| 1316 |
+
|
| 1317 |
+
/**
|
| 1318 |
+
*
|
| 1319 |
+
* @access public
|
| 1320 |
+
* @var string
|
| 1321 |
+
*/
|
| 1322 |
+
public $fundingSourceId;
|
| 1323 |
+
|
| 1324 |
+
/**
|
| 1325 |
+
*
|
| 1326 |
+
* @access public
|
| 1327 |
+
* @var boolean
|
| 1328 |
+
*/
|
| 1329 |
+
public $allowed;
|
| 1330 |
+
|
| 1331 |
+
|
| 1332 |
+
public function init( $map = null, $prefix = '' )
|
| 1333 |
+
{
|
| 1334 |
+
if ( $map != null ) {
|
| 1335 |
+
$mapKeyName = $prefix . 'lastFourOfAccountNumber';
|
| 1336 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1337 |
+
$this->lastFourOfAccountNumber = $map[ $mapKeyName ];
|
| 1338 |
+
}
|
| 1339 |
+
$mapKeyName = $prefix . 'type';
|
| 1340 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1341 |
+
$this->type = $map[ $mapKeyName ];
|
| 1342 |
+
}
|
| 1343 |
+
$mapKeyName = $prefix . 'displayName';
|
| 1344 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1345 |
+
$this->displayName = $map[ $mapKeyName ];
|
| 1346 |
+
}
|
| 1347 |
+
$mapKeyName = $prefix . 'fundingSourceId';
|
| 1348 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1349 |
+
$this->fundingSourceId = $map[ $mapKeyName ];
|
| 1350 |
+
}
|
| 1351 |
+
$mapKeyName = $prefix . 'allowed';
|
| 1352 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1353 |
+
$this->allowed = $map[ $mapKeyName ];
|
| 1354 |
+
}
|
| 1355 |
+
|
| 1356 |
+
}
|
| 1357 |
+
}
|
| 1358 |
+
}
|
| 1359 |
+
|
| 1360 |
+
|
| 1361 |
+
/**
|
| 1362 |
+
* Amount to be charged to a particular funding source.
|
| 1363 |
+
*/
|
| 1364 |
+
class FundingPlanCharge
|
| 1365 |
+
{
|
| 1366 |
+
|
| 1367 |
+
/**
|
| 1368 |
+
*
|
| 1369 |
+
* @access public
|
| 1370 |
+
* @var CurrencyType
|
| 1371 |
+
*/
|
| 1372 |
+
public $charge;
|
| 1373 |
+
|
| 1374 |
+
/**
|
| 1375 |
+
*
|
| 1376 |
+
* @access public
|
| 1377 |
+
* @var FundingSource
|
| 1378 |
+
*/
|
| 1379 |
+
public $fundingSource;
|
| 1380 |
+
|
| 1381 |
+
|
| 1382 |
+
public function init( $map = null, $prefix = '' )
|
| 1383 |
+
{
|
| 1384 |
+
if ( $map != null ) {
|
| 1385 |
+
if ( PPUtils::array_match_key( $map, $prefix . "charge." ) ) {
|
| 1386 |
+
$newPrefix = $prefix . "charge.";
|
| 1387 |
+
$this->charge = new CurrencyType();
|
| 1388 |
+
$this->charge->init( $map, $newPrefix );
|
| 1389 |
+
}
|
| 1390 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingSource." ) ) {
|
| 1391 |
+
$newPrefix = $prefix . "fundingSource.";
|
| 1392 |
+
$this->fundingSource = new FundingSource();
|
| 1393 |
+
$this->fundingSource->init( $map, $newPrefix );
|
| 1394 |
+
}
|
| 1395 |
+
|
| 1396 |
+
}
|
| 1397 |
+
}
|
| 1398 |
+
}
|
| 1399 |
+
|
| 1400 |
+
|
| 1401 |
+
/**
|
| 1402 |
+
* FundingPlan describes the funding sources to be used for a
|
| 1403 |
+
* specific payment.
|
| 1404 |
+
*/
|
| 1405 |
+
class FundingPlan
|
| 1406 |
+
{
|
| 1407 |
+
|
| 1408 |
+
/**
|
| 1409 |
+
*
|
| 1410 |
+
* @access public
|
| 1411 |
+
* @var string
|
| 1412 |
+
*/
|
| 1413 |
+
public $fundingPlanId;
|
| 1414 |
+
|
| 1415 |
+
/**
|
| 1416 |
+
*
|
| 1417 |
+
* @access public
|
| 1418 |
+
* @var CurrencyType
|
| 1419 |
+
*/
|
| 1420 |
+
public $fundingAmount;
|
| 1421 |
+
|
| 1422 |
+
/**
|
| 1423 |
+
*
|
| 1424 |
+
* @access public
|
| 1425 |
+
* @var FundingSource
|
| 1426 |
+
*/
|
| 1427 |
+
public $backupFundingSource;
|
| 1428 |
+
|
| 1429 |
+
/**
|
| 1430 |
+
*
|
| 1431 |
+
* @access public
|
| 1432 |
+
* @var CurrencyType
|
| 1433 |
+
*/
|
| 1434 |
+
public $senderFees;
|
| 1435 |
+
|
| 1436 |
+
/**
|
| 1437 |
+
*
|
| 1438 |
+
* @access public
|
| 1439 |
+
* @var CurrencyConversion
|
| 1440 |
+
*/
|
| 1441 |
+
public $currencyConversion;
|
| 1442 |
+
|
| 1443 |
+
/**
|
| 1444 |
+
*
|
| 1445 |
+
* @array
|
| 1446 |
+
* @access public
|
| 1447 |
+
* @var FundingPlanCharge
|
| 1448 |
+
*/
|
| 1449 |
+
public $charge;
|
| 1450 |
+
|
| 1451 |
+
|
| 1452 |
+
public function init( $map = null, $prefix = '' )
|
| 1453 |
+
{
|
| 1454 |
+
if ( $map != null ) {
|
| 1455 |
+
$mapKeyName = $prefix . 'fundingPlanId';
|
| 1456 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1457 |
+
$this->fundingPlanId = $map[ $mapKeyName ];
|
| 1458 |
+
}
|
| 1459 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingAmount." ) ) {
|
| 1460 |
+
$newPrefix = $prefix . "fundingAmount.";
|
| 1461 |
+
$this->fundingAmount = new CurrencyType();
|
| 1462 |
+
$this->fundingAmount->init( $map, $newPrefix );
|
| 1463 |
+
}
|
| 1464 |
+
if ( PPUtils::array_match_key( $map, $prefix . "backupFundingSource." ) ) {
|
| 1465 |
+
$newPrefix = $prefix . "backupFundingSource.";
|
| 1466 |
+
$this->backupFundingSource = new FundingSource();
|
| 1467 |
+
$this->backupFundingSource->init( $map, $newPrefix );
|
| 1468 |
+
}
|
| 1469 |
+
if ( PPUtils::array_match_key( $map, $prefix . "senderFees." ) ) {
|
| 1470 |
+
$newPrefix = $prefix . "senderFees.";
|
| 1471 |
+
$this->senderFees = new CurrencyType();
|
| 1472 |
+
$this->senderFees->init( $map, $newPrefix );
|
| 1473 |
+
}
|
| 1474 |
+
if ( PPUtils::array_match_key( $map, $prefix . "currencyConversion." ) ) {
|
| 1475 |
+
$newPrefix = $prefix . "currencyConversion.";
|
| 1476 |
+
$this->currencyConversion = new CurrencyConversion();
|
| 1477 |
+
$this->currencyConversion->init( $map, $newPrefix );
|
| 1478 |
+
}
|
| 1479 |
+
$i = 0;
|
| 1480 |
+
while ( true ) {
|
| 1481 |
+
if ( PPUtils::array_match_key( $map, $prefix . "charge($i)" ) ) {
|
| 1482 |
+
$newPrefix = $prefix . "charge($i).";
|
| 1483 |
+
$this->charge[ $i ] = new FundingPlanCharge();
|
| 1484 |
+
$this->charge[ $i ]->init( $map, $newPrefix );
|
| 1485 |
+
} else {
|
| 1486 |
+
break;
|
| 1487 |
+
}
|
| 1488 |
+
$i++;
|
| 1489 |
+
}
|
| 1490 |
+
|
| 1491 |
+
}
|
| 1492 |
+
}
|
| 1493 |
+
}
|
| 1494 |
+
|
| 1495 |
+
|
| 1496 |
+
/**
|
| 1497 |
+
* Details about the party that initiated this payment. The API
|
| 1498 |
+
* user is making this payment on behalf of the initiator. The
|
| 1499 |
+
* initiator can simply be an institution or a customer of the
|
| 1500 |
+
* institution.
|
| 1501 |
+
*/
|
| 1502 |
+
class InitiatingEntity
|
| 1503 |
+
{
|
| 1504 |
+
|
| 1505 |
+
/**
|
| 1506 |
+
*
|
| 1507 |
+
* @access public
|
| 1508 |
+
* @var InstitutionCustomer
|
| 1509 |
+
*/
|
| 1510 |
+
public $institutionCustomer;
|
| 1511 |
+
|
| 1512 |
+
|
| 1513 |
+
public function toNVPString( $prefix = '' )
|
| 1514 |
+
{
|
| 1515 |
+
$str = '';
|
| 1516 |
+
$delim = '';
|
| 1517 |
+
if ( $this->institutionCustomer != null ) {
|
| 1518 |
+
$newPrefix = $prefix . 'institutionCustomer.';
|
| 1519 |
+
$str .= $delim . call_user_func( array( $this->institutionCustomer, 'toNVPString' ), $newPrefix );
|
| 1520 |
+
$delim = '&';
|
| 1521 |
+
}
|
| 1522 |
+
|
| 1523 |
+
return $str;
|
| 1524 |
+
}
|
| 1525 |
+
|
| 1526 |
+
public function init( $map = null, $prefix = '' )
|
| 1527 |
+
{
|
| 1528 |
+
if ( $map != null ) {
|
| 1529 |
+
if ( PPUtils::array_match_key( $map, $prefix . "institutionCustomer." ) ) {
|
| 1530 |
+
$newPrefix = $prefix . "institutionCustomer.";
|
| 1531 |
+
$this->institutionCustomer = new InstitutionCustomer();
|
| 1532 |
+
$this->institutionCustomer->init( $map, $newPrefix );
|
| 1533 |
+
}
|
| 1534 |
+
|
| 1535 |
+
}
|
| 1536 |
+
}
|
| 1537 |
+
}
|
| 1538 |
+
|
| 1539 |
+
|
| 1540 |
+
/**
|
| 1541 |
+
* The customer of the initiating institution
|
| 1542 |
+
*/
|
| 1543 |
+
class InstitutionCustomer
|
| 1544 |
+
{
|
| 1545 |
+
|
| 1546 |
+
/**
|
| 1547 |
+
* The unique identifier as assigned to the institution.
|
| 1548 |
+
* @access public
|
| 1549 |
+
* @var string
|
| 1550 |
+
*/
|
| 1551 |
+
public $institutionId;
|
| 1552 |
+
|
| 1553 |
+
/**
|
| 1554 |
+
* The first (given) name of the end consumer as known by the
|
| 1555 |
+
* institution.
|
| 1556 |
+
* @access public
|
| 1557 |
+
* @var string
|
| 1558 |
+
*/
|
| 1559 |
+
public $firstName;
|
| 1560 |
+
|
| 1561 |
+
/**
|
| 1562 |
+
* The last (family) name of the end consumer as known by the
|
| 1563 |
+
* institution.
|
| 1564 |
+
* @access public
|
| 1565 |
+
* @var string
|
| 1566 |
+
*/
|
| 1567 |
+
public $lastName;
|
| 1568 |
+
|
| 1569 |
+
/**
|
| 1570 |
+
* The full name of the end consumer as known by the
|
| 1571 |
+
* institution.
|
| 1572 |
+
* @access public
|
| 1573 |
+
* @var string
|
| 1574 |
+
*/
|
| 1575 |
+
public $displayName;
|
| 1576 |
+
|
| 1577 |
+
/**
|
| 1578 |
+
* The unique identifier as assigned to the end consumer by the
|
| 1579 |
+
* institution.
|
| 1580 |
+
* @access public
|
| 1581 |
+
* @var string
|
| 1582 |
+
*/
|
| 1583 |
+
public $institutionCustomerId;
|
| 1584 |
+
|
| 1585 |
+
/**
|
| 1586 |
+
* The two-character ISO country code of the home country of
|
| 1587 |
+
* the end consumer
|
| 1588 |
+
* @access public
|
| 1589 |
+
* @var string
|
| 1590 |
+
*/
|
| 1591 |
+
public $countryCode;
|
| 1592 |
+
|
| 1593 |
+
/**
|
| 1594 |
+
*
|
| 1595 |
+
* @access public
|
| 1596 |
+
* @var string
|
| 1597 |
+
*/
|
| 1598 |
+
public $email;
|
| 1599 |
+
|
| 1600 |
+
/**
|
| 1601 |
+
* Constructor with arguments
|
| 1602 |
+
*/
|
| 1603 |
+
public function __construct( $institutionId = null, $firstName = null, $lastName = null, $displayName = null, $institutionCustomerId = null, $countryCode = null )
|
| 1604 |
+
{
|
| 1605 |
+
$this->institutionId = $institutionId;
|
| 1606 |
+
$this->firstName = $firstName;
|
| 1607 |
+
$this->lastName = $lastName;
|
| 1608 |
+
$this->displayName = $displayName;
|
| 1609 |
+
$this->institutionCustomerId = $institutionCustomerId;
|
| 1610 |
+
$this->countryCode = $countryCode;
|
| 1611 |
+
}
|
| 1612 |
+
|
| 1613 |
+
|
| 1614 |
+
public function toNVPString( $prefix = '' )
|
| 1615 |
+
{
|
| 1616 |
+
$str = '';
|
| 1617 |
+
$delim = '';
|
| 1618 |
+
if ( $this->institutionId != null ) {
|
| 1619 |
+
$str .= $delim . $prefix . 'institutionId=' . urlencode( $this->institutionId );
|
| 1620 |
+
$delim = '&';
|
| 1621 |
+
}
|
| 1622 |
+
if ( $this->firstName != null ) {
|
| 1623 |
+
$str .= $delim . $prefix . 'firstName=' . urlencode( $this->firstName );
|
| 1624 |
+
$delim = '&';
|
| 1625 |
+
}
|
| 1626 |
+
if ( $this->lastName != null ) {
|
| 1627 |
+
$str .= $delim . $prefix . 'lastName=' . urlencode( $this->lastName );
|
| 1628 |
+
$delim = '&';
|
| 1629 |
+
}
|
| 1630 |
+
if ( $this->displayName != null ) {
|
| 1631 |
+
$str .= $delim . $prefix . 'displayName=' . urlencode( $this->displayName );
|
| 1632 |
+
$delim = '&';
|
| 1633 |
+
}
|
| 1634 |
+
if ( $this->institutionCustomerId != null ) {
|
| 1635 |
+
$str .= $delim . $prefix . 'institutionCustomerId=' . urlencode( $this->institutionCustomerId );
|
| 1636 |
+
$delim = '&';
|
| 1637 |
+
}
|
| 1638 |
+
if ( $this->countryCode != null ) {
|
| 1639 |
+
$str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
|
| 1640 |
+
$delim = '&';
|
| 1641 |
+
}
|
| 1642 |
+
if ( $this->email != null ) {
|
| 1643 |
+
$str .= $delim . $prefix . 'email=' . urlencode( $this->email );
|
| 1644 |
+
$delim = '&';
|
| 1645 |
+
}
|
| 1646 |
+
|
| 1647 |
+
return $str;
|
| 1648 |
+
}
|
| 1649 |
+
|
| 1650 |
+
public function init( $map = null, $prefix = '' )
|
| 1651 |
+
{
|
| 1652 |
+
if ( $map != null ) {
|
| 1653 |
+
$mapKeyName = $prefix . 'institutionId';
|
| 1654 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1655 |
+
$this->institutionId = $map[ $mapKeyName ];
|
| 1656 |
+
}
|
| 1657 |
+
$mapKeyName = $prefix . 'firstName';
|
| 1658 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1659 |
+
$this->firstName = $map[ $mapKeyName ];
|
| 1660 |
+
}
|
| 1661 |
+
$mapKeyName = $prefix . 'lastName';
|
| 1662 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1663 |
+
$this->lastName = $map[ $mapKeyName ];
|
| 1664 |
+
}
|
| 1665 |
+
$mapKeyName = $prefix . 'displayName';
|
| 1666 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1667 |
+
$this->displayName = $map[ $mapKeyName ];
|
| 1668 |
+
}
|
| 1669 |
+
$mapKeyName = $prefix . 'institutionCustomerId';
|
| 1670 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1671 |
+
$this->institutionCustomerId = $map[ $mapKeyName ];
|
| 1672 |
+
}
|
| 1673 |
+
$mapKeyName = $prefix . 'countryCode';
|
| 1674 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1675 |
+
$this->countryCode = $map[ $mapKeyName ];
|
| 1676 |
+
}
|
| 1677 |
+
$mapKeyName = $prefix . 'email';
|
| 1678 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1679 |
+
$this->email = $map[ $mapKeyName ];
|
| 1680 |
+
}
|
| 1681 |
+
|
| 1682 |
+
}
|
| 1683 |
+
}
|
| 1684 |
+
}
|
| 1685 |
+
|
| 1686 |
+
|
| 1687 |
+
/**
|
| 1688 |
+
* Describes an individual item for an invoice.
|
| 1689 |
+
*/
|
| 1690 |
+
class InvoiceItem
|
| 1691 |
+
{
|
| 1692 |
+
|
| 1693 |
+
/**
|
| 1694 |
+
*
|
| 1695 |
+
* @access public
|
| 1696 |
+
* @var string
|
| 1697 |
+
*/
|
| 1698 |
+
public $name;
|
| 1699 |
+
|
| 1700 |
+
/**
|
| 1701 |
+
*
|
| 1702 |
+
* @access public
|
| 1703 |
+
* @var string
|
| 1704 |
+
*/
|
| 1705 |
+
public $identifier;
|
| 1706 |
+
|
| 1707 |
+
/**
|
| 1708 |
+
*
|
| 1709 |
+
* @access public
|
| 1710 |
+
* @var double
|
| 1711 |
+
*/
|
| 1712 |
+
public $price;
|
| 1713 |
+
|
| 1714 |
+
/**
|
| 1715 |
+
*
|
| 1716 |
+
* @access public
|
| 1717 |
+
* @var double
|
| 1718 |
+
*/
|
| 1719 |
+
public $itemPrice;
|
| 1720 |
+
|
| 1721 |
+
/**
|
| 1722 |
+
*
|
| 1723 |
+
* @access public
|
| 1724 |
+
* @var integer
|
| 1725 |
+
*/
|
| 1726 |
+
public $itemCount;
|
| 1727 |
+
|
| 1728 |
+
|
| 1729 |
+
public function toNVPString( $prefix = '' )
|
| 1730 |
+
{
|
| 1731 |
+
$str = '';
|
| 1732 |
+
$delim = '';
|
| 1733 |
+
if ( $this->name != null ) {
|
| 1734 |
+
$str .= $delim . $prefix . 'name=' . urlencode( $this->name );
|
| 1735 |
+
$delim = '&';
|
| 1736 |
+
}
|
| 1737 |
+
if ( $this->identifier != null ) {
|
| 1738 |
+
$str .= $delim . $prefix . 'identifier=' . urlencode( $this->identifier );
|
| 1739 |
+
$delim = '&';
|
| 1740 |
+
}
|
| 1741 |
+
if ( $this->price != null ) {
|
| 1742 |
+
$str .= $delim . $prefix . 'price=' . urlencode( $this->price );
|
| 1743 |
+
$delim = '&';
|
| 1744 |
+
}
|
| 1745 |
+
if ( $this->itemPrice != null ) {
|
| 1746 |
+
$str .= $delim . $prefix . 'itemPrice=' . urlencode( $this->itemPrice );
|
| 1747 |
+
$delim = '&';
|
| 1748 |
+
}
|
| 1749 |
+
if ( $this->itemCount != null ) {
|
| 1750 |
+
$str .= $delim . $prefix . 'itemCount=' . urlencode( $this->itemCount );
|
| 1751 |
+
$delim = '&';
|
| 1752 |
+
}
|
| 1753 |
+
|
| 1754 |
+
return $str;
|
| 1755 |
+
}
|
| 1756 |
+
|
| 1757 |
+
public function init( $map = null, $prefix = '' )
|
| 1758 |
+
{
|
| 1759 |
+
if ( $map != null ) {
|
| 1760 |
+
$mapKeyName = $prefix . 'name';
|
| 1761 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1762 |
+
$this->name = $map[ $mapKeyName ];
|
| 1763 |
+
}
|
| 1764 |
+
$mapKeyName = $prefix . 'identifier';
|
| 1765 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1766 |
+
$this->identifier = $map[ $mapKeyName ];
|
| 1767 |
+
}
|
| 1768 |
+
$mapKeyName = $prefix . 'price';
|
| 1769 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1770 |
+
$this->price = $map[ $mapKeyName ];
|
| 1771 |
+
}
|
| 1772 |
+
$mapKeyName = $prefix . 'itemPrice';
|
| 1773 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1774 |
+
$this->itemPrice = $map[ $mapKeyName ];
|
| 1775 |
+
}
|
| 1776 |
+
$mapKeyName = $prefix . 'itemCount';
|
| 1777 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1778 |
+
$this->itemCount = $map[ $mapKeyName ];
|
| 1779 |
+
}
|
| 1780 |
+
|
| 1781 |
+
}
|
| 1782 |
+
}
|
| 1783 |
+
}
|
| 1784 |
+
|
| 1785 |
+
|
| 1786 |
+
/**
|
| 1787 |
+
* Describes a payment for a particular receiver (merchant),
|
| 1788 |
+
* contains list of additional per item details.
|
| 1789 |
+
*/
|
| 1790 |
+
class InvoiceData
|
| 1791 |
+
{
|
| 1792 |
+
|
| 1793 |
+
/**
|
| 1794 |
+
*
|
| 1795 |
+
* @array
|
| 1796 |
+
* @access public
|
| 1797 |
+
* @var InvoiceItem
|
| 1798 |
+
*/
|
| 1799 |
+
public $item;
|
| 1800 |
+
|
| 1801 |
+
/**
|
| 1802 |
+
*
|
| 1803 |
+
* @access public
|
| 1804 |
+
* @var double
|
| 1805 |
+
*/
|
| 1806 |
+
public $totalTax;
|
| 1807 |
+
|
| 1808 |
+
/**
|
| 1809 |
+
*
|
| 1810 |
+
* @access public
|
| 1811 |
+
* @var double
|
| 1812 |
+
*/
|
| 1813 |
+
public $totalShipping;
|
| 1814 |
+
|
| 1815 |
+
|
| 1816 |
+
public function toNVPString( $prefix = '' )
|
| 1817 |
+
{
|
| 1818 |
+
$str = '';
|
| 1819 |
+
$delim = '';
|
| 1820 |
+
for ( $i = 0; $i < count( $this->item ); $i++ ) {
|
| 1821 |
+
$newPrefix = $prefix . "item($i).";
|
| 1822 |
+
$str .= $delim . call_user_func( array( $this->item[ $i ], 'toNVPString' ), $newPrefix );
|
| 1823 |
+
$delim = '&';
|
| 1824 |
+
}
|
| 1825 |
+
if ( $this->totalTax != null ) {
|
| 1826 |
+
$str .= $delim . $prefix . 'totalTax=' . urlencode( $this->totalTax );
|
| 1827 |
+
$delim = '&';
|
| 1828 |
+
}
|
| 1829 |
+
if ( $this->totalShipping != null ) {
|
| 1830 |
+
$str .= $delim . $prefix . 'totalShipping=' . urlencode( $this->totalShipping );
|
| 1831 |
+
$delim = '&';
|
| 1832 |
+
}
|
| 1833 |
+
|
| 1834 |
+
return $str;
|
| 1835 |
+
}
|
| 1836 |
+
|
| 1837 |
+
public function init( $map = null, $prefix = '' )
|
| 1838 |
+
{
|
| 1839 |
+
if ( $map != null ) {
|
| 1840 |
+
$i = 0;
|
| 1841 |
+
while ( true ) {
|
| 1842 |
+
if ( PPUtils::array_match_key( $map, $prefix . "item($i)" ) ) {
|
| 1843 |
+
$newPrefix = $prefix . "item($i).";
|
| 1844 |
+
$this->item[ $i ] = new InvoiceItem();
|
| 1845 |
+
$this->item[ $i ]->init( $map, $newPrefix );
|
| 1846 |
+
} else {
|
| 1847 |
+
break;
|
| 1848 |
+
}
|
| 1849 |
+
$i++;
|
| 1850 |
+
}
|
| 1851 |
+
$mapKeyName = $prefix . 'totalTax';
|
| 1852 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1853 |
+
$this->totalTax = $map[ $mapKeyName ];
|
| 1854 |
+
}
|
| 1855 |
+
$mapKeyName = $prefix . 'totalShipping';
|
| 1856 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 1857 |
+
$this->totalShipping = $map[ $mapKeyName ];
|
| 1858 |
+
}
|
| 1859 |
+
|
| 1860 |
+
}
|
| 1861 |
+
}
|
| 1862 |
+
}
|
| 1863 |
+
|
| 1864 |
+
|
| 1865 |
+
/**
|
| 1866 |
+
* The error that resulted from an attempt to make a payment to
|
| 1867 |
+
* a receiver.
|
| 1868 |
+
*/
|
| 1869 |
+
class PayError
|
| 1870 |
+
{
|
| 1871 |
+
|
| 1872 |
+
/**
|
| 1873 |
+
*
|
| 1874 |
+
* @access public
|
| 1875 |
+
* @var Receiver
|
| 1876 |
+
*/
|
| 1877 |
+
public $receiver;
|
| 1878 |
+
|
| 1879 |
+
/**
|
| 1880 |
+
*
|
| 1881 |
+
* @access public
|
| 1882 |
+
* @var ErrorData
|
| 1883 |
+
*/
|
| 1884 |
+
public $error;
|
| 1885 |
+
|
| 1886 |
+
|
| 1887 |
+
public function init( $map = null, $prefix = '' )
|
| 1888 |
+
{
|
| 1889 |
+
if ( $map != null ) {
|
| 1890 |
+
if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
|
| 1891 |
+
$newPrefix = $prefix . "receiver.";
|
| 1892 |
+
$this->receiver = new Receiver();
|
| 1893 |
+
$this->receiver->init( $map, $newPrefix );
|
| 1894 |
+
}
|
| 1895 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error." ) ) {
|
| 1896 |
+
$newPrefix = $prefix . "error.";
|
| 1897 |
+
$this->error = new ErrorData();
|
| 1898 |
+
$this->error->init( $map, $newPrefix );
|
| 1899 |
+
}
|
| 1900 |
+
|
| 1901 |
+
}
|
| 1902 |
+
}
|
| 1903 |
+
}
|
| 1904 |
+
|
| 1905 |
+
|
| 1906 |
+
/**
|
| 1907 |
+
*
|
| 1908 |
+
*/
|
| 1909 |
+
class PayErrorList
|
| 1910 |
+
{
|
| 1911 |
+
|
| 1912 |
+
/**
|
| 1913 |
+
*
|
| 1914 |
+
* @array
|
| 1915 |
+
* @access public
|
| 1916 |
+
* @var PayError
|
| 1917 |
+
*/
|
| 1918 |
+
public $payError;
|
| 1919 |
+
|
| 1920 |
+
|
| 1921 |
+
public function init( $map = null, $prefix = '' )
|
| 1922 |
+
{
|
| 1923 |
+
if ( $map != null ) {
|
| 1924 |
+
$i = 0;
|
| 1925 |
+
while ( true ) {
|
| 1926 |
+
if ( PPUtils::array_match_key( $map, $prefix . "payError($i)" ) ) {
|
| 1927 |
+
$newPrefix = $prefix . "payError($i).";
|
| 1928 |
+
$this->payError[ $i ] = new PayError();
|
| 1929 |
+
$this->payError[ $i ]->init( $map, $newPrefix );
|
| 1930 |
+
} else {
|
| 1931 |
+
break;
|
| 1932 |
+
}
|
| 1933 |
+
$i++;
|
| 1934 |
+
}
|
| 1935 |
+
|
| 1936 |
+
}
|
| 1937 |
+
}
|
| 1938 |
+
}
|
| 1939 |
+
|
| 1940 |
+
|
| 1941 |
+
/**
|
| 1942 |
+
* PaymentInfo represents the payment attempt made to a
|
| 1943 |
+
* Receiver of a PayRequest. If the execution of the payment
|
| 1944 |
+
* has not yet completed, there will not be any transaction
|
| 1945 |
+
* details.
|
| 1946 |
+
*/
|
| 1947 |
+
class PaymentInfo
|
| 1948 |
+
{
|
| 1949 |
+
|
| 1950 |
+
/**
|
| 1951 |
+
*
|
| 1952 |
+
* @access public
|
| 1953 |
+
* @var string
|
| 1954 |
+
*/
|
| 1955 |
+
public $transactionId;
|
| 1956 |
+
|
| 1957 |
+
/**
|
| 1958 |
+
*
|
| 1959 |
+
* @access public
|
| 1960 |
+
* @var string
|
| 1961 |
+
*/
|
| 1962 |
+
public $transactionStatus;
|
| 1963 |
+
|
| 1964 |
+
/**
|
| 1965 |
+
*
|
| 1966 |
+
* @access public
|
| 1967 |
+
* @var Receiver
|
| 1968 |
+
*/
|
| 1969 |
+
public $receiver;
|
| 1970 |
+
|
| 1971 |
+
/**
|
| 1972 |
+
*
|
| 1973 |
+
* @access public
|
| 1974 |
+
* @var double
|
| 1975 |
+
*/
|
| 1976 |
+
public $refundedAmount;
|
| 1977 |
+
|
| 1978 |
+
/**
|
| 1979 |
+
*
|
| 1980 |
+
* @access public
|
| 1981 |
+
* @var boolean
|
| 1982 |
+
*/
|
| 1983 |
+
public $pendingRefund;
|
| 1984 |
+
|
| 1985 |
+
/**
|
| 1986 |
+
*
|
| 1987 |
+
* @access public
|
| 1988 |
+
* @var string
|
| 1989 |
+
*/
|
| 1990 |
+
public $senderTransactionId;
|
| 1991 |
+
|
| 1992 |
+
/**
|
| 1993 |
+
*
|
| 1994 |
+
* @access public
|
| 1995 |
+
* @var string
|
| 1996 |
+
*/
|
| 1997 |
+
public $senderTransactionStatus;
|
| 1998 |
+
|
| 1999 |
+
/**
|
| 2000 |
+
*
|
| 2001 |
+
* @access public
|
| 2002 |
+
* @var string
|
| 2003 |
+
*/
|
| 2004 |
+
public $pendingReason;
|
| 2005 |
+
|
| 2006 |
+
|
| 2007 |
+
public function init( $map = null, $prefix = '' )
|
| 2008 |
+
{
|
| 2009 |
+
if ( $map != null ) {
|
| 2010 |
+
$mapKeyName = $prefix . 'transactionId';
|
| 2011 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2012 |
+
$this->transactionId = $map[ $mapKeyName ];
|
| 2013 |
+
}
|
| 2014 |
+
$mapKeyName = $prefix . 'transactionStatus';
|
| 2015 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2016 |
+
$this->transactionStatus = $map[ $mapKeyName ];
|
| 2017 |
+
}
|
| 2018 |
+
if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
|
| 2019 |
+
$newPrefix = $prefix . "receiver.";
|
| 2020 |
+
$this->receiver = new Receiver();
|
| 2021 |
+
$this->receiver->init( $map, $newPrefix );
|
| 2022 |
+
}
|
| 2023 |
+
$mapKeyName = $prefix . 'refundedAmount';
|
| 2024 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2025 |
+
$this->refundedAmount = $map[ $mapKeyName ];
|
| 2026 |
+
}
|
| 2027 |
+
$mapKeyName = $prefix . 'pendingRefund';
|
| 2028 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2029 |
+
$this->pendingRefund = $map[ $mapKeyName ];
|
| 2030 |
+
}
|
| 2031 |
+
$mapKeyName = $prefix . 'senderTransactionId';
|
| 2032 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2033 |
+
$this->senderTransactionId = $map[ $mapKeyName ];
|
| 2034 |
+
}
|
| 2035 |
+
$mapKeyName = $prefix . 'senderTransactionStatus';
|
| 2036 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2037 |
+
$this->senderTransactionStatus = $map[ $mapKeyName ];
|
| 2038 |
+
}
|
| 2039 |
+
$mapKeyName = $prefix . 'pendingReason';
|
| 2040 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2041 |
+
$this->pendingReason = $map[ $mapKeyName ];
|
| 2042 |
+
}
|
| 2043 |
+
|
| 2044 |
+
}
|
| 2045 |
+
}
|
| 2046 |
+
}
|
| 2047 |
+
|
| 2048 |
+
|
| 2049 |
+
/**
|
| 2050 |
+
*
|
| 2051 |
+
*/
|
| 2052 |
+
class PaymentInfoList
|
| 2053 |
+
{
|
| 2054 |
+
|
| 2055 |
+
/**
|
| 2056 |
+
*
|
| 2057 |
+
* @array
|
| 2058 |
+
* @access public
|
| 2059 |
+
* @var PaymentInfo
|
| 2060 |
+
*/
|
| 2061 |
+
public $paymentInfo;
|
| 2062 |
+
|
| 2063 |
+
|
| 2064 |
+
public function init( $map = null, $prefix = '' )
|
| 2065 |
+
{
|
| 2066 |
+
if ( $map != null ) {
|
| 2067 |
+
$i = 0;
|
| 2068 |
+
while ( true ) {
|
| 2069 |
+
if ( PPUtils::array_match_key( $map, $prefix . "paymentInfo($i)" ) ) {
|
| 2070 |
+
$newPrefix = $prefix . "paymentInfo($i).";
|
| 2071 |
+
$this->paymentInfo[ $i ] = new PaymentInfo();
|
| 2072 |
+
$this->paymentInfo[ $i ]->init( $map, $newPrefix );
|
| 2073 |
+
} else {
|
| 2074 |
+
break;
|
| 2075 |
+
}
|
| 2076 |
+
$i++;
|
| 2077 |
+
}
|
| 2078 |
+
|
| 2079 |
+
}
|
| 2080 |
+
}
|
| 2081 |
+
}
|
| 2082 |
+
|
| 2083 |
+
|
| 2084 |
+
/**
|
| 2085 |
+
* Receiver is the party where funds are transferred to. A
|
| 2086 |
+
* primary receiver receives a payment directly from the sender
|
| 2087 |
+
* in a chained split payment. A primary receiver should not be
|
| 2088 |
+
* specified when making a single or parallel split payment.
|
| 2089 |
+
*/
|
| 2090 |
+
class Receiver
|
| 2091 |
+
{
|
| 2092 |
+
|
| 2093 |
+
/**
|
| 2094 |
+
*
|
| 2095 |
+
* @access public
|
| 2096 |
+
* @var double
|
| 2097 |
+
*/
|
| 2098 |
+
public $amount;
|
| 2099 |
+
|
| 2100 |
+
/**
|
| 2101 |
+
*
|
| 2102 |
+
* @access public
|
| 2103 |
+
* @var string
|
| 2104 |
+
*/
|
| 2105 |
+
public $email;
|
| 2106 |
+
|
| 2107 |
+
/**
|
| 2108 |
+
*
|
| 2109 |
+
* @access public
|
| 2110 |
+
* @var PhoneNumberType
|
| 2111 |
+
*/
|
| 2112 |
+
public $phone;
|
| 2113 |
+
|
| 2114 |
+
/**
|
| 2115 |
+
*
|
| 2116 |
+
* @access public
|
| 2117 |
+
* @var boolean
|
| 2118 |
+
*/
|
| 2119 |
+
public $primary;
|
| 2120 |
+
|
| 2121 |
+
/**
|
| 2122 |
+
*
|
| 2123 |
+
* @access public
|
| 2124 |
+
* @var string
|
| 2125 |
+
*/
|
| 2126 |
+
public $invoiceId;
|
| 2127 |
+
|
| 2128 |
+
/**
|
| 2129 |
+
*
|
| 2130 |
+
* @access public
|
| 2131 |
+
* @var string
|
| 2132 |
+
*/
|
| 2133 |
+
public $paymentType;
|
| 2134 |
+
|
| 2135 |
+
/**
|
| 2136 |
+
*
|
| 2137 |
+
* @access public
|
| 2138 |
+
* @var string
|
| 2139 |
+
*/
|
| 2140 |
+
public $paymentSubType;
|
| 2141 |
+
|
| 2142 |
+
/**
|
| 2143 |
+
* Constructor with arguments
|
| 2144 |
+
*/
|
| 2145 |
+
public function __construct( $amount = null )
|
| 2146 |
+
{
|
| 2147 |
+
$this->amount = $amount;
|
| 2148 |
+
}
|
| 2149 |
+
|
| 2150 |
+
|
| 2151 |
+
public function toNVPString( $prefix = '' )
|
| 2152 |
+
{
|
| 2153 |
+
$str = '';
|
| 2154 |
+
$delim = '';
|
| 2155 |
+
if ( $this->amount != null ) {
|
| 2156 |
+
$str .= $delim . $prefix . 'amount=' . urlencode( $this->amount );
|
| 2157 |
+
$delim = '&';
|
| 2158 |
+
}
|
| 2159 |
+
if ( $this->email != null ) {
|
| 2160 |
+
$str .= $delim . $prefix . 'email=' . urlencode( $this->email );
|
| 2161 |
+
$delim = '&';
|
| 2162 |
+
}
|
| 2163 |
+
if ( $this->phone != null ) {
|
| 2164 |
+
$newPrefix = $prefix . 'phone.';
|
| 2165 |
+
$str .= $delim . call_user_func( array( $this->phone, 'toNVPString' ), $newPrefix );
|
| 2166 |
+
$delim = '&';
|
| 2167 |
+
}
|
| 2168 |
+
if ( $this->primary != null ) {
|
| 2169 |
+
$str .= $delim . $prefix . 'primary=' . urlencode( $this->primary );
|
| 2170 |
+
$delim = '&';
|
| 2171 |
+
}
|
| 2172 |
+
if ( $this->invoiceId != null ) {
|
| 2173 |
+
$str .= $delim . $prefix . 'invoiceId=' . urlencode( $this->invoiceId );
|
| 2174 |
+
$delim = '&';
|
| 2175 |
+
}
|
| 2176 |
+
if ( $this->paymentType != null ) {
|
| 2177 |
+
$str .= $delim . $prefix . 'paymentType=' . urlencode( $this->paymentType );
|
| 2178 |
+
$delim = '&';
|
| 2179 |
+
}
|
| 2180 |
+
if ( $this->paymentSubType != null ) {
|
| 2181 |
+
$str .= $delim . $prefix . 'paymentSubType=' . urlencode( $this->paymentSubType );
|
| 2182 |
+
$delim = '&';
|
| 2183 |
+
}
|
| 2184 |
+
|
| 2185 |
+
return $str;
|
| 2186 |
+
}
|
| 2187 |
+
|
| 2188 |
+
public function init( $map = null, $prefix = '' )
|
| 2189 |
+
{
|
| 2190 |
+
if ( $map != null ) {
|
| 2191 |
+
$mapKeyName = $prefix . 'amount';
|
| 2192 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2193 |
+
$this->amount = $map[ $mapKeyName ];
|
| 2194 |
+
}
|
| 2195 |
+
$mapKeyName = $prefix . 'email';
|
| 2196 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2197 |
+
$this->email = $map[ $mapKeyName ];
|
| 2198 |
+
}
|
| 2199 |
+
if ( PPUtils::array_match_key( $map, $prefix . "phone." ) ) {
|
| 2200 |
+
$newPrefix = $prefix . "phone.";
|
| 2201 |
+
$this->phone = new PhoneNumberType();
|
| 2202 |
+
$this->phone->init( $map, $newPrefix );
|
| 2203 |
+
}
|
| 2204 |
+
$mapKeyName = $prefix . 'primary';
|
| 2205 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2206 |
+
$this->primary = $map[ $mapKeyName ];
|
| 2207 |
+
}
|
| 2208 |
+
$mapKeyName = $prefix . 'invoiceId';
|
| 2209 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2210 |
+
$this->invoiceId = $map[ $mapKeyName ];
|
| 2211 |
+
}
|
| 2212 |
+
$mapKeyName = $prefix . 'paymentType';
|
| 2213 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2214 |
+
$this->paymentType = $map[ $mapKeyName ];
|
| 2215 |
+
}
|
| 2216 |
+
$mapKeyName = $prefix . 'paymentSubType';
|
| 2217 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2218 |
+
$this->paymentSubType = $map[ $mapKeyName ];
|
| 2219 |
+
}
|
| 2220 |
+
|
| 2221 |
+
}
|
| 2222 |
+
}
|
| 2223 |
+
}
|
| 2224 |
+
|
| 2225 |
+
|
| 2226 |
+
/**
|
| 2227 |
+
*
|
| 2228 |
+
*/
|
| 2229 |
+
class ReceiverList
|
| 2230 |
+
{
|
| 2231 |
+
|
| 2232 |
+
/**
|
| 2233 |
+
*
|
| 2234 |
+
* @array
|
| 2235 |
+
* @access public
|
| 2236 |
+
* @var Receiver
|
| 2237 |
+
*/
|
| 2238 |
+
public $receiver;
|
| 2239 |
+
|
| 2240 |
+
/**
|
| 2241 |
+
* Constructor with arguments
|
| 2242 |
+
*/
|
| 2243 |
+
public function __construct( $receiver = null )
|
| 2244 |
+
{
|
| 2245 |
+
$this->receiver = $receiver;
|
| 2246 |
+
}
|
| 2247 |
+
|
| 2248 |
+
|
| 2249 |
+
public function toNVPString( $prefix = '' )
|
| 2250 |
+
{
|
| 2251 |
+
$str = '';
|
| 2252 |
+
$delim = '';
|
| 2253 |
+
for ( $i = 0; $i < count( $this->receiver ); $i++ ) {
|
| 2254 |
+
$newPrefix = $prefix . "receiver($i).";
|
| 2255 |
+
$str .= $delim . call_user_func( array( $this->receiver[ $i ], 'toNVPString' ), $newPrefix );
|
| 2256 |
+
$delim = '&';
|
| 2257 |
+
}
|
| 2258 |
+
|
| 2259 |
+
return $str;
|
| 2260 |
+
}
|
| 2261 |
+
|
| 2262 |
+
}
|
| 2263 |
+
|
| 2264 |
+
|
| 2265 |
+
/**
|
| 2266 |
+
* The sender identifier type contains information to identify
|
| 2267 |
+
* a PayPal account.
|
| 2268 |
+
*/
|
| 2269 |
+
class ReceiverIdentifier extends AccountIdentifier
|
| 2270 |
+
{
|
| 2271 |
+
|
| 2272 |
+
|
| 2273 |
+
public function toNVPString( $prefix = '' )
|
| 2274 |
+
{
|
| 2275 |
+
$str = parent::toNVPString( $prefix );
|
| 2276 |
+
if ( strlen( $str ) > 0 ) {
|
| 2277 |
+
$delim = '&';
|
| 2278 |
+
} else {
|
| 2279 |
+
$delim = '';
|
| 2280 |
+
}
|
| 2281 |
+
|
| 2282 |
+
return $str;
|
| 2283 |
+
}
|
| 2284 |
+
|
| 2285 |
+
public function init( $map = null, $prefix = '' )
|
| 2286 |
+
{
|
| 2287 |
+
if ( $map != null ) {
|
| 2288 |
+
|
| 2289 |
+
}
|
| 2290 |
+
}
|
| 2291 |
+
}
|
| 2292 |
+
|
| 2293 |
+
|
| 2294 |
+
/**
|
| 2295 |
+
* Options that apply to the receiver of a payment, allows
|
| 2296 |
+
* setting additional details for payment using invoice.
|
| 2297 |
+
*/
|
| 2298 |
+
class ReceiverOptions
|
| 2299 |
+
{
|
| 2300 |
+
|
| 2301 |
+
/**
|
| 2302 |
+
*
|
| 2303 |
+
* @access public
|
| 2304 |
+
* @var string
|
| 2305 |
+
*/
|
| 2306 |
+
public $description;
|
| 2307 |
+
|
| 2308 |
+
/**
|
| 2309 |
+
*
|
| 2310 |
+
* @access public
|
| 2311 |
+
* @var string
|
| 2312 |
+
*/
|
| 2313 |
+
public $customId;
|
| 2314 |
+
|
| 2315 |
+
/**
|
| 2316 |
+
*
|
| 2317 |
+
* @access public
|
| 2318 |
+
* @var InvoiceData
|
| 2319 |
+
*/
|
| 2320 |
+
public $invoiceData;
|
| 2321 |
+
|
| 2322 |
+
/**
|
| 2323 |
+
*
|
| 2324 |
+
* @access public
|
| 2325 |
+
* @var ReceiverIdentifier
|
| 2326 |
+
*/
|
| 2327 |
+
public $receiver;
|
| 2328 |
+
|
| 2329 |
+
/**
|
| 2330 |
+
*
|
| 2331 |
+
* @access public
|
| 2332 |
+
* @var string
|
| 2333 |
+
*/
|
| 2334 |
+
public $referrerCode;
|
| 2335 |
+
|
| 2336 |
+
/**
|
| 2337 |
+
* Constructor with arguments
|
| 2338 |
+
*/
|
| 2339 |
+
public function __construct( $receiver = null )
|
| 2340 |
+
{
|
| 2341 |
+
$this->receiver = $receiver;
|
| 2342 |
+
}
|
| 2343 |
+
|
| 2344 |
+
|
| 2345 |
+
public function toNVPString( $prefix = '' )
|
| 2346 |
+
{
|
| 2347 |
+
$str = '';
|
| 2348 |
+
$delim = '';
|
| 2349 |
+
if ( $this->description != null ) {
|
| 2350 |
+
$str .= $delim . $prefix . 'description=' . urlencode( $this->description );
|
| 2351 |
+
$delim = '&';
|
| 2352 |
+
}
|
| 2353 |
+
if ( $this->customId != null ) {
|
| 2354 |
+
$str .= $delim . $prefix . 'customId=' . urlencode( $this->customId );
|
| 2355 |
+
$delim = '&';
|
| 2356 |
+
}
|
| 2357 |
+
if ( $this->invoiceData != null ) {
|
| 2358 |
+
$newPrefix = $prefix . 'invoiceData.';
|
| 2359 |
+
$str .= $delim . call_user_func( array( $this->invoiceData, 'toNVPString' ), $newPrefix );
|
| 2360 |
+
$delim = '&';
|
| 2361 |
+
}
|
| 2362 |
+
if ( $this->receiver != null ) {
|
| 2363 |
+
$newPrefix = $prefix . 'receiver.';
|
| 2364 |
+
$str .= $delim . call_user_func( array( $this->receiver, 'toNVPString' ), $newPrefix );
|
| 2365 |
+
$delim = '&';
|
| 2366 |
+
}
|
| 2367 |
+
if ( $this->referrerCode != null ) {
|
| 2368 |
+
$str .= $delim . $prefix . 'referrerCode=' . urlencode( $this->referrerCode );
|
| 2369 |
+
$delim = '&';
|
| 2370 |
+
}
|
| 2371 |
+
|
| 2372 |
+
return $str;
|
| 2373 |
+
}
|
| 2374 |
+
|
| 2375 |
+
public function init( $map = null, $prefix = '' )
|
| 2376 |
+
{
|
| 2377 |
+
if ( $map != null ) {
|
| 2378 |
+
$mapKeyName = $prefix . 'description';
|
| 2379 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2380 |
+
$this->description = $map[ $mapKeyName ];
|
| 2381 |
+
}
|
| 2382 |
+
$mapKeyName = $prefix . 'customId';
|
| 2383 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2384 |
+
$this->customId = $map[ $mapKeyName ];
|
| 2385 |
+
}
|
| 2386 |
+
if ( PPUtils::array_match_key( $map, $prefix . "invoiceData." ) ) {
|
| 2387 |
+
$newPrefix = $prefix . "invoiceData.";
|
| 2388 |
+
$this->invoiceData = new InvoiceData();
|
| 2389 |
+
$this->invoiceData->init( $map, $newPrefix );
|
| 2390 |
+
}
|
| 2391 |
+
if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
|
| 2392 |
+
$newPrefix = $prefix . "receiver.";
|
| 2393 |
+
$this->receiver = new ReceiverIdentifier();
|
| 2394 |
+
$this->receiver->init( $map, $newPrefix );
|
| 2395 |
+
}
|
| 2396 |
+
$mapKeyName = $prefix . 'referrerCode';
|
| 2397 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2398 |
+
$this->referrerCode = $map[ $mapKeyName ];
|
| 2399 |
+
}
|
| 2400 |
+
|
| 2401 |
+
}
|
| 2402 |
+
}
|
| 2403 |
+
}
|
| 2404 |
+
|
| 2405 |
+
|
| 2406 |
+
/**
|
| 2407 |
+
* RefundInfo represents the refund attempt made to a Receiver
|
| 2408 |
+
* of a PayRequest.
|
| 2409 |
+
*/
|
| 2410 |
+
class RefundInfo
|
| 2411 |
+
{
|
| 2412 |
+
|
| 2413 |
+
/**
|
| 2414 |
+
*
|
| 2415 |
+
* @access public
|
| 2416 |
+
* @var Receiver
|
| 2417 |
+
*/
|
| 2418 |
+
public $receiver;
|
| 2419 |
+
|
| 2420 |
+
/**
|
| 2421 |
+
*
|
| 2422 |
+
* @access public
|
| 2423 |
+
* @var string
|
| 2424 |
+
*/
|
| 2425 |
+
public $refundStatus;
|
| 2426 |
+
|
| 2427 |
+
/**
|
| 2428 |
+
*
|
| 2429 |
+
* @access public
|
| 2430 |
+
* @var double
|
| 2431 |
+
*/
|
| 2432 |
+
public $refundNetAmount;
|
| 2433 |
+
|
| 2434 |
+
/**
|
| 2435 |
+
*
|
| 2436 |
+
* @access public
|
| 2437 |
+
* @var double
|
| 2438 |
+
*/
|
| 2439 |
+
public $refundFeeAmount;
|
| 2440 |
+
|
| 2441 |
+
/**
|
| 2442 |
+
*
|
| 2443 |
+
* @access public
|
| 2444 |
+
* @var double
|
| 2445 |
+
*/
|
| 2446 |
+
public $refundGrossAmount;
|
| 2447 |
+
|
| 2448 |
+
/**
|
| 2449 |
+
*
|
| 2450 |
+
* @access public
|
| 2451 |
+
* @var double
|
| 2452 |
+
*/
|
| 2453 |
+
public $totalOfAllRefunds;
|
| 2454 |
+
|
| 2455 |
+
/**
|
| 2456 |
+
*
|
| 2457 |
+
* @access public
|
| 2458 |
+
* @var boolean
|
| 2459 |
+
*/
|
| 2460 |
+
public $refundHasBecomeFull;
|
| 2461 |
+
|
| 2462 |
+
/**
|
| 2463 |
+
*
|
| 2464 |
+
* @access public
|
| 2465 |
+
* @var string
|
| 2466 |
+
*/
|
| 2467 |
+
public $encryptedRefundTransactionId;
|
| 2468 |
+
|
| 2469 |
+
/**
|
| 2470 |
+
*
|
| 2471 |
+
* @access public
|
| 2472 |
+
* @var string
|
| 2473 |
+
*/
|
| 2474 |
+
public $refundTransactionStatus;
|
| 2475 |
+
|
| 2476 |
+
/**
|
| 2477 |
+
*
|
| 2478 |
+
* @access public
|
| 2479 |
+
* @var ErrorList
|
| 2480 |
+
*/
|
| 2481 |
+
public $errorList;
|
| 2482 |
+
|
| 2483 |
+
|
| 2484 |
+
public function init( $map = null, $prefix = '' )
|
| 2485 |
+
{
|
| 2486 |
+
if ( $map != null ) {
|
| 2487 |
+
if ( PPUtils::array_match_key( $map, $prefix . "receiver." ) ) {
|
| 2488 |
+
$newPrefix = $prefix . "receiver.";
|
| 2489 |
+
$this->receiver = new Receiver();
|
| 2490 |
+
$this->receiver->init( $map, $newPrefix );
|
| 2491 |
+
}
|
| 2492 |
+
$mapKeyName = $prefix . 'refundStatus';
|
| 2493 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2494 |
+
$this->refundStatus = $map[ $mapKeyName ];
|
| 2495 |
+
}
|
| 2496 |
+
$mapKeyName = $prefix . 'refundNetAmount';
|
| 2497 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2498 |
+
$this->refundNetAmount = $map[ $mapKeyName ];
|
| 2499 |
+
}
|
| 2500 |
+
$mapKeyName = $prefix . 'refundFeeAmount';
|
| 2501 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2502 |
+
$this->refundFeeAmount = $map[ $mapKeyName ];
|
| 2503 |
+
}
|
| 2504 |
+
$mapKeyName = $prefix . 'refundGrossAmount';
|
| 2505 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2506 |
+
$this->refundGrossAmount = $map[ $mapKeyName ];
|
| 2507 |
+
}
|
| 2508 |
+
$mapKeyName = $prefix . 'totalOfAllRefunds';
|
| 2509 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2510 |
+
$this->totalOfAllRefunds = $map[ $mapKeyName ];
|
| 2511 |
+
}
|
| 2512 |
+
$mapKeyName = $prefix . 'refundHasBecomeFull';
|
| 2513 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2514 |
+
$this->refundHasBecomeFull = $map[ $mapKeyName ];
|
| 2515 |
+
}
|
| 2516 |
+
$mapKeyName = $prefix . 'encryptedRefundTransactionId';
|
| 2517 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2518 |
+
$this->encryptedRefundTransactionId = $map[ $mapKeyName ];
|
| 2519 |
+
}
|
| 2520 |
+
$mapKeyName = $prefix . 'refundTransactionStatus';
|
| 2521 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2522 |
+
$this->refundTransactionStatus = $map[ $mapKeyName ];
|
| 2523 |
+
}
|
| 2524 |
+
if ( PPUtils::array_match_key( $map, $prefix . "errorList." ) ) {
|
| 2525 |
+
$newPrefix = $prefix . "errorList.";
|
| 2526 |
+
$this->errorList = new ErrorList();
|
| 2527 |
+
$this->errorList->init( $map, $newPrefix );
|
| 2528 |
+
}
|
| 2529 |
+
|
| 2530 |
+
}
|
| 2531 |
+
}
|
| 2532 |
+
}
|
| 2533 |
+
|
| 2534 |
+
|
| 2535 |
+
/**
|
| 2536 |
+
*
|
| 2537 |
+
*/
|
| 2538 |
+
class RefundInfoList
|
| 2539 |
+
{
|
| 2540 |
+
|
| 2541 |
+
/**
|
| 2542 |
+
*
|
| 2543 |
+
* @array
|
| 2544 |
+
* @access public
|
| 2545 |
+
* @var RefundInfo
|
| 2546 |
+
*/
|
| 2547 |
+
public $refundInfo;
|
| 2548 |
+
|
| 2549 |
+
|
| 2550 |
+
public function init( $map = null, $prefix = '' )
|
| 2551 |
+
{
|
| 2552 |
+
if ( $map != null ) {
|
| 2553 |
+
$i = 0;
|
| 2554 |
+
while ( true ) {
|
| 2555 |
+
if ( PPUtils::array_match_key( $map, $prefix . "refundInfo($i)" ) ) {
|
| 2556 |
+
$newPrefix = $prefix . "refundInfo($i).";
|
| 2557 |
+
$this->refundInfo[ $i ] = new RefundInfo();
|
| 2558 |
+
$this->refundInfo[ $i ]->init( $map, $newPrefix );
|
| 2559 |
+
} else {
|
| 2560 |
+
break;
|
| 2561 |
+
}
|
| 2562 |
+
$i++;
|
| 2563 |
+
}
|
| 2564 |
+
|
| 2565 |
+
}
|
| 2566 |
+
}
|
| 2567 |
+
}
|
| 2568 |
+
|
| 2569 |
+
|
| 2570 |
+
/**
|
| 2571 |
+
* Options that apply to the sender of a payment.
|
| 2572 |
+
*/
|
| 2573 |
+
class SenderOptions
|
| 2574 |
+
{
|
| 2575 |
+
|
| 2576 |
+
/**
|
| 2577 |
+
* Require the user to select a shipping address during the web
|
| 2578 |
+
* flow.
|
| 2579 |
+
* @access public
|
| 2580 |
+
* @var boolean
|
| 2581 |
+
*/
|
| 2582 |
+
public $requireShippingAddressSelection;
|
| 2583 |
+
|
| 2584 |
+
/**
|
| 2585 |
+
*
|
| 2586 |
+
* @access public
|
| 2587 |
+
* @var string
|
| 2588 |
+
*/
|
| 2589 |
+
public $referrerCode;
|
| 2590 |
+
|
| 2591 |
+
|
| 2592 |
+
public function toNVPString( $prefix = '' )
|
| 2593 |
+
{
|
| 2594 |
+
$str = '';
|
| 2595 |
+
$delim = '';
|
| 2596 |
+
if ( $this->requireShippingAddressSelection != null ) {
|
| 2597 |
+
$str .= $delim . $prefix . 'requireShippingAddressSelection=' . urlencode( $this->requireShippingAddressSelection );
|
| 2598 |
+
$delim = '&';
|
| 2599 |
+
}
|
| 2600 |
+
if ( $this->referrerCode != null ) {
|
| 2601 |
+
$str .= $delim . $prefix . 'referrerCode=' . urlencode( $this->referrerCode );
|
| 2602 |
+
$delim = '&';
|
| 2603 |
+
}
|
| 2604 |
+
|
| 2605 |
+
return $str;
|
| 2606 |
+
}
|
| 2607 |
+
|
| 2608 |
+
public function init( $map = null, $prefix = '' )
|
| 2609 |
+
{
|
| 2610 |
+
if ( $map != null ) {
|
| 2611 |
+
$mapKeyName = $prefix . 'requireShippingAddressSelection';
|
| 2612 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2613 |
+
$this->requireShippingAddressSelection = $map[ $mapKeyName ];
|
| 2614 |
+
}
|
| 2615 |
+
$mapKeyName = $prefix . 'referrerCode';
|
| 2616 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2617 |
+
$this->referrerCode = $map[ $mapKeyName ];
|
| 2618 |
+
}
|
| 2619 |
+
|
| 2620 |
+
}
|
| 2621 |
+
}
|
| 2622 |
+
}
|
| 2623 |
+
|
| 2624 |
+
|
| 2625 |
+
/**
|
| 2626 |
+
* Details about the payer's tax info passed in by the merchant
|
| 2627 |
+
* or partner.
|
| 2628 |
+
*/
|
| 2629 |
+
class TaxIdDetails
|
| 2630 |
+
{
|
| 2631 |
+
|
| 2632 |
+
/**
|
| 2633 |
+
* Tax id of the merchant/business.
|
| 2634 |
+
* @access public
|
| 2635 |
+
* @var string
|
| 2636 |
+
*/
|
| 2637 |
+
public $taxId;
|
| 2638 |
+
|
| 2639 |
+
/**
|
| 2640 |
+
* Tax type of the Tax Id.
|
| 2641 |
+
* @access public
|
| 2642 |
+
* @var string
|
| 2643 |
+
*/
|
| 2644 |
+
public $taxIdType;
|
| 2645 |
+
|
| 2646 |
+
|
| 2647 |
+
public function toNVPString( $prefix = '' )
|
| 2648 |
+
{
|
| 2649 |
+
$str = '';
|
| 2650 |
+
$delim = '';
|
| 2651 |
+
if ( $this->taxId != null ) {
|
| 2652 |
+
$str .= $delim . $prefix . 'taxId=' . urlencode( $this->taxId );
|
| 2653 |
+
$delim = '&';
|
| 2654 |
+
}
|
| 2655 |
+
if ( $this->taxIdType != null ) {
|
| 2656 |
+
$str .= $delim . $prefix . 'taxIdType=' . urlencode( $this->taxIdType );
|
| 2657 |
+
$delim = '&';
|
| 2658 |
+
}
|
| 2659 |
+
|
| 2660 |
+
return $str;
|
| 2661 |
+
}
|
| 2662 |
+
|
| 2663 |
+
public function init( $map = null, $prefix = '' )
|
| 2664 |
+
{
|
| 2665 |
+
if ( $map != null ) {
|
| 2666 |
+
$mapKeyName = $prefix . 'taxId';
|
| 2667 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2668 |
+
$this->taxId = $map[ $mapKeyName ];
|
| 2669 |
+
}
|
| 2670 |
+
$mapKeyName = $prefix . 'taxIdType';
|
| 2671 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2672 |
+
$this->taxIdType = $map[ $mapKeyName ];
|
| 2673 |
+
}
|
| 2674 |
+
|
| 2675 |
+
}
|
| 2676 |
+
}
|
| 2677 |
+
}
|
| 2678 |
+
|
| 2679 |
+
|
| 2680 |
+
/**
|
| 2681 |
+
* The sender identifier type contains information to identify
|
| 2682 |
+
* a PayPal account.
|
| 2683 |
+
*/
|
| 2684 |
+
class SenderIdentifier extends AccountIdentifier
|
| 2685 |
+
{
|
| 2686 |
+
|
| 2687 |
+
/**
|
| 2688 |
+
*
|
| 2689 |
+
* @access public
|
| 2690 |
+
* @var boolean
|
| 2691 |
+
*/
|
| 2692 |
+
public $useCredentials;
|
| 2693 |
+
|
| 2694 |
+
/**
|
| 2695 |
+
*
|
| 2696 |
+
* @access public
|
| 2697 |
+
* @var TaxIdDetails
|
| 2698 |
+
*/
|
| 2699 |
+
public $taxIdDetails;
|
| 2700 |
+
|
| 2701 |
+
|
| 2702 |
+
public function toNVPString( $prefix = '' )
|
| 2703 |
+
{
|
| 2704 |
+
$str = parent::toNVPString( $prefix );
|
| 2705 |
+
if ( strlen( $str ) > 0 ) {
|
| 2706 |
+
$delim = '&';
|
| 2707 |
+
} else {
|
| 2708 |
+
$delim = '';
|
| 2709 |
+
}
|
| 2710 |
+
if ( $this->useCredentials != null ) {
|
| 2711 |
+
$str .= $delim . $prefix . 'useCredentials=' . urlencode( $this->useCredentials );
|
| 2712 |
+
$delim = '&';
|
| 2713 |
+
}
|
| 2714 |
+
if ( $this->taxIdDetails != null ) {
|
| 2715 |
+
$newPrefix = $prefix . 'taxIdDetails.';
|
| 2716 |
+
$str .= $delim . call_user_func( array( $this->taxIdDetails, 'toNVPString' ), $newPrefix );
|
| 2717 |
+
$delim = '&';
|
| 2718 |
+
}
|
| 2719 |
+
|
| 2720 |
+
return $str;
|
| 2721 |
+
}
|
| 2722 |
+
|
| 2723 |
+
public function init( $map = null, $prefix = '' )
|
| 2724 |
+
{
|
| 2725 |
+
if ( $map != null ) {
|
| 2726 |
+
$mapKeyName = $prefix . 'useCredentials';
|
| 2727 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2728 |
+
$this->useCredentials = $map[ $mapKeyName ];
|
| 2729 |
+
}
|
| 2730 |
+
if ( PPUtils::array_match_key( $map, $prefix . "taxIdDetails." ) ) {
|
| 2731 |
+
$newPrefix = $prefix . "taxIdDetails.";
|
| 2732 |
+
$this->taxIdDetails = new TaxIdDetails();
|
| 2733 |
+
$this->taxIdDetails->init( $map, $newPrefix );
|
| 2734 |
+
}
|
| 2735 |
+
|
| 2736 |
+
}
|
| 2737 |
+
}
|
| 2738 |
+
}
|
| 2739 |
+
|
| 2740 |
+
|
| 2741 |
+
/**
|
| 2742 |
+
*
|
| 2743 |
+
*/
|
| 2744 |
+
class UserLimit
|
| 2745 |
+
{
|
| 2746 |
+
|
| 2747 |
+
/**
|
| 2748 |
+
*
|
| 2749 |
+
* @access public
|
| 2750 |
+
* @var string
|
| 2751 |
+
*/
|
| 2752 |
+
public $limitType;
|
| 2753 |
+
|
| 2754 |
+
/**
|
| 2755 |
+
*
|
| 2756 |
+
* @access public
|
| 2757 |
+
* @var CurrencyType
|
| 2758 |
+
*/
|
| 2759 |
+
public $limitAmount;
|
| 2760 |
+
|
| 2761 |
+
|
| 2762 |
+
public function init( $map = null, $prefix = '' )
|
| 2763 |
+
{
|
| 2764 |
+
if ( $map != null ) {
|
| 2765 |
+
$mapKeyName = $prefix . 'limitType';
|
| 2766 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2767 |
+
$this->limitType = $map[ $mapKeyName ];
|
| 2768 |
+
}
|
| 2769 |
+
if ( PPUtils::array_match_key( $map, $prefix . "limitAmount." ) ) {
|
| 2770 |
+
$newPrefix = $prefix . "limitAmount.";
|
| 2771 |
+
$this->limitAmount = new CurrencyType();
|
| 2772 |
+
$this->limitAmount->init( $map, $newPrefix );
|
| 2773 |
+
}
|
| 2774 |
+
|
| 2775 |
+
}
|
| 2776 |
+
}
|
| 2777 |
+
}
|
| 2778 |
+
|
| 2779 |
+
|
| 2780 |
+
/**
|
| 2781 |
+
* This type contains the detailed warning information
|
| 2782 |
+
* resulting from the service operation.
|
| 2783 |
+
*/
|
| 2784 |
+
class WarningData
|
| 2785 |
+
{
|
| 2786 |
+
|
| 2787 |
+
/**
|
| 2788 |
+
*
|
| 2789 |
+
* @access public
|
| 2790 |
+
* @var integer
|
| 2791 |
+
*/
|
| 2792 |
+
public $warningId;
|
| 2793 |
+
|
| 2794 |
+
/**
|
| 2795 |
+
*
|
| 2796 |
+
* @access public
|
| 2797 |
+
* @var string
|
| 2798 |
+
*/
|
| 2799 |
+
public $message;
|
| 2800 |
+
|
| 2801 |
+
|
| 2802 |
+
public function init( $map = null, $prefix = '' )
|
| 2803 |
+
{
|
| 2804 |
+
if ( $map != null ) {
|
| 2805 |
+
$mapKeyName = $prefix . 'warningId';
|
| 2806 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2807 |
+
$this->warningId = $map[ $mapKeyName ];
|
| 2808 |
+
}
|
| 2809 |
+
$mapKeyName = $prefix . 'message';
|
| 2810 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 2811 |
+
$this->message = $map[ $mapKeyName ];
|
| 2812 |
+
}
|
| 2813 |
+
|
| 2814 |
+
}
|
| 2815 |
+
}
|
| 2816 |
+
}
|
| 2817 |
+
|
| 2818 |
+
|
| 2819 |
+
/**
|
| 2820 |
+
*
|
| 2821 |
+
*/
|
| 2822 |
+
class WarningDataList
|
| 2823 |
+
{
|
| 2824 |
+
|
| 2825 |
+
/**
|
| 2826 |
+
*
|
| 2827 |
+
* @array
|
| 2828 |
+
* @access public
|
| 2829 |
+
* @var WarningData
|
| 2830 |
+
*/
|
| 2831 |
+
public $warningData;
|
| 2832 |
+
|
| 2833 |
+
|
| 2834 |
+
public function init( $map = null, $prefix = '' )
|
| 2835 |
+
{
|
| 2836 |
+
if ( $map != null ) {
|
| 2837 |
+
$i = 0;
|
| 2838 |
+
while ( true ) {
|
| 2839 |
+
if ( PPUtils::array_match_key( $map, $prefix . "warningData($i)" ) ) {
|
| 2840 |
+
$newPrefix = $prefix . "warningData($i).";
|
| 2841 |
+
$this->warningData[ $i ] = new WarningData();
|
| 2842 |
+
$this->warningData[ $i ]->init( $map, $newPrefix );
|
| 2843 |
+
} else {
|
| 2844 |
+
break;
|
| 2845 |
+
}
|
| 2846 |
+
$i++;
|
| 2847 |
+
}
|
| 2848 |
+
|
| 2849 |
+
}
|
| 2850 |
+
}
|
| 2851 |
+
}
|
| 2852 |
+
|
| 2853 |
+
|
| 2854 |
+
/**
|
| 2855 |
+
* The request to cancel a Preapproval.
|
| 2856 |
+
*/
|
| 2857 |
+
class CancelPreapprovalRequest
|
| 2858 |
+
{
|
| 2859 |
+
|
| 2860 |
+
/**
|
| 2861 |
+
*
|
| 2862 |
+
* @access public
|
| 2863 |
+
* @var RequestEnvelope
|
| 2864 |
+
*/
|
| 2865 |
+
public $requestEnvelope;
|
| 2866 |
+
|
| 2867 |
+
/**
|
| 2868 |
+
*
|
| 2869 |
+
* @access public
|
| 2870 |
+
* @var string
|
| 2871 |
+
*/
|
| 2872 |
+
public $preapprovalKey;
|
| 2873 |
+
|
| 2874 |
+
/**
|
| 2875 |
+
* Constructor with arguments
|
| 2876 |
+
*/
|
| 2877 |
+
public function __construct( $requestEnvelope = null, $preapprovalKey = null )
|
| 2878 |
+
{
|
| 2879 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 2880 |
+
$this->preapprovalKey = $preapprovalKey;
|
| 2881 |
+
}
|
| 2882 |
+
|
| 2883 |
+
|
| 2884 |
+
public function toNVPString( $prefix = '' )
|
| 2885 |
+
{
|
| 2886 |
+
$str = '';
|
| 2887 |
+
$delim = '';
|
| 2888 |
+
if ( $this->requestEnvelope != null ) {
|
| 2889 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 2890 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 2891 |
+
$delim = '&';
|
| 2892 |
+
}
|
| 2893 |
+
if ( $this->preapprovalKey != null ) {
|
| 2894 |
+
$str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
|
| 2895 |
+
$delim = '&';
|
| 2896 |
+
}
|
| 2897 |
+
|
| 2898 |
+
return $str;
|
| 2899 |
+
}
|
| 2900 |
+
|
| 2901 |
+
}
|
| 2902 |
+
|
| 2903 |
+
|
| 2904 |
+
/**
|
| 2905 |
+
* The result of the CancelPreapprovalRequest.
|
| 2906 |
+
*/
|
| 2907 |
+
class CancelPreapprovalResponse
|
| 2908 |
+
{
|
| 2909 |
+
|
| 2910 |
+
/**
|
| 2911 |
+
*
|
| 2912 |
+
* @access public
|
| 2913 |
+
* @var ResponseEnvelope
|
| 2914 |
+
*/
|
| 2915 |
+
public $responseEnvelope;
|
| 2916 |
+
|
| 2917 |
+
/**
|
| 2918 |
+
*
|
| 2919 |
+
* @array
|
| 2920 |
+
* @access public
|
| 2921 |
+
* @var ErrorData
|
| 2922 |
+
*/
|
| 2923 |
+
public $error;
|
| 2924 |
+
|
| 2925 |
+
|
| 2926 |
+
public function init( $map = null, $prefix = '' )
|
| 2927 |
+
{
|
| 2928 |
+
if ( $map != null ) {
|
| 2929 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 2930 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 2931 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 2932 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 2933 |
+
}
|
| 2934 |
+
$i = 0;
|
| 2935 |
+
while ( true ) {
|
| 2936 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 2937 |
+
$newPrefix = $prefix . "error($i).";
|
| 2938 |
+
$this->error[ $i ] = new ErrorData();
|
| 2939 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 2940 |
+
} else {
|
| 2941 |
+
break;
|
| 2942 |
+
}
|
| 2943 |
+
$i++;
|
| 2944 |
+
}
|
| 2945 |
+
|
| 2946 |
+
}
|
| 2947 |
+
}
|
| 2948 |
+
}
|
| 2949 |
+
|
| 2950 |
+
|
| 2951 |
+
/**
|
| 2952 |
+
* The request to confirm a Preapproval.
|
| 2953 |
+
*/
|
| 2954 |
+
class ConfirmPreapprovalRequest
|
| 2955 |
+
{
|
| 2956 |
+
|
| 2957 |
+
/**
|
| 2958 |
+
*
|
| 2959 |
+
* @access public
|
| 2960 |
+
* @var RequestEnvelope
|
| 2961 |
+
*/
|
| 2962 |
+
public $requestEnvelope;
|
| 2963 |
+
|
| 2964 |
+
/**
|
| 2965 |
+
*
|
| 2966 |
+
* @access public
|
| 2967 |
+
* @var string
|
| 2968 |
+
*/
|
| 2969 |
+
public $preapprovalKey;
|
| 2970 |
+
|
| 2971 |
+
/**
|
| 2972 |
+
*
|
| 2973 |
+
* @access public
|
| 2974 |
+
* @var string
|
| 2975 |
+
*/
|
| 2976 |
+
public $fundingSourceId;
|
| 2977 |
+
|
| 2978 |
+
/**
|
| 2979 |
+
*
|
| 2980 |
+
* @access public
|
| 2981 |
+
* @var string
|
| 2982 |
+
*/
|
| 2983 |
+
public $pin;
|
| 2984 |
+
|
| 2985 |
+
/**
|
| 2986 |
+
* Constructor with arguments
|
| 2987 |
+
*/
|
| 2988 |
+
public function __construct( $requestEnvelope = null, $preapprovalKey = null )
|
| 2989 |
+
{
|
| 2990 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 2991 |
+
$this->preapprovalKey = $preapprovalKey;
|
| 2992 |
+
}
|
| 2993 |
+
|
| 2994 |
+
|
| 2995 |
+
public function toNVPString( $prefix = '' )
|
| 2996 |
+
{
|
| 2997 |
+
$str = '';
|
| 2998 |
+
$delim = '';
|
| 2999 |
+
if ( $this->requestEnvelope != null ) {
|
| 3000 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3001 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3002 |
+
$delim = '&';
|
| 3003 |
+
}
|
| 3004 |
+
if ( $this->preapprovalKey != null ) {
|
| 3005 |
+
$str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
|
| 3006 |
+
$delim = '&';
|
| 3007 |
+
}
|
| 3008 |
+
if ( $this->fundingSourceId != null ) {
|
| 3009 |
+
$str .= $delim . $prefix . 'fundingSourceId=' . urlencode( $this->fundingSourceId );
|
| 3010 |
+
$delim = '&';
|
| 3011 |
+
}
|
| 3012 |
+
if ( $this->pin != null ) {
|
| 3013 |
+
$str .= $delim . $prefix . 'pin=' . urlencode( $this->pin );
|
| 3014 |
+
$delim = '&';
|
| 3015 |
+
}
|
| 3016 |
+
|
| 3017 |
+
return $str;
|
| 3018 |
+
}
|
| 3019 |
+
|
| 3020 |
+
}
|
| 3021 |
+
|
| 3022 |
+
|
| 3023 |
+
/**
|
| 3024 |
+
* The result of the ConfirmPreapprovalRequest.
|
| 3025 |
+
*/
|
| 3026 |
+
class ConfirmPreapprovalResponse
|
| 3027 |
+
{
|
| 3028 |
+
|
| 3029 |
+
/**
|
| 3030 |
+
*
|
| 3031 |
+
* @access public
|
| 3032 |
+
* @var ResponseEnvelope
|
| 3033 |
+
*/
|
| 3034 |
+
public $responseEnvelope;
|
| 3035 |
+
|
| 3036 |
+
/**
|
| 3037 |
+
*
|
| 3038 |
+
* @array
|
| 3039 |
+
* @access public
|
| 3040 |
+
* @var ErrorData
|
| 3041 |
+
*/
|
| 3042 |
+
public $error;
|
| 3043 |
+
|
| 3044 |
+
|
| 3045 |
+
public function init( $map = null, $prefix = '' )
|
| 3046 |
+
{
|
| 3047 |
+
if ( $map != null ) {
|
| 3048 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3049 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3050 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3051 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3052 |
+
}
|
| 3053 |
+
$i = 0;
|
| 3054 |
+
while ( true ) {
|
| 3055 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3056 |
+
$newPrefix = $prefix . "error($i).";
|
| 3057 |
+
$this->error[ $i ] = new ErrorData();
|
| 3058 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3059 |
+
} else {
|
| 3060 |
+
break;
|
| 3061 |
+
}
|
| 3062 |
+
$i++;
|
| 3063 |
+
}
|
| 3064 |
+
|
| 3065 |
+
}
|
| 3066 |
+
}
|
| 3067 |
+
}
|
| 3068 |
+
|
| 3069 |
+
|
| 3070 |
+
/**
|
| 3071 |
+
* A request to convert one or more currencies into their
|
| 3072 |
+
* estimated values in other currencies.
|
| 3073 |
+
*/
|
| 3074 |
+
class ConvertCurrencyRequest
|
| 3075 |
+
{
|
| 3076 |
+
|
| 3077 |
+
/**
|
| 3078 |
+
*
|
| 3079 |
+
* @access public
|
| 3080 |
+
* @var RequestEnvelope
|
| 3081 |
+
*/
|
| 3082 |
+
public $requestEnvelope;
|
| 3083 |
+
|
| 3084 |
+
/**
|
| 3085 |
+
*
|
| 3086 |
+
* @access public
|
| 3087 |
+
* @var CurrencyList
|
| 3088 |
+
*/
|
| 3089 |
+
public $baseAmountList;
|
| 3090 |
+
|
| 3091 |
+
/**
|
| 3092 |
+
*
|
| 3093 |
+
* @access public
|
| 3094 |
+
* @var CurrencyCodeList
|
| 3095 |
+
*/
|
| 3096 |
+
public $convertToCurrencyList;
|
| 3097 |
+
|
| 3098 |
+
/**
|
| 3099 |
+
* The two-character ISO country code where fx suppposed to
|
| 3100 |
+
* happen
|
| 3101 |
+
* @access public
|
| 3102 |
+
* @var string
|
| 3103 |
+
*/
|
| 3104 |
+
public $countryCode;
|
| 3105 |
+
|
| 3106 |
+
/**
|
| 3107 |
+
*
|
| 3108 |
+
* @access public
|
| 3109 |
+
* @var string
|
| 3110 |
+
*/
|
| 3111 |
+
public $conversionType;
|
| 3112 |
+
|
| 3113 |
+
/**
|
| 3114 |
+
* Constructor with arguments
|
| 3115 |
+
*/
|
| 3116 |
+
public function __construct( $requestEnvelope = null, $baseAmountList = null, $convertToCurrencyList = null )
|
| 3117 |
+
{
|
| 3118 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 3119 |
+
$this->baseAmountList = $baseAmountList;
|
| 3120 |
+
$this->convertToCurrencyList = $convertToCurrencyList;
|
| 3121 |
+
}
|
| 3122 |
+
|
| 3123 |
+
|
| 3124 |
+
public function toNVPString( $prefix = '' )
|
| 3125 |
+
{
|
| 3126 |
+
$str = '';
|
| 3127 |
+
$delim = '';
|
| 3128 |
+
if ( $this->requestEnvelope != null ) {
|
| 3129 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3130 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3131 |
+
$delim = '&';
|
| 3132 |
+
}
|
| 3133 |
+
if ( $this->baseAmountList != null ) {
|
| 3134 |
+
$newPrefix = $prefix . 'baseAmountList.';
|
| 3135 |
+
$str .= $delim . call_user_func( array( $this->baseAmountList, 'toNVPString' ), $newPrefix );
|
| 3136 |
+
$delim = '&';
|
| 3137 |
+
}
|
| 3138 |
+
if ( $this->convertToCurrencyList != null ) {
|
| 3139 |
+
$newPrefix = $prefix . 'convertToCurrencyList.';
|
| 3140 |
+
$str .= $delim . call_user_func( array( $this->convertToCurrencyList, 'toNVPString' ), $newPrefix );
|
| 3141 |
+
$delim = '&';
|
| 3142 |
+
}
|
| 3143 |
+
if ( $this->countryCode != null ) {
|
| 3144 |
+
$str .= $delim . $prefix . 'countryCode=' . urlencode( $this->countryCode );
|
| 3145 |
+
$delim = '&';
|
| 3146 |
+
}
|
| 3147 |
+
if ( $this->conversionType != null ) {
|
| 3148 |
+
$str .= $delim . $prefix . 'conversionType=' . urlencode( $this->conversionType );
|
| 3149 |
+
$delim = '&';
|
| 3150 |
+
}
|
| 3151 |
+
|
| 3152 |
+
return $str;
|
| 3153 |
+
}
|
| 3154 |
+
|
| 3155 |
+
}
|
| 3156 |
+
|
| 3157 |
+
|
| 3158 |
+
/**
|
| 3159 |
+
* A response that contains a table of estimated converted
|
| 3160 |
+
* currencies based on the Convert Currency Request.
|
| 3161 |
+
*/
|
| 3162 |
+
class ConvertCurrencyResponse
|
| 3163 |
+
{
|
| 3164 |
+
|
| 3165 |
+
/**
|
| 3166 |
+
*
|
| 3167 |
+
* @access public
|
| 3168 |
+
* @var ResponseEnvelope
|
| 3169 |
+
*/
|
| 3170 |
+
public $responseEnvelope;
|
| 3171 |
+
|
| 3172 |
+
/**
|
| 3173 |
+
*
|
| 3174 |
+
* @access public
|
| 3175 |
+
* @var CurrencyConversionTable
|
| 3176 |
+
*/
|
| 3177 |
+
public $estimatedAmountTable;
|
| 3178 |
+
|
| 3179 |
+
/**
|
| 3180 |
+
*
|
| 3181 |
+
* @array
|
| 3182 |
+
* @access public
|
| 3183 |
+
* @var ErrorData
|
| 3184 |
+
*/
|
| 3185 |
+
public $error;
|
| 3186 |
+
|
| 3187 |
+
|
| 3188 |
+
public function init( $map = null, $prefix = '' )
|
| 3189 |
+
{
|
| 3190 |
+
if ( $map != null ) {
|
| 3191 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3192 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3193 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3194 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3195 |
+
}
|
| 3196 |
+
if ( PPUtils::array_match_key( $map, $prefix . "estimatedAmountTable." ) ) {
|
| 3197 |
+
$newPrefix = $prefix . "estimatedAmountTable.";
|
| 3198 |
+
$this->estimatedAmountTable = new CurrencyConversionTable();
|
| 3199 |
+
$this->estimatedAmountTable->init( $map, $newPrefix );
|
| 3200 |
+
}
|
| 3201 |
+
$i = 0;
|
| 3202 |
+
while ( true ) {
|
| 3203 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3204 |
+
$newPrefix = $prefix . "error($i).";
|
| 3205 |
+
$this->error[ $i ] = new ErrorData();
|
| 3206 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3207 |
+
} else {
|
| 3208 |
+
break;
|
| 3209 |
+
}
|
| 3210 |
+
$i++;
|
| 3211 |
+
}
|
| 3212 |
+
|
| 3213 |
+
}
|
| 3214 |
+
}
|
| 3215 |
+
}
|
| 3216 |
+
|
| 3217 |
+
|
| 3218 |
+
/**
|
| 3219 |
+
* The request to execute the payment request.
|
| 3220 |
+
*/
|
| 3221 |
+
class ExecutePaymentRequest
|
| 3222 |
+
{
|
| 3223 |
+
|
| 3224 |
+
/**
|
| 3225 |
+
*
|
| 3226 |
+
* @access public
|
| 3227 |
+
* @var RequestEnvelope
|
| 3228 |
+
*/
|
| 3229 |
+
public $requestEnvelope;
|
| 3230 |
+
|
| 3231 |
+
/**
|
| 3232 |
+
*
|
| 3233 |
+
* @access public
|
| 3234 |
+
* @var string
|
| 3235 |
+
*/
|
| 3236 |
+
public $payKey;
|
| 3237 |
+
|
| 3238 |
+
/**
|
| 3239 |
+
* Describes the action that is performed by this API
|
| 3240 |
+
* @access public
|
| 3241 |
+
* @var string
|
| 3242 |
+
*/
|
| 3243 |
+
public $actionType;
|
| 3244 |
+
|
| 3245 |
+
/**
|
| 3246 |
+
*
|
| 3247 |
+
* @access public
|
| 3248 |
+
* @var string
|
| 3249 |
+
*/
|
| 3250 |
+
public $fundingPlanId;
|
| 3251 |
+
|
| 3252 |
+
/**
|
| 3253 |
+
* Constructor with arguments
|
| 3254 |
+
*/
|
| 3255 |
+
public function __construct( $requestEnvelope = null, $payKey = null )
|
| 3256 |
+
{
|
| 3257 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 3258 |
+
$this->payKey = $payKey;
|
| 3259 |
+
}
|
| 3260 |
+
|
| 3261 |
+
|
| 3262 |
+
public function toNVPString( $prefix = '' )
|
| 3263 |
+
{
|
| 3264 |
+
$str = '';
|
| 3265 |
+
$delim = '';
|
| 3266 |
+
if ( $this->requestEnvelope != null ) {
|
| 3267 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3268 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3269 |
+
$delim = '&';
|
| 3270 |
+
}
|
| 3271 |
+
if ( $this->payKey != null ) {
|
| 3272 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 3273 |
+
$delim = '&';
|
| 3274 |
+
}
|
| 3275 |
+
if ( $this->actionType != null ) {
|
| 3276 |
+
$str .= $delim . $prefix . 'actionType=' . urlencode( $this->actionType );
|
| 3277 |
+
$delim = '&';
|
| 3278 |
+
}
|
| 3279 |
+
if ( $this->fundingPlanId != null ) {
|
| 3280 |
+
$str .= $delim . $prefix . 'fundingPlanId=' . urlencode( $this->fundingPlanId );
|
| 3281 |
+
$delim = '&';
|
| 3282 |
+
}
|
| 3283 |
+
|
| 3284 |
+
return $str;
|
| 3285 |
+
}
|
| 3286 |
+
|
| 3287 |
+
}
|
| 3288 |
+
|
| 3289 |
+
|
| 3290 |
+
/**
|
| 3291 |
+
* The result of a payment execution.
|
| 3292 |
+
*/
|
| 3293 |
+
class ExecutePaymentResponse
|
| 3294 |
+
{
|
| 3295 |
+
|
| 3296 |
+
/**
|
| 3297 |
+
*
|
| 3298 |
+
* @access public
|
| 3299 |
+
* @var ResponseEnvelope
|
| 3300 |
+
*/
|
| 3301 |
+
public $responseEnvelope;
|
| 3302 |
+
|
| 3303 |
+
/**
|
| 3304 |
+
*
|
| 3305 |
+
* @access public
|
| 3306 |
+
* @var string
|
| 3307 |
+
*/
|
| 3308 |
+
public $paymentExecStatus;
|
| 3309 |
+
|
| 3310 |
+
/**
|
| 3311 |
+
*
|
| 3312 |
+
* @access public
|
| 3313 |
+
* @var PayErrorList
|
| 3314 |
+
*/
|
| 3315 |
+
public $payErrorList;
|
| 3316 |
+
|
| 3317 |
+
/**
|
| 3318 |
+
*
|
| 3319 |
+
* @array
|
| 3320 |
+
* @access public
|
| 3321 |
+
* @var ErrorData
|
| 3322 |
+
*/
|
| 3323 |
+
public $error;
|
| 3324 |
+
|
| 3325 |
+
|
| 3326 |
+
public function init( $map = null, $prefix = '' )
|
| 3327 |
+
{
|
| 3328 |
+
if ( $map != null ) {
|
| 3329 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3330 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3331 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3332 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3333 |
+
}
|
| 3334 |
+
$mapKeyName = $prefix . 'paymentExecStatus';
|
| 3335 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3336 |
+
$this->paymentExecStatus = $map[ $mapKeyName ];
|
| 3337 |
+
}
|
| 3338 |
+
if ( PPUtils::array_match_key( $map, $prefix . "payErrorList." ) ) {
|
| 3339 |
+
$newPrefix = $prefix . "payErrorList.";
|
| 3340 |
+
$this->payErrorList = new PayErrorList();
|
| 3341 |
+
$this->payErrorList->init( $map, $newPrefix );
|
| 3342 |
+
}
|
| 3343 |
+
$i = 0;
|
| 3344 |
+
while ( true ) {
|
| 3345 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3346 |
+
$newPrefix = $prefix . "error($i).";
|
| 3347 |
+
$this->error[ $i ] = new ErrorData();
|
| 3348 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3349 |
+
} else {
|
| 3350 |
+
break;
|
| 3351 |
+
}
|
| 3352 |
+
$i++;
|
| 3353 |
+
}
|
| 3354 |
+
|
| 3355 |
+
}
|
| 3356 |
+
}
|
| 3357 |
+
}
|
| 3358 |
+
|
| 3359 |
+
|
| 3360 |
+
/**
|
| 3361 |
+
* The request to get the allowed funding sources available for
|
| 3362 |
+
* a preapproval.
|
| 3363 |
+
*/
|
| 3364 |
+
class GetAllowedFundingSourcesRequest
|
| 3365 |
+
{
|
| 3366 |
+
|
| 3367 |
+
/**
|
| 3368 |
+
*
|
| 3369 |
+
* @access public
|
| 3370 |
+
* @var RequestEnvelope
|
| 3371 |
+
*/
|
| 3372 |
+
public $requestEnvelope;
|
| 3373 |
+
|
| 3374 |
+
/**
|
| 3375 |
+
*
|
| 3376 |
+
* @access public
|
| 3377 |
+
* @var string
|
| 3378 |
+
*/
|
| 3379 |
+
public $key;
|
| 3380 |
+
|
| 3381 |
+
/**
|
| 3382 |
+
* Constructor with arguments
|
| 3383 |
+
*/
|
| 3384 |
+
public function __construct( $requestEnvelope = null, $key = null )
|
| 3385 |
+
{
|
| 3386 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 3387 |
+
$this->key = $key;
|
| 3388 |
+
}
|
| 3389 |
+
|
| 3390 |
+
|
| 3391 |
+
public function toNVPString( $prefix = '' )
|
| 3392 |
+
{
|
| 3393 |
+
$str = '';
|
| 3394 |
+
$delim = '';
|
| 3395 |
+
if ( $this->requestEnvelope != null ) {
|
| 3396 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3397 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3398 |
+
$delim = '&';
|
| 3399 |
+
}
|
| 3400 |
+
if ( $this->key != null ) {
|
| 3401 |
+
$str .= $delim . $prefix . 'key=' . urlencode( $this->key );
|
| 3402 |
+
$delim = '&';
|
| 3403 |
+
}
|
| 3404 |
+
|
| 3405 |
+
return $str;
|
| 3406 |
+
}
|
| 3407 |
+
|
| 3408 |
+
}
|
| 3409 |
+
|
| 3410 |
+
|
| 3411 |
+
/**
|
| 3412 |
+
* The response to get the backup funding sources available for
|
| 3413 |
+
* a preapproval.
|
| 3414 |
+
*/
|
| 3415 |
+
class GetAllowedFundingSourcesResponse
|
| 3416 |
+
{
|
| 3417 |
+
|
| 3418 |
+
/**
|
| 3419 |
+
*
|
| 3420 |
+
* @access public
|
| 3421 |
+
* @var ResponseEnvelope
|
| 3422 |
+
*/
|
| 3423 |
+
public $responseEnvelope;
|
| 3424 |
+
|
| 3425 |
+
/**
|
| 3426 |
+
*
|
| 3427 |
+
* @array
|
| 3428 |
+
* @access public
|
| 3429 |
+
* @var FundingSource
|
| 3430 |
+
*/
|
| 3431 |
+
public $fundingSource;
|
| 3432 |
+
|
| 3433 |
+
/**
|
| 3434 |
+
*
|
| 3435 |
+
* @array
|
| 3436 |
+
* @access public
|
| 3437 |
+
* @var ErrorData
|
| 3438 |
+
*/
|
| 3439 |
+
public $error;
|
| 3440 |
+
|
| 3441 |
+
|
| 3442 |
+
public function init( $map = null, $prefix = '' )
|
| 3443 |
+
{
|
| 3444 |
+
if ( $map != null ) {
|
| 3445 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3446 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3447 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3448 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3449 |
+
}
|
| 3450 |
+
$i = 0;
|
| 3451 |
+
while ( true ) {
|
| 3452 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingSource($i)" ) ) {
|
| 3453 |
+
$newPrefix = $prefix . "fundingSource($i).";
|
| 3454 |
+
$this->fundingSource[ $i ] = new FundingSource();
|
| 3455 |
+
$this->fundingSource[ $i ]->init( $map, $newPrefix );
|
| 3456 |
+
} else {
|
| 3457 |
+
break;
|
| 3458 |
+
}
|
| 3459 |
+
$i++;
|
| 3460 |
+
}
|
| 3461 |
+
$i = 0;
|
| 3462 |
+
while ( true ) {
|
| 3463 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3464 |
+
$newPrefix = $prefix . "error($i).";
|
| 3465 |
+
$this->error[ $i ] = new ErrorData();
|
| 3466 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3467 |
+
} else {
|
| 3468 |
+
break;
|
| 3469 |
+
}
|
| 3470 |
+
$i++;
|
| 3471 |
+
}
|
| 3472 |
+
|
| 3473 |
+
}
|
| 3474 |
+
}
|
| 3475 |
+
}
|
| 3476 |
+
|
| 3477 |
+
|
| 3478 |
+
/**
|
| 3479 |
+
* The request to get the options of a payment request.
|
| 3480 |
+
*/
|
| 3481 |
+
class GetPaymentOptionsRequest
|
| 3482 |
+
{
|
| 3483 |
+
|
| 3484 |
+
/**
|
| 3485 |
+
*
|
| 3486 |
+
* @access public
|
| 3487 |
+
* @var RequestEnvelope
|
| 3488 |
+
*/
|
| 3489 |
+
public $requestEnvelope;
|
| 3490 |
+
|
| 3491 |
+
/**
|
| 3492 |
+
*
|
| 3493 |
+
* @access public
|
| 3494 |
+
* @var string
|
| 3495 |
+
*/
|
| 3496 |
+
public $payKey;
|
| 3497 |
+
|
| 3498 |
+
/**
|
| 3499 |
+
* Constructor with arguments
|
| 3500 |
+
*/
|
| 3501 |
+
public function __construct( $requestEnvelope = null, $payKey = null )
|
| 3502 |
+
{
|
| 3503 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 3504 |
+
$this->payKey = $payKey;
|
| 3505 |
+
}
|
| 3506 |
+
|
| 3507 |
+
|
| 3508 |
+
public function toNVPString( $prefix = '' )
|
| 3509 |
+
{
|
| 3510 |
+
$str = '';
|
| 3511 |
+
$delim = '';
|
| 3512 |
+
if ( $this->requestEnvelope != null ) {
|
| 3513 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3514 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3515 |
+
$delim = '&';
|
| 3516 |
+
}
|
| 3517 |
+
if ( $this->payKey != null ) {
|
| 3518 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 3519 |
+
$delim = '&';
|
| 3520 |
+
}
|
| 3521 |
+
|
| 3522 |
+
return $str;
|
| 3523 |
+
}
|
| 3524 |
+
|
| 3525 |
+
}
|
| 3526 |
+
|
| 3527 |
+
|
| 3528 |
+
/**
|
| 3529 |
+
* The response message for the GetPaymentOption request
|
| 3530 |
+
*/
|
| 3531 |
+
class GetPaymentOptionsResponse
|
| 3532 |
+
{
|
| 3533 |
+
|
| 3534 |
+
/**
|
| 3535 |
+
*
|
| 3536 |
+
* @access public
|
| 3537 |
+
* @var ResponseEnvelope
|
| 3538 |
+
*/
|
| 3539 |
+
public $responseEnvelope;
|
| 3540 |
+
|
| 3541 |
+
/**
|
| 3542 |
+
*
|
| 3543 |
+
* @access public
|
| 3544 |
+
* @var InitiatingEntity
|
| 3545 |
+
*/
|
| 3546 |
+
public $initiatingEntity;
|
| 3547 |
+
|
| 3548 |
+
/**
|
| 3549 |
+
*
|
| 3550 |
+
* @access public
|
| 3551 |
+
* @var DisplayOptions
|
| 3552 |
+
*/
|
| 3553 |
+
public $displayOptions;
|
| 3554 |
+
|
| 3555 |
+
/**
|
| 3556 |
+
*
|
| 3557 |
+
* @access public
|
| 3558 |
+
* @var string
|
| 3559 |
+
*/
|
| 3560 |
+
public $shippingAddressId;
|
| 3561 |
+
|
| 3562 |
+
/**
|
| 3563 |
+
*
|
| 3564 |
+
* @access public
|
| 3565 |
+
* @var SenderOptions
|
| 3566 |
+
*/
|
| 3567 |
+
public $senderOptions;
|
| 3568 |
+
|
| 3569 |
+
/**
|
| 3570 |
+
*
|
| 3571 |
+
* @array
|
| 3572 |
+
* @access public
|
| 3573 |
+
* @var ReceiverOptions
|
| 3574 |
+
*/
|
| 3575 |
+
public $receiverOptions;
|
| 3576 |
+
|
| 3577 |
+
/**
|
| 3578 |
+
*
|
| 3579 |
+
* @array
|
| 3580 |
+
* @access public
|
| 3581 |
+
* @var ErrorData
|
| 3582 |
+
*/
|
| 3583 |
+
public $error;
|
| 3584 |
+
|
| 3585 |
+
|
| 3586 |
+
public function init( $map = null, $prefix = '' )
|
| 3587 |
+
{
|
| 3588 |
+
if ( $map != null ) {
|
| 3589 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3590 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3591 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3592 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3593 |
+
}
|
| 3594 |
+
if ( PPUtils::array_match_key( $map, $prefix . "initiatingEntity." ) ) {
|
| 3595 |
+
$newPrefix = $prefix . "initiatingEntity.";
|
| 3596 |
+
$this->initiatingEntity = new InitiatingEntity();
|
| 3597 |
+
$this->initiatingEntity->init( $map, $newPrefix );
|
| 3598 |
+
}
|
| 3599 |
+
if ( PPUtils::array_match_key( $map, $prefix . "displayOptions." ) ) {
|
| 3600 |
+
$newPrefix = $prefix . "displayOptions.";
|
| 3601 |
+
$this->displayOptions = new DisplayOptions();
|
| 3602 |
+
$this->displayOptions->init( $map, $newPrefix );
|
| 3603 |
+
}
|
| 3604 |
+
$mapKeyName = $prefix . 'shippingAddressId';
|
| 3605 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3606 |
+
$this->shippingAddressId = $map[ $mapKeyName ];
|
| 3607 |
+
}
|
| 3608 |
+
if ( PPUtils::array_match_key( $map, $prefix . "senderOptions." ) ) {
|
| 3609 |
+
$newPrefix = $prefix . "senderOptions.";
|
| 3610 |
+
$this->senderOptions = new SenderOptions();
|
| 3611 |
+
$this->senderOptions->init( $map, $newPrefix );
|
| 3612 |
+
}
|
| 3613 |
+
$i = 0;
|
| 3614 |
+
while ( true ) {
|
| 3615 |
+
if ( PPUtils::array_match_key( $map, $prefix . "receiverOptions($i)" ) ) {
|
| 3616 |
+
$newPrefix = $prefix . "receiverOptions($i).";
|
| 3617 |
+
$this->receiverOptions[ $i ] = new ReceiverOptions();
|
| 3618 |
+
$this->receiverOptions[ $i ]->init( $map, $newPrefix );
|
| 3619 |
+
} else {
|
| 3620 |
+
break;
|
| 3621 |
+
}
|
| 3622 |
+
$i++;
|
| 3623 |
+
}
|
| 3624 |
+
$i = 0;
|
| 3625 |
+
while ( true ) {
|
| 3626 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3627 |
+
$newPrefix = $prefix . "error($i).";
|
| 3628 |
+
$this->error[ $i ] = new ErrorData();
|
| 3629 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3630 |
+
} else {
|
| 3631 |
+
break;
|
| 3632 |
+
}
|
| 3633 |
+
$i++;
|
| 3634 |
+
}
|
| 3635 |
+
|
| 3636 |
+
}
|
| 3637 |
+
}
|
| 3638 |
+
}
|
| 3639 |
+
|
| 3640 |
+
|
| 3641 |
+
/**
|
| 3642 |
+
* The request to look up the details of a PayRequest. The
|
| 3643 |
+
* PaymentDetailsRequest can be made with either a payKey,
|
| 3644 |
+
* trackingId, or a transactionId of the PayRequest.
|
| 3645 |
+
*/
|
| 3646 |
+
class PaymentDetailsRequest
|
| 3647 |
+
{
|
| 3648 |
+
|
| 3649 |
+
/**
|
| 3650 |
+
*
|
| 3651 |
+
* @access public
|
| 3652 |
+
* @var RequestEnvelope
|
| 3653 |
+
*/
|
| 3654 |
+
public $requestEnvelope;
|
| 3655 |
+
|
| 3656 |
+
/**
|
| 3657 |
+
*
|
| 3658 |
+
* @access public
|
| 3659 |
+
* @var string
|
| 3660 |
+
*/
|
| 3661 |
+
public $payKey;
|
| 3662 |
+
|
| 3663 |
+
/**
|
| 3664 |
+
*
|
| 3665 |
+
* @access public
|
| 3666 |
+
* @var string
|
| 3667 |
+
*/
|
| 3668 |
+
public $transactionId;
|
| 3669 |
+
|
| 3670 |
+
/**
|
| 3671 |
+
*
|
| 3672 |
+
* @access public
|
| 3673 |
+
* @var string
|
| 3674 |
+
*/
|
| 3675 |
+
public $trackingId;
|
| 3676 |
+
|
| 3677 |
+
/**
|
| 3678 |
+
* Constructor with arguments
|
| 3679 |
+
*/
|
| 3680 |
+
public function __construct( $requestEnvelope = null )
|
| 3681 |
+
{
|
| 3682 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 3683 |
+
}
|
| 3684 |
+
|
| 3685 |
+
|
| 3686 |
+
public function toNVPString( $prefix = '' )
|
| 3687 |
+
{
|
| 3688 |
+
$str = '';
|
| 3689 |
+
$delim = '';
|
| 3690 |
+
if ( $this->requestEnvelope != null ) {
|
| 3691 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 3692 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 3693 |
+
$delim = '&';
|
| 3694 |
+
}
|
| 3695 |
+
if ( $this->payKey != null ) {
|
| 3696 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 3697 |
+
$delim = '&';
|
| 3698 |
+
}
|
| 3699 |
+
if ( $this->transactionId != null ) {
|
| 3700 |
+
$str .= $delim . $prefix . 'transactionId=' . urlencode( $this->transactionId );
|
| 3701 |
+
$delim = '&';
|
| 3702 |
+
}
|
| 3703 |
+
if ( $this->trackingId != null ) {
|
| 3704 |
+
$str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
|
| 3705 |
+
$delim = '&';
|
| 3706 |
+
}
|
| 3707 |
+
|
| 3708 |
+
return $str;
|
| 3709 |
+
}
|
| 3710 |
+
|
| 3711 |
+
}
|
| 3712 |
+
|
| 3713 |
+
|
| 3714 |
+
/**
|
| 3715 |
+
* The details of the PayRequest as specified in the Pay
|
| 3716 |
+
* operation.
|
| 3717 |
+
*/
|
| 3718 |
+
class PaymentDetailsResponse
|
| 3719 |
+
{
|
| 3720 |
+
|
| 3721 |
+
/**
|
| 3722 |
+
*
|
| 3723 |
+
* @access public
|
| 3724 |
+
* @var ResponseEnvelope
|
| 3725 |
+
*/
|
| 3726 |
+
public $responseEnvelope;
|
| 3727 |
+
|
| 3728 |
+
/**
|
| 3729 |
+
*
|
| 3730 |
+
* @access public
|
| 3731 |
+
* @var string
|
| 3732 |
+
*/
|
| 3733 |
+
public $cancelUrl;
|
| 3734 |
+
|
| 3735 |
+
/**
|
| 3736 |
+
*
|
| 3737 |
+
* @access public
|
| 3738 |
+
* @var string
|
| 3739 |
+
*/
|
| 3740 |
+
public $currencyCode;
|
| 3741 |
+
|
| 3742 |
+
/**
|
| 3743 |
+
*
|
| 3744 |
+
* @access public
|
| 3745 |
+
* @var string
|
| 3746 |
+
*/
|
| 3747 |
+
public $ipnNotificationUrl;
|
| 3748 |
+
|
| 3749 |
+
/**
|
| 3750 |
+
*
|
| 3751 |
+
* @access public
|
| 3752 |
+
* @var string
|
| 3753 |
+
*/
|
| 3754 |
+
public $memo;
|
| 3755 |
+
|
| 3756 |
+
/**
|
| 3757 |
+
*
|
| 3758 |
+
* @access public
|
| 3759 |
+
* @var PaymentInfoList
|
| 3760 |
+
*/
|
| 3761 |
+
public $paymentInfoList;
|
| 3762 |
+
|
| 3763 |
+
/**
|
| 3764 |
+
*
|
| 3765 |
+
* @access public
|
| 3766 |
+
* @var string
|
| 3767 |
+
*/
|
| 3768 |
+
public $returnUrl;
|
| 3769 |
+
|
| 3770 |
+
/**
|
| 3771 |
+
*
|
| 3772 |
+
* @access public
|
| 3773 |
+
* @var string
|
| 3774 |
+
*/
|
| 3775 |
+
public $senderEmail;
|
| 3776 |
+
|
| 3777 |
+
/**
|
| 3778 |
+
*
|
| 3779 |
+
* @access public
|
| 3780 |
+
* @var string
|
| 3781 |
+
*/
|
| 3782 |
+
public $status;
|
| 3783 |
+
|
| 3784 |
+
/**
|
| 3785 |
+
*
|
| 3786 |
+
* @access public
|
| 3787 |
+
* @var string
|
| 3788 |
+
*/
|
| 3789 |
+
public $trackingId;
|
| 3790 |
+
|
| 3791 |
+
/**
|
| 3792 |
+
*
|
| 3793 |
+
* @access public
|
| 3794 |
+
* @var string
|
| 3795 |
+
*/
|
| 3796 |
+
public $payKey;
|
| 3797 |
+
|
| 3798 |
+
/**
|
| 3799 |
+
*
|
| 3800 |
+
* @access public
|
| 3801 |
+
* @var string
|
| 3802 |
+
*/
|
| 3803 |
+
public $actionType;
|
| 3804 |
+
|
| 3805 |
+
/**
|
| 3806 |
+
*
|
| 3807 |
+
* @access public
|
| 3808 |
+
* @var string
|
| 3809 |
+
*/
|
| 3810 |
+
public $feesPayer;
|
| 3811 |
+
|
| 3812 |
+
/**
|
| 3813 |
+
*
|
| 3814 |
+
* @access public
|
| 3815 |
+
* @var boolean
|
| 3816 |
+
*/
|
| 3817 |
+
public $reverseAllParallelPaymentsOnError;
|
| 3818 |
+
|
| 3819 |
+
/**
|
| 3820 |
+
*
|
| 3821 |
+
* @access public
|
| 3822 |
+
* @var string
|
| 3823 |
+
*/
|
| 3824 |
+
public $preapprovalKey;
|
| 3825 |
+
|
| 3826 |
+
/**
|
| 3827 |
+
*
|
| 3828 |
+
* @access public
|
| 3829 |
+
* @var FundingConstraint
|
| 3830 |
+
*/
|
| 3831 |
+
public $fundingConstraint;
|
| 3832 |
+
|
| 3833 |
+
/**
|
| 3834 |
+
*
|
| 3835 |
+
* @access public
|
| 3836 |
+
* @var SenderIdentifier
|
| 3837 |
+
*/
|
| 3838 |
+
public $sender;
|
| 3839 |
+
|
| 3840 |
+
/**
|
| 3841 |
+
*
|
| 3842 |
+
* @array
|
| 3843 |
+
* @access public
|
| 3844 |
+
* @var ErrorData
|
| 3845 |
+
*/
|
| 3846 |
+
public $error;
|
| 3847 |
+
|
| 3848 |
+
|
| 3849 |
+
public function init( $map = null, $prefix = '' )
|
| 3850 |
+
{
|
| 3851 |
+
if ( $map != null ) {
|
| 3852 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 3853 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 3854 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 3855 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 3856 |
+
}
|
| 3857 |
+
$mapKeyName = $prefix . 'cancelUrl';
|
| 3858 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3859 |
+
$this->cancelUrl = $map[ $mapKeyName ];
|
| 3860 |
+
}
|
| 3861 |
+
$mapKeyName = $prefix . 'currencyCode';
|
| 3862 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3863 |
+
$this->currencyCode = $map[ $mapKeyName ];
|
| 3864 |
+
}
|
| 3865 |
+
$mapKeyName = $prefix . 'ipnNotificationUrl';
|
| 3866 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3867 |
+
$this->ipnNotificationUrl = $map[ $mapKeyName ];
|
| 3868 |
+
}
|
| 3869 |
+
$mapKeyName = $prefix . 'memo';
|
| 3870 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3871 |
+
$this->memo = $map[ $mapKeyName ];
|
| 3872 |
+
}
|
| 3873 |
+
if ( PPUtils::array_match_key( $map, $prefix . "paymentInfoList." ) ) {
|
| 3874 |
+
$newPrefix = $prefix . "paymentInfoList.";
|
| 3875 |
+
$this->paymentInfoList = new PaymentInfoList();
|
| 3876 |
+
$this->paymentInfoList->init( $map, $newPrefix );
|
| 3877 |
+
}
|
| 3878 |
+
$mapKeyName = $prefix . 'returnUrl';
|
| 3879 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3880 |
+
$this->returnUrl = $map[ $mapKeyName ];
|
| 3881 |
+
}
|
| 3882 |
+
$mapKeyName = $prefix . 'senderEmail';
|
| 3883 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3884 |
+
$this->senderEmail = $map[ $mapKeyName ];
|
| 3885 |
+
}
|
| 3886 |
+
$mapKeyName = $prefix . 'status';
|
| 3887 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3888 |
+
$this->status = $map[ $mapKeyName ];
|
| 3889 |
+
}
|
| 3890 |
+
$mapKeyName = $prefix . 'trackingId';
|
| 3891 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3892 |
+
$this->trackingId = $map[ $mapKeyName ];
|
| 3893 |
+
}
|
| 3894 |
+
$mapKeyName = $prefix . 'payKey';
|
| 3895 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3896 |
+
$this->payKey = $map[ $mapKeyName ];
|
| 3897 |
+
}
|
| 3898 |
+
$mapKeyName = $prefix . 'actionType';
|
| 3899 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3900 |
+
$this->actionType = $map[ $mapKeyName ];
|
| 3901 |
+
}
|
| 3902 |
+
$mapKeyName = $prefix . 'feesPayer';
|
| 3903 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3904 |
+
$this->feesPayer = $map[ $mapKeyName ];
|
| 3905 |
+
}
|
| 3906 |
+
$mapKeyName = $prefix . 'reverseAllParallelPaymentsOnError';
|
| 3907 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3908 |
+
$this->reverseAllParallelPaymentsOnError = $map[ $mapKeyName ];
|
| 3909 |
+
}
|
| 3910 |
+
$mapKeyName = $prefix . 'preapprovalKey';
|
| 3911 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 3912 |
+
$this->preapprovalKey = $map[ $mapKeyName ];
|
| 3913 |
+
}
|
| 3914 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingConstraint." ) ) {
|
| 3915 |
+
$newPrefix = $prefix . "fundingConstraint.";
|
| 3916 |
+
$this->fundingConstraint = new FundingConstraint();
|
| 3917 |
+
$this->fundingConstraint->init( $map, $newPrefix );
|
| 3918 |
+
}
|
| 3919 |
+
if ( PPUtils::array_match_key( $map, $prefix . "sender." ) ) {
|
| 3920 |
+
$newPrefix = $prefix . "sender.";
|
| 3921 |
+
$this->sender = new SenderIdentifier();
|
| 3922 |
+
$this->sender->init( $map, $newPrefix );
|
| 3923 |
+
}
|
| 3924 |
+
$i = 0;
|
| 3925 |
+
while ( true ) {
|
| 3926 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 3927 |
+
$newPrefix = $prefix . "error($i).";
|
| 3928 |
+
$this->error[ $i ] = new ErrorData();
|
| 3929 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 3930 |
+
} else {
|
| 3931 |
+
break;
|
| 3932 |
+
}
|
| 3933 |
+
$i++;
|
| 3934 |
+
}
|
| 3935 |
+
|
| 3936 |
+
}
|
| 3937 |
+
}
|
| 3938 |
+
}
|
| 3939 |
+
|
| 3940 |
+
|
| 3941 |
+
/**
|
| 3942 |
+
* The PayRequest contains the payment instructions to make
|
| 3943 |
+
* from sender to receivers.
|
| 3944 |
+
*/
|
| 3945 |
+
class PayRequest
|
| 3946 |
+
{
|
| 3947 |
+
|
| 3948 |
+
/**
|
| 3949 |
+
*
|
| 3950 |
+
* @access public
|
| 3951 |
+
* @var RequestEnvelope
|
| 3952 |
+
*/
|
| 3953 |
+
public $requestEnvelope;
|
| 3954 |
+
|
| 3955 |
+
/**
|
| 3956 |
+
*
|
| 3957 |
+
* @access public
|
| 3958 |
+
* @var ClientDetailsType
|
| 3959 |
+
*/
|
| 3960 |
+
public $clientDetails;
|
| 3961 |
+
|
| 3962 |
+
/**
|
| 3963 |
+
*
|
| 3964 |
+
* @access public
|
| 3965 |
+
* @var string
|
| 3966 |
+
*/
|
| 3967 |
+
public $actionType;
|
| 3968 |
+
|
| 3969 |
+
/**
|
| 3970 |
+
*
|
| 3971 |
+
* @access public
|
| 3972 |
+
* @var string
|
| 3973 |
+
*/
|
| 3974 |
+
public $cancelUrl;
|
| 3975 |
+
|
| 3976 |
+
/**
|
| 3977 |
+
*
|
| 3978 |
+
* @access public
|
| 3979 |
+
* @var string
|
| 3980 |
+
*/
|
| 3981 |
+
public $currencyCode;
|
| 3982 |
+
|
| 3983 |
+
/**
|
| 3984 |
+
*
|
| 3985 |
+
* @access public
|
| 3986 |
+
* @var string
|
| 3987 |
+
*/
|
| 3988 |
+
public $feesPayer;
|
| 3989 |
+
|
| 3990 |
+
/**
|
| 3991 |
+
*
|
| 3992 |
+
* @access public
|
| 3993 |
+
* @var string
|
| 3994 |
+
*/
|
| 3995 |
+
public $ipnNotificationUrl;
|
| 3996 |
+
|
| 3997 |
+
/**
|
| 3998 |
+
*
|
| 3999 |
+
* @access public
|
| 4000 |
+
* @var string
|
| 4001 |
+
*/
|
| 4002 |
+
public $memo;
|
| 4003 |
+
|
| 4004 |
+
/**
|
| 4005 |
+
*
|
| 4006 |
+
* @access public
|
| 4007 |
+
* @var string
|
| 4008 |
+
*/
|
| 4009 |
+
public $pin;
|
| 4010 |
+
|
| 4011 |
+
/**
|
| 4012 |
+
*
|
| 4013 |
+
* @access public
|
| 4014 |
+
* @var string
|
| 4015 |
+
*/
|
| 4016 |
+
public $preapprovalKey;
|
| 4017 |
+
|
| 4018 |
+
/**
|
| 4019 |
+
*
|
| 4020 |
+
* @access public
|
| 4021 |
+
* @var ReceiverList
|
| 4022 |
+
*/
|
| 4023 |
+
public $receiverList;
|
| 4024 |
+
|
| 4025 |
+
/**
|
| 4026 |
+
*
|
| 4027 |
+
* @access public
|
| 4028 |
+
* @var boolean
|
| 4029 |
+
*/
|
| 4030 |
+
public $reverseAllParallelPaymentsOnError;
|
| 4031 |
+
|
| 4032 |
+
/**
|
| 4033 |
+
*
|
| 4034 |
+
* @access public
|
| 4035 |
+
* @var string
|
| 4036 |
+
*/
|
| 4037 |
+
public $senderEmail;
|
| 4038 |
+
|
| 4039 |
+
/**
|
| 4040 |
+
*
|
| 4041 |
+
* @access public
|
| 4042 |
+
* @var string
|
| 4043 |
+
*/
|
| 4044 |
+
public $returnUrl;
|
| 4045 |
+
|
| 4046 |
+
/**
|
| 4047 |
+
*
|
| 4048 |
+
* @access public
|
| 4049 |
+
* @var string
|
| 4050 |
+
*/
|
| 4051 |
+
public $trackingId;
|
| 4052 |
+
|
| 4053 |
+
/**
|
| 4054 |
+
*
|
| 4055 |
+
* @access public
|
| 4056 |
+
* @var FundingConstraint
|
| 4057 |
+
*/
|
| 4058 |
+
public $fundingConstraint;
|
| 4059 |
+
|
| 4060 |
+
/**
|
| 4061 |
+
*
|
| 4062 |
+
* @access public
|
| 4063 |
+
* @var SenderIdentifier
|
| 4064 |
+
*/
|
| 4065 |
+
public $sender;
|
| 4066 |
+
|
| 4067 |
+
/**
|
| 4068 |
+
* Constructor with arguments
|
| 4069 |
+
*/
|
| 4070 |
+
public function __construct( $requestEnvelope = null, $actionType = null, $cancelUrl = null, $currencyCode = null, $receiverList = null, $returnUrl = null )
|
| 4071 |
+
{
|
| 4072 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 4073 |
+
$this->actionType = $actionType;
|
| 4074 |
+
$this->cancelUrl = $cancelUrl;
|
| 4075 |
+
$this->currencyCode = $currencyCode;
|
| 4076 |
+
$this->receiverList = $receiverList;
|
| 4077 |
+
$this->returnUrl = $returnUrl;
|
| 4078 |
+
}
|
| 4079 |
+
|
| 4080 |
+
|
| 4081 |
+
public function toNVPString( $prefix = '' )
|
| 4082 |
+
{
|
| 4083 |
+
$str = '';
|
| 4084 |
+
$delim = '';
|
| 4085 |
+
if ( $this->requestEnvelope != null ) {
|
| 4086 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 4087 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 4088 |
+
$delim = '&';
|
| 4089 |
+
}
|
| 4090 |
+
if ( $this->clientDetails != null ) {
|
| 4091 |
+
$newPrefix = $prefix . 'clientDetails.';
|
| 4092 |
+
$str .= $delim . call_user_func( array( $this->clientDetails, 'toNVPString' ), $newPrefix );
|
| 4093 |
+
$delim = '&';
|
| 4094 |
+
}
|
| 4095 |
+
if ( $this->actionType != null ) {
|
| 4096 |
+
$str .= $delim . $prefix . 'actionType=' . urlencode( $this->actionType );
|
| 4097 |
+
$delim = '&';
|
| 4098 |
+
}
|
| 4099 |
+
if ( $this->cancelUrl != null ) {
|
| 4100 |
+
$str .= $delim . $prefix . 'cancelUrl=' . urlencode( $this->cancelUrl );
|
| 4101 |
+
$delim = '&';
|
| 4102 |
+
}
|
| 4103 |
+
if ( $this->currencyCode != null ) {
|
| 4104 |
+
$str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
|
| 4105 |
+
$delim = '&';
|
| 4106 |
+
}
|
| 4107 |
+
if ( $this->feesPayer != null ) {
|
| 4108 |
+
$str .= $delim . $prefix . 'feesPayer=' . urlencode( $this->feesPayer );
|
| 4109 |
+
$delim = '&';
|
| 4110 |
+
}
|
| 4111 |
+
if ( $this->ipnNotificationUrl != null ) {
|
| 4112 |
+
$str .= $delim . $prefix . 'ipnNotificationUrl=' . urlencode( $this->ipnNotificationUrl );
|
| 4113 |
+
$delim = '&';
|
| 4114 |
+
}
|
| 4115 |
+
if ( $this->memo != null ) {
|
| 4116 |
+
$str .= $delim . $prefix . 'memo=' . urlencode( $this->memo );
|
| 4117 |
+
$delim = '&';
|
| 4118 |
+
}
|
| 4119 |
+
if ( $this->pin != null ) {
|
| 4120 |
+
$str .= $delim . $prefix . 'pin=' . urlencode( $this->pin );
|
| 4121 |
+
$delim = '&';
|
| 4122 |
+
}
|
| 4123 |
+
if ( $this->preapprovalKey != null ) {
|
| 4124 |
+
$str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
|
| 4125 |
+
$delim = '&';
|
| 4126 |
+
}
|
| 4127 |
+
if ( $this->receiverList != null ) {
|
| 4128 |
+
$newPrefix = $prefix . 'receiverList.';
|
| 4129 |
+
$str .= $delim . call_user_func( array( $this->receiverList, 'toNVPString' ), $newPrefix );
|
| 4130 |
+
$delim = '&';
|
| 4131 |
+
}
|
| 4132 |
+
if ( $this->reverseAllParallelPaymentsOnError != null ) {
|
| 4133 |
+
$str .= $delim . $prefix . 'reverseAllParallelPaymentsOnError=' . urlencode( $this->reverseAllParallelPaymentsOnError );
|
| 4134 |
+
$delim = '&';
|
| 4135 |
+
}
|
| 4136 |
+
if ( $this->senderEmail != null ) {
|
| 4137 |
+
$str .= $delim . $prefix . 'senderEmail=' . urlencode( $this->senderEmail );
|
| 4138 |
+
$delim = '&';
|
| 4139 |
+
}
|
| 4140 |
+
if ( $this->returnUrl != null ) {
|
| 4141 |
+
$str .= $delim . $prefix . 'returnUrl=' . urlencode( $this->returnUrl );
|
| 4142 |
+
$delim = '&';
|
| 4143 |
+
}
|
| 4144 |
+
if ( $this->trackingId != null ) {
|
| 4145 |
+
$str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
|
| 4146 |
+
$delim = '&';
|
| 4147 |
+
}
|
| 4148 |
+
if ( $this->fundingConstraint != null ) {
|
| 4149 |
+
$newPrefix = $prefix . 'fundingConstraint.';
|
| 4150 |
+
$str .= $delim . call_user_func( array( $this->fundingConstraint, 'toNVPString' ), $newPrefix );
|
| 4151 |
+
$delim = '&';
|
| 4152 |
+
}
|
| 4153 |
+
if ( $this->sender != null ) {
|
| 4154 |
+
$newPrefix = $prefix . 'sender.';
|
| 4155 |
+
$str .= $delim . call_user_func( array( $this->sender, 'toNVPString' ), $newPrefix );
|
| 4156 |
+
$delim = '&';
|
| 4157 |
+
}
|
| 4158 |
+
|
| 4159 |
+
return $str;
|
| 4160 |
+
}
|
| 4161 |
+
|
| 4162 |
+
}
|
| 4163 |
+
|
| 4164 |
+
|
| 4165 |
+
/**
|
| 4166 |
+
* The PayResponse contains the result of the Pay operation.
|
| 4167 |
+
* The payKey and execution status of the request should always
|
| 4168 |
+
* be provided.
|
| 4169 |
+
*/
|
| 4170 |
+
class PayResponse
|
| 4171 |
+
{
|
| 4172 |
+
|
| 4173 |
+
/**
|
| 4174 |
+
*
|
| 4175 |
+
* @access public
|
| 4176 |
+
* @var ResponseEnvelope
|
| 4177 |
+
*/
|
| 4178 |
+
public $responseEnvelope;
|
| 4179 |
+
|
| 4180 |
+
/**
|
| 4181 |
+
*
|
| 4182 |
+
* @access public
|
| 4183 |
+
* @var string
|
| 4184 |
+
*/
|
| 4185 |
+
public $payKey;
|
| 4186 |
+
|
| 4187 |
+
/**
|
| 4188 |
+
*
|
| 4189 |
+
* @access public
|
| 4190 |
+
* @var string
|
| 4191 |
+
*/
|
| 4192 |
+
public $paymentExecStatus;
|
| 4193 |
+
|
| 4194 |
+
/**
|
| 4195 |
+
*
|
| 4196 |
+
* @access public
|
| 4197 |
+
* @var PayErrorList
|
| 4198 |
+
*/
|
| 4199 |
+
public $payErrorList;
|
| 4200 |
+
|
| 4201 |
+
/**
|
| 4202 |
+
*
|
| 4203 |
+
* @access public
|
| 4204 |
+
* @var FundingPlan
|
| 4205 |
+
*/
|
| 4206 |
+
public $defaultFundingPlan;
|
| 4207 |
+
|
| 4208 |
+
/**
|
| 4209 |
+
*
|
| 4210 |
+
* @array
|
| 4211 |
+
* @access public
|
| 4212 |
+
* @var ErrorData
|
| 4213 |
+
*/
|
| 4214 |
+
public $error;
|
| 4215 |
+
|
| 4216 |
+
|
| 4217 |
+
public function init( $map = null, $prefix = '' )
|
| 4218 |
+
{
|
| 4219 |
+
if ( $map != null ) {
|
| 4220 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 4221 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 4222 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 4223 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 4224 |
+
}
|
| 4225 |
+
$mapKeyName = $prefix . 'payKey';
|
| 4226 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4227 |
+
$this->payKey = $map[ $mapKeyName ];
|
| 4228 |
+
}
|
| 4229 |
+
$mapKeyName = $prefix . 'paymentExecStatus';
|
| 4230 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4231 |
+
$this->paymentExecStatus = $map[ $mapKeyName ];
|
| 4232 |
+
}
|
| 4233 |
+
if ( PPUtils::array_match_key( $map, $prefix . "payErrorList." ) ) {
|
| 4234 |
+
$newPrefix = $prefix . "payErrorList.";
|
| 4235 |
+
$this->payErrorList = new PayErrorList();
|
| 4236 |
+
$this->payErrorList->init( $map, $newPrefix );
|
| 4237 |
+
}
|
| 4238 |
+
if ( PPUtils::array_match_key( $map, $prefix . "defaultFundingPlan." ) ) {
|
| 4239 |
+
$newPrefix = $prefix . "defaultFundingPlan.";
|
| 4240 |
+
$this->defaultFundingPlan = new FundingPlan();
|
| 4241 |
+
$this->defaultFundingPlan->init( $map, $newPrefix );
|
| 4242 |
+
}
|
| 4243 |
+
$i = 0;
|
| 4244 |
+
while ( true ) {
|
| 4245 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 4246 |
+
$newPrefix = $prefix . "error($i).";
|
| 4247 |
+
$this->error[ $i ] = new ErrorData();
|
| 4248 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 4249 |
+
} else {
|
| 4250 |
+
break;
|
| 4251 |
+
}
|
| 4252 |
+
$i++;
|
| 4253 |
+
}
|
| 4254 |
+
|
| 4255 |
+
}
|
| 4256 |
+
}
|
| 4257 |
+
}
|
| 4258 |
+
|
| 4259 |
+
|
| 4260 |
+
/**
|
| 4261 |
+
* The request to look up the details of a Preapproval.
|
| 4262 |
+
*/
|
| 4263 |
+
class PreapprovalDetailsRequest
|
| 4264 |
+
{
|
| 4265 |
+
|
| 4266 |
+
/**
|
| 4267 |
+
*
|
| 4268 |
+
* @access public
|
| 4269 |
+
* @var RequestEnvelope
|
| 4270 |
+
*/
|
| 4271 |
+
public $requestEnvelope;
|
| 4272 |
+
|
| 4273 |
+
/**
|
| 4274 |
+
*
|
| 4275 |
+
* @access public
|
| 4276 |
+
* @var string
|
| 4277 |
+
*/
|
| 4278 |
+
public $preapprovalKey;
|
| 4279 |
+
|
| 4280 |
+
/**
|
| 4281 |
+
*
|
| 4282 |
+
* @access public
|
| 4283 |
+
* @var boolean
|
| 4284 |
+
*/
|
| 4285 |
+
public $getBillingAddress;
|
| 4286 |
+
|
| 4287 |
+
/**
|
| 4288 |
+
* Constructor with arguments
|
| 4289 |
+
*/
|
| 4290 |
+
public function __construct( $requestEnvelope = null, $preapprovalKey = null )
|
| 4291 |
+
{
|
| 4292 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 4293 |
+
$this->preapprovalKey = $preapprovalKey;
|
| 4294 |
+
}
|
| 4295 |
+
|
| 4296 |
+
|
| 4297 |
+
public function toNVPString( $prefix = '' )
|
| 4298 |
+
{
|
| 4299 |
+
$str = '';
|
| 4300 |
+
$delim = '';
|
| 4301 |
+
if ( $this->requestEnvelope != null ) {
|
| 4302 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 4303 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 4304 |
+
$delim = '&';
|
| 4305 |
+
}
|
| 4306 |
+
if ( $this->preapprovalKey != null ) {
|
| 4307 |
+
$str .= $delim . $prefix . 'preapprovalKey=' . urlencode( $this->preapprovalKey );
|
| 4308 |
+
$delim = '&';
|
| 4309 |
+
}
|
| 4310 |
+
if ( $this->getBillingAddress != null ) {
|
| 4311 |
+
$str .= $delim . $prefix . 'getBillingAddress=' . urlencode( $this->getBillingAddress );
|
| 4312 |
+
$delim = '&';
|
| 4313 |
+
}
|
| 4314 |
+
|
| 4315 |
+
return $str;
|
| 4316 |
+
}
|
| 4317 |
+
|
| 4318 |
+
}
|
| 4319 |
+
|
| 4320 |
+
|
| 4321 |
+
/**
|
| 4322 |
+
* The details of the Preapproval as specified in the
|
| 4323 |
+
* Preapproval operation.
|
| 4324 |
+
*/
|
| 4325 |
+
class PreapprovalDetailsResponse
|
| 4326 |
+
{
|
| 4327 |
+
|
| 4328 |
+
/**
|
| 4329 |
+
*
|
| 4330 |
+
* @access public
|
| 4331 |
+
* @var ResponseEnvelope
|
| 4332 |
+
*/
|
| 4333 |
+
public $responseEnvelope;
|
| 4334 |
+
|
| 4335 |
+
/**
|
| 4336 |
+
*
|
| 4337 |
+
* @access public
|
| 4338 |
+
* @var boolean
|
| 4339 |
+
*/
|
| 4340 |
+
public $approved;
|
| 4341 |
+
|
| 4342 |
+
/**
|
| 4343 |
+
*
|
| 4344 |
+
* @access public
|
| 4345 |
+
* @var string
|
| 4346 |
+
*/
|
| 4347 |
+
public $cancelUrl;
|
| 4348 |
+
|
| 4349 |
+
/**
|
| 4350 |
+
*
|
| 4351 |
+
* @access public
|
| 4352 |
+
* @var integer
|
| 4353 |
+
*/
|
| 4354 |
+
public $curPayments;
|
| 4355 |
+
|
| 4356 |
+
/**
|
| 4357 |
+
*
|
| 4358 |
+
* @access public
|
| 4359 |
+
* @var double
|
| 4360 |
+
*/
|
| 4361 |
+
public $curPaymentsAmount;
|
| 4362 |
+
|
| 4363 |
+
/**
|
| 4364 |
+
*
|
| 4365 |
+
* @access public
|
| 4366 |
+
* @var integer
|
| 4367 |
+
*/
|
| 4368 |
+
public $curPeriodAttempts;
|
| 4369 |
+
|
| 4370 |
+
/**
|
| 4371 |
+
*
|
| 4372 |
+
* @access public
|
| 4373 |
+
* @var dateTime
|
| 4374 |
+
*/
|
| 4375 |
+
public $curPeriodEndingDate;
|
| 4376 |
+
|
| 4377 |
+
/**
|
| 4378 |
+
*
|
| 4379 |
+
* @access public
|
| 4380 |
+
* @var string
|
| 4381 |
+
*/
|
| 4382 |
+
public $currencyCode;
|
| 4383 |
+
|
| 4384 |
+
/**
|
| 4385 |
+
*
|
| 4386 |
+
* @access public
|
| 4387 |
+
* @var integer
|
| 4388 |
+
*/
|
| 4389 |
+
public $dateOfMonth;
|
| 4390 |
+
|
| 4391 |
+
/**
|
| 4392 |
+
*
|
| 4393 |
+
* @access public
|
| 4394 |
+
* @var DayOfWeek
|
| 4395 |
+
*/
|
| 4396 |
+
public $dayOfWeek;
|
| 4397 |
+
|
| 4398 |
+
/**
|
| 4399 |
+
*
|
| 4400 |
+
* @access public
|
| 4401 |
+
* @var dateTime
|
| 4402 |
+
*/
|
| 4403 |
+
public $endingDate;
|
| 4404 |
+
|
| 4405 |
+
/**
|
| 4406 |
+
*
|
| 4407 |
+
* @access public
|
| 4408 |
+
* @var double
|
| 4409 |
+
*/
|
| 4410 |
+
public $maxAmountPerPayment;
|
| 4411 |
+
|
| 4412 |
+
/**
|
| 4413 |
+
*
|
| 4414 |
+
* @access public
|
| 4415 |
+
* @var integer
|
| 4416 |
+
*/
|
| 4417 |
+
public $maxNumberOfPayments;
|
| 4418 |
+
|
| 4419 |
+
/**
|
| 4420 |
+
*
|
| 4421 |
+
* @access public
|
| 4422 |
+
* @var integer
|
| 4423 |
+
*/
|
| 4424 |
+
public $maxNumberOfPaymentsPerPeriod;
|
| 4425 |
+
|
| 4426 |
+
/**
|
| 4427 |
+
*
|
| 4428 |
+
* @access public
|
| 4429 |
+
* @var double
|
| 4430 |
+
*/
|
| 4431 |
+
public $maxTotalAmountOfAllPayments;
|
| 4432 |
+
|
| 4433 |
+
/**
|
| 4434 |
+
*
|
| 4435 |
+
* @access public
|
| 4436 |
+
* @var string
|
| 4437 |
+
*/
|
| 4438 |
+
public $paymentPeriod;
|
| 4439 |
+
|
| 4440 |
+
/**
|
| 4441 |
+
*
|
| 4442 |
+
* @access public
|
| 4443 |
+
* @var string
|
| 4444 |
+
*/
|
| 4445 |
+
public $pinType;
|
| 4446 |
+
|
| 4447 |
+
/**
|
| 4448 |
+
*
|
| 4449 |
+
* @access public
|
| 4450 |
+
* @var string
|
| 4451 |
+
*/
|
| 4452 |
+
public $returnUrl;
|
| 4453 |
+
|
| 4454 |
+
/**
|
| 4455 |
+
*
|
| 4456 |
+
* @access public
|
| 4457 |
+
* @var string
|
| 4458 |
+
*/
|
| 4459 |
+
public $senderEmail;
|
| 4460 |
+
|
| 4461 |
+
/**
|
| 4462 |
+
*
|
| 4463 |
+
* @access public
|
| 4464 |
+
* @var string
|
| 4465 |
+
*/
|
| 4466 |
+
public $memo;
|
| 4467 |
+
|
| 4468 |
+
/**
|
| 4469 |
+
*
|
| 4470 |
+
* @access public
|
| 4471 |
+
* @var dateTime
|
| 4472 |
+
*/
|
| 4473 |
+
public $startingDate;
|
| 4474 |
+
|
| 4475 |
+
/**
|
| 4476 |
+
*
|
| 4477 |
+
* @access public
|
| 4478 |
+
* @var string
|
| 4479 |
+
*/
|
| 4480 |
+
public $status;
|
| 4481 |
+
|
| 4482 |
+
/**
|
| 4483 |
+
*
|
| 4484 |
+
* @access public
|
| 4485 |
+
* @var string
|
| 4486 |
+
*/
|
| 4487 |
+
public $ipnNotificationUrl;
|
| 4488 |
+
|
| 4489 |
+
/**
|
| 4490 |
+
*
|
| 4491 |
+
* @access public
|
| 4492 |
+
* @var AddressList
|
| 4493 |
+
*/
|
| 4494 |
+
public $addressList;
|
| 4495 |
+
|
| 4496 |
+
/**
|
| 4497 |
+
*
|
| 4498 |
+
* @access public
|
| 4499 |
+
* @var string
|
| 4500 |
+
*/
|
| 4501 |
+
public $feesPayer;
|
| 4502 |
+
|
| 4503 |
+
/**
|
| 4504 |
+
*
|
| 4505 |
+
* @access public
|
| 4506 |
+
* @var boolean
|
| 4507 |
+
*/
|
| 4508 |
+
public $displayMaxTotalAmount;
|
| 4509 |
+
|
| 4510 |
+
/**
|
| 4511 |
+
*
|
| 4512 |
+
* @array
|
| 4513 |
+
* @access public
|
| 4514 |
+
* @var ErrorData
|
| 4515 |
+
*/
|
| 4516 |
+
public $error;
|
| 4517 |
+
|
| 4518 |
+
|
| 4519 |
+
public function init( $map = null, $prefix = '' )
|
| 4520 |
+
{
|
| 4521 |
+
if ( $map != null ) {
|
| 4522 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 4523 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 4524 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 4525 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 4526 |
+
}
|
| 4527 |
+
$mapKeyName = $prefix . 'approved';
|
| 4528 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4529 |
+
$this->approved = $map[ $mapKeyName ];
|
| 4530 |
+
}
|
| 4531 |
+
$mapKeyName = $prefix . 'cancelUrl';
|
| 4532 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4533 |
+
$this->cancelUrl = $map[ $mapKeyName ];
|
| 4534 |
+
}
|
| 4535 |
+
$mapKeyName = $prefix . 'curPayments';
|
| 4536 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4537 |
+
$this->curPayments = $map[ $mapKeyName ];
|
| 4538 |
+
}
|
| 4539 |
+
$mapKeyName = $prefix . 'curPaymentsAmount';
|
| 4540 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4541 |
+
$this->curPaymentsAmount = $map[ $mapKeyName ];
|
| 4542 |
+
}
|
| 4543 |
+
$mapKeyName = $prefix . 'curPeriodAttempts';
|
| 4544 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4545 |
+
$this->curPeriodAttempts = $map[ $mapKeyName ];
|
| 4546 |
+
}
|
| 4547 |
+
$mapKeyName = $prefix . 'curPeriodEndingDate';
|
| 4548 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4549 |
+
$this->curPeriodEndingDate = $map[ $mapKeyName ];
|
| 4550 |
+
}
|
| 4551 |
+
$mapKeyName = $prefix . 'currencyCode';
|
| 4552 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4553 |
+
$this->currencyCode = $map[ $mapKeyName ];
|
| 4554 |
+
}
|
| 4555 |
+
$mapKeyName = $prefix . 'dateOfMonth';
|
| 4556 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4557 |
+
$this->dateOfMonth = $map[ $mapKeyName ];
|
| 4558 |
+
}
|
| 4559 |
+
$mapKeyName = $prefix . 'dayOfWeek';
|
| 4560 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4561 |
+
$this->dayOfWeek = $map[ $mapKeyName ];
|
| 4562 |
+
}
|
| 4563 |
+
$mapKeyName = $prefix . 'endingDate';
|
| 4564 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4565 |
+
$this->endingDate = $map[ $mapKeyName ];
|
| 4566 |
+
}
|
| 4567 |
+
$mapKeyName = $prefix . 'maxAmountPerPayment';
|
| 4568 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4569 |
+
$this->maxAmountPerPayment = $map[ $mapKeyName ];
|
| 4570 |
+
}
|
| 4571 |
+
$mapKeyName = $prefix . 'maxNumberOfPayments';
|
| 4572 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4573 |
+
$this->maxNumberOfPayments = $map[ $mapKeyName ];
|
| 4574 |
+
}
|
| 4575 |
+
$mapKeyName = $prefix . 'maxNumberOfPaymentsPerPeriod';
|
| 4576 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4577 |
+
$this->maxNumberOfPaymentsPerPeriod = $map[ $mapKeyName ];
|
| 4578 |
+
}
|
| 4579 |
+
$mapKeyName = $prefix . 'maxTotalAmountOfAllPayments';
|
| 4580 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4581 |
+
$this->maxTotalAmountOfAllPayments = $map[ $mapKeyName ];
|
| 4582 |
+
}
|
| 4583 |
+
$mapKeyName = $prefix . 'paymentPeriod';
|
| 4584 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4585 |
+
$this->paymentPeriod = $map[ $mapKeyName ];
|
| 4586 |
+
}
|
| 4587 |
+
$mapKeyName = $prefix . 'pinType';
|
| 4588 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4589 |
+
$this->pinType = $map[ $mapKeyName ];
|
| 4590 |
+
}
|
| 4591 |
+
$mapKeyName = $prefix . 'returnUrl';
|
| 4592 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4593 |
+
$this->returnUrl = $map[ $mapKeyName ];
|
| 4594 |
+
}
|
| 4595 |
+
$mapKeyName = $prefix . 'senderEmail';
|
| 4596 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4597 |
+
$this->senderEmail = $map[ $mapKeyName ];
|
| 4598 |
+
}
|
| 4599 |
+
$mapKeyName = $prefix . 'memo';
|
| 4600 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4601 |
+
$this->memo = $map[ $mapKeyName ];
|
| 4602 |
+
}
|
| 4603 |
+
$mapKeyName = $prefix . 'startingDate';
|
| 4604 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4605 |
+
$this->startingDate = $map[ $mapKeyName ];
|
| 4606 |
+
}
|
| 4607 |
+
$mapKeyName = $prefix . 'status';
|
| 4608 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4609 |
+
$this->status = $map[ $mapKeyName ];
|
| 4610 |
+
}
|
| 4611 |
+
$mapKeyName = $prefix . 'ipnNotificationUrl';
|
| 4612 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4613 |
+
$this->ipnNotificationUrl = $map[ $mapKeyName ];
|
| 4614 |
+
}
|
| 4615 |
+
if ( PPUtils::array_match_key( $map, $prefix . "addressList." ) ) {
|
| 4616 |
+
$newPrefix = $prefix . "addressList.";
|
| 4617 |
+
$this->addressList = new AddressList();
|
| 4618 |
+
$this->addressList->init( $map, $newPrefix );
|
| 4619 |
+
}
|
| 4620 |
+
$mapKeyName = $prefix . 'feesPayer';
|
| 4621 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4622 |
+
$this->feesPayer = $map[ $mapKeyName ];
|
| 4623 |
+
}
|
| 4624 |
+
$mapKeyName = $prefix . 'displayMaxTotalAmount';
|
| 4625 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4626 |
+
$this->displayMaxTotalAmount = $map[ $mapKeyName ];
|
| 4627 |
+
}
|
| 4628 |
+
$i = 0;
|
| 4629 |
+
while ( true ) {
|
| 4630 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 4631 |
+
$newPrefix = $prefix . "error($i).";
|
| 4632 |
+
$this->error[ $i ] = new ErrorData();
|
| 4633 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 4634 |
+
} else {
|
| 4635 |
+
break;
|
| 4636 |
+
}
|
| 4637 |
+
$i++;
|
| 4638 |
+
}
|
| 4639 |
+
|
| 4640 |
+
}
|
| 4641 |
+
}
|
| 4642 |
+
}
|
| 4643 |
+
|
| 4644 |
+
|
| 4645 |
+
/**
|
| 4646 |
+
* A request to create a Preapproval. A Preapproval is an
|
| 4647 |
+
* agreement between a Paypal account holder (the sender) and
|
| 4648 |
+
* the API caller (the service invoker) to make payment(s) on
|
| 4649 |
+
* the the sender's behalf with various limitations defined.
|
| 4650 |
+
*/
|
| 4651 |
+
class PreapprovalRequest
|
| 4652 |
+
{
|
| 4653 |
+
|
| 4654 |
+
/**
|
| 4655 |
+
*
|
| 4656 |
+
* @access public
|
| 4657 |
+
* @var RequestEnvelope
|
| 4658 |
+
*/
|
| 4659 |
+
public $requestEnvelope;
|
| 4660 |
+
|
| 4661 |
+
/**
|
| 4662 |
+
*
|
| 4663 |
+
* @access public
|
| 4664 |
+
* @var ClientDetailsType
|
| 4665 |
+
*/
|
| 4666 |
+
public $clientDetails;
|
| 4667 |
+
|
| 4668 |
+
/**
|
| 4669 |
+
*
|
| 4670 |
+
* @access public
|
| 4671 |
+
* @var string
|
| 4672 |
+
*/
|
| 4673 |
+
public $cancelUrl;
|
| 4674 |
+
|
| 4675 |
+
/**
|
| 4676 |
+
*
|
| 4677 |
+
* @access public
|
| 4678 |
+
* @var string
|
| 4679 |
+
*/
|
| 4680 |
+
public $currencyCode;
|
| 4681 |
+
|
| 4682 |
+
/**
|
| 4683 |
+
*
|
| 4684 |
+
* @access public
|
| 4685 |
+
* @var integer
|
| 4686 |
+
*/
|
| 4687 |
+
public $dateOfMonth;
|
| 4688 |
+
|
| 4689 |
+
/**
|
| 4690 |
+
*
|
| 4691 |
+
* @access public
|
| 4692 |
+
* @var DayOfWeek
|
| 4693 |
+
*/
|
| 4694 |
+
public $dayOfWeek;
|
| 4695 |
+
|
| 4696 |
+
/**
|
| 4697 |
+
*
|
| 4698 |
+
* @access public
|
| 4699 |
+
* @var dateTime
|
| 4700 |
+
*/
|
| 4701 |
+
public $endingDate;
|
| 4702 |
+
|
| 4703 |
+
/**
|
| 4704 |
+
*
|
| 4705 |
+
* @access public
|
| 4706 |
+
* @var double
|
| 4707 |
+
*/
|
| 4708 |
+
public $maxAmountPerPayment;
|
| 4709 |
+
|
| 4710 |
+
/**
|
| 4711 |
+
*
|
| 4712 |
+
* @access public
|
| 4713 |
+
* @var integer
|
| 4714 |
+
*/
|
| 4715 |
+
public $maxNumberOfPayments;
|
| 4716 |
+
|
| 4717 |
+
/**
|
| 4718 |
+
*
|
| 4719 |
+
* @access public
|
| 4720 |
+
* @var integer
|
| 4721 |
+
*/
|
| 4722 |
+
public $maxNumberOfPaymentsPerPeriod;
|
| 4723 |
+
|
| 4724 |
+
/**
|
| 4725 |
+
*
|
| 4726 |
+
* @access public
|
| 4727 |
+
* @var double
|
| 4728 |
+
*/
|
| 4729 |
+
public $maxTotalAmountOfAllPayments;
|
| 4730 |
+
|
| 4731 |
+
/**
|
| 4732 |
+
*
|
| 4733 |
+
* @access public
|
| 4734 |
+
* @var string
|
| 4735 |
+
*/
|
| 4736 |
+
public $paymentPeriod;
|
| 4737 |
+
|
| 4738 |
+
/**
|
| 4739 |
+
*
|
| 4740 |
+
* @access public
|
| 4741 |
+
* @var string
|
| 4742 |
+
*/
|
| 4743 |
+
public $returnUrl;
|
| 4744 |
+
|
| 4745 |
+
/**
|
| 4746 |
+
*
|
| 4747 |
+
* @access public
|
| 4748 |
+
* @var string
|
| 4749 |
+
*/
|
| 4750 |
+
public $memo;
|
| 4751 |
+
|
| 4752 |
+
/**
|
| 4753 |
+
*
|
| 4754 |
+
* @access public
|
| 4755 |
+
* @var string
|
| 4756 |
+
*/
|
| 4757 |
+
public $ipnNotificationUrl;
|
| 4758 |
+
|
| 4759 |
+
/**
|
| 4760 |
+
*
|
| 4761 |
+
* @access public
|
| 4762 |
+
* @var string
|
| 4763 |
+
*/
|
| 4764 |
+
public $senderEmail;
|
| 4765 |
+
|
| 4766 |
+
/**
|
| 4767 |
+
*
|
| 4768 |
+
* @access public
|
| 4769 |
+
* @var dateTime
|
| 4770 |
+
*/
|
| 4771 |
+
public $startingDate;
|
| 4772 |
+
|
| 4773 |
+
/**
|
| 4774 |
+
*
|
| 4775 |
+
* @access public
|
| 4776 |
+
* @var string
|
| 4777 |
+
*/
|
| 4778 |
+
public $pinType;
|
| 4779 |
+
|
| 4780 |
+
/**
|
| 4781 |
+
*
|
| 4782 |
+
* @access public
|
| 4783 |
+
* @var string
|
| 4784 |
+
*/
|
| 4785 |
+
public $feesPayer;
|
| 4786 |
+
|
| 4787 |
+
/**
|
| 4788 |
+
*
|
| 4789 |
+
* @access public
|
| 4790 |
+
* @var boolean
|
| 4791 |
+
*/
|
| 4792 |
+
public $displayMaxTotalAmount;
|
| 4793 |
+
|
| 4794 |
+
/**
|
| 4795 |
+
* Constructor with arguments
|
| 4796 |
+
*/
|
| 4797 |
+
public function __construct( $requestEnvelope = null, $cancelUrl = null, $currencyCode = null, $returnUrl = null, $startingDate = null )
|
| 4798 |
+
{
|
| 4799 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 4800 |
+
$this->cancelUrl = $cancelUrl;
|
| 4801 |
+
$this->currencyCode = $currencyCode;
|
| 4802 |
+
$this->returnUrl = $returnUrl;
|
| 4803 |
+
$this->startingDate = $startingDate;
|
| 4804 |
+
}
|
| 4805 |
+
|
| 4806 |
+
|
| 4807 |
+
public function toNVPString( $prefix = '' )
|
| 4808 |
+
{
|
| 4809 |
+
$str = '';
|
| 4810 |
+
$delim = '';
|
| 4811 |
+
if ( $this->requestEnvelope != null ) {
|
| 4812 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 4813 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 4814 |
+
$delim = '&';
|
| 4815 |
+
}
|
| 4816 |
+
if ( $this->clientDetails != null ) {
|
| 4817 |
+
$newPrefix = $prefix . 'clientDetails.';
|
| 4818 |
+
$str .= $delim . call_user_func( array( $this->clientDetails, 'toNVPString' ), $newPrefix );
|
| 4819 |
+
$delim = '&';
|
| 4820 |
+
}
|
| 4821 |
+
if ( $this->cancelUrl != null ) {
|
| 4822 |
+
$str .= $delim . $prefix . 'cancelUrl=' . urlencode( $this->cancelUrl );
|
| 4823 |
+
$delim = '&';
|
| 4824 |
+
}
|
| 4825 |
+
if ( $this->currencyCode != null ) {
|
| 4826 |
+
$str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
|
| 4827 |
+
$delim = '&';
|
| 4828 |
+
}
|
| 4829 |
+
if ( $this->dateOfMonth != null ) {
|
| 4830 |
+
$str .= $delim . $prefix . 'dateOfMonth=' . urlencode( $this->dateOfMonth );
|
| 4831 |
+
$delim = '&';
|
| 4832 |
+
}
|
| 4833 |
+
if ( $this->dayOfWeek != null ) {
|
| 4834 |
+
$str .= $delim . $prefix . 'dayOfWeek=' . urlencode( $this->dayOfWeek );
|
| 4835 |
+
$delim = '&';
|
| 4836 |
+
}
|
| 4837 |
+
if ( $this->endingDate != null ) {
|
| 4838 |
+
$str .= $delim . $prefix . 'endingDate=' . urlencode( $this->endingDate );
|
| 4839 |
+
$delim = '&';
|
| 4840 |
+
}
|
| 4841 |
+
if ( $this->maxAmountPerPayment != null ) {
|
| 4842 |
+
$str .= $delim . $prefix . 'maxAmountPerPayment=' . urlencode( $this->maxAmountPerPayment );
|
| 4843 |
+
$delim = '&';
|
| 4844 |
+
}
|
| 4845 |
+
if ( $this->maxNumberOfPayments != null ) {
|
| 4846 |
+
$str .= $delim . $prefix . 'maxNumberOfPayments=' . urlencode( $this->maxNumberOfPayments );
|
| 4847 |
+
$delim = '&';
|
| 4848 |
+
}
|
| 4849 |
+
if ( $this->maxNumberOfPaymentsPerPeriod != null ) {
|
| 4850 |
+
$str .= $delim . $prefix . 'maxNumberOfPaymentsPerPeriod=' . urlencode( $this->maxNumberOfPaymentsPerPeriod );
|
| 4851 |
+
$delim = '&';
|
| 4852 |
+
}
|
| 4853 |
+
if ( $this->maxTotalAmountOfAllPayments != null ) {
|
| 4854 |
+
$str .= $delim . $prefix . 'maxTotalAmountOfAllPayments=' . urlencode( $this->maxTotalAmountOfAllPayments );
|
| 4855 |
+
$delim = '&';
|
| 4856 |
+
}
|
| 4857 |
+
if ( $this->paymentPeriod != null ) {
|
| 4858 |
+
$str .= $delim . $prefix . 'paymentPeriod=' . urlencode( $this->paymentPeriod );
|
| 4859 |
+
$delim = '&';
|
| 4860 |
+
}
|
| 4861 |
+
if ( $this->returnUrl != null ) {
|
| 4862 |
+
$str .= $delim . $prefix . 'returnUrl=' . urlencode( $this->returnUrl );
|
| 4863 |
+
$delim = '&';
|
| 4864 |
+
}
|
| 4865 |
+
if ( $this->memo != null ) {
|
| 4866 |
+
$str .= $delim . $prefix . 'memo=' . urlencode( $this->memo );
|
| 4867 |
+
$delim = '&';
|
| 4868 |
+
}
|
| 4869 |
+
if ( $this->ipnNotificationUrl != null ) {
|
| 4870 |
+
$str .= $delim . $prefix . 'ipnNotificationUrl=' . urlencode( $this->ipnNotificationUrl );
|
| 4871 |
+
$delim = '&';
|
| 4872 |
+
}
|
| 4873 |
+
if ( $this->senderEmail != null ) {
|
| 4874 |
+
$str .= $delim . $prefix . 'senderEmail=' . urlencode( $this->senderEmail );
|
| 4875 |
+
$delim = '&';
|
| 4876 |
+
}
|
| 4877 |
+
if ( $this->startingDate != null ) {
|
| 4878 |
+
$str .= $delim . $prefix . 'startingDate=' . urlencode( $this->startingDate );
|
| 4879 |
+
$delim = '&';
|
| 4880 |
+
}
|
| 4881 |
+
if ( $this->pinType != null ) {
|
| 4882 |
+
$str .= $delim . $prefix . 'pinType=' . urlencode( $this->pinType );
|
| 4883 |
+
$delim = '&';
|
| 4884 |
+
}
|
| 4885 |
+
if ( $this->feesPayer != null ) {
|
| 4886 |
+
$str .= $delim . $prefix . 'feesPayer=' . urlencode( $this->feesPayer );
|
| 4887 |
+
$delim = '&';
|
| 4888 |
+
}
|
| 4889 |
+
if ( $this->displayMaxTotalAmount != null ) {
|
| 4890 |
+
$str .= $delim . $prefix . 'displayMaxTotalAmount=' . urlencode( $this->displayMaxTotalAmount );
|
| 4891 |
+
$delim = '&';
|
| 4892 |
+
}
|
| 4893 |
+
|
| 4894 |
+
return $str;
|
| 4895 |
+
}
|
| 4896 |
+
|
| 4897 |
+
}
|
| 4898 |
+
|
| 4899 |
+
|
| 4900 |
+
/**
|
| 4901 |
+
* The result of the PreapprovalRequest is a preapprovalKey.
|
| 4902 |
+
*/
|
| 4903 |
+
class PreapprovalResponse
|
| 4904 |
+
{
|
| 4905 |
+
|
| 4906 |
+
/**
|
| 4907 |
+
*
|
| 4908 |
+
* @access public
|
| 4909 |
+
* @var ResponseEnvelope
|
| 4910 |
+
*/
|
| 4911 |
+
public $responseEnvelope;
|
| 4912 |
+
|
| 4913 |
+
/**
|
| 4914 |
+
*
|
| 4915 |
+
* @access public
|
| 4916 |
+
* @var string
|
| 4917 |
+
*/
|
| 4918 |
+
public $preapprovalKey;
|
| 4919 |
+
|
| 4920 |
+
/**
|
| 4921 |
+
*
|
| 4922 |
+
* @array
|
| 4923 |
+
* @access public
|
| 4924 |
+
* @var ErrorData
|
| 4925 |
+
*/
|
| 4926 |
+
public $error;
|
| 4927 |
+
|
| 4928 |
+
|
| 4929 |
+
public function init( $map = null, $prefix = '' )
|
| 4930 |
+
{
|
| 4931 |
+
if ( $map != null ) {
|
| 4932 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 4933 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 4934 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 4935 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 4936 |
+
}
|
| 4937 |
+
$mapKeyName = $prefix . 'preapprovalKey';
|
| 4938 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 4939 |
+
$this->preapprovalKey = $map[ $mapKeyName ];
|
| 4940 |
+
}
|
| 4941 |
+
$i = 0;
|
| 4942 |
+
while ( true ) {
|
| 4943 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 4944 |
+
$newPrefix = $prefix . "error($i).";
|
| 4945 |
+
$this->error[ $i ] = new ErrorData();
|
| 4946 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 4947 |
+
} else {
|
| 4948 |
+
break;
|
| 4949 |
+
}
|
| 4950 |
+
$i++;
|
| 4951 |
+
}
|
| 4952 |
+
|
| 4953 |
+
}
|
| 4954 |
+
}
|
| 4955 |
+
}
|
| 4956 |
+
|
| 4957 |
+
|
| 4958 |
+
/**
|
| 4959 |
+
* A request to make a refund based on various criteria. A
|
| 4960 |
+
* refund can be made against the entire payKey, an individual
|
| 4961 |
+
* transaction belonging to a payKey, a tracking id, or a
|
| 4962 |
+
* specific receiver of a payKey.
|
| 4963 |
+
*/
|
| 4964 |
+
class RefundRequest
|
| 4965 |
+
{
|
| 4966 |
+
|
| 4967 |
+
/**
|
| 4968 |
+
*
|
| 4969 |
+
* @access public
|
| 4970 |
+
* @var RequestEnvelope
|
| 4971 |
+
*/
|
| 4972 |
+
public $requestEnvelope;
|
| 4973 |
+
|
| 4974 |
+
/**
|
| 4975 |
+
*
|
| 4976 |
+
* @access public
|
| 4977 |
+
* @var string
|
| 4978 |
+
*/
|
| 4979 |
+
public $currencyCode;
|
| 4980 |
+
|
| 4981 |
+
/**
|
| 4982 |
+
*
|
| 4983 |
+
* @access public
|
| 4984 |
+
* @var string
|
| 4985 |
+
*/
|
| 4986 |
+
public $payKey;
|
| 4987 |
+
|
| 4988 |
+
/**
|
| 4989 |
+
*
|
| 4990 |
+
* @access public
|
| 4991 |
+
* @var string
|
| 4992 |
+
*/
|
| 4993 |
+
public $transactionId;
|
| 4994 |
+
|
| 4995 |
+
/**
|
| 4996 |
+
*
|
| 4997 |
+
* @access public
|
| 4998 |
+
* @var string
|
| 4999 |
+
*/
|
| 5000 |
+
public $trackingId;
|
| 5001 |
+
|
| 5002 |
+
/**
|
| 5003 |
+
*
|
| 5004 |
+
* @access public
|
| 5005 |
+
* @var ReceiverList
|
| 5006 |
+
*/
|
| 5007 |
+
public $receiverList;
|
| 5008 |
+
|
| 5009 |
+
/**
|
| 5010 |
+
* Constructor with arguments
|
| 5011 |
+
*/
|
| 5012 |
+
public function __construct( $requestEnvelope = null )
|
| 5013 |
+
{
|
| 5014 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5015 |
+
}
|
| 5016 |
+
|
| 5017 |
+
|
| 5018 |
+
public function toNVPString( $prefix = '' )
|
| 5019 |
+
{
|
| 5020 |
+
$str = '';
|
| 5021 |
+
$delim = '';
|
| 5022 |
+
if ( $this->requestEnvelope != null ) {
|
| 5023 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5024 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5025 |
+
$delim = '&';
|
| 5026 |
+
}
|
| 5027 |
+
if ( $this->currencyCode != null ) {
|
| 5028 |
+
$str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
|
| 5029 |
+
$delim = '&';
|
| 5030 |
+
}
|
| 5031 |
+
if ( $this->payKey != null ) {
|
| 5032 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 5033 |
+
$delim = '&';
|
| 5034 |
+
}
|
| 5035 |
+
if ( $this->transactionId != null ) {
|
| 5036 |
+
$str .= $delim . $prefix . 'transactionId=' . urlencode( $this->transactionId );
|
| 5037 |
+
$delim = '&';
|
| 5038 |
+
}
|
| 5039 |
+
if ( $this->trackingId != null ) {
|
| 5040 |
+
$str .= $delim . $prefix . 'trackingId=' . urlencode( $this->trackingId );
|
| 5041 |
+
$delim = '&';
|
| 5042 |
+
}
|
| 5043 |
+
if ( $this->receiverList != null ) {
|
| 5044 |
+
$newPrefix = $prefix . 'receiverList.';
|
| 5045 |
+
$str .= $delim . call_user_func( array( $this->receiverList, 'toNVPString' ), $newPrefix );
|
| 5046 |
+
$delim = '&';
|
| 5047 |
+
}
|
| 5048 |
+
|
| 5049 |
+
return $str;
|
| 5050 |
+
}
|
| 5051 |
+
|
| 5052 |
+
}
|
| 5053 |
+
|
| 5054 |
+
|
| 5055 |
+
/**
|
| 5056 |
+
* The result of a Refund request.
|
| 5057 |
+
*/
|
| 5058 |
+
class RefundResponse
|
| 5059 |
+
{
|
| 5060 |
+
|
| 5061 |
+
/**
|
| 5062 |
+
*
|
| 5063 |
+
* @access public
|
| 5064 |
+
* @var ResponseEnvelope
|
| 5065 |
+
*/
|
| 5066 |
+
public $responseEnvelope;
|
| 5067 |
+
|
| 5068 |
+
/**
|
| 5069 |
+
*
|
| 5070 |
+
* @access public
|
| 5071 |
+
* @var string
|
| 5072 |
+
*/
|
| 5073 |
+
public $currencyCode;
|
| 5074 |
+
|
| 5075 |
+
/**
|
| 5076 |
+
*
|
| 5077 |
+
* @access public
|
| 5078 |
+
* @var RefundInfoList
|
| 5079 |
+
*/
|
| 5080 |
+
public $refundInfoList;
|
| 5081 |
+
|
| 5082 |
+
/**
|
| 5083 |
+
*
|
| 5084 |
+
* @array
|
| 5085 |
+
* @access public
|
| 5086 |
+
* @var ErrorData
|
| 5087 |
+
*/
|
| 5088 |
+
public $error;
|
| 5089 |
+
|
| 5090 |
+
|
| 5091 |
+
public function init( $map = null, $prefix = '' )
|
| 5092 |
+
{
|
| 5093 |
+
if ( $map != null ) {
|
| 5094 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5095 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5096 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5097 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5098 |
+
}
|
| 5099 |
+
$mapKeyName = $prefix . 'currencyCode';
|
| 5100 |
+
if ( $map != null && array_key_exists( $mapKeyName, $map ) ) {
|
| 5101 |
+
$this->currencyCode = $map[ $mapKeyName ];
|
| 5102 |
+
}
|
| 5103 |
+
if ( PPUtils::array_match_key( $map, $prefix . "refundInfoList." ) ) {
|
| 5104 |
+
$newPrefix = $prefix . "refundInfoList.";
|
| 5105 |
+
$this->refundInfoList = new RefundInfoList();
|
| 5106 |
+
$this->refundInfoList->init( $map, $newPrefix );
|
| 5107 |
+
}
|
| 5108 |
+
$i = 0;
|
| 5109 |
+
while ( true ) {
|
| 5110 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5111 |
+
$newPrefix = $prefix . "error($i).";
|
| 5112 |
+
$this->error[ $i ] = new ErrorData();
|
| 5113 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5114 |
+
} else {
|
| 5115 |
+
break;
|
| 5116 |
+
}
|
| 5117 |
+
$i++;
|
| 5118 |
+
}
|
| 5119 |
+
|
| 5120 |
+
}
|
| 5121 |
+
}
|
| 5122 |
+
}
|
| 5123 |
+
|
| 5124 |
+
|
| 5125 |
+
/**
|
| 5126 |
+
* The request to set the options of a payment request.
|
| 5127 |
+
*/
|
| 5128 |
+
class SetPaymentOptionsRequest
|
| 5129 |
+
{
|
| 5130 |
+
|
| 5131 |
+
/**
|
| 5132 |
+
*
|
| 5133 |
+
* @access public
|
| 5134 |
+
* @var RequestEnvelope
|
| 5135 |
+
*/
|
| 5136 |
+
public $requestEnvelope;
|
| 5137 |
+
|
| 5138 |
+
/**
|
| 5139 |
+
*
|
| 5140 |
+
* @access public
|
| 5141 |
+
* @var string
|
| 5142 |
+
*/
|
| 5143 |
+
public $payKey;
|
| 5144 |
+
|
| 5145 |
+
/**
|
| 5146 |
+
*
|
| 5147 |
+
* @access public
|
| 5148 |
+
* @var InitiatingEntity
|
| 5149 |
+
*/
|
| 5150 |
+
public $initiatingEntity;
|
| 5151 |
+
|
| 5152 |
+
/**
|
| 5153 |
+
*
|
| 5154 |
+
* @access public
|
| 5155 |
+
* @var DisplayOptions
|
| 5156 |
+
*/
|
| 5157 |
+
public $displayOptions;
|
| 5158 |
+
|
| 5159 |
+
/**
|
| 5160 |
+
*
|
| 5161 |
+
* @access public
|
| 5162 |
+
* @var string
|
| 5163 |
+
*/
|
| 5164 |
+
public $shippingAddressId;
|
| 5165 |
+
|
| 5166 |
+
/**
|
| 5167 |
+
*
|
| 5168 |
+
* @access public
|
| 5169 |
+
* @var SenderOptions
|
| 5170 |
+
*/
|
| 5171 |
+
public $senderOptions;
|
| 5172 |
+
|
| 5173 |
+
/**
|
| 5174 |
+
*
|
| 5175 |
+
* @array
|
| 5176 |
+
* @access public
|
| 5177 |
+
* @var ReceiverOptions
|
| 5178 |
+
*/
|
| 5179 |
+
public $receiverOptions;
|
| 5180 |
+
|
| 5181 |
+
/**
|
| 5182 |
+
* Constructor with arguments
|
| 5183 |
+
*/
|
| 5184 |
+
public function __construct( $requestEnvelope = null, $payKey = null )
|
| 5185 |
+
{
|
| 5186 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5187 |
+
$this->payKey = $payKey;
|
| 5188 |
+
}
|
| 5189 |
+
|
| 5190 |
+
|
| 5191 |
+
public function toNVPString( $prefix = '' )
|
| 5192 |
+
{
|
| 5193 |
+
$str = '';
|
| 5194 |
+
$delim = '';
|
| 5195 |
+
if ( $this->requestEnvelope != null ) {
|
| 5196 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5197 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5198 |
+
$delim = '&';
|
| 5199 |
+
}
|
| 5200 |
+
if ( $this->payKey != null ) {
|
| 5201 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 5202 |
+
$delim = '&';
|
| 5203 |
+
}
|
| 5204 |
+
if ( $this->initiatingEntity != null ) {
|
| 5205 |
+
$newPrefix = $prefix . 'initiatingEntity.';
|
| 5206 |
+
$str .= $delim . call_user_func( array( $this->initiatingEntity, 'toNVPString' ), $newPrefix );
|
| 5207 |
+
$delim = '&';
|
| 5208 |
+
}
|
| 5209 |
+
if ( $this->displayOptions != null ) {
|
| 5210 |
+
$newPrefix = $prefix . 'displayOptions.';
|
| 5211 |
+
$str .= $delim . call_user_func( array( $this->displayOptions, 'toNVPString' ), $newPrefix );
|
| 5212 |
+
$delim = '&';
|
| 5213 |
+
}
|
| 5214 |
+
if ( $this->shippingAddressId != null ) {
|
| 5215 |
+
$str .= $delim . $prefix . 'shippingAddressId=' . urlencode( $this->shippingAddressId );
|
| 5216 |
+
$delim = '&';
|
| 5217 |
+
}
|
| 5218 |
+
if ( $this->senderOptions != null ) {
|
| 5219 |
+
$newPrefix = $prefix . 'senderOptions.';
|
| 5220 |
+
$str .= $delim . call_user_func( array( $this->senderOptions, 'toNVPString' ), $newPrefix );
|
| 5221 |
+
$delim = '&';
|
| 5222 |
+
}
|
| 5223 |
+
for ( $i = 0; $i < count( $this->receiverOptions ); $i++ ) {
|
| 5224 |
+
$newPrefix = $prefix . "receiverOptions($i).";
|
| 5225 |
+
$str .= $delim . call_user_func( array( $this->receiverOptions[ $i ], 'toNVPString' ), $newPrefix );
|
| 5226 |
+
$delim = '&';
|
| 5227 |
+
}
|
| 5228 |
+
|
| 5229 |
+
return $str;
|
| 5230 |
+
}
|
| 5231 |
+
|
| 5232 |
+
}
|
| 5233 |
+
|
| 5234 |
+
|
| 5235 |
+
/**
|
| 5236 |
+
* The response message for the SetPaymentOption request
|
| 5237 |
+
*/
|
| 5238 |
+
class SetPaymentOptionsResponse
|
| 5239 |
+
{
|
| 5240 |
+
|
| 5241 |
+
/**
|
| 5242 |
+
*
|
| 5243 |
+
* @access public
|
| 5244 |
+
* @var ResponseEnvelope
|
| 5245 |
+
*/
|
| 5246 |
+
public $responseEnvelope;
|
| 5247 |
+
|
| 5248 |
+
/**
|
| 5249 |
+
*
|
| 5250 |
+
* @array
|
| 5251 |
+
* @access public
|
| 5252 |
+
* @var ErrorData
|
| 5253 |
+
*/
|
| 5254 |
+
public $error;
|
| 5255 |
+
|
| 5256 |
+
|
| 5257 |
+
public function init( $map = null, $prefix = '' )
|
| 5258 |
+
{
|
| 5259 |
+
if ( $map != null ) {
|
| 5260 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5261 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5262 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5263 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5264 |
+
}
|
| 5265 |
+
$i = 0;
|
| 5266 |
+
while ( true ) {
|
| 5267 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5268 |
+
$newPrefix = $prefix . "error($i).";
|
| 5269 |
+
$this->error[ $i ] = new ErrorData();
|
| 5270 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5271 |
+
} else {
|
| 5272 |
+
break;
|
| 5273 |
+
}
|
| 5274 |
+
$i++;
|
| 5275 |
+
}
|
| 5276 |
+
|
| 5277 |
+
}
|
| 5278 |
+
}
|
| 5279 |
+
}
|
| 5280 |
+
|
| 5281 |
+
|
| 5282 |
+
/**
|
| 5283 |
+
* The request to get the funding plans available for a
|
| 5284 |
+
* payment.
|
| 5285 |
+
*/
|
| 5286 |
+
class GetFundingPlansRequest
|
| 5287 |
+
{
|
| 5288 |
+
|
| 5289 |
+
/**
|
| 5290 |
+
*
|
| 5291 |
+
* @access public
|
| 5292 |
+
* @var RequestEnvelope
|
| 5293 |
+
*/
|
| 5294 |
+
public $requestEnvelope;
|
| 5295 |
+
|
| 5296 |
+
/**
|
| 5297 |
+
*
|
| 5298 |
+
* @access public
|
| 5299 |
+
* @var string
|
| 5300 |
+
*/
|
| 5301 |
+
public $payKey;
|
| 5302 |
+
|
| 5303 |
+
/**
|
| 5304 |
+
* Constructor with arguments
|
| 5305 |
+
*/
|
| 5306 |
+
public function __construct( $requestEnvelope = null, $payKey = null )
|
| 5307 |
+
{
|
| 5308 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5309 |
+
$this->payKey = $payKey;
|
| 5310 |
+
}
|
| 5311 |
+
|
| 5312 |
+
|
| 5313 |
+
public function toNVPString( $prefix = '' )
|
| 5314 |
+
{
|
| 5315 |
+
$str = '';
|
| 5316 |
+
$delim = '';
|
| 5317 |
+
if ( $this->requestEnvelope != null ) {
|
| 5318 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5319 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5320 |
+
$delim = '&';
|
| 5321 |
+
}
|
| 5322 |
+
if ( $this->payKey != null ) {
|
| 5323 |
+
$str .= $delim . $prefix . 'payKey=' . urlencode( $this->payKey );
|
| 5324 |
+
$delim = '&';
|
| 5325 |
+
}
|
| 5326 |
+
|
| 5327 |
+
return $str;
|
| 5328 |
+
}
|
| 5329 |
+
|
| 5330 |
+
}
|
| 5331 |
+
|
| 5332 |
+
|
| 5333 |
+
/**
|
| 5334 |
+
* The response to get the funding plans available for a
|
| 5335 |
+
* payment.
|
| 5336 |
+
*/
|
| 5337 |
+
class GetFundingPlansResponse
|
| 5338 |
+
{
|
| 5339 |
+
|
| 5340 |
+
/**
|
| 5341 |
+
*
|
| 5342 |
+
* @access public
|
| 5343 |
+
* @var ResponseEnvelope
|
| 5344 |
+
*/
|
| 5345 |
+
public $responseEnvelope;
|
| 5346 |
+
|
| 5347 |
+
/**
|
| 5348 |
+
*
|
| 5349 |
+
* @array
|
| 5350 |
+
* @access public
|
| 5351 |
+
* @var FundingPlan
|
| 5352 |
+
*/
|
| 5353 |
+
public $fundingPlan;
|
| 5354 |
+
|
| 5355 |
+
/**
|
| 5356 |
+
*
|
| 5357 |
+
* @array
|
| 5358 |
+
* @access public
|
| 5359 |
+
* @var ErrorData
|
| 5360 |
+
*/
|
| 5361 |
+
public $error;
|
| 5362 |
+
|
| 5363 |
+
|
| 5364 |
+
public function init( $map = null, $prefix = '' )
|
| 5365 |
+
{
|
| 5366 |
+
if ( $map != null ) {
|
| 5367 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5368 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5369 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5370 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5371 |
+
}
|
| 5372 |
+
$i = 0;
|
| 5373 |
+
while ( true ) {
|
| 5374 |
+
if ( PPUtils::array_match_key( $map, $prefix . "fundingPlan($i)" ) ) {
|
| 5375 |
+
$newPrefix = $prefix . "fundingPlan($i).";
|
| 5376 |
+
$this->fundingPlan[ $i ] = new FundingPlan();
|
| 5377 |
+
$this->fundingPlan[ $i ]->init( $map, $newPrefix );
|
| 5378 |
+
} else {
|
| 5379 |
+
break;
|
| 5380 |
+
}
|
| 5381 |
+
$i++;
|
| 5382 |
+
}
|
| 5383 |
+
$i = 0;
|
| 5384 |
+
while ( true ) {
|
| 5385 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5386 |
+
$newPrefix = $prefix . "error($i).";
|
| 5387 |
+
$this->error[ $i ] = new ErrorData();
|
| 5388 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5389 |
+
} else {
|
| 5390 |
+
break;
|
| 5391 |
+
}
|
| 5392 |
+
$i++;
|
| 5393 |
+
}
|
| 5394 |
+
|
| 5395 |
+
}
|
| 5396 |
+
}
|
| 5397 |
+
}
|
| 5398 |
+
|
| 5399 |
+
|
| 5400 |
+
/**
|
| 5401 |
+
* The request to get the addresses available for a payment.
|
| 5402 |
+
*/
|
| 5403 |
+
class GetAvailableShippingAddressesRequest
|
| 5404 |
+
{
|
| 5405 |
+
|
| 5406 |
+
/**
|
| 5407 |
+
*
|
| 5408 |
+
* @access public
|
| 5409 |
+
* @var RequestEnvelope
|
| 5410 |
+
*/
|
| 5411 |
+
public $requestEnvelope;
|
| 5412 |
+
|
| 5413 |
+
/**
|
| 5414 |
+
* The key for which to provide the available addresses. Key
|
| 5415 |
+
* can be an AdaptivePayments key such as payKey or
|
| 5416 |
+
* preapprovalKey
|
| 5417 |
+
* @access public
|
| 5418 |
+
* @var string
|
| 5419 |
+
*/
|
| 5420 |
+
public $key;
|
| 5421 |
+
|
| 5422 |
+
/**
|
| 5423 |
+
* Constructor with arguments
|
| 5424 |
+
*/
|
| 5425 |
+
public function __construct( $requestEnvelope = null, $key = null )
|
| 5426 |
+
{
|
| 5427 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5428 |
+
$this->key = $key;
|
| 5429 |
+
}
|
| 5430 |
+
|
| 5431 |
+
|
| 5432 |
+
public function toNVPString( $prefix = '' )
|
| 5433 |
+
{
|
| 5434 |
+
$str = '';
|
| 5435 |
+
$delim = '';
|
| 5436 |
+
if ( $this->requestEnvelope != null ) {
|
| 5437 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5438 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5439 |
+
$delim = '&';
|
| 5440 |
+
}
|
| 5441 |
+
if ( $this->key != null ) {
|
| 5442 |
+
$str .= $delim . $prefix . 'key=' . urlencode( $this->key );
|
| 5443 |
+
$delim = '&';
|
| 5444 |
+
}
|
| 5445 |
+
|
| 5446 |
+
return $str;
|
| 5447 |
+
}
|
| 5448 |
+
|
| 5449 |
+
}
|
| 5450 |
+
|
| 5451 |
+
|
| 5452 |
+
/**
|
| 5453 |
+
* The response to get the shipping addresses available for a
|
| 5454 |
+
* payment.
|
| 5455 |
+
*/
|
| 5456 |
+
class GetAvailableShippingAddressesResponse
|
| 5457 |
+
{
|
| 5458 |
+
|
| 5459 |
+
/**
|
| 5460 |
+
*
|
| 5461 |
+
* @access public
|
| 5462 |
+
* @var ResponseEnvelope
|
| 5463 |
+
*/
|
| 5464 |
+
public $responseEnvelope;
|
| 5465 |
+
|
| 5466 |
+
/**
|
| 5467 |
+
*
|
| 5468 |
+
* @array
|
| 5469 |
+
* @access public
|
| 5470 |
+
* @var Address
|
| 5471 |
+
*/
|
| 5472 |
+
public $availableAddress;
|
| 5473 |
+
|
| 5474 |
+
/**
|
| 5475 |
+
*
|
| 5476 |
+
* @array
|
| 5477 |
+
* @access public
|
| 5478 |
+
* @var ErrorData
|
| 5479 |
+
*/
|
| 5480 |
+
public $error;
|
| 5481 |
+
|
| 5482 |
+
|
| 5483 |
+
public function init( $map = null, $prefix = '' )
|
| 5484 |
+
{
|
| 5485 |
+
if ( $map != null ) {
|
| 5486 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5487 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5488 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5489 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5490 |
+
}
|
| 5491 |
+
$i = 0;
|
| 5492 |
+
while ( true ) {
|
| 5493 |
+
if ( PPUtils::array_match_key( $map, $prefix . "availableAddress($i)" ) ) {
|
| 5494 |
+
$newPrefix = $prefix . "availableAddress($i).";
|
| 5495 |
+
$this->availableAddress[ $i ] = new Address();
|
| 5496 |
+
$this->availableAddress[ $i ]->init( $map, $newPrefix );
|
| 5497 |
+
} else {
|
| 5498 |
+
break;
|
| 5499 |
+
}
|
| 5500 |
+
$i++;
|
| 5501 |
+
}
|
| 5502 |
+
$i = 0;
|
| 5503 |
+
while ( true ) {
|
| 5504 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5505 |
+
$newPrefix = $prefix . "error($i).";
|
| 5506 |
+
$this->error[ $i ] = new ErrorData();
|
| 5507 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5508 |
+
} else {
|
| 5509 |
+
break;
|
| 5510 |
+
}
|
| 5511 |
+
$i++;
|
| 5512 |
+
}
|
| 5513 |
+
|
| 5514 |
+
}
|
| 5515 |
+
}
|
| 5516 |
+
}
|
| 5517 |
+
|
| 5518 |
+
|
| 5519 |
+
/**
|
| 5520 |
+
* The request to get the addresses available for a payment.
|
| 5521 |
+
*/
|
| 5522 |
+
class GetShippingAddressesRequest
|
| 5523 |
+
{
|
| 5524 |
+
|
| 5525 |
+
/**
|
| 5526 |
+
*
|
| 5527 |
+
* @access public
|
| 5528 |
+
* @var RequestEnvelope
|
| 5529 |
+
*/
|
| 5530 |
+
public $requestEnvelope;
|
| 5531 |
+
|
| 5532 |
+
/**
|
| 5533 |
+
* The key for which to provide the available addresses. Key
|
| 5534 |
+
* can be an AdaptivePayments key such as payKey or
|
| 5535 |
+
* preapprovalKey
|
| 5536 |
+
* @access public
|
| 5537 |
+
* @var string
|
| 5538 |
+
*/
|
| 5539 |
+
public $key;
|
| 5540 |
+
|
| 5541 |
+
/**
|
| 5542 |
+
* Constructor with arguments
|
| 5543 |
+
*/
|
| 5544 |
+
public function __construct( $requestEnvelope = null, $key = null )
|
| 5545 |
+
{
|
| 5546 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5547 |
+
$this->key = $key;
|
| 5548 |
+
}
|
| 5549 |
+
|
| 5550 |
+
|
| 5551 |
+
public function toNVPString( $prefix = '' )
|
| 5552 |
+
{
|
| 5553 |
+
$str = '';
|
| 5554 |
+
$delim = '';
|
| 5555 |
+
if ( $this->requestEnvelope != null ) {
|
| 5556 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5557 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5558 |
+
$delim = '&';
|
| 5559 |
+
}
|
| 5560 |
+
if ( $this->key != null ) {
|
| 5561 |
+
$str .= $delim . $prefix . 'key=' . urlencode( $this->key );
|
| 5562 |
+
$delim = '&';
|
| 5563 |
+
}
|
| 5564 |
+
|
| 5565 |
+
return $str;
|
| 5566 |
+
}
|
| 5567 |
+
|
| 5568 |
+
}
|
| 5569 |
+
|
| 5570 |
+
|
| 5571 |
+
/**
|
| 5572 |
+
* The response to get the shipping addresses available for a
|
| 5573 |
+
* payment.
|
| 5574 |
+
*/
|
| 5575 |
+
class GetShippingAddressesResponse
|
| 5576 |
+
{
|
| 5577 |
+
|
| 5578 |
+
/**
|
| 5579 |
+
*
|
| 5580 |
+
* @access public
|
| 5581 |
+
* @var ResponseEnvelope
|
| 5582 |
+
*/
|
| 5583 |
+
public $responseEnvelope;
|
| 5584 |
+
|
| 5585 |
+
/**
|
| 5586 |
+
*
|
| 5587 |
+
* @access public
|
| 5588 |
+
* @var Address
|
| 5589 |
+
*/
|
| 5590 |
+
public $selectedAddress;
|
| 5591 |
+
|
| 5592 |
+
/**
|
| 5593 |
+
*
|
| 5594 |
+
* @array
|
| 5595 |
+
* @access public
|
| 5596 |
+
* @var ErrorData
|
| 5597 |
+
*/
|
| 5598 |
+
public $error;
|
| 5599 |
+
|
| 5600 |
+
|
| 5601 |
+
public function init( $map = null, $prefix = '' )
|
| 5602 |
+
{
|
| 5603 |
+
if ( $map != null ) {
|
| 5604 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5605 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5606 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5607 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5608 |
+
}
|
| 5609 |
+
if ( PPUtils::array_match_key( $map, $prefix . "selectedAddress." ) ) {
|
| 5610 |
+
$newPrefix = $prefix . "selectedAddress.";
|
| 5611 |
+
$this->selectedAddress = new Address();
|
| 5612 |
+
$this->selectedAddress->init( $map, $newPrefix );
|
| 5613 |
+
}
|
| 5614 |
+
$i = 0;
|
| 5615 |
+
while ( true ) {
|
| 5616 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5617 |
+
$newPrefix = $prefix . "error($i).";
|
| 5618 |
+
$this->error[ $i ] = new ErrorData();
|
| 5619 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5620 |
+
} else {
|
| 5621 |
+
break;
|
| 5622 |
+
}
|
| 5623 |
+
$i++;
|
| 5624 |
+
}
|
| 5625 |
+
|
| 5626 |
+
}
|
| 5627 |
+
}
|
| 5628 |
+
}
|
| 5629 |
+
|
| 5630 |
+
|
| 5631 |
+
/**
|
| 5632 |
+
* The request to get the remaining limits for a user
|
| 5633 |
+
*/
|
| 5634 |
+
class GetUserLimitsRequest
|
| 5635 |
+
{
|
| 5636 |
+
|
| 5637 |
+
/**
|
| 5638 |
+
*
|
| 5639 |
+
* @access public
|
| 5640 |
+
* @var RequestEnvelope
|
| 5641 |
+
*/
|
| 5642 |
+
public $requestEnvelope;
|
| 5643 |
+
|
| 5644 |
+
/**
|
| 5645 |
+
* The account identifier for the user
|
| 5646 |
+
* @access public
|
| 5647 |
+
* @var AccountIdentifier
|
| 5648 |
+
*/
|
| 5649 |
+
public $user;
|
| 5650 |
+
|
| 5651 |
+
/**
|
| 5652 |
+
*
|
| 5653 |
+
* @access public
|
| 5654 |
+
* @var string
|
| 5655 |
+
*/
|
| 5656 |
+
public $country;
|
| 5657 |
+
|
| 5658 |
+
/**
|
| 5659 |
+
*
|
| 5660 |
+
* @access public
|
| 5661 |
+
* @var string
|
| 5662 |
+
*/
|
| 5663 |
+
public $currencyCode;
|
| 5664 |
+
|
| 5665 |
+
/**
|
| 5666 |
+
* List of limit types
|
| 5667 |
+
* @array
|
| 5668 |
+
* @access public
|
| 5669 |
+
* @var string
|
| 5670 |
+
*/
|
| 5671 |
+
public $limitType;
|
| 5672 |
+
|
| 5673 |
+
/**
|
| 5674 |
+
* Constructor with arguments
|
| 5675 |
+
*/
|
| 5676 |
+
public function __construct( $requestEnvelope = null, $user = null, $country = null, $currencyCode = null, $limitType = null )
|
| 5677 |
+
{
|
| 5678 |
+
$this->requestEnvelope = $requestEnvelope;
|
| 5679 |
+
$this->user = $user;
|
| 5680 |
+
$this->country = $country;
|
| 5681 |
+
$this->currencyCode = $currencyCode;
|
| 5682 |
+
$this->limitType = $limitType;
|
| 5683 |
+
}
|
| 5684 |
+
|
| 5685 |
+
|
| 5686 |
+
public function toNVPString( $prefix = '' )
|
| 5687 |
+
{
|
| 5688 |
+
$str = '';
|
| 5689 |
+
$delim = '';
|
| 5690 |
+
if ( $this->requestEnvelope != null ) {
|
| 5691 |
+
$newPrefix = $prefix . 'requestEnvelope.';
|
| 5692 |
+
$str .= $delim . call_user_func( array( $this->requestEnvelope, 'toNVPString' ), $newPrefix );
|
| 5693 |
+
$delim = '&';
|
| 5694 |
+
}
|
| 5695 |
+
if ( $this->user != null ) {
|
| 5696 |
+
$newPrefix = $prefix . 'user.';
|
| 5697 |
+
$str .= $delim . call_user_func( array( $this->user, 'toNVPString' ), $newPrefix );
|
| 5698 |
+
$delim = '&';
|
| 5699 |
+
}
|
| 5700 |
+
if ( $this->country != null ) {
|
| 5701 |
+
$str .= $delim . $prefix . 'country=' . urlencode( $this->country );
|
| 5702 |
+
$delim = '&';
|
| 5703 |
+
}
|
| 5704 |
+
if ( $this->currencyCode != null ) {
|
| 5705 |
+
$str .= $delim . $prefix . 'currencyCode=' . urlencode( $this->currencyCode );
|
| 5706 |
+
$delim = '&';
|
| 5707 |
+
}
|
| 5708 |
+
for ( $i = 0; $i < count( $this->limitType ); $i++ ) {
|
| 5709 |
+
$str .= $delim . $prefix . "limitType($i)=" . urlencode( $this->limitType[ $i ] );
|
| 5710 |
+
$delim = '&';
|
| 5711 |
+
}
|
| 5712 |
+
|
| 5713 |
+
return $str;
|
| 5714 |
+
}
|
| 5715 |
+
|
| 5716 |
+
}
|
| 5717 |
+
|
| 5718 |
+
|
| 5719 |
+
/**
|
| 5720 |
+
* A response that contains a list of remaining limits
|
| 5721 |
+
*/
|
| 5722 |
+
class GetUserLimitsResponse
|
| 5723 |
+
{
|
| 5724 |
+
|
| 5725 |
+
/**
|
| 5726 |
+
*
|
| 5727 |
+
* @access public
|
| 5728 |
+
* @var ResponseEnvelope
|
| 5729 |
+
*/
|
| 5730 |
+
public $responseEnvelope;
|
| 5731 |
+
|
| 5732 |
+
/**
|
| 5733 |
+
*
|
| 5734 |
+
* @array
|
| 5735 |
+
* @access public
|
| 5736 |
+
* @var UserLimit
|
| 5737 |
+
*/
|
| 5738 |
+
public $userLimit;
|
| 5739 |
+
|
| 5740 |
+
/**
|
| 5741 |
+
*
|
| 5742 |
+
* @access public
|
| 5743 |
+
* @var WarningDataList
|
| 5744 |
+
*/
|
| 5745 |
+
public $warningDataList;
|
| 5746 |
+
|
| 5747 |
+
/**
|
| 5748 |
+
*
|
| 5749 |
+
* @array
|
| 5750 |
+
* @access public
|
| 5751 |
+
* @var ErrorData
|
| 5752 |
+
*/
|
| 5753 |
+
public $error;
|
| 5754 |
+
|
| 5755 |
+
|
| 5756 |
+
public function init( $map = null, $prefix = '' )
|
| 5757 |
+
{
|
| 5758 |
+
if ( $map != null ) {
|
| 5759 |
+
if ( PPUtils::array_match_key( $map, $prefix . "responseEnvelope." ) ) {
|
| 5760 |
+
$newPrefix = $prefix . "responseEnvelope.";
|
| 5761 |
+
$this->responseEnvelope = new ResponseEnvelope();
|
| 5762 |
+
$this->responseEnvelope->init( $map, $newPrefix );
|
| 5763 |
+
}
|
| 5764 |
+
$i = 0;
|
| 5765 |
+
while ( true ) {
|
| 5766 |
+
if ( PPUtils::array_match_key( $map, $prefix . "userLimit($i)" ) ) {
|
| 5767 |
+
$newPrefix = $prefix . "userLimit($i).";
|
| 5768 |
+
$this->userLimit[ $i ] = new UserLimit();
|
| 5769 |
+
$this->userLimit[ $i ]->init( $map, $newPrefix );
|
| 5770 |
+
} else {
|
| 5771 |
+
break;
|
| 5772 |
+
}
|
| 5773 |
+
$i++;
|
| 5774 |
+
}
|
| 5775 |
+
if ( PPUtils::array_match_key( $map, $prefix . "warningDataList." ) ) {
|
| 5776 |
+
$newPrefix = $prefix . "warningDataList.";
|
| 5777 |
+
$this->warningDataList = new WarningDataList();
|
| 5778 |
+
$this->warningDataList->init( $map, $newPrefix );
|
| 5779 |
+
}
|
| 5780 |
+
$i = 0;
|
| 5781 |
+
while ( true ) {
|
| 5782 |
+
if ( PPUtils::array_match_key( $map, $prefix . "error($i)" ) ) {
|
| 5783 |
+
$newPrefix = $prefix . "error($i).";
|
| 5784 |
+
$this->error[ $i ] = new ErrorData();
|
| 5785 |
+
$this->error[ $i ]->init( $map, $newPrefix );
|
| 5786 |
+
} else {
|
| 5787 |
+
break;
|
| 5788 |
+
}
|
| 5789 |
+
$i++;
|
| 5790 |
+
}
|
| 5791 |
+
|
| 5792 |
+
}
|
| 5793 |
+
}
|
| 5794 |
+
}
|
| 5795 |
+
|
| 5796 |
+
|
| 5797 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/adaptivepayments-sdk/lib/services/AdaptivePayments/AdaptivePaymentsService.php
ADDED
|
@@ -0,0 +1,314 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once( 'PPBaseService.php' );
|
| 3 |
+
require_once( 'AdaptivePayments.php' );
|
| 4 |
+
require_once( 'PPUtils.php' );
|
| 5 |
+
|
| 6 |
+
|
| 7 |
+
/**
|
| 8 |
+
* AUTO GENERATED code for AdaptivePayments
|
| 9 |
+
*/
|
| 10 |
+
class AdaptivePaymentsService extends PPBaseService
|
| 11 |
+
{
|
| 12 |
+
|
| 13 |
+
// Service Version
|
| 14 |
+
private static $SERVICE_VERSION = "1.8.1";
|
| 15 |
+
|
| 16 |
+
// Service Name
|
| 17 |
+
private static $SERVICE_NAME = "AdaptivePayments";
|
| 18 |
+
|
| 19 |
+
public function __construct()
|
| 20 |
+
{
|
| 21 |
+
parent::__construct( 'AdaptivePayments' );
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
|
| 25 |
+
/**
|
| 26 |
+
* Service Call: CancelPreapproval
|
| 27 |
+
*
|
| 28 |
+
* @param CancelPreapprovalRequest $cancelPreapprovalRequest
|
| 29 |
+
*
|
| 30 |
+
* @return CancelPreapprovalResponse
|
| 31 |
+
* @throws APIException
|
| 32 |
+
*/
|
| 33 |
+
public function CancelPreapproval( $cancelPreapprovalRequest, $apiUsername = null )
|
| 34 |
+
{
|
| 35 |
+
$ret = new CancelPreapprovalResponse();
|
| 36 |
+
$resp = $this->call( "CancelPreapproval", $cancelPreapprovalRequest, $apiUsername );
|
| 37 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 38 |
+
|
| 39 |
+
return $ret;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
|
| 43 |
+
/**
|
| 44 |
+
* Service Call: ConfirmPreapproval
|
| 45 |
+
*
|
| 46 |
+
* @param ConfirmPreapprovalRequest $confirmPreapprovalRequest
|
| 47 |
+
*
|
| 48 |
+
* @return ConfirmPreapprovalResponse
|
| 49 |
+
* @throws APIException
|
| 50 |
+
*/
|
| 51 |
+
public function ConfirmPreapproval( $confirmPreapprovalRequest, $apiUsername = null )
|
| 52 |
+
{
|
| 53 |
+
$ret = new ConfirmPreapprovalResponse();
|
| 54 |
+
$resp = $this->call( "ConfirmPreapproval", $confirmPreapprovalRequest, $apiUsername );
|
| 55 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 56 |
+
|
| 57 |
+
return $ret;
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
|
| 61 |
+
/**
|
| 62 |
+
* Service Call: ConvertCurrency
|
| 63 |
+
*
|
| 64 |
+
* @param ConvertCurrencyRequest $convertCurrencyRequest
|
| 65 |
+
*
|
| 66 |
+
* @return ConvertCurrencyResponse
|
| 67 |
+
* @throws APIException
|
| 68 |
+
*/
|
| 69 |
+
public function ConvertCurrency( $convertCurrencyRequest, $apiUsername = null )
|
| 70 |
+
{
|
| 71 |
+
$ret = new ConvertCurrencyResponse();
|
| 72 |
+
$resp = $this->call( "ConvertCurrency", $convertCurrencyRequest, $apiUsername );
|
| 73 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 74 |
+
|
| 75 |
+
return $ret;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
|
| 79 |
+
/**
|
| 80 |
+
* Service Call: ExecutePayment
|
| 81 |
+
*
|
| 82 |
+
* @param ExecutePaymentRequest $executePaymentRequest
|
| 83 |
+
*
|
| 84 |
+
* @return ExecutePaymentResponse
|
| 85 |
+
* @throws APIException
|
| 86 |
+
*/
|
| 87 |
+
public function ExecutePayment( $executePaymentRequest, $apiUsername = null )
|
| 88 |
+
{
|
| 89 |
+
$ret = new ExecutePaymentResponse();
|
| 90 |
+
$resp = $this->call( "ExecutePayment", $executePaymentRequest, $apiUsername );
|
| 91 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 92 |
+
|
| 93 |
+
return $ret;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
* Service Call: GetAllowedFundingSources
|
| 99 |
+
*
|
| 100 |
+
* @param GetAllowedFundingSourcesRequest $getAllowedFundingSourcesRequest
|
| 101 |
+
*
|
| 102 |
+
* @return GetAllowedFundingSourcesResponse
|
| 103 |
+
* @throws APIException
|
| 104 |
+
*/
|
| 105 |
+
public function GetAllowedFundingSources( $getAllowedFundingSourcesRequest, $apiUsername = null )
|
| 106 |
+
{
|
| 107 |
+
$ret = new GetAllowedFundingSourcesResponse();
|
| 108 |
+
$resp = $this->call( "GetAllowedFundingSources", $getAllowedFundingSourcesRequest, $apiUsername );
|
| 109 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 110 |
+
|
| 111 |
+
return $ret;
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
|
| 115 |
+
/**
|
| 116 |
+
* Service Call: GetPaymentOptions
|
| 117 |
+
*
|
| 118 |
+
* @param GetPaymentOptionsRequest $getPaymentOptionsRequest
|
| 119 |
+
*
|
| 120 |
+
* @return GetPaymentOptionsResponse
|
| 121 |
+
* @throws APIException
|
| 122 |
+
*/
|
| 123 |
+
public function GetPaymentOptions( $getPaymentOptionsRequest, $apiUsername = null )
|
| 124 |
+
{
|
| 125 |
+
$ret = new GetPaymentOptionsResponse();
|
| 126 |
+
$resp = $this->call( "GetPaymentOptions", $getPaymentOptionsRequest, $apiUsername );
|
| 127 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 128 |
+
|
| 129 |
+
return $ret;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
/**
|
| 134 |
+
* Service Call: PaymentDetails
|
| 135 |
+
*
|
| 136 |
+
* @param PaymentDetailsRequest $paymentDetailsRequest
|
| 137 |
+
*
|
| 138 |
+
* @return PaymentDetailsResponse
|
| 139 |
+
* @throws APIException
|
| 140 |
+
*/
|
| 141 |
+
public function PaymentDetails( $paymentDetailsRequest, $apiUsername = null )
|
| 142 |
+
{
|
| 143 |
+
$ret = new PaymentDetailsResponse();
|
| 144 |
+
$resp = $this->call( "PaymentDetails", $paymentDetailsRequest, $apiUsername );
|
| 145 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 146 |
+
|
| 147 |
+
return $ret;
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
/**
|
| 152 |
+
* Service Call: Pay
|
| 153 |
+
*
|
| 154 |
+
* @param PayRequest $payRequest
|
| 155 |
+
*
|
| 156 |
+
* @return PayResponse
|
| 157 |
+
* @throws APIException
|
| 158 |
+
*/
|
| 159 |
+
public function Pay( $payRequest, $apiUsername = null )
|
| 160 |
+
{
|
| 161 |
+
$ret = new PayResponse();
|
| 162 |
+
$resp = $this->call( "Pay", $payRequest, $apiUsername );
|
| 163 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 164 |
+
|
| 165 |
+
return $ret;
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
|
| 169 |
+
/**
|
| 170 |
+
* Service Call: PreapprovalDetails
|
| 171 |
+
*
|
| 172 |
+
* @param PreapprovalDetailsRequest $preapprovalDetailsRequest
|
| 173 |
+
*
|
| 174 |
+
* @return PreapprovalDetailsResponse
|
| 175 |
+
* @throws APIException
|
| 176 |
+
*/
|
| 177 |
+
public function PreapprovalDetails( $preapprovalDetailsRequest, $apiUsername = null )
|
| 178 |
+
{
|
| 179 |
+
$ret = new PreapprovalDetailsResponse();
|
| 180 |
+
$resp = $this->call( "PreapprovalDetails", $preapprovalDetailsRequest, $apiUsername );
|
| 181 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 182 |
+
|
| 183 |
+
return $ret;
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
|
| 187 |
+
/**
|
| 188 |
+
* Service Call: Preapproval
|
| 189 |
+
*
|
| 190 |
+
* @param PreapprovalRequest $preapprovalRequest
|
| 191 |
+
*
|
| 192 |
+
* @return PreapprovalResponse
|
| 193 |
+
* @throws APIException
|
| 194 |
+
*/
|
| 195 |
+
public function Preapproval( $preapprovalRequest, $apiUsername = null )
|
| 196 |
+
{
|
| 197 |
+
$ret = new PreapprovalResponse();
|
| 198 |
+
$resp = $this->call( "Preapproval", $preapprovalRequest, $apiUsername );
|
| 199 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 200 |
+
|
| 201 |
+
return $ret;
|
| 202 |
+
}
|
| 203 |
+
|
| 204 |
+
|
| 205 |
+
/**
|
| 206 |
+
* Service Call: Refund
|
| 207 |
+
*
|
| 208 |
+
* @param RefundRequest $refundRequest
|
| 209 |
+
*
|
| 210 |
+
* @return RefundResponse
|
| 211 |
+
* @throws APIException
|
| 212 |
+
*/
|
| 213 |
+
public function Refund( $refundRequest, $apiUsername = null )
|
| 214 |
+
{
|
| 215 |
+
$ret = new RefundResponse();
|
| 216 |
+
$resp = $this->call( "Refund", $refundRequest, $apiUsername );
|
| 217 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 218 |
+
|
| 219 |
+
return $ret;
|
| 220 |
+
}
|
| 221 |
+
|
| 222 |
+
|
| 223 |
+
/**
|
| 224 |
+
* Service Call: SetPaymentOptions
|
| 225 |
+
*
|
| 226 |
+
* @param SetPaymentOptionsRequest $setPaymentOptionsRequest
|
| 227 |
+
*
|
| 228 |
+
* @return SetPaymentOptionsResponse
|
| 229 |
+
* @throws APIException
|
| 230 |
+
*/
|
| 231 |
+
public function SetPaymentOptions( $setPaymentOptionsRequest, $apiUsername = null )
|
| 232 |
+
{
|
| 233 |
+
$ret = new SetPaymentOptionsResponse();
|
| 234 |
+
$resp = $this->call( "SetPaymentOptions", $setPaymentOptionsRequest, $apiUsername );
|
| 235 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 236 |
+
|
| 237 |
+
return $ret;
|
| 238 |
+
}
|
| 239 |
+
|
| 240 |
+
|
| 241 |
+
/**
|
| 242 |
+
* Service Call: GetFundingPlans
|
| 243 |
+
*
|
| 244 |
+
* @param GetFundingPlansRequest $getFundingPlansRequest
|
| 245 |
+
*
|
| 246 |
+
* @return GetFundingPlansResponse
|
| 247 |
+
* @throws APIException
|
| 248 |
+
*/
|
| 249 |
+
public function GetFundingPlans( $getFundingPlansRequest, $apiUsername = null )
|
| 250 |
+
{
|
| 251 |
+
$ret = new GetFundingPlansResponse();
|
| 252 |
+
$resp = $this->call( "GetFundingPlans", $getFundingPlansRequest, $apiUsername );
|
| 253 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 254 |
+
|
| 255 |
+
return $ret;
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
/**
|
| 260 |
+
* Service Call: GetAvailableShippingAddresses
|
| 261 |
+
*
|
| 262 |
+
* @param GetAvailableShippingAddressesRequest $getAvailableShippingAddressesRequest
|
| 263 |
+
*
|
| 264 |
+
* @return GetAvailableShippingAddressesResponse
|
| 265 |
+
* @throws APIException
|
| 266 |
+
*/
|
| 267 |
+
public function GetAvailableShippingAddresses( $getAvailableShippingAddressesRequest, $apiUsername = null )
|
| 268 |
+
{
|
| 269 |
+
$ret = new GetAvailableShippingAddressesResponse();
|
| 270 |
+
$resp = $this->call( "GetAvailableShippingAddresses", $getAvailableShippingAddressesRequest, $apiUsername );
|
| 271 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 272 |
+
|
| 273 |
+
return $ret;
|
| 274 |
+
}
|
| 275 |
+
|
| 276 |
+
|
| 277 |
+
/**
|
| 278 |
+
* Service Call: GetShippingAddresses
|
| 279 |
+
*
|
| 280 |
+
* @param GetShippingAddressesRequest $getShippingAddressesRequest
|
| 281 |
+
*
|
| 282 |
+
* @return GetShippingAddressesResponse
|
| 283 |
+
* @throws APIException
|
| 284 |
+
*/
|
| 285 |
+
public function GetShippingAddresses( $getShippingAddressesRequest, $apiUsername = null )
|
| 286 |
+
{
|
| 287 |
+
$ret = new GetShippingAddressesResponse();
|
| 288 |
+
$resp = $this->call( "GetShippingAddresses", $getShippingAddressesRequest, $apiUsername );
|
| 289 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 290 |
+
|
| 291 |
+
return $ret;
|
| 292 |
+
}
|
| 293 |
+
|
| 294 |
+
|
| 295 |
+
/**
|
| 296 |
+
* Service Call: GetUserLimits
|
| 297 |
+
*
|
| 298 |
+
* @param GetUserLimitsRequest $getUserLimitsRequest
|
| 299 |
+
*
|
| 300 |
+
* @return GetUserLimitsResponse
|
| 301 |
+
* @throws APIException
|
| 302 |
+
*/
|
| 303 |
+
public function GetUserLimits( $getUserLimitsRequest, $apiUsername = null )
|
| 304 |
+
{
|
| 305 |
+
$ret = new GetUserLimitsResponse();
|
| 306 |
+
$resp = $this->call( "GetUserLimits", $getUserLimitsRequest, $apiUsername );
|
| 307 |
+
$ret->init( PPUtils::nvpToMap( $resp ) );
|
| 308 |
+
|
| 309 |
+
return $ret;
|
| 310 |
+
}
|
| 311 |
+
|
| 312 |
+
}
|
| 313 |
+
|
| 314 |
+
?>
|
trunk/classes/gateways/PayPal_AdvPayments/PayPal_AP/classes/index.php
ADDED
|
File without changes
|
trunk/classes/gateways/PayPal_AdvPayments/paypal_ap.php
ADDED
|
@@ -0,0 +1,562 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( !class_exists( 'WC_Payment_Gateway' ) ) return false;
|
| 4 |
+
|
| 5 |
+
/**
|
| 6 |
+
* Add the gateway to WooCommerce
|
| 7 |
+
*
|
| 8 |
+
* @access public
|
| 9 |
+
*
|
| 10 |
+
* @param array $methods
|
| 11 |
+
*
|
| 12 |
+
* @return array
|
| 13 |
+
*/
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
function add_paypal_ap_gateway( $methods )
|
| 17 |
+
{
|
| 18 |
+
$methods[ ] = 'WC_PaypalAP';
|
| 19 |
+
|
| 20 |
+
return $methods;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
add_filter( 'woocommerce_payment_gateways', 'add_paypal_ap_gateway' );
|
| 25 |
+
|
| 26 |
+
class WC_PaypalAP extends WC_Payment_Gateway
|
| 27 |
+
{
|
| 28 |
+
|
| 29 |
+
public static $pluginDir;
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
*
|
| 33 |
+
*/
|
| 34 |
+
public function __construct()
|
| 35 |
+
{
|
| 36 |
+
global $woocommerce;
|
| 37 |
+
|
| 38 |
+
self::$pluginDir = trailingslashit( dirname( __FILE__ ) ) . 'PayPal_AP/';
|
| 39 |
+
|
| 40 |
+
/* Standard WooCommerce Configuration */
|
| 41 |
+
$this->id = 'paypalap';
|
| 42 |
+
$this->icon = plugin_dir_url( __FILE__ ) . 'PayPal_AP/assets/icons/paypalap.png';
|
| 43 |
+
$this->method_title = __( 'PayPal Adaptive Payments', 'wcvendors' );
|
| 44 |
+
$this->has_fields = false;
|
| 45 |
+
|
| 46 |
+
// Load the settings
|
| 47 |
+
$this->init_form_fields();
|
| 48 |
+
$this->init_settings();
|
| 49 |
+
|
| 50 |
+
$this->enabled = $this->settings[ 'enabled' ];
|
| 51 |
+
$this->title = $this->settings[ 'title' ];
|
| 52 |
+
$this->description = $this->settings[ 'description' ];
|
| 53 |
+
|
| 54 |
+
$this->currency = get_option( 'woocommerce_currency' );
|
| 55 |
+
|
| 56 |
+
/* PayPal Adaptive Payments Configuration. */
|
| 57 |
+
$this->sandbox = $this->settings[ 'sandbox_enabled' ];
|
| 58 |
+
$this->main_paypal = $this->sandbox == 'yes' ? $this->settings[ 'main_paypal' ] : $this->settings[ 'main_paypal_live' ];
|
| 59 |
+
$this->instapay = WC_Vendors::$pv_options->get_option( 'instapay' );
|
| 60 |
+
$this->give_tax = WC_Vendors::$pv_options->get_option( 'give_tax' );
|
| 61 |
+
|
| 62 |
+
add_action( 'woocommerce_update_options_payment_gateways_' . $this->id, array( $this, 'process_admin_options' ) );
|
| 63 |
+
|
| 64 |
+
// Payment listener/API hook
|
| 65 |
+
add_action( 'woocommerce_api_wc_paypalap', array( $this, 'paypal_ap_ipn' ) );
|
| 66 |
+
|
| 67 |
+
$this->debug_me = false;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
/**
|
| 72 |
+
*
|
| 73 |
+
*
|
| 74 |
+
* @return unknown
|
| 75 |
+
*/
|
| 76 |
+
public function is_available()
|
| 77 |
+
{
|
| 78 |
+
return ( $this->is_valid_currency() && $this->enabled == 'yes' );
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
|
| 82 |
+
/**
|
| 83 |
+
*
|
| 84 |
+
*
|
| 85 |
+
* @return unknown
|
| 86 |
+
*/
|
| 87 |
+
public function is_valid_currency()
|
| 88 |
+
{
|
| 89 |
+
return in_array( get_woocommerce_currency(), array( 'AUD', 'BRL', 'CAD', 'MXN', 'NZD', 'HKD', 'SGD', 'USD', 'EUR', 'JPY', 'TRY', 'NOK', 'CZK', 'DKK', 'HUF', 'ILS', 'MYR', 'PHP', 'PLN', 'SEK', 'CHF', 'TWD', 'THB', 'GBP', 'RMB' ) );
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
/**
|
| 94 |
+
*
|
| 95 |
+
*/
|
| 96 |
+
public function include_paypal_sdk()
|
| 97 |
+
{
|
| 98 |
+
$path = self::$pluginDir . 'classes/adaptivepayments-sdk/lib';
|
| 99 |
+
set_include_path( get_include_path() . PATH_SEPARATOR . $path );
|
| 100 |
+
require_once 'services/AdaptivePayments/AdaptivePaymentsService.php';
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
|
| 104 |
+
/**
|
| 105 |
+
*
|
| 106 |
+
*
|
| 107 |
+
* @return unknown
|
| 108 |
+
*/
|
| 109 |
+
public function paypal_ap_ipn()
|
| 110 |
+
{
|
| 111 |
+
if ( empty( $_GET[ 'paypal_chain_ipn' ] ) || empty( $_GET[ 'order_id' ] ) ) return false;
|
| 112 |
+
|
| 113 |
+
$order_id = (int) $_GET[ 'order_id' ];
|
| 114 |
+
|
| 115 |
+
$order = new WC_Order( $order_id );
|
| 116 |
+
if ( !$order ) return false;
|
| 117 |
+
|
| 118 |
+
if ( $_POST[ 'status' ] !== 'COMPLETED' ) {
|
| 119 |
+
$order->update_status( 'failed', sprintf( __( 'Something went wrong. Response from PayPal invalidated this order. Status: %s.', 'wcvendors' ), $_POST[ 'status' ] ) );
|
| 120 |
+
exit;
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
$order->payment_complete();
|
| 124 |
+
$order->add_order_note( __( 'IPN payment completed', 'wcvendors' ) );
|
| 125 |
+
|
| 126 |
+
if ( $this->instapay ) {
|
| 127 |
+
WCV_Commission::set_order_commission_paid( $order_id );
|
| 128 |
+
}
|
| 129 |
+
exit;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
/**
|
| 134 |
+
* Initialise Gateway Settings Form Fields
|
| 135 |
+
*
|
| 136 |
+
* @access public
|
| 137 |
+
* @return void
|
| 138 |
+
*/
|
| 139 |
+
function init_form_fields()
|
| 140 |
+
{
|
| 141 |
+
|
| 142 |
+
$this->form_fields = array();
|
| 143 |
+
|
| 144 |
+
// List each option in order of appearance with details
|
| 145 |
+
$this->form_fields[ 'enabled' ] = array(
|
| 146 |
+
'title' => __( 'Enable PayPal Adaptive Payments', 'wcvendors' ),
|
| 147 |
+
'default' => 'no',
|
| 148 |
+
'type' => 'checkbox',
|
| 149 |
+
);
|
| 150 |
+
|
| 151 |
+
$this->form_fields[ 'title' ] = array(
|
| 152 |
+
'title' => __( 'Method Title', 'wcvendors' ),
|
| 153 |
+
'description' => __( 'This controls the title which the user sees during checkout.', 'wcvendors' ),
|
| 154 |
+
'default' => __( 'PayPal', 'wcvendors' ),
|
| 155 |
+
'type' => 'text'
|
| 156 |
+
);
|
| 157 |
+
|
| 158 |
+
$this->form_fields[ 'description' ] = array(
|
| 159 |
+
'title' => __( 'Description', 'wcvendors' ),
|
| 160 |
+
'description' => __( 'This controls the description which the user sees during checkout.', 'wcvendors' ),
|
| 161 |
+
'default' => __( "Pay via PayPal!", 'wcvendors' ),
|
| 162 |
+
'type' => 'textarea'
|
| 163 |
+
);
|
| 164 |
+
|
| 165 |
+
// ==================================================================
|
| 166 |
+
//
|
| 167 |
+
// Credentials
|
| 168 |
+
//
|
| 169 |
+
// ------------------------------------------------------------------
|
| 170 |
+
|
| 171 |
+
$this->form_fields[ ] = array(
|
| 172 |
+
'title' => __( 'Live Credentials', 'wcvendors' ),
|
| 173 |
+
'type' => 'title',
|
| 174 |
+
'description' => sprintf( __( 'You must have an <a href="%s">Application ID</a> to process live transactions. You do not need one for testing in Sandbox mode.', 'wcvendors' )
|
| 175 |
+
, 'https://developer.paypal.com/webapps/developer/docs/classic/lifecycle/goingLive/' )
|
| 176 |
+
);
|
| 177 |
+
|
| 178 |
+
$this->form_fields[ 'main_paypal_live' ] = array(
|
| 179 |
+
'title' => __( 'PayPal Email', 'wcvendors' ),
|
| 180 |
+
'description' => __( 'The email address main payments should go to.', 'wcvendors' ),
|
| 181 |
+
'type' => 'text'
|
| 182 |
+
);
|
| 183 |
+
|
| 184 |
+
$this->form_fields[ 'username_live' ] = array(
|
| 185 |
+
'title' => __( 'API Username', 'wcvendors' ),
|
| 186 |
+
'type' => 'text'
|
| 187 |
+
);
|
| 188 |
+
|
| 189 |
+
$this->form_fields[ 'password_live' ] = array(
|
| 190 |
+
'title' => __( 'API Password', 'wcvendors' ),
|
| 191 |
+
'type' => 'text'
|
| 192 |
+
);
|
| 193 |
+
|
| 194 |
+
$this->form_fields[ 'signature_live' ] = array(
|
| 195 |
+
'title' => __( 'API Signature', 'wcvendors' ),
|
| 196 |
+
'type' => 'text'
|
| 197 |
+
);
|
| 198 |
+
|
| 199 |
+
$this->form_fields[ 'app_id' ] = array(
|
| 200 |
+
'title' => __( 'Application ID', 'wcvendors' ),
|
| 201 |
+
'type' => 'text',
|
| 202 |
+
'description' => __( 'Only required when doing live transactions.', 'wcvendors' ),
|
| 203 |
+
);
|
| 204 |
+
|
| 205 |
+
$this->form_fields[ ] = array(
|
| 206 |
+
'title' => __( 'Sandbox Credentials', 'wcvendors' ),
|
| 207 |
+
'type' => 'title',
|
| 208 |
+
'description' => sprintf( __( 'You can signup for a sandbox developer account <a href="%s">here</a>. You need a developer account if you want to enable Sandbox mode for testing.', 'wcvendors' )
|
| 209 |
+
, 'https://developer.paypal.com/' )
|
| 210 |
+
);
|
| 211 |
+
|
| 212 |
+
$this->form_fields[ 'main_paypal' ] = array(
|
| 213 |
+
'title' => __( 'PayPal Email', 'wcvendors' ),
|
| 214 |
+
'description' => __( 'The email address main payments should go to.', 'wcvendors' ),
|
| 215 |
+
'type' => 'text'
|
| 216 |
+
);
|
| 217 |
+
|
| 218 |
+
$this->form_fields[ 'username' ] = array(
|
| 219 |
+
'title' => __( 'API Username', 'wcvendors' ),
|
| 220 |
+
'type' => 'text'
|
| 221 |
+
);
|
| 222 |
+
|
| 223 |
+
$this->form_fields[ 'password' ] = array(
|
| 224 |
+
'title' => __( 'API Password', 'wcvendors' ),
|
| 225 |
+
'type' => 'text'
|
| 226 |
+
);
|
| 227 |
+
|
| 228 |
+
$this->form_fields[ 'signature' ] = array(
|
| 229 |
+
'title' => __( 'API Signature', 'wcvendors' ),
|
| 230 |
+
'type' => 'text'
|
| 231 |
+
);
|
| 232 |
+
|
| 233 |
+
// ==================================================================
|
| 234 |
+
//
|
| 235 |
+
// Misc. Settings
|
| 236 |
+
//
|
| 237 |
+
// ------------------------------------------------------------------
|
| 238 |
+
|
| 239 |
+
$this->form_fields[ ] = array(
|
| 240 |
+
'title' => __( 'Misc. Settings', 'wcvendors' ),
|
| 241 |
+
'type' => 'title',
|
| 242 |
+
);
|
| 243 |
+
|
| 244 |
+
$this->form_fields[ 'sandbox_enabled' ] = array(
|
| 245 |
+
'title' => __( 'Enable PayPal Sandbox mode', 'wcvendors' ),
|
| 246 |
+
'default' => 'yes',
|
| 247 |
+
'type' => 'checkbox',
|
| 248 |
+
);
|
| 249 |
+
|
| 250 |
+
$this->form_fields[ 'logging_enabled' ] = array(
|
| 251 |
+
'title' => __( 'Enable logging', 'wcvendors' ),
|
| 252 |
+
'default' => 'no',
|
| 253 |
+
'type' => 'checkbox',
|
| 254 |
+
);
|
| 255 |
+
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
/**
|
| 260 |
+
* Admin Panel Options
|
| 261 |
+
*
|
| 262 |
+
* @access public
|
| 263 |
+
* @return void
|
| 264 |
+
*/
|
| 265 |
+
function admin_options()
|
| 266 |
+
{
|
| 267 |
+
?>
|
| 268 |
+
<h3><?php echo $this->method_title; ?></h3>
|
| 269 |
+
<p><?php _e( 'The PayPal Adaptive Payments gateway can instantly pay your vendors their due commission (if enabled). Also used to mass pay vendors on a schedule / manual method (if enabled).', 'wcvendors' ); ?></p>
|
| 270 |
+
<table class="form-table">
|
| 271 |
+
|
| 272 |
+
<?php if ( $this->is_valid_currency() ) :
|
| 273 |
+
|
| 274 |
+
// Generate the HTML For the settings form.
|
| 275 |
+
$this->generate_settings_html();
|
| 276 |
+
|
| 277 |
+
else : ?>
|
| 278 |
+
|
| 279 |
+
<div class="inline error"><p>
|
| 280 |
+
<strong><?php _e( 'Gateway Disabled', 'wcvendors' ); ?></strong>: <?php printf( __( '%s does not support your store currency.', 'wcvendors' ), $this->method_title ); ?>
|
| 281 |
+
</p></div>
|
| 282 |
+
|
| 283 |
+
<?php endif; ?>
|
| 284 |
+
|
| 285 |
+
</table>
|
| 286 |
+
<?php
|
| 287 |
+
}
|
| 288 |
+
|
| 289 |
+
|
| 290 |
+
/**
|
| 291 |
+
*
|
| 292 |
+
*
|
| 293 |
+
* @param unknown $order
|
| 294 |
+
*
|
| 295 |
+
* @return unknown
|
| 296 |
+
*/
|
| 297 |
+
private function get_receivers( $order )
|
| 298 |
+
{
|
| 299 |
+
$response = array();
|
| 300 |
+
|
| 301 |
+
// Process the payment and split as required
|
| 302 |
+
if ( $this->instapay ) {
|
| 303 |
+
|
| 304 |
+
$receivers = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 305 |
+
$i = 0;
|
| 306 |
+
|
| 307 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 308 |
+
|
| 309 |
+
foreach ( $receivers as $author => $values ) {
|
| 310 |
+
if ( empty( $values[ 'total' ] ) ) continue;
|
| 311 |
+
|
| 312 |
+
$response[ $i ] = new Receiver();
|
| 313 |
+
$response[ $i ]->email = $values[ 'vendor_id' ] == 1 ? $this->main_paypal : WCV_Vendors::get_vendor_paypal( $values[ 'vendor_id' ] );
|
| 314 |
+
$response[ $i ]->amount = round( $values[ 'total' ], 2);
|
| 315 |
+
$response[ $i ]->primary = false;
|
| 316 |
+
$response[ $i ]->invoiceId = $order_id;
|
| 317 |
+
$i++;
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
} else {
|
| 321 |
+
// Send all monies to the site admin
|
| 322 |
+
$single_receiver = new Receiver();
|
| 323 |
+
$single_receiver->email = $this->main_paypal;
|
| 324 |
+
$single_receiver->amount = $order->get_total();
|
| 325 |
+
$single_receiver->primary = false;
|
| 326 |
+
$single_receiver->invoiceId = $order_id;
|
| 327 |
+
// Set a single reciever for the transaction
|
| 328 |
+
$response[] = $single_receiver;
|
| 329 |
+
}
|
| 330 |
+
|
| 331 |
+
if ( $this->debug_me ) {
|
| 332 |
+
var_dump( $response );
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
return $response;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
|
| 339 |
+
/**
|
| 340 |
+
*
|
| 341 |
+
*
|
| 342 |
+
* @param unknown $order_id
|
| 343 |
+
*
|
| 344 |
+
* @return unknown
|
| 345 |
+
*/
|
| 346 |
+
public function paypalap_check_form( $order_id )
|
| 347 |
+
{
|
| 348 |
+
global $woocommerce;
|
| 349 |
+
|
| 350 |
+
$this->include_paypal_sdk();
|
| 351 |
+
$this->logger = new PPLoggingManager( 'Pay' );
|
| 352 |
+
$order = new WC_Order( $order_id );
|
| 353 |
+
$order_id = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->id : $order->get_id();
|
| 354 |
+
$order_key = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->order_key : $order->get_order_key();
|
| 355 |
+
$customer_note = ( version_compare( WC_VERSION, '2.7', '<' ) ) ? $order->customer_note : $order->get_customer_note();
|
| 356 |
+
|
| 357 |
+
$receivers = $this->get_receivers( $order );
|
| 358 |
+
$receiverList = new ReceiverList( $receivers );
|
| 359 |
+
|
| 360 |
+
$actionType = 'CREATE';
|
| 361 |
+
$cancelUrl = $order->get_cancel_order_url_raw();
|
| 362 |
+
$currencyCode = get_woocommerce_currency();
|
| 363 |
+
$returnUrl = esc_url_raw( add_query_arg( 'key', $order_key, add_query_arg( 'order-received', $order_id, $order->get_checkout_order_received_url() ) ) );
|
| 364 |
+
|
| 365 |
+
$payRequest = new PayRequest( new RequestEnvelope( "en_US" ), $actionType, $cancelUrl, $currencyCode, $receiverList, $returnUrl );
|
| 366 |
+
|
| 367 |
+
// ==================================================================
|
| 368 |
+
//
|
| 369 |
+
// Optional params
|
| 370 |
+
//
|
| 371 |
+
// ------------------------------------------------------------------
|
| 372 |
+
|
| 373 |
+
$payRequest->feesPayer = 'EACHRECEIVER';
|
| 374 |
+
|
| 375 |
+
$args = array(
|
| 376 |
+
'wc-api' => 'WC_PayPalAP',
|
| 377 |
+
'paypal_chain_ipn' => '1',
|
| 378 |
+
'order_id' => $order_id,
|
| 379 |
+
);
|
| 380 |
+
|
| 381 |
+
$payRequest->ipnNotificationUrl = add_query_arg( $args, home_url( '/' ) );
|
| 382 |
+
$payRequest->memo = !empty( $customer_note ) ? $customer_note : '';
|
| 383 |
+
$payRequest->reverseAllParallelPaymentsOnError = true;
|
| 384 |
+
|
| 385 |
+
$service = new AdaptivePaymentsService();
|
| 386 |
+
try {
|
| 387 |
+
$response = $service->Pay( $payRequest );
|
| 388 |
+
} catch ( Exception $ex ) {
|
| 389 |
+
wc_add_notice( sprintf( __( 'Error: %s', 'wcvendors' ), $ex->getMessage() ), 'error' );
|
| 390 |
+
|
| 391 |
+
return false;
|
| 392 |
+
}
|
| 393 |
+
|
| 394 |
+
$this->logger->log( "Received payResponse:" );
|
| 395 |
+
$ack = strtoupper( $response->responseEnvelope->ack );
|
| 396 |
+
|
| 397 |
+
if ( $ack != 'SUCCESS' ) {
|
| 398 |
+
$order->update_status( 'cancelled', sprintf( __( 'Error ID: %s. %s', 'wcvendors' ), $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ) );
|
| 399 |
+
wc_add_notice( sprintf( __( 'Error ID: %s. %s', 'wcvendors' ), $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'error' );
|
| 400 |
+
|
| 401 |
+
return false;
|
| 402 |
+
}
|
| 403 |
+
|
| 404 |
+
return $response->payKey;
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
|
| 408 |
+
/**
|
| 409 |
+
*
|
| 410 |
+
*
|
| 411 |
+
* @param unknown $order
|
| 412 |
+
* @param unknown $author_email
|
| 413 |
+
* @param unknown $setPaymentOptionsRequest
|
| 414 |
+
* @param unknown $is_admin (optional)
|
| 415 |
+
*
|
| 416 |
+
* @return unknown
|
| 417 |
+
*/
|
| 418 |
+
public function set_vendor_items( $order, $setPaymentOptionsRequest )
|
| 419 |
+
{
|
| 420 |
+
$receivers = WCV_Vendors::get_vendor_dues_from_order( $order, false );
|
| 421 |
+
$receivers_two = WCV_Vendors::get_vendor_dues_from_order( $order );
|
| 422 |
+
|
| 423 |
+
foreach ( $receivers as $products ) {
|
| 424 |
+
$invoice_items = array();
|
| 425 |
+
$shipping_given = $tax_given = 0;
|
| 426 |
+
|
| 427 |
+
foreach ( $products as $key => $product ) {
|
| 428 |
+
|
| 429 |
+
$product_id = $product[ 'product_id' ];
|
| 430 |
+
$shipping_given += $product[ 'shipping' ];
|
| 431 |
+
$tax_given += $product[ 'tax' ];
|
| 432 |
+
|
| 433 |
+
$product[ 'commission' ] = round( $product[ 'commission' ] , 2);
|
| 434 |
+
|
| 435 |
+
if ( !empty( $product[ 'commission' ] ) ) {
|
| 436 |
+
$item = new InvoiceItem();
|
| 437 |
+
$item->name = get_the_title( $product_id );
|
| 438 |
+
$item->identifier = $product_id;
|
| 439 |
+
$item->price = $product[ 'commission' ];
|
| 440 |
+
$item->itemPrice = round( $product[ 'commission' ] / $product[ 'qty' ], 2 );
|
| 441 |
+
$item->itemCount = $product[ 'qty' ];
|
| 442 |
+
$invoice_items[ ] = $item;
|
| 443 |
+
}
|
| 444 |
+
}
|
| 445 |
+
|
| 446 |
+
if ( empty( $invoice_items ) ) {
|
| 447 |
+
continue;
|
| 448 |
+
}
|
| 449 |
+
|
| 450 |
+
$receiverOptions = new ReceiverOptions();
|
| 451 |
+
$setPaymentOptionsRequest->receiverOptions[ ] = $receiverOptions;
|
| 452 |
+
|
| 453 |
+
// Set the current vendor
|
| 454 |
+
$receiverId = new ReceiverIdentifier();
|
| 455 |
+
$receiverId->email = $product[ 'vendor_id' ] == 1 ? $this->main_paypal : WCV_Vendors::get_vendor_paypal( $product[ 'vendor_id' ] );
|
| 456 |
+
|
| 457 |
+
$receiverOptions->receiver = $receiverId;
|
| 458 |
+
$receiverOptions->invoiceData = new InvoiceData();
|
| 459 |
+
$receiverOptions->invoiceData->item = $invoice_items;
|
| 460 |
+
$receiverOptions->invoiceData->totalTax = number_format( $receivers_two[$product['vendor_id']]['tax'], 2 );
|
| 461 |
+
$receiverOptions->invoiceData->totalShipping = number_format( $receivers_two[$product['vendor_id']]['shipping'], 2 );
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
return $setPaymentOptionsRequest;
|
| 465 |
+
}
|
| 466 |
+
|
| 467 |
+
|
| 468 |
+
/**
|
| 469 |
+
*
|
| 470 |
+
*
|
| 471 |
+
* @param unknown $pay_key
|
| 472 |
+
* @param unknown $order_id
|
| 473 |
+
*
|
| 474 |
+
* @return unknown
|
| 475 |
+
*/
|
| 476 |
+
public function set_paypal_author_specifics( $pay_key, $order_id )
|
| 477 |
+
{
|
| 478 |
+
global $woocommerce;
|
| 479 |
+
|
| 480 |
+
$this->include_paypal_sdk();
|
| 481 |
+
$order = new WC_Order( $order_id );
|
| 482 |
+
|
| 483 |
+
// Create request
|
| 484 |
+
$setPaymentOptionsRequest = new SetPaymentOptionsRequest( new RequestEnvelope( "en_US" ) );
|
| 485 |
+
$setPaymentOptionsRequest->payKey = $pay_key;
|
| 486 |
+
|
| 487 |
+
if ( $this->instapay ) {
|
| 488 |
+
$setPaymentOptionsRequest = $this->set_vendor_items( $order, $setPaymentOptionsRequest );
|
| 489 |
+
}
|
| 490 |
+
|
| 491 |
+
if ( $this->debug_me ) {
|
| 492 |
+
foreach ( $setPaymentOptionsRequest->receiverOptions as $k ) {
|
| 493 |
+
var_dump( $k->invoiceData );
|
| 494 |
+
}
|
| 495 |
+
exit;
|
| 496 |
+
}
|
| 497 |
+
|
| 498 |
+
$setPaymentOptionsRequest->senderOptions = new SenderOptions();
|
| 499 |
+
$setPaymentOptionsRequest->senderOptions->requireShippingAddressSelection = true;
|
| 500 |
+
|
| 501 |
+
$service = new AdaptivePaymentsService();
|
| 502 |
+
try {
|
| 503 |
+
$response = $service->SetPaymentOptions( $setPaymentOptionsRequest );
|
| 504 |
+
} catch ( Exception $ex ) {
|
| 505 |
+
wc_add_notice( sprintf( __( 'Error: %s', 'wcvendors' ), $ex->getMessage() ), 'error' );
|
| 506 |
+
|
| 507 |
+
return false;
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
$this->logger->error( "Received SetPaymentOptionsResponse:" );
|
| 511 |
+
$ack = strtoupper( $response->responseEnvelope->ack );
|
| 512 |
+
if ( $ack != "SUCCESS" ) {
|
| 513 |
+
$order->update_status( 'cancelled', __( sprintf( 'Error ID: %s. %s', $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'wcvendors' ) );
|
| 514 |
+
wc_add_notice( sprintf( 'Error ID: %s. %s', $response->error[ 0 ]->errorId, $response->error[ 0 ]->message ), 'error' );
|
| 515 |
+
|
| 516 |
+
return false;
|
| 517 |
+
}
|
| 518 |
+
|
| 519 |
+
return true;
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
|
| 523 |
+
/**
|
| 524 |
+
* Payment fields
|
| 525 |
+
*/
|
| 526 |
+
function payment_fields()
|
| 527 |
+
{
|
| 528 |
+
if ( $description = $this->settings[ 'description' ] ) echo wpautop( wptexturize( $this->description ) );
|
| 529 |
+
}
|
| 530 |
+
|
| 531 |
+
|
| 532 |
+
/**
|
| 533 |
+
* Process the payment and return the result
|
| 534 |
+
*
|
| 535 |
+
* @param unknown $order_id
|
| 536 |
+
*
|
| 537 |
+
* @return unknown
|
| 538 |
+
*/
|
| 539 |
+
function process_payment( $order_id )
|
| 540 |
+
{
|
| 541 |
+
global $woocommerce;
|
| 542 |
+
|
| 543 |
+
$order = new WC_Order( $order_id );
|
| 544 |
+
$pay_key = $this->paypalap_check_form( $order_id );
|
| 545 |
+
|
| 546 |
+
if ( !empty( $woocommerce->errors ) ) return false;
|
| 547 |
+
|
| 548 |
+
if ( $this->instapay ) {
|
| 549 |
+
$this->set_paypal_author_specifics( $pay_key, $order_id );
|
| 550 |
+
if ( !empty( $woocommerce->errors ) ) return false;
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
+
$paypal_redirect_url = $this->sandbox == 'yes' ? 'https://www.sandbox.paypal.com/cgi-bin/webscr?cmd=' : 'https://www.paypal.com/cgi-bin/webscr?cmd=';
|
| 554 |
+
$pay_url = $paypal_redirect_url . '_ap-payment&paykey=' . $pay_key;
|
| 555 |
+
|
| 556 |
+
return array(
|
| 557 |
+
'result' => 'success',
|
| 558 |
+
'redirect' => $pay_url,
|
| 559 |
+
);
|
| 560 |
+
|
| 561 |
+
}
|
| 562 |
+
}
|
trunk/classes/gateways/PayPal_Masspay/api/ChangeLog.txt
ADDED
|
@@ -0,0 +1,48 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
Version 1.2.95 - September 28, 2012
|
| 3 |
+
|
| 4 |
+
- SDK refreshed to Release 95. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#MerchantAPI
|
| 5 |
+
- SDK now supports third party permission by subject header. Configure subject header
|
| 6 |
+
in the configuration file, this is basically third party merchant email address who has
|
| 7 |
+
given permission to you to call api on their behalf.
|
| 8 |
+
- Bug fixed for Page styling attributes (eg: cpp-header**) serialization. (https://github.com/paypal/SDKs/issues/31)
|
| 9 |
+
- Bug fixed for 'convertToXML' method for not escaping xml element correctly.(https://github.com/paypal/SDKs/issues/17)
|
| 10 |
+
- PayPal Endpoint is corrected in config file.(https://github.com/paypal/SDKs/issues/22)
|
| 11 |
+
- Bug fixed for BasicAmountType serialization without currencyID attribute.(https://github.com/paypal/SDKs/issues/23)
|
| 12 |
+
- Bug fixed for 'PPLoggingManager.php' to pickup configuration entries.(https://github.com/paypal/SDKs/issues/28)
|
| 13 |
+
- Updated SDK sample
|
| 14 |
+
--------------------------------------------------------------------------------------------------
|
| 15 |
+
|
| 16 |
+
|
| 17 |
+
Version 1.1.93 - August 14, 2012
|
| 18 |
+
|
| 19 |
+
- SDK refreshed to Release 93. Please refer https://www.x.com/developers/paypal/documentation-tools/release-notes#MerchantAPI
|
| 20 |
+
- SDK Core - Deserialization Logic Change
|
| 21 |
+
--------------------------------------------------------------------------------------------------
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
Version 1.0.92 - July 30, 2012
|
| 25 |
+
|
| 26 |
+
- Stable release
|
| 27 |
+
-------------------------------------------------------------------------------------------------
|
| 28 |
+
Version 0.7.92 - July 17, 2012
|
| 29 |
+
|
| 30 |
+
- wsdl update version 0.7.92
|
| 31 |
+
--------------------------------------------------------------------------------------------------
|
| 32 |
+
|
| 33 |
+
Version 0.7.90 - 11-June-2012
|
| 34 |
+
|
| 35 |
+
- SDK upgrade to latest WSDL release (90.0)
|
| 36 |
+
--------------------------------------------------------------------------------------------------
|
| 37 |
+
|
| 38 |
+
Version 0.7.88 - 17-Apr-2012
|
| 39 |
+
|
| 40 |
+
- Fix to get SDK working with Permissions API token
|
| 41 |
+
|
| 42 |
+
--------------------------------------------------------------------------------------------------
|
| 43 |
+
|
| 44 |
+
Version 0.6.88 - 27-Feb-2012
|
| 45 |
+
|
| 46 |
+
- Initial release
|
| 47 |
+
|
| 48 |
+
--------------------------------------------------------------------------------------------------
|
trunk/classes/gateways/PayPal_Masspay/api/LICENSE.txt
ADDED
|
@@ -0,0 +1,41 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
PAYPAL, INC.
|
| 2 |
+
|
| 3 |
+
SDK LICENSE
|
| 4 |
+
|
| 5 |
+
NOTICE TO USER: PayPal, Inc. is providing the Software and Documentation for use under the terms of this Agreement. Any use, reproduction, modification or distribution of the Software or Documentation, or any derivatives or portions hereof, constitutes your acceptance of this Agreement.
|
| 6 |
+
|
| 7 |
+
As used in this Agreement, "PayPal" means PayPal, Inc. "Software" means the software code accompanying this agreement. "Documentation" means the documents, specifications and all other items accompanying this Agreement other than the Software.
|
| 8 |
+
|
| 9 |
+
1. LICENSE GRANT Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, prepare derivative works from, publicly display, publicly perform, distribute and sublicense the Software for any purpose, provided the copyright notice below appears in a conspicuous location within the source code of the distributed Software and this license is distributed in the supporting documentation of the Software you distribute. Furthermore, you must comply with all third party licenses in order to use the third party software contained in the Software.
|
| 10 |
+
|
| 11 |
+
Subject to the terms of this Agreement, PayPal hereby grants you a non-exclusive, worldwide, royalty free license to use, reproduce, publicly display, publicly perform, distribute and sublicense the Documentation for any purpose. You may not modify the Documentation.
|
| 12 |
+
|
| 13 |
+
No title to the intellectual property in the Software or Documentation is transferred to you under the terms of this Agreement. You do not acquire any rights to the Software or the Documentation except as expressly set forth in this Agreement.
|
| 14 |
+
|
| 15 |
+
If you choose to distribute the Software in a commercial product, you do so with the understanding that you agree to defend, indemnify and hold harmless PayPal and its suppliers against any losses, damages and costs arising from the claims, lawsuits or other legal actions arising out of such distribution. You may distribute the Software in object code form under your own license, provided that your license agreement:
|
| 16 |
+
|
| 17 |
+
(a) complies with the terms and conditions of this license agreement;
|
| 18 |
+
|
| 19 |
+
(b) effectively disclaims all warranties and conditions, express or implied, on behalf of PayPal;
|
| 20 |
+
|
| 21 |
+
(c) effectively excludes all liability for damages on behalf of PayPal;
|
| 22 |
+
|
| 23 |
+
(d) states that any provisions that differ from this Agreement are offered by you alone and not PayPal; and
|
| 24 |
+
|
| 25 |
+
(e) states that the Software is available from you or PayPal and informs licensees how to obtain it in a reasonable manner on or through a medium customarily used for software exchange.
|
| 26 |
+
|
| 27 |
+
2. DISCLAIMER OF WARRANTY
|
| 28 |
+
PAYPAL LICENSES THE SOFTWARE AND DOCUMENTATION TO YOU ONLY ON AN "AS IS" BASIS WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY WARRANTIES OR CONDITIONS OF TITLE, NON-INFRINGEMENT, MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE. PAYPAL MAKES NO WARRANTY THAT THE SOFTWARE OR DOCUMENTATION WILL BE ERROR-FREE. Each user of the Software or Documentation is solely responsible for determining the appropriateness of using and distributing the Software and Documentation and assumes all risks associated with its exercise of rights under this Agreement, including but not limited to the risks and costs of program errors, compliance with applicable laws, damage to or loss of data, programs, or equipment, and unavailability or interruption of operations. Use of the Software and Documentation is made with the understanding that PayPal will not provide you with any technical or customer support or maintenance. Some states or jurisdictions do not allow the exclusion of implied warranties or limitations on how long an implied warranty may last, so the above limitations may not apply to you. To the extent permissible, any implied warranties are limited to ninety (90) days.
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
3. LIMITATION OF LIABILITY
|
| 32 |
+
PAYPAL AND ITS SUPPLIERS SHALL NOT BE LIABLE FOR LOSS OR DAMAGE ARISING OUT OF THIS AGREEMENT OR FROM THE USE OF THE SOFTWARE OR DOCUMENTATION. IN NO EVENT WILL PAYPAL OR ITS SUPPLIERS BE LIABLE TO YOU OR ANY THIRD PARTY FOR ANY DIRECT, INDIRECT, CONSEQUENTIAL, INCIDENTAL, OR SPECIAL DAMAGES INCLUDING LOST PROFITS, LOST SAVINGS, COSTS, FEES, OR EXPENSES OF ANY KIND ARISING OUT OF ANY PROVISION OF THIS AGREEMENT OR THE USE OR THE INABILITY TO USE THE SOFTWARE OR DOCUMENTATION, HOWEVER CAUSED AND UNDER ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY OR TORT INCLUDING NEGLIGENCE OR OTHERWISE), EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. PAYPAL'S AGGREGATE LIABILITY AND THAT OF ITS SUPPLIERS UNDER OR IN CONNECTION WITH THIS AGREEMENT SHALL BE LIMITED TO THE AMOUNT PAID BY YOU FOR THE SOFTWARE AND DOCUMENTATION.
|
| 33 |
+
|
| 34 |
+
4. TRADEMARK USAGE
|
| 35 |
+
PayPal is a trademark PayPal, Inc. in the United States and other countries. Such trademarks may not be used to endorse or promote any product unless expressly permitted under separate agreement with PayPal.
|
| 36 |
+
|
| 37 |
+
5. TERM
|
| 38 |
+
Your rights under this Agreement shall terminate if you fail to comply with any of the material terms or conditions of this Agreement and do not cure such failure in a reasonable period of time after becoming aware of such noncompliance. If all your rights under this Agreement terminate, you agree to cease use and distribution of the Software and Documentation as soon as reasonably practicable.
|
| 39 |
+
|
| 40 |
+
6. GOVERNING LAW AND JURISDICTION. This Agreement is governed by the statutes and laws of the State of California, without regard to the conflicts of law principles thereof. If any part of this Agreement is found void and unenforceable, it will not affect the validity of the balance of the Agreement, which shall remain valid and enforceable according to its terms. Any dispute arising out of or related to this Agreement shall be brought in the courts of Santa Clara County, California, USA.
|
| 41 |
+
|
trunk/classes/gateways/PayPal_Masspay/api/README.md
ADDED
|
@@ -0,0 +1,60 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
PayPal PHP Merchant SDK
|
| 3 |
+
===============================
|
| 4 |
+
|
| 5 |
+
Prerequisites
|
| 6 |
+
-------------
|
| 7 |
+
|
| 8 |
+
PayPal's PHP Merchant SDK requires
|
| 9 |
+
|
| 10 |
+
* PHP 5.2 and above with curl extension enabled
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
Using the SDK
|
| 14 |
+
-------------
|
| 15 |
+
|
| 16 |
+
To use the SDK,
|
| 17 |
+
|
| 18 |
+
* Copy the config and lib folders into your project.
|
| 19 |
+
* Make sure that the lib folder in your project is available in PHP's include path
|
| 20 |
+
* Include the services\PayPalAPIInterfaceService\PayPalAPIInterfaceServiceService.php file in your code.
|
| 21 |
+
* Create a service wrapper object
|
| 22 |
+
* Create a request object as per your project's needs. All the API request and response classes are available in services\PayPalAPIInterfaceService\PayPalAPIInterfaceServiceService.php
|
| 23 |
+
* Invoke the appropriate method on the request object.
|
| 24 |
+
|
| 25 |
+
|
| 26 |
+
For example,
|
| 27 |
+
|
| 28 |
+
require_once('services/PayPalAPIInterfaceService/PayPalAPIInterfaceServiceService.php'); require_once('PPLoggingManager.php');
|
| 29 |
+
|
| 30 |
+
$itemAmount = new BasicAmountType();
|
| 31 |
+
$itemAmount->currencyID = $_REQUEST['currencyCode'];
|
| 32 |
+
$itemAmount->value = $_REQUEST['itemAmount'];
|
| 33 |
+
$setECReqType = new SetExpressCheckoutRequestType();
|
| 34 |
+
$setECReqType->SetExpressCheckoutRequestDetails = $setECReqDetails;
|
| 35 |
+
$setECReqType->Version = '86.0';
|
| 36 |
+
$setECReq = new SetExpressCheckoutReq();
|
| 37 |
+
$setECReq->SetExpressCheckoutRequest = $setECReqType;
|
| 38 |
+
......
|
| 39 |
+
|
| 40 |
+
$paypalService = new PayPalAPIInterfaceServiceService();
|
| 41 |
+
$setECResponse = $paypalService->SetExpressCheckout($setECReq);
|
| 42 |
+
|
| 43 |
+
$ack = strtoupper($setECResponse->Ack);
|
| 44 |
+
|
| 45 |
+
if($ack == 'SUCCESS') {
|
| 46 |
+
// Success
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
|
| 50 |
+
|
| 51 |
+
SDK Configuration
|
| 52 |
+
-----------------
|
| 53 |
+
|
| 54 |
+
replace the API credential in config/sdk_config.ini . You can use the configuration file to configure
|
| 55 |
+
|
| 56 |
+
* (Multiple) API account credentials.
|
| 57 |
+
* Service endpoint and other HTTP connection parameters
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
Please refer to the sample config file provided with this bundle.
|
trunk/classes/gateways/PayPal_Masspay/api/build.xml
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
+
<project name="PayPal_PHP_SDK" default="build">
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
<condition property="PHPUNIT_PATH" value="phpunit.bat" else="phpunit">
|
| 6 |
+
<os family="windows"/>
|
| 7 |
+
</condition>
|
| 8 |
+
|
| 9 |
+
<target name="clean">
|
| 10 |
+
<delete dir="${basedir}/build"/>
|
| 11 |
+
</target>
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
<target name="phpunit">
|
| 15 |
+
<mkdir dir="tests/reports/"/>
|
| 16 |
+
<exec dir="${basedir}" executable="${PHPUNIT_PATH}" failonerror="true">
|
| 17 |
+
<arg
|
| 18 |
+
line="--testdox --include-path lib --log-junit tests\reports\phpunit.xml tests"/>
|
| 19 |
+
</exec>
|
| 20 |
+
</target>
|
| 21 |
+
|
| 22 |
+
|
| 23 |
+
<target name="build" depends="clean, phpunit"/>
|
| 24 |
+
</project>
|
trunk/classes/gateways/PayPal_Masspay/api/config/sdk-cert.pem
ADDED
|
@@ -0,0 +1,41 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Bag Attributes
|
| 2 |
+
localKeyID: E4 F0 42 FE 24 52 DD 61 B0 4A EE 64 74 62 6B 2F 6E 3B 31 7B
|
| 3 |
+
subject=/CN=certuser_biz_api1.paypal.com/O=Bonzop/L=Austin/ST=TX/C=US
|
| 4 |
+
issuer=/C=US/ST=California/L=San Jose/O=PayPal, Inc./OU=sandbox_certs/CN=sandbox_camerchapi/emailAddress=re@paypal.com
|
| 5 |
+
-----BEGIN CERTIFICATE-----
|
| 6 |
+
MIICiDCCAfGgAwIBAgIDD/WUMA0GCSqGSIb3DQEBBQUAMIGfMQswCQYDVQQGEwJV
|
| 7 |
+
UzETMBEGA1UECBMKQ2FsaWZvcm5pYTERMA8GA1UEBxMIU2FuIEpvc2UxFTATBgNV
|
| 8 |
+
BAoTDFBheVBhbCwgSW5jLjEWMBQGA1UECxQNc2FuZGJveF9jZXJ0czEbMBkGA1UE
|
| 9 |
+
AxQSc2FuZGJveF9jYW1lcmNoYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwu
|
| 10 |
+
Y29tMB4XDTExMDUwMjA1MDQ0NFoXDTIxMDQyOTA1MDQ0NFowYzElMCMGA1UEAxQc
|
| 11 |
+
Y2VydHVzZXJfYml6X2FwaTEucGF5cGFsLmNvbTEPMA0GA1UEChMGQm9uem9wMQ8w
|
| 12 |
+
DQYDVQQHEwZBdXN0aW4xCzAJBgNVBAgTAlRYMQswCQYDVQQGEwJVUzCBnzANBgkq
|
| 13 |
+
hkiG9w0BAQEFAAOBjQAwgYkCgYEAmhsOeujiGniLK6drcs38FLcGqZNmj4C/TfKD
|
| 14 |
+
qD5k5gP26oahfNl+NxAds2RdR2N+ZD6dy+a2Uo6q2hGc+Y+1uA5FzEtvOsC52qId
|
| 15 |
+
NrFVm215S3Gf77AEMzYItbNq2jlqJ5HGwCAMoY1aBkI6bgp+8vWDYEH6WZIK4f0e
|
| 16 |
+
YoPKG0MCAwEAAaMNMAswCQYDVR0TBAIwADANBgkqhkiG9w0BAQUFAAOBgQBj6xWw
|
| 17 |
+
AumLzSodCWyocPcyKSooNa7wgJKzaVrf0Kxz2QBesKpsfe9UN3Dj04016FIUbkRI
|
| 18 |
+
4qLJIkKHyeQRU9hvJ78tU7OeykDEVqlHAEE/Z4c5EIs6l9x60VqOpAjnaqX/9Jty
|
| 19 |
+
jXhqpINjolTh6D5jq8y4FX5krKqIYBCNDHM+cQ==
|
| 20 |
+
-----END CERTIFICATE-----
|
| 21 |
+
Bag Attributes
|
| 22 |
+
localKeyID: E4 F0 42 FE 24 52 DD 61 B0 4A EE 64 74 62 6B 2F 6E 3B 31 7B
|
| 23 |
+
Key Attributes: <No Attributes>
|
| 24 |
+
-----BEGIN RSA PRIVATE KEY-----
|
| 25 |
+
Proc-Type: 4,ENCRYPTED
|
| 26 |
+
DEK-Info: DES-EDE3-CBC,18E53CC94575411A
|
| 27 |
+
|
| 28 |
+
Dbkm1iUDbpaY3abg08u1NKnzdd0tZwArMQKpRJ4zaVbm4qYkwAEvmKWGCemP0hwM
|
| 29 |
+
iA0EeLgbSbYbgXi+3Ba1Hm5kf5p5MbGqylgUNBVzKV+OtuPgZPnHclyHoJwRf8NU
|
| 30 |
+
e+wwRIDB/6ZpXt69t3poxmYR0MfhrgSm/YdBDRLJbBE8I51vTELmCRC2SN/5ebo+
|
| 31 |
+
TCNtGyf/upKBf0XfM8sY5SvffwSA1uaOLh0FwtYq0vQViFayPfmyBBDirVZqAFMt
|
| 32 |
+
DOuX2JaYUj9s9qVuwQIqHThJLhTqU/0eZjkYXy22F2ER8fNG77LQ5+SMevngWXjt
|
| 33 |
+
afErYBJYcSc1V/MX39126vaYL/AzLTBXHkSmJ0w+nCs+4ifVv9dJTb8W6W10ZWk6
|
| 34 |
+
HQrSuIhLbgbPg0J5LagYymCWjkl3UseJSFsUdH2EkQA4uBwKX4aJzH4n44H2sCk0
|
| 35 |
+
UCzDSGC6jWr7VOTpOk5+NHi/pqZhvpNn2Tg+jZt/kqKAa08di9jTP0eZbS4+bb6S
|
| 36 |
+
9FtpOLWXKz/JZVLmA5v2o1L9kqvFoMsgvito4oK/j5jPGat22xTpoBnSom3+QsfB
|
| 37 |
+
ViOStyAh9MqGqsTh+YcNNUbv5dJ4IpmUAki64Cx4j90wFkpbUpoeT3l/0Gbuwnpy
|
| 38 |
+
Ugw97/qHVGlFAhrXDr72TqI2+YXFfxklyCLMNnsBvrM55NZcgxsH7UWp0hCNXq/j
|
| 39 |
+
FQNduuw6CAqfosj5aKjDRIll1MN0631yxkGxhsHiMQNMOCMe6+OwDs5gdF+Wvc4j
|
| 40 |
+
HlSAq1H0v3iZRcWs1qdf9eKMAc1k5T9TPHlcEgwv9zMWSGqvxizwNQ==
|
| 41 |
+
-----END RSA PRIVATE KEY-----
|
trunk/classes/gateways/PayPal_Masspay/api/config/sdk_config.ini
ADDED
|
@@ -0,0 +1,39 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
;Account credentials
|
| 2 |
+
[Account]
|
| 3 |
+
acct1.UserName = jb-us-seller_api1.paypal.com
|
| 4 |
+
acct1.Password = WX4WTU3S8MY44S7F
|
| 5 |
+
acct1.Signature = AFcWxV21C7fd0v3bYYYRCpSSRl31A7yDhhsPUU2XhtMoZXsWHFxu-RWy
|
| 6 |
+
acct1.AppId = APP-80W284485P519543T
|
| 7 |
+
# Subject is optinal, only required in case of third party permission
|
| 8 |
+
acct1.Subject =
|
| 9 |
+
|
| 10 |
+
; Certificate Credentials Test Account
|
| 11 |
+
acct2.UserName = certuser_biz_api1.paypal.com
|
| 12 |
+
acct2.Password = D6JNKKULHN3G5B8A
|
| 13 |
+
; Certificate path relative to config folder or absolute path in file system
|
| 14 |
+
acct2.CertPath = sdk-cert.pem
|
| 15 |
+
acct2.CertKey = password ; Password given when generating .PEM file from a .p12 file
|
| 16 |
+
acct2.AppId = APP-80W284485P519543T
|
| 17 |
+
# Subject is optinal, only required in case of third party permission
|
| 18 |
+
acct2.Subject =
|
| 19 |
+
|
| 20 |
+
;Connection Information
|
| 21 |
+
[Http]
|
| 22 |
+
http.ConnectionTimeOut = 30
|
| 23 |
+
http.Retry = 5
|
| 24 |
+
;http.Proxy
|
| 25 |
+
|
| 26 |
+
;Service Configuration
|
| 27 |
+
[Service]
|
| 28 |
+
; NOTE: Do not change the service binding configuration.
|
| 29 |
+
service.Binding = SOAP
|
| 30 |
+
service.EndPoint = "https://api-3t.sandbox.paypal.com/2.0/" ; Endpoint for 3-token credentials
|
| 31 |
+
; Uncomment this line if you are using certificate credentials
|
| 32 |
+
;service.EndPoint = "https://api.sandbox.paypal.com/2.0/"
|
| 33 |
+
service.RedirectURL = "https://www.sandbox.paypal.com/webscr&cmd="
|
| 34 |
+
|
| 35 |
+
;Logging Information
|
| 36 |
+
[Log]
|
| 37 |
+
log.FileName = ../PayPal.log
|
| 38 |
+
log.LogLevel = INFO
|
| 39 |
+
log.LogEnabled = true
|
trunk/classes/gateways/PayPal_Masspay/api/lib/IPPCredential.php
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Base class that represents API credentials
|
| 5 |
+
*/
|
| 6 |
+
abstract class IPPCredential
|
| 7 |
+
{
|
| 8 |
+
/**
|
| 9 |
+
* Application Id that uniquely identifies the application
|
| 10 |
+
* The application Id is issued by PayPal.
|
| 11 |
+
* Test application Ids are available for the sandbox environment
|
| 12 |
+
* @var string
|
| 13 |
+
*/
|
| 14 |
+
protected $applicationId;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* API username
|
| 18 |
+
* @var string
|
| 19 |
+
*/
|
| 20 |
+
protected $userName;
|
| 21 |
+
|
| 22 |
+
/**
|
| 23 |
+
* API password
|
| 24 |
+
* @var string
|
| 25 |
+
*/
|
| 26 |
+
protected $password;
|
| 27 |
+
|
| 28 |
+
protected abstract function validate();
|
| 29 |
+
|
| 30 |
+
public function __construct( $userName, $password, $applicationId )
|
| 31 |
+
{
|
| 32 |
+
$this->userName = $userName;
|
| 33 |
+
$this->password = $password;
|
| 34 |
+
$this->applicationId = $applicationId;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
public function getApplicationId()
|
| 38 |
+
{
|
| 39 |
+
return $this->applicationId;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
public function getUserName()
|
| 43 |
+
{
|
| 44 |
+
return $this->userName;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
public function getPassword()
|
| 48 |
+
{
|
| 49 |
+
return $this->password;
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPAPIService.php
ADDED
|
@@ -0,0 +1,62 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPCredentialManager.php';
|
| 3 |
+
require_once 'PPConnectionManager.php';
|
| 4 |
+
require_once 'PPObjectTransformer.php';
|
| 5 |
+
require_once 'PPLoggingManager.php';
|
| 6 |
+
require_once 'PPUtils.php';
|
| 7 |
+
require_once 'PPAuthenticationManager.php';
|
| 8 |
+
|
| 9 |
+
class PPAPIService
|
| 10 |
+
{
|
| 11 |
+
public $endpoint;
|
| 12 |
+
public $serviceName;
|
| 13 |
+
private $logger;
|
| 14 |
+
|
| 15 |
+
public function __construct( $serviceName = "" )
|
| 16 |
+
{
|
| 17 |
+
$this->serviceName = $serviceName;
|
| 18 |
+
$config = PPConfigManager::getInstance();
|
| 19 |
+
$this->endpoint = $config->get( 'service.EndPoint' );
|
| 20 |
+
$this->logger = new PPLoggingManager( __CLASS__ );
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
public function setServiceName( $serviceName )
|
| 24 |
+
{
|
| 25 |
+
$this->serviceName = $serviceName;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
public function makeRequest( $apiMethod, $params, $apiUsername = null, $accessToken = null, $tokenSecret = null )
|
| 30 |
+
{
|
| 31 |
+
|
| 32 |
+
$authentication = new PPAuthenticationManager();
|
| 33 |
+
$connectionMgr = PPConnectionManager::getInstance();
|
| 34 |
+
$connection = $connectionMgr->getConnection();
|
| 35 |
+
|
| 36 |
+
$credMgr = PPCredentialManager::getInstance();
|
| 37 |
+
// $apiUsernam is optional, if null the default account in congif file is taken
|
| 38 |
+
$apIPPCredential = $credMgr->getCredentialObject( $apiUsername );
|
| 39 |
+
$config = PPConfigManager::getInstance();
|
| 40 |
+
if ( $config->get( 'service.Binding' ) == 'SOAP' ) {
|
| 41 |
+
$url = $this->endpoint;
|
| 42 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 43 |
+
$headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 44 |
+
} else {
|
| 45 |
+
$headers = null;
|
| 46 |
+
}
|
| 47 |
+
$params = $authentication->appendSoapHeader( $params, $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 48 |
+
} else {
|
| 49 |
+
$url = $this->endpoint . $this->serviceName . '/' . $apiMethod;
|
| 50 |
+
$headers = $authentication->getPayPalHeaders( $apIPPCredential, $connection, $accessToken, $tokenSecret, $url );
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
$this->logger->info( "Request: $params" );
|
| 55 |
+
$response = $connection->execute( $url, $params, $headers );
|
| 56 |
+
$this->logger->info( "Response: $response" );
|
| 57 |
+
|
| 58 |
+
return $response;
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
}
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPAuthenticationManager.php
ADDED
|
@@ -0,0 +1,99 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'PPSignatureCredential.php';
|
| 5 |
+
require_once 'PPCertificateCredential.php';
|
| 6 |
+
require_once 'exceptions/PPInvalidCredentialException.php';
|
| 7 |
+
require_once 'auth/PPAuth.php';
|
| 8 |
+
|
| 9 |
+
class PPAuthenticationManager
|
| 10 |
+
{
|
| 11 |
+
public function getPayPalHeaders( $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
|
| 12 |
+
{
|
| 13 |
+
$config = PPConfigManager::getInstance();
|
| 14 |
+
|
| 15 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 16 |
+
$headers_arr[ ] = "X-PP-AUTHORIZATION: " . $this->generateAuthString( $apiCred, $accessToken, $tokenSecret, $url );
|
| 17 |
+
//$headers_arr[] = "CLIENT-AUTH: No cert";
|
| 18 |
+
} // Add headers required for service authentication
|
| 19 |
+
else if ( $apiCred instanceof PPSignatureCredential ) {
|
| 20 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
|
| 21 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
|
| 22 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-SIGNATURE: " . $apiCred->getSignature();
|
| 23 |
+
} else if ( $apiCred instanceof PPCertificateCredential ) {
|
| 24 |
+
|
| 25 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-USERID: " . $apiCred->getUserName();
|
| 26 |
+
$headers_arr[ ] = "X-PAYPAL-SECURITY-PASSWORD: " . $apiCred->getPassword();
|
| 27 |
+
$connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
// Add other headers
|
| 31 |
+
$headers_arr[ ] = "X-PAYPAL-APPLICATION-ID: " . $apiCred->getApplicationId();
|
| 32 |
+
$headers_arr[ ] = "X-PAYPAL-REQUEST-DATA-FORMAT: " . $config->get( 'service.Binding' );
|
| 33 |
+
$headers_arr[ ] = "X-PAYPAL-RESPONSE-DATA-FORMAT: " . $config->get( 'service.Binding' );
|
| 34 |
+
$headers_arr[ ] = "X-PAYPAL-DEVICE-IPADDRESS: " . PPUtils::getLocalIPAddress();
|
| 35 |
+
$headers_arr[ ] = "X-PAYPAL-REQUEST-SOURCE: " . PPUtils::getRequestSource();
|
| 36 |
+
|
| 37 |
+
return $headers_arr;
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
public function appendSoapHeader( $payLoad, $apiCred, $connection, $accessToken = null, $tokenSecret = null, $url = null )
|
| 41 |
+
{
|
| 42 |
+
$soapHeader = "<soapenv:Envelope xmlns:soapenv=\"http://schemas.xmlsoap.org/soap/envelope/\" xmlns:urn=\"urn:ebay:api:PayPalAPI\" xmlns:ebl=\"urn:ebay:apis:eBLBaseComponents\" xmlns:cc=\"urn:ebay:apis:CoreComponentTypes\" xmlns:ed=\"urn:ebay:apis:EnhancedDataTypes\">";
|
| 43 |
+
|
| 44 |
+
if ( isset( $accessToken ) && isset( $tokenSecret ) ) {
|
| 45 |
+
$soapHeader .= "<soapenv:Header>";
|
| 46 |
+
$soapHeader .= "<urn:RequesterCredentials/>";
|
| 47 |
+
$soapHeader .= "</soapenv:Header>";
|
| 48 |
+
} else if ( $apiCred instanceof PPSignatureCredential ) {
|
| 49 |
+
$soapHeader .= "<soapenv:Header>";
|
| 50 |
+
$soapHeader .= "<urn:RequesterCredentials>";
|
| 51 |
+
$soapHeader .= "<ebl:Credentials>";
|
| 52 |
+
$soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
|
| 53 |
+
$soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
|
| 54 |
+
$soapHeader .= "<ebl:Signature>" . $apiCred->getSignature() . "</ebl:Signature>";
|
| 55 |
+
$subject = $apiCred->getSubject();
|
| 56 |
+
if ( isset( $subject ) && $subject != "" ) {
|
| 57 |
+
$soapHeader .= "<ebl:Subject>" . $apiCred->getSubject() . "</ebl:Subject>";
|
| 58 |
+
}
|
| 59 |
+
$soapHeader .= "</ebl:Credentials>";
|
| 60 |
+
$soapHeader .= "</urn:RequesterCredentials>";
|
| 61 |
+
$soapHeader .= "</soapenv:Header>";
|
| 62 |
+
} else if ( $apiCred instanceof PPCertificateCredential ) {
|
| 63 |
+
$soapHeader .= "<soapenv:Header>";
|
| 64 |
+
$soapHeader .= "<urn:RequesterCredentials>";
|
| 65 |
+
$soapHeader .= "<ebl:Credentials>";
|
| 66 |
+
$soapHeader .= "<ebl:Username>" . $apiCred->getUserName() . "</ebl:Username>";
|
| 67 |
+
$soapHeader .= "<ebl:Password>" . $apiCred->getPassword() . "</ebl:Password>";
|
| 68 |
+
$subject = $apiCred->getSubject();
|
| 69 |
+
if ( isset( $subject ) && $subject != "" ) {
|
| 70 |
+
$soapHeader .= "<ebl:Subject>" . $apiCred->getSubject() . "</ebl:Subject>";
|
| 71 |
+
}
|
| 72 |
+
$soapHeader .= "</ebl:Credentials>";
|
| 73 |
+
$soapHeader .= "</urn:RequesterCredentials>";
|
| 74 |
+
$soapHeader .= "</soapenv:Header>";
|
| 75 |
+
$connection->setSSLCert( $apiCred->getCertificatePath(), $apiCred->getPassPhrase() );
|
| 76 |
+
}
|
| 77 |
+
$soapHeader .= "<soapenv:Body>";
|
| 78 |
+
$soapHeader .= $payLoad;
|
| 79 |
+
$soapHeader .= "</soapenv:Body>";
|
| 80 |
+
$soapHeader .= "</soapenv:Envelope>";
|
| 81 |
+
|
| 82 |
+
return $soapHeader;
|
| 83 |
+
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
private function generateAuthString( $apiCred, $accessToken, $tokenSecret, $endpoint )
|
| 87 |
+
{
|
| 88 |
+
$key = $apiCred->getUserName();
|
| 89 |
+
$secret = $apiCred->getPassword();
|
| 90 |
+
$auth = new AuthSignature();
|
| 91 |
+
$response = $auth->genSign( $key, $secret, $accessToken, $tokenSecret, 'POST', $endpoint );
|
| 92 |
+
$authString = "token=" . $accessToken . ",signature=" . $response[ 'oauth_signature' ] . ",timestamp=" . $response[ 'oauth_timestamp' ];
|
| 93 |
+
|
| 94 |
+
return $authString;
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPBaseService.php
ADDED
|
@@ -0,0 +1,88 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPAPIService.php';
|
| 3 |
+
|
| 4 |
+
|
| 5 |
+
class PPBaseService
|
| 6 |
+
{
|
| 7 |
+
|
| 8 |
+
private $serviceName;
|
| 9 |
+
|
| 10 |
+
/*
|
| 11 |
+
* Setters and getters for Third party authentication (Permission Services)
|
| 12 |
+
*/
|
| 13 |
+
protected $accessToken;
|
| 14 |
+
protected $tokenSecret;
|
| 15 |
+
protected $lastRequest;
|
| 16 |
+
protected $lastResponse;
|
| 17 |
+
|
| 18 |
+
public function getLastRequest()
|
| 19 |
+
{
|
| 20 |
+
return $this->lastRequest;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
public function setLastRequest( $lastRqst )
|
| 24 |
+
{
|
| 25 |
+
$this->lastRequest = $lastRqst;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
public function getLastResponse()
|
| 29 |
+
{
|
| 30 |
+
return $this->lastResponse;
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
public function setLastResponse( $lastRspns )
|
| 34 |
+
{
|
| 35 |
+
$this->lastResponse = $lastRspns;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
public function getAccessToken()
|
| 39 |
+
{
|
| 40 |
+
return $this->accessToken;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
public function setAccessToken( $accessToken )
|
| 44 |
+
{
|
| 45 |
+
$this->accessToken = $accessToken;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
public function getTokenSecret()
|
| 49 |
+
{
|
| 50 |
+
return $this->tokenSecret;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
public function setTokenSecret( $tokenSecret )
|
| 54 |
+
{
|
| 55 |
+
$this->tokenSecret = $tokenSecret;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
public function __construct( $serviceName )
|
| 59 |
+
{
|
| 60 |
+
$this->serviceName = $serviceName;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
public function getServiceName()
|
| 64 |
+
{
|
| 65 |
+
return $this->serviceName;
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
public function call( $method, $requestObject, $apiUsername = null )
|
| 69 |
+
{
|
| 70 |
+
$params = $this->marshall( $requestObject );
|
| 71 |
+
$service = new PPAPIService();
|
| 72 |
+
$service->setServiceName( $this->serviceName );
|
| 73 |
+
|
| 74 |
+
$this->lastRequest = $params;
|
| 75 |
+
$this->lastResponse = $service->makeRequest( $method, $params, $apiUsername, $this->accessToken, $this->tokenSecret );
|
| 76 |
+
|
| 77 |
+
return $this->lastResponse;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
private function marshall( $object )
|
| 81 |
+
{
|
| 82 |
+
$transformer = new PPObjectTransformer();
|
| 83 |
+
|
| 84 |
+
return $transformer->toString( $object );
|
| 85 |
+
}
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPCertificateCredential.php
ADDED
|
@@ -0,0 +1,77 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'exceptions/PPMissingCredentialException.php';
|
| 5 |
+
|
| 6 |
+
class PPCertificateCredential extends IPPCredential
|
| 7 |
+
{
|
| 8 |
+
|
| 9 |
+
private $certificatePath;
|
| 10 |
+
private $passPhrase;
|
| 11 |
+
private $subject;
|
| 12 |
+
|
| 13 |
+
public function __construct( $userName, $password, $certPath, $appId, $passPhrase, $subject )
|
| 14 |
+
{
|
| 15 |
+
parent::__construct( $userName, $password, $appId );
|
| 16 |
+
$this->certificatePath = $certPath;
|
| 17 |
+
$this->passPhrase = $passPhrase;
|
| 18 |
+
$this->subject = $subject;
|
| 19 |
+
$this->validate();
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
public function validate()
|
| 23 |
+
{
|
| 24 |
+
|
| 25 |
+
if ( $this->userName == null || $this->userName == "" ) {
|
| 26 |
+
throw new PPMissingCredentialException( "username cannot be empty" );
|
| 27 |
+
}
|
| 28 |
+
if ( $this->password == null || $this->password == "" ) {
|
| 29 |
+
throw new PPMissingCredentialException( "password cannot be empty" );
|
| 30 |
+
}
|
| 31 |
+
if ( $this->certificatePath == null || $this->certificatePath == "" ) {
|
| 32 |
+
throw new PPMissingCredentialException( "certificate cannot be empty" );
|
| 33 |
+
}
|
| 34 |
+
if ( $this->passPhrase == null || $this->passPhrase == "" ) {
|
| 35 |
+
throw new PPMissingCredentialException( "passphrase cannot be empty" );
|
| 36 |
+
}
|
| 37 |
+
if ( $this->applicationId == null || $this->applicationId == "" ) {
|
| 38 |
+
throw new PPMissingCredentialException( "applicationId cannot be empty" );
|
| 39 |
+
}
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
public function getUserName()
|
| 43 |
+
{
|
| 44 |
+
return $this->userName;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
public function getPassword()
|
| 48 |
+
{
|
| 49 |
+
return $this->password;
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
public function getCertificatePath()
|
| 53 |
+
{
|
| 54 |
+
if ( realpath( $this->certificatePath ) ) {
|
| 55 |
+
return realpath( $this->certificatePath );
|
| 56 |
+
} else {
|
| 57 |
+
return realpath( dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".." . DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . $this->certificatePath );
|
| 58 |
+
}
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
public function getPassPhrase()
|
| 62 |
+
{
|
| 63 |
+
return $this->passPhrase;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
public function getApplicationId()
|
| 67 |
+
{
|
| 68 |
+
return $this->applicationId;
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
public function getSubject()
|
| 72 |
+
{
|
| 73 |
+
return $this->subject;
|
| 74 |
+
}
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPConfigManager.php
ADDED
|
@@ -0,0 +1,121 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* PPConfigManager loads the SDK configuration file and
|
| 4 |
+
* hands out appropriate config params to other classes
|
| 5 |
+
*/
|
| 6 |
+
require_once 'exceptions/PPConfigurationException.php';
|
| 7 |
+
|
| 8 |
+
class PPConfigManager
|
| 9 |
+
{
|
| 10 |
+
|
| 11 |
+
private $config;
|
| 12 |
+
/**
|
| 13 |
+
* @var PPConfigManager
|
| 14 |
+
*/
|
| 15 |
+
private static $instance;
|
| 16 |
+
|
| 17 |
+
private function __construct()
|
| 18 |
+
{
|
| 19 |
+
$configFile = dirname( __FILE__ ) . DIRECTORY_SEPARATOR . ".."
|
| 20 |
+
. DIRECTORY_SEPARATOR . "config" . DIRECTORY_SEPARATOR . "sdk_config.ini";
|
| 21 |
+
$this->load( $configFile );
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
// create singleton object for PPConfigManager
|
| 25 |
+
public static function getInstance()
|
| 26 |
+
{
|
| 27 |
+
if ( !isset( self::$instance ) ) {
|
| 28 |
+
self::$instance = new PPConfigManager();
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
return self::$instance;
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
//used to load the file
|
| 35 |
+
private function load( $fileName )
|
| 36 |
+
{
|
| 37 |
+
if ( class_exists( 'Woocommerce' ) ) {
|
| 38 |
+
global $woocommerce;
|
| 39 |
+
$gateways = $woocommerce->payment_gateways->payment_gateways();
|
| 40 |
+
$settings = $gateways[ 'paypalap' ]->settings;
|
| 41 |
+
$mode = $settings[ 'sandbox_enabled' ];
|
| 42 |
+
|
| 43 |
+
$this->config = array(
|
| 44 |
+
'acct1.UserName' => $mode == 'yes' ? $settings[ 'username' ] : $settings[ 'username_live' ],
|
| 45 |
+
'acct1.Password' => $mode == 'yes' ? $settings[ 'password' ] : $settings[ 'password_live' ],
|
| 46 |
+
'acct1.Signature' => $mode == 'yes' ? $settings[ 'signature' ] : $settings[ 'signature_live' ],
|
| 47 |
+
'acct1.AppId' => $mode == 'yes' ? 'APP-80W284485P519543T' : $settings[ 'app_id' ],
|
| 48 |
+
|
| 49 |
+
'service.Binding' => 'SOAP',
|
| 50 |
+
'service.EndPoint' => $mode == 'yes' ? 'https://api-3t.sandbox.paypal.com/2.0/' : 'https://api-3t.paypal.com/2.0/',
|
| 51 |
+
'service.RedirectURL' => $mode == 'yes' ? 'https://sandbox.paypal.com/webscr&cmd=' : 'https://paypal.com/webscr&cmd=',
|
| 52 |
+
'service.DevCentralURL' => 'https://developer.paypal.com',
|
| 53 |
+
'http.ConnectionTimeOut' => '10',
|
| 54 |
+
'http.Retry' => '5',
|
| 55 |
+
'log.FileName' => 'PayPal.log',
|
| 56 |
+
'log.LogLevel' => 'INFO',
|
| 57 |
+
'log.LogEnabled' => $settings[ 'logging_enabled' ] == 'yes' ? 'true' : 'false',
|
| 58 |
+
);
|
| 59 |
+
} else {
|
| 60 |
+
$this->config = @parse_ini_file( $fileName );
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
if ( $this->config == null || count( $this->config ) == 0 ) {
|
| 64 |
+
throw new PPConfigurationException( "Config file $fileName not found", "303" );
|
| 65 |
+
}
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* simple getter for configuration params
|
| 70 |
+
* If an exact match for key is not found,
|
| 71 |
+
* does a "contains" search on the key
|
| 72 |
+
*/
|
| 73 |
+
public function get( $searchKey )
|
| 74 |
+
{
|
| 75 |
+
|
| 76 |
+
if ( array_key_exists( $searchKey, $this->config ) ) {
|
| 77 |
+
return $this->config[ $searchKey ];
|
| 78 |
+
} else {
|
| 79 |
+
$arr = array();
|
| 80 |
+
foreach ( $this->config as $k => $v ) {
|
| 81 |
+
if ( strstr( $k, $searchKey ) ) {
|
| 82 |
+
$arr[ $k ] = $v;
|
| 83 |
+
}
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
return $arr;
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
/**
|
| 92 |
+
* Utility method for handling account configuration
|
| 93 |
+
* return config key corresponding to the API userId passed in
|
| 94 |
+
*
|
| 95 |
+
* If $userId is null, returns config keys corresponding to
|
| 96 |
+
* all configured accounts
|
| 97 |
+
*/
|
| 98 |
+
public function getIniPrefix( $userId = null )
|
| 99 |
+
{
|
| 100 |
+
|
| 101 |
+
if ( $userId == null ) {
|
| 102 |
+
$arr = array();
|
| 103 |
+
foreach ( $this->config as $key => $value ) {
|
| 104 |
+
$pos = strpos( $key, '.' );
|
| 105 |
+
if ( strstr( $key, "acct" ) ) {
|
| 106 |
+
$arr[ ] = substr( $key, 0, $pos );
|
| 107 |
+
}
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
return array_unique( $arr );
|
| 111 |
+
} else {
|
| 112 |
+
$iniPrefix = array_search( $userId, $this->config );
|
| 113 |
+
$pos = strpos( $iniPrefix, '.' );
|
| 114 |
+
$acct = substr( $iniPrefix, 0, $pos );
|
| 115 |
+
|
| 116 |
+
return $acct;
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPConnectionManager.php
ADDED
|
@@ -0,0 +1,48 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'PPHttpConnection.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
class PPConnectionManager
|
| 5 |
+
{
|
| 6 |
+
/**
|
| 7 |
+
* reference to singleton instance
|
| 8 |
+
* @var PPConnectionManager
|
| 9 |
+
*/
|
| 10 |
+
private static $instance;
|
| 11 |
+
|
| 12 |
+
private function __construct()
|
| 13 |
+
{
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
public static function getInstance()
|
| 17 |
+
{
|
| 18 |
+
if ( self::$instance == null ) {
|
| 19 |
+
self::$instance = new PPConnectionManager();
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
return self::$instance;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
/**
|
| 26 |
+
* This function returns a new PPHttpConnection object
|
| 27 |
+
*/
|
| 28 |
+
public function getConnection()
|
| 29 |
+
{
|
| 30 |
+
|
| 31 |
+
$connection = new PPHttpConnection();
|
| 32 |
+
|
| 33 |
+
$configMgr = PPConfigManager::getInstance();
|
| 34 |
+
if ( ( $configMgr->get( "http.ConnectionTimeOut" ) ) ) {
|
| 35 |
+
$connection->setHttpTimeout( $configMgr->get( "http.ConnectionTimeOut" ) );
|
| 36 |
+
}
|
| 37 |
+
if ( $configMgr->get( "http.Proxy" ) ) {
|
| 38 |
+
$connection->setHttpProxy( $configMgr->get( "http.Proxy" ) );
|
| 39 |
+
}
|
| 40 |
+
if ( $configMgr->get( "http.Retry" ) ) {
|
| 41 |
+
$retry = $configMgr->get( "http.Retry" );
|
| 42 |
+
$connection->setHttpRetry( $retry );
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
return $connection;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
}
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPCredentialManager.php
ADDED
|
@@ -0,0 +1,119 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
require_once 'IPPCredential.php';
|
| 3 |
+
require_once 'PPConfigManager.php';
|
| 4 |
+
require_once 'PPSignatureCredential.php';
|
| 5 |
+
require_once 'PPCertificateCredential.php';
|
| 6 |
+
require_once 'exceptions/PPInvalidCredentialException.php';
|
| 7 |
+
|
| 8 |
+
class PPCredentialManager
|
| 9 |
+
{
|
| 10 |
+
|
| 11 |
+
private static $instance;
|
| 12 |
+
//hashmap to contain credentials for accounts.
|
| 13 |
+
private $credentialHashmap = array();
|
| 14 |
+
/**
|
| 15 |
+
* Contains the API username of the default account to use
|
| 16 |
+
* when authenticating API calls.
|
| 17 |
+
* @var string
|
| 18 |
+
*/
|
| 19 |
+
private $defaultAccountName;
|
| 20 |
+
|
| 21 |
+
/*
|
| 22 |
+
* Constructor initialize credential for multiple accounts specified in property file.
|
| 23 |
+
*/
|
| 24 |
+
private function __construct()
|
| 25 |
+
{
|
| 26 |
+
try {
|
| 27 |
+
$this->initCredential();
|
| 28 |
+
} catch ( Exception $e ) {
|
| 29 |
+
$this->credentialHashmap = array();
|
| 30 |
+
throw $e;
|
| 31 |
+
}
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
/*
|
| 35 |
+
* Create singleton instance for this class.
|
| 36 |
+
*/
|
| 37 |
+
public static function getInstance()
|
| 38 |
+
{
|
| 39 |
+
if ( !isset( self::$instance ) ) {
|
| 40 |
+
self::$instance = new PPCredentialManager();
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
return self::$instance;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
/*
|
| 47 |
+
* Load credentials for multiple accounts, with priority given to Signature credential.
|
| 48 |
+
*/
|
| 49 |
+
private function initCredential()
|
| 50 |
+
{
|
| 51 |
+
$configMgr = PPConfigManager::getInstance();
|
| 52 |
+
$suffix = 1;
|
| 53 |
+
$prefix = "acct";
|
| 54 |
+
|
| 55 |
+
$credArr = $configMgr->get( $prefix );
|
| 56 |
+
$arrayPartKeys = $configMgr->getIniPrefix();
|
| 57 |
+
if ( count( $arrayPartKeys ) == 0 )
|
| 58 |
+
throw new MissingCredentialException( "No valid API accounts have been configured" );
|
| 59 |
+
|
| 60 |
+
while ( in_array( $prefix . $suffix, $arrayPartKeys ) ) {
|
| 61 |
+
|
| 62 |
+
if ( isset( $credArr[ $prefix . $suffix . ".Signature" ] )
|
| 63 |
+
&& $credArr[ $prefix . $suffix . ".Signature" ] != null && $credArr[ $prefix . $suffix . ".Signature" ] != ""
|
| 64 |
+
) {
|
| 65 |
+
|
| 66 |
+
$userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
|
| 67 |
+
$password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
|
| 68 |
+
$signature = isset( $credArr[ $prefix . $suffix . '.Signature' ] ) ? $credArr[ $prefix . $suffix . '.Signature' ] : "";
|
| 69 |
+
$appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
|
| 70 |
+
$subject = isset( $credArr[ $prefix . $suffix . '.Subject' ] ) ? $credArr[ $prefix . $suffix . '.Subject' ] : "";
|
| 71 |
+
$this->credentialHashmap[ $userName ] = new PPSignatureCredential( $userName, $password, $signature, $appId, $subject );
|
| 72 |
+
|
| 73 |
+
} elseif ( isset( $credArr[ $prefix . $suffix . ".CertPath" ] )
|
| 74 |
+
&& $credArr[ $prefix . $suffix . ".CertPath" ] != null && $credArr[ $prefix . $suffix . ".CertPath" ] != ""
|
| 75 |
+
) {
|
| 76 |
+
|
| 77 |
+
$userName = isset( $credArr[ $prefix . $suffix . '.UserName' ] ) ? $credArr[ $prefix . $suffix . '.UserName' ] : "";
|
| 78 |
+
$password = isset( $credArr[ $prefix . $suffix . '.Password' ] ) ? $credArr[ $prefix . $suffix . '.Password' ] : "";
|
| 79 |
+
$passPhrase = isset( $credArr[ $prefix . $suffix . '.CertKey' ] ) ? $credArr[ $prefix . $suffix . '.CertKey' ] : "";
|
| 80 |
+
$certPath = isset( $credArr[ $prefix . $suffix . '.CertPath' ] ) ? $credArr[ $prefix . $suffix . '.CertPath' ] : "";
|
| 81 |
+
$appId = isset( $credArr[ $prefix . $suffix . '.AppId' ] ) ? $credArr[ $prefix . $suffix . '.AppId' ] : "";
|
| 82 |
+
$subject = isset( $credArr[ $prefix . $suffix . '.Subject' ] ) ? $credArr[ $prefix . $suffix . '.Subject' ] : "";
|
| 83 |
+
$this->credentialHashmap[ $userName ] = new PPCertificateCredential( $userName, $password, $certPath, $appId, $passPhrase, $subject );
|
| 84 |
+
|
| 85 |
+
}
|
| 86 |
+
if ( $this->defaultAccountName == null )
|
| 87 |
+
$this->defaultAccountName = $credArr[ $prefix . $suffix . '.UserName' ];
|
| 88 |
+
$suffix++;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
/*
|
| 94 |
+
* Obtain Credential Object based on UserId provided.
|
| 95 |
+
*/
|
| 96 |
+
public function getCredentialObject( $userId = null )
|
| 97 |
+
{
|
| 98 |
+
|
| 99 |
+
if ( $userId == null )
|
| 100 |
+
$credObj = $this->credentialHashmap[ $this->defaultAccountName ];
|
| 101 |
+
else if ( array_key_exists( $userId, $this->credentialHashmap ) )
|
| 102 |
+
$credObj = $this->credentialHashmap[ $userId ];
|
| 103 |
+
|
| 104 |
+
if ( empty( $credObj ) ) {
|
| 105 |
+
throw new PPInvalidCredentialException( "Invalid userId $userId" );
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
return $credObj;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
public function __clone()
|
| 113 |
+
{
|
| 114 |
+
trigger_error( 'Clone is not allowed.', E_USER_ERROR );
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
}
|
| 118 |
+
|
| 119 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPHttpConnection.php
ADDED
|
@@ -0,0 +1,184 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
require_once 'exceptions/PPConnectionException.php';
|
| 4 |
+
require_once 'exceptions/PPConfigurationException.php';
|
| 5 |
+
require_once 'PPLoggingManager.php';
|
| 6 |
+
/**
|
| 7 |
+
* A wrapper class based on the curl extension.
|
| 8 |
+
* Requires the PHP curl module to be enabled.
|
| 9 |
+
* See for full requirements the PHP manual: http://php.net/curl
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
class PPHttpConnection
|
| 14 |
+
{
|
| 15 |
+
|
| 16 |
+
const HTTP_GET = 'GET';
|
| 17 |
+
const HTTP_POST = 'POST';
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* curl options to be set for the request
|
| 21 |
+
*/
|
| 22 |
+
private $curlOpt = array();
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Number of times a retry must be attempted on getting an HTTP error
|
| 26 |
+
* @var integer
|
| 27 |
+
*/
|
| 28 |
+
private $retry;
|
| 29 |
+
|
| 30 |
+
/**
|
| 31 |
+
* HTTP status codes for which a retry must be attempted
|
| 32 |
+
*/
|
| 33 |
+
private static $retryCodes = array( '401', '403', '404', );
|
| 34 |
+
|
| 35 |
+
private $logger;
|
| 36 |
+
|
| 37 |
+
|
| 38 |
+
/**
|
| 39 |
+
* Some default options for curl
|
| 40 |
+
* These are typically overridden by PPConnectionManager
|
| 41 |
+
*/
|
| 42 |
+
public static $DEFAULT_CURL_OPTS = array(
|
| 43 |
+
CURLOPT_CONNECTTIMEOUT => 10,
|
| 44 |
+
CURLOPT_RETURNTRANSFER => true,
|
| 45 |
+
CURLOPT_TIMEOUT => 60, // maximum number of seconds to allow cURL functions to execute
|
| 46 |
+
CURLOPT_USERAGENT => 'PayPal-PHP-SDK',
|
| 47 |
+
CURLOPT_POST => 1,
|
| 48 |
+
CURLOPT_HTTPHEADER => array(),
|
| 49 |
+
CURLOPT_SSL_VERIFYHOST => 1,
|
| 50 |
+
CURLOPT_SSL_VERIFYPEER => 2
|
| 51 |
+
);
|
| 52 |
+
|
| 53 |
+
public function __construct()
|
| 54 |
+
{
|
| 55 |
+
if ( !function_exists( "curl_init" ) ) {
|
| 56 |
+
throw new PPConfigurationException( "Curl module is not available on this system" );
|
| 57 |
+
}
|
| 58 |
+
$this->curlOpt = self::$DEFAULT_CURL_OPTS;
|
| 59 |
+
$this->logger = new PPLoggingManager( __CLASS__ );
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
/**
|
| 63 |
+
* Set ssl parameters for certificate based client authentication
|
| 64 |
+
*
|
| 65 |
+
* @param string $certPath - path to client certificate file (PEM formatted file)
|
| 66 |
+
*/
|
| 67 |
+
public function setSSLCert( $certPath, $passPhrase )
|
| 68 |
+
{
|
| 69 |
+
$this->curlOpt[ CURLOPT_SSLCERT ] = realpath( $certPath );
|
| 70 |
+
$this->curlOpt[ CURLOPT_SSLCERTPASSWD ] = $passPhrase;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
/**
|
| 74 |
+
* Set connection timeout in seconds
|
| 75 |
+
*
|
| 76 |
+
* @param integer $timeout
|
| 77 |
+
*/
|
| 78 |
+
public function setHttpTimeout( $timeout )
|
| 79 |
+
{
|
| 80 |
+
$this->curlOpt[ CURLOPT_CONNECTTIMEOUT ] = $timeout;
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
/**
|
| 84 |
+
* Set HTTP proxy information
|
| 85 |
+
*
|
| 86 |
+
* @param string $proxy
|
| 87 |
+
*
|
| 88 |
+
* @throws PPConfigurationException
|
| 89 |
+
*/
|
| 90 |
+
public function setHttpProxy( $proxy )
|
| 91 |
+
{
|
| 92 |
+
$urlParts = parse_url( $proxy );
|
| 93 |
+
if ( $urlParts == false || !array_key_exists( "host", $urlParts ) )
|
| 94 |
+
throw new PPConfigurationException( "Invalid proxy configuration " . $proxy );
|
| 95 |
+
|
| 96 |
+
$this->curlOpt[ CURLOPT_PROXY ] = $urlParts[ "host" ];
|
| 97 |
+
if ( isset( $urlParts[ "port" ] ) )
|
| 98 |
+
$this->curlOpt[ CURLOPT_PROXY ] .= ":" . $urlParts[ "port" ];
|
| 99 |
+
if ( isset( $urlParts[ "user" ] ) )
|
| 100 |
+
$this->curlOpt[ URLOPT_PROXYUSERPWD ] = $urlParts[ "user" ] . ":" . $urlParts[ "pass" ];
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
public function setHttpHeaders( $headers )
|
| 104 |
+
{
|
| 105 |
+
$this->curlOpt[ CURLOPT_HTTPHEADER ] = $headers;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
/**
|
| 109 |
+
* @param integer $retry
|
| 110 |
+
*/
|
| 111 |
+
public function setHttpRetry( $retry )
|
| 112 |
+
{
|
| 113 |
+
$this->retry = $retry;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
/**
|
| 117 |
+
* Executes an HTTP request
|
| 118 |
+
*
|
| 119 |
+
* @param string $url
|
| 120 |
+
* @param string $params query string OR POST content as a string
|
| 121 |
+
* @param array $headers array of HTTP headers to be added to existing headers
|
| 122 |
+
* @param string $method HTTP method (GET, POST etc) defaults to POST
|
| 123 |
+
*
|
| 124 |
+
* @throws PPConnectionException
|
| 125 |
+
*/
|
| 126 |
+
public function execute( $url, $params, $headers = null, $method = null )
|
| 127 |
+
{
|
| 128 |
+
|
| 129 |
+
$ch = curl_init( $url );
|
| 130 |
+
|
| 131 |
+
$this->curlOpt[ CURLOPT_POSTFIELDS ] = $params;
|
| 132 |
+
$this->curlOpt[ CURLOPT_URL ] = $url;
|
| 133 |
+
$this->curlOpt[ CURLOPT_HEADER ] = false;
|
| 134 |
+
if ( isset( $headers ) ) {
|
| 135 |
+
$this->curlOpt[ CURLOPT_HTTPHEADER ] = array_merge( $this->curlOpt[ CURLOPT_HTTPHEADER ], $headers );
|
| 136 |
+
}
|
| 137 |
+
foreach ( $this->curlOpt[ CURLOPT_HTTPHEADER ] as $header ) {
|
| 138 |
+
//TODO: Strip out credentials when logging.
|
| 139 |
+
$this->logger->info( "Adding header $header" );
|
| 140 |
+
}
|
| 141 |
+
if ( isset( $method ) ) {
|
| 142 |
+
$this->curlOpt[ CURLOPT_CUSTOMREQUEST ] = $method;
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
// curl_setopt_array available only in PHP 5 >= 5.1.3
|
| 146 |
+
curl_setopt_array( $ch, $this->curlOpt );
|
| 147 |
+
|
| 148 |
+
$result = curl_exec( $ch );
|
| 149 |
+
|
| 150 |
+
if ( curl_errno( $ch ) == 60 ) {
|
| 151 |
+
$this->logger->info( "Invalid or no certificate authority found, retrying using bundled CA certs" );
|
| 152 |
+
curl_setopt( $ch, CURLOPT_CAINFO,
|
| 153 |
+
dirname( __FILE__ ) . '/cacert.pem' );
|
| 154 |
+
$result = curl_exec( $ch );
|
| 155 |
+
}
|
| 156 |
+
$httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
|
| 157 |
+
$retries = 0;
|
| 158 |
+
if ( in_array( $httpStatus, self::$retryCodes ) && isset( $this->retry ) ) {
|
| 159 |
+
$this->logger->info( "Got $httpStatus response from server. Retrying" );
|
| 160 |
+
|
| 161 |
+
do {
|
| 162 |
+
$result = curl_exec( $ch );
|
| 163 |
+
$httpStatus = curl_getinfo( $ch, CURLINFO_HTTP_CODE );
|
| 164 |
+
|
| 165 |
+
} while ( in_array( $httpStatus, self::$retryCodes ) && ++$retries < $this->retry );
|
| 166 |
+
|
| 167 |
+
|
| 168 |
+
}
|
| 169 |
+
if ( curl_errno( $ch ) ) {
|
| 170 |
+
$ex = new PPConnectionException( $url, curl_error( $ch ), curl_errno( $ch ) );
|
| 171 |
+
curl_close( $ch );
|
| 172 |
+
throw $ex;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
curl_close( $ch );
|
| 176 |
+
|
| 177 |
+
if ( in_array( $httpStatus, self::$retryCodes ) ) {
|
| 178 |
+
throw new PPConnectionException( $url, "Retried " . $retries . " times, Http Response code " . $httpStatus );
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
return $result;
|
| 182 |
+
}
|
| 183 |
+
|
| 184 |
+
}
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPLoggingManager.php
ADDED
|
@@ -0,0 +1,84 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Simple Logging Manager.
|
| 5 |
+
* This does an error_log for now
|
| 6 |
+
* Potential frameworks to use are PEAR logger, log4php from Apache
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
class PPLoggingLevel
|
| 10 |
+
{
|
| 11 |
+
|
| 12 |
+
// FINE Logging Level
|
| 13 |
+
const FINE = 3;
|
| 14 |
+
|
| 15 |
+
// INFO Logging Level
|
| 16 |
+
const INFO = 2;
|
| 17 |
+
|
| 18 |
+
// WARN Logging Level
|
| 19 |
+
const WARN = 1;
|
| 20 |
+
|
| 21 |
+
// ERROR Logging Level
|
| 22 |
+
const ERROR = 0;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
class PPLoggingManager
|
| 26 |
+
{
|
| 27 |
+
|
| 28 |
+
// Default Logging Level
|
| 29 |
+
const DEFAULT_LOGGING_LEVEL = 0;
|
| 30 |
+
|
| 31 |
+
// Logger name
|
| 32 |
+
private $loggerName;
|
| 33 |
+
|
| 34 |
+
// Log enabled
|
| 35 |
+
private $isLoggingEnabled;
|
| 36 |
+
|
| 37 |
+
// Configured logging level
|
| 38 |
+
private $loggingLevel;
|
| 39 |
+
|
| 40 |
+
// Configured logging file
|
| 41 |
+
private $loggerFile;
|
| 42 |
+
|
| 43 |
+
public function __construct( $loggerName )
|
| 44 |
+
{
|
| 45 |
+
$this->loggerName = $loggerName;
|
| 46 |
+
$config = PPConfigManager::getInstance();
|
| 47 |
+
$this->loggerFile = ( $config->get( 'log.FileName' ) ) ? $config->get( 'log.FileName' ) : ini_get( 'error_log' );
|
| 48 |
+
$loggingEnabled = $config->get( 'log.LogEnabled' );
|
| 49 |
+
$this->isLoggingEnabled = ( isset( $loggingEnabled ) ) ? $loggingEnabled : false;
|
| 50 |
+
$loggingLevel = strtoupper( $config->get( 'log.LogLevel' ) );
|
| 51 |
+
$this->loggingLevel = ( isset( $loggingLevel ) && defined( "PPLoggingLevel::$loggingLevel" ) ) ? constant( "PPLoggingLevel::$loggingLevel" ) : PPLoggingManager::DEFAULT_LOGGING_LEVEL;
|
| 52 |
+
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
public function log( $message, $level = PPLoggingLevel::INFO )
|
| 56 |
+
{
|
| 57 |
+
if ( $this->isLoggingEnabled && ( $level <= $this->loggingLevel ) ) {
|
| 58 |
+
error_log( $this->loggerName . ": $message\n", 3, $this->loggerFile );
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
public function error( $message )
|
| 63 |
+
{
|
| 64 |
+
$this->log( $message, PPLoggingLevel::ERROR );
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
public function warning( $message )
|
| 68 |
+
{
|
| 69 |
+
$this->log( $message, PPLoggingLevel::WARN );
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
public function info( $message )
|
| 73 |
+
{
|
| 74 |
+
$this->log( $message, PPLoggingLevel::INFO );
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
public function fine( $message )
|
| 78 |
+
{
|
| 79 |
+
$this->log( $message, PPLoggingLevel::FINE );
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPObjectTransformer.php
ADDED
|
@@ -0,0 +1,33 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Utility class for transforming PHP objects into
|
| 4 |
+
* appropriate service payload type and vice versa
|
| 5 |
+
*/
|
| 6 |
+
class PPObjectTransformer
|
| 7 |
+
{
|
| 8 |
+
|
| 9 |
+
public function toString( $object )
|
| 10 |
+
{
|
| 11 |
+
|
| 12 |
+
if ( $object == null ) {
|
| 13 |
+
throw new PPTransformerException( "Empty object" );
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
$confManager = PPConfigManager::getInstance();
|
| 17 |
+
switch ( strtoupper( $confManager->get( "service.Binding" ) ) ) {
|
| 18 |
+
case 'SOAP':
|
| 19 |
+
return $object->toXMLString();
|
| 20 |
+
|
| 21 |
+
case 'XML':
|
| 22 |
+
case 'JSON':
|
| 23 |
+
return "";
|
| 24 |
+
case 'NVP':
|
| 25 |
+
default:
|
| 26 |
+
return $object->toNVPString();
|
| 27 |
+
}
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPSignatureCredential.php
ADDED
|
@@ -0,0 +1,56 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
require_once 'exceptions/PPMissingCredentialException.php';
|
| 4 |
+
require_once 'IPPCredential.php';
|
| 5 |
+
require_once 'PPConfigManager.php';
|
| 6 |
+
|
| 7 |
+
/**
|
| 8 |
+
* API signature based credentials
|
| 9 |
+
*/
|
| 10 |
+
class PPSignatureCredential extends IPPCredential
|
| 11 |
+
{
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* API Signature
|
| 15 |
+
* @var string
|
| 16 |
+
*/
|
| 17 |
+
private $signature;
|
| 18 |
+
private $subject;
|
| 19 |
+
|
| 20 |
+
public function __construct( $userName, $password, $signature, $appId, $subject )
|
| 21 |
+
{
|
| 22 |
+
parent::__construct( $userName, $password, $appId );
|
| 23 |
+
$this->signature = $signature;
|
| 24 |
+
$this->subject = $subject;
|
| 25 |
+
$this->validate();
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
public function validate()
|
| 29 |
+
{
|
| 30 |
+
|
| 31 |
+
if ( $this->userName == null || $this->userName == "" ) {
|
| 32 |
+
throw new PPMissingCredentialException( "username cannot be empty" );
|
| 33 |
+
}
|
| 34 |
+
if ( $this->password == null || $this->password == "" ) {
|
| 35 |
+
throw new PPMissingCredentialException( "password cannot be empty" );
|
| 36 |
+
}
|
| 37 |
+
if ( $this->signature == null || $this->signature == "" ) {
|
| 38 |
+
throw new PPMissingCredentialException( "signature cannot be empty" );
|
| 39 |
+
}
|
| 40 |
+
if ( $this->applicationId == null || $this->applicationId == "" ) {
|
| 41 |
+
throw new PPMissingCredentialException( "applicationId cannot be empty" );
|
| 42 |
+
}
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
public function getSignature()
|
| 46 |
+
{
|
| 47 |
+
return $this->signature;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
public function getSubject()
|
| 51 |
+
{
|
| 52 |
+
return $this->subject;
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/PPUtils.php
ADDED
|
@@ -0,0 +1,284 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class PPUtils
|
| 3 |
+
{
|
| 4 |
+
|
| 5 |
+
const SDK_VERSION = "1.2.95";
|
| 6 |
+
const SDK_NAME = "sdk-merchant-php ";
|
| 7 |
+
|
| 8 |
+
/**
|
| 9 |
+
*
|
| 10 |
+
* Convert a Name Value Pair (NVP) formatted string into
|
| 11 |
+
* an associative array taking care to urldecode array values
|
| 12 |
+
*
|
| 13 |
+
* @param string $nvpString
|
| 14 |
+
*/
|
| 15 |
+
public static function nvpToMap( $nvpString )
|
| 16 |
+
{
|
| 17 |
+
|
| 18 |
+
$ret = array();
|
| 19 |
+
$params = explode( "&", $nvpString );
|
| 20 |
+
foreach ( $params as $p ) {
|
| 21 |
+
list( $k, $v ) = explode( "=", $p );
|
| 22 |
+
$ret[ $k ] = urldecode( $v );
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
return $ret;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
/**
|
| 29 |
+
* Returns true if the array contains a key like $key
|
| 30 |
+
*
|
| 31 |
+
* @param array $map
|
| 32 |
+
* @param regex $key
|
| 33 |
+
*/
|
| 34 |
+
public static function array_match_key( $map, $key )
|
| 35 |
+
{
|
| 36 |
+
$key = str_replace( "(", "\(", $key );
|
| 37 |
+
$key = str_replace( ")", "\)", $key );
|
| 38 |
+
$key = str_replace( ".", "\.", $key );
|
| 39 |
+
$pattern = "/$key*/";
|
| 40 |
+
foreach ( $map as $k => $v ) {
|
| 41 |
+
preg_match( $pattern, $k, $matches );
|
| 42 |
+
if ( count( $matches ) > 0 )
|
| 43 |
+
return true;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
return false;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
/**
|
| 50 |
+
*
|
| 51 |
+
* Get the local IP address. The client address is a required
|
| 52 |
+
* request parameter for some API calls
|
| 53 |
+
*/
|
| 54 |
+
public static function getLocalIPAddress()
|
| 55 |
+
{
|
| 56 |
+
|
| 57 |
+
if ( array_key_exists( "SERVER_ADDR", $_SERVER ) ) {
|
| 58 |
+
// SERVER_ADDR is available only if we are running the CGI SAPI
|
| 59 |
+
return $_SERVER[ 'SERVER_ADDR' ];
|
| 60 |
+
} else if ( function_exists( "gethostname" ) ) {
|
| 61 |
+
// gethostname is available only in PHP >= v5.3
|
| 62 |
+
return gethostbyname( gethostname() );
|
| 63 |
+
} else {
|
| 64 |
+
// fallback if nothing works
|
| 65 |
+
return "127.0.0.1";
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
*
|
| 71 |
+
* Compute the value that needs to sent for the PAYPAL_REQUEST_SOURCE
|
| 72 |
+
* parameter when making API calls
|
| 73 |
+
*/
|
| 74 |
+
public static function getRequestSource()
|
| 75 |
+
{
|
| 76 |
+
return str_replace( " ", "-", self::SDK_NAME ) . self::SDK_VERSION;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
public static function xmlToArray( $xmlInput )
|
| 80 |
+
{
|
| 81 |
+
|
| 82 |
+
$xml = simplexml_load_string( $xmlInput );
|
| 83 |
+
|
| 84 |
+
$ns = $xml->getNamespaces( true );
|
| 85 |
+
|
| 86 |
+
$soap = $xml->children( $ns[ 'SOAP-ENV' ] );
|
| 87 |
+
$getChild = $soap->Body->children();
|
| 88 |
+
|
| 89 |
+
$ret = PPUtils::convertXmlObjToArr( $getChild, $array = array() );
|
| 90 |
+
|
| 91 |
+
return $ret;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
/*foreach ($ret as $arry)
|
| 95 |
+
{
|
| 96 |
+
if (isset($arry['children']) && is_array($arry['children'])&& ($arry['children'])!=null) {
|
| 97 |
+
foreach ($arry['children'] as $novel)
|
| 98 |
+
{
|
| 99 |
+
|
| 100 |
+
}
|
| 101 |
+
}
|
| 102 |
+
else if ($arry['name'] != null)
|
| 103 |
+
{
|
| 104 |
+
$a = $arry['name'] ;
|
| 105 |
+
$b= $arry['text'];
|
| 106 |
+
if (isset($arry['attribute']))
|
| 107 |
+
{
|
| 108 |
+
$c = $arry['attribute'];
|
| 109 |
+
}
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
|
| 113 |
+
}*/
|
| 114 |
+
|
| 115 |
+
/*public function xml2array ( $xmlObject, $out = array () )
|
| 116 |
+
{
|
| 117 |
+
foreach ( (array) $xmlObject as $index => $node )
|
| 118 |
+
{
|
| 119 |
+
$out[$index] = ( is_object ( $node ) ) ? PPUtils::xml2array ( $node ) : $node;
|
| 120 |
+
}
|
| 121 |
+
return $out;
|
| 122 |
+
}*/
|
| 123 |
+
|
| 124 |
+
|
| 125 |
+
function convertXmlObjToArr( $obj, &$arr )
|
| 126 |
+
{
|
| 127 |
+
$children = $obj->children();
|
| 128 |
+
foreach ( $children as $elementName => $node ) {
|
| 129 |
+
$nextIdx = count( $arr );
|
| 130 |
+
$arr[ $nextIdx ] = array();
|
| 131 |
+
$arr[ $nextIdx ][ 'name' ] = strtolower( (string) $elementName );
|
| 132 |
+
$arr[ $nextIdx ][ 'attributes' ] = array();
|
| 133 |
+
$attributes = $node->attributes();
|
| 134 |
+
foreach ( $attributes as $attributeName => $attributeValue ) {
|
| 135 |
+
$attribName = strtolower( trim( (string) $attributeName ) );
|
| 136 |
+
$attribVal = trim( (string) $attributeValue );
|
| 137 |
+
$arr[ $nextIdx ][ 'attributes' ][ $attribName ] = $attribVal;
|
| 138 |
+
}
|
| 139 |
+
$text = (string) $node;
|
| 140 |
+
$text = trim( $text );
|
| 141 |
+
if ( strlen( $text ) > 0 ) {
|
| 142 |
+
$arr[ $nextIdx ][ 'text' ] = $text;
|
| 143 |
+
}
|
| 144 |
+
$arr[ $nextIdx ][ 'children' ] = array();
|
| 145 |
+
PPutils::convertXmlObjToArr( $node, $arr[ $nextIdx ][ 'children' ] );
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
return $arr;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
/**
|
| 152 |
+
* Escapes invalid xml characters
|
| 153 |
+
*
|
| 154 |
+
* @param $textContent = xml data to be escaped
|
| 155 |
+
*/
|
| 156 |
+
public static function escapeInvalidXmlCharsRegex( $textContent )
|
| 157 |
+
{
|
| 158 |
+
return htmlspecialchars( $textContent, ( 1 | 2 ), 'UTF-8', false );
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
/**
|
| 164 |
+
* @class xml2array
|
| 165 |
+
*/
|
| 166 |
+
|
| 167 |
+
|
| 168 |
+
/**
|
| 169 |
+
* XMLToArray Generator Class
|
| 170 |
+
* @author : MA Razzaque Rupom <rupom_315@yahoo.com>, <rupom.bd@gmail.com>
|
| 171 |
+
* Moderator, phpResource (LINK1http://groups.yahoo.com/group/phpresource/LINK1)
|
| 172 |
+
* URL: LINK2http://www.rupom.infoLINK2
|
| 173 |
+
* @version : 1.0
|
| 174 |
+
* @date 06/05/2006
|
| 175 |
+
* Purpose : Creating Hierarchical Array from XML Data
|
| 176 |
+
* Released : Under GPL
|
| 177 |
+
*/
|
| 178 |
+
|
| 179 |
+
class XmlToArray
|
| 180 |
+
{
|
| 181 |
+
|
| 182 |
+
var $xml = '';
|
| 183 |
+
|
| 184 |
+
/**
|
| 185 |
+
* Default Constructor
|
| 186 |
+
*
|
| 187 |
+
* @param $xml = xml data
|
| 188 |
+
*
|
| 189 |
+
* @return none
|
| 190 |
+
*/
|
| 191 |
+
|
| 192 |
+
function XmlToArray( $xml )
|
| 193 |
+
{
|
| 194 |
+
$this->xml = $xml;
|
| 195 |
+
}
|
| 196 |
+
|
| 197 |
+
/**
|
| 198 |
+
* _struct_to_array($values, &$i)
|
| 199 |
+
*
|
| 200 |
+
* This is adds the contents of the return xml into the array for easier processing.
|
| 201 |
+
* Recursive, Static
|
| 202 |
+
*
|
| 203 |
+
* @access private
|
| 204 |
+
*
|
| 205 |
+
* @param array $values this is the xml data in an array
|
| 206 |
+
* @param int $i this is the current location in the array
|
| 207 |
+
*
|
| 208 |
+
* @return Array
|
| 209 |
+
*/
|
| 210 |
+
|
| 211 |
+
function _struct_to_array( $values, &$i )
|
| 212 |
+
{
|
| 213 |
+
$child = array();
|
| 214 |
+
if ( isset( $values[ $i ][ 'value' ] ) ) array_push( $child, $values[ $i ][ 'value' ] );
|
| 215 |
+
|
| 216 |
+
while ( $i++ < count( $values ) ) {
|
| 217 |
+
switch ( $values[ $i ][ 'type' ] ) {
|
| 218 |
+
case 'cdata':
|
| 219 |
+
array_push( $child, $values[ $i ][ 'value' ] );
|
| 220 |
+
break;
|
| 221 |
+
|
| 222 |
+
case 'complete':
|
| 223 |
+
$name = $values[ $i ][ 'tag' ];
|
| 224 |
+
if ( !empty( $name ) ) {
|
| 225 |
+
$child[ $name ] = ( $values[ $i ][ 'value' ] ) ? ( $values[ $i ][ 'value' ] ) : '';
|
| 226 |
+
if ( isset( $values[ $i ][ 'attributes' ] ) ) {
|
| 227 |
+
$child[ $name ] = $values[ $i ][ 'attributes' ];
|
| 228 |
+
}
|
| 229 |
+
}
|
| 230 |
+
break;
|
| 231 |
+
|
| 232 |
+
case 'open':
|
| 233 |
+
$name = $values[ $i ][ 'tag' ];
|
| 234 |
+
$size = isset( $child[ $name ] ) ? sizeof( $child[ $name ] ) : 0;
|
| 235 |
+
$child[ $name ][ $size ] = $this->_struct_to_array( $values, $i );
|
| 236 |
+
break;
|
| 237 |
+
|
| 238 |
+
case 'close':
|
| 239 |
+
return $child;
|
| 240 |
+
break;
|
| 241 |
+
}
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
return $child;
|
| 245 |
+
}
|
| 246 |
+
|
| 247 |
+
//_struct_to_array
|
| 248 |
+
|
| 249 |
+
/**
|
| 250 |
+
* createArray($data)
|
| 251 |
+
*
|
| 252 |
+
* This is adds the contents of the return xml into the array for easier processing.
|
| 253 |
+
*
|
| 254 |
+
* @access public
|
| 255 |
+
*
|
| 256 |
+
* @param string $data this is the string of the xml data
|
| 257 |
+
*
|
| 258 |
+
* @return Array
|
| 259 |
+
*/
|
| 260 |
+
function createArray()
|
| 261 |
+
{
|
| 262 |
+
$xml = $this->xml;
|
| 263 |
+
$values = array();
|
| 264 |
+
$index = array();
|
| 265 |
+
$array = array();
|
| 266 |
+
$parser = xml_parser_create();
|
| 267 |
+
xml_parser_set_option( $parser, XML_OPTION_SKIP_WHITE, 1 );
|
| 268 |
+
xml_parser_set_option( $parser, XML_OPTION_CASE_FOLDING, 0 );
|
| 269 |
+
xml_parse_into_struct( $parser, $xml, $values, $index );
|
| 270 |
+
xml_parser_free( $parser );
|
| 271 |
+
$i = 0;
|
| 272 |
+
$name = $values[ $i ][ 'tag' ];
|
| 273 |
+
$array[ $name ] = isset( $values[ $i ][ 'attributes' ] ) ? $values[ $i ][ 'attributes' ] : '';
|
| 274 |
+
$array[ $name ] = $this->_struct_to_array( $values, $i );
|
| 275 |
+
|
| 276 |
+
return $array;
|
| 277 |
+
}
|
| 278 |
+
//createArray
|
| 279 |
+
|
| 280 |
+
|
| 281 |
+
}
|
| 282 |
+
|
| 283 |
+
//XmlToArray
|
| 284 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/auth/AuthUtil.php
ADDED
|
@@ -0,0 +1,83 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php //vim: foldmethod=marker
|
| 2 |
+
|
| 3 |
+
class MockOAuthDataStore extends OAuthDataStore
|
| 4 |
+
{ /*{{{*/
|
| 5 |
+
private $consumer;
|
| 6 |
+
private $request_token;
|
| 7 |
+
private $access_token;
|
| 8 |
+
private $nonce;
|
| 9 |
+
|
| 10 |
+
function __construct()
|
| 11 |
+
{ /*{{{*/
|
| 12 |
+
$this->consumer = new OAuthConsumer( "key", "secret", null );
|
| 13 |
+
$this->request_token = new OAuthToken( "requestkey", "requestsecret", 1 );
|
| 14 |
+
$this->access_token = new OAuthToken( "accesskey", "accesssecret", 1 );
|
| 15 |
+
$this->nonce = "nonce";
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
/*}}}*/
|
| 19 |
+
|
| 20 |
+
function lookup_consumer( $consumer_key )
|
| 21 |
+
{ /*{{{*/
|
| 22 |
+
if ( $consumer_key == $this->consumer->key ) return $this->consumer;
|
| 23 |
+
|
| 24 |
+
return null;
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
/*}}}*/
|
| 28 |
+
|
| 29 |
+
function lookup_token( $consumer, $token_type, $token )
|
| 30 |
+
{ /*{{{*/
|
| 31 |
+
$token_attrib = $token_type . "_token";
|
| 32 |
+
if ( $consumer->key == $this->consumer->key
|
| 33 |
+
&& $token == $this->$token_attrib->key
|
| 34 |
+
) {
|
| 35 |
+
return $this->$token_attrib;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
return null;
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
/*}}}*/
|
| 42 |
+
|
| 43 |
+
function lookup_nonce( $consumer, $token, $nonce, $timestamp )
|
| 44 |
+
{ /*{{{*/
|
| 45 |
+
if ( $consumer->key == $this->consumer->key
|
| 46 |
+
&& ( ( $token && $token->key == $this->request_token->key )
|
| 47 |
+
|| ( $token && $token->key == $this->access_token->key ) )
|
| 48 |
+
&& $nonce == $this->nonce
|
| 49 |
+
) {
|
| 50 |
+
return $this->nonce;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
return null;
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
/*}}}*/
|
| 57 |
+
|
| 58 |
+
function new_request_token( $consumer, $callback = null )
|
| 59 |
+
{ /*{{{*/
|
| 60 |
+
if ( $consumer->key == $this->consumer->key ) {
|
| 61 |
+
return $this->request_token;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
return null;
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
/*}}}*/
|
| 68 |
+
|
| 69 |
+
function new_access_token( $token, $consumer, $verifier = null )
|
| 70 |
+
{ /*{{{*/
|
| 71 |
+
if ( $consumer->key == $this->consumer->key
|
| 72 |
+
&& $token->key == $this->request_token->key
|
| 73 |
+
) {
|
| 74 |
+
return $this->access_token;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
return null;
|
| 78 |
+
}
|
| 79 |
+
/*}}}*/
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
/*}}}*/
|
| 83 |
+
?>
|
trunk/classes/gateways/PayPal_Masspay/api/lib/auth/PPAuth.php
ADDED
|
@@ -0,0 +1,1057 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
//PayPal specific modification starts
|
| 3 |
+
//Method to be called for generating signature
|
| 4 |
+
require_once( "AuthUtil.php" );
|
| 5 |
+
class AuthSignature
|
| 6 |
+
{
|
| 7 |
+
|
| 8 |
+
public function genSign( $key, $secret, $token, $tokenSecret, $httpMethod, $endpoint )
|
| 9 |
+
{
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
$authServer = new OAuthServer( new MockOAuthDataStore() );
|
| 13 |
+
$hmac_method = new OAuthSignatureMethod_HMAC_SHA1();
|
| 14 |
+
$authServer->add_signature_method( $hmac_method );
|
| 15 |
+
|
| 16 |
+
$sig_method = $hmac_method;
|
| 17 |
+
$authConsumer = new OAuthConsumer( $key, $secret, null );
|
| 18 |
+
$authToken = null;
|
| 19 |
+
$authToken = new OAuthToken( $token, $tokenSecret );
|
| 20 |
+
|
| 21 |
+
//$params is the query param array which is required only in the httpMethod is "GET"
|
| 22 |
+
|
| 23 |
+
$params = array();
|
| 24 |
+
//set the Query parameters to $params if httpMethod is "GET"
|
| 25 |
+
|
| 26 |
+
$acc_req = OAuthRequest::from_consumer_and_token( $authConsumer, $authToken, $httpMethod, $endpoint, $params );
|
| 27 |
+
|
| 28 |
+
$acc_req->sign_request( $sig_method, $authConsumer, $authToken );
|
| 29 |
+
$response = OAuthutil::parseQueryString( $acc_req );
|
| 30 |
+
|
| 31 |
+
return $response;
|
| 32 |
+
|
| 33 |
+
}
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
//PayPal specific modification ends
|
| 37 |
+
/* Generic exception class
|
| 38 |
+
*/
|
| 39 |
+
class OAuthException extends Exception
|
| 40 |
+
{
|
| 41 |
+
// pass
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
class OAuthConsumer
|
| 45 |
+
{
|
| 46 |
+
public $key;
|
| 47 |
+
public $secret;
|
| 48 |
+
|
| 49 |
+
function __construct( $key, $secret, $callback_url = null )
|
| 50 |
+
{
|
| 51 |
+
$this->key = $key;
|
| 52 |
+
$this->secret = $secret;
|
| 53 |
+
$this->callback_url = $callback_url;
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
function __toString()
|
| 57 |
+
{
|
| 58 |
+
return "OAuthConsumer[key=$this->key,secret=$this->secret]";
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
class OAuthToken
|
| 63 |
+
{
|
| 64 |
+
// access tokens and request tokens
|
| 65 |
+
public $key;
|
| 66 |
+
public $secret;
|
| 67 |
+
|
| 68 |
+
/**
|
| 69 |
+
* key = the token
|
| 70 |
+
* secret = the token secret
|
| 71 |
+
*/
|
| 72 |
+
function __construct( $key, $secret )
|
| 73 |
+
{
|
| 74 |
+
$this->key = $key;
|
| 75 |
+
$this->secret = $secret;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
/**
|
| 79 |
+
* generates the basic string serialization of a token that a server
|
| 80 |
+
* would respond to request_token and access_token calls with
|
| 81 |
+
*/
|
| 82 |
+
function to_string()
|
| 83 |
+
{
|
| 84 |
+
return "oauth_token=" .
|
| 85 |
+
OAuthUtil::urlencode_rfc3986( $this->key ) .
|
| 86 |
+
"&oauth_token_secret=" .
|
| 87 |
+
OAuthUtil::urlencode_rfc3986( $this->secret );
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
function __toString()
|
| 91 |
+
{
|
| 92 |
+
return $this->to_string();
|
| 93 |
+
}
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
/**
|
| 97 |
+
* A class for implementing a Signature Method
|
| 98 |
+
* See section 9 ("Signing Requests") in the spec
|
| 99 |
+
*/
|
| 100 |
+
abstract class OAuthSignatureMethod
|
| 101 |
+
{
|
| 102 |
+
/**
|
| 103 |
+
* Needs to return the name of the Signature Method (ie HMAC-SHA1)
|
| 104 |
+
* @return string
|
| 105 |
+
*/
|
| 106 |
+
abstract public function get_name();
|
| 107 |
+
|
| 108 |
+
/**
|
| 109 |
+
* Build up the signature
|
| 110 |
+
* NOTE: The output of this function MUST NOT be urlencoded.
|
| 111 |
+
* the encoding is handled in OAuthRequest when the final
|
| 112 |
+
* request is serialized
|
| 113 |
+
*
|
| 114 |
+
* @param OAuthRequest $request
|
| 115 |
+
* @param OAuthConsumer $consumer
|
| 116 |
+
* @param OAuthToken $token
|
| 117 |
+
*
|
| 118 |
+
* @return string
|
| 119 |
+
*/
|
| 120 |
+
abstract public function build_signature( $request, $consumer, $token );
|
| 121 |
+
|
| 122 |
+
/**
|
| 123 |
+
* Verifies that a given signature is correct
|
| 124 |
+
*
|
| 125 |
+
* @param OAuthRequest $request
|
| 126 |
+
* @param OAuthConsumer $consumer
|
| 127 |
+
* @param OAuthToken $token
|
| 128 |
+
* @param string $signature
|
| 129 |
+
*
|
| 130 |
+
* @return bool
|
| 131 |
+
*/
|
| 132 |
+
public function check_signature( $request, $consumer, $token, $signature )
|
| 133 |
+
{
|
| 134 |
+
$built = $this->build_signature( $request, $consumer, $token );
|
| 135 |
+
|
| 136 |
+
return $built == $signature;
|
| 137 |
+
}
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
/**
|
| 141 |
+
* The HMAC-SHA1 signature method uses the HMAC-SHA1 signature algorithm as defined in [RFC2104]
|
| 142 |
+
* where the Signature Base String is the text and the key is the concatenated values (each first
|
| 143 |
+
* encoded per Parameter Encoding) of the Consumer Secret and Token Secret, separated by an '&'
|
| 144 |
+
* character (ASCII code 38) even if empty.
|
| 145 |
+
* - Chapter 9.2 ("HMAC-SHA1")
|
| 146 |
+
*/
|
| 147 |
+
class OAuthSignatureMethod_HMAC_SHA1 extends OAuthSignatureMethod
|
| 148 |
+
{
|
| 149 |
+
function get_name()
|
| 150 |
+
{
|
| 151 |
+
return "HMAC-SHA1";
|
| 152 |
+
}
|
| 153 |
+
|
| 154 |
+
public function build_signature( $request, $consumer, $token )
|
| 155 |
+
{
|
| 156 |
+
$base_string = $request->get_signature_base_string();
|
| 157 |
+
$base_string = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $base_string ); //convert base string to lowercase
|
| 158 |
+
$request->base_string = $base_string;
|
| 159 |
+
|
| 160 |
+
$key_parts = array(
|
| 161 |
+
$consumer->secret,
|
| 162 |
+
( $token ) ? $token->secret : ""
|
| 163 |
+
);
|
| 164 |
+
|
| 165 |
+
$key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
|
| 166 |
+
$key = implode( '&', $key_parts );
|
| 167 |
+
$key = preg_replace( "/(%[A-Za-z0-9]{2})/e", "strtolower('\\0')", $key ); //convert to lowercase
|
| 168 |
+
return base64_encode( hash_hmac( 'sha1', $base_string, $key, true ) );
|
| 169 |
+
}
|
| 170 |
+
}
|
| 171 |
+
|
| 172 |
+
/**
|
| 173 |
+
* The PLAINTEXT method does not provide any security protection and SHOULD only be used
|
| 174 |
+
* over a secure channel such as HTTPS. It does not use the Signature Base String.
|
| 175 |
+
* - Chapter 9.4 ("PLAINTEXT")
|
| 176 |
+
*/
|
| 177 |
+
if ( !class_exists( 'OAuthSignatureMethod_PLAINTEXT' ) ) {
|
| 178 |
+
class OAuthSignatureMethod_PLAINTEXT extends OAuthSignatureMethod
|
| 179 |
+
{
|
| 180 |
+
public function get_name()
|
| 181 |
+
{
|
| 182 |
+
return "PLAINTEXT";
|
| 183 |
+
}
|
| 184 |
+
|
| 185 |
+
/**
|
| 186 |
+
* oauth_signature is set to the concatenated encoded values of the Consumer Secret and
|
| 187 |
+
* Token Secret, separated by a '&' character (ASCII code 38), even if either secret is
|
| 188 |
+
* empty. The result MUST be encoded again.
|
| 189 |
+
* - Chapter 9.4.1 ("Generating Signatures")
|
| 190 |
+
*
|
| 191 |
+
* Please note that the second encoding MUST NOT happen in the SignatureMethod, as
|
| 192 |
+
* OAuthRequest handles this!
|
| 193 |
+
*/
|
| 194 |
+
public function build_signature( $request, $consumer, $token )
|
| 195 |
+
{
|
| 196 |
+
$key_parts = array(
|
| 197 |
+
$consumer->secret,
|
| 198 |
+
( $token ) ? $token->secret : ""
|
| 199 |
+
);
|
| 200 |
+
|
| 201 |
+
$key_parts = OAuthUtil::urlencode_rfc3986( $key_parts );
|
| 202 |
+
$key = implode( '&', $key_parts );
|
| 203 |
+
$request->base_string = $key;
|
| 204 |
+
|
| 205 |
+
return $key;
|
| 206 |
+
}
|
| 207 |
+
}
|
| 208 |
+
}
|
| 209 |
+
/**
|
| 210 |
+
* The RSA-SHA1 signature method uses the RSASSA-PKCS1-v1_5 signature algorithm as defined in
|
| 211 |
+
* [RFC3447] section 8.2 (more simply known as PKCS#1), using SHA-1 as the hash function for
|
| 212 |
+
* EMSA-PKCS1-v1_5. It is assumed that the Consumer has provided its RSA public key in a
|
| 213 |
+
* verified way to the Service Provider, in a manner which is beyond the scope of this
|
| 214 |
+
* specification.
|
| 215 |
+
* - Chapter 9.3 ("RSA-SHA1")
|
| 216 |
+
*/
|
| 217 |
+
abstract class OAuthSignatureMethod_RSA_SHA1 extends OAuthSignatureMethod
|
| 218 |
+
{
|
| 219 |
+
public function get_name()
|
| 220 |
+
{
|
| 221 |
+
return "RSA-SHA1";
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 225 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 226 |
+
// (2) fetch via http using a url provided by the requester
|
| 227 |
+
// (3) some sort of specific discovery code based on request
|
| 228 |
+
//
|
| 229 |
+
// Either way should return a string representation of the certificate
|
| 230 |
+
protected abstract function fetch_public_cert( &$request );
|
| 231 |
+
|
| 232 |
+
// Up to the SP to implement this lookup of keys. Possible ideas are:
|
| 233 |
+
// (1) do a lookup in a table of trusted certs keyed off of consumer
|
| 234 |
+
//
|
| 235 |
+
// Either way should return a string representation of the certificate
|
| 236 |
+
protected abstract function fetch_private_cert( &$request );
|
| 237 |
+
|
| 238 |
+
public function build_signature( $request, $consumer, $token )
|
| 239 |
+
{
|
| 240 |
+
$base_string = $request->get_signature_base_string();
|
| 241 |
+
$request->base_string = $base_string;
|
| 242 |
+
|
| 243 |
+
// Fetch the private key cert based on the request
|
| 244 |
+
$cert = $this->fetch_private_cert( $request );
|
| 245 |
+
|
| 246 |
+
// Pull the private key ID from the certificate
|
| 247 |
+
$privatekeyid = openssl_get_privatekey( $cert );
|
| 248 |
+
|
| 249 |
+
// Sign using the key
|
| 250 |
+
$ok = openssl_sign( $base_string, $signature, $privatekeyid );
|
| 251 |
+
|
| 252 |
+
// Release the key resource
|
| 253 |
+
openssl_free_key( $privatekeyid );
|
| 254 |
+
|
| 255 |
+
return base64_encode( $signature );
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
public function check_signature( $request, $consumer, $token, $signature )
|
| 259 |
+
{
|
| 260 |
+
$decoded_sig = base64_decode( $signature );
|
| 261 |
+
|
| 262 |
+
$base_string = $request->get_signature_base_string();
|
| 263 |
+
|
| 264 |
+
// Fetch the public key cert based on the request
|
| 265 |
+
$cert = $this->fetch_public_cert( $request );
|
| 266 |
+
|
| 267 |
+
// Pull the public key ID from the certificate
|
| 268 |
+
$publickeyid = openssl_get_publickey( $cert );
|
| 269 |
+
|
| 270 |
+
// Check the computed signature against the one passed in the query
|
| 271 |
+
$ok = openssl_verify( $base_string, $decoded_sig, $publickeyid );
|
| 272 |
+
|
| 273 |
+
// Release the key resource
|
| 274 |
+
openssl_free_key( $publickeyid );
|
| 275 |
+
|
| 276 |
+
return $ok == 1;
|
| 277 |
+
}
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
class OAuthRequest
|
| 281 |
+
{
|
| 282 |
+
public $parameters;
|
| 283 |
+
protected $http_method;
|
| 284 |
+
protected $http_url;
|
| 285 |
+
// for debug purposes
|
| 286 |
+
public $base_string;
|
| 287 |
+
public static $version = '1.0';
|
| 288 |
+
public static $POST_INPUT = 'php://input';
|
| 289 |
+
|
| 290 |
+
function __construct( $http_method, $http_url, $parameters = null )
|
| 291 |
+
{
|
| 292 |
+
$parameters = ( $parameters ) ? $parameters : array();
|
| 293 |
+
$parameters = array_merge( OAuthUtil::parse_parameters( parse_url( $http_url, PHP_URL_QUERY ) ), $parameters );
|
| 294 |
+
$this->parameters = $parameters;
|
| 295 |
+
$this->http_method = $http_method;
|
| 296 |
+
$this->http_url = $http_url;
|
| 297 |
+
}
|
| 298 |
+
|
| 299 |
+
|
| 300 |
+
/**
|
| 301 |
+
* attempt to build up a request from what was passed to the server
|
| 302 |
+
*/
|
| 303 |
+
public static function from_request( $http_method = null, $http_url = null, $parameters = null )
|
| 304 |
+
{
|
| 305 |
+
$scheme = ( !isset( $_SERVER[ 'HTTPS' ] ) || $_SERVER[ 'HTTPS' ] != "on" )
|
| 306 |
+
? 'http'
|
| 307 |
+
: 'https';
|
| 308 |
+
$http_url = ( $http_url ) ? $http_url : $scheme .
|
| 309 |
+
'://' . $_SERVER[ 'HTTP_HOST' ] .
|
| 310 |
+
':' .
|
| 311 |
+
$_SERVER[ 'SERVER_PORT' ] .
|
| 312 |
+
$_SERVER[ 'REQUEST_URI' ];
|
| 313 |
+
$http_method = ( $http_method ) ? $http_method : $_SERVER[ 'REQUEST_METHOD' ];
|
| 314 |
+
|
| 315 |
+
// We weren't handed any parameters, so let's find the ones relevant to
|
| 316 |
+
// this request.
|
| 317 |
+
// If you run XML-RPC or similar you should use this to provide your own
|
| 318 |
+
// parsed parameter-list
|
| 319 |
+
if ( !$parameters ) {
|
| 320 |
+
// Find request headers
|
| 321 |
+
$request_headers = OAuthUtil::get_headers();
|
| 322 |
+
|
| 323 |
+
// Parse the query-string to find GET parameters
|
| 324 |
+
$parameters = OAuthUtil::parse_parameters( $_SERVER[ 'QUERY_STRING' ] );
|
| 325 |
+
|
| 326 |
+
// It's a POST request of the proper content-type, so parse POST
|
| 327 |
+
// parameters and add those overriding any duplicates from GET
|
| 328 |
+
if ( $http_method == "POST"
|
| 329 |
+
&& isset( $request_headers[ 'Content-Type' ] )
|
| 330 |
+
&& strstr( $request_headers[ 'Content-Type' ],
|
| 331 |
+
'application/x-www-form-urlencoded' )
|
| 332 |
+
) {
|
| 333 |
+
$post_data = OAuthUtil::parse_parameters(
|
| 334 |
+
file_get_contents( self::$POST_INPUT )
|
| 335 |
+
);
|
| 336 |
+
$parameters = array_merge( $parameters, $post_data );
|
| 337 |
+
}
|
| 338 |
+
|
| 339 |
+
// We have a Authorization-header with OAuth data. Parse the header
|
| 340 |
+
// and add those overriding any duplicates from GET or POST
|
| 341 |
+
if ( isset( $request_headers[ 'Authorization' ] ) && substr( $request_headers[ 'Authorization' ], 0, 6 ) == 'OAuth ' ) {
|
| 342 |
+
$header_parameters = OAuthUtil::split_header(
|
| 343 |
+
$request_headers[ 'Authorization' ]
|
| 344 |
+
);
|
| 345 |
+
$parameters = array_merge( $parameters, $header_parameters );
|
| 346 |
+
}
|
| 347 |
+
|
| 348 |
+
}
|
| 349 |
+
|
| 350 |
+
return new OAuthRequest( $http_method, $http_url, $parameters );
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
+
/**
|
| 354 |
+
* pretty much a helper function to set up the request
|
| 355 |
+
*/
|
| 356 |
+
public static function from_consumer_and_token( $consumer, $token, $http_method, $http_url, $parameters = null )
|
| 357 |
+
{
|
| 358 |
+
$parameters = ( $parameters ) ? $parameters : array();
|
| 359 |
+
$defaults = array(
|
| 360 |
+
"oauth_version" => OAuthRequest::$version,
|
| 361 |
+
// "oauth_nonce" => OAuthRequest::generate_nonce(),
|
| 362 |
+
"oauth_timestamp" => OAuthRequest::generate_timestamp(),
|
| 363 |
+
|
| 364 |
+
"oauth_consumer_key" => $consumer->key
|
| 365 |
+
);
|
| 366 |
+
if ( $token )
|
| 367 |
+
$defaults[ 'oauth_token' ] = $token->key;
|
| 368 |
+
|
| 369 |
+
$parameters = array_merge( $defaults, $parameters );
|
| 370 |
+
ksort( $parameters );
|
| 371 |
+
|
| 372 |
+
return new OAuthRequest( $http_method, $http_url, $parameters );
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
public function set_parameter( $name, $value, $allow_duplicates = true )
|
| 376 |
+
{
|
| 377 |
+
if ( $allow_duplicates && isset( $this->parameters[ $name ] ) ) {
|
| 378 |
+
// We have already added parameter(s) with this name, so add to the list
|
| 379 |
+
if ( is_scalar( $this->parameters[ $name ] ) ) {
|
| 380 |
+
// This is the first duplicate, so transform scalar (string)
|
| 381 |
+
// into an array so we can add the duplicates
|
| 382 |
+
$this->parameters[ $name ] = array( $this->parameters[ $name ] );
|
| 383 |
+
}
|
| 384 |
+
|
| 385 |
+
$this->parameters[ $name ][ ] = $value;
|
| 386 |
+
} else {
|
| 387 |
+
$this->parameters[ $name ] = $value;
|
| 388 |
+
}
|
| 389 |
+
}
|
| 390 |
+
|
| 391 |
+
public function get_parameter( $name )
|
| 392 |
+
{
|
| 393 |
+
return isset( $this->parameters[ $name ] ) ? $this->parameters[ $name ] : null;
|
| 394 |
+
}
|
| 395 |
+
|
| 396 |
+
public function get_parameters()
|
| 397 |
+
{
|
| 398 |
+
return $this->parameters;
|
| 399 |
+
}
|
| 400 |
+
|
| 401 |
+
public function unset_parameter( $name )
|
| 402 |
+
{
|
| 403 |
+
unset( $this->parameters[ $name ] );
|
| 404 |
+
}
|
| 405 |
+
|
| 406 |
+
/**
|
| 407 |
+
* The request parameters, sorted and concatenated into a normalized string.
|
| 408 |
+
* @return string
|
| 409 |
+
*/
|
| 410 |
+
public function get_signable_parameters()
|
| 411 |
+
{
|
| 412 |
+
// Grab all parameters
|
| 413 |
+
$params = $this->parameters;
|
| 414 |
+
ksort( $params );
|
| 415 |
+
// Remove oauth_signature if present
|
| 416 |
+
// Ref: Spec: 9.1.1 ("The oauth_signature parameter MUST be excluded.")
|
| 417 |
+
if ( isset( $params[ 'oauth_signature' ] ) ) {
|
| 418 |
+
unset( $params[ 'oauth_signature' ] );
|
| 419 |
+
}
|
| 420 |
+
foreach ( $params as $key => $value ) {
|
| 421 |
+
$res[ ] = $key . "=" . $value;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
return implode( '&', $res );
|
| 425 |
+
//return OAuthUtil::build_http_query($params);
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
/**
|
| 429 |
+
* Returns the base string of this request
|
| 430 |
+
*
|
| 431 |
+
* The base string defined as the method, the url
|
| 432 |
+
* and the parameters (normalized), each urlencoded
|
| 433 |
+
* and the concated with &.
|
| 434 |
+
*/
|
| 435 |
+
public function get_signature_base_string()
|
| 436 |
+
{
|
| 437 |
+
$parts = array(
|
| 438 |
+
$this->get_normalized_http_method(),
|
| 439 |
+
$this->get_normalized_http_url(),
|
| 440 |
+
$this->get_signable_parameters()
|
| 441 |
+
);
|
| 442 |
+
|
| 443 |
+
$parts = OAuthUtil::urlencode_rfc3986( $parts );
|
| 444 |
+
|
| 445 |
+
return implode( '&', $parts );
|
| 446 |
+
}
|
| 447 |
+
|
| 448 |
+
/**
|
| 449 |
+
* just uppercases the http method
|
| 450 |
+
*/
|
| 451 |
+
public function get_normalized_http_method()
|
| 452 |
+
{
|
| 453 |
+
return strtoupper( $this->http_method );
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
/**
|
| 457 |
+
* parses the url and rebuilds it to be
|
| 458 |
+
* scheme://host/path
|
| 459 |
+
*/
|
| 460 |
+
public function get_normalized_http_url()
|
| 461 |
+
{
|
| 462 |
+
$parts = parse_url( $this->http_url );
|
| 463 |
+
|
| 464 |
+
$scheme = ( isset( $parts[ 'scheme' ] ) ) ? $parts[ 'scheme' ] : 'http';
|
| 465 |
+
$port = ( isset( $parts[ 'port' ] ) ) ? $parts[ 'port' ] : ( ( $scheme == 'https' ) ? '443' : '80' );
|
| 466 |
+
$host = ( isset( $parts[ 'host' ] ) ) ? $parts[ 'host' ] : '';
|
| 467 |
+
$path = ( isset( $parts[ 'path' ] ) ) ? $parts[ 'path' ] : '';
|
| 468 |
+
|
| 469 |
+
if ( ( $scheme == 'https' && $port != '443' )
|
| 470 |
+
|| ( $scheme == 'http' && $port != '80' )
|
| 471 |
+
) {
|
| 472 |
+
$host = "$host:$port";
|
| 473 |
+
}
|
| 474 |
+
|
| 475 |
+
return "$scheme://$host$path";
|
| 476 |
+
}
|
| 477 |
+
|
| 478 |
+
/**
|
| 479 |
+
* builds a url usable for a GET request
|
| 480 |
+
*/
|
| 481 |
+
public function to_url()
|
| 482 |
+
{
|
| 483 |
+
$post_data = $this->to_postdata();
|
| 484 |
+
$out = $this->get_normalized_http_url();
|
| 485 |
+
if ( $post_data ) {
|
| 486 |
+
$out .= '?' . $post_data;
|
| 487 |
+
}
|
| 488 |
+
|
| 489 |
+
return $out;
|
| 490 |
+
}
|
| 491 |
+
|
| 492 |
+
/**
|
| 493 |
+
* builds the data one would send in a POST request
|
| 494 |
+
*/
|
| 495 |
+
public function to_postdata()
|
| 496 |
+
{
|
| 497 |
+
return OAuthUtil::build_http_query( $this->parameters );
|
| 498 |
+
}
|
| 499 |
+
|
| 500 |
+
/**
|
| 501 |
+
* builds the Authorization: header
|
| 502 |
+
*/
|
| 503 |
+
public function to_header( $realm = null )
|
| 504 |
+
{
|
| 505 |
+
$first = true;
|
| 506 |
+
if ( $realm ) {
|
| 507 |
+
$out = 'Authorization: OAuth realm="' . OAuthUtil::urlencode_rfc3986( $realm ) . '"';
|
| 508 |
+
$first = false;
|
| 509 |
+
} else
|
| 510 |
+
$out = 'Authorization: OAuth';
|
| 511 |
+
|
| 512 |
+
$total = array();
|
| 513 |
+
foreach ( $this->parameters as $k => $v ) {
|
| 514 |
+
if ( substr( $k, 0, 5 ) != "oauth" ) continue;
|
| 515 |
+
if ( is_array( $v ) ) {
|
| 516 |
+
throw new OAuthException( 'Arrays not supported in headers' );
|
| 517 |
+
}
|
| 518 |
+
$out .= ( $first ) ? ' ' : ',';
|
| 519 |
+
$out .= OAuthUtil::urlencode_rfc3986( $k ) .
|
| 520 |
+
'="' .
|
| 521 |
+
OAuthUtil::urlencode_rfc3986( $v ) .
|
| 522 |
+
'"';
|
| 523 |
+
$first = false;
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
return $out;
|
| 527 |
+
}
|
| 528 |
+
|
| 529 |
+
public function __toString()
|
| 530 |
+
{
|
| 531 |
+
return $this->to_url();
|
| 532 |
+
}
|
| 533 |
+
|
| 534 |
+
|
| 535 |
+
public function sign_request( $signature_method, $consumer, $token )
|
| 536 |
+
{
|
| 537 |
+
|
| 538 |
+
$empty = false;
|
| 539 |
+
$msg = array();
|
| 540 |
+
if ( $token->key == null ) {
|
| 541 |
+
$msg[ ] = 'Token key';
|
| 542 |
+
}
|
| 543 |
+
if ( $token->secret == null ) {
|
| 544 |
+
$msg[ ] = 'Token secret';
|
| 545 |
+
}
|
| 546 |
+
if ( $consumer->key == null ) {
|
| 547 |
+
|
| 548 |
+
$msg[ ] = 'Consumer key';
|
| 549 |
+
}
|
| 550 |
+
if ( $consumer->secret == null ) {
|
| 551 |
+
|
| 552 |
+
$msg[ ] = 'Consumer secret';
|
| 553 |
+
}
|
| 554 |
+
if ( $this->http_url == null ) {
|
| 555 |
+
|
| 556 |
+
$msg[ ] = 'Endpoint';
|
| 557 |
+
}
|
| 558 |
+
if ( $this->http_method == null ) {
|
| 559 |
+
|
| 560 |
+
$msg[ ] = 'HTTP method';
|
| 561 |
+
}
|
| 562 |
+
if ( count( $msg ) ) {
|
| 563 |
+
throw new OAuthException( 'Enter valid ' . implode( ',', $msg ) );
|
| 564 |
+
}
|
| 565 |
+
$this->set_parameter(
|
| 566 |
+
"oauth_signature_method",
|
| 567 |
+
$signature_method->get_name(),
|
| 568 |
+
false );
|
| 569 |
+
|
| 570 |
+
$signature = $this->build_signature( $signature_method, $consumer, $token );
|
| 571 |
+
$this->set_parameter( "oauth_signature", $signature, false );
|
| 572 |
+
|
| 573 |
+
}
|
| 574 |
+
|
| 575 |
+
public function build_signature( $signature_method, $consumer, $token )
|
| 576 |
+
{
|
| 577 |
+
$signature = $signature_method->build_signature( $this, $consumer, $token );
|
| 578 |
+
|
| 579 |
+
return $signature;
|
| 580 |
+
}
|
